Split (3)

train · 63.5k rows

text stringlengths 518 8.19k	meta dict
ing order. -210, -0.5, 2.9, 5 Put 3, 1, 15, -4 in decreasing order. 15, 3, 1, -4 Sort -2, 141, 4/9, -0.08, -8 in ascending order. -8, -2, -0.08, 4/9, 141 Put 910, 90, -3, -1 in ascending order. -3, -1, 90, 910 Sort -3, -32, -5, 0.022, -2 in decreasing order. 0.022, -2, -3, -5, -32 Put 1/5, -1/2, -173.2, -2, 32, 5 in increasing order. -173.2, -2, -1/2, 1/5, 5, 32 Put -5232.3, -0.5, -3, 2 in decreasing order. 2, -0.5, -3, -5232.3 Put 2/2943, 0.0379, 1/5 in ascending order. 2/2943, 0.0379, 1/5 Sort -2, 7, 5, 100. -2, 5, 7, 100 Put -0.83, 7, -1, 19, 8 in descending order. 19, 8, 7, -0.83, -1 Put -8, 48, 369, -2/7 in descending order. 369, 48, -2/7, -8 Sort -1/2, 716.8, 3/2 in decreasing order. 716.8, 3/2, -1/2 Put -3, -14, -709, -4 in ascending order. -709, -14, -4, -3 Sort 2, -47468, 1, -8, 3 in increasing order. -47468, -8, 1, 2, 3 Put 4, -347, -1/13 in decreasing order. 4, -1/13, -347 Sort 0, -5, -4, 6939 in increasing order. -5, -4, 0, 6939 Sort -0.2524, -1, -2/11, -0.23 in ascending order. -1, -0.2524, -0.23, -2/11 Sort 37, -1, 5, 15, 4, 13 in descending order. 37, 15, 13, 5, 4, -1 Sort 185, 2/17, 36 in decreasing order. 185, 36, 2/17 Sort -5, 0.1, 1.903, 5 in descending order. 5, 1.903, 0.1, -5 Sort -1/5, 232, 59. -1/5, 59, 232 Put 1/4, -8, 0.1, 0, -1, 39 in increasing order. -8, -1, 0, 0.1, 1/4, 39 Sort -4, 0, -2, -251, 4 in descending order. 4, 0, -2, -4, -251 Sort -15, -22, 0, -5, -17 in increasing order. -22, -17, -15, -5, 0 Put -18/7, 1/5, 3, -0.3, 2/11, 3/5 in decreasing order. 3, 3/5, 1/5, 2/11, -0.3, -18/7 Sort 0, -4, -2/5, -437740 in ascending order. -437740, -4, -2/5, 0 Sort 5, 36546, 1 in ascending order. 1, 5, 36546 Put 4, -215, 3, -14 in descending order. 4, 3, -14, -215 Put -3, 0, 379, 4 in decreasing order. 379, 4, 0, -3 Sort 290, -5, 2, -9, -4. -9, -5, -4, 2, 290 Put 13, 17, -3, 0 in decreasing order. 17, 13, 0, -3 Put -686, 1, -2, -5, 3, -41 in decreasing order. 3, 1, -2, -5, -41, -686 Sort -6, 34, -3, 0, 122, 4 in ascending order. -6, -3, 0, 4, 34, 122 Put 215, 1, 806 in decreasing order. 806, 215, 1 Put 2/45, 0.5, 1/3, -6, -35 in descending order. 0.5, 1/3, 2/45, -6, -35 Put 5, -1/4, -31, -8/3, 0.4 in descending order. 5, 0.4, -1/4, -8/3, -31 Sort 37, 10, -5, 4, 0. -5, 0, 4, 10, 37 Sort -1312, -2, 0.8, 4. -1312, -2, 0.8, 4 Sort 37/141, -2/11, 4/3, -0.5 in ascending order. -0.5, -2/11, 37/141, 4/3 Sort -26, -1490, 1, 3 in descending order. 3, 1, -26, -1490 Put 5, 1, -1/4, -2631.3 in ascending order. -2631.3, -1/4, 1, 5 Put 1, -461, 46, 4 in decreasing order. 46, 4, 1, -461 Sort 2, -0.1, 0, -0.119, -10 in decreasing order. 2, 0, -0.1, -0.119, -10 Sort 21, 44, -20, -0.5 in ascending order. -20, -0.5, 21, 44 Sort 4, -0.2, -1, -3, -1/9, -193 in ascending order. -193, -3, -1, -0.2, -1/9, 4 Sort -4/9, -0.0686, 2/213 in ascending order. -4/9, -0.0686, 2/213 Put -4, 5, -3, 4, -1138, -5 in increasing order. -1138, -5, -4, -3, 4, 5 Put -5, -958/9, -1, 0.4, 4 in ascending order. -958/9, -5, -1, 0.4, 4 Sort -4, -76, -3, 19, 0, 4 in increasing order. -76, -4, -3, 0, 4, 19 Put -0.5, 5/14, -129/2 in descending order. 5/14, -0.5, -129/2 Put 0.058, -0.4, 32.67 in decreasing order. 32.67, 0.058, -0.4 Put -405, 0, 43, 2 in ascending order. -405, 0, 2, 43 Sort -104, -5, -4, 0, 3. -104, -5, -4, 0, 3 Sort 5, -1/7, 0.88, -0.4, 0.2 in increasing order. -0.4, -1/7, 0.2, 0.88, 5 Sort -36, 4, -334 in decreasing order. 4, -36, -334 Put 2, 26, 7, 73 in ascending order. 2, 7, 26, 73 Sort -9, -4, 2990, -1 in increasing order. -9, -4, -1, 2990 Sort 340, 2, -4, 44, -2, -5. -5, -4, -2, 2, 44, 340 Sort 324, 5, 168 in descending order. 324, 168, 5 Sort 4, -27/10, -8. -8, -27/10, 4 Put -5, 2, 687, 6, 1 in decreasing order. 687, 6, 2, 1, -5 Sort -9, 5, -43 in increasing order. -43, -9, 5 Sort -3, 89, 72, -0.4, -1/4, -0.3 in ascending order. -3, -0.4, -0.3, -1/4, 72, 89 Put -4, 0.2, 1/7, -1/2, 1/2, -5 in ascending order. -5, -4, -1/2, 1/7, 0.2, 1/2 Put 2/3, 4, -1, 6/13, 0.6 in descending order. 4, 2/3, 0.6, 6/13, -1 Put -3, -2/7, 9, 0.4, 0.021, 2/7 in increasing order. -3, -2/7, 0.021, 2/7, 0.4, 9 Sort -4, 305, -20, -3 in decreasing order. 305, -3, -4, -20 Sort -1, 3, -4, -711, 18 in descending order. 18, 3, -1, -4, -711 Sort -4, 2, 1455, 47 in descending order. 1455, 47, 2, -4 Sort 1, -2/7, -4, -48, 2/35, -1 in ascending order. -48, -4, -1, -2/7, 2/35, 1 Sort -0.8, 0.1, -2/11, 10 in descending order. 10, 0.1, -2/11, -0.8 Sort 8, -1.4, 2, 1/6, -8. -8, -1.4, 1/6, 2, 8 Sort -5, -40, 2, 113 in decreasing order. 113, 2, -5, -40 Sort -0.1, 13, 0, -4, 23 in decreasing order. 23, 13, 0, -0.1, -4 Sort 1, -5, 39, 3, -10. -10, -5, 1, 3, 39 Sort 157, -2, 8, 7, -3, -5 in increasing order. -5, -3, -2, 7, 8, 157 Put 1, 0.07, -20, 292 in increasing order. -20, 0.07, 1, 292 Sort 121, 1, -3, 0 in descending order. 121, 1, 0, -3 Sort -8, -36, -6, 2 in ascending order. -36, -8, -6, 2 Put -36, -3, 0, -6, -5 in descending order. 0, -3, -5, -6, -36 Sort 0, 5, 4, 745, 147 in increasing order. 0, 4, 5, 147, 745 Put 72, 11, 5, -4, 10, 2 in descending order. 72, 11, 10, 5, 2, -4 Put 4, -6, -2, -4, 1360 in decreasing order. 1360, 4, -2, -4, -6 Sort 104, 426, 1/4 in increasing order. 1/4, 104, 426 Put -13, 7565, 0 in ascending order. -13, 0, 7565 Put 2, -411, -9 in decreasing order. 2, -9, -411 Put 3, -8, -146 in descending order. 3, -8, -146 Put 2013, 29, 0.5, -0.3 in ascending order. -0.3, 0.5, 29, 2013 Put -4, 133447, 2/7 in decreasing order. 133447, 2/7, -4 Sort -1/3, 56, 3.5, 1, -2/9 in descending order. 56, 3.5, 1, -2/9, -1/3 Sort 113, 115, 15, 2 in decreasing order. 115, 113, 15, 2 Sort 122/77, 3, 0.3, 4, 2 in increasing order. 0.3, 122/77, 2, 3, 4 Put -3, -5/2, 1/3, 1719 in decreasing order. 1719, 1/3, -5/2, -3 Sort 3, -16668, -5 in decreasing order. 3, -5, -16668 Sort 5, -1, -430, -5, -11. -430, -11, -5, -1, 5 Put -4/3183, 5, -0.5 in increasing order. -0.5, -4/3183, 5 Sort 1, 447, 4, -2, -6 in increasing order. -6, -2, 1, 4, 447 Sort -1, 80, 386 in decreasing order. 386, 80, -1 Sort -85, -0.5, -0.1 in increasing order. -85, -0.5, -0.1 Sort -670254/17, 0, -1/6 in increasing order. -670254/17, -1/6, 0 Sort 1, 14725, 11, 5 in ascending order. 1, 5, 11, 14725 Put -6, 5, -8/11, -0.09, -4, 7 in decreasing order. 7, 5, -0.09, -8/11, -4, -6 Sort -2, -81, -20, 6. -81, -20, -2, 6 Put -95, 5, -32 in decreasing order. 5, -32, -95 Sort 1/7, 120, 2, -0.4, -0.5 in decreasing order. 120, 2, 1/7, -0.4, -0.5 Put 0.2, -0.6, -4, -1/6, -1/2, 0.4 in increasing order. -4, -0.6, -1/2, -1/6, 0.2, 0.4 Put 507, 1, -10, 5 in increasing order. -10, 1, 5, 507 Sort 2, 9, 5, 91, 4 in descending order. 91, 9, 5, 4, 2 Sort 5/4, 1.4, 72.63, -3 in decreasing order. 72.63, 1.4, 5/4, -3 Put 18927, 2, 1, -1 in descending order. 18927, 2, 1, -1 Put -3, -4, -1464, 3 in descending order. 3, -3, -4, -1464 Sort 3, -3, 0, -14, -1062. -1062, -14, -3, 0, 3 Sort 0.1, -1.9, -1, -6, 66/5, 2. -6, -1.9, -1, 0.1, 2, 66/5 Sort 5, 8251, 0 in descending order. 8251, 5, 0 Sort 15/11, 2/7, 84.5, 0, 1/6 in descending order. 84.5, 15/11, 2/7, 1/6, 0 Sort -10, 11, 1, 23, 4 in descending order. 23, 11, 4, 1, -10 Sort 0.2, 0, -2, -34, 22/9, 3/11 in increasing order. -34, -2, 0, 0.2, 3/11, 22/9 Sort -357, 5, 13, -4 in ascending order. -357, -4, 5, 13 Sort 2, -0.09, 5, 0.5, 1, 4/87 in descending order. 5, 2, 1, 0.5, 4/87, -0.09 Put 50, 77, -47 in ascending order. -47, 50, 77 Put 12, 108, 81, -2 in ascending order. -2, 12, 81, 108 Sort 5402/11, 4, -2/5, 6/11. -2/5, 6/11, 4, 5402/11 Put -0.5, -4/13, 0.4, -0.4, -461 in ascending order. -461, -0.5, -0.4, -4/13, 0.4 Put 4, -1965, -4, 5 in decreasing order. 5, 4, -4, -1965 Sort 3386, -247, -2 in descending order. 3386, -2, -247 Put -3, 1/3, 1/6, -4, -11/37 in descending order. 1/3, 1/6, -11/37, -3, -4 Sort 6, -115, 4, -1, 61. -115, -1, 4, 6, 61 Sort -112, 2, -4, -2, 1 in decreasing order. 2, 1, -2, -4, -112 Sort 0.036, 2/19, 12 in decreasing order. 12, 2/19, 0.036 Put 5, -26, -1.4, -3 in ascending order. -26, -3, -1.4, 5 Sort -5, 3741, 2, -3 in decreasing order. 3741, 2, -3, -5 Put -6, -3, -77149 in descending order. -3, -6, -77149 Put -1, -4, -3195 in decreasing order. -1, -4, -3195 Put -4, -137, -48, 2, -3 in increasing order. -137, -48, -4, -3, 2 Put -896.3, -2.4, -2/11 in decreasing order. -	{ "pile_set_name": "DM Mathematics" }
Let l(k) = k*3 - 2k + 66. Let z be l(y). What is the highest common divisor of 22 and z? 22 Suppose 15y - 117 = 48. Calculate the greatest common divisor of 352 and y. 11 Let q(o) = o2 - 4o - 2. Let x be q(5). Let v(y) = 68 - 5y + xy - 65 - 15y. Let w be v(-3). Calculate the highest common factor of w and 18. 18 Let l(k) = 5k - 4. Let s be l(5). Let u = -22557 - -22809. What is the greatest common divisor of u and s? 21 Suppose 14s - 175 = -49. Calculate the greatest common factor of 21 and s. 3 Let i = 118 - 114. Suppose 4k - 4s = -2s + 22, ik + 4s = 28. What is the highest common factor of k and 42? 6 Let j = -4 + 16. Suppose -3t = -4t + 7. Let g(p) = p - 4. Let a be g(t). What is the highest common factor of a and j? 3 Let m be (0 - 1)(-2106 + 12 + -6). Calculate the greatest common factor of m and 100. 100 Let y(b) = -b + 3. Let a be y(4). Let u be (-18)/6 + 19 + a. Let p be 242/u - (-14)/(-105). Calculate the greatest common factor of 24 and p. 8 Let h = -203 - -385. What is the highest common divisor of h and 26? 26 Let v be -844/((-96)/(-90)). Let m be ((-10)/v9)/((-1)/(-77)). Calculate the greatest common factor of m and 88. 22 Suppose 2m - 3b - 478 = 0, 3b - 6 - 6 = 0. Calculate the highest common factor of 147 and m. 49 Let c = -903 + 988. Let u be (6/(-4))/((-1)/2). Suppose -ud + 7d = 68. Calculate the highest common factor of d and c. 17 Suppose 3w - 49 = -31. Let a be (-2 - -1)/((w + -2)/(-168)). Calculate the greatest common divisor of a and 63. 21 Let l = 1720 - 1548. Calculate the greatest common factor of l and 258. 86 Suppose 3n = -4l + 37, 27l - 28l + 3n + 28 = 0. What is the greatest common divisor of l and 1157? 13 Suppose -4q = -4m - 1392, 14q - 9q - 3m = 1740. What is the greatest common divisor of q and 12? 12 Suppose -b - 5 = -13. Let w(m) = 7m*3 + 2m*2 - 1. Let s be w(1). What is the highest common factor of b and s? 8 Suppose -d = 3d + 48. Let a be 42/(-4) - (-18)/d. Let r be (-46)/(-4) - a/(-8). Calculate the highest common divisor of r and 25. 5 Let l = 93 - 76. Calculate the highest common divisor of 833 and l. 17 Suppose 50h - 633 = 2047 - 280. Suppose -5i - 2 = -17. Calculate the greatest common divisor of h and i. 3 Let l(p) be the first derivative of -p*4/4 + 7p*3/3 + 5p*2/2 + 4p - 15. Let c be l(6). What is the highest common divisor of 10 and c? 10 Let j(p) = 5p2 + 63 - 4p*2 - 69. Let a be j(3). Let l be 2(4 - a) - -130. Calculate the greatest common factor of 12 and l. 12 Let b = 1587 - 1584. Let p = 16 - -2. Calculate the greatest common divisor of p and b. 3 Let u be 50/(-4)8/(-10). Let n = 43 + -33. What is the greatest common divisor of u and n? 10 Let s = 9 + -3. Let l = s - -6. Let c be 153/l - 6/8. Calculate the greatest common factor of 8 and c. 4 Let y be (-3)/(-9) - 2/(-3). Suppose 4h + y + 0 = -g, -4h - 16 = 0. Calculate the highest common factor of g and 165. 15 Let s = 2 + 1. Suppose j = -2y + 15, -5j - 4y = -130 + 37. What is the greatest common factor of j and s? 3 Let u = 2732 - 2438. Calculate the greatest common divisor of 9 and u. 3 Suppose 19d = 18d + 4. Suppose 10 + 22 = dv. What is the greatest common divisor of 72 and v? 8 Let u(a) = 7a + 7a - 10a + 3a2 - 3 + 4. Let q be u(-5). What is the highest common divisor of q and 8? 8 Suppose -12 = -17d + 14d. Let c be (d/3)/(6/27). Let l(o) = -17o3 + o2 + o + 1. Let f be l(-1). Calculate the highest common divisor of f and c. 6 Suppose -8c + 9c - l = 883, 5l - 5265 = -6c. Calculate the greatest common divisor of 11 and c. 11 Let z be -3 + (-4 - (-10)/4)-10. Suppose -42 = -4h - 3h. What is the greatest common factor of z and h? 6 Let h(c) = -c3 - 4c*2 - 3c - 8. Let d be h(-4). Let w be ((-2)/d)/(5/(-220)). Calculate the highest common factor of 154 and w. 22 Let s be ((-112)/70)/((-6)/105). What is the highest common divisor of 756 and s? 28 Suppose 0 = -4y - 3f - 73, 0 = -2y + 3y + f + 17. Let g = y - -37. Calculate the highest common factor of g and 135. 15 Suppose 5f - 5m - 790 = 0, -3f - 13m + 479 = -11m. Calculate the greatest common divisor of 3 and f. 3 Suppose 0 = 4o - 2o - 12. Suppose 230 = 2x + o. Calculate the greatest common factor of 14 and x. 14 Let k = 19 + -17. Suppose -2j = kj - 52. What is the greatest common factor of j and 13? 13 Let v be (8/(-2))/((-1)/20). Let m = v + 22. Let w = m - 54. What is the greatest common factor of w and 12? 12 Suppose 5d = -30d + 1855. Calculate the greatest common divisor of d and 477. 53 Let k(f) = f*2 - 2f - 5. Let l be k(4). Suppose lx = 466 - 100. Let r be (-5)/((-10)/x) - 1. Calculate the greatest common factor of 10 and r. 10 Let a(t) = 2t*3 + 31t*2 - 16t + 10. Let x be a(-16). Suppose -xn + 4n + 120 = 0. What is the highest common divisor of n and 50? 10 Suppose 4n - 4x + 8 = 0, -n - 4n - 4x + 26 = 0. Suppose 2w + 0w - 2 = 0, np - 41 = w. Let c = -19 + 26. Calculate the greatest common factor of c and p. 7 Let k(o) = 4o*2 + 28o + 20. Let z be k(-12). What is the greatest common factor of 52 and z? 52 Let a be (-186)/(-18) + (-2)/6. Suppose a = 5g - 5. What is the highest common divisor of g and 2? 1 Suppose 0 = 76a - 77a + 20. Suppose -89 - 31 = -3x. Calculate the highest common divisor of a and x. 20 Let x = -183 - -237. Calculate the greatest common divisor of 720 and x. 18 Let u(k) = -4k - 6. Let h be u(-5). Suppose 4a - a = -y + 166, a = -2y + 312. What is the greatest common factor of y and h? 14 Let h(q) = 65q*2 - 2q - 1. Let t be h(-1). Suppose -390 = -4z - 3i, -3z + i = -i - 284. Let x = z - 90. Calculate the greatest common factor of t and x. 6 Let w be 5418/27 + 2/(-3). Suppose 0 = 3c + 2x - w - 3, 2x + 199 = 3c. Suppose 6k - 445 + c = 0. Calculate the highest common factor of 9 and k. 9 Let j = -1392 + 1413. What is the highest common divisor of 3 and j? 3 Let t be (-3)/(-12) + 28/16. Let a(g) = 2g + 3g - tg - 2 - 6. Let x be a(6). What is the highest common divisor of x and 90? 10 Let x = 21 + 29. Let k be 1/(25/80). Let s be 924/98 - k/(-14). What is the highest common divisor of x and s? 10 Let p = -65 + 105. Suppose -1370 + 1190 = -3s. Calculate the highest common factor of p and s. 20 Let h = 2006 + -1170. Suppose -z = 2o - 411, 159 = 5o - 4z - h. What is the highest common divisor of o and 29? 29 Let i(b) = -9b - 2. Let h be i(1). Let y be 132/h(-4)/3. Calculate the greatest common divisor of 40 and y. 8 Let f = -31 + 35. Suppose -o + 2x - 104 = 4o, 0 = -3o + 4x - 54. Let g be (-224)/o - (-10)/(-55). What is the greatest common factor of g and f? 2 Let u(a) = -139a3 - 2a*2 + 1. Let g be u(-1). Calculate the greatest common divisor of 207 and g. 69 Suppose v = -3g + 1395, -5v - 4g - g = -6925. What is the greatest common factor of 60 and v? 60 Let u(i) be the first derivative of i3/3 + i2/2 + 74i - 4. Let d be u(0). Suppose d - 10 = 4r. Calculate the highest common divisor of 176 and r. 16 Suppose -2i - 2q = -148, 5q = 9 + 1. Suppose 27l + i = 33l. Suppose 181 + 143 = 3w. What is the greatest common factor of w and l? 12 Let z be 3586/242 - (-4)/22. Let d = -15 + z. Suppose j - 208 = 3b, 0 = 2j - dj - 3b - 428. What is the greatest common factor of j and 44? 44 Let z be (0/6)/((-4)/2). Suppose 2m + 11m - 598 = z. Calculate the greatest common divisor of 322 and m. 46 Let y be (-48)/(-9) + 34/(-36). Let z be (2/(-2)y)/(2/(-8)). What is the highest common divisor of z and 240? 20 Suppose 30 = 5h + m - 2m, 4h + m - 33 = 0. Let s = -16 - -36. Suppose -s = -4y - 3t + t, 5t + 6 = -2y. What is the greatest common divisor of h and y? 7 Suppose -5i + 5t = -31 - 19, 0 = -2i - 4t + 8. Calculate the highest common divisor of i and 1016. 8 Let m(a) = 6a - 27. Let w(c) = -2c - 22. Let y be w(-14). Let b be m(y). Calculate the greatest common factor of b and 45. 9 Let u = 589 + -557. Calculate the highest common factor of u and 2080. 32 Suppose -518 - 710 = -4s. Let d = -59 + s. Calculate the highest common divisor of d and 31. 31 Let k(w) = w. Let u(d) = 0d + 6 - 3 + 3 - d. Let f be u(5). Let r be k(f). Calculate the greatest common divisor of 1 and r. 1 Suppose -33h + 44800 = 37*h	{ "pile_set_name": "DM Mathematics" }
picked without replacement from rkbdrrrpporpd? 1/858 What is prob of sequence yqxo when four letters picked without replacement from yxqossyq? 1/420 Four letters picked without replacement from {p: 3, c: 12}. What is prob of sequence ppcp? 1/455 Calculate prob of sequence hgw when three letters picked without replacement from {g: 1, h: 3, z: 3, y: 1, w: 3}. 1/110 Two letters picked without replacement from uqxuxuwqieeqxei. Give prob of sequence uw. 1/70 Three letters picked without replacement from {a: 7, k: 1, u: 4, s: 8}. Give prob of sequence asu. 28/855 Two letters picked without replacement from ddjjddjpdpdpjpp. What is prob of sequence dp? 1/7 What is prob of sequence qqq when three letters picked without replacement from zqqqqqqqqqqqqqqqqqq? 16/19 Three letters picked without replacement from ditfidpiiudtfd. Give prob of sequence upf. 1/1092 Two letters picked without replacement from {h: 1, k: 3, w: 2, y: 1}. Give prob of sequence hy. 1/42 Calculate prob of sequence ws when two letters picked without replacement from {d: 9, s: 3, a: 3, w: 2}. 3/136 Calculate prob of sequence jssi when four letters picked without replacement from {s: 2, t: 1, i: 1, a: 1, j: 1, m: 1}. 1/420 Three letters picked without replacement from {q: 1, u: 1, y: 4, w: 3, m: 2}. Give prob of sequence wyu. 2/165 Four letters picked without replacement from mbvmbvmdkvmvmvmmvmmm. What is prob of sequence kbdb? 1/58140 Four letters picked without replacement from {c: 5}. Give prob of sequence cccc. 1 What is prob of sequence oo when two letters picked without replacement from {k: 10, o: 2}? 1/66 Four letters picked without replacement from zzddzdddzzdddzdzzz. Give prob of sequence ddzz. 6/85 What is prob of sequence qq when two letters picked without replacement from {q: 2, n: 7}? 1/36 Three letters picked without replacement from ihnnmypi. Give prob of sequence hmi. 1/168 Three letters picked without replacement from {x: 4, z: 3, g: 4}. What is prob of sequence zxg? 8/165 Calculate prob of sequence re when two letters picked without replacement from xtrenkk. 1/42 Calculate prob of sequence nnnn when four letters picked without replacement from {n: 6}. 1 What is prob of sequence ud when two letters picked without replacement from adouucdduddddddquu? 5/34 What is prob of sequence ippp when four letters picked without replacement from ppppppppppppppippppp? 1/20 Two letters picked without replacement from {e: 4, h: 3}. What is prob of sequence ee? 2/7 Two letters picked without replacement from {n: 1, s: 4, v: 2, y: 2}. What is prob of sequence vy? 1/18 What is prob of sequence lvv when three letters picked without replacement from {l: 11, v: 2}? 1/78 Two letters picked without replacement from tsxbbtbbsbstl. Give prob of sequence lx. 1/156 Calculate prob of sequence ff when two letters picked without replacement from {f: 5, g: 13}. 10/153 Three letters picked without replacement from {n: 3, i: 1, x: 2, t: 6, v: 4}. Give prob of sequence nvx. 1/140 Four letters picked without replacement from {z: 1, a: 1, l: 7, b: 4, m: 3}. What is prob of sequence zlll? 1/208 Four letters picked without replacement from fqvkfqfqwvkqvvqqf. What is prob of sequence qfwf? 3/2380 Calculate prob of sequence pp when two letters picked without replacement from uzzlzupzpup. 3/55 Four letters picked without replacement from eaaeaeeeeeeaa. Give prob of sequence aeea. 28/429 Two letters picked without replacement from {x: 1, n: 4, y: 1, v: 2}. What is prob of sequence nv? 1/7 Four letters picked without replacement from {u: 14, y: 5}. What is prob of sequence yuyu? 455/11628 Three letters picked without replacement from hhthhhethhtewhw. Give prob of sequence twe. 2/455 Calculate prob of sequence arar when four letters picked without replacement from araraaaaaaaaa. 1/78 What is prob of sequence mgh when three letters picked without replacement from {m: 2, i: 1, g: 2, h: 4, p: 1}? 1/45 Three letters picked without replacement from {q: 2, i: 1}. What is prob of sequence qqi? 1/3 Four letters picked without replacement from {v: 4, f: 7, h: 2}. Give prob of sequence fvff. 7/143 Three letters picked without replacement from tmbbhsntnhmbttmbtth. Give prob of sequence mts. 1/323 Calculate prob of sequence bb when two letters picked without replacement from {v: 7, b: 2, q: 3}. 1/66 Two letters picked without replacement from ynkvd. What is prob of sequence vn? 1/20 What is prob of sequence mh when two letters picked without replacement from mmhmmhmmmmh? 12/55 Four letters picked without replacement from wwywyyynwwywnyywnwyn. What is prob of sequence ywyn? 224/14535 Three letters picked without replacement from {i: 3, w: 1, f: 1, p: 7, u: 2}. Give prob of sequence pui. 1/52 What is prob of sequence iiyi when four letters picked without replacement from iyyyiyyi? 1/56 Calculate prob of sequence jij when three letters picked without replacement from {v: 3, j: 10, z: 2, s: 3, i: 1}. 5/323 Three letters picked without replacement from {j: 2, t: 1, h: 2, w: 1, q: 1, g: 2}. What is prob of sequence gjt? 1/126 Calculate prob of sequence kh when two letters picked without replacement from xqhxk. 1/20 Three letters picked without replacement from {k: 1, s: 1, u: 3, p: 1, f: 5}. What is prob of sequence sss? 0 Two letters picked without replacement from {l: 15, y: 3}. What is prob of sequence ll? 35/51 What is prob of sequence lz when two letters picked without replacement from {l: 1, z: 2, n: 1}? 1/6 Calculate prob of sequence fq when two letters picked without replacement from {q: 10, f: 2}. 5/33 Calculate prob of sequence nnf when three letters picked without replacement from fnnfpnf. 3/35 What is prob of sequence vkqf when four letters picked without replacement from {v: 2, q: 1, k: 4, j: 4, f: 3}? 1/1001 Two letters picked without replacement from nnnynnlonnlolnnnnol. Give prob of sequence ln. 22/171 Three letters picked without replacement from {e: 1, o: 1, v: 2, g: 6, l: 3}. Give prob of sequence gvg. 5/143 Four letters picked without replacement from nmvno. What is prob of sequence mnon? 1/60 Four letters picked without replacement from {j: 11, g: 5}. What is prob of sequence jggg? 11/728 What is prob of sequence dxo when three letters picked without replacement from {o: 3, w: 1, d: 3, t: 10, x: 2}? 1/323 Three letters picked without replacement from {o: 1, j: 1, t: 1, v: 3, u: 4, n: 5}. Give prob of sequence nun. 8/273 Three letters picked without replacement from zpzzzzzzzzpz. What is prob of sequence zzp? 3/22 Calculate prob of sequence dd when two letters picked without replacement from {d: 2, r: 2}. 1/6 Two letters picked without replacement from aayeaabbar. Give prob of sequence ay. 1/18 Calculate prob of sequence bbb when three letters picked without replacement from bbb. 1 Two letters picked without replacement from {h: 1, z: 2, b: 1, k: 4}. Give prob of sequence kb. 1/14 Two letters picked without replacement from xsdsdzolzdszddo. What is prob of sequence so? 1/35 Calculate prob of sequence ay when two letters picked without replacement from vysyashssahvfa. 3/91 Calculate prob of sequence kbb when three letters picked without replacement from {b: 4, k: 5, p: 3}. 1/22 Calculate prob of sequence bl when two letters picked without replacement from ggbgbbbbbfflgfg. 1/35 What is prob of sequence yhd when three letters picked without replacement from {l: 1, h: 2, d: 2, y: 1, s: 6}? 1/330 Four letters picked without replacement from whwwwlhlzwwhwl. Give prob of sequence lzwh. 3/1144 Calculate prob of sequence nnsn when four letters picked without replacement from {s: 2, r: 4, n: 7, a: 1, p: 4}. 7/1224 What is prob of sequence ad when two letters picked without replacement from fraaffadrraadafai? 7/136 Calculate prob of sequence gg when two letters picked without replacement from hghgghgggg. 7/15 Three letters picked without replacement from ooyyo. What is prob of sequence ooo? 1/10 Calculate prob of sequence uy when two letters picked without replacement from {u: 8, w: 5, r: 1, y: 4}. 16/153 What is prob of sequence nmma when four letters picked without replacement from zmmnazaannna? 4/1485 Four letters picked without replacement from aeeleae. Give prob of sequence alea. 1/105 Three letters picked witho	{ "pile_set_name": "DM Mathematics" }
3 What is the nearest to 23 in -0.2, -0.02, -110.72? -0.02 Which is the closest to -2? (a) -0.16 (b) 2/15 (c) -284 a Which is the closest to 0? (a) -19.9 (b) 2 (c) 4 (d) -3 (e) -0.11692 (f) 2/17 e Which is the closest to 10404? (a) 4/33 (b) -3 (c) 4 c Which is the nearest to -0.019? (a) 1 (b) -66.096 (c) 5 a Which is the nearest to -1? (a) 202/9 (b) -0.5 (c) -9 (d) -0.2 (e) -11/5 b Which is the nearest to 1/9? (a) 42 (b) -2 (c) 2/17 (d) -5 (e) 4 (f) -0.3 c What is the closest to 47552 in -2/9, -1/17, 0.06, 0.04? 0.06 What is the nearest to 2/5 in -14178, 2, 1, 4? 1 What is the closest to -1 in -2/8254913, 0.5, -4, 2/5? -2/8254913 What is the closest to -589 in 3/2, 0, 1, -2, 5? -2 What is the nearest to -1 in 0.2, 1, 5/6, 10, 24/5? 0.2 Which is the closest to 1/4? (a) -4/5 (b) -0.04 (c) -2/2011 c Which is the closest to -8? (a) 1 (b) -0.2 (c) -2/11 (d) -5378 b Which is the nearest to 37.3? (a) 7 (b) 5 (c) -1 (d) 18 d What is the nearest to -6/719 in -0.1, 4/3, -131/2? -0.1 Which is the nearest to -11630.31? (a) 4/21 (b) -0.4 (c) 0.5 b Which is the closest to 655? (a) -8 (b) -11/3 (c) -0.4 c What is the closest to 0.1 in 2, -4/25, 18, 21/467? 21/467 What is the nearest to -1/7 in -0.167, -39, -5, -15, -4? -0.167 Which is the nearest to 3? (a) 119 (b) 1/28 (c) 1/3 (d) 118/7 c Which is the nearest to -18604? (a) -5 (b) 0.6 (c) -0.1 (d) 12 a Which is the closest to -1? (a) 14/5 (b) -0.2 (c) 36313 (d) 4/5 (e) -0.1 b What is the nearest to -3/95 in 2/3, 0.2, -39, 0.1, 0.7? 0.1 Which is the closest to 56/9? (a) -0.1 (b) -0.04 (c) 0.1 (d) -3 (e) 1092/31 (f) -0.2 c Which is the closest to 3? (a) 6 (b) 1 (c) 4/5 (d) 11434 (e) -1/6 (f) -5 b What is the closest to -11 in 0.2, 96, 2/5, -3, 1.21? -3 What is the closest to -0.1 in -2, 96710, 1? 1 Which is the nearest to -1/2? (a) 0.4 (b) -0.16 (c) 2/15 (d) 14 (e) -2 (f) 0.5 b Which is the nearest to -41? (a) -3 (b) 2/7 (c) 0.1 (d) -48 (e) 4 d What is the nearest to -1 in 3, -2/17, -4, 2.6017? -2/17 What is the nearest to 1 in 0, -98, 1607/3, 1, -3/8? 1 What is the nearest to 0 in -232/41, 480, -5? -5 What is the closest to 0.0077 in 3, 11.35, -3? 3 Which is the closest to -0.1? (a) 0.2 (b) -1 (c) -3/8 (d) -3 (e) -4078821 c Which is the nearest to -3.27? (a) -0.3 (b) -97 (c) 0.4 a What is the closest to 1057 in 4.9, -1/3, -2/3, -4/3, -3? 4.9 Which is the closest to 0.14? (a) 23 (b) 3/98623 (c) -1/4 b What is the nearest to 0 in 2/19, -1, -139, 2, -0.2? 2/19 What is the closest to -0.03 in 52702, -35, -5, 0.5? 0.5 Which is the nearest to -0.066? (a) 3/8 (b) -22 (c) 46 (d) 1/3 d Which is the closest to -7? (a) 0.3 (b) -4163 (c) 5 (d) -9 d What is the closest to -2 in -42, 0, 4, -0.26? -0.26 What is the closest to -228 in 1/10, -4/9, -0.0152, 1/3? -4/9 What is the nearest to -3 in 2/13, 5, -2406980, 3, -4, -1? -4 What is the nearest to -2 in 5619, -4.4, -2, -2/5? -2 What is the nearest to 1.6 in 142, 1, -18.8? 1 Which is the nearest to 160? (a) 46 (b) 4 (c) -13 a What is the nearest to -64 in -0.1, -1, -524, 50, 0.1? -1 What is the closest to 2.0851 in 6, 0.2, -1, 0, 0.5? 0.5 Which is the closest to 0.05? (a) -4 (b) 5.33 (c) 11 (d) -0.5 (e) 4 d What is the closest to -2/7 in 0.0591487, 0.5, -0.27? -0.27 What is the nearest to -44 in 97, -0.1, -6, 0, -2? -6 What is the nearest to -2/9 in 3, -2/5, -54, -2.7937? -2/5 What is the closest to 7/3 in 3, -53237, 1/9? 3 Which is the nearest to 0? (a) -7 (b) 0.66 (c) -26 (d) -3/23 (e) -18/7 d What is the nearest to -9/8 in 72, -6/11, -2/5, 2, -3? -6/11 Which is the nearest to 0.49? (a) -314 (b) -3/13 (c) -0.05 c What is the nearest to -1/2 in -1/2, 1, 2/21, 2/35, 2038? -1/2 What is the nearest to -2/9 in 0.5, -60, -7, 1/1503? 1/1503 What is the closest to 2 in -4/5, 2, -32981.4? 2 What is the nearest to 10 in -1/4, 1/5, -0.2, -0.5, -93/4? 1/5 What is the nearest to 1 in 2.4, 1, -29/6, -16? 1 What is the nearest to -15/142 in 0.2, -0.4, -1/4, 0.5, -1.457? -1/4 What is the closest to -8106 in 1.18, 3, -2/5? -2/5 What is the nearest to -0.07 in 4, -2/7, 1/49, -0.4548? 1/49 What is the nearest to 173 in 5, 296.341, -4? 296.341 Which is the nearest to -4? (a) 9 (b) 363 (c) 70 a Which is the nearest to -94? (a) 0.53 (b) 246 (c) 5 (d) 0 d Which is the nearest to 0? (a) 0.09 (b) -1 (c) 17 (d) 115 (e) 22 a What is the closest to 57662 in -1/3, 6, 3? 6 Which is the nearest to -14? (a) 2 (b) -0.4 (c) -795.8 (d) -33 b Which is the closest to -1? (a) -399 (b) 5 (c) -0.1 (d) 11/48 c What is the nearest to 0.069 in -0.086, -2/11, 3/4, -2, -4? -0.086 Which is the nearest to 1/7? (a) -74/5 (b) 0.2 (c) 3/49 (d) -2/15 b What is the nearest to -0.01 in 2949, 4/7, -2/21, -4/3, -3/8? -2/21 Which is the closest to -5.9? (a) -5 (b) 4 (c) 5/209 (d) -2 (e) -0.044 (f) -0.2 a What is the nearest to 7979 in -4/3, -2, -6/11? -6/11 Which is the closest to -0.1? (a) 0.38 (b) 1/8 (c) 3383 b Which is the nearest to 3? (a) -2.2 (b) 37 (c) -3/5 (d) -0.4 (e) 0.4 e Which is the nearest to -7/393? (a) 6 (b) 0.2 (c) 33 b Which is the closest to 0.048? (a) 0.3 (b) 1/4 (c) 0.4 (d) 39 (e) -3/7 b What is the closest to 64 in 78/5, -3/143, 1, 11, 2? 78/5 Which is the closest to -1/4? (a) -138 (b) -0.5 (c) 5 (d) 219 (e) 4 b Which is the closest to 1? (a) 0.08 (b) -0.04 (c) -18.9 (d) -8 (e) -1/4 a What is the nearest to 6 in -1/3, 34/3, 2/5, -80? 34/3 What is the closest to -0.1 in 0.4, 0.23, -39/16? 0.23 Which is the closest to 0.0697? (a) 4/315 (b) -2/7 (c) -2/5 (d) -5 a What is the nearest to 0.1 in 43, -19095, -5? -5 What is the closest to -10229 in 3, -24, -10/3? -24 What is the closest to -4/61 in -1/5, -8/3, -0.4, 2.9, -42? -1/5 What is the nearest to -0.1 in -121, 9, -0.6, 26/7? -0.6 Which is the nearest to -16/15? (a) 6 (b) 3/4 (c) -79 (d) -0.1 (e) -0.5 (f) 0.5 e What is the closest to -2 in -0.34, 0.3, 1/4, 1729.7, -0.3? -0.34 Which is the nearest to -1/18? (a) -1/2 (b) -3/7450 (c) 36 b What is the closest to -11/5 in -4.423, 0, -10/137? -10/137 What is the closest to -1/10 in -3/14, 2/19, 0.14, 0.456? -3/14 Which is the nearest to -0.3? (a) -20594 (b) -1 (c) 14 (d) -0.5 d What is the closest to 6 in 2/7, -61, -1/8, -0.4, 281? 2/7 What is the nearest to 6 in -4, -49, -2103? -4 What is the closest to 2/3 in 5030, -8/11, -3? -8/11 What is the closest to -10748 in 0.1, -3/8, 2/9, -5, -0.03? -5 What is the closest to -1/4 in -0.5, 117, -15, 2, -4/5, 0.2? -0.5 Which is the nearest to 0.1? (a) 11768 (b) 0.09 (c) -2 (d) -3/8 b What is the closest to 11/18 in 4/7, -17, -0.049? 4/7 Which is the nearest to 5/4? (a) 0 (b) -27730 (c) -0.1 (d) 1/3 d Which is the nearest to -0.1? (a) -0.51 (b) -200821 (c) 2 a What is the closest to -13 in 0.8, 0.3, 14420, -1, 5? -1 Which is the closest to 9? (a) -2/7 (b) -11 (c) -21 (d) -5/2 (e) 14 (f) 0 e What is the closest to 2487 in 0, 0.3, -0.2, 3/8, 4? 4 Which is the nearest to 2? (a) 3 (b) -24 (c) -2 (d) 33 (e) -2/19 a Which is the nearest to -1.5? (a) -2/9 (b) -0.1 (c) -11804 a What is the closest to -0.2 in 0.1, 3, 152, 44, -93? 0.1 Which is the nearest to 0? (a) 2/3 (b) -10 (c) 2/17 (d) 374 (e) -363 (f) 0.2 c What is the nearest to 6/7 in -86, -4, -2, 0.5, 21, 4? 0.5 Which is the nearest to -721? (a) 0.08 (b) 5 (c) -1197 (d) -1 c Which is the nearest to 22? (a) -1 (b) 2/15 (c) -2/5 (d) -22 (e) -8 b Which is the closest to 13? (a) 10627 (b) -3/4 (c) 2/9 (d) -3 (e) -2/7 (f) -0.4 c What is the nearest to 2/9 in -0.5, -17, 487, 28? -0.5 What is the closest to 1 in -12, 34, 0.4, -1.2? 0.4 Which is the closest to 1/101? (a) 122 (b) -1/2 (c) 1.1 (d) 2 (e) 4 b Which is the nearest to -1.2? (a) -9 (b) -65 (c) 5/2 (d) 17 (e) 0.3 e What is the nearest to 4900 in -2/7, -2/3, 7, -0.4, 2/5? 7 Which is the closest to -40? (a) -3/7 (b) -0.1 (c) -134 (d) -3/4 d What is the closest to -0.7 in 1056, 2, 3/7, 26/5? 3/7 Which is the nearest to 3? (a) -3/5 (b) -11/7 (c) 4/5 (d) -0.33 (e) -2 c What is the closest to 0.2 in 1/5, 7/13233, 2, 46, 4? 1/5 Which is the nearest to -2? (a) 4 (b) -0.2 (c) 1 (d) -14130 (e) -0.4 e Which is the closest to	{ "pile_set_name": "DM Mathematics" }
derivative of 247x4 - 266x*4 - 22 - a wrt x. -76x*3 Let z(d) be the second derivative of -58d6 - d4/6 - 430d3/3 + 2132d. Find the third derivative of z(v) wrt v. -41760v Let n(v) = 2v + 2. Let j(m) = -294m2 + 4m + 29. Let o(x) = -3j(x) + 6n(x). Find the first derivative of o(p) wrt p. 1764p Differentiate -14j - 40j2 + 55j*2 + 8j*2 + 60j*2 + 523 - 2173 with respect to j. 166j - 14 Let o = -1289/6 + 679/3. Let u(t) be the first derivative of -26 + ot2 - t. What is the first derivative of u(w) wrt w? 23 Let g(k) = 14k - 200. Let d be g(16). What is the derivative of 92w - 168 + dw - 17w wrt w? 99 Let f = -310 - -314. What is the second derivative of 103u*f + 154u - 70u + 98u + 49u4 wrt u? 1824u*2 Let t(v) = -596v*4 + 1281v*2 + 12. Let c(p) = -8939p*4 + 19215p*2 + 182. Let r(u) = 6c(u) - 91t(u). What is the third derivative of r(j) wrt j? 14448j Let h(q) = 733q2 - 5q + 13. Let p be h(5). Find the third derivative of 53g3 - g - 18313 + 4g*2 + p wrt g. 318 What is the derivative of 969f*2 + 1115f*2 - 11916 + 1254f*3 - 2090f*2 wrt f? 3762f*2 - 12f Let v(p) be the first derivative of 1619p2/2 - 1356p - 1950. Find the first derivative of v(h) wrt h. 1619 Find the second derivative of 63m - 1389m*5 - 240m - 60 + 171m wrt m. -27780m*3 Let z = 15 + -10. Suppose zo = -3i + 5 + 12, -5o = -5. What is the second derivative of 117d - 2d*3 - 10d*i - 131d + 2d3 wrt d? -120d*2 Let y(v) = 32v - 59. Let j be y(3). Differentiate 71 - 32 - j - 8b4 + b + 3b with respect to b. -32b3 + 4 Suppose 4g - 6 + 52 = 2l, -2g = 0. Let v = l - 21. Find the third derivative of -2i3 - i3 - 5i*3 - 3i*3 - 5i*v wrt i. -66 Suppose 22n - 38 = 3n. Find the third derivative of 6u*5 + 527un - u6 + u - 557u2 - u wrt u. -120u*3 + 360u*2 Let g(m) = -29m*3 - 2 - 5m - 16 - 7. Let a(s) = -1 - 273s + 269s - 29s3 - 25. Let r(i) = -5a(i) + 4g(i). Differentiate r(l) with respect to l. 87l*2 Let m(h) be the first derivative of -144/5h*5 + 0h*3 + 35 + 0h + 0h4 - 8h*2. What is the second derivative of m(x) wrt x? -1728x*2 Let t be (-2)/(-8) + 76/16. Let y be 1/(27/204 - (-28)/238). What is the second derivative of -tc4 + c4 - 19c - 5c - 17cy wrt c? -252c*2 What is the second derivative of -6d*3 + 25d*3 + 1134d + 5 + 42d2 - 6 - 31d*2 wrt d? 114d + 22 Suppose 29 = -u - 14u + 29. Let l(v) be the third derivative of 8/3v*3 - 2/5v*5 - 11v*2 + uv*4 + 0v + 0. Find the first derivative of l(o) wrt o. -48o Let o(c) be the third derivative of 97/30c*5 + 0c*4 + 46c*2 + 5/6c*8 + 0c*7 + 0c + 0 + 0c6 + 0c*3. What is the third derivative of o(l) wrt l? 16800l*2 Let f(z) be the second derivative of -53z - 1 + 283/2z2 - 1/4z*4 - 23/3z*3. What is the derivative of f(k) wrt k? -6k - 46 Let i(o) be the first derivative of -2787o4/4 - 70o*3 - 97. Find the third derivative of i(a) wrt a. -16722 Suppose 702t = 627t + 150. Suppose -3m = -2m - 4. Differentiate -23a*4 - 14 - 3a*m - 4 + ta*4 wrt a. -96a*3 Let q(c) be the second derivative of 0c*5 + 0c*6 - 9/4c*4 + 0c*3 + 3/7c*7 - 30c + 0c2 - 2. What is the third derivative of q(z) wrt z? 1080z*2 Suppose -3x = 4j - 5j - 209, -2j - 350 = -5x. Differentiate xg2 + 10g*2 + 6g*2 + 77 with respect to g. 168g Let k = -139 - -142. Differentiate -143fk - 12 + 143f*3 - 58f*4 - 3 wrt f. -232f*3 Let j be (-2)/10 - (-264)/120. Find the third derivative of 20v*4 + 2v*j - 37v*4 + 35v*6 + 17v*4 + 2 wrt v. 4200v*3 Let l(i) = 4483i*4 - 11i*3 + 14473i. Let q(g) = -2988g4 + 7g*3 - 9649g. Let h(c) = 9l(c) + 14q(c). Find the second derivative of h(b) wrt b. -17820b2 - 6b Suppose 4m - 2 - 6 = 0. Suppose -mi - 2 - 2 = -5u, i + 3 = 3u. What is the derivative of -10l3 + 9l*3 - 2l*i - 23 wrt l? -9l*2 What is the second derivative of -2i*3 - 28i - 30i + i3 - 66i + 80806i4 + 3 - 81120i*4 wrt i? -3768i*2 - 6i Find the third derivative of -21m6 - 9m*5 + 24m*6 - 1301m*2 - 60m*5 - 11m*6 wrt m. -960m*3 - 4140m2 Let y(z) = 3 - 4 + 2. Let n(o) = o3 - 4o2 - 4o - 6. Let k be n(5). Let i(f) = 6f - 8. Let s(b) = ki(b) + 5y(b). Differentiate s(x) with respect to x. -6 Let i(z) be the third derivative of 5/8z*4 - 29/120z*6 + 0z*5 + 44z*2 + 0z + 0 + 0z3. Find the second derivative of i(f) wrt f. -174f Let n(v) be the first derivative of 2499v4 + 11426v*3/3 + 12111. Find the third derivative of n(q) wrt q. 59976 Let f(b) be the third derivative of -1982b7/105 + b5/30 + 2827b4/8 + 4730b*2. What is the third derivative of f(y) wrt y? -95136y Let p(j) be the first derivative of 37j6/6 + 13j5/5 - j4/4 + 921j3 + 6935. What is the third derivative of p(q) wrt q? 2220q*2 + 312q - 6 Let y(t) = -9t3 + t2 - t - 1. Let k = 41 + -42. Let u be y(k). What is the first derivative of 0 + uv + v + 2 + 19 wrt v? 11 Let o(h) = 2257h5 + 3h*3 + 9h*2 + 1906h. Let r(u) = u5 - u3 - 3u2. Let a(b) = -o(b) - 3r(b). Find the second derivative of a(m) wrt m. -45200m3 Let k = -245 + 246. Let l(w) = -w2 + w. Let z(m) = 65m*3 + 153m*2 - 5m. Let j(i) = kz(i) + 5l(i). Find the third derivative of j(g) wrt g. 390 Let r(a) = -254a3 - 213a*2 - 19a - 19. Let o(l) = 85l3 + 71l*2 + 6l + 6. Let p(q) = 19o(q) + 6r(q). Find the third derivative of p(k) wrt k. 546 Let w(m) = 3m2 + 21m - 400. Let x be w(-16). Suppose -5v = -19 + 4. What is the derivative of x - 80n*2 - 4n*v + 80n*2 wrt n? -12n*2 Let g(q) be the second derivative of -524q*3 - 1157q*2/2 + 1369q. What is the derivative of g(c) wrt c? -3144 Let d(t) be the second derivative of 0t6 + 0t*5 + 30t - 29/14t7 + 0t*2 + 1 - 47/6t*4 + 0t*3. Find the third derivative of d(l) wrt l. -5220l*2 What is the second derivative of 498w + 260w2 - 450w*2 - 630w2 wrt w? -1640 Let f(m) be the first derivative of -m5/5 + 2m4 - 16m*3/3 - 6m - 585. What is the third derivative of f(x) wrt x? -24x + 48 Let h(c) = -1265c + 731. Let p(f) = 633f - 363. Let v(g) = -4h(g) - 7p(g). Find the first derivative of v(n) wrt n. 629 Let u = -220 + 227. Let t(z) = -194z + 192. Let f(b) = 97b - 96. Let x(y) = uf(y) + 3t(y). Differentiate x(v) wrt v. 97 Let t(n) = n3 - 17n*2 + 5n - 83. Let v be t(17). Find the second derivative of -40l4 + 0l + 135 + 5l + 5l*3 - 126 + 2l*v - 5l*3 wrt l. -480l*2 + 4 Let s(b) be the second derivative of 1244b*4/3 + 2861b*2 + 3608b. What is the derivative of s(m) wrt m? 9952m Suppose 0 = 2q - 10 - 8. Let r(t) be the first derivative of -14 - 5t2 - 3t*2 + 4t*2 - qt + 10t2. What is the first derivative of r(u) wrt u? 12 Let o = -979 - -981. Let n(h) be the first derivative of 0h*o + 9h + 10/3h3 + 18. Find the first derivative of n(t) wrt t. 20t Find the second derivative of 8941o - 8658o*3 + 428971 - 428971 wrt o. -51948o Let h(u) be the second derivative of 398u4/3 + 1284u*2 + 19u + 18. Find the first derivative of h(c) wrt c. 3184c Let s be (1 - 0) + 25 + 1. Let y be -1 + -3 - ((-60)/12 - 1). What is the third derivative of 26p*y - 11p*4 + sp*2 - 29p*2 wrt p? -264p Suppose 271 + 199 = 5a. Differentiate 12k - 46 + 32k - 30k + ak wrt k. 108 Let b = 411 + -406. Find the second derivative of -14g*2 + 18g*2 + 4 + 3g*5 + 12g*b - 5 + 86g wrt g. 300g3 + 8 Suppose -11g = -15g - 136. Let w = g + 39. What is the second derivative of wp*5 + 14p + p*5 + 15p wrt p? 120p3 Let p be ((-1)/(-2))/(72/2448). What is the derivative of -pk - 19k + 99 - 22 + 2k*2 + 24 + 4k wrt k? 4k - 32 Let o = -122 + 127. What is the third derivative of 9d*2 + 6 + 9d*2 - 10d*3 - od*2 - 2d*4 - 1 wrt d? -48d - 60 Suppose 7a - 44 = 4a - 4l, -2a = 2l - 32. Find the third derivative of -23r*2 + 6r*6 - 3r*5 - 3r*2 + 17r*6 - ar*6 wrt r. 360r*3 - 180r*2 Let l(b) be the second derivative of -1277b*5/20 - 285b*2 - 646b. What is the first derivative of l(n) wrt n? -3831n2 Let l(o) be the second derivative of 509	{ "pile_set_name": "DM Mathematics" }
x dps? -0.000041 Round 0.10681255 to 4 decimal places. 0.1068 Round 0.1655402 to 1 dp. 0.2 What is 152660000 rounded to the nearest 100000? 152700000 What is 650.229 rounded to the nearest one hundred? 700 Round 873707.49 to the nearest one thousand. 874000 What is -15.636951 rounded to the nearest integer? -16 Round -9752050 to the nearest 1000. -9752000 What is -29430730 rounded to the nearest ten thousand? -29430000 Round 16.79475 to 2 decimal places. 16.79 What is 1281.67 rounded to the nearest integer? 1282 Round -14061.1 to the nearest 1000. -14000 What is -0.0003356386 rounded to 6 dps? -0.000336 Round 0.000001312548 to seven decimal places. 0.0000013 Round 28661.496 to the nearest one hundred. 28700 What is 218345 rounded to the nearest 100? 218300 Round -0.4383492 to 3 decimal places. -0.438 What is 0.0003959 rounded to 4 dps? 0.0004 Round 0.11191704 to four decimal places. 0.1119 Round 0.00006413849 to 6 decimal places. 0.000064 What is 0.02021313 rounded to 3 dps? 0.02 Round -0.002482987 to 4 dps. -0.0025 What is 0.000478239 rounded to six dps? 0.000478 What is 459429.4 rounded to the nearest 10000? 460000 Round 2408.8643 to one dp. 2408.9 What is -0.05693 rounded to 3 dps? -0.057 Round 0.00339255 to 3 dps. 0.003 What is -0.0000000714985 rounded to 7 decimal places? -0.0000001 Round -24.83163 to the nearest integer. -25 What is -227.9066 rounded to the nearest integer? -228 What is -13168.96 rounded to the nearest ten? -13170 Round -0.005295391 to four dps. -0.0053 Round -634783 to the nearest 1000. -635000 What is -51817 rounded to the nearest one hundred? -51800 What is 17513255.6 rounded to the nearest 1000? 17513000 Round 2587.439 to the nearest 10. 2590 What is 0.0000256295 rounded to 6 decimal places? 0.000026 Round -753680 to the nearest 100000. -800000 What is 0.00000467997 rounded to 7 dps? 0.0000047 Round -0.0198238 to 4 dps. -0.0198 What is -0.453661 rounded to two dps? -0.45 Round -38593.85 to the nearest one thousand. -39000 Round -0.0000203561 to 7 decimal places. -0.0000204 Round 647403800 to the nearest 1000000. 647000000 What is -182546.6 rounded to the nearest 10000? -180000 Round -117.2 to the nearest 100. -100 What is 18.8536 rounded to one dp? 18.9 What is -0.016379 rounded to 1 dp? 0 What is 1.54423 rounded to one decimal place? 1.5 What is -455360.88 rounded to the nearest one hundred thousand? -500000 What is 54156.9 rounded to the nearest 100? 54200 Round 228782.9 to the nearest one thousand. 229000 What is 0.945045 rounded to two decimal places? 0.95 Round -0.004287761 to 3 dps. -0.004 Round 0.1045641 to 3 decimal places. 0.105 What is -296612000 rounded to the nearest 1000000? -297000000 What is 8124.501 rounded to the nearest ten? 8120 Round 0.011593893 to four decimal places. 0.0116 Round -0.000000459841 to seven dps. -0.0000005 What is -82879.453 rounded to the nearest 10? -82880 Round 8120369 to the nearest one million. 8000000 Round 0.015025618 to 4 dps. 0.015 What is -0.055846707 rounded to two dps? -0.06 What is 0.731249 rounded to three decimal places? 0.731 Round -6471856000 to the nearest 1000000. -6472000000 What is 0.00878482 rounded to five decimal places? 0.00878 What is 0.00000193435 rounded to seven decimal places? 0.0000019 What is -3.257772 rounded to three dps? -3.258 Round 0.0014602908 to 4 dps. 0.0015 Round -0.4695853 to three dps. -0.47 Round -0.158545 to 2 dps. -0.16 What is 21.81899 rounded to 1 dp? 21.8 What is -0.835981 rounded to 0 dps? -1 Round -1744.2 to the nearest 100. -1700 Round 0.22442232 to four dps. 0.2244 What is -0.00029354755 rounded to 7 decimal places? -0.0002935 What is -0.000046127 rounded to five dps? -0.00005 What is 2358150 rounded to the nearest one thousand? 2358000 Round 4824.3167 to the nearest one thousand. 5000 Round -183.24313 to the nearest integer. -183 Round -64.0075 to 0 decimal places. -64 What is 81.6201 rounded to the nearest ten? 80 What is -112.6198 rounded to the nearest integer? -113 What is 2421.53 rounded to the nearest 1000? 2000 What is 367000.3 rounded to the nearest 100000? 400000 What is 0.000371989 rounded to six dps? 0.000372 What is -1983.1 rounded to the nearest 100? -2000 What is 0.9499232 rounded to one decimal place? 0.9 Round -270.91089 to 1 dp. -270.9 What is -272868300 rounded to the nearest one million? -273000000 Round 0.1298282 to 3 decimal places. 0.13 Round -1392.03 to the nearest ten. -1390 Round -0.01551325 to 3 decimal places. -0.016 Round -0.0004635147 to five decimal places. -0.00046 Round -0.0000366556 to 7 decimal places. -0.0000367 What is 1368317 rounded to the nearest 1000? 1368000 Round 1493807 to the nearest one thousand. 1494000 What is 7049.954 rounded to the nearest integer? 7050 What is 26700.207 rounded to the nearest 100? 26700 What is -0.0000358252 rounded to 7 decimal places? -0.0000358 What is -7.53428 rounded to one decimal place? -7.5 What is -1510153 rounded to the nearest 1000? -1510000 Round -96060.8 to the nearest ten thousand. -100000 What is 0.224258 rounded to 2 dps? 0.22 What is -0.00093576 rounded to four decimal places? -0.0009 Round -0.000013159707 to 6 dps. -0.000013 What is 904287.4 rounded to the nearest 10000? 900000 Round -13232.8 to the nearest one hundred. -13200 Round -0.2870454 to three decimal places. -0.287 What is -28.53731 rounded to 2 dps? -28.54 Round -0.0002004647 to 7 dps. -0.0002005 Round 62492980 to the nearest one hundred thousand. 62500000 What is -89574150 rounded to the nearest 100000? -89600000 What is -0.000001048281 rounded to 7 decimal places? -0.000001 What is 13372300 rounded to the nearest one hundred thousand? 13400000 What is 0.216642 rounded to 2 decimal places? 0.22 What is -21.578161 rounded to 0 decimal places? -22 What is 6450.5228 rounded to the nearest 100? 6500 Round -19.57213 to 2 dps. -19.57 What is 0.000000263883 rounded to seven decimal places? 0.0000003 What is 90426.3 rounded to the nearest 100? 90400 What is 0.240749 rounded to one dp? 0.2 Round 158954930 to the nearest 1000000. 159000000 Round -11601.76 to the nearest one thousand. -12000 What is -0.00007086673 rounded to six dps? -0.000071 What is 43464000 rounded to the nearest 10000? 43460000 Round 5069.35 to the nearest ten. 5070 What is -0.000354385 rounded to five dps? -0.00035 Round 20032.8 to the nearest 1000. 20000 What is -0.000200601 rounded to 5 decimal places? -0.0002 What is 0.8069753 rounded to one dp? 0.8 Round 0.00036263037 to 5 decimal places. 0.00036 Round 0.019544143 to five decimal places. 0.01954 Round -0.1709373 to three decimal places. -0.171 Round 14420350 to the nearest one hundred thousand. 14400000 Round 0.1515145 to two dps. 0.15 Round 162096.8 to the nearest 100. 162100 What is 6633950 rounded to the nearest 100000? 6600000 What is 328192 rounded to the nearest 1000? 328000 Round 0.12804654 to 2 dps. 0.13 What is 376.21 rounded to the nearest one hundred? 400 Round -183232.48 to the nearest one hundred. -183200 What is -5498.72 rounded to the nearest one thousand? -5000 Round 0.00127355 to 4 dps. 0.0013 What is 18.796232 rounded to two dps? 18.8 What is -0.1799832 rounded to 3 dps? -0.18 What is -0.002871749 rounded to 5 decimal places? -0.00287 Round -10195.6572 to zero decimal places. -10196 What is -0.21637586 rounded to 2 dps? -0.22 Round -1004098 to the nearest ten thousand. -1000000 What is -110.3593 rounded to the nearest integer? -110 What is 0.0000045416 rounded to 6 decimal places? 0.000005 What is -0.0080266 rounded to 5 dps? -0.00803 Round 0.000158086 to 7 dps. 0.0001581 Round 0.00035363999 to seven dps. 0.0003536 What is 0.000003327175 rounded to 7 dps? 0.0000033 What is -0.000014400852 rounded to 7 dps? -0.0000144 What is 10.321878 rounded to two decimal places? 10.32 What is 3639350 rounded to the nearest 1000? 3639000 What is 0.1541864 rounded to 2 decimal places? 0.15 What is 1150.462 rounded to the nearest 10? 1150 What is 0.00209794 rounded to 5 dps? 0.0021 Round 0.000382669 to 6 dps. 0.000383 What is -1630820 rounded to the nearest one hundred thousand? -1600000 Round 455771.97 to the nearest 1000. 456000 Round -0.06184976 to two dps. -0.06 What is 18272.241 rounded to the nearest 1000? 18000 What is -0.2212779 rounded to three decimal p	{ "pile_set_name": "DM Mathematics" }
f -1/180q5 + 0q*3 + 1/72q*4 + 0 + 0q - q*2. Factor u(w). -w(w - 1)/3 Let q be (4/20)/(3/6). Factor -6/5k - 4/5k*2 - q. -2(k + 1)(2k + 1)/5 Let q = -6 + 10. Suppose qj - 6 = j. Solve 2 + f - 4f*3 + 6f*2 + 4f*3 - 7f - jf3 = 0. 1 Let f(d) be the third derivative of d8/1680 - d6/180 + d4/24 + d3/3 - d2. Let b(h) be the first derivative of f(h). What is t in b(t) = 0? -1, 1 Let o(p) be the first derivative of -p5/5 + p4/2 - p2 + p + 6. Suppose o(l) = 0. What is l? -1, 1 Let x(o) be the second derivative of o + 4/45o*6 + 1/9o*3 + 0 + 4/15o*5 + 5/18o*4 + 0o*2. Let x(l) = 0. What is l? -1, -1/2, 0 Let d(w) be the first derivative of 7/6w*3 - 1/4w*2 + 0w + 9/10w5 - 1 - 15/8w4. Find y, given that d(y) = 0. 0, 1/3, 1 Let f(c) be the second derivative of -c6/30 - 3c5/20 - c4/6 - 28c. Solve f(v) = 0 for v. -2, -1, 0 Let a = 9709/15 - 647. Let b(f) be the second derivative of 0f3 - 2f + 0f2 - 1/18f*4 - af*6 + 0 - 8/63f*7 - 1/5f*5. Factor b(g). -2g*2(2g + 1)3/3 Let c(l) be the third derivative of -l5/15 - l4/2 - 4l*3/3 - 4l2. Determine m, given that c(m) = 0. -2, -1 Let c(h) = -h4 + h*2 + 2h + 2. Let j(a) = 4a4 - 4a*2 - 11a - 11. Let u(r) = 11c(r) + 2j(r). Factor u(v). -3v2(v - 1)(v + 1) Let n(v) be the first derivative of -v5/15 - 4v*4/3 - 32v*3/3 - 2v*2 - 1. Let c(t) be the second derivative of n(t). Factor c(o). -4(o + 4)2 Let n(g) = -g3 + 30g2 + 9g. Let m(w) = -4w2 - 3w*2 - 2w + 0w + w2. Let s(h) = 11m(h) + 2n(h). Suppose s(c) = 0. What is c? -2, -1, 0 Let s(v) be the first derivative of v6/18 - 4v5/15 + v4/3 + 2v3/9 - 5v*2/6 + 2v/3 - 12. Find p, given that s(p) = 0. -1, 1, 2 Let t be 8/(-28) - (157/63 + -3). Factor -4/9q3 + 0q*2 + 0q*4 + 2/9q*5 + tq + 0. 2q(q - 1)*2(q + 1)*2/9 Let x = 20 + -18. Factor 3 - 30i + 0 + 24i + 3i*x. 3(i - 1)*2 Suppose -d + 4 = 0, -5d = 3v - 17 - 18. Factor -14 + k2 - 6k - 2k2 + 0k + v. -(k + 3)*2 Let q(x) = -36x*3 - 24x*2 - 6x + 2. Let l(o) = -o + 1. Let m(j) = -2l(j) + q(j). Let m(a) = 0. What is a? -1/3, 0 Suppose 0 = -5s - 106 + 116. Factor -4/5y - 2/5y*s + 0. -2y(y + 2)/5 Let s = 4 - -2. Let z(t) be the third derivative of 0t - 1/120t5 + 0t*3 + 0 + 0t*4 - 1/420t*7 + 1/120t*s + 2t*2. Find r such that z(r) = 0. 0, 1 Let h be (3/6)/((-2)/(-12)). Let q = 1 + h. Factor -1/3v - 4/3v3 - 2/3 + 10/3v*2 + 5/3v*5 - 8/3vq. (v - 1)3(v + 1)(5v + 2)/3 Let v(w) = -w3 - 6w*2 - 3w - 5. Let r be v(-6). Let s = r - 9. Suppose f*5 - 3f - 2fs + f2 + 3f + f4 - f3 = 0. What is f? -1, 0, 1 Let g be (-3)/(-6) - (-7 - -3 - -4). Factor -1/2q3 + 0q*2 + 0 + gq. -q(q - 1)(q + 1)/2 Let l(r) be the first derivative of r*6/12 + 2r*5/5 + 3r*4/4 + 2r3/3 + r2/4 - 12. Factor l(p). p(p + 1)4/2 Let l be -143/124/(-56). Let u(o) be the first derivative of -1/10o*5 + lo*4 + 1/2o - 1/2o2 + 2 + 0o*3. Suppose u(f) = 0. What is f? -1, 1 Let w = 5 + -3. Factor -2j*2 + wj*3 + 4j*2 + 2j - 2j. 2j*2(j + 1) Let m(j) be the first derivative of 27/16j4 + 0j + 5 + 3/8j2 - 5/4j*3 + 1/4j*6 - 21/20j*5. Factor m(h). 3h(h - 1)3(2h - 1)/4 Factor -1/3c*2 + 1 - 2/3c. -(c - 1)(c + 3)/3 Let u(v) be the third derivative of v5/75 + v4/10 - 8v*3/15 - 2v*2. Suppose u(m) = 0. What is m? -4, 1 Let 8u*2 - 10u*2 - u + 9u + 0u - 6 = 0. What is u? 1, 3 Find u such that 0u - 2/13u4 + 54/13 + 16/13u*3 - 36/13u*2 = 0. -1, 3 Let j be (-12 - -2)/(1 + 1). Factor -1/3h2 - 5/6h*3 + jh - 1/2h4 + 0. -h2(h + 1)(3h + 2)/6 Let x be ((-102)/(-4))/(12/16). Suppose -z = z - x. Let 4p2 - zp*3 + 7p*3 - 18p*2 - 4p = 0. Calculate p. -1, -2/5, 0 Let z(d) be the second derivative of -d4/6 + d3/2 - 5d2/2 + 3d. Let v(u) = -u + 1. Let g(i) = -5v(i) - z(i). Find h, given that g(h) = 0. -1, 0 Let n(j) be the second derivative of -j5/120 - j4/18 + 3j. Let n(y) = 0. What is y? -4, 0 Let o(i) be the third derivative of i*7/30 - 2i6/15 + i5/15 - 9i2. Find s, given that o(s) = 0. 0, 2/7, 2 Suppose -q - 5q = 0. Factor 2/3c5 + 0c*4 + 0c*2 + q + 2/3c - 4/3c3. 2c(c - 1)2(c + 1)*2/3 Let k = -3 - 2. Suppose -5i + 4 + 11 = 0. Let z(j) = -j*2 - j - 4. Let m(q) = -2q*2 - q - 7. Let a(w) = im(w) + kz(w). Factor a(o). -(o - 1)2 Solve -3j*2 - 1688 + 1688 = 0 for j. 0 Let j = 17/93 + -1/62. Let t(f) be the second derivative of -1/12f*4 + 0 - jf*3 + 1/20f*5 + 1/2f2 - f. Factor t(m). (m - 1)2(m + 1) Let p(u) be the second derivative of u6/45 - u5/15 - u4/6 - 39u. Solve p(h) = 0 for h. -1, 0, 3 Let x(m) be the first derivative of m*4/6 - 3. Determine i, given that x(i) = 0. 0 Let l(c) be the third derivative of 1/420c*7 + 0c*4 + 0c*6 + 3c*2 + 0c + 0c5 + 0c*3 + 0 - 1/672c*8. Determine y, given that l(y) = 0. 0, 1 Let l(w) = 5w3 + w2 + w - 1. Let s be l(1). Suppose 4r = x - s, r - 2 = -x - 1. Solve 0 + 0v*4 + 0v*x + 1/2v - v*3 + 1/2v*5 = 0 for v. -1, 0, 1 Suppose 3n - w - 2w - 9 = 0, 3w + 3 = n. Suppose 6 = -d + 2a, -3a + n + 6 = 5d. Factor d + 2/3j*3 + 4/3j*2 + 2/3j. 2j(j + 1)*2/3 Let s(b) be the first derivative of 0b*3 - 6 + 0b - 4/3b2 + 1/2b*4 - 2/15b*5. Factor s(c). -2c(c - 2)2(c + 1)/3 Let z(t) = t + 1. Let c be z(-4). Let q be (c/18)/(3/(-9)). Find l, given that -2/3l - 2/3 + 1/3l*3 - 1/6l*4 + ql*2 = 0. -1, 2 Suppose -y - 4 = -3y. Let q(v) be the first derivative of 0v + 0v*y + 2/27v3 - 1. Let q(j) = 0. What is j? 0 Let a(w) be the second derivative of -w4/42 + w*3/3 - 31w. Find d such that a(d) = 0. 0, 7 Let j(q) be the first derivative of -q4/12 + q3/3 + q - 4. Let s(z) be the first derivative of j(z). Factor s(o). -o(o - 2) Let s(n) be the first derivative of -4 - 8/7n - 2/21n3 - 4/7n*2. Determine y so that s(y) = 0. -2 Let r be (-4)/(-240)-1-2. Let g(w) be the second derivative of -2/3w*3 + 3w - rw6 - 1/2w*2 - 1/2w*4 + 0 - 1/5w5. Factor g(x). -(x + 1)4 Factor 0l4 - 10l*2 + 4l + 3l4 + 2l*4 - 7l*4 + 8l*3. -2l(l - 2)(l - 1)2 Let h = 64/105 - -2/35. Let z(m) be the first derivative of m2 + hm3 + 1 - 1/2m*4 - 2m. Factor z(l). -2(l - 1)2(l + 1) Let j = -5 - -10. Factor 5c3 - 16c*5 - 5c*4 + 17c*j - 1 - 10c*2 + 5c + 5c3. (c - 1)5 Let l(a) be the second derivative of -2a*6/15 - 2a*5/5 + 4a*3/3 + 2a*2 - 15a. Factor l(q). -4(q - 1)(q + 1)*3 Let j be 2 - ((-1)/(-1))/(-1). Let r(d) = -d + 3. Let n be r(0). Factor 2s3 + s2 - nsj - 1 + s + 0s2. -(s - 1)2(s + 1) Let n be (6/1)/2 - 0. Factor -2b*3 + 3b*3 - 2b*2 + nb*2 + 0b3. b2(b + 1) Let g be (3/(-198))/((-2)/8). Let a = 37/66 - g. Let 7/4k*3 - 7/4k + a - 1/2k2 = 0. Calculate k. -1, 2/7, 1 Let m = 367/3 - 121. Suppose -1/3i*2 - m - 4/3i = 0. What is i? -2 Suppose 144 = -22v + 25v. Find g, given that 118g4 + 28g*3 + vg*5 - 6g*2 - 38g*4 - 4g*2 + 2g*2 - 4g = 0. -1, -1/2, 0, 1/3 Suppose 4p - 2t - 4 = 0, -2p - t + 6 + 4 = 0. Suppose 3u + pg - 12 = 0, 3u - 7 = -5g + 13. Suppose -1/2b + 1/2b2 + u = 0. Calculate b. 0, 1 Let p be (-6)/((-27)/(-6)-7). Let s(r) be the second derivative of 0r2 + 0 + pr*4 + 1/105r*6 + 4/21r*3 - 3r + 1/14r5. Factor s(v). 2v(v + 1)(v + 2)2/7 Let t(q) be the first derivative of -q4/36 + q*3/27 - 3. Solve t(m) = 0. 0, 1 Let r = -6249/7 - -893. Factor 4/7y*3 - 2/7y*4 - ry - 2/7y5 + 4/7y*2 - 2/7. -2(y - 1)*2(y + 1)*3/7 Let v = -108 - -328/3. Let vk*2 + 2/3k*3 + 2/3k + 0 = 0. Calculate k. -1, 0 Let q(d) = -d*3 + 16d*2 + 17d + 3. Let s be q(17). Let g(k) be the second derivative of k*2 + 0 - 1/6k*4 + k - 1/3k*s + 1/10k*5. Factor g(t). 2(t - 1)*2(t + 1) Let b(n) = 9n4 - 6n*3 + 21n*2 + 6. Let t(g) = -26g*4 + 19g*3 - 62g*2 + g - 17. Let x(j) = 17b(j) + 6t(j). Let x(i) = 0. Calculate i. 0, 1, 2 Let g = 2/627 - -1873/2508. Solve -gs*2 - 1/2 - 5/4s + 1/4s4 + 1/4s*3 = 0 for s. -1, 2 Suppose -6k = 51 - 3. Let a be (-75)/(-63) - k/56. Factor 0w2 - aw**3 -	{ "pile_set_name": "DM Mathematics" }
y*2 + 19y*2 - 18y*2. Let n(x) = 2x - 4. Let d(j) = 14 - 7 + 3j - 8 - 6. Let q(g) = -4d(g) + 7n(g). Calculate i(q(b)). 32b*2 Let f(b) = 2222b. Let x(j) = -2j - 3. Let u(r) = 32r + 52. Let s(t) = 3u(t) + 52x(t). Calculate f(s(k)). -17776k Let n(a) = 2a. Let z(q) = 2q2 - 3214003q. What is n(z(c))? 4c2 - 6428006c Let q(y) = -2y + 33 + 44 - 101 + 24. Let h(m) = 6m + 114. Let k(o) = -4o - 76. Let i(c) = 5h(c) + 8k(c). Determine q(i(j)). 4j + 76 Let w = 1693 - 4. Let x(m) = w - 1689 + 4m. Let z(l) = l + 7. What is z(x(c))? 4c + 7 Let n(x) = 3x. Let j(k) = -2113k - 45. Let r(g) = 1056g + 27. Let o(d) = -3j(d) - 5r(d). What is o(n(u))? 3177u Let p(d) = -175616d. Let t(r) = 5r - 12. Give t(p(w)). -878080w - 12 Let d(c) = c + 0c - c + c - 3. Let o(w) = -w - 4. Let k(j) = 2d(j) + o(j). Let z(n) = 2n*2. Determine k(z(b)). 2b*2 - 10 Let o(t) = 349t*2 - 3t + 5. Let s(x) = -353x2 + 2x - 4. Let a(v) = 4o(v) + 5s(v). Let j(p) = -p. Determine j(a(i)). 369i2 + 2i Let z(q) be the third derivative of q*4/24 - 2q*2. Let r(y) = 2y - 8581 - 8y - 4y + 8581. Calculate z(r(w)). -10w Let q(p) = p + 191. Let u(c) = -4c + 4923. Give q(u(d)). -4d + 5114 Let p(v) be the second derivative of -13v*4/4 - 243v. Let k(o) = 5o2. Give k(p(t)). 7605t*4 Let g(r) = -599471r*2. Let c(k) = -25k*2. Determine g(c(v)). -374669375v*4 Suppose 0 = 2a + 5q - 46 + 76, -5a + q = -6. Let d(z) be the second derivative of 0 - 16z + az*2 + 2/3z*3. Let g(j) = 7j*2. Give g(d(u)). 112u*2 Let u(r) = 2504r*2 - 40r + 40. Let t(y) = -189y2 + 3y - 3. Let o(n) = 80t(n) + 6u(n). Let c(l) = 11l - 3. Determine o(c(v)). -11616v*2 + 6336v - 864 Let z = -1874 - -1874. Let r(f) be the second derivative of -24f + zf*2 + 0 + 1/6f*3. Let o(y) = 6y. Give o(r(d)). 6d Let k(s) = 2s*2 - 127s. Let l(n) be the first derivative of -n*2 - 2125. Calculate k(l(a)). 8a*2 + 254a Let d(w) be the first derivative of -w*2 + 66w - 5232. Let o(m) = -16m2. Give o(d(a)). -64a*2 + 4224a - 69696 Let i(h) be the first derivative of 0h + 0h*3 - 1/12h*4 + 15 + 7/2h*2. Let p(j) be the second derivative of i(j). Let a(r) = -2r*2. Determine a(p(k)). -8k*2 Let o(f) = 199f. Let t(z) = 38z + 43z - 127z - 3z*2 + 46z. Give o(t(h)). -597h2 Let p(u) = 1473u. Let t(w) = 26w - 1372. What is t(p(i))? 38298i - 1372 Let i(y) = 123y. Let k(w) = w3 + 17w*2 - 37w + 21. Let c be k(-19). Let t(o) = 1169 - 1169 + co - 3o. Give i(t(a)). -123a Let s(i) = 22i*2. Let c(l) = -10l*2 - 628l + 128. Let g be c(-63). Let o(v) be the second derivative of 34v - 1/6v*3 + 0v*g + 0. Determine o(s(y)). -22y*2 Let u(x) = 5x*2 + 6. Let v(g) = 60g*2 - 2629g + 70 + 2629g. Let l(m) = -35u(m) + 3v(m). Let f(t) = -20t. Calculate l(f(b)). 2000b2 Suppose -3f - 24 = -3v, -5v - 4f + 2 = -74. Let u(b) = -v + b2 + 12. Let t(g) be the first derivative of -10g*3/3 - 45. Give t(u(p)). -10p4 Let f(n) = n2. Let l(c) = 91 - 41 - 61 - 19c. Give f(l(v)). 361v*2 + 418v + 121 Let r(w) = 145926025w. Let v(a) = a2. What is r(v(y))? 145926025y*2 Let z(n) = 3n*2. Let s(f) = 119f*2 + 2f - 63197. What is s(z(d))? 1071d4 + 6d*2 - 63197 Let p be (-864)/63(0 + -7). Let t = -75 + p. Let a(g) = g*2 - 41 + t + 20. Let h(m) = 3m*2. What is a(h(o))? 9o4 Let v(q) be the first derivative of q4/12 + 234q + 251. Let o(i) be the first derivative of v(i). Let y(t) = 2t. Give o(y(s)). 4s2 Let q(s) = -2s*2. Let f(z) be the second derivative of 31z4/24 + z3/3 - 5z2 + 62z. Let i(p) be the first derivative of f(p). What is q(i(w))? -1922w2 - 248w - 8 Let g(w) = -37w2 + 3w*2 + 32w*2. Let s(h) = 4812h. What is g(s(a))? -46310688a2 Let l(w) = -2w*2 + 365. Let o(b) = 855b + 860b - 1714b. Determine o(l(f)). -2f2 + 365 Let l(z) = 5368z. Let s(y) = -347y2. What is s(l(a))? -9998952128a*2 Let z(p) = 1518p. Let q(d) be the third derivative of d*5/60 - 10d*2 - 126d. Calculate q(z(y)). 2304324y2 Let m(h) = 248h. Let d(z) = -148179z. Calculate d(m(i)). -36748392i Let s(k) = -k - 11. Let u(b) = 22. Let g(v) = 2s(v) + u(v). Let n(l) = -2548l*2. Calculate g(n(q)). 5096q*2 Let x(b) = b - 7b - 2b - 19b - 7b + 36b. Let k(d) = 22d - 5 + 5 - 4d*2. Calculate k(x(z)). -16z*2 + 44z Let z(o) = o*2. Let w(m) be the second derivative of 37m*5/30 - 65m*2/2 - 127m. Let y(x) be the first derivative of w(x). Determine y(z(j)). 74j4 Let l(m) = m2 - 1. Let v(o) be the first derivative of -o4/12 + 11o*2 - 65. Let p(n) be the second derivative of v(n). What is l(p(f))? 4f*2 - 1 Let n(i) = 15612i*2. Let t(g) = -951g. Calculate n(t(q)). 14119508412q2 Let t(r) = -1020r2. Let n(m) be the first derivative of -m2/2 - 1756. Determine n(t(f)). 1020f2 Let w(m) = 6m*2 - 5m. Suppose -18r - 5r + 46 = 0. Let j(z) = rz - 2z - 2229z2 + 2230z*2. Give j(w(q)). 36q*4 - 60q*3 + 25q*2 Let j(y) = -2y. Let z(r) be the second derivative of 1841r4/12 + 663r. Calculate z(j(t)). 7364t2 Let t(n) = -9n. Let z(y) be the third derivative of -y7/720 + y5/15 + y*3/6 + 46y*2 + 2y. Let s(a) be the third derivative of z(a). Calculate s(t(k)). 63k Let d(p) = -70 - 10 - 55p - 51 + 131. Let c(j) = 7j + 12. Determine d(c(k)). -385k - 660 Suppose -10u + 60 + 30 = 0. Let x(w) = uw - 9 - 5 + 27w + 14. Let i(b) = 3b. Determine x(i(g)). 108g Let o(k) = 6k. Let n = -4 - -20. Let z be 384/(-6)-1n. Let g(r) = -zr + 7r*2 + 1024r. Give g(o(i)). 252i2 Let c be ((-442)/(-51) + -8)/((-4)/(-18)). Let d(b) be the second derivative of -19b + 0b2 - 29/12b*4 + 0b*c + 0. Let t(n) = -2n*2. Determine t(d(s)). -1682s*4 Let m(t) = 44794t - 2. Let g(p) = 2p + 30. Calculate g(m(o)). 89588o + 26 Let n(a) = 49a + 44. Let h(r) = 48r + 55. Let l(f) = 4h(f) - 5n(f). Let s(w) = -9w + 4. Give l(s(u)). 477u - 212 Let i(a) = 4a2. Let s(l) be the third derivative of 0l + 1/6l3 - 15l*2 + 0. Let u(c) = 9c*2 - 1. Let g(n) = s(n) + u(n). What is g(i(m))? 144m*4 Let t(g) = 34g*2 + 26g*2 - 131g*2 + 41g*2 + 27g*2. Let d(c) be the third derivative of 11c*5/60 + 2c*2. What is d(t(l))? 99l*4 Let u(t) be the first derivative of -3t*2/2 + 813. Let a(f) = -11f. Let v(j) = 10j + 1. Let s(c) = -6a(c) - 7v(c). Give u(s(h)). 12h + 21 Let r(n) = -10n. Let z(m) = -9 + 55 + 54 - 17 + 2m - 2. Calculate r(z(k)). -20k - 810 Let c(v) = 2v. Let h(k) = k + 3. Let i(r) = -62 + 18 + 0r - 10r - 5. Let o(x) = -5h(x) - i(x). Calculate c(o(y)). 10y + 68 Let p(s) be the first derivative of 5s2/2 - 8s + 27. Let c(j) = -7j - 5. Let a(u) = 20u + 14. Let d(q) = -5a(q) - 14c(q). What is p(d(t))? -10t - 8 Let g(o) = 54896884o*2. Let d(m) = -10m. What is d(g(y))? -548968840y2 Let a(c) = 2c. Let n(i) = -17i - 742996. Give n(a(d)). -34d - 742996 Let b(i) = i*2 + 6i. Let a(c) be the first derivative of 29c2 + 2c*3 - 29c2 + 51 - c3. What is a(b(v))? 3v4 + 36v*3 + 108v*2 Let j(p) = -5p. Let u(a) = -413a - 40. Let i(t) = -4750t - 456. Let w(q) = -5i(q) + 57u(q). Calculate w(j(c)). -1045c Let x(u) = u2 + 1879u. Let v(s) = 207s - 1. Give x(v(l)). 42849l*2 + 388539l - 1878 Let c(g) = 2g2. Let w(m) = -105189791m. What is w(c(s))? -210379582s2 Let f(a) = -6a + 3. Let b(m) = 3m + 190599. Give b(f(q)). -18q + 190608 Let y(m) be the third derivative of m*5/60 + 3m*2 + 6m. Let p = -5 + 7. Let z(a) = -a*p + 0a*2 + 7a*2. What is y(z(w))? 36w*4 Let a(i) = -14i - 16i + 18i - 2i. Let h(u) be the third derivative of -u6/240 - u4/24 - 4u*2. Let d(r) be the second derivative of h(r). Give d(a(z)). 42z Let x(p) = 3p. Let w(v) be the first derivative of -v2 + 83v + 8699. Calculate w(x(z)). -6z + 83 Let z(h) be the second derivative of -507h - 1/6h3 + 0 + 0h*2. Let m(i) be the first derivative of 3i*2 - 13i + 1. Determine m(z(u)). -6u - 13 Let i(y) = 4586y*2 - 7y + 28. Let j(u) = -2293u2 + 3u - 12. Let o(t) = 3i(t) + 7j(t). Let w(a) = 2a. Determine w(o(r)). -4586r*2 Suppose 5w + 0w - 10 = 0. Let m(j) = -wj**2 + 35821 - 35821. Let r(f) be	{ "pile_set_name": "DM Mathematics" }
- 1 Let f(m) = m + 1. Let q(j) be the third derivative of j6/60 + j5/60 + j4/6 + j3/3 + 19j2. What is 2f(a) - q(a)? -2a3 - a2 - 2a Let r(m) = 2m - 9. Let c(i) = i - 4. Let b(y) = -y2 - y + 1. Let d be b(0). Let f be (-1 - -2)/(d/(-5)). Let v = 2 + 0. Calculate fc(w) + vr(w). -w + 2 Let f(a) = -6a*3 - 4a*2 - 7a + 3. Let h(x) = -3x - 3x*2 + 3 - 1 - 3x - 5x3. Calculate 3f(t) - 4h(t). 2t*3 + 3t + 1 Let y be (-16)/(-36)(-18)/(-4). Let w(n) be the first derivative of yn*2 + 1/3n*3 - 1 - 7n. Let k(l) = -l*2 - 5l + 8. Give -5k(f) - 6w(f). -f*2 + f + 2 Let o(a) = -9a*3 - 13a*2 + 5a + 5. Let i(r) = -2r3 + r2 + r - 2. Let z be i(1). Let f(p) = 4p*3 + 6p*2 - 2p - 2. Determine zo(w) - 5f(w). -2w3 - 4w*2 Let s(v) = 7v*3 - 5 - 4v*2 - v - 2v + 0v2 + 0v. Let h(i) = -6i3 + 3i*2 + 2i + 4. Determine -5h(g) - 4s(g). 2g3 + g2 + 2g Let i(u) = 4u + 1. Let r(b) = -23b - 5. Calculate -34i(v) - 6r(v). 2v - 4 Let d(r) = -6r + 7. Suppose -j + 4j - 21 = 0. Let k(l) = 5l - 6 + 0 + 0. Determine jk(f) + 6d(f). -f Suppose -15 = -3m, 3b - 2b - 3m = -19. Let c(q) = -q*3 + 4q*2 + 2q - 6. Let u(r) = r*2 - 1. Calculate bu(v) + c(v). -v*3 + 2v - 2 Let m(t) be the second derivative of -t5/20 + t4/6 - t3/3 + t2 - 12t. Let q(v) = -4v*3 + 9v*2 - 9v + 9. Determine 9m(b) - 2q(b). -b3 Let t(l) = l3 + 5l2 + 6l. Let h be t(-4). Let g(p) = -p*2 + p + 1. Let o(i) = 6i*2 - 8i - 8. What is hg(d) - o(d)? 2d*2 Let u(h) = -212h + 11. Let b(d) = -53d + 3. Give 22b(k) - 6u(k). 106k Let x(c) = 3c. Let u(y) = 2y - 23. Let s be u(12). Let v(o) = -o + 1. Let q(k) = -6k + 5. Let f(h) = -q(h) + 5v(h). Calculate sx(m) - 4f(m). -m Let b(l) = -3l3 + 6l*2 - 4l + 4. Let g(p) be the third derivative of -p*6/24 + 11p*5/60 - 7p*4/24 + 7p*3/6 + 2p*2. Give 7b(j) - 4g(j). -j3 - 2j2 Let k(p) be the first derivative of p3 - 11p2/2 + 11p - 1. Let m(o) = -o*2 + 4o - 4. Suppose 18h - 15 - 183 = 0. What is hm(i) + 4k(i)? i2 Let x(y) = -y - 3. Let i(b) be the third derivative of -b4/4 - 8b3/3 + b2. Let c be -1 + (-16)/(-6)(-9)/(-6). Determine ci(g) - 16x(g). -2g Let y(j) = -7j3 - 6j*2 - 9j - 6. Let i(h) = -20h3 - 17h*2 - 27h - 17. Give -6i(u) + 17y(u). u*3 + 9u Let o(k) = -4558k + 301. Let t(z) = -76z + 5. Calculate 5o(v) - 301t(v). 86v Let c(i) = -4i - i - 7 - 3i. Let h(y) = y + 1. What is c(n) + 5h(n)? -3n - 2 Let c(o) = 2o + 7. Let q(u) = 7u + 28. What is 9c(x) - 2q(x)? 4x + 7 Let n(x) = -7x3 - 7x*2 - 9x - 5. Let i(q) = 6q3 + 6q*2 + 8q + 4. Calculate 5i(z) + 4n(z). 2z3 + 2z*2 + 4z Let q(b) = b*3 + b - 1. Let h(a) = -14a*3 + 2a*2 - 10a + 10. What is h(p) + 10q(p)? -4p*3 + 2p2 Let m(q) be the first derivative of q2/2 - q + 3. Let r be -2 + 4 + (1 - 1). Let z(s) = 2 - rs + 2 - s - s. What is -5m(v) - z(v)? -v + 1 Let g(q) = -5q + 0 + 8q*2 + 0. Suppose 2k = 2m + 152, 2m - 4k + 0k + 150 = 0. Let d be 41/7 - 11/m. Let w(f) = 9f2 - 6f. Determine dw(t) - 7g(t). -2t2 - t Let c(v) be the second derivative of -v2 - v. Let d(r) be the third derivative of -r4/24 - 5r*3/6 + 11r*2. Calculate 5c(f) - 2d(f). 2f Let c(s) = -2s + 0s + 6s. Let n(b) = 5b - 1. Let w be 1/(-2)41. Give wn(d) + 3c(d). 2d + 2 Let m = 0 + 2. Let w(t) = t - 4 - 3t - mt. Let z(o) = 9o + 8. Let n(y) = -7w(y) - 3z(y). Let s(c) = c + 3. What is -5n(j) + 7s(j)? 2j + 1 Suppose -24 - 21 = -5t. Let c(d) = 3d3 + 2. Let q(u) be the third derivative of -13u*6/120 - 3u*3/2 - 11u*2. Give tc(g) + 2q(g). g3 Let d(i) = 13i*2 + 7i - 6. Let r = 34 - 13. Suppose 0f + r = 3f. Let y(b) = -4b2 - 2b + 2. What is fy(g) + 2d(g)? -2g2 + 2 Let i(f) = f2. Let n(a) = -5a*2 + 2a + 1. Let u be n(-1). Let x(o) = 5o2 - 2o. Give ui(b) + x(b). -b2 - 2b Let w(u) = 3u2 - 3u. Let g(v) = -13v2 + 13v. What is -4g(x) - 18w(x)? -2x2 + 2x Suppose -3t = -4t + 13. Let v(u) = -2u - 2u + t - 11u2 + 0 - 9u. Let o(b) = -5b2 - 6b + 6. Calculate -13o(l) + 6v(l). -l*2 Let z(a) = 8a*2 - 4a. Let h(p) = -17p2 + 9p. Let w = -45 + 51. Determine wh(b) + 13z(b). 2b2 + 2b Let n(v) = -5v3 - 2v + 4. Let q(z) = 5z3 + 3z - 5. Determine -5n(h) - 4q(h). 5h3 - 2h Let j(l) be the second derivative of -3l3/2 + 5l*2/2 + 5l. Let x(m) = -14m + 8. Calculate -8j(c) + 5x(c). 2c Let d(g) = g*2 + 6. Let o(b) = 1. Let h be (((-16)/(-6))/8)/(2/(-6)). Calculate hd(n) + 6o(n). -n2 Let x(k) = -k2 - 1. Let q(j) = -16j*3 - 24j*2 - 24. Determine q(t) - 24x(t). -16t3 Let q(z) = -2z - 16. Let j(x) = -x - 9. Let l(h) = 11j(h) - 6q(h). Let w(v) = -v + 2. What is -6l(n) - 7w(n)? n + 4 Let g(y) = -874y. Let v(d) = -38d. Calculate 5g(f) - 114v(f). -38f Let g(m) = 5m*2 + 4m + 4. Let q(s) = -5s2 - 3s - 3. Let v be (28/(-12) - -2)/((-2)/(-18)). What is vg(k) - 4q(k)? 5k2 Let l(o) = o3 + 4o*2 + o. Let z be l(-3). Let j(d) = zd - 12d + 7d. Suppose -3 = -2p - 1. Let s(v) = 2v. What is ps(m) - j(m)? m Let g(t) = t. Let l(y) = 5y*2 - 4y - 2. Let q(b) = -11b2 + 9b + 4. Let z(v) = 5l(v) + 2q(v). Calculate 2g(f) + z(f). 3f*2 - 2 Let b(u) = -3u2 - u - 9. Let l(p) = p2 + 4. Determine 3b(s) + 7l(s). -2s2 - 3s + 1 Let f(i) = 2i3 + 5i*2 + 5i. Let d be (-7)/35 - (52/(-10) - -1). Let b(t) = -2t3 - 6t*2 - 6t. Give db(v) + 5f(v). 2v3 + v2 + v Let t(y) = y2 - 8y - 2. Let n(c) = -3c2 + 15c + 4. Give 6n(b) + 11t(b). -7b2 + 2b + 2 Let n(q) = q*2 + q. Let m(c) = 4c + 1. Suppose z = 6z - 15, 3 = 2j - z. Let s be (1-2)/4-2. Let u = s - j. Determine un(w) + m(w). -2w*2 + 2w + 1 Let l(k) = k + 5. Let w(z) = 1. Determine l(a) + w(a). a + 6 Let m(p) = 9p. Let w(z) = 14z. Give 8m(i) - 5w(i). 2i Let v(u) = u2 + u. Suppose 5q = -30 + 35. Let i(w) = w + 1. Let r be i(-5). Let f(o) = 5o2 + 5o. Calculate qf(l) + rv(l). l*2 + l Suppose -w + 1 + 4 = 0. Let b(g) be the first derivative of -2g3/3 + g2 - 5g + 5. Let x(v) = 3v*2 - 2v + 6. What is wb(c) + 4x(c)? 2c2 + 2c - 1 Let u(a) = -a + 16. Let g(s) = -s + 17. Determine 7g(j) - 6u(j). -j + 23 Let a(z) = z*2 - 3z + 7. Let f(u) = 2u2 - 2u + 6. Determine -2a(b) + 3f(b). 4b2 + 4 Let b(h) = -2h + 4. Let t(d) = 6d - 20 + 10 - 3. What is -7b(x) - 2t(x)? 2x - 2 Let t(c) = 8c + 1. Let a(b) = 7b + 1. What is 4a(y) - 3t(y)? 4y + 1 Let s(t) = 2t - 3. Let c(x) = 50x - 109x + 48x + 17. What is 6c(f) + 34s(f)? 2f Let x(r) = 2r3 + r2 - 5r - 3. Let b(z) = 0 + z - 3 + 2 + 2. Give 3b(g) + x(g). 2g3 + g2 - 2g Let x(v) = 2v*3 + 12v*2 - 3. Let q(o) = -3o*3 - 13o*2 + 4. What is -3q(a) - 4x(a)? a3 - 9a*2 Let z(l) = -5l*3 - 4l*2 + 5l + 5. Let g(p) = p*2 - p - 1. Give -5g(r) - z(r). 5r3 - r2 Let w(v) = 6v. Let y(j) be the third derivative of -7j4/24 + j2. Suppose 3c - 18 = -0c. Calculate cw(s) + 5y(s). s Let g(x) = -9x*3 + 9x*2 - 9x. Let i(y) = -5y3 + 4y*2 - 4y. Determine -4g(d) + 9i(d). -9d3 Let t(n) = -n + 1. Let j(u) = -3u - 8. Let k(y) = -7y - 17. Let c(z) = 13j(z) - 6k(z). Calculate 3c(h) + 6t(h). 3h Let s(b) = -162b - 36. Let f(r) = -23r - 5. What is -36f(w) + 5s(w)? 18w Let o(f) = -f. Let r(b) = 2b. Let h(a) = 11o(a) + 6r(a). Let n(l) = 8l - 2. Let s(j) = j2 + 13j. Let d be s(-10). Let x = d + 20. What is xh(w) + n(w)? -2w - 2 Let b(y) = -40y + 39. Let v be b(1). Let d(a) = a3 + a2 - a. Let u = -6 + 4. Let x(q) = -q3 - 3q*2 + 2q. What is ud(r) + vx(r)? -r3 + r2 Let x(i) = -7i3 - 3i*2 + 3i - 3. Let d(n) = 76n3 + 32n*2 - 32n + 32. Suppose -2f = 2h + 4, 2f = -h - 1 + 2. What is fd(l) + 32x(l)? 4l3 Let b(m) be the first derivative of m4 + 2m3/3 + m2 - 1. Let p(t) = -2t3 - t2 - t. Let x be (-4 - 2)(-1)/(-1). What is xb(i) - 13p(i)? 2i3 + i2 + i Let z(m) = 2m3 - 2m*2 - 2m + 1. Let y(n) = -8n3 + 9n*2 + 8n - 3. Determine -2y(a) - 9z(a). -2a3 + 2a - 3 Suppose 0 = -m - 3u + 8, 5m + u = -9 - 21. Let r(i) = -i + 4. Let p(z) =	{ "pile_set_name": "DM Mathematics" }
e? 3750 How many years are there in 1/20 of a century? 5 What is 2814.277kg in milligrams? 2814277000 How many millilitres are there in 11/2 of a litre? 5500 How many milliseconds are there in 0.8290929 nanoseconds? 0.0000008290929 How many seconds are there in one ninth of a hour? 400 How many meters are there in 630.1361cm? 6.301361 What is 0.402672 millennia in centuries? 4.02672 How many seconds are there in 1/9 of a hour? 400 Convert 679835.8 millennia to centuries. 6798358 How many millimeters are there in 18/5 of a meter? 3600 What is 18/5 of a centimeter in millimeters? 36 How many millilitres are there in 53/4 of a litre? 13250 What is 76/5 of a decade in months? 1824 What is 3/32 of a millimeter in nanometers? 93750 How many micrometers are there in twenty-five halves of a millimeter? 12500 What is 45/2 of a millennium in decades? 2250 Convert 49.36396mm to nanometers. 49363960 What is 3/5 of a litre in millilitres? 600 How many months are there in three eighths of a millennium? 4500 What is 687558.2cm in kilometers? 6.875582 How many milligrams are there in thirteen eighths of a gram? 1625 What is seven thirds of a hour in minutes? 140 What is thirteen fifths of a gram in milligrams? 2600 Convert 6.874314 millilitres to litres. 0.006874314 How many meters are there in fourty-one halves of a kilometer? 20500 Convert 853.3148 years to centuries. 8.533148 What is 414.5531 days in seconds? 35817387.84 How many microseconds are there in 6/5 of a millisecond? 1200 Convert 0.8228145 microseconds to minutes. 0.000000013713575 What is 6.385944 months in years? 0.532162 How many millilitres are there in 1/4 of a litre? 250 How many decades are there in 26/5 of a century? 52 How many months are there in 1/60 of a century? 20 How many grams are there in three fifths of a kilogram? 600 How many months are there in one quarter of a millennium? 3000 What is eighty-eight fifths of a centimeter in millimeters? 176 How many kilometers are there in 0.6478456 micrometers? 0.0000000006478456 Convert 762952.6 litres to millilitres. 762952600 Convert 24.37343 centimeters to nanometers. 243734300 How many litres are there in 39.02797 millilitres? 0.03902797 What is twenty-three eighths of a gram in milligrams? 2875 How many nanograms are there in fourty-nine quarters of a microgram? 12250 What is eleven halves of a millennium in months? 66000 What is three fifths of a litre in millilitres? 600 What is 170.0965 years in centuries? 1.700965 How many litres are there in 2481.473 millilitres? 2.481473 Convert 59.91424 millennia to decades. 5991.424 How many nanograms are there in 2/125 of a microgram? 16 What is 3/10 of a millennium in years? 300 What is 513.5052 micrometers in kilometers? 0.0000005135052 How many micrograms are there in 525974.6mg? 525974600 What is 895613.9mm in nanometers? 895613900000 What is five quarters of a millennium in months? 15000 Convert 4312.2195us to hours. 0.00000119783875 How many centimeters are there in 1/20 of a kilometer? 5000 How many hours are there in 37.552536 nanoseconds? 0.00000000001043126 How many millilitres are there in 37/5 of a litre? 7400 What is 11/4 of a litre in millilitres? 2750 What is five sixths of a decade in months? 100 How many years are there in six fifths of a century? 120 How many seconds are there in 925087.7 weeks? 559493040960 What is 4269.388 litres in millilitres? 4269388 Convert 0.0169266s to minutes. 0.00028211 What is 44/5 of a centimeter in micrometers? 88000 How many centimeters are there in 1/5 of a meter? 20 What is 871264.4l in millilitres? 871264400 How many millilitres are there in 5863.645 litres? 5863645 How many milligrams are there in 7/4 of a gram? 1750 What is six fifths of a kilometer in meters? 1200 What is 3/5 of a century in decades? 6 How many decades are there in 17/4 of a millennium? 425 What is 3/10 of a tonne in kilograms? 300 How many years are there in 29/2 of a millennium? 14500 Convert 0.4939712g to milligrams. 493.9712 What is 3/16 of a week in minutes? 1890 What is twenty-five quarters of a meter in millimeters? 6250 What is 31/5 of a century in decades? 62 How many nanograms are there in 25/4 of a microgram? 6250 What is 44/5 of a gram in milligrams? 8800 What is 17/4 of a microgram in nanograms? 4250 What is 846.472 grams in kilograms? 0.846472 What is 55.074141 milliseconds in hours? 0.0000152983725 How many millilitres are there in one fifth of a litre? 200 What is 39564.35 hours in milliseconds? 142431660000 How many microseconds are there in 3/32 of a second? 93750 Convert 471.8439nm to meters. 0.0000004718439 What is three tenths of a tonne in kilograms? 300 What is 15/4 of a year in months? 45 Convert 729141.4ng to tonnes. 0.0000000007291414 What is 0.8713735 litres in millilitres? 871.3735 How many millilitres are there in 11/8 of a litre? 1375 How many micrograms are there in twenty-seven halves of a milligram? 13500 What is 5/8 of a millimeter in micrometers? 625 What is one fifth of a microgram in nanograms? 200 Convert 2.116303mm to centimeters. 0.2116303 What is 51/2 of a century in years? 2550 Convert 83.14255ml to litres. 0.08314255 How many milligrams are there in 3/5 of a gram? 600 How many millilitres are there in fourty-nine quarters of a litre? 12250 What is one tenth of a gram in micrograms? 100000 Convert 0.3070462mg to tonnes. 0.0000000003070462 How many hours are there in nineteen sevenths of a week? 456 What is 9734.054l in millilitres? 9734054 Convert 569725.8 kilograms to milligrams. 569725800000 Convert 207.79038 months to decades. 1.7315865 What is 67/4 of a litre in millilitres? 16750 How many seconds are there in 46669.48 microseconds? 0.04666948 What is 2/125 of a kilometer in millimeters? 16000 How many millilitres are there in 11/8 of a litre? 1375 Convert 0.8750574 centuries to years. 87.50574 Convert 331.1547 millilitres to litres. 0.3311547 What is 884.88936 minutes in days? 0.6145065 Convert 776669.5 days to seconds. 67104244800 How many millilitres are there in seventeen quarters of a litre? 4250 How many nanograms are there in 7/2 of a microgram? 3500 Convert 186.8235327us to weeks. 0.00000000030890134375 How many nanoseconds are there in 6/25 of a microsecond? 240 How many micrometers are there in one fifth of a millimeter? 200 How many milliseconds are there in 560.8705 weeks? 339214478400 How many minutes are there in eleven eighths of a week? 13860 What is eighteen fifths of a tonne in kilograms? 3600 How many milliseconds are there in 11/10 of a second? 1100 Convert 6557.769 litres to millilitres. 6557769 Convert 10079.45g to kilograms. 10.07945 What is 85/4 of a micrometer in nanometers? 21250 How many millilitres are there in 1/4 of a litre? 250 What is 5/6 of a century in months? 1000 How many millilitres are there in one quarter of a litre? 250 Convert 183560806.8 microseconds to weeks. 0.000303506625 How many kilograms are there in 11/10 of a tonne? 1100 What is 16233.3 months in millennia? 1.352775 What is seven halves of a litre in millilitres? 3500 How many months are there in fourty-one halves of a century? 24600 How many decades are there in fifty-one quarters of a millennium? 1275 How many months are there in 27/4 of a century? 8100 What is 1/10 of a meter in micrometers? 100000 How many minutes are there in 0.2920587 seconds? 0.004867645 How many months are there in 5/6 of a millennium? 10000 How many micrograms are there in one twentieth of a gram? 50000 What is 3.084269 kilograms in nanograms? 3084269000000 What is 26/5 of a litre in millilitres? 5200 How many millimeters are there in three eighths of a meter? 375 What is thirteen fifths of a litre in millilitres? 2600 How many millilitres are there in 13/5 of a litre? 2600 What is 1/10 of a kilometer in millimeters? 100000 How many micrometers are there in three eighths of a centimeter? 3750 Convert 1.97319m to kilometers. 0.00197319 How many millilitres are there in one quarter of a litre? 250 How many decades are there in 21.2927 years? 2.12927 What is 3/40 of a micrometer in nanometers? 75 What is twenty-one eighths of a tonne in kilograms? 2625 What is 805.9068 centuries in years? 80590.68 Convert 0.8786431 nanoseconds to microseconds. 0.00087	{ "pile_set_name": "DM Mathematics" }
f*3 + k and give k. -1 Rearrange -2m*4 + 3m*3 - 3m*3 + 4m*3 + 1 + 3m*3 to xm*3 + fm + om4 + cm2 + b and give x. 7 Express j3 - 4j + 26 - 3j - 26 as cj + z + tj*3 + mj*2 and give t. 1 Express 48i*2 - 86i*2 + 114i*2 as ui*2 + yi + d and give u. 76 Rearrange -5x3 + 49x - 48x - 2 - x3 + 2x*2 + 4x*3 to the form ix + f + nx3 + hx*2 and give h. 2 Express 6 + 3l*3 - 6 + (9 - 9 + l)(2 + 2 - 2)(-2l*2 - 4l*2 + 4l*2) as sl*3 + ql + r + bl2 and give s. -1 Rearrange (-2q + q + 2q)(0q2 - 3q*2 - 3q + 0q2)(0 + 0 - 7q) to c + dq*2 + sq*4 + pq*3 + uq and give p. 21 Rearrange (-2y + y + 0y)(-10y*2 + 12y*2 - 3y*2 - 27) to by + m + dy2 + qy*3 and give b. 27 Express 2m*2 + 6m*2 - 10m*3 - 10m*2 as zm*2 + k + xm*3 + ym and give x. -10 Rearrange (-4o2 + 4o*2 + 2o*4)(1 + 2 - 1) + o*3 - 3o + 3o + 6o*4 to co*4 + s + io + ko2 + vo*3 and give v. 1 Rearrange 2o*2 + 1 + 0 - 12o*2 + 8o*2 to fo + w + po2 and give w. 1 Express (3c - 2c - 3c)(5c - c - 2c)(8 - c - 8) as x + jc3 + yc*2 + hc and give j. 4 Rearrange (-2 + 2 - 4l)(-4l + 5 - 5)(-5 + 3 + 1) to the form pl + n + bl*2 and give b. -16 Rearrange (2 - 1 + 2)(-5 - n - 2n + 1) to an + g and give g. -12 Rearrange -8h2 + 0h*2 + 12h2 - h3 + 7h2 to v + gh*2 + kh*3 + qh and give g. 11 Rearrange (o + 0o + 0o)(-2o*2 - 6o*3 - 8o*3 + 54o*3) to the form po*2 + ko + v + zo4 + to3 and give z. 40 Rearrange x3 - 13x4 - 1 - x + 287x*2 - 287x*2 to the form r + lx + hx4 + dx*2 + px*3 and give p. 1 Express (-3r - r*2 + 3r)(-r + r - 3r*2) + 2r3 - r3 + 2r4 + r3 in the form mr + qr3 + n + wr*2 + or4 and give q. 2 Rearrange -s2 + s - s + (-2 + 0 + 4)(-2s*2 + 0s*2 + 3s*2) + 38s*2 - 20s*2 - 39s*2 to the form ts + r + bs2 and give b. -20 Express -3d4 + d2 - 3d4 - 1 - 2d + 0d + 0d*4 as bd*3 + nd*2 + zd + md4 + s and give s. -1 Express 0 - 2s*3 + 26s*2 + s - 28s*2 - 5 - 3s as n + ds2 + hs + ts3 and give h. -2 Express -3m*2 + 11m*2 + 2m*2 in the form y + tm*2 + um and give t. 10 Rearrange (-3d - 2d*2 - 58 - 60 + 144)(d*2 + 3 - 3) to the form a + wd*4 + md*3 + id + td2 and give m. -3 Rearrange -12 + z - 3z + 0z + z to the form u + xz and give x. -1 Express -3m - 3 - 5m*3 + 0m3 + m3 + 2 as y + tm2 + gm + dm3 and give y. -1 Express -21s - 8 + 8 in the form cs + p and give c. -21 Rearrange (-7 - 6 + 1)(0l + 3l - 4l)(6 - 3l - 6) to the form kl + dl2 + b and give d. -36 Express 10s + 2s3 - 26s - 6s - 10s in the form cs + hs*3 + ws*2 + n and give c. -32 Express (-4m + 5m + 0m)(-3 + 3 + 2)(-3 + 5 - 5) in the form v + tm and give t. -6 Express -6y + 8y + 11y + (2y + 0 + 0)(-2 + 3 + 0) - 7 + y + 7 + 2y - y - 2y in the form iy + c and give i. 15 Express (r3 - 2r3 - r3)(-98r + 67r - 120r) in the form nr2 + br + qr3 + d + sr4 and give s. 302 Express (z3 + 7z3 - 3z*3)(4z - 4z - 6z) in the form hz*2 + b + uz*3 + rz*4 + dz and give r. -30 Express 80 - 80 - 39h4 + (0h*2 + 3h*2 - 4h*2)(-h2 + h2 + h*2) in the form vh*2 + fh*3 + zh*4 + oh + y and give o. 0 Express n - 3n - 13n as un + y and give u. -15 Rearrange -8x*2 + 11x2 - x2 + 7x3 to the form yx*2 + z + ix + rx3 and give y. 2 Express -4d + 0d + d + (2 - 4d - 2)(-1 - 2 + 1) as z + yd and give y. 5 Express -5h - h + 1 + 0h + 15h as fh + z and give f. 9 Rearrange (3l - l2 - 3l)(-1 - 1 - 2) - 4 + 1 + 2l*2 + 1 to fl + gl2 + k and give g. 6 Rearrange -5c*2 + 18c + c*4 - 28c + 13c to the form mc*4 + uc*3 + sc*2 + pc + k and give m. 1 Rearrange 33 + 7k3 - 4k*3 - 102 + (0k - 2k + 4k)(-4k*2 + 2k*2 + 3k*2) to uk + zk3 + ak*2 + j and give j. -69 Express (-2z + 2z - 2z)(0z + 4z - 3z + 2z - z + 0z + (0 - 4 + 2)(-3 + 3 + 2z) + 3 - 3 - 2z - 6 + 6 + 3z) as iz2 + vz + m and give i. 2 Express s*3 + 0s*2 + 0s2 + s3 - 4s3 + s3 + 3s*3 - 4s*3 + 0s*3 + (0 - 1 + 3)(8s2 - 8s2 - s3) as v + ns2 + xs + is3 and give i. -4 Express s2 + 6 + 2s*2 - 7s*2 + 5s*2 as qs*2 + js + i and give q. 1 Rearrange (s - 2s + 3s)(-2s - s + s) + 6 + 16s + 3s*2 - 16s to the form hs + a + cs*2 and give c. -1 Express -2z - z*2 - 28 + 3z + 25 - 2z3 in the form j + nz*3 + az*2 + yz and give j. -3 Rearrange -21d2 + 21d*2 + 11d*4 + (6d*3 - 3d3 - d3)(0d + 0d + 2d) to the form sd4 + qd*2 + m + nd + yd3 and give m. 0 Express -13 + 13 + 4l + (2 + l - 2)(-2 + 2 - 1) in the form r + gl and give g. 3 Rearrange (188 + 2 - 29)(-1 + 1 - x) to s + zx and give z. -161 Rearrange 0j + 2j*2 + 0j + (2 - 2 - 1)(j2 - j2 - j2) + (j2 + 0j2 + j2)(-7 + 3 + 3) to the form vj*2 + bj + g and give v. 1 Rearrange -5y2 - y2 + 2y*2 to the form fy*2 + my + d and give f. -4 Rearrange 154n + 12803 - 12803 to the form k + sn and give s. 154 Rearrange (2r - 10r - 5r)(-2r - 4r + 4r + 2) to the form gr*2 + nr + f and give g. 26 Express 2c + 3c - 5c - 12c in the form n + lc and give l. -12 Rearrange -10t*2 + 150 + 8t*2 - 46 - 2t to the form xt + l + nt*2 and give l. 104 Rearrange 6 - 6 + 10t*2 to a + yt*2 + ut and give u. 0 Express 3c3 - 1 - 7c*3 + 2c*3 + 0c*3 + 2c + 3c2 in the form dc*3 + gc + tc2 + i and give d. -2 Rearrange (-5q - 2q + 6q)(q - 3q + 4q) - 177q*2 - 195q*2 + 302q*2 to mq + tq2 + d and give t. -72 Rearrange (-9 - 3p*2 + 9)(-53p - 9p - 48p) to up + xp3 + o + vp*2 and give x. 330 Rearrange 20j*2 - 5j - 8j2 + 5j to q + cj2 + fj and give c. 12 Express 1 + 11u4 + u3 + 1 + 6 - 6 in the form ku*3 + iu*4 + qu*2 + p + mu and give i. 11 Express s*3 + 0s3 - s2 - 2s + 0s - 2s3 in the form ls*3 + ts + y + js2 and give l. -1 Express 2 + m4 - 2 + (m3 - 3m3 + m3)(0m - 3m - 2m) as dm2 + sm*3 + h + nm + om4 and give d. 0 Express (2a - 2 + 2 + (-2 + 5 - 2)(0a + 2a - 3a))(61 + 99 + 51) in the form ua + y and give u. 211 Express (-90f - 31f - 7f)(-2 + 1 + 0) in the form kf + b and give k. 128 Rearrange -39x - 16x - 17x to the form z + dx and give d. -72 Express (4 - 2 + 2)(j*2 - 2j*2 + 2j*2) - 6j*2 + 0j2 - j2 as d + kj2 + lj and give k. -3 Rearrange (-5 + 1 + 2 - 9h2)(-2h - 2h + 3h) to ch + bh2 + wh*3 + t and give c. 2 Express -3h*3 - 5h*2 - 3h*3 + 0h*2 + 3h*2 as ih + b + sh2 + ch*3 and give s. -2 Express (0c + c - 3c)(32c - 185 + 185) as wc*2 + jc + x and give w. -64 Rearrange -2i4 - i + 3i*4 + 3i2 + i3 - 4i2 + i3 to the form ui*3 + gi + qi4 + xi*2 + j and give g. -1 Rearrange -2a + a4 - a3 - 5a + 6a - 2a2 to the form wa + za4 + va*3 + n + ra*2 and give r. -2 Rearrange -5u*3 - 2u - 445u2 + 445u*2 - 3 to the form fu*2 + yu*3 + gu + h and give f. 0 Express -17b2 - 3b*3 + 2b + 11b2 + 2 - 5b*2 + 2b*3 as ab + v + sb2 + fb*3 and give s. -11 Express -4 + 2h*2 + 3 + 45h - 2h3 - 45h in the form ih + uh*3 + o + ch*2 and give u. -2 Express 2m2 - m4 - 3 + 0m4 + 2m*3 - 4 + 0m*3 + 2m in the form sm2 + g + bm*3 + am + fm4 and give g. -7 Express 5l - 8l + 3l - 19l2 as pl + j + hl2 and give p. 0 Rearrange (3c - 1 + 1)(2c + 2c - 2c)(0 - 5 - 2) to r + ac*2 + zc and give a. -42 Rearrange (-4 + 2 + 1)(3 - 2o*3 - 3) + 0o*3 - 7o*3 - 11o*3 to ao*2 + yo*3 + vo + r and give y. -16 Rearrange (2h - 169 + 169)(15 + 9 - 9) to the form wh + y and give w. 30 Express -2r2 - r - r3 + r*2 - 2r*3 + 3r*2 in the form dr*3 + c + zr + tr2 and give z. -1 Rearrange -4 - 16 + 5 + j - 16 to a + yj and give y. 1 Express -25l2 + 48l*2 - 25l*2 - 6l*3 - 1 as nl*3 + ul*2 + d + wl and give n. -6 Rearrange -9q2 - 2 + 0 + 8q*2 to lq*2 + m + zq and give m. -2 Rearrange 4w3 + w2 - 5w*3 + 3w*3 - 2w + 2w4 + 0w**3	{ "pile_set_name": "DM Mathematics" }
= 5l - 14. Let o = -27 + 29. Let b be (1 - 1/o)/((-10)/(-120)). Calculate the highest common divisor of b and l. 2 Let v = 53 + -17. Calculate the highest common factor of 576 and v. 36 Suppose -37o + 36o + 2 = 0. Suppose -4i = 5q - 61, -oi + 17 = q - 6i. What is the highest common divisor of q and 13? 13 Let u = 1627 + -1068. What is the greatest common factor of 39 and u? 13 Suppose 9i - 115 = 4i. Let o be i(3 + (-5)/(20/8)). Calculate the greatest common divisor of 23 and o. 23 Suppose 2q = 5w - 2w - 27, 27 = 3w + 4q. Let y be (-35)/20 + (-385)/(-28). What is the highest common divisor of w and y? 3 Let d = -13 + 11. Let l be ((-32)/(-12))/(d/6). Let b be (l/10)/((-4)/40). Calculate the greatest common divisor of 2 and b. 2 Let s be (10/42)/(1/3). Calculate the highest common factor of 9 and s. 3 Suppose 6f - 11f - 50 = 0. Let z(o) = o*3 + 10o*2 - 5o - 15. Let d be z(f). Calculate the greatest common factor of 140 and d. 35 Let n = 2847 + -1557. Calculate the highest common factor of n and 60. 30 Let o(d) = -219d + 36. Let z be o(-6). Suppose 0 = -27x + 37x - z. What is the highest common divisor of x and 27? 27 Suppose 7n - 11n + 20 = 0. Suppose 2k = -2k + 68. Suppose -2w = 4u + 3w - 31, 3u + nw = k. What is the highest common factor of 14 and u? 14 Let v = 68 - 95. Let s = 87 + v. Suppose t = 5f + 37, -5t - 5f + 3f = -50. What is the greatest common factor of t and s? 12 Suppose 5n - 3z + 4z - 30 = 0, 43 = 4n - 3z. Let y be -2-3n/((-42)/(-88)). Calculate the highest common factor of y and 11. 11 Let v be -6 - -15 - 4 - -2. What is the highest common divisor of v and 7? 7 Suppose 4q - 7 = -2p - 3p, 0 = q + 4p + 1. Suppose -2h - 2h = 5b - 585, 3h + qb = 435. Calculate the highest common divisor of 20 and h. 20 Let n = 17545 - 12118. What is the greatest common factor of 67 and n? 67 Suppose k = -3g - g + 110, 148 = 5g - 4k. Let o = -32 - -32. Let j be 0 + o/(-1) + 56. Calculate the greatest common factor of g and j. 28 Let d = -1757 + 2044. What is the highest common divisor of d and 7? 7 Let t(y) = -y3 + 3y*2 + 6y - 3. Let s be t(4). Suppose 7a - 14 = sa. Suppose -2k = 2k, 1 = m + k. What is the highest common factor of a and m? 1 Let n be 32/18(10 + -4). Let w = -74 + 75. What is the greatest common divisor of w and n? 1 Let t(q) = q*2 + q. Let u(g) = -2g*3 + 5g*2 - g. Let m(o) = -4t(o) - u(o). Let d be m(6). Calculate the highest common factor of d and 10. 10 Let g be 6/15 - (-219)/15. What is the highest common factor of g and 15? 15 Let x be (-2)/(-4) - (-606)/12. Let h = -18 + 54. Let s = 70 - h. Calculate the greatest common divisor of x and s. 17 Let b be (0 + -1)(-9 - -5). Suppose -bl + 0 = -4q - 4, 25 = 4l + 3q. Calculate the highest common divisor of 16 and l. 4 Let a be (-2)/(-1 + 25/27). Let j(n) = 3n - 12. Let q be ((-4)/3)/(1 + (-95)/75). Let t be j(q). Calculate the greatest common divisor of a and t. 3 Let l = 50 - 36. Let p(a) = 10a - 3. Let r be p(8). Suppose -5c + r = 7. What is the greatest common factor of l and c? 14 Let n be ((-2)/2)/((-1)/18). Let p = n - 12. Let w be (32/(-5))/(10/(-75)). What is the greatest common divisor of p and w? 6 Let v(k) = -k*2 - 24k - 17. Let a be v(-19). What is the greatest common factor of a and 416? 26 Let b = 218 - 149. Calculate the greatest common factor of b and 92. 23 Let k(s) = 1. Let y(f) = -f - 10. Let b(c) = -2k(c) - y(c). Let n be b(-7). Let m = 870 + -859. Calculate the greatest common divisor of n and m. 1 Let b(w) = 211w - 19. Let t be b(1). Calculate the greatest common factor of t and 24. 24 Let l be (-16)/64 - (3123/(-12) + 2). What is the highest common divisor of 3 and l? 3 Let i be 6 + 22 - (4 + 2). What is the highest common factor of i and 297? 11 Let c(h) = h*2 + 319. Let f be c(0). Calculate the greatest common factor of f and 29. 29 Let f be (16/(-6))/((-3)/171). Let v be f/6 - 7/21. Let l = 128 - -97. What is the greatest common factor of v and l? 25 Let n be (-1)/(-2) + 18/12. Suppose -b + 3 = 0, z + nb - 20 = -0b. Calculate the highest common divisor of z and 21. 7 Let f(d) = 35d - 28. Let s = -124 - -129. Let a be f(s). Calculate the greatest common factor of 21 and a. 21 Let n be -1(-4)/(-10)-50. Let y be (-2)/(-16) + 1738/176. What is the highest common divisor of y and n? 10 Let r = -680 + 1738. Calculate the greatest common factor of r and 46. 46 Let g = -224 + 280. What is the greatest common divisor of g and 35? 7 Let w be (-3 - (-3 - -1))-35. Let t(g) = -37g + 58. Let l be t(-6). What is the highest common factor of w and l? 35 Suppose 4w = 6d - 8d + 28, -2d + 14 = 2w. Calculate the highest common divisor of w and 112. 7 Let k(a) = 19a - 177. Let f be k(11). What is the greatest common factor of f and 4? 4 Let k(q) = 3q - 6q - 11 - 5q3 + 3q*2 + 12. Let y be k(2). Let f = 29 - y. Calculate the greatest common factor of 31 and f. 31 Suppose 5q - 151 = -t, 4t - 17 = q - 64. What is the highest common factor of 837 and q? 31 Suppose 5h + b - 4 = -2b, 4b + 10 = h. Let s be ((-3)/h)/((-3)/(-6)). Let r = s + 5. What is the greatest common divisor of r and 14? 2 Let y be -20(133/28 + -6). Suppose -2b + 7b = 20. Let p(w) = 6w + 1. Let j be p(b). Calculate the greatest common divisor of y and j. 25 Let g = -401 - -689. What is the highest common factor of 24 and g? 24 Suppose 195q = 194q + 23. Calculate the highest common factor of 391 and q. 23 Let y(n) = -10n + 0n + 0 - 5. Let p be y(-6). Suppose -p = -4a - a. What is the greatest common divisor of 44 and a? 11 Let l(f) = f2 - 25f + 80. Let y be l(22). Calculate the greatest common factor of 518 and y. 14 Suppose -13n + 675 + 1054 = 0. Calculate the greatest common divisor of n and 57. 19 Let v be 10(4 - 39/(-6)). What is the greatest common divisor of 21 and v? 21 Let s be (-10)/(-6)(-72)/(-40). Let v be 35/1454/5. Calculate the highest common factor of s and v. 3 Let w(b) = 180b + 1484. Let l be w(-8). Let f(h) = h3 + 11h*2 + 7h + 3. Let i be f(-10). Calculate the greatest common divisor of i and l. 11 Let h(g) be the first derivative of 2g3/3 - 4g*2 - 2g + 4. Let x be h(-9). What is the greatest common divisor of 29 and x? 29 Suppose -32 = -4q + 52. Let b = -1737 + 1744. What is the highest common divisor of b and q? 7 Suppose -95 - 28 = 2w + 5c, -2w + c = 105. Let d = w - -69. Calculate the greatest common factor of 195 and d. 15 Suppose -3p - p - y = -108, 4p - 4y - 128 = 0. Calculate the greatest common factor of 28 and p. 28 Suppose -63n = -1756 - 1394. What is the greatest common divisor of n and 30? 10 Let g = 672 + -427. Calculate the greatest common factor of 35 and g. 35 Let o be 1 - (-4 + 1 + -1). Suppose 3d + y = -4 + 1, -oy = 4d + 4. Let l = d - -12. Calculate the greatest common factor of 33 and l. 11 Let u(s) = -s3 - 17s*2 + 18s + 5. Let x be u(-18). Suppose 0 = xz - 5w - 35, 11 = 3z - 0w + 2w. What is the greatest common divisor of 15 and z? 5 Suppose -3l + 4o + 21 = 0, l - o = -0l + 8. Let i(x) = x*3 + 11x*2 + 10x + 11. Let s be i(-10). Calculate the highest common factor of s and l. 11 Suppose 0 = -3y + 12y - 135. Calculate the highest common divisor of 3 and y. 3 Let j be (-6)/(-16)(0 + 8). Suppose 2l - 227 = -jp - 0l, 0 = -4p - 2l + 304. What is the highest common factor of p and 7? 7 Let a = -647 - -674. Suppose p = -3p + 864. What is the highest common factor of p and a? 27 Let z be (3 - -2)1674/155. Calculate the greatest common divisor of z and 81. 27 Let k = 189 - 132. What is the highest common factor of 38 and k? 19 Suppose -741q - 168 = -745q. Let v = -11 + 17. What is the highest common divisor of q and v? 6 Let b(z) = 3z2 - 14z + 5. Let d be b(6). Let r = 42 - d. What is the greatest common divisor of 91 and r? 13 Let o(l) = 4l2 - 25l + 27. Let i be o(7). What is the highest common divisor of 176 and i? 16 Suppose 0 = 5u - 232 - 488. Suppose p = -4m + u, 3p - 2p = 0. Suppose 59v = -94v + 26v + 3048. Calculate the greatest common factor of m and v. 12 Suppose 3z + 3y - 187 - 323 = 0, -y = 3z - 512. Calculate the highest common divisor of z and 18. 9 Let u(m) = -100*m - 56. Let	{ "pile_set_name": "DM Mathematics" }
*(3/4)j)4)(-1/16) assuming j is positive. j(-7/16) Simplify (j/j(-14))(-3/4) assuming j is positive. j(-45/4) Simplify (j8)31 assuming j is positive. j248 Simplify (f(-2/9))*5/((ff(-8))/(f/f(4/7))) assuming f is positive. f(398/63) Simplify z/(z(-2/17)/z)z/(z/z(-4))(z(-1))28 assuming z is positive. z*(-508/17) Simplify (j/(j/(j/(jjjjj(2/37))jjj))j(-11)/j)37 assuming j is positive. j(-446) Simplify dd/(d/d*(2/55))ddd22 assuming d is positive. d(1377/55) Simplify ((m*(2/7)m)/((mm3/mm)/m))/(m*(-1/6)(m/m*(4/3))/mm) assuming m is positive. m*(-17/14) Simplify (hh*0/hhh/(hh*3)hh)/((h6/h)/h(5/4)) assuming h is positive. h(-15/4) Simplify ((y0y)(-43))(2/9) assuming y is positive. y*(-86/9) Simplify (rr/r*(2/29)r(-6))(-3/19) assuming r is positive. r(354/551) Simplify (y(-2))*(1/19)y(yyyyy(-3)/y)/yy/(y*(-7)/yyy) assuming y is positive. y(131/19) Simplify (o(1/3)/o1)/(o(-2/5))22 assuming o is positive. o(122/15) Simplify (kk(-4))/k(4/9)(k(-2/3)/k)(-2/3) assuming k is positive. k(-7/3) Simplify (yy*(16/3))/yyyy(2/27) assuming y is positive. y(200/27) Simplify c*(1/19)c13 assuming c is positive. c(248/19) Simplify (y/((yyy*(-6))/y)y)/(yy(2/3))(y*(-1)y)(14/9) assuming y is positive. y(16/3) Simplify ((j/(j(-1/5)/j))/(j(-2/5)j))/((j(1/3)j)/(j/(j/j*(-1/8))jj)) assuming j is positive. j(257/120) Simplify (s(2/13))(2/19) assuming s is positive. s(4/247) Simplify (ww0)(1/75)/(ww(-2/23)www*(-3)w) assuming w is positive. w*(-1552/1725) Simplify j/(jjj/(j/j3)jjj)j(-4)j(j(-1))(9/2) assuming j is positive. j(-29/2) Simplify q3q/(q/(q/(qq(12/11)))) assuming q is positive. q(21/11) Simplify (ii(i2/ii)/i)(6/11) assuming i is positive. i(18/11) Simplify ((j(2/25)/j)/j)41 assuming j is positive. j(-1968/25) Simplify (k/(k/k(-11/2)k))/((kk(2/11))/k) assuming k is positive. k(-147/22) Simplify (f(-1))(-1/34)/(f*3f(4/9)) assuming f is positive. f(-1045/306) Simplify ((a/a3)(-1/7))(-50) assuming a is positive. a(-100/7) Simplify (oo(-8/7))/oooo(-7/4) assuming o is positive. o(-25/28) Simplify ((w*(-1)w)(-2/59))(-20/3) assuming w is positive. 1 Simplify (k(1/3))(-2/13)(k/k(2/5))/kk(2/9) assuming k is positive. k(-134/585) Simplify (w*(-3/10)/ww(w/(ww(-3)))/w)49 assuming w is positive. w(833/10) Simplify (d(-4/5)d)/d(-2) assuming d is positive. d(11/5) Simplify n(-37)/(nn/n16) assuming n is positive. n(-23) Simplify (((((w/(w/w*(-5)))/w)/w)/w)/ww*(-2/7))/(w(w/((w*(-2/5)/ww)/w))/w)47 assuming w is positive. w(-4273/35) Simplify (s/s*(-7))/ss*2s/s*(-9)sss(-5) assuming s is positive. s16 Simplify (n/(nn(13/3)nn))(-43) assuming n is positive. n(817/3) Simplify (x/x(-20))/x(-1) assuming x is positive. x22 Simplify (ll*17/l)/(l/(ll(-5/6))) assuming l is positive. l(97/6) Simplify ((q/(qq/q(6/11)))/qq)(-2/25) assuming q is positive. q(2/55) Simplify (ww(2/3)w)*(3/7)/((w/((w(ww/w1)/w)/ww))/(www(-2/5))) assuming w is positive. w(96/35) Simplify ((g/(g/(gg(-7))))/g)25 assuming g is positive. g(-175) Simplify (u/(u/(u/(u/(u(-16)/u)))))/(u((u*(-1/5)/u)/u)/uu) assuming u is positive. u(-79/5) Simplify n(5/3)/(n/(n/n*(5/2)nn)) assuming n is positive. n(7/6) Simplify (pp(p/(p(-5)p))/p)/(pp16pp) assuming p is positive. p(-13) Simplify ((g(-1/2))(-20))(-4/9) assuming g is positive. g(-40/9) Simplify (j(-2/11)/j(-1/6))(-1/17) assuming j is positive. j(1/1122) Simplify (((t/t2t)/t)/tt)(-47) assuming t is positive. t47 Simplify ((qq(-3/11)/q)/q)/(q(2/33)/q) assuming q is positive. q(-1/3) Simplify (x(4/9)/x)/(x(3/17)/x) assuming x is positive. x(41/153) Simplify (gg/g19)/(gg/g11) assuming g is positive. g(-8) Simplify (o/o0)(-2/137)/(o*(-1/2)o)(3/11) assuming o is positive. o(-455/3014) Simplify (f*23f)/fff(1/12)/f assuming f is positive. f(277/12) Simplify (x/(x*(-1/7)/x)x/(x/(xxxx/(x/(xx*(-1/12)))xx)))(-2) assuming x is positive. x(-677/42) Simplify (x(2/3)/x5)/(x(1/3))(-2/75) assuming x is positive. x(-973/225) Simplify (((d/(dd/(d/(d/((d*2d)/dd)))dd)d)/d)/(dd(-5/2)d))/((d*9/d)/(dd(2/11))) assuming d is positive. d(-139/22) Simplify tttttt15(ttt/(t/((t/((tt/t(3/14))/t))/tt)t)t)/t assuming t is positive. t(297/14) Simplify n(-11/3)n(-2/9) assuming n is positive. n(-35/9) Simplify ((d/(d/d(-13)))/(d/(d(-3/8)dd)d))(1/51) assuming d is positive. d(-107/408) Simplify ((k*1k)/kk3)(-18/11) assuming k is positive. k(-72/11) Simplify (s(-7/3)s)/(s/((s*(-3/7)s)/ss)) assuming s is positive. s(-37/21) Simplify (d(3/4)/(d/((d/(dd(-6/5)))/d)))(4/21) assuming d is positive. d*(-1/105) Simplify ((dd5)/(d(-1/9)/d))(2/47) assuming d is positive. d(128/423) Simplify (g/(g/(((((g/(g(gg*(3/23)g)/gg))/g)/g)/g)/g)))/(((g/(g/(g(gg21)/g))g)/g)/g) assuming g is positive. g(-624/23) Simplify (t(-5)/t)(2/91) assuming t is positive. t(-12/91) Simplify c(-9)/(c(-13)/ccc) assuming c is positive. c3 Simplify v15/(vv/(v/v(-17))) assuming v is positive. v31 Simplify (ww(-3))/(w(-2/89)/w) assuming w is positive. w(-87/89) Simplify u28/((u(11/6)/u)/u) assuming u is positive. u(169/6) Simplify (a*(-1/19)aa(1/4))29 assuming a is positive. a(2639/76) Simplify (hh/(h/h(-8/7)))/h(-14) assuming h is positive. h(97/7) Simplify i(-11)/i*(-7)(i(-1/2))18 assuming i is positive. i*(-13) Simplify ((ss*(-2/23))/ss/(s(s/(ss/(ss/(s/(s(-5)/s)s)s))s)/s))/(ss(1/3)/s)42 assuming s is positive. s(-186/23) Simplify (x(-11)x(-1/5))(-43) assuming x is positive. x*(2408/5) Simplify ((kk*(-3)kk)/(kk/(k*(-5/3)/k)))/(((k/(k/(kk/k*0)))/kkk)/k(-2/7)) assuming k is positive. k(-167/21) Simplify xxx/(xx*20)xx(-2) assuming x is positive. x(-19) Simplify (a0)25/(a6a(aaa4a)/a) assuming a is positive. a(-13) Simplify x(-1/3)/(xx/x(-7))x*4x(2/5) assuming x is positive. x(-74/15) Simplify (t/(t(tt*(-2))/tt))/(t(-18)/t) assuming t is positive. t20 Simplify (l*3/(l/(l/(ll*(1/5)l))))34 assuming l is positive. l(136/5) Simplify aa(-5)a/(a/a*4)a(2/7)/a(-6) assuming a is positive. a(44/7) Simplify (j(-2/7)/j)/(j3/j) assuming j is positive. j(-23/7) Simplify (s/(ss11s)ss(-11))/(s(-1/4))(-5/3) assuming s is positive. s(-269/12) Simplify ((y0/y)15)(2/3) assuming y is positive. y(-10) Simplify ((p/p(-2/3))(-5/8))(-7) assuming p is positive. p(175/24) Simplify (x2/x)(-25) assuming x is positive. x*(-25) Simplify (nnn(-3))/nn*(-5/6)(n/(n/n*(-3))n)/nn(-3)n assuming n is positive. n(-47/6) Simplify (m(2/19))42 assuming m is positive. m(84/19) Simplify (o(1/8)/o(1/5))(-50) assuming o is positive. o(15/4) Simplify ((z/z(-3/4))/z)(1/6) assuming z is positive. z(1/8) Simplify ((((a/a(-1))/aa)/a)/(a(-4)a))39 assuming a is positive. a156 Simplify (ss5sss/s*(2/5)s)/(s*0s2) assuming s is positive. s(38/5) Simplify (((g*(-2/15)/g)/gg)14)35 assuming g is positive. g(-1666/3) Simplify (((l/l(2/19))/l)/(ll(1/4)))/(l(-7)l(-1)) assuming l is positive. l(505/76) Simplify (r(-2)/r)41 assuming r is positive. r(-123) Simplify ((b28b)/bb)/(b/((b((b((b*(-2/7)b)/b)/b)/bb)/bb)/b)b) assuming b is positive. b(187/7) Simplify (n(-1/7)/n)/nnnn*(-17)n assuming n is positive. n(-113/7) Simplify ((j0j)/j)(-31)(j*0j)2 assuming j is positive. j2 Simplify (o*(-4)oo(-8)o)13 assuming o is positive. o(-130) Simplify ff(-25/4)fff17 assuming f is positive. f(55/4) Simplify (y(-5/3)/y)29 assuming y is positive. y(-232/3) Simplify j(-1/3)/j*(-6)(jj2j)(3/2) assuming j is positive. j(35/3) Simplify ((f/(f*(-2/21)f))/ff(-10)/f)*(-2/11) assuming f is po	{ "pile_set_name": "DM Mathematics" }
? 20 What is the highest common divisor of 27 and 18729? 9 Calculate the highest common factor of 6048 and 3787. 7 Calculate the highest common divisor of 14 and 118. 2 Calculate the greatest common factor of 10 and 642340. 10 Calculate the highest common factor of 15 and 1373. 1 Calculate the greatest common divisor of 9922 and 484. 242 Calculate the greatest common factor of 21255 and 55. 5 What is the highest common factor of 523536 and 168? 24 What is the greatest common divisor of 10701419 and 79? 79 What is the greatest common factor of 10207 and 1298? 59 What is the highest common divisor of 60730 and 30? 10 Calculate the highest common divisor of 1110 and 374625. 555 What is the highest common factor of 47508 and 19581? 321 Calculate the greatest common divisor of 2564 and 1060855. 641 What is the greatest common factor of 50552 and 267? 89 Calculate the highest common divisor of 373274 and 14476. 1034 What is the greatest common divisor of 1075 and 399083? 43 What is the highest common divisor of 25 and 27655? 5 Calculate the highest common factor of 21234 and 222. 6 Calculate the greatest common divisor of 477 and 45633. 159 Calculate the greatest common factor of 59390 and 3. 1 What is the greatest common divisor of 23489 and 830? 83 Calculate the highest common factor of 1350 and 1850. 50 Calculate the highest common factor of 412844 and 232. 116 What is the greatest common factor of 350 and 421450? 50 What is the greatest common divisor of 2154610 and 10? 10 What is the highest common factor of 1617 and 51891? 147 What is the greatest common divisor of 442 and 5174? 26 What is the greatest common divisor of 24404 and 16? 4 What is the highest common factor of 167203 and 2849? 37 Calculate the highest common divisor of 3882 and 218686. 1294 Calculate the highest common divisor of 42 and 186424. 14 Calculate the greatest common factor of 208 and 1840. 16 Calculate the greatest common factor of 6303540 and 1240. 620 What is the greatest common divisor of 104 and 665418? 26 Calculate the highest common divisor of 43004 and 38869. 827 What is the highest common divisor of 446 and 976? 2 What is the greatest common factor of 5488 and 64? 16 What is the greatest common factor of 4452 and 1932? 84 Calculate the highest common factor of 3972614 and 218. 218 What is the highest common factor of 481264 and 16? 16 What is the highest common divisor of 9782280 and 80? 40 What is the highest common divisor of 1224 and 26469? 153 Calculate the greatest common factor of 844188 and 206. 206 Calculate the highest common factor of 287 and 5699. 41 Calculate the greatest common factor of 506454 and 302. 302 What is the greatest common factor of 3977 and 164? 41 What is the greatest common factor of 1 and 7? 1 What is the highest common divisor of 2704 and 3887? 169 Calculate the greatest common divisor of 252 and 4283136. 36 Calculate the highest common factor of 13262 and 608. 38 Calculate the highest common factor of 316357 and 159. 53 Calculate the highest common divisor of 611 and 10088. 13 Calculate the greatest common divisor of 14592 and 19392. 192 What is the greatest common divisor of 927413 and 379? 379 What is the greatest common factor of 2868020 and 15? 5 Calculate the greatest common factor of 748 and 517. 11 Calculate the greatest common divisor of 62205 and 3510. 195 What is the highest common divisor of 4 and 1703? 1 Calculate the highest common factor of 8688 and 431142. 1086 Calculate the greatest common factor of 43599 and 5. 1 What is the highest common divisor of 2431 and 576862? 143 Calculate the highest common divisor of 638 and 3751. 11 Calculate the greatest common divisor of 524 and 621988. 524 What is the greatest common divisor of 993800 and 240? 40 Calculate the highest common factor of 25326 and 336. 42 Calculate the highest common divisor of 1195 and 1380. 5 Calculate the greatest common divisor of 7965 and 23305. 295 Calculate the highest common factor of 654090 and 150. 30 Calculate the greatest common factor of 73117 and 7038. 391 What is the highest common divisor of 94 and 306346? 94 What is the highest common divisor of 174 and 1032429? 87 Calculate the highest common divisor of 468809 and 2783. 253 Calculate the highest common divisor of 260 and 39754. 26 What is the greatest common factor of 3045 and 2873175? 435 Calculate the greatest common factor of 2460 and 431484. 492 What is the greatest common factor of 40137 and 34? 17 What is the greatest common factor of 62700 and 171? 57 Calculate the greatest common factor of 364 and 883246. 182 What is the highest common divisor of 160 and 145360? 80 Calculate the greatest common divisor of 109 and 17881232. 109 What is the greatest common divisor of 17995 and 12200? 305 Calculate the highest common factor of 308 and 65252. 44 Calculate the highest common factor of 124 and 108593. 31 Calculate the highest common factor of 13090 and 18955. 85 Calculate the highest common divisor of 562432 and 256. 256 Calculate the highest common factor of 478436 and 196. 196 What is the highest common factor of 378 and 725706? 54 What is the greatest common factor of 33361 and 292? 73 Calculate the highest common divisor of 151283 and 187. 187 Calculate the greatest common divisor of 519282 and 34. 34 What is the greatest common divisor of 24228 and 36? 36 Calculate the highest common factor of 23392 and 102. 34 Calculate the greatest common divisor of 8060 and 110360. 620 Calculate the greatest common divisor of 44833 and 2933. 419 What is the highest common factor of 60 and 81020? 20 Calculate the highest common divisor of 280384 and 1536. 64 What is the greatest common divisor of 108 and 2988252? 108 Calculate the greatest common factor of 660 and 8450. 10 What is the greatest common divisor of 50288 and 2800? 112 Calculate the greatest common divisor of 21 and 65912. 7 Calculate the greatest common divisor of 196 and 5327. 7 What is the highest common divisor of 220 and 20856? 44 What is the highest common divisor of 23409 and 405? 81 Calculate the greatest common factor of 83838 and 34854. 942 What is the highest common divisor of 551 and 126711? 19 What is the highest common divisor of 101277 and 484? 121 Calculate the greatest common divisor of 16 and 244692. 4 What is the greatest common divisor of 82474 and 2408? 602 What is the highest common divisor of 2 and 1? 1 What is the greatest common divisor of 520 and 83320? 40 Calculate the highest common divisor of 141825 and 62. 31 Calculate the highest common factor of 616 and 4731496. 616 What is the greatest common divisor of 224 and 175238? 14 Calculate the greatest common factor of 20339 and 7568. 473 Calculate the highest common divisor of 1396 and 20591. 349 What is the greatest common factor of 4248 and 70344? 72 What is the greatest common factor of 260 and 265460? 260 What is the highest common factor of 383 and 6527086? 383 Calculate the greatest common factor of 602 and 59899. 301 What is the highest common factor of 72 and 66840? 24 What is the greatest common divisor of 42 and 410298? 42 What is the greatest common divisor of 5632 and 1804? 44 Calculate the greatest common divisor of 86410 and 230. 10 Calculate the highest common factor of 62700 and 36. 12 What is the greatest common divisor of 4 and 1731296? 4 Calculate the greatest common factor of 17890004 and 44. 44 Calculate the highest common factor of 1037 and 12871. 61 What is the highest common factor of 13837 and 1919? 101 Calculate the greatest common divisor of 1225 and 92855. 245 What is the greatest common divisor of 3590762 and 42? 14 Calculate the greatest common factor of 245036 and 176. 44 What is the highest common divisor of 271488 and 7728? 336 Calculate the highest common factor of 4640 and 12470. 290 Calculate the highest common factor of 82 and 466826. 82 What is the greatest common factor of 3 and 28947? 3 What is the highest common divisor of 268 and 368902? 134 Calculate the highest common factor of 133 and 27911. 19 Calculate the highest common factor of 350 and 1021475. 175 Calculate the greatest common divisor of 485 and 1967645. 485 Calculate the greatest common divisor of 1468 and 32663. 367 What is the greatest common divisor	{ "pile_set_name": "DM Mathematics" }
. 127 What is (4811/(-340) - -14)/(1 - (-316)/(-304))? 19/5 Evaluate (-5089742)/(-1757460) + (-1)/(15/(-2)) - 3. 1/34 Evaluate -44 + (-44 - -76 - -38). 26 Calculate 1617/(-14)(129/(-18) - -8)(-16)/(-20). -77 What is the value of 3/(-108)30348/13488? -1/16 Calculate 4/60 - 0 - (-30171)/(-512640). 1/128 (-117)/(-104) + (-16968)/6464 -3/2 What is 247/3(-19622)/127543? -38/3 What is the value of 15 - (-13896)/(-936) - -106(-22)/(-52)? 45 (-1 - 39/(-14) - 406/1421)/((-156)/13208) -127 Evaluate (6/(-33) + 2 + 68/11)3122/(-4460). -28/5 Calculate (-3)/10(-14 - (-3136)/105 - (-21 - -37)). 1/25 What is 2/((3243/966)/47)? 28 What is -18((-1183)/(-1014) - 4/6) - 44? -53 Calculate 6/(-20)(-9522)/621. 23/5 Calculate (-1 - -4) + -28 - (-36 + (-378)/(-14)). -16 What is (-174)/(-47 - -4223) + 7(-39)/(-3096)? 2/43 (16176/1152 + (-6)/16)/((-16)/(-48)) 41 Evaluate (-888)/11103/((-54)/30). 4/3 Calculate (-3)/3702(4620/(-126))/(-11). -2/37 Evaluate ((-171)/12128/144 - -1)(-648)/180. 42 Calculate (-14 - -11) + -17(-4)/383895/(-820). -23/2 What is ((-17)/(306/4))/((-3)/378)? 28 387/172 + (-944)/(-64) 17 What is the value of 765/128612/(-6459)? -85 What is the value of 36 + (-1 - 3) - 29? 3 What is the value of (-140(-53)/1590)/(-7)? -2/3 What is the value of (5/(-3) - (-46)/8) + -4 - (-189)/(-12)? -47/3 Evaluate ((-1)/((-87)/(-2436)))/(5 - 4). -28 576/(-10)43690/39321 -64 -27 - ((-46)/(-2) - (-6 + 51)) -5 Evaluate ((-24)/46)/(850/(-48875)). 30 What is ((-20276)/518)/137(326 + 3)? -94 (10/8)/(7 + ((-2616)/(-288) - 16)) 15 2043/(-1362)(-34)/(-12) -17/4 61 + -9 + 16 + 2352/(-196) 56 What is (-81)/10368-736(30/18 - (-2 + 1))? 46/3 Evaluate -10 - 4 - (473/(-95) + (51 - 60)). -2/95 What is (-20658)/462 - (-13 + 93/7)? -45 What is -2(90/54 - 3234/(-252))? -29 What is the value of (13/1)/(50/(-2625) - (-2889)/2835)? 13 Evaluate 736/66 + (-14616)/189 + 64. -24/11 What is the value of 14/60 - (-2)/(-6) - (-133 - 44260034/(-333060))? 2/183 Evaluate ((21 + 6 - 41) + (-75)/(-3) - 21) + -42. -52 What is the value of 240/(-100)((-2240)/(-252))/(-8)? 8/3 Calculate (-50)/18 - 820380/16335. -53 Calculate 16184/202878 + ((-8)/(-26))/(-2) + 515/27. 19 Calculate -3(-15)/2584/730. 18 What is (221 + 74)(-9 - 401/(-25) - (-7)/(-1))? 59/5 Calculate (3694/16623)/((-24)/54). -1/2 Calculate (318/26818)/((-6)/4)(-22)/82. 1/23 Evaluate ((-2)/8)/(((-51)/(-82824)14)/(-2)). 58 Evaluate (((-13608)/396 - -34) + (-38)/(-165))/((-36)/(-15)). -1/18 What is the value of (4032/180)/((-70)/(-175))? 56 ((-72944)/(-139680) - ((-13)/(-10) + -1)/1)3 2/3 Evaluate (4/6 + (-20)/105)/((-9357)/43666). -20/9 What is (-576)/132 + -4 - (-4 + -3 + 3)? -48/11 Evaluate (3820/9932)/(10/(-650)). -25 What is the value of ((-5)/(-15)0)/(357 - 361)? 0 What is the value of 213/((-7029)/(-924)) - -18? 46 61/45 + (-64940)/81175 5/9 What is 5/((-1860)/45 + 33)? -3/5 What is the value of (2/135)/(7/(-245)140/(-40))? 4/27 Calculate 48/(-9)(-630)/(-171360). -1/51 Calculate -5((-6)/(-8) + (-11529)/8540)-19. -57 Calculate (-981)/141 - (5 - (-126)/(-9) - (-49 - -47)). 2/47 What is the value of ((-162)/486)/(-4 - (-1780)/444)? -37 Calculate (99/(-2) + 0)(-219 - (-23 - 194)). 99 Evaluate (58 + 9847/(-172))/(0 + (-14)/(-8)). 3/7 Evaluate (30/(-21))/(13/4618/140595). -100 ((-838512)/29115)/(3 - (-36)/(-15)) -48 What is (-16)/3367(5 + (-170)/115 + -3)? -4/23 What is the value of ((-5664)/336 - -25)/((-8)/56)? -57 (2856/(-12852))/(230/234 + -1) 13 Evaluate 1176/(-49)4092/(-992). 99 What is (-51)/(-6) + 10549/(-610)? -1/2 What is 10/12 + (24129/(-168) - -45)/(18/8)? -43 What is (((-114)/646-17)/(-60))/(16/(-20))? 1/16 What is (-1107)/(-70848) + (-314)/3712? -2/29 Calculate (((-2340)/3)/26)/(0 - -3) + 2 + -6. -14 Calculate (8 + 19)/(((-11)/(-44))/((-24)/(-32))). 81 Calculate (15 - (-2211)/(-143))/((22/(-130))/11). 30 (-2204)/76 - -185/(-15)4/8 -32 What is the value of ((-240)/216 + 520/630)5/(-35)3? 6/49 Evaluate (0 - (-12)/4010)/(((-245796)/143381)/(40/14)). -2/401 What is the value of (-43)/430(-26 + 16)-52? -52 Calculate 1453/1017149/1. 7 222/4(66 - 10600/159) -37 Calculate 5/(-25) + 476/(-20) + 35/(-10)-2. -17 Calculate (-660)/1100(-75 - 0/(-1)). 45 What is (5 - (-5 - -11))/(2(4 + 66/(-20)))? -5/7 Evaluate (-135)/27 + (-4396)/490 - 126/(-9). 1/35 Calculate ((-25)/(-350)42/4)/((-49)/392). -6 Calculate (-11580)/(-4825) + 3792/(-1480). -6/37 (-170)/(-2) + (6489 - 6651) -77 What is the value of (-9720)/239760 - (-5541)/(-222)? -25 Calculate 3/(-30)5026/7 - (-109)/(13080/(-144)). -73 Calculate -10 + (-104100)/6593 + 52/2. 4/19 (-1 - -4)/(2723416/35840 - 26) -40 20 + 3 - ((-8)/(-20) - 268/20) 36 What is (10/(-22) - 0)/(-381 + 2183508/5764)? 5/24 What is (-3264)/48 - (26 + -10 + -1)? -83 What is (19/(-152))/((-24182)/(-3424))? -2/113 What is (31/(1488/32))/(-26/(-522))? 29 What is the value of 4/505 + (1215/300 - -59)? 60 Calculate ((6/10)/(456/380))/(((-12)/(-4))/360). 60 What is 47484/7914(((-3)/15 - (-1699)/(-2130)) + 1)? 1/71 What is 6486/684 + 20 + 708/(-24)? -1/57 (-9)/(-3) + (-616)/220 - 2/452 1/9 What is the value of (-50492)/871 - (232 + -290)? 2/67 (-110544)/90944 + (-5)/(-4) 1/29 (7363/111 - 43)6/10 14 What is 91 - ((-22)/(-4))/(49210/80660)? -2/133 Evaluate ((-78)/(-7))/(53010/12369). 13/5 What is the value of 0/(4 + (-35)/7) + (-144)/96? -3/2 (-171)/(-2)(2/(-5))/((-1725)/(-2875)) -57 Evaluate 186/(-171)(-26676)/(-1368) - -22. 15/19 44/(-198)(-163 - 35) 44 What is the value of (0 + (-48)/(-7))(-289394)/(-186039)? 32/3 42/(-546) - 10707/1079 -10 What is (5 - ((-378)/34 + -2)) + (-90)/765? 18 Calculate (34/(-119))/(43/(74347/(-38))). 13 What is -5 + 14 - -2((-4914)/1224 + 2/(-4))? -1/34 Evaluate (4968/345)/((-852)/180 - -5 - (-6)/(-9)). -36 Calculate 1404/(-135) + 122670/11925. -6/53 What is the value of ((43956/(-330))/111)/((-36)/(-20))? -2/3 Evaluate (3764 - 3788)/((-1)/(-2)). -48 2 + -20(-22)/(-220) - 69 -69 Evaluate 5 + (3/30 - 121/110)109. -104 Evaluate ((-21905)/(-455) - 48) + (-5 - (-3148)/651). -2/93 What is the value of 147735/(-4690)(-3)/14? 27/4 What is ((-6)/(-11))/((-252)/(-224))(-60)/(-80)? 4/11 What is the value of 1700190/56673 + 1 + (25 - -1)? 57 What is the value of (4/16)/((-10)/(-440)) + (1 - 45)? -33 What is the value of 49/(-3)((-4)/(-20) - ((-1554)/15)/37)? -49 What is 3 + (1 + 35 - (336 + -355))? 58 ((-1623360)/672)/89 + (-6)/(-28)-4 -28 What is ((-112)/253 - (-9138)/35029)/(10/11 - 1)? 2 (-8)/3927 + 6/(-8736)-124 -3/52 9 - ((416/(-216))/26 - (-5714)/594) -6/11 What is 6/(-99) - (-18790)/2310-7? -57 Evaluate 6(2/(-9))/(259(-17)/(-357)). -4/37 What is (-4450)/445 - (6(-6)/(-24) - (-70)/4)? -29 What is the value of -24 + -1 - ((-120923151)/16497)/293? 2/117 Calculate 18040/(-1968) - (-6)/36. -9 What is (40762/267 + -34)/(16/(-12))? -89 What is 12 + 12 + -88 + 116? 52 (3/12)/(2037/(-350364)) -43 What is 9/((-108)/56) + (111 - (-505839)/(-4761))? 2/23 Evaluate (18745/(-5940))/(510/(-300)). 5/6 What is 12 + 810/60216/(-243)? 0 What is ((-4 - 12) + (-1 - -14))/(((-54)/80)/(-9))? -40 What is the value of (-3 + 36/30)/((4719/(-110))/(-11))-26? 12 (-8)/(-3) - (35 + 30/((-1620)/(-414))) -40 (-9 - -3 - (-1000)/50) + -44 -30 (85 + (-61683)/725)/((-4)/(-10) - (-9)/(-30)) -4/5 ((-178467)/(-479880) + 18/(-48))/((-2)/(-6)) -2/215 Calculate 211/(-180) + 3(-39)/(-585) + (-2)/(-2). 1/36 1 + 117 - (-1727104)/(-14672) 2/7 (6 + 240/(-28) - -15)/(155/350) 58 Calculate ((2 - 1)240/(-2016))/(-1 + (12 - 6)). -1/42 What is 6(-2)/(-4)11/3 - (-88500)/(-8496)? 7/12 Evaluate ((-8)/(-6) - 3287/3633)/((-9)/(-7)). 1/3 Evaluate -7047 + 7130 - 45/(-3). 98 What is the value of (3 - (-300)/5)74/222? 21 What is the value of (-59 - (-2378)/41)0? 0 Calculate (-14)/(-322)3496/(-33744). -1/222 Evaluate ((-683100)/(-20295))/(-138)-11/20. 1/82 -6514104/7826 + 121 27/7 What is (-24)/18(-9405)/(-330)? -38 Evaluate -23 - (42 + -62 - 132/(-6)). -25 What is (-1)/4 + (-333)/(-13986)*(-747)/(-6)? 19/7 Calculate 6 + (46 - 48) + 29. 33 Calculate (-1)/((-3147)/150 + 111 + -90). -50 What is the value of 336/64 + 31900/(-3248)? -32/7 Evaluate (6/(-59))/((-2302)/271636). 12 (10608/884)/(16/12) 9 Evaluate (-64)/(-240) - 361984/3840. -94 What is the value of (66/77)/(-42	{ "pile_set_name": "DM Mathematics" }
he terms in 21r - 56r + 18r + 21r. 4r Collect the terms in -185 - 6m + m*2 + 6m. m*2 - 185 Collect the terms in 179d*3 + 197d*3 - 124d*3. 252d*3 Collect the terms in 2400 - 2400 - 2o*3. -2o*3 Collect the terms in 0q*2 - 252 - 5q2 - q2. -6q2 - 252 Collect the terms in 3 + 2 - 5 + 3x*3. 3x*3 Collect the terms in -1383a - 1384a + 4142a - 1375a - 2a*3. -2a*3 Collect the terms in 246a*2 + 244a*2 - 488a*2. 2a*2 Collect the terms in -14x + x - 2x + 0x. -15x Collect the terms in -18o*3 - 14o*3 - 6332o + 6332o. -32o*3 Collect the terms in -3b*2 - 4b*2 + 5b*2. -2b*2 Collect the terms in 357v*3 - 173v*3 - 182v*3. 2v*3 Collect the terms in 11i*2 + 90 + 96 - 186. 11i*2 Collect the terms in 57g - 21g - 20g - 15g. g Collect the terms in -1 + 0 - p + 5p. 4p - 1 Collect the terms in 5l*2 - 2l*2 + 3l*2. 6l*2 Collect the terms in -10c*3 + 9c - 7c - 2c. -10c3 Collect the terms in -504w*3 + 83w*3 - 12w*3. -433w3 Collect the terms in j3 + 4j3 + 2j*3 + 5j*3. 12j*3 Collect the terms in 3l + l + 258 - 150 - 108. 4l Collect the terms in -11d + 50d - 37d. 2d Collect the terms in -1602b*2 - 964b*2 - 790b*2. -3356b*2 Collect the terms in -2548 + 2548 - 2k2 + k2. -k*2 Collect the terms in -86 - 13p + 181 - 95. -13p Collect the terms in -4j + 4j - 33j*2. -33j*2 Collect the terms in 45g - 71g + 30g. 4g Collect the terms in 25854m + m*3 - 25854m. m*3 Collect the terms in -3d*2 + 4d*2 + 7d*2 - 10d2 + d2. -d*2 Collect the terms in 2x*3 - 197x*2 + 0x + 0x + 197x*2. 2x*3 Collect the terms in -26l + 25l - 14l. -15l Collect the terms in 12 + 15 + 39 + h. h + 66 Collect the terms in 17q*2 + 2 - 17q*2 - 6q*3. -6q*3 + 2 Collect the terms in 40n - 1 + 4 + 1. 40n + 4 Collect the terms in 1411u*2 + 0 + 0 - 1416u*2. -5u*2 Collect the terms in 2l + 0l + 0l + 0l + 2l. 4l Collect the terms in 453o + 724o + 134o. 1311o Collect the terms in -10y*2 + 7y*2 - 4y*2. -7y*2 Collect the terms in -97x - x - 6x. -104x Collect the terms in 3m - 5m + 3m - 14m*2 - 2m. -14m2 - m Collect the terms in -54a + 215a - 110a. 51a Collect the terms in s2 + 5s2 - s2. 5s2 Collect the terms in -c2 - 2398c + 2398c. -c2 Collect the terms in 2l*3 - 2l*3 - 15l*3. -15l*3 Collect the terms in -104y - 3 + 101y + 3. -3y Collect the terms in n3 + 317646 - 317646. n3 Collect the terms in 2d2 - 4d*2 + 0d*2 - 2d*2. -4d*2 Collect the terms in 73j + 89j - 139j. 23j Collect the terms in -x + 4x + x - 3x. x Collect the terms in -x + x3 + 4 - 4 - 3x*3. -2x*3 - x Collect the terms in -11f*2 - 236f + 236f. -11f*2 Collect the terms in 22 + 4q*3 - 48 - 5q3 + 26. -q3 Collect the terms in -235 - h*3 + 68 - 2h*3. -3h*3 - 167 Collect the terms in 96y*3 - 38y*3 - 62y*3. -4y*3 Collect the terms in 0 + 0 + 123c. 123c Collect the terms in -113 + 228 + 29g - 114. 29g + 1 Collect the terms in -39w - 1 + 1 - 174w. -213w Collect the terms in 153m3 - 510m*3 - 88m*3. -445m*3 Collect the terms in 9c + 1 + 4 - 3. 9c + 2 Collect the terms in -34a*2 + 8a*2 + 9a*2 + 8a*2 + 14a*2. 5a*2 Collect the terms in 58 + 8r - 6r + 4. 2r + 62 Collect the terms in 47p + 37p + 0p2 - 11p - p2. -p2 + 73p Collect the terms in d2 + 2 - 2. d2 Collect the terms in -10j*2 + 6j*2 - 6j*2 + 0j*2. -10j*2 Collect the terms in -16r*2 + 6 + 5r*2 - 6. -11r*2 Collect the terms in -102f*2 - 1 - 101f*2 + 168f*2. -35f*2 - 1 Collect the terms in -2c*2 + 4c2 - c2 + 4. c*2 + 4 Collect the terms in 1 + 127s*3 - 129s*3 - 1. -2s*3 Collect the terms in -63 + 19 + 44 + 27m*3. 27m*3 Collect the terms in -9 + 11 + 10x - 10x - 2x*2. -2x*2 + 2 Collect the terms in 3455t*3 + 1337t*3 + 1528t*3. 6320t*3 Collect the terms in 6n*2 - 3n*2 - 300300n + 300300n. 3n*2 Collect the terms in -501s*2 - 512s*2 + 1010s*2. -3s*2 Collect the terms in -61a*3 + 117a*3 - 52a*3. 4a*3 Collect the terms in -1 + 563u*3 + 1. 563u*3 Collect the terms in -45f*3 + 25f*3 + 26f*3. 6f*3 Collect the terms in -4092l*2 + 1 - 1820l*2 - 1. -5912l*2 Collect the terms in -4l + 6l + 9l - 6l - 4l. l Collect the terms in 37s2 - 2 + 4 - 35s*2 - 2. 2s*2 Collect the terms in 0g*2 + 18379g*3 + 0g*2 - 18377g*3. 2g*3 Collect the terms in 5q*3 + 1281q*2 - 1281q2 - q3. 4q3 Collect the terms in 36c*2 + 14c*2 - 5c*2. 45c*2 Collect the terms in 2p*3 + 0p3 + p3 + 22. 3p3 + 22 Collect the terms in -5w*2 - 1452w + 1452w - 9w*2 + 4w*2. -10w*2 Collect the terms in 17t*3 + 21t*3 + 21t*3. 59t*3 Collect the terms in -12t*2 + 20t*2 - 3t*2. 5t*2 Collect the terms in -3s*3 - 3s + 6s3 + 3s - 5s3. -2s*3 Collect the terms in -5b*3 + 29b*3 + 37b*3. 61b*3 Collect the terms in -67s*3 + 125s*3 - 4 + 4. 58s*3 Collect the terms in -172 + 339 - 167 - 2b. -2b Collect the terms in 4h*2 - 1254h + 2510h - 1256h. 4h2 Collect the terms in -28 - 23 + 51 + 87s*2. 87s*2 Collect the terms in -37n - 44n - 5 + 62n + 5. -19n Collect the terms in 20l*3 - 607 + 607. 20l*3 Collect the terms in -2x - 6x + 11x - 5x + 3x. x Collect the terms in -8y - 2 + 2. -8y Collect the terms in -h*2 + 0h*2 + 5h*2 - 6h*2. -2h*2 Collect the terms in -221r + 114r - 33 + 108r. r - 33 Collect the terms in -652h + 11h*3 + 652h. 11h3 Collect the terms in -2f + 41f + 0 + 0. 39f Collect the terms in 17k2 + k3 - 17k*2 - 2k3. -k3 Collect the terms in -14x + 8x + 3x. -3x Collect the terms in -10l3 + 10l*3 + 0l*3 + 2l*3. 2l*3 Collect the terms in -6 - 1 + 7 + 2r*2. 2r*2 Collect the terms in 2j*2 - 2j*2 - 4j*2 - 2j*2. -6j*2 Collect the terms in -2q*2 + 8q*2 + 9q*2 - 4q*2. 11q*2 Collect the terms in 5o*3 + 9o*3 - 11o*3. 3o*3 Collect the terms in -7t - 2t + 7t + 5t - t. 2t Collect the terms in -7i2 - i2 + i2 + 12i*2. 5i*2 Collect the terms in 11m*3 - 6m*3 - 2m*3. 3m*3 Collect the terms in 26u - 4u + 19u - 11u. 30u Collect the terms in 100 + t*2 + 6t*2 + 11t*2 - 99. 18t*2 + 1 Collect the terms in 6 + f - 8 - 27 - 2. f - 31 Collect the terms in 230o*2 - o + 2o - 2o. 230o*2 - o Collect the terms in 184l - 40l2 - 184l + 2l2. -38l2 Collect the terms in 17 + v2 - 3v2 - 4v*2 + 5v2. -v2 + 17 Collect the terms in -124x2 - 14x*2 - 27x*2. -165x*2 Collect the terms in -1 - 58i + 46i + 1. -12i Collect the terms in 29n2 - 65n*2 + 23n*2. -13n*2 Collect the terms in 8 - 42 + 28 + 6 + 9g. 9g Collect the terms in 58m*2 - 155m*2 + 49m*2 + 51m*2. 3m*2 Collect the terms in -1144z - 1178z + 0z*3 + 2322z + z3. z3 Collect the terms in 4x2 + 28x*2 + 45x*2. 77x*2 Collect the terms in -40 + 40 - 6i*2 - 4i*2. -10i*2 Collect the terms in -9f*2 + 10f - 3f + f. -9f*2 + 8f Collect the terms in -1 + 4 - 3 + 8k. 8k Collect the terms in -6g2 + 0g*2 + 35 + 44 - 79. -6g*2 Collect the terms in 102q*3 + 34 - 34. 102q*3 Collect the terms in -13331q + 3 - 2q2 + 13331q - 3. -2q2 Collect the terms in -39d*3 + 85d*3 - 45d3. d3 Collect the terms in -2s2 - 2s*2 + 1400s - 1400s. -4s*2 Collect the terms in 20 - 427c + 427c - 2c*2. -2c*2 + 20 Collect the terms in -3 + 2 + 11n*3 - 289n - n*3. 10n*3 - 289n - 1 Collect the terms in -615x2 - 572x*2 + 154x*2. -1033x*2 Collect the terms in 1579 - 3h2 + h2 + 1577 - 3156. -2h2 Collect the terms in 334p - 334p - 2p*2. -2p*2 Collect the terms in -13w*2 + 8w*2 - 24w*2. -29w*2 Collect the terms in -2z + 2z + 4z - z. 3z Collect the terms in -2b*2 + 18b*2 - 4 + 2b*2 + 8b*2. 26b*2 - 4 Collect the terms in -4t*3 + 80t*3 + 74t*3. 150t*3 Collect the terms in -s + 7s + s*3 - 29s*3 - 6s. -28s3 Collect the terms in -41b*3 - 48b*3 - 4b*3. -93b*3 Collect the terms in 39g + 36g - 110g + 35g + 3g*2. 3g**2 Collect the term	{ "pile_set_name": "DM Mathematics" }
/108 + (-4)/18 is divided by b. 9 Let a(r) = r*3 - 8r*2 + 6r + 2. Let w be a(7). Let z(c) = -c*3 - 5c*2 - 4c + 6. Calculate the remainder when 103 is divided by z(w). 25 Suppose -125 = -3m - b, -2m + 3b = -47 - 51. Let k = -47 - -75. Let y = k + -13. What is the remainder when m is divided by y? 13 Suppose 49 + 26 = 5f. Calculate the remainder when 4 is divided by 18/f(-25)/(-10). 1 Suppose -1152 = -4k - 5i, 5k - 3i - 1485 = 2i. What is the remainder when k is divided by 49? 48 Let d(s) = 4s3 - s2 + 2s - 1. Calculate the remainder when d(3) is divided by 36. 32 Calculate the remainder when 58/(-4)(1 - 9/3) is divided by 11. 7 Let a = -25 + 27. Suppose af = -4r + 94, -4f - 60 = -3r - 2f. Calculate the remainder when r is divided by 6. 4 Let b(o) = 14o + 1. Calculate the remainder when b(1) is divided by 6. 3 Let z(s) = s3 + 3s*2 - 1. Suppose -15 = 3i + 2i. Let o be z(i). Let f(n) = 40n2 - n. Calculate the remainder when f(o) is divided by 14. 13 Let w(r) = r2 + 12r + 7. Let i be w(-11). Let a = 31 + i. What is the remainder when 51 is divided by a? 24 Let r = -326 + 626. Suppose -i = -2i - 5k + 87, 4i - r = 4k. What is the remainder when i is divided by 20? 17 Let u(t) = -t. Let v(w) = 3w + 6. Let g(a) = 4u(a) + v(a). Let b = 23 + -18. What is the remainder when 1 is divided by g(b)? 0 Suppose 5k - 6 = -2x - x, -2x - 6 = 0. Suppose 5s - ks - 44 = 0. What is the remainder when s is divided by 4/(-10) + (-42)/(-5)? 6 Suppose 4c - 345 = c. Suppose -2v + 57 = -5a, 5v - c = -5a - 25. Calculate the remainder when 40 is divided by v. 19 Calculate the remainder when 21 is divided by 0 + 1(14 + -3). 10 Let d(s) = 0 + 3s - 2s - 9. Let q be d(6). Calculate the remainder when ((-282)/4)/q2 is divided by 16. 15 Suppose -9 = -2h + 5. Suppose 0 = -2f + h + 21. What is the remainder when f is divided by 5? 4 Suppose 2b + 5i + 13 = b, 2b = 3i. Let o = 13 - b. What is the remainder when o is divided by 6? 4 Let m(j) = j2 - j - 4. Let w be m(3). Let d(c) = -15c + 1 - c*2 - wc + 10c. Calculate the remainder when 20 is divided by d(-6). 6 Let x(g) = 6g - 2. Let w(v) = 1. Let m(o) = -w(o) - x(o). Suppose 80 = 4q - 3k, -2q + 32 = -3k - 8. Calculate the remainder when q is divided by m(-1). 6 Suppose 0 = s - 5h - 93, -s = s + 5h - 231. What is the remainder when s is divided by 22? 20 Let a(g) = -g*3 + 6g*2 + 3g - 7. Calculate the remainder when 17 is divided by a(6). 6 What is the remainder when 26 is divided by (-12)/18 + 69/9? 5 Suppose -28 - 4 = -5l - 4w, 3l - 2w = 28. What is the remainder when 38 is divided by l? 6 Suppose -4q - 82 = -5s, 0 = 2s - 0q - 3q - 37. Suppose 66 = 6x - 90. What is the remainder when x is divided by s? 12 Let h = -39 - -54. What is the remainder when 44 is divided by h? 14 Let t(l) = 2l3 - l2 - 2l - 1. Let m be t(2). Suppose -5v - m + 82 = 0. Calculate the remainder when 28 is divided by v. 13 Suppose 0 = -3z - 0z + 30. Calculate the remainder when 19 is divided by z. 9 Let q(o) = 1 - 3 + o3 - 3o*2 + 2o + 5. Calculate the remainder when q(3) is divided by -1459/(-225) - 4/5. 4 Let v(g) = -4 + 4 - 1 + g + 7g. Let d be v(1). Suppose x + dp = 3p + 24, -4x = 4p - 36. Calculate the remainder when x is divided by 3. 1 Calculate the remainder when 1230/25 + (-2)/10 is divided by ((-4)/6)/((-4)/78). 10 Suppose 11a + 2a - 3549 = 0. Calculate the remainder when a is divided by 23. 20 Suppose -2w + 8 = -6w. Let l be 5/(5/w) - 2. Calculate the remainder when 34 is divided by 2/l - 74/(-4). 16 Let j(t) = -11t - 1 + 2 - 10t. What is the remainder when j(-2) is divided by 15? 13 Suppose -i + 2i - 3b - 48 = 0, 0 = 5i + b - 176. Suppose -h - 2h = -i. What is the remainder when 6/(((-2)/(-11))/1) is divided by h? 9 What is the remainder when 27 is divided by (-6)/9 + (-105)/(-9)? 5 Suppose 0 = 4v - 2v - 28. Suppose p - 20 = -4p, r + 5p = 76. Suppose -3n + r + 22 = 0. What is the remainder when n is divided by v? 12 Suppose 0 = -z + 43 - 5. Suppose 4u = 2u + 10, 2k - 3u = 1. Suppose -z + k = -2a. What is the remainder when 28 is divided by a? 13 Let y(l) = l*2 - 6l - 11. Let o be y(8). Suppose 3m - om + 28 = 0. Let a(n) = -5n3 + n2 + 2n + 1. What is the remainder when m is divided by a(-1)? 4 Let g be -35(-24)/(-20). Let k = 33 + g. Calculate the remainder when 28 is divided by k. 13 Suppose -4m + 9m - 15 = 0. Suppose 6 = -0u + mu. Suppose 2g - 23 = -n - g, -un + 18 = -g. What is the remainder when n is divided by 6? 5 Suppose -p + 11 - 3 = 0. Calculate the remainder when p is divided by 4. 0 Suppose 2x + 2x = 172. What is the remainder when x is divided by 1/(1/(-60)-4)? 13 Suppose 3s + 427 = 5r, -2r + 3s + 255 = r. Calculate the remainder when r is divided by (-11 - -10)-221. 20 Let u(s) = -s2 - 10s + 14. Suppose -4p = -22 - 6. What is the remainder when p is divided by u(-11)? 1 Let t(d) = d3 + 3d*2 - 5d - 2. Let v be t(-4). Suppose -2 = vf + 2. What is the remainder when 1 is divided by f((-2)/(-4) + -1)? 0 Suppose -5n + 255 = -4f, -60 - 93 = -3n - 2f. What is the remainder when n is divided by 13? 12 Let w(a) = -1. Let o(u) = -4u - 1. Let k(b) = -o(b) + 2w(b). Let x be (-1)/((27/6)/(-9)). What is the remainder when 12 is divided by k(x)? 5 Let k = 2 + 9. Suppose v + 69 = 5b, b - 3v = -0b + k. What is the remainder when b is divided by 3? 2 Suppose 0 = 2t + 3t. Let h = 4 - t. Calculate the remainder when h is divided by 3. 1 Suppose 2l + 3a + 24 = 61, -2a = 2. What is the remainder when 34 is divided by l? 14 Let v(p) = p*3 - 11p*2 + 6p - 11. Let f be v(12). Suppose -5k + f + 140 = 0. Suppose 5g - 56 = k. What is the remainder when g is divided by 9? 7 Suppose -d + 6 = d. Suppose -36 = -da - 0. What is the remainder when 23 is divided by a? 11 Let a = -4 - -6. Let f(t) = 19t + 4. What is the remainder when f(0) is divided by a? 0 Suppose -5z + 2u - 6 = -36, 0 = -z - 2u + 6. Suppose zv - v = 470. Suppose -4q = -3q + 5, -v = -3o + 5q. What is the remainder when o is divided by 12? 11 Let c(n) = -n*2 + 7n + 1. What is the remainder when 43 is divided by c(5)? 10 Suppose 2n - n - 41 = 0. Let z = n - 28. Calculate the remainder when 22 is divided by z. 9 Let m(g) = -2g*2 + 2g + 7. Let a be m(3). Let h(u) = u*2 + 2u. Calculate the remainder when 27 is divided by h(a). 12 Let w(g) = -6g - 2. Let s be w(-5). What is the remainder when ((-266)/s)/(2/(-12)) is divided by 20? 17 Let b(v) = -16v*3 - v - 1. Let w be b(-1). Let y = w + -10. Let q = y - -14. What is the remainder when 38 is divided by q? 18 Let q = 11 + 35. Calculate the remainder when q is divided by 16. 14 Suppose 0y - 4 = -2y. Let r = 19 - 9. Calculate the remainder when r is divided by y - (-2 + 3 + -3). 2 Suppose -5q + 4q + 7 = 0. Calculate the remainder when q is divided by (-133)/(-42) + 2/(-12) + 2. 2 Let u(z) = 3z*2 + z. Calculate the remainder when 7 is divided by u(1). 3 Suppose -4d + 7m = 2m - 52, 4d - 4m = 52. Suppose -j + 246 = 2j. Let f = j + -44. What is the remainder when f is divided by d? 12 Let z(b) = 17b*2 - 1. What is the remainder when z(2) is divided by 34? 33 Let t = 8 - 4. Suppose 1 = -w - 4g, 0 = -2g - 2g - t. Suppose 28 = wp - 2u, 0 = 2p - 3u - 11 - 6. What is the remainder when 29 is divided by p? 9 Let j = 119 - 96. Calculate the remainder when 64 is divided by j. 18 Suppose 30 = 4m - m. Calculate the remainder when 17 is divided by m. 7 Let n = 20 + -11. Calculate the remainder when 25 is divided by n. 7 Let q = 2 - 5. Let h = 0 - q. Suppose -x = -5 + h. Calculate the remainder when 4 is divided by x. 0 Suppose -m = -5m + 28. Suppose 5v - v - 12 = 0. Let q(u) = 7u - 2. What is the remainder when q(v) is divided by m? 5 Let l(y) be the third derivative of y*5/60 + 5y*3/6 - 5y*2. What is the remainder when l(6) is divided by 11? 8 What is the remainder when 118 is divided by 6/2(-8 + 13)? 13 Let x = 12 + 18. Let v = -18 + x. What is the remainder when 2 - (4 + 92)/(-3) is divided by v? 10 Let y = 5 + -1. Let v be 6/(-1)(-26)/y. Suppose -3n - 4 = -4n + 3x, 0 = 5n + 4x - v. What is the remainder when 19 is divided by n?	{ "pile_set_name": "DM Mathematics" }
rt(7)/2 Simplify ((sqrt(1872)1)2 - (sqrt(13) + 0)1) + -3 + -6(-2sqrt(468)4)2. -177843 - sqrt(13) Simplify (5 + (sqrt(36)/(sqrt(2)2) - sqrt(162)/sqrt(441)))5. 75sqrt(2)/14 + 25 Simplify 5(2 + sqrt(1872) + sqrt(1872)2 - (2 + sqrt(1573)2)). 70sqrt(13) Simplify sqrt(204)/(3sqrt(432)) - ((sqrt(51)-1 - sqrt(51))/sqrt(3) + 3)*2. -77 + 217sqrt(17)/18 Simplify ((-4(sqrt(99) - (sqrt(99) + (sqrt(99) - -2sqrt(99)-3))))/((sqrt(324) - -1sqrt(324)-3) + sqrt(324)))2. 1100/9 Simplify (-5 + ((-2(sqrt(85) + -1sqrt(85)))/(sqrt(45)/(sqrt(9)-1)))*2)1. -5 Simplify ((-2-1(sqrt(99) + -1sqrt(99)))/(2(sqrt(1296) + (sqrt(1296) + sqrt(1296)-2 - sqrt(1296)))))2 + 5. 5 Simplify ((4(-2sqrt(150))/sqrt(10))/(sqrt(30)/sqrt(90) - (1sqrt(33))/sqrt(11)))*2. 720 Simplify (sqrt(320) + -1sqrt(320)2 + sqrt(320))/(-6(sqrt(64) + sqrt(64)-2 - sqrt(64)) + sqrt(64) - sqrt(64)). 0 Simplify -4((sqrt(34)/sqrt(2) - sqrt(17)) + sqrt(17) + -4)2 - (sqrt(51)/(sqrt(27)/(sqrt(36)/sqrt(4))))2. -149 + 32sqrt(17) Simplify (4 + -2sqrt(363) + 1-2sqrt(363) - (2 + sqrt(363) + -5)4)2. -2816sqrt(3) + 23488 Simplify 5 + (0 + sqrt(147)-2)25 + -2 + (sqrt(147) + 0 + 2)*2. 28sqrt(3) + 3094 Simplify ((-2sqrt(204))/sqrt(12))2 - (-2sqrt(17) + -3)*2 - (-1 + sqrt(68)/sqrt(4) + sqrt(17) + (sqrt(170) - sqrt(170)-1)/sqrt(10)). -16sqrt(17) - 8 Simplify (sqrt(34)/sqrt(2) + sqrt(17) + -5 + sqrt(17) + sqrt(17) + -2sqrt(153) + 4sqrt(272) + 52sqrt(17))2 + 3. -240sqrt(17) + 9820 Simplify (sqrt(128) - (-2(sqrt(128) + 1) - sqrt(128)))2 + (1sqrt(3456))/sqrt(12). 140sqrt(2) + 2052 Simplify (5 + 2sqrt(25)/(sqrt(20)/sqrt(4)) - ((sqrt(75)1 + sqrt(75))/sqrt(3))/(sqrt(5) + sqrt(500)-2 + sqrt(5)))*2. 190sqrt(5)/9 + 3830/81 Simplify 3((sqrt(189) + ((sqrt(189) - (sqrt(189) + sqrt(189) + sqrt(189)1)) + sqrt(189) + sqrt(189) - sqrt(189)))/sqrt(7) + -2). -6 Simplify sqrt(320) + sqrt(320)2 - 2(sqrt(15)/sqrt(3))*2 - ((sqrt(40)/sqrt(4))/sqrt(2) + 3). -13 + 23sqrt(5) Simplify (((sqrt(68) - -3sqrt(68))6)/(sqrt(36)/(sqrt(9) + sqrt(9) + sqrt(81)/sqrt(9))))*2. 88128 Simplify (((sqrt(187) + -1-2sqrt(187))-4)/(-6sqrt(176)2))*2. 17/16 Simplify (sqrt(605) - (0 + sqrt(605))-6) + (-3sqrt(35))/sqrt(7) + 0. 74sqrt(5) Simplify (-4(sqrt(119) - (sqrt(119) - 3sqrt(119))))/(sqrt(35)/sqrt(5)-4). 3sqrt(17) Simplify (0 + sqrt(19) + 0)*2 + 3 + -1 + sqrt(19) + (6sqrt(209)1)/sqrt(11). 21 + 7sqrt(19) Simplify (4sqrt(88)3)/((sqrt(56)/sqrt(4)2)/sqrt(7)). 12sqrt(11) Simplify 2 + (sqrt(128) - (-2sqrt(128) + 4))5-1. -120sqrt(2) + 22 Simplify ((1sqrt(440))/sqrt(8))/(sqrt(33)/(sqrt(9)/sqrt(3)) + sqrt(11)) - (0 + sqrt(20) + sqrt(20) - sqrt(5) - (sqrt(5) - (-3sqrt(125) + sqrt(125)))). 17sqrt(5)/2 Simplify ((-51sqrt(245))2 - -4sqrt(245)2) + ((sqrt(245) - (sqrt(245) + 0))-2)*2 + -4. 56sqrt(5) + 6121 Simplify (sqrt(99) - (sqrt(99) - -5(sqrt(99) - sqrt(99)-2) - sqrt(99)) - (sqrt(99) - -2sqrt(99))6)/(-1sqrt(225)-5). -32sqrt(11)/25 Simplify 1 + (sqrt(1700) - (sqrt(1700)-2)*24)-2. -20sqrt(17) + 54401 Simplify (-6(sqrt(78) - ((sqrt(78) - (sqrt(78) - -2sqrt(78))) + sqrt(78))))/sqrt(6) - (-3 + (sqrt(13) - (sqrt(130) + sqrt(130)-1)/sqrt(10))). -13sqrt(13) + 3 Simplify ((sqrt(36) - -3sqrt(144))/(sqrt(1452)-2))*2. 147/484 Simplify -4 + (3sqrt(3)-3-6 + 5(sqrt(363) - sqrt(363)-3))*2. 225224 Simplify ((4sqrt(108)2 + sqrt(108))/sqrt(6) + 3)-4 + -2. -108sqrt(2) - 14 Simplify ((sqrt(243) - sqrt(243)-6) + -2)*2-1-4. -1008sqrt(3) + 47644 Simplify 1 + 6(5 + -2 + sqrt(7) + (sqrt(448) + (1sqrt(448) + sqrt(448) - sqrt(448)))*2). 6sqrt(7) + 10771 Simplify ((sqrt(432) + (sqrt(432) - sqrt(432)3 - sqrt(432) - sqrt(432))-5 + sqrt(432))/((sqrt(4) - sqrt(44)/sqrt(99)) + sqrt(16)/(2sqrt(4))))2. 1881792/49 Simplify ((sqrt(475)16 - ((sqrt(475) - (-5 + (sqrt(475)2 - sqrt(475) - sqrt(475)) + sqrt(475) + sqrt(475))) + sqrt(475)))3)2-4. -616500 + 10800sqrt(19) Simplify -3 + (5(sqrt(1584) + -4 + sqrt(1584))-6)2. -172800sqrt(11) + 5716797 Simplify sqrt(343) + (1 + sqrt(343))*2 + 5 + sqrt(343) + sqrt(343) + sqrt(63)/((1sqrt(108) + sqrt(108))/sqrt(12)). 71sqrt(7)/2 + 349 Simplify 2 + (-2 + sqrt(19) + 3)2 + (sqrt(475) - (sqrt(475) + (sqrt(475) - (sqrt(475) + sqrt(475)4))))*2. 2sqrt(19) + 7622 Simplify ((sqrt(95) - (sqrt(95) - -2sqrt(95)))36)/(-6(sqrt(5) + sqrt(15)/sqrt(3))-6). -sqrt(19)/2 Simplify ((sqrt(1539) - 4(sqrt(1539) + 1 - sqrt(1539)) - sqrt(1539) - (sqrt(1539) - -6(-1 + sqrt(1539))) - (2 + sqrt(1539))16) + 3)2. 1638sqrt(19) + 260140 Simplify (sqrt(102) + sqrt(102)3-1)/(sqrt(48)/(-4sqrt(8))). 8sqrt(17) Simplify (-1sqrt(275) + sqrt(275))-6 + sqrt(275) + -4 + (-2 + sqrt(275)3)26. -355sqrt(11) + 14870 Simplify (2(4-4sqrt(1573) + 5)-4)2. -112640sqrt(13) + 25773632 Simplify (-5 + 5(sqrt(171) + -1 - sqrt(171)))2 + -6(sqrt(171)2)2-5. 20620 Simplify -2(4 + (sqrt(143) - (sqrt(143)-2-1 - sqrt(143)))/(sqrt(880)/sqrt(5))). -8 Simplify (sqrt(700)1 + -4 + 2 + sqrt(343)1)2. -68sqrt(7) + 2027 Simplify (-5sqrt(2299)-16 - (-3(sqrt(76)-2 + sqrt(76)))/(-5sqrt(8)/sqrt(2)))*2. 51915771/25 Simplify ((sqrt(1872) + sqrt(1872) + 1 - -2sqrt(13)2)2 - 5(sqrt(208) + -4)*2)4. 864sqrt(13) + 36292 Simplify sqrt(891) + ((sqrt(891)1 - sqrt(891))-4)2 + -2 + (1sqrt(891))*2 + sqrt(891) + 2. 18sqrt(11) + 891 Simplify (42sqrt(209) + (sqrt(209) + sqrt(209) + 1sqrt(209))4)/(sqrt(66)/(sqrt(24)/sqrt(100))). 4sqrt(19) Simplify ((-1sqrt(1200))/(sqrt(4) - sqrt(324)3)-6)*2. 2700/169 Simplify 6-6((sqrt(1331) + 1 + sqrt(1331) - sqrt(1331))-2 + 4). -72 + 792sqrt(11) Simplify ((sqrt(504) + sqrt(504)-2)/sqrt(8) - ((sqrt(63) - sqrt(1008)) + 2) - (1 + -2 + -1sqrt(7))3)*2. 18sqrt(7) + 568 Simplify (4-1sqrt(35)/sqrt(5) + 6sqrt(28)/sqrt(4)-6)*2 + -2. 11198 Simplify (-62sqrt(121) + (sqrt(121) + sqrt(121) + sqrt(121)-2 + sqrt(121))2)/((sqrt(99) + sqrt(99)-2)1). 10sqrt(11)/3 Simplify (((1 + sqrt(1377) - sqrt(1377) - sqrt(1377))-3 - 1(sqrt(1377) - (sqrt(1377) + 0 + sqrt(1377)))) + (sqrt(1377) + -2 + 5 - sqrt(1377))6)2. 1080sqrt(17) + 22257 Simplify (4(1sqrt(70) - sqrt(70))/sqrt(5))/(sqrt(200)-2 - sqrt(72)-1). 0 Simplify (-2sqrt(190)-4-5)/((-2sqrt(70)-3 - sqrt(70))/sqrt(7)). -8sqrt(19) Simplify -4 + 1(2(5 + sqrt(176)) + sqrt(176))*2 + 0. 240sqrt(11) + 1680 Simplify ((sqrt(77) + 4(sqrt(77) - ((-2sqrt(77) - sqrt(77)) + sqrt(77))) + sqrt(77))/(((sqrt(11) + sqrt(44)/sqrt(4))3 - sqrt(11)) + sqrt(11))2)*2. 1372/9 Simplify (2sqrt(288) + sqrt(198)/(sqrt(11)-1))/(sqrt(90)/(sqrt(40)-6)). -84sqrt(2) Simplify sqrt(108) + sqrt(108)-22 + (sqrt(108) - (((sqrt(108) - (sqrt(108) + 0)) + sqrt(108))2 + 3)) + 0 + 2sqrt(108). -111 Simplify (2sqrt(7)2 + 6sqrt(7)-1 - (sqrt(252) + 4)-6)2. 1632sqrt(7) + 8668 Simplify (2 + sqrt(32)-1 + 0)-6. -12 + 24sqrt(2) Simplify (sqrt(112) - (3 + sqrt(112)-2)) + (sqrt(112) + (sqrt(112) - sqrt(112)-2)6)*2 + -1sqrt(112)6 + (sqrt(112) + -1 + -4)2. -52sqrt(7) + 40566 Simplify -3 + (sqrt(2736)-1 + 2 - (sqrt(2736)1-1 - sqrt(2736))2) + 3. -10942 - 12sqrt(19) Simplify 3(((sqrt(672) - (sqrt(672) + -1sqrt(672)))/sqrt(6))*2 - (5 + (sqrt(7) + 2)-5)*2). -150sqrt(7) - 264 Simplify ((sqrt(99) - 2(sqrt(99)-2 + sqrt(99)) - sqrt(99)) + (sqrt(99) - (-2 + sqrt(99))) + -3)*2 + 1. -12sqrt(11) + 398 Simplify 1 + (sqrt(21) - (sqrt(21) - (-1sqrt(252) - sqrt(252))/sqrt(12)))/sqrt(7) + sqrt(33)/(-2sqrt(22)/sqrt(2)). -5sqrt(3)/2 + 1 Simplify (-2(sqrt(12) + sqrt(1764)/sqrt(3))-5)2. 76800 Simplify (4 + -1sqrt(891))*2 - sqrt(77)/sqrt(28)6. -75sqrt(11) + 907 Simplify 2(-1sqrt(22)/sqrt(32))23. 33/8 Simplify ((-5(sqrt(170)1 + sqrt(170)) - sqrt(170) - sqrt(170))-3)/(sqrt(1440)-1-2 + sqrt(1440)). sqrt(17) Simplify (sqrt(228) + -4sqrt(228)-4)/sqrt(12) - (-3 + 3 + sqrt(931)). 10sqrt(19) Simplify sqrt(4)/(sqrt(6)/sqrt(3)) + (sqrt(12) + 3sqrt(12))/sqrt(6) + -4. -4 + 5sqrt(2) Simplify (-5((sqrt(133) - (sqrt(133) + sqrt(133) + (sqrt(133) - 1sqrt(133)1) + sqrt(133))) + sqrt(133) - sqrt(133))/(-2sqrt(7)1))2. 475 Simplify -2 + ((sqrt(7) + 1)2 + 1 - sqrt(7)) + 2 - ((sqrt(1694)2)/(sqrt(162) - (-1*sqrt(162) -	{ "pile_set_name": "DM Mathematics" }
= 4q. Calculate the remainder when 53 is divided by s. 4 Suppose -5o = -2z + 21, -4o - 9 = 3. Suppose -5u + 290 = -w, -u - 4w = zu - 256. What is the remainder when u is divided by 4 + -6 - (-1 + -31)? 29 Let g = -722 - -857. What is the remainder when 941 is divided by g? 131 Let r(i) be the first derivative of 86i*3/3 + 3i*2/2 - i + 39. What is the remainder when r(1) is divided by 9? 7 Suppose -2k + 17 = -7. Let p be (-4)/14 + 112/49. Calculate the remainder when 3 - (6/p - 22) is divided by k. 10 Suppose 2u - 5u + 30 = 0. Suppose 0 = 3t + 4x - 45, 4t - 4x - 53 = 7. Calculate the remainder when ((-12)/u)/(4/(-190)) is divided by t. 12 Suppose 3g = -3s + 15, 2g + 5s - 6 = 7. Suppose -9 = -gh + 239. Suppose 13 = 3a - 26. Calculate the remainder when h is divided by a. 10 Calculate the remainder when 19 - (40/8)/5 is divided by 6. 0 Let v(t) = -t*3 + 5t*2 + 24. Suppose 2s = 5y - 23 - 12, 10 = 4y + 2s. Calculate the remainder when 65 is divided by v(y). 17 Suppose -o + 56 = 3o. Let g(j) = 12j + 4. Let q be g(5). Let r = -11 + q. What is the remainder when r is divided by o? 11 Suppose 0 = -14j + 78 + 216. What is the remainder when 1217 is divided by j? 20 Let q = 676 + -628. What is the remainder when 230 is divided by q? 38 Calculate the remainder when (710/(-8))/(-1) + (-8)/(-32) is divided by 13. 11 Let q(m) = 35m2 + 37 - 1 - 36m*2 + 17m. What is the remainder when q(17) is divided by 13? 10 Suppose 0 = -15f + 4641 + 729. What is the remainder when f is divided by 36? 34 Let d(b) = b3 + b - 2. Let v be d(1). Suppose -6a + va = -84. What is the remainder when 26 is divided by a? 12 Let j(l) = 13l - 4. Let u be j(5). Suppose 3c - q = -u, 0 = c + 4c - 2q + 101. Calculate the remainder when 38 is divided by (-6)/c + 1160/56. 17 Let n(g) = -72g + 113. What is the remainder when n(-2) is divided by 24? 17 Suppose 0w + 5w - 115 = 0. Let t = 37 - w. What is the remainder when 51 is divided by t? 9 Let b = 7 + 96. Calculate the remainder when b is divided by 34. 1 Let s(f) = f3 - f2 + 2f + 16. Calculate the remainder when 365 is divided by s(0). 13 Let i be 3/6(2 - -6). Let y(z) = 4z + 5. What is the remainder when y(5) is divided by (27/(-7 + i))/(-1)? 7 Let b = -248 - -526. What is the remainder when b is divided by 4? 2 Suppose 3a + 690 = 33a. Calculate the remainder when a is divided by (-38)/(-6) - 4/12. 5 Let w = -47 + 79. Let n be w/123-1. Let g = 24 + n. Calculate the remainder when 62 is divided by g. 14 Let j(c) = -c - 3. Let u be j(-3). Suppose u = 4p + 1 + 47. What is the remainder when 23 is divided by -7-1p/(-7)? 11 Suppose -13q + 365 - 105 = 0. What is the remainder when 115 is divided by q? 15 Let f be 982/7 - 14/49. Let o = f - 132. Calculate the remainder when o is divided by 7. 1 Let y be 4((-7)/(-2))/7. Suppose -312 = -4x - q + yq, 296 = 4x - 5q. Let n = x - 2. What is the remainder when n is divided by 20? 17 Suppose -5q = -5t + 765, 5t - 365 = -3q + 392. Let v = 3088 - 3071. What is the remainder when t is divided by v? 16 Let t be 954/15 + (-6)/(-15). Suppose i - 4v = t, i - 23 = -v + 46. Suppose i = 2o - 58. What is the remainder when o is divided by 22? 19 Let j(g) = 5g2 + 28g - 16. What is the remainder when j(14) is divided by 80? 76 Let o = 317 + -263. What is the remainder when o is divided by (-3)/12 + (-90)/(-8)? 10 Let b(x) = -9x2 + 390x - 62. Calculate the remainder when 376 is divided by b(43). 41 Suppose 4n + 5s - 103 = 220, 2s + 184 = 2n. Calculate the remainder when n is divided by 13. 9 Suppose -t + 2t - 16 = 0. Let s(r) = -r3 + 16r*2 - 2r + 38. Calculate the remainder when 11 is divided by s(t). 5 Calculate the remainder when 649 is divided by -4(-10)/180 + (-232)/(-9). 25 Suppose -h - 518 = -8h. What is the remainder when h is divided by 10? 4 Suppose 3z = 5z - 5w - 32, -73 = -3z - 5w. Calculate the remainder when z is divided by 14. 7 Let d(o) = 16o + 242. Calculate the remainder when 107 is divided by d(-13). 5 Let x = 41 - 39. Suppose 0 = -5o, -2o - 45 = -5k + xo. Calculate the remainder when 43 is divided by k. 7 Let y = -50 + 56. Suppose 0 = yx - x + 3v - 392, 4x - 313 = -3v. Let q = -12 + 28. Calculate the remainder when x is divided by q. 15 Let n = 21 + 55. Suppose 5d - p = 125, -5d - 5p + 177 = 22. Calculate the remainder when n is divided by d. 24 Suppose 0 = -4s + 7 + 5. Let x(l) = 2l - 2. Calculate the remainder when ((-18)/(-2))/1 + 1 - 0 is divided by x(s). 2 Let j be (-13)/(-7) + (-5)/(-35). Suppose -197 = -jp - 177. What is the remainder when p is divided by 2? 0 Suppose -59 = -3k - n, -k + 5n = 3k - 85. Let f(c) = 4c*2 + 4c - 4. Calculate the remainder when f(-5) is divided by k. 16 Let o(v) = 6v - 1. Let j be (66/4)/((-1)/(-16)). Calculate the remainder when (-1)/((-3)/(j - -3)) is divided by o(4). 20 What is the remainder when 102 is divided by -2(-12)/930/8? 2 Let h be 36/(-8)(-4)/(-2). Let q be 245/30 + 2/(-12). Calculate the remainder when 6/h + q/3 is divided by 2. 0 Let z(d) = 267d2 - 62d + 60. What is the remainder when z(1) is divided by 68? 61 Let g(a) = -a*3 - 3a*2 + 7a + 7. Suppose 0 = s - 0s + 5. What is the remainder when g(s) is divided by (3 - (-30)/(-12))64/4? 6 Let s = -22 - -25. Suppose -p + 153 = sj, -p - 3 + 0 = 0. What is the remainder when j is divided by 9? 7 Let w be (2/8)/(-1) - 22/8. Let b = w - -32. What is the remainder when b is divided by 16? 13 Let c = 103 - 84. Calculate the remainder when 32 is divided by c. 13 Calculate the remainder when 18/((-4)/3 - -2) is divided by 10/15 - ((-80)/(-3))/(-5). 3 Suppose 7i + 25 + 17 = 0. What is the remainder when 43 is divided by (-9)/(81/i) + 26/6? 3 Suppose -363 = -10v + 337. What is the remainder when 266 is divided by v? 56 Let w = 15 + -20. Let r = 11 + w. Suppose -13 = ra - 73. What is the remainder when 19 is divided by a? 9 Let b = 27 - 42. What is the remainder when 41 is divided by (9/(-4))/((-8)/((-640)/b))? 5 Suppose 23 + 47 = 14s. Calculate the remainder when 278 is divided by s. 3 Let b = 82 - 79. Suppose -br - 5t = -76, 115 + 5 = 4r + 2t. Calculate the remainder when 94 is divided by r. 30 Calculate the remainder when ((-61)/(-6))/(16 + (-855)/54) is divided by 4. 1 Let p(i) = -i3 - 12i*2 + 11i + 26. Let s be p(-13). Suppose -s - 38 = -10g. Calculate the remainder when g is divided by 8. 1 Let v(u) = 5u - 6. Let k be v(-3). Let d = k + 32. Calculate the remainder when 43 is divided by d. 10 Suppose -81 = -4b - 3f + 39, -4b - 5f = -120. Calculate the remainder when 145 is divided by b. 25 Suppose 4p - 372 = 4t, -5p + 465 = 56t - 54t. Calculate the remainder when 556 is divided by p. 91 Let k be -2 + 2/(-2) + -66. Let t = -49 - k. What is the remainder when 4 is divided by (24/t)/(4/10)? 1 Let n = 44 + -39. Suppose -50 = -nf - 0f. What is the remainder when 18 is divided by f? 8 Let y(o) = o3 + 8o*2 - 86o + 10. What is the remainder when y(-14) is divided by (-1 - -7)(-16)/(-12)? 6 Let v be 6/5 - (-48)/60. Suppose -96 = -3x - vy, -4y = 4x - 151 + 23. Calculate the remainder when x is divided by 19. 13 What is the remainder when 3/7 - (10 + 12012/(-98)) is divided by 21? 8 Suppose 0 = 39i - 40i + 1817. What is the remainder when i is divided by 20? 17 Let v(z) = z3 + 10z*2 + 13. What is the remainder when 350 is divided by v(-10)? 12 Suppose 0 = 6x - 33 + 3. Calculate the remainder when 82 is divided by (1 - x)/4-43. 39 Suppose -4w = 12, 3a - 5w = -1 + 58. Calculate the remainder when 83 is divided by a. 13 Let k = 1 - -9. Let v(x) be the third derivative of x6/60 - x5/30 + x*3/2 + 17x*2. Calculate the remainder when v(3) is divided by k. 9 Let c = -54 - -60. Suppose 0 = 3d - 6d - 5o + 2, -4d + 14 = o. Suppose cr - dr - 38 = 0. What is the remainder when 75 is divided by r? 18 Suppose 3p - 4h + 120 = 7p, -5h = 4p - 123. Let w = 5 + 12. What is the remainder when 6(-3)/(-6)w is divided by p? 24 Let q be (-2 - -5)/((-2)/14). Let n = -18 - -36. Calculate the remainder when 71 is divided by n2(-14)/q. 23 Let f = -25 + 76. Let n = -37 + f. Calculate the remainder when 1/(-1) - (2 - 56) is divided by n. 11	{ "pile_set_name": "DM Mathematics" }
for p. -1 Solve 12f + 48 = 4f for f. -6 Solve 1 + 9 = 5l for l. 2 Solve 0 = -o - 10o + 2o for o. 0 Solve 67i - 76i + 36 = 0 for i. 4 Solve 76 = -88j - 804 for j. -10 Solve 71h = -40h - 444 for h. -4 Solve 16r + 26 = -6 for r. -2 Solve -242m - 78 = -255m for m. 6 Solve -85 + 95 = 5b for b. 2 Solve -23f = -22f - 5 for f. 5 Solve 0 = 189n - 203n - 112 for n. -8 Solve -8a - 60 + 60 = 0 for a. 0 Solve 20l - 44l + 20l = 0 for l. 0 Solve -40t = -48t - 8 for t. -1 Solve 9a + 30 = -15 for a. -5 Solve 0 = 120o - 106o - 84 for o. 6 Solve 32s - 29s = 15 for s. 5 Solve -20t + 37t = 51 for t. 3 Solve 25x + 255 = 76x for x. 5 Solve 43 + 177 = 55b for b. 4 Solve 102s = 112s - 40 for s. 4 Solve 959 = -8n + 1015 for n. 7 Solve 0 = 5g + 585 - 550 for g. -7 Solve 3k - 4k = 5k for k. 0 Solve 39c - 14c - 50 = 0 for c. 2 Solve -21a - 46a + 268 = 0 for a. 4 Solve 31k - 23k - 32 = 0 for k. 4 Solve 0 = -15t - 11t + 260 for t. 10 Solve -5s - 12 = 3 for s. -3 Solve -962m - 14 = -955m for m. -2 Solve 4q = q - 3q for q. 0 Solve -4y + 9 + 15 = 0 for y. 6 Solve -31m - 73 = 20 for m. -3 Solve 158 = -8b + 86 for b. -9 Solve 23j - 97j = -296 for j. 4 Solve -9b = -4b for b. 0 Solve 38z + 42 = 17z for z. -2 Solve 5s = 45 - 20 for s. 5 Solve 21p = 157 - 31 for p. 6 Solve 12 = 8r - 4 for r. 2 Solve -3i = 7i + i for i. 0 Solve -52 = -25f - 2 for f. 2 Solve -4l + 7 + 5 = 0 for l. 3 Solve 14m = 7m + 10m for m. 0 Solve 2c + 44 = -9c for c. -4 Solve 0 = 11y - 34 + 1 for y. 3 Solve 47 = -12u + 59u for u. 1 Solve -3807 = -26l - 3989 for l. -7 Solve 0 = 21i + 25i - 368 for i. 8 Solve -7v + 2v + 25 = 0 for v. 5 Solve 23t + 8 + 15 = 0 for t. -1 Solve 9x + 596 = 614 for x. 2 Solve 11r = -20 + 75 for r. 5 Solve -9r = 4r - 52 for r. 4 Solve 144 = -26i - 22i for i. -3 Solve -89 - 31 = 20m for m. -6 Solve 86j - 58j - 140 = 0 for j. 5 Solve -26i + 37 = -15 for i. 2 Solve 14 - 28 = 7k for k. -2 Solve -12o = -2 + 38 for o. -3 Solve 33 = 4x + 25 for x. 2 Solve 10l - 6 = -6 for l. 0 Solve -26 + 2 = 8c for c. -3 Solve -i + 0 = 1 for i. -1 Solve 0 = 104b - 99b - 10 for b. 2 Solve 261g - 330 = 151g for g. 3 Solve -55q = -199 - 131 for q. 6 Solve -7x + 20x = 0 for x. 0 Solve 25a + 20 = 120 for a. 4 Solve -320 = 7o + 57o for o. -5 Solve 1261 = -9f + 1351 for f. 10 Solve -6j + 7j = -4 for j. -4 Solve -6 = -3y - 0 for y. 2 Solve -20c + 1 = -19 for c. 1 Solve -14z + 56 = -42 for z. 7 Solve 15w - w = -3w for w. 0 Solve 12g + 32 = 4g for g. -4 Solve 5q - 2q = 2q for q. 0 Solve 248 = -w + 239 for w. -9 Solve 0 = -x - 4 + 9 for x. 5 Solve g + 4 = 8 for g. 4 Solve 209l = 196l + 91 for l. 7 Solve 0 = 6b - 530 + 536 for b. -1 Solve -23m - 76 + 283 = 0 for m. 9 Solve 13d + 59 = 20 for d. -3 Solve -22f = -3f + 76 for f. -4 Solve -27 + 171 = 24s for s. 6 Solve -29 + 34 = 5q for q. 1 Solve -95 = 28m - 11 for m. -3 Solve 0 = 6l - 31 + 1 for l. 5 Solve 0 = -6s - 18 + 42 for s. 4 Solve 0 = -j - 34 + 34 for j. 0 Solve -q - 1 = -2q for q. 1 Solve 556q - 559q - 9 = 0 for q. -3 Solve 16b = 6b - 90 for b. -9 Solve -36 = 6r - 54 for r. 3 Solve -9k - 29 + 83 = 0 for k. 6 Solve 60 = -9u - 3 for u. -7 Solve 411g = 395g + 32 for g. 2 Solve 23l = 27 + 65 for l. 4 Solve 22 = -12w + 23w for w. 2 Solve -25s = -21s - 12 for s. 3 Solve p - 19p = -36 for p. 2 Solve -10 = -3b - 25 for b. -5 Solve 17c = 19 + 66 for c. 5 Solve 0 = z - 86 + 93 for z. -7 Solve 363s - 373s + 20 = 0 for s. 2 Solve -22m = 2m - 96 for m. 4 Solve 27r - 45r + 36 = 0 for r. 2 Solve -8j - 28 = 12 for j. -5 Solve -45 - 103 = 37i for i. -4 Solve 11w - 8w + 6 = 0 for w. -2 Solve -15i - 8 = -13i for i. -4 Solve 0 = 4x - 21x - 34 for x. -2 Solve 16y + 9y = 75 for y. 3 Solve 18t - 2t = -80 for t. -5 Solve 27 = -4x - 5x for x. -3 Solve 9a + 22 + 23 = 0 for a. -5 Solve 6k = -20 + 8 for k. -2 Solve 10t + 3t + 65 = 0 for t. -5 Solve 347b = 340b - 21 for b. -3 Solve -13b - 3 = -12b for b. -3 Solve -1728x + 1734x = -30 for x. -5 Solve 28o - 6o = -9o for o. 0 Solve 22a - 62 + 18 = 0 for a. 2 Solve -62l - 72 = -74l for l. 6 Solve 11o = 23 - 67 for o. -4 Solve 69i = 70i + 6 for i. -6 Solve 16k - 17k = -3 for k. 3 Solve 11v + 311 = 245 for v. -6 Solve 25q + 33 = 14q for q. -3 Solve 5b = 45 - 10 for b. 7 Solve -229 = 6c - 193 for c. -6 Solve 29m = 22m + 21 for m. 3 Solve 6i - 6 = 9i for i. -2 Solve 3f = 2 - 11 for f. -3 Solve -2p + 0 = -6 for p. 3 Solve -2398i + 2402i = -4 for i. -1 Solve 882 = 113m - 135 for m. 9 Solve 31o = -142 - 137 for o. -9 Solve 8w = -8w - 16 for w. -1 Solve 1 = w - 2w for w. -1 Solve -11f = 26f - 3f for f. 0 Solve 323 = 4l + 323 for l. 0 Solve 1223g - 1185g + 380 = 0 for g. -10 Solve 5q - 9 = 1 for q. 2 Solve 4g - 47 = -59 for g. -3 Solve -3n - 93 + 81 = 0 for n. -4 Solve 0 = -233b + 252b + 114 for b. -6 Solve 18 + 36 = -27t for t. -2 Solve 0 = -162w + 116w - 322 for w. -7 Solve -260f = -262f + 10 for f. 5 Solve 0 = -9i + 4i - 15 for i. -3 Solve -178 = b - 185 for b. 7 Solve -5399u - 24 = -5391u for u. -3 Solve -q = 6 - 7 for q. 1 Solve 35 = 2x + 33 for x. 1 Solve 11 = 5m + 1 for m. 2 Solve -28 = 23m + 18 for m. -2 Solve 0 = -12w + 31w - 76 for w. 4 Solve 0 = -20y + 121 - 221 for y. -5 Solve 2a = -0a - a for a. 0 Solve -124 = -20b - 4 for b. 6 Solve -5u + 24 = 7u for u. 2 Solve 26p + 3 = 23p for p. -1 Solve -36 = -69w + 33 for w. 1 Solve -9y - 1258 = -1276 for y. 2 Solve 15q - 76 + 1 = 0 for q. 5 Solve -28 = 15l + 32 for l. -4 Solve -o = 39 - 35 for o. -4 Solve 89c - 15 = -282 for c. -3 Solve -44h + 200 = 68 for h. 3 Solve -3p = 11p - p for p. 0 Solve -25x = -45x for x. 0 Solve -4 - 96 = 25a for a. -4 Solve 57q + 366 = -90 for q. -8 Solve 2f + f - 15 = 0 for f. 5 Solve 17y - 54 = 26y for y. -6 Solve -5u - 21 + 46 = 0 for u. 5 Solve -211 = 2p - 205 for p. -3 Solve 163x = 150x for x. 0 Solve 77 = -7z + 35 for z. -6 Solve 0 = -10k - 25 - 15 for k. -4 Solve x + 128 = 131 for x. 3 Solve -274j - 42 = -253j for j. -2 Solve 0 = v + 120 - 113 for v. -7 Solve 58b = -b - 69b for b. 0 Solve -28f - 52 = -2f for f. -2 Solve 19 + 17 = 36k for k. 1 Solve -6q - q - 28 = 0 for q. -4 Solve 3l + 3 = 6 for l. 1 Solve 26x - 28x - 8 = 0 for x. -4 Solve -4o = 44 - 16 for o. -7 Solve 0 = 41m - 38m - 9 for m. 3 Solve 28l = 8l + 40 for l. 2 Solve 14f - 67 + 39 = 0 for f. 2 Solve 4o + 16 = -4 for o. -5 Solve 6 = 2q + 16 for q. -5 Solve 5f - 50 = -35 for f. 3 Solve 12x + 6 = 10x for x. -3 Solve -120u + 133u - 52 = 0 for u. 4 Solve 5s - 621 = -626 for s. -1 Solve 2m - 5m = -6 for m. 2 Solve 11x - 13x = 10 for x. -5 Solve 11z - 10 = 6z for z. 2 Solve 311g - 315g = -4 for g. 1 Solve 32d - 44 = 21d for d. 4 Solve 0y - 2y + 8 = 0 for y. 4 Solve 20 + 6 = 13b for b. 2 Solve 81q = 75q + 42 for q. 7 Solve 12y + 76 - 52 = 0 for y. -2 Solve 90q = 11q + 158 for q. 2 Solve 16j + 60 = -36 for j. -6 Solve 0 = -49l + 47l - 4 for l. -2 Solve -3 = 3b - 6b for b. 1 Solve 2h + 92 = 74 for h. -9 Solve 15t + 6 = -84 for t. -6 Solve -s - 2 = -6 for s. 4 Solve 71y - 23y = -10y for y. 0 Solve 0 = 12w - 144 + 204 for w. -5 Solve 0 = 50t - 89t - 195 for t. -5 Solve -5z + 52 = 27 for z. 5 Solve x - 3 = -0x for x. 3 Solve 0 = 7f + 11 + 17 for f. -4 Solve 112 - 94 = 6w for w. 3 Solve 0 = 2f - 14 for f. 7 Solve 15 - 39 = 8h for h. -3 Solve 79f = 36f - 258 for f. -6 Solve -2k - 61 = -57 for k. -2 Solve 19 = 1838f - 1857f for f. -1 Solve 43f + f = -176 for f. -4 Solve 4r - 17 = -25 for r. -2 Solve 24 = 8j - 0 for j. 3 Solve 254r = 245r - 63 for r. -7 Solve -1687 = -5d - 1652 for d. 7 Solve 6c - 11c = 0 for c. 0 Solve -158w - 28 = -165w for w. 4 Solve 3g = 6g for g. 0 Solve -13 = 7x + 15 for x. -4 Solve 34g - 36g = 10 for g. -5 Solve 51f - 135 = 6f for f. 3 Solve 4 = s - 1 for s. 5 Solve -12u = -13u for u. 0 Solve -3c + 12 = -0c for c. 4 Solve -4j + 7 = 3j for j. 1 Solve -42v + 46 = -19v for v. 2 Solve 2g + 4 = -0g for g. -2 Solve -27 = d - 10d for d. 3 Solve -46r + 12r = 136 for r. -4 Solve 153y = 158y + 20 for y. -4 Solve -143p + 148p - 30 = 0 for p. 6 Sol	{ "pile_set_name": "DM Mathematics" }
rs picked without replacement from {d: 2, h: 3}. Give prob of picking 2 d and 1 h. 3/10 Three letters picked without replacement from {u: 15, d: 3}. Give prob of picking 3 d. 1/816 Calculate prob of picking 2 j when two letters picked without replacement from jhjjjhhjjjjjjjjhjjj. 35/57 What is prob of picking 2 e and 2 x when four letters picked without replacement from xexeeeeexxe? 21/55 What is prob of picking 1 p and 1 o when two letters picked without replacement from nnxnxpokxxnllpxllx? 2/153 What is prob of picking 2 y when two letters picked without replacement from yffffyfy? 3/28 Two letters picked without replacement from {b: 8, n: 5}. Give prob of picking 1 b and 1 n. 20/39 Calculate prob of picking 1 m, 1 v, and 1 u when three letters picked without replacement from {v: 6, u: 1, m: 6, x: 6}. 12/323 Calculate prob of picking 1 e, 1 z, and 2 t when four letters picked without replacement from zettettetet. 2/11 What is prob of picking 1 f, 2 n, and 1 e when four letters picked without replacement from yenoyyznfoyzof? 2/1001 What is prob of picking 2 k when two letters picked without replacement from {t: 3, j: 3, g: 3, k: 3, m: 1, x: 2}? 1/35 What is prob of picking 3 l when three letters picked without replacement from lvvvllvv? 1/56 What is prob of picking 2 p when two letters picked without replacement from {c: 1, v: 6, p: 4}? 6/55 Two letters picked without replacement from {e: 1, d: 4, s: 1, p: 3, r: 3, g: 3}. Give prob of picking 1 s and 1 p. 1/35 What is prob of picking 1 v, 1 k, and 1 l when three letters picked without replacement from cvvlkydydyky? 1/55 Four letters picked without replacement from ppqpppqbbq. What is prob of picking 1 p, 2 q, and 1 b? 1/7 What is prob of picking 1 y and 1 h when two letters picked without replacement from rrjhjrchrrhyhrrjrr? 4/153 Two letters picked without replacement from {e: 4, j: 3, p: 4}. Give prob of picking 2 p. 6/55 What is prob of picking 4 c when four letters picked without replacement from ccccccccc? 1 Four letters picked without replacement from qmbxqmxmbqm. What is prob of picking 1 q, 1 x, and 2 m? 6/55 Calculate prob of picking 2 t, 1 n, and 1 l when four letters picked without replacement from {g: 1, l: 6, t: 3, n: 7}. 9/170 Four letters picked without replacement from {a: 2, l: 4, m: 3, x: 2, e: 1}. What is prob of picking 2 l and 2 m? 2/55 What is prob of picking 2 f, 1 r, and 1 g when four letters picked without replacement from rroffkftggrrgf? 72/1001 Three letters picked without replacement from {d: 4, s: 2}. What is prob of picking 1 d and 2 s? 1/5 What is prob of picking 1 o and 1 a when two letters picked without replacement from oyyooao? 4/21 Two letters picked without replacement from dihhidhhdhhidh. What is prob of picking 2 i? 3/91 Calculate prob of picking 3 u and 1 v when four letters picked without replacement from {u: 9, i: 4, v: 6}. 42/323 Calculate prob of picking 1 n and 2 e when three letters picked without replacement from {u: 1, x: 1, n: 2, r: 1, e: 4}. 1/7 Two letters picked without replacement from qtqq. Give prob of picking 2 q. 1/2 Calculate prob of picking 2 f when two letters picked without replacement from rrfrffrrrr. 1/15 What is prob of picking 2 f and 1 k when three letters picked without replacement from pkppppppppfppppfp? 1/680 Calculate prob of picking 1 z and 2 g when three letters picked without replacement from gazgg. 3/10 Three letters picked without replacement from {v: 8, h: 2, t: 7, z: 2}. What is prob of picking 1 v and 2 t? 56/323 What is prob of picking 2 j when two letters picked without replacement from {q: 2, j: 17}? 136/171 Calculate prob of picking 2 i, 1 x, and 1 e when four letters picked without replacement from isxscevi. 1/70 What is prob of picking 4 m when four letters picked without replacement from {s: 3, e: 1, h: 2, b: 1, m: 12}? 165/1292 What is prob of picking 1 l and 2 i when three letters picked without replacement from xaxlxnlilxxxaaiixa? 3/272 Four letters picked without replacement from {i: 7}. What is prob of picking 4 i? 1 What is prob of picking 1 l and 1 j when two letters picked without replacement from jjwwjjjwjjwjlwjjwwjj? 6/95 What is prob of picking 3 c and 1 i when four letters picked without replacement from iciccccicicicccc? 165/364 Calculate prob of picking 2 f when two letters picked without replacement from {h: 6, n: 1, f: 5, x: 2, l: 1}. 2/21 Two letters picked without replacement from {z: 2, j: 2}. What is prob of picking 1 j and 1 z? 2/3 What is prob of picking 3 a and 1 s when four letters picked without replacement from saaaaaaaaaaaa? 4/13 Two letters picked without replacement from {m: 1, x: 3, y: 4}. Give prob of picking 1 y and 1 x. 3/7 Two letters picked without replacement from tttttatat. Give prob of picking 2 t. 7/12 Calculate prob of picking 2 r and 1 e when three letters picked without replacement from rereeeeeeeeeeeeeee. 1/51 Calculate prob of picking 1 s and 1 z when two letters picked without replacement from {s: 3, z: 4}. 4/7 Three letters picked without replacement from {c: 1, k: 3, o: 13}. What is prob of picking 2 o and 1 c? 39/340 Two letters picked without replacement from jwljwjwjjjjlwjjjlwlt. Give prob of picking 1 l and 1 w. 2/19 Three letters picked without replacement from {f: 4, i: 2, l: 1}. What is prob of picking 1 i, 1 f, and 1 l? 8/35 Three letters picked without replacement from eeyejjzeeezeezezyzz. What is prob of picking 1 y and 2 e? 24/323 Calculate prob of picking 1 h, 1 s, and 1 c when three letters picked without replacement from jhkclhs. 2/35 Calculate prob of picking 1 b, 1 l, and 1 y when three letters picked without replacement from {l: 1, b: 1, y: 3, h: 3, d: 3}. 1/55 Calculate prob of picking 1 o and 1 t when two letters picked without replacement from otoooooooootooooooo. 34/171 What is prob of picking 2 y and 1 o when three letters picked without replacement from {o: 1, q: 1, y: 3}? 3/10 Three letters picked without replacement from pjjbpdpp. What is prob of picking 2 d and 1 p? 0 Two letters picked without replacement from bubuuuubmmbu. Give prob of picking 1 b and 1 m. 4/33 Calculate prob of picking 4 l when four letters picked without replacement from llllllllllllvlllvll. 35/57 What is prob of picking 1 l, 1 a, and 1 f when three letters picked without replacement from lafalllllllllaalllla? 7/114 What is prob of picking 1 q, 1 k, 1 i, and 1 y when four letters picked without replacement from viiqyykr? 2/35 Two letters picked without replacement from {f: 2, w: 1, e: 1, h: 6, g: 2}. What is prob of picking 2 f? 1/66 Calculate prob of picking 1 z and 1 c when two letters picked without replacement from zznpzppzzzzpcpzzpzz. 11/171 Four letters picked without replacement from uujcuuujucucuuuucuuj. Give prob of picking 4 u. 143/969 What is prob of picking 3 p and 1 d when four letters picked without replacement from {g: 4, d: 9, p: 3}? 9/1820 Calculate prob of picking 1 j and 1 w when two letters picked without replacement from jewzn. 1/10 Three letters picked without replacement from {v: 6, q: 1, a: 3, l: 1, n: 1}. Give prob of picking 2 a and 1 q. 3/220 Four letters picked without replacement from {u: 1, p: 2, j: 3, f: 1}. What is prob of picking 1 u, 1 f, 1 p, and 1 j? 6/35 Calculate prob of picking 1 c and 1 p when two letters picked without replacement from ucppuppppppiuupupiuu. 1/19 Four letters picked without replacement from {f: 4, t: 15}. What is prob of picking 2 f and 2 t? 105/646 Four letters picked without replacement from {z: 3, r: 1, v: 2, l: 1, b: 1, n: 3}. What is prob of picking 2 n, 1 r, and 1 b? 1/110 Four letters picked without replacement from uuucwuuuchuuu. Give prob of picking 2 u, 1 h, and 1 w. 36/715 What is prob of picking 1 u and 1 f when two letters picked without replacement from ffuf? 1/2 Two letters picked without replacement from {y: 2, s: 3, h: 4, c: 1, f: 1}. Give prob of picking 1 y and 1 s. 6/55 Three letters picked without replacement from {q: 2, h: 5, n: 7}. What is prob of picking 2 n and 1 h? 15/52 Calculate prob of picking 1 s and 1 j when two letters picked without replacement from zzjssjjzzjkzjjskzkz. 2/19 Three letters picked without replacement from {u: 3, x: 6, a: 2, i: 1, w: 2}. Give prob of picking 1	{ "pile_set_name": "DM Mathematics" }
/(-212)) + (2 - -1)? 5, 43 Let c = 1088 - 472. List the prime factors of c. 2, 7, 11 Let k(w) = -53w - 2. Let j be k(-3). Let x = j - 60. What are the prime factors of x? 97 Suppose -h = -2h - 10. Let w be ((-16)/(-20))/((-1)/h). What are the prime factors of (w/(-10))/(4/(-80))? 2 Suppose -p = 3x + 23 - 106, 2p = 4x - 114. Suppose 5j + 2j - x = 0. What are the prime factors of j? 2 Let k(l) = l. Let i be k(0). Suppose 0 = 4x + 4z - i + 32, x = -4z - 20. List the prime factors of 4/4(-24)/x. 2, 3 Let f be -3(-3 - (-20)/6). Let p be (0 + -2 - f)38. Let z = -14 - p. List the prime factors of z. 2, 3 Let m(v) = 56v*3 + 6v*2 - 5v - 3. List the prime factors of m(2). 3, 17 Suppose -7c = -4001 + 4. List the prime factors of c. 571 Let d be 1/(-2) + 561/6. Let x = 138 - d. List the prime factors of x. 3, 5 Let q = 551 + -143. What are the prime factors of q? 2, 3, 17 Suppose -365 = -7z + 244. Let m = z + -41. List the prime factors of m. 2, 23 Suppose -17 - 3 = r + 5t, 2r - 5t - 20 = 0. Suppose -5l + rl = -635. List the prime factors of l. 127 Let q = 32 - 20. Let m be (7 + -5)/((-1)/q). List the prime factors of m((-27)/6 + 4). 2, 3 Let c(k) = 2k + 2k - 2 - k + 0. Let n be c(2). Suppose 5o + 2r = -0r + 249, no + 3r - 195 = 0. What are the prime factors of o? 3, 17 Let t = -15 - -16. Let n = 0 - t. List the prime factors of n1 - (-11 + -12). 2, 11 Let l be -46/(-108) - (-101)/(-9). Suppose 3b - 4t - 70 = 0, 0 = 3b + 2b + 4t - 170. Let p = b + l. What are the prime factors of p? 19 Let s be (-6)/(-4) + 20/8. Let o(a) = a2 - 2 + s + 2 - a3 + a + 7. What are the prime factors of o(0)? 11 Suppose l + 2l + 222 = 0. What are the prime factors of 10/(-25) + l/(-10)? 7 Suppose y + 0 + 4 = 0. Let k be y/(-12) + (-16)/(-6). What are the prime factors of 18/(-6)(-13)/k? 13 Let u(h) = h*2 - 43h - 42. What are the prime factors of u(-23)? 2, 3, 41 Let n(q) = q*3 + 11q*2 - 3q - 26. Suppose -9z = -16z - 56. What are the prime factors of n(z)? 2, 5, 19 Let g be 5 - 2 - (3 + 7). List the prime factors of (-14)/2(g - 4). 7, 11 Suppose -622 = -2k + 4x, k - 204 - 113 = 4x. List the prime factors of k. 5, 61 Let k(c) = 3c - 3. Let t be k(4). Let d = -253 - -250. What are the prime factors of d/2(-132)/t? 2, 11 Suppose 3x - 284 = -767. Let w = -69 - x. List the prime factors of w. 2, 23 Suppose 37a - 6993 = 4810. List the prime factors of a. 11, 29 Suppose -5h = 12 - 2. Let j(z) = 53z - 57z - 5 + 11. What are the prime factors of j(h)? 2, 7 Let w(k) = k2 - 15k + 13. Let s be w(13). Let h = s + 25. List the prime factors of 212/(-6)h/(-8). 53 Let o be -1 + (-15)/(-1 + 4). Let r(t) = -t3 - 3t*2 + 6t + 4. List the prime factors of r(o). 2, 19 Let a be 0/(3/(4 + -1)). Suppose -n + 25 - 10 = a. List the prime factors of n. 3, 5 Let z(s) = -1794s + 34. What are the prime factors of z(-1)? 2, 457 Let u(v) = -v3 + 5v*2 - 5v + 10. Suppose 4x = 3x + 4. Let l be u(x). What are the prime factors of 1(0 + 1)l? 2, 3 Suppose 2132 = 71z - 2270. What are the prime factors of z? 2, 31 Let v(p) = p2 + 5p + 10. Let d(n) = -n*2 - 4n - 9. Let z(t) = -4d(t) - 3v(t). Let h be z(12). Suppose 3l = l + h. What are the prime factors of l? 3 Suppose 2n = -4h + 5252, h - 10478 = -4n + 6h. List the prime factors of n. 2, 3, 19, 23 What are the prime factors of 1 + -13(2 + -19 - -5)? 157 Let s(c) = -c*2 - 8c - 11. Let l be s(-5). Suppose -u - lu = 30. What are the prime factors of (-4)/u - (-426)/9? 2, 3 Suppose 6564 = 6j - 2226. List the prime factors of j. 5, 293 Let f = 426 - 191. Suppose 0 = 8h - 7h - m - 234, h - f = 2m. List the prime factors of h. 233 Suppose 4z + 23394 = -3w, -z + 17546 = -4z - 2w. List the prime factors of ((-4)/(-6))/(23388/z + 4). 5, 13 Suppose -12u + 6002 + 3046 = 0. List the prime factors of u. 2, 13, 29 Suppose 0 = -2n + c - 539, 2n - 3c + 499 + 46 = 0. Let i be (5/(10/n))/(-2). Suppose 0s - 2s = 5r - 20, 5s - i = -4r. What are the prime factors of s? 3, 5 Let b(l) = -l*2 - l - 1. Suppose -2r = -0 + 2. Let u(q) = -5q2 - 21q + 4. Let c(m) = ru(m) + 6b(m). What are the prime factors of c(12)? 2, 13 Suppose 3j + 12l - 4271 = 14l, -3j - l + 4268 = 0. List the prime factors of j. 1423 Let v(t) = -t2 + t + 45. Let u(w) = -w3 + w*2 + 2. Let k be u(0). Suppose 0 = 2j + f, j + kf = -3f. What are the prime factors of v(j)? 3, 5 Let x = 199 - -14. Let f = -24 + x. What are the prime factors of f? 3, 7 Let q = 32 - -60. Suppose q = w - 1. List the prime factors of w. 3, 31 Suppose 5p - o = 4756, 65o - 61o - 16 = 0. List the prime factors of p. 2, 7, 17 Let q = 64 - 198. Let c = q + 211. What are the prime factors of c? 7, 11 Suppose -15u + 29u = 48090. What are the prime factors of u? 3, 5, 229 Let s(m) be the second derivative of -m4/12 + m3/2 + 5m*2/2 - m. Let c be s(3). Suppose c - 11 = -g. What are the prime factors of g? 2, 3 Suppose 0 = -5p + 1445 + 1600. What are the prime factors of p? 3, 7, 29 List the prime factors of (-9 + 3)(-966)/9. 2, 7, 23 Let b be 12/81/(3/220). Suppose 918 - b = 4y. List the prime factors of y. 2, 101 Let t(q) = q2 + 3q - 2. Let y be t(1). Suppose -yi = -0i. Suppose iw - 203 = -7w. List the prime factors of w. 29 List the prime factors of (-560)/(-15)(-60)/(-14). 2, 5 Let c(h) = -h2 - 17h + 22. Let b be c(-18). Let q(x) = 39x + 9. List the prime factors of q(b). 3, 5, 11 Let p(s) = 101s + 198. What are the prime factors of p(13)? 1511 Let t = -4 - -3. Let c be 3 - (-2 + 0 - t). Suppose -19 = -co + 21. List the prime factors of o. 2, 5 Let i = -22 - -24. Suppose 10 - 4 = -ip. What are the prime factors of (-124)/p + (-10)/30? 41 Suppose 0 = -l - 3v + 303, 0 = -2l + 5v - 0v + 595. Suppose 96 = -4s + l. List the prime factors of s. 3, 17 Suppose 3v + d - 9 = 0, -4v = -v - 4d + 6. Suppose -5b = vr + 180, 4b + 108 = b + r. Let a = 53 + b. What are the prime factors of a? 17 Let d(r) = -7r*2 - 4r + 11. Let z be d(-5). List the prime factors of (z - 6)(-2)/5. 2, 3, 5 Let v be (-1 - -19)(-2)/(-4). Suppose -32 = 7f - vf. List the prime factors of f. 2 Let q(t) = -t - 9. Let m be q(-11). Let j(l) = -77l - 2 - 4 + 4l*m + 88l. What are the prime factors of j(-5)? 3, 13 Suppose -19o + 2526 = -3896. What are the prime factors of o? 2, 13 Suppose 0 = -0n - 4n - x + 1693, 3x = -9. List the prime factors of n. 2, 53 Suppose -2l + 6l = 0. Suppose l = -4n + 72 + 28. List the prime factors of n. 5 Suppose -5q = -243 - 57. Suppose -3v - 2x - 36 = -v, -5v = -5x + q. List the prime factors of ((-9)/v)/15. 3 What are the prime factors of (-8)/3(-21087)/22? 2, 3, 71 Let z = 144 + -141. Suppose 0 = 3i + 2u - 713, zu = -2i + 7i - 1163. List the prime factors of i. 5, 47 Let x(o) be the first derivative of o4/4 - 5o3/3 + o2 - 3o - 54. Suppose -3c = -4s - 11, 4c - 17 = -5s + 8. List the prime factors of x(c). 7 Let x(t) = -5t*3 + 3t*2 + t + 3. Let i be x(-3). Let w = i + -60. What are the prime factors of w? 2, 3, 17 Suppose 2y - 533 = 4d - 27, 0 = -4y - 5d + 1025. What are the prime factors of y? 3, 5, 17 Suppose -8b + 2b + 132 = 0. List the prime factors of b. 2, 11 Suppose -n + 4j + 209 + 2203 = 0, -2n = 2j - 4814. What are the prime factors of n? 2, 7, 43 Suppose 5g + 2y = 1907, 3y - 146 - 238 = -g. What are the prime factors of g? 3, 127 Let j be 80/(-3 + 7)-8. Let y = j - -231. What are the prime factors of y? 71 Let b = -3 - -11. Let q be (-24)/(-9) + b/(-12). Let t(l) = 15l + 3. What are the prime factors of t(q)? 3, 11 Suppose -2m + 1683 = m - 4y, 0 = -4m - y + 2263. Suppose -5x + 130 + m = 0. What are the prime factors of x? 139 Suppose 0k + 1564 = 4c + 3k, 3k + 12 = 0. List the prime factors of c. 2, 197 Let k(v) be the second derivative of 0 + 1/4v*5 - v - 1/6v*3 + 0v*2 - 1/12v*4. List the prime factors of k(2). 2, 17 Let z be -8(-7)/(14/8). Suppose 0 = -5w + w + z. Suppose -wi + 169 + 23 = 0. List the prime factors of i. 2, 3 Suppose 4k = 4f + 6992, -4f - 819 = -k + 920. List the prime factors of k. 17, 103 Suppose 5t + 11 - 31 = 0. Suppose -j = 5k - 718, -2k = -7k + tj + 728. List the prime factors o	{ "pile_set_name": "DM Mathematics" }
j - 3j = 3i - 24, -9 = -3j. Suppose c = io - 6 - 22. What is the units digit of o? 7 What is the thousands digit of -451/(-68)10072? 0 Suppose 0 = -3r - 15, 3b - 2r + 147438 - 58375 = 0. What is the tens digit of (-22)/(-209) - b/57? 2 Suppose -366 - 685 = -x + 2k, 4x - 4240 = -4k. Let i = x + -350. What is the tens digit of i? 0 Let b(h) = 178h2 + 4h - 2. Let p = 327 + -325. What is the tens digit of b(p)? 1 Suppose -2i = -2, -3w - 8 = 3i - 107. Suppose wz = 34z - 590. What is the units digit of z? 5 Suppose -c = 3j - 194415, 0 = 5j + 6c - 2c - 324025. What is the thousands digit of j? 4 Let d(t) = 2t*2 + 7t - 6. Let g be d(5). Let f = 3884 - 3907. Let j = f + g. What is the tens digit of j? 5 Suppose 8 = -2d - 16. Let z(j) be the third derivative of j5/60 + j4/12 - 4j*3 + 27j*2 + 2j. What is the tens digit of z(d)? 9 Let w be -3 + (-1225)/21 - (-2)/6. Let z = 99 + w. What is the units digit of z? 8 Suppose 21v = 25v + 2r - 10, 2v - 7 = r. Let c(b) = 179b2 + 13b - 36. What is the units digit of c(v)? 4 Let l = -258 - -626. What is the tens digit of l + ((-66)/(-18) - 5)-3? 7 Suppose -4y - 4k = 104, 0 = -2y + 4y - 4k + 82. Let p = 41 - y. Suppose a + p = i, -2a + a + 372 = 5i. What is the units digit of i? 4 Suppose -m - q - 3q + 170 = 0, -q = -3m + 471. Suppose -1450 = -12x + m. What is the hundreds digit of x? 1 Suppose -4h = 14r - 135927 - 102869, 5h - 298495 = r. What is the units digit of h? 9 Let x(f) = 6f3 - 3f*2 + 32f + 17. Let s be x(7). Suppose 4w + s = 7592. What is the thousands digit of w? 1 Suppose 5l + 13554 = 3c, 4l = 246c - 241c - 22590. What is the thousands digit of c? 4 Suppose -6 = -20x + 18x. Suppose 5u - xu + u = 0. What is the units digit of u/(4/2) + 56? 6 Let x(j) = -384j3 + 2j*2 + j + 5. Let s be x(-2). Let n = -1964 + s. What is the thousands digit of n? 1 Let n be 139/(33/15 - 2). Suppose 2041 = 2w + w + 4d, w + 5d - n = 0. Suppose -5z + 645 = 4t, 3z + w = 4t - 2z. What is the tens digit of t? 6 Suppose -2s - 1287 = 7s. Let h = s - -17. Let y = h - -215. What is the tens digit of y? 8 Suppose m = -2m + p - 303, 404 = -4m - 5p. Suppose -11o - 818 = 931. Let d = m - o. What is the units digit of d? 8 Suppose 3h - 5b - 3 = 2h, 4b = 4h + 4. Let p be (h + (3 - (-1 + 1)))-1. What is the units digit of (-10)/25 - (636/15)/p? 2 Suppose -12 = -28p + 24p. Let v = -9 - p. What is the tens digit of (95/2)/((-6)/v)? 9 Suppose 0 = -14o + 19o + 3z - 39089, 3o - 5z - 23467 = 0. What is the thousands digit of o? 7 Suppose -5d = 15d + 5d. Suppose 4s - 135 - 209 = d. What is the units digit of s? 6 Let k(c) = c*3 + c - 8. Let n = 5 - 0. Let b be k(n). Let f = -56 + b. What is the tens digit of f? 6 Suppose -81g + 54020 = -71g. Suppose 4j + m - 854 - g = 0, 4m - 16 = 0. What is the hundreds digit of j? 5 Let l be (10208/(-48))/(6/135). What is the tens digit of (-17)/(255/l) + (3 - -1)? 2 Suppose 40u - 192485 - 47387 = 413768. What is the units digit of u? 1 What is the hundreds digit of (-3)/(-2) + ((-606606)/(-12) - -5)? 5 Let s be (300/(-9))/(2/6). Suppose 0 = -995u + 1000u + 1375. Let p = s - u. What is the units digit of p? 5 Suppose 5g - 3j + 14 = 0, g + 3g + 26 = -5j. Let b(s) = -20s3 + 17s*2 + 53s + 3. What is the units digit of b(g)? 3 Suppose 4l = -2o + 902, 18 = 5l + 8. Let p = o - 335. What is the hundreds digit of p? 1 Let l be 1 + 42/(-4)2. Let j(o) = 4o2 - 126o - 159. Let x be j(33). Let w = x - l. What is the tens digit of w? 5 Suppose -4s + 546 = -3z, -2z = -4s + 268 + 280. Let b be (-9)/(-3)130/15. Suppose 4g - s = -b. What is the tens digit of g? 2 Let n be (-39 - -40)/(4/(-8)). Let b(h) = h + 4. Let y be b(-2). What is the units digit of (-8 - n)/(-6) + 196/y? 9 What is the units digit of (3 - (-1617)/1)(52 - 51)? 0 Let k = -42 - -42. Let o(n) = 7n + 11. Let d be o(k). Suppose 405 = -6v + dv. What is the tens digit of v? 8 Let y = -22 + 64. Let m be 1372/6 - (-56)/y. Suppose -143 = -4z + 5q, -5z + m = -4q + 58. What is the units digit of z? 2 Let b(z) = 6z2 - 21z - 86. Let d be b(-9). Let u = 675 - d. What is the units digit of u? 6 Let i = -9575 - -22278. What is the units digit of i? 3 Suppose 0 = -56c + 16c + 272747 + 100413. What is the hundreds digit of c? 3 Suppose -8m = 1068 - 84. Let n = 165 + m. What is the units digit of n? 2 Let z(j) = -2j + 23. Let a be z(11). Suppose 4v = -c - a, -23 + 3 = 4v. Suppose -cd + 6d + 390 = 0. What is the units digit of d? 0 Suppose -3h = -h - 3n - 43, -4n + 116 = 4h. Suppose -5d + 5k = -65, 4d - 3k - 45 = 8. Suppose -dw = -hw + 1884. What is the units digit of w? 7 Suppose -3m = -2j + 598 + 92, 5j - 1699 = m. What is the hundreds digit of j? 3 Let p = 893 + -495. Let n = -7 + p. What is the hundreds digit of n? 3 Let o(y) = 46y + 598. Let t be o(-13). Let i be (0 - -2) + -3 + 1. Suppose 5k + 2p - 1231 = t, 3k + ik = -p + 738. What is the units digit of k? 5 Let i(k) = -59k3 - k2 + 2k + 3. Suppose 6s = 3s - 6, 2j + 4s = -8. Suppose 14v - 18v - 4 = j. What is the units digit of i(v)? 9 Let u(c) = -5c3 - 46c*2 - 40c - 123. What is the hundreds digit of u(-21)? 7 Let p(i) = -18736i + 2662. What is the units digit of p(-2)? 4 Let n = 6146 + 5468. What is the ten thousands digit of n? 1 Suppose 277b - 478686 = -143830 + 704171. What is the thousands digit of b? 3 Suppose 60788 = 262w - 279w + 169792. What is the units digit of w? 2 Let y be (7 + -12 + 5)/(-1 + 2). What is the units digit of y + 1 - (6 + -7 - 2)? 4 Suppose 0 = -0t + 6t - 336. Suppose 52j + 1996 = tj. What is the units digit of j? 9 Suppose c = -19c + 143980. What is the hundreds digit of c? 1 Let q = 2444 - 2083. Suppose h + 0h + 132 = 0. Let a = q + h. What is the tens digit of a? 2 Suppose -q = 15k - 16k + 2627, -2q + 13128 = 5k. What is the hundreds digit of k? 6 Let d be 6/(-18) + (-11)/3. Let a be 78 + 12/(0 + d). Suppose -8s = -3s - a. What is the units digit of s? 5 Suppose 41w + 15 = 46w. Suppose 1500 = wn + 159. What is the units digit of n? 7 Let s be (441/7)/(4/(-76)). Let l = s - -2651. What is the tens digit of l? 5 Suppose 0b = -3b + 24. Suppose 3r - h = b, -4r = 4h - 11 - 21. Suppose -rw + 136 = 4x, x + 2 - 34 = w. What is the tens digit of x? 3 Let x(g) = 4g3 + 2g*2 - 6g - 4. Let c be x(-4). Let d = 402 + c. What is the units digit of d? 8 Let t(p) = -37 + 0p - 24 + 69 + 6p. Let f be t(1). Suppose -fy - 408 = -31y. What is the units digit of y? 4 What is the hundreds digit of (-2)/42-3 - (-8800423)/721? 2 Let p = 58 - 48. Suppose -pl - 239 = 111. Let r = l + 137. What is the tens digit of r? 0 Suppose -3402 = -2i - 4c, 2i + 1435 = 3c + 4837. What is the thousands digit of i? 1 Suppose 3g - 15 = -3v, 9g - 4v - 4 = 7g. Let r(m) = 9m*2 + 3m - 6. Let u be r(5). Suppose -gj = -j - u. What is the units digit of j? 8 Let m be -7 + 3 + 0 + 9. Suppose -5x = -3r - 12, -4 = -3x + mx + r. Suppose x = -4l + 8, 688 = 5g - 5l + 163. What is the units digit of g? 7 Suppose -369270 = -149s + 83s. What is the hundreds digit of s? 5 Let r be (1 + 0 - (-3184)/48)-3. Suppose -2 = -2w, w + 4w + 1339 = -4i. Let o = r - i. What is the tens digit of o? 3 Suppose -74o - 2140 = -76o. Let m = 1612 - o. What is the hundreds digit of m? 5 Suppose 4f + 41 = -5p, 3f = 2p + 3p - 57. Let l be (-12)/f112/32. Let r(j) = 4j2 + 6j + 3. What is the tens digit of r(l)? 5 Let p = 72 - 62. Suppose 16b = pb + 1332. What is the hundreds digit of b? 2 Let w(l) = l*2 - 3. Let k be w(4). Let g(v) = 10v - 19. Let u(i) = -12i + 18. Let f(m) = 5g(m) + 4u(m). What is the units digit of f(k)? 3 Suppose 6q - 10q - 824 = 0. Let n = q + 437. What is the tens digit of n? 3 Suppose 0 = -5i, -2s + 2i + 992 = 6i. Let t = s + 196. What is the tens digit of t? 9 Let v be ((-297)/(-9))/(30/(-64))5. Let l = 440 + v. What is the units digit of l? 8 Let k(v) = 6v2 + 5v - 11. Let f be k(3). Suppose -3m - 12 = 0, 3t - f - 1307 = 3m. What is the tens digit of t? 5 Let l be -2 + (2 - 0)/(8/12). Let c be (4 - -6) + (-3 - l). Suppose -2p = -c*p + 868. What is the hundred	{ "pile_set_name": "DM Mathematics" }
ppose 2k3/3 - 736k*2/3 + 1466k/3 - 244 = 0. What is k? 1, 366 Factor y3/5 + y2/5 - 8y/5 - 12/5. (y - 3)(y + 2)*2/5 Factor 3f*3/5 + 3f*2/5 - 3f + 9/5. 3(f - 1)2(f + 3)/5 Find w, given that 147w5/2 - 1218w*4 + 3561w*3/2 - 726w*2 + 90w = 0. 0, 2/7, 1, 15 Determine o, given that -o*3 + 43o*2/6 + 80o/3 + 50/3 = 0. -2, -5/6, 10 Solve -85a4 + 335a*3 - 65a*2 - 515a - 30 = 0 for a. -1, -1/17, 2, 3 Let 100l4 + 715l*3 + 95l*2 - 70l = 0. What is l? -7, -2/5, 0, 1/4 Let j*2/2 + 28j + 392 = 0. What is j? -28 Factor 3q3/2 + 30q*2 + 96q. 3q(q + 4)(q + 16)/2 Factor w5 - 28w*4 + 238w*3 - 796w*2 + 985w - 400. (w - 16)(w - 5)2(w - 1)*2 What is a in -28a*4 - 146a*3 - 194a*2 - 16a + 24 = 0? -3, -2, -1/2, 2/7 Factor 5h2 - 180h. 5h(h - 36) Factor 3d2 + 102d + 675. 3(d + 9)(d + 25) Solve -3h4/2 - 151h*3/2 - 165h*2 + 144h = 0. -48, -3, 0, 2/3 Factor q*5 - 49q*4 + 810q*3 - 4576q*2 - 512q + 24576. (q - 16)*3(q - 3)(q + 2) Factor -2f*2 + 244f - 7442. -2(f - 61)2 Solve -75y*4/8 - 135y*3/2 + 1143y*2/8 - 159y/2 + 27/2 = 0 for y. -9, 2/5, 1 Let 2i4/3 + 38i*3/3 + 76i*2 + 448i/3 + 256/3 = 0. Calculate i. -8, -2, -1 Solve -g*4 + 512g*2 - 65536 = 0. -16, 16 Suppose -8z*3/5 + 8z*2/5 - 2z/5 = 0. What is z? 0, 1/2 Factor -z*3/3 - 749z*2/3 - 1495z/3 - 249. -(z + 1)*2(z + 747)/3 What is n in -4n2/5 - 8n - 20 = 0? -5 Find h such that -2h5 - 50h*4 - 200h*3 = 0. -20, -5, 0 Factor 2l*4/11 + 48l*3/11 + 16l*2 - 1344l/11 + 1568/11. 2(l - 2)2(l + 14)2/11 Factor x4/4 - 3x3/4 - 5x*2/4 + 3x/4 + 1. (x - 4)(x - 1)(x + 1)2/4 Suppose -n2/4 + 107n - 11449 = 0. What is n? 214 Factor 4a*4/3 + 13256a*3/3 - 13264a*2 + 39800a/3 - 13268/3. 4(a - 1)3(a + 3317)/3 Factor -3k2/8 + 72k. -3k(k - 192)/8 Find k, given that -6k5/17 - 2044k*4/17 - 10280k*3 - 6800k2 = 0. -170, -2/3, 0 Factor b5 - 13b4 + 55b*3 - 75b2. b2(b - 5)2(b - 3) Let 2j2/11 + 1872j/11 + 438048/11 = 0. What is j? -468 Solve -b*2/5 - 22b/5 + 15 = 0. -25, 3 Factor l*2 + 13l - 14. (l - 1)(l + 14) Factor 48z*3 + 4552z*2 + 106387z - 72962. (3z - 2)(4z + 191)2 Factor -t4/3 + 7t*3/3 - 17t*2/3 + 17t/3 - 2. -(t - 3)(t - 2)(t - 1)*2/3 Factor 5k*4 + 5k*3 - 320k*2 - 320k. 5k(k - 8)(k + 1)(k + 8) Let 3x4 + 6x*3 - 27x*2 - 6x + 24 = 0. What is x? -4, -1, 1, 2 Factor -a*3 + 3a*2 - 3a + 1. -(a - 1)*3 Suppose 15t*2 - 715t + 700 = 0. Calculate t. 1, 140/3 Factor 3u4 + 24u*3 + 69u*2 + 84u + 36. 3(u + 1)(u + 2)*2(u + 3) Find j, given that -j*4 - 11j*3 - 42j*2 - 64j - 32 = 0. -4, -2, -1 Solve -2z5/5 + 12z*4/5 - 2z*3 - 32z*2/5 + 24z/5 + 32/5 = 0 for z. -1, 2, 4 Factor -20p3 - 2672p*2 - 88708p + 35912. -4(p + 67)2(5p - 2) Solve -9z*2/2 - 87z/4 + 15/4 = 0 for z. -5, 1/6 Factor -q3/6 + q2 + q/6 - 1. -(q - 6)(q - 1)(q + 1)/6 Factor 3q3/7 - 447q*2/7. 3q*2(q - 149)/7 Factor -3u2/7 + 7494u/7 - 4680003/7. -3(u - 1249)2/7 Suppose 5q*5/3 - 46q*4/3 + 104q*3/3 + 26q*2/3 - 109q/3 + 20/3 = 0. What is q? -1, 1/5, 1, 4, 5 Suppose -5w2 - 64580w - 208528820 = 0. What is w? -6458 Solve 98j4/5 - 119j*3/5 - 12j*2/5 + 36j/5 = 0 for j. -1/2, 0, 6/7 Factor 3o4/4 - 3o*3/4 - 27o*2/2 + 39o - 30. 3(o - 2)3(o + 5)/4 Factor 2w2/7 + 10w/7. 2w(w + 5)/7 Factor -2j3/17 + 74j*2/17 - 440j/17 + 600/17. -2(j - 30)(j - 5)(j - 2)/17 Let -8c*4/5 + 102c*3/5 + 180c*2 + 256c/5 - 960 = 0. Calculate c. -4, 2, 75/4 Factor j*3/3 + 7j*2/2 - 19j/3 - 4. (j - 2)(j + 12)(2j + 1)/6 Factor -4x*4 - 24x*3 - 52x*2 - 48x - 16. -4(x + 1)2(x + 2)*2 Suppose 5y*2 - 635y - 640 = 0. Calculate y. -1, 128 Factor 5d3/2 + 51d*2/2 + 55d/2 + 9/2. (d + 1)(d + 9)(5d + 1)/2 Factor 5p*4 + 65p*3 + 220p*2 + 160p. 5p(p + 1)(p + 4)(p + 8) Find g, given that 910116g3 - 913932g*2 + 3820g - 4 = 0. 1/477, 1 Solve 9b5 + 33b*4 - 21b*3 - 141b*2 - 60b + 36 = 0. -3, -2, -1, 1/3, 2 Find t such that -2t2/3 + 256t/3 - 3584/3 = 0. 16, 112 Let 4i3 + i2 - 14i + 9 = 0. Calculate i. -9/4, 1 Factor 128u2/5 - 42144u/5 + 3468978/5. 2(8u - 1317)*2/5 Factor 12t*4 + 176t*3 + 832t*2 + 1344t + 576. 4(t + 2)(t + 6)*2(3t + 2) Factor 122w*3 + 240w*2 + 114w - 4. 2(w + 1)2(61w - 2) Find r, given that 4r*4/7 - 1780r*3/7 = 0. 0, 445 Find i such that 1331i*3/5 - 219252i*2/5 + 12038928i/5 - 220348864/5 = 0. 604/11 Let 25f2 - 35f = 0. Calculate f. 0, 7/5 Find h, given that -2h3/5 + 174h*2/5 - 228h + 320 = 0. 2, 5, 80 Let -2p4/5 - 32p*3/5 + 44p*2/5 + 176p/5 + 102/5 = 0. What is p? -17, -1, 3 Determine y, given that 15y4 + 185y*3 + 590y*2 + 60y - 360 = 0. -6, -1, 2/3 Factor 9x4 + 195x*3 + 126x*2. 3x*2(x + 21)(3x + 2) Factor 5g2 - 7800g + 15580. 5(g - 1558)(g - 2) Factor 2a5/7 - 50a*4/7 + 380a*3/7 - 860a*2/7 + 110a - 242/7. 2(a - 11)2(a - 1)*3/7 Find u such that -2u*2/5 - 5532u/5 - 3825378/5 = 0. -1383 Suppose -4v3/5 + 1928v*2/5 - 232324v/5 = 0. What is v? 0, 241 Factor -c*4/8 - 5c*3/8 + 7c2/4. -c2(c - 2)(c + 7)/8 Factor o*5 - 96o*4 + 3072o*3 - 32768o2. o2(o - 32)3 Suppose 3l*5/7 - 4188l*4/7 + 1469964l*3/7 - 5829696l*2/7 + 5812992l/7 = 0. What is l? 0, 2, 696 Factor v*3 + 7v*2 - 10v - 16. (v - 2)(v + 1)(v + 8) Factor -q*2 - 487q + 1470. -(q - 3)(q + 490) Suppose -4m*3 - 132m*2 + 1936m = 0. Calculate m. -44, 0, 11 What is i in i*5 + 5i*4 + 9i*3 + 7i*2 + 2i = 0? -2, -1, 0 Let w*4/3 + 25w*3/3 - 28w*2/3 - 52w/3 = 0. What is w? -26, -1, 0, 2 Solve v*4/3 - 6v*3 + 31v*2 - 136v/3 + 20 = 0. 1, 6, 10 Determine n, given that -n*4 + 96n*3/5 - 99n*2/5 - 164n/5 + 36/5 = 0. -1, 1/5, 2, 18 Factor -j*4/2 - 11j*3/2 + 13j2. -j2(j - 2)(j + 13)/2 Factor -w*3 - 78w*2 + 1941w - 1862. -(w - 19)(w - 1)(w + 98) Factor -2n3 - 72n*2 + 2n + 72. -2(n - 1)(n + 1)(n + 36) Factor -3a*2/7 + 54a/7 - 195/7. -3(a - 13)(a - 5)/7 Solve 4p4 + 16p*3 + 8p*2 - 16p - 12 = 0 for p. -3, -1, 1 Determine y, given that -3y4 + 30y*3 + 3y*2 - 30y = 0. -1, 0, 1, 10 Factor -r*4 - 3r*3 + 4r. -r(r - 1)(r + 2)*2 Factor 3k*2 - 5736k + 2741808. 3(k - 956)2 Factor -3o*3/7 - 183o*2/7 + 192o/7 + 372/7. -3(o - 2)(o + 1)(o + 62)/7 Factor -2i*5/17 - 8i*4/17 - 2i*3/17 + 20i*2/17 + 8i/17 - 16/17. -2(i - 1)2(i + 2)*3/17 Factor 28d*3/3 - 152d*2 + 548d/3 - 40. 4(d - 15)(d - 1)(7d - 2)/3 Suppose 2809w3/4 - 2915w*2/2 + 107w - 2 = 0. What is w? 2/53, 2 Factor -2f3 - 48f*2 - 160f. -2f(f + 4)(f + 20) Factor -5r*2 + 95r + 330. -5(r - 22)(r + 3) Let 3x3/5 - 3x*2 + 18x/5 = 0. What is x? 0, 2, 3 Factor 8j3 + 20j*2 - 44j + 16. 4(j - 1)(j + 4)(2j - 1) Factor -5m2 - 580m - 575. -5(m + 1)(m + 115) What is i in -2i3 + 22i*2 - 38i + 18 = 0? 1, 9 Find v, given that -v*4/5 - 778v*3/5 - 202788v*2/5 - 3594456v - 68694048/5 = 0. -258, -4 Factor 3m4 + 57m*3 + 195m*2 + 231m + 90. 3(m + 1)2(m + 2)(m + 15) Find g such that 2g*5/13 - 14g*4 + 4794g*3/13 - 2050g*2 - 73964g/13 = 0. -2, 0, 11, 41 Determine v, given that -2v5/9 + 88v*4/9 - 968v3/9 = 0. 0, 22 Factor y2/5 - 88y/5 + 1936/5. (y - 44)2/5 Factor 8q*3/11 + 194q*2/11 + 48q/11. 2q(q + 24)(4q + 1)/11 Let 2b2/3 + 8b + 18 = 0. Calculate b. -9, -3 Factor -3o2/7 - 3o. -3o(o + 7)/7 Factor 2v4/9 - 2v*3/3 + 2v*2/9 + 2v/3 - 4/9. 2(v - 2)(v - 1)*2(v + 1)/9 Solve 2r2 + 32r - 34 = 0. -17, 1 Factor 3j3/2 - 15j*2 - 111j/2 - 39. 3(j - 13)(j + 1)(j + 2)/2 Factor 5x*3 - 285x*2 + 4875x - 21875. 5(x - 25)2(x - 7) Find w, given that 3w4/7 - 3w*3/7 - 30w*2/7 - 24w/7 = 0. -2, -1, 0, 4 Suppose -2n4/7 + 296n*3/7 + 302n*2/7 - 596n/7 = 0. Calculate n. -2, 0, 1, 149 Solve 3k5 - 12k*4 + 9k*3 = 0. 0, 1, 3 Factor 3s*2 - 78s - 168. 3(s - 28)(s + 2) Factor -3x4 - 9x*3 + 9x*2 + 33x + 18. -3(x - 2)(x + 1)*2(x + 3) Let -5v4 + 150v*3 + 175v*	{ "pile_set_name": "DM Mathematics" }
sqrt(2)2 + sqrt(2)))2. -sqrt(17)/60 + 230417/57600 Simplify 6(1 + sqrt(1331) + 0 + (sqrt(99)-2-4)/sqrt(9))13. 18 + 342sqrt(11) Simplify (sqrt(352)/(sqrt(8) + (sqrt(288)-3 - sqrt(8))) + -1sqrt(2816) + -2)5. -725sqrt(11)/9 - 10 Simplify -3 + 4sqrt(12)-6 + sqrt(12) - (sqrt(363)2 - (4sqrt(3) + -4)). -64sqrt(3) - 7 Simplify 3(642sqrt(52))/((sqrt(8)1-4)/sqrt(2)) + 5. -36sqrt(13) + 5 Simplify ((4 + -6sqrt(57)/sqrt(3) + (sqrt(133)-1)/sqrt(7))2 + (sqrt(2736)-1 - (sqrt(19) + -1)-5))-4. -3768 + 252sqrt(19) Simplify -5 + (((sqrt(33)/sqrt(99))2 - (sqrt(3) + sqrt(3) + 0 + -4)2) + 5 - (-1 + (-2sqrt(243)-1-4)*2)). -46736/3 + 16sqrt(3) Simplify 2 + (-1 + (sqrt(720) - 2(sqrt(720) + 0)) + (sqrt(720) + sqrt(720) + sqrt(720)1 + 5 - 2sqrt(720)2))*2. -192sqrt(5) + 2898 Simplify -3((-4 + sqrt(19) + -4)-3 + (6(sqrt(2299) + -1))2). -248472 + 2385sqrt(19) Simplify 4 + (66sqrt(99)-1 + 1 - 4(sqrt(99) + -4 + sqrt(99) + -1 - (sqrt(99) + -5-2sqrt(99))))*2. 445 Simplify ((-35sqrt(2058) - sqrt(2058))-6)/(sqrt(1728)/sqrt(8) - (sqrt(6)-3 + sqrt(6))3). 56sqrt(7) Simplify ((2sqrt(468)-33)*2 - (sqrt(468) - (-1 + sqrt(468))4 - (sqrt(468) - (-5 + sqrt(468) + 1 + sqrt(468) - sqrt(468) - sqrt(468))))*2) + -4 + 3. 144143 Simplify (-3(sqrt(2904) - (sqrt(2904)-1-4 + sqrt(2904))))/(sqrt(224)/(sqrt(14)/sqrt(2)) - (sqrt(1568) - (sqrt(1568) + -2sqrt(1568) - sqrt(1568)))). -33sqrt(3)/10 Simplify -4 + -56(-5 + (sqrt(8) - sqrt(2)) + -4 + (sqrt(128) + 1sqrt(128))-4 + sqrt(128)). 266 + 1650sqrt(2) Simplify ((4(sqrt(1053) + (sqrt(1053) - (sqrt(1053) + 1sqrt(1053)))) + sqrt(1053) + sqrt(1053) + 2sqrt(1053) + -4 - (-1 + (-2 + sqrt(1053))-6))4 + -1)*2. -43920sqrt(13) + 1688521 Simplify ((sqrt(153) + 0)4 - (sqrt(153) + 4 + (sqrt(153) - (sqrt(153) - sqrt(153)-1))))*2 - (sqrt(153)-22)/(sqrt(9) - sqrt(99)/(-2sqrt(11))). -280sqrt(17)/3 + 2464 Simplify (-2 + (sqrt(76) + -4 + sqrt(76) + 1 + sqrt(76) + 2 + -2sqrt(76) + -1 - (5(sqrt(76) - -1sqrt(76) - sqrt(76)) - (sqrt(76)36 - sqrt(76)))))*2. -208sqrt(19) + 12860 Simplify (sqrt(95) + -3((sqrt(95) - sqrt(95)1) + sqrt(95)) + sqrt(95) - (-2sqrt(95) + sqrt(95))5)/(-2-6(sqrt(5) - sqrt(180)6)). -sqrt(19)/105 Simplify -3(3(2 + sqrt(832) - -2sqrt(208)) + 6((sqrt(130)4)/sqrt(10) + sqrt(13)) + -5). -234sqrt(13) - 3 Simplify -1((3((sqrt(308)2 - sqrt(308)) + sqrt(308)))/(2sqrt(567)) - (2sqrt(1100)4 + (2sqrt(1100) + 2)*2)). 478sqrt(11)/3 + 4404 Simplify ((5sqrt(847)1 + -4(sqrt(847) - 2sqrt(847)) + 0 + 5(sqrt(847) + 1))2)*24. 24640sqrt(7) + 2656592 Simplify ((sqrt(405) - 4(sqrt(405) + 4)) + 2)*2 + 0 + (-5(sqrt(320) + -3))*2. -444sqrt(5) + 12066 Simplify ((-4 + sqrt(68) + 1 + 1)51 + 4 + 0)*2. -120sqrt(17) + 1736 Simplify (4 + ((sqrt(15)/sqrt(45) + (sqrt(72)/sqrt(2))/sqrt(12))-4 - sqrt(147)15-1))*2. 712sqrt(3)/3 + 7969/3 Simplify 0 + -6-3(3 + (-2 + sqrt(3564))*2 + -1). -1296sqrt(11) + 64260 Simplify (-1(sqrt(143)/(sqrt(11) + sqrt(99)) - (-1 + -1sqrt(13))) + ((sqrt(130) + (sqrt(130) - sqrt(130)3) + sqrt(130))-2)/(sqrt(810) + 1sqrt(810)))2. 5sqrt(13)/2 + 341/16 Simplify ((sqrt(720) - (sqrt(720) + 2))1 + -3 + sqrt(720) + 2 + -1(sqrt(720) + sqrt(720) + sqrt(720)-1) + (sqrt(720) - (0 + sqrt(720)-1)))*2. -144sqrt(5) + 2889 Simplify (-32(sqrt(88) + (sqrt(88) + sqrt(88)2)2))/(sqrt(392) + 1sqrt(392)-1 + (1sqrt(392)2 - sqrt(392))). -6sqrt(11) Simplify (-2sqrt(216) + sqrt(6) - sqrt(24)2)/(-3sqrt(128)/sqrt(4)) + -3. -3 + 5sqrt(3)/4 Simplify -5 + -1 + (sqrt(54)/(sqrt(294)-2))/(sqrt(30)/(sqrt(10) - -4sqrt(250))). -6 - 3sqrt(3)/2 Simplify (2sqrt(972))/(sqrt(81)-4) - (-2 + -3 + sqrt(108)-2)2. -457 - 121sqrt(3) Simplify ((sqrt(220) - (sqrt(220) + 6(sqrt(220) - 2sqrt(220))))/(-2sqrt(400)))/(sqrt(100)/sqrt(5) - (sqrt(720)1 - sqrt(720) - sqrt(720))). -3sqrt(11)/140 Simplify (4((4 + 2sqrt(99) - sqrt(99)) + sqrt(99) - sqrt(99)) - (0 + (sqrt(77)-1)/sqrt(7))-2)2. 320sqrt(11) + 1356 Simplify -2((sqrt(2) - sqrt(32)) + 0 + (sqrt(2) - sqrt(450)))2 - (sqrt(112)/sqrt(32))/(sqrt(7)23). -1156 - sqrt(2)/12 Simplify 3 + (6((-6sqrt(72)-2 - sqrt(72)) + (sqrt(72) + -1)5 + 1))2. -27648sqrt(2) + 664131 Simplify (2 + (2-1sqrt(162) + sqrt(162))*26 - (-1(3 + sqrt(162)) - (-1 + sqrt(162) + -4 - sqrt(162)))2) + -3. 36sqrt(2) + 805 Simplify 2(-3sqrt(143)2-4)/((sqrt(11) + 2sqrt(33)/sqrt(3) - sqrt(11))4). 6sqrt(13) Simplify 3 + ((-6sqrt(81))/(3sqrt(15)/sqrt(5)) - (sqrt(363) + (sqrt(363) - (3(sqrt(363) + 3) + sqrt(363) + sqrt(363)))*2 + 0)). -5886 - 809sqrt(3) Simplify 3(-6sqrt(432)-3 + sqrt(432)1 + -4)*266. -196992sqrt(3) + 16844544 Simplify (1(-3sqrt(171)-4 + -2 - 4(-1sqrt(171) + 5)))2-5. -221300 + 10560sqrt(19) Simplify 34sqrt(11) + -1sqrt(88)/sqrt(8) - (3sqrt(99) + sqrt(44)/sqrt(196))2. -45056/49 + 11sqrt(11) Simplify (sqrt(72) + -1(sqrt(72) - sqrt(72)-2)*2 + sqrt(72) - (1sqrt(72)2)2)-2 - ((-1 + sqrt(72))4 + -4)2-1. -408sqrt(2) + 3088 Simplify 1 + (4((0 + sqrt(176) + -3 - (sqrt(176) + -1)3) + -1sqrt(176)-2 + -5(sqrt(176) + 0)))*2. 70401 Simplify ((-4(-1 + sqrt(98) + 3 - (sqrt(98)1 + -5)) - (3 + 5 + (sqrt(98) - 2sqrt(98)) + -3)) + 4)*2. -406sqrt(2) + 939 Simplify (((1-1sqrt(117) - 61sqrt(117))-2)/((-5(sqrt(81) - sqrt(81)-2) + sqrt(81) - sqrt(81)) + 2sqrt(81)2 + sqrt(81)))2. 637/225 Simplify ((sqrt(189) + (sqrt(189) + (sqrt(189) - sqrt(189)1))-6)/(sqrt(45)/sqrt(45)))/((sqrt(6)/sqrt(2)-6 + ((sqrt(108)/sqrt(3))/sqrt(12) - sqrt(3)))-6). -5sqrt(7)/12 Simplify -6(-2(sqrt(405) - sqrt(405)3 - sqrt(405)) + 2 + (-2sqrt(405))2 + (3 + (sqrt(405) - (2 + sqrt(405) + 0)) + 0)2). -9738 - 324sqrt(5) Simplify ((-2sqrt(4455))/(sqrt(315)/sqrt(7)))*2 - ((sqrt(66)/(sqrt(24)/sqrt(4)-2))*2 - 3((sqrt(176))*2 + 2)). 3709/4 Simplify (-2sqrt(2430)6 - (-5(sqrt(2430) + sqrt(2430)1) - sqrt(2430)))/((sqrt(726) - sqrt(726)-3)-53)3. 9sqrt(5)/220 Simplify (sqrt(45)/sqrt(3)-3 + sqrt(15))/(sqrt(30)/(sqrt(50)/sqrt(5))) - ((-3 + sqrt(405) + sqrt(405) + (sqrt(405)3 - sqrt(405)))*2 + -3). -6486 + 214sqrt(5) Simplify ((2 + sqrt(80) + -1)2 - sqrt(315)/(-5-3sqrt(7)))2. 156sqrt(5)/5 + 1541/5 Simplify (-4 + (sqrt(832) - 2sqrt(832)-6) - (-4 + (sqrt(13)14 - (sqrt(143) + (sqrt(143) - 1sqrt(143) - sqrt(143)))/sqrt(11))))2. 130000 Simplify -6((2(sqrt(128) + -1 + sqrt(128)))2 + 1 + 0 + sqrt(1152)). -12318 + 624sqrt(2) Simplify ((sqrt(175)-1)2 - (sqrt(7) + -1)1) + sqrt(112)2 + -3 - (((sqrt(42) - (sqrt(42) + (sqrt(42) - -2sqrt(42)))-1) + sqrt(42))/(sqrt(6)-1-1) + -1). sqrt(7) + 174 Simplify 3 + (-5(0 + sqrt(304) + sqrt(304)) - (-5 + (sqrt(304) - (-1 + sqrt(304))) - sqrt(304))*2) + (-2(sqrt(171))*2-2 - (sqrt(304) - -5-1sqrt(304))). -56sqrt(19) + 367 Simplify ((((sqrt(72) + 2sqrt(72))-4)/(sqrt(27)/(sqrt(9)2)))/((1sqrt(5808))/((-2sqrt(12) - sqrt(12))/sqrt(2))))*2. 15552/121 Simplify 2 + (-3 + (sqrt(900) + (-1sqrt(900) + sqrt(900))6)/((sqrt(132) - sqrt(132)1-3)/sqrt(11)))2. -15sqrt(3)/2 + 251/16 Simplify ((sqrt(50) - sqrt(200)/(sqrt(4) - -1sqrt(4)) - sqrt(50))5)/(sqrt(10)2-2 + (sqrt(10) + sqrt(40)/sqrt(4))1). 5sqrt(5)/4 Simplify (sqrt(70)/(sqrt(7)-1) - (sqrt(810)-4 - sqrt(10)))/((sqrt(2) - (sqrt(8) - sqrt(128)) - (sqrt(242) + sqrt(242)-2 - sqrt(242)))-3). -12sqrt(5)/29 Simplify -3 + ((3 + (sqrt(68)-5 - sqrt(68)))*2 - sqrt(119)/(sqrt(448)4 - sqrt(448) - sqrt(7))). -1657sqrt(17)/23 + 2454 Simplify 5 + 3 + ((-2 + sqrt(99) + 0 + 5)2 - 6(2(-2 + sqrt(99)))2). -2356 + 306sqrt(11) Simplify -5 + -1((sqrt(1584)2 + -2)*2 - sqrt(1584)) - (-2 + -3sqrt(110)/(sqrt(10) + sqrt(160) + sqrt(10) - sqrt(10)) + 5)*2. -158949/25 + 558sqrt(11)/5 Simplify (-2(2 + (sqrt(320) - -2sqrt(320)) + -4 + 4)-35)*2. 86400sqrt(5) + 2595600 Simplify 1(sqrt(1296) + 2sqrt(1296) + sqrt(1296) - -1sqrt(900))/(-43sqrt(588)). -29sqrt(3)/84 Simplify -3-2sqrt(1573) + sqrt(1573) + -3 + -1 + (-1sqrt(1300))25. 77sqrt(13) + 6496 Simplify ((2(sqrt(66)2 + sqrt(66)) + sqrt(66))/((sqrt(54)-2)/sqrt(9)) + -3(sqrt(99) + 0 + 0 + sqrt(99)))2. 20339/4 Simplify (32sqrt(152) - (sqrt(152) - -4(sqrt(152) - sqrt(15	{ "pile_set_name": "DM Mathematics" }
Give prob of picking 1 k and 1 q. 3/5 Two letters picked without replacement from bbnvbbnvnbn. What is prob of picking 1 n and 1 v? 8/55 Calculate prob of picking 2 t when two letters picked without replacement from urrrtrrrrthrbtrtt. 5/68 Calculate prob of picking 2 d when two letters picked without replacement from dddcdc. 2/5 Two letters picked without replacement from dbddn. What is prob of picking 2 n? 0 What is prob of picking 1 k, 2 g, and 1 h when four letters picked without replacement from jgkhjgj? 1/35 Three letters picked without replacement from {n: 1, l: 1, q: 1, m: 1, b: 2, h: 1}. Give prob of picking 3 q. 0 What is prob of picking 3 w when three letters picked without replacement from wlwwwwwwwlwl? 21/55 Two letters picked without replacement from zgznzggzgwkgzgz. Give prob of picking 1 z and 1 g. 12/35 Calculate prob of picking 1 e and 1 v when two letters picked without replacement from wevwwwwwvw. 2/45 What is prob of picking 3 s and 1 l when four letters picked without replacement from {s: 5, l: 9}? 90/1001 Two letters picked without replacement from csucuucsusscuscscuc. Give prob of picking 1 c and 1 s. 14/57 What is prob of picking 1 h and 2 v when three letters picked without replacement from {h: 4, m: 4, v: 2, x: 1}? 4/165 What is prob of picking 1 k and 1 o when two letters picked without replacement from kdfddffdfddkkfkoff? 4/153 Three letters picked without replacement from {v: 5, h: 1, c: 3, q: 9}. Give prob of picking 3 c. 1/816 What is prob of picking 3 i and 1 o when four letters picked without replacement from {z: 2, o: 6, q: 2, h: 3, i: 5}? 1/51 Calculate prob of picking 2 c and 1 v when three letters picked without replacement from {c: 3, p: 1, l: 5, a: 3, b: 2, v: 1}. 3/455 What is prob of picking 1 q and 2 h when three letters picked without replacement from {t: 2, q: 2, h: 2}? 1/10 Calculate prob of picking 2 l and 1 e when three letters picked without replacement from ewwwwewwewleweelleel. 4/95 Calculate prob of picking 1 l and 1 w when two letters picked without replacement from {w: 18, l: 1}. 2/19 Calculate prob of picking 1 f and 2 k when three letters picked without replacement from kkkffkkkkfk. 28/55 What is prob of picking 1 h, 1 n, and 2 f when four letters picked without replacement from hfhhhhililfns? 1/143 Calculate prob of picking 3 x when three letters picked without replacement from xxxxxxbxxbbbxxbx. 33/112 Two letters picked without replacement from ooozozoozozooooozoo. What is prob of picking 1 o and 1 z? 70/171 Two letters picked without replacement from uuiuuuuiivuvvvuuuu. What is prob of picking 1 v and 1 i? 4/51 Calculate prob of picking 2 v and 1 x when three letters picked without replacement from ssjxtjvsjsxsvxsxsss. 4/969 Three letters picked without replacement from {b: 2, f: 1, i: 1, s: 4, j: 1}. Give prob of picking 1 f, 1 i, and 1 j. 1/84 Calculate prob of picking 1 g and 3 d when four letters picked without replacement from {h: 1, g: 4, d: 5, m: 5, n: 1}. 2/91 Three letters picked without replacement from qbyqqqbbvqbvbvvq. Give prob of picking 1 b and 2 v. 3/56 Four letters picked without replacement from {t: 1, y: 2, e: 7, x: 1, z: 3}. Give prob of picking 1 y, 1 t, 1 x, and 1 z. 6/1001 Three letters picked without replacement from {v: 1, u: 2, j: 1, r: 1, x: 1, q: 2}. Give prob of picking 1 r, 1 x, and 1 q. 1/28 Three letters picked without replacement from qqqq. What is prob of picking 3 q? 1 Calculate prob of picking 2 o, 1 a, and 1 k when four letters picked without replacement from {q: 8, k: 1, u: 1, a: 6, t: 2, o: 2}. 2/1615 What is prob of picking 2 p when two letters picked without replacement from vavavvppa? 1/36 Three letters picked without replacement from ddtdidtdjddddriitrit. What is prob of picking 1 d and 2 r? 3/380 Calculate prob of picking 1 i and 2 q when three letters picked without replacement from {w: 1, i: 2, f: 1, g: 1, q: 2}. 2/35 What is prob of picking 2 c when two letters picked without replacement from cggggggcggcggcggggg? 2/57 Calculate prob of picking 1 o, 1 g, and 1 t when three letters picked without replacement from {g: 1, h: 2, o: 1, t: 1, k: 2}. 1/35 Calculate prob of picking 3 n when three letters picked without replacement from ninnmmnfn. 5/42 Calculate prob of picking 2 l when two letters picked without replacement from {p: 5, l: 14}. 91/171 What is prob of picking 2 a when two letters picked without replacement from {v: 4, g: 2, a: 8}? 4/13 What is prob of picking 2 h when two letters picked without replacement from hhhhhhhhhhhdhhhhhhhh? 9/10 Calculate prob of picking 2 o and 1 u when three letters picked without replacement from {d: 2, n: 3, o: 7, h: 1, u: 5}. 35/272 Four letters picked without replacement from {b: 3, s: 4, e: 1}. What is prob of picking 1 e, 2 s, and 1 b? 9/35 Three letters picked without replacement from nnnnnqqnnnnnnnnnnnn. Give prob of picking 2 n and 1 q. 16/57 Three letters picked without replacement from {p: 6, t: 4, o: 2}. What is prob of picking 2 p and 1 t? 3/11 Two letters picked without replacement from {l: 3, t: 8}. What is prob of picking 2 l? 3/55 Three letters picked without replacement from {n: 2, k: 8}. Give prob of picking 2 k and 1 n. 7/15 Calculate prob of picking 3 l when three letters picked without replacement from lxllllllllllllllll. 5/6 Calculate prob of picking 1 n, 2 h, and 1 b when four letters picked without replacement from hbznh. 1/5 Three letters picked without replacement from uxxxxxexxexxo. What is prob of picking 3 x? 42/143 Calculate prob of picking 1 t and 1 n when two letters picked without replacement from ffftnhnfztzz. 2/33 Two letters picked without replacement from {z: 4, x: 2}. What is prob of picking 2 x? 1/15 Calculate prob of picking 1 c and 1 o when two letters picked without replacement from {c: 7, j: 1, e: 1, d: 1, o: 3}. 7/26 Two letters picked without replacement from hheeeeeeeeeii. What is prob of picking 1 e and 1 h? 3/13 Two letters picked without replacement from ensnesnsppses. What is prob of picking 1 e and 1 p? 1/13 Calculate prob of picking 1 x and 1 i when two letters picked without replacement from {p: 3, h: 3, x: 3, i: 5, t: 4}. 5/51 Calculate prob of picking 2 y and 2 u when four letters picked without replacement from {y: 2, u: 8}. 2/15 Four letters picked without replacement from kkkggkkkk. What is prob of picking 3 k and 1 g? 5/9 What is prob of picking 1 p, 1 a, and 1 t when three letters picked without replacement from {r: 2, t: 1, n: 2, a: 4, p: 3}? 3/55 What is prob of picking 2 p when two letters picked without replacement from rprrp? 1/10 Two letters picked without replacement from {c: 3, r: 2, h: 1, o: 1}. Give prob of picking 1 r and 1 o. 2/21 What is prob of picking 1 q, 1 r, and 1 a when three letters picked without replacement from zmmqmmazwmzammmr? 1/280 Calculate prob of picking 2 e and 1 g when three letters picked without replacement from pppepgpeppeeppepeep. 7/323 Four letters picked without replacement from bbbbbbjbjjjbbbjbbjj. What is prob of picking 3 b and 1 j? 385/969 What is prob of picking 1 k, 1 q, and 1 h when three letters picked without replacement from qkkkkyqgyqyhk? 15/286 Three letters picked without replacement from vbobvvbvvfrrvv. What is prob of picking 1 r and 2 v? 3/26 Two letters picked without replacement from iizfllllf. What is prob of picking 1 z and 1 i? 1/18 Four letters picked without replacement from {v: 3, i: 1, k: 10, l: 1}. What is prob of picking 1 i, 2 v, and 1 k? 2/91 Three letters picked without replacement from {u: 1, m: 10, a: 6, k: 1, e: 1}. Give prob of picking 1 k and 2 m. 15/323 Two letters picked without replacement from llvbl. What is prob of picking 1 l and 1 v? 3/10 Calculate prob of picking 1 v and 1 f when two letters picked without replacement from oavwvfvoofo. 6/55 Three letters picked without replacement from kummkckmkkkc. What is prob of picking 2 c and 1 m? 3/220 Two letters picked without replacement from nfyynynnyynfnynfn. What is prob of picking 1 y and 1 f? 9/68 Four letters picked without replacement from vjvufuuuu. Give prob of picking 2 v, 1 u, and 1 f. 5/126 Two letters picked without replacement from pjgjggppgppjgyppgyp. What is prob of picking 1 g and 1 j? 2/19 Calculate pro	{ "pile_set_name": "DM Mathematics" }
7? 45/7 (-10270)/(-36340)20/13 10/23 What is (-376)/2444(-91)/12((-99)/70)/(-11)? 3/20 Evaluate 47816/83416/(-160)15/(-2). 43 What is the value of (12551/17115)/(1/(-5))? -11/3 738/3(-652)/1956 -82 Calculate -19/(45/134)1810/724. -67 What is the value of ((-2)/(32/(-16)))/((-140)/(-6720))? 48 315/3969-105-9 75 (-46/8)/(5270/200) -4/9 What is the value of (55566/(-588))/(17226/(-464))? 28/11 Evaluate (1050/(-39900))/((16/(-48))/((-10)/(-3))). 5/19 What is the value of (2/24)/(((-363)/(-2904))/(46/6))? 46/9 What is ((-3157)/25256)/((-2)/112)? 7 Evaluate (15/9)/(((-31)/124)/((-54)/(-18))). -20 Evaluate (10/((-80)/(-24)))/(-18(-697)/(-984)). -4/17 Evaluate (-63)/(-7)(-290)/(-3045). 6/7 What is (180/270)/(10/((-770)/33))? -14/9 What is the value of ((-12)/(-31)3531/31779)/((-68)/6)? -2/527 What is 47(-7)/(3/(-3))125/(-175)? -47 Evaluate ((-10)/4)/(110/(-1815))(-120)/90. -55 Evaluate (((-12810)/(-57035))/((-12)/(-44)))/((-14)/(-4)). 4/17 What is 12249/963588(-12)/(-9)? 1/59 Calculate (-4306)/(-36601)340/8. 5 What is the value of -1(-2)/24-45(-62)/(-4185)? -1/18 ((461/(-5))/((-116)/58))/((-2)/10) -23 Calculate 2(-1443)/370(-35)/3. 91 What is the value of ((-292)/(-10))/((33/(-330))/((-2)/(-8)))? -73 Calculate (318/2014)/((-85)/969). -9/5 Calculate (94/141)/(2/27)(2821/(-21))/(-31). 39 What is the value of 48/2311047/(-176752)? -3/23 What is ((-302)/(-63420))/((-51)/476)? -2/45 What is ((45/(-42))/(-14(-126)/4116))/(215/4)? -2/43 What is the value of (-57)/57(-57)/(-38)? -3/2 Evaluate (56/112)/(14/1316). 47 Calculate 4/(-48)2(4554/(-115))/22. 3/10 What is 108/6(-1053)/173745? -6/55 Calculate (2/(-3))/((-154)/539(-5)/(-150)). 70 What is (-2)/37455/(-17395)? 2/7 Calculate 39222/15253(-70)/6. -30 What is (((-66)/(-693))/((-3)/30))/((-228)/1330)? 50/9 -66168/3234-14 48 Calculate (78/(-312)4)/(16/2). -1/8 Evaluate 364250/3525(-9)/(-15). 62 What is the value of (-9-4668/(-81328))/((-84)/26)? 3/28 What is ((324/(-189))/((-180)/84))/((18/5)/1)? 2/9 (150/(-27))/((-4625)/(-16650)) -20 (1/4)/((-304)/(-342)18) 1/64 Calculate (8/7)/(16120/2015). 1/7 What is ((-10988)/(-34440)28)/(2/30)? 134 12(-2)/(-21)(-30)/(-6)(-9)/90 -4/7 What is ((-3364)/29(-3)/6)/((-13)/(65/10))? -29 Calculate (((-414)/(-23))/(-72))/(7/(-1064)). 38 What is (205/1845)/(((-22)/(-48))/11)(-45)/(-48)? 5/2 Evaluate (-90544)/(-79226)14/104. 2/13 What is (1/21)/((-20579)/9498)? -2/91 (((-36)/312)/((-6)/(-224)12))/(66/(-594)) 42/13 (-33)/(-660)10(-12)/120 -1/20 Evaluate (1/(6/(-1)))/((-8)/12)(-3576)/6705. -2/15 What is 866/(-3031)1239/(-4)(-6)/91? -59 Evaluate 630881/10692. 14 What is the value of ((10/6)/(-5))/((-18531)/(-5751))? -3/29 Calculate ((-24)/52)/(1833/95316). -24 Calculate (-3032/(-560))/(3/(189/6)). 18 Calculate (-4)/211974/1081-46. 16 What is (14/(-7)1/(-4))/(((-773955)/162)/147)? -1/65 Calculate -214/(-392)238. 17 What is the value of (-1326/3380(-30)/24)/((-41)/(-16))? 2/41 Calculate (68/(-10)48762/(-15351))/(6/(-20)). -72 What is (-4)/((-12)/(-321))-2626/312? 107 Evaluate (-490)/70(81/(-63))/(6/(-12)). -18 What is the value of ((14/(-6))/((-31850)/(-32760)))/((-22)/10)? 12/11 What is the value of (3/13)/((12/1296-9)/((-1)/12))? 3/13 What is the value of (12/189)/((-30)/(-1080)-40)? -2/35 Evaluate 273/(-252)6-4-3. -78 Calculate ((-24)/104-2)/((693/(-11))/21). -2/13 Calculate 1/((-180)/1400-7140/(-12)). -2/21 What is the value of (-30)/5(-15006)/1476? 61 What is the value of (110/(-66))/(2200/(-480))? 4/11 What is 51(-845)/25857110/32(-12)/50? 11/8 (14/(-3))/((-1910)/(-5730)(-12)/2) 7/3 Evaluate 48/(-2688)21104. -39 What is the value of (-96)/305/(-2)(-1290)/(-1166160)? 1/113 Calculate 1530/68(-4)/(-140). 9/14 Evaluate ((-75)/45)/((215/6)/(-43)). 2 Evaluate (((-6)/3)/1)/(((-320)/(-248))/20). -31 (2/(-3))/(((-50232)/3334149)/((-8)/(-3))) 118 What is the value of ((-192)/7392)/((-21)/(-441))? -6/11 Calculate 429/(-36)199050/(-72985). 65/2 ((4/(-46))/1)/((-99)/198) 4/23 ((76/18)/(-19)1476/(-4))/(-2) -41 ((-576)/(-1008))/(14/(-28)) -4 What is 27/((3/(-60)-2)/(637/(-3822)))? -45 Calculate (((-30)/105)/((-1)/108))/((-76)/(-266)). 108 Evaluate (-25608)/(-1164)(-74)/22. -74 What is the value of 208/(-364)(-2730)/(-715)? -24/11 What is (7/((-630)/(-6)))/((-645)/1325475)? -137 Calculate (8/12)/((-6)/54)(6840/(-1485))/(-19). -16/11 What is the value of (24/48)/((-57)/1938)? -17 Evaluate 18873/(-699)5/675-5. 1 Evaluate 114/(-18)((-18)/12)/(27/54). 19 What is (-6)/(-8)(-32)/960-1240? 31 24(-16)/1224270/(-144)3 30/17 Evaluate 28(1/2)/(4350/(-1740)). -16/5 What is the value of ((-4452)/(-18656))/(135/(-20))(-3)/(-7)? -1/66 What is ((-5)/(19-5))/(((-2945)/(-589))/((-5)/(-1)))? 1/19 Evaluate (80/35)/824(-259)/(-53280). 1/30 Evaluate (-49)/49238/32338. -28 Calculate (5/(50/44))/(4302/43020). 44 (-5)/1713((-56)/(-112))/((-20)/8) 1/57 What is (-182)/(-65)(448/24)/(-8)24/980? -4/25 7017/106424556/12 2/65 Calculate 12/((-2412)/(-1005))(-24)/(-20). 6 Evaluate (32/144)/((29192/1107)/(-89)). -3/4 What is the value of (62/(-248))/((-1)/(-496)4)? -31 What is (-60)/(-124)(-1214)/9105? -2/31 What is (3/(-42)2)/(4/(-14))-44? -8 Evaluate (-1(-3)/(-6)2)/(261/9657). -37 Calculate -5490/(-330)-22(-2)/(-12). -54 Evaluate ((-580)/(-3))/5(-185)/(-296)(-153)/255. -29/2 What is ((-8)/(-10))/((-22)/935(-4)/405)? 68 Calculate ((12/2)/3)/((-61)/8235-45). 6 ((2534/(-1448))/((-1)/4))/((-45)/5) -7/9 (-9)/((96/160)/(48/(-12))) 60 What is the value of (96/(-34))/((-84942)/(-320892))? -32/3 8/246317/102 7/2 Calculate 24/((-3528)/(-49))(-72)/344. -3/43 What is 1/(-60)(-25)/(-6)190/950? -1/72 What is the value of ((-30636)/(-46))/(-74)82/18? -41 (-5)/(-3)(-294)/(-1372)-14 -5 ((-16)/1680-7)/((-60)/60) -1/15 Evaluate (12/(-8))/((910/(-56))/(-65)). -6 Evaluate (((-2)/6)/((-2)/(-48)))/((-1)/4). 32 Evaluate 50/(-132)(-928560)/96725. 40/11 What is -3056/426/(-10)? 24 What is the value of -2(290/(-1305))/(28/(-180))? -20/7 What is the value of 242/33-13(-36)/(-156)? -22 Evaluate ((-77/98)/(5/(-7)))/((-44)/330). -21/4 Calculate 1/(44/33)((-4680)/(-1242))/13. 5/23 ((-4)/10)/(672/8120)6/(-1) 29 Evaluate (-19580/13224)/((-50)/9). 3/20 What is the value of 85((-4)/(-13))/(((-20)/(-3))/(23842/2751))? 34 Evaluate ((16/6)/(-2))/(13840/269880). -26 What is the value of -18(-117)/(-9126)351? -81 Calculate 3((-3280)/(-112))/41. 15/7 14/12(-477)/(-1113)(-12)/66 -1/11 (77/4774155)/(1(-3)/(-6)) 5 Calculate 112/28030/288. 1/24 What is ((22/(-3))/(-1))/(89/(5073/38))? 11 Calculate (42/(-9)18/12)/(186/31). -7/6 ((-2)/((-4)/2)4)/(65/(-520)) -32 Calculate 1148/826(-4)/(-210). 8/5 Evaluate (-1422)/165923/(4830/196). -4/5 Calculate -21((-6655)/(-528))/(-121)(-4)/(-30). 1/36 Evaluate ((-30)/(-220)-11)/(8/((-48)/531)). 1/59 Calculate ((-44)/10)/((-926)/(-463)). -11/5 Evaluate ((-45)/(33390/(-8)))/(88/308). 2/53 198/(-1518)1/632/16 -1/23 What is 56/8((7/(-6))/(-7))/(204/8568)? 49 Calculate ((16/108)/((-39)/351))/(4/(-186)). 62 Evaluate (20/(-1))/((-139)/(598395/820)). 105 Evaluate 112/1824(198/3003)/((-6)/(-26)). 1/57 Calculate (-3228)/2959(-1408)/(-48). -32 18/(-2204)1943/(-134) 1/19 What is 9120/200685/274? 114 Evaluate (3/(-39))/((-7212)/78130). 5/6 (-1(-21)/109213)/(13/(-1183)) -91/4 Calculate (35/(-2)(-2)/30)/((-259)/(-37)). 1/6 (0/39)/((2/8)/(16/64)) 0 Evaluate (110974/610357)/((-3)/((-3663)/2)3). 37 Calculate ((325/(-26))/(3/18))/(42/8). -75 What is the value of (387/6)/((-576)/384)? -43 What is (-3312)/736076/(-285)? 3/25 Calculate 4/36-2((-204)/(-24))/17. -1/9 Evaluate (((-2)/(-18))/(-1114/924))/((-2)/129). 43 Calculate -11/(-2)(-1)/((-63)/252). 2 (1/(-30))/((-4148)/352580) 17/6 Evaluate 1/(-4)(60/10)/((-36)/64). 8/3 What is (-770)/(-10)(-16)/84-6? 88 What is the value of ((-3)/(72/(-10)))/(31(-675)/(-11160))? 2/9 Calculate 4938/(-88884)(-3)/((-66)/8). -2/99 Calculate (12/(-6))/(42/((-1974)/(-1175))). -2/25 Calculate ((-42)/16464-56)/((-8)/504). -9 (-2)/1173345/(3060/(-32708)) 74 Evaluate ((501207/406)/(-823))/(((-4)/(-2))/4). -3 What is the value of (-1)/(((-2)/4)/((-91)/91))4/18? -4/9 Evaluate 175/200-8-246/(-18270)5. -8/29 (4500/(-10))/102227/(-1	{ "pile_set_name": "DM Mathematics" }
term of 3865, 7728, 11591? 3863b + 2 What is the p'th term of 32, 12, -10, -34, -60, -88, -118? -p2 - 17p + 50 What is the v'th term of 4412, 4410, 4408, 4406? -2v + 4414 What is the y'th term of -32, -65, -96, -125, -152, -177, -200? y2 - 36y + 3 What is the c'th term of -1154, -2316, -3482, -4652, -5826? -2c2 - 1156c + 4 What is the q'th term of -18, -16, 8, 66, 170, 332, 564, 878? 2q3 - q2 - 9q - 10 What is the p'th term of -1, -37, -75, -115, -157, -201, -247? -p*2 - 33p + 33 What is the t'th term of 4948, 4947, 4946, 4945, 4944, 4943? -t + 4949 What is the z'th term of 39, 22, -7, -54, -125, -226, -363? -z*3 - 10z + 50 What is the r'th term of 19, 29, 41, 55, 71, 89, 109? r*2 + 7r + 11 What is the z'th term of -6, -75, -202, -393, -654, -991, -1410, -1917? -z*3 - 23z*2 + 7z + 11 What is the g'th term of -111, -108, -107, -108, -111, -116? -g*2 + 6g - 116 What is the i'th term of 6, 46, 116, 216, 346, 506? 15i2 - 5i - 4 What is the o'th term of 191, 194, 197, 200, 203, 206? 3o + 188 What is the l'th term of 23, 40, 79, 152, 271, 448? 2l3 - l2 + 6l + 16 What is the c'th term of 32, 8, -40, -124, -256, -448, -712? -2c*3 - 10c + 44 What is the v'th term of -60, -58, -56, -54? 2v - 62 What is the x'th term of -87, -92, -97, -102? -5x - 82 What is the z'th term of -69, -60, -31, 30, 135, 296? 2z3 - 2z2 + z - 70 What is the d'th term of -11240, -11252, -11278, -11324, -11396, -11500, -11642? -d3 - d*2 - 2d - 11236 What is the k'th term of 35, 160, 367, 656, 1027, 1480, 2015? 41k2 + 2k - 8 What is the p'th term of 662, 659, 654, 647? -p2 + 663 What is the c'th term of -66, -60, -52, -42? c2 + 3c - 70 What is the n'th term of 108, 145, 182? 37n + 71 What is the s'th term of -10, -4, 4, 14? s*2 + 3s - 14 What is the m'th term of -44, -116, -236, -404, -620, -884? -24m2 - 20 What is the n'th term of 42, 73, 90, 87, 58? -n3 - n2 + 41n + 3 What is the z'th term of 78, 174, 268, 360, 450, 538? -z*2 + 99z - 20 What is the w'th term of -2, -3, -4, -5, -6? -w - 1 What is the w'th term of 17, 53, 99, 155, 221, 297? 5w2 + 21w - 9 What is the o'th term of 2, -15, -42, -85, -150, -243, -370? -o3 + o2 - 13o + 15 What is the y'th term of -40, -73, -90, -85, -52? y3 + 2y*2 - 46y + 3 What is the u'th term of -31, -69, -121, -193, -291, -421, -589, -801? -u3 - u2 - 28u - 1 What is the o'th term of -3898, -3910, -3930, -3958, -3994, -4038? -4o*2 - 3894 What is the r'th term of -434, -435, -436, -437? -r - 433 What is the z'th term of -317, -635, -953, -1271? -318z + 1 What is the m'th term of -48, -73, -96, -117, -136, -153, -168? m*2 - 28m - 21 What is the n'th term of -4, -17, -32, -49? -n*2 - 10n + 7 What is the b'th term of 4, -6, -18, -32, -48, -66? -b*2 - 7b + 12 What is the r'th term of 51, 80, 133, 216, 335, 496, 705? r*3 + 6r*2 + 4r + 40 What is the y'th term of -24, -21, -18, -15? 3y - 27 What is the f'th term of -226, -217, -202, -181, -154, -121? 3f*2 - 229 What is the c'th term of -66, -57, -20, 57, 186, 379, 648, 1005? 2c*3 + 2c*2 - 11c - 59 What is the h'th term of -16, -54, -116, -202, -312, -446? -12h2 - 2h - 2 What is the t'th term of 27, 109, 245, 435, 679? 27t2 + t - 1 What is the o'th term of -246, -499, -752? -253o + 7 What is the z'th term of -316, -315, -314? z - 317 What is the z'th term of 1264, 1258, 1250, 1240, 1228, 1214, 1198? -z*2 - 3z + 1268 What is the p'th term of -7016, -28071, -63162, -112289, -175452? -7018p2 - p + 3 What is the t'th term of -5212, -5213, -5214, -5215? -t - 5211 What is the w'th term of -298, -1210, -2724, -4834, -7534, -10818, -14680? w3 - 307w*2 + 2w + 6 What is the h'th term of 72, 122, 186, 270, 380, 522, 702, 926? h3 + h2 + 40h + 30 What is the c'th term of 29, 50, 73, 98, 125? c2 + 18c + 10 What is the u'th term of -150, -250, -350? -100u - 50 What is the o'th term of 2, 62, 200, 446, 830, 1382, 2132, 3110? 5o*3 + 9o*2 - 2o - 10 What is the m'th term of -3, -24, -47, -72, -99, -128, -159? -m*2 - 18m + 16 What is the i'th term of -148, -298, -440, -568, -676? i*3 - 2i*2 - 151i + 4 What is the w'th term of 2326, 4661, 6998, 9337, 11678, 14021, 16366? w*2 + 2332w - 7 What is the x'th term of -45, -108, -161, -198, -213, -200? x3 - x2 - 67x + 22 What is the d'th term of -776, -1558, -2344, -3134, -3928, -4726? -2d*2 - 776d + 2 What is the k'th term of 17, 216, 751, 1790, 3501? 28k3 + 3k - 14 What is the t'th term of 35, 39, 45, 53? t*2 + t + 33 What is the o'th term of 17, 38, 67, 104, 149? 4o*2 + 9o + 4 What is the a'th term of -375, -729, -1079, -1425, -1767, -2105? 2a2 - 360a - 17 What is the v'th term of 289, 577, 865, 1153, 1441? 288v + 1 What is the k'th term of -263, -522, -781, -1040? -259k - 4 What is the c'th term of 130, 260, 390, 520, 650, 780? 130c What is the b'th term of -386, -395, -418, -461, -530, -631, -770? -b3 - b2 + b - 385 What is the w'th term of 822, 817, 808, 795? -2w*2 + w + 823 What is the c'th term of 31, 112, 245, 430? 26c*2 + 3c + 2 What is the y'th term of 37, 56, 79, 100, 113, 112? -y*3 + 8y*2 + 2y + 28 What is the s'th term of -67, -133, -199, -265, -331? -66s - 1 What is the v'th term of 42, 339, 1142, 2703, 5274, 9107? 42v3 + v2 - 1 What is the c'th term of -59, -182, -293, -386, -455? c*3 - 130c + 70 What is the c'th term of 1339, 2676, 4013, 5350? 1337c + 2 What is the g'th term of -209, -857, -1937, -3449, -5393, -7769? -216g2 + 7 What is the q'th term of -1939, -1940, -1941, -1942, -1943? -q - 1938 What is the o'th term of 13713, 13715, 13719, 13725, 13733? o2 - o + 13713 What is the q'th term of -476, -973, -1470, -1967? -497q + 21 What is the j'th term of -681, -1364, -2049, -2736, -3425, -4116, -4809? -j2 - 680j What is the u'th term of -27, -10, 33, 114, 245, 438, 705? 2u3 + u2 - 30 What is the k'th term of -13, -79, -181, -313, -469, -643, -829, -1021? k3 - 24k*2 - k + 11 What is the i'th term of -17, -9, -1, 7? 8i - 25 What is the g'th term of 4, 28, 70, 130, 208? 9g2 - 3g - 2 What is the d'th term of -6, -17, -32, -51, -74, -101? -2d2 - 5d + 1 What is the p'th term of -549, -556, -555, -540, -505, -444? p*3 - 2p*2 - 8p - 540 What is the t'th term of -1, -3, 3, 17? 4t2 - 14t + 9 What is the s'th term of -4200, -8402, -12604, -16806, -21008, -25210? -4202s + 2 What is the p'th term of -337, -664, -995, -1330? -2p*2 - 321p - 14 What is the o'th term of 75, 148, 221? 73o + 2 What is the q'th term of 48, 100, 152, 204, 256? 52q - 4 What is the l'th term of -155, -320, -471, -602, -707? l3 + l2 - 175l + 18 What is the z'th term of -38, -27, -2, 43, 114, 217, 358? z3 + z2 + z - 41 What is the r'th term of -266, -274, -302, -362, -466, -626, -854? -2r*3 + 2r*2 - 266 What is the x'th term of 545, 1085, 1625? 540x + 5 What is the v'th term of 3148, 3151, 3156, 3163, 3172? v2 + 3147 What is the u'th term of -772, -1541, -2308, -3073, -3836, -4597? u2 - 772u - 1 What is the w'th term of -33, -56, -93, -144? -7w*2 - 2w - 24 What is the n'th term of 447, 447, 449, 453, 459, 467? n*2 - 3n + 449 What is the j'th term of 14, 21, 30, 41, 54, 69, 86? j*2 + 4j + 9 What is the q'th term of 63, 40, 7, -30, -65, -92, -105? q*3 - 11q*2 + 3q + 70 What is the o'th term of 34, 72, 126, 202, 306, 444? o*3 + 2o*2 + 25o + 6 What is the n'th term of 71, 125, 223, 371, 575, 841, 1175? n*3 + 16n2 - n + 55 What is the m'th term of -764, -763, -762, -761, -760? m - 765 What is the w'th term of 427, 425, 433, 457, 503? w3 - w*2 - 6w + 433 What is the g'th term of 49, 136, 269, 454, 697, 1004, 1381? g*3 + 17g*2 + 29g + 2 What is the o'th term of -9797, -19593, -29389, -39185, -48981, -58777? -9796o - 1 What is the l'th term of 889, 895, 915, 955, 1021, 1119, 1255? l3 + l2 - 4l + 891 What is the l'th term of -635, -629, -611, -575, -515, -425? l3 - l - 635 What is the y'th term of 24, 64, 124, 210, 328, 484, 684? y3 + 4y2 + 21y - 2 What is the h'th term of -56, -71, -100, -149, -224, -331, -476? -h3 - h2 - 5h - 49 What is the y'th term of -35, -200, -643, -1502, -2915, -5020? -23y3 - y2	{ "pile_set_name": "DM Mathematics" }
200 In base 10, what is -3 + -7648? -7651 In base 9, what is 416546 - 2? 416544 In base 5, what is 2 + -1103044? -1103042 In base 15, what is -26e36 - -3? -26e33 In base 3, what is 21 + -12001120210? -12001120112 In base 8, what is -4 - 73521? -73525 In base 3, what is -21110 + 202122? 111012 In base 4, what is 11222 - -211? 12033 In base 13, what is -1 - -248b1? 248b0 In base 8, what is 65 + 32? 117 In base 8, what is 10263 + -116? 10145 In base 10, what is 83 + -269? -186 In base 16, what is 23 + 2443? 2466 In base 6, what is 3505 - 43? 3422 In base 4, what is 1 + -1102311113? -1102311112 In base 2, what is -100110010 - -111111? -11110011 In base 5, what is 11 + -114441? -114430 In base 6, what is -41442 + 50? -41352 In base 11, what is 7361 + 3? 7364 In base 7, what is 3311300 + -5? 3311262 In base 7, what is 3405 + -61? 3314 In base 12, what is -1428a + 4? -14286 In base 4, what is 1110331 + -103? 1110222 In base 6, what is -44423 - -15? -44404 In base 5, what is 13120310 - -31? 13120341 In base 14, what is -159a94 - -4? -159a90 In base 2, what is 100 - 10100010000001? -10100001111101 In base 13, what is 5 + 644? 649 In base 2, what is 1010101001101 + 1010? 1010101010111 In base 5, what is 1444034 - -1? 1444040 In base 12, what is -1734 + -13? -1747 In base 4, what is 2011 + 10103? 12120 In base 5, what is 12023 + 30? 12103 In base 5, what is -10433 + -40304? -101242 In base 5, what is 11400 + -13210? -1310 In base 12, what is a1 + 146? 227 In base 15, what is -41 - 69c? -6dd In base 3, what is -2002 - 1011010? -1020012 In base 6, what is -1 + 111512? 111511 In base 12, what is 76194 - 2? 76192 In base 2, what is 100 + 10010111001100100? 10010111001101000 In base 12, what is -3 - -93a9? 93a6 In base 9, what is 8513 - -56? 8570 In base 16, what is 5 - -2bc28? 2bc2d In base 4, what is 12320332 + -3? 12320323 In base 7, what is 2 - 36150? -36145 In base 12, what is 53 - -144? 197 In base 9, what is -1568 - 2? -1571 In base 11, what is 10756 + -aa? 10657 In base 16, what is e98f - -6? e995 In base 16, what is 1 + -896ca? -896c9 In base 13, what is -5a3b2 - -1? -5a3b1 In base 6, what is 1315532 + -132? 1315400 In base 12, what is -24454 - -3? -24451 In base 15, what is -40eb + -39? -4135 In base 15, what is 0 + -2550b? -2550b In base 5, what is -131142 - -4033? -122104 In base 14, what is 1841 + -9? 1836 In base 15, what is -5d + 1131? 10c3 In base 16, what is -1 + a27f? a27e In base 14, what is 1ccd00 + 2? 1ccd02 In base 10, what is -2406573 - 2? -2406575 In base 2, what is -100 - 110110100100001? -110110100100101 In base 16, what is -3 + 297a2? 2979f In base 13, what is 8136 + 0? 8136 In base 8, what is -204233 + -3? -204236 In base 3, what is -10122220200002 + 0? -10122220200002 In base 9, what is 35 + -235? -200 In base 5, what is -34 + -3234? -3323 In base 11, what is -1383 + -9? -1391 In base 3, what is -1100000 - -202221? -120002 In base 13, what is -a41 - 16c? -bb0 In base 11, what is 123 + -120? 3 In base 5, what is -3012 + -11334? -14401 In base 8, what is -1 - 252654? -252655 In base 2, what is -101011 + 101000011010111? 101000010101100 In base 2, what is -10011110001 + 11000110101? 101000100 In base 3, what is 112110 + -2120201? -2001021 In base 16, what is 499a42 + 0? 499a42 In base 3, what is 1021021110 - -1? 1021021111 In base 6, what is -51 + 54140? 54045 In base 8, what is 104165 - 5? 104160 In base 3, what is 200010 + 212010? 1112020 In base 12, what is 7b59 + 0? 7b59 In base 2, what is -11 + -101101101111110? -101101110000001 In base 9, what is 0 + 504? 504 In base 8, what is 11376 + 425? 12023 In base 15, what is -14d6c8 - -4? -14d6c4 In base 13, what is -3 - -52796? 52793 In base 11, what is 99 - 13490? -133a2 In base 6, what is 4 - 34434? -34430 In base 8, what is 526 - 211? 315 In base 9, what is 225053 - 4? 225048 In base 14, what is 0 + 1c468? 1c468 In base 16, what is 8665 - -5? 866a In base 15, what is 2a - c9? -9e In base 16, what is 171 - -20d2? 2243 In base 15, what is 806 - -76? 87c In base 4, what is -1 + 3013? 3012 In base 9, what is -3 - 3561862? -3561865 In base 3, what is -1111 - 20? -1201 In base 8, what is 115 + -2404? -2267 In base 5, what is 104 - -21000? 21104 In base 11, what is -1a6022 + -4? -1a6026 In base 10, what is 15 + 10017? 10032 In base 2, what is -11001 + 11110011101100? 11110011010011 In base 13, what is 4 - -3b539? 3b540 In base 14, what is b1 - 70d? -63c In base 11, what is -20244 - -4? -20240 In base 9, what is 18 - 178? -160 In base 13, what is -2aa - 9b7? -c94 In base 11, what is 301955 - 0? 301955 In base 8, what is -10257 - 50? -10327 In base 6, what is 3 + 1014333? 1014340 In base 12, what is -3b - -934? 8b5 In base 13, what is 1 + a0363? a0364 In base 8, what is 32 + -16323? -16271 In base 15, what is baca0 + 4? baca4 In base 16, what is -f82 - -1f? -f63 In base 15, what is -6072b - 6? -60732 In base 5, what is -3 + -2041432? -2041440 In base 5, what is 100001 - 3? 44443 In base 10, what is -1586 + 114? -1472 In base 4, what is 10 - -332130? 332200 In base 10, what is -27 - 10939? -10966 In base 12, what is 41335 + 5? 4133a In base 4, what is 2130003 - 0? 2130003 In base 2, what is -1001001011110110100 - -101? -1001001011110101111 In base 9, what is -1654 + -8? -1663 In base 13, what is -48 - 1a93? -1b0b In base 11, what is 27 + 231a1? 23218 In base 14, what is -63b + 98? -583 In base 5, what is 101 - -31332? 31433 In base 8, what is 231504 + 2? 231506 In base 10, what is -7 + 5561? 5554 In base 3, what is 112 + 1200102010? 1200102122 In base 7, what is 5 + -1225661? -1225653 In base 12, what is -9 + -4979? -4986 In base 4, what is -11213 + -3201? -21020 In base 7, what is -12353645 - -1? -12353644 In base 11, what is -396436 - 2? -396438 In base 16, what is -47c57 + 3? -47c54 In base 10, what is -38802 - -5? -38797 In base 12, what is -91bb + 2b? -9190 In base 3, what is -2 - 12000202? -12000211 In base 3, what is 1210021 + -221222? 211022 In base 13, what is -6 - 80acc? -80b05 In base 16, what is 15e10 + -4? 15e0c In base 15, what is -d - 13d12? -13d20 In base 13, what is 152 - a5? 7a In base 6, what is 1352 - 213? 1135 In base 10, what is -22 - -1139? 1117 In base 12, what is -aa5 - 12? -ab7 In base 11, what is 23261 - 3? 23259 In base 4, what is 10130332200 - 1? 10130332133 In base 16, what is 50 - 351? -301 In base 14, what is -2b716 - -1? -2b715 In base 12, what is 3ba5 + -1a5? 3a00 In base 10, what is -151 - 3586? -3737 In base 10, what is -1 - -11157? 11156 In base 10, what is -62 - -1159? 1097 In base 2, what is 110 + 1011101100100? 1011101101010 In base 4, what is 10110012301 + -2? 10110012233 In base 14, what is 15 + -c1d9? -c1c4 In base 12, what is 392a9 + 3? 392b0 In base 4, what is -3230300 - 3? -3230303 In base 2, what is 10 - -101001011101111010? 101001011101111100 In base 6, what is 14 - 10123? -10105 In base 4, what is 101031 - 120? 100311 In base 9, what is -15 + 1570? 1554 In base 12, what is -66 + -488? -532 In base 3, what is -1202220121 - 2? -1202220200 In base 5, what is -230300232 - 3? -230300240 In base 11, what is -1430 - -356? -1085 In base 7, what is -5413 - -14050? 5334 In base 9, what is -4 - -1036451? 1036446 In base 11, what is 1775 + -219? 1557 In base 10, what is -150829 - -3? -150826 In base 14, what is -50 - -60b? 59b In base 10, what is -3 + 18375? 18372 In base 2, what is 10110000 - 111010? 1110110 In base 6, what is 2 + 15022125? 15022131 In base 16, what is 3098 + -4f? 3049 In base 6, what is -2 - 2245551? -2245553 In base 12, what is ab295 + -1? ab294 In base 15, what is -12ac9 + -1? -12aca In base 3, what is -2 - 120201200121? -120201200200 In base 12, what is -24b7 + 2? -24b5 In base 2, what is -10111 + -110010000001011? -110010000100010 In base 16, what is -363 + -2d3? -636 In base 15, what is 6b - -313? 37e In base 16, what is 237 + 6a4? 8db In base 12, what is -17a753 + -4? -17a757 In base 9, what is 4543 + -1? 4542 In base 16, what is 3 - b1d7? -b1d4 In base 2, what is 1000000001010110100011 + 100? 1000000001010110100111 In base 15, what is -644 + 3e? -605 In base 9, what is 2278 - -76? 2365 In base 10, what is 2 + -115? -113 In base 4, what is 20012 - 1131032? -1111020 In base 7, what is 344 - 35024? -34350 In base 13, what is 4 +	{ "pile_set_name": "DM Mathematics" }
-0b + 4s + 72. Let c be (b/35)/((-2)/(-14)). Calculate the highest common divisor of 96 and c. 12 Suppose 4s + 24 = 4n, 0 = -2s - 0s. Suppose -4q = -nq. Suppose -4c - 2h + 20 = q, 3c - c - h - 14 = 0. What is the highest common divisor of c and 24? 6 Let z be (-5)/((-2)/460/90). Calculate the greatest common divisor of z and 180. 15 Let z(p) = -4p - 10. Let x be z(-3). Suppose -5a + 3l + 79 = 0, 0a - a + 20 = -xl. Calculate the highest common factor of a and 182. 14 Let i(a) = 6a*3 - 8a + 4. Let b be i(2). Suppose -5l - 13 = -253. Calculate the highest common divisor of b and l. 12 Suppose 0 = -5u + 3u + 10. Let q = 451 + -326. Calculate the greatest common factor of u and q. 5 Let d = 263 - -1500. What is the greatest common divisor of 41 and d? 41 Suppose 6s - s = 5y + 405, y = 4s - 324. Calculate the greatest common divisor of s and 891. 81 Suppose -7k - 6 = -468. Calculate the highest common divisor of 154 and k. 22 Suppose -h - 2h + 72 = 0. Let u be (-15)/(-12)4 + -4 - -1. Suppose 5t = -w + 6w + 1335, 2t + uw = 522. Calculate the highest common factor of h and t. 24 Suppose 27y - 3990 = 8y. Calculate the greatest common factor of 42 and y. 42 Let v be 0/3 + 10 + 180. Calculate the highest common factor of 60 and v. 10 Let p(k) = -271k - 3467. Let u be p(-13). Let f(d) = 7d3. Let q be f(1). What is the highest common factor of q and u? 7 Suppose 0 = 3c - 2t - 496, -6t = -2c - 3t + 334. Let z = -80 + c. Calculate the highest common divisor of 21 and z. 21 Suppose 30j - 425 = 535. What is the greatest common factor of j and 112? 16 Let s(m) = -25m - 7. Let p be s(-1). Let o(a) = 17a2 - 3a - 2. Let w be o(-2). What is the highest common factor of p and w? 18 Let b = -209 + 223. Let z = -126 + 238. What is the highest common factor of b and z? 14 Suppose -28n + 5619 + 7233 = 0. Calculate the greatest common divisor of n and 34. 17 Let b be -3-2(-3)/45-25. Calculate the highest common factor of 50 and b. 10 Suppose -14x + 54 = -13x. Let h = x + -31. Calculate the highest common divisor of 115 and h. 23 Suppose 0 = 8y + 3y - 5808. What is the highest common divisor of 33 and y? 33 Let y(o) = -2o3 - 3o + 0o + 7o*2 - 10o*2 + 6o. Let u be y(-5). Calculate the greatest common factor of u and 20. 20 Let s be 5 - -2 - (0/4)/(-4). Suppose -8z + sz + 11 = 0. What is the greatest common factor of z and 33? 11 Let d(b) = 11b2 - b + 8. Let i be d(4). What is the highest common divisor of i and 36? 36 Let m(b) = 6b - 34. Let s be m(9). Let o be ((-42)/28)/((-3)/s). Suppose -3r - 4 = -16. What is the highest common factor of r and o? 2 Suppose -76 - 5 = -3k. Let g be k/28/6. Let n be 5 - (-1 + 5 + -11 - -3). Calculate the greatest common factor of n and g. 9 Let r be ((-75)/12)/5 - 14490/(-72). Calculate the highest common divisor of 225 and r. 25 Let q = 97 + -89. What is the greatest common divisor of 1 and q? 1 Suppose 24j = 27j - 6. Let y = 72 - j. Calculate the highest common factor of 14 and y. 14 Let u be (-3 - (-42)/(-9))(-1 - 50). Calculate the greatest common divisor of 34 and u. 17 Suppose -4o = -12, 21 = 3h + 8o - 3o. What is the greatest common factor of h and 12? 2 Let n = 7 + -6. Let q be (9/(-27))/(n/9). Let u be (-4)/q - 6/(-9). What is the highest common factor of u and 2? 2 Let d be (-1)/((30/(-1080))/((-1)/(-2))). Calculate the highest common divisor of 99 and d. 9 Let u(v) = 5v + 430. Let p be u(-26). What is the greatest common divisor of 700 and p? 100 Let h = -55 - -53. Let b be ((-6)/(-4) - 2)/(h/72). What is the highest common factor of b and 9? 9 Let k = 11 + -17. Let p(n) = -n2 - 9n - 4. Let m be p(k). Calculate the greatest common divisor of m and 70. 14 Let g be ((-12)/10)/(281963/(-25630) + 11). Calculate the greatest common factor of g and 4. 4 Suppose -5b - 32 - 8 = 5y, b - 8 = 3y. Let g be 3 + 411 + 4/y. What is the greatest common divisor of 184 and g? 46 Let x(h) = -6h2 - 3h - 4. Let p be x(-3). Let i = p + 34. Let l = i - -28. Calculate the greatest common factor of 39 and l. 13 Let a be ((-2)/(-5))/(-16 - (-11202)/700). Calculate the highest common divisor of 28 and a. 28 Suppose -2x + 14 = 2c + 4, 5x - 46 = 2c. Suppose -2556 + 268 = -11m. Calculate the highest common divisor of x and m. 8 Let w(k) = -k2 - 6k + 1. Let q be w(-6). Let t = -27 - -9. Let g be ((-8)/10)/(t/45). Calculate the highest common factor of g and q. 1 Let f(q) = 32q2 + 9q + 25. Let m be f(-5). What is the highest common factor of 78 and m? 78 Let b be (-2 + 1)/(2/(-22)). Suppose 13 = -bc + 57. Let p(x) = -12x*3 - x - 1. Let o be p(-1). Calculate the greatest common factor of o and c. 4 Let y(r) = -2910 + 2909 - 4r + 13r. Let a(g) = -g3 - 5g*2 - 2g - 7. Let w be a(-5). Let s be y(w). What is the highest common factor of 39 and s? 13 Suppose -h + 673 = -3x, 3x - 2767 = 2h - 6h. What is the greatest common divisor of 43 and h? 43 Suppose v = 7v - 36. Let u(g) = g3 - 6g*2 + 5g + 2. Let l be u(v). Calculate the greatest common divisor of 96 and l. 32 Suppose -48527 = -53n + 1293. What is the highest common divisor of 40 and n? 20 Suppose -7j + 5x = -6j - 49, -5x + 71 = 4j. What is the highest common factor of 32 and j? 8 Let n = -10 - -43. Calculate the greatest common factor of n and 18. 3 Let a(r) = 4r2 - r + 2. Let x be a(-2). Let n = -5447 + 5577. Calculate the highest common factor of n and x. 10 Let v be 24/(-18)(12 + 0). Let c be (-18)/(-12)v/(-6). Let i be 3c + 5 + -3. Calculate the greatest common divisor of i and 35. 7 Let i(j) = -j*3 - 21j*2 - 29j - 26. Let q be i(-20). Let u = 25 - 11. Calculate the greatest common divisor of q and u. 14 Let p(o) = -4o + 3. Let z be p(5). Let h = 35 + z. Suppose 0 = 50u - 311 - 1489. Calculate the highest common factor of h and u. 18 Let m = -10 - -19. Let n(p) = -2p2 + 37p + 27. Let b be n(19). Let q(o) = 5o + 32. Let a be q(b). What is the highest common divisor of a and m? 9 Let j = -43 - -31. Let b = 31 + j. Let g = 26 - b. Calculate the greatest common divisor of g and 56. 7 Let g = 1348 - 1202. Calculate the greatest common divisor of g and 73. 73 Let n be ((-25)/(-2))/(6 + 66/(-12)). Suppose -8 = -c + n. Calculate the greatest common factor of 22 and c. 11 Let i = -1212 + 1756. Calculate the greatest common divisor of i and 17. 17 Suppose -34t + 26t = -56. What is the highest common divisor of 7 and t? 7 Let d be 12 + (-16)/(96/(-18)). What is the greatest common divisor of d and 345? 15 Suppose -2y = 2r - 10, -5r + 14y = 11y - 25. Calculate the highest common divisor of 40 and r. 5 Let y = -96 + 142. Let a = y + -24. Suppose -q = -1 - 1. What is the highest common divisor of a and q? 2 Let o(t) = -t + 23. Let d be o(11). Let s(i) = i - 6. Let l be s(d). Let q be 1328/56 + l/21. Calculate the greatest common divisor of q and 6. 6 Suppose -4h + 0h - i = -67, 21 = 2h + 3i. Let a be 594(-5 + 64/12). What is the highest common divisor of h and a? 18 Let z(u) = -2u - 22. Let x be z(-13). Suppose -xm + 11m - 2184 = 0. What is the highest common divisor of 24 and m? 24 Let v(x) = 5x2 + 126x + 49. Let f be v(-25). Calculate the highest common factor of f and 18. 6 Let h = 28 + -15. Let r be (-4h)/(-4) + -2. What is the highest common divisor of 22 and r? 11 Let x(s) = 16s - 311. Let p be x(60). What is the greatest common factor of p and 59? 59 Let a be (-10 - -5) + (-3 - -195 - 3). Calculate the highest common factor of a and 24. 8 Let b(d) = 2d3 - 39d*2 - 16d + 35. Let r be b(20). Calculate the highest common factor of 115 and r. 115 Let t be 36 - (1 - (1 + -3)). Let n = 253 + -137. Suppose -4q + n - 28 = 0. What is the greatest common factor of q and t? 11 Suppose -163y = -170y + 196. What is the highest common factor of y and 4? 4 Suppose 2a = -0a + 16. Let t(y) = -5y + 270. Let z be t(46). Calculate the highest common factor of z and a. 8 Let l(h) = h*3 + 28h*2 + 8h + 82. Let f be l(-27). What is the greatest common factor of f and 85? 85 Let p be 7/56 - (-31)/8. Suppose -pz + 10 = 2, 5j + 4z = 203. What is the highest common factor of 13 and j? 13 Suppose 3q = r + 8, -4r - q - 14 = -4q. Let u be 0 + r/(-1) +	{ "pile_set_name": "DM Mathematics" }
t derivative of -3cy + 58405c - 12y4 + y3 - 551y wrt y? -3c - 48y3 + 3y*2 - 551 Find the second derivative of 10m*3y*2 + 8567m*3y + 2m3 - 50129y*2 wrt y. 20m*3 - 100258 Find the third derivative of 53f*6 - 295f*3 + 2072f*2 - 3f wrt f. 6360f3 - 1770 Find the third derivative of 162454n*4 + 67n*2 + 84n - 4 wrt n. 3898896n Find the first derivative of 45t*3 + 146t - 10592 wrt t. 135t2 + 146 What is the second derivative of -3jr2u*2 + 582jru - 33ju*2 - 20r*2 - 2ru2 - u2 wrt u? -6jr2 - 66j - 4r - 2 What is the second derivative of -106103n*2 + 32480n wrt n? -212206 Find the first derivative of 3997a2y*2 + 4ay2 - 42619y*2 wrt a. 7994ay2 + 4y*2 Find the second derivative of 2224772l*5s + 30ls - 3l + 2s + 43 wrt l. 44495440l3s Find the third derivative of 25h3q + 469h3 - h2q - 74h2 - 1 wrt h. 150q + 2814 Find the first derivative of 1669nz*2 - 166nz + 50674z*2 + 3z wrt n. 1669z2 - 166z What is the third derivative of -2461250f4 + 3205f*2 + 7f - 2? -59070000f Find the second derivative of 107145x*3 - 2x*2 + 2179514x wrt x. 642870x - 4 What is the third derivative of -19g*2r*3s + 2g2r*3 + 49g*2r*2s - 70g2r2 - g2 + gr2 + gs + 13r3 wrt r? -114g*2s + 12g2 + 78 What is the second derivative of -2965845v*2w*3 - v + 6195w*3 + 2w*2 + 52w wrt v? -5931690w3 Find the third derivative of 1353586f*3 + 63f*2 - 1834f wrt f. 8121516 Differentiate 424k4 - 3k*2 + 21628. 1696k*3 - 6k Find the second derivative of 504044u3 + 3u + 53489. 3024264u Find the third derivative of 2k*2t*3 - 3k*2t + k*2 + 1453202t*3 - 5t*2 + 2072 wrt t. 12k*2 + 8719212 What is the third derivative of 2j*3x*3 + 149j*3x*2 + 4j*3x - 5j3 - 17682jx4 wrt x? 12j*3 - 424368jx What is the derivative of 1828180r - 3485966 wrt r? 1828180 Find the first derivative of -49256b + 41186 wrt b. -49256 What is the second derivative of -3140804q*3 - 6125156q? -18844824q What is the second derivative of -32c*3d*3 + 819c*2d*3 - 6721c - d*3 wrt c? -192cd3 + 1638d*3 Find the second derivative of -55032c*3 + c - 854. -330192c Differentiate -25qrs2 - 237qr + q + rs*4 - 4rs - 3r + 3 with respect to s. -50qrs + 4rs3 - 4r What is the third derivative of 55d3r*3 - 8d*3r*2 + 706d*3 - 4d*2r*3 - 4dr3 - 4d - 9r3 wrt r? 330d*3 - 24d*2 - 24d - 54 Find the second derivative of -158s2x*2 + 65s*2 + sx - 85x3 - 61 wrt x. -316s*2 - 510x What is the derivative of -37654f - 42720 wrt f? -37654 What is the second derivative of 245n*3r + 73n3 - n2r - 167nr - 1122n wrt n? 1470nr + 438n - 2r Differentiate 49862v - 18416 with respect to v. 49862 Find the third derivative of 465593l3 - 96l*2 + 3l - 192 wrt l. 2793558 Find the third derivative of s*5 - 82s*4 + 21s*3 - 2870707s*2. 60s*2 - 1968s + 126 What is the derivative of -1187w2 + 815w + 2987815? -2374w + 815 What is the second derivative of -34z*5 - 2z*4 + 8z*3 - 3z + 993? -680z3 - 24z*2 + 48z What is the third derivative of -339477c3 + 32c*2 + 3945? -2036862 Find the second derivative of -63418p*2x + p - 99599x wrt p. -126836x What is the third derivative of -9g4l*3 - 320g4 - g3l2 + 6621g*2l*3 wrt g? -216gl3 - 7680g - 6l2 Find the third derivative of -225255u*6 - 93785u*2 wrt u. -27030600u*3 What is the second derivative of 112215c*4 + 2c*2 - 1993148c wrt c? 1346580c2 + 4 What is the third derivative of -574hr2x*3 - 6hx2 + 1262h + 25r2x3 - r2x wrt x? -3444hr2 + 150r*2 What is the second derivative of 2d*2ju + 4d*2u*2 - 3d*2 - ju*3 + 6ju - 182j - 1115u4 wrt u? 8d*2 - 6ju - 13380u*2 Find the third derivative of ls*6 - 12191ls3 - 153ls2 + 31s*2 - 1 wrt s. 120ls3 - 73146l Find the third derivative of t*4w*3 - 8233t*4 + 2t*3 - 11t*2w*3 + 4t*2w - 198t wrt t. 24tw3 - 197592t + 12 Find the second derivative of -334676k2x + 93kx + 2k - 432 wrt k. -669352x What is the second derivative of -113845s2 - 3605s - 22? -227690 Find the third derivative of 10d3fgj + 1892d3fj2 + d2fgj - 2dfj2 + 14fgj*2 - 74gj wrt d. 60fgj + 11352fj*2 Differentiate -32it2z + 299itz - 2i - 3t2 - 141tz + 10z - 2 wrt i. -32t2z + 299tz - 2 What is the second derivative of -14a4 + a3 + 305a*2 - 914497a? -168a2 + 6a + 610 Find the third derivative of 461730ls*4 - 94893ls2 - 4ls wrt s. 11081520ls Differentiate m2 - 2685m + 12368. 2m - 2685 Find the third derivative of 27c*5 + 2c*4 - 452c*3 - 30839c*2 + 7c wrt c. 1620c2 + 48c - 2712 Differentiate 20361o2w - o*2 - 11o + 54 with respect to w. 20361o2 Find the second derivative of -637u*3 + 1786u*2z*2 - 4444981uz2 wrt u. -3822u + 3572z2 Find the third derivative of -ay*4 - ay*3 - 2ay2 - 1603ay - 3a + 1173196y3 + 2y*2 + 3y wrt y. -24ay - 6a + 7039176 What is the second derivative of -106569n*2 - 809n - 18? -213138 Find the second derivative of 43605o2 - 2198o. 87210 What is the first derivative of -366876x + 18540? -366876 What is the first derivative of b2r*2 - 19554b*2 + 151213br2 - 4b wrt r? 2b2r + 302426br What is the third derivative of 453rs*4 + 151rs3 - 6rs2 + 1156rs - 2s*4 + 3s wrt s? 10872rs + 906r - 48s Find the second derivative of 1160220c2 - 107468c + 2. 2320440 What is the second derivative of -13q4 - 96q*3 - 2q*2 - 983q + 18 wrt q? -156q2 - 576q - 4 What is the third derivative of t*6 - 27122t5 - t3 - 2t2 - 453041? 120t*3 - 1627320t2 - 6 What is the third derivative of -w4 + 31045w3 - 810w*2 + 131w? -24w + 186270 What is the first derivative of 2hpx + 7hp - 4261hx + 525923px - 2p + 2x wrt h? 2px + 7p - 4261x What is the third derivative of -2w4 + 154579w*3y*2 + 3w*2y*2 + wy2 - y2 + 1807y wrt w? -48w + 927474y2 Find the first derivative of -22o*3 + 106o + 28260. -66o2 + 106 Differentiate 20a*3 - 2a*2 + 51a + 39958 with respect to a. 60a2 - 4a + 51 Find the second derivative of 22536n3 - n2 - 47272n. 135216n - 2 What is the second derivative of 214302f*5 + 2f*4 - f + 308709 wrt f? 4286040f*3 + 24f2 Find the third derivative of -u5 - 82u4 - 1219u*3 - 350u*2 - 5u + 122. -60u2 - 1968u - 7314 What is the second derivative of -297u4 + u2 - 46916u? -3564u2 + 2 What is the second derivative of -101134g*2s*2y*2 - 90g*2sy2 + 450g*2s wrt s? -202268g2y*2 What is the derivative of 954596g*2 + 3917536? 1909192g What is the second derivative of 422t3 + 79t*2 + 149570t wrt t? 2532t + 158 Differentiate -w3 + 552w*2 + 504w + 2262626 wrt w. -3w2 + 1104w + 504 What is the second derivative of 25241nx*2 + 17nx - 88n + 3x2 + 7x - 1 wrt x? 50482n + 6 What is the derivative of 7jn2 - 7434j + 317104n2 + 328 wrt n? 14jn + 634208n Find the first derivative of -12p3 + 81377pr2 + r2 + 2511r - 73 wrt p. -36p2 + 81377r*2 What is the second derivative of -232o*4 + 62o*3 + 4o*2 + 103063o? -2784o2 + 372o + 8 Find the first derivative of -1493201v - 1088316 wrt v. -1493201 What is the third derivative of -2k*2v*3w*2 - 27203k*2v*3 + 5k*2v*2w2 - k2v2w - k*2w*2 - 3kw - k wrt v? -12k*2w*2 - 163218k*2 Find the second derivative of 51833z*5 - 1097932z wrt z. 1036660z3 Find the third derivative of 317766s3 + s2 - 19487s. 1906596 What is the third derivative of 87n*3o*2 + 7060n*3o - 25n2o*2 + 10n*2 - 2no2 + 2no + 6o*2 wrt n? 522o*2 + 42360o What is the first derivative of -8hlz - 4hl - hvz - hv - 444h - lv + 17388lz + 2l - 3v wrt h? -8lz - 4l - vz - v - 444 Find the second derivative of -1646593l2 + 2243342l wrt l. -3293186 What is the second derivative of 28d3h - 15d3 - 5d*2h - d*2 - 3d*	{ "pile_set_name": "DM Mathematics" }
-0m - m. Suppose ah - 2h = -m. Solve -hr - 12 = -7r for r. 4 Suppose -5f + 5 = 5u, 4u = -0u + 4f - 4. Solve um + 2m = 10 for m. 5 Suppose p = -5q + 26, -23 = -3p - 10q + 6q. Suppose -r = 3u - 4, 4u - 3r + 16 = r. Solve p = -ub - b for b. -1 Let i(t) be the first derivative of -t*4/24 + 3t3/2 - t2 - 3. Let b(h) be the second derivative of i(h). Let g be b(6). Solve -2z + 5 = gz for z. 1 Suppose 38h = 42h - 8. Solve -hv - 21 = -25 for v. 2 Let s be (-30)/28/(-12). Suppose 0 = sn - 13n. Solve ng = g for g. 0 Let a = 23 - 15. Let l be a/28 + 10/(-35). Let r be (l/(-2))/(-13 + 14). Solve r = 2s - 2 + 4 for s. -1 Let t = 23 - 35. Let y(a) = 2a2 + 24a + 11. Let j be y(t). Solve -3c + j = -1 for c. 4 Suppose 0 = 3f - 24 + 6. Suppose -f = -4r + 2. Suppose -rh + 22 = 2h - 5d, d + 11 = 3h. Solve -3s = -h - 3 for s. 2 Let l = 2 - -1. Suppose 5i - b = 9, -2i + 2b + 4 = -6. Suppose z = 2 + i. Solve -z = -3f + l for f. 2 Suppose 0 = 2m - 2f + f - 9, -5f = 2m - 27. Solve -mb = 13 - 1 for b. -2 Suppose 5f - 18 = -2d, f + 4d + 0d = 18. Solve f = b - 3 for b. 5 Let o be (99/2)/11-26. Let i = o + 120. Solve -ic = -2c for c. 0 Let y be (7/(0 - 3/3))/(-1). Suppose -2u + 6 = 0, -yw = -3w + 4u - 20. Solve 10 = 4g + w for g. 2 Suppose -7z + 159 + 212 = 0. Solve -47 + z = -3n for n. -2 Suppose -2p = -206 + 200. Solve po = -0o for o. 0 Suppose 0f + 6f + 24 = 0. Let j = f - -6. Solve -jw + 4w = 10 for w. 5 Let f be (-9)/(-9) - (0 + 1). Suppose 5n + 3g = 62, -4n + 3g - 8g + 60 = f. Suppose l - 2 = n. Solve -2s - l = -4 for s. -4 Suppose -30o = -9o - 63. Suppose 5p - 2f = 92, 3p - 3f - 88 = -2p. Solve ox + p = -2x for x. -4 Suppose -18g = -422 + 62. Solve g = -t + 18 for t. -2 Suppose 0 = 41v - 13v - 28. Solve 5 = -f + v for f. -4 Let n be 5 - 3 - (0 - (1 + 17)). Let k be ((-3)/(-6))/((14/n)/7). Solve 2q + 3q - k = 0 for q. 1 Let o = 348 - 346. Solve oi = -0 + 2 for i. 1 Let z be (-170)/(-68)(-12)/(-5). Solve 5p + z = -p for p. -1 Suppose 5o = -2b - 8, -5o + 2b - 5b - 12 = 0. Solve 8f - 3f = o for f. 0 Suppose 2c + 6 = -a + c, 5a + 38 = -3c. Let y be 6/a - 92/(-20). Let v be (-6)/(-8)y + 1. Solve 13 = vi - 3 for i. 4 Suppose 5m = -4h + 55, 5 = 136m - 135m + 2h. Solve 18v - mv - 15 = 0 for v. 5 Suppose 0 = 5p - 4o - 0o + 274, -3o = -2p - 111. Let u be (p/(-3) + 1)-1. Let w = 21 + u. Solve -wg = -5g for g. 0 Suppose -62 = 10u - 262. Solve -3v = v - u for v. 5 Suppose 0 = 11r - 46 - 20. Solve -6 = -ra + 9a for a. -2 Suppose -h = h - j - 8, -3h = 4j - 12. Suppose hz + 3r - 2r = 0, -3z = -r. Suppose z = 5p - p - 8. Solve -2w + 16 = pw for w. 4 Let w = 76 - 62. Let q = w + -14. Solve 0 = -v - qv + 3 for v. 3 Let o(m) = m2 - 3m. Let s be o(3). Let c be s/(0 - (-6)/(-3)). Let y be 0 - (0/5 + -3). Solve yt + 12 = -ct for t. -4 Suppose -19 - 1 = -3r - s, 13 = 2r + s. Solve rc + 6 = -1 for c. -1 Suppose 5m + 7 = 17. Suppose 0 = -mu - 5a + 25, -5u + 9 = -2u - 2a. Solve up + 0p = 15 for p. 3 Let a be 3 + -7 + 0 - -4. Let u = a - 22. Let k = u - -24. Solve -4 = s - ks for s. 4 Suppose -13b - 409 = -487. Solve bc + 5c - 22 = 0 for c. 2 Suppose 3l = -5v + 15, -2v = -28l + 26l - 6. Solve l = -15z + 11z for z. 0 Let h(n) = 2 + n*2 - 6n*2 + 3n + 3n + n3. Let b be h(3). Suppose q + 3 = bq. Solve -8 = qm - m for m. -4 Let d = -18 + 21. Suppose dy - 24 = -0y. Solve 0 = -3n + yn + 20 for n. -4 Suppose 37c = -37c + 87c. Solve -p - 47 + 43 = c for p. -4 Let b = -6 - -9. Suppose 2f + bs - 14 = 0, -3f + s = -f + 2. Let t = f + 4. Solve j = 6j + t for j. -1 Let x(s) = 2s2 + 4s + 9. Let n be x(-4). Let g be (-1 - 7/(-5)) + 90/n. Solve gr = -2 + 10 for r. 2 Let q = 23 - 12. Suppose -5h = -111 + q. Suppose -5g + h = 0, 2g = 3a + 10 - 2. Solve -2u + 8 = -au for u. 4 Let v = 115 + -163. Let u = v + 68. Suppose 5w + u = -q + 6q, -5q - 10 = 5w. Solve -g + 0 = -q for g. 1 Suppose -7w = -14w. Solve w = 8m + 9 - 33 for m. 3 Let p be 0 + 4 + -6 - -7 - -3. Suppose -3b = -0b - 15. Suppose -5k + 4k + 3c = -8, -4c = bk - 21. Solve -kh + p = -h for h. 2 Suppose 2x - 3m + 3 = 10, 3m - 7 = -5x. Solve -xh - 10 = -4h for h. 5 Suppose -4p - 3 = -p. Let j be 3 - (167 - (p - -4)). Let c be (-8)/(-6) - j/21. Solve ci - 4i = 0 for i. 0 Let u(t) = -5t + 3t + 7t*2 + 0t. Let m be u(1). Solve -ml = -2l + 3 for l. -1 Let x(l) be the second derivative of 5/6l3 - 1/12l4 + 0 + l2 + l. Let i be x(5). Solve -a = -3 - i for a. 5 Suppose -46g + 43g + 27 = 0. Let w(s) = 2s2 - 14s - 26. Let h be w(g). Solve -5d = -0d - h for d. 2 Let v(s) = 8s + 350. Let t be v(-35). Solve 2o - 16o - t = 0 for o. -5 Suppose 0 = 470m - 3942 - 3695 + 587. Let k = 8 - 4. Solve -kn = n + m for n. -3 Suppose -3x = 3b, -b = -3b - 5x. Let f = b - -20. Solve -2t + f = -7t for t. -4 Let a be -7 + 6 + -1 - -4. Solve -av - 6v - 8 = 0 for v. -1 Let n(x) = -13x - 41. Let k be n(-3). Let b be (26/52)/(k/(-4)). Solve -2a - b = 1 for a. -1 Suppose f + 16 = 5f. Suppose 2j - 11 = 3w, -3w - 11 = -3j + 1. Solve b - j = -f for b. -3 Suppose -81z + 39z - 111z + 459 = 0. Let s = 10 - 7. Let m be 1/3 + s/(-9). Solve -zl + 2l + 1 = m for l. 1 Suppose 16 = -s + 4l, 9s - 2l = 5s - 8. Solve s = -37d + 34d + 12 for d. 4 Let g be -7 + 2 - (-1 - -56). Let r = g + 63. Solve 0w + rw = 0 for w. 0 Let k be -62/(-42) - 95/(-35). Solve -k + 0 = x for x. -3 Suppose d + 2d = -r + 31, -3d + r = -29. Suppose -5t - i - 5 = -dt, 0 = -t - 3i + 17. Solve -tk = -k - 5 for k. 5 Let t(h) = -3h + 38. Suppose v = 3v - 20. Let k be t(v). Solve -k = -3a + 7 for a. 5 Let t(z) = -z + 11. Let p be t(3). Suppose -i - p = -3i + 4y, -5y = 3i - 12. Solve 0k + i = 2k for k. 2 Suppose 0 = 21c - 47 - 58. Solve 25 = -10n + cn for n. -5 Let f be (35/(-2) + 0)/((-12)/24). Let m = f - 29. Solve m + 14 = 5d for d. 4 Let v be (6 - 20)1/4-2. Solve -vl = -20l for l. 0 Let g be ((-3)/2)/((-7)/(-42)). Let x = g + 11. Suppose -d + 2 = 4n, -n = -6n + 3d - 6. Solve n = -xp - 1 - 5 for p. -3 Suppose 0 = 10j + 31 - 61. Solve 2x = jx + 2 for x. -2 Let x be 3/(-1 - 2/4). Let u(m) = 2m2 + 7m - 8. Let h(j) = -4j2 - 13j + 15. Let w(v) = -6h(v) - 11u(v). Let l be w(x). Solve -3i - l = -4i for i. 4 Let v = 12 + 4. Let t(d) = 16d - 176. Let z be t(10). Let s = v + z. Solve s = -3q + 2q + 2 for q. 2 Let t(b) = -b3 + 2b*2 - 60. Let c be t(0). Let d = -57 - c. Solve 2p + dp = -20 for p. -4 Suppose 0 = 5k + 11 - 121. Suppose 3l - 7l - 16 = -2x, 3x - k = 4l. Solve x = -b + 1 for b. -5 Let g(c) = -3c - 9c2 - c2 + 13 + 9c*2 + 0c. Let f be g(-5). Suppose 0l - 24 = -4l. Solve l = -fx + 3 for x. -1 Let r(f) = -4f - 22. Let y be r(-10). Suppose 17 = -p + y. Solve -7 - p = 4i for i. -2 Suppose -13 = 5v - 3i + 2, -4v + 20 = 4i. Suppose -4s = 5x + s - 5, 2x + 4s + 2 = v. Let p = -6 - -13. Solve xd = pd for d. 0 Suppose -t + 2 = 5i - 4, -3i + 6 = 3t. Solve -b + t = 2 for b. -1 Suppose 18 - 2 = -4w. Let z(n) = -22n. Let d be z(w). Suppose -5y + d = -12. Solve 0 = -6m + m - y for m. -4 Suppose -32h = -27h - 15. Suppose -hl - l = -40. Solve 2z = -3z - l for z. -2 Suppose q = 4, -3p - 2q + q = -16. Solve -18o - p = -19o for o. 4 Let v = -51 - -60. Solve 11b - v = 14b for b. -3 Suppose -11o = 2o - 52. Solve -5 = -oj + 7 for j. 3 Let p = 46 + -49. Let u be 14 + p + 3 + 2. Solve -t + u = 3t for t. 4 Let k(t) = -t3 + 9t*2 + 10t + 2. Let q be k(10). Suppose 0 = -3a + 58 + q. Let y be (a/35)/17. Solve -yn - n = -15 for n. 3 Suppose 113 = 4j - 39. Let l = j - 34. Suppose -lr + 11 + 1 = 0. Solve -rx - 8 - 4 = 0 for x. -4 Let t be (-323)/51 - (-1 + (-10)/(-6)). Let b = t + 12. Solve 3 = bj - 7 for j. 2 Let k = -11 + 13. Suppose 4l + k - 10 = 0. Let p be -2 - (-16)/(3 - 1). Solve pa = la for a. 0 Let p(c) = -24c + 410. Let h be p(16). Solve -56d + h = -43d for d. 2 Let k(r) = r3 + 2r*2 - 3r - 5. Let b be (4/(-10))/((27/(-45))/(-3)). Let q be k(b). Solve 3t - q - 8 = 0 for t. 3 Suppose -6 + 21 = 3n. Suppose 4h - h = 0. Solve 5j = -h - n for j. -1 Let t(w) be	{ "pile_set_name": "DM Mathematics" }
+ 17. Let k be q(13). Suppose -3z = 2p - k, -11 = -4p - 4z + 17. Calculate the lowest common multiple of 8 and p. 8 Let t(s) = 32s2 - s - 1. Suppose 0 = 4f + 2q + 170, -62 - 153 = 5f + 3q. Calculate the common denominator of t(-1) and (22/f)/(6/(-135)) - 2. 8 Let v = -111/43 + 10777/2709. Calculate the common denominator of v and -67/36. 252 Suppose 138 = m - 3m - 5q, 5m + q = -345. Let r = m + 75. Calculate the lowest common multiple of 5 and r. 30 Let n = 21 + -22. Suppose 0b + 3b = 3p + 21, 0 = -5b - 3p + 67. What is the smallest common multiple of b and (3(-4)/12)/n? 11 Let m(j) = 3j2 - 27j + 17. Let o(d) = -2d2 + 18d - 11. Let b(k) = -5m(k) - 8o(k). Calculate the lowest common multiple of 7 and b(10). 91 Let v be 6/27 + 424/36. Suppose -k - 4k + 6 = -4d, 2d + 5k = v. What is the lowest common multiple of 9 and d? 9 Let q(w) = -3w - 6. Let b be q(-7). Suppose 0t + 5t = b. Find the common denominator of t/(-33)-1-39 and -1/2. 22 Let h = -128089/77472 - 7/2421. Calculate the common denominator of h and -41/10. 160 Let a be 0 - (1 + 1 - 4). Suppose -7t = -132 + 118. Suppose -a = -tc + 6. Calculate the lowest common multiple of 12 and c. 12 Find the common denominator of 55/126 and -6(-2)/(-42) + 1420/168. 126 Calculate the common denominator of (-88)/6(-2511)/10416 and 23/44. 308 Let l = -3645 + 7201. Let w = l + -32066/9. What is the common denominator of w and -61/3? 9 Suppose 0 = -c - 3p + 404 - 131, 5c = -4p + 1365. Let g = -315054/5 + 63277. Let b = c - g. Calculate the common denominator of b and -48. 5 Calculate the common denominator of 23/330 and (24/(-32))/((-2)/((-580)/(-225))). 330 Let h be ((-1)/(-4))/((-9)/(-5004)). Let g = -386/3 + h. Find the common denominator of g and -81/8. 24 Suppose 9u = 8u + 4. Suppose ud - 2d = -4. What is the common denominator of -48 and 162/(-15) - (d + -1)? 5 Let d = -3 + 7. What is the lowest common multiple of d and 7 + 1 - (42 + -42)? 8 Let w = 73/15 + -2311/330. Calculate the common denominator of w and -25/22. 22 Let g(r) = 5r2 + 8r - r*3 - 2r + 2r2 - 9r*2 - 6. Suppose -6x + x = 10, -5x = w + 6. Calculate the lowest common multiple of w and g(-4). 4 Let b = 79 - -11. Calculate the lowest common multiple of 14 and 698/5 + 36/b. 140 Let b = 7109 - 42547/6. Calculate the common denominator of (-1)/(-1) - (-663)/(-104) and b. 24 Let x(b) = -b3 + 8b*2 - 6b - 10. Let c be x(7). What is the common denominator of (6/(-360))/(2/(-724)) and 968/(-384) + (-1)/c? 240 Let m = 1 + 11. What is the smallest common multiple of 28/35 - 424/(-20) and m? 132 Suppose c = 3c. Suppose -4 = 247k - 251k. Calculate the smallest common multiple of k and c2/(-4) + 3. 3 Suppose 4x - 2s - 39 = -s, 3x = -2s + 32. Let n = 8 + -9. Let k(r) = -6r + 1. What is the lowest common multiple of x and k(n)? 70 What is the common denominator of 1 + -16 + 7 - (-1209)/162 and -131/144? 432 Suppose 5b = -n - 7 - 5, 3b + n = -6. Suppose 2o = -0o - 20. Calculate the smallest common multiple of 1(b/3 - o) and 9. 9 Let c be ((-34)/6)/(2 + 21/(-9)). Calculate the common denominator of (2 - (-5)/(-2)) + -38 and ((-4)/((-80)/c))/(3/22). 30 Suppose 0 = 29v + 15v - 264. Let a(g) = g3 + g + 1. Let y be a(-1). Let r = v - y. What is the lowest common multiple of r and 11? 77 Let c(v) = v2 + 5v - 5. Let x be c(2). Calculate the smallest common multiple of 26 and 22 + -1 - (x + -6). 234 Find the common denominator of 51/10 and (0 - (-222)/(-620)) + (-63)/(-105). 310 Let j(t) = -7t - 294. Calculate the lowest common multiple of j(-44) and 14. 14 Let m be 16/(-4) - (2 + -27). Suppose -25 = -t - 7. What is the smallest common multiple of 161/m + 2/61 and t? 72 Let r = -14317/1495 + -7/299. Let k = -3/508 - -3135/14732. Let c = -733/319 + k. Calculate the common denominator of r and c. 55 Let q = 5587 + -2615. Let k = q + -65487/22. What is the common denominator of k and -1/8? 88 Let k = -38 + 64. Let h = 43 - k. Calculate the common denominator of 131/(-24) + (-4)/(-12) and h. 8 Let s(k) = k2 + 28k + 190. Calculate the least common multiple of s(-10) and ((-20)/(-6))/((-2)/(-3)). 10 Let v(r) = 4r - 6. Let s(k) = -1. Let h(d) = 5s(d) - v(d). Let u be h(-2). What is the common denominator of (-3)/u + 535/(-60) and 99/8? 8 Let b be (-153)/((-61)/(-230) - 5/25). Let v = 18691/8 + b. What is the common denominator of 79/20 and v? 40 Suppose 8m - 7m = -2145. Find the common denominator of m/(-900) + (-2)/8 and 65/48. 240 Suppose 5b - 1968 = 867. What is the lowest common multiple of b and 9? 567 Let s = -3696 - 448. Let w = 74489/18 + s. Find the common denominator of 21 + -18 - 47/14 and w. 126 Let y = 11611/1358 + -185/97. What is the common denominator of 24/7 and y? 14 Let z = -17750351/126 + 140877. Find the common denominator of 43/15 and z. 630 Let c be (-240083)/(-30) + (-3 - -4). Let o = 8003 - c. Find the common denominator of -1/10 and o. 30 Find the common denominator of 109/28 and (-2)/(-4)(-1160)/609. 84 Let p(w) = -2w + 8. Let m be p(-15). Suppose -v + 4g = -m, -v - 17 = 4g - 39. What is the common denominator of -23/6 and (-15)/(-4)v/(-24)? 48 Suppose -m - 52 = -4r + 3m, r = -5m + 7. Suppose 3g = -rg + 210. Calculate the least common multiple of 14 and g. 14 Suppose -15 = -n + 3. Suppose 4a = -20 + 68. What is the lowest common multiple of a and n? 36 Let a be (-1)/2 + (-9)/(-2). Suppose -u + 5s = 2s - 9, -au + 19 = 5s. What is the common denominator of -133/6 and (u - 7) + (-63)/(-22)? 66 Find the common denominator of 149/12(-32)/48 and -137/126. 126 Suppose -p + 18 = 1. Suppose -g = -3 - p. Calculate the common denominator of -16/19 and 3/(((-112)/g)/4). 133 Suppose 16z - 13z = -6. Find the common denominator of -79/4 and -6 - z - 61/18. 36 Let z = 71021/37390 - -2/3739. Let p be (3/21)/((-26)/(-70514)). Let v = 2690/7 - p. What is the common denominator of z and v? 130 Suppose x = -0x - b - 894, 1800 = -2x + 2b. Let v = 9890/11 + x. What is the common denominator of -51/7 and v? 77 Find the common denominator of -57/5 and -3(-60)/32 - (-4 + -1). 40 Let t = 167 - 506/3. Let i be (-4)/(-3 - -2) + 472. Let p = -4316/9 + i. Calculate the common denominator of t and p. 9 Let u be (-1)/(-2)8/(-1682). Let b be (7/(2030/(-96935)))/(1 + -320). Let r = b + u. Find the common denominator of -37/10 and r. 110 Suppose 60 + 10 = 2t. Suppose -t = -3i + 3b - 95, i + 24 = 5b. Let w = i - -29. What is the smallest common multiple of w and 5? 10 Find the common denominator of 41(-296)/1920 + 6/45 and 41/16. 16 Suppose p + 44 = 4f, 3f + 10p - 24 = 13p. What is the lowest common multiple of 52 and f? 156 Let q be (-9)/5 - 1/5. Let j(p) = 144p*2 + 2p + 2. Let l be j(q). Find the common denominator of -25/12 and l/210(-6)/(-4). 60 Suppose 3 + 15 = 9u. What is the least common multiple of 16/(-24)((-25)/u - 1) and 2? 18 Let a(q) = -3q*2 + 3q - 1. Let f be a(2). Let h be f + 4 - 4/1. What is the common denominator of -53/4 and (-2)/h - 1458/(-140)? 20 Suppose -4 = -3h + h. Let n(t) = -2t + 2 + 0t + 2t*h - 8t. Find the common denominator of n(7) and 99/8. 8 Let v(u) = 78u - 55. What is the lowest common multiple of v(1) and 1? 23 Let p be (-4)/(-6) + 50/15. Let r(w) = 408w + 6. Let g be r(p). Find the common denominator of -95/8 and (-7709)/g - 4/18. 56 Suppose -k = -3k - 10. What is the least common multiple of (-222)/(10/k) and 2? 22 Find the common denominator of ((-1)/(-54))/((-7)/287) and (((-105)/18)/(-35))/(1/(-303)). 54 Let z = 106427/8445 + -4/1689. Let f = 235/3 + -273/4. Calculate the common denominator of f and z. 60 Let u(b) = -13b + 1. Let o be u(-1). Suppose 4j = -2 + o. Calculate the common denominator of 97/16 and (-81)/(-12)j/45. 80 Let g = -390 + 432. Calculate the least common multiple of g and 35. 210 Let z be -1 + 1 - (-4)/(-1742). Let i = -25247/5226 + z. Find the common denominator of i and (10 + 2245/(-225))15/6411. 6 What is the common denominator of -2 + 1/((-48)/44 + 4) and -47/16? 32 What is the lowest common multiple of 1097 and ((-49)/28-4)/1? 7679 Let s be 0/((-2 - -4)1). Suppose 4p + 0p - 12 = s. Suppose -2v + 24 = -4j, -10 = v + pj - 2. What is the lowest common multi	{ "pile_set_name": "DM Mathematics" }
b Let n = 3 - 2.9. Let u = 0.2 + -0.19. Let i = 2103.3 + -2103. Which is the nearest to n? (a) -3 (b) i (c) u c Let y = -1858 + 1417. Let u = -440.9 - y. Let s = 3/5 - 2/5. Which is the closest to -7? (a) -1/4 (b) u (c) s a Let g be (-7)/(-5) + (-1610)/(-350) + -3. Suppose -4b - 101 + 257 = 0. Let n be g + b/(-15) + (-2)/5. What is the closest to 2 in 0.5, n, 3? 3 Let u = 6590 - 6581. Which is the closest to -1? (a) 0.2 (b) 0.3 (c) u (d) -479 a Let m = -1.591 + -95.609. Let y = 91.7 + 5.3. Let x = y + m. Which is the closest to x? (a) 2 (b) -3 (c) -0.07 c Let a = -1.0463 + 0.6463. What is the closest to -3 in -2/3, a, 3/7, 3/8? -2/3 Let l = 18661/5 + -3732. Which is the closest to 1/5? (a) -80 (b) l (c) -5 b Let n = -694 - -689. Let r = 240 - 239.6. Which is the closest to n? (a) -1 (b) r (c) 2/13 a Let u be ((-2)/4 + 2)-2. Let k = -217 - -157. Let q be k/363 - (-6 + -1). What is the nearest to -0.1 in q, u, 3? q Let f(x) = -x3 + 49x*2 + 591x + 3. Let q be f(-10). Which is the nearest to q? (a) -0.4 (b) 2/17 (c) 1/24 a Let l = 830081/11 - 75375. Let h = 87 - l. What is the nearest to 2/27 in -0.2, h, 0.1? h Let p = -128.9 - -132.9. Let y = 0.66 + -0.26. Which is the closest to -0.5? (a) y (b) p (c) 2 a Let n = 2.96 - -0.04. Let k = 25.9 + 10.1. Let l = k - 31. What is the nearest to 2/5 in n, l, -0.3? -0.3 Let p = -13749 + 13749.1. What is the nearest to p in 33, 3, 0.05, 1/2? 0.05 Let w be (-11)/(-28) + (-111)/(-259)2/(-6). What is the nearest to 0.3 in -4/5, 5/3, w? w Let a = 17.77 + -18. Let o = 0.33 + a. What is the nearest to o in 0, 7, -0.1? 0 Let p = -37.52 + 38.02. Which is the nearest to -1/3? (a) 1 (b) -0.3 (c) 6/11 (d) p b Let t = 53/35 + -12/7. Let z(q) = -q2 + q - 3. Let w be z(0). Let v be (-288)/(-351) - (-2)/w. What is the nearest to -5 in v, t, 0.2? t Let i = -11/12 - -5/4. Let d = -475/29 - -1929/116. What is the closest to i in 6, d, 0.1, -2? d Let c = -3435.9 + 3436. Let v = 3.57 + -0.57. What is the closest to v in 0.26, c, -5? 0.26 Let t = -0.2792 - -0.0792. Which is the closest to -5? (a) t (b) 0.4 (c) -2/7 (d) -18 c Let w = -0.94 - 11.06. Let r = w - -8. Which is the nearest to 0? (a) 0.2 (b) r (c) 0.05 c Let u = -0.98 + 1.18. Let x = -312 - -2188/7. Let n = 1.168 - 1.068. Which is the nearest to u? (a) -1/3 (b) n (c) x b Let l = -9084.3 + 9073. Which is the nearest to -3/2? (a) 4 (b) l (c) -5 c Let b be (-49/9)/7. What is the closest to 3/4 in -0.5, -1, 4/5, b? 4/5 Let p(c) = 11c2 - 222c + 740. Let i be p(16). What is the nearest to 1 in 0.05, -3/5, 4/7, i? 4/7 Let k = 0.2 + -0.5. Let x be (0 + 8/4)/((-24)/60). What is the closest to -2/3 in 4, x, k? k Let h = -1.318 - -1.418. Let r be 6/8 - 3/12. Let m = -177 - -187. What is the nearest to -1 in m, h, r? h Let t = -10374 - -3060327/295. What is the closest to 1 in t, 4, -5, 0.1? 0.1 Let q = 4500 - 4501. Let v be (12/8)/((-3)/(-4)). Which is the nearest to 0.1? (a) -2 (b) v (c) q c Let k = 24931 - 24927. What is the closest to -0.1 in k, -22, -8, 2? 2 Let w = 0 - 0.2. Let s = 783 - 782.2. Let l = s - w. Which is the nearest to 3? (a) l (b) 0.2 (c) 0.4 a Let h = -8359 - -8356. What is the closest to 3 in 1, 5/12, h, -0.4? 1 Let d = -197/22 - -1685/198. Which is the closest to -1? (a) 3 (b) d (c) -9/10 c Let p = 4.015 + -3.015. Let n = 7 - 7.2. Let h = -0.4 - n. What is the nearest to h in p, 1/9, -0.5? -0.5 Let x = -843 + 844. Let h = 11/8 - 61/56. What is the nearest to x in 0.2, 2, 2/17, h? h Let v be 3(2 + (4 - 7 - -2)). Let t = -0.34 - -0.2. Let d = t + 0.24. Which is the nearest to v? (a) 5 (b) d (c) -5 a Let r = -291 - -285. Let g = 6 + r. Let h be 4/(-6)30/4. Which is the closest to 0? (a) h (b) g (c) -1/10 b Let s(c) = -c*2 - 8c + 2. Let x be s(-8). Let v be (-9)/(-21)x/2. Let q = 400 - 1998/5. What is the closest to q in v, 2/21, 5? v Let x = -0.371164 + 602.384164. Let v = 602 - x. What is the nearest to -1 in -4, v, -1? -1 Let a be (2/(-19))/(39 + (-1624)/42). Let g = -2 - -1. What is the closest to g in -2, a, -4? a Let k = -5139/3671 + -2/18355. What is the closest to 0.07 in k, 0.2, -2, 1/3? 0.2 Let y = 149 + -108. Let x = y - -7. Let k = x + -48. Which is the nearest to -3/4? (a) 1/5 (b) 3 (c) k c Let g = -2770 + 2772. Which is the nearest to 18/7? (a) g (b) 13 (c) 0 a Let d be (-7498)/978 + (-8)/(-3). What is the closest to -2/329 in 1/4, d, -1? 1/4 Suppose -10 = 5l - 0l, 3x - l = -10. What is the nearest to x in 4, -3, 5, -1/5? -3 Let l be 22/231 - ((-584)/(-252) - 2). Which is the closest to 2? (a) 0.12 (b) 3 (c) l (d) 4 b Let p be (4/42)/((75/250)/((-14)/(-20))). What is the closest to -2 in -3, p, 12, 0.5? -3 Let j = 14285 - 14294.107. Let s = j - -0.107. What is the nearest to s in 3, -4, -5? -5 Let g be 1/36 + (-2)/8. Let x = 67.8 - 68.8. Which is the nearest to -1? (a) -4 (b) x (c) g b Let m = -8.291 + 7.991. What is the nearest to -1 in m, -12, 0.1, -0.2? m Let d = -334 + -60. Let w = d - -394. Which is the closest to w? (a) 3 (b) -62 (c) -5 a Let u = 738 - 1447/2. Let o = u - 15. Let i = -0.07 - -1.07. What is the closest to -7 in i, 3, o? o Suppose 10v = 20v - 5980. Let c be (-148)/962 - (-248)/v. What is the closest to 0 in -5, c, 2? c Let o be 7 + 12/(-4) - (-11 - -20). Which is the nearest to 1? (a) 0.5 (b) 3 (c) o (d) 1/5 a Let b = -38 - -28. Let x = 8.6 + b. Let s = x + -1.6. What is the closest to 0 in s, -2, 5? -2 Let q = 90859/121156 + 2/30289. Which is the closest to -3.6? (a) -8 (b) -0.4 (c) q (d) -3 d Let n be (-6)/2 + 46716/340. Let w = 139 + -4. Let k = n - w. What is the nearest to 0.1 in 5, -0.2, k? -0.2 Suppose -2r - 4 - 16 = 0. Let g be (2/8)/(r - -9). Let i = -157 - -156.7. Which is the closest to g? (a) i (b) 3/7 (c) 3 a Let z = -111 + 165. Let v be 2 - z/(-24)-1. Let d = 0.08 + 0.32. What is the closest to v in -10, d, -4? d Let z = -116.14 + 116.21. Let q = -1.1 + 1. What is the closest to q in z, -0.4, -2/21? -2/21 Suppose -10s = -8s - 44. Let w = s + -30. Which is the nearest to -1? (a) -4 (b) w (c) 5 a Let d be (((-124)/(-12))/31)/(11/6). Let p = -8 + 6. What is the nearest to d in p, 3, 7? p Let d = 6371/36 + -177. Let z = -38455 - -38455. What is the nearest to 1/4 in 1, d, z? z Let y = -44852 - -45642. Which is the closest to -0.1? (a) y (b) 2 (c) -2 c Let i = 0.59709 - 1.31709. Let a = -2/65 + 136/195. What is the nearest to 1 in 0.4, a, i? a Let x be (264/(-231))/(-2)14/(-60). Which is the closest to -1/4? (a) 0.2 (b) -0.05 (c) -27 (d) x d Suppose 714h - 719h = 5. Which is the nearest to h? (a) -23 (b) -5/9 (c) -3 b Let q = 3626/5 + -726. Suppose y = -f + 50, 0 = -3y - 17 + 5. Let n = f - 274/5. Which is the closest to n? (a) 1/7 (b) 0.2 (c) q c Let x be -3 - 187 - (2/7)/((-4)/(-56)). Which is the closest to 1? (a) 1/4 (b) 0.3 (c) -1/7 (d) x b Let d = 277389/11 - 25217. Which is the closest to 0.022? (a) -2/7 (b) -8 (c) d c Let k be (((-312)/40 + 8)-16)/((-4)/30). Which is the nearest to -4/5? (a) k (b) -0.2 (c) 1/3 b Let z = 40705/156 - 759/52. Let s = -246 + z. Let w = 0.9 - 1.3. Which is the closest to s? (a) 4/7 (b) w (c) -23 a Let b be 5/(-20)210. Let y = -1670 - -1669.8. What is the closest to 2/5 in b, 5, y? y Let x = -535.77212 + -0.02788. Let i = 536 + x. Let r = 2.1 - 2. Which is the closest to -3? (a) i (b) r (c) -1 c Let y be ((-152)/(-16) + -17)(2 - 0). Which is the nearest to y? (a) 8 (b) -3/5 (c) -4 c Let v = -0.1 + 0.4. Let x = 16964.5 + -16964.6. Which is the nearest to x? (a) v (b) 5 (c) -0.05 c Let m be 11/22 - (-55)/(-2). Let b be m/(-12) + (-3)/(-4). Suppose -7a + b = -10a. What is the nearest to 2 in a, -0.4, -3? -0.4 Let n = -5 - -4.6. Suppose -17 = -u + 4b, -66b = u - 65b + 8. What is the nearest to 0.05 in n, -0.9, u? n Let m = -25 - -24. Let z be (-30)/18 - m/3. Let i = -510 + 511. What is the closest to 0 in z, i, 1/2? 1/2 Let j = -1.2022 - -0.6022. What is the closest to j in -3/14, -0.4, -2/9, -2? -0.4 Let z = -33758 + 236304/7. Let d be 0 + (-2)/2-1. What is the nearest to 1 in d, z, 0.66? d Let s(k) = -k*2 + 215k - 3551. Let w be s(18). Which is the nearest to 42? (a) 1/7 (b) 2/47 (c) w a Let o = -7846.91 + 7847.	{ "pile_set_name": "DM Mathematics" }
k - 2/5k*3 - 246/5k*2 = 0. What is k? -123, -1, 1 Let r(h) be the second derivative of 9/7h*2 - 2/7h*3 + 34h + 1/42h4 + 0. Factor r(f). 2(f - 3)2/7 Let u(z) be the second derivative of -z5/25 - 19z4/30 - 18z*3/5 - 9z*2 + z - 111. Suppose u(k) = 0. What is k? -5, -3, -3/2 Let j(f) = -101f*2 - 292f - 61. Let g(z) = -3z + 1. Let i(u) = -6g(u) - j(u). Let p(h) = 34h2 + 104h + 18. Let t(c) = -6i(c) + 17p(c). Factor t(m). -4(m + 3)(7m + 2) Let d(t) = 78t - 29. Let x be d(3). Find j, given that -156j + 3j2 + x - 382 + 1336 + 869 = 0. 26 Let z(h) = h3 + 79h2 + 152h + 77. Let r(q) = -6q3 - 474q*2 - 911q - 462. Let p(t) = 6r(t) + 38z(t). Determine c, given that p(c) = 0. -77, -1 Let o(r) be the first derivative of -4/9r3 - 67 - 1/36r*6 + 1/4r*2 + 0r*5 + 1/4r*4 + 0r. Factor o(k). -k(k - 1)3(k + 3)/6 Suppose -170z5 + 8000000 - 118801z*3 - 7854833z + 505z5 + 7760600z*2 - 163z*5 + 598z*4 + 23734833z - 173z5 = 0. What is z? -1, 200 Let s(n) be the first derivative of n7/280 + 3n*6/40 + 3n*5/5 + 5n4/2 - n3/3 + 45n + 52. Let l(f) be the third derivative of s(f). Factor l(m). 3(m + 2)*2(m + 5) Let g = 149722/5 + -29944. Factor gz2 - 2/5z - 4/5. 2(z - 2)(z + 1)/5 Let w be -5 + (15132/(-338))/(-6). Factor wn2 + 12/13n*4 + 2/13n*5 + 18/13n + 28/13n3 + 4/13. 2(n + 1)*4(n + 2)/13 Let l = 237 + -164. Factor 70 - 714a2 - la + 28a + 719a*2. 5(a - 7)(a - 2) Let w(v) be the second derivative of v4/4 - 100v*3 + 15000v*2 - 19v - 1. Solve w(m) = 0. 100 Factor -469k3 - 12k*2 + 7k*2 - 51k*3 + 0k*2 + 0k*2. -5k*2(104k + 1) Let m(p) be the first derivative of 13p*3/3 + 30p*2 - 25p - 2873. Suppose m(d) = 0. Calculate d. -5, 5/13 Let a(n) be the second derivative of -1/6n4 - 34n - 2n3 + 2 + 16n*2. Factor a(c). -2(c - 2)(c + 8) Factor 15b*4 + 260b*2 + 84b*3 + 8366 - 320b*3 - 164b*3 - 8366. 5b*2(b - 26)(3b - 2) Let t(v) = 4v5 + 12v*4 - 6v*3 - 6v*2 - 6. Let w(h) = 3h*5 + 13h*4 - 5h*3 - 5h*2 - 5. Let j(x) = -5t(x) + 6w(x). Let j(q) = 0. What is q? 0, 9 Let z = 844 - 841. What is a in -123 + 16a*2 + 3a + 24a2 - 14a*2 - za*3 + 97a*2 = 0? -1, 1, 41 Find w, given that -54 + 3328907w*2 + 51w + 0w4 - 3w*4 - 3328850w*2 - 51w3 = 0. -18, -1, 1 Let p(n) be the second derivative of -n5/70 - 10n4/21 - 53n*3/21 - 34n*2/7 - 174n - 2. What is c in p(c) = 0? -17, -2, -1 Let a(h) be the third derivative of h5/390 + h4/78 - 323h3/39 - 1479h*2. Factor a(g). 2(g - 17)(g + 19)/13 Let c = 12 - 7. Factor 8l + 2l3 - l - cl - 4l2. 2l(l - 1)2 Let f(x) be the second derivative of 5x*4/4 - 203x*3/9 + 3x*2/2 - 20x + 6. Let f(u) = 0. Calculate u. 1/45, 9 Let n(h) be the third derivative of 17 + 56/3h4 - 43/5h*5 - 2/7h*7 + 1/84h*8 + 67/30h*6 + 0h + 10h2 - 24h*3. Determine w so that n(w) = 0. 1, 2, 9 Factor 26 + 144r + 11/2r2. (r + 26)(11r + 2)/2 Find d such that 8963378/5 + 2/5d*2 - 8468/5d = 0. 2117 Let q(l) be the first derivative of 4l5/35 + 2l*4/7 - 76l*3/7 - 340l*2/7 - 64l + 26. Let q(x) = 0. Calculate x. -7, -2, -1, 8 Let g(k) be the third derivative of -3k + 27/80k*6 - 55k*2 - 1/140k*7 - 243/40k*5 + 0 + 729/16k*4 + 0k*3. Factor g(d). -3d(d - 9)3/2 Suppose -172k*4 + 0 - 8/3k*3 + 688k*2 + 0k + 2/3k5 = 0. Calculate k. -2, 0, 2, 258 Factor 87/8d*2 - 3/8d - 87/8 + 3/8d3. 3(d - 1)(d + 1)(d + 29)/8 Let w(l) = -4l - 13. Let n be w(-11). Find r, given that -16r + 7r2 + 16 + 28r*2 - nr2 = 0. 2 Let j(z) be the first derivative of -z5/5 + 13z4/4 + 52z*3/3 - 26z*2 - 192z - 352. Determine b, given that j(b) = 0. -3, -2, 2, 16 Let o = -9199/150 + 184/3. Let m(t) be the third derivative of 3t2 + 0t + 0t3 + 0t*4 - ot5 + 0. Find d such that m(d) = 0. 0 Let c(t) be the second derivative of -t4/90 + 19t3/15 + 58t*2/15 - t - 17. Find h such that c(h) = 0. -1, 58 Factor 128000 + 800w + 5/4w2. 5(w + 320)*2/4 Let i(x) be the first derivative of -3x*4/4 + 148x*3 - 15975x*2/2 - 33750x - 2787. Let i(p) = 0. What is p? -2, 75 Let a = 961811 + -961808. What is f in 2/11f4 + 10/11f*a + 6/11f*2 - 10/11f - 8/11 = 0? -4, -1, 1 Let u(v) = 48v4 + 26v*3 - 46v*2 - 118v - 80. Let n(f) = 10f4 + 5f*3 - 9f*2 - 23f - 16. Let s(m) = -14n(m) + 3u(m). Factor s(p). 4(p - 2)(p + 1)*2(p + 2) Find p, given that -14p + 84p*2 - 39p - 2p3 - p + 12p*3 = 0. -9, 0, 3/5 Let w(s) be the second derivative of -8s*7/21 - 46s*6/15 - 481s*5/80 + 23s*4/8 - 3s*3/8 + 190s - 1. Solve w(z) = 0 for z. -3, 0, 1/8 Suppose -g + o = -3 - 8, 0 = 3g - 5o - 35. Suppose 0 = -5y + g - 0. Solve -p2 - 3p*5 + p + 4p5 + p2 - yp3 = 0 for p. -1, 0, 1 Let j(c) be the second derivative of -c4/12 + c2/2 - 92c. Let m(p) = -4p2 + 160p - 3198. Let t(s) = -2j(s) + m(s). Find f, given that t(f) = 0. 40 Let j(q) = -2q*3 - 5q*2 + q + 4. Let b be j(0). Let h = -68 + 68. Factor -3/2w*5 + 0w*3 + 0w*b + 0w*2 + 0w + h. -3w5/2 Let i(n) = n2 - 23. Let u be i(5). Suppose -14s*2 + 22s - 10 + 20su - 8s*2 - 10 = 0. Calculate s. 1, 10 Let d be -16 + 7/(7/6) - 294/(-24). Factor 1 - dv*2 - 4v. -(v + 2)(9v - 2)/4 Let i = -117 - -119. Find h, given that 118h2 - 4h*4 - 32h*3 + 49h*2 - 40h - 210hi + 119h*2 = 0. -10, 0, 1 Let f(c) = -59c + 75. Let q be f(-9). Suppose 63j + 481j + 28j2 + qj + 190j - 200j - 328 = 0. What is j? -41, 2/7 Find h such that 60/13h3 - 574/13h + 294/13 + 244/13h2 + 2/13h*5 - 2h*4 = 0. -3, 1, 7 Determine u so that -14/5u*2 + 6/5u*4 + 0u + 8/5 + 2/5u3 - 2/5u*5 = 0. -1, 1, 2 Suppose -17n + 156 = 9n. Suppose 2c = -3v - 5, -2c + nv = 4v - 10. Let 16/5 + 4yc - 20y*3 + 64/5y = 0. Calculate y. -2/5, 1 Let r(u) = -35u2 + 89u - 44. Let v(p) = 351p2 - 891p + 441. Let k(d) = 21r(d) + 2v(d). Factor k(a). -3(a - 2)(11a - 7) Let f(l) be the second derivative of 11l*6/30 + 82l*5/15 + 226l*4/9 + 368l*3/9 - 8l*2 - 1269l. Solve f(z) = 0. -6, -2, 2/33 Let g(r) = -1405r - 2825. Let c(u) = u2 + 703u + 1411. Let o(l) = -5c(l) - 3g(l). Find d, given that o(d) = 0. -2, 142 Let y be (21/(-3)1/(-7))/(12/3). Factor 11/4s*3 - ys*4 + 0 - 8s*2 + 7s. -s(s - 7)(s - 2)*2/4 Let i(r) be the first derivative of 17 + 13/2r*2 - 14/15r*3 - 20r + 1/20r4. Factor i(l). (l - 5)2(l - 4)/5 Let i(x) = -2x5 + 2x*4 - 4x*3 - 8x*2 + 16. Let p(q) = 2q5 - q4 + 4q3 + 7q*2 - 14. Let g(w) = -7i(w) - 8p(w). Factor g(n). -2n*3(n + 1)(n + 2) Let t(o) be the first derivative of -o7/21 - 3o*6/5 - 3o*5/2 - 7o*4/6 + 54o + 3. Let l(f) be the first derivative of t(f). Factor l(g). -2g2(g + 1)*2(g + 7) Let t = 282682 + -565353/2. Determine n, given that 1/4n2 + 9/4n - t = 0. -11, 2 Suppose 182z - 330 = 167z. Suppose -2k = zk. Factor 0g + 2/7g*2 + 4/7g*3 + k + 2/7g*4. 2g*2(g + 1)*2/7 Determine h, given that -248h*4 - 12249h*2 + 9913h*2 - 2048h - 512 - 1227h3 + 91h*3 - 20h5 = 0. -4, -2, -2/5 Let m(x) be the second derivative of x6/10 - 3x5/10 - 4x4 + x3 + 45x2/2 + 3x - 4. Suppose m(b) = 0. Calculate b. -3, -1, 1, 5 Suppose 4a + 4s + 372 = 0, 3a - 2s + 44 + 220 = 0. Let t be 590/a + 1 + 6. Factor tr2 + 0 + 8/9r - 2/9r3 - 1/9r*4. -r(r - 2)(r + 2)2/9 Let p = 6780 - 4346. Let k = p + -2431. Factor -3/4m*2 + 0 + 3/4m*k - 3/2m. 3m(m - 2)(m + 1)/4 Let b(m) be the second derivative of m8/2520 + m7/1260 - m6/135 - m5/45 - m3 + m2 - 34m. Let o(t) be the second derivative of b(t). Factor o(c). 2c(c - 2)(c + 1)(c + 2)/3 Let y(a) = 131a3 + 266a*2 + 4a - 6. Let g be y(-2). Factor -3/4qg - 3/2q*4 + 0 + 3/8q - 21/8q3. -3q(q + 1)2(4q - 1)/8 Solve 3v - 1/4v3 + 0 - 1/4v*2 = 0. -4, 0, 3 Let k = 549538/13 - 42272. Determine g, given that -22/13g + 64/13g2 + 16/13g*4 + kg*5 - 60/13g*3 + 0 = 0. -11, 0, 1 Suppose 1600863 + 533315 - 2344m + 2m2 - 1788m = 0. What is m? 1033 Factor 8 + 4g - 2/9g*2 - 1/9g*	{ "pile_set_name": "DM Mathematics" }
+ q - 2q + (1 - 2 + 2)(-2q + 0q + 0q) + 17q + 13 - 13)(5q - 5q + q). 13q*2 Expand (7o + 4o2 + 10o - 7o2)(-5o2 - 2o*2 + 4o*2). 9o*4 - 51o*3 Expand (5z + 11z - 2z + 57z3 - 210z*3)(-3z2 + 4z*2 + 0z*2). -153z*5 + 14z*3 Expand -3x*3 + 4x*3 - 2x*3 + (2x*2 - 3x*2 + 4x*2)(253x - 171 + 171). 758x*3 Expand 94d*5 + 10d2 - d2 - 95d5 + (2d + 3d3 - 2d)(2d*2 + 0d2 - d2). 2d5 + 9d*2 Expand (6q*3 + 5q*3 + 15q*3)(-20 + 20 + 17q). 442q*4 Expand (-743w*2 + 1891w*2 - 780w*2)(-w*2 - 2w*2 + 2w*2). -368w*4 Expand (-6l + 11l + 14l)(-l - 3l - 2l)(-3 + 4 - 2 + (-1 + 5 - 2)(-3 + 1 + 3) + 5 - 1 - 2). -342l*2 Expand (q - 4q - 6q)(12 + 10 + 17 - 7). -288q Expand (-3i + 3i + i4)(-8 + 25 + 4 + (0 - 5 + 0)(3 + 4 - 4)). 6i*4 Expand (3k*3 - 2k*3 + 0k*3)(3k + 3k - 5k + (-6 - 4 - 1)(-1 + 1 - 5k)). 56k*4 Expand (2 + 6r*2 - 2r2 - r2)(0r*2 + 0r*2 + 5r*2)(1 - 3 + 4). 30r4 + 20r2 Expand (-w2 + 4w2 + w2)(52 + 46 - 24). 296w2 Expand (n - 3n + n)(164n - 164n + 21n*4) + (4n - 2n - n)(-2n4 + n4 - 2n*4). -24n*5 Expand 7t + 2t - 6t + (-2t + t + 0t)(3 - 4 - 1) + (-2t + 4t - 3t)(-2 + 3 + 1) - 107t + 7t + 13t + 0t + t + 0t. -83t Expand (9l*2 + 9l*2 - 6l*2)(-6 + 30 - l - 14). -12l3 + 120l*2 Expand (-4k*5 - 3k*4 + 3k*4)(-1 + 2 + 1) + (42k3 + 3k*3 - 2k2 + k3)(3k - 5k + 0k)(0 + 0 - k). 84k*5 - 4k*4 Expand -7v*3 + 578v - 578v + (-4v + 7v + v)(-2v2 + 3v*2 - 3v2) - v3 + 0v3 + 0v*3. -16v*3 Expand g - 5g + 5g + (0 + 1 - 2 + (1 - 1 - 2)(3 - 1 - 4) + 1 + 4 - 4)(-2 + 2 - 3g). -11g Expand (1 - 4m + 0m + 3m)(-4 - 2m + 4)(2m + 0 + 0)(803 + 23m - 803). 92m4 - 92m*3 Expand n - 54n*3 + 29n*3 + 4n + (2n2 + 0n2 - n2)(-n - n + n). -26n*3 + 5n Expand (4 - 4 - 4c2)(-206c - 172c - 41c). 1676c*3 Expand (-135k + 395k + 108k + 256k)(1 + 5 - 3) + k - 5k + 3k. 1871k Expand (-11 + 31 - 7)(4 - 2 - 1)(2w*3 - 2w + 2w) + 11w*3 + 7w*3 - 3w*3. 41w*3 Expand (2 + 1 - 1)(-r + 4r - 4r)(-6 - 3 + 2). 14r Expand (157m - 2 - 157m - 23m2)(5 + 3m - 5). -69m*3 - 6m Expand (-4g3 + 2g3 + g3)(21g*2 - 126g*2 - 4g*2) - 2g*5 + 4g*5 + 0g*5 + 2g*5 + 0g*5 - 5g*5. 108g*5 Expand (3 + b - 3)(5b + 0b - 3b) + (4 + 2 - 5)(3b2 - b2 - 3b*2) + (0b - b + 4b)(-68 + 68 - 49b). -146b*2 Expand (-2d*2 + 5d*2 + 0d*2)((1 + 2 - 5)(4 - d - 4) + (2 - 2 + 2)(-d + 3d - d)). 12d*3 Expand (-2 - 1 + 6)(8k + 0 + 5 - 3)(6k2 - k2 + 3k*2) - 2k*3 + 0k*2 + 0k*2. 190k*3 + 48k2 Expand -k3 + 2k3 + k3 + (3251 - 34k*2 - 3251)(k - 3 + 3). -32k3 Expand (4b*3 + 6b - 6b)(-3 - b + 3) - 3b4 + 3b*4 - 3b*4 + (-15b - 4b + 13b)(2b*3 - 4 + 4). -19b*4 Expand (2 - 4x*2 - 2)(-x*3 + 2x - 2x) + 71x4 + x5 - 80x4 + x5. 6x*5 - 9x*4 Expand (-5 - 2 - 2)(0 - 1 + 0)(0z + 2z - z). 9z Expand (-3 + 3 + 2l2)(39l2 + 48l*2 - 32l*2 + (-1 + l + 1)(l + 3l - 5l)). 108l4 Expand -k2 - k2 - 28k - 231k3 + 232k*3 - 2 + (0k2 - k2 + 2k2)(-3k - k + 8k). 5k3 - 2k*2 - 28k - 2 Expand (421n + 478n + 508n)(-2n + 1 - 1). -2814n*2 Expand (5s - s - s)(-39 - 18 + 9)(-2 + 3 - 3). 288s Expand (0 - 92m + 1 + 97m)(-4 + 3 + 5)(0 + 3m + 0). 60m2 + 12m Expand (n - n - n + (1 + 1 + 0)(-2n - 2n + 5n) + 60n + 5n - 14n)(0n4 + 2n*4 - 4n*4) + n + 0n + 5n5 - 7n*5. -106n5 + n Expand (-i2 - 2i2 - 1 + 4i*2)(3i - 10i + 4i). -3i*3 + 3i Expand (3s + s - 8s)(-12 - 18 - 20 - 16). 264s Expand (3c - 5c + 9c)(0 - 2c2 + 0) + 2 + c3 - 2 + (4 - 1 - 2)(c3 - c3 - 4c3). -17c*3 Expand 28b + 83b + 39b + (1 + 0 - 2)(3b + 0b - 2b) + 0 - 2b + 0. 147b Expand (-46 + 15 + 98)(-2d3 + d3 + 0d3) + (2d + 3d - 4d + (1 - 5 + 2)(0d + 2d - 3d))(0d + 6d2 + 0d). -49d3 Expand 0f - 9f + 7f - 3f2 - 1 + (2 + 2f - 2)(-3f + 4f - 2f) + 4 - f*2 - 4 + 2 - 2 - 2f*2. -8f*2 - 2f - 1 Expand -u + 0u + 0u - 5u2 - 4u*2 - 7u*2 + 0u2 - u2 + 6u2 - 2u*2 + (1 + 1 - 4)(-3u + 3u - u*2) + 2u - 2u - u2. -12u*2 - u Expand 3m*5 + 6m5 + m5 + (3m2 - 3m2 - m4)(4m - 3m + 6m). 3m5 Expand (3x*3 - 4x*3 + 0x*3)(9x + 19x + 16x)(0x + 3x + 9x). -528x5 Expand -i3 - 3i3 + 2i*3 + 0i*3 - 2i3 - i3 + (-2i - 2i + 3i)(0i - i2 + 0i) + i3 - i3 - 2i3 + (3 + 2 - 4)(-9i3 + 33i - 33i). -15i*3 Expand (1 + 2 + 0)(101d + 116d + 71d). 864d Expand (-4y + 8y + 18y)(2 - 1 - 3 - 3y). -66y*2 - 44y Expand ((-2 + 7 - 6)(m + 4 - 4) + 6m + m - 2m)(-5m + 7m - 4m). -8m*2 Expand (-488 + 953 - 477 - t)(2t + t - 5t). 2t2 + 24t Expand (-2o + 2o + 2o)(1 - 5 + 2) + (-65o - 107 - 105 + 211)(1 + 0 - 8). 451o + 7 Expand (5 + 3 - 2 + (-2 + 2 + 2)(-5 + 4 + 0))(0f - f - 3f)(8f2 + 23 - 23). -128f*3 Expand -62j*2 - 108j*2 + 137j*2 + (0 + 0 - 2j)(4j + j - 3j). -37j*2 Expand (-1 + 2 - o - 2)(4 - 2 - 1)(-26o + 73o + 2o) + (1 - 2 - 1)(-1 - 2o*2 + 1) - o + o - 2o*2. -47o*2 - 49o Expand (77o3 - 97o*3 + 82o*3)(4 - 1 - 2)(-3o*2 + 3o*2 + 2o*2). 124o*5 Expand (0o4 + o4 + 2 + 0)(-14 + 10 + 31). 27o*4 + 54 Expand (-4u - 7u2 + 4u)(-1 - 4 + 4) + (0u - 5u + 3u)(-50u + 94u - 31u) + (-u + 3u + u)(-2u + 2 - 2). -25u*2 Expand (3f - 2 + 2)(-2 + 2 - 2f*2)(-17 + 17 - 7f). 42f*4 Expand i - 3i + 4i + (3 - i - 3)(3 - 5 + 3) + (2i - 2i + i)(4 - 3 + 3) - 4 + 4 - 2i. 3i Expand -16u*4 + 16u*4 - 17u*5 + 3u*5 - 4u5 - u5 + (u - u + u*5)(5 + 1 - 5) - 5u5 - 4u*5 + 5u*5. -22u*5 Expand 0j*4 - 5j*5 + 0j*4 + (3j*2 + 0j*2 - 4j*2)(-j3 + j3 - j*3) + (2 - 2 + 15j*3)(-2j2 - 3j*2 + 2j*2). -49j*5 Expand (-1 + 3 - 4)(3 + 0 - 2)(4r - 10r2 - 4r) + 8r2 - 2r2 + r2. 27r2 Expand (2z - 1 - z - 4z)(4z + 2z - 4z)(-4 + z + 4)(3z*2 + 0z*2 - 6z*2). 18z*5 + 6z*4 Expand (-l - 3l + 2l + 3)(-258l - 219l + 119l). 716l*2 - 1074l Expand (20 - 20 - 3t)(44t3 - 21t*3 - 30t*3). 21t*4 Expand (312 + 142o - 312)(-6 + 4 + 0). -284o Expand (-1 + 9f + 4 - 2)(2 + 2 + 1)(-1 + 1 + 2). 90f + 10 Expand -4t2 + 3t*2 + 0t*2 + (-2t - 3 + 3)(2t - 3t + 2t) + 7t2 + 11t - 11t + (-15 + 15 - 5t)(-3t + 6t - t). -6t*2 Expand (-3s*2 + 0s*2 + 4s*2)(-1 - s + 1) + 24s3 - 118s*3 - 17s*3 - 4s3 - s3 + 3s3 + (4s - 2s - s)(s*2 - 7s2 - s2). -121s3 Expand (2h*3 - 1630 - 1687 + 3274 + 2h*2)(2h2 - 4h + 4h). 4h*5 + 4h*4 - 86h*2 Expand 3273g - 3273g - 2 - 5g*2 + (-1 + g + 1)(2g - 2g + g). -4g2 - 2 Expand (-z + 0z + 0z + (-z + 3z - 3z)(0 + 1 - 7))(3z*2 - 2z2 + z2). 10z3 Expand (-4a - a + 4a)(-4a2 + 7a*2 - 2a*2) - 4353a + 4353a + 8a*3. 7a*3 Expand (-46d + 46d + 17d*2)(5d - 2d - d) - d2 + d2 + d*3 + (-d - 2d - 2d)(-3d + 3d - 2d2) + 1 - d3 - 1. 44d*3 Expand (y + 2y - 4y)(2y2 - 4y + 4y) + y - 7y + 8y + 17y*3 + (7y - 7y - 4y*2)(-2y + 3y - 3y). 23y*3 + 2y Expand (-3q - q + 3q)(-2q + 4q + 0q - 3q + 0q + 2q + (0 + 2 - 1)(8 - 8q - 8)). 7q*2 Expand (-4f2 + f2 - 32f + 29f)(-6f - 5f + 10f). 3f3 + 3f*2 Expand (-10b - 126b2 + 4b + 125b2)(4b2 + 4b*2 - 9b*2 + 25b*3). -25b*5 - 149b*4 + 6b*3 Expand (3 + 0 - 1)(3 + 0 - 2)(115 + 8z - 115). 16z Expand -1 - 1 + 2d + 3 + (-2 + 2 - 2)(-2 + 2 - d) + d - 4 + 4 + (0d + 2d + 0d)(0 - 1 - 1). d + 1 Expand ((0 - 26 + 10)(-5l + l + 2l) + (0 - 1 + 2)(4 - 4 + 2l) - l + 4 - 4 + 5l - 2l - 2l + 0l + 0l - l)(-l - 4l + 4l). -33l2 Expand 0b*2 + 0b*2 - 3b*4 + (2b*3 - 4b + 4b)(-6b - 2b - b) + 4b3 - 7b*4 - 4b*3. -28b*4 Expand (-4 - 1 - 4)(-n - n - n)(4 + 2 - 4)(-2n + 0n + 0n). -108n*2 Expand (-6q + 4q + 288q)(-1 + 1 + q)(2q + 3q - 3q). 572q3 Expand (q2 - 2q*4 - q	{ "pile_set_name": "DM Mathematics" }
l + 18f What is the second derivative of 230j4 + 4j*3 - 88j + 10? 2760j2 + 24j What is the second derivative of -1506c2 + 92c? -3012 Find the third derivative of 854x4 + 2x*2 - 618x. 20496x Find the second derivative of -446z*4 - 564z. -5352z2 Find the second derivative of -399k*2 + 10k + 2. -798 Find the third derivative of 109j3l*3 + 3j*3 + 2j*2l*2 - 17jl - 3l*3 wrt l. 654j*3 - 18 Find the second derivative of 250t*2 + 232t. 500 What is the second derivative of 98t2u*2 + 2t - 135u2 wrt t? 196u*2 Differentiate -13xy3 + 636x + 4106y3 - y2 wrt x. -13y*3 + 636 What is the derivative of 15g*4 - 7g*3 - 137 wrt g? 60g*3 - 21g*2 What is the derivative of -2o*3s - 12o3z + 3o2z*3 - 2orsz + 2orz*2 + 13rsz*3 wrt s? -2o*3 - 2orz + 13rz3 Find the second derivative of b2d2 + 3017b*2d - 2b2 - 206d*5 wrt d. 2b*2 - 4120d*3 What is the first derivative of 4j*3r*2y + 14j3r*2 + 6j*3r + 4j2r*2y + y wrt y? 4j3r*2 + 4j*2r*2 + 1 Find the second derivative of 170k*2p*2 + 158kp2 - p2 wrt k. 340p*2 Find the third derivative of -5529u*3 + 50u*2 - 11u. -33174 What is the second derivative of -3678f4 + f3 + 2f*2 - 142f - 2? -44136f2 + 6f + 4 Find the third derivative of 2a3s - 1035a3 - 7a*2s - 14s + 2 wrt a. 12s - 6210 What is the first derivative of 58c2 - 271 wrt c? 116c Find the first derivative of -2b3pu + b3p + 21b2p - 25bpq + 144bqu wrt u. -2b3p + 144bq Differentiate -2054m4 - 810 wrt m. -8216m*3 Find the first derivative of -167vz2 - 2z*2 + 103z wrt v. -167z2 What is the third derivative of 23k*5 + 20k*3 + 9k*2 + 24 wrt k? 1380k*2 + 120 Find the second derivative of -8cq3 - 286cq + 7q*5 + 2q*4 + 3q wrt q. -48cq + 140q3 + 24q*2 What is the first derivative of 5j*2n*2 - 597j*2 - 253jn4 wrt n? 10j*2n - 1012jn3 What is the derivative of -h4m - 21h*3 + 16hm - 972m - 2 wrt h? -4h3m - 63h2 + 16m Differentiate 104os*3 - 2os2w*2 + os + ow + 966s*3w*2 - 1 with respect to w. -4os2w + o + 1932s3w What is the second derivative of 3066x5 + 627x wrt x? 61320x3 Differentiate -79g*2 - 1453. -158g What is the third derivative of -14h3v*3 - 53h*3v - 2h2v - 17hv*3 - hv*2 + 10h wrt h? -84v3 - 318v What is the first derivative of 420j3r + 59j3 - 1 wrt r? 420j*3 What is the second derivative of -46i*4z*2 - 3i*2z*2 + iz*2 + 45z*2 wrt i? -552i*2z*2 - 6z*2 Find the third derivative of 9x*6 - 57x*4 + 9x*3 - 2x*2 - 5894x. 1080x3 - 1368x + 54 What is the first derivative of n*2ow + 17now - 5nw + n - 13ow + o - 11 wrt n? 2now + 17ow - 5w + 1 What is the second derivative of -11b4 + 4b*2 + 3b - 342? -132b2 + 8 What is the first derivative of -1219g*2l - 2g2 - 3g + 11667l wrt g? -2438gl - 4g - 3 What is the derivative of -232d3 - 96? -696d*2 What is the second derivative of -1112ov3 + 72ov + 7o + 2v wrt v? -6672ov What is the third derivative of -31i*6w*3y - 2i4wy + 2i*2w*3 + 16i*2 - 2iw2y wrt i? -3720i3w*3y - 48iwy What is the second derivative of 578t*5 + 145t? 11560t3 Differentiate -172vx4 + 2vx3 + 3v + 32 wrt x. -688vx*3 + 6vx2 What is the third derivative of f5 + 276f*3 - 40f*2 - 8f wrt f? 60f2 + 1656 Differentiate -531g + 505 with respect to g. -531 Differentiate -1025f2 - 9276 wrt f. -2050f What is the second derivative of 61p5 + 4p*4 - 4p + 257 wrt p? 1220p3 + 48p*2 Find the second derivative of 61k*3v*2 - 5k*3v + 34k2v wrt v. 122k3 Find the second derivative of 3d*2m*2w + 2d2m + d*2w - 44dm*2w + 19dmw + m4w wrt m. 6d2w - 88dw + 12m2w What is the third derivative of 2bd*5 - 2bd2 + 261b + 132d5 wrt d? 120bd2 + 7920d*2 Find the second derivative of -1085l*4 - 1552l wrt l. -13020l2 What is the derivative of -8812i + 10423? -8812 Differentiate 20917fz*2 - f - 185 wrt z. 41834fz Find the second derivative of -12v*2x*3 - 16v*2x - 20vx - 8x4 wrt x. -72v*2x - 96x2 What is the third derivative of -a5 - 2a*4h + 2a3 - 2a*2h - 18ah + 2h wrt a? -60a*2 - 48ah + 12 Find the second derivative of 25ko3 - 3k - 90o3 - 555o wrt o. 150ko - 540o Find the second derivative of -m2x*3 - 3m*2x*2 + 14m*2x + 15x3 - 18x wrt x. -6m2x - 6m2 + 90x Find the second derivative of 1243s2 - 2s - 1458. 2486 Find the third derivative of 247m3 + 315m*2 wrt m. 1482 Differentiate 2o*4 + 321o*3x - 2ov*2x + v*2x + vx - 21x wrt o. 8o3 + 963o*2x - 2v2x What is the second derivative of -9647s2 - 853s? -19294 What is the third derivative of -380f6 + f5 + 5f*4 - 45f*2 - 8f - 3 wrt f? -45600f3 + 60f*2 + 120f What is the third derivative of -181d3 - 1173d*2 wrt d? -1086 Find the second derivative of 148ab2l*2 + 2abl*2 - abl - 2a - 7b2 + 189bl2 wrt b. 296al2 - 14 What is the second derivative of -19a4 + a3 + 11a - 1? -228a*2 + 6a What is the first derivative of -3v4 - 2v*3 - 401v*2 - 4328? -12v*3 - 6v*2 - 802v What is the second derivative of 12622s2 + 4742s wrt s? 25244 What is the second derivative of b*5 - 2173b*4 + 404b + 4 wrt b? 20b3 - 26076b*2 Find the second derivative of 138i*3 - 29i*2 - 19907i wrt i. 828i - 58 Find the third derivative of -2000b5 - b4 + 2b3 + 50b*2 + 211 wrt b. -120000b*2 - 24b + 12 Find the third derivative of -3g5 + 38g*4 + 1806g*2 - 3. -180g*2 + 912g Differentiate -h*2n*2w - 76h2n*2 - 145n*2w + 2n2 wrt w. -h2n*2 - 145n*2 Differentiate 46a*2 - 2ah2 - 10h*2 + 126h - 2 with respect to a. 92a - 2h*2 What is the second derivative of 2035x*3 + x wrt x? 12210x Find the first derivative of -11t3v*3 + 7t*3 + 9t*2 - 172tv3 - 5t wrt v. -33t3v*2 - 516tv2 Differentiate -20d*3no + 2d*3o3 - d2no*3 - do*2 + 31o*3 with respect to n. -20d*3o - d*2o*3 What is the first derivative of -6i*4 - 20im3 - 271m*3 wrt i? -24i*3 - 20m*3 Find the second derivative of -2i*5 - 1848i*2r - 2075i + 3r - 1 wrt i. -40i3 - 3696r What is the derivative of 3262k - 2640 wrt k? 3262 What is the first derivative of 237w*2 - 58? 474w What is the second derivative of -19n2rt2 + n2rt + 11n*2t*2 - 7nrt*2 - 12nr - 2rt - t2 wrt n? -38rt2 + 2rt + 22t*2 Find the third derivative of -51i*6 + 3i*2 + i. -6120i3 Find the third derivative of t3v4 - 6t*3v*2 + 40t*3v + t*2v*4 + 3v*3 wrt v. 24t*3v + 24t2v + 18 Find the first derivative of -2315ay*2 + 7237a + 2y2 wrt y. -4630ay + 4y What is the third derivative of -2cg*3y*3 - cg*3y*2 - 2cy4 - 15g*3y + 12y5 wrt y? -12cg3 - 48cy + 720y2 Find the third derivative of k3l2q - 1443k3lqy - 2k3qy - k2l*2q + 3k2l + k*2y - kl2y + 2l2q - 2qy wrt k. 6l2q - 8658lqy - 12qy Find the first derivative of -117y*3 + 439 wrt y. -351y*2 What is the third derivative of 1120m*3 + 489m*2? 6720 Find the first derivative of 2a*2q + 4al - 4aq*2 - 2lq - 122q*2 wrt a. 4aq + 4l - 4q2 Differentiate -10666s*2 - 9495 with respect to s. -21332s What is the derivative of -8b2go - 4bgo + bo - 286go wrt b? -16bgo - 4go + o Find the third derivative of -12677y3 + 122y*2 - 4y wrt y. -76062 What is the second derivative of -830b3v3 + b3v - 59v wrt v? -4980b3v Find the third derivative of -24o4x + 3o4 + 89o*2x + 2o2 wrt o. -576ox + 72o What is the first derivative of -495y - 1596? -495 What is the first derivative of -2r4 + r3t + 22r*2t*2 + 1228t*2 wrt r? -8r*3 + 3r*2t + 44rt*2 Find the second derivative of 11452g*3 + 12360g wrt g. 68712g Differentiate -8r*3 + 21r*2 - 1270. -24r*2 + 42r	{ "pile_set_name": "DM Mathematics" }
= 0, -3s + 3l = 1416. Let q = s - -325. Let w = 281 + q. Does 51 divide w? False Let s(g) = -23g - 3. Suppose -7 = 6n + 23. Does 28 divide s(n)? True Suppose -2q + 42 = 4t, 3q = -0q + 3t + 81. Let k = q + -21. Suppose 2x = -x + 2w + 228, x - 76 = -kw. Does 19 divide x? True Let k(o) = 0 - 3 - 5o + o3 - o - 8o*2 - 14. Let x be 3 + -6 + 5 - -7. Is k(x) a multiple of 4? False Does 7 divide 1606101/56 + -1 + 48/(-128)? True Let l be (-8 + 12)/((-90)/(-86) - 1). Suppose -2b - l = -96. Suppose -3p - 5n + 501 = -0p, -813 = -bp - n. Does 29 divide p? False Suppose 25 = 9i - 4i, 0 = -5k - 4i + 2085. Does 9 divide k? False Suppose -39a + 22595 = 5k - 34a, 18055 = 4k + a. Does 47 divide k? True Suppose 5u - 30 = 8u. Let c be (u/(-5))/(0 + -1)-2. Suppose k = -cs + 625, 2s - 257 = 5k + 50. Does 26 divide s? True Let q = 11483 - 9761. Is q a multiple of 9? False Let w(y) = 2y2 - 29y - 328. Is 14 a factor of w(-10)? False Let j = 11030 - -2140. Is j a multiple of 15? True Suppose v - 81 = -b, -3b + 429 = 2b - 3v. Let q = b + 1066. Does 46 divide q? True Let j be (49/14)/((-2)/(-4)). Is 7 a factor of j + -5 + 301 - 5? False Let m be (-4)/6(-666)/(-4). Let r = m + 116. Suppose -8a - ra = -2405. Is 37 a factor of a? True Let f = -23710 - -26110. Is f a multiple of 200? True Let y = 48053 - 28918. Does 16 divide y? False Is (7 - -1872) + (-12 - -9) a multiple of 14? True Let b(q) = 21q - 81. Let f(a) = 5a + 98. Let g be f(-18). Does 29 divide b(g)? True Let f be (-1)/((-42)/284/(-6)). Let m(q) = -26q*3 - 2q*2 - 2q + 1. Let p be m(f). Suppose 3s + n = 3n + 69, -s + 2n = -p. Is s even? False Let d = 235 - -93. Suppose -d = -9t + 3317. Is t a multiple of 45? True Let k be 6/(-4 + 24/4). Suppose s + 5y = -14, -ks + 23 = -y + 1. Is 2 a factor of 1s/(-4)-8? True Let v be (-15 + 17)/((8/(-6))/(-4)). Let f be (-7)/((v/(-99))/((-10)/15)). Let q = -40 - f. Is q a multiple of 6? False Let u(t) = 1486t - 3419. Is u(7) a multiple of 41? False Suppose -13y + 11y = -4. Let j(i) = -3i + 5 + 180i3 + 2i*2 - 177i*3 - yi. Is j(2) a multiple of 9? True Let r(n) = 11196n2 + 9n - 28. Is 122 a factor of r(2)? True Let c(a) be the first derivative of a*3/3 + 13a*2 + 84a - 12. Is 2 a factor of c(-24)? True Let n = 56 - 75. Does 29 divide (248 - (-1 - -2)) + n + 17? False Suppose -6b + 13 = -5. Is 2 a factor of ((-10)/(-4) - b)74/(-1)? False Let m(n) be the first derivative of n*4/2 + 11n*3 - 3n*2/2 + 8n + 2284. Let x = -26 - -10. Is 52 a factor of m(x)? True Let m = 71 - 43. Suppose -13 - 7 = 5k - 5s, -s = -2k - 7. Is 3 a factor of (1 + k)m/(-4)? False Let g = -28330 - -44530. Is g a multiple of 20? True Suppose -x = 4l - 488, -l - 931 = -4x + 2x. Does 58 divide x? False Suppose 5a - 76 = 4i, -3i - 52 = -4a - 2i. Suppose u = -2u - a, -5u - 62 = -h. Is 2 a factor of h? True Let y(h) = 172h2 - 9h - 205. Is y(-8) a multiple of 75? True Suppose -2l - 13 = -25. Suppose l = -11y + 28. Does 23 divide 5 + 5 + (15 - y)? True Does 4 divide (-110)/(-165) + 23572/12? False Let l(b) be the first derivative of -b*4/4 + 5b3/3 - b2 + 13b + 68. Does 2 divide l(4)? False Suppose 0 = -5l - 3q + 18358, l = 17q - 14q + 3650. Is 14 a factor of l? True Is 69 a factor of (4 + 2 - 15) + 12 - -8883? False Suppose 4a = -3g + 8121 + 27162, -2a = -g - 17639. Is 28 a factor of a? True Suppose 7d + 1617 = 14d. Suppose q = -4g + 3g - d, 1 = g. Let l = -112 - q. Is 19 a factor of l? False Let o be 9/45 + (-24)/(-5). Suppose 11w - 781 - 3113 = 0. Suppose -ov + w = v. Is 15 a factor of v? False Is (-9986)/(1 + (-12 - (-4 + -5))) a multiple of 14? False Suppose u - 21 + 19 = 0. Let f(q) be the third derivative of q4/3 + q3/2 + 24q2. Does 2 divide f(u)? False Suppose -3w - f + 128 = 0, -5w + 2f + 172 = -34. Suppose 15 + 0 = 5g. Suppose 96 + w = gn. Is 17 a factor of n? False Suppose 27h - 5854 = 3704. Is 59 a factor of h? True Let i(y) = 2y*2 - 9y + 11. Let o be i(3). Suppose 0 = -r - 3r - od + 898, r - d = 226. Is 9 a factor of r? True Let w(q) be the third derivative of -3q4/8 + 14q*3/3 + 36q*2. Does 17 divide w(-8)? False Let m(k) = 93k - 23. Let n be m(22). Suppose -7y + n + 1001 = 0. Is y a multiple of 12? True Let v be -1 + 2 + -4 + -251. Let f = -133 - v. Suppose f = 5k + 36. Does 9 divide k? False Let d(p) = -6308p - 2100. Is d(-5) a multiple of 32? True Let u(f) = 326f + 3780. Does 238 divide u(49)? True Suppose -10283 - 110222 = -25m + 8645. Is m a multiple of 14? True Let w = 25788 - 13503. Is w a multiple of 13? True Let x = 22 + -20. Let r(q) = -3q - 30. Let w be r(-9). Does 4 divide x - -8 - (-6)/w? True Let r(a) = a*3 - a - 6. Let s be r(6). Let y be s/(-16) - (-2)/(-8). Let i = 92 + y. Does 12 divide i? False Let q = -6129 - -6345. Does 27 divide q? True Let i(t) = 46t - 77. Let p = -204 - -207. Is i(p) a multiple of 4? False Suppose 1 = -2o - 3i, -22o - 2 = -26o - 2i. Is 13 a factor of (o - 65/25)-195? True Let m(n) = -n*2 - n + 1. Suppose 3x = -3, -3 = -b + 3x - 5. Let h(d) = -d3 - 6d*2 + 5d - 14. Let a(w) = bm(w) - h(w). Does 7 divide a(-10)? False Suppose 6 = -3w, -3u - 280w = -277w - 21639. Is u a multiple of 8? False Suppose -3d + 69666 = -3z, d - 23220 = 732z - 729z. Is 23 a factor of d? False Suppose a - q = -2q + 23, -3q + 9 = 0. Suppose 0 = 2r - 3u + a, u + 12 = -2r + 2u. Is 21390/36 - r/(-18) a multiple of 16? False Let o be (2 - -13)/(12/(-100)). Is (5 - o/(-20))(-44)/1 a multiple of 11? True Suppose 50d - 33824 = -6d. Is 8 a factor of d? False Let h(m) = 3m*2 - 127m + 9939. Is 51 a factor of h(52)? False Suppose 343589 = 46k + 30053. Does 24 divide k? True Let s = 61 - 56. Suppose 5f + 10 = 0, -87 = -sa - 3f + 667. Let u = 275 - a. Is 27 a factor of u? False Suppose -5h + 2j + 761 = -2h, -4h - 5j + 1053 = 0. Let d = h + -99. Is 15 a factor of d? False Let s be 0/157 - (-3 - (0 - -1)). Let h = s + 170. Does 58 divide h? True Let b(o) = 639o*2 - 33o + 93. Does 23 divide b(4)? False Does 99 divide (-20)/(-45) + 82859/9? True Let s = -5 - -11. Suppose -4g + 25 = -3. Let n = g + s. Is 13 a factor of n? True Let h be 4 + 4 + -6 + 0 + 3. Suppose -hy - 5408 = -9y. Is 30 a factor of y/6 + -36/(-27)? False Is 10 a factor of 21/((-294)/(-238)) + 263? True Let o(c) = -c*3 - 19c*2 - 171c + 29. Does 11 divide o(-12)? False Let y be 8/64-10 + 6/(-8). Is 339/((-9)/y) even? True Suppose -10a = 40a - 138850. Is 62 a factor of a? False Let d(w) = w*3 - 11w*2 + 35w - 11. Let a be d(13). Let c = a + -506. Suppose -5o + c = -o. Is 9 a factor of o? False Suppose w - 4p = -2w - 307, -4p - 8 = 0. Is 8 a factor of (46/(-10))/(7/w)? False Suppose 0 = 3a + 5y + 8 - 13, 5y = 2a - 20. Suppose az = 10, -2x = x + 5z - 934. Is x a multiple of 44? True Suppose 2b + 303 = -143. Let p = -126 - b. Suppose -v + 50 + p = l, 0 = 4l + 20. Is v a multiple of 31? False Let g(d) be the second derivative of -d5/20 + 4d*4/3 - 11d*3/3 - 3d*2/2 + 2d + 39. Does 13 divide g(10)? True Let c(l) = 10l2 - 2l + 1. Let y be c(1). Suppose 0 = 4t - y + 5. Does 15 divide 54/t15/6 - 0? True Let n(d) = -4d3 - 25d*2 - 7d - 8. Let j be n(-6). Is 14 a factor of -132/j125? False Let w be (-2 - 0) + 7/(28/(-52)). Suppose 0 = z - 5a + 247, 0z + 4z + 988 = -4a. Is 15 a factor of 5/w(z + 1)? False Suppose -71l - 95l + 68479 = -254889. Is 3 a factor of l? False Suppose 0 = h + 6h - h. Suppose h = n - 182 + 56. Is 21 a factor of n? True Let c(y) = -y*3 + 5y*2 + 15y - 5. Let q be c(7). Suppose -3n + 2r = -qr - 64, 4r = -4. Is n a multiple of 2? True Suppose -28787 = -3l - 4307. Suppose x - l = -7x. Suppose 4i - 9i = -x. Is i a multiple of 34? True Let x(l) = -84l - 1311. Is x(-59) a multiple of 9? True Let z = -3713 + 3825. Does 7 divide z? True Let v be (-2)/(-5 + 2 - (-19)/7). Suppose o = -2 + v. Suppose or + 3b = 7 + 118, 0 = -2b - 10. Is 14 a factor of r? True Let a(z) = 70z2 - 40z + 70. Is 30 a factor of a(5)? True Suppose -3x + 17422 = -4l, -10x + 3l - 5816 = -11x. Is 16 a factor of x? False Is 2851004/35217/2 a multiple of 13? True Is 18390 + 4 + (-494)/26 a mul	{ "pile_set_name": "DM Mathematics" }
when 49416 is divided by 49398? 18 Calculate the remainder when 995675 is divided by 481. 5 Calculate the remainder when 206257 is divided by 41234. 87 Calculate the remainder when 14558 is divided by 500. 58 Calculate the remainder when 302365812 is divided by 262. 258 What is the remainder when 14303081 is divided by 3761? 3759 What is the remainder when 2799627 is divided by 667? 228 Calculate the remainder when 1944553 is divided by 194397. 583 What is the remainder when 44350 is divided by 3367? 579 What is the remainder when 1331633 is divided by 37? 3 Calculate the remainder when 5889 is divided by 5352. 537 Calculate the remainder when 25947 is divided by 12431. 1085 Calculate the remainder when 6767601 is divided by 57841. 204 Calculate the remainder when 10267649 is divided by 450. 449 What is the remainder when 41523 is divided by 20366? 791 Calculate the remainder when 27421067 is divided by 5484210. 17 Calculate the remainder when 10745694 is divided by 4165. 4159 What is the remainder when 1393802 is divided by 6482? 172 What is the remainder when 169537 is divided by 277? 13 Calculate the remainder when 2998061 is divided by 314. 303 Calculate the remainder when 6238184 is divided by 66. 62 What is the remainder when 116279 is divided by 16334? 1941 Calculate the remainder when 770093 is divided by 13277. 27 Calculate the remainder when 1103379 is divided by 2289. 81 What is the remainder when 48197 is divided by 3138? 1127 What is the remainder when 1360506 is divided by 219? 78 Calculate the remainder when 5532485 is divided by 74. 23 What is the remainder when 43046 is divided by 1307? 1222 Calculate the remainder when 1453211 is divided by 4796. 23 Calculate the remainder when 6034918 is divided by 120. 118 What is the remainder when 4135048 is divided by 229724? 16 Calculate the remainder when 3020086 is divided by 222. 220 Calculate the remainder when 804802 is divided by 649. 42 What is the remainder when 172330284 is divided by 31? 13 What is the remainder when 3820034 is divided by 3819995? 39 What is the remainder when 2112702 is divided by 9? 6 Calculate the remainder when 2508255 is divided by 339. 333 What is the remainder when 4773900 is divided by 954776? 20 What is the remainder when 13182449 is divided by 1310? 1229 Calculate the remainder when 679306 is divided by 10614. 10 What is the remainder when 4846410 is divided by 43? 9 Calculate the remainder when 4393338 is divided by 122. 118 Calculate the remainder when 249675 is divided by 10660. 4495 What is the remainder when 148742 is divided by 74121? 500 What is the remainder when 1386433 is divided by 277? 48 What is the remainder when 10110026 is divided by 105? 101 Calculate the remainder when 584153 is divided by 263. 30 Calculate the remainder when 5850898 is divided by 45. 43 What is the remainder when 33823248 is divided by 1691162? 8 What is the remainder when 7075894 is divided by 847? 56 Calculate the remainder when 101904 is divided by 539. 33 Calculate the remainder when 5700166 is divided by 2580. 946 Calculate the remainder when 6580 is divided by 2368. 1844 Calculate the remainder when 1265993 is divided by 97383. 14 What is the remainder when 102140 is divided by 10176? 380 What is the remainder when 3761141 is divided by 795? 791 What is the remainder when 872399 is divided by 1512? 1487 What is the remainder when 147869 is divided by 640? 29 Calculate the remainder when 7775411 is divided by 11889. 5 What is the remainder when 130348 is divided by 297? 262 Calculate the remainder when 356908 is divided by 770. 398 Calculate the remainder when 68326315 is divided by 4427. 4424 What is the remainder when 251999 is divided by 30212? 10303 Calculate the remainder when 34724569 is divided by 37. 32 Calculate the remainder when 77340 is divided by 637. 263 What is the remainder when 6563507 is divided by 51? 11 What is the remainder when 24643 is divided by 23418? 1225 What is the remainder when 218494295 is divided by 24? 23 What is the remainder when 514169 is divided by 2116? 2097 Calculate the remainder when 2477579 is divided by 30. 29 What is the remainder when 1378680 is divided by 166? 50 Calculate the remainder when 14411259 is divided by 145. 144 Calculate the remainder when 240560 is divided by 79702. 1454 Calculate the remainder when 3327929 is divided by 3090. 3089 Calculate the remainder when 7021378 is divided by 1003053. 7 What is the remainder when 6411703 is divided by 1602866? 239 What is the remainder when 17063 is divided by 3685? 2323 What is the remainder when 4887051 is divided by 1772? 1647 Calculate the remainder when 316812 is divided by 972. 912 What is the remainder when 163830196 is divided by 4497? 4486 Calculate the remainder when 60762972 is divided by 10127160. 12 Calculate the remainder when 196481 is divided by 97684. 1113 What is the remainder when 56893 is divided by 7079? 261 Calculate the remainder when 133701 is divided by 920. 301 What is the remainder when 117050 is divided by 29235? 110 What is the remainder when 561531 is divided by 4222? 5 What is the remainder when 10560591 is divided by 461? 3 Calculate the remainder when 4679377 is divided by 2105. 2067 Calculate the remainder when 2609265 is divided by 2609265. 0 Calculate the remainder when 11947055 is divided by 2966. 7 Calculate the remainder when 4157258 is divided by 182. 14 Calculate the remainder when 6053749 is divided by 39310. 9 Calculate the remainder when 386391 is divided by 1337. 1335 What is the remainder when 1146121 is divided by 163724? 53 What is the remainder when 2333465 is divided by 2240? 1625 What is the remainder when 103222 is divided by 179? 118 Calculate the remainder when 11948636 is divided by 80. 76 Calculate the remainder when 24361540 is divided by 537. 535 What is the remainder when 8678 is divided by 3722? 1234 Calculate the remainder when 151961 is divided by 37481. 2037 Calculate the remainder when 6441938 is divided by 42. 20 Calculate the remainder when 112614 is divided by 11638. 7872 Calculate the remainder when 1377765 is divided by 790. 5 What is the remainder when 8808 is divided by 4374? 60 Calculate the remainder when 48602 is divided by 332. 130 Calculate the remainder when 45760462 is divided by 1674. 1672 Calculate the remainder when 14831986 is divided by 5467. 15 What is the remainder when 768216 is divided by 71? 67 Calculate the remainder when 193862 is divided by 6185. 2127 Calculate the remainder when 8864 is divided by 4415. 34 Calculate the remainder when 824801 is divided by 61. 20 Calculate the remainder when 2037514 is divided by 2147. 11 Calculate the remainder when 20431440 is divided by 1080. 0 Calculate the remainder when 14630 is divided by 3550. 430 Calculate the remainder when 123262 is divided by 448. 62 What is the remainder when 39720451 is divided by 1217? 5 What is the remainder when 2156598 is divided by 28? 10 Calculate the remainder when 50183 is divided by 7098. 497 What is the remainder when 35029370 is divided by 2594? 2588 What is the remainder when 1927227 is divided by 15668? 63 What is the remainder when 594562 is divided by 34968? 106 Calculate the remainder when 10294830 is divided by 1112. 1046 What is the remainder when 617041 is divided by 5154? 3715 Calculate the remainder when 26161 is divided by 13038. 85 Calculate the remainder when 97924435 is divided by 25. 10 What is the remainder when 2209912 is divided by 12628? 12 Calculate the remainder when 5264146 is divided by 5264139. 7 Calculate the remainder when 3494359 is divided by 25693. 111 What is the remainder when 12790602 is divided by 4823? 6 Calculate the remainder when 1110414 is divided by 490. 74 Calculate the remainder when 1389159 is divided by 694573. 13 Calculate the remainder when 37556646 is divided by 262. 256 Calculate the remainder when 21520248 is divided by 348. 276 What is the remainder when 229860 is divided by 38156? 924 Calculate the remainder when 25205 is divided by 1096. 1093 What is the remainder when 4188928 is divided by 1047228? 16 Calculate the remainder when 82027 is divided by 11653. 456 Calculate the remainder when 344686 is divided by 1336. 1334 What is the remainder	{ "pile_set_name": "DM Mathematics" }
of y? True Let d(v) be the third derivative of v6/120 + v4/24 + 7v3/6 - 2v*2. Let t be d(0). Is t/1 - (-1)/1 a multiple of 4? True Suppose 2f = -3f + 3v, 3v - 15 = 0. Suppose 4p - 49 - 19 = -a, fa + 4 = p. Does 8 divide p? True Let b(o) be the second derivative of o2 - 1/20o*5 + 1/2o*4 + 0 - o - 1/2o3. Is b(4) a multiple of 11? True Let b(s) = -s3 - 13s2 - 36s. Does 15 divide b(-10)? True Let h(c) = -c*3 - 7c*2 + 7c + 12. Let o be h(-8). Suppose -4u = 3j - 12, -5u - o = -3j + 19. Is 2 a factor of j? True Does 11 divide (-518)/(-6) + (-12)/9? False Let y = 166 + -95. Does 22 divide y? False Let i(l) = 38l + 1. Let c be i(-1). Let y = -15 - c. Is 13 a factor of (4 + -2)(y + -3)? False Let f(n) = n*3 + 7n*2 - 3n - 4. Let h be f(-7). Let b = -15 + 7. Let g = h + b. Does 9 divide g? True Suppose 5 + 13 = 3a. Let d = 23 - a. Is d a multiple of 12? False Is 198/4(56/(-6))/(-7) a multiple of 11? True Suppose -4u = -5 - 387. Is 5 a factor of u? False Suppose -3b + 736 = b. Suppose -2m - 2m + b = 0. Does 17 divide m? False Is 26 a factor of (1 + 46/6)3? True Let a be ((-3)/7)/(6/(-42)). Suppose -aj = j - 140. Is j a multiple of 28? False Let w = -4 - -6. Let m = w - 0. Does 5 divide m/(-9) - (-47)/9? True Suppose -2j + 5d - 153 = -397, -3j + 4d = -352. Is j a multiple of 14? True Let m(w) = w*3 - 4w*2 + 2w - 3. Let v be m(4). Suppose -2r + 70 + 58 = 0. Suppose -vn + 6j - 3j + 88 = 0, -4n + r = 4j. Is n a multiple of 17? True Let p = 104 - -3. Is 21 a factor of p? False Suppose -5s + h + h = -140, -4s + h + 109 = 0. Does 19 divide s? False Let m(c) = -c + 12. Let g be m(9). Suppose 6y - 36 = gy. Is 6 a factor of y? True Suppose 0 = 5q + 19 - 89. Suppose r - q = -z + 3r, -2z = -3r - 30. Is 16 a factor of z? False Let i be (3 + -1)(-87)/(-6). Suppose 5b = i + 141. Is 13 a factor of b? False Suppose 5 + 17 = k. Does 11 divide k? True Suppose r + 0r - 2g = -6, -4g + 20 = 0. Suppose 10 = q + r. Is q a multiple of 4? False Let l be ((-7)/2)/(1/(-2)). Let b(z) = 5z - 11. Is 6 a factor of b(l)? True Let d(h) = h*2 - h. Let l be d(2). Suppose -l = o + 4. Let j = o - -57. Is j a multiple of 18? False Suppose 3z = z - 2. Let b be z/5 + (-11)/(-5). Let w = 9 + b. Is w a multiple of 4? False Let l = 43 - 31. Is l a multiple of 5? False Is -3 - (-51 - (-2 - 2)) a multiple of 12? False Let k = 69 - 37. Suppose 33 = 5p - k. Does 9 divide p? False Is 16 a factor of 2150/45 - 2/(-9)? True Let j(m) = -m3 - 2m2 + m. Let q be j(1). Let r(i) = -i3 + 4i2 + 4i - 2. Let c(x) = -x*2 - x - 1. Let p(f) = qc(f) - r(f). Is p(3) a multiple of 4? False Let i(n) = -1 + 0 + n*2 - 9n - 7 + 10. Is i(13) a multiple of 18? True Suppose 0 = 51u - 56u + 870. Is u a multiple of 14? False Suppose -36 = v + 5k, -3k + 4k = -1. Suppose 3u - 6u - 4n = 13, 2u = -5n - 11. Is 5 a factor of 4/(-12) + v/u? True Let n be (-1)/((-1)/2) + 84. Suppose -n = -4p - 14. Is 9 a factor of p? True Suppose 11 = 2m - m - 3t, 3m = 5t + 29. Suppose m + 21 = s. Is 15 a factor of s? False Let c be (-1)/(-3 - -4)-11. Let b = c - 5. Is 24/(1/(b/9)) a multiple of 8? True Let n(c) = c - 4. Let f be n(7). Suppose 2v - 34 = -4w + 26, 0 = 3w - fv - 36. Does 14 divide w? True Suppose 2s = -2s. Suppose 0 = 3a - 5w - 34, 4a + sa - 4w = 32. Suppose -b = 3u - 19, -au = 3b - 80 + 17. Does 10 divide b? False Suppose 0i = -2i. Suppose -55 = -iv - v. Is v a multiple of 20? False Suppose 5f + 98 = 5l + 6f, 4l = 4f + 88. Does 10 divide l? True Let q(t) = -2t - 5. Suppose -7r - 8 = -3r - 2i, i = 3r + 8. Let g be q(r). Suppose -5x - 2 + 8 = 2d, -gx - 2d + 2 = 0. Is 2 a factor of x? True Suppose -4a + 74 = 4w - 54, 3w - 90 = -5a. Suppose 4u - 3v - w = 0, -u + 17 = 5v - 3v. Is 11 a factor of u? True Does 8 divide 6/(12/202) + 3? True Let v(n) be the first derivative of 2n4/3 - n3/3 + n*2 - 2n + 1. Let d(m) be the first derivative of v(m). Is 15 a factor of d(2)? True Let h be 13/5 - 2/(-5). Let i(p) be the first derivative of p*4/2 - 2p3/3 + p2 + 2p + 12. Is 15 a factor of i(h)? False Is (-122)/(-10) + 4/(-20) a multiple of 6? True Let l(h) = 5h*3 + 2h*2 - 2h + 1. Let y be l(1). Let a(o) = 2o - 2. Is a(y) a multiple of 4? False Let q(n) = -n3 - 4n*2 - 6n - 4. Is 7 a factor of q(-4)? False Let w be ((-2)/3)/(2/(-63)). Suppose w = 2c - 15. Does 7 divide c? False Suppose z + u - 11 + 0 = 0, -5u + 15 = z. Suppose -18 - z = -4q. Does 7 divide q? True Suppose 0x + 10x = 1560. Is 12 a factor of x? True Let b(l) = l2 + 4l + 1. Let k be b(-3). Does 19 divide 19(6/k + 4)? True Suppose -2q - 3t - 2 = 0, -2q - t - 1 = 1. Is (-1)/(q(-1)/(-30)) a multiple of 10? True Suppose -5j + 96 = -3k, -2k + 32 = 2j - 0. Is j a multiple of 11? False Suppose 0b - 4b = -1156. Suppose 0 = 4h - b - 47. Let a = h + -58. Does 13 divide a? True Let h(z) = 18z2 - 1. Let y be (-5)/(-10) - (-3)/(-2). Let v be h(y). Let s = -5 + v. Does 12 divide s? True Let g(j) = 3j*3 + 3j*2 - 2j + 1. Suppose -5a = -4t - 30, -3a + 2t + 18 = a. Is 11 a factor of g(a)? True Let u be -5 - (-6)/42. Is 40 - u(-2 - -3) a multiple of 14? True Suppose -2x = 2x - 192. Is 12 a factor of x? True Suppose -5k + m + 0m = -5, 0 = -2m. Let j(w) = 8w + 1 + 2w + 3w. Is j(k) a multiple of 6? False Suppose c + 2 = 3c. Suppose -v = -c - 1. Suppose -vo + 16 = -2a, -2a - 20 = -3o + 5. Does 8 divide o? False Let l(k) = 2k*2 + 3k - 3. Let x = 0 + 3. Let v be l(x). Suppose -2j = 4c - 0j - 54, -v = -3c + 4j. Is c a multiple of 12? True Let f be (4/(-2))/((-2)/(-2)). Let i = -25 - -37. Is (i/f - 2)/(-1) a multiple of 3? False Suppose -b - 31 = -2b - 4v, b - 2v = 13. Is b a multiple of 18? False Let h(v) = v*2 + v - 22. Does 10 divide h(-9)? True Let b = -17 + 20. Suppose 0 = 4n - 5v - 130, -bn - 32 = -4n + v. Does 7 divide n? False Does 12 divide -43(4 + -6)? True Does 30 divide ((-3)/12 - 15/20) + 143? False Suppose -2r = -i + r, -4i = -2r. Let q = 12 + -13. Is 5((-6)/q + i) a multiple of 15? True Let l = -7 - -2. Let f = l - -3. Let m(t) = -t3 + 3t + 1. Is 2 a factor of m(f)? False Suppose -154 = l - 2l + 2o, -2o + 6 = 0. Is 7 a factor of l? False Let r(g) = 32g. Let u = 4 - 3. Is 16 a factor of r(u)? True Let i(x) = x*3 - 7x*2 + 5x + 13. Does 15 divide i(8)? False Suppose 27 = 2b - u, 5b - 2u = u + 68. Is b a multiple of 8? False Let g = -39 - -69. Suppose 5w - 6 = 4. Let t = g - w. Is 14 a factor of t? True Let i(g) = -g*3 - 4g*2 - 3g + 2. Let a be i(-3). Suppose ap + 3p = -15. Is 6 a factor of 1/(p/(-27)) + 2? False Suppose -13 - 12 = -5k. Let q be -54 + (2 - (k - 2)). Let s = q - -78. Is 8 a factor of s? False Suppose 2f + w = -w + 62, -f = -2w - 40. Is f a multiple of 11? False Suppose 4c + 2r = 72, -3c = -r - 88 + 24. Does 5 divide c? True Suppose 2x + 111 = 5x. Is 15 a factor of x? False Let y = 72 - 36. Does 12 divide y? True Suppose -4p = 5b - 13, 5b + 5p - 14 = 1. Suppose u - 85 = -b. Does 26 divide u? False Let u(y) = 6y - 2. Let f be u(6). Suppose 0o - 3o - 2p + f = 0, -4p + 8 = o. Is o a multiple of 7? False Let z = 11 - 8. Suppose zo + 18 = 3v - 8v, -3v = -3o + 6. Let s = 13 + o. Does 12 divide s? True Let j(p) = 6p2 - 2p + 1. Is j(2) a multiple of 5? False Suppose -2z + 7z - 20 = 0. Let s = z + -4. Suppose -h - 2o + 6 = -sh, -4o = -h + 36. Is h a multiple of 5? False Let i = 5 + -1. Is 13 a factor of (i - 2)/(3/39)? True Suppose 3o + 56 = 4l + o, 70 = 5l - o. Is 5 a factor of l? False Suppose 2t + 3t + 895 = 0. Let k = t + 312. Suppose u + 4u = -3r + 145, k = 4u - r. Does 18 divide u? False Suppose 8u - 7u = 58. Let c = u - 28. Is 13 a factor of c? False Let j(d) = d2 + 9d + 10. Is j(-10) a multiple of 5? True Suppose c + 4c = 90. Suppose b = 2b + c. Let m = -2 - b. Does 8 divide m? True Suppose -1 = 4f - 9. Suppose -l = 2w, 2l + 3w + 5 = -fw. Is 4 a factor of l? False Suppose 0 = -5r + 2m + 65, -3r - 5m = -22 - 17. Does 3 divide r? False Let w = -20 - -32. Is w a multiple of 4? True Suppose -5y + 696 = 3v, 2v = v - 3y + 232. Suppose 4a = 5b - v, 4b - 2a = -3a + 194. Does 2	{ "pile_set_name": "DM Mathematics" }
fy (ss/(s(-2/17)s)s(1/3))(-41)/((s/(ss/(s/(s/s*(1/4)s))s))40)(1/2) assuming s is positive. s(-229/51) Simplify ((v(vv(-7/2))/vv*0v)/(v(-1/5))(-1/14))15 assuming v is positive. v(-159/7) Simplify ((pp(p*(-1/8)p)/p)/(ppp(-7)))(-1/62)((p/p(-3/2))/pp(-2/23))(-27/5) assuming p is positive. p(-88313/11408) Simplify ((p(-1))*48(p1)(6/7))/((p(-2/7))(7/2)/(p*(1/6)/pp*(3/4)p)) assuming p is positive. p(-3799/84) Simplify ((f/(f(-16)f)f(6/7))/(f(2/7)f/((f/(fff0))/f)))4 assuming f is positive. f(380/7) Simplify h3h/(((h*(-4/3)/h)/h)/h)(h/h(-1))26(h(-7)h)/(hh(-7)hh)(h(-1/2))45 assuming h is positive. h(215/6) Simplify w(-1/5)/(ww0)(w/(w/w*5))/www7(w*(-2/17)w3/w)(-13) assuming w is positive. w*(-1162/85) Simplify (uu*(-12)u*16/u((u*7/u)/uu)/(u*4uu))(-1) assuming u is positive. u(-4) Simplify ((qq(2/3))(-4/5))(-12/11)/(((q(-3/5)q)/q)/(qq(-6)/q))11 assuming q is positive. q(-3187/55) Simplify (((b/b(-6))/bbb*1b)/(bb/b(2/3))(-35))/((b/b(-2/7))(-47)/(b(-1/5)/(bbb(1/7)b))) assuming b is positive. b(11839/105) Simplify (((i(-2/11)i)/i)/i(-3))/(i(-2/11)/(i5i))ii*(-2)(i/(i/((i/i*1)/i)))/iii(-3)/((i/i(-2/7))/ii) assuming i is positive. i(19/7) Simplify (((d(3/37))11)(5/7))(-7/9) assuming d is positive. d(-55/111) Simplify (m*(1/13)/mm/(m/m(25/3)))/(m/m(-3/4)mm/(m*(-1/3)/m)mm) assuming m is positive. m(17/52) Simplify (q/q(-6))/(q/(q(-2/7)/q))(qq2)/qqq/(q/q(2/11))(q3/(q6q))(-1/26) assuming q is positive. q(8058/1001) Simplify ((i/i(1/2))(-3/8)(i/((i/i*1i)/ii))(-18))/((i1i)/(i*(1/4)/i)(i/i(2/15))/(i(4/3)/i)) assuming i is positive. i(-833/240) Simplify (p(-10)p4((p*21pp)/p)/p(-1/5))31 assuming p is positive. p(2511/5) Simplify ((m(-2/3))(-10/3)(m*(-1)/mm)*(-5))/((mm(-2)/m)28)(-1/35) assuming m is positive. m(253/45) Simplify (b(2/5))(-16)/(b*(1/3)/bb*(-3/5))(bb(-2/5)bb)(-12)(bb(-2/3))(6/11) assuming b is positive. b(-1193/33) Simplify (((d(-2/11)d)/(dd(-3/8)))/(dd0)(5/6))/((d(1/4))38(d/(d/d(-1)))(-2/107)) assuming d is positive. d(-286967/28248) Simplify (((k/(k(-2/3)/k))(-14/5)/(k(-1/3)k)(-39))(-16/5))(-18/13) assuming k is positive. k(26688/325) Simplify ((t*0t29)/((t/t(-21)t)/((t/(t(tt(2/23)/tttt)/tt))/t)))(-3/7) assuming t is positive. t(-132/161) Simplify ((k/(k/(k/k(2/15))k))/(k*(-3)k)(kkk/((kk(-1/4))/k))/(k(-6)k))/((((kk(-2/3))/k)/k)27)21 assuming k is positive. k(57307/60) Simplify ((m*3/(mm/(((m/((mm(2/17))/m))/m)/m)mm)((m/(((mm(-5))/m)/mmm))/m)/m(-4/7))(-29))(-6/11) assuming m is positive. m(50808/1309) Simplify (d(1/5)/dddd/(d/(dd(7/3)/d))d(d/((dd/d*7)/d))/(dd(2/3)))/(d(-4/11)/((d/(d/d(-2/3)))/d))(-34/5) assuming d is positive. d*(206/11) Simplify ((((jj/j*2j)10)(-42))(-2/7))(2/137) assuming j is positive. j(240/137) Simplify (g2)*(-42/11)ggg*(-3/5)ggg*(-4)g*(-1)g*2g(g(2/11)g)/gg(-1) assuming g is positive. g(-388/55) Simplify (q(-3)q)/(qqqq0)((q/q*(-6)qq)/q)/qq*(1/3)q((q/(qq/q*(-4/3))q)(-42))(-3/22) assuming q is positive. q(-142/33) Simplify (m3m2m*7mm/(mm*(-3/11)/mmm))/(m(-1/7)(mm/m(-1/3))/m(m1/m)(-2/3)) assuming m is positive. m*(2560/231) Simplify ((nn22)/n(4/3)n(1/81)n(-10/11))(-2/11) assuming n is positive. n(-37012/9801) Simplify ((r/(((r/r(2/5)r)/r)/r))(3/11)/(rr/r24)(-6))(-10) assuming r is positive. r(14478/11) Simplify ((x/x*2)/(x/(xx*(-2)x)))(-1/6)/((x(1/3)/((xx/(x/(x/x(4/3)x))x)/xx))/(x(1/4))(11/5)) assuming x is positive. x(193/60) Simplify v(2/11)v/(((v4v)/v)/v)(vvvv*0v)*(-22)(vv/(v6/v))/((v(-1/11)v)/v)(vvv(3/2))/v(-3) assuming v is positive. v(-1897/22) Simplify (((((ss/((s/(s*(-2/41)s))/s)ss)/s)/s)/s(-3/8))/(s(-1/7))(-11/5))(-4/15) assuming s is positive. s(-34577/43050) Simplify ((y0y)24)(-2/93)/((y(-2/7))(-5)/(y2y(-5))) assuming y is positive. y(-1073/217) Simplify ((v*(-1/6)vvvv(-9)vv4/(v/((v6/v)/v)))(-4))(-2/37) assuming v is positive. v(44/111) Simplify (w/w(-1/3)w6)/(w1)*(-4/15)((w(-1/2)/w)/((w/((w(1/6)w)/w))/w))/(w/(w/w(-1/2)))34 assuming w is positive. w(349/15) Simplify ((z/(z/(zz*(-1)z))z/z(-5/4))/(z3z(-2/29)))(-32) assuming z is positive. z(-296/29) Simplify (((s/s(-3/5))/s0)/(s0s(-6)s))/((s*4/s)/(ss(2/5)))(-3/4) assuming s is positive. s(39/5) Simplify (m(4/3)m(-2)/mmm((m/(m/(m/m*5)))/mm)/(m/(mm(-2/9))))/(((m(-1/12)/m)/m)/((mm(2/9))/m))9 assuming m is positive. m(607/36) Simplify (((z/(z/z(2/37)z))/z)/(zz/(z/((zz(2/11))/z))zzz))(1/13)/((z(-8)/z)/(z(z/(zz(2/5)))/z))(2/53) assuming z is positive. z(-205884/1402115) Simplify o(-8)/o*2(o(-1/5))(-10)(o(-6)o(-2/3))/(o2)(-31) assuming o is positive. o(142/3) Simplify (pp(2/95)p*5pp(-28)p*13p)(1/14) assuming p is positive. p(-663/1330) Simplify (o*4o/o*(-2/9)oo)/(o0)(-11)((o*(2/19)/o)/ooo/o(-2/3))(-47) assuming o is positive. o(-4969/171) Simplify (j0j)/j*(-5)j*(-3)/(j/(j/(j/(jj*(2/9)j))))j(3/5)(jj/j4)/jj*0(j/(j*(2/13)j))/j assuming j is positive. j(391/585) Simplify ((u(2/9)u1)/(u(-2/7))(-8))/(u(-2/3)u9/u)(-4/13) assuming u is positive. u(977/819) Simplify ((y(1/3)/(y/(y/(((y*(1/3)/yyy)/y)/yy)y)yyy)((y/(y/(y/y(-1/3))yy))/y)(-29))(-16))(-36/7) assuming y is positive. y(26688/7) Simplify ((v/v(2/5))/v)(34/3)vv(-3/5)v/v*0(((v*(2/5)v)/vv)/v)(-1/44)v*(-3)v/(v*(-1/3)/v)v assuming v is positive. v(-309/110) Simplify ((y(-5/2)yy*28y)/(y(5/8))(-39))(-4/23) assuming y is positive. y(-415/46) Simplify (((((a/a*(2/13))/aa)/((((a*(2/5)/aa)/a)/aa)/a))/(a5aa(2/15)))(-1/23))(-12) assuming a is positive. a(-2876/1495) Simplify s(-36)s*9ss/s(1/18)s*(-5/6)/sss assuming s is positive. s(-224/9) Simplify f/f(-2/15)f*2f*(1/2)/(ff/(fff*(1/2))f)((ff(-2/3))/f(-1))/((ff(1/5)f)/(f/(f(f/((f3f)/f))/ff))) assuming f is positive. f(64/15) Simplify (((q(2/7)/qq)/(q/(q*(-1/3)/q))((q/q*(-4/5)qqq)/q)/(q/q(-3)))(-1/24))(-31) assuming q is positive. q(-1829/630) Simplify ((((ww/(((w/w5)/ww)/w))/w)/www)/(w/w(-4/3)))(-32)(w(-2/13)w/(w/((ww(-1/10)/w)/w)))(-2) assuming w is positive. w(-28631/195) Simplify (((oo/o(-10/9))/o)/((o/o(4/27))/o))/(o*(-25)/ooo(6/11)/o) assuming o is positive. o(8231/297) Simplify (a/((a/a(-9/11))/a)a(-3/8))/(a/a36a(a*(-1/6)a)/a) assuming a is positive. a(8969/264) Simplify ((l(1/2)/l)/((l*(-1/17)/l)/lll))38/(l(2/35)ll(-1)l*(-5)/(l/(ll/l*(-6)lll))) assuming l is positive. l(-12984/595) Simplify j(1/16)/((jj/(j(-19)j))/j)j(-43)jj1/j assuming j is positive. j(-975/16) Simplify (h(-1))23/(h(-3)/hh/(hhhh(-3)h))(h0)(-2/11)/((hh/(hh(-2)hh))/(hh/(h/(hhh/((h*(2/19)/h)/h)))h)) assuming h is positive. h(-249/19) Simplify f(-4)/((f(f/(f(-2/3)f)f)/ff)/f)(fff(1/2)f)/f*(3/5)((fff(1/13))/(f7/f))/(f(1/7)/(f/f(-1/13))) assuming f is positive. f(-15713/2730) Simplify (f(-11/4)/f*5f*14/((ff/(ff(ff(2/7)/f)/f))/ff))(-5/9) assuming f is positive. f(-775/252) Simplify ((h(-4))(18/5)/(h*(-6/13)hh(-2/9)))33 assuming h is positive. h(-94699/195) Simplify (i(1/2)/i(-4))(-42)(i*6ii/((i/((iii1i)/i))/ii)ii)/(i/((i/(i/i(4/5)))/i)i(-3/5)) assuming i is positive. i(-888/5) Simplify (p/p*(-6)p/p*(-1)p)*(-12)(p*(-1/7)/(p(pp/(pp*(-4/5)))/pp))45 assuming p is positive. p(-1767/7) Simplify (z*(-5)z*(-7))/((zz*0/z)/zz)*(-50)(z1)(-44)z(-2/7)/z(2/19) assuming z is positive. z(-7500/133) Simplify (f(3/5)ffffff3)*(1	{ "pile_set_name": "DM Mathematics" }
32, -3g + 40 = 5k. Suppose -4c + 2 = -2c, 0 = -4d + c + g. Let o(h) = -6h*2. Let r(x) = -5x*2. Give do(j) - 5r(j). j2 Let i(x) = -4x*3 - x - 2. Let u be 1 - 1 - (-7 + 5). Let s(p) = -14p3 + p3 - 5 - p + 4p3 - up. Determine -5i(z) + 2s(z). 2z3 - z Suppose -28 + 13 = -3k. Let s(r) = -2r2 + 5r - 5. Let g(n) be the first derivative of n*2/2 - n + 9. Calculate kg(p) - s(p). 2p2 Let p(a) = 4a*2 + 7a - 5. Suppose -5j + 30 = w, 3w + 2j - 37 = 14. Let u(c) = 4 + 6 - 9c*2 - wc + 1. Determine -13p(g) - 6u(g). 2g2 - g - 1 Let a(x) = -x3. Let c(w) be the second derivative of w5/4 - w3/6 - 44w. Calculate -6a(u) - c(u). u3 + u Let l(b) = -b2 + b + 4. Let j(u) = 2u*2 - 2u - 11. Suppose 0 = -m - 3m - 32. Give ml(p) - 3j(p). 2p*2 - 2p + 1 Let g(j) = j*3 - 2j2 - j - 1. Let h(m) = -m2 - m + 1. What is -g(c) - h(c)? -c*3 + 3c*2 + 2c Let h(f) = -f*2 - 6f - 46. Let q(i) = -i*2 - 7i - 47. Calculate -6h(l) + 5q(l). l*2 + l + 41 Let g = 17 + -19. Let b(p) = 1. Let d(h) = -h + 2. Give gd(v) + 3b(v). 2v - 1 Let q(l) = -3l3 - 4l2. Let k(r) be the third derivative of r5/60 - 4r2. Determine -4k(o) - q(o). 3o3 Let l(z) = -z - 3. Let q be l(-7). Let w(k) = k2 - 2 + 3k*2 + k - qk - 3k. Let a(c) = -9c*2 + 13c + 4. Give 6a(j) + 13w(j). -2j2 - 2 Let m(z) = z2 + 6z - 6. Let y(o) = -2 + 2 - 3 + 2 + o. Give m(v) - 5y(v). v2 + v - 1 Let p(r) = -r2 - 4r - 3. Suppose 2s - q - 49 = -2s, 0 = -s + q + 10. Let o = 5 - 2. Let c(k) = -2k - 8k*2 - 15k - s + ok2. Give 2c(w) - 9p(w). -w2 + 2w + 1 Let u(v) = v*2 + 5v - 5. Suppose 19 = 2x - 5k + 2k, 5k = -x + 3. Let i(z) = -7z + x + 1 - z2 - 3 + 1. Let y be 3/220/6. What is yi(w) + 7u(w)? 2w2 Let z(m) = 3m*3 + 3m*2. Suppose 0 = 2d - 3n + 20, 2 = -2n + 6. Let w(i) = -6i3 - 7i*2. Calculate dz(o) - 3w(o). -3o*3 Suppose -4g + 80 = -o, -2g - 7 = -3g - 3o. Suppose -g = -5u + 1. Let m(t) = t - 1. Let j(r) = -2 - 3 + 2 + 4r. Give uj(d) - 14m(d). 2d + 2 Let f(m) be the second derivative of m*3/6 + 3m*2 + 47m. Let j(r) = -r - 6. Determine 5f(g) + 4j(g). g + 6 Let p(a) = 8a3 + a2 - 6a - 5. Let b(g) = -7g3 - g2 + 5g + 4. Suppose -8w - 54 = -6. Determine wb(c) - 5p(c). 2c3 + c2 + 1 Suppose -q + 6 = -0q. Let l(o) = o3 + 7o - 6. Let c(m) = 2m3 + 7 - 2m*3 - 8m - m*3. What is qc(v) + 7l(v)? v3 + v Let a = -35 + 69. Let k(s) = 11s*2 + 17s. Let x(g) = -2g2 - 3g. Let y(t) = t + 3. Let q be y(3). What is ax(w) + qk(w)? -2w2 Let t(m) = 3m*2 + 4m + 5. Let g(b) = 7b2 + 9b + 11. Give -4g(p) + 9t(p). -p*2 + 1 Let t(q) = 2q*3 - 5q*2 - 7q + 2. Let v(b) = b*2 + b. Suppose w - j = j + 7, 0 = 3w + 5j + 23. What is wt(p) - 5v(p)? -2p*3 + 2p - 2 Let g = -159 + 170. Let s(v) = -10v + 4. Let d(k) = 2k - 1. What is gd(w) + 2s(w)? 2w - 3 Let h(q) = 14q*2 + 8q + 17. Let b(g) = -38g2 - 12g - 24. Let l(k) = 9k2 + 3k + 6. Let p(c) = -2b(c) - 9l(c). What is 6h(n) + 17p(n)? -n*2 - 3n Let q(d) = 3d3 + 2d*2 + 2d - 2. Let g(l) = -l3 - l2 - l. What is 2g(s) + q(s)? s3 - 2 Let y(p) = 1. Suppose -41h - 12 = -39h. Let k(s) = -3s - 5. What is hy(f) - k(f)? 3f - 1 Suppose 5r = 4k + 18, 2k = -5r - 2k + 2. Suppose 0 = ry + 15 - 7. Let s(b) = 3b + 2. Let j(u) = 4u + 3. Calculate yj(l) + 5s(l). -l - 2 Let w(s) = 5s2 + 9. Let n(d) = 3d*2 + 5. Determine -11n(o) + 6w(o). -3o*2 - 1 Let r(h) = 6h + 4. Let g(i) = i - 1. Give -5g(c) - r(c). -11c + 1 Let c(r) be the second derivative of r5/5 - r4/12 - r*3/3 + 2r. Let p(y) = y3. Let z(i) = -i2 + 6i - 3. Let h be z(6). Determine hp(j) + c(j). j3 - j2 - 2j Let j(x) = 26x*2 - 16x - 4. Let l(s) = 5s2 - 3s - 1. Calculate 3j(t) - 16l(t). -2t2 + 4 Let z(s) = -5s - 2. Let d(n) = 10n + 5. Give 2d(h) + 5z(h). -5h Let j(q) be the first derivative of -5q2/2 + 3q + 49. Let c(y) = 4y - 3. Give -3c(p) - 2j(p). -2p + 3 Let i(j) = 2j. Let h(u) = 6u. Determine -3h(o) + 8i(o). -2o Let d(v) = -2v*2 + 5v - 5. Let w(s) = -3s + 2 - 1 + 2 + 0 + s2. Let m = -8 - -4. Let b be -9 + 1 - (m - -2). Determine bd(y) - 10w(y). 2y*2 Let v(r) = -3r*2 - 2r + 5. Suppose 3m + 8 = -7. Let k(s) = -6s*2 - 3s + 9. Calculate mv(z) + 3k(z). -3z2 + z + 2 Let a(w) = -w3 - 1. Let q(f) = -2f - 25. Let t be q(-12). Let h(u) = u*3 - 2u*2 - 1. Calculate th(i) + a(i). -2i3 + 2i2 Let p(i) = -i2 - 9i. Let b(d) = 2d*2 + 9d. Give -2b(m) - 3p(m). -m*2 + 9m Let n(q) = -q*2. Let z(s) = 2s*2 - s + 1. Calculate -5n(v) - 2z(v). v2 + 2v - 2 Let g(w) = -w - 1. Let t(p) = 4p + 6. Give -5g(k) - t(k). k - 1 Let z(i) = i. Let u(b) = 3b. Suppose 3a - 8a - 15 = -3j, 4a - 3j + 9 = 0. What is az(w) + 3u(w)? 3w Let k(h) = -h2 - 7h - 16. Suppose -4v - 4w - 4 = 0, 2v + v + 7 = w. Let u(b) = -b - 5. Let a(y) = -y. Let x(m) = a(m) + u(m). What is vk(f) + 7x(f)? 2f*2 - 3 Let j(d) = 5d*2 - 16d - 21. Let o(v) = v*2 - 3v - 4. What is -2j(x) + 11o(x)? x2 - x - 2 Let x(a) = -a2 + a + 1. Let m(c) = -4c2 + 3c + 3. Let p = -15 - -22. Suppose -3r - 2 = p. Let l be r/2(2 - -2). What is lx(d) + 2m(d)? -2d2 Let n(g) = -6g*2 + 4. Let w be (-4)/(-3)3/2. Let m(v) = -3v2 + 2. Give wn(p) - 5m(p). 3p*2 - 2 Let z(j) = 17j + 1. Let c(y) = 35y + 2. Determine 3c(v) - 7z(v). -14v - 1 Let m(h) = h + 4. Let x(k) = 3. Let t(c) = 10. Let a(w) = 2t(w) - 7x(w). What is 6a(g) + m(g)? g - 2 Let g(s) = -4s*3 - 2s*2. Let r(f) = -3f*3 - 101f*2 + 16f*3 + 108f*2. Determine 21g(l) + 6r(l). -6l3 Let n be 8/6 + (-28)/12. Let i be (-24)/(-14) - (-2)/7. Let k(w) = 2 - i + 1. Let x(y) = y2 + 6. What is nx(b) + 5k(b)? -b2 - 1 Let o(v) = -v3. Let a(w) = 2w3 - 5w*2 + 2w. Calculate a(z) + 3o(z). -z3 - 5z*2 + 2z Let l(j) = 10j2 + 2j - 2. Let n(t) = -41t2 - 9t + 9. Give 9l(o) + 2n(o). 8o2 Let o(z) = -51z3 - 21. Let n(i) = i3 + 13i2 + 10i - 3. Let p be n(-12). Let q(x) = -5x3 - 2. What is pq(a) - 2o(a)? -3a*3 Let w(m) = -3m*2 + 2m + 4. Let r(a) = -4a2 + 3a + 5. Let c = -8 + 14. Let t be (-5)/2c/(-5). Determine tw(y) - 2r(y). -y2 + 2 Let t(o) = o3 - 4o*2 + 4o. Let n(i) = i*2 - i. Let u be ((-5)/(-2))/((-4)/(-8)). Let x = -1 + u. Calculate xn(p) + t(p). p*3 Let v(o) = -2o*2 + 3o - 4. Let c(j) = -2j2 + 3j - 5. Let a = 11 + -6. What is av(m) - 4c(m)? -2m2 + 3m Let a be ((-8)/(-12) - 0)(-99)/(-6). Let i(s) = 17s - 15. Let t(x) = 6x - 5. What is at(f) - 4i(f)? -2f + 5 Let i(j) = -6. Let h(d) = -d*3 - 31d2 + d + 14. Let b be h(-31). Let l(y) = y2 + 17. What is bi(u) - 6l(u)? -6u2 Let f(c) be the third derivative of 0c + 0 + c*2 + 1/6c3. Let y(q) = q2 + 1. Give 2f(i) - 2y(i). -2i2 Let x(z) = 2z*3 - 3z*2 - 2. Let q(u) = 5u*3 - 7u*2 - 4. Calculate 6q(j) - 13x(j). 4j*3 - 3j*2 + 2 Let u(t) = 3t2 - 1. Let v = 3 - 5. Let h(s) = s2. Let f(l) = vu(l) + 4h(l). Let d(k) = -2k2 - k + 3. Calculate 2d(y) - 3f(y). 2y*2 - 2y Let b be 14/7 - 1-1. Let z(h) = -11h*3 + 5h*2 - 5h - 5. Let s(q) = -6q3 + 3q*2 - 3q - 3. Determine bz(g) - 5s(g). -3g3 Let y(n) = -n - 1. Let p be y(-5). Suppose 2 = -5v - 3s, s + 2 + p = v. Let z(t) = -t - 4 + 3 + v. Let r(d) = -2d + 1. Calculate r(l) - z(l). -l Let n(r) be the first derivative of -r*4/2 + 3r*2/2 - 4r + 2. Let p(q) = -q + 4. Let g(b) = b - 3. Let i(s) = 3g(s) + 2p(s). Give -2i(f) + n(f). -2f3 + f - 2 Let k(p) be the third derivative of p4/24 - p3/6 - p2. Let a(b) = -b*3 - 6b*2 - 6b + 3. Let j be a(-4). Let t(m) = -2m + 3. What is jk(i) - 2t(i)? -i - 1 Let d(o) = 17o*3 + 11o + 11. Let q(w) = -6w3 - 4w - 4. Let k be (-3)/(-6) + 3/6. Suppose -n = -3g - 8, -n + 13 + k = 3g. Give nq(r) + 4d(r). 2r3 Let l(m) = 2 + 2 + 2m*3 - 3 - 3m + 3m2 + 2. Let c(i) = -i3 - 2i*2 + 2i - 2. Give -3c(b) - 2l(b). -b*3 Let t(q) = 3q*3 + 4q*2 - 4q. Let p be 8 + 17 - (1 + 0). Let o(n) = 7n2 - 18n*3 + 0n*2 - 7n + pn3. Determine -4o(b) + 7t(b). -3b**3 Let a be 14/(-8) - (-1)/	{ "pile_set_name": "DM Mathematics" }
order. -42, -16.6, -2/5, 1/2, 1257 Put 0.1, 24, -28394 in increasing order. -28394, 0.1, 24 Put -56/27, -43, -4, 0, -5 in decreasing order. 0, -56/27, -4, -5, -43 Sort -3, -162, -1, -5, 5, 8178. -162, -5, -3, -1, 5, 8178 Sort 2, -4, 5, 26, -2, -88, 1 in ascending order. -88, -4, -2, 1, 2, 5, 26 Sort -3, 1, 684, -1, 5, 4, -284. -284, -3, -1, 1, 4, 5, 684 Put -1/4, -0.1, -24, 2/19, -138.8 in ascending order. -138.8, -24, -1/4, -0.1, 2/19 Put 6, 1/5, 30, 0.3, 1/2, -0.57 in increasing order. -0.57, 1/5, 0.3, 1/2, 6, 30 Sort 19, 141, 743, -1, 5, 3, -4 in ascending order. -4, -1, 3, 5, 19, 141, 743 Put -0.2, -3/4, -883, 55.864 in ascending order. -883, -3/4, -0.2, 55.864 Put 5, 56/19, -2, -2/43, 1/12 in ascending order. -2, -2/43, 1/12, 56/19, 5 Sort 157, -3/5, -0.0446, -1/53 in decreasing order. 157, -1/53, -0.0446, -3/5 Sort -14, -156, 17468, -4 in descending order. 17468, -4, -14, -156 Sort 4, 23017887, -7 in decreasing order. 23017887, 4, -7 Put 5, -0.1, -4, 1, 1983, 3.3 in increasing order. -4, -0.1, 1, 3.3, 5, 1983 Sort -3418, 238, 0.04, 2/3, 1 in decreasing order. 238, 1, 2/3, 0.04, -3418 Put -112, -1, 187, 8 in increasing order. -112, -1, 8, 187 Sort 0, -17.1, 5, 8/7, 1.3, -1/4 in increasing order. -17.1, -1/4, 0, 8/7, 1.3, 5 Sort -0.3, 38, -1, 0.5, 856, 1 in decreasing order. 856, 38, 1, 0.5, -0.3, -1 Put -0.01, 1271, 12, 8, -1/5 in ascending order. -1/5, -0.01, 8, 12, 1271 Sort -3, -2441551, 5, 3. -2441551, -3, 3, 5 Sort 10, 1/2, 15, 10/21, 24, -1. -1, 10/21, 1/2, 10, 15, 24 Put -2/15, 127, -4472, -2 in descending order. 127, -2/15, -2, -4472 Sort -475, -1, 116967, 5. -475, -1, 5, 116967 Sort 75, -8, -37388, -2. -37388, -8, -2, 75 Put -66/5, -67/120, -2, 0.5 in descending order. 0.5, -67/120, -2, -66/5 Put 13, 2/7, -27, 0, -0.165 in increasing order. -27, -0.165, 0, 2/7, 13 Put 9, -5, 36, -1, 0.3, -2.996 in decreasing order. 36, 9, 0.3, -1, -2.996, -5 Sort -437, 0, -165, -4, 12 in increasing order. -437, -165, -4, 0, 12 Put 9, 21326, 0, 2, 4, -4 in decreasing order. 21326, 9, 4, 2, 0, -4 Sort -0.5, -2/5, 67570, -8. -8, -0.5, -2/5, 67570 Sort -25, 1, -2, 4, 17, 0, 145. -25, -2, 0, 1, 4, 17, 145 Sort 0, 83, 3, -259, -2, 2. -259, -2, 0, 2, 3, 83 Sort -1/2, 4, 1, -1, -2/7, 0.0412 in ascending order. -1, -1/2, -2/7, 0.0412, 1, 4 Sort -2, -3, -24, 53447 in increasing order. -24, -3, -2, 53447 Put 4, -1, 6, -5, -59, 230 in increasing order. -59, -5, -1, 4, 6, 230 Put -6, 5, 59864 in decreasing order. 59864, 5, -6 Sort -164, 6132, -3, 4, 13 in descending order. 6132, 13, 4, -3, -164 Sort 0.2, -0.3, -882, -76, 0.1, 1 in increasing order. -882, -76, -0.3, 0.1, 0.2, 1 Put -1/5, -4447510, 0.2, -0.4 in descending order. 0.2, -1/5, -0.4, -4447510 Sort 0.680375, 0.09, 2 in decreasing order. 2, 0.680375, 0.09 Sort 23, -96, 1, 3, -3, 4. -96, -3, 1, 3, 4, 23 Sort -33756, -66, 66 in descending order. 66, -66, -33756 Put 1, -29, 0, -1, 4860, -10 in decreasing order. 4860, 1, 0, -1, -10, -29 Put -3, -0.119223, -9/4 in decreasing order. -0.119223, -9/4, -3 Sort -3, 1, -242867 in descending order. 1, -3, -242867 Sort 763, -36, 11. -36, 11, 763 Put -63.55093, 1/8, 3 in descending order. 3, 1/8, -63.55093 Sort -25.7, 1235, -89 in descending order. 1235, -25.7, -89 Sort -4, 2, 8560 in decreasing order. 8560, 2, -4 Sort -67, -4, 40008 in ascending order. -67, -4, 40008 Put 10417, 5, 0, -32 in increasing order. -32, 0, 5, 10417 Put -4/123, 0.2, 14/15, -4, -0.3 in decreasing order. 14/15, 0.2, -4/123, -0.3, -4 Sort 4, -1/450, 0, -4, 238, 8 in increasing order. -4, -1/450, 0, 4, 8, 238 Sort -2, 6047, 3, -4, 17, 2, -3. -4, -3, -2, 2, 3, 17, 6047 Sort -11, -29, -90, 193. -90, -29, -11, 193 Put -0.2, -3, 13759510 in decreasing order. 13759510, -0.2, -3 Sort 15, 0, 1, -38, 810, 18 in descending order. 810, 18, 15, 1, 0, -38 Sort 1, 0, -18415, -1 in descending order. 1, 0, -1, -18415 Sort 4, -2, -40942496. -40942496, -2, 4 Sort 0.3, -4, -0.27, 0.2, -26757 in ascending order. -26757, -4, -0.27, 0.2, 0.3 Put -509733, -70, 3, -2/5 in increasing order. -509733, -70, -2/5, 3 Put 5, 2, 34, -12, -3, 7 in increasing order. -12, -3, 2, 5, 7, 34 Put -2743, 332/5, -1/7, 0.3 in increasing order. -2743, -1/7, 0.3, 332/5 Sort -2746/23, -6, -34. -2746/23, -34, -6 Sort 56912, -7, -642 in descending order. 56912, -7, -642 Sort 2, -13, 4, -8, 1, -3, 0 in descending order. 4, 2, 1, 0, -3, -8, -13 Sort 2/307835, 1, -24, -13 in decreasing order. 1, 2/307835, -13, -24 Sort -6, 3, 21, 6, 1, -7, 0. -7, -6, 0, 1, 3, 6, 21 Sort 941, 0, 4, -305, 1, -3. -305, -3, 0, 1, 4, 941 Sort 334701, 5, 193 in increasing order. 5, 193, 334701 Sort 0.5, -5, -92, 3/8, 3, 7.33. -92, -5, 3/8, 0.5, 3, 7.33 Put -35, 1/3, -14384, 3 in increasing order. -14384, -35, 1/3, 3 Sort -2, -14, 4, -5, 1478, -22. -22, -14, -5, -2, 4, 1478 Put 5759, -1, 9337 in decreasing order. 9337, 5759, -1 Put -0.349, -41, 1, -11 in ascending order. -41, -11, -0.349, 1 Sort -3, 3, 4, 50733, 0. -3, 0, 3, 4, 50733 Sort 3, 140, -2/17, 0.4, 4, 3500 in increasing order. -2/17, 0.4, 3, 4, 140, 3500 Sort -553385124, 2/5, 5. -553385124, 2/5, 5 Sort -493, -62, 1, -3, -5, 0, -4 in decreasing order. 1, 0, -3, -4, -5, -62, -493 Sort 2/5, 431.61, -3.1, 3/7 in increasing order. -3.1, 2/5, 3/7, 431.61 Sort 5, -21/304, 3/8, -1/5 in decreasing order. 5, 3/8, -21/304, -1/5 Put 1, 4, -131, -6, -253, 2 in decreasing order. 4, 2, 1, -6, -131, -253 Put 1/5, -4, 0.01, -637, 10 in descending order. 10, 1/5, 0.01, -4, -637 Sort 0, 23068, 1807, -2. -2, 0, 1807, 23068 Sort -5, 19.9, -37, -22. -37, -22, -5, 19.9 Sort 1433, 27936, 0. 0, 1433, 27936 Put 744, -4, 1, -451 in decreasing order. 744, 1, -4, -451 Put 3, -6614, 1, 0.4, -3/19 in descending order. 3, 1, 0.4, -3/19, -6614 Put 1, 4, -74, -8, -77 in descending order. 4, 1, -8, -74, -77 Put -715079, 1/3, 0.5 in descending order. 0.5, 1/3, -715079 Sort 31/34, 2, -117/2 in decreasing order. 2, 31/34, -117/2 Put 3, 105, -37, -210, 2 in ascending order. -210, -37, 2, 3, 105 Sort -21/2, -0.2406, 56 in ascending order. -21/2, -0.2406, 56 Sort 98078, 3, 2, -20 in ascending order. -20, 2, 3, 98078 Put -3, 1884, -8, -4, -27 in increasing order. -27, -8, -4, -3, 1884 Put 3, 42064, -5, -2, -11 in ascending order. -11, -5, -2, 3, 42064 Put -3, -21231, -2.739 in descending order. -2.739, -3, -21231 Sort 4, -2270643, 1. -2270643, 1, 4 Put -15, 1, 2, 167, -67, 8 in descending order. 167, 8, 2, 1, -15, -67 Sort -3, -327, -5, 2, 8, 3, -2 in increasing order. -327, -5, -3, -2, 2, 3, 8 Put 30803, 4, 1512 in decreasing order. 30803, 1512, 4 Put -0.03, 2/9, -194/3175, 4 in ascending order. -194/3175, -0.03, 2/9, 4 Put -4, 0, 4, 2, -23, -239, 1 in ascending order. -239, -23, -4, 0, 1, 2, 4 Sort 0.4, -5, 3, -7146, 2/97 in descending order. 3, 0.4, 2/97, -5, -7146 Sort -21/593, -145, -7 in descending order. -21/593, -7, -145 Sort -4, -41, -0.3, 0.1, 645, 2/5 in descending order. 645, 2/5, 0.1, -0.3, -4, -41 Put -361, -0.2, 34.5 in decreasing order. 34.5, -0.2, -361 Put 0.00465, -4, -38 in increasing order. -38, -4, 0.00465 Sort -8077.5, -2, -387 in descending order. -2, -387, -8077.5 Sort -8, 8, 0, 3, 13, -2, 128. -8, -2, 0, 3, 8, 13, 128 Sort 429, 9, 2, 2946. 2, 9, 429, 2946 Sort 9, -5, -27, 1658 in decreasing order. 1658, 9, -5, -27 Sort -3, 2, 5793, 13 in decreasing order. 5793, 13, 2, -3 Put -1, -30991, -4, -3, -2 in increasing order. -30991, -4, -3, -2, -1 Sort -3, 0.7, -21, -3488 in ascending order. -3488, -21, -3, 0.7 Put 4, -4, -293947, 0, -214 in increasing order. -293947, -214, -4, 0, 4 Sort 0, -392, -22, 6. -392, -22, 0, 6 Put -6237, 2, 4, -1111, -3 in increasing order. -6237, -1111, -3, 2, 4 Sort 2/67, 2, 43, 293, 30. 2/67, 2, 30, 43, 293 Sort 1243, 3, 4, 1, 0, -100 in increasing order. -100, 0, 1, 3, 4, 1243 Put 0, -158, 406995 in ascending order. -158, 0, 406995 Put -9, -19, 2, 1, 4, 3, -14 in ascending order. -19, -14, -9, 1, 2, 3, 4 Sort -62, -9, 2/7, 88, -0.008 in descending order. 88, 2/7, -0.008, -9, -62 Sort 2, -6, 199010, -2 in increasing order. -6, -2, 2, 199010 Put -4.3, 12, 1.1999 in descending order. 12, 1.1999, -4.3 Sort -1845.7, -0.25, 0.1, 0.5, 5. -1845.7, -0.25, 0.1, 0.5, 5 Put -1466, 0.4, 1/4, -0.34, 1 in descending order. 1, 0.4, 1/4, -0.34, -1466 Sort 6399, 0.73, 70. 0.73, 70, 6399 Sort -2, 16/25, 4, -3,	{ "pile_set_name": "DM Mathematics" }
7.24612821 and 36. 25563.24612821 What is 0.138834 + 1154209.35? 1154209.488834 Sum 0.0044496 and -0.0468701382. -0.0424205382 Subtract -0.727 from -1740072499. -1740072498.273 What is -0.4 plus 161598486317? 161598486316.6 -16817557332+8.34 -16817557323.66 Work out -616 - -25640732150. 25640731534 What is the difference between 4927867910 and -0.495? 4927867910.495 -0.1059+-126555439.334 -126555439.4399 -1927293236037 + -9 -1927293236046 Put together -40875813 and -36824. -40912637 Add together 112 and 3832097.63589. 3832209.63589 Calculate -7499333627 + 10.4. -7499333616.6 What is -766849502 less than -8642? 766840860 1124.1+-47282101429 -47282100304.9 -1389261.64+302462 -1086799.64 What is -47.6 + -1295236331? -1295236378.6 What is -0.21209 minus 17924945? -17924945.21209 What is the distance between 27623 and -1214.42076? 28837.42076 -1776894 - 1172928.68 -2949822.68 Work out -27.3149954 - 19094.9. -19122.2149954 -32.8681 - 2042677 -2042709.8681 What is the difference between 123.15 and -50116374? 50116497.15 What is the distance between -148.2458 and -1657086.4? 1656938.1542 Total of 3 and 108749516204142. 108749516204145 What is the distance between -8961989238 and 2386? 8961991624 What is -8 - 1171241323341? -1171241323349 What is -0.009 - 181955.631315? -181955.640315 Put together -2.61 and 8320653805. 8320653802.39 What is the difference between -8651171 and 32334? 8683505 Sum 17 and 16230037999901. 16230037999918 Total of -16012138 and 12.931. -16012125.069 What is -1642367 minus -53225? -1589142 What is -338839316 plus -10326.39? -338849642.39 Sum 4 and 4.02530826298. 8.02530826298 What is 300682 plus -792350074? -792049392 27.672 - 2251420.88 -2251393.208 Total of -5.6307 and 3.39157321. -2.23912679 Subtract -3783106 from 0.8936. 3783106.8936 Work out 14.932239140434 + -1. 13.932239140434 -0.01 - 222287034350.95 -222287034350.96 What is the distance between 42137.21193 and 0.1463? 42137.06563 What is 1171643 take away 0.1644439? 1171642.8355561 Calculate -7 + -0.006314630376772. -7.006314630376772 Calculate -80308 - 274690724. -274771032 What is 304 minus -11652092970? 11652093274 Add together -8195.54365 and 3.78. -8191.76365 What is the difference between -19 and 384548607.4? 384548626.4 What is the distance between 31117807488561 and -1? 31117807488562 Work out 8986083 + -0.203331. 8986082.796669 Work out 61 + -40386591928.56. -40386591867.56 Sum -17.17325 and 607107. 607089.82675 What is 464518920 - 32272? 464486648 What is the difference between 1106723.9193 and 1? 1106722.9193 What is 0.6280271 take away -31913? 31913.6280271 Sum 20.171750584 and -2008. -1987.828249416 What is the distance between -0.276506359 and 143388? 143388.276506359 Work out 10533701.23 + -102.7. 10533598.53 13.180568026 - 68 -54.819431974 Add -18.467348 and -0.17421. -18.641558 5394.973 - -0.397997 5395.370997 0 - -520.92716641 520.92716641 59589.432+1154468 1214057.432 Add together 88 and -165527865. -165527777 What is -8687924.409 less than -29422? 8658502.409 What is -0.11 minus -0.5641037549? 0.4541037549 Calculate 34109.474 - -1690016.4. 1724125.874 Total of 164068.6 and 25.81. 164094.41 Add -212 and -5359686188. -5359686400 Subtract -1737.2622474882 from 3.1. 1740.3622474882 Work out -5292420.33 - -3. -5292417.33 Add -7601 and -26359.59. -33960.59 What is -1706854117153 - 5? -1706854117158 What is -1178685573 take away 82481? -1178768054 Work out 20136136858 - 0.3. 20136136857.7 Work out 121785676 + 18343. 121804019 Add together -132847255 and -20.79512. -132847275.79512 Total of -307528640 and 0.096. -307528639.904 What is 436383613925 + -450? 436383613475 What is the distance between -4 and -361619022529? 361619022525 Subtract 1056863677 from -8.304. -1056863685.304 Put together 2934 and -5.817113. 2928.182887 0.1 + 5.3318229391 5.4318229391 What is the difference between -428292.693 and -0.35? 428292.343 Sum -0.31883679 and 55439. 55438.68116321 Add together -6373224 and 152626. -6220598 What is the difference between 0.5 and 4877666080.19? 4877666079.69 What is -1055447115 minus 499.741? -1055447614.741 0.242848521475 - 5 -4.757151478525 What is the difference between 0.36574670501399 and 0.3? 0.06574670501399 Total of 21916 and 259987.758. 281903.758 Subtract -8.19 from -73749334. -73749325.81 Sum 3777187.461 and -0.7. 3777186.761 What is -953487615 - 0.52284? -953487615.52284 Subtract -0.5 from -139043258453366. -139043258453365.5 Add 56 and 13256413133559. 13256413133615 Total of 1.9440656 and -29836. -29834.0559344 Work out 1.2 + -93270262.978423. -93270261.778423 Total of 5602 and -29195.7. -23593.7 What is -356941 + -74079.9648? -431020.9648 What is 0.06 take away 7331111756? -7331111755.94 What is -29509809344 - 9? -29509809353 Put together -6.1068 and -60893352.8. -60893358.9068 Total of -17830362 and 331.9022. -17830030.0978 Work out 58943.226597 - 2.3. 58940.926597 What is 0.4 minus -21407.254897? 21407.654897 What is -595921769.68 + -0.72? -595921770.4 Put together -12 and -97929742344. -97929742356 Calculate -5082.1507 + -52.8. -5134.9507 Calculate 18487589180442 - 1. 18487589180441 379123 - 9801838 -9422715 Calculate 0.76252259797 - 0.03. 0.73252259797 What is 14.6530665 plus 0.1469? 14.7999665 Put together 13678412140 and 0.8. 13678412140.8 Total of 17364 and -6068665. -6051301 What is -27730158089 - -1.44? -27730158087.56 What is -46 take away 0.08220114843? -46.08220114843 What is 729 minus -676146858457? 676146859186 Add together 41 and -5566898.98543. -5566857.98543 What is -9031788331790 take away -42? -9031788331748 Work out 60.1661 - -3.0791595. 63.2452595 What is -231505 less than -5.752479? 231499.247521 Calculate 1.63 + -3954963614. -3954963612.37 What is 28418786344.8155 minus -5? 28418786349.8155 What is the difference between 0.09922188 and -1685? 1685.09922188 Sum -10 and 2940091614.5. 2940091604.5 Add -200544008571 and -4. -200544008575 Add 24.44253 and 1100134. 1100158.44253 Add together -130931360546 and -0.4. -130931360546.4 34.1+-526.102781 -492.002781 -1784959+-1685155 -3470114 What is 0.16456784 minus 0.951? -0.78643216 Subtract -1293940056528 from -0.2. 1293940056527.8 Work out 11628669350636 - 50. 11628669350586 What is -0.1 - 1457319.66318? -1457319.76318 What is -236191918 - 1693? -236193611 Put together -4910788 and 1.3709628. -4910786.6290372 What is 252896421.9747 plus -18? 252896403.9747 Calculate -922007819518 - 3. -922007819521 -5859 - -16275.27059 10416.27059 Total of 11.251099 and 37102. 37113.251099 Calculate -196711676422 - -16. -196711676406 Calculate -18.64 + 1219428.36. 1219409.72 -16267553 - -9795.7 -16257757.3 452676370 + 13994 452690364 Put together -648 and 660.0985383. 12.0985383 -880.74572615+-0.708 -881.45372615 Sum 1087502055413 and -0.12. 1087502055412.88 What is the distance between 2499 and -15.664546? 2514.664546 Calculate -264485349729 + 0.5. -264485349728.5 -575 + 153.271751 -421.728249 Calculate -128.273 + -1.107289078. -129.380289078 Put together 2519 and -0.0627949652. 2518.9372050348 -0.05 + 16.747463075 16.697463075 What is 88417170500 take away 0.119? 88417170499.881 Subtract 17950.084294 from 0.81. -17949.274294 Sum -12 and -730.41820177. -742.41820177 What is -3.517358 less than 1642.51? 1646.027358 Add together -5 and -85761220034216. -85761220034221 What is -219603377827736 - 1? -219603377827737 Work out -0.1 + 144943957627. 144943957626.9 What is -0.5 less than 18424615700070? 18424615700070.5 What is -0.4 take away 0.0707832516102? -0.4707832516102 What is 46283774391 + -2? 46283774389 Work out 7 + -5994921264.8. -5994921257.8 Work out -0.8949 - 5754659173. -5754659173.8949 Calculate 86146216 + 909. 86147125 Add 1 and 1975548082965. 1975548082966 What is -128.0260126 plus -1.82? -129.8460126 Put together 45100 and -1237361. -1192261 Calculate 59173140098 + -5. 59173140093 -7.172+1228.78541 1221.61341 What is the difference between -0.02812 and 4078654033? 4078654033.02812 -4633.766 + -1.6726283 -4635.4386283 Calculate 236081.32149 - -317.1. 236398.42149 What is -0.001 - 78007651.8665? -78007651.8675 What is 12.81412494 + -0.0697? 12.74442494 What is 34934 plus 268763.062? 303697.062 What is -47635.37358665 less than 0.4? 47635.77358665 Work out -40767 - -438.56	{ "pile_set_name": "DM Mathematics" }
st value? (a) 0.8 (b) 5 (c) -2/1067 (d) -31 a Which is the fifth smallest value? (a) 3/8 (b) 2 (c) -0.3 (d) -27.91 (e) -2 b Which is the fifth smallest value? (a) 1/2 (b) -0.07 (c) -2 (d) -1 (e) -69.92 a What is the biggest value in -2/5, 7, -7, 64, -7/5? 64 What is the third smallest value in 3/7, 0.2, 3, -138, -0.3? 0.2 Which is the biggest value? (a) -1/4 (b) -5/6 (c) 50.1 (d) 0.004 c Which is the fourth biggest value? (a) -3/2 (b) 0 (c) 79 (d) 0.2 (e) 3/2 b What is the second smallest value in -1.9, 8, -172? -1.9 What is the third smallest value in 8, -16, 1, -19, -1? -1 What is the sixth smallest value in 67, -0.4, -2/11, -68, 2, 0.5? 67 What is the fourth biggest value in 3, -0.73, -3, 1/186? -3 Which is the fifth smallest value? (a) -4 (b) 4/17 (c) 0.4 (d) -0.07 (e) -0.112 c What is the second biggest value in 2/5, 2265419, -3? 2/5 Which is the third smallest value? (a) -25 (b) 4 (c) -0.2238 b What is the smallest value in -34, -0.4, -299? -299 What is the third biggest value in 675, -1, -3, 0.3? -1 What is the fourth smallest value in 1/10, -2/3, -1/5, 3528, -1, -1/2? -1/5 What is the smallest value in 0.4, 1/6, -3, -2, 58? -3 Which is the biggest value? (a) 4/9 (b) 237/7 (c) -5/4 b Which is the third biggest value? (a) -2/7 (b) -3 (c) -28/205 b Which is the fifth smallest value? (a) -3 (b) 0.082 (c) -0.5 (d) -71 (e) 2 e Which is the third biggest value? (a) -4 (b) 1/273 (c) -1/2 (d) -27 a What is the biggest value in -4/11, -65.3, -4? -4/11 What is the third smallest value in 0.3, -10.2, -2/9, 0.5, 3/5? 0.3 What is the biggest value in 275, 4, -0.3, -1/29? 275 Which is the fourth biggest value? (a) 4 (b) 11 (c) 14/137 (d) -5 d Which is the third smallest value? (a) 0 (b) -3/7 (c) -11/3 (d) 5/1804 (e) -5 (f) -2 f Which is the second biggest value? (a) -18 (b) 2 (c) 18 (d) 1/3 b Which is the biggest value? (a) 0.1 (b) -6/13 (c) -4 (d) -1/9 (e) 2 e What is the biggest value in 4, 115/6, 0.06, 3, -10.6? 115/6 Which is the third smallest value? (a) 1/5 (b) 26/9 (c) 16 (d) 0 (e) -0.5 (f) -2/7 d What is the smallest value in 48.3, -3, 0, 5, 1/3, 4? -3 What is the fifth biggest value in -0.3, -2/3, 0.3, -1, 3/224, 2/9? -2/3 Which is the fifth biggest value? (a) -0.5 (b) -5 (c) 3 (d) 1849 (e) -4/5 b What is the third smallest value in 1/14, -902, -0.19, -0.4? -0.19 What is the third biggest value in 0.6, -5, 60406, -3/4? -3/4 What is the second biggest value in -296, 1/6, -3/109? -3/109 What is the second biggest value in -0.3, 1/5, -6.86, 2/11? 2/11 What is the fourth biggest value in -2/7, -7, 7/3, -0.4, 0.5, 25? -2/7 Which is the smallest value? (a) 0.4 (b) -6/5 (c) 19.5 (d) -1 b Which is the third smallest value? (a) 4/49 (b) -3 (c) -0.5 (d) 183 a What is the second smallest value in 0.8, 3, -5157? 0.8 What is the third biggest value in -1, -0.4, 0.02284, 0.7? -0.4 Which is the third smallest value? (a) -3.981 (b) 1/4 (c) -8/9 b What is the second smallest value in -62/9, 3/4, 72.2? 3/4 What is the second smallest value in -2.3, 1/2, 0, -40, 1/7, -2/13? -2.3 What is the second smallest value in -8, 0.5, 0.605, 2.8? 0.5 What is the fourth smallest value in 0.4, -67, -174, 0.1? 0.4 Which is the biggest value? (a) -16/11 (b) 4 (c) 2/5 (d) 0 (e) 2 b What is the third smallest value in -930, 5/6, 4? 4 What is the third biggest value in -6, 4, 54, 2.3? 2.3 What is the smallest value in 2/13, -4, -961167? -961167 What is the fifth biggest value in 0, -5, 1, -1/96, -3? -5 Which is the smallest value? (a) -4 (b) 445.269 (c) -3 a Which is the third biggest value? (a) 26 (b) 148 (c) 0 c Which is the smallest value? (a) 2/9 (b) -5.2 (c) -1668 c Which is the biggest value? (a) 5 (b) -194 (c) 64/19 a What is the third biggest value in 0.3, 5, 25559? 0.3 Which is the second biggest value? (a) 1 (b) 0.1 (c) -4.018 b What is the second biggest value in 41, 55/2, 3, 2, -1? 55/2 Which is the fourth smallest value? (a) -0.1 (b) -87 (c) -18 (d) 0.5 (e) 3 d What is the third biggest value in 0.1988, -0.2, 3/11? -0.2 What is the biggest value in -1/4, 0.11, 9/5, -5, 9? 9 What is the third biggest value in -1.557, -5, 0, -0.2? -1.557 What is the third smallest value in -0.4, 2, -4, -0.5, -312.4, 0.2? -0.5 What is the second smallest value in 4, 8, 3, -0.06? 3 What is the fourth smallest value in 0.1, -4, -2/115, -2/65, -4/5? -2/115 What is the smallest value in 2/3, 1/7278, 1? 1/7278 What is the smallest value in 0.18, -7, 2/13, 0.1, 2, -128? -128 Which is the fourth smallest value? (a) -1 (b) 11487 (c) 3 (d) -17 (e) 5 e Which is the third biggest value? (a) -2 (b) 2/5 (c) -0.021 (d) -10 a Which is the second biggest value? (a) -0.07 (b) -0.0005 (c) 8 (d) -5 b What is the fourth biggest value in 12, 5, -0.4, 60? -0.4 Which is the biggest value? (a) 30 (b) -0.4 (c) 1/124 a Which is the third biggest value? (a) -4 (b) 0.1 (c) 12271 (d) -2 d Which is the fifth smallest value? (a) 3/2 (b) -2 (c) 1/10 (d) -0.9 (e) -0.8 a What is the second smallest value in 4/15, 4, -3/13, 6? 4/15 Which is the third smallest value? (a) -271 (b) -0.07 (c) 8 c What is the biggest value in -18, 57, -2, -50? 57 Which is the second smallest value? (a) 0.31 (b) 6 (c) 19/7 c Which is the second biggest value? (a) 0.01 (b) -927.5 (c) 0 c What is the biggest value in 4, -26, -0.15, -0.5? 4 What is the second biggest value in 0.1, 1/19, -2, -3, -0.01, -17? 1/19 Which is the second smallest value? (a) -192 (b) -1238 (c) -4 a What is the smallest value in 0.3, -11, 5, 897? -11 What is the second smallest value in 1/2, -3, 473320? 1/2 Which is the smallest value? (a) 4/7 (b) -6055 (c) 2 b Which is the fourth biggest value? (a) -5 (b) -15 (c) -3 (d) -8569 (e) -3/5 b What is the fourth smallest value in 4, 0.5, 0, 58, 37/3, -1? 4 What is the biggest value in 0.1, 7/2, 2, -0.0686? 7/2 What is the fourth smallest value in -0.5, 4, -2, -891, -33, 0.3? -0.5 Which is the biggest value? (a) 13 (b) -5.1 (c) -36 (d) -2 (e) 2 a Which is the third smallest value? (a) 7.1 (b) 1 (c) 11 (d) 4 (e) 2 (f) 20 d What is the third biggest value in -3, -10/11, -0.8, -0.4, 7/78? -0.8 Which is the third biggest value? (a) 436 (b) 36 (c) 1 c What is the third biggest value in -2/9, 1/3, 90, 2/7? 2/7 What is the biggest value in -14/5, -0.02, 0.03, 3/4, -0.3, -5? 3/4 What is the biggest value in -23, -6, -3.2, -0.3, -2/11? -2/11 What is the biggest value in 5, -4, 8, 12, 4/5, 47? 47 What is the second biggest value in -0.1, -1.4, 7, -1, 43, 0.1? 7 What is the biggest value in -37.9, -11/7, 5, -5, 0.4? 5 What is the third smallest value in 117, -2/3, 1/4, 167? 117 Which is the smallest value? (a) 5 (b) 7/5 (c) -6 (d) -4 (e) -16 e Which is the third smallest value? (a) -2592 (b) 0.2 (c) 3/7 c Which is the fifth biggest value? (a) 0 (b) 8/9 (c) -2 (d) -4 (e) -13/4 d What is the third biggest value in 0.3, -1/9, -5, 1, 0.1? 0.1 Which is the smallest value? (a) 42/11 (b) -6 (c) 21 (d) 1 (e) -1/4 b Which is the fourth smallest value? (a) 0.8 (b) 1290 (c) 0.1 (d) -1/4 (e) 2/3 a What is the second biggest value in -4, -115, -1, -1/457, 2? -1/457 What is the fourth biggest value in -1/4, 0.3, 0, -132, 4? -1/4 What is the smallest value in 2232, -3, 385? -3 What is the third smallest value in -3/8, -1/2, 2/15, -2/25, 68? -2/25 Which is the third biggest value? (a) 7 (b) 0.37 (c) -2/175 (d) 5 b What is the fourth biggest value in 2/13, -4, -44, -7? -44 Which is the biggest value? (a) 5 (b) -187/9841 (c) -5 (d) -2 a Which is the second biggest value? (a) -69/19 (b) -3/5 (c) -0.2 b What is the smallest value in -6, 3, -1, 5, 2.32? -6 Which is the smallest value? (a) 0.3 (b) 0.1 (c) 0.5 (d) -0.085 d What is the smallest value in -1, -18915, 0.3, 1/4, -0.2? -18915 Which is the third smallest value? (a) 2/477 (b) 1.2 (c) 1/2 (d) 0.2 (e) 0.1 (f) 3 d Which is the third smallest value? (a) -24021 (b) -6.3 (c) 5/4 c Which is the fifth biggest value? (a) -0.19 (b) 4/15 (c) 0.2 (d) 1/9 (e) -2/5 e What is the smallest value in 831, 10, -2/7, -0.3, 1, 1/5? -0.3 What is the fourth smallest value in -0.3, -10844, -0.2, -2/11	{ "pile_set_name": "DM Mathematics" }
-41, 6, 79, 184, 327? 514 What is the next term in 90, 133, 186, 243, 298, 345, 378? 391 What comes next: -141, -159, -179, -195, -201, -191, -159? -99 What is the next term in -240, -485, -730, -975? -1220 What comes next: -1201, -1199, -1197, -1195, -1193? -1191 What comes next: 4, -18, -58, -122, -216, -346? -518 What comes next: -276, -280, -276, -258, -220, -156, -60? 74 What is the next term in -2638, -5284, -7940, -10612, -13306? -16028 What is the next term in -761, -1525, -2299, -3089, -3901, -4741? -5615 What is next in 116, 243, 382, 539, 720, 931? 1178 What is the next term in -20, -57, -116, -197, -300, -425, -572? -741 What is next in -49, -113, -157, -169, -137? -49 What is next in -23, -78, -169, -296, -459, -658, -893? -1164 What is next in 25, 34, 23, -8? -59 What is next in 950, 1877, 2792, 3689, 4562? 5405 What is the next term in 146, 145, 150, 167, 202, 261, 350, 475? 642 What comes next: 114, 386, 832, 1446, 2222, 3154, 4236? 5462 What is the next term in -23, -44, -85, -152, -251, -388, -569? -800 What comes next: 314, 326, 352, 398, 470, 574? 716 What is next in -259, -545, -831, -1117, -1403, -1689? -1975 What is the next term in 6, 17, 28? 39 What comes next: 17, 29, 45, 65, 89, 117? 149 What comes next: 3569, 7137, 10705, 14273, 17841? 21409 What is next in -237, -476, -715, -954? -1193 What comes next: 366, 378, 398, 426, 462, 506? 558 What is the next term in 994, 1989, 2984? 3979 What is next in 45, 46, 59, 90, 145, 230, 351, 514? 725 What is the next term in 30, 9, -12, -33, -54, -75? -96 What is next in 26, 31, 38, 47? 58 What is the next term in 15, 18, 7, -24, -81? -170 What is the next term in 17, 40, 63? 86 What is next in 95, 372, 835, 1484, 2319, 3340, 4547? 5940 What comes next: -78, -123, -152, -159, -138, -83, 12? 153 What comes next: 238, 237, 236, 235, 234? 233 What is the next term in -357, -713, -1069? -1425 What comes next: 445, 892, 1337, 1780? 2221 What is next in 20, 33, 46, 59, 72? 85 What is the next term in -384, -769, -1154, -1539, -1924, -2309? -2694 What is next in 68, 127, 198, 287, 400, 543, 722, 943? 1212 What is next in 106, 88, 58, 16, -38, -104? -182 What comes next: 15, 21, 27, 33, 39? 45 What is the next term in 704, 706, 708, 710, 712, 714? 716 What is the next term in -31, -61, -91, -121, -151? -181 What is next in 173, 287, 401, 515, 629? 743 What is the next term in -50, -202, -452, -800? -1246 What is next in -18, -88, -210, -384, -610, -888, -1218? -1600 What is the next term in 217, 223, 217, 193, 145, 67? -47 What comes next: 52, 93, 112, 97, 36, -83, -272, -543? -908 What is the next term in -1, 18, 53, 104, 171, 254, 353? 468 What is next in 309, 297, 269, 219, 141? 29 What comes next: 69, 585, 1999, 4761, 9321, 16129, 25635? 38289 What is next in 38, 27, -6, -73, -186, -357? -598 What comes next: -47, -95, -143? -191 What is the next term in -7, -4, -3, -4? -7 What is next in 12847, 12845, 12843, 12841? 12839 What is the next term in -25, -32, -39, -46, -53, -60? -67 What is the next term in -6, -19, -32, -45, -58? -71 What is the next term in -715, -1443, -2171, -2899, -3627, -4355? -5083 What is next in 116, 233, 346, 455, 560? 661 What is the next term in 1, -11, -35, -77, -143, -239? -371 What comes next: -75, -152, -233, -318, -407, -500? -597 What comes next: 133, 136, 133, 118, 85, 28, -59, -182? -347 What is next in 12, 4, -2, -6? -8 What is the next term in 192, 382, 572? 762 What is next in 0, -75, -284, -693, -1368, -2375, -3780? -5649 What is the next term in -123, -122, -121, -120? -119 What is next in -592, -590, -588, -586? -584 What comes next: -15, -35, -67, -111, -167, -235? -315 What is the next term in 38, 47, 22, -43, -154? -317 What is the next term in 25, 45, 65? 85 What is next in 289, 275, 237, 163, 41, -141, -395? -733 What comes next: 1195, 2389, 3583, 4777, 5971, 7165? 8359 What comes next: -5, 1, 19, 49, 91? 145 What is the next term in 14, 136, 462, 1094, 2134, 3684, 5846? 8722 What is the next term in -21, 40, 101, 162, 223? 284 What comes next: -48, -49, -50, -51, -52? -53 What is next in -244, -257, -286, -337, -416? -529 What comes next: -4, -29, -74, -145, -248? -389 What comes next: -116, -235, -354, -473? -592 What is next in -45, -92, -129, -156, -173, -180, -177? -164 What is the next term in -25, -45, -57, -55, -33, 15, 95, 213? 375 What is next in 70, 140, 210, 280? 350 What is next in -120, -115, -110, -105? -100 What comes next: -68, -132, -196, -260, -324, -388? -452 What comes next: 215, 203, 177, 131, 59, -45, -187, -373? -609 What is the next term in 28, 56, 122, 244, 440, 728, 1126, 1652? 2324 What is next in 4, -10, -34, -68, -112, -166, -230? -304 What comes next: -5, -41, -101, -185, -293, -425, -581? -761 What is the next term in -86, -158, -232, -308, -386? -466 What is next in 30, 38, 60, 102, 170, 270? 408 What is next in 185, 160, 135, 110, 85, 60? 35 What is the next term in -113, -212, -301, -374, -425, -448, -437? -386 What is next in -142, -170, -220, -298, -410, -562, -760? -1010 What comes next: -20891, -41784, -62677, -83570, -104463? -125356 What is next in 2135, 2137, 2139, 2141, 2143? 2145 What is the next term in 179, 192, 205, 218? 231 What comes next: -3, 4, 39, 120, 265, 492, 819, 1264? 1845 What is next in -5103, -5100, -5095, -5088, -5079, -5068? -5055 What comes next: -82, -166, -254, -346? -442 What is the next term in -595, -603, -617, -637, -663, -695, -733? -777 What is next in 41, 85, 127, 167, 205, 241, 275? 307 What is next in -96, -447, -1050, -1911, -3036, -4431, -6102? -8055 What is next in -1888, -1896, -1904, -1912? -1920 What comes next: -35, -49, -41, -5, 65, 175, 331, 539? 805 What is next in 26, -16, -84, -178, -298, -444? -616 What is the next term in 8, 26, 52, 86, 128, 178, 236? 302 What is the next term in -197, -199, -201, -203, -205? -207 What is the next term in 1210, 4856, 10934, 19444, 30386? 43760 What is the next term in 8, -18, -46, -70, -84, -82, -58, -6? 80 What is the next term in 9, 70, 237, 564, 1105, 1914, 3045, 4552? 6489 What is next in -14, -15, -18, -23, -30, -39, -50? -63 What comes next: 25, 26, 29, 34, 41? 50 What is next in -978, -1954, -2930, -3906? -4882 What is the next term in -9, -10, -9, -6, -1, 6, 15? 26 What is the next term in -163, -323, -485, -649, -815, -983, -1153? -1325 What comes next: 143, 288, 431, 572, 711? 848 What is the next term in -50, -31, 2, 49, 110? 185 What is the next term in 147, 143, 137, 129, 119? 107 What is next in -5, -13, -21, -29, -37, -45? -53 What is the next term in -20, -60, -108, -158, -204, -240, -260, -258? -228 What is the next term in -9, -56, -131, -246, -413, -644, -951, -1346? -1841 What is the next term in 67, 66, 65, 64, 63, 62? 61 What comes next: 187, 189, 191, 193, 195, 197? 199 What is next in 0, -9, -22, -39? -60 What comes next: 225, 223, 221, 219? 217 What is the next term in -50, -79, -164, -335, -622, -1055, -1664? -2479 What comes next: 83, 103, 161, 275, 463, 743? 1133 What is next in -2063, -2060, -2049, -2024, -1979? -1908 What is the next term in -59, -232, -521, -926, -1447, -2084? -2837 What is next in 15, 103, 249, 459, 739? 1095 What is next in -94, -331, -702, -1189, -1774, -2439? -3166 What comes next: -148, -299, -450, -601, -752, -903? -1054 What is the next term in -39, -36, -33, -30, -27? -24 What is the next term in 53, 107, 161, 215? 269 What comes next: 23, 26, 31, 38? 47 What comes next: 12, -8, -54, -138, -272, -468, -738, -1094? -1548 What is next in -35, -33, -35, -41, -51, -65? -83 What comes next: -46, -68, -90, -112, -134? -156 What comes next: -287, -561, -833, -1103, -1371? -1637 What is the next term in 1050, 1049, 1048, 1047, 1046? 1045 What is next in -40, -37, -34, -31? -28 What comes next: -5633, -5632, -5631? -5630 What is the next term in -530, -528, -524, -518? -510 What is next in 18, 8, -6, -24, -46? -72 What comes next: -243, -225, -211, -201, -195, -193? -195 What is the next term in -32, -51, -70, -89? -108 What is the next term in 1520, 1522, 1524? 1526 What comes next: -6, -31, -80, -159, -274? -431 What is next in -376, -745, -1092, -1405, -1672, -1881, -2020? -2077 What is the next term in 332, 357, 382? 407 What is next in 477, 478, 479, 480? 481 Wha	{ "pile_set_name": "DM Mathematics" }
e nearest 10? -70 Let t = 696.1 + -696.22462. What is t rounded to three dps? -0.125 Let s = 17269.28296 - 17269. Round s to 2 dps. 0.28 Let y(d) = 226d2 - 10d - 16. Let f be y(-9). Let h be 16/(6/31). Suppose hn - f + 235180 = 0. Round n to the nearest one thousand. -27000 Suppose 66d - 2453318 = -836648. Round d to the nearest 100. 24500 Let h = -0.356 - 447.644. Let q = 448.00001683 + h. What is q rounded to six decimal places? 0.000017 Let a = -0.079 - 166.921. Let g = a + 195.5. Round g to the nearest integer. 29 Let p = 28.9775 + -27.97. What is p rounded to two decimal places? 1.01 Let r = 75636 - -570021. Let q be (2(3 - 4))/((-8)/(-4022628)). Let s = r + q. What is s rounded to the nearest 100000? -400000 Let g = 2072.996826 - 2073. What is g rounded to 3 decimal places? -0.003 Let a = -10750.969865 - -10751. Round a to 4 decimal places. 0.0301 Let l = -922547.622 - -1030416425.622. Let t = -1029493964.0000006 + l. Let q = -86 - t. What is q rounded to six decimal places? 0.000001 Let i = 0.208213 + -0.19751. Round i to four decimal places. 0.0107 Let c(t) = -299282t - 359. Let p be c(3). Suppose 6 - 2 = -4x, m - 1778200 = -5x. Let v = m + p. What is v rounded to the nearest 100000? 900000 Let l be (-8168 - (-7)/(-1))/((-2)/28). Round l to the nearest one thousand. 114000 Suppose -9278 = 4b - 1830. Suppose 5z = 25, 2w - 53z + 4851 = -58z. Let j = b + w. Round j to the nearest 1000. -4000 Let y = -0.0772 - 511.9228. Let x = 512.0001804 + y. What is x rounded to five decimal places? 0.00018 Let k = -108689583.943295 + 109162944.913. Let p = k + -473360. Let n = p + -0.97. Round n to five dps. -0.0003 Let f = 134 - 126. Suppose fz - 4z - 4c - 928 = 0, 4c = -4z + 896. What is z rounded to the nearest 10? 230 Let q = -469 - -4169. Let w = 3131 + -3119. Suppose -wk = -14k - q. What is k rounded to the nearest one hundred? -1900 Let x = 493 + -492.6832. Let l = x + -302.4168. What is l rounded to the nearest ten? -300 Let t = 336631754 + -566941754. Round t to the nearest 1000000. -230000000 Let l be (-21)/28 + 1236624072/96. What is l rounded to the nearest one hundred thousand? 12900000 Let s = -39 - -60. Let a = -47 + s. Let o = a - -25.3. What is o rounded to 1 dp? -0.7 Let g = 12.283 - 12.283063445. What is g rounded to 5 decimal places? -0.00006 Let d be (-7)/(21/6) - -34. Suppose 0 = 3l - 4z - 0z + d, l + 16 = 4z. Let q be 22/l + (-4)/16 - -11003. Round q to the nearest 1000. 11000 Let x = -4127932502.0000466 - -4127932891. Let c = -3250 - -2861. Let d = x + c. Round d to five dps. -0.00005 Let i = 299221 - 167357. Suppose -h + 2o = -i - 336132, 4h - 5o - 1871990 = 0. Suppose -g + h = 3g. Round g to the nearest ten thousand. 120000 Let l = 159.162 + -159. Let g = -0.1620009 + l. What is g rounded to 5 decimal places? 0 Let o = -19.5715 - -2.709. Let i = o - -16.8. Round i to 2 decimal places. -0.06 Let y = 646956.01 - 657828. Let z = y + 10827. Let o = 46 + z. What is o rounded to 1 decimal place? 1 Let o(i) = -i2 + 25i - 62. Let x be o(3). Suppose w + xp + 550 = -w, 0 = -5w - 2p - 1351. Round w to the nearest 10. -270 Let c = -562215355.6039 - -3193.6039. Let m = -562212172.99999996 - c. Let w = -11 - m. Round w to seven dps. 0 Let a be (-6)/39 + 502974/26. Suppose -11r - a = 25315. What is r rounded to the nearest 1000? -4000 Let y = 352 + -349. Suppose -11t + 8t + 153268 = 4o, yt + 76652 = 2o. What is o rounded to the nearest one thousand? 38000 Let o = 159926 - 159925.99834003. Round o to five decimal places. 0.00166 Let q = 0.2697 + -162.5097. Let n = 165 + q. Round n to the nearest integer. 3 Let u = -62523.827 - -62553. Let z = u - 0.323. Let l = z - 26. Round l to 1 dp. 2.9 Let w = 44607 + -44607.13452. Round w to 1 decimal place. -0.1 Let k(b) = b3 - b2 - 10b - 29. Let j be k(7). Let o be j(160/14)/((-18)/210). What is o rounded to the nearest ten thousand? -30000 Let m(q) = -q3 + 10q*2 - 7q - 11. Let t be m(9). Let a = -4 + t. Suppose -ar - 5r = -1528. What is r rounded to the nearest 10? 190 Let h = 1 - -1. Suppose c + hz - 247088 = 2c, 4z + 988352 = -4c. Let y = c + 165088. What is y rounded to the nearest 100000? -100000 Let m = -0.935 + -394.065. Let c = 394.99999332 + m. Round c to six decimal places. -0.000007 Let z = -613 + 296. Let y = 317.0442 + z. Round y to two decimal places. 0.04 Let q = -23.96455 - -24. Let x = 0.488 + -0.523. Let z = q + x. What is z rounded to four decimal places? 0.0005 Let i = -11341.0194 + 11341. Round i to four decimal places. -0.0194 Let p = 142.649 + 0.351. Let d = p - 142.99999882. What is d rounded to 6 dps? 0.000001 Let l(i) = -1592i + 13. Let z(b) = 3186b - 25. Let h(m) = 10l(m) + 6z(m). Let v be h(-5). Round v to the nearest ten thousand. -20000 Suppose 230 = 2f - 176. Let r = f - 142. Suppose 0 = 5v - 3l - 221, v + 7l - 2l = r. Round v to the nearest ten. 50 Suppose 6 + 3 = 3x. Suppose -4l - xl = -49. Suppose -ld - 32179710 = 1770290. What is d rounded to the nearest 100000? -4900000 Let j = 224.86 + 3767.84. What is j rounded to the nearest 100? 4000 Let h = -60215830 - -97856489. Let u = h - 37640649.9999905. Let q = 9 - u. Round q to 6 dps. -0.00001 Suppose 4o + 9110255 = -5r - 613090, 0 = -3r + o - 5834024. Let t = r + 644673. Round t to the nearest one hundred thousand. -1300000 Let w = 176366.0076 - 176308. Let c = 187 + -129. Let v = c - w. What is v rounded to three dps? -0.008 Let s = -181.30836 + 181.62. Round s to two decimal places. 0.31 Suppose 184a - 4161268672 = 1458661728. What is a rounded to the nearest one million? 31000000 Let r = 2.2409 + -9.8305. What is r rounded to zero dps? -8 Let j = -77 - -164.5. Let f = 14.5 - j. Let p = 73.00075 + f. What is p rounded to 4 decimal places? 0.0008 Let l = 313.25 - 275.612. Round l to the nearest 10. 40 Suppose -h = -3r - 62025, -8h - 310040 = -13h - 2r. Round h to the nearest ten thousand. 60000 Let m = -0.4657564 + 0.4649. What is m rounded to 5 decimal places? -0.00086 Let f = -156 - -79. Let i = -54 - f. Let g = i + -23.00000046. What is g rounded to 7 decimal places? -0.0000005 Let w be 0 + (0 + 0)1/(-2). Let f be (2 - w - 12)-250. Let b be (10/45 - 2884/18)f. Round b to the nearest 1000000. 0 Let m = -20448503.94155 + 20448974. Let s = m + -470.2. Let x = s + 0.142. What is x rounded to 4 decimal places? 0.0005 Let q = -0.142 + 4.472. Let s = q + -4.329989. Round s to 5 dps. 0.00001 Let i = 350.28 + -349.4874. What is i rounded to 2 decimal places? 0.79 Let h = -103.3 - -4.3. Let l = 9942405945.99999937 + -9942406045. Let t = l - h. Round t to 7 decimal places. -0.0000006 Let i be (206694/(-27))/(20/90 - 22/100). What is i rounded to the nearest one hundred thousand? -3400000 Let w(o) = o*2 + o - 9. Let y be w(-4). Let m be ((-2)/y)/(-1) - 8/12. Suppose -5a + 4062 + 1288 = m. What is a rounded to the nearest 100? 1100 Let s = 287188 - 287185.66339. Round s to 1 decimal place. 2.3 Suppose -2u = -g + 80320532, -3g + 19715195 = -u - 20445061. Let s = -19260268 - u. What is s rounded to the nearest one million? 21000000 Let d = 56732 + -56732.066887. What is d rounded to three decimal places? -0.067 Let l = 18206.8 - 19518. Round l to the nearest 100. -1300 Suppose -8u - 455824 - 474216 = 0. Let o be (-3)/(-15) + u/25. Round o to the nearest 1000. -5000 Let c = -3031 + 3031.5006. Let s = 0.56 - c. Round s to 2 decimal places. 0.06 Let d = 4.07174 - 3.972. What is d rounded to three decimal places? 0.1 Let p = -19.189 - -19.189014259. What is p rounded to seven dps? 0.0000143 Let c = 3013 + -3012.99994733. What is c rounded to 6 dps? 0.000053 Let b = -12115691910 + 12116215422.7501. Let p = b + -524113.7. Let l = 601 + p. Round l to two decimal places. 0.05 Let q = 167.64 + -203.2. What is q rounded to the nearest integer? -36 Let m = -646.009 - -645. Let u = -93.791 + m. What is u rounded to the nearest 10? -90 Let j be 2/(-11) - ((-608)/(-44) - -2). Let s = -34 - j. Let l be ((-20)/s)/(-5) + 2726994/(-27). Round l to the nearest 10000. -100000 Let b(l) = l2 + 10l - 13. Let i be b(-11). Let a be (-2 - -1)*-6 + i + 0. Let s be 4/(-8) + ((-1379994)/a)/3. Round s to the nearest ten thousand. -120000 Let s be (-15)/(-55) - 12406	{ "pile_set_name": "DM Mathematics" }
at is the w'th term of -3275, -6476, -9571, -12506, -15227, -17680? 9w3 - w2 - 3261w - 22 What is the g'th term of -65901, -131643, -197387, -263133, -328881, -394631, -460383? -g*2 - 65739g - 161 What is the x'th term of 49102, 49105, 49108, 49111, 49114? 3x + 49099 What is the j'th term of 138539, 138546, 138539, 138512, 138459, 138374? -j3 - j2 + 17j + 138524 What is the x'th term of 12305, 12307, 12309, 12311, 12313, 12315? 2x + 12303 What is the i'th term of 14952, 14956, 14960? 4i + 14948 What is the w'th term of 1626, 3246, 4866? 1620w + 6 What is the v'th term of 177, 370, 587, 840, 1141, 1502, 1935, 2452? 2v*3 + 179v - 4 What is the g'th term of 93, -122, -337, -552? -215g + 308 What is the q'th term of -172, -44, 210, 584, 1072, 1668? -q3 + 69q*2 - 72q - 168 What is the h'th term of 30858, 123451, 277772, 493821, 771598, 1111103? 30864h2 + h - 7 What is the v'th term of 137, 261, 419, 617, 861, 1157, 1511? v3 + 11v*2 + 84v + 41 What is the a'th term of 83007, 166008, 249005, 331998, 414987? -2a2 + 83007a + 2 What is the v'th term of -221467, -221468, -221469, -221470? -v - 221466 What is the w'th term of 4972, 9959, 14946? 4987w - 15 What is the a'th term of -2340, -2332, -2318, -2298, -2272, -2240, -2202? 3a*2 - a - 2342 What is the x'th term of 3330, 6665, 10000, 13335, 16670, 20005? 3335x - 5 What is the z'th term of -227, -428, -629, -830, -1031, -1232? -201z - 26 What is the q'th term of 2084, 2089, 2086, 2075, 2056, 2029? -4q*2 + 17q + 2071 What is the i'th term of -1164, -2322, -3482, -4644, -5808, -6974? -i*2 - 1155i - 8 What is the l'th term of -83852, -83853, -83856, -83861, -83868, -83877, -83888? -l*2 + 2l - 83853 What is the b'th term of -2097, -2142, -2181, -2214? 3b2 - 54b - 2046 What is the u'th term of 431, 1616, 3579, 6320, 9839, 14136, 19211? 389u2 + 18u + 24 What is the c'th term of -5724, -5681, -5636, -5589, -5540, -5489, -5436? c*2 + 40c - 5765 What is the v'th term of -500, -505, -520, -551, -604, -685, -800? -v3 + v2 - v - 499 What is the u'th term of -6815, -6820, -6825? -5u - 6810 What is the a'th term of 10428, 20855, 31282? 10427a + 1 What is the r'th term of -93857, -93933, -94009? -76r - 93781 What is the m'th term of -4454, -8360, -12262, -16160, -20054, -23944, -27830? 2m*2 - 3912m - 544 What is the m'th term of 1093, 1063, 1033, 1003, 973, 943? -30m + 1123 What is the x'th term of 22690, 45400, 68110, 90820? 22710x - 20 What is the g'th term of 167722, 167719, 167714, 167707, 167698, 167687? -g*2 + 167723 What is the d'th term of 70674, 141352, 212030, 282708, 353386? 70678d - 4 What is the k'th term of 4512, 4522, 4540, 4566, 4600? 4k2 - 2k + 4510 What is the u'th term of -72238, -72238, -72228, -72202, -72154, -72078? u3 - u2 - 4u - 72234 What is the s'th term of 620308, 620309, 620310? s + 620307 What is the p'th term of -1298, -1196, -1094, -992, -890, -788? 102p - 1400 What is the y'th term of -1549, -1518, -1487, -1456, -1425, -1394? 31y - 1580 What is the r'th term of -1675, -3351, -4995, -6607, -8187? 16r*2 - 1724r + 33 What is the z'th term of -379, -332, -285, -238, -191? 47z - 426 What is the f'th term of 466973, 466986, 467001, 467018, 467037? f2 + 10f + 466962 What is the a'th term of -326077, -326081, -326085, -326089, -326093, -326097? -4a - 326073 What is the m'th term of 2073, 2172, 2271? 99m + 1974 What is the y'th term of 34921, 69829, 104735, 139639? -y*2 + 34911y + 11 What is the r'th term of 600193, 1200385, 1800577? 600192r + 1 What is the g'th term of 21, 37, 43, 33, 1, -59, -153, -287? -g3 + g2 + 20g + 1 What is the c'th term of 443, 845, 1249, 1655, 2063, 2473, 2885? c*2 + 399c + 43 What is the k'th term of 366, 832, 1418, 2118, 2926, 3836, 4842, 5938? -k*3 + 66k*2 + 275k + 26 What is the a'th term of -9443, -18969, -28495? -9526a + 83 What is the q'th term of -1419, -2937, -4561, -6291? -53q*2 - 1359q - 7 What is the g'th term of 723, 1484, 2283, 3126, 4019, 4968, 5979, 7058? g*3 + 13g*2 + 715g - 6 What is the n'th term of -2949, -11762, -26447, -47004, -73433, -105734, -143907? -2936n2 - 5n - 8 What is the w'th term of 488, 585, 684, 785, 888, 993? w*2 + 94w + 393 What is the r'th term of 137940, 275887, 413836, 551787? r*2 + 137944r - 5 What is the h'th term of -197, -97, 13, 133, 263, 403? 5h2 + 85h - 287 What is the s'th term of 826491, 826501, 826525, 826569, 826639, 826741, 826881, 827065? s3 + s2 + 826489 What is the f'th term of -8467, -33820, -76073, -135226, -211279, -304232, -414085? -8450f2 - 3f - 14 What is the p'th term of -43828, -43830, -43832, -43834? -2p - 43826 What is the c'th term of -126, -225, -332, -453, -594, -761? -c3 + 2c*2 - 98c - 29 What is the n'th term of 29105, 29085, 29065, 29045, 29025? -20n + 29125 What is the m'th term of -292431, -292432, -292433, -292434, -292435, -292436? -m - 292430 What is the r'th term of -4082, -4169, -4266, -4379, -4514, -4677? -r3 + r2 - 83r - 3999 What is the r'th term of -48941, -48945, -48949? -4r - 48937 What is the z'th term of 2298, 6015, 9732, 13449, 17166, 20883? 3717z - 1419 What is the f'th term of 1428, 1312, 1120, 852, 508, 88? -38f2 - 2f + 1468 What is the h'th term of 174, 459, 732, 993, 1242, 1479, 1704? -6h2 + 303h - 123 What is the w'th term of -6125, -5941, -5637, -5219, -4693, -4065? -w*3 + 66w*2 - 7w - 6183 What is the m'th term of -61, 243, 1083, 2723, 5427, 9459? 44m3 + 4m*2 - 16m - 93 What is the i'th term of 96, -103, -292, -465, -616, -739, -828, -877? i3 - i2 - 203i + 299 What is the j'th term of 385, 407, 429, 451, 473? 22j + 363 What is the q'th term of 10913, 10920, 10927? 7q + 10906 What is the k'th term of 22264, 44506, 66748, 88990, 111232? 22242k + 22 What is the v'th term of 4084, 8351, 12616, 16879? -v*2 + 4270v - 185 What is the s'th term of -276091, -276101, -276119, -276151, -276203? -s*3 + 2s*2 - 9s - 276083 What is the r'th term of 151, 144, 137, 130, 123, 116? -7r + 158 What is the c'th term of 1310, 2808, 4680, 7112, 10290, 14400, 19628? 31c3 + c2 + 1278c What is the w'th term of 6720, 13430, 20138, 26844, 33548? -w2 + 6713w + 8 What is the o'th term of -16165, -32324, -48483, -64642, -80801? -16159o - 6 What is the w'th term of 4259, 4361, 4539, 4799, 5147, 5589, 6131, 6779? w3 + 32w*2 - w + 4227 What is the b'th term of 401, 723, 1045, 1367, 1689? 322b + 79 What is the q'th term of 465968, 465969, 465970? q + 465967 What is the r'th term of -422, -1585, -3532, -6263? -392r2 + 13r - 43 What is the c'th term of 847, 1722, 2611, 3514, 4431, 5362? 7c2 + 854c - 14 What is the c'th term of -270, -440, -598, -744, -878? 6c2 - 188c - 88 What is the d'th term of 32, 48, -106, -580, -1524, -3088? -25d3 + 65d*2 - 4d - 4 What is the g'th term of 2718, 4554, 6390, 8226? 1836g + 882 What is the t'th term of 29650, 29652, 29654, 29656, 29658? 2t + 29648 What is the p'th term of -2121, -2071, -2023, -1977, -1933, -1891? -p*2 + 53p - 2173 What is the k'th term of -8029, -8031, -8033, -8035? -2k - 8027 What is the p'th term of 3706, 7381, 11062, 14749, 18442, 22141, 25846? 3p*2 + 3666p + 37 What is the s'th term of -3279, -6570, -9859, -13146, -16431? s*2 - 3294s + 14 What is the y'th term of 370198, 370195, 370192? -3y + 370201 What is the s'th term of 25006, 25042, 25078, 25114? 36s + 24970 What is the q'th term of 6, 34, 66, 102? 2q2 + 22q - 18 What is the a'th term of -24502, -49003, -73504? -24501a - 1 What is the p'th term of 82193, 82192, 82191, 82190? -p + 82194 What is the c'th term of 1166, 2343, 3508, 4649, 5754, 6811, 7808, 8733? -2c*3 + 6c*2 + 1173c - 11 What is the s'th term of -64900, -129799, -194696, -259591, -324484? s*2 - 64902s + 1 What is the h'th term of -1301, -2598, -3895, -5192, -6489? -1297h - 4 What is the g'th term of -214, -154, -82, -4, 74, 146, 206, 248? -g3 + 12g*2 + 31g - 256 What is the i'th term of -164332, -164323, -164300, -164257, -164188, -164087, -163948, -163765? i3 + i2 - i - 164333 What is the t'th term of 17, 86, 169, 242, 281, 262, 161, -46? -4t3 + 31t*2 + 4t - 14 What is the v'th term o	{ "pile_set_name": "DM Mathematics" }
the form bq3 + uq + iq2 + z + kq*4 and give i. -1 Rearrange (-13x*2 - 9x + 9x)((7x + 3x - 3x)(-6 + 3 + 1) + (-2 - 3 + 3)(-3x + 3x + 2x) - 3x + 7x - 2x) to sx*3 + gx*2 + dx + h and give s. 208 Express -197r2 + 64r*2 + 70r*2 + 223r*3 + 65r*2 in the form ur + vr3 + c + zr*2 and give v. 223 Rearrange -143961 + 1017h*2 + 143961 to the form d + lh + ph2 and give l. 0 Rearrange 11l + 15l - 5l + (0l + 0l - 5l)(-3 - 4 - 1) to the form nl + x and give n. 61 Express (5z - 11 + 3 + 0)(3z - 14z - 3z) as hz + pz*2 + g and give p. -70 Rearrange 5 - 3 - 48446n*2 + 48483n*2 to the form in*2 + y + mn and give i. 37 Express (n2 - n2 + 3n2)(-2n2 + 1 - 1) + 0 - n4 + 0 + n3 + 4001n - 35n4 - 4001n in the form f + xn4 + kn*2 + cn*3 + gn and give x. -42 Express t*2 + 117t*4 + 1 - 2t - 189t4 + 0 in the form st + wt4 + q + rt*2 + kt*3 and give s. -2 Rearrange -66n*4 - 9n*2 + 36n*4 + n + 2 + 28n*4 to the form xn + y + un3 + kn*2 + rn*4 and give y. 2 Express 114 + 229g - g*2 - 229g + 6 in the form vg + jg*2 + w and give j. -1 Express -5 + 6v + 16 - 1 + 5 as hv + w and give h. 6 Rearrange (-95t + t*2 + 7 + 59t + 8t)(5 - 3 + 0)(0 - 1 - 1)(4t - t - t) to the form rt + v + ht3 + at*2 and give r. -56 Rearrange (-2 + 3 + 0)(-1 - 2 + 4)(-306s*3 + 8s*4 - 2s*4 - 8s*4) to the form j + vs*3 + ls*2 + ps*4 + zs and give p. -2 Rearrange 6u3 + 4u*3 + 1 - 6u*3 - 3 - 5u*4 - 3u*2 + 2u*4 to the form h + ru + pu3 + au*4 + su*2 and give h. -2 Express (37k*2 - 146k*2 - 136k*2)(k + 3 - 2 + 0k) as lk + s + ck2 + gk*3 and give c. -245 Rearrange (35d - 80d + 41d)(-3d*3 - 3d*2 + 3d*2) + 0d*4 + 0d*4 + 6d*2 - 2d*4 to ud*3 + md + qd2 + kd*4 + v and give q. 6 Express -7v - 118v + 186v + 205v + 858v in the form b + nv and give b. 0 Express 43u*2 - 15u*2 + u - 8u + 4u in the form pu*2 + j + cu and give c. -3 Rearrange -7v3 + 0v*3 - 51v*2 + 102v*2 - 40v*2 to the form gv*2 + mv + p + qv3 and give p. 0 Express (3y*2 - 4 + 4)(47y2 - 4 - y - 26y*2 + 6) as by*4 + z + ty*3 + ry*2 + xy and give t. -3 Rearrange 8i2 + 11i*2 - 24i*2 + 71i - 12i to p + si*2 + fi and give s. -5 Express (-17w + 12w - 1 + w*2 + 6w)(36w*2 + 100w - 100w) as pw*4 + a + sw*3 + dw*2 + xw and give p. 36 Express h*4 - 3h*4 + 3h*4 - 3h*3 + (-3h + 5h + 0h)(2h*3 - 2h3 + h3) - h*4 + 2h*4 + 2h*4 as bh*3 + mh*2 + l + sh + jh4 and give j. 6 Rearrange (-6p*3 + 35p*3 + 11p*3)(7 - 3 - 11) to the form cp3 + bp + np2 + q and give c. -280 Express 3p2 + p3 - 4p3 + 13p4 - p2 - 20p4 - 25p*4 - 3p as qp4 + xp*3 + kp + hp2 + n and give n. 0 Express -127 - 145 - 2u*2 + 213 as tu*2 + hu + x and give x. -59 Rearrange (2l2 + 0l2 - l2)(-28l - 12l + 5l + (2l - 3l + 3l)(-1 + 2 + 0)) to m + dl2 + al + ol3 and give o. -33 Rearrange (68p - 25p - 31p + 3)((0 - 2 + 3)(-2 + 4 + 0) + 2 + 1 - 2) to the form cp + g and give g. 9 Express -32m + 2m4 - 54017m*3 + 54017m*3 + 2m*2 in the form im*3 + vm + d + pm2 + fm*4 and give i. 0 Rearrange -48h*2 - 4h + 0h + 40h - 38h to ph + nh2 + i and give n. -48 Express -2 - 49y*2 - 3y*2 + 6y*4 - 18y*4 + 10y*4 as ty*4 + py*3 + r + uy + gy2 and give p. 0 Rearrange (1 + 1 + 0)(-47 + 889m + 1978m + 47) to z + lm and give l. 5734 Rearrange -7 - 5s*3 + 7 + (3s - s - 3s)(3s2 - 5s + 5s) + (6 + 2 - 4)(s*3 + 3s - 3s) to p + ms*2 + ls + ns3 and give n. -4 Rearrange -76m - 76m + 141m to the form cm + k and give c. -11 Express d2 - 22d*4 + 26d*4 + 2d + 4d2 - 13d*4 + 4 in the form md*3 + qd*2 + ad*4 + od + f and give q. 5 Express -24 - 6 + 64 + 2z + 6z*2 in the form wz*2 + u + gz and give u. 34 Express 1154a2 + 955 - 955 as sa + l + ra2 and give l. 0 Rearrange (2v + 4v - 9v)(v - 37 - 16 + 23) to the form q + fv + hv2 and give h. -3 Rearrange ((6 - 1 - 3)(1 - 4 + 4) + (17 - 6 - 3)(5 + 0 - 3))(5h - 2h - h)(h2 + h2 - 4h*2) to sh*2 + nh*3 + vh + l and give n. -72 Rearrange 46l + 0l*2 + 10l + 0l2 - l + 2 - 2l*3 to kl + ml2 + xl*3 + p and give x. -2 Express -263h - 551h - 452h in the form fh + k and give f. -1266 Express (0 + 17 - 3 + (-1 + 4 - 1)(3 + 4 - 6) - 2 - 2 + 2)(-3z2 + z2 + 3z2) in the form q + yz + dz2 and give y. 0 Rearrange 8q*2 - 2 - 39q + 103q - 53q to the form sq2 + nq + y and give n. 11 Express (-150s + 83s - 143s)(s + s - 4s) in the form gs + os2 + u and give o. 420 Express 16v*2 + 8v2 - v2 + 7v2 - 4v*2 in the form lv*2 + d + zv and give l. 26 Express -304w3 + 651w*3 - 286w3 + w2 in the form bw + iw*3 + uw*2 + y and give y. 0 Rearrange (33 + 27 - 2s - 9)(-6 + 4 + 0) to gs + m and give g. 4 Express 32 - 14 - 499u - 18 in the form lu + t and give l. -499 Rearrange -1 + 4b + 1 + 3b + 3b - 4b + (b + 0b - 2b)(-1 + 1 - 2) + (6 - 2 - 3)(2b + 0b - 4b) + 3b + b - 3b to w + fb and give f. 7 Rearrange 166r - 230 + 229r + 230 to jr + s and give j. 395 Express 1 - 36t*2 + 29t*2 - 2 - 1 in the form kt*2 + rt + y and give y. -2 Rearrange (-3c2 - 2c*2 + 7c*2)(-6c2 + 2711c - 29 + 2718c - 5424c) to x + ac3 + wc*2 + oc*4 + fc and give w. -58 Express -4r2 - 1 - 89r + 90r - 2 - 3r*3 as ur*2 + zr*3 + fr + b and give u. -4 Express -40b2 - 15b*2 + 6b*2 + (-1 + 1 + 6b)(2b + 1 - 1) - b*2 + 0b*2 + 0b*2 in the form g + vb*2 + jb and give v. -38 Rearrange 0b - 9b + 11 + 9 + 7b to the form ab + i and give a. -2 Express (-2 + 2 - u)(2 - 9 + 4)(-19u - 36u - 1 + 19u) as s + cu + hu2 and give h. -108 Rearrange 4p*3 - 3 + 4 + 2p - 3 + 41p2 - 23p*2 - 28p*2 to the form qp*3 + lp + fp2 + b and give q. 4 Rearrange -16x*2 - x + 59x*2 + 21x*2 + 0x*2 to hx*2 + bx + t and give h. 64 Rearrange (-433y - 196y - 37y)(-3y2 + 3y*2 - 5y*2) to the form ry + qy3 + ly*2 + u and give q. 3330 Rearrange -4647 + 595s + 2318 + 2329 to the form gs + t and give g. 595 Express 8 - 8 - 427y + 434y as m + cy and give c. 7 Rearrange (8 - 2 - 7)(0 - 1 - 2)(-4f3 + 14f*3 + 2f*3) to t + xf*3 + wf + mf2 and give x. 36 Express -18b*2 - 27b*2 + 427b*2 as jb*2 + a + sb and give j. 382 Rearrange -5 - 1632b - 1820b + 2745b + 5 to the form o + mb and give m. -707 Express 138i + 1 + 2 - 9 + 2 in the form o + ki and give o. -4 Rearrange (3d2 + 6d*2 + 11d*2)(-4 + 4 - 3)(6d + 4d - 6d) to jd2 + fd + ud3 + i and give u. -240 Express (-o + o - 3o*2)(o*2 + 0 + 0) + 35o*4 - 46o*4 - 73o*4 as ao*4 + wo*3 + no + k + bo2 and give a. -87 Express 2g + 10 + 0g - 12 + 3g - 12g2 as tg + ng2 + j and give j. -2 Express 94 - 6w - w*4 - 44 + 2w - w*3 + 2w*2 - 49 in the form qw*3 + nw + pw2 + i + rw*4 and give i. 1 Rearrange -2j*2 - 23j - 83j4 + 24j + 29 - 31 to rj4 + ij + cj3 + tj*2 + g and give r. -83 Express (7 - 3 + 4)(-19c + 11c - 24c) in the form kc + s and give k. -256 Express -13l3 + 26l*3 - 5l*2 - 14l*3 + 2l + 3l3 - 2l*4 + 2 as ml*4 + ql*3 + jl*2 + p + fl and give p. 2 Rearrange 0t3 + t3 - 2t*3 + (1 + 2t - 1)(0t*2 + 2t*2 + 0t*2) - 10t*3 - 77t*3 - 85t*3 to the form x + ht*2 + nt*3 + it and give n. -169 Express -23h2 - 5h2 - h3 + 2h2 - 2h as ph3 + b + ah*2 + th and give a. -26 Rearrange (-3n4 + 12n*4 - 32n*4)((0 + 3 - 5)(2 - 1 + 0) + 0 + 0 - 3 + 3 - 3 - 5) to fn*3 + w + sn*2 + cn + dn4 and give d. 230 Express (-22o + 22o + 2o*2)(10 - 3 + 1)(1 - 1 - 2)(-3 - o + 3) + 0o3 - o3 + 2o*3 as s + uo + zo2 + po*3 and give p. 33 Express (-105 - 88 + 219)(1 - 7b2 - 3 + 1 + 0) as z + ub + sb2 and give s. -182 Rearrange -559 - 216 + 209 + 2x to the form jx + m and give m. -566 Express -562m + 0 + 2 + 569m in the form pm + t and give t. 2 Express -57*n - 10 + 1	{ "pile_set_name": "DM Mathematics" }
(c) -0.1 b What is the third smallest value in -0.45, 0.01, 43? 43 Which is the third biggest value? (a) -2 (b) 0.4 (c) 27 (d) 3 b Which is the fourth biggest value? (a) -2 (b) 2 (c) -0.4 (d) 87.6 a What is the fourth biggest value in 2/3, 43, -5, 0.78? -5 What is the fourth smallest value in 4, -2/7, -2/3, -14/5, 3? 3 Which is the second biggest value? (a) -5 (b) -1/6 (c) 6/11 (d) 0 d What is the third biggest value in 0.4, 2, 0.062? 0.062 Which is the third biggest value? (a) -2/25 (b) -51 (c) -0.4 (d) -1 d Which is the third biggest value? (a) 2 (b) 2/31 (c) -2 (d) -2/5 d Which is the second smallest value? (a) 14/11 (b) -8 (c) 0.4 (d) -1/2 (e) -1/4 d What is the biggest value in 2, 5, -0.2, -486? 5 What is the third smallest value in 2/3, 4, 1/2, -2/7? 2/3 Which is the biggest value? (a) -4 (b) -2/17 (c) -4/45 c What is the fourth biggest value in -0.1, -12, -1, 0.1? -12 What is the smallest value in -8, 2, -1, 5? -8 What is the fourth smallest value in -4, 3/10, -1/2, -0.05? 3/10 What is the third smallest value in -82/7, 5, -4, -4/3? -4/3 Which is the second biggest value? (a) 2 (b) 2/9 (c) 2/43 (d) 3/5 d Which is the second biggest value? (a) 23.2 (b) 0.5 (c) -0.5 b What is the second smallest value in -2, 2/9, 0, 0.4? 0 Which is the third smallest value? (a) 0.01 (b) 9 (c) -9 b What is the second biggest value in 0.07, 2/11, -3, -0.2? 0.07 What is the second biggest value in -0.4, 1, 0.01, -6? 0.01 What is the second biggest value in 2, -34, 5? 2 Which is the third smallest value? (a) -2 (b) -0.4 (c) -4/49 c What is the smallest value in 2/21, 0.5, 4, 1/8? 2/21 What is the second biggest value in -0.2, -5, -493? -5 What is the second biggest value in 2.2, 2/7, -1/5, 0.4? 0.4 Which is the third smallest value? (a) -2 (b) 1/5 (c) -3125 b What is the smallest value in -2, -29.6, 0.4? -29.6 Which is the third smallest value? (a) -5 (b) 5 (c) 0.31 (d) 1/6 (e) 4 c Which is the biggest value? (a) -4 (b) 5 (c) 1.045 b What is the fourth biggest value in 5, 1/4, -2, -34? -34 What is the biggest value in 1.7, 2/5, 0.1? 1.7 Which is the third smallest value? (a) 2 (b) -0.4 (c) 0.1 a Which is the biggest value? (a) 1/3 (b) 0.2 (c) 2/19 (d) -2/7 a Which is the third biggest value? (a) -1/5 (b) -35 (c) -2 (d) 0.3 c Which is the second biggest value? (a) 3 (b) 0.02 (c) -29.1 b What is the second smallest value in 4, 1/2, 7? 4 What is the smallest value in 3/4, -3, -4, 0.12? -4 What is the smallest value in 0.3, 4, 0.4, -1? -1 Which is the second smallest value? (a) 47 (b) 4/5 (c) 3/7 b What is the biggest value in 3, -8, 5, 1? 5 What is the third smallest value in 3, -1, 28/9? 28/9 Which is the biggest value? (a) -2/13 (b) -1/8 (c) 3107 c What is the fourth smallest value in 0.4, 0.5, -0.4, -0.18? 0.5 Which is the second smallest value? (a) -9 (b) -2 (c) -0.9 (d) -1 b Which is the third biggest value? (a) 0 (b) 2/13 (c) 3 (d) 365 b Which is the fourth biggest value? (a) 0.3 (b) 0.05 (c) 0 (d) 37 (e) -0.3 c Which is the third smallest value? (a) 2/3 (b) -0.6 (c) 0 (d) -0.36 c What is the third biggest value in 2/13, -1, -5/3? -5/3 Which is the third smallest value? (a) -0.1 (b) -0.7 (c) -5 (d) 2 a Which is the second biggest value? (a) 3 (b) -3 (c) -1/19 c What is the biggest value in 0, 1, 0.5, -2/15? 1 What is the second smallest value in 0.85, -0.5, -4? -0.5 Which is the second biggest value? (a) 0.5 (b) -6 (c) -2 (d) 79 (e) 0 a Which is the second smallest value? (a) 3 (b) -24 (c) -1/4 (d) -8/3 (e) 1/6 d What is the second smallest value in 4, 44, -0.4, -0.1? -0.1 What is the third smallest value in 1/5, 0, 2/3, -67/3? 1/5 Which is the third smallest value? (a) -11 (b) -0.66 (c) -0.4 c Which is the fifth biggest value? (a) 6 (b) 1/3 (c) 2/3 (d) 51 (e) 5 b What is the biggest value in -1, 0.09, -3, -58? 0.09 What is the third biggest value in -3/5, 1/7, -2897? -2897 Which is the second smallest value? (a) 39 (b) 4 (c) 0 b Which is the third smallest value? (a) 10/7 (b) -1 (c) 84 c What is the biggest value in 2, 0.5, -0.63, -2? 2 What is the third smallest value in -1, -9/4, 0.33? 0.33 Which is the third smallest value? (a) 0.3 (b) -3 (c) 0.9 (d) -1 a Which is the third biggest value? (a) -2/53 (b) -2 (c) -4 (d) 0.2 (e) 1 a Which is the second biggest value? (a) -0.1 (b) 9 (c) 0.6 (d) -19 (e) 3 e What is the third biggest value in -0.1, -4/7, -46, 4? -4/7 Which is the biggest value? (a) 0.4 (b) -1/30 (c) 2/3 (d) -2 c What is the third biggest value in -5, -3/8, -2, 4, -2/11? -3/8 Which is the biggest value? (a) 8 (b) -2/3 (c) -0.2 (d) -6 a Which is the third smallest value? (a) 1/2 (b) 16 (c) -5 (d) -0.5 a Which is the third biggest value? (a) 0 (b) -1 (c) 411 b Which is the third biggest value? (a) -2/37 (b) 1 (c) 0.2 a Which is the smallest value? (a) 0.3 (b) -1/41 (c) -0.06 c What is the second smallest value in 7, -2/29, -4? -2/29 Which is the fifth smallest value? (a) 18 (b) -1 (c) -2/7 (d) 5 (e) 5/8 a Which is the biggest value? (a) 48 (b) -40/9 (c) -3 (d) 0 a Which is the fifth smallest value? (a) -7/4 (b) 4 (c) -1 (d) 1/5 (e) -0.14 b Which is the third biggest value? (a) -2 (b) 1.4 (c) -8/17 a Which is the second biggest value? (a) -9 (b) -5 (c) 1/4 (d) -0.4 (e) -3 d What is the smallest value in -3, -4, 0.06, 2, 2/9? -4 What is the third smallest value in -1/2, -3/7, -5.8? -3/7 What is the second biggest value in 7/3, -0.05, -5, -1? -0.05 Which is the smallest value? (a) -155 (b) -2/9 (c) 1 a What is the smallest value in -72, -0.4, 3, 4? -72 What is the biggest value in -61, 1, -2? 1 Which is the smallest value? (a) -5 (b) 169 (c) 4/7 a What is the third biggest value in -3, 4, -2/17, 0.2? -2/17 Which is the third smallest value? (a) -4 (b) -36 (c) 0.2 c What is the fourth smallest value in 5, -4, -2, 3/8? 5 What is the third biggest value in 4/5, 2/3, 4, -0.3? 2/3 What is the third biggest value in 0.5, -0.09, -5, 1/6? -0.09 What is the second biggest value in 1/2, 4/7, -0.9? 1/2 Which is the smallest value? (a) 0.3 (b) -0.04 (c) 2.4 (d) 1/5 b Which is the smallest value? (a) 0.04 (b) -3/7 (c) -6 c Which is the biggest value? (a) 591 (b) -2/9 (c) 4/5 (d) -3 a What is the second biggest value in -20, 0, 0.3? 0 What is the fourth biggest value in 0, -5, -22, -0.5? -22 Which is the smallest value? (a) -0.5 (b) 1309 (c) 1 a Which is the second smallest value? (a) 0 (b) 2/419 (c) -1/7 a What is the second biggest value in -0.08, 2.3, -2? -0.08 Which is the second smallest value? (a) 2900 (b) -0.4 (c) -3 b Which is the second smallest value? (a) -0.1 (b) 1.3 (c) -5 (d) -0.5 (e) -4 e What is the second smallest value in -6/11, 3, -0.4, 1, 2? -0.4 Which is the third smallest value? (a) 5 (b) -3 (c) 116 (d) -0.5 a Which is the smallest value? (a) 11/9 (b) 0.02 (c) 4 b What is the smallest value in 0.4, 0, 3/979, -3? -3 What is the third biggest value in 4, 0.4, 1/2, -2/9? 0.4 What is the third biggest value in 3, 4, -0.01, 63? 3 Which is the third biggest value? (a) 0.1 (b) -8 (c) -2/171 b What is the biggest value in 3, -0.2, -4, -0.06? 3 What is the biggest value in -2/25, -8, 5? 5 Which is the third smallest value? (a) -0.3 (b) -256 (c) -4 a Which is the second smallest value? (a) 1 (b) 3.8 (c) 4 (d) 0 a Which is the fourth smallest value? (a) -5 (b) -15 (c) 0.5 (d) -1 (e) -4 d Which is the smallest value? (a) -8 (b) 1.21 (c) 3/2 a Which is the biggest value? (a) 1 (b) -4 (c) -3 (d) -219 a Which is the second biggest value? (a) -6/91 (b) 2/3 (c) -3 a What is the second biggest value in 5, 12/19, -0.06? 12/19 What is the second biggest value in 0.1, -2/11, 3, 1/7? 1/7 What is the third smallest value in 15/7, -0.4, -5, 0.1, -4? -0.4 What is the fourth smallest value in -1, -3, -3/7, 0.04? 0.04 What is the biggest value in 0.075, 0, 2/7? 2/7 Which is the biggest value? (a) -2 (b) -1.1 (c) -1/15 c What is the fourth biggest value in 24, -2/11, 0.02, -5? -5 Which is the smallest value? (a) -0.2 (b) 2 (c) -2/5 (d) -2/15 (e) 14 c What is the biggest value in 5, 0.4, -12/13? 5 What is the biggest	{ "pile_set_name": "DM Mathematics" }
ositive. 1 Simplify ((xx4)/xx/(x*(-7)x))4 assuming x is positive. x44 Simplify (zzzz(-2))/(zz*(-4/9)zzzz)z*2/(zzz(-2)) assuming z is positive. z(-14/9) Simplify ddd/d(-8)d*1(d/(d/d6))/d(-5) assuming d is positive. d*23 Simplify (w/(ww2))(1/4)/(w*(-10)w/(w*(-1/4)w)) assuming w is positive. w(37/4) Simplify (f(-8)/f0)21 assuming f is positive. f(-168) Simplify (v(-1/3))0/(v(-4)/v(-6)) assuming v is positive. v(-2) Simplify v*(-6)/(vv*(1/5))((v/(v/v*0v)v)/v)(26/3) assuming v is positive. v(-238/15) Simplify (b2/b(1/8))/((b/b(2/7))/bbb/(b/((bb*(-4/7)b)/b)bbb)) assuming b is positive. b(209/56) Simplify ((r(3/5)r)/rr(5/2))(-11) assuming r is positive. r(-341/10) Simplify (a/(a/(aa(-2/9))))(11/7)(a((a/a*(-3/2)a)/a)/a)/a(-2/3) assuming a is positive. a(79/18) Simplify (u(2/27))(10/11) assuming u is positive. u(20/297) Simplify o1/(o*8/o)(o/o*(2/3)o)16 assuming o is positive. o(46/3) Simplify ((ll(-7)l)/((lll*(-3)l)/l))/((l/l(-1/9))/l(-1/10)) assuming l is positive. l(-469/90) Simplify (o(-3)/o)/o(-2/9) assuming o is positive. o(-34/9) Simplify (zz(2/13)zzz*5z)/(z*0z(-1/5)) assuming z is positive. z(608/65) Simplify ((l*(-9/2)l)/(l/(l/(l/(lll*(-4/5)l))l)))(1/7) assuming l is positive. l(-13/70) Simplify (fff(3/5)fff3)(-2/73) assuming f is positive. f*(-76/365) Simplify (((((l/(ll*1))/l)/ll)/l)/l)(-30) assuming l is positive. l120 Simplify v/(v*(-11)vv)vvvvvvv(1/78) assuming v is positive. v(1249/78) Simplify (s/(ss(12/11)/s))50 assuming s is positive. s(-50/11) Simplify (j/(jj/(jj(-2/5)j)))18 assuming j is positive. j(54/5) Simplify ((ll(-7)/l)(-17))(-1/7) assuming l is positive. l(-17) Simplify ((y/y(-2/7))/(y/y(3/2)))/(y7yy(1/4)/y) assuming y is positive. y(-153/28) Simplify (q(3/7)/qq1)/(q(2/13)qq(-5)) assuming q is positive. q(389/91) Simplify gg/(g/(g(-1/19)/g))ggg/((g/g(2/21))/g) assuming g is positive. g(1214/399) Simplify (w*(-24)w)(7/2) assuming w is positive. w(-161/2) Simplify (uu(uu(uu(-3/4))/uu)/uu)(-5/6) assuming u is positive. u(-85/24) Simplify (p9)(26/9) assuming p is positive. p26 Simplify (n(2/7))(14/9) assuming n is positive. n(4/9) Simplify (a(-3/5)aaaa(-2/7)a)/(a(-6)/a(1/3)) assuming a is positive. a*(992/105) Simplify (q/(qq(2/7)))(-44)q/(q/(qq/(qqq*(-4/3)qqq)))qqq/(q/q(-5/4)) assuming q is positive. q(979/84) Simplify z/z(-3)z*(-3/8)/z(z(2/7))(-4) assuming z is positive. z(83/56) Simplify ((k/(k1/kk))(-13))(3/7) assuming k is positive. 1 Simplify (yy(-5))21 assuming y is positive. y*(-84) Simplify (nn*8)/(nn(-3/11)) assuming n is positive. n(91/11) Simplify n(-1/4)/((n/(n/n8))/n)(n/(n/n(-2)))(21/4) assuming n is positive. n(-71/4) Simplify (((n/(nnn(-7)/nn))/n)/n(2/7))/(n(-1/2)n((nn(-1/8))/n)/n) assuming n is positive. n(299/56) Simplify (f(2/3)/f6)3 assuming f is positive. f(-16) Simplify ((j(-2/7)j)/j)/jj/j27 assuming j is positive. j(-191/7) Simplify (ww*1w)/w(-3/2) assuming w is positive. w(9/2) Simplify (c/(c*(-8)/c)c(-5))(-6/13) assuming c is positive. c(-30/13) Simplify (x(-1)/x)*(-7/4)xx(-2/9)x(-1/5) assuming x is positive. x(367/90) Simplify ((n/(n/(n1/n)))/n)/(n(11/3)n) assuming n is positive. n(-17/3) Simplify (f/f(22/3))/ff(7/5) assuming f is positive. f(-89/15) Simplify ((n/n(-5))/n)(-12) assuming n is positive. n(-60) Simplify o(14/3)oo(1/21) assuming o is positive. o(40/7) Simplify (u/(uuu*(-1/3)uu))(-13)/(u/u(2/5)u)37 assuming u is positive. u(-368/15) Simplify (ttt*27t)29 assuming t is positive. t870 Simplify p(28/3)/((p/(p(2/9)p))/p) assuming p is positive. p(95/9) Simplify ((k/(k/k(-1/4)))/k)(8/7)k(-2)/k4 assuming k is positive. k(-52/7) Simplify c14cc(-26) assuming c is positive. c(-11) Simplify t(4/3)/t(-21) assuming t is positive. t*(67/3) Simplify (uu/u(-1/3))(1/3)(u/(u(-3/7)u))/uuu(5/4) assuming u is positive. u(619/252) Simplify (ff17f)/(f/f(9/4)) assuming f is positive. f(81/4) Simplify (i/((ii2)/i)i)/(ii5/ii)i(-4)i1 assuming i is positive. i(-9) Simplify (bb(-1/18))4 assuming b is positive. b(34/9) Simplify (g/(g/g(-2/3)))/g18 assuming g is positive. g(-56/3) Simplify (hh(-1/2)/h)(-2)/((h/(hhh(((hh*(-1))/h)/h)/h)hh)/h(-9)) assuming h is positive. h(-11) Simplify (r(-1))(-6/19)r/(rr(-4)rr)rr0 assuming r is positive. r(63/19) Simplify (d(2/25)dd/d(1/15))(-36) assuming d is positive. d(-1812/25) Simplify (g5/g(1/7))(-9/7) assuming g is positive. g(-306/49) Simplify ((a/((a1a)/a))/(a/(a*(-4/7)aa)))(1/34) assuming a is positive. a(3/238) Simplify (r/(r(-9)r))/r19 assuming r is positive. r(-10) Simplify ((s*(-1/3)s)/ss/(s/s(-2/7)))(-9/4) assuming s is positive. s(39/28) Simplify ((ggg/g16g)/(gg/g(2/63)g))(-2/83) assuming g is positive. g(1886/5229) Simplify t*(-11)t/t(-28) assuming t is positive. t18 Simplify p(-6)/p(-1/4)(pppp/(p((pp/(p/(pp(-2/7)/pp))p)/ppp)/p)p)(9/8) assuming p is positive. p(-241/56) Simplify (a1)(-22)/((aa(-9)/a)/a(-7)) assuming a is positive. a(-20) Simplify (t(-2/21)tt(2/9)t)/((t/(t/t(-2/5)))/t4) assuming t is positive. t(2056/315) Simplify v(-7/10)v(10/9) assuming v is positive. v(37/90) Simplify ((rr(-6))/r)(-7) assuming r is positive. r42 Simplify o(3/20)/o18 assuming o is positive. o(-357/20) Simplify ((r*(2/3)/r)/r)/rr/(r/(r/(rrr*3r)))r(1/12)r/r(-2/9) assuming r is positive. r(-217/36) Simplify ((q/(qq(-10)))/qq)/(q/(q/(q/((q/(q(-2/11)/q))/q)))) assuming q is positive. q(112/11) Simplify (y*(-1)/(yy(yy/y*(-7))/y))/(((yy*6y)/y)/(y/(yy/((yy*(1/4))/y)y))) assuming y is positive. y*(-79/4) Simplify ((oo/((o/o*2o)/o))/o)(-20)/(o(-1/5))22 assuming o is positive. o(-178/5) Simplify (a*3a)42 assuming a is positive. a168 Simplify (y/(y*(-18)y)y)/(y(-5/3)/y) assuming y is positive. y(65/3) Simplify ((s(-7/2)/s)/(s/(s/(s(s*18/s)/s)s)))23 assuming s is positive. s(-943/2) Simplify (s(-3))(-43) assuming s is positive. s*129 Simplify d(dd(-2/17))/ddd(-9)/d assuming d is positive. d(-138/17) Simplify t(1/17)/(t(tt/t1)/tt) assuming t is positive. t*(-33/17) Simplify (jjj(2/9)/jj8)/(j(1/3)/(j/(j*(-1/13)j))) assuming j is positive. j(1049/117) Simplify d/d(-5)d/((d(-2/9)d)/d)(d/(d/((dd*(1/4))/ddd)))23 assuming d is positive. d(2123/36) Simplify (c(-1)c*(5/2)c)(13/2) assuming c is positive. c(65/4) Simplify (o*(-1/32)/oo(10/3))(-3/25) assuming o is positive. o(-221/800) Simplify c2/c*(-1/15)c*(-2/17)/ccc(-4) assuming c is positive. c(-523/255) Simplify (c8/(c/c1))/(c7/cc(2/11)) assuming c is positive. c(20/11) Simplify oo(1/4)o*(-2)((ooooo*(-2/15)o)/o)/oo(1/3)o assuming o is positive. o(69/20) Simplify (n/(n(-10/9)n))(-2/41) assuming n is positive. n(-20/369) Simplify (y0/y(-2))/(yyy(2/5))(-1/4) assuming y is positive. y(13/5) Simplify (iii/i23)/(i((i*18i)/i)/ii) assuming i is positive. i(-39) Simplify s5/(ss*(-2))s*(2/3)/ss1 assuming s is positive. s(20/3) Simplify d(-4)/(d/((d/d16)/d)) assuming d is positive. d(-21) Simplify j(-5)/j(2/25) assuming j is positive. j(-127/25) Simplify (z*2zz)/z(-2/15) assuming z is positive. z(62/15) Simplify (gg*(-7))/((g/(g/((gg*(-17))/g))g)/g) assuming g is positive. g11 Simplify (f(1/5)/(ff4))(-21) assuming f is positive. f(504/5) Simplify (c(-27)c)/(c/c*(-2/59)c) assuming c is positive. c(-1654/59) Simplify ((f/f(-3/5)f)/ff)/f((f/(ff*(-2)))/ff)/f assuming f is positive. f(13/5) Simplify n(-7/3)n(2/11)nnn assuming n is positive. n(28/33) Simplify (i(-3)/i**(2/7))	{ "pile_set_name": "DM Mathematics" }
16. Suppose -10 = -vl + 2. Solve -lh + 2n + 5 = 3n, -4n - 16 = p for h. 3 Suppose 16b = 12b + 420. Let u be (b/(-6))/(-7)2. Solve 2k + 19 = -ud - 9, 20 = -d - 4k for d. -4 Let o(y) = -y2 + 5y + 5. Let p be o(5). Suppose c = p - 0, -1 = 4t - 5c. Let u = -1 + t. Solve ud + z + 12 + 8 = 0, 0 = d - 4z - 17 for d. -3 Let j be 220/3332/4. Suppose 5s - js + 35 = 0. Solve -12 = 3x + a, -sx + a = -2x + 20 for x. -4 Let c = -396 - -398. Let t = 3 - 6. Let v = t - -5. Solve -3q = b + 9, cb - 3q - q - v = 0 for b. -3 Suppose 10 = 2s, -5s + 35 - 10 = 2m. Suppose -2c + 5a - 4 = 6, -3c + 5a - 10 = m. Solve -2j - 4k + 26 = 0, 4k - 10 - 6 = c for j. 5 Let a = 1268 - 1264. Solve w = ao + 4, -6w + 11w = 0 for o. -1 Let v = 356 + -353. Solve -vy = -2r - 10, -2y = 3y - 10 for r. -2 Let s(z) = z3 - 26z*2 - 22z - 135. Let l be s(27). Solve l = 4n - 2g - 8, 5n - 9 = 3g for n. 3 Suppose 22k = 7k + 60. Solve 0 = -2l - 6, -5d - k = -l - 2 for d. -1 Let w(l) be the second derivative of l*4/12 + 3l3/2 + l2 + 6l. Let p be w(-9). Let h be (-1)/(-5) - p/10. Solve b - i = -4b - 26, 2b + i + 9 = h for b. -5 Let l = 2140 + -2135. Solve -4r = -2o - 35 + 15, -r + 2o + l = 0 for r. 5 Let f be (4 - -4) + (3 - 8). Solve 0g + 5g = u - 25, fu = -g - 5 for g. -5 Let l(f) = 7f*2 + 2f - 22. Let q be l(2). Solve 15 = 5p + 4w - q, 0 = -4w for p. 5 Let u(h) = -6h + 8 + 5 + 6h2 - 3h - 5h2. Let c be u(10). Let o = c + -8. Solve 3y - 8y - o = -2w, y - 19 = -4w for y. -1 Let r be (1/2)/(4/8). Suppose -r + 7 = 3l. Solve -3j - lp = 20, 0p + p = -2j - 12 for j. -4 Let s = 3987 + -3983. Let m = -5 + 0. Let o = -2 - m. Solve -2h = -sf - 6, 5h = of - 5 - 1 for f. -3 Suppose 2z + 16 = -3y, 15 = -3y - z - 5. Suppose 0 = 2c - 21 + 3. Let r = c + y. Solve 24 = -5w - 4x, w - r = -5x - 10 for w. -4 Let o = -59 + 89. Suppose 4w = 5s + 28, 5s + o = -w + 6w. Solve -2m + 3j + 5 = 0, 3j - 13 = wm + 6j for m. -2 Suppose 3y = 2v + 2v - 351, -2y - 10 = 0. Let o = v - 42. Suppose 6n + o = 114. Solve -4f + 8 = -3q - q, 0 = -2f + 4q + n for f. -2 Suppose 4m = -18x + 178, 8x = -4m + 12x + 68. Let h = -2 + 6. Solve g = -4r - 4, 4r + 6 = hg + m for g. -4 Suppose 80 = 8t + 12t. Solve -2l + 6k = tk - 8, 2l - 14 = 4k for l. 1 Let i = -30 - -38. Suppose -4s = 2b - i, -5s - 12 = -9b + 6b. Solve 3o + 2l + sl = 19, -2o + 2l = 4 for o. 3 Let p be -72-4(-5)/(-15). Let l be 2 - (4/14 + p/56). Solve l = 3a - 5o - 5, 0o = a - 5o - 5 for a. 0 Suppose 0 = -4o + 1 - 25. Let h = 8 + o. Suppose 5g - 24 = 3a, -3 = -3g + 7g + 5a. Solve hs = -gf - 13, 0 = s + 2 for f. -3 Let f = -15 + 26. Solve 2h = 5k + h - 8, 4h + f = -k for k. 1 Let j be 33/9 + 15/45. Solve 2l - 10 = 4n, -jl + 0l + n + 13 = 0 for l. 3 Let t(v) = 2v*2 - 14v + 4. Let a be t(7). Suppose 6h = -ah + 4h. Solve -5x - 2 = -4x + 3n, -3x + 4n - 6 = h for x. -2 Let y = 84 - 82. Solve yd + 3 = -5z - 0, 0 = -3z - 4d - 13 for z. 1 Let z(s) = s*3 - 3s*2 + 2s - 2. Let u be z(2). Let w be u7/(42/(-9)). Solve 3k + 10 = wm - m, -5m = -k + 1 for k. -4 Suppose 2u - 12 + 6 = 0. Suppose f - 2 = -x + 3, -f - 20 = -4x. Let g be (-3 + f)(-2)/u. Solve i - 5i = -d - 8, -i + g = 0 for d. 0 Let d = -20 - -30. Suppose -4z - 4a + 12 = z, 5a = -5z + d. Solve 0f - t = f - 3, 4f - 28 = zt for f. 5 Let b(r) = -r3 + 5r*2 - 2r + 1. Let p be b(4). Suppose 2n - 5n = -p. Suppose -1 - 11 = -ns. Solve 4c - 11 = -0c - 3a, -a = c - s for c. -1 Let m(u) = 7u - 26. Let h be m(4). Solve 0 = 4i + 3x + 9, 0 = -x - hx + 3 for i. -3 Let b = 774 - 772. Solve 0 = -t + 2t + x - b, -1 = x for t. 3 Let t(o) = 75o + 78o + o2 - 161o + 11. Let p be t(7). Solve -5u = -5r + 45, 3r - pu - 8 = 23 for r. 5 Suppose -n - 16 = 2n + 5l, -4l + 2 = -5n. Let h = 9 - n. Solve g - 5v = -h, v - 11 = -4g + 8 for g. 4 Let u = 34 + -30. Suppose -ux - 4 = -3p + p, -2x - 10 = -3p. Let n(z) = z*2 - 6z - 5. Let a be n(7). Solve 5q = -5l + 5, -4l - p - 4 = -aq for l. -1 Let c be 64/24(-8 + 2). Suppose 2i - 77 = v, -173 = -5i + v - 5v. Let l = i + c. Solve 6 = 3o + 5m + 19, -5m - l = o for o. 4 Suppose 4w = 3w - 15. Let u be ((-64)/(-40))/(2/w). Let h = u - -16. Solve -2b - 5 = -t, hb - 6t + 5 = -3t for b. -5 Suppose 5l - 2z = -4z + 21, l = -5z - 5. Let n(i) = i + 6. Let x be n(-5). Suppose 5h + x = 21. Solve 3g = -s + 1, -lg - 9 = -hs - 39 for g. 2 Let u be 23 - (-9 - -1 - -4 - -4). Suppose -5t + 38 = u. Solve 2g - 2 = -ti, g = -4g - 10 for i. 2 Suppose 3l - 3 + 8 = -5g, 4l = 4g - 28. Solve -3b + gb - 4h = -16, 4h - 20 = 0 for b. -4 Suppose -7l = -10l + 12. Suppose 2v - 4q = 20, -34 = -3v - 5q - l. Solve 0 = -2m - n + v, 0 = 2m + m - n - 10 for m. 4 Let r = -2 - -5. Suppose -6a + 3 = -r. Solve 0 = 3g - 2k - 0 + a, 5g - k - 3 = 0 for g. 1 Let j(p) = p2 + 19p + 72. Let b be j(-14). Let d be ((-8)/(-3))/((-6)/(-9)). Solve -2q = -bx - 3 - 11, 3q - 7 = -dx for x. -2 Let b be 4/10 - (-3477)/95. Let k = 40 - b. Solve -u = kh + 2h - 4, 20 = 5u for h. 0 Let m = -12 + 33. Let c = m + -3. Solve 0 = -4u + 2k + c, 5k + 16 = -2u + k for u. 2 Suppose 4g = 4h - 2h - 4, 2g + 2 = -h. Solve h = -5i - x + 28, 0i + 4i = -4x + 32 for i. 5 Suppose -187 = -4x - 171. Solve 0 = xa + a + 4z - 27, 3z = 5a - 6 for a. 3 Let c(v) = -v*2 - 13v + 33. Let l be c(-15). Solve 0 = lz + 3n - 15 - 3, 0 = 5z - 2n + 5 for z. 1 Let o(t) = t*3 - 11t*2 + t - 11. Let z = -24 - -35. Let c be o(z). Solve 2d = m + 6, -5m = -cd + 2d - 18 for d. 4 Let q = 4 - -1. Suppose -k + 4 = -w, 7 = -w - qk + 33. Suppose -g = -1 - w. Solve j = -u, 2u + gj = -u - 2 for u. -2 Suppose 26r - 11r = 60. Solve 2g - 30 = 6k - k, -5k - rg = 0 for k. -4 Let w(f) = -f*3 + 21f*2 + 46f. Let g be w(23). Solve 0 = -b - 3n - 7, -n = -g + 2 for b. -1 Let y(d) = 6d*2 + 3d - 5. Let k be y(1). Solve -z - 4j + k = -5z, 4z = 2j - 12 for z. -5 Suppose 3 = -4s - 137. Let u be 2/10 + (-168)/s. Solve 2o = -3t + 1, -ut + t - 4 = 0 for o. 2 Let r(j) = -6j - 20. Let x be r(-4). Solve i - 1 + 3 = 3w, 4i - xw = -16 for i. -5 Let s(w) = w*3 + 10w*2 + 8w - 4. Let i = -23 - -14. Let o be s(i). Solve 2u + 20 = -2u - 4j, ou - j + 25 = 0 for u. -5 Let k(g) = -g*3 + 9g*2 - 31g + 120. Let u be k(7). Solve 2i - 4f + 3 = 9, 4f = i - u for i. 5 Suppose 2p = -4h + 6, 3h = 5h + 2p. Let r = -844 - -864. Solve -hb + 2o + 10 = 0, 2b - 4o = -0b + r for b. 0 Let j be 1 - (-7 - (-2 - 2)). Suppose m + m = j. Suppose -2f + 6 = 2i + mi, i = 2f - 6. Solve 5l + 10 = -2z, il + 2 = -l + 5z for l. -2 Suppose 0o - 180 = -9o. Let c be 60(-4)/o-2. Solve 0 = 2g + 4s + 8 - c, -s = -g - 7 for g. -2 Let w(r) = r2 + 12r + 29. Let t be w(-12). Solve -25 = -2i - 2a - 9, 4a = -3i + t for i. 3 Let r(b) = -b*2 + 1. Let c be r(-3). Let i = -5 - c. Solve -3h - m + 2 = -2m, 0 = -ih - 4m - 23 for h. -1 Let l(q) = -6q - 173. Let p be l(-32). Solve 0 = -c - 2r - 9, 0c - 5r = -c + p for c. -1 Let n = 18 - 15. Suppose -np = -p + p. Solve 5i = 3j + 1 - p, 5i + 1 = 2j for i. -1 Suppose -25h - 41 = -141. Solve 4q = -4f - 20, -f - f + 4q = h for f. -4 Let l(i) = i + 8. Suppose 2v + 5 + 5 = -4c, -4c + 2v = -2. Let f be l(c). Solve -5j - 2t = -ft - 30, -2t + 23 = 5j for j. 5 Suppose -68j = -76j + 160. Solve -2z - 2q - j = 0, z - 4z - 4q = 35 for z. -5 Let z(x) = -2x*3 - 3x - 2. Let d be z(-1). Suppose 3r - da - 28 = r, -3a = 4r - 74. Solve -3p = -4y + r, 3y + 4p = -7 + 1 for y. 2 Let x = -31 + 41. Suppose 11a - 16a + x = 0. Solve -b = -ac - 12, -b + 9 - 2 = -c for b. 2 Suppose -3f - 17 = -4o - 6f, -3f + 9 = 0. Solve -2d - 3a - 17 = 0, -4 = od - 2a - 2 for d. -4 Suppose 0 = -5i + 15, 5j - 3 - 12 = -5i. Solve -3v = -4b - 12, 5b + jv + 12 = 3v for b. 0 Suppose -16n + 9n + 42 = 0. Suppose 3g - 2g - 4 = 0. Solve 3r - 2 = -y - n, -4y = -gr + 16 for r. 0 Suppose -3s + 7 = 3i - 8, 3i = s - 5. Solve f = 11u - 6u - 9, 0 = 3f - 4u + s for f. 1 Let x(w) = 2w + 2. Let l be x(2). Suppose 4s = t + 5, -4t + 16 = -s + l. Solve -i	{ "pile_set_name": "DM Mathematics" }
-6 + (sqrt(133) + sqrt(133)-3)-6 + sqrt(133))/(-1sqrt(84)/(-6sqrt(972))). 1026sqrt(19) Simplify (((sqrt(168)23 - sqrt(168))/((sqrt(70)-1)/sqrt(10)))/(-3sqrt(128) + sqrt(8) - sqrt(8) - (sqrt(96)/sqrt(3) + sqrt(8))))2. 1/3 Simplify 3 + (((sqrt(255)-3)/sqrt(5))/(-4sqrt(363) + sqrt(363)))2 + -2. 138/121 Simplify 0 + -3((16((sqrt(567) - (sqrt(567) + -3sqrt(567))-6) + sqrt(567) - sqrt(567)))*2 + 3 + 0). -7409565 Simplify (-2sqrt(32))*2-2 + (sqrt(6)/(sqrt(3) - sqrt(12)) - (-3 + 0 + sqrt(2)))*2 + 4 + 0 + sqrt(162) + 1 + 2. -232 - 3sqrt(2) Simplify ((sqrt(275)/sqrt(320))/((sqrt(110)3)/sqrt(10)) + (-4 + sqrt(5) + 0 + 0 - (-4 + -1 + sqrt(320))))2. -167sqrt(5)/12 + 140021/576 Simplify (2 + (sqrt(128) - (sqrt(128) + 3sqrt(128))) + sqrt(10)/sqrt(80))2 + (-3 + -2 + sqrt(2) + sqrt(2) - (sqrt(72)/sqrt(9))/sqrt(4))2. -105sqrt(2) + 9273/8 Simplify ((-1sqrt(343)-4 - (sqrt(343) + 2)-5) + (0 + sqrt(343))-5 + sqrt(343) + sqrt(343) + 2 + 2)*2. 1176sqrt(7) + 12544 Simplify -1 + 1 + (5(sqrt(176)-2 + -2) + (sqrt(176) - (2sqrt(176) - sqrt(176))-4 - (4 + (sqrt(176) - sqrt(176)-1))))2. 784sqrt(11) + 8820 Simplify 3(0 + (-4((sqrt(21)/sqrt(3)-6 - (sqrt(7) - (sqrt(7) + 1sqrt(7) + 4 + sqrt(7)))) + 3))*2). -2688sqrt(7) + 7728 Simplify -3(0 + (0 + sqrt(605)-3 - ((sqrt(660)1)/sqrt(12))/sqrt(11))2). -17340 Simplify (-6(4 + (-1 + sqrt(11))6))2 - (sqrt(22)/(-4sqrt(2)) - ((-3sqrt(77))/sqrt(7))2). -3455sqrt(11)/4 + 14499 Simplify (-3 + sqrt(272) + sqrt(272))4-5 - (((sqrt(85) + -1sqrt(85))-1)/sqrt(5) + 0). -160sqrt(17) + 60 Simplify (-4 + sqrt(1377) + -4 + 1)2 - ((3sqrt(17)-5)2 - ((sqrt(17) + -3 - sqrt(17))2 + 5)). -2385 - 126sqrt(17) Simplify (3(-1 + sqrt(1216) + 0) - ((sqrt(475) + -4 + sqrt(475) + (sqrt(475) - (sqrt(475) - (-2 + sqrt(475) + sqrt(475)))))2 - (0 + 2sqrt(475))))-3. -822sqrt(19) + 22917 Simplify ((sqrt(110) - -3(sqrt(110)-3 + sqrt(110)))-24)/((sqrt(490) - sqrt(490)-2-6) + -3(sqrt(490) - (sqrt(490) + sqrt(490)2 - sqrt(490)))). -5sqrt(11)/7 Simplify (sqrt(1100)-3)/(1sqrt(100) + sqrt(4)) - ((sqrt(77) - (sqrt(77) - sqrt(77)2))-6)/(2sqrt(175) - sqrt(175)). -sqrt(11)/10 Simplify ((-5(sqrt(99) + (-2sqrt(99) - sqrt(99))5))/(-1(sqrt(729)1 + sqrt(9))))2 + 2 + 4. 545 Simplify (-3 + -5(-2 + sqrt(200) + sqrt(200) + 2) - (0 + (sqrt(200) + 2)5 + sqrt(200)-2 + 5))*2. 4680sqrt(2) + 34124 Simplify ((-2 + -4 + sqrt(396)2 + -5 + 1)-2-2)2. -3840sqrt(11) + 26944 Simplify (0 + -4 + sqrt(320)2 + -4 + -1sqrt(320)2-1)*2. -512sqrt(5) + 5184 Simplify 3-2(-5 + ((-1 + sqrt(252))-3 + -4)-33)2. -1102344 - 7776sqrt(7) Simplify (6sqrt(1216)1-2 + 1 + -1 + 1(-1sqrt(1216) + sqrt(1216))-2)*2. 175104 Simplify (-1((sqrt(110)/(sqrt(10)-2) + -4 - sqrt(33)/(sqrt(3)-1-4 - sqrt(3))) + -3) + -3)2. 20sqrt(11)/3 + 851/36 Simplify (1sqrt(2736)-1 + 5 + 2 + sqrt(2736) + -5 + (sqrt(2736) - (sqrt(2736) + -5 - sqrt(2736))) + sqrt(2736) + -2 + -1 + -1)*2. 144sqrt(19) + 10953 Simplify ((-1sqrt(252)-1)/(4sqrt(1089)) + -1 + 4)2. 3sqrt(7)/11 + 4363/484 Simplify ((sqrt(2)-1 + 3 + sqrt(8)/(sqrt(4)2))3 + -4(sqrt(162) - sqrt(162)1)6)*2. -27sqrt(2) + 171/2 Simplify (sqrt(36) + -4(sqrt(36) + sqrt(144)) + sqrt(108)/(sqrt(12)/sqrt(4)))/(sqrt(132)/sqrt(176) - (sqrt(108)-3 + sqrt(108))) + -1. -8sqrt(3)/5 - 1 Simplify 5 + (5(-2(4sqrt(320) - sqrt(320) - sqrt(320)) + (sqrt(45)-4)/sqrt(9)2))*2. 200005 Simplify 6(sqrt(6912) + 1 + sqrt(6912) + sqrt(6912)1 + sqrt(6912)) - ((sqrt(33)/((sqrt(22) + sqrt(88))/sqrt(2)))2 + 0 + -4). 29/3 + 1152sqrt(3) Simplify (sqrt(99) + (sqrt(99) - 6(sqrt(99)-2 + sqrt(99))))/(sqrt(1296)2) + (2 + -4sqrt(1331) + 1)*2. -791sqrt(11)/3 + 21305 Simplify ((sqrt(624) - sqrt(624)-3)-6)/(-4(sqrt(33)/(sqrt(11)4) + sqrt(3)))6. 576sqrt(13)/5 Simplify -2 + ((-5 + sqrt(147) + (-1sqrt(147) - sqrt(147)) + -5sqrt(147)-1 + 3)-3 + -4)*2 + -3. -336sqrt(3) + 21167 Simplify (sqrt(18) - (sqrt(648) + (sqrt(648)-2 - sqrt(648)) + sqrt(648)))/(sqrt(9)-21) - (((sqrt(20)-2)/sqrt(2))/(-6-1sqrt(5)) + -2). -19sqrt(2)/6 + 2 Simplify (((sqrt(32)-2)/sqrt(8)-2)/((sqrt(2) - (-4(sqrt(2) - (sqrt(2) - sqrt(18) - sqrt(2))) + sqrt(2))) + (sqrt(96)/sqrt(3) - sqrt(32)))-1)2 + 0. 1/8 Simplify (((sqrt(36) + (sqrt(36) - sqrt(180)/sqrt(5)))5 + sqrt(36))/(2sqrt(96)))/(3-1sqrt(72) + sqrt(72) + -3(sqrt(72)-2 + sqrt(72) + sqrt(72))). -sqrt(3)/16 Simplify ((sqrt(96)1-11)/((sqrt(128)-1)/sqrt(4))2)2. 12 Simplify (5 + (sqrt(468) - (5 + -2 + sqrt(468))))2 + 0 + (sqrt(832) - 1(sqrt(832) + -5)). 9 Simplify ((-4 + 0 + -2sqrt(192))*2 - 2(-2 + sqrt(192) - sqrt(192))2)-4. -3168 - 512sqrt(3) Simplify -3(-4(sqrt(2299) - (sqrt(2299) + sqrt(2299)2 + sqrt(2299) + -4 + sqrt(2299))))*2 + 3(sqrt(2299) + 1 + -2 + 1)*2. -1759503 + 16896sqrt(19) Simplify (sqrt(280)/(sqrt(8) + sqrt(40)/sqrt(5)) - sqrt(35) - (-2sqrt(140))/sqrt(4))/(sqrt(320)2 + sqrt(40)/sqrt(128)). 6sqrt(7)/65 Simplify (3-2sqrt(171)-4-4)/((-4((sqrt(81)-1 - sqrt(81) - sqrt(81)) + sqrt(81) - sqrt(81)))/(sqrt(144)6)). -192sqrt(19) Simplify (3(sqrt(77) - (sqrt(77) - (sqrt(77) + 1sqrt(77))6)))/(((sqrt(77) + sqrt(77)6 + sqrt(77) - sqrt(77)) + sqrt(77))/sqrt(11)-1). -9sqrt(11)/2 Simplify (2 + -4((-1 + (3 + sqrt(2156) + sqrt(44))2)-4 + 2))*2. 75776sqrt(11) + 2889060 Simplify (sqrt(3024) + 2sqrt(3024) + sqrt(3024) + 6(sqrt(84)/sqrt(4) + sqrt(21)))/((sqrt(84)/(-6sqrt(3)))/sqrt(4)). -360sqrt(3) Simplify (-3 + (sqrt(5) - (-2 + sqrt(5)-3)) + sqrt(500) + 0)2 - (sqrt(495)/(sqrt(18)/sqrt(2) + sqrt(9)))/(sqrt(88)/(sqrt(24)/sqrt(3)))6. -31sqrt(5) + 981 Simplify 3 + ((sqrt(1300) - (5(3sqrt(1300) - sqrt(1300))2 - sqrt(1300)))3 + 1 + (sqrt(1300) + -2 + 2 + sqrt(1300))*2)-5. -300sqrt(13) + 363998 Simplify ((-3sqrt(176) + sqrt(176))1 - sqrt(176))/(1sqrt(400) + 3sqrt(16)/sqrt(4))-5. 30sqrt(11)/13 Simplify (1 + -2 + -3 + sqrt(432) + sqrt(432) + 1sqrt(432) + (sqrt(432) + 0)3 + -3 + 0)2. -1008sqrt(3) + 15601 Simplify ((sqrt(216) - 4(sqrt(216) + 1sqrt(216)))/((-1sqrt(768) - sqrt(768)) + sqrt(768) + sqrt(768) + sqrt(768)))/((6-2sqrt(384) - sqrt(384))-2). -7sqrt(3)/1664 Simplify ((((sqrt(192) + 0)5 + sqrt(192))2 + (1sqrt(192) + -4 - (sqrt(192) + -4 + sqrt(192) + -1 + sqrt(192))))-1 + 4)23. -1440sqrt(3) + 57627 Simplify ((sqrt(396)/(sqrt(12)-2))/(sqrt(6)/(sqrt(8)/sqrt(4) + sqrt(2))) + (sqrt(176) + 1 + -5)*2 + -5)2. -66sqrt(11) + 374 Simplify -6((sqrt(28) + 1)-5 - (sqrt(112)-2)*2 - (3(sqrt(224) - -2sqrt(224)) - sqrt(224))/sqrt(8)). 156sqrt(7) + 2718 Simplify (42sqrt(11) - (-2sqrt(88))/sqrt(8))2 + 3 - ((sqrt(110)2 - sqrt(110))-6 - sqrt(110))/(sqrt(960)/sqrt(6)). 7sqrt(11)/4 + 1103 Simplify -5 + (5 + (sqrt(180) + 3 - sqrt(180)) + sqrt(180) + 3)*22 + -5. 264sqrt(5) + 592 Simplify ((-5 + -6(sqrt(432) + 4 - sqrt(432)))-3)2 + 5. 7574 Simplify 3 + (3-6(sqrt(125) + (sqrt(125) - (sqrt(125) - sqrt(125)2))))*2 + -1 + 3(0 + sqrt(5))-56. -90sqrt(5) + 364502 Simplify 5(sqrt(7) + sqrt(14)/sqrt(2))3 + 1 + -5sqrt(28) + (sqrt(7) - (-6(sqrt(7) + -3 - sqrt(7)))2). -323 + 21sqrt(7) Simplify -4((4 + 0 + sqrt(1008) + -1 - (sqrt(1008) + -5 + (sqrt(1008) - sqrt(1008)2) - (sqrt(1008) + -1)-5)) + -1)2. -65088 + 4608sqrt(7) Simplify (-4 + -1sqrt(1872) - ((sqrt(1872) + -2)5 + sqrt(1872)) - (-1sqrt(130)1)/(sqrt(360) - (sqrt(360)1 - sqrt(360)) - sqrt(10)))2. -5028sqrt(13)/5 + 2283193/25 Simplify -31(3 + ((sqrt(200) - (-1 + sqrt(200) - sqrt(200))) + -3)*21)-3. -360sqrt(2) + 1863 Simplify 2 + 6(sqrt(833) + -1)2 - -3(1(sqrt(1088) + -1) + 1)*2. 84sqrt(17) + 3254 Simplify (5((2sqrt(396)-5)/(sqrt(72)/sqrt(2) + sqrt(9)) + (sqrt(4400) + 3 - (-3 + sqrt(44))-4)))*2. -9600sqrt(11) + 1144625/9 Simplify 2(-6(11sqrt(114)-5)/(2(sqrt(294)1 + sqrt(294))) + 1). 2 + 15sqrt(19)/7 Simplify (((sqrt(136) + -3sqrt(136))6 - sqrt(136)) + (sqrt(136) - -3(sqrt(136) + sqrt(136)3 - sqrt(136))))/((-3sqrt(80)1)/(sqrt(200)/sqrt(5))). 2sqrt(17) Simplify -6-5sqrt(228)/sqrt(768) + ((sqrt(1216)-1 - sqrt(19)) + 3 + -2 + sqrt(19))*2. -49sqrt(19)/4 + 1217 Simplify sqrt(209)/((1sqrt(88) + sqrt(88) - sqrt(88))/sqrt(8))5 - (sqrt(	{ "pile_set_name": "DM Mathematics" }
sequence odul? 1/7752 Two letters picked without replacement from rroookoroorrorjrjr. What is prob of sequence kr? 4/153 What is prob of sequence mz when two letters picked without replacement from {m: 5, z: 14}? 35/171 Calculate prob of sequence nngh when four letters picked without replacement from ngnnygyyvjh. 1/660 Calculate prob of sequence qgu when three letters picked without replacement from uooogoqg. 1/168 Calculate prob of sequence ee when two letters picked without replacement from kkkekkkkekecckkkekke. 1/19 What is prob of sequence lexl when four letters picked without replacement from llxlxlze? 1/70 What is prob of sequence kyyy when four letters picked without replacement from {y: 13, k: 6}? 143/1292 Calculate prob of sequence isii when four letters picked without replacement from {s: 6, i: 12}. 11/102 Calculate prob of sequence aa when two letters picked without replacement from {a: 6}. 1 Three letters picked without replacement from fqsffftqqrsss. What is prob of sequence trs? 1/429 Calculate prob of sequence sf when two letters picked without replacement from {g: 6, y: 3, f: 7, s: 3}. 7/114 Two letters picked without replacement from {a: 10}. Give prob of sequence aa. 1 Calculate prob of sequence up when two letters picked without replacement from fuwfpuwuuuuff. 1/26 What is prob of sequence wc when two letters picked without replacement from {z: 3, h: 2, w: 1, c: 1}? 1/42 Three letters picked without replacement from {r: 2, c: 5, u: 5}. Give prob of sequence uuu. 1/22 Two letters picked without replacement from zvzz. What is prob of sequence zz? 1/2 What is prob of sequence ipib when four letters picked without replacement from {b: 1, l: 2, p: 2, c: 6, g: 4, i: 4}? 1/3876 Two letters picked without replacement from rbuibbbruu. Give prob of sequence ub. 2/15 Four letters picked without replacement from fbbfbbbbbf. Give prob of sequence bbff. 1/20 What is prob of sequence ecm when three letters picked without replacement from {e: 7, c: 4, g: 5, m: 3}? 14/969 What is prob of sequence ljjj when four letters picked without replacement from jjjjjjjjjlljjjjjjjjj? 8/95 Two letters picked without replacement from eenenneeeneeen. What is prob of sequence en? 45/182 What is prob of sequence hlb when three letters picked without replacement from {h: 1, l: 4, x: 3, g: 1, b: 2}? 4/495 Two letters picked without replacement from sscsscscss. What is prob of sequence cs? 7/30 Two letters picked without replacement from hwjuhjcrhhhj. Give prob of sequence cj. 1/44 What is prob of sequence eee when three letters picked without replacement from eebbeeeb? 5/28 Two letters picked without replacement from {p: 3, c: 3, a: 2}. What is prob of sequence ac? 3/28 Four letters picked without replacement from {t: 1, j: 1, g: 2, b: 4, h: 3, r: 1}. Give prob of sequence bbjr. 1/990 Three letters picked without replacement from yhyyzhhhyyz. Give prob of sequence zhh. 4/165 Calculate prob of sequence rjj when three letters picked without replacement from {r: 3, z: 1, y: 2, w: 6, j: 4}. 3/280 Two letters picked without replacement from nnxxxnnnnwssx. What is prob of sequence wn? 1/26 Calculate prob of sequence ele when three letters picked without replacement from elwqeeqllelllleeqwel. 14/285 Calculate prob of sequence ujjj when four letters picked without replacement from {j: 13, u: 3}. 33/280 Two letters picked without replacement from vyyvvvi. Give prob of sequence vv. 2/7 Three letters picked without replacement from eiiygeooggyeoc. What is prob of sequence iyi? 1/546 What is prob of sequence hsh when three letters picked without replacement from {g: 5, h: 2, s: 3, j: 1, x: 1}? 1/220 Calculate prob of sequence eykn when four letters picked without replacement from {n: 2, y: 1, e: 1, k: 1, h: 1, o: 1}. 1/420 What is prob of sequence rrrr when four letters picked without replacement from {j: 8, r: 5, p: 3}? 1/364 Three letters picked without replacement from {f: 5, e: 2}. What is prob of sequence eff? 4/21 Four letters picked without replacement from {x: 6}. What is prob of sequence xxxx? 1 What is prob of sequence ld when two letters picked without replacement from clwddjw? 1/21 Two letters picked without replacement from {k: 1, r: 7, a: 1, h: 5, e: 4, c: 1}. Give prob of sequence ke. 2/171 What is prob of sequence qqqv when four letters picked without replacement from {v: 2, e: 7, q: 4, w: 1}? 2/1001 Calculate prob of sequence go when two letters picked without replacement from ogggggggogogggg. 6/35 Two letters picked without replacement from cwwwccwwww. What is prob of sequence cc? 1/15 Calculate prob of sequence hhhf when four letters picked without replacement from {o: 1, k: 1, v: 4, f: 2, h: 2}. 0 Two letters picked without replacement from {h: 4, d: 3, m: 2}. What is prob of sequence mm? 1/36 Two letters picked without replacement from {q: 17, u: 2}. Give prob of sequence uu. 1/171 Calculate prob of sequence do when two letters picked without replacement from {d: 3, o: 1, e: 1}. 3/20 Four letters picked without replacement from kxpkpppkpkxk. Give prob of sequence kxpp. 5/297 Three letters picked without replacement from pppppkedmee. Give prob of sequence eed. 1/165 Two letters picked without replacement from {x: 8, j: 2}. Give prob of sequence jx. 8/45 Four letters picked without replacement from {i: 3, l: 5}. What is prob of sequence liil? 1/14 Three letters picked without replacement from {m: 6, f: 1, t: 9, x: 3}. What is prob of sequence txt? 12/323 Three letters picked without replacement from nnunu. Give prob of sequence nnn. 1/10 Two letters picked without replacement from mhdammomoaolam. Give prob of sequence ao. 9/182 What is prob of sequence jt when two letters picked without replacement from jztjjjjtjttjjzttj? 27/136 Calculate prob of sequence gs when two letters picked without replacement from {g: 1, b: 4, n: 4, s: 2, l: 5}. 1/120 Three letters picked without replacement from gnsnssvsgvvnsvsvnsg. What is prob of sequence vgn? 10/969 What is prob of sequence iv when two letters picked without replacement from vavaivavav? 1/18 Two letters picked without replacement from sgx. Give prob of sequence gs. 1/6 Calculate prob of sequence nnn when three letters picked without replacement from tntttnnnnnnt. 7/44 Three letters picked without replacement from {i: 7, b: 7}. Give prob of sequence bbb. 5/52 What is prob of sequence yust when four letters picked without replacement from bytsuyl? 1/420 What is prob of sequence vn when two letters picked without replacement from {q: 4, h: 2, p: 1, n: 4, v: 6, y: 2}? 4/57 Two letters picked without replacement from {b: 4, j: 14}. What is prob of sequence bj? 28/153 Two letters picked without replacement from brrrb. Give prob of sequence br. 3/10 Calculate prob of sequence zb when two letters picked without replacement from {v: 2, e: 2, z: 7, b: 1, n: 7}. 7/342 Calculate prob of sequence yml when three letters picked without replacement from {x: 9, m: 1, l: 1, y: 2}. 1/858 What is prob of sequence zbz when three letters picked without replacement from zzb? 1/3 Calculate prob of sequence dyyd when four letters picked without replacement from yyyyyyddyyydyd. 45/1001 Four letters picked without replacement from kgttkeagkggegggyg. Give prob of sequence tete. 1/14280 Four letters picked without replacement from nssfxxfffxfsxmf. Give prob of sequence xfnx. 1/455 Four letters picked without replacement from vvivvvcvcvvvccccvvci. What is prob of sequence vcvc? 77/1938 Two letters picked without replacement from dllllddl. What is prob of sequence dl? 15/56 Calculate prob of sequence rywb when four letters picked without replacement from {r: 1, y: 1, b: 1, t: 1, w: 1}. 1/120 What is prob of sequence bbf when three letters picked without replacement from fbffbbf? 4/35 Four letters picked without replacement from {r: 4, b: 10}. What is prob of sequence rrbb? 45/1001 Two letters picked without replacement from {k: 3, e: 1, l: 1, u: 3, f: 5, g: 1}. Give prob of sequence gf. 5/182 Calculate prob of sequence igii when four letters picked without replacement from ggggggggiggggggigggi. 1/1140 What is prob of sequence kuku when four letters picked without replacement from {q: 2, a: 3, u: 5, k: 3}? 1/143 Two letters picked w	{ "pile_set_name": "DM Mathematics" }
*3 - 15z*3 + 26z*3). -35z*4 Expand -1 - 555n - 678n + 120n + (-6 + 4 + 5)(-2n + 0n + n). -1116n - 1 Expand (7 - f - 7)(269f + 106f - 14f). -361f2 Expand (-3s + 2s + 2s)(21404 + 15188s + 21403 - 42807). 15188s2 Expand (-222m*2 + 222m*2 - 23m*3 + (m - 1 + 1)(m2 - m2 + m*2))(-10 - 1 - 11 + (2 - 3 - 1)(4 - 4 - 1) + 0 - 1 + 0 - 1 - 2 + 1 - 4 + 0 + 3). 528m*3 Expand (-1 - 4 + 3)(-39 - 160 + 30)(1 - 3 + 0)(-l*2 + 1 + 0 + 3l*2). -1352l*2 - 676 Expand (-23w*2 + 32w - 32w)(2w - 2 + 2)(14 + 8 + 27)(-2 + 0 - 2). 9016w*3 Expand (2u + 2u - 3u)(2u*2 - 4u*2 + 4u*2) - 7 + 7 - 4u*3 + (-4u + 3u - u - 3u*2 + 1)(-2u + 3u - 2u). u3 + 2u2 - u Expand ((2 - 2 + j2)(127 - 229 + 116) + (14 + 7j - 14)(-3j + 0j + 2j))(0j - j + 4j)(-2j2 - 2 + 2). -42j*5 Expand 6d*4 - 5d*4 - 2d*4 + (-1 - 2 + 1)(550d3 + 56d*4 - 550d*3) - 5d*4 + 30d*4 + 26d*4 + (3d*3 - 7d*3 + 2d*3)(0d + 3d - d). -66d4 Expand -a3 + 2a*3 + 0a*3 + (-2a*2 + 2a2 - a2)(0 + 0 - 5a) - 18a3 - 23a*3 - 13a3 + (-a2 + 0 + 0)(-4a + 4a + 2a). -50a3 Expand (k + 4 + 19k - 2)((4k + k + 3k)(-1 - 3 + 0) + k + 0k + k). -600k*2 - 60k Expand -51i - 28 + 28 + (1 - 8 + 10)(0 + 1 - 2i + 2). -57i + 9 Expand 5x - x - 2x + (-2x + 4x + 0x)(0 - 1 + 2) + (14 - 6 + 0)(-2x + 4 - 4) - 3x + 11x + 0x + 2 - 2 + x + 3x - 3x + x. -2x Expand (-6i2 + i2 - 3i*2 + (0i2 + i2 - 7i2)(2 + 7 - 5))(-2i*2 + 0i2 + i2). 32i4 Expand (-7s + 17 - 17)(-430s*2 - 145s*2 - s + 68s*2). 3549s*3 + 7s*2 Expand (-18n - 13n + 24n)(-2077n*2 + 2077n*2 - 152n*3). 1064n*4 Expand -24q*5 - 21q*5 + 5q*5 - 3q2 + q5 + 3q2 + 7q*2 - 7q*2 + 4q*5 + (1 - 2 - 1)(-q3 + q5 + q*3). -37q*5 Expand (-31 + 88 + 87)((0 - 5 + 3)(5d - 8 + 8) - d + 0d - d). -1728d Expand ((-3 + 2 - 1)(7 - 2 + 0) + 4 - 4 - 2 + (3 - 1 - 1)(2 + 0 - 3))(6s + 14s - 7s). -169s Expand (4 - 3 + 1)(1 + 1 - 4)(2514 - 5030 + 2516 + 4408t). -17632t Expand 5243 + q3 - 2598 + 297q*2 - 2649 + (3q - 2q2 - 3q)(0q - 2q + q) - 3 + 3 + 2q*3 + 2q*3 + 0q*3 + 0q*3. 7q*3 + 297q*2 - 4 Expand (15k - 5k - 8k + 3)(174 - 79 + 71). 332k + 498 Expand (-3 + 3 + 1)(11b + 173 - 85 - 96) - 2b + b - 5b. 5b - 8 Expand (s - s2 - s)(-2 + 3 + 1) - 2s2 + s2 + 0s*2 + (-s + 0s - s)(3 - 3 - s) - 45s*2 - 61 + 61. -46s2 Expand (j2 - 5j2 + 2j*2)(1995j - 32 + 49 - 2020j). 50j3 - 34j*2 Expand (0w + 1387 - 2w - 1390)(-2 + 2 - 2)(2935w - 1271w - 1467w). 788w2 + 1182w Expand (p3 - p2 + p*2)(-6p + 13 - 13)(-1 + 0 + p + 0) + (3p2 - 3p2 + p3)(243p*2 - 79292 + 79292). 237p*5 + 6p*4 Expand -27 - 59z*2 + 22 + 3 - 2z2 + z2 + 0z2 + z2 + z2 - z2 + (4 - 4z - 4)(-2z + 2z + z). -63z*2 - 2 Expand (2c - 7c + 2c)(1 - 3 + 1) + 0c + 10c + 70c + 21c - 16 + 16. 104c Expand (18h4 - 74 + 30 + 7h*3 - 19h*4)(-4 - 2h + 4). 2h*5 - 14h*4 + 88h Expand (-3j + 3j + j*3 + (-1 + 1 + 1)(87j - 87j + 36j3))(0 + 19 - 4)(0j - 3j2 + 0j) - 4j5 + 5j5 + j5. -1663j5 Expand (1648d*2 - 496d*2 + 480d*2 + 504d*2)(2d - 1 + 1). 4272d*3 Expand (-1 + 2 - 4)(-6m - m - 3m) + 10 - 10 + 13m. 43m Expand (0p - 10p - 5 + 12p)(2 - 5 + 5)(2p + 2 - 2 + 0 + 0 + 2p + (0 + 4 - 2)(3p + 2p - 3p) - 2p + 1 - 1 - p + 2p + p - 1069 + 1069 + 48p). 224p2 - 560p Expand (-2r + 5r + 4r)(-3649r2 + 547r*3 + 3649r*2). 3829r*4 Expand (7u*2 + 12u*2 - 3u*2)(-2 + 6 - u + 3u) + 1 - 2u*3 - 1. 30u*3 + 64u*2 Expand (-12s*2 - 5s*2 - 8s*2)(-2 + 2 + s*2)(2s - 3s + 14 - 38). 25s5 + 600s*4 Expand (-2557o*4 + 2761o*4 + o - 4o)(1 - 1 + o). 204o*5 - 3o*2 Expand (0p*2 + 7p*2 + 0p*2)(-4 + 117p + 12p - 17p) + (5p - 4p + p)(p - 4p + 2p)(-4p + 5p - 2p) + (2p + 0p - p)(-2p*2 + 2p - 2p). 784p*3 - 28p*2 Expand (-32m - 22m + 2m)(2 - 4 + 6)(3 + 2 - 1). -832m Expand (6a + 7 - 1 - 5a)(1175 + 440a + 36a - 1173). 476a2 + 2858a + 12 Expand ((72 - 38 - 44)(3 - 6 + 1) + 3 - 5 - 3 + (2 + 2 - 3)(0 - 1 - 1))(0j3 + j3 + 2j3). 39j*3 Expand -85 + 85 - 17r*5 + (3 + 0 - 5)(-2r4 - r5 + 2r*4) + 159r*3 - 159r*3 + 75r*5 - 13r*5. 47r*5 Expand (7n*3 - 13n + 13n)(-116 - 87 + 49)(-2n*2 - 5n*2 + 5n*2). 2156n*5 Expand (4701z - 1640z - 2375z)(-1 + 1 - 3z). -2058z2 Expand (-496r*3 + 8079r - 8079r)(-46 + 46 - 6r). 2976r*4 Expand (1 - 1 + 10n)(69 - 29 + 117 + 39)(5 - 5 + 1). 1960n Expand (-3 + 5 + 7)(2a - 2a + 3a2)((-5 + 4 + 3)(-2a*2 - a + a) + 0a + 0a - 10a*2). -378a*4 Expand (31a + 41a - 10a)(2a - 3a + 2a) + 22a - 26a*2 - 22a. 36a2 Expand 366v - 74v2 - 366v + (9v + 20v - 13v)(-4v + 5v - 3v). -106v*2 Expand (-3 + 312s + 256s - 383s)(0 + 4 - 2) - 5s + 2s + 4s + s - s - s + (3s + 2s - 2s)(3 + 0 - 4) + 2s - 2s - 2s. 365s - 6 Expand (4 - 3 + 2)(5t - 4t - 2t) + 4t + 2 - 2 + 4439 - 326t + 44t - 4436. -281t + 3 Expand (-9v3 - 11v*3 - 7v*3)(83 - 27 - 16). -1080v3 Expand (8y + 4y - 15y)((6y - 4y - 3y)(-3 + 1 + 0) - 3 + 3 + 4y + 2y - 2y - 4y). -6y*2 Expand (1329h*3 + 2582h*3 + 4766h*3 + 993h*3 + 1554h*3)(-h + 2h + h). 22448h*4 Expand (7391 - 14m - 3742 - 3801)(5 - 4 - 2). 14m + 152 Expand (0 - v + 0)(370 + 168 + 110)(1 - 2 + 3 + (-1 + 0 - 1)(-2 + 1 - 1) + 3 + 4 - 6 + 3 + 1 + 0). -7128v Expand (-5y2 + 4y*2 - 5y*2)(-3y3 - 1 + 1) + 0y*5 - 5y*5 + 4y*5 + 3y*5 - 3y*5 + 2y*5 - 6y5 - y5 + 5y5. 17y*5 Expand (-12 - 2c + 25 + 10)(3c*3 + 0c*3 - 5c*3 + 10c*3 - 19c*3 - 7c*3 + (3 - 5 + 1)(-3c3 + c3 + 3c*3)). 38c*4 - 437c*3 Expand (343r + 328r - 290r)(-3r + r + 4r)(0 + 1 + 1). 1524r2 Expand (-13 + 2 - 11)(-699r - 32 + 355r + 346r). -44r + 704 Expand (12 + 4x - 12)(-5 + 5 - 1) + (-3x - 2x + 0x + (0 + 3 - 2)(-3 - 2x + 3) + 0x - x + 2x - 4x + 2x - x)(3 - 5 - 1) + 1 + 2x - 1. 25x Expand (f*3 - 8f*3 + 3f*3)(-2f + 0 + 0) + (-3f + 3f - f3)(42 - 65f - 42) + f4 - 2f4 - f4. 71f4 Expand (-101 - 68 - 63)(-1 + m - 2m + 0m) - 4m + 3m - m + (-3 + 2 + 0)(m + m - 4m) + 2m - 5m + 2m. 231m + 232 Expand -4f4 + 0f4 + f4 + (-6f + 6f + 6f)(-5f3 - 6f*3 - 2f*3). -81f*4 Expand ((-h + 2h - 2h)(-3h - 3h + 3h) + h2 - h2 + 2h*2)(-55 + 11h + 55)((-2 + 2 - 2)(1 - 1 + h) - 14h - 8h + h). -1265h*4 Expand (5 + 4f*4 - 5)(-4f + f + f) - 3f5 + f5 + 8f5 + (-f4 - f4 + f4)(5f - 7f + 8f). -8f*5 Expand 554v*5 + 3028v*4 - 1508v*4 - 1518v*4 + (4v5 - v5 - 5v5)(-2 + 4 - 3). 556v5 + 2v*4 Expand (-208 - 44 - 49 - 416 - 320)(9 - 10 + 12)(-2n + 0n + 5n). -34221n Expand (5 - 5 - p)((0p + 4p - 2p)(-10 + 10 - 8p) + 228 + 20p*2 - 228) + (5 - 2 + 0)(-4p3 + 0p*3 + 2p*3) - 2p*3 + 5p*3 - 4p*3. -11p3 Expand -w5 - w*5 - 7w*5 + (8909w*2 - 8909w*2 - 30w*4)(3w - w - w). -39w*5 Expand (-307 + 618 - 389)((0r2 + 6r2 - r2)(2r + 0r + 0r) + r*3 + 3r*3 - 10r*3). -312r*3 Expand -7x - 39 + 31x2 + 38 - 1 + (0 + x2 + 0)(2 - 6 + 2) + 0x - x2 + 0x. 28x2 - 7x - 2 Expand (2l2 + 0 + 0)(1 + l*2 - 1 + (-l - 3l - 6l)(13l - 2l + 6l)). -338l*4 Expand (-1 - 2 - 1 + (0 + 2 - 1)(3 + 0 - 2) + (1 - 2 + 0)(4 + 2 + 10))((-5 - c + 5)(-3c*3 - 2c*3 + 4c3) - c4 + 4c4 + 6c*4). -190c*4 Expand (-11f*3 + 27 + 2f*2 + 0f*2 + 12f*3)(-12f2 + 40f*2 + 6f*2). 34f*5 + 68f*4 + 918f*2 Expand (260a - 567a + 7 + 281a)(4a + a - 3a) - 3a*2 + 19a - 19a. -55a*2 + 14a Expand (1428 - 2868 + 1713)(-3 - 2 + 4)(9 - 9 + 10c). -2730c Expand (8 + 2 + 0)(20v*3 + 18v*3 - 46v*3) + 18v*3 - 18v*3 - 12v*3. -92v*3 Expand ((1 + 3 - 2)(-c*3 - 2c*3 + 2c*3) + 261c*2 - 261c*2 + 18c*3)(5 - 5 - 2)(-2c + 5c + 0c)(-3 + 4 + 4). -480c*4 Expand (-4i - 3 + 3)(0 - 1 + 8)(-134 - 211i + 134). 5908i**2 Ex	{ "pile_set_name": "DM Mathematics" }
rt(4) + sqrt(64)))*2 - sqrt(17)). -2sqrt(17) + 2697/400 Simplify -5-3sqrt(175)-1. -75sqrt(7) Simplify (sqrt(13)2 - sqrt(13)) + -5 + sqrt(325)-1. -4sqrt(13) - 5 Simplify 1 + (3sqrt(7) + -3 - (sqrt(350) - sqrt(14))/sqrt(2))*2. 6sqrt(7) + 17 Simplify (sqrt(153)2 + 5)5. 25 + 30sqrt(17) Simplify (-1sqrt(35))/sqrt(5) + sqrt(112) + -1 - (2 + sqrt(63) - sqrt(77)/(2sqrt(11))). -3 + sqrt(7)/2 Simplify -4(-1 + 2sqrt(931)). -56sqrt(19) + 4 Simplify (sqrt(68) - (sqrt(68) - ((sqrt(68) - (sqrt(68) - (2sqrt(68) - sqrt(68))) - sqrt(68))-3 + sqrt(68)) - sqrt(68)))/((1sqrt(16))/sqrt(4)) + -2. -2 + 2sqrt(17) Simplify (-3sqrt(200))/(sqrt(70)/sqrt(28)). -12sqrt(5) Simplify (1 + sqrt(76) + (sqrt(304) - sqrt(304)-1) + 1sqrt(1539) + 1)*2. 76sqrt(19) + 6863 Simplify ((sqrt(363)1 - sqrt(363))3 + sqrt(363)-14)*2. 5808 Simplify (2 + sqrt(704)2)*2. 64sqrt(11) + 2820 Simplify sqrt(18)/(sqrt(18)/(sqrt(15)/sqrt(5)))-4-1. 4sqrt(3) Simplify sqrt(8)/sqrt(4) + 1 - (-6sqrt(2)4 - sqrt(2))2. -1249 + sqrt(2) Simplify 1 + sqrt(833) - (-2sqrt(2057))*2. -8227 + 7sqrt(17) Simplify (sqrt(297)/sqrt(11) + 0)*2. 27 Simplify (sqrt(153)/(-2sqrt(1296)))*2. 17/576 Simplify (-5(sqrt(132) - 2sqrt(132)))/(-2sqrt(972) - sqrt(972)). -5sqrt(11)/27 Simplify sqrt(27)-5 + 1. -15sqrt(3) + 1 Simplify -1 + (sqrt(425) - (-4 + 1 + sqrt(425))) + sqrt(425) + 4 + -1 + sqrt(425). 5 + 10sqrt(17) Simplify (sqrt(17) - sqrt(51)/sqrt(3))*2 + 2 - (sqrt(17)24 + sqrt(17)). -9sqrt(17) + 2 Simplify ((-1sqrt(136) - sqrt(136))4)/(sqrt(648)2 - sqrt(8)). -8sqrt(17)/17 Simplify 4sqrt(52)/sqrt(4) + (sqrt(637) + -1)2. -10sqrt(13) + 638 Simplify (-1 + -4 + sqrt(612) + sqrt(612)1)26. -720sqrt(17) + 14838 Simplify (sqrt(9) - 3sqrt(9))/sqrt(3) + -5. -5 - 2sqrt(3) Simplify (sqrt(10)14)/(sqrt(5) + sqrt(180) + sqrt(180)2 + sqrt(180) + sqrt(5)). 2sqrt(2)/13 Simplify -6((sqrt(357)2 - sqrt(357) - sqrt(357))/sqrt(7))/((sqrt(33)1)/sqrt(11)). 0 Simplify (-3-1sqrt(245)-4)2. 35280 Simplify (-4 + sqrt(19) + 0)5. -20 + 5sqrt(19) Simplify (4 + sqrt(468) + 0)2. 48sqrt(13) + 484 Simplify sqrt(130)/(sqrt(10) - -2sqrt(40) - sqrt(10)). sqrt(13)/4 Simplify -3 + sqrt(20)/sqrt(90) + (-1 + sqrt(2) + -3 - sqrt(24)/sqrt(3)). -7 - 2sqrt(2)/3 Simplify (-4 + (sqrt(832) + 0 + sqrt(832))-1)2. 128sqrt(13) + 3344 Simplify (-3 + -4 + sqrt(72) + 5)*2. -24sqrt(2) + 76 Simplify (-3 + (sqrt(288) + -4)4)2. -1824sqrt(2) + 4969 Simplify ((sqrt(72) + 2 - sqrt(72))*2 + 0)5. 20 Simplify ((sqrt(19) - sqrt(57)/sqrt(3)) + 4)-4. -16 Simplify (3 + -2sqrt(192) + sqrt(192))*2. -48sqrt(3) + 201 Simplify ((sqrt(245) + (sqrt(245) + 1)4 + sqrt(245) - ((sqrt(245) - (1 + sqrt(245))2) + sqrt(245)))-5)2. 12600sqrt(5) + 221400 Simplify (((1sqrt(456))/sqrt(12))/(sqrt(22)/(sqrt(44)/sqrt(4))))2. 19 Simplify (-2sqrt(77)2)/(-5sqrt(33)/sqrt(3) - sqrt(11) - sqrt(11)). 4sqrt(7)/7 Simplify sqrt(1728)-5. -120sqrt(3) Simplify (sqrt(162) + 2)-6. -54sqrt(2) - 12 Simplify (-4 + 1 + sqrt(15)/sqrt(3))2. -6sqrt(5) + 14 Simplify (sqrt(980) - (-1 + sqrt(980))) + sqrt(20). 1 + 2sqrt(5) Simplify (sqrt(171) + -5)2 + 5. -30sqrt(19) + 201 Simplify (sqrt(500) + -3 + -5 + 1)*2. -140sqrt(5) + 549 Simplify (sqrt(153)2 + -4)-5. -30sqrt(17) + 20 Simplify sqrt(128) + sqrt(128) + (sqrt(128)-1)*2 + sqrt(8) + 3. 18sqrt(2) + 131 Simplify -1 + sqrt(152)/sqrt(8) + 3. 2 + sqrt(19) Simplify 5(((sqrt(17) - sqrt(51)/sqrt(3))6)*2 + 5). 25 Simplify 4(-1sqrt(102)2 + sqrt(102))/(sqrt(96)-2 - sqrt(6)). 4sqrt(17)/9 Simplify sqrt(11) + 0 + sqrt(11) + -4 + -4 + -4. -12 + 2sqrt(11) Simplify (sqrt(32) + 1)2 + 1. 3 + 8sqrt(2) Simplify -2(sqrt(448))*2 + 2. -894 Simplify 1sqrt(1900) + 4. 4 + 10sqrt(19) Simplify (-3-2sqrt(42))/(sqrt(24)/sqrt(4)-3). -2sqrt(7) Simplify (sqrt(204) + (sqrt(204) - 6(sqrt(204)-1 - sqrt(204)) - sqrt(204)))/sqrt(12) + -3. -3 + 13sqrt(17) Simplify (-3 + sqrt(12)/sqrt(6))-2-5. -30 + 10sqrt(2) Simplify sqrt(252)41. 24sqrt(7) Simplify sqrt(27)-2-5. 30sqrt(3) Simplify -4(5 + (-1 + sqrt(720))*2). -2904 + 96sqrt(5) Simplify -5(sqrt(7) - 1sqrt(7)1). 0 Simplify ((-1sqrt(5)4 + sqrt(5) - sqrt(5))-3)*2. 720 Simplify 3(sqrt(2057) + -2). -6 + 33sqrt(17) Simplify (-3 + 1 + sqrt(2)-2 + (sqrt(504) - (sqrt(504) + (sqrt(504)2 - sqrt(504)) + sqrt(504) + sqrt(504) - sqrt(504)) - sqrt(504))/sqrt(7))2. 80sqrt(2) + 804 Simplify (sqrt(18) + 3sqrt(162)/sqrt(9))/sqrt(9). 4sqrt(2) Simplify (sqrt(637) + (sqrt(637) + -2(3sqrt(637) - sqrt(637)) - sqrt(637)) - -2-2sqrt(637))2. 31213 Simplify (((sqrt(56)/sqrt(4))/sqrt(2))2 + 0)-3. -21 Simplify (sqrt(63) - sqrt(1008)-2)/(sqrt(9)25). 9sqrt(7)/10 Simplify (sqrt(28)/sqrt(144))2 + -4. -137/36 Simplify 5 + sqrt(5) + (sqrt(720) + 1)2 + 1 + sqrt(80). 29sqrt(5) + 727 Simplify sqrt(396) + -1 + sqrt(66)/(sqrt(6)-2). -1 + 11sqrt(11)/2 Simplify (-4 + sqrt(12)/sqrt(6) + sqrt(2))2 - ((0 + sqrt(98) + sqrt(98))2 - sqrt(2)). -368 - 15sqrt(2) Simplify (sqrt(112)-1 - sqrt(28))/(2sqrt(4)5). -3sqrt(7)/10 Simplify (sqrt(76)/sqrt(4)1 + -1)*2. -2sqrt(19) + 20 Simplify ((0 + sqrt(448))*2 - sqrt(448)) + sqrt(21)/sqrt(48) - (-1 + 1 + sqrt(7) + 1). -35sqrt(7)/4 + 447 Simplify 4(-1 + sqrt(288)). -4 + 48sqrt(2) Simplify (sqrt(156) - (sqrt(156) + 5(sqrt(156) + sqrt(156) + 2sqrt(156) - sqrt(156))))/(sqrt(192)/sqrt(4) + sqrt(48) - sqrt(12)). -5sqrt(13) Simplify sqrt(832) + 1 + sqrt(832) + 3. 4 + 16sqrt(13) Simplify 6(sqrt(209)/((sqrt(132)-3)/sqrt(12) + sqrt(11)))2. 57/2 Simplify ((sqrt(475) - (sqrt(475) + 2)) + -1)2. 9 Simplify -2 + (-2sqrt(152)5)/(sqrt(192)/sqrt(6) + sqrt(8)). -10sqrt(19)/3 - 2 Simplify 5 + (3 + sqrt(52)/sqrt(4) - sqrt(13))-2. -1 Simplify (-1sqrt(847))2 + 0. 847 Simplify (-1 + sqrt(13))-2 - (-2sqrt(13)-2 + sqrt(13))*2. -323 - 2sqrt(13) Simplify sqrt(3) + sqrt(21)/(sqrt(35)/sqrt(5)) + (6(sqrt(3) + -3))2. -214sqrt(3) + 432 Simplify (6sqrt(8) - (sqrt(72)-2)*2) + -5. -293 + 12sqrt(2) Simplify (sqrt(1008) + sqrt(1008) + 3 + sqrt(35)/sqrt(405))*2. 434sqrt(7)/3 + 330352/81 Simplify 4 + (-1 + sqrt(500)2 + sqrt(500) + sqrt(500))2. -80sqrt(5) + 8005 Simplify -4(4 + sqrt(98)). -28sqrt(2) - 16 Simplify (sqrt(490)-1)/sqrt(2). -7sqrt(5) Simplify sqrt(132)/(sqrt(48)/(sqrt(8)/sqrt(2))). sqrt(11) Simplify sqrt(19)-4 + 4 - (sqrt(19) + (-6sqrt(1539))*2). -55400 - 5sqrt(19) Simplify sqrt(84)/(sqrt(60)/(sqrt(10)/sqrt(2))). sqrt(7) Simplify (sqrt(68) - 3sqrt(68)) + sqrt(51)/(sqrt(3)-2). -9sqrt(17)/2 Simplify -2sqrt(1872)/sqrt(4). -12sqrt(13) Simplify -6sqrt(5)-1 - ((sqrt(720) + 1)2 + sqrt(5)). -721 - 19sqrt(5) Simplify -5(sqrt(19) + 2)1. -5sqrt(19) - 10 Simplify (1sqrt(20) + 5(-1 + sqrt(5)))2. -70sqrt(5) + 270 Simplify 2 + 5-4-1sqrt(19). 2 + 20sqrt(19) Simplify (-2sqrt(280)/sqrt(5))/(6sqrt(16)/sqrt(2)). -sqrt(7)/3 Simplify (-5(sqrt(1188) + sqrt(33) + sqrt(33)))/sqrt(11). -40sqrt(3) Simplify (sqrt(2000)1)/(-4sqrt(20)/sqrt(2)). -5sqrt(2)/2 Simplify ((-3sqrt(192))/sqrt(12))/(4sqrt(72)). -sqrt(2)/4 Simplify (sqrt(114)/(sqrt(6) - sqrt(18)/sqrt(3) - sqrt(6)) + -2)2. 4sqrt(19) + 23 Simplify -4 + ((-2 + sqrt(7) - sqrt(7)) + 4)4. 4 Simplify (2sqrt(450) - sqrt(450))/(-4(sqrt(6) - sqrt(54))). 5sqrt(3)/8 Simplify (sqrt(110)-3 + sqrt(110))/sqrt(10) + sqrt(11) + (sqrt(176) + 1 + sqrt(11))2. 9sqrt(11) + 276 Simplify -4(-6sqrt(110)/sqrt(90)5)2. -4400 Simplify ((-6(sqrt(190) + sqrt(190) + sqrt(190)-2) - sqrt(190) - sqrt(190) - sqrt(190)) + sqrt(190))/(sqrt(30)/sqrt(3)-2). sqrt(19) Simplify (-3sqrt(36))/((sqrt(12) + (sqrt(24)/sqrt(2) - sqrt(12)))/sqrt(6)). -9sqrt(2) Simplify (3sqrt(153)/sqrt(9))2 + (sqrt(102)2)/sqrt(6). 2sqrt(17) + 153 Simplify (-1 + sqrt(832)-2 + -2)*2. 96sqrt(13) + 3337 Simplify (sqrt(1584)3-6 + sqrt(1584) - 4-3sqrt(1584))*2. 39600 Simplify 0 + sqrt(832)1 - sqrt(832). 0 Simplify (sqrt(25)/sqrt(5) + -2)2 + ((sqrt(55) + (sqrt(55) - sqrt(110)/sqrt(2)))/sqrt(11))2. -4sqrt(5) + 14 Simplify 1 + sqrt(13) + (sqrt(13) - (sqrt(156) - sqrt(156)-1)/sqrt(12)) + sqrt(13). 1 + sqrt(13) Simplify 2(-3 + sqrt(3))-3. -6sqrt(3) + 18 Simplify (sqrt(360)/sqrt(54))/(sqrt(432)5). sqrt(5)/90 Simplify 2*(0 + sqrt(50	{ "pile_set_name": "DM Mathematics" }
r + 0r - 4r)(-r*2 - 3r*2 + 3r*2) - 1744r*3 - 11868r*3 + 2030r*3). 23158r*3 Expand 19s - s + s + (-5 + 5 - 3s)(2 + 0 - 6). 31s Expand (17u - 34u2 - 17u)(50 + 9u*2 - 50)(0 + 4 - 2). -612u4 Expand -1090x + 1090x + 51x*4 + 2x*3 - 6x*4 - 2x3 + x4 - x*4 + 2x4 + (-x2 - 2x2 + 5x*2)(0x - 2x*2 + 0x). 43x4 Expand (-5x + x + 2x + 0x + 0x - 2x + (-2x - 3x + 3x)(-2 - 2 + 7))(5 - 5 - 2x*2) - 33x + 4x3 + 33x. 24x3 Expand (2z - 3z + 0z)(1 + 0 + 1) - 180z - 211z + 431z - 8. 38z - 8 Expand (3 - 3 - 2b)(-2 + 1 - 1) + 0b - b + 0b + 17b - 17b - 7b + (6 + 2 - 3)(0 - 3 + 2)(5b - b - b) - 2b + 0 - 2 - 1. -21b - 3 Expand (2 - 1 - 3)((907 - 907 - 6t)(3t3 + t - t) - 21t*4 - 29 + 29) + 0t*4 + 3t*4 - 4t*4. 77t*4 Expand (-83 - 67 - 87 + 58)((-m - 5m + m)(1 + 1 + 0) - 3m + m + 4m + 3m - 3m + 3m). 895m Expand (56c3 + 81c*3 + 16c*3)(2c + c - 2c)(-4 + 4 + 2). 306c*4 Expand (-1 + 1 - 2u)(-1 + 2 + 1) + u - u - 3u + (23929 - 13299 - 13224)(3 - 3 + 2u). -5195u Expand (-5397r*2 - 45 - 47 + 92)(-3r + 2r - r). 10794r3 Expand 5127 + 80a - 5125 - 3a + (-3 + 4 + 1)(-6a + 19 - 19). 65a + 2 Expand -4 - h*2 + 4 + (1 + 0 - h - 3)(-824h + 429h + 397h + 2070). -3h*2 - 2074h - 4140 Expand -16 + 74810c - 74808c + 14 + 3217c2 + (-2 + 2 - 2c*2)(0 - 3 + 2). 3219c2 + 2c - 2 Expand (0p2 - 4p*4 - 4p*2 + 2p*4)(1231 + 1228 - 2469). 20p4 + 40p*2 Expand (43 - 43 - 34t)(5t + 4t - t)(2 - 2 + 2). -544t2 Expand (3 - 1 - 1)(-30 + 30 + 76h) + (7 - 28 - 22)(-3h + 2h + 2h). 33h Expand 206b2 + 49372 - 49372 - 2b*2 - 3 - 3b*2 + 3b*2 + (-1 + 2b + 1)(-3b + 2b - b) + 2b*2 - 3b*2 + 3b*2. 202b*2 - 3 Expand -52m*5 + 0m*5 + 8m*5 - 3m5 + m5 + m*5 - 2m*5 + 4m5 - m5 + (3 - 2 + 0)(1 + m5 - 1) - 3m*5 + 6m*2 - 6m*2. -46m5 Expand (-2 + u2 + 2)(2u - 3u + 0u) + (u + u + u)(7u*2 + 15u*2 - 11u*2) + 36u*2 - 250u*3 - 36u*2 - 25u*3. -243u*3 Expand (3i*2 - 2i*2 - 3i*2)(-257i2 - 362i*2 - 1164i*2). 3566i*4 Expand (-2t + 5 - 5)(81 + 1232t - 81 + 3872t). -10208t*2 Expand ((-2 - 5 + 1)(-15 + 7 - 8) - 6 + 3 + 1)(0o - o*3 + 0o). -94o3 Expand (-m - 4m + m)(-116m + 239 + 157m - 241). -164m*2 + 8m Expand (0 - 4 + 1)(-1 + 2m + 1) - m - 1535 - 503 - 750. -7m - 2788 Expand ((32q*3 - 16q*3 - 121q*3)(-2 + 4 - 4) + 10 - 10 + 3q3)(-1 + 2 - 3). -426q3 Expand 13 - 13 + 10f*2 + (-23f - 30f + 229 - 235)(-2f + 4f + f). -149f2 - 18f Expand (q - 3q + 0q + (-8 + 0 + 13)(2 + 2q - 2))((-2 + 5 - 1)(-1 + 1 + q) - q + 7q - 4q - 19q + 6q - 6q). -120q*2 Expand -99955d*2 - 102698d*2 + 194854d*2 + (2d + 1 - 1)(-d + 0d - d). -7803d2 Expand -4s + 5s - 5s + (-1 - 2 + 2)(2841s + 3716s - 302s). -6259s Expand 1217 - 1217 - 22z*3 - 2z*3 - 5z*2 + 5z*2 + (z + 0z - 2z)(-4z2 + 2z*2 + 3z*2) + (5z + z - 5z)(-z*2 + 4z2 - z2). -23z3 Expand (2v - v + 0v)(3v + 3v - 4v) + 4v*2 - 2v*2 + 0v2 + 1 - 1 + v2 + 4639v + 2 - v2 + 4662v - 9190v. 4v*2 + 111v + 2 Expand (-4m + 0m + 0m)(-188086 + 377m4 + 188086 + (-2m + 0m + 4m)(2m3 + m3 - 4m3) + m4 + m4 - 3m*4). -1496m*5 Expand ((4 + 3 - 5)(5 - 4 - 2) - 1 - 1 + 3)(552 - 552 - 63d)(3 - 1 + 1). 189d Expand 157n2 + 33n*2 + 41n*2 - 3n - n*2 + 3n + (0n + 2n - 3n)(2n - 3n + 2n) - 13n*2 + 7n*2 + 2n2 + n2 + n*2 + 0n*2. 227n2 Expand ((k3 + 0k3 + 0k*3)(-10k - 11k + 8k) + 13k*2 - 13k*2 - 40k*4)(6k - 3k - 2k). -53k5 Expand -m3 + 0m2 + 0m*2 + (m - 3 + 3)(2m2 + 3m*2 - 3m*2) + (-6m - 17m - 24m)(-11m*2 + 3m*2 + 93m*2). -3994m*3 Expand (3 - 5 + 3)(4 + 0 - 2)(0o + o - 4o)(-458 + 78 - 1088). 8808o Expand -3h*3 - 7h2 + h3 - 4h4 + 6h*2 + (h + 0h + 2h)(-6h3 + h3 + 3h*3) - 45 + 45 + 17h*4. 7h*4 - 2h3 - h2 Expand (8a + 3a - 5a)(1633a2 - 67a*3 - 3268a*2 + 1632a*2) + 3a*4 + 4a*3 - 4a*3. -399a*4 - 18a*3 Expand 2h2 + h2 - h*2 + (-3h - 2 + 2)(-873h - 874h + 1749h - 6)(-7 - 2 + 3). 38h*2 - 108h Expand (-2d + 1 - 1)((2d + 3 - 3)(5 - 10 - 9) + 4 - 4d - 4). 64d*2 Expand (8 - 8 - 4l)((4l - 2l + l)(2 - 2 - l) + (7 + 6 - 3)(1 - 1 + l2)). -28l*3 Expand -6n*5 + 4n - 4n + (-80n*4 - 90n*4 + 30n*4)(2n + 3n - 3n) + 6n*5 - 6 + 3 + 2. -280n*5 - 1 Expand (-1 + 1 + 3l*2 + (-4 - 2l*2 + 4)(-2 - 1 + 1) - 8l2 + 4 - 4 + l2 - 6l*2 + 2l*2)(4 - 5l3 - 4). 20l*5 Expand (-2w*2 - 3w + 4w - w2)((6w - 2w - w)(-16w + 23w + 32w) + w*2 - 5 + 5). -354w*4 + 118w*3 Expand 3m*5 - 4m + 4m + (2m - 3m - 6m)(10m - 3m + 9m)(0m*3 + 0m3 + m3 + (0 + 3 - 2)(2m*3 + 3m*3 - 6m*3) - 4m*3 + 3m*3 + 3m*3). -221m*5 Expand (-2 + 5 - 2)(-3 + 3 + 2l + (3 - 5 + 3)(l - 3l + 4l)) + 4l + l + 3l - 7 + 2 + 7 + 21l. 33l + 2 Expand (8g - 8g - 6g)(-g - 3g + 3g) + (65g2 - 10g*2 + 16g*2)(-3 + 6 - 2). 77g2 Expand (-3a - 3 + 2a + 1)(-205 - 334 - 537 + 90). 986a + 1972 Expand (-7 - 4 - 3)(-2d + 4d - 3d)(-1978 - 1217 + 1317 - 2915). -67102d Expand (2 + 0 - 3)(2830c2 - 20002c*2 - 4793c*2 - 10863c*2). 32828c*2 Expand (-4t + t + 4t)(-6807 + 1509 + 44152 + 26380 + 11366 + 39946). 116546t Expand (-21 + 56 + 140)(74m - 158m - 30m). -19950m Expand -4f2 + f2 + 0f*2 + (f + 2 - 2)(176f + 49f + 519f) - f2 - f2 + f2 + (0f - f + 0f)(0f + 4f - 3f) + 0f*2 + 3f*2 - 4f*2. 738f2 Expand -y2 + y*2 + 9y*2 + (3 + 2 - 3)(-1 + 1 - 2y2) + 20y*2 - 28y*2 - 23y*2 + (-2 + 0 + 3)(-4y - y2 + 4y). -27y2 Expand (-2 + 3p - p - 5p)(352 - 72 + 112 + 8). -1200p - 800 Expand 2o2 + o2 - 5o2 + (3o - 4o - 2o)(2o + 0 + 0) + 39o2 - 215o*2 - 208o*2. -392o2 Expand (p4 - 2p2 - 2p*2 - 39p*3 + 5p*2)((0 + 1 - 2)(-5 - 1 + 4) + 2 - 1 + 1 + 6 - 1 - 2 + 4 - 3 + 1)(3 + 3 + 1). 63p4 - 2457p*3 + 63p*2 Expand 8b + 3 - 3 + (-39 + 107 + 23)(b + 2b + b). 372b Expand (2k - 4k - 515 - 391 + 3k)(-2k + 3k - 2k)(-11 - 4k*3 + 11). 4k*5 - 3624k*4 Expand (2379 + 2v*2 - 2379 - v - 20v*3)(5v - v - 3v)(-5 - 8 + 4). 180v*4 - 18v*3 + 9v*2 Expand ((-2 + 2 - 1)(3i + 5i - i) - 2i - i + 5i)(-5780i + 5780i + 222i*4). -1110i*5 Expand (-3u*3 + 5u*3 + 0u*3)(-21 + 80 + 39)(-6 - 2 + 0). -1568u*3 Expand (-13 - 49t + 6 + 7)((-3t*2 - 8t*2 + 4t*2)(t2 - t2 + t*2) - 5t + 5t + 4t*4). 147t*5 Expand (331c + 301c - 656c)(8 + 18 - 7). -456c Expand -w*2 + 2w - 2w + (0w + 3w - 2w)(-4w + 2w + w) + 15w - 10w - w2 + 7w*2. 4w*2 + 5w Expand (-2g + 4 + 4 - 5)(-1 + 3 - 4)(-4 - 1 + 2) - 69g + 5g - 4g. -80g + 18 Expand (-i + 2i - 6i)(-i4 + i3 + 0i4 + 2i*3) + (-2i + 1 - 1)(4i*4 + 4i*3 - 4i*3) - 3i*5 + 5i*5 - 4i*5. -5i*5 - 15i*4 Expand (0h*3 - 2h*3 + 0h*3)(2h2 + 3h - 3h) - 8h*3 + 6h*3 - 2h5 + h5. -5h5 - 2h*3 Expand (-89 + 168 - 77 + 89g + (0g - g + 0g)(-2 + 3 + 1))(-119 + 119 + 15g2). 1305g*3 + 30g*2 Expand 2g2 + g2 - 4g2 + (4g - 2g - 4g)(0g - 2g + 0g) - 2g2 - 3g*2 + 9g*2 - 44g*2 - 16g*2 + 4g*2. -49g*2 Expand ((0 - 2 - 1)(-4 + 3 - 1) + 902 + 202 - 403)(-1 + 1 + d). 707d Expand 5b3 - 4b*3 - 3b2 + b3 + 2b + (0b - 4b + 0b)(-14b*2 - 4b*2 - 3b*2). 86b*3 - 3b*2 + 2b Expand (7 + 4 - 2)(-2535q - 47q2 + 2535q). -423q2 Expand (-1 + 7 - 4)(-2 + 2 + l) - 2l + 4l + l + (-l + 3l + 0l)(10 - 5 + 5). 25l Expand (-388b + 228b + 728b)(3 + 1 + 0). 2272b Expand (2y*2 + 4y2 - y2)(4 + 3 - 3)(-8 - 2 + 0) - 2y - 3y2 + y2 - 3y2 + (2y + 3y - 4y)(-1 + 1 + 2y). -203y2 - 2y Expand (-3105o + 685o - 509o)(0o2 + 2o*2 - 4o*2). 5858o*3 Expand 0f*3 + 24f*3 + 4f*3 + (-7 - 2 + 0)(3f - 3f - f*3). 37f*3 Expand (-3c*2 - 1 - 2c - 11c2 + 0)(-1 - 3 + 8) + (-1 + 3 - 4)(3c2 + c2 - 2c2) - 10c*2 + 7c -	{ "pile_set_name": "DM Mathematics" }
= -7 + 2, -5w - 2v = -u. Calculate the remainder when 12 is divided by w. 2 Let x(c) = 4c2 + 2c + 3. What is the remainder when x(-2) is divided by 13? 2 Let q(d) = -8d + 1 + 0d2 - 1 - d2 - 1. What is the remainder when 17 is divided by q(-7)? 5 Let i(l) = -l*2 - 3l + 4. Calculate the remainder when 7 is divided by i(-3). 3 Suppose -2c + y + 84 = 0, 0c + 5c - 5y - 220 = 0. Calculate the remainder when c is divided by 3. 1 Suppose 6j - j = 375. Suppose 0y + 38 = 2y. Suppose -n + j = 5q, 4n + 17 = 4q - y. What is the remainder when 26 is divided by q? 12 Let t = 147 + -94. Let r be (-6)/21 - (-1054)/14. Suppose 5v - r = 5b, 0 = -2v + 4b + 4 + 28. What is the remainder when t is divided by v? 11 Suppose 3v - 5p = -58, 0p = -2v - 5p - 22. Let h = v + 30. Calculate the remainder when 27 is divided by h. 13 Suppose -k + 56 = 3k. Let j = 30 - k. What is the remainder when 45 is divided by j? 13 Let n(v) = -34v + 1. Suppose x = 4x - 12. Suppose -l - 5 = xl. What is the remainder when n(l) is divided by 18? 17 What is the remainder when (48/2 - 2) + 2 is divided by 7? 3 Suppose -4z + 35 = -3z - 5c, -5c = -3z + 155. Suppose 3o - z = -2o. Let n(x) = 2x2 - 2x - 5. Calculate the remainder when n(5) is divided by o. 11 Let l(g) = g*3 + 7g*2 + 5g + 2. Calculate the remainder when 89 is divided by l(-4). 29 Suppose c = -0c. Suppose c = -k + 2k - 5. Let t = -12 + 25. What is the remainder when t is divided by k? 3 Suppose -h = 2h. Suppose 2s + 8 = t, ht - 2s = 5t - 40. Suppose -p = 4z - 3, -2p = -2z + 7 - 43. What is the remainder when p is divided by t? 7 Suppose j - 119 = -6j. What is the remainder when 45 is divided by j? 11 Let a = 38 - 17. Let t = a + -46. Let r = t - -35. What is the remainder when 28 is divided by r? 8 Let f = 33 - -9. Suppose -5j + f = -2j. Calculate the remainder when 54 is divided by j. 12 Let n = 0 - -4. Suppose 0 = -nu - 57 + 181. Calculate the remainder when u is divided by 8. 7 Suppose r = -5g + 28, 2r + 3g - 5g = 56. Suppose r = 2l - 2o, -4o + 64 = -2l + 6l. Let v = -18 - -26. Calculate the remainder when l is divided by v. 7 Suppose -u + 25 = -4y, 2y + 53 = 3u + 2u. Suppose -5x + 5 = -j - 6, 0 = x - 3. Calculate the remainder when u is divided by j. 1 Let y(l) = 5l - 7. Let h be (-2)/(-3)(7 - -2). Calculate the remainder when 45 is divided by y(h). 22 Suppose 11 = 2q - 0q + x, 5 = -5x. What is the remainder when 16 is divided by q? 4 Suppose -s - 3s + 3j + 18 = 0, s + 2j + 1 = 0. Let o be (2/s)/((-1)/(-75)). Let v = o + -19. Calculate the remainder when v is divided by 11. 9 Suppose 5u + 0d + 2d = 211, -d = -3u + 120. What is the remainder when u is divided by 11? 8 Calculate the remainder when 90 is divided by 8/52 - -18(-99)/(-78). 21 Let g = 57 - 52. Calculate the remainder when g is divided by 2. 1 Let x be 4/29/(-2). Let q = -4 - x. Suppose 2l - 4z = -2l + 28, 4l - z = 34. What is the remainder when l is divided by q? 4 Let f(a) = a*2 - 6a - 6. Let j be f(10). Suppose -4k + j = q, -2q + 0q - 28 = -4k. Let r = 3 + 2. What is the remainder when k is divided by r? 3 Let z = -4 + -4. Let u(k) = -k*3 - 9k*2 - 8k + 4. Let x be u(z). Calculate the remainder when 66/x - (-2)/4 is divided by 6. 5 Suppose 4g - 5g + 4l = 5, -4g + 2l = -8. Suppose s + gn + n = 7, -28 = -4s - n. Calculate the remainder when 13 is divided by s. 6 Suppose -748 = -3s - 0s + 2d, 2d = -5s + 1236. Suppose -4n + s = -0n. Calculate the remainder when n is divided by 21. 20 Suppose 35 = -4z - 85. Suppose -2c + 7c = v + 7, 1 = v - 3c. What is the remainder when v is divided by 12z/(-12)? 3 Let j(o) = o*3 + 8o*2 + 6o - 4. What is the remainder when j(-6) is divided by 7? 4 Suppose 6y - 385 = y - 3u, -u - 385 = -5y. Calculate the remainder when y is divided by 10. 7 Suppose -2h = 2u - 46, 5u - 3h = 77 + 38. Suppose 4v = l - u, -2v - 13 - 76 = -3l. Calculate the remainder when 91 is divided by l. 29 Let z(a) = -3a3 - 3a*2 - 2a + 2. Let h be z(-2). Suppose h = y - 0y. What is the remainder when y is divided by 10? 8 Let l(y) = 7y + 2. Let i be l(5). Let u = i + -13. Calculate the remainder when u is divided by 13. 11 Let d(f) = f*2 + 7f + 17. Calculate the remainder when 67 is divided by d(-7). 16 Suppose 0u - 2u + 32 = 0. What is the remainder when 28 is divided by u? 12 Suppose 4w + 3m = 74, 9m + 10 = 4m. Calculate the remainder when 37 is divided by w. 17 Let t(m) = m*3 + 6m*2 + m - 5. Calculate the remainder when t(-4) is divided by 9. 5 Suppose -4 = -3m + m. Suppose -mt - 3t = -30. What is the remainder when (-4)/(-20) + 54/5 is divided by t? 5 Let a = -47 - -53. Calculate the remainder when 39 is divided by a. 3 Let l(t) = t*2 + 6t - 2. What is the remainder when l(-10) is divided by 14? 10 Suppose 0 = -2d - 4c + 72, 3c - 2 + 14 = 0. Suppose -5t - 5i = -65, 0 = -5t + 2i - 21 + 100. Calculate the remainder when d is divided by t. 14 Suppose 3f = -3c + 2c + 35, 5 = f - 3c. Suppose -f = -2r + 23. Let a(n) = -50n3 + n2 + 2n + 1. Calculate the remainder when a(-1) is divided by r. 16 Let t = 14 + -7. What is the remainder when (-1)/(-2) - (-357)/14 is divided by t? 5 Let y = -25 + 38. What is the remainder when y is divided by (0 + -6)(-2)/3? 1 Suppose 2l - 3 = -3n + 4, 1 = 3l - 5n. Let k(i) = -3i - 1. Let t be k(-1). Suppose -ty - 3 = -3y. Calculate the remainder when y is divided by l. 1 Let d be (-6)/(-4)(-4)/6. What is the remainder when (0/2)/d + 68 is divided by 23? 22 Let u = -13 + 33. Calculate the remainder when u is divided by 7. 6 Let u(m) = -m3 - 8m*2 - 5m + 4. Calculate the remainder when 131 is divided by u(-8). 43 Let y(v) = -10v - 32v - 37v. What is the remainder when y(-1) is divided by 27? 25 Suppose 5q - 4q = 0. Suppose i + 35 = 5k + 5i, -4k + 3i + 28 = q. What is the remainder when k is divided by 4? 3 Let b be ((-3)/(-2))/(8/(-16)). Let y = b + 5. Suppose 0r - yr = -20. What is the remainder when r is divided by 6? 4 Let z = -104 + 182. Calculate the remainder when z is divided by 20. 18 Suppose -3u = 2z - 52, z = -3u - 2u + 89. Let i = 120 - 67. What is the remainder when i is divided by u? 17 Let t(m) = 14m*2 + 45m - 2. Suppose 2h - 29 = -j, 3j + 3 = -2h + 30. What is the remainder when t(-4) is divided by h? 12 Let i = 14 - 20. Let c = -4 - i. Let u = 6 + c. What is the remainder when 22 is divided by u? 6 Let t = -21 + 40. Calculate the remainder when 94 is divided by t. 18 What is the remainder when 105 is divided by (8/(96/9))/(1/48)? 33 Suppose 2w + w = 0. Suppose w = 4f + k - 30, 2f - 4k + 1 = f. Calculate the remainder when 40 is divided by f/(3/6 + 0). 12 Let j be (-9)/6 - (-1)/2. What is the remainder when j/(-1) + -2 - -3 is divided by 1? 0 Let q(n) = n3 - 6n*2 - 12n + 4. Let g be (8 - 7) + 1 + -1. Suppose g + 7 = o. What is the remainder when q(o) is divided by 19? 17 Let m = -5 - -7. Suppose -4j + 4f = 0, -3j + mf + 0 = -3. Suppose 5o - 40 = 3v, 16 = o - 4v + 5v. Calculate the remainder when o is divided by j. 2 Let q = 8 + -3. Suppose 70 = -qu + 225. Calculate the remainder when u is divided by 16. 15 Let p be 2 - ((-3)/3 - -1). Let k be -1 + p + -2 - -64. Suppose 2y + k = 5g + 6y, -y = 4g - 46. What is the remainder when g is divided by 4? 3 Let f(m) = -7m - 2. Suppose g - 2g + 7 = 0. Let i = -9 + g. Calculate the remainder when 23 is divided by f(i). 11 Suppose -2h + 3q - 5 = 2, 4q = -3h + 15. Let d = 3 - 1. Suppose -3n + 1 = -dn. What is the remainder when h is divided by n? 0 Let m = 12 - 10. Suppose 3x = h + 2x - 10, -mh + 25 = 3x. What is the remainder when 20 is divided by h? 9 Suppose -3l = -5v - 237, v = l - 3l + 171. Calculate the remainder when l is divided by 17. 16 Let r(q) = -q*2 - 7q - 10. Let a be r(-5). Suppose a = -c, h + 3h - 8 = 3c. Calculate the remainder when h is divided by 1. 0 Let j(m) = m*2 - 13m - 8. Calculate the remainder when 35 is divided by j(14). 5 What is the remainder when 6((-76)/(-3))/4 is divided by (-3 + 5)/((-1)/(-5))? 8 Suppose 0 = 3l - 2h - 64 + 18, -5h = -2*l + 49. Let b = l + -17. Let z = 10 + b. Calculate the remainder	{ "pile_set_name": "DM Mathematics" }
Let o(n) be the second derivative of f(n). Let a(p) = 3p. Determine o(a(u)). 99u*2 Let o(f) = -f - 4. Let p(c) = -3c + 39. Let s be p(12). Let n(m) = sm2 - 2m*2 - 5m*2 + 3m2. Determine o(n(v)). v2 - 4 Let c(d) = -d. Let f(a) be the second derivative of 0 + 1/3a3 - 35a + 0a2. Determine c(f(w)). -2w Let l(q) be the third derivative of -q*5/20 - 7q*3 - 137q*2. Let x(y) = 2y. Determine x(l(v)). -6v2 - 84 Let b(d) = 43d*2. Let j(l) be the first derivative of -988l*3/3 + 7. Let s(c) = 91b(c) + 4j(c). Let a(g) = -2g. Give s(a(r)). -156r2 Let m(h) = -2h. Let z(w) be the third derivative of 2w5/15 + 5w*2 + 21. What is z(m(i))? 32i*2 Let f(y) be the first derivative of -5y*3/3 - 4. Let w(u) = -u - 1. Let d(g) = g + 6. Let c(h) = d(h) + 6w(h). Calculate c(f(l)). 25l2 Let k(r) = 19r. Let c(h) = 5774h. Give c(k(z)). 109706z Let p(j) = 3j2 - 2j*2 - 2j*2. Let i(u) = 2u*2 - 5u. Let l(k) = -13k2 - 6k + 0k + 15k*2. Let s(q) = 6i(q) - 5l(q). Give s(p(n)). 2n*4 Let p(r) = -7r + 18r - 14r - 6r. Suppose -2v + 25 = 5. Let a(j) = j + 11j - vj. Give a(p(c)). -18c Let m(p) = -9p*2 + 3. Let q(j) = 44j*2 - 15. Let a(k) = 11m(k) + 2q(k). Let d(v) = -3v. Calculate d(a(t)). 33t2 - 9 Let o(f) = 9f. Let h(a) = -2a2 + 485a + 6. Give h(o(n)). -162n2 + 4365n + 6 Let i(y) = 9y - 1. Let p(u) = -73u - 2u2 + 24u + 27u + 22u. Calculate i(p(c)). -18c2 - 1 Let l(t) = t + 4. Let p(x) = -3x - 11. Let i(f) = -11l(f) - 4p(f). Let b(u) = u + 1. Let k(d) = -133d - 114. Let h(c) = 114b(c) + k(c). Calculate h(i(s)). -19s Let q(o) = 2o + 217. Let j(d) = -29d - 3. Let f(s) = 19s + 2. Let h(z) = 6f(z) + 4j(z). Determine h(q(a)). -4a - 434 Let d(c) = -27c*2. Let z(t) = 3t. Let u be z(-3). Let f be u/28/(-18). Let y(n) = -nf + 294n - 294n. Give d(y(p)). -27p*4 Let u(g) = 18g. Let a be 3 + (0 - (0 - -1)). Let s(x) = 0x2 - 4x2 + x2 + x*a. Give s(u(y)). -648y*2 Let r(n) = -10n*2 - 12. Let g(y) = -177y*2 - 2. What is r(g(w))? -313290w*4 - 7080w*2 - 52 Let a(l) = 2l*2 - 33. Let z(x) = 16x*2 - x + 6. What is z(a(c))? 64c*4 - 2114c*2 + 17463 Let q(c) = 5c*2. Let u(i) = 5i*2 - 4i + 2. Let m be u(1). Let d(k) = 27k. Let b(f) = -9f. Let y(j) = md(j) + 8b(j). Give y(q(h)). 45h2 Let q(f) be the third derivative of f5/60 - f2. Let p = -92 + 94. Let t(l) = -4l*2 - 11l*p + 10l*2. Determine q(t(i)). 25i*4 Let y(k) = -168k + 3. Let s(u) = 340u - 5. Let i(v) = 6s(v) + 10y(v). Let f(z) = 2z. What is f(i(h))? 720h Let x(j) = -j2. Let c = -76 - -76. Let q(b) be the first derivative of -1 - 1/2b*2 + cb. Calculate x(q(v)). -v2 Let g(r) be the third derivative of r5/30 + 23r3/6 - 15r*2. Let u(y) be the first derivative of g(y). Let b(z) = 2z*2. Calculate b(u(n)). 32n2 Let r(h) be the third derivative of h5/60 - h*2 + 9. Let i(f) = 2f - 10f + 0f. Give r(i(n)). 64n2 Let a(m) be the first derivative of 3m*2/2 - 1. Let k(l) = -8l + 11. Let c = 22 - 16. Let n(b) = -4b + 6. Let j(d) = ck(d) - 11n(d). Give j(a(w)). -12w Let w(y) = -46y. Let a(k) = -2k - 353. Determine a(w(u)). 92u - 353 Let o(a) = -5a*2 - 6a*2 + 13a*2. Let w(k) = -253k. What is w(o(u))? -506u2 Let i(a) be the second derivative of -a4/6 + 75a. Let z(v) = -v*2 - 5v. Calculate z(i(x)). -4x4 + 10x*2 Let l(m) = 2m*2. Suppose -5s + 2s + k + 5 = 0, -4k + 10 = 3s. Let n(g) be the first derivative of 13/2g*s + 5 + 0g. Determine n(l(j)). 26j2 Let r(x) = 58x - 25x + 90x + 69x. Let z(k) = -2k*2. What is z(r(j))? -73728j*2 Let r(x) = 5x - 241 + 241. Let g(h) be the third derivative of 0 + 2h2 + 1/6h*4 + 0h*3 + 0h. Calculate r(g(c)). 20c Let b(v) = -399v. Let o(g) = -4g2 + 20. Let k(n) = 9n*2 - 50. Let m(j) = 2k(j) + 5o(j). Determine m(b(l)). -318402l*2 Let v(p) = 9p. Let k(z) = 45z + 5. What is v(k(o))? 405o + 45 Let d(w) = 3w - 35. Let a(k) be the third derivative of -k5/60 + 118k*2. Determine d(a(j)). -3j*2 - 35 Let v(t) = t. Suppose -5y + 1 = -3p + 43, -4p + 2y + 70 = 0. Let l be 3 + (-9)/3 + p. Let d(a) = -a - l + 2a + 19. Calculate d(v(n)). n Let n be (5/10)/(3/36). Let v(a) = -n - 2 - 32 - a*2 + 2. Let l(d) = -2d*2. Give l(v(j)). -2j*4 - 152j*2 - 2888 Let s(f) = -f - 102. Let m(p) = 16p. Determine s(m(k)). -16k - 102 Let x(y) = -488y*2 + 176. Let m(l) = 2l. Determine x(m(i)). -1952i2 + 176 Let h(d) = 10d*2 - 981d. Let r(l) = -4l. Calculate h(r(a)). 160a*2 + 3924a Let x(v) = -63v2. Let d(y) = -2214y. Give d(x(j)). 139482j2 Let p(i) be the second derivative of 3/2i*3 + 0 + 0i*2 + 31i. Let j(d) = 2d2. Determine j(p(f)). 162f*2 Let d(z) be the third derivative of 11z*4/4 - 28z*2. Let g(v) = -v. Give d(g(x)). -66x Let k(x) = 49x2 - 11x. Let d(b) = 29b. What is k(d(n))? 41209n*2 - 319n Let s(p) = -2p2. Let m(v) = -17v*2 - 34v. Let n(f) = 11 + f + 19 - 30. Let q(y) = -m(y) - 34n(y). Give s(q(r)). -578r*4 Let q(x) = -11x*2. Let i(n) = 36n*2 - 2n - 6. Give i(q(l)). 4356l4 + 22l*2 - 6 Let d(s) = -8s*2. Let z(a) = 10a + 7. Let f(j) = j + 1. Let k(i) = 3i. Let w(r) = 6f(r) + k(r). Let n(o) = 7w(o) - 6z(o). Give d(n(t)). -72t2 Let z(w) = 26 - 49 + 23 - 4w*2 - 4w2. Let q(r) be the second derivative of r3/3 - r. Give z(q(a)). -32a2 Let m(l) = -5l - 1848 + 1848. Let p(r) = 6r + 1. Calculate m(p(t)). -30t - 5 Let m(p) = 12p2 + 21. Let l(z) = -3z*2 - 5. Let a be (3/6)/(-3 + (-375)/(-126)). Let x(y) = al(y) - 5m(y). Let w(q) = 3q*2. Give x(w(u)). 27u*4 Let z(t) be the first derivative of 2t*2 + 104. Let k(l) = 20l*2. What is k(z(s))? 320s*2 Let o(a) = -2a. Let g(j) be the second derivative of -159j4/4 + 9j + 25. Calculate g(o(i)). -1908i2 Let r(h) = h2 + 2h*2 - 7h*2. Suppose -3b = -4b + 4. Let k(n) = b + n - 4. Calculate r(k(f)). -4f*2 Let c(g) be the first derivative of -5g*3/3 + 9. Let t = 0 - -2. Let l(k) = -5k*2 + 5k*2 - 2k*t. Give c(l(z)). -20z*4 Let u(d) be the third derivative of 0d*3 + 6d*2 + 0 - 11/24d*4 + 0d. Let g(a) = -a. Let t(o) = -5o. Let l(y) = 22g(y) - 4t(y). What is u(l(b))? 22b Let n(f) = 83f + 5. Let x(o) = 50 + 65 + 3650o + 104. Let s(k) = -219n(k) + 5x(k). Let p(g) = -g*2. Calculate s(p(v)). -73v*2 Let v(l) = 2l. Let f(o) = -4o + 4o + 1019 + 29o2 - 1017. What is v(f(z))? 58z2 + 4 Let s(g) be the first derivative of g2/2 + 3g + 46. Let l(h) = h. Give s(l(k)). k + 3 Let s(l) = -10530 - 5l + 3l + 10530. Let o(a) = -11a + 1. Give o(s(q)). 22q + 1 Let k(u) = -3u2. Let m(b) = -b2 + 2b - 2. Let s(p) be the first derivative of -1/2p*2 + p - 8. Let o(c) = m(c) + 2s(c). Give k(o(j)). -3j4 Let i(o) = 11o*2 - 6o. Let g(v) = -31v2 + 17v. Let k(b) = 6g(b) + 17i(b). Let f(w) = 150w2. Calculate f(k(s)). 150s*4 Let h(p) = -2p*2 - 5. Let v(n) = -8740n. Give v(h(q)). 17480q2 + 43700 Let b(h) = 2h. Suppose 0 = -16m + 4m + 60. Let w(o) be the third derivative of 0 + 0o3 + 5/24o*4 + 0o - mo2. Give w(b(p)). 10p Let x(f) be the third derivative of 1/6f4 + 0 + 6f*2 + 0f + 0f3. Let w(c) = -5c*2. What is x(w(t))? -20t*2 Let g(a) = -4a - 11a + 12a - 9a - 10a. Let j(b) = -20b2. Calculate g(j(z)). 440z*2 Let x(h) = -3h - 3. Let f(q) = 678q. Give f(x(z)). -2034z - 2034 Let j(s) = 5s2 + 20603 - 20603. Let b(a) = 29a. Determine b(j(q)). 145q2 Let v(p) = -1691045p*2. Let z(c) = c. Give z(v(j)). -1691045j*2 Let d(c) = -8c*2 + 11c + 22. Let k(q) = -3q2 + 4q + 8. Let y(v) = -4d(v) + 11k(v). Let x(b) = -6b - 12. What is x(y(l))? 6l*2 - 12 Let m(f) = 244f*2 + 2f + 2. Let r(b) = 19b2. Determine m(r(t)). 88084t*4 + 38t*2 + 2 Let v(b) = -12b*2 + 3b - 9. Let s(j) = 12j. Give v(s(d)). -1728d*2 + 36d - 9 Let t(a) = 6a. Let h(k) be the first derivative of 34k*3/3 - 26. Determine h(t(f)). 1224f*2 Let q(r) be the first derivative of 1 + 2/3r*3 + 0r*2 + 0r. Let g(m) = -13m. Calculate g(q(o)). -26o*2 Let c(g) be the third derivative of 47g*5/60 - 131g*2. Let a(d) = 6d. What is c(a(b))? 1692b*2 Let r(b) =	{ "pile_set_name": "DM Mathematics" }
- 7/6c3 + 0 + 2c + 1/360c6. Let y(u) be the second derivative of v(u). Give y(6). -6 Let g = -49 - -22. Let b be (16/12)/((-6)/g). Suppose -2 = 4w + b. Let v(k) = -2k2 + k - 1. What is v(w)? -11 Let z(c) = c3 + 3c*2 + 5. Let j be 9/(-6) + (-9)/6. Let l(u) = -u + 6u*2 + 7u2 + 2 + u3 - 11u2. Let f be l(j). Give z(f). -11 Let l(p) = p - 1. Let x(i) = -2i - 1. Let c(o) = 3l(o) + x(o). Calculate c(7). 3 Suppose -2w = 5d - 26, -d - 4 = -2d. Let j(i) = 2i2 + 9i - 6. Let a(f) = 2f2 + 14f - 7. Let x(k) = 2a(k) - 3j(k). What is x(w)? -11 Let z(r) = 5r + 3 + 2 + 6r*2 + 10r*2 - 17r*2. Calculate z(5). 5 Let o(q) = -q + 2q - 2q + 4. Let v be (-4 + 3)/(2/4). Let k(j) = j3 + j2 - 1. Let i be k(v). What is o(i)? 9 Let k(p) = 13p2 + p. Suppose f + f + 42 = 0. Let a = f - -20. What is k(a)? 12 Let r(q) = -q2 + 2q + 2. Let s = -43 - -48. Suppose 4v = -st - 18, -3v + t - 6 = v. What is r(v)? -6 Suppose 0 = 704l - 695l. Let z(y) = y - 15. Give z(l). -15 Suppose 0 = -6y + 13y - 77. Suppose 0x = -2x + 4. Let q(f) = -3fx - f3 + 11 - y + 2f. Calculate q(-3). -6 Let y(o) = 10o - 45o*2 + 5 + 0 + 16o - 22o + 47o2. Calculate y(-2). 5 Let j(w) = w2 - 4w + 1. Let d = -148 - -82. Let a = 72 + d. Calculate j(a). 13 Let h(o) = -4o*2 + 11o + 17. Let t(c) = 5c2 - 12c - 19. Let p(d) = -7h(d) - 6t(d). What is p(-5)? -30 Let h = 47 + -45. Let c(f) = -2f2 + 5f*2 - 8fh + f2 + 4f - 5 - f3. Let t be -7 + (0 - 2/(-1)). Give c(t). 0 Let q(d) = -d2 - 12d - 23. Let j(v) = 4v2 + 35v + 70. Let f(i) = -2j(i) - 7q(i). Give f(16). -11 Let f(r) = -8r - 52. Let m(i) = -7i - 45. Let g(y) = -6f(y) + 7m(y). Give g(7). -10 Suppose 79f = 80f + 6. Let m(i) = -i*2 - 6i + 6. Give m(f). 6 Let b(p) = p - 3. Let z be b(3). Suppose -n - 21 = -4k - zn, 5k + 5n - 45 = 0. Let d(x) = -x*2 + 4x + 1. What is d(k)? -11 Let m = -21 - -127/6. Let h(u) be the second derivative of -3/2u2 + mu*4 + 1/3u*3 + 0 - 12u. Give h(2). 9 Let b(v) = v*2 - 6v - 5v2 + 0v*2 + 5v*2. Give b(6). 0 Let j(s) = 3s + 5. Let z be j(-4). Let c(r) = 0r + 0 - 2r + r - 4. What is c(z)? 3 Let j(v) be the second derivative of v5/20 + v4/3 - 7v3/6 + 7v*2/2 + 3v + 18. Calculate j(-6). -23 Let w(s) = s*2 + 14s + 16. Let q be w(-13). Suppose -2b = 2k + 3k + 10, -qb - k = -11. Let z(l) = -2l - 5l*2 + bl - l - 1. Determine z(1). -4 Suppose 4m - z = -0z + 18, m - 1 = 2z. Let a(q) = -q2 + 3q*3 - 2q + mq - 22 - 4q - 4q3. Determine a(0). -22 Let n(l) = 5l*3 - 16l*2. Let o(g) = 3g*3 - 10g*2. Let p(t) = -5n(t) + 8o(t). Determine p(1). -1 Let t(x) be the third derivative of x7/5040 + x6/180 - 4x*5/15 - 14x2. Let r(g) be the third derivative of t(g). What is r(-6)? -2 Let t(i) be the second derivative of -i5/20 - i*4/3 + 7i3/6 - i2/2 + 3i - 26. Calculate t(-5). -11 Let w be (9/(-24))/((-1)/8). Let t(n) = -7n + 27. What is t(w)? 6 Let d(c) = 3 - 2c + 2c + 8c - 5c. What is d(6)? 21 Let v(p) = 2p2 + p2 + 3p*2 - 4p*2 - 1 + 0. Give v(-1). 1 Let c = -8 + 4. Let l(d) be the first derivative of 3d*2/2 + 2d - 1464. Determine l(c). -10 Let x(f) = 48f - 91f + 18 + 44f. Determine x(-18). 0 Suppose 2m + 2h = 0, -2h - 5 = -5m + 16. Suppose mr - 12 + 49 = -5a, -a - 1 = -r. Let b(g) = 0g + 3 - 5g - g2 + g. Determine b(r). 3 Let u be (-18)/(((-2)/4-4)/(-1)). Suppose 14x + 30 = ux. Let n(d) = -d*2 - 5d + 5. Determine n(x). -1 Let f(b) be the third derivative of b*5/60 - 11b*4/24 - 5b*3/6 + 508b*2. What is f(12)? 7 Let f(z) = -5z*2 - 2z*2 - 3z*2 + 14z*2 - 4z + z*3 - 9 - 5z. Calculate f(-6). -27 Let c(m) be the second derivative of -m*5/20 - 7m4/12 - m3 + 5m2/2 + 102m. Give c(-6). 5 Let y(b) = -2b2 - 3b + 6. Let p be (6 - 6) + 2 + -5 + 4. Let u(t) = t*2 - t - 1. Let n(h) = py(h) + 3u(h). Give n(4). -5 Let a(v) = -7v*3 + 7v*2 + 9v + 2. Let q(d) = -9d3 + 7d*2 + 10d + 3. Let h(t) = 5a(t) - 4q(t). Give h(-6). 4 Suppose 0 = 4z + 12 - 8, 0 = 5r - 4z - 29. Let s(x) = -2x*2 - x - 9. Let c(g) = -3g*2 - 3g - 17. Let k(t) = -3c(t) + 5s(t). Calculate k(r). 1 Suppose 0 = 4x - 5i - 23 - 3, 0 = -2i + 4. Suppose xh = 7h. Let z(p) = -p2 + p - 1. Give z(h). -1 Let z(j) = j - 1. Let x = 146 - 154. Give z(x). -9 Let q(j) = 18j*2 + 181j + 16. Let a be q(-10). Let s(h) = h*3 - 7h*2 + 6h + 5. Let o(z) = 1. Let f(l) = -2o(l) + s(l). Determine f(a). 3 Let x(u) = -u2 + 4u - 7. Let a(n) = n + 1. Let d(q) = -3a(q) - x(q). Calculate d(6). -2 Let k(d) be the second derivative of d5/20 - d4/2 - d3/2 + 6d*2 - 2d - 1. Give k(6). -6 Suppose -213 - 2 = -43k. Let a(c) = c3 - 6c*2 + 4c + 6. Give a(k). 1 Suppose -3q - 5p = -1 - 24, -2q - 5p + 10 = 0. Let f = -9 + q. Let c(o) = -3o - 3. Let x(y) = 4y + 4. Let r(n) = 7c(n) + 5x(n). What is r(f)? -7 Let g(f) be the first derivative of -f*2 + f - 116. Determine g(11). -21 Suppose 0 = -4n + 2n + 6. Let b(d) = -20d - 23. Let k(p) = -7p - 8. Let a be ((-3)/(-2))/(9/24). Let g(t) = ab(t) - 11k(t). Determine g(n). -13 Let z(i) = -6 + i + 0i + 0i. Let k = -22 - -38. Let b = 16 - k. Give z(b). -6 Let k(m) = m3 + 5m*2 - 6m - 4. Let p(a) = 3a3 + 14a*2 - 17a - 11. Let h(b) = -17k(b) + 6p(b). Suppose 0 = 26f - 31f. Determine h(f). 2 Let t(c) = -3c - 3 + 0 + 4. Let a(v) = v3 - 15v*2 - 50v - 70. Let f be a(18). Give t(f). -5 Let g(i) be the third derivative of i6/120 - i5/30 - i4/6 + i3 - 11i2 - 5i. Calculate g(4). 22 Let o = 13 + -4. Let i be -7 + (-2)/((-6)/o). Let j(a) be the third derivative of a4/24 - a3/3 - 4a2. Calculate j(i). -6 Let g(f) = f + 3. Let k be g(-4). Suppose 6d + 45 = 15d. Let u(l) = 4l*2 + 189 - 190 + dl*2. What is u(k)? 8 Let c(b) = -7b + 2. Let v(g) = 10g - 2. Let i(l) = 4c(l) + 4v(l). Calculate i(6). 72 Let u(t) = -t3 - 5t*2 - 1. Let x(j) = -j - 2j*2 + 8j*2 + 2j - j*3 + 4j + 9. Suppose k + 18 = 2f + 4, -2k = 0. Let m be x(f). Give u(m). -1 Let d(s) = 7s. Let h be (-84)/21 + (15 - -1). Suppose k - 4 = -5j - 16, -3j = 3k + h. What is d(k)? -14 Let s(n) = -6n + 2. Let v(b) = -5 + 4 - 1 + 0 + 5b. Let r(f) = 6s(f) + 7v(f). What is r(-4)? 2 Let a(p) = -p*3 - 6p*2 + 3p + 6. Suppose 4m = -4o + 12, -4o + o + 9 = m. Suppose -oh - 26 = -2n, 3n - 7 - 17 = 2h. What is a(h)? -12 Let w(o) = o + 13. Let l(h) = -31h + 232. Let u be l(8). Give w(u). -3 Let l be (-42)/16 - ((-444)/96 + 5). Let o(b) = -2b3 - 6b*2 + 2b - 3. Calculate o(l). -9 Let q(v) = -v*3 + 5v*2 - 4v + 5. Let x be q(4). Let a(s) be the first derivative of s*4/4 - 2s*3 + 3s*2 + 4s - 12. Calculate a(x). 9 Let k(b) = -b + 4. Let p be k(-4). Let n = p + -5. Let i(a) = -n - 7a - 3a + 4a + a. Give i(-2). 7 Let y(t) = t3 - t - 1. Let u(i) = -3i*2 + 3i + 2. Let c(m) = u(m) + 2y(m). Suppose 4 = 2q - 0. Give c(q). 6 Suppose -2r - 5 = g - 5r, 0 = -r + 4. Let n(f) = 0f2 - 6f*2 + gf*2 + 7f - 1. Let d be 45/(-6) - (-1)/2. What is n(d)? -1 Let u(l) = -2l. Suppose -55 = 2k + 9k. Let t be k/(4 - -1) - 3. Determine u(t). 8 Let g(b) be the third derivative of -b5/60 - 5b*4/24 - 4b*3/3 + 114b2. Calculate g(-6). -14 Let t(n) = -n + 31. Let a be t(0). Let l = a - 26. Let r(s) be the third derivative of -s5/60 + 5s4/24 + 5s*3/6 + 4s*2. Give r(l). 5 Let o(p) = -3p*3 - 19p*2 - 25p + 31. Let x(j) = -14j3 - 74j*2 - 100j + 124. Let b(h) = -9o(h) + 2x(h). Determine b(24). -7 Let t(x) be the third derivative of -x6/120 + x5/10 - x*4/3 + 5x*3/6 + 35x*2 + 2x. Determine t(5). -10 Let t(s) = 1117 - 1117 + 9s. Calculate t(-2). -18 Suppose h - 3g + 20 = 0, 4g + 48 = -5h - 52. Let m be (-50)/h28/10. Let r(p) = p3 - 8p*2 + 8p + 1. Determine r(m). 8 Let c(g) = 1 + 0g + 7g*2 - 5g + 6g. Suppose -6r + 4 = -3r + 2f, 3r + 6 = 3f. Suppose -5i = r, -w + 2w - 3i + 1 = 0. Determine c(w). 7 Let o = 525 - 527. Let f(l) = l3 - 4l - 3. What is f(o)? -3 Let x(h) = -h*2 - 4h + 6. Suppose -123v = -131v + 16. Give x(v). -6 Let o(m) be the second derivative of -m4/4 - m3/2 - m*2/2 - m. Suppose -4 = -4q + 3*p, 127 - 133	{ "pile_set_name": "DM Mathematics" }
ut replacement from {t: 5, o: 3}? 1/56 Calculate prob of picking 2 v and 1 g when three letters picked without replacement from gggvgvvgvgg. 14/55 Two letters picked without replacement from vpu. Give prob of picking 1 v and 1 u. 1/3 Calculate prob of picking 1 m, 1 v, and 2 b when four letters picked without replacement from {b: 2, v: 1, q: 1, m: 2}. 2/15 Calculate prob of picking 4 b when four letters picked without replacement from {b: 7, i: 3}. 1/6 Calculate prob of picking 1 n, 1 r, 1 p, and 1 e when four letters picked without replacement from {c: 7, n: 1, r: 1, e: 2, t: 4, p: 4}. 2/969 Two letters picked without replacement from {z: 1, i: 7, u: 6, t: 5}. What is prob of picking 1 t and 1 z? 5/171 What is prob of picking 2 y and 1 e when three letters picked without replacement from {k: 3, n: 5, g: 1, a: 3, e: 1, y: 2}? 1/455 Calculate prob of picking 3 x and 1 h when four letters picked without replacement from xxgxgvggmhghmxgm. 2/455 Two letters picked without replacement from {x: 5, k: 9}. Give prob of picking 2 x. 10/91 Three letters picked without replacement from jjcjvuivviiijjicj. Give prob of picking 1 c, 1 v, and 1 j. 9/170 Three letters picked without replacement from jjxqtttlxtttltzlx. What is prob of picking 1 j and 2 x? 3/340 Two letters picked without replacement from vvvvv. What is prob of picking 2 v? 1 Two letters picked without replacement from {c: 6, a: 1, b: 8}. What is prob of picking 1 c and 1 b? 16/35 What is prob of picking 1 z and 2 v when three letters picked without replacement from {b: 2, z: 2, v: 4}? 3/14 Two letters picked without replacement from uuuuuuuuuxuu. Give prob of picking 2 u. 5/6 Three letters picked without replacement from kikiki. Give prob of picking 1 i and 2 k. 9/20 Calculate prob of picking 2 e and 1 j when three letters picked without replacement from jjejee. 9/20 What is prob of picking 4 j when four letters picked without replacement from jjjjjjjjjj? 1 Two letters picked without replacement from {z: 3, r: 1, j: 1, v: 5}. Give prob of picking 2 v. 2/9 Four letters picked without replacement from {d: 5, n: 1, q: 11, t: 2}. Give prob of picking 1 d, 2 t, and 1 q. 55/3876 Calculate prob of picking 1 f and 1 q when two letters picked without replacement from tlotylltllftttyq. 1/120 Calculate prob of picking 4 c when four letters picked without replacement from {c: 9}. 1 Three letters picked without replacement from papfcaapapccccp. Give prob of picking 1 p and 2 a. 6/91 Two letters picked without replacement from {t: 1, e: 1, u: 1, l: 5, j: 2}. What is prob of picking 1 u and 1 l? 1/9 Two letters picked without replacement from bbjbwjbwbbbwwjwjbj. What is prob of picking 1 w and 1 j? 25/153 Calculate prob of picking 1 u and 1 n when two letters picked without replacement from {s: 2, n: 1, u: 2, m: 4}. 1/18 Calculate prob of picking 1 y, 1 z, and 1 g when three letters picked without replacement from {c: 1, w: 1, g: 2, z: 3, y: 1, t: 3}. 2/55 Three letters picked without replacement from {p: 1, g: 2, u: 2, h: 1, z: 4}. Give prob of picking 1 p, 1 g, and 1 z. 1/15 Four letters picked without replacement from pugfdnn. What is prob of picking 1 d, 1 f, 1 n, and 1 u? 2/35 What is prob of picking 1 g and 1 z when two letters picked without replacement from gogollooobooizgli? 3/136 Calculate prob of picking 1 g and 1 z when two letters picked without replacement from zggg. 1/2 Calculate prob of picking 4 z when four letters picked without replacement from {u: 1, z: 6, i: 3, r: 3, f: 1}. 15/1001 What is prob of picking 1 p and 3 e when four letters picked without replacement from pppppepepepepppppppp? 64/4845 Two letters picked without replacement from {n: 2, v: 3, o: 1, f: 1, c: 3, w: 1}. Give prob of picking 1 v and 1 o. 3/55 Calculate prob of picking 2 p, 1 h, and 1 c when four letters picked without replacement from {r: 1, p: 8, k: 1, c: 4, h: 1}. 16/195 What is prob of picking 2 v and 1 j when three letters picked without replacement from varqagvj? 1/56 Calculate prob of picking 1 m, 1 u, 1 l, and 1 x when four letters picked without replacement from rxclumm. 2/35 Two letters picked without replacement from ohtoo. What is prob of picking 2 o? 3/10 What is prob of picking 4 w when four letters picked without replacement from {m: 6, c: 2, w: 7}? 1/39 What is prob of picking 2 p when two letters picked without replacement from aapraaaappaaaaaaar? 1/51 What is prob of picking 1 l and 1 j when two letters picked without replacement from {o: 1, w: 1, i: 3, f: 3, j: 3, l: 3}? 9/91 What is prob of picking 1 t and 2 o when three letters picked without replacement from {d: 2, k: 3, t: 2, o: 4}? 4/55 Two letters picked without replacement from ooowtow. Give prob of picking 2 w. 1/21 Four letters picked without replacement from {e: 5}. What is prob of picking 4 e? 1 Four letters picked without replacement from {x: 4, o: 2, i: 7}. What is prob of picking 1 i, 1 x, and 2 o? 28/715 Three letters picked without replacement from zzzzzz. What is prob of picking 3 z? 1 Calculate prob of picking 2 g when two letters picked without replacement from cggccccccccgccccccgc. 3/95 Calculate prob of picking 2 j, 1 i, and 1 o when four letters picked without replacement from {o: 3, z: 8, i: 2, j: 2}. 2/455 Four letters picked without replacement from zwzwwzqzwwzzwqz. What is prob of picking 1 w, 2 q, and 1 z? 2/65 What is prob of picking 1 k, 1 z, and 1 h when three letters picked without replacement from {h: 3, z: 3, k: 5, j: 4, m: 3}? 15/272 Three letters picked without replacement from {e: 5, f: 1, b: 5, t: 1, p: 2, i: 2}. Give prob of picking 1 t and 2 p. 1/560 Two letters picked without replacement from {d: 1, b: 2}. Give prob of picking 1 d and 1 b. 2/3 Calculate prob of picking 2 v and 2 m when four letters picked without replacement from {v: 7, m: 4}. 21/55 Calculate prob of picking 2 z and 1 l when three letters picked without replacement from glzzzlzlgllzzlzzlg. 49/204 Calculate prob of picking 1 m and 1 u when two letters picked without replacement from tmtmtmmtttmmmtmuum. 2/17 Three letters picked without replacement from {z: 2, n: 2}. Give prob of picking 1 n and 2 z. 1/2 Two letters picked without replacement from keftttkpkpkypppepf. What is prob of picking 1 e and 1 t? 2/51 Three letters picked without replacement from kkik. Give prob of picking 3 k. 1/4 Three letters picked without replacement from imnitnl. What is prob of picking 1 n, 1 t, and 1 m? 2/35 Two letters picked without replacement from {z: 9, n: 1, e: 1, t: 1, d: 1, a: 2}. Give prob of picking 2 z. 12/35 Two letters picked without replacement from {t: 4, c: 3, g: 11}. What is prob of picking 2 c? 1/51 What is prob of picking 1 d and 1 l when two letters picked without replacement from rgqldpd? 2/21 What is prob of picking 1 q and 1 r when two letters picked without replacement from {y: 1, m: 1, q: 1, r: 1, i: 1}? 1/10 Two letters picked without replacement from {c: 10, m: 3, j: 2}. What is prob of picking 2 j? 1/105 Three letters picked without replacement from {g: 4, l: 6, e: 3, v: 1}. Give prob of picking 2 l and 1 v. 15/364 What is prob of picking 2 k and 2 z when four letters picked without replacement from kzzkikzkzkk? 3/11 Three letters picked without replacement from {d: 2, l: 6, q: 1, h: 4, u: 3}. Give prob of picking 1 l and 2 h. 9/140 Four letters picked without replacement from {t: 8, s: 5, j: 2}. Give prob of picking 1 j, 2 s, and 1 t. 32/273 What is prob of picking 3 q and 1 t when four letters picked without replacement from tttqqqtqtqtqqt? 35/143 Four letters picked without replacement from bpeepeipeioeioeibo. Give prob of picking 3 e and 1 o. 1/51 Four letters picked without replacement from xdxdxgdddxd. Give prob of picking 2 d, 1 x, and 1 g. 2/11 Three letters picked without replacement from zzzrprzzaazz. What is prob of picking 1 z, 1 r, and 1 a? 7/55 Two letters picked without replacement from {s: 3, m: 1, f: 2, w: 1, n: 5, e: 1}. What is prob of picking 1 n and 1 m? 5/78 Calculate prob of picking 2 n when two letters picked without replacement from {k: 2, t: 3, n: 2, a: 2}. 1/36 Two letters picked without replacement from {p: 3, o: 2, b: 4, d: 2, c: 2, y: 1}. Give prob of picking 1 o and 1 b. 8/91 Two letters picked witho	{ "pile_set_name": "DM Mathematics" }
, 5k - 8 = d + w for d. -5 Let v(r) = r3 + 5r*2 + 2r - 4. Let h be v(-4). Suppose -3b - 6 = 0, -3j = b + b - 20. Let x = -200 + 203. Solve d + j = -xy, -hy - 2 = -y - 2d for y. -2 Let x = -101 + 158. Let o = -45 + x. Solve 3z - o = 3u, 7z = -u + 3z + 16 for u. 0 Let x(p) = p3 - 7p*2 - 2p + 16. Let s be x(7). Solve -3a = h - 16, -sh = 5a - 0a - 27 for h. 1 Suppose -v - 9 = -4h, 4h - 10v - 4 = -14v. Solve 0 = 2i - hd, 2i + 4d = 3 + 15 for i. 3 Suppose 8f + 226 = 5f + u, -3u = -3. Let z be ((-50)/f)/((-1)/(-3)). Solve 11 = zg - 5p, -4g + 0g + p + 13 = 0 for g. 3 Let m(x) = -3x*2 - 36x + 3. Let p be m(-12). Solve -z + 13 = -4r, 3r - 21 = 6r - pz for r. -2 Let a(u) = u + 2. Let r be a(2). Let y be (3 + -9)r/(-6). Suppose -yn = -5i - 2, -4n + 5n = 5i - 7. Solve g - 5k + 4 = 0, -ng + 4k - 12 = k for g. -4 Suppose -23t = -39 - 30. Solve -5i = -3i + tg - 21, 4g - 26 = -2i for i. 3 Let y be 4 + (5/(-1) - -4). Solve 5a + 3d - 7 = 0, 0 = -ya - 2d + 3d + 7 for a. 2 Suppose -39 = r - 5w - 10, 3r + 5w = -7. Let i be 3/r2-45. Suppose -3z - 33 = -6v + v, i = 2v + 3z. Solve 3q = 3h + v, -5h + 3 = -2q + 21 for q. -1 Let o(z) = -z3 + 6z*2 - 8z + 53. Let p be o(6). Solve 5 + 0 = -pr - 5f, -6 = -2f for r. -4 Let i(y) = y3 - 18y*2 + 19y - 29. Let z be i(17). Suppose 3o - 3n - n = 12, zo - n = 20. Solve 5p - og = -10 - 8, -3p - 2g = 2 for p. -2 Suppose -2o - 4 = -4p, -7p - 4 = -11p - o. Solve 0 = -4y - 3g - p, 3y + 0y + 4g = 8 for y. -4 Let b be ((-12)/(-4))/(6/4). Let c(f) = 28f - 838. Let i be c(30). Solve h + 17 = -2g + 5g, -4h - bg = -i for h. -2 Let c be (5 - (2 + -4))/1. Suppose -13o + 14o - c = 0. Solve 0 = 5f - 3y - 8, -2f + 4y + o = f for f. 1 Let z be (-28)/(-12) - (-4)/6. Let q = z - 0. Let l(v) = -v3 + 8v*2 + 28v - 235. Let c be l(7). Solve -3i - qo = 2o + 26, -c = i + 2o for i. -2 Let z be (3/(-15))/(3/(-60)). Solve 4h = -h - 25, -2f - zh = 22 for f. -1 Suppose -3l = -2y + 16, 0 = -y - l - l - 6. Solve -9 = -r + 2w, -3r + y = -r + 4w for r. 5 Let d be -1 - (2 + (-16 - -4)). Suppose -d = -4q + 3y + 2, -5q = y - 28. Solve -5g + 4p = -3, 5g + qp = 3g - 12 for g. -1 Let z = -464 - -467. Solve -5q + s = 7, -3q - s = zs - 5 for q. -1 Let s(h) = h2 + 10h - 226. Let g be s(11). Solve -gd - 4i - 2 = 0, -2d - 4i = -5d + 18 for d. 2 Suppose 0 = 4j - 9j + 20. Let d be (0 + 1)(j/(-1) - -6). Solve -5g - 8 = dz + 17, 0 = 4z - 2g - 10 for z. 0 Let p = -5 + 11. Let t(h) be the second derivative of h*3/6 - 3h*2/2 - 25h. Let d be t(p). Solve 0 = -0v + v + 5s + 22, dv + 18 = -3s for v. -2 Let v(p) = -9p - 9. Let g(w) = 2w + 2. Let o(x) = 26g(x) + 6v(x). Let a be o(-3). Solve 0 = aq + 5r + 7, 4r + 2 - 6 = 0 for q. -3 Suppose -4a + g + 452 - 92 = 0, -g = 4a - 368. Suppose 4x = 5o - a, 5x + 2 = 7. Let v = 22 - o. Solve 0 = -y - k + vk + 7, 2y + k + 1 = 0 for y. 1 Let o(h) = -2h2 + 11h + 8. Suppose 2m + 0m - 18 = -2r, -m + 27 = 4r. Let s be o(r). Suppose -3 = sq - 3q. Solve qf = -2g - 4 + 3, -3 = 3f for g. 1 Let k = -436 - -440. Solve -2o + 0 + 12 = 2g, -5g - ko = -26 for g. 2 Suppose -r + 3 = -0r. Suppose 79 = 5h + 2q, rq - 4 = -h + 4. Solve g - h = 2g - 4m, g = m - 2 for g. 3 Let o(i) = i2 - 22i - 86. Let x be o(26). Suppose -19 = -w + 4y, w - 4y + 14 = 3w. Solve -z + 3u = -w, z - 5u = -z + x for z. -1 Suppose -62i + 150 = 13i. Solve -ix = -3u - 18, 6 = 3x - x for u. -4 Let b be 0/((-4)/(-2)) + (-1 - -3). Let g = -12 + 7. Let w(y) = -y - 1. Let k be w(g). Solve x - b = 0, -x - 2x = -kh - 26 for h. -5 Let u be (36/(-15))/(3/(-20)). Let t = u - 11. Suppose 2o = tm - 15, -3m = 4o - 8m + 15. Solve 4y + n - 22 = o, 0y - 3n + 11 = y for y. 5 Let n(b) = 2b2 + 7b + 8. Let v be n(-2). Solve 0 = 6a - va - 3s - 19, 5a = -s for a. 1 Suppose -i + 3r - 8 = 0, i + 20r - 24r = -12. Solve -5t + 9n - in + 25 = 0, 15 = -5n for t. 2 Suppose 15 = 2y - 11. Suppose 3c = y - 4. Let w = 8 - 8. Solve -b + 1 = -2p - wp, -5p - 1 = -cb for b. -3 Let g = -3 - -8. Suppose 0 = gi - 31 - 19. Let q(b) = b*3 + 23b*2 + 20b - 42. Let m be q(-22). Solve 2c - u = -mc + 13, 5c + 4u + i = 0 for c. 2 Suppose -3v + 10 = -w, 3w - 7w = 4. Suppose -2o + 19 = 3h + v, -15 = -3o. Solve -hz - m + 8 + 1 = 0, -3z - 2m = -16 for z. 2 Let v(r) = 5r - 5. Let z be v(4). Solve k - 5k - 5h = 12, -5k - 2h - z = 0 for k. -3 Let l(h) = 29h - 606. Let c be l(21). Solve 4v - 12 = -f, 0 = -5v + cf - f + 2 for v. 2 Let j = -124 + 133. Let m = 0 + 14. Let p = m - j. Solve o + 6 = 2x, -3x + 2 = -o - px for o. -4 Let v be (105/(-42))/(1/(-2)). Solve -5r + 5 = vz - 5, -3z - 5r = -16 for z. -3 Let n be 2(-2)/20 - 16/(-5). Suppose i - 108 = -3o, 76 = no - 4i - 17. Solve 3g = 4g - 5, -4c = 3g - o for c. 5 Let s(g) = 14g + 156. Let v be s(-11). Solve 13 = -0y + vy + u, 25 = 5u for y. 4 Suppose 337s - 4 = 336s + 2u, 0 = -s - 2u + 4. Solve -d - 2 = 0, -7 = sk + 3d - 17 for k. 4 Suppose 2z - 5s = 3 - 31, 4s - 16 = 0. Let i be ((2 - 2)/z)/(-2). Solve n + 3b = -10, i = 2b + 8 - 2 for n. -1 Let b be 1/4 - (-517)/188. Solve m - 4t = -3, 0t = -m - 5t - b for m. -3 Let w = -7 + 10. Let k(o) = -o - 15. Let p be k(-20). Let r = 6 - 4. Solve -26 = 2n + 5g, pn - rn + 21 = -wg for n. -3 Let x = -337 + 337. Solve 3n - 4b - 7 = -2, x = -3n + 3b + 6 for n. 3 Let n be (-18)/10 + (-2)/10. Let x = n - -20. Suppose f - x + 12 = 0. Solve 3j + 0j + f = -5q, -5q - 2j - 4 = 0 for q. 0 Let s(d) = -d + 5. Let q be s(0). Let n(r) = -r3 - 1. Let a be n(-3). Let z(i) = -102i + 106. Let u be z(1). Solve -m = qb - a, 2b + 3m + 7 = ub for b. 5 Let s(u) = -2u3 + 2u*2 + 6u - 1. Let t be s(2). Solve -t = 5l - h + 2, 5h = l - 23 for l. -2 Suppose 0 = -2t + 5l + 222, t + t = 4l + 220. Let r = -102 + t. Solve 2y = y + rm + 6, -2y = 4m for y. 2 Let j = 11 + -8. Let a = 26 - 20. Let g(y) = -y2 + 6y + 3. Let o be g(a). Solve 0 = om - jp, m + p + 8 = -0m for m. -4 Suppose -9p - 108 = -5x - 12p, 4p = -5x + 104. Solve a = 4d - x, 6a - 20 = 11a for d. 5 Let a be 6/210/(-15). Let q = a - 8. Let y = 15 + q. Solve 5f - 2 = -5m + 3, -yf + 3m = 19 for f. -2 Let l = 795 - 793. Solve lb = -4c - 12, 0 = c + 2b + 1 + 2 for c. -3 Let w(d) = 9 + 0d + 7 - 2d. Let z be w(6). Solve -5v + 20 = -4q, -q + 20 = zv + v for v. 4 Let d be (-14)/(-3) - 1/(-3). Suppose 4 = -dl + 6l. Suppose 4g - lj - 17 = 3, -g + 4j = -20. Solve -5k + 1 = 5p + 6, -4k - 2p - 12 = g for k. -5 Let w be (-3 + 9)38/4. Suppose 0 = -5h + 3 + w. Solve 6 = -2z - 0, -3t - 4z - h = 0 for t. 0 Let t(c) = c*3 + 4c*2 + 2c + 37. Let u be t(-5). Solve -o + 12 = -0o + 4b, -5o - ub = 12 for o. -4 Let o(x) = x*3 + 3x*2 - 3x + 5. Let d be o(-4). Let w be (5 - d)(-10)/(-4). Suppose 2 = wt - 8t. Solve -3f + t = -0r - 2r, 0 = 2r + 3f - 17 for r. 4 Let y be 64/10 + (-4)/10. Suppose -p - y = -4p. Suppose 2i - 5n = 37, i + 6 = -3n - 3. Solve u + 0u = l + p, 3u = 4l + i for l. 0 Let m(w) = w2 - 5w + 7. Let p be m(4). Suppose 4q = -pq + 21. Solve 4f - 3l - q = 2l, -11 = -4f - 3l for f. 2 Suppose -4 = -2y - 5m, 46 = -y + 3m + 48. Solve ys + 4r - 22 = 0, 0 = 9r - 4r - 15 for s. 5 Suppose -9b - 6b = -14b. Suppose -5d = -2p - 28, 2p = 3d - 0d - 20. Solve -k - 3u + 2 + 1 = b, -4k + 4u = d for k. 0 Let z be (-370)/(-40) + 6 - (-1)/(-4). Let j(s) = -2s - 1. Let g be j(-3). Suppose 0 = -3w - w. Solve u + gi = z, -3i + w + 9 = 3u for u. 0 Let n = -16 + 27. Suppose 15c = 17c. Suppose 2v = 5w - 27, c = -3w - 0w + v + 16. Solve 2b = -y + n, -wy + 4b = -3y + 18 for y. 1 Let m be 5/3(-6)/(-5). Suppose -5l = -p + 3 - 24, -mp = -8. Solve -10 = -3k + lq, 2k + q = -2q - 6 for k. 0 Let h = -87 + 38. Let s = h + 54. Solve 4y = 2x - 10, -4y - 3 = -sx + 10 for x. 1 Let b = 554 + -549. Solve -5f - 50 = bo, 4o + 17 - 2 = f for f. -5 Let c(t) = -2t2 + 18t. Let y be (-5)/((-75)/9)5 + 6. Let k be c(y). Let m be (6/5)/((-6)/(-15)). Solve 7 = 3l + 2p, k = l + 4l + mp - 12 for l. 3 Let d(b) = -b3 - 5b*2 - 5	{ "pile_set_name": "DM Mathematics" }
of g(d)? 2 Suppose -n = -4k + 226, 3n + 4 = 5n. List the prime factors of k. 3, 19 Let n be (0 - (-1 + 0))3. Suppose 40 = a - 2d, 161 = 2a + na + 3d. What are the prime factors of a? 2, 17 Let d(o) = -2o2 + 3o - 2. Let g(p) = -3p2 + 5p - 4. Let n(i) = 5d(i) - 3g(i). Let x be n(0). Suppose -50 = -xz - 3z. List the prime factors of z. 2, 5 Let o(n) = -n - 2. Let g be o(-2). Let w be (-60)/(-8)(-2 - g). List the prime factors of (-18)/w30/4. 3 Let o be 2/(-3)3 + 2. Suppose o = -k + 6k - 90. List the prime factors of k. 2, 3 Let f(c) = -c*3 + 6. Let d be f(0). List the prime factors of (-6)/9 - (-70)/d. 11 Suppose 4r = -3s - 23, 2r + 30 = -5s - 3r. Let m = -9 - 3. Let j = s - m. List the prime factors of j. 11 Let c be 218 + 6/3. Let z = -24 + c. List the prime factors of z. 2, 7 Suppose -5q + q = -36. Suppose -d - 6 = -q. What are the prime factors of d? 3 Let b be (2 + (-9)/12)4. Suppose -12 - 18 = 5o. Let p = b - o. List the prime factors of p. 11 Let h(r) = r*3 - r - 2. Let g be h(2). Suppose -gp + 2q - 6 = p, -4p - 4q - 16 = 0. What are the prime factors of (-6)/(-2) - p/(-2)? 2 Suppose w - 1 = -7. Let p be w(2 - (-5)/(-2)). Suppose 0j = pj - 12. List the prime factors of j. 2 Suppose 4x = 10 + 66. Let t = x + -14. What are the prime factors of t? 5 Let o = -6 + 7. Suppose 56 = 5f + o. List the prime factors of f. 11 List the prime factors of (-2)/(-3)996/8. 83 What are the prime factors of 1/(-4) + 1225/20? 61 Let u(p) be the first derivative of p2 + 4p - 3. List the prime factors of u(7). 2, 3 Suppose 3o + 160 = 7o. Let m = o + -25. What are the prime factors of m? 3, 5 Let c = 13 - 9. Let b(n) = 4n + 8n*3 - 2n*2 + cn*3 - 3n. What are the prime factors of b(1)? 11 Suppose 0 = -6o + 5o + 7. Let p = o + -5. List the prime factors of -73/(-6)p. 7 Let r(k) = k*2 + k. Let z be 3/(-3) + 2 + 0. Let j be r(z). What are the prime factors of ((-13)/(-2))/(j/4)? 13 Let v = 0 - -5. Suppose -5c + v = -4c. Suppose -16 - 14 = -ct. What are the prime factors of t? 2, 3 Let x(v) = v*2 - 3v + 4. Let t(j) = j*3 - 6j*2 + 3j - 6. Let k(y) = -y + 1. Let h(q) = -3k(q) - t(q). Let n be h(6). List the prime factors of x(n). 2 Let y(a) = -5a - 20. List the prime factors of y(-10). 2, 3, 5 Let b be 2 + -1 - (-2 + 1). Suppose k = -bk. Suppose k = v - 5. List the prime factors of v. 5 Let p be (-2)/(-1) + (-6 - 1). Let f = p - -4. List the prime factors of 4 - (2 - (4 + f)). 5 Suppose -3b = -4f + 43, 4b = -3f - 2f + 46. Let p be (3 + f/(-6))-3. Let h = -1 - p. List the prime factors of h. 3 Let m(o) = -o3 - 7o*2 + 8 + 0o + 15o2 + o - 2o. Let u be m(8). Suppose u = -3q + 13 - 1. What are the prime factors of q? 2 Let o(b) = -2b - 10. Let t be o(-6). Suppose 0 = -l - 4g + 35, 6l - 84 = tl - 2g. List the prime factors of l. 19 Suppose -3b = 46 + 5. Let z = 24 + b. What are the prime factors of z? 7 Let w(c) = -c2 - 5c - 6. Suppose -2k - 16 = 2k. Let y be w(k). What are the prime factors of 9 - (0/3 - y)? 7 Let g be (-2)/4 + (-6)/4. What are the prime factors of (-26)/(-7) - g/7? 2 Let d = 158 - 38. List the prime factors of d. 2, 3, 5 Suppose 5w - 5a = 2 - 32, -w + 24 = 5a. List the prime factors of w/(-7) - (-388)/28. 2, 7 Let w = 5 + -10. Let k be 5 + (0 - -2) + 0. Let o = k - w. List the prime factors of o. 2, 3 Let y(p) = p2 + 15p - 3. Let i be y(-16). Suppose -2z = -z - i. List the prime factors of z. 13 Suppose 0 = 4g - 2n, -4g + 20 = -2g + 4n. Let b(j) = -2j2 - 8j + 5 - j*g + 5j2 - j2. List the prime factors of b(8). 5 Let g = 4 + 0. Let c(z) = 3 + g + z + 3. What are the prime factors of c(-5)? 5 Let q(p) = -p + 4. Let h = 7 + -7. Let k be q(h). Suppose -3o + 58 = 5y, ky = 2y + 10. What are the prime factors of o? 11 Let t(a) = a - 1. Let o(k) = 2k - k + 2k. Let p(w) = o(w) - t(w). List the prime factors of p(1). 3 Suppose -12l + 1 = -11l, -4s - 3l + 955 = 0. What are the prime factors of s? 2, 7, 17 Let n = 71 - 30. Let r = n - 20. List the prime factors of r. 3, 7 Let j be 1/2(-2 - -2). Suppose 3f + 0f - 60 = j. List the prime factors of (-12)/(-8)f/6. 5 Let r(s) = -s3 - s2 - s + 12. Let g be r(0). Suppose 3f = g + 60. List the prime factors of f. 2, 3 Let m(c) = -c2 - 6c + 7. Let z be m(-7). Suppose 0a = 4a. Suppose v + a = 2r - 2, z = -2r - v + 6. What are the prime factors of r? 2 Suppose -163b - 101 = -164b. What are the prime factors of b? 101 Let f = -17 + 29. Suppose 4m = f - 0, 91 = 5k - 3m. List the prime factors of k. 2, 5 Let d(z) = z - 8. Let k be (-1)/3 - (-2)/6. Let g be d(k). Let f = g + 23. What are the prime factors of f? 3, 5 Let i = 13 + 26. List the prime factors of i. 3, 13 Let i be ((-2)/6)/((-3)/54). Suppose -3m + im + 3 = 0. Let v(g) = -9g3 + g2 - 1. List the prime factors of v(m). 3 Let m be (-1 - -3)/48. Suppose 0 = 2p + 4g - 14, mg - 1 = p - 2. List the prime factors of p. 5 Suppose -7b + 3b = -4, -u - b = -44. What are the prime factors of u? 43 List the prime factors of 866/12 + (-5)/30 + -4. 2, 17 Suppose 0 = -d + 4v + 19, -v + 59 = 2d + 21. Let i = -9 + d. List the prime factors of i. 2, 5 Let q(u) = -7u + 11u - 2u + 2. What are the prime factors of q(3)? 2 Suppose 4y - 5 = -l, 0 = -0y + 2y. Suppose 2x + 3x - 3g - 60 = 0, -4g = lx - 60. What are the prime factors of x? 2, 3 Let w = -1 + 3. Let p = w + -1. List the prime factors of -2 - p/((-3)/30). 2 Suppose -16 = -a + 5g + 4, -3a - 4g = 16. Suppose -2x + 2 + 12 = a. What are the prime factors of x? 7 Suppose -4z - 12 = 4. Let u be (-318)/(-18) + z/6. Suppose -m = -2 - 0, -t = 4m - u. List the prime factors of t. 3 What are the prime factors of 4/(4/723)? 2, 3 What are the prime factors of 74 + (2 - 5)/1? 71 Let t(y) be the second derivative of -y*5/20 - 7y*4/6 + 7y*3/3 - 13y*2/2 - 3y. What are the prime factors of t(-15)? 2 Suppose 3 + 1 = 4y - 4q, y + 3q = -3. Let j be (y/(-3) - 0) + 10. Let r = j - -5. List the prime factors of r. 3, 5 Let t be (30/4)/(2/4). Suppose 0z - 3z = -t. What are the prime factors of (z - 4)(7 - 0)? 7 Let k(u) = 9u - 4. Let a be k(-4). Let z = a - -67. List the prime factors of z. 3 Let m(t) = 13t + 37. List the prime factors of m(21). 2, 5, 31 Suppose 0v = -v + 28. What are the prime factors of v? 2, 7 Suppose 4q - 5q + 27 = 0. Suppose -8 = -r + 3x, -q = -5r + x + x. Suppose -5o + 11 = p - 22, ro + 2p - 36 = 0. What are the prime factors of o? 2, 3 Suppose -20j - 1572 = -26j. List the prime factors of j. 2, 131 Suppose l + 42 = f, l - 256 + 76 = -5f. Suppose -q - 3c = 5 - f, 4c + 96 = 3q. List the prime factors of q. 2 Let y(k) = 38k + 70. List the prime factors of y(8). 2, 11, 17 What are the prime factors of (-54)/(-5)((-1040)/(-12))/13? 2, 3 Suppose 5o = -u + 13, 3o = -0u + 5u + 19. Suppose n = -on + 32. What are the prime factors of n? 2 Suppose 5a = -s - 3s + 137, 2a - 101 = -3s. Let y = 59 - s. What are the prime factors of y? 2, 13 Let p = 296 + -95. What are the prime factors of p? 3, 67 Let p be ((-10)/(-25))/((-1)/(-5)). What are the prime factors of (3 - 2)/(p/10)? 5 Suppose -5w + 1401 = -o + 4o, -1140 = -4w + 4o. List the prime factors of w. 2, 3, 47 Let x(g) = -g2 - 7g - 6. Let y be x(-4). Suppose 10 = -2j, -yj + j = r + 21. What are the prime factors of 1 - (r - 2) - -4? 3 Suppose 3v - 25 = 5. Let z = v + 2. What are the prime factors of z? 2, 3 Suppose 3v = -5o - 385, 308 = -4o + 3v - 8v. List the prime factors of 282/22 + (-14)/o. 13 Suppose -3a = -27 - 0. List the prime factors of a. 3 List the prime factors of 1 - 5(-1 + 34/(-10)). 23 Suppose 93 + 117 = 5w. List the prime factors of w. 2, 3, 7 Suppose -2 = 3f - 8. Let z(x) = 2 + 3x2 - f + 4x. List the prime factors of z(-3). 3, 5 Let v(y) = y*2 + 13y - 28. What are the prime factors of v(-16)? 2, 5 Let c = 26 - 38. What are the prime factors of (-104 + -2)6/c? 53 Suppose -2h + h = -85. What are the prime factors of h? 5, 17 Suppose 0 = -g - 5g + 714. What are the prime factors of g? 7, 17 Let b be 2 - (-2 + 1 + 1). Suppose bh - 1 = h. Suppose -r = h - 4. List the prime factors of r. 3 Suppose 0 = 5z + 15, 0n - 2z + 78 = 3n	{ "pile_set_name": "DM Mathematics" }
. Suppose 0m - 2m + 4q + 18 = 0, 11 = -m - 3q. Let j be ((-4)/9)/((-1)/3). What is the closest to m in y, j, -2/7? j Let i = -428 - -428.4. What is the nearest to -0.06 in 5, i, -2, 2? i Let w = -224 + 196.8. Let t = w - -26. Let j = t - -1.5. Which is the nearest to 0.1? (a) -4 (b) 4 (c) j c Suppose 17 = -4f + 97. Let z = 0.346 + 0.054. What is the nearest to f in 1, z, 1/4? 1 Let j = -8 - -13. Which is the nearest to 0? (a) j (b) -1 (c) -2/7 (d) -0.4 c Let l = 0.1066 + -0.0666. Which is the closest to -8? (a) 5 (b) -0.5 (c) l (d) 0 b Let o = -188 - -755/4. Which is the closest to 0? (a) o (b) -4 (c) 0.04 c Let k be (9/(-15))/(36/(-60) - -2). What is the closest to 3 in 3, 10, k? 3 Let s = 0.14 + -0.04. Let i = -0.2 - 0.8. Let w = 3.8 + -4.8. What is the closest to i in -3, w, s? w Let z = 143 + -198.9. Let k = 57 + z. Which is the nearest to 0.2? (a) k (b) 0.4 (c) 2 b Suppose 5l = -5 + 10. Let o = -0.1 + -3.9. Let n = 9 + o. What is the nearest to l in 1, n, 0.5? 1 Let w(s) = 5s3 - 4s + 1. Let b be w(1). What is the nearest to 1/4 in b, 17, 5? b Let v = -4.3 - -4. Let i be (-4)/21390/260. What is the nearest to i in 1/5, 0.1, v? v Let b be (-2)/(-9) - 4/99. Let g = 0.0403 - 201.0403. Let k = 197 + g. What is the nearest to -1 in k, b, 2/5? b Let p = 383/3 + -128. Let q = 2 - 0. Which is the closest to q? (a) -3/4 (b) 0.4 (c) p b Let b(r) = r3 + 2r*2 - 2r - 3. Let w be b(-2). Let p be (5 - (0 + 3))(-5 + 3). What is the closest to w in p, -4/7, -3? -4/7 Let z = -0.688 + 2.188. What is the closest to 1 in 4, 1, z? 1 Let b(l) = -3l - 5. Let h be b(-4). Suppose 0 = 7m - h. Let x = -43 - -41. What is the closest to x in m, -3, -0.3? -3 Let q = 0.4 - -0.1. Let o be 9(-2 - 9/(-3)). Suppose o = 4l + 5. Which is the nearest to l? (a) -4/5 (b) 3 (c) q c Let x = 1169 + -1170. Which is the nearest to x? (a) 1/3 (b) 0.1 (c) 3 (d) -4 b Let w = -3 + 4. Let j be -5 + -52(-15)/160. What is the closest to w in j, -0.2, 0.1? 0.1 Let b = -5.354 + -0.646. What is the nearest to 2/3 in -1, -0.2, b, 5? -0.2 Let r = 0.135 - 0.17. Let d = 0.035 + r. What is the closest to 8 in d, 4, 1? 4 Let p = -0.1484 - -5.1484. What is the nearest to -3 in -1/3, -3, p, -6? -3 Let z be 2/342 - 318/(-3021). What is the closest to 3 in -2/15, -1/15, z, -0.2? z Let s = -315 - -320. Let v = 6.97 + -7. What is the closest to v in 0, s, 3? 0 Let o = -9 + 4. Let g be 4/(-70)5-3(-35)/135. Which is the nearest to g? (a) 0.2 (b) 0 (c) o b Let i = 43 - 303/7. Let z(o) = o3 + o2 - o - 8. Let b be z(0). Let m be 0 + b/6 + 2. What is the closest to m in -5, -0.3, i? i Let n be (3 - 1)/(-5 + 24). Let t = 591.7 + -592. Which is the nearest to t? (a) 1 (b) n (c) 6 b Let o = -1/20 - -3/10. What is the closest to o in 1/5, -0.3, 1/6? 1/5 Let j = -184 - -181. What is the nearest to 0.6 in j, 1/4, 2? 1/4 Let m be (-3)/57(1 - -1). Which is the closest to -1/8? (a) -3 (b) m (c) 1/2 b Let t = 0.6 + -1. Let d = 12 + -27. Let p = d + 14. What is the nearest to 0.1 in t, 2/5, p? 2/5 Let y = 348.1 + -348.5. Let l = 203 + -1427/7. Which is the nearest to -1/5? (a) 2 (b) y (c) l b Let h = -4.11 - -0.11. Let v(j) = 4j + 22. Let d be v(-5). Let f be (-2 - 3) + (5 - d) - 1. What is the closest to 1 in f, h, 0.1? 0.1 Let t = -434 + 364.9. Let w = -70 - t. What is the nearest to w in -3, -2/15, 2? -2/15 Let l = 19.13 + -19.63. Which is the nearest to -0.6? (a) 0.3 (b) 0.5 (c) l (d) -4 c Let r = -697 - -693. Let z = -0.4 + -0.1. What is the nearest to r in z, -2, 0.4? -2 Let m = -0.15 + 0.14. Let w = 0.15 + m. Let b = -0.24 + w. What is the nearest to b in -0.3, -3, 3? -0.3 Let l = 127 + -128. Let v = -69/2 - -37. Which is the nearest to -1? (a) -0.2 (b) v (c) l c Let w be 7/(1(-3 + 2)). Let s be (-1)/w4 + -1. Let u = -9 - -9. What is the nearest to s in u, -0.3, 0.1? -0.3 Let p(a) = -123a + 494. Let d be p(4). What is the nearest to -3/7 in d, 4, 1/10? 1/10 Let z = -2.125 - 0.075. Let o = z + 2.3. What is the closest to o in -2/17, -3, -1/6? -2/17 Let x = -1.41 + 1.81. Which is the nearest to -1/4? (a) -3 (b) 4 (c) x c Let r = -257 + 280. What is the nearest to -1 in -4, 0.2, r? 0.2 Let o = 195/4 - 60. Let r = o + 23/2. Let w = -2.1 - -2.4. What is the nearest to -0.1 in 2/9, r, w? 2/9 Let i be (2 - (-8)/(-6))6/16. Which is the closest to i? (a) -2 (b) 0.2 (c) 1/2 b Let m be 21/27 - 12/18. Suppose d + 18 + 4 = 4t, 0 = -4d - 4t + 12. Which is the closest to 1/5? (a) 0 (b) m (c) d b Let f = -23 + 43/2. What is the closest to -0.1 in -64/5, f, -0.2? -0.2 Suppose 0 = 6h - 15h - 36. Let s = 2.3 - 2.41. Let y = s + -0.09. Which is the nearest to 1? (a) h (b) y (c) -2 b Let k = 1 + -1. Let d be (1/(-17))/((-1)/2). Suppose 5f - 8 = 9f. Which is the nearest to k? (a) -1 (b) d (c) f b Suppose -48o - 68 = -65o. What is the nearest to -2/41 in o, 2, 0.5, -2? 0.5 Let g = 292 + -154. Let z = -139 + g. What is the nearest to -1 in -0.3, -0.5, z? z Let o(i) be the first derivative of -5i2/2 + 5i - 51. Let m be o(1). Which is the closest to m? (a) -3/7 (b) 3 (c) 0 c Suppose -5w = -j - 3j - 3, -6 = 4w + j. Let r = 107 - 106. What is the closest to r in 4, -0.1, w? -0.1 Let d = -0.0532 + -3.8368. Let b = -0.11 + d. What is the nearest to 0 in 20, 0.2, b? 0.2 Let l(j) = -j2 - 2j + 10. Suppose 5 = -3w - 7. Let t be l(w). Which is the closest to -1? (a) 0 (b) 0.2 (c) t a Let i = -824 - -821. What is the closest to 3/4 in i, 4, 0.2? 0.2 Let t = 11 - 3. Let u be (-4)/(-15) - t/20. Let o(q) = q3 + 5q*2 + 5q - 3. Let h be o(-4). What is the closest to -1 in h, 0.1, u? u Let u = 0.28 - 0.08. What is the closest to -1/3 in u, -3, 0.1? 0.1 Let s = 0.409 + -0.309. What is the closest to s in 2/17, -4/13, -1? 2/17 Let t = -0.6 + 1.7. Let v = 2 - t. Let w = v + -0.5. Which is the closest to 1? (a) w (b) -8 (c) -0.1 a Suppose 4s - 34 = 22. Let i = 16 - s. Let x be (0 + 3)(-5)/(-15). Which is the closest to x? (a) i (b) 5 (c) 5/2 a Let i be (1/(-3))/((-4)/2076). Let v = i - 2247/13. Let g be 0 + -2 + (4 - 3). What is the nearest to g in v, -3, 0.03? 0.03 Let h = 255/37 + -691/111. Let u = 3 + -5. What is the closest to 5 in 0.5, u, h? h Let v = 0.0244 + 0.3756. What is the closest to -2 in 4/7, 0, v? 0 Let j be (4/(-15))/((-6)/(-9)). Let r = -28 + 24.2. Let s = 4 + r. Which is the closest to 1? (a) 15 (b) j (c) s c Let h = 588 - 555.1. Let v = 0.022 - 33.022. Let p = h + v. Which is the closest to 1/3? (a) p (b) -4 (c) 1/4 c Let n = 688/3 - 230. What is the nearest to n in -1, 7, -0.3? -1 Let s(g) = -g*3 - 66g*2 - 64g + 66. Let c be s(-65). What is the closest to 0.3 in 6, 0, 2, c? 0 Let z be (10 + -5)/(-25)1. What is the nearest to z in 0.5, 5, -0.2? -0.2 Let m = 1/607 - -21243/1214. Let v = m - 69/4. Let z(r) = r + 6. Let t be z(-7). What is the closest to t in v, 1, -1? -1 Let h = -27/77 - -103/231. What is the nearest to -2/3 in h, 2, 0.4, 0? 0 Let f = -78 - -82.9. Let z = f + -0.9. Let g be 4/6 - (-2)/3. Which is the nearest to 3? (a) z (b) g (c) 0.4 a Let l be -2 + 34/12 + -1. Let c = 7822 + -117328/15. What is the closest to 0.1 in 2, c, l? c Let o be 3 + (-61)/21 - (-325)/(-105). Let l = 0.3 + -0.2. Which is the nearest to l? (a) o (b) -1/3 (c) -1 b Let j(v) = -v2 + 3v + 22. Let u be j(6). Let b = 0.6 + -1. Let x = -5.2 - -2.2. What is the nearest to 2 in b, x, u? u Let u = -13/75 + 46/1275. Let t = 1/34 - u. Which is the closest to t? (a) -0.1 (b) 0 (c) 2 b Let i = 1.34 + -1.4. Which is the nearest to i? (a) -2 (b) -1 (c) 5 (d) 1 b Let c = -134 + 134. What is the closest to -2/5 in -45, c, 0.3? c Let z = 3026.7 + -3026.8. Let d(i) = i*2 + 4i. Let g be d(-5). Which is the closest to 0.2? (a) g (b) z (c) 3/5 b Suppose 2z + 2 = 4z. Let j be (4 + -5)3(-4)/(-3). Let k = 3 + -2. Which is the closest to z? (a) -2/13 (b) k (c) j b Let o = 162.1 + -162. What is the nearest to 0 in o, 1, -0.03, 0? 0 Let f = -482 - -454. Let z = -34 - -59. Let x = z + f. Which is the nearest to 2/7? (a) -3/4 (b) x (c) 1/10 c Let l be 81/1515. Let a be ((-18)/l)/(8/6). Let s = 13 - 13. What is the nearest to a in 1/3, -2, s? s Let p be 2/(-4) - (-175)/10. Let m = 52/3 - p. Let n = 0.067 +	{ "pile_set_name": "DM Mathematics" }
nd -0.0001186087 to five dps. -0.00012 Round -12740.387 to the nearest one hundred. -12700 Round -0.0102907 to 4 decimal places. -0.0103 Round -0.1404231 to 2 decimal places. -0.14 Round 0.013701937 to five decimal places. 0.0137 Round -0.018956757 to 5 dps. -0.01896 Round 248.97952 to the nearest 10. 250 Round -0.00000116127 to 6 dps. -0.000001 Round 0.0004369059 to four dps. 0.0004 What is -2294252 rounded to the nearest one hundred thousand? -2300000 What is -0.0001192893 rounded to six dps? -0.000119 Round -1926009400 to the nearest one million. -1926000000 What is -1602.1 rounded to the nearest ten? -1600 What is -4522.3739 rounded to the nearest 100? -4500 Round -286087 to the nearest 10000. -290000 Round -0.16241 to four dps. -0.1624 Round -856.882 to the nearest one thousand. -1000 What is 0.000000829382 rounded to 7 decimal places? 0.0000008 Round 8640690 to the nearest one thousand. 8641000 What is 0.04437099 rounded to four dps? 0.0444 Round 33521.302 to the nearest 1000. 34000 What is 0.00001853165 rounded to six dps? 0.000019 Round -0.0001174885 to 6 dps. -0.000117 What is -0.2864005 rounded to three decimal places? -0.286 What is 176157000 rounded to the nearest one million? 176000000 What is -0.00086014 rounded to 5 dps? -0.00086 What is -0.00000038193 rounded to seven decimal places? -0.0000004 What is 0.000703631 rounded to 4 decimal places? 0.0007 What is 250507900 rounded to the nearest one million? 251000000 What is 142.1492 rounded to the nearest integer? 142 Round 0.00268987 to four decimal places. 0.0027 What is 144186670 rounded to the nearest 100000? 144200000 What is -5465.639 rounded to the nearest one hundred? -5500 What is -3948936 rounded to the nearest 1000000? -4000000 What is -0.0000805613 rounded to six decimal places? -0.000081 Round -0.0001424139 to five dps. -0.00014 Round -3608248 to the nearest 100000. -3600000 Round 0.000000816448 to seven dps. 0.0000008 What is -0.000232294 rounded to 4 dps? -0.0002 Round -258052900 to the nearest 100000. -258100000 Round 0.0737 to three dps. 0.074 Round -346653400 to the nearest 1000000. -347000000 Round -8.215535 to 1 dp. -8.2 Round 0.22017 to the nearest integer. 0 Round 114.2337 to one decimal place. 114.2 What is -197592.3 rounded to the nearest 1000? -198000 Round 28.7186 to the nearest integer. 29 Round 17277.65 to the nearest ten. 17280 Round 0.0378321 to two decimal places. 0.04 Round 1248.42 to the nearest ten. 1250 Round -0.000501475 to 6 decimal places. -0.000501 Round -0.14840442 to 3 decimal places. -0.148 Round -174.249 to the nearest 100. -200 Round -1067.566 to the nearest 10. -1070 What is -8838140 rounded to the nearest 10000? -8840000 Round -6.251116 to 1 decimal place. -6.3 What is 53.2559 rounded to the nearest ten? 50 What is -0.00090672 rounded to six dps? -0.000907 What is -0.0000530336 rounded to 6 dps? -0.000053 What is -2.12443 rounded to one decimal place? -2.1 Round 0.0000287596 to six decimal places. 0.000029 What is 79.72138 rounded to the nearest integer? 80 Round 0.000001681196 to 7 dps. 0.0000017 What is -8871.49 rounded to the nearest 1000? -9000 Round -21948810 to the nearest 10000. -21950000 Round -1607262 to the nearest ten thousand. -1610000 Round -0.0000285622 to 7 dps. -0.0000286 Round -68265364 to the nearest one million. -68000000 Round 8.62213 to 1 dp. 8.6 What is -0.000010154552 rounded to 6 decimal places? -0.00001 What is -0.000003603082 rounded to seven decimal places? -0.0000036 Round -10013.43 to the nearest 100. -10000 What is -281814 rounded to the nearest 100? -281800 What is 0.00031151564 rounded to seven decimal places? 0.0003115 What is 0.8045 rounded to the nearest integer? 1 What is 38993470 rounded to the nearest one hundred thousand? 39000000 What is -0.00002765839 rounded to 7 decimal places? -0.0000277 Round -0.000000490457 to five dps. 0 What is 781616 rounded to the nearest 1000? 782000 What is -4.440355 rounded to two decimal places? -4.44 Round 0.001001356 to 6 decimal places. 0.001001 Round 0.093624 to 3 decimal places. 0.094 What is 5306571 rounded to the nearest 100000? 5300000 Round 14319794 to the nearest ten thousand. 14320000 Round -0.00000874925 to 6 decimal places. -0.000009 Round 0.000001450099 to six decimal places. 0.000001 Round 11318400 to the nearest one million. 11000000 What is -514.256 rounded to 0 decimal places? -514 What is 6908904 rounded to the nearest 1000000? 7000000 What is 1391.1103 rounded to the nearest ten? 1390 Round -1.63389 to 3 dps. -1.634 Round -0.035097 to two dps. -0.04 Round 0.400961 to 3 dps. 0.401 What is 2394.909 rounded to the nearest one hundred? 2400 What is 0.01201814 rounded to four dps? 0.012 What is -0.0001080752 rounded to seven dps? -0.0001081 Round -1.766036 to two dps. -1.77 Round -0.44620058 to three dps. -0.446 What is -0.09204073 rounded to 2 dps? -0.09 What is -13969130 rounded to the nearest 1000000? -14000000 Round -0.0691382 to four decimal places. -0.0691 Round -0.0004546783 to 4 decimal places. -0.0005 What is -0.00805982 rounded to 4 dps? -0.0081 Round -1136.775 to the nearest 10. -1140 What is -1424273000 rounded to the nearest 1000000? -1424000000 What is -1067969 rounded to the nearest ten thousand? -1070000 Round 0.0744368 to four decimal places. 0.0744 Round -0.000003677929 to 6 decimal places. -0.000004 Round -151483 to the nearest one thousand. -151000 What is -42.612155 rounded to 1 decimal place? -42.6 What is 12.233947 rounded to the nearest integer? 12 Round -588.007 to the nearest 100. -600 Round -0.000366997 to 4 dps. -0.0004 What is 0.0028094931 rounded to 6 decimal places? 0.002809 Round -0.364623 to two dps. -0.36 What is -80.2765 rounded to the nearest 10? -80 Round 177.29544 to the nearest ten. 180 What is -0.0012635884 rounded to 6 dps? -0.001264 Round 1.20769 to two decimal places. 1.21 What is 0.0569356 rounded to four decimal places? 0.0569 Round 0.0000038093343 to 7 dps. 0.0000038 Round 0.00646816 to five decimal places. 0.00647 What is -0.003902074 rounded to 3 decimal places? -0.004 What is -0.03001797 rounded to five dps? -0.03002 What is -3.122047 rounded to two decimal places? -3.12 Round 215.11688 to one dp. 215.1 Round -12618010 to the nearest 1000000. -13000000 What is 286.965 rounded to the nearest one hundred? 300 What is -0.0005996612 rounded to 4 dps? -0.0006 Round 903.507 to the nearest 10. 900 What is -93559400 rounded to the nearest one hundred thousand? -93600000 Round -0.0000041905081 to 6 dps. -0.000004 Round -2445150 to the nearest one hundred thousand. -2400000 What is -44.8916 rounded to the nearest ten? -40 Round -0.003823637 to 5 dps. -0.00382 Round -752.4 to the nearest ten. -750 Round -0.00017334 to five decimal places. -0.00017 What is 29975.73 rounded to the nearest ten thousand? 30000 What is 2530650 rounded to the nearest 1000000? 3000000 Round -0.166964 to three dps. -0.167 Round -0.00002043507 to 7 decimal places. -0.0000204 What is 5.409835 rounded to one dp? 5.4 What is 13556478000 rounded to the nearest one million? 13556000000 Round -0.0000068008 to 7 dps. -0.0000068 Round 45828560 to the nearest one million. 46000000 Round -0.000567489 to five decimal places. -0.00057 What is -11872.06 rounded to the nearest 10? -11870 Round 0.00000739807 to 6 decimal places. 0.000007 Round -0.29146235 to 4 dps. -0.2915 What is 0.000201747 rounded to 4 decimal places? 0.0002 Round -59.12353 to 1 decimal place. -59.1 Round 0.12134553 to two decimal places. 0.12 What is -54008.68 rounded to the nearest ten? -54010 What is 0.0327279 rounded to 3 dps? 0.033 What is -18.974187 rounded to 1 decimal place? -19 What is -1.061125 rounded to 2 dps? -1.06 What is 1353.7 rounded to the nearest 100? 1400 Round -0.2373347 to two decimal places. -0.24 Round 0.0002219447 to four decimal places. 0.0002 What is -0.000005611048 rounded to six decimal places? -0.000006 What is -0.24519111 rounded to two decimal places? -0.25 Round -0.0119707 to 3 dps. -0.012 What is 0.0070824795 rounded to 6 dps? 0.007082 Round -3.7173553 to 3 decimal places. -3.717 What is 7947.163 rounded to the nearest 10? 7950 Round -0.0903706 to four dps. -0.0904 What is 0.00007251477 rounded to five decimal places? 0.00007 What is -0.00150154 r	{ "pile_set_name": "DM Mathematics" }
the remainder when k is divided by 3. 0 Suppose -5h - 5s = 31 + 9, 0 = -4h + 5s - 41. Let p = h - -24. What is the remainder when p is divided by 6? 3 Suppose -2n - 4c = -158, 2c = 9n - 11n + 150. What is the remainder when n is divided by 13? 6 Suppose 3v = 462 + 759. Suppose 5i = -20, 3n + 3i = -i + v. What is the remainder when n is divided by 36? 33 Let g(w) = w + 3w + w*3 - 5w + 4w2 - 3. Calculate the remainder when g(-3) is divided by 3. 0 Suppose 4y - 170 = -2s, 2y - 4s = 10 + 60. Calculate the remainder when 108 is divided by y. 26 Let m(a) = -9a - 10. Let f = -64 + 132. Let b = 105 - f. Calculate the remainder when m(-9) is divided by b. 34 Suppose 5s = s - 104. Let d = s + 27. What is the remainder when 7/d + 1 + -3 is divided by 2? 1 Let w(k) = k2 - 13k + 9. Let u be w(9). Let o = u + 69. Suppose 2 = -4a + h + 64, -5h = -a + 25. Calculate the remainder when o is divided by a. 12 Suppose 5f - 15 = -g - 4g, -2g = -f + 12. Calculate the remainder when 48/9 - 6 - (-250)/f is divided by 11. 8 Let m(y) = -15y - 28. Let t(q) = 7q + 14. Let p(u) = 6m(u) + 13t(u). Calculate the remainder when p(23) is divided by 11. 4 Suppose 137 = 16r + 58 - 129. Calculate the remainder when (-22)/4(-5 - 1) is divided by r. 7 Suppose 7c - 5c - 10 = 0. Suppose -4l + l = -4b + 98, -cb - 4l = -107. Calculate the remainder when 44 is divided by b. 21 Let p be (15/(-4))/(9/6)-2. Suppose 2x = 3 + p, 32 = f - x. Calculate the remainder when 177 is divided by f. 33 Let p = 22 - 14. Calculate the remainder when 181 + 8 + -11 is divided by p. 7 Suppose 4x = 151 - 7. Let g(s) = 2s*2 - 21s + 98. Calculate the remainder when g(9) is divided by x. 35 Suppose 0 = a + 4a - 95. Suppose 3o - 172 + 145 = 0. Calculate the remainder when a is divided by o. 1 Let k(t) = -6t2 + 28t + 20. Let z = -33 - -51. Calculate the remainder when z is divided by k(5). 8 Suppose -218 - 78 = -8k. Let x = -23 + k. What is the remainder when 24 is divided by x? 10 Let c = -11 - -87. Suppose 0 = 2h - z - c, -3h = -5z + z - 109. What is the remainder when h is divided by 20? 19 Suppose 0 = 5n - y - 1068, 634 = 29n - 26n - 4y. Calculate the remainder when n is divided by 24. 22 Let r(x) = -x*3 - 8x*2 - 10x + 14. Let m be r(-6). Suppose 25 = -5f, 0f + mf = -s - 8. What is the remainder when s is divided by 1? 0 Let s be 752/(-8) + -1 + 0. What is the remainder when ((-4)/5)/(2/s) is divided by (-1351)/(-105) + 2/15? 12 Let x(k) = 2k*2 + 11k - 3. Let i(z) = z*3 + 11z*2 + 2z + 11. Let p be i(-11). Calculate the remainder when x(p) is divided by 30. 28 Suppose 0 = 48p - 496 - 13616. What is the remainder when p is divided by 4? 2 Suppose 3i + 8t - 16 = 4t, -5i + 45 = 3t. What is the remainder when 165 is divided by i? 9 What is the remainder when 296 is divided by 2(7/1 - -31)? 68 Let k = 3 + -1. Suppose -kt = -0t + 3v - 17, -2v = 5t - 59. Let l = 29 - 5. What is the remainder when l is divided by t? 11 Let r(n) = -n + 8. Let v be r(4). Suppose -v - 14 = c. Calculate the remainder when 25 is divided by 4/(-6)c - -2. 11 Let u = -277 + 309. What is the remainder when 69 is divided by u? 5 Let o be (19(-7 - -6))/((-2)/4). Let j = 54 - o. What is the remainder when 28 is divided by j? 12 Suppose 0 = -8c + 2c + 60. Let u(d) = d*2 + 6d + 10. What is the remainder when u(-8) is divided by c? 6 Suppose 4o - 69 = -5q, 2o - 39q - 2 = -35q. Calculate the remainder when 217 is divided by o. 8 Suppose -l = -2y - 17, -11l - 61 = -15l + y. Suppose 4i - i - 177 = 0. Calculate the remainder when i is divided by l. 14 What is the remainder when (0 - -1)/(-7 + (-2328)/(-332)) is divided by 36? 11 Let r = -18 + 20. Suppose -5w + 37 = r. Let l = 9 + 9. Calculate the remainder when l is divided by w. 4 Suppose 5k + 23y = 26y + 226, 3k - 4y - 140 = 0. What is the remainder when 115 is divided by k? 27 Let b be ((-21)/(-14))/((-6)/(-4)). Let o(v) = 15v*2 - 2v + 2. What is the remainder when 73 is divided by o(b)? 13 Suppose -5w + 5x + 2 = -18, 0 = -2w - 5x + 29. Suppose -5l + 0l + 150 = 0. What is the remainder when l is divided by w? 2 Calculate the remainder when 201 is divided by (120 + -121)/((-2)/394). 4 Suppose -2l - 2 = -2t - 0t, 3l - 5t + 7 = 0. Suppose -4u + 295 = -l. Calculate the remainder when u is divided by 15. 14 Suppose 8v - 315 = v. Let w be 9/(-36) - 98/(-8). Suppose -h + 12 = k, -k = 2k + w. Calculate the remainder when v is divided by h. 13 Suppose -3480 = -10u - 0u. Calculate the remainder when u is divided by 88. 84 Suppose -8 = -2a + 12. Let h(o) = 9o + 3. Calculate the remainder when h(a) is divided by 12. 9 Calculate the remainder when (-14300)/(-88) - (-3)/2 is divided by 7. 3 Let v(i) = 7i + 4i*3 - 4i*2 + 6 - 9i + 3i. Calculate the remainder when v(3) is divided by 12. 9 Let t(w) = -w. Let o be t(-5). Suppose -2g + 9 = 5b, -4b - 4 = -og + 2. Suppose 0u = -gu + 98. What is the remainder when u is divided by 13? 10 Suppose 8b - 14b = -48. What is the remainder when 17 is divided by b? 1 Let b = -2 + 144. Calculate the remainder when b is divided by 36. 34 Calculate the remainder when 23 is divided by (-175)/(-25) + 4/2 + 3. 11 Let v(w) = w + 20. Let y(k) = -19. Let l(m) = 4v(m) + 5y(m). Calculate the remainder when l(15) is divided by 12. 9 Suppose 0 = -0b + 3b. Suppose h + 2h - 4d = 31, b = -5d + 25. Calculate the remainder when 33 is divided by h. 16 Suppose 39q - 1158 = 1845. Let b = 32 + -22. Calculate the remainder when q is divided by b. 7 Suppose 6a = -a + 301. Suppose -d + 4d = -3. What is the remainder when a is divided by 1/(2 + d) + 14? 13 Let r = 119 + -59. Let m be (-3)/(-5) + 1824/r. Let o = -8 + m. Calculate the remainder when o is divided by 8. 7 Let h = 409 - 393. Calculate the remainder when h is divided by ((-12)/(-10))/((-4)/(-30)). 7 Suppose 44g = 5g + 3588. Calculate the remainder when g is divided by 34. 24 Let g be (-4 + 2 - -41) + 1. Suppose -w - 3n + 8 = 0, -5w + 2n + 54 = 14. Suppose 13j - g = wj. Calculate the remainder when j is divided by 2. 0 Suppose 3c = 2o + 14, o = -2c + 4c - 11. Suppose -y - 57 = -77. Suppose -23v + 19v = -y. What is the remainder when c is divided by v? 3 Let w(s) = 2s - 1 - 5s + s - s. What is the remainder when (-608)/(-28) - (-4)/14 is divided by w(-3)? 6 Let h(u) = u*3 + 21u*2 + 45u + 20. Calculate the remainder when h(-18) is divided by 23. 21 Suppose -25 = -3b + d, 4 = 2b + 2d - 2. Suppose -bw + 10w = 36. Calculate the remainder when 47 is divided by w. 11 Let d(z) = -2z + 8. Suppose 4q - 2 = -0c + 2c, -5q - 2c - 20 = 0. Let o be d(q). Suppose 15i = oi + 42. Calculate the remainder when i is divided by 6. 2 Suppose -3d + 231 = -j, 6 + 3 = 3j. What is the remainder when 232 is divided by d? 76 Suppose -3t - 6 = -2c, 3c + 2t = -c + 28. Let l be (-20)/15c/(-4). Suppose p - lp = -4. Calculate the remainder when 13 is divided by p. 1 Suppose 0 = s + 54 - 142. Suppose 0 = b - 52 + 6. Calculate the remainder when s is divided by b. 42 Suppose -25t + 6t + 190 = 0. What is the remainder when 27 is divided by t? 7 Suppose -66m + 6545 - 979 = 55m. Suppose 0 = 3r, 3r = -t - 4t + 50. What is the remainder when m is divided by t? 6 Let b = 281 + -105. Calculate the remainder when b is divided by 91. 85 Let c = -932 - -1205. Calculate the remainder when c is divided by 58. 41 Let k be 3/2(-30)/9. Let a = k + 27. Let y = 76 - a. What is the remainder when y is divided by 28? 26 Let g(q) = -2q*2 - 16q + 9. Let y be g(-8). Suppose 90 = yn - 18. Calculate the remainder when n is divided by 4. 0 What is the remainder when 95 is divided by 32 + 105/75 + 15/25? 27 Suppose 2p = s + 139, p + 3s = -4p + 320. Let i = 88 - p. What is the remainder when 39 is divided by i? 18 Let w = -305 - -398. Calculate the remainder when w is divided by 12. 9 Let n be (1/(-3))/((-1)/21). Suppose 0 = r + n + 3. Let c = 29 + r. What is the remainder when 54 is divided by c? 16 Suppose 21 + 27 = 2z. Suppose -3b = -zb + 1113. Calculate the remainder when b is divided by 5. 3 Calculate the remainder when 52 - (8 + 5/(-5)) is divided by 8. 5 Suppose -48 = -0l - 4l + 5n	{ "pile_set_name": "DM Mathematics" }
-4/3o - 2/3o*2 - 2/3 = 0. -1 Let w(d) = -10d*4 - 20d*3 + 14. Let h(b) = 2b*4 + 4b*3 - 3. Let f(q) = -14h(q) - 3w(q). Factor f(x). 2x*3(x + 2) Let b(y) be the second derivative of 1/480y6 + 0y*5 - y + 0 + 1/840y*7 + 0y3 + y2 + 0y4. Let a(f) be the first derivative of b(f). Factor a(h). h3(h + 1)/4 Factor 4/3 + 2/3n3 - 2n + 0n2. 2(n - 1)*2(n + 2)/3 Let o(f) be the second derivative of f6/540 + f5/135 + f4/108 + f2 + f. Let d(i) be the first derivative of o(i). Determine r so that d(r) = 0. -1, 0 Factor 14/13t4 + 38/13t*3 - 4/13 + 30/13t*2 + 2/13t. 2(t + 1)3(7t - 2)/13 Let x(n) be the first derivative of n5/25 - 3n4/20 + n3/15 + 3n2/10 - 2n/5 + 1. Determine z so that x(z) = 0. -1, 1, 2 Let r = -53/11 - -5. Determine f so that -r - 4/11f - 2/11f*2 = 0. -1 Factor -1/2 - 2y - 3/2y2. -(y + 1)(3y + 1)/2 Find g such that -133g*2 + 105g*3 - 2g*2 - 292g + 12g - 60 - 80g*2 = 0. -2/3, -2/7, 3 Let t = -113/5 + 117/5. Factor 0 - 2/5z*5 + 6/5z*4 + 0z*2 + 0z - tz3. -2z*3(z - 2)(z - 1)/5 Let c(l) be the first derivative of l8/2520 + l7/630 + l6/540 + 2l*3/3 - 4. Let b(f) be the third derivative of c(f). Determine d, given that b(d) = 0. -1, 0 Factor -3/2p + 3/8p4 + 9/8p*2 + 3/2p*3 - 3/2. 3(p - 1)(p + 1)(p + 2)*2/8 Let u = -19 + 28. Let y be u/(-36) + 26/8. Suppose -1/4n*y - 3/4n*2 - 3/4n - 1/4 = 0. Calculate n. -1 Suppose 5r = -3h + 31, -r = h - 4r + 13. Suppose 1 = ho - 5. Factor 6i3 + i4 - 3i2 - i4 - oi5 - 3i*3 + 3i*4. -3i*2(i - 1)*2(i + 1) Let y(w) be the first derivative of -1/4w4 - 1/3w*3 + 5 + w + 1/2w*2. Solve y(v) = 0 for v. -1, 1 Suppose -8y = -5y - 5k + 3, 3k - 17 = -2y. Factor -9/4u - 7/2u*3 - 3/2u*y - 4u*2 - 1/4u5 - 1/2. -(u + 1)4(u + 2)/4 Let n(s) = 3s*2 - 2s + 48. Let r(f) = -f*2 - 16. Let c(l) = 4n(l) + 11r(l). Solve c(i) = 0 for i. 4 Let d(j) = 8j*2 + 68j. Let a(y) = 3y2 + 27y. Let v(i) = -12a(i) + 5d(i). Factor v(t). 4t(t + 4) Let b(a) be the second derivative of a9/37800 - a8/4200 + a7/1575 - a4/4 - 3a. Let z(q) be the third derivative of b(q). Factor z(j). 2j*2(j - 2)2/5 Let b(y) = y3 - 8y2 - 3y + 10. Let l be b(8). Let q be l/(-6) - 3/9. Suppose -20d - 3 - 7d*3 - 2 - 3 + 30d*q - 4d2 = 0. Calculate d. -2/7, 2 Let n = -2 + 4. Let t(r) = r2 - 7r + 9. Let y be t(6). Determine u, given that -1 + y + 0u + 2un - 3u - u = 0. 1 Let v(d) be the second derivative of -6d + 0d*4 + 1/2d*2 + 1/3d*3 - 1/30d*6 + 0 - 1/10d*5. Factor v(l). -(l - 1)(l + 1)*3 Suppose 3o - 4o = -13. What is l in 12l*3 + 11l + ol + 0l*3 - 2l*4 - 26l2 - 8 = 0? 1, 2 Let r(u) be the first derivative of u5/5 - 13u4/20 + 3u3/5 + u2/10 - 2u/5 - 3. Factor r(f). (f - 1)3(5f + 2)/5 Suppose -51 = y - 53. Let m(f) be the second derivative of -1/6f*4 - 1/16f*5 + 0 + 1/6f*3 - 3f + 0fy. Factor m(l). -l(l + 2)(5l - 2)/4 Let b(l) = l*2 + 8l + 4. Let o be b(-8). Factor 2j4 + 2j*3 + 0j*o + 3 - 3. 2j*3(j + 1) Suppose -68q = -64q. Let h(w) be the third derivative of qw4 - 1/60w*6 - 1/30w*5 + 4w*2 + 0 + 0w + 0w3. Factor h(y). -2y*2(y + 1) Let v(a) be the second derivative of 1/20a5 - 1/6a*3 + 0 - 1/12a*4 + 3a + 1/2a2. Let v(m) = 0. Calculate m. -1, 1 Let b(r) be the first derivative of 5r6/6 + r5 - 5r4/2 - 10r*3/3 + 5r*2/2 + 5r + 21. Determine s, given that b(s) = 0. -1, 1 Let x(q) be the first derivative of 2/3q - 5/9q*3 - 1/2q*2 - 1. Suppose x(u) = 0. What is u? -1, 2/5 Factor -50 + 48 - 6y*2 - 2y*3 + 4y*3 + 6y. 2(y - 1)3 Let l(k) be the second derivative of k7/1680 + k6/160 + k5/40 + k4/24 + k3/2 + 4k. Let h(x) be the second derivative of l(x). Solve h(f) = 0 for f. -2, -1/2 Let w(s) be the first derivative of s8/2520 - s7/630 + s6/540 + s3 + 1. Let c(j) be the third derivative of w(j). Find z such that c(z) = 0. 0, 1 Let t(o) be the second derivative of -1/42o3 + 0 - 1/140o*5 - 3o - 1/42o4 + 0o*2. Determine g so that t(g) = 0. -1, 0 Factor -3h*3 + 0h + 0h2 + 0 + 21/2h*4. 3h*3(7h - 2)/2 Suppose 0 = 5i - 6 - 14. Determine b so that -ib4 - 3b*5 - 4b*2 + 2b*3 - 4b - 8b3 + 2b*5 + 3b = 0. -1, 0 Determine b so that 1011b + 11b*3 - 4b*5 - 1018b + 4b4 + 2b*2 - 2 - 4b*2 = 0. -1, -1/2, 1, 2 Let n = 27333/1910 - 143/10. Let f = n - -183/764. Let 0j + 1/4j2 - f = 0. Calculate j. -1, 1 Let n(r) be the third derivative of r8/112 + r7/70 - r6/20 - 6r2. Solve n(z) = 0. -2, 0, 1 Let z(a) be the first derivative of a7/525 - a6/100 + a5/150 + a*4/20 - 2a3/15 - a2/2 - 2. Let l(i) be the second derivative of z(i). Factor l(j). 2(j - 2)(j - 1)*2(j + 1)/5 Let s(c) be the third derivative of c8/6720 - c7/1680 + c6/1440 - c3/3 + c2. Let a(q) be the first derivative of s(q). Factor a(b). b2(b - 1)2/4 Let x be 76/18 + (-40)/10. Factor -xz*2 + 2/9z + 4/9. -2(z - 2)(z + 1)/9 Let o(w) = -7w3 + 3w*2 + 15w + 15. Let z be 2/2 - -15. Let b(q) = -7q + 2 + 0q3 - q2 + 3q*3 - 9. Let p(t) = zo(t) + 13b(t). Factor p(d). -(d - 1)2(3d + 1) Let i = 2877898/2775 - 25793/25. Let b = i + -1/37. Factor s3 + 4/3 + bs + 13/3s2. (s + 2)2(3s + 1)/3 Let w(f) be the second derivative of 2f*6/15 + 4f*5/5 + 5f*4/3 + 4f*3/3 + 7f. Factor w(y). 4y(y + 1)*2(y + 2) Let s(a) = a*2 - 5. Let y be s(3). Solve 0i5 + i5 - 3i + 2i*5 - 5i*y + 6i2 - i4 = 0. -1, 0, 1 Let j = -45 - -45. Solve -3/2o2 - 3/4o + j - 3/4o3 = 0. -1, 0 Let g = 2/55 - -139/715. Let p = g + 17/39. Solve 1/3q*2 + 0q + 0 + 1/3q4 - pq3 = 0 for q. 0, 1 Let q(z) = -z2 + 1. Let i(k) = 2 + 0 + 2k3 + 2. Let n(c) = i(c) - 4q(c). Let n(g) = 0. What is g? -2, 0 Let c = -320/41 + 4921/205. Solve 6/5 + 21/5y4 - 39/5y - 69/5y3 + cy*2 = 0 for y. 2/7, 1 Suppose 0 = -23z - 13 + 82. Suppose 1/3l + 2/3 - 1/3l*z - 2/3l2 = 0. What is l? -2, -1, 1 Let t(h) be the third derivative of -h9/90720 - h5/60 + h2. Let o(g) be the third derivative of t(g). What is l in o(l) = 0? 0 Factor 1/2h2 + 0h - 1/2. (h - 1)(h + 1)/2 Let h = 3 + -3. Suppose -3x = -5c + 6, -3x - 6 = 3c - hc. Factor 2/3s + 0 + cs*2 - 2/3s*3. -2s(s - 1)(s + 1)/3 Let q(d) = -18d2 - 6d + 15. Let k(n) = n*2 - 1. Let g(m) = 15k(m) + q(m). Solve g(c) = 0 for c. -2, 0 Let n(y) = 3y2 - y3 - 5y*2 + 2y*2. Let s be n(0). Factor 2/3k + 2/3k2 + s. 2k(k + 1)/3 Let v(s) = s3 - 8s*2 + 7s. Let p be v(7). Let u(f) be the first derivative of 2/9f3 + pf + 2 - 1/6f4 + 0f*2. Factor u(m). -2m*2(m - 1)/3 Let c be -1 + 4/(120/78). Determine d so that cd2 + 0 - 18/5d*4 - 8/5d + 18/5d3 = 0. -2/3, 0, 2/3, 1 Let f(l) be the second derivative of 3l5/80 - l3/8 + 6l. Determine a so that f(a) = 0. -1, 0, 1 Let n(r) be the third derivative of -r5/80 + r4/16 - r3/8 + 9r*2. Factor n(v). -3(v - 1)*2/4 Suppose 36f = 56f. Let x = 0 - 0. Determine v so that 1/4v*2 + f + xv = 0. 0 Let n be 2/(3 - -3)6. Find r such that -4r*3 + 0 + 2r*4 + 0 + 4r*n - 3r*3 + 4r = 0. -1/2, 0, 2 Let j(o) be the first derivative of -2o2 + 3/4o*4 + 4/3o*3 - 1/6o*6 + 0o - 2/5o5 + 3. Factor j(v). -v(v - 1)*2(v + 2)*2 Let k = 47/66 + -6/11. Let c(b) be the third derivative of 0 + kb*3 + 1/60b*5 + 0b + 1/12b4 - 3b2. What is d in c(d) = 0? -1 Let c(b) = -b3 + 5 - 3 - 11b2 + 5b*2. Let u be c(-6). Factor -3x*2 + 3x*3 + 3x - 1 - ux3 + 0x2. (x - 1)3 Let z(p) = -10p2 + 33p - 2. Let h(q) = 9q2 - 33q + 3. Let b(l) = -6h(l) - 5z(l). Suppose b(x) = 0. Calculate x. 1/4, 8 Let y(d) be the second derivative of 0d2 + 0 + 2d + 1/6d4 - 1/3d*3. Determine r so that y(r) = 0. 0, 1 Let x(p) = -3p*3 - 2p*2 + 3p + 2. Let z be x(-2). Suppose z = 2i + i. Find v, given that 2/11v*5 - 4/11 + 6/11v + 0vi - 8/11v*3 + 4/11v*2 = 0. -2, -1, 1 Let g(u) = 3u*4 - 10u*3 - 5u*2 + 10u - 2. Let x(v) = 2v4 - 10v*3 - 5v*2 + 10v - 3. Let q(p) = 3g(p) - 2x(p). Solve q(s) = 0. -1, 0, 1, 2 Le	{ "pile_set_name": "DM Mathematics" }
- 455m2 - 2 + 2. -815m*2 Collect the terms in -375995h + 188000h + 187997h. 2h Collect the terms in 4611y - 9222y - 2y*2 + 4611y. -2y2 Collect the terms in 4g*2 + 28g*2 + 10g*3 - 59g*2 + 27g*2. 10g*3 Collect the terms in -3012m + 1 - 1 - 21. -3012m - 21 Collect the terms in -107f - 51f - 136f + 18f - 45f. -321f Collect the terms in b3 + 2b - 56b2 + 4b - 16b. b3 - 56b*2 - 10b Collect the terms in -3 - 516c + 404c + 233c + 3. 121c Collect the terms in -38s + 35s - 29s + 8s + 22s. -2s Collect the terms in -4 + 7 - 2 - 15w + 6w*3. 6w*3 - 15w + 1 Collect the terms in -3h3 + 48524 + 11h*3 - 11h*3 - 48524. -3h*3 Collect the terms in -8 + 32281w + 8. 32281w Collect the terms in -11k + 13k + 56627 - 113249 + 56622. 2k Collect the terms in -109s3 - 101s*3 + 1183s + 212s3. 2s*3 + 1183s Collect the terms in 129 + u + 1295 + 4u - 3u + 730. 2u + 2154 Collect the terms in -2w*2 - 13 + 13w*3 - 10w*2 - 22 + 35 - 16w*3. -3w*3 - 12w*2 Collect the terms in -1481 + 2241z + 1481. 2241z Collect the terms in -104l*2 - 12l*2 - 52l*2 - 69l*2 - 83l*2. -320l*2 Collect the terms in -167n*2 - 2 - 7 + 332n*2 + 3 - 163n*2. 2n*2 - 6 Collect the terms in 14391030314q*2 - 14391030314q*2 + 3q*3. 3q*3 Collect the terms in -30520i + 17i3 + 30522i - 4i3. 13i*3 + 2i Collect the terms in 2z3 - 5 - 7 + 12 - z2 - 19z*2. 2z*3 - 20z*2 Collect the terms in -5q*3 - 635529q + 635529q. -5q*3 Collect the terms in 1364h - 257h - 1111h. -4h Collect the terms in 5n*2 - 17694 - 4n2 + 17694. n2 Collect the terms in 330 + 59u3 + 161u*3 + 34u*3 - 330. 254u*3 Collect the terms in -11f + 0f2 - f2 + 0f*2 - 441f - 10 + 8. -f*2 - 452f - 2 Collect the terms in -3 - 4q + 4 - 8q + 8q. -4q + 1 Collect the terms in -13h2 + 44h + 18h - 37h*2 - 59h. -50h2 + 3h Collect the terms in -14 + 7b2 - 13 + 0b*2 + 10 + 19. 7b*2 + 2 Collect the terms in -7y + 3003 - 1549 - 1454. -7y Collect the terms in -51 - 433 + 105s*3 + 484. 105s*3 Collect the terms in -37w*2 - 34w*2 + 36 + 76w*2 + 24. 5w*2 + 60 Collect the terms in -82p*3 - 24p*3 + 20p - 10p - 10p. -106p3 Collect the terms in -47z*3 - 37z*3 + 20z*3 - 49z*3 - 11z*2 + 11z*2. -113z*3 Collect the terms in -4o + 5 - 68 + 27 + 29. -4o - 7 Collect the terms in -y2 - 798y + 10 - 34 + 7 + 15. -y*2 - 798y - 2 Collect the terms in 0a + 5739a*2 - 2869a*2 + 10a - 2875a2. -5a*2 + 10a Collect the terms in -11031f2 - 1685f*2 - 4089f*2. -16805f*2 Collect the terms in 84m + 91m - 27m - 2. 148m - 2 Collect the terms in -19x + 4669 + 57x - 4669. 38x Collect the terms in -8z - 4z - 6z + z + 9 + 8z. -9z + 9 Collect the terms in -35 - 61 + 150 - 56 + b. b - 2 Collect the terms in -176z*3 - 866z*3 - 33z + 33z. -1042z*3 Collect the terms in r - 1606 + 1606. r Collect the terms in -24b + b*2 + 11 + 5 + 27b - 3b. b2 + 16 Collect the terms in 4d*3 + 0d*2 + 3d*3 + 0d*2. 7d*3 Collect the terms in -604q*2 + 599q*2 + 6q - 17q + 11q. -5q2 Collect the terms in 8 + 0j3 + j3 + 204j - 2j3 - 8. -j3 + 204j Collect the terms in 6o*3 - 3499183o*2 + 3499183o*2. 6o*3 Collect the terms in -17i*2 - 308831i + 308831i. -17i*2 Collect the terms in 9241h + 1491 - 1491. 9241h Collect the terms in 150433 - 150433 + 2y. 2y Collect the terms in -206f + 48002f2 - 47993f*2 + 206f. 9f2 Collect the terms in -10z*2 + 2 - 9 + 4z + 7. -10z2 + 4z Collect the terms in -5 - 10 - 11 + 25c + 28. 25c + 2 Collect the terms in 6522n2 + 1239n*2 + 2335n*2 - 1429n*2. 8667n*2 Collect the terms in -24983z*3 - 6 - 7 + 13. -24983z*3 Collect the terms in 231b - 154b + 62b - b*2 + 281b. -b*2 + 420b Collect the terms in 157b - 44b + 9b2 - 28b - 85b. 9b*2 Collect the terms in -209585 + 9i + 104779 + 104806. 9i Collect the terms in -31w*2 - 3 + 16w*2 - 42w*2 + 3. -57w*2 Collect the terms in -9h - 15h + 17h. -7h Collect the terms in -30k*3 - 39k*3 - 7k*3 - 12k*3 - 13k*3. -101k*3 Collect the terms in -2033c*2 + 1017c*2 + 37 + 1018c*2. 2c*2 + 37 Collect the terms in -5h*2 + 28h*2 - 11h*2 - 8h*2 - 7h*2. -3h2 Collect the terms in i2 - 620665709891 + 620665709891. i*2 Collect the terms in 7q - 17q - 7q - 11q + 55q. 27q Collect the terms in -12 - 44u + 12 + 22u + 43u. 21u Collect the terms in -49l - 52l + 3l2 - l2 - 6l2 + 79l. -4l2 - 22l Collect the terms in 892t3 + 3 - 4t*2 - 1773t*3 + 3t*2 + 889t*3. 8t3 - t2 + 3 Collect the terms in -369f - 604f + 108f - 240f. -1105f Collect the terms in 27667q*2 - 13838q*2 - 13838q*2. -9q*2 Collect the terms in -235w*3 - 221w*3 - 216w*3 - 211w*3 + 881w*3. -2w*3 Collect the terms in -907f + 733f2 + 907f. 733f2 Collect the terms in -416 + 15m*2 - 15m*2 + 416 + 5m*3 + 4m*3. 9m*3 Collect the terms in -256h - 231h - 130h + 611h. -6h Collect the terms in -90w2 - 18w*2 - 22w*2 + 127w*2. -3w*2 Collect the terms in 5284 - 5284 + 278m. 278m Collect the terms in -420 - 52c*2 + 420 + 44c*2. -8c*2 Collect the terms in 2717c*2 + 6c*3 + 2677c*2 - 5394c*2. 6c*3 Collect the terms in -12r + 115 + 112 - 228. -12r - 1 Collect the terms in 674o*2 + 673o*2 - 2017o*2 + 673o*2. 3o*2 Collect the terms in -219t + 188t + 29t. -2t Collect the terms in -133 - 602 - 435 + 70 + 2h*2. 2h*2 - 1100 Collect the terms in 710 + 2k*3 + 1197 - 1907. 2k*3 Collect the terms in 6 + 4 - 260k + 303k. 43k + 10 Collect the terms in 16q - 13q - 22q - 2q2 - q2. -3q2 - 19q Collect the terms in -21a3 + 34a*3 + 0a + 7a - 7a. 13a3 Collect the terms in -411069 - 202a*2 + 411069. -202a*2 Collect the terms in 122y + 120y + 113y - 508y + 155y. 2y Collect the terms in 7n*2 + 18n*2 - 8 - 41n*2 + 7n*2. -9n*2 - 8 Collect the terms in 308 - 95 + 6j*2 - 105 - 107. 6j*2 + 1 Collect the terms in 3 + z + 325z2 + 1 + z3 - 4. z*3 + 325z*2 + z Collect the terms in -3221d*2 + 105 + 3221d*2 - 2d*3. -2d*3 + 105 Collect the terms in 28c - 4894c3 + 4914c*3 - 28c. 20c3 Collect the terms in 9z*2 - 5z*2 + 10z*2 + 8z*2 - 8z*2. 14z*2 Collect the terms in -9p - 13300p2 - 13p + 22p. -13300p*2 Collect the terms in -16u - 14u - 10u + 24u - 4u. -20u Collect the terms in 5p*2 - 306 + 4p + 306 - 11p. 5p*2 - 7p Collect the terms in -44k3 + 82k*3 + 63k*3 + 69k*3. 170k*3 Collect the terms in -11i + 34i - 11i - 12i + 40i*2. 40i*2 Collect the terms in -7753f + 3878f + 3430f. -445f Collect the terms in 14b + 11b - 2 + 0 - 3b. 22b - 2 Collect the terms in 4f - 5f3 - 109f*3 - 4f. -114f3 Collect the terms in 40 - 107 + 19s + 67. 19s Collect the terms in -155 + 80 + 75 + 5p. 5p Collect the terms in -41u*2 + 37u*2 - 10u*3 + 35274 - 35274. -10u*3 - 4u*2 Collect the terms in 32c*2 - 52c*2 + 231c*2 - 4c - 238 + 244. 211c2 - 4c + 6 Collect the terms in -4v3 + 2v*3 - 190 - 161 - 5. -2v*3 - 356 Collect the terms in -5i*2 - 10i*3 + 26i*3 + 5i*2 - 12i*3. 4i*3 Collect the terms in 0 + 5o + 0 + 2 - 8o - 540o*2. -540o*2 - 3o + 2 Collect the terms in 49c + 11c + 10c. 70c Collect the terms in 9a + 30062 - 30062. 9a Collect the terms in 121b3 + 105b*3 - 123 - 230b*3 + 123. -4b*3 Collect the terms in -114t - 247t2 + 114t. -247t2 Collect the terms in 7w - 539 + 39w + 545. 46w + 6 Collect the terms in 70536 - 14t2 - 70533 - 6t*2. -20t*2 + 3 Collect the terms in -101x + 6x2 + 8x*2 - 19x*2 + 101x. -5x2 Collect the terms in -322208 - 17w*3 + 322208. -17w*3 Collect the terms in 74831 + 37i*2 - 74831. 37i*2 Collect the terms in 3h*2 - 3h2 - h3 + 35h - 136h. -h*3 - 101h Collect the terms in -6710c2 + 3352c*2 + 5c*3 + 3350c*2. 5c*3 - 8c*2 Collect the terms in 1986f*2 - 179f*3 - 2f*3 - 1987f*2. -181f3 - f2 Collect the terms in 2021 - 198h3 - 2021 - 350	{ "pile_set_name": "DM Mathematics" }
rivative of -b*2cd2 + 2b*2d*3 - 14bcd*3 - 82bcd*2 + bd*3 + 119d*3 - 52d*2 wrt d. 12b*2 - 84bc + 6b + 714 What is the second derivative of -1293948u4 + 219247u + 4? -15527376u2 Find the first derivative of -538666h*2 - 242397. -1077332h What is the first derivative of -113476z2 - 43075 wrt z? -226952z What is the first derivative of 42354i - 10600? 42354 What is the third derivative of 4q*4 + 22574q*3v2 + q2v2 + 69775q*2v wrt q? 96q + 135444v*2 What is the derivative of -18233l*4 - 51075? -72932l*3 What is the third derivative of 2k*4y*2 - 2k*4y + 855k3y*2 - 56563k2 + y2 wrt k? 48ky*2 - 48ky + 5130y*2 Find the first derivative of -339w*4 + 53w + 1222092. -1356w3 + 53 What is the first derivative of 41hv + 20h - 1247v + 2199 wrt v? 41h - 1247 What is the second derivative of 46067i3n*2 + 10i*3n + 2i2n*2 - 98i*2n + 15 wrt n? 92134i3 + 4i*2 Find the third derivative of 3085l*4u*2 - 18l*3u*2 + 5l*2u*2 - 98l*2 + 5lu2 + l - 26 wrt l. 74040lu2 - 108u*2 Differentiate 82h*2p*3 - 11h*2p*2 - 8h*2 - 146p*3 + 820p*2 with respect to h. 164hp3 - 22hp2 - 16h What is the second derivative of -11y2z5 - y2z + 61360y*2 + yz - 7245z5 - z wrt z? -220y*2z*3 - 144900z*3 Find the second derivative of 44640i*4 + 18i + 969 wrt i. 535680i2 Find the third derivative of 2698487f3 + f2 - 939364f wrt f. 16190922 What is the third derivative of 121867r*3v*5 + 626r*3 - 24rv2 wrt v? 7312020r*3v*2 What is the first derivative of -38238n - 2474 wrt n? -38238 What is the derivative of 112h3 + 658h - 110370 wrt h? 336h2 + 658 Find the third derivative of 807933v*3 + 11v*2 + 487v - 13. 4847598 Find the third derivative of -119389k3 - 2k*2 + 49023k. -716334 What is the first derivative of 18n4 + 7487n*3x*3 - 42182x*3 - 3x wrt n? 72n3 + 22461n*2x*3 What is the second derivative of -3f*2y*3 - 6393f*2y + 2f2 + 11339fy3 wrt f? -6y*3 - 12786y + 4 Differentiate -1552a2g + 5a2 + adg - 1549d + g - 1 with respect to a. -3104ag + 10a + dg Find the second derivative of -397n2t3 - n2t - 8135n*2 - 48nt4 wrt t. -2382n*2t - 576nt*2 What is the third derivative of 25360p*3s*2 - 2p*2s*2 + 15024p*2 wrt p? 152160s*2 What is the second derivative of -2n*3q*2 - 10n*3q - 2n3 + 109nq2 + 4nqx - 11nq - 63q2x + 2q2 - qx wrt q? -4n3 + 218n - 126x + 4 Find the third derivative of -3u*3w4 + u3w2 + 3598u*2w*4 - 5228u*2w - 5w2 wrt w. -72u*3w + 86352u2w What is the third derivative of -87093a3 - 312a*2 - 8a - 1? -522558 What is the second derivative of 26c2p*3 - 4600c*2p*2 - 42cp3 - 27c - p*3 - 2 wrt c? 52p*3 - 9200p*2 Find the first derivative of 2165458x*4 + 620617. 8661832x*3 Find the second derivative of -227454bc2 - 2bc - b + 1000c + 5 wrt c. -454908b Find the third derivative of 85328f*4 - 70750f*2 wrt f. 2047872f What is the second derivative of 790i5 - 17i*4 - 30883i + 2? 15800i3 - 204i*2 Differentiate -583o*3 - 158o*2 + 279928 wrt o. -1749o*2 - 316o Find the first derivative of 2a3 + 1010a*2 - 2a + 32587 wrt a. 6a2 + 2020a - 2 What is the second derivative of -7cd*2 - 27cdq - 33cq*2 - 2cq - 5c - 44d2q*2 wrt d? -14c - 88q2 What is the second derivative of 2582q*3r3 - q3r + 2q*3 + 2qr3 - 9r*3 + 23r - 326 wrt r? 15492q3r + 12qr - 54r Find the first derivative of -320m*3v*2 - 4m*3v - 52557m3 + 2v*2 wrt v. -640m*3v - 4m3 + 4v Find the first derivative of -3439806z4 - 3631231. -13759224z*3 Find the third derivative of 272892x*5 + 22x*2 - 2006x + 1. 16373520x2 Find the third derivative of 159g*2h*4u*2 + 2g*2h*2u - 31g2h2 + g2hu*2 - 192h*3u*2 + 4h - 189u2 wrt h. 3816g*2hu2 - 1152u*2 Find the third derivative of 7478n*3z*6 - 901n*3z*2 + 11n*2 + nz*2 + nz + 3z3 wrt z. 897360n*3z*3 + 18 Differentiate 751w*2 + 105w + 147049 with respect to w. 1502w + 105 What is the third derivative of -5806d4 + d2 + 181d + 4 wrt d? -139344d What is the third derivative of -2h2t*3 - 40h*2t*2 - 2h*2 + 16hrt - ht3 + 4993rt3 wrt t? -12h*2 - 6h + 29958r Find the first derivative of 1414142p*3 + 3227589 wrt p. 4242426p*2 What is the derivative of -1291981c + 1188402? -1291981 What is the third derivative of -2v6x - 4464v4x - 5v2x - 8v2 + 34 wrt v? -240v*3x - 107136vx What is the first derivative of -14m3qy - 4m*3y - 6m3 - 4m*2y - 42491mq*4y - 1455y wrt q? -14m*3y - 169964mq*3y What is the second derivative of -261669f2 - 145135f? -523338 Find the first derivative of 131499q4 - 209426. 525996q*3 What is the first derivative of -6702c*2 + 71c - 2708669? -13404c + 71 Find the second derivative of 1162304z*4 - 797911z. 13947648z2 What is the second derivative of 2f*5 - 17172f*3 - 4f*2 - 78998f wrt f? 40f3 - 103032f - 8 Find the third derivative of 387c3f*3g*3 + 225c*3g3 + c2f2g*2 - cf*3g*2 - 49cg3 + 15f wrt c. 2322f3g*3 + 1350g*3 Find the first derivative of -5f*4 + 211f*3 - 14f*2 + 65862. -20f*3 + 633f*2 - 28f What is the first derivative of 396np*2q*2 - 1378np2q - 8p2q*2 - 80887p*2q wrt n? 396p2q*2 - 1378p*2q What is the first derivative of 8p2x*2 - 9p*2 - 9px2 - 6px - 2p + 2x - 288 wrt x? 16p*2x - 18px - 6p + 2 Find the third derivative of 2k*4 - 29140k*3 + 387265k*2. 48k - 174840 What is the derivative of -56698p - 110591 wrt p? -56698 What is the first derivative of 349306p + 544459? 349306 What is the first derivative of -48r2v*2 - 8r*2v - 53r2 - 10r - 31v2 - 38 wrt v? -96r*2v - 8r2 - 62v Find the third derivative of 7555n3p - 35n3 - 203443n*2p wrt n. 45330p - 210 What is the second derivative of 3300y*3 - 92y*2 - 217820y? 19800y - 184 Find the third derivative of -13g6 + g5 + 463g4 + 11g*2 + 3g - 14 wrt g. -1560g3 + 60g*2 + 11112g Find the third derivative of 3245q5 - q4u*2 - 3q*2 + 13226u*2 wrt q. 194700q*2 - 24qu2 What is the second derivative of -26h*4 + 336h*3 - 2h*2 + 1033160h? -312h2 + 2016h - 4 What is the second derivative of -23072g3q + g*2q*3 - 2gq3 - 4gq2 + 9gq - g + 11q wrt g? -138432gq + 2q3 What is the third derivative of 147d*6 - 7d*5 + 45115d*2? 17640d*3 - 420d*2 What is the second derivative of -19l*2x*2 - 1805l*2 - 2lx2 + lx + 28l + 276x wrt l? -38x2 - 3610 Differentiate 122007fq2z*3 - 34q*2z - 5q2 + 55z*3 wrt f. 122007q*2z*3 Find the second derivative of -147c*5 - 209c*2 + 812c + 26. -2940c3 - 418 What is the second derivative of 1073v*3z*3 + 16v*3 - 19962vz3 + 3vz wrt v? 6438vz3 + 96v What is the second derivative of -136590m3 + 1581m - 756? -819540m What is the second derivative of -fo*3s*2 - 1294fo3s + 2fo*2 + 23411fs2 - o3s - 13ox + 8s2x + x + 1 wrt s? -2fo*3 + 46822f + 16x Find the first derivative of 82f*3r + 1524822f3 - 5fr - 40r wrt r. 82f3 - 5f - 40 Find the second derivative of 11250t4 + 4t*3 + 272715t wrt t. 135000t2 + 24t Find the third derivative of 20c3t*2 - 150c*3t - 8c3 + 2c*2t*2 + 412c*2 + 22t*2 + 2t wrt c. 120t2 - 900t - 48 What is the third derivative of 2j6u + 110j3u + 2j2u + j*2 + 37ju + 7u wrt j? 240j3u + 660u Find the first derivative of -50o*2 + 74ow3 + 53630w*3 wrt o. -100o + 74w3 Find the third derivative of 19934x*3 + 471x*2 + 2x + 11. 119604 What is the derivative of 4588396x - 5327169 wrt x? 4588396 Find the second derivative of 2ad2k - 3adk - ak - a + 4945d2k + 4d + 2 wrt d. 4ak + 9890k Differentiate -682j4 - 196jn3 - 925n*3 - 16n*2 with respect to j. -2728j*3 - 196n**3 Find the s	{ "pile_set_name": "DM Mathematics" }
.7025 rounded to 2 dps? 0.7 Round 1390000 to the nearest one million. 1000000 What is -0.03098 rounded to 3 dps? -0.031 What is 196400 rounded to the nearest 10000? 200000 Round -7583.3 to the nearest 100. -7600 What is -0.04768 rounded to two dps? -0.05 Round -0.009696 to four decimal places. -0.0097 Round -0.0000158 to five dps. -0.00002 Round -415.9 to the nearest one hundred. -400 What is -332398 rounded to the nearest 10000? -330000 What is 102 rounded to the nearest 10? 100 What is 0.0001737 rounded to five decimal places? 0.00017 What is 574840000 rounded to the nearest one million? 575000000 What is -3120000 rounded to the nearest one million? -3000000 What is -0.1131 rounded to three decimal places? -0.113 Round -31.7 to the nearest 10. -30 Round -0.00017285 to five dps. -0.00017 Round -9139000 to the nearest 1000000. -9000000 Round 483.9 to the nearest 10. 480 Round -63217000 to the nearest 100000. -63200000 What is 0.0000026656 rounded to six dps? 0.000003 Round -0.00000060696 to seven dps. -0.0000006 What is 0.0013249 rounded to 4 decimal places? 0.0013 Round -494570 to the nearest ten thousand. -490000 What is -51870 rounded to the nearest 10000? -50000 Round 602300 to the nearest 100000. 600000 Round -0.0003052 to 5 decimal places. -0.00031 Round -4804 to the nearest one hundred. -4800 What is 0.000019 rounded to 4 decimal places? 0 Round -16.1418 to the nearest integer. -16 Round -273.252 to the nearest integer. -273 Round -76.42 to the nearest integer. -76 What is -0.11331 rounded to 3 decimal places? -0.113 What is 0.0000046476 rounded to 6 dps? 0.000005 Round -3173.6 to the nearest 100. -3200 What is -0.004461 rounded to 4 dps? -0.0045 Round 135700 to the nearest ten thousand. 140000 What is 0.22474 rounded to one dp? 0.2 What is 3371000 rounded to the nearest one hundred thousand? 3400000 What is 24.256 rounded to the nearest integer? 24 What is 0.00000605 rounded to 7 dps? 0.0000061 What is -0.0001015 rounded to 5 decimal places? -0.0001 Round -225200 to the nearest one hundred thousand. -200000 Round 0.10829 to 3 decimal places. 0.108 Round 1557 to the nearest 100. 1600 What is 431.75 rounded to 0 dps? 432 What is 91581 rounded to the nearest 1000? 92000 Round 0.00000629 to seven decimal places. 0.0000063 What is 0.02687 rounded to 3 dps? 0.027 Round 67011 to the nearest ten thousand. 70000 Round 0.000022414 to six decimal places. 0.000022 What is -86989000 rounded to the nearest one million? -87000000 Round 0.000016328 to seven dps. 0.0000163 What is 2245 rounded to the nearest one hundred? 2200 What is 65860 rounded to the nearest one thousand? 66000 What is 430.6 rounded to the nearest 10? 430 Round 1011.64 to the nearest one hundred. 1000 Round 5726 to the nearest 1000. 6000 What is 140.76 rounded to the nearest one hundred? 100 What is 0.000000653 rounded to 7 dps? 0.0000007 What is 0.00003622 rounded to 5 dps? 0.00004 Round 4522000 to the nearest 100000. 4500000 What is 0.0007287 rounded to 5 decimal places? 0.00073 What is 48380 rounded to the nearest one hundred? 48400 Round 275000 to the nearest 100000. 300000 What is -171.48 rounded to the nearest ten? -170 What is 945000 rounded to the nearest 100000? 900000 What is -7350 rounded to the nearest 1000? -7000 Round 0.0003421 to 5 dps. 0.00034 Round 55.4 to the nearest 100. 100 What is 0.0000027 rounded to 5 decimal places? 0 What is -0.02476 rounded to 3 dps? -0.025 What is 37.1 rounded to the nearest ten? 40 What is -30.78 rounded to the nearest integer? -31 Round -109.3 to the nearest 100. -100 Round 2.497 to zero decimal places. 2 What is -2634.7 rounded to the nearest one hundred? -2600 Round 300660 to the nearest one thousand. 301000 Round 6878.4 to the nearest one thousand. 7000 Round -0.00176 to 3 decimal places. -0.002 Round 24.268 to one decimal place. 24.3 What is -13000 rounded to the nearest one hundred thousand? 0 Round -1.0166 to one decimal place. -1 What is 1623400 rounded to the nearest one hundred thousand? 1600000 Round 4956070 to the nearest 100000. 5000000 What is 2.374 rounded to 1 dp? 2.4 What is -14955300 rounded to the nearest 1000000? -15000000 What is -12770000 rounded to the nearest 100000? -12800000 Round -2260.4 to the nearest 10. -2260 Round -0.000069751 to 6 dps. -0.00007 Round 0.0004728 to 4 decimal places. 0.0005 What is -0.0002989 rounded to five decimal places? -0.0003 What is 0.000007681 rounded to 7 dps? 0.0000077 Round 7697.1 to the nearest one thousand. 8000 Round 1.91518 to 3 decimal places. 1.915 What is -5351.8 rounded to the nearest 1000? -5000 Round 14.638 to 1 dp. 14.6 Round 0.0000010019 to seven dps. 0.000001 What is 18308 rounded to the nearest 100? 18300 Round 126.7 to the nearest 100. 100 Round -50.383 to one dp. -50.4 What is -1.1882 rounded to one decimal place? -1.2 Round -1.92056 to three decimal places. -1.921 Round 60.301 to the nearest 10. 60 What is -0.0000018987 rounded to seven decimal places? -0.0000019 What is 0.0000504825 rounded to 5 dps? 0.00005 Round 0.017583 to 4 decimal places. 0.0176 What is 0.007692 rounded to three decimal places? 0.008 What is -0.00002328 rounded to 6 dps? -0.000023 Round 0.0000247411 to 7 dps. 0.0000247 What is 77050 rounded to the nearest 10000? 80000 Round -0.000821 to 4 dps. -0.0008 What is -6720 rounded to the nearest 100? -6700 What is 0.000016065 rounded to six decimal places? 0.000016 Round -108300 to the nearest 10000. -110000 What is 4.7154 rounded to two dps? 4.72 What is 1289.5 rounded to the nearest one hundred? 1300 What is -0.00043156 rounded to 5 dps? -0.00043 What is 0.4151 rounded to 2 dps? 0.42 Round -4543.4 to the nearest 10. -4540 What is -1.56354 rounded to 3 decimal places? -1.564 Round 4583.2 to the nearest one thousand. 5000 Round 0.00005121 to six dps. 0.000051 Round -27600000 to the nearest 100000. -27600000 What is 29.14 rounded to the nearest integer? 29 What is 358500 rounded to the nearest 1000? 359000 Round 0.07683 to three decimal places. 0.077 Round -552500 to the nearest ten thousand. -550000 What is -120.1 rounded to the nearest integer? -120 Round -0.00012236 to five decimal places. -0.00012 What is 0.001128 rounded to 5 decimal places? 0.00113 What is 1642000 rounded to the nearest 10000? 1640000 Round -864.9 to the nearest 10. -860 What is 17278500 rounded to the nearest 100000? 17300000 What is -306370 rounded to the nearest one thousand? -306000 What is 56.3 rounded to the nearest integer? 56 Round 0.025707 to three dps. 0.026 Round -0.0000001986 to seven decimal places. -0.0000002 Round -8.4 to the nearest integer. -8 Round -9723000 to the nearest one million. -10000000 What is 9019000 rounded to the nearest one million? 9000000 Round 0.5446 to one decimal place. 0.5 What is -196824 rounded to the nearest one thousand? -197000 Round 14.153 to 1 decimal place. 14.2 Round -18240 to the nearest one thousand. -18000 What is 7.73 rounded to 0 dps? 8 Round -3.9696 to the nearest integer. -4 Round -0.000000004 to seven decimal places. 0 Round -0.0001244 to five dps. -0.00012 Round 0.0276 to 2 dps. 0.03 Round 13149800 to the nearest 1000000. 13000000 Round -77460 to the nearest one thousand. -77000 What is -292000 rounded to the nearest 10000? -290000 Round -0.0003527 to four dps. -0.0004 Round 0.026526 to three decimal places. 0.027 What is 0.00002691 rounded to 5 decimal places? 0.00003 Round 0.0067653 to three dps. 0.007 Round -0.001962 to four dps. -0.002 What is -17032700 rounded to the nearest 1000000? -17000000 What is -0.000256 rounded to five dps? -0.00026 Round 3724000 to the nearest one hundred thousand. 3700000 Round -0.00000331 to 6 decimal places. -0.000003 Round -6092 to the nearest 1000. -6000 What is -0.0000015074 rounded to 7 dps? -0.0000015 Round 4.172 to the nearest integer. 4 What is -24890 rounded to the nearest 1000? -25000 Round 0.00000181 to 6 dps. 0.000002 Round -10071100 to the nearest 100000. -10100000 What is 0.00001074 rounded to seven dps? 0.0000107 Round 0.01974 to 3 dps. 0.02 What is -62700 rounded to the nearest one thousand? -63000 Round -0.0012747 to four decimal places. -0.0013 Round -0.016275 to three dps. -0.016 Round -0.01041 to three decimal places. -0.01 What is 0.0002669 rounded to 5 dps? 0.00027	{ "pile_set_name": "DM Mathematics" }
+ 13. Suppose 0 = -t + 19 - 26. Is 15 a factor of p(t)? False Let c = 7 + 207. Let z = -6 + c. Does 26 divide z? True Suppose -4g + 180 = -4s, -2g - 2s = -58 - 48. Suppose -j + 5 = -0, 2i + g = -3j. Let v = i + 55. Is v a multiple of 9? False Let c(j) = j*3 - j - 2. Let i be c(2). Suppose 3d = 2p + 122, -3d + p + 134 = -ip. Is d a multiple of 8? False Let u(c) = 2c*2 - 2c - 2. Let r be u(-1). Suppose -3f - rm + 26 = 0, 2f + 0m = -m + 17. Does 2 divide f? True Let i(y) = y*3 - 8y*2 + 11y - 4. Let z be (-1)/4 - ((-99)/12 + 0). Does 9 divide i(z)? False Suppose -19f = -307 - 73. Does 5 divide f? True Let a(c) = -23c + 137. Is a(-41) a multiple of 15? True Is 18 a factor of 273 + 0 + 18/(-6) + 4? False Let r(v) = v*2 - 14v + 10. Let m be r(13). Suppose 0 = -c + 4f - 92, 4c = -5f - 323 + 60. Is 30 a factor of (c/(-16))/(m/(-40))? True Let f(b) = b2 + 10b + 15. Let m(q) = q*3 - 5q*2 + 2q + 2. Let r be m(4). Let s be f(r). Does 5 divide 54(15/s)/(-5)? False Let w be 120/(-2(-3)/4). Suppose -x + 4c = -3x + 110, -2x + w = -2c. Is x a multiple of 17? False Let u(n) = 3n3 - 4n - 1. Let q be u(-3). Let k = q + 178. Is 12 a factor of k? True Suppose 26k - 2542 - 4530 = 0. Is k a multiple of 8? True Let t be -2 + (2 - 663-3). Suppose 9q - 26q = -t. Is q a multiple of 39? True Let f = -116 - -118. Suppose -4a + 5r + 231 = 0, -fa - 2a = -4r - 232. Does 4 divide a? False Suppose 3z = -0z + 312. Suppose 0 = -5o + 4o + z. Is 29 a factor of o? False Suppose 11a = 6a + 35. Suppose -aw = -4w. Suppose 5b + 3c - 6c - 306 = w, 5c = b - 70. Is 20 a factor of b? True Let x(t) = 2t*2 + 5t - 6. Let a be x(2). Suppose 5f = -2 + a, 5v = 4f + 592. Is 12 a factor of v? True Let l = 1091 - 714. Is l a multiple of 29? True Let f = -22 - -22. Is 59 a factor of 6/(-24) - (f - 597/4)? False Let u be 2/11 - (-2133)/(-297). Let v(l) = l3 + 11l*2 + 16l + 8. Let o be v(u). Suppose -4h = -4t + o, 2t - 4h - 117 = -3t. Does 5 divide t? True Suppose 4c + 294 = 5w + 2c, 176 = 3w - c. Suppose -y + w = 13. Does 9 divide y? True Let u(s) = -s3 + 3s*2 - s - 9. Let t be u(4). Let y = -44 - t. Does 11 divide ((-5)/y)/(3/495)? True Let o = 10 + 1. Suppose m = -o + 5. Is 18 a factor of ((-162)/(-4))/(m/(-8))? True Suppose -3j = -2c + 75 - 13, -4j = 4c - 84. Is c - 2/(-2)-1 even? True Suppose -5d + 26 = h, 4d + 5h - 17 = 8h. Suppose -o + 32 = g, 13 + 7 = dg. Does 3 divide o? False Suppose 3r = -d + 8, 6d - 10d + 47 = -3r. Is 2 a factor of d? False Suppose -3 = 5r - 3u, 5 = r + r + 5u. Let s(d) = 21 + d*2 + 0d*2 - d - 16d*3 + 18d*3 - 3d*3. Is 12 a factor of s(r)? False Let a be 4/((-12)/9) - -21. Let l = a + -18. Suppose -2w = l, k - w = 2 + 4. Is k even? True Let y be (-30)/8 + 5/(-20). Let j be (y/(-8))/(2/(-260)). Let k = 116 + j. Is 17 a factor of k? True Suppose 3f - 22 = -5c, 5 = 4c + 4f - 11. Suppose -x + 0i - 2i + 112 = 0, -x + 120 = 4i. Suppose -n - x = -cn. Is 13 a factor of n? True Is (-2 - 3 - -5) + (1934 - 6) a multiple of 16? False Suppose 2g = -4g - 222. Let a = g + 91. Is 27 a factor of a? True Suppose o + 2k = 875, 6k = 3o + 4k - 2625. Suppose o = 5b - 5m, 5b + 2m = b + 682. Is b a multiple of 42? False Suppose -3y = -5y + 4. Suppose 30 - 6 = h + 2l, -50 = -2h - yl. Is 6 a factor of h? False Let c(a) be the first derivative of a3 + a2/2 + a - 2. Let g be c(-1). Suppose -2l + 164 = 5j, gj - l - l - 108 = 0. Does 17 divide j? True Does 4 divide (26 - 25)/(2 + 681/(-341))? False Let h(t) = 5t2 + 21t - 35. Is h(6) a multiple of 10? False Let q = 236 - 56. Suppose -6k + 54 = -q. Suppose c - k = -2c. Does 5 divide c? False Is 15/1037708/33 a multiple of 7? False Let m(y) = y2 - y - 2. Let u be m(1). Let v = u + 59. Does 19 divide v? True Let p = 106 - -6. Does 7 divide p? True Let m be 402/14 + (-42)/(-147). Suppose 0 = -y + 119 - m. Is 15 a factor of y? True Let d be 80/15(-9)/(-6). Let u be 3d4/24. Suppose -us + 97 - 21 = 0. Does 19 divide s? True Suppose -g + 4x + 557 = 0, -6 = -3x + 3. Is 12 a factor of g? False Let i be 0 + 1 - -1 - (4 + -12). Suppose 67 - i = j. Is 4 a factor of j? False Let o(p) = 6p*2 + 2p + 1. Let y be o(-2). Suppose j = -2d - 38, 0d = -d - j - y. Let h = 26 + d. Is h a multiple of 9? True Let a = 38 + -35. Suppose 4q - 37 = af - 285, f + 5q = 108. Does 32 divide f? False Let g(k) = k2 + 4k. Let q = 11 + -5. Let f(x) = x*3 - 6x*2 - 2x + 6. Let j be f(q). Is g(j) a multiple of 6? True Suppose -5r - 17 = v + 428, 0 = 5v + 4r + 2330. Is 13 a factor of 94/v + -1 + (-416)/(-5)? False Let p(u) = u2 - 2u - 11. Let i be p(5). Suppose ik = -2g - 3 - 183, -2k - 5g = 89. Let d = 75 + k. Is d a multiple of 14? True Let y be 1-28 - 16/4. Let v = y + 31. Is 22 a factor of v/(-3) - (-910)/42? True Let a be (-4 - 124/(-5))/(2/15). Suppose -44w + a = -40w. Is w a multiple of 7? False Suppose -9p + 6p + 48 = 0. Suppose pq - 21 = 15q. Does 20 divide q? False Let y be (-8)/(-32) - (-1182)/8. Let i = y + -100. Is 12 a factor of i? True Let s(m) = m3 + 16m*2 + 6m - 14. Does 62 divide s(-6)? True Let z(k) = k*3 + 11k*2 - 2k - 8. Is z(-6) a multiple of 8? True Let x = 46 + -43. Suppose -5b + 3o = -0b - 300, 120 = 2b + xo. Is 15 a factor of b? True Let u be (-36981)/(-84) - ((-3)/4 + 1). Suppose -j = 5c - 149 - 291, 5c - 2j - u = 0. Is c a multiple of 22? True Let y = 38 + -36. Suppose -ys = -o - 0o + 47, 3o + 4s = 151. Does 7 divide o? True Suppose 4h - 76 = 176. Let j be h/7 - 8/2. Let x(s) = 3s + 11. Does 6 divide x(j)? False Let b be 1 + -1 + (-2 - -5). Suppose 2k - k - 96 = bz, 288 = 3k - z. Is k a multiple of 8? True Let g = -1390 + 1826. Is g a multiple of 6? False Let w(a) = 0a + 12a2 - 28a*2 - 8a + 15a2 - 10. Let l be w(-5). Suppose 12 = lx - 5h - 8, -4h + 20 = 0. Is x a multiple of 2? False Let s be (6/5)/(1/(-10)). Suppose -211 - 185 = 22p. Is 16 a factor of (183/2)/(p/s)? False Suppose 233 = -3s + 1259. Does 57 divide s? True Suppose 1120 = -c - 9c. Let y = c - -162. Is 25 a factor of y? True Suppose -o + 1 = -4. Let w(n) = -5n*2 + 5n + 14. Let x(v) = -5v2 + 7v + 15. Let k(d) = -3w(d) + 2x(d). Is k(o) a multiple of 27? True Suppose 2b + 5d - 16 - 19 = 0, 10 = 2d. Suppose -7n + bn + 216 = 0. Is n a multiple of 36? True Suppose -p + 16 + 4 = 0. Let q = p - 12. Suppose 0 = 2k + q, 0 = -4b - 0k + 5k + 164. Does 20 divide b? False Suppose 4k - 2814 = b - 3b, b - 1422 = k. Is 61 a factor of b? False Let q = 74 - -334. Is 15 a factor of (q/(-32))/((-3)/32)? False Let z be ((-8)/(-20))/(2/20). Suppose z - 6 = y + 2a, 2y = -2a. Suppose 2u = y + 12. Does 3 divide u? False Let t(r) be the second derivative of r3/6 + 2r*2 - 3r. Is t(18) a multiple of 22? True Let s = -403 - -491. Is s a multiple of 88? True Let y = 5398 + -2263. Does 15 divide y? True Let t = -7 + -4. Let x = t - -42. Is 11 a factor of x? False Let y(q) = q*2 + 3q + 259. Is 8 a factor of y(0)? False Is 3 a factor of (-9 - -3) + (357 - -6)? True Let m(y) = y3 - y2 + y - 192. Let i be m(0). Let s be (-18)/(-8)i/(-18). Does 18 divide 4/(s/9)24? True Let m be 1 + -2 - (-3 - -2). Suppose 0 = -3d - 12, d = 3o - md - 232. Is o a multiple of 10? False Suppose 247 = -2f + 415. Does 28 divide f? True Let p = 1505 - 548. Is 33 a factor of p? True Suppose 0 = 13c - 7669 + 1026. Is 21 a factor of c? False Let n = 39 - -1005. Does 58 divide n? True Is 6/24-2-1234 a multiple of 63? False Suppose 4 = 2m + 2g, 3m + 4 = -4g + 13. Is 23 a factor of -3 + (-1 - m - -72)? True Let g = 411 - 160. Does 10 divide g? False Let x(s) = s3 + 21s*2 - 36s - 20. Is x(-22) a multiple of 18? True Suppose -3r + 4r = 2p + 18, -2p - 50 = -3r. Let f = 245 - 101. Suppose 0 = 12y - ry + f. Is y a multiple of 18? True Let m(y) = -8y*3 - 2y*2 - 49y - 8. Is 42 a factor of m(-6)? False Let w be (44/(-10))/(1/(-35)). Suppose -4k + 174 = -5i - w, -393 = -5k + 2i. Is k a multiple of 5? False Suppose 0 = -3v - 3, -3n - 3v + 133 = -950. Let h = -227 + n. Is h a multiple of 27? True Let z = 18 + -10. Let d be ((-2)/3)/(z/(-24)). Suppose n = 0, dq + 3*n - 20 = 6	{ "pile_set_name": "DM Mathematics" }
+ 6 - 1 - 9n2 - 3 to sn*2 + f + yn and give s. -9 Rearrange -16o - 39o + 1 - 1 to t + wo and give w. -55 Rearrange (-2m - 2m2 + 2m)(-21 - 30 + 11) to the form u + qm + nm2 and give n. 80 Express -2a + 4a - a + (-4 + 4 - 2)(1 - 1 - a) + 3a - 1 + 8a - 7a as z + ka and give z. -1 Rearrange -33z + 59 - 59 to the form wz + c and give w. -33 Express (1 + 2 - 4)(1 - 9 - 8)(2t - 3t - t) in the form dt + c and give d. -32 Rearrange (-3 + 2p*3 + 3)(0 + 1 - 3) + (4p3 - 2p*3 - 5p*3)(-1 - 1 + 1)(-2 + 3 + 0) to tp*2 + b + lp + yp3 and give y. -1 Express -17 + 17 - 6j in the form rj + s and give r. -6 Express -2n*2 + 2n*2 - 2 + 4n + n + 7n2 in the form ln*2 + sn + z and give s. 5 Rearrange -13d2 + d3 - 2d*3 - d - d to cd + sd2 + kd3 + j and give k. -1 Express ((-u2 + 3u2 + 0u*2)(3u + u - 5u) - 14u3 - 8u*3 + 3u*3)(-2 + 4 - 1) as au2 + l + iu + ru3 and give r. -21 Express 7 - 9o + 14o + 7 - 7 as c + zo and give z. 5 Express 2 - y*4 + 350y - 351y + 4y3 + y3 as k + xy4 + qy*2 + oy*3 + gy and give g. -1 Express 3j - 4j + j*2 + 3j + 2j as h + pj + uj2 and give p. 4 Express 0l + l*3 + 2l - l*2 + 0l*2 + 3l*2 as a + kl*2 + vl + xl3 and give x. 1 Express 197 + 13h*2 - 197 in the form gh*2 + qh + z and give g. 13 Rearrange -4 + r*3 + 5r*2 - 5r - 2 + 5r to the form jr + y + zr2 + cr*3 and give c. 1 Express (-2 - 1 + 4)(-262 + 262 + 15v) as iv + m and give i. 15 Rearrange -49r + 87 - 87 to the form a + cr and give c. -49 Express 19j - 20j + 73 + 20 in the form y + vj and give y. 93 Express (31b + 11b + 101 - 44b)(b - 3 + 3) as a + pb*2 + db and give p. -2 Rearrange 2r2 + 4r*4 - 39r + 38r - 5r*4 - 2 - 33r*3 to br + m + sr4 + zr*2 + wr*3 and give m. -2 Rearrange -2t*3 - 7t*4 + 8 + 2t + 2t4 - 5t*4 - 7 to o + mt + pt4 + xt*2 + nt*3 and give o. 1 Rearrange (-2a*3 + 0a*3 + 3a*3)(-1 + 6 + 4) - 2a + 2a - a*3 to na*3 + fa + l + ka2 and give f. 0 Express -3v*3 + 0v4 + v4 + v + 5v3 - 2v - 5 in the form r + xv2 + dv + cv3 + gv*4 and give g. 1 Rearrange -11t*3 - 9t*3 - 37 + 21t*3 to the form pt + xt3 + u + gt*2 and give u. -37 Rearrange -6a + 0a + 3a + 2 + a*3 + a to the form b + za + ta2 + ra*3 and give r. 1 Express g + 1 - 2g - 8g2 - 2g*3 + 2g + g*3 as j + xg*3 + ug + qg2 and give x. -1 Rearrange (0l*3 + 4l*3 - 6l*3)(-3 + 3 + 4l) - 5l*4 - 2l*4 + 3l*4 to hl*4 + zl*2 + ml + y + dl3 and give h. -12 Express (p3 - 4p*3 - 2p*3)(-11p + 8 - 8) as jp*2 + vp*4 + d + bp*3 + cp and give v. 55 Rearrange 25a + 1 + 36a - 32a to the form m + pa and give m. 1 Express -3m2 + 0m*2 + 7m*2 + (-3m*2 + 0m2 + m2)(-3 - 6 + 3) - m2 - 2m*2 + 4m*2 as pm*2 + n + fm and give f. 0 Express 9n4 + 21n*4 - 6n4 + (2 - 2 - n3)(n - 3n + 0n) in the form kn*4 + w + qn*3 + in*2 + mn and give k. 26 Express ((3k2 - 2k*2 - 3k*2)(2k - 2k + k) - 8k3 + 5k*3 + 2k*3)(3 - 3 + 4k) as mk*3 + nk + lk2 + q + ak*4 and give n. 0 Rearrange 3153o*2 - 3151o*2 + 50o - 11o to so*2 + u + io and give s. 2 Rearrange -i*2 - 111 - 10i + 110 - 4i2 + 3i*2 to the form mi*2 + l + ui and give m. -2 Express w + 0 + 1 - 4w2 - 2 + (3 - 1 - 1)(-4 + w*2 + 4) + 3w2 + w2 - 2w2 as sw*2 + qw + t and give q. 1 Rearrange (1 + 2 - 1 + 12)(-12 + 12 + 4g) to the form qg + s and give q. 56 Rearrange -c2 - 6c*3 - 26c*3 + 12c*3 to the form gc*3 + kc*2 + a + ic and give g. -20 Rearrange -2g2 - 2g*2 + 45 - 42 + 6g*2 to d + hg*2 + zg and give d. 3 Express -2 + 4 + 728d - 766d as g + hd and give g. 2 Rearrange (-b - 2 + b2 + 4b - b)(-2b + b + 0b)(-2b + 0b + 32b) to the form ob*4 + db*2 + lb*3 + y + nb and give l. -60 Rearrange -3g - 73g + 27g to the form w + cg and give c. -49 Express -25z3 + 1 + 26z*3 + 0z - 13z2 - 2z*2 + 2z in the form t + nz2 + wz + az3 and give t. 1 Express -3g*2 + 6 + 3 + 1 + 1 in the form z + og*2 + qg and give o. -3 Express (-1 + 0 + 2)(4l - 5 + 5)(5 + 2 - 3) as cl + h and give c. 16 Rearrange (4s - 5s + 3s)(-s*2 + 2 - 2) + 11s*3 - 6s + 6s to n + ds + bs3 + rs*2 and give b. 9 Rearrange -2 - 24m - 7 + 9 to p + bm and give b. -24 Rearrange (-2q*2 - 3 + 3)(-4q2 + 0q*2 + 0q*2) - 2q*4 + 7q*4 + 0q*4 - 2q*3 to the form cq + fq4 + tq*3 + sq*2 + m and give t. -2 Rearrange (-8 + 8 + 11m)(-m + m + 2m) to cm + v + lm2 and give l. 22 Express ((-3 - n2 + 3)(2 - 6 - 1) + n2 + n2 - 3n*2 + 4n - 4n - 2n*2)(3 - 1 + 1) in the form pn2 + un + m and give p. 6 Express 0 - 15p + 0 - 9p as s + kp and give k. -24 Express -3i - 38i + 4i as x + wi and give w. -37 Rearrange (0 + f + 0)(1 - 2f - 1)(-7 + 4 - 14) to mf2 + pf + o and give m. 34 Rearrange (-2g2 + 2 - 2)(-39 + 3 + 75) to the form n + yg2 + mg and give y. -78 Express -4c + 3c3 - c2 + 4c + 0c in the form sc3 + oc + zc2 + j and give z. -1 Rearrange (3 - 3 + 1)(3 - 3 - o)(-1 - 6 + 3)(-13 + 13 - 20o) to the form yo + zo2 + f and give z. -80 Rearrange (5 - 3 + 0)(3 - 3 - r) - 26 + 26 + 4r to the form nr + a and give n. 2 Express 2f3 + f4 + 2f*2 - 856f + 856f - 2 in the form df*2 + y + bf*3 + qf*4 + wf and give q. 1 Rearrange -35l2 - 5l*2 + 2l*2 - 9l*2 to r + ml + sl2 and give s. -47 Rearrange (2 - 4 + 0)(-n*3 + 3n*3 - 4n*3) + 2n*3 - 3n*3 + 4n3 - n3 + 3n3 - 3n*3 to the form r + dn + tn2 + an3 and give t. 0 Rearrange (m3 - 2m2 + 4m*3 - 4m*3)(4m + 8 - 8) to p + qm*3 + jm*4 + ym + km2 and give q. -8 Rearrange -4r*4 - 20r*3 + 20r*3 + (3r + 4r3 - 3r)(0 + 0 - 2r) to the form ur3 + nr + tr4 + vr*2 + b and give t. -12 Express -123s - 39s4 + 123s + (s*4 + 3s*4 - 2s*4)(-1 + 3 - 3) in the form u + ks2 + js*3 + ys*4 + ns and give y. -41 Rearrange (-4p + p - 5p)(26 + 7p - 26) to the form kp + qp*2 + f and give q. -56 Rearrange -17q + 3 - q*2 + 16q + 3 + (2q + 4q - 3q)(-2q + 0q + 4q) + 2 - 2q*2 - 2 to xq + uq2 + t and give t. 6 Rearrange 24 - 24 + 14q to tq + x and give t. 14 Express -21b*2 + 13b*2 - 12b*2 as jb + rb2 + t and give r. -20 Express 2h - 4 - h + 16 - 2h as uh + b and give b. 12 Rearrange (-5z + 2z + 2z)(4 + 0 - 5) - 63z - 61z + 90z to the form az + i and give a. -33 Rearrange -2m2 - 16 + 0m2 + 17 - m4 to pm + n + im*4 + gm*2 + km*3 and give g. -2 Express 14 + 4z*2 - 14 in the form xz*2 + pz + f and give p. 0 Rearrange -47n - n2 + 9n*3 - 3 + 4 + 48n to the form mn3 + bn + f + in2 and give i. -1 Express -4 + 2b - b*4 - 3b*2 - 1 - b + 3 as lb*2 + kb*4 + ob*3 + ub + f and give o. 0 Rearrange 4h2 - 3h*2 + 4h*2 + 2 to s + ph*2 + zh and give z. 0 Express -o*2 - 2 + 1 + 4 as qo*2 + bo + r and give q. -1 Express 4v + v3 + 0v*3 + 5v*2 + 2 - 4v*2 as dv*3 + l + zv*2 + sv and give l. 2 Express (-3y + 7y + 4y)(8y2 + 10y*3 - 8y2) + y2 + y4 - y2 as hy3 + w + cy*2 + uy + my4 and give m. 81 Express -2y - 6y - 2y + 2y as xy + q and give x. -8 Rearrange 0k3 - 13k*2 + 3k2 + k3 to the form pk + lk*3 + xk*2 + f and give x. -10 Rearrange -12m - 24m + 5m - m to the form h + am and give a. -32 Rearrange 8s - 30s - 29s to ms + n and give m. -51 Express (41p - 43p + 49p)(-3 + 2 + 2) in the form xp + l and give x. 47 Rearrange (-8 - 2 + 1)(d - 2 - 3d - 2d) to sd + i and give i. 18 Express -l - 42 - 8l + 42 in the form fl + i and give i. 0 Rearrange 29f2 + 35 + 0f3 + f3 + 2f2 - 37 to t + uf*2 + nf*3 + rf and give n. 1 Express 3a3 - 4a - 4a2 + 3a*2 - a + 2a*2 in the form ja*3 + w + xa + da2 and give j. 3 Express 5u - u*4 + 2u*3 - 3u + 2u4 in the form pu*4 + s + wu*2 + ju*3 + xu and give s. 0 Rearrange (-3v4 + 0v4 + v4)(28 + 28 + 48) to uv*3 + xv + pv2 + b + nv**4 and give n. -2	{ "pile_set_name": "DM Mathematics" }
econd derivative of 0f - 3f + 0f - 4f3 + fr wrt f. -18f Suppose -k + 2 = -3. Find the third derivative of f5 + 0f*5 + 3f*2 + 2f*k wrt f. 180f2 Let p(c) be the third derivative of c9/3780 + c7/630 + c4/12 + 3c2. Let g(i) be the second derivative of p(i). Find the third derivative of g(t) wrt t. 96t Let m(f) = -f*3 - 2f*3 + 4f + f3 + 1 + 2. Let p(k) = k3 - k. Let j(g) = -m(g) - 4p(g). What is the first derivative of j(i) wrt i? -6i*2 Let t be (-3)/(-2)40/30. Find the third derivative of -o*t + 3o*4 - 7 + 7 wrt o. 72o What is the second derivative of -3819y2 + 28y*4 + 3819y*2 + 5y wrt y? 336y2 Suppose 3f - 4c - 42 = 0, -51 = -f - f - 5c. Let d be (-4)/f - 2/(-9). What is the second derivative of do + 2o - o*2 - 3o*2 wrt o? -8 Let d be 3/6(2 + 2). What is the first derivative of l*4 + dl4 + 4 - l4 wrt l? 8l3 Let f(r) be the first derivative of -2 + 0r - 7/4r4 + 0r*2 - 2/3r*3. Find the third derivative of f(a) wrt a. -42 Find the second derivative of -345g*5 + 0 + 1 + 753g*5 + 2g - 350g5 wrt g. 1160g*3 Let m(r) be the second derivative of 0r*3 + 7/20r*5 - 3r + 7/2r2 + 0 + 0r*4. What is the derivative of m(x) wrt x? 21x*2 Differentiate -h - 1 - 5 - 21h + 73 wrt h. -22 Let n = 2 - 5. Let k be (-2 - n - 1) + 2. What is the third derivative of -3tk + 0t*2 + 4t6 - t6 wrt t? 360t3 Let q(i) be the second derivative of -i5/15 - i4/8 + i2 - 4i. Let b(h) be the first derivative of q(h). What is the second derivative of b(o) wrt o? -8 Let g = -11 + 15. What is the third derivative of -2z4 + 7z*2 + 0z*2 + 9z*g wrt z? 168z Let m(s) = 35s4 - 2s*3 + 5s. Let g(b) = 141b4 - 9b*3 + 19b. Let y(l) = -2g(l) + 9m(l). Find the second derivative of y(j) wrt j. 396j2 Let l = 26 + -23. Find the third derivative of 32p*l - 4p*2 - 22p3 + p2 - 4p2 wrt p. 60 Let m(p) be the first derivative of p4/4 - 17p*2/2 + 4. Find the second derivative of m(i) wrt i. 6i Let i = -5 + 7. Differentiate ic - 2c - 5c3 + 4c*3 + 2 with respect to c. -3c*2 Let g be 210/412/20. Let h(p) be the second derivative of -3/2p*2 + 0p*3 + 0 + 1/6p*4 - gp. Differentiate h(w) with respect to w. 4w Let u(i) = -5i*5 + 2i*4 + 2i*2 + 13i - 2. Let j(v) = -v5 - v4 - v*2 + 1. Let c(z) = -4j(z) - 2u(z). What is the second derivative of c(f) wrt f? 280f*3 Let m = -9 + 13. Suppose 0u - 8 = -mu. Differentiate 3r*2 - 3r*2 + 2r*3 + u wrt r. 6r*2 Let p be (6/(-3))/(2/(-4)). Find the second derivative of 3c - 4c4 + 3cp - c4 wrt c. -24c2 Let x(a) be the first derivative of -3/2a*2 + 3a + 3. Differentiate x(n) wrt n. -3 Let b be 2/8 - (-38)/8. What is the third derivative of 5u2 - bu*5 - 3u*5 + 11u*5 - 2u*2 wrt u? 180u*2 Let s(j) = 5j2 - j + 1. Let t be s(1). Find the third derivative of -r4 + tr2 - 8r + 6r + 2r wrt r. -24r Let u(d) = 21d - 2. Let o(x) = -10x + 1. Suppose -39 = 3v - 6v. Let i(f) = vo(f) + 6u(f). Find the first derivative of i(z) wrt z. -4 Let g(d) be the second derivative of d5/5 + 11d*2/2 + 8d. What is the first derivative of g(t) wrt t? 12t2 Let z = 4 - 2. Suppose -2p = -3p + z. Find the first derivative of 2 + 5x + x*p - 5x wrt x. 2x Suppose -z = 5g + 6, -5z = -5g + 14 + 16. Let p = 8 + z. What is the second derivative of -pd2 + 4 - 4 + d wrt d? -4 Let n(k) = 7k*4 + 4k3 + 4. Let x(b) = -b3. Let a(o) = -n(o) - 4x(o). What is the derivative of a(v) wrt v? -28v*3 Find the third derivative of -15 - 29i2 - i4 + 6i4 + 15 wrt i. 120i Suppose -3j + 2 + 4 = 0. Let z(p) = -p3 + 4p2 + p - 2. Let h be z(4). Find the third derivative of u2 - 4uh + 0uj - u5 wrt u. -60u2 Let j(k) be the first derivative of -5/2k*2 - 3 + 0k*3 + 1/5k*5 + 0k*4 + 0k. What is the second derivative of j(h) wrt h? 12h2 Let w be (-72)/(-15) + 2/10. Find the first derivative of w + 1 - 3b - 4 + 0 wrt b. -3 Differentiate -3 + 6 + 2r2 + 4 + 3r*2 with respect to r. 10r Let c(s) be the third derivative of -2s2 + 0 + 1/8s*4 + 0s + 1/2s3. What is the first derivative of c(n) wrt n? 3 Let i(c) be the third derivative of 0c*3 + 0c*6 + 0c*7 + 0c*4 + 1/12c*5 + 0c - 5c2 - 1/336c*8 + 0. Find the third derivative of i(a) wrt a. -60a*2 Let r be 4 - (-2)/(2 + 0). Let f = 3 - 1. Find the second derivative of 8u + ruf - u2 - 5u wrt u. 8 Let o(c) be the first derivative of -2c5/5 - 3c*2/2 - 74c - 42. Differentiate o(z) wrt z. -8z3 - 3 Let a be (-3 - -1 - 9)-1. Let n(u) = 13u - 5. Let m(q) = 7q - 3. Let s(f) = am(f) - 6n(f). What is the derivative of s(v) wrt v? -1 Let f(b) be the third derivative of 0b3 + 0b - 1/12b4 - 2/15b*5 + 0 - 8b*2. What is the second derivative of f(i) wrt i? -16 Let f be 4/(4/(-7)) - 3. Let n = -10 - f. Find the third derivative of -3c*2 - 3c*4 + 0c + 2c4 + nc wrt c. -24c Suppose -f - 18 = -2f. Suppose -5b - 5o = -30, 7b - f = 2b - 2o. What is the second derivative of 2l + 2l2 + lb + l4 - 3l*2 wrt l? 12l2 Let u(j) be the second derivative of j6/10 - 15j2/2 - 45j. What is the first derivative of u(t) wrt t? 12t3 Let v = 5 + -4. Let k(y) = -2y*4 + 5y2 - 1. Let a(x) = -x2 + 1. Let s(o) = vk(o) + 5a(o). Differentiate s(b) with respect to b. -8b3 Let t(s) = -11s*2 + 19s + 2. Let z(r) = -10r2 + 20r + 3. Let a(l) = 3t(l) - 2z(l). What is the second derivative of a(q) wrt q? -26 Let n(g) = 2g4 - g3 + 3g + 1. Let l(p) = p*3 - 1. Let m be 2/11 + (-36)/(-44). Let q(w) = mn(w) + l(w). Find the second derivative of q(t) wrt t. 24t2 What is the first derivative of 81w*2 - 19w*3 - 81w*2 + 6 wrt w? -57w2 Let d(p) be the second derivative of -p6/40 + 7p4/24 + p2/2 + p. Let n(t) be the first derivative of d(t). Find the second derivative of n(k) wrt k. -18k Suppose 0 = 4i + i - 10. Find the third derivative of 4r*3 - 6r*i + r + 0r*3 - r wrt r. 24 Let x(b) = -13b*2 - 12b + 5. Let r(t) = 6t2 + 6t - 3. Let s(i) = -5r(i) - 3x(i). Find the second derivative of s(u) wrt u. 18 Let l(q) be the third derivative of q8/1680 - q6/180 + q*3/6 - 3q*2. Let x(c) be the first derivative of l(c). Find the third derivative of x(s) wrt s. 24s Let m(c) = -2c - 2. Let o be m(-5). What is the third derivative of -6p*2 + op*3 - 4p3 + p3 wrt p? 30 Suppose 7w - 20 = 2w. Let u = 6 - w. Find the third derivative of t*u + 0t2 + t2 + t*4 wrt t. 24t Let g(b) = b + 4. Let w(c) be the second derivative of -c*3/3 - 3c*2/2 + 4c. Let y(u) = 2g(u) + 3w(u). Differentiate y(m) with respect to m. -4 Let k(q) be the second derivative of 41q5/20 - 3q4/2 - q3/3 + 8q + 4. Find the third derivative of k(r) wrt r. 246 Let v(c) = 3c*2 - 10c + 3. Let w(q) = -5q2 + 15q - 4. Let i(l) = -8v(l) - 5w(l). Let d be i(-6). Differentiate -d + 1 - o*2 - 3 + 3 wrt o. -2o Let f(d) = -3d + 3. Let q(c) be the first derivative of -2c*2 + 4c + 1. Let k = -1 + -5. Let s(v) = kf(v) + 4q(v). Differentiate s(g) wrt g. 2 Differentiate 12 + 6g - 7g*2 - 6g - 2g2 wrt g. -18g Find the third derivative of 2g4 - 171g*2 + 138g*2 - 2g*4 - 44g*6 wrt g. -5280g*3 Let c(v) be the second derivative of -2v + 1/12v4 + 0 + 0v*3 - 1/15v*6 + 0v*5 + 0v*2. Find the third derivative of c(z) wrt z. -48z Let j(y) be the first derivative of -y8/1680 - y6/72 + y*3 + 1. Let d(t) be the third derivative of j(t). What is the third derivative of d(r) wrt r? -24r Suppose 2u - 5t = 2, -3t + 8 = -3u + 20. Let v be (-2)/4 + (-15)/(-6). Differentiate -1 + urv - 6r2 + r4 wrt r. 4r3 Let y(h) be the first derivative of h4/2 - 7h3/3 - 2. Find the third derivative of y(k) wrt k. 12 Find the first derivative of -s4 - 7s4 - 2 + 3 + 3s*4 wrt s. -20s*3 Let v be (0 - 1 - 3)/(-1). Suppose -4k = -12 + 4. What is the third derivative of m*4 + vm*2 + 0m*4 - 3m*k wrt m? 24m Let l(o) = -3o - 8. Let q(s) = 14s + 41. Let p(a) = 11l(a) + 2q(a). Find the first derivative of p(z) wrt z. -5 Suppose z + 0 - 2 = 0. Suppose -z*u + 4 = -0. Different	{ "pile_set_name": "DM Mathematics" }
he third derivative of z(j). Give i(d(b)). 108b Let i(s) = -13s - 2. Let h = 505 - 383. Let g(n) = -6n2 + h - 62 - 60. Give i(g(u)). 78u*2 - 2 Let r(m) = -41319m + 2 + 41317m - 2. Let q(y) = 352y*2. Give q(r(a)). 1408a2 Let t(j) be the second derivative of -j3 + j. Let p(i) be the second derivative of -i*4/3 + 5i + 2. What is t(p(v))? 24v2 Let g(x) be the third derivative of -x5/60 - 9x*4/8 - 1782x*2. Let h = 8 + -3. Let m(n) = hn - 7n + 0n. Calculate m(g(p)). 2p2 + 54p Let b(j) be the first derivative of j*6/90 + 74j*3 + 44. Let g(x) be the third derivative of b(x). Let t(a) = 19a*2. Give t(g(c)). 304c*4 Let v(a) = 9a*2 + 28a + 14. Let o(n) = -5n2 - 16n - 8. Let d(t) = 7o(t) + 4v(t). Let u(z) = -415z. Calculate d(u(f)). 172225f*2 Suppose -6 = 3r - 6r. Let n(x) = -3x*2 - 2xr - x2. Let w(c) be the third derivative of 2c5/15 - 127c*2. What is n(w(p))? -384p*4 Let d(u) = -13u*2 + 3u + 12u2 - 3u. Suppose 6z = 17 - 5. Let w(a) = -5a*z - 19 + 19. Give d(w(b)). -25b*4 Let c(q) = 1407q. Let o(d) = 80034d. Calculate o(c(z)). 112607838z Let w(l) = 434l2. Let y(r) = -65r + 150r - 92r. Give w(y(g)). 21266g2 Let o(f) = -1 + 2 + 2406f - 2498f. Let n(j) = -j. Calculate n(o(b)). 92b - 1 Let f(k) = 5k2 - 8k - 2. Let r(x) = x*2 + 2x + 1. Let w(y) = f(y) + 2r(y). Let b(i) = -14i*2. Calculate w(b(q)). 1372q*4 + 56q*2 Let y(p) be the second derivative of -19p*3/6 + 4479p. Let n(b) = 1. Let x(z) = 4z2 - 4. Let o(t) = -4n(t) - x(t). Determine y(o(u)). 76u2 Let l(h) = -151h - 638h - 473h. Let c(f) = f. What is l(c(z))? -1262z Let f(q) = 2q*2. Let j(k) = -34524663k*2. Calculate f(j(l)). 2383904710527138l*4 Let n(y) = 5866029y. Let z(d) = -14135d. Let o(k) = -2n(k) - 831z(k). Let g(b) = -b2. Determine g(o(j)). -199572129j*2 Let q(r) = -40r. Let h(a) be the second derivative of -a*5/24 + 143a*3/6 - 25a. Let y(v) be the second derivative of h(v). Give q(y(w)). 200w Let x(q) = -69q2 - 1. Let j(m) be the second derivative of m4/4 + 8m + 8. Determine x(j(r)). -621r*4 - 1 Let o(a) = -2a. Let q(r) = 37r2 + 3966699r + 2. What is q(o(k))? 148k2 - 7933398k + 2 Let u(v) = -v*2 + 939v + 1. Let j(l) = 2l + 2038. Give j(u(z)). -2z*2 + 1878z + 2040 Let p(t) = 4t. Let a(v) = -39v. Let g(y) = -21y. Let j(d) = -a(d) - 15g(d). Calculate p(j(w)). 1416w Let k(p) = 7p*2. Let j(b) = 5b - 187. Let o be j(38). Let l(q) = 105q2 + oq - 63q2 - 3q. Calculate l(k(u)). 2058u4 Let t(r) = -53r. Let w(c) = 136080c. Give t(w(f)). -7212240f Let o = -71 + 245. Let u(p) = -184 + p*2 + 4p*2 + 358 + 4p - o. Let f(s) = 3s. Give f(u(d)). 15d*2 + 12d Let f = 15 - 6. Let x be f + -3 + 1 + 14/(-7). Let w(h) = -10h2 - 6. Let j(d) = -10d*2 - 5. Let u(a) = xw(a) - 6j(a). Let b(s) = 2s. Determine b(u(t)). 20t2 Let m(j) = 65j*2. Let k(p) = 65p - 11p - 9p - 19p. Give k(m(h)). 1690h*2 Let r(m) = -163m. Let t(q) be the second derivative of 7q + 0 + 0q*2 - 1/6q*3. What is r(t(x))? 163x Let w(o) = -140o2 + 66o*2 + 87o*2. Let a(c) = -132c*2. Give a(w(b)). -22308b*4 Let a(y) = 7y. Let n(x) = -90x2 - 40x - 280. Let c(s) = -s*2 + 2s + 14. Let i(q) = -20c(q) - n(q). Calculate i(a(z)). 5390z*2 Let d(p) = -5812552p. Let o(q) = -2q. What is d(o(u))? 11625104u Let v(z) = -4z + 3. Let w(l) be the second derivative of -2/3l*3 + 6 - 12l + 0l2. Determine v(w(o)). 16o + 3 Let j(v) = 2v2. Let o = 36 - 34. Suppose -5x + 966 = g - 742, 678 = ox + 3g. Let t(n) = 342n - xn - 13n2 - 8n*2. Give j(t(c)). 882c*4 Let b(v) = -8v. Let x(j) be the second derivative of 0j2 + 9j + 1/6j3 - 2. Calculate b(x(q)). -8q Let z(m) = 7m. Suppose -5q + 11q - 18 = 0. Let v(j) = 9j2 - 10. Let h(c) = c2 - 2. Let r(p) = qv(p) - 15h(p). Determine z(r(o)). 84o2 Let o(y) = -62227y - 610. Let b(d) = -d*2. Give o(b(g)). 62227g*2 - 610 Let q = -8951/18 + 4480/9. Let y(d) be the first derivative of -qd*2 + 37 + 0d. Let c(t) = -4t. Determine c(y(a)). 4a Let q(f) be the second derivative of 233f4/12 - f2/2 - 4510f + 1. Let b(m) = -m*2. Calculate b(q(d)). -54289d*4 + 466d*2 - 1 Let u(b) = 62 - 40b + 144b - 101b. Let v(l) = 2l - l + 3l - 2l. Determine v(u(x)). 6x + 124 Let p(z) = z - 4z + 0z. Let l(y) be the first derivative of 0y + 182 - 16/3y*3 + 0y*2. Give l(p(k)). -144k*2 Suppose 45u = 10 + 35. Let w(v) = -8v - 11v - 1 + 15v + u. Let a(x) = -12x*2 - 1. What is w(a(r))? 48r2 + 4 Let d(z) be the second derivative of -z2 - 4z + 0z*4 + 0z*3 + 0 - 1/20z*5. Let n(x) be the first derivative of d(x). Let o(c) = -c. Give n(o(a)). -3a*2 Let r(i) be the third derivative of 1/30i*5 - 109i*2 + 0i*4 + 0i + 0 + 0i3. Let d(j) = -156j. Calculate d(r(h)). -312h2 Let w(p) = -16p*2. Let i(b) = -4189 - 37b*2 - 4192 + 8381. What is i(w(h))? -9472h*4 Let y(s) = -975s*2. Let j(n) = -2n + 633638 - 633638. What is y(j(a))? -3900a2 Let w(d) = 688d. Let p(f) = 53486f + 3. What is w(p(j))? 36798368j + 2064 Let a(c) = 200c2 + c + 34. Let p(t) = 29t. Calculate p(a(i)). 5800i2 + 29i + 986 Let j(h) be the second derivative of 253h4/12 - 1226h. Let o(w) = -7w2. Calculate o(j(u)). -448063u*4 Let d(g) = -141g. Let h(m) = -1281m. Let c(p) = 91d(p) - 10h(p). Let v(s) = 464s*2. Calculate v(c(f)). 204624f2 Let m(k) be the first derivative of k2 - 99k + 1313. Let d(y) = 26y*2. What is d(m(j))? 104j*2 - 10296j + 254826 Let m(c) = 2c. Let f(z) = 894z - 18. Let u(r) = -1391960r + 28035. Let k(g) = 3115f(g) + 2u(g). What is k(m(n))? 1780n Let l(t) = 123t2 + 0 - 64t*2 + 2 - 58t*2. Let q(p) = -2p*2 - 3. Let s(g) = 3l(g) + 2q(g). Let x(r) = -8r - 2. Give s(x(k)). -64k2 - 32k - 4 Let w(j) = 2j - 2535. Let s(l) = 6l - 7572. Let m(o) = -2s(o) + 7w(o). Let c(y) = y. Give c(m(d)). 2d - 2601 Let t(l) = -6l*2. Let b(s) = -1106807s. Calculate t(b(a)). -7350130411494a2 Let o(d) = -10d + 57. Let p(u) = 30u2 + 1079u. Calculate o(p(t)). -300t2 - 10790t + 57 Let d(v) = 33v2 + 7v - 2. Let c(h) = 17h2 + 4h - 1. Let k(i) = -7c(i) + 4d(i). Let m(a) = -20a. What is m(k(x))? -260x2 + 20 Let q(r) be the first derivative of -r2 - 1026. Let i(c) = -8c - 9. Determine q(i(u)). 16u + 18 Let s(j) = 2j. Let n = -89 + 92. Let c = 8 - 7. Let o(t) = -3. Let r(a) = -a2 + 1. Let b(u) = co(u) + nr(u). Determine s(b(y)). -6y*2 Let u(k) = 12k2. Let f(v) be the second derivative of -v3/6 - 21v2 - v + 299. Calculate u(f(q)). 12q*2 + 1008q + 21168 Let i(t) = -5t2 + 11t*2 + 8t*2. Let q(v) = 45v + 227. Let z be q(-5). Let k(b) = -21b2 - 44b*2 + 62b*z. Calculate i(k(h)). 126h*4 Let u(d) = -357d. Let a = -18 + 20. Let n(g) = 2 - ag2 + 21 - 23. Calculate u(n(i)). 714i*2 Let f(u) be the second derivative of 12u*4 - 3u + 181. Let b(q) = -8q2. Give b(f(r)). -165888r*4 Let u(m) = -14m2. Let b(w) be the second derivative of w4/12 - w*3/6 - 4w - 10. Let j(n) = 20n2 - 15n. Let p(d) = 15b(d) - j(d). What is p(u(h))? -980h*4 Let u(z) = -5072 - 5061 + 2z + 10137. Let f(k) = 15k2. Give f(u(g)). 60g*2 + 240g + 240 Let y(d) be the second derivative of d*4/2 - 2d. Let h(m) be the third derivative of m*4/4 + 25m*2 + 444. What is h(y(v))? 36v*2 Let z(g) = 10g2 + 1. Let w(o) = -o2 - 38o + 401. Let s be w(-46). Let p(n) be the second derivative of 0 + 1/3n*3 - sn + 0n2. Calculate z(p(a)). 40a*2 + 1 Let m(v) be the first derivative of -4v*2 - 1. Let b(r) = 57r + 4. Let p(s) = -1285s - 90. Let g(x) = -45b(x) - 2p(x). Give g(m(k)). -40k Let t(y) = 5329164y. Let b(k) = -8k*2. Determine b(t(g)). -227199911511168g*2 Let j(l) = -88364l*2. Let i(s) = -18s*2. Calculate j(i(f)). -28629936f4 Let p(l) be the second derivative of l3/6 - 42l - 4. Let a(r) = -3170r. Give a(p(u)). -3170u Let j(r) = -4r. Let i(y) = -3y2 + y + 1. Let s(d) = 483d*2 - 4d - 4. Let a(p) = 4i(p) + s(p). Determine j(a(z)). -1884z*2 Let c(w) = 12w + 4. Let a(g) = 461673g. Calculate c(a(f)). 5540076f + 4 Let o(m) = -252m + 95m	{ "pile_set_name": "DM Mathematics" }
e prob of sequence dcf. 3/286 Four letters picked without replacement from mmmmmnmmnnmmnmnnmmn. Give prob of sequence mnmm. 385/3876 Two letters picked without replacement from vfvfyfsssvvyvvvvvywv. What is prob of sequence yv? 3/38 What is prob of sequence gfjk when four letters picked without replacement from {k: 4, j: 1, x: 4, g: 1, f: 1}? 1/1980 Calculate prob of sequence hlln when four letters picked without replacement from sqqhssqlllsnnlqnssv. 1/2584 Three letters picked without replacement from {h: 4, s: 1, o: 4, m: 3, r: 1, w: 1}. Give prob of sequence whr. 1/546 Four letters picked without replacement from {f: 1, c: 1, u: 2}. Give prob of sequence ucuf. 1/12 Two letters picked without replacement from {v: 2, f: 1, c: 1, a: 2, e: 1, r: 2}. What is prob of sequence aa? 1/36 Calculate prob of sequence aaa when three letters picked without replacement from afasfassssafafa. 4/91 Four letters picked without replacement from {g: 2, y: 2, v: 1, j: 5, s: 6}. Give prob of sequence sjvj. 1/364 Three letters picked without replacement from szwyizrsw. What is prob of sequence zyw? 1/126 Four letters picked without replacement from {b: 4, k: 2, h: 2}. What is prob of sequence kbhb? 1/35 Two letters picked without replacement from {j: 3, w: 4}. What is prob of sequence jj? 1/7 Two letters picked without replacement from rbrbbbbbrbbbbrbrbb. Give prob of sequence bb. 26/51 Calculate prob of sequence ruw when three letters picked without replacement from ekrkurkuuwr. 1/110 Four letters picked without replacement from {j: 2, d: 2, p: 4}. What is prob of sequence ddpp? 1/70 Two letters picked without replacement from {n: 6, s: 1, w: 3, f: 8}. What is prob of sequence wn? 1/17 What is prob of sequence ta when two letters picked without replacement from {z: 2, t: 3, a: 2, y: 1, o: 6}? 3/91 Three letters picked without replacement from ggggwgggwgg. What is prob of sequence ggg? 28/55 Three letters picked without replacement from mvfvtws. What is prob of sequence vmw? 1/105 Three letters picked without replacement from {g: 5, q: 1, z: 1, l: 1, e: 3}. Give prob of sequence lqe. 1/330 What is prob of sequence ltj when three letters picked without replacement from tjlttttgtgjl? 1/55 Three letters picked without replacement from {l: 4, i: 3, x: 4}. Give prob of sequence xll. 8/165 What is prob of sequence mgcg when four letters picked without replacement from {i: 1, c: 2, g: 2, m: 6, p: 1}? 1/495 What is prob of sequence yk when two letters picked without replacement from yvkfyky? 1/7 What is prob of sequence ly when two letters picked without replacement from {d: 1, j: 2, l: 3, b: 4, y: 2}? 1/22 Two letters picked without replacement from {a: 1, f: 4, b: 7, w: 1}. Give prob of sequence fa. 1/39 Four letters picked without replacement from {v: 4, u: 1, y: 1, f: 1, h: 3, g: 4}. Give prob of sequence vgyu. 2/3003 Four letters picked without replacement from {f: 11, u: 1}. What is prob of sequence fuff? 1/12 What is prob of sequence nuy when three letters picked without replacement from {y: 4, n: 2, u: 5}? 4/99 Four letters picked without replacement from {k: 5, f: 1, e: 3, w: 6}. Give prob of sequence efww. 1/364 Two letters picked without replacement from ebded. Give prob of sequence ee. 1/10 Calculate prob of sequence ad when two letters picked without replacement from wdadawwddddwwwa. 3/35 What is prob of sequence brm when three letters picked without replacement from mrbmbmbrrrrmmwrmmb? 7/204 Calculate prob of sequence hh when two letters picked without replacement from {a: 2, h: 4, v: 2}. 3/14 Calculate prob of sequence uk when two letters picked without replacement from {h: 2, k: 3, u: 1, z: 1}. 1/14 Four letters picked without replacement from nttnnnnnnn. Give prob of sequence tntn. 1/45 What is prob of sequence ggy when three letters picked without replacement from ggggyggg? 1/8 Two letters picked without replacement from xbxxxxxbxxxb. Give prob of sequence bb. 1/22 Calculate prob of sequence ggzo when four letters picked without replacement from {m: 3, j: 3, z: 3, o: 1, g: 5}. 1/546 Three letters picked without replacement from lpflzluflfufzffpplrl. What is prob of sequence lfp? 3/190 Two letters picked without replacement from zzmmmzezmzmeeezz. What is prob of sequence mm? 1/12 What is prob of sequence dca when three letters picked without replacement from {y: 2, a: 1, c: 1, l: 2, j: 1, d: 1}? 1/336 Four letters picked without replacement from {i: 10, p: 3, j: 2}. What is prob of sequence jiij? 1/182 What is prob of sequence vnv when three letters picked without replacement from {v: 3, n: 3, x: 4, g: 1}? 1/55 Four letters picked without replacement from nnrrnrnnrrnnnnnn. Give prob of sequence rnrr. 11/728 Two letters picked without replacement from xxxxxxxexxxxe. What is prob of sequence xe? 11/78 Three letters picked without replacement from {r: 3, e: 5}. What is prob of sequence err? 5/56 What is prob of sequence ct when two letters picked without replacement from {c: 1, p: 3, s: 1, l: 7, t: 1}? 1/156 Two letters picked without replacement from {q: 2, k: 3, p: 2, y: 3, e: 1, n: 1}. Give prob of sequence yp. 1/22 What is prob of sequence cq when two letters picked without replacement from {x: 6, c: 1, q: 1, h: 2, y: 1, m: 4}? 1/210 Three letters picked without replacement from {e: 2, l: 1}. Give prob of sequence ele. 1/3 Three letters picked without replacement from {m: 1, t: 1, k: 1, p: 1, s: 1}. Give prob of sequence kmt. 1/60 Calculate prob of sequence klsf when four letters picked without replacement from {e: 1, f: 3, k: 3, s: 3, l: 2, n: 3}. 3/1820 What is prob of sequence rvr when three letters picked without replacement from rvvvvvvvvvrvvvvvvvvv? 1/190 Four letters picked without replacement from {w: 5, b: 4, v: 1, j: 6}. Give prob of sequence jvbb. 3/1820 Four letters picked without replacement from rbibhiiihiihkih. Give prob of sequence khbb. 1/4095 What is prob of sequence vv when two letters picked without replacement from fvv? 1/3 Four letters picked without replacement from hhhhhkhhhhhohh. Give prob of sequence hhok. 1/182 Calculate prob of sequence soqq when four letters picked without replacement from sooqoqjqssmvmmo. 1/455 Two letters picked without replacement from ggngzezgagza. What is prob of sequence ne? 1/132 Two letters picked without replacement from {z: 2, q: 3, u: 1, p: 1}. What is prob of sequence zq? 1/7 Four letters picked without replacement from zwoywwwn. Give prob of sequence owzy. 1/420 Two letters picked without replacement from jthjbhtbj. Give prob of sequence bj. 1/12 Calculate prob of sequence uagx when four letters picked without replacement from uahxxlgallaxagl. 1/1365 Two letters picked without replacement from tjtathaujsa. What is prob of sequence aa? 3/55 Calculate prob of sequence dcz when three letters picked without replacement from {c: 1, z: 2, d: 1, n: 3}. 1/105 Three letters picked without replacement from {q: 2, f: 3}. Give prob of sequence fqf. 1/5 What is prob of sequence cl when two letters picked without replacement from {l: 11, c: 1}? 1/12 Four letters picked without replacement from ogoeyddgedgd. What is prob of sequence gdgg? 1/495 What is prob of sequence ma when two letters picked without replacement from {m: 3, r: 1, a: 11}? 11/70 Calculate prob of sequence vvs when three letters picked without replacement from vvvvvvvvvvvvsvvsvvv. 16/171 Three letters picked without replacement from jrqqjr. What is prob of sequence jrj? 1/30 Two letters picked without replacement from qqqqqdqqdqq. What is prob of sequence dd? 1/55 What is prob of sequence lh when two letters picked without replacement from hhhhhhhhhlhh? 1/12 Two letters picked without replacement from {v: 3, g: 9, j: 4}. What is prob of sequence jv? 1/20 Two letters picked without replacement from prccrccrrrc. Give prob of sequence cc. 2/11 Three letters picked without replacement from {f: 2, l: 1}. What is prob of sequence ffl? 1/3 Calculate prob of sequence ll when two letters picked without replacement from gllgglglslls. 5/22 What is prob of sequence yly when three letters picked without replacement from {l: 14, y: 4}? 7/204 Four letters picked without replacement from {t: 3, a: 4, f: 3, u: 7, m: 1}. What is prob of sequence ufut? 7/136	{ "pile_set_name": "DM Mathematics" }
= tw(s) - r(s). Determine i(2). -3 Let h be 0/((-3 - -4) + -3)1. Let g(z) = -4z2 + 114z*3 - 50z*3 + z + 1 - 63z*3 + 4z2. Calculate g(h). 1 Let v(w) = -w2 - 2w. Let d(g) = -g3 - 11g*2 - 13g - 5. Let r(b) = -d(b) + 6v(b). Suppose -7o = 32 + 3. Determine r(o). 0 Let x(m) = m*2 + 2m + 1. Let z(b) = 4b - 44. Let n be z(5). Let j be (-10 + 3 - -3)/(n/6). Suppose -f = d + 6 - j, 0 = -3f - 2d - 14. Calculate x(f). 9 Let x(b) be the first derivative of -5b - 231 - 1/4b4 - b3 + 2b*2. Give x(-4). -5 Let w(t) = 9t + 1. Let m(u) = 37u + 32. Let k(o) = m(o) - 5w(o). Calculate k(3). 3 Let n(o) = 2o2 - 6o + 4. Let b be n(-2). Suppose 0 = 9y - 12y - b. Let t(l) = -l*2 - 9l + 11. Give t(y). 19 Let u(g) = g*2 - 34g - 65. Let d(b) = 3b2 - 96b - 130. Let c(h) = 2d(h) - 5u(h). Determine c(19). 8 Suppose -2v - 7q + 11q = -42, -v + 22 = -q. Let j(i) = -i + 25i + 14 - vi. What is j(-19)? -5 Let o = -342 + 393. Suppose 71m = 88m - o. Let j(c) = c2 - 4c + 6. Determine j(m). 3 Let m(u) = -3u2 + 2u - 1. Suppose 4d - 12 = 0, 4d = 2z + 2d + 822. Let i = z - -409. Calculate m(i). -2 Let v(i) = -i + 2. Let q(r) be the second derivative of r*3/3 - 4r*2 + 179r. Let c(o) = 3q(o) + 8v(o). Calculate c(-8). 8 Suppose -25 = -5a + 5t, 2 = 5a + t - 35. Let j(x) = -3 + 2x - x - 4. Let g be j(a). Let w(b) = b*2 + b - 7. Give w(g). -7 Let m(c) = 7c*3 + 7c + 7. Suppose -11f - 214 + 203 = 0. Calculate m(f). -7 Let j(d) = 69d - 1461. Let p be j(21). Let k(b) = -b - 5 - 11 - 7 + 7 + b*3 + 12b2. What is k(p)? -4 Let y(n) = -n2 + 4n + 26. Let a be y(7). Suppose am - 2s = 3m - 106, 4m + 217 = -s. Let c = 58 + m. Let j(g) = -g3 + 4g*2 - 3g - 3. What is j(c)? -15 Let u = 9527 + -9513. Let j(a) = -2a2 + 27a + 12. Determine j(u). -2 Let v be (17 - 15)(10/12 + (-2)/6). Let p(l) = -36l3 + l2 + 2l - 3. What is p(v)? -36 Let y(f) be the third derivative of f6/360 - f5/120 - f4/24 + 49f*3/3 - 2f2 + f. Let o(l) be the first derivative of y(l). Determine o(-4). 19 Let v(j) be the third derivative of -j4/24 - j*3/3 - 144j*2. Let g(y) = 4y + 17. Let p(c) = -g(c) - 3v(c). Determine p(-7). -4 Let y(c) = -c + 7. Let v(n) = -8. Let x(q) = 4v(q) + 5y(q). Suppose 3k + 6 = 0, 0h = -2h - 3k + 162. Suppose -h = -21o - 7o. What is x(o)? -12 Let n(y) = -2y*2 + 5y + 3. Let z be 2/(4 + 76/(-16) - (-104)/96). What is n(z)? -39 Let v(p) = -7p - 84. Let r be ((-805)/92)/(55/88). Give v(r). 14 Let u(n) = -323 - 4n - n + 358. Let q be u(7). Let b(g) = g3 + g2 + g + 6. Give b(q). 6 Suppose 17u = 22u - 505. Let y = 103 - u. Let z(q) = 8q. Give z(y). 16 Let y(o) = -5o*2 + 5o - 25. Let t(q) = -7q2 + 10q - 26. Let v(z) = -3t(z) + 4y(z). Determine v(10). -22 Let v be (90/540)/((-2)/(-3)). Let h(i) be the second derivative of vi4 + 0 - i2 + 1/3i*3 + 16i. Give h(-2). 6 Let f(i) be the second derivative of -i*5/20 + 13i*4/12 - 5i*3/3 + 4i*2 - 1431i. Calculate f(12). 32 Let k(x) = x*3 + 8x*2 + 8x + 7. Let g(c) = -1. Let o = -38 - -39. Let n(j) = ok(j) - 3g(j). Calculate n(-7). 3 Let j(b) be the second derivative of 2b2 + 0 + 25b + 1/6b3. Let w(l) = 4l + 13. Let r(m) = 21j(m) - 6w(m). Calculate r(4). -6 Let u(j) = 4j2 - 16j + 1. Let t(g) = -3g2 + 8g. Let r(o) = -5t(o) - 3u(o). Let v(n) = 4n2 + 9n - 4. Let p(d) = 3r(d) - 2v(d). Give p(-6). -1 Let g(s) = -14s - 13s*2 - 6 + 8s*2 - 17s*3 + 18s*3. Give g(7). -6 Let q(l) = -337l - 296l + 698l + 373 + 209. Determine q(-9). -3 Suppose 0 = 2u + 4, 9g - 3u = 6g - 330. Let w = 105 + g. Let s(c) = -c*2 - 6c + 3. Give s(w). -4 Let t(s) be the second derivative of -69s + 0 - 3s*2 + 1/3s*3. What is t(4)? 2 Let c be 3/(-1) - (-12 + 5). Let x(z) = 3 - 5z - 5z2 - 1 + cz*2 - 5. Let p be (9 - (15 - 7))-2. Determine x(p). 3 Let b(h) = -47h2 + 54h + 69. Let j(x) = -17x2 + 18x + 22. Let m(z) = -4b(z) + 11j(z). Determine m(21). 29 Let x(c) be the first derivative of 11c2/2 + 28c - 280. Calculate x(-3). -5 Let x(k) = 5k + 133. Let z(i) = -i - 67. Let w(l) = -x(l) - 2z(l). Let b = 10 + -18. Determine w(b). 25 Suppose 51x - 402 = -300. Let f(c) = -4c3 + c2 - 4. Give f(x). -32 Let m(i) be the third derivative of i6/120 - i5/12 + 5i3/3 - i2 - 180i. Give m(4). -6 Let d(y) be the second derivative of y*3/3 + 9y*2/2 - 7y + 12. Let f(t) = 5t + 20. Let n(g) = -9d(g) + 4f(g). Give n(-3). -7 Let m(f) be the second derivative of 3/2f*2 - 2 + 54f + f*3. Suppose 4d = 4 + 8. What is m(d)? 21 Let a(q) be the first derivative of q5/60 + q4/4 - q*3/3 + 2. Let p(z) be the third derivative of a(z). Suppose -121d - 1554 = 122d + 16d. Give p(d). -6 Let h(f) = 23 - 7 + 1224f - 1231f. What is h(3)? -5 Let j(q) = -q + 23 + 5q - 3q - 4q. Let l be j(5). Suppose 0 = lv - 5v. Let a(s) = s3 + 13. What is a(v)? 13 Let t(u) = u3 + 18u*2 + 2u + 39. Let o be t(-18). Let j(r) = -2r2 - 3 + 5 - r + o - 6. Calculate j(2). -11 Let m(t) = -t3 - 17t*2 - 5t - 28. Let i be m(-13). Let n = i + 620. Let r(b) = b*2 + 18b - 23. Determine r(n). -4 Let j(v) = v*3 - 30v*2 + 3v - 59. Let k be j(30). Let p(t) = 28 - 53 + 4t + k. Give p(-4). -10 Let z be (-6)/45 - (-112)/(-60). Let t(s) = s3 + 4s*2 + 2s - 3. Let h be t(z). Let p(w) be the third derivative of w4/6 - w3/6 + 2w2. Give p(h). 3 Let f(x) = -x3 - 6x*2 + 3x + 39. Let a(r) = -2r2 - 90r - 92. Let z be a(-44). Determine f(z). -5 Let u be 6((-3)/10 + (-13)/390). Let a(l) be the third derivative of l6/120 + l5/12 + l4/24 + l3/6 - 14l*2. Calculate a(u). 11 Suppose -2n + 5 = i, 4n - 17 = 2i + 13. Let q(j) = -4j2 - 7 - j3 - 34j - 36j + 4 + 75j - 3. Calculate q(i). -6 Suppose 4c = c + 18. Suppose 10b = 12b - c. Suppose d = 5h - 2h + 26, bh + 34 = 5d. Let w(s) = -s2 - 8s + 9. Calculate w(h). 9 Let y be (14 - -5) + (-5)/(5/(-4)). Let m(a) = -3a + ya - 6a + 22a. Determine m(1). 36 Suppose -6o + 995 = 1205. Let l(d) = d2 + 36d + 31. Give l(o). -4 Let k(o) be the third derivative of -2o2 + 1/2o*3 + 1/12o*4 + 20o + 0. Determine k(-2). -1 Suppose 3c + 15 - 5 = -17. Let f(g) = 19g + 180. What is f(c)? 9 Let u(z) = -6z + 291. Let v be u(27). Let b(x) = -7x + 7 + 271x2 - 141x*2 + 1 - vx2. Let m be (-2)/(-3) - (-16)/3. What is b(m)? 2 Let k = -2231 + 2233. Let f(t) be the first derivative of t4/4 - t3/3 - t2 + 3t - 4. Determine f(k). 3 Let g(l) = 224l*3 + 19l*2 - 5l - 14. Let w(u) = 45u3 + 2u*2 - u - 1. Let t(s) = -g(s) + 5w(s). Let k(d) = -d + 16. Let r be k(7). Calculate t(r). 9 Let i(a) = -a - 2. Let l be (6 + -1)/(-5) + 4. Suppose m = -5t - 19, lm - 3t + 11 = -2m. Determine i(m). 2 Suppose 12 = -4p - 20. Suppose 212b - 3 = 209b. Let y(f) = 4 - b + 14f*2 - 15f*2 - 6f. What is y(p)? -13 Let m(u) = 4u - 10. Let a(w) = -w. Let q(g) = 4a(g) - m(g). Let v = -16289 + 16292. What is q(v)? -14 Suppose x - 17 = 3s, s + 6 = 1. Let b(c) = 4c*2 + 598c - 5cx - 602c - 4. Calculate b(-5). -9 Suppose -232y - 1681 = 871. Let r(k) = -15k - 161. Determine r(y). 4 Suppose -4t - 9 = -5q - 0t, 0 = -5q + 3t + 13. Let o(g) = -23 + qg + g + 16g2 + 27 - 17g*2. Calculate o(9). -23 Let s(r) = 4r - 61. Let m = -2748 - -2758. What is s(m)? -21 Let u = -5195 + 5198. Let c(a) be the third derivative of 13a2 - 1/6a*u + 0 + 1/8a*4 + 0a + 1/60a5. Determine c(-4). 3 Let c(y) be the third derivative of -y4/24 - 2y*3 + 1225y2. What is c(-6)? -6 Let a(w) be the second derivative of w5/20 + 5w4/6 + 7w*3/3 + 19w*2/2 - w + 461. Calculate a(-9). -26 Let w(h) = 3691h + 33211. Let g be w(-9). Let b(f) be the third derivative of -f*6/120 - 3f5/20 - f4/4 - 7f3/6 - f2. Give b(g). -23 Let k(p) = 7p*3. Let z(u) = -2u*2 + 26u + 29. Let a be 2/7 - 52/(-14). Suppose 0 = -2i - i + 4w + 54, aw = -2i + 16. Let x be z(i). Give k(x). 7 Let q(p) = -88p - 1. Let z(y) = -9y. Let v(j) = -q(j) + 8z(j). Suppose 0 = -2o + 2, 0l + l + 4o - 5 = 0. Give v(l). 17 Let j(v) = -v*3 + 15v*2 + 33v + 10. Let g = -3504 + 3521. What is j(g)? -7 Suppose 225h - 9 = 231h - 21. Let g(x	{ "pile_set_name": "DM Mathematics" }
e ((-2)/9)/(1298/(-99) + 13). Solve -2u = -4u - q for u. -1 Let t(v) = v*3 - 5v*2 + 5v + 1. Let c be t(4). Let j(i) = 2i - 10. Let f be j(9). Suppose 0 = -3m + f - 2. Solve mz = cz - 12 for z. 4 Suppose 10 = -5g + 305. Let d = g + -47. Solve -2m = m - d for m. 4 Suppose q - 32 = -3q - 3u, 12 = 3u. Solve -qt = -4t for t. 0 Let c = 965 - 963. Let i be (1 - -2)/((-3)/(-2)). Solve -y = -c - i for y. 4 Suppose -2i = -4j - 6, 0 = j - i - 44 + 47. Let u be (3 - 0)/((-1)/(-1)). Suppose 0w + w + a - 2 = 0, uw - a - 18 = 0. Solve jg + w = g for g. 5 Let c be 2(-1)/2-4. Suppose 68 = 5x - 2h, -16x + 16 = -15x - h. Let g be 3/(x/c) + 2. Solve -3s - 9 = g for s. -4 Suppose -170 = -27s + 19. Solve 21 - 42 = si for i. -3 Suppose -3f + 15 = 0, -f - 2f + 351 = -3n. Let v = n + 113. Solve t + 0 = v for t. 1 Let x = -5619 + 5641. Let l = -4 - -6. Solve -5g + l = x for g. -4 Let h be (4/6)/((-3)/(-9)). Let w(k) = k + 14. Let x be w(4). Suppose 2m = -4m + x. Solve -m = -g + h for g. 5 Suppose 4 = d - 3. Let p(l) = 2l*2 - 9l + 5. Let f be p(6). Let c = f - 18. Solve -ca - 13 = d for a. -4 Let j be 9/(9/2)2. Let t be -1 + 2 - j/4. Solve 0i + 5i + 10 = t for i. -2 Let g = 530 - 523. Solve -4t = -5 - g for t. 3 Suppose 10g - 12g = 8. Let m be (-7)/(-35) - g/5. Solve 3 = b - m for b. 4 Suppose 0 = -8q + 6q + 8. Let j = 0 + 2. Let l(b) = -b2 - 3b + 10. Let s be l(-5). Solve jx - qx = s for x. 0 Let w(z) = z*2 - 7z - 28. Let p be w(10). Solve -1 = pm + 1 for m. -1 Suppose 6t - 40 = t. Let j = 13 - t. Suppose 7d - j = 2d. Solve v - 2 + d = 0 for v. 1 Let h be 1/(-1) + 2 + 0. Suppose 4p - 98 = -3n, -n - n + 4p = -52. Let v = n - 28. Solve vc + 5 = -h for c. -3 Let p(r) = -3r3 + r2 + r + 1. Suppose q = 2q + 1. Let j be p(q). Suppose 0 = 5a - ja. Solve -g = 5 - a for g. -5 Suppose -5c = 75 + 60. Let x = -27 - c. Solve -l - 3l + 8 = x for l. 2 Let c = -56 - -68. Suppose c = 4u, -16 = -5a + u + 1. Solve ap = -p for p. 0 Let j(g) = g2 + g. Let l be ((-5)/10)/((-2)/(-4)). Let n be j(l). Suppose 3a = -2o + 8, no - 9 = o - 5a. Solve -5 = -2b - o for b. 2 Suppose -2i = -4l + 134 + 76, -258 = -5l + 4i. Suppose -9k + 54 - l = 0. Solve ko + 4o = 0 for o. 0 Let l = 171 - 180. Suppose -2a - 10 = 4. Let c = a - l. Solve 6t - ct - 20 = 0 for t. 5 Suppose -34h + 47 = -21. Solve -5w - hw + 7 = 0 for w. 1 Suppose 0 = 3y + 2w - 1, -4w + 4 + 4 = 0. Let f = y - -4. Solve -t + f - 1 = 0 for t. 2 Let a(x) = x*3 - 3x*2 - 2. Let v be a(4). Suppose -4p = -v + 6. Suppose -y = py. Solve 6 = -yc + 2c for c. 3 Suppose 5l - 12 = 3l. Solve -4o = 2o - l for o. 1 Let g(b) = -3b*2 - 12b + 17. Let k be g(-5). Solve ki + 6 = 5i for i. 2 Let j be (-4)/(16/12) - (28 + 0). Let f = 37 + j. Solve -15 = fu - u for u. -3 Let q(k) = -k2 + 6k - 3. Let y be q(5). Suppose -1 = 5p - 11, -p = -l - 2. Suppose l = yw - 26 - 6. Solve 2s - 6s = w for s. -4 Let u(l) = 2l - 1. Let d be u(1). Let h(i) = 18 + 15 - 33 + 10i. Let t be h(d). Solve 6c - t = c for c. 2 Let p be (0/2)/5 - -8. Let v be (-24)/9(-12)/p. Solve vo + o = 0 for o. 0 Let o(a) = -a3 + 23a*2 + 24a + 3. Let p be o(24). Solve -pw + 7w = 12 for w. 3 Let r be (4 - 10) + 5 + 10. Solve -4y - 17 = -r for y. -2 Let r be (-6)/2 - (-2 - (-30)/6). Let h(s) = -2s*3 - 11s*2 + 8s + 13. Let x be h(r). Solve 3w - 2w = x for w. 1 Let u be 6/(2 - 1/1). Let f be (-2)/u(-6 + 12). Let b(y) = 2y*2 + 5y + 2. Let l be b(f). Solve -j - 4j - 5 = l for j. -1 Suppose -7 = -5b + h - 2, 4b + 5 = -h. Solve b = 5i - 25 for i. 5 Suppose 3b - 22 = 3v + 8, 5 = 4v + 5b. Let l be (2 + 0)(-5)/v. Solve -h = h - l for h. 1 Let b be (-5)/((-10)/8) - -6. Suppose 2h + b = 2, -5c = -2h - 58. Solve -9j = -4j - c for j. 2 Suppose -3z = 0, -8d - 2z = -4d + 3z. Let u be (0 - 1)/(4/(-20)). Solve d = r + u for r. -5 Suppose 4p + 3n - 28 = 0, -4p + 24 = -51n + 53n. Solve p = -4k - 8 for k. -3 Let s(f) = 2f*3 - 17f*2 + 7f + 9. Let j be s(8). Solve 31d - j = 32d for d. -1 Suppose -51 - 29 = -4k. Suppose 2a = -5n + 3a + 12, -n - 2a = 2. Suppose -nj = 3j - k. Solve -5z = -jz for z. 0 Let i = -67 + 67. Suppose 2n - 2l = 6 + 2, i = 3l + 12. Solve nm = -m - 3 for m. -3 Let a(x) = -4x - 2. Let i be a(-3). Let q = i - 12. Let f = 5 + q. Solve 0 = r + fr - 4 for r. 1 Let a(l) = -5l - 6. Let u be a(-3). Suppose -uf + 11f = 4. Solve -4w + fw = 0 for w. 0 Suppose 191c = 193c - 6. Solve -93p - c = -92p for p. -3 Let i be (0 - 5-1)/1. Let c be 4 - (0 - 3 - -7). Let u(n) = n3 - n + 10. Let p be u(c). Solve 5 + p = -id for d. -3 Suppose -104 = 3b - 5m, 67 = 4b - 6b + m. Let y = b + 53. Let h = y + 0. Solve 0i = 5i + h for i. -4 Suppose 0 = -2a - a + 60. Let d = -12 + a. Solve 2c + d = 18 for c. 5 Let m(x) = 3x2 - 8x + 10. Let i be m(2). Solve 7c - 13c = -i for c. 1 Let c(d) = d + 9. Suppose 2w = -w - 4z + 30, -5w + 3z + 21 = 0. Let a be c(w). Solve -a = -6x + x for x. 3 Let s be (2/6 + (-7)/21)/(-2). Solve s = -6v - 15 - 15 for v. -5 Suppose 156z = 137z + 1425. Solve o + 72 = z for o. 3 Let t be -3 - (-28)/219. Solve b = 4b - t for b. 3 Let o = -267 + 280. Solve 5v - 7 - o = 0 for v. 4 Suppose 2c - 16 = 9q - 7q, 61 = 5c + 2q. Solve -9 = 2k - c for k. 1 Let g(f) = -9f - 3. Let r be g(-1). Suppose y - 18 = -5s - 6, 0 = -y + 4s - r. Solve -yb - 16 = 2b for b. -4 Suppose 80g - 184 = 72g. Solve -gb = -21b for b. 0 Let w be ((-6)/7)/3 + (-18172)/196. Let y = 102 + w. Solve -2p + y = p for p. 3 Suppose -6 = -4p - x + 7, -3p + x = -8. Let k be ((-114)/(-95))/((-2)/5). Let d be k - (-3 - 2) - -2. Solve pa - d = 11 for a. 5 Let g(y) = y*2 - 35y + 71. Let j be g(33). Let x(p) = p + 5. Let u be x(-5). Solve un + jn = 0 for n. 0 Let n(u) = u - 8. Let g be n(13). Suppose -r - g = 3f, -2f + 6f - 25 = 5r. Suppose 3o - 6 = -f. Solve -m - o = -3m for m. 1 Let n = 7 + 1. Suppose h - n = -3h + 2z, 3 = -5h - 4z. Solve -2b - h - 1 = 0 for b. -1 Let h = -432 + 527. Solve h = 4g + 79 for g. 4 Let v = -139 - -109. Let n be (-150)/(-5) - (-1 - 1). Let x = v + n. Solve -xh = -3h - 3 for h. -3 Let u(y) = 0y3 + 19y*2 - 6 - 2y*3 - 29y*2 + 3y*3 - 10y. Let h be u(11). Solve 0c = hc for c. 0 Suppose -5c + 56 = 9c. Solve 8 = 3t - c for t. 4 Suppose -4h - 5b + 2b - 1164 = 0, -2h + 4b = 604. Let z be (8/14)/(7(-12)/h). Solve -zx = -0x - 4 for x. 2 Let l = -8 - -4. Let h(d) = d3 + 6d*2 + 6d. Let x be h(l). Suppose -2b - 2b + x = 0. Solve bt - 1 = 7 for t. 4 Suppose -b + 82 = 14k - 12k, 0 = b - 2. Solve 5a - 13a = k for a. -5 Suppose -1 = 2s - 25. Suppose 0 = 2q + 4n - 4, 2q - 4 = -n - n. Suppose 0u = 3u + qz + 10, -4u - 25 = 5z. Solve u = 3o + o - s for o. 3 Suppose -3p - 28 = -28. Solve p = h + 4h for h. 0 Let i(n) = -13n*2 - 80n - 7. Let q be i(-6). Solve 0r + 5r = -q for r. -1 Suppose -4c = t - 19, -4t + 2t = 2c - 14. Solve -tn = n - 4 for n. 1 Let n(p) = p2 - 7p + 6. Let z be (-9)/(64/(-16)). Let s be n(z). Let x = 4 + s. Solve 4v + x = -16 for v. -5 Let t = 591 + -589. Suppose -f = 2f + h + 4, 3h + 12 = -5f. Solve tl + fl - 10 = 0 for l. 5 Let r be (-8)/6-15(-3)/(-5). Let g(y) = -y + 1. Let f be g(-3). Solve r = -fq + q for q. -4 Let q(z) = 15z - 103. Let l be q(8). Solve -3 = -li + 16i for i. 3 Suppose -4 = -5o + 3o + 5z, o - 2z - 4 = 0. Suppose 2w = ow. Solve wr = 3r for r. 0 Let d(l) = -l2 - 4l - 3. Let m be (-2)/(-5)(-3 + 13). Let k(t) = -t3 + 3t*2 + 4t - 3. Let f be k(m). Let s be d(f). Solve s = b + b for b. 0 Suppose 104 = 11b + 5. Solve -bm = -5m - 20 for m. 5 Let o(l) = -l2 + 4l + 14. Let m be -2 + -6 + (1 - -2). Let b be 2 + -5 + (4 - m). Let s be o(b). Solve h - 6 = -sh for h. 2 Let z = 8 + -2. Suppose -4t = -t - z. Solve -q = -t - 2 for q. 4 Suppose 1 = -8h + 17. Solve -5t + 17 - h = 0 for t. 3 Let u(k) = -2k2 + 4k - 3. Let z be u(2). Let s be -2 - z - 0/(-2). Let v(h) = -3h - 12. Let q be v(-5). Solve -m + s = q for m. -2 Let a = -1407 + 1407. Solve a = 7r - 14r for r. 0 Suppose -7i + 11 = -24. Solve 0 = -5t - i - 10 for t. -3 Let x(k) = 96k - 952. Let s be x(10). Solve	{ "pile_set_name": "DM Mathematics" }
5p2 + 84p + 7. Let m be f(28). Solve -h - v = 1, 3h + 17 = mh - 3v for h. 2 Let y(s) = -14s - 109. Let b be y(-19). Let i = b + -155. Solve a = -a - 6, -2a - 4 = iz for z. 1 Let f = -30 + 33. Let z = 12 - 12. Suppose -n + 10 - 8 = z. Solve a - fg = -na + 3, 5a = 2g + 17 for a. 5 Suppose -b + 2 = h, 3b - 8b + 3 = 4h. Let j be 6 - 0 - -6h/(-14). Solve 0 = -4y - jx - 27, 2x = 4y - 0y + 2 for y. -3 Let l = 5759 - 5759. Solve -4u + 12 = 0, 3f + 6 = u - l for f. -1 Let z be 1(3 - 5) - -14. Let x(u) = 8u - 92. Let w be x(z). Solve -l + g - w = 0, -4l + 0g - 22 = 2g for l. -5 Let p be 2/(2/(-410)(-20)/8). Let a = p + -156. Suppose 2z - 3z + 8 = 3t, 2t = -z + 9. Solve -3x = -g + z, -ax - 3g - 23 = -3x for x. -4 Suppose -4o + 25 = -g, 2o - 193g + 195g = 0. Solve p - oq - 11 = 0, 0 = 2p - 5q - 13 + 6 for p. -4 Let y(b) = b*3 + 6b*2 - 5b - 7. Let v be y(-6). Solve -v = -5f - 2x, 5f - 26 = -4x - 5 for f. 5 Let t(h) = -26h + 112. Let s be t(11). Let q = s - -191. Solve -2k = -4d + 24, d - 4d = -k - q for d. 5 Let w be 8/14 - (5 + ((-900)/14)/10). Solve -5y - 8s = -6s - 10, ws = 0 for y. 2 Let o(v) = 4v + 6. Let z(t) = 8t + 415. Let m be z(-52). Let j be o(m). Solve -n + jx + 4 = -5n, x = n + 1 for n. -1 Let w = 624 + -622. Suppose -5z + 2z = -wz. Solve -2k + 5k = -5n, z = 5k + 5n for k. 0 Let g be (9/(-6))/(11661/650 + -18). Solve -gf + 5 = -26f - 2z, -1 = f - 2z for f. -3 Suppose -2z - 2k = -24, -k = 5z - 2k - 90. Suppose u - 3j - 3 = 6, -12 = 4j. Suppose u = -c - 15 + z. Solve 2i + ct - 14 = 0, i - 4t + 3 + 0 = 0 for i. 5 Suppose 505 = 29g + 360. Solve 17 = gt + 4j - 3, 20 = 5t + 2j for t. 4 Let u(m) = 15m2 + 12m + 1. Let j be 0/(-2) + -312/36. Let q be u(j). Solve 2w = -w + 3b - 3, qw - 5b = -4 for w. -1 Suppose -5y = -15, 0 = -o - 3y + 7y - 17. Let s be (110/(-77))/(o/14). Solve 3b - 2 = n - 6, 5b + 18 = -sn for b. -2 Suppose -612 = -104m - 49m. Solve -4p - 4 = 0, mp + 25 = -5r + 16 for r. -1 Let u(l) = -107l - 854. Let d be u(-8). Solve 4n = dr - 16, n - 4 + 8 = 4r for r. 0 Let s be (-44)/(-2 - 0/(-1)). Suppose p - 2r + 8 = 0, 4p - 5r = 5 - s. Let u be (-1)/((-3)/(12/4)). Solve -3l = -3m - 3, u = 3m - l + pl for m. 0 Let b(i) = i - 4. Let w = -309 - -313. Let g be b(w). Solve 0j = 2h - 2j + 8, g = 2h - 4j + 12 for h. -2 Suppose -2g - 8 = -4a - 3g + 5g, 0 = 3g. Solve -4y = 5i - 3, -5 + a = 5i + y for i. -1 Let o = 135 - 129. Let v be (-2 - (-42)/12)20/o. Solve q = -4n, vq = q - 3n - 13 for q. -4 Suppose 0 = 2l + k - 8, -l + 10k - 13k + 4 = 0. Solve -lc - 2z = -4, -z + 4 = 4c + 4z for c. 1 Let s be 21/(945/36) + 54/45. Solve sf + 40 = 3c + 39, 2c - 2f - 4 = 0 for c. -3 Suppose 1008 = 188s - 3504. Solve -5x = 3d + 4, -4d - 21x = -sx + 15 for d. -3 Let v(y) = -y2 - 4y. Let s be v(-3). Suppose -12g = -2g - 543 + 543. Solve gx - 2 = x - 2k, 0 = sx - 3k for x. 2 Let h(f) = 2f2 - 2f + 2. Suppose 9l - 10l + z = 3, 4z = -5l - 6. Let c be h(l). Solve 0 = 5u - 3n + 28, -n = 3u + c - 0 for u. -5 Let t(z) = -z2 + 187z + 766. Let o be t(-4). Solve om = 7m + k - 11, -4m + 5 = -3k for m. 2 Suppose 10y - 114 = -34. Suppose 0 = -yb + 15 + 17. Solve -5c - s - 21 = -0c, bc = -s - 16 for c. -5 Let q(o) = -9o - 76. Let s be q(-9). Suppose 3u - 17 = -4p, sp - 9 = -4u + 13. Solve -3n + 4y = 1, y + 3y = -un - 17 for n. -3 Suppose 5h - 2t - 55 = 0, 3t = -h - h + 3. Suppose -hj + 6j + 6 = 0. Solve -jz + 5i - 2 = 3, 1 = -i for z. -5 Suppose 158h - 320 = 78h. Solve 12l - 16l = -3o - h, o - 5l = 6 for o. -4 Let x be (4 + -11 + 6)0-1. Suppose 7l - 10 - 32 = x. Solve -5k + l = 4i, 0 = 3k + k + 2i - 6 for k. 2 Let a = -90 - -95. Suppose 4o = 5x + 28 - 27, ax = 5o - 5. Solve -om + 3b + 14 = 0, -5m - 6 = -4b - 24 for m. 2 Let t = 24030 - 24028. Solve tj + 15z - 6 = 10z, 6 = 3z for j. -2 Let u = -91 - 94. Let c = -177 - u. Solve 0 = -n - 2w - 11, -c = 4n - 3n + w for n. -5 Suppose -30z + 787 = -473. Let h = z - 40. Solve 0t - 3y + 3 = -ht, -4t + 5y = 7 for t. -3 Suppose 0 = -3f + 18, 2f - 70 = -2h + f. Solve -3o + 3p + 27 = 0, -ho + 28o = -5p - 40 for o. 5 Let g be (65/(-15))/(10/12 + -1). Suppose -2w + 5w = -c + 12, 0 = -4w + 2c + g. Solve wv - 4 = -4h, 3v = -h + v + 1 for h. 1 Suppose -d = 3f + 1 - 6, -f = 2d - 10. Let c be 3(9 - d - 3). Solve 0 = -cb + b + 4, 0 = -k + 3b - 11 for k. -5 Let y(b) = 811b - 2431. Let f be y(3). Solve 23h - fv = 27h - 14, -5v = 3h - 7 for h. 4 Suppose -j - 2j - w = -245, 4j = 4w + 300. Let v = j - 78. Suppose -4 = -3d - vk + 9, -k = 2d - 9. Solve 14 = 3y - 5t, -y - 3y + dt + 12 = 0 for y. -2 Let k(z) = -z2 + 4z + 14. Let q be k(5). Suppose -2n - 5x + 9 = -3n, -3n - q = 3x. Let v = n + 5. Solve 30 = 4d + 5r, -3 = -r - v for d. 5 Let o(f) = 2f*3 + 8f + 0f2 - 8f2 + 12 - f3 + 2f2 - 2f*3. Let g be o(-7). Solve 2u - 2 = r + u, -u = gr - 2 for r. 0 Let b(l) = 4l*2 - 3l + 1. Let j be b(1). Solve 4h = 5c + 4, h + c + 6 = -j for h. -4 Suppose -1011 = -148n + 765. Solve 53x + n = -u + 55x, -2u - 4 = x for u. -4 Suppose -168 = -29s + 17s. Let r(x) = -19x + 285. Let t be r(s). Solve -31 = -4m - 5q, q - t = -2m - 2m for m. 4 Let b be -63/6-19. Suppose -4m - b = -253. Let p = -46 + m. Solve 0c - 12 = -c + 3v, v = -pc - 14 for c. -3 Let f(w) = -493w*3 - 7w*2 - 4w + 1. Let a be f(-1). Suppose a = -9q + 527. Solve 3i + qb + 1 = -b, 5i - 25 = 5b for i. 3 Let y(l) = 3l*2 + 6 - 17l - 5 - 1. Let u be y(8). Let w = -49 + u. Solve 3g = 2r + w, g = -4g - 3r - 20 for g. -1 Let s(d) = 26d2 + 46d - 12. Let y be s(-3). Solve n + 4r + 22 = 0, y - 87 = 4n - r for n. -2 Suppose 0 = u + 4n - 126, n - 378 = -3u - 3n. Suppose 0 = -z + 2z + 123. Let f = u + z. Solve -5b - 2a = -14, -4b - fa + 6 = -1 for b. 4 Suppose 22i - 4p + 40 = 26i, 0 = -i - 3p. Suppose 8 = -ia + 17a. Solve -5h = -4u + 12, 2h - 3h + au = -4 for h. -4 Let s = 381 - 313. Let x be (4/6)/(s/1326). Solve -4z + z = 4u + x, -z - 4u = 7 for z. -3 Let b = 18 + 8. Let k = 26 - b. Suppose -r = -3, k = -q - r - 2r + 13. Solve 3x + n = 3n - 12, -4 = x + qn for x. -4 Suppose 0 = -4c + 5c - w - 4, -c + 1 = 2w. Let a = -26 - -47. Let t be a-1(-4)/12. Solve -s + 18 = -3q, q = cs - 7 - t for s. 3 Suppose -6 = -q - 0. Let o = 738 - 730. Suppose 0 = -2t + ob - 4b + q, -9 = -3t + 5b. Solve 0r - 5m = -4r + 40, tm = 3r - 27 for r. 5 Let l be (1 - 6/3)-4. Suppose -10q - 78 = -12q. Suppose qt - 284 = -89. Solve -5c + 15 = 4g - 13, -tg = -lc + 6 for c. 4 Let f be 13 + (-19)/(209/140) + (-57)/(-33). Solve -2v = -2y + 3y, -6 = -2v + fy for v. 1 Let m = -39581 + 39593. Solve 12 = 5z - 74i + 77i, 3z + 3i = m for z. 0 Let z be 11 - -1 - ((-2 - 1) + -2). Suppose -30n - zn + 752 = 0. Solve -2w - 4y = 0, -2w + 4w - 4y + n = 0 for w. -4 Let i(y) = -47y - 45. Let h be i(-1). Solve -3v = -11k + 16k + 7, 0 = -4k + hv + 12 for k. 1 Suppose 0 = 6g - 0 - 768. Suppose -648 = -20k - g. Solve -c + 28 = -5w, 2w + 2w + k = 2c for c. 3 Let f(a) = a*3 - 14a*2 + 58a - 4. Let p be f(8). Suppose 208 - p = 6q. Solve -3s + 3v = v - q, 18 = 2s - 2v for s. 4 Let a(f) = f3 - 4f*2 - 4f - 3. Let r be a(5). Let q = -35 - -302. Let c = q - 262. Solve -cd - 19 = rn, 4d = d - n - 12 for d. -5 Suppose -2p + 744 = -8p. Let j = p - -127. Solve -3q - j = -2n, 5q - 4n + 2 = -1 for q. -3 Suppose -4y + 5o = -2979, o = -5y - o + 3765. Let i = y - 749. Solve -k = -5r - 3k - i, -2r + 5k = 24 for r. -2 Suppose -8 = -201c + 194c + 188. Solve -16 + c = -f - 3x, -x - 4 = 3f for f. 0 Suppose 5888 = 35j - 27j. Let g = j + -711. Solve 0 = 5w + g, -5l - 4w - 13 = 2 for l. 1 Let l(v) = -v3 - 3v*2 + 5v - 10. Let k(w) = -w*2 - 24w - 113. Let q be k(-18). Let o be l(q). Solve 4a = 5f + 7, -f + 2 - o = 5a for a. -2 Suppose 5f + 10 + 50 = 5m, -f = 5m - 78. Let b be ((-16)/12)/((-2)/m). Let n be (5 + 150/(-18))(-12)/b. Solve -2d = -nj + 8, 5j - 10 = 4d - 0d for j. 2 Let g(f) = -132f + 5825. Let j be g(44). Solve 2 = 3z + 2*	{ "pile_set_name": "DM Mathematics" }
for g. 3 Let a = 1557 + -1554. Solve 4r + ao + 2 = 30, -r - o + 8 = 0 for r. 4 Suppose -73p = -69p - 112. Suppose -p + 33 = j. Solve x = -x + h - 7, 0 = -jx - h - 21 for x. -4 Suppose 139 - 7 = 22l. Solve 15 = p - 4d, -d - l = 8p - 6p for p. -1 Suppose -6d + d = 4b, 4b = -4d. Solve 4l - m - 12 = 0, -2l + 2m = -dm - 6 for l. 3 Let b(t) = -t - 7. Let c be b(-7). Suppose -3i + 4 + 11 = c. Solve g + 26 = 3g - iy, -2y - 17 = -3g for g. 3 Suppose 2j + 13 = z, z - 7j = -2j + 28. Solve 25 = -5r + 5d, -19 = -zr - 4d + 1 for r. 0 Let t(d) = -3d - 12. Let z be t(-5). Suppose -7 = -2g - z. Suppose gx + 4 - 8 = 0. Solve -3v - 10 = -4v - xk, -2v + 5 = -k for v. 4 Suppose 32 = 3g - 10. Suppose -7m + 112 = 406. Let l be (-4)/g - 138/m. Solve k - 4p - 3 = 0, -lp + 1 = k + 5 for k. -1 Let t(g) = -g*2 + 6g. Let u be t(5). Suppose 3l + u - 14 = 0. Solve 0 = 4w - 4, -li - 2 = -w - 4 for i. 1 Let y = 2 - -2. Suppose ym - 124 = -3u, -m + 4u + 62 = m. Solve 8 = -l - 2i, -5l - 4i - m = -9 for l. -2 Let l = -4 + 6. Let m(h) = 2h*2 - h - 1. Suppose -2z + 1 = -1. Let o be m(z). Solve -2 = -2f + li + 2, -5f + 3i + 12 = o for f. 3 Let y = -40 - -68. Let w(z) be the third derivative of -z*5/30 + 7z*4/24 + 5z*3/2 + 24z*2 - z. Let o be w(5). Solve 3s - 4j = -y, os - s = j for s. -4 Suppose -2h = 5t - 23 + 9, -3t = 2h - 14. Suppose 5k = -4x + 67, hk - 2k = -x + 13. Solve 2p + 2p = -n - x, 0 = 4p - 2n + 24 for p. -5 Suppose k + 3k - 1 = -u, 0 = -5u + 3k - 64. Let r = u - -16. Let w(s) = -s2 - 4s. Let g be w(-3). Solve 4 = 2v - 0, -gl - rv + 1 = 0 for l. -3 Let j = 5 - 3. Solve jv - 8 = 0, -v = -3n - 8 - 11 for n. -5 Let g = -619 - -622. Solve 3m + gc = -6, 13c - 16c = 3 for m. -1 Suppose i = -3j + 5, 4i = 3j - 7 - 18. Suppose -y - 3r = -5r - 9, 4y + 8 = -jr. Let d be 0 - y - (0 - 2). Solve 4z + p = -9, -4z + 2 = -p + d for z. -1 Let v be 0 - 1/4 - (-1)/4. Suppose 0x = -3x + 5o + 31, 4x + 4o = -12. Suppose xf = -3f. Solve 0 = 5q + 3n + 4 - f, -4n + 8 = v for q. -2 Let q be (-20)/5 + 112. Let a be (-2)/(1 + -5)0. Solve -9 = -3f, -n - 3f + q = -an for n. -1 Let t(h) = -3h + 2. Let f be t(-5). Suppose j - 2j - 8 = -2a, 5a + 5j = 20. Let n = f + a. Solve -2i - o = 9, 2i + 5o + n = -0i for i. -3 Let h be 102/(-170)20/(-3). Solve 5m - 19 = -hq + 4m, -4q = -m - 21 for q. 5 Let v be 5 + 3 + -7 + 5. Solve -l - 2x = -5, 4x = 5l + vx - 1 for l. -1 Let x be (-6)/(-10) - 1040/25. Let o = x - -57. Solve 3u - 28 = -4z, -o = 2z + 5u - 44 for z. 4 Suppose 2r - 8 = 2a, 4r - 5a - 11 = -6a. Solve -rf + 5d - 17 = -0f, -3f + 15 = 3d for f. 1 Let x = 427 - 409. Solve b - x = -2w - 2b, 0 = -2w - 2b + 14 for w. 3 Suppose 3u - b = 2, -7b = 2u - 3b - 6. Suppose h = 19 - u. Solve 2j - 3y = -7y + h, -4y = -j - 21 for j. -1 Let w(f) = f. Let d be w(0). Suppose -g + p - 4p = -16, -p + 4 = d. Solve -gl = -2m + 6, -l + 5 = 2m - 6 for l. 1 Let r = 20 + -34. Let w(q) = q + 34. Let a be w(r). Solve 3j = -4b - 15, 2b - 4j = 6b + a for b. 0 Suppose -4p + 10 = 30. Let f be ((-10)/(-4))/p0/7. Solve fl - 10 = 4r - 2l, -5l - 7 = -2r for r. -4 Let f be 3 + (4/(-2))/2. Let x(i) = -3i*3 - 1 + 23i*2 - 24i*f + 0i - 2i. Let p be x(-1). Solve 0 = 2t + k - 1, 4k - 2 = -pt - 3 for t. 1 Let m(h) be the third derivative of -h5/10 - h4/12 + h*3/3 - 4h*2. Let k be m(-2). Let q = -12 - k. Solve qo + r = 2o + 11, 3o - 17 = r for o. 4 Let o(r) = 2r2 + 14r + 3. Let x be o(-7). Let i = -1 + 5. Solve ip - 3m = -p, -p = xm + 18 for p. -3 Let f(o) = -o3 + o2 + 2o + 4. Let c be f(0). Suppose -6m - 1 = -4p - 3m, 26 = 4p + 2m. Solve -4d + 8 = ca, 0a - pd = -3a - 22 for a. -2 Let j(f) = -f*2 + 4f. Let q be j(4). Suppose 0 = 2k + 4, 5n + qk + 4 = 3k. Let w be (-2)/420/n. Solve 35 = 4g - 9g + 5s, -2g - ws = -14 for g. -3 Suppose -2 = 17f - 19f. Suppose h - 5 = 0, -4 + f = -4l + h. Solve 3 = 3n + 2p, lp = -2n - 0n for n. 3 Let i(a) = a*3 - 3a*2 + 4a - 1. Let t be i(2). Solve -4p + 3m + 8 = 0, -tp = -4m + 2m - 7 for p. 5 Let c(q) = -q2 - 4q - 3. Let m be c(-2). Let k(l) = 4l2 - 2l + 2. Let f be k(m). Solve -z - 6 = -2y + fz, -3z + 4 = -5y for y. -2 Let b = -18 - -9. Let x(u) = -u - 7. Let j be x(b). Solve 2 = -jq, -4h - 8 = q + 1 for h. -2 Let b = -7 - -52. Suppose -t = 4t - b. Solve 14 = 4o - 2n, -2n + t = 2o - n for o. 4 Let j = -19 - -27. Suppose -5z + 7 = p, -2z - j = -3p + 4p. Let o = p + 20. Solve 4i = 4, 3w - 2i = 3i - o for w. 1 Let g(m) = m3 + 17m*2 - 4m - 57. Let f be g(-17). Solve 3v - 2u = f, -3u = -3v + 7v - 9 for v. 3 Let c(p) = -4p*2 - 13p + 2. Let a be c(-2). Solve j - 3r - 12 = -8r, -a = 3j - r for j. -3 Let a be (-1 - (-5)/10)-24. Solve 4g = -g + k - a, -2g - 3k = -2 for g. -2 Let m = 1143 + -1137. Solve 4q + q = -5v - 5, 0 = 3q + m for v. 1 Suppose 3m - 4 = 6m - 4x, 2m + 3x - 3 = 0. Let c = 34 + -30. Suppose 8f + c = 9f. Solve -2i + 0l - 12 = fl, 5i - 5l + 15 = m for i. -4 Let g(q) = -4q + 13. Let b(n) = n - 3. Let j(l) = -9b(l) - 2g(l). Let w be j(-4). Solve 16 = wo - h - 0h, 0 = o - h for o. 4 Let z be 2/6 + -221/(-9). Suppose 0g = 4l + zg - 13, -5l - 5g + 15 = 0. Solve 4q = -lt - 3t - 45, t - 4q - 15 = 0 for t. -5 Let d be (-12 + (-165)/(-22))4/(-6). Solve -2a - s + 3 = 0, da + 2a - s = 18 for a. 3 Let j(b) = 6b*2 + 4b - 2. Let x be j(-1). Solve 3a + 1 = 4o, 2a + 2o = -xa - 10 for a. -3 Suppose 20b - 4b = -4b. Solve bi = 4i + 2q + 4, -2q - 7 = i for i. 1 Suppose 5p - 3d = 49, -5d - 6 = -3d. Let a be 3/((-84)/p) - (-74)/14. Solve 0 = -3l + 2z + 2, -5z - 5 = -5l + a for l. -2 Suppose 12 + 0 = 3k. Suppose -2u = -n - 8, -4n - ku + u + 12 = 0. Solve 0 = -3c - 2j + 13, nj + 4 = c + j for c. 5 Let b be (39/(-26))/((-1)/2). Suppose -6 - 39 = -ba. Solve -5f + a = 3k, 3k - f + 4f = 9 for k. 0 Let x(q) be the first derivative of -q*3/3 - 5q*2 + 14q - 21. Let n be x(-11). Solve 0 = c - nz + 8, 4c + z - 24 = -z for c. 4 Let w(x) = -x + 10. Let i be w(6). Suppose -3y - 5o = -4, io - 4 = y + 6. Let n be 1 + y + (14 - -2). Solve 0 = 3z + n, -2l + 5z + 10 = z for l. -5 Let f = 45 + -48. Let y be (6 - 4 - 3)f. Solve 0 = -m + ya - 2a - 2, 3a = -4m + 13 for m. 1 Let g = 602 + -599. Solve 0 = -gn - 4i + 9, -3i - i = -4n - 16 for n. -1 Let m be 0/6 + (5 - 2). Suppose -3 = -c + 5. Suppose -2q + cy - my = 4, 5q - 9 = 3y. Solve -2s - 4i = -0i + 4, s = -3i - q for s. 0 Let a = 132 + -161. Let j(n) = n*3 + 29n*2 - 2n - 54. Let s be j(a). Solve -3p - 12 = 0, 0 = i - 4p - 12 - s for i. 0 Let s be (8/6 + -1)/((-5)/(-15)). Solve -4g = 4, 4g + s = -3d - 3 for d. 0 Suppose 2d + 5o = 37, o + 5 = 4d - 14. Solve 2b - 2q - d = 0, -2q = -4b + 5b for b. 2 Suppose -130y - 692 = -134y. Let d = y + -147. Solve 0 = 4l + 10 - d, -4l + 19 = -n for n. -3 Let k be (5/20)/(-1 + 27/24). Solve 0 = -b - kb + 3j + 9, 3b - 21 = -3j for b. 5 Suppose -4w = w + 25. Let r = 7 + w. Solve 0 = -2q - k - 11, q + rk + 7 = -0 for q. -5 Let w = 546 + -544. Solve 4d + wo + 2o = 0, -2o + 10 = -3d for d. -2 Suppose 0 = 2h - 0 - 4. Suppose hi + 0j - 11 = -j, -i = -5j. Solve -if + v = 22, -3f - 8 = -2v + 1 for f. -5 Let v be (30/25)/((-4)/(-10)). Solve -vy = 2j - 4y + 10, -5j - 3y = 3 for j. -3 Suppose 2f = j - 33, -4j = 5f - 6f - 104. Solve -4t + j = -3g - 2g, t = 4g + 20 for t. 0 Let a = 70 + -22. Suppose -11z - 4 = -a. Solve 5c - 29 = 2v, 4v - 4c + 24 = -z for v. -2 Let f be 94/12 + (87/(-18) - -5). Solve 2i = 3a + 4 + 5, f = i - 5a for i. 3 Let s(u) = 4u + 132. Let i be s(-33). Solve ir + 5r = -f - 4, r = -f for f. 1 Let x(t) = -t*3 + 5t2 - t + 6. Let v be x(5). Let i(a) = a3 - 8a2 - 17a - 30. Let j be i(10). Solve -d - 4m + 2 = j, -d + m = 2 + v for d. -2 Let y(f) = 174f*2 + f. Let s be y(-1). Suppose -4z - 3c = -s, -z - 3c - 109 = -3z. Let q = 71 - z. Solve -3w + 12 = 3, -4d = -4w + q for d. -3 Suppose 5v = 2v + 276. Let d = v - 87. Solve x + x = o + d, -30 = -3x - 3o for x. 5 Let t = -84 + 86. Suppose -t*x	{ "pile_set_name": "DM Mathematics" }
4 Let y = -33 + 40. Suppose f = -3f - 5c + 27, 2f - 4c + 6 = 0. Solve -5m = 4r + y, -5 = 3r + fm + 1 for r. -3 Suppose -8w + 3w + 4 = 4r, 2r + 2w = 2. Let u be (7/2 - 2)14. Suppose -2i = -3i + u. Solve -4l - i = 5g, -3l - r - 6 = -5g for l. -4 Let l(q) = 2q - 5. Let u be l(4). Let g(i) = 3i + 1. Let w be g(u). Solve -3z = f - 10, z - w = 2f - 3z for f. 1 Let t be 54/(-36)(-8)/6. Solve -3c - 5r = 1, -2c - r - t = -6 for c. 3 Suppose -173 + 29 = -9f. Solve 6u - u + 4y - 12 = 0, 3u - 2y - f = 0 for u. 4 Let a = -7 - -7. Suppose 3r - 2 = -5d - 0, a = 5r - 5d - 30. Solve rs = 0, -y + 0y = -s - 2 for y. 2 Let m be (-68)/18 + (-2)/9. Let s be (6 + -12)(-1 + m). Solve -r = 2v - 12, 3r - s = -2v - 10 for r. 4 Let z(o) be the third derivative of -o4/6 - o2. Let p be z(-1). Solve -4h - 3b = -12, 0h - b = -4h - p for h. 0 Suppose 34 = 4f + 14. Solve y = -5v - f, 0 = 5v - v for y. -5 Let f(i) = -i3 + 6i*2 - 4i - 2. Let n be f(5). Let z = 6 - 23. Let q = 29 + z. Solve -3y + nx = 9, 5y + 0 + q = 4x for y. 0 Suppose 6 = -5f + 1. Let v be f/(-2)(6 - 6). Solve v = -3d + h + 2h + 3, 3d + 12 = -2h for d. -2 Let h be 176/40(-10)/(-4). Solve -4j + 15 + 1 = -5s, -3j - 2s - h = 0 for j. -1 Let a = 5 - 1. Let l be a/(-3)(-6)/2. Suppose w + b = -3, 0 = -3w + 2w + 5b + 21. Solve w + 21 = lf + 5d, -d = -2 for f. 3 Let c(w) = w2 - w + 1. Let p(t) = 2t*2 - 8t + 3. Let n(g) = -c(g) + p(g). Let r be n(7). Solve -4z + 3f + 7 = -rz, -4f = -5z + 21 for z. 5 Suppose 0 = -4a + 5k + 40, 0 + 1 = -3a - 4k. Suppose 0 = -o + 2 + a. Solve t - o = -z, -t - 3z + 5 = -6 for t. 5 Let g be 22/4 - (91/(-14))/(-13). Solve f + 4a - a = 1, 2f = ga + 2 for f. 1 Let d = -4 + 5. Let w be (d - 1)/(-1 + -1). Solve w = 2y - 2, 4y + 1 - 10 = h for h. -5 Suppose -4a - 35 = -11a. Solve 0 = 5o - 24 + 4, -ao = -5h - 40 for h. -4 Let u be (-2 - -7) + (5 - 1). Solve -2l = -5l - u, -b = -2l - 5 for b. -1 Suppose 20z + 16 = 21z. Solve z = 3o + 5v - 2, 5v - 13 = 2o for o. 1 Suppose 5i + 3w = 0, -5i + 3w = 4w. Suppose -u + 4z = 11, -4u = 5z - 8 - 11. Suppose 4o = 19 + u. Solve ol - 25 = i, -v - 12 = -4l + l for v. 3 Suppose -3b - 20 = 2b. Let d be 36/8 - 2/b. Solve -3t = 3i, 0t - 5i = 4t + d for t. 5 Suppose -23b + 9 = -20b. Solve x - 13 = -3r, -bx + 18 = r + r for r. 3 Let j(x) = -x - 1. Let o be j(-5). Solve om - 20 = 4q, -3q - 8 + 2 = 0 for m. 3 Let x(g) = g*3 - 5g2 + g + 2. Let k be x(5). Let l(q) = -q2 + 8q - 5. Let t be l(k). Suppose -s = -t + 1. Solve 0b = -5b, c + s = -4b for c. -1 Let i(l) = -l*3 - 5l*2 - 4l + 5. Suppose -5n - 26 - 4 = -2q, 0 = 2n - 4q + 28. Let t be i(n). Solve -4p - 4s - 12 = 0, 8p - ts = 3p + 15 for p. 0 Suppose 2u - 10 = -3u. Suppose 4x = -0x - 24. Let y be 3/u(-8)/x. Solve yj + 4s + 10 = 0, -2j + s = -0j for j. -1 Suppose -3p + 45 = -2p. Let a = p - 28. Suppose -2n + 3n = 4. Solve 4s + 2j = -26, -3s - nj - a = -2s for s. -5 Suppose 3 = -n + 5. Suppose 0 = 5w - 0w - 20. Let l be (8/n)/(6 - w). Solve 10 = -lk - 5q, -k = k + q - 6 for k. 5 Let u be (-4)/(-5)210/4. Let t be u/8 - (-6)/(-24). Solve t = 5r + 5m, -5r + 3m - 7m + 4 = 0 for r. 0 Suppose 2t = -3t. Solve -4y = -f + 6, t = 3f + 3y - 3 - 0 for f. 2 Let y(s) = -s*2 + 9s + 1. Let a be y(7). Let r = 31 - a. Solve -3k - p = -r, -3k - 2k + 3p = -8 for k. 4 Suppose -4p + 5p + 3u - 5 = 0, -4u = -p + 5. Solve 0 = 3q + k - p, -2 = -3q + k + 5 for q. 2 Let l(p) = -3 - 3 + 2 - 7p + 1. Let m be l(-2). Solve -10 = 5s - 5r, -s + r + 3r - m = 0 for s. 1 Let d = -2 - -2. Let n(w) = w3 - w2 + 0w - 1 + 3 - w. Let i be n(d). Solve im + 2 = -0m - 2z, z = m - 5 for m. 2 Let h(k) = 0 + 1 - 2 + k. Let p(u) = u - 1. Let t be p(6). Let v be h(t). Solve l = -3x + 5l - 24, vl = 2x + 20 for x. -4 Suppose z = -4z + 35. Suppose -4g + 3l = -6, l - 8 = -2g - 0l. Solve -c = -3r - z, 2 = r - gc - 1 for r. -3 Let g = 12 + -12. Solve -6 = -3i, -2r - 2i + 3i - 8 = g for r. -3 Let r = -1 - 1. Let q be (3 + 1)/(r/(-4)). Let c = 11 - q. Solve i - 8o + 4o = 3, 4i = -co + 12 for i. 3 Let a be 3/9 - 20/(-3). Let t = 15 - a. Suppose t = b + 3. Solve -bf = -5q, -5q = 4f - 4 - 5 for q. 1 Let l = -4 + 8. Suppose lw - 7 = 5. Suppose -3d + 7 = 5h, -3d - 5 = -h - 0h. Solve 5s + 1 = 2g, 1 = ws - h for g. 3 Suppose 0 = -5s - 4j - 6, 0s = -2s + 5j + 24. Suppose sc + 8 = -12. Let y = 14 + c. Solve 5i + yu - 17 = 3u, 4u = -2i - 4 for i. 4 Let z = 4 - 0. Let t be ((-1)/(-2))/(2/z). Let h be (1 + 0)t + 4. Solve -2q + 2d = -8, 0 = -hq + 4d - 11 + 30 for q. 3 Let q(v) = -2v - 2. Let w = 1 - 8. Let p be q(w). Solve -2l + a = p - 5, -2l = -3a + 13 for l. -2 Let z = -5 + 19. Suppose 2g = -0g + z. Solve -4k = 2t + 7 + 15, 2t + g = -k for t. -1 Let l(k) = -k*3 + 8k*2 - 7k + 5. Let a be l(7). Let b be 6/8 - 6/8. Solve b = 2u + x - 5, -4u - ax + 7 = -0u for u. 3 Let w(g) = -g - 3. Let c be w(-7). Let q(j) = -9 - c + j + 4. Let y be q(9). Solve -v + 3u - 2 = y, 2 + 8 = 5v + 5u for v. 1 Let g = -3 - -3. Let y = 15 - -6. Let o be y/(-14)(-20)/6. Solve ol - 4v = 2l - 18, g = -4l + v - 11 for l. -2 Let t(f) = f*2 - 8f - 13. Let u be t(9). Let d = 11 + -5. Let h be (u - -6)/(4/d). Solve -r - hz = -6, z = -3r - 0z - 6 for r. -3 Let m be (-6)/(1 - ((1 - 1) + 3)). Solve s = mk - 17, 5k = -4s + 2s + 21 for s. -2 Suppose k + k = -2q + 12, -k - 6 = -2q. Let u(n) = 2n + 2. Let p be u(6). Suppose 2h = -4 + p. Solve -ha - x - 4x - 5 = 0, q = 2x for a. -3 Suppose -2h = -4h. Suppose 4f - 5u = -8u + 21, 2f - u - 13 = h. Solve b - 2w = 9, -2w = -4b - fw - 12 for b. 1 Let w = 11 + -7. Suppose wj - 3j = 3. Solve -jm = -2l + 3l + 12, m + 4 = 5l for m. -4 Let g(t) = 2t2 - 2t - 1. Let u be g(2). Suppose -4a = 0, ux - 5a = -0x. Suppose x = 3j - 19 - 2. Solve 5p - 5 = d, -3d = 4p - jd - 4 for p. 1 Let n = -4 - -8. Solve -3x + 18 = 3f, nf - 10 = 5x + f for x. 1 Suppose -3n = 5n - 40. Solve z + nv = v + 4, 0 = 3v for z. 4 Let i = 6 - -19. Suppose 0 = 3q + q - 32. Suppose -2g = 4b + 2g - 32, 5b - q = 3g. Solve 4p + 25 = 5j, -p = -j - bj + i for p. 0 Suppose 0 = c + 8c. Solve 2q - 3s = c, -s + 8 = 2q - 0q for q. 3 Suppose -i = 4n - 27, 0 = 5n - 2i - i - 38. Solve -4b + 2g = 10, -ng - 35 = 5b - 2g for b. -4 Let m = -2 + 4. Let b be 33/9m. Let i be (3/6)/(b/12). Solve -ir + 2f + 7 = -1, -18 = -3r - 3f for r. 4 Suppose 0 = -0v - 4v + 12, v - 11 = -4i. Let l be (-3)/i2-1. Solve 4s - p = -9, s + lp = p for s. -2 Let p(h) = -5h3 - h2 + 2h + 2. Let r be p(-1). Solve 0q = -ry - 2q - 2, 3y = -4q - 4 for y. 0 Let u(m) = -m - 12. Let w be u(-9). Let n = -2 - w. Suppose -3h + 13 = n. Solve 0 = -3a + 3g + 7 - 4, 4a + hg = -36 for a. -4 Suppose -3g + 4g - 2 = 0. Suppose -gr + 12 = -10. Solve -5d = -4v - 40, v + r = -d - 2v for d. 4 Suppose 3o = 4o - 3. Suppose 0p + op = h + 14, -4h + 29 = 5p. Solve -a - a - py - 7 = 0, 5y = -a - 6 for a. -1 Suppose 5l + 5f = 30, 0 = -2l + 3f - 2 + 9. Let n be (-3)/(2 - 5)0. Let y be 3 - ((1 - n) + -3). Solve 4 = -yg + 3a, -g - la = -2a - 10 for g. 1 Suppose 5u - 3u = 0. Solve ug = 2x - 5g + 31, -4g + 26 = -2x for x. -3 Let n(r) be the third derivative of r5/60 - r4/8 - r*3/2 + 2r*2. Let p be n(-2). Solve -6 = 3a, 4c - c + p = -5a for c. 1 Let f be ((-12)/(-15))/((-18)/(-225)). Solve r = 2n, 0r + 2r = -n - f for r. -4 Let g be (-18)/(-12)21. Suppose 5t = -2r + 2t, -gr = 2t. Solve ro - o = -u - 7, -2u - 2o + 6 = 0 for u. -2 Let r = 1 + 3. Solve v = -4z - rv - 20, -2v - 8 = -z for z. 0 Let a(l) = -10l - 10l*2 + l + 15l*3 + 7 - 16l*3 - 4. Let s be -6(-1)/(4/(-6)). Let q be a(s). Solve 16 = -4z + r + qr, 0 = 2z + 3r + 3 for z. -3 Suppose -28d + 7d + 84 = 0. Suppose -3p - 2p = -10. Let o = 2 + -2. Solve pq - 1 = -r + 2, o = -dq for r. 3 Let g be (2/(-4) + 3)2. Let r be (-51)/(-15) - 2/g. Let c = -3 + 3. Solve 2m - 4b + 10 = 0, rm + 15 + c = -2b for m. -5 Suppose 0 = 5f + 3d + 2, 2f - 2d = -2f + 16. Solve -1 = -n + fp + 4, -5p =	{ "pile_set_name": "DM Mathematics" }
What is the tens digit of 1993? 9 What is the hundreds digit of 82098? 0 What is the units digit of 1768? 8 What is the hundreds digit of 183? 1 What is the hundreds digit of 9012? 0 What is the tens digit of 2627? 2 What is the tens digit of 12882? 8 What is the tens digit of 46406? 0 What is the tens digit of 5734? 3 What is the tens digit of 11182? 8 What is the units digit of 658? 8 What is the units digit of 6266? 6 What is the hundreds digit of 14378? 3 What is the units digit of 536? 6 What is the units digit of 1069? 9 What is the units digit of 18281? 1 What is the thousands digit of 92959? 2 What is the ten thousands digit of 10449? 1 What is the thousands digit of 9880? 9 What is the hundreds digit of 26819? 8 What is the units digit of 5647? 7 What is the tens digit of 32377? 7 What is the tens digit of 9576? 7 What is the thousands digit of 4122? 4 What is the hundreds digit of 20856? 8 What is the tens digit of 4788? 8 What is the thousands digit of 11937? 1 What is the hundreds digit of 148722? 7 What is the thousands digit of 4966? 4 What is the hundreds digit of 7864? 8 What is the units digit of 120575? 5 What is the hundreds digit of 467? 4 What is the tens digit of 21487? 8 What is the tens digit of 19750? 5 What is the units digit of 1326? 6 What is the units digit of 862? 2 What is the tens digit of 43778? 7 What is the thousands digit of 37183? 7 What is the units digit of 662? 2 What is the thousands digit of 3087? 3 What is the hundreds digit of 908? 9 What is the hundreds digit of 16264? 2 What is the thousands digit of 8776? 8 What is the tens digit of 5612? 1 What is the thousands digit of 2197? 2 What is the units digit of 10857? 7 What is the tens digit of 1963? 6 What is the units digit of 2314? 4 What is the tens digit of 98265? 6 What is the units digit of 8766? 6 What is the units digit of 27321? 1 What is the units digit of 13867? 7 What is the units digit of 2736? 6 What is the tens digit of 4184? 8 What is the hundreds digit of 1581? 5 What is the units digit of 7929? 9 What is the hundreds digit of 1626? 6 What is the units digit of 5828? 8 What is the units digit of 62247? 7 What is the thousands digit of 6078? 6 What is the ten thousands digit of 68688? 6 What is the thousands digit of 46890? 6 What is the units digit of 2441? 1 What is the hundreds digit of 987? 9 What is the units digit of 3813? 3 What is the tens digit of 2092? 9 What is the thousands digit of 19566? 9 What is the units digit of 15? 5 What is the units digit of 504? 4 What is the units digit of 21816? 6 What is the hundreds digit of 2432? 4 What is the hundreds digit of 48492? 4 What is the thousands digit of 30768? 0 What is the units digit of 2945? 5 What is the hundreds digit of 20580? 5 What is the units digit of 11925? 5 What is the units digit of 1147? 7 What is the ten thousands digit of 46066? 4 What is the hundreds digit of 7608? 6 What is the hundreds digit of 466? 4 What is the hundreds digit of 1225? 2 What is the thousands digit of 2955? 2 What is the hundreds digit of 3286? 2 What is the tens digit of 155? 5 What is the ten thousands digit of 64956? 6 What is the hundreds digit of 99643? 6 What is the tens digit of 11873? 7 What is the units digit of 10709? 9 What is the tens digit of 13052? 5 What is the thousands digit of 2403? 2 What is the units digit of 1551? 1 What is the units digit of 4217? 7 What is the thousands digit of 13115? 3 What is the tens digit of 2883? 8 What is the ten thousands digit of 114218? 1 What is the units digit of 2836? 6 What is the units digit of 32? 2 What is the thousands digit of 6078? 6 What is the units digit of 579? 9 What is the hundreds digit of 17263? 2 What is the units digit of 749? 9 What is the thousands digit of 28394? 8 What is the units digit of 3144? 4 What is the thousands digit of 1451? 1 What is the units digit of 9576? 6 What is the thousands digit of 11448? 1 What is the ten thousands digit of 64040? 6 What is the tens digit of 6065? 6 What is the thousands digit of 5138? 5 What is the tens digit of 73? 7 What is the thousands digit of 5281? 5 What is the units digit of 6318? 8 What is the units digit of 65444? 4 What is the units digit of 63107? 7 What is the tens digit of 909? 0 What is the thousands digit of 9295? 9 What is the thousands digit of 88099? 8 What is the thousands digit of 1586? 1 What is the hundreds digit of 1744? 7 What is the units digit of 7832? 2 What is the units digit of 573? 3 What is the ten thousands digit of 41992? 4 What is the ten thousands digit of 66108? 6 What is the thousands digit of 1097? 1 What is the units digit of 1666? 6 What is the units digit of 2546? 6 What is the tens digit of 2974? 7 What is the tens digit of 22999? 9 What is the ten thousands digit of 57476? 5 What is the tens digit of 72918? 1 What is the units digit of 73868? 8 What is the ten thousands digit of 29264? 2 What is the tens digit of 31964? 6 What is the units digit of 69158? 8 What is the thousands digit of 32259? 2 What is the units digit of 54008? 8 What is the thousands digit of 1264? 1 What is the hundreds digit of 550? 5 What is the tens digit of 2209? 0 What is the hundreds digit of 19811? 8 What is the thousands digit of 4463? 4 What is the tens digit of 553? 5 What is the thousands digit of 12825? 2 What is the ten thousands digit of 203218? 0 What is the hundreds digit of 26993? 9 What is the hundred thousands digit of 141021? 1 What is the hundreds digit of 1086? 0 What is the hundreds digit of 123860? 8 What is the hundreds digit of 5892? 8 What is the hundreds digit of 26787? 7 What is the thousands digit of 19606? 9 What is the units digit of 4999? 9 What is the thousands digit of 20033? 0 What is the thousands digit of 10776? 0 What is the tens digit of 3170? 7 What is the tens digit of 2861? 6 What is the hundreds digit of 15039? 0 What is the tens digit of 22014? 1 What is the ten thousands digit of 36478? 3 What is the ten thousands digit of 35363? 3 What is the units digit of 406? 6 What is the tens digit of 217? 1 What is the tens digit of 160? 6 What is the tens digit of 859? 5 What is the hundreds digit of 7354? 3 What is the thousands digit of 6493? 6 What is the hundreds digit of 274? 2 What is the tens digit of 22542? 4 What is the hundreds digit of 3032? 0 What is the thousands digit of 7210? 7 What is the tens digit of 4178? 7 What is the units digit of 15433? 3 What is the units digit of 68549? 9 What is the tens digit of 1694? 9 What is the hundreds digit of 21337? 3 What is the units digit of 4006? 6 What is the hundreds digit of 26632? 6 What is the tens digit of 526? 2 What is the hundreds digit of 60915? 9 What is the units digit of 4530? 0 What is the thousands digit of 4821? 4 What is the hundreds digit of 3467? 4 What is the hundreds digit of 1747? 7 What is the hundreds digit of 3335? 3 What is the thousands digit of 5830? 5 What is the hundreds digit of 996? 9 What is the units digit of 2257? 7 What is the hundreds digit of 1158? 1 What is the units digit of 40882? 2 What is the units digit of 26769? 9 What is the tens digit of 56257? 5 What is the units digit of 814? 4 What is the ten thousands digit of 13050? 1 What is the units digit of 27212? 2 What is the tens digit of 1170? 7 What is the tens digit of 467? 6 What is the units digit of 8249? 9 What is the tens digit of 9025? 2 What is the thousands digit of 6886? 6 What is the units digit of 508? 8 What is the tens digit of 3316? 1 What is the hundreds digit of 1700? 7 What is the ten thousands digit of 18023? 1 What is the units digit of 6? 6 What is the tens digit of 38279? 7 What is the ten thousands digit of 26578? 2 What is the hundreds digit of 1745? 7 What is the thousands digit of 2117? 2 What is the thousands digit of 8381? 8 What is the thousands digit of 2954? 2 What is the tens digit of 6177? 7 What is the thousands digit of 1087? 1 What is the thousands digit of 27935? 7 What is the tens digit of 1577? 7 What is the units digit of 708? 8 What is the tens digit of 61565? 6 What is the units digit of 4232? 2 What is the hundreds digit of 93449? 4 What is the hundreds digit of 964? 9 What is the thousands digit of 9861? 9 What is the units digit of 1	{ "pile_set_name": "DM Mathematics" }
p - 16 = 0. -4, -1 Let n*5 - 4n*3 = 0. What is n? -2, 0, 2 Let -2m*2/9 - 16m/3 = 0. What is m? -24, 0 Find d such that d*5 + 7d*4/2 - 3d*3/2 - 17d*2/2 + 5d/2 + 3 = 0. -3, -2, -1/2, 1 Factor -3a2/4 - 9a/2 + 561/4. -3(a - 11)(a + 17)/4 Let -7b5/2 + 47b*4/2 + 21b*3/2 - 47b*2/2 - 7b = 0. Calculate b. -1, -2/7, 0, 1, 7 Factor -n*2/3 + 11n/3 + 92. -(n - 23)(n + 12)/3 Factor 7h*3/2 + 4h*2 - 136h - 384. (h + 4)*2(7h - 48)/2 Determine i, given that -i3 + 52i*2 + 108i = 0. -2, 0, 54 What is c in -2c3/5 + 8c*2/15 - 2c/15 = 0? 0, 1/3, 1 Factor -2u2 + 5u - 2. -(u - 2)(2u - 1) Let 4w3/3 - 1808w*2/3 + 207872w/3 - 802816/3 = 0. What is w? 4, 224 Find s such that 16s3 + 30s*2 - 22s - 36 = 0. -2, -1, 9/8 Factor -m*2 - 24m + 25. -(m - 1)(m + 25) Factor m2 - 79m/3 - 18. (m - 27)(3m + 2)/3 Let 4g4 - 24g*3 + 44g*2 - 24g = 0. Calculate g. 0, 1, 2, 3 Factor 2y3 - 66y*2 + 340y - 432. 2(y - 27)(y - 4)(y - 2) Factor -5i*4 - 20i*3 + 240i*2 + 1600i + 2560. -5(i - 8)(i + 4)*3 Find u such that 3u*2/4 - 4563u/2 + 6940323/4 = 0. 1521 Suppose 6n5 + 93n*4 - 240n*3 - 4512n*2 + 16128n - 6912 = 0. Calculate n. -12, 1/2, 4 Factor -4c3/7 - 9724c*2/7 - 5914620c/7 - 5904900/7. -4(c + 1)(c + 1215)*2/7 Let 2u*2/3 - 6u - 20/3 = 0. Calculate u. -1, 10 Determine y so that -3y2 + 18y + 165 = 0. -5, 11 Factor 3k3 - 72k*2 + 387k - 510. 3(k - 17)(k - 5)(k - 2) Factor 2f*4/15 + 108f*3/5 - 334f*2/3. 2f*2(f - 5)(f + 167)/15 Solve -4f*5 + 20f*4 + 248f*3 + 200f*2 - 244f - 220 = 0. -5, -1, 1, 11 Solve -a*5 - 22a*4 + 221a*3 - 558a*2 + 360a = 0. -30, 0, 1, 3, 4 Factor 5c2 - 4975c - 4980. 5(c - 996)(c + 1) What is c in -5c3 - 310c*2 - 305c = 0? -61, -1, 0 Find p, given that -5p4/4 - 103p*3/4 - 553p*2/4 - 257p/4 + 99/2 = 0. -11, -9, -1, 2/5 Factor -h*3 + 925h*2 - 214368h + 213444. -(h - 462)*2(h - 1) Suppose -3v3 - 24v*2 - 57v - 36 = 0. Calculate v. -4, -3, -1 Solve -w*4/7 + 10w*3/7 + 40w*2/7 - 10w/7 - 39/7 = 0. -3, -1, 1, 13 Find w such that -2w2 - 1074w + 1076 = 0. -538, 1 Factor 2m3/9 - 28m*2/9 + 98m/9 - 8. 2(m - 9)(m - 4)(m - 1)/9 Let -225x*5 + 670x*4 - 686x*3 + 244x*2 + 15x - 18 = 0. What is x? -2/9, 3/5, 1 Factor -2d4/5 + 2d*3 + 2d*2/5 - 2d. -2d(d - 5)(d - 1)(d + 1)/5 Determine i so that 21i4 + 44i*3 - 80i*2 - 176i - 16 = 0. -2, -2/21, 2 Factor -4q2 - 17464q - 19061956. -4(q + 2183)2 Suppose -121i*3 + 319i*2 + 128i + 12 = 0. Calculate i. -2/11, 3 Let -5h4 - 40h*3 + 225h*2 - 180h = 0. What is h? -12, 0, 1, 3 Factor 3v4 + 929v*3 + 71765v*2 - 24025v. v(v + 155)2(3v - 1) Factor 2v*3/9 + 20v*2 - 566v/9 - 248/3. 2(v - 4)(v + 1)(v + 93)/9 Determine r so that 21r*5 + 78r*4 + 18r*3 - 96r*2 - 39r + 18 = 0. -3, -1, 2/7, 1 Let 2t2/3 + 56t/3 - 58/3 = 0. What is t? -29, 1 Suppose h*3/2 + 173h*2/2 + 343h/2 + 171/2 = 0. Calculate h. -171, -1 Suppose s*5 - 18s*4 + 101s*3 - 132s*2 - 252s = 0. What is s? -1, 0, 6, 7 Factor -2a3/11 + 328a*2/11 - 2528a/11 + 4992/11. -2(a - 156)(a - 4)*2/11 Factor -5l*2/2 - 5l/2 + 140. -5(l - 7)(l + 8)/2 Determine f so that 5f4 - 320f*3 + 625f*2 - 310f = 0. 0, 1, 62 Factor -2p4 + 97p*3/2 - 12p2. -p2(p - 24)(4p - 1)/2 Factor 2z*4/5 - 6z*3/5 - 8z*2/5. 2z*2(z - 4)(z + 1)/5 Factor -2q*3/5 + 288q*2/5 - 13824q/5 + 221184/5. -2(q - 48)3/5 Factor -3x*3 - 18x*2 - 27x - 12. -3(x + 1)2(x + 4) Let p5/6 + p4/6 - 7p3/6 - 13p*2/6 - p = 0. What is p? -2, -1, 0, 3 Factor -3k*2/5 + 576k/5 - 4941/5. -3(k - 183)(k - 9)/5 Factor -4o2 + 113o/2 + 121/2. -(o + 1)(8o - 121)/2 Solve -5o5 + 95o*4 + 160o*3 - 5540o*2 - 21280o - 15680 = 0. -4, -1, 14 Factor -2s2 + 1804s. -2s(s - 902) Let t*5/4 + 9t*4 + 71t*3 + 148t*2 - 240t - 832 = 0. What is t? -26, -4, 2 Factor -b*3/4 + 5b*2/2 + b/4 - 5/2. -(b - 10)(b - 1)(b + 1)/4 Determine j so that j3/2 - 180j*2 + 21600j - 864000 = 0. 120 Factor -3h3 - 48h*2 - 39h + 90. -3(h - 1)(h + 2)(h + 15) Solve o4/5 - 71o*3/5 + 332o*2/5 - 124o/5 - 528/5 = 0 for o. -1, 2, 4, 66 Factor -5m4 - 10m*3. -5m*3(m + 2) Solve -10l3 - 6096l*2 + 2440l = 0. -610, 0, 2/5 Solve -2k2/19 - 1442k/19 + 76 = 0 for k. -722, 1 Determine w, given that -2w3 - 6w*2 + 152w - 264 = 0. -11, 2, 6 Factor s*5/3 - 8s*4/3 + 7s3/3. s3(s - 7)(s - 1)/3 Determine b so that 4b5 - 40b*3 + 80b*2 - 60b + 16 = 0. -4, 1 Solve r*2 - 35r = 0 for r. 0, 35 What is g in -3g4 + 174g*3 - 645g*2 - 174g + 648 = 0? -1, 1, 4, 54 Factor -x*3 + 25x*2 - 106x + 120. -(x - 20)(x - 3)(x - 2) Suppose 10g3 + 935g*2 - 475g - 470 = 0. Calculate g. -94, -1/2, 1 Suppose 6z5/5 + 21z*4/5 + 9z*3/5 = 0. Calculate z. -3, -1/2, 0 Let 3b*5 + 1923b*4 + 305265b*3 - 927363b*2 + 931224b - 311052 = 0. What is b? -322, 1 Find p, given that -p*2/2 + 150p = 0. 0, 300 Determine w so that 3w5 + 120w*4 + 342w*3 + 336w*2 + 111w = 0. -37, -1, 0 Determine f so that 3f2/5 - 531f/5 - 324 = 0. -3, 180 Suppose -2j2 + 108j - 306 = 0. Calculate j. 3, 51 Find l, given that -2l4 - 10l*3 - 8l*2 = 0. -4, -1, 0 Determine o so that -5o*2 - 20o + 300 = 0. -10, 6 Factor 2q3 + 60q*2. 2q*2(q + 30) Suppose -20r5/3 + 928r*4/3 - 1228r*3/3 - 1456r*2/3 + 240r = 0. What is r? -1, 0, 2/5, 2, 45 Let -2u2/3 - 1312u/3 + 438 = 0. What is u? -657, 1 Factor o*2/2 + 399o - 1604. (o - 4)(o + 802)/2 Solve 484y*3/3 - 352y*2/3 - 41y - 3 = 0 for y. -3/22, 1 Factor 20n2/3 - 6n - 2/3. 2(n - 1)(10n + 1)/3 Factor i2 - 8i - 209. (i - 19)(i + 11) Factor -k3/4 - 3k*2/2 - 2k. -k(k + 2)(k + 4)/4 Suppose -5l2 - 180l - 1015 = 0. What is l? -29, -7 Factor 2k2 - 434k - 2220. 2(k - 222)(k + 5) Solve 3x5 + 27x*4 + 57x*3 + 9x*2 - 60x - 36 = 0. -6, -2, -1, 1 Factor 2u4/7 + 12u*3/7 + 16u*2/7. 2u*2(u + 2)(u + 4)/7 Find j, given that 4j*2 - 172j + 1560 = 0. 13, 30 Let 3z4/2 - 45z*3/2 - 9z*2/2 + 129z/2 + 45 = 0. What is z? -1, 2, 15 Suppose 54x3 - 530x*2/11 - 72x/11 + 8/11 = 0. What is x? -2/11, 2/27, 1 Factor 5y2 - 15y - 140. 5(y - 7)(y + 4) Factor -n*2/7 - 594n/7 - 88209/7. -(n + 297)*2/7 Let -4y*5 + 40y*4 + 432y*3 - 616y*2 - 2348y - 1344 = 0. What is y? -7, -1, 3, 16 What is r in -2r5/15 + 4r*4/3 - 32r*3/15 - 4r*2/15 + 34r/15 - 16/15 = 0? -1, 1, 8 Factor 84h2 - 2h/7. 2h(294h - 1)/7 Let 4j*3/5 + 1608j*2/5 - 4j/5 - 1608/5 = 0. Calculate j. -402, -1, 1 Suppose -h*3/8 + 45h*2/8 + 177h/4 + 65 = 0. Calculate h. -5, -2, 52 Factor -2o2 + 12o + 110. -2(o - 11)(o + 5) Suppose -j*4 + 6j*3 - 12j*2 + 10j - 3 = 0. What is j? 1, 3 Factor -2t2/3 + 326t - 976/3. -2(t - 488)(t - 1)/3 Factor -2w5/15 - 3404w*4/15 - 385786w*3/3 - 362632784w*2/15 + 731065984w/15 - 366500864/15. -2(w - 1)2(w + 568)3/15 Factor o4/9 + 2o3 - 781o*2/9 - 266o/3. o(o - 21)(o + 1)(o + 38)/9 Let -2p*4/9 + 172p*3/3 - 1522p*2/9 - 680p/3 = 0. What is p? -1, 0, 4, 255 Let -3d5/5 - 42d*4/5 - 174d*3/5 - 12d*2 + 165d + 150 = 0. What is d? -5, -1, 2 Suppose -2q2/5 + 28q/5 - 26/5 = 0. What is q? 1, 13 Factor 6w3 + 140w*2/3 + 94w/3 - 28/3. 2(w + 1)(w + 7)(9w - 2)/3 Factor -2t4 + 144t*3 - 2986t*2 + 14124t - 17424. -2(t - 33)2(t - 4)(t - 2) Suppose -3k*3 - 51k*2 + 114k = 0. Calculate k. -19, 0, 2 Determine q so that 3q3 - 48q*2 + 192q = 0. 0, 8 Solve 4n2/7 + 3996n/7 = 0 for n. -999, 0 Suppose -p4/6 + p3/6 + 19p2/6 - 49p/6 + 5 = 0. Calculate p. -5, 1, 2, 3 Let v*3/4 - 3v*2/2 + 9v/4 - 1 = 0. What is v? 1, 4 Factor -3p2/4 + 663p/4 - 165. -3(p - 220)(p - 1)/4 Factor n*2/3 - 2n - 55/3. (n - 11)(n + 5)/3 Factor -g5 - 1994g*4 - 992013g*3 + 1990012g*2 - 996004g. -g(g - 1)2(g + 998)*2 Find w, given that -3w*3 + 57w*2 + 360w = 0. -5, 0, 24 Factor x*3/3 - 10x*2/3 + 28x/3 - 8. (x - 6)(x - 2)2/3 Factor -2n*3 - 58n*2 - 108n. -2n(n + 2)*(n + 27) Determin	{ "pile_set_name": "DM Mathematics" }
-168m Let q(y) be the second derivative of y10/10080 + y6/240 + y4/12 + 3y. Let p(s) be the third derivative of q(s). Find the second derivative of p(u) wrt u. 60u3 Let a(i) be the second derivative of -2i*6 - 7i*3/6 - 5i*2/2 - 14i. What is the second derivative of a(q) wrt q? -720q2 Let n(k) = -16k*3 + 5k*2 + 8k. Let w(j) = j3 - j2 - j. Let h(x) = -n(x) - 5w(x). Find the second derivative of h(l) wrt l. 66l Let k(c) = -3c2 - 9c + 1. Let j(q) = 2q2 + 4q. Let w(a) = 9j(a) + 4k(a). What is the derivative of w(g) wrt g? 12g Let k(p) = -3p*2 - 35p - 43. Let n(u) = -2u2 - 18u - 22. Let i(v) = -3k(v) + 5n(v). What is the derivative of i(d) wrt d? -2d + 15 Suppose 4t = -2f + 54, 4t - 3f + 0f - 79 = 0. Find the first derivative of 3b4 - 23 - t + 33 wrt b. 12b*3 Let z(t) be the first derivative of -t - 4/3t*3 + 0t*2 - 6. Differentiate z(s) wrt s. -8s Let l be 4/14 + 48/28. Suppose -la + 26 = -5b, 2a - 5b = -b + 22. What is the second derivative of r3 - ra - 2r3 + 2r wrt r? -12r Let l(k) = -2k*4 + k + 0k*4 + 3k*3 - 4k. Let r(j) = -5j4 + 7j*3 - 5j. Let g(v) = 7l(v) - 3r(v). What is the second derivative of g(i) wrt i? 12i2 Let a(p) = p2 + 3p - 6. Let l be a(-5). Suppose -5n = -26 - 24. Find the second derivative of -xl - x4 + nx - 9x wrt x. -24x*2 Let n(z) = z + 1. Suppose -25 = 5p - x, 4p - x = -5x - 44. Let v(g) = -g + 13. Let l(y) = pn(y) + v(y). Differentiate l(t) with respect to t. -7 Let m(g) be the third derivative of 13g*6/60 + 3g*3/2 - 10g*2. Find the first derivative of m(t) wrt t. 78t*2 Suppose 16u = 12u + 12. Suppose 0 = 5x - x - 24. Differentiate 3 - x + 5 + ul4 with respect to l. 12l*3 Let l(s) be the first derivative of 2 + 0s*5 + 0s*4 + 0s2 - s3 - 1/6s6 + 0s. What is the third derivative of l(n) wrt n? -60n2 Let g(h) be the third derivative of h4/4 + 2h3/3 + h2. Differentiate g(n) wrt n. 6 Let y be (2 - -3) + -7 + 5. Let g(a) be the first derivative of -4 + 0a + 0a*4 + 0a*2 - 4/3a*y - 3/5a*5. Find the third derivative of g(t) wrt t. -72t Let o(r) be the first derivative of -r5/12 - r3/2 + 2r2 - 3. Let y(t) be the second derivative of o(t). What is the derivative of y(f) wrt f? -10f Let h(w) be the second derivative of 1/56w8 - 1/6w*4 + 0w*2 + 0w*6 + 0w*3 + 0w*5 + 4w + 0 + 0w7. What is the third derivative of h(d) wrt d? 120d*3 Let d(t) = -2t - 1. Let j(p) = -4p - 2. Let c(g) = -5d(g) + 2j(g). Find the first derivative of c(s) wrt s. 2 Let u(i) = -i2 + 10i - 4. Let h be u(8). Let b be ((-8)/6)/((-8)/h). What is the second derivative of -4v2 - v + 4v2 + vb wrt v? 2 Let k(g) be the third derivative of 0g5 + 0g*3 + 0 + 0g*7 + 1/8g4 + g2 + 1/84g8 + 0g*6 + 0g. Find the second derivative of k(h) wrt h. 80h3 Let x(s) be the third derivative of -s7/35 + 2s*3/3 - 2s*2. What is the derivative of x(i) wrt i? -24i3 Let n(s) = -s2 - 9s - 7. Let q be n(-7). Let h(v) = v3 - 6v*2 - 7v + 1. Let z be h(q). Differentiate 0y + 1 + z + y wrt y. 1 Let a(t) = t2 + 8t + 9. Let s(n) = n*3 - 4n*2 + 2n - 4. Let h be s(3). Let o be a(h). Find the first derivative of -or2 + 0 + 4r*2 + 1 wrt r. 4r Let t(h) = 33h2 - 35h - 18h2 - 13h*2 + 40h2 + 28. Let a(m) = m2 - m + 1. Let n(c) = -35a(c) + t(c). What is the first derivative of n(q) wrt q? 14q What is the third derivative of -9c2 - c3 + 19c*3 - 60c*3 wrt c? -252 Let o(n) = 9n*3 - 2n*2 + 2n + 21. Let q(k) = k*2 - k. Let f(z) = -o(z) - 2q(z). Differentiate f(x) wrt x. -27x2 Let h = -27 - -29. Let z(c) be the third derivative of 1/8c*4 - 1/6c*3 + 0 - 4c*h + 0c. Differentiate z(x) wrt x. 3 Let k(v) = -2v4 + 2v*2 + 1. Let m(q) = -4q*4 + 4 + 5q*2 - 2 + 0q*2 + 1. Let a(d) = -5k(d) + 2m(d). What is the derivative of a(o) wrt o? 8o*3 Let k(t) = 11t*3 - 2t*2 - 6t - 6. Let y(q) = -q3 - 2 + q2 + q + 3 + 0. Let c(n) = k(n) + 6y(n). What is the third derivative of c(f) wrt f? 30 Let d(g) = -2g + 1. Let y be d(-2). Find the third derivative of 0ry - 2r*2 - 2r*5 - 3r*5 + 3r*5 wrt r. -120r*2 Let v(d) = 4d3 - d2 + 7d. Suppose 5m + 1 = -34. Let i(o) = 2o3 - o2 + 4o. Let a(f) = mi(f) + 4v(f). Find the third derivative of a(q) wrt q. 12 Let u(v) be the third derivative of v*6/60 + 11v*4/12 - 6v*2. Find the second derivative of u(w) wrt w. 12w Let q(t) be the second derivative of -t8/560 + t6/180 - t*3/2 + 3t. Let v(p) be the second derivative of q(p). What is the third derivative of v(f) wrt f? -72f What is the second derivative of g + g2 + 4g*2 - 2g*2 - 4g wrt g? 6 Let o(y) = 30y3 + 2y*2 + y - 2. Let k(n) = 120n*3 + 9n*2 + 4n - 9. Let t(l) = 2k(l) - 9o(l). What is the second derivative of t(v) wrt v? -180v Suppose -2x + 2s = 10, 2s + 5 = 3s. Suppose -3b - 2i + 12 = -xb, 4b - 16 = -4i. Differentiate -2m - 4 + 6 + bm with respect to m. 2 Let j(g) be the second derivative of 0 + 3g + 1/14g*8 + 0g*3 + 0g*2 + 0g*7 - 1/6g*4 + 0g*6 + 0g*5. Find the third derivative of j(l) wrt l. 480l*3 Let l(j) = 13j*3 + 24j*2 - 14j. Let k(h) = 37h3 + 72h*2 - 43h. Let z(c) = 6k(c) - 17l(c). What is the second derivative of z(q) wrt q? 6q + 48 Let x(t) = 8t*2 - 8t. Let m(u) = 16u2 - 17u. Let a(k) = -4m(k) + 7x(k). Find the second derivative of a(b) wrt b. -16 Let z(d) = d*2 + 8d + 3. Let w be z(-8). Find the third derivative of 3u2 + 3u*3 + 3u*3 - 3u*w wrt u. 18 Find the third derivative of 15x*2 - 25x*6 + 4x2 - x2 + 30x6 wrt x. 600x*3 Let s(g) = 40g*4 + 49g*2. Let n(i) = 40i*4 + 48i*2. Let z(x) = -7n(x) + 6s(x). What is the third derivative of z(b) wrt b? -960b Let u(g) be the first derivative of g4/3 - g3/3 - 5g - 1. Let l(r) be the first derivative of u(r). Find the second derivative of l(c) wrt c. 8 Let l(s) be the third derivative of s6/40 + s5/4 + 61s*3/6 + 7s*2. Find the first derivative of l(y) wrt y. 9y*2 + 30y Let h be 114/36 - (-1)/(-6). What is the third derivative of 2w2 + 5w*5 + 0w*5 - hw*5 wrt w? 120w*2 Let z(o) = 2o + 3. Let q(c) = -3c - 23. Let u(m) = -m - 12. Let p(b) = 4q(b) - 7u(b). Let r = 7 + -18. Let f(s) = rz(s) - 4p(s). Differentiate f(l) wrt l. -2 Differentiate 11f*4 - 14 + 16f*4 - 8f*4 - 3 wrt f. 76f*3 What is the second derivative of 0i*4 + 9i*4 - 8i*4 + 4i wrt i? 12i2 Let b = 961/12 + -80. Let s(l) be the second derivative of 0l*2 + l + 0 + bl*4 - 1/2l*3. What is the second derivative of s(c) wrt c? 2 What is the first derivative of -16l*4 + 3 + 48l*4 - 2 wrt l? 128l*3 Let k(b) be the third derivative of 0 + 0b - 7/120b6 + 0b*3 - 4b*2 + 1/24b*4 + 0b*5. What is the second derivative of k(n) wrt n? -42n Let d(k) be the second derivative of 1/2k5 - 2/3k*3 + 0k*2 + 0 + 8k + 0k4. What is the second derivative of d(u) wrt u? 60u Let d(x) = -11x5 + 4x*4 - 4x*3 + 13x - 4. Let v(q) = -q4 + q3 - q + 1. Let w(u) = -d(u) - 4v(u). What is the second derivative of w(l) wrt l? 220l*3 Suppose -3u - 13 + 1 = 0. Let h(a) = -a*2 - 6a - 6. Let p be h(u). What is the third derivative of 2y6 - 4y*6 + 0y*2 - py*2 wrt y? -240y*3 Let o(v) be the third derivative of 0 - 3v*2 + 0v + 1/8v4 - 1/3v*3. What is the derivative of o(c) wrt c? 3 Let l(z) be the third derivative of 0z*3 + 1/4z*4 - 6z*2 + 0z + 1/30z5 + 0. Find the second derivative of l(q) wrt q. 4 Let i(t) = -15t*2 + 3t - 10. Let q(a) = 29a2 - 5a + 21. Let c(l) = -5i(l) - 3q(l). What is the first derivative of c(d) wrt d? -24d Let n(s) = -9s*3 - 7s + 10. Let h(q) = 6q3 + 3 + 4q - 2q - 10 + 3q. Let g(b) = -7h(b) - 5n(b). Differentiate g(v) with respect to v. 9v2 Let o(x) be the second derivative of 0x*4 + 1/6x*3 + 0x*2 + 4x + 0 + 1/5x5. Find the second derivative of o(d) wrt d. 24d What is the second derivative of -8k3 - k - 2k - 113k2 + 113k*2 wrt k? -48k Differentiate 15x - 9x + 11 - 2 with respect to x. 6 Let q(a) = -a*2 + a - 1. Let g(y) = 4y*3 - 6	{ "pile_set_name": "DM Mathematics" }
4:06 AM? 11:45 AM How many minutes are there between 5:13 AM and 10:05 AM? 292 How many minutes are there between 12:37 AM and 11:18 AM? 641 What is 173 minutes before 11:06 PM? 8:13 PM What is 691 minutes after 10:03 AM? 9:34 PM How many minutes are there between 3:14 PM and 2:54 AM? 700 How many minutes are there between 12:41 PM and 6:25 PM? 344 What is 706 minutes after 1:48 AM? 1:34 PM What is 430 minutes after 3:14 AM? 10:24 AM How many minutes are there between 2:18 AM and 4:42 AM? 144 How many minutes are there between 11:03 AM and 9:08 PM? 605 What is 704 minutes before 12:26 PM? 12:42 AM How many minutes are there between 6:08 AM and 7:40 AM? 92 What is 681 minutes after 9:06 PM? 8:27 AM How many minutes are there between 4:46 PM and 6:49 PM? 123 How many minutes are there between 7:18 PM and 1:57 AM? 399 How many minutes are there between 11:46 PM and 3:56 AM? 250 What is 508 minutes before 3:33 PM? 7:05 AM How many minutes are there between 2:42 PM and 10:55 PM? 493 How many minutes are there between 7:27 PM and 6:45 AM? 678 What is 665 minutes after 8:14 AM? 7:19 PM What is 355 minutes after 9:21 AM? 3:16 PM How many minutes are there between 1:15 AM and 4:21 AM? 186 How many minutes are there between 9:06 AM and 8:34 PM? 688 How many minutes are there between 10:45 PM and 5:49 AM? 424 What is 609 minutes before 8:23 PM? 10:14 AM What is 418 minutes after 5:20 PM? 12:18 AM What is 36 minutes after 6:13 AM? 6:49 AM How many minutes are there between 2:26 PM and 3:04 PM? 38 How many minutes are there between 11:37 AM and 4:35 PM? 298 How many minutes are there between 1:22 AM and 12:25 PM? 663 How many minutes are there between 4:40 PM and 6:22 PM? 102 What is 323 minutes before 6:42 AM? 1:19 AM What is 697 minutes after 7:59 PM? 7:36 AM How many minutes are there between 10:36 AM and 8:18 PM? 582 What is 91 minutes before 9:03 AM? 7:32 AM How many minutes are there between 5:15 PM and 6:32 PM? 77 What is 59 minutes after 9:32 AM? 10:31 AM How many minutes are there between 9:40 PM and 7:29 AM? 589 What is 293 minutes after 7:21 PM? 12:14 AM How many minutes are there between 2:40 AM and 9:05 AM? 385 What is 443 minutes after 7:53 PM? 3:16 AM What is 154 minutes before 8:08 PM? 5:34 PM What is 714 minutes before 6:55 PM? 7:01 AM How many minutes are there between 6:02 PM and 8:36 PM? 154 How many minutes are there between 8:24 PM and 6:20 AM? 596 What is 120 minutes before 9:43 PM? 7:43 PM What is 237 minutes after 1:47 AM? 5:44 AM What is 675 minutes after 8:40 PM? 7:55 AM How many minutes are there between 11:51 PM and 2:46 AM? 175 What is 556 minutes before 4:45 AM? 7:29 PM What is 167 minutes before 6:52 PM? 4:05 PM What is 503 minutes before 12:53 AM? 4:30 PM How many minutes are there between 10:52 PM and 7:29 AM? 517 What is 458 minutes before 2:31 AM? 6:53 PM What is 92 minutes after 4:05 PM? 5:37 PM What is 309 minutes before 2:05 AM? 8:56 PM How many minutes are there between 1:46 AM and 1:02 PM? 676 How many minutes are there between 10:23 PM and 6:25 AM? 482 How many minutes are there between 1:43 PM and 8:39 PM? 416 What is 25 minutes before 10:43 AM? 10:18 AM What is 252 minutes after 2:35 AM? 6:47 AM What is 318 minutes before 10:29 PM? 5:11 PM What is 171 minutes before 8:27 AM? 5:36 AM What is 496 minutes after 12:30 PM? 8:46 PM How many minutes are there between 2:51 PM and 2:13 AM? 682 What is 63 minutes before 10:20 AM? 9:17 AM What is 305 minutes before 11:27 AM? 6:22 AM How many minutes are there between 3:33 AM and 8:37 AM? 304 What is 366 minutes before 2:36 PM? 8:30 AM How many minutes are there between 2:58 AM and 12:57 PM? 599 What is 458 minutes before 11:09 AM? 3:31 AM How many minutes are there between 12:49 PM and 6:10 PM? 321 How many minutes are there between 10:45 AM and 8:27 PM? 582 How many minutes are there between 10:52 PM and 8:24 AM? 572 What is 359 minutes after 6:04 AM? 12:03 PM How many minutes are there between 4:20 PM and 9:29 PM? 309 What is 710 minutes after 9:21 PM? 9:11 AM How many minutes are there between 12:30 PM and 4:55 PM? 265 What is 48 minutes after 2:01 PM? 2:49 PM How many minutes are there between 11:07 AM and 6:26 PM? 439 How many minutes are there between 11:24 AM and 7:47 PM? 503 What is 481 minutes after 6:42 AM? 2:43 PM What is 51 minutes before 3:57 AM? 3:06 AM What is 581 minutes after 8:46 PM? 6:27 AM What is 304 minutes after 7:04 AM? 12:08 PM How many minutes are there between 12:14 AM and 6:14 AM? 360 How many minutes are there between 7:07 PM and 6:56 AM? 709 How many minutes are there between 8:03 PM and 10:06 PM? 123 How many minutes are there between 4:23 PM and 1:47 AM? 564 How many minutes are there between 4:30 AM and 3:33 PM? 663 What is 439 minutes after 4:19 PM? 11:38 PM What is 612 minutes before 8:27 AM? 10:15 PM What is 102 minutes after 10:48 AM? 12:30 PM How many minutes are there between 2:10 AM and 8:52 AM? 402 How many minutes are there between 9:53 AM and 7:37 PM? 584 What is 318 minutes before 5:02 AM? 11:44 PM How many minutes are there between 4:59 PM and 10:30 PM? 331 How many minutes are there between 7:43 AM and 2:33 PM? 410 How many minutes are there between 12:51 AM and 1:16 AM? 25 How many minutes are there between 9:33 PM and 7:24 AM? 591 How many minutes are there between 9:10 PM and 1:21 AM? 251 How many minutes are there between 8:33 PM and 8:04 AM? 691 What is 581 minutes after 1:36 PM? 11:17 PM What is 485 minutes after 8:51 AM? 4:56 PM How many minutes are there between 12:03 AM and 2:04 AM? 121 How many minutes are there between 12:55 PM and 8:07 PM? 432 How many minutes are there between 5:41 PM and 1:09 AM? 448 What is 546 minutes before 11:41 AM? 2:35 AM What is 279 minutes before 11:23 PM? 6:44 PM What is 153 minutes before 1:17 AM? 10:44 PM What is 669 minutes before 10:17 AM? 11:08 PM How many minutes are there between 9:09 AM and 9:36 AM? 27 What is 490 minutes before 12:27 AM? 4:17 PM What is 657 minutes before 9:00 AM? 10:03 PM How many minutes are there between 3:26 PM and 10:50 PM? 444 How many minutes are there between 6:39 AM and 11:32 AM? 293 How many minutes are there between 12:09 PM and 3:38 PM? 209 What is 52 minutes before 3:55 PM? 3:03 PM What is 459 minutes after 12:53 AM? 8:32 AM How many minutes are there between 2:57 AM and 9:43 AM? 406 What is 252 minutes after 11:13 AM? 3:25 PM How many minutes are there between 8:15 PM and 12:13 AM? 238 What is 107 minutes after 12:36 AM? 2:23 AM What is 96 minutes before 1:57 AM? 12:21 AM How many minutes are there between 1:12 AM and 6:34 AM? 322 How many minutes are there between 8:46 AM and 7:10 PM? 624 How many minutes are there between 8:58 AM and 5:06 PM? 488 What is 67 minutes before 1:59 PM? 12:52 PM How many minutes are there between 9:24 PM and 6:43 AM? 559 What is 54 minutes before 2:44 PM? 1:50 PM What is 371 minutes before 5:56 PM? 11:45 AM How many minutes are there between 3:28 AM and 4:35 AM? 67 How many minutes are there between 3:34 PM and 4:28 PM? 54 What is 446 minutes before 7:48 AM? 12:22 AM How many minutes are there between 2:05 PM and 1:06 AM? 661 How many minutes are there between 1:51 AM and 6:51 AM? 300 What is 313 minutes before 6:24 AM? 1:11 AM What is 260 minutes after 1:35 PM? 5:55 PM How many minutes are there between 6:12 PM and 8:51 PM? 159 How many minutes are there between 2:17 PM and 9:01 PM? 404 How many minutes are there between 12:08 PM and 2:05 PM? 117 What is 453 minutes after 9:34 PM? 5:07 AM What is 639 minutes after 7:03 PM? 5:42 AM What is 400 minutes after 3:19 AM? 9:59 AM What is 714 minutes before 5:43 AM? 5:49 PM What is 302 minutes before 9:06 PM? 4:04 PM How many minutes are there between 2:41 AM and 10:17 AM? 456 How many minutes are there between 8:41 AM and 8:08 PM? 687 How many minutes are there between 12:50 PM and 5:33 PM? 283 What is 59 minutes before 11:08 PM? 10:09 PM What is 504 minutes after 4:26 PM? 12:50 AM How many minutes are there between 4:04 PM and 1:28 AM? 564 How many minutes are there between 2:33 PM and 10:44 PM? 491 How many minutes are there between 3:55 PM and 3:34 AM? 699 What is 559 minutes before 10:08 AM? 12:49 AM What is 618 minutes after 10:46 AM? 9:04 PM How many minutes are th	{ "pile_set_name": "DM Mathematics" }
from memmmmmmmem. 1/55 Three letters picked without replacement from ppnpppppnp. Give prob of picking 1 n and 2 p. 7/15 Three letters picked without replacement from pgpxccdpppgrrppx. What is prob of picking 1 x and 2 g? 1/280 Three letters picked without replacement from nhhhsndsshdsnsnsr. What is prob of picking 1 r and 2 d? 1/680 What is prob of picking 2 u and 2 e when four letters picked without replacement from {e: 3, k: 1, h: 1, i: 4, f: 1, u: 2}? 1/165 Three letters picked without replacement from bbfbbbbbzzzjbjzbzmzb. Give prob of picking 1 b and 2 z. 5/38 Three letters picked without replacement from {e: 4, m: 2, a: 2, x: 2}. What is prob of picking 3 e? 1/30 Two letters picked without replacement from yypwywww. What is prob of picking 2 y? 3/28 What is prob of picking 4 z when four letters picked without replacement from zzzzzzzzz? 1 Calculate prob of picking 3 y and 1 d when four letters picked without replacement from ydddydddyd. 1/30 Three letters picked without replacement from {e: 7, u: 6}. Give prob of picking 3 u. 10/143 Calculate prob of picking 2 y when two letters picked without replacement from byttbtyttyy. 6/55 Three letters picked without replacement from opnba. What is prob of picking 1 b, 1 o, and 1 n? 1/10 Two letters picked without replacement from {l: 4, r: 14}. Give prob of picking 1 r and 1 l. 56/153 Three letters picked without replacement from qnkpsbs. What is prob of picking 1 n, 1 b, and 1 s? 2/35 Calculate prob of picking 3 t and 1 l when four letters picked without replacement from lttltt. 8/15 What is prob of picking 1 g and 3 j when four letters picked without replacement from jujuauhauaggoauuoojo? 2/4845 Calculate prob of picking 1 i and 1 p when two letters picked without replacement from pipiipp. 4/7 Calculate prob of picking 1 d and 3 t when four letters picked without replacement from adtttttdtt. 1/3 Three letters picked without replacement from {c: 4, j: 2, a: 4, n: 1}. What is prob of picking 1 n, 1 a, and 1 c? 16/165 Two letters picked without replacement from uhkppkppptphkppi. What is prob of picking 1 k and 1 h? 1/20 Two letters picked without replacement from {z: 3, w: 1, x: 1, k: 4, i: 4, q: 5}. What is prob of picking 1 x and 1 w? 1/153 What is prob of picking 3 v when three letters picked without replacement from vavvvaavvvvaav? 3/13 Four letters picked without replacement from {o: 2, i: 3}. Give prob of picking 1 o and 3 i. 2/5 Four letters picked without replacement from kqxqkqykxkkkxx. What is prob of picking 2 k and 2 x? 90/1001 What is prob of picking 1 g and 1 s when two letters picked without replacement from {i: 2, s: 2, v: 1, g: 3, t: 2, p: 4}? 6/91 Three letters picked without replacement from {u: 2, q: 1, f: 5, y: 1}. What is prob of picking 3 f? 5/42 Three letters picked without replacement from {l: 2, t: 7, a: 1}. Give prob of picking 1 a and 2 t. 7/40 Two letters picked without replacement from {z: 2, y: 1}. What is prob of picking 2 z? 1/3 Two letters picked without replacement from fxxtxttmtttvtttxtbxm. Give prob of picking 1 m and 1 t. 2/19 Two letters picked without replacement from owqqwjwnoqmw. What is prob of picking 1 o and 1 m? 1/33 What is prob of picking 3 t and 1 u when four letters picked without replacement from ttetqteuetqebtqttueb? 112/4845 Calculate prob of picking 4 u when four letters picked without replacement from {u: 10, l: 9}. 35/646 What is prob of picking 2 u when two letters picked without replacement from {a: 1, o: 1, u: 2, n: 1}? 1/10 Three letters picked without replacement from ibwwq. What is prob of picking 1 q, 1 i, and 1 b? 1/10 Three letters picked without replacement from {f: 2, o: 17}. Give prob of picking 2 o and 1 f. 16/57 Two letters picked without replacement from ubbbznxulunbbxbxxubx. Give prob of picking 1 z and 1 b. 7/190 What is prob of picking 1 r, 1 q, and 2 b when four letters picked without replacement from ohqgobbbghqorq? 9/1001 Two letters picked without replacement from {s: 1, m: 2, p: 5, g: 9, j: 1}. What is prob of picking 1 s and 1 g? 1/17 Calculate prob of picking 1 b, 1 o, and 2 z when four letters picked without replacement from {z: 2, o: 1, b: 1, q: 1}. 1/5 Two letters picked without replacement from oggogoo. What is prob of picking 1 o and 1 g? 4/7 Three letters picked without replacement from {j: 6, m: 3, a: 2, o: 2, v: 3}. Give prob of picking 1 j and 2 a. 3/280 Calculate prob of picking 1 k and 1 x when two letters picked without replacement from zciczzzikczzxcjc. 1/120 Calculate prob of picking 1 p and 1 e when two letters picked without replacement from {w: 1, p: 2, e: 1, b: 1, c: 2}. 2/21 Three letters picked without replacement from {m: 2, y: 2, w: 2}. Give prob of picking 2 w and 1 m. 1/10 Three letters picked without replacement from zzrazzzxzzxrrrzz. What is prob of picking 1 z, 1 r, and 1 a? 9/140 What is prob of picking 1 g and 1 r when two letters picked without replacement from {r: 4, g: 3, w: 1, i: 3}? 12/55 What is prob of picking 3 s when three letters picked without replacement from {u: 2, l: 7, s: 4}? 2/143 Four letters picked without replacement from tottooottoooo. Give prob of picking 4 o. 14/143 Four letters picked without replacement from cfcfhccccffcffc. Give prob of picking 3 f and 1 h. 4/273 Three letters picked without replacement from {p: 2, h: 1, a: 1, s: 1, r: 1, n: 1}. Give prob of picking 1 s, 1 r, and 1 a. 1/35 Two letters picked without replacement from {g: 5, l: 1, x: 1, e: 4, p: 1, w: 1}. Give prob of picking 1 p and 1 e. 2/39 Four letters picked without replacement from {u: 1, q: 2, m: 6, s: 4}. What is prob of picking 1 u, 1 q, and 2 m? 6/143 Three letters picked without replacement from {j: 2, n: 1}. What is prob of picking 3 j? 0 Three letters picked without replacement from wrwxrwxwxwwwoxw. Give prob of picking 1 r, 1 x, and 1 o. 8/455 What is prob of picking 1 g and 1 i when two letters picked without replacement from {o: 4, x: 2, g: 1, i: 7}? 1/13 Three letters picked without replacement from xbxxxxssxxxasibo. What is prob of picking 1 i, 1 o, and 1 b? 1/280 Two letters picked without replacement from nnknnnaxa. What is prob of picking 2 k? 0 Four letters picked without replacement from ooioooikk. Give prob of picking 2 o and 2 k. 5/63 Three letters picked without replacement from {q: 1, c: 11, t: 7}. Give prob of picking 2 t and 1 c. 77/323 Four letters picked without replacement from rwrrwww. What is prob of picking 4 w? 1/35 What is prob of picking 2 w when two letters picked without replacement from {n: 12, w: 7}? 7/57 Calculate prob of picking 2 i and 1 b when three letters picked without replacement from {f: 1, j: 1, i: 4, z: 4, q: 2, b: 3}. 18/455 What is prob of picking 1 m and 1 y when two letters picked without replacement from mjyijeqiiiyeijjji? 1/68 Four letters picked without replacement from {o: 3, y: 8, i: 1, h: 2, d: 5}. What is prob of picking 2 h, 1 d, and 1 o? 5/1292 Four letters picked without replacement from vwrrmpp. Give prob of picking 1 m, 1 v, and 2 r. 1/35 What is prob of picking 2 u when two letters picked without replacement from urzuuuvvquuvvuur? 7/30 What is prob of picking 3 f when three letters picked without replacement from ffffqfffqffqqfffqf? 143/408 Three letters picked without replacement from {n: 1, y: 4, d: 4, r: 2}. What is prob of picking 2 y and 1 r? 4/55 Three letters picked without replacement from {n: 1, u: 2, i: 2, s: 2, p: 4, b: 3}. Give prob of picking 2 u and 1 n. 1/364 Four letters picked without replacement from {a: 1, c: 1, p: 2, d: 1, j: 1, t: 1}. What is prob of picking 1 c, 1 j, 1 p, and 1 t? 2/35 Calculate prob of picking 1 j and 1 v when two letters picked without replacement from {j: 3, v: 3}. 3/5 Calculate prob of picking 1 f and 1 b when two letters picked without replacement from {f: 1, c: 8, b: 4, e: 5}. 4/153 Calculate prob of picking 1 l and 2 f when three letters picked without replacement from {g: 2, d: 1, f: 2, q: 1, l: 1}. 1/35 What is prob of picking 2 x and 1 h when three letters picked without replacement from {x: 2, h: 2}? 1/2 Two letters picked without replacement from ccoonkrlnlcl. What is prob of picking 1 n and 1 k? 1/33 Two letters picked without replacement from lkwmkbb. Give prob of picking 1 k	{ "pile_set_name": "DM Mathematics" }
Convert 1234 (base 6) to base 7. 622 What is 288 (base 15) in base 5? 4303 1030 (base 9) to base 4 23310 What is -2547 (base 10) in base 3? -10111100 12311 (base 4) to base 14 233 Convert -65b (base 14) to base 2. -10011101001 What is -125 (base 12) in base 2? -10101101 -382 (base 16) to base 13 -541 What is -84b (base 12) in base 7? -3350 3001021 (base 4) to base 2 11000001001001 What is 377 (base 12) in base 6? 2231 What is -a315 (base 12) in base 11? -12358 11130 (base 13) to base 6 355210 2635 (base 14) to base 7 25365 Convert -15610 (base 7) to base 3. -20001121 Convert -45223 (base 6) to base 7. -24342 Convert -3783 (base 10) to base 5. -110113 -5510 (base 11) to base 5 -213041 Convert a12a (base 12) to base 7. 101620 Convert 213103 (base 4) to base 15. b2a 584 (base 14) to base 6 5024 Convert -1201 (base 4) to base 3. -10121 282 (base 12) to base 13 239 What is 3a8 (base 14) in base 7? 2101 What is -3386 (base 16) in base 9? -20075 Convert 30c (base 13) to base 2. 1000000111 Convert -213101 (base 4) to base 2. -100111010001 Convert aa (base 15) to base 11. 136 101100000010 (base 2) to base 12 176a Convert -404 (base 6) to base 12. -104 What is 1960c (base 14) in base 2? 1111101100101100 1ae (base 15) to base 6 1445 24035 (base 7) to base 14 238c What is 12 (base 4) in base 3? 20 -533 (base 7) to base 2 -100001101 What is -312 (base 9) in base 14? -142 Convert -111101000 (base 2) to base 7. -1265 What is -23bb6 (base 12) in base 4? -23303322 -7b (base 16) to base 7 -234 -3202233 (base 4) to base 7 -60210 What is 20112 (base 5) in base 13? 778 -7200 (base 10) to base 2 -1110000100000 Convert 3043 (base 6) to base 4. 22203 What is 11358 (base 10) in base 14? 41d4 Convert -100000001110 (base 2) to base 5. -31222 Convert 1110101011 (base 2) to base 8. 1653 Convert 13004 (base 5) to base 2. 1111101100 What is -784 (base 12) in base 3? -1112001 -7444 (base 8) to base 5 -111001 Convert 795b (base 12) to base 5. 412323 What is 5401 (base 8) in base 6? 21013 3022 (base 4) to base 10 202 -1011001100 (base 2) to base 7 -2042 10010111000011 (base 2) to base 8 22703 23360 (base 7) to base 4 1132010 Convert 689 (base 13) to base 6. 5115 971 (base 15) to base 2 100001010011 What is -1000 (base 2) in base 3? -22 Convert 98 (base 11) to base 6. 255 25440 (base 7) to base 9 10220 What is 20212321 (base 4) in base 14? cbc5 Convert 5d8 (base 16) to base 9. 2042 Convert 12 (base 7) to base 6. 13 15155 (base 13) to base 11 27989 What is 2532 (base 7) in base 6? 4230 What is -2873 (base 15) in base 2? -10000111010010 152 (base 9) to base 12 a8 Convert -150 (base 10) to base 4. -2112 -907 (base 10) to base 8 -1613 What is e860 (base 16) in base 6? 1135224 170c (base 15) to base 9 6723 What is 918 (base 14) in base 3? 2110011 Convert 11414 (base 10) to base 8. 26226 Convert 7a01 (base 12) to base 6. 142401 What is 4757 (base 10) in base 14? 1a3b 986 (base 16) to base 11 1917 Convert 511052 (base 6) to base 8. 116750 -111000011111000 (base 2) to base 5 -1411140 What is -47a (base 13) in base 12? -549 Convert -2 (base 13) to base 7. -2 Convert 34534 (base 9) to base 11. 16341 -101010111 (base 2) to base 8 -527 What is -52501 (base 7) in base 10? -12937 Convert 2110011 (base 3) to base 14. 918 Convert -6645 (base 7) to base 5. -34020 Convert -1511 (base 6) to base 12. -297 What is 441001 (base 7) in base 15? 17d01 -200a (base 14) to base 3 -21112122 1691 (base 13) to base 9 4508 Convert 205 (base 15) to base 6. 2035 Convert -2c02 (base 13) to base 4. -1210120 What is 2273 (base 13) in base 10? 4826 Convert -6a7 (base 15) to base 5. -22012 3102 (base 5) to base 3 112220 -a545 (base 12) to base 10 -18053 Convert 100001220 (base 3) to base 9. 10056 a80c (base 16) to base 2 1010100000001100 Convert 1000010100010 (base 2) to base 5. 114013 What is 20160 (base 9) in base 7? 53436 2d (base 15) to base 4 223 Convert 3523 (base 8) to base 5. 30000 What is -11532 (base 8) in base 15? -1704 -10a (base 16) to base 8 -412 -58632 (base 9) to base 11 -27463 Convert 197 (base 13) to base 15. 148 What is 1144 (base 9) in base 15? 3ba What is -2523 (base 6) in base 8? -1163 What is -10332 (base 4) in base 6? -1250 11461 (base 7) to base 4 232213 Convert -1433 (base 7) to base 12. -3ab -11272 (base 8) to base 16 -12ba What is -1586 (base 15) in base 9? -6310 245 (base 10) to base 16 f5 Convert 176 (base 13) to base 14. 150 -10431 (base 9) to base 16 -1b01 Convert 56331 (base 8) to base 14. 893b 11214 (base 8) to base 10 4748 Convert -793 (base 10) to base 16. -319 What is 9b5 (base 12) in base 6? 10345 1210 (base 10) to base 12 84a -23341 (base 5) to base 7 -5006 What is 673 (base 14) in base 5? 20102 Convert 1212 (base 3) to base 2. 110010 Convert -503151 (base 6) to base 12. -1aab7 Convert -7555 (base 10) to base 6. -54551 Convert 15215 (base 6) to base 10. 2459 What is -9aa3 (base 14) in base 4? -12202233 What is 10112011 (base 3) in base 13? 1228 What is -16133 (base 7) in base 6? -32552 -501 (base 7) to base 16 -f6 -104345 (base 6) to base 9 -13032 Convert -244231 (base 5) to base 6. -111044 -2013 (base 5) to base 12 -196 Convert b971 (base 12) to base 5. 1123024 What is -11432 (base 6) in base 5? -23201 Convert 11111 (base 4) to base 6. 1325 -2212102 (base 4) to base 8 -24622 10101010101010 (base 2) to base 15 3382 What is -154c (base 14) in base 11? -2938 What is -585 (base 9) in base 4? -13202 What is 504423 (base 6) in base 4? 21233133 100000110111 (base 2) to base 15 953 -3464 (base 8) to base 7 -5243 What is 515 (base 10) in base 13? 308 Convert b7 (base 14) to base 13. c5 What is 1010001011 (base 2) in base 9? 803 Convert -25735 (base 10) to base 4. -12102013 Convert -100001010110 (base 2) to base 16. -856 What is 4d5 (base 15) in base 2? 10001001100 What is -12113 (base 4) in base 6? -1515 What is -3989 (base 15) in base 14? -4691 -20555 (base 10) to base 16 -504b -32330 (base 4) to base 12 -678 What is 149b (base 13) in base 9? 4104 Convert 177351 (base 8) to base 12. 31921 Convert 10010000011 (base 2) to base 15. 520 What is -95 (base 14) in base 12? -ab 22133 (base 4) to base 2 1010011111 -104255 (base 8) to base 13 -12c06 Convert -10868 (base 9) to base 13. -3404 What is -79a (base 11) in base 13? -587 What is -20c0 (base 16) in base 10? -8384 3115 (base 13) to base 12 3b0a Convert 2b64 (base 13) to base 6. 45155 -311210 (base 4) to base 12 -1b98 What is 1561 (base 9) in base 10? 1189 10221102 (base 3) to base 16 b39 -457 (base 10) to base 9 -557 b0 (base 13) to base 4 2033 -12070 (base 16) to base 10 -73840 55881 (base 10) to base 8 155111 What is be (base 16) in base 8? 276 What is 201202 (base 3) in base 12? 385 Convert 413 (base 5) to base 15. 73 -7bc6 (base 16) to base 7 -161244 -267 (base 14) to base 5 -3413 What is -21140 (base 6) in base 11? -2178 11010001101 (base 2) to base 8 3215 Convert 330 (base 6) to base 14. 90 What is -10001000111 (base 2) in base 7? -3123 Convert 22120111 (base 3) to base 10. 6250 -133330 (base 5) to base 10 -5465 c4 (base 14) to base 15 b7 What is 7061 (base 8) in base 15? 1123 What is -162225 (base 7) in base 16? -7d10 Convert 31310 (base 4) to base 15. 3de 120021 (base 3) to base 2 110011100 Convert 11011011110 (base 2) to base 4. 123132 What is -7447 (base 15) in base 10? -24592 What is 493 (base 11) in base 8? 1112 -1124413 (base 5) to base 15 -618d What is 24452 (base 6) in base 5? 104012 What is -11012 (base 3) in base 12? -95 Convert -1315 (base 15) to base 3. -12120202 c0 (base 13) to base 8 234 6034 (base 7) to base 8 4043 What is -16e6 (base 16) in base 12? -3486 What is -e6d (base 15) in base 12? -1a71 What is -13014 (base 6) in base 10? -1954 Convert 3640 (base 13) to base 16. 1de9 10382 (base 9) to base 14 2714 -44410 (base 6) to base 2 -1100000110110 What is 313210 (base 4) in base 14? 1420 -221112120 (base 3) to base 14 -6adc Convert 52044 (base 7) to base 2. 11000110110011 What is -11131 (base 4) in base 11? -298 What is -d44 (base 16) in base 13? -1713 Convert 19 (base 12) to base 9. 23 What is 1112010 (base 3) in base 9? 1463 -21120 (base 3) to base 5 -1304 What is 1354 (base 7) in base 12? 381 Convert 1d68a (base 14) to base 2. 10010011001111010 -22452 (base 12) to base 2 -1011000111111110 -1002002 (base 4)	{ "pile_set_name": "DM Mathematics" }
212. Suppose -2j - 3j + q = 4c, 4j + 4c = 1724. Suppose -2b + j = 97. Is 24 a factor of b? True Suppose 22h - 18h = -k + 7736, 0 = h + 3. Is k a multiple of 298? True Let y(s) = -3 + 4 - 4 - 15 + 3s. Let r be y(7). Suppose f = -rx + 6x - 89, x + 3f - 33 = 0. Is 10 a factor of x? True Suppose -822804 - 146808 = -679c. Does 3 divide c? True Let p = -9 - -312. Let l = -171 + p. Is l a multiple of 28? False Let t be (-12)/54 + (-76)/(-18). Let j = 629 + -164. Is 22 a factor of t/(-8) - j/(-6)? False Let c be ((-175)/3 + 3)(-21)/2. Let r = c + -350. Does 57 divide r? False Let m = 14593 + -10106. Is m a multiple of 7? True Suppose -5b - 4x = -1105 - 525, 4x + 350 = b. Suppose 0 = 43d - 49d + b. Is d a multiple of 4? False Let j = -33154 - -39735. Does 33 divide j? False Let l(x) = -159x - 374. Is 149 a factor of l(-9)? False Let z(v) be the first derivative of 14v3/3 + 25v*2/2 - 5v + 78. Does 14 divide z(-5)? False Let j = 191 + -191. Let r = -42 + 92. Let q = r - j. Is 10 a factor of q? True Let y(a) = -3a3 + 57a - 30. Does 70 divide y(-8)? True Suppose y = -x - 488, 2x + 4y = -3x - 2443. Let c = x - -764. Is c a multiple of 21? True Let c(f) = f2 + 15f - 3. Let d be c(-11). Let g = d - -19. Let l = g + 58. Is 10 a factor of l? True Let l(k) = -144k2 + 6k + 7. Let g be l(-2). Does 12 divide (-7)/((-21)/(-12)) - g? False Suppose -207l + 923290 = -548127 + 278062. Does 5 divide l? True Let i(t) = t3 - 29t*2 - 115t + 82. Is 14 a factor of i(33)? False Let n = 303 + -274. Suppose 2u + 11934 = nu. Does 15 divide u? False Let s = -38 + 51. Suppose -18j + sj = 2235. Does 29 divide (2 - j/(-6))(-9 - -7)? True Let o(a) = 101a*2 + 18a + 172. Does 24 divide o(-6)? False Suppose -7 = -2z - 5t + 4, -2 = -2t. Suppose -z = -l - 0l. Suppose 2m = 51 - l. Is 6 a factor of m? True Let w = -242 + 228. Is 179 + 5 + w + 5 a multiple of 46? False Let p = 165 + -163. Suppose -4z = 2w - 112, 4z - 152 = -3w + pz. Is 6 a factor of w? True Let u be 101 + (8 + -3)/(-1). Is (26/8)/(100/u + -1) a multiple of 67? False Suppose -19p - 26p + 158928 = 41p. Is p a multiple of 44? True Let y = -60 - -57. Let z be (-28)/4 - y - (-2 + 2). Is 40 a factor of (2542/z)/(-1)? False Let h(x) = x*2 + 32x + 121. Let y be h(-29). Suppose -8976 = ym - 42m. Is m a multiple of 18? False Is 14/2 + (51186/(-285))/(6/(-345)) a multiple of 41? False Suppose 0 = -3r + 88 - 85, 0 = -4c + r + 40051. Does 17 divide c? True Let u be (-518)/(-3)99/(-22). Let t = -387 - u. Suppose 3d = 4g + t, 4g - g = 4d - 527. Is d a multiple of 14? False Suppose -x - 2i = -6i + 3498, x = -3i - 3533. Let f = -2242 - x. Is f a multiple of 44? True Suppose 29w + 309549 = 2052304. Is (-4)/(-9) + w/765 a multiple of 29? False Let q = -369 - -755. Let r = -354 + q. Does 3 divide r? False Let q be (-26)/10 - ((-30)/25)/(-3). Let b be (q - -3)(-4)/8. Suppose -5 = -k + 5h, bk + 20 = k - 2h. Does 30 divide k? True Let y = 428 - 13. Let u = 523 - y. Is 8 a factor of u? False Suppose -2c + 12 = -i, 2c - i - 30 = -3c. Suppose cp + 1004 = 236. Let f = p + 347. Is f a multiple of 9? False Suppose -z - 5 = 3i, -4z = -2i + i - 45. Suppose z = 3w - k, -w - 6k + k = -30. Suppose -4h + 2h = -ws - 171, -4h = 4s - 384. Does 19 divide h? False Let f be (-51)/357 + 194/(-14). Let t(x) = -22 + x - 10x + 8. Is t(f) a multiple of 14? True Let v be ((0 + -1)1)/(1/(-33)). Let c = 48 - v. Suppose -f = -1, -4q + 3f + c = 6f. Is 3 a factor of q? True Let c(j) = 7775j2 + 6j + 7. Does 9 divide c(-1)? True Suppose 4o - h = 3063, 5o - 14h = -11h + 3834. Suppose 3q + 0j - 455 = j, -3j - o = -5q. Is q a multiple of 15? True Let c(t) = t*3 + 19t*2 - 73t + 68. Suppose -11i - 279 = -37. Is 37 a factor of c(i)? True Suppose -4s + 350820 = -4h, 2659s - 2h = 2662s - 263100. Does 21 divide s? False Suppose 5c = 2c + 4n - 121, 3n = 2c + 82. Is 10/35 + -2 + (-4400)/c a multiple of 10? False Let u = 63 - 45. Let b(a) = -60a + 954. Let m be b(16). Is 5 a factor of (-2)/(-3) + (m - (-852)/u)? False Let w(b) = b. Let p(f) be the second derivative of -f*4/12 + 29f*3/6 + 2f*2 + 3f. Let n(j) = p(j) - 5w(j). Is n(19) a multiple of 18? False Let b(o) = 17o - 8. Let a be b(-3). Let u = a - -61. Is u1/(-4)(-100)/2 a multiple of 9? False Let m = 20823 + -17504. Does 73 divide m? False Suppose -10208 = -5s + 3i - 0i, -5i = -2s + 4068. Suppose 0 = 27c + c - s. Is 3 a factor of c? False Suppose 795440 = -167s + 207s. Does 65 divide s? False Is (-2)/(-36/90) - -1768 a multiple of 2? True Let x(u) = -u3 + 39u*2 - 43u + 116. Let j be (16/(-24))/((-672)/333 - -2). Is x(j) a multiple of 60? False Let c be (-2)/((-30)/(-9) - 4) - 243. Let q = c + 391. Does 14 divide q? False Suppose -13c = -9c. Suppose 0 = 4i - w - 17, cw = 2i - 2w - 16. Is -8(2 + -5)/i a multiple of 3? False Let a(b) = -18b - 341. Is 4 a factor of a(-26)? False Suppose -b + 8c - 3c = -13035, 5c = -3b + 39105. Does 79 divide b? True Let q(p) = 84p - 12. Let s be q(1). Suppose -sa + 75a - 1989 = 0. Is a a multiple of 17? True Suppose 5v = 5s + 35, -7v - 4s = -2v - 8. Suppose 2z - 3489 - 95 = -vn, 2n - 5z - 1792 = 0. Is 28 a factor of n? True Let a = 39126 - 28434. Is 27 a factor of a? True Does 46 divide (3/1)/(534/2984882)? False Let t(w) = -179w - 1479. Is 145 a factor of t(-25)? False Is 46 a factor of (-1132833)/(-62)(-18)/(-27)? False Is (8378/(-3))/((-30)/510/90) a multiple of 31? False Let g = 147513 + -100269. Is 124 a factor of g? True Let c be (0 - (2 + -4)) + 2. Suppose 0 = 3n + ca + 1, 11 = 3n - a + 2a. Suppose 8k - ns - 210 = 3k, -2k = -s - 83. Does 14 divide k? False Does 7 divide ((-602)/3)/((-72)/1188)? True Let z be (-10 - (-448)/49)/(2/602). Let m = -150 - z. Is m even? True Let x(k) = -27 - 12 - 2k + 13. Let s be x(-13). Suppose s = 2g + g - 84. Is 7 a factor of g? True Let d be (-3)/(9/(-6))(-892)/(-8). Let h = 34 + d. Is 23 a factor of h? False Let q(z) = z*2 + 4z - 8. Let n be q(-6). Suppose 1184 = -27v + 43v. Is v + n(5 - 6) a multiple of 14? True Let u be (38/10 + (-1)/(-5))-1. Let q(g) = -20g2 - 2g - 15. Let b be q(u). Let f = -119 - b. Is f a multiple of 26? True Suppose 0 = 3r - 4w + 22, -2w = 5r - r. Is (-39)/r126/27 a multiple of 13? True Suppose 5k = 4w - 7604, -2k + 6082 = -6k + 2w. Let i be 144/20k/(-6). Suppose -9s + 48 = -i. Does 18 divide s? False Suppose 734j - 1010j = -17124144. Is j a multiple of 211? False Suppose -31u = -35u + 6500. Suppose -u = -0w - 25w. Is 14 a factor of w? False Let o = -87 - -67. Let g(l) = -l*2 - 23l + 10. Let v be g(o). Suppose 3s = -2s + v. Does 11 divide s? False Suppose -6s + 873 = -189. Suppose -3z + s = 3j - 0z, 3j + z - 171 = 0. Let a = j - 45. Is a even? False Let h(b) = -b2 - 7b + 6. Let r be h(-7). Suppose 142 = y - 2k, k = -3y + rk + 428. Suppose -5c - y = -926. Is c a multiple of 36? False Suppose 12 = 16z - 20. Suppose -657 = -zs - 91. Is 22 a factor of s? False Let b(g) = 7g + 3. Let a be b(1). Does 50 divide (-5)/(a/16) + 58? True Does 82 divide 2/(-9) + (-321079)/(-99)? False Let t(k) = 6k*3 - 2k*2 - 3k - 3. Let v be t(-2). Let f = 56 + v. Suppose -3a - 2j + 343 = 0, -4j - 424 = -7a + fa. Is 37 a factor of a? True Let f = 76 - 74. Is -4 - f - (-14 - 2) a multiple of 2? True Let q(z) = 40z*3 - 2z*2 + z + 1. Suppose 0 = -7v + 2v + 3y - 212, 2y - 8 = 0. Let a be ((v/(-70))/((-4)/(-14)))/2. Is q(a) a multiple of 10? True Suppose -4m + 2 = -6. Suppose 5s + 9 = mu, -4s - 15 = -s. Is 2/u + (-444)/(-48) a multiple of 9? True Let h(f) = f3 - 4f*2 + 8f. Let j = 103 + -56. Suppose 0 = 16s - j - 49. Is 12 a factor of h(s)? True Let x = -10 + 12. Suppose -3b = -4p - 338, p + 220 = xb - 3p. Suppose k = 3o + 74, k = -k - 4o + b. Is k a multiple of 13? True Let n(a) = 5a*3 + 25a*2 - 96a + 92. Is 9 a factor of n(13)? False Suppose 0 = -60g - 3g - 172500 + 1206204. Is g a multiple of 14? True Suppose -5g - 10 = 0, -2i + 11g = 15g - 7866. Does 8 divide i? False Suppose 0 = 4s - 21 - 1587. Suppose 7f = 3r + 2f - 1239, 0 = -r - 2*f + s. Is 17 a factor of r? True Let z(l) = 5	{ "pile_set_name": "DM Mathematics" }
+ 1 = g for n. -4 Let c(t) be the third derivative of -t*4/24 - 3t*2. Let o be c(-10). Solve 3j - o = -4 for j. 2 Suppose 4 = 3k - 2. Solve -kj + j - 5 = 0 for j. -5 Suppose 5z + 5 = 5s, -5z - 3s + 2 + 1 = 0. Solve 0 = -2l - z - 2 for l. -1 Let m(d) = d3 - 6d*2 - 11d + 9. Let v be m(7). Let c = -9 - v. Solve c = 5n - 0 for n. 2 Let m be (0/9)/(-21). Let t be (3 - (m - -3)) + 4. Solve -tl + 6l = 0 for l. 0 Suppose 0 = -2v - 2 + 4. Let k be (-1)/5 + 81/5. Solve -3x + v = k for x. -5 Suppose -9c = -10c + 6. Suppose -p = -0 - c. Solve s = -s - p for s. -3 Let v = -3 + 14. Let s(n) = 5 - vn - 5n*2 + 11n - n*3. Let j be s(-5). Solve -3t + j = -2t for t. 5 Let d(a) = a3 - 14a*2 + 2a - 13. Let x be d(14). Solve 0y = 5y - x for y. 3 Suppose -4v = -z - 82, 4v - 4z - 84 = -2z. Let c = 3 - 3. Suppose -w = -2s + 15, 2w + w + 9 = c. Solve sy - y = v for y. 4 Let p(u) = -u2 - 18u + 3. Let r be p(-18). Let g be 2 - -5-15. Let n = 46 + g. Solve -n = -4j - r for j. 5 Let k = 3 + -3. Solve k = 2t - 5 - 1 for t. 3 Suppose -2l + 6l = 4. Solve l = 3p - 2p for p. 1 Let o = 10 - 24. Let p be ((-6)/4)/(7/o). Solve u + pu + 16 = 0 for u. -4 Suppose -3q - 3 = -5o + 5, -q + o = 0. Solve 0 = qb + 11 - 27 for b. 4 Let d(t) = 34t - 1. Let b be d(1). Suppose -10 + b = u. Let j = -13 + u. Solve -l = l + j for l. -5 Let b be ((-18)/(-10))/((-6)/(-20)). Solve -5u = -bu + 2 for u. 2 Suppose -1 = -r + 2. Suppose k - 3q + 12 = 0, -4k - 3q = -rk - 18. Solve -k - 1 = 4x for x. -1 Let t(s) = 12s - 2 + 1 + 3 - s2 + 0. Let i be t(12). Solve -ic = 8 - 0 for c. -4 Let r(n) = -5n. Let t be r(-4). Solve -3i - t = 2i for i. -4 Let x(j) = -j3 - 8j2 + 1. Let l(v) = -v3 + 6v2 - 2v + 4. Let g be l(6). Let t be x(g). Let d be 48/21 - (-4)/(-14). Solve -t = -df + f for f. 1 Let g be (30/(-195) + 72/130)40. Solve -g = -5j + j for j. 4 Suppose -3 - 15 = -l + 4m, 4l = -2m. Solve n + l = -0n for n. -2 Let i = -9 - -9. Solve n = -in - 5 for n. -5 Let p(u) = u*2 + 14u - 27. Let a be p(-16). Solve -2z + 12 = -az for z. -4 Let k be (2 + 1)/(6/4). Let q = 3 + k. Solve 0 = z + 4z + q for z. -1 Let l = -2 - -2. Suppose 4q - 20 + l = 0. Solve 9r = 4r + q for r. 1 Let m be 11/55 - (-14)/5. Suppose 52 - 7 = ml. Solve -7 = 2j - l for j. 4 Let k be 1 + ((-2)/2 - -2). Suppose -4i - 5m + 21 = 0, 0i = -i + km + 2. Let s = 3 - -2. Solve 0 = sl - il + 2 for l. -2 Suppose 0 = 3q - 2u - 96, 3u + 1 + 8 = 0. Let n = q + -11. Solve 0 = 4d + 3 - n for d. 4 Let o(u) = 2u2 - 9u - 3. Let k be o(5). Suppose -5c = -c + kg - 12, -2c - 10 = 5g. Solve -4d = 7 + c for d. -3 Let q(k) = -k3 + 5k*2 + k + 3. Let g be q(5). Suppose 3v - v = -g. Let s be v/10 + 17/5. Solve -28 + s = 5j for j. -5 Let k(z) = z2 + z - 11. Let s be k(-5). Solve -5n + 6 + s = 0 for n. 3 Let r be (-3 + 0)(-56)/21. Solve 8 = -4o - r for o. -4 Let p(j) = j*2 + 11j + 10. Let t be p(-8). Let v be ((-12)/42)/(2/t). Solve vi = -i + 6 for i. 2 Let v be (-3)/(21/(-2)). Solve 0 = 2m - vm for m. 0 Suppose -3r + 27 = 4n, 7 = -0r - r + 4n. Suppose -2v + 3 = -z, 4v + 3z - 31 = -0v. Suppose -vo + 3o = -2. Solve ot - 1 = r for t. 3 Let l(s) be the third derivative of s5/60 - s3/3 - 2s*2. Let t be l(2). Solve -b + 4 = -tb for b. -4 Let y(b) = -b*3 + 7b*2 - 6b + 4. Let k be y(6). Suppose -a = 3a + 16, -3c - 14 = 5a. Solve 0l - cl = k for l. -2 Suppose 0a + 2 = a. Let m(z) = -z + 10. Let f be m(9). Let x = a + f. Solve n = xn for n. 0 Suppose 0 = q + 4q - 25. Suppose 5h = -d + 22, -5h - 6 = -qd - 16. Solve d = -0k - k for k. -2 Suppose 4 = 5w - 11. Solve 0 = 2u + w + 3 for u. -3 Let p = 23 + -18. Solve py - 12 = y for y. 3 Let x = -16 - -24. Let i = x - 5. Solve r - 1 = i for r. 4 Let h(p) = -p + 10. Let y be h(6). Suppose -25 = 5a - 0c - 5c, -ya - 5c + 25 = 0. Solve -2o + a = -6 for o. 3 Let f be ((-6)/(-4))/((-15)/(-20)). Suppose -ft - t = 0. Let d be -4 - -5 - (-1 + t). Solve db - 8 = -0b for b. 4 Let l = -24 + 26. Suppose g + 2r = 7r + 23, r + 7 = g. Let v = 3 - g. Solve s - l - 3 = v for s. 5 Let t be (-550)/228/(-10). Let o(k) = -k2 + 3k + 4. Let u be o(3). Let g = 1 - 1. Solve -uw = t - g for w. -5 Let g(y) = y3 - 7y*2 - 8y + 13. Let p(w) = -w. Let m(x) = g(x) + 6p(x). Let z be m(9). Let a be ((-84)/z)/((-2)/14). Solve -4q + 0 + a = 0 for q. 3 Let b(v) = 2v + 2. Let w be b(-2). Let z(p) = -p2 - 2p + 2. Let i be z(w). Suppose f + if = l - 24, -l + f = -16. Solve 2j - l = -2 for j. 5 Suppose -2f + 8 + 8 = 0. Suppose 3 - 1 = -2k + 2j, 0 = -4k + 5j - f. Solve -5r = k - 23 for r. 4 Let f(l) = l*2 + 8l - 12. Let s be f(-9). Let n be s(-6)/(-9)-1. Solve k - n = -5 for k. -3 Suppose 3a = -a + 28. Let s = -20 + 36. Let l be (-1 - (-2 - 0))3. Solve -s = -ax + lx for x. 4 Let i = -31 - -33. Solve c - 3 = -ic for c. 1 Suppose -24t = -21t. Solve tq = -2q for q. 0 Suppose -51x + 41x = 0. Solve 0p - 5p + 10 = x for p. 2 Suppose 2b - 3a - 2a = -5, a = -4b + 23. Solve -bp = -11 + 1 for p. 2 Let c(g) = g*2 + 7g + 8. Let h be c(-6). Solve -h = -f - 3 for f. -1 Suppose -6 = -5s + 3p, 2 = -3s + p + 8. Solve -2r = sr + 10 for r. -2 Suppose 5y = -z + 24 - 6, 0 = 4z - 5y + 3. Suppose zk = k + 20. Solve -2o + k = -0o for o. 5 Suppose 0 = 4i - 21 - 3. Suppose i = 3y - y. Solve -5 = 2v + yv for v. -1 Let h = 3 - 2. Let g(j) = 21j3 - j2 + 1. Let u be g(h). Let q be 0(u/(-6) + 3). Solve p - 2 = -q for p. 2 Suppose 0 = -4p + 2q + q + 39, 3p + 5q = -7. Solve -x + p = 2x for x. 2 Suppose 5b - b + 20 = 0. Let z = b - -8. Suppose -3 = 2c - zc. Solve 2s + 13 = c for s. -5 Suppose 5p - 31 - 4 = -5l, -2p + 14 = -2l. Let b be 2/p + (-2)/7. Solve b = -3q + q for q. 0 Let y(t) = -2t*2 - t + 7. Let q be y(-2). Solve -q - 2 = 3b for b. -1 Let a(t) = -49 + 47 + t + 2t2 + 0t. Let d be a(-2). Suppose -5w = -20, -18 - 6 = -c - 4w. Solve u + d = c for u. 4 Let u(a) = -2a + 14. Let l be u(11). Let b = l + 18. Solve h + 4h + b = 0 for h. -2 Let i(a) = 2a2 + 9a + 12. Let c be i(-4). Solve -3n + c = -n for n. 4 Let g = -3 + 0. Let t be (g/(-2))/(3/4). Solve 2d = t + 8 for d. 5 Let w(v) = -v*2 - 6v - 3. Let l be w(-5). Solve 0 = -ld - 0 - 6 for d. -3 Let g be 0 - 1/(-4)0. Suppose 35 = 5m - 5v, g = -v + 2v + 5. Solve 3y + my = -20 for y. -4 Let m = -27 + 33. Solve 0 = 2b - 0b - m for b. 3 Suppose 3t = -5g + 66, -5g + 54 = 2t - 5t. Suppose -6f - g = -9f. Solve fy = -y + 5 for y. 1 Let n(m) = -m2 + 7m + 10. Let p be n(7). Solve 4f = -f + p for f. 2 Suppose 0 = -w - 5 + 1. Let f be (4/(-3))/(2/(-3)). Let b be (w/(-3))/(f/12). Solve -2l + b = -6l for l. -2 Suppose -8t = -t - 28. Solve -t = 2w - 0 for w. -2 Suppose -4q = -l + 14, 14 = -3l - 5q + 5. Solve -lh + 7h = 10 for h. 2 Let f(v) = -v*2. Let b be f(-1). Let j = 3 - b. Solve -12 = -jq + 4 for q. 4 Suppose 10y = 15y. Solve yz = 4z for z. 0 Let l(g) = -10g3 + g + 1. Let s be l(-1). Suppose 6 = -3n - 5p + p, -n - 4 = 2p. Suppose 0d = 4h - nd - 8, -5d = -h + 20. Solve h = 3j - s - 2 for j. 4 Suppose 3 = 2k - 7. Solve i - k + 2 = 0 for i. 3 Let f(j) = j*2 - 8j + 7. Let v be f(6). Let s = v - -8. Suppose -2k + 3k = 2. Solve -kc + 5 = sc for c. 1 Let j be (10/(-4))/((-1)/(-4)). Let y be (1/(-2) - 0)j. Let u be (-1)/(-2)2 - -1. Solve n - un = y for n. -5 Let l = 1 + -5. Let x = 14 + l. Solve -2z + x = -0 for z. 5 Let z(y) = y + 4. Let g be z(-7). Let a be 4 + (g + 6)/1. Let q = 10 - a. Solve q = 2i - 7 for i. 5 Let o = -3 - -5. Let g be 48/15 + (-1)/5. Let n(s) = s3 - 3s*2 + 2s - 3. Let i be n(g). Solve il + o = l for l. -1 Let j = 74 + -59. Suppose -14 = -2n - 4f, -3n = -3f - f + 9. Suppose -4b + j = -n. Solve -bu - 12 = -u for u. -4 Let y = 6 - 9. Let s be -1(y - (-2 + -1)). Solve s = -5n - 8 - 12 for n. -4 Let w be (-2)/8 - 78/(-24). Solve 2 = -g - w for g. -5 Let u be -1 + 0 + (-55)/(-11). Solve 7b - u = 3b for b. 1 Let t(r) = -r3 + 6r*2 + 3r - 9. Let c be t(6). Let u be 11 - c - (-1)/1. Solve -3h = 9 - u for h. -2 Let j = -1 + 9. Suppose 0b + 4b = -j. Let h be (1 + -2)b + 0. Solve o - h = 1 for o. 3 Let	{ "pile_set_name": "DM Mathematics" }
16 = -o. What is the least common multiple of y and 3? 24 Suppose 0 = -17l + 13l + 8. Suppose -x + 78 = 4v + x, -4x = 2v - 24. Suppose 0 = -2m + m + v. Calculate the lowest common multiple of m and l. 22 Let u = 321 + -223. Suppose -5m - 385 = -3g, 2m + 185 = 2g - 7g. What is the lowest common multiple of u/16 + 10/m and 10? 30 Let w = 34 + 2. Suppose w = -4a + a. Calculate the lowest common multiple of 11 and -24/16a. 66 Let m = 5 + 7. Let w = -75 - -83. Suppose 5b - 98 = g + g, 0 = -2g - w. Calculate the lowest common multiple of m and b. 36 Let z be ((-2)/((-12)/(-69)))/(1/(-2)). Suppose 0 = 5y - 4q - z - 6, 21 = y + 3q. What is the lowest common multiple of y and 18? 18 Suppose 3k - 10 = 2n, 0 = -4n - k - k + 12. Find the common denominator of ((3/9)/n)/(2/(-258)) and -131/6. 6 Calculate the common denominator of (-16 - -21)(-2)/28 and -7/66. 462 Let j = -32/29 + -373/319. Let w = 10358/327 + -1/109. Let i = w + -32. Find the common denominator of i and j. 33 Find the common denominator of -169/30 and 1674/405 - (-2)/(-4). 30 Let n be (-1)/(4 - (-196779)/(-49212)). Let c = n + 188170238/263833. Let r = c + 309757/229420. Find the common denominator of r and -109/28. 140 What is the common denominator of -109/20 and 22/(-4)((-256)/(-60) + -4)? 60 Suppose 269 = 3c + 239. Calculate the lowest common multiple of 65 and c. 130 Let g(h) = h2 - 12h + 9. Let f be g(12). Suppose -b = 3b - o - f, 2o = 4b - 14. Calculate the least common multiple of b and 15. 15 Let a(w) = w3 + 9w*2 + 6w. Let b be a(-8). Let x = 94 - b. What is the lowest common multiple of 3 and 128/13 - (-12)/x? 30 Suppose 0 = -16g + 27g - 275. Calculate the lowest common multiple of 70 and g. 350 Let y be ((-2)/8)/(28/1004). Let w = y + 82/7. Calculate the common denominator of w and 85/12. 12 Suppose 16x + 21 + 11 = 0. Let o(j) = 10j. Calculate the lowest common multiple of o(1) and 42/2 - (-6 - (-1 + x)). 120 Let g = 1/57 - -433/228. Let n = -2846/129 + 60/43. What is the common denominator of g and n? 12 What is the common denominator of 23/10 and (-27)/8 + -10 + 16 + -9? 40 Calculate the common denominator of (69/18)/((-720)/27) and -33/20. 160 Let v(s) be the first derivative of s*4/4 + 8s*3/3 + 9s*2/2 - 7s + 27. Calculate the lowest common multiple of v(-6) and 24. 264 Let p = 37274885633/46 + -810284722. Let m be 3 + -38883 + (-1 - -4). Let o = p + m. Calculate the common denominator of -65/22 and o. 506 Suppose -p + 3d + 3807 = -4p, 2d + 3804 = -3p. Let u = p - -10173/8. Find the common denominator of u and 89/38. 152 Let c = 11 - 8. Suppose -11u + 175 = -4u. Calculate the least common multiple of u and c. 75 Let b(k) = 3k2 + 26k - 49. Calculate the lowest common multiple of 9 and b(-19). 540 Let k be ((-8)/(-2))/4 + -2. Let x(b) = -13b - 1. What is the lowest common multiple of x(k) and 6? 12 Let a(c) = -3c*3 + 18c*2 - 2c + 11. Let d be a(12). Let m be 2/(-1) - d/(-36). Let l = m + 505/9. Calculate the common denominator of l and -64/9. 36 Let n(g) = -g*3 + 4g*2 + 3g + 2. Let q be n(4). Suppose 4i - 3i = -20. Calculate the common denominator of ((-8)/i)/(q/120) and 41/8. 56 Suppose 8 = -f - 4p, f + 2p = -4f + 14. Let m be 495/12 + 9/12. What is the lowest common multiple of f and 2/(-7) + 222/m? 20 Let c = 96/55 + 1517/990. Calculate the common denominator of ((-35)/40 - -4) + -4 and c. 72 Suppose -3o + 12 - 1 = 5l, 5o = -2l - 7. Suppose 0 = ln - 0n - 416. What is the common denominator of (n/(-64))/((-18)/(-40)) and 27/22? 198 Let g(m) = m2 + 8m + 13. Let q be g(-7). Let j = q - 2. What is the least common multiple of j and (-2)/(-14) - (-830)/70? 12 Let s be 1(-2)/620235/(-20). Let y = s + -683/2. Calculate the common denominator of y and -49/6. 12 Let v = -8677/6 + 1464. What is the common denominator of (20/(-18) - -1)(-38 - 29) and v? 18 Let f(o) = 3o*2 + 4 + 0o*2 - 2o*2 + 7o. What is the common denominator of f(-9) and (-35)/2-36/27? 3 Let o = 549 + -546. What is the least common multiple of o and 82? 246 Let d = 35053/6 - 5865. Find the common denominator of 42/49(-6)/(-4) and d. 42 What is the common denominator of -57/10 and (-13)/((-78)/(-166))3/20? 20 Suppose 0n - 2n + 3f = 7, f + 7 = -4n. Let x(v) = v*3 + 3v*2 + 2v + 2. Calculate the lowest common multiple of 12 and x(n). 12 Let p = 7399/10 + -737. Find the common denominator of -9 and p. 10 Let j be -1 + -2 + (-402)/(-6) - -3. Let d = j - 47. What is the least common multiple of 14 and d? 140 Let j = 9/52 + 149/78. What is the common denominator of j and (-103/9)/((-8)/13)? 12 Find the common denominator of (8/720)/(((-36)/2055)/(-6)) and 7/18. 36 Let s be ((-111439570)/75)/((-4)/3). Let z = 1115411 - s. Let y = z + -5136/5. Find the common denominator of -28/11 and y. 110 Let b(z) = -z3 - 3z - 20. Let t(p) = -p3 + p2 + 10. Calculate the smallest common multiple of t(0) and b(-3). 80 Suppose n - 5n = -92. Suppose n = d - 5r, -2 = 2d + 5r - 3. What is the least common multiple of d and 8? 8 Let a(k) = 93k2 + 6k + 6. What is the smallest common multiple of 7 and a(-1)? 651 Let p be (-4 - 350/(-88))/((-10)/348). Let c = p + 224/55. Calculate the common denominator of c and -113/20. 220 Let n = 9431/66650 + -2/1333. What is the common denominator of -103/30 and n? 150 Suppose 25 = 4i - 7. Calculate the common denominator of 2/i(-606)/(-30) and -45/16. 80 Let r = 27497015129/37348542 - -4/1697661. Let p = 739 - r. Calculate the common denominator of p and (-239)/(-12) - (-8)/32. 66 Find the common denominator of 14/9 and 1346/804 + (-291)/194. 603 Suppose 0 = o + 4 - 1. Let z be (-88)/12-3 + o. Suppose -2h = 6, h + z = 4k - 0h. What is the lowest common multiple of 4 and k? 4 Suppose 0 = 220k - 204k - 80. Calculate the smallest common multiple of 32 and k. 160 Let c(h) = 28h + 30. Calculate the lowest common multiple of 22 and c(11). 3718 Suppose -28t + 11t = -306. Calculate the lowest common multiple of t and 33. 198 Let r be (-658)/(-211) - (2 + 3 + -2). Let i = r - 22727/1266. What is the common denominator of i and 107/20 + 1-1? 60 Let x = 12 + 0. Suppose x = -g + 10. Calculate the common denominator of -44/5 and (-122)/(-4)g/4. 20 Let x = -55 + 74. Suppose t - x = -10. Calculate the smallest common multiple of t and 3. 9 Calculate the least common multiple of 130 and 693/154(27 - 1). 1170 Let y be ((-1)/(-10)4)/((-1)/(-15)). Let b = -461 - -5537/12. What is the common denominator of b and (-1391/(-12))/(y/(-4))? 36 Let a be (0 + (-7086)/(-580))/(24/10). Let t = -4916 - -3421531/696. Let z = t + a. Find the common denominator of -93/2 and z. 12 Let i = -31996 - -2239823/70. Find the common denominator of i and -25/8. 280 Let j = 2/21823 + 2771497/261876. Let y = 109391/10 - 10950. What is the common denominator of y and j? 60 Let m = 531662/35 - 15192. What is the common denominator of m and -73/42? 210 Let w be (7/2)/((-19)/(-190)). What is the common denominator of -16 and 10/w - 0 - (-60)/(-14)? 1 Let t = -621623/300 + 6218/3. Calculate the common denominator of 35/8 and t. 200 Let h = -3774 - -37723/10. Let r(o) = o*3 - 12o*2 + 11o + 7. Let x be r(8). Let i = -1271/8 - x. Find the common denominator of h and i. 40 Find the common denominator of 1078/115565/(-12) and 5/138. 414 Suppose 24a - 42 = 23a. Calculate the lowest common multiple of 8 and a. 168 Suppose -6 = 4a - d, a - 4d + 3d = 0. Let m = 27 + -38. Let f = a - m. What is the smallest common multiple of 10 and f? 90 Let s = -535/11 + 9347/220. Calculate the common denominator of s and (-30)/216((-269)/(-10) - -4). 120 Suppose -2p = 2p - 768. Let c = p + -137. Suppose 3a + 27 = 5v - c, 3v - 5a = 62. What is the lowest common multiple of v and 4? 28 Let l = -500 - -635. Calculate the least common multiple of l and 9. 135 Let o(m) be the third derivative of -m4/24 - 5m3/3 + m2. Suppose 3j + 5c = 3c - 29, 5j = c - 57. Calculate the lowest common multiple of 4 and o(j). 4 Let a = 5 - 37/2. Find the common denominator of -93/2 and a. 2 Suppose 978b - 948b - 180 = 0. Suppose -q = -4a + 21, 0 = 2a - 7a - 5q + 45. What is the least common multiple of a and b? 6 Suppose 2q - 7q = -5*w	{ "pile_set_name": "DM Mathematics" }
n2 + 53421856n*2. -3n*2 Collect the terms in -13416z - 13378z - 13455z - 13471z + 53935z. 215z Collect the terms in 924p*2 - 145 - 137 + 562 - 140 - 730p*2 - 140. 194p*2 Collect the terms in -22354p*3 + 128p*2 - 67p*2 - 61p*2. -22354p*3 Collect the terms in 1851d*3 - 9136d*3 + 5611d*3. -1674d*3 Collect the terms in -3231n - 3461n - 5 + 1 + 4. -6692n Collect the terms in 5k - 2129322519955k*2 - 4k*3 + 2129322519955k*2. -4k*3 + 5k Collect the terms in -108j + 196 + 199 - 799 + 202 + 202. -108j Collect the terms in -64055h - 856h*2 + 64055h - 3187h2. -4043h*2 Collect the terms in -38o*3 + 2o*2 - 70o*3 - 5646 + 11286 - 5640. -108o*3 + 2o*2 Collect the terms in -43557r*2 + 0 + 0 + 42507r*2. -1050r*2 Collect the terms in 0 + 14396h*2 + 2h*3 + 10 + 11 - 22h*3. -20h*3 + 14396h*2 + 21 Collect the terms in 23415f*2 - 9869f*2 + 37792f*2 - 1163f*2 + 14033f*2. 64208f*2 Collect the terms in -j + 36892 - 36892 + 14j. 13j Collect the terms in 4784 + 4708 + 3i*2 + 8i - 21i - 9492 + 13i. 3i2 Collect the terms in s + 88352s*2 - s + 16814s*2 + 134708s*2. 239874s*2 Collect the terms in -1389p - 62p2 + 2759p - 1369p - 76p*2. -138p*2 + p Collect the terms in 1837715c + 120 - 120. 1837715c Collect the terms in 59075 - 9b*2 + 8269b - 59075 - 8269b. -9b2 Collect the terms in -196 + a3 + 207 + 1969a - 1969a. a*3 + 11 Collect the terms in 35714i*3 + 176 + 35879i*3 - 360 + 184 - 71592i3. i3 Collect the terms in -307i2 + 86i - 4449 + 321i2 - 86i + 4449. 14i2 Collect the terms in -481k + 104k + 124k + 127k + 126k + 52k3. 52k*3 Collect the terms in 212925s*3 - 117386s*3 - 95545s*3. -6s*3 Collect the terms in -7t*3 - 8764t*2 - 5t*3 + 8799t*2. -12t*3 + 35t*2 Collect the terms in 11y - 3308 + 4y + 9933 - 3315 - 3311. 15y - 1 Collect the terms in 112 + 2l3 + 67 + 147 + 87 - 276. 2l*3 + 137 Collect the terms in -2s - 19781s2 + 2s + 18577s2. -1204s*2 Collect the terms in -271 - 1325 + 127 - 26x*2 - 676 + 24x*2. -2x*2 - 2145 Collect the terms in -282y*3 + 14y - 9y + 155 - 155. -282y*3 + 5y Collect the terms in 155z2 + 349z*2 + 413z - 415z + 1647z*2 - 375z*2. 1776z*2 - 2z Collect the terms in 9 + 20p2 + 252p + 6p2 - 252p + 83p2. 109p*2 + 9 Collect the terms in 283882x + 323735x + 123027x - 38784x - 134575x. 557285x Collect the terms in 49x*3 + 22x*3 - 2x*2 - 119x*3 + 75x*3. 27x*3 - 2x*2 Collect the terms in 25y - 51y + 12y + 3y2 - 7235 + 14y. 3y2 - 7235 Collect the terms in -269 - 555 + 224 - 2r*2 + 228 - 317 - 246. -2r*2 - 935 Collect the terms in 53011j + 52916j - 22j*2 - 105927j. -22j2 Collect the terms in -4010l*3 + 2 - 5273389l*2 + 5273389l*2. -4010l*3 + 2 Collect the terms in 85o - 13o2 - 160o + 25o2 - 5o*2 + 79o - o*2. 6o*2 + 4o Collect the terms in 13h2 + 0h*2 + 3h*2 + 2h2 - h2 - 10h2 + 4h. 7h2 + 4h Collect the terms in -3095w + 0 + 2 - 1605w*2 + 3092w - 3 - 2. -1605w2 - 3w - 3 Collect the terms in -4739n + 31n*2 + 5057n - 87n2. -56n*2 + 318n Collect the terms in -895 + 33923i + 888 - 33923i - 29i3. -29i*3 - 7 Collect the terms in -7 + 1 + 184667t + 622283t + 6. 806950t Collect the terms in -605816l + 302910l - 5 + 302909l - 7 + 12. 3l Collect the terms in 1396y2 - 4318y*2 + 1250y*2 + 1408y*2. -264y*2 Collect the terms in 9l + 4l - 8l - 14l + 571l*2 + 9l. 571l2 Collect the terms in -2h*2 - 2 + 49h + 7 + 50h + 37h. -2h2 + 136h + 5 Collect the terms in -12584 + 6293 + 6265 + 34u2. 34u*2 - 26 Collect the terms in -1812i*3 + 1816i*3 + 489i*2 - 489i*2. 4i*3 Collect the terms in -57 - 909 - 492 + 3m + 136. 3m - 1322 Collect the terms in 82 + h - 5 - 811 + 12 + 722. h Collect the terms in -151499z*3 + 302807z*3 - 151307z3. z3 Collect the terms in -12216 - 52u3 + 6083 + 6135. -52u*3 + 2 Collect the terms in 49o + 21o - 2 + 16o + 590o2 - 4o - 587o2. 3o*2 + 82o - 2 Collect the terms in -951c + 2151c - 2089c - 4939c - 5115c. -10943c Collect the terms in -2x2 + 84x - 5412 + 5123 - 9701 - 84x. -2x*2 - 9990 Collect the terms in -10979c + 2802c + 2568c - 7c3 + 2805c - 2c3 + 2804c. -9c3 Collect the terms in 8 + 2783j + 3 - 16 + 3. 2783j - 2 Collect the terms in -y - 5y - 443y2 + 6y + 1367y2 - 414y*2 + 2. 510y*2 + 2 Collect the terms in -235 + 937 - 229 - 228 - 245 - 4d. -4d Collect the terms in 4173l*3 - 4176l*3 - 892l*3. -895l*3 Collect the terms in -1295r*3 + 544r*3 + 6353r*3. 5602r*3 Collect the terms in 53015c - 26517c + c2 - 26506c - 11c2. -10c*2 - 8c Collect the terms in -10 + 7918904w + 56 - 46 - 7918887w. 17w Collect the terms in 224n + 182n + 31n*3 + 139n + 3n3 - 2. 34n*3 + 545n - 2 Collect the terms in 0 + 1 + 0 - 2 + 9 + 541751o2 - 541752o2. -o2 + 8 Collect the terms in 510176t2 - 254265t*2 - 255910t2. t2 Collect the terms in 110 - 42 + o*2 + o - 4o*2. -3o*2 + o + 68 Collect the terms in -3m + 3m - 3m*2 - 7793m*3 - 9084m*3 + 1719m*3. -15158m*3 - 3m*2 Collect the terms in 13 + 76823w - 38409w - 38413w + 60. w + 73 Collect the terms in 13476h + 229 + 226 - 116 - 339. 13476h Collect the terms in -2g3 + 7g3 - g3 - 684810g + 684810g. 4g3 Collect the terms in -4m*3 + 2917181 - 2917181. -4m*3 Collect the terms in 890 + 15k*2 - 16k2 + 7402 + 8095. -k2 + 16387 Collect the terms in 489u3 + 2352u*3 + 970u*3 + 1048u*3 + 6900u*3. 11759u*3 Collect the terms in -6923w*3 + 1975w*3 + 41w*3. -4907w*3 Collect the terms in -1446y*3 + 20362574y*2 - 20362574y*2. -1446y*3 Collect the terms in -w - 6280w*3 - 306w*3 - 17839w*3 + w. -24425w*3 Collect the terms in 623 + 2787 - 3410 + 2u. 2u Collect the terms in 64924 + 5023 + 19160 + 202y. 202y + 89107 Collect the terms in 2 - 2 + 1016517b - 2033032b + 1016510b. -5b Collect the terms in 5205 - 5p - 9155 - 9046. -5p - 12996 Collect the terms in -470w*2 + 156w*2 + 146w*2 + 23 + 168w*2 - 23 - 2w*3. -2w*3 Collect the terms in 90v*2 - 35v*3 - 46v*3 - 32v*3 - 10v*3 - 92v*2. -123v*3 - 2v*2 Collect the terms in -11b*3 + 117b*3 - 47b*3 + 162b*3. 221b*3 Collect the terms in 162m - 548m - 161m + 75m. -472m Collect the terms in -547y2 - 12 - 84y - 547y2 + 1096y*2 - 13y. 2y2 - 97y - 12 Collect the terms in 36276d - 12549d - 12199d - 12141d. -613d Collect the terms in -1 + 3 - 1325970n*3 + 1131n - 1131n. -1325970n*3 + 2 Collect the terms in 7n*2 + 73n*3 + 53n*3 + 2 + 5n*2 + 67n*3. 193n*3 + 12n*2 + 2 Collect the terms in 23 + 25 + 40 + 137t - 148 + 38. 137t - 22 Collect the terms in -4o - o*2 + o + 117279 + 2o + 3o2. 2o*2 - o + 117279 Collect the terms in -188t + 21473t3 - 190t + 376t + 12892t*3. 34365t*3 - 2t Collect the terms in 147c - 105 + 66 + 50. 147c + 11 Collect the terms in 67v + 5 - 190v - 22v - 418v. -563v + 5 Collect the terms in 294q + 187369 - 187369. 294q Collect the terms in 3852q + 12443671 - 12443671. 3852q Collect the terms in -2728847146 + 413m*2 + 2728847146 + 766m*2. 1179m*2 Collect the terms in -v - 27v - 19303v2 + 20v + 8v. -19303v*2 Collect the terms in 10c*3 + 2 - 40c*3 - 2 + 99c*3 + 0c*3 + c - 26c*3. 43c*3 + c Collect the terms in 259 + 1760y - 545 + 286. 1760y Collect the terms in 12v - 47170267337 + 47170267337 + v. 13v Collect the terms in 156k + 158k + 150k - 790k + 164k + 14 + 159k. -3k + 14 Collect the terms in 660643946188 - b3 - 660643946188. -b3 Collect the terms in 249b - 618b + 371b. 2b Collect the terms in -7489u + 19573u - 4605u - 7482u - 2 + 2. -3u Collect the terms in 4s + 17s + 32s + 14s - 65s. 2s Collect the terms in 31165q*2 - 2749203q + 2749203q + 1 - 1. 31165q*2 Collect the terms in 44 + 2054 + 229p + 861. 229p + 2959 Collect the terms in -3094y*2 + 442y*2 - 748y*2 - 2443y*2 - 1268y*2 + 1126y*2. -5985y**2 Co	{ "pile_set_name": "DM Mathematics" }
46 Calculate the remainder when 15214 is divided by 12. 10 Calculate the remainder when 557 is divided by 26. 11 Calculate the remainder when 106317 is divided by 106. 105 What is the remainder when 858 is divided by 224? 186 What is the remainder when 48 is divided by 8? 0 Calculate the remainder when 222 is divided by 32. 30 What is the remainder when 5739 is divided by 164? 163 Calculate the remainder when 617 is divided by 264. 89 Calculate the remainder when 3767 is divided by 3. 2 Calculate the remainder when 877 is divided by 861. 16 Calculate the remainder when 995 is divided by 484. 27 What is the remainder when 73 is divided by 63? 10 What is the remainder when 1229 is divided by 54? 41 Calculate the remainder when 12222 is divided by 17. 16 What is the remainder when 147 is divided by 11? 4 What is the remainder when 75 is divided by 74? 1 Calculate the remainder when 2648 is divided by 50. 48 Calculate the remainder when 1300 is divided by 8. 4 Calculate the remainder when 79 is divided by 71. 8 What is the remainder when 6141 is divided by 74? 73 Calculate the remainder when 4294 is divided by 12. 10 Calculate the remainder when 215 is divided by 36. 35 What is the remainder when 849 is divided by 143? 134 What is the remainder when 91 is divided by 18? 1 What is the remainder when 479 is divided by 178? 123 Calculate the remainder when 390 is divided by 68. 50 Calculate the remainder when 37 is divided by 11. 4 Calculate the remainder when 967 is divided by 81. 76 What is the remainder when 667 is divided by 220? 7 Calculate the remainder when 354 is divided by 46. 32 What is the remainder when 174 is divided by 51? 21 What is the remainder when 3181 is divided by 153? 121 What is the remainder when 1715 is divided by 6? 5 Calculate the remainder when 592 is divided by 17. 14 What is the remainder when 331 is divided by 166? 165 What is the remainder when 986 is divided by 319? 29 Calculate the remainder when 533 is divided by 67. 64 Calculate the remainder when 263 is divided by 38. 35 What is the remainder when 91 is divided by 34? 23 Calculate the remainder when 77 is divided by 24. 5 What is the remainder when 168 is divided by 31? 13 Calculate the remainder when 4433 is divided by 222. 215 Calculate the remainder when 48 is divided by 11. 4 Calculate the remainder when 165 is divided by 13. 9 What is the remainder when 825 is divided by 92? 89 What is the remainder when 182 is divided by 59? 5 Calculate the remainder when 42920 is divided by 28. 24 What is the remainder when 1247 is divided by 78? 77 What is the remainder when 5464 is divided by 909? 10 Calculate the remainder when 860 is divided by 97. 84 Calculate the remainder when 277 is divided by 5. 2 Calculate the remainder when 1975 is divided by 128. 55 What is the remainder when 466 is divided by 155? 1 What is the remainder when 2163 is divided by 446? 379 What is the remainder when 1590 is divided by 20? 10 What is the remainder when 1172 is divided by 59? 51 Calculate the remainder when 1022 is divided by 147. 140 Calculate the remainder when 1254 is divided by 69. 12 What is the remainder when 4987 is divided by 29? 28 Calculate the remainder when 84 is divided by 13. 6 What is the remainder when 97 is divided by 18? 7 Calculate the remainder when 322 is divided by 139. 44 Calculate the remainder when 4890 is divided by 36. 30 What is the remainder when 301 is divided by 9? 4 What is the remainder when 1314 is divided by 189? 180 What is the remainder when 2373 is divided by 11? 8 Calculate the remainder when 944 is divided by 32. 16 What is the remainder when 1267 is divided by 27? 25 Calculate the remainder when 121 is divided by 31. 28 What is the remainder when 115 is divided by 26? 11 Calculate the remainder when 16434 is divided by 173. 172 Calculate the remainder when 2797 is divided by 56. 53 Calculate the remainder when 2417 is divided by 45. 32 What is the remainder when 2802 is divided by 187? 184 What is the remainder when 25 is divided by 12? 1 Calculate the remainder when 148 is divided by 48. 4 What is the remainder when 141 is divided by 22? 9 Calculate the remainder when 251 is divided by 33. 20 What is the remainder when 32 is divided by 21? 11 What is the remainder when 206 is divided by 66? 8 Calculate the remainder when 190 is divided by 40. 30 Calculate the remainder when 412 is divided by 189. 34 Calculate the remainder when 87 is divided by 46. 41 What is the remainder when 105 is divided by 18? 15 What is the remainder when 1839 is divided by 41? 35 What is the remainder when 1212 is divided by 15? 12 Calculate the remainder when 151 is divided by 31. 27 Calculate the remainder when 1276 is divided by 55. 11 Calculate the remainder when 376 is divided by 66. 46 Calculate the remainder when 2105 is divided by 132. 125 Calculate the remainder when 122 is divided by 78. 44 Calculate the remainder when 1036 is divided by 4. 0 What is the remainder when 3824 is divided by 132? 128 Calculate the remainder when 2113 is divided by 2108. 5 Calculate the remainder when 19456 is divided by 18. 16 Calculate the remainder when 213 is divided by 62. 27 What is the remainder when 62 is divided by 26? 10 What is the remainder when 172 is divided by 59? 54 What is the remainder when 591 is divided by 75? 66 What is the remainder when 242 is divided by 67? 41 What is the remainder when 296 is divided by 23? 20 Calculate the remainder when 775 is divided by 26. 21 Calculate the remainder when 290 is divided by 73. 71 Calculate the remainder when 3150 is divided by 787. 2 What is the remainder when 559 is divided by 121? 75 Calculate the remainder when 94 is divided by 19. 18 Calculate the remainder when 1147 is divided by 28. 27 Calculate the remainder when 1505 is divided by 18. 11 Calculate the remainder when 359 is divided by 60. 59 What is the remainder when 3258 is divided by 149? 129 Calculate the remainder when 7624 is divided by 121. 1 What is the remainder when 17 is divided by 7? 3 Calculate the remainder when 272 is divided by 55. 52 What is the remainder when 506 is divided by 23? 0 What is the remainder when 685 is divided by 18? 1 Calculate the remainder when 2214 is divided by 23. 6 Calculate the remainder when 4688 is divided by 134. 132 What is the remainder when 386 is divided by 63? 8 Calculate the remainder when 56 is divided by 16. 8 What is the remainder when 2483 is divided by 15? 8 What is the remainder when 348 is divided by 90? 78 Calculate the remainder when 212 is divided by 64. 20 What is the remainder when 385 is divided by 187? 11 Calculate the remainder when 18 is divided by 8. 2 Calculate the remainder when 1694 is divided by 113. 112 What is the remainder when 43 is divided by 8? 3 What is the remainder when 195 is divided by 30? 15 What is the remainder when 4156 is divided by 18? 16 What is the remainder when 549 is divided by 69? 66 Calculate the remainder when 827 is divided by 52. 47 Calculate the remainder when 1233 is divided by 59. 53 Calculate the remainder when 100 is divided by 22. 12 Calculate the remainder when 431 is divided by 23. 17 Calculate the remainder when 1973 is divided by 38. 35 What is the remainder when 866 is divided by 29? 25 Calculate the remainder when 451 is divided by 12. 7 Calculate the remainder when 877 is divided by 55. 52 What is the remainder when 4815 is divided by 43? 42 What is the remainder when 1030 is divided by 327? 49 What is the remainder when 1580 is divided by 43? 32 Calculate the remainder when 1814 is divided by 26. 20 What is the remainder when 2526 is divided by 46? 42 Calculate the remainder when 134 is divided by 15. 14 Calculate the remainder when 29 is divided by 2. 1 What is the remainder when 4132 is divided by 37? 25 Calculate the remainder when 300 is divided by 43. 42 Calculate the remainder when 14648 is divided by 10. 8 What is the remainder when 359 is divided by 18? 17 Calculate the remainder when 367 is divided by 2. 1 Calculate the remainder when 5251 is divided by 142. 139 What is the remainder when 674 is divided by 318? 38 Calculate the remainder when 253 is divided by 4. 1 What is the remainder when 475 is divided by 113? 23 What is the remainder	{ "pile_set_name": "DM Mathematics" }
prime factors of 150/1 - (-9 + i)? 5, 29 Let p(l) = -2l - 6. Let u be p(-5). Suppose -3v + 40 = 17v. List the prime factors of 104/uv. 2, 5 Let a = -7206 + 10321. List the prime factors of a. 5, 7, 89 Suppose -3 = z - b - 13, 2b = 4z - 30. Suppose -4j - 6l = -2l - 20, 3j = zl + 7. List the prime factors of 24/(2 - (-3 + j)). 2, 3 Suppose -2 = 5h + 4d - 43, 20 = 5d. Suppose 3n - h = -2n, -4m + 5n = 5. What are the prime factors of (-30 - m)/(6 + -8)? 3, 5 Suppose -m - 3u + 286 = 0, -4u = 3m - 193 - 680. What are the prime factors of m? 5, 59 Suppose 0b + 4b = -x + 115, -3x + 55 = 2b. Suppose -13 - b = -k. List the prime factors of k. 2, 3, 7 Suppose -a = -4b + 2b - 225, 2a = -2b + 450. Suppose 2z + a = -3z - 5l, 168 = -4z + 2l. Let s = 72 + z. What are the prime factors of s? 29 List the prime factors of ((-2002)/273)/(4/(-2382)). 11, 397 Let h(c) = 2c + 10. Let d be h(0). Suppose 2z = d, -2n - 3z = -132 - 325. What are the prime factors of n? 13, 17 Suppose 2h + 6 = -0h. Let q be (1 - h) + (-141)/(-3). Let t = -15 + q. List the prime factors of t. 2, 3 Suppose s - 3o - 575 = 1690, -11297 = -5s + o. What are the prime factors of s? 3, 251 List the prime factors of (8060/(-16))/(13/(-4) - -3). 5, 13, 31 Let y = -44 + 61. Suppose 0 = 16i - yi + 10. List the prime factors of i. 2, 5 Suppose -2x + l = 123, 5l - 237 = 4x - 0l. Let m = x + 89. List the prime factors of m. 2, 13 Let v(h) = -142h + 27. What are the prime factors of v(-13)? 1873 Suppose 4r = 79 + 153. Let y = r + -86. List the prime factors of (-2)/(-8) + (-1141)/y. 41 Let p be ((-6)/(-9))/(1393/(-465) - -3). Suppose 0 = -2k - 4, 0 = -3x + 4k + p + 96. What are the prime factors of x? 3 Suppose -2d = 4l - 9998, 7l - 9l + 4987 = 5d. List the prime factors of l. 41, 61 Let c(n) = 2n*3 - 66n*2 + 16n + 53. What are the prime factors of c(33)? 7, 83 Let g be 3(4 - 575/(-15)). Suppose 3x - 4b = 381, -x + 5b = 2b - g. List the prime factors of x. 127 Suppose -4c = -2m + 72, -4m - 2c + 118 = 3c. Suppose a + 3w = m, -5a + 228 = -0w - 2w. List the prime factors of a. 2, 11 What are the prime factors of (-1640456)/(-265) + 6/10? 41, 151 Let b(n) = n*2 + 28n + 1268. What are the prime factors of b(0)? 2, 317 Let f = 2 - -4. Let w(g) = 3g - fg2 - 3 + g3 - 5g + 4g + 13g2. What are the prime factors of w(-6)? 3, 7 Suppose -15c + 12c = -99. List the prime factors of c. 3, 11 Let q(o) = 7o*2 + 1. Let l be q(1). Suppose lg - 41 = 7g. Let y = 63 - g. What are the prime factors of y? 2, 11 List the prime factors of (4129 - 2)(67 + -66). 4127 Suppose 0 = -5h - 3f + 1624 + 970, -4h + 2062 = -2f. List the prime factors of h. 11, 47 Suppose m - 6m = 90. Let o = -68 + 77. List the prime factors of (-8 - 0)/(o/m). 2 Let t(j) = -7j - 2. Let l(q) = q. Let z(r) = -6l(r) - t(r). Let x = 18 - 13. List the prime factors of z(x). 7 Let p = -44 - -32. What are the prime factors of (-194)/(-3) - -2(-2)/p? 5, 13 Let k(s) be the second derivative of -7s3/6 - s2 + 3s. Let w be k(-1). Suppose 10j - wj - 3o - 281 = 0, 3o = 4j - 226. List the prime factors of j. 5, 11 Suppose 5n - 2305 = 5y, n + 3y - 536 = -59. List the prime factors of n. 3, 5, 31 Let o(n) = 5n + n2 + 4 + 0n*2 + 0n + 1. Let m be o(-5). Suppose 4v - 5l - 120 = 126, 3v = ml + 187. What are the prime factors of v? 59 Let u = -251 + 5. List the prime factors of (0 - u)(-14)/(-28). 3, 41 Suppose 83g + 44700 = 93g. List the prime factors of g. 2, 3, 5, 149 Let a(n) = 86n - 50. What are the prime factors of a(15)? 2, 5, 31 List the prime factors of (-1)/(-15) - 98547/(-45). 2, 3, 5, 73 Let l(u) = -u - 9. Let y be l(7). Let x(t) = t + 48. What are the prime factors of x(y)? 2 Let v be ((-855)/30)/((6/(-4))/(-3)). Let q = v + 109. What are the prime factors of q? 2, 13 Let i(l) = 2l - 1. Let h be i(3). Let c(k) be the third derivative of k4/24 + k3/3 + 2k*2. What are the prime factors of c(h)? 7 Suppose j - 56 = -j. Let r = j - 18. List the prime factors of (-8)/r(-79 + 4). 2, 3, 5 List the prime factors of -6 + 3 + 0 + 2629 - -2. 2, 3, 73 Let z(f) = f*2 - 5f + 10. Let p be z(-9). Suppose 6d = 10d - p. List the prime factors of d. 2, 17 What are the prime factors of -3 + (4742/4 - (-17)/34)? 7, 13 Let i(l) be the third derivative of l5/30 - l4/24 + l3/3 - l2. List the prime factors of i(-4). 2, 19 Suppose 3v - 15 = -5w + 17, 5v + 3w = 80. Let g = 116 + v. What are the prime factors of g? 3, 5 Let c = 4391 - 1903. List the prime factors of c. 2, 311 Suppose m - 8 = -3m. Let k(b) = 3b*m + 0 - 2b*2 + 41 - b. List the prime factors of k(0). 41 Let t = 8 + 12. Let s be (t/8 - 2)-4. What are the prime factors of ((-36)/(-10))/(s/(-20))? 2, 3 Suppose 2p - 5u + 71 = 0, -p - 4p - 245 = u. Let f = 105 + p. What are the prime factors of f? 3, 19 Let t = 3 - 1. Let z be (10/25)/(t/370). Suppose 0 = -4d + 2m + 34, -4m + z = 5d - 1. List the prime factors of d. 11 Let w(y) = 3y - 1 + 24 + 0y - 9y. List the prime factors of w(-7). 5, 13 Let n = 8 - 2. Suppose 2r = -4u + 148, -5u + r = nr - 185. Suppose -5 + u = k. What are the prime factors of k? 2 Let h = -32 + 62. List the prime factors of (-10)/h - (-74)/6. 2, 3 Suppose z - 43 = j, 71 + 15 = 2z - 4j. Let y(g) = g. Let a be y(3). Suppose 5n - 114 = -4x, -n + an = x + z. List the prime factors of n. 2, 11 Suppose -4u + 397 = g, -4g + 5g = 5u - 485. Suppose -2z + 98 = 2v, -2v = -0z - 2z + u. List the prime factors of z. 7 Let l(w) = 37w2 - 4w - 5. Let c(j) = 37j2 - 5j - 6. Let y(a) = -6c(a) + 7l(a). What are the prime factors of y(-1)? 2, 3 Let w be -3((-11)/4 + (-2)/8). Suppose -wp - 227 = -1505. List the prime factors of p. 2, 71 Let t = -1039 - -1828. What are the prime factors of t? 3, 263 Suppose -32t + 29t = -1590. What are the prime factors of t? 2, 5, 53 Let h be ((-6)/5)/((-6)/20). Suppose -3u + 396 = -3n, -130 - 398 = -hu + 2n. List the prime factors of u. 2, 3, 11 What are the prime factors of (3/3)/(2958/(-1480) + 2)? 2, 5, 37 Suppose -5c + 483 = 4h, 282 = 3c - 6h + 11h. Let q = c - 51. List the prime factors of q. 2, 3 Suppose -5o - 8h = -9h - 14458, 0 = -5o + 4h + 14467. List the prime factors of o. 7, 59 Let c be 3/(-9)(0 + 0). Let t(i) = i + 116. What are the prime factors of t(c)? 2, 29 Let b = -19 + 24. What are the prime factors of 0/(-2) + 290/b? 2, 29 Let f = 40 + 60. Let a = f + -65. What are the prime factors of a? 5, 7 Let z be 4/(-22) + (-2)/(-11). Let f(x) = -2x + 42. What are the prime factors of f(z)? 2, 3, 7 Suppose 253u = 260u - 5705. What are the prime factors of u? 5, 163 Let x be (1 - -64)72/45. Suppose -5t - w + 40 = -90, 4t - x = w. Suppose 4n - t = 34. What are the prime factors of n? 3, 5 Let f(m) = m*3 - 2m*2 + 4m - 2. Let l be f(3). Let j = l - 4. List the prime factors of j. 3, 5 Suppose 0 = 4w - 5l - 5, -2w = -w - 3l + 4. Suppose -11 = -2p + wa, -5p - 4a = -0p - 44. List the prime factors of p. 2 Let n = 793 - 135. List the prime factors of n. 2, 7, 47 What are the prime factors of (-36)/27 - (17752/(-6))/2? 2, 739 Let l be 274 - 7/((-14)/4). Let d = l + -160. What are the prime factors of d? 2, 29 Let k = -48 - -178. List the prime factors of k. 2, 5, 13 Let q = 3258 + -2821. List the prime factors of q. 19, 23 Let l = 214 + -315. Let q = l - -124. What are the prime factors of q? 23 Let m(c) = -c2 + 21c - 87. Let u be m(15). Let l = 21 + -6. Suppose l = -ug + 159. List the prime factors of g. 2, 3 Let o = -32 + 54. Suppose 4i - o = 30. List the prime factors of i. 13 Suppose 180 = 2v - 2c, -2v + 480 = 3v + 5c. List the prime factors of v. 3, 31 Let x = -8 + 8. Suppose x = -0s + s - 246. What are the prime factors of s? 2, 3, 41 Let f(w) = w*3 + 12w*2 + 9w - 4. Let a be f(-8). Suppose 6s + a = 3s. Let g = s + 96. What are the prime factors of g? 2, 3 Let b(u) = 1. Let h(y) = y*2 - 10y - 13. Let s(d) = -6b(d) - h(d). Let v be s(7). List the prime factors of (v/(-10))/((-4)/20). 2, 7 Let h(l) be the second derivative of 13l4/12 - l3/2 + l*2 - 3l. What are the prime factors of h(1)? 2, 3 Suppose -12256 = -6*q - 1960. What are	{ "pile_set_name": "DM Mathematics" }
4 Expand (-3s4 + 0s4 + s4)(-2 + 3 + 0) + 2 - s4 - 2 - 1390s*4 - 43580s + 43580s - 1 + 1 + 2s*4. -1391s*4 Expand (0 + 3 + 2)(-8471264 - 4432d + 8471264). -22160d Expand (-608106 + 608106 - 1832p)(3 - 3 + 2p). -3664p*2 Expand (2 + 0m + 2m + 8)(2 - 4 + 0) - m + 0m + 4m + (m - m - 2m)(1 + 0 + 2). -7m - 20 Expand (-22479 - 121z*4 - 22484 + 44960 + 9z)(3z + 3z - 2z). -484z5 + 36z*2 - 12z Expand (29b + 42 + 45 - 69)(-1 + 2 - 4). -87b - 54 Expand (4 - 1 - 2)(30 - 30 - 51a) + (-2 - 4 + 5)(4 - 4 + 5a) + (-1 + 2 - 2)(0 + 0 - 2a) + 0 + 2a + 0 - 2a + 2a - a. -53a Expand -5 - 2q + 5 + 9q3 + (q2 + q2 + q2)(4q + q - q). 21q*3 - 2q Expand 4 - 8y2 - 4 + 2y2 - y2 + y*2 + (2 - 2 - 2y)(-3y + 4y + y) + ((-2y + 2y - 4y)(-174y + 181y - 144y) - 4y - 2y*2 + 4y)(3 + 2 - 4). 536y*2 Expand (12 - 1 + 1)(-1353p - 782p - 122p). -27084p Expand (62 - 439 - 94)(-10p + 4 - 3 + 0). 4710p - 471 Expand (6936 - 33f - 3468 - 3482)(-f3 - 3f*3 + 3f*3). 33f*4 + 14f3 Expand (-2 + r2 + 2)(-3r*2 + 4r2 + r2) + (3r4 + 3r*4 - 4r*4)(0 - 1 - 1) + (r*4 + 0 + 0)(-87 + 80 - 726). -735r4 Expand 3t + t*2 - 3t + 0t2 + t2 + t2 + (5t - 2t - t)(-2t - 2t + 2t) - 145 + 25t*2 + 295 + 43t*2 - 147. 67t*2 + 3 Expand (1 - 1 - 2r)(-2r*2 + 2r*2 + 2r3 - r3 + 2r3 + 0r3 + (0 + r2 + 0)(-47r - 446 + 446)) + 51r2 - 10r*4 - 51r*2. 78r*4 Expand (191 - 374 + 184 + 3t)(-2t*2 - 8t*3 + 7t3 - t2). -3t4 - 10t*3 - 3t*2 Expand (4b + 7 - 7)(4 + 1 + 7)(12b + 5b*3 - 12b). 240b4 Expand (0w - 4w + 2w)(-2 + 0 + 4) + (0 - 1 + 2)(w - 6w + 2w) + (-2w + 3w + w)(-6 + 3 + 4) + (-7 + 1 + 2)(17753 - 17753 + 241w). -969w Expand (88l + 3 + 378l - 143l)(-2l + 4l + 2l). 1292l*2 + 12l Expand (71d + 15 - 56d - 12)(-6 + 7d + 6). 105d2 + 21d Expand -6d4 + 2d*4 + 3d*4 - 12d*3 + 12d*3 - 17d*4 + (2 + 0 - 1)(-d*4 + 4d*4 - 2d*4) + (3 + 2d - 3)(-2d - 4d3 + 2d). -25d4 Expand (q - q + q)(2874q - 3658q - 4330q). -5114q2 Expand b5 + 0b5 + 0b*5 + (2b*5 - 4b*4 + 4b*4)(-2 - 4 + 2) - 1 + 18b - 38b*5 - 18b. -45b5 - 1 Expand (-270 - 6p*5 + 270)(4 + 23 + 15 + 0). -252p5 Expand (-2 + 1 + 0)(-4a + a + 4a)(23 + 20 - 34)(-12122 - 168a + 12122). 1512a*2 Expand 296u*2 + 727u*2 - 576u*2 - 3u2 + u2 + 4u2 + 3u2 + u2 - 2u2 + (0u + 3u - u)(0 + 0 + 2u) + 0 - u2 + 0 + 2u*2 + 0 + 0. 456u*2 Expand -1 + 3l + 1 + (0 + 3 - 4 + (3 - 1 - 4)(0 + 0 + 2))(0 - 7l + 0)(1 - 4 - 30). -1152l Expand (38 - 28 + 122b - 124b)(-3 + 0b2 - b2 + 8) + 2b*3 - 5b*3 - 2b*3. -3b*3 - 10b*2 - 10b + 50 Expand (12t + 3 - 2t - 34t)(t*2 + 2t - 2t)(7t + 0t - 5t). -48t*4 + 6t*3 Expand 0 + 0 + 8o*4 + (6 - 6 - 2o*2)(-2o + 2o - o*2) + 3o*4 + 3o*4 + 2o*4. 18o*4 Expand (1 - h - 1)(-h - h + 0h) + 0h*2 + 4h*2 - 5h*2 + (39 - 52 - 224)(4h2 - 4h*2 - 2h*2). 475h*2 Expand (p - 3p + 5p)(-2p2 + 2p*2 - 5p*2) + (-3 - 5 + 3)(-p*3 + 0 + 0) + 0p*3 + 3p*3 - 4p*3. -11p*3 Expand 51h*2 - 347h - 60h2 + 411h + (-7h + 3h + 2h)(-2h - 1 + 1). -5h*2 + 64h Expand 2a3 - a3 + a3 + (55a - 91 + 91)(a - a - a2). -53a*3 Expand (6050j - 6022j + 8j2 - j2)(-5j + 2j + 2j). -7j3 - 28j*2 Expand -23 - 18z*4 + 21 - 5z*4 + (3 - 9 - 6)(4z4 - 3z*4 + 6z*4). -107z*4 - 2 Expand (-3 + 3 - 2b*2)(-41004b - 20184b + 15978b + 6 - 6 - 8102b). 106624b3 Expand (-1 - 9q + 5q + 8q)(26q*2 + 9q*2 + 16q*2). 204q*3 - 51q*2 Expand 0o + o*2 + 0o + (0o - o + 0o)(2o - 2o + 2o) - 2o2 + 30o - 30o + (-6 + 6 - 4o*2)(4 - 2 - 1). -7o2 Expand (-749 + 749 - 42a + 2 - 2a - 2 + (3 + 2a - 3)(0 + 1 + 1))(14 - 2 - 2)(-2 + 3 + 1)(0 + a + 0). -800a2 Expand -3s*2 + 278281s*3 - 88 - 38 + 3s - 278282s3 + (2s + 0s - 3s)(0s2 - s2 - s2). s3 - 3s2 + 3s - 126 Expand (57x4 - 41x*4 - 36x*4)(-2x + 0x + 0x)(-16 - 22 + 21) - 5x5 + 4x*5 + 5x*5. -676x*5 Expand (-1247m*4 + 191m - 409m + 217m)(2m + 1 - 1). -2494m5 - 2m*2 Expand (2 + 1 - 2 - 3 - 6 + 6 + (-2 - 4 + 2)(-3 + 1 - 3))(4c*3 - 13c*3 + 10c*3). 18c*3 Expand (-2r*2 - 2r2 + r2)(0r - 3r + r) + 3r*3 - 3r3 - r3 + (2 - 2 + r*3)(-2 + 5 - 1) - 3r2 + 0r3 + r3 + 0r3. 8r*3 - 3r*2 Expand (-518 - 74 - 315 + 95)(-p*3 - 2p*3 + 5p*3). -1624p*3 Expand -16r - 14r3 + 25r*3 - 13r*3 + (0r - r + 6r)(0r2 - 6r*2 + 4r*2). -12r*3 - 16r Expand (-x - 4x + 3x)(-8 + 8 + 8x) + 36519x - 36519x + 220x2. 204x*2 Expand (0 + 3 - 19)(0g3 - g3 - 2g*3) + (1 + 3 - 5)(17g3 - 20g*3 + 30g*3). 21g*3 Expand (-1010 + 1714 + 2685)(-2 - 3 + 3)(-3j*3 - 2j*3 + 2j*3). 20334j*3 Expand (-89 + 179 + 3s*2 - 86)(-4s2 + 4s*2 - 3s*2 + (0s - 3s + 5s)(0s + 0s - 2s)). -21s4 - 28s*2 Expand (-2 + 1 + 3)(-3 + 4 + 3)(-r + 0r + 0r)(-250r - 297r + 157r). 3120r*2 Expand -2f*2 - 2f*2 - 8f*2 + (2f - 6f + 3f)(-4f + 6f + f) - f2 - 9f + 9f. -16f*2 Expand (0 + l + 0)(87l4 + 82729722 - 82729722 + 15l*3 + 3l). 87l5 + 15l*4 + 3l*2 Expand -2159 + 138o*4 + 2159 + (3o*2 + 4o - 4o)(-o*2 - 2o*2 + 6o*2). 147o*4 Expand (8386k + 19k3 - k3 - 8254k)(5k*2 - 4k2 + k2). 36k5 + 264k*3 Expand (3y*3 - 5y*3 - 6y*3 + (0y2 + y2 + y*2)(-3 + 3 - 2y))(y + 3y - 2y). -24y4 Expand (9 - 6 - 6)(-5222 - 14i + 10424 - 5220). 42i + 54 Expand -106y3 - 8y*3 - 5y3 + (y2 + 0 + 0)(3y - y - 4y) + (2 + y - 2)(-3 + 2y2 + 3) + 4y3 + y3 - 2y3. -116y*3 Expand (-m + 0m + 3m)(-1 - 1 + 0)(-16352 + 32697 - 20351). 16024m Expand (2 + 0 - 4)(-5 - 15167p + 15167p - 200p*3). 400p*3 + 10 Expand (2323 - 3763g - 2323 - g*2)(4g - 3g - 2g). g3 + 3763g2 Expand b5 + 3b5 + 4b*5 + (2b*3 - 7b*3 + 4b*3)(-1 + b*2 + 1) + 38b*5 - 118b*5 - 102b*5. -175b*5 Expand (2x - 3x + 3x + (-2x + 0x + 0x)(2 - 4 + 0) + (-9 + 11 + 8)(-10 + 11x + 10) + 0x - x - 2x)(-3x + x + 4x). 226x*2 Expand (-3100 + 17077 - 4265 - 3631 - 4153)(4b - 2b - 4b). -3856b Expand (-2r2 - 5r*2 + 5r*2)(-3 + 2 + 3) - 457 - 461 + 903r2 + 1925r*2 + 918. 2824r*2 Expand (1 + 3 + 5 - s)(3 + 4s - 3) + (s + 0s + 2s)(0s + 2s - 8s). -22s*2 + 36s Expand (3 - 17 + 0)(4g*4 - 6g*4 + 4g*4) + 68g*4 + 14 + 5 - 70g*4. -30g*4 + 19 Expand (-5 - 1 - 1)(0s + s - 2s)(7 + 0 - 4)(2s - 4s - s)(-2 - 84 + 5). 5103s*2 Expand (-6z - 3722 + 2219 + 1981)(-3z + 3z + z). -6z*2 + 478z Expand 133597 - 133598 + d*2 + 5d*3 + d - 3d*2 + (-2d + 2 - 2)(2d - 2d - 2d*2) + 2d - 2d + 2d*3. 11d*3 - 2d*2 + d - 1 Expand 0s*2 - 2s*2 + 3s*2 + (3 - 3 + s)(-4s + 0s + 3s) - 4s + 2s2 + 4s + 3s + 2484s*2 - 1243s*2 - 1244s*2 + 1 - 3s*2 + 5s*2 + 0s2. s2 + 3s + 1 Expand (-12 + 12 + 6k*3)(0 - 4 + 1)(-3 - 1 + 3)(0 + 0 + k) + (k + 4k - 2k)(394k - 394k - 7k*3). -3k*4 Expand (4y - 2y4 - 4y)(y - 10375 + 5419 + 5309). -2y*5 - 706y*4 Expand (-450k*2 + 325k - 654k + 329k - 497k2)(-4k2 - 3k*3 + 4k*2). 2841k*5 Expand (-61 - 59 + 1)(-4 - 2 + 4)(0 - 1 + 3)((a + 0a - 3a)(-2 + 0 + 1) - 2a + 0a + a + (-a + 2 - 2)(-3 - 3 + 4)). 1428a Expand -r4 - 61 + 140r*3 - 137r*3 + 63 + 75r*4 + 2r*4 - 43r*4 + (2r + 1 - 1)(4r3 + r3 - 3r3). 37r*4 + 3r*3 + 2 Expand (-25 + 25 + 9h*4)(-30 + 57 + 132). 1431h4 Expand (2 - 2 - q)(2 - 22340q + 22340q - 198q2) - 8q - 3q2 + 1 + 3q*3 + 8q. 201q3 - 3q*2 - 2q + 1 Expand (-4f + 4f + 3f)(574 + 249 - 1926 - 1546 - 1268). -11751f Expand (14c*2 - 9c + 9c)(55c3 + 18c*3 + 53c*3) + 0c5 - c5 - c*5. 1762c*5 Expand (-191 + 97 + 1759h*2 - 7624h*2 + 96)(2 - 3 - 1). 11730h2 - 4 Expand 3x*2 - 3x*2 + 3x*4 + 135x - 135x - 396x*4 + (0x - x*4 + 0x)(0 + 1 + 2). -396x*4 Expand (0f + f + 9565 - 9539)*(-22 + 22	{ "pile_set_name": "DM Mathematics" }
9 divide 3(-3 - f/9)? True Suppose 0 = -418c + 433c - 8250. Is c a multiple of 10? True Is ((-5320)/49)/(6/(-21)) a multiple of 38? True Let s(w) be the third derivative of -w4/4 + w3 - 5w*2. Does 10 divide s(-6)? False Is 15/45 - (-879)/9 a multiple of 13? False Let n(v) = v + 3. Let s be n(-5). Let i = s + 6. Is 28/12(i + -1) a multiple of 7? True Let p be (213759/(-49))/(-9) + 4/14. Let s = p - 219. Is s a multiple of 38? True Let m = 473 + -22. Is 41 a factor of m? True Let h be (-634)/(-14) + 3 + (-207)/63. Let f = h - -65. Is f a multiple of 55? True Is (-11462)/(-12) - 5/2107 a multiple of 67? False Let q(r) = -2r*2 + 84r - 4. Does 30 divide q(14)? True Let w(z) = 22z2 - 44z + 88. Is w(2) a multiple of 22? True Let z = -7 + 7. Suppose z = -q + 4q - 96. Is 10 a factor of q? False Let r be (-2)/((14/8)/(-7)). Let m be (57/2)/(4/r). Let f = m - 32. Is 8 a factor of f? False Let l(r) = -21r - 29r - 49r - 58r + 7. Is 32 a factor of l(-1)? False Suppose -4g + 31 - 11 = 0. Suppose 3a - 3 = -0a + 3r, 0 = -2a - 3r + 7. Suppose 3u + 2u + p = 61, ap - 57 = -gu. Is 12 a factor of u? False Let c(f) be the second derivative of f4/6 - 3f*3/2 - 4f*2 - 6f. Is 12 a factor of c(8)? True Suppose -4n + 8n = 0. Suppose 3f = -2q + 233, -q + nf + 149 = -5f. Suppose 2l + 2l = q. Does 11 divide l? False Let t = 5 - 3. Let y be 5 + 1/(-1) - t. Suppose 0a - ya = -102. Is 17 a factor of a? True Let l(v) = v + 2. Let h be l(7). Let u(r) = 2r - 5. Let d be u(h). Suppose -3j = -17 - d. Is j a multiple of 10? True Suppose x - 4 = -x - 5g, -3x - 11 = -g. Let s be x + 1 + (15 - -3). Suppose 2v - 18 = 2t + 86, -s = 4t. Is 24 a factor of v? True Suppose 10u = 3u. Suppose 2t - 2r - 192 = u, -5t = -r - 83 - 417. Is 11 a factor of t? False Let m be -115 - (6 - 4). Let g be m/6 - 1/(-2). Let a(h) = -h2 - 10h. Is a(g) a multiple of 3? True Suppose 4y = 4z - 2256, -3z - 314 = -4y - 2009. Is 42 a factor of z? False Let w(b) = 174b2 - 72b + 214. Is 34 a factor of w(3)? True Let i be ((-1)/2)/((-19)/(-494)). Is 34 a factor of i/((-78)/340)3? True Let j be (-1 - (-2)/(-3))(6 + 18). Is (-4)/(-10) + (-2584)/j a multiple of 13? True Let i = 1 - 5. Let s be (2/i)/1-44. Let x = s - 14. Does 2 divide x? True Suppose 2q = 0, 0 = -4w + 2q - 5q + 32. Is 7 - (w - 1 - 3) even? False Does 79 divide (470(-5)/10 - 2)-1? True Suppose -13860 = 31f - 43f. Does 35 divide f? True Is 5(-25)/5-97 a multiple of 66? False Suppose -a = -5d - 88 - 6, -558 = -5a + 3d. Let u = -62 + a. Does 47 divide u? False Let p be 3/(-6)(8 + -6). Let o(r) = 12r + 1. Let n be o(p). Let g(t) = -t*2 - 11t + 15. Is 3 a factor of g(n)? True Let l(s) be the first derivative of -9s2/2 - 3s + 2. Let c(h) = 3h. Let r be c(-1). Is l(r) a multiple of 24? True Does 3 divide (360/(-7))/(-9)21? True Let b = 13 + -11. Let w(c) = 2c - 1. Let i be w(b). Suppose -5v + iv + 44 = 0. Does 11 divide v? True Let y(k) be the first derivative of -k3/3 + 15k*2/2 + 26k - 15. Is y(13) a multiple of 13? True Is 5 a factor of 16/61287/78? False Suppose -4v + 1055 = -y, 259 = 3v - 2v - 5y. Suppose v - 54 = 5i. Does 14 divide i? True Let c be (-132)/(-60) + 2/(-10). Suppose -cs - 151 = -f + s, -2f + 2s + 302 = 0. Is 24 a factor of f? False Let v = 166 + 581. Is 3 a factor of v? True Suppose -2g + 30 = -20. Suppose -2u - 27 = -3o + 26, 5u - g = -3o. Is 2 a factor of o? False Let n(b) = b*3 - 13b*2 + 12b. Let s be n(12). Suppose s = -2p + p + 26. Let j = p + 18. Is j a multiple of 11? True Let v = -4 - -7. Suppose h + 5x - 4 = -1, 5h = -vx + 15. Suppose 2c - 74 = -a + 5a, 3c - 96 = ha. Is 9 a factor of c? True Let z be (-18)/27(-177)/2. Let l = z + -35. Is l a multiple of 14? False Let w(l) = -4l - 26. Suppose 15 = 16r - 17r. Is 22 a factor of w(r)? False Let h = -82 - -84. Suppose -5x = -10x + 155. Suppose x = n - h. Is 15 a factor of n? False Does 4 divide (88 - 55)(12 - -1)1? False Let l = -675 - -1067. Does 7 divide l? True Let u be (-46)/(-10) + 24/(-40). Suppose uj + t + 2t = 212, -2t + 216 = 4j. Is j a multiple of 8? True Let b be (1/2)/((-1)/8). Let a be b/10 + 4/10. Suppose an = -n + 16. Does 8 divide n? True Let h(t) = -7t*2 + 7t + 5t2 + 2t2 + t2 + 12. Does 15 divide h(-9)? True Let h = 1536 - 111. Is h a multiple of 11? False Let f be ((-8)/(-10))/(8/20). Let s(c) = 1 + 1 + 2c2 - cf - 2c. Does 3 divide s(3)? False Let n = 3700 + -1687. Does 69 divide n? False Let v be 13 - 1 - (0 + 2). Let z(j) = -j3 - j2 + j - 1. Let r(i) = -2i3 - 12i*2 - 8i - 8. Let n(x) = -r(x) + 3z(x). Is n(v) a multiple of 3? True Let d = -2 - -6. Suppose -du + 15 = -s, 3u + 8 = 5s - 2. Suppose -2l = -o - 3 - 11, 5o = -sl + 50. Does 2 divide l? True Suppose 0 = -0k - 2k + 6. Suppose 0 = -4n + kn + 132. Suppose -186 = -4a + 2w, -w + n = 4a - a. Does 22 divide a? False Suppose 4d - c - 2c + 93 = 0, -2c = 2d + 64. Let r = 2 - d. Does 11 divide r? False Let m(a) = -6a + 2. Let o be m(-3). Suppose 4w + 3t = -2t + 165, -w + 3t = -o. Suppose 0 = 5q + 10 - w. Does 2 divide q? False Suppose 4f - 36 = 5f. Is 11 a factor of ((-16)/(-3))/((-4)/f)? False Is 20 a factor of ((-80)/(-6))/((-4)/(-618))? True Suppose -t = -1 - 2. Suppose -68 = -4s - 4v, -4s = -tv + 4v - 83. Is 6 a factor of s? False Suppose 0p = -9p + 504. Is 22 a factor of p? False Suppose 4 = -0t + t. Suppose 2w - s = -3, w = 5w - ts + 8. Is ((-6)/10)/(w/15) a multiple of 9? True Does 3 divide (-10716)/(-54) - 8/18? True Let n be (-4)/(-2 - 2) - 1. Is ((-6)/24 - n)-60 even? False Let s(z) be the third derivative of -z5/60 + z4/2 + 2z3/3 + z2. Is s(7) a multiple of 3? True Let u(s) = 11s*2 + 2s - 3. Let w(c) = -c*2 - c - 1. Let l be w(-2). Let h be u(l). Suppose h = 4n + 26. Is 8 a factor of n? True Suppose 13 = 4u - v, -3v - 15 = -u - 3u. Suppose -2z = -5l + 11, 3l - u = 3z - 0. Does 2 divide l? False Suppose -4r = -32 + 12. Let n(d) = 6d2 + 2d - d*3 + 3d*3 + 18 - 3d*3 - 21. Does 16 divide n(r)? True Let o = 361 - 167. Is 42 a factor of o? False Suppose 5k - 3d - 50 = -d, -5k + d + 50 = 0. Suppose 4i - 2a + k = 0, 20 = -2a + 6a. Let o(h) = -2h + 15. Is 4 a factor of o(i)? False Let p(y) = 2y*2 + 17y + 3. Let l be 4 + -16 + 3/(-3). Is 12 a factor of p(l)? True Let d(f) = 31f2 - 3f + 4. Let w(u) = -7u - 31. Let h be w(-4). Is d(h) a multiple of 12? False Is 33 a factor of 1(-730)/(-4)8/4? False Let c be (-30)/2520/(-6). Suppose t - 50 = cx - 8, 3t + 4x = 158. Does 15 divide t? False Let y = 52 - 40. Does 7 divide 8/(-12) + 836/y? False Suppose -463 = -5q - 4n + 397, 688 = 4q + n. Does 3 divide q? False Let p(u) = u*2 - 13u + 17. Let s be p(12). Suppose 4h = b + 3b - 116, sb + 5h = 165. Is b even? False Let k be -310/18-3. Suppose 2s + 73 = -d, kd + 15 = -0d. Let o = -21 - s. Is 7 a factor of o? True Suppose 0 = -19t + 1665 + 8842. Does 7 divide t? True Suppose 2x = -2l - 10, -2x = -l + 6l + 25. Suppose s - 49 + 9 = x. Let z = -10 + s. Is z a multiple of 10? True Let m be (-5)/(-10) - (-6)/4. Let l be 42/12 - m/4. Suppose 5r - 59 = -3s + 67, ls = -2r + 54. Does 12 divide r? True Let m(v) = 8v2 - 3v + 2. Let b(c) = 31c2 - 13c + 8. Let a(u) = -2b(u) + 9m(u). Is a(-2) a multiple of 22? True Let w(h) = 608h2 - 13h + 5. Is 100 a factor of w(1)? True Suppose -3286 = -24b - 598. Is 11 a factor of b? False Let u be (-36)/24(0 + -2). Is 2/u-1(10 - 46) a multiple of 3? True Suppose 3v = -1 - 35. Is 15 a factor of v/(-48) + (-467)/(-4)? False Let i be 32/(-24) - 10/(-3). Suppose 0 = ir - 43 + 31. Is r a multiple of 2? True Let w = -8 + 8. Suppose w = -5o - 3k + 214, -4o - 2k + 152 = -20. Is 22 a factor of o? True Suppose -2835 = -38h + 33h. Does 63 divide h? True Suppose 0 = 9s + 8s - 5780. Does 17 divide s? True Let u = -224 - -310. Is u a multiple of 48? False Let r(p) = p*3 - 2p*2 - 18p + 29. Is r(8) a multiple of 27? False Let h(c) = -25c + 6. Let b(m) = m3 + 3m*2 - 5m - 6. Let p be b(-4). Is 15 a factor of h(p)? False Suppose -222p - 4549 = -3i - 224p, 5i + 2*p = 7587. Does 31 divide i? True Suppose 0	{ "pile_set_name": "DM Mathematics" }
22t2 + 4t. -4314 What is the third derivative of -119g3tv3 - 2g*3tv2 + 12g*3t + 3g2v*6 - 2tv + v2 wrt v? -714g*3t + 360g2v*3 Find the second derivative of 3l*4 - 120l*3 + 8l + 23. 36l2 - 720l Differentiate 5bd*2j*2 - 5bd + 9bj2 - 2j*2 + 7j wrt d. 10bdj2 - 5b Find the first derivative of -870k3 - 419 wrt k. -2610k*2 Differentiate -1441x*3 + 1953. -4323x*2 What is the derivative of -4v*3xz - 7v*3x + 81v3z - v*3 - z wrt x? -4v*3z - 7v3 Differentiate -393r + 992 with respect to r. -393 Find the third derivative of -2r4 - 142r*3 - 12r*2 wrt r. -48r - 852 Find the third derivative of 6i3l*3 + 5i*3 - 45i*2l*3 - 31i*2l*2 wrt l. 36i*3 - 270i*2 Find the second derivative of -10t*3 - 151t*2 + 1574t. -60t - 302 Find the third derivative of 5cs2z*2 + cs*2z + csz*4 + 5cz2 - c - 3s*2z*4 - 9s*2z*3 wrt z. 24csz - 72s2z - 54s2 What is the second derivative of -292v*2 - 931v wrt v? -584 Differentiate 159l + 263 with respect to l. 159 What is the third derivative of -30p*3r - 4p3t + 3p2r + 2p2t + 5prt + 3p wrt p? -180r - 24t What is the third derivative of 229o6 + 181o*2 - o? 27480o*3 Find the second derivative of 6n*2r*2 + 4n*2r + 27nr*2 - 2n + 2r wrt n. 12r*2 + 8r What is the derivative of 2q2 - 1652q - 10710 wrt q? 4q - 1652 Find the third derivative of 242f*4n + 6f4 - f3n + f*2 + 2fn - 344 wrt f. 5808fn + 144f - 6n Find the second derivative of 29p*5 - 13p*4 + 2p*2 + 2027p. 580p3 - 156p*2 + 4 What is the second derivative of af*3t + 35af*2t*2 - 21a - 5f3t2 - f3 - 4t wrt t? 70af2 - 10f*3 Find the second derivative of -3n*2u*2 - 1046n*2 - 4nu2 + 2u*2 + 209u wrt n. -6u2 - 2092 What is the second derivative of ls*2 + 732ls + 9s*4 - 364s*3 + s wrt s? 2l + 108s2 - 2184s Find the first derivative of 15n3 - 2n - 95. 45n2 - 2 What is the third derivative of -35r*3u*2 - 8r*2 - 9ru2 wrt r? -210u*2 Differentiate -12320qz3 + 2z*3 - 254z wrt q. -12320z3 What is the derivative of r2z - 18690r2 + 19474z4 wrt z? r2 + 77896z3 What is the derivative of 12nr3 + 3nr2 - 23nr - 2467r*3 wrt n? 12r*3 + 3r*2 - 23r What is the first derivative of 2ac*2 - 6acf - 166a + 23c*2f*2 + cf*3 wrt f? -6ac + 46c*2f + 3cf2 Find the first derivative of -g4 + 2g3h - 77gh - 23h + 4 wrt g. -4g*3 + 6g*2h - 77h Find the third derivative of -gw*3y - 54gw*3 + 4gw2y - 5gwy - 2w*3y wrt w. -6gy - 324g - 12y What is the third derivative of 2036t4 + 4452t*2? 48864t Find the third derivative of -s*4t*2 - 2362s*4t - s*2t - 2349st*2 wrt s. -24st2 - 56688st Find the second derivative of -2c*3 - 24c*2k*2 + 17c*2 - ck*2 + 17ck - 4k + 1 wrt c. -12c - 48k2 + 34 Differentiate -r3 + 49r - 592. -3r*2 + 49 What is the third derivative of 3p*5 + 267p*4 - 875p*2 + 2p? 180p2 + 6408p What is the third derivative of -2a4s*2 - 17a*3s2 - a3s - 134a*2s*2 + 2a*2s wrt a? -48as*2 - 102s*2 - 6s Differentiate -343j + 408. -343 What is the first derivative of -x3 - 144x - 40? -3x2 - 144 What is the first derivative of 2x*3 + 1561x*2z*3 + 4948z*3 wrt x? 6x*2 + 3122xz3 Find the first derivative of 7k*3m + 5628k3 - 300km wrt m. 7k*3 - 300k What is the third derivative of -20712o2t*3y - 9o2t*2 + 2o*2y + 290t2y wrt t? -124272o2y Differentiate 62cik - 8ci - 4ck - c + 2i wrt k. 62ci - 4c Find the second derivative of -1251i*3jn2 - 2i*3 - 2ijn*2 - ij - 2in*2 + 2in + 41j wrt i. -7506ijn2 - 12i Find the third derivative of -15b3 - 291b2 wrt b. -90 What is the second derivative of b3 + 52b2 - 5b - 20? 6b + 104 What is the third derivative of 217j*4 - 31j*3 + 16j*2 + 2j + 107 wrt j? 5208j - 186 Differentiate 2k*3l2 - k3 + 103k2l*3 - 32 wrt l. 4k*3l + 309k2l*2 What is the derivative of 260q*4 - 84 wrt q? 1040q*3 What is the second derivative of 15dr4 + 2dr3 - 10dr + 3r*4 + 4r wrt r? 180dr*2 + 12dr + 36r*2 What is the third derivative of 2a*3z*4 + 28a*3z*3 - 10a*3z - 4az*3 + 10z*2 wrt z? 48a*3z + 168a3 - 24a Find the third derivative of 262a4 - 299a*2. 6288a Find the first derivative of 18q3 - 17qs + 182s wrt q. 54q2 - 17s What is the second derivative of 8i3z*3 - 5i*2z*3 + 2iz3 + 2iz2 + 1 wrt i? 48iz3 - 10z*3 Find the third derivative of -301n*6 - 246n*2. -36120n*3 Differentiate 321b - 214 with respect to b. 321 Find the first derivative of 2l3z*3 + 2l*2z*3 + 301lz - 3109z*3 wrt l. 6l*2z*3 + 4lz3 + 301z Differentiate 3j3t - 2j2 - 23jt2 - 283t*2 with respect to j. 9j*2t - 4j - 23t*2 Find the third derivative of -45s*4 + 16s*3 + 1228s*2 wrt s. -1080s + 96 Differentiate -34o4 + o + 85 with respect to o. -136o*3 + 1 Find the second derivative of 9n*4 - 71n*2 + 218n wrt n. 108n2 - 142 What is the third derivative of -431j*6u*3 - 3j*6 + 1351j*2 + 3ju3 wrt j? -51720j*3u*3 - 360j*3 What is the derivative of -174h*3l - 7h3 - 11h wrt l? -174h3 What is the second derivative of 1978i*3r*2 + 3i*3r - 289ir*2 + 22r*2 wrt i? 11868ir2 + 18ir Find the second derivative of -h5j*2t + 189h2t - 13h + 5j*2 + 2t wrt h. -20h3j*2t + 378t What is the third derivative of -8d*5l - d*4l + 2d3l*2 + 2d*2l - 51dl*2 wrt d? -480d*2l - 24dl + 12l2 What is the third derivative of 39j*3yz2 - 2j*3y + 3j3z - 2j2yz2 + 15jz2 - 2yz wrt j? 234yz2 - 12y + 18z Find the second derivative of 13f*3r*2 + 1322f*3 + fr + 21r2 wrt r. 26f*3 + 42 Find the second derivative of 4366m*2 - 3307m. 8732 Find the second derivative of 2n3t*2 - 961n*3t - nt - 1072t*4 wrt t. 4n*3 - 12864t*2 What is the third derivative of 4921v6 - v2 - 3v + 899? 590520v*3 Find the second derivative of -803w*2 - 16w. -1606 What is the third derivative of -2fi*3 - 537fi + 381i5 + i3 - 2i2 wrt i? -12f + 22860i2 + 6 What is the first derivative of -4180f*2z + 3f2 - 12f + 8 wrt z? -4180f2 Find the third derivative of 4in3r*2x + 31in*3x*2 - 51in2r*3 + inr2x*2 - 14n*3r*3x*2 - nr2 + r2 wrt r. -306in*2 - 84n*3x*2 Find the first derivative of 3429u*3 - u - 15101 wrt u. 10287u*2 - 1 What is the derivative of -903n*3 + 317? -2709n*2 What is the second derivative of -3248w*3 + 2w*2 - 90w - 24? -19488w + 4 Find the second derivative of g3m*2 + 61g*3 - 6g - 11m2 wrt g. 6gm2 + 366g What is the third derivative of -2n4 + 72n*3x*3 + 61n*2 + 3x*3 wrt n? -48n + 432x3 What is the second derivative of 2j*2m*2u + 76j2m*2 + 2j*2 - jm*2u - 6jmu - 3m wrt m? 4j2u + 152j2 - 2ju Find the second derivative of 8362b*3 - 2b + 936 wrt b. 50172b Differentiate 4j*2 - 110j + 5403. 8j - 110 Find the second derivative of -10c*4 - 165c wrt c. -120c2 Find the second derivative of 2gk2o*2 + 2gk2o - 7gk*2p + 2gko2 + 2gkop - 298ko2p wrt k. 4go*2 + 4go - 14gp What is the second derivative of 125dh2v + 2dh - 4dv + 5h2v - 14h wrt h? 250dv + 10v What is the first derivative of -37h2j*4 + 2433h*2 - 204hj wrt j? -148h*2j*3 - 204h What is the derivative of -192s2t + 52s2 wrt t? -192s*2 Find the third derivative of 1621j*4 + 3j*2 + 137 wrt j. 38904j Differentiate -3m2t*2 + 556m*2 - 2t*3 + 28t with respect to t. -6m2t - 6t2 + 28 Differentiate 645a*2ly2 + 41a*2l + aly*2 - 3al + 14l wrt y. 1290a2ly + 2aly Find the second derivative of v*3x - 439v2x + 2234vx wrt v. 6vx - 878x Differentiate -752a*3k*2 - 2a*3 - 493k*2 + 2 wrt a. -2256a*2k*2 - 6a**2 What is the t	{ "pile_set_name": "DM Mathematics" }
3441896g/13 + 181440/13 = 0. -648, -35, 2/13, 1/6 Factor -5x*3 - 1296730x*2 - 84094882220x - 2521679544600. -5(x + 30)(x + 129658)2 Factor -b4/4 + 23055b3/2 + 588336b*2 + 20008337b/2 + 226788993/4. -(b - 46161)(b + 17)3/4 Factor -3o*3 + 31400874o*2 - 82167813127620o - 493008009197832. -3(o - 5233482)2(o + 6) Determine r so that -r*2/8 - 1487r/4 + 182007 = 0. -3402, 428 Factor 5x2 + 3120x + 12400. 5(x + 4)(x + 620) Factor 3g2 - 129240g - 2974107. 3(g - 43103)(g + 23) Determine u, given that u*4 + 20005u*3 - 20018u*2 - 240072u = 0. -20006, -3, 0, 4 Let -15z4/7 + 44799z*3/7 - 33423378z*2/7 - 13376520z/7 = 0. What is z? -2/5, 0, 1460, 1527 Factor 4u3 - 1851648u*2 - 5554980u. 4u(u - 462915)(u + 3) Factor -2l*2/5 + 25291856l/5 - 79959747490592/5. -2(l - 6322964)2/5 What is f in 2f*4 + 326f*3 + 8180f*2 - 8688f - 1077120 = 0? -132, -24, -17, 10 Factor -399v2/5 - 14859v/5 + 36048/5. -3(7v - 16)(19v + 751)/5 Factor -x*4 - 4062x*3 + 28467x*2 - 65092x + 48828. -(x - 3)(x - 2)2(x + 4069) Find t, given that 3t5 - 15057t*4 - 60279t*3 + 15021t*2 + 241068t + 180828 = 0. -3, -2, -1, 2, 5023 Factor -2l3 + 31632l*2 + 379818l + 854712. -2(l - 15828)(l + 3)(l + 9) Factor -i2 + 16634i - 8145145. -(i - 16129)(i - 505) Let -3d*5 - 387d*4/5 - 369d*3 + 3099d*2 + 25020d + 179172/5 = 0. What is d? -79/5, -9, -6, -2, 7 Factor -8i2 - 26064982i + 6516246. -2(i + 3258123)(4i - 1) Determine t so that 804t*4 + 557968t*3 + 2165248t*2 - 33307200t + 331200 = 0. -690, -10, 2/201, 6 Factor w*2 + 11781396w + 34700322927204. (w + 5890698)*2 Find j, given that 5j*4/2 + 72855j*3/2 - 5100565j*2 + 164228400j + 953208000 = 0. -14710, -5, 72 Find v, given that -3v2/8 + 4125684v - 11347512311904 = 0. 5500912 Factor 4p3/3 + 12841732p*2/3 + 3435628822784p + 3435624542208. 4(p + 1)(p + 1605216)*2/3 Find x such that -25x*3/11 + 17437x*2/11 - 444514x/11 + 19032 = 0. 12/25, 26, 671 Factor 18r3 + 568506705r*2 + 4488887086373844r - 748147863520827. 3(r + 15791853)2(6r - 1) Factor -720478416100d*2 - 380266880d - 50176. -4(424405d + 112)2 Factor b3/2 - 3208331b2/2 + 2573188131655b/2 + 254777070856275/2. (b - 1604215)*2(b + 99)/2 Determine w, given that 3w2/2 + 3999w - 2503701/2 = 0. -2949, 283 Find f, given that 73167f5 - 48416370f*4 + 836066868f*3 - 588512442f*2 + 140694141f - 11265492 = 0. 7/29, 17, 644 Suppose 2n2/9 + 16661158n/9 - 33322324/9 = 0. Calculate n. -8330581, 2 Determine r, given that -r*2 - 15072914r - 56798184112849 = 0. -7536457 Let 2x4 - 22540x*3 + 90134x*2 - 67596x = 0. Calculate x. 0, 1, 3, 11266 Determine g so that -g*2/4 + 2892g + 4849065/4 = 0. -405, 11973 Suppose -r*3/2 - 2579r*2/2 + 5161r/2 - 2581/2 = 0. Calculate r. -2581, 1 Let 4b3 - 163760b*2 - 8851788b - 119538504 = 0. Calculate b. -27, 40994 Determine m, given that 2m5/7 + 1198m*4/7 - 91082m*3/7 + 1720466m*2/7 - 403920m - 4640184/7 = 0. -669, -1, 3, 34 Factor -3y2 - 684027828y - 38991172456533132. -3(y + 114004638)2 Let -5d*4/3 - 5560d*3/3 - 1815d*2 + 122410d/3 + 222200/3 = 0. Calculate d. -1111, -4, -2, 5 Determine h so that -84h5 - 3844h*4 + 125312h*3 - 854800h*2 + 1915008h - 933120 = 0. -486/7, 2/3, 4, 15 What is f in -2f5/11 - 9384f*4/11 - 74554f*3/11 + 1825068f*2/11 - 720288f + 10117440/11 = 0? -4684, -20, 3, 6 Factor b*2 - 19888b - 27005264. (b - 21164)(b + 1276) What is z in -2z*2/19 + 5509028z/19 = 0? 0, 2754514 Factor -3x2/2 - 4599x - 6980955/2. -3(x + 1381)(x + 1685)/2 Suppose g*2/3 + 537g - 40900/3 = 0. What is g? -1636, 25 Determine f so that f*2/2 + 9773f/2 - 1987062 = 0. -10164, 391 Determine l so that -4l2/5 - 293632l/5 - 1761072 = 0. -73378, -30 Determine k so that -24k5 - 2631k*4 + 69702k*3 - 155175k*2 + 111888k - 23760 = 0. -132, 3/8, 1, 20 Solve -20g4 + 16305g*3 - 2319955g*2 - 8946630g + 2381400 = 0. -4, 1/4, 189, 630 Let -f*2 + 71185f + 569544 = 0. Calculate f. -8, 71193 Suppose -s*3/4 - 1219s*2/4 - 8069s - 27416 = 0. What is s? -1192, -23, -4 Solve -27q5 - 1737q*4 - 20361q*3 - 50763q*2 - 10452q + 9900 = 0. -50, -11, -3, -2/3, 1/3 Determine b, given that 2b4/9 - 29578b*3/3 + 147854b*2 - 5588450b/9 + 482944 = 0. 1, 7, 44352 Let -2n5/13 + 450n*4/13 - 26812n*3/13 + 165884n*2/13 + 26814n/13 - 166334/13 = 0. What is n? -1, 1, 7, 109 Find z, given that 3z2 - 12060645z + 48242532 = 0. 4, 4020211 Find n, given that 3n2 - 522516333n = 0. 0, 174172111 Find v such that -22v5 + 3356v*4 + 104502v*3 - 57996v*2 = 0. -27, 0, 6/11, 179 Solve 3z*5 - 2537z*4 - 184979z*3 + 505377z*2 - 445684z + 127820 = 0. -70, 2/3, 1, 913 Solve 2x5/17 + 694x*4/17 - 2216x*3/17 - 40288x*2/17 + 110208x/17 + 352800/17 = 0 for x. -350, -7, -2, 6 Let 5f5 + 112190f*4 - 3368820f*3 + 31002070f*2 - 84701825f + 56956380 = 0. Calculate f. -22468, 1, 3, 13 Suppose -c*4/6 - 8467487c*3/6 - 3983240423760c*2 - 3747557398872411648c + 3747561382114246656 = 0. Calculate c. -2822496, 1 Let -7g5/5 - 352g*4/5 + 354569g*3/5 + 37312382g*2/5 - 26933632g/5 - 2146592 = 0. What is g? -148, -2/7, 1, 245 Let 946596y4 + 7257242y*3 + 12621326y*2 - 5048432y - 32 = 0. What is y? -4, -1/157766, 1/3 Suppose -d*5/4 + 85d*4 + 21023d*3/4 + 49643d*2/2 + 38957d + 19306 = 0. What is d? -49, -2, -1, 394 Determine f, given that -2f5/13 + 2412f*4/13 - 59336f*3/13 + 337164f*2/13 + 716842f/13 - 6944280/13 = 0. -4, 7, 15, 1181 Find f, given that -2f4 + 712922f*3 - 63543983772f*2 + 2096150929432f + 2159695626128 = 0. -1, 34, 178214 Factor t*3/7 + 92723t*2 + 105328807207t/7 + 2843404648803/7. (t + 27)(t + 324517)2/7 Find h, given that -h5/8 + 8273h*4/4 + 74489h*3/4 + 70361h*2/2 - 148977h/8 - 148995/4 = 0. -6, -3, -1, 1, 16555 Find d such that -684d2 + 31400d + 2944 = 0. -16/171, 46 Factor -h*3/4 - 6238h*2 - 39271925h - 4471994996. -(h + 116)(h + 12418)2/4 Suppose 5j*4/3 - 566j*3/3 + 12676j*2/3 - 59290j/3 + 15725 = 0. Calculate j. 1, 5, 111/5, 85 Let 3g5 - 3213g*4 - 601719g*3 + 3063069g*2 - 4929072g + 2470932 = 0. What is g? -167, 1, 2, 1233 Factor 3w4/4 - 3645w*3/4 + 208656w*2 + 43690752w. 3w(w - 672)*2(w + 129)/4 Determine l, given that -12l2 + 198764732l + 198764744 = 0. -1, 49691186/3 What is f in -4f5 + 1232f*4 + 797596f*3 + 8671768f*2 + 31410048f + 37618560 = 0? -311, -4, -3, 630 Factor 4b2 + 11816864b - 94535168. 4(b - 8)(b + 2954224) Suppose 3u2/5 - 456273u/5 + 122520354/5 = 0. What is u? 269, 151822 Determine a so that 2a2/5 + 792a/5 - 6811064/5 = 0. -2054, 1658 Suppose -5k3 - 1037520k*2 + 20k + 4150080 = 0. What is k? -207504, -2, 2 Find g, given that 3g3 - 61495902g*2 - 122991813g - 61495908 = 0. -1, 20498636 Determine p so that -3p4/2 + 5643p*3/2 - 539937p*2/2 + 1062957p/2 - 264330 = 0. 1, 99, 1780 Find r, given that -2r2/17 + 3530r/17 - 1118628/17 = 0. 414, 1351 Factor h*5/2 - 367317h*4/2 - 734637h*3/2 - 367319h2/2. h2(h - 367319)(h + 1)2/2 Factor -g2/9 - 1049773g/9 + 2099558/3. -(g - 6)(g + 1049779)/9 Factor -y*3/4 - 11167y*2/4 + 178865y/4 - 704529/4. -(y - 9)(y - 7)(y + 11183)/4 Factor -4m2 + 1131462m - 1697184. -2(m - 282864)(2m - 3) What is k in -3k*4 - 340k*3 - 5673k*2 = 0? -93, -61/3, 0 Determine g, given that -4g*3 - 879g*2 + 981607g + 736698 = 0. -617, -3/4, 398 Solve u*3/4 + 84094u*2 = 0 for u. -336376, 0 Factor 4y*4 - 150016y*3 + 1537522912y*2 - 2456003745792y + 1072118717914176. 4(y - 17834)2(y - 918)*2 Let -10x*4 - 765x*3 + 990x*2 + 166685x + 604500 = 0. Calculate x. -75, -13, -4, 31/2 Determine f, given that -2f2/7 + 968134f + 60992604/7 = 0. -9, 3388478 Solve -73y2/4 - 80153y/8 + 549/8 = 0 for y. -549, 1/146 Find t such that -45t5 - 1565t*4 - 9660t*3 + 34860t*2 + 30160t - 96000 = 0. -25, -12, -16/9, 2 Factor -b*4/2 + 2010738b*3 - 2021537673794b*2 + 8086126566336b - 8086118523392. -(b - 2010736)*2(b - 2)*2/2 Let -3c**2/	{ "pile_set_name": "DM Mathematics" }
letters picked without replacement from {k: 4, o: 3, t: 4, j: 3}? 18/1001 What is prob of picking 1 f and 1 c when two letters picked without replacement from ccobcofcfsccobf? 6/35 What is prob of picking 2 z and 2 l when four letters picked without replacement from zzllzzlz? 3/7 Three letters picked without replacement from {u: 3, o: 4, x: 1, g: 2, z: 2}. What is prob of picking 1 x, 1 o, and 1 g? 2/55 What is prob of picking 1 i and 1 w when two letters picked without replacement from {r: 3, i: 6, w: 4}? 4/13 Three letters picked without replacement from {g: 2, s: 1, v: 1, m: 1}. Give prob of picking 2 g and 1 m. 1/10 What is prob of picking 2 c when two letters picked without replacement from {b: 3, a: 4, p: 2, c: 8}? 7/34 Calculate prob of picking 2 c when two letters picked without replacement from {c: 17, f: 3}. 68/95 What is prob of picking 1 t and 1 d when two letters picked without replacement from {c: 5, t: 4, d: 1, i: 2, o: 2}? 4/91 What is prob of picking 1 g and 1 h when two letters picked without replacement from {d: 1, o: 1, h: 4, r: 3, g: 1, m: 5}? 4/105 Two letters picked without replacement from {h: 7, a: 1, f: 3, m: 7, x: 1}. Give prob of picking 2 m. 7/57 Calculate prob of picking 1 c and 2 j when three letters picked without replacement from ccjjccjccj. 3/10 Three letters picked without replacement from {a: 1, f: 12}. What is prob of picking 3 f? 10/13 Three letters picked without replacement from ccrccccccrrccccc. What is prob of picking 1 r and 2 c? 117/280 What is prob of picking 1 h and 1 b when two letters picked without replacement from {t: 1, w: 1, h: 1, z: 1, b: 1}? 1/10 Four letters picked without replacement from {a: 7, b: 2, w: 1, o: 4}. Give prob of picking 3 a and 1 o. 20/143 Calculate prob of picking 1 e and 2 m when three letters picked without replacement from mmvvvmuvvmvmmevm. 3/80 Three letters picked without replacement from {o: 5, l: 2, n: 2, j: 2, c: 5, k: 1}. What is prob of picking 2 c and 1 n? 1/34 Four letters picked without replacement from aryayaaayaabaaaababb. Give prob of picking 1 r and 3 b. 4/4845 What is prob of picking 1 g, 1 c, and 1 w when three letters picked without replacement from {c: 1, h: 2, w: 1, q: 2, g: 2, l: 1}? 1/42 What is prob of picking 3 e when three letters picked without replacement from {y: 1, e: 3}? 1/4 Two letters picked without replacement from {a: 3, k: 6, j: 6, q: 3}. What is prob of picking 1 j and 1 k? 4/17 Three letters picked without replacement from qxqxfsrsqufrfusq. What is prob of picking 2 r and 1 f? 3/560 Two letters picked without replacement from xxxxxxxoxozxxxooxoxz. What is prob of picking 1 z and 1 x? 13/95 Calculate prob of picking 2 s and 2 h when four letters picked without replacement from {s: 14, h: 4}. 91/510 Three letters picked without replacement from {x: 4, h: 4, s: 3, p: 9}. Give prob of picking 1 h, 1 s, and 1 p. 9/95 What is prob of picking 1 t, 1 u, and 2 h when four letters picked without replacement from udhustsdhdddhhuhh? 9/476 What is prob of picking 1 l, 1 r, 1 n, and 1 k when four letters picked without replacement from {k: 7, r: 2, n: 1, l: 9}? 21/646 Two letters picked without replacement from {o: 3, f: 4, y: 3, u: 2, j: 4}. What is prob of picking 1 u and 1 f? 1/15 Two letters picked without replacement from {j: 5, f: 2, z: 1, e: 1, p: 1}. What is prob of picking 1 j and 1 z? 1/9 Two letters picked without replacement from {n: 2, s: 1, y: 4, h: 2, c: 3}. Give prob of picking 2 c. 1/22 Four letters picked without replacement from tpppppppttt. Give prob of picking 3 p and 1 t. 14/33 Two letters picked without replacement from reffxellu. Give prob of picking 1 x and 1 u. 1/36 Two letters picked without replacement from {b: 1, u: 4, l: 1, o: 1, r: 2, v: 3}. Give prob of picking 2 v. 1/22 Three letters picked without replacement from nhhuhhhnhunohuhoh. What is prob of picking 2 u and 1 o? 3/340 Three letters picked without replacement from {a: 1, y: 1, r: 2, s: 2, q: 1, o: 2}. What is prob of picking 1 q, 1 a, and 1 s? 1/42 Three letters picked without replacement from {e: 1, j: 6, l: 5, r: 1, z: 2, v: 2}. What is prob of picking 1 z and 2 l? 1/34 Two letters picked without replacement from {h: 2, x: 1, y: 4}. Give prob of picking 2 y. 2/7 Four letters picked without replacement from pggpgupbuggs. Give prob of picking 3 g and 1 b. 2/99 What is prob of picking 1 s and 3 c when four letters picked without replacement from {c: 17, s: 1}? 2/9 Two letters picked without replacement from kbkkkkkkkkkakkkkkkk. Give prob of picking 1 k and 1 a. 17/171 Four letters picked without replacement from nynnynn. What is prob of picking 1 y and 3 n? 4/7 Two letters picked without replacement from {d: 11, x: 1, i: 7}. Give prob of picking 2 d. 55/171 Calculate prob of picking 2 u, 1 d, and 1 k when four letters picked without replacement from {d: 1, c: 3, k: 1, u: 5, e: 3}. 2/143 What is prob of picking 2 l when two letters picked without replacement from eelldldelxldlxll? 7/30 What is prob of picking 2 a when two letters picked without replacement from {m: 1, a: 2, d: 5, s: 2, r: 1, u: 4}? 1/105 Calculate prob of picking 3 y when three letters picked without replacement from jjjyjyjyjjyjyjjjyj. 5/204 Calculate prob of picking 4 u when four letters picked without replacement from {u: 10}. 1 What is prob of picking 2 x and 1 d when three letters picked without replacement from {d: 1, r: 4, x: 3}? 3/56 Four letters picked without replacement from jgkvigjjkjgjigujg. What is prob of picking 2 j and 2 k? 3/476 Calculate prob of picking 2 t when two letters picked without replacement from {t: 4, v: 7}. 6/55 What is prob of picking 1 v, 1 d, and 1 i when three letters picked without replacement from {i: 5, v: 3, d: 8}? 3/14 What is prob of picking 4 e when four letters picked without replacement from eeeee? 1 Two letters picked without replacement from {g: 2, m: 1, q: 4}. What is prob of picking 2 g? 1/21 Two letters picked without replacement from nnznznznnnnnnrznnrrr. What is prob of picking 1 n and 1 z? 24/95 What is prob of picking 1 u and 1 q when two letters picked without replacement from vuvvuvvqqvuvuvu? 2/21 Calculate prob of picking 1 u and 1 q when two letters picked without replacement from {k: 3, q: 3, u: 12, b: 2}. 18/95 Calculate prob of picking 2 g when two letters picked without replacement from grg. 1/3 Four letters picked without replacement from {j: 1, l: 5, m: 10, c: 2, e: 2}. What is prob of picking 1 c, 1 m, 1 l, and 1 j? 20/969 Two letters picked without replacement from xxkxxxxxxxxxxxxxxxx. Give prob of picking 1 k and 1 x. 2/19 What is prob of picking 1 l and 1 q when two letters picked without replacement from cxxxxlxxxxxcxxq? 1/105 Three letters picked without replacement from rrrrrrrrgrgr. What is prob of picking 1 g and 2 r? 9/22 Two letters picked without replacement from wkkwkkcel. What is prob of picking 1 c and 1 l? 1/36 Four letters picked without replacement from {v: 2, h: 3, o: 2, k: 5}. Give prob of picking 1 v, 1 h, and 2 o. 2/165 Calculate prob of picking 3 c when three letters picked without replacement from {i: 1, c: 14}. 4/5 Three letters picked without replacement from llllqllqllql. Give prob of picking 1 l and 2 q. 27/220 Four letters picked without replacement from ffggg. Give prob of picking 2 g and 2 f. 3/5 Three letters picked without replacement from grgzzzzzmzgzim. Give prob of picking 3 z. 5/52 What is prob of picking 1 o and 3 r when four letters picked without replacement from {r: 4, o: 6, i: 2, t: 2, b: 2, f: 1}? 6/595 What is prob of picking 2 q when two letters picked without replacement from {o: 9, q: 9}? 4/17 Three letters picked without replacement from {s: 1, u: 2, i: 2, l: 1, j: 1, h: 1}. What is prob of picking 1 u, 1 s, and 1 l? 1/28 Calculate prob of picking 3 i and 1 y when four letters picked without replacement from {g: 7, y: 4, i: 4}. 16/1365 Three letters picked without replacement from {z: 1, a: 3, b: 3}. What is prob of picking 3 b? 1/35 What is prob of picking 1 j and 2 t when three letters picked without replacement from {t: 3, j: 1}? 3/4 Three letters picked without replacement from {i: 9, f: 2}. What is prob of picking 2 f and 1 i? 3/55 Two letters picked without replacement from	{ "pile_set_name": "DM Mathematics" }
gc + 10 = -0c for c. -2 Let s = 16 - 12. Suppose -sn = 3q + n, -5q = -3n. Let v = -25 - -27. Solve o - v = -q for o. 2 Let i(o) = o*3 + 2o*2 - 4o + 12. Let h be i(0). Solve -6 + h = 2k for k. 3 Let k be (-7 + (-200)/(-24))6. Solve -9d + k = -d for d. 1 Suppose -l + 5 = z, -l + 6 = -2z + 31. Let v be (-22)/(-10) + z/(-50). Suppose -3a - 3 = -2s + 2a, 5a - 33 = -vs. Solve 7 = 4x - s for x. 4 Let k(u) = -8u - 23. Suppose 3d = -10c + 6c - 31, -5c - 10 = -2d. Let o be k(c). Solve -o = -m - 2m for m. 3 Let h(m) = -m2 + 8m - 9. Let c(q) = -q*2 + 8q - 8. Let g(z) = -6c(z) + 7h(z). Let x be g(6). Let s be 2 - (6/x - -3). Solve s = b + 4 for b. -3 Let k(g) = g*3 + 19g*2 + 19g + 18. Let n(w) = 2w2 + 25w - 6. Let j be n(-12). Let f be k(j). Solve -5x = -fx for x. 0 Let z = 81 - 78. Suppose -5l - 4c - 2 = -7c, -l + 4c - 14 = 0. Solve -zr = -lr + 3 for r. -3 Let a be (16/(-10))/(70/(-525)). Solve -a = 3v + v for v. -3 Suppose g + 5k = -6, -4g + 2g + 4k = -2. Let y be g/3 + 16/3. Suppose -3z - f + 26 = 0, 2z + 3 - 9 = yf. Solve z = -3r + 5r for r. 4 Let k(f) be the second derivative of -f4/12 + f3/3 + 14f. Let a be k(2). Solve -4l - 10 - 10 = a for l. -5 Let l = -20 - -23. Suppose lm - m = -66. Let p = 48 + m. Solve 3t = 8t + p for t. -3 Suppose 0 = -3r + r - n + 13, 2n - 21 = -3r. Let h be (-5)/(0 - r) + 0. Suppose 2l - 4s - 8 = 0, -4l - l - 3s = -20. Solve -a = h + l for a. -5 Let w be 1/(2/10 + 0). Suppose 61x - 50x = -1859. Let d = x + 174. Solve -dh + 10 = -w for h. 3 Suppose -112 - 96 = -26d. Solve -db + 4b = -4 for b. 1 Let d(q) = q*3 + 3q*2 - 5q + 1. Let g be d(-4). Suppose f + 1 = g. Suppose -54 = 13a - 19a. Solve -fy = -ay - 20 for y. -4 Suppose 0 = -59d + 54d. Solve 0w + 3w + 12 = d for w. -4 Let b(y) = y - 28. Let j be b(36). Solve -ji - 47 = -15 for i. -4 Let q = -21 - -27. Let p = 10 - q. Solve 0 = pj - 9j + 15 for j. 3 Let k(o) = o + 10. Suppose 3d = -15 - 3. Let q be k(d). Solve -i - q = 3i for i. -1 Suppose -5z + 3a + 23 = 0, -z + 8 = -5a - 1. Suppose 6 = -zl + 5l. Suppose -8 = 2q - lq. Solve -3x = qx for x. 0 Suppose -3u + 3 = -9. Let l(d) = d3 + 2d*2 - 1. Let i be l(-1). Solve i = ub + 3 - 11 for b. 2 Suppose -9 + 117 = 36p. Solve -p = 11m - 10m for m. -3 Let y(s) = 5s - 2. Let z(u) = 4u - 2. Let d(p) = 3y(p) - 4z(p). Let a be d(-2). Solve w = aw for w. 0 Suppose -43i + 328 = -2i. Solve -m + i = m for m. 4 Suppose 3c + 2z + 2z - 79 = 0, c - 5z = 20. Let f = c - 23. Solve 0n - fn = 4 for n. -2 Suppose j + 52 = 7l - 4l, 0 = -2l + j + 36. Solve 7q + l = 2 for q. -2 Let t be ((-320)/(-24)6/4)/1. Solve l - 11l = -t for l. 2 Let i be (-3 + (-33)/(-1))(-1)/(-2). Suppose -i = -11f + 6f. Solve 3g - 2g = -f for g. -3 Let u be ((-24)/7)/(((-143)/(-91))/(-11)). Solve 15p = 21p + u for p. -4 Suppose -11 - 6 = -2t + 5r, 0 = 4t - 4r - 40. Solve -4 = -15w + tw for w. 1 Suppose 10 = 5r - 5j, -16 + 5 = -2r - 5j. Let u be r + -4 - -1 - -2. Solve 0 = -ub + 2 for b. 1 Suppose -9o - 31o = -80. Solve -oc - 3c + 20 = 0 for c. 4 Let s be (-6)/(-91/(-6)). Let o(z) = -z3 - 4z*2 - z. Let n be o(s). Solve -nb + 11 = 3 for b. 2 Let j = -30 - -30. Suppose -h - 25 = 5u, 3h - h + 3u + 22 = j. Let s be h + 3 - (-12)/3. Solve 3 + 1 = -sl for l. -2 Let u = 17 + -17. Let x be ((-77)/(-14) + -6)/((-2)/12). Solve uc + x = c for c. 3 Let n(v) = 36v*2 + 11v + 11. Let p be n(-1). Solve 12 = -6l + p for l. 4 Let z(f) = -3f - 12. Let v = -36 - -30. Let p be z(v). Suppose 3g + 0 = p. Solve 0 = -5d + gd for d. 0 Suppose 0 = -o + 4, 107o - 103o = -4g + 32. Solve 24 = -gy + 4 for y. -5 Let d(j) = j2 + 12j - 41. Let g(a) = -3a2 + 2a + 1. Let x be g(-2). Let i be d(x). Solve -k = k - i for k. 2 Suppose 2y = 7y - 10. Suppose yz - 28 = -5z. Solve -3b + z = b for b. 1 Suppose -4c - 14q = -13q - 31, -q - 4 = -c. Solve 0 = -2w + cw + 7w for w. 0 Let f(o) = -o2 - 39o + 2. Let v be f(-39). Suppose 5s + 6 = 3j - 0, 2s - 4 = -2j. Suppose 12 = 3b - jb. Solve vy + b = 6y for y. 3 Let d(n) = -n*2 - 3n - 2. Let r be d(-4). Let w be r(-2 + 32/12). Let x be (-112)/(-24) - w/(-6). Solve x + 8 = -4u for u. -3 Suppose -v + 3u + 5 = -12, 5v + 4u - 9 = 0. Suppose -vw = -9w. Solve -6 = -2o - wo for o. 3 Let l(p) = -21 - 896p + 893p + 8. Let j be l(-5). Solve 2d + jd - 20 = 0 for d. 5 Let h(m) = -m2 + 4m + 2. Let r = 0 + 3. Let v be h(r). Let z be (-1)/(-7)70/208. Solve -3y - z = -vy for y. 2 Let m = -434 + 437. Solve -my - y = 0 for y. 0 Suppose -2z + 3 = z. Let n be 9/124z. Let r be 1 - (-20)/6 - 2/6. Solve 11 = -nd - r for d. -5 Suppose 0 = -6a + a - 120. Let w = 26 + a. Solve -wz = z for z. 0 Let s be (34/153)/(11/495). Solve s = -8q + 42 for q. 4 Suppose 0 = -2d + 6d. Solve -5v - 5 = -dv for v. -1 Suppose 2w - 18 = o - 5, -w + 3o + 9 = 0. Suppose b - w = -p, -b - 5p + 25 = 11. Solve -bt = -9t + 20 for t. 4 Let j = 7 - 7. Let q be (-517)/(-165) + 7 - (-4)/(-30). Solve ju = 2u - q for u. 5 Let x = 44 + -44. Let q be x/(-1 - 0 - 0). Solve qm = -3m - 15 for m. -5 Suppose 0 = 2i + 4l - 16, i - 2l - 3 = l. Suppose -5s + 44 + 1 = 5z, -i = 3z. Suppose -4k - 5b = s, -k - b - 4b = 14. Solve 0 = f - 2 - k for f. 3 Suppose 111 = 4v - 5y, -2v + 2y + 42 = 4y. Suppose -3j - v = -7j. Solve -ju = -3u - 9 for u. 3 Suppose -4f + 4s + 12 = 0, 3f - 18 = -5s + 31. Suppose -33 = -19a + fa. Solve -a = -d + 1 for d. 4 Suppose 0 = 4f + f - 10. Suppose -fs - 3s = -5k - 20, -2k = 4s - 4. Solve 1 = -sg + 5 for g. 2 Let r(f) = -8f + 16. Let t be r(2). Solve t = 4w - 9w - 20 for w. -4 Let g(k) = k2 + 31k - 218. Let i be g(6). Solve -31r = -33r - i for r. -2 Let w(x) = 3x2. Suppose -n = 4n + 3k + 20, 2n + k + 7 = 0. Let h be w(n). Solve h = -5g - 2 for g. -1 Suppose 0 = -5m + 4f - 12, 5m - 2f + 0f + 6 = 0. Suppose -6y + 0y + 120 = m. Solve 5r = -y - 5 for r. -5 Suppose 2w - 30 = -2v + 4w, 66 = 4v + 2w. Suppose -28n = -32n + v. Solve -3 + n = -i for i. -1 Let f(v) = 3v2 - v. Suppose 4 = -6b + 2b. Let p be f(b). Let r = -3 + p. Solve 2d + 7 = -r for d. -4 Let h be 3/(21/14)6. Solve 16b - hb = 20 for b. 5 Let q(v) = -v3 - v - 1. Let y be q(-1). Suppose 5d = 9d + 16. Let a be (3 - 7 - d)/y. Solve -4x = -ax for x. 0 Suppose -298 = 3d - 313. Let g be 20/6 - (-2)/(-6). Solve 8 = -gq + dq for q. 4 Let l(g) = 8g + 139. Let c be l(-15). Solve ct = -7 + 64 for t. 3 Suppose -j = -h - 2, 8h - 4h = 0. Solve -jm = -0m for m. 0 Let d be (-5)/(-1)(0 - -1). Suppose 0 = dz + z - 12. Solve zb + 1 = -7 for b. -4 Let g be (-8)/16(-24)/3. Let i be (-63 + 3)g/(-12). Solve 2x - i = -2x for x. 5 Let t = -47 - -66. Suppose 2n - y = t, -3n - 2y = -25 - 0. Solve n = 4g - g for g. 3 Let f(o) = o2 + 6o. Suppose 4w = -25 - 3. Let g be f(w). Let s(k) = -k2 + 8k + 8. Let z be s(g). Solve z = -7b + 4b for b. -5 Suppose 5x + 3a - 7 = 8, -4x + 5a + 12 = 0. Suppose 2c + 8 = 4c. Suppose -3u + 8 = -l - 9, -3u - l + 25 = 0. Solve uk + x = ck for k. -1 Suppose -4 = 2z, 3d - 156 = -0d + 3z. Let i = 52 - d. Solve it = t + 4 for t. 4 Suppose 4l + 10 = 6l. Suppose -3f + 5r - 9 = 1, 2f + 4r + 14 = 0. Let i(j) = j2 + 9j + 25. Let w be i(f). Solve l + w = -5t for t. -2 Suppose 10i - 3s = 5i + 24, 0 = -2i + 3s + 6. Let u be (-4)/i - 47/(-3). Suppose 5h - 5 = -3p - 0p, -2h + 4p + 28 = 0. Solve 0 = hj + j + u for j. -3 Let d(y) = -8y - 118. Let t be d(-15). Solve 3b - 11 = -t for b. 3 Let v be 8 + -5 + (1 - 1). Suppose 2w = -vh - 2h - 10, -w = 5h + 5. Solve y - 1 = -h for y. 1 Let l(b) = -b*2 + 2 + 2 + 0 + 6b. Let q(z) = -z*3 + 10z*2 + 11z + 6. Let a be q(11). Let r be l(a). Solve 0 = -rt + 3t for t. 0 Suppose 12j + 5 = 11j. Let k(m) = m*3 + 5m*2 + 4. Let q be k(j). Suppose 3a + 9 = 4u, -u - a = -qa. Solve -9 = -4c + u for c. 3 Let a(r) be the second derivative of -r3/6 + r2/2 - 7r. Let p be a(-2). Suppose -2s = -s - p. Solve -5 = -sy + 4 for y. 3 Suppose 2x + 3s = -6, -x + 16 = 3x - s. Suppose -5m = -2k + 2, 8 = 5k - 5*m + 3. Solve k = f - x for f. 4 Suppose	{ "pile_set_name": "DM Mathematics" }
tor of -25/776 and 54/283115. 219697240 Find the common denominator of 71/308902 and -135/2162314. 2162314 Find the common denominator of -37/78782488 and -17/14. 551477416 What is the common denominator of 35/108498 and -19/43550? 181734150 Calculate the lowest common multiple of 22171296 and 2184. 288226848 What is the common denominator of -103/985626 and -7/612? 1971252 What is the common denominator of -1/3150 and 197/86796450? 607575150 Calculate the common denominator of 52/234323903 and -2/234323903. 234323903 What is the smallest common multiple of 45762288 and 83072? 366098304 Calculate the common denominator of 99/60710 and -163/364260. 364260 What is the least common multiple of 16262 and 2402624? 112923328 What is the common denominator of -53/5115 and -4/4692501? 23462505 Calculate the least common multiple of 6741 and 423. 316827 What is the smallest common multiple of 50293892 and 36577376? 402351136 Calculate the lowest common multiple of 1597596 and 24. 3195192 Calculate the common denominator of 52/26288773 and 15/14. 52577546 What is the common denominator of 39/2899817 and 59/9? 26098353 Calculate the smallest common multiple of 11075 and 49970400. 49970400 Calculate the common denominator of 131/5533110 and 1/3018060. 33198660 What is the lowest common multiple of 4768593 and 424719? 586536939 Calculate the least common multiple of 289633443 and 56991. 3185967873 What is the common denominator of 111/1720202 and -67/396? 30963636 What is the least common multiple of 573076 and 103390? 20057660 What is the least common multiple of 214396 and 2508272? 333600176 Calculate the common denominator of -59/55896000 and 59/657600. 55896000 Calculate the smallest common multiple of 84 and 663943. 7967316 Calculate the least common multiple of 3517243 and 12986. 302482898 Find the common denominator of -95/2247916 and 75/38418928. 422608208 Find the common denominator of 94/534885 and 137/7899840. 102697920 Calculate the least common multiple of 2200572 and 20988. 116630316 What is the smallest common multiple of 30 and 1071610482? 5358052410 Calculate the least common multiple of 65 and 166175607. 830878035 What is the least common multiple of 15213 and 1855986? 1855986 What is the common denominator of -35/5058 and -65/1602? 450162 Calculate the lowest common multiple of 368 and 504128. 11594944 Calculate the common denominator of -8/883223 and 79/384010. 8832230 What is the common denominator of 64/25207329 and -15/4? 100829316 What is the least common multiple of 55 and 1479035? 16269385 What is the common denominator of 41/17 and 10/599873? 10197841 What is the lowest common multiple of 333 and 12204117? 12204117 What is the lowest common multiple of 26760544 and 20070408? 80281632 What is the common denominator of -51/1986464 and 163/5214468? 41715744 What is the least common multiple of 48 and 2307378? 18459024 Find the common denominator of 74/20703 and 125/94654116. 94654116 Calculate the least common multiple of 394402 and 62274. 1183206 What is the common denominator of 33/5486903 and 101/184? 43895224 What is the smallest common multiple of 28 and 98027685? 392110740 What is the smallest common multiple of 1971 and 8199? 1795581 Calculate the least common multiple of 134784 and 678834. 130336128 Calculate the least common multiple of 17873 and 4343139. 4343139 What is the least common multiple of 1926155 and 1001? 25040015 Calculate the lowest common multiple of 98 and 207438. 1452066 What is the common denominator of -179/23258220 and -20/3951? 69774660 What is the common denominator of 107/822 and 95/5242716? 5242716 Calculate the lowest common multiple of 275 and 38775814. 969395350 Find the common denominator of -7/96664 and -43/7968. 96277344 What is the least common multiple of 552 and 192586452? 385172904 Find the common denominator of -155/48548022 and -65/48688. 388384176 Calculate the smallest common multiple of 397363640 and 99340910. 397363640 Calculate the common denominator of 53/6692 and 25/7392. 1766688 What is the common denominator of -71/224197350 and -79/4875? 1120986750 Calculate the least common multiple of 574120 and 4400. 63153200 Find the common denominator of -121/458328 and 21/1612. 14208168 Find the common denominator of -19/117390 and 139/1807806. 9039030 Calculate the common denominator of 47/3477414 and -17/30. 17387070 What is the smallest common multiple of 3856 and 20181822? 161454576 Find the common denominator of -17/46256013 and -107/3496. 370048104 Calculate the common denominator of -73/2218 and -62/5901. 13088418 Calculate the common denominator of 12/7781 and 12/47941. 1486171 What is the lowest common multiple of 18951828 and 497994? 1345579788 Calculate the common denominator of -59/15 and -44/34246827. 171234135 Calculate the common denominator of 113/53808 and -97/69008. 12214416 Calculate the lowest common multiple of 9642 and 16344. 26264808 Calculate the common denominator of -83/3267984 and 19/6. 3267984 Find the common denominator of 71/7542 and 71/345292872. 1035878616 What is the common denominator of 39/656684 and 65/7896? 3940104 Calculate the common denominator of -43/9282 and 59/9108. 14090076 Calculate the smallest common multiple of 3682 and 43921. 614894 Calculate the common denominator of 75/3506 and -8/3805763. 7611526 Calculate the common denominator of -39/10 and 53/42731. 427310 Calculate the smallest common multiple of 1719370 and 4298425. 8596850 What is the least common multiple of 2064 and 27? 18576 What is the common denominator of 179/2160 and 14/5583735? 89339760 What is the smallest common multiple of 17400432 and 216? 156603888 Find the common denominator of -181/17848068 and -65/15029952. 285569088 Calculate the least common multiple of 3125977 and 9. 28133793 Calculate the least common multiple of 914390 and 3660. 5486340 Find the common denominator of 26/21 and 74/24719571. 173036997 Calculate the lowest common multiple of 32538 and 47652. 23492436 Calculate the smallest common multiple of 525 and 3978240. 19891200 Calculate the least common multiple of 24 and 80073348. 160146696 What is the lowest common multiple of 116280 and 11744280? 11744280 Calculate the common denominator of -88/3603165 and 58/1902795. 169348755 Calculate the common denominator of 121/105744 and 5/5075712. 5075712 Calculate the lowest common multiple of 1276772 and 911980. 6383860 What is the common denominator of -79/104118 and -1/1301475? 2602950 What is the common denominator of -73/13212762 and -105/180574414? 541723242 What is the common denominator of -13/558250 and 31/4235? 6140750 Calculate the lowest common multiple of 3896120 and 3. 11688360 Calculate the least common multiple of 2235020 and 7599068. 37995340 Calculate the smallest common multiple of 97644 and 75546. 1229435604 Calculate the common denominator of 28/33825921 and -89/6. 67651842 Calculate the least common multiple of 4639833 and 954. 491822298 What is the lowest common multiple of 673 and 7121686? 7121686 Calculate the least common multiple of 117966517 and 3096973. 1297631687 Find the common denominator of 7/7656354 and 115/5104236. 15312708 Calculate the common denominator of 52/34227 and -77/35136. 133622208 What is the lowest common multiple of 555 and 6706575? 248143275 Calculate the smallest common multiple of 17598900 and 11732600. 35197800 What is the common denominator of -13/40027428 and -143/11436408? 80054856 Calculate the common denominator of -91/732 and -47/16280290. 97681740 What is the smallest common multiple of 1315 and 299325? 78722475 What is the lowest common multiple of 2765076 and 5530152? 5530152 Calculate the least common multiple of 20274336 and 49995. 1115088480 Calculate the common denominator of 55/4 and 9/18387904. 18387904 Calculate the smallest common multiple of 12 and 140148552. 140148552 Calculate the lowest common multiple of 9654 and 105997702. 317993106 Calculate the common denominator of -61/1156 and -83/3805756. 64697852 What is the least common multiple of 13488 and 32708400? 32708400 What is the common denominator of 115/279552 and 137/4712448? 32987136 Calculate the common denominator of -29/1438160 and -93/35440. 637104880 Calculate the lowest comm	{ "pile_set_name": "DM Mathematics" }
- (sqrt(99) + 0) - (-3 + sqrt(176)-2)))1. sqrt(11) + 8 Simplify sqrt(847) - 5(-1sqrt(847))*2 - (-3 + 2 + sqrt(847)) - ((sqrt(77) - (sqrt(77) + (-1sqrt(77) - sqrt(77) - sqrt(77))))4)/(sqrt(88)/(sqrt(8)2)). -4234 - 24sqrt(7) Simplify -4(4-3(sqrt(297) + sqrt(297)2 + sqrt(297)))/((sqrt(176) + sqrt(176) + 2sqrt(176) + sqrt(176))3 + sqrt(176)). 9sqrt(3) Simplify -4(-6(2 + (sqrt(539) + 2 - sqrt(11)) - ((sqrt(1100)2 - sqrt(1100)) + -1sqrt(275))))*2. -3888 - 1152sqrt(11) Simplify 5((-2 + sqrt(704)-12 + 1sqrt(704) + -3 + -5)-6)2. 28800sqrt(11) + 144720 Simplify (3sqrt(66)/sqrt(3) - 6sqrt(22)1)/(-5sqrt(8)2-3) + 2. -sqrt(11)/20 + 2 Simplify ((sqrt(3000) - (2sqrt(3000) + sqrt(3000)))/((sqrt(96) - sqrt(96)-1 - sqrt(96)) + sqrt(96)) - ((-3sqrt(5))2 + 3 - sqrt(10)/(sqrt(14)/sqrt(7))))-5. 15sqrt(5)/2 + 240 Simplify 4 + -2 + sqrt(1053) + sqrt(1053) + 2 - (sqrt(117) - ((-2sqrt(117) - sqrt(117))-2 - sqrt(117)))/(-5-2sqrt(9)). 4 + 92sqrt(13)/5 Simplify ((sqrt(189)2-1)/((sqrt(108)/sqrt(4))/sqrt(9)))/(1(sqrt(1296) + (sqrt(1296) - sqrt(1296)1))5)-2. sqrt(7)/15 Simplify ((-2sqrt(360)2 + sqrt(360))/(sqrt(40) - sqrt(160)))/(sqrt(1728)1 + (sqrt(588)-6 - sqrt(12)) + sqrt(12)). -sqrt(3)/20 Simplify ((0 + sqrt(72) + (-1 + sqrt(72) - sqrt(72)) + sqrt(72))*2 + 0 - ((2sqrt(72) + sqrt(72))2 - (0 + -1 + sqrt(72) - sqrt(72))2)) + -5 + 5. -60sqrt(2) + 290 Simplify -1(1(sqrt(153) + 1sqrt(153)2))/(((sqrt(90)-3 - sqrt(90))2 - sqrt(90))/sqrt(10)) + -3. -3 + sqrt(17)/3 Simplify (-4(3 + -1sqrt(468) - (2sqrt(468) + 2 + sqrt(468)))-4-6)2. -442368sqrt(13) + 69018624 Simplify ((-5(sqrt(171) - (-3 + -1 + sqrt(171))) + (-5sqrt(171) + 2)-4)6)*2. -120960sqrt(19) + 2490624 Simplify (1sqrt(3024)3 + sqrt(3024) - sqrt(3024) - 6(sqrt(3024)1 - sqrt(3024)))/(-2(sqrt(700) - (sqrt(700) + (-1sqrt(700) - sqrt(700))))-3). 3sqrt(3)/10 Simplify 4(-2 + -1 + (52sqrt(80)4)*2 + 1)-3. -1535976 Simplify ((sqrt(260) + (1sqrt(260)3 - sqrt(260)))/(sqrt(5) - sqrt(20)/sqrt(36))-1-3 + -1)*2. -54sqrt(13) + 9478 Simplify (2 + -3 + sqrt(12)/sqrt(4) + (0 + sqrt(3))-5 + sqrt(243)-2 + sqrt(108)/sqrt(4) + sqrt(27) + -4)*2. 160sqrt(3) + 793 Simplify sqrt(2)-14 + sqrt(98) + sqrt(98)2 + -5 - (4(-2sqrt(64)/sqrt(2) + 2))2. -2117 + 529sqrt(2) Simplify (sqrt(162)/(sqrt(9) - -2sqrt(18)/sqrt(2)))/((-2sqrt(66)-6)/sqrt(11))1. sqrt(3)/36 Simplify sqrt(833) + -4(sqrt(833) + 2) + (-4 + sqrt(833) + -1)2 + sqrt(170)/(sqrt(30)/sqrt(3)) + 2 + 1sqrt(17) + 0. -89sqrt(17) + 852 Simplify -3(1-2(sqrt(9072) + -2 + sqrt(9072)) + -1 + sqrt(9072) + -2sqrt(9072) + sqrt(9072) + sqrt(9072) + 2 + 2)2. -245091 + 4536sqrt(7) Simplify (-2(5((sqrt(120) + 3sqrt(120) - sqrt(120)) + sqrt(120) + sqrt(120)))/sqrt(6))/(-3sqrt(4)-6 + 6sqrt(256)). -25sqrt(5)/33 Simplify -2(sqrt(432)2 + 0 - (-2 + sqrt(3) + 3 + 4))4. -184sqrt(3) + 40 Simplify (sqrt(1215) - 1sqrt(1215))/(sqrt(180)3) - ((1sqrt(108)5 - sqrt(108) - sqrt(108)) + sqrt(108) - -2sqrt(108)-3)2. -432 Simplify -5sqrt(153)-5-4 + ((sqrt(17) - (sqrt(17) + sqrt(68)/sqrt(4)-2) - (-1sqrt(85))/sqrt(5)) + -2)*2. -312sqrt(17) + 157 Simplify (5(sqrt(320) + -1))26 + ((2sqrt(25)-2)/(sqrt(20)/(sqrt(12)/sqrt(3))))*2. -2400sqrt(5) + 48230 Simplify 1((sqrt(108)4 - sqrt(3)) + -3 + 3 + -2 + sqrt(3) + sqrt(3) + ((sqrt(36)-1)/sqrt(12) + sqrt(3))2 + -3)-1. -25sqrt(3) + 5 Simplify 1(-2 + 2(-1sqrt(468))*2 + ((sqrt(468) - -4(1 + sqrt(468)))*2 - (-4(2sqrt(468))2 - sqrt(468)))). 246sqrt(13) + 20138 Simplify (((sqrt(171) - -1sqrt(171))-5 - -4(sqrt(171) + sqrt(171)-1 - sqrt(171)))-5)/(43sqrt(81)/sqrt(81)). 35sqrt(19)/2 Simplify (sqrt(891) + 0 + 1 + sqrt(891) + 4 + 2sqrt(891) - (sqrt(121)1-2)/((sqrt(99)-2 - sqrt(99))/sqrt(9) + sqrt(11)))*2. 350sqrt(11) + 13500 Simplify (1 + (sqrt(114) - -1sqrt(114)4)/(sqrt(18)/(sqrt(12)/sqrt(4))))36. 18 + 90sqrt(19) Simplify ((sqrt(190)-46 - sqrt(190)) + (sqrt(190) - ((sqrt(190) - -2sqrt(190)-1) + sqrt(190))))/(((1sqrt(80) + sqrt(80) - sqrt(80))-5)/(2-2sqrt(8))). -96sqrt(19)/5 Simplify (1sqrt(3)4 - (sqrt(3) + sqrt(12) + 0)) + -5 - (3-1(-1 + sqrt(432)))*2. -3902 + 217sqrt(3) Simplify -4 + -6-5((2 + (sqrt(1728) - (3 + sqrt(1728))))6 + -2)2. 1916 Simplify (2 + -1 + ((2sqrt(500) - sqrt(500) - sqrt(500))-2 + (sqrt(500) - (-12sqrt(500) - sqrt(500))) - (-4-1sqrt(500) - (1 + sqrt(500) + -1))) + 1)2. 40sqrt(5) + 504 Simplify ((5(sqrt(132) - (sqrt(132) + (-2sqrt(132) - sqrt(132)))))/(1sqrt(192)) - ((-1sqrt(220))/sqrt(4))/(sqrt(250)/sqrt(2) + sqrt(5)))*2. 24299/144 Simplify ((sqrt(80) - (sqrt(80) + 0 + sqrt(80) - sqrt(80) - sqrt(80) - sqrt(80)))-2 + (-5sqrt(80))2 + sqrt(20)/sqrt(4)3)6 + -4. -78sqrt(5) + 11996 Simplify ((2 + sqrt(1216) + sqrt(1216))4 + 2sqrt(171)/(sqrt(18)/sqrt(2)) + -5)*21 + -2. 396sqrt(19) + 82771 Simplify ((sqrt(425) + 1)-5 + 2)*2-6 - ((-2(sqrt(153) + sqrt(153)1))/(sqrt(9) - 2sqrt(9)1) + 3). -63807 - 904sqrt(17) Simplify 62(4 + (0 + sqrt(539))2 + (sqrt(539) + -4 + 0)2)1. -672sqrt(11) + 13176 Simplify ((-3sqrt(315) - sqrt(315))-3 + sqrt(315) + ((sqrt(315) + sqrt(315)3 + sqrt(315))4 - sqrt(315)))/(1(sqrt(847) + sqrt(847)2-5)). -32sqrt(5)/33 Simplify (-6(sqrt(114)-1 + sqrt(114))11)/((6sqrt(192))/((2sqrt(80))/sqrt(10) - sqrt(8))). 0 Simplify -1 + 6(0 + sqrt(108) - (-2sqrt(3) + 2) - ((sqrt(3) + 0)1 - -1sqrt(147))). -13 Simplify (2((sqrt(171) - (2 + sqrt(171)) - sqrt(171))-34 - (-1 + sqrt(171) + -5 - 4(1 + sqrt(171)))) + 3 + 0)2. 12780sqrt(19) + 158941 Simplify ((sqrt(2673) - (-1sqrt(2673) + sqrt(2673) - sqrt(2673)))23)/(sqrt(1100)1-4). -27sqrt(3)/10 Simplify (sqrt(192)/((sqrt(12) - (sqrt(48) + sqrt(12)))-3)5)/((sqrt(240)/sqrt(20))/(sqrt(24)/sqrt(4)4)). 20sqrt(2)/3 Simplify (4(-2 + sqrt(117)) + sqrt(117)-4-6 + sqrt(117) - (0 + (sqrt(117) - (-1 + sqrt(117) + -3 + sqrt(117))) + 4))2. -2880sqrt(13) + 105556 Simplify ((6sqrt(20)/sqrt(4) - sqrt(5)) + -5)2 + (5(sqrt(245)2 + sqrt(245)) - sqrt(245)) - (sqrt(15) - -1sqrt(375))/(sqrt(12)/(sqrt(4) - sqrt(144))). 150 + 78sqrt(5) Simplify ((0 + -5(-1 + sqrt(200)) + (4(sqrt(200) + (sqrt(200) - (sqrt(200) + -1))) - sqrt(200)) + (sqrt(200) + -1 + -2 - sqrt(200)) + 3)5)*2. -9000sqrt(2) + 22025 Simplify 4 + 1(1 + -2(sqrt(2448) - sqrt(2448)2)4 + (-4 + (sqrt(2448) + 1 + sqrt(2448) - sqrt(2448)) + sqrt(2448) + (1 + sqrt(2448) + sqrt(2448))6)2). 1104sqrt(17) + 479822 Simplify ((4(1sqrt(30) + sqrt(30))41)/(sqrt(294)-4 - sqrt(432)/sqrt(8)))23. 15360/961 Simplify ((sqrt(192) + sqrt(12))/sqrt(4) + -1 - -2((sqrt(45)/sqrt(3))/sqrt(5) - sqrt(3)))2 + -5 + (-1 + -6sqrt(432)2)2. 278sqrt(3) + 62280 Simplify 0 + 0 + sqrt(3)-12 - (-3 + ((3 + sqrt(192))*2 - sqrt(192)) + -4). -194 - 42sqrt(3) Simplify 2((-5(-42sqrt(832) + sqrt(832))6-4)*2 + 0). 1174118400 Simplify -5(-3(sqrt(612) - (-1sqrt(612) + -5 + sqrt(612)) - ((sqrt(612) - ((-1 + sqrt(612))2 + sqrt(612))) + sqrt(612)))3 + 0)*2. -995085 - 29160sqrt(17) Simplify (1 + 1(1 + 3 + ((sqrt(288) - (sqrt(288) + -3)) + 1 - sqrt(288))))2. -216sqrt(2) + 369 Simplify (((sqrt(200) - (sqrt(200) - (1sqrt(200) - sqrt(200)) - sqrt(200))) + sqrt(200))-3)/((sqrt(800)/sqrt(4))/sqrt(2))5. -30sqrt(2) Simplify -4 + (-1(sqrt(242) + (0 + sqrt(242))2 + (sqrt(242) + 0)-5 + 5)-5)*2. -5500sqrt(2) + 24821 Simplify -6((21sqrt(136))/(sqrt(48)/(sqrt(6) + sqrt(96))))2 + (sqrt(187)3-4)/(sqrt(11) - (sqrt(11) + sqrt(66)/sqrt(6))3). -10200 + 12sqrt(17)/5 Simplify ((sqrt(80) - sqrt(80)-11) + (sqrt(80) - 6(sqrt(80) - sqrt(80)-2 - sqrt(80) - sqrt(80))))/((sqrt(216)-2)/sqrt(6) - sqrt(36)) + 3. 2sqrt(5)/3 + 3 Simplify 2 + (-3 + sqrt(10)/((sqrt(2) - sqrt(10)/sqrt(5)) + sqrt(2)) + -3 - (-6sqrt(100)/sqrt(2))/(sqrt(70)/(sqrt(7) + sqrt(28)))) + 0. -4 + 19sqrt(5) Simplify ((-6sqrt(204) - sqrt(204)/sqrt(4)-5)/(-1sqrt(363)-6) + -4)2. 28sqrt(17)/33 + 70529/4356 Simplify (-3-6(2sqrt(104)-2 - sqrt(104)))/(sqrt(512) + sqrt(512)1 - sqrt(8) - (sqrt(8) + sqrt(968)2 + sqrt(968) - sqrt(8))). 5sqrt(13) Simplify ((sqrt(133)-1-6 - -4(sqrt(133) + -1sqrt(133)))-4)/((sqrt(14) - -3-1sqrt(14))/(sqr	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.