Datasets:

parameterlab
/

scaling_mia_the_pile_00_DM_Mathematics

Dataset card Data Studio Files Files and versions Community

Split (3)

train · 63.5k rows

text stringlengths 518 8.19k	meta dict
p? 0, 1 Suppose 34b - 117b = -38b. Let -4/5 - 6/5g + bg2 + 2/5g*3 = 0. Calculate g. -1, 2 Let b = -1033/18 + 584/9. Solve -5i + 0 + 25/2i3 + bi*2 = 0. -1, 0, 2/5 Factor 0 + 2f - 1/3f4 - 2f*3 + 1/3f*2. -f(f - 1)(f + 1)(f + 6)/3 Let b(c) = c*2 - 17c + 10. Let v(n) = -2n2 + 52n - 29. Suppose 4t + 4 = 0, -3k - 9 = -5t + 7. Let j(i) = kb(i) - 2v(i). Suppose j(w) = 0. What is w? 1, 4 Let k(n) = 2n - 8. Let p = 24 - 20. Let t be k(p). Determine j, given that t - 1/3j2 - 1/3j = 0. -1, 0 Let z(q) be the first derivative of -2q3/15 + 37q*2/5 - 72q/5 + 19. Find o, given that z(o) = 0. 1, 36 Let y(v) be the first derivative of 0v - 7/4v*3 - 45/16v*4 - 26 - 27/20v*5 - 3/8v*2. Factor y(i). -3i(i + 1)(3i + 1)2/4 Let q(z) be the second derivative of -z6/240 + z5/80 + z4/32 - z3/12 - z2/4 + 110z + 2. Solve q(g) = 0 for g. -1, 2 Let i(v) be the first derivative of -v6/9 + v5/3 + 13v4/6 + v3/9 - 5v2 + 380. Let i(t) = 0. What is t? -2, -3/2, 0, 1, 5 Let s(q) be the second derivative of -q7/105 + 7q6/75 + 9q*5/50 - 7q*4/30 - 8q*3/15 + 44q. What is h in s(h) = 0? -1, 0, 1, 8 Factor 15/4 - 1/4m3 + 1/4m*2 + 17/4m. -(m - 5)(m + 1)(m + 3)/4 Determine l so that 6l2 + 61l - 5l5 - 95l*3 + 99l*2 - 42l - 105l4 + 81l = 0. -20, -1, 0, 1 Let p(t) be the second derivative of -2t7/7 + 23t*6/10 + 57t*5/10 - 4t*4 - 17t*3 - 21t*2/2 - 12t - 1. Let p(n) = 0. What is n? -1, -1/4, 1, 7 Let h be -615/208/(-2). Suppose hl = 19l. Factor 3/2b5 + 0b*4 + 0b*2 + 0 - 3/2b*3 + lb. 3b3(b - 1)(b + 1)/2 Factor 0n + 0 + 3n3 - 3/2n*4 + 12n*2. -3n*2(n - 4)(n + 2)/2 Let t(i) be the second derivative of i6/135 - 14i*5/45 + 65i*4/18 + 28i*3/27 - 196i*2/9 - 536i. Let t(d) = 0. Calculate d. -1, 1, 14 Factor -10/3p2 + 8p - 24/5. -2(5p - 6)*2/15 Let m(x) = -15x + 72. Let c be m(5). Let j be -3(c + (2 - 0)). Factor -3 - 3/2f*5 + jf*3 + 21/2f + 3f4 - 12f*2. -3(f - 1)*4(f + 2)/2 Let h(m) be the third derivative of -m*7/630 - 7m6/360 + m5/180 + 7m4/72 + 145m*2. Factor h(a). -a(a - 1)(a + 1)(a + 7)/3 Let i = 24 + 2. Let l = i - 17. What is z in 20z2 - 7z*2 - lz2 = 0? 0 Let o(s) be the third derivative of -s8/2016 + s7/1260 + s6/240 - s5/72 + s4/72 + 44s2. Factor o(n). -n(n - 1)*3(n + 2)/6 Let l(c) = -3c - 13c + 9c2 - c2 + 5 - c3. Let v be l(5). Factor -7/6r*5 + v + 0r - 1/3r2 - 8/3r*4 - 11/6r3. -r2(r + 1)2(7r + 2)/6 Let y(r) be the second derivative of 0 - 7r - 24r2 + 4r*3 - 1/4r*4. Factor y(f). -3(f - 4)*2 Let s(m) be the first derivative of 5m*3 + 60m - 5/4m4 + 29 + 40m*2. Find c, given that s(c) = 0. -2, -1, 6 Let j(q) be the second derivative of -2q*7/21 - 28q*6/5 - 587q*5/5 - 2702q*4/3 + 392q*3 + 5488q*2 - 3q. Factor j(l). -4(l - 1)(l + 1)(l + 14)3 Let n(x) be the third derivative of x9/166320 + x8/110880 - x7/5544 + x6/1980 - x5/4 + 8x*2. Let v(d) be the third derivative of n(d). Factor v(w). 2(w - 1)(w + 2)(2w - 1)/11 Suppose -o + l + 9 = 0, -3o - 5l - 23 = -10. Solve -3y*4 - 5y*2 - 4 - 5y*o + 8y*3 + 13y*2 - 4y*5 + 4y*4 - 4y = 0 for y. -1, 1 Let m = 38 + -35. Factor 8r - 4r*2 + 3 + m + 6r*2. 2(r + 1)(r + 3) Let n = 19 - 4. Suppose 5g*4 + ng + 3g3 - 10 + 2g*3 + 5g*2 - 6g*3 - 14g*3 = 0. What is g? -1, 1, 2 Suppose 68y - 70y = -5x + 2, 5y = -3x + 26. Factor c + 1/6cx + 5/6. (c + 1)(c + 5)/6 Let n(f) be the second derivative of 5f4/33 - 13f*3/33 + 3f*2/11 + 3f - 1. Suppose n(v) = 0. What is v? 3/10, 1 Suppose -2t = 9t - 22. Factor -j*2 + tj*2 + 43j - 46j. j(j - 3) Let y(s) be the first derivative of -s*6/24 - 17s*5/20 - 57s*4/8 - 94s*3/3 - 76s*2 - 96s + 430. Find f such that y(f) = 0. -4, -3, -2 Let f be 121/48 + -4 + (-255)/(-36). Solve -fy - 2/3y3 + 4/3 + 8/3y*2 = 0. 1, 2 Let k be 1-3(0 - -5). Let f be 5/(k/9)-1. Solve -5 + 2a3 - a5 + 3 - fa - 3a3 + 2a*2 + 5a*3 = 0. -1, 1, 2 Let n(h) be the second derivative of 1/7h*3 + 1/70h*5 + 0 + 18h + 0h2 + 2/21h*4. Solve n(k) = 0 for k. -3, -1, 0 Suppose 60k - 61k - 6 = -l, 3k = -3l. Let h(u) be the first derivative of 16/15u*6 + 4/3u*l - 13 + 33/10u*4 + 1/5u*2 + 0u + 16/5u5. Factor h(t). 2t(t + 1)2(4t + 1)2/5 Factor 12/7i + 6/7i3 + 4/7 + 1/7i*4 + 13/7i2. (i + 1)2(i + 2)2/7 Let z(y) = 3y*2 - 3y + 13. Let b(f) = 2f2 - 2f + 7. Let i(j) = 5b(j) - 3z(j). Let o be i(-2). Factor 15s - 9s*3 - 3s*4 - 24s + 9s - 6s*o. -3s*2(s + 1)(s + 2) Let q(r) be the second derivative of r4/12 + 17r*3/6 + 8r*2 + 143r. Suppose q(c) = 0. What is c? -16, -1 Let s be (-14)/6(-2 - 1). Suppose 5h - 2t = -st + 30, -h + 4t = -1. What is m in 7m*5 - 15m*2 + 3m - 21m4 + 16m3 - mh + 11m3 = 0? 0, 1/2, 1 Let w(l) = -l - 5. Let k be (-3 - -4)-2 - 5. Let h be w(k). Factor 0 + 0b + 4/13b*3 + 2/13b*h + 2/13b*4. 2b*2(b + 1)2/13 Let g(s) be the third derivative of -s5/20 + 41s4/8 - 1681s*3/8 - 4s*2 - 26s. Factor g(p). -3(2p - 41)*2/4 Determine s, given that 18s*4 - 24s*3 + 4s*4 - 7s*4 + 12s - 22s2 - 5s*4 = 0. -1, 0, 2/5, 3 Suppose -2g - 2 = 4p, -10g + 7g - 3 = -2p. Let l be 0 + 2 - (-5)/(-3). Let -lb5 - b3 + b4 + 1/3b*2 + pb + 0 = 0. Calculate b. 0, 1 Let t(k) = -k*3 + 6k*2 + k. Let p be 5/(4 + (-3)/2). Let r(x) = 6x*2 + 2x. Let o(q) = pt(q) - 3r(q). Factor o(f). -2f(f + 1)(f + 2) Let o = -5520 - -5523. Factor -2/5 + 0d*2 - 9/5d*o + 7/5d. -(d + 1)(3d - 2)(3d - 1)/5 Let s = 27693/8 - 3446. Let u(j) be the second derivative of -5/16j4 - sj*2 + 3j - 1/80j5 + 0 - 25/8j3. Factor u(h). -(h + 5)3/4 Let h(j) be the second derivative of -3j5/70 - 5j*4/42 + 4j*3/21 + 4j*2/7 + j - 3. Suppose h(g) = 0. What is g? -2, -2/3, 1 Factor -138g*2 - 1/5g*3 - 31740g - 2433400. -(g + 230)3/5 Let m(r) be the first derivative of -r6/405 - 37r5/540 - r4/12 + 17r*3/3 + 38. Let w(s) be the third derivative of m(s). Factor w(j). -2(j + 9)(4j + 1)/9 Let f = -2/101169 + 730721/2832732. Let a = f - 1/28. Factor 0 - 2/3u2 + 0u*3 + au*4 + 4/9u. 2u(u - 1)*2(u + 2)/9 Suppose 3v - 15v + 24 = 0. Factor -7z3 + 40z*2 + vz*3 - 15z*4 - 19z - z. -5z(z - 1)(z + 2)(3z - 2) Suppose 0 = 5f - 95 + 85. Factor 5j2 + 4 - 3j*2 - 12 - fj - 4. 2(j - 3)(j + 2) Let f(r) be the second derivative of r*5/2 + 52r*4 - 191r*3/3 - 126r*2 - 2r - 182. Find c, given that f(c) = 0. -63, -2/5, 1 Let b(n) = n*3 - n - 1. Suppose 6o = 3o + 18. Let c(k) = 4k*3 - 2k*2 - 3k - 3. Let a(j) = ob(j) - 2c(j). Determine f, given that a(f) = 0. 0, 2 Let n(m) be the third derivative of m*8/672 - 29m7/420 + m6/3 + 491m5/30 + 66m*4 - 432m*3 - 588m*2. Find q such that n(q) = 0. -4, 1, 18 Let p be (-5 - (-2 + -2))/((-2)/44). Suppose -ps - 8 = -26s. Factor 0 + 4/5i - 6/5is + 2/5i*3. 2i(i - 2)(i - 1)/5 Let u be (-3 + 2)(-10 + 5) + -3. Let y be -2 - 1/((-3)/15). Suppose 36/5x*y + 3/5x*5 + 24/5x*u + 0x + 18/5x4 + 0 = 0. Calculate x. -2, 0 Let r(z) = 136z*3 - 524z*2 - 172z + 128. Let g(l) = -l*3 - l - 2. Let s(a) = -24g(a) - r(a). Factor s(c). -4(c - 5)(4c - 1)(7c + 4) Let d be -4 - (1 - -1 - 2). Let f be (-18)/(-10) - 3/(-1 - d). Factor -fy*2 + 2/5 + 2/5y*4 - 2/5y*5 + 4/5y*3 - 2/5y. -2(y - 1)3(y + 1)2/5 Let z(c) be the second derivative of -c7/7560 - c6/810 - c5/270 + 5c3/6 + 26c. Let l(f) be the second derivative of z(f). Factor l(a). -a(a + 2)2/9 Let m(h) be the first derivative of -h3/21 - 9h*2/7 - 17h/7 + 247. Factor m(d). -(d + 1)(d + 17)/7 Let s be (-86)/(-3)1/(-2). Let b = s - -15. Factor b + 0i2 + 1/3i3 - i. (i - 1)2(i + 2)/3 Let c be (-2)/80-2((25 - 5) + -8). Factor 0 - cw*2 - 9/5w. -3w(w + 3)/5 Let o(v) = 5v - 2v + 44 - 17 - 23. Let g be o(5). Solve 6u3 + 13u*2 - 25u*2 - 12u - 3 + gu4 - 4u*4 + 6u*5 = 0 for u. -1, -1/2, 1 Let f be (-16)/(-56) + (-428)/1547. Let y = 878/663 + f. Factor yd**4 + 0 -	{ "pile_set_name": "DM Mathematics" }
37, -4q - 465 = 13m - 14m. List the prime factors of m. 3, 53 Let v = -1695 + 4378. What are the prime factors of v? 2683 What are the prime factors of (-4 + 1256)(6/(-4) - -2)? 2, 313 Let o(b) = -b*2 + 17b + 66. Suppose 8l - 126 = 10. What are the prime factors of o(l)? 2, 3, 11 Let o(p) = p2 - 12p - 14. Let r(b) = 2b2 - 24b - 27. Let u(z) = -5o(z) + 2r(z). Let m be 3/6 + 231/22. List the prime factors of u(m). 3 Let g = -68 + 73. List the prime factors of (-13)/g + 3 + (-1456)/(-10). 2, 73 Suppose -4w + 4j + 42 = -26, -2j - 10 = 0. Suppose 22 = c - w. Suppose -x - c = -3x. What are the prime factors of x? 17 Let t(n) = -14n - 9. Let w be t(-2). Suppose j = w + 20. List the prime factors of j. 3, 13 Suppose -2545 = -3j - 5s, -4s + 3055 = 5j - 1178. What are the prime factors of j? 5, 13 Suppose 21p = 26p - 300. What are the prime factors of p? 2, 3, 5 Suppose 2q - 1117 = -5h + 697, 5q - 5h - 4465 = 0. List the prime factors of q. 3, 13, 23 Suppose 0k + 4k - 28 = 0. Suppose l - 17 - k = 0. Let f = -4 + l. What are the prime factors of f? 2, 5 Suppose -1 = -b - 4. Let l(u) = 19u - 34u - 1 + 3u. What are the prime factors of l(b)? 5, 7 Let s be 2/6 + (-1722)/(-18). Let t(m) = 6m3 - 2m*2 - 2m + 4. Let b be t(-2). Let p = b + s. What are the prime factors of p? 2, 3 Let m(j) = j*2 + 7j. Let z be m(-7). Let x = -16 - -40. Suppose zs = 4s - x. List the prime factors of s. 2, 3 Suppose -3d = 2d - 5l + 405, -2d - 163 = -3l. List the prime factors of ((-20)/d)/((-1)/(-148)). 37 Suppose -29l + 248 = -25l. List the prime factors of l. 2, 31 Let w = 21 - 4. Let k = w - 13. List the prime factors of k. 2 Suppose 8g - 4g = 84. Let n be (-2)/(-6) - 7/g. Suppose n = -3s + 4v + 36, -3v - 60 = -4s - s. What are the prime factors of s? 2, 3 Suppose 14 = 2z - 3v, -4v - 5 = -13. Let u be (24/15)/(2/z). Suppose a + 30 = 5f, 2f + a = 4 + u. List the prime factors of f. 2, 3 Suppose -3i - 1 = -2c, 2c - 2i - 6 + 4 = 0. Suppose -335 = -cd + 3k, 2d - 18 - 313 = -k. List the prime factors of d. 2, 83 Suppose 0 = -5h + 4w + 4178, -2h + 5w + 356 = -1305. List the prime factors of h. 2, 419 What are the prime factors of 2/2(324 + -28)? 2, 37 Let z(r) = -r*3 + 6r*2 + 7r - 7. Let k be z(5). Let i be ((-8)/(-10))/((-1)/35). Let w = i + k. List the prime factors of w. 5 Let n(k) = k*3 - 3k*2 - 2k - 4. Let q be 3 + 3 - (0 + 2). Let f be n(q). Suppose -fa + 3m + 130 = 20, 4a - 124 = -4m. What are the prime factors of a? 29 Let w = 27 - 27. Suppose 6i - 3 - 21 = w. What are the prime factors of i? 2 Suppose t + 4t - 4967 = -3y, -y = t - 995. Suppose -4z - z + g = -t, -201 = -z + 3g. List the prime factors of z. 2, 3, 11 Let q = -19 - -22. Suppose qa - 1 = 2. What are the prime factors of (-3)/9(a + -85)? 2, 7 Suppose 0 = -5h - 3 - 2. Let t(n) = 6n2 - 1. Let g be t(h). Suppose -gi + 4x = -4i - 30, -38 = -3i - x. List the prime factors of i. 2, 7 Suppose 42 = 5m - 8m. List the prime factors of -13 - m - 9-8. 73 Let q be 6/4 + 526/(-4). Let p be -3 - 1/1 - 73. Let i = p - q. What are the prime factors of i? 53 Suppose 14h - 546 - 392 = 0. List the prime factors of h. 67 Let z(t) = 103t - 127. List the prime factors of z(6). 491 Suppose 2065 = -19s + 13712. List the prime factors of s. 613 Suppose 22u = -6u + 13132. What are the prime factors of u? 7, 67 Let l(m) = -2m - 12. Let k(u) = -1. Let z(v) = -20k(v) + 2l(v). Let a be z(-6). Suppose 2h + 4x + a = 5h, -3h + 5x = -19. List the prime factors of h. 2 Let g(n) = 4n*2 + 6n - 36. What are the prime factors of g(6)? 2, 3 Let n = -253 - -592. What are the prime factors of n? 3, 113 Let l(d) = -7d + 3. Let j(c) = c3 - 5c*2 - 9c + 9. Let t be j(6). Let b be 39/t - (-2)/6. What are the prime factors of l(b)? 31 Suppose 0 = 3y - v - 11, -3y + 8y = 4v + 30. Suppose 0 = b + yb - 5q - 253, 3b = 4q + 251. List the prime factors of (b/(-6))/9-38. 3, 19 Suppose -2z - 9 = 4v - 5, 4z = -16. List the prime factors of v/(5/((-145)/(-88)) - 3). 29 Suppose 2030 = -c + 11c. List the prime factors of c. 7, 29 Let g(v) = 5v*2 + 2v + 1. Let q be g(-1). Let s be (-2)/4(-16)/2. Suppose 0 = qa + s - 48. What are the prime factors of a? 11 Let o be (-11 + 6)/(1/2). Let g(c) be the first derivative of -c*2/2 + 2. List the prime factors of g(o). 2, 5 Let a be (2/5)/(7/315). Let y be (-71)/(2/a-3). Suppose 2u + n = 5u - 151, 4u + n - y = 0. What are the prime factors of u? 2, 13 Let s = -3 + 3. Let v(r) = 2r - 30. Let b be v(s). List the prime factors of (7 + 0)b/(-42). 5 Suppose -5l = -8l - 66. Let m = 48 - l. What are the prime factors of m? 2, 5, 7 Let p = 263 + -151. Suppose 0 = -4y + 496 - p. What are the prime factors of y? 2, 3 Let q = -12 + 14. Let v(o) = -o*3 + 4o*2 - 2o - 2. Let c be v(q). List the prime factors of (-2)/(-2 - c)10. 5 Let f = -3566 + 5850. List the prime factors of f. 2, 571 Let b = -564 + 1102. What are the prime factors of b? 2, 269 Let a = 75 - 75. Suppose -2g = 4c - 202, a = 4g - 21 + 9. List the prime factors of c. 7 Suppose -3f - 1020 = 7f. What are the prime factors of -4 + f(-6)/9? 2 Let w(m) = 2m + 18. Let a be w(-11). List the prime factors of a/(-10) + (-1586)/(-10). 3, 53 Suppose -2b = -4n - 34, 2n + 3b - 4 + 1 = 0. Let o(v) = 63v2 + v + 1. Let r be o(-1). What are the prime factors of 6/12 - r/n? 11 Let z(c) = 31c*2 + 3c - 28. What are the prime factors of z(4)? 2, 3, 5 Let n(x) = -x*2 - 7x + 2. Suppose -2k + 21 = -5k. Let u be n(k). Let f = 26 - u. List the prime factors of f. 2, 3 Suppose 60j - 27894 = 82566. What are the prime factors of j? 7, 263 List the prime factors of (571 + 2)80/24. 2, 5, 191 Let l = 46 + -42. Suppose -lz + 100 = 6z. List the prime factors of z. 2, 5 Let l be (-304)/(-4) + 1 + -2. Suppose 2o + 80 = 5u, o - 4o - l = -5u. Suppose 5d = u + 2. What are the prime factors of d? 2 Let t = -5 - -13. Let m(x) = -4x - tx - 8 + 5x + 1. What are the prime factors of m(-7)? 2, 3, 7 Let q(r) = -2r - 23. Let w be q(-13). Suppose -wz + 81 = -0z. What are the prime factors of z? 3 List the prime factors of 24/12 + 956/2. 2, 3, 5 Let p(l) be the third derivative of l5/60 + 11l*4/24 - 11l*3/2 + 35l*2. List the prime factors of p(-15). 3 Suppose -z - 3y + 44 = 0, -5z - 3y - y = -176. Let p = 21 + z. What are the prime factors of p? 53 Let a be (-4 - (-685)/10)-2. Let c = 201 + a. What are the prime factors of c? 2, 3 Let t(y) = -26y - 1. Let i be t(-1). Let v = 105 + -57. Let f = v - i. List the prime factors of f. 23 Let u be -2((0 - 1) + 2). Let s = u + 6. Suppose 4b = s + 8. List the prime factors of b. 3 Suppose 4w = d + 561, -3d = 2w - 80 - 183. Let y = w + -253. What are the prime factors of (-12)/30 + y/(-10)? 11 Let w(r) = r3 - 9r*2 + 20r. Let c be w(8). Suppose 0 = 2v + 4l - 82 + 30, 3l + c = 3v. What are the prime factors of v? 2, 3, 5 Let s(c) = -c*2 + 4c + 5. Let u be s(4). Let f be -252/12306/(-12). Suppose 3t + t - uj = f, -t + 59 = -2j. List the prime factors of t. 7 Let m(o) = -6o - 186. Let n be m(-32). Let k be 8/(-3)9/(-6). Suppose ka - na = -56. What are the prime factors of a? 2, 7 Let j be 60/33(-1)/(-12). Suppose -k + 3k - 4t = 138, jk + 2t - 405 = 0. List the prime factors of k. 79 Suppose -15o + 4452 = -o. List the prime factors of o. 2, 3, 53 Let o be ((-4)/(-8) + 0)4. Suppose -o = -3g + 13. Suppose -5p + 0y = 2y - 131, -gy + 15 = 0. What are the prime factors of p? 5 Suppose -2t + 28 = 18. Suppose -2g + 158 = 4m, -3m + 61 = -m - tg. What are the prime factors of m? 2, 19 Let m(r) = 8r*3 - 3r*2 + 24r - 166. List the prime factors of m(7). 23, 113 Suppose 37w - 21w - 13632 = 0. What are the prime factors of w? 2, 3, 71 Suppose -3 = -g + 4a - 19, 3a = 12. Suppose 2f + l = -2f + 329, g = -2f + 4l + 178. What are the prime factors of f? 83 Let f be 10 - (-3 - 1) - 0. Suppose 0 = -4h + 10 + f. Suppose 0 = -hk + 2k + 44. List the prime factors of k. 11 Let a(u) = u + 6. Let j be a(-6). Suppose 2w = -3r + 111, -2r + 0r = -4w - 90. Suppose jy = 3y - r. List the prime factors of y. 13 Let w(z) = -z*2 + 8z + 9. Let k be w(9)	{ "pile_set_name": "DM Mathematics" }
5 (c) -5 (d) -10 (e) 3 (f) 2/47 (g) 0 g What is the sixth smallest value in 20/19, -5, 0.3, 0, 455, 1/4? 455 What is the sixth biggest value in -144, 2/7, 11, -2/15, -458/3, -2/13? -458/3 Which is the smallest value? (a) -0.2 (b) -117410 (c) 35 b What is the fifth biggest value in 0.05949, 1, -2/7, -1, -3, 6? -1 Which is the sixth smallest value? (a) 3 (b) -1 (c) -0.03 (d) 3/2 (e) -2/3 (f) -412 (g) 7 a Which is the sixth biggest value? (a) 5 (b) 624 (c) 1/263 (d) -0.1 (e) 2 (f) 2/7 (g) 1 c What is the third smallest value in -2215, 54, -2? 54 What is the sixth biggest value in -2, 4, 2/5, -4, 4.265, 0.3626, 2/7? -2 Which is the fourth smallest value? (a) 18/11 (b) -99 (c) -3/16 (d) -18 (e) -0.05 e What is the biggest value in 376042, -31, 0? 376042 Which is the second smallest value? (a) 1.5 (b) -111 (c) -0.3 (d) 1667 (e) -4/3 (f) -2 f Which is the second biggest value? (a) 2/3 (b) -4608/13 (c) -336 c What is the second smallest value in -4, -1104091, 2/27? -4 What is the fourth smallest value in -0.03, -0.2, 5, -1/2, -1/3, -20, -1/835? -0.2 What is the smallest value in 0, -1140, 2.319, 19, -1/4? -1140 What is the smallest value in 4, 0, -1/2, 124/71? -1/2 What is the third smallest value in -24513, -2/13, 10900? 10900 Which is the second biggest value? (a) -22513 (b) 670 (c) 1 c Which is the second smallest value? (a) 13 (b) 0.08 (c) 4 (d) 0 (e) -15/2 d What is the second biggest value in 4, 0.5, -0.2, -476, 6? 4 What is the second smallest value in 5, -10, -30, 0.04, 0.1? -10 What is the smallest value in -3/4, 80, 5, -0.07, 9889/3? -3/4 What is the fourth biggest value in 2, 0.3, 0, 4/17949, 1? 4/17949 Which is the fourth biggest value? (a) -2/15 (b) 4/3 (c) -670986 (d) -3 c What is the fourth biggest value in -169, -0.4, -0.1, 0.5, -1, -1018, 0? -0.4 What is the fourth biggest value in -0.041, -64171, 4/3, 1/3, -3/2, -4? -3/2 Which is the second smallest value? (a) 42 (b) -2/13 (c) 7 (d) -2314 (e) -8.4 e What is the fourth biggest value in 5, -3, -1, 0.3, -0.5, -189, 185? -0.5 What is the fourth smallest value in -0.4, -0.56, 1/3, -407/4, -3? -0.4 Which is the fifth biggest value? (a) -13/77 (b) -9 (c) 2/5 (d) -14 (e) 29 (f) -2/7 b Which is the third smallest value? (a) -41 (b) 33541 (c) 6 b Which is the smallest value? (a) -766210 (b) -79 (c) 0.2 a What is the smallest value in -2, -0.3, -8676, 1? -8676 What is the second biggest value in -2, 3/4, -956.46, 2/9? 2/9 Which is the second biggest value? (a) -103985 (b) -5 (c) -2/281 b What is the second smallest value in 1/4, 0.098, 0.3, -5, -0.25, -0.33? -0.33 Which is the fifth smallest value? (a) 29/7 (b) 78/7 (c) 4 (d) -2 (e) -1 (f) -5 a Which is the sixth smallest value? (a) -4 (b) -1/188 (c) 1 (d) 4 (e) -4.78 (f) 0.19 d Which is the second smallest value? (a) 5 (b) -2/13 (c) -1 (d) 1067982 b What is the second biggest value in 0, 0.1, -2/17, 3334645, -1? 0.1 Which is the third biggest value? (a) -1375 (b) -3/2 (c) -0.2265 a Which is the second smallest value? (a) -0.1 (b) -3 (c) -5 (d) 1076/21 (e) 2430 b Which is the biggest value? (a) 1350/13 (b) 2 (c) 0.057 (d) 0.4 (e) 0.06 a What is the fourth biggest value in 0.08, -1/30, -0.11, 2/9, 3/4, 1/5, 177? 1/5 What is the second smallest value in -9983, -0.09, -0.0648? -0.09 What is the sixth biggest value in -0.1, 1/5, -5, 89, 2/75, 0.6, -0.3? -0.3 Which is the third smallest value? (a) 2/21 (b) 2/9 (c) 32/1267 b Which is the second biggest value? (a) -0.5 (b) 0.3 (c) -0.2 (d) -39/5 (e) -5 (f) 5 (g) -2/107 b Which is the fourth smallest value? (a) 0.4 (b) 53 (c) -3 (d) -0.28 (e) -8/71 (f) -4/9 (g) 5 e Which is the smallest value? (a) 8 (b) 263/41 (c) -5 c Which is the second smallest value? (a) 1 (b) 4/3 (c) 1/6 (d) 0.7 (e) -5 (f) -2394 (g) 0.14 e What is the fourth biggest value in -3, -4, 8, -2, -449? -4 Which is the second smallest value? (a) 18/173 (b) -5 (c) -1/3 (d) 4/11 c Which is the fifth biggest value? (a) -1 (b) -1314 (c) -2/9 (d) 0.079 (e) -4/3 b Which is the smallest value? (a) -4 (b) 2/5 (c) 2 (d) 0.00243 a Which is the smallest value? (a) 0.1 (b) 1 (c) 0.131 (d) 8 (e) 2/13 (f) 1/5 (g) -98 g What is the third biggest value in 2/9, -0.53125, 0, 2, -5? 0 What is the second biggest value in 44, -1, -547259, -2/3? -2/3 Which is the biggest value? (a) -146 (b) -1/5 (c) 72 (d) 564 d What is the third smallest value in 2/9, -3534825, 2, 131? 2 Which is the second biggest value? (a) -12.41 (b) 137 (c) 3 (d) 0.4 (e) -0.3 c Which is the biggest value? (a) 18.6 (b) 15 (c) 786 c What is the fourth smallest value in -5, -1, -2/161, -68.697? -2/161 Which is the second smallest value? (a) -1 (b) -23 (c) -4069 (d) 0.3 b Which is the fourth smallest value? (a) 2 (b) -508 (c) 0.5 (d) 0.6 (e) 33 (f) -4 d What is the second biggest value in 13, -7/37, -0.00847? -0.00847 What is the third smallest value in 44, -3/13, -0.3, 2/9, -1/4, -0.5, -0.02? -1/4 Which is the sixth biggest value? (a) 14 (b) 136 (c) 0.1 (d) 4622 (e) 0 (f) -0.5 f Which is the second biggest value? (a) 16 (b) 11 (c) -0.03739 b Which is the second biggest value? (a) 0 (b) 20/7 (c) 5 (d) 2/3153 b What is the second smallest value in 18/499, 2, -7, 0.2? 18/499 Which is the second smallest value? (a) -1 (b) 1 (c) 8/19 (d) 43 (e) -0.045 e What is the third smallest value in 1/6, -5, 0, -0.0563, 0.3, 5/2? 0 Which is the second biggest value? (a) -0.2 (b) -2/15 (c) 0.5 (d) 24 (e) -2/3 (f) -11 (g) 2 g What is the second biggest value in -3/4, -5, -23565, -8? -5 Which is the seventh smallest value? (a) 5 (b) 3 (c) 1/2 (d) -3 (e) 0.4 (f) -2.9 (g) 0.04 a What is the third biggest value in 3, -1/11, -3056, 0.02, 12, 1/22? 1/22 What is the second smallest value in -4, -2/13, 112.7785, -3, 1/12? -3 Which is the third biggest value? (a) 0 (b) -3148796 (c) -29 b What is the fifth biggest value in -3, -0.3, -38/11, 2/31, -20, 5, 0.2? -3 What is the sixth biggest value in -2, 1.16, 3, -4, -1/3, -0.233? -4 What is the sixth biggest value in 5, 16, 64, -2/9, 8, -1.7? -1.7 What is the fourth biggest value in 3, -59, 5, -144659? -144659 Which is the third biggest value? (a) 0.5 (b) 4 (c) -10.3 (d) -9493 c What is the third smallest value in 0.4, -1, 4, -0.164, -648? -0.164 What is the biggest value in -21, 0.5, 7887.03? 7887.03 What is the second biggest value in -1/3, -0.1, 1/8, -1382, -2/15? -0.1 Which is the third smallest value? (a) -101.38 (b) -3 (c) 2988 c Which is the second smallest value? (a) -10.7 (b) 0.2 (c) 108 (d) 0.02 (e) -3/43 e Which is the third biggest value? (a) 0.3 (b) 4 (c) -1/4 (d) 2/1379 (e) -11972 d What is the smallest value in -3, -0.03, 4426, 2/5, 80? -3 Which is the third smallest value? (a) 5 (b) -1082 (c) 0.3 (d) 0.0725489 c What is the sixth smallest value in 9, -2/3, -196667, 1, -2, -5? 9 Which is the third biggest value? (a) -1 (b) 0.2 (c) 13/8 (d) -30.45 (e) -3/7 (f) 2 (g) 1/2 g What is the third smallest value in -2, -2/3, 9/8, -2163, -5? -2 Which is the second smallest value? (a) -2 (b) 0.915697 (c) 1 b What is the fourth biggest value in -1.7, -0.6, -3/14, -2/3, -0.3, -0.087? -0.6 What is the fourth smallest value in -125, -0.0135, -1, -61, 1? -0.0135 Which is the sixth smallest value? (a) 3 (b) -6 (c) -4/3 (d) -1/5 (e) -529 (f) -7 (g) -3/2 d Which is the third biggest value? (a) 112 (b) -9 (c) 0.17749 b Which is the third smallest value? (a) 2/13 (b) 5/3 (c) 3/8 (d) 3/2 (e) -2 (f) 2/23 (g) 1/8 g What is the fourth biggest value in 3/35, 0.5, -17, -1/5? -17 Which is the fifth biggest value? (a) -0.2 (b) -20/237 (c) 15/4 (d) 3 (e) -5 e Which is the fourth smallest value? (a) -0.0743 (b) -3/7 (c) -3 (d) 1 (e) -1/2 (f) 21/2 (g) -0.4 g Which is the fourth smallest value? (a) 9 (b) -1.7 (c) -3 (d) -4/5 (e) 0.4 (f) 0.2 (g) 11 f What is the second smallest value in -465, 0.3, -2/63, -18/5? -18/5 Which is the third biggest value? (a) -0.05 (b) 2 (c) -2058 (d) -0.2 d Which is the second biggest value? (a) -1345/4 (b) -4 (c) -7 (d) -1/5 (e) -0.0783 d What is the fifth biggest value in -34, 2, 5,	{ "pile_set_name": "DM Mathematics" }
+ 30p - 61. Let f be x(19). Suppose 0 = 2g + 4o - 5630 - f, 3g - 4o - 25985 = 0. Is g prime? True Let n = -16 + 17. Let i be -48210/(-4) + n. Suppose -7a = 359 - i. Is a prime? False Suppose -4f - 2259 = -q + 15, -2q + f = -4527. Let z = 4076 - q. Is z prime? False Suppose 4p - 4h + 8936 = 2p, -2h - 8912 = 2p. Let k = p + 8449. Is k composite? False Let p(r) = 3r - 45. Let s(q) = -q + 15. Let k(z) = 4p(z) + 11s(z). Let h be k(3). Is 54 - 1 - (12 + h) a composite number? False Suppose -5x - 3j = -0j - 868, 350 = 2x + 4j. Suppose -124 = -4h - 2q, 5h = q + x - 4. Suppose 32u + 977 = hu. Is u prime? True Let v = 81 + -76. Suppose -5m = 4u - 128251 - 9800, -5m = vu - 138050. Is m a composite number? False Suppose 4c - 8 = 0, -5b + 2767037 = 5c - 1393468. Is b composite? True Let d be (6/5)/(3/(-30)-4). Suppose db + 3o - 26060 - 1618 = 0, -b + 9224 = 3o. Is b composite? False Let h be (-6 + -1)1 - -2. Let i(w) = 32w*3 + 7w*2 - w - 16. Let x be i(h). Is x/(-6)(4 - 25/10) a prime number? False Let h = -262 + 286. Suppose -ha - 3503 = -25a. Is a a composite number? True Let i = 2302 - 2309. Let o(t) = -74t - 33t - 20 + 4t. Is o(i) prime? True Let s = -59159 + 111933. Is s composite? True Let j(w) = w3 + 11w*2 + 11w + 22. Let d be j(-10). Suppose -do - 2186 = -13o. Let n = o + -1137. Is n composite? False Let a(r) = r - 19. Let m be a(11). Let x = m - -10. Suppose 0 = -3g - 3q - xq + 1214, -5q = 4g - 1627. Is g composite? True Let g(i) = -186i - 739. Let k be g(-4). Let v be 1459 - -1(-1 - -1). Suppose kx - 651 = v. Is x a composite number? True Let r = 9429 + 27004. Is r composite? False Let o(y) be the first derivative of 441y2/2 - 2y - 73. Is o(7) prime? False Let o = -300 - -305. Suppose -3z = -ob + 70618, -4b - b + 70611 = 4z. Is b prime? False Suppose -95k = -90k - 150. Let v be ((-224)/(-140))/(4/k). Suppose -5q = vq - 112693. Is q a prime number? False Let b = -12114 - -12495. Let q = 34 + 212. Suppose g + q = -a + 615, 5a + b = g. Is g composite? True Suppose 173l - 2409312 = 125l. Is l a composite number? True Is (138047 - -6) + 0/(14 + -6) composite? False Let w be (4/8 - (-2 - 0))2. Is 341 + (1 - (6 - w)) composite? True Suppose 186 = b - 5m, m - 659 = -5b + 167. Let k(w) = -4w2 - 6w - 19. Let a be k(-5). Let g = a + b. Is g prime? False Let z be (-2)/5 - (-137)/5. Let t(g) = 2673g - 129 + zg + 128. Is t(1) a prime number? True Let m(h) = 310h - 12. Let o be 3/(-2)(-136)/51. Let x be m(o). Suppose -15f = -11f - x. Is f a composite number? False Let f = -142 + 156. Suppose -5w + 17q = fq - 18200, 7294 = 2w - 4q. Is w prime? True Let i(t) = -38t3 + t2 + 33t + 23. Suppose 199z - 24 = 203z. Is i(z) a composite number? False Suppose -18h + 21h = -g + 47188, 2g + 2h = 94396. Is g prime? False Suppose -35p - 544693 + 11989098 = 0. Is p a prime number? True Is (18 - (9 - 0)) + 854422 a composite number? True Let s be (-303)/(2 + -5) + -2. Suppose 0 = -3p - 2h + 2917, s = -3p - 5h + 3022. Is p a prime number? True Let j(r) = r3 - 14r*2 - 71r - 21. Let x be j(22). Let u = x + 3050. Is u a prime number? False Let b = 77836 + 75891. Is b a composite number? True Let c(p) = -48p3 + 1730p*2 - 5p - 16. Is c(13) a prime number? False Is ((-145)/(-58))/((-5)/(-38554)) prime? False Let x = -135 + 145. Suppose 0m = -5m - x, 4m = -2o + 5688. Suppose -o - 5080 = -4a. Is a composite? True Is (-10430609)/(-63) - 4/18 prime? False Is -7 + ((-1366162)/28)/((-2)/8) prime? False Let t(l) = 89l + 10874. Is t(7) prime? True Let m(g) = g*2 + 8g + 11. Let q be m(-8). Suppose -16f + qf = 400. Let c = f - -117. Is c prime? True Let s be (13970/8)/(-2 + 72/32). Suppose -5b = -5a + s, -2a + 3b + 2794 = 7b. Is a a composite number? True Let r = 193430 - -32783. Is r prime? False Let g(l) = 10l*3 + 2l*2 + 3l + 2. Let p be g(-1). Let d = p + -3. Is (-2)/(-6) - (3536/d + 4) composite? True Is (16 - 17)(1 - (414565 - 1)) a composite number? False Let m(i) = -4i2 + 26i - 50. Let a be m(4). Is (2 + (-5 - a))/((-7)/(-16723)) composite? True Let t be (-1)/(-2) - (-4)/(-56)7. Suppose t = 73j - 80j + 13783. Is j a prime number? False Let r(y) = 51429y*2 - 318y - 1235. Is r(-4) composite? False Let p be -1 + 5301 - (5 - 7). Suppose p = -2d + 69976. Suppose 5z - 14z = -d. Is z a composite number? False Let q(x) = -2x*2 + 23x - 8. Let s be q(11). Suppose u = 2t + 6, 0t - 26 = su + 5t. Is 5 + -5 + (100 - u)/2 a prime number? False Suppose -i + 167 = -160. Suppose -1283 = -5o + i. Is o + (-2 - -4) - -2 a composite number? True Suppose 510887 = 2h + 969. Is h a composite number? False Let j be 1/(3/12) - (4 + 15212). Let s = 25435 + j. Is s a prime number? True Let s(k) = -k*3 + 4k*2 + 7k - 9. Let w(z) = z*2 + 16z - 63. Let l be w(-19). Is s(l) a prime number? False Let k = 101 + -95. Suppose -3d = -5m - 7, -19 = -3d - m - k. Suppose 1542 = 3t + 3y, -d - 11 = 5y. Is t composite? True Suppose 916x - 1477960 = 828x. Is x composite? True Let v be (14/(-6) + 1)/((-4)/6). Suppose c + 2j + j = 5510, -22082 = -4c + vj. Is c prime? True Let o = 181254 - -2224555. Is o prime? False Let v = 112508 + 257195. Is v a prime number? True Let g(f) = 780f*2 + 14f - 12. Let u be g(-8). Suppose 0 = 6q - 166898 + u. Is q a composite number? True Let z be 40316/18 - 12/(-54). Let v be ((-1486)/4)/(3/6). Let r = z + v. Is r a prime number? False Suppose -2a + 9704 = -3d, 0 = a - 2d - d - 4843. Is a a prime number? True Let f(q) be the second derivative of q6/360 - q5/12 + 35q4/24 - 13q*3/6 - 5q. Let z(t) be the second derivative of f(t). Is z(18) a prime number? True Let u be ((-90)/12)/((-6)/4). Is 3/1 - (-2445 - (0 + u)) prime? False Is (-4 + 6)(0 + -1)/(23/(-7986221)) composite? True Let s = -118685 + 167788. Is s a prime number? True Let m = -25263 - -40100. Is m composite? True Let r = 27 - 23. Let f be r + 1 + -3 + 221. Suppose 2i - u - f = 566, -3i + 5u + 1166 = 0. Is i a prime number? True Let v be 1/((-1)/1(-3)/324). Let z = v + 850. Is z a prime number? False Suppose 24p - 256 = 8p. Let j(c) = -c3 + 19c*2 - 17c + 7. Is j(p) prime? True Is (847820/3)/(146/219)1/2 composite? True Let h(f) = -5f + 89. Let z be h(17). Suppose -zl - 4g = -10204, -12767 = -9l + 4l - g. Is l a composite number? True Suppose -5v + 4r + 23 = 0, -13 = -2v - 3v - r. Suppose -5c + 8767 = 4m - vm, -c + 1757 = 2m. Is c a prime number? True Suppose -112d + 482740 + 14675 = -320969. Is d a prime number? True Is 207742032/504 + ((-2)/(-8) - 10/(-56)) a prime number? True Suppose -860w = -849w + 47993. Let h = 20418 - w. Is h composite? False Suppose -5k = 842 - 1117. Let p be 2077/2 - 2/4. Is (p/10)/(11/k) composite? True Is -33 - 2135/(-65) - 1364822/(-26) a composite number? True Suppose -25y + 22y - 24 = 0. Let o be (-3 - -3260)/(-7 - y). Let p = 4656 - o. Is p prime? True Suppose -4v + 300145 = 3a, 3a - 8v = -9v + 300160. Is a prime? False Let n be 1(-65)/10(-56)/1. Let t = 786 - n. Is t composite? True Suppose -39k - 15k + 123k = 351763863. Is k a composite number? True Suppose -137569 = 42x - 43x - 5v, x - 2v - 137597 = 0. Is x a composite number? True Suppose -x - 1 = 4k, -4k - 1 + 6 = 3x. Let y = k + 128. Suppose 2m - 133 = -u, u = -0u + 4m + y. Is u composite? False Let b be (-2)/9 + (-48822)/(-27). Suppose 4x - 2w - 7250 = 0, 5x + 2w = 6x - b. Is x a prime number? False Suppose 0 = 5i - f - 743728, 5i = 6i + 3f - 148768. Is i a composite number? False Let f(p) = 16p*2 - 8p - 5. Let w = 86 - 78. Let u(k) = k*3 - 9k*2 + 8k + 5. Let o be u(w). Is f(o) a composite number? True Let f be 2/4 - (-10)/(-20) - -10. Is f/4(18976/20 + 12) a prime number? False Suppose 4o - 3h = 275750, 6h - 30 = h. Is o a prime number? False Suppose 4r = b + 18, -4b - 28 = r - 6r. Let d be 397(r + 0 + -1). Suppose -5i - 4643 = -4a, -4i - 46 = a - d. Is a a prime number? False Let w(g) = g + 1 - 2 + 3 - 4g*2 + 2195g*3 + 3117g*3. Is w(1) prime? False Let s = -49 - -51. Suppose -3h = 5x - 0h - 74618, -5h = sx - 29832. Suppose 16557 = 19*d - x. Is d a composite num	{ "pile_set_name": "DM Mathematics" }
4 + 8o*3 + 10 - wo*2 + 128o. Factor v(q). -2(q - 4)3 Let j(n) be the first derivative of -6n*2 - 21/2n + 8 - 1/2n3. Factor j(w). -3(w + 1)(w + 7)/2 Let q(s) be the third derivative of -s5/180 + 13s*4/18 - 32s*3/3 - 1009s*2. What is p in q(p) = 0? 4, 48 Let g be 7 + (-6)/(-6)30. Suppose -11j = -gj + 52. Determine x so that 4/19 - 10/19x - 6/19xj = 0. -2, 1/3 Let j(c) be the third derivative of -c6/30 + 8c5/5 + 17c*4/2 + 52c*3/3 - 2569c*2. Find q, given that j(q) = 0. -1, 26 Let p(z) = 28z*3 - 22z*2 - 72z + 3. Let q(y) = 57y3 - 45y*2 - 144y + 3. Let l(i) = -9p(i) + 5q(i). Factor l(d). 3(d - 2)(d + 1)(11d + 2) Let c(k) be the second derivative of -k*6/60 + 113k*5/40 - 303k*4/4 + 873k*3 - 5130k*2 + 9k - 12. Suppose c(l) = 0. Calculate l. 6, 95 Suppose 13r - l - 41 = 0, 35r - 6l = 31r + 98. What is j in -729/4 - 1/4jr + 27/2j = 0? 27 Let b = -197853 + 197855. What is p in -1/5p3 + 4/5p + 0pb + 0 = 0? -2, 0, 2 Let n(g) be the third derivative of 0g + 1/2g3 - 92g*2 + 0 + 1/160g*6 + 3/8g*4 - 1/448g*8 + 11/80g*5 - 3/280g7. Suppose n(d) = 0. Calculate d. -2, -1, 2 Let q(m) = -m3 - 3m2 + 20m + 15. Let d be q(-6). Suppose -14k2 + 11k*d + 2k2 + k3 - 8k3 + 4k*2 - 12k = 0. What is k? -1, 0, 3 Let z(b) be the first derivative of -b*6/24 + 3b*5/5 + 15b*4/4 + 16b3/3 - 716. Factor z(m). -m2(m - 16)(m + 2)*2/4 Let d(k) be the third derivative of -69k*2 + 0k*3 + 1/150k*6 + 0k*4 + 1/525k*7 + 0 - 2/75k*5 + 0k - 1/1680k8. Factor d(y). -y2(y - 2)*2(y + 2)/5 Let q be 38/19 - (0 + -2 - -3). Let l(s) = -s4 + s3 + s*2 + s - 1. Let j(m) = -8m*4 + 8m*3 + 3m*2 + 3m - 3. Let h(n) = qj(n) - 3l(n). Factor h(d). -5d3(d - 1) Let n = -2 - -4. Let v be n/2 - (-7 - (-9 - -4)). Factor -6k - 11k*v - 23k*3 + 15k*2 - 23k*3 + 45k*3 + 3k*4. 3k(k - 2)(k - 1)*2 Factor 0 + 1/10m*4 + 39/10m*2 - 27/10m - 13/10m3. m(m - 9)(m - 3)(m - 1)/10 Let j be 436/327 - 7/6. Let r(d) be the second derivative of 0 + 0d3 + 14d + jd4 + 0d*2. Factor r(z). 2z*2 Factor -4l*3 + 560l - 216l2 - 23l*3 - 1492l*2 + 34l*3 + 5l*3 + 1136. 4(l - 142)(l - 1)(3l + 2) Let x(l) be the first derivative of 4l*5/5 + 2l*4 - 164l*3/3 - 84l*2 + 315. What is a in x(a) = 0? -7, -1, 0, 6 Let p be (180/401/6)/((-20)/(-80)). Let 6/7j2 + 2/7j*p + 0j + 0 = 0. Calculate j. -3, 0 Find y such that 1778y5 - 12y - 591y5 - 594y*5 + 12y*2 - 11y4 - y4 - 590y5 + 9y*3 = 0. -1, 0, 1, 2 Let x = -4996 - -4998. Let d(q) be the first derivative of 2/27q*3 + 50/9q + x - 10/9q2. Factor d(s). 2(s - 5)*2/9 Suppose -8/3j*2 + 16j + 1/6j5 + 56/3 - 14/3j*3 - 1/2j4 = 0. What is j? -2, 2, 7 Let i(c) be the first derivative of -c3/7 - 2433c2/14 + 4878c/7 + 7301. Factor i(p). -3(p - 2)(p + 813)/7 Factor -154 + 139x2 - 100x*3 + 10 - 214x*2 - 661x*2 - 84x*2 + 704x. -4(x + 9)(5x - 2)2 Let f(z) be the third derivative of z7/1050 - 49z*6/200 + 558z*5/25 - 22103z*4/30 - 2z*2 - 39z + 108. Factor f(g). g(g - 62)2(g - 23)/5 Let t = -39003/2 - -19502. Let f(q) be the first derivative of 1/3q6 - tq*4 + 0q + 34 + 0q2 + 4/5q*5 - 4/3q*3. Let f(h) = 0. Calculate h. -2, -1, 0, 1 Let h be (20/(-6) + 0)/((-10)/(-60)). Let r = h + 23. Suppose -27v*4 + 9v*4 - rv + 7v4 - 18v*3 - 12v2 - v4 - 3v5 = 0. What is v? -1, 0 Let g(t) = 8t - 167. Let w be g(20). Let v be 4/(-28) - 1/w. Factor -2/5y2 + 2/5y*5 - 6/5y*4 + 0 + vy + 6/5y3. 2y*2(y - 1)*3/5 Factor -640/3 - 4/3v*2 - 328/3v. -4(v + 2)(v + 80)/3 Let o(r) be the first derivative of -3r4/4 + 8r*3 - 33r*2/2 - 60r - 250. Factor o(h). -3(h - 5)(h - 4)(h + 1) Let o(c) = -16c*3 - 95c*2 - 60c - 11. Let u(a) = 3a3 + 18a*2 + 12a + 2. Let l(q) = 10o(q) + 55u(q). Suppose l(d) = 0. What is d? -6, -2, 0 Let j(i) = -i*2 + 2i + 11. Let r be j(-2). Find g such that -54 - 27 - rg2 + 31g - 67g = 0. -9, -3 Let x(n) = -17n*2 + 4253n - 903113. Let a(d) = 140d2 - 34025d + 7224900. Let f(u) = -3a(u) - 25x(u). Solve f(v) = 0 for v. 425 Let r(f) be the second derivative of 4/3f3 + 9/2f*2 - 1/12f*4 - 44f + 0. Factor r(x). -(x - 9)(x + 1) Let p(g) be the third derivative of -g7/105 + g6/6 - 2g*2 + 1126g. Factor p(s). -2s3(s - 10) Factor 2072n + 0n*2 + 2n - 76n + 1886n - 4n2. -4n(n - 971) Let x(o) = -195o + 784. Let m be x(4). Let f be ((-3)/(-6))/((-1)/(-32)). Factor -fp2 + 56p - mp3 - 42 - 12p + 18. -4(p - 1)2(p + 6) Let j(h) be the first derivative of -h*4/4 - 181h*3 - 73983h*2/2 - 73441h - 4602. Find b, given that j(b) = 0. -271, -1 Let i(f) = 18f + 3. Let c(a) = 17a - 153. Let m be c(9). Let z be i(m). Factor -21/5y2 - 3/5y*z - 24/5y + 48/5. -3(y - 1)(y + 4)*2/5 Let t(i) be the first derivative of -3/2i*6 + 8i*3 + 0i*2 + 0i - 111 - 27/2i4 - 51/5i*5. Suppose t(k) = 0. Calculate k. -4, -2, 0, 1/3 Let f = -1615794 - -1615799. Suppose 1221y*3 + 2544y*2 - 279y*4 + 27/2y*f + 363 - 4125/2y = 0. What is y? -2, 1/3, 11 Let x(v) be the third derivative of 0 + 7v - 11/36v*4 + 4v*2 - 2/9v*3 - 19/180v*5 - 1/80v*6. Suppose x(j) = 0. What is j? -2, -2/9 Let t be 8 - 2 - (-1246)/(-210). Let j(m) be the first derivative of -2/5m*2 + 4/5m + tm3 + 1. Determine x, given that j(x) = 0. 2 Suppose 123w = 64w - 30444. Let c be 29/(-8) - w/129. Factor -cs*5 + 0 + 0s + 0s2 + 0s*4 + 3/8s*3. -3s*3(s - 1)(s + 1)/8 Factor -28n + 1/2n4 + 71/2n*2 - 8n*3 + 0. n(n - 8)(n - 7)(n - 1)/2 Let -2/15j4 + 2/15j*5 - 34/15j*3 + 8/3 + 106/15j*2 - 112/15j = 0. What is j? -5, 1, 2 Let u = 42595/8 + -5324. Let w(c) be the first derivative of 3c + 3/4c2 - c3 - uc4 + 10. Factor w(o). -3(o - 1)(o + 1)(o + 2)/2 Let s(t) be the first derivative of -t*4/6 - 16t*3/3 - 28t*2 - 46t - 60. Let k(n) be the first derivative of s(n). Factor k(u). -2(u + 2)(u + 14) Suppose -6l + 84 = l. Factor lx*2 + 24x - 25x2 + 28 + 9x*2. -4(x - 7)(x + 1) Let f(p) be the second derivative of 15/2p*3 + 1 - 11p + 35/12p4 + 5p2. Find r such that f(r) = 0. -1, -2/7 Let d(l) be the second derivative of -l6/60 - 93l5/10 - 185l*4/12 + 31l*3 + 371l*2/4 + 1323l - 1. Solve d(v) = 0 for v. -371, -1, 1 Let d = 1393 + -1389. Suppose dj - 10 = -o - 18, 5o - 3j - 29 = 0. Factor 24/5c - 4/5c2 - o. -4(c - 5)(c - 1)/5 Let k = 115 - 67. Factor -kg + 9g + 3g*3 + 15g*2 + 56 - 35. 3(g - 1)*2(g + 7) Factor 66l2 + 0 - 118/9l*3 - 20/9l. -2l(l - 5)(59l - 2)/9 Suppose 78t - 15t = -147t + 420. Let d(r) be the first derivative of 84/13r*3 - 49/26r*4 - 60/13r*t + 16/13r + 22. Factor d(j). -2(j - 2)(7j - 2)2/13 Let q be (20818/1813 - 78/1443)/(2/2). Factor 32/7o - 4/7o2 + q. -4(o - 10)(o + 2)/7 Factor -2/9v*2 + 530/9v + 0. -2v(v - 265)/9 Let u(x) = 13x4 + 3x*3 - 13x*2 + 17x - 8. Let q(m) = 3m4 + m3 - 2m + 1. Let v(p) = -4q(p) + u(p). Factor v(k). (k - 3)(k - 1)*2(k + 4) Let y(p) = -3p3 + 807p2 + 21. Let k(d) = -d3 + 404d2 + 12. Let u(m) = -7k(m) + 4y(m). What is s in u(s) = 0? 0, 80 Let l(g) = g + 7 - 1 + 8. Let v be l(-11). Let o(q) = -6q*3 - 6q*2 + 9q. Let k(i) = -i*4 + 6i*3 + 5i*2 - 8i. Let b(a) = vk(a) + 2o(a). Factor b(c). -3c(c - 2)(c - 1)(c + 1) Suppose -c + 19 = -4l, -c - 4l - 7 = 6. Suppose -q - 2q + 12 = -ct, 0 = q + 2t + 2. Solve -z - qz4 - z2 + 3z4 + 5z*3 - 4z*3 = 0. -1, 0, 1 Determine z, given that -25/4z*2 - 1/4z*3 - 143/4 - 167/4z = 0. -13, -11, -1 Factor -3/8d3 + 441/8 + 435/8d*2 + 879/8d. -3(d - 147)(d + 1)*2/8 Let v be 48/128 + 27/(-72). Let i(h) be the first derivative of vh*2 - 23 + 0h + 1/28h4 - 1/21h3. Factor i(o). o2(o - 1)/7 Let z(f) be the second derivative of -f5/30 + 7f*4/4 - 20f*3/3 + 57f*2 + 96f. Let m(x) be the first derivative of z(x). Factor m(y). -2(y - 20)(y - 1) Let j(i) = i*2 - 12i + 45. Let t be j(7). Factor 25 - 2s3 - 3s*3 + ts - 25 + 5s2. -5s(s - 2)(s + 1) Facto	{ "pile_set_name": "DM Mathematics" }
r) wrt r. 5878 Let a be 3/1 - (-60)/30. Find the second derivative of 14k5 + 4 + 7k*5 - 4k - 6k + 27k*a wrt k. 960k*3 Differentiate -1875 - 619c*2 + 361c*2 - 1558c*4 - 266c*4 + 258c*2 with respect to c. -7296c*3 Let n be (0 + 3/(-5))(-3 + 8). Let l be ((-80)/(-60))/((-2)/n - 0). Find the third derivative of -12tl + 52t*6 + 0t*4 + 0t*4 - 59t*6 wrt t. -840t*3 Let r(x) be the second derivative of 3003x5/20 - x4/6 - 67x3/6 + x2/2 - 6784x. Find the third derivative of r(s) wrt s. 18018 Let b(z) = 4z2 - 29z + 10. Let m be b(7). Let y be (4/(-8))/((-2)/12). What is the second derivative of yx3 - x3 - 21x - 6x3 + xm wrt x? -18x Find the third derivative of -7253q2 + 21q + q*5 - 14q*3 - 4729q*4 - 21q + 4610q4 wrt q. 60q*2 - 2856q - 84 Differentiate 628x4 + 899x*4 - 179x*4 + 8 wrt x. 5392x*3 What is the second derivative of 81v*3 - 242v*2 + 2v + 3142 + 308 - 16v3 + 183v*2 + 63v*3 wrt v? 768v - 118 Let u(y) = -y*3 - 18y*2 + 14y - 30. Let d be u(-19). Let c = d - 65. What is the derivative of cv4 + 4v*4 + 9 - 19v*4 wrt v? -60v*3 Let s(y) be the third derivative of 0y - 1/40y6 - 73/6y*3 + 0 + 0y*5 + 0y*4 - 1/105y*7 + 43y*2. What is the first derivative of s(i) wrt i? -8i*3 - 9i*2 Let q(w) be the second derivative of 3w*6/2 + 5w4/12 + w3/3 - 7727w2/2 - w + 2263. What is the derivative of q(p) wrt p? 180p*3 + 10p + 2 Let o(n) = 5627n4 - 5n*3 + 633n - 2. Let l(a) = 2811a4 - 3a*3 + 316a - 1. Let r(y) = -5l(y) + 3o(y). What is the second derivative of r(v) wrt v? 33912v2 Let s(i) be the second derivative of -386i6/15 - i4/12 + 16i3/3 + 6i*2 + 628i. Find the second derivative of s(r) wrt r. -9264r2 - 2 Suppose -4m - 12 = -2n, 5n - 2m = -3m + 30. Let q = n - 0. What is the first derivative of qs - 9s - 15s + 8 - 21 wrt s? -18 Find the second derivative of 24f*3 + 3f + f*5 + 14f*2 + 59f*3 - 173f*3 - 984 + 19f*3 wrt f. 20f*3 - 426f + 28 Let b = 2188 - 640. Differentiate 1439 - 37m - 28m - b wrt m. -65 Let a(k) be the second derivative of 365k7/42 - 179k*3/2 + 3k*2/2 + 1194k. Find the second derivative of a(x) wrt x. 7300x3 Let q be -3 + 1 + 4 - (-2 + -1). Let n be q(1 + 0)6/5. What is the first derivative of -22p + 4 - 13 + 0 - n wrt p? -22 Let v(j) be the second derivative of j*5/10 + 35j4/4 - j3/6 - 7203j2/2 - 7521j. Differentiate v(s) wrt s. 6s2 + 210s - 1 Let r = -16 - -42. Let s = r + -20. What is the derivative of 314 + sa + 22a - 306 - 6a wrt a? 22 Let m(n) be the second derivative of 475n*7/3 - 3n*3/2 - 55n*2/2 + 1574n + 1. Find the second derivative of m(w) wrt w. 133000w3 Let j(f) = 176f*2 + 103. Suppose -5o = t - 14, -t = o + 3t + 1. Let m(r) = 58r*2 + 34. Let p(a) = oj(a) - 8m(a). Differentiate p(c) wrt c. 128c Let u = 141 + -66. Find the second derivative of 33z - 41z - 52z - 53z + uz2 wrt z. 150 Let q = -156 + 108. Let d = -46 - q. What is the derivative of n - 4n - n + 19 - dn wrt n? -6 What is the third derivative of -1467h*2 - 2808h*5 - 5040h*5 - 56550h + 56550h + 209h*5 wrt h? -458340h*2 Let r(m) be the first derivative of -84m*5/5 + 1048m + 33. What is the derivative of r(i) wrt i? -336i3 Let v(j) be the second derivative of 436j*7/3 + 61j*4/4 + 19j*2/2 + 5j + 18. What is the third derivative of v(a) wrt a? 366240a2 Find the third derivative of -752d*4 + 14 - 168 + 2d3 - d5 - 91 - d*2 + 51 - 2d wrt d. -60d2 - 18048d + 12 Let t(g) be the third derivative of -131g8/336 + g5/60 - 512g*3/3 + 3405g*2. What is the third derivative of t(j) wrt j? -7860j*2 Suppose -28 = 3f + 2. Let x be (12/f)/(9/(-30)). What is the first derivative of -x + 4 - 17g + 24 wrt g? -17 Let i(t) = 9t*3 + 5t*2 + 70t - 3424. Let p(y) = 4y3 + 3y*2 + 35y - 1712. Let h(l) = -3i(l) + 5p(l). Differentiate h(w) with respect to w. -21w2 - 35 Let g(u) = -2u*4 + 6u*3 - 26u2 + 743. Let a(c) = c4 - 5c3 + 27c*2 - 744. Let r(i) = 6a(i) + 5g(i). Find the first derivative of r(q) wrt q. -16q*3 + 64q Let l(a) = a + 123. Let h be l(25). What is the second derivative of -243i + 186i*3 + hi*3 + 186i*3 - 564i*3 wrt i? -264i Let r(m) be the first derivative of -25m6 + m4/4 - m2 - 1265m - 2048. What is the second derivative of r(o) wrt o? -3000o3 + 6o Suppose -14z + 19z - 5 = 0. Let g(u) = 59u2 + 6u - 1. Let p(h) = h*2 - 1. Let j(o) = zp(o) + g(o). Find the second derivative of j(w) wrt w. 120 Let l(p) = 12p2 - 5p + 93 - 8p2 - 4p3 - 11. Let m(w) = -w3 - w + 1. Let f(i) = l(i) - 5m(i). Differentiate f(q) with respect to q. 3q*2 + 8q Let f(v) = -5215v + 5471. Let w(u) = 1741u - 1823. Let k(c) = 3f(c) + 10w(c). Differentiate k(h) with respect to h. 1765 Let z(s) = 841s2 - 6s + 1327. Let n(m) = m*2 - 2m + 2. Let u(d) = -6n(d) + 2z(d). Differentiate u(y) wrt y. 3352y Let u be 182/((-30)/(-395)). Suppose 3b - 5b + 257 = 3o, -u = -4b + 2o. What is the second derivative of 28j + bj5 - 2j*2 + 2j*2 - 112j*5 wrt j? 180j*3 Suppose 532 = 46v + 220v. Let u(h) be the first derivative of -16h + 0hv - 9 - 19/4h*4 + 0h*3. What is the derivative of u(d) wrt d? -57d*2 Let f(x) be the second derivative of 0x*3 - 97/12x*4 - 13/30x*6 + 0 + 0x*2 - 95x + 0x5. What is the third derivative of f(b) wrt b? -312b Let i be -1 - -3 - 4 - 2 - 1. Let q be 2(i + (-75)/(-10)). What is the derivative of -14f*4 - 19f*4 - q + 16 wrt f? -132f*3 Let s(d) be the first derivative of 60 + 0d*2 - 50/3d*3 + 0d + 153/4d4. What is the third derivative of s(u) wrt u? 918 Suppose -3h - h + 100 = 0. Suppose 3y - h = 32. Find the third derivative of 11g*5 + yg*2 + 2g*3 - 55g*2 - 2g*3 wrt g. 660g*2 Let z(s) = -1182s*3 + 831. Let m(i) = 8275i*3 - 5816. Let n(t) = 2m(t) + 15z(t). What is the first derivative of n(x) wrt x? -3540x*2 Suppose 45 + 9 = 9n. What is the second derivative of 28i - 16i + ni + 46i*4 wrt i? 552i*2 Let o = 6289/2 + -3139. Let z(r) be the first derivative of -7r*3 + 0r - or2 - 17. What is the second derivative of z(k) wrt k? -42 Let d(s) = -13s*2 - s + 2. Let u be d(0). Find the third derivative of -60o*2 - 18 - 61o*2 - 22 - 38o*5 + 119o*u wrt o. -2280o*2 Let l(s) be the third derivative of 121s*5/12 - 333s*3/2 - 7s*2 + 112. Differentiate l(t) with respect to t. 1210t Find the second derivative of 19909w4 + 4w*3 + 63 - 7w + 19913w4 - 4w*2 + 2w*3 - 39821w*4 wrt w. 12w*2 + 36w - 8 Let n(b) = -b + 1. Let h(o) = 8o2 - 5o + 2. Let j be ((-4 - -10)/(-6))/(-1). Let l(z) = jh(z) - 6n(z). Find the second derivative of l(p) wrt p. 16 Let a(s) = 220s4 + 3s*2 - 4s + 16. Let j(p) = -437p4 - 7p*2 + 9p - 33. Let t(n) = -7a(n) - 3j(n). What is the second derivative of t(b) wrt b? -2748b2 Let q(l) be the third derivative of -6l7/35 - l6/30 + l*4/24 - 3433l*3/2 - 40l*2 - 8l + 4. What is the derivative of q(t) wrt t? -144t3 - 12t*2 + 1 Let k(d) = -271d*3 + 6d*2 + 654d - 3. Let t(b) = 539b3 - 10b*2 - 1309b + 5. Let s(i) = 5k(i) + 3t(i). What is the second derivative of s(p) wrt p? 1572p Find the third derivative of 10677a*2 - 4a*3 - 300a*4 - 9a*3 + 8a*3 - 5a*3 wrt a. -7200a - 60 Let z(x) be the second derivative of -x*7/21 - 771x*5/20 + 4463x*4/12 + x + 512. What is the third derivative of z(y) wrt y? -120y*2 - 4626 Let c(u) = -257u*2 + 286. Let w(v) be the first derivative of -86v*3/3 + 95v + 58. Let i(m) = 6c(m) - 17w(m). Differentiate i(r) wrt r. -160r Find the third derivative of -1759b*6 - 1358b*2 + 389157b*3 - 389157b*3 wrt b. -211080b*3 Let c be 72/310/15. Suppose -c = -4q, -4q + 11 = -j - 1. Differentiate -2 + 7 - 10kj - 13k*4 - 7k*4 with respect to k. -120k*3 Let k(x) be the second derivative of -37x*5/4 - 688x*3/3 - 1982x. Find the second derivative of k(s) wrt s. -1110s Let c = 227 - 198. Find the first derivative of 43g + 32g3 - c + 38g - 80g wrt g. 96g**2 + 1 Let s(r) be the third derivative	{ "pile_set_name": "DM Mathematics" }
6r Collect the terms in 41690335 - 41690335 + 2i. 2i Collect the terms in 92898s*3 - 5 + 5. 92898s*3 Collect the terms in 405k*3 + 255 + 258 - 516. 405k*3 - 3 Collect the terms in -247 + 256 - 6x + 7x. x + 9 Collect the terms in 76f*2 - 2449f*2 - 481f*2 - 77f*2. -2931f*2 Collect the terms in -8398q + 16795q + 38q*2 - 8397q. 38q2 Collect the terms in 90g*3 + 116g*3 - 323g*3 + 98g*3. -19g*3 Collect the terms in -2f + 47f3 + 70f*2 - 70f*2 - 42f*3 + 2f. 5f3 Collect the terms in 4660g*3 - 4595g*3 - 1 + 1. 65g*3 Collect the terms in -18r - 100794 + 100794 + 2r2. 2r*2 - 18r Collect the terms in 2769o2 + 2922o*2 - 5695o*2. -4o*2 Collect the terms in -8b + 19b + 22b - b. 32b Collect the terms in -25o - 20o - 14o - 15o + 75o. o Collect the terms in 372 + 89o - 36o - 372 - 51o. 2o Collect the terms in 51a - 1104a*3 - 1107a*3 + 2212a3. a3 + 51a Collect the terms in 52 - 107 - 116 + 19 + 2v. 2v - 152 Collect the terms in 53l*2 + 49l2 + l2 - 43l2. 60l*2 Collect the terms in -25980 + 25980 + 73s*3. 73s*3 Collect the terms in -35w*2 + 56w*2 - 289w*2. -268w*2 Collect the terms in -593f - 616f + 1172f. -37f Collect the terms in 188 + 11h + 347 - 54 + 15. 11h + 496 Collect the terms in -9 + 9 - 9027a + 9024a. -3a Collect the terms in -a - 2a + 9a + 22460. 6a + 22460 Collect the terms in -6 - 14n + 15n - 6 - 256n*3. -256n*3 + n - 12 Collect the terms in -61542l*2 + 61542l*2 + 2l*3. 2l*3 Collect the terms in 1398f + 2070f - 10f*2 + 12f*2. 2f*2 + 3468f Collect the terms in -1 + 6399z2 + 0 + 686z*2. 7085z*2 - 1 Collect the terms in -450198b*3 + 900384b*3 - 450194b*3. -8b*3 Collect the terms in 29663x*2 - 58899x*2 + 29234x*2. -2x*2 Collect the terms in 94d*2 - 193d*2 + 86d*2. -13d*2 Collect the terms in 474l*3 + 468l*3 - 1412l*3 + 476l*3. 6l*3 Collect the terms in 73f - 12f - 23f - 25f - 17f. -4f Collect the terms in -14583 + 87x + 14583. 87x Collect the terms in 9 + 5 + 10v*2 - 14 - 16v*2. -6v*2 Collect the terms in 10300l - 5155l - l2 - 5145l. -l*2 Collect the terms in -341f*2 + 74f*2 - 27f*2 - 28f + 27f. -294f*2 - f Collect the terms in -440c*3 + 10c*2 - 3c*2 - 7c*2 + 94c*3. -346c*3 Collect the terms in n + 3155n*2 - 208n*2 - n. 2947n*2 Collect the terms in 22t*2 - 9t - 40t2 + 13t*2 + 23t*2. 18t*2 - 9t Collect the terms in 5a + 16 - 3 - a + 0 - 8. 4a + 5 Collect the terms in -2159k - 4 - 7 + 11 + 2162k. 3k Collect the terms in -5f*2 - 37f + 83f - 55f. -5f2 - 9f Collect the terms in -26 - 423d3 + 26 - 2280d*3. -2703d*3 Collect the terms in -19089z*2 - 1148z*3 + 19089z*2. -1148z*3 Collect the terms in 17 + 19 - 146470603h + 146470604h. h + 36 Collect the terms in -122x*2 - 176x*2 - 27x*2 + 67x*2 - 267x*2. -525x*2 Collect the terms in -26z*2 - 198858z + 198858z. -26z*2 Collect the terms in 21i*3 - 43i*3 + 46i*3 - 3. 24i*3 - 3 Collect the terms in -1 - 19 - 40d*3 + 45 - 25. -40d*3 Collect the terms in 965 - 965 + 39x*3 + 45x*3 - 86x*3. -2x*3 Collect the terms in 16n*3 + 6n*3 + 662 - 662 - 9n*3. 13n3 Collect the terms in p3 - 15274p + 15274p - 6p3. -5p*3 Collect the terms in -3s*2 - 5 + 4 - 4s + 11 + 10s2. 7s*2 - 4s + 10 Collect the terms in -5y + 66216 - 66216. -5y Collect the terms in 4b2 - 3b*2 - 470b3 - b2 + 239b3 + 234b*3. 3b*3 Collect the terms in -3s*3 + 2s*3 + 100s*3 + 77s*3. 176s*3 Collect the terms in 1602w*3 - 751w*3 - 609w*3. 242w*3 Collect the terms in -7 + 7 - 285h + 295h. 10h Collect the terms in -4g + 4g + 280395g3 - 280409g*3 - 2. -14g*3 - 2 Collect the terms in 2n*3 + 993n + 0 + 3 + 1489n. 2n*3 + 2482n + 3 Collect the terms in 723l3 - 237l*3 - 253l*3 - 236l*3. -3l*3 Collect the terms in -843x*3 + 331x*3 + 411x*3. -101x*3 Collect the terms in 7s*2 + 11s*2 - 12s*2 - 6s + 24s2. 30s*2 - 6s Collect the terms in -10 - n + 12n + 7n. 18n - 10 Collect the terms in 2d*3 - 49847138 + 49847138. 2d*3 Collect the terms in -45i*2 + 98i*2 + 59i*2 + 24i*2 + 74i*2. 210i*2 Collect the terms in 253 + 2x + 255 - 1073 + 284 + 260. 2x - 21 Collect the terms in 6 + 4 - y2 - 6y + 31y + 0y2. -y2 + 25y + 10 Collect the terms in -8c*2 + 20c2 + c3 - 17c2 + 8c - 8c2 + 13c2. c3 + 8c Collect the terms in -30091601u + 30091601u + 49u*2. 49u*2 Collect the terms in -23536s - 23539s + 3 + 4s*3 + 47075s. 4s3 + 3 Collect the terms in 21784126192 - 21784126192 - 12q. -12q Collect the terms in -4136 + 16860n + 4136. 16860n Collect the terms in -17h*3 - 130h*2 + 254h*2 - 124h*2. -17h*3 Collect the terms in 346 - 3u + 286 - 4u + 418. -7u + 1050 Collect the terms in 2w - 5w - 57435 - 36w + 57437. -39w + 2 Collect the terms in -3076 - 3080 + 6156 - 2i - 61i*2. -61i*2 - 2i Collect the terms in -28j + 78j + 76j2 - 29j - 21j. 76j*2 Collect the terms in -856n + 399n + 456n. -n Collect the terms in -285a + 2a*2 - 307a + 592a + 0a*2. 2a*2 Collect the terms in -15 - 9523a*3 - 20 + 9519a*3. -4a*3 - 35 Collect the terms in 795c*3 + 40c*2 - 790c*3 - 40c*2. 5c*3 Collect the terms in -3629833c + 3629833c + c2. c2 Collect the terms in -4186 - d - 4196 + 8382 + 48d. 47d Collect the terms in -91351w*2 + 45699w*2 + 45691w*2. 39w*2 Collect the terms in -12q + 12q + 532q*2 - 270q*2 - 265q*2. -3q*2 Collect the terms in -34w - 3w - 17w + 88w - 19w. 15w Collect the terms in 4q + 104q - 124q + 4q + 4q + 10q. 2q Collect the terms in 16 - 16 - 3w2 + 26w - 29w. -3w*2 - 3w Collect the terms in -791w2 + 916w*2 + 0w + 2w + 2651w*2. 2776w*2 + 2w Collect the terms in -10616l + 5298l + 5334l. 16l Collect the terms in 29f - 23f + 40f. 46f Collect the terms in -375i - 16445i*3 + 375i - 4314i3. -20759i*3 Collect the terms in 11a - 33a + 11a - 6 + 6a. -5a - 6 Collect the terms in -1343o - 1307o + 2664o. 14o Collect the terms in 8z - 7 - 7 + 3z*2 - 10z. 3z2 - 2z - 14 Collect the terms in -110083k3 + 110034k*3 + 3 - 3. -49k*3 Collect the terms in -2645q*3 + 5281q*3 - 2640q*3. -4q*3 Collect the terms in 110 - 237 - 29m + 130. -29m + 3 Collect the terms in 54599 - 54599 + 265w. 265w Collect the terms in q2 - 6q*2 - 8q*2 + 42 + 14q2. q2 + 42 Collect the terms in -2 - 1 + 0 + 2k3 - 3k3. -k3 - 3 Collect the terms in 0g2 + 51g - 49g + 9g*2. 9g*2 + 2g Collect the terms in -4449m3 + 22m*3 - 3171m*3. -7598m3 Collect the terms in -74 + 23 + 33 - o2 + 18. -o*2 Collect the terms in 18c - 24c + 2c + 8c - 2c - c. c Collect the terms in 4t - 23t + 2t - 6t + 10t. -13t Collect the terms in -828 + 28s - 825 + 1653. 28s Collect the terms in 9380q + 9449q - 18628q. 201q Collect the terms in 0 + 0 + 0 - 368m2. -368m*2 Collect the terms in 366146t + 366128t - 1098420t + 366148t. 2t Collect the terms in -43258l2 + 43260l*2 - 1354 + 1354. 2l*2 Collect the terms in -103x*2 + 99x*2 - 4x - 7x + x. -4x*2 - 10x Collect the terms in 72 + 18706t3 - 72. 18706t*3 Collect the terms in 272c - 128c - 30c*2 + 15c*2 - 144c. -15c2 Collect the terms in -324i*3 + 975i*3 - 331i*3 - 323i*3. -3i*3 Collect the terms in -4q*3 + 5q*3 - 25 + 5q*3 - 99. 6q*3 - 124 Collect the terms in 288c*3 + 329c*3 + 181c*3 - 202c*3. 596c*3 Collect the terms in -2552 + 2552 + 278g*2 + 862g*2. 1140g*2 Collect the terms in -11v*2 + 47v*2 - 17v*2 - 7v*2 - 16v*2. -4v*2 Collect the terms in -25w - 125w - 396w. -546w Collect the terms in -160n + 0 + 0 + 108n - 147n. -199n Collect the terms in 46a + 66a - 205a. -93a Collect the terms in -46f*2 + 3f2 - f2. -44f2 Collect the terms in -85p - 18p - 36p - 79p + 47p. -171p Collect the terms in 158o*3 - 1401o*3 - 2o + 2o. -1243o*3 Collect the terms in 87p + 61p + 87p - 258p + 67p. 44*p Collect	{ "pile_set_name": "DM Mathematics" }
n) = k(n) - 4q(n). Solve w(z) = 0 for z. -1, 5 Let k be (-26)/5 - -14(-11)/(-22). Solve -9/5g3 - 21/5g*2 + kg + 3g4 + 6/5 = 0. -1, -2/5, 1 Let c(j) be the third derivative of -j6/660 + j5/30 + 7j*4/22 + 394j*2. Determine w so that c(w) = 0. -3, 0, 14 Let z(j) = -16j*5 - 150j*4 + 37j*3 - 9j*2 - 9j + 9. Let g(f) = -f5 + f4 - f3 - f2 - f + 1. Let v(x) = 36g(x) - 4z(x). Factor v(o). 4o3(o + 23)(7o - 2) Let c = -410 + 596. Factor 2k3 - 5k - k - c + 190. 2(k - 1)2(k + 2) Suppose 0 + 10/3w2 - 5/2w - 5/6w3 = 0. What is w? 0, 1, 3 Let a be 18/(-5)(-4 + 9) + -1. Let z = a + 22. Factor -d*2 + 1 - 1/2d + 1/2dz. (d - 2)(d - 1)(d + 1)/2 Let w(p) be the first derivative of 4p*5/5 + 8p*4 + 88p*3/3 + 48p*2 + 36p - 53. Factor w(x). 4(x + 1)2(x + 3)2 Let i(m) be the first derivative of -m4/32 - m*3/8 + 9m*2/16 - 19m - 12. Let u(t) be the first derivative of i(t). Factor u(y). -3(y - 1)(y + 3)/8 Let x be ((-6)/4)/((-15)/10). Let s(q) be the first derivative of 1/4q3 - 3/4q*2 - 9/4q + x. Factor s(m). 3(m - 3)(m + 1)/4 Let -6h - 15h*2 + 0h*2 - 5h*3 - 12h*2 + 17h*2 + h = 0. Calculate h. -1, 0 Let q(d) be the third derivative of -1/20d*5 + 0d - 12d2 - 1/4d*4 + 0 + 3/2d*3. Solve q(i) = 0 for i. -3, 1 Let k = 9356/10539 - -4/3513. Let h be (4/6)/((-2)/(-9)). Factor -kn + 2/9nh + 0n*2 + 0. 2n(n - 2)(n + 2)/9 Suppose -17z + 16z - j + 6 = 0, -z - 3j + 6 = 0. Let b be z(-6)/441(-7)/2. Determine h so that -bh*2 + 2/7 + 0h = 0. -1, 1 Suppose -26v - 71 = -383. Suppose -2h + 49 = 3. Factor -va3 + 2a*5 - 3a*4 + ha*3 - 6a*5 - 10a3. -a3(a + 1)(4a - 1) Let f = 408 + -7748/19. Determine d so that 8/19 + 40/19d + 42/19d2 - fd*3 - 14/19d*4 = 0. -1, -2/7, 2 Let k be (-6)/1 + 2 + -1 + 9. Suppose 20 = 4f + 2t, -kf - 8 = -0f - 5t. Factor 0z3 + 3/2z*5 - fz*4 + 0 + 3z*2 - 3/2z. 3z(z - 1)*3(z + 1)/2 Let n(h) be the second derivative of h*4/54 + 23h*3/27 + 15h + 3. Let n(y) = 0. What is y? -23, 0 Factor 13 - v*3 - 13v*2 - 29v + 63v - 33v. -(v - 1)(v + 1)(v + 13) Let l(v) = -v*3 - v. Let n(c) = -2c*4 - 14c*3 + 8c*2 - 4c. Let z(a) = 12l(a) - n(a). Factor z(m). 2m(m - 2)(m + 1)(m + 2) Let w = -225 - -225. Let p(r) be the first derivative of wr - 5 + 0r3 + 1/12r*4 - 1/6r*2. Solve p(z) = 0 for z. -1, 0, 1 Let q = 6 - -14. Let b be (28/q - 1)/(7/5). Suppose bd*2 + 0d + 2/7d5 + 6/7d*3 + 6/7d4 + 0 = 0. Calculate d. -1, 0 Let f(h) be the second derivative of h6/15 + 7h5/20 + h4/2 - h3/6 - h2 + 47h + 1. Factor f(r). (r + 1)*2(r + 2)(2r - 1) Determine m so that 4/7m2 + 960/7 + 964/7m = 0. -240, -1 Let 530 + 224 + v*2 - 263 - 60v - 36 + 445 = 0. What is v? 30 Let p(c) be the third derivative of -42c2 + 1/2c*4 + 0 + 0c + 1/30c5 + 5/3c*3. Let p(m) = 0. Calculate m. -5, -1 Suppose 2a = -3a, 3o + 4a - 36 = 0. Let j = o + -8. Factor -4g2 + g4 + g*5 - 5g*4 + 3g*3 - 4g + 8gj. g(g - 1)(g + 1)(g + 2)*2 Let q(n) be the second derivative of 5n*7/42 + 11n*6/15 + 33n*5/20 + 5n*4/3 + 2n*3/3 + 24n + 2. Solve q(s) = 0. -2, -1, -2/5, 0 Let c be (-1)/(-2) + ((-406)/(-35) - 12). Let f(g) be the third derivative of 1/40g6 + 7g*2 + 0 + 1/8g*4 + 0g*3 + cg*5 + 0g. Solve f(t) = 0. -1, 0 Let o(p) = 10p + 100. Let c be o(-10). Let y(r) be the first derivative of 4 - 2/7r + 2/21r3 + cr*2. Suppose y(u) = 0. Calculate u. -1, 1 Let o = -511/2 - -256. Let p(r) be the first derivative of -9/4r*4 - 6 + 0r + 0r2 + 2r*3 + or*6 + 0r*5. Factor p(d). 3d*2(d - 1)*2(d + 2) Solve -4/3 + 10/3w2 - w3 + 3w = 0. -1, 1/3, 4 Let y(b) be the third derivative of 0b3 + 1/210b*5 + 0 - 1/420b*6 + 0b + 0b4 + 1/1176b*8 - 1/735b*7 + 22b*2. Suppose y(f) = 0. What is f? -1, 0, 1 Let j(g) be the second derivative of 5g*4/12 - 25g*3/6 + 15g*2 + 33g. Factor j(f). 5(f - 3)(f - 2) Let v(o) = 13o3 - o2 - 4o + 1. Let a(z) be the second derivative of 3z5/20 - z3/6 + 13z. Let q(c) = -9a(c) + 2v(c). Let q(h) = 0. What is h? -2, -1, 1 Let l(r) = -r3 + r2 + r - 1. Let x be l(-1). Factor -2b3 - 58b + 58b + xb*4 - 2b*4. -2b*3(b + 1) Let u(n) be the first derivative of -n*3/3 - 4n*2 - 16n - 184. What is q in u(q) = 0? -4 Let q(h) = -33h4 + 228h*3 + 18h*2 + 6h. Let d(v) = -4v4 - v3 + v2 - v. Let b(x) = -6d(x) - q(x). Suppose b(s) = 0. What is s? -2/19, 0, 4 Let h(r) be the second derivative of r6/1620 - r5/540 + 5r3/6 - 45r. Let l(u) be the second derivative of h(u). Find x, given that l(x) = 0. 0, 1 Let o(c) = -9c2 - 91c - 20. Let y(u) = 18u2 + 179u + 38. Let r(q) = 11o(q) + 6y(q). Factor r(l). (l + 8)(9l + 1) Let v(x) = -269x + 34. Let k(f) = f2 - 4. Let j(w) = 5k(w) - v(w). Let j(i) = 0. Calculate i. -54, 1/5 Let t be (141 - 4)(9/(-6) + 1). Let q = 69 + t. Find p, given that -1/2p*2 + qp - 1/2p3 + 1/2 = 0. -1, 1 Factor -7496192/5 + 681472/5h - 23232/5h2 - 2/5h*4 + 352/5h*3. -2(h - 44)4/5 Let a(p) be the first derivative of p5/25 + p*4/5 + 4p3/15 + 7. What is v in a(v) = 0? -2, 0 Let g(y) be the third derivative of y6/40 - 11y5/20 + 4y*4 - 14y*3 + 10y*2. Factor g(f). 3(f - 7)(f - 2)2 Solve -7/4c*3 + 1/2c*4 + 7/4c - 3/4 + 1/4c2 = 0 for c. -1, 1/2, 1, 3 Factor 40/3 + 8a + 2/3a2. 2(a + 2)(a + 10)/3 Suppose 2o + 4 - 30 = 0. Factor 7n2 - 3n*2 - on + 3n + 9n - 3n3. -n(n - 1)(3n - 1) Let n(f) be the first derivative of -f5/5 + f4/4 - f*2/2 + f + 32. Let z(q) = 4q*4 - q - 3. Let k(p) = -6n(p) - 2z(p). Find h, given that k(h) = 0. -2, 0, 1 Let f(u) be the third derivative of u5/195 - 7u*4/52 + 40u*3/39 - 284u*2. Factor f(s). 2(s - 8)(2s - 5)/13 Let g be ((-696)/140)/(32/(-10)). Let p = -9/8 + g. Let -3/7z + pz*4 + 9/7z*2 + 0 - 9/7z*3 = 0. Calculate z. 0, 1 Let z(c) be the third derivative of 2662/21c*3 + 1/210c*6 + 0 + 11/35c*5 + 121/14c*4 + 0c - 41c2. What is u in z(u) = 0? -11 Let w(k) = 98k + 688. Let n be w(-7). Factor h*n + 2/3 - 5/3h. (h - 1)(3h - 2)/3 Let s(t) be the second derivative of 2t + 5/8t*3 + 9/8t*2 + 0 + 1/16t*4 - 3/80t5. Find v, given that s(v) = 0. -1, 3 Let d = -5 + 42. Let b be d/13 + 6/39. Solve -lb + 3l3 + 18l + 7l2 + 5l*2 = 0. -3, 0 Let u = 311 - 80. Factor -24i + ui2 - 14 + 2 + 48i. 3(7i + 2)(11i - 2) Let v(c) be the third derivative of -c6/420 + c5/70 + 3c4/28 - 9c*3/7 + 13c*2. Solve v(t) = 0. -3, 3 Let v(d) = 3d*5 - 2d*4 - 3d*3 - 3d*2 + 5d. Let s(i) = 8i5 - 6i*4 - 8i*3 - 8i*2 + 14i. Let c(a) = -5s(a) + 14v(a). Factor c(x). 2x2(x - 1)(x + 1)2 Let z = 1067/604 + -78/151. Let 0 + zm*4 - 15/4m + 15/4m3 - 5/4m2 = 0. What is m? -3, -1, 0, 1 Let b(k) be the third derivative of k7/420 - 7k6/80 + 19k*5/40 - 55k*4/48 + 3k*3/2 + 381k*2. Suppose b(y) = 0. What is y? 1, 18 Factor 0 + 0h + 1/10h2. h2/10 Let m be (-2)/(-4)-104/(-10). Factor -p + p2 + 12p*4 - 8p*4 - mp*4 - 3p4 + p3. -p(p - 1)2(p + 1) Let k(q) = -274 - 52q2 + 142 - 700 + 416q. Let m(d) = -8d2 + 64d - 128. Let u(f) = 5k(f) - 32m(f). What is y in u(y) = 0? 4 Let d(t) be the second derivative of 0 - 36t2 + 46t*3 - 21t + 9/5t5 + 52/3t*4. Factor d(y). 4(y + 3)*2(9y - 2) Let p(m) = -28m*2 + 767m - 23814. Let r(g) = -10g2 + 256g - 7938. Let l(a) = -4p(a) + 11r(a). What is d in l(d) = 0? 63 Suppose -83 = -98a + 113. Let u(i) be the first derivative of -5 - i5 - 5/3i*3 + 10i - 15/2ia + 15/4i*4. Factor u(r). -5(r - 2)(r - 1)2(r + 1) Let k(g) be the third derivative of g*7/14 + 7g*6/24 + 5g*5/12 + 5g*4/24 + 114g*2. Solve k(c) = 0 for c. -1, -1/3, 0 Suppose 21/2y*3 - 15/2y*4 + 0y + 0 - 9/2y2 + 3/2y*5 = 0. What is y? 0, 1, 3 Let j(g) be the second derivative of 1/2g4 + g2 + 9/10g5 + 18g + 2 - 5/3g3. Let j(r) = 0. Calculate r. -1, 1/3 Suppose 3/4t*2 + 1/4t*4 + 1/4t + 3/4t3 + 0 = 0. Calculate t. -1, 0 Factor -106722/17k*2 - 54/17 + 913066/17k*3 + 4158/17k. 2(77k - 3)**3	{ "pile_set_name": "DM Mathematics" }
4a = 3t - 8, -5t + 4 + 1 = -5a. List the prime factors of l(a). 2, 5 Suppose -t - k + 419 = 0, 14k - 16k - 846 = -2t. What are the prime factors of t? 421 Let t(j) = -j2 + 7j - 10. Let s be t(5). Suppose s = 4g - 0g - 112. What are the prime factors of g? 2, 7 Let j(h) = -h*3 - 5h*2 + 6h - 2. Let d be j(-6). Let g be 1/(d/1)0. Suppose g = -4t + 3t + 10. List the prime factors of t. 2, 5 Let y = 83 + -55. List the prime factors of y/71/1. 2 Suppose 5z + 0k - k - 29 = 0, -3k - 22 = -2z. Let h be ((-32)/z)/((-4)/20). Suppose p = -p + h. List the prime factors of p. 2 Suppose 2y - 6 = -4n, -3n + 2n = y - 2. Suppose -3i + 4x - n = 0, 5i - 4x - 4 = i. Suppose 0 = -is + 8 + 17. What are the prime factors of s? 5 Let j be -3 - (2 - 6/2). Let v(f) = 2f*2 + 2f. What are the prime factors of v(j)? 2 Suppose -2r + 144 = 2r. List the prime factors of r. 2, 3 Let t be -4 + 2/4-2. Let q(v) = -v2 - 7v - 4. What are the prime factors of q(t)? 2, 3 Suppose s + 2s - 12 = 0. Suppose su + 5a + 5 = 9u, -5u + 9 = -3a. List the prime factors of u. 3 Suppose -93 = 9c - 12c. What are the prime factors of c? 31 Suppose -2x + 5x + 5k - 572 = 0, x - 188 = k. What are the prime factors of x? 3, 7 Suppose -2q + 131 + 45 = 0. List the prime factors of q. 2, 11 Let z(i) = -3i + 3. Let l(n) = 13n - 12. Let f(w) = -2l(w) - 9z(w). Let r be f(6). Let y = 6 - r. List the prime factors of y. 3 Let p = 13 + -8. Suppose -q + 8 = -pb - 4, -q - b = 6. List the prime factors of 8 - (6/2)/q. 3 Suppose 4a - 17 - 19 = 0. Suppose 5o = 2o - a. What are the prime factors of (-2)/(-2o/(-12))? 2 Let i = 26 - -3. List the prime factors of i. 29 Let c(a) = -a3 + 3a*2 - 7a - 10. What are the prime factors of c(-6)? 2, 89 Let j(w) = -w. Suppose -4v - 10 = -5v - 3c, v - 5c + 22 = 0. Let g be j(v). List the prime factors of g(-1 + 0 + 2). 2 Suppose 4f - 8 - 35 = -d, -d - f = -46. Let x = -33 + d. List the prime factors of x. 2, 7 Let s(j) = j + 2. Let z be s(0). Let n be ((-2)/z - -4) + -1. List the prime factors of (n/(-4))/(2/(-24)). 2, 3 Let w be (24/(-40))/(1/(-5)). Suppose -wb = -c - 99, -5b + 0c = -5c - 155. What are the prime factors of b? 2, 17 Let y = -808 - -1144. Suppose -4k + 11k = y. List the prime factors of k. 2, 3 Let s = 10 + -6. Suppose -sw + 175 = -5v, 5w = -2v - 2v + 229. List the prime factors of w. 3, 5 Suppose -4h + 3h - 4 = 0. Let g(p) = -3p - 1. Let y be g(h). Suppose 5r - 26 = -y. List the prime factors of r. 3 Let o be 121/17 - 6/51. Suppose -oc - 2 = -8c. What are the prime factors of c? 2 Suppose 11u = 17u - 690. List the prime factors of u. 5, 23 Let r = -87 - -147. What are the prime factors of r? 2, 3, 5 Let w(q) = -q3 - q - 3. Let j be w(0). List the prime factors of 3 - (-19 - -3 - j). 2 Suppose 3j = 3r - r - 16, 0 = -2r - 2j + 16. Let f(y) = -y2 + 9y - 6. Let u be f(5). Let z = u - r. List the prime factors of z. 2, 3 Suppose -r - 53 = -h + 3h, 5r = 2h - 217. Suppose 4v - 4a + 0a - 264 = 0, 4v = -3a + 243. Let d = r + v. What are the prime factors of d? 2, 3 List the prime factors of 104 + 4/(-14) + (-2)/(-7). 2, 13 Let s(k) = 97k + 1. What are the prime factors of s(1)? 2, 7 Suppose 4f - 12 = -4j, -j + 4 = 3f - 9. Suppose 0 = g + 5x - 31 - 7, fg - 2x = 82. Suppose -o + 2 - g = -l, 4o - 44 = -5l. List the prime factors of l. 2, 3 Let d(c) = -c - 14. Let a be 0/(3/(-3) + 0). Let q be d(a). Let l = q - -28. What are the prime factors of l? 2, 7 Let i(m) be the second derivative of m3/3 - 6m*2 + 2m. What are the prime factors of i(9)? 2, 3 Let p(c) = -c*2 + 5c - 15. Let v be p(9). Let i = -10 - v. What are the prime factors of i? 41 Suppose t + 5x = -t + 45, -x = -2t + 75. Let i = -19 + t. Let j = i - 9. List the prime factors of j. 7 Suppose 0 = -3k + 130 + 593. List the prime factors of k. 241 Let j(r) = 1 + 5r + 7r - 14r. Let d be -8(0 - (-1)/2). List the prime factors of j(d). 3 Suppose -52 = -3m + 2o, -3m = -3o - 62 + 8. List the prime factors of m. 2 Suppose -22o + 736 + 3532 = 0. List the prime factors of o. 2, 97 Let j = 8 - -7. Suppose 2f + f = j. What are the prime factors of f? 5 Suppose -o - o + 21 = 5m, -4o + 15 = m. Suppose k = -3d + 78, -5d - ok = -2d - 84. List the prime factors of d. 5 Suppose 12w = 8w + 24. What are the prime factors of w? 2, 3 Suppose 6p - 36 = 2p. What are the prime factors of p? 3 Suppose 0d + d = 46. List the prime factors of d. 2, 23 Suppose -7 = 2z + 3r, z - 3 + 4 = -r. Suppose 0 = zc - 3f - 47, 2c - 3c + 3f = -14. What are the prime factors of c? 11 Let y(t) be the second derivative of -t3/2 + 5t*2 - 5t. What are the prime factors of y(-8)? 2, 17 Suppose 2c + 4c - 180 = 0. List the prime factors of c. 2, 3, 5 Let k be (7/3)/(3/9). Let m = k - -5. What are the prime factors of m? 2, 3 Let r be 3 - (10 - 0/3). Let w = r - 6. List the prime factors of (-5)/((-10)/6) - w. 2 Let j be (-9)/(1-1)-1. Let b be (9/(-3))/(-6)(1 - -37). Let r = j + b. What are the prime factors of r? 2, 5 Let f = -42 - -77. Suppose 5w = -3q + f, 15 = 6q - 3q. Suppose 0 = -wr + 21 + 23. List the prime factors of r. 11 Let v = -3 + 93. List the prime factors of v. 2, 3, 5 Let w = 147 + -68. What are the prime factors of w? 79 Let a(i) be the second derivative of i3 - i2 - i. Let y be a(9). Suppose 3b + 3j - 36 = 0, 0 = 5b + 7j - 4j - y. What are the prime factors of b? 2 Let m = -6 + 11. Let w(v) = -6v*2 - 3v*3 + 6v - v3 + v3 + 4v3 + 6. What are the prime factors of w(m)? 11 Suppose 80f - 83f + 177 = 0. What are the prime factors of f? 59 Suppose 0 = h, 3r - 3h + h = 12. Suppose -18 = -6m + rm. What are the prime factors of m? 3 Let k(i) = -i2 + 3i - 1. Let m be k(2). Let n(j) = -j - m - 4j + 3j. List the prime factors of n(-5). 3 Let z be (-3 + 6)1/3. Let w(p) = p - 2. Let i be w(z). What are the prime factors of (-3)/i - (-2)/2? 2 Let u = -19 + 10. Let p = 6 + u. What are the prime factors of (1/3)/(p/(-27))? 3 Let z = 16 - 27. Let b = -1 + 0. Let g = b - z. List the prime factors of g. 2, 5 Suppose -3b + 2b = 0. Suppose -11 = -ba - a. What are the prime factors of a? 11 Let l(j) = 5j2 - j - 34. List the prime factors of l(6). 2, 5, 7 Suppose -2z - 3 = -3z. Let l(r) = r3 - 3r*2 + 2r + 1. What are the prime factors of l(z)? 7 Suppose -j + 2s + 5 = 0, 0j = -3j - s + 29. List the prime factors of j. 3 Let l(v) = v3 + 5v*2. Let g be l(-5). Suppose gk + 10 = 5k. Suppose -4f + 3 = -1, 50 = 2s + kf. What are the prime factors of s? 2, 3 Let a = 75 + -53. Suppose 6p = 5p + a. What are the prime factors of p? 2, 11 Let r = -1 - -1. Suppose -4t + 41 + 27 = r. Let h = -8 + t. What are the prime factors of h? 3 Let k = -24 - -46. List the prime factors of k. 2, 11 List the prime factors of 2 + (0 - (-2 + 0)). 2 Let c = 13 - -5. Suppose f - 3 = c. What are the prime factors of f? 3, 7 Suppose 21 = 4d - d. Let f = 14 - d. List the prime factors of f. 7 Suppose 5g = -55 - 25. List the prime factors of ((-50)/(-4))/((-8)/g). 5 Suppose -2p + 30 = -p. Suppose 3w = -2f + 90, -2f = -4w + 5w - p. What are the prime factors of w? 2, 3, 5 Suppose 0p = -2p + 4. Suppose -pa + 0c + 12 = -3c, 2c = 2a - 8. Suppose -3y = 3d - 5d - 28, a = -5y + 3d + 46. List the prime factors of y. 2 Let h(o) = -2o3 + o - 1. Let i be h(-2). Let l(n) = n2 - 13n + 14. List the prime factors of l(i). 2, 7 Let j(u) = u + 8. Let b be (-4)/14 - 12/(-42). What are the prime factors of j(b)? 2 Let o = 19 - -11. What are the prime factors of (-12)/5o/(-9)? 2 Suppose s + 3 = -0s, 2r - 4s - 8 = 0. Let v = 18 + -10. Let u = v - r. What are the prime factors of u? 2, 5 Suppose 3m - 35 = 2s - 3s, 5m = -s + 59. List the prime factors of m. 2, 3 Let t(m) = m + 4. Let o be t(-5). Let h = 3 + o. List the prime factors of h. 2 Suppose -4l - 7 - 1 = 0, 5l + 35 = 5x. Suppose xj + f + 19 = -102, -93 = 4j - 3f. Let v = 35 + j. What are the prime factors of v? 11 Let l(p) = 2p*3 + 11p*2 - p + 2. List the prime factors of l(-5). 2 Let o be (-1)/(-2) - 131/(-2). Suppose o = -7h + 4h. Let z = h - -36. List the prime factors of z. 2, 7 Suppose -3x	{ "pile_set_name": "DM Mathematics" }
is divided by 403. 63 What is the remainder when 35885 is divided by 255? 185 What is the remainder when 11412 is divided by 5704? 4 Calculate the remainder when 25654 is divided by 242. 2 Calculate the remainder when 121023 is divided by 25. 23 What is the remainder when 54703 is divided by 99? 55 What is the remainder when 1480917 is divided by 92? 85 What is the remainder when 249940 is divided by 11? 9 Calculate the remainder when 2757 is divided by 731. 564 Calculate the remainder when 145495 is divided by 250. 245 What is the remainder when 1999 is divided by 340? 299 What is the remainder when 14434 is divided by 33? 13 What is the remainder when 77400 is divided by 458? 456 What is the remainder when 848432 is divided by 282805? 17 What is the remainder when 3894 is divided by 777? 9 Calculate the remainder when 65823 is divided by 693. 681 Calculate the remainder when 27805 is divided by 1015. 400 What is the remainder when 328607 is divided by 28? 27 Calculate the remainder when 5877 is divided by 74. 31 What is the remainder when 6725 is divided by 330? 125 What is the remainder when 10870 is divided by 320? 310 What is the remainder when 168925 is divided by 114? 91 Calculate the remainder when 84959 is divided by 84950. 9 Calculate the remainder when 756 is divided by 148. 16 Calculate the remainder when 28663 is divided by 233. 4 Calculate the remainder when 1344326 is divided by 18. 14 Calculate the remainder when 42406 is divided by 73. 66 What is the remainder when 300575 is divided by 466? 5 Calculate the remainder when 11712 is divided by 61. 0 What is the remainder when 4053 is divided by 87? 51 Calculate the remainder when 16583 is divided by 145. 53 What is the remainder when 87406 is divided by 6243? 4 What is the remainder when 995090 is divided by 671? 668 Calculate the remainder when 44786 is divided by 14926. 8 Calculate the remainder when 88697 is divided by 845. 817 What is the remainder when 14025 is divided by 13989? 36 Calculate the remainder when 307096 is divided by 22. 20 Calculate the remainder when 1258 is divided by 15. 13 What is the remainder when 103803 is divided by 970? 13 Calculate the remainder when 208753 is divided by 196. 13 Calculate the remainder when 24552 is divided by 2454. 12 What is the remainder when 967878 is divided by 61? 52 Calculate the remainder when 3381 is divided by 141. 138 What is the remainder when 9988 is divided by 203? 41 Calculate the remainder when 5761 is divided by 165. 151 Calculate the remainder when 7535 is divided by 314. 313 Calculate the remainder when 101122 is divided by 18. 16 What is the remainder when 49282 is divided by 23? 16 What is the remainder when 81232 is divided by 81231? 1 What is the remainder when 44953 is divided by 67? 63 Calculate the remainder when 2249200 is divided by 35. 30 Calculate the remainder when 7331 is divided by 26. 25 What is the remainder when 4975 is divided by 331? 10 Calculate the remainder when 140951 is divided by 140944. 7 Calculate the remainder when 753 is divided by 384. 369 Calculate the remainder when 15699 is divided by 631. 555 Calculate the remainder when 55443 is divided by 132. 3 What is the remainder when 718 is divided by 7? 4 What is the remainder when 1606124 is divided by 36? 20 What is the remainder when 13850 is divided by 462? 452 What is the remainder when 119903 is divided by 2497? 47 What is the remainder when 395252 is divided by 5133? 11 What is the remainder when 2128 is divided by 1871? 257 What is the remainder when 36221 is divided by 15? 11 What is the remainder when 11479 is divided by 1628? 83 Calculate the remainder when 17351 is divided by 3299. 856 What is the remainder when 34742 is divided by 316? 298 Calculate the remainder when 3750 is divided by 9. 6 What is the remainder when 139 is divided by 54? 31 Calculate the remainder when 26495 is divided by 317. 184 What is the remainder when 12662 is divided by 72? 62 What is the remainder when 100282 is divided by 548? 546 What is the remainder when 3788 is divided by 655? 513 What is the remainder when 1006 is divided by 276? 178 Calculate the remainder when 35006 is divided by 15. 11 What is the remainder when 3350 is divided by 177? 164 Calculate the remainder when 92495 is divided by 74. 69 What is the remainder when 4959359 is divided by 1680? 1679 What is the remainder when 110435 is divided by 20? 15 Calculate the remainder when 1433 is divided by 1347. 86 Calculate the remainder when 61514 is divided by 69. 35 Calculate the remainder when 67303 is divided by 709. 657 Calculate the remainder when 12592 is divided by 359. 27 What is the remainder when 16738 is divided by 523? 2 Calculate the remainder when 7876 is divided by 983. 12 Calculate the remainder when 1262558 is divided by 12. 2 What is the remainder when 11043 is divided by 11042? 1 What is the remainder when 129374 is divided by 117? 89 What is the remainder when 888780 is divided by 118? 4 Calculate the remainder when 5207 is divided by 522. 509 Calculate the remainder when 1075 is divided by 179. 1 What is the remainder when 202195 is divided by 60? 55 What is the remainder when 8478 is divided by 926? 144 Calculate the remainder when 3145988 is divided by 77. 76 What is the remainder when 76328 is divided by 33? 32 Calculate the remainder when 52653 is divided by 16. 13 Calculate the remainder when 272042 is divided by 159. 152 Calculate the remainder when 14556 is divided by 415. 31 Calculate the remainder when 135 is divided by 52. 31 Calculate the remainder when 2557 is divided by 31. 15 Calculate the remainder when 7441 is divided by 111. 4 Calculate the remainder when 443211 is divided by 49245. 6 What is the remainder when 44688 is divided by 14895? 3 What is the remainder when 17439 is divided by 88? 15 Calculate the remainder when 6448 is divided by 73. 24 Calculate the remainder when 3798 is divided by 136. 126 What is the remainder when 886826 is divided by 21? 17 What is the remainder when 176849 is divided by 25256? 57 Calculate the remainder when 402269 is divided by 11. 10 Calculate the remainder when 1120 is divided by 1011. 109 Calculate the remainder when 17352 is divided by 140. 132 Calculate the remainder when 1217680 is divided by 135297. 7 Calculate the remainder when 1772 is divided by 219. 20 Calculate the remainder when 367983 is divided by 8. 7 What is the remainder when 9021 is divided by 1551? 1266 Calculate the remainder when 11681 is divided by 1459. 9 What is the remainder when 1372638 is divided by 72244? 2 Calculate the remainder when 4979 is divided by 226. 7 What is the remainder when 3486 is divided by 1641? 204 What is the remainder when 6635 is divided by 50? 35 What is the remainder when 182467 is divided by 26? 25 Calculate the remainder when 4113 is divided by 2029. 55 What is the remainder when 58900 is divided by 5354? 6 Calculate the remainder when 5535 is divided by 1816. 87 Calculate the remainder when 312 is divided by 9. 6 Calculate the remainder when 141677 is divided by 47220. 17 What is the remainder when 12059 is divided by 1721? 12 Calculate the remainder when 3564 is divided by 885. 24 Calculate the remainder when 3899 is divided by 303. 263 What is the remainder when 222837 is divided by 111408? 21 Calculate the remainder when 14862 is divided by 708. 702 Calculate the remainder when 9636 is divided by 166. 8 Calculate the remainder when 3860 is divided by 177. 143 Calculate the remainder when 291876 is divided by 51. 3 Calculate the remainder when 189337 is divided by 1176. 1 Calculate the remainder when 22232 is divided by 556. 548 What is the remainder when 108584 is divided by 54287? 10 What is the remainder when 2149362 is divided by 716451? 9 What is the remainder when 111850 is divided by 111849? 1 What is the remainder when 2856 is divided by 592? 488 What is the remainder when 208879 is divided by 618? 613 Calculate the remainder when 85265 is divided by 79. 24 What is the remainder when 1923 is divided by 128? 3 What is the remainder when 21492 is divided by 10705? 82 Calculate the remainder when 975 is divided by 471. 33 Calculate the remainder when 72530 is divided by 20. 10 What is the remainder when	{ "pile_set_name": "DM Mathematics" }
n 140991 is divided by 235. 226 Calculate the remainder when 5455 is divided by 5175. 280 What is the remainder when 36100 is divided by 46? 36 Calculate the remainder when 125 is divided by 92. 33 Calculate the remainder when 1782 is divided by 123. 60 What is the remainder when 38877 is divided by 19429? 19 What is the remainder when 30958 is divided by 86? 84 Calculate the remainder when 329 is divided by 44. 21 Calculate the remainder when 992721 is divided by 22. 15 What is the remainder when 3883 is divided by 158? 91 Calculate the remainder when 947 is divided by 370. 207 Calculate the remainder when 839 is divided by 834. 5 Calculate the remainder when 188929 is divided by 1671. 106 Calculate the remainder when 10729 is divided by 124. 65 What is the remainder when 15202 is divided by 723? 19 What is the remainder when 34650 is divided by 82? 46 Calculate the remainder when 100030 is divided by 100028. 2 Calculate the remainder when 816 is divided by 203. 4 What is the remainder when 9001 is divided by 246? 145 What is the remainder when 513 is divided by 226? 61 Calculate the remainder when 194032 is divided by 95. 42 Calculate the remainder when 1608 is divided by 95. 88 What is the remainder when 8263 is divided by 1839? 907 Calculate the remainder when 56989 is divided by 130. 49 Calculate the remainder when 3499 is divided by 73. 68 Calculate the remainder when 6903 is divided by 229. 33 What is the remainder when 3458 is divided by 192? 2 Calculate the remainder when 205435 is divided by 92. 91 What is the remainder when 3360 is divided by 1158? 1044 What is the remainder when 129470 is divided by 116? 14 What is the remainder when 5175 is divided by 1568? 471 Calculate the remainder when 4772 is divided by 687. 650 Calculate the remainder when 8998 is divided by 132. 22 What is the remainder when 2218292 is divided by 1109144? 4 Calculate the remainder when 1251 is divided by 114. 111 What is the remainder when 83857 is divided by 70? 67 What is the remainder when 11470 is divided by 478? 476 Calculate the remainder when 21268 is divided by 1633. 39 What is the remainder when 2348 is divided by 147? 143 What is the remainder when 40270 is divided by 1032? 22 Calculate the remainder when 56162 is divided by 14035. 22 What is the remainder when 727 is divided by 656? 71 Calculate the remainder when 41797 is divided by 3483. 1 Calculate the remainder when 57354 is divided by 898. 780 Calculate the remainder when 2071174 is divided by 113. 110 What is the remainder when 13655 is divided by 83? 43 Calculate the remainder when 382 is divided by 5. 2 Calculate the remainder when 2446 is divided by 725. 271 What is the remainder when 252856 is divided by 1119? 1081 What is the remainder when 31382 is divided by 79? 19 Calculate the remainder when 3698 is divided by 202. 62 What is the remainder when 14761 is divided by 3680? 41 What is the remainder when 198618 is divided by 39714? 48 What is the remainder when 7311 is divided by 82? 13 What is the remainder when 9794 is divided by 213? 209 What is the remainder when 2188 is divided by 52? 4 What is the remainder when 257392 is divided by 85791? 19 What is the remainder when 29325 is divided by 11? 10 Calculate the remainder when 13783 is divided by 1028. 419 Calculate the remainder when 433299 is divided by 2832. 3 What is the remainder when 933639 is divided by 4? 3 What is the remainder when 78363 is divided by 151? 145 What is the remainder when 923 is divided by 257? 152 Calculate the remainder when 344 is divided by 224. 120 What is the remainder when 2105 is divided by 303? 287 What is the remainder when 5997 is divided by 5997? 0 Calculate the remainder when 5900 is divided by 1473. 8 Calculate the remainder when 2204 is divided by 282. 230 Calculate the remainder when 16869 is divided by 222. 219 Calculate the remainder when 125274 is divided by 18. 12 What is the remainder when 680 is divided by 66? 20 What is the remainder when 234717 is divided by 489? 486 Calculate the remainder when 226303 is divided by 235. 233 Calculate the remainder when 340590 is divided by 45. 30 What is the remainder when 27229 is divided by 798? 97 What is the remainder when 4702 is divided by 1042? 534 Calculate the remainder when 6816484 is divided by 23. 20 Calculate the remainder when 829086 is divided by 104. 102 Calculate the remainder when 542 is divided by 301. 241 Calculate the remainder when 5951 is divided by 1962. 65 Calculate the remainder when 1722 is divided by 39. 6 What is the remainder when 36336 is divided by 62? 4 Calculate the remainder when 3248 is divided by 88. 80 Calculate the remainder when 29480 is divided by 117. 113 Calculate the remainder when 48991 is divided by 68. 31 Calculate the remainder when 4727 is divided by 1524. 155 Calculate the remainder when 111323 is divided by 411. 353 Calculate the remainder when 4595 is divided by 100. 95 Calculate the remainder when 6226 is divided by 1244. 6 What is the remainder when 29026 is divided by 779? 203 Calculate the remainder when 4839 is divided by 692. 687 Calculate the remainder when 2657 is divided by 2. 1 What is the remainder when 21794 is divided by 20? 14 What is the remainder when 32566 is divided by 680? 606 What is the remainder when 10294 is divided by 152? 110 Calculate the remainder when 3903 is divided by 32. 31 Calculate the remainder when 13432 is divided by 210. 202 Calculate the remainder when 7801 is divided by 905. 561 What is the remainder when 316940 is divided by 13205? 20 What is the remainder when 379823 is divided by 25? 23 What is the remainder when 7764 is divided by 619? 336 Calculate the remainder when 34243 is divided by 28. 27 What is the remainder when 256228 is divided by 64055? 8 What is the remainder when 9921 is divided by 216? 201 Calculate the remainder when 28097 is divided by 55. 47 What is the remainder when 217673 is divided by 152? 9 Calculate the remainder when 19477 is divided by 1640. 1437 What is the remainder when 1874 is divided by 539? 257 Calculate the remainder when 25422 is divided by 8448. 78 Calculate the remainder when 68291 is divided by 34138. 15 What is the remainder when 11317 is divided by 2206? 287 Calculate the remainder when 2148 is divided by 2143. 5 What is the remainder when 37824 is divided by 14? 10 What is the remainder when 110249 is divided by 42? 41 Calculate the remainder when 98331 is divided by 2. 1 What is the remainder when 20232 is divided by 413? 408 What is the remainder when 15240 is divided by 4659? 1263 What is the remainder when 2278 is divided by 39? 16 What is the remainder when 13249 is divided by 1324? 9 What is the remainder when 106482 is divided by 100? 82 What is the remainder when 3089 is divided by 612? 29 Calculate the remainder when 856771 is divided by 28. 27 Calculate the remainder when 31180 is divided by 390. 370 Calculate the remainder when 4554 is divided by 1477. 123 What is the remainder when 4119 is divided by 188? 171 What is the remainder when 127861 is divided by 775? 761 What is the remainder when 70017 is divided by 49? 45 What is the remainder when 39910 is divided by 150? 10 Calculate the remainder when 3490 is divided by 1743. 4 What is the remainder when 62894 is divided by 20894? 212 Calculate the remainder when 254 is divided by 246. 8 Calculate the remainder when 7671 is divided by 1508. 131 Calculate the remainder when 764 is divided by 230. 74 Calculate the remainder when 22499 is divided by 194. 189 What is the remainder when 12526 is divided by 1252? 6 What is the remainder when 60968 is divided by 5? 3 Calculate the remainder when 2846 is divided by 2821. 25 What is the remainder when 32063 is divided by 241? 10 Calculate the remainder when 209525 is divided by 76. 69 What is the remainder when 14888 is divided by 2687? 1453 Calculate the remainder when 29413 is divided by 4891. 67 What is the remainder when 8826 is divided by 1243? 125 What is the remainder when 893120 is divided by 31897? 4 Calculate the remainder when 181582 is divided by 6260. 42 What is the remainder when 90291 is divided by 76? 3 What is the remainder when 93581 is divided by 1534? 7 What is the remainder when 4678 is divi	{ "pile_set_name": "DM Mathematics" }
factor of 27111 and 168? 21 Calculate the greatest common divisor of 3340 and 115. 5 Calculate the highest common factor of 38482 and 7668. 142 Calculate the highest common factor of 6050 and 400. 50 What is the greatest common divisor of 19736 and 232? 8 Calculate the highest common factor of 1274 and 416. 26 Calculate the highest common factor of 16562 and 1690. 338 What is the greatest common divisor of 65 and 2140? 5 Calculate the highest common factor of 360 and 146040. 120 What is the highest common divisor of 109810 and 120? 10 What is the greatest common factor of 87 and 30102? 87 What is the greatest common divisor of 786192 and 240? 48 Calculate the greatest common divisor of 837 and 22351. 31 What is the greatest common divisor of 37500 and 120? 60 Calculate the greatest common divisor of 14 and 30142. 14 What is the greatest common divisor of 47012 and 4526? 146 Calculate the highest common factor of 49728 and 5952. 192 What is the highest common factor of 415 and 51555? 5 What is the highest common factor of 45469 and 8872? 1109 Calculate the highest common divisor of 21900 and 211335. 1095 Calculate the highest common factor of 672 and 321216. 672 What is the highest common factor of 45 and 248895? 45 Calculate the highest common divisor of 400958 and 28706. 926 What is the highest common divisor of 2075370 and 20? 10 What is the greatest common factor of 32691 and 29937? 51 Calculate the highest common divisor of 3130 and 235. 5 Calculate the greatest common divisor of 102 and 12002. 34 Calculate the greatest common divisor of 2461 and 161. 23 What is the highest common factor of 1632 and 2755360? 544 What is the highest common divisor of 606 and 183? 3 What is the highest common factor of 85618 and 130? 26 What is the greatest common factor of 39190 and 23? 1 What is the greatest common divisor of 1210 and 54890? 110 Calculate the highest common factor of 525 and 662675. 25 Calculate the highest common factor of 943 and 186024. 23 What is the greatest common factor of 17988 and 36? 12 Calculate the greatest common factor of 3526 and 5576. 82 What is the greatest common factor of 50 and 43850? 50 Calculate the greatest common divisor of 1224 and 432. 72 Calculate the greatest common factor of 2960 and 178340. 740 What is the greatest common factor of 189 and 471501? 27 What is the greatest common divisor of 107933 and 17? 17 Calculate the highest common factor of 460172 and 406. 58 What is the greatest common divisor of 198910 and 10? 10 What is the greatest common divisor of 122430 and 3366? 66 Calculate the highest common factor of 323 and 9861. 19 What is the highest common factor of 2 and 117902? 2 Calculate the greatest common factor of 2369 and 2116. 23 Calculate the greatest common divisor of 38 and 9766. 38 Calculate the highest common divisor of 1409982 and 63. 21 Calculate the highest common factor of 177 and 156291. 177 What is the highest common divisor of 455328 and 2295? 459 What is the greatest common divisor of 1424 and 29815? 89 What is the greatest common divisor of 2297817 and 9? 9 Calculate the highest common factor of 75060 and 189. 27 Calculate the highest common divisor of 1505 and 21973. 301 Calculate the greatest common divisor of 6976 and 142681. 109 What is the highest common divisor of 783587 and 1085? 217 What is the greatest common divisor of 4264 and 781911? 533 Calculate the greatest common divisor of 60 and 65420. 20 Calculate the highest common factor of 5593 and 1309. 119 What is the greatest common divisor of 2546890 and 1290? 430 What is the highest common factor of 204974 and 14? 14 Calculate the greatest common factor of 4020234 and 6. 6 Calculate the highest common divisor of 249 and 277220. 83 Calculate the highest common factor of 101849 and 517. 517 What is the greatest common divisor of 95226 and 3766? 538 Calculate the greatest common factor of 48051 and 304. 19 Calculate the highest common factor of 540 and 24120. 180 Calculate the highest common factor of 38915 and 860. 215 What is the greatest common factor of 608 and 58824? 152 What is the highest common divisor of 360351 and 9? 9 What is the greatest common divisor of 3920 and 1808? 16 What is the greatest common divisor of 57 and 3666525? 57 What is the greatest common factor of 177648 and 84? 12 What is the greatest common factor of 360 and 11670? 30 Calculate the greatest common divisor of 2916 and 1404. 108 Calculate the greatest common divisor of 222 and 28209. 3 Calculate the highest common divisor of 3315 and 1040. 65 Calculate the greatest common factor of 4096260 and 1260. 1260 Calculate the highest common divisor of 23722 and 319. 29 Calculate the highest common divisor of 46846 and 56374. 794 Calculate the greatest common divisor of 5033 and 238. 7 Calculate the greatest common divisor of 264 and 10098. 66 What is the highest common divisor of 2627 and 158397? 37 What is the highest common factor of 270 and 17766? 54 What is the greatest common factor of 2790 and 31930? 310 Calculate the greatest common divisor of 20175 and 300. 75 Calculate the greatest common divisor of 2484 and 4103568. 2484 Calculate the highest common factor of 25 and 251475. 25 What is the highest common factor of 16 and 5666? 2 What is the greatest common divisor of 52043 and 2932? 733 What is the highest common factor of 11536 and 2184? 56 Calculate the highest common factor of 14 and 6642. 2 What is the highest common factor of 828 and 118611? 207 Calculate the greatest common divisor of 12 and 194772. 12 What is the highest common divisor of 3532 and 2400? 4 Calculate the highest common factor of 12962496 and 543. 543 Calculate the greatest common divisor of 6 and 1137750. 6 Calculate the highest common factor of 936 and 1689246. 234 What is the greatest common divisor of 132 and 3498? 66 What is the greatest common factor of 130000 and 10625? 625 What is the highest common factor of 42 and 195391? 7 What is the greatest common divisor of 81189 and 54? 27 Calculate the highest common factor of 6693 and 2139. 69 Calculate the greatest common factor of 34459 and 34. 17 What is the highest common factor of 1786 and 9253? 19 What is the greatest common divisor of 56 and 694456? 56 What is the greatest common divisor of 46062 and 2? 2 What is the highest common divisor of 96 and 172248? 24 Calculate the highest common factor of 103 and 671457. 103 Calculate the highest common factor of 256 and 928. 32 Calculate the highest common factor of 208416 and 192. 96 Calculate the highest common factor of 385 and 65. 5 Calculate the greatest common factor of 650076 and 8502. 654 What is the greatest common divisor of 5434 and 198? 22 Calculate the highest common divisor of 8019 and 1122. 33 Calculate the greatest common divisor of 221 and 7709. 13 What is the highest common factor of 176 and 2096? 16 What is the greatest common factor of 17048 and 40? 8 What is the highest common factor of 79690 and 1300? 130 Calculate the highest common factor of 442 and 430924. 26 Calculate the highest common divisor of 1472 and 38548. 92 What is the highest common factor of 54209 and 3020? 151 Calculate the highest common factor of 210996 and 24. 12 What is the greatest common divisor of 39812 and 89846? 538 Calculate the highest common factor of 87 and 583567. 29 What is the highest common divisor of 13 and 311077? 13 What is the greatest common divisor of 93032 and 464? 232 Calculate the highest common factor of 6882 and 1054. 62 What is the greatest common factor of 35900 and 8? 4 What is the greatest common divisor of 668 and 716? 4 What is the highest common factor of 56 and 696? 8 Calculate the greatest common divisor of 567 and 628614. 189 Calculate the highest common divisor of 42 and 304017. 21 What is the highest common divisor of 21752 and 40? 8 Calculate the greatest common factor of 649 and 209. 11 What is the greatest common divisor of 4383 and 261? 9 What is the greatest common divisor of 468226 and 22? 22 Calculate the highest common factor of 65792 and 22784. 256 Calculate the highest common divisor of 75864 and 3712. 232 What is the highest common factor of 516 and 760928? 172 What is the highest common divisor of 28 and 34846? 14 What is the grea	{ "pile_set_name": "DM Mathematics" }
-4b - 17v, 29b - 6 = 30b - 4v + 1 for b. 1 Solve -19q - 27q + 4k = -93q + 48q + 43, 4q + 3k - 56 = -0q for q. 5 Solve -5b + 2b - 224 = -13l - b, l = 2l + 4b + 394 for l. 2 Solve -2j + 5j - 13 = 3l - 10, -42j = -3l - 237 for j. 6 Solve 111b - 5i + 70 = 116b - 4i, -10 = -2i for b. 13 Solve 5896w - 5892w = -2q + 10, q = -4w + 15 for q. -5 Solve 2h + 236 - 177 = -4x + 117, 72 = 3h - 9x for h. 27 Solve 0 = 5s - 4b + 175, 4s + 0b + 17b = -5b - 14 for s. -31 Solve -p + 11 = -26q + 25q, -16p = -10p - 7q - 71 for p. 6 Solve -19i + 7i + 5h = 38, i - 57h = -62h - 14 for i. -4 Solve -3s - 1440 = -32k, -109k + 104k - s = -225 for k. 45 Solve 0 = 7a - 4q + 238 - 161, -3a + 0a - 51 = -3q for a. -3 Solve 23y = 2m + 79, 220m + 39y - 213 = 219m for m. 18 Solve -5k + 16a - 18420 + 18485 = 6a, 5k - 2a = a + 2 for k. -5 Solve 31b - j + 45 = 0, 2100b = 2099b - j + 13 for b. -1 Solve -i + z + z = -14, 119z + 31z + 19z = -252 + 759 for i. 20 Solve 3b = -5f - 10 + 15, 0 = -3b + 1 - 1 for f. 1 Solve -3q + 23q + 3 = -97, 96 - 266 = -5a + 4q for a. 30 Solve -2x = -4j + 68, x - 1026 = 10j - 1068 for x. -32 Solve -l + i - 14 - 41 = 4i - 6i, i + 163 = -45l for l. -4 Solve 76q - 79q = 3w + 3, -4q = -q + 5w - 15 + 22 for q. 1 Solve 0 = -55z - 2l + 285, 0z + 3z + 10 = -147l + 152l for z. 5 Solve 3d + 803a + 3 - 36 = 806a, -4a - 40 = -2d for d. 2 Solve f = -2b + 8, 21b + 9 - 9 = f + f + 9 - 0 for b. 1 Solve 0f + 40g - 35g = 2f - 54, -6f - 4g - 66 = 0 for f. -3 Solve -9x = -5z + 303, 77335z = 77333z + 5x + 124 for z. 57 Solve 4s - 8c - 24 = 0, -44646 = -4s - 3c - 44677 for s. -4 Solve 3u + 67 = -3u + 10t - 5t, 3u + 8t - 59 = -5t - 3t for u. -7 Solve 4g + 160 = -6267i + 6262i, 2i + 8g + 217 = 3g for i. 4 Solve 382r - 2 = 380r + 8, 64 = -6x + 2r for x. -9 Solve 0 = -j + 60, 25i + 3j + j = 22i + 5j - 66 for i. -2 Solve -203 = -a - 186, -14y + 25y - 12y - 8a = -141 for y. 5 Solve -3s - 10s + 9s = 2l - 178, 32 = -5l + 4s - 125 for l. 3 Solve -5q + 4z - 11 = 23 - 16, -6q = -3z + 18 for q. -2 Solve q - 8954c + 8955c = -17, -3q - 22 - 13 = 2c for q. -1 Solve 1950h + 1949h + 17 = 3903h + a, -4h - 8a + 52 = 0 for h. 3 Solve -77 = 11g, 21t - 26t - 20 = 5g + 25 for t. -2 Solve 54 = 2c - c - 4z, 2c - 218z = -223z - 61 for c. 2 Solve -2h = -6h + 4h + 2h - 38, 5w + 184 = 4h + 7h for w. 5 Solve 0 = -g - 4f + 2f - 16, -g - 16 + 21 = -f - 3 for g. 0 Solve -13r - 2k - 224 = 0, 40r + 44 = 37r - 2k for r. -18 Solve -3d = z - 95, 3d - 94059839z + 94059824z = 15 for d. 30 Solve 0 = -5c + 3a - 148, -2c - 4a = 66599 - 66545 for c. -29 Solve -v = 4d - 26, -301155d + 301154d = 3v - 23 for v. 6 Solve 4c + 3n - 65 = 0, -8c + 9n = 13n - 5n - 137 for c. 17 Solve 2y - 3p - 51 = 0, 29p = 5y + 51p - 26p - 110 for y. 18 Solve 168m + 62 = -4h + 173m, -m - m + 32 = 2h for h. 2 Solve -19c - 2w + 260 + 1298 = 0, -4c = -5w - 328 for c. 82 Solve 4c + 485 = -5p, -1847p + 155 = -c - 1837p for c. -125 Solve 1241k + 24 + 58 = 1243k + 4w, k - 3947 = -219w for k. 5 Solve -5y = 4b + 4, 8454y - 8 = b + 8457y for b. 4 Solve -5p - 5y = -5, 121p - 24y = 116p + 34 for p. 2 Solve -17560b + 391 = -17555b + 7o, -2o = -116 for b. -3 Solve 3o + 4b + 10244644 - 10244641 = 0, 5o + 4b = -5 for o. -1 Solve 23l - 4q + 19 = -8q, q + 3 = 4 for l. -1 Solve 5r + 29 - 8 = -2z - 12, 0 = 3z + 6r + 42 for z. -4 Solve 52w - 76 = 4m - 388, 0m - 10 = -m - 4w for m. 26 Solve 22o - h = -45, 2o + 112 = 55h + 53 for o. -2 Solve 74j - 5u + 240 = 79j, 0 = -9j - 25u + 1168 for j. 2 Solve 676x - 50 = 681x - 3s, -3x + 2s - 6s = -57 for x. -1 Solve -47i - 48i + g + 33 = -90i, -5i + 9g + 189 = -4g for i. 4 Solve 4g + g + 310 = 5r, -1883 + 1789 = 17g - 2r for g. 2 Solve -48y - 4b = 552 - 876, 2b = 2y - 20 for y. 7 Solve 12j + 4f + 167 = -45, -j = f + 19 for j. -17 Solve -c + 49 = -0j + j + 38, 39j + 173 = 4c for c. 14 Solve n + 1 = -5m + 26, 23m + 34670 = n + 34729 for m. 3 Solve 4v + 316 = -4l, -29v + 20v + 53l - 601 = -5v for v. -84 Solve -3y + 5g = -28, 3y - 42g - 449 + 347 = 0 for y. 6 Solve 4d - 6733a + 6738a - 8 = 0, 4a = -76d - 212 for d. -3 Solve -36p + 73p + 2r - 47 = 36p, -5r - 315 = -4p - 75 for p. 55 Solve f + z = 10, 7f - 7723 + 7651 = -5z for f. 11 Solve -4284z - 4283z + 12838z - 10 = 4277z - 2j, j + 23 = -4z for z. -4 Solve -2392q = -2397q - 4t - 79, 3q = 5t + 145 for q. 5 Solve -l + 9i + 10 = 4l + 4i - 5, 4i = -32 for l. -5 Solve -5n = -61v + 65v + 53, -3 - 9 = -4n for v. -17 Solve 0 = 7a - 5q + 45, q = 1251a - 1249a + 9 for a. 0 Solve z - 4n - 16 = 0, -89 = -2822619z + 2822615z - 3n - 6 for z. 20 Solve -14k - 8k + 6p - 137 = -33k + 10k + 8p, 1540 = -22p for k. -3 Solve 5p + 4095m + 19 = 4093m, 0 = 4p + 7m + 53 for p. -1 Solve 14r + 17415h = 17410h + 51, -3r = -3h - 15 for r. 4 Solve 5h = -7o - 279 + 36, 0 = 5h - o + 211 for h. -43 Solve 0 = 890s - 883s + 616, 0p + 3s + 264 = -9p + 4p for p. 0 Solve -3b - 3t - 153 = 0, -927b = -897b + 3t + 45 for b. 4 Solve 5386g - 2695g = 2695g + b + 1, -b = -2g + 19 for g. 3 Solve i + 23 = -3z, 0i - 2i - 21346 + 21356 = -0i - z for i. 1 Solve 40v - 2q = 44v, -4v - 13q + 8 = -v + 54 for v. 2 Solve -2y + 11 = -5r - 30 - 68, 4y = 18y - 3r - 27 for y. -3 Solve x + 2k + 5 = 3k, -k + 106 = -8x - 112 + 227 for x. 2 Solve -1365d + 1361d - 9 = -q, -d + 5q = 7 for d. -2 Solve -4q - 5f = 61, 2308q = 2303q + f - 69 for q. -14 Solve 88153h - 135 = 88148h, -7h + 50 = 2s - 24 - 92 - 27 for s. 2 Solve -2a + 85 = -269t + 1466, t + 158 = -2a + 314 - 187 for a. -18 Solve 2d - 43 = -3o - 9, 411o + 3d - 54 = 408o for o. -2 Solve -28 = -11g + 12g + 5n, -g + 2g + n + 4 = 0 for g. 2 Solve 444h = 7k + 441h + 92, 4k = -5h - 19 for k. -11 Solve 0 = s - 4t - 19, 1822t = 5s + 1827t + 55 for s. -5 Solve 3f = -r - 0r - 1, 32 = -5f + 360r - 364r for f. 4 Solve -25i + 9826a = 9828a - 118, -5i = -3a + 7 for i. 4 Solve 0 = -157r + 4553, -7r = -f - 12r + 146 for f. 1 Solve -4h = 44, -h = 635v - 322v - 317v + 11 for v. 0 Solve -4v - 9584a + 20 = -9574a, -3a + a = -5v - 33 for v. -5 Solve 5q - 3f - 24 = f, -74f = 4q - 40f - 36f - 12 for q. 0 Solve -5q + 186 - 161 = 0, -2q - 87 = -6o - 5q for o. 12 Solve -36i - 8i = 3s + 19i - 339, s - i - 3i + 12 = 0 for s. 8 Solve 2o = o + 2y - 16, o - 836 + 944 = 25y for o. -8 Solve -3u + 10 = k, 5k + 1253 - 2658 + 1334 = 6u for k. 13 Solve 523 = 5r + 3k, -1725 = -18r + 2k - 771 + 980 for r. 107 Solve 0 = 2r + 4t + 76 - 94, r + 9 = 4t for r. 3 Solve 0 = -3r - 9s - 246, 99r - 7s - 202 = 104r for r. -4 Solve -326925i + 326917i - 2q + 86 = 0, 0 = -4i + 5q - 311 for i. -4 Solve -6x + 1998 = -47t, -2x = -4t + 240 - 416 for t. -42 Solve v = 610q - 609q, -7v + q = v + 4q + 55 for v. -5 Solve -3k - 157 = 2o, k + 24366o - 24371o + 28 = -30 for k. -53 Solve -3r - 16p - 13p = -32p - 27, 0 = 36r + 5p - 529 for r. 14 Solve -7n - 23 = -5s, -1415n + 1420n + 19 = 4s for n. 1 Solve -f + 228 = -5g, -26868f + 3g + 146 = -26872f for f. -2 Solve 5t - 2n + 9 = 0, 0 = 13t - 16t - n - 1 - 0 for t. -1 Solve 0 = -2h - 4t - 18, 2 - 4 = -7h + 8h - t - 5 for h. -1 Solve -7h + 3p - 38 = 0, p - 8528200 + 8528199 = 0 for h. -5 Solve 7s - 4b = -31, 15b = -15s + 40b - 22b - 33 for s. -1 Solve 15j + 5d = 0, 3j + 11j + 2j + 0j - 13j - 5d = -18 for j. -1 Solve 3o + 27 = 4d, 7d + 22940 = 5o + 22987 for o. -1 Solve -3s + 55 = 4b, 2s + 38 = -4b + 8b + 8s - 56 for b. 4 Solve -4y = -17i - 61 + 442 + 388, 0 = -i + y + 46 for i. 45 Solve 30 = 2n - 5s, -n - 163s = -161s - 27 + 30 for n. 5 Solve 4z - 36 = 4l, 5z + 17l = -4l + 19l + 66 for z. 12 Solve 15z + 31 = -5o - 77 - 12, 2o - 4z + 55 = 27 for o. -18 Solve -2t - y - 34 = 0, -y = -22353 + 22357 for t. -15 Solve -s - 6j = -2j + 5, 50s - 51s = j + 5 for s. -5 Solve 44 = -2a + 13x, 880x = 8a + 875x + 82 for a. -9 Solve 0 = s - 2w - 3*w -	{ "pile_set_name": "DM Mathematics" }
3, -477360? -477357 What is the next term in -939, -7989, -27533, -65949, -129615? -224909 What is the next term in -380861, -762755, -1144649? -1526543 What comes next: 14898752, 14898751, 14898750? 14898749 What comes next: 6348039, 12696071, 19044103? 25392135 What is next in 18667, 149344, 504057, 1194826, 2333671, 4032612? 6403669 What comes next: 149537, 299087, 448637, 598187, 747737? 897287 What is the next term in -322147027, -322147032, -322147041, -322147054, -322147071, -322147092, -322147117? -322147146 What comes next: -6878263, -6878256, -6878249, -6878242, -6878235? -6878228 What is the next term in 466773, 934731, 1402689? 1870647 What is the next term in 2424718, 4849445, 7274172, 9698899, 12123626, 14548353? 16973080 What is next in 34816, 139347, 313590, 557545, 871212? 1254591 What comes next: -927747300, -927747301, -927747302, -927747303, -927747304? -927747305 What comes next: -2203542, -4407131, -6610722, -8814315, -11017910, -13221507? -15425106 What is the next term in 377280, 754547, 1131814? 1509081 What comes next: -4857244, -9714487, -14571730? -19428973 What is the next term in -97906, -195705, -293496, -391279, -489054, -586821? -684580 What is next in 129006, 128935, 128856, 128769, 128674, 128571? 128460 What comes next: 3033978, 6067992, 9102006, 12136020? 15170034 What is the next term in -9495, -21158, -32821, -44484? -56147 What is the next term in 2028, 16319, 55048, 130425, 254660, 439963, 698544? 1042613 What is the next term in 213263, 853257, 1919983, 3413441, 5333631, 7680553, 10454207? 13654593 What is next in 815, 1823, 3023, 4415? 5999 What is the next term in -40829410, -81658817, -122488226, -163317637, -204147050? -244976465 What comes next: 32578981, 32578991, 32579001, 32579011? 32579021 What is the next term in 11818, 12949, 14082, 15217, 16354, 17493, 18634? 19777 What is next in -1350884, -2701758, -4052632, -5403506? -6754380 What comes next: -12500, -13131, -13762? -14393 What is the next term in 354908, 709812, 1064720, 1419638, 1774572, 2129528, 2484512? 2839530 What comes next: -961, -1078, -619, 416, 2027, 4214? 6977 What is next in -765053, -764526, -763985, -763424, -762837? -762218 What comes next: -5174, -15115, -25056, -34997, -44938, -54879? -64820 What is the next term in -147209, -588851, -1324927, -2355437, -3680381? -5299759 What is next in -239689, -478741, -717793, -956845, -1195897, -1434949? -1674001 What is next in 127215, 221073, 314941, 408825, 502731? 596665 What comes next: -1508, -2974, -4416, -5828, -7204, -8538, -9824? -11056 What is next in 435351, 1741354, 3918009, 6965310, 10883251, 15671826, 21331029, 27860854? 35261295 What is the next term in -210462919, -210462890, -210462859, -210462826? -210462791 What is next in -3558123, -7116143, -10674163, -14232183? -17790203 What comes next: 11652593, 23305184, 34957775, 46610366, 58262957? 69915548 What is next in -392291, -392353, -392445, -392567? -392719 What is the next term in 82, 518, 1418, 2896, 5066, 8042, 11938, 16868? 22946 What comes next: -7434997, -7434993, -7434989, -7434985, -7434981, -7434977? -7434973 What is next in -246, 1801, 5312, 10293, 16750, 24689, 34116, 45037? 57458 What is next in -3886, -15052, -33516, -59278? -92338 What comes next: 2667, 10599, 23837, 42387, 66255, 95447? 129969 What comes next: -12053057, -12053060, -12053063? -12053066 What is next in 263375, 526722, 790045, 1053344? 1316619 What comes next: 588395, 588422, 588461, 588512, 588575, 588650, 588737? 588836 What is next in 15289, 12342, 9395, 6448, 3501? 554 What is next in 386636353, 386636355, 386636357, 386636359, 386636361, 386636363? 386636365 What comes next: 57, -60, -459, -1248, -2535, -4428, -7035, -10464? -14823 What is next in -12764, -12796, -12868, -12998, -13204, -13504, -13916, -14458? -15148 What is next in 33865, 135438, 304713, 541684, 846345? 1218690 What is next in -2224753334, -2224753335, -2224753336, -2224753337, -2224753338, -2224753339? -2224753340 What comes next: 449076, 898437, 1347800, 1797165, 2246532, 2695901, 3145272? 3594645 What is next in -640781, -640772, -640765, -640760? -640757 What comes next: 233, 1081, 2159, 3455, 4957, 6653, 8531, 10579? 12785 What is the next term in -19880432, -39760934, -59641436, -79521938? -99402440 What is next in 415850509, 415850507, 415850505? 415850503 What is next in -85, -177, -123, 245, 1095, 2595, 4913, 8217? 12675 What is the next term in -19649, -78666, -177051, -314804, -491925, -708414, -964271? -1259496 What comes next: -826287, -826301, -826303, -826287, -826247, -826177? -826071 What is next in 173000, 173040, 173080, 173120, 173160, 173200? 173240 What is the next term in -975046, -1950090, -2925134, -3900178, -4875222? -5850266 What comes next: 976995, 1953962, 2930929, 3907896, 4884863? 5861830 What comes next: 7050, 7094, 7180, 7308, 7478? 7690 What is the next term in 71652, 71644, 71624, 71586, 71524, 71432, 71304, 71134? 70916 What is next in 84564, 84398, 84232? 84066 What is next in 1116892, 2233790, 3350688, 4467586, 5584484? 6701382 What is the next term in 723, 2886, 5049? 7212 What is the next term in 6548, 13052, 19572, 26108, 32660, 39228? 45812 What comes next: 1505893, 3011778, 4517659, 6023536, 7529409, 9035278? 10541143 What is next in 145, 33, -345, -1133, -2475, -4515, -7397? -11265 What is the next term in -52025, -103581, -154191, -203381, -250677, -295605? -337691 What comes next: 184, -304, -760, -1178, -1552, -1876, -2144? -2350 What comes next: -460329, -460315, -460289, -460251, -460201? -460139 What is the next term in -19417, -18949, -18469, -17971, -17449, -16897, -16309? -15679 What comes next: -2273, -9660, -22167, -39800, -62565, -90468, -123515? -161712 What is the next term in -177, -1017, -3557, -8649, -17145? -29897 What is next in -96092, -192188, -288314, -384470? -480656 What is next in 12842, 25652, 38462, 51272? 64082 What comes next: 3219629, 6439248, 9658859, 12878462, 16098057, 19317644, 22537223? 25756794 What is the next term in -312291, -312326, -312353, -312372? -312383 What is the next term in 135666119, 271332254, 406998401, 542664566, 678330755, 813996974, 949663229? 1085329526 What comes next: 23699040, 23699039, 23699038? 23699037 What comes next: -1805, -7592, -17153, -30488, -47597, -68480? -93137 What is next in -660, -1302, -2006, -2772, -3600, -4490, -5442? -6456 What is the next term in 3224907, 3224946, 3225003, 3225072, 3225147, 3225222? 3225291 What is next in -3459, -3357, -3203, -3009, -2787, -2549, -2307, -2073? -1859 What is the next term in 2704080, 5408138, 8112196? 10816254 What is the next term in -942355, -7538813, -25443483, -60310471, -117793883, -203547825, -323226403, -482483723? -686973891 What is the next term in -225127, -900831, -2027013, -3603679, -5630835, -8108487, -11036641? -14415303 What is next in 548288073, 1096576148, 1644864223, 2193152298, 2741440373? 3289728448 What comes next: 32609635, 65219275, 97828915? 130438555 What comes next: 3833407, 7666732, 11500057, 15333382? 19166707 What is the next term in 498195, 498270, 498345, 498420, 498495? 498570 What is next in -49721, -198904, -447549, -795656? -1243225 What is next in 29187, 28973, 28817, 28719, 28679? 28697 What comes next: -196, -458, -778, -1156, -1592? -2086 What is the next term in -5350346, -5350342, -5350338, -5350334? -5350330 What is the next term in 27646348, 27646343, 27646338? 27646333 What is the next term in 21534, 21415, 21154, 20703, 20014, 19039, 17730, 16039? 13918 What comes next: 57525, 460323, 1553649, 3682767, 7192941, 12429435, 19737513? 29462439 What is the next term in -240445, -480970, -721511, -962074, -1202665? -1443290 What is next in 369, -704, -3453, -8664, -17123, -29616, -46929? -69848 What is the next term in 64458, 258112, 580866, 1032720, 1613674? 2323728 What is the next term in -1620003, -3239977, -4859955, -6479937? -8099923 What comes next: 677, 2580, 5741, 10172, 15885, 22892, 31205, 40836? 51797 What comes next: -4324, -8672, -13026, -17386? -21752 What comes next: 2802057, 5604127, 8406207, 11208297, 14010397? 16812507 What is next in 30810, 61605, 92378, 123123, 153834? 184505 What is the next term in 56272869, 112545739, 168818609? 225091479	{ "pile_set_name": "DM Mathematics" }
+ 4)(7c3 + c3 - 4c3) + 2c4 + c4 - 2c4). -24c*5 Expand (10b + 2b - 15b)(2b - 7b + b) + b2 - b2 + 2b*2. 14b*2 Expand (-11 + 10 - 6)(p + 284 - 297 - 3p). 14p + 91 Expand 11y - 5y + 6y + (-2y + y + 0y)(-7 + 3 - 4). 20y Expand (5p + 6p + 2p)(2p*3 - 3p3 - p3)(-2p + 5p + 0p). -78p5 Expand (2i - 4i2 + i2 + 2i*2)(1 - 1 - i*2 + (-4i + 2i + i)(i + 0i - 3i) + i*2 - 6i*2 + 3i*2 + (-36 + 36 - 9i)(5i - 13i + 6i)). -17i4 + 34i*3 Expand (-5w - 4w + 2w)(-2w*2 + 4w*2 - 4w*2)(-2w2 + 4w + w*2 + 0w). -14w5 + 56w*4 Expand (1 + 2d - 1)(-5d - d + 5d) - d2 - 6 + 6 + (-2d + 4d - 4d)(-3d + 2d + 0d)(-1 + 18 + 4). 39d*2 Expand 6607 - 6607 - 56u - 2u + 3u + 0u + u - 2u + 0u - 3u - 2u + 3u - u - u + 4u + (-3 + 4 - 3)(0 + 0 - 2u) - 2u - 3 + 3. -54u Expand (-5 + 1 - 5n*3 + 2n*3)(10n + 103 - 103). -30n*4 - 40n Expand (334l - 1 - l + 1)(0 - 3 + 5). 666l Expand (2y - 7y + 2y)(y + 2y + y)(-4y - 9 + 9). 48y3 Expand 7q*3 + 0q*3 - 4q*2 - 10q*3 + 4q*3 + 0q*3 - 3q*3 + (0 + 1 + 1)(q3 + q2 - q*2) - 2q*2 + 2q*2 + 2q*3. 2q*3 - 4q2 Expand ((z2 - 3 + 3)(-4z + 4z + 3z) + 2z3 - 7z*3 + 3z3 + z3 - 4z3 + z3)(2z - 43 + 43). -2z*4 Expand (0 - 1 - 6f*4 + 21f*4)(-4f + 5f + f). 30f5 - 2f Expand -2s + s + 3s + (2 + 0 - 3)(7s - 17s + 2s) + 0 + 3 - s + 0s. 9s + 3 Expand (285 + 27 + 432 - 1555 - 2i)(-i + 1 - 1). 2i2 + 811i Expand (-2 - 2 + 3)(2y - y*4 - 2y) + y*2 - 1438y*4 - 3y*2 + 880y*4. -557y*4 - 2y2 Expand (-a2 + 9a2 - 5a*2)(-14402 + 14402 + 27a). 81a*3 Expand (u - 3u + 0u)(3 - 3 - 1) + 27u - 237 + 237. 29u Expand (-2y + 0y + 6y)(-6 + 3 + 0) + 15 - 15 + 13 - y. -13y + 13 Expand (-20n - 33n - 16n)(-2n + 2n - 2n*2 + (-38 + 8n + 38)(n + n + 0n)). -966n3 Expand -6s*4 + 0s*4 + 2s4 + (-s3 + s*3 + 6s*3)(-1 - 7s + 1). -46s*4 Expand (0u3 - u3 + 2u3)(-5u + 2u + 2u + 1) + (8u + 0u - 6u)(3u*3 + 5 - 5). 5u4 + u3 Expand (42c2 + 86c*2 + 7c*2)(-2c3 - 2 + 2). -270c*5 Expand -2c - c + 2c + (4c - c - c)(-1 + 1 - 1) - 4 + 4 - 2c - 3c + 2c - c + 6c + c - 2c + (0 + 4 - 5)(-c + c + c) - 3c + 0c - 2c. -8c Expand 2r - 4r2 - 4r + 2r2 + (2r - 4r - 3r)(3 - r - 3) + 2 - 2 + r2. 4r*2 - 2r Expand (-s*2 + 1 - 2s + 0s2 - 6s*2)(3 - 2 + 0). -7s2 - 2s + 1 Expand (-673 + 14z + 673)(0 - 3 + 1) - z - 3z + 6z + (2 + 2 - 3)(-z - 2z + z) + z - z - 2z. -30z Expand ((0 + 3 - 2)(15h*3 + 20 - 20) + (0h + h + h)(3h + 2h2 - 3h))(-5h2 + h2 + 5h2) - 5h*2 + 5h*2 - 2h*5. 17h*5 Expand (-9 + 7v + 7 + 5v)(25v - 31v*2 - 25v). -372v3 + 62v*2 Expand (-3v*2 + 5v*2 - 4v*2)((-7v + 6 - 6)(-1 + 4 - 6) + (-2 + 1 + 0)(-v + 2v + 0v) - 2 + 2v + 2). -44v3 Expand (1 - 1 + j2)(-4922 - 379j + 4922). -379j*3 Expand (6v - 16 - 6v - 3v*2)(-2 + 2 - 2)(6v - 3v - v + (-1 - 2v + 1)(-3 - 2 + 3)). 36v*3 + 192v Expand (-4m3 + 4m*3 + 12m*4)(m + 3 - 3 + (1 + 1 - 4)(0 + 0 - m) + 5m + 2m - 2m). 96m5 Expand (2x + x - 6x)(96 + 50 - 28)(-3 - 1 + 3). 354x Expand 291 - 291 + 25c3 + c3 + 10c*3 - 2c*3 + (3 - 3 - c)(c2 - c + c) - c3 + 0 + 0. 32c3 Expand (-8r*2 - 26 + 26)(0 + 2r + 0)(r + 17r + 2r). -320r4 Expand (3x*2 + 0x + 0x)(-3x + 32x - x)(4x - 2x - 4x). -168x4 Expand (23o*4 - 43o + 43o)(18 - o + 16 - 15). -23o5 + 437o*4 Expand (0g - 5g - 6g)((-1 + 1 + 2)(1 + 0 + 0) - 1 + 1 - 1 - 13 - 8 + 7). 143g Expand (-1 + 1 + 2t)(-2 - 1 + 2) - 222t + 108t + 100t. -16t Expand (-69j*2 - 19j - 13j3 + 20j + j)(0 + 1 - 3). 26j*3 + 138j*2 - 4j Expand (7 + 7 - 7)(-2 + 2 - 2l*2) + 28l*2 - 14l*2 + 12l*2. 12l*2 Expand 2q + 2q5 - 2q + (-1 + 1 - 2q2)(-2q3 - 1 + 1) + q5 - q5 + 2q*5 - 291q*5 + 158q*5 + 157q*5 - 4q*5 - 4q*5 + 0q*5. 24q*5 Expand 18 - 11 - 8 + 22t5 + (-t3 - t*3 + 3t*3)(4 - 4 - t2) + t5 + t*5 - 3t*5. 20t*5 - 1 Expand (-926 + 27h*2 + 926)(-h*2 + 4h*2 - 4h2) + h4 - 6h4 + 2h*4. -30h*4 Expand (-4u + u + 5u)(-u4 + u4 - u*4) + 212u*4 - 47u*5 - 212u*4. -49u*5 Expand (-12 - 4 - 4)(3 - 2s - 3)(-3s + 2s + 2 - 3s). -160s*2 + 80s Expand -3h - 3h*2 + 12h - 7h - 8h*2 + 18h - 18h + 3h*2 - 4h*2 + 3h*2 + (0 + 2 + 0)(-4h2 - 3h*2 + 5h*2) + 0h*2 - 5h*2 + 2h*2. -16h*2 + 2h Expand (-1 + 4 - 2)(-332q*2 + 20q*3 + 332q*2) + 3q*3 + 0q*3 - 2q*3 + (4q2 - q2 - 4q2)(-2q - 1 + 1). 23q*3 Expand ((-14 + 10n + 14)(5 - 4 + 1) + (5 - 3 - 1)(-7n + 4n - 6n))(1 + 0 + 1). 22n Expand (-3k - 2k - k)(-4 + 5 - 5)(1 + 5 - 4)(0 + 2k + 0). 96k*2 Expand (1 - t - 1)(4 - 1 - 2) + 2t + 3t - 6t + (-t + 0t + 3t)(-6 - 3 - 6). -32t Expand (-4i - 4i - 2 + 5i)(21 + 103 + 37). -483i - 322 Expand (3x5 + 2x*5 - 7x*5)(45 - 87 - 29). 142x5 Expand (8 - 5n - 8)(4n + 2n - 3n)(0 - 2 + 4)(-6 + 0 + 3) + (2n - n + 0n)(2 - 2 + 2n). 92n2 Expand (-27j*2 - 73j + 73j)(1064 + 37j - 1064). -999j*3 Expand (-54o*3 + 118o*3 - 57o*3)(-2o + 4o - 4o)(o - 6o + 3o). 28o5 Expand (0 + 2i + 0)((-4i + 4i + 2i)(-8 - 15 - 1) + (-3i + 2i + 3i)(2 - 5 - 2) + i + 4 - 4). -114i*2 Expand -2t + 3 - 3 - 3t + 2t - t + 7t - 8t - 11t + (-4 - 2 + 4)(0t + 4t - 2t). -20t Expand (-2083 + 2083 - 2t)((1 + 3 - 2)(2t - t - 3t) + 0t - 2t + 3t + 3t + 0t - 4t). 8t*2 Expand (0 - 19 - 2)(5b - 5b + b)(48 - 48 - 2b + 0b + 2b + 0b + (b - 2b + 0b)(0 - 3 + 2) + 2 + 2b - 2). -63b*2 Expand 4y*5 - 12y*5 - 10y*5 + 3y*5 + (4y - 4y + y)(-3y + 3y - 2y4). -17y*5 Expand (2o - 4o + 3o)(-139o*3 + 100o*3 - 186o*3). -225o*4 Expand ((1 + 0 - 2)(5 + 0 + 10) - 1 - 4 + 3 + (5 - 3 - 1)(4 - 4 - 2) - 1 + 4 - 5 - 1 + 4 - 5)(i2 + i2 - i*2). -23i*2 Expand g - 6g + 2g + (3 - 1 - 1)(-5 - g + 5) + 25g + 3g + 5g + (-4 + 6 - 3)(g + g - g). 28g Expand -3n + n + n + (1 - 4 + 2)(6n - 5n + 7n). -9n Expand (-l4 - l2 + l2)(0l + 3l - 5l) + 3l*5 + 2l*5 - 3l*5 + 2l*5 + 4l*2 - 4l*2 - 39l*2 + 4l*5 - 2 - 49l*2 + 93l*2. 10l*5 + 5l*2 - 2 Expand (-1 + 2h + 1)(3 - 3 - 2) + 11h - 9h - 36h - 2h - 3h + 3h - 2h + 5 - 5 + (-1 - 4 + 4)(2h + 3h - 3h) + 3 - 3 + 3h. -41h Expand (-3u + 0u + 4u)(-158 + 158 + 9u2)(-3u + 3u - 2u). -18u*4 Expand (-2b + 0b + b)(719b - 719b - 49b3). 49b*4 Expand -3w3 + w3 + 0w3 + (12w - 12w + w2 - 2)(-w - 13w - 5w). -21w3 + 38w Expand -a*3 + 2a - 2a + a2 - a2 - 2a*3 + (0 + 0 - 2)(-2a3 + 0a*3 + 0a*3) + 0 + 2a*3 + 0 + 418 + 443 - 2a3 - 833. a3 + 28 Expand 2174 - 2174 + 98d + 1 - 1 + d + (-3d + 5d + 0d)(0 + 1 + 1) - d + 3d - d. 104d Expand 5n*3 + 2n*3 - 3n*3 + (7n - 4n - 2n)(-7 - n2 + 7) - 5n*3 - 3n*3 - 7n*3. -12n*3 Expand (2 - 1 + 0)(-3 - 1 + 1)((-3 - 3 + 7)(-2u2 + 0u2 + u2) - u2 - u2 + u*2 + 37u*2 - 39u*2 - 13 + 3). 12u*2 + 30 Expand (0 + 0 - 8g)(-g - 3g + 2g) + 14g*2 + 69g*2 + 24g*2 + (-g + 0g + 2g)(-1 + 1 - 2g). 121g*2 Expand (14x - 10x + 5x)(-9 + 5 - 4)(-2x2 - 4x*2 + 4x*2). 144x*3 Expand (-2h + 3h + 0h)(-107h*2 + 368h - 368h) + 0h*3 + 0h3 + h3. -106h3 Expand (201y*5 + 2211y*2 - 2211y*2)(-4 + 3 + 2). 201y5 Expand (0 + 2n + 0)(-37 - 103 + 51) + (-3n + 3n + 2n)(2 - 1 + 8). -160n Expand (2 + 0 + 0)(2q + q - 4q)(-1 - 5 - 1)(-1 + q + 1) + 0q*2 - 2q*2 - 2q*2. 10q*2 Expand 0q*5 - 2q*5 + 5q*5 + (77q + 23q + 59q)(3q4 + q4 - 7q4). -474q*5 Expand (-3m*3 + 4m3 + m3)(-10 + 0 - 2)(-3 + 0 + 0). 72m3 Expand (2 - 1 + 0)(-4 + 5 + 1 + (4 + 0 - 2)(-2 + 1 - 1))((-a + 0a + 2a)(1 + 0 - 3) + 6a - 5a + 5a). -8a Expand (44v - 44v - 26v*2)(v - v + v + (3v + v - 3v)(3 - 5 + 1) - 3v + 4v - 3v). 52v3 Expand (-6k*2 - 2k*3 + 6k*2)(11 - 14 + 5 + 96k). -192k*4 - 4k**3 Expan	{ "pile_set_name": "DM Mathematics" }
emainder when 50288 is divided by 47? 45 What is the remainder when 98266 is divided by 2233? 14 Calculate the remainder when 19495 is divided by 1946. 35 Calculate the remainder when 110918 is divided by 798. 794 Calculate the remainder when 295313 is divided by 298. 293 What is the remainder when 84425 is divided by 53? 49 Calculate the remainder when 177017 is divided by 37. 9 What is the remainder when 180594 is divided by 210? 204 What is the remainder when 90769 is divided by 27? 22 What is the remainder when 11771 is divided by 740? 671 Calculate the remainder when 6577 is divided by 1309. 32 Calculate the remainder when 1115 is divided by 30. 5 Calculate the remainder when 30307 is divided by 30253. 54 What is the remainder when 1293 is divided by 9? 6 Calculate the remainder when 666992 is divided by 223. 222 What is the remainder when 37377 is divided by 37? 7 What is the remainder when 316 is divided by 157? 2 Calculate the remainder when 464 is divided by 245. 219 Calculate the remainder when 54380 is divided by 640. 620 What is the remainder when 1091 is divided by 134? 19 What is the remainder when 16562 is divided by 1693? 1325 Calculate the remainder when 154998 is divided by 408. 366 What is the remainder when 6208127 is divided by 317? 316 Calculate the remainder when 27723 is divided by 79. 73 What is the remainder when 260326 is divided by 3471? 1 What is the remainder when 393942 is divided by 117? 3 Calculate the remainder when 4302 is divided by 47. 25 Calculate the remainder when 113406 is divided by 127. 122 What is the remainder when 603785 is divided by 31? 29 What is the remainder when 2066 is divided by 176? 130 What is the remainder when 320177 is divided by 101? 7 Calculate the remainder when 377275 is divided by 350. 325 What is the remainder when 33724 is divided by 167? 157 Calculate the remainder when 286 is divided by 76. 58 Calculate the remainder when 1033345 is divided by 12. 1 Calculate the remainder when 1447 is divided by 55. 17 What is the remainder when 37650 is divided by 4702? 34 What is the remainder when 11084 is divided by 222? 206 Calculate the remainder when 807 is divided by 804. 3 What is the remainder when 11135 is divided by 5560? 15 Calculate the remainder when 54188 is divided by 27076. 36 Calculate the remainder when 16644 is divided by 1038. 36 What is the remainder when 2839 is divided by 940? 19 Calculate the remainder when 614 is divided by 62. 56 What is the remainder when 138924 is divided by 30? 24 What is the remainder when 62322 is divided by 318? 312 What is the remainder when 1228 is divided by 211? 173 Calculate the remainder when 2397780 is divided by 26. 8 What is the remainder when 1614 is divided by 417? 363 What is the remainder when 11119 is divided by 15? 4 Calculate the remainder when 1139 is divided by 36. 23 What is the remainder when 2800 is divided by 240? 160 Calculate the remainder when 18035 is divided by 1639. 6 Calculate the remainder when 21816 is divided by 22. 14 What is the remainder when 364256 is divided by 52? 48 Calculate the remainder when 162114 is divided by 9. 6 What is the remainder when 120989 is divided by 13? 11 Calculate the remainder when 440 is divided by 48. 8 What is the remainder when 14234 is divided by 4736? 26 Calculate the remainder when 248700 is divided by 9. 3 What is the remainder when 842 is divided by 10? 2 Calculate the remainder when 9696 is divided by 311. 55 What is the remainder when 10253 is divided by 1277? 37 Calculate the remainder when 15332 is divided by 66. 20 Calculate the remainder when 50622 is divided by 25303. 16 Calculate the remainder when 164081 is divided by 6077. 2 Calculate the remainder when 7468 is divided by 3177. 1114 What is the remainder when 26403 is divided by 8780? 63 Calculate the remainder when 265507 is divided by 18. 7 What is the remainder when 93655 is divided by 35? 30 Calculate the remainder when 56383 is divided by 35. 33 Calculate the remainder when 36686 is divided by 1528. 14 What is the remainder when 1869 is divided by 108? 33 Calculate the remainder when 41182 is divided by 463. 438 What is the remainder when 64403 is divided by 6? 5 Calculate the remainder when 36634 is divided by 1362. 1222 Calculate the remainder when 20682 is divided by 15. 12 Calculate the remainder when 41493 is divided by 29. 23 What is the remainder when 44615 is divided by 357? 347 Calculate the remainder when 613 is divided by 533. 80 Calculate the remainder when 29655 is divided by 25. 5 Calculate the remainder when 212733 is divided by 106352. 29 What is the remainder when 90017 is divided by 219? 8 Calculate the remainder when 1992 is divided by 880. 232 Calculate the remainder when 4635 is divided by 20. 15 What is the remainder when 1053672 is divided by 17? 12 Calculate the remainder when 81712 is divided by 20424. 16 Calculate the remainder when 2637 is divided by 2626. 11 Calculate the remainder when 2278370 is divided by 119. 115 What is the remainder when 341160 is divided by 268? 264 Calculate the remainder when 21704 is divided by 482. 14 What is the remainder when 15312 is divided by 1635? 597 Calculate the remainder when 14158 is divided by 392. 46 Calculate the remainder when 364 is divided by 27. 13 What is the remainder when 3401 is divided by 3356? 45 What is the remainder when 3647 is divided by 450? 47 What is the remainder when 5671 is divided by 14? 1 Calculate the remainder when 853 is divided by 750. 103 What is the remainder when 9527 is divided by 27? 23 What is the remainder when 1266326 is divided by 406? 12 Calculate the remainder when 452029 is divided by 224. 221 What is the remainder when 413 is divided by 44? 17 Calculate the remainder when 2123 is divided by 548. 479 Calculate the remainder when 128916 is divided by 44. 40 What is the remainder when 6774 is divided by 77? 75 What is the remainder when 260 is divided by 154? 106 What is the remainder when 6328 is divided by 38? 20 Calculate the remainder when 696982 is divided by 452. 450 What is the remainder when 75600 is divided by 306? 18 What is the remainder when 11124 is divided by 89? 88 Calculate the remainder when 9135 is divided by 15. 0 What is the remainder when 406730 is divided by 101677? 22 Calculate the remainder when 641424 is divided by 5831. 14 What is the remainder when 19043 is divided by 87? 77 Calculate the remainder when 441331 is divided by 1298. 11 What is the remainder when 9527 is divided by 3143? 98 Calculate the remainder when 20718 is divided by 471. 465 What is the remainder when 28114 is divided by 9? 7 Calculate the remainder when 56283 is divided by 18752. 27 Calculate the remainder when 6345 is divided by 528. 9 Calculate the remainder when 7535 is divided by 22. 11 What is the remainder when 404717 is divided by 20? 17 What is the remainder when 5786 is divided by 1422? 98 What is the remainder when 183697 is divided by 3011? 26 What is the remainder when 2050 is divided by 547? 409 Calculate the remainder when 4265 is divided by 158. 157 What is the remainder when 951014 is divided by 44? 42 Calculate the remainder when 14482 is divided by 7240. 2 What is the remainder when 10786 is divided by 142? 136 What is the remainder when 179349 is divided by 19927? 6 What is the remainder when 28478 is divided by 1672? 54 Calculate the remainder when 5142 is divided by 61. 18 What is the remainder when 45170 is divided by 90? 80 What is the remainder when 7908 is divided by 502? 378 What is the remainder when 49546 is divided by 35? 21 What is the remainder when 299552 is divided by 1026? 986 Calculate the remainder when 2523 is divided by 1257. 9 Calculate the remainder when 4138 is divided by 970. 258 What is the remainder when 65776 is divided by 198? 40 Calculate the remainder when 856 is divided by 114. 58 Calculate the remainder when 7263 is divided by 2369. 156 Calculate the remainder when 15253 is divided by 2160. 133 Calculate the remainder when 642968 is divided by 2820. 8 Calculate the remainder when 13557 is divided by 57. 48 What is the remainder when 10666 is divided by 68? 58 Calculate the remainder when 4043 is divided by 478. 219 What is the remainder when 38681 is divid	{ "pile_set_name": "DM Mathematics" }
dps. -162 Let f = 33701500 - 33701458.9999924. Let k = 0.094 - 41.094. Let c = k + f. What is c rounded to six dps? 0.000008 Let q = 852.487 - 852. Let f = q - 0.48696112. What is f rounded to 6 decimal places? 0.000039 Let y = 722454 - 722512.00048. Let h = y + 58. Round h to 3 decimal places. 0 Let f = -30646 + 13797. Let d = f - -86849. What is d rounded to the nearest ten thousand? 70000 Let k = 1031550 + -729750. Round k to the nearest 100000. 300000 Let t = 3.319049058 - 3.319. What is t rounded to 7 decimal places? 0.0000491 Let b = 8947 - 8971.864. What is b rounded to one decimal place? -24.9 Let p = 0.13107 + -44.21307. Let n = -35.5 - 8.5. Let k = n - p. What is k rounded to 2 decimal places? 0.08 Let v = -40.222 + -2.588. What is v rounded to the nearest ten? -40 Suppose 5r = -b + 289157716, 57831544 = -0r + r + b. Suppose 18i + 11895543 - r = 0. Round i to the nearest one hundred thousand. 2600000 Let h = 184 - 183. Let k(n) = 52399999n*2 + 13n - 12. Let s be k(h). Round s to the nearest one million. 52000000 Let a = -7623432.00069 - -7623191. Let q = 241 + a. What is q rounded to four dps? -0.0007 Let j = -253 + 723. Let t = 795 - j. Let c = -324.9999649 + t. Round c to 6 dps. 0.000035 Let w = -352.9522 - 0.0478. Let a = w - -352.9999988. Round a to seven decimal places. -0.0000012 Let o = 436.49 - 509.837. Round o to zero dps. -73 Let n = 24816 - 24823.7815. Round n to 1 decimal place. -7.8 Let x = 9.775 + -1.945. Let p = 6.9 - x. Let a = p + 0.99. Round a to two dps. 0.06 Let u = -189.66 + 189.6611889. Round u to 4 dps. 0.0012 Let v = 124 + -117.4. Let x = -36104129.4000156 + 36104136. Let j = x - v. What is j rounded to 5 dps? -0.00002 Let d = -0.331 + 354.331. Let f = 353.214 - d. What is f rounded to one decimal place? -0.8 Suppose -x + 19038 = -103057. Suppose 0 = -4s + 2277905 + x. Suppose -7d = -3d + s. What is d rounded to the nearest 100000? -200000 Let s = -110 + 289.4. Let k = s - 179.402922. Round k to 4 dps. -0.0029 Let w = -1.68 - -1.67. Let a = 0.01000101 + w. Round a to seven decimal places. 0.000001 Let j be ((-10)/(-25))/((-3)/(-240)). Suppose 11l - 441000 = jl. Round l to the nearest ten thousand. -20000 Let g = 789418391022 + -789418392326.000000733. Let s = 1304 + g. Round s to six decimal places. -0.000001 Let r = -806 + 1440. Let f be (6024 + -24)/((-1898)/r + 3). What is f rounded to the nearest 100000? 1000000 Let s = 172.359 - 0.359. Let v = s - 171.99999938. Round v to seven dps. 0.0000006 Let p = -28196.4175 + 28196. Round p to 1 decimal place. -0.4 Let q(t) = -t2 - 23t - 73. Let h be q(-13). Let d be (38/h)/(4/1014). Round d to the nearest one hundred. 200 Let y = -94.944 - 0.756. Let s = 108.68 + y. What is s rounded to zero decimal places? 13 Let w = -109 - -25. Let j = w - -79.1. Let z = -4.89822 - j. Round z to four decimal places. 0.0018 Let v = -23.7 - 0.3. Let u = 23.83 + v. Let i = 0.1700004 + u. What is i rounded to 6 decimal places? 0 Let j = -83.5 - -83.877. Let p = j - 0.899. What is p rounded to 1 decimal place? -0.5 Suppose -4k - 5 - 11 = 0, 85 = 5z + 5k. Let v(m) = -zm*3 + 15m*3 - 14 + 5m*2 + 9m + 11m2. Let a be v(-18). What is a rounded to the nearest 10000? 40000 Let n = -1133 - -6965. Let g = 5832.28036 - n. Let r = g + -0.28. Round r to four dps. 0.0004 Let k = -394.815 - -322.1. Let y = k - -72. What is y rounded to two dps? -0.72 Let f = -0.022 + 0.122. Let y = -0.5 + -0.2. Let b = f + y. What is b rounded to zero dps? -1 Let y = 121.2 - 121.1870008. Let j = 3.2 + -3.213. Let t = j + y. What is t rounded to seven decimal places? -0.0000008 Let c be (-476)/85(-106430)/1. Let o be (-8 + c)/(4/(-10)). Round o to the nearest 100000. -1500000 Let l = -0.207 + -0.1008. Let k = l + 0.30777313. What is k rounded to 5 dps? -0.00003 Let c = 135.96111 - 135.319. Round c to 2 dps. 0.64 Let w(u) be the second derivative of 1/3u4 + 1/6u*3 - 39063/10u*5 - 24u + 0 - 2u2. Let d be w(4). What is d rounded to the nearest 1000000? -5000000 Let y = -4589015856311 - -4589015854179.999998487. Let j = y - -2131. Round j to 7 decimal places. -0.0000015 Let p = 1422 + -720. Let h = p - -433. Let v = 1135.00000553 - h. Round v to 7 decimal places. 0.0000055 Let q = 2.075 - 0.574. Let i = 1.500999089 - q. Round i to seven decimal places. -0.0000009 Let s = -3345.3672 - -3.2672. Round s to the nearest 100. -3300 Suppose 0u - m = -3u + 1, 0 = -u - 4m - 4. Suppose u = 3f - 4 + 1. Let h be (f - -14)/((-6)/4806). Round h to the nearest ten. -200 Let j = 1373 + -1372.31. Let u = 5.4712 - 6.161096. Let w = u + j. What is w rounded to 5 dps? 0.0001 Let k = -86347 + 86370.4134. What is k rounded to the nearest integer? 23 Let o = 154028.0000099707 - 154028. Round o to six decimal places. 0.00001 Suppose 5b = 3u + 1, -5u + b = -4u - 1. Suppose -2f = -5x + 3f - 377495, 0 = ux - f + 226499. What is x rounded to the nearest ten thousand? -80000 Let j = -12.350473 + 12.344. Round j to four decimal places. -0.0065 Let y = 413.4 + -413.399271. What is y rounded to four decimal places? 0.0007 Let w = -0.067453039 + 0.06746. What is w rounded to 6 decimal places? 0.000007 Suppose 5g + w - 180639 + 1793894 = 0, 0 = -g + 5w - 322625. Let i be 8/3g/36. What is i rounded to the nearest 1000? -24000 Let m = -278548.183 + 278752. Let o = 204 - m. Let l = 0.1830087 - o. What is l rounded to six dps? 0.000009 Let o = -1.6759 - 1020.4241. Let s = -1081 - o. Round s to the nearest ten. -60 Suppose 501 = 4j - a + 132, -4a + 198 = 2j. Let t = j + 13. Round t to the nearest ten. 110 Let y = -3577 - -3577.02583. What is y rounded to 3 decimal places? 0.026 Let n(w) = 3w - 21. Let u be n(4). Let y = 13 + u. Suppose yq + 2725 = -1155. What is q rounded to the nearest 100? -1000 Let v = -1624.398 - -1777.3946. Let c = v + -153. Round c to three dps. -0.003 Let y = 4671.999999432 - 4672. What is y rounded to 7 dps? -0.0000006 Let i = 16.08 - 3.6. Let j = 18 - i. Round j to 1 dp. 5.5 Let t = -0.027924 + 0.16085. What is t rounded to three decimal places? 0.133 Let z = 9076 - 9075.647. Round z to two dps. 0.35 Let u = 122.2 - 76. Let f = -63.9 + -0.1. Let c = u + f. Round c to zero decimal places. -18 Let j = 16.41948 - -11.8858. Let x = j - 28.3. What is x rounded to three decimal places? 0.005 Suppose 3f - 57 = -4l + 10, 60 = 3f - 3l. Suppose fi = -1833 + 12333. What is i rounded to the nearest ten thousand? 0 Let a = -137097 + 137096.939909. Let y = -1.94 - -2. Let v = a + y. Round v to five dps. -0.00009 Let q = 9332.99112 - 9333. Round q to two decimal places. -0.01 Let k = -28185.03 - -28184. Let g = 0.122 + -1.052. Let y = k - g. Round y to the nearest 10. 0 Let n = -157464 - -415412. Suppose 5x = -x + 462312. Let l = n + x. What is l rounded to the nearest ten thousand? 340000 Let n be -2164137 + (12/2)/(-2). Suppose -3f - 23471711 = -2h, -5f - 24023932 = -4h + 22919493. Let o = n - h. Round o to the nearest one million. -14000000 Let s = -0.05 - 3.7. Let z = s - -7.671. Let c = z + -4. What is c rounded to 2 decimal places? -0.08 Let s = 857763 - 471238. Suppose -27q = -s - 431575. Round q to the nearest one thousand. 30000 Let f(x) = x3 + 10x*2 + 8x - 7. Let c be f(-9). Let n be (-21)/147 - (121458/(-7) - c). Let u = -1347 - n. What is u rounded to the nearest one thousand? -19000 Let s(k) = -1353556k + 136. Let b be s(56). What is b rounded to the nearest one million? -76000000 Let o = 0.2272 - 0.147. Let v = o + -0.079651. What is v rounded to 5 decimal places? 0.00055 Let i = 120.947 + -121. Let n = i + 0.09. Let t = n + -0.03700073. Round t to seven dps. -0.0000007 Let c = -274 + 271.146. What is c rounded to the nearest integer? -3 Let a = 20.2 - -0.5. Let t = 108.3 + a. Let j = t + -129.000114. What is j rounded to five decimal places? -0.00011 Let b = -203588.71211 + 203587. Round b to 2 decimal places. -1.71 Suppose -21v - 72 = -39v. Suppose -5w = 3c + 913015, 4c + 182620 = vw - 5w. Round w to the nearest 100000. -200000 Suppose 0 = 5h - 4k + 14746859, 0h + 3k - 8848116 = 3*h. Let m = h - -4979371. Round m to the nearest 100000. 2000000 Let k = 747 - 309. Let s = -438.74 + k. What is s rounded to one dp? -0.7 Let m = -222.54 + 222.540	{ "pile_set_name": "DM Mathematics" }
that v(g) = 0. -196, 0, 2 Let s(d) be the third derivative of d*6/36 + 5d*5/8 - 5d*4/3 - 37d*3/2 - 36d*2 + 4. Let n(u) be the first derivative of s(u). Factor n(t). 5(t + 8)(2t - 1) Let c = 371583 + -1857813/5. Find b, given that 9b4 + 24/5b + cb3 + 7/5b*5 + 0 + 92/5b*2 = 0. -2, -3/7, 0 Let f = -55572 - -722438/13. Let -4/13t - f - 2/13t2 = 0. What is t? -1 Let a = 198 - 60. Factor 142d*5 + 12d*2 - 10d*2 - 26d*2 - ad*5 - 28d*3. 4d*2(d - 3)(d + 1)(d + 2) Let z(q) be the third derivative of q*6/195 - 11q*5/130 + 14q*4/39 - 4q*3/13 - 1788q2. Find s, given that z(s) = 0. 1/4, 2, 6 Let m(k) be the second derivative of -k4/18 - 38k3/3 + 117k*2 + 3036k - 2. Factor m(s). -2(s - 3)(s + 117)/3 Let g = 705/3322 - -16/151. Let i = g - -5/22. Factor 4/11v + 2/11v*3 - iv*2 + 0. 2v(v - 2)(v - 1)/11 Determine k, given that -2k3 - 4k*2 + 61k*2 - 3k*2 - 792k + 1171 + 58k2 - 19 = 0. 2, 6, 48 Let p(k) be the second derivative of k5/70 - 97k*4/21 - 1600k*3/21 - 3232k*2/7 + 4k - 102. Suppose p(s) = 0. What is s? -4, 202 Let z(q) = 11q - 484. Suppose 6k - 10k + 152 = 3c, 3c + k - 137 = 0. Let a be z(c). Factor aj*2 + 0 + 8/9j - 2/9j3. -2j(j - 2)(j + 2)/9 Let s(u) = -63u - 5. Let m be s(1). Let i = 69 + m. Find k, given that -4 + i + k2 + 2 = 0. -1, 1 Let r(q) be the third derivative of -q7/140 + 17q*6/360 + 11q*5/90 - 17q*4/18 - 8q*3/9 + 2018q*2. Find d, given that r(d) = 0. -2, -2/9, 2, 4 Determine n, given that 27/4n*2 - 3/4n*4 - 1/4n*5 + 0n + 9/4n3 + 0 = 0. -3, 0, 3 Let k = 23 + -19. Suppose 15 = 9t - kt. Factor 3x - 13x2 + 3x*3 + 0x*t + 7x*2. 3x(x - 1)2 Suppose 265 = 2i + 255. Let s(r) be the second derivative of -33r + 0 + 0r*3 + 1/30r*i + 0r*2 + 2/9r*4. Factor s(v). 2v*2(v + 4)/3 Let m(n) = -7n + 150. Let r be m(15). Suppose -240 = -51x + rx. Suppose 60z*2 - xz*3 - 40z + 25/2z4 + 8 - 3/2z5 = 0. Calculate z. 1/3, 2 Let u(a) be the first derivative of a6/24 + 19a5/20 + 103a*4/16 + 121a*3/12 - 13a*2 - 35a - 13621. Suppose u(m) = 0. What is m? -10, -7, -2, -1, 1 Let u be (-6)/(-14) - 1065/(-70). Suppose 8 = 10c - uc. Factor 210n*3 - 83n*3 + 4n*5 + 16n*c - 103n*3 + 16n*2 + 4n. 4n(n + 1)4 Let x(h) be the second derivative of h5/6 + 713h4/18 - 286h*3/9 + 2h + 5392. Determine j so that x(j) = 0. -143, 0, 2/5 Let r(h) = 4h3 + 40h*2 + 30h. Let c(w) = -w. Let s = -359 + 360. Let t(n) = sr(n) - 6c(n). Factor t(p). 4p(p + 1)(p + 9) Let -4/5d*2 + 3908/5 + 3904/5d = 0. Calculate d. -1, 977 Let x = -51/29 - -3701/2088. Let h(v) be the second derivative of -18v + 0 + xv*4 + 3v*2 - 1/3v*3. Let h(t) = 0. What is t? 6 Let b(w) be the third derivative of -1/35w*7 - 1/4w*4 + 2w*2 + 0w - 1/84w8 + 3/20w*6 - 8 + 0w*3 - 1/30w*5. Solve b(u) = 0. -3, -1/2, 0, 1 Suppose 3w + 10788 = 32w. Let c = -369 + w. Factor 3/7g*c + 27/7 + 3g*2 + 45/7g. 3(g + 1)(g + 3)*2/7 Factor 7562500/7 + 11000/7v + 4/7v2. 4(v + 1375)*2/7 Let n(q) be the third derivative of -1/15q*5 + 0 + 10q*3 + 0q + 1/3q4 - 174q*2. Suppose n(d) = 0. What is d? -3, 5 Suppose 4v - 12v = -32. Suppose 4 = -m, 3t - 2m - 3m - 35 = 0. Factor 5a5 + av - at - 13a*5 + 8a5. -a4(a - 1) Let f = 704 + -702. Let h be (-14)/f + (10 - 3). Factor 4/11m*2 - 2/11m*5 + 0m + 0 + hm4 + 6/11m*3. -2m*2(m - 2)(m + 1)2/11 Let y(n) = 23n + 5. Let v be ((-48)/(-4))/3 + -3. Let u be y(v). What is z in -uz5 - 244z*4 - 201z - 348z3 + 820z*2 + 75z - 74z = 0? -5, 0, 2/7, 1 Let v(w) be the first derivative of -3w*5/20 - 39w*4/4 - 507w*3/2 - 6591w*2/2 - 54w + 1. Let r(f) be the first derivative of v(f). Factor r(d). -3(d + 13)3 Let i(o) = 4o*2 + 512o - 1876. Let w(l) = -l*2 - 103l + 375. Let y(k) = 3i(k) + 16w(k). Factor y(z). -4(z - 3)(z + 31) Let l(v) = -41v2 - 11657v - 1976548. Let w(s) = -13s2 - 3866s - 658849. Let t(j) = 4l(j) - 13w(j). Solve t(d) = 0. -363 Let t(v) be the second derivative of v*6/540 + 13v*5/90 + 4v*4/3 - 47v*3 - 233v. Let j(d) be the second derivative of t(d). What is a in j(a) = 0? -24, -2 Let z be 225/(-4)171/(-57). Suppose -90 + zr + 5/2r*3 - 25r*2 = 0. What is r? 3, 4 Let c(u) = -7u*5 + 5u*4 - 8u*3 + 20u*2 - 8u. Let g(p) = -8p5 + 6p*4 - 7p*3 + 24p*2 - 9p. Let d(x) = -9c(x) + 8g(x). Factor d(y). -y*2(y - 6)(y + 1)(y + 2) Let k(v) be the second derivative of v*4/114 + 184v*3/19 + 76176v*2/19 + 154v + 1. Determine z so that k(z) = 0. -276 Let w(b) = -b*2 + 4b. Suppose o = 4o - 4o. Suppose 11v + 10 + 45 = o. Let u(c) = c2 - 5c + 1. Let l(x) = vw(x) - 4u(x). Factor l(s). (s - 2)(s + 2) Let x(i) be the first derivative of 3i*5/5 + 15i*4/2 - 61i*3 - 105i*2 + 2106. Find b such that x(b) = 0. -14, -1, 0, 5 Solve 37/5p*3 + 9/5p + 2/5p5 + 33/5p*2 + 3p4 + 0 = 0. -3, -1, -1/2, 0 Let b(f) = f2 + 5f - 4. Let o be b(-6). Let k(g) = g3 + 19g*2 + 74g - 51. Let s be k(-13). Find d, given that s - 8d - 11 + 0d*2 + 2do = 0. -1, 5 Let k(n) be the second derivative of -n7/189 + n*6/5 - 971n + 1. Solve k(w) = 0. 0, 27 Let f(r) be the second derivative of 18r - 1/42r*4 + 10/7r*3 + 0 - 225/7r*2. Solve f(i) = 0 for i. 15 Let r be 23/69(-594)/(-1). Let m = 399/2 - r. Find w such that -3/2w4 + mw*3 + 3 + 9/2w*2 - 15/2w = 0. -2, 1 Let t(c) be the first derivative of 9c5/5 - 119c*4/4 + 26c3/3 + 10872. Factor t(u). u2(u - 13)(9u - 2) Let y(v) be the third derivative of v5/15 + 161v*4/3 + 2v*2 - 194v. Let y(s) = 0. What is s? -322, 0 Let y = -31682 - -31687. Let a(t) be the third derivative of -7/2t3 + 0 - 9/20t*y - 1/40t*6 - 12t*2 - 15/8t*4 + 0t. Factor a(o). -3(o + 1)2(o + 7) Let h(y) be the third derivative of -y*5/20 - 11y*4 + 89y*3/2 - 6799y*2. Factor h(a). -3(a - 1)(a + 89) Let c = 1061067/5 - 211983. Solve -2/5x*4 - c + 88/5x*2 - 8/5x*3 + 192/5x = 0. -6, 4 Let k(z) be the third derivative of -z9/756 - z8/140 - z7/70 - z6/90 - z*3/3 - 3z*2 + 5. Let q(j) be the first derivative of k(j). Factor q(l). -4l*2(l + 1)*3 Let n = -99551/94 + -115/47. Let x = n - -1064. Determine w, given that xw + 5/2w3 - 5w*2 + 0 = 0. 0, 1 Let h(i) be the first derivative of -1/35i*5 + 2i + 0i2 + 0i*3 + 1/42i*4 - 1/35i*6 + 1. Let d(t) be the first derivative of h(t). Factor d(l). -2l*2(l + 1)(3l - 1)/7 Let o(v) be the second derivative of 5/12v4 + 36v + 1/12v5 + 0v*3 + 12v*2 - 1/24v*6 + 0. Let f(n) be the first derivative of o(n). Factor f(d). -5d(d - 2)(d + 1) Let u = 233 + -228. Let h(r) = -8r4 - 24r*3 - 16r*2 - 5r. Let d(v) = -12v4 - 36v*3 - 24v*2 - 8v. Let o(q) = ud(q) - 8h(q). Factor o(z). 4z2(z + 1)(z + 2) Let w(b) be the third derivative of 5/24b*6 + 0b - 14b2 + 153/8b*4 - 289/6b*3 - 13/4b*5 + 0. Find a, given that w(a) = 0. 1, 17/5 Find u such that 43/3u - 8u2 + 2/3 + 22/3u*4 - 43/3u*3 = 0. -1, -1/22, 1, 2 Suppose -2b + b - 2a = -8, 5b = 4a + 12. Let i = b + 19. Factor is*2 + 8s*4 - 6s - 13s3 - s2 - 13s*3 + 2s. 2s(s - 2)(s - 1)(4s - 1) Let b(c) = c2 + 12c + 6. Let q be b(-5). Let s = 45 + q. Factor -s - 29d + 4d*3 + 10d - 8d2 - 9d. 4(d - 4)(d + 1)*2 Suppose -170f - 229f + 1596 = 0. Let m(b) be the second derivative of 1/5b*3 + 0b*2 - 14b + 0 + 1/50b5 + 2/15b*f. Factor m(c). 2c(c + 1)(c + 3)/5 Let h(s) = -81s + 129. Let l be h(-11). What is u in 15u*3 + lu*4 - 510u*4 - 505u4 = 0? -3, 0 Let n(d) be the first derivative of d5/270 + d*4/108 - 2d*3/27 - 9d*2/2 - 2d + 44. Let u(s) be the second derivative of n(s). Factor u(m). 2(m - 1)(m + 2)/9 Let k(u) = 6u2 - 6u. Let x(d) = 12 - 46 + 15 + d*2 + 6 + 12. Let q = 6 - 3. Let j(g) = qx(g) - k(g). Solve j(l) = 0. 1 What is o in 9o4 - 118o + o - 75o - 106o*3 + 8o*4 + 64 - 2o*5 + 212o*2 + 7o*4 = 0? 1, 2, 4 Let p(v) = 21v + 37. Let o(j) = -50j - 92. Let x(i) = -5o(i) - 12p(i). Let d be x(8). Factor 1/2k*2 - 1/2k*4 + 1/4k*5 - 1/4k	{ "pile_set_name": "DM Mathematics" }
-2 + (1 + -1 - 4). Let g be f(-4)/((-12)/(-9)). Suppose 0 = -3k - g + 3. Sort -1/2, k, 4. k, -1/2, 4 Let x(z) = 5z - 3z - z. Let h be 3/(-6)2/(-1). Let f be x(h). Put 0, -2, f in decreasing order. f, 0, -2 Let y = -2 + 2.02. Let w = 1.02 - y. Sort -3/7, -2/3, w. -2/3, -3/7, w Let b be -6(-1 + ((-126)/16)/(-9)). Put 0.2, -3/2, b, -5/4 in descending order. b, 0.2, -5/4, -3/2 Suppose -27i = -33i. Put 3/5, -2, i, 1/4 in increasing order. -2, i, 1/4, 3/5 Let j be 1/(2/82). Suppose -jh + 4q + 6 = 0, 1 = 2h + 3q + 2. Sort 3, -2, h in decreasing order. 3, h, -2 Let w = 45 + -44.1. Sort 2, w, -4, -0.2 in decreasing order. 2, w, -0.2, -4 Let x(c) = -c2 - 4c + 9. Let m be x(-6). Sort 5, m, 4, -4 in decreasing order. 5, 4, m, -4 Let f be ((2/(-3))/(-2))/((-6)/(-90)). Put 1, 20, -1, f in decreasing order. 20, f, 1, -1 Let y = -0.06 + 0.06. Let c = -0.1 - -0.2. Put y, c, -0.2 in increasing order. -0.2, y, c Let s = 2.9 - 0.2. Let d = -0.3 - s. Let y = -130 + 126. Put y, d, 1 in descending order. 1, d, y Let j = 3 + -26. Sort 5, -0.5, j. j, -0.5, 5 Let y = 15 - 17. Let x(b) = -b + 6. Let r be x(0). Let z be (-5)/(-3) + r/(-9). Sort z, y, -1 in increasing order. y, -1, z Let i(f) = -f - 3. Let k be i(-7). Put -3, k, 2 in increasing order. -3, 2, k Let c = 6.4 + -3.4. Sort 0.4, c, -2/11, 1 in descending order. c, 1, 0.4, -2/11 Suppose 4i - 8i = 0. Sort -5, i, -2 in decreasing order. i, -2, -5 Let l = 2 - -4. Let d(f) = -f*2 + 6f - 3. Let z be d(l). Sort 4, 5, z in descending order. 5, 4, z Let h = -0.9 + -3.1. Put 0.4, 4, h in decreasing order. 4, 0.4, h Let b = -10.7 - -7.7. Let f = 2.9 + -3. Put 1, b, f in descending order. 1, f, b Let f(o) = -2o + 17. Let p be f(10). Sort 5, 6, p in descending order. 6, 5, p Let k(u) = -3u - 12. Suppose p + 5 = -3. Let t be k(p). Suppose 0 = 2c - 4c + t. Put 5, -3, c in descending order. c, 5, -3 Let j = -4.1 - -0.7. Let p = j + 1.4. Put -0.1, p, -1 in decreasing order. -0.1, -1, p Let d = 1.6 + -1.1. Sort d, 2, 6/13. 6/13, d, 2 Let p = 0.19 + 3.81. Sort 0, p, 0.4 in decreasing order. p, 0.4, 0 Let k = -9.117 - -0.117. Sort -4, 0, -2/3, k in decreasing order. 0, -2/3, -4, k Let s = -25 - -24.5. Let p = 0.3 - 0.1. Let d = p - 0.6. Sort s, d, 0.1. s, d, 0.1 Let h = 10 + -6. Let a = -757 - -756. Let v be (0 + 0)/((-3)/(-3)). Sort a, h, v in descending order. h, v, a Let u be (-3)/(-62/(-16)). Let h = 7 + u. Sort -3, h, -5 in decreasing order. h, -3, -5 Suppose 24 = 5p - 4l, 0 = -p - 3l - l. Let s = -7 - -5. Put -3, s, p in ascending order. -3, s, p Let s = -15.1 - -15.2. Put s, -0.2, -2/9, 3/7 in decreasing order. 3/7, s, -0.2, -2/9 Let c = 6 - 13. Suppose -i + 0i = -6. Let w = c + i. Sort 0, w, 4. w, 0, 4 Let p = -0.5 - -0.5. Let q = -0.06 + -7.94. Let r = 3 + q. Put p, 0.1, r in ascending order. r, p, 0.1 Suppose 2z - 34 = -0z. Suppose -z = 3l + 25. Let r be l/(-36) + (-6)/27. Sort 5, -2/11, r. -2/11, r, 5 Let z = -0.04 - -0.02. Suppose 2q - 6 + 0 = 0. Put 0, q, z in ascending order. z, 0, q Let n = -17 + 20. Sort 4, n, 0 in decreasing order. 4, n, 0 Let k = -2.95 + 3. Let v = k - 5.85. Let y = 6 + v. Put y, -4/7, -0.5 in ascending order. -4/7, -0.5, y Suppose -5o + h = 8, 3o = o - 4h - 12. Let r = 4 + o. Let b = -1 - -6. Put b, r, -5 in descending order. b, r, -5 Suppose 0 = 3k + 3m, -5m - 2 = 4k - 0m. Suppose -4w = -4a - 8, -ka + 7a - w = -14. Suppose 4t = -0t. Sort t, 3, a in descending order. 3, t, a Let y = 0.3 - 0.8. Let u = 0 + 0.5. Sort y, -2, u in increasing order. -2, y, u Let l = 3 - -5. Let j = -3 + l. Let i be 5/10 - (-33)/(-42). Sort i, -1, j in increasing order. -1, i, j Let f(n) = -n2 - 9n - 5. Suppose -5q + 4 = -2p - 2q, -24 = 2p + 2q. Let d be f(p). Let g be 0/(1/d3). Put -1, g, -5 in increasing order. -5, -1, g Let p(n) = -n*2 + 5n + 5. Let h be p(5). Suppose 5u = -3l + 2l - 16, -hu = -5l + 40. Put u, 0.3, -1 in descending order. 0.3, -1, u Suppose 5m - 15 = 0, -j - 2m + 3 - 1 = 0. Let c be 46/14 - j/(-14). Suppose -4n = -9n + 25. Put c, n, 2 in decreasing order. n, c, 2 Suppose 3f + 3 = -12. Put 2, f, 4 in increasing order. f, 2, 4 Let g = 6 + -5.98. Let q = g - 0.12. Let b = -3 + 7. Sort q, 1/8, b in decreasing order. b, 1/8, q Let g = -23.7 + 25. Let b = g + -0.3. Suppose 0f = -f. Sort 5, f, b in descending order. 5, b, f Let u = 5.6 + -6. Let a = -14 - -13.65. Let d = 0.05 - a. Sort -0.1, d, u in descending order. d, -0.1, u Suppose -3j + j = 0. Suppose h - 3t - 14 = j, -4h - 2t = 2t + 8. Put 3, h, 0.2 in increasing order. 0.2, h, 3 Let z(t) = -4t2. Let b be z(1). Let u(v) = -v2 - 6v - 3. Let a be u(-4). Suppose -3i + 2 = -4i. Sort a, b, i in decreasing order. a, i, b Let z = -6.2 - -0.2. Let t = 16 + -6. Let s = z + t. Put s, 3/2, -3 in decreasing order. s, 3/2, -3 Suppose -3u - 6 = 6. Let y be u/(-7) - (-160)/(-35). Let a = -3 + 1. Put 1, a, y in descending order. 1, a, y Let w = -0.9 - -0.5. Let r = -0.2 + 0. Let o(j) = j + 2. Let z be o(-3). Sort w, r, z in ascending order. z, w, r Let f = -0.8 + 1. Let d = f - -0.8. Let u = 2/443 - -868/3987. Put u, 2, d in increasing order. u, d, 2 Let r(s) = 5s*2 - 5s + 2. Let c be r(1). Put 5, -28, c in descending order. 5, c, -28 Let d be 6/21 + (-132)/21. Let l = -1 - d. Sort -3, l, -5 in descending order. l, -3, -5 Let g(i) = i*3 + 6i*2 + 6i + 6. Let h be g(-5). Let k be 1/(-2)2/h. Let y be (2/18)/(k/(-4)). Put -0.4, y, -1 in descending order. y, -0.4, -1 Let a = 0 - 4. Let q(f) = 15f - 43. Let d be q(3). Put a, 1, d in increasing order. a, 1, d Let c be 6/30 + 2/(-10). Sort c, -0.1, 2/5 in decreasing order. 2/5, c, -0.1 Let f = -1.1 - -1. Let a = -3.1 - -4. Let q = 2.1 + a. Put f, 4, q in decreasing order. 4, q, f Let a = -76 + 75.57. Let c = -0.03 - a. Let r = 0.7 - -0.3. Put c, -5, r in decreasing order. r, c, -5 Let v = 44/63 + -2/63. Put v, 0.4, 0.5, 2 in decreasing order. 2, v, 0.5, 0.4 Let t = -12 - -10. Sort -5, t, -3. -5, -3, t Suppose -42 = 10k + 28. Sort k, 3, -5 in decreasing order. 3, -5, k Let c(y) = -y3 + 26y*2 + 24y + 64. Let l be c(27). Sort 2, 1, l, 5 in descending order. 5, 2, 1, l Let w = -91/4 + 23. Let s = 1 - 1. Let p = s + 0. Sort 2, p, w in descending order. 2, w, p Let m be (0/(-3) + 4)/(-1). Let f = m + 1. Sort -5, 0, f in ascending order. -5, f, 0 Suppose 5v - 16 = 3x, -4x = -0v + 4v - 32. Put x, -2, 5 in decreasing order. 5, x, -2 Suppose -j = -m, -4m - 4j = j - 18. Suppose -n = 4 - m. Let o(y) = -y3 + 9y*2 - 9y + 7. Let l be o(8). Sort l, n, -4. -4, n, l Let f be (1/4)/(4/(-8)). Put 4, 0.2, f, -1/4 in decreasing order. 4, 0.2, -1/4, f Suppose 0 = -2q - 6q - 16. Sort 31, 3, q in descending order. 31, 3, q Let r = 1964/9 + -218. Sort 1/3, 0.3, 5, r in decreasing order. 5, 1/3, 0.3, r Let k be ((-4)/(-6))/(12/(-54)). Let m be k + 288/(-2) + -2. Let r = -742/5 - m. Sort r, 4/3, -1 in descending order. 4/3, r, -1 Let p be 3 + 1 + 0/4. Let n = -0.3 + -0.2. Sort p, 2, n in decreasing order. p, 2, n Let h = 7 + -5. Suppose hp = 10, -n + 2 = 4p - 21. Suppose -nq = -2q. Sort -4, q, 3 in ascending order. -4, q, 3 Let w be (2 - 3)/((-2)/(-4)). Suppose -3j = 2i - 14, -i + 17 = 3j + j. Put -5, w, j in decreasing order. j, w, -5 Let o = -5 + 0. Sort -2, 3, o. o, -2, 3 Suppose -3h + 4 = 19. Let w(u) = u*2 + 4u - 7. Let k be w(h). Put 0, k, -4 in ascending order. -4, k, 0 Let m = 387/308 - 1/154. Let t = -27 + 14. Let q = -18 - t. Sort q, m, 0 in increasing order. q, 0, m Let g = -0.92 + -0.08. Let p = -1.1 - g. Put p, 0, 5/6 in increasing order. p, 0, 5/6 Let s = 77 - 72. Sort 0, -0.2, -1, s in decreasing order. s, 0, -0.2, -1 Suppose 8t - 3t = 40. Suppose 3 = -3k - 5m, -k + m - 1 + t = 0. Let h = 0.2 - 0. Sort k, -2/3, h in decreasing order. k, h, -2/3 Let w = -0.12 - -0.52. Sort 2/3, w, -1/11 in decreasing order. 2/3, w, -1/11 Let q = -8.5 + 9. Put q, -0.2, -11 in descending order. q, -0.2, -11 Let i be (-1)/5 - (-84)/20. Suppose 4u - 37 = -5. Suppose -5r + 16 = -4b + ub, b - 11 = -3r. Sort b, -3, i in increasing order. -3, b, i Let d = -2 - 1. Let w(v) = v - 10. Let k be w(5). Sort -1, k, d. k, d, -1 Let d = -13 + 13. Suppose -3w + 5 = 2w. Put -4, d, w in decreasing order. w, d, -4 Let o be (-20)/5(-5)/(-	{ "pile_set_name": "DM Mathematics" }
t o(m) = 5226m - 67936. Calculate the smallest common multiple of o(13) and (42/(-5))/(z/10). 42 Calculate the common denominator of -155/528 and (-2)/20 - (5/(-3600))/((-396)/(-24792)). 4752 Let s be ((-9)/6)/(-3)2222. Suppose 0 = 2t + 3841 - s. What is the common denominator of (2/18)/(-1)t/10 and 46/11? 66 What is the least common multiple of 1(14 - (-6 + -300)) and 80? 320 Let v(s) be the third derivative of -s6/120 + 7s5/60 - s3/6 - 4s2. Let j be v(7). Find the common denominator of -7/29 and 598/(-39)(j + (-10)/8). 58 Let p = -2904 - -749273/258. Calculate the common denominator of 16/817 and p. 4902 Suppose -3t = d - 19, -t = 4t - d - 29. What is the smallest common multiple of 4/(4 - 3) + 14 and t? 18 What is the common denominator of -53/572 and (-103)/(-412) + 420/(-1144)? 572 Let n(q) = 2q2 - 39q + 10. Let p be (4 - 23)/(2 - 3). Let b be n(p). What is the least common multiple of 7 and (b/(-15) + 4/(-15))3? 7 Let p = 1/243 - -1357/4860. What is the common denominator of p and -27/340? 1020 Let w be (2 + (-68)/(-6))3. Let q = w + -37. Suppose -qu = 4f - 103, -3u = -f - 3 + 10. What is the lowest common multiple of f and 10? 110 Let k = -16763 + 670447/40. Let z = 57020 - 1254455/22. Find the common denominator of z and k. 440 Let x be 4((-15)/(-25) + 8/20). Let s(v) = -5v + 7. Let l = 31 - -12. What is the common denominator of l and s(x)? 1 Let v = 9/175832 + 7113519/149984696. Calculate the common denominator of -133/18 and v. 15354 Let d = 951/2 + -503. What is the common denominator of (-72)/(-15) + -4 + 51009/(-40180) and d? 164 Let y(a) = 72a - 366. What is the lowest common multiple of 649 and y(10)? 3894 Let k = -307 + 1219/4. Let g = 107/12 - k. Calculate the common denominator of g and -86/75. 150 Suppose -196z - 96z = -263 - 1781. Calculate the smallest common multiple of 22 and z. 154 Let h be (6/8)/(9/12). Find the common denominator of -17/4 and -2 + h/((-42)/47). 84 Suppose 5g + 354 = -3j + 471, 5g - 121 = -4j. Calculate the lowest common multiple of g and 3528. 3528 Let b = 229 + -228. What is the lowest common multiple of b/(-3)-20 + 2/(-3) and 50? 150 Let j(w) = 4w*2 - 55w - 1. Suppose -2m + 22 = 2s, 3s + 23 = -3m + 4m. Calculate the lowest common multiple of 49 and j(m). 637 Suppose -3r + 2g = -28, -3r - 2r = 3g - 15. Let m = r + -13. Find the common denominator of 44/3 and (1 - 101/96)m4. 24 Calculate the smallest common multiple of ((-4)/1)/((-50)/9450) and 39. 9828 Let k = 2057 + -2019. Calculate the smallest common multiple of 464 and k. 8816 Let j(i) = -i + 1. Let y be j(-4). Suppose 15 = -yl + 90. What is the smallest common multiple of 4 and -20(-3 - l/(-6))? 20 Let l(v) = v*3 + 10v*2 + 5v - 17. Let j be l(-7). Let w = j - 82. Calculate the smallest common multiple of w and 7. 91 Let i = -457127/252 + 12676/7. Let u = -10/8469 + 29825/22584. Calculate the common denominator of i and u. 72 Suppose 3p = g + 37, -27 = -4p - 4g + 49. Suppose 208o - 384 = 103o + 89o. What is the smallest common multiple of p and o? 168 Let i(u) = 9 - 11u - 4u*2 + 7u2 - u2. Let t be i(5). Calculate the smallest common multiple of 18 and 1 + (-4)/t - -15. 90 Suppose 0 = -3l - 5r + 4, -4l - 2 = -0r + 3r. What is the common denominator of 4 + (-244)/32 + l/(-6) and (-4)/22 - 2415/(-1848)? 24 Calculate the common denominator of (8 - -19)/(-9) + 3903/1440 and -39/320. 960 Suppose 19a + 1637 - 5202 = 3104. Calculate the least common multiple of a and 21. 2457 Suppose -4f - 5p = -2646, p - 589 = -583. Calculate the least common multiple of f and 22. 7194 Let b = 135 - 65. Calculate the least common multiple of b and (-2300)/(-20) + ((-100)/(-10) - -1). 630 Let r = -3701/6930 + 13/90. What is the common denominator of -12/1771 and r? 1771 Let w(t) = -2t3 - 12t*2 - 29t - 134. Calculate the smallest common multiple of 510 and w(-6). 2040 Suppose 3y + 260 = 8y. Let a be ((-5)/(-4))/(((-1025)/60)/(-41)). Suppose ax = 38 + y. What is the lowest common multiple of x and 16? 240 Let p = 14910 + -14804. Calculate the least common multiple of 1060 and p. 1060 What is the common denominator of ((-98)/(-60))/((-3042)/468) and 179/546? 2730 What is the common denominator of (-146225)/(-5700) - (-125)/(-5) and 139/12? 228 Let h = 358793/63 + -5696. Find the common denominator of -5/234 and h. 1638 Let y = 3239 - 11726. Let h = -152701/18 - y. Calculate the common denominator of h and (3 - (-635)/(-135))/(-18 + 20). 54 Suppose -4n - 4202 = -14n + 1678. What is the lowest common multiple of n and 20? 2940 Let x = -9 - -33. Calculate the smallest common multiple of x and ((0 - -85) + (-1 - -4))73/146. 264 Calculate the common denominator of (-5)/204623/(-18) and 107/516. 516 Suppose 24v - 25v - 3 = 0. Let t(k) = 6k + 2. What is the smallest common multiple of (8/183)/((-1)/v) and t(3)? 20 Let v = -243968218766/129 - -1891216945. Let y = 9557 + v. What is the common denominator of y and -65/3? 129 Suppose -4a - 506 - 286 = 0. Let g = -34795/12 + 2902. What is the common denominator of 1/3 - (-5)/a87 and g? 132 Suppose 2j - 3 = 5. Let s be ((-3)/2)/((-1)/(184/j)). Let t = 75 - s. What is the lowest common multiple of 14 and t? 42 Let o = 4 + 68. What is the common denominator of 1718/o - (-9)/(-81) and ((-318)/12)/((-35)/(-10))? 28 Suppose 723s + 3w + 51 = 728s, -2w = s - 5. Calculate the least common multiple of s and 724. 6516 Let g(v) = 16v - 82. Let n be g(4). Calculate the common denominator of -97/20 and (-27)/n + (-294)/220 + -1. 220 Let r = 62443 + -14986381/240. What is the common denominator of r and 131/260? 3120 Let h = -6094 - -414381/68. What is the common denominator of -17/82 and h? 2788 Let q = -1325/498 - 1/166. Let u = 1322004/11 - 1463451586/12177. Let l = u - 20/41. What is the common denominator of q and l? 27 Let l = 0 - -15. Let h = -50 + -12. Let z = 89 + h. Calculate the smallest common multiple of l and z. 135 Let k = 161/15866659 + 589983397997/241474683321. Let f = -2/1691 - k. Let n = 37273/6 + -6228. What is the common denominator of f and n? 18 Let c = 3992 + -3872. Calculate the least common multiple of c and 420. 840 What is the common denominator of 1/3 - (-43)/3 and ((-16)/(-56))/((-24)/(-518))? 6 Let z = 15201 - 15076. What is the lowest common multiple of z and 375? 375 Let n = -86 + 92. What is the lowest common multiple of 2 and (-1 + n/9)/(6/(-684))? 38 Let q(k) = -246k - 5557. What is the least common multiple of 6 and q(-24)? 2082 Let s(o) = -o + 16. Suppose 147 + 344 = a - 4t, 0 = -3a + 2t + 1493. Let v = a + -495. What is the lowest common multiple of v and s(0)? 16 Suppose 29d + 479 = -449. Calculate the smallest common multiple of d/(-2) - (7 + 0) and 51. 153 Suppose -55 = -n - 10n. Suppose -3a = 4b + 10 - 50, -na = 3b - 19. Calculate the smallest common multiple of 9 and b. 117 Let g = -2274 - -2251. Find the common denominator of 53/330 and g. 330 Let s = 51599/35 + -1473. Find the common denominator of s and -70/69. 2415 Let h be (((-36)/8)/(-3))/((-2)/(-44)). Let u be (-2 + h/9)-18. Let z = u - -33. What is the smallest common multiple of 5 and z? 15 Let b = -5043684 - -50365299/10. Let h = b - -7146. Find the common denominator of -17/62 and h. 310 Let l = 454389/16 + -28403. Let j = -1525579/48 + 31785. Find the common denominator of j and l. 48 Find the common denominator of 62/315 and ((-4)/(-14))/(13(-20)/520). 315 Let k = -2007751/532 + 15097/4. What is the common denominator of k and 43/190? 1330 Let w = 893506 - 402077533/450. Calculate the common denominator of w and -187/120. 1800 Find the common denominator of ((-1778)/(-399))/((-800)/(-24)) and -41/8. 3800 Let a = 7 - 4. Let s(i) = -3i + 1 - a + i. Calculate the least common multiple of s(-4) and 6. 6 Let c be (-4 + 10 - 1) + -1. Suppose 2k + c = 0, -3o - 16 = -3k + 11. Let a = -5 - o. Calculate the least common multiple of a and 14. 42 Let o = 5/158 - -187/1580. Let r be -2(-4)/((-24)/(-9)). Calculate the common denominator of (14/18)/((-2)/29) + r and o. 180 Suppose 0 = -10j + 332 - 322. Let l(k) = k*3 - 5k*2 + 6k - 6. Let z be l(5). Let h = -17 + z. Calculate the smallest common multiple of h and j. 7 Let o = 5	{ "pile_set_name": "DM Mathematics" }
the power of 1/5, to the nearest integer? 68 What is 24565855 to the power of 1/3, to the nearest integer? 291 What is 503166623 to the power of 1/3, to the nearest integer? 795 What is 9980605 to the power of 1/5, to the nearest integer? 25 What is the eighth root of 53572984 to the nearest integer? 9 What is the ninth root of 1155114366 to the nearest integer? 10 What is 586012904 to the power of 1/6, to the nearest integer? 29 What is the square root of 114730204 to the nearest integer? 10711 What is 2039013189 to the power of 1/8, to the nearest integer? 15 What is 5215175399 to the power of 1/3, to the nearest integer? 1734 What is 2968978153 to the power of 1/9, to the nearest integer? 11 What is 2004437066 to the power of 1/5, to the nearest integer? 73 What is 15508047 to the power of 1/2, to the nearest integer? 3938 What is the ninth root of 810955172 to the nearest integer? 10 What is 2462017193 to the power of 1/2, to the nearest integer? 49619 What is 28852589 to the power of 1/2, to the nearest integer? 5371 What is the third root of 424030237 to the nearest integer? 751 What is the cube root of 1819107066 to the nearest integer? 1221 What is 127383445 to the power of 1/10, to the nearest integer? 6 What is 77482003 to the power of 1/5, to the nearest integer? 38 What is the eighth root of 809225845 to the nearest integer? 13 What is the fifth root of 575160868 to the nearest integer? 56 What is the sixth root of 28372499 to the nearest integer? 17 What is the square root of 647862815 to the nearest integer? 25453 What is the third root of 697602624 to the nearest integer? 887 What is 3178337389 to the power of 1/2, to the nearest integer? 56377 What is 2396855354 to the power of 1/8, to the nearest integer? 15 What is the third root of 227090005 to the nearest integer? 610 What is the third root of 42372614 to the nearest integer? 349 What is 289371788 to the power of 1/7, to the nearest integer? 16 What is the square root of 27384414 to the nearest integer? 5233 What is the square root of 80779074 to the nearest integer? 8988 What is 10445789 to the power of 1/9, to the nearest integer? 6 What is the square root of 143365091 to the nearest integer? 11974 What is 684814924 to the power of 1/3, to the nearest integer? 881 What is 71974422 to the power of 1/2, to the nearest integer? 8484 What is 37176307 to the power of 1/3, to the nearest integer? 334 What is 4016506065 to the power of 1/2, to the nearest integer? 63376 What is 73916969 to the power of 1/10, to the nearest integer? 6 What is 239591345 to the power of 1/5, to the nearest integer? 47 What is the square root of 540949605 to the nearest integer? 23258 What is the seventh root of 720515065 to the nearest integer? 18 What is the square root of 222003822 to the nearest integer? 14900 What is 114657781 to the power of 1/3, to the nearest integer? 486 What is 164927297 to the power of 1/3, to the nearest integer? 548 What is 38923295 to the power of 1/3, to the nearest integer? 339 What is the fourth root of 2912337922 to the nearest integer? 232 What is the square root of 700227254 to the nearest integer? 26462 What is 38358757 to the power of 1/3, to the nearest integer? 337 What is 138479547 to the power of 1/2, to the nearest integer? 11768 What is the seventh root of 19012405 to the nearest integer? 11 What is the cube root of 477591856 to the nearest integer? 782 What is the third root of 967518941 to the nearest integer? 989 What is the seventh root of 236506484 to the nearest integer? 16 What is the square root of 2249560979 to the nearest integer? 47430 What is 210096198 to the power of 1/2, to the nearest integer? 14495 What is 3189049188 to the power of 1/7, to the nearest integer? 23 What is the square root of 89905427 to the nearest integer? 9482 What is 5039036001 to the power of 1/4, to the nearest integer? 266 What is 292697466 to the power of 1/3, to the nearest integer? 664 What is 379562031 to the power of 1/9, to the nearest integer? 9 What is the fourth root of 188616943 to the nearest integer? 117 What is 21573223 to the power of 1/3, to the nearest integer? 278 What is the ninth root of 395617430 to the nearest integer? 9 What is 5418807131 to the power of 1/8, to the nearest integer? 16 What is 69234566 to the power of 1/7, to the nearest integer? 13 What is the square root of 202347341 to the nearest integer? 14225 What is the third root of 1430369968 to the nearest integer? 1127 What is the third root of 133388579 to the nearest integer? 511 What is the seventh root of 801262904 to the nearest integer? 19 What is the ninth root of 66318726 to the nearest integer? 7 What is the sixth root of 1301239072 to the nearest integer? 33 What is 1125599650 to the power of 1/3, to the nearest integer? 1040 What is 1189736071 to the power of 1/5, to the nearest integer? 65 What is 40639334 to the power of 1/8, to the nearest integer? 9 What is 319325288 to the power of 1/5, to the nearest integer? 50 What is the cube root of 12631334 to the nearest integer? 233 What is 130319273 to the power of 1/4, to the nearest integer? 107 What is the third root of 932048517 to the nearest integer? 977 What is the third root of 146234156 to the nearest integer? 527 What is the eighth root of 1742513935 to the nearest integer? 14 What is 31131047 to the power of 1/2, to the nearest integer? 5580 What is the sixth root of 2867079130 to the nearest integer? 38 What is 15226737 to the power of 1/2, to the nearest integer? 3902 What is the square root of 1758772201 to the nearest integer? 41938 What is 166720968 to the power of 1/4, to the nearest integer? 114 What is 102643630 to the power of 1/3, to the nearest integer? 468 What is 2639686689 to the power of 1/10, to the nearest integer? 9 What is 24177403 to the power of 1/8, to the nearest integer? 8 What is the third root of 23456061 to the nearest integer? 286 What is the square root of 36306072 to the nearest integer? 6025 What is 27098507 to the power of 1/3, to the nearest integer? 300 What is 524063150 to the power of 1/8, to the nearest integer? 12 What is the square root of 54693913 to the nearest integer? 7396 What is 426659784 to the power of 1/9, to the nearest integer? 9 What is the seventh root of 1030837537 to the nearest integer? 19 What is the eighth root of 55821392 to the nearest integer? 9 What is 231667035 to the power of 1/6, to the nearest integer? 25 What is the fourth root of 99435540 to the nearest integer? 100 What is the ninth root of 3094815705 to the nearest integer? 11 What is 1016778233 to the power of 1/2, to the nearest integer? 31887 What is the third root of 155202992 to the nearest integer? 537 What is 777519269 to the power of 1/7, to the nearest integer? 19 What is the square root of 2298816998 to the nearest integer? 47946 What is 2028675730 to the power of 1/8, to the nearest integer? 15 What is the fourth root of 382648468 to the nearest integer? 140 What is 185791699 to the power of 1/7, to the nearest integer? 15 What is the square root of 10727027 to the nearest integer? 3275 What is 25169017 to the power of 1/3, to the nearest integer? 293 What is the square root of 1107581020 to the nearest integer? 33280 What is 3953518 to the power of 1/7, to the nearest integer? 9 What is 371225798 to the power of 1/2, to the nearest integer? 19267 What is 2716521115 to the power of 1/3, to the nearest integer? 1395 What is 5469123 to the power of 1/8, to the nearest integer? 7 What is 705929293 to the power of 1/4, to the nearest integer? 163 What is the third root of 60516821 to the nearest integer? 393 What is the square root of 3133689533 to the nearest integer? 55979 What is 282773410 to the power of 1/2, to the nearest integer? 16816 What is 718951221 to the power of 1/9, to the nearest integer? 10 What is 3351193408 to the power of 1/3, to the nearest integer? 1496 What is the third root of 154519811 to the nearest integer? 537 What is the tenth root of 498879456 to the nearest integer? 7 What is the seventh root of 113230285 to the nearest integer? 14 What is 339290629 to the power of 1/5, to the nearest integer? 51 What is the fourth root of 3145864886 to the nearest integer	{ "pile_set_name": "DM Mathematics" }
v*2 Let k(l) = 19l*2 - 3. Let j(q) = 18q*2. Give k(j(a)). 6156a*4 - 3 Let a(i) = -3i*2. Let s be (-1264)/(-14) + 2/(-7). Let t(r) = sr - 90r - 4r*2. What is a(t(h))? -48h*4 Let i(f) = -f. Let n(w) = 24w*2 + 2w. Calculate n(i(d)). 24d2 - 2d Let k(j) = 2j. Let q(w) be the third derivative of -w4/8 + w3/6 - 14w*2 + 3. Give q(k(g)). -6g + 1 Let f(l) = 4 + l*2 + 1 - 5. Let r(w) = 5w - 3. Let b(y) = 29y - 17. Let u(i) = 6b(i) - 34r(i). What is f(u(q))? 16q*2 Let l(s) = -2s. Let b(k) be the first derivative of k5/30 + k3 - 3. Let f(r) be the third derivative of b(r). What is l(f(j))? -8j Let k(l) be the second derivative of -l4/6 - l. Let t(m) = -2m + 2m + m. Calculate t(k(q)). -2q*2 Let v(l) = -3l. Let q(d) be the second derivative of 0d3 + 0d*2 - 1/12d*4 - d + 0. What is v(q(j))? 3j*2 Let c(l) = 4l*2 + 6l - 6. Let b(i) = i - 1. Let a(z) = -6b(z) + c(z). Let x(j) = 7j*2. Calculate x(a(g)). 112g4 Let i(b) = -b2 + 18. Let k(g) = -8g2. Calculate i(k(v)). -64v*4 + 18 Suppose 0 = 4k - 2k - 30. Let d(z) = z. Let w(u) = -4u. Let h(s) = kd(s) + 5w(s). Let q(j) = -j*2. Calculate q(h(o)). -25o*2 Let z(m) = -20m2. Let x(u) be the second derivative of u4/6 + 3u. What is z(x(c))? -80c4 Let k(x) be the second derivative of x5/30 + x*2 - 5x. Let l(i) be the first derivative of k(i). Let g(o) = -o*2. Determine l(g(b)). 2b*4 Let b(l) = 2l. Let u(v) = -14v. Let q(m) = 9m. Let n(h) = 8q(h) + 5u(h). Let p(w) = -5b(w) + 4n(w). Let k(x) = -2x. Calculate p(k(d)). 4d Let z(n) = n*2. Let s(c) = 4866c. What is s(z(l))? 4866l2 Let j(d) = -2d. Let r(b) be the third derivative of -5b4/24 + 7b*2. Give j(r(n)). 10n Let y(m) = -4m2. Let f(o) be the third derivative of o6/360 - o4/12 + o2. Let q(n) be the second derivative of f(n). Calculate y(q(l)). -16l2 Let k(r) be the second derivative of r5/60 + r*3/2 - 9r. Let n(y) be the second derivative of k(y). Let o(s) = -4s2. Give o(n(t)). -16t*2 Let f(g) = -7g + 5g + 4g. Let m(y) be the first derivative of -y*2/2 + 5. What is m(f(n))? -2n Let o(a) be the third derivative of 0 + 1/24a4 + 2a*2 + 0a + 0a3. Let d(k) = 8k2 - k2 - 2k2. Calculate d(o(f)). 5f*2 Let l(n) be the third derivative of 4n*4/3 + 6n*2. Let j(i) = 2i*2. Calculate j(l(z)). 2048z*2 Let j(l) = -2l2. Let g(a) = -45 + 22 + 23 - a2. Determine j(g(s)). -2s4 Let f(v) = -2v + 26. Let s(i) = -32i2. What is f(s(b))? 64b*2 + 26 Suppose -52 = -0p - 2p. Let a(q) = -5q*2 - 3q. Let r(i) = 21i2 + 13i. Let y(m) = pa(m) + 6r(m). Let j(b) = b*2. Calculate j(y(z)). 16z*4 Let n(z) = -11z. Suppose -f = -r - 4f - 13, 5f = -25. Let c(i) = 10i2 - 12ir + i2. Calculate c(n(o)). -121o2 Let o be 2 + (-2 - -5) + 0. Let b(g) = og - 14g + 8g. Let a(f) = -f2. Determine b(a(v)). v2 Let k(i) = 17i + 17i - 31i. Let d(x) = 9x*2. What is k(d(s))? 27s*2 Let h(t) = t. Let m(o) = -o - 3459. Determine m(h(u)). -u - 3459 Let t(a) = -14098a - 1. Let f(h) = -h. Give t(f(k)). 14098k - 1 Let o(n) = -16 + 35 - 19 - 2n*2. Let u(b) = -3b. Calculate u(o(x)). 6x2 Let s(o) = -79o*2. Let a(z) = 45z. What is s(a(g))? -159975g2 Let d(q) = 2q. Let n(z) be the second derivative of -17z4/12 + 12z. What is d(n(j))? -34j2 Suppose -c = -y, y = -c - y + 12. Let h be (-8)/16(0 - c). Let f(l) = -l - hl + l. Let u(o) = 2o. Give u(f(b)). -4b Let o(c) = -422c. Let w(f) = 2f2. Determine w(o(u)). 356168u*2 Let h(u) = 2u. Let c(d) be the first derivative of 0d + 7/2d*2 + 4. Give c(h(y)). 14y Let u(y) be the second derivative of 2/3y3 + 0 + 2y + 0y2. Let p(q) = -q. Give u(p(n)). -4n Let w(a) = a. Let t(k) = -49k2 - 35. Give w(t(y)). -49y*2 - 35 Let f(o) = 6o - 6o - o2. Let s(d) be the first derivative of 2d*3/3 - 2. Calculate f(s(y)). -4y*4 Let j(f) = -3f. Let x(t) = -25t2. Determine x(j(w)). -225w*2 Let u(d) = 5d. Let p(g) = -4g2 - 19g. Give p(u(l)). -100l2 - 95l Let n(m) = -21m2 + 14m*2 + 6m*2. Let r(g) = 3g. Give n(r(o)). -9o2 Let b(s) = 2s*2. Let x(q) = 3q*2 - 6. What is b(x(d))? 18d*4 - 72d*2 + 72 Let k(t) = 5t + 5. Let z(u) = 228u. What is k(z(l))? 1140l + 5 Let t(a) = -6a. Let q(s) = -s2 + 2s - 2. Let u(z) = 4z2 - 9z + 9. Let p(y) = 9q(y) + 2u(y). Give p(t(d)). -36d2 Let s(l) = -32l*2 + 1. Let g(k) = -2. Let z(p) = p - 10. Let m(j) = 5g(j) - z(j). Calculate s(m(c)). -32c2 + 1 Suppose -2b = -0b. Let f(y) be the first derivative of -3 + 0y*2 + 1/3y*3 + by. Let l(v) = -4v. Give l(f(p)). -4p*2 Let o(y) = -16y + 8y + 8y - 6y2. Let a(p) be the first derivative of -p2 - 1. Determine a(o(s)). 12s*2 Let z(f) = 31 - 3f - 31. Let l(a) = -2a2. Give l(z(q)). -18q*2 Let x(t) = -9t - 2t2 + 9t. Let f(h) = -h. Determine x(f(n)). -2n2 Let t(z) be the third derivative of -z4/24 - z2. Let i(p) = 141p - 4p2 - 282p + 141p. Calculate i(t(l)). -4l2 Let f(k) be the first derivative of -k6/360 + k*3/3 - 2. Let q(p) be the third derivative of f(p). Let h(t) = 2t. Calculate q(h(x)). -4x2 Let s(z) = -2z + 9. Let u(v) = -3v2. What is s(u(x))? 6x*2 + 9 Let p(x) = 2 - 2x - 2. Let a(h) = 2h2. Let m(g) = 9g*2. Let b(t) = 15a(t) - 4m(t). What is p(b(v))? 12v*2 Let i(g) = -3g*2 - 13. Let j(x) = 7x*2. Calculate j(i(s)). 63s*4 + 546s*2 + 1183 Let h(c) = -3c. Let s(v) = v + 4. Let u be s(-7). Let n(j) = 6j2 + 8. Let m(r) = 2r*2 + 3. Let a(o) = un(o) + 8m(o). What is h(a(x))? 6x*2 Let j(y) = 10y*2. Let c(r) be the second derivative of 7r*3/6 + 5r. Determine j(c(h)). 490h2 Let z(g) = 170 - 170 - 2g*2. Let l(h) = 3h*2. Give z(l(k)). -18k4 Let r(u) be the first derivative of -u3/3 - 4. Let z(n) be the third derivative of -n4/6 - n2. Give r(z(x)). -16x2 Let f(g) = -g. Let q(n) = 8n - 2. What is f(q(m))? -8m + 2 Let o(w) = 4w + 11. Let j(t) = 4t2. Give o(j(l)). 16l2 + 11 Let d(v) = v2. Suppose 3r = -9 - 3. Let c = 6 + r. Let p(m) = -8 + 8 - cm*2. Give p(d(b)). -2b*4 Let n(l) = 2l*2. Suppose -1 = -4s + 7. Let t(o) = 20o - 5o*s - 20o. Determine t(n(x)). -20x4 Let y(k) = -k2. Let v(g) = 19g. Let r(u) = 20u. Let h(f) = -3r(f) + 4v(f). Calculate h(y(z)). -16z*2 Let x(u) = -4u. Let k(t) = -148t. Give x(k(n)). 592n Suppose -3 - 5 = -4z. Let h(k) = 2k2 - kz + k*2. Let m(w) = -3w*2 + 2 - 2 + 0. Calculate h(m(q)). 18q*4 Let b(l) = -23l. Let d(r) = -7r2. Determine b(d(k)). 161k*2 Let f = -1 + 3. Let b(k) = 2k*2 + 4k*2 - 3kf. Let x(u) be the third derivative of -u5/30 - u*2. What is x(b(v))? -18v*4 Let v(k) = 3k. Let x(s) = 2s. What is v(x(o))? 6o Let a(h) be the first derivative of -h3/3 + 16. Let f(s) be the second derivative of s3/2 + s. Calculate a(f(r)). -9r2 Let y(q) = q. Let n(u) = -6u. Let h(c) = -4n(c) - 21y(c). Suppose -2g = g - 3, -1 = i - 3g. Let t(d) = -3 - 2di + 3. Calculate h(t(z)). -6z*2 Let y(k) = 4k*2. Let i(j) = -48j. Give i(y(f)). -192f2 Let g(a) = 15a*2 + a - a - 21a2. Let x(y) = y2. What is g(x(v))? -6v4 Let d(p) = 2p*2. Let a(r) = -r. Let z(m) = m. Let y(h) = 2a(h) + 3z(h). What is d(y(k))? 2k*2 Suppose -x + 2g - 1 = -0x, -x - g = -8. Let u(s) = s - 7 + x + 2. Let m(z) = -6z. What is u(m(f))? -6f Let z(q) = -16q*2. Let b(t) = 6t + 8t + 4t - 15t. Give b(z(w)). -48w2 Let g(z) = -z2. Let n = 28 + -18. Let l be 4/n + 16/10. Let u(p) = -2pl + 3 + 0p*2 - 3. Give u(g(j)). -2j*4 Let k(y) = -2y*2. Suppose 2i + 6 = 5i. Let f(p) be the third derivative of 0p*3 + 1/8p*4 + 0 + 0p - 2pi. Determine f(k(u)). -6u*2 Let m(u) = -u - 1. Let i(y) = -3y - 4. Let s(q) = i(q) - 4m(q). Let t(h) = 6h. Give t(s(p)). 6p Let g(m) = 2m*2. Let k(h) be the third derivative of 5h*4/12 + 2h*2. Give g(k(l)). 200l*2 Let h(g) be the third derivative of -2g*2 + 0g + 0 + 0g3 + 0g*4 + 1/30g*5. Let n(d) = -d. What is h(n(p))? 2p2 Let y(d) be the third derivative of -d5/60 + 9d2. Let i(v) = 3v. Calculate y(i(w)). -9w2 Let k(v) = 2v*2 + 23. Let f(n) = 21n. Give f(k(x)). 42x*2 +	{ "pile_set_name": "DM Mathematics" }
13). Solve -6i - 6 - q = 0 for i. -5 Let a(g) = g3 - 8g*2 + 9g + 20. Let v be a(6). Suppose -4h + 8 = -vc, 0 = 2h + 4c - 24. Solve 2 + 14 = hj for j. 4 Let g(x) = -8x - 2x2 + 14 + x2 + 6x + 0x. Let n be g(-4). Solve -26 = -5v - n for v. 4 Suppose 3r + a + 8 = -a, -5r - 16 = 4a. Let q(l) = l - 9. Let m be q(12). Solve r = mi - 4i - 2 for i. -2 Let f(d) = -2d*3 - 17d*2 - 5d + 29. Let v be f(-8). Solve 3w = vw - 10 for w. 5 Let h(y) = -2y + 0 + 2 - 3 + 9. Let s be (-1)/(3(-3)/(-54)). Let l be h(s). Solve -l = 4n - 0n for n. -5 Suppose 11 - 30 = -y. Suppose -7p - 16 = y. Let q(z) = -z2 - 8z - 6. Let o be q(p). Solve 2a = -1 - o for a. -5 Let m(s) = -s3 - 7s*2 - 13s - 32. Let o be m(-6). Solve 10 = -5v - o for v. -4 Let c(h) = -h2 - 8h + 7. Let g be c(-8). Let n(z) = -5z - 1 + 0 - z + gz. Let w be n(3). Solve y = wy for y. 0 Let p(b) = 41b + 255. Let j be p(-6). Solve -4 = ju + 5 for u. -1 Let s be (-5)/15-32. Suppose 2 = -r + sr. Solve rh - 9 = -1 for h. 4 Let k = 31 + -29. Suppose 5g - kg = 0. Solve g = -0f + 5f - 5 for f. 1 Let f be ((5 + -5)/3)/(-2). Let h be (-1 - 1) + 61. Suppose -hx + 2x = f. Solve -w + 6w - 15 = x for w. 3 Let l(v) = -v3 - 8v*2 - 8v. Let z be l(-7). Let t = 11 - z. Solve -o + t = 3o for o. 1 Suppose 4t - t - 12 = 0. Let s(i) = -i*3 + 5i*2 - 4i + 5. Let v be s(t). Suppose 3m = 14 - 2. Solve -v = -y - m for y. 1 Suppose 0 = 4n - u + 151, 0u - 2u = 10. Let i = n - -44. Let p(l) = 15l2 + l + 1. Let t be p(-1). Solve -2x - t = -ix for x. 5 Let l = -968 + 970. Solve -4z + lz = -0z for z. 0 Suppose 13v - 9v = 64. Solve 12h - 8 - v = 0 for h. 2 Suppose -x = 2c - 3, 57x = -c + 52x - 3. Solve 0 = cg - 8 for g. 4 Let k be (760/36)/5 + 18/(-81). Solve 0 = -ki - 20 + 4 for i. -4 Let w(m) = -27m3 + m2 - 1. Let u be w(1). Let s = u - -27. Suppose -2f = -3g - 15, 5f - g = 9 + 9. Solve -a = f - s for a. -3 Let z(l) = -2l - 7. Let w be z(-6). Solve -20 = 5n + w for n. -5 Let n = -26 + 16. Let y be ((-60)/50)/(4/n). Solve h - 2h + y = 0 for h. 3 Suppose 11h - 180 = 29. Solve -5z = -h - 6 for z. 5 Let z be 1/2 - (-8580)/264. Solve p + z = -10p for p. -3 Let q be (-1 - 2 - -4) + -6 + 36. Solve 8 = qj - 33j for j. -4 Suppose 2x + 5f + 6 = 0, 5 = -x - 2f + 3. Suppose -xl + 10 = 2y, 5l + 0l - 10 = 0. Solve -yj = -20 + 8 for j. 4 Let o be (144/112)/(1/7). Solve -o = 4t + 7 for t. -4 Let z be (-188)/(-16) - (-2)/8. Suppose -14o + 3i = -17o + 12, 0 = -o + 5i - 8. Solve -4 + z = -oq for q. -4 Let c(y) = -15y. Let r be c(-1). Let k be (24/15)/((-2)/10). Let l be (-2)/k - 14/(-8). Solve ln = -3n - r for n. -3 Let q be ((-12)/(-16))/(2/32). Suppose 2t = 4r + q, -2 - 1 = -t + r. Suppose t = 3g - 15, -5g - 20 = 2f - 7f. Solve 5i + 16 + f = 0 for i. -5 Let i(h) = -h*3 + 2h*2 + 2h - 3. Let m = 29 + -28. Let p be i(m). Solve -5z + 0z = p for z. 0 Let u be 0 + (0 - -1 - 1). Suppose -6q = 6q - 24. Solve -qs + 2 = -u for s. 1 Let w = 5 + 15. Suppose -wx - 6 = -22x. Solve 2o = -xo for o. 0 Suppose k = -2g + 6k - 55, 4g + 5k + 65 = 0. Let a = 41 + g. Let c = a - 18. Solve cq - 2q - 2 = 0 for q. 2 Let k(a) = -2a*2 + 29a - 8. Let z be k(14). Solve -i - 10 = -zi for i. 2 Suppose -f + 57 - 37 = 0. Solve 0 = 9y - 4y + f for y. -4 Let g = 375 + -375. Solve 3j - j = g for j. 0 Let m(c) = c*3 - 16c*2 + 14c + 8. Let r(x) = 2x3 - 31x*2 + 27x + 16. Let j(u) = 5m(u) - 3r(u). Let a be j(12). Solve al = -7 - 1 for l. -2 Let u = -89 - -92. Solve -4n + un + 2 = 0 for n. 2 Let o = 66 - 51. Let s = 5 - 3. Suppose -u - 2 = 4f + 2, 4f = -5u - 20. Solve sv + 3v + o = f for v. -3 Let s = -347 - -356. Solve m - s + 9 = 0 for m. 0 Let p(l) = l*3 + 4l*2 + 3l. Let o be p(-3). Suppose o = -4t - 61 + 301. Suppose 25 = -5h + t. Solve 3 + h = 2s for s. 5 Let i(c) = -12c - 11. Let w(j) = j. Let s(r) = i(r) + 6w(r). Let x be s(-3). Solve 2a = -1 + x for a. 3 Suppose 5i + 87 + 78 = 0. Let s = -21 - i. Solve 5z + 8 = -s for z. -4 Let w = -34 - -39. Solve 19 - 24 = wt for t. -1 Let q = -158 + 152. Let g(n) = 3n + 33. Let d be g(q). Solve d = u - 4u for u. -5 Suppose 8 + 11 = r. Suppose -21 - r = -2w. Suppose t - x = -2x - 2, -4t + 3x = -w. Solve tk = -2 - 4 for k. -3 Let i be (43 - 48)(1 + 18/(-10)). Solve 26 - 10 = -il for l. -4 Let r(b) = -b*2 + 20b + 69. Let v be r(23). Solve v = -5t - 2 - 3 for t. -1 Suppose -8 = 5r + 62. Let q = r + 19. Let t = q + -2. Solve -t = -3j + 3 for j. 2 Suppose 3b - 18 = -3a, 4a - 3b - 12 = -4b. Suppose 7 = -ac + 9. Solve -2y + c = -5 for y. 3 Let r(z) = 3z2 - 9z - 18. Let n(g) = -4g2 + 9g + 17. Let v(d) = -2n(d) - 3r(d). Let x be v(10). Solve -2p = -0p - x for p. 5 Suppose d = 3l + 14, 2d + 0d - 5l - 23 = 0. Let u be 0/(3 + -5) - d/1. Solve 4n - u = 19 for n. 5 Suppose v = -v + 4. Suppose 3f = -3d - 12, 7d = 2d + vf + 8. Let m(u) = -2u + 16. Let s be m(7). Solve -si = -di for i. 0 Let y = 1081 + -1063. Solve 54p - 60p = y for p. -3 Let p = 1229 - 1227. Solve 8 = -px + 6 for x. -1 Let t = 527 + -525. Solve -2f - tf - 12 = 0 for f. -3 Let o(n) = n + 9. Let k be o(-5). Suppose -ka + 17 = 5. Suppose 4w + 6 = -p, p - w - 2w = 8. Solve pr - ar = -4 for r. 4 Suppose 0 = 3p + 3p - 12. Suppose 0 = -pf - f + 9. Solve -7 = fx + 5 for x. -4 Suppose -20k + 70 + 230 = 0. Solve 6j + k = 9j for j. 5 Let z(l) = 4l2 + 15l + 6. Let m be z(-6). Suppose d + 24 = f - 4d, -5d = 5f - m. Solve -4a = -f - 2 for a. 4 Let z be 1/3 + 520/78. Solve -zj + 2j + 20 = 0 for j. 4 Let t(g) = 6g2 - 51g - 24. Let x(s) = 5s2 - 50s - 23. Let p(r) = -3t(r) + 4x(r). Let b be p(24). Solve 2u = -b - 0 for u. -2 Suppose -78u = -128u + 650. Solve -5y - uy = -18 for y. 1 Let h = -33 + 36. Suppose 14 = hq + j, -5q + 5j + 1 = -9. Solve -qg - 1 = 7 for g. -2 Let n be (-134)/(-201) - (8/3)/4. Suppose b - 2b + 6 = 0. Let j(o) = -o*2 + 6o + 2. Let r be j(b). Solve -3f + 2f + r = n for f. 2 Let v = -1545 + 1545. Solve 0a + 9a = v for a. 0 Suppose 4j = 12 + 8. Let r be (6/(-9))/((-2)/3). Let o(u) = 3u + 77. Let d be o(-25). Solve -j = -da + r for a. 3 Let y(n) = n3 + 4n*2 - 10n - 10. Let z be y(-5). Solve -20 = 19s - zs for s. -5 Let v(d) = d*3 - 9d*2 + 16d - 3. Let a be v(7). Solve -7s + as - 4 = 0 for s. 1 Let j(q) = -q*3 - 7q*2 - q - 13. Let g be j(-7). Let t = g + 4. Let i be 8 + 1/t6. Solve -2m + 12 = -im for m. -4 Suppose -31 = 4l + 5r, -3l + 4l + 5r = -19. Let x(t) = -t3 - 5t*2 - 6t - 6. Let f be x(l). Solve 3n + 7 + f = 0 for n. -3 Suppose -2x = -l - 20, 2x = -0x - 2l + 14. Let v(k) = k3 - 8k*2 - 9k + 4. Let c be v(x). Solve -2j + c = 2j for j. 1 Suppose -2o + 3o - 29 = 4l, -56 = -4o + l. Suppose -k + o = 8. Let y be (4/(-6))/(28/(-42)). Solve -t - y = -k for t. 4 Let i be (2 + 6)15/(-1). Let o be 90/i18/(-2). Solve od - 2 - 1 = 0 for d. 1 Suppose 129w - 70 = 119w. Solve -5h + wh + 8 = 0 for h. -4 Suppose 91 + 109 = 5z. Solve 8f = -0f - z for f. -5 Let f be (30/20)/((-2)/(-4)). Suppose -5w = -fv - 18, 5w = v - 3v + 13. Solve wr = r for r. 0 Suppose -16 = -48b + 44b. Suppose -6c + bk + 4 = -c, -k = -3c + 1. Solve 3o - 5o = c for o. 0 Let u = 2552 + -2483. Solve 10q - 33q = u for q. -3 Suppose 0 = 1575q - 1574q - 7. Solve -2 = -qu - 30 for u. -4 Suppose 5j - 8 = j. Let p(c) = -c + 3 + c3 + 3 - 5c - 4cj. Let s be p(5). Solve k + 2 - s = 0 for k. -1 Suppose -11 = b + 4. Let n be (b/2)/((-21)/28). Solve -3a - n = -4 for a. -2 Let v = 7 + -2. Let q = 7 - v. Suppose -2s + 6s - 2o = 12, 5s + 5o = 0. Solve su - 4u = q for u. -1 Suppose 3d - 5p + 48 + 12 = 0, -27 = 2d + p. Let a(u) = -3u - 2u + 3u + u - 3. Let k be a(d). Solve g = 4g - k for g. 4 Let g(j) = -j*3 - 15j*2 - 15j - 13. Suppose -70 = 3h + 2h. Let t be g(h). Let o be (2 + -14)t/(-2). Solve -n + on = 5 for n. 1 Let x = 19 + -10. Let b = 10 - x. Let p be b-2 + (5 - -2). Solve -10 = pl - 0l for l. -2 Suppose 49 + 7 = 4f. Let x(c) = -c*3 + 13c*2 + 12c + 15. Let s be x(f). Let u(q) = -q - 10. Let r be u(s). Solve 3a + r + 3 = 0 for a. -2 Suppose 0 = 3z - 4*	{ "pile_set_name": "DM Mathematics" }
rivative of -137n3 - 25n*3 + 92n*2 + 41n*3 + mn3 wrt n. -708 Let y(q) be the third derivative of q8/336 + 11q6/20 - 353q*4/24 + 722q*2. Find the second derivative of y(t) wrt t. 20t*3 + 396t Let d(c) = -603 + 613 - 147c - 7c + 275c2. Let v(z) = -413z*2 + 231z - 16. Let u(s) = 8d(s) + 5v(s). Find the second derivative of u(p) wrt p. 270 Let f(j) = -8901j3 - 3j*2 - 1422j - 2. Let t(q) = -17801q3 - 5q*2 - 2843q - 3. Let c(u) = 5f(u) - 3t(u). Find the second derivative of c(n) wrt n. 53388n Let q be -1 + (-205)/(-20) + 10/(-8). What is the first derivative of -qa - 79 - 33a2 - 4a + 10a wrt a? -66a - 2 Let i(a) = a + 12. Let n be i(-10). Suppose 3v = 2t - v - 1434, 2855 = 4t + 5v. Differentiate -11w3 - 2w*3 - 44 - tw*n + 715w*2 wrt w. -39w*2 Let m(l) be the first derivative of 1260l4 + l3/3 + 14l2 + l - 2881. Find the third derivative of m(p) wrt p. 30240 Let k(r) be the first derivative of 11r*5/5 - 49r*3/3 + 4133r - 3472. Differentiate k(w) with respect to w. 44w3 - 98w Suppose -7n = -91 + 70. What is the second derivative of -37p*n + 108p - 15p - 9p wrt p? -222p Let y be -3 + 2 - (3 + (-12)/2). Find the first derivative of -5d*3 + 26 - 11 + 3d*2 + 4d*3 + 2d*y wrt d. -3d*2 + 10d Let y(u) be the second derivative of -7u5/40 + 7u4/4 + u3/3 - 29u2/2 - 84u. Let p(g) be the second derivative of y(g). Differentiate p(q) wrt q. -21 Let c(x) be the second derivative of -111x + 0x*5 + 0x*2 + 0 - 32/15x*6 + 73/6x*3 + 0x*4. Find the second derivative of c(t) wrt t. -768t*2 Find the third derivative of 3l*2 + 63l - 180 - 22l - 178 - 10l*4 + 135l*3 + 352 wrt l. -240l + 810 Let y(l) be the second derivative of -37l8/56 + l7/42 + 3l*5/20 - 23l4/2 - l3/3 + 2l2 + 4271l. Find the third derivative of y(i) wrt i. -4440i3 + 60i*2 + 18 Let u be ((-2)/9)/((-29)/261). Let a be 2 + -2 + -2 - (-40)/u. Find the third derivative of 25o*4 - 5o*2 - ao*4 - o + 45o*4 + 18o*2 wrt o. 1248o Let j(m) be the first derivative of -12249m5/5 + 2290m*2 - 2788. What is the second derivative of j(b) wrt b? -146988b*2 Let n be (4 + -1)(8 - (6 - 1)). What is the third derivative of 1047x4 + n - 520x*4 - 5x*2 - 471x*4 wrt x? 1344x Suppose -24u = -22u - 4. Find the second derivative of -16n2 + 31n*u + 18n*2 - 3n + 5n + 49 - n3 wrt n. -6n + 66 Let d(i) be the first derivative of 413i4/2 - i3/3 - 244i*2 - 3i - 4550. What is the third derivative of d(w) wrt w? 4956 Let o(s) be the second derivative of 0s4 + 0s*3 + 0 + 0s*5 - 19/2s*2 + 13/5s*6 + 11s. Differentiate o(g) wrt g. 312g3 Let a(g) be the first derivative of 0g - 71/2g2 + 7g*3 - 34. Find the second derivative of a(k) wrt k. 42 Find the third derivative of -17t*6 + 9 + 8t*5 + 213t*6 + 35t*5 - 43t*5 + 33t*2 wrt t. 23520t3 Let j(z) be the first derivative of z2 - 47z + 0z*3 + 0z*4 + 28 - 12/5z*5. What is the first derivative of j(u) wrt u? -48u*3 + 2 Let i be (-1 - -4) + -11 + 19. What is the second derivative of -5a - 2 - 135a2 - ia - 5a + 16a wrt a? -270 Let d(j) = 6j3 + j2 - j. Let i(r) = 436r*3 - 519r*2 - 9r. Let w(v) = -18d(v) + 2i(v). Find the third derivative of w(h) wrt h. 4584 Let z(v) be the first derivative of -3235v4/4 + 109v*3/3 + 5v*2/2 - 1354. What is the third derivative of z(c) wrt c? -19410 Let y(p) be the third derivative of 587p*6/12 + 2905p3/2 - p2 + 5p + 127. What is the first derivative of y(g) wrt g? 17610g*2 Let t(s) = 1032s*2 - 328s. Let u(a) = -1037a2 + 327a. Let c(h) = -6t(h) - 5u(h). Find the second derivative of c(b) wrt b. -2014 Let n(h) = -7h3 + 3h*2 + 5h - 2. Let u be n(-2). What is the third derivative of -uz6 + 97 - z + 30z*3 + z - 30z3 - z2 wrt z? -6720z3 Let q(b) be the third derivative of -64b*5/3 + 23b*4/6 + 1264b*2. What is the second derivative of q(g) wrt g? -2560 Let o(s) be the first derivative of 0s*5 + 0s*4 + 49 - 12s*2 + 0s + 0s3 - 67/6s*6. Find the second derivative of o(u) wrt u. -1340u*3 Let f(b) = -1674b*3 - 851b + 10. Let a(y) = -836y3 - 425y + 6. Let n(h) = -5a(h) + 3f(h). What is the second derivative of n(o) wrt o? -5052o Suppose 7v = 112 - 70. Find the second derivative of 11t - 84t*2 - vt*2 - 95t wrt t. -180 Let m(j) be the third derivative of -15j6/2 + j4/8 + 307j*3/6 + 1152j*2. Find the second derivative of m(o) wrt o. -5400o Let s be 1((2 - 6) + 7). Find the first derivative of 65r3 + 44 - rs + 104r3 wrt r. 504r*2 Suppose -3h = 5k - k - 16, 3h - k = 11. What is the third derivative of 18l2 + l + 58 - 58 + 42l*h wrt l? 1008l Suppose 0 = 3l - 3z - 97 - 11, 0 = l + 2z - 33. Let w = 209 + -179. What is the second derivative of -7u*2 - lu + 23u + 0u*2 + wu wrt u? -14 Differentiate -1537 + 1884 + 5438c + 4409 - 486c with respect to c. 4952 What is the second derivative of 67 - 2709p2 - 22p - 30p + 27 - 22p + 79p wrt p? -5418 Let u = 73 + -68. What is the third derivative of -2q*5 + 2q5 + q3 + q*u - 2q*3 - 47q*2 wrt q? 60q*2 - 6 Suppose -2o + 4 = -4w + 2o, 5o = w + 5. What is the derivative of -98a*2 + w + 2 + 117a*2 wrt a? 38a Let a(u) be the third derivative of u*6/30 + 17u*5/30 - 1267u*4/24 + 2u*2 - 739. Find the second derivative of a(n) wrt n. 24n + 68 Let k(s) be the second derivative of 2s7/21 + 308s*6/15 + 2s*4 - 15s*2 - s - 98. Find the third derivative of k(c) wrt c. 240c*2 + 14784c What is the second derivative of -971 + 322 + 323 + 1122p + 323 + 436p + 2862p2 wrt p? 5724 Let j(f) = -75f*3 - 6f - 301. Let g(i) = -i*3 - i. Let q(z) = 5g(z) - j(z). What is the first derivative of q(w) wrt w? 210w2 + 1 Let q(b) be the second derivative of 703b*3/6 + 929b*2/2 + 852b. What is the first derivative of q(k) wrt k? 703 Let t(f) = -111f5 + 2f*3 + 36f*2. Let m(w) = 223w*5 - 3w*3 - 75w*2 + 2w. Let y(a) = -4m(a) - 7t(a). Find the third derivative of y(q) wrt q. -6900q2 - 12 What is the derivative of -72o + 23o + 27o + 605 - 250o2 + 22o wrt o? -500o What is the third derivative of -861h*4 + 575h*4 - 2765h*4 - 920h*2 wrt h? -73224h Let u(s) = 2247s2 - 21s - 6022. Let l(q) = -1123q2 + 12q + 3011. Let h(f) = -7l(f) - 4u(f). Find the first derivative of h(z) wrt z. -2254z Let g(h) be the second derivative of 109h*6/2 - 1289h4/3 + h2 + 2h - 1510. Find the third derivative of g(m) wrt m. 39240m Find the first derivative of -51 - 313 + 3o4 - 275 - 188 wrt o. 12o*3 Find the first derivative of 5760y*2 + 3685y*2 + 1225y*2 - 5520 + 1055 wrt y. 21340y Suppose -z = -4z + 9. Find the second derivative of -r + 20r*3 + 52r*z + 77r wrt r. 432r Find the second derivative of -1 + 1258s*5 + 0 - 2182s*5 + 1 - 985s wrt s. -18480s3 Let w(f) = 4577f*3 - 6f*2 - 277f - 2. Let p(u) = 4583u3 - 8u*2 - 275u - 2. Let v(q) = -2p(q) + 3w(q). Find the third derivative of v(m) wrt m. 27390 Let c = -71 + 75. What is the third derivative of -2y2 - 7y2 - y3 + 39y2 - 18y*4 - 32y*c wrt y? -1200y - 6 Let r(n) = -1850n2 + 64n + 3363. Let a(j) = 1850j2 - 48j - 3364. Let i(w) = -4a(w) - 3r(w). What is the derivative of i(b) wrt b? -3700b What is the first derivative of 5262m - 2971m - 1174 - 3378m wrt m? -1087 What is the third derivative of 100g2 + 45 + 84g*2 - 188g*2 - 267g*4 wrt g? -6408g Let l(a) be the third derivative of 793a5/5 - 199a4/24 + a3/6 - 3594a2 + 2a - 2. What is the second derivative of l(o) wrt o? 19032 Let j be (495/10)/(34/(-8) - -5). What is the second derivative of -2m4 - 59m*5 + 113m*5 + 218 + m - j - 2m wrt m? 1080m3 - 24m*2 Let n(a) = 192a*2 + 7a. Let h(s) = 577s2 + 21s - 1. Suppose -30 = -7j + 2j. Let y(o) = jh(o) - 17n(o). What is the second derivative of y(f) wrt f? 396 What is the third derivative of 226 - 66y5 - 2y*6 + 175 - 460 + 4y*6 + 12y*2 - 1481y*5 + y wrt y? 240y*3 - 92820y*2 What is the derivative of -5817 - 15048131n*3 + 2n*4 - 11n**2 + 15048	{ "pile_set_name": "DM Mathematics" }
2 Let m(o) = o*2 + 5o. Let y = -110 + 106. Calculate m(y). -4 Let t = 5 - -1. Let x(k) = -k*2 + 6k + 1. Determine x(t). 1 Let o(q) = -q2 - q. Let m = -15 + 17. Let j = -3 + m. What is o(j)? 0 Let v(n) = n2 + 3n + 3. Let z(u) = -u3 - 8u*2 + 3u + 19. Let m be z(-8). Give v(m). 13 Suppose -5 = -2f - 1. Let x(w) = w - 3w - f + w. Suppose 2a - d - 3d - 28 = 0, 3a - 2d - 22 = 0. Determine x(a). -6 Let v(r) = -5r2 - 10r - 9. Let n(o) = -7o2 - 10o - 9. Let s(u) = -3n(u) + 4v(u). Give s(10). -9 Let a(d) be the third derivative of d5/60 - d4/4 + 5d3/6 - 2d*2. Suppose 4w - 3m + 40 = 2m, -5w - 50 = 2m. Let j = -5 - w. Determine a(j). 0 Let o(h) = 4 - h + 0 + 0 - 3. Let d = 9 + -11. What is o(d)? 3 Let u be 1/2(3 - -1). Let i(y) = -11 - yu + 3y + 4 + 4y. Suppose 8c - 25 = 3c. Determine i(c). 3 Let h = 62 - 60. Let m(v) = -v2 - v + 2. Calculate m(h). -4 Let n(o) be the third derivative of -o5/60 + 7o*4/24 + 2o*3/3 + 5o*2. Give n(6). 10 Let k(r) = 6r - 6r + 5r*2. Let p be -4 - (3 + -3 + -3). Give k(p). 5 Let y be -1 + -2(-1 - -2). Let p(l) = 2l2 + 15 - 6l*2 - 32 + 3l*2 + 20. Calculate p(y). -6 Let t(d) = 7d + 13. Let u(z) = -9z - 14. Let o(w) = 4t(w) + 3u(w). Determine o(-11). -1 Let c(o) = -4o*3 + 6o - 3. Let m(n) = -7n3 + n2 + 12n - 6. Let f(g) = -5c(g) + 3m(g). Calculate f(4). 5 Suppose r + 3 = -o + 2, -o + r - 7 = 0. Let x = o + 5. Let s(j) be the second derivative of -j4/3 - j2/2 + j. What is s(x)? -5 Suppose 10 = -u + 3u. Suppose -5 = uw + 10. Let k(m) = -2 - 5m2 + 4 + 2m + 6m2. Calculate k(w). 5 Let f(t) be the third derivative of -t4/24 - t3/2 - 4t*2. Calculate f(-7). 4 Let h(w) = 7w*2 + w - 2. Let i(o) = -20o*2 - 2o + 7. Let a(x) = -17h(x) - 6i(x). Let q be 9/(-27) - (-57)/9. Calculate a(q). -2 Let z(q) = -q. Let c be (-36)/(-10) - (-2)/5. Let n(u) = u*3 - 5u*2 + 6u. Let d be n(c). Let x = d + -4. Give z(x). -4 Let x = -26 - -38. Let m be (2/4)/((-3)/x). Let a(k) = 1 - k + 1 - 4. What is a(m)? 0 Let x(f) = f*2 - 2f + 4 + 9f - 6f + 3. Suppose -z + 1 = 3c, -2z + 4c - 1 = 7. Let h = z - -2. What is x(h)? 7 Let h = 16 - 14. Let s(m) = 9m - 1. Give s(h). 17 Let i(j) = -5j - 2. Let t(f) = -f + 1. Let y(n) = -i(n) + 6t(n). Suppose 4k + 76 = 100. Determine y(k). 2 Let u(k) = -4k + 1. Let t(b) = 3b - 1. Let x(r) = 7t(r) + 6u(r). Determine x(1). -4 Let k(s) = 0 - 2s + 4s - 2s*2 - 1. Suppose 4c = 5c - 2v - 3, 0 = 2c - 2v - 8. Suppose -6p - 5y = -p - 5, cp + 2y = 8. Calculate k(p). -5 Suppose -7n = -2n - 10. Let f(v) = -v*2 - 3v + 7. Let r(g) = g*2 + 2g - 6. Let i(c) = -5f(c) - 6r(c). Give i(n). 3 Let d(x) = -5x3 - 5x*2 - 2x - 2x + 5 + 4x*3. Let b = 70 - 74. What is d(b)? 5 Suppose -13p + 3 + 23 = 0. Let q(i) = -7i + 3. Determine q(p). -11 Suppose -i = -2 - 3. Let m(h) be the third derivative of h4/24 - 2h*3/3 - 2h*2. Give m(i). 1 Suppose -9 = -4u + u. Let h be -1 + (-3)/(u/(-4)). Let f(s) = -2s - 12 - hs + 4s. Determine f(-5). -7 Suppose y - 12 = 2m, 3y - m - 2 = 19. Let z(b) = b - 5. Let k be z(y). Let q(u) be the second derivative of u4/6 - u3/6 + 10u. Give q(k). 1 Let o(z) = z*3 - 4z*2 + 3z. Let k(a) = a + 4. Let g be k(0). Let y = g - -1. Let l(f) = f - 3. Let q be l(y). Determine o(q). -2 Let g = -2 + 0. Let u(x) be the first derivative of 2x3/3 + x2 - x - 96. Determine u(g). 3 Suppose 0 = -6j + 8j - 4. Let k(o) = 4o*2 + 2o + 4o2 + 0 - 6oj - 1. Determine k(-2). 3 Let x(o) = -o3 + 2o2 + 3o + 2. Let t be 4/10 - 16/(-10). Suppose -2v - 2j + 4 = 0, 3j = tj - 1. Calculate x(v). 2 Let s(l) = -l2. Let h(z) = z3 + 6z2 - z. Let u(w) = h(w) + 3s(w). Let m(f) = f*3 - 6f*2 - 6f - 10. Let c = 7 - 0. Let y be m(c). Give u(y). 3 Let f(n) = n + 1. Let s(m) = -8m + 1. Let i be s(-1). Let y = i + -5. Let v be f(y). Let a(p) = -p2 + 5p - 1. What is a(v)? -1 Let w(r) be the third derivative of -r6/180 - r4/3 - 6r2. Let i(n) be the second derivative of w(n). Suppose 1 = 2b + 3. What is i(b)? 4 Let z(p) = -p*2 + 6p - 6. Let j = 7 - 4. Suppose 3f - 8 = -4x, jf = 2x + 2f - 14. Let g be z(x). Let h(u) = -2u3 + u2. Give h(g). 3 Let z = -17 + 12. Let s(u) = 11u3 - u2 - 12u + 8. Let i(y) = -5y3 + 6y - 4. Let p(o) = -9i(o) - 4s(o). Give p(z). 9 Suppose -7p + 2y = -4p, y = 5p - 7. Let z(x) = -6 - x - x*p + 0x + x*3 + 0x. Give z(0). -6 Let w(j) be the second derivative of j*4/12 + 2j*2 - 16j. Suppose 3s - 6s = 0. Calculate w(s). 4 Let m(k) = k - 1. Let r be m(3). Suppose -5q + 26 = -2t, -rt + 6 = -q + 16. Let g(p) = -p2 + 2p + 4. Give g(q). -4 Let t(x) = 3x3 - x2 - 2x - 1. Let n be t(-1). Let k(w) = 5w + 2. Determine k(n). -13 Let i(p) = 7p*3 - 11p*2 - 4p + 6. Let x(h) = -15h3 + 23h*2 + 8h - 12. Let o(m) = 13i(m) + 6x(m). Calculate o(5). -14 Suppose t + 13 = -t + p, p - 5 = 0. Let y(k) = k3 - k2 + k. Let q(j) = 6j3 + 11j + 6. Let c(g) = -q(g) + 5y(g). Determine c(t). 2 Suppose -2 = 4h - 10. Let r = h + -3. Let u(d) = -2 - d*3 + 3 + 5d*2 - 6d2. Give u(r). 1 Let s(h) be the third derivative of h6/120 - h*4/24 + 13h*3/3 + 31h*2. Give s(0). 26 Let u be 2/3 - (-112)/12. Let l be (-4)/u - 54/(-10). Let f(b) = -3b + 7. What is f(l)? -8 Let l = 3 + 2. Let r(y) = y*2 - 8y + 12. Let t be r(l). Let p(k) = k*3 + 2k*2 - 4k. What is p(t)? 3 Suppose 4r = -r - 15. Let q(g) = g3 - g2 - g - 1. Let b(f) = 3f*3 - 7f*2 - 6f - 5. Let y(z) = -b(z) + 4q(z). Give y(r). -5 Suppose -2w = -6w + 20. Let u = w - 7. Let c(o) = -2o*2 - 2o - 1. What is c(u)? -5 Let i(t) = t + 1. Let c(w) = w. Let q(h) = -3c(h) - i(h). Let y(x) be the first derivative of -x2 + x - 1. Let k be y(1). Give q(k). 3 Let j(o) = o2 + 4o - 5. Let g = 3 - 1. Suppose -11 = gw + 1. What is j(w)? 7 Let t(a) = a + 2. Suppose n - 4n = -75. Suppose -2h - 10 = -4y - 30, 4h + n = -5y. Determine t(h). 2 Let q(a) be the second derivative of a4/12 + a3/6 - a*2/2 - 4a. Let l(r) = -r*3 + 7r*2 - 7r + 7. Let w be l(6). What is q(w)? 1 Let k(b) = -b + 3. Let w be (-56)/(-12) - 4/6. Suppose -2g + 67 = 5v, 5g - 45 - 12 = -wv. Suppose -2t - 9 = 3d + 2, 0 = 4d + t + v. Give k(d). 6 Let t(z) be the third derivative of z5/60 + z3/6 - 24z2. Determine t(-2). 5 Let b(q) = -q3 + 7q2 - 16 + 6 + 1. Give b(7). -9 Let i(v) = v2 - v - 3. Let h be i(3). Let r(p) = 2p*2 + 2 + 2 + 2 - hp*2 + 6p. Calculate r(5). 11 Let o be 10/(-2)(-3)/3. Let u(v) = -v3 + 4v*2 + 5v - 1. Determine u(o). -1 Let t be (5/3)/((-1)/3). Let m(b) be the second derivative of b6/720 + b5/120 - b*4/6 - 2b. Let c(f) be the third derivative of m(f). What is c(t)? -4 Let z(m) be the first derivative of m*3/3 - 3m*2/2 + 12. Calculate z(5). 10 Let i be ((-15)/12)/(-23/(-24)). Let t(a) = -a - 2. Give t(i). 3 Let t(m) = 2m + 3. Let o(r) = r2 - r - 5. Let k be o(0). Determine t(k). -7 Let l(r) be the first derivative of -1/3r*3 - 1/2r*2 + 3/2r*4 - 2 - r. Suppose 5 = -7d + 2d. Determine l(d). -7 Let n(b) = -3b + 2b - 2b + 4 + b. Determine n(4). -4 Let w be (-21)/(-9) + 2/3. Let v(y) = -y*3 - 2y + 4y3 + 2 + 3y*2 - 4y*3 + 0y*w. Determine v(2). 2 Suppose -2p = p - 18. Let y(h) = -h*3 + 2h*3 - ph*2 + 0h*3 - 6 + 9h - 2h. Determine y(5). 4 Suppose -f + 3v + 6 = -3, f + 4v = -19. Let k(t) = t2 + t - 1. Determine k(f). 5 Suppose 6 = 5s + 1. Let c(v) = 23v2 - 6v + 14. Let x(g) = 8g2 - 2g + 5. Let d(m) = -4c(m) + 11x(m). Calculate d(s). -3 Let k(r) = r*2 - 5r + 3. Let n(u) = -5u2 + 20u - 13. Let s(h) = 9k(h) + 2n(h). Determine s(-5). 1 Let k(a) be the first derivative of -a*4/4 - 2a*3 + 6a + 3. Let m be k(-6). Let t(l) = l. Determine t(m). 6 Let l(k) = k - 3. Let x be l(0). Let s(t) = -3t - 132t*2 + 65t*2 + 66t*2 - 3. Calculate s(x). -3 Let y(p) = -14p*2 - 1. Let b(q) = -q + 6. Let f be b(5). What is y(f)? -15 Let m(u) = 5u*3 - 2u*2 + 2u - 1. Let g be m(1). Let a be 4/(-2) + g + -1. Let b(i) = -i*2 + 5i*3 - 4i + 3i + a + 0. Determine b(1). 4 Let o(j) = -j + 4 + 1 + 2j. Let h(a) = -a*3 - 9a*2 + 2a*3 + 3 + 0 + a - 2a**3. Let z be h(	{ "pile_set_name": "DM Mathematics" }
uppose -3r - 51 = 3l, -6r - 40 = -r - bl. Let k be -2 - r - 1 - 0. Solve s = -2s + k for s. 3 Let d(b) = b3 - 7b*2 - 9b + 11. Let j be d(8). Suppose 0 = -4c + 4. Solve s = c - j for s. -2 Let n = -4 - -4. Let b = 2 + n. Suppose 5s - 3c + 2c - 28 = 0, -bs + 2c = -16. Solve -sy = -y - 12 for y. 3 Suppose 0 = 4t + 2d - d + 12, d + 8 = -3t. Let s(w) = w + 7. Let j be s(t). Solve jo + o = -8 for o. -2 Let f(l) = l2 + 7l - 9. Let r be f(-10). Let c = -18 + r. Solve cv = -3 + 18 for v. 5 Let u(t) be the first derivative of -t4/4 + 2t*3 + 3t*2/2 - 15t - 8. Let d be u(6). Solve 8 = -s + ds for s. 4 Let q(b) = b2 - 4b + 3. Suppose 0 = t + 4c - 4, 2t - 30 = 2c - 12. Suppose -3w = -tw + 15. Let s be q(w). Solve 2m + sm = 4 for m. 2 Let p(z) = -z3 + 4z*2 - z + 1. Let r be p(3). Suppose -4k = -r - 29. Solve k = s + 2s for s. 3 Let u be -2 + 3 + 24/3. Let c be ((-3)/(-2))/(u/120). Solve 4j = 8j - c for j. 5 Suppose b = -2b - 9. Let t be -2 - (2 + b + -7). Solve ti - 4 = 8i for i. -2 Suppose 0 = -3x - 0x - j + 13, 10 = 3x - 2j. Suppose xv = r + 16, 2v = 2r + 2r + 22. Solve -d - 8 = vd for d. -2 Let h(y) = 10y - 48. Let p be h(5). Solve 5c = pc + 3 for c. 1 Suppose 2m = a - 4 - 9, 4m + 16 = 0. Let u be (14/5)/(1/a). Solve -u = -4n - 2 for n. 3 Let q be (-14 + 8)/(2/(-1)). Suppose -2v - 4y = -4v + 8, qy - 12 = -3v. Solve 0 = -2m - v + 2 for m. -1 Suppose -2o = -o + 3. Let k = o - -3. Solve k = q - 2 for q. 2 Suppose -m - m = -38. Let x = m + -10. Let q be -2(x/6)/(-1). Solve -qs - 16 = -7s for s. 4 Let y(q) = q2 + 11q + 12. Let k be y(-10). Let d be (-2)/(-7) - (-10)/14. Solve -d = kv + 5 for v. -3 Suppose 8t - 3t + s - 14 = 0, -4t + s = -13. Solve -7q + tq = 4 for q. -1 Suppose 1 = x, 4x = 5p - 9 + 3. Suppose 3m - 23 = -pw, w - 36 = -5m - 0. Suppose z + 4b + 15 = 0, -3z + m = -0z - b. Solve 2f - 3 - z = 0 for f. 2 Let p = -92 - -92. Solve -h + 4 = -p for h. 4 Suppose -4o + 12 = 0, 19 = 5q + 6o - 3o. Let z = 5 - q. Let l(x) = -x3 + 18x*2 + 17x + 38. Let s be l(19). Solve 4c - zc - 4 = s for c. 4 Suppose -8j + 12j - 8 = 0. Solve 0 = -ji + 3i - 3 for i. 3 Let l(r) = r*2 - 11r + 2. Let h be l(11). Solve b + h = -b for b. -1 Let b(w) = 2w2 - 2w - 1. Let a be b(2). Let d = 27 + -19. Solve q + d = aq for q. 4 Suppose p = -4k + 4, -4p - 3k - 1 = -4. Solve 3c + pc = 0 for c. 0 Suppose -4h + 0t = -5t - 25, -3h = 2t + 10. Solve hq - 5q + 20 = 0 for q. 4 Suppose 4j - 21 = -5. Solve -5q - j = -24 for q. 4 Let z(g) = -g2 - 5g - 2. Let u be z(-4). Let d be 1/u(10 + 2). Solve 0 = -k - k + d for k. 3 Let r = -6 + 10. Let l(v) = v3 - 5v*2 + 3v + 4. Let c be l(r). Solve ci = -5i for i. 0 Suppose 3f = 3 + 24. Suppose -t = -3d - 25 + 3, 0 = -2d + 4t + 2. Let v be d/(6 + -3) - -8. Solve -vl = f - 4 for l. -1 Let u be (-2)/(-1) + (-3 - -4). Suppose 3a - ud + 3 = 0, -2d = 3a - 0a - 12. Solve -c + 3 = -a for c. 5 Let w be (-4)/(-3) - (-204)/(-18). Let b = -8 - w. Solve -2t = bt for t. 0 Let k = -1 + 0. Let d = k - -2. Solve d = 4t - 3 for t. 1 Let c(z) = z - 4. Let f be c(-7). Let g = 16 + f. Solve 5 = gu + 15 for u. -2 Let z be (18 + (-4 - 0))/2 + -3. Solve -3s = -2s + z for s. -4 Suppose 3r + 0 = -12. Let i = 7 + r. Solve -ih + 2 = -4 for h. 2 Let n be -8(-2)/7 + 6/(-21). Solve u = -nu - 6 for u. -2 Let p(l) = l*2 + l + 1. Let z be -4 - 0/(2 + 1). Let a be p(z). Suppose a = 4m + 1. Solve 0 = -2q + m - 9 for q. -3 Suppose 0 = -2l - 4p - 12, 2l - 2p = l + 6. Let b(v) = -v3 + 6v*2 + 2v - 8. Let w be b(6). Suppose -wr + 8 = -0. Solve rd + 2d + 20 = l for d. -5 Let r(g) = 3g + 17. Let c(y) = -y*3 - 5y*2 + 6y - 5. Let u be c(-6). Let k be r(u). Solve 4 + k = -2i for i. -3 Let t(r) = 7r - 4. Let n be t(3). Let o(p) = p*2 - 16p - 10. Let h be o(n). Solve -3x = -hx for x. 0 Let z(k) = k*3 + 11k*2 + k + 8. Let i be z(-11). Let l be -2((-2)/(-4) + i). Solve c = lc - 16 for c. 4 Suppose -6h + 10h - 8 = 0. Solve 3m + 13 = -h for m. -5 Let x(f) = -f3 + f2 + 2f + 1. Let i be x(3). Let q = i - -16. Solve -3z + q = 2z for z. 1 Suppose 2b = 7b - 25. Suppose 8 = ba - 12. Suppose 0 = -5t + 3t + a. Solve z = tz for z. 0 Let o = 6 + -2. Let q = o - 1. Solve -8m - 20 = -qm for m. -4 Let y = -216 + 218. Suppose -5f + 68 = -57. Solve -3j - yj + f = 0 for j. 5 Let p = -129 - -134. Solve 11 = pb - 9 for b. 4 Suppose 3i = i + 6. Solve -ir = r - 12 for r. 3 Let t be (-12)/8 - (-6)/(-4). Let p be 5(51/15 + t). Solve pu + 0u = 0 for u. 0 Suppose -5x + 0x + 5u = -85, 3u + 29 = 2x. Solve 5m = x - 7 for m. 3 Suppose 2c - 3u - 9 = 1, -2c - u + 10 = 0. Let j = -2 + c. Solve jo + o - 20 = 0 for o. 5 Suppose -2 = 5w - z, 2w - 4z + 8 = -w. Suppose w = -x, 2k + 40 = -3k - x. Let l = -5 - k. Solve lr = 5 - 17 for r. -4 Let v be 29/6 + 2/12. Suppose -7i = -vi. Solve i = 2f - f - 3 for f. 3 Let z = 4 - 2. Let y be 624/12. Suppose i - zi + y = 0. Solve -i = 3k + 8 for k. -4 Let f(d) be the first derivative of -4d*2 + d + 2. Let m be f(-2). Let k = m - 9. Solve -6o = -4o - k for o. 4 Let c(f) = -f2 + f + 40. Let s be c(0). Let l be (-1)/(3 + s/(-12)). Solve -lk + 15 = -8k for k. -3 Let l(p) = -p2 - 11p - 9. Let x be l(-10). Let z be (x - 1)/((-8)/8). Solve -d + z + 2 = 0 for d. 2 Let u(p) = -p*3 + 4p*2 - 2p - 2. Let m be u(2). Suppose -2x - 7b + 2 = -2b, x + mb = 2. Let v = x + -3. Solve 0 = -d - vd - 4 for d. -1 Suppose -5a = -5s - 20, 4s - s + 12 = 2a. Let p be ((-7)/9 - -1) + 80/45. Solve a = 2t + p - 10 for t. 4 Let u be 2/5 - (21/15 - 4). Solve -uq = -0q + 3 for q. -1 Suppose -3t + 9 = 3. Let f be 16/t(-2)/(-4). Suppose 4l + 39 = m, 0 = -fm + 2l - 5l + 137. Solve m - 10 = 5w for w. 5 Let j(l) = l3 - 6l*2 + 13l - 14. Let s be j(4). Solve sn = 11n - 5 for n. 1 Suppose 0 = 6y - 7y + 7. Solve 8 = 5u - y for u. 3 Suppose 6r - 3 = 5r. Solve rs - 3 = -0s for s. 1 Let g be (-2)/4 - 1/(-2). Solve 6 = -3b - g for b. -2 Let t be 57/9 + (-2)/6. Suppose -3l = 6, 10 = -p - tl + l. Solve o + po = 4 for o. 4 Let u(y) = y - 3. Let p be u(8). Let v(t) = 5t3 + t2 + t - 1. Let m be v(1). Let z be (32/m)/(p/15). Solve -5r + r = z for r. -4 Let p(x) = -x2 - 9x - 14. Let g be p(-7). Solve 0 = -gl - 6l for l. 0 Suppose -t + 5t = i - 20, 0 = -5i + 2t + 10. Solve -5n - 10 - 5 = i for n. -3 Let x(u) = u*3 + 4u*2 - 2u - 5. Let o be x(-4). Let y be (-2)/8 + (-3)/4. Let m be o - 0(0 + y). Solve mz = 5 + 1 for z. 2 Suppose -3c + 4 = -5, 4c - 15 = -d. Solve 0j + 6 = dj for j. 2 Let i = 17 + -11. Solve s - is = 0 for s. 0 Suppose -4q - 2g + 62 = 0, -g - 8 = -q + g. Solve -2 = 4o - q for o. 3 Let g(l) = 2l3 - 4l*2 + 2l + 2. Let c be g(2). Solve -5m = -cm - 5 for m. -5 Let q = -8 - -7. Suppose 4u - 8 = 4b, 5b = -5u + 7u - 16. Let o be q(u + 2)/3. Solve o = -3c + 2c - 3 for c. -3 Suppose 0 = -3x - 0z - 4z + 65, -85 = -5x - 2z. Suppose 2a = -3a + x. Solve -3g + a = -2g for g. 3 Let s = -38 - -38. Solve sj = 2j for j. 0 Let v(w) = 2w - 7. Let i be v(5). Solve -i = -2x + 1 for x. 2 Suppose -t = -i + 5i + 12, -3i = 2t + 4. Let z be i/(-10) + 76/10. Suppose o = 3o - z. Solve op - 3p = 2 for p. 2 Let z(a) = -1 - a3 + a - 2 - 2a*2 + 0a*3. Let p be z(-3). Suppose -pi + 0t = -2t - 30, -t = -5i + 57. Solve i = -5q + 2 for q. -2 Let i be (-6)/(-24) + (-59)/(-4). Let q = 30 - 26. Solve -qf - i = -9f for f. 3 Let t(b) = -b - 12. Let p(y) = -y - 11. Let j(f) = 5p(f) - 4t(f). Let i be j(-9). Suppose 3s + 2 = 2q, 2q - 3s + i = q. Solve -4 = qg - 0g for g. -1 Let w = 10 + -8. Suppose -wf + 2z + 16 = 0, 0z - 16 = 4z. Let m = -22 + 37. Solve -fy + m = -y for y. 5 Let a = 5 - -5. Solve -a = -h - h for h. 5 Let h be -7 - (-88)/(3 + 5). Suppose 4z - 5q + 5 = -0z, 2z = q - 1. Solve -hu + u = z for u. 0 Suppose 5i - 201 - 69 = 0. Suppose 2g + 2g - i = -5o, 4o - g = 39. Solve 0p + o = -2p for p. -5 Let z be 52/63/2. Let q = z + -4. Suppose 3d = -3 + q. Solve 2k = d - 0 for k. 1 Let c(q) = -q*3 + 2q*2 + 3q - 3. Let v be c(2). Let j(p) = p - 1. Let l be j(v). Suppose 2t = -lt +	{ "pile_set_name": "DM Mathematics" }
/9 + h. What is the second biggest value in t, 3, 5/2? 5/2 Let i(q) = 2q - 2 + q2 - 3q2 + q2 - 1 + 7q3 - q2. Let k be i(1). Which is the smallest value? (a) k (b) -1/6 (c) -1/2 (d) 0 c Let y = -0.19 - -0.12. Let w = y + -0.33. Let p = -1979/7932 - 1/1983. Which is the second biggest value? (a) p (b) w (c) -2 b Let z = -19214 - -19214.1. What is the fourth smallest value in z, 1/3, -3, -960, -2? z Let u = -4177 - -4177.62. Which is the fourth biggest value? (a) u (b) 7/3 (c) 3 (d) 0.5 d Let y = 102 - 7. Let n = -95.2 + y. Suppose -24 = -3g + 2v, 4 = -g + v + 13. What is the third smallest value in g, -5, n? g Let k be 64/10 - 12/30. Suppose -1419o = -1421o. Which is the third smallest value? (a) o (b) k (c) 3/4 b Let p = -10470 - -10475. What is the biggest value in -3, 0.5, p, -8/11? p Let o(y) = 2y*3 + 7y*2 + 103y + 298. Let s be o(-3). Let x = 1 + -0.98. Which is the biggest value? (a) x (b) -0.1 (c) 6 (d) s c Let n = 3 + 0. Let g = 11977 + -11960. Which is the fourth biggest value? (a) n (b) 2 (c) g (d) -1/3 d Let x = 0.45 + -0.05. Let w = -0.3 + -0.1. Let j = -11047.04 - -11047. Which is the third smallest value? (a) j (b) w (c) x (d) 3 c Let w = 5.054 + -0.054. Which is the second biggest value? (a) -2/5 (b) -1.57 (c) -4 (d) 1/2 (e) w d Let l = 4.3 - 4. Let p = 6 - 5.9. Let u(n) = 66n - 722. Let j be u(11). Which is the second smallest value? (a) j (b) p (c) -2/15 (d) l b Let r = -133472/5 - -26694. Let w be 9/(-2) + (-2)/(-4). Which is the biggest value? (a) -5 (b) w (c) 0.3 (d) r c Let v(k) = -k + 14. Let u be v(0). Suppose -h = -4o - 18 - u, 28 = h - 3o. Suppose -72 = -hn + 4n. What is the third smallest value in 0.1, n, -5? n Let j = 174 + -174.185. Let i = j + 0.165. What is the second biggest value in 4, -0.3, i? i Let b = -835.1 + 834.7. What is the fourth biggest value in -8, 3, b, -5? -8 Let f(x) = x3 - 4x*2. Let a be f(4). Let s = 0.03 - 9.03. Suppose -5g = -g - 8. What is the second smallest value in s, a, g? a Let r = -254 - -258. Suppose 106l + ro = 102l + 28, 5l + o - 15 = 0. Which is the third smallest value? (a) l (b) -166 (c) 1 a Let j = -0.26 + -3.34. Let g = j + 7.8. Let b = 4.6 - g. What is the second biggest value in b, -5, 3/5? b Let k(w) = -w*3 + 79w*2 - 80w + 157. Let j be k(78). Which is the fifth biggest value? (a) -4 (b) 3 (c) -1 (d) -0.05 (e) j a Let w = -639 - -7667/12. Let r be 31(-9)/(-81). Which is the third biggest value? (a) r (b) -5 (c) 1 (d) w d Let v = 250 - 269. Let i = 561.1 - 561. Which is the third biggest value? (a) 1/4 (b) i (c) v (d) 4 b Let m = -19/39 - -5528/11427. Let j = m + -285/2344. What is the smallest value in -0.01, j, -2? -2 Let q(k) = -k*2 + k + 2. Let x be q(-2). Let r be (1/(-7)-7)/(-5 + (-4664)/(-912)). Which is the second biggest value? (a) r (b) x (c) -5 b Suppose -2d - 8d = -141 - 159. What is the fifth smallest value in d, -5, -0.5, 2/9, -0.3? d Let x = 0.233 + -0.133. Let f be 0 - (66/4)/11. Which is the second smallest value? (a) f (b) 2/9 (c) x (d) -1/3 d Let s = 6852 + -6844. Which is the third biggest value? (a) 4/17 (b) s (c) 5 a Let n be (-26)/3927/294. Let m = n - -55/98. Which is the third biggest value? (a) m (b) 0 (c) -2/3 c Let u = 6/7 - 43/42. Let l = -118/37 - -125/74. What is the third smallest value in u, 0.5, -2/13, l? -2/13 Let k = -1.85 + 2. Let l = -56.8 - -56.8. Which is the biggest value? (a) -0.2 (b) k (c) l b Let u = -1148 - -10330/9. Let n be 0 - 4/(-24)3. Which is the second biggest value? (a) 3 (b) n (c) 4 (d) u a Let n = -165 - -1156/7. Suppose 2u - 3x = -x, 0 = -3u - 4x + 7. Suppose -4v + u = -2l - 1, -5l + 5v = 0. What is the smallest value in -1/9, n, 0, l? -1/9 Let i = 3173.95 - 3174. Which is the smallest value? (a) i (b) 91 (c) -3/2 c Suppose 2s - 3 = 5p + 26, 21 = 3s - 3p. Let y = -137928 - -137976. Which is the second smallest value? (a) y (b) 1 (c) s c Let a = 183260/69 - 2656. What is the biggest value in -2/7, 1/2, a, 1? 1 Let g be ((-19)/10 + 2)/(124/(-10) + 13). Let x be (1 - -4) + 0/1. Which is the biggest value? (a) g (b) 6/11 (c) x c Let g = -0.016 + -0.084. Let i = 1.5 + -1.5. Let l = 2 - i. What is the fourth smallest value in l, -0.3, 0.5, g? l Let i = -468.47 + 473. Let d = 4.33 - i. Which is the third biggest value? (a) 3 (b) d (c) 2/15 b Let g = 0.2 - 0.2. Suppose -40m = -4p - 36m - 36, -p = -5m + 29. Which is the second smallest value? (a) 10 (b) 9 (c) g (d) p c Suppose 0 = 4f - 4 - 20. Let s be (-35612)/38682 + 16/14. What is the second smallest value in f, s, -3? s Let o be 6/10(-6)/9. Let q = 188284 + -188283.9. Which is the third biggest value? (a) q (b) 2/3 (c) o c Let b = 354 - -843. Let x = b + -1197.1. Let w = -0.1 + 0.1. What is the smallest value in 3, -1, x, w? -1 Let u be (2/(-3))/((-1098)/54 - -23). What is the fourth biggest value in -2/23, -0.2, 3/7, u? u Let z = 53/3 - 52/3. Let l(h) = 3h3 - 160h*2 - 111h + 160. Let k be l(54). Which is the third biggest value? (a) -11 (b) k (c) -3 (d) z c Let v be (2/(-48 - -4))/(((-171)/4)/(-9)). Which is the fourth smallest value? (a) 0.4 (b) 2 (c) 0 (d) v (e) -0.1 a Let u be (77/(-3) + 1)3. Let h(j) = -j2 + 31j + 358. Let g be h(-9). Let y = -2.93 - -2.53. Which is the biggest value? (a) 1 (b) y (c) u (d) g a Let x = -0.0459 + 0.0359. Let w = 2108/9 - 234. What is the third biggest value in -18, w, x? -18 Let s = -0.058 - 0.942. Let q = 0.08 - 3.08. Let f = s + q. Which is the second smallest value? (a) f (b) -2/5 (c) -1/4 b Suppose 4v = -18 + 54. Let z be (378/12)/v + 3/6. Let g = 0 - -0.1. Which is the smallest value? (a) g (b) z (c) 5 a Let t = -183 + 144. Let k = t - -116. What is the fourth smallest value in -0.2, 1, k, 3? k Let h = -0.0294 + 0.6294. Which is the second biggest value? (a) 5 (b) -2/11 (c) 3 (d) h c Let z be 33/(-22) + (-5805)/(-42). Let j = z + -137. What is the second smallest value in 7, j, 1/8? 1/8 Suppose 15y - 39 = 2y. Let b be (-714)/364 + y/2. What is the second smallest value in b, -4/7, 2/3? b Let q be ((-4)/(-10))/((-1)/5). Let n be (70/75)/(q/(-3)). Let w = -33.05 - -33.05. What is the biggest value in n, w, 3, -0.5? 3 Let g be (-6)/14 + (-320)/(-28). Let s(v) = -1 + 24 + 5 + 5 - 3v. Let i be s(g). What is the second biggest value in 0.4, i, 0.06, 0.5? 0.4 Let g = 10 + -10.7. Let q = g - -0.3. Let i = -1308 - -1308.1. Which is the fourth biggest value? (a) q (b) i (c) -5 (d) 0.2 c Let n(s) = -s*2 - s - 5. Let k be n(0). Let o = -149.86 + 149. Let f = o + 0.76. Which is the smallest value? (a) f (b) 0.5 (c) k (d) 0.2 c Let m = 77 - 68. Suppose -l + 3k - 11 = 0, l - m = -3k - 2. What is the second smallest value in 0.4, -2/5, 9, l? -2/5 Let v = -34920 - -34919.6. Which is the second biggest value? (a) -6167 (b) v (c) 3 (d) 1 d Suppose g = -4g - 2w + 36, -5g + 5w + 50 = 0. Let c be 2 - 2/(g/7). Let p = 5271 - 5272. What is the second biggest value in p, 4, c? c Let m = 0.2 - 0.3. Let q = 307376 + -307375. Let h = 5.04 - 0.04. Which is the third smallest value? (a) m (b) q (c) h c Let s = -26 + 26.4. Let l = -12008/9 - -1334. Which is the third biggest value? (a) s (b) 0 (c) l (d) -1 c Let h = -112.03 - -146.03. Which is the second smallest value? (a) 2/9 (b) h (c) 0.3 (d) 0 (e) -2/3 d Suppose -3u + 2 = 11. Let h = -205 + 208. Which is the second smallest value? (a) -0.01 (b) 0.5 (c) h (d) u a Let x = 670/3 - 2683/12. What is the second biggest value in -2/11, x, 1? -2/11 Let l = -141.773 + -0.227. Let q = -99 - l. Which is the fourth smallest value? (a) 1/5 (b) 2/9 (c) q (d) -1 c Let v be (-144)/(-384) - 405/(-8). Let h = v + -52. Which is the second biggest value? (a) -0.3 (b) -2/3 (c) h b Let t = 293 + -415. Let r = t - -124. Which is the second biggest value? (a) -2/11 (b) r (c) 0.9 c Let v = 1.2 + -7. Let f = -6 - v. Let u be ((-30)/(-350))/((-4)/(-20)). Which is the third biggest value? (a) f (b) 1 (c) u a Let v = -17845 + 17845. Which is the second smallest value? (a) -0.0009 (b) v (c) -5 (d) 4 a Let v = 2428.6 + -2429. Which is the fourth biggest value? (a) -43/8 (b) v (c) 1/3 (d) 0.4	{ "pile_set_name": "DM Mathematics" }
20n2 - 4 What is the second derivative of c3s*2 - 5c*3 + 13c*2s*2 - 2c*2 - 10c + 29s2 wrt c? 6cs2 - 30c + 26s2 - 4 What is the third derivative of 34bh3z*3 + bz*2 + 38b + 94h3z*3 + 2h*3z - 3hz*2 wrt z? 204bh3 + 564h*3 Find the third derivative of -6d*4i - 2d3i*2p + 3d3p2 - d2i2p*2 + 2d*2i2 + d2p - 16i*2 wrt d. -144di - 12i*2p + 18p2 Find the third derivative of 35v*5 - 2v*4 - 27v*2 - 3v wrt v. 2100v2 - 48v What is the second derivative of -589r3 - 3r*2 + 1465r - 1 wrt r? -3534r - 6 What is the second derivative of -336r*3 + 12r - 14 wrt r? -2016r What is the second derivative of 362f*2r - fr + 28f wrt f? 724r Differentiate -c2g*3x - c*2g*3z*2 + 6c*2g*3z - 2c2g*2z + 10c2gxz*2 - 2cg3z2 wrt x. -c2g3 + 10c*2gz2 Find the third derivative of -22s6 + s4 + 1220s2. -2640s*3 + 24s Differentiate -306f2s*2 - 6f*2s + 3762f2 with respect to s. -612f*2s - 6f2 Differentiate -102m*3nt2 - 59m*3t2 + m2t2 - 2mt2 + 2nt2 with respect to n. -102m*3t*2 + 2t*2 What is the derivative of 92m*2 + m + 114? 184m + 1 What is the third derivative of 17gi*3nu - 2gi3n + 4gin + 2g - i*3u3 - i2u3 + iu*3 + 1 wrt i? 102gnu - 12gn - 6u3 What is the second derivative of -333v*4 - 5v*2 + 25837v wrt v? -3996v2 - 10 What is the third derivative of 10631z*3 + 2z*2 - 2324? 63786 What is the second derivative of -3n*3o*3v + 2n3ov2 + n3v*2 - 154n*2ov + 8n*2 + 1169o*5v*2 wrt o? -18n*3ov + 23380o*3v*2 Find the third derivative of 5d*2j*2y*2 + 15d*2y*3 - 4dj2y*3 - 27dj2 - 4djy*3 - dy*2 wrt y. 90d*2 - 24dj2 - 24dj What is the second derivative of 915y*4 - 3y*2 - 2004y - 2? 10980y2 - 6 Find the first derivative of 5140p - 2329 wrt p. 5140 Find the second derivative of 6l4 + 6l*3 - 2l*2 - 6l - 89. 72l2 + 36l - 4 Find the second derivative of -2l5w + 1778l3w*3 + 2lw3 + 8lw2 + 141l wrt l. -40l3w + 10668lw*3 Differentiate 229a - 160 with respect to a. 229 What is the first derivative of 21c2f - 146f wrt c? 42cf What is the third derivative of c6k + 4c5k + 2c3k - 2c2k + 6ck wrt c? 120c3k + 240c2k + 12k What is the second derivative of -63o*2r + 20or + 4r wrt o? -126r What is the derivative of -20c2i + 97c2 + 4ci2 + i2 wrt i? -20c*2 + 8ci + 2i Find the second derivative of -29q2x*2 + qx*2 - 94x*2 wrt q. -58x*2 What is the third derivative of -3868w*3 - 2211w*2 wrt w? -23208 What is the third derivative of -147r4 - r2 - 17r + 12? -3528r What is the third derivative of 418s5 - 5s*2 - 6s? 25080s2 What is the first derivative of -39g*3 - 9g*2 + 510 wrt g? -117g*2 - 18g What is the second derivative of -230y2 + 37y + 1? -460 What is the first derivative of s*2 - 150s - 263 wrt s? 2s - 150 Differentiate -5c*3j + 5753c3 - 51c*2j + c + j wrt j. -5c3 - 51c*2 + 1 Find the third derivative of -6i*4r + 78i3r + 3i2r + 3ir wrt i. -144ir + 468r Find the third derivative of -5f*3s - 197f3 - 36f*2 - 37fs wrt f. -30s - 1182 What is the second derivative of 3k3 + 370k*2 - 234k - 2 wrt k? 18k + 740 Find the third derivative of -41r*5 - 12r*3 + 767r*2 wrt r. -2460r*2 - 72 Differentiate 12d*4 + 44d*3 + 385 with respect to d. 48d*3 + 132d*2 Find the first derivative of -112c*4k - 2ck + k - 291 wrt c. -448c3k - 2k What is the third derivative of 247iq3 + 2iq2 - 3i - 3q3 + 113q*2 wrt q? 1482i - 18 Find the first derivative of 1268v2 - 908. 2536v Differentiate 1932a2u*2 - 40u*2 - 3u wrt a. 3864au*2 Find the third derivative of -2kr4s - 2krs - 8ks - 1071r*3s - 21r2s wrt r. -48krs - 6426s What is the second derivative of -104f5 + 371f? -2080f3 Differentiate -2f*2mp2 + 69f*2mz + 2f*2 - 2fp2z + 11fp*2 + 2mp + 2z with respect to z. 69f2m - 2fp*2 + 2 What is the second derivative of 22459a*2r*2 + 46a*2 + 5r + 1 wrt r? 44918a2 What is the third derivative of 2h*2q*3 + 66h*2q - 3h2 - 3986hq3 + 7hq2 - 2q3 - q2 wrt q? 12h2 - 23916h - 12 Differentiate -337y + 387 wrt y. -337 Find the third derivative of 32k*3q*3 + 17k*3q*2t + 4k2q*2t*2 - 48q*3t*3 + 3q*2t*2 + 13qt3 wrt q. 192k*3 - 288t*3 What is the second derivative of -4655l*2 + 3846l? -9310 Find the second derivative of -10x4 + 17x*3 + x - 156. -120x*2 + 102x What is the third derivative of -28j5 - 2j*3r*3 + 314j*2r*3 wrt j? -1680j*2 - 12r3 Find the third derivative of a3p2 - 16130a*3p + a*2p*2 + 4a*2 + 41ap2 wrt a. 6p*2 - 96780p Differentiate 2g4 + 23gp2 + 120p*2 wrt g. 8g*3 + 23p*2 What is the second derivative of 7q*3w*2 - 2q*3w - 22851q3 + 3q*2w*4 + 9w*2 wrt w? 14q*3 + 36q*2w*2 + 18 Find the third derivative of -2223y*4 + 16y*2 - 43y + 1 wrt y. -53352y Find the third derivative of -68g*3l*3n + 2g3l*3 + 2g*2l*2n - 2g2 - 2gl3 - l3 wrt g. -408l*3n + 12l3 Find the third derivative of 44g*6 + 9g4 + g3 + 1777g2. 5280g*3 + 216g + 6 Find the second derivative of -400d4 - 27d. -4800d2 What is the second derivative of -417aj2ms3 + 20aj2m + 91ajms*3 + 2ajs*3 + 2am - 16jms*3 wrt j? -834ams*3 + 40am Find the third derivative of -2t*5 + 3363t4 - t3 - 10151t2 wrt t. -120t*2 + 80712t - 6 What is the third derivative of 48b3c*3 - 757b3 + b2c2 + 3bc3 + 2bc - c3 wrt c? 288b*3 + 18b - 6 What is the derivative of -72k2q*2 - 153k*2 + kq*4 + kq - 12k + 6q wrt q? -144k2q + 4kq*3 + k + 6 What is the second derivative of -50isv*3 + 4isv + 57is - iv - 20sv3 - s - v5 wrt v? -300isv - 120sv - 20v3 Find the second derivative of 26b*3 - 5b*2 - b + 431. 156b - 10 What is the first derivative of 4n3 - 19n*2 + 96? 12n*2 - 38n What is the second derivative of -16382t2 - 14280t wrt t? -32764 Find the second derivative of 10602f5 + 2378f wrt f. 212040f3 Find the second derivative of -3c*4 - 20c*3 + 2c*2 + c + 1172. -36c*2 - 120c + 4 Differentiate 4531fx + 2617x wrt f. 4531x What is the first derivative of 5283t + 8227? 5283 Find the third derivative of 136an2r*3 - 9anr*2 - ar*3 + 2ar - n2r*3 + 2n*2r + 5nr*2 wrt r. 816an2 - 6a - 6n2 What is the third derivative of -16o*6 + 268o*5 - 380o*2 - 4o wrt o? -1920o3 + 16080o*2 What is the first derivative of -9515qs + 23s - 40 wrt q? -9515s What is the first derivative of -496r*3 - 10r - 4427? -1488r2 - 10 What is the third derivative of 1252m*3 - 7m*2 - 2m - 19? 7512 What is the second derivative of -12jlr2 - 84jlr + 2jl + jr2 + 2jr - 3lr2 + 9r*2 wrt r? -24jl + 2j - 6l + 18 Find the second derivative of -9622d*5 - 1112d + 3. -192440d3 Find the second derivative of -25f*2q*3 - 2f*2q - 3f2 + 6fq + 2f - 40q3 + 3q*2 wrt f. -50q*3 - 4q - 6 Differentiate j*2vx3 - 13j*2vx + 4j*2x*3 - 179j*2x + 7jvx wrt v. j2x*3 - 13j*2x + 7jx Differentiate 553w3 + 2w + 25 wrt w. 1659w2 + 2 What is the second derivative of 475f*3o*2 - 60f*3 - 2fo wrt o? 950f*3 Differentiate -609hs2 - 1156s*2 wrt h. -609s*2 What is the second derivative of -177i*4 + 5i*3 - 117i + 2 wrt i? -2124i2 + 30i What is the third derivative of 2l3m*2z + 6l3mz + 6l*3z + 11l2z + 3l2 + lmz - m2z wrt l? 12m2z + 36mz + 36z Differentiate -3f*3m + 42fm*2 - 81m*2 + 5 wrt f. -9f*2m + 42m2 What is the second derivative of 2f*4 + 2f*3 - 14f*2v*2 - 42fv2 - v2 wrt f? 24f*2 + 12f - 28v2 Find the third derivative of -t4 + 89t*3 + 726t*2. -24t + 534 What is the second derivative of -12707m2n**3 -	{ "pile_set_name": "DM Mathematics" }
j. Suppose -2n + 4n = p, 3n - p = y. Solve -2t = 4b + 14, n + 9 = -t - 4b for t. -3 Let g = -262 + 254. Let k be (-2 - g/6)/(4/(-24)). Solve 12 = -2u + kt - 2, u - 5 = -t for u. 1 Let r = 16 + -9. Suppose 5h = 2k + 6, -8 = 27k - 26k - 5h. Solve y + kz - r = 6y, -2y + z - 2 = 0 for y. -3 Suppose -i - 13s + 12s + 11 = 0, 1 = -i + 3s. Solve -4u + j = -3j - i, -3u = -j for u. -1 Let f = 88 - 63. Suppose 5l + 2a - 5 = -1, f = 5l - 5a. Suppose 3v + 2v = ld + 36, 0 = 5v + 3d - 21. Solve -v = 2s + 2y, 3 = -5s - 3y + 2y for s. 0 Let z(d) = 7d + 57. Let i be z(-4). Let o = i - 24. Solve 5l + 1 = -3a - 1, -oa - l = 18 for a. -4 Suppose -6005 + 245 = -12z. Let i be (1/(-3))/((-80)/z). Solve 5o - 6o = -n + 8, -in = -8 for o. -4 Let u = 108016 + -107992. Suppose 3y + 3 - 9 = 0. Solve yb - u = -5j, -2b - 4 = -2j - 0j for b. 2 Let i = -18 - -21. Suppose 4r - 4g + 440 = 0, -ir + 6g - g = 334. Let a = -95 - r. Solve 0c = -h - 4c - 9, 0 = 3h - 2c + a for h. -5 Suppose -89q + 93q - 2 = -r, 2r = -q + 4. Suppose 0 = rs + o - 31, -4o - 11 = -s - 3o. Solve m - 6 = 5x, -3m + s = -7m + x for m. -4 Suppose 0 = 7c + 162 + 6. Let m = 6 - 41. Let f = c - m. Solve j - 3 = -x - 0j, -3x + 2j = f for x. -1 Suppose 7a + 156 = 11a. Let v = 66 - a. Suppose -2l - 3o - 8 + 30 = 0, -3l + v = 3o. Solve lm = 3d - 24, 4d + 2m = -0m + 6 for d. 3 Let h = 2954 - 2954. Solve -4s - m = 15, h = 2s + m + 9 for s. -3 Suppose 4s = 2r - 448, -3s - 341 = -0s + r. Let f = -75 - s. Suppose 3c = -14 + f. Solve 0 = -3d + w - c, -9 = 2d - 5w + 18 for d. -1 Let b be -14 + 10 + ((-10)/(-65) - 510/(-65)). Solve -n - 27 = 5p, 5 = -bp + 4n - 7 for p. -5 Suppose 4f = s + 14, -3s + f - 7 + 9 = 0. Solve -4q - 9 = -q - 5h, -h = -sq - 6 for q. -3 Suppose 4v - 32 = 5n, -5v + 7v - 5n = 26. Solve 3y + vt = 21, 4t + 5 = 5y - 3 for y. 4 Let p(m) be the second derivative of -m5/20 - 41m*4/12 - 20m*3/3 + 3m*2/2 + 188m. Let c be p(-40). Solve ch = 3n, 0 = h - 0n + 2n - 6 for h. 2 Let h(a) = a*3 - 8a*2 + 7a + 3. Suppose 5r + 5m - 10 - 35 = 0, 5m - 17 = -r. Let d be h(r). Solve 2t + 4k = 8 + 10, -dt + 12 = k for t. 3 Let j = 2577 - 2560. Solve -4h + i + 26 = -i, -i + j = 4h for h. 5 Let h be (2 - 7)(-16)/(128/8). Solve -4w = -8, -3w - 65 = hj - 61 for j. -2 Let x(q) = q*3 - 10q*2 + 17q + 4. Let u be x(7). Let p be u2/8(-2 - -7). Let y be (-10)/((p/(-5))/(-3)). Solve -5n = -3c + 7 + y, -c = 5n - 4 for n. 0 Suppose -2q - 4r = 19 - 77, -4r = -24. Solve -u = 3, 8u - q = -2s + 11u for s. 4 Suppose -u - 15 = -4d, -3d + u = -d - 7. Let q be -53/3 + (-100 - -105). Solve 0o - 10 = -dt + 3o, -o + 2 = q for t. 4 Let d = -9152 - -9156. Solve -dm = 5n + 8, 3 - 13 = 5m for n. 0 Let a be 3/4 - (-4518)/(-8). Let k = a + 567. Solve t = kl + 5, 4 = 5l + 2t + 5 for l. -1 Let b = -2 - -5. Let o(y) = 15y - 86. Let i be 4/18 - (-364)/63. Let j be o(i). Solve -4a = a - bl - 12, -16 = -ja - 4l for a. 3 Let c(z) = z*3 - 21z*2 + 19. Let d be c(21). Let f = -16 + d. Suppose 3l = 2p - 14, -fl = -5p + 4p + 13. Solve -5o + 5h - 19 = p, -h = -2 for o. -2 Let h(a) = -55a + 4. Let w be h(-1). Let r = w - 47. Solve r = -5u + 3x, 5u = -2x - 14 - 3 for u. -3 Suppose 0 = 271g - 398 - 892 - 65. Solve -5r - 5 = -gt, 6r + 4t - 13 = 7r for r. 3 Suppose 11p = 12p - 6p + 15. Solve -5d + v = 13 + 12, 3d - p = -3v for d. -4 Let r(f) = -189f + 22117. Let d be r(117). Suppose 0 = 3t + 4c - 57, -c = 4t - 24 - 52. Solve -4n + 22 = -5x - t, 0 = -dx - 5n for x. -5 Let r = 36720 + -36716. Solve rp - 8 = 5k, -5k - 32p - 2 = -33p for k. 0 Let c = 2 - -13. Let f be (20/c)/((-2)/(-6)). Solve 1 = b - 3v - 2, 0 = fv for b. 3 Suppose -3283 = -3u - 4u. Let f = u - 459. Solve -3o + 17 = 4t, 3o - 7o + f = -t for o. 3 Let m = -1150 - -1155. Let k(l) = 2l + 11. Let b be k(7). Let t = -21 + b. Solve 3 = -mu - tr, 2 = -2r - 2 for u. 1 Let v be 0 - (4 + 8 + -16). Let a be (-1 + 6/v)/(35/70). Solve -3f + a = -4l, -3f - 4 - 7 = -l for l. -4 Let x = -2121 - -2126. Solve -11 = -u - 5v + 5, -xv = 5u for u. -4 Suppose 6j - 694 = -574. Suppose 217g - j = 213g. Solve 4z = -2a - 2, -ga + 0 = -3z + 5 for z. 0 Suppose 106 = -16c + 138. Solve -5b = -10b - cp + 31, 3b = 5p for b. 5 Let d(u) = u3 - 7u*2 + 5u + 20. Let i be d(6). Solve 5h + 34 - 54 = 0, -m + i = 4h for m. -2 Let b(v) be the first derivative of 2v2 - 28v + 3. Let s be b(9). Solve -5m = -4f + s - 0, 3m - 5f = -10 for m. 0 Let k(p) = 0 + 0p - 4p + 5p - 12. Let h = 13 + 2. Let y be k(h). Solve v + yu - 19 = -2u, 4u - 20 = -2v for v. 4 Let m(h) be the third derivative of h5/60 + 13h*4/6 - 110h*3/3 - 218h*2. Let s be m(4). Solve 0 = -sf - 8, 7f = a + 3f - 8 for a. 0 Suppose 66x - 913 = 44x - 61x. Solve -2y - 5b + b = 14, 3y + b + x = 0 for y. -3 Let u be 4/((-7 - (-114)/14)/2). Solve -72t = -71t - 4n + u, -11 = 3t - 2n for t. -3 Suppose -3n = -2x - 24, -3x + 18 = 5n - 41. Suppose -q = 5y - n, 4q + 4 = y + y. Solve -a = -qp + p + 6, 16 = 4a - 4p for a. -1 Let j(q) = 7q + 87. Let p be j(-10). Suppose 0 = 21w - pw - 16. Suppose 4o = -2n, -5o = -10o + 2n. Solve 5x - 3z + 5 = o, 2x - wx + 12 = -4z for x. -4 Suppose -5n + 60 = 5l, n = 25l - 21l - 23. Solve 7 = -2y + 1, ny + 7 = -2x for x. 4 Suppose -77i + 380 = -50i + 49i. Solve -4r = 2f - 14, -152f - ir = -148f - 16 for f. -1 Suppose 0 = 3w + 2w + 30. Let y be 22/(-33) + (-76)/w. Solve x = 2c - 8 + 2, -4x = -4c + y for c. 3 Let a(i) = -i3 + 23i*2 - 19i - 9. Let v be a(22). Let w be (24/(-9))/((-38)/v). Solve 0m - 2m + 10 = b, wm = -b + 18 for b. 2 Let a be 90/(-10) + ((-26)/(-14))/((-5)/280-8). Suppose -4b = -0b - 16. Solve -2c - bs = -a, -4s + 8 = -0c + 3c for c. 4 Let a(z) = -14z*2 - 43z - 1. Let k be a(-3). Solve 3d - 29 = 4l, -kd + 15 = -l + 4 for d. 3 Suppose 0b = -5b. Let q(v) = -2v*2 - 36v + 54. Let u be q(-21). Let g be (u - -69)10/(-6). Solve b = -2s + p + 7, -27 = -5s + gp + 3 for s. 1 Suppose b - 6 = 42. Let o = b + -44. Solve oi = 12, 0 = -s + 4i - 2 - 11 for s. -1 Suppose 23z = 20z + 21. Suppose zg = -4g + 176. Suppose 7c + g = 11c. Solve 0v = cv + 3k + 28, 2v = -k - 12 for v. -4 Suppose 369 = 3l + 357. Suppose 4i - 12 = 0, li = y + 14 - 9. Solve 0 = -2b - 2v + yv - 12, -v - 8 = -3b for b. 4 Suppose 0x - 18 = -x. Let k(l) = 94l + 942. Let g be k(-10). Solve -y = -5f - 2 - x, -5y + 31 = -gf for y. 5 Let x be (-64)/(-448) - (-34)/7. Solve 11k - 11 = 10k + 2l, xl + 20 = k for k. 5 Suppose j - 2k + 2 = 10, 0 = -3k + 3. Let a be -3(-3)/18j. Suppose 0 = u - a + 1. Solve -5r - ug - 12 = -r, 4g - 9 = 3r for r. -3 Let o(g) = -2g2 - 20g + 4g - 7g - g*2 + 12. Let i be o(-8). Solve 5h - 3b = 2b - 15, -ib = h - 7 for h. -1 Suppose 233v = 288v - 1320. Solve -4m - 12 = o, -2m = -16o + 21o + v for o. -4 Let f(g) = g3 + 28g*2 + 83g + 1514. Let y be f(-27). Solve ys = r - 11, -5r - 7s = -9s - 7 for r. -1 Let l(k) = 4k3 - 4k*2 + 2k + 1. Let b be l(1). Suppose n - y = 4, -6n = -2n + by - 23. Solve nc - 5i = -0i - 5, -28 = -2c - 4i for c. 4 Suppose 2p = -3c + 48, -2c + 5p + 27 + 5 = 0. Suppose -38 = -11r - c. Solve rw - q = 6, w = 4w - 3q - 9 for w. 3 Let q(o) be the second derivative of 35o4/12 - 6o3 + o2/2 - 203o. Let v be q(1). Solve 3i = -p - 10, -i = -4p - vi + 12 for p. 2 Suppose 5 + 2 = t. Let j(r) = -r*3 + 16r*2 - 21r + 20. Let k be j(14). Suppose y + k = 136. Solve 0 = h - 2a + 5, 5h + t + y = -a for h. -5 Suppose 503 + 77 = 2p. Let a = p + -287. Solve -4c - 12 = o + ao, 4o + c = -6 for o. -1 Let z be -1 - ((-3 - 3/4) + 6/8). Solve 5a + 41 = -4m, -zm - 13a = -8a + 33 for m. -4 Suppose 82m + 96 = 94m. Let k be (-2 + m + -6)/3. Solve 5x = -2r - 23, -4x + kx = -3r + 23 for x. -5 Suppose -3z + 4z - 4 = 0. Let l be (42/49)/(2/(-42)). Let j be 2/l2 - 12/(-54). Solve zd = -6n + 2n + 16, -n = j for d. 4 Let x(j) = j2 + j + 7. Let c be x(-3). Let o(i) = i2 - 12i - 9. Let a be o(c). Let t be 20/8 + 2/(-4). Solve 5k - 2*u	{ "pile_set_name": "DM Mathematics" }
4. Let a(d) = 2h(d) + 5u(d). Let t(x) = -65x2. Determine t(a(l)). -65l2 Let f(s) = -s. Let i(z) = -z2 - 4z + 7. Suppose 4t = 16 - 36. Let g be i(t). Let a(q) = -5q2 - 2q*g + 2q*2. What is a(f(y))? -5y2 Let q(j) = -j2. Let v(x) be the first derivative of -9x2/2 + 908x - 6707. What is q(v(m))? -81m2 + 16344m - 824464 Let f(q) = 82q2 - 69q*2 - 8 + 8. Let m(g) = 9g + 2. What is m(f(a))? 117a2 + 2 Let z(b) = -b + 3 - 3. Let f(n) = -n2 - 152n + 5. Let c(x) = -7x2 + 608x - 20. Let l(i) = c(i) + 4f(i). Calculate z(l(s)). 11s*2 Let y(i) be the third derivative of -19i*5/30 + 33364i*2. Let w(x) = -11x. Let v(c) = -2c. Let k(a) = -34v(a) + 6w(a). Calculate k(y(j)). -76j*2 Let s(d) = -220605407d. Let y(x) = x*2. Calculate y(s(j)). 48666745597635649j2 Let l(b) = b2. Let m(n) be the first derivative of 9n2 - 98n - 1440. Determine m(l(w)). 18w2 - 98 Let b(f) = -53f - 1. Let g(x) = 4x2 - 2x - 6446. Give b(g(s)). -212s2 + 106s + 341637 Let d be (-2)/4 + (1 - 18/(-12)). Let o(j) = -5 + dj + 5. Let r(y) = 3y*2 + 10y*2 + 7y*2 - 7y*2. Calculate o(r(p)). 26p*2 Let o(l) = 95l*2. Let k(z) = z + 27. Let i(x) = -10x - 185. Let j(p) = -2i(p) - 14k(p). Give j(o(s)). 570s2 - 8 Let r(v) = -58v + 3. Let l(t) = 214t - 11. Let b(o) = -3l(o) - 11r(o). Let d(a) be the second derivative of 2a + 0a2 + 0 + 7/6a*3. What is b(d(j))? -28j Let d(x) = 17x. Let w(a) be the second derivative of 0a*2 + 5/12a*4 + 192a + 0 + 0a3. Give d(w(h)). 85h*2 Let m(i) = -16i*2 - 7i. Suppose -70 = -5z - 5q, -q = -5z + q + 42. Let l(s) = -zs + 17s + s - 6s. Give m(l(f)). -64f2 - 14f Let p(v) be the third derivative of 0v + 0 + 0v*3 + 0v*4 - 148v*2 - 2/5v*5. Let w(h) = -5h*2. Calculate w(p(c)). -2880c*4 Let u(x) = 1607x - 553x + 334x. Let p(f) = -4f2. What is u(p(s))? -5552s*2 Let p(f) = -1603f. Let w(q) be the second derivative of q*4/12 + 1449q. What is p(w(n))? -1603n2 Let m(r) be the second derivative of r4/3 - r3/3 + 10r*2 + 74r. Let h(p) = 2p. What is m(h(o))? 16o*2 - 4o + 20 Let f(n) = -6n. Suppose -25o - 4 = -54. Let m(z) = -4zo - 12z*2 + 4z*2. What is m(f(u))? -432u*2 Let j(o) = 68o*3 + 5o*2 - 13o + 17. Let w be j(3). Let y(t) = -3t + 1859 - w. Let x(m) = -149m. Determine x(y(a)). 447a Let d(q) = 5451783q*2. Let b(a) = -3a. What is b(d(j))? -16355349j2 Let z(g) = -g2 - 17g - 70. Let k be z(-8). Let n(r) = 654 - 654 - kr. Let q(s) = -19s*2. Determine q(n(w)). -76w*2 Let c(g) = 19g. Let x(u) be the second derivative of 269u3/6 - 2u - 26. What is c(x(m))? 5111m Let g(r) = 120r - 411r - 3r*2 + 162r + 129r. Let a(q) = -q2 - 4q - 1. Let j be a(-3). Let o(l) = -lj + l2 - 4l2 + 3l*2. Calculate g(o(n)). -3n*4 Let g(d) = d. Let k(s) be the first derivative of -57 - 1/3s3 + s2 + 0s. Determine g(k(i)). -i2 + 2i Let k(f) = -4f2. Let a(t) = 3098 - 7t - 3098. Let h(n) be the second derivative of 155n3/6 + n. Let c(u) = 45a(u) + 2h(u). Give k(c(j)). -100j*2 Let v(w) = 2w*2. Let l(f) = 1705685f*2. What is v(l(q))? 5818722638450q*4 Let r(l) be the third derivative of 23l*5/60 - 53l*3/6 - 14623l2. Let z(n) = -n2. Give r(z(m)). 23m4 - 53 Suppose 3i - 10 = -2i. Let j(x) = 4 - x2 - 6 + i. Let y(b) = 2b + 17. Let f(a) = 3a + 29. Let t(c) = -3f(c) + 5y(c). Calculate t(j(k)). -k2 - 2 Let s(r) = -r2 - 9288. Let y(p) = -3085p + 2. Determine s(y(v)). -9517225v2 + 12340v - 9292 Let s(h) = -2h2. Let c(z) = -282z*2 + 245z*2 + 257z*2 + 135z*2. Calculate s(c(u)). -252050u*4 Let v(b) = -437743b. Let l(k) = -31k2. What is v(l(x))? 13570033x*2 Let p(a) = -14a*2. Let w = -15675 - -15675. Let q(b) be the second derivative of 27b + 0b2 + wb*3 + 0 + 1/12b*4. Give p(q(u)). -14u*4 Let t(n) = 2n. Suppose -56v = -46v. Let b(u) be the second derivative of 0u2 - 10u + v + 2/3u4 + 0u*3. Calculate b(t(h)). 32h2 Let d(g) = -g2 - 8g + 11. Let l be d(-9). Suppose -8u + 1350 = -6u. Let r(j) = -3j*2 + 5j*l + u - 675. Let b(w) = -20w*2. What is r(b(p))? 800p4 Let r(v) = v2 - v + 2. Let j(s) = 5s2 - 9s + 18. Let z(q) = -4j(q) + 36r(q). Let i(f) = 32f + 2. Calculate z(i(y)). 16384y*2 + 2048y + 64 Let v(m) = -364m + 1469m - 360m - 350m - 358m. Let t(w) = -9w + 11. Let a(i) = 5i - 6. Let s(d) = 11a(d) + 6t(d). What is s(v(u))? 37u Let t(i) = 2i + 77. Let f(v) = 4409v. What is f(t(a))? 8818a + 339493 Let t(f) = f - 3658. Let w(h) = 2h*2 + 130h. Determine w(t(s)). 2s2 - 14502s + 26286388 Let x(f) be the first derivative of -f*4/24 + 55f*2/2 - 2f + 66. Let u(m) be the second derivative of x(m). Let c(r) = -157r2. What is u(c(s))? 157s*2 Let w(j) = 6j. Let b(a) = -7a + 9774 + 49a - 9775. Determine b(w(q)). 252q - 1 Let h(o) = 74 - 37 - 37 + o2. Let z(g) = -26g + 74g - 21g - 34g - 2g*2. Calculate z(h(n)). -2n*4 - 7n*2 Let p(r) = 2611337 - 2611337 + 3r. Let a(k) be the third derivative of -k7/1260 + k4/24 - 2k2. Let s(g) be the second derivative of a(g). Give p(s(j)). -6j*2 Let k(v) = -v + 0v + 0v. Let p be (3/3)/(1/3). Let x(d) = -17d + 1 + 6 - 10 + p. Give k(x(i)). 17i Let g(i) = -2i2. Let n(c) = c2 + 7c - 8. Let l be n(-8). Let k(p) = -11p - p + l + 3 - p - 2. Calculate k(g(q)). 26q2 + 1 Let o(m) = 167m + 9. Let f(p) be the first derivative of p*2/2 - 317. Give o(f(d)). 167d + 9 Suppose 3i + 21 = 3c, 0 = -i + 4i - 12. Let h(q) = -2 + 0 + cq*2 + 2. Let k(o) = -2o - 1896 + 1896. Determine h(k(t)). 44t2 Let o(i) = 297412i*2 - i. Let a(j) = -79j. Calculate o(a(t)). 1856148292t2 + 79t Let c(g) = -2g. Let m = 4 + -1. Suppose -f - 2f - mb + 9 = 0, -3b = 4f - 17. Let h(y) = -12y*2 + 6y*2 - fy*2. Determine c(h(x)). 28x*2 Let s(g) = -2g. Let k(v) = -176583630v2. Calculate s(k(c)). 353167260c*2 Let p(y) = -144y - 56. Let l(m) be the third derivative of -m*5/60 + 2m*2 - 5515m. Determine p(l(x)). 144x2 - 56 Let f(y) = -4y*2. Let z(d) = 4d - 8. Let i be (1/4 + 75/(-12))/(-2). Let v(l) = 0l - l + 2l - 3. Let k(q) = iz(q) - 8v(q). Give f(k(h)). -64h2 Let a(j) = -872j. Let n(w) = -45488w2. Calculate a(n(p)). 39665536p*2 Let z(x) = -2x + 32. Let v be 2/1640(-2)/(-5). Let j(p) = 7 - 28pv + 3 - 10 + 30p*2. Calculate z(j(f)). -4f*2 + 32 Let j(z) = -97833z. Let g(y) = 11y + 8. What is g(j(l))? -1076163l + 8 Let d(b) = b. Suppose 3c = x + 150, 5c - 2x - 251 = -0c. Let t(u) = -24u2 - 21u*2 + cu*2. Determine t(d(r)). 4r*2 Let h(b) = 3b2. Let k(c) be the second derivative of c3/6 - 89c2/2 + 2c + 80. Calculate k(h(d)). 3d2 - 89 Let n(q) be the second derivative of q4/2 + 25q. Let a(o) = -o. Let z(d) = -21d2 + 4d. Let k(y) = 4a(y) + z(y). Give n(k(w)). 2646w*4 Let h(u) = -61u2 - u. Let b(a) be the second derivative of a4/4 - 10a + 29. Determine b(h(l)). 11163l*4 + 366l*3 + 3l*2 Let u(s) = s + 17. Let c be 344/6 - 3/9. Suppose -14l + 16l = 238. Let x(z) = cz + 61z - lz. Calculate x(u(g)). -g - 17 Let d(f) = f + 36. Let s(m) = -69m2 - 5m - 182. Let y(z) = -5d(z) - s(z). Let u(l) = -14l + 1. Give y(u(a)). 13524a2 - 1932a + 71 Let r(p) = p*2. Let i(w) = 42083w - 14. What is i(r(a))? 42083a2 - 14 Let a(x) be the second derivative of -x4/12 - 32x*2 - 148x. Let w(m) be the first derivative of a(m). Let n(i) = 77i2 + 2. What is w(n(f))? -154f2 - 4 Let k(v) = -v2. Let c(u) = 15u2 + u - 5. Let y(x) = 1760x*2 - 44x + 220. Let j(o) = -132c(o) - 3y(o). What is j(k(z))? -7260z4 Let g(t) = -89t*2. Let v(a) = -184a + 184a - 8a*2 + 25a*2 - 15a*2. Determine g(v(c)). -356c*4 Let t(l) = -3l - 129. Let z(n) = 0 - 1006n + 489n + 522n + 0. Calculate z(t(p)). -15p - 645 Let v(p) = 3p2. Let x(g) = 2. Let r(n) = n + 8. Let l(t) = -15t - 129. Let u(d) = -2l(d) - 33r(d). Let s(w) = -u(w) - 3x(w). Give v(s(j)). 27j*2 Let l(h) = -9h*2 - 168h*2 - 102h2. Let t(g) be the third derivative of -g4/12 - 16915g2. Calculate l(t(s)). -1116s*2 Let c(k) = -2389282k2. Let i(s) = -s2. Give	{ "pile_set_name": "DM Mathematics" }
4). Calculate the remainder when 15 is divided by y - (9/m - -5). 3 Let q be 10/3(-6)/(-5). Suppose 2h = -4j + 78, -2j + qh = -18 - 16. Suppose 10r - 110 = 8r. What is the remainder when r is divided by j? 17 Let s(l) = -4l - 38. Suppose 4g - y = 33, 3 = -y + 6. What is the remainder when g is divided by s(-11)? 3 Let v be (3/(-15)2)/(1/(-220)). Let u = 107 - v. Calculate the remainder when 188 is divided by u. 17 Suppose -76w + 68w = -400. Calculate the remainder when w is divided by 22. 6 Suppose -7r + 882 + 1603 = 0. What is the remainder when r is divided by 51? 49 Let x(d) = -5d - 1. Let f be (2/((-4)/14))/1. Suppose -32 = -j + 5a, 7j - 28 = 4j - 2a. Calculate the remainder when x(f) is divided by j. 10 Let l = -6 + 9. Suppose p - lr = 86, -3r + 315 = 5p - 25. What is the remainder when p is divided by 24? 23 Suppose -24q = -5q - 532. Let x be (-68)/(-6)(-12)/4. Calculate the remainder when q is divided by (-4)/(-12) + x/(-6). 4 Let a be (-6)/3 - (-5 + 1). Let b = a - -6. What is the remainder when 23 is divided by b? 7 Let a = -5 + 243. Calculate the remainder when a is divided by 15. 13 Let w = 56 + -54. Suppose 0 = c, 2c + 4 = wh - 2c. What is the remainder when h is divided by 2? 0 Suppose 68 = 6h - 2h. Suppose -4j - 4f + 9f = -265, 264 = 4j - 4f. What is the remainder when j is divided by h? 14 Suppose 10g - 8 = 22. Calculate the remainder when 1/g - ((-124)/6 - 2) is divided by 7. 2 Suppose 100 + 98 = 3t + 2a, -t + 4a = -52. What is the remainder when 1533 is divided by t? 61 Suppose -5l - 3c = 3, 0 = -5l + c + 1. Let g = 8 - l. Suppose 3x - 10 - g = 0. Calculate the remainder when 22 is divided by x. 4 Let p = -272 - -314. Let q(t) = -3t - 2. Let k be q(-8). Let a = p - k. What is the remainder when 39 is divided by a? 19 Calculate the remainder when 119 is divided by 3 + 10(-21)/(-35). 2 Suppose -27l + 3181 = 157. Calculate the remainder when l is divided by 34. 10 Let k = -41 - -39. What is the remainder when -1 + (k - -2) - -54 is divided by 11? 8 Suppose 927 = -5p + 1637. What is the remainder when p is divided by 25? 17 Let b = 5 + -2. Suppose 2o - 18 = 3l + l, 0 = -5o + bl + 38. Let c = o + 0. What is the remainder when 24 is divided by c? 3 Let g = -2609 - -2654. Calculate the remainder when 573 is divided by g. 33 Let s be (308/(-42))/((-4)/6). Suppose 10v = sv - 13. What is the remainder when v is divided by 7? 6 Let j be ((-3)/6)/(1/(-84)). Suppose 4w - w = j. What is the remainder when 37 is divided by w? 9 Let x = 4 - 9. Let z = x + 9. What is the remainder when 41 is divided by z? 1 Suppose -15 + 6 = z - 5f, -4z + 3f + 32 = 0. What is the remainder when 505 is divided by z? 10 Let h(k) = -k2 + 10k - 11. Let j be h(8). Suppose -jy + 45 + 50 = 0. What is the remainder when -733(-2)/6 is divided by y? 16 Suppose 20c = 16c + 8. Suppose -60 = -3u - cu. What is the remainder when 19 is divided by u? 7 Suppose 0 = -2v - 2j + 46, -3v = -3j - 14 - 85. Suppose 4d + 6 - 30 = 0. What is the remainder when v is divided by d? 4 Suppose 585 = 74n - 821. Calculate the remainder when 159 is divided by n. 7 Suppose -y + 4h = -0y + 1, 38 = 4y - 2h. What is the remainder when y is divided by (-10 - -2)/(6/(-3))? 3 Let i(a) = -3a3 - a2 + 5a + 6. What is the remainder when 30 is divided by i(-2)? 14 Suppose 0 = 6f + 4f - 3190. Calculate the remainder when f is divided by 64. 63 Let p = -554 - -561. Calculate the remainder when 22 is divided by p. 1 Suppose -130 = -5n + 5m, 4n - m = -1 + 90. Let g(z) = -z*2 - 7z + 6. Calculate the remainder when n is divided by g(-6). 9 Let d(y) = y*2 + 7y + 7. Calculate the remainder when 100 is divided by d(-11). 49 Suppose -10y = -982 - 2718. What is the remainder when y is divided by 77? 62 Let k(n) = -6n*2 - n + 1. Let d be k(1). Let b = -12 - -82. Calculate the remainder when b is divided by d/(-12) - (-70)/4. 16 Suppose 2d = -4z - 6 - 0, -5z = 4d. Let k(q) = 9q*3 - q + 1. Calculate the remainder when k(1) is divided by z/(-18) + (-129)/(-27). 4 Suppose -11p + 17p - 282 = 0. Calculate the remainder when 147 is divided by p. 6 What is the remainder when (-4)/10(3 + -523) is divided by 30? 28 Calculate the remainder when 129 is divided by (22/77)/(((-18)/(-224))/9). 1 Let s = -179 + 233. Calculate the remainder when s is divided by 14. 12 Suppose -2t + 0t = 8. Let h be (56/(-21))/(t/18). Let c = -8 + h. What is the remainder when c is divided by 3? 1 Suppose -i = 2i - 132. Suppose 733 - 917 = -8n. Calculate the remainder when i is divided by n. 21 Let l(i) = -12i2 + i - 2. Let f be l(-3). Let s = f + 157. Calculate the remainder when 85 is divided by s. 41 Let c = -233 + 243. Calculate the remainder when 45 is divided by c. 5 Let p(f) = 2f*2 - 4f - 12. Let n be p(6). Let x = n - -1. What is the remainder when 147 is divided by x? 36 Let d(a) = a*3 - 3a*2. Suppose -3 = -3k + 12. Suppose 5p - 90 = -5o, -48 = -5o + 4p - 3. What is the remainder when d(k) is divided by o? 11 Suppose 23u = 18u - 335. Calculate the remainder when (1 - u) + (-14 - -12) is divided by 17. 15 Let c = 56 + -51. Let b = 10 - -2. What is the remainder when -5(-1 - b/15) is divided by c? 4 Let d(a) = -8a3 + a2 + 10a + 9. Calculate the remainder when 91 is divided by d(-1). 3 Suppose 2n - 12 - 10 = 4w, 3n - 5w - 29 = 0. Suppose 0 = j - 5j + 36. What is the remainder when j/(-6)(-16)/6 is divided by n? 1 Suppose -4u = -3y - 2y + 62, 4u = 3y - 34. Calculate the remainder when y is divided by 6. 2 Let h(b) = b*2 - 20b - 4. Let q(c) = 10c - 39. Let w be q(6). Let l(d) = 17d - 2. Calculate the remainder when l(2) is divided by h(w). 15 Let n(c) = -c*3 + 24c*2 - 22c + 12. Calculate the remainder when 381 is divided by n(23). 31 Let w = -307 - -353. Calculate the remainder when 91 is divided by w. 45 Let v(n) = n*3 - 6n*2 - n + 8. Let z be v(8). Suppose -7h = -397 - z. Calculate the remainder when h is divided by 7. 5 Suppose 4n + 2g = -g + 54, 0 = -2n - 3g + 30. Calculate the remainder when ((-4)/(-10))/((-5)/(-275)) is divided by n. 10 Let z(q) = -40q + 5. Let a(p) = 200p - 26. Let k(c) = -2a(c) - 11z(c). What is the remainder when k(3) is divided by 17? 15 Let m(h) = 7h3 - 57h*2 + 11h - 16. Calculate the remainder when 611 is divided by m(8). 3 Let o(q) = -q*3 - 6q*2 - 6q. Let i(l) = -6 + 25 + 0 - l. Calculate the remainder when i(12) is divided by o(-5). 2 What is the remainder when 128 is divided by 620/14 - 9/37812? 40 What is the remainder when 4495(-2)/(-10) - -3 is divided by 65? 62 Let v(j) = -7j - 3j - 3j - 9 - j*2 + 2j*2. What is the remainder when 8 is divided by v(14)? 3 Suppose -3m + 2875 - 323 = x, 0 = m + 3x - 840. Calculate the remainder when m is divided by 61. 59 Let z be 1(-11 - 1)/(-3). Suppose -5 + 61 = zi. Suppose -3s - i + 44 = 0. Calculate the remainder when 29 is divided by s. 9 Let p = -135 + 217. What is the remainder when p is divided by 22? 16 What is the remainder when 53 is divided by 44(35/(-5))/(-28)? 9 What is the remainder when 137 is divided by (-134)/(2-1) + 20 + -16? 66 What is the remainder when -370((-260)/(-50))/(-13) is divided by 16? 4 Let q = 7 + 11. What is the remainder when -529/42616/(-132) is divided by q? 16 Suppose 2 - 3 = -x. Calculate the remainder when 2/7 - 687/(-21) is divided by 20 + (x + 0 - 4). 16 Let i = -8307 + 8328. What is the remainder when i is divided by 21(-1)/(-3)2? 7 Let m(v) = 9v*2 + 27v + 65. What is the remainder when m(-10) is divided by 41? 39 Suppose 5b - b - 36 = 0. Calculate the remainder when (-5)/((-4)/(-56)-2) is divided by b. 8 Let d(b) = 15b2 + 3b + 3. Let w be d(-1). Suppose -w = 3i, -2i = -5m + 2i + 40. Calculate the remainder when 9 is divided by m. 1 Let r(j) = -j*3 + 6j*2 + 7j - 6. Suppose 4b - 8 - 8 = 0. Calculate the remainder when r(b) is divided by 11. 10 Let o(q) = -q. Let m(d) = d2 - 25d + 21. Let s(r) = -m(r) + 6o(r). Calculate the remainder when 36 is divided by s(17). 10 Let t(n) = n2 - 21n + 20. Let m be t(23). Suppose -14c - m = -17c. Calculate the remainder when c is divided by 0 - 1 - (-6 - 0). 2 Suppose -286 - 169 = -7*i	{ "pile_set_name": "DM Mathematics" }
7p5/60 - 5p*2. Let v(n) be the third derivative of u(n). What is the units digit of v(-4)? 5 Suppose 0 = 15h - 10h - 1175. Let c = h - 2. What is the hundreds digit of c? 2 Let n = 488 - 116. Suppose 4w = -4l + 2l - n, l - 4 = 0. What is the tens digit of (-2)/5 + (-5738)/w? 6 Suppose -21u + 33765 = -13758. What is the tens digit of u? 6 Suppose 0p - 5117 = -17p. What is the hundreds digit of p? 3 Suppose 19y - 63 = -2y. What is the units digit of y? 3 Suppose 3f - 2 + 14 = 0. Let h(a) = 2a2 - a - 6. Let y(m) = m2 - m - 5. Let n(r) = 2h(r) - 3y(r). What is the tens digit of n(f)? 1 Suppose i - 3q = -q + 458, 0 = 5i + 5q - 2275. What is the units digit of i? 6 Let o = -12 + 12. Suppose o = u - 2u + 12. What is the units digit of 111/u + (-3)/12? 9 Let z(m) = -1136m*3 - 5m*2 - m + 3. What is the tens digit of z(-1)? 3 Suppose -2p + 0p + i + 4 = 0, p = 2i - 1. Suppose -4t + 16 = 0, t - 154 = px + 3t. What is the units digit of (882/x)/((-2)/6)? 9 Let k = -12 + 7. Let n be (4/(-4) - k) + 1. Suppose -38 = -2b - 2t, -b = -0t - nt + 5. What is the tens digit of b? 1 Let b(n) = 5n - 28. Let r be b(7). What is the tens digit of (-1296)/(-21) - (-2)/r? 6 What is the hundreds digit of (18 - -7)-256/(-4)? 7 Let q(l) = 48 + 39 - 51 - 9l + l2. What is the units digit of q(11)? 8 Suppose 943 = 3t - 4a, -431 = -3t + 3a + 517. What is the units digit of t? 1 Suppose 60 = 8s - 636. What is the units digit of s? 7 What is the units digit of (-2255)/(-22)((-13)/(-5) + -1)? 4 Suppose 17s - 21s = -376. Let c = 114 - s. What is the tens digit of c? 2 Let i(l) = 83l*2 - 2l - 1. Let y be i(-1). Suppose -4w = -16 + y. Let t = 21 + w. What is the units digit of t? 4 Let n(c) = -c + 6. Let h be n(8). Let q be h/(-9) - (-440)/45. Suppose 0 = -3j - 2j + q. What is the units digit of j? 2 Let p(s) = -15s + 13. Let j be (1/2)/((-6)/(-108)). Let z be p(j). Let g = -81 - z. What is the tens digit of g? 4 Let u = -1103 - -1799. What is the units digit of (2/4)/(6/u)? 8 Suppose -63 - 25 = -k. Let p be (-88 + 2)/(-1 + 3). Let y = k + p. What is the tens digit of y? 4 Suppose -3f + 4 + 2 = 0. Suppose -8 = 2p, i - 51 = -fp + p. Suppose -c + 51 = 2y, 2y - 7c + 4c = i. What is the tens digit of y? 2 Let q be 23 + -25 + (-212)/(-2). Suppose 2l = 24 + q. What is the tens digit of l? 6 Let g be (-7317)/12 - 15/(-20). Let a = g + 870. What is the tens digit of a? 6 Let u(l) = l*3 + 6l*2 - 5l - 6. Let g be u(-6). What is the units digit of g/(-8) + 152? 9 Let v be (-2)/8 - (-2)/8. Let u(i) = -i3 + i2 + 12 - 13i + 26i - 15i. What is the tens digit of u(v)? 1 Let s = 34 + -31. Suppose 12k - sk - 693 = 0. What is the tens digit of k? 7 Suppose 15v = 12v + 348. What is the tens digit of v? 1 Let u be 100/8(-16)/(-20). Suppose 11t = ut + 4. What is the tens digit of -3 - -21 - t/(-4)? 1 Let n(u) = u2 - u + 93. Let r be 0/(8 + -3 + -3). What is the tens digit of n(r)? 9 Let a be (12/(-5))/((-33)/110). Suppose -4t + at - 268 = 0. What is the tens digit of t? 6 Let r(g) = 14g. Let i be r(1). Let b(y) be the second derivative of y*4/12 - 13y3/6 + y2/2 - 3y. What is the units digit of b(i)? 5 Suppose 26 = 5i + 4w, 0 = -2i - 3i - 2w + 18. Suppose 0 = l - i - 26. What is the units digit of l? 8 Suppose 216y - 212y = 12. Suppose 0 = yg - 5x - 876, -3g - g + 3x + 1168 = 0. What is the units digit of g? 2 Let x be ((-8)/(-2) - 3) + 11. What is the tens digit of 4 - 3(-88)/x? 2 Let n = -63 - -107. Suppose 0 = 12c - 16c + n. What is the units digit of c? 1 Let h = -65 - -48. Let o = 97 - h. What is the units digit of o? 4 Let u = 5283 + -2926. What is the hundreds digit of u? 3 Let b(c) be the second derivative of -11c4/24 - c3/6 - c*2/2 - 7c. Let g(o) be the first derivative of b(o). What is the units digit of g(-4)? 3 Let h = 507 - -610. What is the units digit of h? 7 Suppose 5o = 17 - 32. What is the units digit of o + 56 - (3 + -6)? 6 Suppose 0l + 6 = -3l. What is the units digit of 1092/24 - 1/l? 6 Let u(l) = l2 - 8. Let v be u(0). Let z = -83 + 76. Let j = z - v. What is the units digit of j? 1 Suppose 5t - 6 = 2t. Let m = 2 + t. Suppose mu + h = -33 + 147, 4u = 5h + 126. What is the units digit of u? 9 Let g(p) = p*2 - 3p - 3. Let f be g(4). Let m(t) = -4t3. Let r be m(f). What is the units digit of 1 - r/(-4) - -8? 8 Let r(j) = j3 + 14j*2 + j + 20. Let a be r(-14). What is the tens digit of a5/60321? 1 Let v = 39 - 37. Suppose -i = -4b - 1 + 5, -4i - 2b + v = 0. Suppose -4q - 350 = -5s - q, q = i. What is the tens digit of s? 7 Suppose 5a - 2h = 2h + 8093, 0 = -2a + h + 3236. What is the hundreds digit of 4/6-1 - a/(-9)? 1 Suppose 9 + 1 = u. Suppose -11 = -4r - 5x, -4x + 7x + 3 = 0. Suppose -2 = ro - u. What is the units digit of o? 2 What is the units digit of ((-8 + 1)/(-28))/(1/916)? 9 Let n(p) = -p3 + p2 + p - 4. Let x be n(0). Let d(i) = i3 + 4i*2 + i + 4. Let f be d(x). What is the units digit of -1(-1 - (7 - f))? 8 Let w(x) = 266x2 + 24x - 16. What is the tens digit of w(-4)? 4 Suppose 778 = -9j + 4423. What is the hundreds digit of j? 4 Let h = 106 - -963. What is the thousands digit of h? 1 Let o be (-6)/(-4) + 3/2. What is the units digit of -3(-30 + o)/3? 7 Let p(m) = 7m + 14. Let q = 52 - 45. What is the units digit of p(q)? 3 Let g = 503 - -33. Suppose -3i = i - g. What is the hundreds digit of i? 1 Suppose 5i = -6i. Suppose 3x = -2v + 34, ix - 4v = -x + 2. What is the units digit of x? 0 Let g be (27/(-18))/(1/(-2)). Suppose 0m - 3b = m - 104, -gb - 190 = -2m. What is the units digit of m? 8 Let y be (-1)/(3/99)28/(-4). Suppose -yq + 681 = -228q. What is the tens digit of q? 2 Suppose -5832 = 52h - 58h. What is the tens digit of h? 7 Let i be -2 - (-3 + 4 - 98). Let t = i + -47. Suppose 4g + 2f - 194 = 0, 2g - f + t = 3g. What is the tens digit of g? 4 Suppose -31326 = -8k - 12118. What is the tens digit of k? 0 Let g(q) = 36q2 + 4q - 54. Let c(f) = -7f2 - f + 11. Let w(m) = -11c(m) - 2g(m). What is the units digit of w(4)? 9 Suppose 0h - 10 = -5h. Suppose b + 40 = p, -3b - 46 = -hp + 36. What is the units digit of p? 8 Let s be 0 - ((16 - 3) + -1). Let t(j) = -j3 - 12j*2 + j + 14. Let u be t(s). Suppose 5 - 1 = -p, -5p = -un + 62. What is the units digit of n? 1 Let k(g) = 2g + g + 5g - 5 + 3g*2 - 4g - 5g3. What is the units digit of k(-3)? 5 Let h(r) = 38r*2 - 22r - 67. What is the units digit of h(-4)? 9 Suppose 21 = 5m + 6. Let p(x) = m + x2 + 0 + 3. What is the units digit of p(6)? 2 Suppose -2w = 5w - 15547. What is the tens digit of w? 2 Let v = -1 - -5. Let n(w) = 2w*2 + 54w + 8. Let k be n(-26). Let a = v - k. What is the units digit of a? 8 Let p be 12/(-4) - -136 - -1. Let k = -190 + p. What is the tens digit of 36/(-14)k/12? 1 Suppose -22s = -44s + 26378. What is the thousands digit of s? 1 Let j be 1(-6 + 3)/(-3). Suppose 8 = 3z - j. What is the units digit of 9 - 1/(1/z)? 6 Suppose 5a + 61 = -5t + 2a, -5a = t - 1. What is the units digit of (-14)/(-4)t/(-1)? 9 What is the units digit of 3/1208 + 1479/5? 6 Let g(u) = -u3 + u + 3. Let v(x) = x3 + x2 - 2x - 3. Let o(w) = 2g(w) + 3v(w). Let f be o(-4). Let q = f - -19. What is the tens digit of q? 1 Let s(c) = 43c - 75. What is the hundreds digit of s(18)? 6 Suppose 4y + 3d - 2140 = 4d, d = -y + 535. What is the units digit of y? 5 Let c(l) = -2l3 + 9l*2 + 30l - 17. What is the hundreds digit of c(-10)? 5 Let z(c) = c*3 - 9c*2 + 9c - 22. Let v = 51 + -42. What is the tens digit of z(v)? 5 Let h(c) = c - 12. Let a be h(12). Let z = 72 + a. What is the units digit of z? 2 What is the units digit of 5/(-15) + 1 + (-2722)/(-3)? 8 Let j = -177 + 607. What is the tens digit of j? 3 Let z be (76/(-2))/(4/(-16)). Let q = z + -29. What is the units digit of q? 3 Suppose -158w - 5883 = -161w. What is the thousands digit of w? 1 Let q = 24 + -12. Let w be (q/15)/(6/15). Suppose -20 = -7x + wx. What is the units digit of x? 4 Let g = 331 - 220. Let b = g - 43. What is the tens digit of b? 6 Let l = -2895 + 5679. What is the units digit of l? 4 Suppose 3q - 4c	{ "pile_set_name": "DM Mathematics" }
+ 62, -47f + 74f - 2a = 23f + 20 for f. -4 Solve -3109s + 3115s + 5i = -53, -s = 4i + 12 for s. -8 Solve -2s - 3s - 152g + 15 = 114g - 268g, 0 = 5s + 4g - 15 for s. 3 Solve 6v - 165 = -3p, -1152 = 3v - 2v + 5p - 1202 for v. 25 Solve -2228 = -4h - 11j - 2192, -h + 3j - 6 = -4h for h. -2 Solve y + 108 = 53o, -3 = 62o - 67o - 2y + 3 for o. 2 Solve 4p + 4a = 8, -85a + 286 - 26 = 4p - 9p for p. -1 Solve 5h - 5n = 230, 0 = 2h + n - 210751 + 210809 for h. -4 Solve -5q + 219 = 13d - 300, -3d + 119 = -393q + 199q + 195q for d. 38 Solve -2w - 129 = 9k - 153, -2w - 5 = -11 for k. 2 Solve 3b - 42 = -2g - 45, -14b + 4g + 14 = -12 for b. 1 Solve j - 3y - 8 = 0, 3j - 525y + 46 = -530y for j. -7 Solve 0 = 3o - 198, 7b = 2b + 1260o - 1261o + 91 for b. 5 Solve j = 82g - 87g - 18, 27j + 10j + g + 114 = 0 for j. -3 Solve -5b - g - 64 = 0, -32 + 58 = b - 5g - 141 - 75 for b. -3 Solve 889028 - 889004 = -2p + 4u, -u + 16 = 2p for p. 4 Solve -59 = p - 2a - 3a, -a = -2268p + 2271p + 1 for p. -4 Solve 3r + 19b = 48b - 22b - 156, -3r + 3b - 53 = 91 for r. -45 Solve -1888 = 16p + 4m, 668p - 3m - 2006 = 685p for p. -118 Solve -4o = 3r - 15, -3o - 519r = -522r + 15 for o. 0 Solve g + 10 = 2k, 302 - 147 - 147 = 2g for k. 7 Solve -37609n - 5q = -37611n + 9, 0 = -4n - 15q - 7 for n. 2 Solve -4z + 626 = -2i + 564, 4z - 3z + 2i = 22 - 19 for z. 13 Solve -3j + 115 = -n, -3n = j - 5j + j + 105 for n. 5 Solve -q + 9 = -6q - 2s, 13q + s + 170 - 125 = 3s for q. -3 Solve 231644a + 9 = -g + 231648a, -17 = 3g - 2a for g. -5 Solve 0 = -159o + 157o + u - 4u + 115, -11o + 5u - 120 = 0 for o. 5 Solve -4g + 40 = 5a, -42105g - 2 = -3a - 42103g for a. 4 Solve 20t - i = -7, -22t + 19t = 4i + 55 for t. -1 Solve p + 2p - 30 = -m, 4p + 44 = 7p + p for m. -3 Solve x = -4g + 124, 4009 = -8x + 4041 for g. 30 Solve 1 = 11z + 3h, 2h - 12 = 56040z - 56036z for z. -1 Solve -5w + 47 = 5j - 43, 0w - w = 6j - 83 for j. 13 Solve 0 = m - 6m - 16n + 140, 0 = -m - 0m - 11n + 106 for m. -4 Solve 0 = 5x - 2p - 106 + 9 + 16 - 3, 26 = 2x + 3p for x. 16 Solve 4f + 4j + 36 = 0, -f - 1889 + 1910 = -5j for f. -4 Solve 10q = 15o + 70, 8520 - 8561 = 5q + 2o for q. -5 Solve -355169v = -4l - 355171v - 20, -5l = 5v + 35 for l. -3 Solve 14784i + 431 = 14788i - 58j + 11j, 4i + 4j = -28 for i. 2 Solve -9c - 2x + 55 = -0x - 6x, -x = 7 for c. 3 Solve -12d + 3l - 174 = 0, -1096d + 4l = -1091d + 78 for d. -14 Solve -3c = -2x + 165 + 57, -19826 = 3c - 5x - 19604 for c. -74 Solve -168u + 8 - 1 + 65 = -172u - 76, -20z + 5u + 165 = 0 for z. -1 Solve 3d = -5x + 23, -5x = -55514d + 55516d - 17 for d. 6 Solve 5z = 27c - 17, 5857c - 2z = 2931c + 2928c - 6 for c. 1 Solve -34h - 655 = -3d, 94 - 173 = -d + 4h for d. 3 Solve -90u - 4v = -89u - 19, -2v - 17 = -3u - 6v for u. -1 Solve -7903222 = 4v - 5w - 7903239, 9w + 21 = 4v for v. 3 Solve -c - a + 12 = 3c, -21c - 8a + 100a + 384 = -17c for c. 4 Solve 0 = -20c - t - 275, 2c + 25t - 16t - 11t + 38 = 0 for c. -14 Solve -39o + 477 = 3z + 2z + z, 0 = 4o + 2z + 2z - 33 + 1 for o. 13 Solve 226j - 178 = 228j, -i + 7i - 5j - 441 = 2i for i. -1 Solve 1752o + 61 = 4c + 1757o, c - 19o = -86 for c. 9 Solve -32d = -3t - 44, -d - 1805t + 11 = -1810t - 10 for d. 1 Solve -d + 1064930 = -56p + 1065078, 4d = -2p + 86 for d. 20 Solve -k + 10 = -5x - 5, -3k = -78x + 76x + 7 for k. -5 Solve -10l - 5l + 20 = -h, h - l = -8h + 88 for h. 10 Solve 99 = -3y - 3k, 2k - 36627 + 36691 = 0 for y. -1 Solve m = 33v - 24, 268m = -4v + 261m - 168 for v. 0 Solve -12 - 2 = -291496t + 291493t + 5u, 4t + 5u = 2u + 9 for t. 3 Solve -4m + 5q = -71, -7 = -3m + 4q + 14 + 46 - 11 for m. 4 Solve 0 = -3s + 2w + 5, -12802s + 12803s + 5w + 4 = 0 for s. 1 Solve 4j + 6 = -3b, -2b + 0b + 9213 = -4j + 9237 for b. -6 Solve 126k = 6x + 125k - 34, 5x - 3k - 89 = 0 for x. 1 Solve 69h + 16 = 71h, -40l - 128 = -2h - 2h + 3h for l. -3 Solve 2t + 5r = 4r - 87, -421t - 4r + 226 = -427t for t. -41 Solve -4g - 17z = 201, -88 = -g - 3z - 132 for g. -29 Solve 2j - j - 51 = -4j - 2q, 0 = 3j + q - 24 for j. -3 Solve -3r + 4w + 25 = -6 + 6, 42 - 7 = -7r - 4w for r. -1 Solve 208 - 330 = -3y + 25p, 0 = -y + 3p + 8 + 22 for y. 24 Solve 21r - 105 = -83i + 78i, -25 = -5r for i. 0 Solve 2j + 5z = 74, 0 = -310j + 309j + 5z - 22 + 59 for j. 37 Solve 1 + 7 = -4c, 2c + 3 = -2a + 9c + 61 for a. 22 Solve 0 = -l - 6d - 33, 99871d = 3l + 99868d - 6 for l. -3 Solve 2u - 65 = 3y, 11871u = 5930u + 5938u + 5y + 108 for u. 1 Solve 3z + 17 = 2l, -284z + 39 = 34l + 12z + 7z - 304z for l. 1 Solve -1658 + 1594 = -4k + 4s, 8s - 59 = -3k for k. 17 Solve -8y = -5c + 84, -185279c + 185278c - 5y = 36 for c. 4 Solve 3608s - 3594s + 355 = 3a, -s + 15a + 13 = 2a for s. -26 Solve -4f + 34 = 6a, 19a = 4a + 16a - 5f for a. 5 Solve 3d - 5671s + 5672s = 9, -11 = d - 2s for d. 1 Solve -750u + 2f + 48 = -691u, -48 = -u + 2f for u. 0 Solve 0 = -0f - 4f - 4i + 152, -181 = -31f - i + 907 for f. 35 Solve 18d = -5y + 38d - 19d + 7, 0 = -2y + 7d - 83 for y. 4 Solve -2u = 12p - 10, -4p + 13u + 65 = -2p + 10u for p. 4 Solve -1193 + 1251 = 2i - 2f, 4f + 81 + 38 = 3i for i. -3 Solve 1043t - 1044t + 5w + 19 = 0, 2w = -t - 9 for t. -1 Solve 0 = 9q - 25g + 29g - 147, 2q + 119 = 3g for q. -1 Solve -156b + 87b = -66b, 0 = -11g - 4b + 132 for g. 12 Solve 1002 = 2o + 3k + 1009, 0 = 3o - k + 38 for o. -11 Solve 5x - 31 - 24 - 37 + 80 = -9m, 0 = 4x + 12 for m. 3 Solve -o = 5s + 38, -31o + 35o = -3s - 118 for o. -28 Solve -3k - 38244 = 44v - 38493, 2v - 5k - 19 = 3v for v. 6 Solve -116 = 2b - 2z, -286b + 840 = -291b + 15z for b. -3 Solve -105l + 107l + 103 = -w + 108, -5l - 34w = 82 for l. 4 Solve 0 = q + 2q - 4b - 13, 24q + 18q + 20 = 44q + 3b for q. 7 Solve 2d - 462 = 12s, -58s + 87 = -60s - 3d for s. -39 Solve 0 = 4y + 29r + 111, -y - 18 = -44304r + 44308r for y. -6 Solve d - 3x - 11 = 0, -3d - x = -363608 + 363575 for d. 11 Solve 7n + 13n - 38n + 4n = -13n - 173z - 687, 0 = -3n + 4z + 1 for n. -5 Solve 4q - 5q = 1, -13m + 89 = -11m - m - 4m - 17q for m. -24 Solve -82 = -2j + 22l, j - 11266l = -11249l + 65 for j. -3 Solve -2q - 8h + 11h = 25, -8q - 4h = -358 + 314 for q. 1 Solve -5q - 15169 = 5058z, -346q - 2z = -348q + 8 for q. 1 Solve 19o - 9o + 15x = 13x - 6, -3x = o + 23 for o. 1 Solve 14h = 6r - 814, 279h - 283h - 224 = -0r - 0r for r. 5 Solve -3t + 5t - 9 = 3t + 5, -1123b + 1166b + 4t - 30 = 0 for b. 2 Solve -4 = 2r - 7j - 2j + 12j, 3r + 12 = -3r + 31j - 27j for r. -2 Solve -n + 161 - 128 = -3x, 9x - 108n + 36n = -1962 for x. -2 Solve 2911 = 266s + 3w, s + s + w = 4w + 37 for s. 11 Solve -2c + 2424718 = b + 2424724, -4 = c for b. 2 Solve -3j - 31 = -4l, -33479 = 2l + 2j - 33477 for l. 4 Solve 2g = -y - 41, -70 = 5g + 4415y - 4419y for g. -18 Solve -3l - 1108219 + 1108224 = 4h, -5 = -l - 3h for l. -1 Solve a - 31 = 2z, -20a - a = -z - a - 620 for z. 0 Solve 0 = 5u + 22y + 804, 88u = -89u + 254u - 80u + 2y + 80 for u. 2 Solve -14o + 232 = 15o, -2906o + 35 = a - 2a + 2a - 2902o for a. 3 Solve -33k = -8k - 12b - 17b - 2b + 2149, 4k + 332 = 2b for k. -81 Solve -4l + 12018z - 204 = 12016z, -2l = 3z + 94 for l. -50 Solve -7024 = 2a - 7098, 2a - 49 = 5n for n. 5 Solve 5r + 2g = -21, 7099r - 21282r + 7091r = -7096r - 2g - 24 for r. 3 Solve 3a + 148622 = -2i + 148605, 2a + 16 = i for a. -7 Solve 2n + 72 = -n + 3d, -40012d - 58 = -4n - 40015d for n. -2 Solve 2b = m - 6496 + 6490, 5m - 11b - 2b = 45 for m. -4 Solve 3207l - 3205l - 3u + 59 = 0, 2l + 4l + 189 = 5u for l. -34 Solve -606311w = -606308w - 0l + 3l - 96, -3w + 5l + 120 = 0 for w. 35 Solve 4q - k = -73480826 + 73480859, -4k - 36 = 0 for q. 6 Solve -4f = 2j + 24, 0 = -98451f + 98455f - 4j + 12 for f. -5 Solve a + 0a - 5d = 57 - 126, 60a = d - 253 for a. -4 Solve -3r = 4p - 63 + 92, 2*	{ "pile_set_name": "DM Mathematics" }
- 60 = 0 for r. -6, -2, -1 Find b, given that -4b3 + 696b*2 - 30276b = 0. 0, 87 Factor -c*2/5 - 12c + 61/5. -(c - 1)(c + 61)/5 Factor -d2 + 66d - 1089. -(d - 33)*2 Factor -5c*3 + 1955c*2 + 3930c. -5c(c - 393)(c + 2) Solve 2l*3/19 + 108l*2/19 - 6l - 220/19 = 0. -55, -1, 2 Let -3z3 - 63z*2 - 405z - 825 = 0. What is z? -11, -5 Find l such that 3l3/2 - 57l*2/2 - 6l + 114 = 0. -2, 2, 19 Find s, given that -3s2 + 174s - 2523 = 0. 29 Factor 2h2/5 - 296h/5 + 294/5. 2(h - 147)(h - 1)/5 Suppose 8x5/9 + 22x*4/9 + 10x*3/9 - 4x*2/9 = 0. Calculate x. -2, -1, 0, 1/4 Suppose -21m*4/2 - 193m*3/6 + 311m*2/3 + 26m/3 - 20/3 = 0. Calculate m. -5, -2/7, 2/9, 2 Factor y*3 - 26y*2 + 64y + 1536. (y - 16)*2(y + 6) What is z in -2z2/13 + 44z + 1152/13 = 0? -2, 288 Factor -s*4/6 + 11s3/6. -s3(s - 11)/6 Factor -c4/3 - 3c3 + c2/3 + 35c. -c(c - 3)(c + 5)(c + 7)/3 What is u in u*5 + 164u*4 + 5854u*3 - 71340u*2 + 189225u = 0? -87, 0, 5 Factor -w*4 - 10w*3 + 32w*2 + 384w. -w(w - 6)(w + 8)*2 Find m, given that -5m*5 - 30m*4 + 230m*3 + 840m*2 - 225m - 810 = 0. -9, -3, -1, 1, 6 Find r, given that -2r3/3 - 14r*2/3 - 8r/3 + 8 = 0. -6, -2, 1 Suppose -4u3 - 156u*2 - 1056u + 9680 = 0. What is u? -22, 5 Factor -4r3 + 260r*2 + 536r. -4r(r - 67)(r + 2) Let v5 + 4v*4 - 8v*3 - 14v*2 + 7v + 10 = 0. What is v? -5, -1, 1, 2 Factor -q*3/4 - 29q*2/2 - 113q/4 - 14. -(q + 1)*2(q + 56)/4 Factor -21b4/8 - 93b*3/8 - 15b*2 - 9b/2. -3b(b + 2)*2(7b + 3)/8 Find i, given that 5i*3 - 50i*2 - 55i = 0. -1, 0, 11 Determine v so that -30v5 - 8v*4 + 168v*3 - 204v*2 + 86v - 12 = 0. -3, 1/3, 2/5, 1 Suppose h*4/7 - 18h*3/7 + 109h*2/7 - 36h + 28 = 0. Calculate h. 2, 7 What is m in -4m2/3 - 8m = 0? -6, 0 Determine m so that 3m5/5 - 3m*4/5 - 27m*3/5 + 3m*2 + 48m/5 - 36/5 = 0. -2, 1, 3 Factor 2v3/19 + 130v*2/19 - 544v/19 + 552/19. 2(v - 2)2(v + 69)/19 Suppose g*5/4 + 5g*4/2 + 2g*3 - 5g*2/2 - 9g/4 = 0. What is g? -9, -1, 0, 1 Suppose -42t5 + 177t*4 + 474t*3 - 132t*2 - 72t = 0. Calculate t. -2, -2/7, 0, 1/2, 6 Determine s, given that s*4/4 - 3s*2 + 4s = 0. -4, 0, 2 Factor -5y2 - 25y. -5y(y + 5) Determine s so that -2s2 - 468s - 27378 = 0. -117 Let 5c5 + 5c*4 - 15c*3 - 25c*2 - 10c = 0. Calculate c. -1, 0, 2 Factor -q*5/4 + 3q*4/4 + 9q*3/4 + 5q2/4. -q2(q - 5)(q + 1)*2/4 Let -2d*3/11 + 624d*2/11 - 49290d/11 + 96100/11 = 0. What is d? 2, 155 Factor -j*3 + 6j*2 + 40j. -j(j - 10)(j + 4) Find n such that -7n5/3 + 37n*4/3 - 22n*3 + 44n*2/3 - 8n/3 = 0. 0, 2/7, 1, 2 Suppose -2l5/11 - 46l*4/11 + 156l*3/11 = 0. Calculate l. -26, 0, 3 Let 2h*5 - 100h*4 - 222h*3 + 712h*2 + 856h - 1248 = 0. What is h? -3, -2, 1, 2, 52 Factor -4l3/3 - 64l*2/3 - 112l/3. -4l(l + 2)(l + 14)/3 Determine c so that 5c*4 + 25c*3 + 45c*2 + 35c + 10 = 0. -2, -1 Let 2r5/11 - 8r*4/11 + 28r*2/11 - 34r/11 + 12/11 = 0. Calculate r. -2, 1, 3 Factor -3p2/5 - 1647p/5 - 1644/5. -3(p + 1)(p + 548)/5 Suppose -2b2 - 964b - 116162 = 0. Calculate b. -241 Determine u so that -4u3 + 37796u*2 - 89302496u + 89264704 = 0. 1, 4724 Solve -5f5 - 62f*4/3 + 67f*3/3 + 10f*2/3 = 0 for f. -5, -2/15, 0, 1 Solve 2v*5 + 12v4 = 0. -6, 0 Determine j, given that -j3/2 + 19j2/2 - 35j = 0. 0, 5, 14 Factor 5i3 - 665i*2 - 1350i. 5i(i - 135)(i + 2) Factor 2r*2/3 - 962r/3 + 1916/3. 2(r - 479)(r - 2)/3 Determine b, given that 18b3 + 5100b*2 + 6776b + 2256 = 0. -282, -2/3 Factor 2z4/11 + 54z*3/11 + 390z*2/11 + 338z/11. 2z(z + 1)(z + 13)2/11 Factor p3 + 1121p*2 + 314720p + 313600. (p + 1)(p + 560)2 Factor -5z*2 + 170z - 840. -5(z - 28)(z - 6) Let -5y2 + 420y - 415 = 0. Calculate y. 1, 83 Suppose 5a2 - 920a + 1820 = 0. Calculate a. 2, 182 Factor -4q3 + 200q*2 - 548q - 752. -4(q - 47)(q - 4)(q + 1) Factor 3c*4 - 15c*3 - 54c*2 + 384c - 480. 3(c - 4)2(c - 2)(c + 5) Factor 4y*2/7 - 942y/7 + 1404/7. 2(y - 234)(2y - 3)/7 Let 12f*3 - 1749f*2 - 2223f + 2646 = 0. Calculate f. -2, 3/4, 147 Factor 3k3/4 + 1695k*2/4 + 241941k/4 + 710649/4. 3(k + 3)(k + 281)*2/4 Factor 3l*4/7 - 12l*3/7 - 3l*2 + 30l/7. 3l(l - 5)(l - 1)(l + 2)/7 Determine d so that 2d3/15 + 8d*2/15 - 74d - 780 = 0. -15, 26 Suppose -s*2/4 - 295s - 87025 = 0. Calculate s. -590 Let -6d5 - 4d*4 + 50d*3 + 56d*2 - 24d = 0. Calculate d. -2, 0, 1/3, 3 Let q*3/3 - 8q*2/3 - 3q + 24 = 0. Calculate q. -3, 3, 8 Factor 2m4 + 8m*3 + 6m*2. 2m*2(m + 1)(m + 3) Factor -2y*3 + 30y*2. -2y*2(y - 15) Let w*2 - 5w + 4 = 0. What is w? 1, 4 Factor 255c2 + 755c - 30. 5(c + 3)(51c - 2) Find m such that 3m*2 - 216m + 3888 = 0. 36 Suppose -4z5 + 24z*4 - 52z*3 + 48z*2 - 16z = 0. Calculate z. 0, 1, 2 Factor -y*2/4 + 115y/4 + 29. -(y - 116)(y + 1)/4 Factor -o3/4 - 203o*2/4 - 10403o/4 - 10201/4. -(o + 1)(o + 101)2/4 Factor 2f*5 - 10f*4 + 18f*3 - 14f*2 + 4f. 2f(f - 2)(f - 1)3 Factor -2w*3/3 + 1184w*2/3 + 2w/3 - 1184/3. -2(w - 592)(w - 1)(w + 1)/3 Find p, given that 5p*4 + 90p*3 - 120p*2 - 490p - 285 = 0. -19, -1, 3 Factor 2p4/11 - 1698p*3/11 + 480534p*2/11 - 45330374p/11. 2p(p - 283)*3/11 Solve -2k*3/13 - 44k*2/13 - 152k/13 - 144/13 = 0. -18, -2 Determine d, given that 2d2/5 - 204d/5 - 206/5 = 0. -1, 103 Find t such that 2t4 + 1268t*3 + 198418t*2 - 814088t = 0. -319, 0, 4 Factor v*4/4 + 91v*3/4 + 219v*2/2 + 173v + 86. (v + 1)(v + 2)2(v + 86)/4 Factor 5c4 - 65c*3 + 140c*2 + 1020c - 3600. 5(c - 6)2(c - 5)(c + 4) Factor 2d*4/9 + 16d*3/9 + 14d*2/3 + 4d. 2d(d + 2)(d + 3)2/9 Factor 2v*3/3 - 50v/3. 2v(v - 5)(v + 5)/3 Factor -5c*3/2 - 11c*2 + 17c/2 + 5. -(c - 1)(c + 5)(5c + 2)/2 Factor 5x*4 - 15x*3 + 10x*2. 5x*2(x - 2)(x - 1) Factor -j4/9 - j3/9 + 2j*2/3 + 4j/9 - 8/9. -(j - 2)(j - 1)(j + 2)2/9 What is n in -n5/6 + 58n4/3 + 361n*3/6 - 238n*2/3 = 0? -4, 0, 1, 119 Factor 5i*3 + 30i*2 + 55i + 30. 5(i + 1)(i + 2)(i + 3) Factor z2 + 3z - 18. (z - 3)(z + 6) Suppose -4i*5 + 4i*4 + 64i*3 - 64i2 = 0. What is i? -4, 0, 1, 4 Factor -t3/3 + 547t2/3 - 74528t/3 - 75076/3. -(t - 274)*2(t + 1)/3 Solve 3l4/2 - 82l*3/3 - 51l*2/2 + 64l - 38/3 = 0. -2, 2/9, 1, 19 Factor -3p2/7 + 90p - 4725. -3(p - 105)2/7 Factor 20j*3 - 1232j*2 - 5776j - 2112. 4(j - 66)(j + 4)(5j + 2) Suppose -2g4 + 72g*3 - 436g*2 + 888g - 522 = 0. What is g? 1, 3, 29 Factor 4w4 + 8w*3 - 48w*2 + 56w - 20. 4(w - 1)3(w + 5) Solve 5p2 - 490p + 12005 = 0. 49 Solve -2h5/7 - 482h*4/7 - 38396h*3/7 - 984636h*2/7 + 2086398h/7 - 1062882/7 = 0 for h. -81, 1 Determine l, given that 3l4/5 + 39l*3/5 - 42l2/5 = 0. -14, 0, 1 Find q, given that -q4/5 + 196q3/5 - 1840q*2 - 8000q = 0. -4, 0, 100 Solve 3i4/2 + 75i*3 + 1008i*2 + 1728i = 0. -24, -2, 0 Determine b, given that -9b5/5 - 33b*4/5 + 513b*3/5 - 591b*2/5 - 36b + 60 = 0. -10, -2/3, 1, 5 Let -2r2/7 - 132r/7 + 272/7 = 0. Calculate r. -68, 2 Let -3a4/2 - 21a*3 - 147a*2/2 = 0. What is a? -7, 0 Factor -2o*5 - 74o*4 + 1398o*3 - 8046o*2 + 19332o - 16848. -2(o - 6)(o - 3)*3(o + 52) Factor x*3 - 9x2. x2(x - 9) Factor 2p*5/7 - 2p*4 + 20p*3/7 + 36p*2/7 - 54p/7 - 54/7. 2(p - 3)3(p + 1)*2/7 Suppose 2u*2 + 208u + 408 = 0. Calculate u. -102, -2 Factor -2j3/13 + 120j*2/13 + 122j/13. -2j(j - 61)(j + 1)/13 Let -2u*2/5 - 2222u/5 + 4452/5 = 0. Calculate u. -1113, 2 Determine w so that w*4/3 + 11w*3 + 139w*2/3 - 11w - 140/3 = 0. -28, -5, -1, 1 Determine c, given that -2c5/11 + 24c*4/11 - 60c*3/11 + 56c*2/11 - 18c/11 = 0. 0, 1, 9 Let 2h5 + 308h*4 + 10202h*3 + 87080h*2 - 206008h + 108416 = 0. What is h? -112, -22, 1 Solve 2b3/11 + 62b*2/11 + 216b/11 - 2880/11 = 0 for b. -24, -12, 5 Factor 2k2/7 - 1872k/7 + 438048/7. 2(k - 468)2/7 Factor 2c**2/1	{ "pile_set_name": "DM Mathematics" }
tive of -2978058d3k + 2d3 + 3d*2 - d - 79 wrt k? -2978058d*3 What is the second derivative of 1309881k*4 + 157268k - 24? 15718572k2 Find the third derivative of -9dh3os - 756dh2 + 2dos - 361h3o + 62h3s*2 + 2h*2os - 2h*2s*2 - 3hos*2 + 5ho wrt h. -54dos - 2166o + 372s*2 Differentiate -29810393a*2t*4 + 622667209a*2 with respect to t. -119241572a*2t*3 What is the third derivative of 7835811m*3 + 13803795m*2? 47014866 Find the third derivative of 14054207v4 - v2 + 32180v + 4. 337300968v Differentiate 14149792m2w*2 - 3359829m*2 wrt w. 28299584m*2w What is the third derivative of 9338682g4 - 803g*2 + 10509g wrt g? 224128368g What is the first derivative of 7l*3xz3 - 12505350l*3x - 2l3z*3 - 3l*2z*3 - 1327l*2z*2 + 2092lz2 wrt x? 7l*3z*3 - 12505350l*3 Find the second derivative of 4c*2r + 4809871c2 - 250029951cr - 3r wrt c. 8r + 9619742 Differentiate -1335952386x - 660591668 wrt x. -1335952386 What is the second derivative of -377r5 - 866r*4 - 2r*3 - 5942155r? -7540r3 - 10392r*2 - 12r What is the derivative of -123391t4 + 2t*2 + 12569758 wrt t? -493564t*3 + 4t Find the third derivative of 26023293x4 - 2440044x*2 - x + 3. 624559032x Differentiate -3h3x - 628986h2x + h*2 - 4x + 6225698 with respect to h. -9h2x - 1257972hx + 2h What is the derivative of 72298f*4 - 25f*2 - 2f - 724795297 wrt f? 289192f3 - 50f - 2 Find the third derivative of 3p6 + 691789p*5 + 15266461p*2. 360p*3 + 41507340p2 Find the second derivative of -j2t2 - 189j*2t - 144j2 - 1401jt2 + 10jt + 3j + 445t2 + t - 1 wrt t. -2j*2 - 2802j + 890 Find the third derivative of -26923asu3 - 2asu + 6as + 431au*2 - 2au - 991su3 + 2su2 + 7su - s wrt u. -161538as - 5946s What is the derivative of -7087672n2y*4 + 2834n*2 - 983n + 4y4 wrt y? -28350688n*2y*3 + 16y*3 What is the second derivative of -4f*3 - 1640780f*2 - f - 36845566? -24f - 3281560 What is the third derivative of -56926c5 + 8c*4 + 6c*3 + 252493484c*2? -3415560c*2 + 192c + 36 Differentiate 2ik*2t - 318ik*2 - 2ik + 27927118it - 126k*2 + 344k with respect to t. 2ik*2 + 27927118i What is the derivative of 199009872a2 - a - 279607300 wrt a? 398019744a - 1 Find the third derivative of -60886015u6 - 1106397663u*2. -7306321800u*3 What is the derivative of 117o*3 + 71760o*2 - 26687230 wrt o? 351o*2 + 143520o Find the third derivative of -22197161w5 + 2w*4 - 269726w*2 - 470w. -1331829660w2 + 48w What is the first derivative of -5337777c3 + 9098912? -16013331c*2 What is the derivative of 446j*2 - 216j - 2021950? 892j - 216 What is the derivative of 7029z*4 - 3z*3 - 8z*2 + 4z - 14588823? 28116z3 - 9z*2 - 16z + 4 Differentiate 341q4 - 927q*2 + 4q + 4538012 with respect to q. 1364q3 - 1854q + 4 Find the third derivative of -3061790f3 - 388f*2 + 12f + 41 wrt f. -18370740 What is the third derivative of -148568247n3v*2 - 73845709n*2v*2 + 2v*2 wrt n? -891409482v*2 What is the second derivative of 275857g*3 + 48g*2p*3 - 202gp3 - 2gp2 - g - 8p*3 - 7p*2 + 5p wrt g? 1655142g + 96p*3 What is the second derivative of -6d*3j*3 - 23d*3 - 15519d*2j*2 + 131201dj - 22j*2 wrt j? -36d*3j - 31038d2 - 44 Differentiate -9755do3p + 622dop3 - 3o*3p*3 + 2o*3p - 306o2p*3 - 5op2 - 251p*3 with respect to d. -9755o*3p + 622op*3 What is the second derivative of -2p*3w + 3p3 - 435391p*2w - 1962194pw - 2p wrt p? -12pw + 18p - 870782w What is the third derivative of 29872j*3m*3 + 15j*3m - 84j3 + 26j*2m*3 + 3j*2m - 19j2 - 26jm3 + jm*2 - 83jm wrt j? 179232m*3 + 90m - 504 What is the third derivative of -56a3h*2u*3 + 30570a*3h*2u + 359a2h*2u + 32a2hu + 2h*2u*2 - hu*3 - 3u*3 wrt a? -336h*2u*3 + 183420h*2u What is the first derivative of j*2 - 195017591j - 275035575? 2j - 195017591 Find the third derivative of -4198d*5y + 10829d3py - d2py - 5d*2p - d*2 - 217dpy + 2dp + 3d + p wrt d. -251880d*2y + 64974py What is the second derivative of 11u2wx2 + 48u*2x*3 + 13967u*2 + 206uwx*3 + uwx2 + 2ux2 + 9113u + wx3 + 2w + x wrt u? 22wx*2 + 96x*3 + 27934 Find the third derivative of -7565469j*6 + 6403845j*2 wrt j. -907856280j*3 Find the third derivative of 414718bz3 + 376bz2 + 18bz + z4 + 715z*3 - 2z*2 + 438z wrt z. 2488308b + 24z + 4290 Find the third derivative of 11a2g*3 + 19a*2g*2 + 11119ag4 - 155ag2 - a - 8g*3 - 495g wrt g. 66a2 + 266856ag - 48 Find the second derivative of 565822781c*4 + 1049984985c wrt c. 6789873372c2 What is the second derivative of -6677bfx*2 + bfx - 990bf - bx*2 + 2bx - 11fx2 - 44fx + x2 + 4 wrt x? -13354bf - 2b - 22f + 2 Differentiate 29h*2p + 102h2 - 33hp - 9h - 88018648p wrt h. 58hp + 204h - 33p - 9 What is the derivative of -43133a*2 - 67a - 47144997 wrt a? -86266a - 67 Find the second derivative of -5276c*2q*3 + 22860c*2q*2 - 8c*2 + 5195cq + 11c + q wrt q. -31656c2q + 45720c2 What is the second derivative of 256383904i*2 - 654147356i wrt i? 512767808 Find the first derivative of -2i2o + 5i2 - 514io + 2588i - 195385644o wrt i. -4io + 10i - 514o + 2588 Differentiate -2iq2 + 3iq - 168013i + 1162q3 - 255q - 209 with respect to q. -4iq + 3i + 3486q*2 - 255 What is the second derivative of 2858251s*2 + 2832379s? 5716502 What is the third derivative of 214835816g3 - 9317g*2 + g + 9928 wrt g? 1289014896 What is the derivative of -26w*4 - 30257w*2 - 59w - 259674063? -104w3 - 60514w - 59 What is the derivative of 10055c2n - c*2 + 3cn - 2c + 1622n - 2757484 wrt n? 10055c*2 + 3c + 1622 What is the third derivative of 6f5k - 204f4k + 61f3s - 2f2ks - 23f*2k - 2f2s - 2f2 + 10fks + 14f - 85ks wrt f? 360f*2k - 4896fk + 366s Find the second derivative of 165605g*3o*2 + 5g*3 + 3g*2o*2 - go + 198o2 + 5969o - 2 wrt g. 993630go*2 + 30g + 6o2 What is the derivative of -169d*2 - 301689d + 382731222? -338d - 301689 What is the second derivative of -105676337b*4 - 3b*3 + 1458339195b? -1268116044b2 - 18b What is the first derivative of 4il + 9i - 99778963l + 2233449 wrt l? 4i - 99778963 Find the third derivative of 14985i*5 + 12713596i*2. 899100i*2 What is the third derivative of 94076l*4m + 8l3m*2 - 223376l*2m*2 + 5m wrt l? 2257824lm + 48m2 What is the third derivative of 2n*5 - 7992176n*4 - 4600694n*2 wrt n? 120n*2 - 191812224n Find the first derivative of 8585c2n*3 + 762c*2 - 6n*3 + 30849n*2 + 2n + 2 wrt c. 17170cn*3 + 1524c What is the derivative of 4j3 + 530792jz - 12879625z wrt j? 12j2 + 530792z What is the first derivative of -f*3x - 43f3 - 219674f*2 - 16857257x3 - 2 wrt x? -f3 - 50571771x2 Find the second derivative of 73918630v*2 + 212775881v. 147837260 Find the third derivative of 24018328f2s*3 + 22301f*2 - fs*2 + 2fs + 2s*2 + 2s - 1 wrt s. 144109968f2 Find the second derivative of -54685830o*2 - 3982452o - 17. -109371660 What is the second derivative of 175131bc*3 + 63bc2 - 177886705bc + 3c*4 wrt c? 1050786bc + 126b + 36c2 Find the first derivative of -1035mo3 + 42mo2 + mo + m - 8411o3 - 1575o wrt m. -1035o3 + 42o*2 + o + 1 Differentiate -26csz - 3cs - cz - 949c + 102821sz - 4s - 7z + 5812 wrt s. -26cz - 3c + 102821z - 4 Find the third derivative of -i*2u*2x*2 + 3i*2u*2x + 4i2x*3 - 3i*2x - 22974018iu*2x*3 + 24iu2x + 2u2x*2 + 6447u*2 wrt x. 24i*2 - 137844108iu2 Find the third derivative of 881304lm3 - lm*2 + 237l - 38m5 + 2m*2 - 1299m + 3 wrt m. 5287824l - 2280m*2 Find the second derivative of 127041326n**2 - 939448697	{ "pile_set_name": "DM Mathematics" }
+ 3 - 2l. What is the first derivative of j(w) wrt w? 2 What is the third derivative of -15b*4 - 2b*2 + 6b*3 - 10b*3 + 4b*3 wrt b? -360b Suppose 3n + 3 = 9. Suppose -5a = -3g - 39, 4g = -4a + 19 - 7. What is the third derivative of i6 + 5i*2 - 2i*a - 2i*n wrt i? -120i*3 Let i(v) = 2v*2 - 5v + 5. Let a be i(2). Find the first derivative of -5na - 6n*3 + 11n*3 - 3n*4 + 6 wrt n. -12n*3 Let f(s) be the second derivative of -13s*7/21 + 3s*4/2 + 26s. Find the third derivative of f(h) wrt h. -1560h2 Let a(k) be the third derivative of 0k*5 - 1/120k*6 + 0k + 1/24k4 + 0 + 0k*3 + 3k*2. Find the second derivative of a(r) wrt r. -6r Differentiate 17d - 68 + 30 + 62 wrt d. 17 Find the third derivative of -22p*3 - 16p*3 + 6p*4 + 32p*2 - 2p*4 + 50p*3 wrt p. 96p + 72 Find the third derivative of -3k3 + 22k*3 + 62 + 3k2 - 62 wrt k. 114 Let c(i) = i2 + i - 5. Let h be c(4). Suppose -3a = -0a - h. What is the third derivative of 0z2 - 4z2 + z5 + 3za wrt z? 240z*2 Find the second derivative of -6u*5 + 721 + 2u - 721 + 2u5 wrt u. -80u*3 Let a(w) be the third derivative of 13w8/336 - w4/24 + 13w3/6 - 39w*2. Find the second derivative of a(c) wrt c. 260c*3 Let g be 10/(-35) + 60/14. Find the second derivative of -9r - 4r4 + 3r*5 + 4r*g - 5r*5 wrt r. -40r*3 Let t(f) be the first derivative of 16f*5/5 + 8f*2 - 7. What is the second derivative of t(d) wrt d? 192d2 Let d(q) be the third derivative of -q2 + 0 + 0q - 1/8q*4 - 1/2q3. Differentiate d(u) wrt u. -3 Let u(n) = -n3 + 5n2 - 5n + 6. Let j be u(4). Differentiate 4 + 3x2 - xj - 5x*2 - 2x*2 wrt x. -10x Let k(t) = -t2 - 20. Let c(q) = -q2 - 19. Let l(x) = -6c(x) + 5k(x). What is the first derivative of l(i) wrt i? 2i Let g = 15 - 10. Let n = 7 - g. What is the third derivative of 0w2 - w2 - nw2 + w4 wrt w? 24w Let k(f) = -f - 1. Let g(p) = 8p - 3. Let a(j) = -g(j) - k(j). Differentiate a(u) with respect to u. -7 Differentiate -2c4 - c4 - 87 - 2c4 + 88 wrt c. -20c*3 Let j(h) be the second derivative of 29h*5/20 + 9h*2 - 41h. Differentiate j(z) wrt z. 87z2 Let w(g) = 40g*3 + 6g2 + 2. Let m(i) = i3 + i*2 + 1. Let x(d) = -6m(d) + w(d). Differentiate x(c) wrt c. 102c2 Find the second derivative of -5z*2 - 11z*2 - 7z*2 - 5z*2 - 13z wrt z. -56 Let p(b) be the second derivative of b9/5040 + b5/30 + 5b4/12 + 4b. Let a(h) be the third derivative of p(h). What is the derivative of a(y) wrt y? 12y3 Find the third derivative of 14y*3 - 9y2 - y2 - 2y2 wrt y. 84 Let r(w) be the third derivative of w8/56 + w4/3 - 5w*2. Find the second derivative of r(a) wrt a. 120a3 Let f(b) be the third derivative of -b6/24 + b*5/60 + 4b*2. Find the third derivative of f(n) wrt n. -30 Let h = 13 - 11. What is the third derivative of 4n2 - n - n - n3 + hn wrt n? -6 Let k = -53/5 - -54/5. Let b(q) be the first derivative of 0q + kq5 + 3/2q*2 + 0q*4 + 0q*3 - 4. Find the second derivative of b(u) wrt u. 12u2 Let x(f) be the third derivative of -f7/5040 - f6/720 - f5/30 + 2f2. Let t(z) be the third derivative of x(z). What is the derivative of t(s) wrt s? -1 Let o = -3 - -6. Suppose -ou = -7u. What is the second derivative of 5d*4 - 4d*4 + ud - 2d4 - d wrt d? -12d*2 Let f(j) be the third derivative of 3j*6/40 - 7j*4/12 + 5j*2. Find the second derivative of f(n) wrt n. 54n What is the third derivative of -21h2 + 22h*2 + 10h*5 + 22h*2 wrt h? 600h2 Let f(j) be the third derivative of -j9/504 + j*5/60 - 7j*2. Find the third derivative of f(y) wrt y. -120y*3 Let h(u) = -5u*2 - 8u - 2. Let y(m) = 21m2 + 33m + 9. Let r(a) = 9h(a) + 2y(a). What is the second derivative of r(w) wrt w? -6 Let i = -27 + 28. Let n(f) be the first derivative of 0f2 + f - 4/3f*3 - i. Find the first derivative of n(b) wrt b. -8b Find the third derivative of 77l2 - 60l*2 - 2l - 2l3 + 2l wrt l. -12 Let h(w) = 3w2 + 1. Let m be h(1). Suppose -m = -2d + 2. Find the second derivative of k*3 + 7k - 2k3 - 4k + 0kd wrt k. -6k Let m(g) be the first derivative of -6g5/5 + 3g*3 - 10. Find the third derivative of m(f) wrt f. -144f Let r = 7 + -4. Let l(z) = z*3 - 3z*2 + 2z - 4. Let o be l(r). What is the first derivative of oi + 3 - 4 - 2 wrt i? 2 Let u(g) = -2g*3 - 14g. Let i(d) = 9d3 + 57d. Let w(o) = 5i(o) + 21u(o). Find the second derivative of w(z) wrt z. 18z Let r(f) be the third derivative of -11f*8/336 - 7f*4/24 + 29f*2. What is the second derivative of r(u) wrt u? -220u*3 Suppose 0q + 4q + u = -3, -13 = -q - 3u. Let d be 12/(-15)5/q. What is the third derivative of 5g2 - g2 - dg6 - 2g*6 wrt g? -480g3 Let z(n) be the second derivative of -n4/4 - n3/3 - n2 + n. Let d(v) be the first derivative of z(v). Differentiate d(p) with respect to p. -6 Let u(v) be the first derivative of 0v - 3/2v*2 - 4 - 10/3v*3. What is the second derivative of u(w) wrt w? -20 Let y(u) be the third derivative of 7u6/120 - u5/10 - 8u2. Find the third derivative of y(f) wrt f. 42 Let h be -3 - (-5 - (-6 + 4)). Let k(y) be the third derivative of 1/60y*5 + hy*3 + 1/12y4 - y2 + 0 + 0y. Find the second derivative of k(v) wrt v. 2 Let k(n) be the third derivative of -1/8n*4 + 0n*3 + 0 + 3n*2 + 1/120n*6 + 0n + 0n5. Find the second derivative of k(p) wrt p. 6p Suppose 0b = -b. Let q(d) be the second derivative of -1/12d*4 - 1/6d*3 + 0 + d + bd*2. What is the second derivative of q(c) wrt c? -2 Let d(j) = -16j*4 + 5j*2 - 18j + 5. Let o(c) = 15c4 - 4c*2 + 18c - 4. Let n(g) = 4d(g) + 5o(g). Find the second derivative of n(b) wrt b. 132b2 Let d = 12 - 10. What is the third derivative of 4f*4 - 3f*4 - 2f*d + 2f*4 wrt f? 72f Differentiate -22g + 5 - 7g + 36g wrt g. 7 Let l = -27 - -30. Differentiate 5r2 - l + 2 - r2 - 2 wrt r. 8r Let o(a) be the third derivative of 1/12a*4 + 1/15a*6 + 0a*3 + 0a + 3a2 + 0a*5 + 0. Find the second derivative of o(j) wrt j. 48j Let j(h) = 11h3 + 11h*2 - 22h - 11. Let s(o) = 5o3 + 6o*2 - 11o - 6. Let y(w) = 6j(w) - 11s(w). What is the second derivative of y(u) wrt u? 66u Let v(m) = -17m*4 - 6m - 5. Let n(q) = -18q4 - 7q - 6. Let x(y) = 5n(y) - 6v(y). Find the second derivative of x(j) wrt j. 144j2 Let k(u) be the third derivative of -7u*6/60 - 25u*4/24 - 27u*2. What is the second derivative of k(o) wrt o? -84o Let z(s) = -12s2 - 7s. Let w(g) = 6g2 + 4g. Let j(x) = 5w(x) + 3z(x). What is the second derivative of j(n) wrt n? -12 Let f(r) be the second derivative of -7r5/20 - 5r*3/6 - 3r. Find the second derivative of f(i) wrt i. -42i Let l = -5 - -6. Differentiate 5f + 2 - 1 + 1 - l with respect to f. 5 Suppose -2w + 12 = -2f, 3f - 7 = 5w - 27. Let m = 8 + f. What is the third derivative of 0x2 - 5x*2 - mx*3 + 4x*3 + 3x*2 wrt x? 6 Let r be 8/((-3)/((-3)/2)). Let f = r + -1. What is the second derivative of -3j4 + j4 - fj + 4j wrt j? -24j2 Let u(s) be the third derivative of 1/24s*6 + 0s*4 + 0 + 0s*5 - 8s*2 + 0s + 5/6s3. What is the derivative of u(j) wrt j? 15j*2 Let q = -4 + 7. Suppose qm - 12 = -3r, 5m - 26 = -4r - 10. Differentiate 4u*4 + 0u*4 - r + 1 wrt u. 16u*3 Let v be (8/12)/((-4)/66). Let g = -6 - v. Find the third derivative of -5x*2 + 0x*2 + 0x*2 + 2x*2 - 4x*g wrt x. -240x*2 Suppose 6 + 6 = 6j. Let c(h) be the first derivative of 1/2h4 + 0h*j - 1/3h*3 + 0h + 2. What is the third derivative of c(u) wrt u? 12 Let l(j) be the first derivative of -31j2/2 - 32j + 47. Find the first derivative of l(v) wrt v. -31 Suppose 15 = 9v - 6v. Find the second derivative of -3g - 5g - g*2 - 2g*2 + vg wrt g. -6 Suppose -7 - 11 = -3a. Find the third derivative of -9 + 3 + c6 + a + 3c*2 wrt c. 120c3 Let h(i) be the third derivative of -i5/15 + 29i4/24 - 17i*2. Find the second derivative of h(j) wrt j. -8 Let i = 3 + -3/2. Let d(p) be the first derivative of 2p -	{ "pile_set_name": "DM Mathematics" }
? True Is 1111290 a multiple of 170? True Does 18 divide 169686? True Does 14 divide 1569064? True Is 96 a factor of 144864? True Does 2 divide 272880? True Is 6947160 a multiple of 22? True Is 6 a factor of 560658? True Is 92 a factor of 39468? True Is 15 a factor of 460635? True Is 154 a factor of 188532? False Does 10 divide 1549520? True Is 878478 a multiple of 64? False Does 28 divide 59803? False Does 40 divide 8683745? False Does 782 divide 2105144? True Is 180 a factor of 2309760? True Does 1249 divide 1530083? False Does 44 divide 77044? True Is 134 a factor of 309674? True Does 99 divide 6158493? True Is 51 a factor of 20604? True Is 8 a factor of 90982? False Does 294 divide 3353070? True Does 29 divide 11656840? True Is 11 a factor of 6534057? False Does 117 divide 892011? False Is 1300351 a multiple of 13? True Is 189 a factor of 485163? True Is 36 a factor of 161773? False Is 41 a factor of 146821? True Is 354820 a multiple of 314? True Does 60 divide 143460? True Is 67 a factor of 2982873? False Is 18404329 a multiple of 1547? False Is 870 a factor of 356700? True Is 118 a factor of 4409163? False Does 72 divide 245215? False Is 2873187 a multiple of 267? True Does 331 divide 7105683? False Is 2117646 a multiple of 142? True Does 13 divide 78421? False Is 23 a factor of 23966? True Is 93193 a multiple of 41? True Is 9 a factor of 686322? True Does 1045 divide 2870615? True Does 1202 divide 3467459? False Does 16 divide 747584? True Does 444 divide 172272? True Is 8 a factor of 302009? False Is 2 a factor of 10013? False Does 18 divide 22212? True Is 157 a factor of 4799019? True Does 433 divide 794988? True Is 33 a factor of 144520? False Is 4 a factor of 11548? True Is 97 a factor of 1305? False Does 650 divide 4349800? True Does 275 divide 719290? False Is 40742 a multiple of 13? True Is 11 a factor of 428285? True Is 34 a factor of 518908? True Does 17 divide 514641? True Does 79 divide 474208? False Does 12 divide 1284367? False Is 147 a factor of 1122933? True Is 25 a factor of 202725? True Is 46639 a multiple of 67? False Is 41 a factor of 1749195? False Is 95612 a multiple of 82? True Is 891480 a multiple of 184? True Is 244952 a multiple of 5? False Is 855 a factor of 2178565? False Is 95648 a multiple of 16? True Is 691086 a multiple of 222? True Is 997277 a multiple of 83? False Is 30 a factor of 25609? False Is 3778434 a multiple of 99? True Is 6409464 a multiple of 174? True Does 105 divide 455903? False Is 244874 a multiple of 25? False Is 4460616 a multiple of 856? True Does 60 divide 78480? True Is 8612212 a multiple of 989? True Is 1211868 a multiple of 441? True Is 587007 a multiple of 9? True Is 12 a factor of 3669384? True Is 360 a factor of 5051880? True Is 205 a factor of 3807947? False Is 4 a factor of 99735? False Is 3 a factor of 24429? True Does 497 divide 418971? True Is 1097248 a multiple of 17? True Does 69 divide 31898? False Does 31 divide 233492? True Is 19 a factor of 145597? True Is 352625 a multiple of 160? False Is 88 a factor of 24200? True Is 15524 a multiple of 21? False Is 97 a factor of 16708291? False Is 5411966 a multiple of 1099? False Is 32 a factor of 4101056? True Is 2331876 a multiple of 13? False Does 24 divide 73800? True Is 428279 a multiple of 142? False Is 33096 a multiple of 17? False Is 2 a factor of 89884? True Does 110 divide 57642? False Does 26 divide 10394696? True Is 1451 a factor of 11727845? False Is 127 a factor of 161671? True Does 32 divide 61546? False Is 18 a factor of 1280592? True Is 3048668 a multiple of 28? True Is 16 a factor of 543680? True Does 103 divide 1443659? False Is 65076 a multiple of 187? True Is 459 a factor of 177021? False Is 23 a factor of 3975044? True Is 62 a factor of 296360? True Does 16 divide 157216? True Does 122 divide 2932856? False Is 157 a factor of 2639798? True Is 2114238 a multiple of 426? True Is 9 a factor of 8889? False Is 51 a factor of 1894956? True Does 118 divide 1534354? True Is 9834267 a multiple of 111? True Does 15 divide 660018? False Is 6626956 a multiple of 196? True Does 76 divide 841852? True Is 1746288 a multiple of 201? True Is 46 a factor of 22788078? True Is 32 a factor of 1277826? False Is 5 a factor of 545785? True Is 79991 a multiple of 30? False Does 959 divide 1528646? True Is 500916 a multiple of 228? True Is 8 a factor of 441944? True Does 1211 divide 5649077? False Does 13 divide 5459636? True Is 3551616 a multiple of 144? True Is 336 a factor of 7243967? False Is 9217895 a multiple of 451? False Is 1713361 even? False Is 3552854 a multiple of 10? False Does 241 divide 559374? False Does 68 divide 138008? False Is 287 a factor of 566731? False Is 3301650 a multiple of 319? True Is 13 a factor of 775285? False Does 234 divide 1437868? False Is 7 a factor of 816491? False Is 1170589 a multiple of 80? False Is 235184 a multiple of 42? False Is 9 a factor of 36999? True Is 9 a factor of 1176318? True Is 153 a factor of 434979? True Is 5022225 a multiple of 153? True Is 20 a factor of 141300? True Does 30 divide 285120? True Is 136 a factor of 586138? False Does 87 divide 444043? False Does 21 divide 18159771? True Is 2175656 a multiple of 47? False Is 80 a factor of 181520? True Is 291031 a multiple of 4? False Is 140420 a multiple of 295? True Is 4757348 a multiple of 17? True Does 5 divide 63771? False Is 37 a factor of 224183? True Is 103 a factor of 1368355? True Does 25 divide 3610126? False Does 710 divide 802300? True Is 562950 a multiple of 90? True Is 4421544 a multiple of 24? True Does 36 divide 297432? True Does 208 divide 166981? False Is 8573818 a multiple of 121? True Is 309 a factor of 201204? False Is 153 a factor of 5423513? False Is 213 a factor of 15906738? False Is 220746 a multiple of 6? True Is 1818193 a multiple of 315? False Is 290 a factor of 296035? False Is 5333598 a multiple of 1791? True Does 579 divide 5756418? True Does 198 divide 1935108? False Does 37 divide 825914? True Is 1236 a factor of 9762190? False Is 279052 even? True Does 255 divide 5238155? False Does 27 divide 4183596? True Is 450089 a multiple of 556? False Is 16 a factor of 132336? True Is 166630 a multiple of 24? False Is 58112 a multiple of 34? False Is 17 a factor of 6786? False Does 19 divide 277248? True Is 30869141 a multiple of 18? False Is 10 a factor of 419445? False Is 59 a factor of 1855686? False Does 206 divide 113484? False Is 525454 a multiple of 16? False Does 176 divide 3625433? False Is 52160 a multiple of 3? False Does 27 divide 183222? True Is 23 a factor of 82156? True Does 76 divide 20399692? True Is 23 a factor of 1719994? False Does 131 divide 6006874? True Does 359 divide 562774? False Is 240112 a multiple of 16? True Does 1060 divide 7133800? True Is 106151 a multiple of 10? False Is 631 a factor of 480822? True Does 183 divide 1019502? False Is 235532 a multiple of 1111? True Does 5 divide 270938? False Does 37 divide 304196? False Does 6 divide 782449? False Is 24 a factor of 302544? True Is 1950 a factor of 20000903? False Does 17 divide 10353239? False Is 3156390 a multiple of 765? True Does 15 divide 21966? False Does 73 divide 7415486? True Is 14605089 a multiple of 131? False Is 2948 a multiple of 44? True Is 8 a factor of 11385? False Does 18 divide 450648? True Is 297 a factor of 3984552? True Is 15 a factor of 119730? True Does 57 divide 346959? True Does 954 divide 953939? False Is 7 a factor of 3700349? False Is 40 a factor of 2490980? False Is 11735367 a multiple of 163? False Does 533 divide 282786? False Does 11 divide 974699? True Is 5 a factor of 32737? False Does 293 divide 961919? True Does 824 divide 1491440? True Does 170 divide 938570? True Is 273048 a multiple of 248? True Is 335160 a multiple of 152? True Is 317913 a multiple of 36? False Is 23 a factor of 98053? False Is 1047 a factor of 3545868? False Does 35 divide 175394? False Is 38 a factor of 4870612? True Is 3238637 a multiple of 23? False Is 1604226 a multiple of 786? True Is 41691 a multiple of 4? False Is 74 a factor of 33374? True Is 375951 a multiple of 37? False Does 16 divide 4739072? True Is 197730 a multiple of 507? True Is 50 a factor of 2442726? False Does 6 divide 334664? False Does 77 d	{ "pile_set_name": "DM Mathematics" }
4.13856? 277.655424 Product of 86.4919 and -0.082. -7.0923358 Work out 2583.3 * -54.545. -140906.0985 What is the product of -250 and 15.036? -3759 What is the product of -0.001743 and -1451? 2.529093 Multiply -7 and 331401.94. -2319813.58 -10 * -6690052 66900520 Multiply -1755.313 and -16. 28085.008 0.2 * -25191605 -5038321 1729774592 1339269568 -0.3259 times 0.72181 -0.235237879 -66428796 -19120544 What is 6.792314 times -7? -47.546198 -1999 times -562918 1125273082 0.2 times -1159942 -231988.4 -109.93 * -13.54 1488.4522 What is 0.726315155 times 0? 0 87913-3.42 -300662.46 Multiply -251066 and 558. -140094828 Calculate -0.077189-0.0282. 0.0021767298 -0.00928359660.4 -0.00371343864 What is 2 times -3406.09007? -6812.18014 Multiply 9004057 and 0. 0 -0.631565 0.115 -0.072629975 What is -7381144 times 17? -125479448 Multiply 0.3 and -34.281767. -10.2845301 What is the product of -302475 and -65? 19660875 What is -4733 times 1896? -8973768 Multiply 240234 and 29. 6966786 61916-579 -35849364 623.786293 182769.298 Work out 1196 * -6.0101. -7188.0796 Product of -1177.4064 and -12. 14128.8768 What is the product of -21180 and 107.8? -2283204 What is the product of -10 and 0.0618511? -0.618511 Work out -0.14731 * -162. 23.86422 Product of 0.715861923 and 0.3. 0.2147585769 -4 * -3.69921 14.79684 Work out 4 * -751.7994. -3007.1976 Multiply 21 and -91199.9. -1915197.9 -145 times 1297.2 -188094 Calculate 59652-24.58. -1466246.16 Product of 2.1766 and -3459. -7528.8594 0.2200388-34 -7.4813192 What is -100.6 times -118.13? 11883.878 What is the product of 90611540 and -0.5? -45305770 -0.03013378 * -22 0.66294316 Product of -652639 and -7. 4568473 Calculate 0.12606-239. -30.12834 Product of -120.231996 and -6. 721.391976 What is -0.006377896 times 0? 0 Product of 3 and -12978525. -38935575 Product of -0.4 and -0.2254704. 0.09018816 Calculate -276537.612. -553075.22 What is 0.9554 times -2652? -2533.7208 Work out -140 * 115912. -16227680 Calculate 0.029966-1.7. -0.0509422 What is 402 times -3525? -1417050 Calculate 1.790.030331. 0.05429249 Product of -107426 and -3941. 423365866 Calculate -0.10.61826487. -0.061826487 -834111 -0.141 117609.651 Multiply 0 and -6019.553. 0 Multiply -0.092 and 23451.2. -2157.5104 -114 * 0.0131371 -1.4976294 Calculate 8011.5562. 16023.112 What is the product of -15117303 and 0.1? -1511730.3 Calculate 6.398351-0.2. -1.2796702 Multiply 6440702 and 0.02. 128814.04 0.022694122 53882.44 Multiply 2.85 and -0.801. -2.28285 4 times -43598.21 -174392.84 Work out -86.2 101. -8706.2 What is the product of 5.1547 and 0.56? 2.886632 Product of 51.89 and -131.45. -6820.9405 Multiply 566137522 and -0.4. -226455008.8 -27804589 -12757420 Work out -75 51308. -3848100 What is the product of 2 and -293112672? -586225344 Product of -545.9586 and 0.5. -272.9793 18366 times 47 863202 618618708 115727688 -6.9031 0.1373 -0.94779563 Multiply -493 and -0.10357. 51.06001 Calculate -522535318. -112676590 What is -0.981 times -495? 485.595 -1-7.90173 7.90173 Multiply 0.05 and -53.13921. -2.6569605 What is the product of 0.5 and -3882718? -1941359 Work out -0.068634 * 5. -0.34317 Calculate 0.5-18.885147. -9.4425735 What is the product of 7670067 and -24? -184081608 What is 65365 times 553? 36146845 What is the product of -9 and 0.011245872? -0.101212848 -213 times 0.4267 -90.8871 -0.52673-7042 3709.23266 -0.1 times 2699540 -269954 -6 * 27508511 -165051066 Calculate 0.2-1761.934. -352.3868 341.421 -368 -125642.928 3-0.877484 -2.632452 Calculate 2241-53.8. -120565.8 What is the product of 9077738 and -0.5? -4538869 Work out -10 * -0.1147044. 1.147044 What is the product of 221 and 166? 36686 What is -3 times 2136608? -6409824 0.256 times 8.692 2.225152 Product of 41.69 and 0.126601. 5.27799569 What is the product of -793 and -660371? 523674203 Multiply 2 and 450847.13. 901694.26 0 times -5376248.1 0 695209.2-0.1 -69520.92 Work out -2955 0.15. -443.25 Product of -49686542 and 0. 0 4 times -5278878 -21115512 What is the product of 27703.23 and 4? 110812.92 Product of -11739 and -220.66. 2590327.74 Product of -4.8 and 73.754. -354.0192 Multiply 0.041288502 and 0. 0 0.3-3517757 -1055327.1 Calculate -6.2-332132. 2059218.4 -65 * 349585 -22723025 Multiply -105.12 and -670. 70430.4 What is -6 times -13802053? 82812318 Multiply 0.2 and -38049879. -7609975.8 Product of -105.5 and 5.9041. -622.88255 -0.05320.2062 -16.01031 Work out 28298283 -0.09. -2546845.47 What is the product of -0.4 and 96.853? -38.7412 0.06166578-1 -0.06166578 Calculate 3-2050202. -6150606 -335910 times -650 218341500 138954 * 28 3890712 1322678 * -0.87 -1150729.86 Calculate -11886520. -6180720 What is the product of -14654.9 and -57? 835329.3 What is -0.3 times -103665383? 31099614.9 Multiply -20381 and 17775. -362272275 What is the product of 61369080 and 1? 61369080 Calculate -22016871. -2201687 -18617-0.0159 296.0103 -0.2 times 963639.4 -192727.88 7.19309 -0.087 -0.62579883 142231.3 * -213 -30295266.9 0.164601 * -1038 -170.855838 What is the product of 3026.416 and 0.5? 1513.208 1830.8 * 2951 5402690.8 What is -604 times 1042820? -629863280 -34-2.71224 92.21616 Multiply -176.64 and -161. 28439.04 -0.8246-48 39.5808 What is 6 times -19804542? -118827252 Multiply -739 and 49282. -36419398 Product of 11575.1 and -0.04. -463.004 Calculate 48618-7.98. -387971.64 Calculate 83.253-802. -66768.906 Product of -2504.4 and -645. 1615338 -122115.37 -25384.44 -2292950.091 -20865.845 Calculate -47-2482915. 116697005 What is 0.02 times -0.32747809? -0.0065495618 19528021 15656992 Calculate 0.3-9.3278063. -2.79834189 689877489 0 0 2-368.8478 -737.6956 Product of 48417 and 208. 10070736 What is the product of -89762 and 105.3? -9451938.6 -14362872 -2 28725744 Calculate 0.4-39.284541. -15.7138164 What is the product of -2 and -25.65967? 51.31934 Multiply -381 and 0.4069. -155.0289 -2406.71.36 -3273.112 -0.5 times 0.00219874 -0.00109937 Work out -509 * -707328. 360029952 -13-4008982 52116766 -4 -4.05268 16.21072 What is 307 times 0.286? 87.802 Product of 0.0241 and 0.01429. 0.000344389 What is the product of -1448 and 1163? -1684024 Work out -242.34 * 0.0371. -8.990814 What is the product of -0.09 and 139.0479? -12.514311 Work out -113 * -7168.07. 809991.91 Work out -11329 * 597. -6763413 19-0.614639 -11.678141 -9785084 -0.5 4892542 690758483 403942081 What is the product of 3 and 14.079? 42.237 Multiply -1139615 and -0.0349. 39772.5635 Multiply 0.5 and 15958.11. 7979.055 Calculate -538.7-43782. 23585363.4 What is the product of -42 and 0.0912794? -3.8337348 109771 times -0.05148 -5651.01108 Multiply -49573 and -278. 13781294 Multiply -22526215 and -0.3. 6757864.5 What is the product of -20.413 and 138? -2816.994 What is -2471681 times 141? -348507021 -1461.384 times 8 -11691.072 Product of 2 and -0.23633614. -0.47267228 What is -1.9 times -1143.97? 2173.543 What is 8782029 times 6? 52692174 -2685 times -26 69810 Calculate -1-32144807. 32144807 Multiply -0.9 and -451290. 406161 -3 2141114 -6423342 What is 241166 times 127? 30628082 What is the product of -7349 and -504? 3703896 Calculate 4-16113134. -64452536 Product of 2 and 1569484. 3138968 -0.13642796 -364279.6 Work out 28342426 * -0.3. -8502727.8 -0.1 times -9330184 933018.4 Calculate 2.274185538. 421913.412 Calculate -0.192245129. -5.5751079 Product of 2000.653 and -0.1. -200.0653 -538724 times -15 8080860 What is the product of -2 and 36912417? -73824834 Calculate 159509147-2. -319018294 -191030.22 5.1 -974254.122 -0.21-2256709 473908.89 105663099 56630990 Multiply -0.33 and 6113938. -2017599.54 3 times 34580038 103740114 206935408 * 4 827741632 What is the product of 0.1 and 3632352? 363235.2 What is -1715 times -4.818? 8262.87 Calculate -39545-400. 15818000 2 times -20025750 -40051500 -62199650.18 -1119593.7 Product of -47 and -284452. 13369244 -2.143-673 1442.239 Work out -0.1 526712. -52671.2 Product of -0.02703 and 0.1456. -0.003935568 Calculate 33.6033-1.3. -43.68429 What is the product of -26 and -5341306? 138873956 Work out -0.06 4422818. -265369.08 -503133112 * -3 1509399336 Product of 0.52287 and -345. -180.39015 Calculate -7635.8*-30. 229074 -1483383	{ "pile_set_name": "DM Mathematics" }
59). -6 Let q(d) = -d*3 - 140d*2 - 27d - 3779. What is q(-140)? 1 Let x(d) = -5d3 - 21d*2 + 19d + 38. Determine x(5). -1017 Let l(k) = 95k + 6538. Determine l(-69). -17 Let c(k) = 44k3 + k2 + 450k - 452. Give c(1). 43 Let t(y) = y3 - 21y*2 + 79y - 12. What is t(4)? 32 Let h(n) = -n*3 + 99n*2 - 892n + 193. What is h(89)? 15 Let v(g) = 3g2 - 4840g - 24196. Give v(-5). 79 Let w(y) = -6y2 + 2y - 33. Give w(-8). -433 Let f(p) = -p*3 + 11p*2 + 53p - 361. Give f(13). -10 Let f(m) = 40m + 634. Give f(-17). -46 Let r(a) = -624a - 10. Give r(0). -10 Let l(y) = -12y + 343. What is l(22)? 79 Let b(m) = -6m*2 - 30m + 9. What is b(-4)? 33 Let z(w) = -w*3 - 26w*2 - 61w + 979. What is z(-21)? 55 Let r(a) = a*3 - 5a + 229. Calculate r(0). 229 Let t(s) = s*3 - 81s*2 - 346s - 28. Determine t(-4). -4 Let q(s) = -70s2 - 91s - 7. Determine q(0). -7 Let z(g) = -2374g + 9458. Determine z(4). -38 Let q(w) = w3 - 2w*2 - 24w - 66. Calculate q(8). 126 Let q(t) = 70t + 10638. What is q(-152)? -2 Let b(w) = 28w + 116. Give b(-6). -52 Let t(w) = w*3 - 49w*2 + 133w + 227. Determine t(46). -3 Let b(a) = 2a3 - 14a*2 + 51a - 298. Calculate b(7). 59 Let l(x) = -12x2 + 254x - 36. Calculate l(21). 6 Let k(j) = j*2 - 51j + 679. What is k(35)? 119 Let p(i) = -i*3 - 21i*2 - 300i - 7966. Determine p(-23). -8 Let z(k) = 12k - 13. What is z(1)? -1 Let t(b) = -4b*3 - 30b + 107. What is t(4)? -269 Let v(d) = -2d3 - 13d*2 - 5d + 59. Give v(-5). 9 Let q(n) = 108n - 5932. Give q(55). 8 Let d(y) = 81y - 84. Determine d(0). -84 Let d(t) = t*2 - 169t - 2888. What is d(-16)? 72 Let o(r) = r*3 - 23r*2 - 7r - 70. Calculate o(23). -231 Let y(s) = -487s - 261. Calculate y(-3). 1200 Let y(k) = 6k*2 + 71k + 213. Calculate y(-5). 8 Let s(k) = -6k2 + 5k + 13. Give s(4). -63 Let m(h) = -h*2 + 185h - 3831. What is m(161)? 33 Let b(k) = -7k2 + 261k - 1338. What is b(31)? 26 Let m(l) = 2l3 + 20l*2 + 6l - 21. Give m(-8). 187 Let z(m) = -823m - 20578. What is z(-25)? -3 Let n(o) = -o2 - 18o + 432. What is n(-31)? 29 Let n(l) = l*3 + 14l*2 - 34l + 1. Calculate n(2). -3 Let g(l) = l*2 - 12l - 89. Determine g(18). 19 Let b(h) = -84h2 - 3h + 1. What is b(-1)? -80 Let s(l) = 765l + 3096. What is s(-4)? 36 Let t(r) = -539r + 1214. Determine t(2). 136 Let x(h) = h*3 - 26h*2 + 46h + 67. Determine x(24). 19 Let r(l) = -410l - 34026. Determine r(-83). 4 Let t(g) = -16g + 48. Give t(3). 0 Let s(b) = 18b2 + 668b + 98. Calculate s(-37). 24 Let h(j) = j*3 - 33j*2 + 20j + 378. Give h(32). -6 Let v(j) = -2j3 + 145j*2 - 215j + 164. Calculate v(71). 22 Let b(g) = 2485g - 7494. Determine b(3). -39 Let p(o) = o2 - 81o + 447. Give p(6). -3 Let l(p) = 2p3 - 5p*2 + 2p - 15. Give l(4). 41 Let k(j) = -j*3 + 58j*2 + 59j - 24. Determine k(59). -24 Let c(r) = -20r3 + 6r*2 - 15r + 13. Give c(3). -518 Let d(k) = 2k2 + 119k - 169. Calculate d(-61). 14 Let i(u) = -u*3 + 34u*2 - 62u - 225. Calculate i(32). -161 Let o(a) = -183a2 - 1264a + 135. Give o(-7). 16 Let k(s) = s*2 + 31s - 3637. Determine k(47). 29 Let p(b) = b*3 - 18b*2 - 248b + 21. What is p(-9)? 66 Let m(i) = i*3 + 7i*2 + 50i + 451. Calculate m(-8). -13 Let p(y) = 23y3 - 208y*2 + 5y + 17. What is p(9)? -19 Let x(l) = -2l2 + 183l - 718. What is x(4)? -18 Let l(y) = -17y2 + 41y + 1134. Calculate l(-7). 14 Let y(k) = 474k - 1894. What is y(4)? 2 Let j(y) = 3y*3 - 73y*2 + 29y + 109. Give j(24). 229 Let d(k) = -k*3 - 30k*2 - 192k - 50. What is d(-13)? -427 Let q(c) = -241c2 + 11806c + 148. Calculate q(49). 1 Let y(w) = -w*3 + 64w*2 - 188w + 146. Determine y(61). -159 Let b(i) = -11i - 501. Determine b(-49). 38 Let x(l) = 603l + 2422. Calculate x(-4). 10 Let r(a) = -2a2 - 207a + 1286. What is r(6)? -28 Let m(n) = 3n3 + 15n*2 + 7n - 27. What is m(-4)? -7 Let y(r) = -r*3 - 15r*2 - 36r - 42. Give y(-11). -130 Let p(h) = -15h3 - 195h*2 - 231h - 3002. Calculate p(-13). 1 Let f(w) = -w*3 + 114w*2 - 2770w + 65. Calculate f(79). -330 Let p(o) = -33o + 257. What is p(9)? -40 Let f(n) = 640n + 7060. Determine f(-11). 20 Let b(h) = h*2 - 90h + 812. Calculate b(10). 12 Let t(b) = b*2 + 10b - 128. What is t(13)? 171 Let w(c) = -124c + 4832. Calculate w(39). -4 Let u(b) = 14b*2 - 50b - 22. Calculate u(7). 314 Let g(k) = k*2 + 2k - 18. Calculate g(-13). 125 Let h(i) = -3i3 - 44i*2 - 168i - 38. Calculate h(-7). 11 Let l(s) = 2s2 - 81s + 446. Determine l(6). 32 Let y(r) = 153r - 5641. What is y(37)? 20 Let r(g) = 100g*2 + 504g - 3. Give r(-5). -23 Let l(u) = -396u3 - u2 + u + 4. What is l(-1)? 398 Let s(l) = 284l*2 - 2275l + 17. What is s(8)? -7 Let h(m) = -m*3 - 34m*2 + 42m + 254. What is h(-35)? 9 Let d(q) = 334q + 50778. Give d(-152). 10 Let a(x) = -x3 - 21x*2 - 43x + 65. Calculate a(-20). 525 Let s(x) = -2x2 + 1169x - 3496. Calculate s(3). -7 Let h(y) = 4y2 - 131y - 109. Determine h(35). 206 Let d(y) = y*3 - 2y*2 + 28y - 102. What is d(4)? 42 Let h(a) = 29a2 - 542a - 69. Give h(19). 102 Let m(r) = 15r - 47. Determine m(7). 58 Let n(u) = -49u - 1517. Give n(-31). 2 Let s(m) = m*3 + 12m*2 + 17m + 28. What is s(-11)? -38 Let p(a) = -2112a + 16902. Determine p(8). 6 Let t(d) = -d2 + 837d - 84245. What is t(117)? -5 Let b(l) = -3l3 - 30l*2 + 26l - 72. Determine b(-11). 5 Let l(v) = v*3 + 180v*2 - 365v - 194. Give l(-182). -12 Let b(h) = h*2 - 508h + 24911. Determine b(55). -4 Let y(m) = -15m2 + 20m + 193. Calculate y(-3). -2 Let m(p) = p*3 + 5p*2 + 2p - 21. Determine m(-3). -9 Let r(s) = -102s - 6016. Calculate r(-59). 2 Let n(t) = 35t + 368. Determine n(-14). -122 Let u(q) = q*3 + 6q*2 - 5q - 152. Determine u(0). -152 Let q(d) = 43d - 944. Determine q(22). 2 Let z(u) = 23u + 192. Determine z(-7). 31 Let d(z) = -1731z - 6911. What is d(-4)? 13 Let d(b) = 3b*3 - 11b*2 + 11b + 2. Calculate d(4). 62 Let h(s) = -44s3 - 3s*2 + 11s - 8. Give h(1). -44 Let c(n) = 4n2 + 125n + 19. Give c(-31). -12 Let n(d) = -2d2 - 678d - 3349. Determine n(-5). -9 Let j(r) = 2r3 + 12r*2 - 36r - 23. Give j(-8). 9 Let f(u) = -12u3 + 98u*2 - 22u + 48. What is f(8)? 0 Let a(u) = u*3 + 106u*2 - 1016u + 2187. Give a(-115). 2 Let f(u) = -100u - 696. What is f(-7)? 4 Let n(o) = -36o*2 - 953o + 511. Give n(-27). -2 Let i(s) = -19s - 2141. What is i(-113)? 6 Let x(d) = -d3 - 13d*2 + 28d + 2. Determine x(-15). 32 Let m(r) = 36r + 1799. What is m(-51)? -37 Let d(i) = -3i*3 + 19i*2 - 41i + 8. Calculate d(6). -202 Let p(d) = 2d2 - 32d - 16. What is p(16)? -16 Let x(c) = c*2 - 55c - 640. What is x(59)? -404 Let m(w) = 383w + 228. Calculate m(-1). -155 Let g(j) = -190j - 2692. Determine g(-14). -32 Let r(u) = u*3 - 2u*2 + 19. Give r(-3). -26 Let m(j) = 6j + 37. Give m(-13). -41 Let j(r) = 40r + 1327. Calculate j(-32). 47 Let s(i) = -673i - 2023. Calculate s(-3). -4 Let u(v) = -3v2 + 184v - 1963. Calculate u(14). 25 Let z(t) = -t - 128. Determine z(24). -152 Let r(s) = -s*3 - 6s*2 + 21s + 134. What is r(-4)? 18 Let o(h) = -1117h - 4467. What is o(-4)? 1 Let l(k) = -k3 - 13k*2 + 17k + 44. Give l(-14). 2 Let g(d) = d*3 - 6d*2 + 7d + 7. Give g(5). 17 Let l(u) = 28u + 2941. Determine l(-105). 1 Let c(j) = j2 - 8j - 132. Give c(17). 21 Let f(z) = 11z2 + 50z - 39. Determine f(-5). -14 Let t(y) = y*3 - 8y*2 - 50y + 447. What is t(8)? 47 Let b(m) = 21m2 + 52m - 282. Determine b(-5). -17 Let d(b) = 47b3 - 2b*2 - 31b - 55. What is d(-2)? -377 Let d(h) = -639h - 45361. Determine d(-71). 8 Let g(z) = z3 + 13z*2 - 42z - 534. Calculate g(-13). 12 Let t(h) = -28h2 + 16h - 17. Determine t(1). -29 Let r(k) = k*3 - 18k*2 + 9k + 5. Determine r(18). 167 Let r(z) = 66z2 + 19z - 2. Calculate r(-1). 45 Let g(u) = 4u - 244. Give g(-41). -408 Let z(y) = 416y - 27065. Determine z(65). -25 Let p(f) = -10f2 + 2f - 11. Calculate p(0). -11 Let p(q) = -q*3 + 21q*2 - 16q - 219. What is p(20)? -139 Let c(b) = -3b3 - 21b*2 + 82b - 55. Calculate c(4). -255 Let m(p) = 4p2 - 37p - 327	{ "pile_set_name": "DM Mathematics" }
1/88 Four letters picked without replacement from lacaacawacll. What is prob of sequence cwll? 1/660 Two letters picked without replacement from {d: 2, l: 2, k: 1, c: 1, y: 2}. Give prob of sequence cl. 1/28 Two letters picked without replacement from dswywddyiy. What is prob of sequence sy? 1/30 Four letters picked without replacement from {j: 2, l: 2, z: 2}. Give prob of sequence zzzz. 0 Two letters picked without replacement from {e: 4, v: 3}. What is prob of sequence ee? 2/7 What is prob of sequence zzz when three letters picked without replacement from fzfzffz? 1/35 Three letters picked without replacement from {u: 2, b: 11}. What is prob of sequence ubb? 5/39 What is prob of sequence piy when three letters picked without replacement from iyiplip? 1/35 Calculate prob of sequence iaa when three letters picked without replacement from {a: 3, e: 1, n: 2, i: 1}. 1/35 What is prob of sequence vmr when three letters picked without replacement from rmwrrvrmww? 1/90 Three letters picked without replacement from vavlglo. What is prob of sequence lgv? 2/105 What is prob of sequence kye when three letters picked without replacement from kklekkekkeeltyekk? 1/102 Calculate prob of sequence inn when three letters picked without replacement from nnyyiyny. 1/56 Three letters picked without replacement from xzgsm. Give prob of sequence xzm. 1/60 Four letters picked without replacement from fvkfekeetvvxeffkk. Give prob of sequence kxve. 1/1190 Two letters picked without replacement from {c: 3, t: 2, e: 1, p: 7, d: 1}. What is prob of sequence pt? 1/13 Two letters picked without replacement from uuue. Give prob of sequence eu. 1/4 Calculate prob of sequence nns when three letters picked without replacement from nnnsnnnssn. 7/40 Calculate prob of sequence hww when three letters picked without replacement from {w: 3, h: 9}. 9/220 Calculate prob of sequence wwv when three letters picked without replacement from {w: 4, q: 6, v: 2}. 1/55 Three letters picked without replacement from {q: 6, f: 4, p: 2}. Give prob of sequence fqf. 3/55 Four letters picked without replacement from ninovovoxonoox. Give prob of sequence xnvo. 3/1001 Two letters picked without replacement from {k: 1, q: 1, x: 1, z: 1, m: 1}. What is prob of sequence mz? 1/20 Four letters picked without replacement from {c: 3, f: 1, j: 1}. Give prob of sequence fjcc. 1/20 Four letters picked without replacement from {r: 2, y: 2, o: 1, i: 1, p: 2}. Give prob of sequence ypip. 1/420 Three letters picked without replacement from gkkkkxkxkqkx. Give prob of sequence xqx. 1/220 Calculate prob of sequence tcqp when four letters picked without replacement from pmmmmtqmcqqm. 1/3960 Three letters picked without replacement from {f: 7, l: 4, t: 3, k: 1, m: 2}. Give prob of sequence fft. 21/680 Calculate prob of sequence uull when four letters picked without replacement from luullu. 1/10 Calculate prob of sequence uj when two letters picked without replacement from fzvvzfjfnjfu. 1/66 Four letters picked without replacement from jrjrr. Give prob of sequence jrjr. 1/10 Three letters picked without replacement from {s: 1, m: 1, t: 3, y: 3, k: 2}. What is prob of sequence tsm? 1/240 Two letters picked without replacement from {t: 2, p: 3, s: 1, r: 4, e: 1}. What is prob of sequence te? 1/55 Two letters picked without replacement from ddoec. Give prob of sequence dd. 1/10 Four letters picked without replacement from apapttaatattnpa. Give prob of sequence aant. 5/1092 Two letters picked without replacement from dqqqvjqdqqqv. Give prob of sequence vv. 1/66 Three letters picked without replacement from {k: 2, a: 2, z: 2, h: 1, q: 5, s: 1}. Give prob of sequence kks. 1/858 Calculate prob of sequence ppdm when four letters picked without replacement from pkmmpopodpho. 1/495 Three letters picked without replacement from {z: 4, n: 14}. What is prob of sequence znn? 91/612 Four letters picked without replacement from mmrmuummmmrmm. What is prob of sequence uuur? 0 What is prob of sequence zo when two letters picked without replacement from ziioziozzzzozzzzzzoz? 13/95 What is prob of sequence oajo when four letters picked without replacement from oajajcocacaaacaaaj? 1/1360 What is prob of sequence ff when two letters picked without replacement from kkffffffkk? 1/3 Calculate prob of sequence kkai when four letters picked without replacement from {i: 5, a: 5, k: 2}. 5/1188 What is prob of sequence mk when two letters picked without replacement from mmmk? 1/4 What is prob of sequence mhvm when four letters picked without replacement from {y: 3, v: 2, f: 8, m: 2, h: 1, j: 1}? 1/14280 Four letters picked without replacement from {v: 1, q: 1, x: 2, l: 3, b: 4, d: 1}. What is prob of sequence vlqb? 1/990 What is prob of sequence iiii when four letters picked without replacement from wiiiwwiiiiiwwwwwwiii? 22/323 Calculate prob of sequence gog when three letters picked without replacement from ggogoooggoogggggggg. 52/323 Calculate prob of sequence jey when three letters picked without replacement from yececccj. 1/168 Calculate prob of sequence uu when two letters picked without replacement from {d: 3, u: 4, o: 4}. 6/55 What is prob of sequence gi when two letters picked without replacement from ggibg? 3/20 What is prob of sequence mqd when three letters picked without replacement from {q: 1, m: 1, d: 2}? 1/12 Two letters picked without replacement from {q: 1, a: 9, u: 2, f: 1, l: 1, i: 1}. Give prob of sequence aq. 3/70 Three letters picked without replacement from {t: 1, k: 2, y: 2}. Give prob of sequence kky. 1/15 What is prob of sequence oo when two letters picked without replacement from azzezazzesazaoozzzz? 1/171 Four letters picked without replacement from {i: 5, z: 3, x: 2, v: 1, o: 1}. Give prob of sequence vxio. 1/1188 Four letters picked without replacement from xcbxb. What is prob of sequence xxcb? 1/30 Two letters picked without replacement from {o: 11, i: 1}. Give prob of sequence io. 1/12 What is prob of sequence ii when two letters picked without replacement from iiaaa? 1/10 Three letters picked without replacement from jdjdjdjjdjdjjddjdjd. Give prob of sequence ddd. 28/323 Calculate prob of sequence td when two letters picked without replacement from {z: 2, j: 1, d: 1, t: 1}. 1/20 Four letters picked without replacement from xkkxxkxx. Give prob of sequence xxkx. 3/28 Three letters picked without replacement from {e: 4, a: 1, z: 2}. What is prob of sequence zee? 4/35 Three letters picked without replacement from {g: 1, p: 2, s: 2}. Give prob of sequence gpp. 1/30 What is prob of sequence vj when two letters picked without replacement from {j: 5, v: 2, w: 1, g: 11}? 5/171 Three letters picked without replacement from {j: 2, m: 2, s: 1, a: 1}. What is prob of sequence jaj? 1/60 Three letters picked without replacement from {u: 3, v: 4}. Give prob of sequence vuu. 4/35 Calculate prob of sequence ff when two letters picked without replacement from rrnzrrnrnrffz. 1/78 Calculate prob of sequence uuuv when four letters picked without replacement from {u: 11, v: 9}. 99/1292 Calculate prob of sequence innp when four letters picked without replacement from pnnppnppnnpnpnpnppip. 77/14535 Calculate prob of sequence myms when four letters picked without replacement from suyvysmsmyyssttyyys. 7/7752 What is prob of sequence mx when two letters picked without replacement from mxmaxxexya? 4/45 Three letters picked without replacement from {h: 2, z: 1, q: 1, n: 1}. Give prob of sequence nhq. 1/30 Two letters picked without replacement from {l: 1, m: 1, b: 9, u: 2, z: 4}. What is prob of sequence uz? 1/34 Two letters picked without replacement from sppspppppppppppspsp. What is prob of sequence ss? 2/57 Two letters picked without replacement from ilflllelqllfllleeii. What is prob of sequence fl? 10/171 Calculate prob of sequence kp when two letters picked without replacement from otkprpto. 1/28 Three letters picked without replacement from jfifffofflfjltlooj. Give prob of sequence ifj. 7/1632 Four letters picked without replacement from {q: 3, h: 3}. What is prob of sequence hhqh? 1/20 Four letters picked without replacement from {u: 4, y: 1, h: 5}. Give prob of sequence uyyu. 0 Four letters picked without replacement from eeeeeeeeeeepp	{ "pile_set_name": "DM Mathematics" }
r(z)? -1 Let m(t) = 4t. Let u(r) = -2r*3 + 4r*2 - 3r. Let f be u(3). Let y = -28 - f. Determine m(y). -4 Let r(b) = -b + 6. Let q be 12/(-9)9/(-2). Let x be r(q). Let t(p) = 6p + 2. Let u(o) = -o. Let l(m) = t(m) + 5u(m). Give l(x). 2 Suppose -2a - 2d - 16 = 8, 3d = -4a - 48. Let z = -9 - a. Let w(c) be the second derivative of -c3/2 + c2/2 + c. Calculate w(z). -8 Let r(s) = -s2 + 6s + 9. Let p be r(7). Let y(h) = h3 + h2 + 2h - 3. What is y(p)? 13 Let t(f) be the second derivative of -f5/20 + 5f*4/12 + 5f*3/6 + 7f*2/2 + 2f - 13. Let a(m) = -m*3 + 5m*2 - 4m + 6. Let j be a(4). Determine t(j). 1 Let f(i) = -13i + 5 - 2i + i. Let s(t) = -5t + 2. Let u be 3(3 - (-6)/(-3)). Let h(d) = uf(d) - 8s(d). Determine h(1). -3 Let v(r) = -3r2 + r + 1. Let w(n) = n - 5. Let z be w(4). Calculate v(z). -3 Suppose 0 = -4w - 5s + 23, -2s = -0s - 6. Suppose 0 = wz - 3l + 11, 3z + 3l + l - 26 = 0. Let d(h) = h2 + 3h - 3. Determine d(z). 7 Suppose 2z = 3z. Let r be (-2)/(-6) + (-30)/9. Let h(k) = -3k3 - 8k2 - 2. Let c(v) = -v3 - 3v2 - 1. Let u(f) = rh(f) + 8c(f). Give u(z). -2 Let g(l) = -l2 + l + 5. Suppose -5 = -2j + 5. Determine g(j). -15 Let n(v) be the third derivative of -v5/6 + v4/24 + v*3/6 - 7v*2. Determine n(-1). -10 Let h be (6/(-12))/((-2)/(-16)). Let f = -3 - h. Suppose -2y - f = -11. Let q(m) = m + 2. Determine q(y). 7 Let q(k) be the second derivative of -k5/20 - k4/6 - k3/3 + k2/2 - 6k. Determine q(-2). 5 Suppose 8 = -3l + 2l + 2v, 2v - 8 = -l. Let d(r) = -13r*2 + 2 + 4r + l + 16r2. Give d(-2). 6 Let q(u) = -u - 7. Let x = 53 - 62. What is q(x)? 2 Let w(b) = -2b + 1. Let i be w(-1). Suppose 0c = -ic. Suppose c = -o - o - 8. Let n(u) = u - 3. What is n(o)? -7 Let t(l) = l*2 + 2l - 2. Let g(n) = n*2 + 10n - 3. Let z(v) = -4v - 2. Let u be z(2). Let x be g(u). Determine t(x). 1 Let k(g) = -3g*3 + 9g2 + g + 9. Let r(z) = -z3 + 1. Let d(p) = -k(p) + 4r(p). Calculate d(-9). 4 Let i(h) = h3 + 10h*2 + 9h + 6. Let j be i(-9). Let n(u) = -j + u*3 + 2u - 3u - 1. What is n(0)? -7 Let g = -4 + 9. Suppose ga - 3a = 0. Let j(f) be the first derivative of -f2/2 - f - 18. Calculate j(a). -1 Suppose 1 + 7 = -4o. Let l(n) = 2n + 2. What is l(o)? -2 Let l(s) be the second derivative of s4/12 + s3 + 3s*2/2 - s. Suppose 2x - 3p = x - 15, -4x + 10 = 2p. Let m = x + -4. Determine l(m). -5 Suppose -m + 18 = 3r + 3m, -5m - 12 = -2r. Let u(p) = p3 - 7p*2 + 6p - 8. What is u(r)? -8 Suppose n + 8 = -3n, 5d = -n - 2. Let o(a) = d + 1 - a2 - a2 + 4a2. Determine o(1). 3 Let w(y) be the second derivative of y5/20 - y4/3 + y3/2 - y2/2 - 11y. Give w(3). -1 Let x(a) = -a*2 - 8a - 7. Let l(o) = -o - 17. Let f be l(-10). Determine x(f). 0 Let p(v) be the third derivative of 0 + 1/60v5 - v2 + 0v + 0v3 + 1/12v4. What is p(-2)? 0 Let q(h) be the first derivative of -h3/3 - 4h2 + 6h + 1. Let a be q(-9). Let d(u) = u + 5. Give d(a). 2 Let g(a) be the third derivative of -a*6/120 + 2a5/15 - a4/4 - a*3/6 - 27a2. Calculate g(7). 6 Let d(n) be the first derivative of n4/12 - 5n3/6 + n2 + 2n + 3. Let v(t) be the first derivative of d(t). What is v(3)? -4 Let h(c) = c*2 + 4c - 2. Let i be h(-5). Let m(n) = -in - n - 6n*3 + 5n. Let u = 1 + -2. Give m(u). 5 Let y(z) = -z*3 - 6z*2 - 4z + 3. Let j = -117 - -113. Give y(j). -13 Let g(t) = -t*2 + 3t*2 - 2t - 5t - 3t*2 + 5. What is g(-8)? -3 Suppose 5j + 29 = -4i, 4j + 17 = 4i + 1. Let o(m) = -2m - 5. What is o(j)? 5 Let z(d) = -19d2 + 7d - 6. Let a(v) = 20v2 - 8v + 7. Let s(t) = -6a(t) - 7z(t). Suppose -3r + 522 - 525 = 0. Calculate s(r). 14 Let a(l) = l3 + l2 - l - 1. Let n(u) = 5u3 + u2 - 8u - 5. Let b(r) = 6a(r) - n(r). What is b(-4)? 7 Suppose -t - 8 = -2t - 2l, -t + 4l - 10 = 0. Let z(c) be the second derivative of c5/20 - c4/6 - c3/2 + c2/2 - c. Give z(t). -5 Let v(b) = 16b*2 - 2b + 1. Suppose 0 = -p - 1, 4u - 11 + 9 = -2p. What is v(u)? 15 Let q(u) = u2 - u - 1. Let i be (9/(-6))/(2/(48/(-9))). Determine q(i). 11 Let o be 6/5 - (-1)/(-5). Let i(x) be the third derivative of -x6/40 + x*5/60 + 2x*2. Calculate i(o). -2 Suppose 6 = -12v + 18v. Let t(g) = 11g*2 - g + 1. Determine t(v). 11 Let q(r) = -6r + 20. Let x(p) = 2p - 7. Suppose 5g - 2h + 60 = 6g, 0 = -2g + 4h + 152. Suppose 2b = 6b + g. Let c(z) = bx(z) - 6q(z). Calculate c(4). 7 Let k(b) = b*3 - 3b2 - b - 2. Let r(h) = -h3 - 2h2 - 5. Let z be r(-3). Suppose i - z = -1. Determine k(i). -5 Let s(h) be the third derivative of h4/12 - 13h*3/6 - 50h*2. Determine s(9). 5 Let l(b) = 7b*3 + 8b*2 + b - 1. Let h(d) = -3d*3 - 4d*2. Let x(k) = 9h(k) + 4l(k). Determine x(3). -1 Let r(x) = 3x*3 + 27x*2 - 23x - 23. Let c(o) = -4o3 - 40o*2 + 34o + 34. Let f(m) = -5c(m) - 7r(m). Calculate f(10). 1 Let w(y) = -y*2 + y + 13. Let i(j) = -2j*2 + 3j + 27. Let v = 10 - 23. Let g(t) = vw(t) + 6i(t). Determine g(-5). -7 Let q(t) = -5t + 4t - 2 + 3 + 1 - 3t2. Calculate q(-2). -8 Let o(i) = i3 - 6i*2 - 7i + 4. Let q be o(7). Let n(p) = p - 4. Determine n(q). 0 Suppose -2h = -3h - 1. Let j be h - (0 - -2 - 7). Let y be (j/(-2))/(4/10). Let a(o) = -o. Calculate a(y). 5 Let p(x) be the first derivative of -x4/2 - x3/3 + x*2 - x + 2. Suppose -4g + 7g = 3. Calculate p(g). -2 Let g(w) = w + 1. Let j(f) = 6f + 7. Let r(p) = -4g(p) + j(p). Give r(-5). -7 Let k(o) = -o - 4. Let w be k(-6). Let j(d) = wd - 1 + 1 - 2. Calculate j(2). 2 Let n(r) = -r*3 - 5r*2 + 7r + 9. Let p be n(-6). Let z(x) = -2x + 2x*p - 2x*2 + 0x3 - x3 - 4. Let i(c) = 2c + 1. Let v be i(1). Calculate z(v). -1 Let z(v) = -v3 - v2 + 3v + 3. Let i be z(-2). Let d(y) = -2y - 5y - i + 5y. Suppose 5s + 8 + 12 = 0. Calculate d(s). 7 Let n(i) = i - 4. Let v be (12/16)/((-1)/(-8)). Suppose 3c + 9 = vc. Calculate n(c). -1 Let j(l) = 3l2 + 8l + 5. Suppose 7d - 2d = 10. Let n(p) = p*2 + 4p + 3. Let g(i) = dj(i) - 5n(i). What is g(5)? 0 Let d(j) = j - 5. Let y(z) = z*3 - 10z*2 - 10z - 5. Let w be y(11). Let v be 20/w6/4. Determine d(v). 0 Let r = -4 + 12. Suppose 0 = k + 2i - r, 5k - 5i = -3 - 2. Let l(u) = u - 2. Give l(k). 0 Let y = -10 + 17. Let v = y + -6. Let l(p) = -2p. Determine l(v). -2 Let j = -5 + 16/3. Let l(r) be the first derivative of -3 + 0r*2 + jr*3 + 10r. Calculate l(0). 10 Let v(f) = -3 - 4 + 3 + f + 2. Suppose 3s + 6 + 9 = 0. Give v(s). -7 Let a(n) be the second derivative of n4/12 - n3/6 - n2 + 44n. What is a(-3)? 10 Let l(g) be the second derivative of -g3/6 - g2/2 - 59g. Give l(-10). 9 Let m(v) = -4v + v*3 - 2 + 2v*3 - 4v*3 - 6v*2. Give m(-5). -7 Suppose -2p = -4p. Suppose p = -2s - 3h + 8, 0s - h = 2s. Let k(y) = y2. What is k(s)? 4 Let d = 12 + -16. Let j(u) be the first derivative of u4/4 + 4u*3/3 - 3u - 1. What is j(d)? -3 Let z(w) be the first derivative of -w3/3 - w2/2 + 5w - 5. Calculate z(0). 5 Let g be 3/2(12 + 2). Let d(w) = w*2 + 4w - 4. Let f be d(-5). Suppose -g = -4o - f. Let n(q) = q3 - 6q*2 + 4q. What is n(o)? -5 Let h(l) = -2l + 8 + 6l - 9l - l + l2. Determine h(6). 8 Let v(i) = -8 - 2i + 3i - 3 + 9 - i2. Suppose 5p + 30 = -0p. Let a be (-4)/p - (-4)/(-6). Give v(a). -2 Suppose -4w + 10 = w. Let d(n) be the first derivative of 10n + 1 - 1/2nw. Determine d(0). 10 Let t(v) be the second derivative of -v5/20 - 5v4/12 - v3/3 - v2 - 2v. Let r = -5 - -10. Suppose -3q - 3p - 18 = -p, -3q + rp + 3 = 0. Give t(q). -10 Let h(c) be the second derivative of -c*5/20 - 7c4/12 + c3/3 + 9c2/2 + 2c. Determine h(-7). -5 Let s(c) be the second derivative of c*3/6 + 7c*2/2 + 6c. Give s(0). 7 Let m(g) be the first derivative of g3/3 - g2 - 5g + 1. Let u be m(4). Let i(t) = -2t + 3. Calculate i(u). -3 Let x be 2/(-6)(-44 + -1). Let o(i) = 6 - x + 6i + 2 + i2. Give o(-6). -7 Let b(c) = c2 + 4. Let v(i) = 1. Let x(o) = -2b(o) + 10v(o). Calculate x(2). -6 Let s(c) be the first derivative of c*4/4 + 2c*3/3 - c - 14. Determine s(1). 2 Let x(u) = -u	{ "pile_set_name": "DM Mathematics" }
0 - 10 + 6r - r. Determine c(p(u)). -25u2 Let g(i) = -i2. Let m(d) = 2d + 7. Let k = 2 - 9. Let v(b) = b + 4. Let z(f) = kv(f) + 4m(f). What is g(z(x))? -x2 Let k(t) = 2t*2 - 8t - 8. Let m(a) = -a*2 + 5a + 5. Let q(s) = -5k(s) - 8m(s). Let y(x) = 13x. Determine q(y(c)). -338c*2 Let t(c) = 3c*2. Let v be (-3)/(-2)(-12)/(-9). Let k(d) be the third derivative of -vd2 + 1/60d*5 + 0 + 0d*4 + 0d*3 + 0d. What is k(t(q))? 9q4 Let p(u) be the first derivative of -5u3/3 - 2. Let d(s) be the third derivative of -s5/30 + 2s2. Give p(d(w)). -20w*4 Let g(z) = 9z. Let l(b) be the second derivative of -b*3/6 - 10b. Give l(g(d)). -9d Let i(o) = 3o*2. Let y(z) = 3z*2 - 11z2 - z2. Calculate y(i(d)). -81d4 Let r(q) = 4q*2. Let w(d) = -5d + 12d - 5d + d. Calculate r(w(k)). 36k2 Let x(c) = 3c*2 - 3c + 3. Let f(s) = s - 1. Let k(z) = 3f(z) + x(z). Let b(i) = 2i. Give b(k(g)). 6g2 Let n(c) = -c - 1. Let u(h) = -h - 3h - 1 + 3h - 1. Let o(p) = 2n(p) - u(p). Let q(f) = -f2. What is q(o(k))? -k2 Let m(u) = 3u2 - 6u*2 + 0u*2. Let y(c) = 2c - 44 + 44. Calculate y(m(t)). -6t2 Let t(l) = -9l*2. Let f(h) = 6h*2 - 8h*2 - 2h*2 + 2h*2. What is t(f(v))? -36v4 Let q(r) = r2. Let h(s) = -33s - 5. Let c(l) = -16l - 2. Let x(u) = -5c(u) + 2h(u). Calculate x(q(m)). 14m2 Let z(h) = 5h. Let b(w) = -2w2 + 8w*2 - 7w*2. Determine b(z(o)). -25o*2 Let x(m) = -13m*2 + 5m - 5. Let i(k) = -32k2 + 12k - 12. Let f(q) = -5i(q) + 12x(q). Let l(g) = g. What is f(l(w))? 4w2 Let v(m) = -2m. Let g(n) = n*2 - 15n*2 - 5n*2. Give v(g(t)). 38t*2 Let c be 3/(-3 - 9/(-2)). Let h(r) = -5r*2 + 4r*2 + cr*2. Let t(o) = 2o. Calculate t(h(f)). 2f2 Let n(o) = 3o + 11. Let a(z) = z + 4. Let h(j) = -11a(j) + 4n(j). Let d(t) be the first derivative of -t*3 - 15. Calculate h(d(p)). -3p*2 Let g(d) = 24d*2 - 2d. Let t(y) = 7y2. Give g(t(k)). 1176k*4 - 14k*2 Let z(o) = -95o*2. Let v(a) = -34a*2. Calculate z(v(w)). -109820w*4 Let h(u) = -327u. Let j(m) = -m. Determine h(j(n)). 327n Let r(k) = 0k + 0k + 3k. Suppose 2p + 42 = 5o, 5p = -0o - 3o + 19. Let l(d) = -8d + od - d2. Determine r(l(b)). -3b*2 Let d(k) = -2712k*2. Let n(f) = -8f. What is d(n(r))? -173568r2 Let g(m) = 2m*2. Let v(a) = -1540a*2. Give v(g(y)). -6160y*4 Let c(k) = k. Suppose 0 = -2o - 3o + 35. Let r = o - 5. Let h(d) = r + 2 - 3d - 4. What is c(h(i))? -3i Let f(y) = -y. Let s(m) = 7m*2 - 2m. Let z(o) = 85o2 - 25o. Let l(k) = -25s(k) + 2z(k). Determine l(f(a)). -5a2 Let k(c) = 412c2. Let j(p) = -p2. Calculate k(j(y)). 412y4 Let l(c) = -3c*2. Let h(o) = -2o*2 + 35o. Give h(l(i)). -18i4 - 105i*2 Let u(q) = -14q2 + 5. Let j(c) = c2. What is u(j(b))? -14b4 + 5 Let m(z) be the second derivative of 55z*4/12 + 11z. Let r(b) = 2b2. What is r(m(q))? 6050q*4 Let a(f) = -5f - 9. Let x(s) = 2s + 4. Let r(w) = 4a(w) + 7x(w). Let b(z) = z + 1. Let i(v) = -8b(v) - r(v). Let y(m) = -3m2. Determine y(i(n)). -12n*2 Let q(f) = 3f. Let m(a) = -2a2 - 1. Let i(x) = -x2 - 1. Let t(p) = p3 + 4p*2 - 2p - 9. Let h be t(-4). Let d(u) = hi(u) + m(u). Calculate q(d(o)). -3o*2 Let j(s) = -57s - 33. Let k(w) = 7w + 4. Let h = 19 - 52. Let v(o) = hk(o) - 4j(o). Let q(n) be the second derivative of -n3/6 - n. Calculate v(q(y)). 3y Let g(a) = -a*2 + 0a*2 + 2a*2. Let s = 11 - 8. Let t(w) = -w + 3. Let y(m) = 2m - 5. Let r(u) = sy(u) + 5t(u). What is g(r(p))? p2 Let o(f) = -f2. Suppose -g + 3p - 8 = 11, -2g = 2p + 14. Let w(r) = -r - 8. Let l be w(g). Let a(y) = 3y*2 - 2yl + y2. Give o(a(c)). -4c4 Let m(b) = b. Let q(s) = 2041s*2. Determine q(m(p)). 2041p*2 Let d(t) = 2t*2. Let k(i) = -9i - 5i + 16i. Give k(d(g)). 4g2 Suppose 0 = i - 3i - c - 4, 4i = 5c + 20. Let o be 7/(-28) - (-3)/12. Let v(l) = ol - 2l + il. Let k(j) = 3j*2. Give k(v(x)). 12x*2 Let t(u) = -5u*2. Let a(q) = -449q. Give a(t(p)). 2245p2 Let m(a) be the first derivative of a2/2 + 7. Let h(z) be the third derivative of -z4/8 + z2. Calculate m(h(t)). -3t Let b(s) = 1 - 1 + 6s - s. Let q(o) = -2o*2. Calculate b(q(r)). -10r*2 Let p(u) = 984u. Let k(x) = 3x. What is k(p(o))? 2952o Let w(m) = 2 + 1 - 3 - 9m. Let l(v) = -v2. Calculate l(w(r)). -81r2 Let j(r) be the first derivative of r2/2 + 1. Let a(q) = 5q. What is a(j(t))? 5t Let d(w) = -2w. Let b(r) = 15r - 25r - 10r - 21r. Calculate b(d(q)). 82q Let d(m) = 2m2. Let n(w) = 4w - 3w - 3w + 11w. Give n(d(g)). 18g*2 Let a(u) = -2u*2. Let d(n) = 44n*2 + 55n. Let h(z) = -z*2 - z. Let i(j) = -2d(j) - 110h(j). Calculate i(a(q)). 88q*4 Suppose 8s - 3s = 0. Let j(d) = sd - d + d2 + d. Let f(y) = -y2. What is j(f(q))? q*4 Let c(z) = 331z. Let r(t) = -5t2. Determine r(c(q)). -547805q*2 Let v(j) be the second derivative of -2j*3 + 14j. Let i(g) = -2g2. Calculate i(v(o)). -288o*2 Let v(y) = 1231y2. Let u(r) = r2. What is v(u(f))? 1231f4 Let l(j) = 4j + 3. Let m = -25 - -17. Let o(y) = -11y - 8. Let p(g) = ml(g) - 3o(g). Let c(w) = -5w*2. Give p(c(d)). -5d*2 Let q(t) = -7t*2 + 5t + 5. Let g(r) = 4r2 - 3r - 3. Let a(x) = -5g(x) - 3q(x). Let y(s) be the third derivative of s*5/30 + 3s*2. Determine y(a(v)). 2v*4 Let s(g) = -4g*2 - 3g. Let x(r) = -3r2 - 2r. Let y(l) = 2s(l) - 3x(l). Let m(a) be the third derivative of a*5/12 + 7a*2. Give y(m(w)). 25w*4 Let m(w) = w. Let y(x) = 46x*2 - 97x*2 + 48x*2. What is y(m(c))? -3c2 Let d(p) = -p2. Let f(l) = -32l2 - 10l + 10. Let z(y) = y*2 + y - 1. Let h(o) = -f(o) - 10z(o). What is h(d(i))? 22i4 Let g(u) = 2u2. Let v(x) be the first derivative of -x3/3 + 2x2 - x + 2. Let q be v(2). Let j(w) = 2w + qw - 7w. What is g(j(a))? 8a2 Let a(w) = 5 - 3 + 2w - 3w. Let j(g) = g - 3. Let h be (6/4)/((-4)/(-8)). Let k(n) = ha(n) + 2j(n). Let t(o) = o. Calculate k(t(q)). -q Let c(u) = -2u2. Let j(d) be the third derivative of d4/8 - 4d2. Determine j(c(i)). -6i*2 Let h(z) = 2z. Let g(j) = -857j. Determine h(g(m)). -1714m Let z(r) = 2r2. Let x(h) = 1779h. Give x(z(k)). 3558k2 Let u(p) = -p2 + 6. Let n(k) = 18k*2. Determine n(u(w)). 18w*4 - 216w*2 + 648 Let c(i) = -i. Let r(u) = -5u. Let y(z) = -5z. Let n(q) = 3r(q) - 2y(q). Give c(n(o)). 5o Let w(v) = 6v2 - 7v*2 + 5v*2. Let h(z) = 4z. Calculate w(h(x)). 64x2 Let r(q) = -5q*2. Let p(s) be the first derivative of 4s*3/3 - 2. Give p(r(g)). 100g*4 Let x(d) be the first derivative of 2d*3/3 + 7. Let z(s) = -s - 3s + 3s. Calculate x(z(u)). 2u2 Let r(d) be the third derivative of -d7/720 + d5/30 + d2. Let w(t) be the third derivative of r(t). Let x(k) = 2k2. Determine w(x(i)). -14i*2 Let x(u) = 44u*2. Let s(r) = -2006 - r - r + 2006. Give s(x(w)). -88w2 Let l(f) = f2 + f. Let m(u) = -4u2 - 2u. Let h(d) = -2l(d) - m(d). Let p(n) = -2n + 3. What is h(p(i))? 8i2 - 24i + 18 Let t(m) = 3m2. Let c(z) = -101z*2. Calculate c(t(l)). -909l*4 Let m(f) = 2f - 28. Let b(l) = -17l2. Determine b(m(s)). -68s*2 + 1904s - 13328 Let c(h) = 0 + 7h - 2h - 17h2 + 5. Let d(n) = -8n*2 + 2n + 2. Let p(s) = 2c(s) - 5d(s). Let m(r) = 2r. Determine p(m(j)). 24j*2 Let l(i) = -22i - 2i - 2i. Let r(w) = 5w + 18 + 22 - 40. Let k(h) = 3l(h) + 16r(h). Let z(c) = -2c*2. Determine k(z(s)). -4s*2 Let o(x) = 2x*2. Let u(w) = 3w - 6. Suppose -2a + 12 = 4l, a - 2l = 5a. Let t be (3/6)/(1/a). Let g(v) = v - 1. Let d(j) = tu(j) + 6g(j). Give d(o(h)). 6h2 Let c(m) = 2m*2 - 2m*2 + 2m*2. Let n(o) = -18 + 18 - 2o*2. What is n(c(p))? -8p*4 Let r(v) = 13v - 13v + v2. Let n(b) = 2b*2. Let z(f) = 4n(f) - 9r(f). Let t(d) be the third derivative of -d4/8 - d2. Give z(t(j)). -9j2 Let m(y) = y2 - 5y2 + 5y*2. Let p(u) be the first derivative of 4u*3/3 + 7. Determine p(m(z)). 4z*4 Let h(c) = 5c*2 + 6. Let o(j) = -4j*2 - 5. Let u(a) = -5h(a) - 6o(a). Let y(m) = 34 - 61 + 27 - m. Determine y(u(g)). g2 Let h(m) = 8m**2	{ "pile_set_name": "DM Mathematics" }
445)/5(-5)/7819/(-585)? -89 Calculate ((1/(-4))/((-10)/(-160)))/(-4)(-68)/4. -17 Calculate (-10)/(10080/(-462))(-16)/(-2). 11/3 Evaluate ((-21)/14)/((-6)/(3(-144)/(-243))). 4/9 Calculate (-1974)/(-35)((-140)/(-14))/(-150)150/(-6). 94 Calculate 138/502104415/62649. 46/5 Evaluate (14/(-3)2/(-36))/(13538/11604). 2/9 Evaluate (-8)/(-114)3(-1)/4640/960. -2/57 Calculate ((-344)/(-3440))/(14/10)(-5)/(-15)1778. 127/3 Calculate ((-88)/55)/(91/(627900/120)). -92 What is (((-1941)/647)/(7/(-4)))/(45/(-42))? -8/5 What is -12(-2)/(-8)3/((-594)/6)? 1/11 Calculate (-108)/(-1)76/(-228)(-11)/(-11). -36 What is (190/(-76))/((-385)/(-5082))? -33 Calculate ((-12)/(-3))/((-2)/40(-43)/(1032/240)). 8 Evaluate (-2)/10-30(2/12)/((-2)/16). -8 What is (-19040)/(-357)(-1)/(-1)10/(-50)? -32/3 Calculate (12/(-40))/((-702)/(-52)). -1/45 What is the value of (20/(-86))/(9865/3946)? -4/43 Evaluate (-12)/844/28132/726. -3/7 What is the value of (-20)/(-12)138/(-243455)-29? 2/73 What is (-157320)/(-6840)1/5? 23/5 What is the value of 42742/(-5964)27/(-3225)? 3/50 What is the value of ((-658)/(-4794))/((-3)/(-9))1? 7/17 ((-135)/36)/((-595)/1428) 9 Evaluate (-945)/(12705/121)(-24)/2. 108 What is the value of (-704)/(-66)570/912144/(-10)? -96 Calculate (238/(-5))/(4300/(-2150)2/10). 119 What is the value of 125(-3)/(-27)(-771)/(-1285)1/1? 25/3 What is (-455(-98)/(-17150))/((-4)/(-5))? -13/4 Calculate 10(-80)/64(-168)/35(-3)/3. -60 ((-23335)/(-4308))/((-10)/(-4)) 13/6 (-11408)/(-4278)39/4 26 What is (116/(-8120))/((1170/(-42))/13)? 1/150 What is the value of ((-1)/(-13))/(204/(-80))? -1/13 2016/(-84)(-9)/(-6)(-10)/(-120)-38 114 What is 11448/(-288)-1? 19 Evaluate ((-450)/(-360))/(36/(-720)). -25 What is the value of (-167)/((-343185)/(-548))(-2)/((-16)/(-3))? 1/10 What is the value of (-9)/((510/(-935))/((-4)/(-44)))? 3/2 (8556/(-1488))/(2/(-8)(-90)/18) -23/5 What is the value of (11/(-110))/(((-825)/(-25))/99)? -3/10 Calculate ((-1143)/17145)/(2/(-1020)). 34 What is ((-1011)/32015)/(36/(-76))? 1/15 What is (-36)/183/(-1)(-817)/(-114)? 43 Evaluate (39/(-91))/((-135)/1260). 4 (75/((-9450)/(-28)))/((-5)/270) -12 ((-35)/21)/((-133)/(-228)30/483) -46 What is ((-8)/(-6))/(752180/650925)? 15/13 Calculate -6(-15)/(-27)(-15)/5034/(-17). -2 Evaluate 68/6(-8784)/49776. -2 Calculate ((-1)/(-1))/((-19)/(-2)402/3819). 1 Evaluate 219/(-4)31/93(-248)/(4898/(-79)). -73 Evaluate ((-16)/(-6))/(37584/1832220). 130 What is ((1/(10/(-195)))/((-864)/(-128)))/(-2)? 13/9 (-2)/466/31970/(-2167) 10 Calculate ((-276)/414)/(10/(30/(-39))). 2/39 What is the value of ((-12)/(-27))/(((-102)/(-85))/(261/4495))? 2/93 Evaluate 2/(135/74970-1714/(-12)-1). -56 What is ((-1)/(-15))/(92/230)(-12)/22? -1/11 What is ((-83)/(51875/50)(-500)/16)/((-5)/(-88))? 44 Evaluate 14(66/(-4))/((26691/164)/31). -44 Evaluate -28((5/(-12))/((-840)/2688))/(42/27). -24 Evaluate (16/168)/((168/(-14))/144)(-392)/7. 64 (124644/(-47))/78-2 68 What is (38/(-1)1)/(-31184/5704)? 38 Calculate (30/26120/(-100))/((-66)/(-176)). -48/13 1/((-10)/3)54055/(-10242)(-2)/1 -19/6 What is the value of (377/(-104))/((-27)/(-216)-5)? 29/5 (((-12)/81)/((-210)/108)-31)/2 -4/35 What is (24/9613/(91/(-8)))/((-11)/(-33))? -6/7 Evaluate (-20200)/2020-11/(-10)5/85. -1/17 -5(-121)/(-220)(-40)/220-84 -42 What is the value of (((-120)/(-2))/5)/(16/44842)? 8 What is ((-3)/12)/((16/(-480))/((-20)/759))? -18 What is (-238560)/(-13419)(-270)/50? -96 (-6)/63(-34)/(5984/(-3432)) -13/7 What is (9040/(-42488))/((-6)/705)? 25 Calculate 2((-76)/(-190))/(2/(-10)). -4 (-220)/(-275)155/(-1116) -1/9 What is the value of ((-9)/(279/31))/(((-1)/7)/(96/(-28)))? -24 Calculate ((-426)/(-12))/(((-4)/18)/(((-1064)/126)/19)). 71 What is the value of -433/(-440)(-8)/33610? -1/14 (183121/155001)/(2/2843) 2/43 What is (-1(-1)/(-3))/1(-283)/((-56883)/603)? -1 What is 65/(-39)(((-100)/(-20))/(-75))/((-2)/(-3))? 1/6 (13(-511)/3796)/((-14)/240) 30 Calculate ((-8)/((-60)/((-40)/4)))/((-10)/420). 56 Calculate (2/(-5))/(-1001(-270)/(-8775)). 1/77 (-84)/(-2)(-247)/(60268/(-366)) 63 What is (2/161)/(((-4743)/(-102))/93)? 1/4 What is the value of (16240/(-245))/29336/(-8)? 96 What is the value of (2/(-2))/(330/1305010)? -29/2 Evaluate ((-60)/4)/((3/6)/(255/(-6120))). 5/4 What is (-45)/(-10)3/18-20286/(-165)? 26 ((-252)/(-1584))/(-7)(-77)/4 7/16 What is ((-22)/(-45))/(86284/(-194139))? -11/10 Evaluate 6/36-233144/524. -23 What is the value of (18/(-18))/(1/178-5)2325/(-930)? -89 What is (62/24(-8397)/2799)/((1/4)/1)? -31 What is the value of (-1812)/(-6342)(-3955)/(-4)(-2)/5? -113 Evaluate (320/45)/(13(-78)/18252). -128 Calculate (-6)/165-22-15(-3)/2. 18 Calculate (((-2)/3)/(-1))/((-5384)/8076)0. 0 (-1)/(-1)(4704/(-84))/44128-8 2/197 Calculate 8(3/4)/((-177)/649). -22 Evaluate 7860/20960256/(-76). -24/19 What is (-6)/(-4)(-1484)/62328? -1/28 What is (-60)/(-225)4299/(-924)? -6/5 Calculate ((-5)/((-350)/16))/(11/(22/(-2)))10. -16/7 What is the value of (((-1)/(-7))/(36/(-84)))/(1900/228)? -1/25 Calculate 3/(-2)((-198)/(-135))/((-56)/(-280)). -11 Calculate (((-8525)/(-44))/155)/(1255/(-24)). -2/17 Evaluate 28800/64018/12. 30 Evaluate ((-41)/984-18)/((-9)/672-4). 14 Calculate ((-79)/6399-144)/16. 1/9 2553/(-31800)-1896 79 Calculate ((2/6)/((-20)/(-12)))/((-12)/(-21660)-19). -19 (-6)/376-47(-22)/9-6 11 Evaluate (-1(-7)/(-378)-18)/((-236)/24). -2/59 7/(-420)-4354-1 -29 Evaluate (919/12866)/((-1)/(-518)). 37 What is ((-266)/196)/(1197/(-126))? 1/7 What is 9/20-280265/139125? -6/25 Calculate (2340/(-1560))/(1(-564)/8). 1/47 What is (41/(-8610)8)/((-12)/(-18))? -2/35 What is (-970)/97-34/660? 2/11 Calculate (2/6)/(1417/(-187044)). -44 What is ((-3016)/(-29))/7384-2? -2/71 What is (30/(-282))/(2/(-3)(-180)/(-16))? 2/141 What is ((-8)/64)/(32/4842)? -1/224 Evaluate ((-3)/11)/((-2431)/(-26741)). -3 What is the value of (((-231)/(62370/(-240)))/(1/(-1)))/(-2)? 4/9 Calculate (-60)/(-8)145/((-22475)/186). -9 What is 6/99(-9200)/1725? -32 What is the value of (22(-33)/726)/(13/4)? -4/13 Calculate (-2)/43/282(240/(-4))/15. 1/47 What is (216/117)/(16/239223)? 12 What is ((-5)/(450/(-24)))/(-2(-7740)/300)? 2/387 Calculate (2925/(-108))/(-325)33/2. 11/8 Calculate 183/(-3050)125(4/(-18))/((-12)/(-63)). 35/4 Evaluate (-2513/(-650))/((306/(-17))/4392). -122 Evaluate ((-69)/184)/(((-75924)/(-48))/(-37)). 1/114 Calculate (18224/3900)/(-310/(-75)). 14/5 What is -18(6/(-30)30/16)/(2/8)? 27 What is the value of ((-5)/(5/(-4)))/(20(-12636)/(-520))? 2/243 (-58)/(-1)(-7)/((-588)/42)(-1)/1 -29 104/(-110(-16)/(-40)) -26/11 Evaluate (11/(-616)24)/(((-9)/3)/(3/5)). 3/35 What is -120183/1098-12-15? -100 Evaluate (-872)/3270(-4500)/40. 30 Evaluate (220/158418)/(1770/24). 2/59 What is 3597/74937560/18? 2/125 What is the value of 7-1(-621)/61012/(-15939)? -46 What is the value of ((1031264/(-804))/481)/((-4)/(-102))? -68 What is the value of ((6/(-8))/((-2)/(-8)))/(53/(-424)-8)? -3 Evaluate (-184)/24840-2550(-18)/4. -85 (-2)/((-3)/3)(-66080)/2240 -59 What is the value of (2/9)/((-26320)/(-12673080))? 107 Calculate 616/(-72)(-1712)/4708. 28/9 What is the value of (43371/(-9638))/(18/104)? -26 What is the value of (150/(-2125))/((-36)/(-12))? -2/85 What is the value of (271/((-4607)/935))/(25/(-12))? 66 Calculate (39(-86)/(-41925))/((-4)/(-30))90. 54 What is -1((-4176)/(-216))/(-2(-3)/(-9))? 29 Calculate (3/90-5)/(22/(3080/1085)). -2/93 What is ((-168)/(-10))/(686/(-1372)8/(-10))? 42 What is the value of 559209/(-479322)12/(-7)2/(-6)-216? 144 Calculate 120/3222/242. 55/8 Evaluate ((-3445)/212)/((125/(-10))/(-5)2/(-24)). 78 What is (-128)/88(903/(-86))/21? 8/11 What is the value of (6/8(-26096)/(-4893))/(1-31)? -4/31 What is the value of (-22)/((-11)/3(-6)/3190050)? -116 Calculate (14/4)/(12845/(-1468)). -2/5 Evaluate (-4770)/10612/1608. -27 ((-36)/(-28))/((-1533)/(-14308))9/(-4) -27 Calculate 28/802/(((-315)/14)/(-45)). 7/5 Calculate (-23)/(10/(((-24)/10)/(64/320))). 36/5 Evaluate 3240/180(2/(-9))/(6/9). -6 What is the value of (-96)/(-420)(-960)/166413? -12/7 What is the value of 17/(-34)120/(-80)*-188? -141 What is	{ "pile_set_name": "DM Mathematics" }
*2 Find the second derivative of -5c*5 + 4259c*2 - 32119c. -100c3 + 8518 Find the second derivative of -2264899a*3d + 30ad - 7803a + 1 wrt a. -13589394ad What is the first derivative of -87387q*3v - 89648q3 wrt v? -87387q*3 Find the third derivative of 18856l*4 - 2l*2 + 15595 wrt l. 452544l What is the first derivative of 7026m4 + 2m + 11712 wrt m? 28104m3 + 2 Find the second derivative of 94942aj5 - 2aj4 + 699aj + 71a wrt j. 1898840aj*3 - 24aj2 Find the second derivative of 2dhv*2 - 51dhv - 150dh - 11dv*2 - hv*2 + 1701v*2 wrt v. 4dh - 22d - 2h + 3402 What is the third derivative of -76h*6 - 92h*4 - 10h*2 + 4h - 524 wrt h? -9120h3 - 2208h What is the first derivative of -5592b4 + 2b*3 - 6b - 472819? -22368b3 + 6b*2 - 6 What is the second derivative of -8jw2 - 1398jw + 13j - 92268w2 - w + 1 wrt w? -16j - 184536 Find the third derivative of 672s3x*5 - 189s*3 - 516sx5 - 4782sx2 wrt x. 40320s*3x*2 - 30960sx2 What is the third derivative of 2fh3 - 3f - h*5 - 4583h*3 - 120h*2 wrt h? 12f - 60h2 - 27498 What is the third derivative of -1377x*5 - 9x*4 + 46x*2 + 2361 wrt x? -82620x*2 - 216x What is the third derivative of 436463o3 - 5o*2 - 308o + 35 wrt o? 2618778 Find the first derivative of 179407cm + 751183c + 2 wrt m. 179407c Find the third derivative of -51pry3 - pry2 - 2py3 + 2py2 + 2p + 137ry*3 - 24r - 16y2 + 4y wrt y. -306pr - 12p + 822r What is the second derivative of -x*4 + 140927x*2 + 245847x wrt x? -12x2 + 281854 Find the first derivative of c2uv3 + 698c*2v*2 + 6221cuv*3 - 6cv3 wrt u. c2v*3 + 6221cv3 What is the first derivative of -2afw - 33af - 41aw*2 - 19fw - 33f + w + 11 wrt w? -2af - 82aw - 19f + 1 Find the third derivative of 2i*6 - 29i*5 + 106i*3 - 10i*2 + 698i - 2 wrt i. 240i3 - 1740i*2 + 636 What is the third derivative of 5353439t*3 - 138t*2 + 4t + 94? 32120634 What is the second derivative of -600651b5 - 149159b wrt b? -12013020b3 Differentiate -132bn - 144519b + n*2 + 41n - 1 wrt n. -132b + 2n + 41 What is the second derivative of -358743a4 - 58638a + 2 wrt a? -4304916a2 What is the first derivative of 406871i*3 + 133899 wrt i? 1220613i*2 What is the third derivative of 2cq5 - 44273cq3 - 1997cq2 - 36cq wrt q? 120cq2 - 265638c What is the second derivative of -150t5 + 130t*4 - 134460t wrt t? -3000t3 + 1560t*2 What is the second derivative of 2747o*5 - 9o*4 + 15o*2 - 664307o + 2? 54940o3 - 108o*2 + 30 What is the third derivative of 5d*2k*4 + 38429d*2k*2 + 164dk3 + 2k*4 + 2k*3 wrt k? 120d*2k + 984d + 48k + 12 What is the third derivative of 197d6 + 3d*4 - 13d*3 - 37490d*2 wrt d? 23640d*3 + 72d - 78 What is the derivative of -8nsxy + nsy - 130nxy - 32ny + sxy - 1653sy + 3y wrt s? -8nxy + ny + xy - 1653y What is the third derivative of 6235j2w3 + j2w + 2j*2 + 6763jw2 - 154w*5 - 2w*2 - w wrt w? 37410j*2 - 9240w*2 Differentiate -263hmz + 2hm + 303hrz - h - 362mrz + 4z - 4 with respect to r. 303hz - 362mz What is the second derivative of -9753j*2m*2y - 2j2y - jy - 82j - 6m2y + 42m2 - m wrt j? -19506m*2y - 4y Find the second derivative of -2k*2x*4 + 12940k*2x*2 + 58k*2x - 6k2 + 2k + 25x wrt x. -24k*2x*2 + 25880k*2 What is the first derivative of 691ak3 + 65ak + a - k4 - 1555052 wrt k? 2073ak2 + 65a - 4k3 What is the second derivative of 35397x*4 - 125x - 11 wrt x? 424764x2 Find the third derivative of 769753f*3 - 561290f*2. 4618518 Find the second derivative of 57727x*3 + 2x - 9524 wrt x. 346362x Differentiate dh*2n + 2dh*2u + 2dh*2 + 26dh - d - 43h*2nu + 32hnu - hn with respect to u. 2dh2 - 43h*2n + 32hn Find the third derivative of 15i5 - 39i*4r*2 + 3i*3r - i*2r + 33090r2 - 1 wrt i. 900i*2 - 936ir2 + 18r Find the first derivative of -882455r2 - 751191 wrt r. -1764910r Differentiate 1133785o2 - 793349. 2267570o Find the first derivative of 61597b2 + 7398. 123194b Find the third derivative of -5282710b3 + 10474b*2 + 3b - 23 wrt b. -31696260 Find the third derivative of 88m4 - 6101m*3 + 39m*2 + 11313 wrt m. 2112m - 36606 What is the third derivative of -10boq3w + 11boq3 - 2boq*2w - 14bow + 2bq3w + 3bq*2w - 781oqw wrt q? -60bow + 66bo + 12bw Differentiate -2b2c*2 + 259b*2l + 41bc*2l + 1209bc + 2b - 6c*2l + 7c wrt l. 259b*2 + 41bc2 - 6c*2 Differentiate 2c*2r - 6c2 + 104cr + 3804c - 387r + 7 wrt r. 2c*2 + 104c - 387 What is the third derivative of -31205m3n*2t2 - m3nt*3 + 2m*2t*3 - 7m*2t*2 + 10mn2t - 70n2 wrt m? -187230n*2t*2 - 6nt3 What is the third derivative of -63o*6 + 467o*3 + 29o*2 + 428o wrt o? -7560o3 + 2802 Find the third derivative of 73863k*2o3 + k2o2 - k2o + 5ko*4 - ko*3 + 978o*2 - 4 wrt o. 443178k*2 + 120ko - 6k What is the third derivative of -12p5z*2 - 1072p*5 + 20p*2z*2 - 4p*2 - 2pz wrt p? -720p*2z*2 - 64320p*2 Find the third derivative of 5099058g*6i*2 + 61g*2i2 - g2 - 22gi*2 - 2gi + 6i*2 wrt g. 611886960g*3i*2 What is the second derivative of -7x4 - x3 - 30x2 - 299046x? -84x2 - 6x - 60 What is the third derivative of -4i6s*2 + 10947i*3s*3 - 1823i*2s*3 + 5s*3 wrt i? -480i*3s*2 + 65682s*3 What is the first derivative of 3ny4 + 93073n + 2y4 - 5010y*2 wrt y? 12ny3 + 8y*3 - 10020y Find the second derivative of 2986x5 - 13x*4 + 2x*2 + 1437112x wrt x. 59720x3 - 156x*2 + 4 Find the third derivative of -19079x*3 + 7956x*2 - 2x - 1 wrt x. -114474 What is the second derivative of -780356j2 - 9j - 9517 wrt j? -1560712 What is the third derivative of -122137n3sw2 + n2sw2 - 7n*2sw + 4n*2w*2 - 27ns + 5n wrt n? -732822sw*2 Find the second derivative of 31al2q*3y - 1863al*2q*2y*2 + 2al + aq*2y - 147q3 - 16qy2 wrt l. 62aq3y - 3726aq*2y*2 Find the second derivative of 82404r*3 - 2r*2 - 313449r. 494424r - 4 Find the second derivative of 5109m*5 - 2m4 + m3 + 133851m. 102180m*3 - 24m*2 + 6m Find the second derivative of 228133i2 + 305i + 448. 456266 Find the second derivative of -615554d2 - 76106d. -1231108 What is the second derivative of -83dm*2 + dm + 618d - 37m*3 - 6m wrt m? -166d - 222m What is the second derivative of -11k2q*3 - 1200k*2q + 3kq*3 + 9kq + 68k - 2q3 wrt k? -22q*3 - 2400q What is the second derivative of 950z3 - 69z*2 - 161423z + 3 wrt z? 5700z - 138 What is the derivative of 203304n*2 + 321250? 406608n What is the third derivative of -127025j5 + 107j*2 + 193j? -7621500j2 Find the third derivative of -2214901f*3 - 2224901f*2 wrt f. -13289406 What is the third derivative of 408c*2n*3 - 60c*2n*2 + 64n*6 - 124n*2 wrt n? 2448c*2 + 7680n*3 Find the first derivative of 591hlp + 2hl + 8h + lp - 4l - 76p + 2 wrt h. 591lp + 2l + 8 What is the second derivative of 8x*4 + 44x*3 + 22x*2 - 13x - 1425 wrt x? 96x2 + 264x + 44 What is the second derivative of 9o3r*4 + 2188o*3 + 2o*2r - 2r5 + 1324r*2 - r wrt r? 108o*3r*2 - 40r*3 + 2648 Find the second derivative of 50078u*2 + 257220u wrt u. 100156 What is the second derivative of -607go*2 + 158go - 6gr + 3o*5 + 8o*3 + 2o*2r - 14o wrt o? -1214g + 60o3 + 48o + 4r Find the third derivative of -75b*2iy3 - b2iy - 17419b*2y3 - b2 + 6bi + 2iy*2 + iy + 7i wrt y. -450b*2i - 104514b2 Find the third derivative of n4 - 13585n*3 + 32280n*2. 24n - 81510 Differentiate -109450g3 + 19125. -328350g*2 Find the third derivative of 184088b*5 + 2b3 + b2 - 122250b - 1 wrt b. 11045280b**2 + 12 Find the first deriva	{ "pile_set_name": "DM Mathematics" }
000001 Let u = -28 - -28.0000172. What is u rounded to six dps? 0.000017 Let j = 9372850 + -9372827.999964. Let b = 28 + -50. Let t = j + b. Round t to 5 dps. 0.00004 Let b = 2396769 + -2396769.4200122. Let w = b + 0.42. What is w rounded to six dps? -0.000012 Suppose -5i - z + 24 = 0, -3z + 0z = -5i + 28. Suppose 3b - 157834 + 2007819 = ia, 740005 = 2a + b. What is a rounded to the nearest 100000? 400000 Let w = -0.3 - -0.268. Let m = -2.268 + w. Round m to the nearest integer. -2 Suppose -4r = -6168411 - 33325533. Suppose 2d + r + 2726514 = 0. What is d rounded to the nearest 1000000? -6000000 Let j(i) = -2 + 2 - 10800i. Let y(v) = v*3 - 6v*2 + 5v - 5. Let w be y(5). Let b be j(w). What is b rounded to the nearest ten thousand? 50000 Let h = 160.4 - 160.4693. Round h to 3 dps. -0.069 Let f = 10 - 22. Let q = -12.00000045 - f. What is q rounded to seven dps? -0.0000005 Let a(y) = -851500y - 1. Let p be a(-2). Suppose p + 377001 = 4d. Suppose 3u - d = -u. Round u to the nearest 100000. 100000 Suppose -390660 + 3486660 = -8g. What is g rounded to the nearest one hundred thousand? -400000 Suppose -4g = -o - 77, -5g = -o + 4o - 109. Let y be (g/(-15))/((-2)/5401464). Let d = y + -9600976. Round d to the nearest 1000000. -6000000 Let l = 1 - -3. Let s = 106044622.00000008 - 106044626. Let i = l + s. What is i rounded to 7 decimal places? 0.0000001 Let a = 10.00016 + -10. Let p = a - 0. Round p to five dps. 0.00016 Let x = -94.896 + -0.104. Let c = x - -95.0106. Round c to 3 dps. 0.011 Suppose 3o - 11 = 10. Let n = -92 + o. What is n rounded to the nearest ten? -90 Let g(k) = -235938k3 + k2 + 4k. Let u be g(4). Round u to the nearest one million. -15000000 Let i = -24 + 17. Let t = -43819681.9999966 - -43819689. Let c = t + i. Round c to 6 decimal places. 0.000003 Let f = -8 + 8.00000038. What is f rounded to 7 dps? 0.0000004 Let d = 2.8 + 9.7. Round d to the nearest integer. 13 Let r = -7 - -10. Suppose -2j - 5b = rj - 899995, 4j - 719999 = -b. Round j to the nearest 100000. 200000 Let k = 45.99832 + -46. What is k rounded to 4 dps? -0.0017 Suppose 5s = -2j + 164520, j - 3s - 164488 = -j. Let y = j - 142250. Round y to the nearest 100000. -100000 Let x(b) = b - 3. Let q be x(5). Suppose 2s = -qs. Suppose sf + 1700 = 5f. Round f to the nearest 100. 300 Let v(d) = 3d + 1. Let m be v(1). Suppose -mk - 37 = 27. Let a = 24 - k. Round a to the nearest 10. 40 Suppose 5x + 747 = 2r, 0 = -2x + 3r + r - 286. Round x to the nearest 10. -150 Let k = -7.81 + 8.2. Let t = k - 6.79. What is t rounded to the nearest integer? -6 Let o = -45 - -44.19. What is o rounded to one dp? -0.8 Let c(z) = z2 + 9z + 10. Let i be c(-8). Suppose iq = -2q - 20. Let o(k) = -k*3 - 4k*2 - 3k. Let u be o(q). Round u to the nearest ten. 40 Let r = -144.03 + 143. Round r to 1 decimal place. -1 Let l = 54 - 54.0000184. What is l rounded to 6 dps? -0.000018 Let y = -0.76 - -0.26. Round y to zero dps. -1 Let w(v) = -v + 7. Let y be w(3). Let d(q) = -318751q2 + 4q. Let r be d(y). Round r to the nearest 1000000. -5000000 Let y = -0.121 + 49.121. Let x = y + -49.000029. What is x rounded to 5 dps? -0.00003 Let l = 19.67 + -20. Let q = -18211838 - -18211837.67000027. Let j = l - q. What is j rounded to seven dps? -0.0000003 Suppose -6770 = -2c + 2h, -c + 4c - 4h = 10157. Suppose -x = c + 617. What is x rounded to the nearest one thousand? -4000 Let k(i) = -i*3 + 2i*2 + 2i - 1. Let v be k(2). Suppose -5t = -vq + 129010, 2q - t - 85990 = -6t. Round q to the nearest ten thousand. 40000 Let w = 0 + 2. Let t = 2.06 - w. Round t to 2 decimal places. 0.06 Let t = 42 + -15. Let i = t + -26.99999923. Round i to seven dps. 0.0000008 Let z = 258706.1199965 - 258706. Let m = 0.12 - z. Round m to six dps. 0.000004 Let o be 6/21 + (-518002)/7. Round o to the nearest 10000. -70000 Let r = -367.3016 - -367. Let t = -7 - -6.7. Let s = t - r. What is s rounded to three dps? 0.002 Let r = -17 - -15.96. Let q = 7.34 + r. Round q to the nearest integer. 6 Let o = -0.16 - -0.160075. What is o rounded to 5 dps? 0.00008 Let j = 114.6 - 105. Let s = j + -11. Let b = s + 6.6. Round b to 0 decimal places. 5 Let p = -0.8200076 + 0.82. Round p to 5 dps. -0.00001 Let g = -10253 + 27167. Let o = 16919.9928 - g. Let z = -6 + o. Round z to three dps. -0.007 Let t = 271 + -431. Let z = -159.999931 - t. Round z to 5 decimal places. 0.00007 Let d = 14 - 14.13. Let m = d - -0.1300112. Round m to 6 dps. 0.000011 Suppose q = 3r - 3q + 392980, 5q + 25 = 0. What is r rounded to the nearest ten thousand? -130000 Let f = 14 + -10. Let b = f + -3.99999988. Round b to seven decimal places. 0.0000001 Let n = 132 - 132.000113. Round n to five decimal places. -0.00011 Let h = -181516.2 + 181612.2083. Let c = h + -96. Round c to 3 dps. 0.008 Let y = -248.7962284 - -271.796237. Let n = y - 23. Round n to six decimal places. 0.000009 Let x = 0.06 + -0.21. Let y = x - 0.75. What is y rounded to one dp? -0.9 Let u = 2684 - 2797.7. Let h = u - -92. Let j = 22.67 + h. Round j to one decimal place. 1 Suppose 2n - 4t + 9 = -11, -4n = 4t - 8. Let w(o) = 315000o*2 + o + 2. Let k be w(n). Round k to the nearest one hundred thousand. 1300000 Let i = 29.056 - 0.056. Let s = i + -29.00044. Round s to four dps. -0.0004 Let k = 0.022 + 21.978. Let h = 34 - k. Let r = 12.00076 - h. Round r to 4 decimal places. 0.0008 Suppose n + 9 = -2m, -3n - 14 = 4m + 5. Let u be (1(1 - 6))/n. Suppose -2x - 5b = -x + 2020, 8020 = -4x - ub. Round x to the nearest one thousand. -2000 Suppose 0 = -2g + 5 + 9. Let c be 2/(-7) - (-16)/g. Suppose m + 1 = 0, -b - 4m + 158 = cb. What is b rounded to the nearest 10? 50 Let y = 27.6 + -9. Let g = -20.07 + y. Round g to 1 decimal place. -1.5 Let z = -385671.32 - -385635.320037. Let k = -43 - -79. Let u = k + z. Round u to five decimal places. 0.00004 Let a = -12727 + 28727. Suppose t + a = 5t. Let c be (1473 + (2 - 0))t. What is c rounded to the nearest 1000000? 6000000 Let k = 0.00589793 + -0.0059. Round k to 7 dps. -0.0000021 Let l(x) = -111548x - 2. Let o be l(-2). Let w = o + -119094. What is w rounded to the nearest ten thousand? 100000 Let x = 3.6 + -1.5. Let f = x + -2.0999956. What is f rounded to six decimal places? 0.000004 Let g = 568.924 - 580. Let h = 11 + g. Round h to 2 dps. -0.08 Let k = -0.49 - 0.01. Let w = k - -0.5003. What is w rounded to 4 decimal places? 0.0003 Let f = -21 + -28. Let g = f - -1. Round g to the nearest 10. -50 Let p = 141805 + -98623. Let t = p - 146182. What is t rounded to the nearest ten thousand? -100000 Let a = 40.062 + -40. Let q = a + -0.011. What is q rounded to two dps? 0.05 Let v be 0/(4 + (-2 - 0)). Let o be 2 - v2/(-4). Suppose -4g - om - 2853 - 351 = 0, 0 = 2g - 4m + 1592. Round g to the nearest one thousand. -1000 Suppose -2z - z + 2639073 = 0. Suppose 2936 - z = -5h. Let y = 295351 - h. What is y rounded to the nearest 100000? 100000 Let y = -2.008 + 2. Let o = 0.22 - 0.2. Let b = y - o. Round b to 2 dps. -0.03 Let j = 1.5 - -2.5. Let c = -105858 + 105854.00001. Let q = c + j. What is q rounded to 5 dps? 0.00001 Let s = 1654 + -1653.6559. Let i = s + -0.35. What is i rounded to 3 dps? -0.006 Let w = 3928688 + -3928687.7899981. Let c = 0.21 - w. What is c rounded to 6 decimal places? -0.000002 Let z = -0.13 + 0.1282. Round z to three dps. -0.002 Let r = -128.61 - 2.39. Let q = r + 130.883. Let u = q - -0.11569. What is u rounded to four decimal places? -0.0013 Let u = -138.9995 + 139. What is u rounded to 3 decimal places? 0.001 Let a = -18 - -8. Let c be a((-304)/(-20) - -4). What is c rounded to the nearest ten? -190 Let r = 71.938 - 72. What is r rounded to two decimal places? -0.06 Let m be 34/8 + (-2)/8. Suppose 0l + 2f - 414620 = 5l, ml + f = -331709. Let c = l + 141926. Round c to the nearest 10000. 60000 Let q(y) = -y3 + y + 1. Let o be q(-1). Let m be 2 + 116999 - 1/o. Suppose m = -3g + 5d, -5d = -4d. What is g rounded to the nearest 10000? -40000 Let g be 203 - (-4)/(-1). Round g to the nearest 100. 100 Let d be 0 - (2 - 0) - -2. Suppose v - r - 385 = d, 3v - 5r = 763 + 402. What is v rounded to the nearest 100? 400 Let t = 45404.0085 + -45428. Let w = t	{ "pile_set_name": "DM Mathematics" }
e (-5 - (-31)/7)/2. Let u = -0.31 - -0.1. Let j = u + -0.29. What is the nearest to -1/4 in -2, f, j? f Let s = 981 + -983.26. Let n = 1.96 + s. Which is the nearest to 0? (a) -2/13 (b) n (c) -8 (d) -0.5 a Let x be 42/(-20) - (-6)/15-1. Which is the nearest to 1? (a) 0.05 (b) 2 (c) x (d) -4 a Let s = 231 - 231.5. Let w = -3.3 - 0.7. Which is the nearest to -5? (a) w (b) s (c) 0 a Suppose 3s - 1841 = -1736. Suppose -v = 4v - 150. Let x = v - s. What is the nearest to x in 0, 0.5, -4? -4 Let z = 425 + -581. Let m = 154 + z. Let i = 0.3 + -0.4. Which is the nearest to -1? (a) i (b) 1/5 (c) m a Let j = 2/8111 + 16184/154109. What is the nearest to -1 in -9/2, 4, j? j Let t = -172 + 173.27. Let b = t + -5.27. What is the nearest to -1 in 0, b, 4? 0 Let x = 2.1 - 2. Let i = -214.8 + 215.2. What is the closest to i in x, -2, -1? x Let a = 31.58 + -24.58. Let q = 85.5 - 86. What is the nearest to 0.02 in q, -2/3, a, 4? q Suppose 0 = -14l - 6l + 60. Suppose 5n - 35 = -2q, 7n + q = ln + 25. Which is the closest to -1/2? (a) n (b) 1/4 (c) -0.6 (d) -2 c Let u = -33/10 + 19/5. Let i be (-136)/7143/(-2). What is the nearest to -1 in -0.29, u, i? -0.29 Let c = -0.5 + 0.2. Suppose -6659 = -65s - 6594. Let p be ((-12)/21)/(1 + 1). What is the nearest to p in s, c, -2/7? -2/7 Let z = -0.2633 + -0.1412. Let d = z - -0.0045. Which is the closest to 1? (a) 5/6 (b) d (c) -3 a Let s be ((1 + -2)-1)/(14/(8 - 1)). Let o = 0.9 + 1.1. What is the nearest to s in -13.4, o, -0.2? -0.2 Let r(m) = -54m - 163. Let o be r(-3). Let a = -24 + 25.7. Let i = a - 1.9. What is the closest to i in -0.2, -2/5, o? -0.2 Let i be 1(-9 + 6) + 78/10. Suppose 16 - 35 = 19s. Which is the nearest to -0.3? (a) i (b) s (c) 0.3 (d) -5 c Let l = 1.96 - -0.04. Suppose -2z - 14 = 2n, 3z = 3n - 99 + 90. Which is the nearest to -2/11? (a) 3/10 (b) l (c) z a Let d = 47.5 - 47. Let y = -610 + 610.1. Which is the nearest to y? (a) d (b) -97 (c) 1/7 c Let s = -1196 + 1198. Suppose 5m + 5v + 15 = 0, -7 = 2m - m + 3v. What is the closest to m in 17, 0, s? 0 Let i = 102 - 69. Let r = 11 - 39. Let p = r + i. Which is the nearest to 1? (a) -5 (b) p (c) 0.4 c Let j = -10576 - -10576.1. Suppose 0 = -l - 3 + 5. Suppose 1 - 21 = -4g. Which is the closest to l? (a) g (b) j (c) -3/8 b Suppose -227 = h - 0h - 3q, -3q = -3. Let l = h - -224. Let i = 0.36 - 0.06. Which is the nearest to l? (a) i (b) -0.1 (c) 4 b Let j = 10841 - 10840.82. What is the nearest to 0.2 in -0.2, 0.5, j, 3? j Let n = -6 + 6.4. Let z = 45035 + -45032. Which is the closest to -1/4? (a) n (b) z (c) -1 a Let v(f) = f3 + 2f*2 - 60f - 179. Let x be v(-7). What is the nearest to -3/8 in x, -7, -0.4? -0.4 Let d be -10 + 4 + (-6080)/(-18). Let q = 332 - d. Which is the closest to 0? (a) 1/4 (b) 3 (c) q c Let t = -0.16 - -0.06. Let o = -568 - -571.3. Let z = 4.1 - o. Which is the nearest to z? (a) 2 (b) 1/4 (c) t b Let p = 14283 - 186487/13. Let f = p + 62. Let m be -3 - 0 - 8/(-3). What is the nearest to m in 1, -3/7, f? -3/7 Let j = 1125/28 - 14681/364. Which is the nearest to 0.1? (a) 3/5 (b) j (c) 5 b Let a be ((-144)/13554)/((-16)/(-36)-3). What is the closest to -1/2 in a, -0.3, -2/7? -0.3 Let t = -21360/767 + 1634/59. Suppose 0 = -3o - 3. Which is the nearest to 2/13? (a) -1/7 (b) o (c) 0.3 (d) t c Let j = 320.09 + -324.09. What is the nearest to 1 in -0.53, 0.5, -1, j? 0.5 Let i = 60910 + -60909.99. Let h = -0.4 - 0.1. Which is the closest to i? (a) 0.2 (b) h (c) -3 a Suppose -6h = -h. Let n = 503 + -502. Let g be (6/21)/2 + 0. Which is the closest to h? (a) g (b) n (c) -0.4 a Let v = -1933/5 + 13541/35. What is the closest to 3 in v, 2, 1/9, -3? 2 Let p = -18.45 + 17.65. Which is the nearest to 2/5? (a) -1 (b) -1/14 (c) p b Let f = -97110.7 + 97111. Let m(j) = -2 + 2j + j2 + j2 - 4j. Let x be m(2). What is the nearest to x in -8, f, -6/11? f Let q be 212 - (28 - 462/22). Which is the closest to 1/5? (a) q (b) -1 (c) 0 c Let o = 0.09703 - -0.90297. What is the nearest to 0.1 in o, -0.3, 180/17? -0.3 Let y = -12.49 - 0.91. Let i = -9.4 - y. What is the nearest to i in -3, -1, -0.06? -0.06 Let u = -1994 - -1997. What is the closest to -5 in 104, -2/3, u? -2/3 Let s = 4.2304 + -0.2304. Which is the nearest to -2? (a) -1 (b) 6 (c) -23 (d) s a Let g = -22 - -21.44. Let o = -10.04 + g. Let t = -11 - o. What is the nearest to 7 in -0.2, t, 5/3? 5/3 Let n be (-2)/4 - (-7)/10. Let s(o) = o2 - 11o - 9. Let m be s(12). Suppose -r + 2 = 3c, -3r - m = -c - r. What is the nearest to -0.1 in c, -0.5, n? n Let r = -34045 + 34050. What is the closest to -1/7 in -5, -0.1, r, 0? -0.1 Let p = 6288 - 4372. Which is the nearest to p? (a) 0 (b) -5 (c) 0.4 c Let q be 12/27 - (-5191)/(-2871). Which is the closest to q? (a) -1/3 (b) 0.2 (c) -0.1 (d) 3 a Let y be (11/((-594)/(-45)))/(18/(-24) - -2). Let k = 0.2 + 0.8. Which is the nearest to k? (a) y (b) 1/2 (c) 0.1 a Let v = 28685 + -28671. What is the closest to v in -1.2, -0.1, -1, 1/8? 1/8 Let v be 100/45-1 - (-9 - (-2 + -5)). Which is the nearest to v? (a) -5 (b) 3 (c) -3 c Let j = 932 - 931.9. Let v be ((-756)/112)/((-3)/(-16)). What is the closest to j in -4, 3, -2, v? -2 Let f = -0.2 - -0.1. Let t = 43239 + -43229. Let l = 0.1 + 0.1. Which is the closest to t? (a) -0.3 (b) l (c) f b Suppose 0 = -5k + j + 11, 66 = -2k - 3j + 50. Let u = 0 + 0.2. Which is the nearest to 1/4? (a) u (b) k (c) -1/11 a Let m = -845/7 + 119. Let i = -125.9 - -125. Let x = i - -1.9. What is the nearest to 1 in x, 5, m? x Let w = 215/3 - 71. Suppose -5j - 34 = -54v + 55v, 0 = 3v - 2j. Which is the nearest to 2/7? (a) w (b) 5 (c) v a Let v = -6.89 + 6.49. What is the nearest to 0 in 16, v, 78? v Let k = 0.24 + -0.2. Let j = k + -0.34. Let d = 11287 + -191881/17. What is the closest to -2 in j, -1/5, d? j Suppose 2h - 65 = -3r, 0 = h + 3r - 8r - 26. Suppose 15 = -34p + hp. What is the closest to p in 5, -4/3, -1/6? -4/3 Let p = 823 + -822.988. Which is the closest to 2? (a) 3 (b) 0.4 (c) -3/4 (d) p a Let n be (30/9 + -4)-3 + 2. Let y = 0.28 - -0.1. Let j = -3.38 + y. Which is the nearest to 2/17? (a) j (b) n (c) -1/4 c Let o = 5090.3 + -5090. What is the closest to o in -2, -0.3, 5/3, -0.01? -0.01 Let m = 1369.81 + -1367.81. Let t = 1 + 3. Let p = t + -3. What is the closest to p in m, 4, 1? 1 Let r = 814 - 816. Let x = 0.2 - -0.8. Let h = 155 + -153. What is the nearest to x in r, h, 2/7? 2/7 Suppose j + g + 6 = -j, -2 = -3j + 4g. Let h = -1.6018 - -1.1018. What is the closest to 9/7 in -0.2, h, j? -0.2 Suppose -10 = -5s + 5. Suppose 13 = 4j - sv + 50, j + 3v = -13. Let u be 6/j - (-2 - 2 - -4). Which is the nearest to 0? (a) 3 (b) u (c) 1/4 c Let s be (-4(4 - 5))/(2/(-29)). Let j = -59 - s. Let k be (-1)/j - (-4 - -2). What is the closest to k in 1, 3, -2/7? 3 Let n = 0.7055 - 0.2055. What is the closest to n in -1/25, -1/3, 5/4? -1/25 Let v = -11551.5 + 11551. What is the nearest to 0.301 in -5, 2, -2, v? v Suppose z = -k - 8, 165k - 162k - 60 = 4z. Which is the closest to -0.1? (a) -0.2 (b) 30/13 (c) z a Let m = 20.609 + -21.009. Which is the nearest to 0.2? (a) -1/2 (b) 1 (c) -6 (d) m d Let v = -14.41 - -12.41. Let r = 0.37 + -3.37. Let k = 2.9 + r. Which is the nearest to 2? (a) k (b) v (c) 3 c Let y = 1160.3 - 1160. Let j be 8/(-12) - (-2)/3. Suppose j = -2f + 4q - 2, -f + 0q + 4q + 3 = 0. What is the nearest to 2/7 in f, y, -0.1? y Let w = -0.33 - -0.347. Let y = -0.037 + w. Let u(n) = n*3 - 15n*2 - 15n - 17. Let t be u(16). Which is the nearest to t? (a) -4/3 (b) y (c) 0.4 a Let z = -42 - -25. Let g = 17.5 + z. Let v = 2.24 + -2.54. Which is the nearest to 5/7? (a) -1/3 (b) v (c) g c Suppose -4q - 3z + 94 = 0, -9q - 4z = -11q + 36. Suppose 0 = -qj + 4j - 36. Which is the closest to j? (a) -2/9 (b) -5 (c) -1 c Suppose -2 = -10p + 9p. Let d(n) = -n3 + n2 - 4n + 7. Let v be d(2). Which is the nearest to 4/7? (a) p (b) 0 (c) v b Let i = 9.938 + -7.738. Let v = -24 + 28. Which is the nearest to v? (a) i (b) 0.2 (c) -0.5 a Let y = 0 - 0. Let l = -1937/40549 - 1/989. What is the nearest to 0 in y, l, 3? y Let u =	{ "pile_set_name": "DM Mathematics" }
is 11000 - -11022? 22022 In base 3, what is -1 - -21022010? 21022002 In base 15, what is 0 + -cc? -cc In base 10, what is -51 + 74? 23 In base 14, what is 14 + -c? 6 In base 16, what is -33 + a? -29 In base 6, what is -23123 - 5? -23132 In base 10, what is 18 - 39? -21 In base 3, what is 2 + 2011022? 2011101 In base 6, what is -4 + -3350? -3354 In base 8, what is -14 - -74? 60 In base 5, what is 4 + -120? -111 In base 3, what is -10 + -21000022? -21000102 In base 3, what is 1012111 - -12? 1012200 In base 16, what is -3 + -d? -10 In base 3, what is 21211101 - 2? 21211022 In base 12, what is -2 + -89? -8b In base 15, what is 5 + 29? 2e In base 4, what is 213310 + 0? 213310 In base 16, what is 2b + 1c? 47 In base 10, what is 1 - -367? 368 In base 10, what is 147 + 40? 187 In base 2, what is -100110 - 11? -101001 In base 7, what is -2262 - 3? -2265 In base 4, what is -10 + 1102332? 1102322 In base 3, what is 1 - 220102? -220101 In base 9, what is 244 + -3? 241 In base 8, what is -13 - -655? 642 In base 2, what is -1011 - 11010110000? -11010111011 In base 9, what is 65 + 5? 71 In base 4, what is -12 - -33? 21 In base 7, what is 105 + -2? 103 In base 2, what is 101 + -10100011? -10011110 In base 5, what is -441 - -200? -241 In base 11, what is 862 - 4? 859 In base 10, what is 1271 + -4? 1267 In base 8, what is -1041 - -3? -1036 In base 4, what is -1131 + 102? -1023 In base 8, what is 12 + -10? 2 In base 15, what is 91 + 0? 91 In base 13, what is -4a08 - -2? -4a06 In base 13, what is -19c - 1b? -1ba In base 11, what is -41 + -21? -62 In base 13, what is 1 + 105a? 105b In base 4, what is -1 - -13222? 13221 In base 14, what is 23b - 6? 235 In base 6, what is -10045 + 2? -10043 In base 12, what is -7 + 301? 2b6 In base 2, what is -1001001100 + 1? -1001001011 In base 12, what is 20b8 - -4? 2100 In base 6, what is 1440 + -1? 1435 In base 13, what is -4 - 67? -6b In base 4, what is 11 - 31303? -31232 In base 5, what is 33 + -33? 0 In base 9, what is -312 + -1? -313 In base 4, what is 10 - 11123? -11113 In base 12, what is 2 + -8a7? -8a5 In base 15, what is 9 + -3a? -31 In base 8, what is 0 + 73? 73 In base 9, what is -2 + 2314? 2312 In base 16, what is -1 + 32? 31 In base 10, what is 22 - 124? -102 In base 12, what is 2 - 806? -804 In base 9, what is 14 + 1433? 1447 In base 12, what is a00 + 0? a00 In base 10, what is 18 + 2153? 2171 In base 15, what is -6 - -52? 4b In base 5, what is -1 - 11141? -11142 In base 2, what is 100100111001000 - 11? 100100111000101 In base 11, what is a277 + 0? a277 In base 2, what is 101 + 111000000111? 111000001100 In base 7, what is -2 + 2223? 2221 In base 11, what is -5 + 18? 13 In base 2, what is -1001111101001 + 1? -1001111101000 In base 2, what is -11 - -11101? 11010 In base 9, what is 5 - 333? -327 In base 8, what is -162 - -110? -52 In base 9, what is -41 - 3? -44 In base 15, what is 2 + a? c In base 6, what is 5 - -32150? 32155 In base 16, what is 163 - -1? 164 In base 13, what is -11bb + 2? -11b9 In base 2, what is 100 - 110000? -101100 In base 9, what is 5 - -8? 14 In base 10, what is 116 + -1? 115 In base 10, what is 4272 + 0? 4272 In base 13, what is -4 + bc9? bc5 In base 15, what is -1b2 + -26? -1d8 In base 10, what is 20 - -87? 107 In base 13, what is -3 + 157? 154 In base 13, what is 802c - 1? 802b In base 12, what is 520 + a? 52a In base 6, what is -2 + -510? -512 In base 15, what is -40 - 1a8? -1e8 In base 13, what is -42 + -6? -48 In base 10, what is -8 + 91? 83 In base 2, what is -10 + 1001110? 1001100 In base 14, what is -93 + -68? -11b In base 11, what is 385 + -16? 36a In base 6, what is 10 + 25? 35 In base 2, what is 0 + -101001100111? -101001100111 In base 2, what is 1000 - 1100? -100 In base 16, what is 9e + 1? 9f In base 2, what is 111110111 + 10000? 1000000111 In base 9, what is -1 + 458? 457 In base 7, what is -16506 - -1? -16505 In base 11, what is 15 - 23? -9 In base 11, what is -4 + -21? -25 In base 8, what is 236 + 32? 270 In base 13, what is -239 - 0? -239 In base 13, what is 7 + 1257? 1261 In base 14, what is -2 + 131? 12d In base 9, what is 313 + -4? 308 In base 15, what is 19 + -d? b In base 9, what is 327 + 28? 356 In base 13, what is -2 + -338? -33a In base 11, what is 168 + 2? 16a In base 12, what is 692 - 3? 68b In base 16, what is 4 + -15b? -157 In base 9, what is -1206 + 5? -1201 In base 15, what is 4 + a? e In base 3, what is -1111 + -2? -1120 In base 10, what is -10 + 4? -6 In base 5, what is 1004 + -1? 1003 In base 3, what is 12211 - -10? 12221 In base 16, what is 3d - -7? 44 In base 4, what is -2002 + -3? -2011 In base 2, what is 11101 + -1100? 10001 In base 7, what is 3422 + 20? 3442 In base 11, what is -57a + -8? -587 In base 12, what is 63 - 13? 50 In base 15, what is cb + 3? ce In base 16, what is 5 + -145? -140 In base 15, what is -3 + -413? -416 In base 8, what is 441 + 2? 443 In base 12, what is 103 - 1a? a5 In base 11, what is -4 + -515? -519 In base 15, what is 3a + -6? 34 In base 5, what is -102 - 432? -1034 In base 10, what is 22 + -18? 4 In base 11, what is 8139 + 5? 8143 In base 14, what is 1 - -7da? 7db In base 8, what is -1 - -2106? 2105 In base 6, what is -14 - -24002? 23544 In base 9, what is 14 + -48? -34 In base 5, what is 2 + 344? 401 In base 9, what is 12 - 573? -561 In base 16, what is a3 + -1? a2 In base 12, what is 0 + -80? -80 In base 3, what is 2 - -2020? 2022 In base 3, what is -20101 + 11? -20020 In base 13, what is -32 - 2? -34 In base 15, what is -d9 - 3b? -125 In base 12, what is 7091 + 2? 7093 In base 8, what is 12026 - 7? 12017 In base 2, what is -10101101001 - 11? -10101101100 In base 12, what is -100 + -1? -101 In base 13, what is -1 + 11b? 11a In base 11, what is -89a - -18? -882 In base 7, what is 322 - 10? 312 In base 11, what is 1 - 39? -38 In base 12, what is -2a9 - -1? -2a8 In base 3, what is -101010011 + -11? -101010022 In base 16, what is 77 - 9? 6e In base 5, what is 4 + -30? -21 In base 7, what is -3 + 1010? 1004 In base 2, what is 10101 - -100111010? 101001111 In base 11, what is -24 - 390? -404 In base 11, what is -194 + -16? -1aa In base 4, what is -2 - -103323? 103321 In base 7, what is -5 - -103? 65 In base 10, what is 2420 + 4? 2424 In base 3, what is -10 - 2211? -2221 In base 16, what is -3 - 670? -673 In base 9, what is 1383 + -1? 1382 In base 16, what is -f9b + 2? -f99 In base 8, what is 110 - -10? 120 In base 12, what is -146 - 5? -14b In base 2, what is -1011 + -111? -10010 In base 4, what is 1131 + 121? 1312 In base 4, what is -11311 - -10? -11301 In base 4, what is -10 - -10? 0 In base 8, what is -746 + 2? -744 In base 5, what is 24 - -241? 320 In base 14, what is -1b5 - 5? -1ba In base 10, what is 7 + 5? 12 In base 11, what is 1 - 38? -37 In base 3, what is 10 + 10200? 10210 In base 4, what is -23 - -102? 13 In base 7, what is -2 - 2456? -2461 In base 4, what is -10022 - 111? -10133 In base 6, what is -10143 - -2? -10141 In base 3, what is -20 - -1102201? 1102111 In base 6, what is -4511 + 5? -4502 In base 15, what is 5 + 1a? 20 In base 11, what is -49 + a? -3a In base 13, what is 8 - -41b? 426 In base 5, what is -1 - -11244? 11243 In base 6, what is 2403 + 5? 2412 In base 2, what is -101 + 1000110101? 1000110000 In base 12, what is -2 + 229? 227 In base 2, what is 1100110 + 101? 1101011 In base 10, what is 1 + -2691? -2690 In base 14, what is -65 + -5? -6a In base 15, what is -21 - -b? -15 In base 12, what is -1b5 + 5? -1b0 In base 7, what is 11 + 231? 242 In base 16, what is 5d + 21? 7e In base 8, what is -2467 - 0? -2467 In base 10, what is 16389 - 0? 16389 In base 14, what is -214 + 5? -20d In base 10, what is -21 + 40? 19 In base 3, what is 1000 - 10? 220 In base 9, what is -10 + 38? 28 In base 11, what is -6 - -3a? 34 In base 6, what is 14 + -41? -23 In base 3, what is -222 - -202? -20 In base 4, what is -33 + 10210? 10111 In base 12, what is 262 + -4? 25a In base 2, what is -11 + -1001011? -1001110 In base 2, what is 11101 + 100110000? 101001101 In base 5, what is 40 - 320? -230 In base 4, what is -1 - 1021? -1022 In base 10, what is -75 + 39? -36 In base 10, what is -3 + -2137? -2140 In base 4, what is 13 - 211110? -211031 In base 12, what is 4 - 58? -54 In base 2, what is 101 + -11010100? -11001111 In base 10,	{ "pile_set_name": "DM Mathematics" }
r + 1197. What is 1197h(s) + 2q(s)? 171s2 Let p(a) = -24a*2 - 9a + 9. Let r be (-78)/(-975) - 27/25. Let u be 20/(-8)(r - (-2)/10). Let d(x) = -6x*2 - 2x + 2. Give up(i) - 9d(i). 6i2 Let s(a) = 1260a*2 + 14a - 462. Let c(j) = 97j2 + j - 36. Calculate 77c(p) - 6s(p). -91p*2 - 7p Let t(f) = 2f2 + 12f - 37. Let v(h) = -2h2 - 10h + 30. Let i(z) = -4t(z) - 5v(z). Let b(w) = 2w2 + 2w - 2. Give -3b(o) + 2i(o). -2o2 - 2o + 2 Let i(s) = 21s + 4. Let x(z) be the third derivative of -7z*4/4 - 3z*3/2 - 39z*2 + 6z. Calculate -9i(k) - 4x(k). -21k Let q(g) = -3811g + 7652g - 14 - 3797g. Let t(r) = 9r - 3. Determine 6q(j) - 28t(j). 12j Let x(z) = -35z2 + 9z + 7. Let b(w) = 184w2 - 48w - 36. Calculate -2b(s) - 11x(s). 17s2 - 3s - 5 Let v(d) = d*2 + 8d - 18. Let j be v(-10). Suppose -jo - 21 + 31 = 0. Let w(u) = -9u - 7. Let m(g) = -13g - 9 - 1 + 1 - 1. Give om(l) - 7w(l). -2l - 1 Let h(p) = 27p - 2. Let b(u) = 1062u - 63. Give -b(r) + 45h(r). 153r - 27 Let g(n) = n + 4. Let u(r) = -r - 1. Let i be 8188/(-20) - 6/(-15). Let f = -410 - i. Give fg(a) - 3u(a). 2a - 1 Let w(f) = 53f - 6. Let a(l) = 5 + 409l + 391l - 854l + 0. Give 6a(z) + 5w(z). -59z Let b(n) = -17582n - 149. Let c(p) = 587p + 5. Give -5b(x) - 149c(x). 447x Let f = 20254 - 20252. Let q(v) = -4v*2 + 6v + 1. Let t(d) = 16d2 - 25d - 4. Determine ft(j) + 9q(j). -4j2 + 4j + 1 Let u(m) = 261m2 - 9m + 130. Let o(g) = -65g2 + 2g - 29. What is -9o(t) - 2u(t)? 63t2 + 1 Let u(v) = 2v - 6. Suppose 7a = a + 72. Let o be 4/(24/10)a/4. Let i(t) = -2t + 6. Calculate ou(p) + 6i(p). -2p + 6 Let u(v) = 8v2 + 3v - 1. Let d(n) = 43 - n*2 + 46118n - 42 - 46119n. Determine 3d(a) + u(a). 5a2 + 2 Let h(a) = -46a - 125. Let p(o) = 12o + 2. Determine h(b) + 3p(b). -10b - 119 Let r(t) = -t2 - 4. Let j(m) = 0m2 - m2 + 345 - 164 - 184. Suppose -42 = 2z + 2. Let k = 15 + z. Calculate kj(a) + 6r(a). a2 - 3 Let k(y) = 2y. Let d(j) = -528j + 2. Calculate d(s) - 5k(s). -538s + 2 Let c(z) = 490z*2 - 12. Let q(v) = -1033v*2 + 26. What is 7c(w) + 3q(w)? 331w2 - 6 Let n(u) be the third derivative of -u4/6 - u*3/3 - 37u*2 - 2u - 2. Let h(f) = f. Let w(o) = 2. Let c(i) = 4h(i) + w(i). Determine -7c(k) - 6n(k). -4k - 2 Let r(s) = -43s - 1. Let l(x) = -256x - 1142. Give -l(j) + 6r(j). -2j + 1136 Let g(d) = d*2 + d. Let r(f) = -3f*2 + 2. Suppose 4j - 2a + 5a - 38 = 0, -4 = 2a. Let s = -19 + j. Let c be -6(-2)/8s/(-12). Calculate cr(k) + g(k). -2k2 + k + 2 Let n(o) = 5o + 240. Let d(g) = -6g - 227. Determine -3d(b) - 4n(b). -2b - 279 Let y(j) be the second derivative of -j*3/6 + 4j*2 - j - 81. Let t(u) = -u - 1. Determine 6t(d) + y(d). -7d + 2 Let a(w) = -179w*2 - 57w + 5. Let c(r) = -88r2 - 33r + 2. Calculate -4a(f) + 7c(f). 100f2 - 3f - 6 Let n(k) = -249k2 + 8k + 11. Let y(c) = -124c2 + 3c + 5. Determine 2n(j) - 5y(j). 122j2 + j - 3 Let m(v) = 1365v*3 - 273v*2 - 182. Let w(i) = -91i*3 + 18i*2 + 12. What is 12m(y) + 182w(y)? -182y*3 Let r(d) = -4d*2 - 7d - 21. Let h(c) be the first derivative of -c3/3 - c2 - 7c - 215. What is 14h(v) - 4r(v)? 2v*2 - 14 Let r(f) = 21898f - 21898f - 7 + 9f*3. Let h be (4 - (5 - -4)) + -2. Let x(u) be the second derivative of -2u*5/5 + 3u*2 + u. Calculate hx(i) - 6r(i). 2i3 Let y(r) be the second derivative of -r4/12 - 5r3/6 - r2 + 32975r. Let u(b) = 5b2 + 26b + 11. Let q = -23 - -12. Give qy(h) - 2u(h). h*2 + 3h Let a(p) = -p. Let o(c) = -10c2 - 30c. Suppose -4 - 15 + 2 = 17w. Determine wo(v) + 30a(v). 10v*2 Let h(w) = 176w*3 + 33w*2. Let o = 5554 + -5550. Let v(t) = -11t*3 - 2t*2. Calculate oh(f) + 66v(f). -22f*3 Let z(h) = -h. Let k(j) = 36j. Let c(w) = -w. Let y(f) = -60c(f) - 2k(f). Suppose 690 = -67l - 623l. Determine ly(r) + 3z(r). 9r Suppose 0 = -b - 2b + n - 628, -b - 4n = 192. Let j = -203 - b. Let g(s) = 2s*2 + 2s - 8. Let t(r) = 2r2 + 2r - 7. What is jg(i) - 6t(i)? -2i2 - 2i + 2 Let b(g) = 7g3 + 7g + 798. Let k(p) = -13p3 - 13p - 1593. What is -11b(l) - 6k(l)? l3 + l + 780 Let t(p) = -p3 - 6p2 - p + 2. Let a(h) = 2h*3 + 42h*2 + 5h - 262. Determine -a(s) - 7t(s). 5s*3 + 2s + 248 Let h(g) = -1221g + 2. Let u(s) = 1222s - 3. Give 5h(k) + 4u(k). -1217k - 2 Let z(m) = 325m3 + m2 + 12m. Let t(d) = d3 + 4d. Give -3t(o) + z(o). 322o3 + o2 Suppose 4 = 3m - 5. Let p(a) = -2a2 - a - 4. Let u(n) = -n2 - 1. Let f(r) = mu(r) - p(r). Let k(o) = 3o*2 + 2o. Calculate f(h) + k(h). 2h2 + 3h + 1 Let c(f) = -5f3 + 3f*2 - 3. Let l be (4 - (-88)/(-20)) + 51/15. Let j(u) = 5u*3 + 2 + 9u*3 - 2u*2 - 9u*l. Determine 4c(t) + 6j(t). 10t*3 Let s(a) = 9a*2 - 11a - 1. Let t(h) = 5h2 - 2h + 23. Let j(x) = 7x2 - 2x + 37. Let w(i) = -5j(i) + 8t(i). Give -3s(n) + 5w(n). -2n2 + 3n - 2 Let w(l) = -115l - 675. Let r(b) = 23b + 142. Calculate -11r(g) - 2w(g). -23g - 212 Let d(i) = 3i*2 + 3i - 122 - i + 68 + 41. Let a(r) = 1. Calculate 5a(z) + d(z). 3z*2 + 2z - 8 Let y(j) = -116 + 41 + 31 + 3j3 + 43 - 2j3. Let v(r) = r3 - 4r2 + 6. What is -v(w) - 6y(w)? -7w3 + 4w*2 Let h(f) = -22600f*2 + 7f. Let a(c) = 15069c2 - 5c. Give 7a(q) + 5h(q). -7517q2 Let u(i) = -134i - 1406. Let m(n) = -84n - 937. Give 8m(l) - 5u(l). -2l - 466 Let n(k) = 5k3 - 52k*2 - 6k. Let l(o) = -15o3 + 158o*2 + 17o. Give 6l(y) + 17n(y). -5y3 + 64y*2 Let y(i) = -1720i + 2. Let z(b) = -6885b + 7. What is 11y(m) - 3z(m)? 1735m + 1 Let k(z) = -164z2 - 42z + 10. Let h(c) = 5c - 1. Give -8h(i) - k(i). 164i2 + 2i - 2 Let l(i) = 861i3 - 21i*2 + 5i + 10. Let k(q) = -861q3 + 17q*2 - 4q - 8. Calculate -5k(d) - 4l(d). 861d3 - d2 Let k(p) be the third derivative of -p6/120 + p5/60 - p4/6 + 867p*2. Let b(n) = 2n*3 - 3n*2 + 9n. What is -2b(u) - 5k(u)? u3 + u2 + 2u Suppose 0 = -432q + 464q - 288. Let z(l) = 13l*3 - 9l*2 + 5l. Let t(r) = -r - 2r2 + 4r*2 + 0r - 3r3. What is qt(n) + 2z(n)? -n3 + n Let b(q) = 50q*3 + 18q*2 + q + 4. Let r(w) = -9w*3 - 3w*2 - 1. Let f(d) = 2b(d) + 11r(d). Let g(l) = -1. What is -f(p) + 2g(p)? -p*3 - 3p*2 - 2p + 1 Let o(j) be the first derivative of -9j2/2 - 3j - 2. Let i(b) = 71b - 6b - 1 - 15b - 51b. What is 4i(n) - o(n)? 5n - 1 Let r(f) = -4f - 3. Suppose -2z + 15 = -7z. Let y(x) = -87x + 8x - 28 + 27x + 17x. Calculate zy(c) + 28r(c). -7c Let y(j) = -j*3 - j + 1. Let q(b) = 3b*2 - 3 - 3b*2 + 27 - 6b*3 - 24b*3 - 24b. Let g(n) = -n + 1. Let i be g(0). Determine iq(o) - 24y(o). -6o3 Let c(m) = -415. Let t(n) = -311. Let s(q) = 3c(q) - 4t(q). Let h(b) = 10b + 9. Calculate -h(p) - 6s(p). -10p - 3 Let d(m) = 3386m3 + 3382m*3 + m + 5m*2 - 6759m*3. Let c(p) = -4p*3 - 3p*2. Determine 5c(b) + 3d(b). 7b*3 + 3b Let g(a) = -a + 4. Let x be 2/3 - 618/9 - 4. Let o be 8/(-6)x/32. Let p(t) = 2t - 4. What is op(i) + 4g(i)? 2i + 4 Let g be (2 - (-12)/(-9))(26 + -32). Let n(x) = 6x2 - 15x. Suppose 8r - 3r - 11 = -b, -r = b - 19. Let h(l) = l*2 - 3l. Calculate bh(p) + gn(p). -3p2 - 3p Let p(c) = -11c2 - 15c - 10. Let n(h) = -10h2 - 13h - 9. Let b(k) = -6n(k) + 5p(k). Let j(s) = 10s2 + 7s + 9. Give -9b(q) + 4j(q). -5q2 + q Let j(r) = 5r*2 + 70r - 1. Let a(c) = -11c2 - 150c + 3. Determine 6a(y) + 13j(y). -y*2 + 10y + 5 Let h(z) be the first derivative of z3 + z2/2 + 3z + 5601. Let o(i) = -i2 - 1. Give h(v) + 2o(v). v*2 + v + 1 Let s(b) = -9b*3 + 7b*2 + b + 7. Let p(d) = -4d*3 + 3d*2 + 3. Suppose -64 = 15c + 80 - 39. Give cp(v) + 3s(v). v*3 + 3v Let h(b) = -6b3 + 22b*2 - 156b - 114. Let q(s) = s*3 - 4s*2 + 31s + 23. Calculate -2h(g) - 11q(g). g*3 - 29g - 25 Let n(y) = -4 + 2 + 16y - 17y. Let x(u) be the second derivative of -u*2/2 + 1792u. Give n(i) - 3x(i). -i + 1 Let s(t) = -3t*3 + 21t*2. Let a(b) = 11b - 19b - 46b + 53b. What is 2a(k) - s(k)? 3	{ "pile_set_name": "DM Mathematics" }
+ 1)(2v + 1)/3 Suppose -321n + 633 = 207n - 829 + 406. Suppose -5z + 15 = -10. Solve 24q*4 + 33/2q - 21/2qz - 21q*n - 6q*3 - 3 = 0 for q. -1, 2/7, 1 Factor 61357/3h*2 + 49/12h*4 + 274576/3 + 595h*3 - 89080h. (h - 2)*2(7h + 524)2/12 Let b(w) be the second derivative of -w6/15 + 2w*5/5 - 5w*4/6 + 2w*3/3 + 1268w. Suppose b(i) = 0. Calculate i. 0, 1, 2 Suppose 3/4p5 + 63p*3 - 255/4p + 261/2 + 66p4 - 393/2p*2 = 0. What is p? -87, -2, -1, 1 Factor 3/7j*5 - 6/7j*4 - 3j*3 + 0 - 12/7j*2 + 0j. 3j2(j - 4)(j + 1)2/7 Let v = 11 - 7. Let k(i) = -10i*2. Let o(z) = -13z*2. Let p(j) = 5k(j) - 4o(j). Let c(x) = 1. Let a(d) = vc(d) - 2p(d). Let a(y) = 0. Calculate y. -1, 1 Let l(f) be the second derivative of -f5/150 + f4/6 + 11f*3/15 + 17f*2/15 + 4f + 14. Solve l(x) = 0 for x. -1, 17 Let p(v) be the second derivative of v*4/96 + 27v*3/4 + 323v*2/16 + 986v. Suppose p(a) = 0. What is a? -323, -1 Let o be (-5)/(-140)-7 + 4/(-320)-116. Solve -48/5d3 + 96/5 + od*5 - 48/5d*2 + 96/5d + 6/5d4 = 0 for d. -2, -1, 2 Let k(j) be the third derivative of j7/945 - j6/540 - 2j*5/45 - 2j*2 - 7j + 23. Factor k(d). 2d2(d - 4)(d + 3)/9 Let v = -15733/152 + 1988/19. Suppose -r + 8 = -2o, -5r - 2o = -7o - 25. Determine u, given that v + 3/2u + 3/8ur = 0. -3, -1 Determine k so that 364/5k - 34 + 2/5k4 + 4k*3 - 216/5k2 = 0. -17, 1, 5 Let v(l) = -l5 + l*3 - 22l*2 - 1. Let h(q) = 5q*5 - 20q4 + q3 + 194q2 - 6q - 105. Let a(r) = -2h(r) - 6v(r). Determine t, given that a(t) = 0. -2, -1, 1, 3, 9 Let n be (-2)/(-2) - (1407/9380 + 6/(-15)). Factor 0 + k*2 + k - 13/4k*3 + nk*4. k(k - 2)(k - 1)(5k + 2)/4 Let n(c) = 72c + 283. Let a be n(-6). Let u = -145 - a. Factor 0 + 0p + 0p*2 - 4/7p*u + 4/7p*3. -4p*3(p - 1)/7 Let p be (-1)/31 - 76/(-3). Let z = p + -21. Factor -u + 2u + z + u - 2u2 + 0u. -2(u - 2)(u + 1) Let l(o) be the second derivative of o*6/120 - 3o*5/20 - 5o*4/12 - 50o*2 - 2o + 38. Let x(y) be the first derivative of l(y). Find q such that x(q) = 0. -1, 0, 10 Suppose 2r + 5u = 10, 5r + 1322u = 1323u - 2. Let -3/4b*4 + 0 + 3/4b*2 + 0b + rb3 = 0. What is b? -1, 0, 1 Let v(s) be the second derivative of 1/28s*7 + 0s*2 + 0s*6 + 4s - 2s3 + 1 - 33/40s*5 - 9/4s*4. Solve v(q) = 0. -2, -1, 0, 4 Suppose 3 - 94n*2 - 9n + 36 + 5 + 43n2 + 46n*2 = 0. Calculate n. -4, 11/5 Let k(g) = 5g*5 + 7g*4 + 11g*3 - 8g*2 - 24g - 7. Let u(z) = 2z5 + 3z*4 + 6z*3 - 4z*2 - 12z - 3. Let m(d) = 6k(d) - 14u(d). Solve m(l) = 0. -3, -1, 0, 2 What is h in -140013 - 24044 - 1521h - 4h*2 - 129707 - 647h = 0? -271 Let j(d) be the second derivative of -d*5/570 + 4d*4/57 - 64d*3/57 - 19d*2/2 + 75d. Let k(a) be the first derivative of j(a). Let k(t) = 0. Calculate t. 8 Let r(v) be the first derivative of -20/27v3 + 0v*4 + 8/45v*5 + 4/3v + 1/9v2 + 53 - 1/27v6. Let r(b) = 0. Calculate b. -1, 1, 2, 3 Let y(c) be the second derivative of -c4/42 + 296c3/21 - 84c*2 + c + 1051. Determine p, given that y(p) = 0. 2, 294 Let v(b) = -186b*2 - 15b - 33. Let n be v(-3). Let r = 1664 + n. Let 12/7x5 + 0 + 45/7x*3 + 3x*r + 3/7x + 39/7x4 = 0. What is x? -1, -1/4, 0 Let r(v) be the third derivative of 53/15v*5 + 44/105v*8 + 16/75v*7 - 89/30v*6 - 28/15v4 + 34 + v2 + 8/15v3 + 0v. Suppose r(x) = 0. What is x? -2, 2/11, 1/4, 1 Suppose 15n = 2n + n. Let a be 3/1 - (-16)/8. Let -4/9i4 + n + 0i*3 + 0i - 2/9ia + 0i*2 = 0. What is i? -2, 0 Find w, given that 52 + 308/3w + 34/3w3 - 1/3w*4 + 187/3w*2 = 0. -2, -1, 39 Let f(a) be the third derivative of -60a*2 + 1/12a*5 + 0a - 25/3a3 + 0 - 15/8a*4. Find b such that f(b) = 0. -1, 10 Let n(g) = -12438g - 124372. Let w be n(-10). Determine m, given that 1/3m5 + 28/3m - 2m2 - 11/3m*3 + 0m4 + w = 0. -2, -1, 2, 3 Let o(i) be the first derivative of i6/16 + 93i5/40 - 9i*4/32 - 91i*3/8 + 93i*2/8 + 4091. Solve o(z) = 0 for z. -31, -2, 0, 1 Let x = -1765 - -1773. Suppose x + 34 = 21j. Factor 0c + 0 - 2/3c*j. -2c*2/3 Let a(d) be the third derivative of 0d + 3/10d6 + 0 + 2/105d*7 - 25/6d*4 - 1/5d*5 + 139d*2 + 12d*3. Factor a(v). 4(v - 1)*2(v + 2)(v + 9) Let y = 107786/407 - 9792/37. Factor 0s*2 - ys + 0 + 2/11s3. 2s(s - 1)(s + 1)/11 Let j(p) = 21p2 - 84p + 90. Suppose 12z = 10z - 4. Let s(y) = -5y2 + 21y - 22. Let o(l) = zj(l) - 9s(l). Let o(a) = 0. Calculate a. 1, 6 Suppose -56/15v3 + 2/15v*4 + 896v + 7680 - 568/15v2 = 0. What is v? -10, 24 Let g = -4637 - -4641. Let v(h) be the second derivative of -9/4h*g + 1/10h*6 - 3/20h*5 + 0 - 11/2h*3 - 14h - 6h2. Find t, given that v(t) = 0. -1, 4 Find i, given that -138i*2 - 672 + 1520/3i - 2/3i4 + 16i*3 = 0. 4, 7, 9 Suppose -735b - 831b - 22 = -6286. Determine r, given that -1/4r*b + 9/4r*3 - 9/4r + 1/4r2 + 0 = 0. -1, 0, 1, 9 Suppose -227v + 174v + 106 = 0. Factor -5/3j - v + 1/3j2. (j - 6)(j + 1)/3 Let v(l) be the first derivative of 2/45l5 - 2/3l*2 + 0l - 183 + 0l4 - 14/27l*3. Factor v(d). 2d(d - 3)(d + 1)(d + 2)/9 Suppose 225 - 211 = -2b. Let h be (-48)/40(b + 2)/10. Find c such that -2/5c + hc2 - 1/5 = 0. -1/3, 1 Let d(q) = -2q + 317. Let c be d(0). Let -11110y2 - 1870y*3 - cy3 - y5 - 8573y2 - 81y*4 = 0. What is y? -27, 0 Let j(m) = 3m*2 + 440m - 507. Let s(g) = 4g2 + 435g - 511. Let f(k) = -9j(k) + 8s(k). Factor f(r). 5(r - 95)(r - 1) Let h(m) = 4m4 - 4m*3 - 233m*2 - 567m. Let q(r) = -2r4 + 2r*3 + 117r*2 + 283r. Let v(n) = 5h(n) + 9q(n). Factor v(g). 2g(g - 9)(g + 4)2 Let w = -31293 + 156477/5. Let z = 104/35 + -18/7. Determine m so that -8/5m*4 + 0 - 2/5m*5 - zm - wm3 - 8/5m*2 = 0. -1, 0 Factor 1/6v*3 + 4v + 7/3v2 + 0. v(v + 2)(v + 12)/6 Suppose 3/4i*2 - 3/4i + 0 = 0. Calculate i. 0, 1 Let v(g) be the third derivative of -2/105g5 + 0g*3 + 0 + 0g + 27g2 + 1/42g*4 + 4/735g*7 - 1/210g*6. Determine k so that v(k) = 0. -1, 0, 1/2, 1 Suppose -2r + 50p = 45p + 1, -4r + 4p + 4 = 0. Let j = 986 + -858. Factor jw + 2/3w*3 + 16w*r + 1024/3. 2(w + 8)*3/3 Let d = 20341/3 - 6780. Let w(r) be the first derivative of 1/8r*4 + dr*3 - 10 + 0r + 1/4r2. Factor w(j). j(j + 1)2/2 Let v(u) be the first derivative of -u6/420 + u*5/70 + 13u*4/84 - 5u*3/7 - 72u*2 - 3. Let k(f) be the second derivative of v(f). Factor k(n). -2(n - 5)(n - 1)(n + 3)/7 Factor -t*2 + 68 + 58t - 18 - 53t. -(t - 10)(t + 5) Determine y so that -14682y2 - 18y*4 - 193y*3 + 153216y + 19y4 - 4y*4 + 577y*3 - 477603 = 0. 7, 57 Suppose -120/7j + 675/7 - 3/7j2 = 0. What is j? -45, 5 Factor 0 + 474v*2 + 4/3v*3 + 710/3v. 2v(v + 355)(2v + 1)/3 Let d be (4/(-8))/(2/(-8)). Find p such that 5p4 + 11p*3 + 21p - 35pd - 2p - p*3 + p = 0. -4, 0, 1 Suppose 5v*4 - 38v*2 + 261v - 31v - 12v*3 - 57v*2 - 8v*3 + 59 - 179 = 0. What is v? -4, 1, 6 Let y be (0 + 15/6)(278/240 + 357/8568). Factor -82/5a - 44/5a*2 - 8 - 2/5a*y. -2(a + 1)*2(a + 20)/5 Let s(f) be the first derivative of -49 + 0f - 1/3f3 - f2. Let s(j) = 0. Calculate j. -2, 0 Let h(d) be the first derivative of 2d6/27 + 26d*5/45 - 28d*4/9 - 206d*3/27 - 4d*2 - 2193. Determine r, given that h(r) = 0. -9, -1, -1/2, 0, 4 Suppose -243f + 223f = -83 - 17. Let -56/5h*4 - 134/5h*2 + 129/5h*3 + 12h - 8/5 + 9/5hf = 0. What is h? 2/9, 1, 2 Let x(f) be the first derivative of f3/5 + 141f*2/10 + 1026f/5 + 5870. Factor x(i). 3(i + 9)(i + 38)/5 Let d(c) be the second derivative of 2c6/15 + 48c*5/5 + 622c*4/3 + 736c*3 + 1058c*2 - c + 2472. Factor d(b). 4(b + 1)*2(b + 23)*2 Let 2w*4 + 39w + 10178076w2 - 3w*4 - 10178047w*2 - 11w3 = 0. What is w? -13, -1, 0, 3 Let x(v) be the second derivative of -v6/540 + v*5/30 + 5v*4/54 - 13v*2 - 100v - 1. Let l(b) be the first derivative of x(b). Let l(y) = 0. What is y? -1, 0, 10 Let j(m) be the first derivative of -10 + 0m2 + 0m*4 - 1/2m**	{ "pile_set_name": "DM Mathematics" }
Calculate the remainder when 159 is divided by 26. 3 What is the remainder when 5375 is divided by 256? 255 Calculate the remainder when 197 is divided by 53. 38 Calculate the remainder when 440 is divided by 13. 11 What is the remainder when 246 is divided by 3? 0 Calculate the remainder when 70 is divided by 45. 25 Calculate the remainder when 143 is divided by 34. 7 What is the remainder when 394 is divided by 19? 14 Calculate the remainder when 1279 is divided by 16. 15 Calculate the remainder when 87 is divided by 38. 11 What is the remainder when 360 is divided by 5? 0 What is the remainder when 567 is divided by 15? 12 What is the remainder when 6491 is divided by 15? 11 What is the remainder when 48 is divided by 13? 9 What is the remainder when 228 is divided by 58? 54 What is the remainder when 437 is divided by 215? 7 Calculate the remainder when 272 is divided by 10. 2 What is the remainder when 969 is divided by 170? 119 Calculate the remainder when 213 is divided by 27. 24 Calculate the remainder when 1114 is divided by 5. 4 What is the remainder when 114 is divided by 3? 0 Calculate the remainder when 32997 is divided by 15. 12 What is the remainder when 496 is divided by 36? 28 What is the remainder when 126 is divided by 16? 14 Calculate the remainder when 359 is divided by 13. 8 What is the remainder when 540 is divided by 252? 36 Calculate the remainder when 76 is divided by 11. 10 Calculate the remainder when 25 is divided by 13. 12 Calculate the remainder when 111 is divided by 31. 18 What is the remainder when 794 is divided by 6? 2 Calculate the remainder when 172 is divided by 88. 84 Calculate the remainder when 626 is divided by 75. 26 What is the remainder when 25 is divided by 11? 3 What is the remainder when 420 is divided by 59? 7 Calculate the remainder when 3699 is divided by 460. 19 Calculate the remainder when 18 is divided by 1. 0 What is the remainder when 468 is divided by 111? 24 What is the remainder when 5821 is divided by 56? 53 Calculate the remainder when 277 is divided by 27. 7 Calculate the remainder when 3660 is divided by 51. 39 Calculate the remainder when 565 is divided by 129. 49 What is the remainder when 7562 is divided by 62? 60 Calculate the remainder when 664 is divided by 111. 109 Calculate the remainder when 455 is divided by 31. 21 Calculate the remainder when 158 is divided by 34. 22 What is the remainder when 803 is divided by 240? 83 What is the remainder when 9642 is divided by 72? 66 Calculate the remainder when 83 is divided by 21. 20 Calculate the remainder when 10847 is divided by 32. 31 Calculate the remainder when 48 is divided by 10. 8 What is the remainder when 2497 is divided by 1243? 11 What is the remainder when 22 is divided by 14? 8 What is the remainder when 165 is divided by 86? 79 Calculate the remainder when 1682 is divided by 1673. 9 What is the remainder when 111 is divided by 69? 42 What is the remainder when 17247 is divided by 138? 135 Calculate the remainder when 505 is divided by 58. 41 What is the remainder when 16598 is divided by 50? 48 What is the remainder when 184 is divided by 62? 60 Calculate the remainder when 3012 is divided by 45. 42 What is the remainder when 48 is divided by 30? 18 Calculate the remainder when 4525 is divided by 151. 146 What is the remainder when 1245 is divided by 50? 45 What is the remainder when 2956 is divided by 99? 85 Calculate the remainder when 184 is divided by 37. 36 Calculate the remainder when 471 is divided by 43. 41 Calculate the remainder when 34 is divided by 21. 13 Calculate the remainder when 175 is divided by 44. 43 What is the remainder when 907 is divided by 10? 7 Calculate the remainder when 951 is divided by 56. 55 Calculate the remainder when 1189 is divided by 26. 19 What is the remainder when 4123 is divided by 1029? 7 Calculate the remainder when 779 is divided by 23. 20 Calculate the remainder when 235 is divided by 21. 4 What is the remainder when 336 is divided by 17? 13 What is the remainder when 299 is divided by 75? 74 Calculate the remainder when 400 is divided by 15. 10 Calculate the remainder when 1646 is divided by 328. 6 What is the remainder when 571 is divided by 52? 51 Calculate the remainder when 589 is divided by 16. 13 What is the remainder when 171 is divided by 29? 26 What is the remainder when 779 is divided by 30? 29 What is the remainder when 52 is divided by 11? 8 Calculate the remainder when 950 is divided by 56. 54 What is the remainder when 124 is divided by 21? 19 Calculate the remainder when 1097 is divided by 44. 41 Calculate the remainder when 89 is divided by 43. 3 Calculate the remainder when 411 is divided by 84. 75 Calculate the remainder when 139 is divided by 136. 3 Calculate the remainder when 1172 is divided by 25. 22 What is the remainder when 1517 is divided by 19? 16 What is the remainder when 243 is divided by 42? 33 What is the remainder when 237 is divided by 31? 20 Calculate the remainder when 288 is divided by 97. 94 Calculate the remainder when 204 is divided by 65. 9 What is the remainder when 3420 is divided by 286? 274 Calculate the remainder when 176 is divided by 10. 6 Calculate the remainder when 42 is divided by 10. 2 Calculate the remainder when 218 is divided by 37. 33 What is the remainder when 579 is divided by 211? 157 Calculate the remainder when 14 is divided by 4. 2 What is the remainder when 599 is divided by 67? 63 What is the remainder when 132 is divided by 35? 27 What is the remainder when 49 is divided by 17? 15 Calculate the remainder when 259 is divided by 258. 1 Calculate the remainder when 1109 is divided by 30. 29 Calculate the remainder when 302 is divided by 81. 59 What is the remainder when 1379 is divided by 198? 191 Calculate the remainder when 2445 is divided by 175. 170 Calculate the remainder when 1297 is divided by 637. 23 What is the remainder when 48 is divided by 29? 19 What is the remainder when 731 is divided by 32? 27 Calculate the remainder when 935 is divided by 18. 17 Calculate the remainder when 197 is divided by 63. 8 What is the remainder when 45 is divided by 22? 1 What is the remainder when 3279 is divided by 67? 63 What is the remainder when 156 is divided by 17? 3 What is the remainder when 106 is divided by 35? 1 What is the remainder when 810 is divided by 212? 174 Calculate the remainder when 9249 is divided by 37. 36 What is the remainder when 123 is divided by 4? 3 What is the remainder when 6798 is divided by 2260? 18 Calculate the remainder when 227 is divided by 37. 5 Calculate the remainder when 139 is divided by 79. 60 Calculate the remainder when 748 is divided by 15. 13 What is the remainder when 2666 is divided by 36? 2 What is the remainder when 2638 is divided by 8? 6 What is the remainder when 191 is divided by 52? 35 Calculate the remainder when 181 is divided by 48. 37 Calculate the remainder when 1054 is divided by 173. 16 What is the remainder when 394 is divided by 53? 23 Calculate the remainder when 67 is divided by 14. 11 Calculate the remainder when 184 is divided by 108. 76 What is the remainder when 1511 is divided by 17? 15 Calculate the remainder when 157 is divided by 7. 3 Calculate the remainder when 43799 is divided by 121. 118 Calculate the remainder when 1126 is divided by 49. 48 Calculate the remainder when 486 is divided by 146. 48 What is the remainder when 1758 is divided by 875? 8 Calculate the remainder when 4417 is divided by 26. 23 What is the remainder when 148 is divided by 72? 4 What is the remainder when 1603 is divided by 126? 91 Calculate the remainder when 2387 is divided by 104. 99 What is the remainder when 944 is divided by 63? 62 What is the remainder when 268 is divided by 224? 44 Calculate the remainder when 691 is divided by 329. 33 Calculate the remainder when 308 is divided by 24. 20 Calculate the remainder when 19 is divided by 11. 8 Calculate the remainder when 797 is divided by 80. 77 Calculate the remainder when 2399 is divided by 80. 79 Calculate the remainder when 73 is divided by 61. 12 What is the remainder when 125 is divided by 35? 20 Calculate the remainder when 553 is divided by 111. 109 What is the remainder when 126 is divided by 4	{ "pile_set_name": "DM Mathematics" }
038 Let -2m4/3 + 42068m*3/3 - 601914m*2 + 3610596m - 3022704 = 0. Calculate m. 1, 6, 36, 20991 Factor u*3/4 - 1861u*2/2 + 377295u/4 - 1850607/2. (u - 3618)(u - 93)(u - 11)/4 Factor w*2/2 + 141451w/2 + 3322994. (w + 47)(w + 141404)/2 Find y such that -5y*3 - 40887y*2 + 270086y + 114576 = 0. -8184, -2/5, 7 Factor -d*2 + 81929412d + 81929413. -(d - 81929413)(d + 1) Find v, given that 5v*5 - 120435v*4 + 968174245v*3 - 2607227052705v*2 + 77402516292090v - 144383867840520 = 0. 2, 28, 8019 Find j, given that -3j2 + 9505437j = 0. 0, 3168479 Let 3w4/8 + 2835w*3/8 - 11661w*2/8 - 257607w/8 + 697515/4 = 0. What is w? -949, -10, 7 Determine g so that g*2/5 + 19738g/5 - 4168923/5 = 0. -19947, 209 Find k such that 21k4/5 - 8196k*3/5 - 2348337k*2/5 + 3030468k/5 - 673956/5 = 0. -193, 2/7, 1, 582 Determine u, given that -34u5/11 + 602u*4/11 + 1812u*3/11 - 24544u*2/11 - 85696u/11 - 23040/11 = 0. -4, -5/17, 8, 18 Find d such that -d*4/5 + 4344d*3/5 + 4346d*2/5 - 4344d/5 - 869 = 0. -1, 1, 4345 Factor 4n2 - 486464n + 972912. 4(n - 121614)(n - 2) What is l in 4l4 + 4203896l*3 + 1104558960292l*2 + 6627240256992l + 9940803633216 = 0? -525484, -3 Factor -96v2/17 - 640126v/17 + 13336/17. -2(v + 6668)(48v - 1)/17 What is f in 406f*3/11 + 119668f*2/11 - 30094f/11 - 1180/11 = 0? -295, -1/29, 2/7 Determine l so that -l*4 + 853l*3 + 87372l*2 + 2528820l + 18394992 = 0. -42, -11, 948 Determine u so that -3u2/2 + 999u/2 - 13635 = 0. 30, 303 Factor -3s2 - 18444s - 23728185. -3(s + 1833)(s + 4315) Let 3a2 - 1777485a - 12442542 = 0. Calculate a. -7, 592502 Factor 4w2/3 + 350690372w/3 - 116896792. 4(w - 1)(w + 87672594)/3 Determine b so that 5b2 + 2725960b - 357186565 = 0. -545323, 131 Factor 7442z2/13 - 6196624z/13 + 1289913632/13. 2(61z - 25396)*2/13 Factor -3y*4 + 119691336y*3 - 1193834659455408y*2. -3y*2(y - 19948556)*2 Factor -2c*2/5 - 37512c/5 + 1210624. -2(c - 160)(c + 18916)/5 Find s, given that -s*2/9 + 56732s/9 - 2267680/9 = 0. 40, 56692 Let 267v5/7 - 984v*4 + 41049v*3/7 - 14376v*2/7 - 77268v/7 - 14688/7 = 0. Calculate v. -1, -18/89, 2, 8, 17 Factor -2q4/7 - 3164516q*3/7. -2q*3(q + 1582258)/7 Suppose 2l3 + 6080l*2 + 114938l + 422940 = 0. Calculate l. -3021, -14, -5 What is b in -4b5 - 1575772b*4 + 12606360b*3 - 28364472b*2 + 108b + 42546708 = 0? -393951, -1, 3 Suppose k*3/4 + 459395k*2/4 + 4593650k + 45935500 = 0. Calculate k. -459355, -20 Factor 18l4/7 + 2690l*3 + 6738642l*2/7 + 881903754l/7 + 20414106756/7. 2(l + 339)3(9l + 262)/7 Find v such that 5v*2 + 37610v - 11286895 = 0. -7811, 289 Factor -k*3 - 3863k*2 - 927754k - 3649272. -(k + 4)(k + 253)(k + 3606) Factor 2c3/9 - 4444736c*2/9. 2c*2(c - 2222368)/9 Determine w, given that 4w2 - 7853528w = 0. 0, 1963382 Find n, given that -5n4 + 912080n*3 + 19155605n*2 + 51082180n + 32838660 = 0. -18, -2, -1, 182437 Find l such that 2l3 + 1618048l*2 + 327295510440l + 14397870088800 = 0. -404490, -44 Factor 225907238209b2/4 - 475297b + 1. (475297b - 2)2/4 Factor g2/8 + 25741325g + 1325231625511250. (g + 102965300)2/8 Solve -d5/6 - 44d4/3 + 109d*3/2 + 80633d*2/3 + 1170512d/3 - 417088 = 0 for d. -56, -19, 1, 42 Factor 1875v3 - 14043050v*2 - 15728804v/3 - 1468040/3. (v - 7490)(75v + 14)*2/3 Determine s so that 2s*5/17 - 2546s*4/17 + 145994s*3/17 - 525638s*2/17 - 976372s/17 + 1358560/17 = 0. -2, 1, 5, 56, 1213 Solve 3g4 - 1458g*3 + 15699g*2 - 11340g - 28500 = 0 for g. -1, 2, 10, 475 What is c in 202c5/5 - 57356c*4/5 + 501188c*3/5 - 1250704c*2/5 + 151434c + 9900 = 0? -6/101, 1, 3, 5, 275 Find z such that -39551521z2/4 - 4339410z - 476100 = 0. -1380/6289 Find g such that -g*5/5 + 5783g*4/5 - 1156g*3 - 11564g*2/5 = 0. -1, 0, 2, 5782 Solve 3j*4 - 1434j*3 - 70593j*2 - 895896j - 2546640 = 0 for j. -27, -15, -4, 524 Factor 3z2 - 42063z + 15709824. 3(z - 13637)(z - 384) Solve -v*3 - 3019898v*2 - 15099469v - 12079572 = 0 for v. -3019893, -4, -1 Let -2p4 + 2130p*3 - 31392p*2 - 113400p = 0. Calculate p. -3, 0, 18, 1050 Factor 5u2/4 - 2481455u/2 - 4962915/4. 5(u - 992583)(u + 1)/4 Determine s, given that 2s3 - 9682s*2 - 263808s + 4556448 = 0. -39, 12, 4868 Determine f so that -4f2 - 9916f + 72194760 = 0. -5665, 3186 Determine n, given that -3n4/4 - 144n*3 + 33465n*2/4 + 270369n/2 - 302670 = 0. -236, -15, 2, 57 Find g such that -3g2 - 1382815320g - 159348184102225200 = 0. -230469220 Factor -x*2/2 + 4106x - 188347/2. -(x - 8189)(x - 23)/2 Let -3125v*3 + 74500v*2 - 243705v/4 + 50715/4 = 0. What is v? 21/50, 23 Factor -q*3/4 - 15847q*2/4 - 31691q/4 - 15845/4. -(q + 1)*2(q + 15845)/4 Factor 4j3/9 - 7497200j*2/9 + 3513000490000j/9. 4j(j - 937150)2/9 Find y, given that -y2 + 118250y + 3666711 = 0. -31, 118281 Let -69o*3/2 + 166419o*2/2 - 50167188o - 6544962 = 0. What is o? -3/23, 1206 Suppose -w*2/2 - 2285w/2 + 1206903 = 0. Calculate w. -3071, 786 Let 20x5/7 + 14764x*4/7 - 25304x*3 - 95056x*2/7 + 708192x/7 + 144000/7 = 0. What is x? -750, -2, -1/5, 2, 12 Factor -q*3/3 - 94067q*2/3 + 2446249q/3 - 15901717/3. -(q - 13)*2(q + 94093)/3 Solve -6i4/11 - 16300i*3/11 - 27144i*2/11 + 16300i/11 + 27150/11 = 0. -2715, -5/3, -1, 1 Factor 4z3 + 535196z*2 - 15524048z. 4z(z - 29)(z + 133828) Suppose 3u*2/2 - 97557u + 9553383/2 = 0. Calculate u. 49, 64989 Suppose -3d3/5 + 317874d*2/5 + 1271532d/5 + 1271544/5 = 0. Calculate d. -2, 105962 Factor -r*4 - 623882r*3 - 97302196297r*2 + 1556954928144r - 6227979430464. -(r - 8)*2(r + 311949)*2 Solve 4q*2 + 42288q + 13598720 = 0 for q. -10240, -332 Determine f so that -2637f5 - 146127615f*4 - 49706364f*3 - 332484f2 = 0. -55414, -1/3, -2/293, 0 Factor -q3/2 + 295q2 + 84137q/2 + 82953. -(q - 709)(q + 2)(q + 117)/2 Solve -82o4 - 1394411o*3 - 11168349o*2 - 22436056o - 271952 = 0 for o. -16997, -4, -1/82 Suppose -3c4/4 + 724371c*3/4 + 9c*2/4 - 2173119c/4 + 724371/2 = 0. What is c? -2, 1, 241457 Factor -18j3/7 + 2144j*2/7 - 13984j/7 - 3419392/7. -2(j - 76)2(9j + 296)/7 Let -3p*3 - 17837688p2 = 0. Calculate p. -5945896, 0 Factor -o2/3 + 10841o/3 + 4055486/3. -(o - 11203)(o + 362)/3 Factor 3r3/4 - 42795r*2 + 609871104r + 17109958656. 3(r - 28544)2(r + 28)/4 Solve -3l3/5 + 930l*2 - 596493l/5 - 2000754 = 0. -15, 158, 1407 Let -5d4 - 290d*3 + 33545d*2 - 218890d = 0. What is d? -118, 0, 7, 53 Solve 90f4 - 626f*3 + 2600f*2/3 + 232f/3 - 160/3 = 0 for f. -4/15, 2/9, 2, 5 Let 3q2/5 + 75072q/5 + 1107780 = 0. Calculate q. -24950, -74 What is b in b*5/8 + 1295b*4/8 + 632983b*3/8 + 139696597b*2/8 + 1532860714b + 34290709453/2 = 0? -322, -319, -13 Suppose 2q2/9 - 1717544q + 3318702065928 = 0. Calculate q. 3864474 Determine a, given that 254a2 - 246880a - 7776 = 0. -4/127, 972 Let 13v2/3 + 42812v/3 + 3293 = 0. Calculate v. -3293, -3/13 Factor 4b3/7 + 2416136b*2/7 + 364854657008b/7 - 729718978592/7. 4(b - 2)(b + 302018)*2/7 Factor -1351i*3 + 5584i*2 - 6124i + 720. -(i - 2)*2(1351i - 180) Let 2o*5/5 - 16576o*4/5 + 132512o*3/5 - 52992o*2 = 0. Calculate o. 0, 4, 8280 Determine x, given that -2x*4/5 + 12140x*3 - 613818408x*2/5 + 2065492101124x/5 + 26955266040586/5 = 0. -13, 10121 Find o, given that -o*3/8 - 87637o*2/8 - 239332490o + 29603861400 = 0. -43880, 123 Determine h so that -4h2 - 24367896h - 37112147216676 = 0. -3045987 Solve 5y5/2 - 2427y*4/2 + 98415y*3/2 - 226613y*2/2 + 83832y - 18522 = 0 for y. 2/5, 1, 42, 441 Suppose 5h5 + 16295h*4 + 13590395h*3 + 511885205h*2 + 5177051600h + 4678740500 = 0. What is h? -1610, -19, -1 Find l, given that -460l5/7 + 28843072l*4/7 + 25081340l*3/7 - 537456l*2 = 0. -1, 0, 3/23, 313516/5 What is q in 4q*4 + 5907664q*3 + 2908494607320q*2 + 477387686714533200q + 29109827722024786500 = 0? -492285, -61 Solve -2v4/7 + 2638v*3/7 - 117114v*2/7 - 2638v/7 + 117116/7 = 0 for v. -1, 1, 46, 1273	{ "pile_set_name": "DM Mathematics" }
d 3:32 PM? 194 What is 270 minutes after 4:38 PM? 9:08 PM How many minutes are there between 6:33 PM and 11:33 PM? 300 How many minutes are there between 5:11 PM and 7:49 PM? 158 How many minutes are there between 11:42 PM and 6:07 AM? 385 How many minutes are there between 11:08 AM and 7:58 PM? 530 How many minutes are there between 5:11 PM and 8:07 PM? 176 How many minutes are there between 2:40 PM and 7:23 PM? 283 What is 503 minutes after 8:17 PM? 4:40 AM What is 304 minutes after 2:02 PM? 7:06 PM What is 685 minutes after 4:36 AM? 4:01 PM How many minutes are there between 7:20 AM and 6:15 PM? 655 What is 54 minutes after 8:11 AM? 9:05 AM How many minutes are there between 9:26 PM and 5:26 AM? 480 What is 260 minutes before 7:30 PM? 3:10 PM How many minutes are there between 9:16 PM and 2:34 AM? 318 What is 318 minutes after 10:55 AM? 4:13 PM What is 408 minutes before 4:06 AM? 9:18 PM What is 6 minutes after 11:02 AM? 11:08 AM What is 25 minutes after 11:24 AM? 11:49 AM What is 107 minutes before 9:55 AM? 8:08 AM How many minutes are there between 12:30 PM and 6:23 PM? 353 What is 152 minutes before 9:05 PM? 6:33 PM How many minutes are there between 3:38 PM and 11:51 PM? 493 What is 176 minutes before 10:03 AM? 7:07 AM What is 144 minutes after 5:56 PM? 8:20 PM What is 687 minutes after 10:43 PM? 10:10 AM What is 296 minutes after 4:33 AM? 9:29 AM What is 665 minutes after 2:59 AM? 2:04 PM What is 657 minutes after 4:19 PM? 3:16 AM How many minutes are there between 2:58 PM and 4:26 PM? 88 How many minutes are there between 8:51 AM and 11:31 AM? 160 How many minutes are there between 11:19 AM and 3:56 PM? 277 What is 553 minutes after 3:15 PM? 12:28 AM How many minutes are there between 10:55 AM and 5:06 PM? 371 How many minutes are there between 8:19 AM and 11:43 AM? 204 How many minutes are there between 10:25 AM and 10:58 AM? 33 How many minutes are there between 5:27 AM and 2:47 PM? 560 How many minutes are there between 12:14 AM and 10:01 AM? 587 What is 463 minutes before 4:12 PM? 8:29 AM What is 584 minutes before 6:59 PM? 9:15 AM How many minutes are there between 8:51 AM and 9:26 AM? 35 What is 44 minutes after 12:21 AM? 1:05 AM How many minutes are there between 6:18 AM and 6:12 PM? 714 What is 270 minutes before 9:25 PM? 4:55 PM What is 661 minutes after 2:36 PM? 1:37 AM What is 304 minutes after 7:56 PM? 1:00 AM How many minutes are there between 10:30 AM and 7:47 PM? 557 What is 707 minutes before 9:57 PM? 10:10 AM What is 492 minutes after 4:51 AM? 1:03 PM How many minutes are there between 5:53 AM and 1:47 PM? 474 What is 693 minutes before 7:44 AM? 8:11 PM How many minutes are there between 3:21 AM and 9:34 AM? 373 What is 249 minutes before 10:52 AM? 6:43 AM How many minutes are there between 1:05 PM and 12:35 AM? 690 What is 704 minutes before 1:46 PM? 2:02 AM How many minutes are there between 2:52 PM and 3:28 PM? 36 What is 595 minutes before 7:00 PM? 9:05 AM How many minutes are there between 12:46 AM and 6:57 AM? 371 What is 104 minutes after 2:25 AM? 4:09 AM What is 60 minutes before 3:14 PM? 2:14 PM How many minutes are there between 1:50 AM and 12:02 PM? 612 What is 62 minutes before 12:22 AM? 11:20 PM How many minutes are there between 5:30 PM and 12:10 AM? 400 What is 514 minutes after 6:11 AM? 2:45 PM What is 430 minutes after 3:35 AM? 10:45 AM How many minutes are there between 9:54 AM and 6:16 PM? 502 What is 709 minutes after 3:28 AM? 3:17 PM What is 305 minutes after 4:50 AM? 9:55 AM How many minutes are there between 5:49 AM and 9:20 AM? 211 How many minutes are there between 7:07 PM and 9:40 PM? 153 How many minutes are there between 5:56 AM and 8:02 AM? 126 How many minutes are there between 5:25 AM and 7:03 AM? 98 How many minutes are there between 9:23 PM and 6:55 AM? 572 How many minutes are there between 5:33 PM and 9:44 PM? 251 How many minutes are there between 6:19 AM and 12:03 PM? 344 How many minutes are there between 6:50 PM and 3:35 AM? 525 What is 376 minutes after 1:26 AM? 7:42 AM What is 236 minutes after 7:55 PM? 11:51 PM How many minutes are there between 6:58 PM and 5:53 AM? 655 How many minutes are there between 11:50 PM and 10:13 AM? 623 How many minutes are there between 5:37 AM and 12:37 PM? 420 What is 204 minutes after 8:16 PM? 11:40 PM What is 52 minutes after 3:07 AM? 3:59 AM How many minutes are there between 1:07 PM and 4:03 PM? 176 What is 705 minutes after 6:13 AM? 5:58 PM How many minutes are there between 1:24 AM and 4:19 AM? 175 What is 578 minutes after 12:47 PM? 10:25 PM How many minutes are there between 7:30 AM and 5:16 PM? 586 What is 197 minutes after 10:07 AM? 1:24 PM What is 19 minutes after 2:10 AM? 2:29 AM How many minutes are there between 2:20 AM and 4:49 AM? 149 How many minutes are there between 3:12 PM and 8:03 PM? 291 How many minutes are there between 12:36 AM and 4:50 AM? 254 What is 88 minutes after 11:45 PM? 1:13 AM What is 707 minutes after 12:50 PM? 12:37 AM What is 583 minutes after 8:47 PM? 6:30 AM How many minutes are there between 3:14 AM and 1:21 PM? 607 What is 676 minutes before 7:51 PM? 8:35 AM What is 448 minutes before 8:35 AM? 1:07 AM What is 502 minutes before 10:18 AM? 1:56 AM What is 627 minutes before 6:15 PM? 7:48 AM How many minutes are there between 10:39 PM and 11:46 PM? 67 How many minutes are there between 12:53 AM and 9:41 AM? 528 How many minutes are there between 10:37 PM and 6:29 AM? 472 How many minutes are there between 12:41 AM and 6:12 AM? 331 How many minutes are there between 9:58 AM and 2:41 PM? 283 How many minutes are there between 9:49 AM and 10:49 AM? 60 How many minutes are there between 5:08 PM and 3:52 AM? 644 What is 503 minutes before 6:48 PM? 10:25 AM What is 443 minutes after 8:42 PM? 4:05 AM What is 185 minutes before 2:07 PM? 11:02 AM How many minutes are there between 1:42 PM and 3:04 PM? 82 What is 704 minutes after 5:23 PM? 5:07 AM How many minutes are there between 9:52 PM and 8:19 AM? 627 How many minutes are there between 3:30 AM and 9:36 AM? 366 How many minutes are there between 6:21 AM and 5:33 PM? 672 What is 423 minutes after 2:07 PM? 9:10 PM What is 399 minutes after 9:57 AM? 4:36 PM What is 104 minutes before 6:06 AM? 4:22 AM How many minutes are there between 7:31 PM and 8:19 PM? 48 How many minutes are there between 12:01 PM and 10:26 PM? 625 What is 459 minutes after 10:53 PM? 6:32 AM What is 4 minutes after 11:13 AM? 11:17 AM How many minutes are there between 1:29 PM and 2:22 PM? 53 What is 291 minutes after 9:43 PM? 2:34 AM How many minutes are there between 8:49 AM and 6:44 PM? 595 What is 51 minutes after 4:59 PM? 5:50 PM What is 59 minutes after 11:47 PM? 12:46 AM How many minutes are there between 1:07 PM and 10:19 PM? 552 What is 496 minutes after 3:23 PM? 11:39 PM What is 325 minutes before 5:11 PM? 11:46 AM How many minutes are there between 12:08 AM and 7:33 AM? 445 How many minutes are there between 8:59 PM and 10:15 PM? 76 How many minutes are there between 6:47 AM and 6:20 PM? 693 What is 171 minutes after 9:28 AM? 12:19 PM What is 405 minutes before 5:35 PM? 10:50 AM How many minutes are there between 6:54 AM and 11:06 AM? 252 What is 643 minutes after 10:59 PM? 9:42 AM How many minutes are there between 2:20 PM and 11:23 PM? 543 What is 92 minutes before 6:11 PM? 4:39 PM What is 207 minutes after 8:41 AM? 12:08 PM How many minutes are there between 4:52 PM and 10:34 PM? 342 How many minutes are there between 3:00 AM and 3:33 AM? 33 What is 243 minutes before 11:55 AM? 7:52 AM How many minutes are there between 11:25 AM and 7:26 PM? 481 What is 324 minutes before 6:10 AM? 12:46 AM How many minutes are there between 8:03 PM and 3:12 AM? 429 How many minutes are there between 4:38 PM and 9:08 PM? 270 How many minutes are there between 12:19 AM and 9:18 AM? 539 How many minutes are there between 7:07 PM and 12:35 AM? 328 What is 342 minutes after 5:46 AM? 11:28 AM How many minutes are there between 6:42 AM and 4:30 PM? 588 What is 374 minutes after 5:29 PM? 11:43 PM What is 344 minutes before 4:20 PM? 10:36 AM What is 53 minutes before 6:58 PM? 6:05 PM How many minutes are there between 1:17 PM and 12:59 AM? 702 What is 560 minutes after 11:21 PM? 8:41 AM How many minutes	{ "pile_set_name": "DM Mathematics" }
264 = 0. Find the common denominator of 45/8 and (-6)/(g/308) + 1. 8 Let i = 7264/23 - 1049305/3312. Calculate the common denominator of i and -121/72. 144 Suppose p = 5v - p - 35, 5v - 5p - 50 = 0. Suppose vz + 24 = 44. Calculate the lowest common multiple of 4 and z. 4 Let b = -15/28 + 37/252. What is the common denominator of b and 95/18? 18 Let m = -8132 - -243839/30. Calculate the common denominator of m and -73/18. 90 Let v = 8 + 10. Calculate the common denominator of (-22)/v - -1 - 3185/450 and -107/20. 20 Suppose 0f + 12 = 4f. Suppose -3g - 5q = -29, -q + f + 4 = g. Suppose 0 = -gx + 5x - 32. What is the lowest common multiple of x and 10? 80 Let f = -226 - -1807/8. Let a = -55409/37240 - -12/931. Let n = a + f. Find the common denominator of n and -19/2. 10 Suppose -t + c = -78, 0t - 4c = 3t - 206. What is the smallest common multiple of 2 and t? 74 Let k = -2428 - -29197/12. Find the common denominator of k and -113/30. 60 Suppose -f + 3h + 15 = 0, -4f - 28 = -8f + 4h. Suppose fo - 15 - 12 = 0. What is the lowest common multiple of 6 and o? 18 Suppose -2w + 370 = 3f, 2f - 13w - 268 = -9w. Calculate the lowest common multiple of f and 12. 252 Find the common denominator of -35/225(-1185)/(-6) and 85/54. 54 Let b = 265438 - 6918110592/26063. Let f = 3883363/312756 + b. Calculate the common denominator of (-1)/2 - (-101)/(-20) and f. 60 What is the common denominator of 20/24 + (-1695)/900 and 17/20? 20 Calculate the lowest common multiple of 7/(-35)-20 + 0 + 5 and 95. 855 What is the common denominator of 1001/28854 + (-12)/108 and -117/10? 2290 Let z(q) = -3q - 3. Let p be z(-4). Suppose v - 79 = -p. Suppose 4n - v = 2. What is the smallest common multiple of n and 22? 198 Let a(d) = d*2 + 8d - 6. Let o be a(4). Let n = o - 18. Calculate the least common multiple of 21 and n. 168 Let g = -53899276063/1068 + 50467495. Let a = 3/89 + g. Calculate the common denominator of a and (-158)/(-10)5/14. 84 Let m(r) = -r3 - 6r*2 - 3r - 9. Let u be 4/80 + 10. Let c = u - -2. Calculate the lowest common multiple of m(-6) and c. 36 Let p = 2850 - 1957. Suppose 0 = 4u - 12, -3w = 2w + u - p. Calculate the common denominator of 29/10 and (w/(-10))/(24/15). 40 Suppose l - 5j - 29 = 0, -5l - 3j - 23 + 112 = 0. Let r = l - 19. Suppose -2o + 2 = -ro. Calculate the least common multiple of o and 3. 3 Suppose -3p - 4b - 1538728 = p, -b = 2p + 769367. Let s be p/(-84) - (0 - 4). Let o = s - 4587. Find the common denominator of 61/16 and o. 48 Calculate the common denominator of (-2)/(-8) + (-117)/16 - -1 and -91/44. 176 Suppose g + z - 12 = 0, -2z = -19g + 14g + 88. Calculate the least common multiple of g and 304. 304 Let n be 0 - -343789/364. Let m = n + -4522/13. Find the common denominator of 62/44 + (-6)/(-3) and m. 154 What is the common denominator of 5/28 and 2 + (-32)/24 - (-197)/60? 140 Suppose -5o = -5t + 270, -o + 99 = 2t + 3. Suppose -3f = -2 - 22. Calculate the lowest common multiple of t and f. 200 Let r(s) = -s*3 + 9s*2 + 2s - 1. Let b be r(9). Let z = b + -8. Calculate the least common multiple of z and 6. 18 Let n be (-765567941)/6855320 - 8/(-4). Let p = -2/171383 - n. Let d = p + -907/8. Find the common denominator of d and 49/16. 80 Let d = -51 + 27. Let g = 93 + -97. Find the common denominator of 11/2 and (-270)/d1/g. 16 Find the common denominator of (127/(-54))/((-2)/(-3)) and 59/96. 288 Let b be 6 + (2 - -1) + -4. Suppose 15 = bz, 5v = -4z + 14 + 8. Let f(r) = r*2 - 2. Calculate the lowest common multiple of 2 and f(v). 2 Let f = 146 - 215/2. Suppose c - 172 = -2j, 0j + 916 = 5c - 4j. Let h = -1087/6 + c. What is the common denominator of f and h? 6 What is the lowest common multiple of 33 and 179/3 - (0 + (-3)/9)? 660 Let q = -189149/28 + 6753. Calculate the common denominator of 37/77 and q. 308 Let r = -33142 - -1391867/42. Calculate the common denominator of 37/11 and r. 462 Let p = 7 - 4. Suppose -5q + 129 = pr, 18 = q - 0q - 2r. Suppose -8 + q = 2s. What is the smallest common multiple of 10 and s? 40 Let l(c) = 2c3 - 14c*2 + 6c - 2. What is the smallest common multiple of 32 and l(7)? 160 Let r(u) be the third derivative of u*4/24 + 7u*3/6 + 2u*2. Let m be r(-6). What is the common denominator of ((-270)/20)/(21m) and -117/20? 140 Let h = 6/51683 - 52923434/361781. Let u = h + 8493/56. Calculate the common denominator of -69/4 and u. 8 Let u = -6191/380 + 244/19. Let y = -76468 - -304221/4. Let m = y - -399. What is the common denominator of u and m? 20 Suppose 5a + 3 = -37. Let t = a + 10. Calculate the least common multiple of (-1)/(t/(-4)1) and 8. 8 Let q(p) = p*3 - 5p*2 - 5p - 6. Let o be q(6). Find the common denominator of 2 + o + 73/(-9) and -7 + (-37 - -33 - (-170)/16). 72 Let x(d) = -2d2 + 15d + 2. Calculate the smallest common multiple of x(7) and 9. 9 Let y(o) = -o*2 - 19o - 54. Let h be (-12)/(-4) - 116. What is the least common multiple of 10 and y(h)? 120 Suppose 225 = 5o + 45. What is the smallest common multiple of 54 and o? 108 Let z(u) = u*2 - 30u + 72. Calculate the lowest common multiple of 16 and z(28). 16 Let o = -5117 - -81823/16. What is the common denominator of -77/16 and o? 16 Let o = -81127/14 + 5790. Find the common denominator of 43/20 and o. 140 Let a = 334 - 1381/4. What is the common denominator of -10/7 and a? 28 Let l = -16021/10 - -1591. Calculate the common denominator of l and 115/42. 210 Let j = 932 + -929. Calculate the least common multiple of 39 and j. 39 Let h = -2459083/5013750 + -1/119375. Find the common denominator of 29/45 and h. 630 Let t be (-1)/(-2)(11 + -1). Let g = -3 + t. Let j(m) = -m3 - 14m*2 - 23m + 20. What is the smallest common multiple of j(-12) and g? 8 Let m be (-996)/(-1)45/3. Let g = -269011/18 + m. Let k = 20294 - 365149/18. Calculate the common denominator of k and g. 18 Let t = -1/7011 + 168407/1002573. Calculate the common denominator of 46/247 and t. 2717 Let s(b) = 21b + 99. Calculate the least common multiple of 54 and s(-3). 108 Let k be ((-666)/28)/((-7)/(196/24)). Let d = 2/7261 - 922157/36305. Let b = k + d. Calculate the common denominator of -13/14 and b. 140 Suppose -3a - 8z + 3z - 4 = 0, -3a + 5z + 16 = 0. Suppose 5l - 44 = h, al + 6h - 4h - 8 = 0. Calculate the lowest common multiple of l and 9. 72 Let n = -29 - -31. What is the common denominator of 46/4 - 4/n and 17/28? 28 Suppose 141 = 4h - f, 0 = 3f + f + 4. What is the common denominator of -29/24 and (-127)/h + (-28)/210? 168 What is the common denominator of -45/32 and (-18)/63 - 1527/1344? 64 Suppose -28n + 133 = -427. Let f(t) = -3t3 - 3t*2 - t + 2. Calculate the smallest common multiple of f(-2) and n. 80 Let u = -5058 - -30251/6. Calculate the common denominator of -139/390 and u. 390 Let c = 6 - 5. Let g(i) = 3i*2 + i. Let h = -11 + 12. Calculate the smallest common multiple of g(c) and h. 4 Calculate the common denominator of -87/10 and (687/126 - 8) + (-18)/(-21). 210 Let s(v) = -4v + 6. Let p(b) = -4b + 5. Let w(l) = -5p(l) + 4s(l). Let u be w(-3). Let y = -1 - u. What is the least common multiple of 8 and y? 24 Let m = -5/277 + -5223/2216. Calculate the common denominator of 118(2 - 33/16) and m. 8 Let q = 252331/44 + -22919/4. Calculate the common denominator of (1/(-30))/(6/(-261)) and q. 220 Let a = -4 - -6. Suppose 4c = -8, -2c = -aj + 8 + 20. What is the smallest common multiple of 27 and j? 108 Suppose h + 7 = 2d, 0 = -3d - 2h + 5h + 15. Let n = -825 + 837. What is the least common multiple of n and ((-16)/(-2))/(d/5)? 60 Let b = -141 - -159. Calculate the least common multiple of 72 and b. 72 Let y be (((-10)/(-15))/(2/1315))/3. Let l = y - 147. Let g = -4/415 + -24042/2905. Find the common denominator of l and g. 63 Calculate the common denominator of -3524/320 - (-2)/(-5) and 57/32. 32 Let p = -23 + 27. Suppose 5h - 7 = -pq + 16, 2h + 10 = 0. What is the lowest common multiple of q and -2 + (-1)/((-2)/20)? 24 Suppose -5b + 21 = -89. What is the smallest common multiple of b and 184? 2024 Let h = 7 - 15. Let c(d) be the third derivative of -d*6/120 - 7d5/60 + d4/4 - d*3 + 2d**2. Calculate the least common multiple	{ "pile_set_name": "DM Mathematics" }
'th term of -13, -17, -1, 47, 139, 287, 503, 799? 2t3 - 2t*2 - 12t - 1 What is the w'th term of -14567, -14553, -14521, -14465, -14379, -14257, -14093, -13881? w*3 + 3w*2 - 2w - 14569 What is the y'th term of -7, 3, 9, 5, -15, -57, -127, -231? -y*3 + 4y*2 + 5y - 15 What is the x'th term of 210, 265, 320, 375, 430? 55x + 155 What is the l'th term of -143, -125, -117, -137, -203? -3l*3 + 13l*2 - 153 What is the a'th term of 4, -18, -54, -104? -7a2 - a + 12 What is the y'th term of -6, 5, 14, 21, 26? -y2 + 14y - 19 What is the d'th term of 4583, 4575, 4553, 4511, 4443, 4343, 4205? -d3 - d2 + 2d + 4583 What is the u'th term of 28, 39, 62, 103, 168, 263, 394? u*3 + 4u + 23 What is the o'th term of 112, 32, -70, -206, -388, -628, -938? -2o3 + o2 - 69o + 182 What is the p'th term of 117, 78, 39? -39p + 156 What is the v'th term of -106, -208, -310, -412, -514? -102v - 4 What is the u'th term of -13, -43, -97, -175, -277, -403, -553? -12u2 + 6u - 7 What is the s'th term of 500, 990, 1476, 1958, 2436? -2s2 + 496s + 6 What is the j'th term of 350, 337, 324? -13j + 363 What is the k'th term of 25, 67, 181, 403, 769, 1315, 2077? 6k*3 + 19 What is the n'th term of 22, 46, 74, 106, 142, 182, 226? 2n*2 + 18n + 2 What is the f'th term of 78, 76, 74, 72, 70? -2f + 80 What is the p'th term of 3945, 3946, 3947? p + 3944 What is the o'th term of 32, 34, 36? 2o + 30 What is the w'th term of 217, 867, 1959, 3499, 5493? w*3 + 215w*2 - 2w + 3 What is the z'th term of -489, -492, -497, -504, -513, -524, -537? -z2 - 488 What is the j'th term of -13715, -13720, -13727, -13736, -13747, -13760, -13775? -j2 - 2j - 13712 What is the m'th term of -3336, -3335, -3334, -3333? m - 3337 What is the x'th term of 91, 152, 213, 274, 335? 61x + 30 What is the l'th term of -28, -30, -46, -82, -144, -238? -l3 - l2 + 8l - 34 What is the y'th term of 33, 36, 43, 60, 93? y3 - 4y*2 + 8y + 28 What is the j'th term of 29, 130, 401, 926, 1789? 14j3 + j2 + 14 What is the m'th term of 28, 68, 180, 400, 764, 1308? 6m*3 - 2m + 24 What is the m'th term of 9828, 9819, 9798, 9759, 9696, 9603, 9474, 9303? -m*3 - 2m + 9831 What is the x'th term of -170, -149, -128, -107, -86? 21x - 191 What is the p'th term of -3813, -3815, -3817, -3819, -3821, -3823? -2p - 3811 What is the v'th term of 588, 587, 586? -v + 589 What is the p'th term of -634, -628, -622, -616, -610, -604? 6p - 640 What is the v'th term of -221, -447, -695, -977, -1305, -1691, -2147? -2v3 + v2 - 215v - 5 What is the o'th term of -52, -250, -776, -1792, -3460, -5942, -9400? -27o*3 - 2o*2 - 3o - 20 What is the k'th term of 2790, 2788, 2786, 2784? -2k + 2792 What is the q'th term of -880, -3560, -8034, -14308, -22388? -q3 - 891q*2 + 12 What is the g'th term of 39, 81, 123, 165? 42g - 3 What is the a'th term of -32, -46, -84, -158, -280, -462, -716, -1054? -2a3 - 30 What is the g'th term of 91, 186, 287, 394, 507? 3g*2 + 86g + 2 What is the k'th term of -4, -28, -52, -76, -100, -124? -24k + 20 What is the b'th term of -40, -86, -138, -196, -260, -330, -406? -3b*2 - 37b What is the n'th term of -947, -950, -953? -3n - 944 What is the q'th term of -477, -467, -455, -441, -425, -407? q2 + 7q - 485 What is the w'th term of -185, -368, -551, -734, -917, -1100? -183w - 2 What is the l'th term of 640, 1282, 1924, 2566, 3208, 3850? 642l - 2 What is the z'th term of 37, 74, 113, 154, 197? z*2 + 34z + 2 What is the o'th term of 7, 27, 59, 109, 183? o*3 + 13o - 7 What is the v'th term of 27, -16, -59, -102? -43v + 70 What is the g'th term of 83, 143, 193, 227, 239, 223? -g3 + g2 + 64g + 19 What is the m'th term of -217, -216, -215, -214, -213, -212? m - 218 What is the j'th term of 66, 61, 46, 15, -38, -119? -j3 + j2 - j + 67 What is the f'th term of -106, -127, -146, -163? f*2 - 24f - 83 What is the c'th term of -8, 2, 20, 46, 80, 122? 4c2 - 2c - 10 What is the q'th term of 34, 10, -14, -38, -62, -86? -24q + 58 What is the f'th term of 36, 157, 358, 639, 1000, 1441, 1962? 40f*2 + f - 5 What is the k'th term of -151, -153, -155, -157? -2k - 149 What is the z'th term of 148, 264, 380, 496, 612, 728? 116z + 32 What is the n'th term of 262, 261, 260? -n + 263 What is the o'th term of 224, 442, 654, 860, 1060, 1254? -3o*2 + 227o What is the a'th term of 812, 1625, 2438, 3251, 4064? 813a - 1 What is the g'th term of -158, -267, -568, -1157, -2130, -3583, -5612, -8313? -16g*3 + 3g - 145 What is the i'th term of -51, -47, -31, 3, 61? i*3 - 3i - 49 What is the y'th term of 1617, 3236, 4855, 6474? 1619y - 2 What is the q'th term of -16, 30, 114, 242, 420, 654? q3 + 13q*2 - 30 What is the b'th term of -9, 0, 15, 36, 63, 96? 3b2 - 12 What is the w'th term of -11, 8, 33, 58, 77? -w3 + 9w2 - w - 18 What is the a'th term of 5053, 10102, 15151, 20200, 25249, 30298? 5049a + 4 What is the t'th term of -34, -235, -782, -1849, -3610? -29t3 + t2 - t - 5 What is the w'th term of 2, 9, 32, 77, 150, 257? w3 + 2w*2 - 6w + 5 What is the h'th term of 91, 706, 2377, 5632, 10999, 19006, 30181? 88h3 - h + 4 What is the h'th term of -16, -23, -20, -1, 40, 109, 212? h3 - h2 - 11h - 5 What is the n'th term of -120, -220, -306, -372, -412? n3 + n2 - 110n - 12 What is the v'th term of 322, 657, 992, 1327? 335v - 13 What is the m'th term of 10, 3, -16, -53, -114, -205? -m*3 + 11 What is the z'th term of 39, 51, 39, -9, -105, -261, -489? -2z*3 + 26z + 15 What is the x'th term of 471, 979, 1487, 1995? 508x - 37 What is the h'th term of -795, -1580, -2363, -3144, -3923? h2 - 788h - 8 What is the r'th term of -33, -47, -61? -14r - 19 What is the j'th term of 34, 36, 38? 2j + 32 What is the i'th term of -96, -202, -314, -438, -580, -746? -i*3 + 3i*2 - 108i + 10 What is the c'th term of -39, -31, -1, 63, 173, 341, 579? 2c3 - c2 - 3c - 37 What is the t'th term of 78, 88, 106, 132, 166, 208? 4t2 - 2t + 76 What is the u'th term of 900, 908, 936, 996, 1100, 1260? 2u3 - 2u*2 + 900 What is the o'th term of 3990, 3992, 3994, 3996? 2o + 3988 What is the p'th term of 28, 70, 132, 208, 292? -p*3 + 16p*2 + p + 12 What is the u'th term of -4, -6, -8, -10? -2u - 2 What is the z'th term of 75, 291, 645, 1131, 1743, 2475, 3321? -z*3 + 75z*2 - 2z + 3 What is the y'th term of 539, 1079, 1619, 2159, 2699, 3239? 540y - 1 What is the q'th term of -37, -88, -163, -274, -433, -652, -943, -1318? -2q*3 - 37q + 2 What is the u'th term of 160, 220, 320, 460, 640, 860? 20u2 + 140 What is the j'th term of 209, 205, 199, 191, 181? -j2 - j + 211 What is the q'th term of 33, 208, 509, 942, 1513? q3 + 57q*2 - 3q - 22 What is the l'th term of 4033, 8068, 12103, 16138? 4035l - 2 What is the v'th term of 549, 1097, 1645, 2193? 548v + 1 What is the l'th term of -109, -223, -343, -469, -601, -739, -883? -3l2 - 105l - 1 What is the o'th term of -10, -42, -94, -166, -258, -370, -502? -10o2 - 2o + 2 What is the c'th term of -339, -677, -1019, -1371, -1739, -2129? -c*3 + 4c*2 - 343c + 1 What is the p'th term of 90, 94, 98, 102? 4p + 86 What is the l'th term of 87, 179, 289, 423, 587? l3 + 3l*2 + 76l + 7 What is the l'th term of -629, -631, -631, -629? l*2 - 5l - 625 What is the p'th term of -1, -49, -123, -217, -325, -441, -559? p*3 - 19p*2 + 2p + 15 What is the v'th term of 16, 23, 30, 37? 7v + 9 What is the l'th term of -99, -196, -293? -97l - 2 What is the r'th term of 3447, 3431, 3417, 3405, 3395, 3387? r*2 - 19r + 3465 What is the v'th term of -140, -148, -156? -8v - 132 What is the n'th term of 1014, 1015, 1016, 1017, 1018? n + 1013 What is the m'th term of 57, 57, 51, 39, 21? -3m*2 + 9m + 51 What is the q'th term of 404, 824, 1256, 1700, 2156, 2624? 6q2 + 402q - 4 What is the q'th term of 719, 725, 735, 749, 767, 789? 2q2 + 717 What is the b'th term of -10, -41, -92, -163, -254, -365, -496? -10b2 - b + 1 What is the p'th term of 439, 434, 427, 418, 407, 394? -p2 - 2p + 442 What is the q'th term of 366, 497, 630, 765? q2 + 128q + 237 What is the n'th term of -4048, -4047, -4046? n - 4049 What is the u'th term of 55, 62, 79, 112, 1	{ "pile_set_name": "DM Mathematics" }
d(j) = 22j - 6. Let p be d(r). Calculate the remainder when o(p) is divided by 23. 12 Let o = -447 + 635. Let i(m) = -m3 - 36m*2 + 93m + 2110. What is the remainder when o is divided by i(-37)? 36 Suppose -434 = -5z - 4s, -6s = 3z - 4s - 258. What is the remainder when 316 is divided by z? 70 Let j(v) = 131v + 273. Calculate the remainder when 362 is divided by j(-2). 10 Let h(c) = -13c + 30. Let j be (-11)/((-5)/(-5)). Calculate the remainder when h(-6) is divided by (-4)/(-6)-15j. 8 Let s be (-4)/10 - 78/30. Suppose 0 = -4g, -5a + 11 = 5g - 29. Calculate the remainder when 3 + ((-6)/s - -7) is divided by a. 4 Let m be (29 + 2)-1 + 0. Suppose -37 - 28 = -n. Let k = m + n. What is the remainder when k is divided by 9? 7 Let s(n) = n*2 + 7n + 1. Let b be s(-8). Suppose 0 = c + b - 39. Let t(v) = 3v3 - 22v*2 - 17v + 24. What is the remainder when c is divided by t(8)? 14 Suppose 3k - 798 = 525. Suppose ki = 434i + 133. What is the remainder when 72 is divided by i? 15 Suppose -5x + 415 = 3l, -4x + 0l = 5l - 332. What is the remainder when 240 is divided by x? 74 Suppose 0 = 14y + 6556 - 6864. Calculate the remainder when 899 is divided by y. 19 Suppose 3p = -3s + 606, 541 - 132 = 2s - 3p. What is the remainder when 3245 is divided by s? 200 Let u = 117659 - 48273. What is the remainder when u is divided by 11? 9 Let l = -4 + 5. Let m(u) = -1 - u2 + 0 - 8u + l + 6. Calculate the remainder when 63 is divided by m(-7). 11 Suppose -15 = 2c + x - 54, -x - 5 = 0. Calculate the remainder when 8204 is divided by c. 20 Suppose -56 = -13z + 165. Suppose -u - 4m = 4u - 571, -m = -5u + 576. What is the remainder when u is divided by z? 13 Suppose 29h + 4f = 33h - 692, 5f = -3h + 487. Calculate the remainder when 1036 is divided by h. 22 Let n be 2/(-14) + (-106)/(-7) - -2. Suppose 6c = nc - 352. Let i = 29 - 18. What is the remainder when c is divided by i? 10 Suppose -2z + 403 + 1 = 0. Let t(u) = u3 + 22u*2 + 67u + 64. Calculate the remainder when z is divided by t(-3). 32 Suppose 101 = -8s + 389. Let r = s + -11. Suppose -n + u = -75, -u + 85 = -5n + 452. Calculate the remainder when n is divided by r. 23 Let s = -12 - -16. Suppose t = -3q + 101, -3q + q - st + 54 = 0. What is the remainder when 7/q - (-219)/5 is divided by 23? 21 Suppose l - 54 = 5j, -121 = -4l + 5j + 35. Let p = l - 1. Suppose -132b - 1440 = -212b. What is the remainder when p is divided by b? 15 Suppose -22r + 18r = 4u + 24, u = r - 8. Let q(g) = -27g - 164. Calculate the remainder when 173 is divided by q(u). 23 Let c(s) = 11s + 11. Let l = 337 - 167. Let d = l + -161. Calculate the remainder when c(3) is divided by d. 8 Suppose -6d + 2d = -312. Calculate the remainder when d is divided by 3774/(-37740) - 2/((-20)/201). 18 Let k(p) = 3p*2 + 1. Let d be k(-1). Suppose -d + 0 = -2m. Calculate the remainder when ((-9)/8)/((-4)/(-18) - (-1650)/(-4752)) is divided by m. 1 Suppose 0 = 858f - 127332 + 17508. Suppose -93 = 5q - 333. Calculate the remainder when f is divided by q. 32 Let u(t) = t*3 + 10t*2 - 320t + 27. What is the remainder when u(31) is divided by 248? 244 Let h be ((-8)/6)/(2/(-78)). Let b = 76 - h. What is the remainder when 44 is divided by b? 20 Suppose 2y - 43 - 112 = -5t, y + 3t - 75 = 0. What is the remainder when 230 is divided by y? 50 Suppose -2i + 644 = 2q, 4i - 442 = 4q + 830. Suppose 5w = -245 + i. Calculate the remainder when 102 is divided by w. 12 Let l = -42034 + 42083. Suppose -12 = -4a + 28. What is the remainder when l is divided by a? 9 Let k = -5699 - 1219. Let n be (-4)/30 + k/90. Let f = n + 99. What is the remainder when f is divided by 10? 2 Let y(f) = -11f*3 - 2f*2 - 2f - 1. Suppose 3z + 321 = 18w, -w - 5z + 54 = -0z. Calculate the remainder when y(-3) is divided by w. 18 Let n be -3(-3 - -10 - (-110)/(-15)). Let m(s) be the third derivative of 23s6/120 - s5/60 + s*2. What is the remainder when 131 is divided by m(n)? 21 Let m(k) = -503k - 3031. What is the remainder when m(-8) is divided by 257? 222 Suppose 2i + 3i - 80 = 0. Suppose 17h - 2099 - 43 = 0. What is the remainder when h is divided by i? 14 Let p be -6((-105)/6)/(-7). Let h(j) be the first derivative of -j*4/4 - 16j*3/3 - 9j*2 + 12j - 82. What is the remainder when h(p) is divided by 10? 7 Suppose -7k + 74 = -24. What is the remainder when 403 is divided by k? 11 What is the remainder when 2485 is divided by -32(12 - (-392)/(-32))? 5 Suppose 0 = 2p - 45t + 56t - 93, 4p = -4t + 96. What is the remainder when 143 is divided by p? 10 Let b(f) = f2 + 10f - 8. Let v be b(-12). Calculate the remainder when 142 is divided by 8/6(32/(-8) + v). 14 Let u be (-1)/3(0/(-4) - -12). Let x be (u + 5)/(3 - 4). Calculate the remainder when (x + 3)11242/36 is divided by 10. 9 Suppose 5m = -5g + 160, -5m + 7m = -g + 72. Calculate the remainder when 454 is divided by m. 14 Suppose 2o + 2l + 652 = -198, -4l = o + 416. Let i = o + 439. What is the remainder when 29 is divided by i? 7 Suppose 0 = 3p + 5i - 120 - 28, 0 = -2p - 5i + 112. Calculate the remainder when 2069 is divided by p. 17 Let j = -27 + 32. Suppose -5i + 2 = -4r, 3 = -5r + 4i + j. What is the remainder when 43 is divided by r/(-10) - (-12)/4054? 11 Suppose 500o - 482o = 846. What is the remainder when 218 is divided by o? 30 Suppose -8538 = -4t + 3p, -5t + 4t = p - 2138. Suppose t = 39b - 15b. Calculate the remainder when b is divided by (-5 - (-12)/3)-271. 8 Let l(z) = 35z - 80. Let o be l(10). Let j = o + -112. Calculate the remainder when j is divided by 40. 38 Let t(h) = 34h*2 - h + 3. Let m be t(-2). Let b = 231 - m. Suppose 0v + 4v = 52. What is the remainder when b is divided by v? 12 Let l(p) be the third derivative of p6/120 - 3p5/20 + p4/24 + p3/6 - p2 - 30p. Calculate the remainder when 35 is divided by l(9). 5 Suppose -4t = -3t - 11. What is the remainder when t is divided by (-12)/(-14)117/(-13)14/(-12)? 2 Let l(x) = 2x*2 - 120x + 479. What is the remainder when 3438 is divided by l(56)? 28 Suppose 2u + 4g = 2g + 16, 5g = 5u - 50. Suppose -uk + 30 + 6693 = 0. What is the remainder when k is divided by 6? 3 What is the remainder when 0 + (-8)/(-28) - (-517296)/1092 is divided by 115? 14 Suppose 2o - 3d = 205, -2d - 179 - 27 = -2o. Suppose -ou - 24 = -107u. What is the remainder when 47 is divided by u? 7 What is the remainder when ((-36)/90)/(2/(-3365)) is divided by 9? 7 Let o be (-1)/((-8)/4)-4. Let j(u) be the second derivative of -u5/4 + u4/6 + 5u*3/6 + 3u*2/2 + 126u. What is the remainder when j(o) is divided by 6? 5 Let f(g) = 34g - 1310. Calculate the remainder when 219 is divided by f(41). 51 Suppose 0 = -128u - 112u + 26364 + 201156. Calculate the remainder when u is divided by 28. 24 Let w(o) = 360o - 6. Let b be w(1). Suppose 10d = 4d + b. What is the remainder when d is divided by 23? 13 Suppose 2p = -3l + 41, 2l + 2p - 23 - 7 = 0. Suppose 0 = -a - 1 + l. Calculate the remainder when 62 - (-65)/(-26)(-6)/(-5) is divided by a. 9 Let n be (30/(-9) - -3)/(1/(-12)). What is the remainder when -5 + 4/n16 is divided by 6? 5 Let r(s) = 5s + 53. Let m be r(-7). Calculate the remainder when -2 + 5 - -6(m - -3) is divided by 35. 24 Let d(z) = -22z + 2. Let k(f) = 12f - 1. Let a(g) = -6d(g) - 10k(g). Let o = 4 + 0. Calculate the remainder when a(o) is divided by 6. 4 Let u(x) = -x*3 - 4x*2 - 2x - 5. Let h be u(-4). Let c(a) = 10a2 - 20a + 50. Calculate the remainder when 477 is divided by c(h). 77 Suppose 3a + 447 = 126. Let i = 160 + a. Calculate the remainder when i is divided by 12. 5 Let a = -2630 + 2968. Calculate the remainder when a is divided by 19. 15 Let x = -699 - -847. Suppose -x = -7g - 57. Calculate the remainder when g is divided by 6. 1 Let p = 66 + -45. Let u(a) = -a*2 - 89a - 7. Let g(k) = 88k + 7. Let z(j) = 4g(j) + 3u(j). Calculate the remainder when z(28) is divided by p. 14 Suppose -2o - 16 = -n + 2o, 5o + 41 = 2n. Let h(v) = -105v - 5069. Calculate the remainder when h(-52) is divided by n. 27 Suppose 209q - 417q - 30 = -210q. Let d(y) = 5y*2 + 2y. Let x	{ "pile_set_name": "DM Mathematics" }
+ gb4 + f + ab + wb2 and give a. -2 Express 2f*3 - 7f*2 - 1 - 1080404f - 11f4 + 1080404f as n + if4 + hf*3 + mf*2 + cf and give n. -1 Rearrange 108812u2 + 2u + 7u3 + 12 - 54407u*2 - 54392u*2 to the form f + du*2 + mu*3 + nu and give n. 2 Express 2385u2 + 2394u2 - u3 - 4776u2 + 116u*4 in the form bu*4 + vu*2 + wu + ku3 + j and give b. 116 Rearrange ((-3 - 3 + 5)(-2w - w + w) + 3w + 0w - 2w + 4w - 5w - w)(439 - 184w*2 - 439) to the form kw + yw3 + n + jw*2 and give y. -184 Express 171w - 277 + 3759w + 127 + 150 in the form xw + b and give x. 3930 Rearrange (m - 5 + 5)(-5m + 0m + 4m) - 4m2 + 4m - 4m - m2 + 7m*2 + 6m*2 + (-4 + 5m + 16 - 14)(0 + 0 - 3m) to om + rm*2 + c and give o. 6 Express -7m + 5m + m4 - 3345 + 3364 + m4 + 7m*2 in the form lm*2 + x + am*4 + cm*3 + sm and give s. -2 Rearrange 1943x - 130 - 45 + 175 to the form jx + u and give j. 1943 Express 5c2 - 6 - 1 + 14 - 6 - 6c*2 + 247c in the form jc + kc*2 + g and give k. -1 Rearrange 30d*2 - 35d*2 + 38993d*3 - 38992d*3 - 2200 to kd*3 + s + ld + xd2 and give k. 1 Express -122q + 471q - 2 - 114q + 89q3 + 6q*2 - 119q - 118q as yq + i + hq2 + gq*3 and give i. -2 Rearrange -2119z + 1059z + 1055z - 82 to the form vz + c and give c. -82 Express -202d + 73d + 231 + 70d + 59d + 7d*2 as vd + y + md2 and give m. 7 Express -281b + 2 + 134b - 870b + 142b in the form u + kb and give u. 2 Express (26g + 20g - 14g)(5g + g - 5g)(-10g*2 - 52g + 52g) in the form kg + sg3 + xg*4 + a + ng*2 and give a. 0 Rearrange (-18 - 8 - 10)(-3c + 0 + 0)(61 - 167 + 63) to ac + j and give a. -4644 Express -197m + m*2 - 266 + 257 + m - 111m in the form z + qm2 + im and give i. -307 Express 150z - 1375z - 724z - 2224z + 201z as c + lz and give l. -3972 Rearrange 23 - 4 - 9 - 83v - 10 to kv + s and give k. -83 Rearrange -10835a3 - 10745a*3 + 5a*2 + 21671a*3 to na*3 + ja + u + ga2 and give j. 0 Express 47 + 14k - 17k + 33 + 2k*2 + 122 - 2k*3 in the form ck*2 + ok*3 + rk + d and give d. 202 Rearrange 3514f - 5305f - 4182f to the form a + qf and give q. -5973 Rearrange -204k3 + 23k*4 + 202k*3 - 7k - 10k2 + 3 + 5k - 21k4 to v + zk*4 + sk + lk3 + pk*2 and give s. -2 Express 9p*2 - 17012p*3 - 2p*4 - 6p + 6 + 17012p3 as fp*2 + x + bp + wp4 + hp*3 and give b. -6 Express (-4 + 2h*3 + 4)(-1676 + 897 + 1044) in the form wh + ah*3 + b + ch*2 and give a. 530 Rearrange -3 - 43f*2 + 117f2 + f3 - 50f2 + f - 20f*2 to the form wf*3 + qf*2 + df + v and give q. 4 Rearrange -5b4 + 8b*4 - 4b - 7b - 17046b*3 + 17048b3 - 2 + b2 + 3b4 to lb*2 + kb*4 + o + wb*3 + nb and give l. 1 Express -33z + 162 + 40z + 162 + 37z - 329 as qz + n and give q. 44 Rearrange 4 - 18398u3 + 18400u*3 + 8 - 30u to ru + du*2 + s + pu*3 and give p. 2 Rearrange ((-226 + 226 - 22c)(-3 + 1 + 6) + 118c - 60c - 57c + 1 + 0c + c + c)(-3 + 0 + 1) to bc + u and give u. -2 Rearrange 13o - 8636o4 + 17267o*4 - 58 - 8633o4 - o3 to yo4 + io*2 + d + zo + bo3 and give y. -2 Express (-27w*3 - 769w*3 - 3539w*3)(3w - w - w) + 0w*4 + 0w*4 - 2w*4 as qw + xw4 + vw*2 + tw3 + c and give x. -4337 Express h2 - 1590 - 1198 - 568 as w + vh2 + lh and give v. 1 Rearrange -1 + 51p2 + 190p*3 - 3p - 53p2 - 191p*3 to the form l + zp*3 + qp*2 + vp and give l. -1 Express -2 + 76x3 + 70x*3 + 247x*2 - 126x*3 - 21x*3 as lx*3 + a + zx + ox2 and give l. -1 Rearrange (72 + 101 + 91 + 7 + 56)(2w - 3w + 12w) to the form gw + p and give g. 3597 Express -2c3 - 17c*4 - 2c - 52797 + 26459 + 26423 as dc + zc*3 + vc*2 + n + wc*4 and give w. -17 Rearrange -233i*4 - 3i*3 + 0 + 81i*4 + 52i*2 + 1 + 73i*4 - 2i + 78i4 to the form li*3 + mi*4 + vi + c + ji2 and give j. 52 Rearrange u - 6 + 8u*2 + 5 - 9u*2 + 4u*3 + (-2u + u - u)(31u*2 - 59u*2 - 30u*2) to the form iu + xu3 + l + du*2 and give d. -1 Express -4 + 4195y*2 - 6 + 3 + 10 - 4 in the form uy + c + by2 and give c. -1 Rearrange 603p + 609p + 606p + 593p - 1613 - 2413p to the form lp + m and give l. -2 Rearrange 10x*3 + 18x*2 + 58 - 9x*3 - 57 + x to px*2 + kx + y + qx3 and give k. 1 Rearrange 39 - 40 - 9446z + 1 to kz + o and give k. -9446 Rearrange 4 + 6 + 5 - 17 - 167l + 7 to zl + f and give z. -167 Express -3804b - 2218b - 1732b + 1 in the form s + gb and give g. -7754 Express (-403t*2 + 172t*2 - 242t*2)(-t - 32t - 6t) + 4 + t*3 - 4 in the form ot*3 + x + lt*2 + dt and give o. 18448 Rearrange (7d + 242 - 221 - 11d)(-1 - 2d2 + 1) + d3 - 4d2 + 4d*2 - 2d*2 + 2d*2 - 4d*3 to w + hd + yd2 + fd*3 and give f. 5 Express (6822 - 3023 + 14271)(4a + 0a - 5a) as m + za and give z. -18070 Express -2i4 - 7i*3 + 9i*3 + 1 + 46i*2 + 121i*2 + 4i*4 in the form xi*4 + mi*3 + ti + oi2 + g and give o. 167 Express -893z - 43z - 196z as h + qz and give q. -1132 Rearrange (-2q + 1220 + 5609 + 681 + 14602 + 4761)(0 + 2 - 3) to the form v + sq and give v. -26873 Express -226x2 - 299x*2 + 525x*2 - 3x - 3301x3 as bx*3 + ox + m + nx2 and give m. 0 Express (-2 - 3 + 4)(53 - 113 + 88)(-7s*2 + 4s*2 + 14s*2) in the form ts*2 + i + vs and give t. -308 Rearrange (-3 + 1 + 5 + (-1 + 0 + 3)(0 + 1 + 0))(5 + 2y - 5)(-27y2 + 32y*2 + 46y*2 + 2) to dy*2 + uy*3 + b + py and give u. 510 Rearrange 159838x2 - 159230x*2 - 4x + 2x + 2x*3 + 0x to ox + ax*3 + kx*2 + b and give k. 608 Express -19p - 2p2 - 4p*4 - 44 + 44 - 717p as xp3 + qp*2 + r + up + zp4 and give u. -736 Express 4m*2 - 3m2 + m2 + (-m + m - m)(-140m - 358m - 282m) in the form qm2 + sm + g and give q. 782 Rearrange -h*3 - 5165h*4 + 2h*2 + 9 - 7 + 13414h - 13413h to the form k + xh*3 + uh*4 + th + gh2 and give t. 1 Rearrange (-7h - 14 + 14)(58h*2 + 30h - 30h) + (h - 6h - 2h)(h2 + h - h) - h3 + 3h3 + 0h*3 to x + rh*3 + kh*2 + th and give r. -411 Express -71 - 19805f2 - 2f*3 + 19805f*2 as u + mf + rf3 + jf*2 and give u. -71 Rearrange -16c - 465c - 1 - 295c - 511c to the form rc + s and give r. -1287 Express -25l3 - 5l - 2l2 - 359l*4 + 48l*3 - 21l*3 + 376l*4 as ml*3 + il*2 + w + al*4 + fl and give f. -5 Rearrange 148k4 - 147k*4 + 7k*3 - 34k*3 - 24k to s + rk3 + zk + ok2 + qk*4 and give r. -27 Rearrange -33k + 449 + 221k - 217 - 33k - 222 to b + hk and give b. 10 Express (-m + 0m - 4m + (-1 + 3 - 5)(3m + 6 - 6))(148m + 59m*2 - 148m) in the form k + fm + am*2 + tm*3 and give t. -826 Express (13f*3 + 9f*3 - 3f*3)(1 - 1 + 1) + 4f3 + 6f*3 - 6f*3 + 15 in the form gf + mf2 + bf*3 + d and give b. 23 Rearrange (2 + 0 - 5)(-3c - 27 - 3c - 59 - 40) to b + lc and give b. 378 Rearrange 423z*3 + 2z - 60z3 + 2z*4 + 508z3 - z2 - 3 + 16z3 to the form hz*2 + sz*3 + a + gz*4 + qz and give a. -3 Rearrange 10i - 6i - 351 - 2i + 313 + 2343 to di + y and give y. 2305 Rearrange 12t3 + 3t + 29 + 22 + 41t2 - t4 - 12t*3 - 56 to ct*4 + zt + ot3 + h + mt2 and give c. -1 Rearrange (-n2 + 1619n + 10 - 1619n)(72 - 216 + 97) to p + on + dn2 and give p. -470 Rearrange 191454v - 185031v + 1 - 3 to the form r + bv and give b. 6423 Rearrange -1005b3 + 2b - 2 - 216b2 + 2b*4 + 992b*3 + 219b*2 to the form ob + t + hb3 + nb*4 + lb*2 and give t. -2 Express 1028 + 1022 + 129c*2 + 20c*3 + 1028 - 4103 + 1026 in the form mc*2 + oc + v + ac3 and give a. 20 Rearrange 5279h - 5432h + 1 + 40h*2 - 59h*2 to wh + ch2 + v and give w. -153 Express -14 + 6077v - 7 - 4 + 35 - 8 in the form nv + s and give s. 2 Rearrange 38h*2 - 29h2 + h3 - 153h - 1 - 9h*2 - 2h*2 to the form g + bh + ch2 + uh*3 and give u. 1 Express (-180 - 26t + 180)(54t - 161t + 66t + 45*t - 158) in the for	{ "pile_set_name": "DM Mathematics" }
Let w(n) be the first derivative of 9n + 151 + 1/2n*2. What is w(f(c))? 3c*2 + 9 Let f(o) = 2421659o. Let j(v) = 24v. Calculate f(j(r)). 58119816r Let q(r) be the first derivative of -r*3 + 15. Let y(o) = 72o + 1459 - 1459 + 65o. Calculate q(y(g)). -56307g*2 Let z(d) = 3d*2. Let h(s) = -7s*2 - s - 119311. Determine h(z(f)). -63f*4 - 3f*2 - 119311 Let o(n) = 2n*2 + 2n - 4. Suppose -41z + 46z = 10. Let t(d) = 8d2 + 7d - 14. Let y(l) = zt(l) - 7o(l). Let s(q) = -6q2 + 9q. Calculate s(y(b)). -24b4 + 18b*2 Let n(y) = 263210y. Let v(o) = 405o. Determine v(n(s)). 106600050s Let f(g) = 27g2. Let l(r) = 31210300r*2. Determine l(f(w)). 22752308700w*4 Let d(a) = 2a*2. Let h(r) be the first derivative of -386r*2 - 3441. Calculate d(h(s)). 1191968s2 Let y(m) = m2. Let k(u) = -60u2 + 52614. Calculate k(y(i)). -60i4 + 52614 Let p(a) = -a2. Let t(g) = 132915g2 + 7g - 2. Determine t(p(d)). 132915d4 - 7d*2 - 2 Let p(m) be the third derivative of 61m*4/24 - 123m*2 - 12. Let q(z) = -113z*2. What is p(q(n))? -6893n2 Let t(v) = v2 + 3v - 26. Let p be t(-8). Let h(s) = 9s + 8s - ps. Let b(f) be the third derivative of -f*5/30 + 2f*2. What is h(b(m))? -6m2 Let k(x) be the first derivative of x5/15 - x*2 + 33x + 68. Let m(j) be the second derivative of k(j). Let i(q) = -14q2. Calculate m(i(b)). 784b*4 Let i(u) = 5u*2. Let d(c) = 902820c*2 + 3280. Let m(q) = -826q*2 - 3. Let k(z) = 3d(z) + 3280m(z). Calculate k(i(s)). -20500s*4 Let r(p) = 2p. Let l(o) = 1121o2 + 209o + 209. Let i(h) = 30h2 + 60h + 2h2 + 67h + 6 - 121h. Let b(d) = 209i(d) - 6l(d). Give b(r(w)). -152w*2 Let s(h) = 2h + 116 - 8 - 108. Let x(u) = -66u2 - 21u. Determine x(s(g)). -264g2 - 42g Let w = -1 - -3. Let o(y) = -yw - y2 + y*2. Let r(s) = -8s*2 - 4. Let a(b) = -7b*2 - 5. Let d(k) = 4a(k) - 5r(k). Calculate d(o(x)). 12x*4 Let v(q) = 27066335q. Let a(y) = 7y2. Determine v(a(s)). 189464345s*2 Let f(k) = -5485k*2 - 5583k*2 + 11066k*2. Let a(h) = -5248h*2. Determine a(f(j)). -20992j*4 Let l(q) = 8q. Let i(n) = -7n2 - 3n. Let m(x) = -2x2 - x. Let z = -56 + 55. Let w(v) = zi(v) + 3m(v). Give l(w(t)). 8t*2 Let n(j) = 2j. Let v(q) = q + 2959823. What is n(v(b))? 2b + 5919646 Let k(c) be the third derivative of c4/2 - 2c*2. Let t(p) = -1. Let q(h) = -2h - 5. Let j = 251 + -249. Let v(m) = jq(m) - 10t(m). Give v(k(s)). -48s Let b(w) = w. Let j be (354/(-4))/((-15)/10). Let g(s) = 477s + 472s - j - 947s. Calculate b(g(q)). 2q - 59 Let r(d) be the second derivative of 0 + 13d + 1/6d3 + 0d*2. Let n(a) be the first derivative of -13a*2/2 - 17. Calculate r(n(q)). -13q Let r(a) be the second derivative of -a*3/6 - 16a*2 - 1392a. Let y(l) = 5l. Determine y(r(p)). -5p - 160 Suppose b - 57 - 31 = -3m, 5m - 143 = 2b. Let y(r) = -29 - 6r + m. Let c(i) be the first derivative of 5i3/3 - 8. Calculate y(c(z)). -30z*2 Let w(d) = -d - 6291. Let l(u) = -565u*2 + 2. Determine w(l(n)). 565n*2 - 6293 Let m(p) = -740p + 580. Let a(t) = -31t + 24. Let r(l) = -145a(l) + 6m(l). Let i(c) = -c2 + 5c. Determine r(i(u)). -55u2 + 275u Suppose 52 - 48 = 3k - 4q, 2k - 2 = 3q. Let v(s) be the second derivative of -46s + 0 - 55/2s*2 + 0s*3 - 1/6sk. Let t(j) = -j2. Calculate t(v(g)). -4g4 - 220g*2 - 3025 Let b(d) = 5058d. Let f(v) = -2v2 + 4v*2 - 137v + 104v + 33v. What is b(f(n))? 10116n2 Let v(c) = -1316c + 78. Let r be v(-3). Let u be 2106/8. Let h(x) = 4026 - ux2 - r. Let g(o) = -o2. Give g(h(f)). -225f*4 Let v(f) = 254f*2 - 8550. Let n(d) = -d. Calculate v(n(b)). 254b*2 - 8550 Let s(g) = 0g + g + 9g - 14g + 6g. Let y(m) = -m + 512. Determine s(y(r)). -2r + 1024 Suppose 5v - 4r + 105 = 448, -2r + 361 = 5v. Let s(x) = vx2 + 71x*2 - 136x*2. Let y(z) = 5z. Determine y(s(k)). 30k2 Let a(b) = 579149b - 578 - 579149b + 2b*2. Let p(y) = 2y. Give a(p(x)). 8x2 - 578 Let a(z) = 45z*2. Let k(s) = -56564s + 2. What is k(a(o))? -2545380o2 + 2 Let r = -228 + 291. Let n(b) = -rb + 23b + 21b + 18b. Let m(w) = -w2 - 14w. Determine m(n(d)). -d*2 + 14d Let i(y) = -85y. Let v(u) be the second derivative of 14 + 1/3u*3 - 2u + 0u2. Calculate v(i(z)). -170z Let y(j) = -6j. Let q(b) = -19129b + 4. What is q(y(k))? 114774k + 4 Let f(g) = 126g*2 + 2g. Let p(b) be the second derivative of -3b3/2 - 129b - 2. What is p(f(x))? -1134x2 - 18x Let g(c) be the second derivative of -c*4/4 - 2c + 236. Let x(o) = -602o2. What is g(x(p))? -1087212p*4 Let k(g) = -2919523 + 2919523 + 100g. Let w(p) be the first derivative of p*2 + 1. Calculate w(k(b)). 200b Let s(k) = k + 7. Let a be s(-5). Let j(h) = ha - h2 + 2h2. Let g(c) = -29221c + 30c2 + 29221c. Determine g(j(x)). 120x4 Let z(r) = -6r. Let a(w) be the third derivative of -2w2 + 0 + 145w + 0w3 + 0w*4 + 1/15w*5. Determine z(a(m)). -24m2 Let k(r) be the second derivative of r4/12 + 2087r. Let n(f) be the second derivative of 47f*3/6 - f. Determine k(n(v)). 2209v*2 Let m(d) = -8d + 45d - 6d - 33d. Let q(z) = -77z*2 - 2z. Calculate m(q(f)). 154f2 + 4f Let d(w) = -3w2. Let i(k) be the third derivative of 0k + 67/60k5 + 0 + 64k*2 + 0k*4 - 1/3k*3. What is i(d(r))? 603r*4 - 2 Let z(y) = -19y. Let g(b) be the second derivative of -39b3/2 + 7b - 85. What is g(z(s))? 2223s Let b(a) = -4a + 2367 + 2325 - 4858. Let k(r) = -2r. What is b(k(w))? 8w - 166 Suppose 0 = 4j + j - 60. Let i(r) = 0 + 0 - jr. Let a(d) be the first derivative of 2d2 - 32946. What is i(a(k))? -48k Let d(w) = 2w + 30. Let b(s) = -s2 - s. Let g(r) = -3r*2 - 4r. Let p(a) = -4b(a) + g(a). Calculate p(d(v)). 4v*2 + 120v + 900 Let x(d) = -2d + 296. Let z(r) = 28r*2 + 64r - 2. Determine z(x(n)). 112n2 - 33280n + 2472190 Suppose -9200 = -p + 640. Let k(a) = pa - 9840a + 2a2. Let x(g) = -2g + 2 - 2. Determine x(k(l)). -4l2 Let y(j) = 1372j + 317. Let t(q) = -q*2. Calculate y(t(a)). -1372a*2 + 317 Let o(j) = -54j*2 - 17j + 17. Let f(h) = -19h2 - 6h + 6. Let b(z) = -34f(z) + 12o(z). Let k(l) = l + 803. Calculate b(k(d)). -2d2 - 3212d - 1289618 Let l(m) = -2m. Let b(g) be the second derivative of 39g*4/4 + 17g*2/2 - 30g - 14. What is l(b(q))? -234q2 - 34 Let c(p) be the second derivative of -p3/6 + 4p - 24. Let f(j) = -1121j + 2. Determine f(c(x)). 1121x + 2 Let p(u) = 3u2 - 1 + 1. Let y(q) = -2q*2 + 16q + 6. Let f be y(7). Let i(b) = 8 - f + 14b + 12. Calculate p(i(v)). 588v*2 Let g(j) = j + 28. Let d(y) = -9y + 106742y2 + 40y - 106743y2. Determine d(g(r)). -r2 - 25r + 84 Let r = 3549 - 3549. Let j(b) be the second derivative of rb2 - 4/3b*3 - 6b + 0. Let g(c) = c*2. Give j(g(u)). -8u*2 Let h(g) be the first derivative of -26g*2 - g + 2407. Let f(q) = -4q. What is h(f(v))? 208v - 1 Let v(l) = -16l*2. Let b(c) = 301c*2 - 36c - 9. Let j(o) = 12191o2 - 1460o - 365. Let s(y) = -365b(y) + 9j(y). Calculate v(s(q)). -341056q4 Let d(g) = -5g. Let a(x) be the first derivative of 1/6x3 - 16x + 9 + 0x2. Let w(v) be the first derivative of a(v). Calculate d(w(p)). -5p Let w(k) = -16233956k2 - 22065k + 228005. Let v(l) = 4415l2 + 6l - 62. Let u(a) = 7355v(a) + 2w(a). Let d(h) = h*2. What is d(u(o))? 19474569o*4 Suppose -l = -10 + 2. Let o(k) = -11k*2 - 8k*2 - lk*2 + 26k*2. Let d(r) = 7r*2 + 0r*2 + 7r*2. Calculate d(o(q)). 14q*4 Let k(r) = -75639r*2. Let a(h) = -188h*2. Calculate k(a(f)). -2673384816f*4 Let x(c) = 1214c. Let n(q) be the second derivative of q*3/3 + 101q - 50. Determine x(n(p)). 2428p Let w(i) = 21i - 110. Let l(r) = -28306r. Calculate l(w(f)). -594426f + 3113660 Let g(y) = 10y2. Let l(w) = 39146236w*2. Calculate g(l(s)). 15324277929676960s*4 Let y(z) = 42z*2 + 28z - 28. Let b(q) = 4q2 + 2q - 2. Let f(x) = -14b(x) + y(x). Let t(w) = -141w*2. Calculate t(f(g)). -27636g*4 Let s(y) = 1384y + 98. Let v(w) = 214w2. Give s(v(r)). 296176r*2 + 98 Let y(q) = -2557q + 1279*	{ "pile_set_name": "DM Mathematics" }
= -24z. Let c be q(2). Let w = c - -91. Let s = -585 - -710. What is the remainder when s is divided by w? 39 Suppose 17a - 360 = 9a. Let h = 91 - a. What is the remainder when h is divided by (-240)/(-36)((-15)/(-4) - 0)? 21 Suppose 53o = -39o + 16o + 304. What is the remainder when o is divided by 1? 0 Let k(z) = -z3 - 10z*2 + 23z + 73. Calculate the remainder when 189 is divided by k(-12). 19 Suppose -11910 - 1817 = -1961s. Calculate the remainder when 121(-31)/(-3) is divided by s. 5 Let u be (-250)/20(0 + 2). Let g be -6(u/(-10) - 3). Suppose -44 = -gc - 35. Calculate the remainder when 6 is divided by c. 0 Suppose 4f = d + 3d - 1912, 0 = -5f + 5. Calculate the remainder when d is divided by 41. 28 Let p = 288 - 197. Suppose 7d + 5q = 8d + 17, -6 = 2d - 3q. Suppose a = d + 29. Calculate the remainder when p is divided by a. 27 Suppose p - o - 1 = -p, 9 = 5p + 4o. What is the remainder when (p - (-1)/5)/(6/3280) is divided by 14? 12 Suppose -4 = 2p + 2z, -2p + z - 2z - 7 = 0. Let a be 2/p - 16172/(-130). Suppose -254 - a = -3q. What is the remainder when q is divided by 10? 6 Let t(l) = 4l*2 - 9l - 16. Calculate the remainder when t(-3) is divided by (-245)/(-8) - (-78)/208. 16 Suppose 12f + 4 - 40 = 0. Suppose 5p + 2m = 4m + 48, 33 = fp + 3m. What is the remainder when 46 is divided by p? 6 Suppose -z = -3g + 21 - 6, 0 = 2g - 3z - 3. Suppose 0 = -gp - 26p + 13952. What is the remainder when p is divided by 88? 84 Suppose 8 + 1 = 3a. Suppose i + 34 = 4r + ai, -3i = -r + 5. Suppose 2x = -s + 36, r = 5x + 23. What is the remainder when s is divided by 11? 9 Suppose 21k - 26 = 20k. Suppose -5m = -3z + 33, -2m - z - k = z. Calculate the remainder when 30 is divided by -1 - m - (4 + -4). 6 Suppose -17b - 3z + 12 = -14b, -3z + 5 = -4b. What is the remainder when 94/(-6 - (-8)/b) is divided by 6? 5 Let b be (-2 - (-1320)/(-9))-3. Suppose -n - d = -107, 4n - d - b = d. Calculate the remainder when n is divided by 29. 23 Let o(c) = -c2 + 4 - 4618c + 4624c + 4. Calculate the remainder when 79 is divided by o(6). 7 Let z = 12413 - 12213. Calculate the remainder when 583 is divided by z. 183 Let i = 961 + -942. Suppose -2n = n + 2d - 401, 3n - 381 = 3d. What is the remainder when n is divided by i? 17 Let o = 5675 + -1864. Calculate the remainder when o is divided by 123. 121 Suppose 0 = -4s + 21 - 5. Suppose -c = s - 26. Suppose 16a + 198 = -40a + 870. Calculate the remainder when c is divided by a. 10 Let x be 144/(-90)(-1 - 53/2). Suppose -xf + 8494 = -13f. Calculate the remainder when f is divided by 46. 44 Let v(k) = k3 + 8k*2 + 13k - 9. What is the remainder when v(8) is divided by 15? 9 Suppose -20i + 10612 = 8i. Let t = 382 - i. Let o(b) = -b*2 - 5b + 1. Calculate the remainder when o(-4) is divided by t. 2 Let q(m) = 2m3 + 3m - 5. Suppose t - 43 = -t - 5u, -2t + 3u = -35. Calculate the remainder when t is divided by q(2). 2 Suppose 16h = 18h + 8, -5h = 5k - 8715. What is the remainder when k is divided by 125? 122 Let q(h) = -10h + 62. Let i be q(6). Suppose 2 = 5n + p, 4n - 3p - 11 = in. Calculate the remainder when 10 is divided by n. 0 Suppose 3p - 49j - 1053 = -46j, -8 = 2j. What is the remainder when p is divided by 173? 1 Let l be (-4)/660/(-4). What is the remainder when 35 is divided by 26/14((l - 12) + 9)? 9 Suppose 6269 = 28d - 5743. Calculate the remainder when d is divided by 53. 5 Suppose 122t - 125t = 84. What is the remainder when 27 is divided by -8((-49)/t + -3)? 7 Let f(g) = g*3 - 19g*2 - 16g - 1. Let q = 67 + -47. What is the remainder when f(q) is divided by 18? 7 Let t = -5 - -20. Suppose 5q - 3q = 4g - 256, -5g + 8q = -331. What is the remainder when g is divided by t? 3 Suppose -14g - 11664 = 4g. Let k = -596 - g. Calculate the remainder when k is divided by 17. 1 Suppose 2l + 350 - 364 = 0. Suppose 21t - 119 = l. Calculate the remainder when t is divided by 2. 0 Let f(w) = w3 + w2 - 5w + 6. Let x be f(-3). Let h = 3 + x. Let t(p) = 10p2 - 34p + 8. What is the remainder when t(h) is divided by 55? 54 Let g = 7897 + -7693. Let u = -4 - -17. What is the remainder when g is divided by u? 9 Let r(k) = k*3 + 2k*2 - 7k + 4. Let p be r(-4). Suppose p = -3j + 49 + 5. Calculate the remainder when 193 is divided by j. 13 Let k = 49743 + -49713. Let m(z) = 25z*2 + 3z + 2. Calculate the remainder when m(3) is divided by k. 26 Suppose -2w + 717 = 3g + 2g, -2w = 2g - 282. Suppose 0 = -2z + 5j - 0j + 157, 2z - g = j. Calculate the remainder when z is divided by 37. 34 Suppose -276f + 111351 = -147578 - 96007. What is the remainder when f is divided by 631? 24 Let a(x) = 600x - 2323. Calculate the remainder when 692 is divided by a(4). 76 Suppose -64u - 3701 + 12149 = 0. Calculate the remainder when u is divided by 25. 7 Let x be (-5)/218/(-15). Let p be 0/(4(-15)/12). Suppose 0 = -xr + 3u + 150, r = -pu + 4u + 41. Calculate the remainder when r is divided by 5. 3 Suppose 0 = w - 3f - 229, 2w - 13f = -12f + 438. What is the remainder when w is divided by 21((-2)/(-1) + 8/6)? 7 Let v(d) = 12d*2 + 119d + 85. Calculate the remainder when v(31) is divided by 178. 176 Let q be (-2)/6 - (-4)/((-48)/380). What is the remainder when (1 - -9) + -6 - q is divided by 10? 6 Let r = -963 + 1008. Calculate the remainder when r is divided by (-4)/(-26) + 462/39. 9 Suppose -42 = -2z - o + 23, 5o = 5z - 185. Let s(n) = -n3 - 2n*2 + n + 2. Let w be s(2). Calculate the remainder when z is divided by 58/8 - w/(-48). 6 Let a(u) = -4u - 11u + 20u - 11 - 8u2 + 2u*3 - 9u. Calculate the remainder when a(5) is divided by 7. 5 Suppose 5p = -5n + 3620, 3n = -150p + 153p + 2130. What is the remainder when n is divided by 357? 3 Calculate the remainder when 106 + (-22)/(-33)-18 is divided by 480/42 + 12/21. 10 Let p = 29 + -14. Let u(g) = -14g2 + 747g - 296. Calculate the remainder when u(50) is divided by p. 14 Suppose 2b = -2b - 292. Let a = b - -203. What is the remainder when a is divided by 2? 0 Suppose -1 - 227 = -4s. Suppose 2351m + 3n + 102 = 2355m, -n - 155 = -5m. Calculate the remainder when s is divided by m. 24 Suppose -14h + 19h = -82h + 6003. What is the remainder when 1835 is divided by h? 41 Suppose -4f + 92 = -0. What is the remainder when 18/15972/725 is divided by f? 12 Suppose -4 = -v + 2. Let m = 15497 - 15483. What is the remainder when v/3(-2 - -29) is divided by m? 12 Let y(o) = -o*2 + 19o + 13. Let t = 31 + -14. What is the remainder when y(16) is divided by t? 10 Suppose -24o + 64o = -89o + 66564. What is the remainder when o is divided by 85? 6 Let j(r) be the first derivative of r3/3 - 15r*2/2 + 52r - 59. What is the remainder when 3 is divided by j(10)? 1 Let i(k) be the first derivative of k*4/4 + 4k*3 + 3k*2 - 4k - 11. Let d be i(-11). Let w = -31 + d. Calculate the remainder when w is divided by 11. 9 Let s(r) = 129r + 57. Let t be s(1). Suppose 48b = 54b - t. Calculate the remainder when 86 is divided by b. 24 Suppose 0 = 3h + 5q - 259, 4h + q = 4 + 347. Let l(t) = -2t2 - 38. Let c be l(0). Calculate the remainder when h is divided by (53 + c)/((-1)/(-3)). 43 Let z(j) = j + 22. Let m be z(-10). Suppose 0 = u - m - 43. Calculate the remainder when u is divided by 5232/2180 + ((-1064)/10)/(-4). 26 Let y(r) = 5r - 10. Suppose 5n - 34 = -4. Suppose -8g + ng = -10. What is the remainder when 49 is divided by y(g)? 4 Let a(q) = -q3 - 8q*2 + 13q - 14. Let d be a(-10). Let w = d + -54. What is the remainder when 38 is divided by (w/(-6))/((-2)/(-15))-2? 3 Let a be (-1)/(-5) + 209/55. Suppose 5y = ap - 5, -2y + 12 = 2p - 4. Suppose -yf + 14 + 40 = 0. What is the remainder when 69 is divided by f? 15 Let a = 250 - 247. Suppose 0 = aw + 93 - 276. Calculate the remainder when w is divided by 21. 19 Let j be 110/(-22) - (-1)/1. Calculate the remainder when 44 is divided by (32 - 4 - j)/(12). 12 Let s(w) = 551w2 - w - 8. Calculate the remainder when s(-1) is divided by 7. 5 Let w(y) = y3 + 6y*2 - 4y - 2. Suppose -11600 = 906m - 1022m. What is the remainder when m is divided by w(-6)?	{ "pile_set_name": "DM Mathematics" }
+ (1 - 0) - -7) + -4? 2 (-5 - 2) + -2 + (-5 - -10) -4 What is 3 - (-2 + 0 - -1 - -3)? 1 What is (5 - (6 - -3 - 5)) + -2? -1 Evaluate -4 - (-1 + (-13 - -9)). 1 Calculate 2 + (2 - 1) + 3 + -4. 2 Calculate -21 - -25 - (0 - (1 - 10)). -5 Calculate -44 + 42 + (-2 + 1 - 0). -3 0 - -5 - (2 + 7 + -11) 7 -4 + -8 + 5 + 7 0 Evaluate -27 + 39 - (7 + 1). 4 What is the value of -4 + (8 - 12) + 5? -3 Calculate 5 + -4 + 8 + (5 - 11). 3 What is -1 - (4 + (-4 - -3) - 1)? -3 What is 1 - (-3 - (4 - 3))? 5 -5 + 2 - (-5 + 2) - 3 -3 Evaluate 6 - ((-16 - -9) + 3). 10 Evaluate 0 - ((-7 - -4) + -5). 8 What is the value of 7 - 4 - 6 - 5 - -6? -2 4 + (-6 - -2) - (-2 - 0) 2 Evaluate (-2 - -10 - 2 - -3) + -2. 7 What is (-6 + -1 - (11 + -7)) + 6? -5 Evaluate -3 - (-4 + (-2 - -7)) - 0. -4 What is the value of 1 + (-3 + 1 - 3) + 1? -3 What is 25 + -6 + -18 - (-2 + 0)? 3 Calculate 8 + -5 - (6 - 3). 0 Evaluate -10 - -7 - (4 - (-4 + 8)). -3 1 - (-3 + 3 - -3 - 2) 0 What is the value of -7 - (-8 - -4) - (3 + -4)? -2 -4 - (5 + -2) - -7 0 Evaluate 5 - (8 + 6 + -14). 5 What is the value of -13 - -11 - (0 + 2)? -4 Evaluate 0 + 4 + -7 + -1 + 8. 4 What is (1 - 0) + 2 + -6? -3 Evaluate 2 - (-6 + 3 + 8). -3 1 + -7 - 3 - -1 -8 4 - (2 + (1 - 4)) 5 (2 - 2) + (-2 - -1) -1 6 + (1 - -4 - 6) 5 Evaluate 1 + -1 + 6 + -2 + -1. 3 Calculate -5 - (3 + 0 - (-1 - -12)). 3 -1 - -6 - (27 - 17) -5 What is the value of (0 - (0 - (-1 - -1))) + -3? -3 4 + -3 - (-3 - 0) - -3 7 What is (4 - 11 - -8) + 0 - -4? 5 What is -9 + 11 - 6 - 1? -5 Calculate 11 - (-5 + (2 - -9)). 5 2 - (-3 - (1 - (3 + 1))) 2 What is the value of 0 + 2 - ((7 - 6) + -2)? 3 What is 7 + -2 + 1 + -9 + 7? 4 What is 1 - -1 - (-5 + (-2 - -8))? 1 Calculate (4 - 6) + 4 + (-2 - 1). -1 1 + (-7 + 9 - 8) -5 What is the value of (4 - (-14 + 3)) + -6 - 3? 6 (2 - -3) + -1 + -3 1 (1 - (3 + -2)) + -2 -2 What is -4 + 5 + -9 + 16? 8 What is (3 - 9) + 6 + -5? -5 Calculate (22 - 24) + 7 + 1. 6 What is the value of (-17 - -7) + 10 + -6? -6 What is the value of (-2 - 1) + (0 - 1) + -1? -5 0 + (-4 - (4 - 7)) + 8 7 Calculate 6 - (2 + -3 - -2). 5 What is the value of 22 + -13 + (-2 - -1) + -4? 4 (-1 + 5 - 4) + -5 -5 -1 - -4 - (-3 + 6 + -3) 3 Evaluate 1 + 9 + 3 + -12. 1 What is the value of 8 + (2 - 0) - 5? 5 What is 11 - (-1 + -2 + 6)? 8 2 - (-3 - (4 - 8)) 1 Calculate 0 + 2 + -6 + 9. 5 Calculate 2 - ((6 - -1) + (-22 - -11)). 6 What is the value of -1 + 0 - (0 + (-8 - -1))? 6 Calculate 2 + -5 + 6 - 5. -2 -4 - -2 - (-2 - -4) - -4 0 Calculate (-35 - -35) + -5 + 1 + 6. 2 Calculate 2 + -9 - -1 - -11. 5 What is the value of 4 - (1 - -13 - 4)? -6 Evaluate 5 - ((4 - (-3 + 2)) + -3). 3 What is 3 + (2 - -1) + (0 - -1)? 7 -9 + (5 - 18 - -26) 4 What is the value of -1 - (-6 - (5 + -7))? 3 What is the value of -11 - (-15 - -8) - -11? 7 What is (-8 - -2) + -5 + 15? 4 What is the value of -3 - (22 + -18 - (2 - -3))? -2 Calculate 4 - (7 + -8) - 9. -4 11 + (-2 - 7) - -4 6 Calculate -9 - (3 + -6 - 11). 5 Calculate -14 + 20 - (2 + -1). 5 What is the value of 2 + -1 + 0 + -1 + 3? 3 Evaluate 0 - -3 - (38 + -27). -8 Calculate (-1 + 3 - 1) + (-3 - 0). -2 Calculate -6 + 3 + -4 - -6. -1 -3 + 1 + -4 - (-4 - -3) -5 What is -9 + (4 - 2) + 6? -1 Evaluate (-5 - 3) + 3 + 2 + -2. -5 What is the value of -11 + 3 + 5 + 0 + 1? -2 14 - (-11 - -15) - 5 5 What is 2 + 5 + 4 + -6? 5 0 + 1 - (12 + (-11 - 2)) 2 Evaluate (3 - 12) + 3 - -1. -5 9 - 24 - (-1 + 0 - 7) -7 (0 + 0 - -2) + -2 0 Calculate 0 + (1 - (-2 - (0 + 3))). 6 What is (-3 - -1) + -2 + 6 + 3? 5 What is (0 - -2 - (-1 - -4)) + 3? 2 Evaluate 3 - (3 - (-11 - -5)) - -10. 4 -3 - (-7 - (7 - 14)) -3 Evaluate 5 - (-15 - -10 - (2 + -10)). 2 What is -3 + 13 + -3 + -6? 1 -25 - -31 - (0 + 1) 5 Calculate -2 - ((2 + 0 - 6) + 7). -5 1 + 0 - (-2 - -6) - -7 4 1 + 1 + 0 + 3 + -5 0 0 - -2 - (-2 - -2) 2 Evaluate 205 - 198 - (-1 + 9). -1 10 - (-17 - -11 - -16) 0 What is (-11 - -8) + (-2 - (-8 - 2))? 5 What is 0 - (-1 - -4 - 8) - 10? -5 Evaluate (-1 - 2) + 4 + -3. -2 -7 + 20 + -9 + (2 - 3) 3 Evaluate -2 - -1 - (-7 + 5). 1 What is -4 + 2 - (-4 + 2 - -2)? -2 Evaluate -49 + 47 + (-2 + 2 - 1). -3 13 + -15 - ((0 - -1) + 2) -5 What is -1 + 2 + -2 + 4? 3 Calculate (-4 - 1) + -4 + 2 + 2. -5 What is the value of 0 + (-13 - 0 - -6)? -7 What is the value of (25 - 26) + (1 - 3)? -3 Calculate -1 + (-23 + 26 - (2 - -3)). -3 What is the value of 4 + -1 + 7 + -3? 7 What is 1 - (4 - ((-2 - -13) + -3))? 5 Evaluate (0 - -1) + (9 - 8) + -4. -2 What is -2 + (-10 + 6 - -5)? -1 What is -12 + (-3 - 3 - -13)? -5 Evaluate -1 + 12 + -5 + -9. -3 What is the value of (-2 - -1) + 78 + -70? 7 (-5 - -5) + (-2 - (1 + 0)) -3 Evaluate 0 - ((-5 - -9) + (-3 - 1)). 0 -3 + 4 - (10 + -15) 6 Calculate -2 + (-3 - (-2 - -3)) + 8. 2 -1 + (4 - (-10 + (-8 - -12))) 9 Calculate -4 + 12 + -8 + -9 + 5. -4 What is the value of 2 + (10 + -5 - 5)? 2 What is -11 - -2 - -10 - -1? 2 Calculate 0 + -5 + -3 + 6. -2 What is 3 - (-1 + -2) - 10 - -10? 6 Calculate (2 - (-1 + -2)) + (-16 - -5). -6 -3 + 2 + 0 + -3 -4 Evaluate 3 + -7 + 19 + -8. 7 What is the value of (-6 - -2) + (-4 - -2 - -4)? -2 What is 16 + -7 + -1 + -5? 3 Calculate 0 - (2 + 2 - 0 - 0). -4 Calculate 17 - 21 - (0 + 1). -5 Calculate (8 - -2) + 1 - (15 + -10). 6 -3 + 1 + 4 - 6 - -8 4 What is -2 - (-5 + -8 - -7)? 4 Evaluate 1 + (2 - 1) + (63 - 66). -1 What is the value of (2 + 1 - 6) + 3 + -1? -1 Evaluate -5 + (8 - 3) + 4. 4 Calculate (-2 - (-2 + 0)) + (39 - 37). 2 What is the value of 10 - (11 + -5 + 13)? -9 What is -1 + -9 - 0 - (0 + -5)? -5 Evaluate 9 - (7 + 9) - -7. 0 What is the value of 4 + -1 - 1 - (3 - 1)? 0 (14 - 11) + (2 - 6) -1 Evaluate 3 - (-2 + -10 + 7 + -3). 11 What is -6 + -3 + -3 + 9? -3 Evaluate 6 + (3 + 2 + -3 - 3). 5 Calculate (23 - 25) + (2 + -2 - 2). -4 What is (-5 - (2 + -16 + 6)) + -10? -7 What is (-2 - -2) + -2 + (-4 - -12)? 6 What is the value of (39 - 37) + -6 + (4 - 2)? -2 Evaluate -4 + (-3 + 1 + -2 - -5). -3 What is -10 - (8 - (4 + 14))? 0 -20 - (-27 - -15) - (-7 - 1) 0 8 + 0 - (-19 - -26) 1 What is -83 - -75 - (1 + -5)? -4 Evaluate -1 + (0 - -8) + -1. 6 What is the value of (-1 - (-2 - 1)) + (148 - 143)? 7 What is the value of 3 + 0 + 1 + -1? 3 What is 4 - 7 - (2 + -8 + -2)? 5 Calculate 1 - -11 - (30 + -18). 0 (2 + -6 - (0 + -1)) + 4 1 Evaluate 3 - (3 + 7 + -9). 2 What is the value of -1 + (13 - 9 - 6)? -3 What is the value of -2 + 14 - ((14 - -5) + -15)? 8 4 + (-1 - -1) + (2 - 1) 5 2 + -8 - 0 - (-4 - -4) -6 1 - 0 - (0 + 5 - 8) 4 Calculate 2 + -12 - (2 + 2 - 10). -4 What is 2 + 1 - (-17 + 25)? -5 What is the value of -10 - 0 - -4 - -3 - -1? -2 Evaluate (6 - 3 - 5) + -3 + 0. -5 What is the value of -6 - -5 - 0 - (4 + -1)? -4 Calculate 0 + (1 - (4 + 0)). -3 Evaluate 3 - 4 - (0 - 0). -1 Calculate -7 + 0 + 1 + 13 + 1. 8 Calculate 4 + (3 - (14 - -2 - 4)). -5 What is 5 - 5 - -3 - 5? -2 Calculate 0 - (2 + -3 + 4 + 0). -3 What is -5 + (1 - 6 - -9)? -1 Evaluate -1 + (0 - (4 - 12)). 7 What is -7 + (7 + 7 - 1)? 6 Evaluate 3 - 5 - 5 - -5. -2 What is -23 + 30 - ((-4 - 1) + 4)? 8 What is 6 + 1 + (-6 - -2)? 3 0 - -1 - (3 - 0) - -2 0 Calculate -6 + -2 + 5 - -8. 5 What is the value of (-1 - 1) + 16 + -10? 4 What is the value of 1 + (-11 - -5) - 2? -7 What is the value of -3 + 9 + 1 + -6? 1 What is the value of -4 + 4 + (6 - 1) + -4? 1 Calculate 3 - (2 + 2 + -5). 4 Calculate 0 - -2 - 1 - (-2 - -5). -2 What is 7 - 8 - (1 + -12)? 10 Evaluate (-1 - (0 + (2 - 0))) + 4. 1 4 + 3 - (-1 - (3 + -8)) 3 What is the value of 5 + 7 + (6 - (17 + -7))? 8 (-7 + 5 - (-3 - -1)) + -5 -5 7 - (1 + 1 + 0) 5 Evaluate (4 - (4 - (3 - 0))) + -1. 2 What is (2 - (2 + 3)) + 1? -2 What is the value of -2 - (3 + (0 - 0)) - -2? -3 What is the value of (6 - (0 + 1)) + 1 + -1? 5 Evaluate 2 - (-10 - (-2 - 1 - 2)). 7 2 - (-2 - (-3 - (2 + -3))) 2 What is the value of 0 - (5 - 2) - (-3 + 3)? -3 What is the value of 8 + -8 - (-2 + -3)? 5 4 - (1 + (-1 - (4 - 4))) 4 Evaluate 2 + (2 - 2) + -4 + 9. 7 What is the value of (-1 - 4 - 5) + 6? -4 What is the value of 0 + (1 + -1 + 2 - 4)? -2 What is -5 + -1 - 3 - -12? 3 Evaluate -1 + (-4 + 3 + -3 - -3). -2 What is -3 - ((4 - 7) + 11 - 10)? -1 What is -4 - -1 - (4 + (-2 - 0))? -5 Calculate -6 + 2 + 0 + (-9 - -13). 0 What is the value of -7 + (19 - (2 - -1)) + -7? 2 Evaluate (11 - ((-5 - -6) + 1)) + -7. 2 What is (-3 - -8) + -9 + (3 - -2)? 1 Evalua	{ "pile_set_name": "DM Mathematics" }
43/8. 40 Let x = -40841/38 + 1075. What is the common denominator of x and -107/10? 190 Let v = 1260535/97 + -12995. What is the common denominator of v and 17/10? 970 Let k(j) = j*3 + 7j*2 - 7j + 5. Let c be k(-8). Let m(z) = -3z. Let t be m(c). What is the common denominator of -2 + 73/t + 0 and 1/7? 63 Let v = 103/17 + -507/238. Find the common denominator of v and 91/6. 42 Let q = -7 + 10. Suppose -qu = -u - 12. Calculate the smallest common multiple of u and 1. 6 Suppose -4s + 46 = -2. Let j be (-83186)/(-24) + 8/s. Let r = 3444 - j. Find the common denominator of r and -39/16. 16 Calculate the least common multiple of 24 and (-144)/63 + 2 - (-228)/14. 48 What is the common denominator of 53/12 and (-12)/(-16)(-3 + 28)? 12 Let u(k) = 9857k2 - k + 1. Let z be u(1). Let j = z - 177481/18. Calculate the common denominator of j and -27/22. 198 Let p be 1 + -2 + 552/561. Let t = p - -9543/374. Find the common denominator of t and (1/9)/(2/112). 18 Suppose 9n - 4n + 20845 = 0. Let x = -54150/13 - n. Let a = 891/52 + x. Find the common denominator of 65/3 and a. 12 Let p = 111377/12 + -9274. Calculate the common denominator of 29/24 and p. 24 Let h = -1 + 0. Let i(y) = -18y3 - y2 - y - 1. What is the common denominator of i(h) and -36/11? 11 Let a be (5870/180)/(50/(-34)). Let o = a + 628/25. Calculate the common denominator of o and -125/18. 18 Let d = 2365/6 + -26225/66. What is the common denominator of d and 94/(-3)(-1)/6? 99 Let x be (-1)/((-2)/(-3 - -7)). Suppose 0l = -xl - 3h + 16, -4l + 2h = -16. What is the common denominator of l and 49/2? 2 Let j(z) = 5z2 - 3z + 1. Let d be j(-3). Suppose -6l + l = -d. Let c(p) = p3 - 7p*2 + 6p + 7. What is the smallest common multiple of c(6) and l? 77 Let o = -1615/2 + 780. Let d be -373(4 + (-1 - 2)). Let b = 2227/6 + d. Find the common denominator of o and b. 6 Let l be ((-1230819)/(-34))/(3 - -69354). Let m = l + -198/379. Let g = m + -41998/1037. What is the common denominator of g and -29/4? 4 Let y be 4/8(-4)/(-214). Let s = y + 4594/749. Let z = 5453/258 + -99/43. Find the common denominator of z and s. 42 Let h = -164015/11058 + -2/1843. Let l = -701/60 - h. Find the common denominator of 73/10 and l. 20 Let w = -3 + 4. Suppose 3 = j + w. Let i(z) = z*3 - 6z*2 + 5z + 3. What is the smallest common multiple of j and i(5)? 6 Let z = -205/4 - -53. Let a be (348 + (0 - 2))/4. Let s = -84 + a. Find the common denominator of s and z. 4 Suppose 0 = -i - i, 0 = -3h - 4i + 60. What is the least common multiple of h and 66/4 + 2/(-4)? 80 Let i be (-108)/24 + (-2)/(-4). Calculate the smallest common multiple of (2/(-2) + 7)2 and 2/(30/(-8) - i). 24 Let l(f) be the third derivative of -f6/120 - 7f5/60 - f4/24 + f*3/3 + 2f*2. Calculate the least common multiple of l(-7) and 1. 9 Let t = 26 + -16. Calculate the lowest common multiple of t and 2. 10 Suppose -2t + 6198 = 4z - 5z, -2t - 30990 = 5z. Let w = z - -37289/6. Calculate the common denominator of w and -49/2. 6 Let j = -17 + 8. Let l(u) = u*2 + 7u - 8. Suppose -2g + 1 + 3 = 0. What is the lowest common multiple of l(j) and g? 10 What is the common denominator of (-14)/50(-195)/(-6) and (-6)/4(-17)/(-3)? 10 Let a be (6/(-5))/((-6)/20). Let f(m) be the first derivative of m2 + 2m + 3. Calculate the smallest common multiple of f(a) and 7. 70 Let v = -82015/126 - -4514/7. Let o = -1441/8 + 643/4. Let f = o + -73/8. What is the common denominator of v and f? 18 Suppose r = -0r - 4w + 9, r + w - 9 = 0. Let j be 3891/r - 2/6. Calculate the common denominator of 4/18 + (-1203)/j and -101/12. 48 Let n = 9369/11 - 850. Let a = 19161/724 + -551486/15023. Let c = a - 1/166. What is the common denominator of c and n? 44 Let s = 14359/12 - 1188. What is the common denominator of -61/6 and s? 12 Find the common denominator of 63/10 and (-406)/(-7)(-2)/(-184). 230 Suppose -2t = -3t - 4. Calculate the least common multiple of 11 and (t + (-6)/2)-1. 77 Suppose -5t - r = -55, -t - 5r = 3t - 23. What is the common denominator of (-3)/t - 27/(-20) and -9/5? 10 Let j(l) = -l2 + 9l + 10. Let s = 29 + -20. Suppose -40 = -3g + y - 0y, -24 = -3g - 3y. Calculate the least common multiple of j(s) and g. 60 Let w(f) = f*2 + 11f - 22. What is the smallest common multiple of w(-15) and 5? 190 Let d = 1355/4 + -15029/44. What is the common denominator of -16/59 and d? 649 Let k(m) = -m + 13. Let i be (0/((-2)/(-2)))/(-2). Suppose -l = -il - 16. Calculate the least common multiple of l and k(7). 48 Let z = 6 - 3. Suppose 4j = -5h + 34, 3h + 1 + 5 = 0. Calculate the least common multiple of j and z. 33 Let y(q) = q*2 + 15q + 41. Let f = 12 + -7. Calculate the lowest common multiple of y(-12) and f. 5 Let x = -167 - -473/3. What is the common denominator of 1((-66)/8)/(-3) and x? 12 Let g = 115 + -111. Suppose -5h = 2v + 23, 2v = 7v - h - 10. Calculate the smallest common multiple of g and v. 4 Suppose f = -2f. Let k = -4 + 8. Suppose -k = -2o - f. Calculate the least common multiple of o and 20. 20 Let d(h) = -h2 - 7h + 6. Let f be d(-7). Let s = f + 6. What is the least common multiple of 0 + 0 + 161 and s? 48 Let n = 443/60 - 2/15. Let j be (-20)/6141/(-2). Let z = j + -3759/16. What is the common denominator of n and z? 16 Suppose -4j + j - 120 = 0. Find the common denominator of -69/4 and (-4)/10 + (-231)/j. 8 Suppose i - 56 + 55 = 0. What is the least common multiple of i and 45? 45 Let i be -2 - (-1)/((-3)/(-1439715)). Let l = i + -4786561/10. Let x = l + -1254. What is the common denominator of 63/20 and x? 20 Let g be 1/((-8)/(-426))28. Let t = 4430/3 - g. Calculate the common denominator of t and 48/5. 15 Suppose 0 = 4z - 5z + 70. Calculate the common denominator of 38 and 9/60z/12. 8 Let i = 40 - 24. Suppose -102 + 42 = -3p. Calculate the lowest common multiple of i and p. 80 What is the lowest common multiple of ((-408)/10)/(-3) - 38/(-95) and 16? 112 Let u(z) = -z*3 + 7z*2 + 3. Let t be u(7). Suppose 5n = 3v - 24, tn = -v + 2n + 8. What is the lowest common multiple of 22 and v? 88 Suppose 2n = 12 + 4. What is the lowest common multiple of n and 6? 24 Calculate the smallest common multiple of 8 and 2(-41)/(-8) + 9/(-36). 40 Let r = 1063 - 221. Let x = r + -396. Let v = x - 867/2. Find the common denominator of v and -113/6. 6 Let d = 91121/20 - 4552. Find the common denominator of 74/8 + (-1)/(-3) and d. 60 Suppose 2z = 8, -5z = 2v + 18 - 74. Let d(w) be the third derivative of w4/12 - w3 + 2w2. What is the smallest common multiple of d(4) and v? 18 Find the common denominator of (-43)/18 - 10/45 and 19/18. 18 Let k(f) = 2f*3 + 3f*2 + 2f + 2. Let d be k(-2). What is the common denominator of -23/7 and -1 + (2 - (-159)/d)? 14 Suppose 5p - i = 55 + 146, -3p + 5i + 125 = 0. What is the common denominator of 89/6 and p? 6 Let x(q) = q2 + 9q - 6. Suppose -2w = -2t + 24, 0 = -t - 2w - 3w - 12. Calculate the smallest common multiple of t and x(-11). 16 Let m = -4356727980378/12299 - -354234327. Let u = m + 13/251. Let z = u - 2759/98. Calculate the common denominator of 81/4 and z. 4 What is the common denominator of 19/82 and 5 + -4 + (-462)/108? 738 Let m be ((-10)/(-6))/((-2)/(-6)). Suppose -u - 1 = 3n - 8n, -5n + mu = 15. Calculate the least common multiple of 7 and n. 7 Suppose -687 = -3m + 318. Let g = 1295/4 - m. What is the common denominator of g and 53/9? 36 Suppose -4k + 3n = -104, 3k - n - 78 = -4n. Calculate the common denominator of -119/6 and k. 6 Suppose 2x - 2m = 7x + 58946, 3x + m + 35367 = 0. Let k = 235647/20 + x. What is the common denominator of k and -101/22? 220 Let p = 15502 - 604532/39. Find the common denominator of p and 10/27. 351 Suppose 0a - 3y = -2a - 8, -4y = -16. Suppose ai + 2b - 19 = -3b, 5i - b = 61. Suppose -3l = -12 + 6. What is the smallest common multiple of i and l? 12 Let d be (-1)/(3 + (-55)/18). Calculate the lowest common multiple of 114/d - (-4)/6 and 3. 21 Suppose 4t = -3k + 41, 10k + 39 = t + 5k. Suppose u - 40 = -u. Calculate the smallest common multiple of t and u. 140 Let g = 2 - -8. Calculate the least common multiple of (-2)/18 - (-532)/171 and g. 30 Let	{ "pile_set_name": "DM Mathematics" }
2 Let r(v) be the first derivative of 0v2 + 6 + 1/3v*3 + 0v. Let z(c) = 9c2 + 30c - 30c + 2c*2. What is z(r(l))? 11l*4 Let s(f) be the first derivative of 7f*2/2 + 12. Let j(k) be the third derivative of 1/24k4 - k2 + 0k + 0 + 0k*3. Calculate s(j(o)). 7o Let q(c) = -2 - 6 - 6c - 2c + 8c - 2c. Let x(w) be the first derivative of -w*2 - 1. Give x(q(b)). 4b + 16 Let k(g) be the second derivative of -g*4/2 - 7g. Suppose 3u + n - 23 = 0, 3u - n = 3n + 43. Let h(f) = -uf + f + 5f. Determine h(k(s)). 18s*2 Let f(a) = 2a*2 + 2a + 2. Let u(w) = -4w2 - 3w - 3. Let y(p) = 3f(p) + 2u(p). Let g(x) = 2x2 + 56x. Calculate g(y(v)). 8v4 - 112v*2 Let t(v) = 25v*2 + 3. Let r(b) = -1489b. Determine r(t(j)). -37225j2 - 4467 Let n(c) = -5c. Let v(x) be the third derivative of -11x4/3 - 13x*2 - 6. Calculate v(n(a)). 440a Suppose -4r - 3r + 28 = 0. Suppose -rs + s = -3. Let f(d) = -2d*2 + 8d. Let m(q) = q. Let v(b) = sf(b) - 8m(b). Let o(j) = 9j. What is v(o(g))? -162g*2 Let d(k) be the second derivative of -3k*2 + 0 + 3/8k*4 + 0k*3 + 5k. Let g(s) be the first derivative of d(s). Let c(a) = 3a. Determine c(g(w)). 27w Let h(k) = -520k - 26. Let a(b) = -347b - 16. Let y(g) = 8a(g) - 5h(g). Let q(m) = -2m. What is y(q(u))? 352u + 2 Let b(z) = 53z + 4. Let u(r) = 56r*2 - 48r*2 - 6r*2. Calculate u(b(i)). 5618i*2 + 848i + 32 Let o(n) = 10n + 6. Let u be (-1)/3 - (-2)/(-3). Suppose 3p - 13 = 5. Let m(k) = k + 1. Let y(r) = pm(r) + uo(r). Let w(c) = 4c. What is w(y(t))? -16t Suppose 4x + 6 = 7x. Let c(l) = -195 + 195 + xl. Let p(k) = 2k*2. Calculate c(p(o)). 4o*2 Let y(d) = 304d*2. Let u(c) = -23c*2. Calculate u(y(f)). -2125568f*4 Let l(b) = -7b + b - 4b. Let v(d) be the third derivative of d5/30 - 50d*2. Calculate l(v(z)). -20z*2 Let n(r) = -3r. Let h = -90 - -90. Let u(s) be the first derivative of hs - 3/2s*2 + 7. Calculate n(u(t)). 9t Let m(p) be the third derivative of -29p7/5040 - 2p*5/15 + 31p*2. Let x(l) be the third derivative of m(l). Let w(n) = -2n*2. What is x(w(t))? 58t*2 Let a = 828 - 440. Let t(f) = 5f2 - 388 + a. Let i(j) be the first derivative of -j3 + 2. Determine i(t(g)). -75g4 Let i(n) be the third derivative of 0n*4 - 7n*2 + 0 + 1/20n*5 + 0n + 0n3. Let b(z) = 2 - 2 + 2z. What is b(i(l))? 6l2 Let x(y) = -y. Let o(w) be the second derivative of 6w*4 + 3w. Calculate x(o(j)). -72j2 Let q(t) = 7t*2 - 722t + 1. Let r(c) = 28c2. Give q(r(k)). 5488k*4 - 20216k*2 + 1 Let c(l) = -l - 1. Let j(v) = 3v2 - 8 + v2 - 1 - 8v - v. Let y(r) = 18c(r) - 2j(r). Let a(f) = -3f*2. Give a(y(x)). -192x*4 Let y(v) be the third derivative of 0v + 0v3 - 11v*2 + 0 + 1/8v*4. Let g(d) = d. Determine g(y(k)). 3k Let f(d) be the third derivative of -1/12d4 + 0d*3 - 12d*2 + 0 + 0d. Let p(l) = -9l2. What is p(f(v))? -36v*2 Let q(l) = -30l. Let k(o) = 18o2 + 10o + 5. Let a(w) = 50w2 + 28w + 14. Let m(n) = -5a(n) + 14k(n). Determine m(q(j)). 1800j2 Let n(g) = 3g*2. Let y(c) = 284186c. Calculate n(y(u)). 242285047788u2 Let t(o) be the second derivative of 25o4/2 + o3/6 - 347o. Let y(i) = 3i*2. Determine y(t(h)). 67500h*4 + 900h*3 + 3h*2 Let o(t) = -t + 6. Let m(d) = -d + 5. Let n(b) = -6m(b) + 5o(b). Let v(k) be the third derivative of -5k*4/24 + 5k*2 + 6k. Give n(v(a)). -5a Let g(k) = 3k*2. Let x be 5864/12 - -2 - (-3)/9. Let t(m) = -x - 15m*2 + 491. Calculate g(t(q)). 675q*4 Let u(w) = -32w. Suppose 2i - c - 5 = 0, 5i = 4c + 8 + 3. Let o(t) = -4 + 4 - 4t + it. Give u(o(a)). 32a Let r(i) = 184i2 + 57i. Let f(z) = 174z. Give r(f(n)). 5570784n*2 + 9918n Let s(v) = -4v - 13. Let n be s(-4). Let c(y) be the third derivative of 7y*2 + 0 + 0y*n + 0y + 0y4 + 3/20y*5. Let o(m) = -2m. Calculate o(c(p)). -18p2 Let m(y) = -4y*2 + 4y. Let k(z) = -2z - 31. What is m(k(w))? -16w*2 - 504w - 3968 Let n(y) be the first derivative of -2y2 - 3. Let k(d) = 135d*2 - 3d - 2. Let j be k(-1). Let p(h) = h*2 + 136 - j. Calculate p(n(s)). 16s*2 Let y(r) = 0r2 - r2 + 0r2. Let n(p) = 2p + 3. Suppose -5w = 3h, 0 = w - 2w - h + 2. Let c(x) = -x - 2. Let m(z) = wc(z) - 2n(z). Give y(m(t)). -t2 Let l(q) = 154q. Let w(s) = s - 3. Give w(l(u)). 154u - 3 Let w(v) be the third derivative of -v4/4 + 5v2. Let u(o) = -o2 - 6o - 6. Let m(i) = i2 + 5i + 5. Let d(s) = 6m(s) + 5u(s). Determine w(d(k)). -6k2 Let y(s) = -s2 + 551s. Let x(d) = -26d. What is y(x(l))? -676l*2 - 14326l Let d(g) = -3g2. Let i(s) = -5s - 30 - 2s - 2s + 29 - 2s. Determine i(d(r)). 33r*2 - 1 Let t(b) = 2b + 2. Let z(y) = 196y - 10. Let o(q) = -5t(q) - z(q). Let m(n) = 5n2. Give o(m(d)). -1030d*2 Let m(d) = 1377d - 1. Let u(h) = -29h2. Calculate u(m(r)). -54987741r*2 + 79866r - 29 Let k(l) = -29l. Let d(f) be the second derivative of -1/6f*4 + 0f*2 + 0f*3 - 2f - 32. Give k(d(w)). 58w2 Let i(w) = -36w. Let d(x) = 6291x2. What is i(d(u))? -226476u2 Let i(l) be the third derivative of -l5/30 + 2l2. Let d(w) = -w2 - 7w - 4. Let j be d(-6). Let b(r) = -3r - j - 4 + 6. What is b(i(h))? 6h*2 Let j(s) be the third derivative of -11s4/24 + s2. Let x = 9 + -6. Let r(q) = xq2 - q2 - q2. What is r(j(h))? 121h*2 Let j(c) = 2c - 228. Let y(w) = -4w2 - 19. Determine j(y(n)). -8n*2 - 266 Let i(y) = 15y - 6. Let j(n) = -4n2 - 10n - 5. Let p(u) = u*2 + 4u + 2. Let s(z) = 4j(z) + 10p(z). Calculate s(i(k)). -1350k2 + 1080k - 216 Let p(k) = k*2 - 6k - 5. Let i be p(7). Let q(o) = 5o2 - 4o2 - o2 - io2. Let m(s) = -s - 4 + 4 - s. Determine m(q(n)). 4n*2 Let a(w) = 4w*2 + 11w. Let h(t) = -12643t. Calculate h(a(j)). -50572j*2 - 139073j Let q(h) be the second derivative of -h*4/4 - h - 6. Let b(g) = -4g*2 - 13g. Give b(q(f)). -36f4 + 39f*2 Let u(r) = 3 - 3 + 3 - 3 - 96r. Let y(g) = -g. Determine u(y(p)). 96p Let z(k) be the first derivative of 2k*3/3 + 383. Let h(p) = 2p2 - 4. Let g(b) = -b2 + 5. Let q(c) = 4g(c) + 5h(c). Calculate z(q(o)). 72o4 Let f(q) = q - 111479. Let m(u) = -u2. Calculate m(f(p)). -p2 + 222958p - 12427567441 Let t(z) = z. Let l = 75 + -53. Let w(y) = -y. Let s(q) = -11q. Let g(f) = lw(f) - s(f). Give g(t(a)). -11a Let l(f) = 4f - 375 + 103 + 272. Let n(g) = 3g2 + 7g. Let a(i) = 2i2 + 4i. Let k(v) = -7a(v) + 4n(v). What is k(l(w))? -32w2 Let j(r) = 55r*2 - 33r + 33. Let f(n) = n*2 + 0 - 3n + 0n2 + 2n + 1. Let w(x) = 33f(x) - j(x). Let t(c) = -7c*2 + 9c2 - c2. What is t(w(y))? 484y4 Let l(p) = -8p*2 + 12. Let v(a) = -7a*2 + 10. Let w(j) = 5l(j) - 6v(j). Let y(c) be the first derivative of -10c*3/3 - c + 2. Calculate y(w(u)). -40u*4 - 1 Let v(z) = 10178 + z - 10178. Suppose 6 = 2y + 2. Let p(f) = 3f2 - 7f*2 + 0f*y. Calculate v(p(s)). -4s*2 Let r(i) = 2i - 3. Let m be r(3). Suppose 3j - 3 - m = 0. Let l(g) = -29g*j + 12g*2 + 26g*2. Let x(q) = -q. Give l(x(k)). 9k*2 Let t(u) = -1. Suppose -5w = -10w. Let y(k) = 0 + w - k + 1 + 5. Let i(c) = -6t(c) - y(c). Let n(f) = -4f2. Calculate n(i(s)). -4s2 Let r(l) be the second derivative of l4/12 - 9l. Let a(n) be the first derivative of 5n*3/3 + 7. Calculate r(a(f)). 25f*4 Let c(z) = 4282z2. Let k(h) = -h2 - 36. Calculate k(c(y)). -18335524y4 - 36 Let d be (-886)/(-13) - 36/234. Let n(g) = dg*2 - 61g*2 - 4g + 4g. Let t(p) = -2p*2. Determine t(n(w)). -98w*4 Let h(l) = -32l. Let g(v) = 2137v. Determine g(h(f)). -68384f Let m(f) be the second derivative of -4f3/3 + f. Let d(r) = -3r + 14. Let s(v) = -5v + 24. Let p(l) = 12d(l) - 7s(l). What is p(m(y))? 8y Let w(m) = 6361m2. Let a(h) = -12h*2. Determine w(a(i)). 915984i*4 Let m(p) = 509513p*2. Let y(l) = -3l*2. Give y(m(j)). -778810491507j*4 Let x(t) = 4t. Let w(q) = -36q + 13 + 3 - 16. Give x(w(p)). -144p Let k(p) be the third derivative of p*4/12 - 33p*2. Let w(m) = 39m*2. What is w(k(t))? 156t*2 Let i(y) = 18y + 42y - 15y - 11y. Let u(w) = 14w. Deter	{ "pile_set_name": "DM Mathematics" }
212 4708 (base 10) to base 11 35a0 -312013 (base 6) to base 5 -1300230 999 (base 10) to base 16 3e7 What is -10111021 (base 3) in base 9? -3437 What is -2c1 (base 13) in base 2? -111101111 What is 122 (base 5) in base 3? 1101 2b66 (base 12) to base 3 21000120 Convert -2120111 (base 4) to base 9. -14332 -1608a (base 12) to base 9 -46727 What is -1101100011 (base 2) in base 3? -1012010 1999 (base 13) to base 14 1588 What is -1011001111000 (base 2) in base 11? -435a What is 1175 (base 9) in base 7? 2363 -6171 (base 8) to base 7 -12211 What is -412522 (base 6) in base 5? -2024101 Convert 120 (base 15) to base 11. 212 260 (base 13) to base 10 416 Convert 11c62 (base 14) to base 2. 1010101001001110 -1165 (base 8) to base 5 -10004 What is 350 (base 7) in base 11? 156 303301 (base 4) to base 16 cf1 -826 (base 12) to base 3 -1121210 Convert 2444 (base 10) to base 8. 4614 -1cd0 (base 14) to base 4 -1102132 Convert 24 (base 15) to base 2. 100010 Convert 115225 (base 6) to base 12. 5b15 949 (base 11) to base 3 1120022 What is -200121 (base 3) in base 2? -111110110 What is -2947 (base 10) in base 2? -101110000011 -1010011001101111 (base 2) to base 7 -235135 -4890 (base 10) to base 8 -11432 What is 362 (base 9) in base 10? 299 553133 (base 6) to base 14 12b05 Convert 25145 (base 9) to base 6. 210105 -10210021 (base 3) to base 7 -11023 What is -2e2 (base 15) in base 2? -1010010110 Convert -2303020 (base 4) to base 13. -52ab What is -1d9b (base 14) in base 6? -41045 Convert 22300 (base 6) to base 15. ddc Convert 7413 (base 11) to base 6. 113235 a59 (base 14) to base 7 5642 -201101 (base 3) to base 16 -20b 9519 (base 13) to base 5 1130030 Convert -11200 (base 3) to base 8. -176 What is b83a (base 14) in base 12? 164a4 Convert -420 (base 9) to base 14. -1a6 What is 63440 (base 8) in base 14? 989a -129b (base 13) to base 6 -20155 What is -854 (base 11) in base 15? -487 Convert 163114 (base 7) to base 8. 77056 What is -111111110010 (base 2) in base 9? -5535 -92 (base 13) to base 12 -9b Convert 2631 (base 16) to base 3. 111102010 What is -54525 (base 6) in base 5? -220131 -4e37 (base 15) to base 12 -97ba Convert 4a72 (base 11) to base 10. 6613 Convert -11000010000 (base 2) to base 10. -1552 What is 1001000002 (base 3) in base 9? 31002 42a2 (base 12) to base 2 1110010011010 -102134 (base 6) to base 16 -204a -2a8 (base 14) to base 15 -260 What is -313413 (base 5) in base 6? -120311 What is 25400 (base 7) in base 4? 1220321 10302 (base 6) to base 2 10101111110 -38147 (base 9) to base 5 -1310024 Convert 10424 (base 5) to base 10. 739 Convert 40273 (base 8) to base 7. 66212 -101012 (base 3) to base 2 -100010011 What is -1377 (base 12) in base 5? -33001 What is -1521 (base 11) in base 5? -30314 Convert -930 (base 14) to base 15. -806 1103240 (base 5) to base 16 4afb Convert -11030001 (base 4) to base 3. -1002011000 Convert -3c9 (base 13) to base 15. -2ec What is 430320 (base 5) in base 11? a956 Convert 12244 (base 6) to base 14. 948 What is 39a (base 15) in base 12? 584 -2556 (base 7) to base 3 -1100000 -1473 (base 12) to base 3 -10021120 Convert -82 (base 13) to base 2. -1101010 Convert -25303 (base 9) to base 4. -10021311 1cc (base 13) to base 15 177 Convert -9ab (base 12) to base 11. -1088 9a5 (base 12) to base 3 1221122 Convert -32033 (base 4) to base 8. -1617 What is 91 (base 16) in base 9? 171 What is 1131431 (base 5) in base 4? 11012002 What is 25561 (base 7) in base 16? 1a95 -1266 (base 9) to base 10 -951 -2726 (base 12) to base 3 -20011110 -160 (base 11) to base 9 -227 -2c0b (base 15) to base 6 -111445 Convert -367 (base 11) to base 6. -2004 What is -122421 (base 5) in base 13? -2204 What is 12a (base 13) in base 6? 541 102003 (base 4) to base 2 10010000011 What is -579 (base 10) in base 15? -289 -3117 (base 13) to base 16 -1a7c Convert 351 (base 9) to base 16. 121 Convert 563 (base 11) to base 7. 1652 What is 146 (base 9) in base 4? 1323 288a (base 14) to base 10 7178 What is -101012 (base 3) in base 15? -135 Convert -231301 (base 5) to base 8. -20206 221234 (base 5) to base 3 101112222 What is 103a (base 12) in base 16? 6ee Convert c484 (base 15) to base 5. 2312044 Convert -65343 (base 7) to base 16. -3fab What is 1421031 (base 5) in base 3? 1111111012 Convert 7d07 (base 16) to base 8. 76407 What is -10022211 (base 3) in base 16? -979 Convert -133300 (base 6) to base 3. -122001000 767 (base 8) to base 7 1316 Convert -2367 (base 13) to base 9. -6750 What is 102022220 (base 3) in base 2? 10000001000011 What is -15344 (base 7) in base 3? -12220002 Convert -1010110101 (base 2) to base 12. -499 Convert 3a19 (base 15) to base 14. 4739 -52d (base 15) to base 7 -3256 What is -1506 (base 8) in base 15? -3ad Convert 222 (base 10) to base 7. 435 -1933 (base 10) to base 13 -b59 -21000 (base 3) to base 11 -162 What is 122001 (base 3) in base 9? 561 -12270 (base 8) to base 13 -2550 What is 2212 (base 7) in base 3? 1002101 Convert -9289 (base 10) to base 13. -42c7 597 (base 13) to base 4 33021 Convert -5673 (base 8) to base 11. -2290 -3402 (base 5) to base 10 -477 What is -3ed7 (base 15) in base 16? -34a5 1989 (base 12) to base 3 11021220 What is -4dc (base 14) in base 4? -33102 31324 (base 6) to base 14 1780 What is 51491 (base 10) in base 8? 144443 Convert 50 (base 7) to base 6. 55 Convert 2672 (base 10) to base 9. 3588 2a40 (base 14) to base 10 7504 295 (base 12) to base 4 12101 What is 3994 (base 12) in base 2? 1100111000000 125a7 (base 13) to base 7 200641 What is 1001002 (base 5) in base 16? 3d88 What is 387 (base 9) in base 7? 640 What is -1444 (base 6) in base 13? -23b 27175 (base 8) to base 12 6a79 Convert -3581 (base 15) to base 10. -11371 What is -689 (base 15) in base 5? -21404 What is -42340 (base 6) in base 15? -1a83 Convert -37f (base 16) to base 13. -53b What is 1322 (base 5) in base 7? 422 4824 (base 15) to base 14 5834 -101101111100 (base 2) to base 11 -2233 Convert -3311 (base 7) to base 2. -10010100000 Convert 351025 (base 6) to base 4. 13111121 Convert 44156 (base 7) to base 4. 2230322 Convert -293 (base 16) to base 2. -1010010011 What is -54370 (base 9) in base 4? -20302323 What is 1176 (base 9) in base 8? 1557 -310 (base 10) to base 6 -1234 What is 1269 (base 11) in base 9? 2231 What is 60624 (base 10) in base 11? 41603 Convert 2106 (base 7) to base 6. 3233 What is 2e79 (base 15) in base 11? 7584 Convert -1110110010 (base 2) to base 10. -946 -13546 (base 11) to base 16 -4b59 What is -12525 (base 7) in base 2? -110100010111 What is -32233 (base 6) in base 10? -4413 Convert 3970 (base 12) to base 8. 14644 What is 110000101010101 (base 2) in base 10? 24917 Convert -5996 (base 11) to base 9. -11681 Convert 2010122 (base 3) to base 2. 11000010100 -168a (base 13) to base 16 -cfd 1100011001 (base 2) to base 6 3401 What is -27677 (base 9) in base 7? -105520 What is -2d4b (base 15) in base 14? -37a2 What is 6a22 (base 11) in base 13? 4273 Convert -131 (base 7) to base 12. -5b What is -c991 (base 14) in base 13? -12b05 Convert -330310 (base 4) to base 16. -f34 What is -836 (base 16) in base 4? -200312 What is -140223 (base 5) in base 11? -4301 Convert 120031 (base 4) to base 6. 11101 What is 169 (base 10) in base 11? 144 What is -500 (base 6) in base 10? -180 377 (base 9) to base 5 2223 -73e (base 15) to base 7 -4523 -1211113 (base 5) to base 9 -34065 -3770 (base 9) to base 7 -11133 -cc14 (base 13) to base 12 -14535 Convert 86 (base 14) to base 12. 9a Convert 1015 (base 6) to base 8. 343 What is 21204 (base 5) in base 12? 9b1 Convert -8920 (base 13) to base 10. -19123 What is 36307 (base 8) in base 9? 23307 Convert -3252 (base 10) to base 7. -12324 -252304 (base 7) to base 10 -46456 What is -11011000101 (base 2) in base 11? -1336 Convert 13079 (base 13) to base 4. 20212310 -1333321 (base 5) to base 10 -27336 What is -8d0 (base 14) in base 10? -1750 -10312 (base 5) to base 4 -23003 Convert -2883 (base 12) to base 10. -4707 What is 3123303 (base 4) in base 3? 201022000 Convert -24043 (base 10) to base 13. -ac36 What is -2472 (base 8) in base 3? -1211120 41157 (base 8) to base 2 100001001101111 What is -521 (base 12) in base 11? -618 What is 1013 (base 7) in base 14? 1b3 Convert 4359 (base 12) to base 9. 11146 What is -323221 (base 7) in base 4? -31300231 101	{ "pile_set_name": "DM Mathematics" }
vide m(170)? True Suppose -3d + 10 = 2d. Suppose dx = v - 6 + 20, 4x - 18 = v. Does 3 divide (-122)/(-2) - (v - -11)? True Suppose 36 = 9u - 18u. Let r be 136 - (u - (0 + (-2 - -1))). Let n = -47 + r. Is 13 a factor of n? False Let r be 3(6 + (-114)/18)6. Does 3 divide ((1 - 3)/6)/(r/1062)? False Suppose -91872 = 535w - 547w. Does 69 divide w? False Let p(t) = 52t3 - t2 - t + 2. Let i be p(-2). Let u = i + 584. Does 14 divide u? True Suppose 18303 = 2u + w, 2u + 5w + 0w = 18299. Is u a multiple of 11? True Suppose 2c - f - 13147 = 0, 5c - 4f - 32875 = -0f. Is c a multiple of 44? False Suppose 11 = -6q - 7. Let x be 4 + (q/5 - 17/5). Suppose x = 2k + 2v - 94, -k + 59 = 6v - 8v. Is 13 a factor of k? False Is 179172/68 + 3 + (-294)/102 a multiple of 5? True Suppose 3q = -5r + 9173, 0 = r + 5q + 611 - 2428. Is 5 a factor of r? False Let n(y) = -y3 + 4y*2 + 7y + 3. Let d be n(5). Let x = d + 56. Suppose -h = 2l - x, h = -0h - 3l + 66. Does 15 divide h? True Let a(g) = -10g*3 + 14g*2 + 69g - 10. Is 32 a factor of a(-7)? False Let j(s) = 4s - 44. Let a be j(14). Let z(w) = 81w + 21. Let x be z(a). Suppose -57 = 9p - x. Is p a multiple of 8? True Suppose 3r - d - 278 = 0, -5r = -4r - 4d - 100. Suppose v = -h + r, -6v + v = -5h + 490. Is 12 a factor of h? False Let o = -5703 + 7520. Does 23 divide o? True Suppose 0 = 4m, -4v - 6m + 1636 = -m. Let s = 662 - v. Is s a multiple of 25? False Suppose 19n + 142 = 20n. Suppose -2d = -4l + n, 4l - 26 - 137 = -5d. Is l a multiple of 10? False Suppose -5a + 16 = -4. Suppose -j - j - w = -12, -4w = -3j - a. Suppose -150 = -5c - jg, 4g = -c + 34 - 4. Is c a multiple of 20? False Let r = 32 - 24. Let u be (-2)/r + (-232)/(-32). Suppose 450 = ud - 2d. Is 11 a factor of d? False Suppose -g = s + 4s - 44, 4g - 2s = 132. Suppose h - g = 24. Is 20 a factor of h? False Let m(f) be the second derivative of 19/6f*3 - 15/2f*2 + 19f + 0. Does 44 divide m(17)? True Suppose 37 - 73 = -6z. Suppose 3w - zw = -3v + 1869, 4v = 2w + 2482. Does 76 divide v? False Let m be ((-20)/(-12) - 4)-3 + -4. Suppose 0p - 726 = -mp. Does 41 divide p? False Let y = 41936 - 17539. Does 20 divide y? False Suppose -k + 112 = -60. Let b = -25 + k. Is 20 a factor of b? False Suppose -19m = 17m - 144. Does 59 divide (11/m - 2) + (-3210)/(-8)? False Let f = -190 - -253. Suppose -f = 6z - 393. Is z a multiple of 11? True Let l = 15258 - 10521. Is l a multiple of 14? False Is ((-118)/8)/((-11325)/596 - -19) a multiple of 59? True Let s(z) = z*2 + 11z + 8. Let o = 22 + -17. Let i = -8 - o. Is s(i) a multiple of 7? False Suppose 0 = -36w + 42471 - 4851. Is 6 a factor of w? False Let v(u) = 11u*2 + u - 47. Let p(x) = -x - 1. Let c(r) = 4p(r) + v(r). Let o be c(-8). Suppose -2n = -5h + 1156, 5n - o - 493 = -5h. Does 34 divide h? False Suppose 200f - 1078893 = 42f + 114481. Is f a multiple of 56? False Let k = -10 - 10. Let b(i) = -19i + 10. Let m(c) = 22c - 10. Let g(t) = 7b(t) + 6m(t). Is 17 a factor of g(k)? False Suppose -790n - 26264 = -2f - 794n, -f = -4n - 13096. Is 40 a factor of f? True Let v be 739/91 - 1-1. Suppose -5q + x + vx = -1510, q = -4x + 292. Is q a multiple of 50? True Let f = 45 + 19. Let d = f - 64. Does 6 divide d + (-144)/(-4 - 0) + 0? True Suppose -8a + 186 = -318. Let l be (-2)/(-4)32. Suppose -a = lj - 180. Does 27 divide j? False Let o = -38084 + 57142. Suppose 5k - o = -21k. Is k a multiple of 12? False Let o(t) = t2 + 21t + 38. Let d be o(-19). Suppose 2n + 4h - 17 = n, 2n - h - 7 = d. Suppose -333 = -ny - 5b + 632, b = 5y - 995. Does 18 divide y? True Suppose 37f = -12f + 964271. Is 167 a factor of f? False Suppose -4j + 3r - 142 = -0r, 2 = r. Let x be 21/(-9)(-6)/(-4)j. Let z = x + -78. Is z a multiple of 14? False Let g be (1 - -13)5/10. Suppose 4s - a - 14 = 0, 4s + a = 11 + g. Suppose -sb - 5c = -6b + 22, b - 2c - 10 = 0. Is b a multiple of 6? True Suppose -5l = -5c + 11825, -l - 7089 = 75c - 78c. Does 47 divide c? False Let a = -29953 + 34210. Does 129 divide a? True Let s(x) be the second derivative of 4x3/3 - 40x*2 + 51x. Is 8 a factor of s(27)? True Let z = -208 + 192. Does 6 divide (144/z)/((-1)/((-62)/(-3)))? True Suppose -1 = 8w - 73. Suppose z - 7220 = -wz. Is z a multiple of 38? True Suppose -5r = 3i + 2425, -2i + 2450 = -8r + 3r. Is 61 a factor of 32 - 31 - (1 + r)? True Let j be (-60)/42 + 1 - 76/(-14). Suppose 3y - 5h - 3130 = 0, jy - 5h - 824 = 4406. Is y a multiple of 35? True Let c = -28510 - -48532. Is c a multiple of 94? True Let w = -77434 - -119580. Is w a multiple of 37? False Let x = 484 - -824. Does 109 divide x? True Suppose -7g + 8g - 146 = 0. Suppose 0 = 64q - 65q + g. Suppose -21 = 5a - q. Is 5 a factor of a? True Suppose -156n = -167n + 16038. Does 8 divide n? False Let o = 89 + -89. Let v(j) = -j*3 - 4j + 228. Let t be v(o). Let g = -77 + t. Is 58 a factor of g? False Let q be (1 - (-393)/(-4)) + 18/(-24). Let p = -49 - q. Is 5 a factor of p? False Let c = -15 + 19. Let w(d) = 5d + 8d*2 + 5d*2 + 7 - c. Is 35 a factor of w(-3)? True Let h be (-19)/57 - (-19)/3. Let j be (-9)/h(-178)/3. Suppose -y - 4 = -j. Is y a multiple of 19? False Let c(u) be the second derivative of -u5/20 + u4/2 + 13u3/3 + 9u*2/2 - 6u + 3. Does 25 divide c(7)? False Suppose 4r - 11477 = -5u + 2692, -4u = -3r - 11298. Does 123 divide u? True Suppose -9o + 11752 = 4o. Suppose 6i - o = 4i. Is 40 a factor of i? False Let z be 0/(4/(-2)) + (-65)/(-1). Let a = 70 - z. Suppose -ab + 3g + 251 = 5g, 4b + g - 199 = 0. Is 8 a factor of b? False Suppose 123507 = 24s - 20s + a, 2a - 154386 = -5s. Is 62 a factor of s? True Let q(p) = -2 - 10 - 6p2 + 2p*3 + 1 - 9p - 3p3. Let t be q(-5). Let m(v) = v2 + 3v - 20. Is 9 a factor of m(t)? False Suppose 92 = 5o + 4y, -20y - 25 = -o - 23y. Suppose 0 = 3h - 3j - 552, 0 = -j - 3j - o. Is h a multiple of 10? True Let o(w) = 376w*3 + 2w*2 + 8w - 17. Let l be o(2). Suppose d - 512 = -5v + 513, -3d - 3v + l = 0. Is d a multiple of 25? True Is 107 a factor of (-6527(-10 + 11))/(-1)? True Let z = 59540 + -39375. Does 96 divide z? False Suppose -19x + 17x + 832 = 0. Let u = -124 + x. Does 46 divide u? False Let d = 20 - 13. Suppose -dv + 10v = 12. Is 13 a factor of 3 + (4 - v) + 96? False Suppose 68y = 65y + 20748. Does 11 divide y? False Let d(z) = -1316z + 154. Does 10 divide d(-3)? False Suppose -29 = -3t + 22. Suppose -tf - 60 = -13f. Does 5 divide (2 - 1)/(1/f-3)? True Let f be (-1)/(-4) + (-2997)/(-444). Suppose -fh - 3840 = -11h. Does 20 divide h? True Let y(o) = 883o - 11. Is 4 a factor of y(11)? False Suppose 2y - 5n - 5793 = 0, -4n + 14374 = 5y - 59. Does 27 divide y? True Suppose 525 = 17g - 10627. Let f = g - -138. Is 8 a factor of f? False Let d be (-26)/10 - (54/(-15))/6. Is 29 a factor of (4/(-4 + 0))/(d/290)? True Let y = -619 - -1020. Does 7 divide 5 - (-5 + 0 - y - 2)? True Is 9 a factor of 14227 + (61 - 59)? False Suppose 55 = -4r + 2t - 99, 4t + 52 = -2r. Let c be 1/4 + (-171)/r. Suppose 397 = 4d - 0x - x, cd = x + 497. Is 20 a factor of d? True Let w be (-44)/(-374) + 268/34. Suppose 0 = -3o + 4l - 0 + 8, 4l + w = o. Suppose -4y = -4z + 6z - 90, o = 4z + 4. Does 23 divide y? True Suppose 82480 = 36s - 16s. Does 77 divide s? False Let p(x) = -120x2 - 7x + 6. Let o(r) = -239r2 - 15r + 12. Let d(n) = 2o(n) - 5p(n). Is 29 a factor of d(1)? False Suppose 10 = -3o + o, o = -5i + 280. Let k(r) = r + 116. Let t be k(4). Suppose i + t = 3n. Is n a multiple of 17? False Let l(t) = 143t*2 + 1. Suppose -2z + 3c - c = 12, -28 = 4z - 2c. Let k be (8 + z)/(1 - 0) + -1. Is 19 a factor of l(k)? False Let d = 220 - 215. Suppose k + 124 = dm, -k = 3m - 2k - 74. Is m a multiple of 25? True Let c(h) be the first derivative of 124h2 - 2h - 198. Is 33 a factor of c(4)? True Let q be ((1 + -11)15/(-25))/2. Suppose -5r = qj - 244, 3j + 4r + 0r - 242 = 0. Suppose 3m - 4m + j = -3s, -4m = -2s - 332. Does 12 divide m? True Let g(m) = -25m + 7. Let n be g(6). Let i = n - -188. Does 9 divide i? True Let y =	{ "pile_set_name": "DM Mathematics" }
98 = -5v + u. What is the highest common divisor of 22 and v? 11 Let u(s) = -s3 + 3s*2 + 20s - 9. Let m be u(7). Let x = m + 85. What is the greatest common factor of x and 70? 10 Let k = 321 + -166. Let v(g) = -g*3 - 36g*2 - 3g - 46. Let a be v(-36). What is the highest common divisor of k and a? 31 Let y be (53 - 9 - 9) + 1-2. What is the greatest common factor of 12 and y? 3 Let g be 3/(5/((-10)/3)). Let i = g - 1. Let f = 17 - i. What is the highest common divisor of 4 and f? 4 Suppose -2p + 3 = -p - f, 3p - 2f - 10 = 0. Calculate the highest common factor of p and 8. 4 Suppose -l + 10 + 12 = -5v, v = -5l + 162. Suppose 3c - 320 = -c. Calculate the highest common divisor of l and c. 16 Suppose 0 = u + 5x - 41, -4u + 5x + 71 = -3u. What is the highest common divisor of 98 and u? 14 Suppose 1216 = 25f - 6f. Calculate the greatest common factor of 40 and f. 8 Suppose -q = -3q. Suppose q = -3a + y + 43 + 19, 0 = y + 5. What is the greatest common divisor of 19 and a? 19 Let h = 431 + -416. What is the greatest common factor of h and 285? 15 Let p(f) = -2f + 25. Let a be p(11). Suppose h = ah - 18. Let n be ((-3)/7)/((-3)/21). What is the greatest common factor of n and h? 3 Let i(w) = w2 + 4 - 1 - 5w + 2w. Suppose 0 = 5y - 4a - 26, a - 19 = -y - 2y. Let s be i(y). What is the greatest common factor of 21 and s? 21 Suppose 0 = -5g - 2a + 77, 2g + 5a - 14 = -0g. Suppose -gz = -13z - 12. What is the greatest common divisor of z and 3? 3 Let k(y) = 3y*2 + 5y + 12. Let u be k(6). Let n be 15/10u/9. What is the greatest common divisor of 200 and n? 25 Let w be 1/2 - 164/(-8). Suppose -24t + 120 = -wt. Calculate the highest common divisor of t and 8. 8 Suppose 3b = 3i - 7 - 2, -12 = -b - 2i. Let c be b/1(-2 - -1). Let w be c332/(-6). Calculate the highest common divisor of 48 and w. 16 Let q(a) = 2a*2 + 22a + 4. Let h be q(-11). Suppose 3v - v = 0. Suppose 2t - 8 = v, -ht + 101 = m + 8. What is the highest common divisor of m and 11? 11 Suppose z = -5h + 20, 3h + 16 = z + 4z. Suppose d - 11 - 2 = -2r, hr = -d + 17. What is the highest common factor of 40 and d? 5 Let y = 221 - 108. Suppose 3s + y = -106. Let p = s - -460. Calculate the greatest common factor of p and 43. 43 Let j = -634 - -661. What is the greatest common factor of j and 21? 3 Let w = 7 + -9. Let r be (w/6)/((-5)/(-50))-3. Calculate the greatest common factor of 130 and r. 10 Suppose -8b + 123 = -13. Calculate the greatest common divisor of 17 and b. 17 Let l be (-4)/10 + (-52)/20. Let v be -1 + l/(9/(-69)). Let z(w) = -w3 - 8w*2 - 23w - 57. Let q be z(-7). What is the highest common factor of v and q? 11 Let l(n) = 2n + 18. Let k be l(-10). Let q be (-2)/1 - -36 - k. What is the greatest common divisor of q and 18? 18 Let s be 1(18 - 0) + -2. Let c = -1 - -6. Suppose -cd = 4f - 103, -6f + 2f + 2d = -138. What is the greatest common factor of s and f? 16 Suppose -4v - 39 - 21 = 0. Let y = -13 - v. Let t be (-6 - 0)y/(-4). What is the greatest common factor of t and 12? 3 Suppose -3i + 8i - y = 465, -4i + 2y = -366. What is the highest common divisor of 799 and i? 47 Let v(d) = 4d*2 + 10d - 344. Let u be v(12). Calculate the greatest common divisor of u and 32. 32 Suppose 5j - 164 - 6 = 0. Let p(z) = 230z + 8. Let l be p(1). What is the highest common factor of j and l? 34 Let z = -8 + 29. Suppose 0 = 13c - 16c + z. Let l be ((-42)/(-8))/c60. Calculate the highest common divisor of l and 18. 9 Let q = -515 - -525. Calculate the highest common factor of q and 400. 10 Let j(h) = -h3 + h2 + h + 72. Let n be j(0). Let p = 22 + -1. Let q = n - p. Calculate the greatest common divisor of 17 and q. 17 Let p = 227 + -189. Calculate the highest common divisor of p and 209. 19 Suppose -54r = -49r - 205. Calculate the greatest common factor of 123 and r. 41 Suppose -53 = -5o + 27. Suppose 3v - 8v = -135. Suppose 75 - v = 3w. Calculate the greatest common factor of o and w. 16 Suppose -15n = -14n - 331. Let i = -171 + n. Suppose -3k = 15 - 75. What is the greatest common factor of k and i? 20 Let u = -4 - -2. Let i(b) = b*2. Let x be i(u). Suppose -xa + 3 + 45 = 0. Calculate the greatest common factor of a and 36. 12 Suppose 22s - 3910 = 5s. Calculate the greatest common divisor of s and 50. 10 Let g be (-27)/(-12)(-64)/(-2). Suppose -3c + g = -2c. Suppose -3y = -21y + 144. What is the highest common factor of y and c? 8 Let k be 300/12(-1)/(-5). Let m be 27/k + 39/65. What is the highest common divisor of 6 and m? 6 Let m be (9/6)/((-1)/20). Let q be m + (2 - (1 + -2)). Let a = q - -41. What is the greatest common factor of 42 and a? 14 Let r(s) = s*3 + 12s*2 + 2s + 15. Let f be r(-12). Let k(c) = -2c - 7. Let p be k(f). What is the highest common factor of p and 99? 11 Let x = 4360 + -3048. Calculate the greatest common factor of x and 41. 41 Suppose 2c = d + 54, 10c - 5c - d = 135. Let q be 186 + (2 - ((-24)/4)/6). Calculate the highest common factor of c and q. 27 Let d(s) = -s*3 + 7s*2 + 47s - 7. Let g be d(11). Calculate the greatest common divisor of g and 234. 26 Let m be 1/(6/4 + -1). Suppose 0 = mi + i + 36. Let h = 33 - i. Calculate the highest common divisor of 30 and h. 15 Suppose -3z + 17 = 5s, 0 = 4s + z - 19 + 4. Let o be ((-230)/s)/(17/(-34)). What is the highest common factor of 23 and o? 23 Suppose 0 = -4q - 0q + 12. Let b be (-96)/(-5) - (80/25 - q). What is the greatest common divisor of 38 and b? 19 Let c = 5 - -9. Let w be (2 - -31) + c + -10. Let v = w + -22. What is the highest common factor of 5 and v? 5 Suppose 4f + 0g = 5g - 156, 4g = 3f + 118. Let i = f + 42. Suppose 3j - 32 = -8. What is the greatest common factor of i and j? 8 Let x(h) = h - 9. Let b be x(14). Suppose 0 = -o - b + 7. What is the highest common factor of 22 and o? 2 Let r(d) = d*3 - 2d*2 - 8d + 4. Let o be r(4). Calculate the highest common factor of 12 and o. 4 Let h be 204((-6)/9 - 1). Let a = 1232 + -708. Let b = h + a. What is the greatest common divisor of 23 and b? 23 Suppose -5v = k + 113, 0 = -0v - 2v - k - 47. Let w = v + 32. What is the highest common factor of 2 and w? 2 Suppose -5b + 0 = -30. Suppose 27k - 24k - 96 = 0. Let p be (34 - k) + (0 - -40). Calculate the greatest common divisor of b and p. 6 Suppose 0 = 287u - 289u + 648. Calculate the greatest common factor of 12 and u. 12 Suppose 0 = -4a + 2c + 2982, -2a + 58c = 55c - 1497. What is the greatest common divisor of 93 and a? 93 Let s be (28/35)/((-1)/(-30)). Let i = s - 20. What is the highest common divisor of 28 and i? 4 Suppose 0 = -2u - 2s + 604 - 22, 5s = u - 297. What is the greatest common factor of u and 511? 73 Suppose 5d + 60 - 135 = -5s, -3d = -2s + 5. Calculate the greatest common divisor of s and 415. 5 Let r(u) = u2 - 12. Let k be (-2)/((14/(-140))/(2/8)). Let w be r(k). What is the greatest common divisor of w and 117? 13 Suppose -3j - b = j - 287, 343 = 5j - 4b. Suppose -4d + 5d = j. Let w = d - 50. What is the greatest common factor of w and 3? 3 Suppose -3t + 191 = 5c, 2t + 35 - 189 = -4c. Let y be (30/(-40))/((-2)/c). What is the greatest common divisor of 3 and y? 3 Suppose 54o = 43o + 110. Let v be 162/4 - 2/4. Calculate the greatest common factor of o and v. 10 Let b = 15 + -23. Let y be (b/(-6) - 0)(2 + 1). Calculate the highest common divisor of y and 28. 4 Suppose 41 = 4v - r - 7, 0 = 3v - 5r - 19. What is the greatest common divisor of 2 and v? 1 Suppose 27d - 899 = 1045. What is the highest common factor of d and 44? 4 Let z(h) = h2 + 11h + 6. Let k(m) = -12m3 + 2m*2 + m - 2. Let i be k(1). Let s be z(i). Calculate the highest common factor of 6 and s. 6 Let n = 382 - 312. What is the highest common divisor of n and 385? 35 Suppose 0 = -4s - 3a + 599 - 24, -25 = -5a. Calculate the greatest common factor of 35 and s. 35 Suppose -2b = 3b - 10. Suppose -32 = -bp + 2. Calculate the highest common factor of p and 187. 17 Suppose 251 = 3r + 20. Suppose -4j = 2w + j + 31, 5j + 16 = 3w. Let n = r - w. Calculate the highest common factor of 8 and n. 8 Suppose 3h + 292 = 4u, -2u + 172 = 6h - h. Let s = u +	{ "pile_set_name": "DM Mathematics" }
is the o'th term of 239380, 239383, 239386, 239389, 239392, 239395? 3o + 239377 What is the l'th term of -5688, -11343, -16998, -22653? -5655l - 33 What is the l'th term of -76676, -76674, -76672? 2l - 76678 What is the l'th term of 49364, 49371, 49376, 49379? -l2 + 10l + 49355 What is the t'th term of 39239, 156941, 353111, 627749? 39234t2 + 5 What is the i'th term of -12, 69, 326, 861, 1776, 3173, 5154? 17i*3 - 14i*2 + 4i - 19 What is the c'th term of 180, 597, 1458, 2973, 5352, 8805, 13542? 35c3 + 12c*2 + 136c - 3 What is the w'th term of 7057, 14118, 21179, 28240? 7061w - 4 What is the b'th term of 16676, 33207, 49738, 66269? 16531b + 145 What is the l'th term of -153072, -153074, -153076, -153078? -2l - 153070 What is the g'th term of -144, -63, 18, 99? 81g - 225 What is the h'th term of 758, 575, 392, 209, 26? -183h + 941 What is the p'th term of 12178, 48733, 109658, 194953? 12185p*2 - 7 What is the y'th term of 33157, 33155, 33153? -2y + 33159 What is the k'th term of 63475, 63507, 63553, 63619, 63711, 63835, 63997, 64203? k3 + k2 + 22k + 63451 What is the s'th term of -2729261, -2729258, -2729255? 3s - 2729264 What is the f'th term of 9782, 9788, 9794, 9800, 9806, 9812? 6f + 9776 What is the p'th term of 19371, 38750, 58129, 77508, 96887, 116266? 19379p - 8 What is the y'th term of -130315, -130312, -130307, -130300? y*2 - 130316 What is the r'th term of -20, 2, 38, 88, 152, 230, 322? 7r2 + r - 28 What is the d'th term of 24379, 24390, 24415, 24460, 24531? d3 + d2 + d + 24376 What is the u'th term of -115, -221, -309, -373, -407, -405, -361? u3 + 3u2 - 122u + 3 What is the i'th term of 539, 718, 1011, 1424, 1963, 2634? i*3 + 51i*2 + 19i + 468 What is the i'th term of 127, 672, 1579, 2848, 4479, 6472, 8827? 181i2 + 2i - 56 What is the z'th term of 36870, 147551, 332020, 590277? 36894z2 - z - 23 What is the i'th term of 7224, 7218, 7206, 7188, 7164, 7134, 7098? -3i*2 + 3i + 7224 What is the g'th term of 1149, 4590, 10331, 18378, 28737? g*3 + 1144g*2 + 2g + 2 What is the h'th term of 37950, 75900, 113850, 151800? 37950h What is the r'th term of 7383, 7398, 7413, 7428, 7443? 15r + 7368 What is the l'th term of 5274, 10559, 15868, 21213, 26606? 2l3 + 5271l + 1 What is the r'th term of 181, 683, 1503, 2641? 159r2 + 25r - 3 What is the v'th term of 3208, 6425, 9634, 12829, 16004? -v*3 + 2v*2 + 3218v - 11 What is the q'th term of 367, 510, 753, 1102, 1563, 2142? q*3 + 44q*2 + 4q + 318 What is the i'th term of -8134, -8295, -8580, -9001, -9570, -10299, -11200, -12285? -2i3 - 50i*2 + 3i - 8085 What is the b'th term of -527, -3694, -8973, -16364, -25867, -37482? -1056b2 + b + 528 What is the l'th term of -361, -529, -697, -865, -1033, -1201? -168l - 193 What is the n'th term of 14, 229, 814, 1955, 3838, 6649? 31n3 - n2 + n - 17 What is the q'th term of -6007, -12008, -17995, -23962, -29903, -35812? q3 + q2 - 6011q + 2 What is the d'th term of 1364, 5492, 12372, 22004? 1376d2 - 12 What is the z'th term of -748, -639, -454, -193? 38z*2 - 5z - 781 What is the o'th term of -609, -1215, -1823, -2433, -3045, -3659, -4275? -o*2 - 603o - 5 What is the n'th term of 60117, 60125, 60145, 60183, 60245, 60337, 60465? n*3 + n + 60115 What is the w'th term of -4916, -4975, -5074, -5213, -5392, -5611, -5870? -20w2 + w - 4897 What is the u'th term of -56401, -56402, -56401, -56398, -56393, -56386, -56377? u2 - 4u - 56398 What is the z'th term of 7974, 15881, 23788? 7907z + 67 What is the y'th term of -29780, -59574, -89368, -119162, -148956, -178750? -29794y + 14 What is the d'th term of -5054, -10120, -15186? -5066d + 12 What is the n'th term of -216285, -432571, -648859, -865149, -1081441? -n*2 - 216283n - 1 What is the w'th term of 296, 1476, 3450, 6224, 9804, 14196? w*3 + 391w*2 - 96 What is the y'th term of -1691, -3346, -5001? -1655y - 36 What is the l'th term of 5942, 11306, 16660, 21998, 27314, 32602, 37856, 43070? -l3 + l2 + 5368l + 574 What is the v'th term of -24625, -49341, -74055, -98767, -123477, -148185, -172891? v2 - 24719v + 93 What is the l'th term of 3889, 7772, 11651, 15526, 19397, 23264, 27127? -2l2 + 3889l + 2 What is the v'th term of -52, -221, -530, -1003, -1664, -2537, -3646, -5015? -4v3 - 46v*2 - 3v + 1 What is the u'th term of 979, 3853, 8647, 15361, 23995, 34549? 960u2 - 6u + 25 What is the d'th term of -16, -40, -52, -28, 56, 224? 4d3 - 18d*2 + 2d - 4 What is the r'th term of -2032, -4051, -6070? -2019r - 13 What is the l'th term of 61314, 61319, 61326, 61335, 61346, 61359? l2 + 2l + 61311 What is the t'th term of 16, -299, -614, -929, -1244? -315t + 331 What is the c'th term of 44, 141, 212, 263, 300, 329, 356, 387? c3 - 19c*2 + 147c - 85 What is the t'th term of 947, 945, 941, 935, 927, 917? -t2 + t + 947 What is the f'th term of 1127704, 1127699, 1127692, 1127683? -f2 - 2f + 1127707 What is the h'th term of -87033, -87056, -87125, -87264, -87497, -87848? -4h3 + h2 + 2h - 87032 What is the q'th term of -31825, -31836, -31849, -31864, -31881? -q2 - 8q - 31816 What is the b'th term of -64339, -64340, -64341, -64342, -64343? -b - 64338 What is the r'th term of 3106, 6078, 8916, 11614, 14166, 16566? -r*3 - 61r*2 + 3162r + 6 What is the b'th term of -732, -1463, -2206, -2967, -3752? -b*3 - 724b - 7 What is the n'th term of 580, 2246, 5018, 8896, 13880, 19970? 553n2 + 7n + 20 What is the g'th term of -129429, -129424, -129419? 5g - 129434 What is the w'th term of -242, -989, -2234, -3977, -6218, -8957? -249w*2 + 7 What is the a'th term of 540, 800, 1236, 1848? 88a*2 - 4a + 456 What is the z'th term of -162339, -162343, -162347, -162351, -162355, -162359? -4z - 162335 What is the p'th term of 12, 56, 114, 192, 296, 432, 606, 824? p3 + p2 + 34p - 24 What is the d'th term of 102698, 102696, 102706, 102734, 102786? d*3 - 9d + 102706 What is the a'th term of 460, 872, 1284, 1696? 412a + 48 What is the r'th term of 359391, 718784, 1078177, 1437570, 1796963, 2156356? 359393r - 2 What is the d'th term of 6247936, 6247934, 6247932, 6247930, 6247928, 6247926? -2d + 6247938 What is the p'th term of 178, 376, 568, 754, 934, 1108, 1276? -3p*2 + 207p - 26 What is the s'th term of 249, 374, 519, 690, 893, 1134, 1419, 1754? s*3 + 4s*2 + 106s + 138 What is the t'th term of -7237, -7243, -7249, -7255, -7261? -6t - 7231 What is the j'th term of -16865, -33733, -50601, -67469? -16868j + 3 What is the n'th term of -442447, -442438, -442429, -442420, -442411? 9n - 442456 What is the n'th term of 74, 550, 1840, 4352, 8494? 68n3 - n2 + 3n + 4 What is the d'th term of -1718, -1731, -1756, -1799, -1866, -1963, -2096, -2271? -d3 - 6d - 1711 What is the f'th term of 7977, 32005, 72051, 128115, 200197, 288297? 8009f2 + f - 33 What is the y'th term of 255, 397, 469, 435, 259? -6y3 + y2 + 181y + 79 What is the f'th term of -122, -935, -3178, -7577, -14858, -25747, -40970? -121f*3 + 11f2 + f - 13 What is the n'th term of -8798, -8780, -8760, -8738, -8714? n2 + 15n - 8814 What is the n'th term of 269, 675, 1167, 1787, 2577, 3579, 4835, 6387? 7n3 + n2 + 354n - 93 What is the c'th term of 187, 1010, 3239, 7576, 14723, 25382, 40255? 117c3 + c2 + c + 68 What is the u'th term of 22, -139, -578, -1433, -2842, -4943, -7874, -11773? -23u3 - u2 + 3u + 43 What is the t'th term of 72467, 72468, 72469, 72470, 72471? t + 72466 What is the j'th term of 31283, 62569, 93855, 125141? 31286j - 3 What is the o'th term of -272938, -545878, -818818, -1091758, -1364698, -1637638? -272940o + 2 What is the b'th term of -198, -343, -482, -615, -742? 3b2 - 154b - 47 What is the i'th term of -65, -433, -801, -1169? -368i + 303 What is the p'th term of 2359, 993, -1273, -4433, -8481, -13411, -19217? p3 - 456p*2 - 5p + 2819 What is the a'th term of -36483, -72979, -109475, -145971, -182467, -218963? -36496a + 13 What is the w'th term of 1111, 4445, 10013, 17821, 27875, 40181? w3 + 1111w*2 - 6w + 5 What is the y'th term of 39730, 39731, 39732, 39733, 39734, 39735? y + 39729 What is the t'th term of 362, 468, 568, 662, 7	{ "pile_set_name": "DM Mathematics" }
ind the second derivative of 23134688d5 + 4d4 - d2 + 379182618d + 2 wrt d. 462693760d*3 + 48d*2 - 2 Find the third derivative of 31a*4 + 152a*3s*2 + 26a*3 + 6a*2s*2 + 9a*2 - as*2 + 16a - 5s wrt a. 744a + 912s2 + 156 What is the third derivative of q3y*2 - 152755q*3y - 578q3 + 1824985q*2y2 + q2y + 3q*2 - 5qy2 + 1 wrt q? 6y*2 - 916530y - 3468 Find the first derivative of 3187409z - 43392417 wrt z. 3187409 What is the second derivative of -38275877z*2 + 157363377z wrt z? -76551754 Find the second derivative of rs2y*2 + 2463rs2y + 156rs*2 + 35279060rsy*2 + 23rs - 1 wrt y. 2rs2 + 70558120rs Differentiate -190863km3 - 11k - 764m3 - 21056m with respect to k. -190863m3 - 11 What is the third derivative of 49r*6 + 135983r*5 + 22r*2 - 186r - 284 wrt r? 5880r3 + 8158980r*2 What is the third derivative of 1097w*6 - 14w*4 + 2468w*3 - 557769820w*2? 131640w*3 - 336w + 14808 Find the third derivative of -193mw*4 - 25mw3 + 207mw + 4w*4 - 56w*3 + 251689w*2 wrt w. -4632mw - 150m + 96w - 336 Find the second derivative of -575004r*4x - 3r2x*2 - 956rx2 + 2r + 2288x2 - x wrt r. -6900048r*2x - 6x2 Find the third derivative of 692242434p*3r - 2p2r - 9p2 + 3392168p wrt p. 4153454604r What is the third derivative of -n6p + 1322592n5p + 33504758n2p wrt n? -120n3p + 79355520n2p What is the third derivative of 640143o4p - 36o3p + 23o2p - 12o2 - 3p - 8 wrt o? 15363432op - 216p Differentiate 44185325s*3 + 12982785. 132555975s*2 What is the third derivative of -4324328pw3 + 2pw2 + pw - p - 28w3 + 18w*2 + 120588 wrt w? -25945968p - 168 Find the second derivative of 2ot*3 + 15ot2 + 14919ot - o - t3 + 3787667t*2 - 9t - 22 wrt t. 12ot + 30o - 6t + 7575334 What is the second derivative of -25918ln*3 + 11ln2 + 526ln + n2 + 877270n wrt n? -155508ln + 22l + 2 What is the third derivative of 4845188i5 - i2 - 12446i + 1 wrt i? 290711280i*2 Find the second derivative of mx*4 + 654874mx3 - 2mx + 4m + 47x - 57 wrt x. 12mx2 + 3929244mx Find the first derivative of 13915840q*3 - 41267063. 41747520q*2 What is the derivative of 40568783v*2 + 34894166? 81137566v Find the second derivative of -1720324k3z + 26k3 - 6kz + 7518k + 2370z wrt k. -10321944kz + 156k Find the third derivative of -477920997l3 - 13352l*2 - 13l - 300 wrt l. -2867525982 Find the third derivative of 33627985v3 + 72v*2 - 610654v. 201767910 Find the first derivative of 8883760g + 2533214. 8883760 Find the third derivative of 59407z*4 - 747z*3 - 86956422z*2 wrt z. 1425768z - 4482 What is the second derivative of -13i3r - 93779005i3y*3 - 18954214i*2y + 3ry*3 wrt y? -562674030i*3y + 18ry What is the derivative of 19jm*2 - 3585257jm + 527662415m*2 wrt j? 19m*2 - 3585257m What is the first derivative of -26777141o2 + 53109903 wrt o? -53554282o What is the first derivative of -7965vw*2 - 1083vw - 11272681v - 3w2 wrt w? -15930vw - 1083v - 6w Find the third derivative of 5147006ab5 + 3ab2 - 4ab - 135a - b*6 - 2b*2 + 8b + 5 wrt b. 308820360ab*2 - 120b*3 Differentiate -281078826y - 125821482. -281078826 What is the derivative of 187320j2 + 27jy - 195665y + 4 wrt j? 374640j + 27y Find the first derivative of 11d2i*2 + 3380963d*2iq - 2d*2 + di*2q - 6di*2 + 6230di - i wrt q. 3380963d*2i + di2 What is the second derivative of -420901487y*2 + 42527800y - 3? -841802974 What is the third derivative of -1215476c5 - 121c*2 + 2507 wrt c? -72928560c*2 Find the third derivative of -8150772m*4 - 3m*3 + 57015858m*2. -195618528m - 18 Find the third derivative of 147o4 - 15965o*3 + 129o*2 - 26620o + 2 wrt o. 3528o - 95790 What is the derivative of -231511096k*3 + 128336880? -694533288k*2 What is the derivative of 24172959b*4 + 7333066 wrt b? 96691836b*3 What is the third derivative of -21039046i*3 - 5i*2 - 11i + 69487 wrt i? -126234276 What is the derivative of -454345893u2 - 106592026? -908691786u What is the derivative of 2b2w*2 - 6684102bw + 23277995w*2 wrt b? 4bw2 - 6684102w What is the derivative of j*3lq + 4j3 + j2l3 - 37jl2 + 85jl + 1579413l*3q wrt q? j*3l + 1579413l3 Differentiate -2gx2 - 2gx + 130073g - 2x2 + 5040x - 871 with respect to g. -2x2 - 2x + 130073 Differentiate 2820375x3 + 27194502 wrt x. 8461125x*2 Find the third derivative of 198631518x4 + x3 + 6697x2 - 1144x + 2. 4767156432x + 6 Find the second derivative of 264c*3 - 173983c*2 + 94155193c wrt c. 1584c - 347966 What is the third derivative of -h3r + 19189h3 - 10727425h*2r wrt h? -6r + 115134 Find the third derivative of -28321ms3 - 27262083m + 74s3 - s2 wrt s. -169926m + 444 Find the second derivative of -509951dj*5 + dj*2 - 1293dj - 410d - j wrt j. -10199020dj*3 + 2d Find the second derivative of -5j3n3 - j3n2 + 2j*3n + 12j2o + 3jn - 2j + 115682n*2o - 674n wrt n. -30j*3n - 2j3 + 231364o What is the derivative of -12897532u3 + 5042352 wrt u? -38692596u*2 Differentiate 677427798l*3n + 1510070416l3 wrt n. 677427798l*3 What is the second derivative of 14f*3z + 394f3 + 401f*2z - 7f2 - 691fz - 4f + 23728z wrt f? 84fz + 2364f + 802z - 14 Find the first derivative of 8128z*3 - 2725z*2 + 3z + 508017012. 24384z2 - 5450z + 3 Find the second derivative of -2i4 + 9371i*2z*3 + 98i*2z + 239973iz*3 + iz + 5i wrt i. -24i*2 + 18742z*3 + 196z What is the third derivative of 127211661g3 + 31638g*2 + 1282 wrt g? 763269966 What is the third derivative of -223371f*4w + 4f4 - 2f*2w - 10954fw - 2f - 3w - 40 wrt f? -5360904fw + 96f What is the second derivative of -378s*4z - 632s3 - 374s*2z + 70339s - 233z wrt s? -4536s2z - 3792s - 748z Find the first derivative of -270lt - 8732555l + 234998t wrt t. -270l + 234998 Differentiate 2d*4 - 87d*3 + 5d*2 + 684d + 14151166 with respect to d. 8d3 - 261d*2 + 10d + 684 What is the third derivative of -2j3l - 2224620j3q + 2j2lq - 713428jl wrt j? -12l - 13347720q Find the second derivative of 3b*5c - 4b5 - 120165b*2c - 11b + 169036c + 1 wrt b. 60b3c - 80b3 - 240330c What is the second derivative of -10z4 - 10z*3 - 523z*2 - 32485z + 14 wrt z? -120z2 - 60z - 1046 What is the first derivative of -47b4 + b2g*2 + 8621b*2 + 1291g*2 - 305 wrt b? -188b*3 + 2bg2 + 17242b What is the first derivative of -1990368y - 70073054 wrt y? -1990368 Find the second derivative of -29794m*3 + 47m*2 + 59557951m. -178764m + 94 What is the second derivative of 19w*3z2 + w3z + 4018508w*3 + 22977w*2z*2 + 2z*2 wrt z? 38w*3 + 45954w*2 + 4 What is the third derivative of 287x*5 - 35083x*4 + 12257x*2 - 2424x wrt x? 17220x2 - 841992x Find the second derivative of -4379i4 + 554i*2 + 41232640i wrt i. -52548i2 + 1108 Find the second derivative of -3721384f*2k*2 + 21f*2 + 133837k wrt k. -7442768f2 Find the second derivative of -2969779l*2v*3 - 3l*2v2 - l2 + 1670lv*3 - 27246lv2 wrt l. -5939558v*3 - 6v*2 - 2 Differentiate 1246ru3 + 570ru2 + 741065u*3 wrt r. 1246u*3 + 570u*2 Differentiate -170148c*2d*2 + 127cd2 + 61171d*2 - d + 845 wrt c. -340296cd2 + 127d*2 What is the second derivative of 17fv2z + 16471fv*2 - fvz + 11222989fv + fz + 3v2 wrt v? 34fz + 32942f + 6 Find the second derivative of -1155g2i*2n + 70936g2n*3 + 7gi2n*3 - 85gi2n*2 - gn - 24i2n2 - n2 wrt g. -2310i2n + 141872n3 What is the first derivative of -876600k*4 - 13k*3 + 4k - 118441561? -3506400k3 - 39k*2 + 4 What is the second derivative of 22629ht4 + 241ht2 + 24ht - h - 9t*3 + 1442565t wrt t? 271548ht*2 + 482h - 54t Differentiate 534454473g**2 - 508628260 w	{ "pile_set_name": "DM Mathematics" }
1 or -507317? 1 Is 125/174 greater than -0.1? True Is -24/5 greater than -0.0408? False Is 3061394 < 3061395? True Is 1685593 greater than 1685596? False Which is smaller: -7509257 or -7509256? -7509257 Is -124988 bigger than -124989? True Which is greater: -1095275 or -1095274? -1095274 Is 124594 greater than -4? True Which is bigger: -3/41057 or 0? 0 Is 18745 smaller than -3/5? False Is 37950 != -1/5? True Does -1 = 17/235576? False Which is smaller: 30064 or 30071? 30064 Is -4326/227 <= -0.2? True Which is greater: -25 or 140? 140 Which is smaller: -835913 or -835915? -835915 Is 5/86394 equal to -1? False Which is smaller: -1 or -15/6112? -1 Is -47179 != -47154? True Which is bigger: 8647 or 8649? 8649 Is 4726 at least as big as 4728? False Is 4/38455 <= 1? True Which is bigger: 275 or 199? 275 Which is bigger: 1/4786832 or 0? 1/4786832 Is 1 >= 17/40479? True Which is greater: 5/407322 or 0? 5/407322 Which is bigger: -2 or -85733? -2 Which is smaller: 66/10951 or 0? 0 Is -304 < 1036? True Is -1655 less than 49? True Is -2/33065 less than -1? False Which is bigger: 169913 or 169911? 169913 Is 2448054 smaller than 2448054? False Which is bigger: -0.028 or 224? 224 Is 0.358 at most -0.155? False Which is smaller: -1/2 or -2559629? -2559629 Is 460052 less than 460045? False Which is bigger: 9491 or 218274/23? 9491 Which is bigger: 1361 or 50? 1361 Which is smaller: -1 or -51/119251? -1 Which is bigger: -22 or -69.16? -22 Is -1 > 195/647? False Which is greater: -16865 or -16971? -16865 Is 0.6 at least as big as 5556? False Is 851/4 at most 2.3? False Are 2066 and 8263/4 non-equal? True Are -874 and -821 nonequal? True Is 11/14906 at least as big as 0? True Is -727 at most -616? True Which is smaller: 23031 or 23036? 23031 Is 1 at least 45/255019? True Is -62825 <= -62825? True Is -710756 not equal to -710758? True Is -16/148185 less than or equal to -1? False Is -16507 greater than -16628? True Which is greater: 0 or 2722/3885? 2722/3885 Is -20/257939 at least 0? False Is -65029 >= -65029? True Is 30/47029 at least as big as -1? True Is 663 > 1389? False Are 1758 and -22 nonequal? True Which is bigger: -149692/5 or -29939? -149692/5 Are -1147 and -1131 equal? False Which is bigger: -1 or 2/2053205? 2/2053205 Which is bigger: -63/28685 or -1? -63/28685 Which is smaller: -14596 or 12? -14596 Which is smaller: -124.99 or 12? -124.99 Which is greater: 378989 or 1136966/3? 378989 Are -1 and -359/160 unequal? True Is -1781 not equal to 24.7? True Is -7803 >= 2/3? False Which is greater: -488 or 40? 40 Is 1284.03 less than or equal to 5? False Is 38 < 3558.7? True Is 2227 bigger than -79/4? True Is -199629 at least as big as -199629? True Which is smaller: -13931/4 or -3483? -3483 Is -0.1029 smaller than -163? False Which is bigger: -233263 or 4? 4 Which is smaller: -2 or -9790? -9790 Which is smaller: -1 or -1/224136? -1 Is -2567 < -4? True Is 455751 >= 455750? True Is -6346265 less than or equal to -6346264? True Is 14464 less than or equal to 14465? True Which is smaller: -41407 or -41395? -41407 Is 1.807 at most 49/11? True Is -3845 at most as big as -3840? True Which is smaller: 7/40295 or -1? -1 Which is smaller: 31040 or 31123? 31040 Is -1 less than or equal to 7/4280? True Is -1 not equal to -136/26927? True Is 2/9 equal to 139481? False Is -3/2 >= 466463? False Is 19250 > -5? True Which is bigger: -54493 or -54532? -54493 Which is smaller: -1280 or -1116? -1280 Which is smaller: 2/3 or 50257? 2/3 Is -151597 equal to 0.1? False Is -4652675 at most as big as -4652675? True Is 4557.8 bigger than -10? True Is 3 bigger than 2509? False Is -70 at most as big as 20856? True Is 27279/37 >= 1? True Is 4848 less than 4849? True Are 228 and 866 equal? False Which is bigger: 1454129 or 1454130? 1454130 Which is smaller: -104538 or -313615/3? -313615/3 Which is smaller: -0.16 or 282? -0.16 Is 2275/32 >= 72? False Which is greater: 747728/13 or 57519? 57519 Which is smaller: 18 or -2/197793? -2/197793 Which is greater: 26953/178 or 150? 26953/178 Is -6979 at least as big as -7139? True Is 875 > 9630/11? False Is 30048 less than 30045? False Which is smaller: 41 or -550? -550 Which is smaller: -34/25529 or 0? -34/25529 Which is bigger: -242660 or -242656? -242656 Is -229.55 > -6/7? False Which is smaller: -674 or -20904/31? -20904/31 Is 69146 < -3/64? False Is 35 not equal to 1966? True Which is greater: -1815036 or -1815037? -1815036 Is 1 >= 6/45697? True Which is smaller: -4894/2343 or -1? -4894/2343 Which is bigger: -0.1 or 4190/87? 4190/87 Is 49311 equal to 49321? False Is -39/7 <= -1/2151? True Is -2/285623 != -0.043? True Which is smaller: -18187 or -18191? -18191 Is 289 at least -0.16? True Is 0.538 < 0.37? False Which is greater: -0.04 or 8.8073? 8.8073 Which is smaller: 29 or 0.752? 0.752 Which is greater: -7422/67 or -110? -110 Which is smaller: -52 or -6/77? -52 Which is bigger: -145175 or -145176? -145175 Is -0.5063 at most as big as 7? True Are -44/12495 and 1 non-equal? True Which is bigger: 15/4 or 189? 189 Is 131 < 160? True Which is greater: -2 or -29/35? -29/35 Which is smaller: 2181 or 2180? 2180 Is -42017 greater than or equal to -42006? False Is 22.01 smaller than -21? False Are 57 and 13240/229 nonequal? True Is 1/13 smaller than -42190? False Is 0 < -38381/47? False Do 1 and 4/38345 have different values? True Is 0 at most as big as -114/763? False Are 4.19 and -479 equal? False Is 125944 bigger than 125945? False Is 1356 bigger than 1358? False Which is bigger: -557562 or -557561? -557561 Which is smaller: 0.079 or 1.1426? 0.079 Which is smaller: 57797 or 2/17? 2/17 Which is bigger: 639538 or 639537? 639538 Is -42529/23 smaller than -1850? False Which is smaller: -194084 or -1358594/7? -1358594/7 Is -8578606 less than or equal to -8578606? True Which is greater: -1317/74 or 0.3? 0.3 Is 21 at least 36031? False Is -334/883 at most as big as -1? False Which is smaller: -7992 or -7955? -7992 Which is smaller: 90686 or 90685? 90685 Which is greater: -1083/47 or -24? -1083/47 Which is smaller: -4/183439 or 0? -4/183439 Which is greater: 1/222 or -225/4? 1/222 Is 1 greater than or equal to -8/277485? True Which is smaller: 5025/62 or 82? 5025/62 Is 50/268099 < -1? False Which is smaller: -154210 or -154212? -154212 Which is bigger: -70 or -0.00254? -0.00254 Which is bigger: 1/6503878 or 0? 1/6503878 Is -5435 equal to -5609? False Is 26 smaller than 3004/121? False Is -39533 bigger than -39533? False Which is greater: 6/213997 or -1/2? 6/213997 Which is greater: 404 or 544? 544 Which is smaller: 5/8 or -1/1867? -1/1867 Is 294520 <= 294518? False Which is smaller: 2095 or -38? -38 Which is smaller: -1/715652 or 1? -1/715652 Which is smaller: 26/710803 or 1? 26/710803 Which is smaller: 74 or 179? 74 Which is smaller: 5074 or 5091? 5074 Is -481 > -457? False Is 972 less than or equal to 1059? True Which is greater: 31560/539 or 59? 59 Is 4622 equal to 4623? False Is -0.23395 greater than -1/3? True Which is greater: 13640/29 or 470? 13640/29 Which is bigger: 140.8 or -0.37? 140.8 Is -5.1 bigger than 0.24? False Is 1 bigger than -84554? True Which is smaller: -43871/6 or -7313? -7313 Are 1/2 and -4/251 non-equal? True Is -1266 greater than or equal to -1253? False Is -18503/13 at least -1424? True Is -136 less than -134? True Which is smaller: 11027.8 or 0? 0 Is -6315/2 <= -3159? False Is 15003 not equal to 45007/3? True Which is smaller: 54462 or 54453? 54453 Is 98935 less than 98922? False Which is smaller: -1 or 34390? -1 Is 26/7 bigger than 2931? False Is 254825 not equal to -1/3? True Which is smaller: 6125 or 6132? 6125 Is 12/4387 greater than or equal to 1? False Which is smaller: 1823659 or 1823660? 1823659 Is 346227/2 >= 173113? True Which is bigger: -1643 or -1613? -1613 Are -42 and 59274 equal? False Is -1/9 <= 12921? True Which is greater: 0 or -266/5631? 0 Which is smaller: 3/304268 or 0? 0 Is 1812 less than 179? False Is 2/477919 bigger than 1? False Which is smaller: 51/2156 or -1? -1 Does 28215/13 = 2170? False Is -655701 >= -655700? False Is -892 at most 6.1? True Which is smaller: -2063/162 or -14? -14 Which is smaller: 594 or -0.02637? -0.02637 Which is greater: 172 or 58? 172 Is 18/551 != -144? True Which is smaller: 18	{ "pile_set_name": "DM Mathematics" }
= -601 + 1702 - 1101 + 2q2. Determine h(o(m)). 8m*4 + 54 Let x(u) = -2u*2 - 105u - 1425. Let m(z) = -252z. Give m(x(g)). 504g*2 + 26460g + 359100 Let t be (19 - (-20)/(-4))(-2)/(-4). Suppose th - 28 = 3h. Let c(m) = 8m + 3m - hm. Let x(l) = l. What is c(x(d))? 4d Let y(z) = -31z*2. Suppose 3n = -2a + 12, 4a - 11 - 7 = -3n. Let v(i) = -45185i + 2in + 45185i. What is y(v(u))? -124u4 Let w(z) = 28z. Let k(b) = -840854b2. Determine k(w(u)). -659229536u2 Let h(m) be the second derivative of m4/8 - 183m2/2 - 131m. Let x(d) be the first derivative of h(d). Let f(j) = 18j2. What is f(x(b))? 162b2 Let y(g) be the third derivative of g4/24 + 44g2 - 4g. Let v(d) = -d. Let c(r) = -2r - 2. Let x(t) = -c(t) + 3v(t). Calculate x(y(i)). -i + 2 Suppose 0 = 4c + 16, -2v = 2c - 0c. Let y(r) = -22r - 9. Let x(p) = 10p + 4. Let j(g) = vy(g) + 9x(g). Let s(z) = 8z - 22z + 3 - 3. Determine s(j(q)). -28q Let y(q) = -17q. Suppose 0 = -26f + 5f - f + 66. Let g(a) be the third derivative of -1/24a4 - 9a*2 + 0a + 0af + 0. Calculate g(y(o)). 17o Let t(k) = 2k - 692. Let d(a) be the third derivative of a4/8 - 1656a*2. Determine t(d(m)). 6m - 692 Let w(o) be the third derivative of 7o4/24 + o2 - 130o. Let u(s) = -2s - 58. What is w(u(f))? -14f - 406 Let b(c) = 8902c. Let m(k) = -13k*2 + 6k + 3. Let n(f) = -8f2 + 4f + 2. Let w(g) = 2m(g) - 3n(g). Give b(w(t)). -17804t2 Let m(v) be the third derivative of v4/12 + 2v*2. Suppose -98w = -103w + 20. Let n(q) = 6q - 5q + q + w + q. Determine n(m(d)). 6d + 4 Let s(m) = 17m2. Let x(i) = 6i*2 + 6. Let c = -751 - -755. Let j(u) = -5u*2 - 8. Let v(w) = cx(w) + 3j(w). Give v(s(q)). 2601q*4 Let c(a) = 41794148a. Let b(v) = -v*2. Give c(b(t)). -41794148t2 Let h(j) = -j. Let z(k) = -k2 + 2k + 2. Let n be z(-2). Let v = n - -8. Let f(i) = 391i - 40iv - 391i. Determine h(f(c)). 40c2 Let i(z) = 7z + 20. Let w(f) = -112f - 315. Let j(u) = -63i(u) - 4w(u). Let y(q) = -171q. What is j(y(t))? -1197t Let y(s) = -9s. Let i(f) = f*2 + 4f + 3. Let h(z) = 2z2 + 18z + 13. Let q(d) = -2h(d) + 9i(d). Calculate y(q(b)). -45b2 - 9 Let k(v) = v2. Let f(g) = 4g*2 + 8g - 11. Let n(w) = 8w2 + 18w - 20. Suppose 87 - 91 = -c. Let u(s) = cn(s) - 9f(s). Calculate k(u(p)). 16p4 - 152p*2 + 361 Let h(m) = 4072m - 3156. Let y(s) = -3s. Give h(y(f)). -12216f - 3156 Let z(j) = 7j + 4. Let s(l) = -6l - 3. Let o(d) = -4s(d) - 3z(d). Let f(n) be the first derivative of -26 + 0n2 + 0n + 1/3n3. What is f(o(r))? 9r*2 Let w(d) = 5d. Let b(c) = 5c + 159753. What is w(b(u))? 25u + 798765 Let j(k) = -3k. Let q(w) = -2w*2 + w + 2. Let l(h) = -1216h*2 + 760h + 1520. Let i(p) = l(p) - 760q(p). Determine i(j(c)). 2736c*2 Let y(u) = 3u*2. Let j(z) = 11651z*2 - 5645z*2 - 5764z*2. What is y(j(b))? 175692b*4 Let p(u) = -38139u - 12. Let k(x) = 4x2. Give p(k(d)). -152556d*2 - 12 Let k(l) = -l - 20845163. Let s(d) = 8d. What is k(s(h))? -8h - 20845163 Let x(y) = 122y - 26. Let i(l) = 14l - 3. Let g(n) = -104i(n) + 12x(n). Let h(t) = 5t. Calculate g(h(m)). 40m Let g(b) = 4b2. Let j(c) be the second derivative of c4/12 + 9c2/2 + 507c + 1. Calculate g(j(t)). 4t4 + 72t*2 + 324 Let u(v) = -4v - 292 - 438 + 733. Let g(t) = 35t. Give u(g(n)). -140n + 3 Let g(u) = -29429u2 + 960u. Let a(y) = 2y. Give g(a(x)). -117716x*2 + 1920x Let z(t) = 2206t2. Let y(w) = -4674w + 57. Determine y(z(i)). -10310844i2 + 57 Let i(d) = 498753d. Let m(w) = 51w. What is m(i(t))? 25436403t Let d(m) = -31134m. Let z(l) = -55l - 8. Calculate z(d(c)). 1712370c - 8 Let i = 157 + -286. Let r = i - -131. Let b(x) = -6x*2 + 3x*2 + 5x*r. Let u(v) = 68v. Calculate b(u(a)). 9248a2 Let v(f) = 13f*2 + 9f + 9. Let s(z) = -6z2 - 4z - 4. Let g(a) = -9s(a) - 4v(a). Let q(c) be the first derivative of -7c3/3 - 52. Give q(g(n)). -28n*4 Let p(b) = 10255b. Let u(r) = -32r + 715. Determine p(u(a)). -328160a + 7332325 Let w(g) = -2g. Let h(u) = 4868641u. Determine h(w(a)). -9737282a Let k = 20 - 22. Let q be ((-12)/(-21))/(k/(-7)). Let t(b) = qb - 2b + 3b + 0b. Let d(m) = -7m. Determine t(d(o)). -21o Let q(m) = 22m2. Let p(o) be the first derivative of o3/3 + o - 178. Give p(q(t)). 484t4 + 1 Let h(n) = 2n*2. Let d(q) = -2q*2. Let l(s) = -169s*2. Let o(v) = -65d(v) + l(v). Give o(h(z)). -156z4 Let y(p) = -3p*2. Let g(h) = -1020166h + 2. Determine g(y(l)). 3060498l2 + 2 Let t(k) = 109k. Let m(x) = 25x - 21. Let l(q) = 144q - 119. Let n(o) = 6l(o) - 34m(o). Determine n(t(a)). 1526a Let z(v) = 142v. Suppose -844 + 790 = -6l. Let p(x) = l - 2x - 22 + 13. Give p(z(b)). -284b Let o(x) = 2x. Let c(v) = -625658373v2. Determine c(o(w)). -2502633492w*2 Let q(o) = -15850o + 31666o - 15900o. Let t(h) = -45h2 + 2h. Determine q(t(z)). 3780z2 - 168z Let z(l) = -3443516l. Let d(y) = y2. Calculate d(z(m)). 11857802442256m*2 Let o(u) be the second derivative of -2u*3 + 2u. Let s be -4(-3)/(0 + 3). Let i(l) = 7l*2 - sl*2 - 12l*2 + 5l*2. What is i(o(b))? -576b2 Let x(o) = -o2 + 29o + 63. Let z be x(24). Let i(k) = 512k - zk2 - 512k. Let d(s) = -2s. What is d(i(w))? 366w*2 Let u(i) = -7i. Let r(o) = 4o2 - 9o. Let k(t) be the first derivative of -t3/3 + t2 + 42. Let n(y) = 18k(y) + 4r(y). Give n(u(q)). -98q2 Let q(w) = w. Let m(u) = 3u - 31964636. Determine m(q(c)). 3c - 31964636 Let c(t) = -17t*2 + 1535. Let g(p) = 94p. Give g(c(z)). -1598z2 + 144290 Let g(m) = -2m - 92. Let i(z) = -56851z. What is g(i(r))? 113702r - 92 Let s(r) = 555139r. Let a(g) = 3g + 21. Give a(s(q)). 1665417q + 21 Let t(g) = -372g + 607 + 139g - 607 - 543g. Let f(p) = 17p2 - 45p*2 + 11p*2 + 18p*2. Determine t(f(c)). -776c*2 Let s(b) = -8b. Let p(j) = 71248503j. What is p(s(m))? -569988024m Let t(g) be the first derivative of 5g4/12 + 2g*2 - 7g + 2. Let m(j) be the second derivative of t(j). Let v(y) = 14y. Calculate v(m(n)). 140n Let r(u) = u. Let m(h) be the first derivative of -62h3 - 244 + 14h*2 - 14h*2. Calculate m(r(q)). -186q*2 Let k(s) be the first derivative of 22s*2 + 12s + 1807. Let d(u) = 3u2. What is k(d(x))? 132x*2 + 12 Let m(f) be the second derivative of -2f*3/3 - 428f - 34. Let v(j) be the second derivative of j*4/12 - j. Determine v(m(q)). 16q*2 Let s(w) = -803w. Let v(x) = 23x2 + x + 2. Let p(l) = 93l*2 + 4l + 8. Let k(o) = p(o) - 4v(o). What is s(k(m))? -803m*2 Let x(s) = 148s*2. Let b(v) = 73v*2 - 1081. Give b(x(t)). 1598992t4 - 1081 Let c(n) be the third derivative of n4/3 + n*3/3 - 6n*2 - 14. Let x(h) = h - 70. Determine c(x(j)). 8j - 558 Let f(j) = -259j2 - 3j - 2. Let w(g) = 496g. Give w(f(m)). -128464m*2 - 1488m - 992 Let w(o) be the first derivative of 2o2 - 3138. Let q(u) = -9u*2 + 4u. What is w(q(g))? -36g2 + 16g Let y = -320 + 322. Let f(z) = 5z2 + 2z*2 + 2z*2 + 6z*y. Let a(b) = -2b*2. Determine f(a(n)). 60n*4 Let b(l) = -14l*2 + 333 - 171 - 162. Let x(n) = 7n + 2. Give x(b(h)). -98h2 + 2 Let v(w) = -13w*2 - 3w*2 + 841 - 841. Let h(z) = -3z - 1. Give h(v(r)). 48r2 - 1 Let f(x) = -506x*2. Let v(g) = 255g*2 + 37g + 1. Determine v(f(j)). 65289180j4 - 18722j*2 + 1 Let a(q) = -19714q2. Let t(j) = -j2 + 188j. Give t(a(k)). -388641796k*4 - 3706232k2 Let m(j) = -j2. Let p(y) = -y*2. Let x = 90 + -72. Let c = x + -13. Let a(v) = cm(v) - 7p(v). Let n(g) = -6g*2. What is a(n(d))? 72d*4 Let u(a) = 12a - 3. Let b(d) = 335d - 85. Let h(s) = -6b(s) + 170u(s). Let w(p) be the first derivative of 5p*3/3 + 23. What is w(h(q))? 4500q2 Let n(s) = -s. Let g(x) = -x2 - 2x + 58. Let l(d) = 456d*2 + 304d - 8816. Let b(a) = 760g(a) + 5l(a). What is n(b(o))? -1520o2 Let y(q) be the first derivative of 4q*3/3 + 110. Let h(o) = 17o - 25. Calculate h(y(p)). 68p2 - 25 Let d(f) = f - 1. Let v be (180/16)/(5/20). Let n(t) = -47t + 87t - vt + 4. Let l(c) = -4d(c) - n(c). Let w(m) = -5m. Give l(w(u)). -5*u	{ "pile_set_name": "DM Mathematics" }
atest common divisor of 884 and 40487200? 884 What is the highest common factor of 445858616 and 434? 434 Calculate the highest common divisor of 6230 and 2050265. 35 What is the highest common divisor of 46712582 and 294? 98 What is the highest common divisor of 9024 and 843264? 192 What is the greatest common factor of 998602033 and 429? 143 What is the greatest common factor of 4274300 and 1475? 25 Calculate the greatest common divisor of 322040 and 5230240. 3880 Calculate the highest common factor of 53331512 and 728. 104 What is the highest common divisor of 880 and 28757080? 440 What is the highest common factor of 5668 and 15238418? 2834 What is the greatest common divisor of 249920 and 45653? 71 What is the greatest common divisor of 15416 and 31030481? 1927 What is the greatest common divisor of 567583 and 39547? 557 What is the greatest common divisor of 132600368 and 112? 16 What is the greatest common divisor of 1173021844 and 538? 538 Calculate the highest common divisor of 2958852 and 429. 39 What is the greatest common divisor of 13490 and 833530? 190 Calculate the greatest common divisor of 6486 and 19234233. 3243 Calculate the greatest common factor of 58683 and 107322. 93 Calculate the highest common factor of 16575 and 2473653. 663 Calculate the greatest common divisor of 1212746 and 12070. 34 Calculate the greatest common divisor of 187143 and 5778. 321 What is the highest common factor of 26214 and 20818285? 4369 Calculate the highest common divisor of 48 and 818058. 6 What is the highest common factor of 1459300 and 32300? 100 What is the highest common divisor of 342 and 24948045? 171 Calculate the highest common factor of 137878 and 32344. 26 What is the highest common factor of 620531362 and 3014? 3014 Calculate the highest common factor of 2853 and 360333. 9 Calculate the greatest common factor of 63865800 and 3600. 1800 What is the greatest common divisor of 7180 and 71428076? 1436 What is the highest common divisor of 3132026 and 2248? 562 Calculate the highest common divisor of 350 and 322240. 10 Calculate the highest common divisor of 33706493 and 2978. 1489 Calculate the greatest common divisor of 17124 and 542. 2 Calculate the greatest common divisor of 655081485 and 111. 111 What is the highest common factor of 3017178 and 477? 9 What is the greatest common factor of 268 and 171706126? 134 What is the highest common factor of 1045471 and 6524? 1631 Calculate the greatest common divisor of 25636996 and 1316. 1316 What is the greatest common divisor of 6077345 and 24185? 3455 What is the greatest common factor of 1818143782 and 532? 266 What is the greatest common factor of 18149805 and 1080? 135 What is the highest common factor of 753063 and 70184? 283 What is the greatest common divisor of 94 and 82068674? 94 What is the highest common divisor of 274 and 170756? 2 Calculate the highest common divisor of 22 and 13683571. 11 What is the highest common divisor of 3181298 and 8181? 101 Calculate the highest common divisor of 8552907 and 5643. 1881 Calculate the highest common factor of 232754 and 68150. 58 What is the highest common factor of 77691018 and 3636? 606 Calculate the greatest common factor of 2688 and 27146112. 2688 Calculate the greatest common factor of 860 and 42783581. 43 What is the highest common divisor of 4912729 and 53? 53 What is the greatest common divisor of 2 and 32685826? 2 Calculate the highest common divisor of 776 and 18949629. 97 Calculate the greatest common divisor of 438060 and 14896. 196 Calculate the greatest common factor of 27685 and 245720986. 5537 What is the highest common divisor of 26 and 427758552? 26 Calculate the greatest common factor of 17108730 and 135. 45 Calculate the highest common divisor of 411700 and 72910. 230 Calculate the highest common divisor of 63678950 and 460. 230 What is the highest common divisor of 9929600 and 646280? 4280 What is the greatest common factor of 530 and 203620? 10 Calculate the highest common factor of 3560 and 23419015. 445 What is the highest common divisor of 139 and 1295375611? 139 What is the highest common divisor of 51 and 207352077? 51 What is the greatest common factor of 2905545 and 345? 15 Calculate the greatest common factor of 275 and 2094059. 11 What is the greatest common factor of 172 and 32551774? 86 Calculate the greatest common factor of 54366 and 224094. 1326 Calculate the highest common divisor of 4102 and 16869182. 586 Calculate the highest common factor of 2968 and 68841647. 371 What is the greatest common divisor of 2724 and 37001? 227 Calculate the highest common divisor of 2545668 and 2268. 324 What is the greatest common factor of 80285706 and 2802? 2802 What is the greatest common divisor of 27324 and 58508136? 2484 Calculate the greatest common divisor of 30 and 18569030. 10 Calculate the greatest common factor of 27698216 and 13. 13 Calculate the highest common factor of 340 and 2157436. 68 Calculate the highest common divisor of 719 and 4825209. 719 Calculate the greatest common divisor of 20856805 and 10. 5 What is the greatest common divisor of 174878 and 132? 22 Calculate the greatest common factor of 63792 and 2023624. 3544 Calculate the greatest common divisor of 963 and 4759574. 107 What is the greatest common divisor of 61 and 898017661? 61 Calculate the greatest common factor of 1102643978 and 1149. 383 Calculate the highest common factor of 4 and 111839100. 4 What is the greatest common divisor of 4088 and 160173096? 584 Calculate the highest common factor of 810 and 14709330. 270 Calculate the highest common factor of 1628700 and 90585. 915 What is the highest common factor of 1023106 and 224? 14 What is the greatest common factor of 49706 and 3406862? 58 Calculate the highest common factor of 468575388 and 1044. 1044 What is the highest common divisor of 1348155 and 3345? 15 Calculate the greatest common factor of 3356 and 9082175. 839 Calculate the greatest common divisor of 240 and 114678576. 48 Calculate the greatest common divisor of 2192 and 204702112. 2192 Calculate the highest common factor of 4648 and 39004024. 664 What is the greatest common factor of 1464384480 and 6? 6 What is the highest common divisor of 352 and 5633276? 44 What is the highest common factor of 58 and 15910647? 29 What is the highest common divisor of 4532465 and 161? 7 Calculate the greatest common factor of 3156 and 130. 2 What is the greatest common divisor of 175566 and 1888848? 6054 What is the highest common divisor of 4906 and 42427? 11 What is the greatest common divisor of 4374 and 652887? 27 What is the highest common factor of 14055240 and 696? 24 What is the highest common divisor of 6659260 and 3330? 370 What is the highest common factor of 214 and 952390? 2 Calculate the greatest common divisor of 664290 and 1251171. 549 Calculate the greatest common divisor of 420 and 515841060. 420 What is the greatest common divisor of 169908566 and 13674? 4558 What is the highest common divisor of 46283 and 150958723? 1493 Calculate the greatest common factor of 396820877 and 393. 131 Calculate the greatest common divisor of 43375 and 197375. 125 Calculate the greatest common factor of 83545 and 30535. 155 Calculate the greatest common divisor of 108726835 and 570. 95 Calculate the greatest common factor of 5157 and 27742941. 1719 Calculate the greatest common divisor of 101089323 and 27. 27 Calculate the highest common factor of 39100 and 27399716. 1564 Calculate the greatest common divisor of 88 and 521619208. 88 Calculate the highest common divisor of 215 and 4597345. 215 What is the highest common divisor of 2599 and 450524? 23 What is the highest common divisor of 160018794 and 1404? 702 What is the highest common factor of 31556949 and 2532? 633 Calculate the greatest common divisor of 22552189 and 1111. 1111 Calculate the greatest common divisor of 2533055 and 8440. 1055 What is the highest common factor of 2576 and 165649036? 644 What is the greatest common divisor of 469 and 71603168? 469 What is the highest common factor of 125477540 and 356? 356 What is the greatest common factor of 3858 and 161316483? 1929 Calculate the greatest common divisor of 301336 and 1000. 8 What is the highest common diviso	{ "pile_set_name": "DM Mathematics" }
10ps - 2p*2 + 9p*2. Let l be w(-1). What is the greatest common factor of l and 26? 13 Let u = 0 + 1. Suppose 5j + 70 = 75. What is the greatest common divisor of u and j? 1 Let s be 2-1(-10)/10. What is the highest common divisor of s and 5? 1 Let z(n) be the first derivative of -n*2 + 22n - 8. Let c be z(0). What is the greatest common divisor of c and 2? 2 Let j = 367 + -255. Let b = j + -55. What is the greatest common divisor of b and 19? 19 Let f(o) = 6o2 + 11o + 25. Let w be f(-7). Let r be -1 - -1 - (-16 + -6). Calculate the greatest common factor of w and r. 22 Suppose 0 = 2o - 9 - 3. Let x(h) = h2 - h - 50. Let d be x(8). What is the highest common divisor of d and o? 6 Let q(k) = k + 1. Let w be q(3). Suppose -a = -2a + 10. What is the greatest common divisor of a and w? 2 Let f be 5 - 1 - (-1)/(-1). Let h be (-4)/(-12) + 29/f. Calculate the greatest common divisor of 70 and h. 10 Suppose 51 = 3v + 6. Calculate the highest common divisor of 15 and v. 15 Let p = 35 + -15. What is the highest common factor of p and 10? 10 Suppose 2l = -5k - 20 + 374, 0 = 2k + 5l - 129. Calculate the greatest common factor of 18 and k. 18 Let b = 58 + -22. Calculate the greatest common factor of 9 and b. 9 Suppose -4l + l + 60 = 0. Let t = -1282 - -671. Let b = -391 - t. What is the greatest common divisor of b and l? 20 Suppose -6d + 108 = -3d. Calculate the greatest common divisor of d and 144. 36 Let m = 60 - 57. What is the highest common divisor of 6 and m? 3 Suppose 3b + 0h = -h + 336, 5b - 4h = 560. Let v(j) = -3j3 - j2 + 3j + 2. Let z be v(-2). What is the greatest common divisor of z and b? 16 Let h be -7(4 - 2)5/(-2). Calculate the greatest common divisor of 14 and h. 7 Let r be (-36)/(-2)(-2)/(-4). Let t be (r/(-2))/(2/(-4)). Calculate the highest common divisor of 81 and t. 9 Let a = 1 - -85. Let o = -146 + a. Let d = o - -100. What is the highest common divisor of d and 8? 8 Let a(v) = v3 + 47v*2 + 40v - 177. Let z be a(-46). Let j(x) = -x*3 + 6x*2 - 4x + 4. Let q be j(5). Calculate the greatest common divisor of z and q. 9 Let n(s) = s*3 - 10s*2 + 11s + 14. Let x be n(9). Calculate the greatest common factor of 48 and x. 16 Suppose r = -3x + 2r - 37, 2x - 3r + 13 = 0. Let k be (1 + -2)/(1/x). What is the highest common factor of 14 and k? 14 Suppose 5h = 2h - 138. Let o = -7 + 3. Let w be (-2)/o + h/(-4). What is the highest common factor of w and 108? 12 Suppose 12 = -5f + 37. Let a(l) be the first derivative of -l2/2 + 9l + 3. Let z be a(4). What is the greatest common divisor of z and f? 5 Suppose -9u = -13u + 24. What is the highest common factor of 6 and u? 6 Let s = 118 + -3. Calculate the greatest common factor of s and 23. 23 Let w(z) = 10z - 20. Let m be w(10). What is the highest common factor of 32 and m? 16 Let u = -6 + 51. Calculate the greatest common divisor of u and 45. 45 Let m = 21 - 14. Calculate the highest common divisor of 21 and m. 7 Let l be 6/(6/(-3)) + 59. What is the highest common factor of 42 and l? 42 Let i be 2/(-3) - (-5 - 34/6). What is the highest common factor of 10 and i? 10 Let n be 4 - (-4)/(-8)2. What is the highest common divisor of 3 and n? 3 Suppose 0 = -4v + v + 123. Let q = 140 - v. Calculate the greatest common factor of 9 and q. 9 Let c be 8/(-6)(-9)/2. Let g(p) = -5p + 7. Let o be g(-7). What is the highest common divisor of o and c? 6 Let t(v) = -5v + 6. Let i(h) = h - 1. Let y(m) = 6i(m) + t(m). Let j be y(2). Calculate the highest common factor of 22 and j. 2 Let n be (4 - 6)(-27 + 5). Calculate the greatest common divisor of n and 11. 11 Let h = -6 + 10. Let n be (6 - h)/((-1)/(-9)). Calculate the highest common divisor of n and 2. 2 Let y = -474 - -686. Suppose 3s - 4j = -j + 120, j = -5s + y. What is the greatest common factor of 14 and s? 14 Let g be 530/6 - (-1)/(-3). Calculate the greatest common factor of g and 11. 11 Let c = 47 - 40. What is the greatest common divisor of 63 and c? 7 Let v(d) = d2 - d - 25. Let b(r) = -r2 + r + 25. Let s(u) = -3b(u) - 4v(u). Let h be s(0). What is the greatest common divisor of 10 and h? 5 Suppose 0o = -o + 5. Suppose -2 = -v + oy + 2, -3y = 3v - 30. Calculate the highest common divisor of 36 and v. 9 Suppose -72 = 5k + 5b + 53, k - 5b + 55 = 0. Let o = k + 42. Let i be 42/48/1. What is the greatest common divisor of i and o? 12 Let u be 57((-8)/(-12))/1. What is the greatest common divisor of 76 and u? 38 Let i(o) = -4o - 8. Let y be i(-3). Suppose 5s = 2s + 3c - 87, -c - 133 = 5s. Let x = s + 47. Calculate the highest common factor of y and x. 4 Suppose -6v + 9v = 12. Calculate the highest common divisor of v and 2. 2 Let b be (-3 - 21/(-6))18. What is the greatest common divisor of b and 27? 9 Let b(c) = 38c*2 - 4c - 3. Let x be b(-1). Calculate the greatest common factor of 13 and x. 13 Suppose -2b = -6b + 32. Let r be (84)/(1 + 0). Calculate the highest common factor of b and r. 8 Let u = 17 + -13. Calculate the highest common factor of 32 and u. 4 Let f be (-2)/(-1(-5)/(-45)). Calculate the greatest common divisor of f and 12. 6 Let i = -6 - -20. What is the greatest common factor of 42 and i? 14 Let g = -22 + 48. What is the highest common divisor of g and 39? 13 Let y be 5(12/(-5))/(-2). Suppose 0x = 2x, -2l = 4x - 60. What is the greatest common factor of l and y? 6 Suppose 2s = -2 + 10. Let u = s - -2. Calculate the highest common divisor of 2 and u. 2 Let q be (-2)/6 - 14/(-6). Let a = 26 + -20. Suppose -11h + ah = -15. What is the highest common factor of q and h? 1 Suppose -2 = -4r + 18. Let q be 6/r(-15)/(-2). What is the greatest common factor of q and 3? 3 Let r(m) = m - 1. Let b be r(0). Let w = b - -5. Suppose 4c - 171 = -l, l - 6l = 25. Calculate the highest common divisor of c and w. 4 Suppose 3n - n = 12. Suppose m + n = 2m. Calculate the greatest common divisor of m and 30. 6 Let l = 24 - 9. Let y = 3 + 1. Let f be 239/y + (-1)/(-4). Calculate the highest common factor of l and f. 15 Let k(r) = -r*2 + 8r - 5. Let j be k(3). What is the highest common divisor of 30 and j? 10 Let a be 99/24 + 1/(-8). Calculate the greatest common factor of 12 and a. 4 Let h = 7 + 3. Calculate the highest common factor of h and 110. 10 Suppose 4t + 28 = 4. Let b be (-136)/(-3) + t/18. Let v(h) = h3 + 2h - 3. Let d be v(3). What is the highest common factor of d and b? 15 Suppose -20 = -3d + s + 14, 0 = -d - 5s + 22. Suppose 5g = 2g. Suppose g = -0y - 3y + 288. What is the greatest common factor of y and d? 12 Let s be (-344 - 1)1/(-3). What is the highest common factor of s and 46? 23 Suppose 2y = -7 + 23. What is the greatest common divisor of 88 and y? 8 Let x(w) = w*2 - w + 5. Let l be x(4). Suppose 0 = 4z + 2h - 16, 3h = 2h + 2. Suppose -5b = -zb - 102. What is the highest common factor of b and l? 17 Let v = -10 + 20. Let o(i) = -i2 - 17i. Let m be o(-10). What is the greatest common factor of v and m? 10 Suppose 8 + 0 = 2q. Let f be q/(-22) + 79/11. What is the highest common factor of 63 and f? 7 Let h = -60 + 76. What is the greatest common divisor of h and 32? 16 Let z(p) = p3 - 3p*2 - 2p - 8. Suppose -4k + 9 = -15. Let q be z(k). What is the greatest common factor of 8 and q? 8 Let j(h) = h + 12. Let y be j(-11). Let p be (y + -2)/((-3)/27). What is the highest common divisor of p and 54? 9 Let o(c) = -7c + 2. Let w be o(-3). Let l(m) = -18m - 39. Let v be l(-6). What is the greatest common factor of w and v? 23 Suppose -735 = -7j + 2j + 3i, -3j + 445 = -i. Calculate the greatest common divisor of j and 60. 30 Suppose 6 = 2s - 0s. Let x(g) = -g - g - 5g*s + 4g*3. Let n be x(-3). What is the greatest common factor of 22 and n? 11 Let u be 0 - 1 - (-4 + 4). Let p be (26/4)/(u/(-2)). Let w = -2 + p. What is the highest common divisor of w and 44? 11 Suppose -4z + 32 = -5l, z - 5 = -5l - 22. Let k be (z/9)/(1/3). Let o be 0/(k - -2) - -12. Calculate the greatest common divisor of o and 36. 12 Let z be -2(-2)/(-4)-3. Let r(p) = -p*2 - 2p - 4. Let m be r(z). Let w = -1 - m. Calculate the greatest common factor of w and 6. 6 Suppose -3*s + 4 = -11. Let f = -201 + 91. L	{ "pile_set_name": "DM Mathematics" }
= -33 - -16. Let w = -1758.0013 - -1775. Let d = s + w. What is d rounded to three decimal places? -0.001 Let q = -97.3 - -97.3000408. What is q rounded to five dps? 0.00004 Suppose -5p - 2o + 20310 = -6o, 0 = o. Round p to the nearest one hundred. 4100 Let i = -455.999996055 + 456. What is i rounded to six dps? 0.000004 Suppose 2j - 127204 = i, 3i - 20j = -21j - 381598. What is i rounded to the nearest 1000? -127000 Let g = 31 - 31. Suppose -2b + c + 5 = -gb, -3b + 3c = -15. Suppose 0 = -4h + x - 717, -h + bh - 177 = -x. Round h to the nearest one hundred. -200 Let i = 2271778 - 1274695. Suppose 5s + 2a = -2900004, -5s + 3a - 1902911 = i. Round s to the nearest one hundred thousand. -600000 Let a = 1.13 + -1.2. Let c = -2.6182 - -2.683. Let u = a + c. What is u rounded to three decimal places? -0.005 Let f = 1615 - 1614.99996265. Round f to 5 dps. 0.00004 Let d = -58839673 + 89247959. Let f = -30408294.0000005 + d. Let t = f + 8. What is t rounded to 6 dps? -0.000001 Let g = -0.119 - -0.039. Let l = g - 0.032. Round l to 2 dps. -0.11 Let s = 1836 + -1840.498. Let a = 4.08 + s. What is a rounded to 1 dp? -0.4 Let h = 3203335801072963 - 3203335920065727.99999805. Let b = -118992750 - h. Let j = b - 15. Round j to seven decimal places. -0.000002 Let m = -5789643.800315 - -5789630. Let d = 13.8 + m. What is d rounded to 5 decimal places? -0.00032 Let g = 1529.71740008 + -1528.9274. Let m = 0.79 - g. Round m to seven decimal places. -0.0000001 Let d = -951 + 942.7. Let t = 70647.29852 + -70639. Let r = t + d. Round r to 4 dps. -0.0015 Let p = -188 - -187.23. Let q = p - -0.770167. What is q rounded to 5 decimal places? 0.00017 Suppose 0 = -5a - 7663061 + 29648686. Let t = a + 5802875. Round t to the nearest 1000000. 10000000 Let i = 2446100 - 827529. Suppose 5r - 981429 - i = 0. Round r to the nearest one hundred thousand. 500000 Let t = 0.6918 - 0.2303. Let x = t - 0.47. Round x to 3 dps. -0.009 Let a(z) = z + 1. Let o(r) = -227990r + 10. Let j(u) = -10a(u) + o(u). Let i be j(-5). Round i to the nearest 100000. 1100000 Let g = 12060 + -12149.552. Let n = g - -89. Round n to 2 dps. -0.55 Let p(l) = l3 + 9l*2 - 10l + 5. Let b be p(-10). Suppose -5h + 5g - 804 = 189171, bg = -4h - 152025. Round h to the nearest ten thousand. -40000 Let z = -70 - -48. Let w = z + 21.2. Let k = w - -0.79999954. Round k to seven dps. -0.0000005 Suppose -10363 + 27955 = 12r. Let i(n) = 128n - 2. Let a be i(6). Let y = r - a. Round y to the nearest one thousand. 1000 Let y = -18.463 + -0.237. Let b = -20.9 + 1.9. Let g = b - y. Round g to one decimal place. -0.3 Let y = -1070935 - -283835. Round y to the nearest one hundred thousand. -800000 Let c = 708413 - 347274. Suppose -78861 = -v + c. What is v rounded to the nearest 100000? 400000 Let q = -48.8 - -48.80416. What is q rounded to four decimal places? 0.0042 Let f = 2245 - 2345.1. Let v = 100.099999066 + f. Round v to 7 dps. -0.0000009 Let b = -70834 - -531452. Suppose 0 = 2o + b + 619382. Round o to the nearest 100000. -500000 Let s = -3278.32911 + 3107.33. Let h = 400 - 229. Let i = s + h. Round i to 4 decimal places. 0.0009 Let y = 214.22 + -212. What is y rounded to zero decimal places? 2 Let p = -0.2028312 - -991228.2028312. Let v = p - 991209.00044. Let m = -19 + v. What is m rounded to 4 decimal places? -0.0004 Let f = 26.51 + 1.79. Let d = f - 26. Let h = 2.326 - d. Round h to two dps. 0.03 Let p = 30.5999998142 - 30.6. Round p to seven dps. -0.0000002 Let l = 6.72 - -8.288. Let s = -15 + l. Let f = -0.171 - s. Round f to two dps. -0.18 Let z = -262.4 - -262.4006455. What is z rounded to 5 decimal places? 0.00065 Let s = 78.26 - 79. Let t = 0.7575 + s. What is t rounded to three dps? 0.018 Let s(o) = 2o - 3. Let r be s(5). Let p = r + -2. Suppose -pi = 5 - 35. What is i rounded to the nearest ten? 10 Let m = 0.01 + -0.06. Let f = 9.95 - m. Let p = 10.032 - f. What is p rounded to 2 decimal places? 0.03 Let q = -277.9648 + -0.0352. Let y = -278.00000508 - q. What is y rounded to six dps? -0.000005 Let t = -305.26 + 439.65. Let u = 135 - t. Round u to 1 dp. 0.6 Let l = 121.999624 - 122. What is l rounded to 4 dps? -0.0004 Let i = 83 - 82.67. Let p = -766 + 765.73. Let n = i + p. What is n rounded to one dp? 0.1 Let a = 67443.396 + -67443.81199831. Let w = a - -0.416. What is w rounded to 7 dps? 0.0000017 Suppose 0w + 4w - 378 = f, -4w + 372 = -4f. Let c = 905 + w. What is c rounded to the nearest ten thousand? 0 Let p = -377070.00900232 - -377046.009. Let v = 24 + p. What is v rounded to seven dps? -0.0000023 Let y(b) = 3b + 3. Let r(m) = 1. Let g(i) = -3r(i) - y(i). Let s be g(-3). Let v be (-20)/(s(-3)/19350). What is v rounded to the nearest ten thousand? 40000 Let w = -1068278 + -3211722. Round w to the nearest 100000. -4300000 Let z = -1.670000123 + 1.67. Round z to 7 dps. -0.0000001 Let s = -9301 - -13798. Let u(x) = -x*3 - 5x*2 - 2x - 6. Let v be u(-5). Suppose 3y = -4f + 3f - s, f = vy - 4504. Round f to the nearest 1000. -5000 Let j = -69.66 - -70. Let r = -4.99 + j. What is r rounded to 0 decimal places? -5 Suppose -14y = -16y. Let d be 1 - (y/4 - 1). Suppose -2u - 123 = l + 31, -u = -dl - 303. Round l to the nearest ten. -150 Suppose 3x + 26618 = -4n, -2n - 2 = 2. Round x to the nearest 1000. -9000 Let a = -23 - -22.982. Let h = 0.0179989 + a. Round h to 6 dps. -0.000001 Let i(c) = -1. Let h(q) = -2q + 11. Let x(f) = h(f) + 6i(f). Let m be x(4). Let g be m + -43(16283 + -4). What is g rounded to the nearest 100000? -700000 Let c = 24.600000138 + -24.6. What is c rounded to 6 decimal places? 0 Let l = 0.02 + 11.98. Let m = l - 11.935. Let d = m - -1.075. Round d to 1 decimal place. 1.1 Let n = -173.0000552 - -173. Round n to 5 decimal places. -0.00006 Suppose 0 = -5a + a, -4h = -a - 16. Suppose -m + hm + 65178 = 0. Let f = 10726 + m. What is f rounded to the nearest ten thousand? -10000 Let v(h) = 284h*2 - 4h - 128. Let p be v(-21). Round p to the nearest one thousand. 125000 Let a = -65832 - -172982. Round a to the nearest 10000. 110000 Let m(i) = -9i2. Let p be m(-1). Let f = 11 + p. Suppose 3d = -fk - 740, -199 = 2d - 4k + 321. What is d rounded to the nearest 100? -300 Let s(y) = -4y + 4. Let v be s(-2). Let a be v/(-2 - 2) + 3. Suppose -5n + 1338 - 9088 = a. What is n rounded to the nearest one hundred? -1600 Let l be (3/(-5) - -2)5. Suppose -d + 153 = -l. Round d to the nearest 100. 200 Let y = -14 + 14.255. Let u = 31.845 + y. What is u rounded to 0 decimal places? 32 Suppose -2m = i + 7, -3i = 5m - 0i + 15. Let r = m - -12. Let z be (-3 + -12297)8/r. What is z rounded to the nearest 1000? -16000 Let y = 121 + -111. Let p be (-10)/(-25) - ((-1236)/y - -2). What is p rounded to the nearest ten? 120 Let m = -100081.083 - -99937. Let g = -18.9 - 125.1. Let j = g - m. What is j rounded to 2 decimal places? 0.08 Let k = -0.6 + -27.4. Let c = 34.8 + k. Round c to the nearest integer. 7 Let b = 2692007 + 227993. What is b rounded to the nearest one hundred thousand? 2900000 Let w = 216.9998448 + -217. What is w rounded to 5 decimal places? -0.00016 Suppose -6u + 5100000 = -16u. What is u rounded to the nearest 100000? -500000 Suppose 5a + 116 = 3q - 339, q - 3a = 153. Suppose -4n - q = n. Let f be 12/n + (-26)/10. What is f rounded to the nearest integer? -3 Let m be 2/15 - (33426000080/75)/8. What is m rounded to the nearest 1000000? -56000000 Let p = 185.630100702 - -0.369885598. Let h = 186 - p. Round h to 6 decimal places. 0.000014 Let k(o) = -482o - 441. Let s be k(14). What is s rounded to the nearest 1000? -7000 Let j be (-5)/(-2)42(-1)/(-5). Let d(t) = -1437t3 + 20t*2 - 34t - 49. Let i be d(j). What is i rounded to the nearest one million? -13000000 Let q = 199.336 - 200. Let r = q + 0.004. What is r rounded to one decimal place? -0.7 Let q = 787 - 786.99167. What is q rounded to 4 dps? 0.0083 Let z = -1953.9 + 1953.899991371. What is z rounded to 6 dps? -0.000009 Let x = -1.068 + 1.0678418. Round x to 5 dps. -0.00016 Let l = 27.2 - 27.514. Let x = 0.313999574 + l. What is x rounded to 7 dps? -0.0000004 Let q = 105.000000832 + -105. Round q to seven decimal places. 0.0000008 Let z = -2251 + 225	{ "pile_set_name": "DM Mathematics" }
ose 3a + ia = 0. Solve a = s - 2b - 15, -8b - 50 = -5s - 3b for s. 5 Let l(g) = -g*2 + g + 5. Let z be l(0). Let s(x) = x - 3. Let n be s(z). Solve -3 = -3a - 3j, -5a + 0a - nj = -5 for a. 1 Let p = 5 + -7. Let c be ((-3)/(-4))/(p/(-16)). Let d(q) = -q*3 - 10q*2 + q + 12. Let k be d(-10). Solve z + kz + c = -x, 2x = -5z - 9 for x. 3 Suppose -4a - 25 = -9a. Suppose -u + i - ai + 13 = 0, -4u - i + 22 = 0. Solve -3l + 3n = 0, -l + 14 = l + un for l. 2 Suppose -5l - 9 = -5x + 6, -5l - 5x = 15. Suppose 0 - 9 = -3b. Let c be 5 - (3 + b + l). Solve 5j - cj = a + 5, -2a = 2j + 2 for a. -2 Let x = 0 - 1. Let s be (x/(-2))/((-1)/(-32)). Suppose -2p - 46 = -4l, -5p - 19 = -6l + 4l. Solve -l = -3z - 3b, 4z + z + s = 4b for z. 0 Let t(u) = -u2 - 3u + 2. Let z be t(-3). Suppose 4c = 3c + z. Solve 0 = -2p - 2k - ck - 6, -2p + 3 = k for p. 3 Suppose 3n - 1 = a, -2a + n = -7a + 27. Solve 0y - as = -3y - 14, 3s - 3 = 0 for y. -3 Suppose 2x - 3x = 0. Let o be (0 + x)/(1 + 1). Solve 3s + v - 14 = o, s + 14 = 6s - 3v for s. 4 Let d be (-2)/(-1) - (-2 - 4/4). Solve -4c = -0c - 4, -r = c - d for r. 4 Let q = 17 + 3. Suppose 0 = -5o - 25, -5d - 3 - 2 = -o. Let k be (1/d)/((-2)/q). Solve ka = 4m + 5, 3m = -0a + 5a for m. -5 Let w = 1 + -6. Let i = w - -7. Suppose -4c + 19 = 3h - 0h, 0 = 3c - ih - 10. Solve 5b + cv = -0v - 9, b + 5v - 15 = 0 for b. -5 Let l = -9 + 17. Solve u + 2u - 27 = -3k, 0 = -4k + 3u + l for k. 5 Let t(n) = -n*2 - 10n - 7. Let u be t(-9). Solve 2x + 2c = 8, 3c = 5x + uc - 8 for x. 2 Suppose 3d - 3 = 2w - 5, -3w + 5d = -2. Solve 5b + wu = -13, -2b - 3 = 3b - u for b. -1 Let y = 1 + -4. Let u(k) = -k2 - 3k + 2. Let t be u(y). Solve -3 = 2s - 5d, -3 + 0 = -5s + td for s. 1 Let d = -11 + 11. Suppose -2r + d = -4. Solve 0z + 4z = 3b - 4, -rz = -3b - 4 for z. -4 Let q(s) = 4s + 15. Let n be q(0). Solve 0 = 5m + x + 12, -4m + 3x = n + 6 for m. -3 Suppose -3c - 8 = -7c. Suppose -4n - 2 = -2r, -r - cn = 2n - 13. Solve 4p - 5t + 17 = -0p, 0 = p - rt + 8 for p. -3 Let w be (-4)/(-10)5 + 3. Solve -wg = 4a + 23, -4g + 2 = 5a + 24 for a. -2 Let l(c) = -c2 + 12c + 17. Let f be l(13). Solve -3u = -fg - 7, g - 3u - 8 = u for g. -4 Let v = 8 + 0. Let q(h) = 13h*3 + 2h*2 - 1. Let i be q(1). Solve 5n + 2l + i = 0, -5l - v = -n - 0l for n. -2 Suppose -8s + 6s = -18. Solve 4d - y - s = 0, -3d - 3y = 2d + 10 for d. 1 Let q be (-12)/15 + 12/(-10). Let d be (-4 - 1)q/5. Solve -37 = -4f + 5g, f + 4 + 3 = -dg for f. 3 Let b(a) = a3 + 3. Let u be b(0). Solve -9 = up + 3t, p - 2p + 3t - 11 = 0 for p. -5 Let w be 3 + -1 + 11/1. Solve h + 5i - w = 2h, 6 = 2i for h. 2 Suppose -3a + 2 = -5v - 1, -4v - 5a + 5 = 0. Solve 0 = 2q - k - 11, v = 4q + k - 0k - 7 for q. 3 Let j = 10 - 4. Solve 5g + 13 = 4b, -2g - b = -jg - 17 for g. -5 Let z be 8/28 + 122/14. Suppose 4w = 3s + 16, 0 = -4s + w - 14 - 3. Let f be 5 - (-1 - 1 - s). Solve -fy - z = -2a, 2a = -y + 3a - 3 for y. -3 Let p = 0 - -2. Let v be (-68)/(-18) - (-6)/27. Suppose -2y - 3s = 2, -vs + 1 - 5 = 2y. Solve 0 = -yu - 8, -4g + 6 = -pu - 22 for g. 5 Let s(j) = j - 4. Let x be s(9). Let h be (-7 + x)(-1 - 0). Suppose -8 = -hm - d + 3d, -19 = -3m - 4d. Solve -24 = mg + t, -g - 24 = 7t - 2t for g. -4 Let l be (-41)/(-5) - (-4)/(-20). Suppose -3t - 4a + 8 = 0, 5t - 10 = -2a - 3a. Solve -l = 4j - 0, k - j = t for k. -2 Suppose 6a = 11a - 10. Let i(j) = 0j3 - j - 2 + 17 - j2 + j*3. Let c be i(0). Solve -2b + 7b = 5f - c, 5f = -ab + 22 for b. 1 Suppose 0 = -6u + u + 10. Let v(o) = 0o + o + 2o - uo. Let t be v(3). Solve 5g - 4p = -13, tp = -2g + 6p - 8 for g. -1 Suppose d = -d + 10, -d + 1 = -2w. Let p = 0 + w. Let h be 0/(-1p-1). Solve -3b + 3z + 15 = h, -b + 2 = b + 2z for b. 3 Let b = 19 + -6. Let n = b + 4. Solve 0 = k + 4m - n, -5k = 2m - 23 - 8 for k. 5 Suppose 2 = 4p + 2. Solve 5c = c - m - 9, 3c + 3m + 18 = p for c. -1 Suppose -3q - 72 = -3n, -n - 4n + 134 = 2q. Suppose 0 = -p - p + n. Solve -7s + 3s + 36 = -4v, -2s + v = -p for s. 4 Suppose -9 = -4m - y, -5m = -8y + 4y + 15. Solve -i = 2q - 1, -2i - 3 = 2q + m for q. 3 Let z(q) = -q3 - 7q*2 + 16q - 15. Let d be z(-9). Let j = 0 + 6. Suppose -jw = -w - 10. Solve 0f + df + h - 5 = 0, 5h = -wf - 14 for f. 3 Suppose 0c - c = -4. Suppose -4u + 5 = -5r, 3u - cr - 1 - 3 = 0. Suppose u = 3z - 8 - 7. Solve -5a - i - 2i + 40 = 0, -za + 35 = 2i for a. 5 Suppose -2 = -2h + z + z, -5h - 15 = 5z. Let q = h + 5. Solve 4i + 6 = -v, i = 2v - qi - 14 for v. 2 Suppose 0 + 6 = -2c. Let m be (4 + c)/(2/(-6)). Let k = m - -5. Solve -k = -4i - 3w + 2, -4i - 5w = -4 for i. 1 Suppose 3a - 4o = -9o + 40, 5a + o = 30. Solve am - g + 4g + 16 = 0, -3m - 5g = 0 for m. -5 Suppose -5l + 3l = -2. Let j be l - (1 + 2) - 1. Let a = 1 - j. Solve p - 4p - aw = 0, -2w = -3p + 18 for p. 4 Let c(z) = z*2 + 4z + 6. Let l(f) = f*2 + 7f + 1. Let y be l(-6). Let k be c(y). Solve -2n - 4a + 10 = 0, -2n + 0n = 5a - k for n. 3 Let p = 18 + -8. Suppose 0 = 5k - 3d - p, -5k + 0k + d = -10. Suppose kr = -6h + 3h, -4h = -r. Solve j - 5s + 0s = -19, r = 2j + 4s - 18 for j. 1 Let v(a) = a3 + 4a*2 - 2a - 1. Let m be v(-4). Suppose -3s + 27 = 3l, 5s - l - 37 = -4l. Solve 4q = sz + 17, -z - q = -0z + m for z. -5 Let k(u) = -u - 5. Let r be k(-8). Suppose 6 = 4d - 6. Let l = r - d. Solve 11 + 0 = 5p - v, l = -v + 4 for p. 3 Let d(t) = -t2 - 4t + 5. Let c be d(-4). Let n be 8/12 - (-7)/3. Let p be (2/n)/((-6)/(-18)). Solve px = -2b + 3x - 5, -3b = cx + 14 for b. -3 Let u = -137 - -137. Solve u = k - 5c + 19, 5 = 3c - 4 for k. -4 Let v = 8 - 5. Let z be (6(-2 + v))/2. Solve -zs - 4 = -2l + 3, 3 = 3s + 3l for s. -1 Let m(j) = j*2 + 6j + 1. Let z be m(-7). Let t(r) = r - 5. Let g be t(z). Solve -4d + 2l - 6l = 16, -d - gl - 4 = 0 for d. -4 Let t(c) = 5c2 - c - 1. Let j be t(-1). Let z be 66/8 - (-2)/(-8). Solve 2u = 2r + z, u + jr - 3 = 7 for u. 5 Let g(s) = -5s3. Let d be g(-1). Suppose 0 = -4a + u + 20, 4 = -4a - 7u + 2u. Solve l + 13 = -dh, -ah - 23 = -0l + 5l for l. -3 Let s be (-2)/(-7) + 33/7. Solve sh - 2w = -6, -2h + 4w + 0 = -4 for h. -2 Let u(x) = -x2 - 7x - 3. Let r be u(-6). Suppose -ry = -4a + 4, 2y - a - 1 = -2. Solve 0 = -3m - b - 2b - 3, y = -3m + 5b - 3 for m. -1 Suppose v - 4 = -0. Solve 5l + 3 = -0p - vp, -4p - 3l - 5 = 0 for p. -2 Let c = 88 + -30. Let r be c/8 + 8/(-32). Suppose -4m + r = -13. Solve 5n + 26 = -4g - m, -10 = 4g - 2n for g. -4 Let f(d) = -d2 + 9d - 2. Let j be f(7). Solve -2w + 2 = z, -z + 2z + j = 5w for w. 2 Suppose 2p + 3j = 2j + 4, 0 = 5p + 2j - 10. Solve -2u - ps + 0s = 0, -3u - 4s = 5 for u. 5 Let a be 3 - 2 - 1-2. Suppose -t + 2 = -a. Let d be 7/(-49) - 85/(-7). Solve -l = b, -tl - 8 = d for b. 4 Let m be (-44)/11 - (1 + -8). Solve mf - x + 6 = 3, 0 = 3f + x + 9 for f. -2 Let x(g) = g - 3. Let n be x(7). Let d = 0 + n. Suppose 5h + k + 1 = -3k, 3h - 25 = 4k. Solve 9 = -u + dj - 0, hj = 5u + 28 for u. -5 Let x(a) = -3a + 4a + 0a - 2. Let n be x(4). Suppose -10 = -2h - 3h. Solve 4f - nq + 16 = 0, -f + hq - 4 = -2q for f. -4 Let s be 23/7 + (-4)/14. Suppose sn + 5b = 5n + 23, 4b = -3n. Let m(f) = 2f2 + 3f. Let a be m(n). Solve 4k - a = -5h, 8 = 3h - h - 4k for h. 4 Let x be (198/27)/(-11)-32. Solve 0 = -4w + 2t + 2, 0 = -2w - 0w + 2t - x for w. 3 Suppose 4o = -q - 12, q = -5o + 2q - 6. Let a be 0 - -1 - 2o. Let x be (-4)/(-14) + (-24)/(-14). Solve 1 = -4m - 2y + a, -14 = -5m + xy for m. 2 Suppose -10 = 3a + 5. Let i = 22 - 14. Let s = i + a. Solve 5x - 3z - s = 0, 3x - 5x - 3z = -18 for x. 3 Suppose -4o = -108 + 48. Solve u - 3f = -o, -2f = 3u - 0f + 1 for u. -3 Suppose -3c = -8c + 25. Suppose -2r = -3 + 1. Suppose 4w = ci + r, 3w - 2w - 19 = -5i. Solve -wq + 2 = z + 6, 2z + 3q + 8 = 0 for z. -4 Let g(j) = -j - 10. Let l be g(-9). Let k be (-5 - -5)l/(-1). Solve -u + 5m - 10 - 10 = k, 0 = 3u - 4*m + 16 for u. 0 Let u	{ "pile_set_name": "DM Mathematics" }
Suppose m + 4d - 6 + 22 = 0, 2m - 4d - 16 = 0. Sort 1, w, m in ascending order. m, 1, w Suppose -12t + 5t - 7 = 0. Let s be (3 + -2)t(5 - 2). Put s, 2, 4, 5 in decreasing order. 5, 4, 2, s Let m(a) = -a3 + 13a*2 + a - 20. Let i be m(11). Let r = i - 247. Put -3, r, -2, 4 in decreasing order. 4, -2, -3, r Let j = -8222 + 8226. Let n = -18 + 20. Sort n, j, -1, 9 in descending order. 9, j, n, -1 Let g = -57 + 287/5. Let z be 21 + (-7 + 6)(-4 + 3). Sort z, 4, -0.1, g in ascending order. -0.1, g, z, 4 Let r = 43318 - 43377.994. Let d = r + -0.006. Let z = d - -60.2. Put z, 3, 7, -3 in descending order. 7, 3, z, -3 Suppose -165n + 458 = 128. Put -2, 3, -1, -18, n in decreasing order. 3, n, -1, -2, -18 Suppose -27 = l + 2l. Let m(c) = c3 + 9c*2 + 5c + 20. Let t be m(l). Let f = t + 22. Sort f, -4, -1. -4, f, -1 Let r(j) = -j + 1. Let d(t) = 17t + 35. Let s(k) = d(k) - 2r(k). Let a be s(-2). Put a, 0, 109, -3 in increasing order. a, -3, 0, 109 Let s = -147.41 + 148. Let i = -0.49 + s. Put -50, -3, i, -0.2 in ascending order. -50, -3, -0.2, i Let y = -23833/28 + 5967/7. Sort y, -29/3, -0.4, -4/3, 0.1 in descending order. y, 0.1, -0.4, -4/3, -29/3 Let o be ((-7)/(-1365)-6)/((-7)/((-21)/2)). Put 2, 1/5, o in increasing order. o, 1/5, 2 Let x = -14 + 12. Let h = -0.18 - -0.28. Suppose -v = 3v, 4a + 2v = 8. Sort 1/6, x, a, h in decreasing order. a, 1/6, h, x Let n = 3557 + -3552. Let o = -0.1 - -0.1. Let r = 6.18 + -0.18. Sort o, n, r in ascending order. o, n, r Let f be -1(1 - -1)/2. Suppose -t = -2d + 6 - 1, -4t + 12 = 0. Let o be 12/(48/34) - (-10)/20 - 6. Sort o, 0, d, f. f, 0, o, d Let b = -1871.7 + 1872. Let o = -432 - -431.91. Sort b, -1, o, -2/19. -1, -2/19, o, b Let t be ((-21)/28)/((-3)/(-3 - (-1 - -1))). Let v = 193/4 + -48. Put t, 5, v, -2 in ascending order. -2, t, v, 5 Let y = 4.1 + -0.1. Suppose -6 = -15a - 36. Let p(h) = 2h3 + 3h*2 + 5h + 9. Let t be p(a). Put 0.2, y, 0.04, t in ascending order. t, 0.04, 0.2, y Suppose -43 + 16 = -3v - 3b, -12 = 4v - 2b. Put -1, v, 58, -4 in increasing order. -4, -1, v, 58 Let b be (-36)/(-252) + 1398/14. Let m be b/75((-34)/(-20) + -2). Let a be 2/(-14) + 2/7. Sort m, a, 0.4, 0 in descending order. 0.4, a, 0, m Let v = 756.857 + -756. Put 0.1, -0.3, v, 4, 0.5 in decreasing order. 4, v, 0.5, 0.1, -0.3 Let b = 9506.2 + -9506. Sort -3, b, -122, 3 in descending order. 3, b, -3, -122 Let c = -11440/51399 + 2/5711. Sort -0.1, c, 4/5 in descending order. 4/5, -0.1, c Let z = -115/53 - -177/106. Let w = -2 - 3. Let j be 30/8 - (-21)/(-28). Sort j, w, 0, z in descending order. j, 0, z, w Suppose 2b - 34 = -2l - 38, -l + 5b - 14 = 0. Put l, 6, 1, -31, 4 in increasing order. -31, l, 1, 4, 6 Let u be (-3)/(6/(-4)) + -3. Suppose -6 = -4l + 14. Suppose 2k = lj - j + 16, -4j - 14 = -k. Sort 3, 1, j, u in descending order. 3, 1, u, j Suppose 0y + y + 10 = 0. Suppose -171 = -12f + 2m - 45, -5f = 3m - 87. Put 1, y, f in descending order. f, 1, y Let f = -482 - -484. Let d(y) = 0y - y - 3 + 4. Let u be d(-5). Put f, u, 4, -3 in descending order. u, 4, f, -3 Let t = 3042 - 3047. Put -0.3, t, -3/8, 9, -4 in ascending order. t, -4, -3/8, -0.3, 9 Let w = 8425 + -8402. Let o be (60/(-18))/(4/(-6)). Suppose 4d + o + 11 = 0. Sort d, -3, w. d, -3, w Let h = 42.6 + -34.6. Sort -2/5, h, 2/3. -2/5, 2/3, h Suppose -2i + 37u + 68 = 33u, -5i = -2u - 122. Sort 9, i, 1, 3, 0 in increasing order. 0, 1, 3, 9, i Suppose -22143z = -22142z - 15 - 2. Put 2, -5, z in descending order. z, 2, -5 Let h(l) = l*3 - 9l*2 - l + 9. Let j be h(9). Suppose 2o + 0o + 8 = j. Suppose 5f + 20 = 0, -3x - 4f = -7f - 24. Put x, 5, o, -5 in decreasing order. 5, x, o, -5 Let k = -84.13 + 85. Let a = -374 + 375.17. Let x = a - k. Sort -2, x, -4 in descending order. x, -2, -4 Let d be (-6 - 84/(-15))/(90/25 - 4). Put 2/15, -0.03, 11, -2/3, d in increasing order. -2/3, -0.03, 2/15, d, 11 Suppose 38s + 50s = 42s + 46. Put 0, -2, -235, s in descending order. s, 0, -2, -235 Let q = 16.5 + -14. Let k = q + -11.9. Let d = k - -9. Sort -5, d, 0.8 in decreasing order. 0.8, d, -5 Let a = 36.6 - 36.908. Let w = a - -0.408. Sort -1/7, -33, w in descending order. w, -1/7, -33 Let q = -0.2688 - 0.0312. Put q, 4, -1/3, -12 in descending order. 4, q, -1/3, -12 Let h(u) = 7u - 137. Let c be h(20). Suppose -3q = 12a - 9a + 132, -5a = cq + 138. Sort q, -5, -0.2, 3 in descending order. 3, -0.2, -5, q Let f(g) = -3g - 10. Let d be f(-4). Suppose du - 3u - 2 = 0. Suppose 15w = -10w - 125. Sort w, 4, 5, u in decreasing order. 5, 4, u, w Let o be -12 + (9 - (-7 + 13)). Let c be 1((o/3)/3 - 1). Sort c, 5, -5/4, 5/3. c, -5/4, 5/3, 5 Let g = -6209 + 6250. Put -2, -2/9, -9, g in decreasing order. g, -2/9, -2, -9 Let y = -76 + 46. Let u = -67 - y. Let b = u - -36.8. Put b, 3/2, 3 in descending order. 3, 3/2, b Let v = -10 - -7. Suppose -4d = 44, -33 = 441a - 437a + 3d. Sort a, -1, -4, v. -4, v, -1, a Let h = 42 - 42.3. Let i = 0.03683 - 0.23683. Let w = -0.5 - 2.5. Put h, w, i in ascending order. w, h, i Suppose 29n - 86n = 13n + 140. Sort 2, n, -1, 60. n, -1, 2, 60 Let v(s) = 6s*2 - 83s - 14. Let u be v(14). Sort u, 0.4, 4, -7 in ascending order. -7, u, 0.4, 4 Let h be (7/28)/((-3)/9). Put h, 69, 0 in ascending order. h, 0, 69 Let n = 993 + -949. Suppose 2s - 3b + n = 0, -36b + 41b = -4s - 66. Let a(m) = -m - 1. Let g be a(1). Put 3, s, 2, g in decreasing order. 3, 2, g, s Let s = 1/3 + -1/21. Let d = 8261.2 - 8262. Put 0.5, d, s in descending order. 0.5, s, d Suppose 12t - 10 = 7t. Let l = t + 30. Let v be (3 - (-9)/(-6))/(12/l). Sort 3, -1, 2, v in descending order. v, 3, 2, -1 Let w(i) = -i2 - 9i - 15. Let g(l) = -4l + 13. Let n be g(5). Let o be w(n). Let k be (1/o)/(2/(-2)). Put 0, -5, k in increasing order. -5, 0, k Let i(m) = 3m*3 + 53m*2 - 10m + 139. Let q be i(-18). Put q, -6, 1/50, 2/9 in descending order. 2/9, 1/50, q, -6 Let y be 54/10 + -1 + -4. Let b = 4776 - 4781. Put -2/7, 3/4, y, b in decreasing order. 3/4, y, -2/7, b Let a = 24 + -14. Suppose 4m + 13p - 31 = 10p, 0 = -5m - 4p + 40. Put a, m, -0.5, 2/9 in descending order. a, m, 2/9, -0.5 Let k = -489 + 311. Let d = 177.84 + k. Put 1, -0.3, 0.01, d in increasing order. -0.3, d, 0.01, 1 Suppose -2c + s - 9 = 0, -3c + 5s = -0s + 31. Suppose -1637w + 30 = -1634w + 5x, 170 = 2w - 5x. Sort 0, c, w in descending order. w, 0, c Let g = 1557 + -1575. Suppose 4z + 111 = -z - r, -113 = 5z + 3r. Let n = z - g. Sort n, 0, 1 in decreasing order. 1, 0, n Let w = 20542 - 20544. Let f be (-1 - 1) + 9/(-3). Put 0, w, 34, f in ascending order. f, w, 0, 34 Suppose 19g + 36 = -67 - 49. Put g, -5, -154/5 in decreasing order. -5, g, -154/5 Let f be (-31 + 19485/630)(-4)/(-3). Put 29, -0.04, f in descending order. 29, -0.04, f Let o be (-10 - -7) + -1 + 0. Suppose 10 = 5a - 4l, 5l - 6 = -3a - 0l. Suppose -101w + 47w = 57w + 111. Sort o, w, a, 0 in ascending order. o, w, 0, a Let b = -6 + 4. Let j be (-7)/(91/(-26)) - (6 - (-9 - -13)). Let g(c) = c2 - 6c - 3. Let p be g(6). Sort p, b, j, -0.2. p, b, -0.2, j Suppose 472t - 519t - 141 = 0. Let i be 0 + -3 - 81. Put i, t, 4 in increasing order. i, t, 4 Suppose -1 = -v + 3u, 3v - 4u = -5u - 57. Let i = -7 - -6. Let f be (-1 + 1)/(-1 + i). Sort f, 3, -2, v. v, -2, f, 3 Suppose -3p - 18 = 2s, -4s + 12 = 31p - 33p. Sort -3, -69, 4, s. -69, -3, s, 4 Suppose 0 = -16w + 174w + 632. Put w, 0, -1, 133 in decreasing order. 133, 0, -1, w Suppose 0 = 2w + 2w + 40. Let s(o) = -o + 1. Let y be s(w). Let x = -2.89 - 1.11. Sort 4, y, x in increasing order. x, 4, y Let c = -2468 - -2463. Suppose -5f = 4i - 9, -2i = 3f + 2i - 7. Sort f, -4, 4, c in decreasing order. 4, f, -4, c Let u be (32/(-14) - -2)/(-18 - 1397/(-77)). Sort u, -3/8, 18/113, -6 in increasing order. -6, u, -3/8, 18/113 Suppose -g - 4q = -1, -20g + 5q - 8 = -19g. Sort 4, 3, g, 5, -83 in decreasing order. 5, 4, 3, g, -83 Let d = 153785 - 153788. Let m be (-74)/(-14) + (-4)/14. Sort 7, m, d, 3 in decreasing order. 7, m, 3, d Let x be 2((-462)/(-12))/(-11). Put -4, 13, x in decreasing order. 13, -4, x Suppose 5 = -2a - u, 27 = 3u + 36. Put -14, a, 0.11, -2/3 in descending order. 0.11, -	{ "pile_set_name": "DM Mathematics" }
+ 1 - 1)(0f2 - f2 - f*2). -257f*2 - 2 Expand -1425q - 4 + 1609q - 3 + (2q + 3q - 6q)(-4 - 1 + 4) + 2q - q + q. 187q - 7 Expand (-4 + 5 + 1)(889o - 236 + 236 - 4928o). -8078o Expand l + 2l*4 - l - 2l*4 - 2l*4 + 2l*4 + 2l*4 - 2l*4 - 3l*4 + (110 - 246 + 106)(4l4 + 2l*4 - 5l*4). -33l*4 Expand -4 + 4 - 3a*2 + (-3 + 0 + 4)(a*2 - 4a2 + a2) - 6323 + 231a2 + 6323 + (2 + 0 - 4)(2a2 - 3a*2 + 3a*2). 222a*2 Expand ((-1 - 2 + 5)(-y + 4y + 0y) - 450y - 333y + 100y - 4y + 2y + 4y)(4y*2 + 0y*2 - 5y*2). 675y*3 Expand ((12 + 75 - 4)(r + r + 3r) + (-1 - 1 + 4)(2r + 0r - 3r))(-3r + 3r - 2r3). -826r*4 Expand (72i*2 + 238i - 238i)(-i + 0 + 0 + i - 3i - 5i + (2i + 1 - 1)(-5 + 3 + 4))(21 - 21 + 16i). -4608i4 Expand (14j - 2j - j)(3j - j - 4j + (3 - 5 + 7)(9j + 72 - 72)). 473j2 Expand (-1374709y*5 - 3 + 1374856y*5 + 2)(3 - 3 + 1). 147y5 - 1 Expand (96 + 26 + 79)(0 + 0 - 2i) + 4i - i - 2i - 343 + 40i + 343. -361i Expand (-f + 0f + 0f)(3 + 0 - 2) + 567 - 40319f - 10553f - 281 - 286. -50873f Expand (4q*2 + 0q*2 - 2q*2)(-141q + 139q - 2 - 21) - 18q3 - 13q*3 + 10q*3. -25q*3 - 46q*2 Expand 27 - 62t*3 - 65t3 - t2 - 18 - 14 + t3 + t3 - 3t3 + (-2 + 2t*2 + 2)(-2t + 2t + 2t) - t3 - t3 + 3t3 - t3 + t2 - t2. -124t3 - t2 - 5 Expand (40t*4 - 25t*3 + 25t*3)(2 - 2 + 4 + 2 + 3 - 4 + (-1 + 3 - 3)(4 - 3 - 3)). 280t*4 Expand (3c - 4c + 3c)(-2 + 1 - 4)(-5c3 - 6c + 6c)(c - 1 + 1). 50c5 Expand (-42 + 109 - 69 + 32p)(-1 + 0p + 0p + p). 32p*2 - 34p + 2 Expand (-9 + 5 - 4)(3t - 2t - 3t + (2t - 1 + 1)(-4 + 2 + 1) - 4t + 4t - 2t + (2 - 5 + 1)(102t + 649t + 12t)). 12256t Expand (100 + 805 + 0o + 122 - o)(-1 + 2 - 3). 2o - 2054 Expand (-15o + 7o + 25o)(-9o + 6o + 6o)(-4 + 2 + 4). 102o*2 Expand (-16 - 2 + 3 - 10)(-5a + 21a - 18a). 50a Expand (5f + 0 + 2 - 2f)(f + f + 0f + (0 + 1 + 2)(-6515 - 82f + 6515)). -732f2 - 488f Expand 2n3 - 5n*4 - 2n*3 + (2 + n - 2)(2n3 - 3n*3 + 3n*3) + 3n*4 - 3n4 + n4 + n*4 + 3n*4 - 3n*4 + 9n*4 + 8n*3 - 5n*3 - 10n*4. -2n*4 + 3n*3 Expand (-9293 + 9490 + 3927)(2m5 + 0m*4 + 0m*4). 8248m*5 Expand (0t - 2t + 4t)(0t*2 - 1029 + 1029 - 181t*3 + 2t*2 - 110t*3). -582t*4 + 4t3 Expand v5 - 4v5 + 0v*5 + (16v*4 + 2v*4 - 4v*4)(0v - v + 2v) + (6v4 - 2v*4 + 2v*4)(3 - 3 + 2v) + v5 + 2v*2 - 2v*2. 24v5 Expand -z2 + 22764 + 36z - 22764 + (2z - 5z + 5z)(-3z + 0z + 4z) + 2z - 2z + z*2. 2z*2 + 36z Expand (0 - 2 + 0)(4m - 5m - m) + 168m + 8 + 63m - 178m. 57m + 8 Expand (-2 + 2 + 2)(-3 + 3 + o*2) + 9o*2 - 5o*2 - 11o*2 + 170o - 170o - 8 + 13o*2. 8o*2 - 8 Expand (-2x + x - x)(2634x - 581x + 1464x + 12434x + 2728x). -37358x2 Expand (1 - 9 - 3)(6328 - 6328 - 66m) + 6m + 6m - 2m. 736m Expand (s + 0 + 0 + (-5s + 0s + 2s)(-2 + 2 - 10) + 0 + 0 + s)(1 - 9 + 1 + s). 32s2 - 224s Expand (-2 + 1 + 2 + (1 + 3 - 2)(0 + 4 + 10))(6v + 7v - 7v). 174v Expand (-2m2 - 1 + 1)(12m - 12m - 7m3) + 77m*5 - 23m*5 + 30m*5. 98m*5 Expand 15b + 2b4 - 15b + (4b - 4b - 2b2)(2b2 + 1 - 1) + 0b*4 + 7b*4 + 14b*4. 19b*4 Expand (-4v*2 - 5v*2 + 0v*2)(0 - 8v2 + 0) + 0v - 5v4 + 0v + (-2v - v + v)(-v3 + v3 + 2v3) - v4 + v4 - v4. 62v*4 Expand (15j - 72j2 - 15j)(-7 + 1 - 1) - 4j*2 + 5j - 5j. 500j*2 Expand (6 - 6 + 4)(20335 - 10171 - 10165 + 3465c). 13860c - 4 Expand (2n2 - 2 + 2)(-365n - 289n - 426n)(-1 + 1 - 5). 10800n3 Expand -8b - 80b3 + 80b*3 + 2b4 - b4 + 0b4 - b4 + (5b - 8b + 9b)(b + 2b*3 - b). 12b*4 - 8b Expand 33 - 33 + 9o3 + (6o - 2o - 2o)(173o*2 + 8877o - 8877o). 355o*3 Expand (-3f*2 + 2f*2 - f + 3f*2)(16f + 10f + 2f) - f3 - 1 + 0f3 - f3 + 14f3 - 7f*3 - 4f*3. 57f*3 - 28f*2 - 1 Expand (v + 0 + 0)(0v3 - 10v*3 + 0v*3 + (3v + 3v + 3v)(5v*2 - 4v + 4v)). 35v*4 Expand (-1 - 1 - 2)(-d*5 + 3d*4 - 22d*3 + 4d*4 - 8d4) + d5 + 3d5 + 2d*5. 10d*5 + 4d*4 + 88d*3 Expand (1523r + 199r - 166r)(5r*3 - 5r*3 + 2r*4). 3112r*5 Expand (-26v + 7v - 8v)(-39v*3 - 48v*3 + 23v*3). 1728v*4 Expand 2h*5 - 6h*5 + 2h*5 + ((-2h*2 + 3h*2 - 2h*2)(-12h2 + 29h*3 + 12h*2) + (-1 + 0 + 3)(-2h5 - h5 + 0h*5))(59 - 20 - 24). -527h5 Expand (-1121 + 2327 - 161r - 1189)(-r + 4r - 4r). 161r*2 - 17r Expand -5m + m - m + (22m - 34m - 21m)(-1 + 0 - 1). 61m Expand (0g2 - 4g*2 + 2g*2)(2g + 0g + 0g) + 63g*2 - 62g*2 - 292g3 + g2. -296g3 + 2g*2 Expand 618h*2 - 202h*2 + 85h*2 + (2h + 3 + 1 - 6)(-h + 2h + 6h). 515h*2 - 14h Expand (-3g + 3g - 2g2 - 2g*2 + 4g2 - g2 + (4 - 5 + 3)(2g*2 - 1 + 1))((10 - 4 - 10)(271 - 271 - 17g) - g + 0g + 2g). 207g3 Expand -47y + 47y + 22y*2 + 3y*2 + 2y - 2y + (-y + y + y)(14y - 298 + 298) - 2y - 2y2 + 2y. 37y2 Expand (-1 + 4 - 1)(-3d2 + 0d*2 + 2d*2) + 1 - 4683d + 2470d2 + 9381d - 4700d. 2468d*2 - 2d + 1 Expand (0 + 2 + 0)(5l - 4l - 3l + (-2 - 3 + 1)(-37l + 113l + 78l)). -1236l Expand ((-3 + 0 + 2)(-1 + 2u + 1) - u + u - u + (4u - 5u - u)(-4 + 5 + 1) - 3u - 5u + 2u + 2u - 2u - u)(4u - 87 + 169 - 87). -56u*2 + 70u Expand 5r3 + 2r*3 - 2r*3 + (-7r*3 + 12r*3 - 6r*3)(-16 - 5 + 5). 21r3 Expand 5r*3 - 5r*3 + 5r5 + (-r5 - 2r5 + 4r*5)(-2 + 7 - 1). 9r5 Expand (-111 + 4a + 111)(-a - a + 0a)(52 + 55 - 109 + 27a). -216a3 + 16a*2 Expand 5d*4 - 46d*5 + 26d*4 - 112d4 + (d3 - 6d3 + 3d*3)(0d2 - 4d*2 + 2d*2). -42d*5 - 81d*4 Expand (157 + 47j - 135 - 5j2 - 44j)(1 + 0 - 2 - 2j). 10j3 - j2 - 47j - 22 Expand (10615i - 2i*2 + 0 - 1 - 10595i)(0 - 7 + 0). 14i*2 - 140i + 7 Expand (-410 + 410 + 24a)((-5a + 2a + 5a)(-1 + 1 - 2) + 0a + 0a + 2a). -48a*2 Expand (-a + 0a + 0a + (0a - a + 0a)(-2 + 2 + 2) + 2a - 2a + a + a - a + a + 3a - 2a - 2a + 3a - a - 3a + 128a - 89 + 89)(-6 + 5a + 6). 625a2 Expand (3a - 10a + 0a)(a2 + 2a*2 - 2a2) - a3 - 3a3 + 3a*3 - 155a*3 + 77a*3 - 97a*3. -183a*3 Expand 16 - 16 - 9m*2 + 2m - 2m - m2 + (-1 + 1 - 1)(-m + m*2 + m) - 4m + 4m - m2 - 7m*2 + 2 + 11m + 13m2 - 11m*2. -17m*2 + 11m + 2 Expand (-159 - 112 + 113)(-7 + g + 2g*2 - 3g2 + 3) - g2 + 2g2 - 2g*2 + (2g*2 - g + g)(-3 + 2 + 0). 155g2 - 158g + 632 Expand ((-3o2 + 2o*2 + 0o*2)(-1978 + 1978 + 35o) + o3 - 3o + 3o)(o + 7o - 18 + 17). -272o*4 + 34o*3 Expand (9p + 36 - 36)(1 - 1 - 2)(-13 + 13 + 23p). -414p*2 Expand 5b - 10b - 4 + 7b + (2b + b + 0b)(1452 - 944 - 807). -895b - 4 Expand (-34i3 + 108i*2 - 108i*2 + (-5i + 3i2 + 5i)(-1 - 3 + 3)(58i - 38i - 45i))(1 + 0 - 3)(2 - 1 + 0). -82i*3 Expand (-2s*3 + 0s*3 + 0s*3)(3 - 5 + 1) - 1134 + 1134 + 6238s3. 6240s*3 Expand (4 - 1 - 2)(-w + 0 + 0) - 15w + 10w + 9w + 2w - 3w + 2w + (-2w + 3 - 3)(-1 + 2 + 1) + 0w + w + 3w + (3 - 2 - 2)(-1 + 1 - w) - 6w - 16 + 16. -w Expand -8w3 - 15w*3 + 15w*3 + (-w + 2w + 5w)(-5w - 5w*2 + 5w) + 8w3 + 105w - 105w. -30w*3 Expand (11 - 11 + 23l)(2 - 5 + 0) + 2l - 4l - l. -72l Expand -v4 - v4 + 0v4 + (-4v - 23 + 23)(-6v3 + v3 - 6v3) + (3v - v*2 - 3v)(-v2 + 3v*2 + 0v*2). 40v*4 Expand (3f - 5f + 0f)(-6f + 0f + 4f) + (-2906 + 58f + 2906)(2f - f - 2f)(23 + 2 - 6). -1098f*2 Expand (1 - 1 + 2)(-4 + 4 + 2w) + (0 + 0 + 2)(-54183w + 26126w + 35745w). 15380w Expand 3w2 - 2w*2 - 2w*2 + 9 + 13w*2 - 9 + 49w*2 - 5w*2 - 5w*2 + (-2w + 1 - 1)(w - w + 2w). 47w2 Expand ((0 - 4 + 2)(0r + 2r - 3r) - 822r - 309 + 582 - 272)(5 + 1 - 5). -820r + 1 Expand 9981177p2 - 9981177p*2 + 1175p*5 + (-3p - 4p + 5p)(2p*4 - 2p*2 + 2p*2) + 3p5 - p5 - p*5. 1172p*5 Expand (0o -	{ "pile_set_name": "DM Mathematics" }
when j is divided by d? 4 Let n = 87 + 13. What is the remainder when n is divided by 51? 49 Suppose -o + 50 = 4o. Suppose -o = -2m + 2. What is the remainder when 10 is divided by m? 4 Suppose -3w + 5w = -48. Let x be -3 + 4/(12/9). Let n = x - w. What is the remainder when n is divided by 9? 6 Let l be 2(-6)/(-4) - -124. Let n = 182 - l. Let a = -24 + n. Calculate the remainder when a is divided by 8. 7 Let n(r) be the first derivative of -r2 - 3 - 2r*2 - 1 + 4r + 4r2. Calculate the remainder when 39 is divided by n(5). 11 Suppose -2g + 5f = -7g + 60, 2g = 3f + 9. Let v = -137 - -97. Let b = -6 - v. What is the remainder when b is divided by g? 7 Suppose -56 = -60b + 58b. Let l(a) = a*3 - 4a. What is the remainder when b is divided by l(3)? 13 Let b(v) = v - 1. Let n be b(6). Suppose c + c + 5p - 125 = 0, -5c + 290 = np. Let x = 63 + -44. Calculate the remainder when c is divided by x. 17 Let l = 55 + -37. Calculate the remainder when 70 is divided by l. 16 Suppose 2g + 5v - 272 = 122, 4g - 824 = -v. Calculate the remainder when g is divided by 42. 39 Suppose 3d + d = 20. Suppose -dm + 265 = t, 0 = -6m + m + 3t + 245. What is the remainder when m is divided by 18? 16 Let u(l) = 7l - 5l2 - 6 + l3 - 1 + 1. Let b be u(4). Suppose 0 = 2o - 14 - b. What is the remainder when 28 is divided by o? 8 Let s = -59 + 83. Suppose -5p + 8p - s = 0. Calculate the remainder when (-7)/((4 - 2)/(-4)) is divided by p. 6 Suppose -2q + 69 - 21 = -4h, -2q + 3 = 5h. Suppose -5o + 3o = -q. Let p(v) = v3 + v2 + v - 1. What is the remainder when p(2) is divided by o? 6 Let s = 6 - 4. Suppose 0 = sw - 35 - 53. What is the remainder when w is divided by 12? 8 Let n(b) = b + 6. What is the remainder when 52 is divided by n(12)? 16 Suppose -p = 2p - 12. Suppose 6 = -3x + px. Let a = 2 - 0. What is the remainder when x is divided by a? 0 Suppose -501 = -5r - 4w, r - 43 - 74 = -5w. Calculate the remainder when r is divided by 25. 22 Let v = 7 - 4. What is the remainder when 62/3 - (-1)/v is divided by 6? 3 Let a(y) = -9y - 1. Let k be a(-1). Let m = -1 + k. Calculate the remainder when m is divided by 2. 1 Let s(t) = 2t + 2. Calculate the remainder when s(12) is divided by 14. 12 Let s be -2((-27)/6 - -2). Suppose 5z = -o + 7 - 17, -4z = so - 13. Calculate the remainder when 17 is divided by o. 2 Let f(q) = -q + 5. What is the remainder when f(-6) is divided by 7? 4 Suppose 14 = 9s - 31. Let f(b) = 3 - 3b*2 - 2 + 2b + 1 + b*3. What is the remainder when s is divided by f(2)? 1 Calculate the remainder when 6 is divided by 1/2 + (-12)/(-8). 0 Suppose -9w + 90 = 6w. Calculate the remainder when 22 is divided by w. 4 Let s(g) = 2g*2 - 5g - 1. Let x = 14 - 9. Suppose -5h + 90 = -0p + 2p, -3p + 85 = xh. What is the remainder when h is divided by s(4)? 9 Suppose 183 = 5k + 2v, -2v - 51 - 46 = -3k. Calculate the remainder when 102 is divided by k. 32 Suppose -14 - 96 = -5h. What is the remainder when h is divided by 12? 10 Let q = -7 - -12. Let r(i) = -i*3 + 6i*2 + 2i + 6. Calculate the remainder when r(q) is divided by 14. 13 Suppose -2b + 2k - 6 + 2 = 0, -k + 6 = 3b. Let h be b/(-2)6 - 6. Calculate the remainder when 20 is divided by ((-6)/h + 3)3. 9 Let b(f) = -61f - f*3 + 7f*2 + 61f. Calculate the remainder when b(4) is divided by 17. 14 Suppose -3j + 13 - 1 = -5z, 0 = 2z - 5j + 20. Suppose -4f + 80 + 8 = z. What is the remainder when 41 is divided by f? 19 Suppose 0 = 5t - 4f - 353, 5t - 354 = -f + 14. Calculate the remainder when t is divided by (-1 - 4/(-6))/((-14)/798). 16 Let j be (14/7)/((-2)/31). Let i = j + 47. What is the remainder when 61 is divided by i? 13 Let j = 36 + -22. Calculate the remainder when j is divided by -12/(4/(-10)). 4 Calculate the remainder when 3/(-14/(-104)) is divided by 20. 18 What is the remainder when (-2 + 68/8)6 is divided by 8? 7 Suppose j + 5z = -18, 4z + 0z = -j - 14. Suppose 5y + j - 22 = 0. Suppose 0 = ym + 2 - 54. What is the remainder when 37 is divided by m? 11 Let c(u) = u*3 + 6u*2 - 3u - 5. Let r = 49 - 25. Calculate the remainder when r is divided by c(-6). 11 Let i(q) = -3q3 - 4q - 5. What is the remainder when 80 is divided by i(-2)? 26 Let d(m) = m*2 + 8m - 34. What is the remainder when 27 is divided by d(-12)? 13 Let z(f) = -f*3 + 6f*2 + 5f - 4. Let n be z(6). Suppose -5r - 9 - n = 0. Calculate the remainder when ((r - -2) + 3)-17 is divided by 9. 7 Let m = 15 + 155. Suppose 3w = -2w + m. Let u = 58 - w. Calculate the remainder when u is divided by 13. 11 Let a = 9 - 7. Suppose 2t - 2p - 44 = 0, -p + ap - 113 = -4t. Calculate the remainder when t is divided by 7. 6 Let y = 44 - 26. What is the remainder when y is divided by 5? 3 Let a be ((-9)/(-4))/(3/(-24)). Let v = 34 + a. Suppose 5q - 3 = 3y + 36, -4q = -5y - 26. What is the remainder when v is divided by q? 7 Suppose 0 = 3k - 5 - 1. Suppose kw + 2j - j = 23, 5w - j = 47. Let c = -8 + 47. What is the remainder when c is divided by w? 9 Calculate the remainder when (20/(-2))/(1/(-4)) is divided by 14. 12 Suppose -y = -2c - 31, 0y + 4y + 3c - 157 = 0. Suppose -2l - 4t = l - 59, 4l = 2t + 42. Calculate the remainder when y is divided by l. 11 Let d(m) = 4m2 + 5m + 16. Calculate the remainder when 146 is divided by d(-3). 35 What is the remainder when 87 is divided by 1 - -1412/8? 21 Suppose 8 = -2v + 26. Let s = 52 - 82. Let j = s - -47. What is the remainder when j is divided by v? 8 Let h = -2 - -6. Let m = 10 - 16. Calculate the remainder when h is divided by (0 - -1) + (-6)/m. 0 Let q(s) = s*2 - s - 1. Suppose -7p + 5p + 14 = 0. Calculate the remainder when q(-4) is divided by p. 5 Let t = 1 + 0. Let r = t - -5. Calculate the remainder when r is divided by 2. 0 Suppose 0 = u - 20 - 25. What is the remainder when u is divided by 6? 3 Let o = 5 - 1. Let r be (o/(-4))/((-2)/8). What is the remainder when (r/(-8))/((-2)/4) is divided by 1? 0 Suppose -66 = -6k + 216. Calculate the remainder when k is divided by 12. 11 Let k(h) = h*3 + 2h*2 - 2h - 6. What is the remainder when 55 is divided by k(3)? 22 Let c(x) = x*3 + 8x*2 + 12x + 22. Calculate the remainder when 174 is divided by c(-6). 20 Let p = 32 + 21. What is the remainder when p is divided by 28? 25 Suppose -310 = -5k + 3d, -4k = -3d - d - 248. What is the remainder when k is divided by 21? 20 Let d be (4 + -1)/((-9)/24). Calculate the remainder when 15 is divided by ((-4)/(-2)d)/(-2). 7 Suppose -k - 3k = 0. Let m be (k + 1)(-87)/(-3). Suppose -q + 17 = -5f, 7f + m = 2q + 2f. Calculate the remainder when 34 is divided by q. 10 Let n be 6/9 - 4/(-3). Suppose -nq + 8 = 0, 2l - 79 = -3l - q. What is the remainder when 43 is divided by l? 13 Let t(s) = -5s + 5. Let w = 0 - 0. Suppose -5f = -b - 26, 4b + wb + 2f = -16. Calculate the remainder when t(b) is divided by 18. 17 Suppose 80 = -2j + 4j. What is the remainder when j is divided by ((-21)/4)/((-3)/8)? 12 Suppose 3x - 4x = -11. Let b be 2/(-4) + (-1)/(-2). Suppose b = -4g + 2g + 40. Calculate the remainder when g is divided by x. 9 Let d be (-1)/(-1)7-2. Let x = 22 + d. Calculate the remainder when 4/(-16) + 202/x is divided by 13. 12 Let d be 91/2 + 4/(-8). Let u = d + -32. Calculate the remainder when 36 is divided by u. 10 Let v(r) = r2 + r - 8. Let y = 13 + -3. What is the remainder when y is divided by v(-4)? 2 Let b(d) = -2d + 26. What is the remainder when 98 is divided by b(0)? 20 Suppose 4u = -i + 15, -3i + u - 12 = -70. What is the remainder when 92 is divided by i? 16 Suppose x + 0r + 2r = 6, -5r - 39 = -2x. What is the remainder when 58 is divided by x? 10 Suppose -p + o - 5o + 6 = 0, -3o - 43 = -4p. Calculate the remainder when 28 is divided by p. 8 Let j(t) = -t2 + 3t + 4. Let n be j(3). Let w(z) = z*2 - 2z*2 + 7z - 9 - nz + 2z*2. What is the remainder when w(-7) is divided by 10? 9 Let d(r) = -r + 12. What is the remainder when 25 is divided by d(3)? 7 Let d(i) be the third derivative of 23i5/60 - i2. What is the remainder when d(1) is divided by 12? 11 Suppose 4l = -9 + 25. Suppose lq - 3q - 39 = 0. Suppose -2z + 9 = -5*v	{ "pile_set_name": "DM Mathematics" }
out replacement from {t: 5, h: 14}. Give prob of picking 1 t and 1 h. 70/171 Calculate prob of picking 1 k and 1 y when two letters picked without replacement from {x: 6, i: 3, y: 5, q: 2, k: 2}. 10/153 Three letters picked without replacement from {h: 1, u: 4, x: 2}. What is prob of picking 2 x and 1 h? 1/35 Calculate prob of picking 1 s and 1 k when two letters picked without replacement from gsegygygssghskgsh. 5/136 Calculate prob of picking 1 u, 1 b, and 2 z when four letters picked without replacement from bmeizziizibzube. 6/455 Three letters picked without replacement from {o: 2, v: 3}. What is prob of picking 2 v and 1 o? 3/5 Three letters picked without replacement from hyyh. What is prob of picking 1 y and 2 h? 1/2 Four letters picked without replacement from {f: 3, i: 1, m: 3}. What is prob of picking 1 i and 3 f? 1/35 Three letters picked without replacement from dxdxh. What is prob of picking 2 d and 1 x? 1/5 What is prob of picking 1 n and 2 r when three letters picked without replacement from nrrnxlnnrnnpnlnnnln? 11/323 Calculate prob of picking 1 f and 1 q when two letters picked without replacement from qmqkmqqwmfqk. 5/66 Four letters picked without replacement from {k: 1, c: 3, p: 2, d: 4, q: 7}. Give prob of picking 1 k, 1 q, and 2 p. 1/340 Calculate prob of picking 4 z when four letters picked without replacement from {z: 10, h: 4}. 30/143 Two letters picked without replacement from {t: 16, j: 1, u: 1}. What is prob of picking 1 t and 1 u? 16/153 What is prob of picking 3 b and 1 v when four letters picked without replacement from khkvvkkvthkbtktvb? 0 What is prob of picking 2 f and 1 p when three letters picked without replacement from {i: 1, f: 2, j: 1, k: 2, n: 2, p: 1}? 1/84 What is prob of picking 1 m and 2 z when three letters picked without replacement from {q: 2, z: 2, m: 1, l: 1, p: 2}? 1/56 Three letters picked without replacement from {e: 12, r: 6}. What is prob of picking 2 e and 1 r? 33/68 Two letters picked without replacement from rrwvuwuwwww. What is prob of picking 1 r and 1 v? 2/55 Calculate prob of picking 1 x and 2 l when three letters picked without replacement from {l: 11, x: 5}. 55/112 What is prob of picking 1 o, 1 x, and 1 d when three letters picked without replacement from vxdxjxodxdjdoxxdox? 35/272 Calculate prob of picking 1 d and 1 e when two letters picked without replacement from {v: 1, d: 1, n: 1, e: 1, g: 1}. 1/10 Three letters picked without replacement from {j: 2, g: 1, d: 5, b: 1}. Give prob of picking 2 j and 1 d. 5/84 Four letters picked without replacement from {z: 2, x: 2, j: 1, g: 1}. What is prob of picking 2 z, 1 x, and 1 g? 2/15 Three letters picked without replacement from {c: 1, g: 9, z: 1}. What is prob of picking 3 g? 28/55 What is prob of picking 1 j, 1 v, 1 a, and 1 b when four letters picked without replacement from {j: 2, b: 2, d: 1, a: 1, v: 1}? 4/35 What is prob of picking 1 r and 1 j when two letters picked without replacement from {i: 1, p: 1, r: 1, s: 1, j: 1}? 1/10 Calculate prob of picking 1 j, 1 t, and 1 p when three letters picked without replacement from {f: 1, q: 4, p: 2, t: 2, j: 3}. 3/55 Calculate prob of picking 2 x when two letters picked without replacement from ddxxx. 3/10 What is prob of picking 3 p when three letters picked without replacement from {b: 11, p: 5}? 1/56 Calculate prob of picking 1 g and 2 o when three letters picked without replacement from {o: 6, g: 2}. 15/28 What is prob of picking 1 i and 1 w when two letters picked without replacement from micwycg? 1/21 Calculate prob of picking 1 z and 1 w when two letters picked without replacement from {y: 1, z: 1, w: 1}. 1/3 Three letters picked without replacement from {a: 1, f: 3, k: 2, n: 1, y: 1, z: 4}. Give prob of picking 2 k and 1 y. 1/220 Three letters picked without replacement from pddddppd. Give prob of picking 3 d. 5/28 Calculate prob of picking 3 t and 1 p when four letters picked without replacement from {c: 2, p: 4, t: 4, x: 1, q: 3}. 16/1001 Three letters picked without replacement from {e: 4, v: 14}. What is prob of picking 3 v? 91/204 Four letters picked without replacement from bblblcbebgeeebgl. Give prob of picking 1 c, 1 e, and 2 g. 1/455 Four letters picked without replacement from {j: 2, u: 6, f: 5, k: 2, h: 3}. What is prob of picking 3 f and 1 k? 1/153 Three letters picked without replacement from qchhchqhqchhch. Give prob of picking 1 q and 2 h. 9/52 Four letters picked without replacement from {n: 5, y: 8}. Give prob of picking 1 y and 3 n. 16/143 Three letters picked without replacement from {d: 4, a: 1, h: 2, t: 6, i: 3}. Give prob of picking 2 h and 1 d. 1/140 Calculate prob of picking 1 r and 1 c when two letters picked without replacement from crhrccrrcrc. 5/11 Four letters picked without replacement from ccccc. What is prob of picking 4 c? 1 Two letters picked without replacement from knknlblnhbpp. Give prob of picking 2 b. 1/66 Four letters picked without replacement from flfdfllfdf. Give prob of picking 3 l and 1 f. 1/42 Calculate prob of picking 2 m when two letters picked without replacement from cmcmccmmmmm. 21/55 What is prob of picking 2 s when two letters picked without replacement from {a: 2, s: 7, y: 9}? 7/51 Calculate prob of picking 1 c and 3 x when four letters picked without replacement from ccxxccccxcx. 14/165 Calculate prob of picking 3 i when three letters picked without replacement from {i: 3, g: 2}. 1/10 What is prob of picking 1 y and 1 i when two letters picked without replacement from {i: 2, l: 1, y: 1}? 1/3 Four letters picked without replacement from {b: 2, f: 3, n: 2, r: 1, u: 12}. Give prob of picking 1 b, 1 u, and 2 f. 24/1615 Calculate prob of picking 1 l, 1 u, 1 t, and 1 y when four letters picked without replacement from {y: 2, u: 2, l: 1, k: 1, e: 1, t: 1}. 2/35 Three letters picked without replacement from htthwth. Give prob of picking 1 h and 2 t. 9/35 Four letters picked without replacement from tttpptvppttv. Give prob of picking 2 v, 1 t, and 1 p. 8/165 Calculate prob of picking 2 p and 2 j when four letters picked without replacement from {p: 1, j: 1, v: 2}. 0 Three letters picked without replacement from {d: 7, b: 1, p: 5, w: 1}. What is prob of picking 1 b and 2 d? 3/52 Four letters picked without replacement from {w: 2, j: 7, i: 5}. What is prob of picking 1 w and 3 i? 20/1001 What is prob of picking 4 t when four letters picked without replacement from tttrtcttcttrttttntmr? 143/969 What is prob of picking 1 o and 1 w when two letters picked without replacement from {o: 1, j: 4, w: 2}? 2/21 Four letters picked without replacement from {v: 9, h: 4, s: 4}. Give prob of picking 1 h, 1 v, and 2 s. 54/595 Three letters picked without replacement from {l: 3, s: 9}. Give prob of picking 3 s. 21/55 Three letters picked without replacement from hhhphpl. What is prob of picking 1 h and 2 p? 4/35 Two letters picked without replacement from {e: 3, p: 8, s: 4, l: 2}. What is prob of picking 2 e? 3/136 Calculate prob of picking 1 h and 2 s when three letters picked without replacement from sssssssshssssssshss. 16/57 Calculate prob of picking 2 n when two letters picked without replacement from nunnnnnu. 15/28 Two letters picked without replacement from {l: 3, g: 7, x: 2}. Give prob of picking 2 g. 7/22 What is prob of picking 1 t, 1 j, and 1 q when three letters picked without replacement from qjvtjke? 2/35 What is prob of picking 1 d and 3 q when four letters picked without replacement from dqddiiiqddddqi? 1/143 Three letters picked without replacement from {r: 7, z: 4}. What is prob of picking 1 r and 2 z? 14/55 What is prob of picking 1 b, 1 i, and 1 h when three letters picked without replacement from zbbbiqbihmbbbb? 4/91 Four letters picked without replacement from lzwwlwwlkkwzzkklwz. Give prob of picking 3 k and 1 l. 4/765 Two letters picked without replacement from lbondll. What is prob of picking 1 n and 1 l? 1/7 Two letters picked without replacement from {c: 4, e: 9, g: 3}. Give prob of picking 1 c and 1 g. 1/10 Calculate prob of picking 3 f when three letters picked without replacement from {f: 17, y: 1}. 5/6 Calculate prob of picking 2 d when two letters picked without replacement from {d: 15, p: 5}. 21/38 Calculate prob of	{ "pile_set_name": "DM Mathematics" }
-0.05? -31 What is the fourth smallest value in -1/107, 0.13, -0.4, -5, -37, 0.5? -1/107 What is the fifth biggest value in 1, 4, -104, 12, 0, 2? 0 What is the smallest value in 4/5, -7, -2/2699? -7 What is the biggest value in 17.3, 2/753, -4/7? 17.3 What is the smallest value in -5, -101/5, 1, -32? -32 Which is the fourth smallest value? (a) -5 (b) 0.2 (c) 1 (d) -0.167 (e) 3 (f) -0.88 b What is the third smallest value in 0, 0.084, -0.16, 10, 4/3? 0.084 What is the biggest value in 2.4, 1/2, -0.1, 0, -54? 2.4 What is the third biggest value in 3/2, 0, 317, -3? 0 What is the smallest value in 2, 3/8, 1/16718? 1/16718 What is the second biggest value in 3, -23754, -6? -6 What is the biggest value in -1.116, 3/244, 0.2, -2/3? 0.2 Which is the biggest value? (a) 0.2 (b) 0.08 (c) -4/3 (d) -12/13 (e) -6 a What is the fourth biggest value in 2, 12, 149, -0.4, 1/15? 1/15 What is the third biggest value in 1.8, -2, -0.5, -0.2? -0.5 What is the second biggest value in 3, 31, 10, -4? 10 Which is the second smallest value? (a) -2/11 (b) -2/67443 (c) -2 a What is the smallest value in -1/7, 93, 2, -0.4, -40/9, -4? -40/9 What is the third smallest value in 32861, 2/19, -5, 3/2, 2/21? 2/19 Which is the fifth biggest value? (a) -3/5 (b) -4/7 (c) 0 (d) 2/9 (e) 102 (f) -4 a Which is the second biggest value? (a) -10 (b) -40214 (c) 2 a What is the third smallest value in 1107, -4, 0.5? 1107 What is the smallest value in 0.3, 6/383, -6? -6 What is the fifth biggest value in 6625, 1.5, -0.5, -4, -2? -4 Which is the smallest value? (a) -0.6 (b) 5 (c) 7/29 (d) 4 a Which is the second biggest value? (a) -10/9 (b) -67 (c) 19 (d) -21 a Which is the biggest value? (a) 1/14 (b) 2 (c) 43 c Which is the sixth biggest value? (a) 33 (b) -2 (c) 2/15 (d) 4/5 (e) -1/6 (f) -0.8 b What is the fifth smallest value in -0.2, 5, -5/8, -3, 0.2, 137? 5 Which is the smallest value? (a) 25 (b) 257 (c) -0.3 c What is the smallest value in 2/29, 1, -3, -4/7, 3.207, 0? -3 Which is the smallest value? (a) -1 (b) 1 (c) -23/5 (d) -1175 d What is the third biggest value in 1/6, 0.25, 1, -1? 1/6 Which is the third smallest value? (a) 73 (b) 3 (c) 105.3 (d) -0.1 a Which is the third smallest value? (a) 0.0001 (b) 1 (c) -1281 b Which is the fifth biggest value? (a) -0.2 (b) -2/5 (c) -9 (d) 147 (e) 1 c What is the smallest value in -66, -136, -0.4, 2/9? -136 What is the third biggest value in 2, 3, -4/9, 0.376? 0.376 Which is the sixth biggest value? (a) -3/1394 (b) -7 (c) -1/3 (d) -1/2 (e) 5 (f) -1 b Which is the third smallest value? (a) -11/4 (b) 0.5 (c) 7 (d) -0.1 (e) 1 b What is the fourth smallest value in -7, 98, 0.2, 59, -3/4? 59 Which is the third biggest value? (a) 625 (b) 0 (c) 1 (d) 8/3 (e) -0.4 c Which is the fifth smallest value? (a) -2/9 (b) 1/17 (c) -2 (d) 1/3 (e) 4 (f) 10 e What is the third biggest value in 0.5, -10, -2, 197? -2 What is the fifth biggest value in 0.7, 0.03, -17, 2/9, -0.12, -4? -4 What is the biggest value in 24, 4, 1143, 2/7, 1, -2/15? 1143 What is the fifth biggest value in -9/7, 288, 0.1, 5, 1? -9/7 Which is the smallest value? (a) -1/4 (b) -0.9 (c) 0 (d) -4.2 (e) 225 d Which is the third biggest value? (a) -5/4 (b) 87 (c) -1 a What is the third smallest value in -3/5, -1/10, 3/34, -5/3? -1/10 Which is the smallest value? (a) 0.2 (b) 74 (c) -0.0119 c What is the fourth biggest value in 6/11, -14/3, -10, -2/21, -5, -8? -5 What is the second smallest value in 0.3, -1/103, -0.2, 29.7? -1/103 What is the fourth biggest value in -0.039, 0.7, 0.06, 0, 0.2? 0 Which is the fourth smallest value? (a) 1/2 (b) 5 (c) -5 (d) 4 (e) -0.007 (f) -0.8 a Which is the third smallest value? (a) -16/5 (b) 57 (c) -1/9 (d) -0.4 c Which is the fourth smallest value? (a) 2/3 (b) 1.4 (c) 3/7 (d) -1/36 (e) 26 b What is the third biggest value in -1/5, -0.05, -5, 6, 0? -0.05 What is the second smallest value in -0.11, -0.29, -0.2, -1, -3? -1 What is the second smallest value in 1964, -3, -0.2? -0.2 Which is the fourth smallest value? (a) 8 (b) -0.08 (c) 3 (d) -5/33 (e) 0.5 (f) 0 e Which is the fourth biggest value? (a) 0 (b) 0.3 (c) -2/25 (d) -8 (e) -5 e What is the sixth biggest value in 2/3, 0.1, -7.3, 0.4, 1/7, -0.3? -7.3 What is the fifth biggest value in -3, -4/7, 16, 19, 127? -3 Which is the fifth smallest value? (a) -1/30 (b) -1 (c) -2 (d) -0.3 (e) 13/3 e Which is the third smallest value? (a) 2.87916 (b) -5 (c) 0 (d) 3 a What is the second biggest value in -2/3, -3, -12/7, 118? -2/3 Which is the third smallest value? (a) 3 (b) -0.04 (c) -4/7 (d) 1893 a Which is the fourth biggest value? (a) 6/5 (b) -7 (c) -5/2 (d) -26 (e) 1/8 (f) -4/5 c Which is the biggest value? (a) 2/7 (b) -0.22 (c) -0.24148 a Which is the third biggest value? (a) 1/4 (b) -0.1 (c) 3 (d) -5 (e) -2 (f) 66 a What is the third biggest value in 3, 6/209, 0.4, -5, 2/15? 2/15 What is the third smallest value in 2/3, -18/71, -0.1? 2/3 What is the biggest value in -0.13, 0.02, 2/11, -63, -0.2? 2/11 What is the second smallest value in -1/4, 0.4, -1190/11? -1/4 What is the second biggest value in 1.1, 90, -120? 1.1 Which is the second biggest value? (a) 6 (b) -0.25 (c) -27 (d) 1/6 (e) -4 d Which is the biggest value? (a) -4 (b) -3/8 (c) 6/7 (d) -37 c Which is the smallest value? (a) -4 (b) 120 (c) 20/21 a What is the biggest value in -0.1, 4/7, 0.03, -0.4, -4? 4/7 Which is the third biggest value? (a) -5 (b) -17 (c) 787 b Which is the fourth biggest value? (a) -1/9 (b) -8 (c) 3 (d) 0.404 b Which is the biggest value? (a) 3/2 (b) -2/9 (c) -490 (d) -37 (e) 3 e Which is the smallest value? (a) 11 (b) -2/17 (c) -0.5 (d) 1/261 c Which is the second biggest value? (a) 2717 (b) -3.5 (c) 0.3 c Which is the smallest value? (a) -1 (b) 6670 (c) -2 (d) -138 d What is the fourth smallest value in 1/4, 3.3, 2/5, -118, 3? 3 Which is the second smallest value? (a) -1/98 (b) -1 (c) 3 (d) 1.74 a Which is the fourth smallest value? (a) -2 (b) 2 (c) -1869 (d) -0.3 (e) 7 b Which is the fifth smallest value? (a) -0.3 (b) 1/4 (c) -0.6528 (d) 0.1 (e) -2/5 b Which is the third smallest value? (a) 11.3 (b) -4 (c) 3/8 (d) -2/13 c Which is the third biggest value? (a) 3 (b) -2 (c) 0.5 (d) -4/49 (e) -0.039 (f) 0.1 f Which is the third smallest value? (a) 10/3 (b) -5 (c) 3 (d) 1/4 (e) 1 (f) -0.1 d What is the second smallest value in 3, -0.131, -4/7, -0.4, -3, 15? -4/7 What is the fourth smallest value in 3/5, -16, -8, -6? 3/5 What is the third biggest value in 1/5, -1.52, -2/5, 1.41? -2/5 What is the biggest value in 21872, 32, -1/4, 4? 21872 What is the fifth biggest value in -5, 1498, 9, 1/2, -0.3? -5 What is the third biggest value in 1/5, 1.8, -19.9? -19.9 Which is the second biggest value? (a) 1/5 (b) -18195/7 (c) 1 a Which is the fourth smallest value? (a) 1/3 (b) 0 (c) -4 (d) -6 (e) 1051 (f) -0.01 b Which is the fifth biggest value? (a) -4 (b) 3/4 (c) 1 (d) -471 (e) 32.7 d Which is the biggest value? (a) -1069 (b) 4 (c) 28 (d) 2/13 c What is the second biggest value in -0.02, -1, -4/5, 3, -4/13? -0.02 Which is the third biggest value? (a) -99 (b) 104/207 (c) -1/3 a Which is the smallest value? (a) 125/29 (b) 0.3 (c) -7 c What is the biggest value in -2/9, -5815, -0.1? -0.1 What is the second smallest value in -4, 3/5, 0.4, -2094? -4 What is the third smallest value in 0.07, -5, -0.3, 7/22? 0.07 What is the second smallest value in -0.2, 203/3, 2/17, -4/29, -1, 0? -0.2 Which is the third biggest value? (a) -1/5 (b) 1 (c) 2/5 (d) -6 (e) 2/9 e What is the second smallest value in -76, 2/13, -0.1, 2/11, -0.3? -0.3 What is the fourth biggest value in 10.333, 2, 4, 1/4? 1/4 Which is the second biggest value? (a) -2 (b) -1.4 (c) -0.05 (d) -2/3 d Which is the third biggest value? (a) -7/3 (b) 0.1 (c) -9 (d) -1 (e) 2/49 (f) 4/5 e What is the smallest value in 1, -5, 326, 2/7? -5 Which is the smallest value? (a) -2/63 (b) 0.2 (c) 11 (d) -3 d Which is the second smallest value? (a) -2 (b) 24 (c) 0.4 (d) -0.3 (e) -8/5 (f) 4/3 e Which is the fourth smallest value? (a) -2/11 (b) 1/5 (c) -0.2	{ "pile_set_name": "DM Mathematics" }
)? 5 What is the value of 12/(-63)-3(-7)/(-6)? 2/3 77/(-28)-2 + -7 -3/2 Calculate (81/45)/9 + 0/(-3). 1/5 Evaluate 4(102/(-24) - -4). -1 (2 - (-36)/(-14)) + (-30)/21 -2 Calculate (-38)/285(-18)/8. 3/10 What is 1/513 + 6/15? 3 Evaluate (-286)/99 + (-3)/(-1). 1/9 18/36(-16)/(-2) 4 Calculate (2/36)/((-4)/6 - -1). 1/6 Calculate (-156)/30 - (-5 - 0). -1/5 What is ((-9)/24)/((76/32)/19)? -3 (-48)/(-45)(-15)/(-12) 4/3 (3 + -5)(180/(-8))/9 5 Calculate 34/9 + -2 + -2. -2/9 What is 16/(-12)3 - (-48)/18? -4/3 Evaluate (-16)/(-5) + 3/(-15)1. 3 Evaluate 0 + (-24)/6 - 63/(-15). 1/5 What is (-27)/12 + (3 - 1)? -1/4 What is 6/15(-3)/(24/(-10))? 1/2 Evaluate ((-24)/36)/((-2)/(-3)). -1 What is (-10 - 3)/268? -4 What is -1 - 4 - (-71)/(26554/1848)? -1/17 What is the value of 10/(-3)24/20? -4 Calculate (-3)/30 - 15/(-30). 2/5 Calculate ((-10)/(-6))/((110/15)/(-22)). -5 What is ((1058/115)/23)/(2/(-40))? -8 What is the value of (-38/(-42))/(1606/511)? 2/11 What is (7/(-189))/(3/(-9))? 1/9 Calculate (3/30)/((-15)/60). -2/5 What is (1/(-4))/((-213)/284)? 1/3 Evaluate 4 - (0 - 2 - -1). 5 ((-6)/(-28))/(21/56) 4/7 What is the value of 35 + -35 + (-2 - -2)/(-2)? 0 What is the value of (-49)/(-7) - (-1 + 7 + -3)? 4 Calculate (33/22)/((-3)/2). -1 (-5)/(-6) + (-2960)/3885 1/14 6/(-2) + 4 + 12 3 What is 418/108 - 32/30? -2/5 What is the value of (1 - 0)/(-212/16)? -2/3 Calculate 275/(-125) - 18/(-15). -1 Calculate (-7)/(-28)0 + 5. 5 ((-12)/(-3))/(-51 + 5) -2/23 Calculate -15 + 23 + 3/(1 + -2). 5 What is the value of (-1 + 0)/((-37)/(-37))? -1 -8 - -3 - (-2 + 1) -4 What is (-3 + (-23)/(-6))27/(-30)? -3/4 Calculate ((-756)/(-208))/9 + (-6)/39. 1/4 1/(-24/324) -1 ((-38)/6 - -2) + 24/18 -3 What is 10/(-12) + 12 + -11? 1/6 (-2)/(-6(-2 - -5)/(-45)) -5 12/(-3) - 54/(-15) -2/5 What is the value of (-3 + (-36)/(-8))(-3 + 1)? -3 2-1 - (-49)/28 -1/4 What is (-63)/98 - (-1)/7? -1/2 What is the value of 806/84 - 23? -2/7 20/(-100) - (-1)/5 0 Calculate (72/27)/((-16)/(-12) + -2). -4 What is (-18)/(-64)(2 - 50/15)? -3/8 Evaluate (-88)/110 - (-68)/110. -2/11 Calculate (-60)/63 - (-2)/(-3)-1. -2/7 What is ((-3)/(-4))/1 - (-11)/(-4)? -2 What is the value of 1/4 - (-138)/(-720)2? -2/15 Calculate 30/(-44) + (-40)/22 + 2. -1/2 What is the value of (-188)/2961 - 4/18? -2/7 Calculate 8 + 1308/(-324)2. -2/27 What is the value of 440/2754/((-8)/5)? -4 424/(-64) - 19/(-14) -1/7 What is the value of 351/34(-2)/36? -1/4 What is (-8)/16 + (-3)/(-12)? -1/4 What is (-952)/(-153) + (-8)/36? 6 What is the value of 3114/173 - (9 - 1)? 10 7/35 + (-51)/30 -3/2 Calculate 2/(-3)(1 + (2 - 9)). 4 What is -4 + (-1)/(-4) + (-3)/(-4)? -3 Calculate (-2)/4212/477. -2/9 7 - (-3 + 9 + -2) 3 Evaluate (6/5)/(3/5). 2 What is the value of (21/(-12))/((-44)/176)? 7 What is (-20)/(-160) + (-1)/2? -3/8 Evaluate (-23)/7 + 1 - (-62)/31. -2/7 What is 21 + (-375)/225? 1/3 What is (-9 + 0)(-17)/51? 3 Evaluate (9/(-15))/(((-378)/(-15))/(-14)). 1/3 Evaluate ((-30)/(-36))/((-45)/(-27)). 1/2 Calculate ((-3 - 1) + 4)/(-4). 0 Calculate 5/35 - (-8)/(-7). -1 What is 6 - (-22)/(44/4)? 8 Calculate 2/(-40) - (-5)/(-25). -1/4 Evaluate 2/(-11) - (-630)/(-770). -1 What is 13 + -5 + (-4 - -9)-1? 3 What is (6 + (-5 - 0) + -1)/2? 0 Evaluate 5/(-6)(-144)/(-180). -2/3 Calculate (-6)/(4 - 1)-2. 4 What is the value of 93(-3)/(-99) + -3? -2/11 2 - (-1 - (-10)/3) -1/3 ((-95)/19)/(((-15)/(-18))/1) -6 Calculate 1/((-2)/(-8) + (-10)/20). -4 What is (6/4)/((-3)/(-2))? 1 What is (-225)/625(-10)/6? 3/5 Calculate (3/((-18)/(-10)))/((-22)/(-66)). 5 What is the value of -34/(-3) - -1? 5 (6 + 72/(-15))20/(-44) -6/11 Evaluate (2 + -2)/2 + -3 + -1. -4 What is the value of 55/25(-3)/15? -1/5 Calculate (-15)/(-9)2/5. 2/3 What is the value of 76/48 - (-1)/(-3)? 5/4 Calculate 211/(-16). -1/8 1104/(-966)(-14)/(-4) -4 6/14 + (-4)/(-7) - 1 0 ((-20)/(-8))/((-35)/(-28)) 2 Evaluate ((-1)/3)/((-1)/12). 4 What is the value of (7 + 0 + -1)4/(-8)? -3 What is (-1728)/126 - (-20 + 6)? 2/7 Calculate 2365/275 + (1 - 9). 3/5 What is ((-9)/39)/(3/(-2))? 2/13 Calculate (5 - (-497)/(-98))(-20)/(-5). -2/7 What is 341/(-66) + 3 + 2/12? -2 What is (-91 - -90)/((-2)/(-10))? -5 What is the value of 7 + -6 + 1 + (-28 - -34)? 8 What is the value of 0(30/(-8) - -4)? 0 Calculate ((-4)/(-6))/((-7)/(-21)). 2 What is the value of 3/(0 + 12/(-16))? -4 Evaluate (1/(-1))/((22/33)/2). -3 Evaluate ((-92)/12 - -6)/((-15)/(-54)). -6 ((-2)/8)/(-4(-8)/(-128)) 1 Calculate 3/(-12)(-88)/(-33). -2/3 What is 82/(-123)(-18)/4? 3 What is the value of -3 + (12/(-8))/(-3)? -5/2 What is (-7 + 5)3/(-2)? 3 8/2568 + 0 1/4 What is 10/(-120)(2 - -6)? -2/3 What is (2/(-4) + 2)(-20)/(-15)? 2 What is the value of (-6)/18 + 4/3? 1 What is the value of 24/39(0 + (-3)/(-12))? 2/13 Calculate (8/(-16))/(2 - 22/12). -3 What is (-1)/7(1 + -2)? 1/7 What is -5(-19 - -20) + -3 + 0? -8 What is (-2090)/(-741) - (-48)/(-18)? 2/13 What is the value of (12/(-9))/((-12)/27)? 3 Calculate -11/((-10)/(-30)). -3 What is (-4 - 2)/(18/4)-3? 4 What is ((-68)/102)/(((-28)/(-9))/2)? -3/7 What is the value of 9/2(3 + 51/(-18))? 3/4 2/((-5)/(-15) - 64/(-6)) 2/11 Calculate -3 + -7 + 9 + -4. -5 Calculate 2(1 - (-52)/(-48)). -1/6 Evaluate (8/4)/((-5)/(5/9)). -2/9 ((-2)/(-4))/((-11)/22) -1 Calculate (1 + -2)/((-7)/21). 3 (-1 - 9/(-6))(9 + -9) 0 What is the value of ((-2)/(-4))/(0 + (-3)/(-6))? 1 What is (9 - 6) + -5 + 1/3? -5/3 Calculate (9/60)/((-17)/(-68)). 3/5 1150/130 - 6/(-39) 9 Calculate 6 - (-40)/24-3. 1 Calculate 8/(-30)(-3)/(-2). -2/5 What is 400/100 - (-3 - (-2)/(-1))? 9 Calculate 68/170 - (-18)/5. 4 84/14 - (-57)/(-6) -7/2 What is the value of (1/(-6))/(128/(-18) - -7)? 3/2 What is ((-4)/((-64)/24))/(14/(-4))? -3/7 What is the value of -2(-15)/10 + 16/(-5)? -1/5 What is the value of 1-35/(-12)? 5/4 What is the value of 56/144 - 2/9? 1/6 What is 85/30 - (9/3 + 0)? -1/6 What is 94/24 + 0 + 1/12? 4 Evaluate (((-24)/18)/(-4))/(8/12). 1/2 Calculate ((-6)/45)/((-24)/15). 1/12 What is -7 + (-130)/25 - -12? -1/5 Evaluate 351/(-45) + 4. 3/5 4 + 44/16 5 What is 41/(-44) - 4/(-22)? -3/4 (4 - 0) + 43 + -44 3 What is the value of (4 - 19/2) + 3? -5/2 What is ((-136)/(-34))/(-72)? -2/7 What is the value of (5 - (10 + -6))-1? -1 ((-1)/42)/((-40)/80) 1 What is the value of ((1 + -2)/3)/((-124)/(-2604))? -7 What is 7/84 - 305/60? -5 Calculate 260/35 - (2 - -5). 3/7 Calculate ((-8)/20)/(9/(-90)). 4 What is ((-4)/7)/2(-7)/15? 2/15 (-2(-9)/60)/((-18)/(-5)) 1/12 What is ((-5)/10)/(21/42)? -1 Calculate (-2170)/6300 + 1/(-18). -2/5 (-104)/1563/2 -1 Calculate 8/363(-3)/(-8). 1/4 Calculate ((-24)/(-80))/((-6)/45-18). 1/8 Evaluate (8 - -1 - 4) + (3 - 6). 2 Evaluate 1/(-5 + 28/6). -3 ((-2)/(-4))/122/44 1/4 What is the value of (-1548)/(-126) + -12 - (-58)/(-7)? -8 What is 123/363 + -10? 1/4 Calculate (8/12)/(15/10). 4/9 Evaluate 24/(-52) - (-340)/(-52). -7 1/((-6)/8(-3)/(-9)) -4 What is 0 + -7 + 2 - 0? -5 What is (-18)/16(-92)/69? 3/2 Evaluate -12 - -6 - (-10 - 0). 4 What is (14/(28/(-6)))/1? -3 What is the value of (20/5 - 7)1? -3 Calculate (-2)/(-7)(-35)/(-10). 1 Calculate (-4 + 3)(-10)/95. 2/19 What is the value of ((-3 - -4)/(-6))/((-19)/(-38))? -1/3 (45/18)/(1/(-2)) -5 (-4)/12 + (-3 - 84/(-9)) 6 Evaluate 3 + (-69)/21 + 1769/(-203). -9 Evaluate (0 + 6)/(-2) - (-6 - -3). 0 What is 145/(-150) - 36/(-45)? -1/6 Calculate 30/165 + 525/77. 7 ((-108)/15)/(-4)80/(-24) -6 What is the value of (-2 - -5) + (-24)/14 + -1? 2/7 Evaluate -41 - (-1 + 2)-2. -2 Calculate 120/39 + (2 - 3)3. 1/13 Evaluate 390/(-325)5/(-51). 2/17 ((-6)/12 - -1) + 22/4 6 What is the value of 42/2 + -1 + 0? 3 What is the value of ((-12)/1)/4 - -6? 3 Calculate ((-10)/(-30))/(3/(-45)-1). 5 Calculate (0 + 3)2/6 - -3. 4 What is the value of -1(-9)/(36/(-28))? -7 Evaluate (-63)/(-30) - (-2 - -4). 1/10 Calculate (90/27)/((-8)/6) + 5. 5/2 Calculate -11 + -1 - (-158 + 151). -5 What is ((-65)/(-7) + -9)/(24/(-14))? -1/6 Evaluate (40/60)/(15/9). 2/5 Calculate (1 + 1 + -1)(-2 + -1). -3 What is the value of (48/8)/248/(-6)? -1/3 What is (-101)/(-202) + 14/(-20)? -1/5 ((-12)/16 + 14/8)-5 -5 -8 - 2(-3 - 0) -2 What is 1/(3 - (-2)/(20/(-25)))? 2 What is the value of (6 + (-16)/4)/(2/3)? 3 What is ((-38)/20 + 2)/(2	{ "pile_set_name": "DM Mathematics" }
ive. i(6802/45) Simplify (i/(i/(i7i)))/((ii*(-11))/i)(i(-5/3)/i)/i10 assuming i is positive. i(19/3) Simplify t(9/7)/(ttt*(-10)/t)(t3)(4/19) assuming t is positive. t(1452/133) Simplify s(-1)ss/(s/(s(sss5s)/s))s(-1)/((((s(-1/18)s)/s)/s)/ss) assuming s is positive. s(145/18) Simplify ((zz/(z/((z/(zz(-2/43)z)z)/z)))/z(5/3))/((((zz*(-1)zzz)/z)/z)/z(1/8)) assuming z is positive. z(-2575/1032) Simplify ((k/(k/(kkk*(-1/19)k)k))/(k(2/25)/k))/(k(3/14)/kk)(-2/155) assuming k is positive. k(295839/103075) Simplify c*14c*(-2/13)cc/((c(-1/10)/c)/cc)c/(c(2/13)c) assuming c is positive. c*(2183/130) Simplify ((zz(-1/3)/z)(-33)/((zz(3/7)z)/z(-2/11)))(18/13) assuming z is positive. z*(11628/1001) Simplify (((uu*(2/3))/uu(1/4)/u)(-18))(4/25) assuming u is positive. u(6/25) Simplify ((((i/(i*0i))/i)24)(-2/15))(-2/17) assuming i is positive. i(-32/85) Simplify (c/c(-1/8))(-22)(c0)(6/35) assuming c is positive. c(-99/4) Simplify (s(2/43)/(s/s(-2/19)s))/(ss(-2)s)42 assuming s is positive. s(-1682/817) Simplify ((d0/d)(-29)(dddd*1)/ddd6)(-14/3) assuming d is positive. d(-182) Simplify (o(-2/21)oo(ooo*(1/11))/o)/((o/(oo*20))/(oo/((oo17oo)/o))) assuming o is positive. o(1385/231) Simplify ((vv*2v)/v7)/(v(1/8)v)27 assuming v is positive. v(-267/8) Simplify (pp/p*(16/3)p/((p/(p*(-1/25)/p)p)/p))(36/5) assuming p is positive. p(-3936/125) Simplify (n*18/nnn/n(-5/2))/(nn(n/(nn/((n/((n/(n/n*(-7)))/n)n)/n))n)/nnnn*(-8)n) assuming n is positive. n*(33/2) Simplify (p/(p/(pppp*(2/9)/pp))p/p(-4/3))/((((p/(((pp/p(-1/17))/p)/p))/p)/p)/(p(-5/3)p)) assuming p is positive. p(910/153) Simplify ((jj*(-10)j(j/j(-3/11))/j)/(j/j1)(-2/5))(-50) assuming j is positive. j(4250/11) Simplify (tt/t6)/(t/t(-2/17))(t/t(-1/5)t)(7/8) assuming t is positive. t(-2171/680) Simplify ((((d/d(-1/4))/d)(-49))(-50))(3/25) assuming d is positive. d*(147/2) Simplify (uu*2u*(-1)(u/u(1/2))/(u/u(-3/4)))(-2/39) assuming u is positive. u(-1/26) Simplify (yy(2/7)y/(y(-1/2)/y))/((y(7/2)y)/(yy*(7/6)y)) assuming y is positive. y(103/42) Simplify (x1)*(-1/3)/((xx*(4/3))/(xx(1/6))) assuming x is positive. x(-3/2) Simplify ((u/u(1/2))(14/9)/((u(1/5)/u)/u(5/4)))(2/33) assuming u is positive. u(509/2970) Simplify (((m/m2)/m)(-46)(m3)45)(3/11) assuming m is positive. m(681/11) Simplify ((xx*(-4/9)(x(x(-1/3)/xxx)/xxx)/xx)/((x*4x)/x4))(-42) assuming x is positive. x(-280/3) Simplify (y15yy/(y/(yy(-2/15)y)))/(((y*0y)/y)/(y*(-2/35)yyy)) assuming y is positive. y(437/21) Simplify (((z(-2/3))50)(-3/17))(5/14) assuming z is positive. z(250/119) Simplify bb(b*(-3/5)bb)/bbbbb(1/2)b((b/b0)/bb)31 assuming b is positive. b(379/10) Simplify ((i*(1/5)/(i/(ii/(ii(-6/11)ii)i)))/(i*4i(-3/7)))(5/2) assuming i is positive. i(-1473/154) Simplify ((g6/(gg/(g(g/g*(-1)g)/g)g))/((gg*(-5/6)g)/g(2/15)))(1/36) assuming g is positive. g(149/1080) Simplify (y(-5)yy)(-3/4)/((y/y(1/5))/y(1/22)) assuming y is positive. y(329/220) Simplify ((t/(t/(t/t*7))t*(-3))/(((tt(-2/17))/t)/t(-5)))(1/5) assuming t is positive. t(-236/85) Simplify (g/g*(-17)gg(-2/7)g)/(g6/g(2/27)) assuming g is positive. g(2606/189) Simplify (y/((y(-2/17)yy)/y))*(1/8)(y17)(-15) assuming y is positive. y(-17339/68) Simplify (x/(x/x(-3)))/(x/x*(5/7))(x/(xx(13/2)/x))/x(1/16) assuming x is positive. x(-991/112) Simplify ((g(-1/3)g)*(-2/85)g/(g/g*(-2/13))g/g*(4/7)g)(7/6) assuming g is positive. g(14608/9945) Simplify (l(2/9))(-13/4)/(ll(-3/10))(1/10) assuming l is positive. l(-713/900) Simplify (qq(-3))(-2/157)/(q/(q/(qq(-5/3)))q/q4) assuming q is positive. q(1739/471) Simplify ((nn/n(-1/15))(-2/99))38 assuming n is positive. n(-2356/1485) Simplify z10/(zz/(z/z*(-14/9)z))z(-1/5)/z19 assuming z is positive. z(-344/45) Simplify ((((p(3/7)p)/pp)/p)/pp)1/(p/((p/(p15p))/p)(p*(-2/3)/p)/pp) assuming p is positive. p*(-313/21) Simplify (d/((((d/((dd*(1/9))/dd))/d)/d)/d)dddddd*(2/5))/((d(d/(dd(-11)))/dd)/d(3/2)) assuming d is positive. d(-89/90) Simplify (o(-9))16/(o(1/5)/o)33 assuming o is positive. o(-588/5) Simplify (u(-1/5))*(-4/17)u*(-5/6)u(-14) assuming u is positive. u(-7541/510) Simplify (y*(-18)(y/y*15)/yyy)(-31/3) assuming y is positive. y(961/3) Simplify (o(9/2)/o(-1/8))/((((o(oo/o(14/5)o)/o)/o)/o)/(o/o(-18))) assuming o is positive. o(1017/40) Simplify (l6)(-15)/(l*(2/5)/(ll/l(1/4))) assuming l is positive. l(-1773/20) Simplify (j/j3)(-5/13)/((j/(jj(-1/9)/jj))/j(-10/9)) assuming j is positive. j(-53/117) Simplify uu(-18/11)u*19u((u/u36)/u)/(u/(u(1/43)/u)) assuming u is positive. u(-8804/473) Simplify ((u/u(1/4))/uu)*(4/7)u(2/43)/u(-1/20) assuming u is positive. u(3161/6020) Simplify ((h(-3)/(h*(-4/7)hh))/((h/(h(1/2)/h))/hh)(-50))(-16) assuming h is positive. h*(-7904/7) Simplify ((pp(p/(p/((pp/p5)/p)))/p)/p(3/4)(p(-2/9)p)18)(-2/9) assuming p is positive. p(-41/18) Simplify (d/(d/d(1/3)))*(4/3)d*(-7/4)dd(-14)d assuming d is positive. d(-479/36) Simplify u(-7)u/(u/(uu*(-1/8)/u))(u(u6/u)/u)/(u/((u(-2/9)/uu)/u)) assuming u is positive. u(-313/72) Simplify (w/(w31/w))(-1/3)/(w/w(-40)w40/ww) assuming w is positive. w*(-214/3) Simplify (vv*2vv)/((v(-10/13)vv)/v)v(5/2)/v11 assuming v is positive. v*(-97/26) Simplify (((x((x(x/(((((x(-2/7)/x)/x)/x)/x)/x)x)/xxxxxx)/x)/x)(-26))(5/6))(-1/10) assuming x is positive. x(1027/42) Simplify c(-6/11)/c(2/41)(c(c(-10)/c)/cccc)/(c/((c2/c)/c)) assuming c is positive. c(-4327/451) Simplify g(-12/13)/g(-13)g(-3/5)g/g*(-35)g assuming g is positive. g(3151/65) Simplify (((z/(z4z))/(zz*(-1/3)z))/((z/((zzz/(z*(-7)/z)zzz)/z))/(z/z(9/5))))(-14/11) assuming z is positive. z(-1162/165) Simplify (m(-6))*(12/13)(m/m(-9))(-10/9) assuming m is positive. m(-1948/117) Simplify (a8)*(-38)/((a/(aa(2/85)))/(a/(a/a18))) assuming a is positive. a*(-24308/85) Simplify ((q(qq/(q/q(-1/4))q)/q)*(4/17)q/(qq(-2/3)q)qq(-1/9))(-44) assuming q is positive. q(-6512/153) Simplify ((o(-6)/o)/(o/(oo/o(-12))))/(o(-8/7)ooo((o(-4/13)oo)/o)/o) assuming o is positive. o(405/91) Simplify (((r/r(1/3)r)22)(-37))(-1/49) assuming r is positive. r(4070/147) Simplify ((j*13/(jj1))(-39))20 assuming j is positive. j(-8580) Simplify (tttt(2/13)t)*18t*(4/23)tt(-14)t assuming t is positive. t(18820/299) Simplify (b(6/11)/b)*(-5)b/(b/((b*23b)/b))b(-2/17)/b assuming b is positive. b(4517/187) Simplify (c(-3/17))(-1/8)cc/c(-9/2)(c*(-5/3)c)/c assuming c is positive. c(1981/408) Simplify (d(-4/9)dd(-1/8))(-36) assuming d is positive. d(-31/2) Simplify y13yy/((y/y*(-5/2)yyy)/y)((y/y(3/4)y)/yy)(1/47) assuming y is positive. y(1791/188) Simplify x(-2/15)xx(-10/9)x(x(-3/4)/x)(-28) assuming x is positive. x(2239/45) Simplify (ii/(i*0i))*(3/10)/((((i/(i(i*13/i)/ii))/i)/i)/((ii(2/37))/i)) assuming i is positive. i(5311/370) Simplify x(1/11)/(xx/x*16)(x/(xx11))/((x(-16)x)/x) assuming x is positive. x(210/11) Simplify (o19/(o/o*19))/((o(o/((o/(o/(o/(o/(oo/o(-16)))o)))/o))/o)/o4) assuming o is positive. o58 Simplify ((u/(u/(u/u19)))/u1)/(u5)20 assuming u is positive. u(-119) Simplify ((b(5/3)(bb*(-2/11)b)/b)/((bb2)/(b/((bb/(b/b*(3/2)))/bb))))9 assuming b is positive. b(-399/22) Simplify (y6/y(-10))/(y*(2/3)yyy)(-17/4) assuming y is positive. y(379/12) Simplify (o/(o*18o))/(o/(o((o(1/16)/o)/oo)/o))o/o(-2/19)oo(-21)o assuming o is positive. o*(-11501/304) Simplify ((pp**(1/25))/	{ "pile_set_name": "DM Mathematics" }
g + 66. Does 8 divide g? True Let c = 377 - 210. Let a = -95 + c. Is 12 a factor of a? True Let m(o) = -o2 + 10o + 5. Let c be m(10). Let w be 0 - -1 - (-15)/c. Suppose -5s + 2f = -60, 2s - 5f = w - 1. Is s a multiple of 14? True Suppose -19h + 29h = 2380. Does 5 divide h? False Suppose 0 = -0d + 4d - 2n - 2, -n + 3 = 2d. Let u be (-2 - 2)d + 5. Suppose -u = 2z - w - 104, w - 152 = -3z. Is z a multiple of 17? True Suppose c + 17 = -0c. Let a = c + 21. Suppose h = a - 1. Is 3 a factor of h? True Suppose -8 - 20 = 2k - 4m, 0 = 2k - 3m + 26. Does 19 divide (-190)/(-38)(-44)/k? False Let v = -16 + 18. Suppose -60 = -d - vk, d + 3 = -4k + 63. Let p = -8 + d. Does 12 divide p? False Let q be (-9 + 9)/(13). Let i(j) = 26 + q + 2j + 15. Is 14 a factor of i(0)? False Does 13 divide (6 - (-1128)/2) + -7? False Suppose -5156 = -5d + 4a - 204, 4d = -2a + 3972. Does 10 divide d? False Suppose 4296 = 7x - 2473. Is x a multiple of 10? False Suppose -f - u = -1, 4f = 3u - 8 - 23. Let b(x) be the third derivative of x5/30 + x4/6 - 2x3/3 - 18x*2 - 2. Is b(f) a multiple of 6? True Is 31 a factor of 2/4 - (-21375)/30? True Let l(c) = -51c - 21. Is l(-1) a multiple of 6? True Let k be 6/8 + 111/12. Let r be k/15 - (-415)/3. Suppose -2p + 3x = -0x - r, p - 71 = 2x. Does 17 divide p? False Suppose 733 = -5g - 592. Let u = -149 - g. Is 18 a factor of u? False Let n(x) = 2x*2 + 20x - 23. Let b(y) = y*2 + 10y - 11. Let k(t) = 9b(t) - 4n(t). Let h be k(-11). Suppose hc - 6c + 132 = 0. Is 10 a factor of c? False Is 141 - 29 - (-1 + 0 - 2) a multiple of 5? True Suppose -19x = -18x. Suppose -i = 5p - 0i - 451, x = 5p + 5i - 455. Is p a multiple of 9? True Let v(k) = 3k2 + 3k - 22. Let c be v(-7). Suppose -5g + 118 = -2i, 2g - 4i = -2g + c. Is 12 a factor of g? False Suppose 0 = -3o - 0 - 3. Let q(w) = w*2 - 2w - 1. Let f be q(o). Suppose 2t + ft = 3j - 238, -2t = 3j - 232. Is j a multiple of 39? True Let x be (12 - 14) + 12. Suppose 4j + k - 507 = x, j - 246 = -j - 2k. Does 32 divide j? True Suppose -y - 40 = -5n - 0y, 2n + 5y - 16 = 0. Is (-9 + n)/((-2)/358) a multiple of 18? False Let u(j) = -2j3 - 2j*2 - 5j - 18. Let a(y) = y*3 + 2y + 1. Let x(s) = 3a(s) + u(s). Does 8 divide x(5)? False Let i(k) = 4k2 + k - 27. Let q(o) be the second derivative of o4/12 - 7o. Let z(r) = -i(r) + 5q(r). Is z(0) a multiple of 27? True Is (-12 + 0)/(3093/(-441) - -7) a multiple of 49? True Let t = 28 + -28. Suppose 5f - 19 + 4 = t, 3f = -5x + 584. Is x a multiple of 6? False Suppose 3v = -12p + 9p + 732, -3p - v = -740. Does 31 divide p? True Let w = 7 - 14. Let q(l) = -l2 - 37l - 79. Let u be q(-34). Let h = w + u. Does 16 divide h? True Is 7 a factor of -178(-25)/(150/36)? False Is 111/6(22 + 7 - -1) a multiple of 9? False Let m(q) = -q3 + q2 + 4q. Let i be m(-2). Suppose 2x - 60 = -if + 5f, 2x = -4f + 40. Is x a multiple of 8? False Let d = -158 - -263. Suppose 0 = 4q + h - 106 - 149, d = 2q + 5h. Is 13 a factor of q? True Let k(f) = -f + 12. Let q be 2/(1/(-4 + 6)). Suppose -qb - 12 = -4s, s - 17 = 4b + 4. Does 9 divide k(b)? True Suppose -132 = -5l + 578. Suppose 3z = -4i + 34, 4z - 2 - 46 = -4i. Suppose -2m - z + l = 0. Is m a multiple of 16? True Suppose 46c - 14291 = 3695. Is c a multiple of 3? False Let m = 342 - 294. Is m a multiple of 16? True Suppose -5n + 365 = 4i, 0 = 5i - 79 + 104. Does 7 divide n? True Suppose -4g - 4a - 4 = 64, 5g - 2a + 106 = 0. Let j = -15 - g. Is j a multiple of 3? False Suppose -54 = -3l - 15. Suppose 41 = -ls + 2654. Does 12 divide s? False Suppose -186 = -8q + 574. Is q even? False Let b(w) = -2w*2 - 13w - 9. Let f be b(-11). Let s = -76 - f. Let a = 11 + s. Does 11 divide a? False Let j be (0 + 3)/(3 + 70/(-24)). Let b = -9 + j. Is b a multiple of 10? False Suppose -3 = 3h + 5j, -3h + 2j = 2h + 5. Does 8 divide (-12)/18(h + 19)-8? True Let v = 188 + -56. Suppose 0 = -3q + v + 195. Does 41 divide q? False Let r = -303 - -401. Is r a multiple of 7? True Suppose -94 - 179 = 7g. Let m = g + 80. Does 12 divide m? False Let u(d) = -104d + 250. Is u(-11) a multiple of 50? False Let c(t) = t*3 + 18t*2 + 15t - 29. Let u be c(-17). Suppose uw - 435 = 295. Is 13 a factor of w? False Let l(i) = i + 1. Let j be l(-1). Let p be ((-1)/((-3)/2))/(53/159). Suppose j = 2m - 3w - 60, -4w + 31 - 95 = -pm. Is m a multiple of 6? True Let y be -1 + 4 + 0 + 9. Let q be -4 - -6 - y - 3. Let p(o) = -o3 - 14o*2 - 15o + 6. Is 16 a factor of p(q)? True Let i = -457 - -503. Is i a multiple of 23? True Suppose -m + 5j + 800 = 0, -2j - 2202 - 1088 = -4m. Is 33 a factor of m? True Let m(j) = -15j*2 + 237j + 4. Does 9 divide m(13)? False Let c = -65 + 509. Is 6 a factor of c? True Let f(v) = -6v - 9 - 7v*2 + 0v + 8 - v*3. Let k be f(-6). Let u(c) = 52c*2 - 1. Is 23 a factor of u(k)? False Suppose 30o = 33658 + 44792. Does 30 divide o? False Let p(g) be the first derivative of -g - 2g2 + 3 + 0g - 7g - 1. Does 2 divide p(-4)? True Let x = -19 + 23. Suppose 0r - xr + 20 = 0, 0 = -3l + r - 41. Let k = 7 - l. Is 5 a factor of k? False Let w(s) = -s + 7. Let l be w(5). Let t(i) = -i*3 - 5i*2 + 105. Let v be t(0). Suppose lh = v + 33. Is h a multiple of 23? True Suppose 0 = 9m - 3231 - 198. Is m a multiple of 3? True Let y(z) = 195z - 171. Is y(6) a multiple of 27? True Suppose 2225 = 6n + 641. Is n a multiple of 33? True Suppose 0 = 4j - 2x - 18, -2 = j + 2x + 6. Suppose 0b = -t + jb + 30, -b - 29 = -t. Suppose 2m = 6m - t. Is 2 a factor of m? False Let j(v) = v*3 - 8v*2 - 8v - 4. Let k be j(11). Let f = k - 171. Is f a multiple of 25? True Let t(y) be the first derivative of -y6/120 - y5/30 + 7y4/24 + 4y*3/3 + 2y2 - 3. Let x(f) be the second derivative of t(f). Does 4 divide x(-4)? True Is 17 a factor of 5/2 + 776/16? True Let a be ((-36)/42)/((1 + 0)/(-7)). Let j = a + 30. Is j a multiple of 6? True Let c(b) = -b3 + 2b2 - b + 8. Let h be c(0). Suppose hf - 362 = 182. Does 5 divide f? False Suppose v + 88 = 3v. Is 7 a factor of (-3 + v/8)(0 - -20)? False Let o(r) be the third derivative of r6/10 - r4/12 + r*3/3 + 13r*2. Does 6 divide o(1)? True Suppose 2x = -0r - 2r + 8, 3x = r + 4. Suppose -174 = -0z - xz. Is z a multiple of 18? False Suppose n + 2r - 19 - 1 = 0, 3n - 60 = -2r. Let j = 33 - n. Does 9 divide j? False Suppose 3v + z - 2z = -67, -v - 4z = 31. Let l = v + 25. Suppose 69 = 2j - 3f, -2j + lf + 75 = -3f. Is j a multiple of 7? False Let j be (-4)/(-6) - 365/(-15). Suppose -3f = 10 - j. Suppose 0 = -5p + d + 132, fp = d + 3d + 138. Does 10 divide p? False Let g(q) = 4q3 + 4q*2 + 3q + 1. Is g(4) a multiple of 8? False Suppose -5c - 4o = 8, -6 = 4o - o. Suppose 2m - 5b = c, 0b = 4m + 3b. Suppose ml + l = 22. Is 4 a factor of l? False Let f(s) = -s3 + 7s*2 + 2s - 7. Let q be f(7). Suppose -qw = -6w + 63. Let i = -29 - w. Is 12 a factor of i? False Let y(i) = 28i + 32. Let f be y(16). Suppose 0 = -12n + 7n + f. Is n a multiple of 16? True Let z(b) = 4b*3 - 17b*2 - 30b - 21. Does 16 divide z(9)? True Suppose 6u + 176 = 8u. Is u a multiple of 2? True Let b = 16 + -21. Is 14 a factor of (-10)/b + -2 - -42? True Let t be 4-4(-3)/12. Let w be (-2)/360/(-8). Suppose u + 179 = 3v - u, tv - wu = 248. Is v a multiple of 19? True Suppose 0 = -22w + 12w + 120. Suppose -425 = 7r - wr. Does 14 divide r? False Let p = 474 + -279. Is p a multiple of 13? True Let z = -234 + 147. Let s = 186 + z. Does 33 divide s? True Let k = 124 - -11. Let h = 200 - k. Is h a multiple of 14? False Is 2 a factor of -594(-2)/3 - -9? False Let f(z) = -z2 + 29z - 39. Does 57 divide f(15)? True Suppose 12 = -4h, -3p + 2h - 276 = h. Let o = 7 - p. Suppose -3j - 2j + 5a + 120 = 0, -4j + o = -3a. Does 18 divide j? False Suppose 2z - 22 - 18 = 0. Suppose a + a = -z. Let q = 11 - a. Does 7 divide q? True Suppose 0 = -2p + 7p - 225. Let j(r) = -r2 - 6r. Let f be j(-6). Suppose -3g - 6 + p = f. Is g a multiple of 4? False Suppose 7x + 18 = -2x. Let k(g) = -2g*3 + 2g*2 + 2g + 1. Let q(z) = z**3 -	{ "pile_set_name": "DM Mathematics" }
common multiple of a and l. 88 Let j = -10135/18 - -564. Let f be 8/2(1 + 1 + -4). Find the common denominator of j and ((f/(-21))/(-2))/((-6)/(-36)). 126 Suppose 6g - 4m = 4g - 8, 2m - 2 = 0. What is the common denominator of 95/8 and g/8(-196 + 2)? 8 Let s be 0 - (116 - (-2 - -1)). Suppose v - 270 = 4v. Calculate the common denominator of -63/2 and s/v - 0/1. 10 Suppose 0 = -2x - 9x + 363. What is the common denominator of 8/(-6)86/8 and x? 3 Suppose 5m = -2i - 6 + 11, 3i - 36 = 2m. Calculate the lowest common multiple of 105 and i. 210 Let u be 2/(3-2) + (-35528)/(-24). Let t = -9013/6 + u. What is the common denominator of -53/6 and t? 6 Find the common denominator of -6/157 and (-1098)/(-144) - 3/(-2). 1256 Let b(f) = 2f*3 - 32f*2 + 33f - 42. Calculate the smallest common multiple of b(15) and 128. 384 Suppose -5o + 1085 = 380. Calculate the lowest common multiple of 12 and o. 564 Let o = -3640 + 5729. Let p = -8427/4 + o. Calculate the common denominator of 4/(-30)(3 - (-1488)/(-36)) and p. 36 Let h = -21 + 16. What is the common denominator of 73/22 and (57/h)/(100/125)? 44 Suppose 0 = -5w - 0 + 20. What is the common denominator of 15/8 and ((-1)/w)/(25/(-390)) + -1? 40 Suppose 2u - 6172 = 4g, g + u = 2g + 1544. Let j = g - -10732/7. Let n = 195/56 + j. What is the common denominator of n and 23/12? 24 Let z = 4313937/160 - 26962. Find the common denominator of z and -61/2. 160 Let u = 2647421263863967 + -2864510420104705537/1082. Let b = -566177393 - u. Let i = b + -1/541. Find the common denominator of i and -85/6. 6 What is the common denominator of 260/184 + (-9)/9 and -55/12? 276 Let f be 6139/118356466/(-4). Let v = 3/2818 + f. Find the common denominator of v and 75/16. 48 Let d = 45 + -25. Suppose x - 12 = -5r + 2x, -x = 2r - 2. Suppose -v - 22 = -3m + 54, -rv + 134 = 5m. What is the lowest common multiple of m and d? 260 Let g = 45115 - 19670159/436. What is the common denominator of -11/8 and g? 872 Calculate the common denominator of 16/9 and (234/(-4) + 3)(-6)/243. 27 Suppose 0 = -5b - 5q + 15, -358b + 355b = -5q - 49. What is the smallest common multiple of (-2)/(-4) + (-5)/(-2) and b? 24 Calculate the common denominator of -125/18 and 53393/26750 - (0 - -2). 2250 What is the common denominator of (2/(-24))/((-3)/(-858)) and (370/315)/(2/3)? 42 Let m be (-40)/10 + (-14)/(-2). Find the common denominator of 52/33 and 3519/460(-2)/m. 330 Suppose -312 + 816 = 21i. What is the lowest common multiple of 11 and i? 264 Let o = 139341 + -19228945/138. Calculate the common denominator of -37/115 and o. 690 Suppose 39 = 5o + b - 11, b + 13 = 2o. Suppose 4s - 32 = 16. What is the smallest common multiple of o and (s/(-21))/(8/(-28))? 18 Suppose 0 = y - 3, 3u - 2y = 4u - 83. Suppose -284 = -4q + 4p, 2q + 2p - u = 61. Calculate the common denominator of (-4)/14 + (-65)/q and -17/6. 42 Let m = 5/10529 - -936921/336928. Calculate the common denominator of m and 83/24. 96 Suppose 516 = 3f + 18v - 21v, -12 = -3v. Calculate the smallest common multiple of f and 16. 176 Suppose 10n - 396 = 6n. Suppose -d = 5v + 2d - n, -4v = -2d - 66. Let r = -46 + 58. What is the lowest common multiple of v and r? 36 Let m = -4811 - -942969/196. Calculate the common denominator of m and -54/5. 980 Suppose -5b - 2 = -42. What is the least common multiple of 21 and b? 168 Let g = -12277 - -122887/10. Calculate the common denominator of g and 12. 10 Let p = -36284/5 + 2830927/390. Calculate the common denominator of 20/143 and p. 858 Let l = -5377/2799 - -10/311. What is the common denominator of l and 11/12? 36 Calculate the smallest common multiple of -110((-3)/(-3) - -1 - 3) and 9. 990 Let z = -65 - -68. Calculate the least common multiple of (-4)/((-1)/(-2 + z)) and 2. 4 Suppose 9s - 10s + 1052 = 5o, 4s = -3o + 638. What is the lowest common multiple of 40 and o? 840 Suppose 0 = 4l - 3k - 100, -19k - 2 = -l - 24k. Calculate the least common multiple of 6 and l. 66 Let p(g) = -3g - 10. Let l(n) = -n3 + 9n*2 - 7n - 1. Let j(s) = -s - 4. Let i be j(-12). What is the smallest common multiple of l(i) and p(-5)? 35 Let t be (40/5)/(4/3 + -2). Let j = t + 30. Calculate the least common multiple of j and 52. 468 Let o(b) = b*3 + 11b*2 - 11b - 105. Calculate the least common multiple of o(-11) and 92. 368 Let b(j) = 0 + 5j - 3 + 0j + 4j. Let o be b(-3). What is the common denominator of 257/(-60) + (-10)/o and -53/6? 60 Calculate the least common multiple of 20 and (82)/((-712)/48 - -15). 480 Calculate the common denominator of 69/8 and (-1)/4((-306)/(-3))/(-6). 8 Let g = 4553941/852 - 5345. Let s = -1467/284 - g. Calculate the common denominator of s and (-1)/(-2) - (-357)/(-28). 12 Calculate the common denominator of 25 + -78/(-112) and 9/232. 232 Let p = 15/2068 - 142379/241956. What is the common denominator of -41/104 and p? 936 Let m(y) = -30y + 4. Let z = 2 - -1. Calculate the smallest common multiple of m(0) and z. 12 Suppose q + 114 = 5c, -2c + 4c = -q + 40. Calculate the least common multiple of c and 18. 198 Suppose -21 = -3d - t + 2t, 35 = 5d + 4t. What is the common denominator of 46/21 and ((-35)/(-2))/(d + (0 - 4))? 42 Let x = -69 + 45. Let g(r) = -2r - 40. What is the least common multiple of 22 and g(x)? 88 Let l = -7 + 8. Suppose 4u = -3z + 58, -5z + 2u + 7 + 107 = 0. Calculate the least common multiple of z and l. 22 Let y(r) = -r3 - 3r*2 + 33r + 41. What is the smallest common multiple of y(-7) and 4? 12 What is the common denominator of 2/44(-330)/11 and -107/12? 132 Calculate the common denominator of 1((-194)/(-4) - -2) and (-202)/12(6 - 297/44). 8 Let z = 4727/10 - 475. Calculate the common denominator of ((-24)/15 + 2)(-2555)/(-28) and z. 10 Calculate the common denominator of -58/85 and (68/(-14))/((-24)/(-448)-20). 255 Let v(q) = 183q*3 - 4q*2 + 2q + 1. What is the least common multiple of v(1) and 143? 2002 Suppose -3v - 195 = -4v. Let k be ((-144)/v)/((-7)/15). Let j = 1457/1092 + k. Calculate the common denominator of -61/12 and j. 12 Suppose 35p - 80 - 95 = 0. Calculate the least common multiple of 2 and p. 10 Find the common denominator of (-3)/958/(-6) and 435/156(-6)/204. 234 What is the common denominator of -53/175 and -2 - (11 - 17871/1400)? 1400 Let r = 14 - 36. Find the common denominator of 438/(-8)(2 + (-10)/6) and 4/r + 606/308. 28 What is the common denominator of -17/25 and (485/(-100) + 5)/(15/(-74))? 50 Let o = 320370 - 2559171/8. Let d = 472 - o. Calculate the common denominator of d and -75/8. 8 Let h = -290 + 293. What is the lowest common multiple of 7 - 11 - 1-25 and h? 21 Calculate the common denominator of (-7)/(-21)(-10947)/164 and (-206)/96 - (-4)/(-6). 16 Let g(r) = -r - 8. Let z be g(-7). Let y = -2993/4 + 771. Find the common denominator of 2106/24 + z and y. 12 Suppose -4 + 0 = k, 0 = 2v + 3k + 18. Let h = v - -7. Calculate the common denominator of h/32 - 407/24 and -77/6. 6 Suppose -44i - 22 = -45i. Let n(p) = 2p3 - 19p*2 - 9p - 2. Calculate the smallest common multiple of i and n(10). 88 Let a be ((-5301)/(-4200))/((-8)/60). Let r = -176/35 - a. Calculate the common denominator of r and 24/(-10)(-26)/32. 80 Suppose -85 = -5y - 15. What is the common denominator of (36/8y)/(-46) and 101/6? 138 Let p(i) = -i - 8. Let n be p(-4). What is the common denominator of 87/16 and (609/150 + n)/((-12)/(-470))? 80 Let z = -26114 + 79234/3. Let x = -27310/11 - -459964/165. Let a = x - z. Find the common denominator of 109/6 and a. 30 Let c = -213 + 582. Calculate the least common multiple of 15 and c. 1845 Let k = -2803 - 4451. Let n = 72621/10 + k. Find the common denominator of -15/22 and n. 110 Let t = -12911/24 - -1627/3. Let j be 0/(-2) - 968655/240. Let r = j + 4034. Find the common denominator of t and r. 16 Let t(q) = -59q*3 - 6q*2 + 6q - 1. Let i be t(-5). Let s = i + -57459/8. Calculate the common denominator of (30 + 0)/((-24)/(-30)) and s. 8 Suppose 107 = 5n - v, 3n - 4v - 29 = 42. What is the lowest common multiple of n and 77? 231 Suppose -3n + v = 15, 4n + 2v + 10 = 2n. Suppose 274l = 278*l + 8. What is the least common multiple of 6 and 17 + (l -	{ "pile_set_name": "DM Mathematics" }
((19 - 31) + 15). 2 Calculate -2 + -8 + (-24 - (1 - -12 - 18)). -29 Evaluate (-13 - -15 - -11) + (-1 - 2) + 2. 12 Calculate -4 + -6 + 9 + -17 + 18. 0 What is (-5 + -8 - -16) + -3? 0 (-145 - -132) + (-4 - (-1 + -28)) 12 What is the value of -2 - -11 - (382 - 389)? 16 Calculate 359 + -335 + -5 + -1 + -1 + 1. 18 What is the value of (22 - 2) + -3 + -6? 11 -2 - -2 - 1 - (-9 - (19 + -5)) 22 What is (10 - (4 - (7 + 4))) + 11? 28 What is 2 - (-16 - (-2 - 18))? -2 59 + -13 - 39 - (1 - 13 - 0) 19 (-10 - -36) + (4 - 14) 16 What is the value of 8 + (-7 + -22 - 3)? -24 Calculate 12 + 1 + -13 + 7 + -6. 1 What is the value of (-3 - 6 - -2) + 15 + -3 + 1? 6 What is the value of -5 + 4 + 4 + -23 - (-3 + 1)? -18 What is -12 - -12 - 1 - (-2 - 14)? 15 What is -1 - -1 - (-2 + 17 + -18)? 3 Evaluate 17 - 7 - (-12 - -13). 9 (-29 + 43 - 27) + 31 18 Evaluate 0 + -2 + 11 - (9 + -48 + 30). 18 Calculate 0 + 11 + 1 + -510 + 500. 2 Calculate (-6 - 5 - -17) + 22 - (-2 + 0). 30 -4 - (-103 + 130 - (15 - 2)) -18 Evaluate -1 + 4 - -28 - (232 + -224). 23 Evaluate (0 - 33) + -241 + 256. -18 Evaluate -15 - -3 - (-56 + 50). -6 What is the value of 0 + 8 + (-41 - -103 - 47)? 23 (-3 - -4 - (-11 - -2)) + -27 + 30 13 Calculate (5 - -4) + (6 - (45 + 0)) + 1. -29 What is the value of 16 - (-9 + 31 - 11)? 5 What is the value of 26 + -16 + 8 + -23? -5 -13 - (-24 + 7) - 17 -13 What is 24 + (-20 - 8 - -29)? 25 Calculate -30 + 28 + -24 + 8. -18 Evaluate 0 + (-9 + 9 - -9) + -24. -15 What is the value of -11 - (-17 - (7 + -2))? 11 What is the value of 17 + (-19 - (6 + -20))? 12 Evaluate 10 + -20 + 11 - -12. 13 What is the value of 9 + 2 + 7 + -5 - 9? 4 -13 + 17 - 0 - (3 - 0 - -2) -1 What is 8 - 0 - (-35 + 44 - -9)? -10 What is the value of (0 - 0) + 33 + -5 + -2 + -11? 15 Evaluate 2 + 24 + -1 + -4 + -4. 17 Calculate (0 - -1) + -41 + 15 + 16. -9 21 + -11 + -1 + -3 6 Calculate -15 - -1 - (-4 + 2 - (-2 - 0)). -14 Calculate -1 - (-19 - (-18 - (-6 + -3))). 9 What is the value of (-3 - (2 - -3)) + -17 + -12 + 29? -8 What is the value of -9 + 3 + 8 + -6? -4 Calculate -3 - -1 - (-22 - (-11 + 23 - 34)). -2 What is -11 + -28 + 34 + -11? -16 What is -17 + 31 + -22 + 28? 20 (7 - (4 - ((-5 - -5) + -1))) + 0 2 Evaluate -4 - (8 + (8 - 13) - (1 + 0)). -6 What is 12 + (3 - (5 - -6)) + (2 - 0)? 6 Calculate ((-8 - 5) + 5 + 1 - -8) + 6. 7 (1 - -8) + -3 + -5 + 9 10 Evaluate 1 + (4 - 3 - 4). -2 Evaluate (0 - -7) + (-4 - -4) + -5 - 4. -2 Evaluate 172 + -172 + -15 + 2. -13 Calculate 1 + -12 + 2 - -2 - (341 - 344). -4 6 + 15 + -21 + 17 - (2 + 6) 9 Calculate -14 + (15 - (6 - 0)) - -18. 13 Calculate -31 - -19 - -27 - (5 - -1). 9 What is the value of -16 + 1 + 2 - (714 - 733)? 6 What is the value of -12 - (-2 + (4 - 9)) - -11? 6 What is -13 + 19 + 26 + -26? 6 (-7 + (-6 - -16) - (9 + 1)) + 11 4 What is the value of -2 + -15 + 33 + 3 + -1 + 2? 20 What is 23 - ((16 - 6) + 9)? 4 (23 - 1) + (192 - 211) 3 What is (5 - (-15 - -32 - (5 - 2))) + -9? -18 -12 - -8 - -12 - (-7 - -13) 2 What is the value of 12 + 22 + -11 + 2 + 2 + -13? 14 What is 8 + -24 + (-10 - -17) - -35? 26 What is the value of -9 + (2 - -3) + -2 + 104 + -109? -11 What is -13 - (-6 - -2) - (-18 - (37 + -19))? 27 Evaluate 7 - 2 - (-25 - -44). -14 Evaluate 4 + (10 - 4 - 4) + 7. 13 -4 - (-14 - (-3 + -10)) -3 (2 - 1) + (5 - -1) - (15 + -2) -6 Calculate -19 + 2 - (6 + -12) - -7. -4 Evaluate (-38 - -17) + -9 - -55. 25 Evaluate (7 - -15) + -6 + -35. -19 What is the value of (0 - 17) + 1 - 3? -19 Calculate -15 + (21 - -2 - 30). -22 (-22 + 23 - 13) + 10 -2 What is -3 + 1 + 4 + (-1 - -4)? 5 -10 - (-3 + 1 - 9) 1 Calculate -14 + (14 - 1) + 2. 1 What is 2 + (15 + -7 + -11 - 16) + -4? -21 What is the value of -22 + (20 - 40 - -26)? -16 Evaluate (-7 - (11 - 15)) + (1 - 0) + 20. 18 Calculate -8 + (2 + -9 + 3 - (-10 + -1)). -1 What is the value of (-79 - -87) + (4 - 7) + 0 + -19? -14 Calculate 4 - (2 + (5 - (-9 + 6 - -18))). 12 Evaluate 19 + (14 - 12) + -33. -12 What is 4 + (4 + 12 + -3 - 21)? -4 Evaluate 2 - ((17 - 32) + 24 - (0 + 2)). -5 Calculate -1 + (18 - 20 - (0 + -11 + 2)). 6 Calculate (7 - -1) + 18 + -31 + -9 + 2. -12 What is (-5 - -5 - -28) + -4 + -9? 15 15 - (10 + (-6 - -15)) -4 Evaluate (-23 - -30) + -13 + 3. -3 Evaluate (-122 - -128) + (1 - -1 - -3). 11 Calculate -11 - (22 - 13 - 9 - 12). 1 What is the value of 17 + (8 - 33) - -8? 0 Calculate 10 - 2 - (1 + 13 - (-48 - -39)). -15 Evaluate (-11 + 24 - 31) + 13 + -2. -7 What is the value of (-10 - -20 - -5) + -13? 2 What is the value of (-4 + 6 + -8 - -9) + -10? -7 Calculate 37 - (48 + -28 + 25). -8 Calculate -2 - (18 + -15 - 19) - 4. 10 What is the value of 9 - ((3 - (2 + 3)) + 6)? 5 What is the value of 0 + -3 + 9 - (6 - (3 + -6))? -3 Evaluate -6 + (5 - -1) + 3 - -17. 20 What is the value of (15 - 23 - -1) + 16? 9 (5 - 25 - 0) + 49 + -42 -13 Calculate 3 + 1 - (0 + -6 + -3 + 3). 10 Calculate (40 - (1 + 9)) + -20. 10 -1 + 24 - (82 - 76) - 7 10 Evaluate -42 + 39 + -6 + -1 + 0. -10 -1 + 0 + 48 + -47 + -4 + -5 -9 (-2 - (1 + -5)) + -1 + (-18 - -9) -8 What is 5 - (2 - (2 + -9 + (-1 - -3)))? -2 What is the value of (-1 - (6 + -9 - (-3 + 1))) + 20? 20 What is the value of (-2 - (1 + 4)) + (-4 - -14) - 3? 0 What is 23 - (24 - 24) - 22? 1 What is 0 + 6 + (-77 - -57)? -14 What is 3 + -7 + -5 + 2 + (-47 - -70)? 16 What is 164 - 146 - (20 - -2)? -4 (-4 - (-2 + 1) - (-22 + 24)) + 0 -5 Evaluate 12 + (-12 - 17) + 10. -7 What is 82 + -84 + (-2 + -1 - -5) + -12? -12 Calculate 17 - (15 - -13 - 19). 8 What is the value of -14 + (1 - 1 - (9 - 6))? -17 What is the value of -1 + -1 - (16 - 8)? -10 What is the value of (-1 - -25 - (92 - 79)) + (8 - -1)? 20 What is -7 - -2 - (12 - 26) - (7 + 1)? 1 2 + -4 + -2 + 22 + 26 + -52 -8 What is -268 + 295 - (-2 - 1)? 30 Calculate 4 + -3 + (-3 - (2 - 5)) + 2. 3 Evaluate -5 - ((-3 + 8 - 3) + -6). -1 What is 23 + -19 + 6 + -24? -14 Calculate (-2 - 9) + -11 - -13. -9 What is -3 + -4 + (11 - 43 - -16)? -23 What is 8 + -18 + 20 + -4? 6 Evaluate -11 - (3 - (-13 - -15)). -12 Calculate (-5 - (0 - (7 + -7))) + -7 + 35. 23 What is (-13 + 7 - -6) + -3 + 0? -3 Evaluate 0 + 0 + (-12 - (-13 + -3)) - 6. -2 What is the value of -15 - 0 - (9 - 3 - (-25 + 30))? -16 Calculate -2 - -3 - (-6 + (0 - -19)). -12 What is 7 - (13 - (3 + 3)) - -9? 9 What is 0 + -7 - (-2 - (-15 + 11))? -9 Calculate (3 - -34 - 32) + -25 + -1. -21 -79 - -42 - -44 - (-9 + 1) 15 What is the value of -11 - (-17 - (-21 - -10))? -5 -13 + (1 - 1 - 12) + 3 -22 What is (70 - 66 - (-2 - 12)) + -6? 12 What is 20 + (31 + -12 - 45)? -6 What is -11 - (1 - (-1 + 5 + 9))? 1 What is -87 + 112 - (26 - 5)? 4 What is -12 - (-9 + (-10 - -15) + -5)? -3 Calculate -12 + -17 - -20 - 15. -24 Calculate -6 - ((-1 - (-4 - -9)) + -1) - 25. -24 What is -10 + (21 - -2) - (33 - 2)? -18 (23 - 13) + 9 + 1 + 3 - 3 20 What is the value of 31 - ((-15 - -23) + 16)? 7 Evaluate 15 - (19 - 9 - 14 - 8). 27 What is the value of -20 + (-15 - 0 - -28)? -7 -4 + -11 + (5 - -2) + 37 29 What is the value of (-15 - 2) + -5 + 49 + 5? 32 Calculate -1 + -21 + (59 - 71) + -1 + 12. -23 What is the value of 16 + -3 - (-5 + (22 - 5 - 7))? 8 What is -6 + 17 + 1 + -1? 11 What is the value of 13 + -4 - (7 + -3) - (10 + 1)? -6 Calculate (11 + -13 - -23) + -4. 17 Evaluate -3 + (2 - (-9 + 0 + 19)). -11 What is -2 - -9 - (5 + (10 - 18))? 10 Evaluate -3 + 4 - (4 + -8 + -1 + -1). 7 Calculate 1 + -7 - (3 + (52 - 66)). 5 Calculate (-2 + -16 - -56) + -36. 2 Evaluate 41 + (-13 + 1 + 8 - 13). 24 Evaluate -12 + (-21 - (-13 + -2)) + 47. 29 What is the value of (2 - 1 - (-1 + 0)) + (-17 - -14)? -1 -3 + 0 - (8 + (-14 + 12 - 3)) -6 Calculate -44 + (36 - (25 + -18)). -15 Evaluate 15 - (-3 + -8 + 4 + 7 + -1). 16 Evaluate (8 - 10 - -18) + -9. 7 10 - (8 + (2 - 10)) - 24 -14 Evaluate 5 + -26 + 11 - -6. -4 What is 36 + 25 + -95 - -28? -6 -4 + 6 + (6 - 41) -33 What is the value of -185 - -147 - (-17 - 0)? -21 What is the value of (9 - 15) + (3 - ((3 - -3) + -8))? -1 22 + (5 - -3) + (8 + -17 - -14) 35 Calculate (22 - 7) + 2 - 8. 9 Calculate (-75 - -77) + (-2 - -11) + -3. 8 -6 + (-2 + (-4 - -2) - -3) - 18 -25 What is (-7 - (2 - (-6 + 9))) + 0 + -6? -12 Calculate 6 - ((-6 - -8) + -10 - -1). 13 What is (-115 - -97) + (17 - 0) - 20? -21 Evaluate 42 + -36 + (-2 + 1 + 2 - -4). 11 -2 + (-5 - (-2 + -1)) - -20 16 What is (-11 + 48 - 8 -	{ "pile_set_name": "DM Mathematics" }
et m(y) = 2196y2 - 56y - 23. Is m(-11) prime? False Let x be (-1)/2 + 99/6. Let j = x + -10. Suppose -jm + 974 = -40. Is m a prime number? False Let v be (-6)/(-15) - (-12)/(-5). Let g(n) = 3n*2 + 10n - 87. Let i be g(-7). Is (12/i)/(v/85) prime? False Let y = 32 - 18. Suppose -h + 8h - y = 0. Suppose -18 + 272 = hd. Is d prime? True Let h(y) = -y*3 + 8y*2 + 23y + 5. Let f be h(10). Let s be 7 - (3/5 + (-187)/(-55)). Suppose -5u + f = r + 3r, -u = sr - 18. Is u prime? True Suppose 34y + 30y = -22y + 14428306. Is y composite? False Suppose 0i + 10 = 2i, 301 = -4u + 5i. Let k = -69 - u. Is 11/((-3)/(-2517) + k) a composite number? False Suppose -2 = a + 1. Let p(j) = -344j + 73. Let y(r) = -86r + 17. Let h(v) = -2p(v) + 9y(v). Is h(a) a composite number? True Suppose 5s = -7a + 4a + 3128, 4a = 3s + 4219. Suppose -5b = -3p + a, -3b - 293 = 2p + 349. Is (-13)/(852/b - -4) composite? True Let l(k) = 69k + 32. Let a be (-23 - -10)(3 - (-3 + 7)). Is l(a) a composite number? False Let v be 2(-3)/2 + 9516. Suppose -18q = -20205 - v. Is q prime? False Let i = -1575 + 1574. Let l(m) = 4m + 1. Let y be l(-1). Is -1(y + 616)i prime? True Suppose -5v + 4z = -1607, 5v + 3z - z - 1619 = 0. Suppose -4w - 3q = q - 1260, v = w + 3q. Is w prime? True Suppose 3h = 9h - 30. Suppose z - i - 1127 = 0, hz + 4i + 196 = 5813. Suppose 907 + z = 8o. Is o prime? False Let g(n) = 21n + 4142. Let k be g(0). Suppose 4 = -3v - 8, -2b + v + k = 0. Is b a composite number? False Suppose 3w - s = 3131, -5s + 1033 = 65w - 64w. Suppose 0 = 5g - 4720 + 1390. Suppose 0 = -l + g + w. Is l composite? False Let p(l) = 29506l + 159. Is p(5) a prime number? True Let n(z) = -4008z - 11. Let h be n(-3). Suppose 6008 = u + 7y - 6y, -y - h = -2u. Is u composite? False Let y be (-511476)/252 - (1 + -2)/(-3). Let r = y - -4191. Is r a composite number? False Is (-2740433)/(-387) + (-116)/36 + 3 a prime number? False Let s be (-1176)/10 - 0 - 27/(-45). Let c = s + 334. Is c a composite number? True Let i be 32 - (35/7 - 0). Suppose iy = 5y + 142714. Is y a prime number? False Let p(q) = -138q. Let m(f) = -139f + 1. Let s = -14 + 18. Let d(w) = sp(w) - 5m(w). Is d(8) composite? True Let u = -17253 + 170132. Is u prime? True Let g be (21/6 + -5)/((-6)/8). Suppose -v - h = -87, 4v + h + gh = 350. Is v prime? True Suppose -1 = -31u - 1. Suppose u = -16s + 25654 + 8698. Is s a prime number? False Suppose -45833750 - 55229742 = -93r - 23r. Is r a composite number? True Let b be (0 - 0)/(6 - 5). Let d(i) = 4i2 - 2i + 5261. Is d(b) a composite number? False Let m(a) = 2a3 - 97a*2 - 208a - 211. Is m(64) composite? False Let k(s) = -44s3 - 14s*2 - 9s - 67. Is k(-10) a prime number? False Let t(b) = 846b2 - 1331b + 31. Is t(16) a composite number? False Let j = -194767 - -296034. Is j a composite number? False Let g(t) = 48t2 - 10t - 15. Let j be g(-10). Suppose -5x - 5u + 2619 = -2251, -j = -5x - 2u. Is x prime? False Let l(p) = 6p2 - 88p - 739. Is l(-53) a composite number? True Is (1 - (5 - 10))(-2492485)/(-15) + 3 composite? True Let g(l) = 12391l - 12661. Is g(12) composite? True Let a(x) = -15544x + 959. Is a(-18) prime? True Let c = 3040600 + -2147223. Is c prime? False Is (-340/9 - 6)3183/(-2) a composite number? True Suppose 3763x - 3760x - 538487 = 4b, 2b = -5x + 897487. Is x a composite number? False Let q(k) = 9k + 502. Let s be q(22). Let i = -3 - -5. Suppose iu - 7702 - s = 0. Is u a prime number? True Let o(s) = s*3 + 18s*2 - 17s - 21. Suppose 6m - 2m + 2h - 22 = 0, 3h - 3 = 0. Suppose 6v = mv - 17. Is o(v) a prime number? True Let c be (-3 - -2)/(-12/4110). Let p = 3046 - c. Is p composite? False Suppose -q - 4312 = -5h + 2h, 3h - 4q = 4324. Suppose 2i = -2c - h, -2c - 2c + i = 2857. Let j = 1206 + c. Is j composite? False Let p(k) = -8 + 3k - 2 - 7. Let y(q) = 3q2 + 50q - 5. Let f be y(-17). Is p(f) prime? True Let p(a) = -4a - 9 + 15 - 9 + 3129a*2 - 6a - 12. Is p(-2) composite? True Is (-1122912)/(-9) + 2 + -5 a prime number? False Let u = -169749 - -276470. Is u a composite number? False Suppose 0 = -15y + 519 + 24876. Let f = y + -873. Suppose 0 = 7m - f - 2967. Is m a composite number? False Suppose -28099 = -h + 3w, 4h - 91713 - 20767 = -2w. Is h a prime number? False Suppose -12487225 = -5f - 5z, f - 2z = -z + 2497449. Is f a composite number? False Let x(u) = 15494u2 + 221u + 646. Is x(-3) prime? True Let j(u) = -2u + 3. Let w be j(3). Let b = -5283 + 5280. Is 4445 - w/(b + 0) a prime number? False Suppose 8a - 30a = -264. Suppose -790 = -14s + as - 2m, -5s + 3m = -1991. Is s composite? False Let y(u) = 51u*2 + 113u + 11. Let l be y(-17). Let q = -8886 + l. Is q composite? False Is 5215 + (4/8)/(378/(-48) + 8) prime? False Let o(p) = -3980p + 531. Is o(-5) a prime number? True Let j(h) = -1028h - 15. Let a be j(-4). Suppose -5q - 6r + 6865 = -10r, 3q = -2r + a. Is q a prime number? False Suppose -46894486 + 48429838 = -206d + 107062766. Is d a prime number? True Let j(b) = 10459b - 1280. Is j(33) a composite number? True Let a(v) = 2v*3 - 4v*2 + 68v - 257. Is a(58) a prime number? False Let r be 143832/36 - (-4)/6. Let i = r + -985. Suppose 3557 + i = 4a. Is a a prime number? False Let l(a) = -2a*2 - a - 12. Let p be l(-5). Let z be (5 + -2 - p/(-15))-1285. Suppose 3b = -b + z. Is b a composite number? False Let s(n) = -7n - 3n - 38 + 3n. Let y be s(-6). Suppose yx = 2659 + 1113. Is x a prime number? False Suppose 16v - 16736881 = -33v. Is v composite? False Suppose -c = -13n + 12n - 6017, 3c = -3n + 18081. Let l = -2993 + c. Is l a prime number? False Suppose 6w - 1721915 = 19w. Is (-10)/7 + 2 + w/(-35) a composite number? True Suppose 4h - 2j = -h + 24937, -4h + 4j = -19952. Is h a composite number? False Is (-27)/(1620/105) + (1 - 1733661/(-12)) prime? False Is (166856(-91)/14)/(-4) prime? False Let z(g) = g*3 + 2g*2 - 16g - 303. Is z(16) a prime number? True Suppose -1560804 - 3566726 = -95m. Is m a composite number? True Suppose d - 6d + 10 = -2q, d = -2q - 10. Is (-71284)/q - 12/(-60) a prime number? False Suppose 4q + x = 81, -4q = -6x + 4x - 78. Suppose 0 = qw - 21w + 2. Suppose -wn + 4n - 3o = 3082, -5n - 5o = -7655. Is n composite? True Let w(i) = 2904i + 165. Let z be w(31). Suppose -14t - 3x - z = -18t, -5 = -x. Is t a prime number? False Suppose 4x - 69x = 78x - 43299971. Is x a prime number? False Suppose 28u - 4169293 + 1471540 - 3909883 = 0. Is u prime? False Let c(z) = 20638z - 625. Is c(29) composite? True Let w = -159 + 69. Let q = w - -88. Is q/(-8 + 22) + 8366/7 prime? False Suppose 0 = 12o + 3o - 5203 + 1318. Is o composite? True Suppose 0 = -4a - 16, 3y - a - 4a = 4658. Let c = y + -575. Is c composite? False Suppose q = -6u + 547452, -4u = -2q - 147952 - 217032. Is u composite? False Let j = 120 + 228. Let r = 1849 - j. Is r a composite number? True Suppose 7 = -12h + 31. Suppose 0 = -4q + 3k + 13679, -4k + hk = -4q + 13678. Is q prime? False Is (-452)/(-12)45505/(-38)(-18)/15 a composite number? True Let j = 32125 - 21806. Is j a prime number? False Let h = 129 - 29. Suppose 839 = a + h. Is a a composite number? False Let w = -48927 + 378418. Is w a prime number? False Let t = 219995 + -83184. Is t prime? True Suppose -3a + 47 - 170 = -n, -4a - 164 = -2n. Let q = a - -822. Is q prime? False Let u(z) = -162z*3 + 6z*2 - 31. Is u(-22) composite? True Let v be ((-826)/5)/(13/325). Suppose 11j - 58429 - 8748 = 0. Let p = j + v. Is p a composite number? True Let b be 7(-2 + (-12)/(-7)). Is b/((-24)/18369) - (-1)/4 a composite number? False Let o = -40245 + 24039. Let c be (-1 + (-1 - -14))/((-148)/o). Suppose -2v + c = 2u, -5v + 2632 = -v + 5u. Is v composite? False Suppose 10h = -6h - 632064. Is 17/85 + h/(-5) composite? False Let j(t) = -388t - 4 - 2 - 1 + 393t. Let u be j(5). Let o = 395 - u. Is o a prime number? False Let j = 14907 + -613. Let m = -9925 + j. Is m prime? False Suppose 34f + 90 = 39f. Suppose 81c = fc + 143577. Is c prime? False Suppose -l - 3l = -0*l. Suppose j = -	{ "pile_set_name": "DM Mathematics" }
2)(s - s + 2s3) + 0s*2 - 2s*5 + 0s*2. 5s*5 Expand (4 - 1 - 2)(3 - 3 + 2c4) - c4 + 4c4 + c4 - c*4 + 3c*4 - 4c*4. 4c*4 Expand (4u + 2u2 - 4u)(-22 + 2u + 22)(3u*2 - 3u + 3u). 12u*5 Expand (0t + 0t - 2t*4)(3 - 4 + 2) + (3 - 3 - 2)(0t4 + t4 + 0t4). -4t*4 Expand (-v - 3v + v)(9v*2 - 4v*4 - 9v2) + v4 - 2v2 - 2v4 + v5 + 3v4. 13v*5 + 2v*4 - 2v*2 Expand (-t + 1 - 1)(-6t2 + 2t*2 + 3t*2)(7t + 2t - 4t). 5t*4 Expand a + a - 5a - 5a + 2a + a + (2a + a - 4a)(1 - 5 + 3) + (-2 - 3 + 4)(3a + 0a - 4a). -3a Expand (3i4 - 2i*4 - 6i*4)(4i - 5i + 4i). -15i*5 Expand (-15j + 6j4 + 15j)(3 + 1 - 2) + (j + 5j*2 - 4j - 4j2)(-3j2 + j2 + 0j*2). 10j*4 + 6j3 Expand (-w2 + 1 - 1)(2 - 2 - 1)(2w - w - 2w) + (2w - 3w + 5w)(-1 + w*2 + 1). 3w*3 Expand (26v*2 - 26v*2 + 13v*4)(-1 + 1 + v)(-1 - 2 + 1)(5 + 0 - 3). -52v5 Expand (-3h*2 + 4 - 4)(-5 + 2h - 3h + 8) + (-4h + 0h + 3h)(-h2 + h2 - h*2). 4h*3 - 9h*2 Expand (5 - 1 - 2)(-3 + q*2 - 3q2 + q2). -2q2 - 6 Expand -u3 + 5u*3 + 4u*3 + (u - u - 3u)(4u*2 - 3u*2 - 2u*2). 11u3 Expand -a3 + 2a - 2a + (1 - 7 + 2)(a3 - 3a*3 + 0a*3) + 9a3 - a3 + a*3. 16a*3 Expand (-f + 2f*3 + f)(6 + f - 6) + 73f2 + 11f*4 - 73f*2. 13f*4 Expand (m - 2m - 11m)(-m*2 - 4m2 + m2). 48m3 Expand 4r*2 - 3r*2 - 3r*2 + (17 - 8 - 10)(2r2 - 4r2 - r2). r*2 Expand (0 - 5 + 3)(u*2 - 5u*2 + 5u*2) + 4u - 4u + 2 + u2. -u2 + 2 Expand (-21 + 21 + 2j*2 + 2j)(4 + 0 - 3). 2j*2 + 2j Expand (o + 0o + 7o)(-o4 + 3o*4 - 3o*4). -8o5 Expand (-c5 + c*5 - 3c*5 + 4c*2 - 4c*2 - 2c*5 + (0 + 0 - c)(2c4 + c4 - c4))(-5 + 5 - 4). 28c5 Expand (-8s*2 + 5s*2 + 3 + 4)(0s + s2 + 0s). -3s4 + 7s*2 Expand 2h + 0h - h3 - h - 6h*3 + 10h*3 + 0h*3 + (2h*3 - 4h3 + h3)(-2 + 1 - 1). 5h*3 + h Expand ((-3q + 2q + 2q)(1 + 1 - 4) + 3q - q - q)(7 - 7 + 16). -16q Expand (-2y2 + 2y2 + y3)(2 + y - 2) + 4y4 + y4 - 2y4. 4y4 Expand (r2 - r*2 + 2r*2)(4566r2 - 4566r*2 + 76r*3). 152r*5 Expand (3 - 3 - 2z)(-14 + 77 - 7). -112z Expand (-1 - p*2 + 1)(2 - 30p - 4 + 21p). 9p3 + 2p*2 Expand 23c - 23c - 4c*2 + (-3 + 2 + 2)(c2 + 4 - 4) - c2 + 0c2 + 3c*2 + 3c + 3c2 - 3c. 2c2 Expand (0 + 0 + 2g)(-6g2 + g2 + 4g2) + (-g3 + 2 - 2)(-1 + 4 - 2). -3g3 Expand (0m + 3m - 4m)(-4m + 3m + 0m) + 62 + 8m2 - 62. 9m2 Expand (v2 + 0 + 0)(v + v - 3v) + v*3 - 3v*3 + 4v3 + v3 + 2v2 - 2v*2. 2v*3 Expand ((-3s + 4s + 4s)(s2 - 2s*2 + 0s2) + s3 - 3s3 + s3)(-3s + s + s). 6s*4 Expand -3w*5 + 0w*5 + 0w*5 + (6w*5 - 4w*5 - 3w*5)(8 - 1 - 2). -8w5 Expand (3g - 3g + 2g*3)(-3g2 + g2 - 2g2) - g5 - 7g3 + 7g*3. -9g*5 Expand 3 - 3 - d + (-3 + 1 - 4)(0 + 0 - d) + 0 + 6d + 0 - 2d + 3d - 2d. 10d Expand (-11j - 20j + 21j)(2j*4 + 3j*4 - 6j*4). 10j*5 Expand (3 - 2 - 5)(2g + 0g - g). -4g Expand -3k + k + k + (-2 + 2 + 2k)(1 - 6 - 1). -13k Expand (4 - 2 - 1)(-2f2 + 2f*2 - 2f*2 + (1 + 5 - 2)(4f - 4f - f*2)). -6f*2 Expand 0o*5 - 3o5 - o5 + (2o - o - 3o)(-2o*4 - 4o*4 + 5o*4). -2o*5 Expand ((-1 + 4 - 2)(0z + 3z - 5z) - z + 3z - z)(-4z*2 - 2z*2 + 0z*2). 6z*3 Expand -2a4 + a4 + 4a4 + (0a + 5a3 + 0a)(3 - a - 3). -2a*4 Expand (3r2 + r2 - 5r2)(2r3 + 4r*3 - 5r*3 + (11 - r - 11)(0 + 2r2 + 0)). r5 Expand (0t*2 + 3t2 - t2)(-3t + t + 3t) - 4t*3 - 3t + 3t - t. -2t*3 - t Expand (2t*3 - 2t*4 + 4 - 4)(0t - 3t + 7t). -8t*5 + 8t*4 Expand (-1 + 4 - 1)(0q - 3q - 3q)(-2 + q*2 + 2). -12q*3 Expand 2 + 2 - 8 - 6x - x + 2x - 3x + 0x + x - 3x + (1 + 2 - 2)(-3x + 3x - 2x) - 2x - 2x + 3x. -13x - 4 Expand (-5 + 2 + 1)(-5 + 6 + 8l + 0). -16l - 2 Expand (a + 3a - 6a)(4 + 0 - 6) - 4a + 2a + a - a + 5a + 2a + 0 + 0 - 4a. 5a Expand 1 + 2c4 - 1 + 5c4 + c4 - 4c4 + (0c*3 + 3c*3 - 2c*3)(6c - 4c - 3c) + 4c*4 + 2c*4 - 4c*4. 5c*4 Expand -u + 6u - 4u + (0u - u + 3u)(2 - 1 + 0) + u - 4u + 4u - 2 + 2u + 2 + 0u - 2u + 0u + 3u - u + 1 - 4u. 2u + 1 Expand (-173z + 2 + 380z - 181z)(z4 + 0z*4 - 2z4) - z4 + 2z5 + z4. -24z*5 - 2z*4 Expand (-1 + 1 + k)(-9 - k + 9)(-2 + 3 - 3). 2k*2 Expand (-10c*2 + 53c - 53c)(2c - 3 + 3) - 4c + 2c3 + 4c + (2c2 + 2 - 2)(-c - c + 0c) - c3 + 3c3 - c3. -21c3 Expand b3 + 5b*3 - 23b*3 + 4b*3 - 4b3 + b3 + (2b - b - 3b)(b2 + 2b2 - b2). -20b3 Expand (0 - 4l*2 + 0)(-4l - 5 + 10 - 4). 16l*3 - 4l*2 Expand (4v*2 - 2v*2 - 3v*2)(v*2 - 2v - 7v2 + 2v*2)(0 + 1 + 1). 8v4 + 4v*3 Expand (-3y - y + y)(3y - 4y - y) + y - y2 - y. 5y*2 Expand -4 + 4 - 2k*3 + (-1 + 3 - 3)(4k3 - 3k*3 + 0k3) - 3 + 3 + k3 + (k3 - k2 + k*2)(-2 - 2 + 2). -4k3 Expand 3y*4 - 6y4 + y4 + (2y3 + y3 - y3)(-y + 0y + 0y) - 6y4 - 19y*4 + 0y*4. -29y*4 Expand (19h - 18h - 3 - 1)(0h + 0h + h). h*2 - 4h Expand (-n - 3n + 5n)(2 - 3 - 1)(-4n + 10n + 3n). -18n*2 Expand 5g*2 - 2g2 - g2 + (g*2 + 0 + 0)(3 - 4 - 2). -g*2 Expand (-24c + 22 - 22)(-2c - 2 + 2). 48c2 Expand (0 - 1 + 2)(3 - 5 + 0)(2 + 3b - 1 + 6b). -18b - 2 Expand -2c5 + 2c*3 - 2c*3 + (-3c*4 + 2c4 - c4)(c + c - 1 - 1). -6c*5 + 4c*4 Expand (-3l*2 - 2l*2 + 3l*2)(-7 - 8 + 17)(-3 - 4 + 5). 8l*2 Expand 4q*4 + 3 - 3 + (0q - 2q4 + 0q)(2 + 0 + 1). -2q*4 Expand (-2r + 5r - 5r)(-2r + 0r + 3r) + 119r - 65r - 23r2 - 54r. -25r2 Expand (1 + 2l - 2l2 - 1)(2l - 3l + 0l). 2l*3 - 2l*2 Expand (-2i - 4i + 5i)(2i + 4i - 4i)(4 + 0 - 1). -6i*2 Expand (4 - 4 + 2h)(-2h*4 + 2 - 2 + (3h - h - 5h)(2h3 + 0h*3 + 3h*3)). -34h*5 Expand (-2h + 3h + h)(-10h2 - 5h + 7h2 + 2h*2). -2h*3 - 10h*2 Expand (-7b*2 + 20b*2 - 3b*2)(b + 2b3 - b). 20b*5 Expand (-174c - 2 + 173c + 5c*2 - 3c*2)(-c2 + c2 + c*2). 2c4 - c3 - 2c2 Expand (-1 + 1 - s2)((2 - s - 2)(-s - 3s + 2s) + 3s - 3s - s2 - 4s*2 - 1 + 1). 3s*4 Expand (0 + 0 - 2t)(4t*2 - 2t*2 + 0t*2)(-2t2 - t2 + 2t*2). 4t*5 Expand (r - 3r + r)(-1 + 5 - 2) + 7r - 11r - 4r - 3r + 4r + r - 4r + 4r - 2r + (2 - 1 + 1)(0 - 2r + 0). -14r Expand (-5 + 5 + 2m)(-1 + 1 - 1)(-m + m + 2m). -4m2 Expand -m4 - 3m*4 - 1 + 7m*4 + (5m2 - m2 - 2m2)(-3 - 2m2 + 3). -m4 - 1 Expand (21 - 17 - 5d + 2d)(-6 + 1 + 3)(-4 - 1 + 3)(4d - 4d - 2d). 24d*2 - 32d Expand (r + 5 - 5)(r + 2 - 2) + (-2 + 2r + 2)(2r + 0r + 0r). 5r2 Expand 4x*3 + 0x*3 - 2x*3 + (2x - 5x + 2x)(x2 + 0x + 0x) - 3 + 3 - x3 + 0x*3 + 0x*3 + 3x*3. 3x*3 Expand (5l2 - l2 - 5l2)(3l - l - 3l) + 5l2 + l3 - 5l2 - l3 - 3 - 2 + 3l3. 4l*3 - 5 Expand ((-2 - 4 + 3)(-4s + 2s + 3s) - 2 + 2 - s)(2s + 6 + 5 + 0s). -8s2 - 44s Expand 0 + m*3 + 0 + 2m*2 - 2m2 + m3 - 2m3 - 2m*2 + 2m*2 + (-5m*2 + 2m2 + m2)(-4m + 3m - m). 4m*3 Expand (-4 + 6 + 0)(s - 15s - 4s). -36s Expand (2 + 2 - 8)(3 + 1 - 3)(-3m*2 - 8 + 8). 12m*2 Expand (-2x*2 + 2 - 2)(4x3 + 0x*3 - 3x3) + x3 + x5 - x3 + 4 + 0 + 0x5 + 4x*5. 3x*5 + 4 Expand (-2 + 3 + 1)(1 + 2 - 1)(g + 0 + 0). 4g Expand (0g + 87g + 18g)(-2g + 2g + 2g). 210g2 Expand (-k2 - 2k2 + 4k*2)(-5 - 4k - 3k + 11k). 4k*3 - 5k*2 Expand 3s + 2s2 - 3s + (6s - 2s + 0s)((3 + 1 - 2)(-s - 3s + 3s) + 3s + 0 + 0). 6s2 Expand (-1 + 0 + 0)(-k - k - k*2 + 4k + (-3 + k + 3)(k + k - 5k)). 4k2 - 2k Expand (3k2 - 4k*2 - 6k*2)(-1 + 1 - 1)(0 + 0 - k3). -7k*5 Expand (7 - 7 - j)(j + 1 + 0j2 - 2j*2 - 3j). 2j3 + 2j*2 - j Expand (0 - 1 + 0)(-2v + 3v - 2v)(-v*2 + 5v*2 + 0v*2). 4v*3 Expand (0s + 0s - 2s)(0s	{ "pile_set_name": "DM Mathematics" }
h) be the second derivative of -h*4/6 - 9h*2 - 64h. Let f(p) = p*2. What is b(f(i))? -2i*4 - 18 Let k(b) = -1792b + 2. Let z(x) = -4x + 8. Calculate z(k(y)). 7168y Let a(r) = -322r. Let g(x) = x + 1. Let h(n) = -2n - 1. Let u(q) = -2g(q) - 2h(q). Calculate a(u(o)). -644o Let h(y) = -97y*2 + 30y*2 + 62y*2. Let t(q) = 76q. Determine t(h(p)). -380p2 Let i(g) = -2g*2. Let c be 0/(-2 + 36/12). Let j(p) be the first derivative of 0p + cp2 + 8 + 7/3p*3. Determine j(i(d)). 28d4 Let g(z) be the second derivative of -z3/3 + 23z. Let d(q) = -228q. What is d(g(v))? 456v Let n(t) = -2155772t. Let w(z) = 3z2. Calculate w(n(o)). 13942058747952o*2 Let g(b) = 2b*2. Let x(o) = -13o*2 - 50o*2 - 38o*2. Calculate g(x(u)). 20402u*4 Let a(h) = 4h. Let i(r) = r*2 - 3166r - 10. Determine a(i(y)). 4y2 - 12664y - 40 Let u(f) = 7732f2 - 15463f*2 + 7732f*2. Let i(j) = 766j*2. Calculate u(i(o)). 586756o*4 Let t(b) = 11b - b - 4b. Let u(o) = -7o. What is t(u(h))? -42h Let j(x) = -4x + 1. Let z(d) be the first derivative of -4d2 + 121. What is z(j(w))? 32w - 8 Let i(a) = -66a2. Let k(c) = -568c. Calculate i(k(r)). -21293184r2 Let j(i) = i + 20. Let t be j(-18). Let k(z) = 5z2 + 35 - zt - 35. Let y(x) = 8x. Calculate y(k(d)). 32d*2 Let x(l) = 0l + 0l + 2l. Let n = -65 + 111. Let v(b) = 33b - nb + 0 + 0. Calculate x(v(w)). -26w Let t(m) be the second derivative of -m5/60 + m4/24 - 29m3/6 + m. Let p(c) be the second derivative of t(c). Let w(g) = g2. Determine w(p(i)). 4i2 - 4i + 1 Suppose -9a + 109 = -8a. Let o(z) = -a + 15z + 109. Let q(y) = -2y*2. What is q(o(n))? -450n*2 Let k(g) = -2g. Suppose 0 = 5x - 7n + 5n - 14, -18 = -5x + 4n. Let b(y) = 279y - 279y + 0y2 + yx. Determine k(b(c)). -2c2 Let y(x) = -4x - 9. Let u be y(-5). Let b(m) = 1 + 8m2 - um*2 - 1. Let v(h) = 15h*2. What is b(v(r))? -675r*4 Let g(z) = 652582z2. Let m(c) = -c2. Give g(m(s)). 652582s4 Let c(p) = -448808p. Let o(l) = 9l2. What is o(c(y))? 1812857587776y*2 Let j(c) = 39c - 123c + 46c + 35c. Let k(d) be the second derivative of d4/4 + d. Calculate j(k(l)). -9l*2 Let c(j) = 14607j. Let g(u) = 17u. Determine g(c(k)). 248319k Let w(n) = n. Let l(p) be the first derivative of -2p3/3 + 305p + 794. Calculate w(l(v)). -2v2 + 305 Let l(s) be the second derivative of -91s4/12 + s2/2 - 6s + 1. Let v(z) = -2z. Determine l(v(c)). -364c2 + 1 Let h(z) be the third derivative of 19z*5/12 + 32z*2 - 2z. Let d(k) = -4k. What is h(d(m))? 1520m*2 Let g(i) be the first derivative of -2i3/3 - 92. Let u(s) = s2. Give u(g(z)). 4z4 Let f(g) = -323g - 11. Let u(b) = 8b - 3. What is u(f(x))? -2584x - 91 Let y(l) = 16l2. Let d(n) = -5128n. Calculate y(d(f)). 420742144f2 Let t(x) = 297468x. Let c(j) = -2j2. Determine c(t(w)). -176974422048w2 Let v(b) be the third derivative of -b6/180 + 22b3/3 - 11b*2. Let n(o) be the first derivative of v(o). Let u(s) = 30s. Give n(u(m)). -1800m2 Let g(z) = -5z*2. Suppose 0 = 4r - 121 - 183. Let x(c) = -36c - 38c + rc. Calculate x(g(t)). -10t*2 Let k(c) = -4c*2 + 10c*2 - 5c*2. Let n(w) = 11w + 8w - 20w. Give k(n(l)). l2 Let v(d) = d3 - 14d2 - 14d + 15. Let q be v(15). Let w(o) = -2o2 + 30o - qo. Let l(r) = 2r*2. Calculate l(w(h)). 8h*4 Let t(j) = -4j*2. Let z(m) = -1 + 44m - 26m - 24m. Determine z(t(h)). 24h2 - 1 Let z(o) be the first derivative of 5o*3/3 + 321. Let l(i) = 5i. Let c(d) = 11d. Let k(u) = 6c(u) - 13l(u). What is z(k(p))? 5p*2 Let i(t) = 49t - 2. Let v(p) = -556p2. Determine i(v(q)). -27244q*2 - 2 Let n(p) = 4p. Let q(d) = 258d - 2. Determine q(n(o)). 1032o - 2 Let d(b) be the third derivative of -b*4/24 - 131b*2. Let j(x) = -12x - 1. Give j(d(y)). 12y - 1 Let p(u) = 2u*2. Let a(y) = -51y*3 + 3y*2 + 2y - 1. Let i be a(-2). Let j(w) = -415 + i - 14w. Give j(p(s)). -28s*2 Suppose -2g = -g - 1. Let b be (-4)/1g/(-2). Let i(f) = -21 + 21 + fb. Let u(m) = 5m*2. Give u(i(y)). 5y*4 Let z(b) = 2b*2 - 2b - 2. Let i = 17 + -20. Let l(d) = -2d2 + 3d + 3. Let h(w) = iz(w) - 2l(w). Let o(x) = -6x2. What is o(h(r))? -24r*4 Let u(c) = -13c*2 - 4c + 4. Let r(y) = -39y2 - 13y + 13. Let h(s) = -4r(s) + 13u(s). Let b(d) = -3 - 8d2 + 6d*2 + 3. Give h(b(o)). -52o*4 Let m(z) be the first derivative of -2z*3/3 + 574. Let s(l) = -l. Let f(j) = 7j. Let r(y) = -f(y) + 2s(y). What is m(r(k))? -162k*2 Let t(i) = -2i*2. Let m(x) = 153024x. What is m(t(g))? -306048g2 Let i(h) be the third derivative of 7h*4/12 + 455h2. Let p(n) = n2 - 79. Determine i(p(v)). 14v2 - 1106 Let i(u) = -12u2. Let a(t) = t2 + 8t - 1256. What is a(i(g))? 144g*4 - 96g*2 - 1256 Let x(c) = 32c*2 + 40. Let m(i) = -11i*2 - 12. Let w(g) = 10m(g) + 3x(g). Let u(b) = -38b. Calculate u(w(z)). 532z2 Let b(g) = -6g*2. Suppose -4l - 8 = 2o, -3o - 4l = -18 + 26. Let q(d) be the second derivative of -11d + od2 + 0 - 1/6d*3. What is b(q(a))? -6a*2 Let n(a) = 161a. Let j(m) = -6m + 172. Give n(j(d)). -966d + 27692 Let j(f) = 50f. Let r(n) be the second derivative of -n3/3 - 44n - 2. Calculate r(j(k)). -100k Let s(w) = -2w*2. Suppose 3o - 30 = -5m, -109m - 35 = -114m - 2o. Let n(k) be the first derivative of 0k + m + 1/2k*2. Give s(n(q)). -2q*2 Let p(v) = -7v - 580. Let z(j) = 10j2 - 5j. Give p(z(l)). -70l2 + 35l - 580 Suppose 163 = -6y + 877. Let t(b) = -31b*2 + yb*2 - 57b*2. Let r(c) = -c. Give r(t(s)). -31s*2 Let t be 3/11 + -9 + 6. Let i(l) be the third derivative of 4l2 - 1/60l*5 + 0l*4 + 0l*3 + 0l + t. Let m(c) = -2c. Give i(m(d)). -4d2 Let l(n) = -n2. Let z(g) = 20g + 30. Suppose 0t - t - 3b - 39 = 0, -3b = 9. Let q(x) = -1. Let i(a) = tq(a) - z(a). Determine i(l(r)). 20r*2 Let t(y) = 39y*2 + y - 174. Let h(i) = 2i. Give t(h(j)). 156j2 + 2j - 174 Let b(h) = -270h. Let m(r) = -44r + 9. What is m(b(f))? 11880f + 9 Let m(x) be the third derivative of 0x3 + x2 + 0 - 1/24x4 + 0x. Let v(b) be the second derivative of 5b4/12 + 134b + 2. Give v(m(p)). 5p2 Let u(y) be the third derivative of -y5/120 - 2y*3/3 + 7y*2. Let x(h) be the first derivative of u(h). Let g(i) = 6i - 3i2 - 6i. Calculate g(x(v)). -3v2 Let n(t) = 58t*2 - 2. Let h(q) = -q. Calculate n(h(s)). 58s*2 - 2 Let n(i) = 2i - 3. Let o(a) = -6a + 10. Let c = 47 - 44. Let j(u) = co(u) + 10n(u). Let b(x) = -5 + 5 - 2x. Calculate j(b(f)). -4f Let q(d) = -121d*2 + 1. Let u(i) = 5i - 4. Determine q(u(p)). -3025p2 + 4840p - 1935 Let k(l) be the first derivative of 70l2 - 2l + 296. Let g(i) = 2i. Give k(g(z)). 280z - 2 Let u(k) = -29k. Let n(m) be the first derivative of 2/3m*3 + 0m + 0m2 - 15. Calculate u(n(p)). -58p2 Let q(r) be the third derivative of -r5/30 - r*2. Let s(o) be the third derivative of -13o4/12 + o2 - 81o. Determine s(q(v)). 52v*2 Let a(t) = t - 6. Let u(r) = -4657r. What is a(u(o))? -4657o - 6 Let b(a) = 215a. Let f(p) = -3371p. Determine f(b(h)). -724765h Let z(s) = 20s2. Let u(k) = -k + 2. Let d(q) = 3q - 4. Let l(w) = -d(w) - 2u(w). Give l(z(f)). -20f*2 Let x(s) = -33s. Suppose -4g + 15 + 9 = 4i, 0 = 2i - g. Let b(l) = il*2 - 174 + 174. What is x(b(a))? -66a*2 Let x(y) = -3y2 - y2 - 10y2. Let u(i) = -6i*2 - 84i + 6. Let t(k) = 11k2 + 140k - 10. Let f(v) = -3t(v) - 5u(v). What is f(x(c))? -588c4 Let a(x) be the second derivative of -x4/4 + 13x*2/2 + 140x. Let z(p) be the third derivative of -p*4/24 + 2p*2. Calculate z(a(s)). 3s2 - 13 Let r(y) = -y2. Let h(g) be the third derivative of 145g4/24 + 55g*3/6 + 13g*2. Let o(v) = 8v + 3. Let p(i) = -6h(i) + 110o(i). Calculate r(p(k)). -100k2 Let t be -2(221/(-2) + -3). Let y(g) = g - t + 227. Let o(r) = -r + 1. Let l(a) = 9a2 + 18a - 18. Let j(b) = -3l(b) - 54o(b). Calculate y(j(c)). -27c2 Let f(h) be the second derivative of -29h*4/6 + 55h - 3. Let u(a) = a*2 - a. Let s(r) = 8r*2 - 10r. Let i(c) = s(c) - 10*u(c).	{ "pile_set_name": "DM Mathematics" }
Let j be 7 - (4 + 60/(-8))-215. Which is smaller: j or -112? -112 Let j = -345 - 8. Let a = j - -335. Which is smaller: a or -118/7? a Let r be 0 - -1 - (-847)/(-28). Let a = -1/1695 - -110177/3390. Let z = a + r. Is z equal to 2? False Let h(f) = f*3 - 3f*2 + f - 5. Let i(o) = -6o - 1. Let c be i(-1). Let k be h(c). Let n = k - 67. Is n > -18? True Let k be (-19 + 1)74/(-148). Let m be (-2360)/(-60)(k/(-6) + 0). Which is bigger: 0.01 or m? 0.01 Let w be (28/(-528))/((-3)/24). Let c = w + -301/165. Is -2 at least c? False Let q = -22 - -41. Let o = 7800.03 - 7800. Which is smaller: o or q? o Suppose 5b - 3334 + 134 = 0. Suppose -4s + 224 = -b. Is 214 < s? True Let a = 4924 - 4922. Which is smaller: a or 86/57? 86/57 Let c = -43.36 - -15.36. Which is greater: c or 1.07? 1.07 Let q = 18485 - 18472. Which is smaller: q or -239? -239 Let c(u) = -6798u - 275. Let s be c(-1). Is s bigger than 6524? False Suppose -3j = -4y + 73, 5y + 0j + j = 77. Let q(b) = -8b + 9. Let t(c) = 15c - 18. Let p(m) = -11q(m) - 6t(m). Let f be p(-4). Is f > y? True Let h be 27/(-2) + (-20)/40. Let w be 7/(h/(-260)) + 3. Let a be 38/w - (-220)/14. Is a at least as big as 15? True Let k be (-18069)/30 + 18/60. Let v be (-4 - 210/(-49)) + 176/k. Which is smaller: v or 1? v Let f = -14942 - -432298/29. Is -34 <= f? False Suppose -2x + 5v + 7208 = -3x, -5x - 5v - 36040 = 0. Which is greater: -7209 or x? x Let h be (-978)/16((-4708)/(-132) - 35). Suppose 0 = -5t - 25, f + 50 = -0f - 2t. Which is smaller: f or h? h Let i = 2.08 + -1.987. Let l = i + 6.907. Is l < 1? False Let l be (-1)/(2(-7)/42). Suppose 3u - 159 = 3k, 0 = -lu + 2u. Which is greater: k or -160/3? k Suppose -75g + 82g = 0. Suppose 5p - 292 - 203 = 0. Let w be 3/12 + p/(-492). Does w = g? False Let z be ((-35)/(-15) - 2)/((-4)/3852). Let j = 421 + z. Is 100 less than j? False Let r(l) = -37l3 + 2l*2 + 7l + 10. Let j be r(-2). Suppose 0 = -86v + 71v - j. Is -12 greater than v? True Suppose -9732 = -4a + 2b, -2b = 4a - 10595 + 879. Is 4863/2 not equal to a? True Let y = 2.1 - 0.3. Let h = 1.6 - y. Let a = 783 - 792. Is a less than h? True Suppose 5g - 75 + 30 = 0. Let a be 2 - (-33)/(-121) - -7. Do a and g have the same value? False Let p = -0.099 + 85.099. Let c = 5.607 - 5.907. Is p greater than c? True Let z = 2723 + -10891/4. Let u be 1 - -18(-2)/4. Which is greater: u or z? z Let b be ((-146)/(-219))/(6/400). Is 45 >= b? True Let r = 105.36352 + -0.03352. Let j = r - 105. Let i = -5.33 + j. Do 3 and i have the same value? False Let i = 0.86 + 96.14. Let c = -183 + i. Let g = c - -60. Is 0 > g? True Suppose 35w - 101 + 1288 = -563. Are -8 and w non-equal? True Let k be (-27 - 0) + (-21)/((-273)/(-52)). Suppose 203 = 5b + 3v - 0v, -4b = 4v - 164. Let s = k + b. Do 2/13 and s have different values? True Suppose -94279 = 56d - 55d. Let f = -469398/5 - d. Let g = -380 + f. Is g greater than 19? True Let o = 866 + -865.8. Let h = 2.8 + o. Is h > -0.124? True Let j = -5 + 3. Suppose -9d = -3n - 6d - 1755, -4n = -5d + 2344. Let o = n - -572. Is o not equal to j? True Let k = -57 - -41. Let h(c) = -4c*3 + 5c*2 - 2c + 2. Suppose -27 = -3v - 21. Let f be h(v). Do f and k have different values? True Suppose -34p - 108 = 22p - 20p. Which is smaller: 4.35 or p? p Let b be 36/318967/(-854). Which is greater: b or -1? -1 Let k = -1057 - -1878. Let g = 744 - k. Which is smaller: -80 or g? -80 Let i(w) = 84w*2 - 9w - 13. Let m be i(10). Suppose -m = 8a + 2711. Let s be a/72 - 1/(-9). Is s at least as big as 1? False Suppose 4z + 1118 = 6z. Suppose 5s - 41 = z. Suppose q = 11q - s. Which is greater: q or 11? q Let f be (1 + 2 + -4)(-4)/830. Let j = 2893/2490 + f. Let w = 3 - 1. Is w > j? True Let w(o) = -o*2. Let j be w(1). Let i = -121 + 117. Let h be (-2 + 12/10)(-10)/i. Which is bigger: h or j? j Suppose -4z + 5i = -2285, -4z - 3i = -i - 2306. Suppose -8g + 13g - z = 0. Which is bigger: g or 114? g Let t = 13010 - 14950. Are -1939 and t nonequal? True Suppose -5o + 2g + 103935 = 0, 461g + 20809 = o + 465g. Which is smaller: 20790 or o? o Let j be 340 - 331 - 2282/((-4)/(-2)). Which is smaller: j or -1134? -1134 Let z be (29193/558)/(2 - 1). Let x = -17/93 - z. Let m = 50 + x. Is m > -4? True Let h be 83/(-1909)(-20)/(-14) - (-4)/(-7). Which is smaller: 0 or h? h Let d(u) = -2u*3 + 167u*2 - 58u - 2180. Let q be d(83). Is -113 > q? False Let a be ((-193)/(-9))/((-21996)/(-2106)). Is a >= 2? True Suppose 0 = h - 26 + 32. Let m be ((-2)/7)/(h/168). Let x be 2/m180/75. Is -1.3 at least x? False Let w = 130 - 250. Let a = w - -217. Which is smaller: a or 0? 0 Let i be 30500/(-8) - (5 + 56/(-16)). Is -11443/3 at most as big as i? True Let a(x) be the first derivative of 3x*2/2 - 30x + 56. Let s be a(11). Suppose -5z + 24 = -z. Are s and z equal? False Suppose -2u = -7u + 15, -3v - 4u + 66 = 0. Let t be v/265/15. Which is bigger: t or 8? 8 Suppose 0 = -59i + 93i - 1972. Is 49 > i? False Let c = 2694 - 1877. Let g = c + -573. Which is smaller: -1/2 or g? -1/2 Let w = 0.0591 + 0.0409. Are w and -3348 unequal? True Let u = -540 + 557. Suppose 55 = 5t + 4i + 6, t = i + u. Which is smaller: t or 24? t Let h = 716 - 715.946. Which is bigger: h or 1? 1 Let r(k) = -2k + 8. Let x be r(4). Let s = 564.7 - 560.1. Are x and s equal? False Let l(q) = 29q + 314. Let w be (-66)/(-3)(-7 - 104/(-16)). Let j be l(w). Are j and -43/8 equal? False Suppose -2k = -3y - k - 17, 3k - 31 = 4y. Let m be ((2/y0)/1)/2. Let c be 7/(-1)10/(-130). Which is greater: m or c? c Suppose 50 = 2q + 5r, -4r = -3q + 5 + 93. Suppose -5z = -q + 45. Are -25/16 and z equal? False Let k = -40 - -288. Suppose -16i + 12i = 4m - 200, -k = -5m - 4i. Which is bigger: m or 0? m Let v(p) be the first derivative of 17p*2/2 - 144p - 177. Let r be v(13). Do 80 and r have different values? True Suppose 5947 - 2507 = -40s. Which is smaller: -77 or s? s Let c = 3 - 3. Suppose 5j - j = -3m + 16, c = -5j - m + 20. Let o be (-2440)/10575 - j/(-18). Which is smaller: 0 or o? o Let x(d) = -d*3 + 11d*2 + 6d - 34. Let m be x(10). Let h be 8/36 - (0 - (-172)/m). Let q(l) = 6l + 22. Let b be q(-4). Which is bigger: h or b? h Let s = -6.9327 - -6.387. Which is smaller: -1 or s? -1 Let d be (98/36)/(-7)((-11134)/855 - -13). Which is bigger: -1/7 or d? d Suppose 2 = 2p + 2n, 3p = -n + 5 - 0. Suppose -g + 26 = pg - 4h, 0 = 3g + 3h - 12. Let m = -11 + g. Is m >= 1? False Let i(r) = -7r + 26. Let w(x) = 8x - 25. Let y(f) = -6i(f) - 5w(f). Let z be y(18). Suppose 2h - 2t - 6 = 0, -z = -4t - t. Is h at most 0? False Let a = -4882 - -4886. Is 660/127 < a? False Suppose -5z + z = 0. Let w be 3/73((-98)/7 + 16). Which is smaller: w or z? z Let i be (169 - 174) + 1 + (0 + 2)/1. Let f = 0 - 10. Let z = f - -5. Is i greater than z? True Let p = 0.33 + 1.37. Let c = p + -1.6. Let d = 1/478 + -1921/4302. Which is smaller: c or d? d Let c be (22 - 23)(-2 + 2). Let g be (-24)/(-16) - (c - 3/(-6)). Which is greater: 2 or g? 2 Let b be (867/(-204))/(6/(-8)). Let v be ((-28)/8)/(2/(-4)). Let p(l) = -l2 + 8l - 1. Let w be p(v). Is w > b? True Let y be (10 - 3) + -7 - 0. Suppose -6k = -k - 2j + 227, y = 2k - 5j + 74. Does k = -47? True Let b = 1697 - 6885/4. Let o = 902 - 927. Which is smaller: o or b? o Suppose 47p + 82 = -24p - 11p. Is 1/16111 at most p? False Let v be (352 + -351)/(0 + (-2)/1030). Which is bigger: -513 or v? -513 Let n be -1 - 1/1 - (-11 - -1). Suppose h + 3 = 0, 0s + n = s - 2h. Suppose sa - 4p = -7p - 6, 0 = -a + 3p + 6. Which is bigger: 2/27 or a? 2/27 Suppose 2w + 4p - 94 = 0, -36p + 12 = -40p. Which is greater: 48 or w? w Let r = 0.6 - -19.4. Let w = 0.81 - -114.89. Let m = -116.7 + w. Which is smaller: m or r? m Let o = 9 + -4. Let d = 12309/5 + -208893/85. Is o >= d? True Let w = 302.7 - 291.71. Which is bigger: 8 or w? w Suppose 0 = -5u + 3v + 116, -9v + 37 = u - 5v. Suppose 31 = 5d - 4q, -3d + q + u = -3q. Are d and 40/11 nonequal? True Let q = 1.31 - 1.98. Let v = -0.533 + 0.063. Let j = q - v. Which is smaller: j or -20? -20 Suppose -434 = -8u - 1666. Let c be 3/(-4)*-2 + 229/u. Is 1 greater than	{ "pile_set_name": "DM Mathematics" }
st to 32.53? (a) -0.2 (b) 0 (c) -1/2 b What is the closest to -1 in 9, -0.8, 5, -1? -1 Which is the nearest to 2? (a) -2/3 (b) -140/9 (c) -5/3 a What is the nearest to 3/8 in 1/3, 3, 0.3? 1/3 What is the nearest to -0.2 in -9, 4, -3? -3 Which is the closest to 0? (a) -5 (b) -1/8 (c) -0.05 (d) 2/7 c What is the closest to 0.1 in 3, 1, 0.041, -6? 0.041 What is the closest to 2 in -0.33, 0.3, -3, 2/21? 0.3 Which is the nearest to 2? (a) -1 (b) -1/15 (c) 4 (d) -170 c What is the nearest to 2 in 2/19, 2/9, 8? 2/9 Which is the nearest to -1? (a) -1/4 (b) 3 (c) 2 (d) 0.03 a What is the closest to -1 in 0.1, 2, -2/9, 3? -2/9 What is the nearest to -4 in -4, -2, -3/4? -4 Which is the nearest to 0? (a) -0.4 (b) -1.1 (c) -5 (d) -0.1 d What is the closest to -2 in 0, 1/40, 1/3? 0 Which is the closest to 0? (a) -3 (b) 15 (c) 2 c What is the nearest to -9 in -2/5, 2, -58/9? -58/9 What is the nearest to -3.4 in 6/5, 1/2, -5? -5 Which is the nearest to 0? (a) -0.3 (b) 4.5 (c) -3 a What is the nearest to -5 in 0, -2, -1.3? -2 What is the nearest to -1/11 in -2.9, 0.4, 1/4? 1/4 What is the closest to -11 in 4, 7, 1/4, -1/8? -1/8 Which is the closest to -0.1? (a) 1/2 (b) 2/7 (c) -7 (d) -3 b Which is the closest to -3/5? (a) -2 (b) 2/5 (c) 2 b Which is the nearest to 8? (a) -2/5 (b) -4 (c) -0.05 c Which is the closest to -0.09? (a) -0.08 (b) 4 (c) 3/5 a What is the closest to -1 in -0.4, -3/7, 4, -9/2? -3/7 What is the closest to -3 in -10, -0.4, 5, -2/7? -0.4 Which is the nearest to 0.1? (a) -0.5 (b) -2/11 (c) 0.6 (d) 1/4 d What is the closest to -95 in 3, -3, 1, 0.5? -3 What is the nearest to 1 in 2, -3.7, -1/5? 2 What is the closest to -2 in 342, -2, -0.1, -2/3? -2 What is the closest to 3.5 in 8, 5, -5? 5 What is the closest to 1 in 0.1, -0.01, -13, 2/5? 2/5 Which is the nearest to 0? (a) -9 (b) 1 (c) -2/21 (d) -0.1 c What is the nearest to -26 in -3, 4/3, -2/13? -3 Which is the nearest to -131? (a) -0.06 (b) 2/3 (c) -0.5 (d) -3 d What is the nearest to -1 in -33, -2, -0.1, 5? -0.1 What is the closest to 1/3 in -0.4, -2/9, -249/7? -2/9 Which is the closest to -0.1? (a) -5 (b) 6 (c) -1/6 c What is the nearest to -95 in 0.2, -1/3, -0.04, 0.5? -1/3 Which is the nearest to -42? (a) -3 (b) 12 (c) 3 a Which is the nearest to -29? (a) -3 (b) 28 (c) 3 (d) 2/11 a Which is the closest to -0.3? (a) -4 (b) 3 (c) -3 c What is the nearest to 0.1 in -5, 0.02, 0.5, -0.5? 0.02 What is the nearest to -2 in -0.51, 0.3, -1/4? -0.51 Which is the closest to 1.4? (a) -1/8 (b) 2 (c) -0.05 (d) 8 b What is the nearest to 0.1 in -7/22, 2, 0? 0 What is the nearest to -2 in 0.4, 5, -2/35? -2/35 What is the closest to 2 in -1/5, 103, -0.4? -1/5 What is the closest to 1 in 0.5, -3/151, 0.1? 0.5 What is the nearest to -0.021 in -4, -8, -1, 1? -1 Which is the closest to -1? (a) 5/3 (b) -2/9 (c) -3 (d) -1/10 b Which is the nearest to -111? (a) 0.5 (b) -3/2 (c) 13 b What is the closest to -2/9 in 1/19, 2/3, 1, -2/19? -2/19 What is the closest to -1/7 in 1, -1/3, -0.1? -0.1 What is the closest to 0.1 in 0.06, 5, -4? 0.06 Which is the nearest to 1/3? (a) -3/4 (b) 2 (c) -3 a What is the closest to 2 in 1/2, 0.4, 7, 5? 1/2 What is the closest to -1/3 in 1, 0, 30, 5? 0 Which is the nearest to 0.17? (a) 0.4 (b) 29 (c) -5 (d) 1/6 d Which is the nearest to -0.1? (a) -102.3 (b) 0 (c) 4/5 b Which is the nearest to 1? (a) -4/5 (b) 1/5 (c) -1/4 (d) 0 b Which is the closest to -0.1? (a) 4 (b) 16 (c) 4/7 (d) 14 c Which is the nearest to 6? (a) -0.2 (b) 1.7 (c) -1 (d) 0.2 b What is the closest to 0.1 in -3, 1/2, -2/9, 2? -2/9 What is the closest to -1 in -0.4, 637, 5? -0.4 What is the nearest to -4 in -2/23, -1, 3/5? -1 Which is the closest to -1/2? (a) -0.4 (b) 5 (c) 2/3 (d) -12 a What is the nearest to 0 in 4, -3, -2, -1/5? -1/5 Which is the nearest to -3? (a) 0.3 (b) -4866 (c) -3 c What is the nearest to 145 in 5, 0.2, -2/13, -0.2? 5 Which is the closest to -0.16? (a) -0.1 (b) -3/5 (c) 0.1 (d) -5 a What is the nearest to -0.1 in -1/3, -0.2, 0.1, -26? -0.2 Which is the nearest to 0.1? (a) -1/2 (b) -18 (c) 4 a What is the closest to 1 in 1/5, -5, -3/8, 2/17? 1/5 What is the closest to 71 in -1/2, 5, 2/7? 5 Which is the nearest to 0.1? (a) -3 (b) -2.3 (c) -2/7 (d) -0.9 c What is the nearest to -1 in 1/11, 0.5, -0.1, -5? -0.1 What is the nearest to 0 in 0.063, 0, -9, 1? 0 What is the nearest to 4 in -2, 2, -1/5? 2 Which is the closest to -1/2? (a) -2/19 (b) 3 (c) -346 (d) 0.4 a What is the closest to -0.2 in -2/3, -2, -0.02? -0.02 What is the closest to -6 in -6, 1, -2? -6 What is the closest to -1/2 in 3, -0.2, 17, -1? -0.2 What is the closest to 0.1 in -4, -3/5, -4/7, -2/5? -2/5 Which is the closest to 2? (a) -2 (b) -3 (c) 10 (d) 3/2 d Which is the closest to -1? (a) 1 (b) 2/165 (c) -0.6 c Which is the nearest to -3? (a) 9 (b) 2 (c) -1 (d) 1/2 c Which is the closest to -1/4? (a) -16/7 (b) 1 (c) -5.1 b What is the nearest to -1/4 in -1/2, 1, -9, -3? -1/2 Which is the closest to -0.3? (a) 5 (b) -4 (c) 2/61 (d) -2 c What is the closest to -0.1 in 5, -3, -8? -3 What is the closest to 1/5 in 1/7, 0.06, 2, 0.3? 1/7 What is the nearest to -1 in 28, 1/4, -1? -1 What is the nearest to 0 in -3/4, -0.2, -2/47, -3? -2/47 What is the closest to -0.2 in 1/3, 2/27, 1/8? 2/27 Which is the nearest to -0.05? (a) 4 (b) -2 (c) 0.1 c Which is the closest to 6? (a) 10 (b) -0.1 (c) 0.4 a Which is the closest to 2/7? (a) 0.1 (b) 2/13 (c) -1/4 (d) 4 b Which is the closest to -0.05? (a) 3/4 (b) 1/6 (c) 4 (d) 1 b What is the nearest to 0.2 in -14, -8, 0.4, 0.2? 0.2 Which is the nearest to 40? (a) 2 (b) -3 (c) -4 (d) 0.3 a Which is the nearest to 1? (a) -5 (b) 0 (c) 1 (d) 3/5 c Which is the closest to -1? (a) 1 (b) 167.2 (c) 3 a Which is the closest to -2/11? (a) 5 (b) -2/21 (c) 1/6 (d) 0.5 b What is the nearest to -5 in -0.3, -2/9, 4? -0.3 Which is the nearest to -2/3? (a) -2/15 (b) 3/4 (c) -0.2 c Which is the nearest to -2? (a) 0.2 (b) -3 (c) 2 (d) 1 b What is the closest to 2/7 in 2, 0.5, -5, 2/27? 2/27 Which is the nearest to 3/2? (a) 4 (b) -22 (c) 1 (d) 3/5 c Which is the closest to -12? (a) -1/7 (b) -1 (c) 0.2 b Which is the nearest to 8? (a) 0.1 (b) 6 (c) -1 (d) 1/2 b What is the closest to 28 in -1.6, 1, -4/9? 1 Which is the closest to 2? (a) -0.2 (b) -2 (c) -11/7 a What is the closest to -12 in 0.2, 0, -5? -5 What is the nearest to 0 in -3/2, -19, -3, -4? -3/2 What is the nearest to -1/8 in -2/7, -0.04, -2.2, 4? -0.04 What is the nearest to 0.09 in -2/9, 4, 1, -4? -2/9 Which is the nearest to 0? (a) 2/17 (b) 0.11 (c) -0.1 (d) -7 c What is the closest to 3 in -14, -5, 3/4? 3/4 What is the nearest to 22/5 in -14, 2, -1/5? 2 Which is the nearest to 1? (a) 1 (b) -0.04 (c) -4 a Which is the closest to 1967? (a) -1 (b) 0 (c) 5 c What is the nearest to -4 in 0.2, -1/7, -2/7, -3? -3 What is the nearest to 1 in 3/7, 3, -4/9, 1.16? 1.16 Which is the nearest to -2? (a) 0 (b) -3/8 (c) 2 (d) -1 d Which is the nearest to 1? (a) -0.2 (b) 2/9 (c) -1 (d) 5 b What is the closest to -11 in -5, 1/8, 8? -5 What is the nearest to 0 in 1/5, 1/3, -3? 1/5 What is the nearest to 1/7 in 2, -3, 1, -11? 1 Which is the closest to -2/3? (a) 2/3 (b) -8 (c) 4 (d) 7 a Which is the closest to -1? (a) 5 (b) -0.19 (c) 2/7 (d) -2/13 b What is the nearest to 0.1 in 2/9, 3/7, -14/9, -4? 2/9 Which is the closest to 0.6? (a) -4 (b) -2/7 (c) -10 (d) -0.2 d Which is the nearest to -2/7? (a) -10 (b) -5/199 (c) -1/5 c Which is the nearest to 14? (a) -5 (b) -0.3 (c) 0 c Which is the closest to -1? (a) -7 (b) -9 (c) 0.2 (d) -0.4 d Which is the closest to 1? (a) 0 (b) -94 (c) 4 (d) -0.9 a What is the nearest to -8 in 5, -0.3, 1? -0.3 Which is the closest to -0.1? (a) -2 (b) 347 (c) 1 c Which is the nearest to -1? (a) -3 (b) -166 (c) -4 (d) -4/3 d What is the nearest to -0.4 in 0.049, 4/3, 2/3, -1/3? -1/3 Which is the nearest to 1/5? (a) 0 (b) 2/3 (c) -4 a What is the closest to -1/4 in 8, -4/3, 2, 1? -4/3 Which is the closest to -1/2? (a) 0.0482 (b) 0.2 (c) -0.1 c What is the closest to 1/3 in 0.9, 0.06, 0? 0.06 Which is the cl	{ "pile_set_name": "DM Mathematics" }
b. -386b What is the second derivative of 2503l*4 - 2l*3 - l - 5469 wrt l? 30036l*2 - 12l What is the second derivative of -1017n3 - 2n - 148? -6102n What is the second derivative of 2bj3 + 2bj - 26b + 85j3 - 12j*2 - 3j - 11 wrt j? 12bj + 510j - 24 Find the third derivative of -1363h*2m*3q*3 + 2h*2m3 + h2m2 + 236hm2q*3 - hm - m*2q*3 wrt m. -8178h*2q*3 + 12h*2 Find the second derivative of 13731p*2v - pv + 2987p wrt p. 27462v What is the third derivative of -29g*6 - 10g*5w*3 - 7g*2w*3 - 19g*2 - 2w*3 wrt g? -3480g*3 - 600g*2w*3 Find the second derivative of 284a*2mw + 2a*2m + am - a + 4mw + 3m wrt a. 568mw + 4m What is the third derivative of 176r*5 + 2r*3 - 1045r*2? 10560r*2 + 12 Find the second derivative of -1350y*4 - 219y - 2 wrt y. -16200y2 Differentiate 18r*4 - 1210 wrt r. 72r*3 Differentiate 3h*2x3 + h2 + 242hx*3 + h + 2x*2 + 607 wrt x. 9h*2x*2 + 726hx2 + 4x Find the second derivative of 319v4 + 15v wrt v. 3828v2 Find the second derivative of 1703k*4 - 2k*2 - 2k - 8. 20436k2 - 4 Find the second derivative of -9088j*2 + 3j - 2103 wrt j. -18176 Find the third derivative of -15m6 - 8m*4 + 5m*3 + 1705m*2. -1800m*3 - 192m + 30 Find the second derivative of -2l3n*3o + 7l3n + l*3o - 1063l2n*2o - 2l2no + o wrt n. -12l*3no - 2126l*2o What is the third derivative of 2g2x*3 + 4g*2 + 248gx5 + 307x*2 wrt x? 12g*2 + 14880gx2 Find the second derivative of 3a*2cx3 + 101a*2cx - 2a*2kx3 - 2ackx + acx - 58akx + ak + 4ax3 wrt a. 6cx3 + 202cx - 4kx3 Differentiate -3hnr + 16hr*2 - 7nr2 - 3n wrt h. -3nr + 16r2 Find the third derivative of -12i*4n - 13i3nq + 2i3 - i2nq + 2i2n - 11i2 - nq + 8n wrt i. -288in - 78nq + 12 What is the third derivative of -a3l3 + a3 - 25a2l*2 + 2a*2l - 57al*6 wrt l? -6a*3 - 6840al3 Find the second derivative of 1344m*3w + 2m3 - mw + 10m - 17w wrt m. 8064mw + 12m What is the third derivative of -395d*3 - 2d*2 - 41d wrt d? -2370 Differentiate 8bg + 4bn + 2bo - 170gn - 3go + 2no + 2o + 2 wrt n. 4b - 170g + 2o What is the first derivative of 2b3it + 32b*3t + 31bit wrt i? 2b*3t + 31bt What is the third derivative of -a*3pv3 + 250a*3v3 + a3v + 2a*2pv3 + 138a*2pv2 - apv + 11v*3 wrt a? -6pv3 + 1500v*3 + 6v Find the first derivative of -m*3q - 2m3 - 2m*2q*2 + 2m*2 - 50mq2 + 1095m wrt q. -m*3 - 4m*2q - 100mq What is the first derivative of 465d3h*2r - 5d2h*2r + 11h2r - 59h2 + r wrt d? 1395d*2h*2r - 10dh*2r Find the second derivative of 1720f4i - f*3i - 10432fi - 2f wrt f. 20640f*2i - 6fi Differentiate -735d2f*3n - 3d2f*3 + 3d*2f*2n - d*2f*2 - 95df3 - f3 with respect to n. -735d*2f*3 + 3d*2f*2 What is the second derivative of 5hkz + hk - 2hz3 + 28hz2 - 21hz + 2kz2 wrt z? -12hz + 56h + 4k What is the second derivative of h3l*2s*2 - 2h*3l*2s + 43h2s - 2hl*2s + 3h - 19l*2s*2 - 3ls2 wrt s? 2h*3l*2 - 38l*2 - 6l What is the second derivative of 25hp*2 + 14hp + 9p*2 - p wrt p? 50h + 18 Find the third derivative of 260u3 + 183u*2. 1560 What is the third derivative of 2f*3h*3ms - 9f*3h3 - f3s2 - f2h*3ms2 + fhs2 + 9h*3ms2 wrt f? 12h*3ms - 54h*3 - 6s*2 Find the second derivative of 3060q*2 + 58q + 7. 6120 What is the second derivative of -gi2ov + 2gi2o - 19gi*2 - gv + 72iv + 3o wrt i? -2gov + 4go - 38g Find the first derivative of -6j*3t - 2j3 - 2jnt*2 + 5j + 4nt*3 - 6n wrt t. -6j3 - 4jnt + 12nt*2 What is the third derivative of -2h*3w - 2162h3 - 7859h*2 + w wrt h? -12w - 12972 Find the third derivative of -1885r4 - 905r*2 + r. -45240r What is the derivative of 57o - 126? 57 Find the first derivative of -473d*3 + 2d*2l + l + 155 wrt d. -1419d2 + 4dl What is the derivative of 4f*3r + 31f3 - 2f - 47r2 wrt r? 4f*3 - 94r Find the third derivative of -8f4 - 141f*3 - 137f*2. -192f - 846 Find the first derivative of 3503n3 + n2 + 18306 wrt n. 10509n*2 + 2n Find the second derivative of -18s4 - 3s*3 + 4s - 46. -216s2 - 18s What is the third derivative of 58n6 - 3n*2 + 45 wrt n? 6960n*3 Differentiate -14o*4 + 26o*3 + 924 with respect to o. -56o*3 + 78o*2 What is the third derivative of -23362x*6 + 1075x*2 + 12? -2803440x*3 What is the second derivative of 6936k*2 + 4175k wrt k? 13872 What is the third derivative of 10fox3 - 9fx3 - 76f + 6ox*3 - 7ox2 + 4o wrt x? 60fo - 54f + 36o What is the first derivative of -50h3n*2 - 449h*3 + 2h*2n wrt n? -100h3n + 2h2 What is the third derivative of -33g*5 - 2g*3 - 312g*2 wrt g? -1980g*2 - 12 Find the second derivative of -226n*3 - 36n. -1356n Find the second derivative of -h3qv + 4h*3q - 2h2qv - 2hqv + 26hv - 2qv - 2 wrt h. -6hqv + 24hq - 4qv What is the first derivative of 59r*2x*2 + 3863r*2 - 53rx2 - 2r - 2 wrt x? 118r2x - 106rx Find the first derivative of -202i4 - 185 wrt i. -808i*3 Find the first derivative of 34bd2p + 3bd - 2blp - 897bl - 4b + 3d2lp wrt d. 68bdp + 3b + 6dlp What is the second derivative of -121l4 - l3 - 104l wrt l? -1452l2 - 6l What is the third derivative of -44r6 - 2r*4 + 206r*2? -5280r*3 - 48r What is the second derivative of -af2 + 2a + 12f4 + f3 + 85f wrt f? -2a + 144f*2 + 6f What is the derivative of 4760b3 + 3116? 14280b*2 Find the second derivative of 1790z4 + z3 - 2z - 1191 wrt z. 21480z*2 + 6z Find the second derivative of -2198b3 + 12b + 73. -13188b What is the second derivative of -2f*2n*3 + 69f*2n*2v*2 + 64fn3v*2 + 3n*2v*2 wrt f? -4n*3 + 138n*2v*2 Find the second derivative of 135r*2 + 18r - 7. 270 What is the derivative of -980y - 1107 wrt y? -980 Find the third derivative of -24f*3v*3 + 2f*2v - 2fv*3 - 26fv wrt f. -144v*3 Find the third derivative of -2t*2x*4 + 173t*2 + 25x*5 + 2x*2 wrt x. -48t*2x + 1500x2 What is the derivative of 2ix3 - 3ix - 630i + 6x3 wrt x? 6ix2 - 3i + 18x2 What is the third derivative of -2240ct3 + 1908ct2 - c - t4 wrt t? -13440c - 24t What is the second derivative of -483u*5 + 12990u wrt u? -9660u3 Find the first derivative of -814q + 235 wrt q. -814 What is the third derivative of 468m6 + m3 - m2 - 1471m wrt m? 56160m3 + 6 Find the second derivative of 1781x5 + x2 - 1317x - 2. 35620x*3 + 2 Differentiate 3d*4 - 99d + 247 with respect to d. 12d3 - 99 What is the first derivative of 1174f*2s*3 - 1317f*2 wrt s? 3522f*2s2 What is the third derivative of c2k3o*2 + 11c*2k*3 - 329c*2k*2r - 2c2o*2r + 2cko2 + k3or wrt k? 6c*2o*2 + 66c*2 + 6or Find the second derivative of -6065w*4 - 379w + 1 wrt w. -72780w2 Find the third derivative of 35r*5 - 15r*4 - 1230r*2. 2100r*2 - 360r What is the third derivative of -2st*4 + 3st3 - 3st2 - 6st - 8t*4 + 5 wrt t? -48st + 18s - 192t Differentiate -100g - 261 with respect to g. -100 Find the first derivative of -42m2tz - 5m*2z - 136mtz2 - 64mz2 wrt t. -42m*2z - 136mz*2 What is the derivative of -512jrv*2 + 2jv2 + rv*2 + 1938v*2 wrt j? -512rv2 + 2v*2 Find the third derivative of -13n6 + n4 - 106n3 + 314n*2 + n - 2 wrt n. -1560n*3 + 24n - 636 Find the second derivative of -1619c2q*2 - 833cq2 wrt c. -3238q*2 What is the third derivative of 120h*3p2 - h3 - 2h2p*2 - 2hp2 + 6h wrt h? 720p2 - 6 Find the third derivative of -12g*6n*2 - 39g*3n*3 - 4g*2 - gn*3 - 4n wrt g. -1440g3n*2 - 234n**3 What is the derivative of -7	{ "pile_set_name": "DM Mathematics" }
218 divided by -69 -3322 What is -10115 divided by 16? -10115/16 What is 22792 divided by 7? 3256 715000 divided by -25 -28600 What is -4 divided by -3854? 2/1927 Calculate 87 divided by -1269. -29/423 What is -40 divided by 4257? -40/4257 Calculate 6267 divided by -2. -6267/2 Divide -1856274 by -1158. 1603 Divide 175365 by 81. 2165 Divide -236418 by -5. 236418/5 Divide 438600 by 340. 1290 Divide 5000 by 91. 5000/91 1209654 divided by 57 21222 What is -504465 divided by -2587? 195 Calculate 505572 divided by -6. -84262 7 divided by -24672 -7/24672 What is -11330 divided by 110? -103 Calculate 50136 divided by 4. 12534 Calculate -1 divided by 11823. -1/11823 65920 divided by -1648 -40 Divide 4203 by -3. -1401 What is 3460860 divided by -3? -1153620 Divide -2260 by -82. 1130/41 115204 divided by 694 166 Divide -8146280 by -4. 2036570 Calculate 575283 divided by -3. -191761 -107762 divided by -107762 1 What is -132 divided by -89? 132/89 What is 152442 divided by 6? 25407 Calculate 2205 divided by 3. 735 Calculate 11 divided by 2354. 1/214 Divide 1985 by -397. -5 387496 divided by -96874 -4 -2 divided by 2486 -1/1243 What is 12980 divided by 45? 2596/9 What is -2 divided by 21522? -1/10761 -33 divided by -12838 33/12838 Divide 884580 by 176916. 5 121093 divided by -7 -17299 Calculate 7062 divided by -84. -1177/14 -1273052 divided by 22 -57866 4549 divided by 128 4549/128 Divide 487370 by 598. 815 -152778 divided by 76389 -2 Calculate 376720 divided by -3. -376720/3 What is 443118 divided by 437? 1014 What is -2576 divided by -7? 368 166336 divided by -16 -10396 Calculate -13 divided by -2572. 13/2572 Divide -332 by 4192. -83/1048 What is -47 divided by 195? -47/195 -1508878 divided by 215554 -7 Calculate 19 divided by 636. 19/636 Calculate -42204 divided by -14068. 3 Calculate -2 divided by 349810. -1/174905 Divide -948882 by -66. 14377 Calculate 53355 divided by 10671. 5 What is -6366 divided by 3? -2122 Divide -3659 by -16. 3659/16 Divide -16393 by -13. 1261 What is -180289 divided by 3? -180289/3 Divide 8 by 7632. 1/954 64 divided by -65 -64/65 332 divided by 20 83/5 -18888 divided by -66 3148/11 Divide -1760 by -209. 160/19 Divide -6 by 471. -2/157 -988920 divided by 369 -2680 -40880 divided by -73 560 Divide -457416 by 4. -114354 Calculate -1630 divided by -90. 163/9 Calculate -26988 divided by 6. -4498 What is 25420 divided by -6355? -4 Calculate -274905 divided by 274905. -1 Calculate -12045 divided by 5. -2409 What is 5 divided by -20440? -1/4088 Divide -2090013 by -6. 696671/2 Calculate 316274 divided by 41. 7714 Divide 142752 by 8922. 16 Divide 6960 by 290. 24 Calculate 2050867 divided by 403. 5089 Divide 26581 by 35. 26581/35 -165056 divided by 64 -2579 What is -32 divided by -328? 4/41 What is 42758 divided by 121? 42758/121 -1209 divided by 11 -1209/11 What is -172764 divided by -14397? 12 Calculate -104799 divided by -8. 104799/8 Divide 912729 by -3. -304243 Calculate 287866 divided by 31. 9286 Divide -30538 by 15269. -2 Divide 6 by -20178. -1/3363 Divide 41 by 519. 41/519 What is 1447 divided by -25? -1447/25 What is 676 divided by -84? -169/21 4 divided by -30443 -4/30443 Calculate 1013621 divided by -7. -144803 144884 divided by -4 -36221 -5 divided by 226539 -5/226539 Divide -1 by -103929. 1/103929 116909 divided by -2 -116909/2 161161 divided by -1001 -161 Calculate 5699 divided by -9. -5699/9 -81411 divided by 3 -27137 Divide -2448593 by 7. -349799 Calculate -23937 divided by 3. -7979 570906 divided by 9062 63 Divide 685784 by -8. -85723 What is -358455 divided by 15585? -23 6 divided by 9429 2/3143 629596 divided by -28618 -22 Calculate 528 divided by -19. -528/19 -3 divided by 29237 -3/29237 3171516 divided by 6 528586 Divide -82584 by 186. -444 What is 4 divided by 182426? 2/91213 Divide 1193472 by -4144. -288 -1620 divided by -217 1620/217 Divide -640550 by 557. -1150 Calculate 34278 divided by 2. 17139 What is 22356 divided by 9? 2484 Divide -4379019 by 159. -27541 Divide -54642 by 10. -27321/5 Divide -4 by -20404. 1/5101 Divide -968 by -123. 968/123 Divide -40652 by 32. -10163/8 -2779165 divided by -5 555833 Divide 35730 by -3970. -9 Divide -140844 by 33. -4268 -11 divided by -810 11/810 Divide 1945 by -156. -1945/156 Divide 23114 by 13. 1778 What is -1610656 divided by -4? 402664 Divide 597720 by -74715. -8 Calculate 172328 divided by -13. -13256 Calculate 43869 divided by 7. 6267 -3363 divided by 59 -57 What is -4745 divided by 107? -4745/107 What is 49 divided by -245? -1/5 Calculate -36400 divided by -4550. 8 Calculate 1118 divided by 559. 2 97122 divided by 32374 3 Calculate -6 divided by 296. -3/148 341172 divided by 27 12636 Divide 37653 by 489. 77 Calculate -9490 divided by 67. -9490/67 Calculate -1970449 divided by 13. -151573 1049 divided by 18 1049/18 150 divided by -22 -75/11 What is 159 divided by -1511? -159/1511 Divide 271474 by 6. 135737/3 8355 divided by -1671 -5 Divide 56 by 2043. 56/2043 What is -222943 divided by -2? 222943/2 12408 divided by -132 -94 Divide -4 by -97776. 1/24444 What is -1090996 divided by 1090996? -1 550 divided by 2 275 Divide 4 by -8725. -4/8725 Divide -184800 by -6600. 28 12 divided by 113785 12/113785 65 divided by 1882 65/1882 0 divided by 49524 0 Divide -250425 by -21. 11925 26 divided by -602 -13/301 What is 9 divided by 74481? 3/24827 Calculate 28016 divided by 34. 824 Calculate 29 divided by 6181. 29/6181 Calculate 1 divided by 84299. 1/84299 Calculate 2622 divided by -15. -874/5 What is 2380 divided by -501? -2380/501 Calculate -290 divided by -11. 290/11 What is -64885 divided by 5? -12977 What is 6473 divided by -505? -6473/505 Divide -15560 by -778. 20 Divide 13475 by 539. 25 -72348 divided by 12058 -6 Divide -162748 by 29. -5612 Calculate -2 divided by 91776. -1/45888 What is 29777 divided by -6? -29777/6 Calculate -10225 divided by -25. 409 -11806 divided by 29 -11806/29 Divide 445 by 4225. 89/845 Divide -19637 by -6. 19637/6 Divide 1213017 by -3. -404339 Divide 30115 by -23. -30115/23 What is 819312 divided by 31512? 26 -14930 divided by -10 1493 Divide 108087 by 45. 36029/15 What is -37347 divided by -1? 37347 What is 3 divided by -549627? -1/183209 Divide 12 by -157402. -6/78701 What is -1774596 divided by 591532? -3 What is -78800 divided by -788? 100 Divide 7366 by -7. -7366/7 Calculate -26381 divided by 25. -26381/25 Calculate 618231 divided by -7. -618231/7 What is 164 divided by 389? 164/389 325952 divided by 162976 2 Divide 53976 by -692. -78 Calculate -475 divided by 9718. -475/9718 0 divided by 75043 0 Calculate 134448 divided by -5602. -24 Calculate 38 divided by -1335. -38/1335 Divide -292 by 3596. -73/899 What is -2594 divided by -13? 2594/13 Divide 75960 by -15192. -5 Divide 19098 by -9549. -2 What is 4 divided by -18772? -1/4693 Calculate 1927 divided by 4. 1927/4 Calculate 5928 divided by -5. -5928/5 Calculate -3454 divided by 2. -1727 8367 divided by -5 -8367/5 What is 155155 divided by -5005? -31 1768675 divided by 5 353735 247306 divided by 6 123653/3 What is 97685 divided by 7? 13955 -382968 divided by -127656 3 Calculate 7274277 divided by -6309. -1153 Divide -35556 by 4. -8889 What is -5 divided by 76768? -5/76768 What is -13972 divided by 43? -13972/43 Divide -16440 by -4. 4110 What is 4950 divided by -990? -5 -42 divided by 13680 -7/2280 Divide 27550 by -50. -551 Divide -24197 by 33. -24197/33 Calculate 14 divided by -18414. -7/9207 Calculate -65705 divided by -1. 65705 454420 divided by 5 90884 2155 divided by 688 2155/688 -1971035 divided by 5 -394207 What is -50496 divided by -64? 789 What is -101 divided by -26504? 101/26504 Calculate -314019 divided by -104673. 3 What is 69 divided by 7762? 69/7762 What is 73467 divided by -8163? -9 Calculate 2685 divided by -16. -2685/16 Divide 37 by 1516. 37/1516 2274096 divided by -758032 -3 Calculate 2208969 divided by -49. -45081 24210 divided by -8070 -3 Calculate 383250 divided by -18250. -21 Calculate 277232 divided by -69308. -4 What is 18704 divided by -28? -668 What is 421653 divided by -3? -140551 What is 456984 divided by 20772? 22 Calculate 0 divided by -142431. 0 Calculate 1104 divided by 36. 92/3 297016 divided by -4 -74254 What is -1108 divided by 25? -1108/25 Divide 2874 by 108. 479	{ "pile_set_name": "DM Mathematics" }
on factor of 7290 and 9. 9 Calculate the highest common factor of 514 and 8. 2 What is the greatest common factor of 9217 and 65? 13 What is the greatest common divisor of 98 and 112? 14 Calculate the highest common divisor of 12 and 21. 3 What is the highest common factor of 11 and 5313? 11 Calculate the greatest common divisor of 583 and 13939. 53 What is the highest common factor of 135 and 15? 15 What is the highest common factor of 14 and 1953? 7 What is the highest common divisor of 432 and 112? 16 What is the highest common factor of 18234 and 36? 18 What is the greatest common factor of 2397 and 51? 51 Calculate the greatest common factor of 4488 and 102. 102 What is the greatest common divisor of 5751 and 71? 71 Calculate the greatest common divisor of 341 and 1240. 31 What is the highest common factor of 120 and 920? 40 Calculate the greatest common divisor of 840 and 50. 10 Calculate the greatest common divisor of 20 and 10. 10 Calculate the highest common divisor of 80 and 4720. 80 What is the greatest common divisor of 65 and 21515? 65 What is the highest common divisor of 10481 and 223? 223 What is the greatest common factor of 81 and 567? 81 What is the highest common factor of 316 and 4? 4 Calculate the highest common factor of 2678 and 338. 26 What is the highest common divisor of 8208 and 76? 76 Calculate the greatest common divisor of 273 and 126. 21 Calculate the greatest common divisor of 72 and 16. 8 What is the highest common factor of 42 and 4347? 21 Calculate the highest common divisor of 874 and 138. 46 Calculate the greatest common divisor of 17912 and 24. 8 What is the highest common divisor of 2448 and 391? 17 Calculate the greatest common factor of 1352 and 104. 104 Calculate the highest common factor of 567 and 243. 81 Calculate the greatest common divisor of 117 and 5811. 39 Calculate the greatest common divisor of 5 and 1. 1 What is the greatest common divisor of 1917 and 3408? 213 Calculate the greatest common factor of 82 and 3854. 82 What is the highest common factor of 12 and 3796? 4 Calculate the greatest common divisor of 40 and 224. 8 What is the greatest common factor of 3828 and 12? 12 What is the highest common divisor of 1256 and 471? 157 Calculate the greatest common divisor of 7 and 14. 7 What is the highest common factor of 6254 and 236? 118 Calculate the highest common divisor of 404 and 606. 202 Calculate the greatest common divisor of 53289 and 279. 279 Calculate the highest common divisor of 5508 and 864. 108 Calculate the greatest common divisor of 50 and 950. 50 Calculate the greatest common divisor of 170 and 85. 85 Calculate the greatest common divisor of 35 and 15. 5 Calculate the greatest common divisor of 4672 and 73. 73 What is the highest common divisor of 2981 and 22? 11 Calculate the highest common divisor of 10 and 270. 10 Calculate the highest common divisor of 456 and 72. 24 Calculate the highest common divisor of 723 and 11086. 241 What is the greatest common divisor of 50 and 245? 5 Calculate the greatest common divisor of 76 and 608. 76 What is the highest common divisor of 341 and 11? 11 What is the highest common factor of 272 and 153? 17 What is the greatest common factor of 3933 and 342? 171 What is the greatest common divisor of 15522 and 78? 78 Calculate the greatest common factor of 75 and 540. 15 What is the highest common divisor of 30 and 255? 15 Calculate the highest common factor of 64 and 2080. 32 Calculate the greatest common factor of 42 and 532. 14 Calculate the highest common factor of 12 and 948. 12 What is the highest common factor of 1615 and 437? 19 What is the highest common divisor of 297 and 5511? 33 What is the highest common divisor of 17 and 1054? 17 What is the greatest common factor of 376 and 8? 8 Calculate the highest common factor of 242 and 110. 22 Calculate the greatest common factor of 40 and 1910. 10 What is the highest common factor of 345 and 5? 5 Calculate the highest common divisor of 11 and 2959. 11 What is the highest common divisor of 166 and 31? 1 Calculate the highest common factor of 312 and 234. 78 What is the greatest common factor of 27 and 3? 3 What is the highest common factor of 15484 and 711? 79 Calculate the highest common divisor of 1480 and 4255. 185 What is the highest common factor of 4215 and 45? 15 What is the greatest common factor of 11 and 308? 11 What is the highest common factor of 285 and 35625? 285 Calculate the highest common factor of 988 and 52. 52 Calculate the greatest common divisor of 6804 and 70. 14 What is the greatest common divisor of 322 and 112? 14 Calculate the highest common divisor of 212 and 28037. 53 Calculate the highest common divisor of 24 and 93. 3 What is the greatest common factor of 48 and 7512? 24 Calculate the greatest common divisor of 18 and 2718. 18 What is the greatest common divisor of 270 and 42795? 135 What is the highest common divisor of 105 and 49? 7 What is the highest common divisor of 145 and 348? 29 Calculate the greatest common factor of 1 and 19. 1 What is the greatest common divisor of 87 and 145? 29 What is the highest common divisor of 2 and 34? 2 Calculate the highest common divisor of 75 and 120. 15 What is the greatest common divisor of 1219 and 46? 23 What is the highest common factor of 135 and 75? 15 What is the greatest common factor of 116 and 116? 116 Calculate the greatest common factor of 194 and 2813. 97 What is the greatest common divisor of 1573 and 847? 121 What is the greatest common divisor of 35 and 20? 5 Calculate the highest common factor of 9 and 288. 9 Calculate the greatest common divisor of 28 and 21. 7 Calculate the greatest common divisor of 4 and 9242. 2 What is the highest common divisor of 99 and 432? 9 Calculate the greatest common factor of 258 and 6751. 43 What is the highest common divisor of 1348 and 3707? 337 What is the highest common factor of 12 and 516? 12 What is the highest common factor of 1224 and 272? 136 What is the highest common divisor of 112 and 88? 8 What is the highest common factor of 238 and 204? 34 Calculate the highest common divisor of 3515 and 740. 185 Calculate the highest common divisor of 120 and 2280. 120 What is the greatest common divisor of 80 and 6690? 10 Calculate the greatest common divisor of 166 and 2. 2 What is the highest common divisor of 168 and 63? 21 What is the highest common factor of 891 and 2835? 81 Calculate the greatest common factor of 2664 and 18. 18 What is the highest common divisor of 12096 and 960? 192 What is the highest common factor of 242 and 4961? 121 Calculate the highest common divisor of 537 and 3. 3 Calculate the highest common divisor of 29 and 3103. 29 What is the greatest common divisor of 141 and 47? 47 Calculate the highest common divisor of 36 and 1926. 18 What is the greatest common factor of 12 and 2262? 6 What is the greatest common factor of 16 and 906? 2 What is the highest common factor of 120 and 5592? 24 Calculate the highest common factor of 3337 and 47. 47 What is the greatest common divisor of 27229 and 146? 73 What is the greatest common factor of 185 and 60? 5 Calculate the greatest common divisor of 9078 and 102. 102 What is the greatest common divisor of 49700 and 142? 142 Calculate the highest common factor of 360 and 80. 40 Calculate the highest common factor of 240 and 48. 48 What is the greatest common factor of 7 and 2? 1 Calculate the greatest common divisor of 34 and 1666. 34 Calculate the greatest common divisor of 250 and 30. 10 Calculate the greatest common factor of 1984 and 256. 64 What is the greatest common divisor of 13 and 4979? 13 Calculate the greatest common divisor of 160 and 4880. 80 What is the highest common divisor of 88 and 198? 22 What is the highest common divisor of 282 and 940? 94 Calculate the greatest common divisor of 66 and 12507. 33 What is the greatest common divisor of 155 and 5? 5 What is the greatest common divisor of 5609 and 142? 71 Calculate the highest common divisor of 480 and 3072. 96 What is the highest common divisor of 144 and 20? 4 Calculate the highest common divisor of 27 and 3375. 27 Calculate the highest common divisor of 778 and 2. 2 What is the highest common factor of 87 and 87? 87 Calculate	{ "pile_set_name": "DM Mathematics" }
- 4414 - 21n2 + 31n wrt n? -42 Let q(g) = g*3 - 16g*2 - 13g + 1. Let h be q(17). Suppose 0 = x - 428 + h. What is the second derivative of -351j4 + 3j - j3 + j3 + xj4 wrt j? 96j*2 Let w(z) be the second derivative of 5/3z*3 + 0 + 0z*2 + 2/5z*5 - 3z + 0z4. What is the second derivative of w(x) wrt x? 48x Let y(r) = 2r2 - r - 1. Let i(j) = j3 + 87j*2 - 366j - 2. Let u(f) = -i(f) + 2y(f). What is the second derivative of u(t) wrt t? -6t - 166 Suppose 10 + 11 = 3j + 3s, -2s + 10 = j. What is the derivative of -2r + 8r - 10 - j wrt r? 6 Suppose 5b - 5n + 8 = 3b, 4b = -4n + 40. Find the third derivative of sb + s2 + 0s6 + 0s2 + s6 wrt s. 240s3 Let g(n) be the third derivative of -n8/168 - n7/5 - 21n4/8 - n3/3 - 5n2 + 3. What is the second derivative of g(y) wrt y? -40y*3 - 504y2 Let b(l) = l3 - 11l2 + 5. Let c(f) = 290f*3 + 1 - 3f*2 - 289f*3 + 4f*2. Let r(a) = b(a) - 5c(a). What is the third derivative of r(j) wrt j? -24 Let h(l) = l*3 - 10l*2 + 9l + 4. Let f be (-39)/(-13) + (-6)/(-1). Let y be h(f). What is the second derivative of 9o + 80o*2 - 80o*2 + yo*3 wrt o? 24o Let y(k) be the third derivative of -31k7/105 + 95k*3/6 + 28k*2 - 1. What is the first derivative of y(v) wrt v? -248v*3 Suppose 140 = w + 4w. Let h(f) = 7f - 35. Let s(k) be the first derivative of -k - 13. Let t(b) = ws(b) - h(b). Differentiate t(d) wrt d. -7 Suppose -7 + 19 = 4o. Suppose -138 = -2r - 5v, -3r + 165 = -0r - ov. Find the second derivative of -r + 59 - 2w4 - 5w wrt w. -24w2 Find the third derivative of -78d*2 + 4d*4 - 4d*4 + 1505d*5 - 1397d*5 wrt d. 6480d*2 Let d(v) be the second derivative of 81v*7/14 + 7v*4/3 - 496v + 1. Find the third derivative of d(s) wrt s. 14580s2 Find the third derivative of -3s + 339s6 + 79s*2 - 95s*6 - 5 + 5 - 95s*2 wrt s. 29280s*3 Let y(d) be the first derivative of -11/3d*3 + 0d*2 + 13 + 11/5d*5 + 0d + 0d4. Find the third derivative of y(f) wrt f. 264f Let j(t) = t*2 - t + 3. Let a(o) = -46o*2 - 12o + 92. Let h(g) = a(g) - 6j(g). What is the first derivative of h(r) wrt r? -104r - 6 Let d(t) = -4t5 + 15t - 7. Let c(h) = 4h5 - 16h + 8. Let n(k) = 3c(k) + 4d(k). Let l(g) be the first derivative of n(g). Differentiate l(r) wrt r. -80r3 Suppose 5d + 2v - 68 = -0d, 4d - v = 44. Suppose 5k - d = k. Find the second derivative of -ka + 4a*5 - 2a - 2a wrt a. 80a*3 Let v(o) = 129o*4 - 2o*3 - 33o*2 - 4. Let q(x) = 131x*4 - 2x*3 - 31x*2 - 4. Let p(a) = -6q(a) + 5v(a). Find the third derivative of p(f) wrt f. -3384f + 12 Let q(z) = z*2 + z - 6. Let w be q(-4). Find the second derivative of 13m + 16m2 - 3m*2 - wm*2 - 5m*2 wrt m. 4 Suppose 5m - 2645 = 1645. What is the third derivative of -mr - 47r*2 + 858r - 3r5 wrt r? -180r*2 Suppose -7h + 11h = 52. What is the second derivative of -hu + 10u5 - 11u5 + u5 + 3u5 wrt u? 60u*3 Let q(d) = 265d*3 - 10d*2 - 5d - 2. Let a(g) = 133g3 - 5g*2 - 3g - 2. Let k(r) = 5a(r) - 3q(r). What is the third derivative of k(o) wrt o? -780 Suppose 66 = -4h + 90. Let v be 6/21 - (-24)/14. What is the third derivative of -4q*2 - hq*2 - 2q*v - 4q*6 wrt q? -480q*3 Let k(a) = -3a + 7. Let g be k(5). Let u = 12 + g. What is the second derivative of 11x4 - 2x*4 + 2x - 5xu wrt x? 48x*2 Let q = 130 + -124. Let x(b) be the third derivative of 0b*5 - 1/40b*q + 0b - b*2 + 0 + 0b*4 - 1/2b*3. What is the first derivative of x(l) wrt l? -9l2 Let z(o) = -o2 - 4o + 5. Let r be (-342)/66 + 2/11. Let t be z(r). Find the third derivative of h2 + 2h*2 - 4h*2 + th*2 - 7h*5 wrt h. -420h*2 Suppose 0 = -4i - i - 40. Let u = -6 - i. Differentiate 0 - u + 5x - 2 with respect to x. 5 Suppose 4g = -3a + 5 + 4, -4g + 8 = 4a. Find the third derivative of 11b*2 + 18b*3 - 18b*g - 2b*5 - 2b*5 wrt b. -240b*2 Let t(h) be the first derivative of 145h*5 + 5h*3/3 + 34h + 443. Find the third derivative of t(n) wrt n. 17400n Let v(m) be the third derivative of 109m*7/210 + 15m*3 + 73m*2 - 1. What is the first derivative of v(u) wrt u? 436u*3 Let q = 58 - 55. Find the third derivative of 24o*2 + 68o*4 + 59o*4 - 124o4 + oq wrt o. 72o + 6 Let m(t) be the first derivative of 311t4/4 + t2/2 - 398t - 245. What is the second derivative of m(k) wrt k? 1866k What is the first derivative of -124s + 293 - 557s + 476 wrt s? -681 Let y(z) be the first derivative of -z*3/3 - 9z*2/2 - 10z + 3. Let o be y(-7). What is the third derivative of 2f2 - 2f*6 - of*2 - 2f*6 wrt f? -480f*3 Let i(g) be the third derivative of 11g8/336 + g6/20 + 69g4/2 - 155g*2. What is the second derivative of i(r) wrt r? 220r*3 + 36r Let p(f) be the third derivative of 221f5/60 + 293f*3/6 + 51f*2. Differentiate p(z) with respect to z. 442z Suppose 29 = -6r - 1. Let w be ((-1)/(-3))/(r/(-30)). Find the third derivative of wh*3 - 2h*4 - 2h*3 + 0h*3 - 5h*2 wrt h. -48h Let l(a) be the third derivative of -47a5/60 - 53a*3/6 + 4a*2. Differentiate l(u) with respect to u. -94u Let f(o) be the first derivative of -91o4/2 + 12o*3 + 2o - 66. Find the third derivative of f(z) wrt z. -1092 Let y(i) be the first derivative of 0i4 - 4/7i*7 - 11/3i*3 + 0i + 0i5 + 0i*2 + 0i*6 + 17. What is the third derivative of y(q) wrt q? -480q*3 Suppose 2m - 4 = 2g - 8, -5m + 3g = 0. Suppose -5 = ml - 14. Find the third derivative of -c*3 - lc*2 - 10 + 18 - 8 wrt c. -6 Differentiate 0 - 7 + 10b*2 + 11 - 9 with respect to b. 20b Let g(z) = -2z + 4. Let p be g(-4). Suppose 2t + 2o - p = 0, 0 = 2t - 2o - 2o + 18. What is the first derivative of -t + 2 - 7j4 + 5 wrt j? -28j3 Let o(f) be the third derivative of f7/30 - f6/40 + f5/30 + 19f4/24 + 66f*2 - 1. What is the third derivative of o(u) wrt u? 168u - 18 Let j(s) = -12s2 - 191. Let u(q) = -q + 2. Let v(o) = -j(o) + 2u(o). What is the second derivative of v(k) wrt k? 24 Let i(j) be the third derivative of -j*6/60 - 47j*5/60 - 93j*3 + 49j*2. Differentiate i(g) wrt g. -6g*2 - 94g Let m(u) be the second derivative of 44u4 - 37u*2/2 - 27u + 4. What is the derivative of m(p) wrt p? 1056p What is the first derivative of -42n*4 + 65 + 221 + 78n*4 - 34n*4 - 43n*2 wrt n? 8n*3 - 86n Let g(q) be the third derivative of q*5/20 - 11q*4/12 - 499q*3/6 - 255q*2. Find the first derivative of g(v) wrt v. 6v - 22 What is the derivative of -11 - 76 - 60s - 79s + 31s wrt s? -108 Suppose 0 = 50i - 100 - 150. Let b(a) be the first derivative of -3/5ai + 0a*2 + 9 + 0a*4 - 2a*3 + 0a. What is the third derivative of b(c) wrt c? -72c Let z(h) be the second derivative of 2h*7/105 + 17h*3/6 + 9h*2/2 + 9h. Let i(q) be the first derivative of z(q). Differentiate i(w) with respect to w. 16w3 Suppose 2w + 20 = 3w + 3c, -53 = -4w - 3c. Find the third derivative of 20o2 - 3o*2 + 89o - 89o - wo*5 wrt o. -660o*2 Let u(r) = -51r*2 - 35r - 6. Let m(v) = 152v2 + 106v + 17. Let w(p) = 6m(p) + 17u(p). What is the second derivative of w(i) wrt i? 90 Suppose -5k - 2v + 183 = 1031, -12 = 3v. Let s be k/(-30) - 4/(-10). Find the third derivative of 4m*2 - 7m*2 + 13m*2 - 13m*s wrt m. -1560m*3 Let p(h) be the third derivative of -253h*4/12 - 667h*3/6 + 2h*2 - 390. Find the first derivative of p(m) wrt m. -506 Let s be (-1 - 3)11/(-22). Suppose -sd + 5 - 1 = 0. Differentiate -4 - 8g*2 - 3g*3 + 8g*d wrt g. -9g2 Let q be 8/24 + 13/(-3). Let f(g) = g2 - 2g - 5. Let s be f(q). Find the third derivative of -sx*5 + 6x*6 - 2x*2 + 3x*6 + 19x*5 wrt x. 1080x*3 Let y be (-2)/(-1)(36/6 + -5). What is the second derivative of -j*y + 7 + 4014j*3 - 4043j3 + j2 - 2j wrt j? -174j Suppose 5i + 1 = 11. Let b be (-4)/i(-10)/4. What is the second derivative of 0u + 0u*4 + 2u + 2u4 - bu wrt u? 24u2 Let w(q) = q4. Let h(o) be the first derivative of -4o*5/5 - 9o - 11. Let u(b) = -h(b) + 3*w(b). Differentiate u(i	{ "pile_set_name": "DM Mathematics" }
3q - 730 = -733. Let y = 3.1 - 4.4. Which is the closest to q? (a) -4 (b) 0.4 (c) y b Let i = 7.11 + -7.31. Which is the nearest to 3/5? (a) -4 (b) i (c) 0 c Let a = 1740 - 1739. What is the closest to a in -0.7, -2.2, 4/7? 4/7 Let i = 2/23 - -15/92. Which is the nearest to -49? (a) -0.5 (b) i (c) 0.2 a Let w = -2 - -1. Let l = -553.136 + 550. Let j = l + 0.136. Which is the nearest to w? (a) -5 (b) j (c) -1/3 c Let n = 9 - 9.3. Let f = 309 + -318. Which is the closest to 1? (a) f (b) n (c) 4 b Let w = 248 - 245. What is the closest to 0 in 5, 1, w? 1 Let z = 22 - 21.88. Let y = -1.88 - z. Let v = -1 - -1.1. What is the closest to -3 in -0.5, y, v? y Let v = 315 + -314.005. Let j = 0.005 + v. What is the nearest to j in 3, 0.3, 0.4? 0.4 Let x = -4.77 - -5.97. Which is the closest to -3? (a) 2 (b) 0.1 (c) x b Let g = 1784.96 + -1785. Let t = 0.4 + 0.1. What is the nearest to 2/7 in g, t, -2? t Let o = 6.3 + -6. Let l be (-1)/3(0 + -4 - (-118 - -108)). Which is the closest to -0.1? (a) 2 (b) l (c) o c Let v = 0.211 + 2.789. What is the closest to 2/7 in v, 1, -1? 1 Let y = 6032/7 - 862. Which is the closest to 1/3? (a) -2 (b) y (c) 3/10 (d) 2 c Suppose 24 = -84u + 76u. What is the closest to u in 0.4, 2/17, 0.1? 0.1 Let t(h) = h2 - h + 28. Let r be t(0). Let i be ((-2)/(-7) - 8/r)/2. Which is the nearest to 7/4? (a) -4 (b) i (c) -0.2 b Let k(y) = -y3 - 6y2 + 8y + 9. Let w be k(-7). Suppose -7n - 20 = -wn. What is the closest to 1 in n, 3/8, -0.4? 3/8 Let q be 46/36/4. Let o = 21 - q. What is the nearest to -1/7 in 3/2, o, -0.5? -0.5 Let s = -26 + -5. Let g = s + 30.6. What is the closest to g in 2/19, -5, 1/9? 2/19 Suppose 6d + 4d + 40 = 0. Suppose 0 = -h + 7 + 5. Let z = h + -11. What is the nearest to 2 in d, 1/4, z? z Let z(x) = 13x*2 + 82x + 27. Let i be z(-6). Let k = -4 - -3. Which is the closest to k? (a) -1/8 (b) -4 (c) i a Let d be (-71)/(-3124)38/3. Which is the closest to -15? (a) 4/5 (b) d (c) -2 c Let i = -13.29 - -0.29. Let w = i + 17. Which is the closest to -0.1? (a) -4 (b) w (c) -1/10 c Let g = -0.36 - -1.06. Let i = g - 0.8. What is the nearest to 0 in -5, 6, i? i Let h(d) = 17d - 1. Let k be h(3). Let i = k - 46. What is the closest to -0.1 in -4, i, -0.2? -0.2 Let i = 254/7 - 3316/91. Let j = 0.1 - 0. Let y = -6668/11 - -606. Which is the closest to j? (a) 4 (b) y (c) i c Let j be (8/10-1)/((-15)/75). Let s = -0.03 - -0.43. What is the nearest to -1 in s, 3, j? s Suppose -3p + 15 + 3 = 0. Let j(t) = -2t + 6. Let a be j(p). Let w = -1 - a. What is the closest to -2 in -2/9, w, -1/6? -2/9 Let l = 529.6 + -530. Let c = 10 + -5. What is the closest to 0 in c, l, -0.1? -0.1 Let p = -296.1 - -296. What is the nearest to 2 in -3, 1/4, p? 1/4 Let t = -19 + 38. Let m = t + -19. What is the nearest to m in -1/3, -2, 3/2? -1/3 Let d = -65 - -104. Let n = d - 43. Let v be -2 - ((-38)/10 - -2). What is the nearest to 1/3 in 5/4, n, v? v Let x be (-2)/5 + 132/80. Let v = -21 - -20.7. What is the nearest to 1 in 1, v, x? 1 Let n = 15.7 + -11.7. What is the nearest to -2/9 in -0.4, -4, -3, n? -0.4 Let r = -26.83 + 27. Let j = 69.07 - 69. Let m = j - r. What is the nearest to 0.3 in m, -1/4, -2/7? m Let g = 881 + -879. Which is the nearest to g? (a) -8 (b) 1/3 (c) -0.4 b Let m(d) = d*2 + 4d + 5. Let o be m(-2). Let l = 66 + -64. Which is the closest to 2/13? (a) l (b) -1/3 (c) o b Let b(i) = -2i + 29. Let l be b(15). What is the closest to -2/3 in l, 2/13, -1/2? -1/2 Let r = 3423/8 - 428. What is the nearest to -0.15 in -4/7, 0.5, r? r Let z = 0.467 - 0.867. What is the closest to 0 in -4, z, 2, 1.6? z Let q = 1945 + -5839/3. What is the closest to 5 in 1, -5, q? 1 Let z be 15/(10350/(-20))(1 + -4). Which is the closest to 7? (a) z (b) -3 (c) 1/32 a Let a = -0.24 - -0.34. Let y = -7 - -27/4. What is the nearest to a in y, 0.2, -6? 0.2 Let h = 0.209 + -0.409. Let v = 29 - 28.9. What is the closest to v in -5, h, -5/6? h Let t = -108.1 + 103.1. Let q = -6 - -9. What is the closest to q in t, 1/2, -0.5? 1/2 Suppose -5z + 8 = 8. Let q be 2/(-4)(-14)/21. What is the nearest to q in -1/6, 3, z? z Let i = -9.44 + 0.74. Let j = -9.2 - i. What is the closest to 0.5 in -4, j, 0.3? 0.3 Let z = 102 + -99. Which is the closest to 3/5? (a) 1 (b) z (c) 2 a Let t(w) = 4w - 34. Let s be t(10). Suppose sd = -4c + 3d - 16, -d = c + 5. Let r = 0.3 - 3.3. What is the closest to 0.2 in -0.2, c, r? -0.2 Let h be 7 - ((-8)/10)/((-8)/80). Let j = -1 - -3. Let s be (2 + -12)(-2)/(-4). Which is the closest to j? (a) h (b) -5/3 (c) s a Let v be 6789/3942 - 4/(-18)-1. Suppose 2w - 5w + 15 = 0. Which is the closest to -1/4? (a) -4 (b) v (c) w b Let q = 190.9 - 188. What is the closest to -2 in 1/11, 4, q? 1/11 Let f = 3599/40 - 723/8. Which is the closest to f? (a) -1 (b) 7 (c) 5 a Let k = -49 - -21. Let l = -28 - k. Which is the nearest to l? (a) 2/3 (b) -0.1 (c) 1 b Suppose 3m + 9 = -0m. Let y = m - -7. Let k be ((-14)/(-4))/(-7)1. Which is the nearest to k? (a) -2 (b) -0.1 (c) y b Let u = 9.2 - 9.3. Suppose 20 = -3j - j. What is the closest to 3 in u, -1, j? u Let h = -0.06 + 2.06. Let o(d) = -1 + 85d3 + 3d*2 + 0d*2 - 84d*3 + 2d. Let s be o(-2). Which is the nearest to s? (a) 4 (b) h (c) -3/4 c Let y = -23.3 + 22.9. What is the nearest to y in -3, -31, -4? -3 Let b = 63.97 - -0.03. Let v = -62 + b. What is the nearest to -0.3 in -1/8, 4/7, v? -1/8 Let v = -0.2 + 0. Let s = -13.9 - -14. Which is the nearest to v? (a) s (b) -5 (c) 1/4 a Let f = -1.105 + 0.905. What is the closest to 0.6 in 4, -4, f, 5? f Let d = -0.07 + 0.12. Let p = d - 0.15. What is the closest to 0.1 in 3, 0.1, p? 0.1 Let y = 1.8 - 11.8. Let k = y + 5. What is the nearest to -1 in -0.5, 1/2, k? -0.5 Let u = 394 - 388. Which is the closest to u? (a) -3 (b) 6 (c) 0.4 b Suppose 31 = 44l - 13. Let k = -0.26 + -0.04. What is the closest to -0.3 in 1/4, l, k? k Let q = -3.417 + -0.583. What is the nearest to 2 in q, 4, 2, -3? 2 Let r = -31.58 - -32. Let q = r + -0.92. Let i(t) = t2 - 1. Let w be i(0). Which is the closest to w? (a) q (b) 1 (c) 0.4 a Let m = 0.41 - 5.41. Let n = -1526/3 - -509. Let u = -0.2 - -0.4. What is the closest to u in n, -2, m? n Let r = -619387/2 + 10545215/34. Let o = -460 + r. Let x(u) = -u2 - 15u - 4. Let g be x(-15). Which is the nearest to -2/11? (a) o (b) 3 (c) g a Let u = -39 + 35. Let o be (-3)/(-6)(-3)/(-1). Which is the nearest to o? (a) -3 (b) -0.1 (c) u b Let k = 0.16 - 0.66. Let o = 5/32 - 89/160. Which is the closest to 1/4? (a) o (b) k (c) 0.2 c Let u = -551.2 - -551. Let t = 0.1 + 0.4. Which is the nearest to -2? (a) t (b) u (c) 1 b Let q = 1.8 + -2. Let r = -48744/5 - -9749. What is the closest to q in 2, -4, r? r Let s = 1023 - 1023.1. Let k = 0.26 + 0.04. What is the closest to 1/3 in s, -4/7, k? k Let q be (5 + -4 - 1)/(1 - -1). Which is the closest to 0? (a) -4/5 (b) 2/3 (c) -0.5 (d) q d Let z be ((-12)/9)/43. Let v be 3/(-10) + z/5. What is the closest to v in 0.3, 5, 4? 0.3 Let d = -48 + 48.39. Let r = 0.35 - d. What is the closest to r in -4, -5, 0.4? 0.4 Suppose 2m = -3n - 2m + 13, -n - 5m = -8. Suppose 25 = 5t + 2p - 7p, -nt = -p - 13. Let l = -55 - -54.6. What is the nearest to 1 in 0.4, l, t? 0.4 Let w = 43 - -7. Let k = w - 49. Which is the nearest to -0.2? (a) 5 (b) k (c) -0.2 c Let n = 0.23 + -0.3. Let z = n - -0.17. Which is the closest to z? (a) 0.5 (b) -3 (c) -4 a Let k = -281 + 282. What is the closest to 2/5 in 5, 10, -0.4, k? k Let z = -2410 + 2410.1. Let p = 8 + -5. Which is the closest to -0.1? (a) p (b) z (c) -1.2 b Let u be (3/(-9))/((-5)/30). Let i = 25 + -24.9. What is the closest to 1 in i, -0.3, u? i Suppose 0 = -n + 2n - 2h - 14, -5h - 29 = -n. Let p = -120.1 + 115. Let d = p + 0.1. What is the nearest to -0.2 in n, -4, d? -4 Let i be 88/55 - 236/160. Which is the nearest to i? (a) 0.5 (b) -0.5 (c) -0.3 (d) -1/6 d Let p be (8/84-1)/((-15)/70). What is the closest to 2 in 14, -2/17, p? p Let x = 757 - 762. Which is the closest to x? (a) 3 (b) -0.5 (c) -2 c Let r = -20 + 20.5. Let v be ((-9)/(-6))/((-12)/(-2)). Which is the closest to 2? (a) -3/5 (b)	{ "pile_set_name": "DM Mathematics" }
)/((-72750)/(-3465) - 21). Is r >= 305? True Let m be 0/19 - (-2121)/7. Which is smaller: 302 or m? 302 Let q = 12 - -12. Suppose -3f - q - 81 = 0. Suppose -5a = -92 + 272. Is a smaller than f? True Let b = 110254 - 6284479/57. Suppose 0 = 3x - 3. Suppose d = -3y - x, -3d = 2 + 10. Is y at most b? False Let g be (-969)/399(-42)/(-12). Suppose -2k + 3 + 1 = 0. Suppose -13 = ku - u - 2v, 5u + 2v + 41 = 0. Which is smaller: g or u? u Let t = 547 - 1632. Let u be (11/7 - 1)t/(-558). Is u greater than or equal to -4? True Let r = 5247 - 5678. Which is bigger: -434 or r? r Let r be 2/(-25) - -225905/750. Which is smaller: 28 or r? 28 Suppose -109j = 788161 - 116176. Which is smaller: j or -6168? -6168 Let x = 439299156/5161 - 85119. Which is greater: x or 1? 1 Let j be ((-14)/(-371))/((-2)/21302). Let b = j + 402. Suppose 3a + 3 = 4a, 4n - 2a = -2. Do b and n have the same value? False Let s(z) = 3z3 - 16z*2 - 7z - 17. Let q be s(6). Let d = -27 - -11. Which is smaller: q or d? d Suppose 0 = -140y + 153y - 1001 - 1495. Suppose z = 5q - 84 - 879, 4q = 5z + 783. Is y bigger than q? False Suppose 16 = 7k - 3k. Suppose -2w - 260 = n + 4n, 3w = -kn - 390. Let x be (-74)/w + 3/30-6. Is x >= -1? True Let s = -76 + 167. Let o = -51 + s. Let a be (-3 - -2) + -1 + o/12. Which is smaller: 1 or a? 1 Let s(x) = -x*3 + 3x*2 - 3x + 10. Suppose 5w + 0w - 4y = -177, -2w = -3y + 75. Let j = w - -37. Let f be s(j). Which is greater: -17 or f? -17 Let y = 94 + -33. Let c = y + -181/3. Let f be 1/(176/10) - ((-456)/64 + 7). Is c at least as big as f? True Suppose 111 = 5d + 3f, -2d + d + 5f + 39 = 0. Suppose 20i = di + 160. Which is greater: i or -38? -38 Let q = -486 - -198. Let n = q + 308. Is n less than or equal to 19? False Suppose -34v = 28v + 1998 + 5318. Which is smaller: v or -68? v Let c be 9(-4)/(-24)(-2)/(-3). Let j = -280/139 + 190962/94937. Which is smaller: c or j? j Let o(t) = -2t - 4. Let j be o(-4). Let p be (-101877)/10j/50. Let r = 815 + p. Which is smaller: -1 or r? -1 Let t be (-4)/(-8)(-1 - -1). Suppose 5w - 170 = -tw. Suppose -x + 3x = -w. Is x at most -17? True Let a = 1548 - 1547.9. Is 1965 smaller than a? False Let p(l) = l3 - 17l*2 + 2l - 19. Suppose -2m - 2m + 2k + 70 = 0, m - 19 = 2k. Let u be p(m). Let z be 3/u(62/(-16) - -2). Is z not equal to 1? True Let o = -150.18 + 182.18. Does o = 1? False Suppose 0v = -3f + 5v - 224, 3f + 203 = 2v. Let r be (9/(-6))/(6/254). Which is greater: f or r? f Suppose -4926r + 4910r = 16. Which is bigger: r or -1/3070? -1/3070 Let i be 1155/(-7) + 2 + 0. Let t = i + 8640/53. Suppose 0 = -2k - 5p - 8, 0k + k = p + 3. Which is smaller: k or t? t Let a = 27.4 - -305.6. Let i = -258 + a. Do 0.2 and i have different values? True Let c = -401 + 410. Suppose 0 = t + 3t - ct. Which is smaller: -4/207 or t? -4/207 Let j(r) = 7r - 51. Let m be j(8). Suppose 0 = -4d - 5c + 988, 5c = md - 1111 - 79. Do 241 and d have different values? True Let m = 51298/57 - 900. Let r = -30 + 29. Is m less than or equal to r? False Let d = 2 + -167. Let x = d + 164.82. Is x at most 2/7? True Let a(y) = -6976y + 64. Let z be a(1). Is -6911 <= z? False Let i(x) = -x + 12. Let g be i(6). Suppose -8s + gs + 902 = 0. Let q = 41491/92 - s. Which is bigger: q or 0? 0 Suppose 3447 = 119q - 110q. Suppose qz - 387z - 368 = 0. Which is smaller: 1 or z? z Let x(o) = o2 + 3o - 54. Let b be x(-9). Suppose -3j = -bj - 5h - 140, 4j = -5h + 140. Which is smaller: j or 2? 2 Suppose 8o = 12o - 76. Suppose -8 - 15 = 3q + 4n, 4q = -3n - o. Let j be ((-21)/98)/((-3)/q). Which is bigger: -1 or j? j Let f be (2/3)/((-3)/(-9)). Suppose -2o - 2h + 58 = 0, fo + 2o - 106 = -2h. Let l = 100 - 77. Is o equal to l? False Let j be 13/(-18)28 + -4 + 2. Let u = j - -1057/18. Which is greater: u or 38? 38 Let r = 10 + -8. Let f = -84.3356 - -1.3356. Which is smaller: r or f? f Let w = 7 - 6. Let d = 7041 - 112655/16. Is w at least d? True Let g be ((-3)/(-2))/(-1 + (-244)/(-248)). Let r = g + 98. Suppose -rh - 6f = -f - 40, 0 = -h - 5f + 8. Which is bigger: 60/7 or h? 60/7 Let s = -37 + 81.8. Let r = s - 40.8. Which is smaller: r or 13? r Let g = 0.29 - -60.71. Let b = 18.224 + -16.224. Which is greater: g or b? g Let s = 1 - -24. Let q = -108 + 79. Let f = s + q. Is -0.8 <= f? False Let h(s) = 20s2 + 12s - 13. Let b be h(1). Suppose 75 = 24l - bl. Which is smaller: 12 or l? 12 Suppose 3x - 3 = 4x. Let k be (x + 0 - -2) + 1. Let d = -2084/589 - -66/19. Which is smaller: k or d? d Let h(p) = -p*3 - 18p*2 + 39p - 25. Let x be h(-20). Is -1445 > x? False Let o = 1.7 + 72.3. Let l = o - 51. Let v = -23.2 + l. Which is greater: v or -8? v Suppose 4k + 8 = -2z, -3k + 0z + 2z - 13 = 0. Let j be ((6/5)/2)/(1/k). Which is bigger: j or 1/6? 1/6 Suppose -5l = -0l + 5. Let r be (398/(-4577))/((-1)/5). Are l and r unequal? True Let t(u) = 5u - 9. Let i(l) = -11l + 19. Suppose 26 - 62 = -4q. Let w(z) = qt(z) + 4i(z). Let b be w(4). Which is greater: 3 or b? 3 Let f = -5 + 6. Let a = 582 - 576. Let g be a/8 + (-3220)/4144. Which is greater: g or f? f Let y = -21 + 31. Let b be (2/3)/((-8)/(-1668)). Let q = -128 + b. Which is smaller: y or q? y Let u = 123 + -121. Let q be 191u - (-4 + (-6 - -10)). Are q and 382 equal? True Let b = 93 - 30. Suppose 6l + b = 21. Let y be l/212/(-2373). Which is bigger: 1 or y? 1 Let l = 109483983/17 + -6438090. Let h = 2143 - l. Do -1 and h have the same value? False Let y be -1 + 4 + 2 + 17. Let i = y - 17. Let c = 45/2 + -221/10. Which is bigger: i or c? i Let c be 6/42 - (-814)/(-210). Which is smaller: 4 or c? c Let i = -18.99 - -19. Let q = i - 2.01. Let s = -14.3 - -13. Which is greater: s or q? s Let t = -63.853 - 0.147. Let j = 6626.94 + -6691. Let p = j - t. Which is greater: -2 or p? p Let o(m) = 2m - 42. Let s(g) = 8g - 51. Let z be s(7). Let k be o(z). Which is bigger: k or -29? -29 Let v be 79 + -2832 + (2 - 3)/(-1). Does v = -2754? False Let b = 4115 - 4115.471. Is b not equal to 4? True Let r(j) = -5j + 0j + 23j - 9j - 1 - 8j2 - j3. Let z be r(-9). Is 3/83 smaller than z? False Let i(n) be the first derivative of 5n3/3 + n2/2 + n - 21. Let z be i(1). Let t = z - 6. Is t less than or equal to 7/11? False Let l be (-3248)/(-110) - (-14 + 15). Let a = l + -189/5. Let j = a - -9. Which is bigger: 0 or j? 0 Let j be -2 + 3 + (-3)/3. Let l = -969 + 59103/61. Do j and l have the same value? False Let s = 193 - 2507/13. Is 1403 greater than s? True Let b = -154581/4 - -2189639873/56660. Which is smaller: b or 0? 0 Let w(h) = -35h + 91. Let i be w(-10). Suppose -327j + 324j = i. Which is smaller: -146 or j? j Suppose -6 = 2l - 12. Let j be l/4 - 58/87. Does j = 2? False Let g be (9 - 21)/((-5)/(5680/72)). Is g != 190? True Suppose 300 + 1888 = 3t - 4h, 0 = -5h - 20. Suppose -244 = -6n - t. Let v = -60 - n. Is 19 bigger than v? False Suppose -3q - 11 = p, -8q + 5q - 3p - 15 = 0. Which is greater: -111/28 or q? q Suppose 12 = 6i - 5i. Suppose -4n + 4a = 0, -5n + 3n - a + i = 0. Suppose 5 = -3v - nc - 10, 2c + 6 = 0. Which is smaller: 6/43 or v? v Let p = 203 - 342. Let d = 697/5 + p. Let m = 14 + -15. Which is bigger: d or m? d Let d = -67 + 147. Let w = d - 88. Let t = 0.29 - 0.09. Which is bigger: t or w? t Suppose 26 = -3v + 16v. Let d be ((-1)/(-2) + -1)v. Which is smaller: 4/153 or d? d Let a = 29061 + -25744. Which is smaller: a or 0? 0 Let b(f) = 6f*2 - 15f - 48. Let z be b(-13). Suppose z = -24a + 3153. Is a >= 83? True Let i be ((-62)/15400836)/((-2)/(-36)). Let d = 0.13 - 5.13. Which is smaller: d or i? d Let g = -2/1933 + -48313/11598. Let s(n) = 8n + 220. Suppose 15l = 8l - 196. Let m be s(l). Is m less than g? False Let n = 30117 - 89087/3. Is 421 smaller than n? True Let w = 26/5 + -57/10. Let p = -4863/244 - 50/61. Which is greater: w or p? w Let c = -46 - -45. Let y be (-288)/(-54) + (c - 4). Which is bigger: 0 or y? y Let s be 7 + -3 - -9 - -3. Suppose -2o - s = -10o. Suppose -a + 0 = -u + 8, -ou = -3a - 14. Is -2 != u? True Suppose 0 = -513m - 28354 + 158656. Which is bigger: m or 276? 276 Let j be (-210)/24*((-1)/5)/((-25)/(-3050)	{ "pile_set_name": "DM Mathematics" }
-1127)34/51. Which is smaller: a or 1? a Let g be -3 - ((-13396)/5712 + (-2)/24). Let d = -40.9 - -44. Let q = -3 + d. Are g and q unequal? True Let s(f) = f3 - 6f*2 + 8f + 3. Let b be s(6). Suppose b = j + 49. Suppose 4n + 5v = -21, 30 = 4n + n - 5v. Is n at most j? True Let u = -92/21 + -1/3. Is -6 equal to u? False Let f be ((-165)/(-15) - 15)3/249. Which is bigger: 0 or f? 0 Let i = -95 - -97. Which is smaller: i or 10/7? 10/7 Let x = 145246/29 + -5009. Which is bigger: x or -1? x Let i = 10.51 + -10.5. Is -0.15 at least as big as i? False Let m = 138 - 1530/11. Which is greater: -0.1 or m? -0.1 Suppose -10l = -7l - 78. Let y = -32 + l. Is 2 at most y? False Suppose 6c - 80 = -10c. Let y be 6/c(-30)/(-12). Which is smaller: y or 7? y Let h = 8 - -40. Let o = 47 - h. Let g = 4 + -1. Which is smaller: g or o? o Let h = -334.3 + 322.3. Let k = 0.2 + -0.2. Let o = 1 - k. Is h at least o? False Let k be (12/(-20) - (-192)/20) + 4. Let b(j) = -2j2 + 22j - 15. Let l be b(k). Is l at most as big as 0? True Let t = -3 - -4.3. Let u = -2.3 + t. Is 4/3 > u? True Let v = -1078.8 + 1079. Which is smaller: v or -333? -333 Let y(z) = 2z - 6. Let p be y(5). Suppose 11o + 7 + p = 0. Is o equal to -1/13? False Let z = -5.93 - 0.07. Let t = 5.9 + z. Let j = 8 + -16. Is t smaller than j? False Let f = -124 + 52. Let o = 9925 + -9998. Which is smaller: f or o? o Suppose -5d + 675 = -5r, -3r - 2r = 4d + 630. Are r and -132 nonequal? True Suppose m - 4 - 25 = 0. Let v = -28 + m. Which is bigger: v or -1? v Let z be (0 + 1)/((-11)/22). Let i(k) = -k2 - 5. Let c be i(-4). Let g be c/(-27) + 1 + z. Which is smaller: 0 or g? g Let z = 68 + 72. Let a = z + -136. Is -6/7 < a? True Let o(a) = -a3 - 31a*2 + 25a - 107. Let c be o(-32). Which is smaller: c or 116? 116 Let m = -258 - -257.6. Which is greater: -15/7 or m? m Suppose -2k + 5h = 31, -18h + 14h = -4k - 68. Is -8 at least k? True Let g = -118 - -119.9. Which is smaller: g or 3? g Let j = -1369291/390 + 3511. Which is bigger: j or 0? 0 Let s = 28 + -113. Is s less than or equal to -83? True Let j(u) = -u3 - u - 11. Let h be j(0). Let c be (-8 - h)15/18. Which is smaller: c or 4? c Suppose 3r - 100 = 4w, -2r + w + 0w + 75 = 0. Which is smaller: 39 or r? 39 Let f = -12 - -39. Let s = -19 + f. Let t = s - 7.7. Is t greater than 1? False Let u = 2.99 + 28.01. Is u less than or equal to 4? False Let h = 3109 - 40395/13. Let f = 24/13 - h. Let a(x) = x*3 - 6x*2 - 8x + 6. Let t be a(7). Which is smaller: f or t? t Let l be 4/(-3)(-4)/144. Let g = 16/297 + l. Are 1 and g non-equal? True Suppose 22h - 8h + 32h = 0. Which is bigger: 3/2587 or h? 3/2587 Let i = -36/109 + -332/1635. Do i and 0 have different values? True Suppose 5k = 6k. Suppose 3z - 15 = k, 2i + 0i = -3z - 37. Let h = 26 + i. Which is greater: 3/25 or h? 3/25 Let j(q) be the first derivative of q*4/4 + 2q*3 + 5q*2/2 + 3q - 1. Let f be j(-5). Suppose t = 5b - 21, -ft - 3b = b - 13. Is -1 >= t? True Let r be (1 + 0)/(664/(-84) - -8). Are 1/2 and r nonequal? True Let c(g) = -g2 - 4g + 38. Let w be c(-8). Suppose 7r = wr. Does -18/17 = r? False Suppose -5h - 153 - 127 = 0. Is h at most as big as -53? True Let u = -78 + 92. Let w be (u - 12)/(4/(-6)). Is -7/2 smaller than w? True Let k = -0.49 + 0.53. Does k = 111? False Let r = 496 + -134. Which is bigger: r or 363? 363 Suppose -8 = g + 12. Let n be (10/(-4) - -3)0 - 19. Is g bigger than n? False Let b be 21/(-14)((-4)/(-6))/(-1). Which is smaller: -3/35 or b? -3/35 Let w = 304 - 223. Is 82 > w? True Suppose 2j = 4s + 60, -26j + 5s + 24 = -25j. Which is smaller: j or -9? -9 Let k = 1275 + -829. Is 445 less than k? True Suppose -44g + 2 = 46. Which is smaller: 2/1053 or g? g Let n = 775.2 - 775. Which is greater: 2/655 or n? n Let l be 31079/(-39) - (0 + 0). Is -83 greater than l? False Let g = -0.25 + -5.75. Let m = g - -4. Is m less than -23? False Let m be (-112)/140((-34 - 0) + -1). Let x = m - 33. Is -5 <= x? True Let i be 1 + 1 + 1 + -98 + 4. Let d be (-2)/916 - 14/i. Which is bigger: 0 or d? d Let l be ((-3)/65)/((-18)/(-12)). Let s = -5 - -12. Let g be (-3)/s - (-6)/14. Which is greater: l or g? g Let u be ((-2)/(-3))/((-2)/6). Suppose 11m + 3m = 3m. Suppose -5s + 1 - 21 = m. Which is smaller: s or u? s Let t = -969 + 968.52. Which is greater: t or 5? 5 Let j be (-2432)/(-456) + (-1 + -3)1. Does -16 = j? False Suppose -74 = 5v + 51. Let h = v + 32. Is h <= 7? True Let i = 102 + -103. Is i >= -6? True Let w(o) = o*3 + 19o*2 - 17o + 5. Let d be w(-20). Let y = d + 54. Is 2/85 not equal to y? True Suppose -4q - 14w = -9w + 1076, -2w = -4q - 1048. Which is smaller: -265 or q? -265 Suppose 2s + 0s = s. Let f be 24/(-60) + (-126)/(-340). Do s and f have the same value? False Let f = -11 - -14. Suppose -i + 10 = 3d, d = -2i + 8 + 2. Suppose fn + 12 = -4y, y + y + dn = -8. Is y >= -2/35? True Let d(g) = g. Let f be d(-2). Let j = -9.04 - -9.14. Which is smaller: j or f? f Let v(t) = -t*2 - 5t + 8. Let a be v(4). Let h = 7 - a. Is h greater than 35? False Let q be 83/5 - 10/(-25). Suppose 2g = 3 - q. Suppose -k + 3m = 5, -4k + 4m = 21 + 7. Do k and g have the same value? False Let c(r) = -4r2. Let m be c(1). Let u be ((-6)/m)/((-3)/(-8)). Let n be u/11/58. Which is smaller: n or 0? 0 Suppose -5v + 2 = 7. Let x be (v/(-2))/(0 - 3/(-6)). Which is bigger: 2/161 or x? x Let x(h) = -h3 + 10h*2 - 14h + 1. Let z be x(5). Is 57 at least z? True Let k = -0.098 + -75.902. Let m = k + 75.8. Is -7 equal to m? False Let r(o) = -o + 17. Let h be r(13). Suppose 9 = -5j - 4k, 4j - k + h - 1 = 0. Is j at most -3? False Let h = -24.04 - -24. Let g = 1.15 - -2.81. Let s = h - g. Which is greater: s or -1? -1 Let c be (-24)/288 + 8282/24. Are 343 and c non-equal? True Let f be -90 - (6/(-4))/((-6)/(-8)). Let j be f/30 - (3 - (-18)/(-5)). Which is smaller: j or 0? j Let t = 2/75445 - 153232/88346095. Is t at most as big as 1? True Let r = -423 - -422.7. Which is smaller: 40 or r? r Let g be -4 + 7 + 9 - 5. Is g > -32? True Let m be 6(1 + 340/(-328)). Which is smaller: m or -1? -1 Suppose 4v + 3 = 3v. Let z be (-1)/v + 28/12-1. Which is bigger: z or 2.9? 2.9 Suppose -3g - 5v = -45, 103 = g + 4g - v. Let n be (1 - 2) + -2 + 33. Suppose -5b + 3h = g, 2h + n = -5b + 3h. Which is smaller: -8 or b? -8 Suppose 0 = n + 2u - 10, 0 = -5n + 4n - 3u + 15. Let t = 258 + -1294/5. Are n and t unequal? True Suppose -2t = -11 - 3. Suppose 6z = tz - 4. Suppose -3o + n = 5, -3n + 10 = -zo - 0n. Is o greater than -3? True Let d be (21 - 19)/((-8)/(-2)). Are d and -1577 nonequal? True Suppose -4k = -5a - 16, -21 = 10k - 5k + 4a. Which is smaller: -2/4403 or k? k Let i = -390 - -389.79. Is i less than -1/14? True Suppose -2 = -4y + 6. Let z be (-6)/3 - -1 - y. Suppose 0 = 7p - 15 + 43. Which is smaller: p or z? p Suppose 1090 = -5v + 2x, 0 = -15x + 17x. Which is smaller: -217 or v? v Let j = 779 - 1074. Are j and -2 nonequal? True Let u = -217 + 104. Is -1/8 <= u? False Let x(k) be the first derivative of -3k4/2 - k3 - k*2/2 - 2k + 5. Let n be x(-2). Let w be (-1)/5 + n/405. Is w > -1? True Let j(l) be the second derivative of 0 + 1/3l3 - 5l + 2/3l4 - 13/2l*2 - 1/20l*5. Let k be j(8). Are 4 and k equal? False Suppose 4p - 2 = 2. Let c(q) = 5q - 267. Let t be c(0). Let v be -4 + (0 - t/66). Is v at least as big as p? False Let b = 72 + -51. Let m = b - 21. Which is greater: 12 or m? 12 Let y be 2 + (0 - -4)/(-4). Let q be 3-2 + y + 4. Let c be (q/3)/((-5)/(-40)). Is 0 != c? True Let q be 1/(24/9 - 3). Let r be 118/(-28) - 1/(-2). Is q greater than or equal to r? True Let p = 676.93 + -677. Are -1/21 and p nonequal? True Let x(c) = -4c + 1. Let t(k) = -5k + 2. Let i(s) = 3t(s) - 4x(s). Let r be i(-12). Does -10 = r? True Suppose x - 27 = 5x + j, -5x = j + 33. Which is smaller: -1 or x? x Let b = 1339 - 1340. Is 2/389 != b? True Suppose -23j - 19456 = -61j. Are j and 511 nonequal? True Let s(w) = 9w. Suppose 3c = 5 - 2. Let g be s(c). Suppose 3u + 3 = 0, 2u = 5k + g + 4. Which is smaller: k or -2? k Let f be -2 + (0 - 6)/(-1). Suppose 4r = d - 8 + 70, -d = f*r	{ "pile_set_name": "DM Mathematics" }
-5 (b) 0.059 (c) -3 b Which is the nearest to -1? (a) -4 (b) -1/4 (c) 11 b What is the closest to -1.6 in -10, 3, -3? -3 What is the nearest to 1 in 1, 2, -5, 0.2? 1 Which is the nearest to 0.9? (a) 5/3 (b) 75 (c) -4 a What is the nearest to -2/3 in 0.1, 3, -554? 0.1 Which is the nearest to -1/2? (a) -5 (b) 3 (c) 1/4 (d) -16/5 c What is the closest to -4.1 in 0.1, 2, 0.4? 0.1 Which is the closest to -1? (a) 1 (b) 24 (c) -2 (d) -2/5 d Which is the closest to -47? (a) 0.5 (b) 0.3 (c) -5 c Which is the nearest to -1/9? (a) -4 (b) -0.4 (c) 3 (d) 99 b Which is the closest to -5? (a) -4/5 (b) 5 (c) 1/6 (d) -7 d What is the closest to -2 in 0.2, 2, -16, -3? -3 What is the nearest to -7/4 in 9, 2/3, -0.2? -0.2 What is the closest to -2/9 in 0.4, 0, -2, 5/16? 0 What is the nearest to -2/7 in 0.4, -1/2, 18.1? -1/2 What is the closest to 2 in -2, -3, -6/11? -6/11 What is the nearest to 1/4 in 1, 131, -1? 1 What is the nearest to -1 in 1, -1/2, 1/8, -1? -1 Which is the nearest to 0? (a) -1 (b) 1/6 (c) -18/5 (d) 4 b What is the nearest to 1 in -0.5, -14, -3/5? -0.5 What is the nearest to -224 in 3, -0.4, 5, -0.5? -0.5 What is the nearest to 2 in -2, 0.3, 1/4, -2/11? 0.3 Which is the nearest to -1? (a) -35 (b) 5 (c) -4 (d) -1/6 d Which is the nearest to 2/7? (a) 4 (b) 0.4 (c) -237 b What is the nearest to 2 in 0, -3/5, -13, 83? 0 Which is the closest to -89/5? (a) -0.5 (b) 0.07 (c) -3 c What is the closest to 27 in -37/3, -2/17, -4? -2/17 Which is the closest to 0.024? (a) -3 (b) 4/5 (c) 4 b Which is the closest to 2/11? (a) 0.3 (b) -0.7 (c) 1 (d) -5/2 a Which is the nearest to 41? (a) 0.3 (b) 1/4 (c) -2 a What is the nearest to -169 in 0.5, 1, 2/13? 2/13 What is the nearest to 0 in -1/2, 1, -9, -1/12? -1/12 Which is the nearest to -2/63? (a) -1 (b) -2/7 (c) 0.2 (d) 5/3 c What is the nearest to -2/5 in 4, 0.1, -17, 0.5? 0.1 Which is the closest to -1? (a) -19 (b) 0.1 (c) 0 (d) 4 c What is the closest to 5/14 in -0.2, 3/5, 20? 3/5 What is the nearest to -0.1 in -1, -3/5, -0.5? -0.5 What is the closest to -1 in -5, 2/7, 0.203, 4? 0.203 Which is the nearest to 5? (a) 0.4 (b) 5/3 (c) -5 b What is the closest to 4.6 in -4, 4, 2? 4 Which is the nearest to -1/2? (a) 0.5 (b) -2.2 (c) -1/6 (d) 2 c Which is the nearest to -1? (a) 2 (b) -233 (c) -2 c Which is the closest to -7? (a) 0.3 (b) -0.7 (c) -1 c What is the closest to -2/7 in 1, -1, 0.1, -0.08? -0.08 Which is the nearest to 8? (a) 0.01 (b) 4 (c) -1/2 (d) 2/3 b What is the nearest to -0.2 in -1/5, -3, -2/7? -1/5 Which is the closest to 16? (a) -0.15 (b) -5 (c) 0.3 c Which is the closest to 5? (a) 3 (b) -2/5 (c) -5 a Which is the closest to -1? (a) -2/9 (b) -4/13 (c) 2 (d) -56 b What is the nearest to 1/8 in -0.5, 2/9, 0.1, -1/3? 0.1 Which is the closest to 2? (a) 2/5 (b) 2/9 (c) -46 (d) 3 d Which is the closest to 1/2? (a) 3/98 (b) -2/3 (c) -1/5 a What is the nearest to -2/7 in 1/24, 0.15, 7/4? 1/24 Which is the closest to 1? (a) 0.3 (b) -1/9 (c) -1/12 (d) 4/3 d What is the nearest to 0.2 in 0.086, -1, 0.5? 0.086 What is the closest to 0.04 in -3, -0.2, 0.5? -0.2 What is the closest to -1 in 1/8, -0.2, 0.08, 1/12? -0.2 Which is the nearest to -0.2? (a) -1111 (b) 2/9 (c) 1 (d) -3/5 d Which is the nearest to 2? (a) 1 (b) -1/619 (c) -7 a Which is the nearest to 1? (a) -1 (b) 43 (c) 0 (d) -0.1 c What is the nearest to 2/7 in -1, 1, 5/4, 4? 1 Which is the closest to -1/2? (a) -1/4 (b) 0.3 (c) -1 (d) 47/17 a Which is the nearest to 0.2? (a) -10 (b) 1/5 (c) -5 (d) 0.05 b Which is the closest to -5? (a) -1 (b) -5/7 (c) 4 a Which is the nearest to 2? (a) 3 (b) -6 (c) -1 a Which is the closest to -3/26? (a) 2 (b) 0 (c) -5 (d) -0.3 b Which is the closest to 0.24? (a) 1/4 (b) -5 (c) -0.38 a Which is the closest to -5? (a) 3/2 (b) 1.1 (c) -0.11 c Which is the nearest to 1? (a) -89/2 (b) 0.5 (c) -2/7 b Which is the closest to 1? (a) -1/1167 (b) -0.4 (c) -1/7 a What is the nearest to 6 in 0.9, 2/7, 1/3, 4? 4 Which is the closest to -0.5? (a) 3/2 (b) 0.3 (c) 1 (d) 2.1 b What is the nearest to 1 in 3, -1/8, -18? -1/8 Which is the closest to -8/7? (a) 4 (b) -3/2 (c) -0.01 b Which is the closest to -1? (a) -2/5 (b) 4/5 (c) 0.1 (d) -3/2 d What is the nearest to 1/3 in -1/11, -0.4, -1, -0.1? -1/11 Which is the closest to -2/9? (a) -79 (b) 0.2 (c) 2 (d) -0.9 b Which is the closest to 0.2? (a) 3 (b) 0.5 (c) -41 (d) -1 b Which is the nearest to 4? (a) 0.1 (b) -3 (c) -2/9 a Which is the closest to -9? (a) 2/3 (b) -0.02 (c) -0.4 (d) 0.1 c Which is the closest to 21? (a) -5 (b) -3 (c) -2 c Which is the nearest to -2? (a) -4/7 (b) -2 (c) -0.8 b Which is the closest to -0.1? (a) 0.02 (b) -2/3 (c) -11 (d) 0.4 a What is the nearest to 1 in 2, -6, 0.2? 0.2 Which is the closest to 0.053? (a) 1 (b) -2/7 (c) 0.4 (d) 5 b What is the nearest to -7 in -1/3, 30, 1? -1/3 What is the nearest to 0 in 1, -163, -0.14? -0.14 What is the nearest to -0.1 in 1, -1/9, -3, -1/4? -1/9 Which is the nearest to -2/5? (a) 3/2 (b) -2/157 (c) -1/6 c What is the nearest to -11 in 1, 2, 3, 0.5? 0.5 Which is the closest to -0.3? (a) 0.3 (b) 3 (c) -44 (d) 2 a Which is the closest to 2/7? (a) 3 (b) 1 (c) 15 (d) -0.2 d What is the closest to 0.6 in 0.15, 4/3, -21? 0.15 What is the closest to 1 in -2, 2/7, -178, 1.3? 1.3 Which is the nearest to 0.1? (a) 1 (b) 0 (c) 46 (d) -0.5 b Which is the closest to -373? (a) -1 (b) 0.4 (c) -6/7 a What is the closest to 0.1 in -9, 5, -1/4, -2/9? -2/9 What is the nearest to -2/7 in 2, -5/6, -5? -5/6 Which is the nearest to -1? (a) -5 (b) 0.038 (c) 0.2 (d) 4 b Which is the closest to 2/3? (a) 2/3 (b) 0.4 (c) -3/7 a Which is the nearest to 2/15? (a) -180/11 (b) -0.2 (c) 5 b What is the nearest to 1/3 in -3/8, 0, 2/7, -0.1? 2/7 What is the closest to -1 in -3, 0.06, 0.3? 0.06 What is the nearest to 0.2 in -42, -0.2, -1/4, -0.04? -0.04 Which is the closest to -0.1? (a) 0 (b) 2 (c) -0.4 (d) -7 a Which is the nearest to 2? (a) -1 (b) 8 (c) -0.3 c Which is the closest to -4? (a) -4 (b) 0.4 (c) 1/4 a Which is the closest to 0? (a) 1 (b) -3 (c) -42 (d) -2 a Which is the closest to 1/4? (a) 14 (b) -6 (c) 4 c Which is the closest to -8? (a) 0.5 (b) 66 (c) 4/3 a Which is the nearest to 0.1? (a) 4 (b) 0.4 (c) 3 (d) 0.015 d What is the nearest to 1 in 2/13, 4/3, -4? 4/3 Which is the closest to -13? (a) -4 (b) 4/9 (c) 5 (d) 2 a Which is the closest to 1? (a) 2/5 (b) 0.5 (c) 352 b What is the nearest to -1 in 0.2, 0.07, -4, 3? 0.07 What is the closest to -0.1 in 0.1, -18, 0? 0 What is the nearest to 2 in -0.2, -0.4, 13, 3? 3 Which is the closest to -0.07? (a) -1/9 (b) -1/11 (c) -5 (d) -320 b Which is the closest to 2? (a) -1 (b) -65/12 (c) 1 (d) -4 c What is the nearest to 5 in -2/5, 4/3, 5, 0.4? 5 What is the nearest to 2/5 in 1, 2, 0.3? 0.3 What is the closest to 1 in -2/19, 8, -0.5, 558? -2/19 What is the closest to -1 in 5, 3.2, 1/50, -1? -1 Which is the closest to 2? (a) -2/9 (b) 0.089 (c) -3/2 b Which is the closest to -1/2? (a) 4/5 (b) -3 (c) -0.09 (d) -2/9 d Which is the nearest to 11/7? (a) 1 (b) 0 (c) -5 a Which is the nearest to -1/3? (a) -3 (b) -2 (c) -1 (d) -0.11 d What is the closest to 2 in 4, 1, 5, 17? 1 What is the closest to 0.7 in -4, -5, 0? 0 What is the closest to -1 in 3, -0.122, 0.3? -0.122 Which is the closest to 1? (a) 4.6 (b) -17/2 (c) -5 a Which is the nearest to -0.7? (a) 5/4 (b) 1/4 (c) -1 c Which is the nearest to -52? (a) -3/5 (b) 3 (c) -3 (d) -4 d Which is the closest to -1? (a) 0.2 (b) -14 (c) 1/3 (d) 2/9 a Which is the closest to -2/5? (a) 2/7 (b) 5 (c) -0.5 (d) -2/5 d Which is the nearest to -2/7? (a) 0.02 (b) -3/7 (c) 5 (d) -1/3 d Which is the nearest to -6? (a) 3/5 (b) 28 (c) 2 a What is the nearest to -1 in -1, 1/3, -3/4? -1 What is the nearest to -2/3 in 4/7, -2/11, -6, 0? -2/11 What is the closest to 0.1 in -77, -2, 3, 2? 2 What is the closest to -0.1 in -0.039, 0, 1? -0.039 What is the nearest to 1 in 0.22, -5/4, -2, 20? 0.22 What is the nearest to 1/3 in -2/19, -0.1, -5, -1/2? -0.1 Which is the nearest to -1? (a) -5 (b) -1/10	{ "pile_set_name": "DM Mathematics" }
= -w - 1. Let k be x(-6). Solve -26 = 2i + ko - 9, -9 = 3o for i. -1 Let m be ((-3)/2)/((-30)/100). Solve -2j = -j - 5, 4j - 15 = -ml for l. -1 Let l be 9/2 - (-3)/2. Suppose -o + lo = 0. Suppose o = b + b. Solve -9 = 4v - h - 1, b = -5v + 5h - 25 for v. -1 Let y be 304/10 + 12/(-5) + 2. Let g(w) = 2w2 - 3w + 2. Let p be g(2). Solve 6k + px - y = k, 3x = 15 for k. 2 Let h be 0/(-21/2). Let f(y) = -2 - 5y + 2. Let k be f(-1). Solve ko + ho - 6 = -b, -b + 4o = 12 for b. -4 Let d be (-9)/3 - (-28)/4. Solve -3y = 2z - d, 1 = -3z - y - 0 for z. -1 Let w(b) = b2 - 7b + 4. Let z be w(5). Let t = 8 + z. Suppose -tu = -4u + 4. Solve g = d - 0g + u, -3g + 4 = -d for d. -1 Let x = -1 - -4. Let a = 0 + x. Let r be (2/(-2))/a-6. Solve ri - 2l + 5 = i, -30 = -4i - 2l for i. 5 Let z be (04/8)/(-1). Let f be ((-42)/(-4))/((-2)/(-4)). Solve s + 8 = -4c + f, c + 4s - 22 = z for c. 2 Let w(y) be the second derivative of -y*3/3 - 4y*2 - 2y. Let g be w(-6). Solve -2i = 4, 2c + 2i - g = -16 for c. -4 Let u = -6 + 2. Let y be (5/2)/((-2)/u). Let g = -2 + y. Solve gf = -3l - l - 31, -5f + 3l = 13 for f. -5 Let y = 1 + 4. Solve 3a - 8a = 5n + 20, 3n = -ya - 18 for n. -1 Suppose 6 = -5m + 21, 0 = 3x + 3m - 9. Solve 0b + 15 = 3b, x = -3w + b - 11 for w. -2 Let a(t) be the second derivative of -t3/6 + t2 + 3t. Let i be a(0). Solve -3c + 9 = -4n, 5 = ic - 3n - 2 for c. -1 Suppose s = 5v - 105, 6v = 3v - 4s + 63. Suppose q = -3c - 2q + v, 5c - 25 = -3q. Solve 3h - ci - 16 = 0, 3h - 5i - 8 = 14 for h. 4 Let j be 1/((-2)/20-2). Suppose -2c = -jc. Solve c = 2g + 4r - 8, 5r = 3g + 13 - 3 for g. 0 Let b(n) = 3n + 31. Let h be b(-6). Solve 2x - r - 5 = 0, -x + h = -r + 4r for x. 4 Let t(q) = q3 + 5q*2 - 2q - 9. Let m be t(-5). Solve -3 = 2p + m, 2w + 5p + 6 = 0 for w. 2 Let r be (1 + (-4)/3)3. Let x be (r - (-3)/3)/1. Suppose 0 = 3v - xv - 84. Solve h + 4 = -3h + 3l, 3l = -4h - v for h. -4 Let d = 11 + -9. Solve -dy + 2 = -2l, -3l = 2y - 2l - 2 for y. 1 Let l = -15 - -17. Solve 4g = -4r + 16, 2g + 4 = -lg for r. 5 Suppose 0 = -6g + 13 - 1. Solve n + 5 = -4j, -j + 3n - g = 4n for j. -1 Let s be ((-3)/(-6))/((-2)/(-24)). Solve 8 = -2k + sk, 5k = y + 5 for y. 5 Suppose -2y + 0k + 21 = -3k, -4k - 22 = -2y. Let w(r) = -r3 - 5r*2 + 5. Let n be w(-5). Solve -n = -s - 3g + 1, -2g = -s - y for s. -3 Let h = 75 - 71. Solve 3y + h = x, -y - 3y + 2x - 6 = 0 for y. -1 Let w(i) be the third derivative of -i*4/24 - 5i*3/6 + 9i*2. Let q be w(-8). Solve -qm + 5m - 3l - 10 = 0, -15 = -3m + 5l for m. 5 Let a = 0 - -4. Suppose 3p - 2m - 7 = -2p, -5p = 4m - 1. Let i = a - p. Solve 5 = -5s + d, -4 = 3s - id - 1 for s. -1 Suppose 3i + 2u + 74 = 0, 4i - u + 3u + 96 = 0. Let b = i - -34. Let s be 8(0 + -3 + (-14)/(-4)). Solve -o = -2x - x - b, so - 2x = 18 for o. 3 Let h(c) = 7c3 + c2 - 1. Let b be h(1). Let l be 25/(-10)8/(-10). Let w = 5 - l. Solve a = -wt - b, -a = -5t - 6a - 5 for t. -3 Suppose -31n - 6 = -34n. Suppose 0 = -0x - 2x + 2j + 4, 0 = x + 4j - 17. Solve -i = xw - ni - 24, 5w = -4i + 4 for w. 4 Suppose -3i - 8 = -5i. Let h be ((-30)/(-4) + -7)(-1 + 39). Solve -ij + 2 = -5g, g - 3g + h = 5j for g. 2 Let c be (-2 + 10/(-2))-3. Let b = c + -14. Let d = -4 + b. Solve -2a + a - dt + 10 = 0, a + 22 = 5t for a. -2 Let f = 3 + 0. Suppose c + n = 0, fn + 8 = 2c + n. Solve -5a + 11 = 3d, 3d - 5a + ca = -21 for d. -3 Suppose 5o + 7 + 3 = 5x, 3o + x - 2 = 0. Solve oz - 5f = -3z - 5, z - 5f = -5 for z. 0 Suppose -2z + 10 = 0, 4z = c + 14 + 4. Solve cp + 2q + 3q = -7, 20 = 2p - 4q for p. 4 Let y = 14 + -11. Solve 0 = -d - yp + 9, d - 2p + 19 = 2p for d. -3 Suppose -4v + 12 = 2z, -z = -3z + 4v - 4. Suppose -6 = -zw - 0. Solve 12 = wx - 2m, 2x = x - 3m + 4 for x. 4 Let q(k) = k - 10. Let a be q(11). Solve -3g = -m + 4m + 12, -g = a for m. -3 Let r(y) = -y3 - 4y*2 + 3y - 7. Suppose -2a + 4 = 14. Let i be r(a). Solve -20 = 5x + 2u, 0 = -ix + u - 4 - 8 for x. -4 Let k(s) = -s*3 + 7s*2 - s + 8. Let m be k(7). Solve 9 = -2c + 2q + m, -2c + 5q = 8 for c. -4 Let l = 9 - 1. Suppose v = 2z - 3 - 1, 4v - l = 2z. Solve -va = -3u + a + 26, 0 = u + 5a + 18 for u. 2 Suppose -z + 6z - 104 = -3w, -69 = -3z - 4w. Let d = -31 + z. Let t be ((-2)/3)/(4/d). Solve 2v - 10 - 8 = -2p, 0 = -tp + v + 3 for p. 4 Suppose -p - i + 0i = -10, -5i = -25. Solve py + d + 19 = 2y, 0 = 3d + 12 for y. -5 Suppose 0 = 4n + z - 15, -5n + z + 23 = -2z. Let w = -2 + 3. Let v be 4 + -2w + -2. Solve 2i + ns + 8 = v, s = i - 2i - 3 for i. -2 Suppose 0 = -2r + f + 5, -3f = 3r - 2f - 15. Solve ro - 4m = -5m + 1, -3m + 18 = -3o for o. -1 Let h = -27 + 45. Let m be ((-6)/8)/(2 + 75/(-40)). Let a = m + h. Solve 0 = 3b + a, -7 = 3v - 3b + 4b for v. -1 Let a(v) = v2 - 3. Let r be a(2). Solve o + 16 + r = 5t, 0 = 3o + 6 for t. 3 Suppose 5y = 3y + 2, p - 5y + 2 = 0. Suppose 5a + 33 = 2v, 5v + 5a = -2 - p. Solve -x - 3o = 4x - 1, -4o - 4 = vx for x. 2 Suppose 5r = 4b - 9b + 95, -2r + 13 = -3b. Solve -4y + 29 = 5n - 2n, -3n + r = y for n. 3 Suppose -12 = -3o, -5o = -3r + 44 + 2. Solve -l - 4a - r = a, -4l - 3a - 20 = 0 for l. -2 Let t(y) = y3 - 7y*2. Let c be t(7). Suppose 3a = -ca. Solve 3w - 4h + 2 + 29 = a, 5 = -5w - 5h for w. -5 Suppose 3 = 2c - 3. Suppose cf - 3 - 6 = 0. Solve -13 = -q + 5q - fw, q - 14 = -5w for q. -1 Let m(k) = 4k2 - 4k - 3. Let s be m(-2). Suppose 3n + 5r = 4n - 18, 3r + s = 4n. Solve -2w + d + 6 = 0, 4w + 3 - 13 = nd for w. 4 Let k be 2 - ((-1 - -3) + 4). Let i be (58/k)/((-1)/2). Solve 9h - 4h - i = -3n, -2h = -8 for n. 3 Let f(m) = 11m + 2. Let u be f(3). Let g = -3 + u. Solve -4l - l = 5i - 35, -4i = 5l - g for i. 3 Let z be (-6 + 0)/(1/(-4)). Let i be 15(3 - z/9). Let l(f) = -f*3 - 7f*2 - 8f - 6. Let v be l(-6). Solve -h - v = -4h, -3a = ih + 2 for a. -4 Suppose -1 - 4 = -a + 3z, 5z - 1 = -3a. Suppose q - a - 1 = 0. Let x be 2 - ((-1)/1 - -1). Solve -5 = 3y - w + xw, 15 = -3y - qw for y. 0 Let d = -5 - -8. Let l(t) = t + 14. Let z be l(-14). Solve z = -do + 5n + 8, 3o - o = 2n + 4 for o. 1 Let h be (1 + 5/(-2))80/60. Let v(s) = s - 8. Let i be v(6). Let u be 10/(i - 5/h). Solve 4z = 4r, 10r + u = 5r - 5z for r. -2 Let g be 5/(-2)(-1 - 1). Solve 14 = 5a - 2i, -4a + g = -i - 8 for a. 4 Suppose -55 + 20 = -5q - 4h, 0 = 3q + h - 21. Solve 5w - 4a - q - 2 = 0, -4w = 4a for w. 1 Let q(y) = -y3 - 9y*2 + 9y - 14. Let m be q(-10). Let k be -1 + (1 - m)/1. Solve -3z - k = o, -2o - 3o = 5z + 20 for o. -4 Suppose 5 = -3h - 31. Let f = -20 + 3. Let p = h - f. Solve -2 = -g - po - 12, 5g - 22 = -o for g. 5 Let d = 22 - 19. Suppose 0 = dx - 18 + 3. Solve j + 2v - 4 = 0, xj + 0j - 2v = -16 for j. -2 Suppose -14 = -4b + 2. Suppose -4z + 2z = -b. Let l(h) = -2h*2 - 18h - 34. Let v be l(-5). Solve zf + 2i + 10 = 0, 2 = -4f + vf - 4i for f. -3 Let k(u) = u3 + 8u*2 + u - 4. Let v be k(-8). Let h be (-2)/(-6) + (-8)/v. Let c be 4 - 4 - (-16 + h). Solve 5g + 3w - 3 = 0, w + c = 5g - 4 for g. 3 Let l(a) = -11a3 - a + 1. Let t be l(1). Let h = 11 + t. Solve h = 5b - 4u + 45, 6b - 5u = b - 50 for b. -5 Let d(u) = 2u*3 - 11u*2 + 5u + 3. Let q be d(5). Solve 2w = 2o + 3w + 3, -24 = qo - 5w for o. -3 Suppose -6g + g = p - 5, -4g + 3p = -23. Suppose -gn + 3n = 8. Solve n + 8 = 4z + 4f, 5f = 4z - 25 for z. 5 Let q be -4 + (-1)/2-2. Let x be 17/(-3)(-9)/q. Let p = -12 - x. Solve -2v + 3n + 3 = -v, pn - 2 = 4v for v. -3 Let m = -2 - -2. Let g be (0 - 0 - m) + 1. Let h(w) = 6w - 1. Let f be h(g). Solve 2o - fu + 7 = 0, -3o - u = -2o for o. -1 Let l(h) = h3 + 6h*2 + 15. Let v be l(-6). Solve j = -3, 4p + 5j = p - v for p. 0 Suppose -6r - 115 = -11r. Solve 2x + 10 = d + 2, r = -4d - 3x for d. -2 Let g(u) = 0u + 1 - 2u - 2u2 + 7u*2. Let p be g(1). Solve -3i = pq - 24, -q - 3i + 8 + 7 = 0 for q. 3 Suppose 0 = 5h - 5w - 20, -3h - 4w = -0h + 2. Let k be 2 - (2 + -3)h. Solve -4 = ku + 3c,	{ "pile_set_name": "DM Mathematics" }
19 + 5167y. 25y + 4 Collect the terms in 3863v - 7721v + 3866v. 8v Collect the terms in -220 - 838w + 103 + 119. -838w + 2 Collect the terms in 752k3 - 10 + 10 - 723k*3. 29k*3 Collect the terms in 23y*3 - 31 + 5y*3 - 12y*3 + 30 + 24y*3. 40y*3 - 1 Collect the terms in -7y*2 + 1215y + 1222y - 3656y + 1219y. -7y*2 Collect the terms in -592p*2 + 329p*2 + 298p*2. 35p*2 Collect the terms in -2j*3 - 2j*3 - 3 + 199j - 199j - j3. -5j*3 - 3 Collect the terms in 11v*3 - v - 38v - 19v3 + 162v + 10v3. 2v*3 + 123v Collect the terms in 18 - 365q3 + 4 - 9 - 13. -365q*3 Collect the terms in -2l2 - l2 + 12l2 + 2l*2. 11l*2 Collect the terms in -2p*3 - 4p*3 + 0p*3 - 128p*2 + 4p*3. -2p*3 - 128p*2 Collect the terms in -9 - 1 + 3f + 53 - 15. 3f + 28 Collect the terms in -75044 + 150091 - s3 - 75047. -s3 Collect the terms in 0r*2 - 615r*3 + 1649r*3 + 0r*2. 1034r*3 Collect the terms in -12q*2 - 9q*2 + 132q + 4q2 + 3 + 30q. -17q2 + 162q + 3 Collect the terms in 1288r2 - 3r*3 - 1288r*2. -3r*3 Collect the terms in 3c*3 + 590905c*2 - 590905c*2 - 10c*3. -7c*3 Collect the terms in -2492s*2 + 4922s*2 - 195s*2 + 7187s*2. 9422s*2 Collect the terms in 4 + 102i*2 - 4 - 26i*2 + 86i*2. 162i*2 Collect the terms in -13w*2 - 16w*2 - 49w*2 + 65w*2. -13w*2 Collect the terms in -210g*2 + 85g*2 + 82g*2 + 72g*2. 29g*2 Collect the terms in -1912s*3 + 3s - 132s3 - 3s + 141s3. -1903s3 Collect the terms in q3 + 5q + 4q - 7 + 11q - 20q. q*3 - 7 Collect the terms in -714c + 1514c - 774c. 26c Collect the terms in -626f*2 + 289f*2 + 298f*2. -39f*2 Collect the terms in -738d + 372d + 366d + 7703d2. 7703d*2 Collect the terms in -26324k + 52667k - 26343k - 3k3. -3k*3 Collect the terms in -40f*2 + 17368 - 17368. -40f*2 Collect the terms in -11t*3 + 39t*2 - 38t*2 + 635 + 12t3. t3 + t*2 + 635 Collect the terms in -4547b*3 - 4543b*3 + 13637b*3 - 4544b*3. 3b*3 Collect the terms in 508j*2 - 5j + j + j + 119j2. 627j*2 - 3j Collect the terms in 77w - 224w + 73w + 75w. w Collect the terms in 293u - 716u - 5333u - 1785u. -7541u Collect the terms in -10273 + 10273 - b - 8b + 7b. -2b Collect the terms in -328d + 328d + 366d2 - 83d*2. 283d*2 Collect the terms in 151q*2 + 408q*2 + 177q*2 - 40q*2 - 52q*2. 644q*2 Collect the terms in -110367h*2 - 110365h*2 + 220735h*2. 3h*2 Collect the terms in 35u - 21u3 - 19u - 16u + 20u - 20u. -21u*3 Collect the terms in -2z + 7z + 2z + z - 18z + 6z. -4z Collect the terms in -7 - 1 + c - 12 - 4c + 20. -3c Collect the terms in -20 - 533c + 10 - 528c + 1059c + 10. -2c Collect the terms in z - 146 + 52 - 2z - 109. -z - 203 Collect the terms in m3 + 14 - 29 - 36 + 91 - 40. m3 Collect the terms in -411q2 - 412q*2 + 1223q*2 - 423q*2. -23q*2 Collect the terms in -26 + 46z*2 - 201z*2 + 47z*2 + 52z*2 + 57z2. z2 - 26 Collect the terms in 29b + 34b - 54b. 9b Collect the terms in 16l2 - 97l*2 - 60l*3 + 58l*3. -2l*3 - 81l*2 Collect the terms in 212 - 4j*3 - 18 - 194 + 2j*3 - 4j*3. -6j*3 Collect the terms in -819510 + 0n - 3n + 819510. -3n Collect the terms in 1993s2 + 1949s*2 - 3942s*2 + 4s*3. 4s*3 Collect the terms in -52g - 1181 + 1107g2 - 1108g2 + 1181. -g2 - 52g Collect the terms in 4 - 5 + 13921m + 1. 13921m Collect the terms in -14o + 9o - 9o + 7o. -7o Collect the terms in -7675b - 7677b - 7672b - 7670b + 30694b - 3b*2. -3b*2 Collect the terms in -5z*3 - 23 - 12 + 18 + 17 + 2z*3. -3z*3 Collect the terms in -8m*2 + 12m*2 - 42m*2 - 31m*2. -69m*2 Collect the terms in -536 + 0c - 7c + 198 - 10c. -17c - 338 Collect the terms in -104f*3 - 81f*3 + 349f*3 - 77f*3 - 85f*3. 2f*3 Collect the terms in -o - o + 3o + 13o + 3o - 20o. -3o Collect the terms in 6791s - 13571s + 6788s. 8s Collect the terms in 4m2 + 301m*3 - 4m*2 - 450m*3 - 365m*3. -514m3 Collect the terms in w2 + 99 + 115 + 117 + 111 - 442. w*2 Collect the terms in -8 + 27 - 16 + 114m*3 - 115m3 - 24. -m3 - 21 Collect the terms in 5583 + 5593 - 16d2 - 11176. -16d*2 Collect the terms in 0 + 0 - 2042w + 241927w. 239885w Collect the terms in 249253512 - 249253512 + 5h3. 5h*3 Collect the terms in -19h + 43h - 18 - 8h - 11h. 5h - 18 Collect the terms in -8b3 - 18b*3 - 28b*3 - 3b + 0b. -54b*3 - 3b Collect the terms in 785b - 262b - 266b - 257b - 39b3. -39b*3 Collect the terms in -1 + 1 + 8773b + 10697b. 19470b Collect the terms in -2905r3 - 1 + 1 + 2910r*3. 5r*3 Collect the terms in -3436b + 1693b + 1746b. 3b Collect the terms in 1193a*3 + 2392a*3 + 779a*3. 4364a*3 Collect the terms in 5030f*2 - 1677f*2 - 1682f*2 - 1674f*2. -3f*2 Collect the terms in 11228o*3 - 52 + 52. 11228o*3 Collect the terms in 33121x*2 - 33131x*2 - 292x + 292x. -10x2 Collect the terms in 16546 - k3 - 3k3 - 33087 + 16541. -4k*3 Collect the terms in -12693v*2 + 5 - 6404v*2 - 5. -19097v*2 Collect the terms in 26k + 19k + 2k + 36k + 20k - 107k. -4k Collect the terms in 69o + 4o*3 + 17o*3 + 124o - 5o3 - 193o. 16o3 Collect the terms in -2206 + 4400 + 18r*3 - 2194. 18r*3 Collect the terms in 0 + 0 - 10g*3 + 17g*2 + 2g - 6g3. -16g*3 + 17g*2 + 2g Collect the terms in 148p2 - 11p*2 - 13p*2. 124p*2 Collect the terms in -17n - 10n - 6n + 41n - 5n. 3n Collect the terms in -66 - 135 + 201 + 22c. 22c Collect the terms in -19z*2 - 16z*2 - 5632 + 5632 - 21z*2. -56z*2 Collect the terms in 80r*2 + 394r + 126 - 42r2 - 39r*2 - 394r. -r*2 + 126 Collect the terms in 23 - 10 + 2758w*3 - 13. 2758w*3 Collect the terms in -12w - 78w + 73w. -17w Collect the terms in 71q*3 + 141q - 885q3 - 273q + 132q. -814q*3 Collect the terms in -6 - 675k*2 - 106k*2 + 7. -781k*2 + 1 Collect the terms in -1023 - 907 + 209 - i. -i - 1721 Collect the terms in -157v + 893v + 285v. 1021v Collect the terms in -28j*3 - 31j*3 + 133j*3 - 66j*3 - 7j3. j3 Collect the terms in -2m + 3 + 5 - 4 + 3m - 15m. -14m + 4 Collect the terms in -4 - 20 - 5n - 4n. -9n - 24 Collect the terms in 152t*3 - 260t*3 + 109t3. t3 Collect the terms in 891l2 - 420l*2 - l + l - 434l*2. 37l*2 Collect the terms in 330 - 310d*3 - 330 - 316d*3 + 624d*3. -2d*3 Collect the terms in 2263n*2 - 8876n + 8876n - 6546n*2. -4283n*2 Collect the terms in 68 - 2582a*2 - 68 + 2859a*2. 277a*2 Collect the terms in -8z - 5 + 66z - 25z - 14z - 1. 19z - 6 Collect the terms in -12n + 134395714 - 134395714. -12n Collect the terms in -p*3 - 3p*3 - 26p*2 - 7p*2 + 31p*2. -4p*3 - 2p*2 Collect the terms in -41 - 4l + 49 - 43. -4l - 35 Collect the terms in l2 + 41l*3 + 0l - 7l - 211l*3. -170l3 + l2 - 7l Collect the terms in -173893 - 173902 + 5u*3 + 347795. 5u*3 Collect the terms in -8448u*3 - 8463u*3 + 16904u*3. -7u*3 Collect the terms in 0z*3 + 8648z2 + z3 + 8524z2 + 8648z*2 - 25820z2. z3 Collect the terms in 45d - 2d*2 - 2d - 97 - 5d - d2. -3d*2 + 38d - 97 Collect the terms in 0v3 + 2604v + 3v3 + 153v*2 - 2602v. 3v3 + 153v*2 + 2v Collect the terms in 29 - 10t - 60 + t + 25. -9t - 6 Collect the terms in 159932c + 6c*3 - 159932c + 11c3. 17c*3 Collect the terms in 0h3 - h3 + 278447h2 - 278447h2 + h3 + 4h3. 4h*3 Collect the terms in -108f*2 + 180f*2 - 78f*2. -6f*2 Collect the terms in -6y - 45547y2 + 45541y*2 + y. -6y*2 - 5y Collect the terms in -11n + 6n - 7 - 2n. -7n - 7 Collect the terms in -18880g2 + 9444g*2 + 9435g2. -g2 Collect the terms in 25 - 25 - 83z2. -83z*2 Collect the terms in 306k*3 + 8 + 145k*3 - 578k*3 - 8. -127k*3 Collect the terms in 13v*2 - 22667268v + 22667268v. 13v*2 Collect the terms in c + 12 + 81c*3 - 12 + 116c*3. 197c*3 + c Collect the terms in -31x	{ "pile_set_name": "DM Mathematics" }
)/(-42))/(2/51000). What is p rounded to the nearest one million? 2000000 Suppose -2x - 9 = -3x. Let r = x + -6. Suppose -rt + 4s = -209992, -2 = -s - 0s. Round t to the nearest one hundred thousand. 100000 Let a = -6 + 8. Suppose 2x = 3l + 3 - 11, 3x - 1 = -al. Suppose lp + 659980 = -v - 3v, -989995 = 3p + v. What is p rounded to the nearest 100000? -300000 Suppose 0t = -2t. Suppose t = 13c + c - 280000. Round c to the nearest 100000. 0 Let b = -0.3589997486 - -0.359. What is b rounded to 7 decimal places? 0.0000003 Let t be (-4)/9 - (-1682932)/(-153). Round t to the nearest one hundred thousand. 0 Let y = 84640.9998 + -84629. Let x = -1.4 + 13.4. Let q = y - x. Round q to three decimal places. 0 Let k = -5513.732 + 5778.8. Let x = k - 264. Let d = x + -1.1. What is d rounded to 2 decimal places? -0.03 Let s = 44886 - -135114. What is s rounded to the nearest 1000000? 0 Let l = 412.00002397 + -412. Round l to 6 dps. 0.000024 Let x = -0.446 + 182.446. Let o = x - 108. Let h = o - 74.53. Round h to 1 decimal place. -0.5 Let k = 0.096 + 61.904. Let w = 113 - k. Let b = -51.049 + w. Round b to 2 dps. -0.05 Let d be 26/(-4)-2 - 3. Let h = d - 7. Let p be 25(-1128)/(h - 0). Round p to the nearest 1000. -9000 Let l(o) = -o + 18. Let h be l(14). Let k be 1/h - (-106419)/(-76). What is k rounded to the nearest one hundred? -1400 Let g = 69 + -979. Let u be 7(-10)/(-35)g. What is u rounded to the nearest 100? -1800 Let x = 6.95 - 7. Let n = -1.17 - -1.1. Let s = n - x. Round s to two decimal places. -0.02 Let m = -6.760000618 + 6.76. Round m to seven decimal places. -0.0000006 Let k = -8.115045398 - 42.884955392. Let o = 51 + k. Round o to seven dps. -0.0000008 Let z = 158.6 - 156. Let v = 2.449 - z. Round v to 2 decimal places. -0.15 Let b = 70754 + -29354. What is b rounded to the nearest 1000? 41000 Let f = -110.11 + 1.11. Let j = -110.46 - f. Round j to 1 decimal place. -1.5 Let l(j) = j2 - 13j + 6. Suppose -5v + 39 + 21 = 0. Let a be l(v). Let m be 1 + 3217469/a. What is m rounded to the nearest 100000? -400000 Let n = 14579 + -14578.39998. Let b = 2.4 - 3. Let d = b + n. Round d to 4 dps. 0 Let l = 114 + -36. Let b = -77.8276 + l. Let d = b - 0.17. What is d rounded to 3 dps? 0.002 Let s = -6172 + 6178.882. Let j = s - 0.082. Let v = -8.14 + j. Round v to 1 dp. -1.3 Let r = 23.8 + 52.7. What is r rounded to zero decimal places? 77 Let d = 16034 - 16035.3998. Let h = -1.38 - d. What is h rounded to three decimal places? 0.02 Suppose 5 = 3c + 4n, 2c + 4n + 1 = 3. Let t be 2 + 10/(-2) + c. Suppose -2s + 6s + 3400 = t. What is s rounded to the nearest one hundred? -900 Let l = -4.17 - -4.05. Round l to 2 dps. -0.12 Let n(q) be the third derivative of -4859999q4/24 + 5q*3/6 + 15q2. Let s = 8 + -13. Let t be n(s). Round t to the nearest one million. 24000000 Let v(h) = h2 + 12h + 12. Let z(a) = a2 + 11a + 11. Let b(d) = 3v(d) - 4z(d). Let n be b(-8). Let p be 99 - 5n/(-20). Round p to the nearest ten. 100 Let b = 0.63 - 20.63. Let d = 19.999 + b. Round d to two dps. 0 Suppose -99 - 61 = -16t. Suppose -tc = -6c - 1760000. Round c to the nearest 1000000. 0 Let f = 7.5 + 76.5. Let r = -0.5035 - -83.6835. Let o = r - f. Round o to one decimal place. -0.8 Let t = 836 + -966.2. Let n = -116 - t. Let m = 0.7 - n. Round m to the nearest integer. -14 Let r = -6.55 + 6.554433. What is r rounded to 3 dps? 0.004 Let z = -1091.987552 - -1092. What is z rounded to three decimal places? 0.012 Suppose -1914000 = 2w - 4v, -w + 208508 - 1165508 = -v. What is w rounded to the nearest 100000? -1000000 Let f = 470 - 467.89. Let p = 0.11 - f. Let l = 1.976 + p. Round l to 2 dps. -0.02 Let r = 0.0434 + -0.043683. What is r rounded to five dps? -0.00028 Let f = -452.999743 - -453. What is f rounded to four decimal places? 0.0003 Let m = 268.1404 + 0.1596. What is m rounded to the nearest ten? 270 Let k = 0.06 + 0.49. Let s = -3.82 - -3.04. Let f = s + k. What is f rounded to 2 decimal places? -0.23 Suppose 0 = -3n - r + 23 + 12, 36 = 4n - 4r. Let y(h) = -h3 + 12h*2 - 11h. Let a be y(n). Round a to the nearest one hundred. 0 Let v = 0.09 + -31.09. Let t = v + 31.071. Round t to two decimal places. 0.07 Let u(b) = 83b3 + 6b*2 - 3b - 6. Let j be ((-15)/(-10))/((-3)/18). Let g be u(j). Round g to the nearest one hundred thousand. -100000 Let t = 11168.0006519 - 11168. What is t rounded to 5 dps? 0.00065 Let q = 876287 - 875244.851. Let p = -1041 + q. Let t = p - 1.07. Round t to 2 dps. 0.08 Let z = -0.7999672 + 0.8. Round z to 5 dps. 0.00003 Let z = -4.06 - -3.7996. Let b = z + 0.25. What is b rounded to three decimal places? -0.01 Let p = 27.99944 + -28. What is p rounded to four dps? -0.0006 Let h = 4281.2 - 4659. Let k = h - -459. Let d = k + -91. Round d to the nearest integer. -10 Let d = 66 - 66.00289. Round d to 4 dps. -0.0029 Let w = -26 + 29. Let m be (-4)/(1 - w) - -149998. What is m rounded to the nearest one hundred thousand? 200000 Suppose -4l - 3l = 56. Let d be -4106 - (0 + l + 4). Let u = 902 + d. Round u to the nearest 100. -3200 Let b = -55 - -33. Let l = b - -21.99974. Round l to five dps. -0.00026 Suppose 0 = -258b + 252b + 297660. What is b rounded to the nearest ten thousand? 50000 Let a = -65.198 - 41.701. Let m = a - -107.5. Round m to 1 dp. 0.6 Let d = 6.86 - 6.860005032. What is d rounded to six dps? -0.000005 Let g = -8.748 - -9.93. Let o = g - 1.2. Let x = 0.017977 + o. What is x rounded to five decimal places? -0.00002 Let l = 980 - 1120.2. Let w = l - -161. Let n = w + -24. What is n rounded to 0 decimal places? -3 Let l = 0.47101139 - 0.471. Round l to 7 decimal places. 0.0000114 Let a = -989.3 + 991.30212. Let u = -1.832 + a. Let f = u - 0.17. Round f to 4 decimal places. 0.0001 Let y = 49.4 + -4.4. Let k = y + -45.0135. What is k rounded to 3 dps? -0.014 Let q(g) = 10 - 2g + 3g + g - 3g + 900g*2. Let z be q(10). Round z to the nearest one hundred thousand. 100000 Let n(r) be the second derivative of -340007r*3/6 - 21r*2/2 - 52r. Let x be n(-3). What is x rounded to the nearest one hundred thousand? 1000000 Let s be (115)/(30/8000). Let v be (s/(-15))/(22/3600). What is v rounded to the nearest 10000? -240000 Let z = 806.5125 - 0.1125. Round z to the nearest ten. 810 Let g(l) = -l*2 - 3l - 23800000. Let t be g(0). Round t to the nearest 1000000. -24000000 Let x = -1.13691 + 549.36591. Let j = x + -548. Round j to 2 decimal places. 0.23 Let g = 372 + -240. Let j = g - 83. Let m = j - 49.00000023. What is m rounded to 7 decimal places? -0.0000002 Let f = 0.58 + -0.580565. What is f rounded to 4 dps? -0.0006 Let j(f) be the first derivative of -3916f2 + 8f - 1. Let h be j(-6). Round h to the nearest 10000. 50000 Let v = 0.0788 + 123.1212. Let t = -102 + v. Round t to the nearest integer. 21 Let g = 899 - 577. Let d = -318.66 + g. Round d to 1 dp. 3.3 Let x = 1769759924.430000127 + -1769760026.43. Let o = -102 - x. Round o to seven decimal places. -0.0000001 Let a = 795.59 - 799. Let w = -4.1 - a. Let j = w - -0.689913. Round j to 5 dps. -0.00009 Let p be (3 + (3 - 152))-50. Suppose 3t = -3 + 24. Suppose tw - p = 8w. Round w to the nearest 1000. -7000 Let o = -376 - -376.187. Round o to two decimal places. 0.19 Let v = -1.32 + 1.3209088. What is v rounded to four decimal places? 0.0009 Let q(r) = 34159r + 18. Let k be q(-2). What is k rounded to the nearest ten thousand? -70000 Let o(j) = -4298j + 2. Let w be o(-1). Let s be 165/(-11)w-40. What is s rounded to the nearest 100000? 2600000 Let a = 3299 - 3327.26. Let r = -28 - a. Let m = r - 0.48. Round m to one dp. -0.2 Let i = 0.016 + -59.016. Let m = 7785565116 + -7785565056.99999959. Let l = i + m. Round l to seven decimal places. 0.0000004 Let z be (-4)/32 + 30/(-16). Let d be 3802 - (z - 20/(-5)). Round d to the nearest one thousand. 4000 Let j = 41 - 84. Let g = -49605735 - -49605777.999961. Let w = g + j. What is w rounded to five dps? -0.00004 Suppose 5g + 2139 = 14189. Round g to the nearest 1000. 2000 Let k = 36 + -34. Suppose -181990 = 3u - ku + 2p, -4u - 2p - 727990 = 0. Round u to the nearest 10000. -180000 Let u = 28 + -31.2. Let z = u - -3.19999922. What is z rounded to 7 decimal pla	{ "pile_set_name": "DM Mathematics" }
uppose -10f - 18 = -4f. Let n be (-6)/15 + 14/10. Let k = 0 - n. Sort f, k, 0. f, k, 0 Let o be 2/8 - 39/12. Suppose 2d - 43 = -3v, 3d - 2d = -5v + 74. Let i(a) = a - 17. Let w be i(v). Sort w, 1, o in increasing order. o, w, 1 Let r = 2 + -1.8. Let c = 1739.98 - 1740. Put r, c, -1 in decreasing order. r, c, -1 Let u(f) = f3 - 5f*2 - 4f - 8. Let q be u(6). Suppose -8 = -t - 5. Let r(x) = -x*3 + 6x*2 + 6x + 3. Let i be r(7). Sort i, t, q in descending order. q, t, i Suppose -4q - 21 = 35. Let b = 13 + q. Let p = 1 - 7. Sort 3, p, b. p, b, 3 Let x be 5 - 4 - (-21 - -2). Suppose -21s = -xs + 6. Let o be 4/(-10) + 8/20. Sort o, 2, s in decreasing order. 2, o, s Let a = -0.0984 - 16.6816. Let p = a - 0.22. Let w = p - -16.3. Put 4/5, w, -0.3 in decreasing order. 4/5, -0.3, w Let f = 18 - 32. Let n = 16 + f. Suppose 2a - 3o - 3 = 0, -5o = -6a + a. Sort 3, n, a. a, n, 3 Let v = -6 + 20. Suppose -4o + 4q - 2q - 36 = 0, 2q = -4. Let w = v + o. Sort 0, 1, w in descending order. w, 1, 0 Suppose 316i - 315i - 5w = -3, -9w + 9 = -3i. Let y = 5 + -2. Put y, 1, i, 2 in decreasing order. y, 2, 1, i Let g = 3023/6 - 504. Let w = 0.27 + -0.77. Sort 2/21, g, w in descending order. 2/21, g, w Suppose -9 = u + t, -2u - 3 = -u + 4t. Let y(s) = s*2 + 12s + 7. Let w be y(u). Put -1, w, 4 in descending order. 4, -1, w Let j = 6.88 - 101.68. Let t = j + 95. Let u = 0.1 + 0.9. Sort -3, t, u in descending order. u, t, -3 Let n = 191 + -190.7. Put 5, 2, n, -2/11 in descending order. 5, 2, n, -2/11 Suppose 9 = 3t - 3i, 5t - 6t + 5 = -2i. Let q = -10 + 6. Sort -3, t, q in descending order. t, -3, q Let s = -7045 + 119763/17. Suppose 0q - 3 = -q. Put s, -2/13, q in ascending order. -2/13, s, q Let i = 30 - 64. Let u = 29 + i. Let t be ((-6)/15)/(1/u). Sort 1, 4, t in descending order. 4, t, 1 Let c = 1 + -2. Suppose q - 1 = 2q + 5j, -4j + 8 = 3q. Suppose 2u + 3u = -30. Put q, u, c in ascending order. u, c, q Let s = -1010 - -1014. Let j be 1/3 + (-8)/(-3). Put 0, -6, j, s in decreasing order. s, j, 0, -6 Let z be 5/(4/(7 - 3)). Let g = 40.2 + -40. Sort g, 3, z in increasing order. g, 3, z Let z = 17523 + -17521. Let t = 1 + -1.1. Put z, t, 14 in increasing order. t, z, 14 Suppose -4b = -3b - 8. Let q = -210 - -211. Put q, 3, b, -1 in descending order. b, 3, q, -1 Let a(o) = 17o2 + o3 - o3 - o3 + 18 - 24o*2 + 3o. Let m be a(-7). Sort -28, m, -5 in decreasing order. m, -5, -28 Let w = -51 + 53. Let b = -7.5 + 8. Put -5, b, w in decreasing order. w, b, -5 Let d be ((-750)/(-27) - 3) + (-6)/(-27). Sort d, 4, -4, 5 in descending order. d, 5, 4, -4 Suppose 0 = -7x + 2x - 5. Let y = -1 + x. Let t be ((-40)/(-30))/(y/3). Sort 5, 2, t in ascending order. t, 2, 5 Let x = 0.11 - -1.89. Sort x, -1/47, -4 in increasing order. -4, -1/47, x Let q = -98 + 104. Sort q, 3, 1 in descending order. q, 3, 1 Suppose -x - 3m = -4x + 81, -4x - 2m = -114. Put 2, -4, x, -5 in decreasing order. x, 2, -4, -5 Let v = -0.5 + 0.1. Let j = -7525/4 + 1881. Sort 9, -2/9, j, v in decreasing order. 9, -2/9, j, v Suppose -5u - 26 = -3h, -4u - 5 - 15 = -2h. Let m be ((-7)/(-21)0)/2. Sort 6, h, m in ascending order. m, h, 6 Let q = 66.4 + -66.5. Sort -46, -1/3, -1/9, q in ascending order. -46, -1/3, -1/9, q Let s be 23 + ((-16)/(-40) - (-12)/(-5)). Let f(y) = -y3 - 4y*2 + 8. Let c be f(-2). Sort -4, c, s in increasing order. -4, c, s Suppose 3w - a + 5 = 0, 99w - 97w + 3a + 7 = 0. Let l be 18/(-2) - 8/(-8). Sort l, -1, w, 1 in descending order. 1, -1, w, l Let z = 30 - 22. Let q(p) = p2 + 7p + 8. Let j be q(-6). Suppose -o - 2k + 9 = 0, -23 = -4o + o - 4k. Put z, j, o in increasing order. j, o, z Suppose -13x - 2g + 12 = -15x, 6 = -5x - 3g. Let i = -5 + 8. Sort x, -1, i. x, -1, i Let p = 1584 - 1587. Suppose -2t = 4, s + 5t - 2t + 2 = 0. Suppose 3h = y - 11, 6y = -sh + 3y - 32. Sort h, p, -2 in descending order. -2, p, h Let v = 955 - 955.2. Sort v, -2, 4, -2/23. -2, v, -2/23, 4 Let f = 0.098 - 0.198. Sort f, -3, -0.15. -3, -0.15, f Let r = 0.686 + -0.286. Put r, -3/2, -4, 0.33 in increasing order. -4, -3/2, 0.33, r Suppose -13r = 106 - 67. Put r, 1, 5, 32 in descending order. 32, 5, 1, r Let f = 508 - 512. Let c(j) = -j*2 + 12j + 4. Let i be c(12). Put i, f, 2, 9 in descending order. 9, i, 2, f Suppose -2c + 3l = -3, 2c - 8 = -2c + 4l. Suppose -3o + 0 + 1 = -2p, p + c = -o. Sort -4, o, 3 in ascending order. -4, o, 3 Suppose 4r + 22 = -r - v, -19 = 5r + 2v. Let h be (-4)/8 + 2/4. Suppose -5o - 3z = 20 - 50, 3o - z - 4 = h. Sort 0, o, r in decreasing order. o, 0, r Let u = 1 - 0.9. Let n = 7578.2 + -7578. Put -3/5, n, u in descending order. n, u, -3/5 Suppose 0 = -0m - 3m - 9. Let h(z) = z + 2. Let n be h(m). Suppose -2a = 5g - 4, 3a + 3g - 3 = -6. Put a, n, 1 in ascending order. a, n, 1 Let l be 2 - 2 - (-3 + -2). Sort 4, l, -5, -17 in ascending order. -17, -5, 4, l Let h = -1406 + 1405.7. Put -18/11, 5, h in ascending order. -18/11, h, 5 Let l = -266.102 - -266. Sort 1/2, -1/8, l in descending order. 1/2, l, -1/8 Let y(q) = q2 + 36q + 133. Let f be y(-32). Sort f, 4, -27, 0 in descending order. f, 4, 0, -27 Let z be 980/(-294)(-1)/25. Sort 1, 11, z. z, 1, 11 Suppose 0v + 2 = v, 5 = b + v. Suppose x + b - 1 = 0. Sort x, 4, 2. x, 2, 4 Let b(r) = r*3 - 7r*2 + 11r - 5. Let c be b(6). Suppose 0 = -2v - 2n + 42, 2v + 5n + 7 = 49. Let s = c - v. Put s, 0, 2 in decreasing order. s, 2, 0 Suppose -3h = 4j - 6, -4h - 10 = -3j - 9h. Suppose 2v - s - 12 = -2v, j = -v - 2s + 12. Suppose u - v = -u. Sort 5, u, -5 in descending order. 5, u, -5 Suppose 4m + 11 = 3j, -j - 1 + 10 = 4m. Sort j, -13, 3 in decreasing order. j, 3, -13 Suppose 83 = -3x + 56. Sort 2, 5, x in ascending order. x, 2, 5 Let h(g) = -g + 28. Let i be h(25). Suppose -a + 2q = -ia - 6, -q = -2a + 9. Put a, -4, 3 in decreasing order. 3, a, -4 Let u(z) = 10 + 7 + 0 + 3 + 4z. Let y be u(-5). Sort -4, y, 3, -8 in increasing order. -8, -4, y, 3 Let o be (-36)/10 - -62/3. Sort -1, 3, -2, o in descending order. 3, o, -1, -2 Let b = -3 - -1. Let i = 5 + b. Let a = -248.2 - -248. Put 0.2, i, a in descending order. i, 0.2, a Let r = 20 - 19.79. Let n = -0.51 + r. Let s = 2.7 - n. Sort s, -0.4, -1/7 in increasing order. -0.4, -1/7, s Let u(w) = -w3 + 4w*2 + 8w + 3. Let p be u(6). Let t be 18/21p/(-6). Sort -5, -6, t in descending order. t, -5, -6 Let b be (-7)/(61152/(-4168)) + (-4)/(-14). Let z = b - 1/78. Sort 0.5, 5/2, z, 2/5 in increasing order. 2/5, 0.5, z, 5/2 Suppose -6m + 1 = 31. Put -21, 2, m in decreasing order. 2, m, -21 Let x = -998 - -998.09. Put 2/15, -2/11, x in ascending order. -2/11, x, 2/15 Let m = -136 + 141. Sort -2, 0, m in ascending order. -2, 0, m Let w = 11 - -11. Let f be (-16)/(-6) + w/66. Suppose -x + 2 = -3. Put x, -5, f in ascending order. -5, f, x Let f(h) = -h*3 - 5h*2 - 2h + 9. Let d be f(-3). Sort -2, d, -2/13, 1/9 in descending order. 1/9, -2/13, -2, d Let s = -6.15 - -6. Let l = 0.713 - 0.813. Sort l, s, -1 in decreasing order. l, s, -1 Let c(p) = -13p - 303. Let b be c(-23). Put -14, -3, b in increasing order. -14, b, -3 Let y = -0.3 - -0.3. Let i = -0.6 + -99.4. Let r = 99.5 + i. Put y, 2, r in increasing order. r, y, 2 Suppose 2 = -3a + 5, u + 2 = 5a. Suppose 3n + g - 16 = 3g, 5g = -2n - 2. Sort -11, u, n in increasing order. -11, u, n Suppose -j - 13 = 3n, -4j - 19 - 1 = 4n. Let i be (-4 - 1 - j)/1. Suppose 2a - 5u + 30 = 0, 3u - 25 = 3a + 2. Sort i, a, 1 in decreasing order. 1, i, a Let n = -2 + -2. Let b = 0.67 + -0.57. Put b, -3, 4, n in decreasing order. 4, b, -3, n Let i(v) = v + 8. Let s = -22 - -18. Let c be i(s). Put -6, c, -2 in decreasing order. c, -2, -6 Let t = -267 - -267. Sort 20, 1, t in decreasing order. 20, 1, t Let z = 24.1 - 25.1. Put 40, -0.5, z in decreasing order. 40, -0.5, z Let z = 90 - 901/10. Sort -0.4, z, -5, -7/3 in descending order. z, -0.4, -7/3, -5 Let a = -3759 + 3759.2. Let o = -3 - -1. Put o, -3, 4/3, a in decreasing order. 4/3, a, o, -3 Let v be (-69)/6-12. Let f = v + -25. Sort f, 1/7, -4 in descending order. 1/7, f, -4 Let f = 4 - 3. Let o = -4208 + 4212. Sort f, 2/7, o in decreasing order. o, f, 2/7 Let l be 0 + 5 + (	{ "pile_set_name": "DM Mathematics" }
of sequence qjw when three letters picked without replacement from wqwjdwdwdjq. 8/495 Two letters picked without replacement from {h: 1, t: 1, f: 2, w: 1}. Give prob of sequence tf. 1/10 Calculate prob of sequence uu when two letters picked without replacement from {u: 2, w: 1, d: 2, m: 1, t: 1}. 1/21 Four letters picked without replacement from {o: 3, r: 5, a: 2, c: 2, s: 1, l: 6}. Give prob of sequence coca. 1/7752 What is prob of sequence hhh when three letters picked without replacement from {h: 7, b: 2}? 5/12 Three letters picked without replacement from yyybybyyyyy. Give prob of sequence byb. 1/55 What is prob of sequence jdjd when four letters picked without replacement from jjddjjjjjjjjjdjjjddj? 35/969 What is prob of sequence ci when two letters picked without replacement from {c: 5, i: 1, k: 7}? 5/156 Calculate prob of sequence eenn when four letters picked without replacement from {n: 8, e: 5}. 28/429 Two letters picked without replacement from {s: 15, h: 4}. What is prob of sequence hh? 2/57 What is prob of sequence htk when three letters picked without replacement from uuthskth? 1/84 Calculate prob of sequence jj when two letters picked without replacement from {i: 1, j: 3, v: 3}. 1/7 What is prob of sequence gg when two letters picked without replacement from {g: 7, l: 4}? 21/55 Two letters picked without replacement from lwllww. What is prob of sequence ll? 1/5 Four letters picked without replacement from csdis. Give prob of sequence siii. 0 Four letters picked without replacement from {b: 1, s: 2, p: 1, a: 4, o: 5, q: 2}. What is prob of sequence oaqs? 2/819 What is prob of sequence vv when two letters picked without replacement from {v: 6}? 1 What is prob of sequence gg when two letters picked without replacement from {y: 2, g: 6, q: 1, n: 2}? 3/11 Calculate prob of sequence ryg when three letters picked without replacement from {y: 1, g: 3, t: 1, r: 4, v: 1, k: 2}. 1/110 Two letters picked without replacement from dzdzuzmdudddmnzd. Give prob of sequence uz. 1/30 Three letters picked without replacement from {p: 7, e: 5, d: 3, w: 1}. Give prob of sequence dpp. 3/80 Two letters picked without replacement from {c: 9, l: 3}. What is prob of sequence cc? 6/11 What is prob of sequence jx when two letters picked without replacement from {j: 11, x: 2}? 11/78 Calculate prob of sequence omm when three letters picked without replacement from maccataoatatamoaaca. 2/2907 Three letters picked without replacement from mqymwmuuuwu. What is prob of sequence ymw? 1/165 What is prob of sequence knn when three letters picked without replacement from nlurklkn? 1/84 Calculate prob of sequence pd when two letters picked without replacement from {d: 4, r: 1, z: 7, w: 6, p: 2}. 2/95 Calculate prob of sequence op when two letters picked without replacement from {u: 9, p: 1, o: 1}. 1/110 Three letters picked without replacement from {b: 2, j: 4, p: 2, c: 2, t: 2}. Give prob of sequence jbp. 2/165 Calculate prob of sequence ene when three letters picked without replacement from {n: 7, e: 4}. 14/165 Three letters picked without replacement from {t: 5, f: 3, h: 2}. What is prob of sequence tff? 1/24 Calculate prob of sequence kk when two letters picked without replacement from kssysksk. 3/28 Calculate prob of sequence na when two letters picked without replacement from {q: 1, n: 2, a: 2, w: 2, c: 1}. 1/14 What is prob of sequence tm when two letters picked without replacement from ttttmm? 4/15 Two letters picked without replacement from qoqqoqqqqoqqqqoqqq. What is prob of sequence oq? 28/153 Calculate prob of sequence kc when two letters picked without replacement from {c: 4, j: 1, m: 6, e: 1, k: 3, u: 5}. 3/95 What is prob of sequence hyjj when four letters picked without replacement from johjyyyyjjjjj? 7/715 Calculate prob of sequence tz when two letters picked without replacement from {z: 2, t: 2, j: 1, y: 1}. 2/15 Four letters picked without replacement from zzzznzzznzzzzzznzn. What is prob of sequence zznz? 91/765 Two letters picked without replacement from gvugugvuvuuhu. Give prob of sequence gg. 1/26 What is prob of sequence yfz when three letters picked without replacement from mfnyyyzy? 1/84 Four letters picked without replacement from rwlmlrlwsw. What is prob of sequence lswl? 1/280 Four letters picked without replacement from {s: 3, x: 5, t: 2}. Give prob of sequence sstt. 1/420 Two letters picked without replacement from {k: 11, n: 1}. What is prob of sequence nk? 1/12 Three letters picked without replacement from {q: 2, p: 1, l: 2, f: 1, c: 1, e: 1}. Give prob of sequence cqq. 1/168 Calculate prob of sequence ebx when three letters picked without replacement from {b: 1, e: 1, n: 1, x: 2, p: 4, v: 3}. 1/660 Four letters picked without replacement from veeeeeveeeleeeeve. What is prob of sequence leve? 39/4760 Calculate prob of sequence msyz when four letters picked without replacement from {m: 2, s: 1, z: 1, y: 1}. 1/60 Three letters picked without replacement from {x: 1, s: 2}. What is prob of sequence sxs? 1/3 Calculate prob of sequence nn when two letters picked without replacement from {n: 8, b: 2}. 28/45 Two letters picked without replacement from jnjononjongon. What is prob of sequence on? 5/39 Four letters picked without replacement from rrdrrrdddrdr. Give prob of sequence ddrd. 7/198 Three letters picked without replacement from bwsxyuu. Give prob of sequence yxb. 1/210 Two letters picked without replacement from jmvvppvjcppm. What is prob of sequence pj? 2/33 Three letters picked without replacement from ciinnofonccj. What is prob of sequence foj? 1/660 What is prob of sequence nnqq when four letters picked without replacement from {q: 6, n: 6}? 5/66 Four letters picked without replacement from {w: 2, i: 2, m: 2, x: 2}. What is prob of sequence xwmw? 1/210 Two letters picked without replacement from {e: 2, d: 4, k: 2, m: 2, l: 1, n: 3}. Give prob of sequence dm. 4/91 Three letters picked without replacement from bbbbbbbbbtbbbbbbbttb. Give prob of sequence btt. 17/1140 Two letters picked without replacement from amammkmk. Give prob of sequence ak. 1/14 What is prob of sequence iffo when four letters picked without replacement from ioofffiooioofff? 3/182 Two letters picked without replacement from ordrcccdo. Give prob of sequence od. 1/18 Two letters picked without replacement from {d: 3, g: 2, l: 10}. What is prob of sequence gg? 1/105 Two letters picked without replacement from {o: 5, n: 9}. What is prob of sequence nn? 36/91 What is prob of sequence ccc when three letters picked without replacement from mmcmmcmccc? 1/12 Four letters picked without replacement from {e: 1, b: 8, x: 5, w: 5, n: 1}. Give prob of sequence ewww. 1/1938 Four letters picked without replacement from kkkkkkzzkzkkkk. Give prob of sequence kkzz. 5/182 Calculate prob of sequence nh when two letters picked without replacement from nghnngg. 1/14 What is prob of sequence ggmm when four letters picked without replacement from mmgbgbgg? 1/70 Four letters picked without replacement from looqoqojqqjnqpnnjlqj. Give prob of sequence npqo. 1/1615 What is prob of sequence fpn when three letters picked without replacement from {n: 4, f: 3, e: 1, p: 2}? 1/30 Two letters picked without replacement from {r: 1, l: 6, f: 11}. What is prob of sequence rl? 1/51 Calculate prob of sequence ld when two letters picked without replacement from {i: 2, d: 2, l: 2}. 2/15 What is prob of sequence cc when two letters picked without replacement from cccccccchcccccccccc? 17/19 What is prob of sequence hn when two letters picked without replacement from {n: 6, q: 3, h: 2, u: 1}? 1/11 Two letters picked without replacement from {q: 2, a: 2}. Give prob of sequence aa. 1/6 What is prob of sequence pphp when four letters picked without replacement from {h: 1, p: 12}? 1/13 Four letters picked without replacement from looavzzxxazxxlxzz. Give prob of sequence vzoz. 1/1428 Four letters picked without replacement from {z: 1, t: 1, x: 1, o: 1, j: 2, p: 2}. Give prob of sequence pjtz. 1/420 What is prob of sequence nu when two letters picked without replacement from {n: 2, b: 1, q: 1, u: 1}? 1/10 Three letters picked without replacement from {y: 1, h: 2, n: 2, v: 1}. Give prob of sequence nhv. 1/30 T	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.