Datasets:

parameterlab
/

scaling_mia_the_pile_00_DM_Mathematics

Dataset card Data Studio Files Files and versions Community

Split (3)

train · 63.5k rows

text stringlengths 518 8.19k	meta dict
minutes are there in one fifth of a day? 288 What is 7/2 of a century in months? 4200 How many kilograms are there in twenty-nine fifths of a tonne? 5800 How many milliseconds are there in 1/4 of a second? 250 What is 21/2 of a litre in millilitres? 10500 Convert 46013.37 grams to kilograms. 46.01337 What is 27/5 of a gram in milligrams? 5400 How many months are there in 1/6 of a year? 2 What is 1/18 of a hour in seconds? 200 What is 25/2 of a tonne in kilograms? 12500 What is 35413.47kg in milligrams? 35413470000 What is twenty-one eighths of a litre in millilitres? 2625 How many micrometers are there in 82.60579 nanometers? 0.08260579 How many milligrams are there in 445.0046 nanograms? 0.0004450046 What is 485.7473um in kilometers? 0.0000004857473 What is 97.4247 months in years? 8.118725 What is 9/10 of a century in years? 90 What is 19/4 of a micrometer in nanometers? 4750 How many milligrams are there in 6071.698kg? 6071698000 Convert 0.382545 micrograms to nanograms. 382.545 How many litres are there in 99130.54 millilitres? 99.13054 What is five quarters of a centimeter in micrometers? 12500 What is 5.729576 milligrams in micrograms? 5729.576 Convert 96.14157s to milliseconds. 96141.57 How many millilitres are there in 5/4 of a litre? 1250 What is five quarters of a milligram in micrograms? 1250 How many micrometers are there in eleven quarters of a centimeter? 27500 Convert 7.313145 meters to kilometers. 0.007313145 What is one tenth of a tonne in kilograms? 100 What is sixty-four fifths of a century in decades? 128 What is five quarters of a microsecond in nanoseconds? 1250 How many millimeters are there in 3/8 of a meter? 375 What is one fifth of a meter in millimeters? 200 How many months are there in twenty-eight thirds of a year? 112 What is 242.14 millennia in years? 242140 How many tonnes are there in 1417.824mg? 0.000001417824 What is fourteeen ninths of a week in minutes? 15680 How many litres are there in 235.4294ml? 0.2354294 Convert 0.577539cm to millimeters. 5.77539 What is 1/4 of a micrometer in nanometers? 250 What is 939624.2 decades in months? 112754904 How many days are there in 10/7 of a week? 10 How many hours are there in 7/2 of a day? 84 What is seven sixths of a day in hours? 28 What is thirty-one fifths of a kilometer in meters? 6200 How many millilitres are there in three eighths of a litre? 375 Convert 4.41478 decades to millennia. 0.0441478 What is 18/5 of a tonne in kilograms? 3600 What is one tenth of a second in milliseconds? 100 What is 3/25 of a gram in milligrams? 120 What is 5/4 of a millennium in years? 1250 How many milligrams are there in sixty-seven fifths of a gram? 13400 What is 434.3156 decades in years? 4343.156 Convert 504.8688 hours to microseconds. 1817527680000 What is 3/8 of a meter in millimeters? 375 What is 20.4361ml in litres? 0.0204361 Convert 0.1085005t to kilograms. 108.5005 What is 626270.4kg in nanograms? 626270400000000000 Convert 55420.31 years to decades. 5542.031 How many grams are there in one fifth of a kilogram? 200 What is 103.4107mm in meters? 0.1034107 What is 806046.6 millilitres in litres? 806.0466 What is one tenth of a litre in millilitres? 100 Convert 29355.39 centimeters to nanometers. 293553900000 What is 1/4 of a litre in millilitres? 250 How many microseconds are there in 1/10 of a millisecond? 100 Convert 45060.597ns to days. 0.0000000005215346875 What is 56518.71l in millilitres? 56518710 How many grams are there in 0.8698288 micrograms? 0.0000008698288 Convert 6.555624 litres to millilitres. 6555.624 How many litres are there in 2.051487ml? 0.002051487 What is one fifth of a litre in millilitres? 200 How many seconds are there in ten thirds of a hour? 12000 How many years are there in 5.79223 millennia? 5792.23 What is twenty-five halves of a tonne in kilograms? 12500 How many millilitres are there in 1/10 of a litre? 100 How many kilograms are there in 3/25 of a tonne? 120 What is eleven tenths of a tonne in kilograms? 1100 How many centimeters are there in 3/32 of a kilometer? 9375 Convert 1840563.27s to days. 21.302815625 Convert 70002.99ml to litres. 70.00299 What is 23/6 of a century in months? 4600 Convert 2817.839mm to micrometers. 2817839 What is 17/6 of a decade in months? 340 Convert 893449.4 meters to millimeters. 893449400 What is 1/5 of a litre in millilitres? 200 Convert 8466.248t to micrograms. 8466248000000000 Convert 0.9641163ng to kilograms. 0.0000000000009641163 What is 6/5 of a gram in milligrams? 1200 Convert 0.9256789 kilograms to milligrams. 925678.9 What is 5/4 of a millennium in decades? 125 What is 5854.862cm in millimeters? 58548.62 What is three eighths of a microgram in nanograms? 375 What is 2/125 of a millennium in years? 16 What is 461.6965us in nanoseconds? 461696.5 What is 52/5 of a litre in millilitres? 10400 How many kilograms are there in 11/2 of a tonne? 5500 How many millilitres are there in eighty-nine halves of a litre? 44500 What is twenty-seven quarters of a meter in millimeters? 6750 Convert 0.8322079 days to minutes. 1198.379376 What is fourty-eight fifths of a millennium in centuries? 96 What is 13/5 of a microsecond in nanoseconds? 2600 How many minutes are there in 2.896319 weeks? 29194.89552 How many seconds are there in one sixth of a day? 14400 How many nanograms are there in 68303.35 kilograms? 68303350000000000 How many millilitres are there in 7/2 of a litre? 3500 How many nanoseconds are there in 0.0918651 hours? 330714360000 How many centimeters are there in 15.47608um? 0.001547608 How many years are there in 26/5 of a millennium? 5200 Convert 9574.61 decades to centuries. 957.461 How many grams are there in nine tenths of a kilogram? 900 How many centimeters are there in 606.22km? 60622000 Convert 5611.969 centuries to millennia. 561.1969 Convert 67.4506 litres to millilitres. 67450.6 What is 0.318355ml in litres? 0.000318355 How many months are there in 46/5 of a century? 11040 How many kilograms are there in 601087.2 grams? 601.0872 How many millilitres are there in three tenths of a litre? 300 How many millilitres are there in 8/25 of a litre? 320 How many millilitres are there in three eighths of a litre? 375 Convert 88762.52 micrometers to kilometers. 0.00008876252 What is sixty-seven fifths of a gram in milligrams? 13400 How many millilitres are there in 1/4 of a litre? 250 What is five eighths of a kilometer in meters? 625 How many grams are there in one quarter of a kilogram? 250 How many microseconds are there in 6/25 of a millisecond? 240 How many months are there in 17/4 of a decade? 510 Convert 33.84017 centuries to millennia. 3.384017 What is fourty-four fifths of a litre in millilitres? 8800 How many millilitres are there in 6/5 of a litre? 1200 What is 5/4 of a centimeter in micrometers? 12500 What is fifteen quarters of a decade in months? 450 How many microseconds are there in thirteen quarters of a millisecond? 3250 What is 57092.1ng in kilograms? 0.0000000570921 How many milligrams are there in 3353.797ng? 0.003353797 How many grams are there in 3/50 of a kilogram? 60 How many decades are there in 1/5 of a millennium? 20 What is 20.959221 months in years? 1.74660175 How many kilograms are there in 26/5 of a tonne? 5200 How many millilitres are there in 25/2 of a litre? 12500 How many nanograms are there in seven halves of a microgram? 3500 How many centimeters are there in three tenths of a kilometer? 30000 What is one twentieth of a centimeter in micrometers? 500 How many tonnes are there in 18.69905kg? 0.01869905 What is fourty-six fifths of a litre in millilitres? 9200 What is 1.978573ml in litres? 0.001978573 How many micrometers are there in 42/5 of a millimeter? 8400 How many millilitres are there in 1/5 of a litre? 200 Convert 1208.185l to millilitres. 1208185 How many seconds are there in 3/28 of a week? 64800 How many micrometers are there in 6/5 of a millimeter? 1200 What is 1/10 of a hour in seconds? 360 How many minutes are there in one fifth of a week? 2016 What is fourty-five quarters of a litre in millilitres? 11250 How many minutes are there in 4426.862 weeks? 44622768.96 How many milligrams are there in 8208.961 nanograms? 0.008208961 How many minutes are there	{ "pile_set_name": "DM Mathematics" }
t h(g) = 25g2 - 2g - 3. What is o(h(u))? -50u2 + 4u + 6 Let u(l) = 2l. Let f(q) be the first derivative of 284/3q*3 + 74 + 0q*2 + 0q. Give f(u(v)). 1136v2 Let r(w) = -2w. Let y(n) = 2615 + 669n - 7865 + 2625 + 2625. Determine y(r(x)). -1338x Let r(p) = -16p. Suppose -5q - 3m + 2m + 20 = 0, -3q + 2m = -12. Let l(o) = -12 + 3 - qo + 4. Let k(g) = g + 1. Let n(u) = 5k(u) + l(u). Give r(n(h)). -16h Let y(g) = -2g*2 - 19g + 1141. Let t(o) = 778o. Calculate y(t(h)). -1210568h*2 - 14782h + 1141 Let p(g) = -7g + 12. Let i(y) = 8y - 14. Let w(b) = 6i(b) + 7p(b). Let r(l) be the third derivative of -19l5/20 + 7l*2. Give r(w(j)). -57j*2 Let c(b) = -118b*2 + 177b + 118. Let k(l) = l*2 - 3l - 2. Let x(m) = c(m) + 59k(m). Let f(y) = -12y. Give x(f(w)). -8496w2 Let n(h) = 73h + 38h - 4h. Let s(g) = -154g2 - 164g*2 + 491g*2 - 169g*2. Determine n(s(w)). 428w*2 Let d(v) = 11v*2 + 7v - 7. Let y be d(1). Let w(i) = yi2 + 9i*2 + 10i*2 - 29i*2. Let o(k) = 199k*2 - 1. Give w(o(f)). 39601f*4 - 398f2 + 1 Let h(c) be the second derivative of c3/2 - c. Let r = 10 + 285. Let k(b) = 6b2 + rb - 295b + 9b*2 - 12b*2. Give k(h(g)). 27g*2 Let g(a) = 59a. Let k(l) = -93l. Let o(t) = 215t. Let w(m) = -5k(m) - 2o(m). Determine g(w(p)). 2065p Let v(j) = 3j*2. Let w(d) = 10d + 6d - 23d + 1 + 1. Let g(p) = 15p - 5. Let c(q) = 2g(q) + 5w(q). Give v(c(l)). 75l*2 Let c(u) = -45u*2. Let v(q) be the third derivative of 49q*5/60 + 1523q*2. What is v(c(i))? 99225i*4 Let l(k) = -4k. Let h(w) = 72w2 - 24w + 24. Let t be (4 + -7 + -2)/1. Let u(s) = 29s2 - 10s + 10. Let f(i) = th(i) + 12u(i). Give l(f(x)). 48x2 Let r = 830/471 + -15/157. Let x(v) be the first derivative of 0v*2 - rv*3 - 17 + 0v. Let q(b) = -3b2. What is q(x(n))? -75n*4 Let r(m) = -2m. Let g(s) be the second derivative of -77s4/3 - 99s - 3. Give g(r(p)). -1232p2 Suppose 108 = -2i + 6i - 4u, -5u = -2i + 51. Let t(y) = -28 - 16y + i + 16y + 2y2. Let n(w) = -2w + 22. Determine t(n(x)). 8x2 - 176x + 968 Let b(v) = -v*2. Let d(i) = -22665634i. Calculate d(b(q)). 22665634q2 Let n = 411 + -412. Let s(q) = 2q*2 - 6q + 3. Let b(o) = o*2 + o. Let j(h) = ns(h) - 6b(h). Let c(f) = -2f*2. Determine j(c(m)). -32m*4 - 3 Let r(l) = -4l*2. Let i(o) = -4o + 37. Let k(n) = -46n + 416. Let g(f) = 68i(f) - 6k(f). Determine r(g(b)). -64b*2 - 640b - 1600 Let d(y) = 338y2 + 24. Let f(n) = 11709n. Determine d(f(x)). 46340030178x2 + 24 Let l(m) = 14m. Let z(k) be the second derivative of 0k2 + 39k + 0k3 + 0 - 1/12k*4. What is l(z(h))? -14h*2 Let m(j) = -136j. Let k(o) be the third derivative of -o*4/24 - 3363o*2. Determine k(m(n)). 136n Let n(o) = 5828o2. Let f(y) = -57y*2 + 7y. Let l(d) = -49d2 + 6d. Let r(v) = 6f(v) - 7l(v). What is r(n(i))? 33965584i4 Let f(y) be the second derivative of 5y*4/12 - 6412y. Let h(q) = 825q2. What is f(h(z))? 3403125z*4 Let i(d) = -6d*2 + 624d - 14. Let y(a) = -5a2 + 623a - 12. Let x(c) = 6i(c) - 7y(c). Let z(f) = -2f2. Calculate x(z(b)). -4b*4 + 1234b*2 Let b(j) = 51j - 567800. Let v(s) = 3s. Determine v(b(m)). 153m - 1703400 Let z(o) be the first derivative of 2o3/3 - 4818. Let i(q) = 5500q. Determine z(i(l)). 60500000l2 Let s(c) = 3c*2. Let y = -99 + 120. Let m(z) = yz*2 - 51z*2 + 41z*2. Give s(m(x)). 363x4 Let y(j) be the third derivative of j4/12 - 63j2. Let c(l) = -143l*3 + 2l*2 + l. Let o be c(-1). Let m(u) = ou - 36u - 80u. Determine m(y(s)). 56s Let g(w) = 1615w*2. Let r(i) = 2653i*2. Calculate r(g(b)). 6919620925b*4 Let u(v) be the second derivative of -5459v*3/6 - v + 520. Let t(z) = 2z. Calculate u(t(j)). -10918j Let r(s) = 8s. Let j(b) = -2071879b. What is j(r(a))? -16575032a Suppose -8d + 2 = -7d. Let g(z) = 9296z + zd - 9296z. Let m(y) = 2y + 3. Let t(r) = 3r + 7. Let v(n) = 7m(n) - 3t(n). Give g(v(w)). 25w2 Let c(h) = 39799131h. Let f(b) = -5b. Determine f(c(j)). -198995655j Let c(d) = -123d2. Let t(u) = 512066u*2. Determine c(t(b)). -32252025367788b*4 Suppose 7u - 2181 = 2334. Let k(q) = 645 - 48q - u. Let n(p) be the second derivative of -p3/6 - 2p. Give n(k(d)). 48d Let y(f) = 4f*2 + 13. Let s(i) = 0i*2 + 8i*2 - 9i*2 + 3i + 3. Let a(l) = -l*2 + 2l + 2. Let h(u) = 6a(u) - 4s(u). Calculate h(y(g)). -32g4 - 208g*2 - 338 Let f(i) = 3i*2 + 4i - 4. Let w(x) = -x*2 - x + 1. Let z(j) = f(j) + 4w(j). Let k(r) be the second derivative of -11r4/6 - 66r. Determine k(z(q)). -22q4 Let a(s) = 19s. Let k(b) = 39b. Let p(y) = 2a(y) - k(y). Let x(z) = 15 + 0z2 - 2z*2 + 45 + 6. Calculate x(p(l)). -2l*2 + 66 Let t(l) = -3l*2. Let n(r) be the third derivative of 122r*4/3 + 19r*2 - 9. Determine n(t(m)). -2928m*2 Let h(x) = -17x*2. Let g(s) = -4496897s. What is h(g(j))? -343775404686353j2 Let i(s) = -2s*2 + 9s - 416. Let y(p) = -5p - 430. What is y(i(u))? 10u*2 - 45u + 1650 Let h(c) = c. Suppose 25f - 66 = 3f. Let k(n) = -5 - f + 6n2 - 8 + 7. What is k(h(b))? 6b*2 - 9 Let a(k) = 2k*2. Let x(h) be the third derivative of -2h - 1/20h5 + 0 - 1/6h*4 + 0h*3 - 11h*2. Calculate a(x(j)). 18j*4 + 48j*3 + 32j*2 Let r(d) = 1288d - 1315 + 1878d - 3165d. Let h(x) = x. Determine h(r(u)). u - 1315 Let a(k) = -4k2. Let b(j) = 39549j*2 + 39538j*2 + 2j - 79083j2. Determine a(b(r)). -64r*4 - 64r*3 - 16r*2 Let k(s) = -73s - 68s - 70s + 212s. Let m(v) = -73v*2. Give k(m(b)). -73b*2 Let h(d) = -217d2. Let l(p) be the first derivative of -p2 + 1337. Calculate h(l(r)). -868r2 Let c be ((-1)/(-2))/((-7)/(-1932)6). Let p(t) = -86t + ct + 31t + 34t. Let w(a) = 406a. Calculate p(w(r)). 812r Let w(q) = -89q2. Let b(s) = -4s - 87. Let c(g) = -g - 29. Let m(l) = -2b(l) + 6c(l). Determine m(w(j)). -178j2 Let b(q) be the second derivative of -q3/3 + 12519q. Let o(x) = -2x2 - 15x + 197. Determine b(o(p)). 4p2 + 30p - 394 Let q(w) = 6w. Let s(h) = h2 - 50h + 7. Let x(d) = -d*2 + 43d - 6. Let t(o) = -6s(o) - 7x(o). Determine q(t(f)). 6f2 - 6f Let o(a) = 20a2 + 26a. Let d(c) = -198c - 5. Let t(l) = -238l - 6. Let f(x) = -6d(x) + 5t(x). Determine o(f(n)). 80n2 - 52n Let o(j) = -3 - 764270j + 764267j + 3. Let n(h) = -38h - 3. Let l(d) = 228d + 19. Let g(r) = 3l(r) + 19n(r). Determine o(g(x)). 114x Let o(j) be the second derivative of j3/3 - 18j. Let q(x) be the first derivative of -26x3/3 + 141. Give q(o(w)). -104w*2 Let g(f) = -155f2 + 7. Let n(c) be the second derivative of -c4/12 - 2c - 92. Give g(n(y)). -155y*4 + 7 Let j(p) = -8p + 90. Let s(b) = 12b - 140. Let y(n) = -14j(n) - 9s(n). Let c(o) = 8o*2. What is c(y(g))? 128g*2 Let x(j) = 10j*2 + 3. Let w(m) = -9m*2 + 4m + 20. Let z(o) = 8o2 - 3o - 15. Let k(y) = 6w(y) + 8z(y). Give x(k(n)). 1000n4 + 3 Let m(l) = -2 + 6 + 0 + 11l - 6. Let h(s) = -s - 6. Let i(q) = -21q - 108. Let k(a) = -18h(a) + i(a). What is m(k(o))? -33o - 2 Let i(t) = -1512t*2. Let q(r) = 524r*2 + 1. Give q(i(d)). 1197939456d*4 + 1 Let m(d) = 170d*2 - 92d*2 - 80d*2. Let o(g) = -2g*2 + 37g. What is m(o(f))? -8f4 + 296f*3 - 2738f*2 Let n(z) = 49z. Let v(h) be the third derivative of -h*7/1260 + 23h*4/12 - 84h*2. Let o(w) be the second derivative of v(w). What is n(o(a))? -98a*2 Let d(j) be the third derivative of -11j*5/60 - 11j*3/6 - 2271j*2. Let g(k) = 9k*2. Give d(g(z)). -891z4 - 11 Let k(n) be the third derivative of -n5/15 - 70n2. Let i be (3 - 3/3)/2. Let q(j) = -7j + 1 + 6j - i. What is k(q(p))? -4p2 Let c(g) be the third derivative of -g5/20 + g2. Let p(s) = -s3 - 6s2 - 7s - 8. Let r be p(-5). Let j(f) = 10f + rf - 14f. What is c(j(y))? -12y*2 Let t(v) = 62 - 28 - 17 - 17 - 3v. Let c(b) = -10 + 10 + 5b - 19b. What is c(t(u))? 42u Let o(n) = 2n. Let y(s) = -s*2 + 36095s - 2. Determine o(y(d)). -2d2 + 72190d - 4 Let y(h) = 3h + 2h + 45534h2 - 45537h*2 - 5h. Let g(a) = 3078*a - 2. What is y(g(w))? -284	{ "pile_set_name": "DM Mathematics" }
derivative of w(m) wrt m? 2040m3 Let g(o) be the third derivative of -o9/1512 + o6/120 - o3/3 + o2. Let r(v) be the first derivative of g(v). Find the third derivative of r(i) wrt i. -120i*2 Suppose j = 3j - o - 7, -j = 4o - 17. Find the second derivative of -17p*4 - 3p + 17p4 - 2p*j wrt p. -40p*3 What is the third derivative of 12o*5 - 2o*5 - 13o*2 - 27o*4 + 27o*4 wrt o? 600o*2 Let w = 61 - 58. Let r(o) be the second derivative of -1/30o*6 - wo + 0o4 + 0 - 1/2o*3 + 0o*2 + 0o*5. What is the second derivative of r(g) wrt g? -12g*2 Let b be -15(-1)/(-5)-3. Differentiate 9i*3 + 3i*4 - bi*3 + 3 with respect to i. 12i3 Let u(l) = -l3 - l*2 - 1. Let t(z) = 5z*4 + 6z*3 + 6z*2 - 7. Let b(y) = t(y) + 6u(y). What is the derivative of b(m) wrt m? 20m3 Let q(x) be the third derivative of -x7/280 + x5/120 - x3/2 - 4x*2. Let n(r) be the first derivative of q(r). Find the second derivative of n(p) wrt p. -18p Suppose 0 = -3x + 6x - 9. Differentiate 8 + 2y3 - 11 + yx with respect to y. 9y*2 Suppose f - 3p = -2f + 21, -4p = 3f + 14. Find the second derivative of mf + 4m - m*2 - 7m*2 + 2m2 wrt m. -10 Let w(o) = -o4 + o*2 - 1. Let g(p) = -p + 3. Let t be g(0). Let c(z) = 3z*2 + 2z - 3. Let b(n) = tw(n) - c(n). Find the second derivative of b(v) wrt v. -36v*2 Suppose 2d - 8 = -0d. Find the second derivative of 3h + dh2 - 12h*2 + 10h*2 wrt h. 4 Let x(u) = -23u + 26. Let s(p) = -47p + 52. Let i(g) = 3s(g) - 7x(g). Differentiate i(o) wrt o. 20 Let b be 7/14 + 0/(1 - 3). Let h(k) be the second derivative of 0 - bk*3 + 2k + 1/6k4 + 0k*2. Find the second derivative of h(n) wrt n. 4 What is the derivative of 199 - 11l*2 - 226 - 6l*2 wrt l? -34l Let v(g) = 3g3 - g. Let i(a) = -a3. Let h(t) = 4i(t) + v(t). What is the second derivative of h(u) wrt u? -6u Let h(x) be the first derivative of x8/336 - x5/30 + 3x*2/2 + 2. Let p(f) be the second derivative of h(f). Find the third derivative of p(y) wrt y. 60y*2 Suppose 0 = 2k + 1 - 5. Suppose 0 = 6l - kl. What is the second derivative of u - u*3 + lu - 2u wrt u? -6u Let t(r) be the first derivative of -r6/180 - r5/120 + 8r3/3 - 4. Let d(z) be the third derivative of t(z). Find the second derivative of d(j) wrt j. -4 Let j(u) be the first derivative of u7/210 - u4/4 + 7u*3/3 + 1. Let m(c) be the third derivative of j(c). Differentiate m(i) with respect to i. 12i*2 Suppose 0 = -2x + 1 + 3. What is the second derivative of -5px + 4p*2 + 5p*2 + 2p wrt p? 8 Let g(z) = 25z3 + 4z*2 + 3z - 3. Let y(r) = 26r3 + 4r*2 + 4r - 4. Let i(u) = 4g(u) - 3y(u). What is the third derivative of i(s) wrt s? 132 Let w(m) be the first derivative of -17m5/5 + 16m + 2. Differentiate w(d) wrt d. -68d3 Let k(p) be the first derivative of -p9/1008 + p6/120 + 4p*3/3 - 5. Let h(z) be the third derivative of k(z). What is the third derivative of h(r) wrt r? -180r*2 Let c(g) be the second derivative of 0g*6 + 0g*5 + 0 - 1/14g*7 + 3g + 0g4 + 0g*2 + 1/2g*3. Find the second derivative of c(z) wrt z. -60z*3 Let u = 1 - -2. Suppose l = 3l - uo - 10, 3o = -6. What is the third derivative of -7z3 + 4z*2 - lz*2 + 4z*3 wrt z? -18 Let k be ((0 - 1) + -1)-1. What is the third derivative of -c*3 - 34c*6 + 32c6 + c3 - 6ck wrt c? -240c*3 Let p(u) = 2u*2 + 4u + 2. Let f be p(-2). What is the second derivative of -fz + 2z4 + z4 - 6z4 + 6z wrt z? -36z2 Let z(j) be the second derivative of 9j*5/10 - 2j*2 + 4j. Differentiate z(v) with respect to v. 54v2 Let p(n) be the second derivative of -n8/336 - 5n*4/12 + 2n*3/3 + 9n. Let k(d) be the second derivative of p(d). Find the first derivative of k(i) wrt i. -20i3 Let m = -21 + 23. What is the third derivative of 0y*m - 79y4 + y2 + 74y4 - 4y*2 wrt y? -120y Find the third derivative of -5 + 5 + 6u2 - 5u*4 wrt u. -120u Let a be 0(-4)/((-8)/2). Differentiate q4 - 3 - 1 + a wrt q. 4q*3 Find the third derivative of 0l*6 + 9l6 - l2 - 8l2 wrt l. 1080l3 Let w(g) = g3 - g*2 + g - 1. Let x(i) = 11i*3 - 7i*2 + 7i - 5. Let z = 17 - 19. Let h(a) = zx(a) + 14w(a). Find the first derivative of h(j) wrt j. -24j2 Let i be 3/(-18) - (-26)/12. What is the second derivative of 0 + 2v*i + 0v*2 - 4v + 0 wrt v? 4 Suppose 0 = -2p - 5r - 6 + 30, -20 = -5r. Let x(c) be the first derivative of 0c*3 - c - 3/4c*4 + 2 + 0c*p. Find the first derivative of x(h) wrt h. -9h*2 Suppose 3 + 3 = -2y. Let h(z) = z2 + z - 4. Let d be h(y). What is the third derivative of -6 + 6 - cd - c*3 wrt c? -6 Let n(t) = 2t2 + 13. Let s(y) = y2 + 6. Let i(l) = 2n(l) - 5s(l). Find the first derivative of i(c) wrt c. -2c Let l = -5 + 4. Let i be 2 + -2 + (-3)/l. What is the derivative of -3a3 - 2 + a2 - a*2 + i wrt a? -9a2 Let r(j) be the third derivative of -j8/336 + j*4/12 - 2j*2. What is the second derivative of r(y) wrt y? -20y*3 Let w = -8 - -11. Find the second derivative of 2y - wy - y2 - 3y2 wrt y. -8 Let u(p) be the first derivative of -p4/4 - 3p2/2 - 2. What is the second derivative of u(z) wrt z? -6z Differentiate -1 + 0 + 0 - 4 - 9y with respect to y. -9 Let n(b) = -b6 - b4 - b3 + b2. Let v(w) = 17w*6 - 4w*4 - 4w*3 + 16w*2. Let i(k) = -4n(k) + v(k). What is the third derivative of i(s) wrt s? 2520s3 Find the first derivative of 49h + 43h + 19 - 56h wrt h. 36 Find the third derivative of -2w2 - w + 3w*2 + 3w*3 + w wrt w. 18 Let t(g) = 8g*6 - 6g3 - g2 + 6. Let s(x) = 8x6 - 7x*3 + 7. Let j(q) = 6s(q) - 7t(q). What is the third derivative of j(h) wrt h? -960h3 Let n(h) = -h4 + h*2 + h - 1. Let c(v) = 7v5 + v4 - 3v2 - v + 1. Let z(b) = c(b) + n(b). What is the third derivative of z(m) wrt m? 420m2 Let j(m) be the third derivative of -m8/168 - m*5/60 - 4m*2. What is the third derivative of j(c) wrt c? -120c2 Let s(b) be the second derivative of b6/720 - b5/30 + b4/6 + 2b. Let p(q) be the third derivative of s(q). What is the derivative of p(t) wrt t? 1 Let r(g) = -13g*2 - 6g - 7. Let v(j) = -9j2 - 4j - 5. Let c be 5 + -3 + -1 - -6. Let t(a) = cv(a) - 5r(a). Find the second derivative of t(m) wrt m. 4 Let u(r) be the second derivative of 3/2r2 + 0r*5 + 0 + 0r*4 + 5r + 0r3 - 1/10r*6. Differentiate u(k) with respect to k. -12k3 Let g(u) be the first derivative of -u7/7 - 16u5/5 - 52u*3/3 + 31. What is the third derivative of g(k) wrt k? -120k*3 - 384k Let g(m) = 16m3 + 2m*2 - 2m + 8. Let j(q) = -q*2 + q + 1. Let k(b) = g(b) + 2j(b). Find the first derivative of k(w) wrt w. 48w2 Let y(u) = 7u + 2. Let g(o) = 8o - 4 + 1 + 6. Let f(l) = 3g(l) - 4y(l). Differentiate f(a) wrt a. -4 Let i(w) = -w3 - 2w*2 - 2w. Let l be i(-3). Let y be 12/(-10)l/(-6). What is the second derivative of -6v5 + v5 + 4v5 - yv wrt v? -20v3 Let w(r) be the third derivative of -r8/56 + 2r*5/15 + 5r*2. Find the third derivative of w(m) wrt m. -360m*2 Suppose 3d = 4r, 2r + 3r + 3d - 27 = 0. Find the first derivative of -ri + i + 4i - 3 - 4i wrt i. -2 Let k(s) = -s3 + 5s3 - 6 + 20 + s3 - 8s. Let q(y) = -3y*3 + 5y - 9. Let f(j) = 5k(j) + 8q(j). What is the derivative of f(d) wrt d? 3d2 Let l(n) be the third derivative of -n8/48 + n4 + 13n*2. What is the second derivative of l(f) wrt f? -140f3 Let y(x) be the second derivative of x7/42 + x4/12 + x2/2 - 2x. Let l(j) be the first derivative of y(j). What is the second derivative of l(m) wrt m? 60m*2 What is the second derivative of 38w - 28w - w5 + 2w*5 wrt w? 20w*3 Let t(s) = 6s*2 - 5s - 10. Let l(z) = z*2 - 7z - 3. Let j be l(8). Let f(y) = -6y2 + 4y + 9. Let h(w) = jf(w) + 4t(w). Differentiate h(v) wrt v. -12v Let j(c) be the third derivative of c8/1680 - c5/120 + c3/2 + 2c*2. Let o(d) be the first derivative of j(d). Find the second derivative of o(q) wrt q. 12q*2 Let r(f) = -50f*3 + 33f*2 + 7f. Let u(c) = -25c3 + 17c*2 + 3c. Let g(t)	{ "pile_set_name": "DM Mathematics" }
Let l(i) = 2i2 + 9i - 3i2 - 13i. Suppose 2a - 25 = -3a. Let x be 1a(-8)/10. What is l(x)? 0 Let j(b) = -7b - 11. Let u(s) = -3s - 4. Let v(l) = -4j(l) + 9u(l). Determine v(-13). -5 Let h(n) be the third derivative of -n*5/60 - 11n*4/24 + 8n*2 - n. Give h(-9). 18 Let m(r) = 70r - 32r - 40r + 2. Suppose 8b = 6b + 8. Give m(b). -6 Let p(o) = -1435 - 8o + o + 727 - 2o2 + 728 + o2. Calculate p(-10). -10 Let n(g) = 16g3 + 19g*2 + 15g + 1. Let i(t) = 9t3 + 10t*2 + 8t + 1. Let f(l) = -7i(l) + 4n(l). Give f(-4). 13 Let p(h) = -h*3 - 9h*2 - 8h + 6. Suppose -c = 2d - 5 - 12, 28 = 3d - c. Let u be 1 - (d - (2 + -2)). What is p(u)? 6 Let o be ((-42)/(-15))/((-4)/(-60)). Let a be (-2)/8 + o/8. Suppose -a = -w - k, -3w = 2k + 2k - 14. Let c(v) = v2 - 4v - 4. What is c(w)? 8 Let i(d) = -d*2 - 2d. Let h(w) = 2w2 + 6w. Let o(n) = -3h(n) - 8i(n). Let c be 150/4(-4 + (-36)/(-6)). Let z = c + -73. Give o(z). 4 Let m(t) = -35t - 29. Let j be m(-1). Let y(z) = 3z - 13. Give y(j). 5 Let w(m) = m2 + 3. Let g = -10 + 7. Let q be 1 - g/(1 - 0). Suppose -3a + q = 13. Calculate w(a). 12 Let b = -10 - -14. Let d(i) = -7 + b + 4i - 3i. Suppose -394z = -400z - 24. Give d(z). -7 Let y be 14 + -5 - 4 - -59. Let l = -57 + y. Let f(d) = -d + 2. What is f(l)? -5 Suppose 0p + 12 = 2p + 4b, -3p + 3b = 27. Let v be -6(-4 - 11/(-3)). Let u(w) = 0w2 - w3 + 12w + 2 - 13w - 4w*v. Give u(p). 6 Let j(g) = -1 + 4g + 21g2 - 4 + 18g*2 - 40g*2. What is j(-4)? -37 Let m = 6 + -2. Suppose 2s + m = -4. Let r(o) = 5o3 - 5o*2 + 2o. Let a(q) = 4q3 - 5q*2 + q. Let z(l) = -6a(l) + 5r(l). Calculate z(s). 0 Let a(s) be the first derivative of 7s + 3/2s2 - 22. Give a(-5). -8 Let l(t) be the second derivative of t5/20 - 2t4/3 + t3/2 + 5t2 - 4t - 37. What is l(7)? -18 Let d(q) = 5q2 + 10q*2 - 3q*2 - 11 + 6q2 + q3. Give d(-18). -11 Let j(m) = m*2 - 4m + 5. Let z be j(6). Let k = z + -11. Let b(u) = 0u - 7u + ku. What is b(-3)? 3 Let m(t) = -t3 - 10t*2 - 9t. Let y = -278 + 269. Give m(y). 0 Let l(j) = 28j3 - j2 + 1. Let z be 1/(-5)(-91 + 86). What is l(z)? 28 Let h(l) = -3l3 - 8l*2 - 5l + 2. Suppose -44 = -5y + 21. Let v(a) = -7a*3 - 17a*2 - 11a + 4. Let b(g) = yh(g) - 6v(g). What is b(2)? 20 Let r(q) be the second derivative of 0 + 5/12q4 + 1/20q*5 + 5/2q2 + q3 - 6q. Calculate r(-4). -3 Let z(f) = f3 + 5f*2 + 7f + 8. Let m = -877 - -872. Calculate z(m). -27 Let f(c) = c - 5. Let i(k) = -2k3 - 12k*2 - 19k - 3. Let u be i(-3). Give f(u). -5 Let s(b) = -326 - 4b + 5b + 325. Let z(v) = v2 + v - 3. Let g be z(-3). What is s(g)? 2 Let l(h) be the second derivative of -h5/20 + 2h4/3 - 7h*2/2 - 2h. Suppose 7b - 43 - 13 = 0. Calculate l(b). -7 Suppose 9n - 4n - 10 = 0. Suppose -2s + s - u + n = 0, 0 = -5s + 4u + 37. Let t be -7 + s + (-2)/1. Let y(p) = -p*3 - 4p*2 + 2p + 3. Give y(t). -5 Let d be 6-2(-3)/12. Let i(q) = q*3 - 4q*2 - 1. Let x(n) = -3n*3 + 12n*2 + n + 2. Let v(o) = 7i(o) + 2x(o). Give v(d). -6 Let o(p) = 11p*2 + 2p + 1. Let j(w) = w. Let s(u) = -6j(u) - o(u). What is s(-1)? -4 Suppose 3t + m + 3m = -32, -t + 3m + 11 = 0. Let i(k) = -k3 - k2 + k + 1. Let u be i(-2). Let y(l) = u + l + 2l - l. Determine y(t). -5 Let j(o) = 3o + 1. Suppose 4x + 21 = 2s + 129, -5x - 5s = -135. Suppose 46 = -2g + 5d - 0d, -5g - 146 = 3d. Let z = x + g. Calculate j(z). -2 Suppose -2o - 3v = -v + 2, 0 = 2o - 3v + 7. Let s be (6/24)/((-2)/(-8)). Let g(i) = -8 + s + 0i3 + i - i3 - 2i2 + 5. Calculate g(o). -4 Let m(x) = 2x + 5. Let k(q) = -q - 2. Let p be k(-3). Suppose 14 - 11 = -i. Let o = i - p. Calculate m(o). -3 Let g(s) = -3s + 7. Let m = 246 + -243. Calculate g(m). -2 Let z(f) = -5f*2 + 5 - 1 + 4f*2 - 4f. Suppose 3t + 10 = 64. Suppose 10 + t = -7u. What is z(u)? 4 Suppose j + 6l - 17 = 3l, 3l = 3. Let t be -1 + 1 + j/7. Suppose -3w = tw. Let u(x) = -x + 5. Give u(w). 5 Let k(z) = z3 + 5z*2 + 3z + 1. Suppose 3q + 135 = 2h - 5h, -2q = -4h + 114. Let d = 45 + q. What is k(d)? 5 Let v = 33 - 30. Let n(o) be the second derivative of 2o*2 - 8o + 0 + 1/3o3. What is n(v)? 10 Let j(y) = 2y + 3. Suppose 19 = 3k - 5. Suppose -4f = -k - 12. Suppose -12 = w + fs, -2w + 0w + s + 9 = 0. Determine j(w). 9 Let k be ((-3)/(-2))/((-30)/(-80)). Suppose 3g - 2 - 6 = -5o, -2o + kg = -24. Let h(d) = d3 - 4d2 + d - 2. Calculate h(o). 2 Let p(j) = j2 + 4j - 5. Let o(u) = -u2 - 5u + 6. Let s be (6/(-9))/((-2)/(-15)). Let m(a) = sp(a) - 4o(a). Calculate m(-2). -3 Let x(g) = 2g + 4. Let t(z) = -3z + 35. Let d be t(11). Let l be (1 + (-2)/1)-5. Suppose 0 = 4i - 5n + 36, -li - 20 = -di - 2n. Calculate x(i). -4 Let s = -25 - -32. Let a be 118/(-14) - (260/(-35) + s). Let f(r) = -r*2 - 8r - 7. Calculate f(a). -7 Suppose -14 = s - 3t, 0 = 3s - 2t + 37 - 30. Let m(j) = -11j - 5. What is m(s)? -16 Let t(a) = -a*3 - 5a*2 + 2a. Suppose 2g + 6 = -m, -4m + 2m - 12 = -5g. What is t(m)? 24 Let y(b) be the first derivative of b*2 - 5b + 29 + 1/3b3. Calculate y(-4). 3 Let m(g) = g3 - g2 - 5g - 4. Suppose -165 = -7v + 3. Suppose 0 = 3j - 5r + v, 21 = -j - j + 5r. What is m(j)? -25 Let w(b) = -b*2 - b. Let m(z) be the second derivative of -5z*3/6 - 53z*2/2 + 30z. Let i be m(-10). Give w(i). -6 Let j be (-165)/(-66)(-156)/15. Let t(c) = c3 + 26c*2 - c - 21. Calculate t(j). 5 Let g(l) = -1616 - l + 1616. Let k(v) = -1. Let n(p) = -2g(p) - 3k(p). Let c = 8 + -5. Calculate n(c). 9 Let h = 2 + 0. Let u be (-1)/((-1)/h1). Let o(z) = 2z3 + 2z - z*3 + u - 4z*2 - 8z*2 + 17z*2. Calculate o(-4). 10 Let q be (-189)/(-18)2/(-3). Let r(b) = -3b - 9b*2 + b + 7 - 5b + 8b2. Calculate r(q). 7 Suppose 0q + 27 = 3q - 4o, 4o - 13 = -5q. Let i(p) = 40p3 + 1 + p - qp + 6p - 39p3 + p2. What is i(-2)? -7 Suppose -4t - 9 - 79 = 0. Let u = 23 + t. Let z(r) = 8r*2 - 5r - 1. Let h(d) = d*2 - d. Let n(a) = 6h(a) - z(a). Calculate n(u). -2 Let m(d) = -d*3 - 14d*2 + d + 6. Let a be m(-14). Let z be 86/a + 33/12. Let g(x) = -x*3 - 10x*2 + x + 2. Calculate g(z). -8 Let u(g) = -7g*2 + g. Let k(a) = -6a*2 + 2a - 1. Let n(x) = 6k(x) - 5u(x). Let i = -16 + 2. Let b be ((-12)/i)/(5/35). Give n(b). 0 Let t(k) = k*2 + 2k - 4. Let b be t(2). Let n(q) = bq - 2q + 3q - 30q*2 + 31q2 - 7. Determine n(-8). 17 Let r(f) be the first derivative of -f4/4 + 4f3 - 11f*2/2 + 4f + 335. Determine r(11). 4 Let h(l) = l*3 - l - 15. Suppose 49 = 4q + 1. Suppose -12 = 4x - q. Determine h(x). -15 Let m(a) be the second derivative of a3/6 - a2 - 15a. Let x be m(6). Let p(s) = -s*2 + 3s - 6. Give p(x). -10 Let y be 34/4 - (-6)/3. Suppose -yk = -4k + 6. Let v(r) = 2r*2 - 4r - 5. Let j(q) = -5q2 + 7q + 9. Let a(m) = 3j(m) + 7v(m). What is a(k)? -2 Suppose 2q = 4q. Let i(k) be the first derivative of k*6/360 + 13k*4/24 + 2k*3/3 - 3. Let n(j) be the third derivative of i(j). Determine n(q). 13 Let o(n) = -n + 12. Let y be -10 - 377/(-39) - 32/(-6). Give o(y). 7 Let u be 2/(36/(-10) - -4). Suppose 8 = -9y + uy. Let k(x) = 2x*2 + 3x. Determine k(y). 2 Let h(m) = m*3 + 5m*2 + 5m + 4. Suppose -5q - 10 = -2i, -4i - 1 = -3q + 7. Calculate h(i). -21 Suppose -5v + 5q = -0q + 5, q + 11 = 5v. Let j(l) = 3l + l + 3 + vl - 6l. Give j(-7). -4 Let r(m) be the third derivative of m6/40 + m4/24 - m3/3 - 120m*2 + 2. Calculate r(-2). -28 Suppose -m - 566 = -5o, 0m = -3o - m + 338. Let j = o + -104. Let b(k) = k*3 - 10k*2 + 11k - 10. Give b(j). 8 Suppose 5a - 44 = -9. Let n be 0/(5 - (7 - 3)) + 18. Let d(m) = 2 - nm + 31m - 14m. Give d(a). -5 Let i = 30 + -44. Let l = i - -22. Let w(s) = s - 8 - ls + 5s + 0s. Give w(-7). 6 Let n(p) be the second derivative of 2p*2 - 1/6p*3 + 14p + 0. Give n(0). 4 Suppose -4w = p + 7, -7w + w + 3p - 33 = 0. Let b(t) = t3 + 3t*2 + 2t + 4. Give b(w). -2 Suppose 50i = 53i + 36. Let n(m) = m*2 + 11m - 14. Calculate n(i). -2 Let m = -411 - -398. Let x(w) = w + 9. Give x(m). -4 Let t(a) be the second deri	{ "pile_set_name": "DM Mathematics" }
r w. 5 Suppose 3d - 12 = -d. Solve da - 3 = -18 for a. -5 Let f = -2 - -8. Let t be 3/(-9) - (-2)/f. Let z = 41 + -41. Solve t = -zx + 3x - 12 for x. 4 Let l = -4 + 6. Solve -4u = l - 10 for u. 2 Let n(c) = 5c*3 - 1. Let l be n(-1). Let g be l7/(63/(-30)). Solve 0 = 2w + 3w - g for w. 4 Suppose 4t - 29 = s, 2s - s = t - 5. Suppose 4j - t = 2j. Suppose 3m = -4k + 74, 0m - m = -5k + 7. Solve 0 = -jv - 2 - m for v. -5 Suppose 5l - 8 = 4k - 0l, -2l + 5 = -k. Suppose kp = -1 + 7. Solve v + 2 + p = 0 for v. -4 Let j be 2/(-4) - (-129)/6. Suppose -4v = 3y - j, 4v + 4 = -4y + 28. Suppose -k + vl = 3, -5k - 5l - 8 = -53. Solve -3m - 3 - k = 0 for m. -3 Let n(h) = h + 4. Let d be n(-5). Let y be d/(-6) - 4/24. Suppose -2 + y = -v. Solve -4x = -vx + 2 for x. -1 Let a be -2(-2 - -3)-1. Let d = 4 - a. Suppose 0 = q + q - d. Solve 4p - 21 = -q for p. 5 Let a = -41 - -46. Solve 0 = -q - 4q + a for q. 1 Let n be 14/8 + (-1)/(-4). Suppose -nv = -4v + a + 15, a - 34 = -5v. Suppose u + d = 3 + v, 0 = -2u - 3d + 25. Solve -3h = -uh - 8 for h. -4 Let t(o) = -o2 - o + 9. Let j be t(0). Solve 8b + j = 5b for b. -3 Let k be (-1)/(-3)(1 - -14). Suppose 3u - 18 = 2u - kb, 0 = 4b - 12. Suppose 2s = -5d - 4 + 12, d + 5s = -3. Solve -d = -q - u for q. -1 Let s(q) = q2 - 2. Let n be s(-2). Solve 6 - 2 = nw for w. 2 Suppose 0 = -5o + 37 - 17. Solve -om = m - 20 for m. 4 Suppose -g + 4g = 0. Solve g = 2z - 2 - 0 for z. 1 Suppose 2x = -5m + 33, 5m + 5x = 26 + 19. Solve mq - 4q = 1 for q. 1 Suppose 10w - 13w + 15 = 0. Suppose -2l = wd + 2l, -5d + 4l = 0. Solve z + d = -4 for z. -4 Let o = -8 - -5. Let l be ((-1 + 19)/o)/(-2). Suppose -3d + 26 = -4a, -d - l + 10 = -a. Solve -3c = dc for c. 0 Suppose 2d + 2d = g + 11, -g - 7 = -3d. Let o be (-6)/g(-7 - -2). Solve -3 + o = j for j. 3 Let s(w) = w2 - w. Let j be s(4). Let f = 8 + j. Solve 0 = -3i - 2i + f for i. 4 Suppose 6c - 3c + 9 = 0. Let o(n) = n3 + 4n*2 + 4n + 3. Let b be o(c). Suppose -p + 22 = 2d + 2d, b = -2d - 4p + 4. Solve j - 20 = dj for j. -4 Let x = -5 - -17. Let t(l) = -l - 2. Let s be t(0). Let i = 1 - s. Solve 0 = -5n + i + x for n. 3 Suppose -5s = 4n, -3n + 7n + 4s = 0. Solve n = 4v - 3v for v. 0 Let d = -31 - -32. Solve 0 = t + d - 0 for t. -1 Suppose -4 - 2 = -d. Suppose 4v - dv = 0. Solve 3i - i - 10 = v for i. 5 Suppose -3u + 6 = 0, 0 = -3i - 2u + 3 + 7. Solve ih + 9 = -h for h. -3 Let d be -1 - (3 - 12/(-3)). Let i = 13 + d. Suppose -5g + 5 = iy - 20, 4g = 3y - 1. Solve -gp = -p for p. 0 Let b(o) = -17o - 18. Let u be b(-2). Let y(v) = v. Let j be y(5). Solve -ji - u = -i for i. -4 Let w = -8 + 12. Suppose 12 = wb + 4. Solve -6 = -c - b for c. 4 Suppose -4l - 4 = 0, 3o + 10l - 9 = 13l. Solve ov = 3v for v. 0 Let x be 6/(-3) - -1 - -4. Suppose -m + xr = -6m - 5, -4m = -r - 13. Let d be (-19)/(-3) - m/6. Solve di = 2i - 8 for i. -2 Let f be (-5)/(-1)(-4)/(-5). Let a be ((-2)/f)/((-5)/50). Solve 2b = a + 3 for b. 4 Let q(l) = l2 + 4l + 6. Let w(p) = p*2 + 3p - 7. Let o be w(-5). Suppose -os = s + 16. Let m be q(s). Solve 2f + 0 = -m for f. -3 Suppose 0 = -5f + 3 + 22. Solve 0 = -b + f for b. 5 Let r(n) = n3 + 4n*2 - 5n. Let h be r(-5). Solve h = -s - 1 + 4 for s. 3 Suppose 0p = 2p - 8. Let z = 26 - 14. Let m be ((-9)/z)/((-3)/8). Solve 0j - mj - p = 0 for j. -2 Let i = 11 + -15. Let x = 4 + i. Let f = 0 - x. Solve f + 8 = 4p for p. 2 Let j be -1 + 0/5 + 3 + 0. Solve -v - jv + 15 = 0 for v. 5 Let f = -5 + 8. Suppose c + c + 8 = -fk, -4c = -4k - 24. Solve 0 = -t + 3 - c for t. 1 Suppose 17 = 5g + t, 4g - 3t - 13 = 3g. Solve -5y = -gy + 3 for y. -3 Suppose 0i + 3i - 12 = -3k, 14 = 2k + 5i. Solve km + 16 = -2m for m. -4 Let r(u) = -u*3 + 3u*2 - 1. Let z be r(2). Suppose -g + z = -0. Solve 1 + 8 = -gl for l. -3 Let l = 13 + -8. Suppose 2r - 4v - 20 = 0, 3v = -4r - 3 - 1. Solve -l - 5 = rk for k. -5 Let r be (-15)/((2 - -1)-1). Suppose -2q + 3q = 2. Let h = -1 + 1. Solve -qi + 7i - r = h for i. 1 Let q(v) = 6v2 + v. Let c(x) = x2 - 3x - 3. Let h be 20/6(-18)/(-15). Let j be c(h). Let t be q(j). Solve g - 2 = -t for g. -5 Let s = -44 + 44. Solve -c + 2 + 0 = s for c. 2 Suppose d = -2g + 1, -3g - 8 = -g + 4d. Suppose -3f + 39 = -2w - 123, 4f - gw - 218 = 0. Suppose -3i - i + f = 0. Solve 5k + i = -1 for k. -3 Let f be 66/15 - 9/(-15). Solve 0 = 5d - 0 + f for d. -1 Let x be (3/6)/(1/4). Solve 4m = xm for m. 0 Let q = -3 + 3. Solve qh = -2h + 6 for h. 3 Let c(n) = -n3 + 5n*2 + 6n - 9. Let q be c(6). Let m be (6/q)/((-1)/3). Suppose m = 2g - 2. Solve gs - 12 = -s for s. 4 Let z(x) = 10x - 25. Let h be z(3). Let a(i) be the first derivative of i2/2 - 3i + 1. Let d be a(5). Solve 0 = dy - h - 1 for y. 3 Let p(y) = -y2 - 5y + 3. Let b be p(-5). Suppose -5k + bk = 0. Suppose -3n = 2f - 7, 2n - 7 = -2f - 1. Solve fz + 10 = -kz for z. -5 Let g = 7 + 4. Solve -4d = 5 + g for d. -4 Let r = 9 + -2. Suppose -q - v + r = 0, 2q + 2v - 5v - 4 = 0. Suppose 2p - 30 = -4w + 36, -3w - qp = -53. Solve -w = z + 3z for z. -4 Suppose 0 = -0y - 3y + 21. Suppose -2d + 15 = 3f + d, -2f + d + y = 0. Let v = -6 - -10. Solve 0 = 2b - vb - f for b. -2 Let a = 2 + -1. Solve 6 = 5j + a for j. 1 Let b be (-6)/5130/(-39). Solve 2t + 6 = bt for t. 3 Let u be (36/15)/(8/20). Solve 0 = 5j - u - 9 for j. 3 Suppose 5v + 9 = -6, -3f + 3v + 21 = 0. Suppose -11 = -fb + 5. Suppose 0 = 2u - 0u - b. Solve 0 = ul + 2 for l. -1 Let p be 1(1 + 2 + -1). Suppose -3n - 17 = -4u, 5u + 4n = pn + 4. Solve 0 = 5c - uc for c. 0 Suppose 3m = 38 - 29. Solve 0s - ms = 0 for s. 0 Let z be (-4)/(-3)3/2. Suppose -6l = -l - 3h - 17, zh + 9 = l. Solve l = -3f + 16 for f. 5 Suppose -v = 4b - 0v + 12, 15 = -5b - 5v. Let l be (b - -3)1/2. Solve 6j - j = l for j. 0 Let q(i) = -i + 8. Let z be q(6). Let n(s) = -s*3 - 7s*2 - 8s - 8. Let x be n(-6). Let p = -15 + 33. Solve -z = -xf + p for f. 5 Let h(x) = x2 + 5x + 3. Let n be h(-5). Suppose -y + n = -1. Solve -ym = 1 - 5 for m. 1 Suppose 2y = -4z - 2y + 12, -25 = -5z - 3y. Let t be 74/8 + 27/36. Let w = z + t. Solve -w = 4n - 2 for n. -4 Suppose -4u = 120 - 140. Solve -3m = -17 + u for m. 4 Suppose -6 = -5u + 2u. Suppose -uz - z + 9 = 3a, -4z + 4a = -4. Solve 3y + z = -7 for y. -3 Suppose -4q - 16 = 0, 2n + 19 - 5 = 3q. Let g = n + 18. Solve b = gb - 12 for b. 3 Let x(z) = 2z2 - 10. Let h be x(4). Solve 0 = 25d - hd for d. 0 Suppose -170 - 106 = 4u. Suppose -18 = -3y + 6y. Let h be u/y + (-1)/(-2). Solve -x = -5x - h for x. -3 Let j = 6 + -2. Suppose 4f + o - 75 = jo, 3o + 15 = 0. Suppose 3i + f = 0, i + 11 = 4q + 2i. Solve c + q = 3c for c. 2 Suppose 0 = 9s - 8s - 3. Solve 2 + s = -y for y. -5 Let h(x) = x*3 - 6x*2 + 5x. Let g be h(5). Suppose -2m = 4m + 36. Let v be 6/(-10)(m - -1). Solve gy = -vy for y. 0 Let y be -1((4 - 2) + -3). Solve 2d + 3 + y = 0 for d. -2 Let l = 28 + -27. Solve 0a - l = a for a. -1 Let m = -20 - -27. Let r be (0 - 1)(m + -9). Let d = 2 - -3. Solve 1 = -rw + d for w. 2 Let n(z) = 2z - 3. Let p be n(2). Solve t + 0t - p = 0 for t. 1 Suppose h + 15 = 3y, -6 = -h - h. Solve -3r = -yr + 15 for r. 5 Let m be (-284)/(-18) - 2/(-9). Let h = -6 - -9. Let z be (h/2)/(2/4). Solve n + zn - m = 0 for n. 4 Suppose 0 = -p + 3p + 48. Let d = -20 - p. Solve -c = c - d for c. 2 Let c = 175 + -160. Solve 10u - 7u + c = 0 for u. -5 Let m = -10 - -12. Solve mr - 2 = -0r for r. 1 Let d = 10 + -7. Suppose t = 4t - 24. Let h(u) = -u*2 + 8u - 7. Let a be h(7). Solve df - f - t = a for f. 4 Suppose f - 3f = 0. Solve f = -2n - n for n. 0 Let i(u) = -2u + 5. Let r be i(4). Let y be 3 + (-3 - r) + -1. Solve 0 = yq - 0q + 2 for q. -1 Suppose -2y = 5f - 27, y + 5f - 29 = -3y. Let u(c) = c*3 - 2c*2 + c. Let p be u(y). Solve -2v - 2 - 8 = p for v. -5 Let c = -3 + 3. Let l(p) = -p*2. Let s be l(0). Let x = s + c. Solve -4w = -x + 4 for w. -1 Suppose 4g + 100 = 800. Suppose 3y = -4 + g. Let c be y/5 + (-12)/30. Solve 3h - c = 4 for h. 5 Let o(u) = u3 + 6u*2 - 8u - 2. L	{ "pile_set_name": "DM Mathematics" }
2/(-138)). Solve t = -l + 4 + 3, -l + 5t - k = 0 for l. 2 Let p be (-20)/(-6) - 2/(-3). Suppose 2d + 19 = 5a, -2a = 5d + a - 30. Suppose -ph + d = -h. Solve 0 = r + h, -4w + 7r + 1 = 2r for w. -1 Let l = 168 + -158. Suppose 0 = 9m - 7m - l. Solve 5k + 7 = 2n - 12, -mn = k - 7 for n. 2 Let p be 0/(-1) + (67 + -2 - -7). Let l = -68 + p. Solve -2q = 2w + 3q - 13, 4q = 2w - l for w. 4 Let i(t) = t + 4. Let n be i(-3). Let z = 80 - 128. Let d be ((-2)/4)/((4/1)/z). Solve -3h + d = 5r + n, -5 = 5r + 5h for r. 4 Let a be 15(-1 + 3)/6. Let p(s) = -12s - 346. Let u be p(-29). Solve 3z - 3 = ac, -3c + uz + 2 = 4z for c. 0 Let z = 3651 - 3646. Solve -3u = -4u - 5x - 25, zu = 3x + 15 for u. 0 Let d(i) = 3i + 17. Suppose 40 - 16 = -6t. Let x be d(t). Solve -b + 4 = -o, -xb = -0b - o - 24 for b. 5 Let d = 471 + -467. Suppose 0 = -dr + 5f + 19, r - 4f = -0f + 2. Solve -11 = 2x - 3o, 2x - o - 13 = -ro for x. -1 Suppose i - 3 = 0, 2f - 6f + 4i + 24 = 0. Solve 2d + f = -4h - 13, 2h = -4d - 26 for h. -3 Suppose -2n - 2h - 8 = 0, -4n + 20 = 5h + 44. Solve -no - 110p = -114p + 24, 2p = o + 11 for o. -1 Suppose 9h + 2788 = 565. Let a = h - -269. Solve 0w + w - a = 4s, 0 = 5w + 2s for w. 2 Let j be 7/(-2)(-6)/218. Let i be 27/9 + j/4. Let k be 1/2(6 - 2). Solve ia + 2m + 3 + k = 0, 5a = -5m + 10 for a. -3 Suppose -16p - 8p = -48. Let q(z) = -10z + 23. Let b be q(p). Solve o + 10 + b = 4f, 5f + 5 = -3o for o. -5 Suppose -6k + 2 = 4g - 8k, g - 5k = -22. Solve 3z + 12 + 5 = 5y, 0 = gy + 3z + 9 for y. 1 Let i be 72 + (7 - (15/(-5))/(-1)). Let n = 81 - i. Solve 0 = z - nz - 5a - 13, 3z - 5a + 1 = 0 for z. -2 Let p(a) = a*3 - 2a*2 - 6a - 4. Let d be p(-1). Let q be 7/(6 + 1) - d. Solve 4o + 6 = qn - 8, -4 = 3o + 5n for o. -3 Suppose 2a + 81w - 79w - 14 = 0, 5a + 3w = 41. Solve -13o - 3m - a = -9o, 0 = -4o - 4m - 8 for o. -4 Suppose 916g = 823g. Solve 4t + 2 = 3t + k, g = -5k + 15 for t. 1 Let h(w) = -4w*3 + 6w - 20. Let c be h(2). Let l be ((-10)/c)/(4/64). Solve j - 2j + 4s = -20, 4s = -3j - l for j. 4 Let k(w) = 9w - 108. Suppose 74 = 5d + 5m + 24, -2d + 18 = 3m. Let p be k(d). Solve 2b = q + 4q + 5, p = b for q. -1 Suppose -2y - 3u = 53 - 79, 4u - 30 = 2y. Solve 15 = -3h, h + 2 = 4s + y for s. -1 Let b = -657 + 661. Let n(l) = -l3 + 8l*2 - 3l - 21. Let u be n(7). Solve 4q = -2i - 4, bi - u = -0q - 3q for i. 4 Let f = -3054 - -3056. Solve fq = -8, 2q + 28 = -i - 3i for i. -5 Let r(g) = -7g + 69. Let p(m) = -8m + 65. Let d(y) = -3p(y) + 2r(y). Let h be d(6). Solve 2z = 0, 5k + 5z = hz for k. 0 Suppose 0 = -0y + 2y - 12. Let a(w) = w*3 - 4w*2 - 11w + 3. Let h be a(y). Let u be h/((-27)/2)-6. Solve 5l = -g + 3g - 18, 3l = -ug + 10 for l. -2 Let k = 634 - 372. Let i = k + -259. Solve -ic - 12 = -3a, 2c + 4 = -4 for a. 0 Suppose 25x = 20x + 30, -3v = -3x - 156. Solve 4i - u - 25 = 0, -vi - 5u = -53i for i. 5 Let d be (-18)/(-4)8/6. Let y be -14(2 - 6). Suppose -3b + y = -k, 19 - 5 = 3b + k. Solve -t = bm - 21, -t + 0m = 2m - d for t. -4 Let s(a) be the first derivative of 2a3/3 - 17a*2/2 + 11a - 1. Suppose -90 = u - 99. Let o be s(u). Solve 5w - 23 = 2, 0 = -2g + 2w - o for g. -5 Let n = -5516 + 5509. Let l(q) = -q2 + q + 168. Let r be l(0). Let d be 72/r - (39/n - -1). Solve 0b + 5b - dx - 15 = 0, 2x = 5b for b. -2 Let b = -52 - -56. Suppose 4t = 4q - 12, t = -3t - 4. Suppose -3s = -k + 14, 19 = 2k - qs - s. Solve 5u - 16 = bj - 3, -5j = 5u + k for j. -2 Suppose 2q - 1 = g, -19 = -5g - 41q + 43q. Solve 4x = -3c + 6x - 9, 0 = -gx for c. -3 Let i(z) = 7z - 693 + 389 + 286. Let w(j) = -j2 - 3j + 3. Let v be w(-3). Let q be i(v). Solve 5k - 4 = -qr - 5, 0 = -5r - 5k - 5 for r. -2 Suppose 5p - 33 = 4n, -4n + p - 3p = -2. Let l be 5 + -3 + (-1 - n - -2). Solve -lr - 2h = 21, 2r + 3h + 2 = -h for r. -5 Let d(t) = 3t + 40. Suppose -78 = -2i + 8. Let j = i + -55. Let z be d(j). Solve 4r + 2p = 2, -2p = -4r + 7r - z for r. -2 Suppose -5o - 2y = -43, 20 = 5o - 2y - 7. Solve 5b + 23x - 25x + 16 = 0, ob + x = -11 for b. -2 Let d be (4 + -7 - -2)0. Suppose d = -4b + 3p + 30, -5p - 22 = -b - 6. Suppose -21 + b = -5n. Solve -4m - m - 3f = -n, 0 = -4m + 5f - 5 for m. 0 Let u be (6 + (-84)/14)/(-12). Solve -14 = -p - 4p + g, u = -2p - 4g - 12 for p. 2 Let k be 133/70 - 22/(-220). Solve 3u - 1 = 5f + 7, -ku + 6 = -4f for f. -1 Let u = 11304 - 11275. Solve -5a - 62o + 59o + u = 0, 0 = 5a - 5o - 5 for a. 4 Let v(k) = 21k + 23. Let a be v(-1). Suppose ac = -2h + 30, -6c + 8c = -4h + 50. Solve 0t = 3t + 2p + h, 5p = -3t - 16 for t. -2 Let l be (-17)/(-3) + (-4)/(-12). Let u(x) = 3x - 8. Let z be u(l). Let c = 0 - -5. Solve 2k - z = -5h, -ch = k - 2k - 25 for k. -5 Suppose 15y - 31y + 1568 = 0. Let n be ((-336)/y)/((-8)/42). Solve 4x = -2o + 2 + n, 0 = 2x - 3o - 2 for x. 4 Let q(p) = p*2 + p - 2. Let i be q(2). Let j = 1448 - 1440. Suppose -2t + 3m + j = 0, -t - 3m = m - i. Solve a - 6 = -2u - 0, 0 = -3a + u + t for a. 2 Let d = -398 + 402. Solve dj = -4, -3h - 23j = -24j + 8 for h. -3 Let k be (4 - (-63)/(-15)) + (-1)/(-5). Suppose k = -t + 15 - 6. Let d be (0 + -1)(8 + -8). Solve i + di + n = -t, -3n - 12 = 0 for i. -5 Suppose -5r = 3n - 43, 2r - 2 = -2n + 8. Solve 0 = -4c + 3x - 12, 2 = 4c - 5x + r for c. -3 Let k be ((0/(2 + -5))/(-2))/(4 - 5). Suppose -3o = -2o - 21. Solve g + 3h - o = -6, k = 4g - h + 5 for g. 0 Let o(b) = b3 - 9b*2 + 9b - 13. Let j be o(7). Let h be 2/42 - j/12. Solve y + 2i + h = 0, 2y - 3i + 2i + 5 = 0 for y. -3 Let o = -13289 - -13301. Solve 2k - 6 = -4l, 51k = 49k + 5l - o for k. -1 Suppose 3l - 29 = 2n - 0n, 2l - 3n = 16. Suppose -lo + 30 = -14. Let d = 3 - -4. Solve -dy = -2g - oy - 8, 5g - 3y + 11 = 0 for g. -1 Let z = 353 - 349. Suppose -n = 2h - 4, -n + z = -6h + 10h. Solve 3k - 3r - 30 = h, -k - 2r - 10 = r for k. 5 Suppose 15k = 21k - 47k + 82. Solve ku - h = 2 - 15, 5h + 5 = 0 for u. -7 Let d = -95 + 63. Let h = d - -36. Solve 23 = 2y + 5k, 0y + hk - 8 = y for y. 4 Let h be 18/27(2 - (-2)/2). Suppose hq - 3 = 7. Let v = q + 7. Solve -5r + 4g = -v, -4r + r + 3g + 9 = 0 for r. 0 Let b = 693 - 668. Suppose 8 = -7w + 11w. Solve -12 = 3q + wy, 5q - 5 + b = -4y for q. -4 Let y be (-38 - -37)(0/(-7) - 2). Solve s = -4g + 16, -ys + 2g = -3g + 20 for s. 0 Let p be (-2)/(-11) + 243/297. Let z be 11 + -3 + p/((-4)/12). Solve -5 = -n, 2h - zn = 6h - 45 for h. 5 Suppose 5 = q + 4x - 0, 20 = 4q - 3x. Let g be (-2)/(-2) - (8 + 3). Let m = -6 - g. Solve ms + 8 = 0, 0 = -4j - 0j + qs + 26 for j. 4 Suppose -j + 1 = 4. Let f be j + 45/6 - 2/(-4). Solve fz = -2u - 10, -3z = -2z + 3u + 2 for z. -2 Suppose 4a = 2r - 14, 16 = 4r + 4a - 0a. Suppose -2n = -rz + 19, z = 2z + n - 1. Solve k + 2f - 6 = -0k, 2k - zf + 23 = 0 for k. -4 Suppose 15r = 4r + 55. Let a = -77 - -49. Let j = 37 + a. Solve -3k = -d - 3d + 16, -rd = -k - j for k. -4 Suppose -114y = -113y - 51. Suppose -6k + y = -87. Solve k - 3 = 5d - 4b, 0 = 3d + 5b - 12 for d. 4 Suppose -6g - 9g + 1515 = 0. Suppose 6t - 203 = -g. Solve 3i + y = t, -7y = -2y - 25 for i. 4 Let j = 410 + -185. Let w = j - 225. Suppose -o - 5 = -4u, 0o + 4u = -3o + 33. Solve d - o = 3s, wd + 18 = 2s + 5d for s. -1 Let w(j) = 2j + 23. Let v be w(17). Suppose -4t = -5u - 46 + v, -13 = -5u + 2t. Solve -um - 12 = 4z, -4z + 3z - 3 = 3m for z. -3 Let k = -10 - -12. Suppose k = 4g - 6. Let j = 7723 - 7718. Solve a + 6 = gn - 2a, 4n - 12 = -ja for n. 3 Suppose 81d - 107 - 168 = 26d. Suppose -29 = 5k + 1. Let w be ((-34)/k)/((-1)/(-3)). Solve 0t + w = -4r + t, dr = -t - 19 for r. -4 Let w(v) = -2v*3 - 4v*2 - 4v. Let h be w(-3). Let a = 34 - h. Suppose -m + a = m. Solve -3 = -5x + 5y - 2y, 3x - my - 2 = 0 for x. 0 Suppose g + 34 = 40. Let o(b) = -b2 + 3b + 2. Let v be o(4). Let y = v + g. Solve 3r + x = y, -r = -4x + 5x - 4 for r. 0 Let n = -22 - -66. Suppose 30 = 47q - nq. Suppose 2 = 4l - q. So	{ "pile_set_name": "DM Mathematics" }
/3 Simplify (sqrt(900) - (sqrt(900) - (sqrt(900) - (2sqrt(900) - sqrt(900))-6)))/((-2sqrt(200))/sqrt(10)). -21sqrt(5)/2 Simplify -2 + 1(-1 + -5(sqrt(468) + 1 + sqrt(468))2)2. 2640sqrt(13) + 187319 Simplify 5((sqrt(468) - sqrt(468)-3) + -4 - (sqrt(468) + 0)-4)2 + 2. -1920sqrt(13) + 149842 Simplify (((sqrt(847) - (sqrt(847)1 + 5)) + -3 + sqrt(847) + -1 + -3)-6)*2. -9504sqrt(7) + 35676 Simplify ((sqrt(56)1)/sqrt(4) - sqrt(56)-2)/(sqrt(16)/((sqrt(32) - sqrt(8) - sqrt(8) - sqrt(8) - sqrt(8)) + sqrt(8)) + sqrt(18)-2). -5sqrt(7)/7 Simplify 0 + (sqrt(700) + 1)-4 + 1 + -4. -40sqrt(7) - 7 Simplify ((sqrt(132)/sqrt(4)-2 - sqrt(33))1)/(sqrt(432) + -2sqrt(432) + sqrt(432) + sqrt(432) - (1sqrt(432) + sqrt(432))). sqrt(11)/4 Simplify -4 + sqrt(44)/(sqrt(8)/(sqrt(4)/sqrt(2) + sqrt(2)))-1 + 0. -2sqrt(11) - 4 Simplify (sqrt(306)1)/(sqrt(12)/(sqrt(42)/sqrt(7))). 3sqrt(17) Simplify 2(5 + (2(sqrt(200) + sqrt(50))*2 - (sqrt(72)/sqrt(3)-6)/sqrt(12))). 12sqrt(2) + 1810 Simplify (sqrt(121) + sqrt(121)1)/sqrt(11) + sqrt(44)/sqrt(4) + 5 + (-5sqrt(11)-15)2. 3sqrt(11) + 6880 Simplify (-1(sqrt(147) + sqrt(147) + -3(-2 + sqrt(147)) + sqrt(147) + -5(sqrt(147) - (2 + sqrt(147))) + sqrt(147))4)*2-4. -25792 - 14336sqrt(3) Simplify (-4 + (sqrt(30)/sqrt(108))/(sqrt(35)/(sqrt(7)3)))*2. -4sqrt(2) + 33/2 Simplify (4(-3(-1 + sqrt(112)) - (1sqrt(112) + sqrt(112) + -5)) + -1)2. -4960sqrt(7) + 45761 Simplify ((1sqrt(1584) - sqrt(1584))-5)*2 + -3sqrt(110)/(sqrt(10) + sqrt(40)/sqrt(4) + sqrt(10) - sqrt(10)). -3sqrt(11)/2 Simplify 2((sqrt(462)/(sqrt(88)/sqrt(8)))/(sqrt(432)/sqrt(8)))*2. 14/9 Simplify ((-4sqrt(704) + -4)5 + -5)2. 8000sqrt(11) + 282225 Simplify ((sqrt(3584) - -1sqrt(3584)) + sqrt(224) + sqrt(224)-2)/(-2sqrt(648)2). -7sqrt(7)/18 Simplify (1sqrt(77)-1-2)/(sqrt(189)/sqrt(3) + sqrt(21)/sqrt(3)-5). -sqrt(11) Simplify (2 + 2 + sqrt(847) + 3 + 1)2. 176sqrt(7) + 911 Simplify ((sqrt(672)2)/sqrt(12) + sqrt(56) + (sqrt(2016) - (sqrt(2016) + sqrt(2016)2)))/(sqrt(56)/(sqrt(1008)1)). -108sqrt(7) Simplify 3(sqrt(1100) + (4 + sqrt(1100) - sqrt(1100)) + -3 - (1((sqrt(1100)-4)2 + sqrt(1100)) - sqrt(1100))). -52797 + 30sqrt(11) Simplify (sqrt(17) + sqrt(34)/sqrt(2)-1 + sqrt(17) + -1 - (5sqrt(68) + -2)*2)5. -8525 + 205sqrt(17) Simplify (sqrt(30) + 1sqrt(30)-4)/(sqrt(60)/(sqrt(48)/sqrt(8)))-5. 15sqrt(3) Simplify (5 + sqrt(176) + 2 + sqrt(176))2 + (sqrt(264)/sqrt(6)-1)*2. 112sqrt(11) + 797 Simplify (5(sqrt(576) - 1sqrt(576)))/(31sqrt(972)). 0 Simplify -3 + sqrt(32) + -4 + 3 + -5sqrt(8). -6sqrt(2) - 4 Simplify -2 + ((3sqrt(400)1 - sqrt(400))/(4-6sqrt(16)/sqrt(2)))*2. -119/72 Simplify ((sqrt(363) + 4sqrt(363))-4)2 + (14sqrt(75))2. 146400 Simplify -3(-5 + (sqrt(833) + sqrt(833) + 0 + sqrt(833) + -1)*2). -22479 + 126sqrt(17) Simplify ((-2sqrt(66)-42)/(sqrt(600)-3-1 - sqrt(600)))2. 176/25 Simplify (-2(sqrt(68) + 2sqrt(68) + sqrt(68)) - sqrt(68) - (sqrt(68)1-6 + sqrt(68)))/(sqrt(8)/(-2sqrt(98))). 56sqrt(17) Simplify ((sqrt(2) + sqrt(2) + (sqrt(242)1 - sqrt(242)) + sqrt(2))1)2 + (sqrt(288) + 2)2 + 1. 48sqrt(2) + 311 Simplify ((sqrt(32)2)/sqrt(2))/(2sqrt(648)). sqrt(2)/9 Simplify 1(-2 + ((1sqrt(300)1 + 5)-3)*2). 900sqrt(3) + 2923 Simplify -5 + ((-1 + sqrt(2))-14 - (sqrt(2) - sqrt(14)/(-1sqrt(7)))3). -10sqrt(2) - 1 Simplify ((sqrt(60)/sqrt(4) + sqrt(15))-2)/(sqrt(3) - (sqrt(3) + sqrt(27))6)-6. -24sqrt(5)/23 Simplify (sqrt(405) + -2 - sqrt(35)/(-1sqrt(7)))*2 + -3 + (sqrt(5) - (5 + sqrt(35)/sqrt(7))). -40sqrt(5) + 496 Simplify (4 + -1sqrt(2057) + 1)-46. -120 + 264sqrt(17) Simplify (sqrt(133)2-3 - sqrt(133)26)/(26((sqrt(7) - sqrt(14)/sqrt(2)) + sqrt(7))). -3sqrt(19)/2 Simplify (sqrt(3520) + -4-2sqrt(3520))/(sqrt(110)/(-1sqrt(10)1)). -72sqrt(5) Simplify ((2sqrt(360))/sqrt(8) - sqrt(495)/(-1sqrt(11))) + 5sqrt(45)4-2. -111sqrt(5) Simplify -2 + sqrt(1300) + 5 - (-5 + (sqrt(832) - 1sqrt(832)) - sqrt(832)). 8 + 18sqrt(13) Simplify (1sqrt(156)/(sqrt(12)2))*2 + sqrt(130)/(sqrt(10) + 4(sqrt(10) - sqrt(10)-3)). sqrt(13)/17 + 13/4 Simplify (2 + 4 + -3 + sqrt(44))5. 15 + 10sqrt(11) Simplify (sqrt(648) + (sqrt(648) - (sqrt(648) - (sqrt(648) - (sqrt(648) - (3 + sqrt(648))))2)) + 3 + (sqrt(8) - (sqrt(8) + (sqrt(8) - sqrt(8)-2))))5. 600sqrt(2) + 3300 Simplify ((sqrt(1408) - sqrt(1408)-1)1)/(2sqrt(6050)). 8sqrt(11)/55 Simplify ((sqrt(22) + sqrt(198))-5)/(sqrt(22)/(sqrt(55)/sqrt(5))). -20sqrt(11) Simplify ((sqrt(119) - (sqrt(119) + sqrt(119)-3 + sqrt(119)))/sqrt(7) - (sqrt(34) - 4sqrt(34))/sqrt(2)) + 3. 3 + 5sqrt(17) Simplify 1((sqrt(19) - sqrt(171)4 - sqrt(19)) + sqrt(171) + sqrt(171)-3). -18sqrt(19) Simplify ((-2sqrt(77)4-1)/(sqrt(77)/(-1sqrt(11))-2))*2. 176 Simplify -2(1sqrt(88)-6 + sqrt(88) + sqrt(88) - 2sqrt(88)1)/(5sqrt(200)6). 2sqrt(11)/25 Simplify (0 + sqrt(3) + -4)5 + 4 + -2. -18 + 5sqrt(3) Simplify 1 + (sqrt(132) - (sqrt(132) - (sqrt(132) + 1sqrt(132)5)))/(sqrt(12) - (sqrt(300) - 2sqrt(300))). 1 + sqrt(11) Simplify (-441sqrt(143))/(sqrt(1584)-1-1). -4sqrt(13)/3 Simplify (sqrt(1458)-1-3)/((sqrt(9) - 3sqrt(36)/sqrt(4)) + sqrt(45)/(sqrt(20)/sqrt(4))). -27sqrt(2) Simplify -1 + (((1sqrt(33) - sqrt(33))-4)/sqrt(11) - -5(0 + sqrt(75)))2. 1874 Simplify -4 + -4 + sqrt(304) + (2 + sqrt(304))2 + -3 + -1. 20sqrt(19) + 296 Simplify ((sqrt(130) + (sqrt(130) - (sqrt(130) + -6(sqrt(130) - (sqrt(130) + sqrt(130)1) - sqrt(130)) + sqrt(130))))-1)/(6sqrt(640)-3). -sqrt(13)/12 Simplify (sqrt(78)/sqrt(2))/sqrt(3) + 4(sqrt(13) + (sqrt(78)/sqrt(6) - sqrt(13))) + ((sqrt(13) - -2sqrt(13))3 + sqrt(208) + -1)*2. -21sqrt(13) + 2198 Simplify (6sqrt(240)/sqrt(4))/(sqrt(48)/sqrt(64))5. 120sqrt(5) Simplify -4(-1sqrt(15))/sqrt(5) - (1 + (sqrt(3) - sqrt(12)/sqrt(4) - sqrt(3))5)*2. -76 + 14sqrt(3) Simplify (-3(3(sqrt(52) - sqrt(52)-2) + sqrt(52)))/(sqrt(36)/(sqrt(63)/((sqrt(7)-3 - sqrt(7)) + sqrt(7)) - sqrt(9))). 40sqrt(13) Simplify 61sqrt(468)2 + -1 + 5. 4 + 72sqrt(13) Simplify (4sqrt(24) - ((sqrt(108)/sqrt(2))/sqrt(9) - sqrt(6)))/(sqrt(6)/(sqrt(3) - (sqrt(147)2 - sqrt(147)))). -48sqrt(3) Simplify (5(sqrt(612) - -2(-1sqrt(612) - sqrt(612))) + 0)2. 137700 Simplify (2 + -3 + 2 + sqrt(1377) + sqrt(1377)-2)*215. -90sqrt(17) + 6890 Simplify (3 + (-3 + (3 + sqrt(704) - sqrt(704)) + sqrt(704) - (-3sqrt(704)4 + sqrt(704))) + -4)*2. -192sqrt(11) + 101377 Simplify ((-3 + sqrt(38)/sqrt(2) + (sqrt(19) - 6sqrt(76)/sqrt(4)) + sqrt(19))-3)*2 - (-3 + ((sqrt(171) + (-1sqrt(171) - sqrt(171)))-6)/sqrt(9)). 156sqrt(19) + 1623 Simplify (4(sqrt(3) + 1) + (sqrt(12) - sqrt(108))/sqrt(4))2 - 2(sqrt(3) + -3 + 2). 14sqrt(3) + 30 Simplify 5 + (1sqrt(360) + sqrt(360))/(sqrt(500) + (-1sqrt(500) - sqrt(500) - sqrt(500)) - sqrt(500)). -2sqrt(2)/5 + 5 Simplify sqrt(55)/(sqrt(55)/sqrt(5)) + 1 + (-1(2 + 0 + sqrt(5)))2. 10 + 5sqrt(5) Simplify (5 + sqrt(11)3 + sqrt(11) - (-1 + sqrt(11) + -5) - 4((sqrt(11) - sqrt(66)/sqrt(24)) + sqrt(11) + sqrt(99)2))2. -594sqrt(11) + 8140 Simplify -5(-3sqrt(98)/sqrt(2))/((sqrt(49)-2)/sqrt(7))-6. 45sqrt(7) Simplify (-23sqrt(65) - sqrt(65))/(6sqrt(5)1)1. -7sqrt(13)/6 Simplify ((0 + (sqrt(1900)1 - sqrt(1900)) - (1 + (sqrt(1900) + -3)*2 + sqrt(1900))) + -5)-5. -250sqrt(19) + 9575 Simplify (sqrt(2057) + 4(sqrt(2057) + -2sqrt(2057)) + -1 + (sqrt(2057) + -2 + -5 - -1sqrt(2057)2))2. 64 Simplify (((3sqrt(210) - sqrt(210))5)/sqrt(6))/((sqrt(720)1 - sqrt(5))6). 5sqrt(7)/33 Simplify -5((sqrt(104) - sqrt(104)1 - sqrt(104) - sqrt(104))5 - sqrt(104))/(sqrt(8) - sqrt(56)/sqrt(28)). 110sqrt(13) Simplify -3(5 + -1(sqrt(13) + (sqrt(13)2 - sqrt(13))2))-2. -48 - 6sqrt(13) Simplify (((sqrt(52) + -2(sqrt(52) - sqrt(260)/sqrt(5)))/sqrt(4)2 + 5)4)*2. 320sqrt(13) + 1232 Simplify ((2sqrt(80)-4 + sqrt(80))/sqrt(2))/(2sqrt(8)-1 + sqrt(648)-2). 7sqrt(5)/20 Simplify -4(-6(sqrt(75)-2)2 + sqrt(12)/(-2sqrt(4) - sqrt(4)) + 4) + 0. 4sqrt(3)/3 + 7184 Simplify sqrt(19) - (sqrt(19) - (sqrt(684)2)*2) - sqrt(513)/sqrt(3) - (-5 + -6sqrt(114)/sqrt(6)). 3sqrt(19) + 2741 Simplify (sqrt(80) + 1 + sqrt(80))-6 + (sqr	{ "pile_set_name": "DM Mathematics" }
09732.999974. Let j = 53 + -22. Let u = j - s. Round u to 5 dps. 0.00003 Let g = 36704.09923 - 36604.1. Let b = -39 + -61. Let s = g + b. What is s rounded to four dps? -0.0008 Let c be (-623)/(-5) - 12/(-30). Let m = -235 + c. What is m rounded to the nearest 10? -110 Let a = 2.575 + -2.5. What is a rounded to 2 decimal places? 0.08 Let z(w) = 14249w - 1. Let c be z(8). Suppose -3y + 170137 = -2x - 857, -2y = -3x - c. What is y rounded to the nearest ten thousand? 60000 Let f = 17 - 15. Suppose 0 = -3o - fo + 69000. What is o rounded to the nearest 1000? 14000 Let g = -153 - -84.6. Let b = g - -60. What is b rounded to zero decimal places? -8 Let v(n) = -81999n + 5. Suppose -9 - 2 = 3a - 2o, 2a + 6 = 2o. Let d be v(a). Round d to the nearest 100000. 400000 Let l = -3 - -3.8. Round l to one dp. 0.8 Let d(i) = i*2 - i - 3. Let f be d(3). Suppose -2v + 6723 = -5l - 452, -fv = -l - 10795. What is v rounded to the nearest 1000? 4000 Let q = -0.259 + 56.159. Let b = 10.9 - q. Let o = b - -45.000066. What is o rounded to five dps? 0.00007 Let z be 382500/(33/12 + 1 + -4). What is z rounded to the nearest one hundred thousand? -1500000 Let w = 8.7988 + 0.0412. Let x = -0.08 - -9.08. Let j = w - x. Round j to 1 dp. -0.2 Let o = 18.142 + -18. Round o to two dps. 0.14 Let i = 0.166 + -0.166218. Round i to five decimal places. -0.00022 Let x = -0.006 + -63.994. Let y = x - -64.071. Round y to two decimal places. 0.07 Suppose 3v - 5c + 155042 = 35067, -4v + 4c - 159980 = 0. Round v to the nearest 100000. 0 Suppose 5b - 16620010 = 3w, -4b + 9b = 10. What is w rounded to the nearest one hundred thousand? -5500000 Let i(z) = 20z + 10. Let o(x) = -x2 + 4x. Let k be o(6). Let t = 4 + k. Let q be i(t). Round q to the nearest 100. -200 Let p = 73.49999639 + -73.5. Round p to 7 dps. -0.0000036 Let r = -2 + 1.9. Let k = 0.08 + -1.78. Let u = r + k. Round u to 0 dps. -2 Suppose -5s - d = -0d + 520002, 2d = -s - 104004. Round s to the nearest 10000. -100000 Let s = 6.6 + 39.4. Let w = s + -46.0000118. What is w rounded to 6 dps? -0.000012 Let v = 77.00081 + -77. Round v to four dps. 0.0008 Let v = -0.675 - -0.105. Round v to 1 dp. -0.6 Let b = -25 + 137. Let o = 112.00057 - b. What is o rounded to four decimal places? 0.0006 Let j = -4.22 + 6.2. Let o = 2 - j. What is o rounded to 2 dps? 0.02 Let g = 0.99 - 0.9. Let q = g + -5.39. What is q rounded to the nearest integer? -5 Let b = 19.5 - -0.5. Let t = b - 11. Let w = t + -8.99999953. What is w rounded to 7 dps? 0.0000005 Let v = 61 - 60.999999. Round v to 5 dps. 0 Let o = -0.275 + 0.005. What is o rounded to one dp? -0.3 Let q be (-9)/1241. Let f(h) = -2h - 2. Let o be f(q). Suppose -15000 = oc - c. What is c rounded to the nearest one thousand? -5000 Let y = 0.5424 + -0.6. What is y rounded to two dps? -0.06 Let m = 20 + -7. Let a = m - 13.1. What is a rounded to 0 dps? 0 Let z(i) = -i3 + 5i*2 + 5i + 6. Let p be z(6). Let w = p + -9. Let x(f) = -6050f2 - 6f - 4. Let a be x(w). What is a rounded to the nearest 100000? -500000 Let v = 18.4 + -18. Round v to 1 decimal place. 0.4 Let k = 44266 - 8755. Let j = k - 35509.20072. Let a = 1.8 - j. What is a rounded to four decimal places? 0.0007 Let w = -11 + 10.9932. Round w to three dps. -0.007 Let m be 5/(-2)(-4)/10. Let g(w) = 56624w3 - w2 - w + 1. Let q be g(m). Suppose -q = -v - 156623. What is v rounded to the nearest 100000? -100000 Let n = -0.351 - -0.35271. Round n to four dps. 0.0017 Let l = 206.0000099 - 206. What is l rounded to 6 dps? 0.00001 Let l = 1 + -1. Let y be l - (-6)/3 - -466. Suppose 68 - y = -5u. Round u to the nearest ten. 80 Suppose 2z - 6z = -11200000. Let l be z/(-6)33/(-2). What is l rounded to the nearest 1000000? 8000000 Let m = -2.88 - 353.12. Let c = 359.99 + m. Let n = 3.3 - c. Round n to 1 decimal place. -0.7 Let k(g) = g*2 + 3. Let p(n) = -n + 5. Let v be p(5). Let x be k(v). Suppose -2l + xl - 610000 = 0. Round l to the nearest 100000. 600000 Suppose 2z + 0z = 0. Let i be (-382)/(-2) + 1 - z. Let a = -358 - i. What is a rounded to the nearest one hundred? -600 Let b = 15.4 - 1.4. Let j = 17.3 - b. What is j rounded to 0 dps? 3 Let z = -0.07 + 2.07. Let o = z - 1.99804. Round o to four dps. 0.002 Let n = -0.2395 - -0.39. Let m = 32.7005 - n. Let k = -34 + m. What is k rounded to one decimal place? -1.5 Let i = -219644 - -78932. Let b = i + 248712. Round b to the nearest 10000. 110000 Let b = -0.177 - 2.893. Let v = 3 + b. Let w = v + 0.0715. Round w to three dps. 0.002 Suppose -5m + 3t = -1750003, -4 = t - 3. Round m to the nearest 100000. 400000 Let w(f) = 26f + 2. Let j(x) = 8x. Let c be j(1). Let z = c - 5. Let s be w(z). What is s rounded to the nearest 10? 80 Let g = -0.00768 - -0.006. Round g to 4 dps. -0.0017 Let i = -0.6 - 0.9. Let v = i - -1.596. Round v to two decimal places. 0.1 Let f(s) = 2s*3 - 28s*2 - 5s - 15. Let x be f(19). What is x rounded to the nearest 1000? 4000 Let x(a) be the first derivative of a3/3 - a2/2 + 30000a - 21. Let u = 2 + -2. Let d be x(u). Round d to the nearest one hundred thousand. 0 Let m = 4 - 5.14. Round m to one decimal place. -1.1 Let y = -80 + 83.0001. Let u = -3 + y. What is u rounded to 4 decimal places? 0.0001 Suppose s + 12 = -3. Let z be s/9 + 2/(-6). Let q(t) = -80000t3 - t2 - 2t. Let g be q(z). Round g to the nearest 100000. 600000 Suppose 0i + 4z + 4 = -3i, -2i + 2z = 26. Let f be (-16)/i + (3998 - 0). Round f to the nearest 10000. 0 Let m = -1284454.9894 - -1284344. Let n = -111 - m. Round n to 3 dps. -0.011 Let t = 621 - 620.99999677. What is t rounded to 7 dps? 0.0000032 Let i = -0.474 + -2.936. Round i to one decimal place. -3.4 Let n = -6.04 - -6. Let f = 0.04 + n. Let u = f + 0.000084. What is u rounded to five decimal places? 0.00008 Let x = 0.371 + -0.38. Round x to 3 dps. -0.009 Suppose 2k = 4k + 4448. Let i = 27776 - k. Round i to the nearest 10000. 30000 Let x(k) = 8k3 - 9k*2 - 9k. Let o be x(-8). Round o to the nearest 1000. -5000 Let y(g) = g*2 - 15g + 8. Let m be y(14). Let l be (-33200)/m(-8 + 23). Round l to the nearest 10000. 80000 Let h = -15 - -11. Let v = 8955.9992 - 8960. Let j = h - v. Round j to 3 decimal places. 0.001 Let g = -96.2 - -73. Let a = -24.17 - g. What is a rounded to one decimal place? -1 Let o = 119 + -83. Let h = o - 23. Let k = h + -13.00014. What is k rounded to 4 dps? -0.0001 Let j = -5 - -1. Let i = -4907900.000011 + 4907896. Let l = i - j. Round l to five decimal places. -0.00001 Let z = -0.6 + 2. Let k = 1.385 - z. Round k to two dps. -0.02 Let m = 4.3 - -0.7. Let c = -9 + m. Let k = c + 4.00064. Round k to 4 dps. 0.0006 Let q = 1935.9 + -2044. Let b = -116.897 - 0.103. Let r = b - q. Round r to 0 decimal places. -9 Let x = -14 - -13.89. Let b = x - -0.0944. What is b rounded to three decimal places? -0.016 Suppose 0 = -c - c. Suppose 5 + 0 = 5d. Let k be (c - d - -1) + 6600. Round k to the nearest one thousand. 7000 Let v = 9 + -9.04. Let n = 0.03 - v. Round n to one decimal place. 0.1 Let l = -358261.259987 + 358261. Let v = 2.9 - 2.64. Let y = l + v. What is y rounded to five dps? 0.00001 Let k = 13 - 13.7. Round k to one decimal place. -0.7 Let v be 11/4 + 12/(-16). Suppose 2b = vm + 1765299 - 525297, 0 = -2m + b - 1240001. Round m to the nearest 100000. -600000 Let v = -7 - 1. Let o = 7.99952 + v. What is o rounded to four dps? -0.0005 Let k = 1.57 - 1.7. Let b = 0.35 - k. Let i = b - 0.479981. What is i rounded to 5 decimal places? 0.00002 Let x(b) = -9b3 + b2 - 5b - 5. Let l be x(5). What is l rounded to the nearest 100? -1100 Let y = 531 - 520.84. Let r = y - 10. Round r to one dp. 0.2 Let z(a) = a - 1. Let l be z(3). Suppose lr - 1605368 = -5u, r - 2u = 363944 + 438749. Suppose r + 257311 = q. Round q to the nearest one hundred thousand. 1100000 Let y(f) = f + 3f + 53f*2 - 4f - f - 4. Let n be (2 - 1) + -6 - 2. Let x be y(n). What is x rounded to the nearest 1000? 3000 Let o be 4 - (-1 - 1 - -4). Suppose 0 = 3c + oc + 3077010. Let b = -955402 - c. Round b to the nearest one hundred thousand. -300000 Let k be (-2)/(-8) + (-1)/4. Suppose k = -2w, -2v + 12 = -4v + 4w. Let y(l) = 55l2 - 4l - 4. Let b be y(v). Ro	{ "pile_set_name": "DM Mathematics" }
. -1 Rearrange -113m - 15m + 38m to the form o + xm and give x. -90 Express 11s - 4s - 17s - 3s*2 + (-1 - 1 - 1)(2s2 + s2 - 2s*2) in the form ms + g + ps2 and give m. -10 Rearrange 4v - 3v + 10v + 25v to x + gv and give g. 36 Rearrange 2t2 - 2t*2 - 6t*3 + (-3 + 5 + 0)(7t2 - 2t*3 - 7t*2) to the form r + jt + dt3 + qt*2 and give d. -10 Rearrange (-3p2 + p2 - 13p2)(2 - 1 - 6) to s + kp2 + rp and give s. 0 Express 16n + 15n*2 - 16n in the form t + rn2 + wn and give r. 15 Rearrange -8n + 14n - 8n to x + rn and give r. -2 Rearrange -116n + 4638 - 4638 - 3n to tn + p and give t. -119 Express -33 + 33 + 64s as us + p and give u. 64 Express (-2y - y + y)(76 - 4y*2 - 76 - y) in the form ly*3 + sy*2 + fy + q and give l. 8 Rearrange -3n3 + 0n3 + n3 + (2 - 2 - 2n3)(21 - 37 + 27) to wn3 + m + dn + cn2 and give w. -24 Express (-3 + 4 + 2)(-3x + 4x - 2x) + (2x - 3x - 2x)(4 + 0 - 6) + 4x - 4x - 4x as q + vx and give q. 0 Express (-2 + f + 2)(-2 - 4 + 1) - f - 4f + 3f as yf + d and give y. -7 Express -4a*2 + 19a*2 - 3a*2 as x + wa + la2 and give l. 12 Express 26i + 27i + 11i in the form pi + w and give p. 64 Express (3 - 4 - 1)(5o - 2o - 2o + (-1 + 0 + 0)(10o - 8 + 8)) in the form jo + x and give x. 0 Rearrange -3q2 + 71 + 0q*2 - 61 to the form aq + k + nq2 and give n. -3 Rearrange 4 - 4 + 3t - 21t to the form l + st and give s. -18 Rearrange 41r - 40 + 40 + (-4r - 4r + 6r)(-3 + 0 + 1) + r + 0r + 0r to kr + w and give k. 46 Express (-s - s + s)(0s - s + 0s) - 2s + 2s + 2s*2 + (4 - 4 + 2s)(3 + 20s - 15s - 2) as xs*2 + t + os and give o. 2 Express 2b4 - 11b*3 + 10b*3 + 0b*2 - 4b*2 in the form rb*3 + ub + k + jb2 + xb*4 and give r. -1 Rearrange -4y - 2 + 1166y3 + y - 1185y*3 + 2y*2 + 1 to the form w + xy + my3 + oy*2 and give m. -19 Express 8s - s + 7s - 9s - 3 as j + ys and give y. 5 Express 1 + l - 1 + (-3 - 2 + 4)(-1 + 54l - 56l - 7) as ul + k and give u. 3 Rearrange 6 - 6 - 6j*3 + 9j*3 - 9j to v + sj3 + pj*2 + qj and give q. -9 Rearrange -5l + 4l + 0l - l3 - l4 to the form nl*3 + gl*4 + u + bl + rl2 and give b. -1 Rearrange 0p2 - p3 - 2p2 - p2 + p4 + 4p*2 to the form gp*3 + xp*2 + jp + cp4 + t and give c. 1 Express -3a*2 + 0a*2 + a + 2a in the form da + f + ga*2 and give g. -3 Rearrange (-7t + 4t + t)(0 - 3 + 2)(-23t + 70t - 24t) to it + j + ct*2 and give c. 46 Rearrange -3 + 2 - 9u*2 + 9u*2 - 15u*2 to gu*2 + fu + l and give l. -1 Rearrange (-5 + 0 + 2)(-9j + 8j - 22j)(0j + 0j - j2) to gj*3 + tj + k + rj2 and give g. -69 Express 5 - 2i + 0 + 3i4 - 4 in the form xi*2 + di*3 + b + ni*4 + qi and give n. 3 Rearrange -11c2 - c3 - 21 + 11c*2 to the form rc*3 + o + xc*2 + zc and give o. -21 Express 33b2 + 6 - 31b*2 - 2b + 8b as f + cb*2 + ab and give f. 6 Rearrange -1 + 3p2 + 6p*2 - 12p*2 to the form wp*2 + dp + r and give w. -3 Express (-2l - 2l + 0l - l + 3l - l + 0l - 4l + 3l + (-3 + 1 + 0)(1 - 1 + l))(-3l - 2l + 2l) + l*2 + 0l2 + l2 as v + ml2 + kl and give m. 20 Express -2 - 23i + 2 + 2i in the form wi + c and give c. 0 Rearrange -p - 2p + 2p - 3 - 3p to the form f + xp and give x. -4 Express (-1 + 1 - 1)(2m2 + 0 + 0)(0 + 0 - 13m) as a + nm + om3 + qm*2 and give o. 26 Rearrange -2x*3 - 6x*2 + 4x*2 - 2x*2 + 3 to the form cx*3 + gx + ox2 + n and give n. 3 Express -6p*3 - 6p*2 + 7p*2 + 5p*3 + 1 + 0p*3 as xp + jp3 + m + zp*2 and give z. 1 Rearrange -9p + 10p - 4p - 4p to qp + h and give q. -7 Rearrange -17h2 - 22h*2 + 13h*2 to the form yh*2 + o + sh and give y. -26 Rearrange 0o + 4o - 6o + o - 2 - 14o*4 + 2o*3 to the form so + yo3 + to*4 + r + po2 and give r. -2 Rearrange (1 - 1 - d2)(d2 - 3d*2 + 3d*2)(1 - 2 + 0) to m + kd4 + cd*2 + vd*3 + nd and give k. 1 Express -4b4 + 2b2 - 1 - b + b4 + 2b4 in the form lb*2 + f + ab*4 + zb + tb3 and give z. -1 Rearrange -2 - 2f*3 + 22 - 2f*2 + f - 8 to the form qf*3 + o + kf*2 + bf and give o. 12 Rearrange -3o4 - o + 2o*3 - 5o - 3o + 2 to ko + uo3 + no*4 + ro*2 + m and give u. 2 Rearrange -3w - 12w - 2w - w to jw + z and give j. -18 Express -2d - 8d + d in the form nd + m and give n. -9 Rearrange 28d - 4d*2 + 3d2 - d2 to zd + a + xd*2 and give x. -2 Rearrange 6l - 3l - 5l + (0 + 2l + 0)(4 - 1 - 4) - 2 - 2l + 2 + 48l + 83l + 19l + 45l to the form xl + p and give x. 189 Rearrange (-1 - 4 - 1)(-47t - 4t - t) to the form c + xt and give c. 0 Express 18 - 3u + 3u + u as d + wu and give w. 1 Express 0 + 0 + 2h + (4 - 5 + 0)(h + 0h + 0h) + (2h + 11h - 4h)(-2 - 1 + 5) as i + bh and give b. 19 Express (6p2 - 3p*2 - 2p*2)(-2 - 5p - 3p + 18p) as wp*3 + bp + jp2 + o and give w. 10 Rearrange (-6 + 1 + 3)(-b + 4b + 0b) + 0b - b + 7b + (3b - b - b)(-3 + 4 + 1) + 2b - b - 2b to qb + u and give q. 1 Express (-4 + 2 + 0)(-7y - 4y + 2y) in the form m + jy and give j. 18 Express 751 + 37d2 - 751 as t + vd + nd2 and give v. 0 Rearrange (0 - 1 - 1)(0 + 0 + 2b) + (-5 + 3 - 2 + (-4 + 1 + 2)(4 - 1 - 2))(17 - 17 + 9b) to the form ob + t and give o. -49 Rearrange -2 - i + 2 + (2 + 2 - 6)(-1 + 1 - i) + 0i + 0i - 3i + (-4 - 2 + 5)(-i - 4i + 4i) to the form ci + q and give c. -1 Express (-j2 - 2j*2 + 2j*2)(3j - j + 10j) in the form hj3 + g + yj + pj2 and give h. -12 Rearrange 3 - 2210s*2 + 2215s2 - s3 - 2s - 5 to the form os*2 + a + ts*3 + rs and give t. -1 Express (4 + 0 - 2)(p - 1 + 1) - 3p + 3p + 2p + (1 + 4p - 1)(0 - 2 + 3) in the form fp + z and give z. 0 Rearrange -7r*2 + 287r - 287r + 2 + (2 - r - 2)(-r + 3 - 3) + 3r2 - 2r*2 - 3r*2 to the form kr + cr2 + d and give c. -8 Rearrange i + 476i*4 - 2 + 4i*2 - 405i4 + i3 - 4i2 to ti*3 + zi*2 + ki + ji4 + l and give j. 71 Rearrange 9 - i3 - 14i + 7i + 7i to ri + v + hi*2 + ji*3 and give j. -1 Rearrange (m + 2 + 4 - 1)(-1 + 2 - 3)(2 + 2 - 2) to im + z and give z. -20 Rearrange -10z + 6z - 13z to hz + g and give h. -17 Express (8r - 4r - 6r - 5r2 - r4)(2 + 4 - 3) in the form fr + lr4 + u + ir*2 + dr*3 and give f. -6 Rearrange (19q - 46q + 72q)(-4q + 2q + 4q) to hq2 + d + tq and give h. 90 Express 1736 - 1736 + 19v2 + 58v*2 as xv + y + gv2 and give g. 77 Express (2 - 1 - 7)(d - 3d - 4d) in the form ld + n and give n. 0 Rearrange (8r - 2r - r)(0 - 2r + 0)(2 - 1 + 1)(-7 - 9 + 8) to the form fr + h + yr2 and give y. 160 Express -2 - 2z - 29 - 7 + z as cz + n and give n. -38 Express 6a*2 + 0a*2 + 7a*2 as da + ya2 + r and give y. 13 Rearrange -780 + 780 - 49q*2 to fq*2 + p + rq and give f. -49 Express -47 + 47 - 28r as jr + i and give j. -28 Express 5 - 18 + 3m2 + 4 + m + 7 as u + sm + fm2 and give s. 1 Rearrange -11l - 3l3 + 19l - 2l3 to hl + xl2 + w + il*3 and give h. 8 Express 3q*2 + 4 - 3 - 4 as gq + r + jq2 and give j. 3 Rearrange -34h - 32h + 58h to a + ch and give c. -8 Express 2a - 6a3 + 8a3 - a3 - 37 as za + ca*2 + qa3 + f and give z. 2 Rearrange -11 + f3 + 7 - 2 + (0f + f + f)(-2f2 - f2 + f2) - 2f*3 - 3f + 3f to lf + sf2 + m + gf*3 and give m. -6 Express (-h + 2h + 0h)(-2 + 1 + 3)(12h - 9 + 9) in the form xh2 + l + kh and give x. 24 Rearrange 2 + 16m3 - 5m - 8m3 - 2m*2 - 2m*4 - 10m*3 to the form km + xm3 + y + dm*4 + hm*2 and give y. 2 Rearrange 45q*3 - 20q*3 - 7q*2 - 1 - 23q*3 to fq + vq2 + i + zq*3 and give z. 2 Express 2o - 3o - 5o - o*2 + 3o*2 as lo*2 + w + ao and give l. 2 Express (y + 3 - 3)(4 + 0 - 2) - 15y + 31y + 13y in the form c + sy and give s. 31 Express (4 + 1 - 4)(-6 + 6 - v)(-3v + 5v + v)(-1 + 0 - 2) in the form x + kv2 + fv and give k. 9 Express 53 + 2q3 - 8q*2 - 117 - q + 59 in the form v + h	{ "pile_set_name": "DM Mathematics" }
49, -345? -669 What comes next: -6052, -23875, -53572, -95137, -148564, -213847? -290980 What comes next: 166392, 333736, 501080, 668424, 835768? 1003112 What comes next: 57079, 57053, 57011, 56953, 56879, 56789? 56683 What comes next: -317286, -634556, -951810, -1269042, -1586246, -1903416, -2220546, -2537630? -2854662 What is next in -49414, -50837, -52260, -53683, -55106? -56529 What is the next term in 6440, 6282, 6052, 5756, 5400, 4990, 4532? 4032 What comes next: 899, 4186, 9967, 18242, 29011, 42274, 58031? 76282 What is next in -1434061, -2868125, -4302189, -5736253, -7170317, -8604381? -10038445 What comes next: 1811629, 3623243, 5434843, 7246429, 9058001, 10869559? 12681103 What is next in -170254, -170521, -170788? -171055 What comes next: -401, -618, -1015, -1592, -2349? -3286 What is the next term in -814981177, -814981178, -814981179? -814981180 What is next in -24873, -49633, -74287, -98835, -123277, -147613? -171843 What is the next term in -92636, -191979, -291322, -390665, -490008? -589351 What comes next: 2474, 6401, 10332, 14267, 18206? 22149 What is the next term in 33286, 66638, 100126, 133822, 167798, 202126, 236878, 272126? 307942 What comes next: -131826, -263588, -395348, -527106, -658862, -790616? -922368 What comes next: -4, 219, 592, 1127, 1836, 2731, 3824, 5127? 6652 What is the next term in -3979, -13952, -29925, -51904, -79895, -113904? -153937 What is next in -242280, -241931, -241582, -241233? -240884 What is next in -830, -1893, -2990, -4127, -5310, -6545, -7838, -9195? -10622 What is the next term in 2837860, 5675728, 8513596, 11351464, 14189332, 17027200? 19865068 What comes next: -110038, -110044, -110050, -110056, -110062? -110068 What is the next term in -1311, -10744, -36351, -86220, -168439, -291096, -462279, -690076? -982575 What is next in 30883, 123531, 277945, 494125, 772071, 1111783? 1513261 What comes next: -2026, -8021, -17984, -31915, -49814, -71681? -97516 What comes next: -1693, 241, 5485, 15695, 32527? 57637 What comes next: 42755268, 42755271, 42755274, 42755277, 42755280, 42755283? 42755286 What comes next: 16693, 16107, 14523, 11443, 6369, -1197? -11753 What is next in 2417460, 4834914, 7252368? 9669822 What is next in 2074, 17207, 58478, 138961, 271730, 469859? 746422 What comes next: 8081791, 8081652, 8081511, 8081368, 8081223, 8081076? 8080927 What is the next term in -650607, -1301824, -1953041, -2604258, -3255475? -3906692 What is next in 466111, 466081, 466031, 465961, 465871, 465761, 465631? 465481 What is the next term in -612582, -612690, -612868, -613116? -613434 What comes next: 4987, 19663, 43677, 76675, 118303, 168207? 226033 What is the next term in 430, 2402, 7446, 17098, 32894? 56370 What is next in 3535, 3573, 3619, 3679, 3759, 3865, 4003, 4179? 4399 What comes next: -1263, -11056, -38083, -91056, -178687, -309688, -492771? -736648 What is the next term in 7469712, 7469736, 7469750, 7469748, 7469724, 7469672? 7469586 What comes next: -234, -1952, -6594, -15612, -30458, -52584, -83442? -124484 What is next in -7276477, -14552954, -21829431, -29105908? -36382385 What comes next: -388, -914, -1886, -3526, -6056, -9698, -14674? -21206 What is next in -401, -719, -1093, -1511, -1961, -2431, -2909? -3383 What is the next term in 5998, 7510, 9026, 10546, 12070? 13598 What is next in 6620, 26429, 59444, 105665, 165092, 237725? 323564 What is next in 842, 1570, 2168, 2570, 2710, 2522, 1940? 898 What is the next term in -71827, -71831, -71835, -71839, -71843, -71847? -71851 What is the next term in -31653170, -31653169, -31653168, -31653167? -31653166 What is next in -1694, -4867, -8040? -11213 What is the next term in 4234, 5228, 6872, 9166? 12110 What is the next term in 179868327, 179868323, 179868315, 179868303? 179868287 What is next in 569544, 1139069, 1708594, 2278119, 2847644? 3417169 What is the next term in -1061, -3957, -8785, -15545, -24237, -34861, -47417? -61905 What is next in -94327, -92821, -91315, -89809, -88303, -86797? -85291 What comes next: 3456497, 13825966, 31108415, 55303844? 86412253 What comes next: 2626, 18744, 61874, 145522, 283194? 488396 What is the next term in 4230695, 4230695, 4230697, 4230701, 4230707, 4230715? 4230725 What is the next term in 8688, 17414, 26134, 34848, 43556, 52258, 60954? 69644 What comes next: 13911, 13184, 12471, 11778, 11111, 10476? 9879 What comes next: -26830, -53635, -80440, -107245, -134050? -160855 What is the next term in -14770852, -29541690, -44312528, -59083366, -73854204? -88625042 What comes next: -175, -334, -455, -520, -511, -410, -199? 140 What comes next: 761, 914, 1065, 1214, 1361, 1506, 1649? 1790 What is next in -3854, -14282, -31660, -55988, -87266? -125494 What is the next term in -1459, -1335, -1203, -1063, -915, -759? -595 What comes next: -83, 1159, 2365, 3517, 4597, 5587, 6469, 7225? 7837 What comes next: -24317604, -24317606, -24317608, -24317610, -24317612? -24317614 What is next in 25488, 25589, 25870, 26421, 27332, 28693, 30594, 33125? 36376 What comes next: 3857, 15433, 34725, 61733, 96457? 138897 What comes next: 1246, -1707, -6630, -13523, -22386? -33219 What is the next term in 51035, 103246, 155457, 207668? 259879 What comes next: -43080, -43158, -43236? -43314 What is next in -498946, -499551, -500156, -500761, -501366, -501971? -502576 What is next in -1554, -5569, -11056, -17031, -22510, -26509, -28044? -26131 What is next in -8788563, -8788467, -8788307, -8788083, -8787795, -8787443, -8787027? -8786547 What comes next: 18846, 37328, 55504, 73374, 90938? 108196 What comes next: 9493, 9659, 10105, 10969, 12389? 14503 What is the next term in 2714, 5410, 8158, 10988, 13930, 17014, 20270? 23728 What is the next term in 358017, 357987, 357957, 357927? 357897 What is the next term in -392755926, -785511852, -1178267778? -1571023704 What is the next term in 586, 2514, 6090, 11608, 19362, 29646, 42754, 58980? 78618 What comes next: -12929502, -25859004, -38788506, -51718008, -64647510, -77577012? -90506514 What is the next term in -2713, -9936, -21971, -38818, -60477, -86948? -118231 What is next in 40669, 81374, 122119, 162904? 203729 What is next in 443, 435, 421, 401, 375, 343, 305? 261 What comes next: 5682248, 22728991, 51140230, 90915965, 142056196, 204560923? 278430146 What comes next: -594850, -596400, -597950? -599500 What is next in 19146, 76581, 172336, 306411, 478806, 689521? 938556 What is the next term in -8069, -17512, -26957, -36404, -45853, -55304? -64757 What is next in -9285, -18584, -27921, -37296, -46709, -56160, -65649? -75176 What comes next: 38904, 38841, 38778, 38715, 38652? 38589 What comes next: 427303, 427068, 426833? 426598 What is the next term in 16643948, 16643944, 16643938, 16643930? 16643920 What is the next term in -573, -2168, -4813, -8514, -13277, -19108, -26013? -33998 What is next in -115784, -115528, -115246, -114926, -114556, -114124, -113618, -113026? -112336 What is the next term in -2053076, -8212308, -18477688, -32849210, -51326868, -73910656, -100600568? -131396598 What is next in -961, -6003, -15115, -28297? -45549 What is the next term in -2472, -4376, -6280? -8184 What is the next term in 1716, 3433, 5150? 6867 What is next in 1887, 6070, 12831, 22164, 34063? 48522 What is the next term in 59341868, 118683736, 178025602, 237367466, 296709328? 356051188 What is the next term in 22740, 89842, 201696, 358314, 559708? 805890 What comes next: 78048, 78279, 78520, 78771, 79032, 79303? 79584 What is next in -29159, -58305, -87441, -116567? -145683 What comes next: 6570, 52583, 177488, 420729, 821750, 1419995, 2254908? 3365933 What is the next term in -21190, -42264, -63206, -84010, -104670, -125180? -145534 What is the next term in 4226, 3770, 3318, 2870, 2426? 1986 What is next in 385, -1791, -5397, -10415, -16827, -24615, -33761, -44247? -56055 What is next in 19744, 19490, 19064, 18466, 17696, 16754, 15640? 14354 What is next in -2209248, -2209334, -2209420, -2209506? -2209592 What is next in -1347237, -1347245, -1347253, -1347261? -1347269 What is the next term in 20914, 41928, 63052, 84340, 105846, 127624, 149728? 172212 What comes next: 1316, -2246, -8076, -16174, -26540, -39174, -54076? -71246 What is next in -2089, -16386, -55137, -130570, -254	{ "pile_set_name": "DM Mathematics" }
the terms in -3087x3 + 1547x*3 + 1537x*3. -3x*3 Collect the terms in 10880q - 10880q + 4q*2. 4q*2 Collect the terms in -3g*3 + 50229g*2 - 50229g*2. -3g*3 Collect the terms in -188f*3 - 187f*3 + 381f*3. 6f*3 Collect the terms in 19p + 14p - 6p. 27p Collect the terms in 35y*3 + 4y3 - y3 - 3y3. 35y*3 Collect the terms in 4m - m - 10m + 2m + 8m. 3m Collect the terms in y + 11y2 + 2y - 3y - 2y + 88y3. 88y*3 + 11y*2 - 2y Collect the terms in -5 + 4 + 4b + 5. 4b + 4 Collect the terms in 281 - 281 - 3x2. -3x*2 Collect the terms in 38q + 39q - 80q. -3q Collect the terms in 52a*3 + 53a*3 - 151a*3 + 49a*3. 3a*3 Collect the terms in 8f*2 + 6f*2 - 5f2 + f2. 10f2 Collect the terms in -6k - 5k - 10 + 10. -11k Collect the terms in -3l - 8l*2 + 3l2 + l2. -4l2 - 3l Collect the terms in -84 - 3g + 28 + 25 + 31. -3g Collect the terms in 10 - 5 - 5 - 342d3 + d. -342d*3 + d Collect the terms in 13d*3 - 14d*3 + 10d*3. 9d*3 Collect the terms in 0r - 40321r3 + 0r + 40323r3. 2r*3 Collect the terms in 0s*2 - 8520s*3 + 0s*2 + 8518s*3. -2s*3 Collect the terms in -32q*3 + 1 - 1 - 15q*3. -47q*3 Collect the terms in 18c + 11c - 43c + 12c. -2c Collect the terms in 85 - 164 + 75 + 6a. 6a - 4 Collect the terms in -6b2 - 6b*2 + 4b*2 - 2b*2. -10b*2 Collect the terms in 314j*3 + 363j*3 - 74j*3 - 94j*3. 509j*3 Collect the terms in 32u*2 - 57u*2 - 10u*2 - 1 - 45u*2. -80u*2 - 1 Collect the terms in 3f - 25 + 10 + 15. 3f Collect the terms in -178m*2 - 127m*2 - 163m*2. -468m*2 Collect the terms in 162j*2 - 2j - 164j2 + 2j + 0j. -2j*2 Collect the terms in 544 - 544 + 3r*2 + 2r*2. 5r*2 Collect the terms in 134a + 128a - 268a. -6a Collect the terms in 8w - 14w + 6w + 2w. 2w Collect the terms in -2v2 - 3466 + 3466. -2v*2 Collect the terms in 6r3 - r2 + 7r2 - 4r3 - r3. r*3 + 6r*2 Collect the terms in -25h - 295h2 + 25h. -295h2 Collect the terms in -6y*3 + 74y + 5y3 - 67y. -y*3 + 7y Collect the terms in -239b2 - b3 + 239b2. -b3 Collect the terms in -3 + 2v3 + 3 - 8v*3. -6v*3 Collect the terms in 8f*2 - 3f - 2f2 + 3f - 12. 6f2 - 12 Collect the terms in 6m*2 - 2m*2 + 6m*2. 10m*2 Collect the terms in -20x - 2x - 11x. -33x Collect the terms in -117273p - 7p2 + 117273p. -7p2 Collect the terms in -4m*3 - 3m*3 - 124 + 124. -7m*3 Collect the terms in 2b*2 - 59b*2 + 108b*2 + 150b*2. 201b*2 Collect the terms in -4m*2 + 2m*2 + 15m*2 - 19m*2 + 4m*2. -2m*2 Collect the terms in -9p - 73p2 + 10p - 2p. -73p*2 - p Collect the terms in 4 - 4 - 86m. -86m Collect the terms in 0f + f - 807 + 807. f Collect the terms in 16489s3 - 8244s*3 - 8243s*3. 2s*3 Collect the terms in -24728 + 4o*3 + 24728. 4o*3 Collect the terms in -62v*2 + 8v*3 + 16v*3 + 62v*2. 24v*3 Collect the terms in -24k*3 + 17k*3 - 29k + 29k. -7k*3 Collect the terms in -16m*2 - 225m - 38m2 + 225m. -54m2 Collect the terms in 2871 + 8w - 2871. 8w Collect the terms in -124t - 1 + 1. -124t Collect the terms in 416833v - 416833v - 4v*3. -4v*3 Collect the terms in 534 + 2g + 532 - 1066. 2g Collect the terms in -6x + 6x + 17x*3 - 46x*3 + 25x*3. -4x*3 Collect the terms in -6i*2 - 16i2 + i2 - 3i2. -24i*2 Collect the terms in 3d*2 - 4078d*3 - 5d*2 + 4075d*3 + 2d*2. -3d*3 Collect the terms in -237p*2 - 235p*2 + 708p*2 - 235p2. p2 Collect the terms in -4u + 19u - 16u - 8u. -9u Collect the terms in 6m + 619m3 - 3m + 647m3. 1266m*3 + 3m Collect the terms in 33z2 + 25z*2 - 59z2. -z2 Collect the terms in -187h2 + 91h*2 + 97h2. h2 Collect the terms in t - t - 3t - 2t. -5t Collect the terms in 126106 + 2i*2 - 126106. 2i*2 Collect the terms in 3o*3 + 5o*3 - 10o*3. -2o3 Collect the terms in f3 + 4 - 21f3 + 0 - 3. -20f*3 + 1 Collect the terms in -138y*2 + 66y*2 + 69y*2. -3y*2 Collect the terms in -19g*2 - 18g*2 - 25g*2 - 20g*2 + 80g*2. -2g*2 Collect the terms in 470 - 470 + 11a*2. 11a*2 Collect the terms in -48o*3 + 121o*3 - 64o*3. 9o3 Collect the terms in -g3 + 2g3 - g3 + g3 + 3g*3. 4g*3 Collect the terms in 3 - 3266387j - 3 + 3266391j. 4j Collect the terms in 0a - 2450 + 4895 - 2445 - 2a. -2a Collect the terms in -310 + 2r*3 + 310. 2r*3 Collect the terms in 1429j + 1574j - 424j. 2579j Collect the terms in -6 - 3 + 96y + 10. 96y + 1 Collect the terms in 0a*2 + 0a*3 - 3a*3 - 2a2 - a3. -4a3 - 2a*2 Collect the terms in 4g*2 + 3g*2 - 3g*2 + 4g*2. 8g*2 Collect the terms in -4b - 4b + 3b + 2b. -3b Collect the terms in 19x2 - 8x*2 - 11x*2 + 6x*3. 6x*3 Collect the terms in -94q*2 + 44q*2 + 54q*2. 4q*2 Collect the terms in -329m*3 - 335m*3 + 666m*3. 2m*3 Collect the terms in 2f + 0f - 4f. -2f Collect the terms in -19 + 19 - 4v*2 - 5v. -4v2 - 5v Collect the terms in w3 + 603 - 603. w3 Collect the terms in 82g3 + 76g*3 + 82g*3 - 202g*3. 38g*3 Collect the terms in -8l + 25l - 4l. 13l Collect the terms in 153x*3 - 55x*3 - 50x*3 - 53x*3. -5x*3 Collect the terms in -2490c - 8c3 + 2490c. -8c3 Collect the terms in -4 + 0 - 16p*2 + 3p*2. -13p*2 - 4 Collect the terms in 5d*2 + 18d + d*3 - 18d. d*3 + 5d*2 Collect the terms in -37805o - 6o2 + 37805o. -6o2 Collect the terms in -28x*2 + 16x - 18x - 50x*2. -78x*2 - 2x Collect the terms in -23n + 56n - 33n - 3n*2. -3n*2 Collect the terms in 75y - 4 + 75y - 152y - 7. -2y - 11 Collect the terms in 2b*3 - 22 + 8 + 6 + 8. 2b*3 Collect the terms in -4 - 117j*2 + 3 + 1. -117j*2 Collect the terms in 46t*2 - 92t*2 + 5t*3 + 46t*2. 5t3 Collect the terms in -1 + h2 - 2h2 - 5 + 6. -h2 Collect the terms in 0f*2 + 0f*3 + 0f*2 + 2f*3 + 2. 2f*3 + 2 Collect the terms in 32j*3 + 22j*3 - 7j*3 + 7j*3. 54j*3 Collect the terms in 2g*2 - 114g*3 - 2g*2 + 118g*3. 4g*3 Collect the terms in -4261m*2 + 2134m*2 + 2128m2. m2 Collect the terms in 6p2 + 2p*2 + 53p*2 + 37p*2. 98p*2 Collect the terms in 6 + 11w*2 + 9w - 9w - 6. 11w*2 Collect the terms in 43z*2 - 28z*2 + 43z*2. 58z*2 Collect the terms in -163 + 163 + 6l*3. 6l*3 Collect the terms in 4d - 3d + 0d - 13d3. -13d*3 + d Collect the terms in -580v*3 + 1152v*3 - 569v*3. 3v*3 Collect the terms in -160t + 40t + 43t + 37t + 39t. -t Collect the terms in 0u - 5 - 16 - 10 + 3u. 3u - 31 Collect the terms in -3 + 27l + 0l + 8l. 35l - 3 Collect the terms in 2 - 57x*3 - 2 + 181x*3. 124x*3 Collect the terms in 2d*2 - 15d*3 - 16d*3 - 2d*2. -31d*3 Collect the terms in -5h + 5h - 4h - h - 7h. -12h Collect the terms in 1718m - 1718m - 27m3. -27m*3 Collect the terms in 16 + 0 - 8 + 20i - 8. 20i Collect the terms in -81 + 81 + 10v - 5v. 5v Collect the terms in 3064 - 6a - 3064. -6a Collect the terms in 11 - 2 + 3 - 3r2. -3r*2 + 12 Collect the terms in -87l*2 + 197l*2 - 112l*2. -2l*2 Collect the terms in 16b*3 - 5b*3 - 5b*3. 6b*3 Collect the terms in -503c*3 - 18c*2 + 18c*2. -503c*3 Collect the terms in -258z + 258z - 16z*3 + 62z*3. 46z*3 Collect the terms in 28s + 4s - 10s. 22s Collect the terms in 4 - 4 + 154o*3. 154o*3 Collect the terms in 0v + 2v - 3v + 2v - 39v*2. -39v*2 + v Collect the terms in -40d*3 - 2739d + 2739d. -40d*3 Collect the terms in 29g*2 + 33g*3 - 54g*2 + 25g*2. 33g3 Collect the terms in u3 + 12267u - 12267u. u*3 Collect the terms in -8j + 15j - 14j. -7j Collect the terms in 447f*3 - 304f*3 + 835f*3. 978f*3 Collect the terms in -975 + j + 975. j Collect the terms in -1203 + 1203 + 3p. 3p Collect the terms in -239l*3 - 104l*3 - 19l*3. -362l3 Collect the terms in -9 + 12 - 10 + k2. k**2 - 7 Collect the terms in -7 + 80 + r - 146 + 73. r Collect the terms in	{ "pile_set_name": "DM Mathematics" }
when four letters picked without replacement from {w: 2, k: 4, u: 2, r: 1, c: 7}? 2/455 Calculate prob of picking 3 w and 1 p when four letters picked without replacement from pwwwwwwpxpwxppwppwww. 77/323 Two letters picked without replacement from ojaomjowjooroamoaa. What is prob of picking 1 j and 1 o? 7/51 Two letters picked without replacement from iamivnsvmmnvi. Give prob of picking 1 m and 1 v. 3/26 Calculate prob of picking 3 f when three letters picked without replacement from ppyfyfyppyyypyyyfpyf. 1/285 Three letters picked without replacement from {o: 3}. What is prob of picking 3 o? 1 Two letters picked without replacement from gdghdddhhhdd. What is prob of picking 2 d? 5/22 What is prob of picking 1 o and 1 w when two letters picked without replacement from oiw? 1/3 What is prob of picking 3 v when three letters picked without replacement from vvvvvssvvvsv? 21/55 Two letters picked without replacement from {f: 2, q: 2, a: 1, s: 1, x: 2}. Give prob of picking 1 x and 1 a. 1/14 Two letters picked without replacement from vlxtuta. Give prob of picking 1 a and 1 x. 1/21 What is prob of picking 2 e when two letters picked without replacement from eeoeeeoeeeeeooeeoe? 26/51 Calculate prob of picking 2 e and 2 f when four letters picked without replacement from fftstsstststteteee. 1/510 Three letters picked without replacement from {z: 1, a: 2, j: 7, v: 2}. What is prob of picking 2 v and 1 j? 7/220 What is prob of picking 2 v when two letters picked without replacement from {c: 10, v: 4}? 6/91 Two letters picked without replacement from {h: 5, q: 2, k: 6}. Give prob of picking 2 k. 5/26 Calculate prob of picking 1 i and 1 c when two letters picked without replacement from {d: 2, j: 6, i: 1, f: 2, w: 4, c: 4}. 4/171 Four letters picked without replacement from {f: 5, w: 9}. Give prob of picking 1 f and 3 w. 60/143 Calculate prob of picking 3 y when three letters picked without replacement from {y: 10}. 1 Calculate prob of picking 1 f and 1 g when two letters picked without replacement from ffffflfgfffflf. 11/91 Calculate prob of picking 2 i and 2 t when four letters picked without replacement from tttiitttitttttt. 66/455 Two letters picked without replacement from {x: 1, b: 2, d: 6, e: 2, c: 1, t: 6}. Give prob of picking 1 e and 1 t. 4/51 What is prob of picking 3 f and 1 w when four letters picked without replacement from {w: 2, f: 4}? 8/15 Three letters picked without replacement from {t: 4, w: 1, j: 1, n: 2}. Give prob of picking 2 n and 1 t. 1/14 Two letters picked without replacement from vcvvvvvvrrrvvvrrcrrv. What is prob of picking 1 v and 1 c? 11/95 Calculate prob of picking 1 p and 1 c when two letters picked without replacement from {d: 3, z: 4, h: 1, c: 1, p: 5}. 5/91 Two letters picked without replacement from ycyyycycyyyyyyycyyyy. Give prob of picking 2 y. 12/19 Two letters picked without replacement from vhsuuivvhshhuhs. Give prob of picking 1 v and 1 h. 1/7 Four letters picked without replacement from {d: 10, y: 2}. Give prob of picking 1 y and 3 d. 16/33 Four letters picked without replacement from yzgmz. What is prob of picking 1 m, 1 g, and 2 z? 1/5 Calculate prob of picking 3 a when three letters picked without replacement from {a: 9, h: 2}. 28/55 Calculate prob of picking 2 q and 1 d when three letters picked without replacement from qdqdqd. 9/20 Three letters picked without replacement from {v: 1, q: 1, r: 2, h: 1, m: 1, a: 2}. What is prob of picking 1 v, 1 m, and 1 r? 1/28 Three letters picked without replacement from lhhlhllhhhhl. What is prob of picking 1 l and 2 h? 21/44 Two letters picked without replacement from ehrfk. Give prob of picking 1 f and 1 r. 1/10 What is prob of picking 1 c and 1 b when two letters picked without replacement from {b: 1, c: 2, n: 1, i: 1, a: 2, f: 1}? 1/14 What is prob of picking 2 x when two letters picked without replacement from xxxxxxxxx? 1 What is prob of picking 2 v and 1 g when three letters picked without replacement from lvnnnnnnnngnvnun? 1/560 What is prob of picking 1 l and 1 w when two letters picked without replacement from heeeesslewwweeswlsee? 4/95 Three letters picked without replacement from {d: 1, y: 1, s: 1, c: 2}. Give prob of picking 1 y and 2 c. 1/10 Three letters picked without replacement from cwviccijviggjjiv. Give prob of picking 2 j and 1 g. 3/280 Calculate prob of picking 2 o when two letters picked without replacement from {o: 3, w: 9}. 1/22 What is prob of picking 2 m when two letters picked without replacement from mmg? 1/3 Three letters picked without replacement from {b: 13, z: 1, t: 3}. Give prob of picking 2 b and 1 t. 117/340 Three letters picked without replacement from {a: 1, u: 5, e: 5, b: 4, d: 1, v: 1}. Give prob of picking 1 d, 1 b, and 1 v. 1/170 What is prob of picking 2 g, 1 j, and 1 m when four letters picked without replacement from {o: 4, j: 4, g: 2, m: 1, f: 3}? 4/1001 Two letters picked without replacement from {p: 4, v: 3}. Give prob of picking 2 p. 2/7 Two letters picked without replacement from hchhhhhhhhhh. What is prob of picking 2 h? 5/6 Three letters picked without replacement from {f: 9, e: 11}. What is prob of picking 1 f and 2 e? 33/76 What is prob of picking 2 e when two letters picked without replacement from meeeeeeememmme? 36/91 What is prob of picking 2 y when two letters picked without replacement from hhhyhzhzhzyz? 1/66 What is prob of picking 2 a when two letters picked without replacement from jjeexejajaja? 1/22 Calculate prob of picking 2 g when two letters picked without replacement from gcccggcgcgggg. 14/39 Three letters picked without replacement from {o: 1, l: 1, i: 5, s: 9, t: 2}. Give prob of picking 1 o, 1 i, and 1 t. 5/408 Two letters picked without replacement from {e: 4, z: 1, h: 2, q: 9}. What is prob of picking 1 z and 1 e? 1/30 Two letters picked without replacement from {r: 2, v: 3, j: 3, t: 1, i: 1, w: 2}. What is prob of picking 1 t and 1 j? 1/22 Calculate prob of picking 1 t and 1 r when two letters picked without replacement from tttttttttrtttttttttt. 1/10 What is prob of picking 3 s when three letters picked without replacement from {s: 3, d: 11}? 1/364 Two letters picked without replacement from {y: 6, c: 1, b: 5, g: 1, j: 1, z: 3}. What is prob of picking 1 b and 1 c? 5/136 Four letters picked without replacement from rvrvrvrvrvvr. What is prob of picking 4 v? 1/33 Calculate prob of picking 1 k, 1 i, and 2 e when four letters picked without replacement from {e: 5, k: 1, i: 1, h: 1, g: 1}. 5/63 Two letters picked without replacement from {x: 1, z: 3, b: 5, y: 2, n: 3, c: 1}. Give prob of picking 1 y and 1 n. 2/35 What is prob of picking 1 s and 3 u when four letters picked without replacement from kuuuuuskkkukuk? 5/143 What is prob of picking 2 e and 1 j when three letters picked without replacement from jjjtqlteetjjqeqqo? 3/136 What is prob of picking 2 y, 1 n, and 1 v when four letters picked without replacement from {v: 1, n: 1, x: 2, y: 1}? 0 Two letters picked without replacement from {q: 1, b: 1, w: 1}. Give prob of picking 1 w and 1 q. 1/3 Calculate prob of picking 1 v and 1 h when two letters picked without replacement from {s: 4, h: 1, q: 2, v: 7, l: 1}. 1/15 Three letters picked without replacement from lgnngofgiin. Give prob of picking 1 o, 1 l, and 1 i. 2/165 Four letters picked without replacement from {t: 3, k: 5, x: 4, i: 4}. What is prob of picking 2 k and 2 i? 3/91 Calculate prob of picking 1 w and 1 o when two letters picked without replacement from {w: 2, o: 2, y: 5}. 1/9 Two letters picked without replacement from {a: 1, o: 6, d: 3, x: 3, z: 2}. What is prob of picking 1 a and 1 x? 1/35 Calculate prob of picking 1 p and 1 u when two letters picked without replacement from {v: 1, p: 2, u: 2, f: 1}. 4/15 Two letters picked without replacement from esennneeene. Give prob of picking 1 n and 1 e. 24/55 What is prob of picking 1 w, 1 i, and 1 s when three letters picked without replacement from {s: 4, i: 1, w: 1, a: 1, c: 2}? 1/21 Two letters picked without replacement from eeeeeeeeee. Give prob of picking 2 e. 1 Calculate prob of picking 2 s and 2 j when four letters picked without replacement from {h: 1, e: 1, a: 7, j: 2, o: 2, s: 2}. 1/1365 Four letters picked without repla	{ "pile_set_name": "DM Mathematics" }
= u + 6, rl - 192 = -2u. What is the tens digit of l? 6 Suppose 382a - 377a + 20 = 0. What is the hundreds digit of -91(1 - a)/(-1)? 4 Let n(j) be the third derivative of -61j*4/24 - 293j*3/6 - 56j*2. What is the units digit of n(-13)? 0 Let m = 750 - 1674. Let i = -565 - m. What is the hundreds digit of i? 3 Let g be 2/(-2)1(10 + -18). What is the thousands digit of (2105/(-4))/((-2)/g)? 2 Suppose 2p = 108 + 172. Suppose -3i + 170 = j, -5i - 9j + 11j + 298 = 0. Suppose 0 = 5l - 5b - p, -l + b = 6b - i. What is the tens digit of l? 3 Let x = -413 - -749. Let y = x + -199. What is the units digit of y? 7 Let c = -22253 - -10203. What is the units digit of (-8)/(-36) + c/(-45)? 8 Let j be (-23289)/(-63) + 1/3. Let i = j - -327. What is the units digit of i? 7 Let q(w) = -6w*2 + 2w + 5w2 - 2 - 8. Let d be q(0). What is the units digit of -182/(d/5)? 1 Let a(u) = -23u3 + 2u + 6. Let l = 20 + -23. What is the tens digit of a(l)? 2 Let n(k) = 404k - 5. Let s be (-1)/((0 - -5)/(-5)). What is the tens digit of n(s)? 9 Let c = 25 - -7618. What is the thousands digit of c? 7 Let w(r) = 43r + 87. Let g(v) = -87v - 173. Let q(p) = 4g(p) + 9w(p). What is the hundreds digit of q(17)? 7 Suppose -4u - 1298 = -5t, -1310 = 28u - 24u + t. Let z = u + 504. What is the tens digit of z? 7 Let b be ((-1)/(-3))/(1/12). Suppose -u - 2r + 15 = -1, u - br = -8. Suppose 1228 - 388 = us. What is the tens digit of s? 0 Let a(o) = -18o2 - 4o - 11. Let n be a(-4). Let s = 355 + n. What is the tens digit of s? 7 Suppose -6q = -5886 - 474. Suppose -7y + 200 = -q. Suppose c + y = 7c. What is the units digit of c? 0 Let x(q) = q2 - 55q + 85. Let w be x(55). Let d be -3153/3. Let h = d + w. What is the tens digit of h? 3 Suppose -3p + 1 + 5 = 0. What is the tens digit of 107p(-5)/(-10) + 1? 0 Let o(g) = g2 + 11g + 19. Let k be o(-9). Suppose 2w = -9 - k, -w = -3v + 779. What is the tens digit of v? 5 What is the units digit of ((-7665)/(-315))/(2/600)? 0 What is the thousands digit of (-3)/8 + (-46165416)/(-1472)? 1 Let v(z) = 9z3 + z2 - z - 1. Let b be v(1). Suppose 4148 = bo + 204. What is the tens digit of o? 9 Let w be 2/(1 + (-4)/8). Suppose -75 - 1621 = -wn. What is the tens digit of n? 2 Let p be 43 + (2 - 5) + 3. Suppose 0 = 3t - p - 635. Suppose i = 5g - 0i - t, -2i = -4g + 182. What is the units digit of g? 5 Let j = -65 + 71. Let x = j - 9. What is the units digit of -3 - x/(-2)-30? 2 Let p(r) = r2 - r + 40. Let b be p(0). Suppose -i + 13 = -3g + g, -b = 5g - i. What is the tens digit of (6/g)/((-14)/4893)? 3 Let u = 31128 + -16440. What is the thousands digit of u? 4 Let z(a) be the second derivative of -8a*3/3 + 10a*2 + 21a + 2. What is the units digit of z(-14)? 4 Suppose -6z = -78 + 30. Let l(j) be the first derivative of -j4/4 + 8j*3/3 + 4j*2 - 2j + 5. What is the tens digit of l(z)? 6 Let m = 2 - -5. Suppose 291 = -2o - 4l + 5l, 2l + 594 = -4o. Let j = m - o. What is the units digit of j? 4 What is the tens digit of (-7 + (-48414)/24)-4? 9 Suppose i = 4x - 15209 - 15122, -2i = -4x + 30330. What is the thousands digit of x? 7 Suppose 0 = -282w + 287w + 5u - 50455, -u = -w + 10097. What is the thousands digit of w? 0 Suppose 0 = 2d - 2z + 26, 0 = 4d + 4z + 15 + 29. Let o(c) = 21c + 22. Let n be o(d). Let a = -161 - n. What is the units digit of a? 9 Let c = 23683 + -15531. What is the tens digit of c? 5 Let l(q) = -q2 - 23q - 40. Let g be l(-21). Let x be (-948)/2142/(-12). What is the hundreds digit of -5 + x - (g - (-2 + 2))? 1 Let z(u) = -u2 - 6u + 94. Let x be z(-13). Suppose -b + xb = 2t - 1162, -2t + 1160 = -4b. What is the tens digit of t? 8 Suppose -5s = -s - 4f - 8, 0 = -f. Suppose -3l + 1071 = -sa + 5a, -5a = -2l - 1778. What is the tens digit of a? 5 Let a(x) = 27x3 - x2 - 18x + 5. What is the thousands digit of a(8)? 3 Suppose -45j + 89j - 79j + 359100 = 0. What is the thousands digit of j? 0 Suppose -5m - 3p = -17134, -95m = -100m + 4p + 17148. What is the hundreds digit of m? 4 What is the thousands digit of ((-79137)/288)/((-6)/(-8))-8? 2 Suppose -16k + 9k = -14. Suppose -3d + 3u = 7u - 2, -6 = -2d + ku. Suppose 0 = -ds + 10, 2n - 9 - 201 = -2s. What is the hundreds digit of n? 1 Let f(i) = 11i3 - 16i*2 + 22i + 128. What is the tens digit of f(11)? 7 What is the hundreds digit of -3(-1527)/(-45)-35? 5 Let y = 18820 + -9761. What is the tens digit of y? 5 Suppose -138l + 8283726 + 1286988 = 0. What is the thousands digit of l? 9 Suppose 36q = 72q. Suppose -760 = -4v - v. Suppose -4z - 3a + 330 = q, 0z = -2z + 5a + v. What is the tens digit of z? 8 Let a(v) = -5v*3 + 2v*2 + 4v + 1. Let i be a(-1). Let p = 2 + -2. Suppose p = -0k - ik + 412. What is the units digit of k? 3 Let r be (-3 - (1 - (1 - -1))) + 987. Suppose -4y + 443 = -r. What is the hundreds digit of y? 3 What is the hundreds digit of 276732/42 + (2 - 13/7)? 5 Suppose -7l = 862 + 1315. Let n be (l + -7)2/3. Let j = n - -325. What is the hundreds digit of j? 1 Suppose 0 = 7c - 19c + 10590 + 33990. What is the units digit of c? 5 Let u = 44469 - 24934. What is the thousands digit of u? 9 Suppose -4h - 2z = -29706, -2h + 4400 = 3z - 10463. What is the thousands digit of h? 7 Suppose 2y - 260 = -5u + 2, -3u + 5y + 182 = 0. Let j be 0 + 1 + -1 - (u - -32). Let v = 244 + j. What is the hundreds digit of v? 1 Suppose 0 = -n + 49 + 68. Let p = -837 - -836. What is the hundreds digit of n - (4 + p) - (0 + 3)? 1 Suppose -17 = 10g - 7. Let o be (46/(-3) - -6)/(g/(-42)). Let h = -214 - o. What is the hundreds digit of h? 1 Suppose 0 = 8z + 102 - 158. What is the units digit of (z - 1) + 9 + 146? 1 Suppose 51y - 67y - 16 = 0. What is the hundreds digit of 3122/8 + y1/4? 3 What is the units digit of 1 + (36628/(-7))/(25/((-2625)/30))? 5 Let w = 29 + -24. Suppose -3n + 9 = -2q + 3, -4q + 32 = wn. Suppose 333 = qo - 3u, -5o + u + 3u + 550 = 0. What is the units digit of o? 6 Suppose 0i - 4i = 5b - 2991, 2b - i = 1186. Let g = -234 + b. What is the units digit of g? 1 Suppose 5g + 3930 = s, -11790 = -3s - 3g - 0g. What is the hundreds digit of s? 9 Suppose 31l + 149335 = 531999. What is the ten thousands digit of l? 1 Suppose 2w - f - 39 = 22, 2f + 93 = 3w. Suppose -w = -3g + 25. Suppose -3n = gn - 3612. What is the hundreds digit of n? 1 Let u be (-3)/2((-20)/15 - 6). Suppose x = ux - 2810. What is the hundreds digit of x? 2 Suppose 69f = 90f - 506499. What is the thousands digit of f? 4 Let t = 461 + 16718. What is the tens digit of t? 7 Suppose 492y = 3505242 - 1240566. What is the thousands digit of y? 4 Suppose 0 = a + 2a + 3, -4a + 906 = 5u. Suppose 2i + 1195 = 4p + i, 4i - 602 = -2p. Let h = p - u. What is the units digit of h? 7 Suppose -10u = -5u - 4o, 3o = 5u. Let r = -349 - -532. Suppose 3d + 0d = a + r, u = -3d - a + 177. What is the units digit of d? 0 Let v(s) = -11s + 38. Let b be v(4). What is the hundreds digit of (b/15)/(18/(-9090))? 2 Let k(n) = 28n2 + 414n + 134. What is the ten thousands digit of k(26)? 2 Let z be (965/15)/(((-15)/9)/(-5)). Suppose -2w = 15 + 147. Let n = w + z. What is the tens digit of n? 1 Let q = -49 + 51. Suppose 15 = h + 5g - 15, -3g + 25 = qh. Suppose -hl + 410 = 125. What is the units digit of l? 7 Let u be ((-998)/(-10))/(8/(-40)). Let p = 1098 + u. What is the tens digit of p? 9 Let y = 31390 - -31972. What is the thousands digit of y? 3 What is the hundreds digit of -2(-2)/128644296/64? 2 Suppose s = -3t + 19384, 0 = -2s + 3t - 12335 + 51076. What is the units digit of s? 5 Let q(k) = -14k + 53. Let y(r) = 14r - 52. Let c(m) = 3q(m) + 2y(m). What is the units digit of c(-8)? 7 Let q(n) be the first derivative of -5n*2 + 132n + 104. What is the tens digit of q(-24)? 7 Let o = 97 + 660. Let l(g) = -g*3 + 6g*2 + 9g - 10. Let h be l(7). Suppose -2q + m + 376 = -m, -hq + 5m = -o. What is the units digit of q? 3 Let k(r) be the second derivative of -r5/20 + r4/4 - r3/6 + 342r*2 - 12r - 2. What is the hundreds digit of k(0)? 6 Let x = 139 + -426. Let z = 698 + x. What is the units digit o	{ "pile_set_name": "DM Mathematics" }
56 = -d, -s - d + 4 = -4. Suppose -o = -6 - 2. Let u = s - o. Which is the smallest value? (a) 0.4 (b) u (c) -5 c Let q be (1 - 1) + (-2)/(-13). Let j be ((-9)/(-18) - (-10)/(-8))/3. Which is the second biggest value? (a) j (b) q (c) -0.1 c Let z = -0.4 + -0.1. Which is the biggest value? (a) z (b) -1/6 (c) -4 b Let z be -3 + 12/(-4) + 19. Suppose -3f = -3i + 45, i = 3f + 6i + z. Which is the third biggest value? (a) 2/7 (b) -3/4 (c) f c Let p(n) = n*3 + 5n*2 + 6n + 4. Let w be -4(2/1)/2. Let v be p(w). Which is the second smallest value? (a) 0.1 (b) 2 (c) v a Let x be (-20)/(-70) + (-73)/35 + 2. Which is the third biggest value? (a) 0 (b) 77 (c) -4 (d) x a Let c = 0.04 - 0.34. Let l = -106/7 - -205/14. What is the second smallest value in l, 1/8, c? c Let n = 38 + -110/3. Which is the third biggest value? (a) 0 (b) 1 (c) n a Let j = -885 + 8903/10. Let q = -34/5 + j. Which is the biggest value? (a) -1 (b) -5 (c) q a Let t = 15 - 10. Let h(f) = 4f + 3. Let q be h(5). Suppose -2u = -5o + 15, 3o = -3u + 7u + q. Which is the smallest value? (a) o (b) -2 (c) t b Let n = 0.4 + 0.1. Suppose 780 - 4 = 4f - 2d, 0 = -3f + 5d + 568. Let l = 1370/7 - f. Which is the second smallest value? (a) -3/2 (b) n (c) l c Let o = 43 - 44. Let n = -0.02 + -0.28. Which is the biggest value? (a) n (b) 1/3 (c) o b Let n = -77.1 + 66. Let h = n - -11. What is the second biggest value in 0.5, 0.2, h? 0.2 Let x(l) = 2l + 12. Let m be x(-6). Which is the second biggest value? (a) 4 (b) 1 (c) m b Let f = -885 - -884. Let u = 7 + -6.93. Which is the second smallest value? (a) u (b) f (c) 5 a Let h = -2.4 - -2.6. What is the second biggest value in -0.3, -0.04, h, -1/6? -0.04 Let r = 0 + -0.6. Let n = -2.4 + r. Let u = 3/146 - -207/584. Which is the third smallest value? (a) n (b) -4 (c) u c Let j = 949/7 - 135. Which is the second smallest value? (a) j (b) 1/7 (c) 3 (d) -4 b Let x = 1727/2 + -844. Let i = x - 18. Let j = -76/231 + -8/33. What is the third biggest value in i, -0.5, j? j Let h = 4 + -3.83. Let u = -0.1 + h. Which is the second smallest value? (a) -2 (b) -4 (c) u a Let z = 0.2 + 2.8. Let t be (-4)/18 - (-47)/9. What is the biggest value in t, -0.04, z? t Let d = 8 - 17. Let i = 10 + d. Which is the biggest value? (a) 5 (b) i (c) -1/2 a Suppose 0 = -0c - 2c. What is the third smallest value in -0.12, 1/2, c? 1/2 Let h = -15.6 + 15. Let x = 0.1 - -0.9. Let s = h + x. What is the second biggest value in s, -0.3, 1/4? 1/4 Let o = 21 - 12. Let w = 8.7 - o. What is the second smallest value in w, -1, -3/7? -3/7 Suppose 0b + 12 = 4b. Suppose i = -bi - 4. What is the second smallest value in 1/4, 0, i? 0 Let b = -15.15 - -15. Let f = b - -4.15. What is the smallest value in -2/7, 2/15, f? -2/7 Suppose 0 = -3y - 3 + 9. Suppose -yz + 4 = -6. What is the second smallest value in -1, 0.3, z? 0.3 Let m = -46.987 + 47. Which is the biggest value? (a) 1/4 (b) -0.3 (c) m (d) -0.4 a Let s = -3 + 10. Let i = s + -8. Which is the second biggest value? (a) i (b) 5 (c) 1 c Let m = -4/11 - -63/22. Let k = -8.9 + -1.1. Let v = 15 + k. What is the smallest value in 1, v, m? 1 Let n = -25.2 - -15.5. Let s = n - -10. What is the second smallest value in 1, -3, s? s Let z = 0.54 - -0.16. Let m = 50 + -49.1. Let h = z - m. What is the second biggest value in -0.07, -4/9, h? h Let u = 223 - 212. Which is the second smallest value? (a) u (b) -2 (c) -1 (d) 0 c Let u = -2.2 + 2.4. Let q = 0 - 0. What is the second smallest value in u, q, 1/3? u Let m = 1 - 1.2. Let h = -15 - -16.7. Which is the biggest value? (a) m (b) h (c) 0.3 b Suppose 0 = -4a - 0 + 8. What is the second smallest value in -0.4, a, -2? -0.4 Let z = 91 - 97. Which is the smallest value? (a) 1 (b) z (c) -1/4 b Let h = 0.5 - 0.3. Let l = 2.7 + -7.7. Let p be (-1 - 1)/((-10)/6). Which is the biggest value? (a) l (b) p (c) h b Let d be (-1)/((-4)/11) - 3. Let g = 30103/193212 - -36/1789. Let z = 2/27 + g. Which is the second biggest value? (a) d (b) z (c) 0.1 c Let u be (-16)/88 - (-2)/132 - 0. What is the biggest value in u, 0.03, -1/3? 0.03 Let f = 51 - 45.6. Let g = f - 0.4. Let h = g + -4. Which is the biggest value? (a) -3 (b) h (c) 2/5 b Let g = 0.5 - 0.2. Let y(a) = a*2 + 4a - 5. Let u be y(-5). Suppose u = -3s + 6s. What is the biggest value in -2, s, g? g Let m be 2/(-3)1/(-2). Let p = -0.27 + 0.07. Which is the smallest value? (a) p (b) m (c) 3 a Let m(b) = -2b - 1. Let o be m(-3). Let x = -23 + 27. What is the second biggest value in -5, o, x? x Let w be 7 - ((-5)/(-2) + 4/(-8)). What is the second biggest value in w, -6, -2/7? -2/7 Let y = 4 - 3.9. What is the biggest value in y, -2/17, -4? y Let n = 62 - 57. What is the second smallest value in -2, n, -0.2? -0.2 Suppose -d + 0d + 80 = 0. Let n be ((-12)/d)/((-4)/(-10)). What is the smallest value in 2/11, n, 0? n Let h = -0.162 - 0.828. Let x = 0.01 - h. Let y = -3.3 - -3. Which is the second smallest value? (a) 0.1 (b) y (c) x a Let n be 87/9 + (-2)/3. Let o = n + -55/6. Which is the smallest value? (a) o (b) -0.3 (c) -3 c Let t = 9 - 4. Suppose ty + 6 + 4 = 0. Let b = -16/5 + 262/85. What is the smallest value in 5, y, b? y Let y = 0.04 + 2.96. Let h = -0.06 - 0.24. Which is the second smallest value? (a) h (b) y (c) 0 c Let t be (-25)/140 + 2/(-8). Let k = 0 + 0.5. Let f = -0.5 - k. Which is the second smallest value? (a) 0.3 (b) t (c) f b Let i(p) = -p3 - p2 - p. Let g be i(-1). Let w = 0.7 + -0.4. Let y = 2.8 + 1.2. What is the third smallest value in y, g, w? y Let k = -36 + 254/7. What is the third biggest value in -0.4, k, -1/4? -0.4 Let x be ((-15)/(-4))/(27/(-18)). Which is the third biggest value? (a) 11 (b) 4 (c) -0.5 (d) x c Let u = -9.7 + 1.7. Let n = u - -15. Let x = -5 + n. What is the biggest value in x, -1/2, 0.1? x Let a = -2.8 + 8. Let n = a + -1.2. What is the third biggest value in 5, n, 2/9? 2/9 Let p = 177/8 + -45/2. Let d = 59.1 - 62. Let l = 3 + d. Which is the third smallest value? (a) -1 (b) l (c) p b Let k = 24 - 24. Which is the second biggest value? (a) -2/5 (b) -0.3 (c) k b Let c be 3020/564/(-5). Let r = -43 - c. What is the third biggest value in r, 2, -2/27? -2/27 Let j be (-6)/21 + 33/91. What is the smallest value in -2/3, j, 1? -2/3 Let q be (-2)/10 - 16/(-5). Suppose -t = -2 + q. What is the second smallest value in 0.5, t, -4? t Let i be (-1)/(-3) + 38/(-42). Let h(f) = -2f*3 - 10f*2 + 6f + 34. Let o be h(-5). What is the biggest value in o, i, -0.5? o Let i = -68 + 70. Which is the second smallest value? (a) i (b) 3 (c) -1 a Let x = -0.041 + 0.041. Which is the third smallest value? (a) -2/3 (b) 4 (c) -0.3 (d) x d Let d = -23.1 - -22. Let k = 2.1 + d. Which is the third biggest value? (a) 4/9 (b) k (c) -2/7 c Let g = 7 + -7.3. Which is the biggest value? (a) -0.5 (b) g (c) 2/23 c Let x be (-8)/12 - (-254)/228. Let q = 1/19 + x. What is the second smallest value in -2, q, -5? -2 Let m = 6.001 + -0.001. Which is the third biggest value? (a) 2 (b) -2 (c) m (d) -3/5 d Let l(n) = n*2 + 7n + 4. Let t be l(-5). Let z be 19/(-39) - t/18. What is the third smallest value in 2, 5, z? 5 Let x = 1 - 2. Let d = 2 - 5. Let h = d + 2.5. Which is the third smallest value? (a) 3 (b) h (c) x a Let o = 365857/19177 + -12672352633/213900258. Let i = 2/5577 - o. Let u = -41 + i. Which is the biggest value? (a) -0.1 (b) 0.3 (c) u b Let g = -4 - -3.6. Let z = -0.1 + -5.9. Let j = 4 + z. What is the third smallest value in 0, j, g? 0 Let k = -1100/9 + 122. Let p = -2/65 + 41/65. Let m be (8/114)/(4/6). Which is the smallest value? (a) p (b) m (c) k c Suppose 2 = 2o - 3o. Let d be (-3)/(-2)(-16)/132. Let n(t) = -4t - 3. Let i be n(-2). Which is the second smallest value? (a) i (b) o (c) d c Suppose -r - 153 = 2r. Let g be (-1)/(2 + r/39). Let j = g - 1/18. Which is the third biggest value? (a) -2 (b) 1/3 (c) j a Let o(u) = u - 11. Let z(i) = 6i*2 - 1. Let s be z(1). Let k be o(s). Let f = -1/204 + -397/2244. Which is the smallest value? (a) f (b) 1/7 (c) k c Let m = 22.5 - 22. Suppose 3l - 2 = -2d, 3d - 5*d = 4. What is the second smallest value in m,	{ "pile_set_name": "DM Mathematics" }
24/p + 72/(-120) a prime number? True Let c(d) = 87d2 + 7d - 1117. Is c(-39) a composite number? True Let r = 16418 - -3033. Is r composite? True Suppose -5n = -4n - 2o - 19, -49 = -n - 4o. Let c = 4 - -1. Suppose -cs + 69 = 3j, -4j - s + n + 63 = 0. Is j a prime number? True Suppose 7p + 0p = 14. Let y = -3355 + 5759. Suppose -4c + 4784 = -4g, 0c - y = -pc - 4g. Is c composite? True Suppose -a + 249 = 3v + 2a, -168 = -2v - a. Let p = v + -81. Suppose -z - 2498 = -4r - pz, 3r - z = 1867. Is r composite? True Let k = 31824 + 55003. Is k composite? True Let l(r) = -r*2 + 11r - 25. Let w be l(8). Let t(k) = 15k2 - 13k*2 - 186k*3 + 3k + 2 - 2k - 4k*2. Is t(w) a composite number? True Suppose -k = -0k - 3b - 548, -5b = -3k + 1656. Suppose k = -11i + 12i. Is i composite? False Suppose -b + 4 = -0. Suppose 3w + bu - 15 = 0, -1 = -6w + 2w + u. Is 18/(-4)(w + (-425)/3) a prime number? False Let y(h) = 1816h2 - 3h + 5. Let u be y(2). Suppose u + 3922 = 5s. Is s composite? False Is (-54)/(-243)(-289647)/(-2) a composite number? False Suppose 0p + 5d - 2200 = p, -3d - 8869 = 4p. Suppose -9v + 14v + a + 6088 = 0, 5a - 4882 = 4v. Let b = v - p. Is b a prime number? True Suppose -b + 3704066 = 4p, -5p + 2b + 3359315 + 1270774 = 0. Is p prime? True Let f(d) = -15d + 2d - 8 - 13d - 29d. Is f(-7) a prime number? False Let x = 138318 + -48640. Is x composite? True Suppose 11z + 27295 = 6z. Let v = -3798 - z. Suppose -5f + 3l + 3668 = 0, l = -4f + 1270 + v. Is f composite? False Let m = 10 - -37. Let h = 84 - m. Let u = 140 - h. Is u composite? False Let g(w) = -87798w3 - w2 - 12w - 12. Is g(-1) prime? True Let r be (-18/20)/((-1)/(-15)). Is (r + -2655)3/(-9) prime? True Suppose -15 = -f + 6f. Let w(u) = 3u*2 - u - 8. Let z be w(f). Suppose 486 + z = 4k. Is k prime? True Suppose 0 = -4j - 19 + 15. Let w be -1(j/1 + -1). Suppose 0 = wq - 4083 + 553. Is q prime? False Suppose 0 = -3h - w + 11658, -h = 3w - 5w - 3886. Suppose -22m = h - 48458. Is m a prime number? False Suppose 4c - 3f = -0c + 26, -c = -5f - 15. Suppose 4y = -d + 7, -cy + 7y = -2d - 4. Suppose 0 = 4z - s - 14560, -s + 16 = ys. Is z composite? True Suppose -57p - 114p + 92117187 = 0. Is p a composite number? False Let k be 3 + (-3)/((-9)/6). Suppose 0 = x + 3c - 1522 + 56, -2x - c + 2932 = 0. Suppose 2q - 2982 = 4f, -kf + 2f = q - x. Is q a composite number? False Let a = 11 - 8. Let p be a(1/4 + 7/(-12)). Is -2 + 49(21 - (p + 1)) composite? True Is -2327558/(-30) - 8/(-10) a prime number? True Let h = -109 + 109. Let q(o) = -65o + 15 - 70o + h + 7. Is q(-15) prime? False Suppose x + 3x + h - 11 = 0, -3x + 3h + 27 = 0. Suppose -5m + 10263 = -xc, 3m = m - 5c + 4092. Is m composite? True Let w(z) be the second derivative of 241z*3/3 + 55z*2/2 + 2z + 74. Is w(9) a composite number? True Let x = 1753 + 437. Let l = x - 569. Is l prime? True Suppose -4s = -3w - 2w + 46, -4s + 2 = 3w. Is (-5 - -13 - w) + 4689 composite? False Suppose -8r - 7 = 2y - 13r, -5y + 29 = 3r. Suppose -yz - 21j + 12896 = -20j, 3z - 9649 = 5j. Is z a composite number? True Let b = 876 + -242. Suppose -4h + 4168 = -5m, -2h - m + 2098 = -0m. Let f = h - b. Is f prime? False Let s(a) = 113a*2 + 5a + 25. Let d be s(6). Suppose -l + d = 3q, l - 4103 = 17q - 15q. Is l a prime number? True Let q(i) = 3i*2 - 11i + 10. Suppose 4o - 27 = 13. Let h be q(o). Let y = h - -195. Is y a composite number? True Let l = 42518 + 71. Is l a composite number? False Let k = -27 - -32. Let q(b) = 2b - 7. Let l be q(k). Is (-912 - (4 - l))/(-1 - 0) a prime number? False Let p = 296505 - -68584. Is p a prime number? True Let f = 713645 - 324138. Is f prime? True Let f = -162056 + 616399. Is f a prime number? False Let j be ((-1932)/126)/((-1)/495). Let g = 11971 - j. Is g composite? True Suppose 16v - 23314 + 290 = 0. Is v a composite number? False Let g = 246109 - 161152. Is g a prime number? False Let z = 78 - 76. Let p(c) = -21c + 7c2 - 4c*z + 41 + 4c + 2c. Is p(19) prime? True Suppose -21p - 19p - 29p = -10462263. Is p prime? False Suppose -129t + 67t - 2473365 = -77t. Is t prime? False Let y = 26868 + -40668. Is 2/11 - 0 - y/88 prime? True Let u = 7075 - 15900. Let x = u - -17404. Is x a prime number? False Let m(j) be the second derivative of -209j*6/720 - 13j*5/120 - 11j*4/6 - 4j. Let v(y) be the third derivative of m(y). Is v(-3) prime? False Suppose 16 = 4y, 1531 = -50n + 55n - y. Is n composite? False Suppose 4x + 3p = -p + 351312, -4x = -2p - 351342. Is x prime? True Let u = 71878 - 10065. Is u composite? False Suppose n + 0p - 5 = -p, 2n - p + 5 = 0. Suppose nf = f - 1. Let o(v) = 87v. Is o(f) prime? False Let j(u) = 1985294u*2 - 120u + 123. Is j(1) composite? True Suppose 0 = 4o + 2a - 4430 - 82, -o + 4a = -1110. Let d be 9366/(-12) - 2/(-4). Let j = o + d. Is j a composite number? True Let s = 137770 + -88371. Is s prime? False Suppose 9t = 2t + 42. Suppose tq = -3q + 2q. Suppose q = -6o + 1175 + 1063. Is o a composite number? False Let c(u) = 1211u*2 - 5u - 3. Let y(s) = 11s - 56. Let f be y(5). Is c(f) prime? True Is 20337/(-4)55648/(-2220)(-5)/(-2) a prime number? False Suppose 18o + 2j + 10 = 21o, 19 = 5o - j. Suppose 36757 = 5a - ob, -5b + 14689 = 2a - 2b. Is a a composite number? False Is (-2 + 32)13877891/318 a prime number? False Suppose -7u + 6c = 4c - 167019, u - 3c = 23849. Is u a composite number? True Let i = 942766 + -120513. Is i prime? True Suppose -14q + 0q + 112 = 0. Let n be (q/(-10))/((-1)/5 - 0). Suppose -c + 5b = -4c + 2942, -3912 = -4c + nb. Is c a composite number? True Let s = 19 - 16. Suppose -su = -4500 - 678. Is u prime? False Let d be (-60)/(-90) - (1 + 4/(-3)). Let s be 2d/((-1)/43). Let b = 143 + s. Is b prime? False Let y = 4171 + -2922. Is y a composite number? False Is (4/6)/((-294)/(-71587971)) prime? False Suppose -3v = 2b - 40465, -5v + 39944 = 2b - 507. Is b a composite number? True Suppose 3c - s + 200 = -6s, 5s = -4c - 260. Let r be (3 - c/27) + 2/(-9). Suppose -3j = -4y - 797, -8j - 529 = -10j + ry. Is j prime? False Let r be 7/(-2)(-30)/21 - -23774. Suppose -7i + 17052 = -r. Is i prime? False Suppose 0 = 33x - 23x - 115570. Let n = -7230 + x. Is n prime? True Let t = 70458 + 278593. Is t composite? False Suppose 60w - 10950439 = -4668914 + 7242295. Is w a prime number? False Suppose 49 - 340 = -3y. Let z be 5/10-74-3. Let q = y - z. Is q prime? False Let r(s) = -5s*2 + 16s - 8s2 - 2s*2 + 17s*2 + 18. Let u be r(-7). Suppose uw - 5658 = 4y - 1310, 5435 = 5w + y. Is w composite? False Is 2078051 + (-8 + 4 - -7 - 3) a composite number? False Let o(j) be the third derivative of 0j + 2/5j*5 + 0 - 19/24j*4 + 5/2j*3 - 29j2. Is o(8) composite? False Let h = 2690 + -1516. Let r(z) = z2 + z + 2. Let n be r(0). Is (n + 2)/(4/h) a composite number? True Let q(h) = -31752h - 619. Is q(-4) a prime number? False Let b(h) = 47h*2 - 1089h - 237. Is b(109) composite? True Suppose -9r + 25232 - 173885 = 0. Let s = r - -26288. Is s a composite number? True Let o = -92378 - -166197. Is o a prime number? True Suppose 0 = -p - 3h + 5943, 3p + 43h - 17817 = 40h. Suppose -119b = -116b - p. Is b a prime number? True Suppose -v + 1 = 0, v - 13 = -2a + 6. Suppose -az + 12z = 768. Let y = z - 111. Is y composite? True Let p = 12 - 8. Suppose 4s = 2b - 0s - 916, 0 = 4b + ps - 1880. Is b a prime number? False Suppose 61g - 3765966 = 238g - 29101215. Is g composite? False Let l be (1 - -3) + 13 + (-490842)/(-9). Suppose m = -m + 2p + 27280, 0 = -4m - p + l. Is m a composite number? True Suppose -308j + 5j = -16926909 - 10420962. Is j a prime number? False Let s(l) = 16223l + 50. Let p be s(4). Suppose 58086 + p = 4f. Is f prime? True Let c(m) = -m2 - 4m + 14. Let w be c(-6). Suppose wy - 8 = 0, 5z - 3 = 3y - 15. Suppose 5j + 3q - 961 = z, q = -0j + j - 197. Is j a composite number? True Let a(y) = y*3 + 11y*2 - 3y - 25. Let c be a(-11). Suppose 49j - 53j = -c. Suppose 9333 = -jt + 11t. Is t prime? False Suppose -4*	{ "pile_set_name": "DM Mathematics" }
2, 3, 47 Let m be 90/27(-6)/(-4). Let h be m/10(57 + 1). Suppose 4 = -5s + h. List the prime factors of s. 5 Let r = -6 - -9. Let t(o) = -o2 + 5o - 2. Let i be t(r). What are the prime factors of (1611)/i - 0? 2, 11 Suppose 9p + 12 = 6p. List the prime factors of (-16)/(-3)(-51)/p. 2, 17 Let u be 14/4(-24)/(-3). Let y = -63 + u. Let i = 53 + y. What are the prime factors of i? 2, 3 Suppose 5k - k + 4i - 28 = 0, -27 = -5k - i. Suppose k = -3b + 92. List the prime factors of b. 29 Let p(q) = 4q + 2 - 3q - 3 - 9. List the prime factors of p(14). 2 Suppose -2f - 73 = -3z, f + 0z = 2z - 38. Let w be (-3)/(12/f) - 3. Let l = w - -14. List the prime factors of l. 19 Suppose 49 = 22q + 5. Suppose -qi = 9 - 171. List the prime factors of i. 3 Let c = 3 - 1. Let r(b) = -b2 + b + 2. Let a be r(c). Let w = a + 4. What are the prime factors of w? 2 Suppose 14a - 23621 = -7577. List the prime factors of a. 2, 3, 191 Let b(s) = -8 + s + 15 + 8. Suppose -4o + 2o - 10 = m, 15 = -m - 3o. List the prime factors of b(m). 3, 5 Let q(a) = 4a*2 - 17a + 31. List the prime factors of q(16). 3, 29 Let z be 1(4 - 0) - 34. Let s be (-24)/z - 8/10. Suppose -2p = -4j - 20, -3p = -sj - j - 30. What are the prime factors of p? 2, 5 Suppose 5f + 27 - 197 = 0. List the prime factors of 51/f(-92)/(-6). 23 Let h(l) = -7l + 0 + 3 + 10l. Let v be h(-6). What are the prime factors of 310(-6)/v? 2, 3 Let c(j) be the third derivative of -j6/120 - 7j*5/20 + 11j*4/6 + 3j*3 + 26j*2. What are the prime factors of c(-23)? 2 Suppose -14 = -4p + 2. Let z = -156 - -221. Suppose pq - z = -q. List the prime factors of q. 13 Let t be (3 + -3)/(4 + -2). Let g = t - -1. Suppose 2s + g + 1 = 4a, -2s = 5a - 34. What are the prime factors of s? 7 Let s(u) = -80u - 35. Let b(v) = -9v - 4. Let m(l) = -35b(l) + 4s(l). Let n(t) = 10t. Let c(w) = 5m(w) + 2n(w). List the prime factors of c(-5). 5 Let b = 1687 + -1171. List the prime factors of b. 2, 3, 43 Suppose 1680 = 16o - 13o. Suppose -428 - o = -4z. Suppose -4n + 178 = -i, -i - 73 + z = 4n. What are the prime factors of n? 2, 11 What are the prime factors of -23783/6-11? 13, 97 Let o = -30 - -55. Suppose -41 - o = -3x. List the prime factors of x. 2, 11 Suppose -678 = -3a - 0a. Suppose 3p - 4k - a = 0, -2p - 3k = -68 - 94. List the prime factors of p. 2, 3, 13 Let f be ((-30)/4)/((-6)/16). Suppose -f = -3z - 5. Suppose 1 = -t - 3, -5c - zt + 95 = 0. What are the prime factors of c? 23 Suppose 2t + 180 = -2t. Let f be 18/t + 104/10. List the prime factors of f/((-14)/4 - -4). 2, 5 Let o(b) = b3 + b2. Let p be o(-2). Let r = 2 + p. What are the prime factors of (-1 + r/(-1))15? 3, 5 Let u be (-2 + -1)-1 + 2. Suppose u = -3m + 89. Let s = m - 16. What are the prime factors of s? 2, 3 Suppose 4b - 6 = 2. Suppose bp + 3r - 15 = 0, 6r = 2p + r + 25. Suppose p = 4s - 64 - 100. List the prime factors of s. 41 Suppose 4s - 3 = s, 3y - 5s = 1387. What are the prime factors of y? 2, 29 What are the prime factors of 10/45 + (-1)/((-27)/35175)? 1303 Let y(t) = 24t2 + 26t + 188. List the prime factors of y(-12). 2, 7, 17 Let k(f) = 5f2 + 3f + 2. What are the prime factors of k(-6)? 2, 41 What are the prime factors of (-433)/2-2(-3 + 4)? 433 Let v(s) = 230s - 163. What are the prime factors of v(9)? 1907 Suppose -2m = 3b - 656, 5b + 2m - 1130 = 6m. What are the prime factors of b? 2, 3, 37 Let x(i) = 3i2 + 30i + 6. List the prime factors of x(-22). 2, 3, 7, 19 Let n(b) be the first derivative of -b*4/12 + 2b*3/3 - 3b2 + 4. Let w(j) be the second derivative of n(j). What are the prime factors of w(-5)? 2, 7 Let t be ((-1)/(-1))/(6/(-54)). Let b(a) = -a2 - 13a + 19. What are the prime factors of b(t)? 5, 11 Let k be 1((-54)/(-15) + 4/10). Suppose 0 = 2w + 2m - 136, -w - km = -4w + 211. What are the prime factors of w? 3, 23 Let q be (-6 - (6 + -9)) + 2-3. List the prime factors of (-547)/(-9) - 1/q2. 61 Suppose 2t + k - 656 = 0, 3t = -t - 5k + 1306. Let p = t + -146. Suppose 0 = -5j - 4g + p, -5g + 4g = j - 36. What are the prime factors of j? 3, 13 Suppose 4b - 7b = -39. Let d = b + -10. Suppose -da + 81 = -y, 0 = 5a + 4y - 78 - 74. List the prime factors of a. 2, 7 Suppose 2094 = 23j - 55406. What are the prime factors of j? 2, 5 Let o(l) = 8 + l - 3 + 3 + 8. Let v be o(11). Suppose 2 + 13 = -3n, -r + v = -n. What are the prime factors of r? 2, 11 Let x(f) = f3 - f2 - 1. Let z(c) = 3c3 - 22c*2 - 15c - 10. Let s(w) = -2x(w) + z(w). List the prime factors of s(21). 2, 59 Suppose -x + 104 = 3m, -183 = -4x - 4m + 217. List the prime factors of x. 2, 7 Let c = 1771 - 1581. List the prime factors of c. 2, 5, 19 Let w = -6 - 9. Let u = w - -30. What are the prime factors of u? 3, 5 Suppose 3z + 365 = 1094. What are the prime factors of z? 3 Let j(p) = 3p*2 + 3p + 6. Let x be j(-4). Let z be ((-42)/5)/(23/(-115)). Suppose 2t = 2q + x, -2t + 4q + z = q. List the prime factors of t. 3, 7 Let i(q) = 15 - q - 11 + q*3 - 3q*2 + 13q*2 + 11q. What are the prime factors of i(-5)? 79 Suppose 4q - 104 = 4h, 3q + 2h + 18 - 101 = 0. Suppose 2p + q = 9. Let o = p + 11. What are the prime factors of o? 2 What are the prime factors of 5 - (-698 - (4 - -3))? 2, 5, 71 Let m = -100 - -105. Let q be (-2)/39/(-3). Suppose -qa = a, 5a - 105 = -mf. List the prime factors of f. 3, 7 What are the prime factors of (-8364)/(-22) + 30/(-165)? 2, 5, 19 Let y be 2/3(-2 - -13 - -1). What are the prime factors of 1 + ((-2)/(-8) - (-142)/y)? 19 Suppose 17d = 3a + 19d - 119, -2d - 4 = 0. List the prime factors of a. 41 Let l = 15 - 0. Suppose 0 = 4y - 4j - 11 - 9, 3y - 4j = l. Suppose yx - 2u = -7u + 255, -x = -4u - 36. What are the prime factors of x? 2, 3 Suppose 12 = -2g + l + 3l, 5g - 2l - 10 = 0. Suppose -3x - 5t + 78 = 0, gx = -3t - 45 + 160. What are the prime factors of x? 31 Suppose 4l = -0l - 56. Let t(u) = -4u - 16. Let p be t(l). Suppose -2i = 8 - p. What are the prime factors of i? 2 Suppose -10o = -11o. Suppose -4d + 3f + 117 = o, 0 = -2d + 7f - 2f + 69. What are the prime factors of d? 3 Suppose -4f - 136 = -i - 7f, -i = 4f - 141. Suppose 0 = -2w + 4a + i + 7, 3a = 5w - 306. What are the prime factors of w? 2, 3, 5 Let q be ((-190)/(-19))/((-1)/2). Let k(c) = -c*2 - 19c + 23. List the prime factors of k(q). 3 Suppose -4g + g - 24 = 0. Let z(h) = 4h*2 + 16h + 5. List the prime factors of z(g). 7, 19 Suppose 2y - 4 = 2. Suppose 3j - ya - 34 = 2j, 2j - 84 = -2a. What are the prime factors of j? 2, 5 List the prime factors of (1265 + 21)(-3)/(-3). 2, 643 Let z = -162 + 165. Let p be -3 + 3 + -2 - -12. Suppose zf - 41 = p. List the prime factors of f. 17 Suppose -2p = 5t - 24865, 5p + 28 - 3 = 0. List the prime factors of t. 5, 199 Let a = 88 - 60. List the prime factors of 40(a/(-8) - -4). 2, 5 Let u(d) = 2 - 2 + 1 - 2d. Let b be u(-2). Suppose o - 3o - 148 = -bl, l + 4o = 34. List the prime factors of l. 2, 3, 5 Suppose q + 6 = -8. Let b be (0 - 1)(-1 - q). Let y = b + 32. List the prime factors of y. 19 Let z = -106 - -111. List the prime factors of (-4)/z10/(-4) + 84. 2, 43 Suppose f - 5 = -2. Suppose 34 = 2j + v, j - f = -v + 4v. What are the prime factors of ((-6)/(-10))/(3/j)? 3 Suppose 3l - 2p = 169, 5l - 330 = 4p - 45. Let h = 7 + l. List the prime factors of h. 2, 3, 5 Suppose 3 = i - 0. Suppose 0 = -2u - iu. Suppose 2x - v = -ux + 91, -2x = 2v - 82. What are the prime factors of x? 2, 11 Suppose -4k - 24 = 4x, -4x - 54 = -0x - 2k. Let d = 19 - 0. Let m = x + d. List the prime factors of m. 2 Let w = -843 - -883. List the prime factors of w. 2, 5 Let d = -24 - -31. What are the prime factors of 3/d - (-610)/14? 2, 11 List the prime factors of (12 - (-4347)/(-14))/(2/(-4)). 3, 199 Let y be (8/(-3))/2(18 - 21). Let z(o) = o3 + o2 - 3o + 6. List the prime factors of z(y). 2, 37 Let i(r) = -r + 1. Suppose s - u + 2 = 0, 0 = -4s + s - 3u. Let q(c) = 7c - 24. Let x(a) = sq(a) - 6i(a). List the prime factors of x(-16). 2, 17 Suppose 3n = 3t - 0n - 24, 0 = -5t - 3n. Let w(s) = -5s*3 + 3s*t + 9s*3 - 10	{ "pile_set_name": "DM Mathematics" }
letters picked without replacement from {a: 2, n: 5, r: 3, s: 8, k: 1}? 0 What is prob of sequence rj when two letters picked without replacement from jrrjjjrjrjrj? 35/132 Three letters picked without replacement from {d: 4, n: 3}. Give prob of sequence ddn. 6/35 Two letters picked without replacement from ztxlztttatzt. What is prob of sequence la? 1/132 Three letters picked without replacement from {x: 1, z: 1, g: 1, v: 2, u: 5, c: 3}. What is prob of sequence gcx? 1/572 Calculate prob of sequence ou when two letters picked without replacement from ouu. 1/3 Calculate prob of sequence jfnh when four letters picked without replacement from jnhtnft. 1/420 Three letters picked without replacement from {w: 3, k: 3, c: 1}. Give prob of sequence wkk. 3/35 Calculate prob of sequence mdig when four letters picked without replacement from {g: 1, m: 2, i: 1, h: 1, d: 2}. 1/210 Two letters picked without replacement from {r: 1, s: 1, h: 1, q: 3, l: 1}. What is prob of sequence rq? 1/14 Four letters picked without replacement from cioccicoocccccc. What is prob of sequence oioi? 1/2730 Three letters picked without replacement from wynyzxx. What is prob of sequence yxx? 2/105 Calculate prob of sequence ssg when three letters picked without replacement from gssgsssgsg. 1/6 What is prob of sequence jj when two letters picked without replacement from {s: 1, j: 4, f: 5, t: 1}? 6/55 Calculate prob of sequence qzqz when four letters picked without replacement from {z: 5, q: 2}. 1/21 Calculate prob of sequence jjj when three letters picked without replacement from jjcccccjcjcccccccjcc. 1/114 Four letters picked without replacement from {t: 6, k: 4, v: 1}. Give prob of sequence ttvk. 1/66 Three letters picked without replacement from {f: 1, j: 4, k: 3, t: 2, s: 1}. What is prob of sequence jsf? 2/495 Two letters picked without replacement from ooooosoo. Give prob of sequence os. 1/8 Three letters picked without replacement from {o: 12, r: 2, z: 1, w: 2, s: 1}. What is prob of sequence oro? 11/204 Calculate prob of sequence qo when two letters picked without replacement from qbbyooyobojbobobjb. 1/51 Four letters picked without replacement from eeeeneeeeeeeneeene. Give prob of sequence eeen. 91/816 Two letters picked without replacement from {m: 1, n: 1, d: 2, c: 1, t: 1, l: 2}. What is prob of sequence tl? 1/28 What is prob of sequence xxo when three letters picked without replacement from xoox? 1/6 What is prob of sequence ngbg when four letters picked without replacement from gbbgonbbiboggbbnggu? 35/7752 Calculate prob of sequence kk when two letters picked without replacement from {l: 9, k: 10}. 5/19 Calculate prob of sequence xrx when three letters picked without replacement from xrxxrx. 1/5 Three letters picked without replacement from {n: 1, v: 1, s: 2, g: 1, y: 2, u: 2}. Give prob of sequence nug. 1/252 Two letters picked without replacement from {s: 1, o: 1, w: 1, j: 1, r: 2, m: 1}. What is prob of sequence os? 1/42 Three letters picked without replacement from rrpprrprpppr. Give prob of sequence prp. 3/22 Four letters picked without replacement from {p: 1, a: 3, k: 4, d: 2, z: 2}. Give prob of sequence azka. 2/495 What is prob of sequence ng when two letters picked without replacement from gng? 1/3 Two letters picked without replacement from {x: 1, n: 3, f: 2, c: 1}. What is prob of sequence xn? 1/14 Three letters picked without replacement from axaaxxxxxaaaooxxx. Give prob of sequence oao. 1/340 Three letters picked without replacement from orxurje. What is prob of sequence oju? 1/210 What is prob of sequence shh when three letters picked without replacement from {h: 4, s: 3}? 6/35 Two letters picked without replacement from {m: 8, g: 3, b: 2, q: 2}. Give prob of sequence qb. 2/105 Calculate prob of sequence xdto when four letters picked without replacement from dddddttoddxttt. 5/3432 Two letters picked without replacement from ennznedntz. What is prob of sequence dz? 1/45 Four letters picked without replacement from sttsq. What is prob of sequence sqtt? 1/30 Two letters picked without replacement from {x: 3, e: 3}. What is prob of sequence ee? 1/5 Calculate prob of sequence xss when three letters picked without replacement from xuxisiussitxsixuix. 5/408 What is prob of sequence ntle when four letters picked without replacement from {l: 1, e: 2, t: 1, n: 4, j: 3}? 1/990 Three letters picked without replacement from {m: 19, o: 1}. What is prob of sequence oom? 0 What is prob of sequence yyrr when four letters picked without replacement from yyyyyyyryyyryryrry? 13/306 Three letters picked without replacement from nnnnnennnnnennnnnnnn. What is prob of sequence enn? 17/190 What is prob of sequence rrs when three letters picked without replacement from {r: 4, s: 3, t: 7}? 3/182 Four letters picked without replacement from oaarorrrarrarar. What is prob of sequence aaao? 1/273 Calculate prob of sequence celt when four letters picked without replacement from {e: 2, c: 3, j: 2, n: 2, l: 1, t: 2}. 1/990 Calculate prob of sequence orr when three letters picked without replacement from {f: 9, r: 2, o: 3, j: 2}. 1/560 Calculate prob of sequence uuuu when four letters picked without replacement from {u: 7, q: 7}. 5/143 Two letters picked without replacement from {k: 5, i: 2}. What is prob of sequence ii? 1/21 Four letters picked without replacement from {y: 3, n: 3}. Give prob of sequence nyny. 1/10 Calculate prob of sequence aa when two letters picked without replacement from {m: 6, s: 7, a: 4}. 3/68 Calculate prob of sequence cgg when three letters picked without replacement from {g: 2, c: 1, y: 1}. 1/12 Four letters picked without replacement from {q: 1, m: 11}. What is prob of sequence mmmm? 2/3 Two letters picked without replacement from {a: 3, k: 4, n: 1, q: 1, f: 4, v: 1}. Give prob of sequence qf. 2/91 What is prob of sequence eeee when four letters picked without replacement from {e: 5, m: 3}? 1/14 Four letters picked without replacement from {c: 7, x: 3}. Give prob of sequence ccxx. 1/20 Four letters picked without replacement from {d: 10, q: 2}. Give prob of sequence qdqd. 1/66 Three letters picked without replacement from {l: 5, t: 1, c: 1, w: 9, m: 2}. What is prob of sequence wwl? 5/68 Four letters picked without replacement from jrrxjrjjrxrjrr. Give prob of sequence rxrj. 5/286 Four letters picked without replacement from qgglgqlg. Give prob of sequence gqql. 1/105 Three letters picked without replacement from {n: 2, b: 2, t: 8, l: 2}. Give prob of sequence tbl. 4/273 Three letters picked without replacement from {e: 6, f: 3, p: 4, t: 1, c: 1}. What is prob of sequence etf? 3/455 What is prob of sequence jej when three letters picked without replacement from eeejjejjjjjjjjje? 55/336 What is prob of sequence gmpp when four letters picked without replacement from {m: 1, p: 2, j: 3, g: 3, t: 1, v: 1}? 1/1320 Two letters picked without replacement from mmimmmmi. What is prob of sequence mi? 3/14 Calculate prob of sequence ss when two letters picked without replacement from {c: 4, e: 4, s: 6}. 15/91 Calculate prob of sequence mpph when four letters picked without replacement from {m: 3, h: 4, p: 2, k: 9}. 1/3060 Three letters picked without replacement from yqqnl. What is prob of sequence nnq? 0 Three letters picked without replacement from aabaaaabaaaaaabaaa. What is prob of sequence abb? 5/272 Three letters picked without replacement from nnnocnnnocccoccno. Give prob of sequence occ. 1/34 Two letters picked without replacement from kkksikmirsi. What is prob of sequence ms? 1/55 Calculate prob of sequence df when two letters picked without replacement from dfvvhfivdfffvevfh. 3/68 Calculate prob of sequence exx when three letters picked without replacement from bezzeeeexeeeeeexexe. 13/969 Four letters picked without replacement from {i: 2, h: 1, d: 3, v: 1}. Give prob of sequence hiid. 1/140 What is prob of sequence qobq when four letters picked without replacement from qbooqqbo? 3/140 Two letters picked without replacement from tnnntnn. Give prob of sequence nn. 10/21 Two letters picked without replacement from mmmccpam. What is prob of sequence ap? 1/56 Four letters picked without replacement from yyeyeye. Give prob of sequence eeye. 1/35 Two letters pi	{ "pile_set_name": "DM Mathematics" }
What is the s'th term of -41, -14, 29, 88, 163, 254? 8s2 + 3s - 52 What is the t'th term of 31, 9, -27, -77? -7t2 - t + 39 What is the k'th term of -5614, -5610, -5604, -5596? k2 + k - 5616 What is the v'th term of 31, 64, 97, 130? 33v - 2 What is the s'th term of 100847, 100848, 100849, 100850, 100851? s + 100846 What is the c'th term of 16, -38, -104, -188, -296, -434, -608, -824? -c*3 - 47c + 64 What is the t'th term of -1004, -1002, -990, -962, -912, -834, -722? t3 - t2 - 2t - 1002 What is the f'th term of -88, -179, -274, -373, -476, -583, -694? -2f*2 - 85f - 1 What is the b'th term of -11, -15, -19, -23, -27, -31? -4b - 7 What is the s'th term of 541, 563, 585, 607, 629? 22s + 519 What is the d'th term of -3085, -12356, -27807, -49438, -77249, -111240, -151411? -3090d2 - d + 6 What is the t'th term of 1675, 3351, 5027? 1676t - 1 What is the l'th term of -152, -309, -472, -641, -816, -997? -3l2 - 148l - 1 What is the q'th term of 2196, 2197, 2200, 2205? q*2 - 2q + 2197 What is the d'th term of 21, 84, 189, 336, 525? 21d2 What is the h'th term of 30, 58, 86, 114, 142, 170? 28h + 2 What is the v'th term of -7, -21, -37, -55, -75? -v*2 - 11v + 5 What is the r'th term of 22, 49, 86, 139, 214, 317, 454, 631? r3 - r2 + 23r - 1 What is the f'th term of 632, 623, 614, 605? -9f + 641 What is the r'th term of 10, -68, -146, -224? -78r + 88 What is the z'th term of -1882, -1878, -1872, -1864, -1854, -1842, -1828? z2 + z - 1884 What is the d'th term of 152, 162, 178, 200? 3d*2 + d + 148 What is the n'th term of 223, 225, 227, 229? 2n + 221 What is the x'th term of 781, 1562, 2343, 3124, 3905? 781x What is the v'th term of 53, 92, 179, 338, 593, 968, 1487? 4v*3 + 11v + 38 What is the u'th term of 629, 634, 643, 656, 673, 694, 719? 2u2 - u + 628 What is the d'th term of 79, 311, 697, 1237, 1931, 2779? 77d*2 + d + 1 What is the u'th term of 1480, 1479, 1478, 1477, 1476, 1475? -u + 1481 What is the t'th term of 369, 370, 371? t + 368 What is the j'th term of 11, 43, 83, 131, 187, 251, 323? 4j*2 + 20j - 13 What is the g'th term of 44, 96, 150, 206? g*2 + 49g - 6 What is the g'th term of -95, -87, -75, -59, -39? 2g2 + 2g - 99 What is the f'th term of -32, -61, -102, -161, -244, -357, -506, -697? -f*3 - 22f - 9 What is the c'th term of -1071, -2140, -3209, -4278, -5347? -1069c - 2 What is the h'th term of -197, -393, -589, -785? -196h - 1 What is the b'th term of 311, 624, 937, 1250, 1563, 1876? 313b - 2 What is the l'th term of -791, -1583, -2375, -3167, -3959, -4751? -792l + 1 What is the l'th term of 50, 51, 60, 83, 126, 195? l*3 - 2l*2 + 51 What is the r'th term of -21, 39, 197, 501, 999, 1739? 8r3 + r2 + r - 31 What is the o'th term of -204, -413, -630, -855, -1088, -1329, -1578? -4o2 - 197o - 3 What is the i'th term of 27, 50, 77, 114, 167, 242, 345? i*3 - 4i*2 + 28i + 2 What is the q'th term of 21, 45, 105, 219, 405, 681, 1065, 1575? 3q3 + 3q + 15 What is the s'th term of -8, -18, -28? -10s + 2 What is the q'th term of 258, 517, 776, 1035? 259q - 1 What is the h'th term of -7, -2, -7, -28, -71, -142, -247, -392? -h3 + h2 + 9h - 16 What is the p'th term of 0, -34, -112, -234? -22p*2 + 32p - 10 What is the c'th term of -30, -42, -58, -78, -102, -130, -162? -2c2 - 6c - 22 What is the p'th term of -20, -17, -8, 7? 3p2 - 6p - 17 What is the o'th term of 1950, 7800, 17544, 31176, 48690, 70080, 95340, 124464? -o*3 + 1953o*2 - 2o What is the b'th term of -1336, -1330, -1322, -1312? b*2 + 3b - 1340 What is the i'th term of -50, -104, -158, -212, -266, -320? -54i + 4 What is the q'th term of -142, -142, -154, -184, -238, -322, -442? -q3 + 7q - 148 What is the w'th term of 61, 55, 49, 43? -6w + 67 What is the d'th term of -15, -192, -671, -1602, -3135, -5420, -8607, -12846? -25d3 - d2 + d + 10 What is the l'th term of -24, -160, -536, -1272, -2488, -4304, -6840? -20l3 + 4l - 8 What is the k'th term of 95, 73, 37, -13, -77, -155, -247? -7k2 - k + 103 What is the q'th term of 174, 179, 208, 273, 386, 559, 804, 1133? 2q*3 - 9q + 181 What is the j'th term of 4773, 4778, 4785, 4794, 4805, 4818, 4833? j*2 + 2j + 4770 What is the u'th term of -188, -188, -190, -194, -200, -208, -218? -u*2 + 3u - 190 What is the v'th term of -43, -103, -209, -367, -583, -863, -1213? -v*3 - 17v*2 - 2v - 23 What is the m'th term of 12, 49, 146, 333, 640, 1097, 1734, 2581? 5m3 + 2m + 5 What is the j'th term of -57, -89, -121, -159, -209, -277? -j*3 + 6j*2 - 43j - 19 What is the i'th term of 39, 65, 75, 63, 23, -51, -165? -i*3 - 2i*2 + 39i + 3 What is the y'th term of -496, -495, -494? y - 497 What is the a'th term of -908, -907, -906, -905? a - 909 What is the q'th term of -7, 85, 239, 455, 733, 1073? 31q2 - q - 37 What is the v'th term of -67, -66, -65, -64? v - 68 What is the q'th term of 41, 35, 33, 41, 65, 111, 185, 293? q3 - 4q*2 - q + 45 What is the c'th term of -204, -216, -248, -312, -420, -584, -816, -1128? -2c*3 + 2c*2 - 4c - 200 What is the t'th term of -52, -179, -396, -709, -1124, -1647, -2284, -3041? -t*3 - 39t*2 - 3t - 9 What is the o'th term of -40, -78, -148, -256, -408? -o*3 - 10o*2 - o - 28 What is the x'th term of -763, -757, -751, -745, -739? 6x - 769 What is the f'th term of -79, -61, -27, 29, 113, 231, 389, 593? f*3 + 2f*2 + 5f - 87 What is the c'th term of 4, 20, 50, 100, 176, 284? c3 + c2 + 6c - 4 What is the o'th term of -20, -288, -1014, -2426, -4752, -8220, -13058? -38o3 - o2 + o + 18 What is the h'th term of 25, 14, -1, -20, -43, -70? -2h2 - 5h + 32 What is the w'th term of 247, 228, 209, 190, 171? -19w + 266 What is the d'th term of -263, -265, -267, -269, -271? -2d - 261 What is the x'th term of 117, 273, 429, 585, 741, 897? 156x - 39 What is the r'th term of -7, -24, -57, -112, -195, -312? -r3 - 2r*2 - 4r What is the m'th term of 5, 18, 41, 80, 141, 230? m3 - m2 + 9m - 4 What is the r'th term of -364, -729, -1094, -1459, -1824? -365r + 1 What is the x'th term of -4, -5, -16, -43, -92, -169, -280, -431? -x3 + x2 + 3x - 7 What is the t'th term of -163, -175, -203, -253, -331, -443? -t3 - 2t*2 + t - 161 What is the u'th term of -17, -56, -119, -206, -317, -452, -611? -12u*2 - 3u - 2 What is the v'th term of -43, -69, -97, -127, -159, -193, -229? -v*2 - 23v - 19 What is the p'th term of 43, -66, -365, -950, -1917, -3362, -5381, -8070? -16p3 + p2 + 58 What is the v'th term of 113, 102, 91, 80, 69, 58? -11v + 124 What is the o'th term of 1195, 2401, 3621, 4861, 6127, 7425, 8761, 10141? o3 + o2 + 1196o - 3 What is the j'th term of -1185, -2371, -3557, -4743? -1186j + 1 What is the z'th term of 0, 7, 14? 7z - 7 What is the d'th term of -34, -71, -122, -193, -290, -419? -d3 - d2 - 27d - 5 What is the m'th term of -913, -914, -915, -916? -m - 912 What is the p'th term of 32862, 32863, 32864, 32865? p + 32861 What is the f'th term of 81, 102, 123? 21f + 60 What is the q'th term of -17, 34, 109, 202, 307, 418, 529? -q3 + 18q*2 + 4q - 38 What is the c'th term of -266, -538, -812, -1088? -c*2 - 269c + 4 What is the h'th term of 10192, 10194, 10198, 10204? h2 - h + 10192 What is the w'th term of 6039, 6040, 6041, 6042, 6043? w + 6038 What is the r'th term of 1607, 1612, 1629, 1664, 1723, 1812, 1937? r3 - 2r + 1608 What is the r'th term of 52, 104, 156? 52r What is the i'th term of -57, -46, -37, -30, -25, -22, -21? -i*2 + 14i - 70 What is the h'th term of 555, 2219, 4993, 8877, 13871? 555h2 - h + 1 What is the k'th term of 377, 436, 541, 698, 913, 1192, 1541? k3 + 17k*2 + k + 358 What is the k'th term of -215, -207, -199, -191, -183, -175? 8k - 223 What is the r'th term of 27, 57, 137, 291, 543, 917, 1437? 4r3 + r2 - r + 23 What is the c'th term of -739, -729, -705, -661, -591? c3 + c2 - 741 What is the q'th term of -201, -404, -607, -810? -203q + 2 What is the h'th term of 123, 120, 117, 114? -3h + 126 What is the s'th term of 19, 7, 5, 19, 55? s3 - s2 - 16s + 35 What is the g'th term of 899, 906, 917, 932? 2g*2 + g + 896 What is the t'th term of -2990, -5990, -8994, -12002, -15014, -180	{ "pile_set_name": "DM Mathematics" }
- 12465j2t + 199t wrt j? -137758968jt - 60t Find the first derivative of 2815bo*2 + 4bop + 8bp + 171261b - 154o*2p + 4p wrt o. 5630bo + 4bp - 308op Find the second derivative of -165197669w*3 + 82837703w. -991186014w Differentiate 1958k*4 - 55k*2 + 19k - 210309750. 7832k3 - 110k + 19 Find the second derivative of 2964269h3 - h2 - 13423870h wrt h. 17785614h - 2 Find the first derivative of 11304s*2y*3 - 3s*2y - 24sy*3 - 40502y*3 - 50y wrt s. 22608sy*3 - 6sy - 24y*3 Find the second derivative of 11421y*3 - 781y*2 - 57y + 357338 wrt y. 68526y - 1562 Differentiate 4554134cm2z - 4cmz2 - 16204m*2z2 + m2 - mz - 12z*2 wrt c. 4554134m*2z - 4mz*2 Find the third derivative of -19071067o*4 + 7854096o*2 - 2. -457705608o What is the first derivative of -715060034gz3 - z3 - 65725978z2 wrt g? -715060034z*3 Find the second derivative of -15334344j*3 - 570j + 1906 wrt j. -92006064j What is the third derivative of 3781209k*4 - 22812971k*2 wrt k? 90749016k Find the first derivative of 9383j2 - 117j + 4845503 wrt j. 18766j - 117 Find the first derivative of 12963156x*4 + 156019191. 51852624x*3 What is the first derivative of -16m*2 + 21606mz2 + 18081812z*2 wrt m? -32m + 21606z2 Find the third derivative of 23380ap3 - ap*2 - 487013a + 198p3 - 10p wrt p. 140280a + 1188 What is the third derivative of -j4x + 19j4 + 7309j*3x + 9j3 - 258j*2x + jx - 7j - 18x + 1 wrt j? -24jx + 456j + 43854x + 54 Differentiate -9klt*3 - 20350002kl - 66kt2 + 4kt + k - 7556t*3 wrt l. -9kt3 - 20350002k Find the second derivative of -278972663j3 - 34160700j wrt j. -1673835978j What is the derivative of 42ilq*3 + 87646ilq*2 - 3iq2 - 2i - 10q3 - 75q - 9 wrt l? 42iq*3 + 87646iq2 Find the third derivative of 1456847n*4 - 13522496n*2 + 1 wrt n. 34964328n What is the derivative of -25179gh*3 + gh*2 - 85gh - h3 + 4895193h*2 wrt g? -25179h3 + h2 - 85h Find the second derivative of -76537248i*3 - 61727334i wrt i. -459223488i Differentiate -7197g*2o + 28758192g2 - 27go + 51o wrt o. -7197g2 - 27g + 51 Find the third derivative of -7326020c3 - 2c*2 + 248c - 363. -43956120 What is the second derivative of 2195780f3 - 4345887f + 1 wrt f? 13174680f What is the first derivative of 3fq4 - 648fq - 3614539f + 19q4 wrt q? 12fq3 - 648f + 76q3 Differentiate -1599hn2 + 5hv - 1206178h + 10n4 - 14nv with respect to n. -3198hn + 40n*3 - 14v Find the third derivative of 18268037k4 + 14894763k*2 wrt k. 438432888k What is the first derivative of 17949112n + 18837332? 17949112 Find the second derivative of -113068375o*4 - 1213o - 44043 wrt o. -1356820500o2 What is the derivative of -13812b*2t*2 - 631582b*2 + 2bt - 12t wrt t? -27624b2t + 2b - 12 Find the second derivative of 866658792y*5 - 536918448y wrt y. 17333175840y3 Find the third derivative of 437922994k*4u*3 + 54398k*2u - ku2 + 567u*3 wrt k. 10510151856ku3 What is the derivative of 2f*2i - 1951418f2 + 375231fi4 - 8i wrt i? 2f2 + 1500924fi3 - 8 What is the second derivative of 225h*5 - 2h*4 + 15h3 + h2 + 3155734h? 4500h*3 - 24h*2 + 90h + 2 Find the first derivative of -5466916o + 258893830 wrt o. -5466916 Find the third derivative of 11906685m*5 - 2m*4 + 5m*2 + 3m - 742748. 714401100m2 - 48m Find the second derivative of -6y5 + 81y*3 + 713y*2 - 3205087y. -120y3 + 486y + 1426 Find the first derivative of -91hl*2 + 2624hlv - 32204l3v - 178987l3 wrt v. 2624hl - 32204l*3 What is the second derivative of -69211720q*2 + 8965361q? -138423440 Find the second derivative of 5664718a2o*4 + 10a*2o - 1825a2 - 2ao5 - 68ao wrt o. 67976616a*2o*2 - 40ao3 Find the second derivative of 375208174m*3 + 47m + 17746 wrt m. 2251249044m What is the third derivative of -7v*5 - 8v*4 - 3700v*3 - 27705104v*2? -420v*2 - 192v - 22200 What is the second derivative of 216418449f2 - 13719596f wrt f? 432836898 Find the second derivative of 69650597b2 + 765135416b wrt b. 139301194 Find the second derivative of o*4 + 11562944o*2 - 69721o - 127. 12o2 + 23125888 Find the second derivative of 115828700x*5 - 1351827x + 11 wrt x. 2316574000x3 Differentiate -48057468h*2 - 34331501. -96114936h What is the first derivative of -172432463x - 389137609? -172432463 Find the first derivative of -188873g + 312912. -188873 Find the first derivative of 7i3 - 240i*2 - 424i + 12298027 wrt i. 21i2 - 480i - 424 What is the third derivative of 2576490a4 + 8822a*2 + 2606? 61835760a What is the derivative of -9535758h - 2472401? -9535758 Find the second derivative of -2g*3 - 2508700g*2 - 704g + 764 wrt g. -12g - 5017400 Find the third derivative of -60030994a*2j*3 + 41a*2j*2 - 2j*3 - 4780j*2 - 7j wrt j. -360185964a2 - 12 Differentiate -2hoy + 63020ho + 634hy*2 - 1408443oy2 - 3oy - 1 wrt h. -2oy + 63020o + 634y2 What is the third derivative of -43q*4r + 28q4 + 8q*3r + q*3 - 401q*2r + 1696r wrt q? -1032qr + 672q + 48r + 6 What is the first derivative of -2v*2 - 3808528v + 8364198 wrt v? -4v - 3808528 Find the third derivative of -6023c*3n*2 - 5813c*3n + 26c2n*2 + 6965cn2 + c + n2 + 40 wrt c. -36138n*2 - 34878n Find the second derivative of -21104748s2 - 100761541s wrt s. -42209496 What is the second derivative of -38606920l3 + 1266352l - 1? -231641520l Find the first derivative of 2v*2 + 162024450v - 424934827. 4v + 162024450 What is the third derivative of 3m*6 + 4m*3o*2 + 59938m*3o - 3m2o*2 + 2110805m*2o wrt m? 360m3 + 24o*2 + 359628o Find the second derivative of -t*2w*2 + 256862t*2w - 3t2 - 3tw2 - 14t + 3w2 + 493 wrt t. -2w*2 + 513724w - 6 Differentiate 21fij + fj*2 + 11550fj - 4ij2 + 2i - 763j2 + 4j + 3 with respect to f. 21ij + j*2 + 11550j Find the second derivative of 38896h3m*2p - 132h3 + 1642h*2p*2 - 53hmp*2 - 4040m*2p*2 + 2m wrt m. 77792h3p - 8080p2 What is the second derivative of -346514646n*2 + 34441597n wrt n? -693029292 What is the second derivative of -3023o2w3 - o2w2 - 521o*2w + ow3 + 10ow + 538o - 479w3 - w - 1 wrt o? -6046w*3 - 2w*2 - 1042w Differentiate 674654725i2j*3 - 7j*3 - 12j*2 - j - 202593 with respect to i. 1349309450ij3 What is the third derivative of 38496636i*3 + 2i*2 + 7347i + 236? 230979816 What is the derivative of 4339914a4 - 13a*2 - 14396902? 17359656a*3 - 26a Find the second derivative of -29641399z3 - 21194488z wrt z. -177848394z What is the derivative of -p4 + 147892p*2 - 628p - 246230209? -4p3 + 295784p - 628 What is the second derivative of 336918336p5 + 47565228p? 6738366720p3 What is the third derivative of 12268146n*2t4 - n2t2 + 6nt6 + 998nt2 + nt - 2t2 + 5t - 6 wrt t? 294435504n2t + 720nt*3 What is the third derivative of 38662241b*3z - 12484b2z - 182z wrt b? 231973446z What is the second derivative of -193426119n2x - 41nx + 2n - 5x + 97192 wrt n? -386852238x Find the third derivative of -1166067s*5 - 2s*3 - 6s*2 + 26s - 3771. -69964020s2 - 12 What is the first derivative of -660b*2m + 5b2 - 4675bm + 10m - 26963641 wrt m? -660b2 - 4675b + 10 Find the third derivative of 1765764k3l + 12k3z + 11k2l - 5k2z - 19lz + 59l + 8 wrt k. 10594584l + 72z What is the third derivative of 2i*5 - 73623343i*4 + 135811112i*2 wrt i? 120i*2 - 1766960232i Find the third derivative of 538102543c5 - 62022252c*2 wrt c. 32286152580c*2 Find the first derivative of -17283452i*2z - 28236677z wrt i. -34566904iz Find the first derivative of 968946x*2 - 264x - 100942789. 1937892x - 264 Find the second derivative of -16422lp4 + 2765lp - 36l - 44p4 + 5p wrt p. -197064lp*2 - 528p**2 What is the second deriv	{ "pile_set_name": "DM Mathematics" }
nearest ten? 410 Round -27.7124 to one decimal place. -27.7 What is -0.0000946 rounded to 5 dps? -0.00009 What is 0.0000021159 rounded to five dps? 0 What is 0.00041 rounded to 3 decimal places? 0 Round 796090 to the nearest one hundred thousand. 800000 Round -349500 to the nearest ten thousand. -350000 What is 197.2 rounded to the nearest ten? 200 What is 0.000004149 rounded to 7 dps? 0.0000041 What is 0.03094 rounded to 3 dps? 0.031 What is 2310600 rounded to the nearest 10000? 2310000 Round -0.00000060481 to 7 dps. -0.0000006 What is -0.00014899 rounded to 5 dps? -0.00015 Round -0.02667 to two decimal places. -0.03 What is -0.0011706 rounded to 5 decimal places? -0.00117 Round 8.529 to the nearest integer. 9 Round 93.64 to the nearest 10. 90 What is -146000 rounded to the nearest one hundred thousand? -100000 What is -0.1763 rounded to 2 dps? -0.18 What is -68950 rounded to the nearest 1000? -69000 Round 0.000130607 to four decimal places. 0.0001 Round -1940000 to the nearest 1000000. -2000000 Round -11073000 to the nearest one million. -11000000 Round -6270000 to the nearest one hundred thousand. -6300000 Round -0.0000759 to 4 dps. -0.0001 Round -7052.3 to the nearest 100. -7100 What is 0.01408 rounded to 4 decimal places? 0.0141 Round 2089.2 to the nearest 10. 2090 What is 3830000 rounded to the nearest one hundred thousand? 3800000 Round -0.00000033392 to 7 decimal places. -0.0000003 Round 13382600 to the nearest one million. 13000000 What is 1.1089 rounded to two decimal places? 1.11 Round 112 to the nearest 10. 110 What is 0.00789 rounded to three dps? 0.008 Round 789000 to the nearest one hundred thousand. 800000 Round 0.00000010036 to seven decimal places. 0.0000001 Round -112937 to the nearest one thousand. -113000 Round -31300 to the nearest one thousand. -31000 Round -0.0479 to 2 dps. -0.05 Round 0.0043509 to four dps. 0.0044 What is -0.00000622 rounded to 6 decimal places? -0.000006 Round -1026.722 to the nearest one hundred. -1000 Round 565600 to the nearest 10000. 570000 Round 0.000001813 to seven dps. 0.0000018 Round 4240000 to the nearest 100000. 4200000 What is -0.0000075371 rounded to 7 dps? -0.0000075 Round 0.0001825 to 6 dps. 0.000183 What is 0.0000000668 rounded to 7 dps? 0.0000001 What is 0.00000018098 rounded to seven dps? 0.0000002 Round 0.00382 to four decimal places. 0.0038 What is 0.4723 rounded to 2 decimal places? 0.47 What is -111790 rounded to the nearest 1000? -112000 Round -273640000 to the nearest one million. -274000000 Round 161540 to the nearest ten thousand. 160000 Round -0.81102 to 3 dps. -0.811 Round 0.009061 to three decimal places. 0.009 Round -0.0000593 to 6 decimal places. -0.000059 Round 0.362 to 2 decimal places. 0.36 What is -0.0001318 rounded to 4 decimal places? -0.0001 Round -0.00000009687 to seven dps. -0.0000001 Round 14.447 to 0 decimal places. 14 Round -6019300 to the nearest one hundred thousand. -6000000 Round -288200 to the nearest 100000. -300000 Round 0.1328 to 3 dps. 0.133 What is 27293.6 rounded to the nearest 10000? 30000 Round 101867 to the nearest 1000. 102000 Round -0.0000015735 to seven decimal places. -0.0000016 Round 0.34156 to two decimal places. 0.34 Round 56.798 to zero dps. 57 Round 1.4274 to one dp. 1.4 Round -0.0000000933 to seven dps. -0.0000001 Round 0.000005617 to seven decimal places. 0.0000056 Round 5813800 to the nearest one hundred thousand. 5800000 Round 206120 to the nearest 1000. 206000 What is 0.00014119 rounded to six dps? 0.000141 What is -331200000 rounded to the nearest one million? -331000000 Round -4279000 to the nearest one hundred thousand. -4300000 Round 0.00037364 to 6 decimal places. 0.000374 Round 5441000 to the nearest one million. 5000000 Round -32.4 to the nearest ten. -30 Round 7.9843 to 0 dps. 8 Round -0.00003994 to six dps. -0.00004 What is -0.14839 rounded to 3 decimal places? -0.148 What is -0.00001253 rounded to 5 dps? -0.00001 Round 0.0001584 to five dps. 0.00016 What is 372000 rounded to the nearest one hundred thousand? 400000 What is 0.00010091 rounded to 5 decimal places? 0.0001 Round 0.0028911 to 5 dps. 0.00289 Round 12060000 to the nearest 1000000. 12000000 What is 239560 rounded to the nearest ten thousand? 240000 What is 0.0000002463 rounded to seven decimal places? 0.0000002 Round 396600 to the nearest 1000. 397000 What is 0.000738 rounded to three decimal places? 0.001 What is -1183580 rounded to the nearest 10000? -1180000 What is -942000 rounded to the nearest 100000? -900000 What is 1.354 rounded to 2 dps? 1.35 Round -0.06016 to two decimal places. -0.06 Round -27.65 to the nearest integer. -28 Round -24344.8 to the nearest 10000. -20000 What is 11079.7 rounded to the nearest ten? 11080 Round 0.2389 to two dps. 0.24 Round -316.9 to the nearest 100. -300 What is 8.783 rounded to 0 dps? 9 What is 440.4 rounded to the nearest ten? 440 What is -0.00001903 rounded to 6 dps? -0.000019 Round 0.00776 to 4 dps. 0.0078 Round -0.03664 to 3 decimal places. -0.037 Round 200.86 to the nearest integer. 201 Round -469710000 to the nearest one million. -470000000 What is 7289000 rounded to the nearest 100000? 7300000 Round -693.66 to the nearest ten. -690 Round -239600 to the nearest 10000. -240000 What is -0.00003588 rounded to six dps? -0.000036 What is 18.121 rounded to zero dps? 18 What is -0.347 rounded to one dp? -0.3 Round 20822000 to the nearest 100000. 20800000 What is -0.0000016555 rounded to 7 dps? -0.0000017 Round -0.002106 to four dps. -0.0021 What is 8.426 rounded to 1 decimal place? 8.4 Round -0.0001238 to five decimal places. -0.00012 What is -0.00019141 rounded to 5 dps? -0.00019 What is -0.0000296 rounded to 6 decimal places? -0.00003 What is -0.51179 rounded to 3 dps? -0.512 Round 837.8 to the nearest one hundred. 800 What is 0.0000117748 rounded to six decimal places? 0.000012 Round 0.0000096547 to six decimal places. 0.00001 What is -283900 rounded to the nearest one hundred thousand? -300000 Round 930530 to the nearest one hundred thousand. 900000 Round -36127000 to the nearest one hundred thousand. -36100000 What is -2086 rounded to the nearest one hundred? -2100 What is 18.3202 rounded to 1 decimal place? 18.3 Round -4613 to the nearest one thousand. -5000 What is -6782000 rounded to the nearest 1000000? -7000000 Round -389390 to the nearest 10000. -390000 Round 9446000 to the nearest one million. 9000000 What is 0.256 rounded to zero decimal places? 0 What is -0.002403 rounded to four dps? -0.0024 What is -0.0039229 rounded to 3 decimal places? -0.004 Round 0.000035199 to 6 decimal places. 0.000035 Round -11755 to the nearest 100. -11800 What is -3583100 rounded to the nearest 100000? -3600000 Round -0.00052961 to six dps. -0.00053 Round 0.143 to one decimal place. 0.1 Round 1.19703 to 2 decimal places. 1.2 What is 266370 rounded to the nearest 1000? 266000 What is -0.010138 rounded to four decimal places? -0.0101 What is -8776000 rounded to the nearest one hundred thousand? -8800000 What is -130100000 rounded to the nearest one million? -130000000 Round 4.57 to the nearest integer. 5 Round -616700 to the nearest one hundred thousand. -600000 Round -28470 to the nearest ten thousand. -30000 What is -0.0773 rounded to two decimal places? -0.08 What is -235.94 rounded to the nearest 10? -240 Round 0.8875 to one decimal place. 0.9 What is -0.0035185 rounded to three dps? -0.004 Round -0.24582 to 3 decimal places. -0.246 What is -8319800 rounded to the nearest ten thousand? -8320000 What is 0.000009062 rounded to 7 dps? 0.0000091 Round 0.000029154 to six dps. 0.000029 What is 53.65 rounded to the nearest 10? 50 What is -1303000 rounded to the nearest 100000? -1300000 Round 0.000000375 to seven decimal places. 0.0000004 Round 129250 to the nearest 10000. 130000 What is -2232380 rounded to the nearest 100000? -2200000 What is -0.00003591 rounded to five dps? -0.00004 What is 7550000 rounded to the nearest one hundred thousand? 7600000 Round -200170 to the nearest ten thousand. -200000 Round -0.0000008237 to 7 decimal places. -0.0000008 Round 0.006894 to four decimal places. 0.0069 What is 0.0033512 rounded to 4 decimal places? 0.0034 Round 1.61732 to 2 decimal places. 1.62 Round -0.0124132 to 4 decimal places. -0.012	{ "pile_set_name": "DM Mathematics" }
m + 3g = -1, -2m - 2m + 10 = 2g for m. 2 Solve -r = -n - 10, 6n + 3r - 25 = 8n for n. -5 Solve 9 = -4j + u, -3u = 2j - 0u - 13 for j. -1 Solve z + 4b = 2b + 2, -3z = 4b for z. -4 Solve 4i = 2i + 3a - 13, -5i = -3a + 19 for i. -2 Solve -3i - 86 + 71 = 3a, 4i = 9a + 19 for i. -2 Solve 2f - 10 = 2i, 251 - 245 = -3i for f. 3 Solve -2m - 11 = 2b - 1, 0 = -4m + 3b - 6 for m. -3 Solve -5 = i + 3z, i - 25z = -22z + 1 for i. -2 Solve -4h = 3a - 10, -11 = -7a + 4a - 5h for a. 2 Solve -5o - 13d + 15 = -15d, -3d - 15 = 0 for o. 1 Solve 3o + 56 = -3b + 80, -2b - 8 = -4o for b. 4 Solve 7k = 9k + u + 8, -k = -5u - 18 for k. -2 Solve -3z - 3 = 0, 0 = -2j - z - 3 - 8 for j. -5 Solve -2o = -2n + 2, 0 = -o - 5n - 3 + 8 for o. 0 Solve 0 = -5j + 3j + 4x + 14, j - 3x = 10 for j. 1 Solve 0k - m = 3k - 13, 0 = -4k + 4m + 28 for k. 5 Solve -4h + 7h - 2g + 4 = 0, -2 = 2h - 2g for h. -2 Solve 625g - 3c = 621g - 3, -5g = -3c + 6 for g. -3 Solve 10p - 5a - 20 = 11p, -5p = -4a - 45 for p. 5 Solve -4l + 17 = -5p - 11, -2 = -l for p. -4 Solve -4l - v + 3 = 0, -l + 3v = 15 - 6 for l. 0 Solve -5f + 8 = -2m, -1 - 19 = 5m - f for m. -4 Solve -a = -2m - 1, 2a = 5m + 6a - 17 for m. 1 Solve -4i - 8 = 2o + 2, 3i + 11 = 2o for o. 1 Solve y - 3k + 11 = 0, 7 + 5 = -4y - 4k for y. -5 Solve -21 + 32 = m + 4s, -3 = m - 3s for m. 3 Solve q = -2n + 12, 7n - 4 = 3q + 3n for q. 4 Solve 5m = -3p - 3, -3p + 291m = 295m + 3 for p. -1 Solve 0u + 4u - 4 = 4s, -3u - 4s + 3 = 0 for u. 1 Solve -5j - 14 = -3p, 4j = -5p - 0 + 11 for p. 3 Solve -7g - 15 = -36w + 41w, -3g - w - 11 = 0 for g. -5 Solve 4r + p = -12, -3p - 8 = -2r - 0p for r. -2 Solve -9 - 21 = 5a + m, m + 12 = -2a for a. -6 Solve -5l = 3y - 40, -5y = 11 - 36 for l. 5 Solve -3q = k - 0k + 1, -4k + 9 = -q for q. -1 Solve 0 = 3n - 5y - 19 - 1, y = -4 for n. 0 Solve 2p - 13 = -3h, -2p + 4h - h = 5 for p. 2 Solve 3p - 18b + 15b - 12 = 0, 0 = 5p + 5b - 20 for p. 4 Solve -y + 4j - 13 = 0, -24y + 4j - 16 = -20y for y. -1 Solve -2x - 13 = -5m - x, 0 = 2m - 5x - 19 for m. 2 Solve u + 26 - 9 = 5q, 0 = -5u + 2q + 7 for u. 3 Solve 3s = 3x - 6 - 6, x = -2s - 5 for s. -3 Solve 5b - 16 = -t + 4, 5b + 10 = 5t for b. 3 Solve -5d - 6 - 2 = -l, 5l = 5d for d. -2 Solve 4p - 9 = 3v + 4, -p + 4v = 0 for p. 4 Solve -5f + 8 = v, -v + 0v + 4f = 10 for v. -2 Solve 103l - 106l + c = -13, -2c + 4 = 0 for l. 5 Solve 3s = 5a - s - 5, -5s = 25 for a. -3 Solve 4i - 3f + 6 + 2 = 0, 4f = 16 for i. 1 Solve 5d = 5, 7q + d = 11q - 19 for q. 5 Solve -5j - 165f = -169f + 17, 0 = -2j + 3f - 4 for j. -5 Solve 3n = 2s + 2, 5s + 5 + 0 = -4n for s. -1 Solve -3i + 3z = -17 + 8, 3i - 2z = 6 for i. 0 Solve 15 = -0m + 3m, 5w + 4m - 40 = 0 for w. 4 Solve 5v - 5p + 40 = -10p, 4p + 26 = -2v for v. -3 Solve -5d = 5p, -23 = -5p + 3d - 15 for p. 1 Solve 0 = -2l + 3c - 15, -2c + 4c = -3l - 3 for l. -3 Solve 8b - 12r - 52 = 6b, -4b + 3r + 20 = 0 for b. 2 Solve v + 0n + 5n = -20, -2v = 2n for v. 5 Solve 3b + 85d - 86d = -9, -5d = -5b - 15 for b. -3 Solve 22 = 5s - 3p, -3p - 8 = -p for s. 2 Solve -4d = 4z + 12, 2d + 4 = 4z - 8 for z. 1 Solve 2h = 3a - 14 - 5, 3h = -4a + 14 for a. 5 Solve -6v = -10v - 3d + 22, -5d = -4v + 6 for v. 4 Solve 0q = 4q - 20, q = -3l - 1 for l. -2 Solve -5i - 2d - 29 = 0, 3d = -5i + 5d - 21 for i. -5 Solve -p = -g - 0 - 4, 3g - 4p + 15 = 0 for g. -1 Solve 6p + 12 = 3a + p, -5p - 20 = -5a for a. 4 Solve -17 = g + c - 12, 4c = 8 for g. -7 Solve 28 = -4j + 4m, 0j - 5j - 19 = 3m for j. -5 Solve -79x - 22 = -l - 74x, 2x - 5 = 5l for l. -3 Solve r - 18 = -5v, -3v + 6 + 9 = 2r for r. 3 Solve -2j = 2m + 14, 5j = j - m - 13 for j. -2 Solve -15 = -5x, 0 = -5a + 6x - 11x + 35 for a. 4 Solve 7f - 34 = -3w + 2f, 3w + 6 = 3f for w. 3 Solve 6 = -4w - 5b - 23, 0 = w - 3b - 14 for w. -1 Solve -3d + 2s = -13, -2d - 7s = -4s for d. 3 Solve 2l + 5s = 22, -2s = 3l + s - 15 for l. 1 Solve 0k = -k - 3l + 13, 4k - 3l = -23 for k. -2 Solve 3p + 3s = 15, -4s + 10 = -51p + 53p for p. 5 Solve -3v = -4i + 23, 3v + 0i - 5i + 28 = 0 for v. -1 Solve -2q = -4p + 6p - 2, -5q - 30 = -2p for q. -4 Solve 0 = -3z - 5g - 35, -5z - 2g = 25 + 8 for z. -5 Solve -3o + 24 = 4u + o, 0 = -5u + 4o - 15 for u. 1 Solve -3u + 9 = 5t, 2u = -13 + 9 for t. 3 Solve -5g - o + 9 = 0, -6o + o + 20 = 0 for g. 1 Solve b + 2j = 3, -2b - 2j + 6 = -2 for b. 5 Solve 2b = -d - 2 + 1, 5d + 33 = 4b for b. 2 Solve -4l + 5t - 14 = 0, 0l - 8 = 2l - 3t for l. -1 Solve 0 = 5m + g - 28, 3g + 5 = 14 for m. 5 Solve -2z + 2 = -0t + 2t, 5t - 37 = -13z for z. 4 Solve 10g - 11g + 3 = 0, 0 = -4f - 2g + 10 for f. 1 Solve 4l - 12 = 4y, 0 = -11l + 10l - 2y - 9 for l. -1 Solve 4o + 12 = -0w - 4w, -4 = 2o for w. -1 Solve -2l - 14 = -n + 5n, -n = l + 5 for n. -2 Solve -27r + 25r + 2 = -l, l + 5 = 5r for r. 1 Solve 2d + 4g - 18 = 3d, 3d + 3g - 21 = 0 for d. 2 Solve 0p = -v - p + 2, 0 = -4v - 5p + 8 for v. 2 Solve -2h - 4d - 15 = 3, -2h + 4d = -6 for h. -3 Solve 0 = -3s - 4g - 7, 0 = 4s - 4g + 5 - 33 for s. 3 Solve 2o + 4y = 12, y - 10 = -3o + 3 for o. 4 Solve -j + a = -1, 0 = 2j + 2a + 3 - 17 for j. 4 Solve 10 = 2v, 5g + v + 13 + 2 = 0 for g. -4 Solve 4m = -4t + 12, -m - 19 + 7 = -4t for t. 3 Solve -5j = -2y - 9, 9j + 5 = -4y + 6j for y. -2 Solve 17s - 15s = -5k + 28, 0 = -2k + 8 for s. 4 Solve 0 = -2n + 3s + 2, -2s + 0 - 4 = 0 for n. -2 Solve p - 96 = 3k - 93, 5k = -4p + 12 for p. 3 Solve g = 4g + 3, 0 = -4m - 4g for m. 1 Solve -2c = 4t - 14, 3c + 24 = 4t + 7c for t. 1 Solve 4s - 4 = 0, 2q = 36s - 33s + 5 for q. 4 Solve 8 = 4o - 4n, 8n - 13n - 25 = 0 for o. -3 Solve 3a + 10 = 2u - 13, -a + u = 9 for a. -5 Solve 4h + 2 = -5x - 1, -2h = 4x for h. -2 Solve 0 = 4a + 5x + 16, 2a - 2x = 2 + 8 for a. 1 Solve 2i - 4 = 0, 0 = -4f - 3i + 12 + 6 for f. 3 Solve 19 = 4o + 3m, 2o + 3o + 5m - 25 = 0 for o. 4 Solve -4l = -2f - 2l + 2, 0 = -3f + 2l for f. -2 Solve 2v - 5o = 9, 5 = 6v - 2v + 3o for v. 2 Solve 13 = 4j + u, j + 0u - 5u + 2 = 0 for j. 3 Solve -3g = 3v, -3v = -g - 0v for g. 0 Solve -s + 13 - 8 = 0, 0 = -3i + 2s - 4 for i. 2 Solve 5x - 121 + 141 = -u, -3x + 5u - 40 = 0 for x. -5 Solve 2j - 5 = 5j + 5h, -2j = 3h + 2 for j. 5 Solve -23 = -5j + 4w - 15, 3w + 25 = -j for j. -4 Solve -5w + 4f + 17 = 5f, f = 2w - 11 for w. 4 Solve 4h - 13 = 5n + 2, -2n - 4h = 6 for n. -3 Solve 0 = -3n - 2c + 12, -8c = -6c for n. 4 Solve 5t = 4s - 8, -4t - 3s = -0t + 25 for t. -4 Solve -25 = -d + 8a + 11, 4a = 5d - 36 for d. 4 Solve 2i - 4i = -k - 12, -i - 16 = 5k for k. -4 Solve 3w = 4n - 120 + 144, 0 = 3w + 5n + 3 for w. 4 Solve 26 = -4s + 3g, 7s - 8s - 15 = -5g for s. -5 Solve -2h + 4 = -2u, 6 = 8h - 7h + 3u for h. 3 Solve 0 = 10s - 5s + 10, 18 = 4x - s for x. 4 Solve 0 = -0o - o - 2p + 5, 2o - 7 = -3p for o. -1 Solve -5a = -3o - 30, -4o + 10 = 3a + 21 for o. -5 Solve 5c = -2q + 17, 0 = 3q - 196c + 195c for q. 1 Solve 3l + 4r - 9 = 11, 0 = -3l + r - 5 for l. 0 Solve g - 2g = 2a + 1, 0 = 3g + 3a for g. 1 Solve 3l - 4l + 5m = 12, -m = -4l - 29 for l. -7 Solve -4m + 21 + 1 = 2n, 15 = n + 3m for n. 3 Solve -2x + 5 = j, 28 - 8 = 4j + 4x for j. 5 Solve -5p = 2j, 4p = 4j - 2j - 18 for p. -2 Solve -3o - 8 = 5u, 15u - 19u - 2o - 6 = 0 for u. -1 Solve z + f + 0f = 0, 18 = -5z + f for z. -3 Solve 0 = v - 5m - 18, 6m - 2m - 3 = -5v for v. 3 Solve -4a = -4d - 12, -16 = -5a + a for d. 1 Solve s = -5l - 12, -30l + 8 = -2s - 32l for s. -2 Solve 4q = -5b - 41, -q = -2b - 0b - 6 for q. -4 Solve 0 = -2j - 8, 0 = -5p - 6j + 2j - 26 for p. -2 Solve y = 2w + 3y, -4w - 3y + 2 = 0 for w. 2 Solve 4x = 2v - 18, x = -3v - 11 + 3 for v. -1 Solve -o + 20 = 4t, t - 5 + 0 = 3o for t. 5 Solve 2z + 6 = 5z + 5x, -3x = -2z - 15 for z. -3 Solve 16 = -4t, 3t = 2w - 0t - 4 for w. -4 Solve -5w + 3v = 2v - 23, 0 = 5w - 3v - 29 for w. 4 S	{ "pile_set_name": "DM Mathematics" }
+ sqrt(153)))*2)) + 1) - (sqrt(153)-1 + -4 + 5 + -1 + sqrt(153))*2). 342 Simplify 4(1 + (-3 + sqrt(17) + -2 + ((2 + sqrt(612))*2 - sqrt(17)) - (sqrt(187) + -31sqrt(187))/(sqrt(88)/sqrt(2)))). 100sqrt(17) + 2448 Simplify (-6(sqrt(27) + 1sqrt(27) + sqrt(27)) - (sqrt(27) + sqrt(27) + sqrt(3888)-2 + sqrt(3888) + sqrt(27)))/(sqrt(144) + 2sqrt(144)-2 + sqrt(144)-23). sqrt(3)/4 Simplify ((sqrt(1275)-2 + sqrt(1275))/((1sqrt(6))/sqrt(2)) + -4(sqrt(1377)1)2 + 1)-6. 30sqrt(17) + 33042 Simplify (-3 + sqrt(1539)2 - sqrt(209)/(sqrt(99)5))2 + (sqrt(2299) + (1 + sqrt(2299) + sqrt(2299))2)3 + (2 + sqrt(2299)1)2. 507sqrt(19)/5 + 8103034/225 Simplify (2 + ((6-2sqrt(500) + sqrt(500) + (0 + sqrt(500))-3)-1)*2 + 1 + -1)6. 588012 Simplify (12(sqrt(153)2-4 + (-2(sqrt(153) + -2) - sqrt(153)))-51)2. -26400sqrt(17) + 1852900 Simplify (sqrt(1400) - 6(sqrt(1400)1 + sqrt(1400)) - 5(1sqrt(1400) - sqrt(1400)))/((sqrt(80)/sqrt(72))/(-5-2sqrt(5))). -3300sqrt(7) Simplify (4(sqrt(192) + (sqrt(192) + 1)-6)-2)*2 + 5 + (sqrt(75) - (-4 + 0 + sqrt(75))) + 4. 30720sqrt(3) + 309517 Simplify ((sqrt(420)/(-1sqrt(847))-6)/((sqrt(3456)1 + sqrt(3456))/(sqrt(242)-2)))*2. 5/4 Simplify ((sqrt(396) + -2 - (sqrt(22)/sqrt(2)6)*2) + (5 + sqrt(132)/(2sqrt(48)))*2)4. -5957/4 + 34sqrt(11) Simplify ((1(sqrt(475) + 1) - 4(-1 + sqrt(475))) + 1)2 + (-6((sqrt(1900)-1 - sqrt(1900)) + -4 + sqrt(1900))-5)*2. 71820sqrt(19) + 1728711 Simplify -4 + 3(((sqrt(77) + (sqrt(77)1 - sqrt(77) - sqrt(77) - sqrt(77)) - sqrt(77))/sqrt(7) + (2(sqrt(11) + 2) + sqrt(11))2 + -3)46 + -4). 1584sqrt(11) + 8048 Simplify 1 + ((3((-2sqrt(200) + sqrt(200))-1 + ((sqrt(200) + 0)6 - sqrt(200))) + 1)-3)2. 3240sqrt(2) + 583210 Simplify ((sqrt(350) - (sqrt(350) + (sqrt(350)2-6 - sqrt(350)) + sqrt(350)))-2)/(3sqrt(2)2 + sqrt(2) + 1sqrt(288) + sqrt(288)). -120sqrt(7)/31 Simplify (-2 + -4(sqrt(1053) + 2)3 + (3 + sqrt(78)/sqrt(6) - (sqrt(13) + 2 + sqrt(832))))2. 5800sqrt(13) + 175553 Simplify (-2 + (sqrt(18) + (sqrt(2592) - -1sqrt(2592) - sqrt(2592)))/sqrt(9) + -5 + -4((sqrt(16) - sqrt(16)-1)/sqrt(2))/sqrt(4))2. -70sqrt(2) + 99 Simplify ((sqrt(420) - 4(sqrt(420) + (sqrt(420) - (sqrt(420) + 1sqrt(420) - sqrt(420) - sqrt(420)))))/sqrt(10))/(sqrt(600) + -4sqrt(600)4 - sqrt(600)). 7sqrt(7)/160 Simplify 0 + (-3 + (1sqrt(275) - sqrt(275)) - sqrt(275))*2 - ((sqrt(44) + -1 + -5sqrt(99))*2 + 3). -1579 + 4sqrt(11) Simplify (-4(sqrt(2916) + 2sqrt(2916))3)/(1sqrt(84)/sqrt(7) - (sqrt(12) + (sqrt(12) - (sqrt(12) + -2sqrt(432))))). 27sqrt(3) Simplify 4(((sqrt(108) + 0 - sqrt(108))1)*2 + sqrt(108)) - (-2 + 2 + 1sqrt(75)-6). 54sqrt(3) Simplify ((sqrt(4800) + -1sqrt(4800) + -3)2 + sqrt(4800) + 0 + 3sqrt(4800))-6 + 3. -960sqrt(3) - 51 Simplify (sqrt(18)-2-5 - -1sqrt(72))/(-4(sqrt(300)/(sqrt(20)/sqrt(2)))/sqrt(5)). -3sqrt(3) Simplify (sqrt(832)2-1 - (sqrt(832) - -5sqrt(832)-3))2 - (0 + sqrt(832) + 1 + sqrt(832) + sqrt(832))2-4. 192sqrt(13) + 119816 Simplify ((1(sqrt(198)1 - sqrt(198)))/(sqrt(22)/sqrt(8)))/(sqrt(30)/(sqrt(5) + sqrt(30)/sqrt(6)) - (sqrt(1728) + sqrt(48))/sqrt(8)). 0 Simplify -2 + ((-5 + -1 + sqrt(68) + sqrt(68) + (-2(sqrt(68) - sqrt(68)-1) + sqrt(68) - sqrt(68)))-5 + -3 + 5 + -1sqrt(68) + 1)*2. 1188sqrt(17) + 6595 Simplify ((-45sqrt(405)/(sqrt(9) - (sqrt(99)/sqrt(11) + sqrt(9))))/(2(sqrt(45)/sqrt(180) + sqrt(45)/sqrt(45))))2. 2000 Simplify 2 + -4 + -3 + 1(1sqrt(8) - sqrt(8)) + -2. -7 Simplify -1sqrt(275) - 5sqrt(66)/sqrt(6) - (sqrt(99)-14)/(sqrt(9) + (-1sqrt(9) + sqrt(9))-6). -6sqrt(11) Simplify -5 + 3 + (sqrt(180) + sqrt(180) + 2 + sqrt(180))*2 + (sqrt(560)-1)/(-4sqrt(7)-2). 143sqrt(5)/2 + 1622 Simplify -4(1(-3 + (2 + sqrt(405) + sqrt(405))4)-6-1)*2. -3736080 - 103680sqrt(5) Simplify ((((sqrt(135)-3)/sqrt(9) + 3sqrt(60))5)/((1sqrt(200)-2)/((sqrt(70)-2)/sqrt(7))))*2. 675/4 Simplify 0 + ((2(sqrt(187) + 2-1sqrt(187)))/(sqrt(539) + (sqrt(539) + sqrt(539) + -1sqrt(539))-3))*2-6. -102/49 Simplify (2sqrt(9)/sqrt(3) - (0 + sqrt(3) + 3) - (sqrt(27)-5 - sqrt(3) - (sqrt(21)/(-3sqrt(7)) - sqrt(3))))2 + -4. -94sqrt(3) + 2224/3 Simplify (6(1(sqrt(500) + 0 - 2sqrt(20)) - ((sqrt(80) + -1)-5 - sqrt(80) - (0 + -1sqrt(80) - sqrt(80)))))2. -7920sqrt(5) + 88020 Simplify -5 + -2(((-3 + sqrt(192))5 - sqrt(192) - -5(sqrt(192)3 + sqrt(192)))-2)2. -886541 + 46080sqrt(3) Simplify -3 + ((4(sqrt(512)3 + sqrt(512)))*2 - (sqrt(648) + 1 + -3)). -18sqrt(2) + 131071 Simplify -2((-3(sqrt(224)-5-5 + sqrt(224)))/(-2(sqrt(1152)5 + sqrt(1152))))*2. -1183/72 Simplify ((-1-4sqrt(7344) - sqrt(7344))2)/((6sqrt(84))/(sqrt(7) - (sqrt(1008)-2 - sqrt(7)))). 156sqrt(17) Simplify 0 + ((sqrt(480)-1 - 41sqrt(30))-6)/(-2(sqrt(486)-2 + sqrt(486) + sqrt(486) - sqrt(486))1). 8sqrt(5)/3 Simplify (sqrt(1620)2 + 3 + -3 + sqrt(1620) + 1sqrt(1620)-4 + 5(-1 + sqrt(1620)))2-4-1. -2880sqrt(5) + 103780 Simplify (6-4(sqrt(77) + sqrt(77) + (sqrt(77) - sqrt(77)-2))6)/(-4sqrt(252)-6). -5sqrt(11) Simplify -5 + (-1(((sqrt(171) + -2)*2 - sqrt(171)) + sqrt(171))-3 - (-2 + -2 + sqrt(171))1). -39sqrt(19) + 524 Simplify -4((-1sqrt(125) + -3 + (sqrt(125) + -1)5)2 + -3)5 + -5. -41225 + 6400sqrt(5) Simplify -3 + -2 + (((sqrt(216) - 1sqrt(216))-2)/sqrt(9))/(sqrt(48)/(sqrt(36)/sqrt(144))). -5 Simplify 0 + ((sqrt(104) + -3sqrt(104))1)/(sqrt(16)/(sqrt(8)/sqrt(4))) + 5 + 3 + 2. -2sqrt(13) + 10 Simplify ((1sqrt(84)-3 + 6(sqrt(84)-2 + sqrt(84)))-5)/((-6(sqrt(132)-1 - sqrt(132) - sqrt(132)))/((-2sqrt(44))/sqrt(4))). -5sqrt(7) Simplify (-4sqrt(300)/sqrt(605))/(1(sqrt(1452) - ((sqrt(1452) - (sqrt(1452) + sqrt(1452) + -2sqrt(1452) + sqrt(1452) - sqrt(1452))) + sqrt(1452)))). 4sqrt(5)/121 Simplify (-1 + 4 + 5 + -1 + sqrt(19) + 2-5sqrt(475) + 4)2. -1078sqrt(19) + 45740 Simplify -3 + (sqrt(17) + -2 + 0)2 + 4 + (0 + -3 + -2 + sqrt(153))2. -34sqrt(17) + 200 Simplify (sqrt(152)/sqrt(8) + -4 - (-3sqrt(228))/sqrt(12)) + sqrt(171)/(2sqrt(9)) + 3 + -1. -2 + 9sqrt(19)/2 Simplify (-3 + sqrt(468) + sqrt(468)1 + 0)2 + -5 + -3 + 1. -72sqrt(13) + 1874 Simplify ((-5(-1 + 2sqrt(1088)1) + -5)1 + 2)*2. -320sqrt(17) + 108804 Simplify ((sqrt(108) - (2sqrt(108) - sqrt(108)))-1 + (sqrt(108) + 0)-3 + ((0 + sqrt(108))-2 - (sqrt(108) - (-1 + sqrt(108) + sqrt(108)))3))2 + 5 + 2. 72sqrt(3) + 448 Simplify -1-6-1(sqrt(425) - ((5sqrt(425) - sqrt(425)) + 5))*2-21 + 4. 1800sqrt(17) + 46204 Simplify (-1sqrt(1701)-4-2)/(((sqrt(216)/sqrt(4) + sqrt(54))/sqrt(6))/(sqrt(3) + (-5(sqrt(15)/sqrt(5) - sqrt(3)) + sqrt(3) - sqrt(3)))). -36sqrt(7) Simplify (-4(-5 + sqrt(448) + -4 + 5)-1)22. -2048sqrt(7) + 14848 Simplify ((2 + sqrt(800))-6 + (-5 + sqrt(4)/sqrt(2)-2)2 + 4)*2. 4464sqrt(2) + 31076 Simplify (-5sqrt(336))/(sqrt(300)3) + -1(-4(sqrt(847) - (sqrt(847) - -1sqrt(847)))2 - sqrt(847) - (-1 + sqrt(847)1)). 64sqrt(7)/3 + 3387 Simplify (2 + -2sqrt(162) + (3sqrt(54))/sqrt(3))2 - (-3(sqrt(150) - sqrt(6)))/(((sqrt(15) - sqrt(60))/sqrt(5) - sqrt(3)) + sqrt(3) - sqrt(3)). -42sqrt(2) + 166 Simplify (4 + (-1-2sqrt(1584) - sqrt(1584)) + 3 + sqrt(1584) + 1 + 2 + -3 + (sqrt(1584) - (sqrt(1584) + 1)) + -2 + 2 + -5)2. 48sqrt(11) + 6337 Simplify -3 + 2 + -2((sqrt(110) + -5(sqrt(110) + sqrt(110)-2))/((sqrt(150)/sqrt(3) + sqrt(50))/sqrt(5)))2 + 2. -197 Simplify (-4 + 0 + (-1sqrt(425)-2 - sqrt(425))2 + sqrt(425) + (sqrt(425) - (2 + sqrt(425) + 0) - sqrt(425))2 + -3)5 + 3. 125sqrt(17) + 4238 Simplify (sqrt(66)/(-5(sqrt(99) - sqrt(11))))/(sqrt(33)/(3sqrt(11)-1))-2. -3sqrt(2)/5 Simplify (((-2sqrt(144))/sqrt(6))/(sqrt(432) + (sqrt(432) - -1sqrt(432))))/((sqrt(576)/(sqrt(36)/sqrt(3)))/((sqrt(192) - sqrt(12))2)). -sqrt(2)/3 Simplify (sqrt(24)/(sqrt(2) + sqrt(2)2) + sqrt(12)-2-3)/(sqrt(484) - (sqrt(484) - 1sqrt(484)4))1. 19sqrt(3)/132 Simplify 4 + ((sqrt(108) + sqrt(108) + 2 + sqrt(108))4 + 6-1sqrt(108))2 + ((-3sqrt(12)-1 - sqrt(12) - sqrt(12))/(sqrt(48)/sqrt(48)))2. 576sqrt(3) + 3968 Simplify ((sqrt(110) - -1sqrt(110))-2)/(sqrt(10)-2-6) + -4 - (-3 + (3 + sqrt(275)-3)*2 + -5). -2480 + 2	{ "pile_set_name": "DM Mathematics" }
(-8 - (7 - 5))? -89 Calculate 7 + -21 - (-98 + (-6 - -22) - 25). 93 Calculate -8 + (-8 - (-54 + (4 - 2) - (-156 - -146))). 26 What is the value of 0 + -1 + 48 + (-38 - (-49 + 86 - 75))? 47 226 + -288 + -2 + (3 - (10 - 6)) -65 (1 - (-5 + 0 - (0 - 45))) + (130 - 137) -46 What is (-19 - ((-18 - (-7 - 6)) + -8)) + -39? -45 -6 + -4 + (119 + 21 + (0 - -5) - -8) 143 What is (13 + 0 - 27 - 60) + 2 + 11? -61 What is (6 - 0) + -32 + 10 + 47? 31 What is -64 + -43 + 114 + -61? -54 What is the value of -52 + -9 + 5 + (3 - -15) + 0 + -16? -54 -19 + 57 + -13 + -6 + -17 2 Calculate 8 + -9 + 6 - -3 - (-179 + 223). -36 What is (-32 - -6) + (-5 - 6) + 9 + (12 - 4)? -20 What is the value of (-51 - 3) + 31 - -22? -1 Calculate -5 + (2 + -11 - (14 + -13 - -3)). -18 What is -56 + (-37 - (56 + -97))? -52 What is the value of -8 + ((-1 - -3) + (-241 - -214) - 13)? -46 (-48 + -110 + 98 + 10 + 1 - -5) + -9 -53 Calculate -1030 + 1009 - (14 + 1 + -3) - -2. -31 What is (1 - (-17 - 2)) + (-28 + 8 - -8)? 8 Evaluate -2 - 67 - (-219 + 199) - 19. -68 Calculate -9 + (-39 - 12 - 21) - 28. -109 Calculate -1 + -32 + 359 + -509 + 195. 12 Calculate 7 + 71 + -79 + 44. 43 What is -16 - (-65 - (-9 - (-1 - (4 - -6))))? 51 Evaluate (90 - -1) + (306 - (-137 - -410)). 124 6 + -1 + (16 - 17) - (-5 - -10) - 27 -28 What is (-35 - -43) + (-31 - -25)? 2 Evaluate -138 - (-154 - -25) - (0 - 1). -8 What is -22 + -14 + -12 + 47 + -4 - -64? 59 Calculate -427 - -449 - (-4 + 75). -49 Calculate 27 + (17 + -6 - (-15 + 13 + 12)) + 3. 31 What is the value of 36 + -34 - (4 - (-10 - -13))? 1 What is the value of 8 + 33 - ((4 - -34) + -25)? 28 48 + 9 + (-6 - (83 + -86 - (-1 - -2))) 55 What is 52 + (0 - 14) + (-19 - -19) + 13? 51 What is the value of -5 + -7 + (-1 - (1 + -6) - -6) - -60? 58 Calculate 8 + 8 - 6 - 10 - ((5 - 27) + 95). -73 5 - (-5 + 3 - -31 - (334 - 326)) -16 What is (36 - -24 - 42) + -15 + 4 + -2? 5 Calculate 0 + (-13 - 4) - -24. 7 Evaluate (-65 - -92) + -1 + (-5 - 16) - 53. -48 What is 27 - (35 + 12 + -10)? -10 Calculate 121 + (25 - 170) + (0 - 15). -39 Evaluate -244 + 233 + (1 - 3) + 1 + -13. -25 What is the value of -3 + (1214 + -1296 - ((3 - -10) + 0 + -2))? -96 What is the value of (2 + -41 - -19) + 15 + (1 + -6 - -1)? -9 16 + 3 + (13 - (12 + -4)) + -13 11 Evaluate 27 + -3 + -325 + 387 + -24. 62 What is the value of 9 - 1 - (-17 + (-8 - (-78 + -22)) - -13)? -80 Evaluate 0 + 1 - (-447 + 422 - (-24 - 2)). 0 -50 + (-10 - (12 - -12)) + (21 - 9) -72 What is 60 - (-1 - (-5 + 0 - (72 - 98)))? 82 What is the value of (-35 - 26) + -11 + 29? -43 What is the value of 91 + 20 + -59 - 77? -25 What is the value of -20 - (92 + -79 - 32)? -1 What is (17 - (-25 + -4 - 5)) + -2 + -12? 37 Evaluate -15 + (-3 + 15 - (-55 + 53)) - 71. -72 5 + 3 - ((52 - 25) + -3) -16 74 - (-41 - -82) - 58 -25 What is the value of (37 + -15 - -10) + (0 - -14) + 5? 51 (-116 - (46 + -183)) + (45 - -1) 67 Evaluate 440 + -432 + (-6 - (-5 + 6 + -7) - -6). 14 What is -72 + 65 + -64 + 29 + -10? -52 -6 - (10 + (14 - 32 - -14 - 50)) 38 Calculate -66 - (137 - (228 - 77)). -52 Evaluate -20 - ((67 - 48) + 0). -39 127 + (-17 - -37 - 10 - 6 - 20) 111 What is the value of 17 - 77 - (-2 - (-7 - 6)) - (-14 + 2)? -59 Evaluate 48 + (-7 + -15 + 1 - -1) + -22. 6 Evaluate (13 - -21) + 9 + 0 + 49 + -42 + -5. 45 (-2 - (20 - 0)) + (-79 - -25) + (10 - -38) -28 Evaluate -22 - (-19 + 22 - 32) - (-37 - 3 - -1). 46 47 + (59 - (41 - 19)) + -2 82 Evaluate (-28 - (18 - 35)) + 48. 37 98 + (-27 - (1 + -2 - 4)) 76 Evaluate (57 - 1) + (-9 - 41 - -46) - 1. 51 59 + (-6 + 11 - ((1 - 13) + (-26 - -31))) 71 -7 + (0 - (-12 + (-6 - (-3 + -7)) - 3)) 4 Calculate (-48 - (-3 + 0 - -1)) + -262 + 256. -52 What is 15 + (20 - (9 - (-12 - -3)))? 17 91 + -5 - (-13 + (2 + -13 - -37)) 73 What is (38 - (-27 + 28)) + (13 - -13)? 63 (28 - 23) + 162 + -173 -6 What is the value of -97 - (-104 + -14 + 62)? -41 Evaluate 1 + -119 - -23 - ((0 - 19) + 138 + -128). -86 What is the value of (-42 + 97 - 69) + (-2 - 1)? -17 What is the value of -2 - 17 - (9313 + -9454)? 122 What is the value of 1 - (-38 + 34) - -43? 48 Calculate -54 - ((-7 + 2 + -2 - -17) + -10). -54 Evaluate 4 - 10 - (31 - 85). 48 (-14 - -42) + -23 + 0 5 Evaluate 2 + (52 - 22) + -85. -53 Evaluate (10 - 2) + (13 + -5 - (12 + (-30 - -15))). 19 What is the value of (-54 - -60) + -3 + -36 + (-6 - -4)? -35 What is the value of -1157 - -1065 - (-5 - (0 + -5 + 20))? -72 What is the value of (-38 - ((-6 - 7) + -15)) + (-3 - -1 - -33)? 21 Evaluate (-1 - -23) + -1783 + 1722. -39 -44 + (-49 - -61) - 49 -81 -64 + -51 + 151 + 67 103 Evaluate 19 - (30 - (33 - 20)) - (-6 - -2). 6 Calculate -9 + 19 + -22 - -1 - (1 + 18). -30 Evaluate (7 - 31) + -2 + 16 - 39. -49 -513 + 602 + (-2 - (12 - 5 - -1 - -1)) 78 What is the value of (-35 - -3) + 35 - (-4 + 5) - 49? -47 (7 - (-5 + 6) - (8 - -1)) + -34 -37 11 + (17 - (-28 - 27)) - (-1 + (11 - -1)) 72 -21 + (-20 + 23 - 25 - -64) 21 What is the value of -22 - (20 - 11) - -11 - -9 - -28? 17 What is the value of -126 + (-84 + 199 - 45)? -56 Calculate (56 - 10) + (-4 - -6) + -2 - 5 - -5. 46 What is -19 + (5 - 8) + -9? -31 What is -1 - 21 - (-9 + 48 - (673 + -682))? -70 What is the value of -7 - ((7 - 12 - 18) + -29 + 37)? 8 What is the value of (19 + (0 - (-13 + 27)) - -133) + -22? 116 What is 15 + 5 - (7 + (26 - -40))? -53 What is the value of -27 - (-3 + -2 + 5 - (-121 + 132))? -16 What is (10 + 0 - -4) + -8 + -8 - 20? -22 What is the value of 27 + 1 + (17960 - 18083)? -95 Calculate 188 + -187 + -75 + (-6 - (-6 - 4)). -70 -5 - (2806 + -2723 + (0 - 1 - 15)) -72 What is the value of 2 + 6 + 18 + 3 - (6 - (-2 - 4))? 17 What is -66 + -26 - (-3 - 15 - (10 + -28))? -92 12 + 13 + -90 + 19 -46 (-56 - (-53 - (69 + -54))) + -98 + (1 - -1) -84 Calculate (-42 - -11) + (-13 - -6). -38 Evaluate 40 - 3 - (73 - 48). 12 Evaluate 62 + (14 - -1) + 62 + 63 + -124. 78 What is the value of (-12 - (-2 + 2 + -2)) + (-3688 - -3695)? -3 Evaluate -18 - (62 + (-32 - 35)). -13 What is the value of 26 + (-15 - 7) + (-1 - 13) + 69? 59 Evaluate (-1 - 12) + (43 - (38 + -16)) - 72. -64 Calculate 10 + 72 + 46 + -4 + -34. 90 Evaluate -46 - ((-1 - (-7 + 17)) + -1 + 1). -35 What is the value of -55 + 87 + -6 + (-6 - -2) + 18? 40 -7 + -2 + (-12 - -24 - -36 - 16) 23 Evaluate 122 - (-96 + 90 - (-4 + 1 + -2 + 7)). 130 Evaluate 15 + (-86 - -53) + (-1 - -11). -8 Calculate 71 - (-9 - ((18 - (-7 - -7)) + -43)). 55 What is 24 + (-5 + -2 - -8)? 25 What is the value of -8 + (-31 - (-94 - -11)) + (11 - -1)? 56 What is (9 - -5) + -6 - (21 + -21) - -13? 21 Evaluate -73 + -11 + -14 + 22 + -3. -79 What is the value of -52 + -3 + 12 + -45? -88 What is (-164 - -61) + (5 - (-12 + -5) - 9)? -90 Evaluate (44 - (-44 + 62 - -36)) + -103. -113 What is the value of 2873 - 2695 - (46 + 2 + -1)? 131 Evaluate 14 + -1 + 13 + -24 + 12 + 14 + -16. 12 -43 + 3 + -6 + 12 + (-5 - 4) -43 What is 12172 + -12195 + (2 + -4 - -56)? 31 What is (0 + 8 - -1) + -23 + 110 + -61? 35 Evaluate -13 + (0 - 0) + 165 + -190. -38 Calculate 27 + 0 - (106 - -31 - 64). -46 Evaluate 138 - 7 - (15 - (16 - (-12 - -14)) - 4). 134 What is the value of 14 + 31 + -30 + 30? 45 What is the value of -7 + 43 + -64 + 3 + 1 + -19? -43 Evaluate -39 - -41 - ((-1 - 2 - -42) + 1). -38 Evaluate 13 - (10 + 7 + -9) - (-9 + -8 + 5). 17 What is the value of -124 + 131 - (-9 - (-3 - -8))? 21 Evaluate -29 + 9 + -58 + -1. -79 -27 - (74 + -106) - -56 61 Calculate 8 + -1 - (119 + -11 + -83). -18 Calculate -35 - (-103 + -37 + 12 + 4). 89 What is -10 + (-139 + 115 - (1 - 19) - (54 + 1))? -71 What is (-8 + (-86 - -90) + 2 + 0 - 12) + 64? 50 Calculate (7 - (1 + 2 - (-107 - -95) - -5)) + -2. -15 What is the value of -4 + 7 - 56 - -49? -4 What is the value of (-20 - 29) + (-9 - (21 + -9 + -32) - -3)? -35 Evaluate (-3 - 20) + (-511 - -537) + 20. 23 Calculate -26 - (34 + 6 - 33) - 42. -75 What is the value of 206 + (-202 - (79 - 165))? 90 (-200 - (125 + -405)) + (-1 - -11) 90 Calculate 93 + -12 - (18 + 30). 33 Calculate -3 + -40 + 36 - -40. 33 Calculate -61 + 71 + (-11 - -2 - 9) + (34 - -2). 28 Evaluate 22 - (23 + -16 + -21 - -24). 12 17 + -8 + -33 + (-17 - (4 - (-9 + 22))) -32 Calculate 1016 + -1011 + (0 + -10 - 0) + -1 + 6. 0 What is (1 - 4 - -2) + -6 + 19 + 3 + -31? -16 Calculate 99 + -104 - (21 - 5). -21 What is the value of (	{ "pile_set_name": "DM Mathematics" }
45508kn*2 - 2kn - 8961 wrt n. -91016k Find the first derivative of -7i2m*3 - 548808i*2 - 74193m*3 wrt m. -21i*2m*2 - 222579m*2 Find the second derivative of 48y*5 + 89y*4 - 14y*3 + 3143471y wrt y. 960y3 + 1068y*2 - 84y What is the second derivative of 161612k3 + 19703k - 3? 969672k Find the third derivative of 1150u*6 + 35425u*2. 138000u*3 Differentiate 228666u*2 - 388654. 457332u Find the third derivative of -41033dh*3 + 129d - 233h2 wrt h. -246198d What is the third derivative of 7o6 - 235o*5 - 2o4 - o2 - 2o + 907? 840o*3 - 14100o*2 - 48o What is the third derivative of -120446l4 + 13l*2 - 1150l wrt l? -2890704l What is the first derivative of 14d*3 + 174d*2 - 4d + 1745837? 42d2 + 348d - 4 What is the third derivative of -3l6m - 325346l3m*3 - 33l*2m + 20l2 - 5lm2 - 14m*3 wrt l? -360l*3m - 1952076m3 What is the third derivative of 32d*2s*3 - 2d*2 - 2ds3 + ds*2 + 698s*3 + 44s*2 - 81s wrt s? 192d2 - 12d + 4188 Find the first derivative of -2r2 + 364689r - 1496064 wrt r. -4r + 364689 Find the second derivative of -698a*2d*2 - 8a*2 - 5ad2 - a - 18 wrt a. -1396d*2 - 16 Find the second derivative of -74645z*2 - 264z - 97 wrt z. -149290 Find the second derivative of 38m2n*3 + 1536m*2n + 55mn*2 + 2528n*3 wrt m. 76n*3 + 3072n What is the third derivative of -62750j4 + 1562j*2 - 4j wrt j? -1506000j Differentiate -183w*3x + 2w3 + 2w*2 - 23wx + x + 5632 wrt x. -183w*3 - 23w + 1 Find the second derivative of 111mu*4 + 3mu + 69m - 231u4 - 48u - 2 wrt u. 1332mu*2 - 2772u*2 Find the third derivative of -597045u*3 + 15u*2 - 7458u. -3582270 Find the second derivative of 261657g4 - 322181g. 3139884g2 What is the third derivative of goq3 + 42103gq3 + gq*2 + 639g + 4oq*2 + 6oq + o - q3 wrt q? 6go + 252618g - 6 Find the second derivative of -16441t5 - t4 - 2t*2 + 788458t. -328820t3 - 12t*2 - 4 What is the second derivative of -494092t*2 - 4768103t wrt t? -988184 Find the second derivative of 3c2m - 159c2 + 879c + 16m wrt c. 6m - 318 Find the third derivative of -911455n3 - 703197n*2 wrt n. -5468730 Find the third derivative of 3f*3x*4 - 7847f*3x*3 + 6f*3x2 + f3x + f2 - 397fx2 wrt x. 72f*3x - 47082f3 Find the third derivative of 2799176q3 - q2 + 5q + 4840 wrt q. 16795056 Find the second derivative of 4076b*3jo2 - 3b*3jos - 2b3j + 2b2j*2 + 542bo - 23j*2o*2s - j*2os + 3o*2s wrt o. 8152b3j - 46j2s + 6s What is the third derivative of -99t*5 + 3t*4 - 60t*3 - 197t*2 - 296 wrt t? -5940t*2 + 72t - 360 What is the first derivative of 232l4o*3 + 11l*4o - 125o3 + 7o*2 - 2o wrt l? 928l3o*3 + 44l*3o What is the third derivative of -111i2m*3o*2 - 2i*2m*2o*2 + 18i*2mo + i2o - 182im*3o*2 - im*2o*2 + 810io2 + io wrt m? -666i2o*2 - 1092io2 What is the third derivative of 530752x*3 - 6665483x*2 wrt x? 3184512 What is the first derivative of 188253r*4 - 86410? 753012r*3 Find the second derivative of -15g*4 + 41g*3 + 100g*2 + 2g + 109665 wrt g. -180g2 + 246g + 200 Find the third derivative of 223988s3 - 3061s*2 + 31s. 1343928 What is the third derivative of d*2k*3 - 2d*2k*2 + 87d*2k + 58dk*3 - 17dk2 + 5dk - 2459k6 - k2 wrt k? 6d2 + 348d - 295080k3 What is the third derivative of -170m*4 + 1151m*3 - 525m*2 + 69 wrt m? -4080m + 6906 Find the third derivative of 11161g5 - 22590g*2. 669660g*2 Differentiate -7l*3n*2 - 13l*3y - 4l3 - 3l*2n*2 + 2ln2y + 456ly + 3l wrt y. -13l*3 + 2ln2 + 456l What is the second derivative of -24475u4 + 16141u? -293700u2 Find the third derivative of 4d*3j*3 + 3d*3j - d*2j*3 - 3680dj3 + 15801j*2 wrt j. 24d*3 - 6d*2 - 22080d What is the first derivative of -34g3y + 209g3 - 6109g*2 - 11392gy + 1 wrt y? -34g*3 - 11392g Differentiate 609656uv - 475u + 180 with respect to v. 609656u What is the third derivative of 152559h3 - 425730h*2 - 1 wrt h? 915354 Find the third derivative of 20103h*4 - 524h*2 + 14h + 3 wrt h. 482472h Differentiate -3cs + 214933c + 1536s - 269 wrt c. -3s + 214933 Find the first derivative of -230889s4 - 1834779 wrt s. -923556s*3 Find the second derivative of -349770j*2 - 800997j. -699540 Find the second derivative of 177739b4 + 23319b. 2132868b2 Find the second derivative of -178f*2m*2t2 - f2m2t + 309f2mt2 + 853ft + 4m*2 - 4m wrt t. -356f2m*2 + 618f*2m What is the first derivative of 4u2yz - 4u*2z - uyz + 45uz + 8yz - 2y + 75z - 1 wrt u? 8uyz - 8uz - yz + 45z Find the second derivative of -319478u*4 - 183008u wrt u. -3833736u2 What is the second derivative of 2b*2l3 + b2l + b2 - 22196b - 101513l4 - 2l wrt l? 12b2l - 1218156l2 Differentiate -9021j*3m*2 - 94j*3 + 56j*2 + 10jm4 + j with respect to m. -18042j*3m + 40jm*3 Find the third derivative of 529731u*5 - 3u*3 - 3u*2 - 347750u. 31783860u2 - 18 What is the derivative of -27410s + 71086 wrt s? -27410 Differentiate -108320h - 176590 wrt h. -108320 Find the second derivative of 836307k*3 - 88550k + 2 wrt k. 5017842k What is the derivative of -1366674g*2 - 1218546? -2733348g What is the third derivative of 168c5p*2 + 1949c*3p*2 + 916c*2 + 2cp2 + 268c wrt c? 10080c2p*2 + 11694p*2 Find the second derivative of -457184d*2l*2 - dl + d + 3l2 - 6l + 398 wrt d. -914368l2 What is the second derivative of 113536z*4 + 2z*3 - 1048z + 40 wrt z? 1362432z2 + 12z Find the second derivative of 32jrt2 - 2jt3 - 2jt2 + 3jt + 9rt3 + 526r + 14t wrt t. 64jr - 12jt - 4j + 54rt What is the third derivative of -21845o3 + 16966o*2 wrt o? -131070 What is the second derivative of -8u*2w*2 - 2u*2w - 24509u2 + 235w*2 + w wrt w? -16u*2 + 470 Find the third derivative of 1078bc3r*3 + 174bc3r + 5bc*2r*3 + 333962c*2r3 + c2r wrt c. 6468br3 + 1044br Find the second derivative of -2hi2t*2 + 19hi2 - hit2 - hit - 104hi + 4505ht2 wrt t. -4hi2 - 2hi + 9010h Find the second derivative of -93204f2 - 3f - 15587 wrt f. -186408 What is the second derivative of 7i2q*2 + 5i*2q + 2iq*2 + iq - 3648q2 - 779 wrt q? 14i*2 + 4i - 7296 Find the third derivative of 3j4 - 3177j*3 - 252j*2 + j - 2. 72j - 19062 Find the third derivative of -126185aq*3 + 4aq2 + 2aq + 14a + 18q2 - q wrt q. -757110a Find the first derivative of -1168646t + 506493 wrt t. -1168646 Find the first derivative of 11c*2 + 5c - 17653. 22c + 5 Differentiate -1019732c*3su + 4483c*3 + 13cu with respect to s. -1019732c*3u What is the second derivative of -b*2k*2 + 27b*2k - bk - 22k*5 + 1348k*2 - 35k wrt k? -2b2 - 440k*3 + 2696 Find the third derivative of -15427d*3z4 - d3z2 - 325d*3z - 2z6 - 5 wrt z. -370248d*3z - 240z3 Differentiate 5d*3 - 64d*2 - 238d - 946201 with respect to d. 15d2 - 128d - 238 Find the first derivative of -3266257d3 - 965019. -9798771d*2 What is the derivative of 10b*4m*3 - 1725b*4m - 38m3 - 117m wrt b? 40b3m*3 - 6900b*3m Find the first derivative of 39267bs*2 - 89s*2 - 14 wrt b. 39267s*2 What is the derivative of -14982b*2q + 6bq - b - 3q + 67048 wrt b? -29964bq + 6q - 1 Find the second derivative of -53y4 + 544y*2 + 5y - 5454 wrt y. -636y2 + 1088 What is the derivative of 692g*4 + 52g*2p2 + g2p + p2 - p + 3 wrt g? 2768g*3 + 104gp2 + 2gp What is the second derivative of 7190h*3 - 18h*2 + 588h + 339? 43140h - 36 Differentiate 20p*2w*3 - 1556p*2w + 181224p2 - 1 wrt w. 60p*2w*2 - 1556p*2 Differentiate 406764g*2sw - 2g*2s - 3g2v - 48svw - 2sv - sw - 1357s + vw + w with respect to g. 813528gs*w -	{ "pile_set_name": "DM Mathematics" }
fy (-4sqrt(10)/sqrt(2) - (sqrt(5) + -3 + (sqrt(20)/sqrt(4))2 + sqrt(5))) + ((3sqrt(25))/sqrt(5) - ((-2sqrt(15))/sqrt(3))2). -22 - 3sqrt(5) Simplify ((sqrt(216)/sqrt(4))/sqrt(3) - (1sqrt(90))/sqrt(5))/((sqrt(315)/(sqrt(5)1))/(sqrt(7) - sqrt(112)-4)). 0 Simplify (2 + ((-1(sqrt(2057) + -6(sqrt(2057) + -1sqrt(2057))) - (sqrt(2057) + -3(0 + sqrt(2057)) + 5sqrt(2057)1))6)*2)-1. -1184834 Simplify (1 + -3 + 2(sqrt(475) + 3 - sqrt(475)) + -5 + (sqrt(475) + -2)-5)*2 + -3. -450sqrt(19) + 11953 Simplify (15sqrt(162)1 - ((4sqrt(2)2 - sqrt(2)) + -2 + (sqrt(2) - sqrt(18) - sqrt(2)) + sqrt(2)))2-5. -16020 - 800sqrt(2) Simplify 1 + ((2 + 3sqrt(4800))*2 - (-1sqrt(4800) + -1)) + -2 + -3. 520sqrt(3) + 43201 Simplify ((sqrt(36)/(sqrt(6) + sqrt(24))65)/((sqrt(162)1 + sqrt(162))/sqrt(6) - sqrt(3888)-1))2. 50/441 Simplify (5((-2 + sqrt(363))6 + -5 + -1 + sqrt(363) + sqrt(363)) - (3 + sqrt(363) + -2 - ((sqrt(363) - -3sqrt(363)) + 4)))*2. -82302sqrt(3) + 678756 Simplify 5 + (sqrt(9)/(sqrt(3)46) - (sqrt(75)-1 - (sqrt(75)-6)*2)). 121sqrt(3)/24 + 2705 Simplify -4(-4sqrt(1188)6)/(sqrt(3) - sqrt(81)/sqrt(3) - (-2sqrt(3)1 + sqrt(3))). -576sqrt(11) Simplify ((sqrt(152)3)/sqrt(2) + 0)2-6 + -4. -72sqrt(19) - 4 Simplify (sqrt(114)/((sqrt(30) + -3sqrt(30))/sqrt(5))4)2 + (sqrt(2299) + 0 - sqrt(2299))25-4. 76 Simplify -1 + -4 + -5 + ((sqrt(125) - 3sqrt(125)1) + -5)*2. 100sqrt(5) + 515 Simplify ((sqrt(52) + sqrt(104)/(sqrt(2) + sqrt(32)) + 4 - ((sqrt(52) - 2sqrt(52)) + -1)-2) + 0)*2-1. -932/25 + 32sqrt(13)/5 Simplify (sqrt(121)3-5 + sqrt(121) - 3sqrt(121)-2)/((sqrt(176) - -6sqrt(176)-2) + sqrt(176)11 + sqrt(176)). 2sqrt(11)/9 Simplify 4-3((3 + 3-1(sqrt(208) + 3 + 0))*2 + 2). -22920 - 1728sqrt(13) Simplify -5 + (1sqrt(240))/((-2sqrt(24))/sqrt(2)) - (-3 + sqrt(720)-1 - (3 + sqrt(500)2))*2. -5161 - 385sqrt(5) Simplify (-6(sqrt(576) + sqrt(576)-2 + sqrt(44)/(sqrt(11)2)))/(1-1sqrt(98) - (sqrt(98) + -1sqrt(98))5). -69sqrt(2)/7 Simplify ((sqrt(756)-1-4 - (sqrt(21) + -5sqrt(189))3)/((3-3sqrt(84))/(sqrt(192)2)))2. 30976/3 Simplify (21sqrt(1404)-3)/(64sqrt(3) - -3(sqrt(3) + sqrt(6)/sqrt(2))). -6sqrt(13)/5 Simplify (-4(0 + -6(-4 + -5 + 2sqrt(468)) + -5 + -1))2. -110592sqrt(13) + 1115136 Simplify ((sqrt(72)-3 - sqrt(72))/sqrt(9)-2)/(sqrt(484)-2 - 2sqrt(100)). -sqrt(2)/4 Simplify (-1((sqrt(512) + sqrt(512) + -4)2 + 1 + 2)-3)2 + 5. -5760sqrt(2) + 73958 Simplify (-3(-3 + (2sqrt(220) + sqrt(220))/sqrt(11)) - (sqrt(720) + -1 - sqrt(2880)1))2. -120sqrt(5) + 280 Simplify ((sqrt(450)-1)/(sqrt(2) + (sqrt(72) - (sqrt(72)-1 + sqrt(72)))))/(sqrt(315)/(sqrt(847)-2 - sqrt(847))). 33sqrt(5)/7 Simplify (-4 + sqrt(19)2 + -2)5 + (6sqrt(114)/sqrt(6) - (-5sqrt(57)/sqrt(3) + sqrt(19)))*2 + 4. 10sqrt(19) + 1874 Simplify ((sqrt(119) - sqrt(119)1 - sqrt(119))4 + sqrt(119)-15)/(5(sqrt(700) - (-2sqrt(700) + sqrt(700)))). -9sqrt(17)/100 Simplify (0 + -1 + -2sqrt(128)2 + (sqrt(128) - (-4 + sqrt(128)-1)) + 5 + 0)*2. -256sqrt(2) + 576 Simplify 0 + ((sqrt(144) + (5(sqrt(144) + -1sqrt(144)) - sqrt(144)))/(-6(sqrt(12)-2 + sqrt(12))))/((1sqrt(72))/(2(sqrt(12) - sqrt(3)))). 0 Simplify -4sqrt(605)-6 + (sqrt(245) + 3 + sqrt(245))4 + 0. 12 + 320sqrt(5) Simplify (-2 + (sqrt(128)-2 + sqrt(128) - sqrt(128)) + -5sqrt(128)2 - (1 + (sqrt(128) + sqrt(128) + -1 + sqrt(128))-4 + 2sqrt(128) + 2)2)-6. -6144sqrt(2) + 77106 Simplify ((sqrt(168) - (1sqrt(168)6 + sqrt(168) - sqrt(168) - sqrt(168)) - sqrt(168))/(sqrt(18)/sqrt(48)))/((-2sqrt(392))/sqrt(32))4. 160sqrt(7)/7 Simplify (((5 + sqrt(4)/sqrt(2) - sqrt(2)) + sqrt(2) - sqrt(2))3 + sqrt(12)/(sqrt(36)/(sqrt(42)/sqrt(7))))2 + 2. 30sqrt(2) + 229 Simplify -6(-3(-4(sqrt(325) + -1 - sqrt(325))5 + -5 + -1 + sqrt(325) + (sqrt(325) - (1sqrt(325) + -1)))-1)*2. -29700 - 8100sqrt(13) Simplify (sqrt(720)-6)2 - (3sqrt(1620))*2 - (sqrt(750)-2)/(sqrt(294)-1). -10sqrt(5)/7 + 11340 Simplify (-3 + (-4(3 + -1 + 1sqrt(847)1 + 5))2)2. 4928sqrt(7) + 28666 Simplify ((sqrt(980) + (sqrt(980) + -2sqrt(980) - sqrt(980)) + sqrt(980) + sqrt(980))/sqrt(4) - (-3 + sqrt(720) + -1sqrt(720))) + -4 + 2(-3 + sqrt(5)-2)-6. 35 + 31sqrt(5) Simplify (3(sqrt(110) - -1sqrt(110)) - (-1sqrt(110)2 + sqrt(110)))/(sqrt(110)/sqrt(99) - (-5sqrt(160) + sqrt(10))). 21sqrt(11)/58 Simplify (2 + 5 + (sqrt(125) - 5(sqrt(125) + 1)))*2 + -3(-3 + -1 + sqrt(20)/sqrt(4) + -5)*2. -26sqrt(5) + 1746 Simplify (sqrt(891) + 1 - ((2sqrt(396))2 - sqrt(396)))6 - ((-2(1sqrt(99) - sqrt(99)))/(sqrt(729)-1))2. -9498 + 90sqrt(11) Simplify (-5 + sqrt(2548) + 0 - (0 + sqrt(2548) + 0))2 + ((sqrt(364)/sqrt(63))/sqrt(4))26 + 3. 110/3 Simplify (-4((sqrt(3645) + (sqrt(3645) - (0 + sqrt(3645)) - sqrt(3645)))-4 + (-2 + sqrt(3645))-2)6)2 + -1. -248832sqrt(5) + 8407295 Simplify 5((((sqrt(65)2 - sqrt(65))1)/((sqrt(35)-2)/sqrt(7)))*2 + (-5sqrt(325) + -3sqrt(1872))2). 967525/4 Simplify -6((2 + 1 + sqrt(288) + -5)*2 - (-3 + -1 + (-2 + sqrt(288) - sqrt(288)) + sqrt(288))) + -2. -1790 + 360sqrt(2) Simplify (((sqrt(2016) - -2sqrt(2016) - sqrt(2016)) + sqrt(2016))/(sqrt(360)/sqrt(10)))/(-1sqrt(112) + sqrt(21)/(sqrt(3) + sqrt(75))). -36sqrt(2)/23 Simplify -1 + 0 + (sqrt(190)/(sqrt(30)/sqrt(27)))2 + ((sqrt(19) + -1sqrt(19) + -3 + -2)2 - ((0 + sqrt(171))2 - (-3 + sqrt(19)-2))). -2sqrt(19) + 21 Simplify -3 + (sqrt(121) + (sqrt(121) + sqrt(121)-1)-5)/(sqrt(176) + sqrt(176) + -1sqrt(176)) + (sqrt(1584)4)/(13sqrt(4)). -3 + 33sqrt(11)/4 Simplify (4 + (sqrt(80) + 2 + 5 + 1(sqrt(80) + 2) - (sqrt(80) - (-4 + (3 + sqrt(80) - sqrt(80)) - sqrt(80)))-3) + 1)2. 1088sqrt(5) + 5409 Simplify 0 + (((sqrt(1575) - sqrt(1575)-2) + sqrt(1575))/(sqrt(9) + sqrt(36)1) + -1)5. -5 + 100sqrt(7)/3 Simplify (sqrt(143) + sqrt(143) + (sqrt(143) + -1sqrt(143))6 + -3sqrt(143)-1)/(sqrt(891) + (sqrt(891) - sqrt(891)1 - sqrt(891))4) + -3. -3 - 5sqrt(13)/27 Simplify ((sqrt(70) + 6-1sqrt(70))/((3sqrt(50))/sqrt(5)) - (0 + -3(sqrt(343) - 1-2sqrt(343))))2. 236992/9 Simplify (6(sqrt(3993)1-5 + sqrt(3993) - sqrt(3993)))/(-2(sqrt(48) + sqrt(12) + sqrt(9)/sqrt(3)4)). 33sqrt(11)/2 Simplify (1(sqrt(891) - 1(sqrt(891)-2 + sqrt(891))) - (sqrt(891) - (-1sqrt(891)-5)*2)-6)-2 + -5 + -3. -144sqrt(11) + 267292 Simplify (sqrt(8) - 2sqrt(8)-1 - (sqrt(64)1 + sqrt(64))/sqrt(8))/((2sqrt(44)-3)/(sqrt(11) - (sqrt(44)/sqrt(4) + sqrt(11) - sqrt(11) - sqrt(11))-4)). -sqrt(2)/6 Simplify (1(-2 + ((sqrt(252)-2 - sqrt(252)) + -5)-1-2))*23. 2592sqrt(7) + 27648 Simplify 2 + -5(3 + (sqrt(114)/sqrt(6))*2) + (sqrt(190)/(sqrt(90)-1)5)2. -497/9 Simplify ((sqrt(504) + -1-1sqrt(504))/sqrt(432))/((sqrt(726) - (sqrt(726) + -1sqrt(726)2))-1). -sqrt(7)/66 Simplify ((sqrt(132) - 1sqrt(132))6 - sqrt(132)-26)/(sqrt(48)/(sqrt(12)/sqrt(3))-5). -12sqrt(11)/5 Simplify (-4 + (-1 + ((sqrt(567)1 - sqrt(567))/sqrt(9))/(-1sqrt(1089)))5)2. 81 Simplify 1(sqrt(176) + -3-2sqrt(176) - (-4 + sqrt(176) + 1))*2 + 6(-1 + sqrt(176))*23 + 1. 9532 Simplify 0 + -2(-1(sqrt(1088) + ((-2sqrt(1088) - sqrt(1088)) + 3)2 - sqrt(1088)) - ((sqrt(1088) + 1 - sqrt(1088))-3 + 4)). -288sqrt(17) + 19604 Simplify (-1sqrt(72) - sqrt(50)5)22 - (3 + 2 + sqrt(50) + -2)*2. -30sqrt(2) + 3785 Simplify -2 + (-22sqrt(119) + sqrt(119))/(-5sqrt(7)2) - (-1 + sqrt(153)/(sqrt(36)/(sqrt(4) + (sqrt(64) - sqrt(4)))) + 3)*2. -278 - 157sqrt(17)/10 Simplify 34(4 + (1 + 1 + sqrt(605) + 4)*2 + -2). 1584sqrt(5) + 7716 Simplify (-1(-1sqrt(66)2)/sqrt(2))/((sqrt(99)/(sqrt(11)1))/(sqrt(3)-25)). -20sqrt(11) Simplify (-6(3 + sqrt(38)/(sqrt(6)/sqrt(3)))-2 - (sqrt(209) + (sqrt(209) - sqrt(209)-1)1)/(-6sqrt(44)/sqrt(4)))*2. 900sqrt(19) + 17059/4 Simplify ((sqrt(13) + sqrt(78)/(sqrt(24)/sqrt(4)) - (sqrt(1300) - -2sqrt(1300)))-1)*2 - (-3 + sqrt(468) + -1(sqrt(468) + sqrt(468) + 3)*2). 66sqrt(13) + 12076 Simplify (-4 + (-2(sqrt(17) - -2sqrt(17)) - sqrt(204)/(sqrt(24)/sqrt(2))) + (sqrt(17) + 4 + sqrt(153)/sqrt(9) - sqrt(119)/(3sqrt(7))))2. 4352/9 Simplify ((-2sqrt(119)-6 + sqrt(119) - sqrt(119)) + sqrt(119) + sqrt(119)-1	{ "pile_set_name": "DM Mathematics" }
Let y = -6 + 10. Let m(h) = h*3 - 11h*2 + 11h - 8. Let r be m(10). Suppose rk = 7k - 50. Solve 0 - k = -2c - yl, c - 2l = -7 for c. -1 Let n be (-7)/(21/(-18)) + 0. Suppose 30 = 6s - 6. Let m = n - s. Solve m = -2b - 3p - 5, -2b - p = -4p + 11 for b. -4 Let s be (0 + 0)43/(-24). Suppose s = 14d - 76 - 8. Solve 0 = 5u + 4t - 9, u + t - dt = 25 for u. 5 Let y(w) = -w + 3. Let i be y(-2). Let s = -3 + i. Let v be s12 + (-30)/10. Solve 5f - 4x + v = 0, -3x - 3 = -3f - 18 for f. -1 Suppose 0 = 5t - 0 - 20. Solve f + 21 = -4n, -tn + 8f - 5f = 1 for n. -4 Suppose -15 = -5d - 5. Let a(l) = -6ld + 5 + 3 + l3 + 6l - 1 - 1. Let y be a(5). Solve 2 = 2n + 6, 0 = -q + 3n + y for q. 5 Let w(y) = y2 + 14y + 48. Let l be w(-6). Solve -5n + 9 + 11 = 5h, l = 2n - 2h - 8 for n. 4 Let n = 8 - -2. Suppose y = -5x + 10, -5x = -5y - 0y - n. Let o be (13 - x)/(4 + -3). Solve 5g + o = l, -3g - 7 = -2l + 2g for l. -4 Suppose -1 = 15u - 14u + 3f, 2u + 4f = 2. Solve ul + 4r + 37 = 0, l + 3l - r + 17 = 0 for l. -5 Let j = -728 - -732. Solve 4i - 4 = q, q = -ji + 8 - 4 for i. 1 Suppose 0 = 5k - 2u + 288, 244 = -3k - k + 5u. Let w = -54 - k. Solve wc + 1 = -3a, 0c - 12 = 3c + a for c. -5 Let u = 3 + -40. Let z be 10/(-35) - u/7. Let g(b) = -b + 5. Let n be g(4). Solve -3r = 3h + 18, 2h + n - 10 = zr for h. -3 Suppose 5a - 4a + 5o + 5 = 0, -a - o + 3 = 0. Solve 0 = m - 2g - 7, am = g + 2g + 14 for m. 1 Let i be (-3029)/(-91) + (-2)/7. Let v = 38 - i. Solve 3j = 0, t + vj - 2 = 7j for t. 2 Suppose 14 = 4l + 6. Suppose -3c - 17 = -6r + 2r, 24 = -c + 5r. Let z = -10 - -15. Solve b = -c, a - zb - l - 4 = 0 for a. 1 Let q(g) = -2g*2 + 36g + 5. Let l be q(18). Solve ls = -16 - 9, -i = 4s + 22 for i. -2 Suppose 0 = -f - 179 + 183. Let j(u) = -u*2 - 6u - 3. Let y be j(-5). Solve 6 = -fo + 3t, 0o - yo = t + 8 for o. -3 Suppose -3g + 19 - 4 = 0. Let p(x) = -9x - 7. Let z = 8 + -9. Let j be p(z). Solve -8 - 13 = -jm + gc, -c + 3 = 2m for m. 3 Suppose l = -3w - 0l + 4, -4w = 4l. Solve 6 = -4g - 3a, 0 = -wg + a - 6 - 2 for g. -3 Let v(a) = a*3 + 4a*2 + 2. Let f be v(-4). Suppose 0 = fb - 6 - 2. Suppose 4j - 12 = b. Solve 2y - 24 = -5h, 0 = jy + 4h - 5h - 4 for y. 2 Let v = -31 - -66. Suppose 0 = -vw + 34w. Solve 4t + 0p - p + 21 = w, 0 = -4t - 2p - 18 for t. -5 Let a(t) = t*2 + t - 42. Let j be a(-7). Solve -5n - w - 10 = j, -w - 6 = 3n - 3w for n. -2 Let k(w) be the third derivative of w5/60 - w4/8 - 5w3/6 + 7w*2. Let j be k(-2). Solve 5c + i = 29, -13 = -jc + 3i - 0 for c. 5 Let m(p) = -2p2 - 9p - 2. Let c be m(-8). Let s = c + 31. Let f = -15 - s. Solve 5h + 0 - 20 = 3u, 4u = -3h + f for h. 4 Suppose -71j + 4 = -69j. Solve -o - 1 = 4t, -t = 4o - jt - 13 for o. 3 Let n(p) = -p - 4 - 13p*2 + 14p*2 - 2p. Let i be n(4). Solve d - 5c - 17 - 5 = i, 0 = -c - 4 for d. 2 Suppose 2y - 16 = -0. Solve 2h - y = 2r, -5r = 3h - 5h + 14 for r. -2 Let m = 0 - -3. Suppose -3t - 11 = 4a, -5t - 5a + 25 = -7a. Solve 0 = -mu + u + tf + 1, -4f - 8 = -u for u. -4 Suppose -117 + 5 = -28u. Solve -q - 3b = 1, -ub - 8 - 5 = -q for q. 5 Suppose -5w + 38 + 57 = 0. Let h = w + -4. Solve 0 = -5s + h, v - 2 - 2 = -3s for v. -5 Let b be 1/(-9) + 1/(-36)-148. Solve 7 = 3y + i - 2i, -8 = -by + i for y. 1 Let a be (125 + -125)(0 + 1/(-3)). Solve a = 2o - 5p - 3, 4o = -3p + 2p + 17 for o. 4 Let o(s) = -s + 1. Let j be o(-10). Let p be (4 - (-4)/(-2)) + j. Solve 21 = -k + 4f, 24 + p = -5k + 3f for k. -5 Let v(h) = 3h + 5. Let f be v(5). Let q(j) = -2j + 8. Let c be q(13). Let y = c + f. Solve 2t = -z - 2t - y, -3z - 6 = 4t for z. -2 Suppose 124 = -4q + 136. Solve qz + 5 = 4c, -z + 15c - 10c = 9 for z. 1 Suppose 7u - 4u = 18. Suppose 10 = -uy + 28. Solve f - 10 = yr, -19 = 4r + f - 8 for r. -3 Let h(m) = -m3 + m2 - 2m + 2. Let a be h(1). Let r = -22 + 23. Solve a = b - r, -2b = u + u + 6 for u. -4 Let s(w) = 2w2 + 5w - 3. Let z be s(-4). Solve -g - 20 + 5 = 5a, -3a + z = -3g for g. -5 Let m(d) = -d3 + 8d*2 - 18d + 10. Let q be m(4). Solve 5j + 3p - 15 - 7 = 0, -qj - 3p + 7 = 0 for j. 5 Let q = -35 - -37. Solve -6 = -5l + l + qs, l - 3 = -s for l. 2 Let x = -142 - -157. Solve x = 5y, -12 = 4f - 7f - 2y for f. 2 Let n be (-2)/2(10 + -9) - -3. Suppose -6 = -2o - n. Solve 2s = q - 14, -3q + s + 9 = -oq for q. 4 Let z = 1 + -17. Let y = 19 + z. Suppose -x = -4w + yx + 64, -3w - 5x = -16. Solve 3f - 22 = 5r, 0 = -f + 2r + 2r + w for f. 4 Let i = 161 + -154. Suppose -3d = 3z - 36, -d + 4z + 8 + 29 = 0. Let x = d - i. Solve -3v - 5j = 15, 2v + 4j - x = 4v for v. -5 Let r be -1 + (12/(-6))/(-2). Let a = 0 + 0. Solve -x + 5v + 6 = r, -x - 3x + 4v - 8 = a for x. -4 Let v = 27 + -17. Suppose vm = 9m. Solve y - 3y + 10 = -4t, m = -5t - 4y - 19 for t. -3 Let m(v) = 5v2 - 1. Let x be m(1). Let k(a) = -8a + 8. Let g be k(7). Let w = 53 + g. Solve p = 5, 0l - p = xl - w for l. 0 Suppose -3s + 45 = -3y, -4s - 2y = -0s - 42. Suppose -2u = u - s. Suppose -5l - u = -14. Solve -d + 3 + 0 = 4r, -2d = -lr + 14 for r. 2 Let l(i) = -6i + 46. Suppose 0 = u - 2n - 4 + 3, 2u + 2n = 14. Let w be l(u). Solve q + w = 4a, -7 = 2a + 3q - 1 for a. 3 Let q be 2 + (-3)/1 + 1. Suppose 4j - j = 24. Suppose 0 = -4b + j. Solve -5f - 3x + 16 = q, -3 = -bf - 5x + 11 for f. 2 Let j = 1847 + -1842. Solve -ju - 2k + 13 = 0, 0 = 4u + 5k - 2 - 5 for u. 3 Let a(p) = 2p. Let h be a(2). Let z = -909 - -950. Solve z = 5r - hb, -2r - 2 = -2b + 5b for r. 5 Let w = -12 + 33. Suppose 0 = -d + 9 - w. Let x = d - -15. Solve -3a - x = 5n - 0, 5a + 5 = n for n. 0 Let r = 3 - -1. Let t = 6 + 1. Suppose 0 = tb - 8b. Solve 4q + 9 + r = i, -2q - 4 = b for i. 5 Let n(q) = -q*3 - 2q*3 + 28 + 4q*2 - 21 + 4q + 2q3. Suppose 6 + 14 = 4y. Let c be n(y). Solve -3x + b - 7 = 0, cx - 3b - 2b - 17 = 0 for x. -4 Suppose z = 11z - 410. Solve 2y - 5p + z = -2y, -3y - 4p = -8 for y. -4 Let i = 2 + 5. Suppose -2v + 6 = 4l, -5v - 3l = l - 21. Suppose s = -3h + 2h + 1, -2s - v = -5h. Solve -5c = s, -2f = -if - 5c - 15 for f. -3 Suppose -2n - 2 = -14. Let r be (-4)/n(-147)/14. Suppose 0 = -3t + 3q + 21, -t = -rq + 3q - 16. Solve 2x - 5u = 1, 5x + tu - 17 = 2u for x. 3 Suppose -8o + 30 = -74. Solve 3v + o = 4b, 0v = -5v - 4b + 21 for v. 1 Suppose -2g - 3g = -i + 6, 2i - 5g = 12. Let j(s) = 38s + 2244. Let y be j(-59). Solve y + 1 = -3k + 2z, k = -z - i for k. -3 Let o(j) = 10j - 4. Let n be o(2). Solve n = 4h + 2p, 5p + 12 = -3h + 6h for h. 4 Let w(b) = -b - 2. Let z be w(-5). Let p = 996 + -992. Solve 0 = -zo - 3c + 30, o - 13 = -pc + 12 for o. 5 Let l be (-12)/(-36) + (-154)/(-6). Suppose la - 30a - 12 = 0. Let d be (-4 - -1)/(a/5). Solve 2n + 12 = 3h - 7h, -dh - 15 = -4n for h. -3 Let z be (-1)/9 - (-57)/513. Solve -4 = -3p + 5b, z = -3p - 7b + 4b - 12 for p. -2 Let p(y) = -12 - 9y*2 - 2y + 0y2 + 0y3 - y3. Let q be p(-9). Suppose 3l - q = l. Solve lv + 16 = -2s - 0v, 4s + 30 = -5v for s. -5 Suppose -4h - 20 = 12. Let i be -4 - (h/(-4) + -8). Solve -5d + 14 = -ig, 0 = g + 2 for d. 2 Let x = 0 + 2. Suppose xf - 7 = -5. Let u be 2 + f - (-3 + 6). Solve 5n + 16 = 4k + 4n, -5n + 20 = u for k. 5 Let g = 123 + -99. Suppose -g = 3l - 39. Solve -2b + 5v = -0v - 33, -5b - 5v = l for b. 4 Let c(u) = u3 + u2 + u + 33. Let x be (-9)/(-6) + (-3)/2. Let s be c(x). Suppose s = 3g - 18. Solve 3o + g = 5v, 0 = 3o - 3v + 3 + 6 for o. 1 Let r be -2(2 + (-7)/2). Suppose 2 - 2 = -66x. Solve d - 5 = rn - 1, x = n + 2d - 8 for n. 0 Let v be 558/78 - (400/(-104) - -4). Solve -4d + 12 = -4n, -vd + 4d - 4n = 26 for d. -2 Let s(k) = 2k2 - 27k - 10. Let z be s(14). Solve -4u + zp = -8, u + 3p = 2u + 4 for u. 5 Let p(n) be the third derivative of -n5/60 + n4/2 + 5n3/3 - 8n*2. Let i be p(14). Let d = i + 20. Solve -6 = 4z + j - d, -4j = 4z - 8 for z. -2 Suppose -3d = -11 - 1, -5g + 3d = -58. Solve 2p = 2q - 14, -5p - q - g = -3 for p. -3 Let a = 1042 + -1039. Solve w	{ "pile_set_name": "DM Mathematics" }
7270 = -17372, d + 22 = -l for d. -21 Solve -56d - 2f = -614, -418 = -4d + 3f - 371 for d. 11 Solve 0 = -5g + 4n + 120, -3n = g - 730 + 725 for g. 20 Solve 4u + 56 = 4l, 446l = -446l + 897l - 90 for u. 4 Solve -f = 4r + 13, -2f = 5909r - 5904r + 20 for r. -2 Solve 16n + 565g - 80 = 564g, -5n + 57g = -25 for n. 5 Solve 0 = -4j - 2 + 6, -2x + 4j - 436 = -404 for x. -14 Solve 45 = 5f + 3k - 4k, -f + 3252 - 3224 = -4k for f. 8 Solve -2d + 441 = 439, -3g - 43 = 7g - 2d + 39 for g. -8 Solve 2i - 81 = -4y - 37, 0y - 2y - 5i = -142 for y. -4 Solve 2w + 3 = p + 68, -2p = w + 5 - 30 for w. 31 Solve 16t = -208, 2t + t - 25 + 84 = -y + 20 for y. 0 Solve 0l - 10l + l - 5z - 4 = 4, -2l + l - 3z = -2z for l. -2 Solve 10x = 5m - 55, 0 = 4m - 25638x + 25639x - 8 for m. 3 Solve m + 2q = 27, -7q + 21719 - 21652 = -2m for m. 5 Solve -k - 38 = k + 2i, 45k = 46k - 5i - 71 for k. -4 Solve 2u - 42123t + 42119t - 40 = 0, -2u - 68 = 8t for u. 2 Solve 32 = -2n + 9c - 15c + 8c, 7n + 88 = c - 6c for n. -14 Solve -5f - 28 = -4z, 0 = 342f - 346f - z - 14 for f. -4 Solve 0 = 5b + 25, h - 1 - 8 - 10 = 3b - 7 for h. -3 Solve 1288c - 320 = 5b + 1292c, b + 127c = 567 for b. -68 Solve 4y + 11p + 36 = -67, -12y - 3p - 50 + 76 = 112 + 73 for y. -12 Solve 0 = -5x + 7x + 69a - 71a + 38, 9x = -0a + 4a - 196 for x. -24 Solve -3c + 6 = 0, -33o + 118 = 26o - 55o - 5c for o. 32 Solve -37f + 452 = 2s, 3f - 3981s - 24 = -3978s for f. 12 Solve 4l - 5l + 5h + 5872 = 5581, -3l + 3h = 7h + 248 for l. -4 Solve 20 = 6y + 2d, -5y - 348d - 20 = 349d - 699d for y. 0 Solve -767437w - 6 = 4s - 767439w, 5s = -3w - 35 for s. -4 Solve -5l = 8t + 116, -3t + 4l - 1405935 + 1405915 = 0 for t. -12 Solve 0 = b - 3c + 2 - 1, -5b - 15 = 5c + 10 for b. -4 Solve 1807c - 1810c + 27 = 4u - 120, 31c - 4u + 249 = 0 for c. -3 Solve 25o - 30o + 75 = 5a, 5o - 17 - 3 = 0 for a. 11 Solve 5u + 13x - 140 = 7u, 5x = 5u + 252 + 194 - 371 for u. -5 Solve -4s = -7s + 5s + 5h + 18, -46 + 1 = 5s + 2h for s. -9 Solve 11v - 7v = -10s - 132, -5s + 6v + 3 - 26 = 7v for s. 4 Solve -2v + 208 = 2k + 98 + 104, -2k - k + 7 = 2v - 4 for v. -2 Solve -3r + 5r + 2r = 29y + 69, 2y + 51 = 5r - 1 for y. -1 Solve -45w - 986 - 2254 = -5q, -2w - 4q + 236 = q + 380 for w. -72 Solve 28f + 3p = 2515 - 1971, -f - 3p + 31 = 0 for f. 19 Solve -3b + 391 + 499 - 527 = -25k, -k = -6b + 3b + 3 for k. -15 Solve -38q = -43q - 3t - 37, 25q + 183 = -10q - 2t for q. -5 Solve -32030t + 36 = 4w - 32028t, -27 = -3w + 2t for w. 9 Solve -16x + 7x = -4z - 6x + 36, 32 = 2z - 5x for z. 6 Solve 2m = -4h + 12, 2h + 1540m - 770m - 768m - 10 = 0 for h. 1 Solve 3o - 251 + 127 + 133 = 0, 4w + 3o + 0o - 15 = 0 for w. 6 Solve 5i + 98 = 3g - 9, -i = 196g - 5680 for g. 29 Solve -5l - 39 = 10w - 89, -w = -l + 7 for w. 1 Solve -3y + 4t = -48, 0y + 28y - 14t - 18 = 25y for y. 20 Solve -5v - 5x + 15 = 0, 19v + 52x = 24v + 1 - 73 for v. 4 Solve 76a = 78a - 4r + 2, 1440 = -67a + 5r + 986 for a. -7 Solve -2v + 44 = -6o + 4o, -89v + 726 + 1224 = 3o - 284 for o. 3 Solve 0 = -3z - 6186y + 6171y - 18, -22z = -21z - 4y - 12 for z. 4 Solve -j + 7 = 3z, j - 47z + 108z - 53z = 17 for j. 1 Solve 90 = 3v - 5b, 21472 = -2v - 4b + 21400 for v. 0 Solve -12b + 441h - 6 = 438h, -2b = 2h - 4 for b. 0 Solve 18 = -3x - g - 7 - 27, -364 = -2x + 7g for x. 0 Solve 12j = -4q - 160, 3q + q - 2j - 70 = -4q for q. 5 Solve 2z - 9 = 2p + 29, 3z = 67p + 26p + 2037 for z. -3 Solve 5k + 2z + 0 + 7 - 7 = 3z, -2k - k = z for k. 0 Solve -3z - 8 = -f, -114f = -3z - 214f + 96f - 58 for z. -6 Solve -61k - 68i - 50 = -64k - 63i, -2k - 98i - 372 = 0 for k. 10 Solve -57 = 113660q - 113664q - 5z, -5q - 63z + 128 = 0 for q. 13 Solve 0 = -4u - 4k - 44, -2u - 61713k - 1 = -61718k for u. -8 Solve h - 8 - 7 = -22, 5i - 5h - 20 = 0 for i. -3 Solve -3u + 4m - 42 - 57 - 14 = 6u, 7m - 2m = 40 for u. -9 Solve 282n - 281n - 85 = 5v, 4v = n - 69 for n. 5 Solve -216469p + 216470p + 4r - 25 = 0, -545 = p - 2p - 108r for p. 5 Solve 0r - 15 = -0x + 4x - 3r, 26x = 58x + 3r - 15 for x. 0 Solve 0 = 3h + 3g, 0 = 4h - 506g + 465g + 90 for h. -2 Solve -a + 2 = -4o, 277678o - 277676o - 5a + 28 = 0 for o. 1 Solve 40b + 3g = 39b - 4, 3g + 21 = -18b for b. -1 Solve 4s + 296 - 268 = 20k, -5s - 8 = -3k + 5 for s. -2 Solve -4t + 60 = -4i, -16t = -2i + 22i - 30t + 13t + 186 for i. -9 Solve 9i = -2d - 2i - 15 - 28, -3d = -84i + 89i + 30 for d. -5 Solve 2u - 894749 + 894772 = u - 4m, -u - m - 23 = 0 for u. -23 Solve -3q - 71j + 48 = -50j, -2j - 14 = -3q - 12 for q. 2 Solve q - 54 = 4b + 32, 2q + 2b - 370 = -418 for q. -2 Solve 45g - 42g + 16 = f, -3g + 0g + 23f = 14f + 6 - 30 for g. -7 Solve -3m = -m + 4g + 46, -m + g - 8g - 74 = 2m for m. -13 Solve -r + 72n - 156n = -79n + 10, -3r - 12 = -3n for r. -5 Solve 2s = 12z - 9z - 9, -10s + 3 + 9 = -6s for z. 5 Solve -2o + 3v = -76, 66 = 5o - 3v - 52 + 27 for o. 5 Solve -10z - 778x + 775x + 16 = 0, 1 = 3z - x for z. 1 Solve 8b - 137 = 3b - k - 85, 2b - 2k + 56 = -0k for b. 4 Solve 8q - 3q + 0q - 2212x + 21 = -2215x - 76, -19x - 93 = q for q. -17 Solve -11f = 4i - 121 - 34, 3f = -3i + 43 + 48 - 1 for f. 5 Solve -3r - 5k = -42, -116k - 59k = 5r - 177k - 101 for r. 19 Solve 0 = 5i + 3w - 13, 5i + 9 = 7i - 220w + 225w for i. 2 Solve -7s + 2s + 33 = -a, 3s - 18a - 423 = -90 for s. 3 Solve -77g = q + 106g - 256 + 82, -q = -5g + 14 for q. -9 Solve -l = 5y - 16, 3l - 5 = -3y + 2l + 5 for y. 3 Solve 3y - 55 = -7w, -10 + 33 = 3y + 3w - 4 for y. 2 Solve j + 0j = -6m + 13, 3j + 10695 - 10692 = -0j + 3m for j. 1 Solve 75g + c + 161 = 10, -g - 31 = 2c - 3c + 46 for g. -3 Solve k + 59 = -5h, 25 = k + 23427h - 23429h for k. 1 Solve 223y = 228y - a + 1, y = 520a - 2062 + 11938 for y. -4 Solve 21 = -5r + 3s, 101r - 102r - 11 - 12 = -10s for r. -3 Solve 87t - 180t + 91t + 4j - 64 = 0, 5j = 2t + 66 for t. -28 Solve 60 = 4x, 47x + 49x - 143x - 33 = -3k - 52x + 39 for k. -1 Solve 2k = -2k - 9 - 3, d - 67k + 39k = 77k + 354 for d. 39 Solve 414a + 12 = 411a, 2a = -m - 12 for m. -4 Solve -77 = 3j - a + 74 + 158, 10a = j + 132 for j. -102 Solve 0o + 14c = o - 656, 5c + 2095 - 1862 = o for o. -2 Solve 2l - 18294789 = 3x - 18294773, 30 = -5x + 4l for x. -2 Solve -219w + 220w + 4 = 3u - 12, 5w + 30 = 5u for u. 5 Solve 4b + 8k + 24 = 0, 14k - 27k + 6 = -2b - 14k for b. -2 Solve 0 = -f + 7b - 106579 + 106541, -2f = 4b - 32 for f. 4 Solve r - 5x + 40 = -10x, 24r - 21r - 3x = -30 for r. -15 Solve 7027c + 145 = 24i + 7022c, 0 = 4c + 20 for i. 5 Solve 2a = 2k + 26, 17k - 22k + a = 21 for k. -2 Solve 3o - 1083 = -276s, -3241o = -3237o - 3s + 40 for o. -7 Solve -5j + 4 = 3p, -5p + 38950j + 12 = 38953j for p. 3 Solve 0 = n + 8j + 13, 48j + 45j = 3n + 98j - 56 for n. 27 Solve 2r = 2l + 30, -4r + 16008513 = l - 3l + 16008479 for r. 2 Solve 0 = -3c - 2h - 32, 22c - 18c + 4h + 32 = 14c for c. -2 Solve 12u + 5u - u + 3z - 5z + 344 = -8, 5z = 0 for u. -22 Solve -7h = 6u - 3, -u - 13 + 5 = -111h + 115h for h. -3 Solve 0 = 3f + 14j + 88, 44 = -4f - 807j + 803j for f. -6 Solve 33b = -0n + 5n - 5, n + 2n + 3b - 6 = -3n for n. 1 Solve 16a + 2 = -2z - 12a + 14a - 2, 0 = -z - z + a - 4 for z. -2 Solve -26 = -h - 13l, -h + 16 = h + 4l + 8 for h. 0 Solve 1205u - 69 = 1201u - 3b - 16, 4u = -8b + 108 for u. 5 Solve 2q - 2v + 113 - 75 = 0, 0 = -39q - 2v - 618 for q. -16 Solve 4199053u - 5r = 4199052u - 246, -144 = -3u - 3r for u. -1 Solve -71i + 75i + 4g - 132 = 0, 81 = 12i + 3g for i. -2 Solve -5d - 60l + 170 = -65l, 22d + 75d - 5l - 78 = 0 for d. -1 Solve 15d = -i + 325, -i - d + 5873 - 5856 = 0 for i. -5 Solve -272f + 3q = -267f + 33, -17q = -0f - 4f - 41 for f. -6 Solve 147t + 47 = 149t + 5f + 49, -19t = 4f + 106 for t. -6 Solve -i - i - 5l = -12i + 25, 0 = 5i - 9l - 19 for i. 2 Solve 2z	{ "pile_set_name": "DM Mathematics" }
126 = 7c - vc. Suppose 0 = -0j + 5j - 30. Calculate the highest common divisor of j and c. 6 Let u be ((-9)/(-18))/(5/(-40)) + 303. What is the highest common factor of 23 and u? 23 Let i be (-6 + 6)/(-1 - 0). Let c be -31 - (-10 - i). Let v be (c/(-21))/(1/(-42)). Calculate the greatest common factor of 21 and v. 7 Let q = -62 + 42. Let z = q - -116. What is the greatest common factor of 32 and z? 32 Let l(y) = 35y*2 - 26y - 25. Let a be l(-1). What is the highest common factor of a and 60? 12 Let c = 90 + -84. Suppose 1291 = cw + 211. What is the highest common factor of 36 and w? 36 Let p = 17 - -3. Let g = 49 + 101. Let c = g + -70. Calculate the highest common divisor of p and c. 20 Let z(t) = -t2 + 4t + 11. Let n be z(4). Calculate the greatest common factor of n and 77. 11 Let n = 1373 - 68. Calculate the highest common divisor of n and 45. 45 Let b = -146 + 353. Let y = -20 - -43. Calculate the highest common divisor of b and y. 23 Let x be 4/(-10) - (7 - 1002/30). What is the highest common factor of 104 and x? 26 Let q be (-4 - -12) + (-6)/(9 + -6). Let m = -58 - -124. What is the greatest common divisor of q and m? 6 Suppose 0 = q - 4q - 3. Let a(s) = 18s3 - s2 - 3s - 2. Let b be a(q). Let z be 2 - (b/(-3))/(-3). Calculate the highest common divisor of z and 8. 4 Suppose 3g = -2m + 40, -m + 10g = 5g - 46. Calculate the greatest common factor of 416 and m. 26 Let o = 205 - -3. What is the highest common divisor of 312 and o? 104 Let m be (-8)/147/(-2). Suppose -b - 9 = -4b. Suppose bu = -0 + 30. Calculate the greatest common divisor of u and m. 2 Let d = 2749 - 1909. What is the highest common factor of d and 45? 15 Let s = -25 - -39. Let m(a) = 73a - 2a2 + a2 + 22 - 128a + 74a. Let c be m(17). Calculate the highest common factor of s and c. 14 Let x(p) = p*2 + 11p. Let s be x(-9). Let y be (-6090)/(-189) + 4/s. What is the highest common factor of y and 4? 4 Suppose 3w = 3z + 348, -4w + 4z - 616 = -9w. What is the greatest common divisor of w and 165? 15 Suppose 10i - 15 = 65. Suppose ic - 287 - 49 = 0. Calculate the greatest common divisor of 105 and c. 21 Let d = -7 - 3. Let p be (-17 + 32)(-6)/d. Let g = p - -11. What is the greatest common divisor of 4 and g? 4 Suppose 4y = 4u + 132, -5y + 4u - 2u + 168 = 0. Suppose 5k = -5d + 255, -64d + 62d + 102 = -5k. Calculate the highest common factor of d and y. 17 Let b be (0/(-2))/((-21)/(-7)). Suppose b = -4h - 0 + 4. What is the highest common divisor of h and 1? 1 Suppose d - 4d = -1224. Suppose 5q - 2i - 988 = 0, 0 = -5q + i + 1397 - d. Suppose 28 = 2t - 8. What is the highest common factor of t and q? 18 Let x = 1866 - 1861. What is the highest common factor of x and 505? 5 Let s = -79 + 85. Suppose -2b = -2y - 6, -5y - 2 = -2b - 5. Let c be 49/b - 1/s. What is the highest common factor of 12 and c? 4 Let f = 12 - 8. Let x be (-418)/(-13) - (-2 - (-280)/130). Calculate the highest common divisor of x and f. 4 Let a be 9/5 - (-8)/40. Suppose 165 = 5x - 5c, 0 = 5x + 3c + ac - 135. What is the highest common divisor of 20 and x? 10 Let c(q) be the third derivative of 9q*2 + 1/60q*5 + 0 + 0q + q*3 + 0q*4 + 1/15q*6. Let v be c(3). Calculate the greatest common divisor of v and 21. 21 Let n be 1/3 - 10/(-6). Suppose -n = -2y + 4, -f = 5y - 10. Let d = f - -13. What is the highest common factor of 32 and d? 8 Suppose -3u - 5n = -11, 5u - 2n + 0 - 8 = 0. Suppose -149x = -200x + 1530. Calculate the highest common divisor of u and x. 2 Suppose 3u - 4z = 153, 4u - 15z - 173 = -20z. What is the greatest common factor of u and 611? 47 Let t be 52/(-390) + 19144/30. Calculate the highest common factor of 58 and t. 58 Let s = 386 - 353. Calculate the highest common factor of 143 and s. 11 Suppose -42j + 4600 = -482. What is the highest common divisor of j and 22? 11 Suppose 7 = -y - 3t, 2y + 2t + 6 - 4 = 0. What is the highest common factor of 14 and y? 2 Suppose 67o - 60o = 1652. What is the greatest common factor of 413 and o? 59 Let m be (-1 - (-16)/24)/((-3)/81). Calculate the greatest common divisor of 9 and m. 9 Suppose 5v = 5a - 70, -32 = v - 0a + 5a. Let w = v + 81. What is the greatest common divisor of 8 and w? 8 Suppose 15w = -82 + 442. What is the highest common factor of w and 184? 8 Let k = 86 - 82. Suppose kj = 3g - 178, 0 = 5g - g - 2j - 254. Let z be -1 + (-3)/(6/(-46)). What is the greatest common divisor of z and g? 22 Suppose 0 = -2s + 7s + 4y - 122, 3s + 3y - 75 = 0. Let x(o) = 1218o - 6035. Let q be x(5). Calculate the greatest common factor of s and q. 11 Let a = 3061 + -2874. Calculate the highest common factor of 34 and a. 17 Let q = 35 - 32. Suppose -qg - 5280 = 2g. Let x be 13/(52/g)-1. Calculate the greatest common divisor of x and 33. 33 Suppose -176 = 5c - 196. Calculate the greatest common factor of c and 7. 1 Suppose 92f + 1258 = 129f. Calculate the greatest common divisor of f and 68. 34 Let x = 13 + 24. Let i be 1/(-12(-8)/31968). What is the greatest common divisor of x and i? 37 Suppose -5h = 5, 2079 = 3v + h + 310. Calculate the highest common factor of v and 10. 10 Suppose -3y + 210 = 2j, 57y + 2j = 52y + 354. What is the greatest common divisor of 1476 and y? 36 Suppose -4 = -u + 28. Calculate the highest common divisor of u and 112. 16 Suppose -2k + 3 = t, t + 3k - 3 + 0 = 0. Suppose 71 = 4n - 3l, -46 = -tn + l + 11. What is the greatest common factor of 50 and n? 10 Let m be 8 - (5 + (-171)/9 + -5). Let j(w) = -w*3 + 3w*2 - 3w + 1. Let q be j(-5). Calculate the highest common factor of q and m. 27 Suppose 4m + 98 = i, -4m - 155 = -4i + 285. What is the greatest common divisor of 95 and i? 19 Suppose -42 + 186 = 4b. Let a = -21 - 3. Let y = a - -48. What is the highest common factor of y and b? 12 Let u = 100 - 98. Calculate the greatest common factor of 17 and u. 1 Suppose 46 = 3d - 2s - 29, s = d - 25. Let y = 42 - d. Calculate the highest common factor of y and 153. 17 Suppose -38 = -k + 4b, 5k - 14b = -9b + 145. What is the greatest common divisor of k and 494? 26 Let o(v) = -v*3 + 11v*2 + 12v - 6. Let z be (-147)/(-12) + (-4)/16. Let y be o(z). Let f = 15 - y. What is the highest common factor of f and 3? 3 Suppose -1967 + 1955 = -3b. Let s(i) = i + 8. Let c be s(-6). Suppose 3v + c - 8 = 0. Calculate the highest common factor of b and v. 2 Suppose -4f = 2c - 3694, 0 = f - 17c + 12c - 940. Calculate the greatest common divisor of 37 and f. 37 Suppose y + 14 = -4c, 2y + 4c + 7 = -9. Let m be 1 + (-3 - 46/y). What is the greatest common divisor of m and 126? 21 Let o be 2/(((-6)/84-4)/5). Let g(r) = r*2 - 8r + 7. Let x be g(8). Calculate the greatest common divisor of x and o. 7 Suppose 195 = 2i + 5d, -8i = -3i - d - 528. Let n(z) = z3 - z2 + 15. Let c be n(0). What is the greatest common factor of i and c? 15 Let i = 11 + -6. Suppose in = 15 - 5. Suppose 18 = q + nq. What is the highest common divisor of 54 and q? 6 Suppose -n + 520 = 64n. Suppose -t = 2j - 4, 4j + 4t - 3 - 5 = 0. What is the greatest common divisor of j and n? 2 Let x = 606 + -558. What is the highest common factor of x and 176? 16 Let c be (-3 + (-69)/(-21))/(1/7). Suppose cl - 2w - 16 = 64, 5l + 4w = 200. Calculate the highest common factor of l and 16. 8 Suppose -12 = q - 3q. Let y be 1/(-2) - 230/4. Let h = -10 - y. What is the greatest common factor of h and q? 6 Suppose -4h = f - 431, 0 = 5h - f + 2f - 539. Let k(d) = -4d + 7. Let x be k(-5). What is the highest common divisor of h and x? 27 Let a(c) = c3 - 20c*2 + 19c + 21. Let k be a(19). Calculate the highest common factor of k and 28. 7 Suppose -2k = -3f - 12, 2 = 5f + 22. Let i be (-13 - -1)3/((-36)/6). Let y be (12 - k)92/i. What is the greatest common factor of y and 23? 23 Suppose -165d - 1512 = -174d. What is the greatest common factor of 72 and d? 24 Let u(z) = z2 + 3z + 3. Let r be u(-3). Suppose -r = -2i + 11. What is the greatest common divisor of 35 and i? 7 Let y = 5 - 2. Suppose 0h - 88 = -2h - yg, 4g = -4h + 176. Calculate the greatest common factor of 4 and h. 4 Let i(u) = -u*2 - 4u + 14. Let x(p) = 2*p	{ "pile_set_name": "DM Mathematics" }
d 69788. 69788 What is the common denominator of -37/14 and 67/52340? 366380 What is the smallest common multiple of 10 and 6923? 69230 What is the smallest common multiple of 26607 and 1086? 53214 Calculate the least common multiple of 2400 and 120. 2400 Calculate the lowest common multiple of 48 and 244194. 1953552 Find the common denominator of 21/1595 and 1/210265. 6097685 What is the least common multiple of 3942 and 582? 382374 Find the common denominator of 7/30 and -125/14016. 70080 Calculate the common denominator of 53/21 and 83/276423. 276423 Calculate the smallest common multiple of 2872 and 38413. 307304 Calculate the common denominator of 113/6 and -87/479668. 1439004 Calculate the common denominator of -79/71852 and 29/782. 1221484 Find the common denominator of 9/136 and -57/13175. 105400 Find the common denominator of 25/4081 and 9/229649. 2526139 Find the common denominator of 17/2511 and 86/9765. 87885 Calculate the lowest common multiple of 275 and 124775. 1372525 Calculate the lowest common multiple of 6 and 534. 534 Find the common denominator of -115/152388 and -23/78. 1981044 Calculate the common denominator of -13/21 and -41/25347. 25347 What is the common denominator of -19/6123 and -16/4537? 2136927 Find the common denominator of 103/14436 and -31/126. 101052 Calculate the least common multiple of 11135 and 5. 11135 Find the common denominator of 37/1896 and -121/504. 39816 What is the lowest common multiple of 3546 and 6304? 56736 What is the common denominator of -71/9492 and 43/14238? 28476 Calculate the least common multiple of 147660 and 49220. 147660 What is the smallest common multiple of 70020 and 240? 280080 Calculate the least common multiple of 1854 and 7508. 6959916 Find the common denominator of 99/15932 and -53/68. 270844 What is the common denominator of -73/34595 and 9/185? 34595 Calculate the least common multiple of 9149 and 275777. 1930439 Calculate the smallest common multiple of 9191 and 845. 597415 What is the smallest common multiple of 16728 and 2788? 16728 What is the common denominator of 97/577280 and 20/9? 5195520 Find the common denominator of 41/78 and -103/138632. 415896 Calculate the smallest common multiple of 174930 and 153. 524790 What is the lowest common multiple of 52070 and 20828? 104140 What is the common denominator of -113/80 and -39/253880? 507760 What is the common denominator of 67/1015 and -13/435? 3045 Calculate the common denominator of -13/21328 and -137/24. 63984 Find the common denominator of 80/509859 and -25/315627. 6628167 Calculate the smallest common multiple of 22 and 24034. 264374 Calculate the least common multiple of 58272 and 96. 58272 What is the least common multiple of 1112 and 54210? 216840 What is the common denominator of -27/60760 and -34/37975? 303800 Calculate the least common multiple of 10815 and 155. 335265 Calculate the least common multiple of 56 and 526748. 7374472 Find the common denominator of 29/840 and -151/2232. 78120 Calculate the least common multiple of 270144 and 2940. 9455040 Find the common denominator of -13/72368 and -29/108552. 217104 What is the common denominator of -25/2924 and -73/344? 5848 What is the common denominator of -11/1087060 and -23/5876? 1087060 What is the common denominator of 101/5460 and -193/318360? 4138680 What is the common denominator of 39/13331 and 29/123? 1639713 Calculate the common denominator of -15/466484 and 9/556. 466484 Calculate the common denominator of -49/76782 and -115/76782. 76782 What is the least common multiple of 2724 and 31780? 95340 What is the common denominator of 28/9 and -32/225093? 675279 Calculate the lowest common multiple of 15 and 1245. 1245 Calculate the smallest common multiple of 54020 and 2555. 378140 Calculate the common denominator of 47/8355 and 11/75195. 75195 Calculate the lowest common multiple of 375774 and 230. 1878870 Find the common denominator of -57/17435 and 58/470745. 470745 What is the smallest common multiple of 6454 and 23972? 167804 Calculate the smallest common multiple of 684 and 6390. 242820 Find the common denominator of 56/86581 and -3/187. 86581 Calculate the least common multiple of 801 and 24267. 6479289 Find the common denominator of -13/73 and -69/5192. 379016 Find the common denominator of 79/7100 and 88/15975. 63900 What is the common denominator of 127/29472 and -133/7368? 29472 Calculate the smallest common multiple of 100 and 256. 6400 What is the smallest common multiple of 235499 and 107045? 1177495 Calculate the lowest common multiple of 9 and 6259. 56331 What is the lowest common multiple of 3047028 and 52? 39611364 Calculate the least common multiple of 36050 and 82915. 829150 Calculate the lowest common multiple of 233255 and 176. 3732080 Find the common denominator of 5/48 and -1/228788. 2745456 What is the lowest common multiple of 26245 and 20996? 104980 Calculate the lowest common multiple of 191322 and 28344. 765288 Calculate the common denominator of -55/794 and 73/1882. 747154 What is the smallest common multiple of 2008 and 8785? 70280 Find the common denominator of -70/9 and -22/255909. 767727 What is the smallest common multiple of 15 and 31105? 93315 What is the common denominator of -51/12128 and -45/94? 570016 What is the common denominator of -40/31 and 73/545139? 16899309 What is the common denominator of -1/44 and -101/44264? 44264 Calculate the lowest common multiple of 18 and 22008. 66024 What is the lowest common multiple of 1441 and 26069? 286759 Find the common denominator of 41/27 and -41/827157. 7444413 Find the common denominator of 17/1000 and 65/62. 31000 Calculate the common denominator of -137/250290 and -76/891. 2753190 What is the smallest common multiple of 21012 and 6798? 231132 What is the lowest common multiple of 282020 and 295? 282020 Calculate the smallest common multiple of 5130 and 1080. 20520 Find the common denominator of -47/16 and -119/154674. 1237392 Find the common denominator of 69/29222 and -67/1990172. 37813268 Find the common denominator of -42/5 and 23/325366. 1626830 What is the common denominator of 79/25964 and 5/207712? 207712 What is the common denominator of 32/143 and -9/42064? 546832 What is the common denominator of -37/4710 and 83/10? 4710 Calculate the common denominator of 103/70 and -41/8608. 301280 What is the least common multiple of 376 and 16896? 794112 What is the smallest common multiple of 463972 and 12020? 2319860 Find the common denominator of -149/248352 and 17/455312. 2731872 Calculate the lowest common multiple of 12740 and 11760. 152880 Calculate the lowest common multiple of 30 and 70. 210 What is the common denominator of -107/2580 and -95/2064? 10320 Calculate the least common multiple of 15302 and 154. 168322 Calculate the smallest common multiple of 35855 and 78881. 394405 Calculate the least common multiple of 288 and 15456. 46368 What is the lowest common multiple of 12 and 1492536? 1492536 Find the common denominator of -101/5520 and -103/1104. 5520 Find the common denominator of 83/3844 and 181/714. 1372308 Calculate the least common multiple of 2160 and 800. 21600 What is the common denominator of 125/28608 and -127/66? 314688 Calculate the least common multiple of 270 and 15732. 235980 What is the smallest common multiple of 4544 and 8? 4544 What is the common denominator of 83/168 and -59/22974? 91896 What is the least common multiple of 37064 and 4? 37064 Calculate the common denominator of 16/279 and -11/17. 4743 What is the common denominator of 113/861400 and -53/100? 861400 Find the common denominator of -73/2457 and -155/67392. 471744 Calculate the smallest common multiple of 26 and 21642. 281346 What is the lowest common multiple of 10071 and 72? 80568 What is the smallest common multiple of 1494 and 144? 11952 Calculate the common denominator of 105/418 and 59/102. 21318 Find the common denominator of -47/159 and -64/1431. 1431 Calculate the common denominator of -65/8844 and 16/9207. 2467476 Find the common denominator of 83/76760 and 29/120. 230280 Find the common denominator of 8/258225 and -61/198. 1549350 What is the common denominator of -95/336 and -1/1056? 7392 What is the common denominator of 19/6875 and -49/40? 55000 Calcu	{ "pile_set_name": "DM Mathematics" }
- 0z, 0 = -n + 2z + 2. Suppose -ng = -17 - 31. What is the tens digit of g? 1 Let d = 0 + 53. What is the units digit of d? 3 Let p = -47 + 4. Let n = p + 68. What is the tens digit of n? 2 Let a = 2 + 1. Suppose 5u + l = 19, -2u + 6 = al + 1. Suppose -g + 5 = ug. What is the units digit of g? 1 Suppose -4z - 3r = -199, 7r = 3r - 12. What is the tens digit of z? 5 Let r(u) = u2 - 7u + 7. Let o be r(7). Suppose -2n = -on - 5. What is the tens digit of (-9)/n + 2/2? 1 Let f(o) = -4o2 - 2o. Let x be f(-1). What is the units digit of 17 - -4 - x/2? 2 Let f(j) = j - 1. Let g = 6 - 2. Let a(i) = 6i - 1. Let d(u) = gf(u) - a(u). What is the units digit of d(-5)? 7 Suppose -4l + 129 = 5b, -5l = -9b + 4b - 105. What is the tens digit of l? 2 Let r be 1 + (0 - 1) + -3. Let k = -1 - r. What is the units digit of k? 2 Let t(v) = v2 - v. Let x be t(1). Let c = -11 - -20. Suppose n + 2n - 2b - c = x, 2n = 4b + 14. What is the units digit of n? 1 Suppose 3s + 2n = 220, 0 = 4s - 9s + n + 358. What is the tens digit of s? 7 Let t be 2/7 + 114/42. Suppose 5v + 4 = 9v, 11 = tq - 4v. Suppose 40 = 4u + qi, 5u + 4i - 40 = u. What is the tens digit of u? 1 Let x(l) = 3l + 3. Let u be x(-2). Let c = u + 1. What is the units digit of (1 + c)/(1/(-3))? 3 Suppose -4i = 6g - 3g - 25, 5g = 2i + 7. Suppose -gq + 15 = -4u - u, -5q - 3 = u. Suppose q = b + 3b - 28. What is the units digit of b? 7 Let r = 16 + -2. Let k = r - 4. What is the tens digit of k? 1 Suppose 2l = -3l + 15. Let q be l(-1 - (-21)/9). Suppose q = 2s - 0. What is the units digit of s? 2 Let v(b) = b2 + 4b - 3. Let k be (-20)/(-6)(-6)/5. Let a be v(k). Let x = a + 11. What is the units digit of x? 8 Suppose 2o - 6o = -32. Let l(a) = -a2 - 7a + 1. Let r(t) = -6t2 - 34t + 4. Let i(k) = -11l(k) + 2r(k). What is the units digit of i(o)? 5 Suppose -i + 134 = 5j, 4j + 5i = i + 104. What is the units digit of j? 7 Let b(y) = 4y*2 + y - 3. Let l be b(-4). Suppose -3u + l = -0u. What is the units digit of u? 9 Let d(z) = -z3 - 10z*2 - 8z + 7. Let b be d(-9). Let q be 2/4(6 - b). Suppose g = qg - 12. What is the units digit of g? 4 Let g(x) = x + 8. Let s be g(-7). Let y = 2 + s. Suppose j - 27 = -yl, 2j - j - 3 = 0. What is the units digit of l? 8 Suppose 22 = 10x - 118. What is the tens digit of x? 1 Let r = 7 - 1. What is the units digit of 40 - 3 - r/2? 4 Let a(w) = 7w + 3. What is the units digit of a(0)? 3 Let z(h) = h*3 + 5h*2 - 6h - 3. Let f be z(-5). Suppose 24 = w + 3w - 4t, 2w - 5t - f = 0. What is the units digit of w? 1 Suppose -32 = 2n - 4n. What is the units digit of n? 6 Let r = 0 - -3. Suppose rm + 4n - 12 = n, 5n + 10 = m. What is the units digit of m? 5 Let j = 10 + -6. Suppose d - jy - 18 = -0d, 0 = -2d - 4y + 12. Suppose -4s + g + d = -0s, 16 = 3s - 5g. What is the units digit of s? 2 Suppose -64 - 104 = -4m. What is the units digit of m? 2 Suppose 116 = -3a + 410. What is the units digit of a? 8 Suppose 2n + 73 = -x, n - 5x = -x - 50. What is the units digit of n/(-5) - (-4)/10? 8 Suppose s = -5g - 2s + 900, -g = 2s - 173. What is the tens digit of g? 8 Let u = -3 + 12. What is the units digit of u? 9 Suppose -2t + 396 = 3j, -2j - 2t + 206 + 60 = 0. What is the hundreds digit of j? 1 Let f(n) = -n*2 + 1. Let t be f(-3). Let y = t + 14. What is the units digit of y? 6 Let j(l) = 2l*2 - l - 1. Let y be j(2). Suppose 0 = -3v - 3r + 18, y = -v - 4r - 4. What is the units digit of v? 1 Let p = -1 - -6. Suppose pl - 3 = 17. What is the units digit of l? 4 Let k(j) = j + 4. Let m be k(0). Suppose -3n = mv - 2, 5n + 0n - 4v = -18. Let x = 4 - n. What is the units digit of x? 6 Let a(x) be the first derivative of -2 + 2/3x3 - 4x - 1/2x2. What is the tens digit of a(-3)? 1 Suppose -5q - 12 = -2s + 18, -4s + 28 = -2q. What is the tens digit of 2(17 - (-12)/q)? 2 Suppose -128 = -5m + d, -3m + 2d + 81 = -0. What is the tens digit of m? 2 Let p be (6/(-4))/((-3)/6). Let u be (-3)/12-462. Suppose 4b = 5r + u, -4 = pb + 4r + 2. What is the units digit of b? 2 Let t(m) = -m + 5. Let s be t(6). What is the units digit of 11 - 0s/4? 1 Suppose 4r + 3r - 973 = 0. What is the tens digit of r? 3 Suppose -3r + 113 + 172 = 0. What is the tens digit of r? 9 Suppose 15 = -5z, 0z + 3z = -w - 20. Let h = 18 + w. Suppose m = -h + 14. What is the units digit of m? 7 Let u(m) = m*2 - 4m - 4. What is the tens digit of u(-8)? 9 Let z = -11 + 15. Suppose -zj + 120 = -d - 5, 9 = 3d. What is the units digit of j? 2 Suppose 0 = f - 3b - 84, 2 = -2b - 8. Let c = f - 43. What is the units digit of c? 6 Let o = -44 - -80. What is the tens digit of o? 3 Let c = -4 + 11. Suppose 2v - 65 = -c. What is the units digit of v? 9 Let n(h) = -1. Let m(k) = -k - 8. Let w(f) = m(f) - 6n(f). What is the units digit of w(-4)? 2 What is the tens digit of 485/(20/3)? 3 Let b = -109 - -213. What is the units digit of b? 4 Suppose -2v + 52 = -84. Suppose -4t = -48 - v. What is the tens digit of t? 2 Suppose -10l + 680 = -270. What is the tens digit of l? 9 Let y = 3 - 4. What is the units digit of y - (2 + (-8 - -3))? 2 Let o = -4 - -6. Suppose 0 = -oq + m + 24, -2q - m - 10 = -3q. Suppose 0 = r + 4k + q, -3r + 1 = 3k - 2. What is the units digit of r? 6 Suppose -4j = -77 - 419. What is the tens digit of j? 2 Suppose -24 = -3p - 2h + 6h, 0 = -5p + 5h + 40. Suppose 4v = pv - 52. What is the tens digit of v? 1 Let j(y) = 4y3 - y + 5. Let k(o) = -5o3 + o2 - 6. Let b(w) = -6j(w) - 5k(w). Let g be b(4). Let l = g + -6. What is the units digit of l? 2 Suppose 903 = 11f - 747. What is the units digit of f? 0 Let r(q) = 2q*2 + 9q + 11. What is the tens digit of r(-6)? 2 Suppose o = 2n + 8, 2n + 2n = -5o - 16. Suppose -4g - 2a + 106 = 0, o = a - 1 + 4. Let f = 39 - g. What is the tens digit of f? 1 Let p = 116 + -72. Suppose 0 = s - x - p, 0 = 4s - 0x - 5x - 181. What is the units digit of s? 9 Suppose 3t - 1 = -2i, -3i - t - 1 = -6. Let g = i + 1. What is the units digit of g? 3 Let n = 642 + -303. What is the tens digit of n? 3 Suppose 4 = 2r - 6. Suppose -2m + 0t = -2t + 10, -32 = rm + 2t. Let g = 23 + m. What is the units digit of g? 7 Let c(k) = -k3 - k2 + 5 + 3k - 6 - 3k. Let a be c(0). What is the units digit of (1 - 1/a) + 5? 7 Let f = -25 + 30. Suppose 3q + 3 - 42 = 0. Suppose 2t - f = q. What is the units digit of t? 9 Suppose 5l + 3y - 12 = 9, -2y - 5 = -3l. Suppose l = 3z - 0. What is the units digit of z? 1 Let m(n) = -n2 + 7n - 4. Let o be 1/(0 + (-2)/(-10)). Let p be m(o). Let k = p + 1. What is the units digit of k? 7 Suppose -3y + 17 = -16. Suppose 2j - 5b = y, 0 = -j + 3b + 2 + 3. Suppose 2g - 3g + j = 0. What is the units digit of g? 8 Suppose -2h - 5d + 24 = 0, -2h - 3d + 27 = h. Let s(w) = 3w - 4. Let j(n) = -10n + 13. Let a(t) = 2j(t) + 7s(t). What is the units digit of a(h)? 5 Suppose 4 = 2g + 2g. Let m = 6 - g. Suppose -12 = -c - mz, 7z = -5c + 2z + 20. What is the units digit of c? 2 Suppose 3n - 2n + 4o - 24 = 0, n - 5o = -12. Let f(x) = x*2 - 8x - 1. Let b be f(n). What is the tens digit of (-9 + -1 + b)-1? 1 Let o be -2100/(-2) + 0. Suppose -k + o = 4k. What is the units digit of k? 0 Let j = 14 - 10. Let q(f) = -f3 + f2 + 4f - 3. Let a be q(2). Suppose 0 = -jg + a + 31. What is the units digit of g? 8 What is the units digit of 2021 - (2 + (-4 - -2))? 2 Let c be 4 - (-3 - (-2 - 1)). Suppose 0 = 2n - 62 + c. What is the tens digit of n? 2 Suppose 2l + 2l - 193 = -5c, 0 = -4c - l + 161. What is the units digit of c? 1 Let x = 4 - 5. Let g be ((-3)/(-5))/(x/(-35)). Suppose -4d = -g - 39. What is the units digit of d? 5 Let d = 0 + 1. Let c be ((-1)/(-4))/(9/36). Let r = c + d. What is the units digit of r? 2 Suppose 2u + n + 3 - 20 = 0, 5n = 5u - 80. Let z be (-6 - 0)(1 + 0). Let f = u + z. What is the units digit of f? 5 Let w be 3/6(6 + 0). Suppose -wf + 15 = 0, -f + 13 = 5h - 12. Suppose -23 = -3m + 4t, -1 = -m + ht + 4. What is the units digit of m? 9 Let z be -25 - (-3)/((-9)/(-3)). What is the units digit of (88/6)/((-16)/z)? 2 Suppose 0	{ "pile_set_name": "DM Mathematics" }
n = -38 for o. 6 Solve -3b = 5s + 143, 4b = 2s + 3s + 238 - 67 for b. 4 Solve -306426k + 306429k = -2m + 38, 12 = 4m + 2k for m. -5 Solve 2002b = 2003b - 27t - 517, 4t = -2b - 68 for b. 4 Solve 325608l - 325604l - 4g - 24 = 0, 12g = -2l - 2 for l. 5 Solve 14741y - 2v - 2 = 14737y, 2v - 2 = 0 for y. 1 Solve 116j - 83 = 145j + w, w = j + 7 for j. -3 Solve -l = 535s - 534s - 116 + 114, 9 = 2l - 3s for l. 3 Solve -38l = -4k - 40l - 130, -10k + 2l = -12k - 64 for k. -33 Solve -3f + 105 = -4s, -28s + 26 - 459 = -3f + 392 for s. -30 Solve 0 = -3a + 66, 5 = -4p - 6a + 5a + 4 + 11 for p. -3 Solve -37s + 57 = 4u - 32s, 0 = -u - 4s + 28 for u. 8 Solve 62349c - 62369c + 40 = 0, 3q + 3 = -3c for q. -3 Solve -7v - 8a + 4a = 102, 5v - 2a + 11 + 57 = 0 for v. -14 Solve -5d + 294n - 585n + 290n + 50 + 110 = 0, 3n = 25d - 840 for d. 33 Solve -61n - 3s + 64 = -0s, s = 4n - 9 + 6 for n. 1 Solve -2f - f = 8c - 0c + 81, 14f + 5c + 0 + 87 = 0 for f. -3 Solve 24b - 27b + 2q - 23 = 0, -b - 5q + 18 - 3 = 0 for b. -5 Solve -437q + 433q = 5w - 24 - 68, -2w - 2q = -44 for w. 4 Solve -2t + 60260j - 60221j = -201, -19 = 2t + 5j for t. 3 Solve -56 = -y - 2m - 11, -11y + 0m + 12 = -m - 23 for y. 5 Solve -2u + 37 = -5u - 648v + 644v, 3u - 79 - 40 = 35v for u. -7 Solve 0 = 2c - b - 1, -3b + 16 = -4c + 6 + 5 for c. 4 Solve 2u = -1483b + 1489b + 56, 4 = -5u - b for u. 1 Solve -2x + 2876 = -2b + 2910, 3x = 63b + 9 for b. -1 Solve -2d = 3h + 1128 + 1115 - 2210, -h - 4d = 51 for h. -3 Solve q - 22 = -1463818c + 1463814c, -10c + 2q = -46 for c. 5 Solve 16h + 40 = -b + 21h, -9b - 4 = -8b - h for b. 5 Solve 92t - 371 = -3i, 3i + 5t - 13 = -0t + 10 for i. 1 Solve 0 = 2r + j - 14, -48r + j + 239 - 3 = 0 for r. 5 Solve 0 = 3u + 4i - 8, -14716 + 14700 = 4u - 8i for u. 0 Solve 0 = 5w + 5y - 65, 4w + 2y = -19 + 40 + 15 for w. 5 Solve -48 = 5y + 6i, 0 = -4y + 74i - 40i - 30i - 12 for y. -6 Solve -3x + 8x - 5r = 300, 14x + 11r + 669 = 16x for x. -1 Solve 0 = -4n + 5p + 129, -37n + 63n + 5p + 133 = 29n for n. -4 Solve -w + 4w = 11m - w + 169, 216m - 213m = -w - 44 for m. -15 Solve 44 = 5j + 3i, 18i + 4i - 528 = -4j + 9i - 51i for j. 4 Solve -2m - 65s - 91 = 0, 75 - 74 = -s for m. -13 Solve -5f + 3p + 52 = 0, 25f + p + 4p = 4f + p + p for f. 2 Solve 31799l - 31794l + 2y - 2 = 0, 0l - 8 = l + 5l + 5y for l. 2 Solve -324c = -4h + 308c - 627c + 21, -h = 9c - 36 for h. 9 Solve 3g - 57 = -4i, 2i - 18 = -5i + 6i + 3g for i. 15 Solve -36g - 6m = 138, -2g - 6 = 3320m - 3318m for g. -4 Solve -427s + 3f = -1257, 7f + 13 = s + 9f - 6 for s. 3 Solve -2q - 15n + 0n + 0n + 24 = -5n - 4n, -106q + 3n - 12 = 0 for q. 0 Solve 28f + 186 = -5q, 3f - 71 = 4q - 100 for q. 2 Solve -240b = 3a - 244b + 41, 4a = -0a + 7b - 58 for a. -11 Solve 6n + 0d + 2d - 123 = 45n + 92n + 151, -46 = 8n - 5d for n. -2 Solve -l + 10804g - 5403g - 1 = 2l + 5402g, -10g + 25 = -5l for l. -1 Solve -4n + 7n - 13f = -128 - 26, -4f - 20 = -9f for n. -34 Solve 5i + 5t = -5, -6i + 8 = 2155t - 2156t for i. 1 Solve 2432062u + 5c = 2432060u + 23, -4c = u - 19 for u. -1 Solve -16d - 10u + u = -20d + 33, 2d + 3u - 9 = 0 for d. 6 Solve 5j + 11l - 23 = 12 - 27, -4j - 9l + 6 = 0 for j. 6 Solve g + 1978870h + 27 = 1978873h, -3h + 18 = -4g for g. 3 Solve -3v = -5n - 46, 24n + 5v - 3v = -12 + 108 - 38 for n. 1 Solve -r + 3u = 2r + 2570 - 2798, -3r - 3u + 252 = 0 for r. 80 Solve q = -2t + 16, 2q + 5950 = -6t + 6002 for t. 10 Solve -138f + 158f + 4q - 2q + 52 = q, 0 = f + 2q + 26 for f. -2 Solve -10g + 15g = 9g - 204u - 1208, 6g = g - 5u - 50 for g. -4 Solve 4013t + 33 = 4016t - 2x, 47 = 2t + 7x for t. 13 Solve 1332023d = -3o + 1332018d - 36, 2d + 110 = -49o for o. -2 Solve 0 = -5l - 101o + 96o + 5, -2l + 2o = -6l - 4 for l. -3 Solve 3r + 109b - 107b = 4, -4r + 2b = b + 13 for r. -2 Solve 20h + 18h + 195 = -20w + 43h, w = -h - 2h + 78 for w. -3 Solve -3w + 9 = -4w + 3l - 6, 459 + 118 = -65w - 4l for w. -9 Solve -34 + 9 = 5f + 2x + 13, -3f - 301 = 18x + 125 for f. 2 Solve 137g + 5s + 17 = 139g, -2g - 5s - 162 = -129 for g. -4 Solve 0 = 5z + 3r - 120, -3r + 6r = 2z + 3r + 4r - 48 for z. 24 Solve -3t - 497 + 534 = 2h, -3h - 2h - 452 = -53t for t. 9 Solve 6b + 0k - 42 = -3k, -k + 166 - 73 = 9b - 4k for b. 9 Solve -28y + 52y + 142 = 27y - 2s - 70, -4s - 20 = s for y. 68 Solve 2b + 16 = p - 3b, -5p + 681b = 684b + 32 for p. -4 Solve -3t + 3 = -3i, 2t - 3t - 4t + 6t - 5i = -19 for t. 6 Solve -41z + 35 = 117, 2j + 4 + 6 - 57 + 13 = 2z - 14 for j. 8 Solve 2x - 3j - 74 = 37 - 73, -9x + 26 = j for x. 4 Solve -2m = -3p + 2260 - 4528 + 2224, -m - 8p = 92 for m. 4 Solve 54 = 2v + 3g, 4v - 2g - 17 = 55v - 53 for v. 0 Solve -123s - 115s = -3y - 235s - 87, 0 = 5y + 3s + 121 for y. -26 Solve 5s - a + 93 = 124 + 141, 100 = 3s + a for s. 34 Solve 6u + 342 - 30 = -6o, o + 161 = -2u - 2u - 2o for u. -5 Solve s - 12224 = -4g - 12199, 4s = -5g + 45 for g. 5 Solve -2x + 317 = i - 317 + 657, 5i = -4x - 49 for x. -11 Solve -440 = -k + 5t, -264 = 3951k - 3948k + 3t for k. 0 Solve -41w + 86w - 111 = -v + 42w, 5v - 5w + 205 = 0 for v. -3 Solve -2a = 2g + 6, 138279a - 2g - 2g - 12 = 138279a for a. 0 Solve -3g + 5f = 287, 4965g - 4968g - 232 = -4f for g. -4 Solve n = 28t - 6187 + 8205, -3n = -4t - 294 for n. 2 Solve -22d - 16d + 62d + 6 = 20d + 3w, 9 = -d + 2w for d. 3 Solve 4i - u = 35, -253894u + 253890u = 3i - 50 for i. 10 Solve -4t = -2t - 471s + 467s, -4t - 4s = -0s + 24 for t. -4 Solve -22m + 69 = -w, -1967m + 1971m + w - 9 = 0 for m. 3 Solve -226g + 81g - 4p = -74g - 76g, 5g - 5 = 3p for g. 4 Solve 0 = 26r - 4n - 65 + 179, -15 - 1 = -25n + 29n for r. -5 Solve p + 5p = 0, -7b - 490p = -8b - 485p - 2 for b. -2 Solve 53x - 71x = -13x + 385, 0 = -y - 3x - 235 for y. -4 Solve 38w = 13w - 4n + 492, n = 2w - 75 + 33 for w. 20 Solve 3x + 6a - 24 - 26 - 39 = -53, 32 = -2x + 4a for x. -2 Solve -103m - 20y = -28m - 18y - 5y + 6000, -80 = m - y for m. -80 Solve -3278o + 124 = -3271o + 5j, 3j - 3 = 0 for o. 17 Solve 2g - 4v + 11 + 12 = 19, -4v - 4 + 24 = 2g for g. 4 Solve -l = 5x - 9, -1872 + 957 + 964 = -15x + l for x. -2 Solve -5p + 25v = 11v + 15v + 22, 0 = 5p - 2p + 5v for p. -5 Solve 4551x = 4548x - 3t + 6, 40t - 280 = 0 for x. -5 Solve 0 = -4o - o - m + 6m + 355, 0 = -3o - m + 201 for o. 68 Solve -w + 43 = -3w - 50 + 31, 2i - 5w = 165 for i. 5 Solve -5a - 55 = -5w, -2w + 1897 = 3a + 1920 for w. 2 Solve -2d - 94 + 304 = 2l, 0l + 3l - 67d - 315 = -17d for l. 105 Solve -3h - 45 - 4 = -33y + 68, 72h - 68h + 4y - 36 = 0 for h. 5 Solve 0 = -2y + 48888l - 48892l + 26, 71 = 6y + 5l for y. 11 Solve 0 = -2u + 4, 41h + 5 = 28h + 19h - 7h + u for h. -3 Solve 242874h - 3p = 242889h + 69, 4h + 5p + 10 = 0 for h. -5 Solve -1 = 2x - 3f + 2, 0 = -21x + f - 62 for x. -3 Solve -4o - 12961u - 51 = -12966u, 6o - 4u + 52 = 0 for o. -4 Solve 3o - 36 = 0, 0 = -9818a + 9813a + 5o - 45 for a. 3 Solve -4h - 40 = 0, 1275q + 57h = 1279q + 14h - 410 for q. -5 Solve -10n - 14p + 6 = 0, -5n = 2p + 64 - 47 for n. -5 Solve -3p - 37 = 2y, y - 2p - 153 + 133 = -0y for y. -2 Solve 0 = -y + 5s - 95, -10y + 4s = 9y - 15y + 76 for y. 0 Solve -2v - 5d + 3 = -3v, -90v - 4d = -1092 for v. 12 Solve 0 = 3m + z - 2, -6 = -2m - 109297z + 109294z for m. 0 Solve -29p + 33p - 24 = 14w, -9w + 4p = -74w + 24 for w. 0 Solve -4d + 13 = a, -253a - 16 = 2d + 263a - 520a for d. 2 Solve -4692 + 4778 = -2a - 4u, 6u - 265 = -4a + 21u for a. -5 Solve q + 19 = -17l, 4331q + 6 = 4328q for l. -1 Solve 9x - 2a = 12x - 22, a = -x - 11 + 35 - 15 for x. 4 Solve 0 = -2l + 23z - 18z - 21, -63 = -l + 28z - z for l. -18 Solve 0j + 3j - 100 = 12i - j - 20, 2i + 2j = 0 for i. -5 Solve 17337 = -5b + o + 17313, 3o = 2b + 33 for b. -3 Solve -r + m + 44 = -2m, -3m - 96 = 15r - 612	{ "pile_set_name": "DM Mathematics" }
s positive. l(240/11) Simplify g(-4/9)/g(((g/(g(-3/13)g))/g)/gg)/g assuming g is positive. g(-376/117) Simplify (d(2/13)d)42 assuming d is positive. d(630/13) Simplify ((ggg/g3)/g)(-14/11) assuming g is positive. g(14/11) Simplify h(10/9)h12hh assuming h is positive. h(136/9) Simplify (d/(d(14/3)d))/(d/d(-2/55)) assuming d is positive. d(-941/165) Simplify ((rr/r(-2/7)r)/r)*40r*5r3 assuming r is positive. r(696/7) Simplify j(-25)/j(5/4) assuming j is positive. j*(-105/4) Simplify (gg*(-1/3)/ggg7)/(g/(g/g(-5))g4) assuming g is positive. g(26/3) Simplify (p/(p*1p)p)/p(-8) assuming p is positive. p8 Simplify (p(-4))40 assuming p is positive. p(-160) Simplify ((ii*(-8)i)/i(-6))(12/17) assuming i is positive. 1 Simplify ((((z/z*(-3/2))/zz)/z)/zz)(-21) assuming z is positive. z(-63/2) Simplify (f(-1/8)f)/f*(-2/29)((f/f*2)/f)/(fff/(ff*9)f) assuming f is positive. f(1147/232) Simplify s(-1/15)/(s*(-3/8)/s)(ss(2/7)s)0 assuming s is positive. s(157/120) Simplify ((ll(-4))(12/11))34 assuming l is positive. l(-1224/11) Simplify (g(-4)/g)/((g7/gggg)/g)(g(-1)gg)36 assuming g is positive. g23 Simplify (i/i(-11))/((i(2/89)i)/i) assuming i is positive. i(1066/89) Simplify (z/z(-3/8))/zz(-1) assuming z is positive. z(-5/8) Simplify (t34)(2/27) assuming t is positive. t(68/27) Simplify (r(-6)/r5)(35/6) assuming r is positive. r(-385/6) Simplify (a(2/5))(-5)(a1)26 assuming a is positive. a24 Simplify (a/(a(-1)/aa))(-1/13)(aa0)29 assuming a is positive. a(375/13) Simplify s3s*8s assuming s is positive. s12 Simplify ((y/(y(-6)y))/yyy/(y(-2/3)y))/((y*(-3/5)y)/yy7y) assuming y is positive. y*(-11/15) Simplify ((f/(ff/(ff(3/5))))/f(2/15))(-13/7) assuming f is positive. f(-13/15) Simplify x(-5/2)/(x/x(-9/2)) assuming x is positive. x(-8) Simplify ((bb*(1/4))/bb(-3/4)/b)(6/7) assuming b is positive. b*(-9/7) Simplify ((x(xx(3/5))/x)/x(-4/3))(-48) assuming x is positive. x(-704/5) Simplify p/p(-8/9)p(-18) assuming p is positive. p(-145/9) Simplify (rr(-10/7)rr)/rr(3/13)/r assuming r is positive. r(-18/91) Simplify (b*(-14/11)b)(1/3) assuming b is positive. b(-1/11) Simplify (((a/(a/a*(5/6)))/a)/aaaa/a9)/(a/a(-3)a(1/6)) assuming a is positive. a(-34/3) Simplify (m(m/(m*(-2)/m)mm)/mm)/m*0(mm(-2/7))(-4) assuming m is positive. m(29/7) Simplify (m1)46(m/((mm3/m)/m)mm)(-41) assuming m is positive. m5 Simplify (w(-4)/ww(-2))/(w(2/3))(16/9) assuming w is positive. w(-221/27) Simplify ((((d/(d/d(-8)))/d)/d)/d(-2/49))29 assuming d is positive. d(-14152/49) Simplify c*34/(c((c*(-5/6)/cc)/c)/cc) assuming c is positive. c(209/6) Simplify (z(2/5)z)*30z(-3/5)/z(-5) assuming z is positive. z(232/5) Simplify (k(1/32)k)(-11/2) assuming k is positive. k(-363/64) Simplify (cc*(-1)ccc10)28 assuming c is positive. c336 Simplify u(-6)uu(u(-1/13)/u)/u assuming u is positive. u(-79/13) Simplify p6/(p5/p)(p(p/p(-2/7))/p)1 assuming p is positive. p(23/7) Simplify (y/y(-1))0 assuming y is positive. 1 Simplify (i(-1)/i)(-3/19)/(i9i2) assuming i is positive. i(-203/19) Simplify (ii(-29))/(i/i18) assuming i is positive. i(-11) Simplify (rr/((rr(1/2)r)/rrr))(-1/57) assuming r is positive. r(1/38) Simplify (p6)(-3/10) assuming p is positive. p(-9/5) Simplify o(1/9)o/o(-31) assuming o is positive. o(289/9) Simplify (yy(-2/13))/y8y(5/7)y/y*(-5/6)y assuming y is positive. y*(-1969/546) Simplify ((z(z/(z/z(-2/9)))/z)/z(2/33))(-3/20) assuming z is positive. z(7/165) Simplify (a/(a*(2/75)aa))/a(-10) assuming a is positive. a(673/75) Simplify c/(c/(c/(c/(c(3/2)/c))))cc2(c(-1/4))12 assuming c is positive. sqrt(c) Simplify (q/q3)/q(2/17)(q1/qq)48 assuming q is positive. q(780/17) Simplify (y(-2/3))(-12/5)(y(-3)/y)/y(-3) assuming y is positive. y(3/5) Simplify (t(2/19)/tt(4/3))(-31) assuming t is positive. t(-775/57) Simplify ((l/l(-24))/l)/l21 assuming l is positive. l3 Simplify ((i/(i/((i*(-2/3)i)/i))i)/ii(-1/6))/(i(-4)/ii/(ii/(ii5)i)ii) assuming i is positive. i*(-11/6) Simplify ((r/(rr/(rr(7/5)r)))/r)(-45) assuming r is positive. r(-63) Simplify (h/(h/h*(-3))h*(-2/9)/h)/(hh/(h/h*(-3))h/h(-1/3)) assuming h is positive. h(-32/9) Simplify (d/d*(-1/15))/(d((dd/d(-1/28))/d)/dd) assuming d is positive. d(-407/420) Simplify ((y3)(-5/6))(-48) assuming y is positive. y120 Simplify (z(-13))(3/17) assuming z is positive. z(-39/17) Simplify (x/x(-1/5))(-16/5)x(1/8)/x(1/3) assuming x is positive. x(-2429/600) Simplify qqq(-2/45)q((q/(q/((q/(qq/(q*(2/17)/qq)q))/q)))/q)/q assuming q is positive. q(-1474/765) Simplify (m(-2/9)mmm*(-10)m)/(m*(1/3)m(-4)) assuming m is positive. m(-32/9) Simplify (o/o(-1/2))(12/13)/(((o/((o*(-5/6)oo)/o))/o)/o(-1/4)) assuming o is positive. o(203/156) Simplify (zzz10z(-2/23))(-27) assuming z is positive. z(-7398/23) Simplify u(5/6)/uu/(uu(12/11)) assuming u is positive. u(-83/66) Simplify x*(-3)x(((xx/x*(-7)xx)/xx)/x)/x(xx/(x/(x/x*(-1)x)))17 assuming x is positive. x75 Simplify s*(-4)ss/(ss*(1/7)s)s(ss(1/4)/ss)(-2/59) assuming s is positive. s(-2631/826) Simplify (d(2/5))(1/19)(((d/(dd*(-1/4)))/d)/dd)(-1/4) assuming d is positive. d(317/1520) Simplify (h/((hh(5/3))/hh))/h(2/3) assuming h is positive. h(-7/3) Simplify (p(-1/33)/p)/p8 assuming p is positive. p(-298/33) Simplify (o/o4)/o(1/12) assuming o is positive. o(-37/12) Simplify ((xx/(xx(-3)))(-28))(-40) assuming x is positive. x4480 Simplify ((gg4gg)44)10 assuming g is positive. g3080 Simplify d(-18)/d(2/29) assuming d is positive. d(-524/29) Simplify (u(-2))(1/4)/(u/u(-2/3))12 assuming u is positive. u(-41/2) Simplify (hhh(1/3))(-5/7)/((hhhh*(-6)hh)/h(1/4)) assuming h is positive. h(-5/12) Simplify ((y/(yy*(-2/9))y)/(yy(-9)))(2/33) assuming y is positive. y(166/297) Simplify ((ff/(f*2/f)f)/ff/(ff*(1/7)ff))(-50) assuming f is positive. f(400/7) Simplify (j/(j(1/3)/j))(1/47)(j*(-2/5)jj)16 assuming j is positive. j(18073/705) Simplify (cc(2/3))(7/4)/(c(1/4))(5/8) assuming c is positive. c(265/96) Simplify s3/(s/(ss(-2)s))(s1)(-12/5) assuming s is positive. s(-2/5) Simplify a(-2/9)/aaa(1/14)aa0a(-5)/a assuming a is positive. a(-649/126) Simplify yy(-2/41)yy(4/9) assuming y is positive. y(884/369) Simplify (j(-8))(5/4) assuming j is positive. j(-10) Simplify b/b(-3/23)(b(-13)/b)/b assuming b is positive. b(-319/23) Simplify v(-9)/v(-2/19)((v(-2)v)/v)(-4/3) assuming v is positive. v(-355/57) Simplify (i*1i)*17(ii/i(-8))/i(-3/2) assuming i is positive. i(91/2) Simplify s20/ss/s*(-22)s assuming s is positive. s*43 Simplify (qqq/((qq*10q)/q)qq)(-9/4) assuming q is positive. q(27/2) Simplify (o*(-2/3)oo/(o2o)o)10 assuming o is positive. o(-20/3) Simplify q(-2)/(q(1/4)/q)(q(qq*(-1/9))/q)/(q/(qq*(-2/19)q)) assuming q is positive. q*(365/684) Simplify (n/(n(nn((n*(-2/91)n)/n)/nnn)/n)nn)/(n/n(19/3)) assuming n is positive. n(1462/273) Simplify (r4/(r(-2/5)/r))/(r*1r(4/9)) assuming r is positive. r(178/45) Simplify (((t*(-2/3)t)/t)50)34 assuming t is positive. t*(-3400/3) Simplify ((vv*3vv)49)(2/77) assuming v is positive. v(84/11) Simplify (k(1/2)/k(-4))(-5/7) assuming k is positive. k(-45/14) Simplify d(-8)/d(8/9) assuming d is positive. d(-80/9) Simplify r(1/4)/r(4/11) assuming r is positive. r(-5/44) Simplify ((k0/kkkk)(2/15))(4/11) assuming k is positive. k*(16/165) Simplify ((n/(nn/n*(-6)))/nnn(-2/31))(4/3) assuming n is positive. n(-292/31) Simplify j/j(1/8)j	{ "pile_set_name": "DM Mathematics" }
3 - 7624b3 - 320b*3. -9b*3 Collect the terms in 6036020z*3 - 3941462z*3 + 10391893z*3 + 749316z*3. 13235767z*3 Collect the terms in -3 - 3068h - 2945h + 3 + 5973h. -40h Collect the terms in -1284205n*2 + 2568358n*2 - 1284141n*2. 12n*2 Collect the terms in 381 - 9236a - 179 - 202. -9236a Collect the terms in -2 + 20 + 27w + 9w - 14w + 10w. 32w + 18 Collect the terms in 9 + 5 + 63094i3 - 63060i*3 - 17. 34i*3 - 3 Collect the terms in -1664127 + 231t*3 + 1664127. 231t*3 Collect the terms in -501n + 299 - 2n3 - 166 - 135. -2n*3 - 501n - 2 Collect the terms in -818f3 + 1444f*3 - 1052f*3. -426f*3 Collect the terms in -3t*2 + 3t*2 - 8140 - 1608t*3 + 7935. -1608t*3 - 205 Collect the terms in -70 + 2678l*3 + 70 + 1117l*3. 3795l*3 Collect the terms in 18 + 28 - 46 + 1103q + 1840q. 2943q Collect the terms in 737d2 + 514d*3 - 244d*2 - 248d*2 + 1175d*3 - 245d*2. 1689d*3 Collect the terms in -9 + 7c2 + c2 - c2 + c2 + 238. 8c2 + 229 Collect the terms in -583g*2 - 595g*2 + 318g*3 + 1178g*2 - 1823g*3. -1505g*3 Collect the terms in 116n + 2 - 70n - 44n - 16n2. -16n*2 + 2n + 2 Collect the terms in 6 - 174435996s - 23s*3 + 174435996s. -23s3 + 6 Collect the terms in -3220o - 3388o + 9909o - 3412o. -111o Collect the terms in 3803w2 - 5w - 2233w2 + 5w. 1570w2 Collect the terms in 86b + 342b3 - 93b - 476b3 - 3b*2 - 589b*3. -723b*3 - 3b*2 - 7b Collect the terms in -38938810v2 + 19467598v*2 + 19471214v*2. 2v*2 Collect the terms in -25s - 22061s2 - 95s + 21998s2. -63s*2 - 120s Collect the terms in -1268g3 + 2g - 2762g3 + 3g. -4030g3 + 5g Collect the terms in -2330 + 536 - 2u + 925 + 869. -2u Collect the terms in -3026638373591 + 3026638373591 + 102n2. 102n*2 Collect the terms in 2314282670n*2 - 2314282554n*2 - 1 + 1. 116n*2 Collect the terms in -307 + 488 - 181 + 33975g. 33975g Collect the terms in 6249w*2 - 2733 - 2751 + 5484 - 6294w*2. -45w*2 Collect the terms in -626h*2 + 1066h*2 - 13h*3 - 440h*2 + 5h*3. -8h*3 Collect the terms in -3r*2 - 3887 + 0r2 - 2365 + r2. -2r2 - 6252 Collect the terms in -m3 + 27m + 14m + 2m*3 - 46m + 46m + 0m*3 + 0m3. m3 + 41m Collect the terms in -24 + 97 - 1737r - 1738r - 1733r + 5206r. -2r + 73 Collect the terms in -35319x2 + 59047x*2 - 23729x2. -x2 Collect the terms in -406g3 - 117g*3 - 294g*3 + 1110g*3. 293g*3 Collect the terms in -27508 - 27c*2 - 2764 + c - 7246. -27c*2 + c - 37518 Collect the terms in -671149w*2 - 206434w*2 + 86529w*2. -791054w*2 Collect the terms in -5925g*3 - 4164g*3 - 209g*3 + 3226g*3 - 805g*3. -7877g*3 Collect the terms in 7761b*3 + 59879b*3 + 24781b*3 + 22806b*3. 115227b*3 Collect the terms in -63197x - 63352x + 126665x. 116x Collect the terms in -410145574y*3 + 410145572y*3 - 6y*2 + 6y*2. -2y*3 Collect the terms in -260 - 17g - 26g + 71g - 18g. 10g - 260 Collect the terms in 1898h - 485h - 52h + 1355h + 2780h. 5496h Collect the terms in 42033v3 + 42352v*3 - 84196v*3. 189v*3 Collect the terms in 60178z*3 - 30023z*3 - 30045z*3. 110z*3 Collect the terms in 324 - 100 - 74 + 179j - 77 - 73. 179j Collect the terms in -62m + 3m2 - 3m*2 - 104m + m*3 - 98m + 264m. m3 Collect the terms in 363958i - 925320i - 431044i. -992406i Collect the terms in -38089x + 76133x - 40x*2 - 38044x. -40x2 Collect the terms in -18i*3 + 14i*3 + 5i3 - i2 - 29486i. i3 - i2 - 29486i Collect the terms in -27b2 + 54135321b - 54135321b. -27b*2 Collect the terms in -125h + 47h - 2163h - 3004h - 3469h. -8714h Collect the terms in 119749g*2 + 5 + 5 - 7254g*2 - 12. 112495g*2 - 2 Collect the terms in -23s*2 + 23s*2 + 71763s*3. 71763s*3 Collect the terms in -251t - 438t - 390t + 1236t - 6. 157t - 6 Collect the terms in -19604i2 + 9773i*2 - 59i*3 + 9831i*2. -59i*3 Collect the terms in -5c - 3c + 8403 - 8646 - 14515. -8c - 14758 Collect the terms in 555464h - 118h*3 - 1110916h + 555451h + 3 - 3. -118h*3 - h Collect the terms in 5l*2 + 5l - 16l - 1737l*3 + 11l - 11 + 9. -1737l3 + 5l*2 - 2 Collect the terms in -482451485 + 482451485 - 18193i*2. -18193i*2 Collect the terms in 41198r*2 + 184r + 32r - 216r. 41198r2 Collect the terms in -59j*2 - 89j + 12j3 + 89j + 43j3 - 12j*2. 55j*3 - 71j*2 Collect the terms in 0t - 338t2 - 1557 + 776 + 780 + 0t. -338t2 - 1 Collect the terms in 1599w + 1600w + 1623w + 28w2 - 4822w. 28w2 Collect the terms in 51 - 1361u - 7 + 55 + 4658u. 3297u + 99 Collect the terms in -16510 + 8325 - p - 100p2 + 8185. -100p*2 - p Collect the terms in -308a*3 + 310a*3 + 149a*2 - 5a + 2a. 2a*3 + 149a*2 - 3a Collect the terms in 11h - 133h + 36h - 104h + 53h - 111h. -248h Collect the terms in 216918z*3 - 43384z*3 - 43379z*3 - 43420z*3 - 43385z*3 - 43390z*3. -40z*3 Collect the terms in -2g*2 + 2g*2 + 152g*3 + 125g*3 - 159g*3. 118g*3 Collect the terms in 6r*3 - 55126r*2 - 20583r*2 + 2 - 4r*3. 2r*3 - 75709r*2 + 2 Collect the terms in -12582 - 48i + 19i + 28i. -i - 12582 Collect the terms in 60085u + 60141u - 120226u - 34u*3. -34u*3 Collect the terms in -28q - 300540127q2 + 150270060q*2 + 150270066q2. -q2 - 28q Collect the terms in -63p + 146p2 - 143p*2 - 56p + 164p - 60p. 3p2 - 15p Collect the terms in 147s + 145s - 646s + 142s + 75s + 145s. 8s Collect the terms in -276n + 1350n - 276n - 271n - 263n - 268n. -4n Collect the terms in -2083370x + 4166718x - 2083349x. -x Collect the terms in 193g - 7g3 + 251g - 5g3 - 2 - 444g - 15g3. -27g*3 - 2 Collect the terms in -339701u*3 + 602783u*3 + 362296u*3. 625378u*3 Collect the terms in -43504y + 5 + 0 + 21746y + 21745y - 5. -13y Collect the terms in -23 - 20 - 39 - 18 - 4h + 104. -4h + 4 Collect the terms in 0 - 37p*3 + 18p*3 + 2 - 2 + 5p*3. -14p*3 Collect the terms in 64367q + 14 - 14 - 32182q - 32188q. -3q Collect the terms in 35 - 73 + 2w*2 + 33 - 4w*2. -2w*2 - 5 Collect the terms in -47c*2 + 230c*2 - 43c*2 + 2c - 92c2 - 2c - 44c2. 4c*2 Collect the terms in 141545499y - 283090990y + 141545489y. -2y Collect the terms in -9404l*2 + 276l*2 + 1004l*2 - 1339l*2. -9463l*2 Collect the terms in 42w*3 + 10013w + 10013w + 10017w + 9999w + 10018w - 50060w. 42w*3 Collect the terms in -13n + 357684 + 12n - 357684 - 155n*2. -155n*2 - n Collect the terms in -5m*2 + 63m*2 + 65 - 65 - 6m*2 - 47m*2 - 6m2. -m2 Collect the terms in 4755 + 4610 + 4748 + 4776 - 18889 + 2k3 - 14k*3. -12k*3 Collect the terms in -84 - 148 + 69h*2 - 117 - 148 - 68h2. h2 - 497 Collect the terms in 16446812l2 + 16446807l*2 - 32893606l*2. 13l*2 Collect the terms in -736j*2 + 1468j*2 + 4868j*3 - 732j*2. 4868j*3 Collect the terms in -803708j*3 + 200983j*3 + 200916j*3 + 200982j*3 + 201024j*3. 197j*3 Collect the terms in -98286q*3 + 98254q*3 - 125q + 35q. -32q*3 - 90q Collect the terms in -98k + 47k - 10572k2 + 10561k*2 + 51k. -11k2 Collect the terms in -9l*2 - 1506696 - 1506738 + 3013434 + 13l*2. 4l*2 Collect the terms in 2708q - 1506q - 5q*3 + 8q*3 - 1387q. 3q3 - 185q Collect the terms in 48l2 + 224l + 2l3 - 19l*2 + 0l*3 - 11l - 27l2. 2l*3 + 2l*2 + 213l Collect the terms in -8 + 8 + 2970114z + 14z*2 - 2970114z + 0 - z3. -z3 + 14z2 Collect the terms in 178x + 305x - 21315 + 21313. 483x - 2 Collect the terms in -3 + 30047l - 2 - 3 + 8. 30047l Collect the terms in -8f + 9f - 846 - 1487 - 8971. f - 11304 Collect the terms in -2079 + 82m - 42m - 18m - 18m. 4m - 2079 Collect the terms in -4 - 508x + 5 - 2 + 693x. 185x - 1 Collect the terms in -43307a3 + 86557a*3 - 43160a*3. 90a*3 Collect the terms in -324z + 66z + 78z + 60z - 44z*2 + 65z + 59z. -44z*2 + 4z Collect the terms in -2189g*2 -	{ "pile_set_name": "DM Mathematics" }
d(x) be the second derivative of g(x). Is d(8) a prime number? False Let p be 5 - (11 + -7 - 2). Suppose -pi = -i - a - 4868, 0 = -3i + 2a + 7301. Is i a composite number? True Let q = 49558 + 16299. Is q prime? False Suppose 4v - 1465726 = 3d, -704v + 3d = -699v - 1832159. Is v a prime number? True Suppose -32 = -2o - o + 5k, 2k = 3o - 38. Let r(d) = -d*2 + 19d + 9. Is r(o) prime? True Let u = 468 - 463. Suppose 9m - 388 = um. Is m prime? True Let f(b) = 34998b + 7141. Is f(10) composite? True Let d(c) = c2 - 2c - 164. Let k be d(-12). Suppose 19208 = 5b + u, 5b - 7694 = 3b - ku. Is b composite? True Let h(w) = -w*3 + 10w*2 - 20. Let q = -30 + 46. Suppose -j + p - 4 = 6, -5p = j + q. Is h(j) prime? True Is 7/28 - (10801377/(-15))/((-32)/(-40)) composite? True Let m(c) = 3c2 + 38c - 6. Let z be m(-13). Let l(x) = 35x + 6. Is l(z) a composite number? False Let k(d) = d3 - 37d*2 + 127d - 3528. Is k(61) a prime number? True Let p(u) = -2457u - 2206. Is p(-55) a prime number? True Let d(y) = -47y - 2. Let b be d(-1). Let m(j) = -21j + 57j - 16 + 105j + b. Is m(4) prime? True Suppose 782873 - 3068957 = -12u. Is u prime? True Let v(q) = -11q3 - 11q*2 - 32q + 17. Is v(-8) a prime number? False Let i(y) = 5943y2 - 3y + 149. Is i(-7) composite? False Suppose -2o - 8o + 178870 = 0. Is o composite? True Suppose 19176 = 10q + 7q. Is (-1)/(-5) - (q/(-20))/3 composite? False Suppose -9d + 227 = -43. Suppose -89861 = -df + 7f. Is f composite? False Suppose -3j + 1 + 5 = 0. Let t(y) = 0y + 5y*2 - 2y - 32 - 2yj + 2y2. Is t(-13) a composite number? False Let v(l) = l2 + 4l - 1. Let t be v(-5). Suppose -a - 4921 = -3s, -3s - a = -ta - 4929. Suppose 16z = 5z + s. Is z a prime number? True Let d(g) = 10g - 167. Let r be d(17). Is ((-70210)/8 - -2)/(r/(-4)) prime? True Suppose 18r - 139 = 19r. Let g = 2990 + r. Is g a prime number? True Let j(q) = 152q*2 + 13q - 4. Let t be j(-4). Suppose 7i = i - t. Let a = 89 - i. Is a a prime number? False Suppose -14y = -4y. Suppose 12b - 3b - 36999 = y. Is b a prime number? True Is -9 + (56381 - 104/8) a prime number? True Let t(n) = -n3 + 90n*2 - 2n - 146. Is t(21) composite? False Let a = -479 - -484. Let k(w) = -w + 2. Let i be k(-2). Suppose an = im + 2439, -5n + 819 = -5m - 1621. Is n composite? False Suppose 371m - 178m - 28641007 = 0. Is m composite? False Let b(i) = 15i2 - 21i + 83. Is b(19) a composite number? False Let s = 57 + -53. Suppose 12 = sv - v. Suppose 3h = -vq + 313, 0 = 2h - 4q - 77 - 125. Is h prime? True Let r(s) = 4s*3 + 13s*2 + 7s + 5. Let h(i) = 3i3 + 13i*2 + 6i + 4. Let u(b) = 5h(b) - 4r(b). Let f be u(12). Let l = f - -319. Is l prime? True Let o(z) = 2z - 11. Let q be o(8). Suppose -q = -49d + 48d. Suppose -890 = -5c + da, 3c - 378 = 2a + 155. Is c composite? True Suppose 0 = 4a - r - 14, 0 = -2a + 6r - 3r + 2. Suppose -av = v - 70595. Is v a composite number? True Let v(b) = -b*3 - 7b*2 - b - 4. Let y be (-6)/4154/33. Let l be v(y). Suppose t + 283 = lt + 5o, -733 = -5t - 4o. Is t a composite number? False Suppose 0 = 40x - 35x + 665. Is (-732488)/x + 3/(-7) + 0 a prime number? True Let n(q) = 9q3 + 3q*2 - 4q + 13. Let a be 30/(3 + -6)5/(-2). Let z be a/5(2 + -1). Is n(z) a composite number? False Let k(v) = -v*3 - 19v*2 + 19v + 408. Is k(-49) a composite number? True Let n(g) = 436g2 + 11g + 1528. Is n(-30) a composite number? True Let f(s) be the second derivative of 25s4/3 + 14s*3/3 - 69s*2/2 - 43s - 1. Is f(-14) composite? False Let f(p) = -5p2 - 7p + 10. Suppose -5a + 3i - i = 34, -2a - 16 = -2i. Let n be f(a). Is (-133024)/n + (-2)/8 composite? False Let a(w) = 40246w + 1449. Is a(2) composite? True Let s(b) = -2b*2 - 28b + 146. Let f be s(-18). Suppose 3i + fi = 7495. Is i composite? False Let x be (2 + -4)/((-4)/19814). Is 5 + x + -6 + 7 a prime number? False Let g be 1 - (-20)/(-6 - -11). Let b(d) = 3d3 + 2d*2 + 6d - 6. Is b(g) a composite number? False Suppose -m - 433w + 432w = -6807, -4m + w = -27198. Is m composite? True Suppose -445523 = -80g - 6925 + 139722. Is g a prime number? True Let x = 5428 + -1786. Is x - ((-36)/32 - (-6)/48) a composite number? False Let r be 50503 - (-3 + (7 - 7)). Suppose 36s + 8422 = r. Is s composite? True Suppose -877n - 30159 = -904n. Is n a composite number? False Suppose 262n - 64977 = 257n - 2x, -7n = 3x - 90967. Is n prime? False Let x = -493 + 498. Suppose xd - 4d = 557. Is d a composite number? False Suppose 15 = 3b, 4b - 5167 = 67n - 68n. Is n composite? False Let f be (14/(-21))/(20/(-6))15. Suppose 0 = fz + 5i - 1363, i - 401 - 52 = -z. Is z a prime number? False Let t = 1012 + -1008. Is 23358/4 + (-6 - -4)/t composite? False Suppose -2z + l + 64798 = 0, -l + 244443 = 5z + 82462. Is z a composite number? True Let j(r) be the third derivative of 115/6r*3 + 0r - 1/24r4 - 1/30r*5 - 9r*2 + 0. Is j(0) prime? False Let p be 7 + -7 - 15/(-1). Suppose 156y - 155y = p. Let b(r) = r2 - 4r - 16. Is b(y) composite? False Let c = 5734290 - 3973373. Is c a prime number? True Suppose -13o = -5b - 12o + 12, -3b = -o - 6. Suppose -7p + 4p - 5435 = -4k, 0 = -k - bp + 1370. Is k prime? True Suppose -3l - 14h = -19h - 223, 0 = -2l + 2h + 150. Suppose -51i = -li + 385525. Is i a composite number? True Suppose s = 1 - 0. Let f(j) = 3j - 1. Let o be f(s). Suppose 2r - 2p = 754, -r + 393 = p + op. Is r a prime number? False Let k(f) = -f3 - 9f2 + 71. Let l be k(-7). Let w(q) = q2. Let o be w(-2). Let m = o - l. Is m prime? True Let z be -53/((-12)/(-8)). Let w be 5 + 8/z-5. Is -1 + 1 - (-8 + w) - -708 a composite number? True Let r = -222298 + 488721. Is r composite? True Is (-956694 - 1)(134 - 135) prime? False Let p = 70 + -36. Let v(d) = -42 - p + 53 + 429d. Is v(4) a composite number? False Suppose -3806 = 106c - 107c + q, 4c = -q + 15264. Is c prime? False Let o(x) be the second derivative of x5/10 + 19x*4/4 - 16x*3/3 + 18x*2 - 55x. Is o(-29) a prime number? False Suppose g + 2q - 236491 - 278778 = 0, 0 = 4g + 3q - 2061101. Is g a prime number? True Suppose -4g = -l - 147233, 36806 = -8g + 9g - l. Suppose 20j - 1051 - g = 0. Is j prime? False Is (-57748 - 3)2(-4)/8 a composite number? False Suppose 2q + 13 = 3r, 2r - 9 = 3q + 8. Let v(j) = 8j*2 - 4j - 9. Let b be v(q). Let k = b - 80. Is k a prime number? True Let m = 302569 - 144984. Is m composite? True Suppose 3b - 9 = 5b - 3z, -5b = 2z - 6. Suppose -41d + 51d = b. Suppose -2h + 119 = -w, 4h + 9w - 13w - 228 = d. Is h a prime number? False Let k = -107485 - -304567. Suppose 0 = 43i + 8699 - k. Is i composite? True Let d(n) = 2n - 2573. Let r(a) = -3a + 5147. Let z(u) = -5d(u) - 2r(u). Let b be z(0). Suppose -b + 207 = -4m - 4f, -4m = -f - 2344. Is m prime? True Suppose -24646113 + 6391283 = -110n. Is n prime? False Suppose 0 = 5x + 3u - 7493 - 3413, -x + 2177 = 2u. Let a(k) = -k2 - 6k + 16. Let y be a(-8). Suppose 7j - x - 3032 = y. Is j a composite number? True Is 29473/(-3)(2 - (18 + -17 - -4)) composite? False Let t = 134 + -244. Let u be 11/(t/(-48)) + 2/10. Suppose -4h = h + u, 4s + 3h = 11753. Is s composite? False Let k(h) = 111h*2 - 2591h + 111. Is k(-55) prime? True Let x(b) = -2b2 + 25b - 25. Let r be x(10). Let f = -12 + r. Suppose -10t = -ft + 255. Is t a composite number? True Suppose 4z - 12 = -2z. Let h(x) = -2 + 2x + 2x + 378x2 - 89x*2 + 236x*z. Is h(1) prime? False Let a(h) = -14h*2 - 4h - 17. Let s(p) = -p*3 - 12p*2 - 5p - 28. Let r(l) = -3a(l) + 2s(l). Let d = -13 + 21. Is r(d) a composite number? False Let r be (-2)/(-7)56/(56/7). Suppose 5b - w - 900 = 3b, -1351 = -3b + rw. Is b a composite number? False Let z(d) = -13858d + 177. Is z(-4) prime? True Suppose -4i + v + 89644 = 0, 79i = 80i - 2v - 22411. Is i a composite number? True Let r(o) = -17o + 27. Let t be r(0). Suppose -th + 2933 = -26h. Is h a composite number? True Suppose 5v + 4f = -5, -6v = -2v + 2f - 2. Suppose 5q + 5n - 4410 = 0, q + vn = 4q - 2616. Is q comp	{ "pile_set_name": "DM Mathematics" }
s next: 2, -1, -2, -1, 2, 7, 14? 23 What comes next: 9, 17, 23, 27, 29? 29 What is next in -5, -4, -7, -20, -49, -100, -179? -292 What is the next term in -20, -27, -38, -53, -72, -95, -122? -153 What is next in -42, -36, -28, -18, -6? 8 What is next in 503, 1002, 1503, 2006, 2511? 3018 What is next in -69, -134, -219, -330, -473, -654, -879? -1154 What is the next term in 100, 71, -8, -161, -412? -785 What comes next: 571, 1131, 1685, 2233? 2775 What comes next: -84, -174, -268, -366, -468, -574, -684? -798 What is the next term in 62, 173, 348, 587? 890 What is next in 1145, 1168, 1191, 1214? 1237 What comes next: 23, 57, 127, 251, 447, 733, 1127, 1647? 2311 What comes next: 12, 34, 56, 78, 100? 122 What comes next: -29, -69, -121, -191, -285, -409? -569 What is next in 62, 206, 446, 782, 1214? 1742 What is next in -247, -476, -693, -892, -1067, -1212? -1321 What is next in -715, -691, -629, -511, -319? -35 What comes next: -4, -5, -2, 5, 16, 31? 50 What is next in -47, -46, -45? -44 What is next in -8, -1, 6? 13 What comes next: 5676, 11350, 17024, 22698, 28372, 34046? 39720 What is the next term in -155, -288, -411, -518, -603, -660, -683, -666? -603 What is the next term in 1185, 1186, 1189, 1194? 1201 What is next in 5, 58, 115, 176, 241? 310 What comes next: 239, 314, 389? 464 What is the next term in -8, 4, 16? 28 What comes next: -4, -39, -98, -181, -288? -419 What is the next term in 348, 690, 1032, 1374? 1716 What is the next term in 33, 53, 87, 135, 197, 273? 363 What comes next: -651, -1308, -1967, -2628, -3291, -3956, -4623? -5292 What comes next: 89, 95, 113, 149, 209? 299 What is next in 12, 9, 2, -9, -24, -43, -66? -93 What is the next term in -6, 4, 28, 72, 142, 244, 384, 568? 802 What is the next term in -12651, -12648, -12645, -12642? -12639 What is the next term in -1304, -2608, -3912, -5216, -6520, -7824? -9128 What is the next term in 16, 43, 106, 223, 412, 691? 1078 What is next in -10636, -21271, -31906, -42541? -53176 What comes next: 37, 33, 29? 25 What is the next term in -17, -26, -43, -68, -101, -142, -191? -248 What is the next term in -106, -82, -54, -28, -10, -6, -22, -64? -138 What is the next term in -84, -90, -98, -108, -120? -134 What is the next term in -24, -45, -64, -81, -96? -109 What is next in -512, -510, -508? -506 What is next in -224, -213, -190, -149, -84, 11, 142? 315 What is the next term in 392, 793, 1194? 1595 What comes next: -18, -38, -58? -78 What comes next: 87, 53, -1, -75, -169? -283 What is the next term in 53, 213, 481, 857, 1341? 1933 What is the next term in 282, 232, 196, 180, 190, 232, 312, 436? 610 What is the next term in 25, 19, 23, 43, 85? 155 What is next in 35, 76, 107, 122, 115? 80 What comes next: -1383, -2764, -4145, -5526? -6907 What is next in -25, -44, -67, -94, -125, -160? -199 What is the next term in 12, 47, 102, 171, 248? 327 What is next in 2, 25, 72, 149, 262, 417, 620? 877 What is the next term in -97, -187, -275, -361, -445? -527 What is the next term in 176, 700, 1574, 2798, 4372, 6296? 8570 What comes next: 2078, 2074, 2080, 2102, 2146? 2218 What is the next term in 151, 305, 459, 613? 767 What is next in -944, -958, -972, -986? -1000 What comes next: 245, 358, 471, 584, 697? 810 What is the next term in -55, -38, -19, 2, 25, 50, 77? 106 What comes next: -3, -14, -25? -36 What comes next: -416, -377, -338? -299 What comes next: -1432, -1437, -1444, -1453, -1464, -1477? -1492 What comes next: 0, -19, -74, -183, -364? -635 What is next in -20, -106, -250, -452, -712, -1030? -1406 What is the next term in 699, 681, 645, 585, 495, 369, 201, -15? -285 What is the next term in 29, 34, 41, 50, 61? 74 What is next in 6950, 13899, 20848? 27797 What is next in 473, 931, 1391, 1853, 2317, 2783? 3251 What comes next: -767, -769, -771, -773? -775 What is next in 83, 140, 235, 374, 563, 808, 1115, 1490? 1939 What comes next: 117, 215, 313, 411? 509 What is the next term in 4691, 4686, 4667, 4628, 4563, 4466? 4331 What is next in -112, -222, -332? -442 What is the next term in -120, -234, -360, -504, -672? -870 What is the next term in -8, -31, -68, -119, -184? -263 What is next in -4126, -8251, -12376? -16501 What is next in -40, -89, -138, -187, -236, -285? -334 What comes next: -92, -172, -274, -410, -592, -832? -1142 What is next in -8, -12, -16, -20? -24 What is the next term in 334, 671, 1008, 1345, 1682, 2019? 2356 What is next in 22, 37, 60, 97, 154, 237? 352 What comes next: -47, -107, -189, -305, -467, -687? -977 What comes next: 4, 8, 26, 64, 128, 224, 358, 536? 764 What is next in -3161, -6315, -9469? -12623 What comes next: -162, -161, -160? -159 What is the next term in 23, 60, 167, 380, 735? 1268 What is the next term in -147, -270, -395, -522, -651, -782? -915 What comes next: -3163, -3164, -3165, -3166, -3167, -3168? -3169 What comes next: 1296, 1297, 1298, 1299? 1300 What is next in 322, 319, 314, 307, 298, 287, 274? 259 What comes next: -15, -91, -169, -249? -331 What is next in 639, 637, 633, 627, 619, 609? 597 What is next in 136, 628, 1442, 2572, 4012, 5756? 7798 What comes next: -222, -394, -576, -774, -994, -1242, -1524, -1846? -2214 What is the next term in 231, 468, 709, 954? 1203 What comes next: 43, 23, -1, -29, -61? -97 What comes next: -120, -240, -360? -480 What is the next term in -288, -587, -888, -1191, -1496? -1803 What is the next term in 44, 69, 94? 119 What is next in 14, 10, 2, -10? -26 What is next in 135, 257, 379, 501, 623, 745? 867 What comes next: 4, 5, -4, -29, -76, -151? -260 What is next in -120, -133, -168, -237, -352, -525, -768, -1093? -1512 What comes next: 526, 1036, 1546, 2056, 2566? 3076 What is the next term in -2426, -2429, -2442, -2471, -2522? -2601 What is next in 182, 204, 226, 248? 270 What is next in -568, -585, -604, -625, -648? -673 What is next in 1170, 1169, 1168, 1167, 1166? 1165 What comes next: 22, 42, 54, 52, 30, -18, -98? -216 What is next in -427, -467, -507, -547, -587? -627 What comes next: -26, -35, -42, -47, -50, -51, -50? -47 What comes next: -20, -56, -140, -296, -548, -920, -1436? -2120 What is next in 3039, 6075, 9111, 12147, 15183? 18219 What is the next term in 3079, 3071, 3051, 3013, 2951, 2859, 2731, 2561? 2343 What is the next term in -38, -71, -104, -137, -170? -203 What comes next: -419, -392, -363, -332, -299, -264? -227 What is next in -140, -256, -372, -488, -604? -720 What comes next: -74, -51, -12, 43, 114, 201? 304 What is the next term in 3, 18, 53, 108? 183 What is the next term in 9, 19, 43, 87, 157, 259, 399, 583? 817 What is next in -216, -211, -196, -165, -112, -31? 84 What is the next term in -304, -305, -304, -301, -296, -289? -280 What comes next: -26, -70, -140, -248, -406, -626, -920? -1300 What is the next term in -171, -345, -523, -705, -891, -1081, -1275? -1473 What is the next term in 14, 9, 2, -7, -18? -31 What is the next term in 65, 167, 269, 371, 473, 575? 677 What is the next term in -101, -111, -135, -179, -249? -351 What is the next term in -1225, -2450, -3689, -4948, -6233, -7550, -8905, -10304? -11753 What is the next term in 308, 353, 398, 443? 488 What is next in 17247, 17248, 17249, 17250, 17251? 17252 What is the next term in 42, 50, 54, 48, 26, -18, -90? -196 What comes next: 34, 33, 32? 31 What is the next term in -1, -15, -59, -151, -309? -551 What comes next: -101, -188, -313, -470, -653, -856, -1073? -1298 What is the next term in 21, 67, 185, 411, 781? 1331 What is the next term in -16, -20, -24, -28, -32? -36 What is the next term in 12, 26, 46, 72, 104? 142 What comes next: -20464, -40927, -61390? -81853 What comes next: -219, -428, -637, -846? -1055 What comes next: -42, -81, -114, -141, -162, -177, -186? -189 What is next in -17, -11, 9, 49, 115, 213, 349, 529? 759 What is next in -28, -34, -44, -58, -76? -98 What comes next: -153, -195, -233, -267, -297, -323, -345? -363 What is the next term in -161, -154, -149, -146, -145, -146? -149 What comes next: 8934, 8930, 8924, 8916, 8906? 8894 What comes next: 213, 221, 229, 237, 245, 253? 261 What comes next: 299, 296, 291, 284, 275, 264, 251? 236 What comes next: 73, 118, 163, 208, 253? 298 What comes next: -803, -1630, -2467, -3320, -4195, -5098, -6035, -7012? -8035 What comes next: -196, -185,	{ "pile_set_name": "DM Mathematics" }
4z + 6v = 2v + 36. Sort -38, z, -4 in increasing order. -38, -4, z Let a = 1 + 0. Let n = -8 + 4.2. Let u = 1.2 - n. Sort u, a, -0.5 in increasing order. -0.5, a, u Let i = 9 - 12. Let b be (-4)/6(-9)/i. Put b, 5, -7 in increasing order. -7, b, 5 Let r = -19 + 19.16. Let v = r - -0.14. Let o = -0.3 - -0.4. Sort -0.1, v, o in decreasing order. v, o, -0.1 Suppose -2x = -3x + 4. Suppose 5q - 26 = u, q + 2u - u = 4. Suppose -qr + f + 8 = -12, 3r - 35 = -xf. Put -5, r, -2 in descending order. r, -2, -5 Let g = 86.4 - 86. Sort -2, 5, g in decreasing order. 5, g, -2 Let h = -4.98 - 0.02. Let d(c) be the second derivative of c3/2 + c. Let r be d(-1). Sort h, -0.3, r in decreasing order. -0.3, r, h Let p be (3/(-32))/(5/(-20)). Sort p, -0.2, -1/6 in decreasing order. p, -1/6, -0.2 Let q be 4 - 1(-3 + 2). Suppose 8n = 4n - 12. Sort -4, q, n in ascending order. -4, n, q Let o be -3 + (-5)/((-10)/18). Let g be (o/3)/((-2)/4). Let w = -7 + 10. Put w, g, -5 in decreasing order. w, g, -5 Let p = 10 + -4. Suppose -5k = -2k - p. Put -1, k, 3 in descending order. 3, k, -1 Let v = 65 - 60. Sort -0.3, -2, 1/5, v in descending order. v, 1/5, -0.3, -2 Let g = -3 + -7. Let h = 0 - g. Let r be (-24)/(-10) + (-4)/h. Sort r, 0.3, -1 in descending order. r, 0.3, -1 Let u = -61 - -60.9. Sort -2/3, u, 3/5. -2/3, u, 3/5 Let i be 2/(-22)(-56)/16. Let k = -2/11 - i. Put k, 1, -0.05 in descending order. 1, -0.05, k Let c(r) = -r2 - 5r - 2. Let o be c(-4). Suppose 2w + d + 2 = -0, -4d = 4w + 8. Suppose 0 = -ws + os - 10. Sort s, -3, -1 in decreasing order. s, -1, -3 Let x = -3 - 2. Let h = -2 - x. Let d = 44 + -40. Put d, h, 2 in descending order. d, h, 2 Let b(m) = 4m3 - m2. Suppose -v - 4v = 0. Suppose 0a - 3a + 14 = -n, v = 5n - a. Let s be b(n). Sort s, 2, -2 in descending order. s, 2, -2 Let g be ((-30)/12)/((-1)/6). Suppose -4o - 3u - 3 = -g, -o - u = -4. Put o, -2, 2 in decreasing order. 2, o, -2 Suppose 3p - p = 4. Suppose o + 0o = -4m + 14, pm = 8. Put 4, 5, o in increasing order. o, 4, 5 Let l be 1(3 + 3)/2. Let z(k) = k2 + 2k + 1. Let q be z(-3). Put l, -4, q in decreasing order. q, l, -4 Let f be (6/5)/((-3)/(-10)). Suppose 0 = -22s - 3 + 25. Put s, -1, f in increasing order. -1, s, f Let n be (-17 - -21)/(28/(-58)). Let t = n + 1116/133. Sort t, -3/4, 4 in decreasing order. 4, t, -3/4 Let d = 23 + -49. Let b be (-4)/d + (2 - 2). Let z = 0.5 + -0.4. Put b, 0.3, z in increasing order. z, b, 0.3 Suppose 27 = -6o - 3. Put 4, 5, o in increasing order. o, 4, 5 Let g be (6/(-4))/(39/52). Sort -1, g, 5, -3. -3, g, -1, 5 Let b be ((-20)/2)/(4/(-8)). Suppose -3x + 2d - 10 = -2x, 4d - b = 0. Suppose x = -3a + 5 + 1. Put 5, -4, a in descending order. 5, a, -4 Let l = -5.3 - -4.9. Put 1, l, -2/15 in descending order. 1, -2/15, l Let g be 1/1(2 - -5). Let u = -2 + g. Let d(w) = -5w2 - 2w - 1. Let l be d(-1). Put 1, u, l in decreasing order. u, 1, l Let a be ((-4)/6)/((-2)/(-4)). Let j be 20/40 + 2/(-12). Sort j, -4, a in ascending order. -4, a, j Let o = 22590 - 994029/44. Let b = -3/44 - o. Sort b, 4, 0 in decreasing order. 4, b, 0 Let g be 4/(-6) + 8/3. Let h(q) be the second derivative of -q5/20 + q4/6 - q3/2 + q2/2 + q. Let a be h(2). Sort a, g, 1 in descending order. g, 1, a Suppose 10 = -o + 6. Let f(w) = -w*3 + 5w*2 - w + 7. Let d be f(5). Put o, d, 4 in ascending order. o, d, 4 Suppose 0 = 2k + k - 2a - 6, 0 = 3k + 5a + 15. Put -1, -3, -5, k in increasing order. -5, -3, -1, k Suppose 0i + 18 = 4z + 2i, -z + 3i - 13 = 0. Suppose 0 = 5d - 5, 2f - 7 = -d - z. Let c be (-6 - 0)/(f-1). Put 2, -1, c in decreasing order. c, 2, -1 Suppose 7b = 9b - 30. Let i = -17 + b. Sort i, -0.4, 2 in ascending order. i, -0.4, 2 Let z = -0.2 + 0.1. Let x = -3 + 6. Let r be -4(1 - 2)1/22. Sort x, r, z in increasing order. z, r, x Let w = -0.3 - -0.8. Let r be (4/10)/((-3)/(-15)). Put r, -4, w in descending order. r, w, -4 Suppose 12d = 18d - 24. Put d, 3, -17 in decreasing order. d, 3, -17 Let t = -3 - -5. Put 4, 1, t in ascending order. 1, t, 4 Suppose -3x - x = -4. Let d be x/((-2)/(-2) + -2). Let w be 2 - 3 - (-1 + -1). Put w, d, 4 in increasing order. d, w, 4 Suppose -9i + 4i + 10 = 0. Suppose w = 2r + iw + 10, w = -4. Sort 0, 10, r. r, 0, 10 Suppose -7v + 108 = 5v. Put v, -3, 3, 0 in descending order. v, 3, 0, -3 Let d(y) = 2y + 43. Let x be d(-21). Sort 2, x, -3 in ascending order. -3, x, 2 Let u be ((-7)/105)/((-2)/12). Sort -1.1, -2, u in increasing order. -2, -1.1, u Suppose 15n = 17n - 4. Put -2, n, -1 in descending order. n, -1, -2 Let z = -4.81 - 0.19. Sort z, -4, -2/5. z, -4, -2/5 Let s = 1 + 4. Put -0.4, s, -0.5 in descending order. s, -0.4, -0.5 Suppose -y = -2y + 3. Suppose -7o + 4g = -yo, -4 = 5o - 4g. Put -2, o, 0 in decreasing order. 0, -2, o Let t = -0.01 - -0.06. Let n = -0.15 + t. Suppose 4k - 14 = 6. Put n, 1, k in decreasing order. k, 1, n Suppose -6 - 19 = 5j. Put 3, -3, j in ascending order. j, -3, 3 Let w be ((-1)/(-3))/((-13)/(-117)). Sort w, 0.5, 4 in increasing order. 0.5, w, 4 Let b = 11 + -11.2. Let j = b - -0.1. Put 0.4, j, 0 in increasing order. j, 0, 0.4 Suppose 0 = 5c - 0c - 20. Suppose -3g = -5k - 25, k + 4g + 1 = -4. Sort c, k, -4 in decreasing order. c, -4, k Let h = -8.8 - -9. Let m = 3.2 - 1.2. Sort -1, m, h. -1, h, m Let s = 0.3 - 0. Suppose x - 11 = -v + 6v, 4v - 8 = 5x. Let u = 4 + x. Put 1, u, s in increasing order. u, s, 1 Let n = 8737/56 + -156. Let z = -23/280 - n. Let g be (-15)/27 + 3 - 2. Put z, -1/6, g in decreasing order. g, z, -1/6 Let i be 6 + -11 - (-4)/2. Put 0, 1, i in decreasing order. 1, 0, i Let n be 6 - 2/(0 - -2). Let z(t) = t*3 + 3t*2 - 5t. Let g be z(-4). Let h(y) = -y*2 + 5y - 2. Let b be h(g). Sort b, n, -4 in descending order. n, b, -4 Let w = 13 - 9. Put w, 1, 3 in descending order. w, 3, 1 Suppose 0 = 5f - 0f + 10. Sort 5, 3, f in decreasing order. 5, 3, f Let m(t) = t*3 - t - 1. Let o be m(2). Suppose 1 = -j - 4. Sort o, 0, j in descending order. o, 0, j Let p be (-12/4)/(24/(-16)). Let y = -0.4 + 0.5. Put -3, p, y in decreasing order. p, y, -3 Suppose 3i = -4c + 25 + 7, 0 = -i - c + 9. Let f = 5 + -2. Suppose -5r = -fr - 4. Put i, -5, r in ascending order. -5, r, i Let b = -0.14 - -1.14. Put -0.1, 3, b in ascending order. -0.1, b, 3 Suppose -2z + f = -5, -5z + 4f - 6f = -35. Let p = -1 - -3. Sort p, -12, z. -12, p, z Let m = -1.5 - -1. Let a = -20 - -20.2. Sort -0.1, m, a. m, -0.1, a Let w = -18 + 14. Let j be 5 + w - (4 - 1). Put j, 3, 2 in descending order. 3, 2, j Suppose 2t = 5t + 3g - 6, 22 = -t + 5g. Let x be 1 - (0/t)/(-2). Sort x, 0, 0.4. 0, 0.4, x Let j(x) = -x*3 - 5x*2 + 5x - 2. Let t be j(-6). Let n be (0 - 8)/(-5 + 3). Suppose -9 = ns - 1. Sort t, s, -4 in decreasing order. t, s, -4 Suppose o + 3y - 8 = 5o, -o - 13 = 2y. Let d(x) = -x*3 - 3x*2 + x + 3. Let z be d(-3). Sort 5, z, o in decreasing order. 5, z, o Let f be 1 + (-4)/(-22) + -1. Let l be (-14)/(-44) - (16 - 2848/176). Sort f, l, 5 in decreasing order. 5, l, f Let a be (46/(-42) - -1)-3. Let q(h) = -h*2 - 6h - 7. Let t be q(-5). Put -1/3, t, a in increasing order. t, -1/3, a Let x = 52 + -50. Put 0.1, x, -0.4, -5 in increasing order. -5, -0.4, 0.1, x Let j = -5 + 3. Let d = 2.1 - 0.6. Let v = -2 + d. Sort v, -2/15, j in ascending order. j, v, -2/15 Let f = 3 + -2. Let z = f + 0. Put 3/2, z, -4 in ascending order. -4, z, 3/2 Let c be (5 + -7)(-5)/(-2). Sort c, 0, 3. c, 0, 3 Suppose -k = 5d - 5, 0 = 4k - 0 - 20. Suppose -n = -1 - 0. Suppose z + d = -n. Sort 3, -5, z in descending order. 3, z, -5 Suppose -4q = -5q + 3. Let a(s) = -s3 + 6s*2 - 4s - 6. Let p be a(5). Sort p, -2, q in decreasing order. q, p, -2 Suppose 13 = -20z - 7. Put 2, -4, z, -5 in ascending order. -5, -4, z, 2 Let w(k) = k2 - 2k - 1. Let l(z) = -2z2 + 3z + 2. Let i(f) = -6l(f) - 11w(f). Let s be i(-4). Put s, 2, 1 in decreasing order. 2, 1, s Let x be (-22/(-12))/2. Let w = -2 - 0. Sort x, -1/3, w in decreasing order. x, -1/3, w Let t(k) = 1 + k3 + 4k - 2k - k2 - 3k*2 + 0k. Let n be t(3). Sort n, -0.1, 0.4 in increasing order. n, -0.1, 0.4 Suppose -2p + 0p = -18. Let f = -9 + p. Suppose -5*w + 5 = -0,	{ "pile_set_name": "DM Mathematics" }
)(-3o - 4 + 4). 7o5 Expand (7 - 10 + 5 + 2d)(-3d*3 - 3d3 - d3) + (2d3 - d3 + 0d*3)(-4d + 4d + 2d). -12d*4 - 14d*3 Expand (-5z + z - 2z)(22 - 6 - 5)(-2z + 0z + 0z). 132z2 Expand -2i - 4 + 4 + (0i - i + 2i)(-5 + 1 + 2) - i + i - 2i + 41i + 19 - 19. 35i Expand (2 - 5 + 2 + (3 - 3 + 1)(-2 - 1 + 2) + 5 - 4 - 3)(-7d - 9d - 10d). 104d Expand (-2z + z - 2z)(2 + z - 2)(5 - 5 + 4) + 4 + z*2 - 4. -11z*2 Expand (2 + 0 - 1)(-43m2 - 39m*2 + 60m*2). -22m2 Expand -r5 - r5 + r5 + 0 - r*5 + 0 + (2r + 3r - 3r)(r4 + 3r*4 - 5r4) + r5 + 0r5 - 3r*5 - 2 + 2 - 4r*5. -10r*5 Expand (-4 - n + 5n - 3n)(2 + 1 - 2). n - 4 Expand h2 - h2 + h5 + (h2 - h4 - h2)(-2h - 11h + 3h) + (-1 - 1 + 0)(-2h*5 - 2h*4 + 2h*4) - 2h5 + h5 + 3h5. 17h*5 Expand 8h + h + 3h + (-6 + 0 + 4)(-h - 2h + h) - 3h + 3h - h + 2h - h + 0h. 16h Expand (3l3 - 2l*3 + 0l*3)(3 + 1 - 1)(-6 - 3l + 6). -9l4 Expand -j2 + 2j - 2j + 0 + j2 + 0 + (-3j*2 + 3j*2 + 2j*2)(-3 + 6 - 2) - 13j + 7j*2 + 13j. 9j2 Expand (-9 + 12c + 7 + 4)(-c2 - 3c*2 + 3c*2). -12c*3 - 2c*2 Expand (65 - 18 + 23)(0 + m + 0). 70m Expand (0u*2 - 4u*2 + 2u*2)(-11u3 + 22u*3 - 16u*3) + 0u*4 + 0u*4 - 2u*5. 8u*5 Expand (2 + x - 2)(-3x2 + 4x*2 - 3x*2) + 3x*3 - 3x*3 - 2x*3 + (5x*3 - 7x*3 - 2x*3)(5 + 1 - 3). -16x3 Expand (-4m + 3m + 2m)(5 + 2 + 0)(4 - 2 - 1)(3m - 3m + m). 7m2 Expand -b2 + b*2 + 2b*5 + 3b5 - b5 - 6b5 + (b3 - b3 - 2b*3)(0b2 + 0b2 + b2). -4b5 Expand (-6n*2 - 13n*2 + 4n*2)(-n*2 + 5n*2 - 2n*2)(-2 + 2 - 2). 60n4 Expand (4 - 5 + 2)(-3u3 + 7u*2 - 5u2 + u3). -2u3 + 2u*2 Expand (16o*4 + 7o*4 - 37o*4)(-1 + 1 + 2). -28o4 Expand 2g*2 + 2g*3 - 2g*2 + (2g + g - 5g)(-4g2 + 0g*2 + 2g2) - g3 - g3 + g3 + 5g - 5g - g*3. 4g*3 Expand -1 + 1 + 5g + 2g + 3 - 2 - 2 + (-3g + 7g - 2g)(3 - 5 + 0). 3g - 1 Expand (-2g + 7g + 0g)(2g2 + 0g + 0g) + (-2g*2 + 6g*2 - 2g*2)(-g + g + 2g) - 2 + 2 - 2g*3 + 0g*3 - 3g*3 + 5g*3. 14g3 Expand -q2 + 0q2 + 0q*2 + (1 - 1 + q)(-3q + 0q + 5q) + (17q + 7q - 11q)(-q + 0q + 3q) - q + 2q*2 + q. 29q*2 Expand 3 - 3 + 2y*4 + (-2y + 3 - 3)(3y + 2y3 - 3y) + (0y3 + 0y3 - y3)(-15y + 8 - 8). 13y4 Expand s3 + 4s - 4s + (-1 + 3 + 0)(-s*3 + 0s3 - s3) + (3 + 2s - 3)(0s2 - 3s2 - s2) + s3 - s3 + s*3. -10s*3 Expand -7p4 + p4 + 3p4 + (-8p - p*2 + 0p*2 + 5p)(2p2 - p2 - 2p2). -2p*4 + 3p*3 Expand -11v*5 + 7v*5 + 14v*5 + (2v + 2v - 3v)(1 - 1 - 2v*4). 8v*5 Expand (-1 + 2 + 0 - 3 - 2 + 3 + (2 + 0 - 1)(3 - 3 - 1) - 1 + 1 + 2 - 4 + 4 - 1 + 1 - 4 + 2 + 1 - 5 + 1 + 4 - 3 - 5)(-2s + 2s - s4). 9s*4 Expand (-9 + 9 + 5t5 + t5 + 3t - 3t + (-5t + 5t + 2t)(3t4 + 0t*4 - 2t*4))(-1 + 0 + 2). 8t5 Expand (0 - 3 + 1)(x*2 + 2x*2 - 4x*2)(5x2 - x2 - 2x2) - x4 + 4x4 - x4. 6x*4 Expand -l + 0 + 0 - 5l - 2l - 21l + (-l - l + l)(-4 - 1 + 3). -27l Expand (0 + 6 - 4)(f3 + 4f*3 - 3f*3) - 3f*3 + 2f*3 - 9f*3. -6f*3 Expand (-2k*2 - 5k*2 + 5k*2)(4k - 5k + 0k) - 3k*3 + 2k*2 - 2k*2 - 2k*2 + 2k*2 - 2k*3 + 0k*3 + 3k3 - k3. -k*3 Expand (-2l + l + 3l)(-5 + 5 - 2)(0 - 1 + 4)(3l + 2l + l). -72l2 Expand (-2i - i + 5i)(-3 + 3 - i*2) + 4i*3 - 3i*3 - 2i3 + (-i2 + 0i2 + 0i*2)(-3 + 11 - 2i + 0). -i3 - 8i*2 Expand (-1 + 2 - 3)(3v - 5v + 5v)(-4 - v + 4). 6v2 Expand (3g - 5g + g + (1 - 1 + 3)(-2g - 2 + 2))(-5g + 45 - 45). 35g*2 Expand (-10 + 5t + 5t + 11)(4t2 + t - t). 40t*3 + 4t*2 Expand (3 - 7 + 2)(3 + 1 - 3)(8o4 + o5 - 8o4). -2o5 Expand (i3 - 5i2 + i2 - 3i*2)(5 + 2 - 3)(-1 - 2i + 1). -8i4 + 56i*3 Expand (1 - 4m - m + 0m)(4m3 - 4m3 - m3). 5m4 - m3 Expand o - 4 + 4 + 1 - 1 + 2o + (0 - 3 + 4)(-5o + 3o + o) + 6 - 16o - 6 + o - 1 + 1. -13o Expand ((-2j + 0 + 0)(0j + 3j - j) + 3j*2 - 3j2 + j2 - j2 + j2 + 2j2 - 3 - j2 + 3)(-j + 2 - 2). 2j3 Expand (0 + 0 + 5)(-2f4 + f2 - f2). -10f*4 Expand (-3d + 3d - 4d*2)(2 + 2d - 2) + 2d*3 + 3d3 - d3. -4d3 Expand (3u - 7u + u)(1 + 3 + 0)(1 + 0 + 0). -12u Expand (-2m3 + 2m*2 - 2m*2)(2m - 4m - 2m) + 6m*2 - 6m*4 - 6m*2. 2m4 Expand -i3 - 3i + 3i + (-i*2 + 3i*2 + 0i*2)(-1 + i + 1) + 2i3 - 2i3 - i3 + 10i3 - 5i3 - i3. 4i3 Expand (-2w*2 - 31 - 85 + 19)(1 + 2w2 - 1). -4w*4 - 194w2 Expand (v3 - 6 - 4v2 + 6)(-4 - 1 + 3)(v - 2v - v). 4v4 - 16v*3 Expand (-1 + 1 + 1)(-q - q + q) + 3q + 2q - 2q. 2q Expand (m*2 - 1 + 1 + (2m2 - m2 + m*2)(2 + 1 - 1) + 0m + 2m*2 + 0m - m*2 - 2m + 2m + 0m - 3m2 + 0m)(4 - 3 - 3). -6m*2 Expand (5 - 2 - 2)(1 - 2 + 3)(-12 + 12 - m). -2m Expand (1 + 4q5 + 3q*5 - 4q*5 - 2q*3)(2 - 3 - 1). -6q5 + 4q*3 - 2 Expand 0a2 + a2 - 2a2 + (-a + 2a + a)(3a + 3a - 4a) - 4a2 - a2 + 3a2. a2 Expand 3m5 - 2m*5 - 2m5 + (2 - m3 - 2)(3m - 3m - m2) + 3m5 + m5 - 2m5 - m2 - 18m*5 + 5m + 15m5 + 0m2. -m5 - m*2 + 5m Expand (-2u4 + 3u*4 + 0u*4)(-u + 0u - 14u). -15u5 Expand (7j + 17j - 17j + (5 - 2 - 1)(3j + 0j - 2j))(6j + 0j - 4j). 18j2 Expand (m - 2m*2 - m)(6 - 6 + 3m3) + 0m*2 + 0m*2 + 2m*5. -4m*5 Expand 2t3 - 1 + 1 + (t3 - t3 + t3)(-1 + 2 + 0) + t3 - t3 + 3t*3 + (4t + 0t - 3t)(2t - 2t2 - 2t). 4t3 Expand (-3 + 3 + n)(-2 - 2 - 4) + (-1 + 0 - 1)(1 + n - 1) - 2n + 5n - 2n. -9n Expand 6j - 3j + 3j + (6 - 6 - 4j)(2 - 5 + 1). 14j Expand (q + 2 - 2)(1 + 3 - 2) - 1 + q + 1 - 2q + q + 0q + q + 3 - 3 + (2 + 2q - 2)(1 - 6 - 2). -11q Expand 0 + 0 - v - v + 2 - 2 - 2v - 1 + 1 + (-1 + 1 - 1)(0v + v - 3v) - 2v + 0v + v + 1 - 1 + 6v. 3v Expand (0w + 5w + 0w)(3 + 0 - 5)(-5w3 + 4w*3 + 4w*3). -30w*4 Expand (7 - 4 - 4 + 4 - 3 - 6 + 1 - 4 + 2 + (0 - 3 + 2)(0 - 4 + 2))(-4d + 2d + 0d)(-4d + 4d + d2). 10d*3 Expand (1 + 3 - 3)(-2w + 0w + 0w) - 3w + 6 - 6. -5w Expand (3 + 14w - 3)(-2w3 - w3 + 2w3). -14w*4 Expand 3t*3 - 52t + 34t - 5t*3 + (-6t*3 + 4t*3 + 4t*3)(2 - 2 - 1). -4t3 - 18t Expand -2z2 + 3z*2 - 8z + 0z2 + (-2z + 4z + 0z)(-1 + 2z + 1). 5z2 - 8z Expand (10 - 10 - 3i + (2 + 3 - 4)(-i + 2i + i))(5i2 + 0i*2 + 0i*2). -5i*3 Expand (2 - 2 - 2m)((-10 - 16 + 4)(-2 - 3 + 7) + (-1 - 3 + 3)(-2 + 2 - 1) + 2 - 1 - 2). 88m Expand (17z - 8z + 7z)(3 + 1 - 5)(4 + 0 - 5). 16z Expand (-51p2 - p3 + 53p2 - p3 - 2p4)(p + 0p + p). -4p*5 - 4p*4 + 4p*3 Expand (-3 - 2 + 1)(x*4 + 3x*4 - 3x*4) - 55x4 + x3 + x*3 + 48x*4. -11x*4 + 2x*3 Expand (-1 + 1 - 2y + 2y2)(-2 - 2 - 6). -20y2 + 20y Expand -s*3 + 6s*2 + 0s*3 - 3s*2 + (-2 + 2 - 2s*2)(0s + s + 0s). -3s3 + 3s*2 Expand (-2n + 1 - 1)(0 + 2n + 0 + 2 - 2 - n + (3 + 0 - 5)(-1 + 1 - 2n) - 2 - 2n + 2)(-n*3 - n + n). 6n*5 Expand (1 + 0 - 3)(-4s4 + 4s - 4s). 8s*4 Expand -356h + 356h + 43h4 + (-h2 - h2 + h2)(3h*2 + 2h*2 - 4h*2) + 0h*4 - 2h4 + h4. 41h4 Expand -3q*5 + 3q*5 - 2q*5 + (q + q - 3q)(q3 - q3 - q4). -q5 Expand (13 - 2y - 13)(4y*2 - 3y*2 + 0y*2). -2y*3 Expand (-4g*2 + 4g*2 + 2g*2)(2 + 5g2 + 24g - 24g). 10g*4 + 4g*2 Expand (2 - 3 + 0)(-97 + 82p + 203p + 97). -285p Expand -4w + w + w + (3 - 6 + 2)(3 - 3 + w) + 2w - 3w - w - 2w - 4w + w. -10w Expand (-518 - 114w + 518)(-2 + 2w + 2). -228w*2 Expand (3z*2 + 8z*2 + 2z*2)(-z*2 - 4z*2 + 6z*2 - 2z*3). -26z*5 + 13z*4 Expand (-2y + 3 - 3)(-2 - 3 + 3) + 2y - 1 + 1 + (-5 + 2 + 4)(2y - 4y + 7y) + (-1 + 8 + 2)(-2y + 0 + 0). -7y Expand (2d*3 - 4 + 4 + (-1 + d + 1)(0d2 + 0d*2 + 2d*2) + 2d*3 + d - d + (4d - 3d - 2d)(-6d*2 + 10d**	{ "pile_set_name": "DM Mathematics" }
o = 1 + 8. Solve -4w + z = -7, r = 3z + o - 24 for w. 3 Let y be -1 + 4 + 0/(-2). Suppose -u + 6 - y = 0. Solve o + 3o = -q - 15, -2o - 5 = uq for q. 1 Let v = 7 - 7. Suppose 3p - 2s = 4p - 12, 5p - 2s = v. Solve -6 = 4g - 2o, -po = 5g - 4o + 6 for g. 0 Let z(a) be the second derivative of 0 - 1/2a*2 + 2a + 1/6a3. Let n be z(5). Solve 0 = -f, -2f - n = -4m + 2f for m. 1 Let n be 290/(-232)(-3 + (-2 - -1)). Solve h - nd = -4, -h + 0d + 4d = 3 for h. 1 Let p = -8 + 5. Let b be p1 + -11 + 14. Solve 2s + 5f - 29 = b, 0 = 4s - f - 3 for s. 2 Let r be 6/44/3. Suppose 37 = -o + 4o + 4x, 0 = -3o + rx + 31. Let u(a) = a + 1. Let t be u(2). Solve ts + 7 = -3q - 8, 0 = -4q + 5s - o for q. -4 Let k be (-2)/424/(-4). Solve 0 = -2d + 3v + 9, -4d = -kd - 2v - 5 for d. 3 Let k(j) = j - 10. Let l be k(5). Let r be (4/(-10))/(l/25). Suppose -z + 1 + 1 = 0. Solve 4y + 4 = -v, -rv + y = -zy + 8 for v. -4 Suppose -3g + 3 = -27. Solve -c - 3h = -g, c - 2h + 2 + 3 = 0 for c. 1 Let b be (-1)/(86/(-84) - -1). Suppose y - b = -2y. Solve 3u - y = -5v, -3v + 8 = -4u - 12 for u. -2 Suppose 1 = -b - 3w, 0 = -3b - 2b - 5w - 5. Let d be (-1)/(b - 12/(-15)). Solve -s + 11 = -dn - 2, 4s = -5n + 2 for n. -2 Let y = -4 - -9. Solve 7 = -a + yk - 17, -16 = -4k for a. -4 Let x = 53 + -37. Solve 5l + 3y + y + x = 0, -12 = 3y for l. 0 Let c(m) = -m + 1. Let r be c(-4). Suppose -3j - p + 2 = 0, -2p + p = -2j + 3. Let g = 5 - j. Solve 5k - gf = -2f, 0 = 5k - rf for k. 0 Suppose -3d - 2k + 20 = 4, -4k + 18 = -d. Suppose dj = 19 - 3. Solve 2z = 0, 2 = 2q + 2z - j for q. 5 Let d(c) = -3c - 1. Let h(o) = 8o + 2. Let q(s) = 17d(s) + 6h(s). Let l be q(-5). Let t = l - 7. Solve 0 = p + ty + 5, -3p + y = 2 + 3 for p. -2 Let g be 2/(-3) + (-17)/(-3). Let u be (-3)/g(-1 - 4). Solve -3o - 5 = 5s, 4s + 0s + o = u for s. 2 Suppose 5 = 3d - 25. Suppose d - 34 = -4h. Suppose 3f - 9 - h = 0. Solve -4c - q = 3, -fc + 5q - 8 = 2 for c. -1 Let u(t) = t + 2. Let v be u(4). Let y be (3/v)/((-1)/(-8)). Solve 5n + 27 = yd, -5n - 4d = 5 - 2 for n. -3 Let j be ((-12)/(-8))/(6/16). Solve -2c - 3t = 10, jt = -4c + 8t for c. -2 Suppose 27 = -21v + 30v. Let n = 11 + 1. Suppose 0 = -2s - 2s + n. Solve -2h + sh - 16 = -4x, -vx - 3h + 12 = 0 for x. 4 Suppose -3a = 4u - 54, 0a + 2a + 5u = 43. Solve a = 4t + n, -n = t - 6t + 13 for t. 3 Let p(d) = d3 + d2 + d. Let i(o) = -6o*3 - 10o + 2. Let h(v) = -i(v) - 5p(v). Let z be h(4). Solve 4u + 2k = -26, zk = -u - 13 - 1 for u. -4 Suppose -10 = -s - 4s. Suppose -sx - x = -18. Solve -b = -5k - xb, -2k - 2 = 3b for k. 2 Suppose 2 - 8 = -2z. Let c(a) = -2 - a + 5 + 1. Let h be c(4). Solve 4q = 2u - 12, 4q + h = -zu - 12 for q. -3 Suppose 0m + 3m + 18 = 0. Let z(q) = q3 + 5q*2 - 7q + 4. Let i be z(m). Solve -i = p + 3s, 3s = 3p - 0s - 30 for p. 5 Let z = 23 - 14. Let n = z + -7. Let w(o) = o*3 + 4o*2 + 4o + 4. Let c be w(-3). Solve 0l = -3m - 2l - c, nm = 4l - 6 for m. -1 Suppose 0 = -3f + 3a + 198, 0a + 2a - 2 = 0. Suppose 4k + 3 - f = 0. Solve -4t = -k, -2r - 2t = 6 - 22 for r. 4 Let c(r) be the second derivative of r5/5 + r4/6 - r3/3 + r2/2 + r. Let v be c(1). Solve -2g - 8 = -3a - 0g, g + 18 = va for a. 4 Let n be (4/10)/((-1)/(-5)). Solve -5d + 2 = -2i, -nd - i + 0i = -8 for d. 2 Suppose 4q = 4, -i = -0q + q - 3. Solve a = -2d - 12, -4a = id - 4d - 2 for a. -2 Suppose -7 = -5r + 18. Let m = r - 1. Solve 2k + 2k + mi = 4, 5k = 3i + 13 for k. 2 Suppose -x + 4b = 14, 4x + b + 20 = -2. Let o = -3 - x. Solve 5s + 2 = -3w, 5w + 2s = -0s + o for w. 1 Let i be 4 + ((-9)/(-3))/1. Suppose 4q + 16 = 4k, -ik + 2k = 5q - 20. Solve 0 = kl - 0h + 3h - 1, h + 4 = 3l for l. 1 Let r = 6 + 2. Solve 5u - 30 = ry - 3y, -4y - 14 = u for y. -4 Let s be (-25)/(-10) - ((-2)/4 - -1). Solve 0 = -3u, 3o + 15 = -0o + su for o. -5 Let s be ((-16)/(-3))/((-20)/(-30)). Solve -5p + s = h + 2h, -p = h for h. -4 Let u = -3 - -5. Solve q - 12 = -3q, 5 = h + uq for h. -1 Let u be (-8)/(-10) + 60/(-75). Solve -15 = -5a - c, 3a + uc - 4c - 9 = 0 for a. 3 Let j = 0 + 1. Let l be (6/(-4) + j)-42. Suppose -3p = 9 - l. Solve 0 = -5t - 15, -37 = 5d + pt for d. -5 Let q = 1 + 1. Suppose qs = -8 + 12. Solve 7 + s = -4x - y, 5y = x + 18 for x. -3 Let n be (-3)/6-4 - -50. Let m be (n/(-4) + 1)/(-2). Solve -5v - 2 = -4c - m, v - 24 = -5c for v. 4 Suppose 4h - 6 - 26 = 0. Let f be (21/14)/(3/h). Let a = 2 - -2. Solve -fm = -2i - 12, -4i - 3 = -3m - a for m. 5 Suppose 3h + 3x - 54 = -0h, 4h - x = 47. Solve 0 = -4a + 2r - 8, -3a - 2r + 7r = h for a. -1 Let v(y) = 3y - 1. Suppose -12q + 8 = -8q. Let r be v(q). Solve 19 = 2c + 3c - 3k, 29 = rc + 2k for c. 5 Suppose 1 + 1 = y. Let o be (-1)/(y/4) - -10. Let l = -3 + o. Solve 0 = -2r - 0r + 2d - 6, -2d = -lr for r. 2 Let y(v) = 3v - 2. Let q be y(2). Suppose -5s + q + 6 = 0. Suppose -sa + a = -4. Solve -f = 0, aj = -6f + 3f + 4 for j. 1 Let b be (2 - 3) + (3 - 0). Solve 2u - by = 12, 7 + 1 = -4u - 4y for u. 2 Suppose -2l + 5l = 4r - 108, l - 4r + 28 = 0. Let i be 44/10 + 16/l. Solve 4v - 24 = -ia + 6a, -2a - 2v = -6 for a. -2 Let r = -28 + 20. Let t = -3 - r. Let w be ((-3)/t)/((-1)/5). Solve -2c - 5i + 1 = c, 0 = -wi - 3 for c. 2 Suppose -l = 4l. Solve 4q - 2t + 10 = l, -4t + 2t = -2q for q. -5 Suppose 0 = 2j - 10, 3n = 3j - 4 + 1. Let x be (0 - 0)/(5 - 3). Solve 3g + 15 = -v, -nv - 3g = -xg + 24 for v. -3 Let b = 9 + 2. Let d = -7 + b. Solve 2s + 4q + 16 = 0, -ds - 25 = 3q - 8 for s. -2 Let x be (-2)/4 + 13/2. Suppose -3r = -xr + 57. Let w be (-4 - 5)1/(-3). Solve -4u = 5v + r, 3v + wu - 4u + 8 = 0 for v. -3 Let o = -26 + 28. Solve -5j - y = 7, oj - 3y + 2y = 0 for j. -1 Suppose -5k + 0k - i + 4 = 0, -2i = 3k - 8. Let d be -5 - (k - 2) - -1. Let q be (9/6 + -2)d. Solve g = 3x + q, -3x - x = 0 for g. 1 Let z = 12 + -7. Suppose 4x + x + 5 = 0, -3x + 362 = zr. Suppose 5v + 28 = r. Solve -3d + d + 5 = -3i, 5i + d = v for i. 1 Let v be -2 - (-2 + 2 + 1). Let k(i) = i3 + 4i*2 + 4i + 4. Let n be k(v). Let a = n - -2. Solve -8d = 3y - 3d + 11, -3d + a = -3y for y. -2 Let n(r) = -r3 + r. Let v be n(1). Let o be -21 + 8 + v. Let s be (-20)/o12/(-10). Solve -2j + 2q = -sj + 2, -2j - 4 = 4q for j. 4 Suppose 4v - 3u = 2, -v + 4v - 8 = -u. Solve f - vb = 8, 2f + 0b = 2b + 8 for f. 0 Let s(h) = 4h*2 + h + 1. Let d be s(-1). Suppose du - 3q - 2q = 25, -u + q = -6. Solve 0 = -3f - j - 13, -uf - 4j = 31 for f. -3 Suppose 16 + 9 = -5f + b, f - 4b = -24. Let p be 6 - 2/f0. Let y be (6/(-2))/1 + p. Solve 2x = 3i - 11, 4i = -x + yx + 12 for i. 1 Let b = 7 + -5. Suppose -8 = -c - b. Solve -j - 22 = -ca + 2a, 3a + 2j - 11 = 0 for a. 5 Let b(h) = 2h - h + h - 2 + 3. Let m be b(1). Solve 3t + t - w + m = 0, 28 = -4t - 4w for t. -2 Suppose 0 = 111j - 112j. Solve j = 5z + n - 2n + 26, -n = z + 4 for z. -5 Let m be (1 - -1)/(2/15). Let z = m - 12. Solve 9 = -2p - 0p - 3f, -5p - f - z = 0 for p. 0 Let s = 4 + -2. Solve -3b + 0v = v + 7, sb - 2v = -10 for b. -3 Let c(b) = b*2 - 1. Let o(p) = 2p*2 + 6p - 1. Let d(t) = -3c(t) + o(t). Let r be d(6). Solve 5y + r = -5i - 3, 4i - 3y = 17 for i. 2 Let l be 2(7/2 + -3). Let t be ((-3)/(-2))/(l/2). Solve 0 = tn, -4n = g - 4 - 1 for g. 5 Let w = -4 + 9. Let g be (-14 - -2)3/(-9). Solve -4m - h + 7 = gh, 0 = -m + h - w for m. -2 Let s be (0 - -6) + 2-1. Suppose -4c - 5a + 12 = -16, 0 = sc - a - 4. Let m = -43 + 63. Solve -2r = 3q + cq + 8, -5q + m = -5r for q. 0 Suppose -4 = -2f - 4g, 2f + 1 = 2g - 1. Suppose -p - 1 = -2z - 2p, 5z = 3p + 8. Let m = 6 - z. Solve -mc - 2y = -28, fy - 4 = -3c + 2y for c. 4 Suppose -2 = -3z + 4j - 22, -15 = 5z - 3j. Suppose z = 4y - 0y. Suppose -q = -yq. Solve q = -5p + 5r + 5, 5p - 2r + 4 = 0 for p. -2 Let x = -81 + 85. Solve -xq - 20 = 0, 5q + 15 = -3u - 10 for u. 0 Let h = -7 + 12. Suppose a + 11 = p, 4p - h - 7 = 0. Let w be 2/a - (-51)/12. Solve 0q + 5q = -4z - 17, -5q - 33 = -w	{ "pile_set_name": "DM Mathematics" }
hat is the tens digit of v? 2 Suppose 13 = -4k + 1. Let w be (-1)/(0 + -2 - -3). Let m = w - k. What is the units digit of m? 2 Let m = 28 - 14. Let v = m - -12. What is the tens digit of v? 2 Suppose -6t + 8t = 32. What is the tens digit of t? 1 Let d(c) = -33c - 1. Suppose 2 + 3 = -5k. What is the tens digit of d(k)? 3 Let a be (-5)/1(0 - 1). Let t = a - 0. Suppose -5k = 2w, 0 = w - 3k - t - 6. What is the units digit of w? 5 What is the units digit of ((-32)/12 - 0)-3? 8 Let t = 1 - 0. What is the tens digit of t/(-2) - 29/(-2)? 1 Let v(k) = -k*3 - 5k*2 - 5k - 4. Let j be v(-4). Let a = j - -8. What is the units digit of a? 8 Let g be (-3 + 23)/(6/(-9)). What is the units digit of 20/(-6)g/25? 4 Let a = 423 - 41. What is the units digit of a? 2 Suppose 2u - 102 = -0u. What is the tens digit of u? 5 Let t be 4/12 + (-11)/(-3). Let q be (-6)/(-15)-15. Let b = q + t. What is the units digit of b? 2 Suppose -3w = 4d + 9, -3w + 3 - 12 = 3d. What is the units digit of d - -1 - (-1 - 3)? 5 What is the tens digit of ((-25)/(-1))/(15/195)? 2 Let o be (-1)/(-2) - (-51)/6. Let r = o - 2. Suppose 5m - g - 28 = 0, -rm = -2m - 2g - 26. What is the units digit of m? 6 Let u be 318/(-27) + (-2)/9. Let x be 3/u - 1/(-4). Suppose x = 5b - 5 - 5. What is the units digit of b? 2 Suppose -i + 46 = k + i, k = i + 46. What is the tens digit of k? 4 Let q(x) = x*3 + 12x*2 - 5x + 22. What is the units digit of q(-12)? 2 Let k = 75 - 43. What is the units digit of k? 2 Suppose 10n - 199 = 3281. What is the units digit of n? 8 Suppose 4h + 12 + 13 = a, 10 = -2h. Suppose -3 = -4r + a. Let f = r - -2. What is the units digit of f? 4 Let r be 20/(16/4) + 1. Suppose -2o + rx + 15 = x, 2x = -2. What is the units digit of o? 5 Let m be (30/8)/(1/(-4)). Let t be ((-35)/m)/((-2)/6). Let k = t - -16. What is the units digit of k? 9 Let q(f) = f3 - 6f*2 + 6f - 8. Let n(u) = 2u2 - 3u - 3. Let y be n(3). What is the units digit of q(y)? 8 Let d be 58(-3 - -2)/(-2). Let q = d + -20. What is the units digit of q? 9 Let n = -18 + 25. Let d be (-5)/(-7) - (-2)/n. What is the units digit of -5d8/(-20)? 2 Let a(v) = -v3 + 7v*2 + v - 4. Let m be a(7). Let f be 2 + 3/m + 45. Suppose -5j + 40 = 2s + s, -5s + j + f = 0. What is the units digit of s? 0 Suppose -3a + 21 = -g, -4g = -5a + 63 - 7. Let v(o) = -o + 4. What is the tens digit of v(g)? 1 Let r = 13 + 2. Suppose -j = f - 3j - r, 0 = -4f - 5j + 21. What is the units digit of f? 9 Suppose -2a - 3f = -0a - 21, -2a = -4f. Suppose 5y + 0 + 2 = i, -a = -3i. Suppose -4g - g + 10 = y. What is the units digit of g? 2 What is the tens digit of 3/(-12) - (-340)/16? 2 Suppose 0n + 3s - 29 = 5n, -5n - 33 = -s. Let u = n - -25. Let j = 27 - u. What is the units digit of j? 9 Let v = 53 - -25. What is the tens digit of v? 7 Let m(d) = d*2 - d + 8. Let r be 1 + -2 - (5 - 6). Let p be m(r). Suppose -4 = -4t + p. What is the units digit of t? 3 Let a(q) = -3q + 2. Let i(h) = h3 - 6h*2 + h - 2. Let v be i(6). Suppose z = -v - 0. What is the tens digit of a(z)? 1 Let x = -387 + 560. What is the tens digit of x? 7 Suppose -3b + 29 = -2h - 40, 46 = 2b + h. Suppose 0 = -4a + 4s - 12, -a = -3s - 2s + b. Suppose -20 + a = -3q. What is the units digit of q? 6 Suppose 2y - 8 + 0 = 0. Suppose -5w - 4r - y = 0, 0 = -r + 3r + 2. Suppose 0 = j - wj - o - 12, 54 = 4j + 2o. What is the units digit of j? 3 Suppose 4t = -3x - 42 - 8, t + 20 = 3x. What is the units digit of 25/2 + (-7)/t? 3 Suppose -c = -2n - 43, 2c + 5n - 48 = 29. What is the units digit of c? 1 Let v = 59 + 29. What is the units digit of v? 8 Let i = 5 - -7. What is the units digit of i? 2 Let f be 1/(-4) - (-2)/8. Suppose -2b + 5x + 7 = f, -4b - x + 85 = b. What is the tens digit of b? 1 Let u(o) = 14o*2. Let x be u(1). Let c be 7/(-2)(2 - x). Suppose -2 + c = 5v. What is the units digit of v? 8 Let t(m) = m + 1. Let s be t(-7). Let f(c) = -c2 - 9c + 7. What is the tens digit of f(s)? 2 Suppose 3c + 3 = 4c. Suppose 0 = -0l - cl + 36. What is the units digit of l? 2 Let s(r) = r*3 + 6r*2 - 9r + 6. What is the units digit of s(-7)? 0 Let k(y) = -y + 1. Let s be k(-3). Suppose -sc = -c. Suppose p + 0 - 8 = c. What is the units digit of p? 8 Let w be (-1 - 0)/(2/(-4)). Suppose -wu = -b - u + 8, -2b + u = -11. What is the units digit of b? 3 Let n = -5 - 1. Let d = n - -9. Suppose -9 = -dq - 5c - 31, q + 19 = -4c. What is the units digit of q? 1 Let i = 39 - -18. What is the tens digit of i? 5 Let q(h) = 36h2 + h. What is the units digit of q(1)? 7 Suppose -c + 16 = 3c. What is the units digit of ((-14)/c)/((-1)/2)? 7 Let p = 6 - 4. Suppose 4j = -4h + 72, h = 3j + 2j - 6. What is the units digit of (-7)/h-8p? 8 Let b be 4((-15)/4)/(-3). Let u = b - 3. What is the units digit of u? 2 Suppose 7c - 3c = 976. Suppose -4a + 0a = -c. Suppose -16 + a = 3n. What is the tens digit of n? 1 Let i(t) = 0t3 - 2t + t3 - t2 - 5 + 0t + 2. Let m be i(-2). Let k = m - -21. What is the units digit of k? 0 Let d = 22 - 13. Let f = d + -6. What is the units digit of f? 3 Let m(n) = -2n3 + n2 - n. Suppose 4z = -7 - 1. Let a be m(z). Suppose 0 = 3u - 5r - 50, -3u - 2r = -0r - a. What is the tens digit of u? 1 Let k be -1 + 1-13. What is the units digit of (4/(-1))/(2/k)? 8 Suppose t - 38 = -b, 4t - b - 2b - 124 = 0. Let h = t + -2. What is the units digit of h? 2 Let i be ((-2)/(-4))/((-1)/24). Let m be (9/i)/((-9)/24). Suppose s - 7 = -m. What is the units digit of s? 5 Let v(r) be the second derivative of -3/2r2 - r - 1/12r*4 - 7/6r*3 + 0. What is the units digit of v(-5)? 7 Let n = -156 - -305. What is the hundreds digit of n? 1 Let f be -8(-2)/10-5. Let s(n) be the third derivative of -n5/60 - 3n4/8 - n3/6 - 2n2. What is the units digit of s(f)? 7 Let f = 8 - 3. Let q = f + -5. Suppose 30 = 3v - qv. What is the units digit of v? 0 Let b(j) be the third derivative of j5/60 + 5j4/24 + j3/6 - 2j2. Suppose -3s = -2z, 19 = z - 5s + 5. What is the units digit of b(z)? 7 Let w = 13 - 6. Suppose w = 4z - 9. What is the units digit of z? 4 Let g(o) be the second derivative of o4/12 + o3/2 - o2 - o. Let b be g(-4). Suppose -3l = -9, 4x - 47 = bl - 7l. What is the units digit of x? 8 Suppose 5k = 3n - 20, 3n - 5n - 3k = 12. Let q(z) = z + 27. What is the tens digit of q(n)? 2 Suppose -3 - 5 = -4v. Suppose 3l = -vp - 4 + 41, -6 = -p + l. What is the units digit of p? 1 Let k be (42/4)/((-3)/(-6)). Let q = k - -6. What is the units digit of q? 7 Let g be 21/(-12) - (-1)/(-4). What is the units digit of (g/4)/((-1)/10)? 5 Let x(w) = -1 - 3 + 3 - 3w + w*2. What is the units digit of x(-2)? 9 Let s be 2/(-10) + (-1432)/(-10). Suppose -n - 4w + 5w + 34 = 0, 5n - s = -4w. What is the units digit of n? 1 Let q = -57 + 232. What is the tens digit of q? 7 Suppose -4n - 2 = -5w, -2n + 3n + 5w + 13 = 0. Let f = -2 - -9. What is the units digit of (n - (-1 - 1)) + f? 6 Let s = 6 + 2. Suppose 40 = 3p - s. What is the tens digit of p? 1 Let u = 158 - 91. What is the units digit of u? 7 Suppose -16 = -4v + 4h, -3v - 3h + 0h = 0. Let o(f) = -f*3 + 3f*2 + f - 1. What is the units digit of o(v)? 5 Let y(o) = 4o*2 + 4o - 4. What is the units digit of y(2)? 0 What is the hundreds digit of -19 - -19 - (-1 + -372)? 3 Suppose 0 = 3i + 2b - 186, -2i + 2b + 151 = 37. Suppose -4f + i - 4 = 0. What is the tens digit of f? 1 Suppose 0 = z - 3g - g - 17, 0 = 5z + g + 20. What is the units digit of (21 - z)(-9)/(-12)? 8 Suppose 2r = 7r - 25. Suppose rn = -h + 26, 5h - 2n = -n. What is the units digit of h? 1 Let w(c) be the first derivative of c4/4 - 5c*3/3 - 2c*2 + 3c + 6. What is the units digit of w(6)? 5 What is the units digit of 155 - ((-1 - -3) + -4)? 7 Let y(c) = c*3 - 6c*2 - 8c + 7. Let j be y(7). Suppose -4r + 4 = -j. Let t = r + 2. What is the units digit of t? 3 Suppose 30 = w + 5s, 2w = 2s + 3s - 15. Suppose wu - 55 = 55. What is the units digit of u? 2 Let o = -2 + -2. What is the units digit of 3/(-9)(o - 23)? 9 Let j(c) = 3c + 11. Suppose -5y - l + 2l = 44, 5y = -5l	{ "pile_set_name": "DM Mathematics" }
. Let n = -1.55 + -0.45. Which is the nearest to n? (a) -3 (b) 5 (c) p a Let z = -65 + 65. What is the nearest to 2 in -0.5, 1, z? 1 Let g = -423 + 423.1. Let v = -0.5 - -1. What is the nearest to -3 in g, -1/3, v? -1/3 Let z = 3 + -6. Let h be (-14)/20 + (-3)/(-15). Which is the closest to h? (a) z (b) -0.2 (c) 1 b Let n = 1 - 1.1. Let l = 1 - -6. Let k = -3 + l. Which is the closest to n? (a) -5 (b) -3 (c) k b Let o = 18 - 13. Let u = 24 - 22. What is the closest to u in o, -2/13, -3/8? -2/13 Let n = -14.81 - -0.31. Let g = n - -14. Which is the nearest to 1/2? (a) 0.4 (b) 0.2 (c) g a Let j = 0.69 + -1. Let h = 0.01 + j. Let u = 1 + 0. What is the closest to -1 in h, -3/4, u? -3/4 Let i = 25/4 - 129/20. What is the nearest to 6 in 1/2, i, 5? 5 Let n be ((-2)/(-4))/((-4)/(-200)). Suppose 0 = 5t - 5m + n, -3m + 4 - 1 = 0. Which is the nearest to 1? (a) t (b) 4 (c) -3 b Let g = 0.3 + -0.1. Let i = -0.8 - g. Let d = -209 - -3973/19. Which is the nearest to i? (a) -2/9 (b) d (c) 1 a Let s be 0 + ((-2)/2)/5. Let u be (-10)/(-15) + (-554)/924. Let k = -1/42 - u. What is the nearest to s in -2, k, -2/5? k Let j = -42 - -127/3. What is the nearest to j in -0.2, 2, -3/2? -0.2 Let d = -30.1 + 30. Let m be (3 + -4)1/2. Which is the closest to m? (a) d (b) -1/4 (c) 3 b Let w = -1.6 + -3.4. What is the closest to 0.01 in -1, 5, w? -1 Let n = 103/14 + -55/7. Let c be ((-12)/(-1 - 1))/2. Let s be -5 + c - 16/(-6). What is the closest to n in s, -3/5, -1? -3/5 Let w = -3.8 - -4. What is the closest to 2 in 2, w, -2? 2 Let i = 3.7 + -3.8. Let u = -1 + 0.7. Let t = u - i. What is the nearest to -2/5 in t, 4, 1? t Let h = -0.05 - -0.01. Let v = 3.96 - h. Let w be 1/(-4) - (-1)/2. What is the closest to w in v, -0.3, -1/4? -1/4 Let r = -0.03 + 0.02. Let o = r + -0.99. Which is the closest to 0.3? (a) -2 (b) -5 (c) o c Let p = 1.3 + -0.3. Let j = 224.4 + -224. Which is the nearest to p? (a) 4 (b) 0.1 (c) j c Suppose -6d - 4 = 20. Which is the nearest to -2? (a) d (b) -3 (c) -5 b Let g = -62 - -125/2. Which is the nearest to g? (a) 0.05 (b) 1 (c) 0.1 c Let o(y) = y3 - 7y*2 - 7y + 10. Let r be o(8). Suppose n = -4t - 14, 0t = -4t - 3n - r. What is the nearest to -2/3 in 2, t, 0.2? 0.2 Let x = -2 + 1.5. Let o be (-1)/10 + 1/2. Which is the nearest to 0? (a) o (b) 3/4 (c) x a Let t = 0.12 + -0.22. What is the closest to -0.1 in 0, -1/6, t? t Let b be (1/3)/((-3)/(-24)4). Let u = -3 - -3. What is the nearest to -1 in b, 1/3, u? u Let a = 6 - 11. Let q = 2 + -1. Suppose -8 = -4w + 2w. What is the nearest to 0 in a, w, q? q Let v be ((-7)/(-63))/((-2)/(-24)) + -2. What is the nearest to 1/4 in 0, -24, v? 0 Let q = -0.11 - -0.17. Let v = 0.94 + q. What is the closest to 2/5 in v, -0.5, -3? v Let r = -2 - 0. Let d(z) = -z2 + 4z + 7. Let s be d(6). Which is the closest to -0.1? (a) s (b) r (c) 1 c Suppose -5n + 129 = 144. Which is the nearest to 0.2? (a) n (b) -0.2 (c) 1/7 c Let w = -6/7 + 31/28. Let y be 3 - (17/3 + -3). Suppose 0l = l - 4, -4l = -4p - 16. Which is the nearest to y? (a) -2/11 (b) p (c) w c Let i(r) = 18r2 + 4r + 1. Let d be i(4). Let y = -4573/15 + d. Let f = -4.6 - -5. Which is the closest to -2/7? (a) f (b) y (c) 4 b Suppose q + 10 = -4q. Let i be (3 + -4)q/(-8). Which is the closest to i? (a) 1/2 (b) -0.2 (c) -1/2 b Let w = -80 + 174. Let c = -100.9 + w. Let t = 7 + c. What is the nearest to t in -0.1, -4, 0.4? -0.1 Let i = -7/10 - -11/10. Let y = 27 - 26. Which is the nearest to -1? (a) y (b) i (c) -1/8 c Let g = 8 + -12. What is the nearest to 0 in 5/4, -5, g? 5/4 Let x = -4 + 4.4. Let m = 0.13 + 8.87. Let n = m + -8. What is the closest to n in x, 1, 2/11? 1 Let h be 2/(-5)(-21 - 4). Which is the closest to 1? (a) 3 (b) -0.2 (c) h b Let q = -0.05 + -0.25. What is the nearest to 1 in 3, q, 0.5? 0.5 Let n(h) = h - 5. Let q be n(3). Let i = -239.98 + 238. Let c = i + -0.02. What is the nearest to q in 0.1, 1/3, c? c Let l = 27 + -27. Let h = -0.1 + -0.2. What is the closest to -1/4 in h, l, -3? h Suppose -3 = -5i + t - 0, 9 = 5i + 2t. Suppose 2 = -3y - i. Let o be (-5 + 7)/(18/(-4)). What is the nearest to y in 0.3, 2, o? o Let t = -22.1 - -22. Which is the nearest to 0? (a) -1 (b) t (c) 5 b Let o be (4/6)/(2 - 3). Let p = 0.19 + -1.19. What is the nearest to 0.2 in p, -5, o? o Let g(o) = -3o*2 - 2o + 1. Let s be g(3). Let y be -12 - s/18. What is the nearest to -2/7 in -0.2, -1, y? y Suppose 3l = 2y - 1 + 8, 5l - 37 = -3y. Which is the nearest to 1/2? (a) y (b) 0.5 (c) 1 b Let k = -8.1 + 9.1. What is the nearest to 0 in 0.4, k, 4? 0.4 Let r = 444 + -3102/7. Which is the nearest to 0.1? (a) -5 (b) r (c) -3 b Suppose 0 = z - 0z + 1, -z - 17 = 4f. Let k = -1 + 0. What is the closest to k in 3, f, 5? f Let z be (-1)/(-4) - 1/(-28). Let t = -29 - -27. What is the nearest to -1 in t, z, -0.5? -0.5 Let z be ((-2)/(-5))/((-76)/(-20)). Which is the nearest to 2/5? (a) z (b) -2 (c) 1/8 c Let o = 6 + -6. Let i = o + 0.03. Let x = 0.33 - i. What is the closest to 0 in 0.4, -3, x? x Let m be 1/12(-3 + 0). Which is the closest to m? (a) -0.1 (b) 1 (c) -4 a Let i = 285/7 - 41. Which is the closest to 1/2? (a) -5 (b) -2 (c) i c Suppose 5y = 4h - 10, -4y + 2h = 4 + 4. What is the closest to -2 in -4/11, 5, y? y Let p = 0.066 - 0.106. Which is the closest to 1/3? (a) p (b) 2/11 (c) -0.3 b Let k = 4 + -3.9. Let s(h) = -2h2 - 9h + 4. Let d be s(-5). What is the nearest to k in -4, -2/11, d? -2/11 Let z = -69.5 + 70. What is the closest to 0.1 in z, -0.07, 5/2? -0.07 Let q be (-6)/8(4 + 0). Let j(d) be the second derivative of -d3/3 + 3d. Let p be j(-1). Which is the closest to -2/5? (a) p (b) -2/3 (c) q b Let d = -8 - -8.3. What is the nearest to -1 in -1/5, -5, d? -1/5 Let m = -0.4 - -0.7. What is the nearest to m in 0, -2, -1? 0 Let z = -503/6 - -84. Let d = -1 - -2. What is the nearest to -1 in -1/4, z, d? -1/4 Suppose -2y - 2v = -4y - 8964, 0 = 2v. Let w be y/(-105) - 6/15. Let i = w - 42. Which is the closest to i? (a) -1 (b) -0.3 (c) 0.1 c Let g be 2/11 - 60/(-275). Suppose 5s - 11 - 4 = 0. What is the nearest to g in 0, -1/3, s? 0 Let r = -23 + 23.1. Which is the nearest to -1/4? (a) -0.1 (b) r (c) -2/9 c Let p be 27/(-12) + (2 - 0). Which is the nearest to 1? (a) -0.4 (b) p (c) 2/3 c Let p = -6 + 5.6. Let u be -3 - 10/15-3. What is the nearest to u in p, 1, -0.2? p Let o = -0.014 - -0.314. What is the closest to 0 in -3, o, -4? o Let i = -12 + 18. Let z = 3 - i. Let h = -0.04 + 2.04. Which is the closest to h? (a) 0.5 (b) z (c) 2 c Let m = -93 + 93.5. What is the closest to -1/2 in m, 0.4, -5? 0.4 Let k = 6 + -8. Let w be -19 - -16 - (0 + (-40)/14). Which is the nearest to k? (a) w (b) -1 (c) 1/2 b Let w = -4 + 3. What is the nearest to w in 0.2, -3, -1/8? -1/8 Let s = 6.8 + -6.3. What is the nearest to 2/3 in -0.3, s, -2/15? s Suppose 0 = f + 3. Suppose -7s - 15 = 4b - 6s, -5b = 4s + 16. What is the nearest to 3/2 in b, f, -5? f Let v = -31 + 92/3. What is the closest to v in 4/7, -2/7, 1/3? -2/7 Let p = -109/1290 + -2/129. Let b be (-2)/((-3)/((-9)/(-6))). Let l be (-20)/2(-2)/(-4). What is the closest to b in l, 2/9, p? 2/9 Let s be 4/(-14) - 24/(-182). Let i = 86 - 87. Let y = -446/5 + 90. What is the nearest to i in s, -1/4, y? -1/4 Let m = -662.6 - -663. Let z(p) = -p*3 - 6p*2 + 1. Let k be (-4)/(3/((-18)/(-4))). Let s be z(k). Which is the closest to -2/3? (a) s (b) 5 (c) m c Let h = -0.1 + 0.4. Which is the closest to -0.1? (a) -0.4 (b) 3 (c) h a Suppose -3c + 6c - 2j + 6 = 0, 0 = -j + 3. Let y = -1 + 2. What is the closest to -2/5 in -0.5, y, c? -0.5 Let g = 12 + -12.6. Let o = -0.1 - g. Let i be -1 + (10/(-8))/(-1). What is the nearest to 0 in o, i, -3? i Let o = -20 - -17. Which is the closest to o? (a) 5 (b) 4 (c) -3/7 c Let n = 17.9 + -17.7. What is the closest to -1/2 in 0.1, n, 1? 0.1 Let m = 8/31 - 134/279. Which is the nearest to 1/3? (a) -2/7 (b) m (c) -0.4 b Let s = -1 - -1.2. Let o = -2.1 - -2. Let r = 489 + -487. Which is the closest to 0? (a) r (b) s (c) o c Let p = 9 + -7. Let o be ((-3)/(-4))/((-15)/8). Which is the closest to o? (a) p (b) 5 (c) 4	{ "pile_set_name": "DM Mathematics" }
0 - 5j4/24 + 6j*2. Let k(n) be the second derivative of h(n). Factor k(b). -4(b - 3)2 Let h be 1/3 - 6/18. Factor r4 + 3r3 + hr*4 - 2r3. r3(r + 1) Suppose -m = -5 - 4. Find z, given that -3z + 3z2 + 3z + 3z2 + mz*3 = 0. -2/3, 0 What is c in -10c*3 - 4c*4 + 14c + 2c4 - 6c*2 - 1 - 4c + 9 = 0? -4, -1, 1 Let x be (-36)/(-8)6/36. Find a such that -xa + 1/2 + 1/4a2 = 0. 1, 2 Solve 0 - 2/5w*3 + 2/5w*2 + 4/5w = 0. -1, 0, 2 Let s = 33/14 - 6/7. Factor -9/4 + 3/4g2 - sg. 3(g - 3)(g + 1)/4 Let k(t) be the third derivative of -t5/20 + t4/2 + 6t3 + 4t*2 + 3t. Factor k(w). -3(w - 6)(w + 2) Let c = 4 - 2. Let m(i) be the second derivative of ci - 1/12i*4 - 1/2i*2 + 0 + 1/3i*3. Determine w, given that m(w) = 0. 1 Let i = 2185/7 + -311. Determine m, given that 2/7 + 2/7m*4 - im*3 - 8/7m + 12/7m2 = 0. 1 Let y be ((-2)/(-28))/((-3)/240-1). Factor 4m2 + 16/7 + ym + 6/7m3. 2(m + 2)*2(3m + 2)/7 Let g(b) be the second derivative of 7b*6/10 + 57b*5/20 + 15b4/4 + b3/2 - 3b2 - 9b. Find l such that g(l) = 0. -1, 2/7 Let r be 8/(-10)10/(-4). Suppose -rm + 10 = -0m + k, 2m = 2k - 2. Find t, given that 3t*2 - 12t2 - t4 + 3t4 + 4t*4 + 3 + 3t - mt3 = 0. -1, -1/2, 1 Let p(b) be the second derivative of -b5/10 + b4/2 + b3/3 - 3b*2 - 9b. Determine l, given that p(l) = 0. -1, 1, 3 Factor 137z4 + 10z*4 + 752z*3 - 288z + 264z2 - 248z*3 + 48. 3(z + 2)*2(7z - 2)2 Let q(c) be the second derivative of -3c5/80 - c4/4 - 5c3/8 - 3c*2/4 + 3c. Factor q(d). -3(d + 1)2(d + 2)/4 Let x be 26/6 + 1/(-3). Let a be -4 + -56/(-3). Solve 13y + 0 + a + 4 - 5y2 - x = 0 for y. -2/5, 3 Let j(t) = t3 + 7t*2 - 9t - 5. Let k be j(-8). Suppose 0c3 - c3 - c - 2 + kc + c = 0. Calculate c. -2, 1 Suppose -5a - 2w = -7, -3w - 2 - 13 = -a. Factor -7v*2 - av*3 + 2v*2 + 12 - 4v*2. -3(v - 1)(v + 2)2 Let s(u) = u + 6. Let p be s(-3). Suppose t - pt + 16 = -4i, -i - 5 = -t. What is c in -2c*5 - 6c*3 - 3c*t - 6c4 - c2 + c2 + c2 = 0? -1, 0 Let i(r) = -r*2 + 3r + 3. Let j(v) = v*3 - 5v*2 - 6v + 3. Let h be j(6). Let c be i(h). Find t such that 4t2 + 2t*c - 6t*2 + 0t*3 = 0. 0, 1 Solve 5w*4 - 2w*3 - 6w*3 + 8w*2 - 6w*4 - 5w*4 = 0 for w. -2, 0, 2/3 Let d(r) be the first derivative of 2r3/27 + r2/9 - 4r/9 + 6. Factor d(b). 2(b - 1)(b + 2)/9 Suppose 3t - 21 - 6 = 0. Let u be 21/t8/14. Factor u - 2w + 2/3w2. 2(w - 2)(w - 1)/3 Let p be ((-10)/(-4) + -2)6. Let w(d) be the third derivative of 0 - 7/60d5 + 4d*2 + 0d - 3/8d4 - 1/3d*p. Factor w(g). -(g + 1)(7g + 2) Let r = -219 + 4600/21. Let a(y) be the third derivative of 0y + 0y5 - ry*3 - 1/42y*4 + 0 + 1/210y*6 + 2y*2 + 1/735y*7. Factor a(s). 2(s - 1)(s + 1)3/7 Let z(k) = -30k*5 - 21k*4 + 39k*3 + 21k*2 - 30k. Let r(t) = -3t5 - 2t*4 + 4t*3 + 2t*2 - 3t. Let g(f) = -21r(f) + 2z(f). Factor g(q). 3q(q - 1)*2(q + 1)*2 Suppose 0 = 2p - 3p + 3v + 13, -15 = 3v. Let y = 6 + p. Solve 0 + a4 - 2a*y + 0 - 4a*2 - 4a3 = 0 for a. -2, 0 Let x(s) be the second derivative of s6/50 + 3s5/50 - 4s. Factor x(r). 3r3(r + 2)/5 Let p(i) be the second derivative of -i*7/21 - 2i*6/15 + 3i*5/10 + 2i*4/3 - 4i*3/3 + 35i. Factor p(m). -2m(m - 1)*2(m + 2)*2 Suppose 4t = 5t + 2m - 2, 4m + 4 = 0. Suppose -tv + 2c = -0v - 6, 5v + 5c - 45 = 0. Determine a, given that -va + 2a*2 - 3a - a + 8 = 0. 2 Let q = 67 + -333/5. Let x be (-3 + 2)(-1)/5. Determine c so that 0c*4 + 1/5c + xc5 - qc*3 + 0c*2 + 0 = 0. -1, 0, 1 Suppose 0 = -4h + 1 + 11. Let z(w) be the third derivative of w*2 + 0w + 1/168w8 + 0 + 0w*6 + 0w*h + 0w*5 + 0w*4 - 1/105w*7. Factor z(o). 2o*4(o - 1) Factor 6/13u - 2/13u*2 - 4/13. -2(u - 2)(u - 1)/13 Let b = -59/4 - -15. Let s be ((-2)/20)/((-4)/10). Factor 1/4g*3 + 1/4g*2 - bg - s. (g - 1)(g + 1)2/4 Let m(x) = 18x*3 + 6x*2 - x - 23. Let u(s) = 2s*2 + 0s + 6s3 - 3 - 5 + 0s. Let a(p) = -6m(p) + 17u(p). What is v in a(v) = 0? -1, -1/3, 1 Let k(p) be the second derivative of 3p5/10 + 7p*4/6 + 2p*3/3 + 8p. Factor k(l). 2l(l + 2)(3l + 1) Let f(c) be the second derivative of -c*7/189 + 2c6/135 - c4/27 + c*3/27 - 4c. Let f(x) = 0. What is x? -1, 0, 1 Let i(k) be the first derivative of -1/16k4 + 0k*2 + 0k + 3 + 1/12k3. Suppose i(f) = 0. What is f? 0, 1 Suppose -75a + 54 = -57a. What is z in -2/3z*a - 2/9z*4 - 2/3z*2 - 2/9z + 0 = 0? -1, 0 Let u(f) be the second derivative of -4f + 4/3f*3 - 2f*2 + 0 + 1/20f*5 - 5/12f*4. What is c in u(c) = 0? 1, 2 Factor 0 + 16/11h*4 + 48/11h*2 - 4h*3 - 18/11h - 2/11h5. -2h(h - 3)2(h - 1)*2/11 Suppose -4c + 1 = -7. Factor -4t + tc + t - 2t*2 + 4t*2. 3t(t - 1) Let x(w) be the second derivative of 1/55w*5 + 3/55w*6 + 0w*3 + 0 - w + 0w*2 + 0w*4 + 1/33w*7. Factor x(g). 2g*3(g + 1)(7g + 2)/11 Let k(x) = -x*2 + 1. Let t be k(1). Factor t + 2/3c*2 - 2/3c. 2c(c - 1)/3 Let n(x) = -6x3 - 24x*2 + 3x. Let g(a) = -3a3 - 11a*2 + a. Let r(d) = -14g(d) + 6n(d). Factor r(j). 2j(j + 1)(3j + 2) Let k(j) be the first derivative of -j3/12 + j/4 + 7. Factor k(c). -(c - 1)(c + 1)/4 Let b(d) = d*3 - 19d*2 + 33d + 17. Let l be b(17). Solve x*4 + 0 + 1/3x*2 + lx - 1/3x5 - x3 = 0 for x. 0, 1 Let c(l) = 13l*5 + 11l*4 + 40l*3 + 49l*2 + 20l + 4. Let f(t) = -3t5 - 3t*4 - 10t*3 - 12t*2 - 5t - 1. Let u(w) = 2c(w) + 9f(w). Factor u(b). -(b + 1)*5 Let f be (21/28)/((-9)/6)-1. Factor -1/2l - fl3 + l2 + 0. -l(l - 1)2/2 Let u = 14 - 14. Let d(x) be the second derivative of 0x*5 + ux*3 + 0x*2 + 2x + 0 + 1/15x6 - 1/6x*4. Factor d(o). 2o*2(o - 1)(o + 1) Let y(s) be the first derivative of s4/32 - s3/6 + s2/4 + 16. Factor y(b). b(b - 2)*2/8 Suppose 0b = 2d - b - 3, -9 = -3d - 3b. Factor -u5 + 2u*2 - 4u*2 + 2ud + u2 - 3u3 + 3u4. -u2(u - 1)3 Suppose -2s + 4 = -0s. Solve -x4 + 6x*2 - 4x + 3x4 - 6x*3 + sx = 0. 0, 1 Let g(v) be the second derivative of -4v + 1/30v*4 + 0 - 1/5v*3 + 2/5v*2. Factor g(a). 2(a - 2)(a - 1)/5 Let z(t) be the second derivative of -t7/42 + t6/5 - t5/4 - t. Factor z(i). -i3(i - 5)(i - 1) Suppose 4/5q*2 - 16/5q + 12/5 = 0. Calculate q. 1, 3 Let w(b) be the first derivative of -3b4/4 + 9b*2/2 + 6b + 26. Suppose w(n) = 0. What is n? -1, 2 Let k = 26 - 24. Let 1/2w + 1/4w*k + 1/4 = 0. What is w? -1 Suppose 1 + 1/4l*2 - 5/4l = 0. What is l? 1, 4 Let o = 322/5 - 64. Suppose j + 20 = t + 5j, 5j = 3t + 25. Factor -2/5i - oi2 + t. -2i(i + 1)/5 Let r be (-52)/39(1 + -4). Let h(k) be the second derivative of 1/30k3 - 1/30k*4 + 0 - rk - 1/100k5 + 1/5k*2. Determine o so that h(o) = 0. -2, -1, 1 Let h(y) = -y + 8. Let c be h(8). Let u(k) be the third derivative of 0k*5 - 1/24k*4 + 0k + k*2 + 1/120k*6 + c + 0k*3. Factor u(s). s(s - 1)(s + 1) Let r(y) be the first derivative of y4/4 - 5y*3/3 + 3y*2/2 + 9y + 50. Factor r(k). (k - 3)*2(k + 1) Let x be 7/14 + 2/(-12). Factor -2/3t2 + 0 + 1/3t + xt3. t(t - 1)2/3 Let s = -37 + 41. Suppose 0 + ys - 1/4y + y2 - 1/4y*5 - 3/2y*3 = 0. What is y? 0, 1 Let v(o) be the third derivative of -1/120o*6 + 0o*3 + 1/336o*8 + 0o + 0o4 - 1/210o*7 + 10o*2 + 1/60o5 + 0. Factor v(s). s2(s - 1)2(s + 1) Let d(i) be the second derivative of 1/12i3 + 6i + 0i2 + 1/84i*7 + 0i*4 + 0i*6 + 0 - 1/20i*5. Factor d(u). u(u - 1)*2(u + 1)*2/2 Factor 16d - 6 + 5 - 11 - 4d2. -4(d - 3)(d - 1) Let a(d) = d2 + 25d + 24. Let k be a(-24). Suppose 3/2l5 + k - 9/2l*3 + 3l*2 + 0l*4 + 0l = 0. What is l? -2, 0, 1 Let b = 0 + 4. Factor 4v - 10v*3 + 6v*4 + bv*4 + 2v*2 - 6v*3. 2v(v - 1)2(5v + 2) Solve -1/2s*2 + 0 - 1/2s = 0. -1, 0 Factor -3/7s3 - 3/7s + 6/7s2 + 0. -3s(s - 1)2/7 Let h(g) be the first derivative of -1 - 1/12g*3 + 1/16g*4 - 1/8g*2 + 1/4g. Suppose h(x) = 0. What is x? -1, 1 Le	{ "pile_set_name": "DM Mathematics" }
to -0.05 in 1/3, 0.1, h? 0.1 Let y = -11 - -56/5. Let d = -1643 + 1640. What is the nearest to -2/5 in y, d, -5? y Let z = 2358 + -2359. What is the closest to -2.7 in z, 0, -3? -3 Let s be ((-10)/(-15))/((-6)/45). Let d be ((-4)/s)/(5 - 162/30). Which is the closest to -1.6? (a) 0 (b) d (c) -3 b Let m = 85 - 72. Which is the nearest to -0.1? (a) -4 (b) m (c) -0.3 c Suppose 12f - 17 = 19. Let c be 2/(-3)12/(-20). What is the closest to c in -1/6, 0, f? 0 Let t = 305 - 265.9. Let z = -39 + t. Let d = 0.08 + -0.38. Which is the closest to z? (a) d (b) 5 (c) -5 a Let d = -129.8 - -130. Which is the nearest to 2/5? (a) d (b) 19 (c) -3 a Let j = -2.4 - -2.6. Let n = 31 - 33. Which is the closest to 11/3? (a) n (b) 3 (c) j b Let t = 38 - 36. Suppose -5n = r - 6, 5n + 4 = tr + 7. Which is the closest to -0.1? (a) 0.06 (b) -2 (c) n a Suppose p + 4 = 3p. Let z be 6/2p/3. Let u = -281 + 277. What is the closest to z in u, -1, -2/17? -2/17 Let j = 0.1068 + -0.5068. What is the nearest to -1 in j, 3/2, -16, -0.3? j Let q be -3 - (5/(3 - 13) - 4). What is the closest to -1 in -4, 0, q, 0.4? 0 Let z = 36 - 31. Let x = 41 + -40. Let h = 1.9 - 2. Which is the nearest to h? (a) 2 (b) x (c) z b Let x = -70 - -71.38. Let r = -0.38 + x. What is the nearest to -1 in r, 3, -4? r Let p = -22.6 - -36.6. What is the nearest to -2/3 in -2/9, 4, p? -2/9 Let x = 0.18 - 0.83. Let d = 2.65 + x. What is the closest to 0 in 2/13, d, 5? 2/13 Suppose -2l - n = 128 - 510, 0 = -3l - 2n + 571. What is the nearest to -0.2 in l, 0.4, 5, -1? 0.4 Let z = 153/2 - 78. Let a = -72 - -76. Let l = 6 + -6.1. What is the closest to l in a, z, -3/7? -3/7 Let f(x) = -2x + 7. Let q be f(6). Let a be (24/14)/((-1980)/(-630)). What is the nearest to -2/3 in 0.5, a, q? 0.5 Let w = -104.9 + -32.1. Let v = w + 130.9. Let l = -6 - v. Which is the closest to 2/5? (a) 4/5 (b) l (c) 2/7 c Let d = -4.9968 + -0.0032. Let h = -0.1 - 0. Which is the closest to -2/9? (a) d (b) h (c) 0 b Let k = -2042 + 2042. Which is the nearest to k? (a) -13.7 (b) 0.2 (c) -0.5 b Let d = -1720 - -1696. What is the nearest to 0.1 in 0.5, d, -0.06, 1? -0.06 Let r = 0.1 - 0.1. Let n be 3(-14)/24 + 1/4. Let l = 142.2 - 142. What is the closest to r in 0.3, n, l? l Let h be 7/(31 - -4)-1. Which is the nearest to 0.1? (a) h (b) 2/3 (c) -6 a Let r = -806 - -805. Suppose 4 = -0s + s. What is the nearest to r in s, -5, -0.1? -0.1 Let y = -27.028 - -0.028. Let k = -10 - y. Let m = 34.8 - 35. Which is the nearest to 1/4? (a) k (b) 2/11 (c) m b Let v = 38 - 53. Let i be 12/870/v. Which is the nearest to 0? (a) 1 (b) 4 (c) i a Suppose -75f + 83f - 8 = 0. Which is the nearest to -2/7? (a) f (b) 6 (c) -4 a Let f = 0.7 - 0.4. Let y be 5 - 12 - (-23)/3. Which is the closest to y? (a) -6 (b) -5/2 (c) f c Let x = -36 + 44. Suppose 2b - 2 = 4r, -2b = -3r + xr - 20. What is the nearest to 0.3 in r, -3, 5? r Let d = 0.1 + -0.1. Let i = -359 + 1075/3. What is the closest to 0 in d, -6, i? d Let k = -302/915 - 1/305. What is the nearest to 0 in k, 19, -0.3? -0.3 Let p = -735.96 - -736. Which is the closest to -0.1? (a) -5/2 (b) p (c) 0.07 b Let r be (-3)/4(-6)/9. Let w = -1374 - -15116/11. Let y = -0.2 - 0.3. Which is the nearest to 1? (a) y (b) r (c) w b Let t = -37/7 - -81/14. What is the nearest to 0.3 in 0.7, 1, t? t Let i = 0.3 + 0.7. What is the closest to i in -5, -1, 1? 1 Let d be 78/54 - 36/27. What is the closest to -1/3 in -6, -2, d, -0.09? -0.09 Let w = -68 + 477/7. Let z = 0.4 + 2.6. Let s be (-10)/(-2) - (-10 - (-7 + -6)). Which is the closest to 0? (a) z (b) s (c) w c Suppose 2q + 4 = -0w + w, 2w = 2q + 2. What is the closest to 0.03 in -2/21, 2, w? -2/21 Let p be 24 - 19 - (-2)/(-22)56. What is the nearest to 66 in 1, 0, p? 1 Suppose w + 2w = -3t + 21, 0 = 5w. Suppose 0 = tk - 4k - 3. Which is the closest to 1? (a) 0 (b) k (c) 5 b Let d = -247 - -250. What is the nearest to -1 in d, 0, -1.1, 5? -1.1 Let f = 104.1 - 6.1. Let j = -97.99 + f. What is the closest to -1/2 in 5, j, -1/4? -1/4 Let d = -878/377 + 72/29. What is the closest to -1 in 49, 3, d? d Let x = 37.9 - 33.9. Which is the closest to -1/5? (a) x (b) -2/5 (c) -4 b Let z = 46.16 + -46. Let n = -0.109 + -1.731. Let j = z - n. Which is the closest to 1? (a) 0.4 (b) j (c) 2/19 a Let v = 3150 - 3150.5. Which is the nearest to -9? (a) -3 (b) -5 (c) -0.3 (d) v b Let j = 0.05 - -3.95. Let x be ((-139)/4)/((-6)/(-24)). Let v = 975/7 + x. Which is the closest to v? (a) j (b) -5 (c) -1 c Suppose -i + 4r = 20, -47i - 15 = -49i - 3r. Which is the closest to i? (a) -1 (b) 0.1 (c) 2/5 (d) -6 b Let s = -2.3 + 0.3. Suppose -2 = h - 7. Which is the closest to 4? (a) h (b) 0.5 (c) s a Suppose -14 = -4f + 2. Let u = 146 - 146.01. What is the closest to u in -4, f, 1/5? 1/5 Let q = -19/140 - -1/420. Let a = -222 - -222. What is the nearest to -1/3 in q, a, 4? q Let v be (-4)/248/14. What is the nearest to -0.2 in v, 3/14, 0.5? v Let u = 11 + -8. Suppose 0n + 3n = 15. Which is the closest to 2? (a) n (b) -1/3 (c) u c Let c be -1 + (4 - -8)/3. Let x be 4 + (57/(-4))/c. Let m = 3 - 2.9. What is the nearest to m in x, 0.3, 0.4? 0.3 Let d = 5 + -5.3. Let l = 0 + d. Let h = 487 - 487. What is the closest to 1/2 in l, 5, h? h Let q be (-87)/58 + 218/312 + 0. Let w be (-6)/(-3) + (-80)/39. Let z = q - w. Which is the closest to -1? (a) 3 (b) z (c) -2 b Let u = -587.8 - -588. Let v = 14/3 + -4. What is the nearest to -6 in u, v, 5? u Let g = 90 + -89.98. Let x = -38.2 + 38. Which is the closest to 0.1? (a) 0 (b) g (c) x b Let q = 1.849 - -0.151. What is the closest to -2/5 in 0.05, q, -1, -1/6? -1/6 Let n = 0.059 + -1.059. Let z = -0.1 + 0. What is the closest to n in z, -1, -4? -1 Let p = -3 + 8. Let v = -3.3 + 0.3. Let k = 0.599 + -0.099. Which is the nearest to -0.2? (a) v (b) p (c) k c Let w = -0.03 - 1.97. Let y = 0 + -1. Let d = 11.3 + -11.5. Which is the nearest to d? (a) w (b) y (c) 2/3 b Suppose -3j - 3c - 2c = -23, -3c = -4j - 8. What is the closest to j in 3/2, -1.9, -1/4? 3/2 Let n = 0.38 - 0.5. Let u = n - -0.02. Let l = -0.728 - -0.028. Which is the nearest to u? (a) 0.4 (b) -0.4 (c) l b Let o = -585 + 588. What is the closest to -7 in -0.5, o, -4, -5/2? -4 Let l be ((-12)/20)/((-9)/(-6)). Which is the nearest to l? (a) 0.06 (b) 0.2 (c) -4 (d) -0.3 d Let h(n) = -3n - 16. Let u = 37 - 42. Let g be h(u). Which is the closest to -1? (a) 2 (b) 0 (c) g c Let n(o) = o2 + 16o + 19. Let y be n(-15). Suppose -j = -2j + y. Which is the closest to 0? (a) 1/4 (b) j (c) 0.3 a Let x = 6.87 + 19.13. What is the closest to 0 in 1/5, -3, -4, x? 1/5 Let a = 59.28 + -61.28. Let g = 1.2 - 0.2. What is the nearest to -1/4 in a, g, -0.1? -0.1 Let d = -0.09 - 0.06. Let j = d - -0.05. Let o = -0.5 - -0.5. Which is the closest to j? (a) 0.2 (b) o (c) -5 b Let o(p) = 36p - 4. Let u be o(2). Let j = u + -1290/19. Let r = -3 - -5. Which is the closest to r? (a) -1 (b) -3 (c) j c Let h = -177 + 175. Which is the nearest to 1/2? (a) h (b) 4 (c) -4/5 c Let p = 0.159 - -6.611. Let b = 7 - p. Let s = 0.13 - b. What is the nearest to s in 1/7, -3, -4? 1/7 Let r be (-3)/(-6)-2 - 1. Let z be 2/(-5) + r/(-5). Let h be 13/(-5) - (-6)/(-15). What is the nearest to -2 in z, 0.5, h? h Let j = 457 - 455. What is the closest to 0 in -1, j, -7, 5? -1 Let x = 2135 + -10602/5. Which is the closest to -2? (a) -1 (b) x (c) 1 (d) 0.5 a Let o = 47/7904 - 1095021/2047136. Let t = o + 9/37. Let m(a) = -2a*3 - 3a*2 + a + 3. Let c be m(-1). What is the nearest to 1 in t, 3/2, c? c Let u = -15 + 14.93. Let i = u + -0.03. Let y = 366 - 366. Which is the nearest to y? (a) 1 (b) -5 (c) i c Let s = 27 + -24.9. Let w = 0.4 + -2.4. Let u = w + s. What is the closest to 0 in 0.2, u, 0? 0 Let q = -190.2 + 190. Suppose 0 = -m + 4t + 7, -2m - 41 = 4t - 7. Let j be 21/m-3. Which is the closest to j? (a) -3/5 (b) -1/6 (c) q b Let o = -1362.08 + 1362. Which is the closest to o? (a) 2 (b) -1 (c) -12 b Let j = 41.2 + -41.2. What is the closest to j in -6, -3, -0.06, 2? -0.06 Let v = 0.65 - 0.62. What is the nearest to 1 in v, 3, 5? v Let g = -242 + 239.03. Let x =	{ "pile_set_name": "DM Mathematics" }
dred thousands digit of 3031872? 0 What is the millions digit of 2541980? 2 What is the ten millions digit of 10590603? 1 What is the tens digit of 190205? 0 What is the thousands digit of 99630? 9 What is the thousands digit of 16141? 6 What is the hundreds digit of 2863961? 9 What is the hundreds digit of 332610? 6 What is the thousands digit of 5615202? 5 What is the thousands digit of 196926? 6 What is the thousands digit of 52965? 2 What is the ten thousands digit of 1099163? 9 What is the thousands digit of 315315? 5 What is the units digit of 603302? 2 What is the ten thousands digit of 351323? 5 What is the tens digit of 2894500? 0 What is the hundreds digit of 1035013? 0 What is the units digit of 479788? 8 What is the ten thousands digit of 9333888? 3 What is the ten thousands digit of 365553? 6 What is the ten thousands digit of 935169? 3 What is the ten thousands digit of 4495784? 9 What is the units digit of 884373? 3 What is the units digit of 238916? 6 What is the thousands digit of 20903? 0 What is the ten thousands digit of 99517? 9 What is the hundreds digit of 45586? 5 What is the thousands digit of 605645? 5 What is the units digit of 822112? 2 What is the ten thousands digit of 365165? 6 What is the units digit of 8516541? 1 What is the thousands digit of 5072229? 2 What is the ten thousands digit of 410639? 1 What is the units digit of 768086? 6 What is the thousands digit of 6968909? 8 What is the hundred thousands digit of 14187180? 1 What is the hundreds digit of 15799? 7 What is the millions digit of 1867578? 1 What is the hundred thousands digit of 3367736? 3 What is the thousands digit of 17817299? 7 What is the thousands digit of 370377? 0 What is the hundred thousands digit of 7525643? 5 What is the hundreds digit of 318025? 0 What is the tens digit of 231674? 7 What is the tens digit of 49305? 0 What is the hundreds digit of 309137? 1 What is the hundreds digit of 441134? 1 What is the hundred thousands digit of 2262920? 2 What is the units digit of 772530? 0 What is the tens digit of 690156? 5 What is the thousands digit of 472147? 2 What is the hundred thousands digit of 248049? 2 What is the tens digit of 433248? 4 What is the thousands digit of 1895253? 5 What is the thousands digit of 4375752? 5 What is the hundred thousands digit of 4083051? 0 What is the ten thousands digit of 124516? 2 What is the ten thousands digit of 14845523? 4 What is the millions digit of 4466243? 4 What is the tens digit of 313846? 4 What is the units digit of 70155? 5 What is the hundreds digit of 5234364? 3 What is the hundred thousands digit of 2325825? 3 What is the hundreds digit of 143854? 8 What is the ten thousands digit of 317180? 1 What is the ten thousands digit of 1661705? 6 What is the tens digit of 280425? 2 What is the units digit of 37182? 2 What is the hundreds digit of 690470? 4 What is the hundred thousands digit of 634647? 6 What is the ten thousands digit of 4223834? 2 What is the thousands digit of 946499? 6 What is the hundreds digit of 932529? 5 What is the thousands digit of 87989? 7 What is the hundred thousands digit of 995653? 9 What is the ten thousands digit of 8402765? 0 What is the ten thousands digit of 152697? 5 What is the hundreds digit of 2999834? 8 What is the hundred thousands digit of 461183? 4 What is the units digit of 1763682? 2 What is the ten millions digit of 14373180? 1 What is the hundreds digit of 307231? 2 What is the thousands digit of 9369004? 9 What is the ten thousands digit of 249232? 4 What is the hundred thousands digit of 3782164? 7 What is the hundred thousands digit of 205690? 2 What is the millions digit of 34138439? 4 What is the units digit of 4446984? 4 What is the hundred thousands digit of 22886510? 8 What is the hundred thousands digit of 1119068? 1 What is the tens digit of 16091694? 9 What is the hundred thousands digit of 35474554? 4 What is the units digit of 643300? 0 What is the tens digit of 4478021? 2 What is the tens digit of 13858546? 4 What is the thousands digit of 11670433? 0 What is the hundreds digit of 1015023? 0 What is the ten thousands digit of 3675115? 7 What is the thousands digit of 10684883? 4 What is the tens digit of 8065250? 5 What is the hundreds digit of 4017627? 6 What is the hundred thousands digit of 8611042? 6 What is the millions digit of 7094343? 7 What is the thousands digit of 4791282? 1 What is the thousands digit of 3575605? 5 What is the hundred thousands digit of 159238? 1 What is the thousands digit of 14068743? 8 What is the hundred thousands digit of 825733? 8 What is the hundred thousands digit of 269613? 2 What is the hundred thousands digit of 451345? 4 What is the hundred thousands digit of 206063? 2 What is the ten thousands digit of 365451? 6 What is the units digit of 406377? 7 What is the thousands digit of 20256269? 6 What is the thousands digit of 7508715? 8 What is the ten thousands digit of 6568923? 6 What is the tens digit of 4684841? 4 What is the units digit of 25983558? 8 What is the tens digit of 1204912? 1 What is the units digit of 15989114? 4 What is the tens digit of 1334019? 1 What is the tens digit of 1917691? 9 What is the tens digit of 194476? 7 What is the tens digit of 9697165? 6 What is the units digit of 1753435? 5 What is the hundred thousands digit of 2474676? 4 What is the hundreds digit of 493451? 4 What is the hundreds digit of 10428? 4 What is the ten thousands digit of 5302914? 0 What is the thousands digit of 90393? 0 What is the tens digit of 6313621? 2 What is the ten thousands digit of 490542? 9 What is the millions digit of 12212880? 2 What is the units digit of 1933659? 9 What is the units digit of 358846? 6 What is the hundred thousands digit of 859882? 8 What is the tens digit of 185591? 9 What is the thousands digit of 41580? 1 What is the hundred thousands digit of 3241692? 2 What is the tens digit of 2550701? 0 What is the millions digit of 22658986? 2 What is the millions digit of 1644960? 1 What is the hundred thousands digit of 706535? 7 What is the thousands digit of 234814? 4 What is the units digit of 2872841? 1 What is the units digit of 562856? 6 What is the ten thousands digit of 9372205? 7 What is the tens digit of 2371657? 5 What is the thousands digit of 315678? 5 What is the units digit of 653898? 8 What is the hundred thousands digit of 696712? 6 What is the ten thousands digit of 86878? 8 What is the hundred thousands digit of 12064879? 0 What is the ten thousands digit of 6456423? 5 What is the ten thousands digit of 236323? 3 What is the hundred thousands digit of 1260635? 2 What is the hundreds digit of 168689? 6 What is the ten thousands digit of 467222? 6 What is the thousands digit of 2370? 2 What is the hundred thousands digit of 338116? 3 What is the hundred thousands digit of 712413? 7 What is the hundred thousands digit of 4726108? 7 What is the tens digit of 197779? 7 What is the units digit of 2861837? 7 What is the units digit of 2138971? 1 What is the thousands digit of 566754? 6 What is the thousands digit of 384543? 4 What is the hundreds digit of 1874863? 8 What is the millions digit of 3816520? 3 What is the thousands digit of 3564556? 4 What is the tens digit of 10303848? 4 What is the hundred thousands digit of 1591359? 5 What is the tens digit of 305927? 2 What is the millions digit of 8641618? 8 What is the millions digit of 25395562? 5 What is the ten millions digit of 10361792? 1 What is the millions digit of 5121873? 5 What is the hundreds digit of 216126? 1 What is the units digit of 25327542? 2 What is the thousands digit of 519608? 9 What is the hundreds digit of 58737? 7 What is the ten millions digit of 12804296? 1 What is the hundreds digit of 744? 7 What is the units digit of 1146795? 5 What is the hundreds digit of 864087? 0 What is the thousands digit of 316373? 6 What is the tens digit of 482346? 4 What is the tens digit of 405232? 3 What is the thousands digit of 688977? 8 What is the millions digit of 1125569? 1 What is the hundreds digit of 2219904? 9 What is the thousands digit of 857981? 7 What is the hundred thousands digit of 2658886? 6 What is the hundreds digit of 9504961? 9 What is the units digit of 105954? 4 Wha	{ "pile_set_name": "DM Mathematics" }
by -50813 -3/50813 Calculate 1705320 divided by 426330. 4 280002 divided by -46 -6087 Divide -15340270 by -5. 3068054 What is -1 divided by 44436? -1/44436 75673 divided by 2 75673/2 4 divided by 1133302 2/566651 2037816 divided by -2739 -744 Calculate -19 divided by -8975. 19/8975 -28472 divided by 1 -28472 Calculate -631 divided by 112. -631/112 -57 divided by -42975 19/14325 Calculate -2186079 divided by -41. 53319 Divide 5 by -9788. -5/9788 -203 divided by -666 203/666 -339392 divided by -4 84848 Calculate 174 divided by -7346. -87/3673 55179 divided by 6131 9 What is 2335041 divided by 3? 778347 Divide 2798016 by 24. 116584 Divide -3913 by 10. -3913/10 What is -23 divided by -170793? 23/170793 Divide -3352761 by -6. 1117587/2 Calculate -890 divided by -12. 445/6 4 divided by 8988 1/2247 434155 divided by -4 -434155/4 Calculate -50303 divided by 4573. -11 -99072 divided by 4 -24768 What is -418 divided by -1519? 418/1519 Calculate -1 divided by 11244. -1/11244 Divide -5 by -241812. 5/241812 -51888 divided by -12972 4 Divide 607572 by -151893. -4 Calculate -20384 divided by -26. 784 Divide -1114660 by -278665. 4 20419 divided by 7 2917 Divide 3 by 650409. 1/216803 Calculate -675 divided by -2. 675/2 Calculate 860050 divided by 430025. 2 Calculate -124 divided by 16037. -124/16037 -481 divided by -53 481/53 What is 43044 divided by -10761? -4 Calculate -126443 divided by 6. -126443/6 Divide -166554 by 171. -974 -13023 divided by -3 4341 Calculate 129696 divided by 672. 193 560 divided by -5136 -35/321 Divide 672945 by -10353. -65 Divide -1419816 by -4. 354954 Divide 1667233 by -1. -1667233 -1 divided by 145074 -1/145074 What is 10528 divided by -4? -2632 Calculate 968960 divided by 60560. 16 -417445 divided by -83489 5 Divide 34 by -231810. -17/115905 Calculate -2 divided by -4472. 1/2236 Calculate 5577 divided by 4. 5577/4 Divide 42687 by 27. 1581 What is 5 divided by -579239? -5/579239 Divide -37 by 4093. -37/4093 -101626 divided by 6 -50813/3 -35305 divided by 7061 -5 What is -333 divided by -1519? 333/1519 Divide -500000 by -250. 2000 -15 divided by -430 3/86 Calculate 242 divided by -398. -121/199 Calculate 1332512 divided by -4. -333128 What is -5607 divided by -9? 623 What is 5 divided by -554100? -1/110820 Calculate 32 divided by 2. 16 What is -15288 divided by 2? -7644 -988011 divided by 27 -36593 Calculate 1382 divided by 11. 1382/11 -37846 divided by -298 127 Calculate 71074 divided by 2. 35537 Divide 29800 by -25. -1192 What is 1754 divided by -13? -1754/13 295928 divided by 71 4168 -315995 divided by -63199 5 What is -11246 divided by 1? -11246 -2291 divided by 37 -2291/37 0 divided by -19616 0 Calculate 43050 divided by -287. -150 What is 20229 divided by 613? 33 Calculate -32844 divided by 2737. -12 Divide 41392 by -3184. -13 Divide -1462 by -17. 86 What is 15 divided by -97288? -15/97288 -6 divided by 73118 -3/36559 What is -6127 divided by -1? 6127 What is -62906 divided by -4? 31453/2 Divide -299717 by -9. 299717/9 What is -891310 divided by -1190? 749 Calculate -2112 divided by -2. 1056 Divide -15 by 17228. -15/17228 274398 divided by -551 -498 3071 divided by 83 37 What is 250967 divided by -5? -250967/5 -15366 divided by 70 -7683/35 What is 2 divided by 2703? 2/2703 Divide 136140 by -45380. -3 Divide -121480 by 5. -24296 -101265 divided by 1 -101265 8316 divided by 6 1386 Divide 5 by 103899. 5/103899 What is 845277 divided by -2? -845277/2 11801 divided by 4 11801/4 Divide 1887000 by -408. -4625 0 divided by -1436 0 Calculate 31570 divided by 205. 154 What is -488966 divided by 67? -7298 What is 1463463 divided by -339? -4317 Calculate 519915 divided by -345. -1507 3 divided by -492963 -1/164321 344870 divided by -1 -344870 -344720 divided by -43090 8 Divide -671076 by -167769. 4 Divide -129 by 295. -129/295 Calculate 137642 divided by 6. 68821/3 Divide 46663 by 1. 46663 What is -5167 divided by -13? 5167/13 Calculate 1197 divided by -3. -399 -1798356 divided by 948 -1897 0 divided by 42979 0 2234 divided by -906 -1117/453 Divide -2117473 by -57229. 37 699567 divided by 319 2193 Divide -17918 by -8. 8959/4 What is -141072 divided by -70536? 2 Calculate 71912 divided by -8. -8989 -10967 divided by -13 10967/13 Divide -188050 by -5. 37610 -219716 divided by -54929 4 What is 5230160 divided by 260? 20116 What is -2354562 divided by 56061? -42 -9 divided by 7521 -3/2507 60838 divided by -60838 -1 -1483482 divided by 10374 -143 Calculate -4530 divided by -15. 302 What is 13321 divided by 6? 13321/6 Calculate 0 divided by -118317. 0 -874 divided by 167 -874/167 Divide -40678 by 20. -20339/10 1846 divided by 79 1846/79 What is -526470 divided by -2415? 218 Calculate 524 divided by -142. -262/71 Divide -442234 by -5. 442234/5 What is -409200 divided by 24? -17050 10 divided by 1177 10/1177 What is -5 divided by 281344? -5/281344 What is 7938 divided by 378? 21 What is -14231 divided by 6? -14231/6 Calculate -851790 divided by 15. -56786 -194485 divided by 2005 -97 What is -79 divided by 9896? -79/9896 Divide 184424 by 46106. 4 94 divided by -11743 -94/11743 -5504 divided by 128 -43 Calculate -157670 divided by -78835. 2 Calculate -98856 divided by 32952. -3 What is 1023990 divided by 165? 6206 -2 divided by 2821 -2/2821 Calculate 925 divided by -289. -925/289 What is -15 divided by -81533? 15/81533 Divide -4 by -21822. 2/10911 What is 408128 divided by -102032? -4 Divide 31488 by -15. -10496/5 28640 divided by -179 -160 Divide -8124 by -6. 1354 Calculate 11904 divided by -64. -186 -10 divided by 60071 -10/60071 Divide -381197 by -19. 20063 Divide -9205448 by -4. 2301362 Divide 0 by 13467. 0 What is 2626155 divided by 875385? 3 Divide 4 by 26863. 4/26863 What is -5 divided by 822555? -1/164511 -6642 divided by 7 -6642/7 What is -206725 divided by -41345? 5 2628 divided by 4 657 Divide -55700 by 4. -13925 Divide 735258 by -2077. -354 -197520 divided by -80 2469 Calculate 2343565 divided by 5. 468713 -28480 divided by 4 -7120 Calculate -301310 divided by 301310. -1 16226 divided by -2 -8113 What is -85766 divided by 6? -42883/3 Divide -76 by -671. 76/671 Divide -14824 by -436. 34 39104 divided by 9776 4 392 divided by 16 49/2 Divide 0 by -39166. 0 What is 105 divided by 15? 7 -14025 divided by -1275 11 -13 divided by 11436 -13/11436 -5521 divided by 5 -5521/5 Calculate -314016 divided by -157008. 2 -33550 divided by 610 -55 Divide -29472 by 307. -96 Divide -53 by -154. 53/154 What is 196203 divided by -3? -65401 785816 divided by 3 785816/3 71862 divided by -3 -23954 Divide -8568 by -24. 357 Divide -329 by -1017. 329/1017 Calculate 183048 divided by 24. 7627 What is 828 divided by -4? -207 93 divided by -19333 -93/19333 -113 divided by 131 -113/131 39690 divided by 2 19845 Calculate 183 divided by -7790. -183/7790 What is -23 divided by -15040? 23/15040 0 divided by -14208 0 Divide 13405 by 82. 13405/82 What is 44226 divided by -21? -2106 Calculate 626944 divided by -158. -3968 Divide 16550 by -19. -16550/19 2 divided by 38199 2/38199 Calculate -476749 divided by -5239. 91 -10532 divided by 17 -10532/17 Calculate 6859 divided by -361. -19 Calculate 1019128 divided by 2504. 407 What is 1563775 divided by 6? 1563775/6 What is -6 divided by 10341? -2/3447 Divide 259920 by 1520. 171 Divide 55899 by 9. 6211 What is -37440 divided by 9360? -4 Calculate 11594 divided by -1054. -11 Calculate 25 divided by 4715. 5/943 11112 divided by -5 -11112/5 What is 247917 divided by -82639? -3 8159316 divided by 4 2039829 What is 66264 divided by 24? 2761 Divide -70912 by 16. -4432 Calculate 2006400 divided by 160. 12540 Divide 1079 by -579. -1079/579 Calculate 20 divided by -2510. -2/251 -6 divided by -321924 1/53654 What is 48336 divided by 16? 3021 0 divided by 4338 0 -1489904 divided by -2204 676 -134 divided by 2217 -134/2217 What is 0 divided by -8869? 0 Calculate 68 divided by -713. -68/713 -45053 divided by 6 -45053/6 Divide -206483 by 1. -206483 172870 divided by -86435 -2 Divide -3 by 1926. -1/642 Calculate 974 divided by 178. 487/89 What is 21438 divided by -21438? -1 Calculate -4 divided by 98518. -2/49259 Calculate 247 divided by -12352. -247/12352 What is -25 divided by 205821? -25/205821 Calculate 5702 divided by 81. 5702/81 6282 d	{ "pile_set_name": "DM Mathematics" }
is the tenth root of 3793178169 to the nearest integer? 9 What is the cube root of 116307193 to the nearest integer? 488 What is the square root of 1378980610 to the nearest integer? 37135 What is the sixth root of 34258686 to the nearest integer? 18 What is the seventh root of 194333487 to the nearest integer? 15 What is the square root of 135698503 to the nearest integer? 11649 What is 138592245 to the power of 1/7, to the nearest integer? 15 What is the eighth root of 6262144450 to the nearest integer? 17 What is 86755041 to the power of 1/8, to the nearest integer? 10 What is the sixth root of 211943073 to the nearest integer? 24 What is the ninth root of 19063236 to the nearest integer? 6 What is the fourth root of 50107199 to the nearest integer? 84 What is the fifth root of 1564954004 to the nearest integer? 69 What is the fifth root of 127972951 to the nearest integer? 42 What is the fifth root of 2594644901 to the nearest integer? 76 What is the cube root of 186074860 to the nearest integer? 571 What is the fourth root of 287672335 to the nearest integer? 130 What is the cube root of 4245541008 to the nearest integer? 1619 What is 842367448 to the power of 1/4, to the nearest integer? 170 What is the square root of 433088903 to the nearest integer? 20811 What is the ninth root of 1029912613 to the nearest integer? 10 What is 2094000985 to the power of 1/10, to the nearest integer? 9 What is the fourth root of 38770021 to the nearest integer? 79 What is the fourth root of 3038561822 to the nearest integer? 235 What is 72255587 to the power of 1/2, to the nearest integer? 8500 What is the square root of 458528675 to the nearest integer? 21413 What is 54794971 to the power of 1/8, to the nearest integer? 9 What is 232957806 to the power of 1/6, to the nearest integer? 25 What is 874116032 to the power of 1/5, to the nearest integer? 61 What is 383903551 to the power of 1/2, to the nearest integer? 19593 What is the cube root of 54904377 to the nearest integer? 380 What is the cube root of 75479987 to the nearest integer? 423 What is the square root of 27968569 to the nearest integer? 5289 What is the cube root of 13444581 to the nearest integer? 238 What is the eighth root of 1624414138 to the nearest integer? 14 What is 99453739 to the power of 1/10, to the nearest integer? 6 What is 12361918 to the power of 1/3, to the nearest integer? 231 What is the square root of 1666955262 to the nearest integer? 40828 What is 454723070 to the power of 1/8, to the nearest integer? 12 What is the fourth root of 1833122294 to the nearest integer? 207 What is 2658552428 to the power of 1/7, to the nearest integer? 22 What is the third root of 200238923 to the nearest integer? 585 What is 1015877892 to the power of 1/4, to the nearest integer? 179 What is the ninth root of 55593071 to the nearest integer? 7 What is the third root of 348589828 to the nearest integer? 704 What is the square root of 149825617 to the nearest integer? 12240 What is 3210012202 to the power of 1/2, to the nearest integer? 56657 What is the cube root of 3668359589 to the nearest integer? 1542 What is 90316081 to the power of 1/10, to the nearest integer? 6 What is 7153308 to the power of 1/3, to the nearest integer? 193 What is the square root of 70797742 to the nearest integer? 8414 What is 17575552 to the power of 1/3, to the nearest integer? 260 What is 200181870 to the power of 1/2, to the nearest integer? 14149 What is the square root of 246029309 to the nearest integer? 15685 What is the square root of 3074228745 to the nearest integer? 55446 What is 1084546675 to the power of 1/3, to the nearest integer? 1027 What is 1687713890 to the power of 1/4, to the nearest integer? 203 What is the third root of 192168592 to the nearest integer? 577 What is the tenth root of 260900795 to the nearest integer? 7 What is the tenth root of 105156217 to the nearest integer? 6 What is the square root of 76941339 to the nearest integer? 8772 What is 349347755 to the power of 1/2, to the nearest integer? 18691 What is the cube root of 125351532 to the nearest integer? 500 What is the third root of 655330435 to the nearest integer? 869 What is the fourth root of 3707078504 to the nearest integer? 247 What is 82119056 to the power of 1/5, to the nearest integer? 38 What is 393215037 to the power of 1/2, to the nearest integer? 19830 What is 441067985 to the power of 1/2, to the nearest integer? 21002 What is the third root of 536429216 to the nearest integer? 813 What is 37606700 to the power of 1/2, to the nearest integer? 6132 What is 115644933 to the power of 1/2, to the nearest integer? 10754 What is 2718194950 to the power of 1/10, to the nearest integer? 9 What is the ninth root of 957432807 to the nearest integer? 10 What is 1107682906 to the power of 1/9, to the nearest integer? 10 What is 1256149 to the power of 1/2, to the nearest integer? 1121 What is the square root of 56699313 to the nearest integer? 7530 What is 227318069 to the power of 1/2, to the nearest integer? 15077 What is the third root of 2037849696 to the nearest integer? 1268 What is the eighth root of 4123133431 to the nearest integer? 16 What is 688365685 to the power of 1/6, to the nearest integer? 30 What is 19306067 to the power of 1/2, to the nearest integer? 4394 What is the square root of 780948335 to the nearest integer? 27945 What is the ninth root of 226515400 to the nearest integer? 8 What is 1498990762 to the power of 1/2, to the nearest integer? 38717 What is 79457120 to the power of 1/8, to the nearest integer? 10 What is 38805016 to the power of 1/2, to the nearest integer? 6229 What is the square root of 66837522 to the nearest integer? 8175 What is 333367082 to the power of 1/10, to the nearest integer? 7 What is the square root of 32071623 to the nearest integer? 5663 What is the cube root of 1238257337 to the nearest integer? 1074 What is the cube root of 131765710 to the nearest integer? 509 What is the square root of 1962038215 to the nearest integer? 44295 What is the square root of 2108088 to the nearest integer? 1452 What is the cube root of 117563320 to the nearest integer? 490 What is 2231990 to the power of 1/8, to the nearest integer? 6 What is 3966430515 to the power of 1/3, to the nearest integer? 1583 What is 44480161 to the power of 1/5, to the nearest integer? 34 What is the square root of 95748883 to the nearest integer? 9785 What is 4432857 to the power of 1/5, to the nearest integer? 21 What is the seventh root of 39443725 to the nearest integer? 12 What is the square root of 19679359 to the nearest integer? 4436 What is 4994675774 to the power of 1/8, to the nearest integer? 16 What is the third root of 109811516 to the nearest integer? 479 What is the ninth root of 2536334513 to the nearest integer? 11 What is the third root of 16897728 to the nearest integer? 257 What is 5092668028 to the power of 1/3, to the nearest integer? 1720 What is the cube root of 1704607552 to the nearest integer? 1195 What is the cube root of 336135867 to the nearest integer? 695 What is the eighth root of 62047183 to the nearest integer? 9 What is the eighth root of 275330078 to the nearest integer? 11 What is 22703780 to the power of 1/4, to the nearest integer? 69 What is the tenth root of 5520869 to the nearest integer? 5 What is 800339010 to the power of 1/2, to the nearest integer? 28290 What is the cube root of 56556657 to the nearest integer? 384 What is the square root of 33852610 to the nearest integer? 5818 What is the square root of 33826911 to the nearest integer? 5816 What is the third root of 522932911 to the nearest integer? 806 What is the fourth root of 561625784 to the nearest integer? 154 What is the fourth root of 2015930357 to the nearest integer? 212 What is 1761241228 to the power of 1/2, to the nearest integer? 41967 What is 4228033348 to the power of 1/9, to the nearest integer? 12 What is the square root of 3495970695 to the nearest integer? 59127 What is 271046967 to the power of 1/5, to the nearest integer? 49 What is the fifth root of 325202638 to the nearest integer? 50 What is 130782447 to the power of 1/6, to the nearest integer? 23 What is the sixth root of 2407	{ "pile_set_name": "DM Mathematics" }
0.1 (c) r (d) -2 c Let u = 0.5 - 3. Let i = u - 0.5. Let t(q) = -q*3 - 4q*2 - 2q + 3. Let h be t(-3). Which is the second biggest value? (a) h (b) i (c) 1/4 a Let x = 5.04 + -0.04. Let t = 5 + -8. Let w = 51 - 461/9. Which is the smallest value? (a) x (b) t (c) w b Let o = 4.41 + 0.59. Which is the second smallest value? (a) 1/4 (b) 0.2 (c) 4 (d) o a Let y(v) = -2v + 3. Let b be y(3). Let g be (-3)/((-2)/14-1). Let q be (-1)/(-15) + 14/g. What is the third biggest value in b, -2, q? b Let n = -1.9 + 3. Let h = n - 1.1. Which is the second biggest value? (a) 0.2 (b) h (c) -0.2 b Let y = 12 + -8. Let m be (-2)/(-6)27/15. What is the third smallest value in -0.2, y, m? y Let h = 0.136 + -0.636. What is the biggest value in -3, 3, -0.08, h? 3 Let k be -2 + (0 - -2) - -9. Let z be (-8)/k(-2)/4. Which is the second smallest value? (a) z (b) -0.04 (c) -2 b Let l = -11/5 - -2. Let n be ((-10)/15)/(4/(-42)). Let d = n + -20/3. What is the second smallest value in d, l, 1/11? 1/11 Let h = 0.7 + -0.2. Let g = -22 + 17. What is the biggest value in g, -2, h? h Let m = -23/12 + 5/3. Let u = -0.2 + 0.4. Let h = 0 + -5. What is the biggest value in m, u, h? u Let t = -2/27 - -31/54. Let n = -3319/5 - -669. Let a = 202/35 - n. What is the third smallest value in 2/3, a, t? 2/3 Let c be 8(1/6)/1. Let n(y) = y3 - 9y*2 - 13y + 25. Let b be n(10). What is the third smallest value in -1/4, b, c? c Suppose x - 3 = 1. Let q = 3 - 3. Which is the third smallest value? (a) -1/6 (b) q (c) x c Let q be ((-1)/(-4))/((-2)/2). Let m be 804/(-7) + 3/(-21). Let a be m/25 + 4/(-10). What is the biggest value in q, 0.06, a? 0.06 Let l = -0.52 - -0.62. Which is the third biggest value? (a) 2 (b) l (c) -0.8 c Let m = -2 - -8. Let r = -10 + m. Which is the smallest value? (a) 2/21 (b) r (c) 2/5 b Let h = 0.5 - 4. Let o = -3 - h. Which is the smallest value? (a) 3 (b) -3 (c) o b Let v = 0.28 - 0.27. Let j = 0.07 + -3.07. Which is the third smallest value? (a) j (b) v (c) -0.4 b Let v be -2(3 + -2) + 8. Suppose 0 = 2j - vj. Suppose -2g + 5p = 2g + 1, 4p - 4 = j. Which is the third biggest value? (a) -0.4 (b) 0.3 (c) g a Suppose -8r + 3r - 17 = a, 2a + 3r = -27. Let b = a - -11. Let h = -0.1 - -0.3. What is the third smallest value in b, 5, h? 5 Let x = 83 + -80. Which is the fourth biggest value? (a) -0.05 (b) x (c) 0 (d) 6/7 a Let h = 0.7 + 0.3. Let o be 1 - (7/3 + -2). Suppose -5n + 4 = -3n. Which is the smallest value? (a) n (b) o (c) h b Let m = 167/2 + -82. Let g = 69471/220 - 1574/5. Let v = g + -8/11. Which is the third biggest value? (a) v (b) 3 (c) m a Let c be 2/(-7) - (-852)/42. Suppose 4g + 0t = -3t + c, 3t = 0. Let f be (-4)/14 + (-6)/(-21). What is the third biggest value in f, g, -1? -1 Let o = -0.19 - 4.81. Let z(y) = 4y. Let l be (-6)/(-2) - 2/1. Let g be z(l). Which is the second smallest value? (a) o (b) -1 (c) g b Let u = 1.62 + -0.62. Which is the third biggest value? (a) u (b) 4 (c) -2/9 (d) 2/3 d Let a = -2.21 + 0.21. Let g = -0.7 - -0.5. What is the third smallest value in -4, g, a? g Let f be (-6)/27 + (-34)/(-72). Which is the biggest value? (a) -1 (b) f (c) -0.2 b Let g = -10 + 3. Let j = g - -3. What is the smallest value in 5, j, 3? j Let g(v) = v*2 + 5v - 2. Let y be g(-6). Let f = -26 + 29. What is the third biggest value in y, 0.3, f? 0.3 Suppose -6 = -o + 4c + 8, -2o - c = 8. Suppose 2h = 3t - 6, -5h + 3h = -6. What is the biggest value in o, t, 1? t Let h = -88 - -357/4. Which is the third smallest value? (a) h (b) 5 (c) -3 (d) 4 d Let n be 195/9 - (1 + 0). Let w = -20 + n. What is the third biggest value in 3, w, 0.3? 0.3 Let q = 0.01 + 0.19. Let n = -0.3 + q. Which is the biggest value? (a) -5 (b) n (c) 3/8 c Let f = 4 - 2. Let k = 15 + -14. Which is the second biggest value? (a) f (b) k (c) -5 b Let y = -87 + 90. Which is the third smallest value? (a) y (b) -4 (c) 2 a Let u = -1 + 5. Let k be (-3)/4 + (-14)/(-8). Which is the biggest value? (a) k (b) -5 (c) u c Let o = -5.04 + 0.04. Let n = o + 5.2. Let m = -0.5 + n. Which is the smallest value? (a) -1/3 (b) m (c) -5 c Let j be (4 - (-34)/(-8))5. Which is the third biggest value? (a) -0.4 (b) 1/5 (c) j c Let l = 0.4 - 0.6. Let c = l + 0. Let a = 2/159 - 116/795. What is the second smallest value in -0.5, a, c? c Let f = -90 + 90.3. Which is the biggest value? (a) 11 (b) 0.5 (c) f a Let u = 0.03 - 0.03. Let z = -1 - u. Which is the second biggest value? (a) 1/2 (b) z (c) 4 a Let v be 0/(1/(4/(-10 + 2))). Let m = 0.1 - 0. Which is the biggest value? (a) 1 (b) m (c) v a Let d = 3.3 - -1.7. Let q = -6.3 + -0.7. Let t = q + d. What is the second smallest value in t, 0, -1/5? -1/5 Let z = 362/5 + -73. Let w = 0.9 + 4.1. Which is the second smallest value? (a) 7 (b) z (c) w c Let j = 3717 + -10934/3. Let o = j - 73. What is the second smallest value in o, 3, 0.1? 0.1 Let h = 46 - 46.3. What is the biggest value in -3, h, -1? h Let o = -5 + 3. Let d = -2.1 - o. Let s = 0.4 - d. Which is the third smallest value? (a) 2 (b) -4 (c) s a Let d = -12 + 13. What is the third biggest value in d, 3, 4? d Let o = -0.26 - -0.34. Let x = 0.92 + o. Let u be -3 + 1 - (-4)/6. Which is the biggest value? (a) 0.1 (b) u (c) x c Let b = -920/3171 + 2/453. What is the third biggest value in -1, b, -2/5? -1 Let h = -25 - -26.1. Let d = 0.6 - h. What is the third biggest value in d, 0.5, 0.2? d Let h = 0.06 - 3.06. Let w = -3 - h. Which is the smallest value? (a) -1/6 (b) 2/5 (c) w a Let y = -311 + 308.93. Let f = -0.07 - y. Let d = -1 - -6. What is the third smallest value in f, d, 0.2? d Let a = 0 + 0.07. Let i = 1.93 + a. What is the biggest value in -1, i, 3? 3 Let v = 469 - 5153/11. Suppose -o + 6 = -4o. What is the third biggest value in 5, v, o? o Let k = 135105/7 + -19481. Let n = -180 - k. What is the biggest value in n, 1, -2/7? 1 Let m be (-3 + 180/(-16))-1. Let g = m + -13. Which is the second smallest value? (a) g (b) 1 (c) 2 a Let g(l) = l3 + 24l*2 - 2l - 48. Let q be g(-24). Which is the third smallest value? (a) 0.03 (b) q (c) 4 (d) 1/4 d Let f(t) = -2t2 - 6t + 3. Let p be f(-8). Let y = p - -233/3. What is the biggest value in 0, -0.3, y? y Suppose 2g = 5g - 6. Let q be 4145/2514(-12)/45. Let l = q + -2/419. Which is the third biggest value? (a) g (b) l (c) 4 b Let o = 4 - 7. Let q be ((-3)/(-18))/(1/2). Which is the smallest value? (a) o (b) -1/8 (c) q a Let l = -2.3 - -2. Suppose 5m - 30 = 3m. Let o be ((-6)/m)/(11/(-5)). Which is the third smallest value? (a) l (b) o (c) 0.4 c Let v = -12 - -9. Which is the third biggest value? (a) 1.9 (b) v (c) 5 b Let p = 0.4 - 0. Suppose 0x + 7 = -5m + 3x, 4x = m + 15. Which is the second biggest value? (a) p (b) 0 (c) m a Let y = 7/5 + -1. What is the third biggest value in 0, 1/3, 2/3, y? 1/3 Let i = 0.053 - 5.053. What is the third smallest value in -2/11, i, -4/5? -2/11 Let r(p) = p3 + 5p*2 + 4p + 6. Let z be r(-4). Let j be (-4 + z)6/20. Which is the smallest value? (a) 1/3 (b) j (c) 5 a Let s = 67 + -67.2. Which is the second smallest value? (a) -0.03 (b) s (c) 1/3 a Let g = 269 - 268.8. Suppose -2y + 15 = 5. Which is the third biggest value? (a) g (b) 10 (c) y a Suppose 0f - 5f + 3s + 22 = 0, -3f - 4s - 10 = 0. Let h be (-12)/(-16) + f/(-4). Which is the third smallest value? (a) 2/7 (b) 3 (c) h b Suppose 2i - 5w + 4 = -0w, 3i + 6 = -w. Which is the second smallest value? (a) i (b) 4 (c) 3 (d) 0.03 d Let d be (104/16)/((-5)/(-22)). Let h = d + -29. What is the third smallest value in 4, h, -2/15? 4 Let q = 22 - 19. Which is the second biggest value? (a) -1/4 (b) q (c) -6 a Let o = -19 - -18.6. What is the third biggest value in -2/11, 0, o? o Let o = 0.73 + 3.22. Let z = 0.05 + o. Which is the third smallest value? (a) -3 (b) -5/2 (c) z c Let a = 37.6 - 38. Let l = 0.22 - -0.08. What is the second smallest value in a, -4/9, l? a Let v = 0.09 - 10.09. Let x = v + 14. Which is the third smallest value? (a) x (b) -3 (c) -1/4 a Let u(c) = 2c3 + c2 - 4. Let q be u(-2). What is the second smallest value in q, -2/3, -1? -1 Let q = -4.8 + -	{ "pile_set_name": "DM Mathematics" }
00000 Let l = -147.182 + -1.518. Let f = -130 - l. Let o = 18.783 - f. Round o to two decimal places. 0.08 Let z = 12194 + -8591. Let s be z/(-3 + 6) + -1. Let v be (100/8)/(1/s). What is v rounded to the nearest 10000? 20000 Let m(r) = 104999r - 6. Let p be m(-6). What is p rounded to the nearest 100000? -600000 Suppose 10k = 9k. Suppose k = -p + 5p + 52000. Round p to the nearest 1000. -13000 Suppose 5f - 38 + 13 = 0. Suppose f = r - 0. Suppose -3h = -h + 5y - 655, -2h + ry + 665 = 0. Round h to the nearest one hundred. 300 Let z = 1.31 - 2.3. Let j = z + 0.9736. Round j to three decimal places. -0.016 Let u = 16.986 + -17. What is u rounded to 3 dps? -0.014 Let k(j) be the third derivative of -75j5 + j2. Let f be k(-1). What is f rounded to the nearest one thousand? -5000 Suppose -5d + 7 = 2. Suppose l = 4 - d. Suppose -lt + 0t = 39600. What is t rounded to the nearest 1000? -13000 Let y = -276.000242 - -276. What is y rounded to 5 decimal places? -0.00024 Let v(n) be the third derivative of -n4/12 + n3/6 + n2. Suppose -2 - 2 = -4z. Let k be v(z). What is k rounded to zero decimal places? -1 Let g = 0.6 + -5.7. Let a = 5.09999958 + g. Round a to 7 dps. -0.0000004 Let s = -6.75841 - -6.1584124. Let p = 0.6 + s. Round p to 6 dps. 0.000002 Let n = 23549 - 23548.936134. Let f = -0.064 + n. What is f rounded to five decimal places? -0.00013 Suppose 2u = -3u - 3850000. Round u to the nearest 100000. -800000 Let f(p) = -284p3 + 5p*2 + 5p + 2. Suppose -2y = -0 + 6. Let q be f(y). Round q to the nearest one thousand. 8000 Let t(h) = -h2 + 10h - 6. Let s be t(9). Let x = 2 + s. Suppose 0 = -2j + xj + 3900000. Round j to the nearest 1000000. -1000000 Suppose u = 5c - c - 5803080, 4c - 5u = 5803096. Suppose -c - 2449231 = 3s. Round s to the nearest 1000000. -1000000 Let m = 25904.77 + -25713. Let k = m + -3.77. Let w = k + -177.9. What is w rounded to the nearest integer? 10 Let c(q) = -40q - 1. Let a be c(1). Let z = a + 73. Round z to the nearest ten. 30 Let g = -0.07934 - -1078.67934. Let a = g + -1078.44018. Let v = 0.16 - a. Round v to four decimal places. 0.0002 Let i = 86 + -41. Let t be 1240/(-3(-3)/i). What is t rounded to the nearest one thousand? 6000 Let x = -0.786 + 0.8. Let r = 0.0140051 - x. What is r rounded to six dps? 0.000005 Suppose 3w - 3c = 2w + 19, 0 = -5w + 5c + 105. Suppose o - 478 = w. What is o rounded to the nearest one thousand? 1000 Suppose 6d + d = 5572. Round d to the nearest one hundred. 800 Suppose -j = -4n + 162401, n = -3n - 2j + 162398. What is n rounded to the nearest 10000? 40000 Suppose 2 - 1 = n, -4i - 19171 = 5n. Let q be 6/(-15) - i/(-15). What is q rounded to the nearest 100? -300 Let r = -61826 - -61879.0114. Let l = r - 53. What is l rounded to 3 dps? 0.011 Let j = -2.48 - 0.02. Let y = 7.3 + j. Let a = -4.17 + y. What is a rounded to one decimal place? 0.6 Let l = -43 - -60.1. Let t = -3.05 + -21.35. Let w = l + t. Round w to the nearest integer. -7 Let t = -0.27 - -1.37. Let m = 1.1000035 - t. Round m to six dps. 0.000004 Let j = 69 - 130. Let s = j - -60.99999969. What is s rounded to 7 dps? -0.0000003 Let r be 2749502/3 + (-54)/(-81). What is r rounded to the nearest 10000? 460000 Let z be (-110951451)/(-12) - 3/(-4). Suppose 0 = -5g + 2y - 23229773, 5g - 4y + 9291906 = 3g. Let c = z + g. What is c rounded to the nearest 1000000? 5000000 Let w = 1.1 + -1.099993. What is w rounded to 5 decimal places? 0.00001 Let m = -1209341203 - -2276767652. Let w = 1067426288.0000067 - m. Let d = -161 - w. What is d rounded to 6 dps? -0.000007 Suppose -5j = -0j - 25. Let n(t) = -119t + 5. Let g be n(j). What is g rounded to the nearest one hundred? -600 Let q = -1810946 - -1810942.000146. Let w = q - -4. What is w rounded to five decimal places? 0.00015 Let m = 0.6 + -0.5955. Let a = 0.0274 - m. What is a rounded to 3 decimal places? 0.023 Let v be (80/6)/((-1)/(-8025)). Round v to the nearest ten thousand. 110000 Let o = -997559 + 997556.9999925. Let s = -4 - -6. Let z = s + o. Round z to 6 decimal places. -0.000008 Let g = -72.6598 - 0.0402. Let w = g + 78. Round w to the nearest integer. 5 Let x = 96 + -170. Let i = -73.999941 - x. What is i rounded to five decimal places? 0.00006 Let d(w) = -275w2 + 5w. Let p be 3(3 - 42/9). Let t be d(p). Round t to the nearest one thousand. -7000 Let w = 3144.977898 + -3144.9. Let g = 0.078 - w. What is g rounded to five dps? 0.0001 Let b(h) = -16h3 + h2 + 4h - 7. Let q be b(5). Let w be (q/(-12))/(3/(-4)). Round w to the nearest 10. -220 Suppose 3z - 4 = 2. Suppose -2s - 6c - 313 = -c, -343 = zs - c. Let i = s + 96. What is i rounded to the nearest ten? -70 Suppose -346461 = -3v + 733539. Round v to the nearest 100000. 400000 Let f(c) = -2c + 1. Let j be f(-2). Suppose 0w = jw - 285. Let l = w + -1. Round l to the nearest 10. 60 Let y be (320/30)/(1/(-15750)). Round y to the nearest 10000. -170000 Let v = 176 - 180.052. Let b = -4 - v. Round b to two decimal places. 0.05 Let f = -0.69 + -0.15. What is f rounded to one dp? -0.8 Let g = -1905010.43009774 - -9205.43013174. Let z = g - -1895830. Let w = -25 + z. What is w rounded to five decimal places? 0.00003 Suppose 0 = -p + 2p. Suppose 3d + d - 1476316 = p. Suppose -n + 3c = d + 830930, 1200006 = -n + 2c. What is n rounded to the nearest one million? -1000000 Suppose 0 = 5s + 16190 + 23810. Round s to the nearest one thousand. -8000 Let q be -55 - ((-3 - -2) + 0). Let g = -26 - q. What is g rounded to the nearest ten? 30 Let c = -129552.090003 - -129552. Let q = 0.09 + c. Round q to 5 decimal places. 0 Let d = -1.400107 - -1.4. What is d rounded to 5 dps? -0.00011 Let t = 138 + -138.0000149. What is t rounded to 6 dps? -0.000015 Let l = -12.36 + 12. Let k = 0.04 - l. Let c = k + -0.4000003. What is c rounded to seven dps? -0.0000003 Let z = -10 - -9.6. Let n = z - -0.39999956. Round n to seven dps. -0.0000004 Let k = -20862.9974 + 20865. Let c = 0.2 - 2.2. Let d = k + c. What is d rounded to 3 dps? 0.003 Let v = -0.6 - 4.4. Let g = v - -4.9924. What is g rounded to 3 decimal places? -0.008 Let z = -5.2 + 1.6. Let g = 12.4 - z. Let h = -15.91 + g. Round h to 1 dp. 0.1 Let t = 2.01 - 0.01. Let m = -1 + t. Let w = m - 1.00003. What is w rounded to four dps? 0 Let y = 0.12 - -3.48. What is y rounded to 0 dps? 4 Let g = 24108 + -41913. Let v = g + 17795.177. Let j = -9.9 - v. What is j rounded to 2 decimal places? -0.08 Let g = 30 + -29.998. Round g to two dps. 0 Let v = 174966964 - 174966965.39999914. Let x = v - -1.4. What is x rounded to 7 dps? 0.0000009 Let d = 7 - 6.975. Let r = -1.015 - d. Round r to 1 dp. -1 Let u = 163 - 164.43. Let r = u - -0.03. Let w = r + 1.400038. Round w to 5 dps. 0.00004 Let d = 6 - -1. Let o = -173954201.0000001 + 173954194. Let k = d + o. Round k to 7 decimal places. -0.0000001 Let z = 19.35 - 25. Let a = 6 + z. Let h = a + -0.349942. What is h rounded to five decimal places? 0.00006 Let n(t) = -1449999t - 2. Let b(c) = -c2 + 7c - 4. Let s be b(6). Let k be n(s). What is k rounded to the nearest one million? -3000000 Let z = -369.8 + 273. Round z to the nearest ten. -100 Let k = -78.9883 + 79. What is k rounded to 3 dps? 0.012 Suppose -s + 5s + 4227772 = 0. Let o = 1656941 + s. Suppose 1 = -3k - 5, -k = -4t - o. Round t to the nearest one hundred thousand. -200000 Let c = 0.6 - -0.4. Let n = c - 0.99817. What is n rounded to 4 decimal places? 0.0018 Let n = -0.95 + 1. Let f = -0.05006 + n. Round f to 4 dps. -0.0001 Let w = -65.7109 + 0.0109. Let a = -0.96 - 62.04. Let c = w - a. Round c to zero decimal places. -3 Suppose 9 = -3l, 0m + m + 18 = -5l. Let x be 3/6 + (-49)/2. Let y be (x/(-4))/(m/(-2)). Round y to the nearest ten. 0 Let t = 0.06 - -16.94. Let u = 4 + t. Let f = 21.036 - u. What is f rounded to 2 dps? 0.04 Let u = 0.639999838 + -0.64. Round u to 7 dps. -0.0000002 Let q(l) = -274l2 - 3l + 2. Suppose 2z = -2, j - 3z = z + 6. Let x be q(j). What is x rounded to the nearest 1000? -1000 Let s be -2 + (-5 + 3)/(-1). Suppose 2j = -sj + 22600. What is j rounded to the nearest 1000? 11000 Let b(j) = -j*3 + 5j*2 + 4j - 6. Let a be b(6). Let g(p) = -34567p2 + 15p - 22. Let x be g(a	{ "pile_set_name": "DM Mathematics" }
. 7 Rearrange -4k + 242 + 2k*3 - 2k*2 - 242 to mk + uk2 + f + dk*3 and give m. -4 Express 149 - 149 - 30h + (-1 + 1 + 2h)(6 + 4 - 5) - 4h + 6h - h as a + oh and give o. -19 Express -4 + 9k*3 - 7k*3 + 14k + 3 in the form zk3 + a + sk + rk2 and give a. -1 Rearrange (1729 - 1729 + 31b)(-b - b + b) - 3b*2 + 3b2 + b2 to the form o + ib + qb*2 and give q. -30 Express (-16i*3 - 9i*3 + 1 + 26i*3)(-7 + 2 - 2) in the form x + qi + ci*3 + zi*2 and give x. -7 Express 0c + 2c - 3c + 4c as y + jc and give j. 3 Rearrange 9y3 - 5 - 6y*3 - 5y*3 to the form u + ry + oy2 + py*3 and give u. -5 Express -3x + 2x2 - x2 - 5x3 + x3 - 2x2 in the form gx*3 + nx*2 + qx + k and give q. -3 Express (1 + 2 - 2)(0i + i*2 + 0i) - 35i2 - 26i*2 + 66i*2 in the form di*2 + b + zi and give d. 6 Express 4d + 0d - 27d2 - 4d in the form bd2 + zd + u and give b. -27 Rearrange -l*3 + 2 + 10l*2 - 6l*2 - 2l*4 + 0l*2 to the form d + al*3 + cl + ml4 + jl*2 and give d. 2 Rearrange -54y*2 - 1175 + 1175 to the form dy + g + sy2 and give s. -54 Rearrange -2x*4 + 0x*4 + 9x*4 + (3x*2 - 5x*2 + 0x*2)(-1 + 1 - x*2) to the form ax + fx3 + yx*4 + d + cx*2 and give y. 9 Express (-1 + 2g + 1)(-31g + 14g - 102 + 2g*2 + 19g) in the form xg2 + hg + t + lg3 and give h. -204 Rearrange -2 + 0j*3 + 3 + 6j - j + j4 + j3 to xj + sj*2 + nj*4 + r + gj*3 and give n. 1 Rearrange (-15 + 13 - 8)(-4b2 - 4b + b + 5b) to v + tb*2 + ub and give t. 40 Rearrange 0 - 4z3 - 1 - 2 + 6 to dz + u + pz3 + mz*2 and give u. 3 Rearrange -2j + 2j3 - 4 - j3 - 4j*3 + 6j*3 - 2j*4 to the form mj*3 + dj + tj2 + uj*4 + l and give l. -4 Express (2 - 26 - 2)(i - 4 + 4) in the form wi + v and give w. -26 Rearrange -49b*2 + 14b*2 - 40b*2 to the form h + vb + wb2 and give h. 0 Rearrange (-4 + 2 + 4)(2q + 0q + 8q) to the form dq + z and give d. 20 Rearrange -65t3 + 56t*3 + 2t - 3t to nt + ut3 + b + xt*2 and give u. -9 Rearrange (-18g + 35g + 4 - 4g)(0g + 0g - g) to cg*2 + ng + z and give n. -4 Rearrange (186u + 183u - 6u2 - 314u)(1 - 6 + 3) to the form pu + hu2 + x and give h. 12 Rearrange 2z + 2z + 0z + (-13 + 3 + 4)(-5z + 3z + z) to az + y and give a. 10 Rearrange (0 + 9 - 64)(l - 1 + 1)(-l*2 - 2l3 + l2) to the form nl3 + o + kl*2 + vl + tl4 and give t. 110 Rearrange (3 - 2 - 4)(-4 + 6 - 1)(30 - 30 - 19o)(1 + o - 1) to fo + ro2 + u and give r. 57 Express -11 + g - 8g*2 + 11 in the form ng*2 + c + lg and give l. 1 Express 2y2 + 2y + 2y2 - 4y*2 + 13y*3 as jy*2 + f + cy + dy3 and give d. 13 Express (-2j + 2j2 + 3 - 3)(7j - 2 - 16 + 17) in the form a + pj + nj2 + ij*3 and give p. 2 Rearrange (z + 4z - 3z)(-1 + 1 - z) + 193 - 193 + 10z2 + 11z + 0z - z2 - 8z to the form sz2 + yz + w and give s. 7 Rearrange (-2z + 0z + 3z + (-3 + 3 + 2)(2 - 2 - 2z) + z + z - 3z - z - z - z)(5z2 - z2 + z*2) to the form x + vz + pz3 + sz*2 and give p. -35 Rearrange 22m - 3m + 8m + 9m to the form q + nm and give n. 36 Express (-3 - 3 + 5)(1 + 1 + 1)(-2h + 36h + 19h) in the form yh + s and give y. -159 Express -195 + 6j + 195 - 8j + 14j - j + (2 + 2 - 5)(j - 3j + 4j) - 4j - 2j + 7j in the form u + mj and give m. 10 Rearrange -p*2 + 4 + 1 + 2p*2 to the form wp + xp2 + y and give x. 1 Express (-4j + j + 2j)(1 + j - 1) - 8j2 - j2 - 6j2 + j2 + 3 - 3 + (-3 - 4 + 5)(2j2 + j2 - 5j2) in the form s + nj*2 + qj and give n. -11 Rearrange 20b - 5b*2 - 20b + (-b + 4b - 2b - 1)(b + 0b + b) to z + ob + db*2 and give o. -2 Rearrange 2d + 0d4 - 5 - 2d*4 + 2d*3 - 2d*2 + 4 - 3d*3 to kd*2 + pd*3 + jd*4 + h + ud and give p. -1 Rearrange 3 + 577q - 576q - 4q2 - 4q*2 to the form rq*2 + n + mq and give m. 1 Rearrange 4r4 + 0r*3 - 13r*3 - 2r*4 + 0r*4 + 2r to or3 + pr*4 + h + lr + qr2 and give p. 2 Rearrange (-y - 2y - 3y + (-1 + 2 - 2)(2y + 3y - 3y) + 0 + 0 + 2y)(2 - 3 + 4 + (1 - 2 + 0)(-3 + 2 + 2)) to v + xy and give x. -12 Express (5r - r - r)(0r - 8r + r) + (2r - 6r + 2r)(-r + 2r + 0r) - r2 + 4 - 4 + 2r*2 + 3r*2 - 7r*2 as d + jr + pr2 and give p. -26 Rearrange -3 + 4 - 4j + 2j + (-1 + 2 + 0)(-j + j + 2j) - 5j + 10j + 2j to z + oj and give o. 7 Rearrange (-35 + 38 + 3z + z)(4 + 4 - 6) + (-6z + 3z + z)(-4 - 4 + 2) + 4z + z - 3z to v + az and give v. 6 Rearrange -q4 - q2 + 1 - q3 + q - q - 7 to i + bq*4 + sq*2 + rq*3 + jq and give r. -1 Rearrange s*3 + 0s3 + s3 + (-6 + 0 + 3)(4s*3 - 3s*3 - 2s*3) + 4s - s*3 - 4s to r + js2 + us + vs3 and give v. 4 Rearrange (-4l*2 - 4l*2 + 3l*2)(6l + 2l - 4l)(-1 + 4 + 0) to the form a + ul + cl*2 + il*3 and give i. -60 Express -2v*2 + 2v*3 + 9v + 2 - 10v + 5v in the form wv2 + sv*3 + lv + i and give l. 4 Express 39b3 - 7b3 + b3 + 3b - 2b*3 - 3b + (-b + 2b2 + b)(-2b + 1 - 1) as xb + vb2 + w + ib3 and give w. 0 Express -y4 + 7y2 - y + 2 - 9y2 + y2 in the form v + jy3 + qy*2 + ky*4 + ny and give k. -1 Rearrange -5 - 2a3 - 2a*3 + 4a3 - a3 + a to r + ya + ka*2 + oa*3 and give k. 0 Rearrange -h + 3h - h - 4 + 2h + 4h - 2h + 2h - 4h + 3h + (4 + h - 4)(2 + 2 - 3) to l + rh and give r. 7 Express 2v2 + 25v - 1 - 68v4 + 1 + 69v*4 in the form mv + gv3 + lv*4 + u + rv*2 and give r. 2 Rearrange (-t + 4t - 2t)(-2 + 3 + 0 + (2 - 6 + 2)(-15 - 3 + 4)) to v + pt and give p. 29 Express (-4v2 - v2 + 3v*2)(-v*2 + 3 - 3) in the form mv*2 + kv*3 + n + iv*4 + qv and give i. 2 Rearrange -2d - d + d + 0d + 0d - d + (-d + 3d - 4d)(2 - 4 + 1) + 1 - 1 - 2d - 1 + 1 - 3d + d + d + 0d to the form zd + w and give z. -4 Rearrange (22r - 12r - 34r)(-4 + 2 + 0) + 2r + 4 - 4 - 2r + 1 - 1 - 2r - 2r + 6r + (-4 - 2 + 4)(-5r + 4r - r) to the form u + ir and give i. 54 Rearrange -10s + 5s + 27s to the form f + rs and give r. 22 Rearrange (-3g + 3g + 2g*2)(-7 - 4 + 2) - 6g2 - g2 + 3g*2 to s + fg + ug2 and give u. -22 Rearrange ((-1 + 1 + 1)(3 - 1 - 3) - 7 + 2 + 2)(3d + 3d - 4d) to the form xd + u and give x. -8 Rearrange 0n + n - 3n + 1 - 2n + 4n - 5n + (5 + n - 5)(0 + 2 - 5) to q + pn and give q. 1 Rearrange 29q2 - 1 - q3 - 29q*2 - 5q*4 to jq*4 + cq*2 + mq + fq3 + w and give w. -1 Express 113o*4 - 44o*4 - 48o*4 + (0o + o*2 + 0o)(-2o*2 + 4o2 - o2) as po + no*2 + a + jo*4 + to*3 and give n. 0 Rearrange -5a*2 - 7 + 3 + 6 + 16a*2 to the form j + ya + ba2 and give j. 2 Rearrange 4u*2 + 16 - 2u*2 - 9 to du + w + ru2 and give r. 2 Rearrange 3y*2 + 2y3 - y2 + 32 - 27 to h + ny + gy*2 + zy*3 and give g. 2 Express -2n*2 + 81 + 0n*3 + 2n*3 - 82 in the form v + bn*3 + zn*2 + ln and give z. -2 Express (83o + 46 + 87o - 172o)(o + 0o + o3 - 3o) in the form jo + zo*3 + d + mo*4 + go*2 and give m. -2 Express (3s + 2s - 7s)(-2 + 2s + 2) + s*2 + 4 - 4 + (s - s + s)(-2s + 0 + 0) in the form ms + gs2 + o and give g. -5 Express -1 - 5u*3 + 4u*2 - 5u2 - u4 + 0u3 - u2 in the form mu*3 + nu*4 + cu + ku2 + a and give a. -1 Express (6 - 2 - 2)(-3c + 5c - 4c) - 2c - 7c - 6c as o + rc and give r. -19 Express -w - 30w*2 + 16w*2 + 15w2 + 0 - 4 + w4 - w*3 in the form cw*2 + gw*4 + yw + sw3 + b and give s. -1 Express 4t + 0t + 7t as n + xt and give x. 11 Express 2r2 - r4 + 36r3 + 2 - 36r*3 + 2r in the form sr2 + p + lr*3 + kr + br4 and give p. 2 Express 2b - 11 - 4b3 - 3b + 7 in the form xb + jb*3 + nb*2 + c and give x. -1 Rearrange 20i*2 + 16i*2 + 20i*2 to hi*2 + y + ti and give h. 56 Express (4u + 0u - 7u - 4)(3u - u + 0u) in the form m + ru + lu*2 and give l. -6 Rearrange -6 + 8 - 2 + 3x to zx + r and give z. 3 Express (2f*2 - 4f*2 + 3f*2)(-10f + 147 - 147) as v + df**	{ "pile_set_name": "DM Mathematics" }
((2(sqrt(171) - sqrt(171)2) + sqrt(171))5)/(-2sqrt(441)-2). -5sqrt(19)/28 Simplify (-1 + (6(sqrt(52) + sqrt(156)/sqrt(3)))/((sqrt(84)/sqrt(3))/sqrt(7)))1 + -1. -2 + 12sqrt(13) Simplify (2-1sqrt(500) - sqrt(500) - (sqrt(500) + sqrt(500)25)) + ((sqrt(500) + 1)-4)*2 + 1. 180sqrt(5) + 8017 Simplify (4(0 + sqrt(13) + 1 + sqrt(117) + -5 + -1))2. -640sqrt(13) + 3728 Simplify -3 + (sqrt(168)/sqrt(6))*2 - (2 + sqrt(63))5. -15sqrt(7) + 15 Simplify (sqrt(330)/(1sqrt(10)) - -5sqrt(132))/(((sqrt(45) + (1sqrt(45) - sqrt(45)))/sqrt(5))/sqrt(3)). 11sqrt(11) Simplify (1 + (sqrt(152)/(sqrt(16)/sqrt(2)) + sqrt(684) + 0)-3)4. -84sqrt(19) + 4 Simplify ((-2 + 4-5(1 + sqrt(1539) + -5))1)2. -28080sqrt(19) + 621684 Simplify ((sqrt(539)/(sqrt(77)/sqrt(7)))/(sqrt(441)/sqrt(7)))*2. 7/9 Simplify -4 + (sqrt(4719) + sqrt(4719)2 + sqrt(4719) + sqrt(39))/(sqrt(6)/sqrt(2)-6) + -4. -15sqrt(13)/2 - 8 Simplify (4sqrt(5200))/((sqrt(64) - sqrt(64)-2) + sqrt(4)). 40sqrt(13)/13 Simplify 3(sqrt(143)26)/(sqrt(44)-2). -9sqrt(13) Simplify (6(sqrt(125) - (sqrt(125) - (-5(-1 + sqrt(125)) + sqrt(125))) - (sqrt(125) + (sqrt(125) + 1 - sqrt(125)))-5))2. 3600sqrt(5) + 8100 Simplify (sqrt(77)-2-5-3)/((-5sqrt(21)-1 - sqrt(21))/sqrt(3)). -15sqrt(11)/2 Simplify (4 + -4(-3 + -3 + sqrt(1700)))2. -2240sqrt(17) + 27984 Simplify (((-2(sqrt(504) - sqrt(504)2 - sqrt(504)))/sqrt(8))/(6sqrt(225)1))*2. 28/225 Simplify ((-5(sqrt(1176) + sqrt(1176)-2))/((sqrt(192)2 - sqrt(192))2))2. 1225/32 Simplify (-4 + (sqrt(1300) - (-2 + sqrt(1300))) + sqrt(1300) + sqrt(1300)2 + 4)*2-3 + -4. -35116 - 360sqrt(13) Simplify ((0 + ((3 + sqrt(432) + 1 - sqrt(432)) + 5)-6)6)2. 104976 Simplify (((-3sqrt(200) + 2)5 + 4)1)*2. -4200sqrt(2) + 45196 Simplify 4((sqrt(112) + sqrt(112)3 + -4)*2 - (sqrt(28) - (sqrt(28) - (-3sqrt(224))/sqrt(8)))/sqrt(4)). -500sqrt(7) + 7232 Simplify ((2 + -2 + sqrt(153) + sqrt(153))2 - (-13sqrt(153))2) + 0. -765 Simplify 2(((-2sqrt(175) + sqrt(175))-6 - (-1 + sqrt(175) + 3))*2 + -1). -200sqrt(7) + 8756 Simplify (sqrt(98) + -3 + 0 - (sqrt(98) - ((sqrt(98) + -3 - sqrt(98)) + 1)))*2-4 + 1. -99 Simplify sqrt(204)/sqrt(48) + -1 + (2sqrt(119))/sqrt(7) + -5. -6 + 5sqrt(17)/2 Simplify (-5 + -2 + 1sqrt(425) + (sqrt(425) - sqrt(425)3) + 4)*22. 60sqrt(17) + 868 Simplify ((2sqrt(567)-4)2 - sqrt(567)) + -3 + ((1 + sqrt(7) + -5)-33)2. -657sqrt(7) + 38148 Simplify (-4sqrt(77)-1 - (sqrt(77) - (sqrt(77) - (sqrt(77) - -6sqrt(77)1))))/(4(sqrt(7) - sqrt(14)/sqrt(2)) - 1sqrt(7)5). 3sqrt(11)/5 Simplify -6(-6(sqrt(847) - (2sqrt(847) + sqrt(847)))2 - ((sqrt(847) - (sqrt(847) + 0)-4)*2 - sqrt(847))). -66sqrt(7) + 249018 Simplify ((sqrt(19) - sqrt(38)/sqrt(2)) + 3)*2-3 - (sqrt(57) + (5sqrt(6897) + sqrt(6897) - sqrt(6897)))/sqrt(3). -56sqrt(19) - 27 Simplify ((-5 + -1sqrt(605) + sqrt(605) - 4(sqrt(605) + -2))-3)2. -2376sqrt(5) + 87201 Simplify -2 + (5(-3sqrt(162)-5 - sqrt(162))4)*2. 12700798 Simplify (5(sqrt(119) - (sqrt(119) - (sqrt(119)1 - sqrt(119))) - sqrt(119))4)/((sqrt(105)/sqrt(3))/sqrt(5) - -2sqrt(700)). -20sqrt(17)/21 Simplify 2(4 + ((sqrt(252) - sqrt(252)1) + 5 - (-1 + 0 + sqrt(252)))*2) + -2. -144sqrt(7) + 582 Simplify (sqrt(190)-11 - (-2-2sqrt(190) - sqrt(190)))/(3(sqrt(10) - sqrt(20)/sqrt(2)) + ((-1sqrt(110))/sqrt(11) - sqrt(10))) + -5. -5 + 2sqrt(19) Simplify 2(sqrt(98) + 0)-6 + (sqrt(2) - sqrt(72)) + 2 + (sqrt(50) - 2sqrt(50) - sqrt(2)). -95sqrt(2) + 2 Simplify 4 + sqrt(33)/(sqrt(99)/sqrt(9)) + 5sqrt(36)/(sqrt(96)/sqrt(8)). 4 + 6sqrt(3) Simplify ((4sqrt(245) - sqrt(5)) + (sqrt(245))*2 + -4)6. 162sqrt(5) + 1446 Simplify -1(sqrt(70)-1-5)/(1sqrt(640)). -5sqrt(7)/8 Simplify (2sqrt(110)/sqrt(2))/(sqrt(121)/sqrt(396)). 12sqrt(5) Simplify ((sqrt(114) + 4sqrt(114)-1 - sqrt(114)) + sqrt(114)1-5)/((-3sqrt(72))/sqrt(3)). 3sqrt(19)/2 Simplify ((sqrt(72)/sqrt(2))/sqrt(9) - (sqrt(512)/sqrt(8) + sqrt(4)))/(sqrt(24)/(sqrt(12)2) - sqrt(8)/sqrt(4)1). 8sqrt(2) Simplify (((sqrt(243)-2-5)/sqrt(9))/(sqrt(9) - -1sqrt(36)/sqrt(4) - (-1sqrt(324) - sqrt(324))))2. 75/49 Simplify (1((sqrt(500) - (sqrt(500) + 0 + sqrt(500) + sqrt(500))) + 3 + 3 + 1 + sqrt(500)))*21. -140sqrt(5) + 549 Simplify 6((sqrt(294) + 2sqrt(294))/(2sqrt(2)1))2. 3969/2 Simplify ((-2sqrt(216)-5)/sqrt(9))/(sqrt(1728) + -4sqrt(1728)1 + sqrt(1728) - sqrt(1728)). -5sqrt(2)/18 Simplify (-5(3 + sqrt(192)))2 + 4. 1200sqrt(3) + 5029 Simplify -6(sqrt(288) + sqrt(288)-1 + 3 - (sqrt(288) + 2(2 + sqrt(288))))3. 18 + 648sqrt(2) Simplify (-4 + 1sqrt(208) + sqrt(208) + 5(-3 + sqrt(208)) + -1)2 + 3. -1120sqrt(13) + 10595 Simplify sqrt(15)/(sqrt(21)/(sqrt(28) - sqrt(7))) + sqrt(245)-2-5 + sqrt(245). 78sqrt(5) Simplify (sqrt(880) - (sqrt(880) + -4(sqrt(880)2 + sqrt(880))))/(sqrt(15)/(sqrt(3) + sqrt(30)/(1sqrt(10) + sqrt(10)))). 72sqrt(11) Simplify (sqrt(2736) - (2 + (sqrt(2736) - 1sqrt(2736)))) + (sqrt(2736)-1)2 + 3. 12sqrt(19) + 2737 Simplify ((((sqrt(198) + 2sqrt(198))2)/sqrt(9))/(sqrt(88)/(sqrt(8) - sqrt(72)) + sqrt(11) + sqrt(11) + 1sqrt(1331)))2. 288/625 Simplify -5-2(-4 + sqrt(114)/sqrt(6) + (sqrt(19) - sqrt(19)1)-4). -40 + 10sqrt(19) Simplify (1-1sqrt(84) - -3(sqrt(84)2 + sqrt(84) + sqrt(84)))/(sqrt(972) - sqrt(972)-1-6). -11sqrt(7)/45 Simplify 3 + (-3 + (sqrt(17) - (sqrt(612) + sqrt(612) + 0)) + -4-4sqrt(17) + -5)2. -80sqrt(17) + 492 Simplify sqrt(720) - 3(sqrt(720) - (sqrt(720) + -2)) - (2 + (-4sqrt(720) + sqrt(720) - sqrt(720))). -8 + 60sqrt(5) Simplify (46(sqrt(132) + (sqrt(132) - (-2sqrt(132) + sqrt(132))) + sqrt(132)))/((sqrt(1728) + sqrt(1728) + sqrt(1728)2)-4). -sqrt(11)/2 Simplify (1 + (sqrt(209) + 1-1sqrt(209) - (1sqrt(209)4 + sqrt(209) + sqrt(209)))/(45sqrt(22)/sqrt(2)))*2. -3sqrt(19)/5 + 271/100 Simplify (5 + sqrt(208) + -4 + -4sqrt(208)-5 + -3)*2. -336sqrt(13) + 91732 Simplify 4((-2 + sqrt(17))3 - (sqrt(17) + 1)*2-4). 44sqrt(17) + 264 Simplify 0 + 1 + sqrt(1584)1 + 3 + (1 + (-1 + sqrt(1584))*2 - sqrt(1584) - sqrt(1584) - (-5 + sqrt(1584) + 0 + sqrt(1584))). -60sqrt(11) + 1595 Simplify -3(sqrt(720) + sqrt(720)-2 + 2 - ((sqrt(720)1)2 + 1)). 36sqrt(5) + 2157 Simplify ((-3 + sqrt(3) + -1)44-2-6 + -4)*2. -296448sqrt(3) + 706576 Simplify (((sqrt(162) - (sqrt(162) + 3))*2 + sqrt(2) - sqrt(2)) + -5sqrt(128))4. -160sqrt(2) + 36 Simplify (4 + ((sqrt(350) - (sqrt(350)-3 + sqrt(350)))-2 - sqrt(350))/sqrt(7))*2. -280sqrt(2) + 2466 Simplify (sqrt(156) + sqrt(156)-2-1)/((-2sqrt(9))/sqrt(3) - (sqrt(3) - -2sqrt(432))). -2sqrt(13)/9 Simplify 5 + 4 + (sqrt(33) + sqrt(396)/(sqrt(60)/sqrt(5)))/(sqrt(891)2). sqrt(3)/9 + 9 Simplify ((sqrt(45)/sqrt(3))/sqrt(3))*2 - sqrt(60)/(sqrt(12) + (sqrt(12)-2 - sqrt(12))) - (sqrt(405)/sqrt(9) + sqrt(5) - (sqrt(245) + 1)). 6 + 7sqrt(5)/2 Simplify (2 + (-3 + 5sqrt(28)/sqrt(4))-4)3. -60sqrt(7) + 42 Simplify -5 + (sqrt(2268)2 - sqrt(2268))/((sqrt(108)/(sqrt(12) - (sqrt(12) + sqrt(12)-1)) - sqrt(9)) + sqrt(9)) + -5. -10 + 6sqrt(7) Simplify (3-2sqrt(1700)62)*2. 8812800 Simplify (sqrt(1323)1)/(sqrt(9) + -1sqrt(81)) + ((sqrt(99) + (sqrt(99) - sqrt(99)-2))/sqrt(3))/(sqrt(11) + (sqrt(11) - sqrt(396)1)). -9sqrt(3)/2 Simplify (sqrt(513) + ((sqrt(513) + sqrt(513)1)-5 - sqrt(513) - sqrt(513)))/(3sqrt(297)/sqrt(11)). -11sqrt(19)/3 Simplify (-5 + (sqrt(128) - (-2 + 1 + sqrt(128)) - (0 + sqrt(128) + 4)))*2 + 0. 128sqrt(2) + 192 Simplify ((-3(-5sqrt(102) + sqrt(102) - sqrt(102) - sqrt(102)))/(sqrt(30)/(sqrt(5) - -6sqrt(5))))2. 269892 Simplify -3 + (sqrt(117) + 5)2 + (sqrt(39)/sqrt(3) - sqrt(13)) + 0. 30sqrt(13) + 139 Simplify ((-3 + sqrt(176) + 1)-3 + 5)-6. -66 + 72sqrt(11) Simplify ((sqrt(448) - (sqrt(448) - (0 + (1 + sqrt(448) - sqrt(448)))) - -5sqrt(448)2) + -4 + sqrt(448)1-5)2. -240sqrt(7) + 11209 Simplify (sqrt(153) + 2(-2 + sqrt(153)))2 - sqrt(85)/(sqrt(50)/(sqrt(10) - sqrt(20)/sqrt(2) - sqrt(10))). -71sqrt(17) + 1393 Simplify -4 + -5 + (sqrt(5) - sqrt(20)) + sqrt(10)/(sqrt(4)/sqrt(2)) + sqrt(320) + -1. -10 + 8sqrt(5) Simplify sqrt(171)/(sqrt(225) - sqrt(225)-2) + (sqrt(57)/(sqrt(3)-2))*2 + 4. sqrt(19	{ "pile_set_name": "DM Mathematics" }
= 0 for d. 7 Solve 365 = -5u + 335 for u. -6 Solve 2p = -1437 + 1443 for p. 3 Solve 42 = -h + 43 for h. 1 Solve 24h + 98 = 218 for h. 5 Solve 8x - 324 + 340 = 0 for x. -2 Solve 179 - 314 = -15o for o. 9 Solve 30k = -63 - 117 for k. -6 Solve -35p = -51p + 48 for p. 3 Solve 0 = -3k + 13 + 14 for k. 9 Solve 0 = 70x + 67 + 283 for x. -5 Solve 0 = -147v + 156 - 9 for v. 1 Solve 11o - 33 = -22o for o. 1 Solve -106 = 21l - 43 for l. -3 Solve 15n + 75 + 45 = 0 for n. -8 Solve 3 = 11h + 36 for h. -3 Solve -2w = -5 + 9 for w. -2 Solve 6d - 6 - 6 = 0 for d. 2 Solve -242z + 241z = -1 for z. 1 Solve 229u = 221u + 40 for u. 5 Solve -1 = -72c + 73c for c. -1 Solve 88 = -80b + 248 for b. 2 Solve 25 + 15 = 8m for m. 5 Solve 0 = -4r + 17 + 3 for r. 5 Solve 3n = -4 + 4 for n. 0 Solve 939n - 956n = -119 for n. 7 Solve -20u - 57 - 23 = 0 for u. -4 Solve -66r - 21 = -59r for r. -3 Solve -16t + 97 = -47 for t. 9 Solve 4z - 5 = 3 for z. 2 Solve 0 = -2s + 13s + 22 for s. -2 Solve -24b = -16b - 48 for b. 6 Solve -25x = -28x - 12 for x. -4 Solve -18u = 5 - 59 for u. 3 Solve -8h - 15h = -92 for h. 4 Solve 3z + 9z = 48 for z. 4 Solve -333p + 7 = -326p for p. 1 Solve -4n + 109 = 125 for n. -4 Solve -5p - 8p = 6p for p. 0 Solve -5b - 6 = 4 for b. -2 Solve 97 = -44l - 35 for l. -3 Solve 175 = -8o + 215 for o. 5 Solve -15o = -19o - 8 for o. -2 Solve -4 = -3i + 2 for i. 2 Solve -32y = -26 - 38 for y. 2 Solve -3n + 11 = 17 for n. -2 Solve -22r + 15 = -25r for r. -5 Solve -2x - 10 = 8x for x. -1 Solve -9u + 14u = 25 for u. 5 Solve 38v = 27v - 66 for v. -6 Solve -7r + 15 = 1 for r. 2 Solve 40x = -3x for x. 0 Solve -7d + 1 = 8 for d. -1 Solve 15c + 56c - 13c = 0 for c. 0 Solve -3u + 8u = -30 for u. -6 Solve -111 = 41j - 78j for j. 3 Solve -10n - 15n - 75 = 0 for n. -3 Solve -11d + 9d + 4 = 0 for d. 2 Solve 0 = -143x + 147x + 4 for x. -1 Solve 87u - 84u = 0 for u. 0 Solve 404 = -9r + 377 for r. -3 Solve 19 = 7s - 37 for s. 8 Solve 0 = 20v - 9 + 29 for v. -1 Solve 0 = f - 1 - 2 for f. 3 Solve 68b + 15 = 73b for b. 3 Solve -21 = -19v + 36 for v. 3 Solve -22n + 13n = -11n for n. 0 Solve 0 = 8w + 2w - 7w for w. 0 Solve 0 = 87m - 41m - 138 for m. 3 Solve 130t = 143t - 104 for t. 8 Solve 18w - 697 + 661 = 0 for w. 2 Solve 0 = 5k + k + 12 for k. -2 Solve 0 = -5p - 56 + 16 for p. -8 Solve 0 = -5t - 4 + 24 for t. 4 Solve 0 = -58h + 63h - 35 for h. 7 Solve -h = -7h - 6 for h. -1 Solve -3u + 34 = 43 for u. -3 Solve -4t = -16t - 12 for t. -1 Solve 0 = 111m - 10m + 808 for m. -8 Solve 5 + 4 = -3j for j. -3 Solve 25o + 5 = 30o for o. 1 Solve 0 = 17b - 98 + 47 for b. 3 Solve 27l + 22 = -32 for l. -2 Solve -2k = 19k - 42 for k. 2 Solve -11t - 90 = 4t for t. -6 Solve 63 = -217a + 238a for a. 3 Solve -8t + 7t + 2 = 0 for t. 2 Solve 10s - 213 = -203 for s. 1 Solve 0 = -2c + 27 - 23 for c. 2 Solve 0 = -16m + 8m for m. 0 Solve 14 = 3j + 5 for j. 3 Solve 3b - 11 - 4 = 0 for b. 5 Solve 8 = -164d + 166d for d. 4 Solve -536 = 6f + 61f for f. -8 Solve 4v - 4 = 2v for v. 2 Solve 17f = -2f - f for f. 0 Solve -47r + 52r - 30 = 0 for r. 6 Solve -4m + 8m + 12 = 0 for m. -3 Solve 154x + 80 = 174x for x. 4 Solve -473u + 474u + 7 = 0 for u. -7 Solve 18l + 52 = -2 for l. -3 Solve -16 - 14 = 10r for r. -3 Solve 3u = -16 + 4 for u. -4 Solve -13 = -6t + 5 for t. 3 Solve 0 = -11r + 5 - 27 for r. -2 Solve -17 = 3x - 32 for x. 5 Solve -56 = 2d - 58 for d. 1 Solve 0 = -25h + 6h - 19 for h. -1 Solve 178n = 186n - 8 for n. 1 Solve 0 = 4d + 78 - 98 for d. 5 Solve -10 = -10r - 0 for r. 1 Solve 30 = 10r - 0r for r. 3 Solve 12z = -39 + 123 for z. 7 Solve -18 = -0d - 9d for d. 2 Solve 2k + k = 6 for k. 2 Solve 108g = 106g + 6 for g. 3 Solve 0 = 194j - 29j - 1650 for j. 10 Solve -342c - 30 = -352c for c. 3 Solve -38t - 9 = -41t for t. 3 Solve -47k + 48 = -39k for k. 6 Solve 6u + 238 - 244 = 0 for u. 1 Solve 5253 = 10t + 5253 for t. 0 Solve 16i - 21i + 20 = 0 for i. 4 Solve 5g = 24g - 18g for g. 0 Solve 30 = a + 32 for a. -2 Solve -6x + 180 = -51x for x. -4 Solve 9s = -21 - 6 for s. -3 Solve -19m - 16m + 70 = 0 for m. 2 Solve -15x + 96 - 201 = 0 for x. -7 Solve 14c + 49 + 21 = 0 for c. -5 Solve 263 = 64f + 71 for f. 3 Solve -8s = 18s for s. 0 Solve -2i + 4 = -2 for i. 3 Solve 7o - 2146 = -2132 for o. 2 Solve 78 = -81j + 68j for j. -6 Solve -28m - 18m + 414 = 0 for m. 9 Solve 52 = 4v + 32 for v. 5 Solve -37m = -9m + 112 for m. -4 Solve 2u = -5u for u. 0 Solve t = 2t + 6t for t. 0 Solve 0 = 20b + 18b - 14b for b. 0 Solve -13t - 8t - 12t = 0 for t. 0 Solve 0 = 9w + 14w + 69 for w. -3 Solve 0 = 28g - 388 + 80 for g. 11 Solve 719m - 711m + 56 = 0 for m. -7 Solve 44y - 178 - 130 = 0 for y. 7 Solve z - 3 = -0z for z. 3 Solve -50 = -22l - 138 for l. -4 Solve 7k + 55 = 62 for k. 1 Solve 0 = -m + 63 - 62 for m. 1 Solve -14 = -5x + 6 for x. 4 Solve 4 = -15t - 11 for t. -1 Solve 6f + 28 = 10 for f. -3 Solve 40 = -28i + 12 for i. -1 Solve 66r + 35r + 909 = 0 for r. -9 Solve 0 = 2q - 864 + 866 for q. -1 Solve 8x = 27x - 76 for x. 4 Solve -8r + 10 = 2r for r. 1 Solve 10j + 77 = 117 for j. 4 Solve -27 = -m - 8m for m. 3 Solve 10s - 6466 = -6426 for s. 4 Solve -20m = -18m + 8 for m. -4 Solve 6d = -2634 + 2616 for d. -3 Solve 64u + 25 = 69u for u. 5 Solve 3c + 1 + 11 = 0 for c. -4 Solve 5p + 6 + 9 = 0 for p. -3 Solve 2 - 12 = 5d for d. -2 Solve -20 = -0k - 5k for k. 4 Solve -4x + 13x = -18 for x. -2 Solve -18 = 4k - 26 for k. 2 Solve 64f = 67f - 15 for f. 5 Solve -7b + 34 = -1 for b. 5 Solve m = -2m + 6m for m. 0 Solve -2048y = -2058y + 60 for y. 6 Solve 1 = -2s - 1 for s. -1 Solve 3 = m - 0m for m. 3 Solve 76x = 83x + 42 for x. -6 Solve 5 = 57g - 52g for g. 1 Solve -13g + 45 = -22g for g. -5 Solve 5p = -6 - 19 for p. -5 Solve -3i + 9i - 18 = 0 for i. 3 Solve 0 = 8z - 10z - 8 for z. -4 Solve -35j - 29j - 128 = 0 for j. -2 Solve -32s + 36s + 20 = 0 for s. -5 Solve 3b - b - 14 = 0 for b. 7 Solve 0 = 180t - 190t - 20 for t. -2 Solve -17y + 13 = 30 for y. -1 Solve 40h + 44 = 4 for h. -1 Solve 6p + 6 = 3p for p. -2 Solve 216u - 16 = 220u for u. -4 Solve -5 = -10k + 25 for k. 3 Solve -4j + j = 3 for j. -1 Solve 24 = 2y + 22 for y. 1 Solve 23n = 25n + 2 for n. -1 Solve 85 = -6o + 49 for o. -6 Solve 27 = 15a - 108 for a. 9 Solve -47u = -206 - 29 for u. 5 Solve -2 - 10 = 3p for p. -4 Solve -7y = 5y - 2y for y. 0 Solve -93d + 106d = -52 for d. -4 Solve 0 = 31b - 8b + 31b for b. 0 Solve 0 = 2p - 2 - 0 for p. 1 Solve 0x = -x - 2 for x. -2 Solve -14j + 26 = -72 for j. 7 Solve 25s - 34s = -54 for s. 6 Solve 4w = 5w for w. 0 Solve 20v + 8 - 88 = 0 for v. 4 Solve -40k = -84 - 76 for k. 4 Solve -48f = -414 + 30 for f. 8 Solve -3 = 549y - 550y for y. 3 Solve 56 = -62n + 490 for n. 7 Solve -63x = -54x + 18 for x. -2 Solve -27n - 133 - 29 = 0 for n. -6 Solve -4a + 11 = -1 for a. 3 Solve 0 = 44w - 47w + 6 for w. 2 Solve -72 = -2q - 68 for q. 2 Solve 7a - 60 = -32 for a. 4 Solve -134i = -142i + 32 for i. 4 Solve 5w = -4w + 10w for w. 0 Solve -8f + 13 = 37 for f. -3 Solve 0 = 61w - 51w - 10 for w. 1 Solve 362s - 48 = 354s for s. 6 Solve 26g - 122 + 18 = 0 for g. 4 Solve -229x = -221x - 8 for x. 1 Solve 8g = 7g + 4 for g. 4 Solve 34j - 30j = 16 for j. 4 Solve -2 = 4q + 2 for q. -1 Solve 0 = -2z + 30 - 40 for z. -5 Solve 0 - 1 = r for r. -1 Solve 120s - 126 = 99s for s. 6 Solve -2g + 5 - 1 = 0 for g. 2 Solve 12 + 5 = 17v for v. 1 Solve -4b = -10b + 18 for b. 3 Solve 242 = 4z + 214 for z. 7 Solve 10o = -2o + 48 for o. 4 Solve -3n + 589 = 598 for n. -3 Solve -10i - 32 - 38 = 0 for i. -7 Solve 2s - 3s + 3 = 0 for s. 3 Solve 20r - 200 = -20r for r. 5 Solve 14k + 158 = 242 for k. 6 Solve -92n + 88n + 20 = 0 for n. 5 Solve 216x - 221x = 0 for x. 0 Solve -9k = 2k - 44 for k. 4 Solve -9x - 26 = 17x for x. -1 Solve -4t - 31 + 15 = 0 for t. -4 Solve 6c - 1664 + 1670 = 0 for c. -1 Solve 202 - 184 = 9k for k. 2 Solve -17p + 0p = 51 for p. -3 Solve 3z - 10 = 8z for z. -2 Solve 48j = 54j + 6 for j. -1 Solve 0 = -0*	{ "pile_set_name": "DM Mathematics" }
site number? True Is (-12(-15)/180)/((-3)/(-84963)) a prime number? False Let v = 4581 - 2538. Let s be v - -1 - (-2)/(-1). Let k = 7075 - s. Is k prime? False Suppose -120y + 1144635 = -1289085. Is y prime? False Suppose 75o + 159o = 5414058. Is o a composite number? True Suppose 5d = -4u + 231, 10d - 8d = u + 95. Suppose dv = 35v + 58596. Is v a prime number? False Let j(o) = 6o2 - 5 + 0o2 + o2 - 6o2 + 21o. Is j(17) a prime number? True Is (-42518015)/(-973) - (-2 + 20/7) composite? True Let c = -1904 - -4201. Suppose a + c = 2y - 0y, 3y - 3444 = a. Is y a composite number? True Let z(p) = -p3 - 74p*2 + 220p - 165. Is z(-80) prime? False Let b(n) = n*3 + 9n*2 - 10n - 5. Let r be b(-5). Suppose -r = -4w + 1371. Is w prime? True Let d be (-14)/(-514/35). Is 59940/d + (-3)/63-3 a prime number? True Let j(h) be the first derivative of h2/2 + 42h + 1. Let r be j(-18). Is (-1 - (-2686)/4)r/36 a composite number? True Let o be (-1 + -14)1(-4)/5. Let g(t) = 0t - ot + 7t*3 + 5t*2 + 4t + 1. Is g(3) composite? False Let l(u) = -11u - 92. Let r be l(-9). Is (-4027 - r)/((-4)/2) a composite number? False Suppose 503 - 55 = 4q. Let w = q - -256. Suppose 4c + 77 = u, 5c - w = -4u + c. Is u a prime number? True Suppose g + 3u = 1059, 0 = 5g - 2u - 1571 - 3690. Suppose 0 = -h + 5a + 4687 - g, h - 3649 = 2a. Is h a prime number? True Let q = 47 + -44. Suppose -3328 = -qt + 1355. Suppose t = 6a + a. Is a composite? False Suppose -2o = -4t + 14534, -3o + 12 = -7o. Suppose 295c = 318c - 29969. Suppose -5l + c = 2m - t, 0 = 4m + 20. Is l a composite number? True Suppose k + 96k = -17k + 30079014. Is k composite? True Let c be 202464/11 - 28/(-154). Suppose -5w = -2x + c, 5w - 4w = 3x - 27609. Is x prime? True Suppose 0 = -12m + 2m + 16050. Let t = m - 208. Is t a prime number? False Let i(s) = 937s3 - 87s*2 + 43s + 54. Is i(7) a prime number? True Suppose 6q + 140676 - 495102 = 0. Is q composite? True Let i = -16492 + 22055. Is i a composite number? False Let q(x) = 152x*2 + 11x + 12. Let g be q(-8). Suppose -3z = 19z + 145750. Let s = g + z. Is s a composite number? True Let p be -6 - (-10908 - (-5 + 1)). Let k = 24315 + p. Is k a prime number? False Let q = -4628 - -15235. Is q composite? False Let n be ((-30)/40)/((-2)/24). Suppose -np - 54412 = -238507. Is p prime? False Let j(g) = -15g - 7. Let z(y) be the third derivative of 2y4/3 + 4y*3/3 - 14y*2. Let d(r) = 5j(r) + 4z(r). Is d(-8) composite? True Let p(b) = 185457b - 419. Is p(6) composite? False Let o(v) be the third derivative of -47v4/24 - 7v*3/6 - 23v*2. Let f be o(-13). Let s = -287 + f. Is s composite? False Let s = -11509 + 36000. Is s a prime number? False Let g(o) = 128o*2 - 434o - 7. Is g(-32) prime? False Suppose -9m + 50 = 5. Suppose 9533 = ml - n, 2n + n = 2l - 3808. Is l prime? True Is 117659 + -1 - 0/4 - (-2 + 1) prime? True Suppose 4n = -4l + 12, 2n = n + 4l - 2. Let q(x) = x*2 + 2x - 1. Let b be q(n). Suppose -2j - 3845 = -bj. Is j prime? True Suppose m - 41947 = 4z, -23m + 5z = -19m - 167821. Is m a composite number? False Suppose 19q - 3p = 18q + 708418, -5p = -2q + 1416831. Is q prime? True Suppose -23o + 17o + 131376 = 0. Let w = 30709 - o. Is w prime? False Let t = 276 + -276. Suppose 3g + 12 = 0, 3p + tg + 3g = 1545. Is p composite? True Suppose -x - 4g - 9 = -8g, -5g + 14 = -x. Suppose n + 3w - 13957 = 0, 8w - xw + 55846 = 4n. Is n a prime number? True Let d(f) = -f*2 + 27f + 31. Let i be d(28). Is (-9)/i87374/(-42) a prime number? False Let k = -23203 - -13586. Let d = k + 14894. Is d prime? False Suppose -3999696 = -75l + 5046729. Is l a prime number? True Let p be (-48)/(-80) + 3/(-5). Suppose -s + 0s - 2 = p. Is s((-606)/4 + 0) composite? True Suppose 23380 = 3r + 4r. Suppose -q + 680 = 2i, 0 = 6q - 11q + 2i + r. Suppose m = 3m - 4n - q, 1334 = 4m - 5n. Is m a prime number? True Let o(y) be the first derivative of -19y5/10 + 3y*4/8 - 7y*3/3 + 43. Let a(q) be the third derivative of o(q). Is a(-4) prime? False Suppose -i + 0i + 2613 = 0. Let o = i + -1336. Is o a prime number? True Let s be (1697/(-5))/(-1) + 18/(-45). Suppose 0 = 4m - s - 873. Suppose m = 10v - 207. Is v prime? False Let g be -4(-2)/(-12) - 2968/(-6). Suppose -3m = -547 - g. Is m a prime number? True Suppose 5j - 29 = 2n, j - 4n - 3 = 2j. Suppose jt + y - 5040 = 0, 4t - 5025 = -t - 4y. Is t a composite number? False Let c be 0(-8 + 6 + 1). Suppose 3l + 3m + 36237 = 133698, c = -3m - 6. Is l a prime number? False Suppose -8 - 1 = -3z. Let q be (-8)/(-28) + (4 - 120/28). Suppose 4y = zj + 2522, q = -2j - 2 - 2. Is y prime? False Suppose 18647v = 18618v + 5101361. Is v composite? False Let n be 11860/11 - -1(-2)/11. Is (-1)/2 - n/(-4) a prime number? True Is 321132/168 a composite number? True Suppose 5f + 72869 - 3646 = -2t, 4f - 5t + 55352 = 0. Let d = f + 5224. Is d/(-18) - 4/(-24) a composite number? False Suppose 480311 = 17i - 439746. Is i a prime number? True Let g = 712 - -140. Let t(k) = -1 + 14 - 823k*2 + gk*2 + 12k. Is t(-12) a prime number? False Suppose -79h + 1997639 = -72h. Is h a prime number? True Let i = -1640 - -18106. Is i prime? False Let i(h) = -h - 2. Let o(l) = 128l + 79. Let q(p) = -6i(p) - o(p). Is q(-18) a prime number? True Suppose -w - 42 = f + 2w, 2w = -2f - 88. Is (-9141)/f - (-10)/(-75) a prime number? False Let t(x) = -824x - 115. Let b(q) = 8q - 20. Let s be b(2). Is t(s) composite? False Let a(r) = 195r*2 + 8r - 804. Is a(23) composite? True Let y = 85 + -55. Suppose 2z + 12 = y. Is (-2108)/(-10) + z/45 a composite number? False Let u be (40 - (6 - 1)) + -5. Is (-2)/(u/(-5)) - (-7132)/6 a composite number? True Suppose 0 = -3v - 5z + 633441, -3z + 0z = -2z. Is v a prime number? False Suppose -1 = -4g - 4r - 13, 0 = 4g - 5r - 24. Let y be -2 + g + -4 + 5. Suppose 2t = -4x + 322, yt - t - 4x + 165 = 0. Is t composite? False Let k = 127767 - 28930. Is k a composite number? False Suppose -12w + 513360 + 812625 + 1294299 = 0. Is w prime? True Let l(y) = y3 + 180y*2 - 99y + 97. Is l(-44) prime? True Suppose 188 = -2r - 6. Let c = 91 + r. Let o(s) = -s3 - 5s*2 + s - 7. Is o(c) a prime number? True Suppose -4q - v - 77964 + 222539 = 0, 144595 = 4q - 3v. Is q composite? True Let a be 4224/((-40)/(-185)). Suppose -6t - 8393 - a = 0. Let q = -1077 - t. Is q a prime number? False Let x = 250 + 214. Let s = -311 - -100. Let r = x + s. Is r a composite number? True Let w be (12/(-3) - 4)(-9)/(-12). Let t be 0 - (w/2 - 1). Suppose 4i - p - 1163 = 0, 0 = 5i + tp - 441 - 1018. Is i composite? True Let v(s) be the second derivative of 347s4/12 + 25s*3/6 - 161s*2/2 - s + 3. Is v(6) a composite number? True Let g = -23302 + 39603. Is g a prime number? True Suppose -5z - 2300 = -2w - 2z, -5z = 3w - 3431. Is 8/(-6) - w/(-3) a prime number? False Is (-1)/(2/6) + 36750 + 134 a prime number? False Suppose -5x = 0, 4s + 5x = 2s + 10. Let y be -195 - s/(-15)0. Is 14/(-1 + y/(-185)) prime? False Suppose -v + 3545 = -14211. Suppose 5o + 4q = 44403, -14o + q = -12o - v. Is o composite? True Let i(d) be the first derivative of -9 - 5/2d*2 + 9d + 5d3. Is i(10) a composite number? False Suppose -3i + d = -16, -5i + 22 = -d - 6. Let a be 84/15 + i/(-10). Suppose 4t + al - 1309 = 0, 4t - 6l - 1259 = -l. Is t a prime number? False Suppose -1 + 2 = b. Let j = 292 + -278. Is 34573/j + b/(-2) composite? True Let w = -194 + 248. Is -34(-3639)/w - (-2)/(-9) prime? False Suppose 12141591 = 19m + 9725503 - 23111875. Is m composite? True Let u(d) = 251843d*2 + 355d + 355. Is u(-1) a composite number? False Let j = -38 + 56. Suppose -b - 5v = 35 - 7, j = -b - 3v. Let d(n) = -16n + 3. Is d(b) composite? True Is (-837546)/(-8) - ((-22)/(-110))/(8/10) a prime number? True Let q(u) = u3 + 5u*2 - 2u - 4. Let h be q(-5). Suppose 0 = hb - 10b - 184. Let l = b + 139. Is l a prime number? False Suppose 1279281 + 340402 = 13y. Is y a composite number? True Let d(c) be the second derivative of -2c*3/3 + 11c*2 + 154c + 2. Suppose	{ "pile_set_name": "DM Mathematics" }
5/4 + n4/6 - 6n + 3. Let i(g) be the first derivative of l(g). What is the third derivative of i(s) wrt s? 30 Let v(w) = 38 + 0w + 16w*3 - 45 + 0w + 12w2. Let p(s) = -8s*3 - 6s*2 + 4. Let z(k) = 7p(k) + 4v(k). Find the third derivative of z(b) wrt b. 48 Let a = 44 - 21. Let x = a + -18. What is the third derivative of -2t*5 + 3t*2 - xt*5 + 3t*5 + 0t*2 wrt t? -240t*2 Let x = -123 - -188. Suppose 9q - 4q = x. What is the second derivative of 0 + 0 - 12t*2 + t + qt*2 wrt t? 2 Let n(o) be the second derivative of -4o + 10/3o3 + 0o*2 + 0o*5 + 7/10o*6 + 0 + 0o*4. Find the second derivative of n(s) wrt s. 252s2 Let s(y) be the third derivative of -y3 - 1/120y6 + 0 + 8y*2 + 0y + 0y4 + 0y*5. Differentiate s(x) wrt x. -3x*2 Let p(f) be the second derivative of 0f*4 + 10f - 9/20f5 + f2 + 0 + 0f*3. Differentiate p(w) wrt w. -27w*2 Let m(d) = -19d*3 + 2d*2 - 2d - 3. Suppose 3x - 6 = -2a - 1, 5x - 5 = -5a. Let c be m(a). What is the derivative of ci - 3 - 159i - 1 wrt i? 2 Let z(g) = 179g4 + 13g*3 + 4g + 25. Let f(h) = 89h4 + 6h*3 + 2h + 12. Let y(j) = 13f(j) - 6z(j). Find the second derivative of y(l) wrt l. 996l2 Let i = 671 + -665. Let v(f) be the first derivative of 0f*3 + 2f - i + 4/5f5 + 0f*4 + 0f*2. Find the first derivative of v(a) wrt a. 16a*3 Let f(k) be the second derivative of 0k*3 + 11/2k*2 + 0k*4 + 3/10k*5 - 7k + 0. Find the first derivative of f(q) wrt q. 18q2 Let c be 2/9 + (-272)/(-72). Suppose 2v = -v. What is the third derivative of -9r3 + 7r*2 - cr*2 + vr*3 wrt r? -54 What is the first derivative of -32v - 57 + 77v - 18v - 130v wrt v? -103 Let m(r) be the third derivative of 106r*7/105 - 109r*3/3 + 202r*2. Differentiate m(x) wrt x. 848x*3 Let u = 46 - 21. Suppose y - u = 23. What is the third derivative of -7k*2 + y - 48 + 5k*4 wrt k? 120k Let x(g) = g - 1. Let y(f) = 2f - 4. Suppose -120 = 5w + d - 5d, 2w - 4d = -48. Let a = w + 16. Let m(z) = ax(z) + y(z). Differentiate m(v) wrt v. -6 Let z(c) = -12c - 1. Let w(j) = 557j - 204. Let y(r) = w(r) - 4z(r). What is the derivative of y(v) wrt v? 605 Let p(x) be the second derivative of x7/105 - x5/8 + 2x*3 + 3x. Let k(n) be the second derivative of p(n). What is the second derivative of k(d) wrt d? 48d Let t(q) = 4q*2 - q - 1. Let a(z) = 191z*2 - z + 36. Let s(l) = -a(l) - 4t(l). What is the second derivative of s(w) wrt w? -414 Let n be (-4 - 28/(-12))-6. Let o be (-2 + 0)/((-5)/n). Differentiate -3t*4 + 4t*4 - ot*3 + 4t*3 - 4 with respect to t. 4t*3 Let c(y) be the second derivative of 19y*7/210 + 3y*3/2 + 3y*2/2 + 7y. Let h(z) be the first derivative of c(z). What is the derivative of h(m) wrt m? 76m3 What is the third derivative of 66 - 34 + 47m*2 - 32 + 64m*3 wrt m? 384 Suppose -3d + 7v - 3v + 12 = 0, 2v = 0. Differentiate -18i*d + 29 + 2366i - 2366i wrt i. -72i*3 Let g(u) be the second derivative of 106u*5/5 + 13u*3/6 - 7u*2 + 305u. What is the second derivative of g(f) wrt f? 2544f Let b = 5 + -3. Let a be (-5)/(-20) + (-7)/(-4). Find the third derivative of 10tb + ta - 7t3 - 5t*2 wrt t. -42 Suppose 0 = -5w + 43 + 37. Suppose -w = -3c - c. Find the second derivative of 6z*c - 2z*4 - 6z + 3z4 wrt z. 84z*2 Find the third derivative of -63g*2 - 453g + 28g6 + 453g + 53g6 wrt g. 9720g*3 Suppose 0 = -4i - 5l + 16, -3i + 7i - 16 = -l. Suppose 2a + 6 = ia. Differentiate -5m3 + 4 + 1 - 1 + ma wrt m. -12m2 Let d(u) = -5u*2 + 3u - 7. Let n(a) be the first derivative of -a*2/2 + 8. Let g(h) = 2d(h) + 6n(h). What is the derivative of g(f) wrt f? -20f Suppose 4k + 54 = -m - m, -5m + 60 = -3k. Let l be (15 + k)/(-1 - -3). What is the third derivative of 5w*2 + lw2 + w3 - 9w2 wrt w? 6 Let j be (4 - 3) + 4 + -3. Suppose -jr = r + 3o - 459, 0 = 4o + 12. Differentiate -1 - 161z3 + 0 + rz*3 with respect to z. -15z*2 Suppose -84 + 2 = -4b - n, -4 = 2n. What is the first derivative of -1 + 38x*3 + b + 18 wrt x? 114x2 Let t(k) = k2 + 9k - 7. Suppose 11 = -d + 1. Let a be t(d). Differentiate -2 - h + 2h + ah with respect to h. 4 Let b(l) = -22l*2 - 4l + 48. Let p(z) = -45z2 - 7z + 95. Let o(h) = -5b(h) + 3p(h). Let g(d) be the first derivative of o(d). Differentiate g(s) wrt s. -50 Suppose q = -4p - 1, 3q + 6p - 7 = 4p. What is the second derivative of -14cq + 53c*2 - 106c*2 + 53c*2 - 18c wrt c? -84c Let j(h) be the third derivative of 0h*4 + 0 + 13h*2 + 7/30h*5 + 7/2h*3 + 0h. What is the derivative of j(u) wrt u? 28u Suppose 3a = 6a - 9. Suppose 0 = f + 3 - 1, 0 = 2o + 5f - 16. Find the second derivative of 13 + wa - o + w wrt w. 6w Find the second derivative of 283c - 556c + 225c - 153c*4 - 2 wrt c. -1836c*2 What is the third derivative of 113g*2 - 32393g*5 + 32401g*5 - 13g*2 + 9g*4 wrt g? 480g*2 + 216g Let i(d) = 3d2 + 4d - 17. Let c be i(-5). Find the third derivative of -123z3 + cz*5 + 20z*2 + 123z*3 wrt z. 2280z*2 Differentiate -142 + 20 - 2j*4 + 4j*3 + 4j*3 wrt j. -8j*3 + 24j*2 Let u(i) be the second derivative of 127i4/12 - i3/3 + 259i2/2 - i - 45. Differentiate u(j) with respect to j. 254j - 2 What is the second derivative of -106s - s3 - 50s*2 + 47s*2 - 14s + 0s3 - 7s*3 wrt s? -48s - 6 Suppose 8 = 5x - 7. Let o = -1 + x. What is the third derivative of 5z*2 + 0z*o - 4z3 - z3 wrt z? -30 Let s(i) = -344i3 - 4i - 267. Let z(g) = 344g3 + 6g + 267. Let a(o) = -3s(o) - 2z(o). Find the first derivative of a(w) wrt w. 1032w2 Let p = 7 + -10. Let i(v) = -v2 - 5. Let y be (-2)/7 - 160/35. Let m(q) = 5. Let l(k) = pm(k) + yi(k). Find the first derivative of l(j) wrt j. 4j Suppose -3 = -2d - k - 4, 3d = 5k - 34. Let o = d + 7. Find the second derivative of 2 - 3z3 + 5z - 6 + o wrt z. -18z Let b(l) = l + 22. Let a be b(-20). What is the third derivative of 19r*5 - 6r*5 + 25r*2 - 14r*a wrt r? 780r2 Let k(l) be the second derivative of -l6/10 + 5l4/2 - 11l*3 + l - 14. What is the second derivative of k(d) wrt d? -36d*2 + 60 Let z = -47 - -52. What is the derivative of -z - 5 + 4 - 7 + k wrt k? 1 Let j = 22 + -6. What is the second derivative of -105x*2 + jx + 13x + 134x*2 wrt x? 58 Let o(n) = 2n*2 - 5. Let f be (3/(-1))/(1 - 0). Let t(v) = 14v*2 + 16 - 1 - 29v*2 + 25. Let a(j) = ft(j) - 25o(j). Differentiate a(u) wrt u. -10u Let h(f) be the second derivative of -137f3/2 - 83f*2/2 + 147f + 1. Find the first derivative of h(n) wrt n. -411 What is the second derivative of -130b4 + 32b*4 - 129b - 7b4 wrt b? -1260b*2 Let p be (-10 - 328/(-32))10/6. Let u(w) be the second derivative of pw4 - 9/2w*2 + 0w*3 + 0 + w. What is the derivative of u(j) wrt j? 10j Suppose 34 = -2y - 4o, 3y + 3o = o - 35. Let a be ((-3)/y)/(1/30). Find the second derivative of -3b3 + 6b*3 - 10b - ab3 wrt b. -42b Let n(r) be the first derivative of r*5/5 - 65r*2/2 + 57. Find the second derivative of n(m) wrt m. 12m*2 Let c(y) be the third derivative of 43y*2 + 0y*5 + 0 + 41/120y*6 + 5/24y*4 + 0y + 0y3. Find the second derivative of c(n) wrt n. 246n Let z = -7 - -13. Suppose -3l + 0 + z = 0. What is the third derivative of -g2 - 4g*l + 2g*2 + 4g*6 + 4g*2 wrt g? 480g*3 Suppose 2z - p = 2 + 4, -4p = 8. Find the second derivative of 2 - 3l*2 - 8l*z - 2l - 2 wrt l. -22 Let v(j) be the third derivative of -2/15j5 + 0 + 0j - 17j2 - 5/3j*3 + 0j*4. Differentiate v(u) with respect to u. -16u Let b(u) be the first derivative of u*5/6 + 3u*4/4 - 23u*3/3 + 2. Let r(k) be the third derivative of b(k). What is the first derivative of r(j) wrt j? 20 Suppose -86q + 8 = -82q. What is the third derivative of -14j*2 + 12j*5 + 3j*q - 5j*2 wrt j? 720j*2 Let z = 4 - 4. Let x be (-3)/(-6)z + 2. Find the first derivative of -3b - 2 - 5 + 2 - x wrt b. -3 Let u be (-15)/(-6) + (-1)/2. Let f be (-21)/12(u + -6). Find the second derivative of 4l2 - 7 + f + 5l - 5l*2 wrt l.	{ "pile_set_name": "DM Mathematics" }
ork out 287 - -21620159175. 21620159462 What is 37.7407 minus -1177.8815? 1215.6222 3475211953 + 302 3475212255 Work out 280.25897 - 74.4038. 205.85517 Subtract -1.03538878559183 from 0.5. 1.53538878559183 What is -2380623.376 take away -285? -2380338.376 Add 206.8035 and 21516574. 21516780.8035 388533354 - -140.374 388533494.374 Work out 45646699.1 - 35191. 45611508.1 What is the difference between -23566896.6763 and 6? 23566902.6763 What is 0.03 - -10448040691? 10448040691.03 -0.03 + 1.424684248162 1.394684248162 What is the difference between -12778548 and 0.61972? 12778548.61972 Work out 822337487134 + 0.4. 822337487134.4 43004 + 133333501 133376505 -244981315+-0.59168 -244981315.59168 What is 8 plus -4.172155152? 3.827844848 What is 44372382 - 8220? 44364162 Sum -1327984579470 and -5. -1327984579475 What is -5 plus -30881511932? -30881511937 What is 4723 plus 374.27318836? 5097.27318836 Add together 2.75 and 115752700. 115752702.75 Add -26.66570077 and -137. -163.66570077 Subtract 70288 from 1075634619. 1075564331 Add together -0.081581 and -2615043. -2615043.081581 Sum 176635.186 and -17.77. 176617.416 Add together 50664 and 8.575554. 50672.575554 0.5+69666760848 69666760848.5 0 + -62.46162393597 -62.46162393597 What is -0.613763640976 + -0.03? -0.643763640976 Calculate -4058.84097432462 + 2. -4056.84097432462 What is the distance between 4918.567 and -0.337203? 4918.904203 0.06 + -80154.093353 -80154.033353 What is 4678731 plus 5022566? 9701297 Calculate 9.830315 + -1362301. -1362291.169685 What is -980.2 plus -497601197? -497602177.2 84808644519.6 + 2 84808644521.6 What is -90 minus -3977.14323? 3887.14323 Total of -210.191230518 and 218. 7.808769482 42177928 + 7.93499 42177935.93499 What is -882710 - 0.566141945? -882710.566141945 Calculate -17 - -63466551219. 63466551202 Calculate 25.2468765 + -208002. -207976.7531235 -15669825529.2+-4069 -15669829598.2 Add together -564485542 and 375804. -564109738 What is the distance between -0.319289 and 4606787.6? 4606787.919289 Calculate 46.02 + 90814965512. 90814965558.02 What is 60.4 plus -941755496? -941755435.6 What is -0.5 plus 483604.0816719? 483603.5816719 Work out 792755 + -38.62404. 792716.37596 Work out 0 - -2501503335591. 2501503335591 What is the difference between 0.07462 and -128702532303? 128702532303.07462 What is the distance between -4 and 114398.631449434? 114402.631449434 What is -61168580765 plus 1150? -61168579615 Calculate 358418504 - -26.761. 358418530.761 What is 1430.28 less than -2515.067? -3945.347 What is -205.3824501 - -10.9? -194.4824501 Add 392 and 1413346728060. 1413346728452 What is -43345820.6 - -0.10438? -43345820.49562 Add together 0.013965 and -43.228889. -43.214924 -1136539.4960616+5 -1136534.4960616 What is -0.3 less than 747.1075052202? 747.4075052202 Calculate 6 - 52949588068. -52949588062 Add together -369030890701651 and 1. -369030890701650 What is 14880495 take away -6.912? 14880501.912 1706548938073 - -5 1706548938078 Add -155967 and -34858892. -35014859 -3310.6+-6716.9109 -10027.5109 What is the distance between -4567290666 and 0.0766? 4567290666.0766 -2.24543662+8 5.75456338 -54123.688+2888856 2834732.312 What is -0.0486 less than -3423158370? -3423158369.9514 6805169.2 + -419 6804750.2 6015 + -17230740084 -17230734069 Calculate 423985237 + -3499.6. 423981737.4 Subtract 12.5 from -18236688.1181. -18236700.6181 326971 - -2.613602694 326973.613602694 What is 89.77932 minus 1780123? -1780033.22068 What is the difference between 168278335 and -0.38679? 168278335.38679 What is -3396014125 take away -3.7793? -3396014121.2207 What is 34338552 plus -18457.07? 34320094.93 Sum -1 and 7318666904274. 7318666904273 What is 23758 + -142749059? -142725301 What is 59536 less than -809288483? -809348019 Work out -117842790008 + -2.4. -117842790010.4 Add 820 and 892956768. 892957588 Calculate 1771175.187059 + -0.1. 1771175.087059 Work out 0.31 - 4186764.01345. -4186763.70345 -0.3 + -4018045603920 -4018045603920.3 Calculate 0.28508204 + -22.287. -22.00191796 What is 0 plus 150389121099? 150389121099 Put together 83638500041400 and 4. 83638500041404 Total of -147.416755 and 71497. 71349.583245 What is 0.4 take away 9223955180550? -9223955180549.6 What is 17.9091131 less than -1333? -1350.9091131 Add together -93067 and -242098.4. -335165.4 What is -2.6 less than -119898920? -119898917.4 What is 56789 - 617685480? -617628691 What is 258.3 minus -885369488? 885369746.3 What is 21964899004 take away 1136? 21964897868 What is -6.1352715682 less than 0.2? 6.3352715682 Add -0.2 and 81312.9836. 81312.7836 What is 463187800201 + 35? 463187800236 What is -245031481427 - -81? -245031481346 What is 8.689 less than 0.11532285223? -8.57367714777 Subtract -1916593 from 3069609.5. 4986202.5 Total of 464.74388793 and 594. 1058.74388793 -420+34940908.02 34940488.02 Sum -64948 and -3346805. -3411753 What is -5067037120735 + -113? -5067037120848 Put together 5624 and -0.04908445. 5623.95091555 Put together -332789 and -13138811. -13471600 What is the distance between -0.1 and -12394748347? 12394748346.9 What is 326536515439 - 10? 326536515429 Work out -1174982 + 1118491. -56491 Add together -28862731277 and 1164.1. -28862730112.9 65441.258 + -21461 43980.258 What is -0.0794 plus -60868668? -60868668.0794 What is 56.19 minus -26846445? 26846501.19 Calculate 189200635493 + 3. 189200635496 What is 30534261 take away 8982? 30525279 What is 0.7 plus 7473413952? 7473413952.7 Add together 4 and -45457640583. -45457640579 What is 1 minus 969143169.49? -969143168.49 What is the distance between -121857249 and 11541? 121868790 -3.6342+3762568 3762564.3658 Calculate 808802684.5 - -0.027. 808802684.527 What is the distance between -68.845331 and 926679? 926747.845331 What is -0.3 less than -317.568890884? -317.268890884 What is -10698541 less than 21296? 10719837 What is the distance between -88775.87 and -4749228? 4660452.13 Calculate 0.2 + 4130217543663. 4130217543663.2 What is 0.018163 minus 2985178? -2985177.981837 What is -11026.476 plus -0.0330228? -11026.5090228 -0.016 + 86850.317 86850.301 What is 7436 minus 0.0556995021? 7435.9443004979 151544363963 + 0.01 151544363963.01 Sum 49069 and -0.9531653515. 49068.0468346485 What is the difference between 12.399860487227 and 0.8? 11.599860487227 What is -785 plus -87485.37586? -88270.37586 Add together -155311066.7 and 19.22. -155311047.48 Add 0.96486693786 and 1960. 1960.96486693786 What is -1.65 - 2910109769? -2910109770.65 What is the distance between -3.8 and -860505646315? 860505646311.2 What is the distance between -0.671 and 11.650257? 12.321257 Add together 18250517 and -4117495.6. 14133021.4 What is -4320806 plus 832? -4319974 Work out -14096 + -0.01071981. -14096.01071981 0.1 + -3831781043840.91 -3831781043840.81 701447.656 + -8 701439.656 Put together -147256765 and 9273.96. -147247491.04 Put together -4267264208995 and -8. -4267264209003 What is 11.3756679721 less than 0.5? -10.8756679721 What is the distance between -2838 and -11580307774? 11580304936 Total of 21437 and -0.05159088. 21436.94840912 Calculate 0.0046 - -372891069015. 372891069015.0046 Put together 0.2 and -113156633.14179. -113156632.94179 What is 66 plus -17592926043.6? -17592925977.6 Work out -2.3262497 - -11640.48. 11638.1537503 Put together 6098171890 and -30.9. 6098171859.1 3062.644+397900 400962.644 What is -673195436032 plus 0.4? -673195436031.6 What is 4.7055142837229 + -4? 0.7055142837229 What is -42054669 plus -19.573? -42054688.573 What is 31.9623209 plus -0.0573? 31.9050209 What is -18 + -12498549190.67? -12498549208.67 Work out 355933404704440 - 0.5. 355933404704439.5 What is 2771819 plus -62841? 2708978 -1109 + -88061416145 -88061417254 What is -23977659259 take away -83? -23977659176 What is 5780015 plus 190.585? 5780205.585 What is the difference between 0.2736802377 and -328.3? 328.5736802377 Sum -510.541 and -56515. -57025.541 What is the difference between 1368150070 and 8.8104? 1368150061.1896 What is 2269625978 less than 0.39? -2269625977.61 Calculate -143703283 + -74.2226. -143703357.2226 Work out -4 + 2062587907789. 2062587907785 -743.476+0.10970344 -743.36629656 What is -0.9 take away 21310865515? -21310865515.9 Put together 2732006 and 7556	{ "pile_set_name": "DM Mathematics" }
((2sqrt(76)/sqrt(4) + sqrt(19) - (sqrt(57) + 3sqrt(57))/sqrt(3))1)2. 24 Simplify 2 + -4((6sqrt(99)/sqrt(3))/(-1sqrt(27)) + 0). 2 + 8sqrt(11) Simplify (sqrt(4455)2-6)/(-12sqrt(704)). 27sqrt(5)/4 Simplify ((((sqrt(33) - (sqrt(33) - sqrt(99)/sqrt(3)))1)/sqrt(3) + sqrt(11) + (3sqrt(22))/sqrt(2) + 0)2)2. 1100 Simplify ((sqrt(78) - (sqrt(78) + sqrt(78) + (sqrt(78)-1 - sqrt(78))-2 + sqrt(78) - sqrt(78)))/sqrt(6) - (4 + (sqrt(13) - sqrt(117)1)))*2. 24sqrt(13) + 133 Simplify (sqrt(2057)2)2-5 + sqrt(2057) + (3-4sqrt(2057) + sqrt(2057) - sqrt(2057)). -41140 - 121sqrt(17) Simplify ((sqrt(119) - 5sqrt(119)-5)/(-1sqrt(700) + sqrt(7)))2. 11492/81 Simplify ((0 + sqrt(448) + 4 + sqrt(448))2 + -1sqrt(448)-1 - (3 + (3 + sqrt(448)-1)2)) + -1. 184sqrt(7) + 1347 Simplify 1 + 2((sqrt(132)/sqrt(6))/sqrt(2) - sqrt(88)/(sqrt(40)/sqrt(5))). 1 Simplify 24(sqrt(143) + (sqrt(143) - (sqrt(143) - sqrt(143)33)) - sqrt(143))/(sqrt(1100) + 3sqrt(1100)). 9sqrt(13)/5 Simplify 3 + -4 + (sqrt(931) + 2)-5 + -4. -35sqrt(19) - 15 Simplify (1sqrt(72)/sqrt(6) - (sqrt(81)/(sqrt(9) + (sqrt(9) - sqrt(18)/sqrt(2))))/sqrt(3))5. 5sqrt(3) Simplify (-3(sqrt(196) + -1sqrt(196)4 + sqrt(196))/(sqrt(10)/(sqrt(10)/sqrt(2) + sqrt(5) - sqrt(5)) - sqrt(24)/sqrt(48)))2. 14112 Simplify (-3(-3sqrt(187) + sqrt(187) + sqrt(187) - sqrt(187))6)/((sqrt(275)/(sqrt(30)/sqrt(6)))/sqrt(5)). 36sqrt(17) Simplify -1(-3 + 1 + sqrt(15)/(sqrt(15)/sqrt(3)) + 0 + sqrt(75)) + -1. -6sqrt(3) + 1 Simplify (-4 + 3((sqrt(72)1)/sqrt(6))/(sqrt(196)-1))*23. 72sqrt(3)/7 + 2433/49 Simplify ((sqrt(320) + 1)2 + -4)-4 + -5 + -3 + ((1sqrt(320) - sqrt(320)) + sqrt(320))2. -956 - 64sqrt(5) Simplify (0 + sqrt(216)/(sqrt(288) + 1sqrt(288) - sqrt(288)))2. 3/4 Simplify (4 + -3-3sqrt(80) + sqrt(80) + 3)2. 560sqrt(5) + 8049 Simplify -2(1 + (sqrt(33) + sqrt(165)/(-2sqrt(5) + sqrt(5)))/sqrt(3))2. -2 Simplify (sqrt(847) + sqrt(847) + -2 + (4 + sqrt(847) - sqrt(847)))2 - ((sqrt(7) + sqrt(49)/(sqrt(35)/sqrt(5)))-3)2. 88sqrt(7) + 3140 Simplify (1(2sqrt(77) + sqrt(77)))/(sqrt(396)1) - (((sqrt(567) - sqrt(567)2) + 0)*2 + 5). -572 + sqrt(7)/2 Simplify (2(-63(-3 + sqrt(468)) + 2)-3)2. -435456sqrt(13) + 5571648 Simplify (4 + 0 + 1((sqrt(99) - (-5 + sqrt(99) + sqrt(99)))2 + sqrt(99)))-4. -512 + 108sqrt(11) Simplify -4 + 1 + -5-2sqrt(65)/(sqrt(15)/sqrt(3)). -3 + 10sqrt(13) Simplify 4 + (sqrt(99) - 6sqrt(99)2) + (-1sqrt(99) + 0 - sqrt(99))2 + -4. -33sqrt(11) + 396 Simplify -3((sqrt(588) - (-1 + sqrt(588) + -2)) + 5 + sqrt(588)-2)*2. -7248 + 1344sqrt(3) Simplify (-6sqrt(33)1 + sqrt(99)/sqrt(3)1)/(sqrt(33)/(sqrt(99)/(sqrt(18)/sqrt(2)))). -5sqrt(11) Simplify (-4((sqrt(80)1 - sqrt(80) - sqrt(80) - sqrt(80) - sqrt(80))2 + -4)-4)*2. 49152sqrt(5) + 741376 Simplify 2(((sqrt(168)/(-2sqrt(6)))/sqrt(4) + -1)1 + 4). -sqrt(7) + 6 Simplify (0 + sqrt(11) + sqrt(176))1 - sqrt(1331)-1-5. -50sqrt(11) Simplify 2(2 + sqrt(448) + (sqrt(448) + sqrt(448)4 - sqrt(448)) + -1). 2 + 80sqrt(7) Simplify (sqrt(156)/(sqrt(21)/sqrt(7)) - (0 + (sqrt(325) + -3 - sqrt(325))))*2. 12sqrt(13) + 61 Simplify (4 + 4 + sqrt(112))-33. -36sqrt(7) - 72 Simplify (-5 + (2 + -2sqrt(11) - (4(sqrt(11) + 0) + sqrt(11))))2. 42sqrt(11) + 548 Simplify (sqrt(6048)-3)/sqrt(6) - sqrt(252)1. -42sqrt(7) Simplify (sqrt(120)/(sqrt(968) - (-2sqrt(968) - sqrt(968) - sqrt(968))))/(((sqrt(210) - (sqrt(210) + sqrt(210)-1 - sqrt(210)))/sqrt(10))/sqrt(7)). sqrt(5)/110 Simplify -2 + (-3 + sqrt(605)-2 - (sqrt(245) + sqrt(245) + 0)-3)2 + 5. -120sqrt(5) + 2012 Simplify (3sqrt(84)-3)/(2sqrt(588))-6. 27sqrt(7)/7 Simplify sqrt(136)/(sqrt(8)-2) + (sqrt(34)/sqrt(2) + 0)*2 + sqrt(17) + 3 + sqrt(68)/sqrt(4) + sqrt(187)/(sqrt(275) + sqrt(11) + sqrt(11)). 23sqrt(17)/14 + 20 Simplify (sqrt(136)1-2)/(-43sqrt(8)). sqrt(17)/6 Simplify (((sqrt(84) - (sqrt(84) - (3sqrt(84)2 + sqrt(84))))/sqrt(12))*2 - ((sqrt(175)-1 + -5)*2 + sqrt(175)))6. -330sqrt(7) + 858 Simplify (3(0 + sqrt(832) + 0))*2 + 0. 7488 Simplify (sqrt(2268) - (((-4(sqrt(2268) + 0 + sqrt(2268)) - sqrt(2268)) + sqrt(2268) - sqrt(2268))*2 - sqrt(2268))) + (sqrt(2268) - (sqrt(2268)2 + 3))*2. -181431 + 144sqrt(7) Simplify (1sqrt(1600))/(sqrt(60)/sqrt(3))1 + -1. -1 + 4sqrt(5) Simplify -1sqrt(88)/(sqrt(64)/sqrt(8)) - (2 + (sqrt(11) - (0 + sqrt(22)/sqrt(2)))). -sqrt(11) - 2 Simplify (1sqrt(1872) + -2 - (4 + sqrt(1300) + sqrt(1300) + -2))-5. 20 + 40sqrt(13) Simplify -2 + (-6(1 + sqrt(108)) - ((sqrt(108)1 + sqrt(108))2)*2) + -1-12sqrt(108). -1736 - 24sqrt(3) Simplify 2sqrt(119)/sqrt(7) + 3 - ((sqrt(85)-1)/sqrt(5) - 1(0 + sqrt(17))). 3 + 4sqrt(17) Simplify (-4 + 3sqrt(2736)-24-6)3. -12 + 5184sqrt(19) Simplify (sqrt(84) + (sqrt(84) - sqrt(84)-2) + (sqrt(1029)2 - sqrt(1029)))/(((sqrt(84) + (sqrt(84)-2 - sqrt(84) - sqrt(84)))/sqrt(4))/sqrt(7)). -5sqrt(7) Simplify (5 + -2 + (1 + sqrt(68) + sqrt(68) + -3 + sqrt(68) - (-5 + sqrt(68)-2)))*2. 120sqrt(17) + 1736 Simplify ((sqrt(256)-3)/(sqrt(32)/sqrt(4)6) + -3 + 5)*2. -8sqrt(2) + 12 Simplify 5 + (-1sqrt(54)/sqrt(9) + sqrt(6))/(sqrt(2) + sqrt(108)/sqrt(6)). 5 Simplify -3 + 3 + -3(sqrt(245) + 2). -21sqrt(5) - 6 Simplify (5sqrt(243) + 1 + sqrt(243))*2 - (sqrt(243) + 4 + sqrt(243))-4. 180sqrt(3) + 8765 Simplify ((-1(sqrt(704) - (sqrt(704) - 4sqrt(704) - sqrt(704))) - (5 + (3 + sqrt(1584) - sqrt(1584))))-3)*2. 5760sqrt(11) + 158976 Simplify (2 + -2(-3 + 3sqrt(99)))*2. -288sqrt(11) + 3628 Simplify -3 + (2sqrt(360) - -4(-2sqrt(10) + sqrt(10)))/(sqrt(40)/(sqrt(8) - (sqrt(8) + (sqrt(800) - sqrt(800)-1)))). -160sqrt(2) - 3 Simplify ((-2sqrt(70)/sqrt(5))/sqrt(2) + (sqrt(847)-2 - (2 + sqrt(28)/sqrt(4))))1. -25sqrt(7) - 2 Simplify (-1 + (sqrt(117)-2)*2 - (5 + 0 + sqrt(117)) - (sqrt(117) + sqrt(117)-1 - sqrt(117))*244) + -2. -1412 - 3sqrt(13) Simplify -1(3 + ((sqrt(132) + (sqrt(132)-15 + sqrt(132) - sqrt(132) - sqrt(132) - sqrt(132)))/sqrt(12) - (-5 + sqrt(33)/sqrt(3) - -3sqrt(33)/sqrt(3))*2)). -34sqrt(11) + 198 Simplify ((sqrt(242) - sqrt(242)-1) + 0 + 5)2-1. -993 - 220sqrt(2) Simplify -4(sqrt(176) + (sqrt(176) - sqrt(176)-2) + -2)21-6-1. -67680 + 1536sqrt(11) Simplify (-54sqrt(304)-2 + -3)*2. -960sqrt(19) + 486409 Simplify -1((sqrt(1053) - ((sqrt(1053) - (sqrt(1053) + (2 + sqrt(1053) - sqrt(1053)))) + 5 - sqrt(1053))) + -3)2. -4248 + 216sqrt(13) Simplify (3(-4 + sqrt(171)) + -5)2 + 3. -306sqrt(19) + 1831 Simplify sqrt(133)/(sqrt(112) - (sqrt(112) - sqrt(112)-1)) - ((1(0 + sqrt(19)))*2 + 1). -20 - sqrt(19)/4 Simplify (sqrt(756)/sqrt(7) + (-2 + sqrt(108) - sqrt(3)) + (1 + sqrt(192) + 0 - ((1sqrt(192)-2 - sqrt(192)) + sqrt(192))))2. -70sqrt(3) + 3676 Simplify 2(((sqrt(1377) + sqrt(1377) + -1)2 + sqrt(1377) - (sqrt(1377) + -1 + -3))*2 + -1). 288sqrt(17) + 44070 Simplify sqrt(39)/(sqrt(3) + 1sqrt(3)) - 2(sqrt(13) + 1) - ((sqrt(91) + sqrt(91)-2)/sqrt(7) - sqrt(13) - (1sqrt(13)-1)2). sqrt(13)/2 + 11 Simplify 3(-1 + sqrt(112) + -2) + sqrt(847) + 0 + 3 + 3 + sqrt(847)-2 + sqrt(847). -3 + 12sqrt(7) Simplify 5 + (1sqrt(171)-4 - sqrt(171))/(sqrt(9) + (sqrt(1296) - (sqrt(1296)2 - sqrt(1296)))). -5sqrt(19) + 5 Simplify -5 + ((sqrt(143)-2 + sqrt(143) - sqrt(143))-23)/(sqrt(66)/(sqrt(486) + sqrt(6) - sqrt(6))). -5 + 108sqrt(13) Simplify 2(sqrt(252) - (0 + sqrt(252) + -5)2)4. -2216 + 528sqrt(7) Simplify ((-6sqrt(7)2 + sqrt(7) - sqrt(7))-1)2 + -1 + (-1 + sqrt(847))2. -22sqrt(7) + 1855 Simplify (-2(sqrt(792) + 2sqrt(792)))/(5sqrt(44)/sqrt(4)-3) + 3. 3 + 12sqrt(2)/5 Simplify (-1((sqrt(2448)-1 - sqrt(2448) - sqrt(2448)) + 2))*2 + -2 + -5. -144sqrt(17) + 22029 Simplify (((sqrt(84) - (sqrt(84) + 1sqrt(84) - sqrt(84)) - sqrt(84))1 - 2sqrt(84)1)/(6-1sqrt(588)))*2. 1/28 Simplify -5 + sqrt(52) + -3 + (sqrt(65) + 2(sqrt(65) - sqrt(65)3))/sqrt(5). -8 - sqrt(13) Simplify (2(sqrt(91) - sqrt(91)3)4)/(-5(sqrt(105)/sqrt(5))/sqrt(3)). 16sqrt(13)/5 Simplify (0 + -2 + sqrt(17) - (sqrt(272) + 5 - sqrt(17))*2)1. -180 - 29sqrt(17) Simplify (sqrt(39) + sqrt(3159)1)/(sqrt(3) - 34sqrt(3)). -10sqrt(13)/11 Simplify -6(2 + (sqrt(686) - sqrt	{ "pile_set_name": "DM Mathematics" }
, 226? 18m2 + 3m - 74 What is the s'th term of 29012, 29005, 28998, 28991? -7s + 29019 What is the f'th term of 2662705, 2662707, 2662709, 2662711? 2f + 2662703 What is the d'th term of 176, 431, 686, 941, 1196? 255d - 79 What is the p'th term of 186788, 373545, 560302, 747059, 933816? 186757p + 31 What is the x'th term of -9839, -19680, -29521, -39362? -9841x + 2 What is the n'th term of -363334, -726672, -1090010? -363338n + 4 What is the o'th term of -4029, -16103, -36221, -64383, -100589, -144839? -4022o2 - 8o + 1 What is the l'th term of -19, -85, -273, -649, -1279? -11l3 + 5l*2 - 4l - 9 What is the w'th term of 71, 370, 1177, 2744, 5323? 42w3 + 2w*2 - w + 28 What is the g'th term of 51, 111, 195, 303? 12g*2 + 24g + 15 What is the q'th term of 2324, 2331, 2342, 2357, 2376? 2q2 + q + 2321 What is the b'th term of 38481, 153906, 346273, 615576, 961809, 1384966, 1885041, 2462028? -b3 + 38477b2 + b + 4 What is the k'th term of -81, -225, -385, -567, -777? -k3 - 2k2 - 131k + 53 What is the s'th term of -499, -3952, -13323, -31570, -61651, -106524, -169147? -493s3 - s2 + s - 6 What is the b'th term of 927, 1931, 2935, 3939, 4943, 5947? 1004b - 77 What is the q'th term of 137388, 137392, 137396, 137400, 137404, 137408? 4q + 137384 What is the x'th term of 34677, 34637, 34597? -40x + 34717 What is the q'th term of 912, 804, 644, 450, 240, 32, -156, -306? 3q3 - 44q*2 + 3q + 950 What is the u'th term of -1218, -1027, -822, -597, -346, -63, 258? u3 + u2 + 181u - 1401 What is the z'th term of -391, -421, -521, -727, -1075, -1601, -2341, -3331? -6z3 + z2 + 9z - 395 What is the r'th term of -1477, -1471, -1465? 6r - 1483 What is the q'th term of -97, -25, 79, 203, 335, 463, 575? -2q3 + 28q*2 + 2q - 125 What is the r'th term of 395, 412, 429, 446, 463? 17r + 378 What is the s'th term of -6673, -6641, -6609, -6577, -6545, -6513? 32s - 6705 What is the x'th term of -75, -232, -329, -366, -343? 30x2 - 247x + 142 What is the u'th term of 2136, 4225, 6278, 8295? -18u2 + 2143u + 11 What is the r'th term of -46, -201, -600, -1363, -2610, -4461, -7036? -20r3 - 2r*2 - 9r - 15 What is the t'th term of -182, -231, -306, -407, -534, -687? -13t2 - 10t - 159 What is the v'th term of 715523, 715516, 715495, 715454, 715387, 715288? -v3 - v2 + 3v + 715522 What is the k'th term of -1429713, -1429714, -1429715? -k - 1429712 What is the t'th term of -33822, -33820, -33818, -33816, -33814? 2t - 33824 What is the y'th term of 12380, 24753, 37126, 49499, 61872, 74245? 12373y + 7 What is the t'th term of 1418, 3292, 5166, 7040, 8914, 10788? 1874t - 456 What is the g'th term of -2518, -2524, -2564, -2656, -2818? -3g3 + g2 + 12g - 2528 What is the c'th term of 165, 436, 921, 1620, 2533, 3660? 107c2 - 50c + 108 What is the c'th term of -940, -1751, -2576, -3421, -4292, -5195, -6136, -7121? -c3 - c2 - 801c - 137 What is the b'th term of -7, -473, -1247, -2329, -3719, -5417, -7423? -154b*2 - 4b + 151 What is the r'th term of 72, 313, 708, 1251, 1936, 2757, 3708, 4783? -r*3 + 83r*2 - r - 9 What is the p'th term of 31217, 62427, 93637, 124847, 156057? 31210p + 7 What is the m'th term of -1441, -5855, -13217, -23527, -36785, -52991, -72145? -1474m2 + 8m + 25 What is the f'th term of 2175, 4353, 6521, 8685, 10851, 13025? f*3 - 11f*2 + 2204f - 19 What is the w'th term of 44, 260, 622, 1124, 1760, 2524, 3410, 4412? -w*3 + 79w*2 - 14w - 20 What is the i'th term of -48, -122, -228, -366, -536, -738? -16i2 - 26i - 6 What is the h'th term of -27661, -27645, -27627, -27607, -27585, -27561? h*2 + 13h - 27675 What is the z'th term of -218, -216, -206, -182, -138, -68, 34? z*3 - 2z*2 + z - 218 What is the u'th term of 5745, 22927, 51585, 91737, 143401, 206595? 3u*3 + 5720u*2 + u + 21 What is the v'th term of -8783, -17592, -26401? -8809v + 26 What is the c'th term of -25538, -25851, -26372, -27101, -28038, -29183? -104c2 - c - 25433 What is the h'th term of -1182, -1264, -1334, -1386, -1414, -1412? h3 - 89h - 1094 What is the d'th term of 115702, 115699, 115692, 115681, 115666, 115647, 115624? -2d2 + 3d + 115701 What is the p'th term of -8392, -8442, -8482, -8506, -8508, -8482, -8422? p3 - p2 - 54p - 8338 What is the j'th term of 249709, 249713, 249717, 249721, 249725? 4j + 249705 What is the f'th term of -36192, -72357, -108522, -144687, -180852? -36165f - 27 What is the f'th term of 416721, 833447, 1250173, 1666899? 416726f - 5 What is the m'th term of -1135, -2257, -3367, -4465, -5551, -6625? 6m2 - 1140m - 1 What is the f'th term of 10477, 10450, 10395, 10306, 10177, 10002? -f*3 - 8f*2 + 4f + 10482 What is the q'th term of 451, 1688, 3755, 6658, 10403? q*3 + 409q*2 + 3q + 38 What is the q'th term of 4310, 4311, 4314, 4319, 4326? q*2 - 2q + 4311 What is the l'th term of 22, 1, -88, -281, -614? -6l3 + 2l*2 + 15l + 11 What is the d'th term of 4150, 8299, 12450, 16603, 20758, 24915? d*2 + 4146d + 3 What is the a'th term of 7791, 7626, 7173, 6288, 4827, 2646? -24a3 + 3a + 7812 What is the s'th term of 20728, 20741, 20762, 20791, 20828, 20873? 4s2 + s + 20723 What is the l'th term of -387899, -387893, -387883, -387869, -387851, -387829? 2l*2 - 387901 What is the g'th term of -70, -311, -726, -1315, -2078, -3015, -4126? -87g*2 + 20g - 3 What is the a'th term of -15, 84, 245, 468, 753, 1100, 1509? 31a2 + 6a - 52 What is the h'th term of 53340, 106678, 160020, 213366, 266716, 320070, 373428? 2h2 + 53332h + 6 What is the f'th term of -8209, -8180, -8133, -8068, -7985? 9f2 + 2f - 8220 What is the i'th term of 332, 652, 972, 1292? 320i + 12 What is the a'th term of -1087, -2423, -4015, -5857, -7943? a3 - 134a*2 - 941a - 13 What is the l'th term of 28442, 28451, 28464, 28481, 28502? 2l2 + 3l + 28437 What is the x'th term of -5402, -6717, -8032, -9347, -10662, -11977? -1315x - 4087 What is the u'th term of -1880, -7487, -16816, -29855, -46592, -67015, -91112? 2u*3 - 1873u*2 - 2u - 7 What is the t'th term of 25319, 25312, 25303, 25292, 25279, 25264, 25247? -t*2 - 4t + 25324 What is the a'th term of 713, 1448, 2203, 2978, 3773? 10a2 + 705a - 2 What is the x'th term of 25, 41, 3, -143, -451? -9x3 + 27x*2 - 2x + 9 What is the o'th term of -33, 44, 173, 354, 587, 872, 1209? 26o2 - o - 58 What is the j'th term of 11124, 22314, 33502, 44688, 55872, 67054? -j2 + 11193j - 68 What is the n'th term of 13798, 13732, 13666, 13600? -66n + 13864 What is the s'th term of -8, -13, -22, -35? -2s*2 + s - 7 What is the x'th term of -605, -875, -1327, -1961, -2777, -3775? -91x*2 + 3x - 517 What is the a'th term of -13532, -54103, -121724, -216389, -338092, -486827, -662588, -865369? a*3 - 13531a*2 + 15a - 17 What is the v'th term of -1020, -1110, -1210, -1326, -1464, -1630, -1830? -v3 + v2 - 86v - 934 What is the i'th term of 4555, 9103, 13653, 18205? i2 + 4545i + 9 What is the k'th term of 163, 377, 587, 787, 971, 1133? -k*3 + 4k*2 + 209k - 49 What is the p'th term of 17114, 34280, 51446, 68612, 85778, 102944? 17166p - 52 What is the l'th term of 1451, 1866, 2271, 2660, 3027, 3366, 3671, 3936? -l3 + l2 + 419l + 1032 What is the b'th term of -1260, -998, -736? 262b - 1522 What is the s'th term of -28, -146, -474, -1120, -2192? -18s*3 + 3s*2 - s - 12 What is the n'th term of 22808, 45516, 68224? 22708n + 100 What is the n'th term of 67, 210, 447, 778, 1203, 1722? 47n2 + 2n + 18 What is the w'th term of -1388, -5543, -12468, -22163, -34628? -1385w2 - 3 What is the a'th term of -133, -294, -549, -886, -1293, -1758? 2a*3 - 59a*2 + 2a - 78 What is the s'th term of 406, 375, 346, 319, 294, 271? s*2 - 34s + 439 What is the l'th term of -15029, -15024, -15007, -14972, -14913, -14824? l*3 - 2l - 15028 What is the r'th term of -1588, -1572, -1552, -1528, -1500, -1468, -1432? 2r2 + 10r - 1600 What is the w'th term of 4936, 9722, 14508, 19294? 4786w + 150 What is the c'th term of 3147, 6372, 9597? 3225c - 78 What is the p'th term of 171, 580, 1263, 2220? 137p2 - 2p + 36 What is the x'th term of 125014, 250023, 375032, 500041, 62505	{ "pile_set_name": "DM Mathematics" }
6941/63) Simplify (((uu(2/3)uu)/u)18(uu(2/3))/u(-2/13))43 assuming u is positive. u(83549/39) Simplify (l(-1/5))(-3/35)/(((l(1/4)l)/l)/((l/(l/(l*13/l)l)l)/l)) assuming l is positive. l(7537/700) Simplify (m(3/5)/m)(2/49)((mm(-10)m)/m)32 assuming m is positive. m(-70564/245) Simplify (l*(4/3)/l)/(ll*3/l)l/l*(-1/3)l/(ll5l) assuming l is positive. l*(-22/3) Simplify ((x/(xx*(-2/11))x/((x/x(-10))/x))/((x(-4)/x)/x(3/7)))(-3/17) assuming x is positive. x(783/1309) Simplify ((w(3/13)/w(-12))/(w7w(-4/11)w))(-22) assuming w is positive. w(-1314/13) Simplify h*(10/7)h*17h((h(-1/6)/h)/h)/(h(2/3)hh) assuming h is positive. h(613/42) Simplify d(-4)/d(-1/11)(d(-3))(-25) assuming d is positive. d(782/11) Simplify ((t/(t/(t(-11)t)))/((t(-11)/tt)/t))/((t/(t/t(2/3)))/(t(2/5)t)) assuming t is positive. t(41/15) Simplify (l15l)/ll11((ll/(l/l(-1/41)ll))/l)/l10 assuming l is positive. l(573/41) Simplify l(-14)/(ll/(ll28))(l(-11)/l)/l(2/19) assuming l is positive. l(17/19) Simplify ((l/(l(1/9)/l))/(l(1/4)/l))/(l15/ll)(-1/37) assuming l is positive. l(4055/1332) Simplify (o/o(-1/7))15/(o/o(-10))(-11/2) assuming o is positive. o(1087/14) Simplify (z(-6)/(z(-8)/zz))/(z*(3/4)z(3/5)) assuming z is positive. z(13/20) Simplify (l/l(2/27))(-5/3)(l/(ll(-6)/l))(-1/27) assuming l is positive. l*(-146/81) Simplify (gg(-1))50((g/(((g(-2/27)/g)/ggg)/g)g)/g)/g(-4) assuming g is positive. g(164/27) Simplify (m/m7)(-6/11)/(m/(m*10/m)m(-4)) assuming m is positive. m(168/11) Simplify (((t1)(-22))(-9))(1/12) assuming t is positive. t*(33/2) Simplify ((fff5)/(f(-4)ff)(f(-6)/f)/f(-4/3))(-2/55) assuming f is positive. f(-4/33) Simplify (q(-4)/q(5/7))(-7/3) assuming q is positive. q11 Simplify (l(-1))(-1/9)l(-1/7)/(ll*(-19)l) assuming l is positive. l(1069/63) Simplify (z/((z/z(-6/11))/z)z(-1/12)z(2/7)/(z/((z(-1/15)zz)/z)z))(-2/111) assuming z is positive. z(631/85470) Simplify (b(1/2)/(bb*(-22)))/((bb*(5/9))/(bb(-21)/b)) assuming b is positive. b(-19/18) Simplify (d/(d/(d/(ddd(-3/7)))))(-46)(d/d(7/6)d)/dd(1/4) assuming d is positive. d(2215/84) Simplify ((((a/a(-1))/a)/a)/(a(1/30)/a))/(a3)(-28/9) assuming a is positive. a(103/10) Simplify d/(d(-2/5)/d)d*(3/10)dd(-2/25)d/(d((d(-3/8)/d)/d)/d)d assuming d is positive. d(1599/200) Simplify ((c1/cc)(-37)/(cc*7/ccc0))(-6) assuming c is positive. c270 Simplify j6jj26jjjj(-25)j((j/(j/(jjj(-1/43)/j))j)/j)/jj assuming j is positive. j(558/43) Simplify (ll*15l)*(-2/41)/(((ll/l*(-32)l)/l)/(l33/l)) assuming l is positive. l(-116/41) Simplify (uu(-1/11)/uu(-5/6))/(u(-6)/uu(-7)u) assuming u is positive. u(797/66) Simplify (b(-1)/bb)/(b/b(1/21))(b/b(-1/5))(8/5) assuming b is positive. b(-17/525) Simplify b/b(-2/11)b9/bb/(b/(b/(b/(b/((b(b/b(-2/3))/b)/bb)))))b(-4) assuming b is positive. b(149/33) Simplify ((w17w)(2/5))(46/7) assuming w is positive. w*(1656/35) Simplify (((llll/((l*(2/5)l)/l)l)/((lll/(l/(l2/l)ll)ll)/l))11)16 assuming l is positive. l(2288/5) Simplify (gg4)(-1/30)g/(g((g*5g)/g)/g)g/(g(1/6)/g) assuming g is positive. g(-7/3) Simplify (w25w*(-6/13))/(ww/(w/w*(-15))ww(-6/13)) assuming w is positive. w38 Simplify (f8/(f/(f/((f0f)/f)f)))/(f(-1/6))(4/7) assuming f is positive. f(191/21) Simplify ((b(-2/3)bb/((bb*(2/41)b)/b))/(b(-9)/((b/b9)/b)))(-1/38) assuming b is positive. b(-35/4674) Simplify (j(7/5)/j)(5/19)(j(-2/25)j)/((j*(-5)j)/j) assuming j is positive. j*(2862/475) Simplify ((ttt0)(16/5)(tt(-1/5))(-2/9))23 assuming t is positive. t(1288/9) Simplify (i((i/(i/i(-3)))/i)/i)15/(i(-2/75)/i(-18)) assuming i is positive. i(-5848/75) Simplify ((r/r(2/15))/(r(rr*(3/7))/rr))/(r(2/9)/r20) assuming r is positive. r*(5738/315) Simplify (zzz/(z/(zz/z*(1/4)))z)*(-1/2)/(((zz/(z*(-2/89)/zz)z)/z)/z(-18)) assuming z is positive. z(-15947/712) Simplify (((c0)(2/29))(-32/5))(-7/12) assuming c is positive. 1 Simplify (n(-1)/n)(-2/17)n*(2/7)nn(2/33) assuming n is positive. n(6211/3927) Simplify i/i(-6)i*(-14)i*(-13)i*(-7)i assuming i is positive. i*(-26) Simplify (p/(pp*(-1/3)))/(pp*(-10)p)p1p/(pp(6/7)) assuming p is positive. p(178/21) Simplify (((i/i(1/3))/i)/i)/i(i/i*5)/i(i(2/7))(-25/7) assuming i is positive. i(-1228/147) Simplify ((p/((p/(p/p(12/7)))/p))/p(-19))/(p/p(-2))15 assuming p is positive. p(-180/7) Simplify p/p*(-2)ppp*(-3/4)p(10/9)/p10 assuming p is positive. p(-167/36) Simplify (w(1/2))*(3/2)/(ww*(2/35)www)(46/5) assuming w is positive. w(-25603/700) Simplify g/g*(1/5)gg8((gg5)/g)/g(6/5) assuming g is positive. g(68/5) Simplify ((((m/(mm*(2/3)))/m)/m)/mmm)/(m/m(3/11))(m*1m)43 assuming m is positive. m(2759/33) Simplify (g(-1))47(ggg10)(1/68) assuming g is positive. g(-796/17) Simplify (((uu(-1/10))/(u(-2/9)u))/(u0)(-5))(-4) assuming u is positive. u(-22/45) Simplify ((d(-3/5)d/d*(-5)d)(4/11))(-2/17) assuming d is positive. d*(-256/935) Simplify (dd*(-2/11)(((d/(d/((d(d/(d(-2/9)d))/d)/d))d)/d)/d)/d)/((dd(-1/3))/d)45 assuming d is positive. d(1291/99) Simplify ((o/(o/o(-2/23)))/(o*(-2/7)o))/(o(2/13))(-41) assuming o is positive. o(11525/2093) Simplify (j18jj*1j)/(j(-8))(-4) assuming j is positive. j(-11) Simplify (((w/w(-4/3))/ww(-1/11))13)(4/5) assuming w is positive. w(2132/165) Simplify (x(-6)(x*8x)/x)/((x/((xx21)/x))/(x/(x(-15)x))) assuming x is positive. x37 Simplify ((o8o)(-1/7))(-3/17) assuming o is positive. o(27/119) Simplify (q48/qq/(qq(3/10))q)(-6/23) assuming q is positive. q(-1431/115) Simplify (o/(ooo*(-21)oo)o)/o*(-1/10)o/o*(-26)oo/(o/((oo*(-1)/o)/oo)o)ooo assuming o is positive. o*(481/10) Simplify (((uu*(-6/7)/u)/uuu)/u(4/5))/(u/(uu(3/8)))(-50) assuming u is positive. u*(-2717/140) Simplify (p/(p(p/p*(-3))/pppp)p/p(1/4)p3/p(-1))(-9) assuming p is positive. p(45/4) Simplify (g(2/7))(-12)g/(g/(g4/g))g(2/31) assuming g is positive. g(-79/217) Simplify ((t*(-2/53)tt)/(t35t))/(t6)(-45) assuming t is positive. t(12506/53) Simplify b(-2/13)b(-1)b/b*(11/4)b/b*0b assuming b is positive. b*(-47/52) Simplify (x/(((x(xx(3/11)x)/x)/x)/x)x(-1/6))/(x(-1)x)(-4/23) assuming x is positive. x(37/66) Simplify ((t/(tt(1/2)ttt))/t)*(-2/19)t*(2/27)t(-2/11) assuming t is positive. t(2065/5643) Simplify x*(6/5)x*(-12/11)xx/x18(x/((x/(x(10/9)/x))/x))/x assuming x is positive. x(-7811/495) Simplify (((bbb(-2/5))/b5)/(b*(-1)b)(-18))(-10/7) assuming b is positive. b(34/7) Simplify (((w/w(2/9))(2/43))4)34 assuming w is positive. w(1904/387) Simplify (l*(4/15)l(-4/9))/(l3)(5/4) assuming l is positive. l(-707/180) Simplify ((qq4)/(qqq/(q12/q)))/((qq*(-4))/(q/(qq((q(-6/13)q)/q)/qq))) assuming q is positive. q(201/13) Simplify (r(-2/9))(-1/22)/((r/(r/r12))/rr/((r*(-4/11)rr)/r)) assuming r is positive. r(-1124/99) Simplify (t(-1/6))(-3/2)/(t(-4/3)/(t/t(-8)t)) assuming t is positive. t(139/12) Simplify ((y/(y(2/9)/y))/y)*(-13)(y(-2))(-30) assuming y is positive. y(449/9) Simplify ((a24)(1/19))(2/21) assuming a is positive. a(16/133) Simplify (n15/(nn(-23)))/(n(nn17n)/n)(-17/2) assuming n is positive. n(397/2) Simplify (i/(i/i(-3)))(-5/8)/(ii/(ii/(i*(6/11)/ii))i(i/((i/(i(2/15)/i))/i))/i) assuming i is positive. i(1579/1320) Simplify o*(-2/33)(ooo*(1/4)/ooo)/oo(o/(o/(o/(oo(-2/9)))))(-25) assuming o is positive. o(-937/396) Simplify (((h(11/5))(-41))(-37))(-5) assuming h is positive. h(-16687) Simplify ((n/(n*(-2/7)n)*	{ "pile_set_name": "DM Mathematics" }
197r2/7 - 58r + 24/7. (r - 2)(197r - 12)/7 What is w in 10w2 + 4845w/2 + 6025/2 = 0? -241, -5/4 Solve 3n4/7 - 222n*3/7 + 5364n*2/7 - 40338n/7 - 6561 = 0 for n. -1, 21, 27 Factor 6u2/11 + 36u/11 + 48/11. 6(u + 2)(u + 4)/11 Solve g*2/5 - 404g + 204020 = 0. 1010 Determine u so that -3u5 + 252u*4 + 255u3 = 0. -1, 0, 85 Let b2/4 + 3b/4 - 1 = 0. What is b? -4, 1 Determine k so that -5k*4/4 - 265k*3/4 + 355k*2 - 435k = 0. -58, 0, 2, 3 Find j, given that -12j5/11 - 46j*4/11 - 32j*3/11 + 42j*2/11 + 40j/11 + 8/11 = 0. -2, -1/2, -1/3, 1 Determine w so that 2w4/5 + 3548w*3/5 + 1577082w*2/5 + 3143528w/5 + 1569992/5 = 0. -886, -1 Factor -o*2/3 + 22o/3 - 7. -(o - 21)(o - 1)/3 Factor -3a*3 + 228a*2 - 4551a + 8214. -3(a - 37)2(a - 2) Determine y so that y*4/10 - 67y*3/10 + 189y*2/5 - 74y + 244/5 = 0. 2, 61 Solve -4g4/5 - 24g*3/5 + 116g*2/5 + 456g/5 + 64 = 0 for g. -8, -2, -1, 5 Find b, given that 2b5/3 - 28b*4/3 - 4b*3/3 + 56b*2/3 + 2b/3 - 28/3 = 0. -1, 1, 14 Let 2q3/11 - 8q*2/11 - 2q/11 + 8/11 = 0. What is q? -1, 1, 4 Solve -3t2 + 2016t - 338688 = 0. 336 Let -b*5 + 26b*4 - 193b*3 + 312b*2 - 144b = 0. What is b? 0, 1, 12 Determine s, given that -4s4 + 44s*3 - 96s*2 = 0. 0, 3, 8 Factor 63m*3 - 24187m*2 - 1922m + 768. (m - 384)(7m - 1)(9m + 2) Factor 4y2 + 24y + 20. 4(y + 1)(y + 5) Find i such that 3i3/5 + 183i*2/5 + 2697i/5 - 2883/5 = 0. -31, 1 Factor -p*4/3 + 4p*3/3 - 5p*2/3 + 2p/3. -p(p - 2)(p - 1)2/3 Factor l2 + 9l + 18. (l + 3)(l + 6) Solve -3p3/7 + 12p*2/7 - 15p/7 + 6/7 = 0. 1, 2 Suppose -2i2 + 16i - 32 = 0. What is i? 4 Factor -6a3 + 170a*2 + 296a + 120. -2(a - 30)(a + 1)(3a + 2) Suppose 4m3 + 20m*2 + 28m + 12 = 0. Calculate m. -3, -1 Factor -5l3 + 110l*2 - 520l + 640. -5(l - 16)(l - 4)(l - 2) Factor -4o*4 + 40o*3 - 28o*2 - 72o. -4o(o - 9)(o - 2)(o + 1) Suppose 2x2/3 + 1164x + 508086 = 0. Calculate x. -873 Factor 2b2 + 50b - 108. 2(b - 2)(b + 27) Factor i*2 + 882i. i(i + 882) Solve -t2/2 + 7t/2 + 4 = 0 for t. -1, 8 Determine j so that -15j5 - 531j*4 - 3966j*3 + 12834j*2 - 11571j + 3249 = 0. -19, 3/5, 1 Factor v*5/4 + 3v*4 - 4v*3 - 17v*2/2 + 63v/4 - 13/2. (v - 1)*3(v + 2)(v + 13)/4 Factor 2b*5/3 - 388b*4/3 - 782b*3/3 - 392b*2/3. 2b*2(b - 196)(b + 1)2/3 What is n in -6n*3/11 + 1786n*2/11 - 132610n/11 - 44402/11 = 0? -1/3, 149 Solve 3g3 - 12g*2 - 123g - 108 = 0. -4, -1, 9 Suppose 2r3/15 + 316r*2/15 - 1288r/15 + 432/5 = 0. What is r? -162, 2 Let s*4 - 29s*3 + 99s*2 + 29s - 100 = 0. What is s? -1, 1, 4, 25 Determine k, given that -50k5 - 7010k*4 - 1268k*3 + 18392k*2 - 12304k + 2240 = 0. -140, -2, 2/5, 1 Determine s so that -s*2/5 + 86s/5 + 176/5 = 0. -2, 88 Solve -a*3/5 + 7a*2/5 + 2a - 16/5 = 0. -2, 1, 8 Find p such that p*2/8 + 5p/2 - 125/8 = 0. -25, 5 Let -a*4 - 23a*3 + 80a*2 + 1488a + 3456 = 0. Calculate a. -24, -4, 9 Find i such that 4i3 - 1400i*2 - 4i + 1400 = 0. -1, 1, 350 Factor 5i4 - 130i*3 - 5i*2 + 130i. 5i(i - 26)(i - 1)(i + 1) Let -4k4/7 - 116k*3/7 - 772k*2/7 + 1140k/7 + 1800/7 = 0. What is k? -15, -1, 2 Factor 2y3 - 86y*2. 2y*2(y - 43) Let -6t4 - 176t*3 - 52t*2 + 176t + 58 = 0. What is t? -29, -1, -1/3, 1 Suppose 3c2 + 9c - 30 = 0. What is c? -5, 2 Solve -z*3 + 28z*2 - 27z = 0 for z. 0, 1, 27 Determine l, given that l4/4 + l3/2 - 37l2/4 - 43l/2 + 30 = 0. -5, -4, 1, 6 Factor 12f4 - 52f*3 - 208f*2 - 112f. 4f(f - 7)(f + 2)(3f + 2) Suppose -4g*4 + 160g*3 - 1596g*2 - 160g + 1600 = 0. Calculate g. -1, 1, 20 Factor 2n3/5 + 4n*2 - 22n/5. 2n(n - 1)(n + 11)/5 Factor 2w*4/9 - 4w*3/9 - 10w*2/3 - 8w/9 + 40/9. 2(w - 5)(w - 1)(w + 2)2/9 Let -3j*5 - 18j*4 - 24j*3 + 6j*2 + 27j + 12 = 0. Calculate j. -4, -1, 1 Suppose -50l5/3 + 32l*4 + 58l*3/3 - 32l*2 - 8l/3 = 0. What is l? -1, -2/25, 0, 1, 2 Factor 3k2/7 + 585k/7 + 582/7. 3(k + 1)(k + 194)/7 What is t in -2t2/3 + 518t/3 - 2440 = 0? 15, 244 What is o in -2o2/15 - 10o/3 = 0? -25, 0 Determine d so that 6d4/19 + 310d*3/19 - 1424d*2/19 + 1784d/19 - 448/19 = 0. -56, 1/3, 2 Suppose -2v3/7 + 52v*2/7 - 30v - 1800/7 = 0. What is v? -4, 15 Solve 5c2 + 320c + 5120 = 0. -32 Factor 9m4 + 150m*3 + 348m*2 + 168m. 3m(m + 2)(m + 14)(3m + 2) Let -5s*3/3 + 6s*2 + 308s/3 + 40 = 0. What is s? -6, -2/5, 10 What is j in -j*2/2 - 93j/2 - 135 = 0? -90, -3 Find p, given that -2p4/13 + 6p*3/13 - 4p*2/13 = 0. 0, 1, 2 Solve 2i*4 + 904i*3 - 910i*2 - 1812i = 0 for i. -453, -1, 0, 2 Factor -4l4 + 116l*3 - 640l*2 - 3072l. -4l(l - 16)*2(l + 3) Solve 3y3 + 1557y*2 - 9423y + 14175 = 0 for y. -525, 3 Factor 2k3 + 14k*2 - 8k - 56. 2(k - 2)(k + 2)(k + 7) Factor k3 - 5k*2 - 104k. k(k - 13)(k + 8) Determine s, given that 2s3/11 - 296s*2/11 + 1160s/11 - 1152/11 = 0. 2, 144 Factor o*3/4 - 73o*2/2 - o/4 + 73/2. (o - 146)(o - 1)(o + 1)/4 Determine a, given that -2a*2/7 - 3158a/7 - 3156/7 = 0. -1578, -1 Factor -3p3 - 2p*2 + 127p - 42. -(p - 6)(p + 7)(3p - 1) What is x in 2x*3/15 - 4x*2/15 - 2x/5 = 0? -1, 0, 3 Suppose 4o3 - 8o*2 - 12o = 0. Calculate o. -1, 0, 3 Factor -2f2/5 - 716f/5 - 64082/5. -2(f + 179)2/5 Factor 4g*3 + 288g*2 + 6324g + 38440. 4(g + 10)(g + 31)*2 Solve -42v*4 + 723v*3 - 3303v*2 + 4833v - 891 = 0. 3/14, 3, 11 Let -5i4 + 5140i*3 - 1320980i*2 = 0. What is i? 0, 514 Solve -4w*3 + 36w*2 + 136w + 96 = 0 for w. -2, -1, 12 Factor -3c4 + 3c*3 + 6c*2. -3c*2(c - 2)(c + 1) Let q4/7 - 3q*2/7 - 2q/7 = 0. Calculate q. -1, 0, 2 Factor 12n4 - 448n*3 + 4028n*2 + 2888n. 4n(n - 19)*2(3n + 2) Solve 28b*3 - 68b*2 + 52b - 12 = 0. 3/7, 1 Factor -4x4 - 284x*3 - 1352x*2 - 2128x - 1056. -4(x + 1)(x + 2)*2(x + 66) Factor -2o3 + 19o*2 - 38o + 21. -(o - 7)(o - 1)(2o - 3) Determine m so that -m2/6 + 25m/3 - 49/6 = 0. 1, 49 Factor -4l2 + 20l - 16. -4(l - 4)(l - 1) Suppose 3c3 + 303c*2 + 300c = 0. Calculate c. -100, -1, 0 Determine k so that -7k3/2 - 169k*2 - 425k/2 - 47 = 0. -47, -1, -2/7 Determine g, given that g*3/7 - 26g*2/7 + 71g/7 - 46/7 = 0. 1, 2, 23 Factor 4u3/3 + 164u*2/3 + 104u. 4u(u + 2)(u + 39)/3 Factor 16n*2 - 132n - 484. 4(n - 11)(4n + 11) Solve 5s*5 - 75s*4 + 235s*3 + 315s*2 = 0. -1, 0, 7, 9 Factor 22q*4 - 26q*3 + 4q*2. 2q*2(q - 1)(11q - 2) What is j in j5/2 + j4/2 - 7j3/2 - j2/2 + 3j = 0? -3, -1, 0, 1, 2 Factor -s*4 + 2s*3 + 20s*2 + 24s. -s(s - 6)(s + 2)2 Solve -m3 + 5m2 + m - 5 = 0. -1, 1, 5 Let -5f*2 + 1850f - 171125 = 0. Calculate f. 185 Find d such that 4d4/7 + 36d*3/7 - 4d*2/7 - 36d/7 = 0. -9, -1, 0, 1 What is n in -3n3 + 150n*2 - 1971n + 7776 = 0? 9, 32 Determine s so that s*5 + 53s*4 + 618s*3 - 2240s*2 + 1568s = 0. -28, 0, 1, 2 Determine j, given that 3j2/4 - 1275j/2 + 541875/4 = 0. 425 Factor -2g5 - 6g*4 + 18g*3 - 10g*2. -2g*2(g - 1)*2(g + 5) Find b such that -2b2 - 2b + 12 = 0. -3, 2 Solve -4y2 - 1596y + 1600 = 0. -400, 1 Suppose -14i2/9 + 422i/9 + 124/3 = 0. What is i? -6/7, 31 Factor -2x3/13 + 14x*2/13 - 12x/13. -2x(x - 6)(x - 1)/13 Let -2i*2/3 + 353i/2 + 265/6 = 0. Calculate i. -1/4, 265 Factor -27s4 + 183s*3 + 42s*2. -3s*2(s - 7)(9s + 2) Find i such that -4i5 + 44i*4 + 1256i*3 + 3464i*2 + 3356i + 1100 = 0. -11, -1, 25 Suppose 2a2/7 - 2808a/7 - 2810/7 = 0. Calculate a. -1, 1405 Factor -3h4 + 132h*3 - 1161h*2 - 6480h - 5184. -3(h - 24)2(h + 1)(h + 3) Factor 6a*2/5 + 8a/5 + 2/5. 2(a + 1)(3a + 1)/5 Factor -4q*2/5 + 464q/5 - 912/5. -4(q - 114)(q - 2)/5 Suppose 2z3/5 - 36z*2/5 - 78z/5 - 8 = 0. Calculate z. -1, 20 Suppose -2z4/9 + 28z*3/9 + 32z*2/3 + 100z/9 + 34/9 = 0. Calculate z. -1, 17 Factor -3v2/4 - 7v/2 - 15/4. -(v + 3)(3v + 5)/4 Let c3/6 + c2/2 - 24*c + 70/3 = 0. Calculate c. -14, 1, 10 Fi	{ "pile_set_name": "DM Mathematics" }
6160000 to the nearest 1000000. 6000000 Round -4.3789 to the nearest integer. -4 Round 0.242962 to 3 decimal places. 0.243 Round 0.00172 to three decimal places. 0.002 What is -10.09 rounded to zero decimal places? -10 Round 159400 to the nearest 1000. 159000 Round -5340 to the nearest one hundred. -5300 What is 42.116 rounded to 1 dp? 42.1 What is -0.0158773 rounded to 2 dps? -0.02 Round 0.00023487 to four decimal places. 0.0002 What is -30.143 rounded to the nearest integer? -30 What is -604000 rounded to the nearest 10000? -600000 What is -0.0040429 rounded to five dps? -0.00404 What is -0.0000082006 rounded to six dps? -0.000008 What is -5.93 rounded to the nearest integer? -6 Round -0.056091 to 2 dps. -0.06 Round 0.000064 to 4 decimal places. 0.0001 What is 0.000004925 rounded to seven decimal places? 0.0000049 What is 0.004859 rounded to three decimal places? 0.005 Round 2894 to the nearest 100. 2900 Round 169.85 to the nearest 10. 170 What is 312800 rounded to the nearest 1000? 313000 What is 0.00000263 rounded to 6 decimal places? 0.000003 What is 320.431 rounded to the nearest one hundred? 300 Round 18340000 to the nearest one million. 18000000 Round 3889100 to the nearest one million. 4000000 Round 0.003548 to four dps. 0.0035 What is 0.00023667 rounded to 6 dps? 0.000237 Round 21.52 to zero dps. 22 Round -0.000025666 to 7 dps. -0.0000257 What is 831.27 rounded to the nearest one hundred? 800 Round -0.000109168 to six dps. -0.000109 What is -318.82 rounded to the nearest 10? -320 Round -636000 to the nearest one hundred thousand. -600000 What is 6780.6 rounded to the nearest 1000? 7000 Round -0.0088819 to 4 decimal places. -0.0089 What is -0.000003804 rounded to 6 dps? -0.000004 Round 3.842 to 1 dp. 3.8 Round -0.00000478 to 7 dps. -0.0000048 Round -0.53626 to one decimal place. -0.5 What is 0.012297 rounded to 4 decimal places? 0.0123 What is 32983 rounded to the nearest one thousand? 33000 Round 0.0214 to 3 decimal places. 0.021 What is 0.000001196 rounded to seven dps? 0.0000012 What is 537680 rounded to the nearest 100000? 500000 What is -0.000095549 rounded to 6 decimal places? -0.000096 Round 0.0013821 to 4 decimal places. 0.0014 Round 0.001959 to 4 dps. 0.002 Round -266390000 to the nearest 1000000. -266000000 Round 469.9 to the nearest 100. 500 Round 0.01199 to three dps. 0.012 Round -0.0001186 to six decimal places. -0.000119 What is 0.0053289 rounded to three dps? 0.005 What is 0.000010692 rounded to six decimal places? 0.000011 What is 0.004438 rounded to 4 dps? 0.0044 Round 7290 to the nearest one hundred. 7300 What is -1578950 rounded to the nearest ten thousand? -1580000 What is 0.0542 rounded to two decimal places? 0.05 Round 0.00084788 to 3 decimal places. 0.001 What is 2669900 rounded to the nearest ten thousand? 2670000 What is 1942.8 rounded to the nearest one hundred? 1900 Round -62762.1 to the nearest one thousand. -63000 What is -466040 rounded to the nearest one thousand? -466000 Round -12.43 to the nearest integer. -12 What is -0.1099 rounded to one dp? -0.1 What is 0.151438 rounded to 3 dps? 0.151 Round 0.012947 to four dps. 0.0129 What is -0.001711 rounded to 4 dps? -0.0017 Round 4853 to the nearest 100. 4900 What is -252500 rounded to the nearest 10000? -250000 Round -0.0000136 to five dps. -0.00001 What is -271290 rounded to the nearest 100000? -300000 What is -1125550 rounded to the nearest one hundred thousand? -1100000 Round 0.34036 to 2 dps. 0.34 Round -23.99 to zero decimal places. -24 Round 0.000006299 to 6 decimal places. 0.000006 What is -0.00000129 rounded to six decimal places? -0.000001 What is 0.000066 rounded to five dps? 0.00007 What is -0.0000002671 rounded to seven decimal places? -0.0000003 What is -11.555 rounded to 0 dps? -12 What is -636 rounded to the nearest 10? -640 Round 7074 to the nearest 100. 7100 Round 0.000002318 to 7 dps. 0.0000023 Round -0.00077294 to six decimal places. -0.000773 What is 344762000 rounded to the nearest 1000000? 345000000 Round -6914000 to the nearest one hundred thousand. -6900000 What is -1642300 rounded to the nearest ten thousand? -1640000 What is 34.86 rounded to zero dps? 35 Round -2373000 to the nearest 1000000. -2000000 What is -0.00003812 rounded to six decimal places? -0.000038 Round -64.06 to the nearest 10. -60 What is -0.0002267 rounded to four decimal places? -0.0002 What is 7879 rounded to the nearest one thousand? 8000 Round 18457000 to the nearest 100000. 18500000 Round 0.0000002049 to six decimal places. 0 What is -11469 rounded to the nearest 1000? -11000 What is 0.00089937 rounded to 6 decimal places? 0.000899 Round -0.0001176 to 6 dps. -0.000118 What is 234300 rounded to the nearest ten thousand? 230000 What is -0.7319 rounded to 2 decimal places? -0.73 What is 13419 rounded to the nearest 1000? 13000 What is 3560 rounded to the nearest one thousand? 4000 What is 166610 rounded to the nearest 1000? 167000 What is 3.3081 rounded to 1 decimal place? 3.3 Round 104590 to the nearest one thousand. 105000 Round -155800000 to the nearest 1000000. -156000000 Round -0.00011323 to five dps. -0.00011 Round -0.4432 to two dps. -0.44 What is 0.00005512 rounded to 6 dps? 0.000055 Round -0.00003585 to 5 decimal places. -0.00004 What is -93087000 rounded to the nearest 1000000? -93000000 Round 32.63 to the nearest 10. 30 Round 266390 to the nearest one hundred thousand. 300000 Round 0.294 to one dp. 0.3 What is 393.525 rounded to 0 dps? 394 What is 0.0000176 rounded to 5 decimal places? 0.00002 Round -15900 to the nearest ten thousand. -20000 Round 5578000 to the nearest one hundred thousand. 5600000 What is -1371.7 rounded to the nearest 100? -1400 What is 2295 rounded to the nearest 1000? 2000 What is -60480 rounded to the nearest ten thousand? -60000 What is 12880000 rounded to the nearest one hundred thousand? 12900000 What is -17533 rounded to the nearest one hundred? -17500 What is 1.9528 rounded to 1 decimal place? 2 What is -885800 rounded to the nearest one hundred thousand? -900000 Round 0.00124634 to 4 dps. 0.0012 What is 8.9 rounded to the nearest integer? 9 What is -308.26 rounded to the nearest 10? -310 What is -0.0000022 rounded to six dps? -0.000002 What is -16497 rounded to the nearest 100? -16500 What is 50257000 rounded to the nearest 100000? 50300000 Round 0.0018762 to 5 dps. 0.00188 Round -39222000 to the nearest one hundred thousand. -39200000 What is 1425460 rounded to the nearest 100000? 1400000 Round 811.2 to the nearest ten. 810 What is 0.000036509 rounded to seven decimal places? 0.0000365 What is -4987.5 rounded to the nearest 1000? -5000 Round 0.0004125 to 5 decimal places. 0.00041 Round -512.192 to the nearest integer. -512 Round 0.0000700729 to 6 decimal places. 0.00007 What is 0.03247 rounded to 2 decimal places? 0.03 Round 7990000 to the nearest one million. 8000000 Round -3897000 to the nearest 100000. -3900000 Round 6740000 to the nearest one hundred thousand. 6700000 What is 3060 rounded to the nearest 10000? 0 What is 14.101 rounded to 0 decimal places? 14 What is -5330 rounded to the nearest one thousand? -5000 Round -0.00668 to 3 decimal places. -0.007 What is -5624200 rounded to the nearest one hundred thousand? -5600000 What is 0.0004318 rounded to five decimal places? 0.00043 Round 0.00003181 to six decimal places. 0.000032 What is 0.0000144158 rounded to 6 decimal places? 0.000014 Round -0.15617 to 3 dps. -0.156 What is 3880300 rounded to the nearest ten thousand? 3880000 Round -1150000 to the nearest one million. -1000000 Round -0.00003197 to six dps. -0.000032 Round 0.00008707 to 5 dps. 0.00009 What is -35 rounded to the nearest ten? -40 Round 0.29878 to two decimal places. 0.3 What is 0.00000062889 rounded to 7 dps? 0.0000006 What is 0.0000137749 rounded to seven decimal places? 0.0000138 What is -253560 rounded to the nearest ten thousand? -250000 Round -15.4033 to 1 decimal place. -15.4 Round 9.3 to 1 dp. 9.3 What is 22855 rounded to the nearest 1000? 23000 Round 155000 to the nearest 100000. 200000 Round 16877000 to the nearest one hundred thousand. 16900000 Round -1.96 to 1 dp. -2 What is 3.79 rounded to zero decimal places? 4 Round 127.94 to the nearest 10. 130 Round -0.01283 to three dps. -0.013 Wh	{ "pile_set_name": "DM Mathematics" }
f3 Find the second derivative of -j5 + 17425183j4 - 11455911j - 8. -20j3 + 209102196j*2 Find the third derivative of 4650448m*3 + 1750m*2 + 5m - 121. 27902688 Find the third derivative of 21217842hv*3 + 10hv2 + 4hv + 3h - v*2 + 424v - 82 wrt v. 127307052h Find the second derivative of -150j*4 + 9j*3 + 6740j*2 + 79421j - 166. -1800j2 + 54j + 13480 What is the second derivative of 18300l3 - 99l*2 + 5l - 62701? 109800l - 198 What is the third derivative of -32b*3i*2j - 98629b3j*3 - 2b*2ij3 + 15b*2j - 98723i2j*2 wrt b? -192i*2j - 591774j3 Differentiate -233704036k + 1448563674 with respect to k. -233704036 Find the second derivative of 93i2w*2 + 238641i*2w - iw2 + iw + 448274w2 wrt i. 186w*2 + 477282w What is the first derivative of 219c3 - 62818c*2 + 15636999? 657c*2 - 125636c What is the third derivative of -65dgm3 + 9dgm*2 - 308dm3 + 1036d - gm3 + 2gm2 + 8m*3 + 54 wrt m? -390dg - 1848d - 6g + 48 Differentiate -151213743h*2 - 104293345 wrt h. -302427486h Find the second derivative of -119i2o*3 - 168i*2o2 + i2o - 61io3 - 20i - o*2 - 300 wrt i. -238o*3 - 336o*2 + 2o What is the third derivative of 4615867u3x - 484u2 + 16016ux wrt u? 27695202x What is the second derivative of 3855648y2 - 1042600y? 7711296 What is the second derivative of 78l5 + 235221l*4 + 16l + 704453 wrt l? 1560l3 + 2822652l*2 What is the third derivative of 559715p*5 - 12p*3 + 3p*2 + 3740p + 1651 wrt p? 33582900p2 - 72 Find the third derivative of -346173072b*6 + 378b*2 - 401b + 776 wrt b. -41540768640b3 What is the derivative of -2881hj2 - 7hj - 41795248h + 3j2 - 3j wrt j? -5762hj - 7h + 6j - 3 What is the derivative of -45232547h + 12356403? -45232547 What is the third derivative of -32238j*4 - 2388j*3 + 2228j*2 - 4234j - 1? -773712j - 14328 What is the derivative of -j4 + 16996228j - 414757596? -4j3 + 16996228 Find the first derivative of -1687562f*2z + 2fz*2 - 5066439z*2 wrt f. -3375124fz + 2z*2 What is the derivative of -2rt3 + 75989418rt - 56207299r wrt t? -6rt*2 + 75989418r What is the first derivative of -87155855p - 49496091 wrt p? -87155855 What is the second derivative of -35o*2v*2 - 85o*2v + ov2 - 2ov + 4442v*2 - 3323v - 14 wrt v? -70o2 + 2o + 8884 Find the second derivative of -b*5 - 43172254b4 + b2 + 25474605b. -20b*3 - 518067048b*2 + 2 What is the derivative of -365266200r + 570078975? -365266200 Find the first derivative of 14615316u3 + 10951838. 43845948u*2 Find the third derivative of -899976964f*3 - 567263434f*2. -5399861784 Find the first derivative of -100c*4z - 17793c3z*2 - 4743780z*2 wrt c. -400c*3z - 53379c2z*2 Differentiate -630u*3 + 11u*2 + 329u - 111730742. -1890u2 + 22u + 329 Differentiate 1025331952r - 1395566298. 1025331952 Find the first derivative of -106jp2 + 8jpz + 167362p2z + 3499p2 wrt z. 8jp + 167362p*2 Find the third derivative of -8082877l*4 + 5251330l*2 wrt l. -193989048l What is the second derivative of 39268d3 + 8115d*2q*3 - dq*3 - dq*2 + 5dq - 1513q*3 + 2q*2 + 3 wrt d? 235608d + 16230q3 What is the third derivative of -127385380vy3 + 43vy2 + 3vy - 2v - y*3 + 2y*2 - 3y wrt y? -764312280v - 6 What is the first derivative of 64274113g*3j*2 + 2g*3j - 28j2 - 499j - 32 wrt g? 192822339g2j*2 + 6g*2j What is the second derivative of -2c3i*2 + 2c*3i + c*2 + 99992ci2 + 678ci - c - 27i*3 + 11162 wrt i? -4c*3 + 199984c - 162i What is the first derivative of -19b*2 + 300272b + 107196413 wrt b? -38b + 300272 What is the second derivative of 52359a*3 - 488a*2 - 112814058a wrt a? 314154a - 976 What is the second derivative of -133863007f*3y - 3f2 + 19631f - 603y wrt f? -803178042fy - 6 Differentiate -24211h*4 + 7169h + 321542701 wrt h. -96844h3 + 7169 What is the third derivative of su*3 - 42231su2 + 118s + 1687u6 - 340u*3 wrt u? 6s + 202440u3 - 2040 What is the second derivative of 353v*3 + 17385v*2 + 33205722v wrt v? 2118v + 34770 Differentiate 304837j*3r - 1574j3 + 133j*2r + 7526j2 with respect to r. 304837j*3 + 133j*2 Find the third derivative of -12784742z*3 - 151714904z*2 wrt z. -76708452 What is the first derivative of -382691257sv4 + 651071566s wrt v? -1530765028sv*3 What is the third derivative of -685352514f*4m - 1359f2m + 37f + 3m + 164 wrt f? -16448460336fm Find the second derivative of -53797071i2 - 2i - 2232919. -107594142 What is the first derivative of -2cnt2 + 8cn - 657ct + 4c - nt2 - nt + n - 1289 wrt t? -4cnt - 657c - 2nt - n What is the third derivative of 16370519t3 - 29997225t*2? 98223114 What is the second derivative of 104786756k*2 + 130884774k? 209573512 What is the second derivative of -5994p3 + 3p*2y - 33p2 + 6945py + 11p - 14y + 2 wrt p? -35964p + 6y - 66 Find the second derivative of -108d*4 - 103895d*3 + 770d - 38050. -1296d2 - 623370d What is the second derivative of -7212101n2 - 187n + 5542 wrt n? -14424202 Find the second derivative of -3j5 - 13970j*3 - 163j*2 - 251117400j. -60j3 - 83820j - 326 What is the third derivative of -160834006s4 + 4398s*2 + 4s - 2242? -3860016144s Find the second derivative of 685d*3s*5 - 51396d*3s*2 - 635d*3s + 9d2 - 2d + 50s wrt s. 13700d*3s*3 - 102792d*3 Differentiate 96161n*3ps3 + 1246n*3s3 - n3s - 554n*3 + 36nps*3 - 2ns3 with respect to p. 96161n*3s*3 + 36ns3 Find the first derivative of -xy*2 + 403xy + 149516x + 37y2 - 12y + 312 wrt y. -2xy + 403x + 74y - 12 Find the third derivative of -507965872v3 + 23846v*2 - 7673v wrt v. -3047795232 What is the third derivative of -102754c2f*3l*3 + 2c*2l - 2c2 - 337cf3 + 111f*3l*3 - 22f*3l*2 + 4f*2 wrt l? -616524c*2f*3 + 666f*3 Find the second derivative of -4985a*3f*3 - 1088a*2f*3 + 13183af + 7760f*3 wrt a. -29910af3 - 2176f*3 Find the first derivative of -2c*4 - 74c*2 - 5764c - 22369509 wrt c. -8c3 - 148c - 5764 Find the third derivative of -2952264r6 - 2r*5 - 26r*2 + 51r - 168. -354271680r3 - 120r*2 What is the third derivative of 22666q*3x*3 + 2q*3x*2 - 206q*3x + 14q2 + 60qx3 + 21qx + x3 - 661 wrt q? 135996x*3 + 12x*2 - 1236x What is the third derivative of 2c3lo2 + 577c*3lo + 5300c*3o + c*2o*2 + 7clo*2 - 3co2 + 849co + 82lo2 - 2l wrt c? 12lo*2 + 3462lo + 31800o Find the third derivative of 29268527z6 + 89466z*2 - z - 2 wrt z. 3512223240z*3 Find the second derivative of 460457d*2i*3 - 2d*2 + 7di2 - 19594237di - 2i*3 wrt i. 2762742d*2i + 14d - 12i Find the third derivative of -77027pq*4 - 32pq + 2301q*6 - 368q*2 - 2807 wrt q. -1848648pq + 276120q*3 Differentiate 163112734l*4 + 30976454. 652450936l*3 What is the third derivative of 30mn3 - mn - 167663n3 + 6n*2 - 262608n - 1 wrt n? 180m - 1005978 What is the third derivative of -276430696m*3 - 2m*2 + 60043645? -1658584176 Find the second derivative of 3578066ah3n*2s + 5ah*2ns + 5ans - 4833h3n + 2n2s wrt n. 7156132ah*3s + 4s What is the second derivative of 24h*5 - 947h*3x*3 - 20h*2x - 8hx - 2x3 + 12573x*2 wrt h? 480h*3 - 5682hx3 - 40x Differentiate -169620013y2 - 247212527 wrt y. -339240026y Find the first derivative of -4793366x - 7804510 wrt x. -4793366 What is the third derivative of -2g*4 - 3216312g*3 + 15478977g*2 wrt g? -48g - 19297872 What is the first derivative of -187774101c - 107616247? -187774101 What is the first derivative of -59445879y*3 - 3y*2 - 79318068 wrt y? -178337637y*2 - 6y Find the first derivative of -883608k2p + 4kp - 27p - 327104 wrt k. -1767216kp + 4p Find the second derivative of 55477804c3 - 299773c - 72 wrt c. 332866824*c What is the thi	{ "pile_set_name": "DM Mathematics" }
. -4 Suppose 0k - k - 2x = 8, -12 = -3k + 3x. Let m be (0 - -3)(k + 1). What is n in 261n*4 + 10n*m - 260n*4 + 36n*2 + 54n + 12 + 15 = 0? -3, -1 Let x(p) be the third derivative of -1/420p7 + 0 + 12p*2 + 1/40p*5 + 1/240p*6 + 1/6p*3 + 0p - 5/48p4. Factor x(s). -(s - 1)3(s + 2)/2 Let q(s) be the third derivative of s*7/1680 - 3s6/320 + s5/20 - s*4/12 - 35s*2. Factor q(n). n(n - 4)*2(n - 1)/8 Let x(m) be the second derivative of -m*4/12 - 7m*3/3 - 49m*2/2 - 93m. Let x(j) = 0. What is j? -7 Let g(d) = d*2 + d - 1. Let x(a) = -18a*2 - 24a + 20. Let n(u) = -u*2 - u. Let p(s) = 6n(s) - x(s). Let l(k) = 20g(k) - 2p(k). Factor l(w). -4(w - 1)(w + 5) Let y(j) be the third derivative of -2j7/525 - 2j6/75 + j5/75 + 2j4/15 - 54j*2. Factor y(f). -4f(f - 1)(f + 1)(f + 4)/5 Let c(n) be the third derivative of n7/630 - n6/40 + 2n*5/15 - 5n*4/18 - 5n*2 + n. Factor c(j). j(j - 5)(j - 2)2/3 Let x = -463/5 - -93. Let p(g) = 8g + 117. Let j be p(-14). Factor 7/5i2 - 1/5ij + i4 - 9/5i3 - xi + 0. -i(i - 2)(i - 1)*3/5 Let y = 227/322 + -33/161. Factor -2o + 0 + yo2. o(o - 4)/2 Let f be (-20)/(-42)(-243)/(-45). Find m such that 27/7m*3 + 0 + 0m + 0m2 + 3/7m*5 - fm*4 = 0. 0, 3 Suppose -j = 5b - 1412, 4b + 6940 = 5j - b. Suppose 2500k4 + 6608k*3 + 5102k + 621 + 403 + 9600k2 + jk*3 + 18k = 0. Calculate k. -4/5 Let v(x) be the first derivative of -x7/1470 + x6/126 - 2x5/105 - x3 - 21. Let w(n) be the third derivative of v(n). Factor w(l). -4l(l - 4)(l - 1)/7 Let c be -44/4 + 11. Suppose -cy = -4 - 129. Factor 2 - 5q2 - 2 + 9q - yq. -5q(q + 2) Suppose 5i = 3i + 8. Let s = 38 - -70. Determine x so that -37x*3 - sx*i + 46x*2 + 109x*3 - 13x*2 + 3x = 0. -1/6, 0, 1 Let v(q) be the third derivative of 17/24q4 - 7/30q5 - q2 + 0q + 0 - 5/6q*3. Factor v(f). -(2f - 1)(7f - 5) Let w(z) be the third derivative of -z*5/270 + 55z*4/108 + 59z*2 + 2z. What is m in w(m) = 0? 0, 55 Let u be 35/15 - (-8)/12. Let y(r) be the second derivative of 1/42r7 + 4r + 0ru + 0r*2 + 0r*4 + 0r*6 + 0r*5 + 0. Find t such that y(t) = 0. 0 Let m(o) = -14o*2 + 6o - 19. Let g(y) = 5y2 - 2y + 6. Let n(i) = 17g(i) + 6m(i). Let w be n(-5). Determine x so that -7/2x - x2 - 1 + 3/2xw = 0. -1, -1/3, 2 Let f(s) be the third derivative of s6/1260 + 3s5/70 + 27s*4/28 - 11s*3/3 - 32s*2. Let j(h) be the first derivative of f(h). Factor j(z). 2(z + 9)*2/7 Let t = 157/6 + -1715/66. Factor tp*4 + 0p + 0 - 4/11p2 + 2/11p*3. 2p*2(p - 1)(p + 2)/11 Let k(w) be the third derivative of 0w + 0 - 150w3 - 1/15w*5 - 5w*4 - 25w*2. Factor k(r). -4(r + 15)*2 Let g = 4/921 + 1168/13815. Let u(b) be the first derivative of 0b - 1/15b2 - 1/30b*4 - 5 + gb*3. Let u(y) = 0. What is y? 0, 1 Suppose -10 = 2x - 14. Factor -13l4 - l - 12l*4 + 9lx - l3 - 14l3. -l(l + 1)(5l - 1)2 Solve -w3 - 9w2 + 8w*4 - 10w*4 + 10w*2 = 0. -1, 0, 1/2 Let l(p) be the second derivative of 8/21p*3 - 1/21p*6 + 18p + 4/7p2 - 1/10p*5 + 0 - 1/147p*7 + 1/42p*4. Determine y, given that l(y) = 0. -2, -1, 1 Suppose 4o - 4u = 2 - 14, -4o - 22 = -6u. Factor 0g - 18/7g4 + 0g*o - 3/7g*5 + 0 - 27/7g*3. -3g*3(g + 3)*2/7 Let d(a) = -9a*3 - 42a*2 + 3a + 42. Let t(p) = -p3 - p2 + 1. Let f(k) = -d(k) + 6t(k). Factor f(q). 3(q - 1)(q + 1)(q + 12) Suppose -4m - 30 = -19m. Let v be (-16)/(-64) + m/24. Solve 2/3l2 - 1/3l + vl3 - 2/3 = 0 for l. -2, -1, 1 Let a = -110 - -70. Let m be (-1)/5 - 16/a. Let 0w2 - w4 + 0w + 4/5w*5 + 0 + mw*3 = 0. What is w? 0, 1/4, 1 Let m = 623 - 620. Let n(s) be the first derivative of 1/10s*5 + 1 + 0s + 1/8s2 - 1/24s*6 - 1/6s*m + 0s*4. Let n(j) = 0. What is j? -1, 0, 1 Factor -17/7y*2 - 24/7 - 206/7y. -(y + 12)(17y + 2)/7 Suppose 1 - 86 = -5u. Suppose -5j + 24 = 3c, -2c - uj + 3 = -18j. Factor 1/4bc + 0 - 1/2b*2 + 1/4b. b(b - 1)2/4 Factor -270/7g - 6075/7 - 3/7g2. -3(g + 45)*2/7 Suppose -344g + 19g2 - 41306g3 - g4 - g*4 + 137g*2 + 240 + 41288g*3 = 0. Calculate g. -15, 2 Factor -3/5j - 1/5j3 + 2 - 6/5j*2. -(j - 1)(j + 2)(j + 5)/5 Let d(u) be the second derivative of -73u*4/18 + 16u*3 + 4u*2/3 - 509u. Factor d(o). -2(o - 2)(73o + 2)/3 Let v = -25/316 + 391/948. Suppose 1/3i*2 + 0i - v = 0. Calculate i. -1, 1 Factor 2d3 - 6d*3 - 72 + 54d - 6d2 + 6d - 4d3 + 5d*3. -3(d - 2)*2(d + 6) Suppose 28 = 3i + 5k, 0i + 4k - 38 = -5i. Let p(o) be the second derivative of 1/25o*5 - io + 2/15o4 + 0o*2 + 2/15o*3 + 0. Solve p(h) = 0 for h. -1, 0 Let t be (-9)/((-18)/(-92))(-2)/(-12). Let m = -10/3 - t. Suppose 2/3a + 19/3a*3 - 11/3a2 + a5 - ma4 + 0 = 0. What is a? 0, 1/3, 1, 2 Let v(m) = -9m*5 + 6m*4 + 9m*3 - 6m + 6. Let g(d) = 8d3 + 28d*4 + 4 + 1 - 23d*4 - 8d*5 - 5d. Let y(k) = -6g(k) + 5v(k). Factor y(c). 3c3(c - 1)(c + 1) Let r(w) be the first derivative of -w4/2 - 4w3/3 + w2 + 4w - 70. Find k, given that r(k) = 0. -2, -1, 1 Find z, given that 8/3 + z2 - 10/3z = 0. 4/3, 2 Suppose -79r5 - 99r - 2r5 - 12 - 139r*2 - 117r*4 + 72r*2 + 11r + 365r3 = 0. What is r? -3, -2/9, 1 Let s(i) be the second derivative of 0i*2 + 5/42i*7 - 14i + 5/6i6 + 0 + 2i*5 + 0i*3 + 5/3i*4. Factor s(g). 5g*2(g + 1)(g + 2)2 Suppose m - 5m - h + 268 = 0, -3m - h + 200 = 0. Let x = -68 + m. Factor -1/6n*2 + 0n - 1/6n3 + x. -n2(n + 1)/6 Let i(w) be the third derivative of w9/6720 + w8/6720 - w7/210 + w6/60 + 3w5/20 - 2w*2. Let v(b) be the third derivative of i(b). Factor v(h). 3(h - 1)(h + 2)(3h - 2) Let t be 62/22 - (420/(-132) + 3). Suppose -2/5u*2 + 2/5 - 2/5u*t + 2/5u = 0. Calculate u. -1, 1 Let b(q) = q*2 - q. Let a(l) = -5 - 2l*2 + 4l*3 + 6l - 4 + 1. Let x be (-3)/(-5) + (-16)/120-3. Let d(z) = xa(z) + 10b(z). Factor d(v). 4(v - 1)(v + 1)(v + 2) Let d(t) be the second derivative of t7/5040 + t6/360 + t*5/80 - 19t*4/12 - 14t. Let i(k) be the third derivative of d(k). Determine s so that i(s) = 0. -3, -1 Suppose -17t + 266 = -40. What is q in 3q*5 - 51/2q*2 + t + 6q + 15/2q4 - 9q*3 = 0? -2, -1, 1, 3/2 Let n(b) be the third derivative of 8b*2 + 5/3b*4 + 0 + 0b + 1/2b6 + 19/12b*5 + 5/6b*3. Factor n(g). 5(g + 1)(3g + 1)(4g + 1) Let g(z) = 2z4 - 7z*3 + 19z*2 + 22z - 6. Let w(f) = 3f4 - 6f*3 + 21f*2 + 22f - 8. Let p(n) = -4g(n) + 3w(n). Solve p(k) = 0. -11, -1, 0, 2 Suppose 0 = 2x - 2p - 20, x - 2p = 6x - 36. Let d be ((-9)/72)/((-6)/x). Determine j, given that -1/2j - 1/3 - dj2 = 0. -2, -1 Let d(t) be the second derivative of t7/7 + 8t6/15 + 3t5/5 - t3/3 - 88t. Determine c so that d(c) = 0. -1, 0, 1/3 Let r(l) be the first derivative of l5/15 - 17l*4/6 + 11l3/3 + 195. Factor r(o). o2(o - 33)(o - 1)/3 Let i(y) be the first derivative of 5y6/12 + 19y*5/10 + 13y*4/4 + 7y3/3 + y2/4 - y/2 + 549. Factor i(g). (g + 1)*4(5g - 1)/2 Let w = -2/13407 + 13411/26814. Determine n so that wn*2 - 1/2 + 1/4n*3 - 1/4n = 0. -2, -1, 1 Suppose 3j = -3a - 0j, -j - 15 = -4a. Let z = 5 - a. Determine r, given that -37 - r - r*z + 37 = 0. -1, 0 Let d be -162(-1)/(-4). Let i = 16 + d. Factor ic*3 + 0 - c + 1/2c*2. c(c - 1)(c + 2)/2 Suppose 3t = -m + 10, 5m = -4t - 0 + 6. Let s(g) = -g*2 + g + t + 0g*2 - 5. Let v(f) = -4f*2 + 3f + 1. Let d(w) = 3s(w) - v(w). Factor d(x). (x - 2)(x + 2) Let z(f) be the second derivative of f9/3780 - f8/840 + f7/630 - f4 - f. Let h(b) be the third derivative of z(b). Factor h(y). 4y2(y - 1)*2 Let z(o) = o + 4o*3 - 2o3 + o3 - 2o3 + 12o*2 + 14. Let u be z(-12). Let -6n*3 + 11n*2 + 3n*4 - 3 - 11n*u + 6n = 0. Calculate n. -1, 1 Let 32/5t + 14/5t2 + 8/5 = 0. Calculate t. -2, -2/7 Let d(z) = -z3 + z*2 - z + 1. Let u(a) = -4a*4 - 58a*3 - 198a*2 - 258a + 6. Let x(i) = -6d(i) + u(i). Factor x(p). -4p(p + 3)2(p + 7) Suppose -12v + 10 = -11v. Facto	{ "pile_set_name": "DM Mathematics" }
2. Find the third derivative of h(q) wrt q. 384q Let c = -2 - -2. Suppose -3d + 4x + 24 = 0, -5d - 3x = -cx - 11. Find the first derivative of -d + 2y*3 + 5y*3 - 3y*3 + 1 wrt y. 12y*2 Let w(y) = y + 13. Let h be w(-9). Suppose -2 = -2j + j + hg, 5j - 31 = -g. What is the second derivative of -jo - 3o4 + o4 - 2o4 wrt o? -48o*2 Suppose 10c - 4 = 9c. Find the second derivative of 18y*2 + cy - 33y2 + 10y wrt y. -30 Let c(q) = -2q3 + 36q*2 + 31q - 6. Let p(a) = 6a3 - 107a*2 - 94a + 17. Let i(n) = -17c(n) - 6p(n). What is the second derivative of i(g) wrt g? -12g + 60 Let z(q) be the first derivative of 17q*8/336 - 25q*4/24 - 5q*2 + 9. Let k(g) be the second derivative of z(g). Find the second derivative of k(s) wrt s. 340s*3 Suppose 0 = -5h + 3w + 12, 0h - 4h + 15 = 3w. What is the second derivative of -16t3 - 14t + 29t3 - th wrt t? 72t Suppose 0 = -3u - 2u + 125. Let s = 33 - u. What is the second derivative of sx + 6x3 + x + x3 - 3x wrt x? 42x Let c be (-9)/12 - (-21)/28. Let x be (c + 2)(-5)/(-2). Find the second derivative of 8h*3 - xh*3 + 9h - 4h3 wrt h. -6h Let c(v) = v*2 + 5v - 10. Let p be c(-6). Let j be p-3(-2)/(-8). What is the first derivative of -6w3 + 4w3 - wj + 0 - 6 wrt w? -9w2 Differentiate -27m - 54 + 3 - 20m - 20 - 18m wrt m. -65 Let n(q) = 3q - 8. Let f be n(4). Suppose -b = f - 16. What is the derivative of 6 - 12a + ba + 6a*4 wrt a? 24a*3 Let k(p) be the second derivative of -5p4/12 + p3/2 + 53p2 + 12p. Differentiate k(x) wrt x. -10x + 3 Let v(o) = -o2 + 12o - 15. Let x be v(11). Let r = x - -7. Find the second derivative of -2l5 + rl + 0l - l5 wrt l. -60l*3 Let o = -29 + 34. What is the third derivative of 12w*o + 6w*5 - 7w*5 + 15w*5 + 21w*2 wrt w? 1560w2 Let r(q) = -q2 + 5q - 4. Let n be r(3). What is the third derivative of 9i*3 - 17i + 3in + 17i wrt i? 54 Let p(j) = -j*3 + 4j*2 + 7j - 9. Let c be p(4). What is the derivative of 2x - 2x + c + 2x3 + 40x*3 wrt x? 126x*2 Let a(w) be the third derivative of 16w6/15 - w5/60 + 7w3/3 - 124w2. Find the third derivative of a(m) wrt m. 768 Let h(i) be the first derivative of -i6/6 - 179i5/5 + 40i3/3 - i2/2 + 236. Find the third derivative of h(p) wrt p. -60p2 - 4296p Let m be (-35)/(-21) - 8/(-6). What is the second derivative of 0z3 + 10z - 4z3 + 4z*m + 5z*4 wrt z? 60z*2 Let p(q) = 89q*3 + 3q*2 - 6q - 86. Let g(h) = h3 - h2 + 2h - 1. Let l(d) = 6g(d) + 2p(d). What is the first derivative of l(o) wrt o? 552o2 Let d(r) = -r5 + 2r4 + r2 - 1. Let o(f) = -189f*5 + 2f*4 + 5f*2 - 26f - 1. Let v(w) = d(w) - o(w). Find the third derivative of v(u) wrt u. 11280u2 Find the second derivative of 9 - 1 - 2d + 7d2 - 8d*2 - d - 36d*2 wrt d. -74 Differentiate -81 - 2g*2 + 67g2 - g2 + 23g2 with respect to g. 174g Let v(g) be the second derivative of 3/2g3 + 0g*2 + 2/21g*7 + 0g*6 + 0 + 0g*5 - 9g + 0g4. What is the second derivative of v(j) wrt j? 80j*3 Suppose -66 = 60o - 66o. Let f(a) = 4a*2 + 1. Let t(x) = 2 - 10x*2 + 23x*2 + 0. Let k(m) = of(m) - 4t(m). Differentiate k(l) with respect to l. -16l Let o(w) = 103w2 - 5w + 438. Let b(m) = -102m2 + 4m - 439. Let s(i) = -5b(i) - 4o(i). Find the first derivative of s(j) wrt j. 196j Let b(k) = 15k - 13. Suppose -4f = -4i - f + 8, 2f - 8 = 0. Let a(c) = 15c - 13. Let m(h) = ia(h) - 4b(h). Find the first derivative of m(n) wrt n. 15 Suppose -2q - g = -5g - 18, 5q + 5g = 15. What is the third derivative of 8h5 + 4h*5 + 3h*q - 4h*5 + 9h*2 wrt h? 660h*2 Let u(y) = y + 27. Let q be u(-17). What is the first derivative of 15 + ql*2 + 21 - 39 wrt l? 20l Let o = -790 - -794. Let g(w) be the third derivative of 0w - 5w*2 + 1/6w*3 + 0 - 1/6w*o. What is the derivative of g(r) wrt r? -4 Suppose 2k - 3k = -4. Find the third derivative of -16i*2 - 3i*k + 8i*4 + 5i*2 wrt i. 120i Suppose -f + 16 = f + 4l, 2l = -4f + 26. Suppose 2m - fi + 2i = 0, -2i = -2. What is the first derivative of 7w*2 - mw*2 + 1 - 3 wrt w? 10w Let v be -22/(-3)3. Let t be (v/10)/((-2)/(-10)). Find the third derivative of 0u6 + tu*6 - 6u*2 + 4u*6 wrt u. 720u*3 Let r(b) be the third derivative of -79b*6/60 + 709b*3/6 - 83b*2 + 3b. Find the first derivative of r(w) wrt w. -474w2 Let a(r) be the first derivative of -r9/252 + r5/20 - 10r*2 + 13. Let h(n) be the second derivative of a(n). Find the third derivative of h(g) wrt g. -240g*3 Suppose 0p - 4p = 32. Let k be 23/7 - p/(-28). What is the third derivative of 0g*2 - 4g*2 + 2g*2 - kg*5 wrt g? -180g*2 Let x = -45 + 58. Find the first derivative of 11v - 3 - 11v - xv - 6 wrt v. -13 Let d(g) be the third derivative of 9g6/20 - 7g5/15 + g3/3 + 66g2. Find the third derivative of d(v) wrt v. 324 Let t(k) be the third derivative of k9/2160 - 3k5/20 - k4/8 + 7k2. Let u(h) be the second derivative of t(h). Find the first derivative of u(o) wrt o. 28o*3 Let y(c) = -155c*3 + 234c*2 - 9c + 5. Let f(p) = -77p3 + 117p*2 - 4p + 2. Let s(h) = 5f(h) - 2y(h). What is the third derivative of s(q) wrt q? -450 Let d = 18 + -25. Let c = d - -14. What is the second derivative of -12s + s2 + cs + 3s2 + 0s*2 wrt s? 8 Let g be 0/(-3) - (-2 - -1). Find the first derivative of 1 + 3 - 3 - 11f*4 + g wrt f. -44f3 Let g(u) = -u2 - 5u + 3. Let h be g(-5). Suppose 0 = -hr - r + 224. What is the first derivative of 2 - rn + 3n*3 + 56n wrt n? 9n2 Let z(v) = -v4 + 6v*3 - 6v*2 + 6v - 21. Let n(q) = 3q4 - 11q*3 + 11q*2 - 11q + 41. Let o(a) = 6n(a) + 11z(a). Differentiate o(c) wrt c. 28c3 Find the third derivative of 33d*4 - 130d*2 - 57d*4 + 28d*4 - 7d*3 wrt d. 96d - 42 Suppose 4f - 2f - 8 = 0. Suppose 4x = -n + 5 - 0, 0 = fn + 2x - 20. Find the third derivative of 14z*3 + 6z*2 - 14z*3 + 3z*n wrt z. 180z*2 Find the second derivative of 0f + 96f2 + 203 - 618f*2 - 415 + 20f + 204 wrt f. -1044 Let r(b) be the first derivative of 87b4/4 + b3/3 - 77b*2/2 - 7b - 968. What is the second derivative of r(m) wrt m? 522m + 2 Let n(u) be the second derivative of -34u5/5 + u4/12 - 26u3 - 159u. What is the second derivative of n(k) wrt k? -816k + 2 Let w be (2/(-5) - (-96)/80)5. Let k(u) be the second derivative of 1/30u6 + 0u*w - u - 2u*2 + 0u*5 + 0 + 0u*3. Differentiate k(c) wrt c. 4c*3 Suppose 30j - 27j = 120. What is the third derivative of 5r*4 - 10r*2 - jr + 20r + 20r - 3r5 wrt r? -180r*2 + 120r Let o = 168 + -165. Let w(t) = 28t2 - 45t + 3. Let h(r) = 1. Let k(p) = oh(p) - w(p). Find the second derivative of k(f) wrt f. -56 Let b(m) = 55m*2 - 7m + 15. Let o(j) = 28j2 - 4j + 7. Let t be 105/(25/(-2)). Let d(i) = tb(i) + 7o(i). Differentiate d(r) with respect to r. -48r Find the third derivative of 7d6 + 48d*4 - 104d*4 - 53d*2 + 56d*4 - 111d*2 wrt d. 840d*3 Let m(d) = -16d*2 + 50d + 73. Let w(p) = -6p2 + 17p + 24. Let s(l) = 4m(l) - 11w(l). Differentiate s(r) with respect to r. 4r + 13 Let r(l) = -3l*6 - 23l*4 + 83l*2 + 2l - 2. Let o(g) = -g*6 + g - 1. Let f(z) = 2o(z) - r(z). What is the third derivative of f(n) wrt n? 120n3 + 552n Let c(b) = 5b - 76. Let s be c(17). Let a(z) be the first derivative of 0z*3 + 1/4z*4 + 3z - s + 0z2. What is the first derivative of a(r) wrt r? 3r*2 Let o = -37 - -41. Differentiate 0 + 10w*3 + 0 + o wrt w. 30w*2 Suppose -2r + 5 = -3. What is the second derivative of -3v + 0v - 7v - v + 8v*r wrt v? 96v*2 Suppose -3t - 1 = y, 3y - 2t + 6t = 17. What is the derivative of yn - 19 + 3n4 - 11n wrt n? 12n3 Let r(o) be the first derivative of o8/210 + o4/2 - 20o*3/3 - 5. Let z(l) be the third derivative of r(l). Find the first derivative of z(k) wrt k. 32k*3 Let h = 0 - -2. Suppose hs + r = 6s - 21, 3 = 2s - 3r. Find the third derivative of 3v*2 + 3v2 + v2 + sv*3 wrt v. 36 Let w be (6/10)/((-7)/(-35))	{ "pile_set_name": "DM Mathematics" }
+ u. Which is the third smallest value? (a) o (b) 2 (c) h b Let k be -2 + (-3662)/276 - 4. Let s = k - 3/46. Let o = s - -176/9. Which is the second biggest value? (a) -0.4 (b) o (c) -3 (d) -1/11 d Let n = -39 - -15. Let v = -59 - n. Let s = v + 36. Which is the second smallest value? (a) s (b) 0.5 (c) 2/19 b Let w be (1/(-10))/(16/(-32)). Which is the fourth smallest value? (a) -0.04 (b) w (c) -0.1 (d) 11 d Let x = -289/15 + 56/3. Let z = 45431 - 45426. Which is the biggest value? (a) z (b) x (c) -30/11 a Let h = -9.4 - -9. Suppose 3o - 12 = 0, 2b + 5o - 28 + 8 = 0. Let t = -857/42 - -281/14. What is the second biggest value in 2/15, b, h, t? b Let u be (-11)/6(-14)/(-154)-4. What is the fourth smallest value in 77, 2/9, u, 2/7? 77 Suppose -2p + z + 2z = 0, 5z = -20. Let h be (p/(-1288))/((-12)/(-936)). Let g = -3/46 - h. Which is the biggest value? (a) -3 (b) g (c) -4 b Let v = 3985/36 + -441/4. Let i = -0.47 - 1.63. Let x = 2 + i. What is the third smallest value in x, 3, v? 3 Let s = -12/35 + -3/35. Which is the fifth biggest value? (a) 2/13 (b) -5 (c) -4/19 (d) -0.5 (e) s b Let t = -4943 - -44491/9. Which is the third biggest value? (a) t (b) 0.2 (c) 1.863 b Let s = 32.032 + -32. Let n = 6.968 + s. Let h = 175 - 179. Which is the second biggest value? (a) n (b) h (c) -1 (d) 1/6 d Let m be (-6)/10(124/(-18) - -8). Let s = 8 - -13. Let q = s - 20. What is the biggest value in q, -0.2, -3/8, m? q Let v = 492 + -502. Let g = -4777/336 + -13/112. Let r = -13 - g. Which is the smallest value? (a) v (b) r (c) 2 a Let l = -3.344 + 1.344. Which is the biggest value? (a) 3/10 (b) l (c) 49 c Let c(o) = 2o*3 + 11o*2 - 33o - 167. Let s be c(-6). What is the second smallest value in s, 2/5, -8/7, 2/11? -8/7 Let c = 3605.4 + -3605. What is the third smallest value in c, 20/11, -4/7, 24, 1/9? c Let k = -16/167 - 373/1336. Let t = 105 - 841/8. Which is the fourth biggest value? (a) 0.2 (b) k (c) t (d) 3 b Suppose -28z - 22 = -39z. Let x be z/11 + 104/(-88). Which is the biggest value? (a) 11 (b) x (c) 0 a Let z be (390/(-35))/((-4)/(-18) - 190/342). What is the third smallest value in z, 3, 9? z Let o = 3 - 3.3. Suppose 37h + 542 - 431 = 0. What is the third biggest value in o, 3/5, -1/2, h? -1/2 Let k = -203.4 - -200.4. Which is the biggest value? (a) -9/28 (b) k (c) -8 a Let p = 25.7 + -25. Let l = -9375 - -9371. Which is the third biggest value? (a) p (b) 0.1 (c) l c Let o = -203/18 + 187/18. What is the second biggest value in -11, o, -1/4? o Let k = 37.67 - 32.67. What is the second smallest value in k, 0.046, 3? 3 Suppose 403p - 192p = 273p. Which is the second smallest value? (a) 6 (b) 2 (c) -4/5 (d) p (e) 2/11 d Let r = -59.43 - -59.93. What is the biggest value in 5, -0.3, r, -1? 5 Let u = -4184/65 - -842/13. What is the second biggest value in 181, 0, -2/9, u? u Let g = -3687 + 3682. Which is the second biggest value? (a) 0.019 (b) g (c) -1.2 (d) -3 c Let f = -17244 - -17240. Which is the fourth biggest value? (a) -0.061 (b) -5 (c) 0 (d) -5/4 (e) f e Let i = 2625 - 2894. What is the second biggest value in 0, i, -1? -1 Let i = -3294 - -3292. What is the third biggest value in -0.02, -20, 0, -3, i? i Let l = -0.078 + -86.922. Let n = l - -41. Let h = -44 - n. What is the fourth smallest value in -3/8, h, 1.1, -0.2? h Let x = 0.0682 + -36.0082. Let f = 1.9 + x. Let m = 34 + f. What is the third biggest value in 0.5, m, -1/2? -1/2 Let m be 39/(-6)35/((-4095)/36). What is the second smallest value in -5, -150, m, 3, 2/9? -5 Let v = 7577 - 15517/2. Let i = v - -182. What is the second biggest value in -0.5, i, 80? i Let f = 876.12 - 7.12. What is the second biggest value in 0.5, 1, -3, f? 1 Let v = 0.03 + 0.27. Let u be 7 + (4 - 33/9) + -7. Which is the second biggest value? (a) v (b) 0.5 (c) u (d) -1 c Let u = 48.9 - 49.9. Let p = -2.86 + 3.6. Let x = p + -0.24. Which is the biggest value? (a) 1/4 (b) u (c) x c Let c be (-8)/(-14)2/(-8). Let v = -5365 + 5364.6649. Let a = v - 0.0649. What is the second smallest value in a, c, 2/119? c Suppose v = x + 6, 0 = -3v + 8v + 4x - 12. Let m be (-5 + 1)/(v + 6). What is the second smallest value in m, 0.83, 5? 0.83 Suppose -25 + 59 - 10 = 24l. What is the biggest value in -0.02, -1/8, l, -3/8, 0? l Let m = -6.2 + 28.7. Let y = m - 22. Which is the third biggest value? (a) 2/31 (b) y (c) -8 c Let y be 21/(-5) + 72/(-2040)-34. Let g = -3.97 - 0.03. What is the third biggest value in y, 1/6, g? g Suppose -2i + 0i - 847 = -5v, 2i = -3v + 521. Let y = -87 + v. Let h = y + -48. Which is the biggest value? (a) -1/4 (b) h (c) 3 b Let n be (135/6)/15 - 130/100. What is the smallest value in -465, n, 0.3? -465 Let s = -450 - -108448/241. Let p = s + -448/4097. Which is the smallest value? (a) 0 (b) p (c) 0.5 (d) -2 d Let g = 7236.5 - 7237. Which is the fourth biggest value? (a) g (b) -3 (c) -0.2 (d) 1/226 b Let y = -9336 - -9335.92. Let n be (-3)/1 + (-108)/(-30). What is the third biggest value in y, -2, n, -1/4? -1/4 Let d = 306 - 306. Suppose -13c - 26 + 0 = d. What is the second biggest value in c, 6, 3/2? 3/2 Let t = 74.72 + -79.72. What is the third biggest value in -2, -2/63, -3, -1/10, t? -2 Let o = 67 - 203/3. Suppose 7 = -5x - 3g + 58, 0 = 5x - g - 63. Let d be (-1)/7(x + -13). Which is the second biggest value? (a) o (b) -2 (c) d a Suppose -4y + 4n - 32 = 0, -253 = -3y + n - 267. Let w be (-9 + 7)/(1 + -7). Which is the third smallest value? (a) w (b) -0.2 (c) 3 (d) y a Let f be (-2)/(-4)2(11 + -10). What is the fourth biggest value in 2, 17, f, 1/6, 0.3? 0.3 Let u = 6345 - 6350. Which is the third smallest value? (a) 4 (b) u (c) 0.7 (d) 2 d Let a = 0.09175 + -2.09175. What is the fourth smallest value in a, -90, 3/7, 0, -2/5? 0 Let w = -0.97 + 205.97. Let z = -204.2 + w. Let j be -2 + 6(-1)/2. Which is the third biggest value? (a) j (b) 1/11 (c) z a Let a = 0.222 + -0.271. Let t = a + -3.951. What is the third smallest value in t, 7, 0.4? 7 Let h = -2.03681 - -0.03681. Which is the second biggest value? (a) 0.01 (b) -5/2 (c) h (d) -0.39 d Let t(o) = -20o + 3. Let u be t(6). Let k = 821/7 + u. Which is the second smallest value? (a) 0 (b) 11 (c) k c Let o = -53 - -267/5. Let c = 15953 - 15958. What is the fourth smallest value in o, -2/5, c, -3? o Let i = -2159 + 2159.4. What is the third biggest value in i, 1, -8/53? -8/53 Let k = -5796 + 5795.5. What is the fourth smallest value in -300, -4, 5, k? 5 Let c = 74/35 - 64/35. What is the second biggest value in -578, -2, c? -2 Let t be (((-12)/39)/((-2)/13))/(1 + 2). Which is the second smallest value? (a) -30 (b) 2/13 (c) t b Let a = -0.166 - 1.234. Let w = -1.6 - a. What is the third biggest value in -6/23, -3/4, w? -3/4 Let l = -27666.016 + 27666. Which is the biggest value? (a) l (b) -2.8 (c) 0.1 c Let i be (-1 - (2 + -2))/((-15)/(-30)). Let w be (264/(-220))/(i/(-15)). What is the biggest value in 1/2, w, -0.5? 1/2 Let u = -46 - -20. Let d = -6.7 + 9.6. Let s = 2.9 - d. What is the second smallest value in u, 5, s? s Let q(x) = x + 3. Suppose 0 = 5f + 10 + 20. Let g be q(f). Let r = 0.01011 + -0.21011. Which is the smallest value? (a) g (b) -2/11 (c) r (d) 0.1 a Let k = 67.36 - 63.36. Let h = 520/9 + -58. What is the fourth smallest value in h, 0.3, 3/22, k? k Let c = -4.0958 + -0.3042. What is the second smallest value in -4/7, c, 4/5? -4/7 Let g be 2/4-1 - (-7)/2. Suppose gd = j + 4j - 15, 4d = 3j + 2. What is the second smallest value in j, 1/3, 0, -1? 0 Let w = 14.056 - 14. Let k = -4.944 - w. Let u = 1069/11 + -97. Which is the smallest value? (a) u (b) k (c) -7 c Let j = 7628/95 + -402/5. What is the second biggest value in 2/3, j, 250? 2/3 Let o be 17/(-34) - (-13)/28. Let y = -24.37 + 24.3. Which is the third biggest value? (a) o (b) y (c) -0.5 c Let u = 11.3616 - -0.0384. Let h = u + -10.9. What is the biggest value in h, -0.1, 5, 0.02? 5 Let f = -84 - -87. Let w = 0.86 - 0.96. Let q = -0.3 - w. Which is the second biggest value? (a) 1 (b) f (c) q a Let n(f) = -25*f + 306. Let d be n(41). Let k = -6469/9 - d. Which is the second smallest value? (a) 0.1 (b) k (c) -2	{ "pile_set_name": "DM Mathematics" }
? (a) -1/11 (b) 1/6 (c) w c Let g = 0.54538 + 0.04462. Which is the closest to 0.2? (a) -2/3 (b) 1/3 (c) g b Let m(a) = 2a3 + 11a*2 - 18a + 14. Let d be m(-7). What is the nearest to -3 in -50, -4, d, 0.3? -4 Let q = -33.4 + 32.9. What is the nearest to -0.1 in 0.2, q, -0.3, -2/15? -2/15 Suppose z - 2p + 47 = -p, 232 = -5z + 4p. Let h = -40 - z. What is the closest to -1/2 in -2/3, 2/7, h? -2/3 Suppose 11m + 0 = 11. Suppose 783 = 3v - 3f, v - 5f = -3f + 264. Let z be (2 - 519/v)/((-7)/(-28)). Which is the nearest to -1? (a) z (b) m (c) 1/7 a Suppose 0c - 57 = -c + 4u, 0 = 5u - 20. Let h = c - 513/7. What is the closest to 3 in 1, h, 2/9? 1 Let o = -0.2 - -0.1. Let k = -374.51 - -379.51. Let z = 1 + 4. Which is the nearest to z? (a) o (b) k (c) 1/2 b Suppose -14f + 1 + 11 = -8f. What is the closest to -34.8 in 1/2, 0.3, -2/9, f? -2/9 Let f be (-7)/(-6) - 1804/328. Which is the closest to 0.1? (a) 0.3 (b) 0.1 (c) -6 (d) f b Let f = -138 - -138. Suppose f = 4u + 3 + 1. Let k = 130 - 130. What is the nearest to k in -1/7, 11, u? -1/7 Let v = 5 - 4.7. Let u = 420 + -386.6. Let l = -37.4 + u. What is the nearest to 1 in l, 1/5, v? v Let k be (18/(-7))/((-6)/56). Suppose -58q + 24q = 0. What is the nearest to k in 0.4, q, -2/11? 0.4 Suppose 3n + w - 1 = 0, -5n - 4w + 3w = -5. Let q = -0.3 + 0. Let v be (-6)/(-20)(-10)/(-15). What is the closest to 1 in q, v, n? v Let v(q) = -q3 + 7q*2 + 141q + 44. Let w be v(16). Let o = -1147/7 - -163. Which is the nearest to 2/3? (a) o (b) -0.01 (c) w b Let k = -5340 - -5346. What is the nearest to 1 in k, 1, 5/4, 0.2? 1 Let m = -6.4 - -6. Let y = -24479 - -24479.1. What is the closest to y in 2, -1, 3/2, m? m Let l = -19/40 + 11/40. What is the nearest to 14 in l, 2/9, 5, -0.3? 5 Let g be (19/((-1330)/10))/(8/14). What is the nearest to g in 0.09, -2, -27? 0.09 Let o be (-1)/6 + -1 + -1 + (-3043952)/1824. What is the nearest to o in -0.5, -0.1, 1, 2? -0.5 Let q = -28 + 31. Let o = -56.2 + 64. Let n = 5.8 - o. Which is the closest to q? (a) -0.1 (b) 2/3 (c) n b Let y be -1 + -24 + (18 + -17)8. Let s(u) = -2u + 2. Let h be s(-5). Let a be (-4)/h + y/(-33). What is the closest to 1 in 1, a, -6? 1 Suppose 7d + 3p = -15, 5d - 4d + 25 = -5p. Let x be -2 + 16(-5)/(-22). Which is the nearest to d? (a) x (b) -2/7 (c) 2/9 c Let k = -3055.1 + 3055. What is the nearest to k in 18, 4, -3, 8? -3 Let s = -4498 + 4679.9. Let v = s + -182. What is the closest to 0.12 in -0.4, v, -0.2? v Let d = 22.6 + -21.37. Let v = -1.77 - d. Let l = -17 + 33/2. Which is the closest to v? (a) l (b) 0.5 (c) 2 a Let s = -18673 + 18670. What is the closest to 9 in -2/29, 0.1, 0.4, s? 0.4 Let u = 0.1534 - 2.1534. Let v = 9.9 - 9.7. Which is the closest to u? (a) 3/7 (b) v (c) -3 c Let r = -258 + 144. Let i be r/95(-5)/(-11). Let k be 3/(-30) - 6/(-12). Which is the closest to 0? (a) i (b) k (c) -12 b Let r = 2397 - 2399. Which is the closest to -1? (a) r (b) -0.79 (c) -0.3 b Let h be 3(35/6 + -3)-10. Let l = h - -58. Let d be l/(-18)4/(-2). Which is the nearest to d? (a) 3/5 (b) 0.1 (c) -3 c Let f = 4/13725 + -13733/27450. Let d = -2 - -2.1. Which is the closest to f? (a) 0.9 (b) -5 (c) d c Let j = 0.85 + 13.15. Let h = 2.62 + -2.92. Which is the nearest to j? (a) h (b) -3/5 (c) 3 (d) -5 c Let y = 23 + -23.2. Let f = 0.23 + 1.57. Let x = -1.9 + f. Which is the nearest to x? (a) 1/6 (b) 2/7 (c) y c Suppose -5u = -3s + 29, 5u + 8 = -4s - 0s. Let x = -1184.9 - -1034. Let q = x + 151. Which is the closest to -2? (a) 3/2 (b) s (c) q c Let c = -9 + 9.3. Let y = 135.3 - 131. Let i = c - y. What is the nearest to -2/7 in -0.4, i, -1? -0.4 Let p = -473 - -6147/13. Let r = -68 + 65. What is the nearest to p in 0, -2, r? 0 Let x be 3742/(-6) + 266/(-114). Let k = -3143/5 - x. What is the nearest to 1/2 in k, -4/7, 0.2, -5? 0.2 Let o = -3/8 - 1/8. Let u = -149/399 + 5/57. Let n = 0.9333 - 0.4333. What is the closest to u in o, n, 1/9? o Let j = 1382.96 - 1383. What is the nearest to 2/21 in j, -3/2, -3, 6/7? j Let n be (9 - -17) + -35 - -6. Let f = -0.3 + 0.8. Which is the closest to 0.08? (a) -1 (b) f (c) n b Let l = -0.4 - 3.6. Let j = -76411 + 76411.1. Which is the closest to -1/2? (a) 4/5 (b) j (c) -1/5 (d) l c Let p(y) = y2 - 4y. Let f be p(4). Let l = 584.08 + -586.08. Which is the nearest to 3? (a) l (b) f (c) 0.1 c Let c = -25 + 24. Let h = 2/11053 - -44206/33159. What is the closest to 0 in 17, h, c? c Let p = -43.2 - -37. Let u = 4 - -2. Let m = p + u. Which is the closest to m? (a) 1 (b) 2/9 (c) 2/21 c Let i = 2.2904 + -1.9904. Suppose 4z + 0 = g - 6, -2z + 4 = -4g. What is the nearest to 1.6 in i, 0, z, -1/2? i Let z = -0.9665 + 0.7665. Which is the closest to -272? (a) -0.5 (b) -1 (c) z b Let t(h) = h3 + 65h*2 - 77h - 731. Let r be t(-66). Which is the nearest to -1/12? (a) r (b) 9 (c) -6 (d) -2 d Let v = -1686.4 + 1687.4. Let f = -0.2 - 0.3. Which is the nearest to v? (a) -3 (b) 4 (c) f c Let b = 11864 + -11592. What is the closest to b in -2/9, -3, 3? 3 Let u = -4047.2 + 4047. What is the nearest to -6 in 11/3, u, -4? -4 Let y = 203 - 204.15. Let r = 0.85 + y. Which is the nearest to -3/2? (a) r (b) -4 (c) 1/6 a Let j = 351 - 351.09. Which is the nearest to -1/4? (a) j (b) 0.2 (c) 9 a Let l = -4 + 4. Let d = 0.0575 + -0.5335. Let r = d + 0.576. Which is the closest to l? (a) r (b) 0.2 (c) 1 a Let s be (4 - 5) + 0 + -4. Let j = -5.8 - -6. Let y = -1823 - -5470/3. What is the closest to y in j, 4, s? j Let l = -2893.3 - -2894. Which is the closest to -2/19? (a) 0.3 (b) 0.05 (c) -0.3 (d) l b Let j be 6/30 - (-13 - (-1692)/135). What is the nearest to j in -4, -835/4, -0.2? -0.2 Let p = 1656 - 1658. Suppose 0 = -h + q + 5, -2h + 3h = -5q + 29. Which is the closest to p? (a) 3 (b) h (c) 4 a Let z = 31/131 + -720/2489. What is the nearest to z in -13/4, 5, 2/7? 2/7 Let l be ((-6)/1442)/(282/72 + -4). Which is the nearest to -43? (a) 1/4 (b) 2/9 (c) l b Let i = -1057/5335 + -2/1067. Which is the closest to 29? (a) i (b) -38 (c) 2 c Let p = 24 - 21. Let y be (-3)/3 - (p + -3). Let x be (y - -1)/(3 + -2). What is the nearest to x in -0.1, 5, 0.5? -0.1 Let a be (48/18)/((-80)/(-90)). Let y be 130/(-6) + (-6 - (-20)/a). What is the nearest to 1/2 in y, 0.2, -2/11? 0.2 Let v = 11248.5 - 11249. Let u be (14/(-126))/(2/4). Which is the closest to -4? (a) u (b) -3 (c) v b Let r = -81775/3 - -27255. What is the closest to -1/2 in r, -2/9, 3, 0.1? -2/9 Suppose 3y = -y - 64. Let i be (744/(-1116))/(16/12). Which is the closest to i? (a) 2/13 (b) -3 (c) y a Let i = -226.3 + 232.3. What is the nearest to -0.1 in i, -3, -24/7? -3 Let j = -3949.4 + 3950. Which is the closest to j? (a) -3/2 (b) 1/2 (c) -1/2 (d) -1 b Let d = -1330/11 + 121. Let g = -310/3 + 103. Let q = -4.11 + 0.11. What is the nearest to d in q, -1, g? g Let j = 285.27 + -285.67. Which is the closest to 2/5? (a) -86 (b) -5 (c) j c Let a = -15 - -75. Let g = -34 + a. Let t = 25.94 - g. What is the nearest to 0 in 1, 0.5, t? t Let w = -70.6 + 69.8. Let x = 7 + -9. Let z = x + 2.2. What is the closest to z in 0.5, 5, w? 0.5 Let y = 2138/34965 - 12/259. Let a = 169.82 - 170.02. What is the nearest to -1/3 in -3, y, a? a Let i be (90/8)/(-15)(-1)/(-6). Let o be (-2 - -5)5/60. What is the closest to o in -0.1, i, -0.3? -0.1 Let f(y) = y + 7. Let u be f(5). Let t be ((-52)/u + 4)-1. Let k = -0.057 + 0.047. Which is the closest to k? (a) -4 (b) -1 (c) t c Suppose -3h = 4h - 77. Suppose -17 = -2w - h. Which is the closest to -0.3? (a) 1/4 (b) w (c) 0.1 c Let p = -463.044 + 463. Let z = p - 0.156. Suppose 0u + 3 = -u. Which is the closest to z? (a) u (b) 2 (c) 2/7 c Let t = -4917 + 4914. What is the closest to 1/3 in 1.7, t, -2, -4? 1.7 Let o = 0.124 - -0.176. Let x = -419 + 406. What is the nearest to -0.1 in o, -3, x, 5? o Let x be (((-12)/(-4))/15)/(((-915)/(-100))/61). Suppose -4y = 2w - 5w, 3w = 2*y. Which is the nearest to 1? (a) x (b) -0.4 (c) w a Let m = 14920 + -14917. Which is the closest to -1? (a) m (b) -2/5 (c) -3/8 (d) -2/3 d Let o be -5 + 732/120 - (-3)/(-2). What is the closest to -0.1 in o,	{ "pile_set_name": "DM Mathematics" }
uppose 2w - 668 = 4l, 2w + 4l - l = 689. Is w a multiple of 20? True Let d be 15814/30 + -1 + (-6)/45. Let w = -129 + d. Does 68 divide w? False Suppose -2c - 518 = -j, -16j - 3c = -18j + 1041. Does 44 divide j? True Let i(o) = -14o3 - o2 + 23o + 76. Is i(-4) a multiple of 48? True Let w(z) = -2 - 10z2 - z3 + 14 - 5z - 2z. Let n be w(-9). Is 27 a factor of 348/9 - (-4)/n? False Suppose 21l - 962 = 4. Is 46 a factor of l? True Let h be -4(-3)/(-9)-3. Suppose 80 = 9l - hl + 2u, -l - u = -16. Is l a multiple of 3? False Let h(r) = r3 + 7r*2 + 17. Let k be h(-7). Suppose -3w + 8 = k, 4u = -4w + 76. Is 11 a factor of u? True Let w = -3 + 7. Suppose -353p - 6 = -355p. Suppose -l + p = 0, wu - 142 = 4l + 158. Is u a multiple of 39? True Suppose w - 1538 = -31l + 30l, -3w - 5l = -4622. Is 41 a factor of w? False Suppose 19i = -369 + 2193. Does 12 divide i? True Suppose -5r + 716 + 874 = 0. Is r a multiple of 66? False Suppose 3p = 2l - 3653, -2p = 15l - 10l - 9085. Is 17 a factor of l? True Does 15 divide -13 + 580/3036? False Suppose 5d + 8 = 7d. Suppose dx + x = 15. Suppose 0 = -2z - 4m + 52, 7m = xm + 20. Does 16 divide z? True Let b(j) = 96j. Suppose 0z = 2t + z - 2, 0 = 2z. Does 24 divide b(t)? True Let u = -83 - -89. Let h(f) = -2f + 1. Let j be h(-1). Is 7 a factor of 1/(u/20)j? False Let n be (-4)/6 - (-2)/3. Suppose -t - y = -16, nt - t + 4 = 4y. Is 10 a factor of t? True Is 7 a factor of 42/(-98) - 2554/(-14)? True Let p(s) = -226s - 1. Is p(-1) a multiple of 15? True Let l(w) = -6w + 17. Let n(k) = k + 1. Let g(a) = l(a) + 5n(a). Is 8 a factor of g(9)? False Suppose 40 = 2k + 2k. Let y = 19 - 16. Suppose 2r - k = -yr. Does 2 divide r? True Let d(l) = 4l3 - l2 - 7l + 8. Let u be d(1). Let j(i) = i*3 - 2i - 2i2 - 1 + i + 3i. Does 13 divide j(u)? True Let n(q) = -3q2 + 5q + 1. Let t(g) = 2g2 - 4g - 1. Let a(d) = 6d + 2. Let l be a(-1). Let h(c) = ln(c) - 5t(c). Is 13 a factor of h(-4)? False Suppose -68i - 5194 = -75i. Does 53 divide i? True Let b(f) = -f3 + 3f*2 - f - 2. Let s be b(2). Suppose s = 2v - v - 7. Does 12 divide (-3)/v - (-675)/7? True Let i = 15 + -15. Let v(a) be the first derivative of a4/4 + a3/3 + a*2/2 + 11a - 2. Is 11 a factor of v(i)? True Let o = -356 - -482. Is o a multiple of 7? True Suppose 7 = 5m - 3. Suppose 2w + 6a = a - 40, -8 = mw - 3a. Is (-234)/4w/15 a multiple of 6? False Let u = 29 - 21. Let j(z) = 7 - 1 + 0 + 78z - 68z - 3. Does 12 divide j(u)? False Suppose -3d = 5a - 1989, -2d = 3a - 784 - 410. Does 11 divide a? True Is (6/(-42)-7)/((-5)/(-4845)) a multiple of 51? True Let d = -41 - -44. Suppose -53 + 435 = 3s + 5j, dj + 461 = 4s. Is s a multiple of 11? False Suppose 0 = 9k - 6k - 18. Does 11 divide (-32)/(-48) + 590/k? True Suppose 0 = 4l - 5o - 832, -221 = -0l - l - 2o. Suppose -2w - 2a = -17 - l, 341 = 3w + 5a. Is w a multiple of 39? True Suppose -c + 4 - 18 = 0. Let s = c + 16. Does 10 divide s - (-5 + (-4 - -1))? True Is ((-4779)/12)/(-242/1120) a multiple of 17? False Suppose -14 = o - 18. Suppose -3s + 389 = -2x, -4s + 50 = -ox - 466. Does 12 divide s? False Let a be 12/(-28) + (-1714)/(-14). Suppose b = -b + a. Is b a multiple of 12? False Let t = 28 - 58. Does 26 divide (t + 0)(-156)/36? True Suppose -5z = 5b + 40 - 260, -5z = b - 40. Is 5 a factor of b? True Suppose 3j - 59 + 14 = 0. Does 26 divide -2j/(-6)17? False Is 12 a factor of ((-8)/(-5))/(9/1350)? True Let t be (-12)/1818/1. Let n be t + (-3)/((-9)/12). Does 30 divide (n/6)/(2/(-45))? True Let h(b) = -7b + 8. Let t = -25 + 30. Suppose ty + y + 18 = 0. Does 18 divide h(y)? False Suppose 1164 = 25f - 6436. Is 17 a factor of f? False Suppose 5c + 299 = 49. Let r be 30/c + 36/10. Suppose rj = -12, -31 - 24 = -5a - 5j. Is a a multiple of 10? False Let u(t) = 9 + t + 14 + t - 3t. Let s(n) = -n*3 - 6n*2 + 9n + 14. Let b be s(-7). Is u(b) a multiple of 7? False Let d = 993 + 339. Is 6 a factor of d? True Let b = 47 - 29. Let f(i) = i*3 - 19i*2 + 18i + 40. Is f(b) a multiple of 20? True Suppose -3w - 23v + 1746 = -26v, 2v = 4. Does 73 divide w? True Let v(q) = 89q2 + 5q - 6. Let p be v(2). Suppose -h = 2h - p. Is 30 a factor of h? True Let c(d) be the first derivative of -23d4/24 + d2 + 12. Let h(y) be the second derivative of c(y). Does 10 divide h(-3)? False Let a(y) = 24y + 13y + 7 - 43y + 6y*3 + 2y*2. Is a(2) a multiple of 4? False Let o = 37 + -35. Let j(y) = 0y*2 + 5y*2 + 2y*2 - 1. Does 27 divide j(o)? True Suppose 13b = -g + 15b + 900, 6 = -3b. Is 32 a factor of g? True Let a(h) = h*3 + 15h*2 - 28. Let l be a(-15). Suppose -5x + 0 = -70. Is ((-36)/x)/(3/l) a multiple of 15? False Let m(o) = 2o - 11. Let f(u) = 2u - 11. Let x(n) = 5f(n) - 6m(n). Is 5 a factor of x(-12)? True Let k(t) = -t*2 - 3t - 5. Let d be k(0). Is 20 a factor of ((-131)/3)/(d/15)? False Let a be 75/27 + (-6)/(-27). Let t(b) = -4b3 + 4ba + 17 - b3 - b*2. Does 10 divide t(0)? False Let t = 670 - 324. Suppose 0y = y - t. Is 1/3 + y/6 a multiple of 29? True Let t be (1 - 0)/((-7)/(-21)). Suppose 426 = tj + 135. Is 20 a factor of j? False Suppose 7l = 26l - 10393. Is 9 a factor of l? False Suppose -m + 2m = 0. Suppose -5v + 33 + 162 = m. Suppose 4b - v = 3b. Is b a multiple of 14? False Let f be 8 + 1(-2 + -2). Suppose -16 = -fg, -4y + 3g - 7g + 280 = 0. Is y a multiple of 11? True Let y(k) = k*2 + 12k + 9. Let r(g) = 4g - 1. Let m be r(-2). Let b be y(m). Let s = b + 42. Is s a multiple of 10? False Let z = -3251 + 5597. Is z a multiple of 51? True Suppose 5j - 10 = 4c + c, -10 = -3j + 2c. Suppose 35 = b - jb. Let w = 55 + b. Is 26 a factor of w? False Suppose 12o - 11o = 5m - 3579, 2m = 2o + 1438. Does 7 divide m? False Let v be -1(-1 + 2 + -3). Suppose 258 = -0t + vt. Let w = -35 + t. Is w a multiple of 22? False Suppose 2j = -2r, j - 2j + r + 4 = 0. Suppose -l + jl = 3. Suppose -4o + 73 = -li - 11, 0 = 3i. Is o a multiple of 12? False Let c = 3086 - 1277. Is 51 a factor of c? False Is 390/(-52)((-18)/5 + 2) a multiple of 2? True Let y(u) = 5u2 + 14u + 141. Is 141 a factor of y(-31)? True Does 7 divide ((-34)/(-1))/(13/(2262/12))? False Suppose -r + 3 = 4c - c, -r + c + 19 = 0. Let p = -10 + r. Let t(w) = 9w - 3. Is 21 a factor of t(p)? True Let g be 7-6112/12. Let j = g + 667. Does 40 divide j? True Let f = -77 + 109. Let m = f + 215. Is m a multiple of 23? False Suppose 58 = 4j - 66. Suppose -5p - 3y + 568 = 0, 200 + 152 = 3p - y. Let n = p - j. Is 18 a factor of n? False Let q(m) = 393m + 3. Is 16 a factor of q(1)? False Let n(p) = p + 117. Does 12 divide n(27)? True Suppose -191 = -2u + w + 245, -u = 4w - 200. Is 24 a factor of u? True Let i = 44 - 42. Suppose k + ik - 3l = 198, -4k + 278 = 3l. Does 34 divide k? True Suppose 3k + 456 = 5s, -2k + 4s + 70 - 374 = 0. Let d = k + 198. Is 3 a factor of d? False Let j = 322 + 127. Does 66 divide j? False Suppose 0 = 3y - 4i - 2896, 4y = -5i + 2i + 3903. Does 18 divide y? True Let v = -65 - -66. Suppose v = 8u - 1247. Is 26 a factor of u? True Suppose 81 + 33 = 3d. Let i = d + -22. Let h = 42 - i. Is h a multiple of 24? False Suppose -12 = -4k + k. Let u(i) = -i3 + 4i*2 - 3i - 1. Let h be u(k). Is 5 a factor of 10/10 - (h + -1)? True Let r be (-3 + 20/6)-57. Let o = -22 - r. Does 16 divide 2 + 33/1 + o? True Suppose 0 = -2v - 4d + 68, -4v + 3d + d = -136. Suppose -11f = -5f - 24. Suppose v - f = 5y. Is y a multiple of 5? False Let r be (-3)/(-6)(-90 - 0). Let k = r + 137. Is 13 a factor of k? False Let s(o) = o2 - 13o + 48. Is 4 a factor of s(7)? False Suppose -1486c + 1128 = -1474c. Is 3 a factor of c? False Let b(i) = -i + 38. Is 9 a factor of b(-16)? True Let r be 525/(-9) - 2/3. Let t = r + -1. Is 4 a factor of ((-5)/3)/(5/t)? True Let k = 124 + -121. Let s = k - -43. Is s a multiple of 6? False Suppose 2f + 9 = 387. Is 27 a factor of f? True Suppose -4u + 3292 = 4w, 2u - 769 = -4w + 867. Is 12 a factor of u? True Suppose -3u - 3u = -u. Suppose -q = -4c + 316, u - 4 = -q. Does 10 divide c? True Let r be (-1)/(-6) +	{ "pile_set_name": "DM Mathematics" }
.000006669245 What is six fifths of a litre in millilitres? 1200 What is 597.5416 centimeters in kilometers? 0.005975416 How many nanograms are there in 11/2 of a microgram? 5500 What is 63151.34g in kilograms? 63.15134 How many months are there in 13/4 of a century? 3900 What is nine tenths of a millennium in decades? 90 How many millimeters are there in 44/5 of a meter? 8800 Convert 742.9011 microseconds to nanoseconds. 742901.1 How many nanograms are there in five quarters of a microgram? 1250 How many kilograms are there in fourty-seven quarters of a tonne? 11750 How many litres are there in 866.095ml? 0.866095 How many milligrams are there in 21/2 of a gram? 10500 Convert 630.9765mm to nanometers. 630976500 What is 1436486.7ns in minutes? 0.000023941445 How many days are there in 6.9615558 microseconds? 0.0000000000805735625 How many nanoseconds are there in 21/5 of a microsecond? 4200 What is one quarter of a micrometer in nanometers? 250 How many litres are there in 766271.5 millilitres? 766.2715 What is seven halves of a micrometer in nanometers? 3500 Convert 250618.1mg to tonnes. 0.0002506181 How many millimeters are there in seventeen halves of a meter? 8500 What is fourty-three quarters of a millennium in decades? 1075 How many micrometers are there in one quarter of a centimeter? 2500 How many milligrams are there in 7.834511 micrograms? 0.007834511 How many months are there in 25/4 of a decade? 750 How many years are there in 1/4 of a century? 25 What is fifty-nine fifths of a minute in seconds? 708 How many months are there in seven sixths of a millennium? 14000 How many millilitres are there in eighty-seven halves of a litre? 43500 What is 0.2379113 meters in micrometers? 237911.3 How many micrograms are there in eleven eighths of a milligram? 1375 What is nine tenths of a milligram in micrograms? 900 How many decades are there in 3/10 of a millennium? 30 What is eight fifteenths of a hour in minutes? 32 Convert 1546.678 micrometers to centimeters. 0.1546678 What is five eighths of a centimeter in micrometers? 6250 What is 7/2 of a centimeter in micrometers? 35000 How many millilitres are there in seven quarters of a litre? 1750 What is 7/2 of a week in hours? 588 How many months are there in 4/3 of a year? 16 How many micrograms are there in one fifth of a milligram? 200 Convert 0.2921378 millilitres to litres. 0.0002921378 How many centuries are there in 59928.68 decades? 5992.868 What is 5/24 of a day in hours? 5 How many micrometers are there in 11.28365 meters? 11283650 How many seconds are there in 0.1542761 hours? 555.39396 How many months are there in 2/15 of a century? 160 What is 626174.1 millilitres in litres? 626.1741 What is 0.6171959 years in centuries? 0.006171959 What is 83149.78ns in microseconds? 83.14978 Convert 59.07615 millilitres to litres. 0.05907615 What is 64586.15kg in tonnes? 64.58615 How many milliseconds are there in 87.38229 microseconds? 0.08738229 How many centimeters are there in 75/2 of a meter? 3750 What is three fifths of a millennium in months? 7200 How many micrograms are there in three eighths of a milligram? 375 How many litres are there in 6.453268 millilitres? 0.006453268 How many years are there in 69/2 of a decade? 345 What is 0.8085085 kilograms in grams? 808.5085 How many hours are there in thirteen eighths of a day? 39 What is 353226.3 years in decades? 35322.63 How many microseconds are there in 26.46872 seconds? 26468720 How many millimeters are there in 3/8 of a meter? 375 Convert 0.3079991 nanometers to centimeters. 0.00000003079991 What is seven halves of a litre in millilitres? 3500 What is 61/4 of a minute in seconds? 915 What is 48.82711 millennia in decades? 4882.711 Convert 46846.55 decades to millennia. 468.4655 How many millilitres are there in 21/5 of a litre? 4200 How many kilograms are there in fifty-five quarters of a tonne? 13750 Convert 669.19446ms to days. 0.00000774530625 What is 31.39275 tonnes in micrograms? 31392750000000 What is 3/40 of a milligram in nanograms? 75000 What is 141.599l in millilitres? 141599 How many micrograms are there in 26/5 of a milligram? 5200 Convert 1303.394274 nanoseconds to weeks. 0.000000000002155083125 Convert 0.668087 millilitres to litres. 0.000668087 What is 18574.89 millimeters in centimeters? 1857.489 What is 11/2 of a microgram in nanograms? 5500 How many decades are there in 55/2 of a century? 275 Convert 15743.7108s to days. 0.182218875 Convert 0.885883l to millilitres. 885.883 Convert 54421.73ml to litres. 54.42173 What is 23/8 of a kilogram in grams? 2875 Convert 2179.87ng to grams. 0.00000217987 What is 5/4 of a tonne in kilograms? 1250 How many micrometers are there in 8298.501km? 8298501000000 What is 20/9 of a hour in seconds? 8000 What is one fifth of a millennium in decades? 20 What is six fifths of a century in decades? 12 What is 21/4 of a millennium in decades? 525 How many centuries are there in 803483.8 decades? 80348.38 What is thirteen quarters of a litre in millilitres? 3250 Convert 0.1389042mm to nanometers. 138904.2 How many microseconds are there in 995.7409 minutes? 59744454000 What is 3/8 of a tonne in kilograms? 375 How many millilitres are there in 458033.5l? 458033500 What is 0.4783111 litres in millilitres? 478.3111 What is 469.5317 litres in millilitres? 469531.7 How many nanograms are there in 1/5 of a microgram? 200 How many tonnes are there in 33681.44 grams? 0.03368144 How many micrometers are there in 2976.859cm? 29768590 How many years are there in 0.0507577 decades? 0.507577 What is eighty-seven halves of a milligram in micrograms? 43500 What is 1/15 of a minute in milliseconds? 4000 How many millilitres are there in 25/4 of a litre? 6250 Convert 3283.696km to nanometers. 3283696000000000 What is 5/8 of a litre in millilitres? 625 What is 34/5 of a meter in millimeters? 6800 How many nanograms are there in 5/8 of a microgram? 625 How many tonnes are there in 8723.123ng? 0.000000000008723123 What is 2/15 of a minute in seconds? 8 Convert 26059.72nm to centimeters. 0.002605972 How many kilograms are there in one fifth of a tonne? 200 How many tonnes are there in 0.4493987ng? 0.0000000000000004493987 Convert 3.645984 micrometers to millimeters. 0.003645984 What is 78301.99 litres in millilitres? 78301990 Convert 53700.13 millilitres to litres. 53.70013 What is ten ninths of a hour in seconds? 4000 How many months are there in 1/4 of a century? 300 Convert 12238.46 kilometers to micrometers. 12238460000000 Convert 49.1116 hours to seconds. 176801.76 Convert 55.2095 millennia to months. 662514 What is 90.3824nm in meters? 0.0000000903824 What is 7/15 of a millennium in months? 5600 How many seconds are there in five sixths of a day? 72000 What is 8.948974 millennia in years? 8948.974 How many micrograms are there in 7/2 of a milligram? 3500 What is 783904.4mm in micrometers? 783904400 Convert 8020.973 milliseconds to seconds. 8.020973 How many centimeters are there in 5/4 of a meter? 125 What is 3/5 of a litre in millilitres? 600 Convert 0.2783212 tonnes to micrograms. 278321200000 What is 7136.005 years in decades? 713.6005 What is one fifth of a litre in millilitres? 200 What is twenty-seven fifths of a gram in milligrams? 5400 What is 197.0355 centuries in months? 236442.6 How many nanometers are there in twenty-seven halves of a micrometer? 13500 What is fifteen quarters of a week in minutes? 37800 What is 2191460.1 months in decades? 18262.1675 What is 455786.3cm in millimeters? 4557863 How many litres are there in 7.348554 millilitres? 0.007348554 What is 7/25 of a litre in millilitres? 280 How many millimeters are there in 1/10 of a kilometer? 100000 What is 72253.04 litres in millilitres? 72253040 How many millilitres are there in fourty-four fifths of a litre? 8800 How many minutes are there in thirty-one sixths of a hour? 310 Convert 1729.154 millilitres to litres. 1.729154 How many millilitres are there in 68488.82 litres? 68488820 What is 3/10 of a meter in centimeters? 30 Convert 2.4282789 months to centuries. 0.00202356575 How many seconds are there in 375.8957 days? 32477388.48 Convert 0.6350868 kilometers to micrometers. 635086800 What is 0.3152794 centuries in decades? 3.152	{ "pile_set_name": "DM Mathematics" }
2((sqrt(176) - -3(-1 + sqrt(176)))6 + 1 + sqrt(176)2 + -5)*2-5. -45760sqrt(11) + 1194600 Simplify (-5(sqrt(17) - (0 + sqrt(17))-1 - (sqrt(17)-3 + 0) - ((sqrt(408) + (sqrt(408) - -2sqrt(408) - sqrt(408)) - sqrt(408))/sqrt(12))/sqrt(2)3))*2 + 0. 425 Simplify 2 + ((4 + sqrt(704)-36)2 - (-2sqrt(704)3 + 2)). -1104sqrt(11) + 228112 Simplify -3(((sqrt(396) + sqrt(396) + sqrt(396)-2 + -3)-3)2 - (-5(sqrt(132) - 1sqrt(132)) - sqrt(132))/(-2sqrt(300))). -243 + 3sqrt(11)/10 Simplify (1 + sqrt(1100) + 0 + sqrt(1100) - (sqrt(1100) - -41sqrt(1100) - sqrt(1100)))5 - (-3((sqrt(1100) - (2 + 2 + sqrt(1100))) + -3))2. -436 - 100sqrt(11) Simplify (-5(1 + ((sqrt(1900)-3 - sqrt(1900))2 + sqrt(1900) - sqrt(1900)) - (-2 + -3(sqrt(1900) - sqrt(1900)4))) + 1)2. -23800sqrt(19) + 13727696 Simplify -1 + sqrt(448) + 2 + sqrt(448) + sqrt(448) + -2 + (4 + (sqrt(112) + 0)-2)2. -40sqrt(7) + 463 Simplify (2 + (sqrt(15)/sqrt(45))*2)63 - (-1(sqrt(27) + (sqrt(27)2 - sqrt(27))2 + 0) + 5). 3sqrt(3) + 64 Simplify 2((sqrt(637) - (-1 + sqrt(637))) + 3) - (3 + (2 + sqrt(2548))2). -2547 - 56sqrt(13) Simplify (-43(sqrt(153) + sqrt(153)-3)4)/(sqrt(441)1-4 + sqrt(441) + sqrt(441) + (sqrt(441) - sqrt(441)26)). -96sqrt(17)/91 Simplify ((sqrt(500) - (sqrt(500) - sqrt(500)1))*24 - sqrt(500) - (sqrt(500) + 0)-2) + -1 + -3 + (sqrt(500) - (-5 + (sqrt(500) + 0)2)) + 3. 20sqrt(5) + 1504 Simplify 4(2(sqrt(66) - (-1sqrt(66) - sqrt(66))) + sqrt(66) - -61sqrt(66))/(((sqrt(168) - sqrt(168)-1)/sqrt(7))/sqrt(4)). 26sqrt(11) Simplify (-3((1 + sqrt(1584))4 + -3)-4-4)2 + 2 + 4. 221184sqrt(11) + 58394886 Simplify (-1 + sqrt(2736) + 61sqrt(2736) + sqrt(2736) + -2 - (sqrt(342)/(sqrt(45)/sqrt(5)))/(5sqrt(4)/sqrt(2) + sqrt(2)))2. -575sqrt(19) + 6282199/36 Simplify ((sqrt(270)1 - sqrt(270))/sqrt(9))/(-2sqrt(810)) - ((sqrt(36)/sqrt(3)3)/(sqrt(64)-1))2. -27/16 Simplify (sqrt(3) + 1 + 0 - (sqrt(3) - (sqrt(6)/sqrt(2) + -4))2 - (sqrt(33) - 1(sqrt(132) - sqrt(33)))/(sqrt(88)/(sqrt(8) + (sqrt(32) - sqrt(8)))))-1. -sqrt(3) + 15 Simplify -1(3 + (0 + sqrt(833))2 + -5 + 1 + (sqrt(833) + -2 + 4)2 + -4). -1665 - 28sqrt(17) Simplify (-5(((sqrt(2178)-5-3 - sqrt(2178)) + sqrt(2178) + sqrt(2178))/(sqrt(96) + (sqrt(96) - 3(sqrt(96) - sqrt(96)-2))) + 4))2. -8800sqrt(3)/7 + 164800/49 Simplify -1(0 + 2 + (6(sqrt(1728) + sqrt(1728) + -1) + sqrt(1728) - (1 + 1 + sqrt(1728))))*2. -248868 + 3456sqrt(3) Simplify -1 + (sqrt(99) - -1(sqrt(99) - (-2sqrt(99) + sqrt(99))))/(sqrt(144)1)-3. -9sqrt(11)/4 - 1 Simplify (4(0 + 1 + sqrt(171) - (-1sqrt(171) + -4)))2 + -3 + 2. 960sqrt(19) + 11343 Simplify 5 + 3(((-42sqrt(448))2 - (0 + (2sqrt(448))*2 - sqrt(448)) - -4(sqrt(448) + 2)-5) + -5). -456sqrt(7) + 80510 Simplify (sqrt(132) - -1sqrt(132)1 - -2sqrt(132)-1)/(((-1sqrt(132) + sqrt(132))5 - sqrt(132))/(sqrt(96)/sqrt(2))) + -5. -5 Simplify (2sqrt(130)4)/(sqrt(270)/sqrt(3)) - -2((sqrt(117))2 + 0 + 2). 8sqrt(13)/3 + 238 Simplify (-2(sqrt(6) - sqrt(36)/sqrt(6)) + sqrt(6) + -1sqrt(96))/(1(sqrt(12) - sqrt(324)/sqrt(3))). 3sqrt(2)/4 Simplify (5 + (sqrt(72) - sqrt(72)-2) - (0 + (sqrt(72) - (sqrt(72) + (sqrt(72) - (sqrt(72)2)*2))))) + (sqrt(12)/(sqrt(384) - sqrt(6)) - -1-4sqrt(2))2. -12409/49 + 24sqrt(2) Simplify -2 + 3 + (-5sqrt(288)1 - (2sqrt(288)5)*2) + -3. -28802 - 60sqrt(2) Simplify -3 + -5 + (3 + sqrt(1331)1)2 + (sqrt(1331) - ((sqrt(1331) + 1)2 + -1)) + (-5(sqrt(1331) + -1)*2 - (sqrt(1331) - (1sqrt(1331) + 3))). -6656 + 165sqrt(11) Simplify -5 + 5-3(((-4sqrt(85) + sqrt(85))4)/(sqrt(5) - ((sqrt(500)/sqrt(10))/sqrt(10) - sqrt(5))))2. -36725 Simplify (1 + (-1(sqrt(198) + sqrt(198)1 + sqrt(198)) + (-1sqrt(198)-2 - sqrt(198) - sqrt(198)))/(-4(-3sqrt(55))/sqrt(5)))2. -3sqrt(2)/2 + 17/8 Simplify ((sqrt(121) + (sqrt(121)2 - sqrt(121))-2 - sqrt(121))/(1sqrt(1100)))2 - (sqrt(88) - sqrt(88)-13)/((sqrt(128) + sqrt(8))2). -2sqrt(11)/5 + 11/25 Simplify -5 + -1(sqrt(192))*2 + sqrt(18)/sqrt(6) + sqrt(3) + -3 + ((sqrt(108)-2 - -2sqrt(12)/sqrt(4))1)*2. 2sqrt(3) + 100 Simplify -1((sqrt(72)-1 - sqrt(72))-4 - 2-3sqrt(72) - ((sqrt(72) + 2sqrt(72) + -2)-6 + -1))2. -73849 + 4224sqrt(2) Simplify (5(sqrt(704) + 2) - (sqrt(704) - (sqrt(704) + -3sqrt(704) + sqrt(704))-3))2 - -2((sqrt(99) - sqrt(99)1)4 - (4 + sqrt(99) + 0))*2. 1168sqrt(11) + 34826 Simplify ((1sqrt(70)-1 - -3(sqrt(70) + 1sqrt(70) + sqrt(70)))/(-4(sqrt(90) + 1sqrt(90))-3))2. 7/81 Simplify (sqrt(220)5)/((sqrt(11) + sqrt(275) - sqrt(11))4) + (sqrt(300)/(sqrt(50)/sqrt(5)))/(sqrt(6) + -2sqrt(6)5). 7sqrt(5)/18 Simplify (-1(3-3sqrt(325) - (4 + (sqrt(325) - (sqrt(325) - (0 + sqrt(325))))))-3 + 2)*2. 3000sqrt(13) + 292600 Simplify ((0 + sqrt(396))-1 + 3(sqrt(396) + 0))*2 - (((sqrt(396) + 1)-5)*2 - sqrt(396)-22). -8341 - 324sqrt(11) Simplify (6(sqrt(80) + 1)2 - (4 + -6sqrt(20))) + -3 + 0. 60sqrt(5) + 479 Simplify ((0 + sqrt(19) + -3)2 + (sqrt(95)/(sqrt(5) - 3sqrt(5)) - sqrt(19))*2 + (sqrt(19) + 1)-5 + -4-4sqrt(19))4. 20sqrt(19) + 263 Simplify ((6sqrt(270))/(sqrt(250)-2) + sqrt(108)2-44)2. 2816883/25 Simplify (-4 + sqrt(2299) + 1 + (sqrt(2299) - (-1 + sqrt(2299) + sqrt(2299))-3) + -5)-2. -176sqrt(19) + 22 Simplify 5(((sqrt(1584) + 0)-4 + 1sqrt(1584)1)*2 - (sqrt(11) + (sqrt(77)-1)/sqrt(7) - (-1 + -3sqrt(11)))). -15sqrt(11) + 71275 Simplify (63(sqrt(132) + sqrt(132) + -3sqrt(132) + sqrt(132))-3)/(-4sqrt(972) + sqrt(972) - (sqrt(300) + -1sqrt(300))). 0 Simplify sqrt(13) + sqrt(13) + (sqrt(91)-3)/sqrt(7) - (2 + sqrt(1573)) - ((sqrt(65) + -6sqrt(65))/sqrt(5) - (-5 + sqrt(78)/sqrt(6))). -6sqrt(13) - 7 Simplify ((-6(2sqrt(100) + sqrt(100)) + sqrt(100))/(sqrt(180)-2))/(4(sqrt(196) + (11sqrt(196) - sqrt(196)))). 17sqrt(5)/336 Simplify (5(-1 + 55(sqrt(1331) - -2sqrt(1331)2 - 4(0 + sqrt(1331) - sqrt(1331)))))*2 + 5. -68750sqrt(11) + 519921905 Simplify ((2(-6(sqrt(684) - (sqrt(684) + -1 + sqrt(684))-5) - ((sqrt(684) + 0 - sqrt(684)) + -2 + 4 + sqrt(684) + 0)))2 + -5)5. -450240sqrt(19) + 61425175 Simplify -5 + (-4(-3sqrt(7) + 1)-5 - 1(sqrt(56)/sqrt(72) + 4))2. -5792sqrt(7)/3 + 231586/9 Simplify -5((sqrt(288) + 0 + 0 + (sqrt(288) + sqrt(288) + 0)2 + -4)-5 + 5). 300sqrt(2) + 28675 Simplify ((-1sqrt(324)6 + sqrt(324))/sqrt(9))/(sqrt(108) + -51sqrt(108) + sqrt(108) - (sqrt(108) + (sqrt(108) - (sqrt(108) - sqrt(108)1)))-5). -5sqrt(3)/21 Simplify (1-5sqrt(20)/sqrt(2))/(-2((sqrt(98)-3 + sqrt(98) - sqrt(2)) + sqrt(2))) + -5. -5 - 5sqrt(5)/28 Simplify (((sqrt(50)-1-3)/sqrt(5)-4)/(sqrt(15)/sqrt(3)-5 + (1sqrt(45) - sqrt(45))))*2. 288/25 Simplify ((sqrt(66) + (-41sqrt(66) + sqrt(66) - sqrt(66)) + -11sqrt(66))-5)/((1sqrt(300))/(-6sqrt(10)/sqrt(5) - sqrt(2))). -28sqrt(11) Simplify (sqrt(104) + 4sqrt(104)-4)/(-4sqrt(288)) + (((sqrt(26) - -2sqrt(2106)) + sqrt(26))/((sqrt(98)/sqrt(7) + sqrt(14))/sqrt(7)))2. 5sqrt(13)/8 + 1300 Simplify -6(4(3(-1sqrt(78) + sqrt(78)) + sqrt(78)))/((sqrt(294) + -4sqrt(294))-3). -8sqrt(13)/21 Simplify (((sqrt(180)/sqrt(5))/sqrt(2) + -2 - (sqrt(1458) + 2 + 4 + sqrt(72))) + 5)2. 180sqrt(2) + 1809 Simplify -1 + 5 + 1sqrt(11) + -1 + -4 - (3 + (sqrt(1100)-3)*2 + sqrt(275)3). -9904 - 14sqrt(11) Simplify ((-2(sqrt(192) + 1sqrt(192)))/(sqrt(40)/sqrt(45) + sqrt(8)))/(sqrt(288)/sqrt(6) + sqrt(300)-1). sqrt(2) Simplify (((-5-1sqrt(240))/sqrt(6)6)/(-4(sqrt(48)/sqrt(6) + sqrt(8)) - 6sqrt(40)/sqrt(5)))2. 1125/49 Simplify 4 + ((-2 + sqrt(80))2-3 - (sqrt(405) + (sqrt(405)1 + -4)2 - sqrt(405)))-4. -480sqrt(5) + 2696 Simplify 4((4(0 + sqrt(104)/(sqrt(8)2) + 4 + 3))*2 + 5). 448sqrt(13) + 3364 Simplify (4(-1 + 1sqrt(12)) - ((sqrt(210) - sqrt(210)2)/sqrt(10))/(3sqrt(63)))*2. -584sqrt(3)/9 + 5761/27 Simplify (-3((sqrt(68) - 6(sqrt(68) - sqrt(68)2 - sqrt(68))) + 2sqrt(68)4))/(42sqrt(324)-2). 7sqrt(17)/16 Simplify -5 + ((-2(sqrt(1920) + sqrt(1920)2 - sqrt(1920)))/(-2sqrt(726) + -1sqrt(600)))2-3 + -2. -22 Simplify (1 + sqrt(27))5 + sqrt(324)/sqrt(432) - (sqrt(27) + sqrt(216)/sqrt(8)-3 - (4 + (sqrt(27) - (-3 + sqrt(27))))). 12	{ "pile_set_name": "DM Mathematics" }
n fifteen quarters of a microgram? 3750 How many decades are there in 2977649.7 months? 24813.7475 What is 12/25 of a litre in millilitres? 480 What is 5.034965 hours in seconds? 18125.874 What is 6/25 of a century in years? 24 What is 77.93357mm in meters? 0.07793357 What is 21/2 of a litre in millilitres? 10500 How many nanograms are there in six fifths of a microgram? 1200 Convert 1.400144 centuries to months. 1680.1728 What is 3/5 of a micrometer in nanometers? 600 How many milligrams are there in six fifths of a gram? 1200 How many months are there in twenty-seven quarters of a millennium? 81000 How many micrograms are there in 1/20 of a milligram? 50 Convert 56.1726 weeks to milliseconds. 33973188480 What is 92.0331 millennia in decades? 9203.31 What is 15/4 of a microsecond in nanoseconds? 3750 What is seventy-five halves of a century in years? 3750 How many micrograms are there in 4439.929mg? 4439929 Convert 5083.558 decades to millennia. 50.83558 What is one twentieth of a second in microseconds? 50000 What is fifty-one quarters of a litre in millilitres? 12750 How many centuries are there in 50.401 decades? 5.0401 Convert 3.52583 micrograms to milligrams. 0.00352583 Convert 79069.6 meters to nanometers. 79069600000000 What is 6/5 of a centimeter in micrometers? 12000 How many months are there in 55/6 of a century? 11000 What is 1/4 of a day in seconds? 21600 What is six fifths of a second in milliseconds? 1200 What is one sixteenth of a millisecond in nanoseconds? 62500 How many millilitres are there in 7339.089l? 7339089 How many kilograms are there in eleven halves of a tonne? 5500 What is 9.028899cm in nanometers? 90288990 Convert 57.42615 nanometers to millimeters. 0.00005742615 What is 3/32 of a meter in micrometers? 93750 What is one sixth of a decade in months? 20 How many nanograms are there in 26/5 of a microgram? 5200 What is 2119691.4 months in decades? 17664.095 Convert 834.327 nanometers to kilometers. 0.000000000834327 What is 19/10 of a millennium in centuries? 19 What is ten thirds of a minute in seconds? 200 What is 3/50 of a millennium in years? 60 Convert 198.4826l to millilitres. 198482.6 What is six fifths of a meter in centimeters? 120 How many litres are there in 354.1009 millilitres? 0.3541009 How many litres are there in 362178.9ml? 362.1789 How many millilitres are there in 2.330993 litres? 2330.993 What is two fifteenths of a minute in milliseconds? 8000 How many micrometers are there in 9/25 of a centimeter? 3600 What is 49.17919 centimeters in millimeters? 491.7919 Convert 852540.57 milliseconds to hours. 0.236816825 How many seconds are there in fourty-five eighths of a hour? 20250 What is 2098.739l in millilitres? 2098739 What is seven quarters of a kilometer in meters? 1750 How many microseconds are there in 998.9642 minutes? 59937852000 How many grams are there in 0.6040372 micrograms? 0.0000006040372 Convert 18.990081 months to centuries. 0.0158250675 How many months are there in 0.3108869 decades? 37.306428 How many kilograms are there in one quarter of a tonne? 250 Convert 7271.485kg to micrograms. 7271485000000 How many seconds are there in seven quarters of a hour? 6300 What is 8/25 of a litre in millilitres? 320 What is 8.1862569ns in hours? 0.00000000000227396025 How many seconds are there in 11/4 of a hour? 9900 What is 78983.1g in nanograms? 78983100000000 What is 0.7963082 millilitres in litres? 0.0007963082 Convert 48.74715mg to grams. 0.04874715 What is 192608.31 months in decades? 1605.06925 Convert 3007.873 millennia to months. 36094476 How many days are there in 27214.395 hours? 1133.933125 How many minutes are there in thirty-two fifths of a week? 64512 How many millilitres are there in 0.8551484l? 855.1484 How many hours are there in one sixth of a week? 28 How many millimeters are there in 212008.6um? 212.0086 What is 3.94384 centuries in millennia? 0.394384 How many centimeters are there in 13/4 of a meter? 325 How many litres are there in 1.523028ml? 0.001523028 What is 1/20 of a meter in centimeters? 5 How many meters are there in 3/5 of a kilometer? 600 How many litres are there in 65.38848 millilitres? 0.06538848 What is 64/7 of a week in minutes? 92160 Convert 0.8763481 millilitres to litres. 0.0008763481 How many seconds are there in 3/40 of a day? 6480 Convert 9151.113 minutes to seconds. 549066.78 How many grams are there in thirteen quarters of a kilogram? 3250 What is 15.6917898ms in days? 0.0000001816179375 What is 21/5 of a microgram in nanograms? 4200 How many years are there in twenty-five eighths of a millennium? 3125 Convert 5291.398mg to kilograms. 0.005291398 What is twelve sevenths of a week in hours? 288 How many kilograms are there in 537.1408t? 537140.8 Convert 1.43741ml to litres. 0.00143741 How many days are there in 1087207.65ns? 0.000000012583421875 Convert 90982.82 litres to millilitres. 90982820 Convert 2559.998 millilitres to litres. 2.559998 What is 8/25 of a gram in milligrams? 320 What is nine tenths of a gram in milligrams? 900 How many seconds are there in 1/6 of a day? 14400 How many milliseconds are there in 3/25 of a second? 120 How many seconds are there in 3248.923us? 0.003248923 How many millimeters are there in one tenth of a meter? 100 How many kilograms are there in 23.95509 milligrams? 0.00002395509 How many milliseconds are there in seven fifteenths of a minute? 28000 Convert 9979.885 micrometers to meters. 0.009979885 Convert 830.4826 microseconds to seconds. 0.0008304826 How many tonnes are there in 826312.6 milligrams? 0.0008263126 How many millennia are there in 225.05487 months? 0.0187545725 What is six fifths of a litre in millilitres? 1200 How many days are there in sixteen sevenths of a week? 16 How many millilitres are there in one tenth of a litre? 100 How many millilitres are there in 11/8 of a litre? 1375 How many millilitres are there in 2.866672l? 2866.672 How many years are there in seventy-five quarters of a millennium? 18750 What is 5/8 of a litre in millilitres? 625 How many grams are there in 829588.3 tonnes? 829588300000 What is 3.835515 meters in micrometers? 3835515 What is 0.8859531l in millilitres? 885.9531 What is 98076.58 millimeters in micrometers? 98076580 How many micrometers are there in twenty-one quarters of a centimeter? 52500 How many micrometers are there in 9215.487 nanometers? 9.215487 What is 88.95725 micrometers in nanometers? 88957.25 What is 3/5 of a litre in millilitres? 600 What is 5.986319nm in micrometers? 0.005986319 How many minutes are there in 58.85622us? 0.000000980937 What is five quarters of a millimeter in micrometers? 1250 How many hours are there in thirteen quarters of a day? 78 What is 9.246181cm in micrometers? 92461.81 Convert 889.0746ml to litres. 0.8890746 What is 42/5 of a kilogram in grams? 8400 What is 113.985 litres in millilitres? 113985 What is 403803.5 nanoseconds in milliseconds? 0.4038035 How many decades are there in 1.62686 millennia? 162.686 Convert 0.4873269 kilometers to nanometers. 487326900000 What is 44/5 of a millennium in decades? 880 How many seconds are there in 11/10 of a minute? 66 What is 5/4 of a minute in seconds? 75 How many decades are there in one fifth of a millennium? 20 How many millilitres are there in 3/40 of a litre? 75 How many years are there in 6/5 of a century? 120 Convert 7093.191ml to litres. 7.093191 How many nanograms are there in one twentieth of a milligram? 50000 What is 60827.03 milliseconds in microseconds? 60827030 What is 99074.8962 microseconds in weeks? 0.0000001638143125 Convert 990.26 days to milliseconds. 85558464000 What is 0.8996988 days in microseconds? 77733976320 How many nanometers are there in 19/4 of a micrometer? 4750 How many millilitres are there in 0.8214158 litres? 821.4158 What is 345.3356 centuries in years? 34533.56 What is 10169.04s in milliseconds? 10169040 What is 7.922031g in milligrams? 7922.031 What is 5/4 of a litre in millilitres? 1250 How many decades are there in eleven quarters of a millennium? 275 What is 1878.671 years in centuries? 18.78671 What is 3/40 of a litre in millilitres? 75 What is one fifth of a centimeter in micrometers? 2000 What is three eighths of a kilometer in meters? 375 Wh	{ "pile_set_name": "DM Mathematics" }
= -3c - 11c + 24c + 10. Let f(z) = z + 1. Determine -d(h) + 8f(h). -2h - 2 Let q be 1/5 + 39/5. Let t(c) = 2c*2 - 2c + 0 + 7c - 5 + 2c*3. Let z(p) = -3p*3 - 3p*2 - 8p + 8. Calculate qt(i) + 5z(i). i3 + i2 Let f(y) = -1216y. Let d(w) = -27w. Give 224d(b) - 5f(b). 32b Let b(k) be the first derivative of 3k*4/2 + 2k + 50. Let g(w) = -30w3 - 11. Determine -11b(r) - 2g(r). -6r3 Let f(z) = -z2 + z - 1. Let s(w) = -2w2 + 12w - 3. Give 3f(y) - s(y). -y2 - 9y Suppose -q + 5 = 12. Let w(h) = 11h3 + 5h*2 + 7h - 4. Let m(x) = -5x3 - 2x*2 - 3x + 2. Calculate qm(v) - 3w(v). 2v3 - v2 - 2 Let c(y) = -2y*2 - 2y - 1. Let i(b) = 4b2 + 3b + 2. Determine -7c(d) - 4i(d). -2d2 + 2d - 1 Let y(u) = 3u - 1. Let h(p) = 9p - 5 + 4p - p + p. What is 2h(k) - 9y(k)? -k - 1 Let b(j) = 2j - 2. Let q(y) = -10y + 10. What is -16b(f) - 3q(f)? -2f + 2 Let s(j) = -2j - 3. Let b(o) = 6o + 8. Let n = 3 + 8. What is ns(y) + 4b(y)? 2y - 1 Let a(x) = -5x*3 + x + 1. Let w be a(-1). Let p(g) = -9g. Let q(c) be the second derivative of 5c3/6 + 5c. Calculate wq(o) + 3p(o). -2o Let x(l) = -14l*3 - 2l*2 + 3l. Let q(b) = 27b3 + 3b*2 - 5b. Calculate 3q(t) + 5x(t). 11t3 - t2 Let k(n) = 2n*3 + 4n2 + 7. Let l(o) = o2 + 1. Give -k(i) + 6l(i). -2i*3 + 2i*2 - 1 Let r(m) = -m + 5. Let z(l) = -2l + 9. Let i(y) = -4y + 19. Let n(q) = -3i(q) + 7z(q). Suppose 2h + 3 = h. Calculate hn(o) + 4r(o). 2o + 2 Let o(f) = 2f*3 - 4f*2 - 4f. Let u(n) be the third derivative of n*6/15 - 17n*5/60 - 17n*4/24 + 2n*2 + 4. What is 9o(s) - 2u(s)? 2s*3 - 2s*2 - 2s Let h(s) = -4s3 + 16s*2 + 2s + 3. Let b(v) = -21v3 + 81v*2 + 11v + 16. Determine -2b(l) + 11h(l). -2l3 + 14l*2 + 1 Let l(o) = -5o*3 - 5o*2 + 3o - 1. Let r(i) = -11i3 - 11i*2 + 7i - 3. Let a be (-4)/(-1) - (-6 - -3). What is al(q) - 3r(q)? -2q3 - 2q*2 + 2 Let w(c) be the first derivative of -1/3c*3 + c + 2 + 0c2. Let u(s) = -s3 + s*2 + 4s. Let i be u(3). Let a(k) = -4k2 - k + 4. What is iw(o) + a(o)? 2o2 - o - 2 Let i be (-4 - (-1 - 2)) + -1. Let k(n) = -2n. Let t(u) = -u*2 + 4u. Determine it(a) - 4k(a). 2a2 Let a(k) = 8k - 8. Suppose 3s = -4s + 35. Let r(c) = -c - 1. Let m(y) = sr(y) - a(y). Let h(j) = 6j - 1. What is 9h(n) + 4m(n)? 2n + 3 Let n(r) = -7r*3 + 3r + 13. Let d(i) = -3i3 + i + 6. Let c(b) = -13d(b) + 6n(b). Let o(g) = g. What is c(q) - 5o(q)? -3q3 Let s(v) = 1165 - 1165 + 6v*2. Let i(g) = 2g*2. Give -14i(n) + 5s(n). 2n*2 Let w(t) = -2t*3 - 6t*2 - 7t - 4. Let o(r) = -r*2 + 2r - 1. Let j(q) = -2q2 + 5q - 2. Let b(z) = 3j(z) - 7o(z). Determine 6b(n) + w(n). -2n3 - n + 2 Let h(b) = -6 - b2 + b + 1 + 6. Let u(q) = -q*3 - 7q*2 + 5q + 3. What is -5h(c) + u(c)? -c3 - 2c*2 - 2 Let q(t) = 6t - 7. Let w = -5 + 8. Let u be (-2 - (1 + -2)) + 41. Suppose u = -b + 5b - 4g, wb + 2g = 5. Let l(f) = -5f + 6. Calculate bl(p) + 4q(p). -p + 2 Let w(y) = 2y + 1. Let c(x) = -4x - 3. Calculate -3c(b) - 5w(b). 2b + 4 Let s(l) = 2l2 + l + 3. Suppose -z - 6 = -0z. Let r(u) = u*2 + u + 2. Give zr(o) + 4s(o). 2o*2 - 2o Let u(j) = -36j3 - j2 - j + 1. Let p(m) = -m3 + m2 + m - 1. Determine p(l) + u(l). -37l*3 Let d(v) = 4v - 3 + 18v2 + 3 + 1 - 16v2. Let y(k) = -k2 - k. Calculate -2d(z) - 6y(z). 2z2 - 2z - 2 Let x(d) = d + 3. Let u(b) = b - 1. Calculate -2u(c) - x(c). -3c - 1 Let a be 2/(-12) + 13/6. Let n(l) = 2 - 3 + 9l + 8 - 2. Let o(w) = 4w + 2. Give an(q) - 5o(q). -2q Let n(r) = -5r*2 - 8r - 5. Let g(o) = 2o2 + 3o + 2. Calculate -8g(p) - 3n(p). -p*2 - 1 Let k(h) = h. Let t(c) = 7c + 1. Let b(g) = -6k(g) + t(g). Let f(v) = -5v - 4. Determine 6b(x) + f(x). x + 2 Let v(t) = 5t - 5. Let o = -1 + -3. Let u(x) = -4x + 4. Suppose -3k + k + 6 = 0. Suppose k = -0h - h. What is hv(s) + ou(s)? s - 1 Let g(i) = -i - 1. Let t(a) = -88a - 1 + 90a + 3. Calculate -8g(y) - 3t(y). 2y + 2 Let u(r) = r*2 + 4r. Let f(w) = -w*2 - 5w. Let t be ((-5)/1)/((-1)/1). What is tu(z) + 4f(z)? z*2 Let z(y) = 19y*3 - 5y*2 - 7y - 4. Let l(d) = 20d3 - 6d*2 - 8d - 5. Give 5l(h) - 6z(h). -14h3 + 2h - 1 Let h(y) = -4y - 9. Let z(l) = l + 2. Determine 4h(g) + 18z(g). 2g Let t(i) = -i + 1. Let k(s) = s*3 - 8s*2 + 7s - 5. Let a be k(7). Let v(l) be the third derivative of l*4/4 - 5l*3/6 - 16l*2. What is at(j) - v(j)? -j Let z(o) = 3o - 14 - 4 + 7. Let g(f) = -2f + 6. Give 5g(s) + 3z(s). -s - 3 Let m(c) = -c + 1. Let t(v) = -5v + 6. Suppose 3l = 6l + 12. Give lm(g) + t(g). -g + 2 Let d(l) = -9l2 - 2l + 9. Let v(m) = -4m2 - m + 4. Let i = 0 + -5. What is iv(j) + 2d(j)? 2j2 + j - 2 Let t(r) = -r3 - 2r2 - 1. Let w(a) = a3 + a2 + 1. Calculate -t(s) - 2w(s). -s*3 - 1 Let a(q) = 5q*3 - 3q*2 - 3q + 27. Let t(x) = 9x3 - 5x*2 - 5x + 53. Determine -5a(l) + 3t(l). 2l3 + 24 Let v(p) = 5p - 7. Let d(t) = t*2 + 11t - 14. What is -2d(i) + 5v(i)? -2i2 + 3i - 7 Let q(m) = 5m + 3. Let d(x) = 15x + 8. Determine -4d(o) + 11q(o). -5o + 1 Let y(o) = -2o - 1. Let d(x) be the third derivative of 0x - 1/24x4 - x2 - 1/6x3 + 0. Give -d(j) + y(j). -j Let q(n) = -13n + 2. Let b(j) = 65j - 11. What is 2b(l) + 11q(l)? -13l Let u(c) = -3c + 1. Suppose -o + 3 = 5. Suppose -2r - 3g = -19, 2r + 2r + 3g = 29. Let b(d) = 0d - rd + 2d + 4d. Calculate ob(l) - u(l). l - 1 Let t(h) = 2h + 8. Let i = -17 + 23. Let c(m) = 2m + 7. Give ic(b) - 5t(b). 2b + 2 Let u(q) = q*3 - 6q*2 - 9q + 13. Let d be u(7). Let j(c) be the third derivative of c4/24 + c3/6 + c*2. Let y(x) = -3x - 3. Give dy(h) - 4j(h). -h - 1 Let d(v) = -v3 - v2 - 1. Let t(i) = -3i3 - 6i*2 - 6. What is 30d(h) - 5t(h)? -15h*3 Let c(p) = -11p2 - 10. Let l(v) = -v2 - 1. Determine c(o) - 6l(o). -5o*2 - 4 Let q(z) = 3z*2 + 3. Let c(o) = -5o - 11. Let f be c(-13). Let t be (f/45)/((-3)/(-10)). Let b(s) = -s*3 + 4s*2 + 4. Give tq(w) - 3b(w). 3w*3 Let t(k) = 6k - 3. Let n(l) = l - 17. Let y be n(16). Let d(j) = j - 1. Give yt(i) + 4d(i). -2i - 1 Let q(c) = -5c*3 - 2c. Let b(k) = -k3 - k2 + 1. Calculate -2b(f) + q(f). -3f*3 + 2f*2 - 2f - 2 Let t(c) = -c - 3. Let a(d) = -4d - 10. Suppose -u + 5w = -20, 2u + w - 3w = 24. Give ut(y) - 3a(y). 2y Let r(j) = -14j*2 + 29j*2 - 14j*2 + 3j. Let s(z) = 4z2 + 14z. Calculate -14r(a) + 3s(a). -2a2 Let w(z) be the second derivative of -7z*3/6 + 5z*2/2 + 2z. Let y(d) = -3d + 2. Give 2w(f) - 5y(f). f Let z(l) = 0l*3 + 9 - 6l*3 - 1 + 5l + 6l2 + 4l*3. Let q(d) = 6d*3 - 17d*2 - 14d - 23. Give 6q(r) + 17z(r). 2r3 + r - 2 Let g(v) = 4v. Let n(u) = -5u + 1. Let c(k) = -2g(k) - 3n(k). Let l(q) = 8q - 4. Suppose -3h = 0, -2h - h = 5i - 30. What is ic(w) - 5l(w)? 2w + 2 Let z(x) = -2x2 + 4x - 30. Let p(w) = 2w2 - 5w + 30. Give -3p(u) - 4z(u). 2u2 - u + 30 Suppose -q - 2q + 21 = 0. Let x = q - 6. Let t be (4 - x)(-5)/3. Let j(r) = -r3 - r2 - r + 1. Let w(n) = 6n*3 + 5n*2 + 5n - 5. What is tj(k) - w(k)? -k3 Let c = -111 - -108. Let h(x) = x2 + 4x. Let w(n) = 5n. Give cw(k) + 4h(k). 4k*2 + k Let m be (0/2 + 3)/(-1). Let f = -6 - -1. Let r(q) = 2q + 5. Let c(s) be the third derivative of -s*4/6 - 3s*3/2 + 3s*2. Give fr(x) + mc(x). 2x + 2 Let l(i) = i*2 + i + 5. Let v be l(0). Let o(q) = 8q + 8. Let r(c) = c. Let y(u) = o(u) - 4r(u). Let h(k) = 3k + 7. Determine vy(b) - 6h(b). 2b - 2 Suppose 2s = -3s + 5. Let p(w) = -1 - w + s. Let m(j) = 2j. Let t(o) = -2o - 17. Let c be t(-10). Calculate cp(d) + m(d). -d Let f(c) = -3c3 - 4c - 2. Let j(d) = -4d3 - 5d - 2. Suppose -3 = 3x, 0x - 13 = 3k + 4x. Determine kf(g) + 2j(g). g*3 + 2g + 2 Let r(q) = 8q - 13. Let d(y) = -4y + 6. Let m(o) = 13d(o) + 6r(o). Let w(s) = -s. Suppose 5l = t + 16, -5 = -5t - 3l - 1. Determine tm(j) + 3w(j). j Let c(w) = -2w + 7. Let d be c(6). Let l(b) be the second derivative of b*3/2 - 3b*2/2 - 33b. Let g(o) = 2*o - 2. Determine d	{ "pile_set_name": "DM Mathematics" }
e nearest to 0? (a) m (b) j (c) i a Let s = -11498 - -22995/2. Which is the nearest to -3? (a) -2/17 (b) -5 (c) -20 (d) s b Let m = 10144.1 + -10147. What is the nearest to -0.1 in m, 5, 0? 0 Let j(s) = 23s - 1703. Let p be j(74). Let v = 57.5 + -57. What is the nearest to p in 6, -2/17, v? -2/17 Let i = 1.8 - 1.709. Let l = i + -0.1. Let o = -0.391 + l. Which is the nearest to -4? (a) -4/7 (b) -3 (c) o b Let q = -6763 - -6762. Which is the closest to 2/5? (a) 1/9 (b) 1/3 (c) 2/5 (d) q c Let o(c) = -c3 - 12c*2 + 18c + 43. Let a be o(-13). What is the closest to 7 in a, -0.5, 0.4? 0.4 Let g be 2/6(-552)/368. Which is the nearest to g? (a) 2 (b) 70 (c) -0.2 (d) 3 c Suppose -30 - 30 = -30l. Let r = -0.04 + -0.07. Let i = r - -0.14. Which is the closest to -0.1? (a) i (b) l (c) 1 a Suppose 0 = 3t + 3p + 36, -5t + 3797p - 3798p = 72. Which is the nearest to -0.1? (a) -3 (b) 3 (c) t (d) -2 d Let n = 4.99 + 0.01. Let x be (221/(-34) - -4)/(-2(-20)/(-32)). What is the nearest to n in -0.08, x, 1/11? x Let k = 182.1 + -181.6. What is the nearest to -2 in k, 0, 3, 2? 0 Let f = -2414.33 + 2414. Which is the nearest to f? (a) 0.5 (b) -1 (c) -0.3 (d) -2/13 c Suppose 0 = -5m + 2c + 23, 0 = -4m - 783c + 784c + 16. What is the closest to 1 in -2.3, -4, 0.23, m? 0.23 Let n be ((-12)/(-28))/((-1)/(-5)80/32). What is the closest to 3/8 in 6, -7, 2/17, n? 2/17 Let z = 614 + -615. Let t = 16 + -15. Which is the closest to z? (a) t (b) -0.2 (c) -2 b Suppose 0 = 2y + 4t - 48 + 56, 3t = y + 4. Let k be 4/(-1) + 13 + 2. What is the closest to 0 in y, 0.3, k? 0.3 Let y = 1996 - 2076. What is the closest to 1 in 0.3, -3, y, 0.5? 0.5 Let f be 1/9 + (-35)/45. Which is the nearest to 0? (a) 6 (b) -0.07 (c) f b Let d be (-105)/21 - 150/(-8). Let q = 14 - d. Which is the closest to q? (a) 3 (b) -5 (c) -1/4 c Let i = 5.6 - 10.6. Suppose 0p - p + x = 73, -4p - 332 = 4x. Let w = -82 - p. Which is the closest to 0? (a) i (b) w (c) 0.1 c Let m = -0.47978 - 0.02022. What is the nearest to 4 in 1.17, m, 0.5? 1.17 Let n = 612 - 602. Let r be 1/(-6 - -5)(2 - -1). What is the nearest to n in r, -4, -1? -1 Let o = -14889.7 - -14890. Which is the nearest to -4? (a) o (b) 4/53 (c) -0.1 c Let j = -0.62 + 1.008. Let k = 83.512 + -83.5. Let o = k + j. What is the nearest to 0 in o, 0.2, 0? 0 Let t = -1.722 - -0.022. Let l = 2 + t. Let j = 17 + -17. Which is the closest to j? (a) -5 (b) -2 (c) l c Let r(a) = 6a - 47. Let f be r(8). Suppose -1 = -p - f. What is the nearest to p in -2/9, 5, 7? -2/9 Let j = -32.787 + 34.787. Which is the closest to j? (a) -1/4 (b) -1 (c) 4 (d) 35 c Let i = 0.3 - -0.2. Let s = -175.19 - -176. Let g = s + 3.19. What is the nearest to 2 in -1/3, g, i? i Let o(h) = -4h - 58. Let w be o(-16). Let b be (w/((-240)/155) - -4)-1. What is the nearest to 1/3 in -3, 0.2, b? 0.2 Let u = -2.12 + 40.62. Let j = 36.5 - u. What is the nearest to j in 1/2, -0.02, -4/5? -4/5 Let p = 0.03233 + 43.96767. What is the nearest to 2 in -0.3, 16, -0.2, p? -0.2 Let m = -5914.9 + 5918. Which is the closest to m? (a) 0.01 (b) -2/9 (c) 6 c Let l be 164/205 - (-168)/(-110). What is the nearest to -1 in -5, l, -4, 0? l Let p = 250 - 268. What is the closest to 1.9 in p, -2, 0.2, -2/13? 0.2 Let n = 44.8 + -45. Let u(x) = x + 5. Suppose 0 = 2k - 3 + 15. Let h be u(k). Which is the nearest to 0? (a) 5 (b) h (c) n c Let y = -8.04 + 8. Suppose -2t = -4l + 6, t + 6 = -0t + 5l. Let c be (-1)/4 + t/(-4) + -2. What is the nearest to 0.1 in y, c, 5? y Let g = 0.14 + -31.14. Let i = -35 - g. Let k = -32.3 - -31.9. Which is the closest to 7? (a) 5 (b) i (c) k a Let w = -0.1 - 0.1. Let l = 330 + -332.41. Let n = -1.41 - l. Which is the nearest to 1? (a) -5 (b) n (c) w b Suppose -742y + 809y = 0. Let n = -4 + 6. What is the closest to y in n, -1/9, 0? 0 Let n = -0.17 + 1.17. Let v = -1.06 - -1.26. What is the closest to n in v, -6/11, 0.5, -0.07? 0.5 Let n = 0.0864 + -0.4374. Let u = -0.151 - n. What is the nearest to 4 in 3, 2/5, u? 3 Suppose -4r - 5q - 35 = r, -2q - 12 = r. Which is the closest to r? (a) -0.4 (b) 0.097 (c) 2/13 (d) 2/9 a Let p be (-4 + 860/180)(-6)/(-7). Suppose 2r - 6 = 4r. Let w be ((-1)/r)/((-2)/3). Which is the nearest to 0.2? (a) p (b) w (c) 2 a Let i = -19528 + 19528.3. What is the nearest to 0.1 in -0.5, i, 0.1, 0.5? 0.1 Let q = -447 + 457. What is the closest to 1 in 1, -4/3, 6, q? 1 Let t = 65/176 - 3/16. Suppose 19f = 9f - 26f - 108. Which is the nearest to f? (a) -0.3 (b) 0 (c) t a Let n = -0.01 + 0.01. Let a = -4.16 + 5.16. Let d = -0.034 + 0.534. What is the closest to n in 0.1, a, d? 0.1 Let j = 9.76 + -49.46. Let g = j + 40. Let q be (-15)/7 + 6 + -8 + 4. What is the closest to -1/4 in 3/7, q, g? q Let o be (1-19 - -1)(13 - 5). Let i = o - -146. Which is the closest to -1? (a) -0.4 (b) i (c) -1 c Let u = -245 + 246. What is the nearest to 1 in 0.1, 1/24, u? u Suppose 5z - 31z = -52. Let i be z/34/(-64)2. Let n = -0.98 - 0.32. What is the nearest to -1 in 1/6, n, i? n Let x = 2.9635 - -0.0365. Let f = -0.046 - -0.346. What is the closest to -0.1 in x, 10, f? f Let g(f) = -2f2 + 4f + 1. Let h be g(0). What is the nearest to -2 in h, -4/7, 0.0127? -4/7 Let s be 22/(-165)12/8421. Which is the closest to s? (a) 0.1 (b) -0.01 (c) 0.07 b Let t = -0.375462 - 0.124538. Let k(a) = a*3 + 4a*2 - 6a - 6. Let n be k(-5). What is the closest to n in t, -2, -5, 0.1? t Suppose 0 = -r + 23n - 22n + 10, 4n = -28. Suppose 2 = -2i + d + d, -4d + 20 = 0. What is the closest to 1/6 in r, i, -1? -1 Let r be (-51)/(-34)(-4)/9. Which is the nearest to -3? (a) r (b) 2 (c) -0.5 a Let z be (-66)/(-14) - 2/(-7). Suppose -79y + 152 + 231 = 67. Suppose -n = yn - z. Which is the nearest to -1? (a) 0.4 (b) -2 (c) n b Let g = -3.01 + 0.01. Suppose -9f + 11628 = -28f. Let r = 615 + f. Which is the nearest to g? (a) r (b) 1/3 (c) 1 b Let v = -136.04 + 135.84. What is the closest to 3 in 71, v, 1? 1 Let i = 4.1259 - 1.1259. Let o = -4.5 + 0.5. Let s = 0.1 - 4.1. Which is the closest to o? (a) 0.4 (b) i (c) s c Let n = 139.1 + -139.2. Which is the nearest to -1? (a) n (b) -2 (c) -0.01 (d) 2/3 a Suppose 2b = -4m + 24, 6m - 20 = m. Let j be (-1406)/6882 + (-168)/1302. What is the closest to -0.1 in -3, -0.1, b, j? -0.1 Let d = -27.891 - -27.791. Let s = 0.2 + -0.4. Let j = s - -0.1. What is the nearest to d in 0.2, 0.3, j? j Let o = -3.215 - -3.195. What is the closest to 0 in o, 6, 1? o Let o = -3.91 + 4. Let h = 83 - 82.9. Which is the nearest to h? (a) 4 (b) -2 (c) o c Let z = -395 - -423.9. Let c = z - 29. What is the closest to c in -5, 2, -0.2? -0.2 Let s = 0.03 - -0.84. Let q = s - 0.77. Which is the nearest to q? (a) -5 (b) -0.003 (c) -2/7 b Let r = -901/3636 + -2/909. Let b = 17.0332 - 0.0332. What is the nearest to r in b, -0.5, 2? -0.5 Let a = -18 + 23. Let z(g) be the second derivative of -2g*3/3 + 26g*2 - 20g. Let y be z(12). What is the closest to 2 in a, y, -9? y Suppose t - 2m = 3t - 4, -2m = -4t - 4. Let q = 0.9 + -0.6. Let d = 108 - 108. Which is the closest to d? (a) 3 (b) q (c) t c Let z = 68622 - 68621. Let w = -3 + -1. Which is the nearest to 1/3? (a) z (b) w (c) 13 (d) -3 a Let m = -41/105 - -2/35. Let z = 183 - 1833/10. Which is the closest to -1? (a) z (b) m (c) -4 b Let d = -10466.135 - -10466. What is the closest to -0.1 in d, 0.5, 1, -1/7? d Let z = -0.1 + -0.9. Let t = 9360.9 - 10508. Let d = 1147 + t. Which is the closest to z? (a) d (b) 0.1 (c) -9/4 a Let p be (51/(-867))/((-24)/102). Let k = 0.34 - -0.06. Let t = k + -0.46. What is the nearest to 1/4 in t, p, 5? p Let y = -0.4 - -0.3. Let b = 0 + -2. Let o = 297217 - 594437/2. What is the closest to y in b, o, 0.07? 0.07 Let n = 3184 + -3183.4. Let j = -0.2 + 0. Let h = -0.5 - j. What is the closest to n in 0.5, -1, h? 0.5 Let m = -21.4951 + -0.0949. Let p = -22 - m. Let z = 2.41 + p. Which is the nearest to 1/3? (a) 0.1 (b) z (c) -5 a Let n = -0.446 + 0.699. Let l = n + 0.247. What is the closest to -3 in l, 1/19, -2/9? -2/9 Let f = 2129 - 2251.3. Let d = f + 122. Which is the nearest to 6? (a) -3 (b) -3/2 (c) d c Let f = -33	{ "pile_set_name": "DM Mathematics" }
l) be the second derivative of -1/20l5 - 2l*2 + 0 + 0l*3 + 0l*4 + 2l. Find the first derivative of o(f) wrt f. -3f2 Let t(k) be the third derivative of 3k*2 + 0 + 0k*5 + 0k + 0k4 - 1/6k*3 + 1/120k*6. What is the derivative of t(u) wrt u? 3u2 Let i(c) be the second derivative of -c8/6720 + c7/2520 - c4/12 + c. Let r(k) be the third derivative of i(k). What is the third derivative of r(a) wrt a? -6 Let q(b) = b*2 - 6b + 7. Let m be q(5). Suppose 7 = 3c - 2o + 3, -3c - 2o + 8 = 0. Find the second derivative of z2 - z - zm - cz3 wrt z. -12z Let s be -4(-3)/6 - 4. Let o = s + 5. Find the second derivative of -7f + 5f + 0f*o - 3f*3 wrt f. -18f Suppose 0z - 3r + 11 = 4z, 6 = z + 4r. Let u(k) be the first derivative of 0k2 - z + 2/3k*3 + k. Differentiate u(a) wrt a. 4a Find the second derivative of -30v - 73v*5 + 39v*5 + 55v*5 wrt v. 420v3 Let n(c) be the third derivative of c6/240 + c5/120 - c4/24 - 3c2. Let x(g) be the second derivative of n(g). Differentiate x(m) with respect to m. 3 Let l be (-1)/(-7) + (-6)/42. Let p(c) be the second derivative of -1/12c*4 + l + 0c3 - c2 - 3c. Differentiate p(n) wrt n. -2n Let j = 4 + -2. Find the third derivative of -m - m + m2 - m6 + jm wrt m. -120m*3 Let m = 5 + 1. Suppose w = -w + m. Find the first derivative of -4q*w + 1 + 2q*3 - 2 wrt q. -6q*2 Let g(b) be the first derivative of -3b*4/4 + 3b*2 + 3. What is the second derivative of g(h) wrt h? -18h Let w(z) be the third derivative of 5z8/56 + z4/24 + 26z*2. Find the second derivative of w(q) wrt q. 600q3 Let r(u) = u2 - 1. Let j = -25 - -24. Let k(p) = -8 + 3 + 5p2 - p2. Let x(f) = jk(f) + 2r(f). Find the first derivative of x(m) wrt m. -4m Let n(w) be the second derivative of -w + 0w2 + 0w*6 + 0w*5 - 5/42w*7 + 2/3w*3 + 0w*4 + 0. Find the second derivative of n(r) wrt r. -100r*3 Let g(r) be the first derivative of 4r*2 + 16r + 13. Find the first derivative of g(y) wrt y. 8 Let o(p) = -p - 1. Let w(i) = -4i2 + 4i + 7. Let u(s) = -s*2. Let m(g) = 2u(g) - w(g). Let c(q) = -m(q) + 4o(q). Differentiate c(b) with respect to b. -4b Let d(p) = -p*3 - 3p*2 + 5p + 1. Let f be d(-4). Let v be (1/1)/(-1)f. Find the third derivative of -2h*3 - 2h*2 + vh2 + h2 wrt h. -12 Let y(v) be the first derivative of -v*4/4 + 8v*3/3 - 4v*2 + 8v - 1. Let q be y(7). What is the derivative of -u2 - u2 - 4 + q wrt u? -4u Let z(x) = 3x*2 - 4x + 3. Let v be z(2). What is the second derivative of -4j - vj*2 + 4j*4 + 3j + 7j2 wrt j? 48j*2 What is the derivative of -4m - 12 + 15m + 13 + 66 wrt m? 11 Let m(n) = n2 - 16n + 17. Let l be m(15). What is the third derivative of 0w4 + w5 - lw*2 + 0w*4 + 5w*2 wrt w? 60w*2 Let m = 58 - 56. Let k(x) be the second derivative of 3x + 0x3 - 1/12x*4 + 0 + 1/2x*m. Find the first derivative of k(p) wrt p. -2p Let x(g) = -11g4 - 6g*2 + 15. Let c(u) = 22u*4 + 13u*2 - 30. Let a(v) = -6c(v) - 13x(v). What is the derivative of a(f) wrt f? 44f*3 Differentiate 25 - 65 - 11l*4 + 22 with respect to l. -44l3 Find the second derivative of -k5 + 92k + 1 - 102k - 1 wrt k. -20k3 Suppose 4x + 5m + 42 = 0, 2x + 2x + 4m = -44. Let c = -9 - x. Find the third derivative of 2yc - 3y*2 - 4y4 + y4 wrt y. -24y What is the second derivative of -190w + 103w - 10w*3 + 102w - 9w3 wrt w? -114w Let s(k) = -k*2 + k - 1. Let f(i) = 59i*3 - 18i*2 - 5i + 5. Let j(d) = -f(d) - 5s(d). What is the third derivative of j(a) wrt a? -354 Suppose 5f - 10 = 5j - 0j, -2j + 21 = 3f. What is the third derivative of -k5 - k5 + fk2 + 3k*5 - 6k*5 wrt k? -300k*2 Let r(k) be the second derivative of 4k7/21 + k4/2 - 3k. Find the third derivative of r(y) wrt y. 480y*2 Let j(g) be the third derivative of 0g*4 + 0g*6 + 0g*3 - 1/112g*8 + 0g + 2g2 - 1/20g*5 + 0g*7 + 0. Find the third derivative of j(y) wrt y. -180y*2 Suppose 0p - 3 = -p. Let k(g) = 12g + 9. Let h(m) = 6m + 5. Let x(s) = pk(s) - 5h(s). Differentiate x(q) with respect to q. 6 Let d(r) = -r*3 + 8r*2 - 8r - 12. Let g = 7 - 12. Let k(m) = m*3 - 5m*2 + 5m + 8. Let y(z) = gd(z) - 8k(z). What is the derivative of y(p) wrt p? -9p2 Let a(l) = -l5 - 4l4 + l3 + 6l2 - 1. Let x(j) = j3 + 2j*2 + 1. Let v(n) = -a(n) + x(n). What is the third derivative of v(z) wrt z? 60z*2 + 96z Let a be (4/10)/((-5)/(-100)). Let z(w) = -w*3 + 7w*2 + 9w - 6. Let k be z(a). Find the third derivative of -2s2 - s4 + 3s*2 - 3s*k wrt s. -24s Let c = 21 + -17. Find the second derivative of 3h - 2h + 16h4 - 9h*c wrt h. 84h*2 Find the second derivative of 7d*4 + 7d + 4d4 - 3d - 2d4 wrt d. 108d*2 Suppose 0 = 4m + 3g + 7, 2m - g - 2g - 19 = 0. Find the first derivative of -3 + mp - 3 + 2 wrt p. 2 Let v(p) be the first derivative of p4/4 - p2/2 + 4p + 3. Let t be v(0). Find the first derivative of 5c*4 + 2c*4 + 1 - tc*4 wrt c. 12c*3 Let u(n) be the first derivative of 9n*4/4 - 4n + 6. What is the derivative of u(b) wrt b? 27b2 Suppose 0 = -4z + 27 - 11. Suppose zc + 0c = 20. Find the third derivative of -c - 4n3 + 0n*3 + 4n*2 + 5 wrt n. -24 Suppose -n - 3o + 2o + 6 = 0, -3n - 6 = -5o. Let x = 7 - 5. What is the third derivative of -t2 - t6 + nt*x + 0t*6 wrt t? -120t*3 Find the second derivative of -18r*2 - 2r + 5r + 11r + 11r wrt r. -36 Let w(b) be the first derivative of 7b*6/3 + 8b*3/3 - 4. Find the third derivative of w(r) wrt r. 840r2 Let f(l) be the second derivative of l6/72 + 3l5/40 - l3/6 - 5l. Let h(m) be the second derivative of f(m). What is the second derivative of h(i) wrt i? 10 Suppose 4r - 7 = 9. Suppose -3i - 5f = -14, ri - 4f - f - 7 = 0. Find the second derivative of -n - n3 - ni + 6n - 3n wrt n. -12n Let w(p) be the second derivative of -p7/42 - p4/12 + 7p. What is the third derivative of w(o) wrt o? -60o2 Let y(t) = -t3 - 7t2 - 6t. Let u be 16/6(-18)/8. Let k be y(u). What is the first derivative of v + 2 + kv + 0v + 2v wrt v? 3 Suppose 0 = -4d + 2z + 10, -4d = 2z + 2z - 16. Find the third derivative of -2c*5 + 2c*d - 2c3 + c2 wrt c. -120c2 What is the third derivative of 108x*6 + 0x*2 - 16x*2 - 136x*6 wrt x? -3360x*3 Let d(x) be the first derivative of 15x*2 - 62x - 44. What is the first derivative of d(i) wrt i? 30 Let m be (6/4)/(24/32). Let z(q) be the second derivative of q - q*m - 1/12q*4 + 0 + 0q*3. Find the first derivative of z(a) wrt a. -2a Let g(j) be the first derivative of j6/180 - j5/40 - j*3/3 - 1. Let y(c) be the third derivative of g(c). Find the second derivative of y(o) wrt o. 4 Let k(g) be the second derivative of -2g7/105 - g4/12 + g*2 + 4g. Let l(u) be the first derivative of k(u). What is the second derivative of l(j) wrt j? -48j2 Let j(u) = -u3 + 2u*2 + 2u - 3. Let m(g) = 1. Let q(x) = -j(x) - 2m(x). Let k be q(3). Find the second derivative of 0w*4 + 2w - 4wk + 3w*4 wrt w. -12w*2 Let b(d) = 2d*3 - 16d*2 + 8d. Let v(u) = u3 + u2 - u. Let w(q) = b(q) + 8v(q). What is the third derivative of w(t) wrt t? 60 What is the third derivative of -5c4 + c2 + 4c4 + 0c*4 wrt c? -24c Let s(q) be the third derivative of -1/210q7 + 0q + 0 + 1/8q4 + 0q*3 + 0q5 - q2 + 0q6. Find the second derivative of s(b) wrt b. -12b*2 Let n(a) = 44a*3 - 5a*2 - 3a - 3. Let l(i) = -45i3 + 5i*2 + 2i + 2. Let r(u) = 3l(u) + 2n(u). Find the third derivative of r(h) wrt h. -282 Let y(k) = k*3 - 3k*2 + 1. Let z be y(3). Suppose j - z = -0. Differentiate -1 + 3q*3 + 2 + j wrt q. 9q2 Let n(s) be the third derivative of -s8/56 - 7s5/60 + s2. What is the third derivative of n(d) wrt d? -360d*2 Suppose -2j + 4 + 0 = 0. What is the third derivative of -6 - 6kj + 6 - 2k*4 wrt k? -48k Let b(r) be the third derivative of r5/20 - r4/24 - r*3/6 + 2r**2. Let j(p) be the first derivative of b(p). What is the derivative of j(g) wrt g? 6 Let w = 35 + 9. What is	{ "pile_set_name": "DM Mathematics" }
xt term in -202, -721, -1552, -2701, -4174, -5977? -8116 What is next in 14, 33, 44, 47, 42, 29, 8? -21 What comes next: -648, -626, -588, -534, -464, -378? -276 What is the next term in 42613, 42642, 42701, 42802, 42957, 43178, 43477, 43866? 44357 What comes next: 253597, 253596, 253595? 253594 What comes next: 25556, 51123, 76690, 102257, 127824, 153391? 178958 What comes next: -244852, -489704, -734556, -979408, -1224260? -1469112 What is next in -30521, -30581, -30629, -30659, -30665, -30641, -30581? -30479 What is next in -1336, -2661, -3990, -5323? -6660 What comes next: 128, 536, 1228, 2210, 3488, 5068, 6956, 9158? 11680 What is next in -1618, -3228, -4830, -6424? -8010 What comes next: 1262, 2576, 3946, 5372, 6854? 8392 What comes next: -49854, -199425, -448718, -797739, -1246494? -1794989 What is next in -1065, -2107, -3139, -4155, -5149, -6115, -7047? -7939 What is next in -758, -825, -894, -965, -1038, -1113, -1190? -1269 What is next in -2252, -8741, -19556, -34697, -54164, -77957, -106076? -138521 What comes next: 87905, 88206, 88715, 89438, 90381, 91550, 92951? 94590 What is next in -15278, -30564, -45850, -61136, -76422? -91708 What is the next term in -413, -343, -273, -203? -133 What comes next: 18, -225, -470, -717, -966? -1217 What is the next term in -753, -758, -767, -780, -797, -818? -843 What comes next: 369, 468, 577, 702, 849, 1024, 1233, 1482? 1777 What is next in -271, -2181, -7365, -17461, -34107, -58941? -93601 What comes next: -87, 4006, 10827, 20376, 32653, 47658, 65391? 85852 What is next in 290, 643, 996, 1349? 1702 What is the next term in -45137, -90248, -135359, -180470, -225581? -270692 What is the next term in -129, -350, -661, -1062, -1553, -2134? -2805 What is the next term in -10226, -10232, -10238, -10244? -10250 What comes next: 11892334, 11892333, 11892332, 11892331? 11892330 What is the next term in -119, -665, -2131, -4973, -9647, -16609? -26315 What comes next: -2756, -2750, -2744, -2738, -2732? -2726 What comes next: -1526, -1461, -1354, -1205, -1014, -781, -506? -189 What is next in 21571, 43368, 65153, 86920, 108663, 130376? 152053 What comes next: -265, -1263, -2261, -3259, -4257? -5255 What is the next term in -2603, -5172, -7709, -10214, -12687? -15128 What comes next: -23670, -47385, -71100, -94815, -118530, -142245? -165960 What is next in 39941, 39980, 40019? 40058 What comes next: -918, -863, -808, -753, -698? -643 What is the next term in 133, 560, 1281, 2296, 3605? 5208 What is next in -944, -966, -1032, -1166, -1392, -1734, -2216? -2862 What is the next term in -62729, -62712, -62695? -62678 What is next in -94381, -94382, -94383, -94384? -94385 What is next in 5970, 5960, 5950, 5940, 5930, 5920? 5910 What is next in -277, -1173, -2685, -4813, -7557, -10917? -14893 What comes next: 446, 470, 496, 524, 554? 586 What comes next: 1522, 1499, 1440, 1327, 1142, 867, 484? -25 What is next in -82701, -82670, -82619, -82548, -82457, -82346? -82215 What comes next: -1203, -1237, -1305, -1425, -1615, -1893? -2277 What is next in -61870, -61871, -61872, -61873, -61874, -61875? -61876 What comes next: -483266, -966532, -1449798? -1933064 What is the next term in -1232, -1249, -1266? -1283 What comes next: 10, -210, -566, -1052, -1662, -2390? -3230 What comes next: -158, -340, -540, -758, -994? -1248 What comes next: -21477, -21474, -21471, -21468, -21465, -21462? -21459 What comes next: -220, -394, -548, -682, -796, -890, -964? -1018 What is the next term in -277, -1032, -2283, -4030, -6273? -9012 What is the next term in 468422, 936850, 1405278, 1873706, 2342134, 2810562? 3278990 What is next in -1742759, -1742765, -1742773, -1742783? -1742795 What is next in 421, 481, 545, 583, 565, 461, 241? -125 What is next in -1055797, -1055795, -1055793, -1055791, -1055789? -1055787 What is the next term in 1012, 1000, 984, 964? 940 What is next in 84024, 168109, 252204, 336315, 420448, 504609? 588804 What is the next term in 207, 753, 1969, 4191, 7755, 12997, 20253? 29859 What is next in -1384, -1375, -1368, -1363, -1360, -1359, -1360? -1363 What comes next: 3065, 3044, 3009, 2960? 2897 What comes next: -2245, -4479, -6713? -8947 What is the next term in -16500, -16491, -16470, -16431, -16368, -16275, -16146? -15975 What comes next: -50755, -50745, -50727, -50701, -50667? -50625 What comes next: 2606, 2630, 2676, 2750, 2858, 3006, 3200? 3446 What is next in -851, -3402, -7639, -13550, -21123, -30346, -41207? -53694 What comes next: 651345, 1302680, 1954015? 2605350 What is next in -3038, -12169, -27394, -48713, -76126? -109633 What is the next term in -58, -483, -1192, -2185, -3462? -5023 What comes next: -12822, -25646, -38472, -51300, -64130, -76962, -89796? -102632 What is next in -30, -126, -296, -546, -882, -1310, -1836, -2466? -3206 What is next in -92800, -185598, -278396, -371194, -463992, -556790? -649588 What is next in -62459, -62456, -62443, -62414, -62363, -62284? -62171 What comes next: 2509, 2522, 2549, 2596, 2669, 2774, 2917? 3104 What comes next: 2015, 2019, 2031, 2057, 2103, 2175? 2279 What comes next: -8372, -17718, -27064, -36410? -45756 What is next in 7114725, 7114724, 7114723? 7114722 What comes next: 7478, 7623, 7854, 8165, 8550, 9003, 9518? 10089 What is next in -949, -2233, -4175, -7105, -11353, -17249? -25123 What comes next: -13462, -13457, -13452, -13447? -13442 What comes next: -203868, -203876, -203896, -203934, -203996, -204088? -204216 What is the next term in 726, 695, 630, 525, 374, 171? -90 What comes next: 13973, 13961, 13943, 13919, 13889? 13853 What comes next: -798, -6418, -21674, -51384, -100366, -173438, -275418, -411124? -585374 What is the next term in 131360, 131359, 131358? 131357 What is next in 77, 72, 67, 68, 81, 112, 167, 252? 373 What is next in -174554, -174554, -174556, -174560, -174566? -174574 What is next in 5, 161, 317, 473? 629 What is the next term in -45924, -183724, -413392, -734928, -1148332, -1653604? -2250744 What is next in -49, -142, -181, -70, 287, 986, 2123, 3794? 6095 What is the next term in -33042, -33035, -33024, -33009, -32990, -32967, -32940? -32909 What is the next term in 422, 417, 412? 407 What is the next term in -115, -460, -997, -1696, -2527, -3460, -4465? -5512 What is the next term in 3913, 3977, 4041, 4105, 4169, 4233? 4297 What is the next term in 15345, 15317, 15289, 15261? 15233 What comes next: -275962, -275959, -275954, -275947, -275938, -275927? -275914 What is the next term in 1073, 4291, 9657, 17171, 26833, 38643? 52601 What comes next: -1190, -2436, -3682, -4928, -6174? -7420 What is the next term in 12587, 12600, 12621, 12650? 12687 What is the next term in -59480, -118960, -178440? -237920 What comes next: -6736, -6571, -6404, -6235, -6064? -5891 What is the next term in -81251, -162503, -243755, -325007? -406259 What comes next: -4036, -4030, -4014, -3982, -3928, -3846, -3730, -3574? -3372 What comes next: 6242, 12444, 18638, 24824, 31002, 37172? 43334 What is the next term in 396, 3036, 10166, 24030, 46872? 80936 What is the next term in 6803, 6831, 6885, 6965, 7071? 7203 What comes next: -1757981, -3515956, -5273931? -7031906 What is next in 7656196, 7656191, 7656172, 7656133, 7656068, 7655971, 7655836? 7655657 What is next in -2317, -18335, -61751, -146263, -285569, -493367, -783355? -1169231 What is next in -1493274, -1493266, -1493244, -1493202, -1493134, -1493034, -1492896? -1492714 What comes next: 302, 578, 824, 1040, 1226? 1382 What comes next: 6962, 7176, 7388, 7598? 7806 What is next in -71, -108, -141, -170, -195, -216, -233? -246 What is next in 583, 581, 579? 577 What is next in -7275, -14552, -21833, -29118? -36407 What is the next term in 1238394, 2476789, 3715184, 4953579, 6191974, 7430369? 8668764 What is the next term in -23796, -47591, -71386, -95181, -118976? -142771 What is next in 1004110, 1004109, 1004108? 1004107 What comes next: -12811, -25609, -38395, -51169, -63931, -76681? -89419 What is next in 5625, 22462, 50517, 89784, 140257? 201930 What is next in 173504, 347006, 520508, 694010, 867512, 1041014? 1214516 What is next in -3906, -15619, -35154, -62523, -97738, -140811, -191754, -250579? -317298 What is the next term in -96, -181, -244, -273, -256, -181? -36 What comes next: 24	{ "pile_set_name": "DM Mathematics" }
u = -2j - j + 27. Let h = 36 - -16. Let q = -48 + h. Solve -4r - u = -qb, -2b - 3r = -7b + 11 for b. 4 Let m = -21 + 24. Let a be 2(2 - 13 - -3). Let h = -12 - a. Solve -3w - ms = 24, -hw + 0s - 5s = 35 for w. -5 Suppose 0 = 4l + 4l - 112. Let k = 16 - l. Suppose -h + 24 = -4a, -a = -ka - 5. Solve -4d - 2g + 7 = -3, -hg = -2d + 20 for d. 4 Suppose -5g - 12 = -82. Let b = g - 11. Suppose -2m = bl + 3, -m + 9 = -l - l. Solve mu + 2d = 4d + 5, 3u - 5d = -1 for u. 3 Suppose -10g + 1 = -39. Solve -4q = -gt - 4, -4t = 2q + q - 10 for t. 1 Let y(o) = 28o + 554. Let h be y(-19). Solve -4v = 2i + h, -27 = 3i - 0v + 4v for i. -5 Let p(q) = q*3 + 6q*2 + q + 9. Let h be p(-6). Solve -5m + hm - 13 = y, -4m - 5y - 41 = 0 for m. -4 Let x(z) = -z3 - 2z*2. Let a be x(-3). Let o = a + -6. Suppose -2p - 4 = -op. Solve -5c = 2u + 2, pu + 0u + 4c = -4 for u. -1 Suppose -11u = -u + 370. Let g = u + 48. Solve r - 1 = 0, -r - g = 4y - 28 for y. 4 Let v(w) = 54w - 14. Let i be v(11). Let t be i/16 - (-3)/4. Let f = t + -19. Solve s - 2b + 7 = 0, 4s - s - 3b + f = 0 for s. -5 Let o = 195 + -183. Solve -5h - 24 + 9 = 0, -2h - o = -3t for t. 2 Let j = 22 - 29. Let n be (-6)/18 + j/(-3). Solve -5d = nx + 5, d - 3x - 17 = -7x for d. -3 Let x(c) = c3 - 13c*2 + 3c + 108. Let f be x(12). Solve -4b = v - 3, b + fv = v - 3 for b. 0 Let p = -13 + 14. Let s(h) = 0 - 2 - p + 2h + 2. Let l be s(3). Solve 0 = a - 4t - l + 1, 3t + 3 = -a for a. 0 Let i(n) = -2n*3. Let x be i(-1). Solve -k - 2t + 6 = 0, -4 = -2k + xt + 2t for k. 4 Suppose m + 2l + 3 = 0, m - 6l - 25 = -l. Suppose -mx + 66 = x. Suppose 0 = -2h - 0h + 4. Solve -8s + 2o + x = -3s, -hs = -5o - 17 for s. 1 Let z be (-35)/4 - 9/(-12). Let j be (-64)/(-10) - z/(-20). Let k be 2/3j/2. Solve -2l = -5l - 3a, 0 = -kl - 5a - 9 for l. 3 Let v(s) = -4s + 10. Let a be v(4). Let n be (-12)/(-36) + (-238)/a. Let j be 30/n + (-37)/(-4). Solve i - 2g - 2 = 0, 5g + j + 9 = -i for i. -4 Suppose 3i - 4h = 0, -4i + 21 + 1 = 2h. Let x be 25/50 - (-10)/i. Solve 3w - 19 + 6 = -2b, 0 = -xb - 2w + 12 for b. 2 Let h(a) be the second derivative of a5/5 + a4/6 - 5a3/6 + 3a*2/2 - 37a. Let i be h(1). Solve 2k - 1 = -iw - 19, -3k - 5 = -5w for w. -2 Let d be (1 - 1)/(62 - 60). Let h(r) = r*2 - 5r - 2. Let n be h(6). Solve d = 2t + 4s - 0s, ns = 4t - 12 for t. 2 Let p(d) = -d2 + 10d - 22. Let l be p(6). Suppose -lu + 30 = -3c - 2c, -u + 4c = -21. Solve 0 = 3f + 5r + 31 - u, -12 = 4f + r for f. -2 Let r(k) = -4k - 18 + k - 4k + 4k. Let a be r(-6). Solve -5b - 3u + 34 = a, 0u - 25 = -2b - 5u for b. 5 Let k = -74 - -83. Suppose ka - 12a = -6. Solve -5r + 25 = -3d, -ad = 2r - 4r + 10 for d. 0 Suppose 60 = 5p - 9p. Let c(f) = f + 17. Let a be c(p). Suppose -6 = -3u + 3. Solve -aj = -2o, -4j - u = 5o + 24 for o. -3 Suppose 3a = -4o + 21, 0 = -a + 3 - 0. Solve -2d = 5m - 2m + 11, -od = -m - 11 for d. 2 Let g be 2 - (3 + -2 + -1). Let o = g + -5. Let p be (-55)/(-44) + o/(-4). Solve -5q = -2t - q - 18, 5t - pq + 29 = 0 for t. -5 Suppose -4d + 2m + 11 = -d, 7 = -d - 2m. Suppose 4g = -s + 11, 2g + 2g + d = 3s. Solve -2t - si - 8 = 0, t + 4t = -2i - 20 for t. -4 Let m be -8 + -8(-4)/8. Let g be (-18)/(-18) - m/2. Solve -3n = n - 2w + 2, 0 = gw - 3 for n. 0 Suppose -3b - 3k + 18 = 0, -5 = -2b - 4k + 5. Let c(g) = -2g + 16. Let v be c(b). Suppose r = -0r + v. Solve d = w - 6, w + 0w + 6 = -rd for d. -4 Let m = -68 - -6. Let t = m - -64. Solve 2h - 9 = -3h + ti, 3i = 9 for h. 3 Let j(w) = -w*3 - 6w*2 + 5w - 10. Let g be j(-7). Solve 12 = -4b + 2b - 4k, 0 = -4b - gk - 16 for b. -2 Suppose 2c - 4u - 20 = -2c, 3u = -c - 11. Let d be (-32)/(-1) + (7 - 7). Suppose -v = 7v - d. Solve -j = -4r + c, 3j - 2r + 9 = -v for j. -5 Let a(p) = -10p*2 - 6p - 19. Let v be a(-3). Let z(s) = -s - 3. Let j be z(-7). Let u be j/(-26) - 469/v. Solve -2g + 3 - u = 0, -12 = 3x - 3g for x. -5 Let f(d) = -27d3 - d2 - d. Let h = 4 + -5. Let l be f(h). Suppose -5q = -q + a - 9, 5q - l = 4a. Solve n - 2u = 2, -n - 5u = -qn + 6 for n. -2 Let h = 574 - 571. Solve 3y = 3u - 3, hy + 2u = 8y + 2 for y. 0 Suppose 0 = 5u + 13 - 33. Let w = u + 5. Solve 3 = 3d + 2t - 8, 5d - w = -t for d. 1 Let l = -53 + 57. Suppose -1 = -3p + la, 0p + p - 4a = -5. Solve 3i = -pz - 6, 0z - 3z - 12 = 0 for i. 2 Let v(w) = 6w*2 + 14w + 9. Let h be v(-3). Solve -2q + 9 - 1 = 0, 0 = 5p + 4q - h for p. 1 Suppose 0 = i + 3a - 44 + 28, 0 = -3i - 5a + 52. Solve 0 = 5q + 2x + 3, q = -6x + x - i for q. 1 Let u be (-20)/5 + 4/(-2) + 9. Solve -4q - 10 = -m - 2q, -m - uq = 15 for m. 0 Let z(n) = 16n3 + 4n*2 - 2n - 1. Let i be z(1). Solve -2v = 2v - 5q, 3q - i = -v for v. 5 Let w(m) = m + 27. Suppose 5n + 120 = -5k, -4k - 122 = -3n - 5. Let u be w(k). Solve -y + 2 = g, ug + 2g = -3y + 6 for y. 2 Let i be (2 - 30/12)-8. Solve -16 = ig, -3g - 12 = -5f + 25 for f. 5 Let d = -4 + 7. Suppose -2i + db = -34, -b = 2i + 2b - 22. Suppose -3z + 4 = -8. Solve 3m = 2 + z, 5a - 2m = -i for a. -2 Let l = -737 - -747. Solve -4v + l = -6x + 4x, v = 3x + 15 for x. -5 Suppose -m + 6m + 5 = 0. Let v = -149 - -151. Let b be (v/m)/((-16)/24). Solve 0 = 4p - bp + 5t + 14, -p = -t + 2 for p. -4 Suppose -400 = 23q - 699. Solve -3u = -g, 3g + 0 - q = -4u for u. 1 Let g(p) = -22p + 10. Let q be g(0). Solve 4f = 3n + 4 - 6, 2n + 3f + q = 0 for n. -2 Suppose 43 + 27 = 5v. Let u(x) = -x3 + 8x*2 + 2x - 12. Let p be u(8). Solve v = -pd - 4t - 2, 3d = 3t for d. -2 Let o be (-2 - 2) + 7 + 1. Suppose m + 5h = -21, m - 3h + oh = -1. Solve -t - mc = 11, -t + 10 = -4c + c for t. 1 Let c(w) = -2w*2 - 3w*3 + 7 - 4w - 3w3 + 7w*3. Let m be c(3). Solve -2u = -0u - mj - 4, 3 = 2u - 3j for u. 0 Suppose -8 = -x - 3x + 5f, -f = 0. Suppose -xu + 0 = -12. Solve 0 = -2c + 2h - u, -4h - 4 = -0 for c. -4 Let w = 28 - 16. Suppose 2x - 3x = -y - w, 4x = -3y + 20. Suppose b + 0r = -r + 1, 3r - x = -4b. Solve -4h - bu = 13 + 12, -4h - u - 5 = 0 for h. 0 Let m(p) = 5p - 22. Let c(h) = -2 - 8 - 2h + 17. Let t(y) = 11c(y) + 4m(y). Let f be t(-8). Solve -3a + 10 = -v, -5a + 11 = fv - v for a. 3 Let r(n) = n3 - 2n*2 - 3n + 3. Let t be r(3). Suppose t = l - 9. Suppose -5j + l + 3 = 0. Solve jw = -2s - 20, -s - 16 = 2s + w for s. -4 Let k be ((-3)/9)/(18/(-270)). Solve -2r - 3r - 2j = -11, 5r = kj - 10 for r. 1 Let s = 11 - 7. Let j = 43 + -43. Suppose r = -3t + 14, 0r + sr - t - 4 = j. Solve -d - 7 = -m, m + 5d = rm - 23 for m. 3 Let r(o) be the second derivative of o*4/12 - 5o3/6 - o2 - 11o. Let z be (27/(-6))/((-3)/4). Let m be r(z). Solve g = x + 3, 0x + x + mg + 8 = 0 for x. -4 Let s be -34(-12)/8. Suppose -a + s = -0a. Suppose 0 = 7t - 3t. Solve 0 = -4w - 5c - a, 8 = -5w + c - t for w. -2 Let j(v) = 5v - 25. Let h be j(6). Suppose 1 - 9 = -2m. Solve 3w = -ho - w - 41, mo = 2w - 12 for o. -5 Let j be (7 + 2)(2/3 + 0). Suppose 2f + j = 2l, -5f - 7 + 2 = -3l. Solve -3q + q + 18 = 4i, 3i - 17 = fq for i. 5 Let s = 34 + -23. Suppose -2i + s = 3. Solve 0 = j + j + n - 8, 24 = ij - 2n for j. 5 Suppose 4q = -3m + 28 - 2, m = 5q - 23. Suppose 7i - 5i + 3 = -l, -ql = 2i - 9. Solve -u = 2s - 10 - l, -2s + 22 = 4u for u. 3 Suppose 5r + 21 = -14. Let i(s) = 5s + 38. Let k be i(r). Solve -5w + kq - 8 = -36, 5q = 2w - 15 for w. 5 Suppose 2i = 3g - 3i - 34, -g + 5i + 28 = 0. Solve 0 = 2y - 0y - gk + 12, 4y = -k + 4 for y. 0 Let c be 6(-6)/18-2. Solve -3q = 4i - 11, -3i - q = -2i - c for i. -1 Suppose -2y + 787 = 781. Solve 3c + 2p = 13, 0p + 18 = 4c + yp for c. 3 Suppose -d - 11 = -2t + 2, -5t - 4d = 0. Suppose 20 = -3b + 13b. Let m be (8/(-10))/((-2)/10). Solve -g + 3 = -u + 2g, -bu - tg + m = 0 for u. 0 Suppose t - g = 6, 9 - 13 = -t - g. Solve -l - 3x - t = 2x, -4 = -l + 4x for l. 0 Let q(v) = 2v - 40. Let z be q(23). Solve -b - 4l + 9 = -zb, l = 3b + 4 for b. -1 Let u(z) = -z + 4. Let m = -23 - -28. Suppose -g - 7 = -mt, 6t - 2	{ "pile_set_name": "DM Mathematics" }
5. 79 Calculate 251856 divided by 1188. 212 Calculate 3077656 divided by 769414. 4 Divide 1770024 by 2. 885012 What is 324220 divided by -5590? -58 Calculate 11 divided by -16832. -11/16832 38360 divided by 1096 35 -509786 divided by 5 -509786/5 Calculate -130400 divided by 16300. -8 Calculate -4 divided by -8755. 4/8755 -1589280 divided by -4 397320 Calculate -146385 divided by -3253. 45 Calculate -903149 divided by 5. -903149/5 Divide -127 by -101. 127/101 Divide -3 by 431705. -3/431705 Calculate -547008 divided by -2442. 224 Calculate -13946 divided by 367. -38 142940 divided by 14 10210 3514 divided by -1757 -2 Calculate -9937 divided by -219. 9937/219 85316 divided by 277 308 What is 24533250 divided by -6? -4088875 Calculate 1 divided by 15251. 1/15251 Calculate -48447 divided by -63. 769 What is -14599 divided by 146? -14599/146 What is 3613 divided by -16? -3613/16 -140 divided by 1355 -28/271 Divide -238 by 119. -2 What is -3645181 divided by -53? 68777 Divide -247 by 523. -247/523 196 divided by 187 196/187 Divide 42405 by -1285. -33 19255 divided by 3 19255/3 1774 divided by 400 887/200 Calculate -325745 divided by -205. 1589 Divide 138585 by -9239. -15 Divide -11 by 881. -11/881 22725 divided by 25 909 Calculate -10807 divided by -67. 10807/67 What is 1992946 divided by 6? 996473/3 Calculate -84651 divided by 5. -84651/5 66805 divided by 2155 31 0 divided by 27094 0 What is -218 divided by -957? 218/957 What is 294564 divided by -73641? -4 41080 divided by 20 2054 Divide -799920 by 90. -8888 -1 divided by -129346 1/129346 What is -1194209 divided by 1? -1194209 -5 divided by -25834 5/25834 Divide -438024 by -12. 36502 Calculate 403168 divided by -2. -201584 Divide -124191 by -41397. 3 What is -2814112 divided by -50252? 56 Divide 4 by -2190. -2/1095 Calculate -62836 divided by -1. 62836 2 divided by 406920 1/203460 Calculate 229 divided by 9691. 229/9691 -3873618 divided by 7794 -497 Calculate -552436 divided by -4. 138109 Divide 264806 by -132403. -2 Calculate -1287 divided by 6. -429/2 Divide -5624560 by 5. -1124912 Divide 29254 by 4. 14627/2 16 divided by 38445 16/38445 What is 8637 divided by 95? 8637/95 What is 2017968 divided by -8? -252246 Calculate -165426 divided by 1047. -158 -3971265 divided by -1323755 3 Divide -16492 by 4. -4123 Divide -3 by -31237. 3/31237 Divide 3956 by -65. -3956/65 What is 231868 divided by -52? -4459 What is 329952 divided by -11784? -28 -365260 divided by 35 -10436 Divide -185005 by 1. -185005 88308 divided by 132 669 Calculate -8 divided by 110179. -8/110179 Divide -152004 by 12. -12667 248746 divided by 554 449 What is 1 divided by -14618? -1/14618 Calculate -149936 divided by 5. -149936/5 Calculate -65 divided by 1305. -13/261 What is 255945 divided by 453? 565 -55053 divided by -1 55053 95 divided by -5876 -95/5876 Divide -5 by -15078. 5/15078 5 divided by -4210 -1/842 Divide 98237 by 98237. 1 29 divided by -155 -29/155 Divide -8551 by 8551. -1 What is -2258 divided by 2? -1129 424960 divided by 1 424960 What is 14334 divided by 8? 7167/4 What is -931 divided by 22? -931/22 146202 divided by -6 -24367 -111006 divided by -4 55503/2 What is 78499 divided by 2? 78499/2 63520 divided by -7940 -8 Calculate -2854992 divided by 1392. -2051 Calculate -27840 divided by 3480. -8 Divide -1204 by -17. 1204/17 65659 divided by 47 1397 Divide -138160 by -17270. 8 Calculate -2239 divided by -50. 2239/50 13 divided by -2598 -13/2598 -7984 divided by 1 -7984 What is -507338 divided by 2054? -247 Divide 1292655 by -14205. -91 Divide -35308 by 5044. -7 Calculate 1246 divided by 1785. 178/255 66 divided by -7783 -66/7783 Calculate 153075 divided by -75. -2041 What is 27688 divided by 13? 27688/13 Divide 5 by -1181. -5/1181 Divide 110 by 372. 55/186 -6564 divided by 1 -6564 What is -252316 divided by 11? -252316/11 What is -2243646 divided by 2? -1121823 Divide 374 by 196. 187/98 40 divided by -8484 -10/2121 What is 377375 divided by 125? 3019 Calculate 100903 divided by 18. 100903/18 What is -4 divided by 5659? -4/5659 Divide 664 by 69. 664/69 -956 divided by 2153 -956/2153 Divide -150618 by -75309. 2 What is 366 divided by -879? -122/293 Calculate 904911 divided by -43091. -21 What is 2359 divided by 7? 337 Divide -3874452 by -4. 968613 Divide -163844 by -6. 81922/3 What is 74250 divided by -375? -198 -3 divided by -55138 3/55138 Calculate 65550 divided by -19. -3450 Divide 173869 by -3. -173869/3 Calculate -93223 divided by -1313. 71 Calculate -2104643 divided by -4. 2104643/4 What is -20 divided by -2342? 10/1171 What is 72814 divided by 10402? 7 -8158 divided by 7 -8158/7 What is -364 divided by 927? -364/927 Calculate 112 divided by -1842. -56/921 Calculate 97 divided by 4988. 97/4988 -9472 divided by 8 -1184 Calculate -10230 divided by -1705. 6 What is -2 divided by 46131? -2/46131 -7192 divided by -62 116 -90254 divided by -45127 2 Calculate 46494 divided by -5166. -9 Calculate -106062 divided by -27. 35354/9 -1 divided by 1705562 -1/1705562 Divide 11822 by 5911. 2 67 divided by -3000 -67/3000 What is 6 divided by 22169? 6/22169 187904 divided by -187904 -1 187934 divided by -4 -93967/2 17 divided by -795 -17/795 Divide 20 by 10746. 10/5373 What is -29856 divided by -24? 1244 Divide -551 by 551. -1 Divide -51984 by -456. 114 Calculate 5 divided by 485. 1/97 Divide -35082 by 6. -5847 Calculate 6081 divided by -28. -6081/28 What is 45228 divided by 15076? 3 What is -3035 divided by 1? -3035 What is -710876 divided by -177719? 4 What is 23999 divided by 1? 23999 -7613 divided by 30 -7613/30 Divide 6015 by -11. -6015/11 Divide -38 by -2466. 19/1233 Calculate 71024 divided by -4. -17756 Calculate 1247368 divided by 311842. 4 9357 divided by -119 -9357/119 Calculate -132312 divided by 149. -888 Calculate -57402 divided by 6. -9567 Calculate 68994 divided by -3. -22998 What is 1447152 divided by 103368? 14 Calculate 4350708 divided by -6. -725118 4338 divided by -38 -2169/19 222714 divided by 6 37119 What is -433864 divided by 8? -54233 25815 divided by -22 -25815/22 Divide -87920 by 43960. -2 Calculate -14904306 divided by 6. -2484051 -875696 divided by -229 3824 What is 108600 divided by -2715? -40 -826365 divided by 89 -9285 Divide 81177 by -27059. -3 -18 divided by -1198 9/599 What is 6020 divided by -4? -1505 What is 89 divided by 8086? 89/8086 Calculate 156798 divided by -562. -279 Calculate 364950 divided by -60825. -6 -378348 divided by 9228 -41 Divide 2551290 by 510258. 5 What is 5304620 divided by 5? 1060924 -45 divided by -318 15/106 928 divided by -5005 -928/5005 -4 divided by 130080 -1/32520 What is -17 divided by -41187? 17/41187 Calculate 18 divided by 3878. 9/1939 Divide -5560 by 278. -20 What is -29601 divided by -33? 897 Divide 110025 by -5. -22005 What is -2353564 divided by -4633? 508 Divide -150 by 15131. -150/15131 2965 divided by -1 -2965 What is -3 divided by -321054? 1/107018 Calculate 2677 divided by 36. 2677/36 85690 divided by 4510 19 What is 3390849 divided by 49? 69201 Divide 12750 by -6. -2125 Divide 17986748 by 4. 4496687 What is 66792 divided by -1518? -44 21732 divided by -1 -21732 Divide 51400 by -2570. -20 Calculate 9 divided by 85202. 9/85202 What is -137 divided by 315? -137/315 Calculate -12769 divided by -12. 12769/12 Calculate -1699766 divided by 5. -1699766/5 Divide -31489 by 1. -31489 Divide 1 by -296745. -1/296745 -884151 divided by -3169 279 Divide 0 by 27455. 0 What is -7 divided by 54135? -7/54135 -3 divided by -8420 3/8420 Calculate 468800 divided by -5. -93760 -4970647 divided by -1 4970647 Calculate 40 divided by 215. 8/43 3 divided by -478350 -1/159450 10686 divided by 8 5343/4 37 divided by 5994 1/162 What is 27442 divided by 27442? 1 What is 1536486 divided by -36583? -42 Divide -3 by -152471. 3/152471 Divide 609 by 39. 203/13 What is -4285 divided by 822? -4285/822 What is 1272 divided by 1? 1272 Divide -43 by -8484. 43/8484 Divide 2 by -1082911. -2/1082911 Calculate -19 divided by -17256. 19/17256 What is 33 divided by 5035? 33/5035 32930 divided by 10 3293 Divide 134232 by -5593. -24 Calculate -63666 divided by -3537. 18 Calculate -989877 divided by -3. 329959 What is 9220 divided by 9? 9220/9 -314916 divided by 4 -78729 Calculate 105 divided by 18. 35	{ "pile_set_name": "DM Mathematics" }
e? (a) 0.2 (b) -4 (c) 2/3 (d) 0.07 b Which is the second biggest value? (a) 5 (b) -23/37 (c) 4 (d) 3/5 c What is the second smallest value in 2/7, 1/155, -1/8? 1/155 What is the third biggest value in 4, -1/2, 0.5, 209/2? 0.5 Which is the second smallest value? (a) 5 (b) 4 (c) -1 (d) 0.152 d Which is the second biggest value? (a) -2/3 (b) -61 (c) -1 (d) -0.5 (e) -5 a Which is the smallest value? (a) -1/30 (b) 4/7 (c) -0.3 (d) 1 c What is the second smallest value in -0.1, -3/22, 96? -0.1 Which is the biggest value? (a) -11 (b) 1/2 (c) -2 (d) -8/19 (e) 0.3 b Which is the smallest value? (a) -3/7 (b) -3 (c) 25 b Which is the second biggest value? (a) 3 (b) -0.2 (c) 42 (d) 2 a Which is the smallest value? (a) -15 (b) 40 (c) 0.2 a Which is the smallest value? (a) 0.4 (b) -5/2 (c) 5 (d) 1 (e) -11 e What is the third biggest value in -2.7, -4, 13? -4 What is the smallest value in 1, 26, -0.4, 0.8, 2/5? -0.4 Which is the fourth smallest value? (a) 0 (b) 2/7 (c) 89/3 (d) -0.3 c What is the fifth biggest value in -7, -5, 19, -3, 0.3? -7 Which is the smallest value? (a) 2 (b) -0.1 (c) -25 (d) -14 c What is the third smallest value in -3, 267, 2/5? 267 Which is the fifth smallest value? (a) -3 (b) -3/5 (c) 0.07 (d) -1 (e) -2/9 c What is the third biggest value in 0.2, -1/2, -4/5, 9/2, 1? 0.2 Which is the third smallest value? (a) -4 (b) -5 (c) 3091 c Which is the second smallest value? (a) -5 (b) -7/3 (c) -0.5 (d) 1/2 b Which is the third biggest value? (a) -4/11 (b) -6/17 (c) 2 a Which is the fifth smallest value? (a) -0.2 (b) -1/8 (c) -5/9 (d) -1 (e) -32/3 b Which is the second biggest value? (a) -2/163 (b) 3/22 (c) -4 (d) 2 b Which is the second biggest value? (a) -5 (b) 2 (c) 88 (d) -3/5 (e) 3 e What is the second biggest value in -22, 0.5, 0, 2/9, 4? 0.5 What is the third biggest value in 0.1, 0.5, 1, 6/13? 6/13 What is the third smallest value in -0.2, -0.5, -7? -0.2 What is the smallest value in -34, 3, 0.01, -1/8? -34 What is the second biggest value in 4/3, 0.2, 27/2? 4/3 What is the second biggest value in -2/3, 8273, -3? -2/3 What is the third smallest value in -0.06, -0.16, 2/3? 2/3 What is the second smallest value in -3, -66, 1/7, 3, 0? -3 What is the biggest value in -8/15, -0.3, -1? -0.3 Which is the second biggest value? (a) 0.4 (b) -2 (c) -35 (d) -0.1 d Which is the fourth smallest value? (a) -3/2 (b) -2/3 (c) 3 (d) 0.04 c What is the biggest value in -6/7, -1, 6, 0.4? 6 What is the biggest value in 2.7, -0.4, 1, 0.1? 2.7 What is the second smallest value in 1/5, 5/4, 4, 9? 5/4 What is the smallest value in 2/17, 0.06, 3/2? 0.06 What is the smallest value in 19, -5, -2? -5 Which is the biggest value? (a) 1 (b) 2/11 (c) -1/38 (d) -0.3 a What is the third smallest value in 1/6, -1, 3, 12/55, 3/5? 12/55 What is the fourth smallest value in 1/4, 3/5, -0.2, 0? 3/5 Which is the biggest value? (a) 0 (b) 4 (c) -433 b Which is the second smallest value? (a) -0.5 (b) -0.2 (c) 3/8 b Which is the biggest value? (a) 0.5 (b) -2 (c) -3/8 (d) -22.6 (e) 0 a Which is the fourth smallest value? (a) 3 (b) 4 (c) 0.4 (d) 14 d Which is the third biggest value? (a) 1/68 (b) 2 (c) 0.037 a What is the third smallest value in -1, 2/11, -3, 4? 2/11 Which is the fourth biggest value? (a) -1/2 (b) 0.5 (c) 3 (d) 26 a What is the third smallest value in 15, 0.2, -1/4? 15 Which is the biggest value? (a) 0.6 (b) -4 (c) -28 (d) 0.2 a Which is the third smallest value? (a) 0.4 (b) 2/9 (c) -2/19 a What is the fourth biggest value in -1, 0.1, -3, -4, -1/2? -3 Which is the smallest value? (a) -2/7 (b) -0.19 (c) -1/5 a What is the third smallest value in 3, -0.3, -5, 0.5? 0.5 What is the second biggest value in 2, 4, -3? 2 Which is the fourth biggest value? (a) -0.1 (b) 3 (c) 0 (d) 59 (e) 0.2 c Which is the smallest value? (a) -0.5 (b) 4 (c) 3/4 (d) 5 (e) -3 e What is the second biggest value in 2/59, 0.4, -42? 2/59 What is the second biggest value in -0.4, 0.464, -5/2, 5? 0.464 What is the biggest value in 3/4, 8/5, 1, 5? 5 What is the smallest value in -205, 0.3, 2/3? -205 Which is the third smallest value? (a) 0.1 (b) 5 (c) -57 b What is the biggest value in 25, -1, -5, 2? 25 What is the second biggest value in -5, -6, -0.6, 5? -0.6 Which is the third biggest value? (a) 4 (b) 308 (c) -0.1 c What is the second smallest value in 3, 36, -4? 3 Which is the third smallest value? (a) 0.5 (b) -1.42 (c) 0 (d) 0.1 d What is the fourth biggest value in -5, 0, 2/17, -0.5? -5 What is the fifth biggest value in -4, 5/2, -2, 0, 3? -4 Which is the smallest value? (a) 2/5 (b) -1/4 (c) -16/9 (d) -1/3 c Which is the second smallest value? (a) 4/33 (b) 4 (c) -2/3 a Which is the smallest value? (a) 5 (b) -4 (c) -0.09 b Which is the second biggest value? (a) 8/3 (b) 0 (c) -2/13 b Which is the second biggest value? (a) 2/13 (b) 2 (c) -0.4 (d) -3/4 (e) 5 b What is the second biggest value in 5/3, 4, -1/2, -31, 1/4? 5/3 What is the second biggest value in -0.1, 2, 0.2, 18? 2 What is the fourth smallest value in -2, 3, 0.07, -0.9, -0.5? 0.07 Which is the second biggest value? (a) -0.19 (b) -2/3 (c) -3 b Which is the smallest value? (a) -0.4 (b) -4 (c) 2 (d) 1 b What is the second biggest value in -1, 3/5, 7, -4? 3/5 What is the biggest value in -3, -2/15, -5, 12/7? 12/7 What is the second smallest value in 1, -3/101, 2/9, -4? -3/101 What is the third smallest value in 0.1, 1/7, -0.5, 0.3, -1.9? 0.1 What is the second smallest value in 0.3, 3/2, -59? 0.3 What is the smallest value in -4/5, -3, 1/5, -8.6? -8.6 Which is the smallest value? (a) -1.33 (b) 8 (c) -2/7 (d) 3 a Which is the biggest value? (a) -40 (b) -2 (c) -1/4 (d) 31 d Which is the smallest value? (a) -6/41 (b) -0.5 (c) -1 c Which is the fourth smallest value? (a) -2/19 (b) 3 (c) -50/11 (d) -3 b What is the third biggest value in -0.239, 0.5, 3, -4? -0.239 Which is the fourth biggest value? (a) 3/4 (b) 0 (c) 4/3 (d) -1/2 d What is the second smallest value in 2, -1/3, 0.08, 0.04? 0.04 What is the smallest value in -0.1, 3/4, -0.2, -1? -1 What is the fifth smallest value in 5, -2/69, 1/2, -1/6, -4/7? 5 Which is the third biggest value? (a) 4 (b) 0.2 (c) 1/8 (d) -17 (e) -7 c What is the third smallest value in 4/11, -1.4, -0.2? 4/11 What is the biggest value in 0.038, 2, 1, 5? 5 What is the biggest value in 2, 1, -10, 0.1, -0.1? 2 What is the second smallest value in -6, -1, 45? -1 What is the smallest value in -84, 2/13, -1/10? -84 Which is the fifth biggest value? (a) -2 (b) 4/5 (c) -1 (d) 157 (e) 1 a What is the fourth biggest value in -8, -2, -4/3, 0.4? -8 What is the smallest value in 0.4, 3/8, -0.595, -0.3? -0.595 What is the biggest value in -3/13, -15, -0.01, 1? 1 What is the third biggest value in 0, 2, -0.32, 1? 0 What is the second smallest value in 0.29, 1, -3/11? 0.29 Which is the smallest value? (a) -5/2 (b) -28 (c) -0.3 b What is the second biggest value in -7.1, -28, 0? -7.1 Which is the third biggest value? (a) 24/11 (b) 2/13 (c) -3 c What is the second biggest value in -10/9, 0.6, 1, -0.2, -2/5? 0.6 Which is the second biggest value? (a) -0.4 (b) 4 (c) -0.7 (d) 1 d Which is the fourth biggest value? (a) 2 (b) 1 (c) -2 (d) 0.032 c Which is the second biggest value? (a) -1 (b) -503 (c) 0.3 a What is the third biggest value in -17, -0.3, -1/3? -17 What is the biggest value in 0.3, 2, 39, -0.06? 39 Which is the second smallest value? (a) -5/4 (b) 0.2 (c) -8/3 (d) -5 (e) -1 c What is the biggest value in 18, 0.1, 0.5? 18 What is the third biggest value in 4, 1, -3.2, -3/7? -3/7 What is the smallest value in 5, -96, 2? -96 What is the second biggest value in 2/53, 0.2, -0.12, -2/3? 2/53 Which is the third biggest value? (a) -12.7 (b) -1 (c) 6 (d) -0.6 b What is the third smallest value in -4, 5/158, 4/3? 4/3 Which is the second smallest value? (a) 0.2 (b) -2 (c) -5 (d) -4/33 b What is the second smallest value in -5, 3/28, -42? -5 What is the second biggest value in 2/21, 0.3, -1/3, 1/317, -3/2? 2/21 What is the third biggest value in -0.4, 23, 0.5, 2, 5? 2 What is the fourth smallest value in -1, -4/	{ "pile_set_name": "DM Mathematics" }
rm of 380, -649, -2364, -4765? -343x2 + 723 What is the z'th term of -18945, -37953, -56961, -75969, -94977? -19008z + 63 What is the h'th term of -331, -603, -835, -1021, -1155, -1231, -1243? h*3 + 14h*2 - 321h - 25 What is the y'th term of 358091, 716166, 1074243, 1432322, 1790403? y*2 + 358072y + 18 What is the s'th term of 38, 346, 1182, 2810, 5494, 9498? 44s3 - 6 What is the l'th term of 727, 1415, 2087, 2737, 3359, 3947, 4495? -l3 - 2l*2 + 701l + 29 What is the o'th term of -34409, -68815, -103221? -34406o - 3 What is the y'th term of -46, 4, 88, 206, 358? 17y*2 - y - 62 What is the a'th term of -38756, -77501, -116246, -154991, -193736, -232481? -38745a - 11 What is the x'th term of -300653, -300655, -300657? -2x - 300651 What is the n'th term of 308, 561, 812, 1061? -n2 + 256n + 53 What is the q'th term of 121, 455, 1003, 1765, 2741, 3931, 5335? 107q2 + 13q + 1 What is the m'th term of -2903, -5819, -8733, -11645, -14555, -17463, -20369? m*2 - 2919m + 15 What is the j'th term of 3, 60, 203, 462, 867, 1448, 2235? 5j3 + 13j*2 - 17j + 2 What is the u'th term of 499, 1961, 4361, 7705, 11999, 17249, 23461? u*3 + 463u*2 + 66u - 31 What is the x'th term of -220679, -220681, -220683, -220685, -220687? -2x - 220677 What is the u'th term of -897, -1808, -2719, -3630? -911u + 14 What is the s'th term of 113973, 113969, 113965? -4s + 113977 What is the r'th term of -65, -218, -481, -908, -1553? -9r3 - r2 - 87r + 32 What is the r'th term of -2079433, -4158868, -6238303, -8317738? -2079435r + 2 What is the g'th term of 7072, 7097, 7122, 7147, 7172? 25g + 7047 What is the f'th term of -32959, -65900, -98841? -32941f - 18 What is the t'th term of -205, -597, -993, -1393, -1797? -2t2 - 386t + 183 What is the q'th term of 145, 275, 623, 1297, 2405, 4055? 18q3 + q2 + q + 125 What is the z'th term of 134003, 268012, 402021, 536030, 670039, 804048? 134009z - 6 What is the j'th term of 1110053, 1110054, 1110055, 1110056, 1110057? j + 1110052 What is the a'th term of -104, -151, -220, -323, -472, -679, -956, -1315? -2a3 + a2 - 36a - 67 What is the o'th term of 181, 492, 931, 1498, 2193? 64o2 + 119o - 2 What is the u'th term of -29050, -29004, -28934, -28828, -28674? 2u3 + 32u - 29084 What is the q'th term of -3363, -3352, -3339, -3324? q*2 + 8q - 3372 What is the p'th term of -102328, -102329, -102330, -102331, -102332, -102333? -p - 102327 What is the f'th term of -7205, -14413, -21621, -28829, -36037, -43245? -7208f + 3 What is the c'th term of -1, -42, -109, -202, -321, -466, -637? -13c*2 - 2c + 14 What is the o'th term of -5356, -21559, -48608, -86503, -135244, -194831? -5423o2 + 66o + 1 What is the z'th term of 5255339, 5255340, 5255341, 5255342, 5255343? z + 5255338 What is the v'th term of 1959, 2306, 2651, 2994, 3335? -v*2 + 350v + 1610 What is the r'th term of -8053, -7972, -7905, -7858, -7837, -7848, -7897, -7990? -r3 - r2 + 91r - 8142 What is the d'th term of -65282, -130565, -195860, -261173, -326510, -391877, -457280? -d3 - 65276d - 5 What is the k'th term of 7252146, 7252145, 7252144, 7252143, 7252142? -k + 7252147 What is the q'th term of -21, -121, -235, -369, -529, -721, -951? -q3 - q2 - 90q + 71 What is the z'th term of 96, 402, 984, 1902, 3216, 4986, 7272, 10134? 10z*3 + 78z*2 + 2z + 6 What is the c'th term of 78604, 157206, 235808, 314410? 78602c + 2 What is the d'th term of 618, 1234, 1828, 2388, 2902, 3358, 3744, 4048? -2d3 + d2 + 627d - 8 What is the u'th term of -10, -2, -18, -82, -218, -450, -802? -4u*3 + 12u*2 - 18 What is the r'th term of 213, 189, 171, 177, 225? 3r*3 - 15r*2 + 225 What is the r'th term of -7408, -7352, -7258, -7126? 19r*2 - r - 7426 What is the c'th term of -364, -308, -170, 92, 520, 1156, 2042, 3220? 7c3 - c2 + 10c - 380 What is the z'th term of 1218, 4895, 11032, 19629, 30686, 44203, 60180? 1230z*2 - 13z + 1 What is the s'th term of 4304, 17414, 39254, 69818, 109100, 157094, 213794, 279194? -s*3 + 4371s*2 + 4s - 70 What is the z'th term of 1443, 1420, 1397, 1374, 1351, 1328? -23z + 1466 What is the x'th term of 22789, 45628, 68511, 91444, 114433, 137484, 160603, 183796? x3 + 16x*2 + 22784x - 12 What is the p'th term of -16522, -66074, -148660, -264280, -412934, -594622, -809344? -16517p2 - p - 4 What is the d'th term of -617, -1012, -1401, -1784, -2161, -2532? 3d*2 - 404d - 216 What is the k'th term of -23157, -23160, -23163, -23166? -3k - 23154 What is the l'th term of -27108, -27100, -27092, -27084, -27076? 8l - 27116 What is the f'th term of 94, 510, 1202, 2170? 138f2 + 2f - 46 What is the p'th term of 4424, 17759, 39982, 71093? 4444p2 + 3p - 23 What is the t'th term of 92537, 92534, 92531? -3t + 92540 What is the o'th term of 8, 53, 126, 215, 308, 393, 458, 491? -2o*3 + 26o*2 - 19o + 3 What is the q'th term of -264, -201, -102, 33, 204, 411, 654? 18q2 + 9q - 291 What is the n'th term of -1783, -7132, -16047, -28528, -44575? -1783n2 What is the i'th term of -108616, -108615, -108614, -108613, -108612, -108611? i - 108617 What is the n'th term of 371, 348, 313, 260, 183? -n3 - 16n + 388 What is the j'th term of -1690, -3385, -5080, -6775, -8470? -1695j + 5 What is the g'th term of -11688, -11710, -11778, -11916, -12148, -12498, -12990, -13648? -4g3 + g2 + 3g - 11688 What is the t'th term of 2242, 2291, 2376, 2509, 2702, 2967, 3316, 3761? 2t*3 + 6t*2 + 17t + 2217 What is the l'th term of 857, 465, -195, -1129, -2343, -3843, -5635? -l*3 - 128l2 - l + 987 What is the x'th term of 543814, 543823, 543844, 543883, 543946, 544039? x3 + 2x + 543811 What is the y'th term of -206, -174, -156, -152, -162, -186? -7y*2 + 53y - 252 What is the o'th term of -363402, -726812, -1090228, -1453650? -3o2 - 363401o + 2 What is the h'th term of 206, 792, 1770, 3140, 4902, 7056, 9602? 196h2 - 2h + 12 What is the j'th term of -1479, -2905, -4331? -1426j - 53 What is the q'th term of 5283, 5279, 5275, 5271, 5267, 5263? -4q + 5287 What is the t'th term of 48, 106, 246, 510, 940? 7t3 - t2 + 12t + 30 What is the n'th term of -2761, -5492, -8231, -10984, -13757, -16556, -19387, -22256? -n*3 + 2n*2 - 2730n - 32 What is the g'th term of 38309, 38307, 38305, 38303? -2g + 38311 What is the c'th term of -92, -176, -248, -308? 6c*2 - 102c + 4 What is the q'th term of -425, -453, -483, -515? -q*2 - 25q - 399 What is the n'th term of 209433, 209436, 209441, 209448, 209457, 209468? n2 + 209432 What is the p'th term of -438, -1866, -4252, -7602, -11922, -17218, -23496? -p3 - 473p2 - 2p + 38 What is the f'th term of 364, -932, -2228, -3524, -4820, -6116? -1296f + 1660 What is the k'th term of 603, 1301, 1999? 698k - 95 What is the r'th term of -339, -336, -371, -462, -627? -3r3 - r2 + 27r - 362 What is the u'th term of -21872, -21822, -21774, -21728? -u*2 + 53u - 21924 What is the x'th term of 1220, 595, -446, -1903, -3776? -208x2 - x + 1429 What is the o'th term of -13755, -13762, -13769, -13776? -7o - 13748 What is the c'th term of -10559, -21183, -31805, -42425, -53043? c*2 - 10627c + 67 What is the d'th term of -79649, -79630, -79623, -79634, -79669, -79734, -79835, -79978? -d*3 + 26d - 79674 What is the u'th term of -329, -364, -399? -35u - 294 What is the q'th term of 4581, 8914, 13247? 4333q + 248 What is the s'th term of -7941, -7983, -8099, -8325, -8697, -9251? -6s3 - s2 + 3s - 7937 What is the l'th term of 265197, 265198, 265197, 265194? -l*2 + 4l + 265194 What is the o'th term of 46, 57, 78, 109, 150, 201, 262? 5o2 - 4o + 45 What is the o'th term of -46182, -46180, -46178? 2o - 46184 What is the l'th term of 6560, 6551, 6542, 6533, 6524, 6515? -9l + 6569 What is the g'th term of -586458, -586460, -586462, -586464? -2g - 586456 What is the c'th term of -803, -823, -843? -20c - 783 What is the h'th term of -231, -187, -143, -99, -55? 44h - 275 What is the h'th term of 225, 668, 1119, 1584, 2069, 2580? h3 - 2h*2 + 442h - 216 What is the a'th term of -98, -265, -608, -1211, -2158? -14a3 - 4a*2 - 57a - 23 What is the c'th term of 218, 855, 1918, 3407? 213c*2 - 2	{ "pile_set_name": "DM Mathematics" }
ivided by 10. 6 Let r = 1048 + -734. Suppose -5y = -r - 16. Calculate the remainder when y is divided by 35. 31 Suppose 15 = 6x - 3x. Let y(t) = -t2 + 6t - 3. Let f be y(x). Suppose f = -4r + 34. Calculate the remainder when r is divided by 5. 3 Let j(p) = -10p - 244. What is the remainder when 460 is divided by j(-36)? 112 Let a(c) = -12c2 + 170c + 6. Calculate the remainder when 84 is divided by a(14). 16 Let w = 1638 - 1554. Calculate the remainder when 159 is divided by w. 75 Let t(r) = -5r - 55. Let p be t(0). Let c = -38 - p. Suppose -23 = -2k - 4y + 41, 128 = 4k + 4y. What is the remainder when k is divided by c? 15 Let j(u) be the third derivative of -u4/4 + 13u*3/3 - 2u2. Calculate the remainder when j(-28) is divided by 49. 47 Let d = 1221 - 1187. Calculate the remainder when 77 is divided by d. 9 Let t(p) = p2 + p + 5. Let o be t(12). Suppose o + 19 = 2f. Suppose x - 5m = 5x - 69, 5x + 5m = f. What is the remainder when 41 is divided by x? 20 Suppose -2n + 22 = -6. Calculate the remainder when 97 is divided by n. 13 Suppose -2 = -r + 19. Let k(j) = -j*3 - 8j*2 - 9j - 11. What is the remainder when k(-8) is divided by r? 19 Let s(t) = t + 6. Let k be s(-8). Let i be k/(-9) + (-174)/54. Let n(j) = -j*3 - 2j*2 - j - 1. Calculate the remainder when 30 is divided by n(i). 8 Suppose -4w - 128 = -9w - 3y, 0 = 3y - 3. Let f = -6 + 5. Let v(m) = -13m. What is the remainder when w is divided by v(f)? 12 Suppose 0o = 2u + o - 13, 4 = 2u - 2o. Suppose 6 = -ub - 34. What is the remainder when (b - -6)/(4/(-38)) is divided by 10? 9 Let r = 22 - 16. Suppose -rl - 175 = -l. Let s = -10 - l. Calculate the remainder when s is divided by 14. 11 Let n = 259 + -256. What is the remainder when 6 is divided by n? 0 Let b(i) = -i*3 + 6i*2 - 2i + 7. Calculate the remainder when (-2)/6 + 524/6 is divided by b(5). 21 Let v = 5 - 1. Suppose -vz + 16 = 4a - 2z, a = 3z + 4. Calculate the remainder when 14 is divided by a. 2 Let q(s) = -s*3 + 6s*2 - 5s + 1. Let u be (-1)/(15/(-20)). What is the remainder when 24 is divided by q(u)? 11 Calculate the remainder when 121/(-4)-1024/60 is divided by (-6)/9 + 95/3. 28 Suppose -5l = -3l - 4. Let q = -1654 + 1655. What is the remainder when l is divided by q? 0 Suppose -4o + 3s = -341, 0 = -o - 10s + 5s + 68. What is the remainder when o is divided by 8? 3 Let n(t) = 5t*3 - 3t*2 - 3t + 2. Let j be n(-4). Let u = -204 - j. Calculate the remainder when (6/(-2))/((-9)/u) is divided by 17. 16 Let a(n) = 2n2 - 4n + 0n + 7n + 2. Let p = 18 + -16. Calculate the remainder when a(-2) is divided by p. 0 Let o(q) = -2q + 37. Let z be 5/(((-9)/(-3) - 1) + -3). What is the remainder when o(z) is divided by 18? 11 Suppose 4 = -g + 7. Suppose -5z - gj = -3, j - 2j - 13 = -3z. What is the remainder when 29 - (z + -4 + 2) is divided by 16? 12 Let l(w) = -6w*2 - 81w + 42. Let s = 4 + -2. Suppose -4g - k + 83 = 0, 25 = sg + 2k - 15. Calculate the remainder when l(-13) is divided by g. 18 Let d(g) = g3 - 18g*2 - 15g + 8. Let h be d(19). Let r = h - 51. Calculate the remainder when r is divided by -2 + 20 + (-2 - -1). 16 Let m = 6 + -3. Suppose k = 5i - 3 + 63, -mk + 4i + 136 = 0. Suppose l + 43 = 3g, -12l = 5g - 13l - 71. Calculate the remainder when k is divided by g. 12 Suppose -312g + 308g = -116. Suppose 128 = 4y - 96. Calculate the remainder when y is divided by g. 27 Suppose 2b = -2m + 44, 0 = m + m - 4b - 14. Calculate the remainder when m is divided by 11. 6 What is the remainder when 55 is divided by 169/52 + 5 + (-1)/4? 7 Let z = 0 + -2. Let j(r) = -2r*2 + 14r + 32. Let g be j(9). Calculate the remainder when (-6)/g + (-55)/z is divided by 16. 13 Let i(j) = -2j + 2. What is the remainder when i(-34) is divided by ((1 - 0) + -25)-1? 22 Suppose 11d - 696 = 305. Calculate the remainder when 174 is divided by d. 83 Suppose -2s + 4q + 69 = 3s, -30 = -2s + q. Suppose -4p = -o + 12 + 16, 4p = 4o - 124. What is the remainder when o is divided by s? 15 Calculate the remainder when 186 is divided by -7 - ((4 - 3) + -26). 6 Suppose g + 0 + 3 = 0. Let h be (3 - 0) + 30/g. Let n = 29 + h. Calculate the remainder when n is divided by 8. 6 Suppose 3m - 12 = -4r, 4r + 5m + 3 = 23. Suppose -23d + 27d - 292 = r. What is the remainder when d is divided by 25? 23 Let z be (-2)/4(-6)/(-1)3. Suppose 0 = 5d - 0g - 2g - 158, 4g - 100 = -3d. Calculate the remainder when ((-3)/z)/((-4)/(-1116)) is divided by d. 29 Suppose -16g + 312 = -10g. Calculate the remainder when 202 is divided by g. 46 Suppose -k + 114 = -4y, 0 = 2k + 6y - 5y - 237. Calculate the remainder when 582 is divided by k. 110 Let d = 383 + -226. Calculate the remainder when d is divided by 40. 37 Suppose -4c + 16 = -3c. Let v(r) = -r + 1. Let a(l) = 10l - 13. Let s(j) = 2a(j) + 18v(j). What is the remainder when c is divided by s(7)? 4 Let z(c) = 2c2 + 5 + 3 + 27c + 11. What is the remainder when 17 is divided by z(-13)? 5 Suppose 5i = -2j + 18, -5j + 2j = 3i - 18. Suppose 0 = 4g - u - 30, -4g - iu + 40 = 2u. What is the remainder when g is divided by 5? 3 Let c(n) = -n2 - n + 11. Suppose -6j - 45 + 15 = 0. Let s be c(j). Let w(x) = x*2 + 8x - 7. Calculate the remainder when w(s) is divided by 2. 0 Suppose 2n - 33 = -21. Calculate the remainder when 36 is divided by ((-18)/n)/(3/2) - -21. 17 Let p = 275 + -245. Calculate the remainder when p is divided by 9. 3 Let g(c) = 3c*3 - 11c*2 - 13c + 3. Let l(b) = -2b3 + 5b*2 + 7b - 1. Let n(o) = -3g(o) - 5l(o). Calculate the remainder when n(-3) is divided by 5. 4 Let c = 68 - -162. Suppose -4s - 232 = -0s - 4v, -4s - c = -5v. Let k = s + 95. Calculate the remainder when k is divided by 19. 16 Suppose -4h = -2j + 698, 0 = 3j + 4 - 7. Let a be h/12 - 9/(-6). Calculate the remainder when 37 is divided by (a/(-39))/((-2)/(-114)). 18 Calculate the remainder when 61 is divided by (1 + 0)(6 + 6 + 1). 9 Suppose 2c + 14 = c. Suppose -2k + 204 = 2k. Calculate the remainder when k is divided by (7/c)/((-3)/108). 15 Suppose 4o - 177 = -i, -i - 4o + 177 = -8o. Calculate the remainder when i is divided by 12. 9 Let v = -4 - -10. Let t be v/10 + (-63)/(-45). Suppose 0 = tr - 109 + 3. What is the remainder when r is divided by 18? 17 Let o(h) = h*2 - 11h + 4. Let x be o(10). Let w be (-9)/(-6)(0 + x). Let z = w + 54. What is the remainder when z is divided by 12? 9 Let a = -68 + 112. Suppose -3s = l - a, -l - 2s = -4s - 39. Calculate the remainder when l is divided by 21. 20 Suppose -3t + 4 = -2i + 15, -4i = 3t + 23. Let n(v) = v*2 - 5v - 21. Calculate the remainder when n(t) is divided by 18. 11 Let a(y) = y*3 + 8y*2 - 9y + 7. Let q(i) = i*3 + 5i*2 - 5i - 3. Let o = 18 - 24. Let d be q(o). What is the remainder when 25 is divided by a(d)? 4 Let r(g) = 2g2 + 4g + 3. Let q(m) = -m*3 - 20m*2 - 20m - 11. Let f be q(-19). Let a = 18 + f. What is the remainder when r(-6) is divided by a? 25 Suppose 1800g - 1798g = 268. Calculate the remainder when g is divided by 64. 6 Suppose 2n = -60 + 308. Calculate the remainder when n is divided by 28. 12 Let l(y) be the second derivative of y3/2 - 4y*2 - 10y. Calculate the remainder when 65 is divided by l(10). 21 What is the remainder when (-17550)/(-1575)(13 - -1)/1 is divided by 32? 28 Suppose -v - o - 1 = 0, 4v + 8 - 1 = -5o. Calculate the remainder when (0 + -6 - v)-10 is divided by 23/(-115) + (-136)/(-5). 26 Let s = 377 - 235. Calculate the remainder when s is divided by 75. 67 What is the remainder when 364 + ((-5)/4)/((-3)/12) is divided by 4? 1 Let j(l) = l*3 - 7l*2 + 3l + 13. Let u be (44/2 - 3)/1. Suppose b - u = -2f, -f - 2b = -3b - 8. Calculate the remainder when j(7) is divided by f. 7 Let g(j) = 25j*2 - 18j - 2. Calculate the remainder when 1044 is divided by g(1). 4 Let h be -31(-1 - 0/(-3)). Let d = h + -22. Let q = 15 - d. Calculate the remainder when 9 is divided by q. 3 Let s(m) = -m3 - 3m*2 - 3m - 6. Let g(r) = 40r2 + r. Let p be (4 - 21/6)/(3/6). What is the remainder when g(p) is divided by s(-4)? 19 Suppose -2r + 3q = 4q, -9 = -3r + 3q. What is	{ "pile_set_name": "DM Mathematics" }
+ 5 = x, -2q + 5 = p + 3 for p. 0 Suppose 5c - 2g + 6g - 410 = 0, 0 = -2c - 3g + 171. Let x = c - 75. Solve 0 = -0t - 3t + 3y + 15, 0 = xy + 9 for t. 2 Let u(w) = w + 4. Let x be u(12). Solve 10 = 4i - 2d + 5d, 2d = 3i - x for i. 4 Let u be -1 - (0 + 18 + 4). Let f = u + 25. Solve -a + 4m - 20 = 0, 0m = fa + 5m - 25 for a. 0 Let t be (-2 + 2 + 1)/((-26)/(-390)). Suppose 13x - t = 10x. Let a be (-4)/10 + (-2)/(-5). Solve 4u - 3j - 2 = a, 5u + j - 2 = xj for u. 2 Suppose -5g = -62 + 17. Suppose -k + g = j + 1, -5j + 4k + 85 = 0. Solve 2z + 3d = 4, -3d = -4z - j + 3 for z. -1 Let y = 71 + -51. Let u(f) = -f*3 + 11f*2 - 8f - 20. Let s be u(10). Let b = 15 + -10. Solve -4c = 2l - y, bc - 4l + s + 1 = 0 for c. 3 Suppose 10 = 4o - 2. Suppose 2j + 34 = 40. Suppose js + s - 40 = 0. Solve 5h + 5 = -4i - s, 16 = h - oi for h. 1 Let m(c) = 97c + 8. Let r be m(0). Solve -3f + a + 16 = 0, 12a = 5f + ra - 29 for f. 5 Suppose -4w = 4s - 8, 11w + 2 = s + 14w. Solve 2m - 2 = -4j, j + sm = 5m - 10 for j. -1 Let j be -9 + 23 - 9 - -2. Solve 3 = 3t - 4u, 4t + ju + 9 = 8u for t. -3 Let o = 438 - 434. Solve -q + 3h - 12 = 0, -oh - h = -3q - 24 for q. -3 Suppose 4l = -r - 5 + 42, r = 5. Suppose f + l = -0. Let w be f/4-1 + -2. Solve w = -t + 4t + 5u + 17, 5 = -2t + 3u for t. -4 Let s(c) = c + 8. Let o = -74 + 70. Let q be s(o). Solve z - qz + y - 19 = 0, -4z - 4y - 4 = 0 for z. -5 Let a be (-7 + 1 + -4 + 9)-4. Solve -l - 12 = -0c + ac, -4c = -l + 20 for c. -4 Let t = 2 + -8. Suppose 13 = 3i - 41. Let h be (2 + t)/((-3)/i). Solve -3u - 3a = -h, -3u = -4u + a for u. 4 Let i(m) = -28m - 56. Let v be i(-2). Solve -2h + h + 2u = v, 3h = -u - 14 for h. -4 Suppose 0 = -2o - 3o + 4j + 14, -4j = -3o + 2. Suppose -2u - u + 10 = -l, l - o = -u. Solve 4w + u = 3g, w - 3g + 9 = -1 for w. 2 Suppose -10b + 15b = 0. Suppose b = -3d + 5c + 12, 3d - 2c = 2c + 12. Solve -dg + 1 = -g - 2l, 5l + 12 = -2g for g. -1 Let l(u) be the second derivative of -u4/12 - u3 + 3u*2/2 + 11u. Let z be l(-6). Solve -3c + 11 = 2t - zt, 4c - 5t - 11 = 0 for c. 4 Let d(x) = -x2 + 7x - 7. Let t = -2 - -8. Let h be d(t). Let m be (h/(-1) + -2)/(-1). Solve 0 = -3n + 5k - m, -4n = -5k - 1 - 1 for n. 3 Let t(n) be the first derivative of -n*2 + 0n*2 - 1 - 2n - 2n + 2. Let c be t(-7). Solve -2i - r = 0, r = -i - 2r + c for i. -2 Let l = 17 - 10. Let m(f) = 4f*2 + 4f - l + 0 - 15f - 3f*2. Let x be m(12). Solve 2t + t = -xa + 2, 3t - 6 = -3a for t. 4 Let l(g) = -5g*2 - 43g + 2 + 20g + 21g. Let r be l(1). Let z be 14/35 - 8/r. Solve -2f - 10 = zw, 3f + 2 = f for w. -4 Suppose -13 = -5n + 3a, -5n + 40a - 43a + 7 = 0. Solve 6z = -2k + 2z - 14, -nk = 2z + 10 for k. -3 Suppose 0 = -3v - 0 + 3, 3v = -4h + 3. Suppose -2l - 4y = -hl + 6, -4l = y - 9. Solve -lf - 20 = -g, 15 = -g - 5f + f for g. 5 Let m be (-141)/(-11) + (-14)/(-77). Suppose 0 = -4p + m + 7. Suppose -2q - n + 8 = 0, -4n + 11 = -p. Solve -2l - 3l + qf - 11 = 0, 0 = l - 2f + 7 for l. -1 Let o = -12 + 15. Solve -5z - 3q - 30 - 2 = 0, oz = -3q - 24 for z. -4 Suppose -1653 = -89k - 407. Solve -5u + p = 29, p + 0 - k = 2u for u. -5 Let d = 36 + -33. Let h be (6/d)/(-5 + 6). Let z(n) = -n*3 - 4n*2 + 5n + 4. Let r be z(-5). Solve -5b + hk = rk + 11, 0 = 4b + 2k + 8 for b. -3 Let o = -17 + 16. Let s be 2 - 1(o + -2). Suppose -3a - 12 = -5a - 4w, 0 = -sa - 2w + 6. Solve ac = -3c - 4d - 22, -22 = 5c + 3d for c. -2 Suppose -3c + 84 = 3j, -2c + 2j = -3j - 28. Suppose -2u = -s + 2u + c, 2s = -4u + 12. Let h = -12 + s. Solve a - 3b = -2a - 9, h = 4b + 8 for a. -5 Let q be 280/4 + (-2 - 2). Let k = 66 - q. Let m = 2 + 1. Solve k = -5c - g - mg + 30, 0 = -5c - g + 15 for c. 2 Let l(q) = -42q - 8q + 17 + 2q*2 + 0q. Let j be l(25). Solve 2n = -4c - j + 5, -c = 2n for c. -4 Let z = -806 + 808. Solve 4f = zj - 4, 0 = 3j - 3 - 3 for f. 0 Let y(d) = d*3 - 8d*2 - 9d + 9. Let b be y(9). Suppose -3t = 2n - 3, n + 2t = -0t. Solve -q - n = -2r, 2r - 3 + b = 4q for q. 4 Suppose -2o - 5x = -44 + 7, -18 = -3o + 5x. Solve z + 26 = -5m, 4z - 2 = -m - o for m. -5 Let a(y) = y3 - 2y*2 + 5y + 3. Let x be a(0). Solve -xg = -5v + 27, -4v + 0 + 12 = 0 for g. -4 Let o(b) be the second derivative of -b4/12 + b3/3 + 3b*2/2 + 17b. Let c be o(2). Solve 0 = -t + ct, 0 = g - 4t + 1 for g. -1 Suppose -73n = -71n - 4. Solve -12 = -2y + 2s, y - ns + 16 = 6y for y. 4 Suppose -2r = -3k - 3r - 16, -k + 2r = -4. Let u be k/(-12)01. Suppose 5i - 18 - 62 = u. Solve 16 = -4m, 4l - 7m + 3m - i = 0 for l. 0 Let t be (12/(-24))/((-1)/(-4)). Let y(n) = 7n*2 - n - 4. Let h be y(t). Solve 2k = 4s - h, 2s + 6 = s - 2k for s. 4 Suppose 4g + 8 = 0, 0 = -5c - 0g + 3g + 16. Let a be (172/(-43))/(3 - 4). Solve -ay - 8 = -2o, cy + 0y = 4o - 10 for y. -1 Suppose -h + 4g + 7 = 0, -2h - 2g = -3h + 15. Suppose -4z + h = 11. Solve 4a + 2r + 15 = zr, r - 7 = 2a for a. -4 Let s be 2 - 45/(-20). Solve -4c + s = a, a = 3c - 2a - 21 for c. 2 Suppose -5a + 6a = 0. Let z be (-3)/6-4 - -2. Let k(p) = 9p - 10. Let s be k(z). Solve g - 5c - 27 = a, -4c + 0c - s = -3g for g. 2 Let s be (-3)/((-22)/(-4) - 4). Let g be -3 - s(-21)/(-6). Suppose -3m = -gm. Solve -5l - 35 = -5v - mv, -5v - l = -23 for v. 5 Let o(j) = j*2 - 35j - 154. Let a be o(39). Solve -k = -av - 1, v = 3k + 2 - 10 for k. 3 Suppose 0 = -4f + 67 - 47. Solve 3k + 5 = -5s, 8k - fk - 4s = 31 for k. 5 Let p = -53 - -53. Solve t = -4m + 4 + 4, 3t - 5m - 7 = p for t. 4 Suppose v - 32 + 2 = 0. Solve 6z - 2z - v = 2l, 3z = -l + 10 for l. -5 Let g(v) = 22v*3 - 1. Let w be g(1). Let h = w + -19. Solve -2b = 5c - 6 - 17, hb + 17 = 3c for c. 5 Suppose 0 = -2y - 63 + 3. Let h be (10/6)/((-4)/(-6 + y)). Solve n + 4t + h = 0, n + n + t = -2 for n. 1 Suppose 4g = -2a + 16, 6 + 4 = 2a + g. Suppose -4x + 436 = 5c, -490 = -4c - 4x - 138. Let o = 86 - c. Solve -4f - 2v = a, 5 = -5f - ov + 5v for f. -1 Let w = -69 - -55. Suppose 4b - 34 = 34. Let k = b + w. Solve kd - 20 = -5n, -5d = 3n - n - 27 for d. 5 Let w be 35/4 - 6/8. Suppose 12 = 3r - 3o, 4r + 4o = -0o + w. Suppose rf - 8 = -f. Solve fd - 4c + 11 = d, 4d + 11 = 5c for d. 1 Suppose -4f = -5l + 244, -2l - 228 = 3f - 22. Let x = f + 76. Solve x = -5n, -3n = -2y - 2n + 12 for y. 5 Let d be 4/((-4 - -1) + 4). Suppose -dj + 2b = j - 8, -4j + b + 7 = 0. Let p = 7 - j. Solve 3i - 13 = 4l + l, 5i = pl + 15 for l. -2 Suppose -3w + 6t - 3t - 9 = 0, 9 = 3t. Suppose w = c + 3c - 16. Suppose -17 = cg - 5s, 3s = -4g + 27 - 4. Solve -3 - g = 5h + 5i, 2i + 4 = 0 for h. 1 Let c = -81 - -83. Solve -g + 0 = -3j + 8, -10 = cg for j. 1 Let q(o) = -o3 - 7o*2 + 10o + 16. Let s be q(-8). Solve s = 6l - l - 5a, a = 5l + 12 for l. -3 Suppose 2n + 12 = 4n + 4b, 2n = -5b + 13. Solve -p = nc + p, 3p + 12 = 0 for c. 2 Suppose 0 = -10y - 2y. Suppose 7u = -u + 24. Solve -uk - 3 = 0, -4s + 0s - 2k + 14 = y for s. 4 Suppose -4y + 3y = -3. Suppose -g = -0g - 2. Let r = 15 - 4. Solve -2q + yb - 5 = 0, 4q - r = b - gb for q. 2 Suppose n = 0, -17 = -j + 2n - 4. Let a(r) = -r3 + 14r*2 - 13r + 1. Let i be a(j). Solve 4y + 3d = 14, 3 = -3y + 4d + i for y. 2 Let c(f) = 6f - 18. Let a be c(-5). Let y = a - -52. Let g(l) = 2l + 7. Let w be g(6). Solve 3s - o + w = o, ys + 2o = -2 for s. -3 Suppose 14m - 10m - 16 = 0. Solve d - 1 = 3c, 0d = -md + 5c - 10 for d. -5 Suppose -4r - 20 = -4q - 2r, 5q = -4r - 1. Solve -5s - qy + 7 = 0, 3s + 2 = -5y + 3 for s. 2 Let k be (60 - 27) + 2(-1)/2. Solve -4 = 4b, -kn = -36n + 2b - 14 for n. -4 Let a be (-18)/(-153) + 21/(-204)-28. Solve ap + 6 = g + 22, 3p - 28 = 4g for g. -4 Let x(j) = j - 5. Suppose -l = -3i - 22, 6l + 5i = 2l + 3. Let n be x(l). Let d be 3/12/n. Solve 6a + 4 = 2a, -2f = -5a + d for f. -4 Suppose 0 = 29m - 21m - 80. Solve 5a + 8 = 2o - m, -a = -o + 6 for o. 4 Let z = -85 - -95. Suppose 0 = 3f + 2 + 4. Let g be (f + 2)/(2 - 1). Solve 2i = -5*j	{ "pile_set_name": "DM Mathematics" }
31d + 1. Find the second derivative of k(g) wrt g. 532 Differentiate -103904z + 158z3 + 145 + 103904z wrt z. 474z2 Let j = 3 + 1. Let i(l) = -21l*3 + 4l*2 - 4l + 7. Let x(f) = 20f3 - 3f*2 + 3f - 6. Let r(s) = jx(s) + 3i(s). What is the derivative of r(u) wrt u? 51u2 Let c(x) be the first derivative of -9x*2 + 0x*3 + 0x - 31 + 0x4 + 8/3x*6 + 0x*5. What is the second derivative of c(h) wrt h? 320h*3 Let n(w) = -2w*4 + 23w*2 - 5w. Let b(d) = -d4 - d2 - d. Let h(l) = 5b(l) - n(l). Find the third derivative of h(u) wrt u. -72u Suppose -3n - 2h - 8 = 0, -3n + 0n + 20 = -5h. Suppose o = -no + 3. What is the second derivative of 6k5 - ok*5 - 5k + 5k5 wrt k? 160k3 Let i(u) be the third derivative of -u4/24 + 19u3/6 - 3u*2. Let t be i(15). Find the third derivative of tn*6 + 692n*4 - 4n*2 - 692n*4 wrt n. 480n*3 Let d(z) = 35z*6 + 2z*3 - 18z*2 - 7. Let u(b) = 35b*6 + 2b*3 - 19b*2 - 6. Let h(w) = 6d(w) - 7u(w). Find the third derivative of h(o) wrt o. -4200o*3 - 12 Let c(d) be the first derivative of -3d*5/5 - 17d4/4 - d2 + 53d + 44. Find the second derivative of c(m) wrt m. -36m*2 - 102m Let v(j) be the third derivative of -13/24j4 + 0j*5 + 0j - 13/120j6 + 3j*2 + 0 + 0j*3. Find the second derivative of v(h) wrt h. -78h Let w(y) be the second derivative of -2y - 1/2y*3 + 0 + 5/2y*2. What is the first derivative of w(m) wrt m? -3 Let r(h) be the second derivative of -9h + 5/21h7 + 0h*2 + 4/3h*4 + 0h*3 + 0h*6 + 0h*5 + 0. Find the third derivative of r(t) wrt t. 600t*2 Find the first derivative of -592j + 296j - 17 - 14j*2 - 125 + 299j wrt j. -28j + 3 Let z(b) be the first derivative of -11b*8/336 - 7b*4/24 - 6b*2 + 9. Let t(f) be the second derivative of z(f). Find the second derivative of t(o) wrt o. -220o*3 Suppose 0 = 6y + 40y. Let h(r) be the first derivative of yr*4 + 0r + 4/5r5 + 0r*3 - 7/2r*2 - 2. Find the second derivative of h(a) wrt a. 48a*2 Let c(f) = 11f*4 + 14f*3 + 114f*2 + 5. Let z(q) = 2q4 + q3 + q*2 + 1. Let l(t) = -c(t) + 5z(t). Find the third derivative of l(b) wrt b. -24b - 54 Find the second derivative of r4 - 63r - 51r3 + 104r - 52r3 wrt r. 12r*2 - 618r Let f(q) be the second derivative of -57q4/4 + 41q*2/2 + 483q. Differentiate f(x) with respect to x. -342x Differentiate 3v*3 - 82v*4 - 237 - 3v*3 + 242 with respect to v. -328v*3 Let m(c) = 259c*2 - 265. Let p(v) = 65v*2 - 65. Let l(g) = 6m(g) - 22p(g). What is the first derivative of l(h) wrt h? 248h Let m = -456 - -459. Let o(l) be the second derivative of 0l4 + 0l*m - 5l - 3/10l5 - 11/2l*2 + 0. Differentiate o(d) with respect to d. -18d*2 Let n(a) be the third derivative of 16a*6/3 - 349a*5/60 + 53a*2 - 2a. What is the third derivative of n(q) wrt q? 3840 Let c(v) be the second derivative of 53v3/3 + 11v*2 + 70v. What is the first derivative of c(z) wrt z? 106 Find the third derivative of -7n + 2n + 220n6 - 2n*2 + 5n wrt n. 26400n3 Let v(d) be the third derivative of 20d7/21 + d5/2 - 267d2 + 1. Find the third derivative of v(q) wrt q. 4800q Let z(a) be the first derivative of -33a4/4 + 146a*3/3 - 2. What is the third derivative of z(i) wrt i? -198 Find the third derivative of 92i*2 + 3i*5 - 26i*2 - 3i*5 + 45i*6 - 44i*6 + 2i*5 wrt i. 120i*3 + 120i*2 Suppose -9f + 4f + 40 = -v, -3f + 24 = -3v. Suppose 0l - 2l = -24. What is the derivative of fq + q + l + 2q - 2q wrt q? 9 Let o(f) be the third derivative of 39f6/40 + 13f5/60 - f4/8 - 6f2 + 8. What is the third derivative of o(i) wrt i? 702 Let o(d) be the second derivative of -52d + 3/14d7 + 1/4d*4 + 0d*5 + 0d*3 + 0d*2 + 1/15d*6 + 0. What is the third derivative of o(g) wrt g? 540g*2 + 48g Let c = 10/139 - -228/695. Let w(d) be the first derivative of 0d - 5 - 5/3d*3 - cd*5 + 0d*2 + 0d*4. What is the third derivative of w(s) wrt s? -48s Let y(w) = 2w + 16. Let g be y(22). What is the second derivative of 5f*3 - 47f - 18f3 + gf wrt f? -78f Let q(m) be the second derivative of 3m7/70 + m5/60 + 3m2 - 11m. Let x(g) be the first derivative of q(g). What is the third derivative of x(v) wrt v? 216v Let y be 0 + (1 - (-3 - -3)). Let i(t) = t2 + t. Let q be i(y). Find the second derivative of 10v*2 - 8v*q - 4v + 9v + 0v*2 wrt v. 4 Suppose 5l + 2 - 17 = 0. Let v be ((-9)/1 - -1)/(-2). What is the derivative of 20hl - 20h*3 + 10h*v + 10 wrt h? 40h*3 Let w(m) be the second derivative of -37m*4/2 - 119m*3/6 - 90m. Find the second derivative of w(v) wrt v. -444 Let h = -47 + 29. Let a be 10/45 + (-86)/h. What is the second derivative of -2x5 - xa - 2x*5 + 2x wrt x? -100x3 Let j(k) = -67k*3 + 4k*2 + 4k - 53. Let t(a) = -66a3 + 3a*2 + 3a - 52. Let z(s) = 3j(s) - 4t(s). Differentiate z(x) wrt x. 189x2 Differentiate -191 - 18g*2 - 73g*4 + 58g*2 - 21g*2 - 15g*2 + 11g*4 with respect to g. -248g*3 + 8g Let f(l) = l - 1. Let a(s) = -s - 1. Let c be a(-2). Let u be f(c). Find the second derivative of 7v + 6v*3 + uv - 2v + 3v*3 wrt v. 54v Suppose 12 = -2h + 6. Let r be (-2)/(-6)(3 - h). What is the third derivative of 2 - 4s2 + 2s*4 - r + 0 wrt s? 48s Find the first derivative of -841g2 + 374g*4 - 136 + 841g*2 wrt g. 1496g*3 Let r be (-24)/(-9) - (-4)/12. Differentiate 5 + 2 + 4q*4 + 5q*3 - 5q*r with respect to q. 16q*3 Suppose 2g + 10 = 0, 2g - g = 4m + 55. Let v = 3 - m. What is the first derivative of -v + 8 + 3 + 6k4 wrt k? 24k*3 Differentiate 3 + 270v*3 + 9 - 3315v*2 + 3315v*2 + 16 wrt v. 810v*2 Let q(h) = -24h*2 + 13h + 9. Let k(u) = 6u2 - 5 - 3u - 4 + 6 + 1. Let n(t) = 9k(t) + 2q(t). Find the second derivative of n(g) wrt g. 12 Let m = 0 - -2. Suppose 0 = -6c - 5c + 22. Find the third derivative of -8n5 + 0n*m + 10n*5 - 3n*c wrt n. 120n*2 Let u = -28 - -33. Suppose 0 = w - 2w + u. Find the third derivative of 15q2 - 3q*5 + 12q*5 - wq*2 wrt q. 540q*2 Let n(d) = -4d*3 - 3d*2 - 141. Let c(z) = -20z*3 - 16z*2 - 706. Let r(m) = 2c(m) - 11n(m). Differentiate r(l) wrt l. 12l*2 + 2l Let i(m) = -206m3 - 3m*2 + 3m - 237. Let v(w) = -409w3 - 7w*2 + 7w - 473. Let r(l) = 7i(l) - 3v(l). Differentiate r(k) with respect to k. -645k2 Let y(v) be the third derivative of -v8/336 - 43v*6/120 - 2v5/15 + v4/12 + 6v2 - 8v. What is the third derivative of y(n) wrt n? -60n2 - 258 Suppose 0n + n = 0. Let h be 5 + -1 + (-2 - n). What is the third derivative of -8j4 + jh + 8j*4 - 8j*6 wrt j? -960j*3 Suppose 0 = -i - 3d - 24, -5d - 76 = 4i - i. Let h be 9/i + (-14)/(-6). Differentiate 6z2 - 8z*h - 2 + 12z*2 + 9 wrt z. 20z Suppose 20 = 7d - 1. What is the derivative of -c - 5 + c - 20 + 41c*d wrt c? 123c*2 Differentiate 33 + 26z*2 + 150 + 45 + 104z*2 - 24z*2 wrt z. 212z Suppose 2z + d - 157 = 67, -562 = -5z - 3d. What is the second derivative of zk*3 - 110k*3 + 4k*4 + 6k wrt k? 48k2 Let i = -36 + 38. Differentiate 2 + 5y*4 + 4y*4 + i - 24 with respect to y. 36y*3 Let t = -10 + 18. Let s be ((-5)/2)/(2/(-4)). What is the third derivative of 5c*5 + 9c*2 - 3c*5 + tcs - c5 wrt c? 540c2 Let c(n) = n3 + 4n*2 - 3n - 7. Let m be c(-4). What is the derivative of -mj3 - 11 + 29 - 14 wrt j? -15j*2 Let f(g) be the second derivative of 0 + 0g*4 + 0g*2 + 4/3g*3 - 2g - 11/20g5. What is the second derivative of f(t) wrt t? -66t Let v(g) = 2g2 - 3g + 6. Let h(p) = 3p2 - 7p + 13. Suppose -15d = -17d + 26. Let l(c) = dv(c) - 6h(c). Find the second derivative of l(j) wrt j. 16 Let b = -5 + 7. Let c(u) = 3u + 4 + 6u*2 - 5u - 6u2 + 4u*3. Let w(f) = f - 1. Let n(k) = bw(k) + c(k). Differentiate n(s) with respect to s. 12s2 Let k(z) = -z2 - 4z + 5. Let o be k(-4). Suppose 2u - 1 = o. What is the derivative of 3f*4 - 6f*4 + 2f*4 + u wrt f? -4f*3 What is the second derivative of -34x*3 - 252x*3 - 71x*3 - 66x*3 - 637x wrt x? -2	{ "pile_set_name": "DM Mathematics" }
ven decimal places? -0.0000007 Let h = -20 + 32. Suppose -4y = -hy + 39680. What is y rounded to the nearest one hundred? 5000 Let p be 153/85 + 2/10. Let y be (-1)/(-1)(6 - p). Suppose 5w - i = -7310683 - 639314, -yw = 3i + 6360009. Round w to the nearest 100000. -1600000 Let r = -43.8368 + -0.5932. Round r to the nearest 10. -40 Let q = 0.4 - 0. Let t = 30.6 + q. Let d = t + -30.9999852. What is d rounded to six decimal places? 0.000015 Suppose 50h + 432000 = 41h. What is h rounded to the nearest ten thousand? -50000 Suppose 4g = 23301 + 6295. Let a = g + -16687. Let x = 19988 + a. Round x to the nearest one thousand. 11000 Let z = -451.0199 - -0.0199. Let t = z + 452.9532. Let a = 1.92 - t. Round a to 3 dps. -0.033 Let u = -1 - -55. Let i be 26/u + (-40318)/(-9). What is i rounded to the nearest 100? 4500 Let g = 1.496 + -1.3733. Let p = -0.12268559 + g. Round p to 6 decimal places. 0.000014 Suppose -2k = 2k + 12. Let s be (7783)/2 - k. Suppose 0 = -3w + 2w + s. What is w rounded to the nearest 100? 1200 Let b = -113 - -211. Let n = -5319374674.99999866 - -5319374773. Let v = b - n. What is v rounded to seven decimal places? -0.0000013 Let x be ((-80)/(-100))/((-2)/17725). Round x to the nearest 1000. -7000 Suppose -4m = 3w + w - 13467988, 2m = -6. Round w to the nearest 100000. 3400000 Let d = 4381.11 - 4363. What is d rounded to zero decimal places? 18 Let x(d) = d*2 + 9d - 10. Let t be x(-10). Suppose 273010 = -h + 2m, -3h + 3m - 907136 + 88121 = t. Round h to the nearest 10000. -270000 Let h = -0.144 - 70.856. Let s = h - -71.0266. What is s rounded to two decimal places? 0.03 Let d = -3.003 + -0.861. Let f = d - 0.036. Let o = f + 3.90057. Round o to four dps. 0.0006 Let o = 208.579 - 10964.279. Let b = 10342 + o. Let r = -445 - b. Round r to the nearest integer. -31 Let h = 6831.71 - 6347.7. Let m = -482 + h. What is m rounded to 1 decimal place? 2 Let h = 51.66 + -0.66. Let g = 37407 - 37457.969. Let b = h + g. Round b to 2 decimal places. 0.03 Let a be -1 + (-200)/(-35) + (-8)/(-28). Let h be 12/((-5)/(a137500)). What is h rounded to the nearest 100000? -1700000 Let b = 347.2 - 347.206071. What is b rounded to 4 dps? -0.0061 Let s = -12.65 + 13. Let m = s + 0.23. What is m rounded to 1 dp? 0.6 Let r = 3403.998279 - 3404. What is r rounded to 3 decimal places? -0.002 Let l = -548.3 + 576.41. Let r = -28 + l. Let a = -0.109878 + r. Round a to 5 decimal places. 0.00012 Let z = -896285 + 902891.67. Let s = z - 6562. Let g = 45 - s. Round g to 1 decimal place. 0.3 Suppose 0 = -35i + 36i. Let c(q) = -2q2 - q + 11300. Let u be c(i). Round u to the nearest one thousand. 11000 Let q = 23809222 + -5209210. Suppose -q = 2u - 4k, 2u + 0k + 18599988 = -4k. Round u to the nearest 1000000. -9000000 Let n = 190.61565237 + 34.38437893. Let z = 225 - n. What is z rounded to six decimal places? -0.000031 Suppose 96 = 2y + 4n, -5y + 2n = -166 - 110. Let k = y - 6. Let i be -2k/10125000. Round i to the nearest one million. -1000000 Let l = -3.1281 - -57.1086. Let h = -44.1 + -9.9. Let i = l + h. What is i rounded to 3 decimal places? -0.02 Let s = 400 + -399.99999446. What is s rounded to 7 dps? 0.0000055 Let r = -1751 + 679. What is r rounded to the nearest 10? -1070 Let o(p) = -786722p - 224. Let r be o(8). What is r rounded to the nearest 1000000? -6000000 Let c = -0.158 + 0.158008. What is c rounded to 6 decimal places? 0.000008 Let v(b) = -29556b + 6. Let w be v(-4). Round w to the nearest 10000. 120000 Let i = 1051669.9486 - 1051331. Let k = i - 339. What is k rounded to 2 decimal places? -0.05 Let u = 48 + -55. Let l(r) = -3r2 - 12r - 10. Let q be l(u). Round q to the nearest ten. -70 Let i(j) = 1186538j + 11 + 9 - 226536j. Suppose 5z + 1 = -49. Let a be i(z). What is a rounded to the nearest 1000000? -10000000 Let f = -1934.7 - -1155.4. Round f to the nearest one hundred. -800 Let p = -41 + 98. Let o = -57.00000062 + p. What is o rounded to seven decimal places? -0.0000006 Let c = 17.7 - -0.3. Let m = -17.9907 + c. Round m to 3 decimal places. 0.009 Let m = 57.4 - -16.6. Let o = m - 75.38. Round o to zero dps. -1 Let q = 85859 - 85911.9886. Let v = 52 - -1. Let u = q + v. What is u rounded to three decimal places? 0.011 Let s be (-3)/(1 + (-8910)/8901). Round s to the nearest 100. 3000 Let d = 16 + -2. Let q = d + -12.9. Let g = -1.1000003 + q. What is g rounded to 7 decimal places? -0.0000003 Let u(m) = -9380m + 10. Let s be u(15). Let w = -70190 - s. Round w to the nearest 10000. 70000 Let n = -168.8 + 134.3. What is n rounded to the nearest ten? -30 Let g(a) = -4a. Let d be g(-1). Suppose 4z + 4r = -8, dz - 2r + 14 = -24. Round z to the nearest ten. -10 Let h = -1011672 - -1011671.8890338. Let j = -0.111 - h. Round j to 6 decimal places. -0.000034 Let d = -7.8075 - -9.15. What is d rounded to one dp? 1.3 Let x = 40411.971 + -40481. Let f = x + 69. What is f rounded to 2 decimal places? -0.03 Let b = -298.7 - -13.7. Let l = b + 284.999999298. Round l to 7 dps. -0.0000007 Let g = -1673917499.99999926 - -1673917518. Let i = g + -18. Round i to seven decimal places. 0.0000007 Let n = 3.279001487 - 3.279. Round n to 7 decimal places. 0.0000015 Let h = 18 - 4. Suppose -4k = 5r + 13, 3r - 3k = 2r - h. Let w be 50/3(1625 + r). What is w rounded to the nearest 10000? 30000 Let u = 10 - 7. Let c = u - -11. Let g = 14.056 - c. Round g to two decimal places. 0.06 Let m = -618 - -618.000000157. Round m to seven decimal places. 0.0000002 Let d(x) = -5648x*3 + 9x*2 + 14x + 5. Let k be d(-9). What is k rounded to the nearest 1000000? 4000000 Let p = -27.4 - -27.343. What is p rounded to 3 dps? -0.057 Suppose 3b = -5a + 458399990, 4a + 125095962 = b - 27704046. Round b to the nearest one million. 153000000 Let a = 1054.00000683 - 1054. What is a rounded to six decimal places? 0.000007 Let h = -22.19 + 23. Let s = -4.71 + h. Round s to 0 dps. -4 Suppose -5w = -9w + 1280. Round w to the nearest 100. 300 Let c = 0.1607 - 0.160695905. What is c rounded to seven decimal places? 0.0000041 Let x(n) = -2269n*3 + 5n*2 - 3n - 6. Let q be x(-4). Suppose -5l + q = -137263. Suppose -j - 396513 = -l. Round j to the nearest 100000. -300000 Let c = 2447.612 + -2447.1720076. Let k = 0.44 - c. Round k to six dps. 0.000008 Let l = -10.3 - -27. Let z = -8.3 + l. Let q = z + -8.4000098. What is q rounded to six dps? -0.00001 Let w = 7272 + -2103. Let q(z) = -wz - 9110z + 10 + 2578z. Let g be q(10). Round g to the nearest 10000. -120000 Let i(c) = 6c + 1. Let h be i(-1). Let p(o) = 24401o*2 + 4 + 5o - 4. Let w be p(h). What is w rounded to the nearest one hundred thousand? 600000 Let i = 2 - 3.1. Let z = -0.3920915 + -0.707909. Let h = i - z. Round h to 7 decimal places. 0.0000005 Let g = -1229.92 - 16.08. Let i = -1246.1027 - g. Let n = -0.1 - i. Round n to three dps. 0.003 Let l = 24 - 24.95. Let h = l + 2.09. Let t = h - 1.1451. What is t rounded to three decimal places? -0.005 Let h = 35 + -34.79. Let i = h - 0.29. Let w = 0.78 + i. Round w to 1 decimal place. 0.7 Let a = 6.2444535 + -6.246. What is a rounded to four decimal places? -0.0015 Let l = -23 + 27. Suppose -n - 1472 = -lu + 7127, -3n + 10753 = 5u. What is u rounded to the nearest 100? 2200 Let w = -2.137 + 37.917. Round w to zero decimal places. 36 Suppose 22860001 = -2n + a, 4n + 5a - 22336778 = -68056773. Round n to the nearest one million. -11000000 Suppose -11499 = -5w - 2x, -6 - 4 = -5*x. Let u = w + 2101. What is u rounded to the nearest one thousand? 4000 Let r = -0.9673 - 13.637. Let j = r - -14.68. Round j to 2 dps. 0.08 Let y = -49.001 + 0.001. Let c = y + 48.99942. What is c rounded to 4 dps? -0.0006 Let c = 73.000412 + -73. What is c rounded to 5 decimal places? 0.00041 Let b = 13 - 12.9998789. Round b to five dps. 0.00012 Let j = -124 - -52. Let m = j - -72.083. What is m rounded to 2 dps? 0.08 Let m = -13.9 - -1.9. Let j = m + 17. Let w = 4.9999992 - j. Round w to 7 dps. -0.0000008 Let a = 1047050 - -2555829. Let v = a - 3602878.8360091. Let u = -0.164 + v. What is u rounded to 6 decimal places? -0.000009 Let s = -0.030507173 + 0.03051. Round s to 7 dps. 0.0000028 Let h be 24/36 - (-15810346)/3. Let n = h +	{ "pile_set_name": "DM Mathematics" }
by 1 -39078798 21727 divided by 12204 21727/12204 What is 65039 divided by 1079? 5003/83 2480157 divided by -4 -2480157/4 -448 divided by 3888 -28/243 What is 64373 divided by 336? 64373/336 What is 0 divided by 1410479? 0 Calculate 43486291 divided by -4099. -10609 Calculate 3 divided by 34557. 1/11519 Divide -132323958 by 234. -565487 What is -3 divided by -22953451? 3/22953451 What is 4 divided by 2080114? 2/1040057 Calculate -114946608 divided by 8. -14368326 Calculate -773049232 divided by 4. -193262308 -218297762 divided by 2423 -90094 What is -21110090 divided by 1? -21110090 Divide 5125 by -8018. -5125/8018 Divide -5164 by 29986. -2582/14993 -51743580 divided by -1190 43482 Divide -13501282 by -2. 6750641 3 divided by -13123649 -3/13123649 Divide -2139101 by -5. 2139101/5 Divide 3794122 by 362. 10481 What is 153432750 divided by 6? 25572125 What is 1384295 divided by 2? 1384295/2 15995 divided by 24 15995/24 What is -139240 divided by 23? -139240/23 Calculate -121 divided by 279565. -11/25415 -3788773 divided by -3 3788773/3 Calculate -14278000 divided by -15. 2855600/3 Calculate -15169632 divided by 5056544. -3 What is 526 divided by -183998? -263/91999 Calculate 76543324 divided by -76. -1007149 What is -12460614 divided by 6230307? -2 Divide 247 by -26784. -247/26784 What is 3 divided by -126899? -3/126899 Divide -77846 by -661. 77846/661 Divide -3405 by -85368. 1135/28456 Divide 77 by 1745160. 77/1745160 Divide 17117 by 829. 17117/829 What is 23690436 divided by 14? 1692174 Calculate 18747741 divided by 6249247. 3 Divide -1011558186 by -125847. 8038 Divide 348905900 by -303925. -1148 541316248 divided by -5 -541316248/5 Calculate -35888088 divided by -2111064. 17 What is 40125059 divided by 39? 3086543/3 -2 divided by -6770373 2/6770373 Calculate -40976316 divided by -2. 20488158 Divide 0 by -17772481. 0 Calculate -150 divided by 1057979. -150/1057979 2 divided by -155081180 -1/77540590 Calculate -20020 divided by -2016. 715/72 What is 156318363 divided by 9? 17368707 What is -35803790 divided by -171310? 209 -1007988843 divided by 1 -1007988843 What is 47787330 divided by -207771? -230 What is 2759718 divided by -1379859? -2 Divide 23121 by -815. -23121/815 Calculate -72084 divided by 35. -72084/35 -1944 divided by -216693 216/24077 79475853 divided by 4 79475853/4 60531458 divided by 2328133 26 What is -160324563 divided by -53441521? 3 -123620860 divided by 24724172 -5 Calculate -3114 divided by -10701. 346/1189 What is 294983892 divided by 342? 862526 Calculate -8886 divided by 7662. -1481/1277 Calculate 628973731 divided by 4. 628973731/4 What is -3968888 divided by -1516? 2618 Calculate 31455396 divided by -84. -374469 Calculate -2817400 divided by -28174. 100 What is -2 divided by -31974209? 2/31974209 -54962814 divided by 186 -295499 Divide 4 by 99597077. 4/99597077 Divide 112430516 by -5110478. -22 Divide -17517139 by -1. 17517139 4 divided by 12394737 4/12394737 33749585 divided by -6749917 -5 Divide -9791026 by -11. 9791026/11 Calculate 349606600 divided by 120554. 2900 -5279150 divided by 50 -105583 -4 divided by 1234954 -2/617477 What is 3753799 divided by 5? 3753799/5 Divide -5188251 by 4773. -1087 What is 11931038 divided by 7? 1704434 What is -1 divided by 6149774? -1/6149774 Calculate 97321743 divided by -8667. -11229 Divide 25612496 by -11. -25612496/11 Divide 11 by 386214. 11/386214 Calculate 1552072 divided by 10211. 152 What is -33852510 divided by 6770502? -5 Calculate -547085 divided by 35. -15631 Calculate -383581699 divided by 4. -383581699/4 Divide -252978070 by -5. 50595614 What is 127464625 divided by 5? 25492925 What is -8832384 divided by -3168? 2788 Divide 12346920 by 30. 411564 Divide -2186 by -53492. 1093/26746 -7186 divided by -169 7186/169 83531240 divided by -4176562 -20 1241025 divided by 2 1241025/2 What is 17 divided by -2285707? -17/2285707 180807680 divided by 141256 1280 Calculate -73058202 divided by 47013. -1554 Calculate 5585444 divided by 4. 1396361 Calculate 5545 divided by 39655. 1109/7931 -74218760 divided by -1686790 44 Divide -15771616 by -1267. 12448 Calculate 25695600 divided by 79800. 322 Divide 1965720 by 6. 327620 Calculate -111 divided by -24038. 111/24038 Divide -11601996 by -196644. 59 What is 44 divided by 306465? 44/306465 Divide -686184375 by -517875. 1325 Calculate 5553 divided by 2794. 5553/2794 Divide 141419817 by -9. -15713313 Calculate -3971077 divided by 84491. -47 What is 5707 divided by 22686? 5707/22686 What is -772634761 divided by -6? 772634761/6 Calculate 58110405 divided by -1. -58110405 -1018015 divided by 5 -203603 Calculate 8015256 divided by -4. -2003814 Calculate 26795701 divided by 431. 62171 What is 166666 divided by -3868? -83333/1934 5 divided by -23115243 -5/23115243 Divide 599695 by 36. 599695/36 Calculate 135651078 divided by 3. 45217026 361773900 divided by -401971 -900 What is 11 divided by -3395092? -11/3395092 48002360 divided by 25 9600472/5 What is 591171 divided by 21? 28151 What is 144700168 divided by -412? -351214 Divide -48360180 by 85745. -564 -38165386 divided by 7574 -5039 What is 243 divided by -87473? -243/87473 Divide -1137 by 7548. -379/2516 Divide 2368882 by -722. -3281 What is -8725464 divided by 479? -18216 What is -272176 divided by -38? 136088/19 -59 divided by -132021 59/132021 What is -129 divided by -2240? 129/2240 328195426 divided by -358 -916747 Calculate -11137184 divided by 179632. -62 Calculate 61021161 divided by 6780129. 9 597 divided by -20829 -199/6943 Calculate -1747643 divided by -1747643. 1 Divide 13871 by -95. -13871/95 Calculate 740772 divided by 13718. 54 Divide 134707768 by 4. 33676942 Calculate -19 divided by 287. -19/287 Divide -108374 by -230. 54187/115 Divide -19 by 10336478. -19/10336478 Divide -97430662 by 5. -97430662/5 What is 13427969 divided by -167? -80407 What is -8397860 divided by 1679572? -5 What is -35673920 divided by 2229620? -16 Calculate 1788138 divided by -1. -1788138 1240344 divided by 8 155043 Divide -58 by -390246. 29/195123 Divide 511 by -662249. -73/94607 What is 3 divided by 1453594? 3/1453594 What is -698091064 divided by 4? -174522766 Calculate 161806158 divided by 80903079. 2 Calculate 599498 divided by -1. -599498 0 divided by -3864765 0 Divide 68 by -2509932. -17/627483 Calculate 153 divided by 10000. 153/10000 Calculate 6950 divided by -1012. -3475/506 Calculate -3985 divided by -1128. 3985/1128 Calculate 63413554 divided by -2. -31706777 What is 7 divided by -6305344? -7/6305344 Calculate -6 divided by -58917946. 3/29458973 5 divided by 5386806 5/5386806 Divide 14336880 by 2389480. 6 What is -146451024 divided by -92808? 1578 Divide -326478210 by 15. -21765214 Calculate 41 divided by -236370. -41/236370 Calculate 4 divided by -11513430. -2/5756715 Divide -13498 by 3513. -13498/3513 -688398 divided by 2382 -289 Calculate 1470022 divided by 118. 735011/59 What is -622607 divided by 753? -622607/753 -2 divided by -17466490 1/8733245 Divide 7613 by -2755. -7613/2755 189451787 divided by 12887 14701 0 divided by 7703594 0 Divide -8 by -13826103. 8/13826103 1049160 divided by 209832 5 -3559680 divided by -2304 1545 564887 divided by 516 564887/516 Divide -4697784 by -1404. 3346 Divide 7814175 by 5. 1562835 What is -398717865 divided by 44301985? -9 What is 4482136 divided by -8? -560267 Divide 236123601 by -1606283. -147 What is 974660 divided by 4? 243665 Divide -631507 by 94. -631507/94 Calculate 2054 divided by -12140. -1027/6070 Divide -3757860372 by -4. 939465093 Divide -19 by 3627087. -19/3627087 -541337916 divided by 3 -180445972 Divide 75587711 by 8. 75587711/8 Calculate 1598575 divided by 145325. 11 -17 divided by 4660 -17/4660 -486711154 divided by -2 243355577 -214 divided by 787009 -214/787009 Calculate -10171832 divided by 4. -2542958 Divide 31 by -14489. -31/14489 What is -17971962 divided by -5990654? 3 What is 140452580 divided by -6? -70226290/3 What is 1478949 divided by 51? 28999 What is 155047 divided by -75? -155047/75 What is 43374986 divided by -43374986? -1 Divide -11053296 by 15612. -708 Calculate 9506016 divided by -40624. -234 What is -5576280 divided by 3720? -1499 Divide -195944 by 688. -24493/86 -52719228 divided by 166833 -316 -541 divided b	{ "pile_set_name": "DM Mathematics" }
3 What is the ninth root of 232 to the nearest integer? 2 What is 132055 to the power of 1/10, to the nearest integer? 3 What is the cube root of 38390 to the nearest integer? 34 What is the square root of 2682 to the nearest integer? 52 What is the eighth root of 5640 to the nearest integer? 3 What is 80493 to the power of 1/10, to the nearest integer? 3 What is the third root of 3431 to the nearest integer? 15 What is the cube root of 8473 to the nearest integer? 20 What is the tenth root of 1357 to the nearest integer? 2 What is the fifth root of 4665 to the nearest integer? 5 What is 65298 to the power of 1/2, to the nearest integer? 256 What is the third root of 28386 to the nearest integer? 31 What is the sixth root of 1523 to the nearest integer? 3 What is the cube root of 39196 to the nearest integer? 34 What is the cube root of 19887 to the nearest integer? 27 What is 9077 to the power of 1/2, to the nearest integer? 95 What is 17415 to the power of 1/2, to the nearest integer? 132 What is the third root of 5760 to the nearest integer? 18 What is the tenth root of 21451 to the nearest integer? 3 What is the third root of 24161 to the nearest integer? 29 What is the square root of 15318 to the nearest integer? 124 What is 11648 to the power of 1/3, to the nearest integer? 23 What is 29054 to the power of 1/2, to the nearest integer? 170 What is the fifth root of 20549 to the nearest integer? 7 What is 7127 to the power of 1/3, to the nearest integer? 19 What is 9361 to the power of 1/2, to the nearest integer? 97 What is the cube root of 119800 to the nearest integer? 49 What is 982 to the power of 1/2, to the nearest integer? 31 What is 16893 to the power of 1/6, to the nearest integer? 5 What is 102 to the power of 1/4, to the nearest integer? 3 What is the fourth root of 2120 to the nearest integer? 7 What is the square root of 72145 to the nearest integer? 269 What is the cube root of 52804 to the nearest integer? 38 What is 5223 to the power of 1/3, to the nearest integer? 17 What is 21150 to the power of 1/2, to the nearest integer? 145 What is the tenth root of 1173 to the nearest integer? 2 What is 136667 to the power of 1/4, to the nearest integer? 19 What is 33 to the power of 1/8, to the nearest integer? 2 What is 12497 to the power of 1/6, to the nearest integer? 5 What is 9753 to the power of 1/2, to the nearest integer? 99 What is 765 to the power of 1/3, to the nearest integer? 9 What is 9130 to the power of 1/2, to the nearest integer? 96 What is 162 to the power of 1/6, to the nearest integer? 2 What is the tenth root of 1454 to the nearest integer? 2 What is the ninth root of 4166 to the nearest integer? 3 What is the ninth root of 15591 to the nearest integer? 3 What is the ninth root of 4158 to the nearest integer? 3 What is the fourth root of 2773 to the nearest integer? 7 What is 24808 to the power of 1/2, to the nearest integer? 158 What is 125831 to the power of 1/8, to the nearest integer? 4 What is 2181 to the power of 1/2, to the nearest integer? 47 What is the square root of 14085 to the nearest integer? 119 What is 5589 to the power of 1/3, to the nearest integer? 18 What is the square root of 85701 to the nearest integer? 293 What is 130487 to the power of 1/2, to the nearest integer? 361 What is the square root of 20982 to the nearest integer? 145 What is the third root of 5647 to the nearest integer? 18 What is 687 to the power of 1/2, to the nearest integer? 26 What is 8279 to the power of 1/2, to the nearest integer? 91 What is the cube root of 1881 to the nearest integer? 12 What is the square root of 556 to the nearest integer? 24 What is 3288 to the power of 1/3, to the nearest integer? 15 What is 10638 to the power of 1/3, to the nearest integer? 22 What is the third root of 267 to the nearest integer? 6 What is 89 to the power of 1/8, to the nearest integer? 2 What is 3197 to the power of 1/8, to the nearest integer? 3 What is 4235 to the power of 1/7, to the nearest integer? 3 What is 4399 to the power of 1/2, to the nearest integer? 66 What is 1127 to the power of 1/6, to the nearest integer? 3 What is the seventh root of 8745 to the nearest integer? 4 What is the ninth root of 1997 to the nearest integer? 2 What is 5094 to the power of 1/9, to the nearest integer? 3 What is the sixth root of 1062 to the nearest integer? 3 What is 148 to the power of 1/3, to the nearest integer? 5 What is 49856 to the power of 1/3, to the nearest integer? 37 What is the ninth root of 10700 to the nearest integer? 3 What is 7160 to the power of 1/9, to the nearest integer? 3 What is the fifth root of 4203 to the nearest integer? 5 What is 13778 to the power of 1/2, to the nearest integer? 117 What is 141 to the power of 1/3, to the nearest integer? 5 What is the cube root of 48338 to the nearest integer? 36 What is the third root of 3200 to the nearest integer? 15 What is the square root of 561 to the nearest integer? 24 What is the square root of 123086 to the nearest integer? 351 What is 3953 to the power of 1/2, to the nearest integer? 63 What is 27447 to the power of 1/6, to the nearest integer? 5 What is 369 to the power of 1/2, to the nearest integer? 19 What is 3929 to the power of 1/2, to the nearest integer? 63 What is 49720 to the power of 1/8, to the nearest integer? 4 What is the square root of 1422 to the nearest integer? 38 What is the square root of 7317 to the nearest integer? 86 What is 6123 to the power of 1/8, to the nearest integer? 3 What is the cube root of 1280 to the nearest integer? 11 What is the cube root of 58032 to the nearest integer? 39 What is the square root of 21866 to the nearest integer? 148 What is 25099 to the power of 1/10, to the nearest integer? 3 What is 4551 to the power of 1/10, to the nearest integer? 2 What is the square root of 1253 to the nearest integer? 35 What is 3614 to the power of 1/6, to the nearest integer? 4 What is 1433 to the power of 1/3, to the nearest integer? 11 What is the third root of 5040 to the nearest integer? 17 What is 4419 to the power of 1/6, to the nearest integer? 4 What is the square root of 147562 to the nearest integer? 384 What is 2805 to the power of 1/2, to the nearest integer? 53 What is 33898 to the power of 1/4, to the nearest integer? 14 What is the fourth root of 6573 to the nearest integer? 9 What is the third root of 12272 to the nearest integer? 23 What is the tenth root of 8334 to the nearest integer? 2 What is the eighth root of 2629 to the nearest integer? 3 What is 31939 to the power of 1/3, to the nearest integer? 32 What is the tenth root of 298 to the nearest integer? 2 What is 97546 to the power of 1/2, to the nearest integer? 312 What is the cube root of 114017 to the nearest integer? 48 What is the square root of 30970 to the nearest integer? 176 What is 2146 to the power of 1/2, to the nearest integer? 46 What is 9112 to the power of 1/6, to the nearest integer? 5 What is the square root of 14808 to the nearest integer? 122 What is the square root of 1135 to the nearest integer? 34 What is the cube root of 1433 to the nearest integer? 11 What is the fifth root of 305 to the nearest integer? 3 What is the square root of 2739 to the nearest integer? 52 What is the fourth root of 12710 to the nearest integer? 11 What is 8373 to the power of 1/3, to the nearest integer? 20 What is the tenth root of 30402 to the nearest integer? 3 What is the square root of 19562 to the nearest integer? 140 What is 1358 to the power of 1/2, to the nearest integer? 37 What is the cube root of 3415 to the nearest integer? 15 What is the fourth root of 675 to the nearest integer? 5 What is the third root of 1989 to the nearest integer? 13 What is 15668 to the power of 1/3, to the nearest integer? 25 What is 76442 to the power of 1/10, to the nearest integer? 3 What is 824 to the power of 1/8, to the nearest integer? 2 What is 4362 to the power of 1/3, to the nearest integer? 16 What is 2647 to the power of 1/4, to the nearest integer? 7 What is the tenth root of 497 to the nearest integer? 2 What is the square root of 114 to the nearest integer? 11 What is the fifth root of 41475 to the nearest integer? 8 What is the ninth root of 244	{ "pile_set_name": "DM Mathematics" }
) = 43o3 - 2o*2 + 4o - 4. Is b(3) prime? True Let r be (-7)/21(-43 - -1). Is (-3511)/(-3) - r/(-21) a composite number? False Suppose i - 32 = -1. Suppose -4y = 8l - 3l - i, 3l = -4y + 25. Suppose -la + a = -254. Is a prime? True Let f(n) = -n3 + 61n*2 + 25n + 249. Is f(58) composite? True Let s be 4((-15)/10 + 0). Let v(y) = -15y - 3. Is v(s) composite? True Let n(o) = -3o + 68. Is n(-15) a prime number? True Suppose 5k - 2j - 30 = 3k, -2k = -j - 29. Suppose 0 = -15y + ky + 1. Is 3(8 - -3)y composite? True Suppose 8k = u + 5k - 16507, 16479 = u + 4k. Is u a composite number? True Suppose 1014 = -7v + 23911. Is v composite? False Suppose 2s + 3q = 17241, -2q + 6q = -2s + 17240. Suppose 2326 = -8t + s. Is t composite? False Let g = -1508 - -3051. Is g a prime number? True Suppose 17 = -3b + 296. Is b composite? True Let v be 12(-1 + (-1)/(-2)). Let r = v + 6. Is 2 - -35 - (r + 0) composite? False Let j(y) be the second derivative of -305/6y*3 + 3y + 0 - y*2. Is j(-1) a composite number? True Let a = 1734 + -839. Is a a prime number? False Suppose 3o + z = 11, z + 7 = 3o - 0z. Let n = -2 + 3. Is 444/o + (n - 0) composite? False Is (2 - -2) + 2294/2 composite? False Let l be (-1 + (-2)/(-1))-37. Let w = 95 + l. Is w a prime number? False Let v(t) = -98t*3 - 12t*2 - 3t + 4. Is v(-5) prime? True Let o = -43 + 42. Is 1((o - -1) + 331) composite? False Is (-121150)/(-5) - (8 + -1) a prime number? True Suppose -17r + 22r = 35. Let u = r - 1. Is u composite? True Let z be -9 + 8 + 13. Suppose 4f + d + 42 = -f, 20 = -2f - zd. Is ((-2628)/f)/32 a prime number? False Suppose 3i - 2z = 4, -28 = -3i - 0i - 4z. Suppose ix + x - 85 = 0. Let d = x - -106. Is d a composite number? True Suppose -2h + 386 = -2z - 134, -3h + 5z = -770. Let q = h - -1296. Is q a prime number? False Let i be 9/2 - 35/30. Suppose -1971 = -il - o, -2o - 3o - 5 = 0. Is l a composite number? True Suppose -2j + j + 2 = 0. Let w be j + (-2 + 1)-4. Is (w/4)/338 composite? False Suppose 139i = 104i + 1016085. Is i a composite number? True Let q = 169901 - 101550. Is q composite? False Suppose 50q - 991469 + 31119 = 0. Is q composite? False Suppose -2n = -3p + 322463, 14p - 10p = -n + 429958. Is p a composite number? True Let c = 10 + -2. Suppose -2a - 18 = -ca. Suppose au - 425 = -0u + 2z, 3u - 429 = 3z. Is u a composite number? False Suppose -5c = 5v - 30, 5c - 1 = -v + 13. Suppose -3t - cw = -276 - 1418, -t + 562 = 2w. Is t a composite number? True Let n = 23 + -15. Suppose -6d - 2422 = -nd. Is d prime? False Let z = -123 - -285. Let q be (-3 + 2)/(2/z). Let v = 284 + q. Is v composite? True Let a(k) = -k2 + 9k + 3. Let r be a(10). Let o(b) = 3b2 - 8b + 8. Is o(r) composite? False Let l(v) = -2v3 + 2v*2 - 5v + 2. Suppose 26 = 7k - 5k. Suppose -4n + 2x - 7 = 7, -3n + 4x - k = 0. Is l(n) a prime number? True Let g(q) = -26q3 + 4q*2 + 5q + 25. Is g(-6) prime? False Is (-2)/((-1189756)/169964 - (-5 + -2)) prime? True Let f(q) = 272q2 - 23q - 572. Is f(-19) prime? True Is -29/((-54)/16845) prime? False Is (-153806)/(-22) + 158/(-22) + 7 composite? False Suppose -45754 = -7g + 25793. Is g composite? True Let c(p) = 1351p - 2. Let y be c(-1). Let l = y + 2380. Is l composite? True Let g = -52 + 44. Let a(y) = y3 + 17y*2 - 13. Is a(g) a prime number? True Let z = 9 + -2. Let c = -5 + z. Suppose -6u + 628 = -cu. Is u a prime number? True Let m(a) be the second derivative of -8a*3 + 11a*2/2 + 15a. Suppose -33 = -4u - 13, 5p + 45 = 4u. Is m(p) a composite number? False Let l(w) = 34w*2 + 6w + 4. Let n = 11 + -4. Let p be l(n). Suppose 2u + 3v - 874 = 0, -4u + 4v = v - p. Is u a composite number? False Suppose -5n + 8 - 23 = -5m, 4m - 5n - 10 = 0. Let k(s) = s - 1. Let q be k(3). Is 131 + m - (q - -1) a composite number? True Let y be 251 + (1 - 0) + (-14)/(-14). Is -2 + y + (0 - 1 - -3) prime? False Let s(t) be the third derivative of -4t4/3 - t3/6 + 28t2. Let r be 1 + (-1)/(3/21). Is s(r) a prime number? True Let t(m) be the second derivative of -m5/20 - 7m4/6 + 5m*3/2 + 21m*2/2 + 10m. Is t(-15) composite? True Suppose 14d - 12d = 2. Is ((-394)/4)/(d/(-14)) prime? False Suppose -592042 - 8461 = -29w. Is w a prime number? True Suppose 2n = -c, 0n - 2 = -2n. Let f = -12 + 8. Is 3/c + (-514)/f a composite number? False Suppose 17103 = 15j - 53172. Is j a composite number? True Let m(u) = -u3 + 11u*2 - 10u + 3. Let h be m(10). Let l(g) = g*3 + 3g - 1. Let d be l(h). Let a = 88 - d. Is a a prime number? True Let r(t) = -75t3 + t2 + 3t + 2. Let l be r(-1). Suppose -2g = 5b - 143, 5b + 450 - l = 5g. Is g composite? True Let h(k) = 2k2 - 7k - 16. Let i be h(-15). Let y = i - 237. Is y composite? True Let i(t) = 2t3 + 18t*2 - 19t + 28. Is i(-9) composite? False Is ((-1)/((-4)/(-548)))/(11/(-407)) prime? False Let x be (-4)/10 + (-268)/5. Let i = x + 216. Let u = 241 - i. Is u prime? True Let n(y) = 11y2 - 4y - 22. Let s(c) = 2c - 11. Let q be s(-2). Is n(q) composite? True Let s be 251959/(-57) - (-2)/6. Is 6/(-14) + -2 + s/(-7) a composite number? True Suppose -4t - 2x + 33 = 5, x + 11 = 3t. Suppose 0 = -3p + 3f + 27, 0 = -tp - 4f - 0f. Suppose pz - 4 = 12. Is z a prime number? False Suppose -1044d + 32997 = -1041d. Is d a composite number? True Let r(p) = 378p - 941. Is r(12) composite? True Suppose 0 = 75g - 28g - 96397. Is g prime? False Is 430 - -13 - 4/(-1) composite? True Suppose 0 = -5i + 2i + 12. Let a be 405/18(-1 - -5). Suppose 5l = 3b - 164, -b + il + a = 33. Is b a prime number? True Let v(h) = -4h*2 + 7h*2 + 31h - 40h. Let d be v(10). Is 28/d + 4708/15 a composite number? True Let m(q) be the first derivative of 39q4 + q3 - q*2/2 + q - 24. Is m(2) a prime number? True Let y = -14 - -27. Suppose 4i + y = 1. Is (-145)/(i/((-3)/(-1))) composite? True Let u(c) = -444c + 59. Is u(-12) a prime number? True Let y(q) = q2 + 7q - 4. Let u(w) = w*2 - 8w + 6. Let o be u(6). Let z be y(o). Is (-138)/(-4) - 5/z a prime number? False Suppose -4t = -4p + 4, 4t - 2p + p + 16 = 0. Let b(l) = 56l2 - 14l + 1. Is b(t) a prime number? True Let a = 3 - 0. Let s(o) be the third derivative of 17o5/30 - 5o4/24 + o3/3 + o*2. Is s(a) a composite number? False Let g(c) = 449c + 862. Is g(17) prime? False Suppose -2 = 2p - 10. Suppose -pu + 0h = h - 233, u + h = 56. Is u composite? False Let c = 22 - 37. Let v = -24 - -18. Is (130/c)/(v/45) prime? False Suppose -2x + 4 = 5v - 2, 0 = 5x + 5v - 15. Suppose xw - 285 = 2w. Let a = -166 + w. Is a composite? True Let a = 4149 - 1776. Suppose -16z = -13z - a. Is z composite? True Suppose -2h - 2241 = -5h. Let g(f) = 3f - 25. Let d be g(9). Suppose 4x = -5s + 1313 + 2478, -dx = -s + h. Is s a composite number? True Let h be 14610/(-9)9/(-2). Suppose -97r + 102r - h = 0. Is r a prime number? False Suppose -65 + 66 = z. Is (z - 4) + ((-7776)/(-6) - 0) prime? False Let j(i) = 1 + 6i2 - 3i*2 + 4i*2 - 5i. Let n = -212 + 209. Is j(n) a composite number? False Suppose -s = -2s + 5. Suppose sh + 0h = 1315. Is h prime? True Suppose -5v - 10 = 0, -3v + 32212 = 5c - 43327. Is c prime? False Suppose 3m + 0m = 4287. Let n = m + -560. Is n composite? True Let y be (-32)/12(-18)/8. Let h = -9 + y. Is h + 0 - -2 - -890 prime? False Let z(g) = 11g2 - g + 18. Is z(-5) a composite number? True Let v(r) = r3 + 2r - 2. Let b be v(1). Let k be -5(9/(-5) + b). Suppose -ko + 579 = -377. Is o composite? False Let r(l) = 9l - 1. Let j(k) = 17k - 2. Let x(s) = 2j(s) - 5r(s). Let z be x(-1). Is (3 + (-33)/z)44 a composite number? False Let v = 10722 - 4473. Suppose v + 11081 = 10s. Is s composite? False Let z(k) = 82k*2 + 4k - 5. Let p be 15 - (0 + 3/(-1)). Let q = 20 - p. Is z(q) prime? True Let a(c) = -c*2 + 3c - 12. Let d(j) = -j*2 + 4j - 11. Let o(w) = 3a(w) - 4d(w). Let z be o(6). Suppose -zp + 79 = -79. Is p a prime number? True Suppose -d + b = -7, -6d + b = -d - 19. Suppose 2n - z = 257, -2z - 260 = n - d*n. Is n a prime number? True Let u(f) be the second derivati	{ "pile_set_name": "DM Mathematics" }
= k*2 - 5k - 2. Let u be r(g). Solve -x = up - 20, 3p = 4p - 2x - 5 for p. 5 Let i(y) = y*2 + 6y - 11. Let j be i(2). Solve -jx - 22 = -f, 3f + 29 = 3x - 7x for x. -5 Let m(o) = -11o + 17. Let b be m(0). Solve 0g - b = g + 5f, -23 = -g + 5f for g. 3 Suppose 196 = 6t + 70. Suppose 16l = 19l - t. Solve -5 = -x + b, 2x - l = -x + b for x. 1 Let b be 3(-2)/8 + 777/28. Suppose b = -6l + 87. Solve -12 = -4s, -c + 2s + 2 = l for c. -2 Let d = -138 - -142. Solve 5s = 3l - 0l + 12, 2l = 2s - d for l. 1 Suppose 8i = 1344 - 1320. Solve -l - 2n = 6, 3n + 6 = 4l - i for l. 0 Suppose -3l - 2 = -11. Let b be ((-10)/(-15))/(2/6). Suppose -br = r. Solve -la - 2p + 6 = r, 0p = -3p + 9 for a. 0 Let i be (-30)/(-9)9/2. Suppose -4b + 5 = -i. Let s be (-207)/(-36) + 15/(-20). Solve sw + v + 16 = 0, bw + 2v + 24 = 3v for w. -4 Let f(w) = -w2 + 19w - 20. Let m be f(17). Solve -6h = s - 3h + 2, -m = -s + 5h for s. 4 Let g = 9 + -5. Let z = -29 + 29. Suppose 4m = 5d - 1 + 11, z = -m + 5. Solve 0 = db - 2o, 2b = b - go - 25 for b. -5 Let t(a) = -3a + 24. Let o be t(7). Let z = -14 - -17. Suppose 2r - 6 = -0. Solve -f + 6f + 37 = -zb, of = 3b - r for b. -4 Let q(w) = 17w3 + w2 - 36w + 34. Let c be q(1). Let o = 4 + -2. Solve -4a + 26 - 9 = -p, -2a + op = -c for a. 3 Suppose 5r = 5a - 5, 0 = 3r - 4a + 1 + 4. Let m be -5 + -1 + 200/20. Solve 6 = mw - 2w - 2j, -w - r = 3j for w. 2 Let d = 78 - -18. Suppose 4i + d = -12. Let w be -33/(i/12). Solve -4x - 32 = 5j, 0 = 4x + j - 5j - w for x. -3 Suppose -3x - 3 + 5 = -h, 0 = h + 5x - 14. Solve -5r = ho - 5, 6r = 10r + 5o - 13 for r. -3 Let s be (-3)/(-24) + 405/(-40). Let k = s - -14. Solve -g = -0b - 4b + k, -12 = -4g + 2b for g. 4 Let m be (4 + 0 - -1) + 0. Suppose 3h - m = -2. Solve -28 = 4n - 4g, g = -3n + n + h for n. -2 Suppose y + 3 = 25. Suppose 5w - w - 67 = s, -3s - 9 = 0. Solve -w = g + 3f, -2g + f = 5f + y for g. -1 Let a(p) = p*3 + 4p*2 - 8p - 11. Let v be a(-5). Let d = v - 1. Solve 3f + dl - 18 = 0, -4l + 4 = f - 5 for f. 5 Suppose 2p - 4 = 12b - 16b, 3p = 4b - 24. Solve -bj + 2 - 5 = 3x, 0 = 2j - 4 for x. -3 Suppose 5v - 10 = 2w, -4v - 13w = -11w - 26. Solve -3p + 3o = vo + 2, 0 = -3o + 3 for p. -1 Suppose 3l = -9, -5z - 16 = 4l + 1. Let y be 9 - 9 - (z - 1). Solve 2c + 6 = -b, -4b - 5c + yc - 9 = 0 for b. 0 Let p = 689 + -687. Solve -2n + 4 = 0, -3d = -d + 4n + p for d. -5 Let f be ((-4)/10)/((-1)/5). Suppose -3k + 27 = 3j, 4k - 5 - 1 = 2j. Solve 5i = jt - 5, -ft - 1 = -t for i. -2 Let a(m) = m3 - 3m*2 - 28m + 91. Let x be a(5). Solve w = -2r + x, -r + 6r - w = -1 for r. 0 Let m = -23 + 27. Suppose 3u = 5x - 102, 0 = mu - 2u - 2. Solve -4j = 5s + 22, 5j + x = -2s - s for j. -3 Let o = 9 + -7. Let p(s) = 0s2 - 5s*o + 0s*2 + 4s*2 - 6s + 10. Let b be p(-7). Solve bt + 15 = -3u, 2t + 2u = -u - 12 for t. -3 Suppose 16 = -256n + 260n. Solve -12 = -3b + 5k, 3b + 11 = nb - 4k for b. -1 Let x(i) be the second derivative of -i3/3 + 5i*2 + 14i. Let u be x(5). Solve uq - 4q + 28 = 4g, -12 = -3q for g. 3 Let d be (4 - 0)(-14)/(-8). Suppose 2i = di - 20. Solve 0 = -5u - j - i, 4j - 1 - 3 = 0 for u. -1 Let t = 20 - 18. Solve -4p = -4q + 24, tq + 29 = 7q - 4p for q. 5 Suppose m - 5z - 34 = 0, 5m + 0z - 110 = -5z. Solve 4o = 5x + 12, -7o + 3o - m = 4x for o. -2 Let o(i) = -2i - 5. Let m be o(0). Let g be m/(1 - 14/4). Let d = -7 - -7. Solve 0 = -f - g, d = 4j - f + 3f - 12 for j. 4 Suppose -5v - 38 = -2a, 0 = -3a - 0a + 5v + 47. Solve -4q + 1 = -4f + q, -5f = 4q - a for f. 1 Let a = 58 - 58. Suppose 5m = 2j + 4, 14 = 4j - am + m. Solve 4i - 28 = 4t, 2t - 4t + ji = 17 for t. -4 Suppose -p - i - 13 = 2i, 2p - 29 = 5i. Let b be (p/(-4))/((-6)/36). Solve 4k - 4d = -28, 4d - 18 = bk + 2d for k. -4 Suppose 3a - 2a - 79 = -5u, -5u - 3a = -77. Solve 5w - 1 + u = 5g, 0 = w - 4g + 6 for w. -2 Suppose u + 3a + 4 = -0u, 5a + 15 = 0. Suppose 7z = -uz + 24. Solve 0 = -zx - 2, -g = 3x for g. 3 Let o(f) = -3f + 27. Let v be o(9). Solve 2b = -3g - 1, -5g + vg - 4b = 3 for g. 1 Suppose -65 = -3y + 5a, -3y - 7a + 55 = -2a. Let o be y/11 + (-26)/(-143). Solve -5x - 15 = -2r, or - 5 = -3x + 2 for r. 5 Suppose -5k = -15k. Suppose k = -t + 2f, 0f + 5 = 5f. Solve -2c = -5n + 19, 3c + 4 = tn + 3 for n. 5 Let w(n) = n3 - 31n*2 - 31n - 30. Let f be w(32). Solve -fa - 4 = q - 7, 0 = 3a + 4q - 7 for a. 1 Let l be (-42)/(-7) - 0/(-1). Let o be 21/5 - l6/180. Solve -oq + 11 = -3h, -h = 4h - 5q + 10 for h. 3 Let p(i) = i*2 + 6i - 9. Let n be p(-8). Suppose 0 = -2b + nb - 10. Solve 0 = -3o - 7t + bt - 25, 20 = -2o - 4t for o. 0 Let y be 6(24/28)/(1/7). Let f be 5/10 + 98/4. Let t = y - f. Solve 3q - 5o = -28, -3o = -3q - 7 - t for q. -1 Suppose -5m = -2n - 34, 4m - 18 = -2n + 2. Let h be 0/(-11) + -1 + 4. Suppose -5r - hr = -24. Solve 12 = -rb, -3u - 17 = -mu + 2b for u. 3 Suppose t + 2t = 6. Let k = t - -1. Let l be k/(-12) + (-1)/(-4). Solve -3r + 0r - 5 = 5o, l = -3o + 3r - 27 for o. -4 Suppose 0 = -36u + 34u. Solve -o + 4a - 12 = u, -a + 2a - 4 = 0 for o. 4 Let r(o) = -14o - 33. Let i be r(-3). Solve 0g - 2g = -3y + i, 6 = g + 2y for g. 0 Suppose t = h + 7, -t - h = 6 - 9. Solve -i + 0g - 4g + 10 = 0, 5i = -tg + 20 for i. 2 Suppose 4s - 13 = -u + 9, -30 = -5u. Let t = -10 - -6. Let a be 2/(-8) + (-13)/t. Solve 0 = 5n + sd - 18 + 2, -an - 3d = -9 for n. 4 Let r = 705 + -703. Solve -4 = -w - 5o, 2w - 4 = w + ro for w. 4 Suppose -39 = -5w + 11. Let i(f) = f3 - 10f*2 - f + 13. Let u be i(w). Solve -5a = -0h - uh - 14, h = 3a - 10 for h. 2 Let o(n) be the second derivative of -n5/20 + n4/6 + n3/2 + n2/2 - 17n. Let p be o(-1). Solve -2d - 9 = 5m, -d + 2m - m = p for d. -2 Suppose 2 = u + 4h, -2 + 0 = -u - h. Suppose 15 = 3d - 3j, -5d - j + 5 = -uj. Suppose g + 0g = d. Solve 3i + i + 20 = g, 4n + i - 3 = 0 for n. 2 Suppose 3x - 2x - 2 = 0. Suppose -x = -k + 2. Let w = 27 - 9. Solve 2n = -5v + n + w, -kn + 9 = -v for v. 3 Suppose 29r - 39r = -30. Solve 2x = -g - rx + 14, -4 = g - 4x for g. 4 Let u(k) = -k2 - 14k - 25. Let r be u(-5). Solve -5v - r - 8 = -3l, 3l - 2v = 13 for l. 1 Let a(c) = 6c2 - 23c + 1. Let y be a(4). Solve 15 = -0x - 3x, 10 = -yo - x for o. -1 Let q be ((-3 - -3) + 3)3. Let r = 13 - q. Suppose 3g - 5g + r = 0. Solve 2h - 8 = -f, h + g = -2f + 3 for h. 5 Let i = 952 - 944. Solve -8 = -d - q, d - iq + 17 = -4q for d. 3 Suppose 5z + b = 17, 2 + 4 = -2b. Solve -i - z = 0, -4w = -3i - 9 - 11 for w. 2 Suppose -2g + 3d = 2g + 6, -3g = -d + 7. Let n(s) = 5s + s2 - 1 - 24s + 9s + 12s. Let v be n(g). Solve -m - m - 4 = 0, 2m = vl + 6 for l. -5 Let w be 981/(-27) + (-2)/(-6). Let d = 43 + w. Suppose dc = 11c - 68. Solve 2m - 2t + 14 = 0, -4m + 2t = -m + c for m. -3 Let f = -13 - -29. Suppose 2v + f = 10v. Solve vk + 2q - 18 = 0, -5k + 16 = 3q - 21 for k. 5 Suppose 0a + 5a = 7a. Let j be a/2(6/(-2))/(-6). Solve 4x - 14 = -3h, 2h + jh - 12 = -4x for h. 2 Let t = -12 + 16. Suppose 0 = 4a + 5m + 11, -a = ta + m + 19. Let u be 3/(-6)a1. Solve ui = -5v - 14 + 2, i = -v for v. -4 Let y = -1672 + 1676. Solve yc + 0l + 12 = -2l, 0 = 2l - 8 for c. -5 Suppose 0 = 5z - 45 + 10. Suppose zv + 6 = 9v. Solve 0 = -q - n - 3n - 19, -4n = vq + 25 for q. -3 Suppose -19t = -22t. Let k = t + 1. Solve 2g - 3a + 6 = -k, 2 = -g + a for g. 1 Let n be 5((-3)/(-20))/((-22)/(-88)). Solve -5p = 3s - 17, -3p = ns - p - 5 for s. -1 Suppose -20 - 60 = -16b. Solve -29 = bt + 3j, 4t = 5j + 2 - 3 for t. -4 Suppose -10 = d + 9. Suppose -4c + 2 = -126. Let a = c + d. Solve p = 4o + a, p + 23 = -3o - 2o for o. -4 Suppose -60 = -5c + 5. Suppose -c = a - 16. Solve -5g = -3u, -2u - au = -2g for u. 0 Suppose -j - 3 = -6. Let q = -87 - -126. Let o = q + -32. Solve -jp - 29 = -ox + 2x, -p + 9 = 3x for p. -3 Suppose -3p - 3 = 0, 0 = 4n + 35p - 34p - 23. Solve -4s - n = -3s - 3u, 2 = -2s - 4*u for s. -3 Suppose	{ "pile_set_name": "DM Mathematics" }
Let c(s) = -7s3 + s2 - 8s + 17. Let v(i) = -5c(i) - 6p(i). Let u be v(6). Give f(u). 7 Let i(v) = v*2 - 6v + 6. Let q be (21 - 16)/((-10)/(-12)). Determine i(q). 6 Suppose 28 = 2y + 4. Let x be ((-4)/y)/((-1)/3). Let o(j) = -8j + 1. Determine o(x). -7 Let y(l) be the second derivative of -l5/20 - l4/4 - l3/6 - l2/2 - 6l. Let t(o) = o3 - 30o*2 + 28o + 26. Let i be t(29). Determine y(i). 2 Let p(v) = 33v2 + v - 2. Let n be p(1). Suppose -5q + 32 - n = 0. Let r(x) be the second derivative of -x3/6 + x2/2 - x. Give r(q). 1 Let d(m) = m*3 + 5m*2 + 5m + 2. Let x be d(-4). Let n(z) = 0 - 8 - 6z + 5 + 3z. Give n(x). 3 Suppose 43f + 23f = -528. Let n(w) be the second derivative of -w*4/12 - 7w*3/6 - 3w*2 + w. Give n(f). -14 Let w(k) = -k + 1. Let a be w(-3). Suppose -2b + az - 1 = 3z, b + 3z - 10 = 0. Let u be (0/b)/(6 - 5). Let t(d) = d2 + d + 1. What is t(u)? 1 Let u(n) = -24n*2 + 8n + 153. Let x(a) = 8a2 - 3a - 51. Let v(r) = -3u(r) - 8x(r). Let g(d) be the first derivative of v(d). Give g(-1). -16 Let o(v) = -v + 10. Suppose 11u = 9u. Suppose 3y + 6 = -3s - u, 20 = -4s + 2y. Let t be 2 + s + 36/4. Determine o(t). 3 Let d(v) = 1. Let n(k) be the first derivative of k*2/2 + k - 1. Suppose -2i + 15 = 3i - b, -2b = 5i. Let r(p) = in(p) + d(p). Calculate r(-2). -1 Suppose 3b - 4w = 5b + 30, 3w = 5b + 23. Let k(j) be the second derivative of -j5/20 - 7j4/12 + j3/6 - 2j2 + j. Calculate k(b). -11 Let o(t) = t - 5. Let h = -16 - -23. Let a be o(h). Suppose -af - f = 18. Let y(d) = d*2 + 7d + 1. What is y(f)? -5 Let y(b) = -348 + 10b + 180 - 3b + 170. Determine y(-3). -19 Let z(u) be the third derivative of -u*5/60 - 35u*3/6 - 116u*2. Give z(0). -35 Let o = -11 - -3. Let x(l) = -17l + 14. Let s(y) = -11y + 9. Let r(v) = os(v) + 5x(v). Give r(4). 10 Let i(t) = t2 + 2t + 3. Let h(o) = -7o2 - 7o - 20. Let j(r) = h(r) + 6i(r). Let u(m) = m - 2. Let v be u(5). Calculate j(v). 4 Let h(u) = -19 - 19u - 7593u2 + 3798u*2 + 3796u*2. Determine h(20). 1 Let b = 59 - 63. Let a(g) = -g + 3. Let j(s) = -2s + 5. Let r(l) = 7a(l) - 4j(l). What is r(b)? -3 Let v(o) = -98 - 3o2 + 26 + 5o + 4o2 + 42 + 24. Suppose -3n = -1 + 22. Determine v(n). 8 Let a(d) = -d*3 - 11d*2 + 11d - 17. Let z = 31 + -43. Let l be a(z). Let b(j) = -j*2 - 7j - 7. Determine b(l). 3 Suppose -5a + 0a - 50 = 0. Let g(i) be the first derivative of i*3/3 + 11i*2/2 + 12i + 418. Calculate g(a). 2 Let o(q) be the first derivative of -q*2/2 - 4q - 2. Let z = -103 - -109. Calculate o(z). -10 Suppose 2o - 1 = -11, -2u - 5o - 15 = 0. Let a(k) be the second derivative of 3/2k*2 - 1/2k*3 - 5k - 1/20ku + 0 + 1/3k*4. Determine a(4). -9 Let x(a) = a - 5. Let q(r) = -10r3 - r2 + r + 1. Let d be q(-1). Give x(d). 4 Let o(m) = -13 - 3m3 - 9m + 2m3 + 4308m*2 - 4297m2. What is o(10)? -3 Let t(j) be the third derivative of j5/30 - 7j4/24 + j3 - j2. Let d be ((-64)/288 - 1/9)-12. Determine t(d). 10 Let s(g) be the third derivative of g*6/120 + 7g5/60 + g4/3 + 2g3/3 + 48g*2 + 57. Let w(r) = -7r + 1. Let i be w(1). What is s(i)? -8 Let t(o) = 3o3 - 17o*2 - 2o + 9. Let n be (2 - 3)/(((-2)/6)/(-1)). Let a(y) = -2y3 + 9y*2 + y - 5. Let w(v) = nt(v) - 5a(v). Calculate w(-6). -8 Suppose -35 = -0n + 5n. Let a = -12 - n. Let h(z) be the second derivative of -z4/12 - z3/2 + 5z*2/2 - 3z. Determine h(a). -5 Let k(q) = -4q + 7 - 4q + 20q - 9q. Suppose -3l + 6 = -3n, 2l + 6 = -5n - 25. What is k(n)? -8 Let n(w) = 9 + 0 - 2w - 8 - 2w2 + 0. Give n(-2). -3 Let q(l) = -l3 + 14l2 + 5l. Let m be q(14). Let d(a) = -ma2 + 3 - 7a + 69a2 - 2 - 6. Let t = 6 + -11. Calculate d(t). 5 Let w(f) be the third derivative of -2/3f*3 + 0f - 1/60f5 - 3f*2 + 0 - 1/4f4. Let p(l) be the first derivative of w(l). Give p(-5). 4 Let g(h) be the third derivative of -h6/720 - h*5/24 - 13h*4/8 - 5h*2. Let t(x) be the second derivative of g(x). What is t(-8)? 3 Let s = -6/23 + 41/69. Let r(y) be the first derivative of 1/4y*4 + 3/2y*2 + 4 + 2y + sy3. Calculate r(-2). -8 Let o(p) = 664p*2 + 666p*2 - 1331p*2 - 7p - 1. Determine o(-5). 9 Let f(i) = -i*3 + 10i*2 + 24i + 6. Let c be f(12). Let y(q) = 6q + 2. Calculate y(c). 38 Let w(k) = -k2 + 7k - 10. Let a be w(4). Let p(h) = 2h - h - 46 - ah*2 + 4h + 43. Calculate p(3). -6 Let a be 10/(-120)(1 + -3). Let j(o) be the third derivative of -3o*2 + 0o + 0 + ao4 - 7/6o*3. Give j(5). 13 Suppose -h = 3f - 11, 34 = 5f - 2h + 12. Let j(g) = -g*3 + 3g*2 - 4. Give j(f). -20 Suppose 12g - 64 = -4g. Suppose g = 4i - 4a, -5 = -5i - 6a + a. Let v(n) = -3n2 - n. What is v(i)? -4 Let f(l) = l3 + 3812l2 + 5 + 2l - 3812l2. Calculate f(0). 5 Let l(v) be the first derivative of -v3/3 + v2/2 - 5v - 133. Calculate l(5). -25 Let d(b) = -b + 5. Let a(v) = 4v - 23. Let g(y) = -a(y) - 5d(y). What is g(0)? -2 Suppose -5k = 108 + 167. Let b = -53 - k. Let y(j) = -2j. Calculate y(b). -4 Let j(d) = 18 + 15 - 12d - 31. Let x(t) = t + 1. Let r(l) = j(l) - 3x(l). Give r(1). -16 Suppose 0 = 4v + 12, 3v = -4o + 2v + 9. Let q(b) = 5b3 - b2 + 8b. Let n(f) = 2f3 - f2 + 4f. Let k(c) = oq(c) - 7n(c). What is k(-4)? 16 Let u(k) be the third derivative of 0k - 2/3k*3 - 1/60k*5 + 1/6k*4 + 0 - 27k2. Determine u(3). -1 Let u(q) = -q2 - 6q - 5. Let y(z) = z + 2. Let v = -5 + 0. Let m be y(v). Let w be u(m). Let i(h) = h2 - 4h + 3. Calculate i(w). 3 Suppose 0 = -5s + 40 + 20. Suppose 2v = 2d - 8, d - s = -2v - d. Let a(w) = 5w2 - w + 1. Let k be a(v). Let p(b) = -b - 3. Give p(k). -8 Suppose -8 = -3n + q, -3n - 8q + 13q = -16. Let f(x) = 1 + x - x - x2 + x. Calculate f(n). -1 Let m(v) be the first derivative of 1 - 1/2v*2 - 4/3v*3 + 0v. Let t be m(-1). Let p(h) = h*2 + 5h + 3. What is p(t)? -3 Let t(s) = 2s2. Let p(q) = 3q - 2. Let x be 1-2 - (-13 - -8). Suppose 5b - 24 = -4z, 3z + xb = -2z + 17. Let j be p(z). Calculate t(j). 2 Let o(z) = -z*2 + 6z - 7. Suppose -d - 3d = -16. Let q be o(d). Let c(k) = 5k + 5k - 5k. Calculate c(q). 5 Let p(q) be the second derivative of q*3/6 - 7q*2/2 - 3q. Let i = 5 + -3. Suppose -6 = -2t, k + 2t - 6 = ik. What is p(k)? -7 Let w(t) be the third derivative of 1/2t*3 - 1/24t*4 - 2t*2 + 0t + 0 - 1/60t5. Determine w(-3). -3 Let l be (-65)/(-91) - (-2)/7. Let t(n) be the first derivative of n2 + n + 0n*3 - l - 3/2n4. What is t(-1)? 5 Let m(q) = -q3 - q*2 - q + 11. Let s(r) = r + 18. Let x be s(-17). Suppose -t + 7 = -5y, 0y - 3y - 11 = -4t. Let a = x + y. Calculate m(a). 11 Let k(z) = -6z - 56. Let q be k(-9). Let t(v) = -5v3 - 3v2 + 2. What is t(q)? 30 Let f(b) = -b3 + 23b2 + 18b + 4. Let o(i) = -i*2 + i - 1. Let k(u) = -f(u) - 3o(u). Calculate k(21). -1 Let c(q) = q*3 + 15q*2 + 14q + 2. Let y be c(-14). Let g(d) = -2 + 0 + 7 - 2 + 8d + dy. What is g(-7)? -4 Let u(c) = -72c + 22. Let h(d) = 26d - 7. Let f(l) = 11h(l) + 4u(l). Suppose 4q + i - 3 = 25, -i + 36 = 5q. What is f(q)? -5 Suppose -232h = -231h + 3. Let y(b) = -3b - 2. Determine y(h). 7 Suppose 2t - 5c + 4 = -2c, -c = -5t - 10. Suppose 0i = -2i. Let m(w) = 1 + 1 + i - 3w2 - w. What is m(t)? -8 Let n(k) be the first derivative of 2 - 1/3k*3 + 0k + 2k2. Let h be n(3). Let q(x) = -x2 + 6x - 1. Calculate q(h). 8 Let c(o) = 3o2 - 3o + 2. Let k be c(1). Let g(w) = 5w + 8w*2 - 21w*k + 11w*2 - 5. Calculate g(4). -17 Suppose 4j = 8 - 0. Let g(u) = -u*3 + ju + 4 - u + u - 2u2. What is g(-3)? 7 Let p(g) = g + 1. Let y(w) = -w2 - 2w - 3. Let l(t) = -2p(t) - y(t). Suppose 0 = 91o - 64o. What is l(o)? 1 Suppose 12a - 904 = -832. Let r(m) = -m + 10. Calculate r(a). 4 Let j(q) = -q - 7. Suppose 4c = -3x - 8 - 23, -4c = -2x + 26. Give j(c). 0 Let r(n) = 2n + 12. Let h(z) = -z - 10. Let j(k) = -7h(k) - 6r(k). Give j(5). -27 Let m(j) = j - 2. Let u(d) = d2 - 2d - 2. Let f be 0 - (2 - 5 - 1). Suppose -fn + 3n = -4. Let v be u(n). Give m(v). 4 Let n be (-4)/14 - (-164)/(-14). Let j be n/(-	{ "pile_set_name": "DM Mathematics" }
-19 - (z + (0 - 1)). Let b = f + 43. What is the remainder when b is divided by 12? 10 Let c(m) be the third derivative of 0m3 - 1/60m*5 + 0m + 0 + 0m4 + 1/12m6 - m2. Calculate the remainder when 16 is divided by c(1). 7 Let v(d) = d*2 + 3. Let q be v(-3). Calculate the remainder when (7 - -2)q/9 is divided by 4. 0 Let l(a) = 0a + 4 + 5a*2 - 3 - 2a. Suppose 2s + 5n = 1 + 10, s - 4n = 25. Calculate the remainder when l(-2) is divided by s. 12 Suppose 2i - 55 = -3y, -9y + 4y + 77 = -4i. Calculate the remainder when 50 is divided by y. 16 Let a(k) = k*2 - k + 9. Let h be a(0). Let z be 0(-1)/(3 - 1). Let m = h + z. What is the remainder when 24 is divided by m? 6 Let n = 86 + -41. Calculate the remainder when n is divided by 8. 5 Let c(t) be the first derivative of 11t2/2 + 3t + 3. Calculate the remainder when c(4) is divided by 16. 15 Suppose 62 = b - 172. Let z = 23 - 9. Calculate the remainder when 4/(-6)b/(-6) is divided by z. 12 Let g = -5 + 24. What is the remainder when g is divided by 7? 5 Let o(w) = -w2 - 13w - 14. Let g(r) = r*2 - 4r - 1. Calculate the remainder when g(-4) is divided by o(-10). 15 Let d be (25/(-3))/569. Let z = -75 - d. Calculate the remainder when z is divided by 21. 19 Suppose -51 = 4i - 7i. Calculate the remainder when 63 is divided by i. 12 Suppose 5s - 890 = 5c, -7c + 684 = 4s - 4c. What is the remainder when s is divided by 11? 9 Suppose -j = 4j + r - 383, 5j + 4r - 377 = 0. What is the remainder when j is divided by 20? 17 Let c = 537 - 383. Calculate the remainder when c is divided by 31. 30 Let l be (-3)/2(-8)/(-6). Let o(y) = 12y2 - 2y - 3. What is the remainder when o(l) is divided by 13? 10 Let a = 5 - 3. Suppose aj + 0j - 5z - 34 = 0, 3j - 76 = -5z. What is the remainder when 43 is divided by j? 21 Let u(l) = -l2 + 13l - 21. Let j be 0 + -1 - (-2)/(-1). Let z(g) = -6g - 2. What is the remainder when z(j) is divided by u(10)? 7 Let k = 14 + -11. Let p = 3 + -3. Let j = p - -6. What is the remainder when j is divided by k? 0 Suppose -112 = -5r + r. Suppose q + 3q - r = 0. What is the remainder when 11 is divided by q? 4 Suppose k = -2k - u + 71, -141 = -5k + 4u. Suppose 3a - 1 = g + 8, -k = g + 5a. Let o = -1 - g. What is the remainder when 27 is divided by o? 13 Let j(l) be the second derivative of l4/12 - l3/6 - l*2/2 - 6l. Calculate the remainder when 3/(-9) + (-169)/(-3) is divided by j(5). 18 Let z(i) = -6i + 2i*2 - 1 + 4i - 8i. Let r be 2 + (-2)/1 + 7. What is the remainder when z(r) is divided by 14? 13 Let x(s) = s3 - 4s*2 - 2s - 8. What is the remainder when 12 is divided by x(5)? 5 Let a = 39 - 18. Suppose j - 20 - a = 0. Calculate the remainder when j is divided by (-1 - 27)(-1)/2. 13 Suppose -j - 49 = -a - a, -3a + 63 = 2j. What is the remainder when 44 is divided by a? 21 Let y = 16 + -3. Suppose -3u + v = -2v - 87, -u + y = -5v. Calculate the remainder when u is divided by 12. 9 Let g(d) = -d - 6. Let r be g(-7). Let c be r - -4(5 - -1). Let w = 41 - c. What is the remainder when 30 is divided by w? 14 Let n(r) be the second derivative of r5/20 - r4/3 + r3 - r2 - 2r. Calculate the remainder when n(4) is divided by 8. 6 Suppose -3j + 8 = -0l + l, -10 = -2l - 4j. Let h(z) = -13z + 1. Let k(n) = -n - 2. What is the remainder when h(l) is divided by k(-10)? 6 Let s(i) = i3 + 11i2 - i - 1. Let b(r) = r2 - 6r - 6. Let f be b(5). Calculate the remainder when 27 is divided by s(f). 7 Let f(q) = -q3 - 6q*2 - 4q - 3. Calculate the remainder when 82 is divided by f(-6). 19 Suppose -28 = -c + 9. Suppose 2u - 17 = 3. What is the remainder when c is divided by u? 7 Let s(k) be the first derivative of -k4/4 - k3/3 - k2/2 + 34k + 7. What is the remainder when s(0) is divided by 9? 7 Calculate the remainder when 104 is divided by 1/3 + 88/6. 14 Suppose 6n = 4b + n - 117, 0 = 2b - 3n - 61. Let a = 32 - b. Calculate the remainder when a is divided by 4. 1 Let u = 43 + 28. Let f = u + -50. Calculate the remainder when 39 is divided by f. 18 Let z(f) = f*3 - 13f*2 + 12f - 5. Let j be z(12). Suppose -5w + 22 = -13. Let g = w + j. Calculate the remainder when 3 is divided by g. 1 Suppose 4o - 4b = -84, 3o + 66 = -o - 2b. Let l = 42 + o. Let q = 25 + 22. Calculate the remainder when q is divided by l. 23 Let y = -45 + 70. Calculate the remainder when y is divided by 9. 7 Suppose 3d - 3z - 33 = 0, 0z - 15 = 3z. Suppose -4v = -133 + 45. What is the remainder when v is divided by d? 4 What is the remainder when (1 - 10/8 - -1)32 is divided by 15? 9 What is the remainder when ((-3)/5)/(34/(-3570)) is divided by 6? 3 Let s = 5 + -1. Suppose 0z + sz - 88 = 0. Let c = -77 - -141. What is the remainder when c is divided by z? 20 Let b(n) = -n2 - 15n + 13. What is the remainder when b(-13) is divided by 10? 9 Let k(w) = -4 - 13w + 8w + 6w. What is the remainder when 4 is divided by k(7)? 1 Suppose 3s = 4t + 124, 0 = -2s + 2t + 3t + 85. Let d = s - 23. Let p(k) = k + 9. Calculate the remainder when d is divided by p(0). 8 Suppose 3q + 6 = 0, j + 2q + 16 = 4j. Suppose -y + 130 = jy. Calculate the remainder when y is divided by 10. 6 Let w(i) be the second derivative of i*4/6 + 11i3/6 + i2/2 + 2i. What is the remainder when w(-8) is divided by 14? 13 Suppose 2w = -u + 36, w + 4u = -w + 42. Suppose -33 = -5t + 2h + w, 4h = t - 10. Calculate the remainder when t is divided by 4. 2 Suppose -3o = -5l - 0o + 187, 5 = 5o. Calculate the remainder when l is divided by (-45)/(-12)(-16)/(-6). 8 Let m = -7 + 11. Let t = -1 + m. Let b = -2 + 10. What is the remainder when b is divided by t? 2 Let p(v) = -22v - 2. Suppose 5j + 15 + 20 = 0. Let b(g) = -7g - 1. Let l(o) = jb(o) + 2p(o). What is the remainder when l(3) is divided by 10? 8 Let o(j) = j*2 + 2j - 5. Let y = 15 - -2. What is the remainder when y is divided by o(-5)? 7 Suppose -d = 3i - 5, 5i = -d + 1 - 2. Suppose 0q - 120 = -5q. Calculate the remainder when q is divided by d. 10 Let u(p) = -5p2 + 3p - 7. Let i be u(-6). Let w be 4/16 + i/4. Calculate the remainder when 25 is divided by w/(-4) - 5/(-20). 12 Suppose 4w - 9w = 0. Suppose 2q - 13 + 7 = w. Calculate the remainder when -47(0/q + -1) is divided by 12. 11 Let w = -10 + 6. Let j be 44/3 + w/6. Calculate the remainder when 60/j + 6/(-21) is divided by 3. 1 Suppose 2l - 4g = 4, -5g - 12 = -3l - 3. What is the remainder when l is divided by (-6)/4(2 + -4)? 2 Suppose 2z + 16 = 4z. Let k(r) = r3 - 10r*2 - 9r - 13. Let u be k(11). Suppose -3f = -0f - u. Calculate the remainder when z is divided by f. 2 Suppose -3d + 6 + 9 = 0. Let j(i) be the second derivative of i4/6 - i3 - 5i*2/2 + 2i. Calculate the remainder when 28 is divided by j(d). 13 What is the remainder when 62 is divided by (24/(-10))/((-3)/(-8))-5? 30 Suppose 0 = l, -4l - 16 - 8 = 3w. Let m = 28 - -4. Calculate the remainder when m is divided by ((-55)/20)/(2/w). 10 Let w = 0 - -6. What is the remainder when ((-56)/w)/((-2)/6) is divided by (20/(-14))/((-2)/14)? 8 Suppose 8o = o + 105. Calculate the remainder when o is divided by 6. 3 Suppose -4c - 2x + 134 = -0c, -5c - 2x + 168 = 0. Let i = 66 - c. What is the remainder when i is divided by 11? 10 Suppose 107 + 4 = 3t. Let u be (-6)/3 - t-1. Let l = u - 24. What is the remainder when 32 is divided by l? 10 Let o = 4 - 6. Let a be 1/(o2/8). Calculate the remainder when 47 is divided by 228/14 - a/(-7). 15 Let b = -18 - -10. What is the remainder when (-4)/b + 37/2 is divided by 7? 5 Let u = -8 - -8. Suppose s + 5j = 15, -2s - 4j + 0j + 54 = u. What is the remainder when s is divided by 12? 11 Let t = 10 - 10. Suppose 4k + 8 = 0, 4k + t = -s + 23. Suppose 5o + 5b = 2b + s, -o + 2b = -14. What is the remainder when 14 is divided by o? 6 Calculate the remainder when 134 is divided by (34/6)/(4/24). 32 Let r(n) = -12n2 - 2n - 1. Let t be r(-1). Let m = t - -18. Suppose m + 6 = p. Calculate the remainder when p is divided by 5. 3 Let j = 120 + -43. What is the remainder when j is divided by 20? 17 Let k be (2/(-4))/(1/(-10)). Suppose -3s - k = -4s. What is the remainder w	{ "pile_set_name": "DM Mathematics" }
d - 40. Let n be o(15). What is n rounded to the nearest one million? -20000000 Let r = 2.916 - 0.256. Let o = 0.06 - r. Let n = o - -2.60000029. What is n rounded to seven dps? 0.0000003 Suppose 4208 = -2u + 340. Let l = -3234 - u. What is l rounded to the nearest one thousand? -1000 Let w = 0.995 + -85.595. Let y = w - -4.6. Let d = y + 79.9999943. What is d rounded to 6 dps? -0.000006 Let h(v) = 2v + 1. Let u be h(2). Suppose 36 = -ur - 3g, -7 = -5g - 17. Let i = 36 + r. Round i to the nearest one hundred. 0 Let j = -1.31 + 1.179. Round j to two dps. -0.13 Let u = 10 + -29. Let l = 257391460 + -257391478.9999971. Let q = l - u. What is q rounded to 6 dps? 0.000003 Suppose -5b - 2i - 1658 = -0i, 0 = 3i + 12. What is b rounded to the nearest one hundred? -300 Let o = 0.41 + -0.40998. What is o rounded to 5 decimal places? 0.00002 Suppose 4 + 8 = 2t. Let m(v) = v*3 - 3v*2 + 4v - 5. Let l be m(t). What is l rounded to the nearest ten? 130 Let n = 1.79825 + -1.8. What is n rounded to 4 decimal places? -0.0018 Let w = 7.9538 + -1395.45364. Let y = w - -1388. Let n = y - 0.5. Round n to four dps. 0.0002 Let q = 143.7 - 138. Round q to the nearest integer. 6 Let o(t) = t - 1. Let l be o(-5). Let h = l + 4. Let u be -4703 - h/46. Round u to the nearest 1000. -5000 Let l be 2/11 - 909814/22. Let y = l + 137355. What is y rounded to the nearest 10000? 100000 Let l(m) = 2900000m. Let x be l(6). What is x rounded to the nearest 1000000? 17000000 Let b = 0.2 + -0.154. What is b rounded to 2 decimal places? 0.05 Suppose 3h - 4l = -2h - 5837, 3h + 3501 = 3l. What is h rounded to the nearest one hundred? -1200 Suppose h - 2 = -f - 21, -3f + 23 = -2h. Round h to the nearest ten. -20 Let o = 20 + -19.9979. What is o rounded to 3 decimal places? 0.002 Let d = -0.7 - -0.7. Let y = 0.02 + d. Let c = 0.01999932 - y. What is c rounded to seven decimal places? -0.0000007 Let u = 0.29 + 0.01. Let m = u + -0.30073. Round m to 4 decimal places. -0.0007 Let r = 0.5759229 + 7.4240675. Let j = r - 8. Round j to six decimal places. -0.00001 Let s = -1 + 3. Suppose 2l - 6l + 21296 = 3t, 0 = t + sl - 7098. Round t to the nearest one thousand. 7000 Let p = 16 + -17.55. Let c = p + 0.15. Let s = c - -0.76. Round s to one decimal place. -0.6 Let f = -0.01 + -0.49. Let j = -0.49999925 - f. Round j to 7 dps. 0.0000008 Let j(o) = 271o3 - o2 - 6o - 5. Let g be j(6). Suppose 0 = -4p - g + 12459. What is p rounded to the nearest 1000? -12000 Let i(x) = -165x + 10. Let c be i(-6). Round c to the nearest one hundred. 1000 Let c = 0.4 - 0.33. Let p = -0.07001 + c. What is p rounded to five decimal places? -0.00001 Let n = 0.89964 + -0.9. Round n to four decimal places. -0.0004 Let u = 60 + -45.5. Let s = -1.1 - u. Let h = 15.59999913 + s. Round h to 7 dps. -0.0000009 Let a = 1.007 - 1. What is a rounded to 3 decimal places? 0.007 Let k(y) = -y3 + 4y*2 + 3. Let g be k(4). Let p(t) = -2 - 15t - 6t2 + 1 + 8t + 3208tg. Let s be p(7). Round s to the nearest 1000000. 1000000 Let b = -1.58 + -0.22. Let i = 1.7999955 + b. What is i rounded to 6 dps? -0.000005 Let r = -573787.19877 + 573810.3. Let w = 23.1 - r. Round w to four dps. -0.0012 Let a = -13.5 - -11. Let l = 2.50000027 + a. What is l rounded to seven decimal places? 0.0000003 Let c = 0.72 + -0.7. Let x = c + 0.38. Round x to the nearest integer. 0 Let p = -0.15 - -8.15. Let q = 7.99958 - p. Round q to 4 decimal places. -0.0004 Let b(c) = -312c*2 - 12. Let k be b(7). Round k to the nearest 1000. -15000 Let z = 70.9295 - 71. Let k = z + 0.07. What is k rounded to 4 decimal places? -0.0005 Let i = 112612 + -112611.8400175. Let v = i - 0.16. What is v rounded to six decimal places? -0.000018 Suppose -2u + 468 = -2w, 9w - 4w - 246 = -u. Let f = 1236 - u. Round f to the nearest 10000. 0 Let g(s) = -247221s*2 - 5s - 14. Let r be g(6). Round r to the nearest one million. -9000000 Suppose 0 = -3f + r - 220 - 199, 5r = 2f + 275. Let b be f/8(-240)/(-14). What is b rounded to the nearest 1000? 0 Let o = -16.6 - -18. Let c = 1.4000005 - o. Round c to seven decimal places. 0.0000005 Let m = 159.9 - 153. Let i = m - 6.900041. What is i rounded to five decimal places? -0.00004 Let l = -61.0000095 + 61. Round l to 6 dps. -0.00001 Let s = 26.9999744 + -27. What is s rounded to six dps? -0.000026 Let z = 26.25 + -21.3. Let w = -5 + z. Let v = -0.0452 - w. Round v to three decimal places. 0.005 Let a = -75 - -75.0066. What is a rounded to 3 decimal places? 0.007 Let o = 4.95 + -5. Let l = o + 0.5. What is l rounded to 1 decimal place? 0.5 Let g = -6.4674708 + 4.86747. Let u = g - -1.6. Round u to 7 decimal places. -0.0000008 Let i = 36.49 + 0.51. Let z = i - 36.9999967. Round z to six dps. 0.000003 Let r(z) = 4z2 - 2z + 5. Let i be r(-3). Round i to the nearest 10. 50 Let n = 52011 - 161011. What is n rounded to the nearest ten thousand? -110000 Let w(z) = 179z + 6. Let i be 1(0 - 2) - 2. Let c be w(i). Round c to the nearest one hundred. -700 Suppose 0 = -4i + d + 14, 3d = 5i - 2d - 10. Suppose 4 = it - 12. Suppose -tq = 4o + 12780, -2q - 3185 = o + q. Round o to the nearest one thousand. -3000 Let a = -29 + 28.89. Let g = 0.08 + a. Let m = g - -0.0299947. Round m to 6 decimal places. -0.000005 Let a = 60 - 59.9947. Round a to three decimal places. 0.005 Let z = 118503.0058 + -118521. Let l = -18 - z. What is l rounded to three dps? -0.006 Suppose -5c + 24 = -c. Let l(u) = -7279u*3 + u - cu*2 + 4u + 0u. Let r be l(5). What is r rounded to the nearest 100000? -900000 Let r = 3291 - 7691. Round r to the nearest one thousand. -4000 Let s = -889 + 895.195. Let d = 0.105 + s. What is d rounded to zero decimal places? 6 Suppose -w = 2f + 2w - 1691, 0 = -3w + 15. Let z = f + 98. Suppose -b - 3436 = -z. Round b to the nearest one thousand. -3000 Let m = 42 - 42.046. What is m rounded to two decimal places? -0.05 Suppose -5v + 10 = -0v. Suppose 0 = -o + vo - 902. Suppose -t + 3f - 906 = -4t, 0 = -3t - f + o. What is t rounded to the nearest 100? 300 Let s be (18/(-4))/((-6)/30400). What is s rounded to the nearest one thousand? 23000 Suppose 0 = 5q - 23 + 13. Suppose 2w = -r + 10010, -3r - qw + 20010 = -r. Round r to the nearest 10000. 10000 Let i = -112 - -48. Suppose 2a + 2a - 128 = 0. Let x = a + i. Round x to the nearest 10. -30 Let o = 9.9 - -3.1. Let c = o - 12.999825. Round c to five decimal places. 0.00018 Suppose 0 = 2n - 3n + 24. Suppose -n = d + 35. What is d rounded to the nearest 10? -60 Let g(s) = 9s. Let i be g(2). Suppose 3t - i = 3. Suppose 14500000 = 5a + n, 0 = tn - 3n. What is a rounded to the nearest 1000000? 3000000 Let n(f) = -51317f*2 + 2f - 1. Let m be n(1). Let a = 38150 - 20834. Let k = a + m. What is k rounded to the nearest 10000? -30000 Let w = -87934.34999987 - -87934.39. Let u = -1 - -0.96. Let m = u + w. What is m rounded to 7 dps? 0.0000001 Let z = -0.03 + 54.03. Let h = z - 37. Let g = h + -17.00056. What is g rounded to 4 dps? -0.0006 Let g(r) = 83r3 - 2r*2 + r + 6. Let m = -33 - -14. Let l = m - -13. Let x be g(l). Round x to the nearest 10000. -20000 Let n = -4033 + 6318. Let h = 4890 + n. Suppose 3u - 4q = u - 4780, h = -3u + 5q. What is u rounded to the nearest 1000? -2000 Let f(n) = 4799n + 5. Let q = 13 - 8. Let x be q/(-2(-2)/4). Let v be f(x). Round v to the nearest ten thousand. 20000 Let o = -35.1 + 1.1. Let u = o - -34.66. What is u rounded to one decimal place? 0.7 Suppose -2a + 34931 = n, 2a - n - 34929 = -4n. Suppose -a - 934 = 4q. What is q rounded to the nearest one thousand? -5000 Let i be 1/(-1)(1 + -7). Suppose -ig + 4g + 198 = 0. Let u = 49 - g. What is u rounded to the nearest 10? -50 Let a(y) = 3334y2 + 3y - 6. Suppose 4x = -16 - 8. Let d be a(x). What is d rounded to the nearest ten thousand? 120000 Let b be 10/5 + (1 - 1). Suppose -3g - bs + 9400008 = -4g, g - s = -9400004. Round g to the nearest 1000000. -9000000 Suppose -4r - 1359996 = -2s, -r - 3399997 = -5s + 2r. Round s to the nearest 100000. 700000 Suppose -3*j + 139 + 197 = 0. What is j rounded to the nearest ten? 110 Let x = 1409982 + -1409972.0000075. Let o = x + -10. What is o rounded to six decimal plac	{ "pile_set_name": "DM Mathematics" }
(a) 5 (b) -0.01 (c) 2/9 (d) -1/4 (e) 0 e What is the closest to 1/4 in -2/11, -3, 3, -74? -2/11 What is the closest to 0 in 0, 2/5, -0.06, -124, 8? 0 What is the closest to 6 in -1, -0.2, 0, 0.04712? 0.04712 What is the nearest to 8 in -1/2, -579, -0.3, 0.4? 0.4 What is the nearest to 3/23 in -3, -5, 3, -114/5, 32/5? 3 Which is the closest to 0? (a) 2/3 (b) 7/211 (c) -7 (d) -1 b What is the nearest to -81 in -0.38, 5, -1, -29? -29 Which is the closest to 6? (a) -0.4 (b) -4 (c) -3905 (d) 4/3 d What is the nearest to -29 in 4, 2/17, 31, 1/4, 0.2? 2/17 What is the nearest to 0 in -0.1, 4, -1/146, 1.08, 0.5? -1/146 Which is the closest to 264? (a) 1/2 (b) 0.09 (c) 0 a Which is the closest to -34? (a) -652 (b) 0.4 (c) -1 c What is the nearest to 2/241 in -1/16, -2, 3, -0.5? -1/16 What is the nearest to 52 in 2, 38, -4? 38 Which is the nearest to 2/3? (a) -1/4 (b) 3 (c) 1 (d) -1710 (e) -2/15 c What is the closest to 2/9 in 195, -2, -0.1, -5, -0.5? -0.1 Which is the nearest to -68/7? (a) -22 (b) -1 (c) 2 b What is the closest to 0 in 2, 153, -82? 2 Which is the nearest to 1/3? (a) -1 (b) -4 (c) -0.14 (d) -2.95 (e) -2/9 c What is the closest to -0.06 in -1, 3/8, 901, 0.5, -3? 3/8 Which is the closest to 0.1? (a) -6 (b) -20368 (c) -1 c Which is the closest to 20442? (a) -2/3 (b) -5 (c) -0.4 c What is the closest to -0.1 in 0.3, 0.15, -8, -40? 0.15 What is the nearest to -0.01 in 0.6, -0.04, 0.058? -0.04 What is the nearest to 9 in 113/29, 2/11, 0, -4, -3? 113/29 Which is the closest to -0.1? (a) 14/9 (b) 3 (c) -20 (d) 0.5 (e) 1.4 d Which is the nearest to 1? (a) -2/17 (b) 3 (c) 81176 a Which is the nearest to -3/16? (a) 0.05 (b) -84 (c) -1 a Which is the nearest to 0.1? (a) -49 (b) -1/29 (c) 0 c What is the closest to -0.2 in 0.31, 1, 12, 5? 0.31 What is the nearest to 0 in 0.3, -5/2, 15, 469, 3? 0.3 Which is the nearest to -0.2? (a) 6 (b) 5 (c) 2/3 (d) 0.2 (e) 0 e What is the nearest to -9 in 3/44, 6, 5, -1/6? -1/6 Which is the nearest to 2/3? (a) -0.3 (b) 4 (c) -4 (d) 2/7 (e) 3/7 e Which is the closest to 0.1? (a) -0.3 (b) -0.4 (c) 560 (d) 0.3 d Which is the nearest to -0.2? (a) 13/53 (b) 4 (c) -3 (d) -0.1 d Which is the nearest to 1? (a) -21 (b) -63 (c) 2/41 c Which is the closest to -6/11851? (a) -0.4 (b) 5 (c) -0.3 c What is the closest to -194 in 4.3, 1/2, 2, 5? 1/2 What is the closest to -15 in 0.02392, 1/4, -0.5? -0.5 Which is the nearest to -2? (a) 3/5 (b) -1/11 (c) 4/9 (d) 4/3 b Which is the closest to 0? (a) -2 (b) 0.11 (c) 2/9 (d) 5 (e) -2/11 b What is the nearest to -2/7 in 1, 0.1548, -1/23? -1/23 What is the nearest to 31 in -2/11, 2, -7/8? 2 Which is the nearest to -28? (a) -21/124 (b) -0.4 (c) 1/2 b Which is the nearest to -88? (a) -2/7 (b) -0.1 (c) 0.1 (d) 0.06 a Which is the nearest to 4/21? (a) -0.3 (b) 3 (c) 0 (d) -5/3 (e) -2/3 c Which is the nearest to 1? (a) -0.44 (b) -6 (c) -21 a What is the closest to -0.1 in -0.3, 2/3, -5, -1/1019? -1/1019 What is the nearest to -1/20 in 0.2, 2967, -0.04? -0.04 Which is the nearest to 138? (a) 2 (b) -19 (c) 11 c What is the closest to 12 in 0, -1, 275? 0 Which is the closest to 10? (a) -2.3 (b) -2.7 (c) 3/2 c What is the closest to 1/8329 in 0.1, -5/2, -5, -0.6? 0.1 Which is the closest to -2/3? (a) 0.3 (b) 3/7 (c) 122 (d) -4 (e) -2 a What is the closest to 1 in -170, -0.4, 286? -0.4 What is the nearest to 1/4 in -4, 71, 64, -0.2? -0.2 What is the closest to -0.1 in -2, 89, -13, 2/5? 2/5 Which is the closest to 0.13? (a) 36 (b) 122 (c) 4 c What is the closest to -0.1 in -1/6, -374, 14? -1/6 What is the nearest to 2 in 1.78, 0.08, -4/19? 1.78 Which is the nearest to -0.2? (a) 1351 (b) 2 (c) -221 b What is the closest to -2 in -0.3, 31, 3, -2/5? -2/5 What is the nearest to -0.2 in 68, -4, -0.2? -0.2 Which is the closest to 0? (a) 6 (b) 2/9 (c) 4/5 (d) 4/23 d What is the closest to -26 in 105, 5, -0.3? -0.3 What is the closest to -6/19 in 7, 33, -0.2? -0.2 What is the closest to 0 in 0.387, -1, 0.4? 0.387 What is the nearest to 34 in -2/9, -3/5, -4, -5? -2/9 Which is the closest to 21/88? (a) 0 (b) -0.02 (c) -5 a What is the closest to 6/13 in 0, -3/8, 2/7, -6? 2/7 Which is the closest to -1? (a) -0.2 (b) -10 (c) -65.1 a What is the closest to 0.1 in 1, -4, 1423? 1 What is the nearest to -1 in 0.4, -1.49, -7? -1.49 What is the nearest to 2/11 in 0.3, -0.1, 2/9, 3, 1.29? 2/9 Which is the nearest to 0? (a) -5 (b) 0.6 (c) -4 (d) -772 (e) -1 b What is the nearest to 0.1 in 8/5, -1/4, -11, 1.2? -1/4 What is the closest to 0 in -0.5, -0.4, -3/182, 4.1? -3/182 Which is the nearest to 74? (a) 1/4 (b) -2 (c) 5/6 (d) 0.07 c Which is the nearest to -5/2? (a) -3 (b) 1 (c) 5 (d) 4 a What is the nearest to -259 in 1/5, -145, -5/3? -145 Which is the nearest to -3? (a) 2 (b) -3 (c) -3487 b What is the nearest to -2/45 in 2, -1/6, -3, -7? -1/6 What is the closest to 2/61 in 0.19, -264, 1? 0.19 What is the closest to -1 in 2/5, 0.3795, 2, -1/6? -1/6 What is the closest to -0.1 in 2, -5, -0.0166, 2/23, 7? -0.0166 Which is the closest to 1? (a) 1/5 (b) 642 (c) -7 a What is the closest to 2/3 in 3, 4, 0, -1374/5? 0 Which is the nearest to 2/1521? (a) -24 (b) 1/10 (c) 6/5 b Which is the closest to -3/2? (a) 2 (b) 10 (c) -2/15 (d) 2/9 (e) 30/13 c What is the closest to 5 in 4, -3/2, -0.1, 2.4? 4 Which is the closest to 0.054? (a) 1/3 (b) -449.7 (c) -4 a Which is the nearest to 1? (a) 3 (b) 107/3 (c) -1/10 (d) 5 c What is the nearest to 0 in -3/10, -1/4, 2, 0.4? -1/4 Which is the nearest to -0.02? (a) 3 (b) -39 (c) -1 (d) -0.1 d What is the closest to -1 in 5, 92.5, -3/29? -3/29 What is the closest to -185 in 0.1, 5, -80? -80 Which is the nearest to -1801/25? (a) -4 (b) 6 (c) 0.1 a What is the nearest to 3 in 4, -22/3, -27.2, 0.4? 4 What is the nearest to 0.04 in -54, -1/15, -0.2? -1/15 What is the nearest to 73 in -0.6, 7, 16, 3? 16 What is the closest to 95 in -3.8, 5, 3, -2? 5 What is the closest to 1 in -5, 0.65, -1/4, 34? 0.65 What is the closest to 0 in 0.112, 11, 3/4, 4? 0.112 What is the closest to 1 in -0.4, -1, -2839? -0.4 What is the closest to 0.1 in -9/7, -34, -5, 0.03? 0.03 Which is the nearest to 1/146? (a) -0.2 (b) 4/3 (c) -1 a Which is the nearest to -1? (a) 0.2 (b) 84901 (c) 3 (d) -2/7 d Which is the closest to -1/3? (a) 57.8 (b) 2 (c) 2/13 (d) -172 c What is the nearest to 0 in -5/6, 4, -7123, 0, 1? 0 What is the closest to 0.1587 in 61, -3, 2/7? 2/7 Which is the nearest to -2? (a) 0.2 (b) -7 (c) -0.2 (d) 2/11437 (e) -0.3 e Which is the closest to -2/9? (a) 2/9 (b) -0.5 (c) -108/11 (d) -0.1 d What is the nearest to 3 in 676, -6, 0.4? 0.4 Which is the nearest to 39/5? (a) -4/663 (b) -2/5 (c) -5/4 (d) 2/9 d Which is the nearest to -9? (a) -2 (b) 34 (c) 1/4 (d) -2/13 a What is the nearest to -1583 in -0.5, 3.5, -1/3, 2/13? -0.5 Which is the closest to -29? (a) -7/3 (b) -1/4 (c) -2 a Which is the nearest to 1/3? (a) 85 (b) 2/5 (c) -0.05 (d) -2 (e) -2/11 b What is the nearest to 1/3 in 17/7, -0.3, -1/5, -0.4, 0.07? 0.07 What is the nearest to -1/2 in 3/7, -0.3, -2.8, 11/21, 1/7? -0.3 What is the closest to -0.13 in -4, 0.5, 4/7, -73? 0.5 What is the nearest to 0 in -312/5, -0.2, 2/11, -3/50, 4/3? -3/50 What is the nearest to 1 in 338, -14.6, -3? -3 Which is the nearest to 3684? (a) -6/11 (b) -0.4 (c) 0.2 (d) -2 c What is the closest to 4/5 in -4, 11, -41, -6? -4 Which is the closest to -32? (a) -2 (b) -0.5 (c) 2/57 (d) 4 a What is the closest to -3 in 5/3, -11, 264? 5/3 What is the nearest to 334 in -2, -2/11, -17, -2/17, 4? 4 What is the closest to 0.1 in 3/7, 0.8, -1/3, -0.45, -0.2? -0.2 What is the nearest to 1 in 8, 1, 2/3, -95, 0.05? 1 What is the nearest to -6 in 0.09, 0.044, 2? 0.044 Which is the nearest to -0.43? (a) 0 (b) 153 (c) 4 a What is the closest to -1/2 in -2/11, 1/3, -2/13, 1/2? -2/11 Which is the nearest to 2? (a) 2/11 (b) 162 (c) -3 (d) -0.2 a What is the nearest to 0.1 in -41, 2, 116? 2 Which is the closest to -638? (a) 2 (b) 0.3 (c) -1/2 c Which is the nearest to 38.2? (a) -3/5 (b) 5 (c) -2 (d) 0.4 (e) -2/15 b Which is the closest to 2? (a) 1001 (b) 3/5 (c	{ "pile_set_name": "DM Mathematics" }
+ 1 + (-13)/13. Suppose n = 380s - 376s. Suppose s = 9d - 180 - 306. Is 9 a factor of d? True Suppose 0 = -4f + 28, 4d - 13f - 34282 = 5f. Does 46 divide d? True Let m be (14/28)/((-3)/(-6)) + 57719. Is (m/36)/10 + (-2)/(-3) a multiple of 23? True Suppose 1643 = -5c - 477. Let i = c - -522. Is 7 a factor of i? True Let i be -21(5/3 + 0). Let j = i - -27. Does 3 divide (j/5)/((-28)/350)? False Suppose 572908 = 59h + 89h. Does 49 divide h? True Let d(c) = c2 - 24c - 23. Let a be d(25). Suppose 5i = ai - 1635. Is 41 a factor of (i/(-35) + 3)7? False Let j(u) = 4u*2 + 19u + 37. Let a be j(-3). Is (-148)/(a/32 - (-18)/(-28)) a multiple of 58? False Let v be (-195)/(-75) - 4/(-10). Let w(x) = 35x2 - vx + 9x3 - 36x*2 + 3 + 8x*3. Does 3 divide w(1)? False Is 11 a factor of (42 - (-9 - -4))(-564)/(-3) - -8? True Suppose -5v = 4b - 173, 0 = -v + 161b - 163b + 37. Let q be (0 - 0) + (38 - -1). Suppose 216 = qr - vr. Is 13 a factor of r? False Let s be (-1 + 2)-3 + 13. Let n be (s/(-25))/((-1)/35). Let k = 56 - n. Is k a multiple of 6? True Let z(w) = -49w*3 + 31w*2 + 15w + 92. Is 8 a factor of z(-8)? False Let o = -32 - -41. Let c(i) = 32i + 146. Does 7 divide c(o)? True Let d(c) = -5c*3 - 18c*2 - 2c - 25. Let y(x) = -6x3 - 19x*2 - 2x - 25. Let o(v) = -7d(v) + 6y(v). Is 13 a factor of o(9)? True Let v(x) = 17870x2 - 177x + 178. Is v(1) a multiple of 23? True Let l(k) = -30k - 156 + 0 - 84 + 0 + 152k. Is l(10) a multiple of 56? False Let s = 57 + -82. Let l = -21 - s. Suppose 0 = -2i + 5w + 118, 0 = -0i - 5i - lw + 262. Is 23 a factor of i? False Suppose 7 = -4k - 13, 4h - 3k = -9. Let r be (-10)/(-12) - (-9 + 325/30). Does 15 divide r/3 + (-584)/h? False Suppose 2t + 3648 = 14t. Suppose 11 - 2 = g + 5l, l = 4g - 36. Suppose -t = -gp + p. Is 19 a factor of p? True Suppose -10x + 14x + 12 = 0, -4p + 29 = x. Suppose -p = -2z, -4t + 2688 = t - 3z. Is 18 a factor of t? True Let n = 43 - 47. Let m be 2/(-8) - (n + (-2338)/8). Suppose -4q + 0q = 3w - m, -4w = 5q - 369. Is 11 a factor of q? True Let g = -939 + 2203. Does 16 divide g? True Suppose 4c - 13 = -5. Suppose -10p - 3q + 4765 = -5p, -cp = 5q - 1887. Suppose 0 = -5n + 119 + p. Does 27 divide n? False Suppose 11r - 1 + 1 = 0. Suppose 5c - 3h = 356, -4c + rh - 3h + 274 = 0. Is c a multiple of 6? False Let y be (3 - (-30)/24)52. Let c = y + -131. Does 15 divide c? True Suppose 0 = -u - 139 + 141. Suppose 1651 = 3d - us, 6d + 2s = 3d + 1643. Does 29 divide d? False Let m(n) = 12n - 135. Let f(d) = 4d - 45. Let k(v) = -8f(v) + 3m(v). Is k(13) a multiple of 7? True Suppose 2z = -2w + 12062, 7 = 4z + 31. Is w a multiple of 20? False Let o(q) = 2q + 4 - 34q - 5 + 14. Does 41 divide o(-6)? True Let x(k) = 1343k2 - 7k - 1. Let n be x(1). Suppose -4p + 1047 = c, 5p - 7c + 3c = n. Does 11 divide p? False Let j(z) = 8z - 12. Let t be j(7). Suppose -td + 720 = -41d. Is d a multiple of 8? True Suppose 194 = 3i - 4f, -17i = -13i + f - 246. Suppose 2t + 42 + i = m, -3m + 300 = -3t. Is 12 a factor of m? True Let t(k) = k*3 + 5k*2 + 7k + 5. Let x be t(-3). Suppose -s = -p - xp + 8, 3p + 2s = 11. Suppose pl - l = 336. Is 28 a factor of l? True Suppose 0 = 3b - w - 61212, 0b - 61188 = -3b + 5w. Does 19 divide b? True Suppose -5f = 4r - 1967, 0 = 4r + 548f - 549f - 1997. Is 25 a factor of r? False Suppose -572b = -585b + 184184. Is b a multiple of 14? True Let h(n) = -n2 + 25n - 41. Let x be h(23). Suppose xq = 1928 + 1387. Does 17 divide q? True Let z(u) = 13u*2 + u. Let t be z(1). Suppose -25o + to + 6336 = 0. Is 24 a factor of o? True Let n be (19 - (-1 - 1)) + 0. Let q be (-24 - -25)(35 + 2) + 5. Let m = q - n. Is m a multiple of 16? False Let l = 180 - 122. Suppose 2u + 16 = -3o + 39, -4o - 2u + 28 = 0. Suppose 3 = -ob + l. Is 2 a factor of b? False Let w(f) = -3f*3 + 18f*2 - 44f - 15. Is 13 a factor of w(-7)? False Suppose 11i - 22704 - 36729 = 0. Does 100 divide i? False Let n(i) = -i3 + i2 + 6i. Let w be 3 - 0/(-13)(-1)/2. Let h be n(w). Suppose -336 = -3o - 2o - 2r, h = -5o - 3r + 334. Is 6 a factor of o? False Suppose 0 = -p + 61 - 57. Suppose -306 = ph - 10h. Let a = 85 - h. Is a a multiple of 7? False Suppose -12 = -2l + f - 1, -5l + 25 = -2f. Suppose ln + 0n - 288 = 0. Is n a multiple of 13? False Let l = 34180 + -25291. Does 10 divide l? False Let t(d) = d3 + 6d*2 + 6d + 9. Let z be t(-5). Suppose 4y + 241 + 591 = zn, 0 = 4n - 5y - 829. Does 20 divide n? False Suppose 2t = -30t + 55424. Let h = -813 + t. Does 86 divide h? False Does 11 divide (4 - -19) + (73 - -10101)? True Suppose 0 = -5l + 5z + 7640, -7658 = -20l + 15l - 4z. Does 10 divide l? True Let s(t) = -t3 + 2t - 3. Let d(n) = n*2 + 9n - 12. Let v be d(-8). Let f = v - -17. Is s(f) a multiple of 2? True Suppose 4s = 2u + 24, 2s = -s + 4u + 28. Suppose 2q + 488 = sf, f - q - 29 - 95 = 0. Is 24 a factor of f? True Let u be (-2)/62-3. Let a = u + -12. Let r(q) = 2q2 + 10q + 5. Is r(a) a multiple of 21? True Let z(g) = -9g3 + 14g*2 - 6g - 5. Is z(-4) a multiple of 39? True Let r(m) = -m*3 + 9m*2 + m - 7. Let x be r(8). Let u = x - 63. Is 9 a factor of 15/(135/1116) + 2u? False Suppose 173 = 2w + 185, -3d = -2w - 1407. Does 48 divide d? False Let h be (-2)/(-5)(-12 + 288/4). Suppose 0 = 80r - hr - 77616. Is r a multiple of 14? True Let x(i) = i*3 + 10i*2 - 3i - 25. Let y be x(-10). Suppose 0 = -2n - n - 4j - 7, -5n - 35 = -yj. Is (n - (-21)/3)/(4/34) a multiple of 4? False Let g be ((-6 + 0)/(-12))/(1/8). Suppose -2c - 3n + 1317 = -gn, 0 = -3c + 2n + 1977. Does 24 divide c? False Let m be (-1)/(5/(-1020)) + -5. Let b(w) = -2w*3 - 10w*2 - 211w + mw + 4 + 2. Does 15 divide b(-6)? True Let o(h) = -1. Let a(b) = -5. Let y(m) = a(m) - 6o(m). Let r(g) = -g*2 + 9g + 24. Let v(i) = r(i) - 6y(i). Does 6 divide v(10)? False Let w(n) = -709n + 8292. Does 39 divide w(9)? True Suppose 0 = -3z - 3m - 7035 + 135423, 0 = -z + 2m + 42793. Does 12 divide z? False Let y(n) = n - 16. Let r be y(-13). Let u = 29 + r. Suppose -4g = o - 0o - 316, u = -5g + 2o + 382. Does 13 divide g? True Let r = -290 - -826. Suppose p - 560 = -4q, -p - 6q = -8q - r. Is 34 a factor of p? True Suppose -5t - 3n = 0, -n = 2t - 2n. Suppose t = 5v - 73 - 482. Suppose -4r + 7r - 120 = -a, -3r = -2a - v. Does 11 divide r? False Let q(l) = l2 - 3l + 14. Let z be q(0). Let n = z + -9. Let v(h) = 18h - 12. Is 39 a factor of v(n)? True Let l = 157 + -148. Suppose -s - 2976 = -ls. Let y = s + -240. Is y a multiple of 22? True Let z(l) = 14l2 - 18l - 86. Let r be z(-9). Let q = -612 + r. Does 26 divide q? True Let n(z) be the second derivative of 3/2z3 - 12z*2 - 1/3z*4 + 9/20z*5 + 2z + 0. Is 14 a factor of n(3)? True Let u(k) = 10k2 - 100k + 455. Is u(25) a multiple of 5? True Is 29 a factor of (15 + (-260565)/(-45))3? False Suppose b - 62 = 3d, 7b + 3d + 112 = 9b. Suppose -55r = -br - 620. Is 62 a factor of r? True Suppose -3h + 3r - 48 + 3 = 0, 3h + 4r = -59. Let k be ((-663)/h)/(-1 + 0). Let n = 101 - k. Is n a multiple of 11? False Does 16 divide (785/(-4))/(65/(-1144))? False Let n(p) = p3 + 12p*2 + 4p - 10. Suppose -6v - 58 = 14. Let t be n(v). Let i = t + 65. Does 7 divide i? True Suppose -88i - 47i + 2709276 - 924981 = 0. Is i a multiple of 11? False Let w(x) = -x2 - 1. Let h be w(5). Let l be 3 + 4 - (37 + -23). Let k = l - h. Is 4 a factor of k? False Suppose 5t - 310 = 3r, 0 = 38t - 36t + 5r - 93. Suppose 70b = tb + 99. Does 3 divide b? True Let x = 27 + -19. Let c be (-2)/(-24) - (-542)/x. Suppose 5i + c = 298. Is 7 a factor of i? False Let c = -1321 - -42181. Does 289 divide c? False Suppose -17 = -6n + 7. Suppose nz = z + 5s + 80, -2z + 2s = -56. Does 10 divide z? True Suppose 0 = 3g - 12 - 3. Let s(w) = 2w2 + 9w + 12. Let o be s(-2). Suppose -5 = r, 7d - gr - 860 = od. Is d a multiple of 11? False Let v = 362 - 224. Suppose -2a + v = 350. Let q = -61 - a. Does 19 divide q? False Is 25 a factor of (79384/(-11))/(9600/440 - 22)? False Suppose -2*m +	{ "pile_set_name": "DM Mathematics" }
without replacement from nyrvv. What is prob of sequence vr? 1/10 Three letters picked without replacement from dzdddzd. What is prob of sequence ddz? 4/21 Calculate prob of sequence xr when two letters picked without replacement from xrw. 1/6 Three letters picked without replacement from oodo. Give prob of sequence ooo. 1/4 Three letters picked without replacement from atpjt. Give prob of sequence tpj. 1/30 Three letters picked without replacement from pxktz. Give prob of sequence kxt. 1/60 Four letters picked without replacement from lkmlllusumlm. What is prob of sequence lmum? 1/198 What is prob of sequence ooed when four letters picked without replacement from dzoodeodddeddddeddde? 4/1615 Four letters picked without replacement from wwwccccwaawwcwccwcw. Give prob of sequence wacc. 7/646 Two letters picked without replacement from {f: 4, n: 1, e: 2}. What is prob of sequence fe? 4/21 Two letters picked without replacement from {g: 1, d: 1, a: 1, l: 3, u: 1}. Give prob of sequence du. 1/42 Four letters picked without replacement from bebgjjfefaab. What is prob of sequence jgfa? 1/1485 Four letters picked without replacement from {f: 4, v: 3, q: 2, o: 2, c: 2, u: 1}. Give prob of sequence vvvu. 1/4004 Four letters picked without replacement from {l: 2, t: 3}. Give prob of sequence ttlt. 1/10 Calculate prob of sequence sy when two letters picked without replacement from syyyysyyyyssyy. 20/91 Three letters picked without replacement from vinkkknnvvnvv. Give prob of sequence nkn. 3/143 Three letters picked without replacement from fffhjfjjhjggfgfjhe. Give prob of sequence jge. 5/1632 Two letters picked without replacement from {n: 3, a: 6, p: 2, h: 1, c: 1}. What is prob of sequence ch? 1/156 Two letters picked without replacement from kkkkkkkkakkkkkkkkk. What is prob of sequence ak? 1/18 What is prob of sequence orw when three letters picked without replacement from {w: 2, y: 1, r: 7, o: 4}? 1/39 Calculate prob of sequence aauy when four letters picked without replacement from {u: 2, y: 1, a: 4, n: 7, c: 1}. 1/1365 Three letters picked without replacement from {u: 1, t: 1, q: 13, i: 5}. Give prob of sequence tiq. 13/1368 Three letters picked without replacement from hhhhzzhhhhhhh. What is prob of sequence hzh? 5/39 Two letters picked without replacement from icmmb. What is prob of sequence im? 1/10 Calculate prob of sequence rkyz when four letters picked without replacement from {z: 3, x: 1, r: 1, y: 3, k: 2}. 1/280 What is prob of sequence sxx when three letters picked without replacement from {x: 4, p: 2, s: 1}? 2/35 Four letters picked without replacement from {m: 8, t: 5, e: 2, q: 2}. What is prob of sequence mqqe? 1/1785 Four letters picked without replacement from {u: 2, c: 2, l: 1, w: 2, a: 1}. Give prob of sequence wcwl. 1/420 Calculate prob of sequence eb when two letters picked without replacement from {b: 3, e: 1}. 1/4 Four letters picked without replacement from qvqvv. What is prob of sequence vvvq? 1/10 What is prob of sequence ggg when three letters picked without replacement from {g: 10}? 1 Two letters picked without replacement from {f: 6, i: 2, a: 2, y: 2, m: 1, q: 4}. What is prob of sequence qf? 3/34 What is prob of sequence moo when three letters picked without replacement from ommnmoonoomm? 5/66 Four letters picked without replacement from {c: 3, q: 3, p: 7, t: 1}. Give prob of sequence cqct. 3/4004 What is prob of sequence bf when two letters picked without replacement from {b: 2, l: 1, v: 2, f: 1}? 1/15 Two letters picked without replacement from {r: 5, a: 2}. What is prob of sequence aa? 1/21 Three letters picked without replacement from {t: 5, b: 7}. Give prob of sequence btb. 7/44 Three letters picked without replacement from rcbhrckh. Give prob of sequence rhc. 1/42 Three letters picked without replacement from zdppdqztr. Give prob of sequence dpr. 1/126 Two letters picked without replacement from {u: 6, c: 9, q: 1, p: 1, h: 2, g: 1}. Give prob of sequence uh. 3/95 Two letters picked without replacement from {u: 1, a: 2, z: 1, i: 1, j: 2}. Give prob of sequence jj. 1/21 Calculate prob of sequence cm when two letters picked without replacement from {e: 2, c: 2, h: 1, m: 1, q: 4}. 1/45 What is prob of sequence gre when three letters picked without replacement from lllergeveeeee? 7/1716 What is prob of sequence ufaa when four letters picked without replacement from auufffuaffffufffffu? 5/3876 What is prob of sequence ph when two letters picked without replacement from bbbbbbbbbbphbbhhhbbh? 1/76 Two letters picked without replacement from rrrssrrsrrrrrs. What is prob of sequence sr? 20/91 Four letters picked without replacement from {t: 4, h: 2, b: 7, d: 4, a: 1}. What is prob of sequence adtb? 7/4590 Three letters picked without replacement from czoag. Give prob of sequence azg. 1/60 Three letters picked without replacement from {d: 4, j: 1, p: 3, y: 5}. What is prob of sequence dpp? 2/143 Two letters picked without replacement from {q: 2, o: 1, i: 3, u: 4}. Give prob of sequence qi. 1/15 Two letters picked without replacement from {o: 3, d: 5, u: 1}. Give prob of sequence oo. 1/12 What is prob of sequence sssf when four letters picked without replacement from sscsffscfsff? 5/198 Four letters picked without replacement from bbbhhuuubbhbhu. Give prob of sequence buuu. 6/1001 What is prob of sequence ml when two letters picked without replacement from {m: 1, v: 10, u: 7, l: 1}? 1/342 Calculate prob of sequence zayc when four letters picked without replacement from yczayycazycyyyz. 1/260 What is prob of sequence yt when two letters picked without replacement from {x: 2, y: 1, l: 2, t: 5, f: 6}? 1/48 What is prob of sequence qdm when three letters picked without replacement from {q: 3, m: 6, e: 2, z: 1, d: 7}? 7/323 Calculate prob of sequence pg when two letters picked without replacement from {h: 4, c: 4, p: 3, g: 3}. 9/182 What is prob of sequence wfw when three letters picked without replacement from rrwrrwcrrwfc? 1/220 Three letters picked without replacement from {t: 8, i: 5}. What is prob of sequence tii? 40/429 Calculate prob of sequence hhh when three letters picked without replacement from {a: 3, h: 5}. 5/28 Three letters picked without replacement from qpqiq. What is prob of sequence qqp? 1/10 Calculate prob of sequence afhh when four letters picked without replacement from {a: 2, f: 2, g: 1, h: 4, k: 2, z: 4}. 2/1365 Two letters picked without replacement from {n: 15, o: 4}. Give prob of sequence on. 10/57 Calculate prob of sequence gv when two letters picked without replacement from ururugrirvi. 1/110 Calculate prob of sequence ppp when three letters picked without replacement from {u: 1, n: 1, b: 1, k: 1, p: 5}. 5/42 Three letters picked without replacement from {w: 2, o: 2, m: 4, s: 3, r: 2}. Give prob of sequence som. 2/143 Two letters picked without replacement from {t: 4, d: 2, e: 1}. Give prob of sequence ed. 1/21 Two letters picked without replacement from {u: 1, m: 1, n: 1, s: 1, l: 1}. What is prob of sequence ul? 1/20 Calculate prob of sequence fq when two letters picked without replacement from qqtqqfftt. 1/9 Two letters picked without replacement from {n: 1, r: 1, o: 1, q: 1, h: 1, m: 2}. What is prob of sequence or? 1/42 Two letters picked without replacement from kukuuukmkukumu. What is prob of sequence ku? 5/26 What is prob of sequence wrr when three letters picked without replacement from {r: 18, w: 2}? 17/190 Three letters picked without replacement from rxxtrtxxx. What is prob of sequence rrt? 1/126 Three letters picked without replacement from zzbzzzxvzzbtzbbfz. What is prob of sequence fzx? 3/1360 Calculate prob of sequence zzo when three letters picked without replacement from iqioioooioqiiiiozzo. 7/2907 What is prob of sequence dv when two letters picked without replacement from {r: 2, s: 1, v: 2, d: 1}? 1/15 What is prob of sequence ccoc when four letters picked without replacement from ococcccccc? 2/15 Three letters picked without replacement from {k: 3, z: 1}. What is prob of sequence kzk? 1/4 What is prob of sequence hhhq when four letters picked without replacement from tthqqqthttthht? 3/1001 Two letters picked without replacement from gmmmtgmcmgccccmymmc. Give prob of sequence mc.	{ "pile_set_name": "DM Mathematics" }
mallest value? (a) r (b) j (c) o c Let a = 23 - 22.6. What is the smallest value in -2/11, a, -0.5? -0.5 Let y be (6 - 7)1/(-9). What is the second biggest value in 3, -2/7, -0.2, y? y Let z be 2/(-60) - (-13)/(-78). Which is the third smallest value? (a) -0.3 (b) z (c) 2 c Let n = 12 + -11.6. Let x be (-2)/(-4)30/(-18). Which is the smallest value? (a) -5/3 (b) n (c) x a Let z = -38 - -26. Let f = z - -7. Let j = -4.6 - f. What is the third smallest value in j, 4, -1? 4 Let h = 0.12 - -2.88. Which is the third smallest value? (a) 4 (b) h (c) 5 c Let z(o) = o*3 - 3o*2 - 5o + 4. Let p be z(4). Let d = 4 + p. Which is the third biggest value? (a) 0 (b) d (c) 3 a Let k = -88 + 97. What is the second smallest value in k, -4, 4? 4 Let f(d) = 2d - 4. Let c be f(6). Let b = c + -6. Let a be ((-2)/24)/(8/(-16)). What is the third biggest value in -1, a, b? -1 Let w be 0 - (-3 - -6) - 11. Let r = -10 - w. Which is the second biggest value? (a) r (b) -1 (c) -5 b Suppose -18 = 2b + 2q, b - 4b = -3q + 3. Suppose -2 = -n + 3. What is the second smallest value in -0.2, n, b? -0.2 Let m = -17 + 11. Let k be 27/m - 2/4. What is the smallest value in 2, -0.3, k? k Let k = 1.1 - 2.1. Let b = k - -2. What is the second biggest value in -3/4, b, -0.3? -0.3 Let u = 4 - 4.1. Let i = 0.81 - -0.29. Let w = i + u. Which is the biggest value? (a) -0.2 (b) -0.1 (c) w c Let h be ((-2)/16)/((-11)/(-66)). What is the smallest value in h, -4, 6? -4 Let y be 6/15 + 51/(-15). Let x(g) = -g + 2. Let o be x(y). Suppose -6 = -os + 2s. Which is the third biggest value? (a) -5 (b) s (c) 2/15 a Let u = 2.05 - 0.05. Let y = 2.03 + -0.03. Let s = y - u. Which is the second smallest value? (a) -0.1 (b) s (c) -5 a Let f be (42/175)/(4/10). Let s = -2.05 + 2. Let j = s - -0.15. What is the smallest value in f, j, -3? -3 Let m = 117 - 471/4. Let z be (-3)/(-2 + 10/8). Which is the second smallest value? (a) z (b) 1/3 (c) m b Let l = -359/7 - -51. Which is the third biggest value? (a) 5/3 (b) l (c) 0.4 b Let s = -0.85 - -0.15. Let j = s + 1.7. Let t = -0.2 - 0.1. What is the third biggest value in j, -0.1, t? t Let v(p) = -p - 7. Let z be v(-9). Let t be 0z(-3)/6. Suppose 2h - 3o = -t + 5, o = -3h + 13. Which is the second smallest value? (a) h (b) -0.5 (c) 5 a Let j(v) = -v*2 - 5v - 2. Let a be j(-4). What is the fourth smallest value in a, -0.4, 0, 0.1? a Let y = 5 + -8.5. Let w = y - 1.5. What is the biggest value in 0, 3, w? 3 Let d = 3.06 + -3. Let a = d + -0.56. What is the third smallest value in a, 3, -1/11? 3 Let q = 103/6 - 17. Let w = 76 + -75. Which is the biggest value? (a) q (b) w (c) -1 b Let r = -28 - -22. Let j be ((-6)/(-16))/(9/r). What is the biggest value in j, 2, 0? 2 Let m = -1805/13 - -139. What is the second biggest value in 0.2, -1/2, m, 2.8? 0.2 Let z be (5 - (-105)/(-28))(-2)/10. Let h(n) = n2 - 5n + 4. Suppose -u = u - 8. Let r be h(u). Which is the third smallest value? (a) -0.4 (b) z (c) r c Let o be (0 + 1)24/(-30). Which is the third smallest value? (a) -0.2 (b) -6 (c) o a Let r be (3/(-25))/((-4)/(-10)). Let p = 7/40 + r. Let c be (-2)/(((-4)/6)/1). What is the third smallest value in 0.5, p, c? c Let v = -7 + 4. Let m = 12 + -7. Which is the second smallest value? (a) m (b) -1/6 (c) v b Let j = 6.7 - 7. Suppose -p = -2f + 2p - 4, -4f + 8 = 2p. Let o be f/(((-12)/(-2))/3). Which is the third biggest value? (a) j (b) -5 (c) o b Suppose -2y = -3y + 5j - 24, 3y = -2j + 13. Suppose 4z = y - 9. Let i be (-1)/6z3. Which is the smallest value? (a) i (b) -2 (c) -2/7 b Suppose 5q + 2 = 7q. What is the second biggest value in -0.4, -0.9, q? -0.4 Suppose 3h - 7h = 0. Suppose -2s - 13 + 5 = h. Suppose -6j + j - 10 = 0. What is the biggest value in j, -0.5, s? -0.5 Let z = 3 + -5. Let s be 3 + 0/2 + -1. Which is the second biggest value? (a) s (b) z (c) 0.3 c Let u = -2.2 - 5.3. Let k = -2.5 - u. Which is the third biggest value? (a) 1/10 (b) k (c) 0.5 a Let j be (2/(-4))/(1/(-10)). Let h(n) = -2n + 6. Let i be h(j). Suppose -2r = 1 + 5. Which is the smallest value? (a) i (b) r (c) 0.4 a Let v = 28 - 12. Let o be 1(36/v)/3. Which is the third smallest value? (a) o (b) -0.4 (c) 4 c Let t = 3 - 4. Let s = -7.1 + 7. Let h be (-1 + 4)(-8)/12. Which is the biggest value? (a) t (b) s (c) h b Suppose 4r + 3 = 11. Let a = -0.039 - 0.461. What is the third smallest value in r, -1, a? r Let d = -9 + 7. Let r be 6/(-12) - 1/d. Let h = 2.3 - 0.3. Which is the smallest value? (a) r (b) h (c) -3 c Let i = -3/1139 + 35333/9112. Let v = -4 + i. Which is the smallest value? (a) 2 (b) -1/5 (c) v b Let h = 0.01 + -4.01. Let x = 0.5 - -2.5. Which is the second biggest value? (a) -0.1 (b) h (c) x a Let d = -0.049 - 2.951. Let x = -0.09 - -4.09. What is the third smallest value in 0.4, d, x? x Let v = 0.2 + -2.2. Let h = 2.4 + v. Which is the second smallest value? (a) 4 (b) h (c) 2/7 b Suppose -2n + 5n - 12 = -3z, -13 = -5z + 2n. Let u = 2 - 1.5. Which is the biggest value? (a) z (b) 1/3 (c) u a Let j = 0.2 - 0.7. Let k(d) be the second derivative of d4/12 - 7d*3/6 - 11d*2/2 - 8d. Let q be k(8). What is the smallest value in 4/9, q, j? q Suppose -3o - o + 10 = 5u, -o = -4u + 8. Suppose -ug + 5g = -12. Let w = -3.4 + 3. Which is the smallest value? (a) -0.1 (b) g (c) w b Let w(t) = 8t3 + t2 - 1. Let k be w(1). Suppose 0b = b - k. Let p = b + -10. What is the second smallest value in p, 3, 5? 3 Let y = -0.6 + -1.4. What is the second biggest value in y, 0, -3? y Let r = 2.86 + -0.81. Let z = 0.05 - r. Let q be (-10)/(-8) + 1/(-2). Which is the smallest value? (a) 5/4 (b) z (c) q b Let n = -2.5 - -1.8. Let a be 1 + 5/((-50)/14). What is the third biggest value in a, n, 2/7? n Let h = 1.3 - 1.1. Suppose 0 = -3t - 0t - 18. Let z be (t/(-21))/((-9)/7). Which is the smallest value? (a) 0 (b) h (c) z c Let x(h) = h3 + 12h*2 + 12h + 15. Let l be x(-11). Let z be l/14 + (-30)/7. Which is the smallest value? (a) -1/3 (b) z (c) 2 b Let s = -1.4 - -1. Let g(z) = -2z + 3. Let f be g(4). Let v = 125 - 124.5. Which is the second biggest value? (a) s (b) v (c) f a Let m = -2.1 + 5.1. Which is the biggest value? (a) -3 (b) m (c) 1/4 b Let d(r) = r2 + 8r + 7. Let y be d(-6). Let j be ((-55)/3)/y + -3. Which is the third biggest value? (a) j (b) -5/4 (c) -0.2 b Let p be 19 + -2 - 0 - -1. Suppose 0 = -5j - n - p, 3n = 2j - 3j - 12. Which is the third biggest value? (a) 0.4 (b) 1 (c) j c Let z = 0.008 + 5.392. Let u = z - 0.4. Let t = 0.19 - -0.01. Which is the third smallest value? (a) u (b) t (c) 4 a Suppose -5p = -4 - 26. Suppose 4 + p = 2d. Which is the biggest value? (a) 1/2 (b) d (c) -0.5 b Suppose -f = -3c + 21, 5c - 5f - 33 = 12. Suppose 0 = -3s - c. What is the third biggest value in -0.2, -5, s? -5 Let t = 0 - -1. What is the second smallest value in t, -4, 2? t Suppose -4k - 2h = -3k - 4, -h = -1. Which is the second smallest value? (a) k (b) 3 (c) -5 a Suppose 5b = 5l, 0l = 2l + 4. Let s = -23/6 - -148/3. Let z = s + -44. What is the third smallest value in z, b, 1/11? z Let o be (-3)/1 - -33. Let f be (-20)/16o/(-20). Which is the smallest value? (a) f (b) -1 (c) -2 c Suppose -41 = 5x - 11. Let i be 2/(-12) - 2/x. Which is the smallest value? (a) 4 (b) i (c) 0.02 c Let n = 0.2 - 0.3. Let p = -2.1 - -2.2. Which is the biggest value? (a) n (b) -0.2 (c) p c Let b = 0.14 + 0. Let v = -0.64 + b. What is the second biggest value in v, -4, -0.2? v Let o be (-2(-1)/(-4))/(-1). Which is the smallest value? (a) -1 (b) -2 (c) o b Let n = -0.2 - -0.7. What is the third smallest value in -5, 1, n? 1 Let u be (3/(-1))/(2 + -3). Suppose 7l = 3l - 3g + 7, -2l - u = -5g. Which is the second smallest value? (a) -1/7 (b) l (c) 0.4 c Let k = 27 + -28. Which is the third smallest value? (a) k (b) -2 (c) 5 c Let f = 2 - 4. Let w(s) = -s*3 + 4s*2 + 4s + 4. Let z be w(5). Which is the third smallest value? (a) -1/2 (b) z (c) f a Let a = 608/5 + -122. What is the third biggest value in a, -4, 1/6? -4 Let n = -0.04 - 2.96. Let k = 26 - 24. What is the smallest value in -0.	{ "pile_set_name": "DM Mathematics" }
a factor of p? True Let u = 114 + -110. Let o(n) = n*3 + 7n*2 - 4n + 2. Is 9 a factor of o(u)? True Suppose 3t + 5p - 15 = -t, -2p + 6 = -3t. Suppose -2s - 5f + 27 = t, 0 = 3f - 13 + 4. Is 47 a factor of (87/s - -3)/((-1)/(-12))? False Does 10 divide (3 - 1035/(-105))/((-6)/(-2044))? True Suppose -4r - 2t + 0t = -554, -2r + 289 = -3t. Let j be (-10)/(2 - -3) + 132. Suppose r + j = 6k. Is 15 a factor of k? True Suppose 3h - 17 = -5t + t, -t + h = -6. Suppose 49 = 4x + t. Suppose -c + xc - 480 = 0. Is c a multiple of 15? False Let x(f) = 10061f*3 - 14f*2 + 24f - 10. Is x(1) a multiple of 32? False Let w = 2212 - -7086. Does 20 divide w? False Let o be 2936/8 + -3 + 8. Let b = 1079 - o. Is b a multiple of 7? True Let f(r) be the second derivative of r*4/12 + 3r*3 - 27r*2 - 69r. Is 21 a factor of f(9)? True Suppose -4x = -4s + 3s + 2, x + 6 = 3s. Suppose -6n + 7n + 10 = x. Is 25 a factor of n/((-4)/(-90)-3)? True Suppose 3s - 6314 = -4f + 125, -5 = -5f. Is 39 a factor of s? True Let t(l) = -7l2 + 35l - 50. Let p(s) = 4s2 - 17s + 27. Let q(u) = -5p(u) - 3t(u). Is q(21) a multiple of 12? True Suppose 2v = 4z + 10, -27 = -5v - z - 2. Let t be 950/18 + (v - (-129)/(-27)). Suppose -2u - t = -305. Does 14 divide u? True Let b(p) = p*2 + 21p + 13. Let x be b(-16). Let c = x + 130. Let d = c + -48. Is 3 a factor of d? True Let h be 1387/3 + 16/(-12). Let v = -266 - -927. Let q = v - h. Is q a multiple of 34? False Let k(u) = 575u + 1173. Is k(16) a multiple of 11? True Let w be (-12 + 30 + -12)323/3. Let t = -779 + 385. Let o = w + t. Does 42 divide o? True Suppose 5f = 15 - 60. Let d(u) = -14u + 371. Let y be d(25). Is 8 a factor of y - 4/6f/(-6)? False Suppose -5j + 4a + 177 + 2 = 0, -82 = -2j - a. Let h = j - 37. Let g(l) = 3l3 - 3l2 + l + 6. Is g(h) a multiple of 4? True Let v(g) = -g3 - 6g2 - 18g + 78. Is v(-12) a multiple of 13? False Let k = 4717 + -1593. Does 22 divide k? True Let z(r) = -r*2 + 11r - 22. Let p be z(8). Suppose 5m + 5 = -3f - p, -5m + 5f + 25 = 0. Let b(q) = 34q3 - q2 - q + 1. Does 19 divide b(m)? False Suppose 17n - 17676 - 3230 = -506. Is n a multiple of 15? True Is (12 - 3900/(-24))/(1/14) a multiple of 5? False Suppose -27r - 13798 = -8r - 96524. Is 19 a factor of r? False Let s = -587 + 593. Let m(h) = 36h - 128. Does 11 divide m(s)? True Let w(n) = n3 - 2n*2 + 2n - 1. Let d be w(2). Let t(k) = 2k2 + kd + 9k*2 - 18k*2 + 6k + 2. Does 11 divide t(7)? True Suppose -x = a + 6, -25x + 18 = -4a - 23x. Is 6 a factor of 3 - -2 - (995 - 5)/a? False Let i = -5844 + 14157. Is 51 a factor of i? True Let p be 77/5 - (-4)/(-10). Suppose 0 = 4t - 7t + p. Suppose 2n - 4n = tj - 40, -n + 32 = 4j. Does 8 divide j? True Is 5065 + (-6(-7)/63)/(20/90) a multiple of 23? False Suppose 11s - 15s - 604 = 0. Let l = s - -177. Is l a multiple of 7? False Suppose l - 113 = -4q, 4q - 7q - 473 = -5l. Let i = 154 - l. Is 19 a factor of i? True Let i(r) = 559r - 1183. Is 15 a factor of i(7)? True Let l = -29 + 18. Let g(c) be the third derivative of -3c*4/8 + 16c*3/3 - 490c*2. Is 25 a factor of g(l)? False Suppose 5k - 7304 - 3566 = 0. Is k a multiple of 10? False Let s(u) = u*2 + u - 12. Let m(d) = 196d*3 + 2d*2 + 8d + 9 - 3d2 - 195d*3 + 7d*2. Let c be m(-4). Is s(c) a multiple of 13? True Let z = -117 + -112. Let h = -131 - z. Is h a multiple of 28? False Let t be (-2)/(-7)(-1)/((-13)/182). Suppose -2l + 3835 = -5r, 0l + tr + 5735 = 3l. Is 24 a factor of l? False Suppose 5d + 3245 = -5r, -4r - d = -5d + 2612. Let i = 998 + r. Is i a multiple of 15? False Let l(g) = -89g - 516. Is l(-32) a multiple of 53? True Let i = 8867 - 8544. Is 17 a factor of i? True Suppose 54617x + 228501 = 54630x. Does 81 divide x? True Suppose 68v = 78v - 37v + 718740. Is 55 a factor of v? True Suppose m + 5l = -8, -4l + 8 + 0 = -m. Does 3 divide 4 - m(-1 + (-8)/(-4))? True Let f(u) = -2u2 - 6u - 4. Let y(s) = -s*2 - s. Let m(n) = f(n) - 3y(n). Let g be (6/(-1))/((-6)/8). Is m(g) a multiple of 9? True Let v(c) = -c*2 + 21c - 41. Let f be v(18). Suppose 0 = -fa + 18a - 1890. Is a a multiple of 6? True Suppose -35t = -39t + 1656. Suppose 0 = 3d - 123 - t. Suppose 2z = 4m - z - d, 0 = 5m + 3z - 217. Is m a multiple of 8? False Let a(h) = -3h*3 + 412h*2 - 132h - 610. Let r be a(137). Suppose 2l = -3l - 380. Does 5 divide (-15)/r + l/(-5)? True Let d(v) = -3v2 + 78v + 9. Let x be d(26). Is 11 a factor of ((-12)/(-10))/(x/315)? False Let p = 936 + -371. Let r = 981 - p. Is 26 a factor of r? True Suppose 4 = 2x, 0 = p - 5x - 4 + 14. Let z = 7 + -3. Suppose -4a + pa - zw = -860, -a = -2w - 215. Is 43 a factor of a? True Let y(r) = r*3 + 8r*2 - 17r - 86. Is 7 a factor of y(20)? False Suppose -4i + 2d + 13812 = 0, -40i - d = -41i + 3453. Does 104 divide i? False Is (103360/70)/(28/98) a multiple of 136? True Does 8 divide (207 - 271)(-1 - -2 - 72)? True Suppose 1065684 = 139m - 858746 - 2163699. Is 15 a factor of m? False Suppose 0 = 4v - 4c - 3104, 0v + 5v - 3910 = -5c. Let z = v - 210. Is z a multiple of 64? False Let y(x) = -6x + 21. Let m be y(-41). Let u = m - 72. Does 39 divide u? True Suppose 13m - 738 - 666 = 0. Suppose m = -4s + 1428. Is 66 a factor of s? True Let f = -95 - -205. Suppose -4n - 6n = f. Let q(i) = 3i2 + 14i + 7. Is 32 a factor of q(n)? False Let f = 9 + -9. Suppose f = -25s + 24s - 37. Let j = 65 + s. Is j a multiple of 4? True Suppose -217 + 65 = -4a - 4o, -5o - 179 = -4a. Is 43 a factor of (a - -2)/((-13)/(-117))? True Suppose -32 + 29 = -a. Suppose 4g - 1888 = -4w, g + aw - 278 = 202. Is g a multiple of 6? True Does 13 divide (-1 + (-73404)/(-72))(-104)/(-6)? True Let s(t) = -102t - 6392. Does 76 divide s(-126)? True Let a(p) = 2p*2 + p - 38. Let v be a(14). Let y = -284 + v. Is 12 a factor of y? True Suppose -2a + 29943 = 5l, 0 = a + 11l - 9l - 14975. Is a a multiple of 23? False Suppose 15s + 206742 = 95s - 189018. Is s a multiple of 51? True Let s be ((-1 - -1)/(1/(-1)))/1. Suppose -d + 5h = -0d + 6, s = 5d - 5h - 70. Does 9 divide d + -4 + 5 + -2? True Let g be ((-4)/(-5))/((-2)/35). Let k be ((-539)/g - 0) + 2/(-4). Suppose -3n = -680 + k. Does 52 divide n? False Let q(m) = -2m - 1. Let a(v) = -5v - 3. Let i(r) = -3a(r) + 8q(r). Let l be i(-2). Suppose 0 = -4w - u + 23, w - lu = -4w + 16. Does 3 divide w? False Does 50 divide (-101 + -1)(-110 - -35)? True Suppose 4g = 20, 2g + 3g = -4x + 229. Let r = x + 16. Suppose -13 + r = 2c. Is c a multiple of 3? True Let q(f) = f3 - 10f*2 + 11f - 18. Let c be q(9). Let u(b) = 3b2 + 78 - 4b*2 - 14. Does 16 divide u(c)? True Suppose 73x = -107x + 1735200. Is x a multiple of 49? False Let d(g) = -g2 - 12g - 36. Let w be d(-9). Is (6 - w/(-2))1366/3 a multiple of 74? False Suppose 5o = -11y + 7y + 15, -2o + 4y - 22 = 0. Is 35 a factor of (-3o/(-2))/(3/(-274))? False Let v = -5059 + 4905. Let t = 582 - 284. Let g = v + t. Does 12 divide g? True Let c(k) be the second derivative of -k5/20 - k4 + 7k*3/3 - 45k*2/2 + 4k + 3. Does 28 divide c(-15)? True Let v = -56 - -59. Let h = 45 - 43. Suppose 2g + 822 = 5s - hg, -v = g. Does 27 divide s? True Let d = -4836 - -6614. Is d a multiple of 17? False Let c(j) = -j2 - 31j + 34. Let m be c(-32). Suppose -12d + 110 = -md. Suppose -828 = 5w - dw. Is 9 a factor of w? False Let r = -118 - -123. Suppose ri + 5h - 540 = 0, 2i - 166 - 50 = 3h. Is i a multiple of 54? True Let m = -311 + 318. Is 9 a factor of 75 + (-35)/m + -3? False Let m = -27907 - -38393. Is 70 a factor of m? False Suppose -12u - 120 = -10u. Let f be (-58)/(-12) + (-10)/u. Suppose 3r = 4y - 163, 6y = 2y - fr + 123. Is y a multiple of 6? False Let f = 564 + -565. Is 17 a factor of (37 - 30) + 504 + f? True Suppose -5x + d = -510, -4x - 3d + 123 = -285. Suppose 0 = -5z - 77 + x. Suppose -zo = -2o - 243. Does 9 divide o? True Suppose -7d = 7d - 84. Let b = d - -314. Is b a multiple of 10? True Suppose -f = 2x - 6x - 53, -4x = -3*f + 55. Let r = 50 + x. Let s = -22 + r. Is s a multiple of 5? True Let i(k)	{ "pile_set_name": "DM Mathematics" }
se 0 = 2q + 3y - 2y + 3, q + 14 = -by. Sort q, 0.1, -1/3 in decreasing order. q, 0.1, -1/3 Let t = -654.01 - -657. Let i = -0.01 - t. Let q = 0 - i. Put q, 0.1, -0.4 in decreasing order. q, 0.1, -0.4 Suppose 6 = -5z - 9. Let v = 17 + -13. Let l be -4zv/12. Sort 1, l, -5 in descending order. l, 1, -5 Let s be (-6)/(-4)(-2)/3. Suppose v + 0v = 5y - 3, 2v + 6 = -y. Suppose 3d + 10 = 5n - yd, -3n + 35 = 4d. Put -3, s, n in descending order. n, s, -3 Suppose k + 19 = 24. Let q(u) = -2u + 4. Suppose -4p + 2j = 7j - 40, -37 = -5p - 3j. Let f be q(p). Put k, f, 4 in descending order. k, 4, f Suppose -43b - 21 = 4c - 44b, -c = 4b + 1. Let t(j) = j*2 - 10j + 9. Let d be t(6). Sort c, 0, -3, d in decreasing order. 0, -3, c, d Let l = 5.4 + -0.4. Let y be 1206/90 + 3 - 16. Sort -0.1, y, l. -0.1, y, l Let y = 0.3044 + -0.3044. Put -2/9, 60, -3/7, y in decreasing order. 60, y, -2/9, -3/7 Let o = -30 + 30. Let l = -31 + 26. Sort o, l, -4 in ascending order. l, -4, o Let i be (-8 + 5)(-2)/(-4). Let y = 2.5 + -9.5. Put y, 0.1, i in increasing order. y, i, 0.1 Let z be (0 + 8/3)15/(-10). Put 28, -6, z in descending order. 28, z, -6 Let r(x) = x*3 + 6x*2 - 1. Let z be r(-6). Let u = z + 5. Suppose 16 = 4t - 0m - 3m, 0 = -3t + 2m + 11. Put u, t, -5 in ascending order. -5, t, u Let g = 12 + -5. Suppose -g = -3w + 2a, a + 10 = -4w + 1. Sort 0.03, 0.2, w, 2/15 in ascending order. w, 0.03, 2/15, 0.2 Let c = -5 - 18. Let r = c + 32. Suppose rs + 10 = 7s. Put 0.4, s, 5/3 in descending order. 5/3, 0.4, s Let i = -1373 - -1369. Sort -36, -3, i in ascending order. -36, i, -3 Let v = -1.76 - -1.76. Let t = -7.7 - -8. Sort t, -0.3, v in ascending order. -0.3, v, t Let w = 0.1 + 0.5. Put w, 0.1, -0.3, 1/8 in ascending order. -0.3, 0.1, 1/8, w Suppose -7 = -g - 2. Suppose -16 = -3a - 5f, -8 - 4 = -a - gf. Put 1, a, -3 in descending order. a, 1, -3 Let n = 418 + -417.5. Let a = -11 + 27. Let c be (6/4)/((-60)/a). Sort c, 1, n in decreasing order. 1, n, c Let r = 824 + -821. Put 1, 129/5, r, -2 in decreasing order. 129/5, r, 1, -2 Let p be (-4 + 8 - 2 - -6) + 3. Let k be p/5 - (-6)/(-5). Put k, -8, -4 in decreasing order. k, -4, -8 Let w(k) = -20k + 340. Let x be w(17). Sort x, 4, -4, 18. -4, x, 4, 18 Let m = -586/3 + 196. Sort -4/7, m, 2/5, 0.5 in descending order. m, 0.5, 2/5, -4/7 Let d be (-20)/40-81. Suppose 14 = 4q + 2f, 4f = -dq + 13 + 7. Sort -0.1, -7, q. -7, -0.1, q Let s = -71 - -74. Let l(w) = -w3 - 22w*2 + 19w - 97. Let m be l(-23). Suppose -4f + 2f = 2c + 4, 0 = 3c + f. Sort c, s, m in decreasing order. s, c, m Let u = -15417 - -15416. Suppose 4j - 6 = 2k, 5j - k = 6 - 3. Sort -8, j, u in ascending order. -8, u, j Let v = 105 + -104.94. Sort -5, v, -1, 1/11. -5, -1, v, 1/11 Let x be (-1)/(-1) - 42/6. Let b = 29 - 27. Put x, b, 1 in increasing order. x, 1, b Suppose 38 = -4k + 6. Let g = k + 13. Suppose 10 = -t - t - go, -12 = 3o. Put -3, t, -1 in decreasing order. t, -1, -3 Let n be (-18)/(-5)(-25)/(-20)-2. Put n, -2, -1 in decreasing order. -1, -2, n Let w = -0.0175 - 1.9825. Put 4/7, -2/15, w in decreasing order. 4/7, -2/15, w Suppose 123 - 45 = 6p. Let w be (-3)/(0 + 1) - (p - 13). Sort -4, 1/5, w in ascending order. -4, w, 1/5 Let f(k) be the second derivative of k3/3 - 2k. Let j be f(1). Let w be j/8(-24)/21. Sort w, -4/7, 1 in decreasing order. 1, w, -4/7 Let y be (-1 + 0)/((-2)/(-4)). Let p = y - -2. Suppose -2q = -pq + 10. Put -1, q, 3 in decreasing order. 3, -1, q Let b(h) = -2h - 14. Let u be b(-7). Suppose u = z + 3z + 24. Let c = -2.87 + -0.13. Sort c, 0.1, z in decreasing order. 0.1, c, z Suppose 20u - 211 = -3n + 16u, -2n + 5u = -110. Sort 5, -4, -2, n in decreasing order. n, 5, -2, -4 Suppose 21a - 2a + 570 = 0. Sort -3, -5, a, -2 in decreasing order. -2, -3, -5, a Let q = 41 + -23. Let t = q + -15. Let k be 0/(2/(-1 + 3)). Sort k, t, -2 in descending order. t, k, -2 Let g = -18 + 17.6. Let m = 0.7 + g. Let a be 2 - (-3)/9-5. Sort a, -0.1, m in decreasing order. a, m, -0.1 Let q = 3094 + -3094. Let o = 1 - 0. Put q, 2, o in increasing order. q, o, 2 Suppose -10q + 9q - 1 = 0. Let y be 18/2q(-1)/(-3). Sort -2/11, y, 0.5, -4. -4, y, -2/11, 0.5 Let w = -42 + 45. Suppose -6n + wn + 23 = r, 0 = 3r - 2n - 25. Let u be -3(2 - 1)-1. Sort r, 2, u in ascending order. 2, u, r Let z = -11 - -13. Suppose 4l + z + 2 = 0. Sort l, 5, 0. l, 0, 5 Let s be (-2 - (-25)/12)-2. Sort 0, 1/4, 0.4, s. s, 0, 1/4, 0.4 Let j = 0.04 - -0.01. Let w = j + -0.55. Let p = -0.6 + 0.5. Sort p, w, -3 in descending order. p, w, -3 Suppose 4z + 2g = -0g - 4, -z - 5g - 19 = 0. Suppose 2q - q - p = 6, -3p = -2q + 14. Suppose -10i - q = 56. Sort -2, z, i. i, -2, z Let s = -7 - -9. Let f be (2/s)/(2/(-4)). Let a be ((-4)/15)/(f/5). Put a, 0.4, -1/5 in descending order. a, 0.4, -1/5 Let i = -173 - -78. Let w be (i/(-10))/(3/6). Let p = w + -26. Put 5, 2, p in descending order. 5, 2, p Let q = 1 + 0. Let z be (5/(-2))/(q/2). Let r(f) = -f3 - 4f*2 + 5f - 2. Let j be r(z). Sort -5, j, -3. -5, -3, j Let c = 8 - 4. Let p be 341/(-4464) - 3/(-16). Sort c, -2, p. -2, p, c Let n = 989 - 1003. Sort -2/5, n, 0.09 in decreasing order. 0.09, -2/5, n Let j be 18/(-63) - 7132/(-1638). Let c = 38/9 - j. Sort c, 5/2, -0.7 in increasing order. -0.7, c, 5/2 Let q(w) = 2w2 - 7w - 11. Let p be q(5). Put -6, -1, p, 1 in ascending order. -6, -1, 1, p Let o = 2.02 + -0.12. Let p = 1.5 - o. Let r(h) = h*3 + 3h*2 - 3h - 4. Let l be r(-3). Sort 2/9, l, p in increasing order. p, 2/9, l Let y = -6 - -8. Suppose yl + 2i = 7i + 23, i + 27 = 2l. Let n be (-35)/9 + (-14)/126. Sort -5, n, l. -5, n, l Let b = -23/9 - -25/9. Sort -0.06, 2/7, -2/7, b in decreasing order. 2/7, b, -0.06, -2/7 Let g = 299 + -302. Put g, 21, -1, 0 in decreasing order. 21, 0, -1, g Let q be 0/(-1)2/(-4). Let n be (488/64 + -8)/((-2)/16). Sort q, n, -2, -4 in descending order. n, q, -2, -4 Let q = 90.5 - 90. Sort 20, -1, q in ascending order. -1, q, 20 Let i(p) be the third derivative of p6/120 - p5/60 - 3p*4/8 + 5p*3/6 + 55p*2. Let q be i(3). Sort -1, -5, q. -5, q, -1 Suppose -11c + 10 = -6c. Let n be ((-1)/c)/((-11)/66). Put 2/9, n, -3 in ascending order. -3, 2/9, n Let d = 71/462 - -1/77. Let g = -8.2 + 1.2. Let u = 2 + g. Sort 2, d, u in increasing order. u, d, 2 Let p be (1/(-9))/((116/24)/(-29)). Sort 2, -5, p, 8. -5, p, 2, 8 Let r = -1642 + 1645. Sort 2, r, -9, -5 in decreasing order. r, 2, -5, -9 Let v = -273.2 - -273.6. Put -2/23, -1/6, v in increasing order. -1/6, -2/23, v Let l = 42 + -42.4. Let n = 0.016 + -0.516. Sort l, -5/4, n in decreasing order. l, n, -5/4 Let q = 375 + -380. Sort 0, 2, -3, q. q, -3, 0, 2 Suppose -15 = -5b, 3w = 5b - 2 - 25. Sort -3, w, 2, 9 in descending order. 9, 2, -3, w Suppose -3z = -5l + 13, 5l - 18 = 4z - 4. Put 5, 25, l in descending order. 25, 5, l Let o(h) = -h*3 - 4h*2 + 2h - 12. Let t be o(-5). Let g(p) = -p*2 - 8p + 8. Let j be g(-9). Put 1, t, j in decreasing order. t, 1, j Let d(p) = p*3 + 7p*2 - 1. Let k be d(-7). Let f be (1 + k/3)3. Let u be (-6)/21(18 + 17)(-2)/(-5). Sort u, f, 1 in decreasing order. f, 1, u Suppose -5o + 29 = 7l - 5l, 5o = 3l - 6. Let v(i) = i2 - 4i - 23. Let d be v(l). Sort -4, d, 1/3, 6/13 in ascending order. -4, d, 1/3, 6/13 Let n = -1.2 + 11.2. Let y = n + -21. Let i = -11 - y. Sort i, 2, -0.1 in descending order. 2, i, -0.1 Let p = 182 + -178. Put -34, p, 2, -1 in increasing order. -34, -1, 2, p Let q(i) = i - 6. Let c be q(4). Suppose 0l - 3l = -z - 4, -1 = 3l - 2z. Suppose 0 = -w - lw - 4. Sort c, 0, w in descending order. 0, w, c Let d be (5/(-4) + 2)4. Let q be ((-1)/(-6))/(2/3). Let x = 107 - 534/5. Sort x, q, d in ascending order. x, q, d Let y be ((-3)/(-9))/(2/6). Let q be ((-6)/8)/((-1)/4). Put q, y, -7 in descending order. q, y, -7 Let b = 97 - 97.3. Sort -1/9, -1.4, 0, b. -1.4, b, -1/9, 0 Let l(r) = -r2 + 18. Let f be l(-4). Let z(w) = -w3 - 6w2 - 5w + 5. Let t be z(-5). Sort -7, t, f in ascending order. -7, f, t Suppose s = -2f - 1 - 2, -f + 2 = -3s. Let j = -10 - -10. Suppose 0 = -jw - 3w - 9. Sort s, -5, w in increasing order. -5, w, s Suppose 0 = -9a + 4a - 25. Suppose -38*s	{ "pile_set_name": "DM Mathematics" }
35))/(2/202). Let v = 35/236 - o. Which is the second biggest value? (a) 0.2 (b) x (c) 2 (d) v d Let o = 6732 - 6732. Let u = -3.6 - -3.3. Which is the smallest value? (a) u (b) 2 (c) o a Let m = -161/146 + 44/73. Let n = 60 + -59. What is the third smallest value in 0.4, m, n, -0.9? 0.4 Let a = -638561/52 + 12280. What is the third smallest value in -3, a, -0.04? a Let r = -805.7 - -806. Let j = -1/10 + 1/2. Suppose -5 + 0 = y. Which is the second biggest value? (a) y (b) 20/7 (c) r (d) j d Let m = 5 - 5.1. Let s = -75756/7 - -10822. What is the biggest value in m, -10/17, s? m Let i = 1651 + -1651.06. What is the third biggest value in i, 1/3, -55/4, -0.5? -0.5 Let m = 113 - 112.664. Let c = 0.436 - m. Let o = 0.02 - -1.98. What is the third biggest value in -4, -0.4, o, c? -0.4 Suppose -5s + 49 = 3x + x, 0 = -4s - 4x + 36. Suppose 4a - 862 = -2g, -g - 99 = -a + 121. Let r = 439/2 - a. What is the smallest value in -3, s, 0.3, r? -3 Let z = -894.2 + 897.2. Which is the second smallest value? (a) 23 (b) 4 (c) 0.1 (d) z d Let h(v) = v3 + 6v*2 + 8v + 2. Let g be h(-4). Let f be (-11)/99(-9)/g. Let i = -1 + 2. Which is the biggest value? (a) 22 (b) f (c) i a Suppose v = -34 + 37, 4q - 1668 = 4v. Let k = q - 2097/5. Let h be 10/41/20. What is the third smallest value in k, 3, h? 3 Let y = 544.6 - 549.6. Let h be 28/(-2)(-1 + 0). Let f = h - 31/2. Which is the fourth smallest value? (a) y (b) 0.4 (c) 0 (d) f b Let o = -5342 - -5337. Which is the fourth biggest value? (a) 0 (b) -77/4 (c) -1 (d) o (e) 2/5 d Let x = 4.25 + -0.25. Let k = -149/6 - -25. Let f = -87/7 + 13. What is the smallest value in f, k, x? k Let y = 119/30 + -317/90. Which is the third smallest value? (a) 1/3 (b) y (c) -2.4 (d) 0.3 a Let x be 175/(-210) - (-1)/1. Let y = 21 - 16. Suppose y = 4s + s. Which is the third biggest value? (a) 3 (b) s (c) 0 (d) x d Let i = 40 + 214. Let t = i + -255. Which is the biggest value? (a) -0.7 (b) -9 (c) t (d) 4 d Let i be (-840)/(-100) + (-8 - 0). Let b be (-84)/105 - (-3)/5. Let x(l) = -l - 6. Let r be x(-8). What is the second smallest value in b, r, i? i Let v = 206 - 203. Which is the biggest value? (a) -4 (b) v (c) 402 c Suppose 3804g - 4003g + 995 = 0. Which is the fifth biggest value? (a) -0.02 (b) 27 (c) 3 (d) 2 (e) g a Suppose -20 = 6x - 12 - 2. What is the smallest value in 5, x, -3/14, -1/7, 7? x Let y = 2.1 - 2.07. Let a = -3.827 + 4.027. What is the third smallest value in y, a, -5/4, -0.4? y Suppose 3s = -4h + 2, 0 = 3h - 6h - 2s + 3. What is the fourth biggest value in 0.4, -3, h, 1/19, 3? 1/19 Let g = -203/2 + 101. Let z = -76 - -75.33. Which is the third biggest value? (a) -3 (b) z (c) g a Let t = -13951 + 13944. Which is the second biggest value? (a) 4 (b) 6/11 (c) -6 (d) t b Let q be (-24)/108 - 5/(-225)-8. Let h(y) = -2y + 18. Let m be h(10). What is the biggest value in 2, 0, m, q? 2 Let f = 441 - 4852/11. Let l = 2.7 - 3. Let o = -0.6 - -0.6. What is the second biggest value in o, l, f, -0.11? f Let g be (-104)/630 - (-2)/14. Let b = 977.8 + -978. What is the third biggest value in g, 5, b? b Let r = 0.68 + 0.4. Let p = r - 0.68. Let x = -40 - -40.2. What is the biggest value in p, x, -3/7, 5? 5 Let f = -178 - -178.06. Let j = 248/15 + -76/5. What is the second biggest value in f, -3, j, 1/8? 1/8 Let q = -5 + 5.3. Let b = q - 0.4. Let d be 3 + 1 + 51/(5355/(-390)). What is the biggest value in b, 0.2, d? d Let k = -696 - -708. Let u = 484/9 - 54. Let l be (4/(-3) + 2)(-6)/(-28). Which is the third smallest value? (a) -0.4 (b) l (c) u (d) k b Let s = 8.902 + -9.9529. Let z = s + 0.0509. What is the third smallest value in 2/3, 6/11, z? 2/3 Let f = 576 + -380. Let j = -211 + f. What is the biggest value in 0, j, -2? 0 Let j = -0.4 + 16.4. Let k = j + -15.8. Let y = -97 + 488/5. What is the second smallest value in 0.3, y, k, 2? 0.3 Let y = -0.022 + -208.978. Let n = 208.7 + y. Let u = -39/20 - -11/5. What is the third smallest value in u, 1/6, 1/9, n? 1/6 Let q = -16257/5 - -3252. Let z = 9 - 29/3. Which is the third smallest value? (a) 18 (b) q (c) z a Let s = -2 - -2.04. Suppose -11 - 17 = -14i. Suppose -4d = x + 1, 3x = x + id - 12. What is the second biggest value in s, 3/4, x? s Let q = 128784 - 128781. Let o be (-1)/(3/((-6)/4)). What is the second smallest value in o, q, -1, 2? o Let c = 0.12 + 0.01. Let z = 8.26 + -8.43. Let k = c - z. What is the third smallest value in 0.1, -1, k? k Let r(m) be the third derivative of -7m*4/24 + 41m*3/6 + 3m*2 - 16. Let n be r(6). What is the biggest value in 0.4, n, 4/19? 0.4 Let l = -402 + 347. Let g be -4 - ((3 - 0) + 395/l). Which is the second smallest value? (a) g (b) 1 (c) 4 (d) 16 b Let m = -155.71 - -155. Let f = m + 6.81. Let y = f - 1.1. Which is the fourth smallest value? (a) y (b) -0.6 (c) -5 (d) 1/7 a Let o be 748/(-1870) + 2/(((-120)/27)/(-2)). Which is the second biggest value? (a) -4/5 (b) o (c) 19.6 (d) 1.7 d Let d = 32/3 + -65/6. Let x = d + -1/12. Let j be -551 + 541 - 2-7. What is the second smallest value in x, j, -6? x Let s(m) = -8m2 + m + 2. Let l be s(-3). Let g = 224/3 + l. Let v = -1654230/7 - -236319. Which is the fourth smallest value? (a) g (b) 6 (c) -2 (d) v b Let o = -4 + 3.7. Let j = 187 - 185. Let s be j + (-4)/(-10)231/(-42). Which is the second smallest value? (a) s (b) -3/2 (c) o c Let g = 59 + -59.5. Let o be 4 + -1 + 2 + 68/(-12). Let x = 0.4 + 1.6. Which is the fourth smallest value? (a) g (b) -0.06 (c) o (d) x d Let x = 1.98 - 2.81. Let u = -0.008 + 0.888. Let y = u + x. What is the smallest value in -0.1, -2, -5, y? -5 Let v be (-180)/(-81) - (-2)/(-9). Let u = -1.36 + -0.14. Let q = 1 + u. What is the second biggest value in 3/2, q, v? 3/2 Let r = 29 - 16. Let n = -108.97 + 109. Let d = -0.03 + n. What is the third biggest value in d, 0.1, r? d Let z = 21940 + -21939.9. What is the second smallest value in -0.3, z, 127/3, 0.3? z Let k = -0.8 + 1. Let y = 273.6 + -187. Let p = y - 87. Which is the biggest value? (a) 0.4 (b) k (c) p a Let n be -4(-264)/(-384) + (-6)/(-2). What is the second smallest value in 0, 2/17, n, 0.01, -1? 0 Let k = -220 - -476. Let m be k/(-144) + (4 - 6/3). Which is the smallest value? (a) 1/5 (b) m (c) 4 (d) -0.6 d Let k = -12.15 + -0.55. Let d = -13 - k. Let c = 324 + -1297/4. What is the second smallest value in 14, c, d? c Let l = 78.66 - 75.66. Which is the fifth biggest value? (a) l (b) 2/9 (c) 0 (d) -2/13 (e) -15 e Let x = 2490.9 - 2491. Let k = -136/5 - -28. Which is the fourth biggest value? (a) k (b) x (c) 4/3 (d) -1/4 d Let v = 17680 + -17671. Let f = -5.97 + 6. Which is the fourth smallest value? (a) f (b) v (c) -0.4 (d) 0.2 b Let t = 7 + -14. Let s = -24.156 - -24.356. Which is the third biggest value? (a) -0.3 (b) -2/5 (c) t (d) s b Let t = 1218 + -1217. What is the fourth biggest value in 1/6, -1/4, t, 20? -1/4 Let z = 1.07 + -0.47. Let d = z + -0.8. What is the second smallest value in 0.03, 3, d, -5? d Let p(j) = -4j*3 + 2j*2 + 17j + 14. Let l be p(-2). Which is the smallest value? (a) -9 (b) -3 (c) -4 (d) l a Let w = -2 - -1. Let z = -4.32 - -439.32. Let r = z - 427. Which is the second smallest value? (a) r (b) -5 (c) w c Let q = -119/4 - -28. Let n = q + 61/28. Let r be (-30)/(-8) - 24/6. What is the third biggest value in r, n, -3/7? -3/7 Let c = -21 + 19. Let m = 636 + -636.06. What is the fourth smallest value in -4, c, m, 2? 2 Let o = -9.319 + 11.919. Which is the fourth biggest value? (a) o (b) 6 (c) 0.5 (d) -1 d Let w = -3 - -2.5. Let l = 87396.5 + -87392.5. Which is the third biggest value? (a) w (b) 5 (c) l (d) -4 a Let l = -2.4877 - -2.2877. Which is the third smallest value? (a) 3186 (b) l (c) 1 a Let k = 1427 - 1599.9. Let h = -173 - k. What is the biggest value in h, 3/8, 6? 6 Suppose -3o + 13o + 3o = 0. Suppose o = 7n - 30 - 5. Which is the second smallest value? (a) 0.071 (b) n (c) -3 a Let g = 5492 + -5495. Which is the fourth smallest value? (a) -14/27 (b) 1/3 (c) -4 (d) 5 (e) g b Suppose 7a - 24 = 4. Suppose -4p - al + 3l - 174 = 0, -p - 47 = 2*l. What is the biggest value in 5, 2, p?	{ "pile_set_name": "DM Mathematics" }
8 - (1 - -2). Solve -3j = qc, -3j = -5c - 0c + 27 for j. -4 Let x = -1 + 1. Let b(w) = -4w*2 + 50w - 21. Let m be b(12). Suppose -4l - 3j = -xj - 12, -ml - 8 = -2j. Solve i + l = 4g - 12, -3i + 3g = 0 for i. 4 Let g = -73 + 61. Let k(l) = 2l2 + 22l - 16. Let c be k(g). Suppose 0 = 2u - cu + 24. Solve r = -r - 3y - 13, -u = -r + 2y for r. -2 Let y(r) = r*3 + 14r*2 - 19r - 35. Let h be y(-15). Suppose 0 = -2q + 3u + h, -16q + u - 10 = -19q. Solve 15 = -5b - 5s, 11 = -2b - b - qs for b. -2 Let b be (-1)/(-3) + 456/171. Suppose -bx - 4v = -34, 0 = -3x + 5v - 0 + 25. Solve -5p + p - 10 = -3d, 0 = -2p - d - x for p. -4 Let q = 371 - 355. Solve -k + 5p = -20, -22k + q = -20k - 2p for k. 5 Suppose 580 = 5z + 4n, 4z - 4n + 188 - 616 = 0. Suppose -141 = -4b - v + z, 4b - 2v = 250. Let f = b - 62. Solve -f = 2g - p - 3, 4p - 3 = -3g for g. 1 Suppose -865g = -857g - 16. Solve 0 = -3x - d + 5 - 13, gd = x + 5 for x. -3 Let s be (736/(-6))/(-4)(-24)/(-16). Let z be 0 + (-9)/3 - s/(-2). Solve v = -4v - 3p - z, 3p + 15 = 0 for v. -1 Let u be (((-1)/(-9))/(6/18))/(15/315). Solve -2p + q + 5 = 0, -u = -15p + 17p + 3q for p. 1 Suppose -16b + 65 - 25 + 72 = 0. Solve 3f - 15 = 0, 0 = -3v - 2f - b + 2 for v. -5 Let n(i) = 15i - 15. Let y be n(1). Suppose -15j + 38 + 67 = y. Solve jm = -3q + 4m - 3, -2 = 3q + 4m for q. -2 Suppose -3t - t = -20. Suppose tx = -5, 2i + 3x + x - 4 = 0. Solve 3y = 2r - 22, -iy - 15 = y + r for y. -4 Let k(o) = -2o*2 + 18o + 117. Let z(x) = -3x2 + 39x + 233. Let h(l) = -5k(l) + 3z(l). Let w be h(-5). Solve -2q = -j - 3 - w, -5q = 4j - 11 for j. -1 Suppose 133d = 149d - 512. Solve -5k - 27m = -dm + 20, -4k - 3m = -12 for k. 0 Let n be -19 - (-19 + 262)/(-9). Let m(p) = p + 10. Let f be m(-8). Solve 4q + 8u = 3u - 36, 0 = -fu - n for q. -4 Let o(f) = -f*2 - 118f + 887. Let u be o(7). Solve 5k + 2j - 6j = -21, -u = -3j for k. -1 Let x = -1456 + 1468. Solve -3n + 2n = -4h - 20, x = h + 4n for h. -4 Suppose 0 = 941o - 1878o + 922o + 510. Solve -t - 36 + o = 0, h + t = -3 for h. -1 Let o be (-6)/21 + 60/14. Let m = -572 + 463. Let f = -97 - m. Solve 3t + t = -on - f, -4n - 16 = 5t for t. -4 Let d be 452/(-678)(3/(-2))/((-1)/(-4)). Solve 2 = 5s - 2p, -3s - 3 = -dp - 7 for s. 0 Let n be 198/48-22 - 6/(-8). Let i = n - -93. Solve 3c + iu = -24, 5 = c - 2u + 4 for c. -5 Let o = -108 - -108. Let g(j) = 9j + 3. Let u be g(6). Let l be 1/((-2)/12 + 38/u). Solve o = -a + 3a + 5w - l, w = -5a - 18 for a. -4 Let p(z) = z*2 - 47z - 47. Let t be p(48). Let s be 4/((-14)/(-7) - t). Solve 2 = -2b + 5h, 0 = 5b + sh + 5 for b. -1 Let c(r) = 4r - 62. Suppose 3k - 26 + 11 = 0. Suppose -3a = -15, -8a + 120 = km - 3a. Let b be c(m). Solve 3f - 4f = -3i - b, -f + 4i + 18 = 0 for f. 2 Let d(l) = -l + 40. Let i be d(35). Suppose -5z = iz + 6z. Solve 0 = -5r + r + 4y - 8, z = 3r + 5y + 22 for r. -4 Let b(h) = -2h*2 + 17h - 38. Let i be b(10). Let a = -2 - i. Suppose -4u - a = -10u. Solve 5q = 4k - u, 11 = k - 5q - 3 for k. -1 Suppose -3h - 15w = -17w - 24, -24 = -3h - 4w. Solve -k + h = 3p, -3p + 11 = 8k - 10k for p. 3 Let f be (-4)/((51/18)/(-17)). Suppose -3i - 3 - f = -5d, 4i = 2d - 22. Solve q + 5 = -3z, dz = -8q + 4q - 11 for q. -2 Suppose 0 = -34f + 31f + 15. Let d(b) = -b*2 + 4b + 12. Let g be d(f). Suppose 93 = -go + 10o. Solve -6a - 4l - 33 = -a, -o = 5a + 3l for a. -5 Let v(c) = 3c2 - 43c - 30. Let w be v(15). Suppose 30a - 32a + 6 = w. Solve -3s - u = -0s - 2, -au - 4 = -s for s. 1 Suppose 4c - 4s = 52, -4s - 57 = -38c + 33c. Solve 3d - ch - 31 = 0, -5h - 6 = 19 for d. 2 Let c be 0(2/4)/1. Suppose 44 = 12i - i. Suppose 2b = 5u - 17, 0 = 2u - b - 11 + i. Solve 0 = -5t + up + 14, 1 = -2t - p - c for t. 1 Suppose 41p - 25 = -r + 44p, -5p = -5r + 45. Solve r + 3 = -4c, 0 = -g - 5c - 9 for g. -4 Let b = -86 - 58. Let g be 48/b-6(0 + 1). Solve 2o + 4d + g = 4o, -1 = d for o. -1 Let z be 12/2(-40)/(-60). Let f be (-9)/(z3/48). Let a be 6/(-27) + (-44)/f. Solve t - a = 0, -1 = -w - 3t + 3 for w. 1 Suppose -27r = -32r - 2p + 17, -5p + 14 = 3r. Solve 14 = -2j - 2c, 2j + 11 = -rc - 7 for j. -3 Let h(x) = x*3. Suppose -8i - 2 = -9i. Let m be h(i). Suppose -5g + 13g = m. Solve z + 4u + 17 = 0, 3z + 2u + 12 = g for z. -1 Let d(i) = 4i - 24. Let s be d(11). Let j = 70 - 65. Suppose -5h - j = -v, 3h + 3v = 20 - 5. Solve hu - 8 = u - 3r, 0 = u + 4r - s for u. 4 Let j = -836 + 835. Let v be 8j(10 - (-190)/(-16)). Solve -2p - 5d + 30 = 0, -v = -3p - d + 4 for p. 5 Let k(y) = 462y - 1848. Let x be k(4). Solve -4f - q + 24 = -xq, -f - q + 9 = 0 for f. 5 Let d(w) = -w2 + 8w - 4. Let s be d(6). Let r(j) = -4j + 40. Let k be r(s). Solve -z = -4a, 4z = -8 - k for a. -1 Suppose -34j + 38j - 20 = 0. Let z = -7 + 16. Suppose 57x - 51x - 120 = 0. Solve q + jr = -x - z, -q = -4r - 16 for q. -4 Let h be (-2 - -6)70/56. Solve 47t - 43t = 5m + 12, -2m = -ht - 2 for t. -2 Let o = -55 - -57. Suppose ov + 2w - 214 = 0, -116 = -4v + 3v - 4w. Suppose -v = -2u - 88. Solve 5i + 5r - 14 = 6, -2i = -4r - u for i. 4 Suppose 0 = -d + 4c - 7, 31 = 4d + 2c + 5. Suppose ds - 23 = -y, -y = 2s + 2y - 4. Solve -12 = 3b + sh, -h - 16 = 4b - 3h for b. -4 Let j(t) = 3t*2 + 11t - 12. Let d be j(1). Suppose -m + dc + 4 = c, -5c = -m. Solve ma = 4r - 23, -4a + 4r - 8r = 4 for a. -3 Let p(u) = 16u + 1072. Let z be p(-67). Solve z = 4v - 5r + 5, -8v + 3v = -5r for v. 5 Let y(b) = -10b + 10b - 2b*2 + 34 - 33 - 6b*3. Let m be y(-1). Solve -m = 5g + 4p + 3, -2g = 2p + 2 for g. -4 Let z = 9 - 4. Solve -5a - 5b = -z, -11a + 4b - 16 = -9a for a. -2 Let s(h) = h*2 + 6h - 26. Let n(x) = x*2 + 6x - 25. Let q(z) = 5n(z) - 4s(z). Let t be q(3). Solve 9 = -3j - t, 0 = g - 5j - 29 for g. 4 Suppose 3f + 5c = 957, 8 - 2 = -2c. Suppose 2x = -2x - f. Let p = -53 - x. Solve k - 5u = -2 - p, 2k + 3u = 5 for k. -5 Suppose -82s = -110s + 112. Solve 49 - 50 = c - k, -sk = -c - 4 for c. 0 Suppose -2r - 222 = -4s + 58, -3s = 4r + 604. Let y = r + 152. Solve 3i = -5x + 6 + 22, i - 21 = -yx for i. 1 Let f(a) = -a*3 - 16a*2 - 32a - 5. Let p be f(-2). Solve -pd - 12 = 2v, 16 = -4d - 3v - 2v for d. -4 Let b be (-16)/(-6)5/(40/6). Suppose 2w - 148 = bi, -i + 5i - 2w = -286. Let q = i + 97. Solve -5j - 24 = -u - j, -2u = -4j - q for u. 4 Let i(h) = 8h*2 + 3h - 31. Let x be i(5). Let m = -179 + x. Solve -4s + 0o = mo - 19, -4s + 4o = 8 for s. 1 Let x(z) = 8z*2 + 121z + 144. Let v be x(-14). Solve 2f - vs = -17s - 12, -5f = -6s + 44 for f. -4 Let a = -4576 + 4579. Solve 18 = 3v - al, 16 = 4v - l - l for v. 2 Suppose i = 3b - 18, 0 = -5b + b - 4i + 24. Suppose 0 = 4z - bz. Suppose 15 = -5f, 19 = -zw + 5w - 3f. Solve -wm + d = 2d - 12, 5m - 3d = 8 for m. 4 Let t be ((-140)/(-14))/(2/(-8)). Let g = t - -40. Suppose 2 = 2w - 6. Solve 0 = -wd - 4l - 17 - 3, g = -d + 2l + 1 for d. -3 Let z = 19260 - 19246. Solve -r = -3f - 2, -23r - z = -4f - 25r for f. 1 Let r(x) = 38x - 285. Let l be r(8). Suppose -2f - 5b = -24 - l, -3f + 2b = -17. Solve f = 5q + 2i - 12, 0 = -q + 5i + 15 for q. 5 Let p = 2165 + -2162. Solve -pt - h = 18, -6h = -4t - 4h - 14 for t. -5 Let m = 38682 - 38681. Solve -5s - 4 + 18 = 4x, 3x = s + m for x. 1 Suppose 0 = -4x + 5d + 9, 4d - 6d - 2 = 0. Let w be (30/(-4))/(x/(-2)). Let g be 25/10(3/w + 3). Solve r = -3c - g, 2r + 3c = 5c for r. -2 Let o(s) = s2 + 30s + 81. Let j be o(-3). Solve 5a - 9a = j, -5m = a - 20 for m. 4 Let i(d) = 154d - 1380. Let w be i(9). Solve -5c = -4o + w, 53o = 57o - 3c - 2 for o. -1 Let n be (262 + 0)165/(-110). Let p = n - -397. Solve d + 3 = j + 2, -3d - 3 = pj for j. 0 Suppose 8 = m + m. Suppose 0 = -2n + 12, -24 = -4i - 7n + 3n. Solve -c + mc - 4l - 32 = 0, 4c + 2l - 6 = i for c. 4 Let v = -2493 + 2497. Solve -34h + 2b - v = -33h, b = -h - 1 for h. -2 Let o be -4 - 184/(-6). Let t = 13 - o. Suppose q = 4q - 5r - 35, tr = -4q. Solve -	{ "pile_set_name": "DM Mathematics" }
o. -1 Solve 4s + s = -20 for s. -4 Solve -15z - 15 = 60 for z. -5 Solve 11 = -5t + 11 for t. 0 Solve -495v = -490v - 30 for v. 6 Solve 12q + 7245 - 7293 = 0 for q. 4 Solve 34 - 1 = 11h for h. 3 Solve -16b - 23 - 9 = 0 for b. -2 Solve 12 = -2p + 5p for p. 4 Solve -7h + 4h = -9 for h. 3 Solve -4w = -5w for w. 0 Solve -16 = -5j - 26 for j. -2 Solve 8y - 53 = 61y for y. -1 Solve -78 + 57 = -3f for f. 7 Solve 13 = 3d + 16 for d. -1 Solve -8b - 2b = -60 for b. 6 Solve 21 = -72o + 79o for o. 3 Solve 0a + 24a = 120 for a. 5 Solve 0 = -55z + 60z + 25 for z. -5 Solve 0 = 8v - 38v - 210 for v. -7 Solve 0 = -2i + 5 - 15 for i. -5 Solve -1014l + 1009l = -30 for l. 6 Solve 8o = -2 + 26 for o. 3 Solve 35 = -21h - 70 for h. -5 Solve 0y + 8y = -0y for y. 0 Solve 0l = -11l - 11 for l. -1 Solve -744q - 18 = -747q for q. 6 Solve -5q = -q for q. 0 Solve 11r + 5r = 16 for r. 1 Solve 15 - 33 = -3q for q. 6 Solve -116i + 6 = -122i for i. -1 Solve -35 + 35 = 7x for x. 0 Solve -39x - 132 = -27x for x. -11 Solve 118 = 5z + 88 for z. 6 Solve 14i - 8 = 10i for i. 2 Solve 7387q = 7399q - 96 for q. 8 Solve -4384p = -4355p - 203 for p. 7 Solve 5d - 12 = -32 for d. -4 Solve -89 = -121o + 32 for o. 1 Solve 143u = 144u + 3 for u. -3 Solve 2d = 7d - 20 for d. 4 Solve -1 = 66j - 67 for j. 1 Solve -13 + 1 = -12q for q. 1 Solve -8a - 7a + 60 = 0 for a. 4 Solve -15k - 55 = 35 for k. -6 Solve 0 = -15l - 50l for l. 0 Solve 0 = -133a + 121a + 48 for a. 4 Solve 2k + 6k = -14k for k. 0 Solve 132y - 136y - 8 = 0 for y. -2 Solve 10b = 3b - 35 for b. -5 Solve 19y - 14 = 5y for y. 1 Solve 12021 - 12037 = 2l for l. -8 Solve 7d = 48d - 41 for d. 1 Solve 0 = 5s - 13 + 8 for s. 1 Solve 0h = 5h + 20 for h. -4 Solve -65m = 392 - 1042 for m. 10 Solve -23 = 19l + 15 for l. -2 Solve p + 3 - 4 = 0 for p. 1 Solve 0 = -9p - 20 + 2 for p. -2 Solve 0 = -19q - 26q + 225 for q. 5 Solve 56x + 48 = 48x for x. -6 Solve 0 = 15l - 11l - 32 for l. 8 Solve -2v + 40 = -12v for v. -4 Solve -33 = -4q - 17 for q. 4 Solve -167a = -165a for a. 0 Solve 14r = -21r + 140 for r. 4 Solve 6s + 0 = -6 for s. -1 Solve -16h = 8 + 72 for h. -5 Solve 29u = 28u - 2 for u. -2 Solve 0 = -10t + 35 - 15 for t. 2 Solve -77t + 31t - 184 = 0 for t. -4 Solve -27p + 28p = 6 for p. 6 Solve -23t + 3t = 100 for t. -5 Solve 226v - 14 = 224v for v. 7 Solve -6o = 30 - 66 for o. 6 Solve 0 = 3x + 2x + 15 for x. -3 Solve 8v - 4v - 4 = 0 for v. 1 Solve -3n - 20 = 2n for n. -4 Solve -o = 2o - 6 for o. 2 Solve 10 = -239i + 234i for i. -2 Solve -273 = 8a - 217 for a. -7 Solve 13o - 24 = -141 for o. -9 Solve 0 = -29y + 44y + 90 for y. -6 Solve 0 = 25w + 27 + 48 for w. -3 Solve -w + 28 = 13w for w. 2 Solve 0 = u - 6u - 25 for u. -5 Solve g = -0 - 5 for g. -5 Solve 0u = u - 5 for u. 5 Solve -5w + 19w = -42 for w. -3 Solve -9q = 20q + 87 for q. -3 Solve -118p = -112p for p. 0 Solve -6y - 20y = -5y for y. 0 Solve 94 = -2c + 86 for c. -4 Solve -306 = 31t - 492 for t. 6 Solve 4u - 5u = -3 for u. 3 Solve -9 = -34x + 59 for x. 2 Solve 20 + 28 = 24p for p. 2 Solve 15d - 19d = 20 for d. -5 Solve -6i = -33 + 39 for i. -1 Solve -4o = 8 - 24 for o. 4 Solve -161 = -70r + 609 for r. 11 Solve -10f + 30 = -4f for f. 5 Solve -66v - 45 = -51v for v. -3 Solve 13c + 23c = 288 for c. 8 Solve 8q - 4 = 4 for q. 1 Solve -262s = -271s - 45 for s. -5 Solve 3c = 2 - 2 for c. 0 Solve 0 = 12o + 1 + 11 for o. -1 Solve -a + 169 = 163 for a. 6 Solve -13q - 54 = -2 for q. -4 Solve -10 = 18r - 20r for r. 5 Solve -27c + 422 = 206 for c. 8 Solve 33l + 60 = 3l for l. -2 Solve 3r = -10r + 13 for r. 1 Solve 159c = 162c + 12 for c. -4 Solve 156 - 146 = -2n for n. -5 Solve 16q + 2 + 94 = 0 for q. -6 Solve 7c + 5 = -23 for c. -4 Solve -59f - 98 = 39f for f. -1 Solve -8 - 4 = 4t for t. -3 Solve -70l - 5 = -69l for l. -5 Solve 0 = -23x + 1017 - 948 for x. 3 Solve 39r - 12 = 35r for r. 3 Solve 5b - 165 = 38b for b. -5 Solve -20 + 10 = 2w for w. -5 Solve 0 = -12d - 8 - 76 for d. -7 Solve -60 = 201b - 191b for b. -6 Solve -12j = -3j + 36 for j. -4 Solve 1375z - 28 = 1368z for z. 4 Solve -4g + 6g = 4 for g. 2 Solve -4n - 7 = 13 for n. -5 Solve 42c + 20 = 47c for c. 4 Solve -18f - 35 = -25f for f. 5 Solve -6s - 43 + 49 = 0 for s. 1 Solve -22u = -83 + 17 for u. 3 Solve o + 48 = -11o for o. -4 Solve 4d - 29 + 21 = 0 for d. 2 Solve 23g + 17 = 63 for g. 2 Solve 0 = 6355a - 6349a + 6 for a. -1 Solve 558 = 8k + 526 for k. 4 Solve -5 - 11 = 8v for v. -2 Solve -8h + 25 = 9 for h. 2 Solve -3c + 54 = -21c for c. -3 Solve 0 = 8g - 2g + 30 for g. -5 Solve 5y = 662 - 667 for y. -1 Solve -64 + 82 = -6l for l. -3 Solve -3s = -5s + 8s for s. 0 Solve -32b + 76b - 264 = 0 for b. 6 Solve 0 = -4l - 170 + 178 for l. 2 Solve 15s = -381 + 291 for s. -6 Solve -9 + 3 = 3r for r. -2 Solve -9p + 35p - 26 = 0 for p. 1 Solve 10a - 20 = 5a for a. 4 Solve -33 = -k - 30 for k. 3 Solve -137s + 142s + 10 = 0 for s. -2 Solve 0 = 22s + 38 - 192 for s. 7 Solve 11a = 27 + 6 for a. 3 Solve -38d = 573 - 231 for d. -9 Solve 1027n = 1017n - 10 for n. -1 Solve 0 = 2h + 40h + 168 for h. -4 Solve 25 = 3l + 22 for l. 1 Solve -120j + 56 = -134j for j. -4 Solve 3h - 546 = -573 for h. -9 Solve 2g - 16 + 18 = 0 for g. -1 Solve -3z = -49 + 37 for z. 4 Solve 112q + 4q - 232 = 0 for q. 2 Solve -285 + 261 = -8m for m. 3 Solve 3 = -57v + 60v for v. 1 Solve -8b + 48 = 4b for b. 4 Solve -2x - 5x = -2x for x. 0 Solve 4 = x + 1 for x. 3 Solve 0 = 13l - 19l - 18 for l. -3 Solve 53k - 20 = 33 for k. 1 Solve 0 = -364t + 368t - 24 for t. 6 Solve -10w + 8w - 2 = 0 for w. -1 Solve 15n + 6 = -99 for n. -7 Solve -15s + 30 = 45 for s. -1 Solve -2l = 1 + 1 for l. -1 Solve -17t = -871 + 769 for t. 6 Solve -19o - 8 + 103 = 0 for o. 5 Solve 0 = 134q - 133q - 3 for q. 3 Solve -18 = m - 22 for m. 4 Solve -13i + 15i - 4 = 0 for i. 2 Solve 50 = 11u + 61 for u. -1 Solve -20b + 116 + 24 = 0 for b. 7 Solve 872 - 896 = 3b for b. -8 Solve 31c = -57c for c. 0 Solve 22h = 27h - 5 for h. 1 Solve -14r + 216 = 13r for r. 8 Solve 2c + 24 = -10c for c. -2 Solve 3b + 972 = -105b for b. -9 Solve 57n + 51 = 40n for n. -3 Solve -8k + 64 = 24 for k. 5 Solve 138q + 72 = 156q for q. 4 Solve -268k = -191k + 385 for k. -5 Solve 0 = 23b - 49b + 208 for b. 8 Solve -44a - 5a = -49 for a. 1 Solve -5 - 1 = 3f for f. -2 Solve 0 = 23v - 35v + 12 for v. 1 Solve -8 - 2 = 2s for s. -5 Solve -29 + 19 = -2r for r. 5 Solve 144f + 30 = 154f for f. 3 Solve 45k - 259 = -34 for k. 5 Solve 0 = 101q - 27 + 128 for q. -1 Solve 4 = -3k + 13 for k. 3 Solve -51i = -61i - 60 for i. -6 Solve -6m - 31 = -13 for m. -3 Solve 23o = -116 + 1 for o. -5 Solve 0 = -509k + 513k - 16 for k. 4 Solve 14m - 15 = 9m for m. 3 Solve 0 = -5u + 16u + 11 for u. -1 Solve 1220k - 1208k + 48 = 0 for k. -4 Solve 8 = 805o - 803o for o. 4 Solve 1125r = 1122r - 18 for r. -6 Solve 4g = 15g - 33 for g. 3 Solve 41s + 108 = 23s for s. -6 Solve -10 = 2c - 6 for c. -2 Solve -499l + 505l + 30 = 0 for l. -5 Solve -v + 0 - 3 = 0 for v. -3 Solve 2g + 31 - 33 = 0 for g. 1 Solve 21j - 84 + 0 = 0 for j. 4 Solve -13d - 10d = -5d for d. 0 Solve f - 51f + 200 = 0 for f. 4 Solve 11 - 56 = 15m for m. -3 Solve 3194u - 51 = 3211u for u. -3 Solve -6m - 17 = 7 for m. -4 Solve -11u + 12 - 1 = 0 for u. 1 Solve 43y = -48 + 177 for y. 3 Solve -336 = 3b - 330 for b. -2 Solve -19a - 28 = 29 for a. -3 Solve -389a + 370a - 76 = 0 for a. -4 Solve 78 = -99p + 86p for p. -6 Solve 3 = 1171o - 1172o for o. -3 Solve 41 = -27k - 67 for k. -4 Solve -47x = -45x - 4 for x. 2 Solve -5z - 79 = -44 for z. -7 Solve -4 = -109x + 111x for x. -2 Solve 12t = 19t - 14 for t. 2 Solve -19i = 16 - 130 for i. 6 Solve 3n = n + 10 for n. 5 Solve 18v - 27v = 18 for v. -2 Solve 224 = 28h - 56 for h. 10 Solve -2o = o + 3 for o. -1 Solve -20 = -8r + 3r for r. 4 Solve -92o + 76o - 128 = 0 for o. -8 Solve 0 = -24x + 60x + 108 for x. -3 Solve 183 = 36b + 111 for b. 2 Solve 30o + 24 = 18o for o. -2 Solve -10 = -29p + 34p for p. -2 Solve 0	{ "pile_set_name": "DM Mathematics" }
in 3 + 84509g2 - 84520g*2 - 1 - 2. -11g*2 Collect the terms in -46r + 29r + 74r + 14r. 71r Collect the terms in -w*3 + 109 + 242 - 7 - 137 + 3w*3. 2w*3 + 207 Collect the terms in 6564b - 3362b - 3309b. -107b Collect the terms in -3c*3 + 17c*3 - 308c + 308c. 14c*3 Collect the terms in 71f*3 + 350f*3 - 2f*2 + 601f*3. 1022f*3 - 2f*2 Collect the terms in -17434h*2 + 23 - 23. -17434h*2 Collect the terms in 1305f - 1305f + 1300f*3. 1300f*3 Collect the terms in -593i - 489i + 18i. -1064i Collect the terms in -8 + 10 - 2 + 3694w*3 - 3696w*3. -2w*3 Collect the terms in -36 - 71 + 107 - 315d*2. -315d*2 Collect the terms in 136h + 135h - 35h - 9h. 227h Collect the terms in -652 - 33v3 + 326 + 324. -33v*3 - 2 Collect the terms in 130j - 478j3 - 130j + 480j3 - 17 + 17. 2j*3 Collect the terms in 0q*2 - 11q*2 + 0q + 136 + 3q. -11q*2 + 3q + 136 Collect the terms in -366789i + 366789i - i2. -i2 Collect the terms in 318458b - 318458b - 24b2 + 21b*2. -3b*2 Collect the terms in 43u*2 + 0u*2 - 41u*2. 2u*2 Collect the terms in -34m*3 - 213 + 213. -34m*3 Collect the terms in -8d + 24d - 10d - 17d + 13d. 2d Collect the terms in -2k*3 + 4 - 1288k*2 - 4 + 6627k*2. -2k*3 + 5339k*2 Collect the terms in 23c - 7c + 15c + 14c - 52c + 6c. -c Collect the terms in -5x - 525 - 371 + 5x + 598 - 3x*2. -3x*2 - 298 Collect the terms in 15439739b*2 - 7719867b*2 - 7719869b*2. 3b*2 Collect the terms in 2525a - 7577a + 2a*2 + 2522a + 2530a. 2a*2 Collect the terms in -151v - 341v - 277v. -769v Collect the terms in 4m*2 + 9 - 9 - 22 + 7 + 11. 4m*2 - 4 Collect the terms in -15824m*3 - 15825m*3 + 47480m*3 - 15828m*3. 3m*3 Collect the terms in 4 - 1 - 843n + 1094n3 - 1093n3. n3 - 843n + 3 Collect the terms in 68 - 3v*3 - 177 + 109. -3v*3 Collect the terms in 15575c*2 + 15574c*2 - 31149c*2 - 2c3 + c3. -c*3 Collect the terms in -11604c*3 + 5799c*3 + 5792c*3. -13c*3 Collect the terms in -34 + 2p*2 + 114 - 47 - 23p*2 - 33. -21p*2 Collect the terms in -173a + 1 + 1 - 2 + 44a + 119a. -10a Collect the terms in 35b - 1487b2 - 1490b*2 - 35b + 2981b2. 4b*2 Collect the terms in -51v*2 - 2 - 3 + 18v*2 + 12v*2 + 15v*2. -6v*2 - 5 Collect the terms in -66z + 1461z2 + 1185z*2 + 65z - 1. 2646z2 - z - 1 Collect the terms in 163o - 59o - 9 + 102o. 206o - 9 Collect the terms in 457o*3 - 1849o*3 + 461o*3 + 456o*3 + 459o*3. -16o*3 Collect the terms in -276c + 11845 - 11845. -276c Collect the terms in 2 - 338y - 1801y - 4. -2139y - 2 Collect the terms in -61 - 67 + 128 - 591g3 - 185g*3. -776g*3 Collect the terms in 330 - 179 + 12q - 154. 12q - 3 Collect the terms in -12 - 17 - 79s + 37 + 26. -79s + 34 Collect the terms in 10r*2 - 10r*2 - 2r + 2r + 12r*3. 12r*3 Collect the terms in 57h - 131 - 2h3 + 0h*3 - 57h. -2h3 - 131 Collect the terms in -11h - 17h - 20h + 52h - 15h - 23h. -34h Collect the terms in -9786i2 + 108304i*2 + 35467i*2 + 32783i*2. 166768i*2 Collect the terms in 6 - 4035a - 6. -4035a Collect the terms in 8n*2 - 59n*2 + 3n*3 - n + 28n*2. 3n*3 - 23n*2 - n Collect the terms in 13p + 67p - 274p - 121p. -315p Collect the terms in 4566z2 + z - z - 35158z*2. -30592z*2 Collect the terms in 34 - 295a - 62 + 28. -295a Collect the terms in 31 - 14 - 11 - 28g*2 + 31g*2 - 6. 3g*2 Collect the terms in 0v + 81 - 3113v2 + 3122v*2 + 0v. 9v2 + 81 Collect the terms in -14133h - 14133h + 42230h - 13966h. -2h Collect the terms in 2b2 - 256800416b + 256800416b. 2b*2 Collect the terms in -20c - 504101c2 + 2c + 504100c2. -c2 - 18c Collect the terms in 0 + 4532d2 + 1 - 1. 4532d2 Collect the terms in -o2 + o*2 - 1219606o*3 + 1219609o*3. 3o*3 Collect the terms in -17c*3 - 1491 + 1491. -17c*3 Collect the terms in 9d - 7d - 1109 - 3d - 2d. -3d - 1109 Collect the terms in 3438u2 - 6799u*2 + 3457u*2. 96u*2 Collect the terms in 29 + 39l + 16l + 27l - 34. 82l - 5 Collect the terms in -76180v*2 + 4v*3 + 76180v*2. 4v*3 Collect the terms in -218q*2 - 40q*2 - 44q*2. -302q*2 Collect the terms in -18 - 25995d + 13002d + 12995d + 18. 2d Collect the terms in 670d - 1005d + 364d. 29d Collect the terms in -25476m - 25470m + 50946m - 3m3. -3m*3 Collect the terms in 16 - 308s*3 + 310s*3 + 6. 2s*3 + 22 Collect the terms in -699v*2 + 6 - 8 + 2. -699v*2 Collect the terms in 8450u*3 + 8453u*3 - 16919u*3. -16u*3 Collect the terms in 20t - 58t + 23t + 22t. 7t Collect the terms in 11673f + 27f*3 - 3886f - 3895f - 3892f. 27f3 Collect the terms in 196f*2 - 83f*2 - 21f*3 + 7f*3 + 1 - 113f*2. -14f*3 + 1 Collect the terms in -1058 + 507 + 551 + 145p + p2. p2 + 145p Collect the terms in -273f*2 + 435f*2 - 83f*2 - 77f*2. 2f*2 Collect the terms in 49q + 152q - 196q. 5q Collect the terms in 617d*3 + 993d*3 + 29d*3 + 776d*3. 2415d*3 Collect the terms in -827h*3 - 174h*3 - 1256h*3. -2257h*3 Collect the terms in -44m*3 - 2m - 1192m3 + 6m + 7m3 + 0m. -1229m3 + 4m Collect the terms in -227 + 114 + 113 - 6u3 + 9u*3. 3u*3 Collect the terms in -6v + 10v - 2v + 221 - 110 - 111. 2v Collect the terms in -8r*2 + 244682r - 244682r. -8r*2 Collect the terms in 4774 + 3j*3 + 4810 - 9584 - 4j3. -j3 Collect the terms in 179d + 120d - 104d. 195d Collect the terms in 5h - 2205 + 1197 + 1114. 5h + 106 Collect the terms in -52x + 6x*3 + 11x*3 + 55x. 17x3 + 3x Collect the terms in 6a + 17 - 17 - 487a*2. -487a*2 + 6a Collect the terms in -14440x2 - 14450x*2 + 26x*3 + 3 + 28890x*2 - 75x*3. -49x*3 + 3 Collect the terms in 6 + 0 - 2 - 3848p - 1172p. -5020p + 4 Collect the terms in w + 9w - 9w - w + 10w2. 10w*2 Collect the terms in -2p*2 - 4301345p*3 + 2p*2 + 4301328p*3. -17p*3 Collect the terms in -5f - 182f2 - 195f*2 + 11f - 9f. -377f*2 - 3f Collect the terms in -21 + 104h3 - 18 - 96h*3 + 39. 8h*3 Collect the terms in 898271 + 3g - 4g - 3g - 5g - 898272. -9g - 1 Collect the terms in 1631p2 + 291p*2 - 2 - 362p*2 + 2. 1560p*2 Collect the terms in 1424b*2 + 1427b*2 + 1429b*2 - 4266b*2. 14b*2 Collect the terms in 11u + 408u3 - 795u*3 + 390u*3 + 33u. 3u3 + 44u Collect the terms in 2585l - 5175l + 2593l. 3l Collect the terms in -17409 + 17409 + 769y. 769y Collect the terms in 36w3 + 117w*2 - 38w*3 - 366w*2. -2w*3 - 249w*2 Collect the terms in -49i*3 + 39i*3 - i + 15i - 14i + 44i*3. 34i*3 Collect the terms in -8 + 0 - 1 - 7 - 3 - 5q. -5q - 19 Collect the terms in 0p3 + p3 + 4p2 + 2p*3. 3p*3 + 4p*2 Collect the terms in -4389296968a + a*2 + 4389296968a. a*2 Collect the terms in 2n + 35100 - 35100. 2n Collect the terms in 7 - 7b*2 + 25 - 30. -7b*2 + 2 Collect the terms in 56 + 8955u*3 - 56. 8955u*3 Collect the terms in -103 + 6l*2 - 2l + 1761 - 4l2. 2l*2 - 2l + 1658 Collect the terms in -44h3 + 261h*3 + 119h*3. 336h*3 Collect the terms in -h - 5489h*2 + 551h*2 - 3923h*2. -8861h*2 - h Collect the terms in 824i + 10 - 1662i + 834i. -4i + 10 Collect the terms in 6z - 4z2 + 6z*2 - 7z*2 - 5z*2 - 4z*2. -14z*2 + 6z Collect the terms in 64494o + 64494o + 64495o + 64501o - 257988o. -4o Collect the terms in -10k3 + 19k*3 - 13k*2 + 1 + 1 + 30k*3. 39k*3 - 13k*2 + 2 Collect the terms in -780b + 51b2 + 389b + 390b + 7b*2. 58b*2 - b Collect the terms in 1126v*2 + 909v*2 - 1 + 1 - 1618v*2. 417v*2 Collect the terms in -1125k*2 + 3324k*2 - 6k*3 - 1123k*2 - 1076k*2. -6k*3 Collect the terms in 440 - 155 - 147 - 27z - 138. -27z Collect the terms in 10v + v*3 + 10v - 44555 + 44555. v*3 + 20v Collect the terms in -7 - 2 + 2i + i2 - 2i. i2 - 9 Collect the terms in -z3 + z*3 - 872z*2 + 247z*2 + 3z*3. 3z*3 - 625z*2 Collect the terms in 4m*3 + 2m*3 - 35	{ "pile_set_name": "DM Mathematics" }
second derivative of m*6/10 - 369m*5/5 - 987m*4/4 - 247m*3 - 12m + 66. Factor p(k). 3k(k - 494)(k + 1)2 Solve -2592/5a*2 + 0a - 36/5a4 - 756/5a*3 + 0 + 3/5a5 = 0. -6, 0, 24 Let c(f) be the third derivative of f5/240 - 23f4/96 + 21f*3/4 - 634f*2. Factor c(o). (o - 14)(o - 9)/4 Suppose -269 = -7m - 262. Suppose -10z + m + 29 = 0. Factor -1/2v2 + 0v + 0 + 1/2vz. v2(v - 1)/2 Let w = 52771 - 369394/7. Factor 0 + 3p3 + 27/7p + 45/7p2 + wp*4. 3p(p + 1)(p + 3)*2/7 Factor 20/3t*2 + 2/3t*3 + 14/3t - 12. 2(t - 1)(t + 2)(t + 9)/3 Suppose -145u*3 - 9 - 6u - 126u3 - 3u*2 + 232u*3 + 45u + 12u4 = 0. Calculate u. -1, 1/4, 1, 3 Let r(t) = 3t*3 + 3 + 11t*3 - 5t - 12t3. Let l(s) = 10s*3 - 24s + 14. Let y(g) = -3l(g) + 14r(g). Let y(v) = 0. What is v? -1, 0, 1 Factor -39 + 14a - 1/3a*2. -(a - 39)(a - 3)/3 Let z(o) = 13o4 + 123o*3 + 488o*2 + 523o - 10. Let t(d) = 84d4 + 800d*3 + 3172d*2 + 3400d - 64. Let h(n) = 5t(n) - 32z(n). Factor h(l). 4l(l + 2)(l + 3)(l + 11) Suppose -84d - 98 - 27/2d*4 + 167/2d*3 + 223/2d*2 + 1/2d*5 = 0. What is d? -1, 1, 14 Suppose 14x - 170 - 194 = 0. Solve -xb + 8b - 16b4 + 12b*3 + 68b*2 - 30b - 16 = 0. -2, -1/4, 1, 2 Let z = 47607 - 333246/7. Factor 9/7h - zh*2 - 6/7. -3(h - 2)(h - 1)/7 What is s in 42 + 69/4s + 3/2s2 = 0? -8, -7/2 Determine o so that 48/5o*3 + 0 + 0o*2 + 0o + 2/5o5 - 28/5o*4 = 0. 0, 2, 12 Let b be (2 - (-120)/(-225)6)-2. Determine o so that -90o*5 - bo*3 + 0 + 0o - 12/5o2 + 57o*4 = 0. -1/6, 0, 2/5 Let l = 650 - 641. Factor 17a - 6a - la + 2a2. 2a(a + 1) Let w(g) be the second derivative of g4/30 - 5g*3/3 + 114g*2/5 + 41g + 26. Factor w(l). 2(l - 19)(l - 6)/5 Let f(r) be the first derivative of -r*6/8 - 93r*5/20 - 549r*4/16 + 991r*3/4 + 561r*2/2 - 2601r + 2449. Solve f(x) = 0 for x. -17, -2, 2, 3 Let t = 336 - 216. Let p be (3 + -2)/1 + (-30)/t. Let -15/4c - 15/2c*3 - pc*5 + 15/2c*2 + 15/4c*4 + 3/4 = 0. Calculate c. 1 Let d(r) be the second derivative of 1 + 11/2r*3 + 1/4r*4 + 7r - 18r2. Determine m so that d(m) = 0. -12, 1 Let q(n) = 9n*5 + 437n*4 + 152n*3 - 11n*2 + 11. Let o(x) = 3x*5 + 146x*4 + 51x*3 - 4x*2 + 4. Let k(g) = 11o(g) - 4q(g). Solve k(i) = 0 for i. -47, -1/3, 0 Let r(o) = -o4 + o2 - o. Suppose 0l - 33l = -132. Let g(j) = 8j*4 + 8j*3 - 8j*2 - 4j. Let b(z) = lr(z) + g(z). Suppose b(t) = 0. Calculate t. -2, -1, 0, 1 Let t(r) = -r3 + r2 + 2r - 3. Let q be t(0). Let v be (0/q)/(0 - 2). Find u such that vu3 - u3 - 4u + 0u2 + 5u*2 = 0. 0, 1, 4 Let t(s) be the first derivative of 1323/2s + 229 - 41/2s3 - 1197/4s*2 - 3/8s*4. Factor t(w). -3(w - 1)(w + 21)2/2 Let o(c) = c2 - 7c - 8. Suppose 0 = -x - 2 + 3. Let f(t) = -t*2 - t. Let m(d) = xo(d) + 2f(d). Suppose m(h) = 0. Calculate h. -8, -1 Let k(t) be the second derivative of -t4/3 - 724t*3 - 589698t*2 - 630t + 1. Factor k(b). -4(b + 543)2 Let t(h) be the second derivative of h7/189 + 8h*6/27 + 397h*5/90 - 61h*4/27 - 1280h*3/27 - 800h*2/9 - 426h. Solve t(p) = 0. -20, -1, 2 Solve -1/4h2 + 201/4 + 16h = 0 for h. -3, 67 Let m = 873207929/546 + -1599281. Let a = m - 5/78. Solve 0 - an3 + 9/7n*2 - 4/7n + 1/7n4 = 0. 0, 1, 4 Let k be 5 - (-3)/(-4)4. Suppose -4 = -2x - l, l + 7 = 3x + kl. Solve 1/6a*x + 1/6 - 1/6a*2 - 1/6a = 0 for a. -1, 1 Let j(n) = -n*4 - 2n3 + n2 - 2n. Let h(w) = -7w*4 - 2w*3 - 21w*2 + 6w. Let y(x) = h(x) - 6j(x). Factor y(d). -d(d - 6)(d - 3)(d - 1) Factor -68r + 5r + 116r + 91r - 180r2 + 4r*4 + 32r*3. 4r(r - 3)(r - 1)(r + 12) Let a(u) be the third derivative of 4u*5/15 - 193u*4/6 - 98u*3 - 26u*2. What is v in a(v) = 0? -3/4, 49 Suppose 27b + 24b = 255. Suppose 2a = -by, 13a = 12a - 4y. Solve -6q + 14q*2 + a + 2q*4 + 34/3q*3 = 0 for q. -3, 0, 1/3 Let r(p) be the first derivative of 1/4p*6 + 3/20p*5 + 14p + 20 + 0p4 + 0p*2 + 0p*3. Let j(w) be the first derivative of r(w). Solve j(c) = 0. -2/5, 0 Let l(r) be the second derivative of -19r*4/24 + 667r*3/12 - 35r*2/2 - 1925r. Let l(g) = 0. Calculate g. 2/19, 35 Let o = 905/2 - 4521/10. Find k, given that 6/5k2 - 4/5k + 0 - ok3 = 0. 0, 1, 2 Factor 80/3 - l3 + 92/3l + 20/3l2. -(l - 10)(l + 2)(3l + 4)/3 Let m(f) be the first derivative of 50f + 54 - 5/3f*3 + 15/2f*2. Factor m(o). -5(o - 5)(o + 2) Let p(f) = -f3 - 7f*2 - 4f + 14. Let g be p(-6). Factor -4t4 + 18t + 76t3 - 8t*4 - 13t*3 - 87t*g. -3t(t - 3)(t - 2)(4t - 1) Determine i so that 2i4 - 6i*3 + 6i*4 - 132i + 2i5 - 72i*2 - 165i + 225i - 4i*3 = 0. -3, -2, 0, 3 Let x = -11952/161 + 1714/23. Determine m so that -xm*5 - 10/7m*3 + 4/7m*2 + 0 + 8/7m*4 + 0m = 0. 0, 1, 2 Let b(y) = -y*3 - 152y*2 + 121y - 4896. Let g be b(-153). Suppose -6p - 1/2p*2 + g = 0. Calculate p. -12, 0 Let k(g) be the third derivative of 0g + 1/9g3 + 1/540g*6 + 77g*2 + 7/108g*4 + 0 + 1/54g*5. Find f such that k(f) = 0. -3, -1 Let p(d) = 99d*2 + 5d - 4. Let s be p(1). Suppose 47q4 - 52q*4 + 2q*3 + q - s + 19q + 8q3 + 75q*2 = 0. What is q? -2, 1, 5 Solve -609d*2 + 3d*4 - 41334d + 14d3 + 41037d + 606 + 283d3 = 0. -101, -1, 1, 2 Let w(r) = -r2 + 16r - 6. Let m = 180 + -183. Let q(d) = -d*2 + 15d - 8. Let p(i) = mq(i) + 4w(i). Suppose p(b) = 0. What is b? 0, 19 Let a = -225444 - -225444. Suppose -2/3k2 + a - 4/3k*3 - 2/3k*4 + 0k = 0. What is k? -1, 0 Factor -10222y2 - 165 + 5113y*2 + 38y + 5108y2. -(y - 33)(y - 5) Let d be 2 + 5 + -1 - 2. Suppose -dv + j = -13, -32v - 4j - 30 = -37v. Suppose 24 + 3/8mv + 6m = 0. What is m? -8 Let s be (720/(-480))/((-126)/36). Let i be (3 - 2)41. Factor 1/7a2 + 3/7a*3 - sa + 1/7ai - 2/7. (a - 1)(a + 1)*2(a + 2)/7 Let d(o) = -18o4 - 42o*3 - 18o*2 + 122o + 84. Let t(q) = 7q4 + 14q*3 + 6q*2 - 41q - 28. Let h(n) = 3d(n) + 8t(n). Factor h(f). 2(f - 7)(f - 2)(f + 1)2 Let v = 3484/3975 + 1047/1325. Find z, given that -130/3z + 0 - vz2 = 0. -26, 0 Factor 0i - 123/2i2 + 0 - 1/4i3. -i2(i + 246)/4 Factor 273x*2 + 108x*3 - 384 + 5x + 4x4 + 7x + 374x2 - 359x*2 - 28x. 4(x - 1)(x + 2)*2(x + 24) Let h be 6/(-81)51440/(-768). Let n(d) be the second derivative of -hd3 - 5/4d*2 - 5/72d*4 + 1/24d*5 + 31d + 0. Suppose n(c) = 0. Calculate c. -1, 3 Let o(g) be the third derivative of -g8/672 + g7/42 - g6/16 - g5/12 + g*4/3 - 2341g*2. Suppose o(c) = 0. What is c? -1, 0, 1, 2, 8 Suppose -3w - w = 36. Let x(a) = -a*3 - 9a*2 - 2a - 16. Let l be x(w). Factor 8 - 3g3 + 3g*3 + 11g*3 - 8g*l - 4g - 7g3. 4(g - 2)(g - 1)(g + 1) Let c(u) be the first derivative of -1/4u3 - 65 + 9u - 3/8u2. What is n in c(n) = 0? -4, 3 Let i = 5063 - 10125/2. Let z(o) be the first derivative of -io*2 + 1/4o*3 + 15 - o. Factor z(l). (l - 2)(3l + 2)/4 Let u(d) = -d4 + 44d3 + d2 - 44d + 108. Let w(i) = i4 - 89i3 - i2 + 89i - 198. Let p(x) = -11u(x) - 6w(x). Determine s so that p(s) = 0. -10, -1, 0, 1 Let i = 4/35 - -58/105. Let t be -23(-62)/1173 + -41/(-34). Solve tf*2 + if - 4/3 - 2/3f3 = 0. -1, 1, 2 Let c(r) = 4r*2 + 7r + 3. Let v be c(6). Suppose 72 = 2u - 5n + 15, 3n - v = -5u. Factor ua2 - 300a*3 + 272a*3 + 136a*3 + 3a. 3a(6a + 1)2 Suppose 0 = 66y - 72y + 480. Factor 2074 - 4i*3 - 6170 - 102i*2 - 41i*2 - yi*2 - 37i*2 - 4352i. -4(i + 1)(i + 32)*2 Let h be 51/21 + (7 - (-90)/(-14)). Factor -6u*2 - 2564 + 2564 + 3u*h. 3u*2(u - 2) Let -26/15q - 2/15q*2 - 44/15 = 0. What is q? -11, -2 Let r be (-2 - 2) + -6 + 4. Let s be (-3)/r - (-5 + 5). Suppose -1/2j*2 - 3/2 + 5/2j - sj3 = 0. Calculate j. -3, 1 Let o be (8/(-5))/(-12/40). Let r(t) = -t + 2. Let n be r(-5). Factor 49h2 - oh*2 + 1 + n + 2h*3 - 23h*2. 2(h - 2)*2(h + 1) Let c(h) = -11h3 + 2705h*2 - 367200h + 364686. Let j(n) = -n*3 + 31. Let w(l) = c(l) - 6j(l). Factor w(i). -5(i - 270)2(i - 1	{ "pile_set_name": "DM Mathematics" }
t is -1263 divided by 3? -421 Divide 81 by 3. 27 Divide 4052 by 5. 4052/5 What is 8614 divided by 59? 146 693 divided by 9 77 -196380 divided by 4 -49095 Divide 243 by 5. 243/5 Divide -5193 by -4. 5193/4 -1 divided by 317 -1/317 12 divided by -37 -12/37 What is 55 divided by -1? -55 What is 760 divided by -2? -380 What is 0 divided by 50? 0 Calculate -8 divided by -35. 8/35 Divide -1 by -12. 1/12 -865 divided by -4 865/4 Divide 4498 by 13. 346 What is 45 divided by -6? -15/2 What is -15 divided by 85? -3/17 2770 divided by 5 554 What is 45 divided by 10? 9/2 Divide 6 by -36. -1/6 Divide 16 by 202. 8/101 Calculate 249 divided by -4. -249/4 Divide 2550 by -510. -5 What is -7 divided by -203? 1/29 What is 442 divided by 17? 26 Calculate -9824 divided by 5. -9824/5 Calculate 996 divided by 4. 249 1364 divided by 341 4 Calculate -15 divided by -8. 15/8 Calculate 10870 divided by -2174. -5 Divide -1448 by 8. -181 What is 11326 divided by 1? 11326 Calculate 5 divided by 2967. 5/2967 Calculate 52 divided by 2. 26 Calculate -2814 divided by -1. 2814 Calculate 84628 divided by -4. -21157 What is 696 divided by -87? -8 Calculate -56 divided by -2. 28 What is 472 divided by -2? -236 Divide -203 by 6. -203/6 Divide 2182 by 5. 2182/5 Divide -4120 by 5. -824 0 divided by -1528 0 What is 14 divided by 12? 7/6 Divide 27 by 11. 27/11 What is -3 divided by 233? -3/233 -459 divided by 3 -153 -28 divided by 2 -14 104 divided by -13 -8 Calculate -15912 divided by 117. -136 Divide -8853 by -1. 8853 Divide -11 by -2. 11/2 2 divided by -77 -2/77 Divide -308 by 5. -308/5 What is -276 divided by 69? -4 What is 3747 divided by -3747? -1 Divide 6583 by 3. 6583/3 Divide -912 by 6. -152 -6955 divided by -65 107 What is 25700 divided by 5? 5140 What is -3 divided by 53? -3/53 Calculate 2634 divided by -439. -6 What is 1197 divided by 3? 399 -2610 divided by 58 -45 What is 12960 divided by -3240? -4 What is -12 divided by -4? 3 Calculate -337 divided by 10. -337/10 Calculate 1 divided by -307. -1/307 Divide 324 by 6. 54 What is 454 divided by 1? 454 -252 divided by 6 -42 Divide 23 by -23. -1 3526 divided by 6 1763/3 Divide 39 by 669. 13/223 -640 divided by -5 128 What is 3 divided by 47? 3/47 705 divided by -47 -15 Calculate 12026 divided by 7. 1718 Calculate 1357 divided by 3. 1357/3 -19731 divided by 5 -19731/5 75815 divided by -5 -15163 What is -20 divided by -20? 1 Divide 0 by 833. 0 Calculate 353 divided by -8. -353/8 What is 8 divided by 1628? 2/407 326 divided by -1 -326 Calculate -230 divided by -2. 115 635 divided by -3 -635/3 What is -2 divided by -44? 1/22 Calculate 4 divided by 469. 4/469 0 divided by -2772 0 -4 divided by 239 -4/239 Calculate 20 divided by -1. -20 Divide 19910 by 55. 362 Calculate 4849 divided by -4. -4849/4 -16 divided by 2 -8 What is -21575 divided by -4315? 5 Calculate -2949 divided by 6. -983/2 Calculate 2810 divided by -281. -10 Divide 401 by 6. 401/6 Divide 2 by -9. -2/9 Divide 90 by 5. 18 -4094 divided by 2 -2047 -27 divided by 107 -27/107 Calculate 392 divided by 98. 4 -994 divided by 4 -497/2 1877 divided by 3 1877/3 Divide -30 by -111. 10/37 What is 4104 divided by 18? 228 What is -5992 divided by -1498? 4 Calculate -35 divided by 19. -35/19 Divide -23144 by -6. 11572/3 -478 divided by 5 -478/5 Divide 106 by -133. -106/133 Divide -11670 by 4. -5835/2 What is -1114 divided by 557? -2 Calculate -10 divided by -15. 2/3 Divide -1 by -5622. 1/5622 Divide -10 by -18. 5/9 Divide 3 by -569. -3/569 -2936 divided by 5 -2936/5 Divide -2 by 33. -2/33 Divide 128 by 32. 4 Divide 30 by 5. 6 What is 2349 divided by 3? 783 What is 1626 divided by -6? -271 Calculate 6726 divided by -2242. -3 Divide -221 by 85. -13/5 0 divided by 425 0 Divide 3 by 404. 3/404 Divide 1099 by -2. -1099/2 14620 divided by 4 3655 What is 27 divided by -221? -27/221 -8 divided by 2200 -1/275 Calculate -8 divided by 10. -4/5 What is -400 divided by 5? -80 What is -309 divided by 3? -103 Calculate -14793 divided by -3. 4931 What is -1230 divided by -6? 205 Calculate 0 divided by -263. 0 Divide 18 by 2. 9 Calculate 784 divided by 4. 196 What is 3692 divided by -52? -71 248 divided by -62 -4 What is -3 divided by 1325? -3/1325 Calculate 564 divided by 1. 564 15 divided by -38 -15/38 What is 1 divided by 193? 1/193 Divide 0 by -44. 0 What is 0 divided by 58? 0 -3 divided by 961 -3/961 What is 4 divided by -56? -1/14 Divide -116 by 65. -116/65 -5 divided by 7 -5/7 19494 divided by -27 -722 Calculate 100 divided by -100. -1 What is 0 divided by -16? 0 What is -2505 divided by -2505? 1 Divide -210 by -6. 35 Divide -157 by -6. 157/6 Calculate -5 divided by -2101. 5/2101 What is 13365 divided by 2673? 5 Calculate 105 divided by -21. -5 -31 divided by -5 31/5 Divide -1252 by 313. -4 What is 2 divided by -3446? -1/1723 726 divided by 33 22 Divide 79 by -6. -79/6 -80 divided by -5 16 What is 13 divided by -80? -13/80 -18192 divided by -2 9096 Calculate -164 divided by 4. -41 What is -376 divided by 5? -376/5 3 divided by -1344 -1/448 10 divided by -122 -5/61 What is 21004 divided by 2? 10502 0 divided by -1758 0 Calculate -11 divided by 207. -11/207 Divide 400 by 2. 200 Divide -50 by -46. 25/23 Calculate -210 divided by -6. 35 What is -2 divided by 549? -2/549 Divide -10604 by 482. -22 Calculate -2 divided by -595. 2/595 195 divided by -12 -65/4 Divide 185 by 37. 5 What is -2892 divided by 2? -1446 Calculate -312 divided by -78. 4 Divide 5 by -372. -5/372 What is 3640 divided by -728? -5 65 divided by 278 65/278 Divide -44 by -40. 11/10 Calculate -832 divided by 32. -26 Divide 132 by 33. 4 1523 divided by 1 1523 -248 divided by 4 -62 208 divided by 39 16/3 -134 divided by 3 -134/3 Divide -1285 by 5. -257 What is 11163 divided by -61? -183 What is -472 divided by 2? -236 What is 810 divided by 162? 5 What is 4 divided by -1441? -4/1441 Divide 33904 by 26. 1304 What is -571 divided by -17? 571/17 Calculate -3135 divided by -55. 57 -344 divided by -4 86 1004 divided by -251 -4 What is -1 divided by -93? 1/93 -22 divided by 129 -22/129 What is -2324 divided by 581? -4 What is 0 divided by 11? 0 Calculate 280 divided by -40. -7 Calculate -5112 divided by 1278. -4 What is 6220 divided by 1555? 4 Calculate -7320 divided by -8. 915 Calculate -424 divided by 424. -1 Calculate 246 divided by -32. -123/16 Divide -4374 by 1458. -3 What is -1 divided by 598? -1/598 2355 divided by 471 5 199 divided by 12 199/12 Divide -2 by 63. -2/63 What is -462 divided by 1? -462 2 divided by 26 1/13 -292 divided by -3 292/3 -109 divided by 4 -109/4 What is 2241 divided by -3? -747 5 divided by -18 -5/18 Calculate -3428 divided by 4. -857 Divide -56 by 3. -56/3 Calculate -13064 divided by 4. -3266 -444 divided by -6 74 -5373 divided by 3 -1791 Calculate 6472 divided by -3236. -2 3 divided by -1435 -3/1435 What is 565 divided by -11? -565/11 2188 divided by -4 -547 What is -2910 divided by 3? -970 -25650 divided by -570 45 Divide -18 by 6. -3 -29 divided by 4 -29/4 What is -6042 divided by -2? 3021 Calculate -306 divided by -102. 3 Calculate 251 divided by -1. -251 Calculate 202 divided by -101. -2 Divide 590 by 3. 590/3 Calculate 2992 divided by -272. -11 Divide -9360 by 208. -45 -3 divided by 59 -3/59 Divide -1707 by -3. 569 Calculate 3990 divided by -95. -42 -172 divided by -4 43 Divide -7851 by 3. -2617 Divide 148 by 5. 148/5 21300 divided by 7100 3 Calculate 21426 divided by -6. -3571 Calculate -7 divided by 1132. -7/1132 -80 divided by -3 80/3 -184 divided by -92 2 Calculate 77 divided by 16. 77/16 Divide -95 by -5. 19 Calculate 79 divided by 1. 79 Divide 64 by 16. 4 Divide -15645 by -149. 105 Divide 84 by 7. 12 Divide 7 by -2. -7/2 5 divided by -541 -5/541 Calculate 5 divided by 12. 5/12 Calculate -3 divided by 407. -3/407 What is -6 divided by -78? 1/13 What is -320 divided by -1? 320 Calculate -180 divided by 13. -180/13 Divide -115 by 47. -115/47 Divide 2 by -11. -2/11 Calculate -189 divided by -8. 189/8 Calculate -24144 divided by -2012. 12 5 divided by -155 -1/31 What is 3 divided by 117? 1/39 Calculate 51 divided by 8. 51/8 35 divided by -177 -35/177 Calculate 1 divided by -658. -1/658 Calculate 9 divided by 5. 9/5 What is -4 divided by 19? -4/19 What is -940 divided by -2? 470 Calculate -3032 divided	{ "pile_set_name": "DM Mathematics" }
e 294/15(-590000)/82600. -140 Evaluate (-252)/2520(-52)/2. 13/5 Evaluate -1690(-25)/(-675)2. -40 (-4)/6216/96010(-40)/(-3) -20 Evaluate -98/127851/(-68). 3/71 What is the value of ((18/12)/(210/(-80)))/(198/11)? -2/63 Evaluate (((-2)/3-3)/(530/53))/((-6)/15). -1/2 What is the value of (-45)/(-75)(-352335)/(-2547)? 83 Evaluate (-69)/(-598)-16918/3. -117 Calculate 9/4(4/85)/((-894)/745). -3/34 What is the value of (18/(-5))/(-3)(-149)/((-22946)/(-3465))? -27 9/(-8)(-21904)/13690 9/5 Calculate ((-11118)/(-102))/(-327)(-138)/(-8). -23/4 What is the value of 1125/(-225)5/(-250)-1220/27? -8/9 What is (9/(-33))/(114/(-355718)111)? 23/3 Calculate (-12474)/(-31185)450/(-2). -90 Calculate 14/(-16)((-8)/(-140))/(32/8960). -14 What is 130/(-13)(123/(-15))/(-7(-9)/(-63))? -82 (-6(-132)/(-198)(-18)/(-16))/((-510)/(-10)) -3/34 (-432)/48((-28)/(-168))/((-111)/4) 2/37 Evaluate 190/2438808/3234. 95 What is (-6)/21(-144)/6(-2163)/309? -48 (10452/(-260))/(-67)15/(-36) -1/4 Calculate (((-484)/99)/22)/(595/(-9639)). 18/5 (-455/675)/(((-3)/21)/((-6)/38)) -7/19 What is ((3/6)/1)/((-20655)/(-16524))? 2/5 Calculate (-855)/(-2)(-744)/(-5580). 57 ((-4)/82)/((-3150)/(-21525)) -1/3 Calculate ((276(-30)/(-80))/3)/(48/96). 69 (-2700)/400120/45 -18 What is (402/402)/((-3)/177)1-1? 59 Evaluate 1/(-3860)(-372100)/18605. 1/193 ((-1323)/634/((-20)/3))/((-1035)/(-3450)) 42 25111/20350011 3/20 Calculate ((6/(-21))/(-24(-28)/588))/(15/8). -2/15 Calculate -85195/221001/129-2. 1/86 Calculate 6/18(9/(-93))/1. -1/31 What is (25788/10745)/(4/5106)? 51 What is the value of (208/(-832))/(210/25608)? -8/21 (-2(-1)/462)/(28/490025) 1/33 (-1)/(-1)(10/(-90)3)/(24/5688) -79 What is the value of ((-24)/(-84))/((256/(-4648))/8)12/6? -83 What is ((-3)/(-62))/(-1)(-14808)/(-11106)? -2/31 Calculate -9((-26)/72-3)/(1164/(-1552)). 13 What is (-2)/(-5)(60/(-78))/(672/(-416))? 4/21 (((-6960)/(-72))/29)/(-10)156 -30 Evaluate (-1)/211350/(-1075)-43. -18/7 Evaluate ((-41)/((-4593681)/844))/((-2)/3). -2/177 Calculate ((-22752)/216)/((2484/81)/23). -79 What is the value of (5/((-675)/12))/(28/672-112)? 2/105 (8/(-85))/(((-131)/((-5109)/(-52)))/((-60)/9)) -8/17 Evaluate (-3(-49)/18708/(-3304))/(16/(-448)). 49 Evaluate ((-48)/2880-20)/((-8)/60-4). 5/8 (154/1657)/((-2)/(1/(6/(-15)))) 49/6 What is the value of 3/(-12)-1((-42484)/13)/19? -43 Calculate (-4716)/(-4716)2/(1(-1)/(-6)). 12 Calculate (68/102)/((-14)/(-162))14/4. 27 Evaluate (-67)/(-1206)-1871. -71 (-1)/(-5)(-235675)/65989 -5/7 What is ((-21384)/7776)/(2/8)? -11 ((15/(-45))/(-1)8/(-12))/(-4) 1/18 What is (-357)/6(-752)/3196? 14 Evaluate 665/(-4655)(-1)/(2/(-2)). -1/7 Calculate (21/((-504)/60))/((-4)/10(-90)/(-264)). 55/3 What is (4/(-8))/((-562)/14612)? 13 Calculate ((-3)/(-636))/(1598/6392). 1/53 What is (-59/(-30))/((10/35)/((-60)/(-7)))? 45 Calculate ((-124)/(2480/75))/((-300)/3). 3/80 Calculate 93/213(-10)/(-30)(-14)/(-21). 2/71 What is (5(-1)/2)/(16495/79176)? -12 What is (19/(5643/(-18)))/((-249)/(-1826))? -4/9 What is (34032/9926)/((-3)/(-28))? 32 What is the value of ((516/16)/3)/(((-1947)/33)/236)? -43 ((-24)/393913/602)/(4/(-67)) 67 (19/(627/6)15)/((48/(-33))/(-2)) 15/4 What is the value of (-9)/((-54)/4)162/(-27)(-20)/5? 16 (39/(-78))/((-2)/(-18))(-80)/198 20/11 What is the value of 18(-2)/5(-960)/(-144)? -48 ((-45)/6)/34116/490 -21 ((-57)/15)/(31(-19)/(-2945)) -19 Calculate ((-2850)/19)/220/50. -30 Evaluate (270/(-29970))/(28/518). -1/6 (-27(-15)/405)/(14(-35)/(-84)) 6/35 What is 105/1557520475/6? 23/2 Evaluate (-2918/(-2346))/((-14)/(-161)). 9 What is the value of ((-56)/(-20)(-4380)/(-37814))/(-3)? -4/37 What is 6/(((-3568)/(-6690))/((4/(-6))/1))? -15/2 What is ((-2)/2)/(39/(-90)(-107)/1391)? -30 What is ((-6)/(-27)93)/(177952/(-66732))? -31/4 Evaluate 3751/(-31)520/520. -121 Evaluate -136/(-30)-51. -13 What is ((-63)/12)/(((-15)/36)/((-515)/(-309)))? 21 Calculate ((-21)/((-378)/(-6)))/(49/1473/(-141)). 47 What is the value of (2/(-6))/(((-9779)/10626)/(-127))? -46 (((-10)/32)/((-360)/192))/((-3)/144) -8 What is (29/((-174)/180))/((-29)/((-725)/(-25)))? 30 What is (-294)/11544462-57? 9 ((-450475)/(-740))/(-487)4/(-430)6 3/43 What is the value of ((8/(192/18))/42)/((-23)/(-92)-7)? -1/98 What is (-10)/(-8)38/4560-144? -3/2 Calculate 3/(-5)2465145/7395. -29 Evaluate ((-4284)/(-765))/28(-1)/12. -2/5 Calculate 1591/((-2730)/24). -12 Evaluate (14/49)/(66/(-5775)). -25 (-356)/((-67)/107264) 89 What is (391/(116127/5742))/((-4)/6)? -29 What is (-33)/(-2475)-25((-117)/132)/13? 1/44 What is the value of (-16(-41)/(-3444))/2? -2/21 What is the value of (-10)/(31820/(-43))-37? -1/2 What is the value of 2/(-2639/6084)? -12 Calculate 79912/31394(-22)/(-21). 8/3 What is -48870/334088/265? -2/53 (-24)/((-624)/13)3/(3/(-44)) -22 What is the value of ((-100)/125)/((-137)/685)? 4 What is (-220(-266)/(-51205))/((-1)/(-42))? -48 What is the value of (-514)/(-23387)9/(99/77)? 2/13 What is the value of ((-2190)/(-438))/((-25)/155)? -31 (4178/12534)/((-1)/60) -20 Calculate (-34)/340625. -15 Calculate ((-135)/(-21))/(2484/(-28980)). -75 What is the value of ((-7)/1)/11(-21)/49? 3 What is the value of ((-8)/22)/((-454)/24970)? 20 Evaluate 3((-157)/(-942))/((-17)/6). -3/17 (61/(-122))/((-12)/(-40))64/40 -8/3 Calculate (6396/(-1230))/(((-224)/(-280))/(-12)). 13 Calculate (2/(((-2)/5)/(36/60)))/((-1809)/60903). 101 Calculate (105552/64504)/((2/(-11))/2). -18 Evaluate 115/18-7(-522)/(-87). -35 Calculate 39/(2873/393). 3/17 Evaluate 289/3451360/(-7276). -60 (-15)/(-6)878/650 12/5 Evaluate ((-3)/(-3(-50)/(-10)))/(2/(-1730)). -73 (((-10)/450)/(21/(-35)))/(8/612) 17/6 Calculate (3900/59150)/((-6)/(-104)). 8/7 What is ((-51)/(-17))/((15/(-30))/((-5)/410))? 3/41 Evaluate (-65575)/(-5246)((-16)/10)/2. -10 Evaluate 98/343(-2)/302240/192. -2/9 Evaluate ((-6592)/(-5768))/((-52)/28). -8/13 Calculate (3/(-4))/(-1024/224(-35)/(-30)). 6/17 What is ((-12)/8)/(2/84468/52)? -7 What is (((-1152)/(-224))/(-9))/(90/(-189))? 6/5 Calculate (9/(-42))/((23490/17226)/(10/11)). -1/7 Evaluate (26/(-7))/(99134/46431). -13 Evaluate (-70)/(-275)(-6952)/(-2212). 4/5 Calculate ((-9)/(-6))/((-1966)/(-74708)). 57 Calculate (37/(-7))/1266/(-21). 38 Evaluate 5(-154)/77192/154/16. -32 What is the value of ((-8)/(-16))/(50/(-8)(-648)/540)? 1/15 (12446/11557)/(77/1716) 24 Evaluate (-76)/52-13(-75)/(-25). 57 What is 24/((-1200)/(-14560)-28)? -52/5 What is ((90/(-36))/((-50)/(-8)))/(8/10)? -1/2 What is the value of (178/(-30))/(((-129)/430)/(99/22))? 89 Calculate (-30)/(-8)2760/2415(-21)/(-2). 45 Evaluate ((-3)/(-15)3420/(-570))/((-4)/(-50)). -15 Calculate 61620/(-1422)18/(-12). 65 Evaluate (36)/((35/(-49))/((-11)/(7161/248))). 48/5 Calculate (32/(-18))/(-1)1654/(-827). -32/9 ((-168)/72(-12)/126)/((-17)/9) -2/17 Calculate 3414/170712/(-128)-4(-8)/405. -2/135 Calculate (-2)/84(-30)/4((-1890)/(-42))/450. 1/56 What is the value of ((7/21)/(2/4))/(((-246)/(-792))/(-41))? -88 Calculate -1((-12)/(-19950)19)/((100/14)/10). -2/125 ((-13949)/(-1508))/(((-204)/48)/(-17)) 37 What is the value of (1616790/7699)/((-30)/(-8))? 56 What is the value of (918/198)/51122(-560)/(-20)? 56 Evaluate (((-1232)/88)/42)/(-2-12/564). -47 Calculate ((-198)/813)/((-72)/48). 44/9 What is 9((-18)/(-1584))/(10/160)22? 36 What is ((6/528)/((-1)/30))/(1164/3104)? -10/11 (2/(-18))/((-5)/(-1290))((-450)/12)/(-25) -43 What is the value of (2/(-5))/(589/(-1240)1424/(-89))? -1/19 Evaluate (11875/(-4750))/((-30)/(-8))113. -22 What is the value of (34/12/16)/(30/(-240))? -34 What is the value of (-1(-1)/75)/((-51)/(-23256)-38)? -4/25 What is the value of (-6)/(-16)(-3901)/(-564)-32? -83 Evaluate (-644)/368(-30)/175. 3/10 What is (11453/(-10572))/((-741)/24)? 2/57 What is 465/124835/((-450)/5)? -5 116/(-10)133/((-123291)/206)45/(-2) -58 What is the value of (156/702)/((-8)/(-2232)-10)? -31/5 Calculate 11/(462/12)42/84(-308)/(-7). 44/7 What is the value of ((-171)/(-15))/(((-4)/(-140))/((-196)/(-2058)))? 38 What is the value of ((768/(-96))/(-120))/((-3)/(-5715))? 127 What is the value of 10758/(-152405)3/(-36)*5? 1/34 What is the value of (-	{ "pile_set_name": "DM Mathematics" }
387142 What is next in -988773, -988778, -988785, -988800, -988829, -988878, -988953, -989060? -989205 What is the next term in -8783, -17609, -26439, -35273, -44111, -52953? -61799 What comes next: 34996, 35131, 35266? 35401 What is next in -26857, -27235, -27507, -27619, -27517, -27147? -26455 What is next in 204883, 204862, 204815, 204742, 204643, 204518, 204367? 204190 What comes next: 14, -116, -462, -1126, -2210, -3816? -6046 What comes next: -57, 450, 1517, 3144, 5331, 8078? 11385 What comes next: -279959, -560023, -840083, -1120139, -1400191, -1680239, -1960283? -2240323 What is next in 6966, 11172, 15380, 19590, 23802, 28016? 32232 What is the next term in -2827370, -2827362, -2827356, -2827352, -2827350, -2827350, -2827352? -2827356 What is the next term in 12764, 12551, 12316, 12053, 11756, 11419, 11036, 10601? 10108 What comes next: -1155, -1765, -2401, -3069, -3775, -4525? -5325 What is the next term in 7116324, 14232636, 21348948? 28465260 What is next in -1089121, -2178521, -3267921? -4357321 What comes next: 9909, 19824, 29707, 39534, 49281? 58924 What is the next term in -9831007, -39324049, -88479113, -157296193, -245775283? -353916377 What is the next term in -389, -1207, -2453, -4127, -6229? -8759 What is next in -45936, -46054, -46262, -46560, -46948, -47426? -47994 What is next in 37, 444, 1709, 4264, 8541, 14972, 23989? 36024 What is next in -83220, -166407, -249544, -332607, -415572, -498415? -581112 What comes next: 38261, 76737, 115201, 153647, 192069, 230461? 268817 What is the next term in -21027, -84095, -189195, -336321, -525467? -756627 What is next in 6740939, 26963690, 60668275, 107854694, 168522947? 242673034 What comes next: 4067494, 8134991, 12202488, 16269985? 20337482 What comes next: 40612, 162792, 366426, 651514, 1018056, 1466052? 1995502 What comes next: 7791, 24236, 51641, 90006, 139331, 199616, 270861? 353066 What comes next: 9668258, 19336517, 29004776, 38673035? 48341294 What is next in 99700, 99879, 100368, 101323, 102900? 105255 What is the next term in -685516, -685532, -685560, -685606, -685676, -685776? -685912 What is next in 411, 1862, 4357, 7890, 12455, 18046, 24657? 32282 What comes next: -635, -1261, -1913, -2591, -3295, -4025? -4781 What is next in -412, -220, 0, 248, 524, 828, 1160? 1520 What is next in 65649, 65181, 64407, 63333, 61965, 60309, 58371, 56157? 53673 What is next in 3321269, 3321285, 3321303, 3321323, 3321345, 3321369, 3321395? 3321423 What is next in -7210, -12438, -21142, -33322, -48978, -68110? -90718 What is next in 3217, 3200, 3163, 3106, 3029? 2932 What is next in 18223, 37844, 57479, 77134, 96815? 116528 What is the next term in -78238, -78428, -78622, -78820, -79022, -79228, -79438? -79652 What comes next: 3378, 4830, 7236, 10584, 14862, 20058? 26160 What is the next term in -224, -838, -1878, -3380, -5380, -7914? -11018 What comes next: -388345, -1553371, -3495083, -6213481, -9708565? -13980335 What comes next: -12946735, -25893529, -38840323, -51787117? -64733911 What is next in -649498, -649770, -650042, -650314, -650586? -650858 What is next in 15839324, 31678646, 47517968, 63357290? 79196612 What is the next term in -6026, -12048, -18050, -24020, -29946? -35816 What is next in 3269, 3852, 4823, 6182, 7929? 10064 What comes next: -824069, -1648141, -2472213, -3296285, -4120357, -4944429? -5768501 What comes next: 8296, 14814, 21298, 27748, 34164? 40546 What is the next term in -2081, -3110, -4813, -7190, -10241, -13966, -18365? -23438 What comes next: -208, -759, -2002, -4279, -7932? -13303 What is the next term in -39714, -40275, -41208, -42513, -44190, -46239? -48660 What is the next term in -7367328, -7367309, -7367270, -7367205, -7367108? -7366973 What is the next term in -721711, -721902, -722199, -722584, -723039, -723546? -724087 What is next in -11021, -10977, -10863, -10643, -10281, -9741, -8987? -7983 What is next in 21929, 83382, 185803, 329192, 513549, 738874? 1005167 What is the next term in 4888, 60312, 210742, 503680, 986628? 1707088 What comes next: -71136104, -142272209, -213408316, -284544425? -355680536 What is next in -3268257644, -3268257643, -3268257642, -3268257641? -3268257640 What is the next term in 1587, 4903, 10481, 18321, 28423, 40787? 55413 What is the next term in -226, -949, -2336, -4537, -7702, -11981, -17524, -24481? -33002 What comes next: -469473, -938930, -1408373, -1877796, -2347193? -2816558 What comes next: 104729012, 104729011, 104729010, 104729009, 104729008? 104729007 What is the next term in 4126, 10779, 19952, 31639, 45834, 62531, 81724, 103407? 127574 What is the next term in 28587, 28559, 28537, 28521? 28511 What comes next: -9719105, -19438229, -29157353, -38876477? -48595601 What is the next term in -1136, -5363, -12342, -22019, -34340, -49251, -66698, -86627? -108984 What is the next term in -4336, -4545, -4822, -5167, -5580, -6061, -6610? -7227 What comes next: 451183, 902397, 1353611, 1804825, 2256039? 2707253 What is next in 21357, 85167, 191517, 340407? 531837 What is next in 124, 320, 622, 1054, 1640? 2404 What is the next term in 6635, 23085, 50495, 88859, 138171, 198425, 269615? 351735 What is the next term in 90661, 361927, 814035, 1446985, 2260777, 3255411? 4430887 What comes next: 33206690, 66413382, 99620072, 132826760? 166033446 What is next in 2891490, 5782982, 8674474, 11565966, 14457458, 17348950? 20240442 What is next in 6403188, 12806377, 19209566? 25612755 What is the next term in -337, -579, -661, -499, -9, 893, 2291? 4269 What is next in 4549, 4574, 4595, 4594, 4553, 4454, 4279, 4010? 3629 What comes next: -131096, -131089, -131084, -131087, -131104, -131141, -131204, -131299? -131432 What is next in 154, 119, 12, -221, -634, -1281? -2216 What comes next: 82463, 82522, 82619, 82754, 82927, 83138? 83387 What is the next term in 120769, 111487, 102205, 92923, 83641, 74359? 65077 What comes next: -555881, -1111462, -1666467, -2220608, -2773597, -3325146, -3874967? -4422772 What is the next term in -4802, -39247, -133300, -316943, -620158, -1072927, -1705232, -2547055? -3628378 What comes next: -9064, -7715, -6366, -5017? -3668 What comes next: -7278, -7563, -8044, -8721, -9594, -10663? -11928 What is next in -1396126, -1396214, -1396302? -1396390 What is the next term in 15890459, 63561849, 143014165, 254247407, 397261575? 572056669 What is next in -411642, -824531, -1237418, -1650303, -2063186, -2476067? -2888946 What comes next: 1693957, 1693888, 1693773, 1693612? 1693405 What is next in -175640210, -351280418, -526920626, -702560834, -878201042, -1053841250? -1229481458 What is the next term in 1182667, 2365338, 3548007, 4730674? 5913339 What comes next: 1077, 827, 125, -1263, -3571, -7033, -11883, -18355? -26683 What is next in 8155, 15910, 22875, 28654, 32851, 35070, 34915? 31990 What is the next term in 59598, 117522, 175446, 233370, 291294, 349218? 407142 What is the next term in -44034, -176237, -396606, -705141, -1101842? -1586709 What is next in -37849, -151363, -340547, -605401, -945925? -1362119 What is next in 276857, 550943, 825027, 1099109, 1373189, 1647267, 1921343? 2195417 What is next in -1643199, -1642520, -1641841, -1641162, -1640483? -1639804 What is next in 11681, 23237, 34539, 45455, 55853, 65601, 74567? 82619 What comes next: 1871941, 7487820, 16847655, 29951476, 46799313, 67391196? 91727155 What is next in -23269, -27972, -35809, -46780, -60885? -78124 What comes next: -94721, -94798, -94877, -94958? -95041 What comes next: -22593, -90409, -203431, -361647, -565045? -813613 What is the next term in -455748, -911605, -1367484, -1823391, -2279332, -2735313, -3191340, -3647419? -4103556 What comes next: -73664, -294664, -663000, -1178672? -1841680 What comes next: -95217980, -190435959, -285653938, -380871917, -476089896, -571307875? -666525854 What comes next: 11856, 11562, 11288, 11034, 10800, 10586, 10392? 10218 What is the next term in 2715, 5570, 8553, 11676, 14951, 18390, 22005, 25808? 29811 What is next in -259, 14, 803, 2378, 5009, 8966, 14519? 21938 What comes next: -4687, -1172, 4681, 12872, 23401, 36268, 51473? 69016 What comes next: -1185051, -2370102, -3555153? -4740204 What is next in 1787, 7371, 16819, 30185, 47523, 68887, 94331? 123909 What is the next t	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.