Datasets:

parameterlab
/

scaling_mia_the_pile_00_DM_Mathematics

Dataset card Data Studio Files Files and versions Community

Split (3)

train · 63.5k rows

text stringlengths 518 8.19k	meta dict
re there in thirteen fifths of a millennium? 31200 What is 143508.645ms in days? 0.0016609796875 How many nanometers are there in 94.209 centimeters? 942090000 What is 258875.4 centuries in decades? 2588754 How many nanometers are there in 0.0329471m? 32947100 How many litres are there in 48480.7 millilitres? 48.4807 What is 47147.3 years in decades? 4714.73 Convert 82.82052um to millimeters. 0.08282052 How many months are there in fifty-four fifths of a century? 12960 What is 37.19993 centimeters in meters? 0.3719993 What is 25/2 of a milligram in micrograms? 12500 What is 11.01608 years in months? 132.19296 How many days are there in 3.7373391 minutes? 0.002595374375 How many millennia are there in 60403.2 months? 5.0336 How many decades are there in thirty-four fifths of a century? 68 How many litres are there in 13006.92ml? 13.00692 What is 55/4 of a gram in milligrams? 13750 How many millimeters are there in 7063.451km? 7063451000 How many centimeters are there in one fifth of a meter? 20 Convert 68.74243 decades to months. 8249.0916 What is 7/8 of a millennium in months? 10500 How many millilitres are there in 12.83532l? 12835.32 Convert 66251.83 days to hours. 1590043.92 What is eleven eighths of a kilometer in meters? 1375 How many nanoseconds are there in five quarters of a microsecond? 1250 What is twenty-one fifths of a millennium in years? 4200 Convert 0.959322 hours to nanoseconds. 3453559200000 How many millilitres are there in thirteen quarters of a litre? 3250 What is 0.4025097l in millilitres? 402.5097 What is 21/4 of a microgram in nanograms? 5250 How many milliseconds are there in 4.649586us? 0.004649586 How many grams are there in 85.74213t? 85742130 Convert 1501014.3 months to millennia. 125.084525 What is seventy-five eighths of a litre in millilitres? 9375 How many millilitres are there in three eighths of a litre? 375 What is 3/8 of a litre in millilitres? 375 Convert 95.72964cm to kilometers. 0.0009572964 How many hours are there in 3365872.2 microseconds? 0.0009349645 What is 68995.78 grams in tonnes? 0.06899578 How many milliseconds are there in six fifths of a second? 1200 What is one tenth of a decade in months? 12 What is fourty-five eighths of a litre in millilitres? 5625 Convert 364.4771 millilitres to litres. 0.3644771 How many hours are there in 620.11656ms? 0.0001722546 How many grams are there in seventeen halves of a kilogram? 8500 What is fourty-three quarters of a millimeter in micrometers? 10750 Convert 483.935ms to seconds. 0.483935 Convert 994.8408l to millilitres. 994840.8 What is 73.19755cm in millimeters? 731.9755 How many months are there in 7/8 of a millennium? 10500 How many centuries are there in 8021.74 decades? 802.174 What is 7.592209 centimeters in micrometers? 75922.09 How many tonnes are there in 342.7209 milligrams? 0.0000003427209 How many millilitres are there in five quarters of a litre? 1250 How many months are there in 6/5 of a century? 1440 How many decades are there in six fifths of a millennium? 120 Convert 26093.9kg to milligrams. 26093900000 Convert 155.2289 millennia to months. 1862746.8 How many millilitres are there in twenty-six fifths of a litre? 5200 What is 6/5 of a milligram in micrograms? 1200 How many tonnes are there in 2430.25 milligrams? 0.00000243025 How many milligrams are there in eleven quarters of a gram? 2750 How many millilitres are there in 7/2 of a litre? 3500 What is 976.2226ml in litres? 0.9762226 How many millilitres are there in 67062.81l? 67062810 What is 6085.387ml in litres? 6.085387 What is 4.241164l in millilitres? 4241.164 What is 5/8 of a millennium in months? 7500 What is three eighths of a millimeter in micrometers? 375 How many years are there in 21/5 of a century? 420 How many millilitres are there in 1/5 of a litre? 200 What is 43423.55 kilograms in milligrams? 43423550000 What is 31/2 of a microsecond in nanoseconds? 15500 Convert 279817.2 months to centuries. 233.181 What is 13/4 of a century in months? 3900 Convert 0.47236 milligrams to tonnes. 0.00000000047236 What is 214461.5kg in tonnes? 214.4615 What is 6/5 of a microgram in nanograms? 1200 What is 3.603696 tonnes in grams? 3603696 How many kilograms are there in 75.96654 grams? 0.07596654 How many centimeters are there in 11/4 of a meter? 275 How many micrograms are there in 45/4 of a milligram? 11250 Convert 216073.494 milliseconds to days. 0.002500850625 What is 8155.566cm in millimeters? 81555.66 How many nanograms are there in 944.3821 grams? 944382100000 How many millilitres are there in fifty-four fifths of a litre? 10800 How many millimeters are there in 47.72367 kilometers? 47723670 What is 5/8 of a microgram in nanograms? 625 How many minutes are there in sixty-four fifths of a hour? 768 Convert 39934.71m to micrometers. 39934710000 What is 5888.181s in nanoseconds? 5888181000000 How many micrometers are there in 7/8 of a millimeter? 875 What is 34/5 of a century in years? 680 How many hours are there in 379.1952 minutes? 6.31992 Convert 999730.1km to millimeters. 999730100000 Convert 32474.65 millimeters to micrometers. 32474650 What is 33613.06 minutes in seconds? 2016783.6 What is 80.3717 days in minutes? 115735.248 What is eleven halves of a litre in millilitres? 5500 What is 39925.01 microseconds in milliseconds? 39.92501 What is 0.9436712m in nanometers? 943671200 How many litres are there in 0.861241 millilitres? 0.000861241 How many weeks are there in 1679489.7 days? 239927.1 How many decades are there in 11357.523 months? 94.646025 How many millilitres are there in 26/5 of a litre? 5200 What is 306604.998 minutes in weeks? 30.4171625 How many centuries are there in 78115.17 years? 781.1517 How many years are there in thirty-three fifths of a century? 660 Convert 528065.5mm to kilometers. 0.5280655 How many years are there in eleven quarters of a millennium? 2750 Convert 188.6191 grams to milligrams. 188619.1 How many litres are there in 6.763399 millilitres? 0.006763399 How many milligrams are there in 461.0014t? 461001400000 What is eleven quarters of a hour in minutes? 165 Convert 8104.472ml to litres. 8.104472 What is 607.907 millilitres in litres? 0.607907 What is 43.59957 kilograms in tonnes? 0.04359957 How many decades are there in 27/5 of a century? 54 How many centuries are there in 1.133379 years? 0.01133379 Convert 381.3197l to millilitres. 381319.7 How many micrograms are there in 1/20 of a milligram? 50 What is 149867.7 months in decades? 1248.8975 How many micrograms are there in thirty-one halves of a milligram? 15500 How many millilitres are there in 21/2 of a litre? 10500 Convert 955845.6 nanograms to tonnes. 0.0000000009558456 What is 68/3 of a century in months? 27200 How many minutes are there in 4/15 of a hour? 16 Convert 875.795 weeks to hours. 147133.56 What is nine tenths of a day in minutes? 1296 How many millilitres are there in 7/4 of a litre? 1750 How many seconds are there in 18085.8 milliseconds? 18.0858 Convert 0.4370841cm to micrometers. 4370.841 How many millilitres are there in 823.2351l? 823235.1 How many grams are there in 5.630736 nanograms? 0.000000005630736 What is 4.486637 decades in millennia? 0.04486637 How many micrograms are there in one tenth of a milligram? 100 What is 3/25 of a micrometer in nanometers? 120 How many nanometers are there in 0.4231474um? 423.1474 Convert 135314.9 millilitres to litres. 135.3149 What is seventy-seven fifths of a litre in millilitres? 15400 Convert 0.9559904cm to kilometers. 0.000009559904 How many nanograms are there in twenty-one eighths of a microgram? 2625 Convert 0.0552082 litres to millilitres. 55.2082 How many hours are there in seven thirds of a day? 56 What is 2018.783 days in microseconds? 174422851200000 Convert 0.6903504 millennia to decades. 69.03504 Convert 1169.156 centimeters to millimeters. 11691.56 What is one fifth of a litre in millilitres? 200 What is one fifth of a decade in months? 24 How many seconds are there in fifteen quarters of a minute? 225 How many nanograms are there in 0.665001ug? 665.001 Convert 13.87146 months to millennia. 0.001155955 How many nanoseconds are there in 0.9277696 minutes? 55666176000 What is three fifths of a century in years? 60 Conver	{ "pile_set_name": "DM Mathematics" }
wffjnjj. What is prob of sequence nfw? 1/420 Three letters picked without replacement from tdudtououautta. What is prob of sequence ooa? 1/546 What is prob of sequence cn when two letters picked without replacement from fznacsaf? 1/56 Two letters picked without replacement from {g: 5, f: 4, h: 2}. What is prob of sequence fh? 4/55 What is prob of sequence bbb when three letters picked without replacement from zzzzzbzbbbzzbz? 5/182 What is prob of sequence ad when two letters picked without replacement from atdttta? 1/21 Calculate prob of sequence pwxe when four letters picked without replacement from {w: 3, x: 1, c: 1, p: 2, n: 10, e: 2}. 1/7752 What is prob of sequence ysyh when four letters picked without replacement from {s: 1, h: 1, y: 2, e: 4, l: 2}? 1/2520 What is prob of sequence mm when two letters picked without replacement from mmmmmmm? 1 Three letters picked without replacement from {n: 2, e: 3, y: 4, z: 1}. What is prob of sequence yny? 1/30 What is prob of sequence qq when two letters picked without replacement from yqy? 0 Two letters picked without replacement from rrnrrrrr. What is prob of sequence nr? 1/8 What is prob of sequence gg when two letters picked without replacement from {g: 3, o: 2, y: 3}? 3/28 Calculate prob of sequence rkx when three letters picked without replacement from {x: 1, r: 1, k: 2, p: 1}. 1/30 Calculate prob of sequence eqyw when four letters picked without replacement from {y: 1, k: 1, q: 1, f: 2, w: 1, e: 1}. 1/840 Four letters picked without replacement from {e: 3, y: 5, d: 8}. What is prob of sequence eedd? 1/130 What is prob of sequence cl when two letters picked without replacement from {y: 9, l: 1, h: 5, c: 3}? 1/102 What is prob of sequence xtp when three letters picked without replacement from txuctpupbccx? 1/165 Three letters picked without replacement from {o: 7, g: 2, s: 2}. What is prob of sequence osg? 14/495 Two letters picked without replacement from fpppfpppffpf. Give prob of sequence pp. 7/22 What is prob of sequence ffff when four letters picked without replacement from yffyyfffffyfyfff? 33/182 Calculate prob of sequence ae when two letters picked without replacement from jbzannea. 1/28 Calculate prob of sequence mt when two letters picked without replacement from {m: 1, t: 6, k: 11, i: 1}. 1/57 What is prob of sequence cvcc when four letters picked without replacement from {i: 1, m: 5, v: 1, u: 1, c: 6}? 5/1001 Calculate prob of sequence ff when two letters picked without replacement from ffx. 1/3 Four letters picked without replacement from gaggikkgciigkg. What is prob of sequence cikk? 3/4004 Calculate prob of sequence xc when two letters picked without replacement from xxxc. 1/4 Two letters picked without replacement from ckckklklc. Give prob of sequence ck. 1/6 Three letters picked without replacement from tqyowsqtyty. Give prob of sequence qwy. 1/165 Two letters picked without replacement from {x: 1, a: 1, y: 2, l: 3}. Give prob of sequence yy. 1/21 Four letters picked without replacement from {w: 5, o: 8, y: 4, c: 2}. Give prob of sequence wwcy. 5/2907 Calculate prob of sequence ot when two letters picked without replacement from fuoptmuf. 1/56 What is prob of sequence kq when two letters picked without replacement from {k: 2, z: 1, q: 4, i: 2}? 1/9 Three letters picked without replacement from {i: 1, a: 2, h: 1, k: 3}. What is prob of sequence kah? 1/35 Two letters picked without replacement from nnandnnnp. What is prob of sequence na? 1/12 Two letters picked without replacement from tttjj. Give prob of sequence jj. 1/10 Two letters picked without replacement from {w: 5, s: 1, x: 14}. What is prob of sequence xs? 7/190 Two letters picked without replacement from iuwikwww. Give prob of sequence wi. 1/7 Calculate prob of sequence qssy when four letters picked without replacement from mmsqmqmqsqqsyss. 5/1638 What is prob of sequence rrt when three letters picked without replacement from {r: 13, t: 6}? 52/323 Two letters picked without replacement from xxxasxvxrvrrrxxr. Give prob of sequence av. 1/120 Three letters picked without replacement from zzgzeceecgzgzczzggg. Give prob of sequence gzg. 35/969 Three letters picked without replacement from lllllllll. What is prob of sequence lll? 1 Two letters picked without replacement from {u: 2, v: 1, k: 3, g: 1, w: 8, a: 1}. What is prob of sequence kg? 1/80 Two letters picked without replacement from {p: 1, j: 1, e: 1, a: 2, y: 1, k: 1}. What is prob of sequence ey? 1/42 Two letters picked without replacement from {y: 2, d: 2, r: 1, k: 1, g: 1, c: 2}. Give prob of sequence kc. 1/36 Two letters picked without replacement from {f: 6, h: 5, k: 2}. Give prob of sequence hh. 5/39 What is prob of sequence yp when two letters picked without replacement from {p: 2, b: 5, y: 2, g: 2, x: 2}? 1/39 What is prob of sequence kkhk when four letters picked without replacement from {p: 3, h: 2, a: 5, k: 3}? 1/1430 Calculate prob of sequence iza when three letters picked without replacement from {z: 1, i: 2, a: 1, e: 4}. 1/168 Two letters picked without replacement from fblbfic. What is prob of sequence bi? 1/21 Calculate prob of sequence wvdv when four letters picked without replacement from {w: 6, v: 4, d: 1, l: 2}. 3/715 Three letters picked without replacement from qpddofk. What is prob of sequence kof? 1/210 Calculate prob of sequence iiu when three letters picked without replacement from {i: 5, u: 11}. 11/168 Two letters picked without replacement from {q: 2, u: 1, a: 1, t: 1, r: 1, f: 1}. What is prob of sequence tu? 1/42 What is prob of sequence fifi when four letters picked without replacement from {d: 7, f: 5, i: 2}? 5/3003 Three letters picked without replacement from biuuyde. Give prob of sequence eby. 1/210 Three letters picked without replacement from aaasaapsaasasads. Give prob of sequence aps. 3/224 Calculate prob of sequence bib when three letters picked without replacement from ibb. 1/3 Calculate prob of sequence ba when two letters picked without replacement from tvsab. 1/20 Two letters picked without replacement from zzzzjzjzzjzzzzzzzzzz. Give prob of sequence jz. 51/380 Two letters picked without replacement from pykeklekollekl. What is prob of sequence ky? 2/91 Two letters picked without replacement from nuuuunuunuuuun. Give prob of sequence nu. 20/91 Calculate prob of sequence bqyq when four letters picked without replacement from {b: 1, t: 2, q: 3, y: 1}. 1/140 Calculate prob of sequence ld when two letters picked without replacement from ldld. 1/3 What is prob of sequence ppl when three letters picked without replacement from {p: 7, l: 1}? 1/8 What is prob of sequence amm when three letters picked without replacement from {z: 2, m: 9, a: 5}? 3/28 Calculate prob of sequence pu when two letters picked without replacement from {p: 1, f: 1, k: 1, a: 2, u: 1, m: 2}. 1/56 Two letters picked without replacement from dyddddydddddyd. Give prob of sequence dy. 33/182 Three letters picked without replacement from doooddxoxxxxx. Give prob of sequence xxd. 15/286 Three letters picked without replacement from uzzzj. What is prob of sequence jzz? 1/10 What is prob of sequence pnyy when four letters picked without replacement from {p: 1, u: 2, n: 2, t: 1, y: 2}? 1/420 Three letters picked without replacement from ebbbbbbebbbbeb. What is prob of sequence bee? 11/364 Two letters picked without replacement from {y: 2, m: 2, e: 4, p: 2}. Give prob of sequence ym. 2/45 Three letters picked without replacement from {b: 1, r: 2}. What is prob of sequence rbr? 1/3 What is prob of sequence ffc when three letters picked without replacement from {f: 5, w: 1, c: 8, u: 1, h: 2}? 2/51 Three letters picked without replacement from wiiifikmkikwiifk. What is prob of sequence wmw? 1/1680 Calculate prob of sequence kp when two letters picked without replacement from {p: 1, k: 1, b: 1, n: 2}. 1/20 Two letters picked without replacement from bbppppbwppwwwp. Give prob of sequence bw. 6/91 What is prob of sequence hbb when three letters picked without replacement from hsbhbsshhbshxsx? 1/91 Calculate prob of sequence wnnn when four letters picked without replacement from {w: 1, n: 18}. 1/19 Two letters picked without replacement from {n: 1, s: 3, r: 4, w: 4, z: 1}.	{ "pile_set_name": "DM Mathematics" }
nator of -79/34387216 and -3/4298402? 34387216 What is the lowest common multiple of 51534 and 96524? 6081012 Find the common denominator of -89/109410550 and -27/747194. 765873850 Calculate the common denominator of -79/7803783 and -14/1417. 850612347 What is the common denominator of -69/495014 and 11/17820504? 17820504 What is the common denominator of -19/1188 and 53/260172? 260172 What is the lowest common multiple of 10448067 and 64603? 114928737 Calculate the smallest common multiple of 26269600 and 985110. 78808800 Calculate the common denominator of -83/242676324 and -17/66184452. 728028972 What is the smallest common multiple of 1278 and 206190? 14639490 What is the lowest common multiple of 45768 and 12328755? 98630040 What is the lowest common multiple of 4600 and 961170? 19223400 Find the common denominator of 55/156994 and -39/14. 1098958 Calculate the least common multiple of 83000 and 1751300. 17513000 What is the least common multiple of 180524439 and 520056? 1444195512 What is the lowest common multiple of 68363897 and 517? 752002867 Calculate the smallest common multiple of 2 and 149571740. 149571740 What is the lowest common multiple of 8162610 and 816261? 8162610 Calculate the lowest common multiple of 24192 and 11433744. 91469952 Find the common denominator of 34/37317 and 25/92841. 164978457 What is the common denominator of -47/49431276 and 93/4? 49431276 Calculate the common denominator of 97/44720082 and -19/2484449. 44720082 Calculate the common denominator of 97/91920 and -41/38058710. 913409040 Find the common denominator of 79/1916600 and -41/56425. 116912600 Find the common denominator of 39/881600 and -91/1763200. 1763200 Calculate the common denominator of -169/35276388 and 131/2208. 282211104 What is the common denominator of 73/212307 and -19/37545? 2657022105 What is the common denominator of 55/9153 and -131/4374? 494262 What is the common denominator of 37/283450 and -57/5500? 31179500 Find the common denominator of 97/128372288 and -17/819896. 898606016 Calculate the common denominator of -157/264 and -19/4085896. 134834568 What is the common denominator of 143/5790 and -89/387930? 387930 What is the least common multiple of 608 and 7565952? 7565952 Calculate the least common multiple of 28 and 159212466. 318424932 Calculate the common denominator of -45/439112 and 73/1660032. 695553408 Calculate the least common multiple of 277984 and 4284. 2501856 What is the least common multiple of 16101 and 966? 5184522 Calculate the common denominator of -197/2923200 and -53/556800. 11692800 What is the smallest common multiple of 5260 and 94158? 247635540 What is the lowest common multiple of 44251 and 252? 11151252 Calculate the common denominator of 26/53425861 and -83/115018. 106851722 What is the common denominator of 55/618 and 28/2102127? 4204254 Calculate the least common multiple of 3254304 and 2024784. 1259415648 What is the least common multiple of 89442372 and 24? 178884744 What is the common denominator of 40/121857 and 46/183? 7433277 What is the smallest common multiple of 545 and 3948416? 19742080 Calculate the least common multiple of 18 and 49472808. 148418424 Calculate the least common multiple of 998580 and 195. 12981540 Calculate the common denominator of 35/971 and 37/86787. 84270177 What is the smallest common multiple of 4829632 and 603704? 4829632 Calculate the common denominator of -13/4932 and -121/2770140. 8310420 What is the common denominator of -32/24382387 and -34/77899? 24382387 What is the common denominator of 71/4554 and 56/2935881? 64589382 What is the least common multiple of 21 and 195885? 1371195 Find the common denominator of -25/5037 and 65/381279. 8769417 Calculate the smallest common multiple of 119600 and 26910. 1076400 Calculate the common denominator of -23/4342394 and 19/586810. 21711970 Calculate the common denominator of -7/442615 and 34/4868765. 4868765 What is the lowest common multiple of 30590874 and 1035? 152954370 Calculate the least common multiple of 7773777 and 4240242. 46642662 What is the least common multiple of 1201496 and 2102618? 8410472 What is the lowest common multiple of 2695 and 6237? 218295 What is the lowest common multiple of 732 and 36458? 13343628 What is the lowest common multiple of 175780 and 58327? 12831940 Find the common denominator of -101/44453060 and -67/45. 400077540 Find the common denominator of 64/42063 and -12/91346815. 274040445 What is the least common multiple of 167620 and 9269386? 92693860 Calculate the smallest common multiple of 31778 and 771. 24500838 What is the smallest common multiple of 93208 and 8656693? 69253544 Calculate the lowest common multiple of 18558 and 2796. 8648028 Find the common denominator of 169/4980 and 43/45912. 19053480 What is the lowest common multiple of 117826500 and 2640? 471306000 Calculate the common denominator of 149/40164 and -103/1146. 7671324 What is the lowest common multiple of 1558611 and 6753981? 20261943 What is the lowest common multiple of 2828301 and 77? 31111311 Calculate the least common multiple of 378 and 10112816. 273046032 Calculate the common denominator of -43/50480 and -103/5868300. 23473200 Calculate the common denominator of 4/135 and 11/148815. 446445 Calculate the lowest common multiple of 45112545 and 3341670. 90225090 What is the common denominator of 109/272454 and -106/4095? 4086810 What is the common denominator of 109/18713784 and -125/5663382? 430417032 What is the common denominator of -43/4367352 and 37/66? 4367352 What is the least common multiple of 34 and 1755048? 29835816 Calculate the smallest common multiple of 24 and 33668. 202008 Find the common denominator of -87/3602 and -5/7972. 14357572 What is the smallest common multiple of 74653 and 1851? 138182703 Find the common denominator of -43/3516210 and -11/60. 7032420 Calculate the common denominator of 69/81272 and -85/20886904. 20886904 Find the common denominator of 15/4811716 and -75/105752. 9623432 Calculate the common denominator of -53/9197710 and 1/440. 404699240 Calculate the common denominator of -67/860436 and 23/478020. 4302180 What is the common denominator of -113/76620 and 107/52220? 200054820 Find the common denominator of -111/1400 and -83/767256. 19181400 What is the common denominator of 133/749634 and -47/29112? 2998536 Calculate the common denominator of -103/286 and -115/56129502. 56129502 Calculate the smallest common multiple of 37056 and 7633536. 7633536 What is the lowest common multiple of 1469888 and 78744? 4409664 Calculate the common denominator of -43/2383844 and 93/4767688. 4767688 Calculate the common denominator of 2/1885 and 7/4342. 629590 Find the common denominator of -109/67176 and 43/742668. 13368024 Find the common denominator of -47/9840129 and -19/44694. 59040774 Calculate the common denominator of -44/469002587 and 89/10. 4690025870 Calculate the common denominator of 61/670185 and 113/42930. 12063330 What is the common denominator of 143/18 and 79/529050? 1587150 Find the common denominator of 41/580575 and -129/620. 71991300 What is the common denominator of -97/3253320 and 29/820? 133386120 Find the common denominator of -37/13284810 and 229/328020. 26569620 What is the least common multiple of 610 and 2376895? 289981190 Calculate the common denominator of 149/6 and 17/2045987. 12275922 Calculate the common denominator of 67/3129 and -73/28887375. 202211625 Find the common denominator of 83/3190752 and -61/4387284. 35098272 Calculate the common denominator of 103/18522 and 19/25354. 33543342 What is the common denominator of -111/6580 and -139/72996546? 729965460 What is the lowest common multiple of 21266 and 752010? 1142303190 Find the common denominator of -74/309 and 121/434658. 44769774 Calculate the least common multiple of 13667800 and 1708475. 13667800 What is the common denominator of -111/13635550 and -11/96025? 13635550 Calculate the least common multiple of 1387529 and 30987. 12487761 Find the common denominator of 83/970 and -34/20881675. 41763350 Calculate the common denominator of 61/434 and -169/95340. 2955540 What is the common denominator of 79/62475 and -88/24735? 6060075 What is the smallest common multiple of 2337760 and 7040? 10	{ "pile_set_name": "DM Mathematics" }
446 What is the sixth root of 378971742 to the nearest integer? 27 What is the square root of 8241710497 to the nearest integer? 90784 What is the third root of 609058981 to the nearest integer? 848 What is 602473047 to the power of 1/4, to the nearest integer? 157 What is the sixth root of 1140785213 to the nearest integer? 32 What is the third root of 136901033 to the nearest integer? 515 What is 45836716 to the power of 1/2, to the nearest integer? 6770 What is the fourth root of 11595258 to the nearest integer? 58 What is the cube root of 1097961844 to the nearest integer? 1032 What is 627113634 to the power of 1/2, to the nearest integer? 25042 What is 498979246 to the power of 1/2, to the nearest integer? 22338 What is the cube root of 748287960 to the nearest integer? 908 What is the tenth root of 3386894439 to the nearest integer? 9 What is the third root of 10663196 to the nearest integer? 220 What is the ninth root of 523352301 to the nearest integer? 9 What is 125700475 to the power of 1/9, to the nearest integer? 8 What is the seventh root of 2109559305 to the nearest integer? 21 What is 190916160 to the power of 1/7, to the nearest integer? 15 What is 644223608 to the power of 1/5, to the nearest integer? 58 What is the cube root of 18331617 to the nearest integer? 264 What is 75566505 to the power of 1/2, to the nearest integer? 8693 What is the third root of 2311532049 to the nearest integer? 1322 What is the tenth root of 20944755 to the nearest integer? 5 What is the cube root of 757731412 to the nearest integer? 912 What is the third root of 3259271 to the nearest integer? 148 What is 481940429 to the power of 1/7, to the nearest integer? 17 What is 1096464731 to the power of 1/2, to the nearest integer? 33113 What is 181666435 to the power of 1/10, to the nearest integer? 7 What is 2002326317 to the power of 1/8, to the nearest integer? 15 What is the square root of 416247457 to the nearest integer? 20402 What is the cube root of 3501952159 to the nearest integer? 1519 What is 26843470 to the power of 1/2, to the nearest integer? 5181 What is 1401571667 to the power of 1/2, to the nearest integer? 37438 What is the fifth root of 76535020 to the nearest integer? 38 What is 1389439455 to the power of 1/2, to the nearest integer? 37275 What is the ninth root of 1879329079 to the nearest integer? 11 What is the square root of 435067672 to the nearest integer? 20858 What is the third root of 935136891 to the nearest integer? 978 What is 2379324984 to the power of 1/2, to the nearest integer? 48778 What is the seventh root of 1408673539 to the nearest integer? 20 What is 4474232734 to the power of 1/6, to the nearest integer? 41 What is the tenth root of 33093464 to the nearest integer? 6 What is the square root of 38767998 to the nearest integer? 6226 What is 33813894 to the power of 1/2, to the nearest integer? 5815 What is the tenth root of 6327614671 to the nearest integer? 10 What is 191130102 to the power of 1/2, to the nearest integer? 13825 What is 792047723 to the power of 1/3, to the nearest integer? 925 What is the square root of 5730895 to the nearest integer? 2394 What is 50801741 to the power of 1/6, to the nearest integer? 19 What is the square root of 738065493 to the nearest integer? 27167 What is 99735488 to the power of 1/2, to the nearest integer? 9987 What is 3238777043 to the power of 1/4, to the nearest integer? 239 What is the third root of 49521192 to the nearest integer? 367 What is the tenth root of 41769728 to the nearest integer? 6 What is the cube root of 137498762 to the nearest integer? 516 What is 37086409 to the power of 1/3, to the nearest integer? 333 What is the cube root of 248978716 to the nearest integer? 629 What is 853212031 to the power of 1/2, to the nearest integer? 29210 What is the tenth root of 115478379 to the nearest integer? 6 What is the tenth root of 1878666041 to the nearest integer? 8 What is the cube root of 124204334 to the nearest integer? 499 What is 935518444 to the power of 1/3, to the nearest integer? 978 What is the eighth root of 167689896 to the nearest integer? 11 What is 90580066 to the power of 1/2, to the nearest integer? 9517 What is 7696807987 to the power of 1/2, to the nearest integer? 87731 What is the square root of 31765782 to the nearest integer? 5636 What is the cube root of 51533111 to the nearest integer? 372 What is 33872638 to the power of 1/3, to the nearest integer? 324 What is 34942081 to the power of 1/3, to the nearest integer? 327 What is 1354742102 to the power of 1/2, to the nearest integer? 36807 What is 110801393 to the power of 1/9, to the nearest integer? 8 What is 234840487 to the power of 1/8, to the nearest integer? 11 What is the third root of 3803682233 to the nearest integer? 1561 What is 106451222 to the power of 1/2, to the nearest integer? 10318 What is the eighth root of 55438418 to the nearest integer? 9 What is the square root of 235943560 to the nearest integer? 15360 What is 3238089470 to the power of 1/2, to the nearest integer? 56904 What is 42384769 to the power of 1/9, to the nearest integer? 7 What is the eighth root of 63812139 to the nearest integer? 9 What is 346130528 to the power of 1/3, to the nearest integer? 702 What is 540218797 to the power of 1/6, to the nearest integer? 29 What is the cube root of 104323810 to the nearest integer? 471 What is the fifth root of 279453789 to the nearest integer? 49 What is 129066004 to the power of 1/7, to the nearest integer? 14 What is 4708754603 to the power of 1/2, to the nearest integer? 68620 What is the square root of 13644941 to the nearest integer? 3694 What is the cube root of 787750826 to the nearest integer? 924 What is the sixth root of 2174595900 to the nearest integer? 36 What is 5547339 to the power of 1/2, to the nearest integer? 2355 What is 232747827 to the power of 1/3, to the nearest integer? 615 What is 272832132 to the power of 1/3, to the nearest integer? 649 What is 413280499 to the power of 1/8, to the nearest integer? 12 What is the ninth root of 38294942 to the nearest integer? 7 What is the third root of 30172937 to the nearest integer? 311 What is the tenth root of 13422370 to the nearest integer? 5 What is 4950968809 to the power of 1/2, to the nearest integer? 70363 What is 690374392 to the power of 1/4, to the nearest integer? 162 What is the cube root of 3695258667 to the nearest integer? 1546 What is 81308030 to the power of 1/6, to the nearest integer? 21 What is the third root of 246333849 to the nearest integer? 627 What is the square root of 44838247 to the nearest integer? 6696 What is the square root of 927356765 to the nearest integer? 30453 What is the cube root of 652999436 to the nearest integer? 868 What is the eighth root of 361929448 to the nearest integer? 12 What is the cube root of 377134503 to the nearest integer? 722 What is the tenth root of 34594537 to the nearest integer? 6 What is the cube root of 2505771342 to the nearest integer? 1358 What is the third root of 6651383318 to the nearest integer? 1881 What is the square root of 291273985 to the nearest integer? 17067 What is 7064488 to the power of 1/2, to the nearest integer? 2658 What is 2997728068 to the power of 1/2, to the nearest integer? 54752 What is the cube root of 47397520 to the nearest integer? 362 What is 2803911602 to the power of 1/3, to the nearest integer? 1410 What is 2215008123 to the power of 1/8, to the nearest integer? 15 What is the square root of 968877652 to the nearest integer? 31127 What is 581807536 to the power of 1/2, to the nearest integer? 24121 What is the fifth root of 104928924 to the nearest integer? 40 What is the third root of 175724342 to the nearest integer? 560 What is the tenth root of 986508175 to the nearest integer? 8 What is the square root of 11631112 to the nearest integer? 3410 What is the fifth root of 18957058 to the nearest integer? 29 What is the seventh root of 489330968 to the nearest integer? 17 What is the sixth root of 355249402 to the nearest integer? 27 What is the ninth root of 97525554 to the nearest integer? 8 What is 137212605 to the power of 1/8, to the nearest integer? 10 What is the ninth root of 46	{ "pile_set_name": "DM Mathematics" }
o 1 dp? 1 Let n = 0 + 8. Let t = 13 - n. Suppose 365 = i + t. Round i to the nearest one hundred. 400 Let b = 1 + -1. Let y be -5 + 7 + 1 + b. Let w be 60001/4 - y/12. Round w to the nearest ten thousand. 20000 Let k = 2.21 - 2.3. Let i = k - 10.91. Let c = 10.951 + i. What is c rounded to two dps? -0.05 Let n = 344 - 340.86. Let i = n - 3. Let f = -0.162 + i. Round f to two dps. -0.02 Let f = 832 - 548. Suppose f + 556 = p. Round p to the nearest one hundred. 800 Let u be (3 - 6) + (2 - 4). Let h be -52(-20)/8u. Round h to the nearest 100. -700 Let b = -2.24 + 11.14. Let c = 10.5 - 0.5. Let w = c - b. What is w rounded to zero dps? 1 Let g = 4.01 + -4. Let l = 0.095 - g. Let s = 0.13 - l. Round s to two decimal places. 0.05 Let v = 0.29531877 - 0.2953. Round v to 6 dps. 0.000019 Let a = -81 + 118. Let g = 500849269 - 500849232.0000019. Let f = g - a. What is f rounded to 6 dps? -0.000002 Let v = -1 - -7. Let q = 12.5 + -17. Let b = q + v. What is b rounded to the nearest integer? 2 Let c(r) = 2r2 - 3r + 3. Let q be c(2). Suppose 79007 - 879002 = -4m - o, -3o = -qm + 1000015. What is m rounded to the nearest 100000? 200000 Let o = -6.7 + 2.2. Let r = o + 4. What is r rounded to the nearest integer? -1 Let m = 34.9999981 + -35. Round m to 6 decimal places. -0.000002 Let b = 3 + -7. Let y = b - -3.84. Let f = -0.2 - y. What is f rounded to two decimal places? -0.04 Suppose 5o + 3 = 28. Let z(p) = p - 5. Let a be z(o). Suppose a = -x + 15 + 28. What is x rounded to the nearest ten? 40 Let z(t) be the second derivative of -t5/20 - t4/12 + t*2 + 3t. Let l be z(0). Suppose v + 38000 = lv. What is v rounded to the nearest ten thousand? 40000 Let t = -8459 - -8461.0045. Let z = -2 + t. What is z rounded to three decimal places? 0.005 Let p = 6.6 + -6.5999883. What is p rounded to 6 dps? 0.000012 Let p be (-6)/15 - (-2116)/(-10). Let l be p/((0 + 3)/750). Round l to the nearest 10000. -50000 Let w = 12 - 29. Let t = w + 17.0062. What is t rounded to three dps? 0.006 Let b = 98089 + -98088.940009. Let v = 0.06 - b. What is v rounded to six decimal places? 0.000009 Let c = -17781034.9699909 - -17781037. Let b = c - 2.03. Round b to 6 dps. 0.000009 Let z(q) = -1360q*2 - 14q + 8. Let c be z(12). What is c rounded to the nearest 10000? -200000 Let q = 3388 - 3387.986897. Let l = q + -0.013. What is l rounded to five dps? 0.0001 Let q = -2151446.035871 - -2151445. Let t = 1.1668773 + q. Let o = t + -0.131. Round o to 6 decimal places. 0.000006 Let k = 66466614944488228.29999987 + -66466614664025366. Let f = 280462861 - k. Let v = -1.3 - f. What is v rounded to 7 decimal places? -0.0000001 Let r = -1588049 - 95591. Let j = r + 942251. Let f = j + 41389. What is f rounded to the nearest one million? -1000000 Let o = -0.56387 - -32.54287. Let w = o - 32. Let b = 0.02008 + w. Round b to 4 dps. -0.0009 Suppose 4n = -4v + 2952, 5v = 6n - n + 3720. Let j = v - 10831. Let q = -5690 - j. Round q to the nearest 1000. 4000 Let g = -42.2289 - -0.0289. What is g rounded to zero dps? -42 Let x = -33.98 - -34. What is x rounded to 1 dp? 0 Let k = 1 + -5. Let m(z) = -56z2 + 3z - 2. Let b be m(k). What is b rounded to the nearest one hundred? -900 Let h = -317219365.7408 + 315933118.640861. Let v = h + 1286116.1. Let p = v - -131. What is p rounded to five dps? 0.00006 Let m = -2.3 + 2.15. Round m to one dp. -0.2 Let t = 106 - 105.99999732. What is t rounded to 7 dps? 0.0000027 Let n = 1516150 - 1516049.0051. Let m = 101 - n. What is m rounded to three decimal places? 0.005 Let m = -0.75 - 0.1. Let o = -0.05 + m. Let f = o + 0.89999989. Round f to seven dps. -0.0000001 Let w = 71 - -2. Let d = -308308.189938 - -308381.19. Let r = d - w. Round r to 5 decimal places. 0.00006 Let y(h) = -h*3 + 4. Let q be y(0). Suppose 0z - 76800 = -qz. What is z rounded to the nearest 1000? 19000 Let j be 3/(-4) - 189591/12. Let v be ((-9)/18)/(1/j). What is v rounded to the nearest one thousand? 8000 Let k = 2.087 - 0.037. Round k to one dp. 2.1 Suppose -2a + a + 200 = 0. Round a to the nearest 1000. 0 Suppose -3 = -a - 2a. Let o(x) = -2 + 2 + 5 - 3x + 2x2 + 209x*3 - a. Let v be o(4). Round v to the nearest 1000. 13000 Let s = 0.150396 - -386.684604. Let p = -394.9 + s. Let f = p - -8. Round f to two decimal places. -0.07 Let q = -67.6 + 74. Round q to the nearest integer. 6 Let t = -58 - -20. Let i = 38.1904 + 0.4396. Let s = t + i. What is s rounded to one dp? 0.6 Let a = -0.0391 - -0.3201. Let j = 16.019 + a. Round j to the nearest integer. 16 Let o = -17894484 - -45894484. Suppose -o = 9q - 5q. What is q rounded to the nearest 1000000? -7000000 Let o be (-75)/20552/(-9). Let i = -109 + o. Round i to the nearest ten. 120 Let f = -2.9 + -13. Round f to the nearest integer. -16 Let s = -27 + 16. Let l = -11.0009 - s. Round l to three dps. -0.001 Suppose 5p + 6 - 233 = -b, 0 = 3b - 5p - 741. Suppose -4n - 5i + 983 = -0n, 2i = -n + b. Suppose -d + 4d = -n. What is d rounded to the nearest ten? -80 Let d = -4 - -7. Suppose -1400009 = -4j + 3o, -j + 4j = -do + 1049991. Round j to the nearest one hundred thousand. 400000 Let m = 200.99766 + -201. Round m to four decimal places. -0.0023 Let q = 80959 - 80955.50039. Let y = q - 3.5. Round y to four decimal places. -0.0004 Suppose 0 = -0h - 2h. Suppose -9 = -hf - f. Suppose 0 = x + 4r - 78, -4r + 396 = 4x - fr. What is x rounded to the nearest 10? 90 Let k = 37.74 - 48.9. Let a = 11 + k. Let m = 0.34 + a. What is m rounded to one decimal place? 0.2 Let z be (-9569990)/55 + 4/(-22). Round z to the nearest ten thousand. -170000 Let r = 0.57000121 + -0.57. What is r rounded to 7 dps? 0.0000012 Let g = 15313.896 + -19326.78. Let j = 3951 + g. Let r = j + 62. Round r to 2 decimal places. 0.12 Let w = -1291.980048 + 1292. Let d = 0.2 - 0.22. Let k = d + w. What is k rounded to 5 decimal places? -0.00005 Let h = 2025946 - 1033762. Suppose 5r = -4q - 2159990, -h = 4q - 5r + 1167826. What is q rounded to the nearest 100000? -500000 Let v = -404 + 403.803. Let j = -8.097 - v. What is j rounded to 0 dps? -8 Let h = -56.5 - 6.5. Let u = 63.78 + h. Let k = u + -0.08. What is k rounded to the nearest integer? 1 Suppose -3k + 11 + 4 = 0. Suppose -3w + kw + 4 = 0. Let a be 1(-1 - w) - -29999. What is a rounded to the nearest 100000? 0 Let q = 4.58293262 - -0.01711438. Let c = q - 4.6. What is c rounded to five dps? 0.00005 Let x = 1.999984 + -2. Let y = 0 + x. Round y to 5 decimal places. -0.00002 Let s = -248 + 61. Let d = -195.7 - s. What is d rounded to zero dps? -9 Let c be (-492)/(-4) + 1 + -1. Let y = c + 577. What is y rounded to the nearest one thousand? 1000 Let j = -3.338 - -0.038. Let g = 3.3023 + j. What is g rounded to 3 dps? 0.002 Let r = -7173.13100071 + 7173.161. Let y = -2.6 + 2.57. Let m = r + y. What is m rounded to 7 dps? -0.0000007 Let o = 50 + -49.99978. Round o to 4 decimal places. 0.0002 Let d = -28286.963 - -28266. Let b = 0.037 - d. Let y = b + -20.99955. What is y rounded to 4 decimal places? 0.0005 Let l = 6.5959 - 6.6. What is l rounded to 3 dps? -0.004 Let q be 1/(-3) - (-20845)/3. Suppose 28153 - q = 5l. Let k = l + 4859. Round k to the nearest one thousand. 9000 Let w = 0.0259 - -199.9741. Let r = 199.999913 - w. Let v = 0 - r. Round v to five decimal places. 0.00009 Let b = 4.7745 - 4.89. Let p = 0.12 + b. What is p rounded to 3 decimal places? 0.005 Let f = 0 - 0.00003. What is f rounded to 4 dps? 0 Let r = 980866441 + -980866628.0000089. Let p = -283 - -470. Let g = p + r. Round g to six decimal places. -0.000009 Let u be ((-11474)/(-4))/((-1)/(-22)). Let g = -123107 + u. Round g to the nearest one hundred thousand. -100000 Let r = -0.1 - -2.1. Let i = -2.05376 - -0.05656. Let a = r + i. Round a to three dps. 0.003 Let v = -194374 + 283874. Suppose -7f + 2f = -v. Round f to the nearest one thousand. 18000 Let c = -230579 + 230579.2199912. Let j = c + -0.22. What is j rounded to six dps? -0.000009 Let t = -25.861 - 0.039. Round t to zero dps. -26 Let k = 5.80036 - -0.05364. Let u = 0.054 - k. Round u to the nearest integer. -6 Let g = -28.983 - 0.017. Let s = 29.11 + g. Let i = s + -0.1035. What is i rounded to three decimal places? 0.007 Let a(t) = 2t*2	{ "pile_set_name": "DM Mathematics" }
How many micrometers are there in 31/5 of a centimeter? 62000 What is twenty-seven halves of a litre in millilitres? 13500 Convert 2968.086 nanometers to meters. 0.000002968086 Convert 0.89213 nanograms to micrograms. 0.00089213 How many kilograms are there in fifteen quarters of a tonne? 3750 What is 944813.2 seconds in microseconds? 944813200000 Convert 4.798684 centuries to years. 479.8684 What is 0.2328446l in millilitres? 232.8446 What is 217.7307 millennia in months? 2612768.4 Convert 324410.7 kilometers to millimeters. 324410700000 What is 2.966084km in micrometers? 2966084000 What is 1.615042mm in micrometers? 1615.042 Convert 0.7248691 years to months. 8.6984292 What is 4/75 of a century in months? 64 What is 14.2935651s in days? 0.00016543478125 How many seconds are there in four thirds of a hour? 4800 What is 1/4 of a century in years? 25 What is twenty-one fifths of a millennium in decades? 420 Convert 69.82125 millimeters to kilometers. 0.00006982125 Convert 8.43162 millilitres to litres. 0.00843162 What is 0.1715159 nanograms in milligrams? 0.0000001715159 How many weeks are there in 12.2171091 hours? 0.0727208875 What is 26410.86nm in micrometers? 26.41086 What is one tenth of a millennium in centuries? 1 What is 435.57561us in hours? 0.000000120993225 What is 0.6946782l in millilitres? 694.6782 Convert 1944.301mm to nanometers. 1944301000 Convert 0.6350336 weeks to nanoseconds. 384068321280000 Convert 79.82406ml to litres. 0.07982406 How many years are there in 3/10 of a millennium? 300 What is 2818.313 milliseconds in seconds? 2.818313 How many millilitres are there in 11.34375l? 11343.75 Convert 0.5789212ng to tonnes. 0.0000000000000005789212 How many micrometers are there in 3/25 of a millimeter? 120 Convert 92298.51 centuries to years. 9229851 How many months are there in one quarter of a century? 300 How many micrometers are there in seventeen quarters of a millimeter? 4250 How many minutes are there in 1/28 of a week? 360 How many nanometers are there in 7.694254 meters? 7694254000 How many millilitres are there in sixty-one quarters of a litre? 15250 Convert 767.3976ns to minutes. 0.00000001278996 What is 1/100 of a millimeter in micrometers? 10 Convert 11820.82167 milliseconds to weeks. 0.000019545009375 What is thirty-three fifths of a meter in centimeters? 660 What is 346.9077ml in litres? 0.3469077 What is 0.1770861mg in nanograms? 177086.1 Convert 84764.46 weeks to seconds. 51265545408 How many milliseconds are there in 0.070652 hours? 254347.2 How many milligrams are there in thirteen eighths of a gram? 1625 What is 3/32 of a kilometer in millimeters? 93750 What is 4364.66l in millilitres? 4364660 Convert 30891.44 kilograms to milligrams. 30891440000 What is 3/50 of a centimeter in micrometers? 600 How many grams are there in 11/10 of a kilogram? 1100 What is 1/6 of a hour in minutes? 10 How many decades are there in one tenth of a century? 1 What is 5/8 of a kilometer in meters? 625 What is eleven halves of a century in decades? 55 What is 9446.658t in grams? 9446658000 What is fifty-four fifths of a minute in seconds? 648 How many milliseconds are there in 1/30 of a minute? 2000 What is 3/10 of a litre in millilitres? 300 What is 9/10 of a kilometer in centimeters? 90000 How many decades are there in three fifths of a century? 6 How many millennia are there in 61179.1 years? 61.1791 What is twenty-one eighths of a litre in millilitres? 2625 How many days are there in 19.4661522s? 0.0002253026875 How many tonnes are there in 0.4193366 milligrams? 0.0000000004193366 How many nanograms are there in twenty-nine halves of a microgram? 14500 How many nanograms are there in 1/4 of a microgram? 250 What is 516295.3cm in millimeters? 5162953 How many microseconds are there in one quarter of a millisecond? 250 Convert 9.177216 litres to millilitres. 9177.216 Convert 80232.26 micrometers to millimeters. 80.23226 How many nanograms are there in eleven halves of a microgram? 5500 How many nanograms are there in one sixteenth of a milligram? 62500 How many nanoseconds are there in 99830.48 minutes? 5989828800000000 Convert 924442.8 centimeters to micrometers. 9244428000 How many millilitres are there in one twentieth of a litre? 50 How many minutes are there in three sixteenths of a week? 1890 What is 1/18 of a week in seconds? 33600 What is 2508.731nm in kilometers? 0.000000002508731 What is 45/2 of a gram in milligrams? 22500 What is 0.3672826 years in decades? 0.03672826 What is three fifths of a century in years? 60 What is 1/20 of a gram in micrograms? 50000 How many nanometers are there in 9.725273 meters? 9725273000 Convert 16020.02 centimeters to nanometers. 160200200000 How many millilitres are there in thirty-one halves of a litre? 15500 What is 9/10 of a litre in millilitres? 900 What is 3/10 of a gram in milligrams? 300 What is seventeen halves of a litre in millilitres? 8500 Convert 14.61228 millilitres to litres. 0.01461228 How many milligrams are there in sixty-one halves of a gram? 30500 How many micrograms are there in 71797.13mg? 71797130 Convert 16180346.7ms to weeks. 0.02675321875 What is 149767.8 millimeters in micrometers? 149767800 How many millilitres are there in 5.95035l? 5950.35 How many seconds are there in 182369.4 milliseconds? 182.3694 How many kilometers are there in 6.080951cm? 0.00006080951 How many litres are there in 0.052482ml? 0.000052482 What is 2055.7074 months in millennia? 0.17130895 How many millilitres are there in nine tenths of a litre? 900 What is one fifth of a century in decades? 2 What is 0.8908246 minutes in microseconds? 53449476 What is 6065.625um in nanometers? 6065625 How many nanometers are there in 75844.71m? 75844710000000 How many grams are there in one quarter of a kilogram? 250 Convert 2.39296cm to micrometers. 23929.6 What is 17172.258 months in millennia? 1.4310215 Convert 8411.183 kilometers to centimeters. 841118300 How many months are there in eighteen fifths of a decade? 432 What is 20457.4626ns in days? 0.0000000002367761875 What is sixty-four thirds of a day in hours? 512 Convert 0.1366872 hours to seconds. 492.07392 Convert 117.35433 milliseconds to hours. 0.000032598425 How many meters are there in 5.386827 nanometers? 0.000000005386827 What is 13/4 of a gram in milligrams? 3250 What is 86.02535 millilitres in litres? 0.08602535 How many micrometers are there in 3973.402 millimeters? 3973402 How many millilitres are there in twenty-one quarters of a litre? 5250 What is 8841.92 centuries in months? 10610304 Convert 7112.577g to nanograms. 7112577000000 How many kilograms are there in 3/8 of a tonne? 375 What is 3/5 of a litre in millilitres? 600 How many millilitres are there in 2619.755l? 2619755 How many decades are there in 0.3704958 months? 0.003087465 What is six fifths of a microsecond in nanoseconds? 1200 Convert 53.28231 days to milliseconds. 4603591584 How many minutes are there in 17/6 of a week? 28560 How many centimeters are there in 32942.09m? 3294209 How many nanograms are there in twenty-six fifths of a microgram? 5200 How many years are there in one tenth of a decade? 1 How many years are there in fifty-nine fifths of a decade? 118 How many milligrams are there in 19/4 of a gram? 4750 Convert 3.579861mg to kilograms. 0.000003579861 What is 8505.697 centuries in decades? 85056.97 How many meters are there in twenty-five halves of a kilometer? 12500 How many minutes are there in 5254.282 weeks? 52963162.56 Convert 26968690.8 microseconds to days. 0.000312137625 How many millennia are there in 18310.092 months? 1.525841 How many years are there in three tenths of a decade? 3 What is 161.88um in centimeters? 0.016188 How many years are there in 1/4 of a century? 25 What is one twentieth of a kilogram in grams? 50 Convert 9.712191kg to milligrams. 9712191 How many millilitres are there in twenty-seven fifths of a litre? 5400 Convert 25.29636 seconds to microseconds. 25296360 Convert 1232.854ml to litres. 1.232854 How many seconds are there in 7/2 of a hour? 12600 How many years are there in 3/25 of a millennium? 120 What is 21/4 of a millimeter in micrometers? 5250 How many millilitres are there in 26.3499 litres? 26349.9 How many centuries a	{ "pile_set_name": "DM Mathematics" }
he nearest 100000. 2800000 Let h be 1/(-11 + 3) + 3/24. Suppose -3a = 2q + 1, -q + 7 = -a - 3q. Suppose 117 = az - hz. Round z to the nearest 10. 40 Let l = -413 + 408.94. Let m = -14.024 - l. Let o = -10 - m. Round o to 2 decimal places. -0.04 Let s = 0.008 - 0.0165. Round s to 3 dps. -0.009 Let u = -6566.813 - -6573. Let i = u - -0.113. Round i to zero dps. 6 Let y = -5731.2137 - -5730.11234919. Let b = 0.3386484 - y. Let n = b + -1.44. What is n rounded to seven dps? -0.0000008 Let c = 317752.1764 + -317685. Let x = -0.0764 + c. Let z = x + -71. Round z to 0 decimal places. -4 Let m be (-376000)/660/8. What is m rounded to the nearest one hundred thousand? -500000 Let p = -27 - -13. Let m = p - 2. Let y = 16.0009 + m. Round y to three dps. 0.001 Let s be (-1)/(-4) - 87874/8. Let b = 6684 + s. Round b to the nearest one thousand. -4000 Let s(u) = -56600001u2 + 2u + 3. Let y be s(-1). What is y rounded to the nearest 1000000? -57000000 Let q = -45.0102 - -45. Round q to three decimal places. -0.01 Let a(s) = s*3 + 4s*2 + s + 4. Let z be a(-4). Suppose zg = g - 1715. Suppose -n = 3f - g, 0n + 565 = f - n. Round f to the nearest one hundred. 600 Let c = -24 - -40. Let x = c - 10. Let a = -5.999934 + x. Round a to 5 dps. 0.00007 Let r = 59 + -59.000092. What is r rounded to 5 dps? -0.00009 Suppose -4f + n = -904, 3f + f = -n + 896. Round f to the nearest 10. 230 Let u = -0.021 + 0.0449. What is u rounded to 3 decimal places? 0.024 Let g = 6 + -2. Suppose -5h = -gh + 4. Let f be (-2550006)/(-15) - h/(-10). What is f rounded to the nearest 100000? 200000 Suppose 0 = -5i - 1 - 224. Let g be (i/(-4))/(6/(-480000)). Round g to the nearest one hundred thousand. -900000 Let y = 21.2 - -124.8. Let i = -280.5292 + 134.529271. Let l = i + y. What is l rounded to 5 decimal places? 0.00007 Let w = 905.01 + -900. What is w rounded to one decimal place? 5 Let g = -26.6493 - 0.3037. Let r = -27 - g. What is r rounded to 2 decimal places? -0.05 Let k(d) = -7939d*2 + 7d - 4. Let v be k(4). Round v to the nearest ten thousand. -130000 Let o = 4.97 - 0.07. What is o rounded to the nearest integer? 5 Suppose -3u + 179281 = d, 3d - 169987 = -2u - 50464. Let c = -112760 + u. What is c rounded to the nearest ten thousand? -50000 Let r = 1 + -0.96. Let w = 0.0469 - r. What is w rounded to three dps? 0.007 Let t = -418.12 + 410. Let v = 0.02 + t. Round v to zero dps. -8 Let t = 7 + -13. Let p = 6.0000064 + t. Round p to six dps. 0.000006 Let u be (-10)/65 - 41/(-13). Suppose uc - 41884 = 87116. Round c to the nearest 10000. 40000 Suppose -187 = z - 0t - 2t, -4t - 20 = 0. Suppose 0 = h - 4l + 76, -4h + 3h = l + 66. Let c = h - z. Round c to the nearest ten. 130 Suppose -3q = -4b + 6b + 17, -b - 21 = 4q. Let f be 1 - 1/b - 33002. What is f rounded to the nearest ten thousand? -30000 Let f(p) = 311200p. Let s be f(-25). What is s rounded to the nearest one million? -8000000 Let p = 0.807 - 1.45. What is p rounded to one dp? -0.6 Let q = 111 - 110.999921. What is q rounded to five decimal places? 0.00008 Let t = 0 - -5. Suppose 4y - 4040000 = o, 0y = -ty - 3o + 5050000. What is y rounded to the nearest 100000? 1000000 Let c = -101.264 + 102. Round c to 2 dps. 0.74 Let q = 5.2 - 6.17. What is q rounded to one decimal place? -1 Let c = -1.7 + 3.5. Let d = -4226.929 - -4225. Let w = c + d. What is w rounded to 2 dps? -0.13 Suppose 0 = 2c - 5 + 17. Let t(f) = -5251f2 - 7f - 6. Let l be t(c). What is l rounded to the nearest ten thousand? -190000 Let m = -22.0145 - -22. Round m to 3 dps. -0.015 Let l = -9.60001 + 9.6. What is l rounded to 4 dps? 0 Let w = 0.044 + -0.043922. Let p = w + 0. What is p rounded to 5 dps? 0.00008 Let y = 7 + -5. Suppose 0 = 2w + yw + 4800. What is w rounded to the nearest one thousand? -1000 Suppose -3p - 4f + 2f = 35396, 2f + 11796 = -p. What is p rounded to the nearest one thousand? -12000 Let j = -292.9999801 - -293. What is j rounded to six decimal places? 0.00002 Let n = -144 + 147.47. Let l = 0.03 + n. Let u = -3.4946 + l. What is u rounded to 3 decimal places? 0.005 Let d be (182000/15)/((-1)/(-150)). What is d rounded to the nearest 100000? 1800000 Let r = 0.15 + -0.150005. What is r rounded to six dps? -0.000005 Let f = 102 + -101.99814. Round f to 4 dps. 0.0019 Let d = -0.2 - -0.3. Let t = -0.7 + d. Let g = t + -2.2. What is g rounded to the nearest integer? -3 Let f(v) = v3 - v2 - 2v - 4. Let z be f(3). Suppose 5n + z = 3h, 2n - n = h - 2. Let g be -1 - (0 - (h - -20)). Round g to the nearest 100. 0 Let x = -11.502 + 2.192. Round x to 0 decimal places. -9 Let n be (1/2)/(8/192). Round n to the nearest 10. 10 Suppose q = -4h + 639, -4q + 142 = h - 14. Round h to the nearest 100. 200 Let n = 7 + 8. Let t = n - 15.4125. Let o = t + 0.4. What is o rounded to 3 decimal places? -0.013 Let d = 39.3 - 36. Let a = d + -3.337. What is a rounded to 2 decimal places? -0.04 Let a = 123117355455654.80669933 + -123117353899904. Let l = a + -1555828.8067. Let b = l - -78. Round b to 7 decimal places. -0.0000007 Suppose -z = 180369 + 546778. Suppose y + 3y = 5828588. Let f = y + z. What is f rounded to the nearest one hundred thousand? 700000 Let k = -137 - -94. Let a = -42.28 - k. What is a rounded to 1 dp? 0.7 Suppose -4p - 1 = 4k - k, -4 = p + 2k. Let i be p3/(-12)-3400. Round i to the nearest 1000. 2000 Let u = 18.168 - 18. Let d = -1244618.1679933 - -1244618. Let c = u + d. What is c rounded to six dps? 0.000007 Let h = 31740.699892 - 31741. Let u = h - -0.3. What is u rounded to five dps? -0.00011 Let l = 12.05 + -12. Round l to two decimal places. 0.05 Let q = 200 - 81. Let z = 119.0000157 - q. What is z rounded to 6 decimal places? 0.000016 Let t be (-352000)/(-4)(-1)/2. What is t rounded to the nearest 10000? -40000 Let g = -18.4 + 1.4. Let r = 16.9978 + g. Let p = r - -0.008. Round p to three dps. 0.006 Let a be (6/(-4))/(3/(-4)). Let p(l) = -5l*2 - 427l*3 - 822l3 - la. Let z be p(6). What is z rounded to the nearest 100000? -300000 Suppose 158 = f - 1142. Round f to the nearest 100. 1300 Suppose 0 = t - 0t - 5722. Let b = t + -13722. What is b rounded to the nearest one thousand? -8000 Let d(j) = -1461j*3 + j. Let q be d(-1). Round q to the nearest 100. 1500 Let m = -146.000126 + 146. Round m to 4 dps. -0.0001 Let f = 8676 + -15156. Round f to the nearest one thousand. -6000 Let y be 5 + 2/(-2) + 0. Suppose 0 = -5c + f + 74, yc - 2f + 0f - 58 = 0. Let l = c - 5. What is l rounded to the nearest one hundred? 0 Let t(w) = -1240000w. Suppose 0b + v + 10 = 2b, 4v = b + 2. Let r be 9/b(-10)/(-3). Let h be t(r). What is h rounded to the nearest 1000000? -6000000 Let i = -31.603 - 22300.397. Let k = 22326.0014 + i. Let b = k - -6. What is b rounded to 3 decimal places? 0.001 Let n be ((-180)/42)/(2/252). Round n to the nearest ten. -540 Let o = 705630364.94407 + -705637955. Let x = -7590 - o. Let q = x - 0.055. Round q to four dps. 0.0009 Let l be 6/(-21) + (-58)/(-7). Let y = -6 + l. Suppose -2150000 = -3u - yu. Round u to the nearest 100000. 400000 Let p = -1.6 + -6.36. Let r = 8 + p. What is r rounded to one decimal place? 0 Let b = -71.937 - -72. Round b to 2 dps. 0.06 Let o = 1.56 - 0.6. Let m = o + -1.2. What is m rounded to two decimal places? -0.24 Let w = 57 + -57.00058. What is w rounded to four decimal places? -0.0006 Let a = 41 - -1. Let z = a - 40.04. Let g = z + -2. Round g to 2 decimal places. -0.04 Suppose 5 + 3 = s. Suppose g = r - 0g - 14, 4r - 46 = -g. Let h = r - s. What is h rounded to the nearest ten? 0 Let q = -18 - -28. Let c be q/(-75) - (-105002)/15. What is c rounded to the nearest 1000? 7000 Suppose 6l - 2l = 72000000. Suppose y + y + l = 0. What is y rounded to the nearest one million? -9000000 Let x be 4/18 - 88/72. Let b be (x - -1)/(0 + 2). Suppose b = -q + 3*q - 116000. What is q rounded to the nearest 10000? 60000 Let c = 56 + -55.99977. What is c rounded to five decimal places? 0.00023 Let w = -1979 - -907. Let j = 791 - 359. Let u = j + w. Round u to the nearest 100. -600 Let b = 10.2 - 5. Let n = b + -1.1. What is n rounded to zero dps? 4 Let n = 9.9982 - 10. Round n to three decimal places. -0.002 Let p = 22 + -16.	{ "pile_set_name": "DM Mathematics" }
(135)/(sqrt(9)/sqrt(3)) + sqrt(90)/(1sqrt(2)) + sqrt(45))/(((2sqrt(72) - sqrt(72)) + sqrt(72))/sqrt(8) + 1sqrt(9)2). 3sqrt(5)/4 Simplify (5-3sqrt(19)1-5 + 21sqrt(19)1-2)2. 95779 Simplify 6(sqrt(63)/(sqrt(1575)/sqrt(7) + sqrt(9))-4)23. 56 Simplify (((sqrt(7) + sqrt(252) - (sqrt(7) + sqrt(315)/sqrt(5))) + 2)-6)2. 432sqrt(7) + 2412 Simplify -4(-1sqrt(400) - sqrt(400))/(-2sqrt(8)). -20sqrt(2) Simplify 0 + -3 + ((sqrt(1377) + 1 + sqrt(1377) + 2 - sqrt(1377)) + sqrt(1377) - sqrt(1377))2 + (4 + 0 + sqrt(1377))2-3. -2796 - 162sqrt(17) Simplify (sqrt(2940)-2-2)/(sqrt(84)/(sqrt(56)/(sqrt(16)/sqrt(2)))). 28sqrt(5) Simplify ((((sqrt(200) - sqrt(200)-2) + sqrt(200))1)/(-5sqrt(256)-3))2. 1/18 Simplify (-2(-2sqrt(4131) - sqrt(4131)))/((-2(sqrt(12) + sqrt(300)))/sqrt(4)). -9sqrt(17)/2 Simplify (-2((sqrt(70) - 1sqrt(70)) + sqrt(70))5)/((2sqrt(90)2 + sqrt(90))/sqrt(9)). -2sqrt(7) Simplify (23sqrt(8))/((sqrt(24) + (-3sqrt(24) - sqrt(24)))/sqrt(6)). -2sqrt(2) Simplify (-2(-1sqrt(294) + sqrt(6)))/(sqrt(15)/sqrt(5)-5 + sqrt(6)/sqrt(2)6). 12sqrt(2) Simplify (-5 + 0 + sqrt(539) - sqrt(539))-4 + 4-2-2sqrt(539). 20 + 112sqrt(11) Simplify ((sqrt(18) + -2sqrt(18))-1)2 + 2-1sqrt(2) + sqrt(2) + sqrt(2) + 0 + sqrt(2) + -5. sqrt(2) + 13 Simplify (-1sqrt(153)4 - (0 + sqrt(153) + 1 + sqrt(153)) - (-5 + sqrt(153) + 0 + 4))2. 7497 Simplify (5sqrt(1573)3-61)2. 12741300 Simplify -2sqrt(1216)1 + -2 + 4 + sqrt(2736)-1 + 3. -28sqrt(19) + 5 Simplify -5 + (-4(3sqrt(91)/sqrt(7))2 - ((-1 + 2sqrt(117))*2 - sqrt(117))). -942 + 15sqrt(13) Simplify (sqrt(88)/((sqrt(4) - sqrt(4)2)-2))/(-3sqrt(1331)-5). sqrt(2)/330 Simplify (((4 + 2sqrt(1700) + sqrt(1700))6 + 3)2-3)*2. 349920sqrt(17) + 19855044 Simplify (1 + (3sqrt(52)/sqrt(4)2)*2)-6 + -5. -2819 Simplify 2((1(sqrt(1573) + -3) + 3(sqrt(1573) + -2))-4)*2. -25344sqrt(13) + 807968 Simplify sqrt(12)/(sqrt(4) - (sqrt(24)/(sqrt(216) - sqrt(6)) - sqrt(4))) - ((sqrt(3) - (sqrt(24)/sqrt(8) + 3)*2) + 3). 9 + 50sqrt(3)/9 Simplify ((sqrt(66) + -1sqrt(66)1)4)/(sqrt(726)-2 + -2sqrt(486) + sqrt(486)). 0 Simplify 0 + (2sqrt(209)1)/sqrt(11)2. 4sqrt(19) Simplify ((sqrt(4131) + sqrt(4131)-1 + sqrt(4131) - sqrt(4131))-6)/(sqrt(27)/((1sqrt(81))/sqrt(9))). 0 Simplify (-4 + (((sqrt(130) - sqrt(130)3 - sqrt(130)) + sqrt(130))/sqrt(10) - (sqrt(91)/sqrt(7) + 1)))5. -15sqrt(13) - 25 Simplify (sqrt(105)/(sqrt(7) + sqrt(63)/(1sqrt(9))))/(((sqrt(385) + 2sqrt(385))/sqrt(11))/sqrt(7)). sqrt(3)/6 Simplify (1(sqrt(130)-1 + sqrt(130)))/((sqrt(10) + sqrt(50)/sqrt(5) + sqrt(10))-3) + -3. -3 Simplify (2 + (-2sqrt(75) - (-1sqrt(243) + sqrt(243) - sqrt(3))) + 2)*2. -72sqrt(3) + 259 Simplify 51(sqrt(637) + -1 + sqrt(637))*2 - 6(-1 + (sqrt(637) - (sqrt(637) + 3))). -140sqrt(13) + 12769 Simplify -3 + -4 + (-1 + sqrt(18))-2. -6sqrt(2) - 5 Simplify (-1 + sqrt(700))3 - (sqrt(49)/(sqrt(7) - -3sqrt(112)))2. -514/169 + 30sqrt(7) Simplify -2 + ((sqrt(168) + (sqrt(168) - -1sqrt(168)) - sqrt(168))/sqrt(7))/(sqrt(8) + (1sqrt(80) - sqrt(80))/sqrt(10)). -2 + 2sqrt(3) Simplify ((sqrt(242) + -1 + sqrt(242) + 5)-3 - (-3(sqrt(242) + 0) + (sqrt(242) - 6(-1 + sqrt(242) - sqrt(242)))))*2. 1584sqrt(2) + 4196 Simplify (sqrt(171) + (sqrt(171) - (-2(sqrt(171) + sqrt(171)5) - sqrt(171))))/(sqrt(72)/sqrt(1152)). 180sqrt(19) Simplify 4 + -5((sqrt(112) + 2)6 + -3). -120sqrt(7) - 41 Simplify -1 + (sqrt(121) - (sqrt(121) - -32sqrt(121)))/(3sqrt(99) + sqrt(99)). -sqrt(11)/2 - 1 Simplify (sqrt(100) + sqrt(100) + sqrt(100)-1-4 + sqrt(100))/(-1sqrt(2)1)-2. 70sqrt(2) Simplify ((sqrt(108) - (2sqrt(108) + sqrt(108)) - sqrt(3)) + sqrt(147)-1 + (sqrt(168)/sqrt(112))/(1sqrt(128)))*2. 305283/256 Simplify -4 + (((sqrt(4320) - sqrt(4320)-3) + sqrt(4320) + sqrt(4320))/(sqrt(120)/sqrt(3)))*2 + 1. 3885 Simplify (2 + (sqrt(660)/(sqrt(12) + sqrt(108)/sqrt(9)) - sqrt(55))/(sqrt(1100)4 + sqrt(1100) - sqrt(11))-1)2. 2sqrt(5)/49 + 38421/9604 Simplify ((-1-2sqrt(84) + sqrt(84))4)/(sqrt(84)/(sqrt(7)1) + (sqrt(12) - (sqrt(192)/sqrt(4))/sqrt(4))). 12sqrt(7) Simplify (3 + sqrt(125) + -4(sqrt(125)3 + sqrt(125)) + 0 + sqrt(15)/sqrt(27))2. -448sqrt(5) + 250961/9 Simplify (sqrt(78) + (-2sqrt(78) - sqrt(78))-1 + (sqrt(78) - (sqrt(78) + 1(-1sqrt(78) + sqrt(78)) + sqrt(78))))/((sqrt(540)-1)/sqrt(10)). -sqrt(13) Simplify ((1 + sqrt(80) + -4 - -1sqrt(80)-2) + 4)2-4. -324 + 32sqrt(5) Simplify -3 + 0 + -1sqrt(252)4 + 1. -24sqrt(7) - 2 Simplify -5 + (5(sqrt(11)-11 - sqrt(11))2 - (-6(sqrt(33)/sqrt(3))*2 - sqrt(44)/(2sqrt(4)))). sqrt(11)/2 + 281 Simplify (sqrt(26)-16)/(sqrt(72)-5). sqrt(13)/5 Simplify -5 + -5((sqrt(119) - (sqrt(119) - -2sqrt(119)))/sqrt(7) + sqrt(102)/(sqrt(6)2)). -5 + 15sqrt(17)/2 Simplify -4((sqrt(605)3 + sqrt(605))2-2 + -2 + sqrt(605) + sqrt(605) + -4) + 0. -88sqrt(5) + 77464 Simplify 5 + (-1-5sqrt(108)-11)2. 2705 Simplify (((sqrt(76)4 + sqrt(76))-1 - sqrt(76))/(sqrt(252)/sqrt(7)))2. 76 Simplify (sqrt(4)/(2sqrt(288) + sqrt(2)) - -4sqrt(14)/(sqrt(21)/sqrt(3)))2. 20402/625 Simplify 6((2(sqrt(288) + 4))2 - (-1 + sqrt(288))6). 1872sqrt(2) + 7332 Simplify 3((sqrt(16)/(-2sqrt(8) - sqrt(8)))2 - (sqrt(72)2 + sqrt(72) - sqrt(72))) + -3. -36sqrt(2) - 7/3 Simplify (-1(-13(sqrt(605) + 1) + -1))*2. 264sqrt(5) + 5461 Simplify 5(3(sqrt(72) + 0) + sqrt(24)/sqrt(300) + -2). -10 + 91sqrt(2) Simplify (3(sqrt(76) - sqrt(76)-1 - sqrt(76)))/sqrt(144)-5. -5sqrt(19)/2 Simplify -3(sqrt(608)-4)/(sqrt(2) - (sqrt(20) - sqrt(1280))/sqrt(10)). 6sqrt(19) Simplify (54(-4 + (sqrt(192) - (sqrt(192) - (sqrt(192) + -2)) - sqrt(192))-6 + -3))2. 10000 Simplify (16(5 + -2(sqrt(108) + sqrt(108) + (sqrt(108) - (sqrt(108)-1 + -5 - sqrt(108))))))2. 21600sqrt(3) + 389700 Simplify (sqrt(13)-25 + (-1 + sqrt(13))-3 + (1 + sqrt(13) + -4 - sqrt(13)) + (sqrt(130) + -1sqrt(130) - sqrt(130))/sqrt(10))2 + 1. 2549 Simplify (sqrt(468) + sqrt(468) + (sqrt(468) + sqrt(468) + -3)2 + sqrt(468))-4 + sqrt(468) + (sqrt(156) + 52sqrt(156) + sqrt(156) + sqrt(156))/sqrt(12). -7524 + 235sqrt(13) Simplify (3 + (sqrt(1900)3 - sqrt(1900)) + -3)-2. -40sqrt(19) Simplify ((sqrt(325) + -2 + sqrt(325) - sqrt(325)) + -4)2 + 3 + -1. -60sqrt(13) + 363 Simplify (sqrt(75)-2 - (sqrt(21)/(sqrt(7)1))*2) + (-1 + sqrt(108) - (-6(1 + sqrt(3)) - sqrt(3)))*2. 120sqrt(3) + 529 Simplify (66(sqrt(187) - 1sqrt(187)))/(2(sqrt(275) + sqrt(275) + sqrt(275) + sqrt(275)-2)). 0 Simplify (-4sqrt(84)-2-3)/((sqrt(972) + sqrt(972)3)3). -2sqrt(7)/9 Simplify sqrt(95)/(sqrt(245)2) + -3 + (sqrt(228) + sqrt(228)-4)/sqrt(12). -41sqrt(19)/14 - 3 Simplify (2(sqrt(343) - ((sqrt(343)2 - sqrt(343)) + 5) - (sqrt(343) - (-3 + sqrt(343) + 0))))*2 + -2. 254 Simplify 5 + (-1 + -4sqrt(243) + -1 + 3sqrt(243))2 + -3. 36sqrt(3) + 249 Simplify ((0 + (-2 + sqrt(243) + 0 + sqrt(243) - sqrt(243) - sqrt(243)) - (0 + sqrt(243) + 4 - (sqrt(243) + sqrt(243) + 1 + 3)))-3)2. -324sqrt(3) + 2223 Simplify ((sqrt(539) - (1sqrt(539) + 3)) + -1)22-4. -128 Simplify 6(-4sqrt(896))/(-3sqrt(24)/sqrt(3)). 32sqrt(7) Simplify 5(0 + 1 + sqrt(4)/sqrt(2) + -1 + sqrt(18) + ((2sqrt(20))/sqrt(10) - 2sqrt(18))). 0 Simplify (sqrt(1053)-2 - (sqrt(637) + 1) - (sqrt(1573) + sqrt(1573) + -2 + 4))2. 282sqrt(13) + 28726 Simplify ((sqrt(104)/sqrt(2)1)/sqrt(2))/((sqrt(64)/(sqrt(8)/sqrt(2)))/sqrt(8)). sqrt(13) Simplify 5(5 + -1sqrt(128))-1-6. -240sqrt(2) + 150 Simplify -4 + ((sqrt(704) - (sqrt(704) - (-1sqrt(704) + -4 + sqrt(704)))) + sqrt(704) + sqrt(704) + sqrt(704) + (sqrt(704)-1 - sqrt(704)) + 0)*2. -64sqrt(11) + 716 Simplify (5sqrt(720)1 + -4 + sqrt(720) + 0 + sqrt(720) - ((sqrt(5) - ((sqrt(45)-1)/sqrt(9) + sqrt(5))) + (sqrt(5) - sqrt(125)-1)))*2. -616sqrt(5) + 29661 Simplify -2(sqrt(75) + -5(1 + sqrt(75)) - (sqrt(75) + 4sqrt(75) + -1 + sqrt(75)))22. -30064 - 1600sqrt(3) Simplify 1(sqrt(352) - (((sqrt(352) + -2sqrt(352) - sqrt(352)) + sqrt(352))2 - sqrt(352)))/(-5sqrt(288)1). -4sqrt(11)/15 Simplify ((sqrt(204)-2 + sqrt(204))/sqrt(12) - (1 + -2sqrt(17))) + (sqrt(1700)-1 - sqrt(1700)) + 2. -19*sqrt(17) + 1 Simp	{ "pile_set_name": "DM Mathematics" }
- 44. Let a be q(-6). Which is bigger: a or 833? 833 Let h = -298 + 298. Are 24 and h equal? False Let o(p) = -p - 15. Let x be o(-15). Let v be -3 + (x - 3) + 3. Let d = v + 11/3. Which is smaller: 2/41 or d? 2/41 Let j be 717/262944/(-6). Let h(t) = 4t. Let l be h(1). Suppose -5c - 3v = 30, 0 = c - lv + 3 + 26. Which is greater: j or c? j Let q be (-1)/(-6) + 7 + 180/(-27). Which is smaller: q or -299? -299 Let k = 0.3 - 0.2. Let u = 0 - k. Let x = 274/623 - 1/89. Is u not equal to x? True Suppose -r + 19 = -22. Let g be 175/30 + -6 + r/(-6). Is -5 less than or equal to g? False Let h(n) = -79n + 475. Let y be h(11). Which is smaller: -391 or y? y Let a = -166 + 184. Which is bigger: 1 or a? a Let u be 34/(-51)30/(-4). Suppose -2m - 10 = uf, 16 = -2f - 4m - 4. Which is smaller: f or -1? -1 Let a(l) = -4l - 7. Let u = -16 - -19. Suppose -x - 3x + 22 = -3p, -ux + 3 = 0. Let o be a(p). Is 17 > o? False Let z = 74 + -72. Suppose 5h = -zl + 24, 3l - 5h + 10 = -2l. Is 7/4 equal to l? False Let d = 0.052 - 89.052. Let b = 130 + d. Which is bigger: b or 0.1? b Let v be (102/119)/(3/469). Which is greater: 132 or v? v Suppose 2c + 5n + 19 = 0, 0 = -c + 2n - 4 + 17. Let x be ((-12)/20)/((-1)/5). Suppose -c = -2g + x. Are g and -1 unequal? True Let z = -2 + 7. Let h = 10 - z. Let l = h - -2. Are 1 and l unequal? True Let p(w) = -w*2 - 1. Suppose v + 5 = 0, 19 = -t - v - 3v. Let a be p(t). Which is smaller: -1 or a? a Let n = -565/3 - -189. Which is smaller: n or 0? 0 Let y(w) = w*2 - 4w + 1. Let m be y(5). Let a(i) = -i*3 + 5i*2 - 5i - 3. Let t be a(4). Let x be (t/14)/((-2)/4). Are m and x equal? False Suppose -17q + 45 = -12q. Let b = q + -17. Is b not equal to -11? True Let o = -17.15 - -17.25. Are o and 2/1689 non-equal? True Suppose 2z - 46 = -4a, 2z - 3a - 33 = -z. Suppose -35 + z = 4k. Does 0 = k? False Let p = 13789/325010 - -2/4643. Let a = 4 + -3. Which is smaller: p or a? p Suppose 3d = 5i + 22, -9 = -2i - 5d + 7. Let q be (2 + -5)1i/6. Which is greater: q or -2/199? q Let o be (-1)/(-21/(-2)). Let r be (o - (-3)/3) + 2/(-169). Which is bigger: r or 1? 1 Let f = -2/935 - -32731/2805. Suppose 44b - 1018 = -33b - 94. Which is bigger: b or f? b Suppose 2v - 99 + 12 = 5k, 111 = 3v - k. Let s be (12/v)/(1/(-3)). Let o be ((-12)/168)/(s/4). Do o and -1.8 have the same value? False Suppose -3q - 5r = -3, 3q + 2r = 4r + 24. Let a(x) = -8x - 17. Let t(k) = -3k - 6. Let w(i) = -4a(i) + 11t(i). Let d be w(1). Is q equal to d? False Suppose 4y - 4 = 4v, v = 4 - 5. Let t = -5731/66045 + 2/1887. Are t and y unequal? True Let b = 612 + -618. Which is bigger: -93 or b? b Suppose -4k + 20 = 0, -c - 19 = -2c - k. Which is bigger: 18 or c? 18 Let i = -22 + 44. Let o be i/(-77) - 16/(-7). Which is greater: 12/13 or o? o Suppose 0 = -f - w + 11, -6f - 2w = -3f - 31. Is f > 8? True Let u be ((-1)/30)/((-3)/(-6)). Let t = 6 - 5.9. Is t at most u? False Let l = -317 - -323. Let r(y) = y2 + 4y - 7. Let d be r(-6). Is d < l? True Let w be (-9)/(-42)(-2 + -2). Suppose 2a - 16 = -2f - 2f, -60 = -3a + 3f. Suppose 14 - a = l. Which is greater: l or w? w Let m = -0.93 + -26.07. Which is smaller: m or 0.1? m Let l = 22 + -23.8. Let i = l - -1.75. Let o = -11.95 + i. Is 0 < o? False Let w(x) = 14x. Let l be w(1). Suppose -10o + lo = 0. Which is bigger: -1/6 or o? o Let a = 1 + 3. Suppose al - 25 = 11. Let h = 118 + -117. Is h != l? True Let n be 1 - (-1 - 1)17. Suppose 3h + 1 = -14. Let g(l) = -6l + 6. Let x be g(h). Is x bigger than n? True Let c = 796/7 - 114. Do c and -0.1 have different values? True Let p be (-1 + 3)/(2/3). Let a(x) = -x2 - 10x - 11. Let d be a(-7). Let q(l) = l*2 - 11l + 14. Let t be q(d). Which is smaller: p or t? p Let n be 1 + (-1)/(-4) + -1. Let a be 0 - (-3 + 2) - (0 + -44). Let r be a/25 - 4/5. Is n smaller than r? True Let p = 22843/35 + -3089/5. Let n = 1222/35 - p. Which is bigger: n or 0? n Let d(b) = 18b + 39. Let a be d(6). Let s = -86 + a. Are s and 61 non-equal? False Let m(s) be the third derivative of 0s*4 + 1/60s*5 + 0s + 0s3 + 6s*2 + 0. Let h be m(-2). Is h equal to 2? False Let m = 0.21 - 0.02. Let w = -0.51 + m. Which is bigger: w or 1? 1 Suppose -n = -0 + 3. Let v = 31 - 29. Let h be 1/v(-36)/6. Do n and h have the same value? True Suppose -5 = 2o + 139. Suppose 0 = -2x + 10, 3u = -6x + x - 188. Is o >= u? False Suppose -5a + 67 - 12 = 0. Suppose ar + 20 = 16r. Suppose 0l + 4l + r = 0. Is -2 at most as big as l? True Let q be (2/12)/(1/4). Let z be 30/100(-16)/12. Which is greater: q or z? q Suppose 11i - 18 - 4 = 0. Suppose -2k = -3d + 3, 3d - i = k + 1. Is -4/3 at most k? True Let z = -144 + 94. Let d = z - -50. Is -3 at least d? False Let w = -157 - -151. Let a be 28/(-33) + (-4)/w. Suppose r - 10 = -5d, -3r + 2 + 0 = d. Is a smaller than r? True Let g = -26.543 - -26.55. Suppose 3y + 8 = -o - 3o, -2o - 4 = y. Which is smaller: y or g? y Let d be (-5)/(1/1) + (-2187)/(-435). Are d and -1 nonequal? True Let f(a) = -a2 - 10a + 4. Let j be f(-10). Is j at least -2? True Let y = 18.7 - 18. Let l = -6.884 + 9.884. Which is smaller: y or l? y Let t = 696 - 30629/44. Let s = 1943/11 - 177. Let j = t - s. Is j <= -2? False Suppose 68 - 133 = -5t. Which is smaller: 10 or t? 10 Suppose -29n - 9 = -26n, 5g + 3n = -909. Is -180 at most as big as g? True Let o be (-40)/(-140)(-1 - -8). Suppose -5k - 93 = 4l, k + 13 = -0k + ol. Is -17 bigger than k? False Let o = 385.7 + -385. Is o at least 15/4? False Suppose 0 = 2m + 5a + 760, 2m = 3m - 4a + 354. Let s be ((-1)/m)/(2/(-8)) + 0. Is s > 1? False Let w = 0.4 - 0.5. Let x = w + 0.2. Suppose -11 = 290f - 279f. Is x greater than or equal to f? True Let x = 0.348 + -1.348. Is x equal to -259? False Suppose 0g - 3094 = -14g. Let k be 26/g - (-208)/(-34). Let x = -9 - -4. Is k at most x? True Let y = -1356 + 9508/7. Let u(v) = -v3 + 5v*2 - 2v + 11. Let w be u(5). Is y < w? False Let u be (-1)/2(-7)/56. Let y(a) = -9a - 2. Let h be y(-1). Let i be 6/(-27) + h/(-9). Is i not equal to u? True Let y = 7.9 - 7.8. Let v = -0.1305 + -8.7795. Let w = v + 9. Which is smaller: y or w? w Let x = 163.9 + -164. Do -6/95 and x have the same value? False Suppose -2j - 2m + 158 = 0, 385 = 5j + 20m - 25m. Which is smaller: 79 or j? j Suppose 0 = 2i + 50i - 572. Let k(t) = -t - 1. Let m be k(-12). Are i and m equal? True Let x(h) = -h3 - 17h*2 + 2h + 13. Let f be x(-17). Let d be ((-3)/f)/((-1)/3). Is -1 smaller than d? True Let l = 4.67 + -4.97. Is 0.04 greater than l? True Let n = -17.8 + 16. Let o = -1.9 - n. Let p = o - 0.1. Is p bigger than 0.05? False Let l = -302.51 - -304. Is 1 >= l? False Let h = 859 + -1367. Let w = h - -916. Let c be (-88)/w + 2/6. Which is bigger: c or 1? 1 Suppose -4k + 8 = -0. Suppose -3b = -o - 7, ko + 7 + 3 = 4b. Is 2 bigger than b? False Suppose p - 4a - 34 = 0, p = -38a + 39a + 19. Which is smaller: 13 or p? 13 Let p = 0.441 - 0.341. Let t be (-1)/(-4) - 276/16. Is t at least as big as p? False Suppose 10h = 5h - 5. Which is smaller: 20 or h? h Let t = 549 + -1648/3. Let o = -3.9 + 4.07. Which is greater: o or t? o Let d = 0.28 - -0.01. Let t = 0.09 - d. Let c be -6 + 2 - 38/(-10). Is c at least t? True Let q(d) = -d3 + 21d*2 - 17d - 54. Let v be q(20). Which is greater: v or -3.5? v Suppose -3v = -y + 13, -43 + 0 = 3v + 5y. Let u = 348/35 - 106/7. Is v at most as big as u? True Suppose 2w + 10 = 3w. Let d = w + -12. Let y be (-1 - -2) + d/3. Which is smaller: y or 1? y Let w(x) = -x + 4. Suppose 0 - 8 = -2a. Let c be w(a). Let q = -24 + 790/33. Which is smaller: c or q? q Let g = 2.2 + -2. Let s = 11 + -18.1. Let c = 7 + s. Is g less than or equal to c? False Let a = -6/47 + 244/1175. Let r be (-9 - -9)/(2 - 1). Which is greater: r or a? a Suppose 37u - 48u = 0. Are u and -5/177 non-equal? True Let g = 63.62 + 3.98. Let t = 67 - g. Is t not equal to -1? True Let b = -148.3 - -144.5. Which is greater: b or 1? 1 Let j = 149 - 279. Let c = j + 129.94. Is c not equal to 1/5? True Let p(o) = 14 + 1 + 7o - 5o - 4o. Let u be p(5). Is 7 equal to u? False Let t = 2514 + -2515. Let z(h) = h3 + 7h**2 +	{ "pile_set_name": "DM Mathematics" }
(-5)/(-3). Let a(p) = gd(p) + n(p). Let z(b) = -14b. What is a(z(j))? 28j Let j(b) = -40b*2. Let h(k) = 3k + k + 3k - 6k. What is h(j(c))? -40c2 Let h(o) = -2o. Let p(m) be the second derivative of 0m3 + 0m*2 - 1/6m*4 + 0 + m. Calculate h(p(c)). 4c*2 Let t(l) = 5l. Let k(j) = -2723j2. Determine t(k(f)). -13615f*2 Let g(h) = 20h*2 - 82h. Let i(b) = -6b. Determine g(i(t)). 720t*2 + 492t Let c be (3/2)/(5/(-10)). Let d(q) = -4q + 3. Let b(l) = l - 1. Let k(f) = cb(f) - d(f). Let i(h) = -h2. Determine i(k(g)). -g2 Let c(h) = 297h2 - 88h. Let r(s) = -17s2 + 5s. Let y(j) = -5c(j) - 88r(j). Let f(v) = 3v2. Give y(f(m)). 99m*4 Let l(h) = 3h*2. Let r(d) be the first derivative of 3d*3 + 2. Give r(l(j)). 81j*4 Let i(c) = -42c - 35. Let k(s) = s + 1. Let l(o) = i(o) + 35k(o). Let r(h) = 3h. Let z(t) = 2l(t) + 5r(t). Let u(m) = m2. Give z(u(w)). w2 Let b(f) = -6f - 8. Let i(c) = -5c - 6. Let d(o) = 3b(o) - 4i(o). Let j(h) = 84h2. Calculate d(j(l)). 168l2 Let x(b) = b2. Let h(o) be the first derivative of 0o - 9 - 3/2o*2. What is h(x(k))? -3k*2 Let p(t) = 2t. Let z(i) = -i. Let l(m) be the first derivative of -3m2 - 2. Let d(s) = -l(s) + 5z(s). Give p(d(b)). 2b Let y(h) = -707h + 1. Let r(c) = 6c2. Determine y(r(k)). -4242k*2 + 1 Let w(q) = 37 - 15 - 22 - 15q*2. Let g(b) = -b. Give g(w(o)). 15o*2 Let r(q) be the third derivative of -3q*5/10 - 80q*2. Let o(p) = 2p + 2 - 2. Determine r(o(z)). -72z2 Let q(z) = -16z. Let c(j) = 3j. Let g(v) = -22c(v) - 4q(v). Let i(f) be the first derivative of 10f*2 + 1. Calculate i(g(d)). -40d Let c(w) be the third derivative of w*6/180 + 2w*3/3 - 4w*2. Let j(a) be the first derivative of c(a). Let v(y) = -4y*2. Determine j(v(p)). 32p*4 Let t(a) = -50a*2 + 25a*2 + 24a*2. Let v(u) = u + 3u - 2u. Calculate t(v(q)). -4q*2 Let f(z) = -3z. Let k(a) = -a*3 + 24a*2 + 2. Let q be k(24). Let u(s) be the first derivative of -1/3s*3 + q + 0s*2 + 0s. What is u(f(y))? -9y2 Let o(m) = -5m*2. Suppose 3n - 4b = b + 2, -3b + 6 = 0. Let t(y) = -y*2 - 4y*2 + 0y*2 + ny*2. What is o(t(r))? -5r*4 Suppose -3u - 3h + 24 = 0, -5u + 5h = 4 - 34. Let x(o) = -2o - uo + 2o + 8o. Let j(r) = -4r*2. Determine j(x(w)). -4w2 Let m(a) = a2. Let i = 7 + -4. Suppose 9 = 4l - i. Let w(s) = ls + s - 4s - s. Give m(w(j)). j2 Let m(j) be the third derivative of j5/5 - 11j*2. Let b(u) = 2u. Calculate b(m(k)). 24k2 Let o(n) = n. Let h(z) = 2082z*2. Calculate o(h(v)). 2082v*2 Let u(z) = -18z*2. Let d(q) = -230q*2. Calculate d(u(i)). -74520i4 Let u(z) = -z2. Let w(c) = -5c2. Let k(a) = -22u(a) + 4w(a). Let h(m) = 11m. Calculate h(k(y)). 22y2 Let q(v) = -3v. Let u(z) = -z*2 - 3z + 4. Let a be u(-4). Let n(p) be the second derivative of 0p2 + 1/3p*3 + 2p + a. Determine n(q(l)). -6l Let f(h) = -2h*2. Let p(t) = -23t. Let a(i) = -126i. Let c(y) = -5a(y) + 27p(y). What is f(c(u))? -162u*2 Let x(b) = -6b. Let y = 7 - 5. Let f(s) = 0s2 + 0s*y + 3s*2 - 2s*2. Give f(x(p)). 36p*2 Let f(y) = 2y2. Let d(j) be the second derivative of j4/6 + 12j. Calculate f(d(u)). 8u4 Let b(j) = -j2. Suppose 0 = 4o + 1 - 9. Suppose 0 = q - g + og - 2, -5q = g - 2. Let p(s) = qs - 4s + s. What is p(b(i))? 3i*2 Let s(y) = -6y*2 - 9y*2 - 5y*2 + 17y*2. Let c(k) = 20k - 25. Let d(h) = -5h + 6. Let j(l) = -6c(l) - 25d(l). What is s(j(x))? -75x*2 Let r be 3(2/(-6) + 1). Let t(z) = -4z2 - 2z*2 + 3z*r + 2z2. Let s(u) = u. Determine s(t(y)). -y2 Let r(g) = 391g2. Let l(m) = -m2. What is l(r(o))? -152881o4 Let a(t) = -t2. Let v(l) = -338l. What is v(a(j))? 338j*2 Let p(w) = 4w*2 - 4w. Let v(r) = -9r. Give p(v(m)). 324m*2 + 36m Let g(z) = -z*2 + 2z - 2. Let r(u) = 5u2 - 11u + 11. Let p(s) = -11g(s) - 2r(s). Let t(h) = 0h2 - h2 + 2h2. Give t(p(m)). m4 Let p(o) = 3o. Let l(t) = 59t*2. What is l(p(f))? 531f*2 Suppose 3 = 2g - 7, 4g = 5c - 10. Let w(y) = 3y2 + 2y*2 - cy2. Let u(d) be the first derivative of d3/3 - 11. Calculate w(u(b)). -b*4 Let r(a) = 17a2. Let s(j) be the first derivative of j2/2 + 45. Determine r(s(u)). 17u2 Let m(i) be the third derivative of i4/24 + 14i*2. Let g(q) = -22q*2. Give m(g(w)). -22w*2 Let g(k) = -3k*2. Let w = -29 + 29. Let i(v) be the second derivative of v + wv*2 + 0 + 1/3v*3. What is i(g(q))? -6q*2 Let m(z) = -7z + 5z - z. Let t(f) = -f. Determine m(t(p)). 3p Let l(h) = 3988h. Let f(d) = d. Determine f(l(u)). 3988u Let n(k) = 4k. Let z(r) = -86r*2. Calculate n(z(b)). -344b*2 Let b(g) = 3g. Let s(u) be the first derivative of u*4/3 + 3u + 1. Let x(o) be the first derivative of s(o). What is x(b(r))? 36r2 Let s(b) be the third derivative of 0b*4 + 1/15b*5 + 0b + 0 - 3b2 + 0b*3. Let n(v) = 0v + 3v - v. Calculate n(s(c)). 8c*2 Let w(m) = m. Let a(u) be the third derivative of -13u*5/120 - 2u*3/3 + 4u*2. Let p(v) be the first derivative of a(v). Calculate p(w(j)). -13j Let d(k) = 3k2. Let z(q) = -5q*2 - 6. Determine z(d(l)). -45l*4 - 6 Let u = 7 - -3. Let m = u - 1. Let d(v) = m - 9 + 2v*2. Let l(a) = -3a. What is d(l(h))? 18h2 Let h(b) = -186b. Let r(w) = 2w2. Give h(r(z)). -372z*2 Let d(m) = 4m + 0m - 5m. Let v(k) = -2k. Determine v(d(g)). 2g Let o(w) = -w*2. Let k(a) = a + 1. Let l = -2 - -1. Let b(d) = 1 + 7 - 3. Let r(x) = lb(x) + 5k(x). Calculate o(r(t)). -25t*2 Let i(h) = 5h + 1. Let j(p) = 6p2. Give i(j(g)). 30g*2 + 1 Let o(y) = -4y*2 - 2y*2 + 4y*2. Let q(r) be the third derivative of 0r*3 - 1/30r*5 + 0r + 0 + 0r4 + 4r*2. Determine q(o(m)). -8m4 Let y(h) = h2. Let w(m) = -2m - 3. Let u(v) = v + 1. Let z = 10 + -13. Let o(l) = zu(l) - w(l). Calculate o(y(b)). -b*2 Let c(u) = u + 1. Let s(n) = n + 4. Let b(g) = -4c(g) + s(g). Let w(r) = -3r. What is b(w(a))? 9a Let h(b) = 2b. Suppose 0 = -3r + r - 8. Let g be r/(-10) + 16/10. Let w(k) = 2kg + 0k + 0k. Give w(h(o)). 8o*2 Let l(i) = -7i*2 + 12i*2 - 6i*2. Let j(q) = -11q*2. Determine j(l(u)). -11u4 Let w(p) = -p. Let v(m) be the first derivative of -m3/3 - 3m + 2. Let s(x) be the first derivative of v(x). Give w(s(z)). 2z Let j = 0 + 0. Let f(k) = jk - k + 0k. Let u(s) = -6s - 5. Let i(z) = -5z - 4. Let l(m) = 5i(m) - 4u(m). What is f(l(t))? t Let u(y) be the first derivative of y*4/12 - 2y - 3. Let h(a) be the first derivative of u(a). Let r(l) = -l. Calculate r(h(q)). -q*2 Let p(j) = -j. Let i(l) = -240l*2. Determine i(p(b)). -240b*2 Let j(c) = -4c + 5c - 3c. Let o(i) = -69i2 + 32i*2 + 35i*2. Calculate o(j(w)). -8w*2 Let y(a) = 3a - 2. Let f(g) = 9g - 7. Let z be ((-280)/10)/(1 - 0). Let d be (2 + (-9)/4)z. Let n(j) = dy(j) - 2f(j). Let s(t) = -t. Give s(n(u)). -3u Let n(m) = m. Suppose -3x + x + 20 = 0. Let o(t) = -10 + x + 4t2. What is n(o(j))? 4j*2 Let f(d) = -23d*2. Let l(u) = -8u*2. Give f(l(g)). -1472g*4 Let h(a) = -1 + 4 - 5a - 3. Let z(d) = d*2. Determine h(z(r)). -5r*2 Let x(u) = -3u*2 - 4u - 4. Let d(i) = -3 + 5i + 14 + 8i*2 + 6i + 0i. Let o(y) = 4d(y) + 11x(y). Let z(k) = 2k. Give z(o(g)). -2g2 Let p(g) be the second derivative of g7/630 - g4/12 - 2g. Let m(r) be the third derivative of p(r). Let q(s) = 2s. Give q(m(b)). 8b*2 Let o(r) = 47r. Let x(n) = -n + 131 - 131 + 2n. Calculate o(x(b)). 47b Let o(c) = -5c - 3. Let b(v) = -24v - 14. Let p(g) = 3b(g) - 14o(g). Let u(y) be the third derivative of y4/24 - y2. What is u(p(t))? -2t Let s(u) = -2u. Let v be (9/(-3))/(6/(-4)). Let b(o) = -v + 2 - 8o2 + 5o*2. Determine s(b(p)). 6p*2 Let p(t) = 3t - 2. Let q(o) = 12o - 6. Let w(n) = 3p(n) - q(n). Let f(h) = h - 2. Let u be f(4). Let d(m) = 2 + 3m - u. What is d(w(a))? -9a Let w(r) = -6r. Let z(u) be the second derivative of 0u*2 + 0 - 2u + 0u3 - 1/6u*4. Calculate w(z(s)). 12s*2 Let z(a) = 3a. Suppose 0 = -0n + 3n + o - 30, -2n = 3o - 27. Suppose -4v - 8 = 3s + n, -4s = 3v + 11. Let j(w) = -1 + s + 2w. What is z(j(t))? 6t	{ "pile_set_name": "DM Mathematics" }
. List the prime factors of d. 3, 31 Let j = 388 - -1250. List the prime factors of j. 2, 3, 7, 13 Suppose o - 5 = -1. Suppose -ok - m + 492 = -3m, -k = 2m - 128. What are the prime factors of k? 2, 31 Suppose 28 = -8g + 12g. Let z(d) = -6 + d2 - 6d + 0d + 2d. List the prime factors of z(g). 3, 5 Suppose r = -j, -4r - 3j + 3 - 1 = 0. Suppose 71 = 2i - t, i - 3i - rt + 68 = 0. Suppose 0u = u - i. List the prime factors of u. 5, 7 What are the prime factors of (-63)/(-3)(1 + -2)-13? 3, 7, 13 Suppose l + 0l - 3l = 0. Suppose 0r + 35 = -r. What are the prime factors of l - 2 - r1? 3, 11 Let q = -19 - -36. Suppose 5h - q = 2m + 4, 2m = -3h + 19. What are the prime factors of (1 + m)/(5/105)? 3, 7 Let v(u) = u + 12. Let f be v(0). Suppose -3m = -3z + 54, 3m - z + f = -36. What are the prime factors of 3 - (-3 + 5) - m? 2 Let l(w) = 2w2 + w + 1. Let s(n) = n2. Let i(k) = k*3 - 4k*2 + 2k + 1. Let x be i(3). Let v be s(x). What are the prime factors of l(v)? 37 Let p(q) = 56q2 - 6q + 49. List the prime factors of p(8). 3, 5, 239 Let r(z) = -19z3 - 22z*2 + 10z - 14. List the prime factors of r(-6). 2, 1619 Let b(f) = -f*2 + 1 + 2f*2 + 3f*2 - 7. Suppose 5r = -2 - 13. What are the prime factors of b(r)? 2, 3, 5 Let s = -15 + 13. What are the prime factors of ((-75)/(-30))/(s/(-28))? 5, 7 Let a be (84/10)/(-7)340/(-6). Suppose -b - 7k = -2k - a, -5b + 224 = -4k. What are the prime factors of b? 2, 3 Let h be (-141)/3 + 9/3. Let s(c) = 2c*2 - 10c - 1. Let u be s(10). Let p = u + h. List the prime factors of p. 5, 11 Suppose d - 8881 = -5a, -4a + 10637 = -2d + 3535. What are the prime factors of a? 2, 3, 37 Let l be 34 - (-6 + (-21)/(-3)). Suppose ly - 7y = 12. List the prime factors of y. 3 Suppose u - 3r - 653 = 0, -5u - r - 643 = -6u. What are the prime factors of u? 2, 11, 29 Let m be -37/(42/32). Let s = m - 14. Let i = 50 + s. What are the prime factors of i? 2, 5 Suppose 3n = 5n - 60. Suppose 0y - 3y = n. List the prime factors of (y/3)/((-8)/12). 5 Let o be 515/4 - (-5)/20. Let a = -90 + o. What are the prime factors of a? 3, 13 Let g(q) = -1141q - 29. List the prime factors of g(-2). 3, 751 Let x = 8 - 21. Let q = 10 - x. What are the prime factors of q? 23 Let z be (-18)/10 - (-28)/35. List the prime factors of 1842/15 + -4 + z/(-5). 7, 17 Suppose -b + 138 = z + 2z, 0 = -4b + 5z + 637. Suppose p - 3k = -p + 104, -3k = -3p + b. List the prime factors of p. 7 Let y be 13/((-78)/756)12/(-7). Suppose 9b - y = 7b. What are the prime factors of b? 2, 3 Suppose -3l + 3a = -840, -2a - 385 = 4l - 1499. Let j = 473 - l. List the prime factors of j. 2, 97 Suppose 0 = 5o - 4o - 896. What are the prime factors of o? 2, 7 Let i(c) = c*3 - 11c*2 + 15c - 10. Let u be i(11). Suppose -4w - s + u = -2s, w = 3s + 36. What are the prime factors of w? 3, 13 Suppose -5o + 0f + 4f = -2380, 2o + f - 965 = 0. What are the prime factors of o? 2, 3, 5 Let w(k) = -2k*2 + 19k - 7. Let m be w(9). Suppose -73 = -4c + s, -2s + m = 4. What are the prime factors of c? 2, 3 Let j be (-45)/(-21) - (-2)/(-14). Let d(z) = 5z3 - 3z*2 + 2. What are the prime factors of d(j)? 2, 3, 5 Suppose -r = 4l - 2350, -4r + 7r = -l + 6995. What are the prime factors of r? 2, 5, 233 Suppose 12i = 21268 + 12008. List the prime factors of i. 47, 59 Suppose -2017 + 5071 = 6a. List the prime factors of a. 509 Let h be 32/10 - (-12)/(-60). Suppose -hn = -4n + 45. What are the prime factors of n? 3, 5 Let q(n) = 51n + 31. List the prime factors of q(11). 2, 37 Suppose 30g = 43g - 47216. What are the prime factors of g? 2, 227 Suppose -3d + 122 = -166. Let q = -31 + d. List the prime factors of q. 5, 13 Let r = 11 + -9. Suppose -3z - n = -113, -rz + 0n + 57 = -3n. Let l = -21 + z. List the prime factors of l. 3, 5 Suppose 4b - 20 = 0, 5z - 416 - 219 = -2b. Suppose 4q - 239 = 3l, 175 = 5q - 5l - z. List the prime factors of 1 - (q/(-1) - -3). 3, 19 Let d(o) = 6o - o + 63 - 2o. List the prime factors of d(-12). 3 Let m = -1672 - -3646. List the prime factors of m. 2, 3, 7, 47 Let m(x) = x + 11. Let n be m(-6). Let y be (-498)/(-3) + 10/n. Let u = y + -115. List the prime factors of u. 53 Let m = 11 - 8. Suppose 0 = -3x - x + g + 12, -4x = -mg - 4. Suppose 9 = -a + xa. What are the prime factors of a? 3 Let y(l) = -3l + 4l + 5 + 7l2 - l - l3. Let x be y(7). Suppose -xs - 1 = -26. What are the prime factors of s? 5 Suppose 5s = -10, 2g - 2s - 54 + 22 = 0. Suppose -56 - g = -2c. List the prime factors of c. 5, 7 Suppose -3g = -m - 4m + 174, 0 = -3m - 5g + 84. Suppose 2y + 78 = 2r, m = -0r + r + y. Suppose -3d - d = -r. List the prime factors of d. 3 Let w(h) = h2 - 15h - 10. Let g be w(21). Suppose g = -d + 5d. What are the prime factors of d? 29 Suppose 0 = 8z - 1478 - 1074. What are the prime factors of z? 11, 29 Let z be 0 + -3 + 3 + 4 + -10. List the prime factors of -3((z/3)/(-2) + -52). 3, 17 Let s = 880 - 418. List the prime factors of s. 2, 3, 7, 11 Suppose 3o = 4084 - 3442. List the prime factors of o. 2, 107 Let d = 8 + -26. Let s = d - -14. List the prime factors of (-2079)/(-84) - 1/s. 5 Suppose -2i + 3h = 8h, -2i = 2h - 6. List the prime factors of (i-7)/(9/(-45)). 5, 7 Let b = 1620 + -159. List the prime factors of b. 3, 487 Let t be -52(-57)/(-15). What are the prime factors of (t/(-2) - 0) + 1? 2, 5 Let l be ((-42)/(-12) - 4)-246. Let h = 107 + l. What are the prime factors of h? 2, 5, 23 Let d be (0 + -2)/((-2)/4). Let t be (1-4)/d + 4. Let x = 9 - t. What are the prime factors of x? 2, 3 Suppose 7l - 3200 = 2l. List the prime factors of l. 2, 5 Suppose -2d = 3d. Suppose d = 3v + 5 - 17. Suppose 0 = n - vg - 15, 0 = n + g - 4g - 15. What are the prime factors of n? 3, 5 Suppose 22l - 1904 = 14l. List the prime factors of l. 2, 7, 17 Suppose -25 = -5z, -2a - 41 = -5a + 2z. Suppose a = 3p - y + 6, p + 4y - 21 = 0. Suppose -2 = -u + 3f, u + pf = 2 + 16. List the prime factors of u. 2 Let s(t) = -16t - 4. Let n(q) = 3q + 1. Let b(f) = -11n(f) - 2s(f). Let u be b(-4). What are the prime factors of (558/(-9))/(u-2)? 31 Let f be 25/10 - 4/8. Suppose -212 = -fn - 46. What are the prime factors of n? 83 What are the prime factors of (-3)/6 + 683/84? 11, 31 Let q(w) = -w*3 - 8w + 2876. List the prime factors of q(0). 2, 719 Let j(t) = -30t - 4 - 11 + 44t. What are the prime factors of j(7)? 83 Let p(q) = -5q2 + q + 12. Let a be p(7). Let k = 388 + a. What are the prime factors of k? 2, 3 Suppose -11v = -16v + 3035. List the prime factors of v. 607 Let n(h) = -6h - 2h - 6 + 5h2 - h2 - 4. List the prime factors of n(-4). 2, 43 Suppose 16j = 20j - 52. Let x(b) = 4 - 3b - 4b - j. What are the prime factors of x(-5)? 2, 13 Suppose -n = -4i + 3116, 3n - 8n + 2314 = 3i. What are the prime factors of i? 2, 389 Suppose 2230 + 2423 = 9y. What are the prime factors of y? 11, 47 Let n = -142 - -1649. What are the prime factors of n? 11, 137 Let u(l) = -6l3 - l2 - l - 106. Let x(w) = -5w3 - w2 - w - 107. Let i(h) = 4u(h) - 5x(h). What are the prime factors of i(0)? 3, 37 List the prime factors of (-90)/60(-1588)/6. 397 Suppose 3a - 7a = -5z + 113, -2a - 59 = -3z. Let v = a + 108. What are the prime factors of v? 2, 43 Let q = 644 - -380. What are the prime factors of q? 2 Let h = 10 - 6. Let j = -5 + 6. Suppose -ht + j = -19. What are the prime factors of t? 5 Let h be (0 + -1)5(-1)/5. What are the prime factors of 6 + -2 + 0 + h? 5 Let d = 1329 - -325. What are the prime factors of d? 2, 827 Let u(n) = 20n2 - 6n + 3n - 8 + 2. What are the prime factors of u(-2)? 2, 5 Let x(o) = 4o*3 - 26o*2 - 11o - 49. List the prime factors of x(8). 13, 19 Let y = 635 + -118. List the prime factors of y. 11, 47 Let c = -23 - -38. Let a = c + -12. Suppose -au - 4 = -67. What are the prime factors of u? 3, 7 Let z(d) = -917d + 469. List the prime factors of z(-3). 2, 5, 7, 23 Let g(v) = -v*2 + 10v - 9. Let t be g(9). Let w be (t - 3)32/24. What are the prime factors of (-696)/(-40) - w/(-10)? 17 Suppose 3x = -5w + 174, -2w - 3*w = x - 48. What are the prime factors of x	{ "pile_set_name": "DM Mathematics" }
- 0t + d. Solve -tb = w + 4w + 8, 2w = -5b + 12 for w. -4 Let d = -34 + 353. Suppose 19k + 15 = d. Solve 0 = 5u + 5, -4w - k = -u - 5 for w. -3 Suppose -14v + 75v - 81 = 224. Solve -vs = -k - 25, -2s + 17k = 13k - 28 for s. 4 Let v(y) = -5y - 139. Let q be v(8). Let x = 200 + q. Solve x = 2k + 3m + 8, 4k + 2m - 6 = 0 for k. -1 Let q = -802 + 805. Solve 3p + 2c + 6 = 12, qp + 4c - 12 = 0 for p. 0 Let z(s) = 93s + 292. Let d be z(-3). Solve -5y + 1 = 4q + d, 9 = -4y - 3q for y. 0 Let a(p) = -53p - 362. Let f be a(-7). Suppose -fw - 2w = -33. Solve 11 = -2k + 4l + 1, 0 = wk + l - 13 for k. 3 Let c(v) = 50v2 - 12v - 14. Let m be c(-1). Solve 0 = 4t + 5g - 15, 52g = -3t + mg + 11 for t. 5 Let z(r) = r2 - 18r - 4. Let u be z(19). Suppose 2n - 5o - u = 0, 15o - 11o + 29 = 5n. Solve n = 4i + 3c, c - 3 - 4 = 4i for i. -1 Suppose 9b = 45 + 117. Solve 0 = 2l + 4n + 8 - 2, l - 5n = b for l. 3 Suppose -3a = -3j - 36, 2j = -a + 460 - 475. Solve 0 = -u - 3k, -au = 44k - 42k for u. 0 Let f(x) be the first derivative of 7x*2/2 + 21x - 23. Let g be f(3). Let w = g + -27. Solve 0 = -b - 3b + 2c - 12, -5b - 4c = w for b. -3 Let y = 15896 + -15892. Solve 3i - 4 = -4j, 3i - i = -3j + y for i. -4 Let i(b) = 2b + 115. Let s be i(-55). Solve 25 = -5k - sx, 12k - 1 = 8k + 3x for k. -2 Let i = -3698 + 3698. Solve -w + 4 = w + j, i = -5j + 20 for w. 0 Let q = -176 + 179. Suppose -2 = -4d - 2g, -1 = qd - 2g + 1. Solve 3t + b + 10 = d, 5t - 2b + 14 = -b for t. -3 Let n = -7 + 10. Let c = 45677 - 45673. Solve -2q - nu = q - 18, -4u = -c for q. 5 Suppose 4v = -4z - 8, 152z - 2 = -4v + 153z. Solve v = t + 5f + 19, -3t + 6f = 7f + 15 for t. -4 Let f = -148 + 150. Suppose -4n - 6 = 4l - 22, 0 = -l - fn + 4. Solve -4v - v - r = 2, -15 = 3v - lr for v. -1 Let l be (14 - (18 + -4))/9. Solve l = 5w + 4u + 14 + 1, -2u = 3w + 9 for w. -3 Let l be 1/(-4) - 34/(-8). Let s be -554/(-44)(-6)/(-3). Solve 2x + a = s, -lx - 5a - 11 = -37 for x. 4 Suppose 17j = 42 - 8. Solve -3o = -4d - 12, -jd + 2o = -3d + 8 for d. 0 Let w be 182 + -180 + (0/2 - (-1 - 0)). Solve -w = -3c + 2i, -c + 3i - 1 = -2 for c. 1 Let m = 14 + -22. Let k be (10/m - -2) + (-633)/12. Let h be (-122)/(-8) - (-13)/k. Solve 8o = 3o + 5z + h, -6 = -2o - 2z for o. 3 Let w be ((-1050)/12 + -4)-2. Suppose 179j + 20 = wj. Solve -2q + 6 = 2m - m, 13 = 2m + jq for m. 4 Let l = 10 - 2. Let p be (5/(-4))/(14/l - 2). Let w be (25/(-10))/p - 15/(-6). Solve -4v + wd = 8, 3v + 0d + 7 = 2d for v. -1 Let a = -201 + -42. Let h = a + 245. Solve 7q - 3u + 1 = hq, 2q = -u + 4 for q. 1 Let x(w) = 298w - 18170. Let k be x(61). Solve k = 3y + 5p, -7y - 2p = -3y + 8 for y. -4 Let c = -39257 - -39260. Suppose 2d - 1 = 3. Solve -3v = -do - 1, -c = -4o + 3v - 2 for o. 1 Let b = 31374 - 31369. Solve 0 = 3m - 2d - 6, -10 = -bm - 15d + 18d for m. 2 Let q be 1121/118 + (-5)/(-2). Solve q = 2w - g, 32 = 3w + w - 4g for w. 4 Suppose 0 = 3d + 177 - 54. Let r = 50 + d. Solve -5s = 3m - r, m - 1 = -4s + 2 for m. 3 Let g(k) = -9k - 71. Let b(n) = 5n + 35. Let t(m) = 5b(m) + 2g(m). Let o be t(-4). Solve -5q = oh, -2q + q + 5h + 30 = 0 for q. 5 Suppose 3x - 16 = 2. Let z be (-54)/x(-16)/18. Solve -10a = -7a - 2w - 6, -5w + z = 4a for a. 2 Let j be (-8)/(-36) - (-86)/18. Suppose -3r + 6r - jg - 58 = 0, 5g + 25 = 0. Suppose rh - 9h = 0. Solve h = 7x - 2x - 10, 3x = -u + 7 for u. 1 Suppose -344d + 7 = 5f - 346d, 0 = -d + 9. Solve fn = u - 10 + 2, 0 = -2n - 5u + 13 for n. -1 Suppose 3x - 30 = -3a, 2a - 10 = x - 5. Suppose 2o + 5s - 24 = 0, 12 = -22o + 23o - 2s. Solve -2j - xp = 3, -4j - p = 3 + o for j. -4 Suppose 0 = -4r - 54a + 50a + 28, -2r = 3a - 9. Solve -3o - n = -4n - r, -o - 3n - 16 = 0 for o. -1 Let s = -226935 - -226938. Suppose -51 = -4x - 3. Suppose -4b - x = -7b. Solve -13 = o + bj - j, sj + 16 = -4o for o. -1 Suppose 5q + 76 = -2f + 93, -q + f = -2. Solve -x = -2y + 4x + q, 5 = 5x for y. 4 Let l be (2/(-5))/(-5 - 360/(-75)). Solve -2p + 5w - l = w, -4p - 9 = -3w for p. -3 Suppose -i - 7i = -3i. Suppose 7t - 16 - 19 = i. Solve -tn = h - 3, 0 = 4n + 4h + 2 + 2 for n. 1 Suppose 264c - 135 = 219c. Solve 4d + 9 = y, -cd + 101 - 109 = -y for d. -1 Let r(f) = f*2 + 24f + 47. Let i be ((-44)/(-2))/(-39 + 38). Let m be r(i). Solve -my - 14 = -h + 6h, 8 = -2h for y. 2 Let u(s) = -s3 - 32s*2 - 30s + 45. Let x be u(-31). Let b be x/4 - (49/(-14) - -4). Solve -bw + 1 = t + w, -4w + 6 = 2t for t. 5 Let v(f) = f2 - 15f + 51. Let j be v(6). Let s be (-2 - -8)/(1/(j/(-2))). Solve s = -3h + 2z, 2h - 4z - z + 6 = 0 for h. -3 Let g = 226 - 224. Suppose 0 = gx + 2r + 2r + 4, -7 = 2x + 5r. Solve 3t - xt - 5 = -3n, 22 = 4t + 2n for t. 4 Let p be -2 + 3 + -2 - (0 - 3). Let d be 18/((p + 0)/1). Solve -3o + 2w + 6 = 7w, 0 = o + 4w - d for o. -3 Let b be 271(40/(-5))/8. Let j = -269 - b. Solve -5u + j + 2 = -f, 0 = -3f + u + 2 for f. 1 Let w = 15334 - 15331. Solve 2r + wi - 7 = -3, -r = 5i - 16 for r. -4 Let o(p) = -486p + 9 + p3 + 972p + 6p2 - 482p. Let x be o(-5). Let z(b) = 3b2. Let c be z(-1). Solve -cf - 2i = x, -f + 0i = -4i - 14 for f. -2 Let f = -18 - -44. Suppose 3s - f - 46 = 0. Let l = -13 + s. Solve -2j + j + l = 3b, -b = -2j - 6 for j. -1 Suppose -994 = -20v - 3774. Let i = -135 - v. Solve -ij - 22 = -2x, -x + 5j + 2 + 24 = 0 for x. 1 Let o(v) = 2v*2 - 14v + 17. Let h be o(1). Solve 30 = -hk + 4r, -3k + r = k + 13 for k. -2 Let y(v) = v3 + 20v*2 - 678v + 235. Let h be y(-38). Solve 0 = 2s + 4m, 5m - hm + 4 = 2s for s. 4 Suppose 30 = 5k + 66a - 69a, 0 = k - 3a + 6. Suppose -2u + 26 = 2y, -ku + 4 = 3y - 13u. Solve 14 - 2 = 3p, s - y = -p for s. 4 Let d = -15084 + 15088. Solve r - dr + 5h - 16 = 0, -8r + 14 = -2h for r. 3 Let m be 3 - ((-5)/10 - -1)-2. Let q be m/((-4)/5) - (-9 + 0). Solve -k - 2k = -z - 18, -3z - q = k for z. -3 Let q be (-3)/(-54)862 - (-5)/45. Suppose -3z = 13z - q. Suppose -4b - 25 = -5x - 6, -5 = -x + 2b. Solve 5f + 9 = xk - 9, -3k - 6 = zf for k. 1 Let m(p) = 2p - 1. Suppose 35o + 12 = 41o. Let s be m(o). Let v be ((4 - 1)/s)/1 - -1. Solve vb + 1 = 3q - 6q, -13 = -4b - q for b. 4 Let y = -35 + 35. Let g = -107 + 62. Let b = 50 + g. Solve y = 5h - 4o - 5, bo - 2o = -h - 18 for h. -3 Let i be 3(-1)/(4/(-8)). Suppose 0 = -6y - 0 + i. Solve 0 = 3j - 2n - 10, -2n - y + 3 = 3j for j. 2 Let s be 1/((34/(-72))/1). Let v be (5 - (14 - -3))/((-1)/s). Let m be v/(-63)(-21)/(-6). Solve 5n - c = 2c - 6, -3c + 6 = mn for n. 0 Let t = 9553 + -9551. Solve -2s + 2 = 0, 3s = tf + 6s - 5 for f. 1 Suppose 2n - 4 = 0, p - 20 + 9 = -3n. Suppose 0 = -pv - 17 + 57. Suppose -v = -5b - 3. Solve b = -s, -8 = -4x + x + 5s for x. 1 Suppose -38h - 196 = -42h. Suppose -69n = -76n + h. Solve 5m + 7 + n = -3g, -4g = -3m - 20 for g. 2 Let b be (9438/(-24))/(-11) + 2/8. Suppose -bc + 10 = -31c. Solve cs - 18 = d + d, -3d - 22 = -2s for s. 5 Let u = -280 + 282. Suppose b = -m + 5 - 7, -um + 16 = -3b. Solve 2 = g + 2f - m, -10 = -g - 4f for g. -2 Let k be 56/(-21)(0 + 2 - -4). Let l be -3 - (-8)/(-16)k. Solve -2 = -lv + 3h - 0, 10 = 3v - 4h for v. -2 Let f be (-684)/81 - 8/(-18). Let w be -2 - -8 - (f - -11). Solve -2 = 5v - a + wa, v + 5a - 18 = 0 for v. -2 Let p = -872 + 879. Suppose -4 - 9 = -4r + l, -25 = -5r + 3l. Solve 0 = -n + rn - 3v + p, 5 = n + 3v for n. -1 Suppose 0 = 2g - 4, -f + 751 = 4f - 2g. Let d = f - 115. Let h = d - 36. Solve h = 2s - 4, -2i - 2s - 1 = -5 for i. 0 Suppose -10575 + 10607 = 16x. Solve 7 = -i - 5w - x, 3w = -4i - 2 for i. 1 Suppose 18 = -z + 4z. Let p be 0 - -3 - (-2 - -2)/(-1 + 0). Solve -3 = 5s - zq + pq, -3s = q - 1 for s. 0 Suppose -53 = 3d + 4b - 59, 4d = 2b + 8. Solve -5w + 5h - 40 = 0, dw + 5h - 28 = -23 for w. -5 Suppose -37b + 36b + 109 = -13f, 4b - 93 = 3f. Solve -3u + 5 = -6u - 2o, -b = -2u + 4o for u. 1 Suppose 0 = -309a - 60 + 233 + 754. Solve ay + 4c + 1 = 2y, -2y + 3c + 9 = 0 for y. 3	{ "pile_set_name": "DM Mathematics" }
t the terms in -7n3 - 7n*3 + 60n*2 - 260n*2 + 104n*2 + 96n*2. -14n*3 Collect the terms in -30z*2 - 26z*2 - 21z*2 + 74z*2. -3z*2 Collect the terms in 4703c - 2612c + 3836c. 5927c Collect the terms in -40 + 267t*2 + 8t - 3t - t + 42. 267t*2 + 4t + 2 Collect the terms in -18s3 - 16s + 6s3 - 23s*3 + 32s - 15s. -35s*3 + s Collect the terms in 4b*2 - 22b*2 + 85b*2. 67b*2 Collect the terms in -37838298 + 24q*2 + 37838298. 24q*2 Collect the terms in 495n + 123n2 - 62n*2 - 59n*2. 2n*2 + 495n Collect the terms in -274 - 5n3 + 3n3 - 205 + 558 + n3. -n*3 + 79 Collect the terms in 19 + 406041s*2 - 19 - 406042s2. -s2 Collect the terms in -48a2 - a + 35 + 34 - 69. -48a*2 - a Collect the terms in 1172c*3 - 86c*3 - 60c*3. 1026c*3 Collect the terms in 8 - 5 - 3 + 13600d. 13600d Collect the terms in 206o*2 + 4o - o - 170o2 - 3o. 36o2 Collect the terms in 2a - 32a - 5 - 2. -30a - 7 Collect the terms in -227r + 286r - 3r2 + 175r. -3r2 + 234r Collect the terms in 504f2 - 163f*2 - 168f*2 - 33f - 172f2. f2 - 33f Collect the terms in 460d - 413d + 304 - 304. 47d Collect the terms in -152369k - 152371k + 304737k. -3k Collect the terms in -956h*2 + 956h*2 + 3703h*3. 3703h*3 Collect the terms in 740 - 369 - 371 + 13a*2. 13a*2 Collect the terms in -9781g - 9788g + 29350g - 9780g. g Collect the terms in 20 + 7z + 5 - 1 - z. 6z + 24 Collect the terms in -v2 - 9v - v*2 + 10v*2 + 9v. 8v2 Collect the terms in -6z + 9589z2 + 6z. 9589z2 Collect the terms in -19118j*2 + 9j - 9j + 3 - 1. -19118j*2 + 2 Collect the terms in -12 - 1349g + 12 + 1242g. -107g Collect the terms in -5k2 - 8k*2 + 5k*2 - 4k*2 - 4k*2. -16k*2 Collect the terms in 1826029156 + 9y - 1826029156. 9y Collect the terms in n + 394 - 130 - 124 - 3n - 140. -2n Collect the terms in 144851718w*2 - 2 + 2 - 289703441w*2 + 144851721w*2. -2w*2 Collect the terms in -876 + 7d3 + 435 + 441 - d2. 7d3 - d2 Collect the terms in 6049k*2 - 3040k*2 - 3023k*2. -14k*2 Collect the terms in 17h*3 - 26h + 4h3 + 26h. 21h3 Collect the terms in -3 + 3 + 33386n*2 + 33383n*2 - 66773n*2. -4n*2 Collect the terms in -3215f + 13 - 13. -3215f Collect the terms in 23r - 16r + 8r. 15r Collect the terms in -11y + 12y - 140 + 22y. 23y - 140 Collect the terms in 6475p - 3245p + 101p*2 - 3230p. 101p2 Collect the terms in -534m + 534m - 6035m*2 - 1672m*2. -7707m*2 Collect the terms in 1 + 0 + 586z*2 + 563z*2 - 1118z*2. 31z*2 + 1 Collect the terms in 11b - 107b2 - 2b - 14b. -107b*2 - 5b Collect the terms in -211u - 112u + 95u - 139u. -367u Collect the terms in -72r*3 + 220r*3 - 48r*3 - 56r*3. 44r*3 Collect the terms in 85 + 72 - 157 + 5u. 5u Collect the terms in 546q - 112q - 427q. 7q Collect the terms in 21g + 21g + 23g - 61g. 4g Collect the terms in 0 + 82y2 - 2 + 0 + 3y*3 - 30y*2. 3y*3 + 52y*2 - 2 Collect the terms in -3 - 1718u + 3. -1718u Collect the terms in -13d - 6d + 41848 - 41848. -19d Collect the terms in -3119j3 + 1554j*3 + 1572j*3. 7j*3 Collect the terms in 454917 - 36m - 454917. -36m Collect the terms in 4753p*3 + 21p - 4751p3 - 29p. 2p3 - 8p Collect the terms in 45s2 + 52s*2 - 2 + 53s*2 - 2 + 55s*2 - 206s2. -s2 - 4 Collect the terms in -3640n3 - 3642n*3 + 7286n*3. 4n*3 Collect the terms in k + 24k*3 + 4k*3 - 4k + 82k3. 110k*3 - 3k Collect the terms in 27 - 52 - 44k2 + 25 + 263k*2. 219k*2 Collect the terms in -205d*2 + 60d*2 + 14d*2 - 17 + 17. -131d*2 Collect the terms in 8880 - 2l + 14l - 4441 - 4439. 12l Collect the terms in -5 + 5 - 18263h2 + 2h + 18237h2. -26h*2 + 2h Collect the terms in -975q3 - 969q*3 - 961q*3 + 2902q*3. -3q*3 Collect the terms in -15232x + 5071x + 5067x + 5079x. -15x Collect the terms in -4t - t3 + 7t*3 + 5t*3 + 3t*2 + 5t. 11t3 + 3t*2 + t Collect the terms in 455922 + 8d*3 + 455926 - 911848. 8d*3 Collect the terms in -18x - 26x3 + 19x - x. -26x3 Collect the terms in -6714n*2 + 3n - 3n + 6739n*2. 25n*2 Collect the terms in -325n - 3 + 3 - 13n2 + 162n + 167n. -13n*2 + 4n Collect the terms in 210j + 179j + 257j + 457j. 1103j Collect the terms in -6a + 2a + 4a - 2697a3. -2697a*3 Collect the terms in -181 + 100s - 87 - 395. 100s - 663 Collect the terms in 9v + 6 + 1 - 4. 9v + 3 Collect the terms in 843c*2 - 9c*2 + 431c*2. 1265c*2 Collect the terms in -4w*2 + 4 + 8 - 19 + 7. -4w*2 Collect the terms in 72h*3 - 196h*3 - 326h*3 - 123h*3 - 2h. -573h3 - 2h Collect the terms in 96j3 - 16063j - 93j3 + 16063j. 3j3 Collect the terms in -757 + 12x*2 + 9x*2 + 757. 21x*2 Collect the terms in 116u*3 - 549u*3 + 436u*3. 3u*3 Collect the terms in -19249 + 19249 - 14d*3. -14d*3 Collect the terms in 108m*2 + 9000 + 8991 + 8996 - 26987. 108m*2 Collect the terms in 22p*2 + 59p + 53p + 115p - 227p. 22p*2 Collect the terms in z - 3z - 81 - 4z + 88. -6z + 7 Collect the terms in -r2 + r + 45 + 51 + 87 + 30. -r2 + r + 213 Collect the terms in -81k2 + 10k3 - k3 - 4k3. 5k*3 - 81k*2 Collect the terms in 928b - 989b - 389b*2 + 388b2. -b2 - 61b Collect the terms in 7h - h + 2h3 - 19h*3 - 17h*3 + 10h*3. -24h*3 + 6h Collect the terms in -394o2 - 234o*2 + 611o*2. -17o*2 Collect the terms in -438 - 438 - 433 - 5n + 1309. -5n Collect the terms in -365i - 34i2 + 365i. -34i2 Collect the terms in -1360m - 562m + m. -1921m Collect the terms in 7h - 10h*2 + 38h*2 + 5h - 8h. 28h*2 + 4h Collect the terms in -55j3 + 174 - 174 + 51j*3. -4j*3 Collect the terms in -3j + 133j + 218j - 58j. 290j Collect the terms in -847 + 5626 + 3095 + 2y. 2y + 7874 Collect the terms in 30t + 0t - 14 + 11t. 41t - 14 Collect the terms in -881i - 257i*2 - 43i*2 + 67i*2 + 881i. -233i2 Collect the terms in -66u - 19886u2 + 66u. -19886u2 Collect the terms in -54b + 13 + 16 - 29 - 218b. -272b Collect the terms in 0 + 3r + 36r + 0 + 8r. 47r Collect the terms in 2d2 - 4300d - 2d2 + 80d*3 + 2152d + 2148d. 80d*3 Collect the terms in -589p + 589p - 30p*2. -30p*2 Collect the terms in -35h*2 + 35h*2 - 41452h*3 + 41454h*3. 2h*3 Collect the terms in -19i*3 - 188i*3 - 160i*3. -367i*3 Collect the terms in -16 - 2x - 11 - 63. -2x - 90 Collect the terms in -159n*3 - 10n + 16n + 26n. -159n3 + 32n Collect the terms in 136p + 91p - 325p - 3p*3 + 98p. -3p3 Collect the terms in 0 + 35n*3 - 7n*3 + 63n*3 - 9n*3 + 2. 82n*3 + 2 Collect the terms in 82 + 94 - 196 - j. -j - 20 Collect the terms in 49w*3 - 70w*3 - 24w*3 + 58w*3. 13w*3 Collect the terms in -191 - 187 - 4z + 579 - 200. -4z + 1 Collect the terms in -4o + 76o2 + 4o + 83o2 - 145o*2. 14o*2 Collect the terms in 68277j*2 - 68277j*2 + 32j*3 + 22688j - 22688j. 32j*3 Collect the terms in 2 + 845d - 402d + 0 - 2 - 457d. -14d Collect the terms in 222s + 98 - 76s - 69s - 75s. 2s + 98 Collect the terms in -4t - 3t + 2t + 3t + 7t3. 7t*3 - 2t Collect the terms in 12921m2 - 16m*3 - 12921m*2 + 7m*3. -9m*3 Collect the terms in 0m*3 + 467805m - 467805m + m3. m3 Collect the terms in -95 + 47 + 118o*2 + 48. 118o*2 Collect the terms in 24d*2 + 36d*2 - 58d*2 + 0d + 0d. 2d*2 Collect the terms in -519 + 172 + 170 + 53p*3 + 177. 53p*3 Collect the terms in -19864b + 39535b - 19774b. -103b Collect the terms in 76u*3 + 113u*3 - 37u*3. 152u*3 Collect the terms in -18r - 203017 + 203017. -18r Collect the terms in 412k*3 - 141k*3 - 133k*3 - 144k*3. -6k*3 Collect the terms in 24k*2 - 4k*2 - 10k*2 - 12k*2 - 18k*2. -20k*2 Collect the terms in p + 13p - 295p3 - 14p. -295p3 Collect the terms in 84o - 46o + 119o + 61o. 218o Collect the terms in -13f2 - 11f*2 + 11 - 11 + 73f*2. 49f**2 Collect the terms	{ "pile_set_name": "DM Mathematics" }
ime factors of l? 2, 3, 491 Let a(o) = 2o3 + o2 - o - 7. Let q = -15 + 11. Let z be 1/((16/(-12))/q). What are the prime factors of a(z)? 53 Let f(d) = -3d + 2987. List the prime factors of f(0). 29, 103 Suppose -29 - 11 = -2g. Suppose 0o = o + g. List the prime factors of (o/6)/((-4)/6). 5 Suppose -4k + 32 - 12 = 5m, m = 0. Suppose w + 2p - 16 = 3p, -kw + 87 = 2p. List the prime factors of w. 17 Suppose 8 = -3k + 3o + 2, -2o = -3k - 1. What are the prime factors of (-77)/(-2)(k - 4/4)? 7, 11 Suppose 3q + i = 653, 4q = q - 2i + 649. Suppose 11k = 1233 + q. List the prime factors of k. 2, 3, 11 Let d = -15 - -20. Suppose -585 = -dj + 5a, 0j = -j - 5a + 141. List the prime factors of j. 11 Suppose 18i - 1073 - 7297 = 0. What are the prime factors of i? 3, 5, 31 Suppose 0 = 29u - 23u - 780. List the prime factors of u. 2, 5, 13 Let b be (-1)/(-2) - (-1251)/6. Let m(l) = l*3 + 18l*2 - 12l - 12. Let h be m(-19). Let j = h + b. List the prime factors of j. 2 Let i(o) = -32o + 180. What are the prime factors of i(-30)? 2, 3, 5, 19 Suppose 4g = 2g + r + 10474, 0 = -g - 3r + 5244. List the prime factors of g. 2, 3, 97 Let n be 20/70 - (-58)/(-7). Let o(h) = -h*3 - 7h*2 + 7. List the prime factors of o(n). 71 Let k be (-3)/(22/(-100)). Let s be 4((-152)/(-171) - 1/(-9)). Suppose sf - 35 = -g + f, 0 = g - 5f - k. List the prime factors of g. 2, 5 Let t = -1968 + 3522. What are the prime factors of t? 2, 3, 7, 37 Let i(f) = f3 - 10f*2 + 10f - 2. Suppose 3b - t - 24 = -0, -4b = -t - 33. Let d be i(b). Suppose -dq = -11q + 184. List the prime factors of q. 2, 23 Suppose -2l + 11 = 3. Suppose 3u - c + 15 = 3c, -lc + 7 = 5u. What are the prime factors of (u - 2) + 1 + 13? 11 Suppose -2m = -7y + 3y + 2594, -y - 4m = -635. List the prime factors of y. 647 Let m = -235 + 341. Suppose m - 298 = -3a. List the prime factors of a. 2 Suppose 5p + 0 = 15. Suppose -w - 2f + 22 = 0, -5w - pf + 81 = -15. List the prime factors of w. 2, 3 Suppose 879a - 886a + 5208 = 0. List the prime factors of a. 2, 3, 31 Let r(u) = -16u3 - u2 - 9u + 3. What are the prime factors of r(-4)? 3, 349 Let g be (3 + -1 - 0)16. Let t be (-7(-6 - -12))/(-1) + 2. Let d = t - g. List the prime factors of d. 2, 3 Let z be 0((1 - 6) + 4). Suppose -4u - 64 - 4 = -4w, -4u = -2w + 44. Suppose 2l - 58 + w = z. What are the prime factors of l? 23 Let u(f) be the first derivative of -5f2 - 11f + 7. List the prime factors of u(-3). 19 Let v(k) = 6k + 5. Let s be v(6). Suppose 0 = 3z + g + 5, 0 = 2z + g - 1 + 4. Let y = z + s. What are the prime factors of y? 3, 13 Suppose 16t - 1245 = 13t. List the prime factors of t. 5, 83 Let m = 6 + -3. Suppose -mp + 4 = 10. What are the prime factors of 0 + p + 34 + -2? 2, 3, 5 Let r = -212 - -462. Suppose -9h + 14h = r. What are the prime factors of h? 2, 5 Let t = -16 + 20. Suppose x = -6 + t. Let j(b) = -4b3 - b2 + 2b + 3. List the prime factors of j(x). 3 Let u = 2047 + -974. List the prime factors of u. 29, 37 Suppose 22 - 2 = 10v. Suppose -3p - vp + 535 = 0. What are the prime factors of p? 107 Let q(b) = 2b - 10. Let d = -16 - -23. Let w be q(d). Suppose ws = 9s - 250. What are the prime factors of s? 2, 5 Suppose -7 + 20 = o. Suppose 0 = 3l + 5x - 421, 2l - ox + 8x = 264. List the prime factors of l. 137 Let x = 1235 - -431. List the prime factors of x. 2, 7, 17 Let i(n) = -n2 - 23n + 4. Let v be i(-20). Let y = -55 + v. What are the prime factors of y? 3 Let b(q) = q*3 + 14q*2 - 7q - 11. Let g be b(-11). Suppose o = -2k + 85, 5o - 2k = 32 + g. What are the prime factors of o? 7, 13 Suppose -12 = -3g, 164 = 3b + 5g - 3. What are the prime factors of b? 7 Let d = -18 - -20. Suppose 10k - 296 = dk. What are the prime factors of k? 37 Let z(w) = 6w + 8 - 2 - 21 - 12. List the prime factors of z(11). 3, 13 Suppose 3m + 18 = 5m. Let j(i) = i2 - 3i - 4. What are the prime factors of j(m)? 2, 5 Suppose -3j = -3q - 6 + 18, 5q = -3j + 20. Let k = 165 - q. Let s = -114 + k. List the prime factors of s. 47 Let j = -29 - -22. Let d(r) = -27r - 24. List the prime factors of d(j). 3, 5, 11 Suppose 8s = 2s + 54. List the prime factors of -1 + (24/(-7))/(s/(-63)). 23 Let f(o) = 22o + 541. What are the prime factors of f(0)? 541 Suppose 4j = 4o + 140, 8o - 3j = 3o - 185. Let s(x) = -2x + 6. Let i be s(3). List the prime factors of (i + o)(-6)/12. 2, 5 Let o = -11 + 14. Suppose ox - 15 = 0, -54 = -k + 2x - x. What are the prime factors of k? 59 Let i(n) = 14n + 13. Let l be (-81)/(-15) + 10/(-25). List the prime factors of i(l). 83 Suppose -4k = -3n + 649, -2k = -0n + 2n - 428. What are the prime factors of n? 5, 43 Let v be -3 + (-1 - -3)8. Suppose -5 = -2d - v. List the prime factors of ((d + -172)/(-2))/2. 2, 11 Let c(t) = 23t*2 - 7t + 37. List the prime factors of c(11). 13, 211 Let q = -662 - -1725. What are the prime factors of q? 1063 Let w(j) be the second derivative of 0 - 1/6j3 - 1/6j*4 - 6j + 1/20j5 + 1/2j*2. What are the prime factors of w(4)? 29 Let g be (2 - -1) + -3 + 6. Let h(a) = 6a + 9 - ga + a. What are the prime factors of h(7)? 2 Suppose 2x - 18 = -f - 3x, 0 = 5f - 4x - 61. Suppose 0 = -3r + 5j - 10 + 71, r = -2j + f. List the prime factors of r. 17 Suppose b = -b + q - 20, 4q = -5b - 76. Let p be (2 - b/(-8))22. Let n = 9 + p. List the prime factors of n. 2, 5 Suppose -2q - w = -1504, 0q = q + 3w - 757. What are the prime factors of q? 751 List the prime factors of ((-10252)/(-33))/(2/3). 2, 233 Suppose -3q + 27 + 9 = v, 0 = 2q + 4v - 14. Let j = -13 + q. Let z(k) = -k3 - k + 27. List the prime factors of z(j). 3 Let q(k) = -k3 + 12k*2 - 6k + 6. Let j be q(9). Suppose 5b = 5x - j, 6x - x - 177 = -4b. What are the prime factors of x? 37 Let c(n) = n*2 - 3n - 2 + 7n2 - 2n*2 - 2n*2. List the prime factors of c(6). 2, 31 Suppose 14i - 132 = 10i. Let r be i - 2(-3)/(-6). Let x = r - -15. List the prime factors of x. 47 Suppose -q - 5i + 4247 = 1638, -5q = -i - 13071. List the prime factors of q. 2, 1307 Let m(y) = 2y2 + 36y + 682. List the prime factors of m(-41). 2, 3, 107 Let m(y) = 4y - 14. Let r be m(9). Suppose -428 = -26i + ri. What are the prime factors of i? 107 Suppose 2b - 5t = -37, 0 = 2t - t - 5. Let v be (-16)/b(-18)/(-12). Suppose 0 = 2h + 4d - 70, 4d - 2d - 122 = -vh. List the prime factors of h. 29 Suppose -2a - 24 = -110. List the prime factors of a. 43 Let d(p) = -p2 + 3p + 13. Let s be d(5). Suppose 4k = -sh + 109, 0h - 4k - 46 = -2h. List the prime factors of h. 31 What are the prime factors of (4 + 0)/(-5 - (-1274)/254)? 2, 127 Suppose -3 - 7 = -5q. Let i be q/((-2)/6-2). Suppose in = 9, u - 5n + 3 = -u. List the prime factors of u. 2, 3 Suppose 2f = -469 + 3309. List the prime factors of f. 2, 5, 71 List the prime factors of (-1988)/(-77) + (-10)/(-55). 2, 13 Suppose -2h - 8 = h - 2d, 0 = 5h + d - 4. Let b = -28 + 83. Suppose hm - n = m - b, m - 4n - 75 = 0. What are the prime factors of m? 59 Suppose 0 = -3z + 5s - 2s + 1008, -z + 332 = -5s. What are the prime factors of z? 337 Suppose -4i = -3w + i - 135, w - 4i + 52 = 0. Let n = -7 - w. List the prime factors of n. 3, 11 Suppose 0f - 50 = 2f. Let o be (-3 + 5 + -3)f. Let k = -14 + o. What are the prime factors of k? 11 Suppose -3a + 4g + 13 = 5, 5a - 4g = 8. Suppose 8 = 2n - a. Suppose -5c = -25, 0 = -nt + t - 3c + 120. What are the prime factors of t? 5, 7 Let t = 354 + -216. Suppose 4f = -0i + i + 254, 5i - t = -2f. What are the prime factors of f? 2 Let i be 1/(-3) + 48/9. Suppose -5f + 11 = -3o - 0o, io + 5f - 35 = 0. Suppose 2s = -5h + 25 + 6, -5s + oh = 0. What are the prime factors of s? 3 Suppose 0 = y - 2s - 12, 4y - 6y = -s - 21. Let h(r) = 2r - 12. List the prime factors of h(y). 2 Suppose -3q - 5u + 149 = -2q, -q + 5u = -149. List the prime factors of q. 149 Let g = 7 - 15. Let v be g4/(-8)43. What are the prime factors of v/24 + 2/(-12)? 7 Let v(o) = -o*2 + 18o + 41. Let w be v(17). What are the prime factors of (w + 3)/(3/6)? 2, 61 List the prime factors of 777*5/(5 - 0) - -1. 2,	{ "pile_set_name": "DM Mathematics" }
10g3 + 14g*2 + 16g. Let u(o) = 4o3 + 5o*2 + 6o. Let p(i) = -3t(i) + 8u(i). Let f(r) = 5r3 - 4r*2. Determine 3f(c) - 5p(c). 5c*3 - 2c*2 Let u(d) = 6d - 2. Let j(t) = 10t. Let i(o) = -j(o) + u(o). Let p(g) = 5g - 3. Let q(w) = -10w + 7. Let c(f) = 13p(f) + 6q(f). Give -5c(v) - 6i(v). -v - 3 Let g(i) = i3 + 10i*2 + 5i - 2. Let l(n) be the first derivative of -n*4/4 - 11n*3/3 - 2n*2 + 2n - 6746. Determine -5g(k) - 6l(k). k*3 + 16k*2 - k - 2 Let z(p) = 865p*2 + 4. Let x(u) = 21615u*2 + 99. Give -4x(d) + 99z(d). -825d*2 Let w(f) = -3f*3 - 4f2 - f + 14. Let x(q) = q3 - q*2 - q + 2. Give w(v) - 3x(v). -6v3 - v2 + 2v + 8 Suppose 16 = 3t - 7t. Let u(h) = -h*2 + 18h - 82. Let f be u(10). Let n(q) = 3q - 2. Let s(p) = -p + 1. Calculate fn(z) + ts(z). -2z Let a(y) = 4y2. Let g be (25 - 4048/138) + (4/(-6) - 0). Let m(v) be the second derivative of -v4/4 + 5v. Determine gm(k) - 4a(k). -k2 Let g(a) = a3 + 5a - 2. Let c be ((-2)/(-3))/(((-16)/(-20))/((-156)/(-65))). Let n(b) = -b3 - b2 - b + 1. Give cn(y) + g(y). -y*3 - 2y*2 + 3y Let p(a) = -9a2 - 8a + 97. Let r(h) = 25h2 + 22h - 290. Determine -11p(l) - 4r(l). -l*2 + 93 Let z(o) be the third derivative of -5o5/12 - o3/2 - 747o2. Let c(p) = -1. Give 3c(u) - z(u). 25u2 Let n(h) = -15h - 9. Let l(i) be the first derivative of i*2/2 + i + 3764. Give -6l(r) - n(r). 9r + 3 Let j(l) = -5l*2 - 2l + 20. Let y(v) = 4v2 + v - 21. Let o be (-5 + (-171)/(-27))/((-10 - -7)/(-9)). Calculate oy(i) + 3j(i). i2 - 2i - 24 Let x(r) = -4r - 5. Let t(i) be the second derivative of -5i*3/6 - 3i*2 - 3i. Let c = 9027 + -9021. What is cx(j) - 5t(j)? j Let i(y) = 3y3 + 2y*2 - 2y - 282. Let w(v) = -9v3 - 7v*2 + 7v + 845. Calculate -7i(u) - 2w(u). -3u3 + 284 Let x(z) = 1507z*3 - 26z*2 + 13z - 26. Let v(a) = -377a3 + 6a*2 - 3a + 6. Calculate 17v(g) + 4x(g). -381g3 - 2g*2 + g - 2 Let f(h) = 17h3 + h2 - h + 4. Let p(i) = 94i3 + 5i*2 - 6i - 85. What is 6f(u) - p(u)? 8u3 + u2 + 109 Let k(b) = -b*3 - 4b*2 + 142b. Let i(s) = -s*3 + 2s*2 - s + 1. Give 2i(a) + k(a). -3a3 + 140a + 2 Let o(u) = 9u - 1. Let g(r) = 37r - 2. Let k(z) = -g(z) + 4o(z). Let f(d) = -3d - 6. Calculate -3f(c) + 8k(c). c + 2 Let h(i) = -i*3 - 6i - 28. Let v(g) = 8g + 33. Determine 4h(w) + 3v(w). -4w3 - 13 Let m(o) be the third derivative of -o5/60 + o*4/3 + 2o*3/3 + 664o*2 - 2o + 7. Let h(q) = 3q2 - 32q - 17. What is -2h(u) - 9m(u)? 3u2 - 8u - 2 Let b be (-15)/(-25)(-7 - (-364)/42). Let q(v) = -v + 1. Let k(p) = -64p - 8. Give bk(f) + 6q(f). -70f - 2 Let s(w) = 2w*3 - 4w + 1. Let y(m) be the first derivative of -m - 1/2m2 - 1/4m*4 + 0m*3 + 109. What is -s(h) + y(h)? -3h*3 + 3h - 2 Let g(z) = -z*3 - 5z*2 - 6z + 4. Let i be g(-6). Suppose 4b = -i + 20. Let w(s) = 2s*2 - 2. Let y(l) = 372 - 362 - 6l*2 - 4l*2. Give bw(c) - 3y(c). 2c*2 - 2 Let w(n) = 47n*3 + 3n*2 - 3n - 9. Let o(q) = 2q3 + q2 - q + 2. Determine -3o(g) + w(g). 41g3 - 15 Let f(k) = 7k*3 + 9k*2 + 8k. Let z(n) = -4n3 - 5n*2 - 4n. Let a(i) = 7i2 - 121i - 123. Let m be a(-1). Determine mz(c) + 3f(c). c*3 + 2c*2 + 4c Let k(r) = -r*3 + 7r*2 - 246r + 30. Let i(s) = s*3 - 2s*2 - s - 10. Determine 3i(q) + k(q). 2q3 + q2 - 249q Let c(o) = 1. Let v(z) = -z - 1. Let k(l) = -21 + l + 46 - 16. Let w be k(-7). Suppose 3y + wd + 6 = 0, 3d - 2 = y - 0y. Calculate yv(p) + c(p). 2p + 3 Let h(f) = -7f - 1. Let r(o) = -3o - 1. Let n = 215 + -43. Suppose -4s + 212 = n. Give sr(w) - 4h(w). -2w - 6 Let y(r) = -134134r + 728. Let s(n) = 552n - 3. Give 728s(l) + 3y(l). -546l Let p(v) = -438v*2 + v + 62. Let b(a) = -874a*2 + 2a + 151. Determine 2b(i) - 5p(i). 442i2 - i - 8 Let z(j) = 5j*2 - j - 1. Let b(x) = -106x*3 - 80x*2 + 16x + 14. Give -b(a) - 16z(a). 106a*3 + 2 Let d(y) = 7y + 9y - 3y - 25y2. Let b(u) be the second derivative of 1/2u*3 - 1/2u*4 + 3u + 0u2 - 23. Give -9b(v) + 2d(v). 4v*2 - v Let p(z) = 5278z*2 + 609z. Let b(v) = 6v2 + v. What is 1218b(a) - 2p(a)? -3248a*2 Let k(r) = 11r*2 + 135r - 2552. Let j(z) = 3z2 + 30z - 638. Calculate -9j(c) + 2k(c). -5c2 + 638 Let l(i) = 2i - 13. Let g(t) = t - 8. Let q(r) = 5g(r) - 3l(r). Let m(a) = 2a - 8. Let c(h) = -h + 2. Let k(n) = -9c(n) - 2m(n). Calculate -k(f) + 2q(f). -7f Let v(m) = m2 + m + 2. Let k(r) = 9r*2 + 4r + 16. What is -k(w) + 6v(w)? -3w*2 + 2w - 4 Let q(w) = -37w + 1037. Let y(m) = 12m - 347. What is -3q(n) - 10y(n)? -9n + 359 Let b(d) = -151d*3 - 19d*2 - 12d - 6. Let k(a) = 3a2 + 2a + 1. Determine b(z) + 6k(z). -151z3 - z2 Let l(m) be the third derivative of 5m4/24 + 3m3/2 - m2. Let u(g) = -6g - 10. Let f = -174023 - -174028. Calculate fl(c) + 4u(c). c + 5 Let s = 1928 - 1925. Let w(b) = b3 + 5b*2 + 3b - 3. Let a(d) = 3d3 + 16d*2 + 8d - 8. What is sa(k) - 8w(k)? k*3 + 8k*2 Let a(c) = 10c*2 - 1731c + 16. Let n(t) = 5t2 - 887t + 7. Give 4a(o) - 9n(o). -5o2 + 1059o + 1 Let j(c) = 2. Suppose -2f + 4 = 2o, 5o + 0 = 4f + 1. Let l(u) = -665u + 2. Let r(t) = -2328t + 7. Let z(n) = 7l(n) - 2r(n). Calculate oj(m) - 3z(m). -3m + 2 Let y(m) = -18m. Let t(l) = -12l. Let g(b) = 3b + 35. Let n be g(-7). Let s(u) = u*3 - 13u*2 - 12u - 35. Let j be s(n). What is jt(a) + 5y(a)? -6a Let p = 2 - -3. Let z(u) = 2u + 6. Let t = -1545 - -1546. Let b(l) = -1. What is pb(y) + tz(y)? 2y + 1 Let l(c) = -134937c*3 - 203c*2 - 203c + 203. Let b(k) = 1336k3 + 2k*2 + 2k - 2. What is -609b(i) - 6l(i)? -4002i3 Let g(i) = 3i*3 + 5i*2 - 10i + 3. Let p(t) = 3t3 + 4t*2 - 13t + 4. Determine 5g(q) - 4p(q). 3q3 + 9q*2 + 2q - 1 Suppose 9 - 1 = 4w. Let d(m) = -wm + m*2 - 4m*2 + 4m - 4m. Let q(v) = 42v - 208. Let l be q(5). Let g(t) = -t*2 - t. Give lg(f) - d(f). f*2 Let n(l) = -10l*2 + l - 5. Suppose 26 = 1898h - 1900h - 5d, h - 4d - 26 = 0. Let o(f) = -5f*2 + f - 2. What is hn(v) - 5o(v)? 5v*2 - 3v Let r(m) = -16m3 + 8m*2 + 8m + 8. Let b(u) be the first derivative of 5/2u2 + 5u + 5/3u3 - 11/4u*4 - 18. Determine 8b(c) - 5r(c). -8c*3 Let a(c) be the second derivative of -2c*4/3 + 53c*3/6 + 7c*2 - 140c + 5. Let p(x) = -3x2 + 18x + 5. Give -4a(m) + 11p(m). -m*2 - 14m - 1 Let z(r) = 2r3 + 96r*2 + 99r + 236. Let b be z(-47). Let l(j) = -1. Let w(k) = -4k + 10. Give bw(n) + 2l(n). -4n + 8 Let f(s) = 24s2 - 24s - 19. Let u(v) = 49v2 - 52v - 38. Give -13f(y) + 6u(y). -18y2 + 19 Let h(b) = 4b*2 - 3b*2 + 54b*3 - 1211 + 1206 - 51b3. Let w(x) = -x3 + 1. What is -h(y) - 5w(y)? 2y3 - y2 Let l(z) = -18z2 + 25z + 16. Let a(o) = -o*2 - 5o - 2. What is -10a(f) - 2l(f)? 46f2 - 12 Let b(v) = -v3 - v2 - v - 1. Let g(n) = -4n*2 - 48 - 53 - 17n*3 - 6n + 128 - 32. Determine -6b(z) + g(z). -11z*3 + 2z2 + 1 Let j(d) = d3 - 21d2. Suppose 33y + f = 37y + 20, 4y - 4f + 20 = 0. Let h(q) = -2q*3 + 41q*2. What is yj(b) - 3h(b)? b3 - 18b*2 Let i(s) = 3s - 1. Let k(j) be the first derivative of j*2 - 2j + 1073. Determine 3i(c) - 2k(c). 5c + 1 Let f(m) = -7m - 4. Let y(w) = 8w + 5. Let l(k) = k3 + 8k*2 - 4k - 30. Let t be l(-8). Suppose tj - 50 = -8j. Calculate jf(x) + 4y(x). -3x Let v(m) = 6m*3 + 3m*2 + 5m - 1. Suppose 67 = -32j - 77 - 16. Let w(t) = t3 + t2 + t. What is jw(l) + v(l)? l*3 - 2l*2 - 1 Let h(s) = -112s*2 + 108s - 83. Let k(y) = 45y2 - 45y + 33. Calculate 5h(b) + 12k(b). -20b2 - 19 Let f(a) = 0a*2 - 5a*2 + 7 - 2a*2 + 7a. Let j(u) = 15u2 - 15u - 15. Suppose -587 + 173 = -69z. What is zj(c) + 13f(c)? -c2 + c + 1 Suppose p = -p - 2. Suppose -3d - 47 = -3v + 43, v = -5d + 12. Let l(m) = -51 - m + v + 25. Let c(w) = w*2 + w - 1. What is pl(r) - c(r)? -r*2 Let a(t) = 40t - 267. Let z(u) = -71u + 535. What is -7a(g) - 4z(g)? 4g - 271 Let a(i) = i*2 - 2i - 4. Let d(j) = 3j + 38. Let o(l) = 2l +	{ "pile_set_name": "DM Mathematics" }
What is the third derivative of 2n4 - 2n*s + 5n*2 - 3n*4 + 0n*4 wrt n? -72n Let x(y) be the second derivative of 0 + 1/3y3 - y + 3y*2 - 1/4y*4. Let l(r) be the first derivative of x(r). What is the first derivative of l(n) wrt n? -6 Let y(a) be the second derivative of -25a7/6 - a4/4 - 10a2 + 2a - 18. Find the third derivative of y(l) wrt l. -10500l2 Let c be ((-13)/26)/((-2)/12). What is the derivative of -62i4 + i3 - i*c + 65i*4 - 10 wrt i? 12i*3 What is the second derivative of 18029 - 6j + 8j - 18427 + 565j*2 wrt j? 1130 Find the second derivative of 24y + 57y4 + 11y + 46y4 + 62y wrt y. 1236y2 Let o(v) = -73v*3 - 99v*2 - 2v - 4. Let t(m) = 292m3 + 397m*2 + 9m + 18. Let y(q) = 9o(q) + 2t(q). Find the third derivative of y(z) wrt z. -438 Find the first derivative of 0m4 + 82 - 5m*4 + 102 + 8 - 27 - 3m*2 wrt m. -20m*3 - 6m Let i be (1 + -2)/((-2)/(-10)). Let v(c) = -7c3 - 1. Let s(t) = -14t*3 - 7 + 13 - 9. Let x(p) = iv(p) + 3s(p). What is the derivative of x(h) wrt h? -21h*2 Let n be (-1026)/(-378) - 1/((-14)/4). Differentiate 19 - 16z*3 - 43 - 5z*n wrt z. -63z*2 Suppose 15 - 1 = 2l. Find the second derivative of -ls2 + 0s*2 - 4s*2 - s - 10s wrt s. -22 Let w = 142 - 142. Let j(c) be the second derivative of 0c3 + 0 + 0c*5 + c + wc*2 - 1/6c*4 + 1/30c*6. What is the third derivative of j(h) wrt h? 24h Let j(u) be the second derivative of -39u5/4 - 163u*3/6 + 139u. What is the second derivative of j(n) wrt n? -1170n Let j(b) = -5b*2 - 14. Let z(s) = 1. Let o = 38 + -65. Let m = -29 - o. Let i(d) = mz(d) - j(d). Differentiate i(h) wrt h. 10h Let c(o) = -o2 + 12o + 5. Let f be c(12). Suppose -fh = t - 0t - 22, -5t - 4h = -47. Differentiate 0x2 + tx*2 - 6 - 3x*2 wrt x. 8x Find the second derivative of 39s2 + 33s + 280s2 - 26s*2 + 397s wrt s. 586 Find the third derivative of 7772r3 - 7772r*3 + 207r*6 - 83r*2 wrt r. 24840r3 Let r(l) be the second derivative of -l9/84 - 4l5/15 - l2/2 - 15l. Let z(n) be the first derivative of r(n). Find the third derivative of z(a) wrt a. -720a3 Let c(z) be the third derivative of 209z*4/24 + 211z*3/6 + 226z*2. Find the first derivative of c(r) wrt r. 209 Let y(g) be the third derivative of 0g + 2/15g5 + 0 + 19/24g*4 + 0g*3 + 25g*2. What is the second derivative of y(c) wrt c? 16 What is the second derivative of 2u*5 + 14u*2 + 3u*2 + 12u - 3 + 108u + 13u*2 wrt u? 40u*3 + 60 Let r(m) be the third derivative of -5m6/24 + m4/24 - m*3/3 - 63m*2. What is the second derivative of r(a) wrt a? -150a Let a(o) be the first derivative of -1/2o4 + 0o*3 + 0o + 9/2o2 - 6 + 3o*5. Find the second derivative of a(d) wrt d. 180d*2 - 12d Let g(h) = 3h2 - 9h + 2. Let r be g(4). What is the second derivative of 13m - rm*5 - 16m*5 + 28m*5 wrt m? -40m*3 Suppose -5y + 164 = 3c, 5y + 6c - c - 160 = 0. What is the third derivative of yv*4 - 18v*2 - 6v*2 - 57v*3 + 57v*3 wrt v? 816v Find the second derivative of 1 + 4986h + 7h*5 + 0h*4 + 15h*4 - 2h*5 - 4947h wrt h. 100h3 + 180h*2 Suppose -6 - 9 = -5d. What is the third derivative of u*2 + 3u*3 + 4u*d + 3u*3 - 4u*3 wrt u? 36 Let d(y) = 3y - 18. Let l be d(8). What is the third derivative of -16gl + 4g*5 - 4g*5 - 9g*6 - 7g*2 wrt g? -3000g*3 Suppose -5x = 4 - 19, 4x - 404 = -4f. Differentiate 98 - 5a + f - 189 with respect to a. -5 Let b(r) be the second derivative of 25r8/56 + r7/14 - 3r4/2 + 4r*3/3 + 11r + 4. What is the third derivative of b(h) wrt h? 3000h3 + 180h*2 Let h(c) = -4c - 42. Let u be h(-12). Find the third derivative of -ur2 + r2 - 2r*2 + 0r*2 + 18r*3 wrt r. 108 Let s(z) be the third derivative of 107z*6/24 - 11z5/15 + z3/2 - 2z2 + 118. What is the third derivative of s(m) wrt m? 3210 Let b(c) = -126c*6 + 3c*4 - 82c*2 + 6c - 3. Let x(j) = j6 - j4 + j*2 - 2j + 1. Let l(g) = b(g) + 3x(g). Find the third derivative of l(k) wrt k. -14760k*3 Suppose 21g = -3g. Let m(z) be the third derivative of 0z + 1/120z6 + 0 - 4z*2 + 0z*5 - 1/8z*4 + gz*3. Find the second derivative of m(a) wrt a. 6a Let s(r) be the first derivative of 0r - 17/2r*2 - 3 + 0r*3 + 17/4r*4. What is the second derivative of s(b) wrt b? 102b Suppose 9w - 4w = 310. Find the second derivative of 9u + wu*3 - 31u*3 - 31u*3 - 4u*4 wrt u. -48u*2 Suppose 49 = 5c - 66. Let k(h) = h*3 + 5h*2 + 4h + 4. Let x be k(-4). Find the third derivative of i*4 + xi*4 - 13i*2 + ci*2 wrt i. 120i Let q(v) be the first derivative of 3v2/2 - 9v + 5. Let k be q(4). Differentiate 5z - kz*2 - 5z - 3 + 4z2 wrt z. 2z Let w(u) be the third derivative of 0u + 0u*5 + 14/3u*3 + 0 - 3u*2 + 1/15u*6 + 0u*4. What is the first derivative of w(g) wrt g? 24g*2 Let p(j) = -4j2 + 10. Let o(u) be the third derivative of u5/60 - 17u2. Let f(v) = -o(v) - p(v). Differentiate f(z) with respect to z. 6z Let s(m) = -9m3 + 11m*2 + 114m + 5. Let b(w) = 2w3 - 1. Let j(a) = -5b(a) - s(a). Find the second derivative of j(t) wrt t. -6t - 22 Find the third derivative of -6w*2 + 295w*4 - 2w*6 - 161w*4 + 339w + 8w2 wrt w. -240w*3 + 3216w Let w(k) be the third derivative of -k*5/12 - 5k*4/24 + 37k*3/2 - 34k*2. Differentiate w(i) with respect to i. -10i - 5 Let t be (-40 - -35 - (-5)/2)/(-5). Let n(f) be the first derivative of -2 + 0f3 + 1/2f*4 + tf*2 + 0f. Find the second derivative of n(j) wrt j. 12j Let w(h) be the first derivative of -41h*2/2 + 46h - 1. Differentiate w(t) wrt t. -41 Suppose y + 22 = 3y. Let p = y + -7. What is the derivative of 10 + 0x4 - 12 - xp wrt x? -4x3 Let x(h) be the third derivative of 103h*7/105 - 149h*3/6 + 12h*2 + h. What is the first derivative of x(n) wrt n? 824n*3 What is the second derivative of 22x - 11x - 126x*2 + 197x wrt x? -252 Let q = -9 - -11. Let z(i) = -2 + 3 + qi - 2 - 2. Let n(w) = -2w + 2. Let x(c) = 6n(c) + 5z(c). Find the first derivative of x(t) wrt t. -2 Let m(x) be the second derivative of -8x4/3 - 60x*2 - 147x. Find the first derivative of m(y) wrt y. -64y Let a(o) = o2 + o + 5. Let y(c) = 11c*2 + 4c - 483. Let w(p) = a(p) + y(p). What is the derivative of w(r) wrt r? 24r + 5 Let o(x) be the second derivative of 3/10x*5 + 4x + 1/2x4 + 0 + 0x*2 + 0x*3. What is the third derivative of o(v) wrt v? 36 Differentiate 2j*3 - 7j + 186j4 - 69 - 2j*3 - 373j*4 + 189j*4 wrt j. 8j*3 - 7 Let m(h) be the first derivative of -5h*7/7 + 25h*4/12 + 26h - 3. Let b(s) be the first derivative of m(s). What is the third derivative of b(w) wrt w? -1800w2 Let d = -4 - -7. Suppose -5n - q = -32, -3n = -3q - q - 10. Find the third derivative of 18s2 - 24s*2 - ns6 + s3 - s*d wrt s. -720s*3 Let m(g) = 75g*4 + 4g*2 + 9g + 1. Let k(x) = 151x4 + 7x*2 + 17x + 1. Let c(o) = -4k(o) + 7m(o). Find the second derivative of c(v) wrt v. -948v2 Let t(n) be the second derivative of -31n*5/5 - 35n*4/6 - n - 11. Find the third derivative of t(i) wrt i. -744 Let b be (10/8)/((-2)/(-8)). Suppose 0 = -28z + 21z + 35. Find the second derivative of -h5 + 3h*b - 4h - 3hz wrt h. -20h3 Let n(w) be the third derivative of -w7/14 + 31w5/60 + 25w*2 - 2w. Find the third derivative of n(j) wrt j. -360j Suppose -6v - 2 + 14 = 0. Let u(h) be the first derivative of 3h + 0h*4 - 3 + 0h*v + 0h*3 + 1/5h*5. What is the first derivative of u(o) wrt o? 4o3 Let t(g) = g4 + 14g3 + 9g*2 + 392g - 9. Let p(l) = 4l3 + 2l*2 + 98l - 2. Let z(w) = 9p(w) - 2t(w). What is the second derivative of z(a) wrt a? -24a2 + 48a Let g(p) = 2p + 1. Let f(n) = 2n - 57. Let t(w) = -f(w) + 2g(w). Find the first derivative of t(r) wrt r. 2 What is the derivative of 12i*3 - 23 + 19i*2 + 24i*2 - 4 - 13i*3 + 5 wrt i? -3i*2 + 86i Let g be 2/5 - (-6)/(-15). Find the second derivative of 9a + 4a4 - a4 + ga4 wrt a. 36a*2 Differentiate -385 + 304 + 333 + 65z with re	{ "pile_set_name": "DM Mathematics" }
Let p(o) = 8o + 8. What is -p(n) + 6s(n)? -2n - 8 Let f(p) = -p3 + p2 - 5. Suppose -r - 5z = r - 6, 0 = -5z + 10. Let o be r/17 - (-870)/170. Let l(y) = -y3 - 2. What is ol(x) - 2f(x)? -3x*3 - 2x*2 Let n(w) = 2w - 43. Let i(a) = -1. What is 4i(j) + n(j)? 2j - 47 Let o be (-1)/2(-5 - -1). Let v(i) be the first derivative of i2/2 - i - 92. Let l(m) = m + 1. Give ov(t) + l(t). 3t - 1 Let s(t) = t + 1. Let l(g) = 3g + 9. Let r(h) = 9. Let u(z) = 5l(z) - 4r(z). Let i be (-10)/44/(-10). Determine iu(d) - 9s(d). 6d Let z(m) = -1. Let v(a) be the second derivative of a*6/360 - 7a5/120 + a4/2 + 18a. Let o(s) be the third derivative of v(s). Give -o(l) + 4z(l). -2l + 3 Suppose 3b - 84 = 2b. Let l(z) = 6z - b - 25z - 114z. Let u(q) = 11q + 7. Let o(h) = 4l(h) + 49u(h). Let c(i) = 8i + 8. Determine 5c(x) - 6o(x). -2x - 2 Let t(d) = -1 + 32d*3 - 4d - 1 - 31d3. Let w(j) be the first derivative of 3j*4/4 - 11j*2/2 - 6j - 2. Determine -11t(s) + 4w(s). s*3 - 2 Let a(d) = -3d*3 + 4d. Let t be 2/(-1) - 2/1. Let s(m) be the first derivative of -2m4 + 11m*2/2 - 81. Calculate ts(q) + 11a(q). -q3 Let y(i) = -10i*2 + 20i*2 - 7i*2 - 2i*2 + 1. Let x(o) = 22o*2 + 11. What is -x(q) + 11y(q)? -11q2 Let c(o) be the third derivative of 0o + 2o2 + 1/3o*3 + 1/8o4 + 0. Let a(i) be the first derivative of i2/2 + i - 4. Give -2a(r) + c(r). r Let b(i) = 4i - 1. Let v(m) = -11m - 6. Give -4b(p) - v(p). -5p + 10 Let q(i) = -5i + 1. Let w(z) = -14z + 3. Let h = 11 - 17. Let p be -31/h-8. Let v = 4 - -7. Give pw(a) + vq(a). a - 1 Let m(u) = u2 - u. Let h(d) = d3 - 6d*2 + 6d - 5. Suppose -5o - 5 = 5v - 3o, -4 = 4v - 5o. Give vh(j) - 6m(j). -j3 + 5 Let p(h) = -310h + 4. Let o(c) = 620c - 9. Determine 6o(l) + 13p(l). -310l - 2 Let q(j) = 2j3 + 48j*2 - j + 3. Let f(c) = -3c3 + c2 - 1. Determine -3f(o) - q(o). 7o*3 - 51o*2 + o Let p(d) = -5d - 267. Let c(n) = -n - 53. What is 11c(j) - 2p(j)? -j - 49 Let c(m) = 79m3 - 5m + 5. Let g(a) = 79a3 - 4a + 4. What is -4c(d) + 5g(d)? 79d3 Suppose -2u + 3d + 17 = 0, 2 = u - 2d - 8. Let v(j) = 11j + 3. Let a(k) = -5k - 2. Give uv(x) + 9a(x). -x - 6 Let p(d) = d. Let f(u) = 3u. Suppose -4 = 4t - 0, 7 = w - 5t. Suppose 3a - 13 + 4 = 5g, 0 = -5g + wa - 6. Suppose g = h - 2h - 2. Give hf(s) + 5p(s). -s Let k(g) = -16 + 56g - 62g + 16. Let d(i) = i. Determine 20d(p) + 4k(p). -4p Let z(c) = 1. Let d(n) = n2. Let m be 14(-6)/60 - (-242)/55. What is mz(r) - d(r)? -r2 + 3 Let l(s) = -7s*2 + 6. Let m(f) = 20f*2 - 17. Let k be (-7)/(-3) + 25/(-3). Give km(u) - 17l(u). -u2 Let l(h) = -h2 + 1. Let m = -140 - -164. Let z(t) = 8t*2 - 12. Determine ml(x) + 2z(x). -8x*2 Let h(y) = -y - 2. Let w(s) = 5s + 9. Let f(n) = 9h(n) + 2w(n). Let d(l) = -8l. Suppose 2040j - 3 = 2037j. Give jd(r) + 4f(r). -4r Let u(q) = 8q + 3. Suppose -92t + 100t + 48 = 0. Let d(f) = 8f + 4. What is td(w) + 8u(w)? 16w Let k(a) = -21a*3 - 8a*2 + 2a - 2. Let o(v) = 43v3 + 17v*2 - 5v + 5. Determine -5k(s) - 2o(s). 19s3 + 6s*2 Let d(p) = 6p - 10. Suppose -22q + 0 = 22. Let g(f) be the second derivative of -f3/6 + f2/2 + f. Give qd(c) - 8g(c). 2c + 2 Let f(w) = -4w. Let a = -60 - -103. Let g(r) = -19r - 11r + ar - 14r. Suppose 0 = -2b + 5b - 3. What is bf(j) - 6g(j)? 2j Let t(d) = 2d3 + 0d2 - d3 + 5 + 5d2. Let q(z) = 1488 - 4z*2 - 752 - 740. Give 5q(v) + 4t(v). 4v*3 Let m(p) = 49p*2 - 2. Let r(w) = 50w*2 - 3. Calculate 3m(k) - 2r(k). 47k2 Let m(c) = c2 - c + 1. Let n(h) = -14h - 76. Let f be n(-5). Let j(k) = 5k*2 - 9k + 5. Determine fm(x) + j(x). -x2 - 3x - 1 Let t(k) = 23k + 10. Let o(v) = -195v - 81. Give 6o(b) + 51t(b). 3b + 24 Suppose -10h - 243 = -213. Let q(b) = 3b. Let p(n) = 6n + 1. Determine hp(g) + 5q(g). -3g - 3 Let v(a) = 2a + 15. Let i(s) = -3s - 12. What is -4i(u) - 3v(u)? 6u + 3 Let l(a) = -1. Suppose 0 = 4h + 4p + 13 - 33, -5p = 2h - 10. Let j(o) = 2o - 9. Give hl(c) - j(c). -2c + 4 Let m(g) = 5. Let q(f) = 7f. Let i(s) = 10s - 1. Let u(r) = 5i(r) - 7q(r). Give -2m(k) - 3u(k). -3k + 5 Let a(n) = -4n2 - n - 1. Let w(x) = 2x*3 - 8x*2 + x - 15. Determine -2a(b) + w(b). 2b3 + 3b - 13 Let i(m) = -2m + 6. Let k(v) = 2v - 5. Let r(f) = 2i(f) + 3k(f). Suppose -6 = o - 8. Let h(u) = 3 - o - 43u - 3 + 45u. What is 5h(z) - 4r(z)? 2z + 2 Let r(g) = 7g + 199. Let d(o) = -12o - 198. Determine -2d(s) - 3r(s). 3s - 201 Let s(w) = 2w3 + 4w*2 - 3w + 3. Let n(v) = 11v - 129. Let d be n(12). Let a(c) = -6c*3 - 12c*2 + 8c - 8. Determine da(u) + 8s(u). -2u3 - 4u*2 Let f(i) = 8i*3 + 14i*3 + 4 - 12i*3 - 7i*2 + 2i + 3. Let z(p) = -7p3 + 5p*2 - p - 5. What is 5f(b) + 7z(b)? b3 + 3b Let r(d) = d. Let c(s) = -7s2 - 11s + 2. Let t(l) = -3l2 - 5l + 1. Let o(j) = -4c(j) + 9t(j). Give 2o(i) + 3r(i). 2i2 + i + 2 Let i(b) = 4b - 1. Suppose 49v - 42v - 42 = 0. Let n(a) = a. What is vn(h) - i(h)? 2h + 1 Let c(m) = 6m3 + 17m*2 + 14m + 11. Let z be 4 + (-2 - -4) - (-5 - -2). Let f = 8 + z. Let o(i) = -2i3 - 6i*2 - 5i - 4. Give fo(l) + 6c(l). 2l3 - l - 2 Let f(d) = -2d - 42. Let c(b) = -2b - 43. Calculate -5c(x) + 4f(x). 2x + 47 Let f(v) = 15v2 - 3. Let h(i) be the first derivative of 29i*3/3 - 5i + 329. Calculate 5f(p) - 3h(p). -12p2 Let h(u) = 7u*3 - 12u - 6. Let f(y) = -9y3 + 11y + 4. Determine -4f(n) - 3h(n). 15n3 - 8n + 2 Let f(c) = -5c2 + 9c - 25. Let x(m) = -3m2 + 5m - 13. Calculate 6f(d) - 11x(d). 3d2 - d - 7 Let d(s) = -21s*2 + 6s - 1. Let l(c) = 21c2 - 8c + 2. Calculate -4d(k) - 3l(k). 21k2 - 2 Suppose 5t = -7 + 27. Suppose i - 18 = -b + t, -2i = -b - 53. Let s(p) = 85p*3 + 25p + 25. Let y(u) = -7u3 - 2u - 2. Give iy(q) + 2s(q). -5q3 Let q(o) = 3o*3 + 4o2 - 4. Let m = 10 + -24. Let i = -18 - m. Let z(x) be the first derivative of -x4/2 - x*3 + 3x - 1. Calculate iz(r) - 3q(r). -r*3 Let a(c) = 8c*3 + 6c*2 + 9c - 11. Let b(f) = 7f3 + 5f*2 + 8f - 11. Give -5a(i) + 6b(i). 2i3 + 3i - 11 Let s(f) = -f2 + f + 1. Let g(m) = -m3 - 3m2 - 21m + 1. What is g(y) - s(y)? -y*3 - 2y*2 - 22y Suppose 0v = -3v - 18. Suppose -9d + 2 = -8d - j, 0 = 3d + 3j - 6. Let r(i) = -1 - 1 - i*3 + 1. Let t(o) = -4o*3 - 2. Determine dt(c) + vr(c). -2c*3 + 2 Let v(m) = -13m + 16. Let w(h) = 54h - 66. Calculate -9v(j) - 2w(j). 9j - 12 Let q(o) = 5o3 + 2o*2 - 3o. Let b = 8 - 9. Let h(p) be the first derivative of 0p + 1/3p*3 + 1/4p*4 + 5 - 1/2p*2. Calculate bq(w) + 3h(w). -2w3 + w2 Let k(s) = -12s2 - 2s + 2. Let r(h) = h3 - h2 + h - 1. Calculate k(p) + 2r(p). 2p*3 - 14p*2 Let a(m) = -81m3 - m2. Let k(h) = 325h3 + 4h*2. Determine -9a(g) - 2k(g). 79g3 + g2 Let a(q) = 2q - 251. Let y(u) = -15u + 2070. Let i(h) = -33a(h) - 4y(h). Suppose 0x - 15 = -5x. Let z(n) = -3n + 2. Determine xi(w) - 5z(w). -3w - 1 Let q(i) = -827i - 7. Let b(p) = -415p - 4. Determine 11b(v) - 6q(v). 397v - 2 Let f(s) = -62 - 66 + 128 + 15s. Let w(z) = -8z. Calculate -5f(c) - 9w(c). -3c Let h(y) = 25y2 - 35y. Let c(d) be the third derivative of -d5/30 + d4/8 - 9d2 + 5. Calculate -35c(i) - 3h(i). -5i*2 Let q(m) = -4m*3 + 5m - 3. Suppose 5c = -5k + 15, -5k + 20 = -4c + 14. Let l(w) = -w*3 + w - 1. Give cq(t) - 3l(t). -t3 + 2t Let k = -48 + 59. Let w(z) = 11z2 + 2z + 7. Let b(n) = -55n2 - 11n - 34. Let a(s) = kw(s) + 2b(s). Let u(g) = -5g2 - 4. Give -6a(x) - 13u(x). -x2 - 2 Let z(r) = 2r. Let m(w) = -2w2 - 8w + 1. Determine m(v) + 2z(v). -2v*2 - 4v + 1 Let y(b) = -5b + 5 + 6b*3 + 3b*2 - 3b*2. Suppose -6 = -5d + f, 4f + 0 + 6 = 2d. Let w(q) = -q*3 + q - 1. Calculate dy(i) + 5w(i). i3 Let c(l) = 4l*3 - 3l*2 + 3l. Let y(b) be the third derivative of b6/120 - b5/60 + b4/24 - b2. Let s = 364 + -365. Determine sc(r) + 3y(r). -r*3 Let m(l) = 3l + 22 + 25 + 25 - 68. Suppose 0 = -3*j	{ "pile_set_name": "DM Mathematics" }
8)). Factor 9k5 + 1 - 8k*5 + 16k - 5 + 19k3 - 25k*d - 2k*4 - 5k4. (k - 2)2(k - 1)3 Let u(l) be the first derivative of -3l*4/20 - 1. Factor u(f). -3f*3/5 Let y(g) = -5g*5 - 4g*4 - 2g*3 - 14g*2 - 13g + 4. Let p(m) = -m5 - m4 - m*2 - m + 1. Let k(v) = 6p(v) - y(v). Factor k(a). -(a - 2)(a + 1)4 Let v = -31/15 + 12/5. Factor vg*2 + 1/3g + 0. g(g + 1)/3 Find t, given that -3t*4 - 16t*3 - 25 + 23 - 21t2 - t4 - 11t = 0. -2, -1, -1/2 Solve -4d2 - 5 + d2 - 3d + 5 = 0 for d. -1, 0 Let x(s) = s. Let c(q) = q2 + 3q. Let p(o) = -o*3 + 4o*2 + 2. Let g be p(4). Let v(a) = gx(a) - c(a). Factor v(l). -l(l + 1) Let f = 3/5 + 3/20. Suppose 1/4s*3 + 0s - 1 + fs2 = 0. Calculate s. -2, 1 Let q(t) be the first derivative of 0t - 1/420t6 + 1 - 1/7t*4 + 8/21t*3 + 1/35t5 - t2. Let j(v) be the second derivative of q(v). Factor j(g). -2(g - 2)3/7 Let i(u) be the second derivative of -u8/5880 + u6/1260 + u3/6 - 2u. Let h(b) be the second derivative of i(b). Factor h(z). -2z2(z - 1)(z + 1)/7 Let 1/4 - w3 - 1/4w*2 + w = 0. Calculate w. -1, -1/4, 1 Determine h, given that 0h + 16/5h3 + 32/5h*4 + 0 + 2/5h*2 = 0. -1/4, 0 Let h(p) be the first derivative of -3/2p*4 + 3/5p*5 + 0p*2 + 3 + 0p*3 + 0p. Let h(a) = 0. Calculate a. 0, 2 Factor 0 - 1/5k2 + 2/5k. -k(k - 2)/5 Let b(j) be the second derivative of 0j*2 - 1/84j*4 + 0j*3 - 7j + 0. Factor b(x). -x*2/7 Let w(q) = 3q*4 - 4q*3 + 2q*2 + 2q + 1. Let d(c) = 9c3 - 5 - 1 - 4c - 5c2 - 7c*4 + 2 + 1. Let i(g) = -2d(g) - 5w(g). Factor i(k). -(k - 1)3(k + 1) Suppose 2a - 4b = -0a + 4, 0 = a - 3b. Suppose -ar + r + 10 = 0. Solve or + 0o*2 + 0o*2 + 1 - 2o = 0 for o. 1 Let y(w) = w*2 - 2w + 5. Let b(n) = -2n2 + 4n - 9. Let p(a) = -4b(a) - 7y(a). Find q, given that p(q) = 0. 1 Suppose 92i = 84i + 32. Suppose 0a + 0 + 3a*i - 3/4a*2 + 9/4a3 = 0. What is a? -1, 0, 1/4 Let p(s) be the first derivative of s6/720 + s5/60 + s4/16 + 4s3/3 - 5. Let z(k) be the third derivative of p(k). Suppose z(m) = 0. What is m? -3, -1 Let m(r) be the third derivative of r5/12 - 5r*4/12 + 5r*3/6 - 8r*2. Determine o, given that m(o) = 0. 1 Let v be (-3)/4(-6 + 2). Factor -2fv + 24f*2 - 48f + 32 - 2f3 + f3 - f3. -4(f - 2)*3 Determine c so that 4c*2 + 3c*3 + 0 + 4/3c + 2/3c4 = 0. -2, -1/2, 0 Suppose 6 = g + 2i, 5i = -3g + 4g - 20. Let q be 4/g - 9/45. Let -1/5t*3 + qt*2 - 1/5t*4 + 1/5t + 0 = 0. What is t? -1, 0, 1 Let g(r) be the second derivative of -38/5r5 + 157/12r*4 - 22/3r*3 + 14/3r*7 + 2r*2 - r + 0 - 161/30r*6. Let g(j) = 0. What is j? -1, 1/4, 2/7, 1 Let n = 15/2 - 7. Let u(o) be the first derivative of 0o + no2 + 1/6o*6 + 4/3o*3 + 2 + 4/5o*5 + 3/2o4. Determine q, given that u(q) = 0. -1, 0 Let a(y) be the second derivative of -y6/480 - y5/120 - y4/96 - 3y2/2 - 3y. Let u(q) be the first derivative of a(q). Let u(m) = 0. Calculate m. -1, 0 Let b(d) be the first derivative of 2d3/9 - 1. Determine m so that b(m) = 0. 0 Let j = 247/7 - 35. Let i(y) = -2y*2 + y + 2. Let m be i(0). Factor 0d + j - 2/7dm. -2(d - 1)(d + 1)/7 Let m(f) be the second derivative of -f6/45 + 2f5/15 - f4/6 + 2f - 7. Suppose m(o) = 0. What is o? 0, 1, 3 Factor -105g - 120g - 8 + 20g*3 - 4g*4 + 253g - 36g2. -4(g - 2)(g - 1)3 Let m(l) be the first derivative of 0l*2 + 2 + 0l + 1/420l5 + 1/1260l*6 - 1/42l4 - l3. Let w(n) be the third derivative of m(n). Factor w(j). 2(j - 1)(j + 2)/7 Let z(x) be the third derivative of 5x8/168 - x7/14 + x5/12 + 2x*2. Factor z(o). 5o*2(o - 1)*2(2o + 1) Let z = 13 + -11. Factor 1/5d*3 + 0 + 0d + 0dz. d3/5 Factor 21l*2 - 23l*2 + 4l - 4 - 2l + 4l. -2(l - 2)(l - 1) Let d be 1/((-4)/(-6)(-2)/(-4)). Solve 2/9m*2 + 2/9m*d - 2/9m - 2/9 = 0. -1, 1 Let l(u) = -16u3 + 74u*2 - 29u. Let y(b) = 5b3 - 25b*2 + 10b. Let a be (2/4)/(3/24). Let c(f) = al(f) + 11y(f). Factor c(x). -3x(x - 2)(3x - 1) Let s be -6 - 52(-8)/68. Factor 4/17k*3 - 2/17k - 2/17k5 - 2/17 + 4/17k*2 - sk*4. -2(k - 1)*2(k + 1)*3/17 Let g(l) be the first derivative of -14l*6/9 - 76l*5/15 + 13l*4/3 + 76l*3/9 - 4l*2 - 68. What is m in g(m) = 0? -3, -1, 0, 2/7, 1 Suppose -21 = -4y - 9. Let i(d) be the first derivative of y + 0d4 - 1/9d*3 + 1/15d*5 + 0d + 0d2. Let i(h) = 0. What is h? -1, 0, 1 Let z(i) be the first derivative of 175i*6/12 + 109i*5/2 + 5i*4 - 380i*3/3 - 20i*2 + 40i + 40. Find v, given that z(v) = 0. -2, -2/5, 2/7, 1 Let l(o) be the third derivative of -5o8/42 + 9o7/35 + o6/15 - 3o5/10 - o4/6 + 2o*2. Let l(v) = 0. What is v? -2/5, -1/4, 0, 1 Let f(a) be the third derivative of 2/45a*5 + 0a + 1/36a4 + 1/60a*6 + 0 + 0a3 - a2. Factor f(h). 2h(h + 1)(3h + 1)/3 Suppose 0 + 0a + 3/2a*2 - 3/2a*3 + 3/8a*4 = 0. Calculate a. 0, 2 Suppose 4k = -3h + 27, 5h = -5k - 0k + 40. Solve -s + 5s + 3s*2 - 4s - ks3 = 0 for s. 0, 1 Let a be (-9)/6(-20)/3. Let c = a + -7. Factor 0f2 + 0f + 1/2fc - 3/2f*4 - 2f5 + 0. -f3(f + 1)(4f - 1)/2 Let l(o) be the first derivative of o3 - 9o*2/2 - 12. Find k such that l(k) = 0. 0, 3 Let b(a) be the second derivative of -3/10a*2 + 0 + 4a - 1/5a3 - 1/20a4. Solve b(m) = 0. -1 Solve 5 - n2 - n + 9 - 8 = 0 for n. -3, 2 Let y(n) be the second derivative of n7/252 - n6/45 + n5/20 - n4/18 + n*3/36 + 18n. Suppose y(m) = 0. Calculate m. 0, 1 Let d(o) = 4o5 - o3 + 2o*2 - 2. Let f(c) = -7c*5 + 3c*3 - 4c*2 - c + 4. Let w(a) = 5d(a) + 3f(a). Find l such that w(l) = 0. -2, -1, 1 Let y(a) be the second derivative of -a7/231 + a6/165 + 14a. Determine m, given that y(m) = 0. 0, 1 Let m(g) be the third derivative of g*6/150 + 4g5/75 + g4/6 + 4g3/15 - 16g*2. Factor m(n). 4(n + 1)*2(n + 2)/5 Let d(h) be the second derivative of h7/105 - h5/25 + h*3/15 - 13h. Factor d(b). 2b(b - 1)*2(b + 1)*2/5 Factor 0 + 1/4v*3 + 0v*2 - 1/4v. v(v - 1)(v + 1)/4 Let n(y) = y*4 + 9y*3 + 18y*2 + 10y - 3. Let c(b) = 4b4 + 28b*3 + 54b*2 + 30b - 10. Let m(l) = -3c(l) + 10n(l). Factor m(s). -2s(s - 5)(s + 1)2 Suppose -2 - 4 = -2v. Determine d so that 6d3 - 6d - vd5 - 2d*3 + 2d*3 + 3d = 0. -1, 0, 1 Suppose 2d + 0l + 19 = l, -3l = d - 1. Let a = 14 + d. Find z, given that -3z - 2z2 - 2z + az2 + 2 - z3 = 0. 1, 2 Let b(i) = -117i - 114. Let r be b(-1). Solve 0y + 9/7y*2 - 12/7 - 3/7y*r = 0 for y. -1, 2 Let f(v) be the first derivative of -2v5/5 - v4/2 + 2v3 + v2 - 4v + 4. Factor f(d). -2(d - 1)2(d + 1)(d + 2) Let i(s) = s2 + s + 1. Let u(c) = 3c*2 + 33c - 36. Let l(o) = 6i(o) + u(o). Factor l(k). 3(k + 5)(3k - 2) Suppose -2o + 6 = 2t - 0t, -5t = -5. Factor -3go - g - g3 + 3g*2 - 2g*2. -g(g + 1)2 Let h(o) be the second derivative of -o6/105 + o5/35 - o4/42 - o - 1. Find s, given that h(s) = 0. 0, 1 Solve 101r - 101r + 2r3 - r2 = 0 for r. 0, 1/2 Suppose 3s - 4 = -n - 0, -n = 5s - 10. Let x(o) be the first derivative of -3 - 2/5o*5 + 2/3o*s + 0o + 1/6o6 - 1/2o*2 + 0o*4. Factor x(i). i(i - 1)*3(i + 1) Let h(i) be the third derivative of 0i + 0i*3 + 0 + 3i*2 - 1/480i*6 + 0i*4 - 1/240i*5. Find r such that h(r) = 0. -1, 0 Suppose 0 = -3w - 15, -3s - w - 5 = -0s. Let a(f) be the third derivative of 0f + sf*3 + 1/84f*4 - 3f*2 - 1/210f*5 + 0. What is g in a(g) = 0? 0, 1 Let u be 9/(-21)12/(-18). Let w be ((-2)/(-3))/((-14)/(-12)). Factor 0p - wp*3 + 0p*2 - 6/7p*4 + 0 - up*5. -2p*3(p + 1)(p + 2)/7 Let 0p - 2/9p3 + 0 + 4/9p*2 = 0. Calculate p. 0, 2 Let d = 10 + -8. Suppose 2k + dk = 0. Let 0a*3 - 1/4a*4 + k - 1/2a + 3/4a2 = 0. Calculate a. -2, 0, 1 Let t(m) be the second derivative of -m5/60 - m4/12 - m3/9 - 3m. Factor t(p). -p(p + 1)(p + 2)/3 Solve -8/3 + 0a + 2a*3 + 14/3a*2 = 0. -2, -1, 2/3 Let x(m) = 6m*5 + 6m*4 - 6m*3 - 2m*2 - 4m + 4. Let l(k) = -11k5 - 11k*4 + 11k*3 + 4k	{ "pile_set_name": "DM Mathematics" }
6.7 - 353.7. Which is the third smallest value? (a) r (b) 1 (c) x b Let f be 1/(-2) + (2 - 2). Let m = -184.8 + 185. Let c = m + -2.2. What is the biggest value in c, -0.02, f? -0.02 Let p be (11 - 11)/((-4)/(-2)). Suppose 0 = -pd - 3d + d. What is the second smallest value in d, 1, 0.3, 0.47? 0.3 Let k = -1534 + 1531. What is the third biggest value in -38, 0.1, k? -38 Let h(o) = -o - 5. Let j be h(-8). Let w be 22/(-42) - (-22)/(-154). Which is the second smallest value? (a) w (b) 0.04 (c) j (d) -2 a Let y = 44.3 - 1.3. Let z = 0.9 + -48.9. Let c = y + z. What is the second biggest value in 1/3, 4, c? 1/3 Let j = 9 - 8.7. Let a = -0.2063 + 0.3063. What is the third smallest value in -0.2, j, -5, a? a Suppose 1 = -i - 3u, -6i + 1 = -5i + 5u. Let h be (i/(-32))/(7/(-210)3). Which is the fourth smallest value? (a) 79 (b) -0.5 (c) 0.4 (d) h a Let j = 5 + -2. Suppose 7w - 5w = ji, 3i + 3w = -15. Let n = 1 - i. What is the second smallest value in n, -5, 4? n Let q = -18 + 16. Let b(u) = -u*3 + 3u*2 + 6u + 4. Let p be b(4). Suppose -17a = -14a - p. What is the third biggest value in a, -0.4, -1/2, q? -1/2 Let z(k) = k*3 + 58k*2 + 58k + 62. Let w be z(-57). Which is the fifth smallest value? (a) 0.4 (b) -1/2 (c) 0.2 (d) w (e) -2 d Let i = -4420 + 4419.93. What is the fourth biggest value in 2, i, -12, -4/3? -12 Let c = -1.2611 - -1.2611. Let g = 2.3 - 0.3. What is the fourth smallest value in 0.1, g, c, 3? 3 Let m = -33.56 + 33.5395. What is the second biggest value in m, -0.3, -3/2? -0.3 Let d = -47 - -46.902. Let p = 27.098 + d. What is the fourth smallest value in 0.4, -1, p, 1/6? p Let j = -1 - 0. Let s(g) = -12g3 - 3g*2 + 2g + 3. Let p be s(j). Which is the second smallest value? (a) -4 (b) p (c) -2 c Let w = 11455 + -11450.58. Which is the smallest value? (a) 0.3 (b) -3 (c) w b Let f = 22 - 95. Let u = f - -76. Let g be (-171)/270 + 1/((-15)/(-2)). Which is the third biggest value? (a) 0.18 (b) g (c) u b Suppose -3y - 4j = -6 + 12, -3j + 21 = -2y. Let g be 22/(-5) - 24/y. What is the smallest value in g, 4, 2? g Let y = 1.5 + -1. Suppose 0 = -2f - 4t + 2, 3f + 7221 - 7238 = t. Which is the second biggest value? (a) y (b) f (c) -8/7 a Let r be ((-234)/(-168))/(-13)(-1 + 4/(-12)). What is the second smallest value in 0, 1/4, 23/11, -1/2, r? 0 Let u(y) = 2y2 + 3y + 8. Let s be u(5). Suppose -s = -21j + 11. What is the third smallest value in -0.21, -4, j? j Let m be (9/4)/(15/80) - 2. Let v be 8/3 + (-5)/(m/6). Let b = 1.9 + -0.9. What is the smallest value in v, 3, b? v Suppose 0 = 10k - 8k - 14. Let y be ((42/(-32))/k)/((-6)/8). What is the second smallest value in -6, y, 2? y Let s = 2389.4 + -2390.1. Which is the second biggest value? (a) 5 (b) s (c) -5 (d) 2/21 d Let j = -1031 + 1035. Which is the second smallest value? (a) -0.8 (b) j (c) 5/7 c Let g(u) = u3 - 53u*2 - 61u - 2701. Let h be g(55). What is the biggest value in h, 2/9, -0.69, 0.3? 0.3 Let h = 159.03 + -159. Let m = -41.5 - -42.5. What is the second biggest value in h, m, -0.05? h Let r = -0.35 - -0.05. Let d be 12/(-15) - (1098/(-135) - -8). Let y = 1.92 + -2.42. What is the fourth biggest value in r, d, y, 1/5? d Let j = -1 + 1.4. Let d = -1287024809/7019714955 - 24/989389. Let v = 1/645 + d. What is the smallest value in j, 2/3, v? v Let a = 10792 - 10779. What is the biggest value in 1, 1/9, -0.01, a, -2? a Let o = 5.5 - 5. Let y = 2231.4 + -2236.4. What is the fourth smallest value in 1/9, 0.28, y, o? o Suppose 2k - 5y = -71, -3y - 953 = 6k - 974. Let n be 2/7 - 62/70. Which is the second smallest value? (a) -2 (b) -2/3 (c) k (d) n a Suppose -7a = 19 + 2. Let o be 82a/(-60) - 24/(-60). Let d = -145 + 1307/9. What is the biggest value in d, o, -2, 2? o Let w(d) = -101d - 1915. Let v be w(-19). What is the fourth smallest value in 0.6, -44, v, -0.1, -5? 0.6 Let r be (-40)/75 + (-1)/(-3). Let k = -31.53 + -0.47. Let u = k + 27. Which is the smallest value? (a) r (b) u (c) 2 (d) -1/4 b Let y = -6.264 + 4.864. Which is the biggest value? (a) 0.4 (b) 2/27 (c) -2 (d) -4 (e) y a Let d be (-8)/((-208)/(-299)) - -11. What is the fourth smallest value in 0.5, -186, 1, -5, d? 0.5 Suppose -1 = -6t + 11. Suppose 3u = tu - 3h - 72, 5u - 5h = -360. Let k be -2(4/u)/1. What is the smallest value in k, -4/9, -0.9? -0.9 Let n = 2.464 - -218.636. Let i = -221 + n. Which is the smallest value? (a) 4 (b) -0.4 (c) i (d) -2 d Let t = 203 - 202. Which is the fifth smallest value? (a) 0.3 (b) 3 (c) t (d) 0.1 (e) -1/6 b Suppose 5z + 4320 = 2l + 2l, 0 = -4z. Let r be (-2)/(-10) + 99/l-4. Let f = -6 + 10. What is the biggest value in r, f, -1/4? f Let v = -16.2 + 21.2. Let x(r) = 4r*2 - 19r + 23. Let k be x(2). Which is the third smallest value? (a) v (b) k (c) -33 (d) 0.2 b Let b(g) = -g*3 - 2g*2 + 22g + 9. Let s be b(4). What is the second biggest value in s, 18, 2/5? s Let f = -373 - -371. Let k = 162.4 - 162. What is the second smallest value in -0.3, f, k, 3? -0.3 Let o = -426.0935 - -0.0935. Let r = 426.7 + o. Which is the second biggest value? (a) 0.2 (b) r (c) -2 a Suppose -8p + 146 = -42p - 330. Let u = 2 + -2.5. Which is the second smallest value? (a) p (b) u (c) -0.1 b Let o = -42 + 101. Let x = o - 59.5. Let h = -10 - -5. Which is the second smallest value? (a) 0.3 (b) h (c) x c Let m be 19 - 4767/147 - -14. Let s = 0.2 + -5.2. What is the third biggest value in m, -3, s? s Let y = -34.5 + 33. Let r = 1 - 0.6. Let w = -40 - -43. Which is the third smallest value? (a) w (b) r (c) y a Let c = 2415/2 + -12071/10. What is the second biggest value in 401, -0.4, c? c Let k(b) = -b - 36. Let g be k(-12). Let r be (g/96)/(9/(-4)). What is the second biggest value in -3/5, -0.2, 3, r? r Let h = 0.945 - 0.83772. Let r = 5.21028 - h. Let z = r + -0.103. Which is the smallest value? (a) -0.07 (b) 0.5 (c) z a Let x = 15711 - 15672. Which is the smallest value? (a) x (b) -10/9 (c) 1.1 b Suppose 55 - 12 = -15x - 47. Which is the second smallest value? (a) 2 (b) x (c) -9 (d) 10 b Let x = 26.51 + -28.51. What is the fourth smallest value in x, -4, 3, 0.5, 1/4? 0.5 Let j = -2.391 + 1.391. Which is the smallest value? (a) -4/7 (b) 4 (c) j c Let u = 7005 + -6990. What is the second biggest value in u, 5/6, -2/33, -2/21? 5/6 Let x = 1683.8 - 1683.6. What is the second biggest value in -0.1, x, 0.3, 21, 3/5? 3/5 Let q = 321.2016 - 0.1516. Let y = q - 321. Suppose -3u = -6u. Which is the smallest value? (a) u (b) 1/3 (c) y a Let t = 7.7 + -8. Let i = 150.42 - 2.42. Let u = i - 148.2. Which is the third biggest value? (a) 0.05 (b) t (c) u b Let x = 29/1268 + -5217/6340. Let j = -0.06 + 0.36. Which is the third smallest value? (a) x (b) j (c) 1/27 b Let q(y) = y2 + 19y + 51. Let t be q(-16). Let s = -49 + -14. What is the second biggest value in t, s, -1? -1 Let i = -17461 - -17462.6. Let w = -27.9 + 28. Which is the third smallest value? (a) i (b) -0.6 (c) w a Let m = -719.4 - -759.11. Let x = m - 0.71. Let z = x + -41. Which is the third smallest value? (a) -3/7 (b) z (c) -3 a Suppose 0 = 5k, -3h + 71 + 43 = 2k. Let j(g) = g2 + g - 3. Let y be j(0). Let q be 0 - y - h/12. What is the smallest value in q, -2/19, 0.08? q Let y = 97 + -681/7. Suppose -914f + 1470 = -358. Which is the second smallest value? (a) y (b) f (c) -1 a Let s = 8205 - 16407/2. What is the smallest value in 5, s, -2/3, 1, -0.1? -2/3 Let i = 0.9 - 0.9. Let z = -74 + 70.6. Let l = z + 3.6. Which is the biggest value? (a) l (b) i (c) 1 c Let n = -0.02 - 3.98. Let i = -15050 + 15045. What is the second biggest value in n, i, 1, 1/4? 1/4 Let j = 0.331 + 9.669. Let d = 5.57 - 5.55. Which is the smallest value? (a) d (b) 2/5 (c) j a Let m be (-2 - (-45)/20) + 8*(-2)/(-448). What is the third biggest value in m, 0.75, 3? m Let b = 0.2942 - 1.2942. Let m = -58 + 60.3. Let r = -0.3 + m. What is the third biggest value in -0.4, 2/11, b, r? -0.4 Let h = 0.54 + 448.46. What is the second smallest value in 10, h, 0.4? 10 Let r = 662/9 + -1567/18. Which is the fourth biggest value? (a) -0.25 (b) -3 (c) r (d) -4 c Let k be (6 + (-70)/14)/(4/(-20)). What is	{ "pile_set_name": "DM Mathematics" }
141a + -8a? 1350 In base 5, what is 20 + 241321? 241341 In base 10, what is 2 - 881541? -881539 In base 14, what is 1c + -4203? -41c5 In base 8, what is -22 + -4777? -5021 In base 16, what is -215ac - -1? -215ab In base 15, what is -2b - 1315? -1341 In base 5, what is 123314 - -2? 123321 In base 14, what is -2 - 2c83? -2c85 In base 16, what is -4654 - -c? -4648 In base 9, what is 261 - 10330? -10058 In base 8, what is 0 + -566666? -566666 In base 11, what is -4556a8 - -4? -4556a4 In base 8, what is 261020 - -1? 261021 In base 14, what is 1 + 56d0? 56d1 In base 10, what is -11898 + -3? -11901 In base 6, what is -224 + 3033? 2405 In base 7, what is 2 - -11046511? 11046513 In base 11, what is 1a069 + -39? 1a030 In base 11, what is -3856 - -19? -3838 In base 9, what is -28 + -251? -280 In base 4, what is -1 - 2101010222? -2101010223 In base 3, what is 101 + -11220? -11112 In base 11, what is -2676 + 8? -2669 In base 15, what is -15d - -46? -117 In base 4, what is 10 - -103102311? 103102321 In base 7, what is -144 + -5? -152 In base 8, what is -55566 + 0? -55566 In base 12, what is 61 + -193b? -189a In base 8, what is -54 + 65142? 65066 In base 10, what is 2 - 51642? -51640 In base 13, what is -c8b86 + -1? -c8b87 In base 2, what is -1100011101000110 + 10100? -1100011100110010 In base 16, what is 18 - -39b? 3b3 In base 8, what is 3667 + -67? 3600 In base 5, what is 14 - -124423? 124442 In base 11, what is 39a031 + -4? 39a028 In base 12, what is 3333 + -64? 328b In base 13, what is -1145 - 1b? -1163 In base 16, what is -2 - -6c91? 6c8f In base 15, what is 6b6a0 - -3? 6b6a3 In base 7, what is 11 - 26225? -26214 In base 9, what is 30 + -1663? -1633 In base 3, what is 12 + 22002021121? 22002021210 In base 10, what is -1702 - -2204? 502 In base 11, what is -4 - 36161a? -361623 In base 13, what is -2 + 5ac6? 5ac4 In base 14, what is -6ad8 + -16? -6b10 In base 3, what is 20 + -1100221? -1100201 In base 6, what is 3423 + 3? 3430 In base 15, what is -115 - 4? -119 In base 3, what is -201022 + -211? -202010 In base 11, what is -7a64 + 3? -7a61 In base 16, what is -a - e85? -e8f In base 7, what is 2 + 426111? 426113 In base 7, what is -53210 + -1? -53211 In base 14, what is 2 + -6312? -6310 In base 12, what is -5 + 2b? 26 In base 16, what is -5dcae + -5? -5dcb3 In base 14, what is -5335 - -33? -5302 In base 15, what is -69 - -13b7? 134d In base 12, what is 3 - 76424? -76421 In base 9, what is 1038 - -333? 1372 In base 2, what is -1111001011000101110 - 1? -1111001011000101111 In base 3, what is -221111110 - 1? -221111111 In base 10, what is 83637 + -2? 83635 In base 16, what is 8 + -f81? -f79 In base 12, what is -b - -12a0? 1291 In base 10, what is -37897 - -17? -37880 In base 5, what is -111 - -1414? 1303 In base 3, what is 221 + 120201? 121122 In base 15, what is 345 - -d? 353 In base 14, what is 66c + -227? 445 In base 7, what is 11353 - 34? 11316 In base 14, what is 20b2 + -380? 1b32 In base 6, what is 12104 + 112? 12220 In base 6, what is 2 + -13202? -13200 In base 12, what is -741b + 196? -7245 In base 10, what is -1 - -608529? 608528 In base 13, what is -1 + 28a19? 28a18 In base 4, what is -201 + 1213122? 1212321 In base 7, what is 5 - 40602? -40564 In base 12, what is 1b0b2 + 1? 1b0b3 In base 5, what is 2330234233 + -2? 2330234231 In base 9, what is 0 - -3413? 3413 In base 11, what is -198 - -115? -83 In base 12, what is 5b - 6b2? -653 In base 7, what is -100416 - 10? -100426 In base 3, what is 10 + -10021002221? -10021002211 In base 12, what is -242 - -7a9? 567 In base 16, what is -150 - 52? -1a2 In base 13, what is 5079ba + 2? 5079bc In base 13, what is -1753 - -2? -1751 In base 7, what is 165 - 1401? -1203 In base 5, what is -1202134 + 10? -1202124 In base 13, what is -486 - 23b? -6c4 In base 11, what is 71 + -8828? -8767 In base 4, what is -203200 - -113213? -23321 In base 12, what is 3 - -64668? 6466b In base 2, what is 10100111111010010000 - -101? 10100111111010010101 In base 14, what is 2 + 5902b? 5902d In base 13, what is 3926 - -19? 3942 In base 6, what is -3342 - -20? -3322 In base 4, what is -3 + 13023031? 13023022 In base 16, what is -4d0 - b? -4db In base 15, what is -19883 - -35? -1984d In base 8, what is 10 + -27536? -27526 In base 4, what is -1 - 2011030? -2011031 In base 3, what is 0 + 10212100? 10212100 In base 14, what is -1b - -35? 18 In base 2, what is -110000111 - -1000011? -101000100 In base 2, what is -110110111111 - -1000? -110110110111 In base 14, what is 0 - 1c096? -1c096 In base 5, what is -3 + 2422202? 2422144 In base 13, what is 3 + 3872? 3875 In base 7, what is 3230164 - 13? 3230151 In base 5, what is -102 - -120304? 120202 In base 10, what is 3 + -57941? -57938 In base 7, what is 0 - -356530? 356530 In base 5, what is 2432330 - 2? 2432323 In base 6, what is 134445001 + -2? 134444555 In base 13, what is 1c37 + -c9? 1b3b In base 13, what is 9 + -723? -717 In base 13, what is -5 + 362aca? 362ac5 In base 7, what is -5 + 60455? 60450 In base 5, what is -21430 - -134? -21241 In base 14, what is 2 - 1dc33? -1dc31 In base 10, what is -144 - -578? 434 In base 14, what is 9 + 68a42? 68a4b In base 16, what is -17 + 1ecc6? 1ecaf In base 15, what is -3 + 103b57? 103b54 In base 2, what is 1011 + -1001100010000? -1001100000101 In base 11, what is -2 - -45005? 45003 In base 11, what is -54087 + 18? -5406a In base 16, what is -fe748 - -4? -fe744 In base 11, what is -25 - -1aa11? 1a997 In base 10, what is 3494 - -36? 3530 In base 4, what is 3 + -12031030? -12031021 In base 4, what is 232100102 - 2? 232100100 In base 11, what is -13 + -123? -136 In base 6, what is 0 + -343205? -343205 In base 4, what is 1010 - 131233? -130223 In base 3, what is -101002020101 + 10? -101002020021 In base 4, what is 21102 - -233? 22001 In base 10, what is 14976 + 10? 14986 In base 14, what is -2 - 1862a9? -1862ab In base 3, what is -11 + 220001220002? 220001212221 In base 11, what is 8a3691 + -2? 8a368a In base 9, what is -3 - -751440? 751436 In base 12, what is -140 + -311? -451 In base 7, what is -5543350 + -4? -5543354 In base 16, what is 0 + -ab? -ab In base 7, what is 3 + 603? 606 In base 6, what is 142 + 3022? 3204 In base 12, what is 1721 + -50? 1691 In base 13, what is 0 + 1862c? 1862c In base 13, what is 2 - -1a798? 1a79a In base 5, what is -3 - 10013301? -10013304 In base 9, what is 106777 - -1? 106778 In base 13, what is 33b - -8b? 3c9 In base 10, what is 1747 + 319? 2066 In base 2, what is 101 - -101110110110000011? 101110110110001000 In base 11, what is 812 - 4764? -3a52 In base 7, what is -64402 + -6? -64411 In base 2, what is 11100111101011011 + 100? 11100111101011111 In base 4, what is 0 + 213121? 213121 In base 12, what is -4176 + 4? -4172 In base 11, what is 184 - 1184? -1000 In base 6, what is 12312545 + -3? 12312542 In base 10, what is 8 + -17891? -17883 In base 13, what is -29 - 96a? -996 In base 16, what is 54 + -66d? -619 In base 2, what is -100 + 11111011100010? 11111011011110 In base 13, what is -3 - -13325? 13322 In base 11, what is -120 + 236? 116 In base 4, what is 3111 + -1312? 1133 In base 14, what is -1c7 - 460? -647 In base 13, what is -323 - -21? -302 In base 15, what is 312cc3 + 4? 312cc7 In base 8, what is 7022 + -616? 6204 In base 6, what is 42 - 11154? -11112 In base 13, what is 0 + 55aa9? 55aa9 In base 8, what is -15 + 2647? 2632 In base 8, what is -53432 + 34? -53376 In base 13, what is -6 - 1427c? -14285 In base 6, what is -123 + 241333? 241210 In base 3, what is -22 - -202020110? 202020011 In base 13, what is -2683a + 0? -2683a In base 8, what is -151025 - 2? -151027 In base 15, what is -3 - 8b5ba? -8b5bd In base 6, what is 5 + -130422? -130413 In base 6, what is -1334 - 14? -1352 In base 13, what is 10361 - -18? 10379 In base 5, what is 104214 + 104? 104323 In base 10, what is -20 - -53? 33 In base 5, what is -42 + 23220? 23123 In base 5, what is 3 + 2020040? 2020043 In base 2, what is 110111000100101011101 - -1? 110111000100101011110 In base 12, what is 6815 - -3? 6818 In base 9, what is 1215 - -1? 1216 In base 13, what is 1 - 67783? -67782 In base 11, what is 5 + -3862? -3858 In base 3, what is -12000 - -200221? 111221 In base 8, what is 4 - -3207016? 3207022 In base 15, what is -1 + -14eb? -14ec In base 2, what	{ "pile_set_name": "DM Mathematics" }
-95 + 95.098. Let m = 7.098 - u. Sort 0.5, m, -2, -3 in descending order. m, 0.5, -2, -3 Let r = 179.98 + -177.98. Sort -27, 1/6, 2/9, 0, r in decreasing order. r, 2/9, 1/6, 0, -27 Let y be 7040/968 - 33/121. Let h(r) = r3 - r2 - r. Let d be h(2). Let x = -1402/9 - -156. Put x, -4, y, d in decreasing order. y, d, x, -4 Suppose 19w - 413 = 423. Suppose 22 - w = 11a. Suppose 0 = -5l + 1 + 4, 0 = 4p + l - 17. Put p, -3, a in descending order. p, a, -3 Let s = -1423 - -1422.5. Sort s, -5/4, 3/26 in increasing order. -5/4, s, 3/26 Let w(k) = 61k - 12. Let n be w(2). Let i be 10/(-25)50/n. Let l = -2.8 - -3. Sort l, i, 3/7, 0 in decreasing order. 3/7, l, 0, i Suppose 200 = -11o + 16o. Suppose 0 = of + 30 + 90. Let k be 3 - (-2 - (2 - 2)). Put -4, k, f, -2 in increasing order. -4, f, -2, k Let o = -3572.3 - -3573. Sort -5, 1/3, -0.032, o, -4 in decreasing order. o, 1/3, -0.032, -4, -5 Let h = 1277/7 + -183. Suppose -15u + 4u = -55. Suppose u = -2n + 7. Put 0.2, h, n, -5 in descending order. n, 0.2, h, -5 Let k = 1496 - 7476/5. Sort -5.2, k, 3/7, -0.1 in decreasing order. k, 3/7, -0.1, -5.2 Let q = 8 - 8.08. Let f = -6.92 + q. Sort f, -5, 4. f, -5, 4 Let p = 6.31 + -6.21. Let w be (3 - 35/10)/1. Put p, 0.4, w, -2/5 in decreasing order. 0.4, p, -2/5, w Let c(h) = 347h - 2079. Let a be c(6). Put -3, 1, a, -5, 14 in increasing order. -5, -3, 1, a, 14 Suppose 0 = 8n - 3n - 5. Let a be ((-1)/(-2))/(11/110). Suppose -50j - 41j = -20j. Sort a, j, n, -3 in decreasing order. a, n, j, -3 Let o = -17044 - -17050. Let p = 3 + -7. Put -1, p, o, 1 in ascending order. p, -1, 1, o Let m = 6944 - 6946. Put 0, 0.7, 37, m in increasing order. m, 0, 0.7, 37 Suppose -4t - 3x - 10 = t, 4t - 7x + 55 = 0. Put t, 5, 2, 257 in increasing order. t, 2, 5, 257 Let v = -40.99 - -40.29. Sort v, 0.29, -2 in ascending order. -2, v, 0.29 Suppose 66y = 69y - 207. Suppose 0 = 4g - 68p + yp + 11, -g + 5p = 8. Sort -1, 0, 6, g. g, -1, 0, 6 Let t(j) = j*2 + j - 2. Let s be t(2). Suppose -2q + 3z = 52, 122z - 118z - 62 = -q. Sort s, 14, 3, q. q, 3, s, 14 Let k = -227 + 231. Put -3, -1, k, -1/7 in descending order. k, -1/7, -1, -3 Let p be -1 + ((-1)/(-2) - 1). Let k(d) = 6d*2 - 15d + 17. Let q be k(6). Let m be q/(-390) + 6/(-45). Put -1, m, 1/5, p in descending order. 1/5, m, -1, p Let j(y) = y*3 - 2y + 1. Let w be j(2). Suppose 20 = -119a + 124a. Let i be (4 + -6)/(a/(-2)). Put w, i, 0, 3 in decreasing order. w, 3, i, 0 Let b(s) = -s*3 + 4s*2 - 3s + 2. Let g be b(3). Let q(o) = -o + 4. Let m be q(9). Suppose -14k = -21 - 35. Sort k, g, m. m, g, k Let h be 40352/4036 + 250/(-25). Put 0.3, 0.5, h in descending order. 0.5, 0.3, h Let k = -203/1362 - 4/227. Put 3, -0.1, k, -2/7, -0.06 in descending order. 3, -0.06, -0.1, k, -2/7 Suppose -33f + 6f = -81. Let x = 3 - 1. Suppose -x = -2o + 3i - i, 5o = -fi - 35. Sort 0.7, -0.3, o in descending order. 0.7, -0.3, o Suppose 2q = 6q - 628. Let y = 475/3 - q. Let t = -14332/461565 - -2/7101. Sort y, 2, t. t, y, 2 Suppose -15g = -8g - 21, 0 = -5x - g - 7. Put 5, 721, x in descending order. 721, 5, x Suppose 3z + 174 = -3j, 2z + 120 = 2j - 6j. Let p be 4/(-18) - z/210. Sort p, -1/11, 0.2, 3/7. -1/11, p, 0.2, 3/7 Suppose 3f + f + 68 = 0. Let w = f + 15. Let z(d) = -53d + 55. Let q be z(1). Put q, 53, 0, w in decreasing order. 53, q, 0, w Suppose -86w + 92w + 37 + 11 = 0. Put 2/17, -5, 2/5, w, 1 in increasing order. w, -5, 2/17, 2/5, 1 Suppose -2d = -9d + 91. Let x = 448 - 446. Sort 5, x, d. x, 5, d Let z be (2 + (-3)/2)2. Suppose p = -5b - 603, 4b + 0p = p - 486. Let q = b + 116. Sort z, 0, q. q, 0, z Let r = -0.04902 + -77.24098. Let u = 80.9 + r. Let h = u - -0.39. Sort -3, h, -13 in increasing order. -13, -3, h Suppose 2k + 76 = 6k. Suppose 5l + 6 + k = 0. Let o be (1 - 18/22) + 0. Put -0.3, o, 5/2, l in descending order. 5/2, o, -0.3, l Let t = -1321.7 + 229.7. Let m = t + 1090. Let k be 1/((-13)/(-15)) + -1. Put m, 5, k in increasing order. m, k, 5 Let b = 685 - 689. Sort b, 4, 0.4, -3, -0.113. b, -3, -0.113, 0.4, 4 Let c = 3 + 15. Suppose 4i = o + o - c, 2o - 12 = i. Let m = 11 - 12. Sort m, o, 2 in increasing order. m, 2, o Let i be (4/(-6))/(15/((-360)/(-16))). Let k = -79 + 83. Sort i, -5, 1, k in decreasing order. k, 1, i, -5 Let h = 3.97576 + 0.02424. Put 3, -113, h, -4, 5 in descending order. 5, h, 3, -4, -113 Let a = 23 - 114/5. Suppose 15n + 24 = 5q + 17n, 14 = 2q + 3n. Let w = 5365/3 + -1788. Put 3, w, q, a in increasing order. a, w, 3, q Let n = 0.34488 - 0.04488. Let z = 1 + -0.995. Sort z, n, 5 in descending order. 5, n, z Let c be 14/(-49) - 23/(-7). Suppose 0 = -4t - o + 18, 0 = -2t + o + co. Let h(b) = b*3 - 2b - 3. Let q be h(2). Put q, -3, t in increasing order. -3, q, t Let g be (14 - 750/54)9. Sort g, -4, 4, 28 in descending order. 28, 4, g, -4 Let i be ((-53)/1749)/((14/12)/7). Put -1/4, -1, i, 5 in increasing order. -1, -1/4, i, 5 Let s = 9.8309 - -0.3691. Sort 3, s, 0 in ascending order. 0, 3, s Suppose -31 + 1 = -3p. Let w be -2 - 2p/(-4). Suppose -5y = -4k - 24 - 9, -k - 12 = -2y. Sort k, w, -9, -3 in decreasing order. w, k, -3, -9 Let z(s) = 23s + 759. Let q be z(-33). Sort 60/47, -2/3, q in descending order. 60/47, q, -2/3 Suppose 0 = -3m - 6, -3m = 2d - 0m + 14. Suppose 81s - 77s = -2q + 5396, 4s - 3q = 5406. Let h = s - 1351. Sort d, -31, -3, h. -31, d, -3, h Let u be (-1353)/(-165) - (-3 - (-184)/60)3. Put -4, u, 1, 0 in decreasing order. u, 1, 0, -4 Let w = -3.01969 - -0.01969. Let j = -28.05 + 28. Sort -0.4, j, w, 2/9. w, -0.4, j, 2/9 Let y be ((-35)/(-30))/7 + 77/6. Let t(c) = 7c - 93. Let l be t(y). Sort l, 5, -19 in decreasing order. 5, l, -19 Let u(r) = -r*2 + 7r + 22. Let x be u(9). Suppose m - xj - 132 = 6m, -j = -4m - 93. Put 0, m, -5 in decreasing order. 0, -5, m Let z = -62 - -57. Let h = -10 - -35. Let y = h - 25.2. Sort y, z, 3. z, y, 3 Let h be -14/16((-2124)/9 - -8). Put 0.3, -2/19, h, 4/7, 1/2 in ascending order. -2/19, 0.3, 1/2, 4/7, h Let n = 1681.7 + -1785. Let y = n + 101.3. Let h = -0.06 + -3.94. Sort y, 0.4, h in descending order. 0.4, y, h Let m = -4759.5 - -4764.5. Let b = -3 + 3.2. Sort m, b, -18, 4. -18, b, 4, m Let j = 77/20 + -18/5. Let v = 0.795 + -0.395. Let n = -1/4 - 1/12. Sort j, v, 0, n in increasing order. n, 0, j, v Let q(o) = -o3 - 4o*2 + 2o + 5. Let x be q(-4). Let u be (-20)/(2/(-1))36/18. Let i be -5(-2)/60u. Put 0.1, x, i in descending order. i, 0.1, x Let u(b) = 53b*2 + 472b - 42. Let g be u(-9). Suppose -4r = -2o - 14, 3o + r - 5 = 2o. Put g, o, 2, -7 in descending order. g, 2, o, -7 Let q = 567 + -565. Let h(l) = 2l - 16. Let n be h(9). Suppose -6 + 4 = ng. Sort q, g, 21. g, q, 21 Let c = 2.92 + 0.08. Let l = -263.8 - -263.7. Let n be 2/(-39)6/(-2). Put 4, n, c, l in descending order. 4, c, n, l Suppose -5q - 19 = -2o, 2q + 2o - 16 = 6q. Suppose 4g = g - 3f - 9, 0 = -g - 2f - 6. Sort -5, q, 5, g in increasing order. -5, q, g, 5 Let l = -17.6 + 14.6. Let j = -26.63 - -1.83. Let p = j + 25. Sort p, -1, l. l, -1, p Let d(m) be the third derivative of -m5/60 + 31m*4/24 + 95m*3/6 + 12m*2 - 4. Let s be d(34). Put 16, s, 2 in decreasing order. 16, 2, s Suppose 0 = -4y - 3o - 2o + 11, -5o - 70 = -5y. Suppose 5z - 5n = 20, -3n - 5 = -z + y. Let b = -2502 + 2500. Sort 6, z, -5, b in ascending order. -5, b, z, 6 Let g(b) = b2 - 10b + 11. Let y be (-5 - 1)/(8/(-12)). Let a be g(y). Let p = -14256 - -14248. Sort p, 5, a. p, a, 5 Let n(b) = -4b2 + 123b + 64. Let p be n(31). Sort 6/11, p, 4/3 in decreasing order. p, 4/3, 6/11 Let b = -0.17969 - -0.14969. Put b, -0.6, -4, 36 in decreasing order. 36, b, -0.6, -4 Let q be ((-122)/(-122))/(3/(-14 + -1)). Let h = -1 + 4. Let r be 0 - 1/(h/6). Sort r, q, -3. q, -3, r Let w be 1(-4)/(-14) + (-33)/(-7). Let q be 1/(w + (-4)/(1 + 0)). Suppose -3o + 0j = -2j + 15, 15 = -3o + j. Sort q, 3, o in increasing order. o, q, 3 Let f = -49 + -59. Let c = f - -108. Put c, 6/13, 0.04 in descending order. 6/13, 0.04, c Suppose -5u = 5a - 55, 17u - 15 = 14u + 3a. Put u, -127, -2, 3 in descending order. u, 3, -2, -127 Let r = 5.59896 - 2.59896. Let y = -1.1 + 0.8. Sort y, 0.08, 0, r in a	{ "pile_set_name": "DM Mathematics" }
62 + -254 - (2 - (1 + -2)). 5 Calculate (-2 - -62) + -66 + 46 + -11. 29 Calculate -12 - 6 - -12 - -4. -2 Evaluate -23 - (16 - (36 + -12)). -15 10 - 32 - (-13 - 6) -3 (2 - 7) + 0 - (37 + (66 - 116)) 8 1 - 17 - -15 - 9 -10 Evaluate 5 + -29 + 22 + (-1 - -1). -2 Evaluate (13 - 10) + 3 + -11. -5 -14 + 19 + -17 + 17 5 What is the value of 7 + 1 - (-29 + 22) - 6? 9 Calculate 3 - (1 - -9 - 5) - (-6 - -3). 1 Evaluate -39 - (34 - (-18 - -91)). 0 -26 - (-9 + 3 + (-12 - (11 - 26))) -23 What is -10 - (-3 - -1 - 10)? 2 What is the value of -21 - (-7 - -1) - (11 - -1)? -27 -55 + 34 + (15 - 17) + -14 -37 12 - ((6 - 1) + -10 + (-3 - -11)) 9 22 + (-22 - (-25 + -8) - (0 - -13)) 20 (5 - -2) + -20 + -6 + 25 6 4 - (2 + (-12 - -1)) 13 (42 - 37) + 2 + -15 -8 Evaluate 1 + (18 - 12 - 15). -8 48 + -58 + (-2 - -3 - 0) + 8 -1 Calculate -5 + -207 + 228 + 3 + -1. 18 Calculate -1 + -2 + (-20 - -19) + -13 + 22. 5 What is the value of (86 - 90) + (-10 - (-3 - (0 - 1)))? -12 What is the value of -4 - (-13 - (0 - (15 + -13)))? 7 Calculate (-24 - (8 + -3)) + 34. 5 What is (9 - (-8 + 4) - 6) + -15? -8 What is the value of (-17 - 42 - -55) + (-1 - -18) + 0? 13 What is (7 - 5 - -2) + (10 - -19) + -17? 16 Evaluate 127 - 125 - (2 + -13). 13 Calculate (-15 - -1) + -121 + 115 + (0 - -13). -7 -2 - 7 - -48 - 21 18 4191 + -4192 + 1 + -1 + 9 8 What is -42 + (0 - -6) - (-1 - (5 - -3))? -27 What is (1 - (10 + 20)) + 26? -3 What is the value of 3 - (1 + (1 - 5) - 1)? 7 What is 30 - 5 - (0 + 11 - -4)? 10 (-3 - (-16 - -6)) + -18 + -5 -16 15 - (-2 + -17 + 30) 4 Evaluate 6 + (275 - 265) + 0 + -24. -8 Evaluate (-16 - (-1 + -16)) + 7. 8 What is (11 - (3 + 0 - -11)) + (1 - -26)? 24 What is the value of -6 + (-17 - -10) + -18 - -4? -27 What is (0 - -2) + 10 - ((0 - -10) + -13)? 15 What is the value of (-8 + -11 - -25) + (1 - -1)? 8 53 + -49 - (3 - (8 - 2)) 7 Calculate 13 - (17 + -18 + 0). 14 (-12 - -9) + 2 + (1 - 4) -4 What is the value of 19 + (20 - (-21 + 10 + 11))? 39 (-4 - -12) + -11 + 13 10 What is (1 - 3 - (-23 - -12)) + (-3 - 3)? 3 15 + (-2 + -11 + 6 - -3) 11 What is the value of (0 - -2) + 2 + (15 - 23) + 3? -1 -16 - -11 - (0 - 14) 9 What is (-36 - -44) + -2 - (1 - 13)? 18 Calculate (1 + -2 - 0) + -2 - (-1238 + 1234). 1 Calculate -8 + (14 - -8 - -7) + -7 - 2. 12 Evaluate 7 + (-12 - -14) - 23. -14 (-3 + -13 - -6) + 7 -3 2 + -15 + 15 - 10 - 18 -26 Calculate -1 + -11 + 3 - (4 + -20). 7 Calculate -87 + (47 - 2) + -2 + 13. -31 What is the value of (-28 - -11) + 6 - (2 + 2)? -15 What is the value of 6 - -2 - (2 - -18)? -12 Evaluate 68 - (22 - -16) - 42. -12 Evaluate 9 + (3 - 7) + (8 - 31). -18 What is the value of 34 + (-1 - 1) + 6 - (-12 - -20)? 30 What is the value of -6 - (2 - 20 - (-1 - (-9 + 6)))? 14 Calculate (1 - (0 + (3 - 7))) + 3. 8 Evaluate -2 + 3 + (6 - 25). -18 Calculate 3 + -3 - 9 - 0. -9 What is the value of -119 + 92 - (-52 + 2)? 23 Evaluate 1 + 6 + (-50 - -55). 12 6 - (-2 + 7 + -9) 10 Evaluate (-55 - -79) + -11 + 0 + 1. 14 13 + (-3 - (15 - (15 - 28))) -18 What is (-21 - -10) + (5 - -9)? 3 What is (50 + -46 - (3 - 2)) + -1 - 29? -27 What is -7 + (-3 - -11) + 2 + 3 - 5? 1 What is 23 + 35 + (-61 - -21)? 18 -35 - (-7 - (9 - 7 - 0)) -26 Calculate 19 + (-2 - (23 + 2)). -8 (484 - 500) + (0 - -12) -4 What is the value of (-5 - -2 - -11) + -27 + 30? 11 Evaluate 1 + -4 + (4 - (12 + 17)) + 18. -10 Calculate -28 - (-15 - 3) - -23. 13 Evaluate 5 + 11 + -20 + 15 + 5. 16 What is the value of (5 + -7 - 0) + -1 + 18 + -11? 4 What is the value of (-6 - -7 - -2 - 2) + 4 + -4? 1 Evaluate -8 - -1 - (2 + -19 - -19) - 2. -11 What is the value of 5 + -39 + 12 + 1 + -1 + -5? -27 What is the value of 3 - -18 - 30 - 10? -19 Calculate 2 - (11 + -4 + 6 + -14) - -1. 4 Evaluate -2 - (-9 - 2) - (-1 + (-3 - -9)). 4 Calculate 10 - (0 + (8 - ((4 - 3) + 5))). 8 Evaluate (-10 - -13) + -70 + 47. -20 What is -26 + 42 + -19 + 6? 3 Calculate 14 - ((-12 - -36) + -12). 2 (2 - (-2 + -6)) + (-10 - 1 - -10) 9 Calculate 15 + 12 + -13 - 14 - (1 - -13). -14 What is -2 + -3 + 12 + -10 + -3 + 1? -5 What is the value of -2 - (-3 + 1 + 6) - -17? 11 Calculate -10 + (-10 - -4) + 2 + (3 - 3). -14 What is 20 - (1 + -15 - -20)? 14 (4 - 5 - -2) + (-22 - -16) -5 What is the value of -6 + (-3 + (1 - 2) + -1 - -2)? -9 What is 34 + (4 - 12 - -5) + -7 + 1? 25 Calculate 124 + -123 - ((2 - 3) + 0 - 4). 6 Evaluate 4 - (2 - -4) - -18 - (-67 - -66). 17 What is 6 - -15 - (2 + (-1 + -5 - -15))? 10 Evaluate 120 + -120 + 0 + -9. -9 What is the value of 1 - -12 - 16 - (-30 - (-3 - 1))? 23 Evaluate -10 + -5 + 8 + (-6 - 0). -13 What is the value of (10 - 11 - -20) + -7? 12 What is the value of 11 - -4 - (2 + -1 - -8)? 6 Evaluate 16 - (-1 - (-24 + 10)). 3 Calculate -9 + (1 - 13 - (116 - 127)). -10 What is 4 + -3 + 0 + (10 - 9) + 7? 9 What is 22 + (-26 - 27) + 29? -2 Calculate (21 - (-5 + 41)) + (5 + -2 - -2). -10 What is the value of -28 - (-5 + 11 - 20)? -14 Calculate -25 - ((11 - 81) + 42). 3 Evaluate 3 + 10 + 0 + -9. 4 Evaluate -5 - (-1 + (-51 + 57 - (1 - -3))). -6 Evaluate -2 + (1 - -3) - (-14 + 2 + 6). 8 What is the value of 17 - ((-1 - (-5 - -11)) + -4 + 14)? 14 What is -6 - -2 - (13 - 13)? -4 4 + -13 + 1 + (25 + 3 - 0) 20 Calculate 30 - ((7 - 5) + 1 - (3 + -9)). 21 What is the value of -2 + (11 - 7 - -10)? 12 What is the value of -10 + -3 + (18 - 12) + 7? 0 What is the value of -14 - (15 + -13 + -3)? -13 What is the value of 7 - (-1 + (-1 - 0))? 9 What is the value of 33 + -54 - (-5 + 2 + -1)? -17 2194 + -2152 + -1 + -15 + 2 28 Evaluate 10 - (-25 + 25 - (-20 - -4)). -6 Evaluate -12 - (-1 - (18 + -27 - (-17 + 3))). -6 Evaluate 11 + -15 + -5 + 4 + 8. 3 What is 6 + 2 - 4 - 13 - (-33 + 41)? -17 Evaluate 17 + -9 + 0 + -34. -26 What is the value of -4 - (2 + -18 + (53 - 58))? 17 Evaluate -1 - (3 + -2) - 3 - (-94 - -95). -6 Evaluate -5 + 20 + (-5 + -18 - -12). 4 What is 38 - 5 - (40 - 15)? 8 Evaluate -9 + (14 - -12 - 9). 8 Evaluate -18 - (-22 + 12 + 0). -8 What is the value of (23 - (33 - 18)) + (4 - 6)? 6 Calculate (25 - (55 + -25)) + 16 + -1 + 1. 11 -11 + 4 + (-2 - 11) + 27 7 What is the value of -20 - (-2 - 2) - -4? -12 Calculate (-3 - 6) + 3 + -4 + 8 + -2. -4 What is the value of 6 - (2 - (17 - (1 - (-8 - -4))))? 16 What is 10 + -1 + -11 + 28 - 8? 18 Calculate 7 + 0 + (22 + (-1 - 10) - 5). 13 What is 0 + 19 - (14 + (-14 - -21) + -18)? 16 Calculate -13 + (0 - (-12 - (0 + -2))) + -8. -11 What is the value of (105 - 101) + 1 + (-7 - 3)? -5 What is 4 + (12 - (9 - (8 - -2)))? 17 What is -5 + 35 - (131 - 106)? 5 What is the value of -7 - (7 - 27) - 19? -6 (4 + -1 - (26 - 22)) + 5 4 What is the value of -1 + 1 + 6 + 2 + -4 - -9? 13 Evaluate (-1 - 0) + -3 + 9 + -15 + 0. -10 Calculate 13 + (-10 - (21 + -14)). -4 Calculate -13 + (45 - (-5 + 6)). 31 (-11 - -1) + (14 - (-43 + 64)) -17 What is -3 + -4 + 6 + (33 - 8)? 24 Evaluate -2 - 3 - (-16 - (15 - (-12 - -33))). 5 Calculate -91 + 102 - (-1 + -1 - (-10 + 2)). 5 What is (-1 - -8) + (15 - (12 + 4)) - 24? -18 Evaluate 6 + -15 - (7 - (51 - 2)). 33 (-3 + (19 - 18) - -5) + (-9 - 1) -7 What is the value of 1 + -17 - (-52 + 43 + (-2 - -11))? -16 What is the value of -11 - (18 + -23 + -15)? 9 What is the value of (2 - (23 + -29 + (-2 - -2))) + -5? 3 Calculate (0 - -11) + -45 + 46 - (3 + 0). 9 Evaluate 8 - (-3 - 0 - (1 + 0)). 12 What is the value of -27 + -12 + (-21 + 7 - -30)? -23 -20 + ((-9 - (-2 + -1)) + 6 - -7) -13 What is the value of -10 + (-5 - 7 - -17)? -5 What is 11 - (7 - (13 + -8) - -11) - 19? -21 11 - (18 + (-19 - (14 + -31))) -5 What is the value of 15 + (6 - (22 + -10))? 9 Calculate (3 + (-2 - -1) - -8) + -6. 4 What is 7 + -1 - (12 + -7) - (13 - 3)? -9 Evaluate 165 - 168 - (1 - (-2 - 1)). -7 Evaluate (-3 - -13) + (-16 - (-6 + -7 - -6)). 1 What is the value of (17 - 20) + 6 + -12 + 3 - -2? -4 Evaluate 20 + -16 + 1 + 0 + -7. -2 What is the value of (36 - 18) + -2 + -15? 1 What is 4 + (-16 - (75 + -68 - (-4 + 0)))? -23 What is the value of (11 - (24 - 15)) + 9 + -2? 9 Evaluate -17 - (22 - (-5 - -61)). 17 Evaluate -3 - (-3 + (-4 - (0 + -2 + 36))). 38 Calculate 7 - (-1 - (12 + (-9 - 4))). 7 What is the value of -4 + (-384 - -386 - (-16 - (4 - 2)))? 16 5 + 3 + -2 - 3 3 What is 29 + (3 - 42) - 7? -17 What is the value of (-9 - -20) + 11 - 14? 8 Evaluate 9 - 22 - 14 - -15. -12 11 - (64 + -75 - (-6 + 2 + -5)) 13 (-1	{ "pile_set_name": "DM Mathematics" }
erm in 44, -23, -148, -343, -620, -991, -1468? -2063 What comes next: -17, -13, 3, 37, 95? 183 What is the next term in -37, -146, -323, -568, -881, -1262, -1711? -2228 What is next in -17, -24, -37, -56, -81? -112 What is the next term in -3615, -3620, -3629, -3642, -3659, -3680? -3705 What comes next: 45, 98, 141, 168, 173? 150 What comes next: 11407, 11409, 11411, 11413, 11415? 11417 What comes next: -50, -81, -120, -173, -246? -345 What is next in -4, -12, -26, -46? -72 What comes next: -13, -29, -57, -97, -149, -213, -289? -377 What comes next: -96, -193, -290, -387? -484 What is the next term in -7, -15, -25, -37? -51 What is next in -31, -54, -75, -94, -111, -126, -139? -150 What is the next term in -54, -62, -72, -84, -98, -114? -132 What is next in 339, 335, 323, 297, 251, 179, 75? -67 What is the next term in -5, -51, -137, -269, -453, -695? -1001 What is next in -18, -5, 16, 45, 82, 127? 180 What is next in 32, 27, 10, -25, -84? -173 What is the next term in -22, -55, -106, -175? -262 What is next in 3, -5, -21, -51, -101, -177? -285 What is the next term in -11539, -11540, -11541? -11542 What is next in -115, -230, -345? -460 What comes next: -238, -240, -244, -250, -258, -268, -280? -294 What is next in -15, -85, -275, -645, -1255, -2165, -3435, -5125? -7295 What is next in 65, 126, 187? 248 What comes next: -191, -386, -581? -776 What comes next: -4, -25, -72, -157, -292, -489, -760? -1117 What comes next: 1613, 3230, 4849, 6470, 8093? 9718 What is the next term in -2241, -2235, -2227, -2217, -2205, -2191? -2175 What is next in -19, 1, 43, 113, 217, 361, 551, 793? 1093 What comes next: -34, -45, -56, -67? -78 What is next in -19, -49, -91, -145, -211, -289, -379? -481 What is the next term in 171, 318, 465, 612, 759? 906 What is the next term in 20, -73, -230, -451? -736 What is next in -3005, -6011, -9015, -12017, -15017, -18015? -21011 What is next in 7213, 14421, 21615, 28789, 35937, 43053, 50131? 57165 What is the next term in 93, 185, 273, 357, 437? 513 What comes next: 311, 314, 317, 320? 323 What comes next: -44, -21, 24, 97, 204? 351 What is next in -2073, -2076, -2081, -2088, -2097? -2108 What is the next term in 128, 262, 396, 530? 664 What comes next: -134, -534, -1192, -2102, -3258? -4654 What is the next term in 34, 29, 20, 7, -10, -31? -56 What is next in 6646, 6642, 6636, 6628, 6618, 6606, 6592? 6576 What comes next: 2168, 2200, 2242, 2300, 2380, 2488, 2630? 2812 What is next in 106, 457, 1052, 1897, 2998? 4361 What is the next term in 693, 692, 689, 684? 677 What comes next: 2344, 2343, 2342, 2341? 2340 What comes next: -124, -249, -374, -499, -624? -749 What is next in 16, 4, -24, -74, -152, -264, -416? -614 What is the next term in -5, -10, -27, -62, -121, -210? -335 What is the next term in -10, -30, -90, -208, -402? -690 What comes next: -21, -4, 23, 60, 107, 164? 231 What is next in 340, 339, 338? 337 What is the next term in 61, 99, 137? 175 What comes next: 8, 4, -10, -40, -92, -172? -286 What is next in 1093, 1091, 1089, 1087, 1085, 1083? 1081 What is the next term in 60, 124, 176, 210, 220? 200 What is next in -187, -373, -559? -745 What is next in -22, -61, -120, -199, -298, -417? -556 What is next in -41, -78, -113, -146, -177, -206? -233 What is the next term in 158, 327, 496? 665 What is the next term in -1191, -2385, -3581, -4779, -5979, -7181? -8385 What is the next term in 4, 13, 44, 109, 220, 389? 628 What is the next term in -33, -94, -181, -288, -409? -538 What is the next term in -178, -139, -98, -55? -10 What is next in -1105, -1098, -1079, -1042, -981, -890? -763 What is next in -142, -118, -52, 74, 278? 578 What is the next term in -8243, -8247, -8251, -8255? -8259 What comes next: 48, 97, 148, 201? 256 What comes next: -15, -20, -31, -48, -71, -100? -135 What comes next: 24, 31, 24, -3, -56? -141 What is next in -67, -111, -155, -199? -243 What is the next term in 54, 66, 84, 108, 138? 174 What is the next term in -108, -204, -292, -372? -444 What is next in -15, -33, -51, -69, -87? -105 What is the next term in -2109, -2107, -2105, -2103, -2101, -2099? -2097 What comes next: -144, -287, -430, -573, -716? -859 What is the next term in -702, -733, -784, -855, -946, -1057? -1188 What comes next: 1, 52, 103? 154 What is the next term in 52, 99, 148, 199, 252, 307? 364 What comes next: 4, 62, 154, 274, 416, 574, 742, 914? 1084 What is the next term in -128, -171, -242, -341, -468? -623 What is next in 30, 117, 262, 465, 726, 1045, 1422? 1857 What is next in -446, -886, -1326, -1766? -2206 What is next in -37, -75, -147, -265, -441? -687 What is next in -8, -31, -76, -155, -280, -463, -716, -1051? -1480 What comes next: 15, 25, 35, 45, 55? 65 What is the next term in -28, -57, -86? -115 What is the next term in 54, 115, 176, 237? 298 What comes next: -313, -322, -333, -346, -361, -378, -397? -418 What comes next: 68, 137, 208, 281, 356, 433? 512 What is the next term in -23, -37, -53, -71? -91 What is the next term in 253, 250, 249, 250, 253, 258, 265? 274 What is next in -349, -347, -345, -343? -341 What comes next: 2209, 2213, 2219, 2227? 2237 What is next in -765, -760, -755, -750, -745? -740 What is the next term in -1648, -6603, -14862, -26425, -41292, -59463? -80938 What is next in -232, -244, -264, -298, -352, -432, -544, -694? -888 What is next in 41, 153, 337, 593, 921, 1321? 1793 What comes next: 284, 553, 810, 1049, 1264? 1449 What is next in 24, 52, 76, 90, 88, 64, 12? -74 What is next in -23, -89, -201, -359? -563 What is the next term in 10, 7, -8, -41, -98, -185? -308 What is the next term in -1, 4, 11, 20, 31, 44, 59? 76 What is the next term in -175, -344, -511, -676? -839 What is next in -1398, -1396, -1394? -1392 What is the next term in 100, 91, 82, 73? 64 What comes next: -36, -38, -40, -42? -44 What is the next term in -1432, -1435, -1442, -1453, -1468? -1487 What is the next term in 767, 747, 713, 659, 579, 467? 317 What comes next: -15577, -15575, -15573, -15571, -15569, -15567? -15565 What is next in -136, -133, -126, -115, -100? -81 What is next in 18, 54, 92, 132? 174 What is the next term in -31, -72, -103, -118, -111, -76, -7? 102 What is next in 20, -17, -112, -295, -596, -1045, -1672, -2507? -3580 What is the next term in -60, -186, -528, -1194, -2292, -3930, -6216? -9258 What is the next term in -55, -83, -111, -139? -167 What comes next: -17, -4, 9, 16, 11, -12? -59 What comes next: 9, 19, 29, 39? 49 What is next in 2037, 2036, 2035, 2034, 2033? 2032 What is the next term in 40, 129, 292, 565, 984? 1585 What is next in 20, 43, 66, 89? 112 What comes next: 14, 88, 164, 242, 322? 404 What is the next term in 1193, 1188, 1185, 1184? 1185 What is next in -15, -33, -49, -51, -27, 35, 147? 321 What comes next: -609, -606, -603? -600 What comes next: -69, -73, -87, -117, -169? -249 What is next in 18, 19, 26, 39? 58 What is next in -47, -51, -57, -65, -75? -87 What is the next term in -411, -382, -325, -234, -103, 74, 303? 590 What is next in -6, -36, -126, -306, -606, -1056, -1686, -2526? -3606 What comes next: -3197, -3204, -3213, -3224, -3237? -3252 What is next in -246, -954, -2132, -3780? -5898 What comes next: 23, 21, 19, 17, 15? 13 What is the next term in 29, 56, 83, 110? 137 What comes next: -151, -305, -459, -613, -767? -921 What is next in 26, 20, 14, 8, 2, -4? -10 What comes next: 119, 231, 343, 455, 567, 679? 791 What is next in -854, -846, -832, -812, -786? -754 What is next in -104, -207, -312, -419, -528? -639 What comes next: 165, 153, 127, 81, 9, -95, -237? -423 What is next in -1037, -1042, -1051, -1064? -1081 What is the next term in -2, 62, 234, 568, 1118, 1938? 3082 What is the next term in 1028, 1032, 1036? 1040 What is the next term in 1128, 1129, 1124, 1107, 1072, 1013? 924 What is next in -27806, -27814, -27832, -27866, -27922, -28006? -28124 What comes next: 897, 1812, 2727, 3642, 4557? 5472 What is the next term in -486, -998, -1510, -2022, -2534? -3046 What is the next term in 214, 208, 194, 172, 142, 104? 58 What comes next: 6, 12, 20, 24, 18? -4 What is next in -79, -449, -1455, -3415, -6647, -11469? -18199 What comes next: 331, 330, 329, 328, 327? 326 What comes next: 24, 38, 54, 72, 92? 114 What is next in -4, -30, -76, -142, -228,	{ "pile_set_name": "DM Mathematics" }
. -3, 2/5, 1, 2 Put -4, 15, 0 in ascending order. -4, 0, 15 Put -5, 2, 1, -4, -120 in ascending order. -120, -5, -4, 1, 2 Sort 2, -15, 0, -9, -5 in increasing order. -15, -9, -5, 0, 2 Sort 2/5, 0, -3 in decreasing order. 2/5, 0, -3 Put 195, 4, 3, -3 in ascending order. -3, 3, 4, 195 Put -1, 2, 32/653, -3 in decreasing order. 2, 32/653, -1, -3 Sort 4, 1, -3, 143, -2 in increasing order. -3, -2, 1, 4, 143 Sort -19, -5, 22 in descending order. 22, -5, -19 Put 2/5, 9, -1, 2/3 in decreasing order. 9, 2/3, 2/5, -1 Put -114, -4, 4, 0 in descending order. 4, 0, -4, -114 Sort 5, -1, -51, 16 in increasing order. -51, -1, 5, 16 Put 3, 2, 5 in ascending order. 2, 3, 5 Put 0.81, -0.3, -3 in increasing order. -3, -0.3, 0.81 Put 8, -1/8, -1 in decreasing order. 8, -1/8, -1 Put 16, 4, -5, -4 in decreasing order. 16, 4, -4, -5 Sort -5, -1/5, -1, -20, 0.3 in descending order. 0.3, -1/5, -1, -5, -20 Put 21, 2, 0 in ascending order. 0, 2, 21 Sort 0.056, -1, -5, 4 in increasing order. -5, -1, 0.056, 4 Put 2, -6, -21 in decreasing order. 2, -6, -21 Sort 0, 2, -4, -10, 5 in decreasing order. 5, 2, 0, -4, -10 Sort -6, 6, -3, 1, 10 in descending order. 10, 6, 1, -3, -6 Sort 65/7, -4, 0.4. -4, 0.4, 65/7 Sort 2048, -4, 4. -4, 4, 2048 Sort 3/4, 1, -4, -1 in decreasing order. 1, 3/4, -1, -4 Sort -1, -0.4, -122. -122, -1, -0.4 Sort 0.0269, 4/5, 1, 0 in descending order. 1, 4/5, 0.0269, 0 Put -3, 3, 0 in decreasing order. 3, 0, -3 Sort 2, -0.12, 5. -0.12, 2, 5 Sort 47, -1/5, 3 in descending order. 47, 3, -1/5 Sort -7, -2/3, -5. -7, -5, -2/3 Put 3, 0, 4, 1, 31 in increasing order. 0, 1, 3, 4, 31 Sort -4, 5, -9, 3, -26 in decreasing order. 5, 3, -4, -9, -26 Put 0, -42, -3, 2 in ascending order. -42, -3, 0, 2 Sort 4, -0.02, 1/3, -42. -42, -0.02, 1/3, 4 Sort -4, 0.3, 4/13 in increasing order. -4, 0.3, 4/13 Put 0.15, 8, -2/9, 3 in ascending order. -2/9, 0.15, 3, 8 Sort -0.3, -2.8, -5. -5, -2.8, -0.3 Put 1, -1, 0, 23 in descending order. 23, 1, 0, -1 Sort -5, 35, -2, 5 in decreasing order. 35, 5, -2, -5 Put 1/5, 3, -5, -767 in ascending order. -767, -5, 1/5, 3 Put 19, 1/8, 1 in ascending order. 1/8, 1, 19 Sort 2, -4, -77, -2, 0 in increasing order. -77, -4, -2, 0, 2 Put 5, -4, 0, 2 in increasing order. -4, 0, 2, 5 Put -5, -18, -2, 3 in increasing order. -18, -5, -2, 3 Sort -5, -14, 7, -4, 4 in ascending order. -14, -5, -4, 4, 7 Put -2, 138, 4, -5 in ascending order. -5, -2, 4, 138 Put 64, -1, 5 in descending order. 64, 5, -1 Sort -5, 2, -3, 1. -5, -3, 1, 2 Sort -2, 14, 4, -1 in ascending order. -2, -1, 4, 14 Sort -32, -2, 5, -12 in descending order. 5, -2, -12, -32 Sort 0, 1, -6, 10. -6, 0, 1, 10 Sort 2, 0, -86 in decreasing order. 2, 0, -86 Sort -3, 5, -1, 30 in increasing order. -3, -1, 5, 30 Put 2, 3, 7, 0, 18 in descending order. 18, 7, 3, 2, 0 Sort -1/7, -3, 3, 0.12, 4 in decreasing order. 4, 3, 0.12, -1/7, -3 Sort 5, -110, 22 in increasing order. -110, 5, 22 Put -2/15, 0.2, -1, -2 in increasing order. -2, -1, -2/15, 0.2 Sort -4, 2, -20 in descending order. 2, -4, -20 Put 2, 5, -73, 0 in descending order. 5, 2, 0, -73 Put 2/143, -5, 1, -2 in ascending order. -5, -2, 2/143, 1 Put 4, -1, 2/5, 10/7 in increasing order. -1, 2/5, 10/7, 4 Put -0.3, -229/8, -5/4 in descending order. -0.3, -5/4, -229/8 Sort -5, 3, -3, 66, 0 in ascending order. -5, -3, 0, 3, 66 Sort 38, 3, 4, 5. 3, 4, 5, 38 Put -3, -19, -183 in ascending order. -183, -19, -3 Put -5, 0.1, -3/8, 6, 3/5 in decreasing order. 6, 3/5, 0.1, -3/8, -5 Put 6, -5, 3, 2 in decreasing order. 6, 3, 2, -5 Sort 0.3, -0.3, 36/11, 2 in ascending order. -0.3, 0.3, 2, 36/11 Put -4/5, -4, 0.5, 0.2, 12 in ascending order. -4, -4/5, 0.2, 0.5, 12 Put -1, 2, -5, 0 in decreasing order. 2, 0, -1, -5 Sort 17, -12, 4 in ascending order. -12, 4, 17 Sort -3/142, -24, 3, 0.1 in increasing order. -24, -3/142, 0.1, 3 Put 11, 5, -2, 17 in decreasing order. 17, 11, 5, -2 Put 5, 2, -2, 9, 0 in decreasing order. 9, 5, 2, 0, -2 Sort 2, -4, -708, 5 in decreasing order. 5, 2, -4, -708 Put 1, -3, -4, 5 in increasing order. -4, -3, 1, 5 Sort 152, 2, -2 in increasing order. -2, 2, 152 Put -0.2, -12, 5 in decreasing order. 5, -0.2, -12 Put -2, 0, 23 in descending order. 23, 0, -2 Sort -6/37, 2/11, -4/5 in ascending order. -4/5, -6/37, 2/11 Sort -0.5, 18, -4, -4/3 in decreasing order. 18, -0.5, -4/3, -4 Sort 9, -36, -1, -3 in ascending order. -36, -3, -1, 9 Put 13, -2, 17, -3 in decreasing order. 17, 13, -2, -3 Sort -0.03, -16, -1/2, 3. -16, -1/2, -0.03, 3 Sort 3, -3, 4, -56 in decreasing order. 4, 3, -3, -56 Sort -1, -21, 4, 1, 2 in descending order. 4, 2, 1, -1, -21 Put -2, -0.1, -0.13, 3 in increasing order. -2, -0.13, -0.1, 3 Put 3/2, 30, -4, 0.05, -0.4 in descending order. 30, 3/2, 0.05, -0.4, -4 Put 1/3, -0.076, -1/7, 11, 0.3 in decreasing order. 11, 1/3, 0.3, -0.076, -1/7 Sort -4, 9, -3, 4 in descending order. 9, 4, -3, -4 Put 2, 2/2627, -3/8 in descending order. 2, 2/2627, -3/8 Sort 4, 25, 5, 3, 2. 2, 3, 4, 5, 25 Put 27, -5, -3, 4 in descending order. 27, 4, -3, -5 Put 0.4, -0.1, -0.2, 298 in increasing order. -0.2, -0.1, 0.4, 298 Sort 1, -4, 18, 0, 4 in descending order. 18, 4, 1, 0, -4 Sort 0.1, -2/17, 0.4, -0.023. -2/17, -0.023, 0.1, 0.4 Put -0.02, 0, -112 in ascending order. -112, -0.02, 0 Put 31, -17, -0.5, 2, 1 in descending order. 31, 2, 1, -0.5, -17 Sort 1/3, -18, -0.1. -18, -0.1, 1/3 Sort 6, -1, 16, -5, -3 in decreasing order. 16, 6, -1, -3, -5 Sort 0.2, 4, -195, 1. -195, 0.2, 1, 4 Sort 2/11, 63, -1, -3/5 in decreasing order. 63, 2/11, -3/5, -1 Put -0.38, 2/9, 0.2, 3 in descending order. 3, 2/9, 0.2, -0.38 Put -2, 30, 5, 3, -5 in descending order. 30, 5, 3, -2, -5 Sort 2, -4, -3, 4, -35 in descending order. 4, 2, -3, -4, -35 Sort 48, -10, 4 in increasing order. -10, 4, 48 Put -4, -2, -1, 72 in descending order. 72, -1, -2, -4 Sort 0, 2, 97, 3 in decreasing order. 97, 3, 2, 0 Sort 5.1, 1/6, -2/5, -4/3, -1/3 in increasing order. -4/3, -2/5, -1/3, 1/6, 5.1 Sort -1/32, -1/3, 2/11, -0.3, 2/7 in decreasing order. 2/7, 2/11, -1/32, -0.3, -1/3 Sort -1/2, 1/4, 0.2, -0.4 in descending order. 1/4, 0.2, -0.4, -1/2 Sort -0.5, 0.3, -21, 139. -21, -0.5, 0.3, 139 Put -13, -6, -2, -5 in increasing order. -13, -6, -5, -2 Sort 2/3, 1/3, 7/30 in descending order. 2/3, 1/3, 7/30 Put -4, 58, -24, 4, 0 in ascending order. -24, -4, 0, 4, 58 Put -11, 0.4, -6 in decreasing order. 0.4, -6, -11 Sort -5, 11/3, -0.3 in increasing order. -5, -0.3, 11/3 Sort 1/11, -0.08, 1 in increasing order. -0.08, 1/11, 1 Sort -2.1, 2/11, -4/27 in descending order. 2/11, -4/27, -2.1 Sort -1, -78, 6 in increasing order. -78, -1, 6 Sort 63, 0, 2 in descending order. 63, 2, 0 Put 4, -77, -1, 0 in descending order. 4, 0, -1, -77 Put 1184, 5, 1 in descending order. 1184, 5, 1 Put -14, -1, -2, 2, -4 in decreasing order. 2, -1, -2, -4, -14 Sort 3, -3, 430. -3, 3, 430 Put 4, 0, -46 in descending order. 4, 0, -46 Sort -2, -2/13, -5, -4. -5, -4, -2, -2/13 Sort 0.97, -4, 1/9, 8 in ascending order. -4, 1/9, 0.97, 8 Sort 3.43, -1, 2. -1, 2, 3.43 Sort -68, 27, -3, -2. -68, -3, -2, 27 Put 0, 3, 61, -3 in descending order. 61, 3, 0, -3 Put -5, -3, -4, 3 in decreasing order. 3, -3, -4, -5 Sort -1, 0.03, -5, -11 in descending order. 0.03, -1, -5, -11 Put -6, 5, 0, -3 in decreasing order. 5, 0, -3, -6 Sort -5, -3, 3, 8 in increasing order. -5, -3, 3, 8 Put -2, -34, 2/5 in decreasing order. 2/5, -2, -34 Sort -1/5, 1, 534, 2 in ascending order. -1/5, 1, 2, 534 Sort 11, -13, -2, -4 in ascending order. -13, -4, -2, 11 Sort -457, 1, -5, 18 in ascending order. -457, -5, 1, 18 Put 1, -3/5, -4/9, 0.03 in ascending order. -3/5, -4/9, 0.03, 1 Put -4, 2, 339 in descending order. 339, 2, -4 Put -0.1, -1, -0.3, -5/21 in decreasing order. -0.1, -5/21, -0.3, -1 Sort 1, -5, 56, -2 in ascending order. -5, -2, 1, 56 Sort -1, -3, -12, 12 in descending order. 12, -1, -3, -12 Put -14, 42, -1/4, -4 in increasing order. -14, -4, -1/4, 42 Put 1/4, -2/5, 21, -7 in increasing order. -7, -2/5, 1/4, 21 Put 5, 10, -2, -5 in descending order. 10, 5, -2, -5 Put 33, -3, 1, 2 in decreasing order. 33, 2, 1, -3 Sort -4/3, -0.6, -5, -1 in ascending order. -5, -4/3, -1, -0.6 Sort 4, -20, -1, -3. -20, -3, -1, 4 Put 2, 15, 0.2, -0.12 in increasing order. -0.12, 0.2, 2, 15 Put 4, 0, 2, -3 in decreasing order. 4, 2, 0, -3 Sort 10, -3, -4, 0.05	{ "pile_set_name": "DM Mathematics" }
). 27t2 Let m(b) = 16b*2. Let x(n) = 3n*2 + 4n + 8. Let g(y) = 4y2 + 5y + 10. Let r(c) = -4g(c) + 5x(c). Give r(m(o)). -256o4 Let i(p) = -18p - 2. Let x(h) = 8h + 8h + 3h - 25h. What is i(x(z))? 108z - 2 Let f(w) = -5w. Let y = -30 - -33. Let g(k) = 2k + k + 4k - yk. Give g(f(r)). -20r Let c(i) = -3i2. Let a(m) = -302m + 8. Let r be a(-6). Suppose l + 4l - r = 0. Let z(t) = lt + 2t2 - 364t. Determine z(c(d)). 18d4 Let t(r) = -3r*2. Let z = -652 + 655. Let a(n) be the first derivative of 0n*2 - 2/3n*z - 6 + 0n. Determine t(a(x)). -12x4 Let w(q) = 3q - 2. Suppose 0 = -4f - 21 - 3. Let i(y) = y - 1. Let l(b) = fi(b) + 3w(b). Let v(s) = -3s*2. Calculate l(v(g)). -9g*2 Let r(j) = 5j. Let p(y) = -y. Let a(i) = -2p(i) - r(i). Let s(k) be the first derivative of -2k*2 + 4. Give a(s(n)). 12n Let v(o) = 1131o + 1867. Let i(d) = -3d. Calculate v(i(x)). -3393x + 1867 Suppose -k + 3k - 10 = 0. Let z(f) = -6f + kf + 23f + 10f. Let l(g) = -g*2. Determine z(l(d)). -32d*2 Let m(f) = 16013f. Let y(v) = -v. Determine y(m(o)). -16013o Let w(x) = 72x + 3. Let c(k) = 2k2 - 132k. Determine w(c(u)). 144u2 - 9504u + 3 Let i(v) = -10v2. Let d(u) = 7u - 8. Let b(k) = -2. Let q(m) = 6b(m) - d(m). Calculate q(i(o)). 70o*2 - 4 Let v(g) = 136g - 15. Let p(n) = -n*2. Determine p(v(j)). -18496j*2 + 4080j - 225 Let g(i) = -11i2. Let o(t) = 13089t*2. Determine o(g(a)). 1583769a*4 Let a(b) = 5766b*2. Let g(t) = 6t*2. Give g(a(u)). 199480536u4 Let l(n) be the third derivative of n5/30 + 50n2 + 1. Let c(a) = 3a. Give l(c(p)). 18p2 Let r(o) be the second derivative of -o3/2 - 2o + 68. Let k(u) = -u + 0u - 4u. Calculate k(r(x)). 15x Let v(m) be the second derivative of -5m*3/6 - m + 11. Let t(c) = 62c*2. Determine t(v(j)). 1550j*2 Let v(u) = -2u*2 - 277 - 2u*2 + 277. Let s(m) = 20m*2. Calculate s(v(k)). 320k*4 Let k(m) be the third derivative of 17m*5/30 + 2m*2 - 38m. Let z(o) = 0o2 + 5o2 - o2 - 2o2. Calculate k(z(r)). 136r*4 Let v(z) be the third derivative of -7z*5/60 - 3z*2. Let j(q) = 76 - 76 - 3q - q. Calculate v(j(u)). -112u2 Let b(r) = 1629 - 787 + 2r - 842. Let c be 2/(-7) - (-132)/21. Let v(i) = ci - i + i. Determine v(b(d)). 12d Let a(q) = -83q + 2. Let x(k) = -6k. What is a(x(l))? 498l + 2 Let h(t) = -57t*2. Let g(l) = -6l*2 + 4l + 8. Let u(y) = 19y2 - 14y - 28. Let p(x) = 21g(x) + 6u(x). Determine h(p(r)). -8208r4 Let l(n) be the first derivative of 47n*2/2 + 270. Let y(r) = 5r. Determine l(y(o)). 235o Let h(n) be the first derivative of n2/2 - n - 3. Let u(v) = 7v - 6. Let k(y) = 6h(y) - u(y). Let r(m) = 2m*2. Give r(k(w)). 2w*2 Let y(t) = -18t*2 - 14t*2 + 12t*2. Let v(z) = -475 - 6z*2 + 4z*2 + 475. Give y(v(r)). -80r*4 Let j(w) = 4w*2 - 2w - 2. Suppose 0m + m + v - 1 = 0, 4v = 3m + 11. Let n be j(m). Let r(c) = 2c*2 + nc*2 + 2c*2. Let a(x) = x. Determine a(r(l)). 8l*2 Let p(q) = -5q*2 + 16q. Let s(u) = 3u2 - 10u. Let d(t) = 5p(t) + 8s(t). Let o(x) = -32x. Determine d(o(r)). -1024r*2 Let b(f) = -12f*2. Let n(i) = -3i*2 + 2i. Let g(x) = -13x2 + 20 + 9x - 20. Let o(y) = 2g(y) - 9n(y). Determine o(b(w)). 144w4 Let r(c) be the first derivative of -c4/3 + c + 5. Let b(g) be the first derivative of r(g). Let u(s) = -s2. Give u(b(v)). -16v*4 Let k(y) be the third derivative of 0y*3 + 19y*2 + 0 + 3/8y*4 + 0y. Let x(l) = -l. Let t(i) = 2i. Let g(b) = -2t(b) - 5x(b). Give k(g(d)). 9d Let x(q) = q - 2q - q. Let o(l) = 60l*2 + 343l. Let g(a) = 20a2 + 98a. Let h(n) = 7g(n) - 2o(n). Give x(h(t)). -40t2 Let x(a) = 2a*2. Let g(s) = 11303s - 19. Give g(x(m)). 22606m2 - 19 Let f(j) = 0j - 10j - 12j*2 + 10j. Let s(a) be the first derivative of -a6/180 + a3/3 - 2. Let l(r) be the third derivative of s(r). Calculate l(f(k)). -288k4 Let s(x) = -7x. Let j(h) = 41h. Determine s(j(w)). -287w Let a(s) = -s*2. Let r(d) be the second derivative of 25d*3/6 - 93d + 2. Determine r(a(c)). -25c2 Let z(o) be the third derivative of -o5/30 - o2. Let a(h) = -236h*2 + 128h*2 + 111h*2. Calculate a(z(w)). 12w*4 Let o(h) = 6h. Let q be (-2 + -2 + 23)1. Let d = q - 14. Let s(z) = 3z + 2z + 2z - dz. Determine s(o(c)). 12c Let f(x) = -13693x2. Let t(h) = -14h*2. What is f(t(l))? -2683828l*4 Let u(o) = -5o. Let d(r) = -4r2 - 5r + 5. Let k(c) = -c*2 + c - 1. Let b(j) = d(j) + 5k(j). Determine u(b(n)). 45n2 Let o(h) = -11h. Let y(c) = -2c2 + 19. Determine y(o(k)). -242k*2 + 19 Let c(x) = -3x. Suppose 3d + 2843 = 5m, -3d = 7 - 4. Let f(y) = -m - 29y*2 + 568. Calculate f(c(v)). -261v*2 Let t(b) = 2 - 2 + b. Let j(c) = c - 1. Let h(r) = 11r - 9. Let a(n) = 16n - 13. Let d(q) = -5a(q) + 7h(q). Let k(l) = -d(l) - 2j(l). Determine k(t(z)). z Let g(t) = t*2. Let v(j) = 1244j*2 - 2j - 2546j2 + 1239j*2 + 2j. Give g(v(y)). 3969y4 Let w(d) = 214d*2 + 202d*2 - 317d2. Let p(s) = -s2. Calculate w(p(u)). 99u4 Let a(d) = 25 - 44 - 2d*2 + 19. Let z(l) = -195l*2 + l. Determine z(a(r)). -780r*4 - 2r*2 Let b(f) be the second derivative of 0f*2 - 13/3f*3 - 6f + 7. Let p(y) = 2 - 2y - 2. Give b(p(g)). 52g Let q(b) = -27127 + 27127 - 3b. Let n(s) = 4s + 2. Give n(q(t)). -12t + 2 Let t(s) = -159s - 103s + 235s. Let r(f) = -6f. Determine t(r(q)). 162q Let x be (-3)/(-4) + 66/8. Let s(q) = 3q - 9 + x - 6q. Let h(z) = -2z - 3. Let k(d) = 3d + 2. Let u(l) = -2h(l) - 3k(l). Determine s(u(c)). 15c Let j(k) = 6k. Let p(q) = 206q. Calculate p(j(y)). 1236y Let j(g) = g*2. Let p(u) = 17u - 4. Let r(f) = 42f - 10. Let t(b) = 12p(b) - 5r(b). Let a(n) = 6n - 3. Let c(q) = 4a(q) + 6t(q). Determine j(c(l)). 144l2 Let c(t) = -t. Let u(a) = a. Suppose -3m + 12 = 2w, 0m - 2m + 8 = 3w. Let s(n) = mu(n) + 5c(n). Let i(r) = -58r2. What is i(s(b))? -58b*2 Suppose 0 = -y + 6 - 1. Suppose -5l + w = 5w - 37, yl + 3w - 34 = 0. Let g(z) = -6z + 18z + lz. Let b(d) = 2d2. Give g(b(m)). 34m*2 Let k(n) = 8n*2. Suppose -5z = -24 - 1, -5x + 210 = 3z. Let f = -25 + x. Let c(r) = -23r + 10r + fr. Determine c(k(h)). 8h*2 Let o(g) = g. Let s(d) = 3d. Let y(n) = 9o(n) - 4s(n). Let t(l) be the third derivative of 1/6l4 + 14l*2 + 0 + 0l*3 + 0l. Determine y(t(x)). -12x Let o(p) = -69p. Let g(c) = -178c - 32. Calculate o(g(m)). 12282m + 2208 Let z be (-30)/50 + 56/10. Let u(y) = 4y - y + zy - y. Let t(x) = x. What is t(u(j))? 7j Let d be 7 + (-3 - -4)-1. Let h(l) = -dl + 4l + 2l - l. Let i(a) = 15a*2. Calculate i(h(v)). 15v*2 Let s(g) = 7g. Let w(b) = -11357b. Determine s(w(q)). -79499q Suppose -4q = -3n + 1, -5q = 5n - 20 - 5. Let k(o) = 5o - 7o + o - qo. Let g(h) = -4h*2. Determine k(g(i)). 12i*2 Let q(y) = -2y. Let o(s) = -9s2 - 22511s. Give q(o(l)). 18l2 + 45022l Let b(q) = 49q - 1. Let t(g) = -3824g + 2g2 + 3824g. Determine b(t(m)). 98m2 - 1 Let x(w) = -2w*2. Let s(m) be the first derivative of 6 - 29/2m*2 + 2m. Give x(s(z)). -1682z2 + 232z - 8 Let c(t) = -7t - 6. Let h(l) = -6l - 5. Let z(v) = -5c(v) + 6h(v). Let x(u) = 7u + u - 2u. Calculate z(x(r)). -6r Let v(k) = -2k. Let q(w) = 731w. Calculate q(v(d)). -1462d Let s(i) = 3i2 + 55i. Let l(u) = 2u - 31. Determine l(s(a)). 6a*2 + 110a - 31 Let t(o) = -101o + 1. Let v(p) = -2p*2 - 9. Determine t(v(u)). 202u*2 + 910 Let w(z) = -2z*2. Let p(g) = 3g + 38g + 13026 - 13026. Calculate p(w(d)). -82d*2 Let r(w) = 4w. Let a(b) = -258b2. Calculate r(a(k)). -1032k*2 Let o(k) = -8180k. Let j(w) = 7w2 - 18w. Give j(o(z)). 468386800z2 + 147240z Let a(q) = 2558q + 9. Let l(c) = -22c. Determine l(a(p)). -56276p - 198 Let a(l) be the second derivative of -l3/3 - 986l. Let x(h) be the second derivative of -11h3 + h. What is x(a(j))? 132j Let u(a) = -2a. Let r be (-5)/(-15) + 100/6. Let x(g) = -rg - 23g + 41g. Determine u(x(q)). -2q Let m(u) = -201u - 3. Let p(r) = -524r2 + 2r. Determine m(p(c)). 105324c2 - 402c - 3 Let z(m) = -4*m. Let r(b) be the	{ "pile_set_name": "DM Mathematics" }
d without replacement from {z: 4, o: 7}. 14/55 Two letters picked without replacement from ufvxkke. What is prob of sequence uv? 1/42 Calculate prob of sequence ee when two letters picked without replacement from xxxxxxexxxxxe. 1/78 Calculate prob of sequence oz when two letters picked without replacement from zzozozzzozz. 12/55 What is prob of sequence nn when two letters picked without replacement from nnznnnzznzzznnzzzn? 4/17 Three letters picked without replacement from {q: 1, k: 2}. What is prob of sequence kkq? 1/3 Four letters picked without replacement from hhvyhvhvvv. What is prob of sequence hvvv? 1/21 Two letters picked without replacement from {p: 1, u: 1, o: 1}. What is prob of sequence op? 1/6 Calculate prob of sequence qo when two letters picked without replacement from {j: 2, q: 1, o: 1}. 1/12 Four letters picked without replacement from {s: 2, l: 9, e: 5, b: 3}. Give prob of sequence esbe. 5/3876 Four letters picked without replacement from {a: 1, t: 3, h: 1, b: 5, d: 6, z: 3}. Give prob of sequence tzbz. 5/5168 Two letters picked without replacement from {v: 1, r: 12, k: 1, h: 1}. What is prob of sequence rh? 2/35 Four letters picked without replacement from mmpmmmmmmmmpm. What is prob of sequence pmmm? 3/26 Calculate prob of sequence wfc when three letters picked without replacement from wfuweeuecwwueue. 2/1365 Four letters picked without replacement from {v: 1, j: 2, w: 3, p: 1, h: 3}. What is prob of sequence hhvh? 1/840 What is prob of sequence xg when two letters picked without replacement from {y: 1, g: 2, x: 1, l: 1}? 1/10 What is prob of sequence rso when three letters picked without replacement from {w: 1, s: 2, z: 1, o: 1, t: 1, r: 1}? 1/105 Three letters picked without replacement from wuwwwweewwwu. What is prob of sequence wue? 4/165 Calculate prob of sequence kqqp when four letters picked without replacement from {p: 2, k: 3, m: 2, y: 6, q: 2, r: 2}. 1/4760 Calculate prob of sequence ba when two letters picked without replacement from duabataaaauaab. 8/91 Three letters picked without replacement from farrugngauaugarru. Give prob of sequence ggg. 1/680 Three letters picked without replacement from qqq. Give prob of sequence qqq. 1 Calculate prob of sequence lt when two letters picked without replacement from {t: 5, l: 3}. 15/56 Two letters picked without replacement from {g: 3, q: 1, u: 5, y: 3}. Give prob of sequence uq. 5/132 Two letters picked without replacement from {g: 2, j: 1, m: 1, e: 2, f: 1}. What is prob of sequence jm? 1/42 Four letters picked without replacement from yyymyyyymymyyymymy. What is prob of sequence ymym? 13/306 What is prob of sequence rryr when four letters picked without replacement from {r: 3, v: 3, g: 3, k: 2, f: 1, y: 3}? 1/1820 What is prob of sequence xb when two letters picked without replacement from {b: 11, t: 3, x: 1}? 11/210 Calculate prob of sequence nll when three letters picked without replacement from nll. 1/3 What is prob of sequence su when two letters picked without replacement from {s: 3, j: 4, i: 1, u: 2}? 1/15 What is prob of sequence gwl when three letters picked without replacement from {w: 5, c: 2, n: 1, g: 3, l: 5}? 5/224 Four letters picked without replacement from ipipddcppppc. Give prob of sequence cdcd. 1/2970 What is prob of sequence tttj when four letters picked without replacement from kjtkjkttttttkj? 15/572 What is prob of sequence mmc when three letters picked without replacement from {m: 9, c: 7}? 3/20 Four letters picked without replacement from {w: 10, p: 2}. Give prob of sequence wpww. 4/33 Two letters picked without replacement from unjjuq. Give prob of sequence jq. 1/15 Three letters picked without replacement from {a: 7, s: 7}. What is prob of sequence sss? 5/52 Two letters picked without replacement from {w: 1, g: 1, z: 2, h: 1}. Give prob of sequence gw. 1/20 What is prob of sequence le when two letters picked without replacement from lejllllzglllellmlzll? 13/190 Two letters picked without replacement from ppyjnppyjn. Give prob of sequence pn. 4/45 Two letters picked without replacement from {d: 1, l: 5, j: 1, b: 3}. What is prob of sequence bl? 1/6 Three letters picked without replacement from {e: 3, j: 6, f: 1, l: 4}. What is prob of sequence jje? 15/364 Three letters picked without replacement from hrtma. What is prob of sequence ram? 1/60 What is prob of sequence ddq when three letters picked without replacement from goooodyqogoogqood? 1/1020 Two letters picked without replacement from {u: 1, k: 2, t: 1, o: 2}. Give prob of sequence to. 1/15 Three letters picked without replacement from gixigpsxrxiisx. What is prob of sequence ggp? 1/1092 Calculate prob of sequence ybwo when four letters picked without replacement from {w: 5, b: 1, y: 2, k: 1, o: 1}. 1/504 What is prob of sequence wwiw when four letters picked without replacement from jbisissbwjwssswij? 3/9520 Calculate prob of sequence qcq when three letters picked without replacement from {v: 5, c: 3, q: 7, t: 1}. 3/80 Two letters picked without replacement from {c: 11, i: 4, t: 2, z: 2}. What is prob of sequence cc? 55/171 Calculate prob of sequence nrrr when four letters picked without replacement from {r: 3, n: 8}. 1/165 Calculate prob of sequence rese when four letters picked without replacement from eerreeeefefefsrfs. 1/170 Three letters picked without replacement from {n: 5, r: 7, j: 8}. What is prob of sequence rjn? 7/171 Calculate prob of sequence dk when two letters picked without replacement from {d: 1, h: 2, k: 1}. 1/12 Two letters picked without replacement from aeee. Give prob of sequence ea. 1/4 Calculate prob of sequence phh when three letters picked without replacement from hzphzzphh. 1/21 Three letters picked without replacement from ooss. Give prob of sequence oos. 1/6 Calculate prob of sequence ca when two letters picked without replacement from {r: 5, c: 5, a: 1}. 1/22 Calculate prob of sequence zy when two letters picked without replacement from yuweeeezey. 1/45 Calculate prob of sequence jlv when three letters picked without replacement from jlkzzjzjzkzvkik. 1/910 Calculate prob of sequence co when two letters picked without replacement from oococcoococc. 3/11 What is prob of sequence tkl when three letters picked without replacement from lltknlkdl? 1/63 What is prob of sequence cx when two letters picked without replacement from {x: 5, d: 8, c: 3}? 1/16 Four letters picked without replacement from {k: 1, r: 1, c: 2, g: 2}. Give prob of sequence ckcc. 0 What is prob of sequence uyyy when four letters picked without replacement from yyuyyyuyyyyyuyyyyu? 91/765 Three letters picked without replacement from taacatateaetatatt. Give prob of sequence ate. 49/2040 Three letters picked without replacement from qyozoq. Give prob of sequence qqo. 1/30 Two letters picked without replacement from {g: 1, c: 1, a: 3}. Give prob of sequence ag. 3/20 Calculate prob of sequence jmh when three letters picked without replacement from mhjhhhmj. 1/21 Four letters picked without replacement from uuuzuuuuuuuuzzuzzuuu. What is prob of sequence uzzz? 5/646 Four letters picked without replacement from {r: 4, d: 4, a: 6, x: 1}. What is prob of sequence ddar? 4/455 Three letters picked without replacement from {x: 3, z: 3, d: 5}. Give prob of sequence xzz. 1/55 What is prob of sequence zz when two letters picked without replacement from zjjjzzjzzzzj? 7/22 Calculate prob of sequence bv when two letters picked without replacement from {v: 1, p: 2, b: 2, z: 1, l: 2}. 1/28 Three letters picked without replacement from szsesnsslzzszddzs. Give prob of sequence esl. 7/4080 Calculate prob of sequence orr when three letters picked without replacement from zoopopuobzpr. 0 Four letters picked without replacement from jjioijijjiioi. Give prob of sequence ioio. 1/286 What is prob of sequence ddw when three letters picked without replacement from {d: 5, w: 7}? 7/66 What is prob of sequence ta when two letters picked without replacement from ataaaaaatt? 7/30 Four letters picked without replacement from oyqqqeqoqyqqq. What is prob of sequence yqoe? 4/2145 Four letters picked without replacement from jjjrrmr. What is prob of sequence rjjj? 3/140 Two letters picked without replacement from {o: 11, b: 3}. What	{ "pile_set_name": "DM Mathematics" }
se 5 -142210 What is -46643 (base 7) in base 8? -27323 -40321 (base 7) to base 10 -9766 23024 (base 5) to base 9 2221 -2314 (base 6) to base 16 -226 What is 2310 (base 12) in base 9? 5313 -22130 (base 4) to base 2 -1010011100 Convert 23110 (base 4) to base 15. 334 What is 654 (base 10) in base 12? 466 Convert 4927 (base 11) to base 13. 2c17 What is -3621 (base 9) in base 4? -222010 Convert 53050 (base 10) to base 8. 147472 4551 (base 7) to base 13 9a2 -14345 (base 6) to base 9 -3132 Convert -111133 (base 4) to base 5. -21000 -3130131 (base 4) to base 13 -6564 Convert 1000010100011111 (base 2) to base 9. 51665 What is 54323 (base 7) in base 16? 34e5 10432 (base 5) to base 2 1011100110 Convert 10055 (base 8) to base 10. 4141 15 (base 15) to base 9 22 What is -20022200 (base 3) in base 2? -1001000000000 -214 (base 15) to base 13 -2a1 Convert 10302 (base 4) to base 14. 17c 4134 (base 5) to base 15 264 Convert 474 (base 13) to base 9. 1046 What is -201122011 (base 3) in base 6? -150134 -199 (base 13) to base 12 -207 -10001111 (base 2) to base 11 -120 What is -1506 (base 7) in base 8? -1122 What is 126 (base 16) in base 9? 356 Convert 111000 (base 2) to base 11. 51 -c2 (base 15) to base 11 -156 Convert 4ff (base 16) to base 6. 5531 Convert 14930 (base 10) to base 3. 202110222 101110010111 (base 2) to base 13 1473 Convert 11111101111010 (base 2) to base 13. 7520 Convert 143663 (base 7) to base 14. a1a3 What is -3310000 (base 4) in base 16? -3d00 -32111 (base 4) to base 3 -1020222 -5a6 (base 13) to base 2 -1111010101 What is -16e (base 15) in base 13? -1c4 What is 16385 (base 10) in base 16? 4001 Convert -658 (base 15) to base 9. -1862 What is 1 (base 3) in base 14? 1 Convert 1203 (base 12) to base 10. 2019 Convert -11a2 (base 11) to base 7. -4363 Convert 1544 (base 12) to base 16. 9c4 -2144 (base 5) to base 16 -12b What is 12013231 (base 4) in base 3? 1021101111 Convert 13157 (base 8) to base 4. 1121233 Convert -3104 (base 5) to base 15. -1be Convert -2321 (base 4) to base 6. -505 -920 (base 12) to base 7 -3564 Convert a4ba (base 12) to base 2. 100011001001110 Convert -3080 (base 13) to base 10. -6695 Convert -44314 (base 6) to base 7. -23656 What is -1773 (base 13) in base 6? -24030 Convert -98 (base 10) to base 2. -1100010 454a (base 13) to base 12 573b ca (base 14) to base 11 152 What is 289 (base 13) in base 3? 121201 Convert 441 (base 9) to base 3. 111101 What is -23113102 (base 4) in base 3? -2100211221 Convert 1010 (base 10) to base 15. 475 What is -20110221 (base 3) in base 5? -122343 Convert 153b (base 14) to base 12. 2229 What is 1a2 (base 16) in base 5? 3133 50145 (base 6) to base 14 2557 3113300 (base 5) to base 9 77050 -5444 (base 7) to base 11 -1507 What is -479 (base 16) in base 3? -1120102 What is -123 (base 14) in base 8? -343 Convert -5005 (base 7) to base 14. -8ac Convert -425 (base 12) to base 7. -1523 Convert -37c (base 16) to base 10. -892 Convert -2206 (base 8) to base 12. -806 Convert -414 (base 7) to base 11. -179 Convert -3509 (base 14) to base 3. -110122112 What is 1000110000011110 (base 2) in base 10? 35870 What is -700 (base 10) in base 7? -2020 What is 2364 (base 12) in base 9? 5384 -8c8 (base 14) to base 8 -3320 What is -2f (base 16) in base 14? -35 -1344353 (base 6) to base 16 -1298d What is 1145c (base 15) in base 11? 38349 Convert -13324 (base 10) to base 6. -141404 Convert -3d15 (base 15) to base 13. -5c45 -30c (base 15) to base 8 -1257 -842 (base 16) to base 14 -ab0 Convert 1101001100 (base 2) to base 5. 11334 Convert 260321 (base 8) to base 13. 3215a 22600 (base 9) to base 12 8876 327a (base 12) to base 3 21122011 What is 31332 (base 4) in base 3? 1020010 What is -13468 (base 12) in base 10? -26576 -235563 (base 7) to base 4 -22131012 What is -14 (base 6) in base 16? -a Convert 1f9 (base 16) to base 2. 111111001 What is -140 (base 13) in base 15? -eb What is -113324 (base 6) in base 10? -9844 35 (base 6) to base 3 212 Convert -10132 (base 4) to base 5. -2121 What is 113153 (base 6) in base 5? 303124 -270 (base 12) to base 6 -1420 48a (base 14) to base 10 906 -44442 (base 8) to base 6 -222402 Convert -1243240 (base 5) to base 12. -12444 Convert 723 (base 9) to base 7. 1500 What is -1010101010 (base 2) in base 11? -570 Convert c46 (base 13) to base 15. 941 232 (base 12) to base 14 194 What is 33456 (base 7) in base 11? 63aa 111 (base 16) to base 14 157 -1393a (base 16) to base 7 -452531 4472 (base 9) to base 11 2535 -13022 (base 4) to base 9 -558 877 (base 12) to base 16 4db What is -3b3 (base 14) in base 6? -3241 Convert 192e (base 15) to base 8. 12504 What is 215055 (base 6) in base 13? 823a 3253 (base 9) to base 15 a9c Convert -41e (base 15) to base 9. -1242 What is 5262 (base 8) in base 7? 10661 -10c2c (base 15) to base 16 -d077 3247 (base 10) to base 11 2492 -73 (base 15) to base 16 -6c What is -555 (base 15) in base 10? -1205 What is -27100 (base 8) in base 12? -6a28 What is 10b2 (base 16) in base 7? 15314 -10000001000011 (base 2) to base 4 -2001003 What is -5742 (base 9) in base 7? -15251 b7a8 (base 12) to base 3 1000122002 -8550 (base 9) to base 4 -1202022 What is 2f (base 16) in base 15? 32 Convert 180a (base 12) to base 11. 2198 Convert 3022 (base 7) to base 5. 13140 101221210 (base 3) to base 4 1330302 Convert 2430312 (base 5) to base 11. 31382 What is 152f (base 16) in base 8? 12457 What is -1252 (base 8) in base 15? -307 Convert -14123 (base 5) to base 13. -6b6 Convert -20251 (base 11) to base 2. -111001110001100 -25223 (base 10) to base 7 -133352 -ac (base 16) to base 5 -1142 Convert -1c3 (base 14) to base 7. -1033 2013 (base 6) to base 4 12321 3303 (base 5) to base 9 553 What is 1050 (base 8) in base 14? 2b6 -720 (base 8) to base 12 -328 -153 (base 13) to base 3 -22210 What is -6338 (base 15) in base 14? -7906 476 (base 15) to base 4 33303 Convert -1001100001 (base 2) to base 8. -1141 Convert 4043 (base 7) to base 11. 1066 17599 (base 14) to base 13 20975 What is 856b (base 12) in base 13? 6872 What is 204 (base 15) in base 5? 3304 What is 334 (base 10) in base 4? 11032 -33001 (base 4) to base 5 -12321 Convert -10248 (base 12) to base 10. -21080 Convert 14413 (base 5) to base 9. 1620 Convert -1da (base 16) to base 7. -1245 -79e (base 16) to base 11 -1513 What is 21221 (base 3) in base 6? 554 What is -b31 (base 15) in base 7? -10231 -70238 (base 9) to base 13 -17cc0 Convert 63bd (base 14) to base 6. 211415 40d (base 16) to base 13 61a -33165 (base 7) to base 10 -8328 -7320 (base 16) to base 15 -8aec What is 1444 (base 8) in base 2? 1100100100 a146 (base 11) to base 12 7975 Convert 11505 (base 8) to base 13. 2326 Convert -11321211 (base 4) to base 2. -101111001100101 Convert 4b1b (base 15) to base 4. 3322001 What is -3ba7 (base 12) in base 7? -26050 1000110001000 (base 2) to base 16 1188 What is 5256 (base 8) in base 15? c24 What is 1433 (base 5) in base 9? 300 What is 614 (base 9) in base 16? 1f3 Convert -496 (base 11) to base 10. -589 Convert 110001010110 (base 2) to base 7. 12131 Convert 3ba (base 13) to base 15. 2e0 210c1 (base 13) to base 9 100524 79 (base 14) to base 7 212 What is 12002220 (base 3) in base 4? 322023 Convert 111000111010 (base 2) to base 4. 320322 -1239 (base 16) to base 11 -3561 Convert 2021200 (base 3) to base 2. 11010000001 What is 24025 (base 6) in base 12? 2015 Convert 3002314 (base 5) to base 7. 254431 Convert -5504 (base 6) to base 8. -2360 What is -12501 (base 6) in base 4? -131311 803b (base 12) to base 16 362f What is -453 (base 6) in base 10? -177 5285 (base 14) to base 4 3132111 -1012020 (base 3) to base 13 -51c Convert 1101010001110111 (base 2) to base 10. 54391 -20331 (base 7) to base 8 -11553 What is 10306 (base 8) in base 4? 1003012 111003 (base 5) to base 10 3878 Convert -341061 (base 7) to base 14. -18031 Convert -4533 (base 6) to base 12. -749 What is 2330231 (base 4) in base 11? 908a Convert 12021 (base 6) to base 8. 3315 What is 329 (base 15) in base 3? 222110 -212233 (base 4) to base 7 -10141 Convert 9362 (base 16) to base 2. 1001001101100010 Convert -11100000111 (base 2) to base 8. -3407 Convert -102020301 (base 4) to base 9. -122813 What is 3515 (base 11) in base 8? 11006 What is 1a1ab (base 12) in base 15? b52b 127b (base 14) to base 11 2490 1001110222	{ "pile_set_name": "DM Mathematics" }
y2 + 2y - 3. Let b be v(5). Suppose -q - b = -4q. What are the prime factors of q? 19 Let l(z) = -z3 + 2z*2 + 3z - 3. Let p be l(2). Suppose -pv + 345 = 2v. Suppose 4r + 13 = v. List the prime factors of r. 2, 7 Suppose 5u - 1806 = -101. List the prime factors of u. 11, 31 Let a(q) = q*3 - 10q*2 - 8q - 16. What are the prime factors of a(11)? 17 Let l be 0 - (0 - 2) - -8. Let b(r) = r*3 - 3r*2 + r - 2. Let k be b(3). Suppose -l = -a - k. What are the prime factors of a? 3 Let s = -19 + 21. Let u = s + 13. List the prime factors of u. 3, 5 Suppose -4z + 5 = -7. Let q(n) = -n + 1. Let o be q(z). What are the prime factors of (-57)/(-4) - o/(-8)? 2, 7 Let u = -57 - -67. List the prime factors of u. 2, 5 Suppose 0 = -5z - y + 5, 0 = -4z - 4y + y + 4. Let t = 0 + z. List the prime factors of (-4)/(-2) - -11t. 13 Let a(n) = n*3 + 14n*2 + 13n + 13. Let v be a(-13). Suppose -c = c - 14. Let t = v - c. What are the prime factors of t? 2, 3 Let c = -5 + 8. Suppose v = -cv + 36. List the prime factors of v. 3 Let d(o) = 6o - 2. Let a(j) = j - 1. Let m(w) = -5a(w) + d(w). Let v be m(-5). What are the prime factors of 1 + 6 + 0 - v? 3 Let g(v) be the third derivative of 13v*4/24 - 4v*2. List the prime factors of g(3). 3, 13 Let j be 68/20 - 2/5. Suppose -a - 6 = -2a - l, 2l - 22 = -ja. Suppose d + d - a = 0. List the prime factors of d. 5 Suppose 0 = -8z + z + 875. What are the prime factors of z? 5 Let z(d) = d3 - 4d*2 - 2d + 4. Let i be z(5). Suppose 3 = l + 2b + b, -l + i = -b. List the prime factors of l. 3, 5 Let t(k) = -k3 - 3k*2 - k + 4. Let g be t(-3). Suppose gb = 2b + 10. What are the prime factors of b? 2 Let j be 4 + (-1)/(1/1). Suppose -t - 7 = jl - 0l, -2l = 4t + 18. Let m = 4 - t. List the prime factors of m. 2 Suppose -2o + 23 = -203. List the prime factors of o. 113 Suppose 5z = -5r - 55, 5r = 2z - 27 - 35. Let i be 16/r(-3)/(-2). List the prime factors of (-8 - 2)/(i/1). 5 Let y be 1/((-3)/(-46 - -1)). List the prime factors of y2/3 - -3. 13 Suppose 2s - 32 = 46. Let w = -18 + s. What are the prime factors of w? 3, 7 Suppose 0 = -3c + 112 + 32. List the prime factors of c. 2, 3 Let v be 37 + -2 - (3 - 3). Suppose 8m = 3m + v. What are the prime factors of m? 7 Let u(x) = -x*3 + 6x*2 + 6x - 4. Let d be u(6). What are the prime factors of (d/20)/((-4)/(-110))? 2, 11 Suppose v = 5v - 60. Suppose 4d - v = -5w, 25 = 4d + w + 2w. What are the prime factors of d? 2, 5 Suppose 1149 + 3107 = 16y. List the prime factors of y. 2, 7, 19 Suppose 70 = 2y + 12. What are the prime factors of y? 29 Let u = 7 - 6. Suppose 5p + u - 41 = 0. What are the prime factors of p? 2 List the prime factors of (32/(-6))/((-220)/216 + 1). 2, 3 Suppose -3h - 138 = 3w, 2w + 3h = -2w - 181. Let x = -18 - w. Let k = x + -15. List the prime factors of k. 2, 5 Suppose 4j + 0j + 7 = -o, 3j = -6. What are the prime factors of o/(-4) - 621/(-36)? 17 Let w(y) = 2y3 + 3y*2 - 3y. Let g(o) = o*2 + 2o - 1. Let j be g(-3). What are the prime factors of w(j)? 2, 11 Suppose 4o - 5 = -u, -4u = 4o + 8 - 28. Suppose 0 = uc - 0t + t - 35, 3c - 3 = 3t. What are the prime factors of c? 2, 3 Suppose -4d + 162 = -2g, 2d + 5g - 84 = 3g. List the prime factors of d. 41 Let i = -38 - -55. What are the prime factors of i? 17 Let f = 103 - 214. Let a = f + 175. Suppose -5r + u = -60, r + 5u = -2r + a. What are the prime factors of r? 13 Let d(s) = s3 - 10s*2 + 10s - 9. Suppose -3h + l = -27, 18 = 2h + 3l + 2l. Let i be d(h). Suppose 3q - 15 - 51 = i. What are the prime factors of q? 2, 11 Let y = 0 + 7. List the prime factors of -3 + (y + -1 - -2). 5 Suppose -3f - 52 = -187. Suppose -f = -4o + 3s, 4o = s - 23 + 70. What are the prime factors of o? 2, 3 Let t(n) = -1 + 5 - 8n - 7n2 + 10n*3 - 9n*3. Let f be t(8). Suppose -5c = -4c - f. List the prime factors of c. 2 Let t = 21 - 15. Let r = t + 5. Suppose 4w = 25 + r. What are the prime factors of w? 3 Suppose -3x + 4x + 321 = 3g, -3g + 330 = -4x. List the prime factors of g. 2, 53 Suppose -3c - 239 + 773 = 0. List the prime factors of c. 2, 89 Let z = -74 + 157. List the prime factors of z. 83 Let z(v) = -v*3 + 3v*2 + 5v - 2. Let u be z(4). Suppose 35 + 25 = uh. List the prime factors of h. 2, 3, 5 Let k = 18 + 23. What are the prime factors of k? 41 Let a(u) = u + 1. Let t be a(0). Suppose -c = t + 1. Let f = c - -5. What are the prime factors of f? 3 Suppose c = -5w + 291, -4c + 3w = -3c - 267. List the prime factors of c. 2, 3, 23 Suppose 8u + 451 - 2571 = 0. What are the prime factors of u? 5, 53 Let d be -33/(-9)4. Let k = d - 2. Suppose -3g + kg = -3. What are the prime factors of g? 3 Let p(v) = -3v + 0v - 2 + 4v - 6v. Suppose s + s - 12 = 3r, -2r = -5s + 19. List the prime factors of p(r). 2 Let o be 1(-11)/(-1) - -3. What are the prime factors of 2/(o/(-18) - -1)? 3 Suppose 0u = -5u + 195. Let y = -16 + u. What are the prime factors of y? 23 Let v(a) = -a*2 - 14a - 23. What are the prime factors of v(-11)? 2, 5 Let i(q) = -q*2 + 6q - 3. Let w be i(3). Suppose 3o - 2o - w = 0. What are the prime factors of o? 2, 3 Let y(h) = 5h - 25. What are the prime factors of y(11)? 2, 3, 5 Suppose 3q + 108 = 3d + 24, 5q + 2d + 105 = 0. Let w = q - -45. What are the prime factors of (-3 - w/(-6))15? 2, 5 What are the prime factors of (-36)/(-27)(-9)/(-6)? 2 Let n(y) = y3 - 6y*2 - y + 13. List the prime factors of n(6). 7 Let o be (3 - 4) + -126 + 3. What are the prime factors of (o/(-1))/4 + 1? 2 Let y(v) = 3v*3 + 8v*2 + 6v + 5. Let f be y(-5). What are the prime factors of 2/4 - f/16? 13 Suppose -2j - 2j = 5s - 185, j + 3s = 55. Let q = j - 23. What are the prime factors of q? 17 Let c(u) = 18u3 - 2u*2 + 2u - 1. Let f be c(1). Suppose -4t = l - 92, -5t - 2l + f = -98. What are the prime factors of t? 23 Suppose 3g - 1246 = -4g. List the prime factors of g. 2, 89 Let y(k) = -103k + 7. List the prime factors of y(-1). 2, 5, 11 List the prime factors of 1(-1 - 2 - -46). 43 Suppose -5g = -h - 8g + 176, -3h - 2g = -514. Suppose -l + 6l = h. List the prime factors of l. 2, 17 Let o = -18 + 9. Let u = -7 - o. Suppose -5d + 32 = 4z, 0 = -4d - uz + z + 30. List the prime factors of d. 2 Suppose -2t - 10 + 116 = 0. List the prime factors of t. 53 Suppose 5h - 10 = -0h. Let z be (4/5)/(h/(-20)). Let d = 3 - z. What are the prime factors of d? 11 Let f = 3 - 1. Let v = f + 11. List the prime factors of v. 13 Let l = -69 + 101. Let c = l - 2. List the prime factors of c. 2, 3, 5 Suppose -3n + 40 = 2h, 5n - 40 - 32 = 2h. Suppose -4k - n = -2d, -k = d + 3k - 1. List the prime factors of d. 5 Suppose 0 = 13w - 9w - 208. What are the prime factors of w? 2, 13 Let w = 24 + 9. What are the prime factors of w? 3, 11 Let f be ((-6)/(-15))/((-1)/5). Let h be 1/((f/3)/2). What are the prime factors of 1/h(-1 - 8)? 3 Suppose 0s - n = -s + 52, 3s + 4n - 149 = 0. Suppose -5v = -3g - s, 2v - 3g - 24 = -0g. List the prime factors of v. 3 Let o(k) = -23k - 1. Let x be o(1). What are the prime factors of 5/10(-2 - x)? 11 Let y be (-2)/(-3 + (-21)/(-9)). Suppose 3d - 3g - 45 = 0, yd + 3g + 35 = 5d. List the prime factors of d. 2, 5 Let t be (-8)/(-28) - 4/14. Suppose -5w - 4q + 14 = t, -2w + 3q + 1 = -0w. Suppose wy + 5 = 33. What are the prime factors of y? 2, 7 Let q = 49 + -13. What are the prime factors of 368/q + 6/(-27)? 2, 5 Suppose 4r + 109 - 705 = -2v, -454 = -3r + 2v. What are the prime factors of r? 2, 3, 5 Let p(o) = -5o + 7. What are the prime factors of p(-10)? 3, 19 Let h(m) = -m3 + 8m*2 - 6m - 5. Suppose 3g = 4b + 37, -2g + b = -g - 11. Let p be h(g). Suppose pr - 6 = 16. What are the prime factors of r? 11 Suppose 0c + 4c = -44. List the prime factors of -1c/(-2)-2. 11 Let v(l) = l*3 + 4l*2 + 3l - 2. Let x be v(-3). Let m = 4 + x. Suppose -mb - 1 = -19. What are the prime factors of b? 3 Suppose 0 = 41i - 39i - 184. List the prime factors of i. 2, 23 Suppose 4c = 4h - 24, 24 = -2c - 2c - 2h. Let l be c/(-8)(11 - 7). Suppose -m - lm = a - 31, -3a + 37 = 5m. List the prime factors of m.	{ "pile_set_name": "DM Mathematics" }
ers picked without replacement from {c: 5, d: 9}. What is prob of sequence ccc? 5/182 Calculate prob of sequence jjsz when four letters picked without replacement from jjsjczszj. 1/63 Calculate prob of sequence yyil when four letters picked without replacement from yylilylllliiyylhhf. 7/1224 What is prob of sequence xb when two letters picked without replacement from {y: 1, p: 2, w: 3, b: 1, x: 5, q: 1}? 5/156 Four letters picked without replacement from kgkgggknnknkgnggggk. Give prob of sequence gngk. 6/323 Four letters picked without replacement from uxxxuvxkxzxxukjkjuuv. What is prob of sequence uuxu? 7/1938 Two letters picked without replacement from uiummmuiimm. Give prob of sequence ii. 3/55 What is prob of sequence ll when two letters picked without replacement from flltallyatlt? 5/33 What is prob of sequence qkq when three letters picked without replacement from {k: 3, q: 11}? 55/364 Calculate prob of sequence nnnn when four letters picked without replacement from nnnnnn. 1 What is prob of sequence mm when two letters picked without replacement from miisiqmsiuumiqmuiwim? 1/19 Four letters picked without replacement from {z: 2, y: 2, p: 1, w: 14}. Give prob of sequence yyzp. 1/23256 Two letters picked without replacement from ocz. Give prob of sequence oz. 1/6 Calculate prob of sequence nnnn when four letters picked without replacement from mttttmttmttntttmtmn. 0 Three letters picked without replacement from nwnwnqww. Give prob of sequence nqn. 1/56 What is prob of sequence bbh when three letters picked without replacement from {m: 2, o: 1, h: 1, b: 10, s: 4}? 5/272 Two letters picked without replacement from {h: 1, g: 1, i: 3, z: 5}. Give prob of sequence hi. 1/30 Two letters picked without replacement from {h: 1, e: 2, q: 1}. Give prob of sequence eq. 1/6 What is prob of sequence iwrr when four letters picked without replacement from wirirw? 1/45 What is prob of sequence ev when two letters picked without replacement from mzvezsm? 1/42 Three letters picked without replacement from pydtpjy. What is prob of sequence dty? 1/105 Two letters picked without replacement from imimttmma. Give prob of sequence ai. 1/36 Two letters picked without replacement from {a: 9}. What is prob of sequence aa? 1 Calculate prob of sequence rza when three letters picked without replacement from {w: 1, r: 1, z: 2, k: 1, a: 1, j: 1}. 1/105 Calculate prob of sequence xkkl when four letters picked without replacement from lpklxkk. 1/70 What is prob of sequence saa when three letters picked without replacement from {s: 3, a: 4, j: 1}? 3/28 Calculate prob of sequence ah when two letters picked without replacement from hvqqqahaah. 1/10 Calculate prob of sequence kyk when three letters picked without replacement from kkjtktvvmjjvtyk. 2/455 What is prob of sequence ko when two letters picked without replacement from {o: 1, m: 1, r: 1, k: 4, j: 1}? 1/14 Two letters picked without replacement from tttttttttkttt. Give prob of sequence tt. 11/13 Three letters picked without replacement from gggguzzzsgggugttgt. Give prob of sequence utt. 1/408 Calculate prob of sequence css when three letters picked without replacement from {s: 11, c: 1}. 1/12 What is prob of sequence toyo when four letters picked without replacement from {x: 1, o: 2, u: 1, b: 2, y: 1, t: 1}? 1/840 Three letters picked without replacement from {c: 3}. Give prob of sequence ccc. 1 What is prob of sequence lo when two letters picked without replacement from osomls? 1/15 Three letters picked without replacement from {b: 5, r: 2}. Give prob of sequence bbr. 4/21 Calculate prob of sequence inn when three letters picked without replacement from wpwwnwwinlwnwnl. 2/455 Calculate prob of sequence kpp when three letters picked without replacement from {p: 2, d: 4, l: 4, a: 3, w: 3, k: 2}. 1/1224 What is prob of sequence hn when two letters picked without replacement from {a: 1, h: 1, n: 4, d: 7, p: 4}? 1/68 Four letters picked without replacement from rccrcrrrocrrrroccoc. Give prob of sequence crco. 63/5168 Two letters picked without replacement from {h: 6, q: 4, k: 4, o: 4}. Give prob of sequence ko. 8/153 Calculate prob of sequence qh when two letters picked without replacement from hcphwfq. 1/21 What is prob of sequence eg when two letters picked without replacement from ggcecegccgggcgc? 1/15 Three letters picked without replacement from xhbrvpb. What is prob of sequence vhp? 1/210 Calculate prob of sequence wu when two letters picked without replacement from {w: 2, n: 11, r: 1, u: 1, v: 5}. 1/190 Four letters picked without replacement from {c: 3, x: 2, i: 3, k: 2, a: 3}. Give prob of sequence ickk. 3/2860 Three letters picked without replacement from {i: 2, m: 9, l: 7}. Give prob of sequence lii. 7/2448 What is prob of sequence trhz when four letters picked without replacement from ztizthr? 1/210 Four letters picked without replacement from yyqnnhnssnnn. What is prob of sequence qynn? 1/198 Two letters picked without replacement from {j: 3, d: 5, l: 2, e: 1, x: 1, g: 1}. What is prob of sequence xj? 1/52 What is prob of sequence aa when two letters picked without replacement from {a: 5}? 1 Calculate prob of sequence ul when two letters picked without replacement from pufxlclf. 1/28 Two letters picked without replacement from gyypppggg. What is prob of sequence gp? 1/6 What is prob of sequence al when two letters picked without replacement from {a: 18, l: 2}? 9/95 What is prob of sequence ddqq when four letters picked without replacement from qdqdqqddqddd? 7/99 What is prob of sequence nnn when three letters picked without replacement from {n: 6}? 1 Two letters picked without replacement from {h: 6, p: 12, e: 1}. Give prob of sequence eh. 1/57 What is prob of sequence vds when three letters picked without replacement from ddddcsvc? 1/84 Four letters picked without replacement from bbiii. Give prob of sequence ibbi. 1/10 Two letters picked without replacement from iaafiyyyoayfyyaaya. Give prob of sequence yy. 7/51 What is prob of sequence fzy when three letters picked without replacement from iiyrffrbbzfbi? 1/572 Four letters picked without replacement from {o: 1, s: 5, h: 5}. Give prob of sequence shhs. 5/99 Calculate prob of sequence eayy when four letters picked without replacement from ayyaaaeyayeea. 9/715 Four letters picked without replacement from yjjwjkkqwqjk. What is prob of sequence qyqw? 1/2970 Two letters picked without replacement from tetetqkttzkeqttmq. What is prob of sequence kq? 3/136 Calculate prob of sequence nvf when three letters picked without replacement from vfvvvfffnvfnfnv. 18/455 Four letters picked without replacement from uugguuu. Give prob of sequence guuu. 1/7 Calculate prob of sequence iihv when four letters picked without replacement from {h: 3, v: 1, i: 11, e: 1, o: 2}. 11/2448 Two letters picked without replacement from {y: 7, f: 1, b: 1, n: 3, e: 3, t: 3}. Give prob of sequence ny. 7/102 Calculate prob of sequence ette when four letters picked without replacement from {e: 2, t: 5, i: 11, h: 1}. 5/11628 What is prob of sequence gh when two letters picked without replacement from {h: 6, f: 4, g: 2, d: 1, n: 3, a: 3}? 2/57 Four letters picked without replacement from aaaa. Give prob of sequence aaaa. 1 Three letters picked without replacement from odogsgsqoo. Give prob of sequence sdo. 1/90 What is prob of sequence sc when two letters picked without replacement from csacssllso? 4/45 Three letters picked without replacement from aeyeeeweyeyyvyv. What is prob of sequence eey? 5/91 Calculate prob of sequence nf when two letters picked without replacement from efenseesfsfsfneess. 4/153 Four letters picked without replacement from llzflllzzzlzlllnlzl. What is prob of sequence zfll? 55/7752 Calculate prob of sequence qd when two letters picked without replacement from {q: 2, d: 2}. 1/3 Two letters picked without replacement from jeuljejjruueueurejl. Give prob of sequence rr. 1/171 What is prob of sequence rrz when three letters picked without replacement from zzrzzzrrrrzrzrzzzzz? 28/323 Two letters picked without replacement from {a: 1, t: 7, p: 1, b: 4, g: 3, q: 2}. Give prob of sequence tp. 7/306 Three letters picked without replacement from {k: 1, w: 19}. What is prob of sequenc	{ "pile_set_name": "DM Mathematics" }
the power of 1/3, to the nearest integer? 1519 What is 5276256240 to the power of 1/4, to the nearest integer? 270 What is 16370075 to the power of 1/3, to the nearest integer? 254 What is 35399160 to the power of 1/2, to the nearest integer? 5950 What is the third root of 82069722 to the nearest integer? 435 What is the eighth root of 153029050 to the nearest integer? 11 What is the square root of 8622264811 to the nearest integer? 92856 What is 22835793 to the power of 1/8, to the nearest integer? 8 What is 624259217 to the power of 1/2, to the nearest integer? 24985 What is the fifth root of 157065239 to the nearest integer? 44 What is 1038928770 to the power of 1/3, to the nearest integer? 1013 What is the cube root of 810984027 to the nearest integer? 933 What is 2232673767 to the power of 1/3, to the nearest integer? 1307 What is the sixth root of 871128544 to the nearest integer? 31 What is 5240099884 to the power of 1/2, to the nearest integer? 72389 What is 1113186925 to the power of 1/6, to the nearest integer? 32 What is 305058362 to the power of 1/2, to the nearest integer? 17466 What is the third root of 64685841 to the nearest integer? 401 What is 1514293042 to the power of 1/8, to the nearest integer? 14 What is the sixth root of 171984290 to the nearest integer? 24 What is 9304313 to the power of 1/7, to the nearest integer? 10 What is the eighth root of 512871051 to the nearest integer? 12 What is 57410968 to the power of 1/3, to the nearest integer? 386 What is 3991662102 to the power of 1/3, to the nearest integer? 1586 What is the third root of 839175305 to the nearest integer? 943 What is the third root of 29460096 to the nearest integer? 309 What is the third root of 1057798941 to the nearest integer? 1019 What is the square root of 201639164 to the nearest integer? 14200 What is 1219455361 to the power of 1/7, to the nearest integer? 20 What is 5240627108 to the power of 1/6, to the nearest integer? 42 What is the eighth root of 3203147020 to the nearest integer? 15 What is 4320474 to the power of 1/2, to the nearest integer? 2079 What is the square root of 94557153 to the nearest integer? 9724 What is 116732404 to the power of 1/3, to the nearest integer? 489 What is the fifth root of 158567174 to the nearest integer? 44 What is the square root of 45517126 to the nearest integer? 6747 What is 69343677 to the power of 1/2, to the nearest integer? 8327 What is the third root of 63396886 to the nearest integer? 399 What is the tenth root of 67731874 to the nearest integer? 6 What is 865518568 to the power of 1/4, to the nearest integer? 172 What is the seventh root of 347415378 to the nearest integer? 17 What is the square root of 28976456 to the nearest integer? 5383 What is the cube root of 590789639 to the nearest integer? 839 What is the square root of 80229863 to the nearest integer? 8957 What is the third root of 43219619 to the nearest integer? 351 What is the square root of 7107603380 to the nearest integer? 84307 What is the fifth root of 458892380 to the nearest integer? 54 What is 1198152527 to the power of 1/2, to the nearest integer? 34614 What is the third root of 47394581 to the nearest integer? 362 What is 356685526 to the power of 1/3, to the nearest integer? 709 What is the ninth root of 437247026 to the nearest integer? 9 What is the tenth root of 20250001 to the nearest integer? 5 What is 1804546774 to the power of 1/2, to the nearest integer? 42480 What is 189694037 to the power of 1/2, to the nearest integer? 13773 What is 22145507 to the power of 1/3, to the nearest integer? 281 What is the ninth root of 2770058418 to the nearest integer? 11 What is the third root of 290097874 to the nearest integer? 662 What is 34329216 to the power of 1/3, to the nearest integer? 325 What is the sixth root of 339228263 to the nearest integer? 26 What is 98999722 to the power of 1/2, to the nearest integer? 9950 What is 51485784 to the power of 1/2, to the nearest integer? 7175 What is 99484854 to the power of 1/3, to the nearest integer? 463 What is the cube root of 406095233 to the nearest integer? 741 What is 93656059 to the power of 1/6, to the nearest integer? 21 What is 1804069342 to the power of 1/3, to the nearest integer? 1217 What is 1650459668 to the power of 1/5, to the nearest integer? 70 What is the eighth root of 2709360248 to the nearest integer? 15 What is 401409740 to the power of 1/2, to the nearest integer? 20035 What is 71964781 to the power of 1/3, to the nearest integer? 416 What is the square root of 4511932188 to the nearest integer? 67171 What is 538191385 to the power of 1/3, to the nearest integer? 813 What is the third root of 16387262 to the nearest integer? 254 What is 136775169 to the power of 1/2, to the nearest integer? 11695 What is the cube root of 34181289 to the nearest integer? 325 What is 60856739 to the power of 1/3, to the nearest integer? 393 What is 103460182 to the power of 1/2, to the nearest integer? 10172 What is 161975019 to the power of 1/9, to the nearest integer? 8 What is 1720591710 to the power of 1/2, to the nearest integer? 41480 What is the ninth root of 6197208504 to the nearest integer? 12 What is the ninth root of 816320019 to the nearest integer? 10 What is 1318752989 to the power of 1/2, to the nearest integer? 36315 What is 283798525 to the power of 1/4, to the nearest integer? 130 What is 130162471 to the power of 1/2, to the nearest integer? 11409 What is 539122651 to the power of 1/5, to the nearest integer? 56 What is 156066722 to the power of 1/9, to the nearest integer? 8 What is the cube root of 2894901185 to the nearest integer? 1425 What is 4462314 to the power of 1/3, to the nearest integer? 165 What is the third root of 160892244 to the nearest integer? 544 What is the cube root of 354292740 to the nearest integer? 708 What is the square root of 10250449 to the nearest integer? 3202 What is the cube root of 54724685 to the nearest integer? 380 What is the eighth root of 116416120 to the nearest integer? 10 What is 96720262 to the power of 1/2, to the nearest integer? 9835 What is 861811382 to the power of 1/2, to the nearest integer? 29357 What is the square root of 304517700 to the nearest integer? 17450 What is the square root of 54113334 to the nearest integer? 7356 What is the sixth root of 82730033 to the nearest integer? 21 What is the cube root of 622712360 to the nearest integer? 854 What is 363198133 to the power of 1/9, to the nearest integer? 9 What is 20047568 to the power of 1/2, to the nearest integer? 4477 What is the cube root of 274751721 to the nearest integer? 650 What is the square root of 95644173 to the nearest integer? 9780 What is 57390860 to the power of 1/3, to the nearest integer? 386 What is the ninth root of 72086434 to the nearest integer? 7 What is 36816712 to the power of 1/3, to the nearest integer? 333 What is 3734357 to the power of 1/3, to the nearest integer? 155 What is the square root of 578424519 to the nearest integer? 24050 What is 23130190 to the power of 1/10, to the nearest integer? 5 What is the third root of 3328156903 to the nearest integer? 1493 What is the tenth root of 2494566 to the nearest integer? 4 What is 264806558 to the power of 1/3, to the nearest integer? 642 What is the fifth root of 278681603 to the nearest integer? 49 What is 606332164 to the power of 1/2, to the nearest integer? 24624 What is 21233890 to the power of 1/10, to the nearest integer? 5 What is the third root of 229435494 to the nearest integer? 612 What is the cube root of 2753927301 to the nearest integer? 1402 What is 7461667374 to the power of 1/2, to the nearest integer? 86381 What is 11704156 to the power of 1/8, to the nearest integer? 8 What is 3505021470 to the power of 1/8, to the nearest integer? 16 What is 298278300 to the power of 1/3, to the nearest integer? 668 What is the square root of 49823266 to the nearest integer? 7059 What is the cube root of 3813379203 to the nearest integer? 1562 What is the seventh root of 43650 to the nearest integer? 5 What is the ninth root of 580997645 to the nearest integer? 9 What is 31576515 to the power of 1/9, to the nearest integer? 7 What is 4288430 to the powe	{ "pile_set_name": "DM Mathematics" }
e third smallest value? (a) 0.3 (b) -0.7 (c) -0.13 a What is the fourth smallest value in 1/5, 3964, -3, 2? 3964 Which is the third smallest value? (a) -2/19 (b) 0.8 (c) -5.4 (d) 0 d What is the third biggest value in -1, 4, -23/7, 0? -1 Which is the biggest value? (a) 1 (b) -2/7 (c) 2/5 (d) 8 d Which is the smallest value? (a) -8 (b) 3 (c) -0.15 a What is the fourth biggest value in -4, 3/7, -0.3, -0.13? -4 What is the smallest value in 141, -1, -4? -4 Which is the smallest value? (a) -1.7 (b) 5 (c) 3.3 a Which is the fourth smallest value? (a) 0.5 (b) -2 (c) -0.5 (d) -6 a What is the smallest value in 15, 49, -5? -5 What is the second smallest value in -2, -59, 3/4? -2 Which is the smallest value? (a) 0.4 (b) -4 (c) -11 c What is the biggest value in 17, -0.038, 5? 17 What is the third biggest value in -2/9, 33, -5? -5 Which is the fourth smallest value? (a) -12 (b) 0.1 (c) 28 (d) 4 (e) 0.5 d Which is the second biggest value? (a) -2 (b) 2/13 (c) -1/7 (d) 14 b What is the biggest value in -42, -2/7, 1, 5, -1/4? 5 Which is the fifth smallest value? (a) -3 (b) -9 (c) 3 (d) 1 (e) -0.4 c Which is the third smallest value? (a) -5 (b) -4 (c) -4/23 c Which is the second biggest value? (a) 0 (b) -0.2 (c) 3 a What is the third biggest value in -0.3, -0.1, 5, 4? -0.1 What is the second smallest value in -3/8, -299, -3? -3 What is the third biggest value in 0, -3, -1/2, 183, 0.5? 0 What is the second smallest value in 1/5, -0.1, 1, -6? -0.1 What is the second biggest value in 0.1, -4, -0.2, -2/7, 1? 0.1 Which is the third biggest value? (a) 1/2 (b) -2 (c) -0.3 (d) 1/11 c Which is the fourth biggest value? (a) -2/11 (b) 0 (c) -5.6 (d) 5 c What is the third biggest value in -0.03, -5, 7? -5 Which is the second biggest value? (a) -12 (b) -1 (c) 0.2 (d) 28 c What is the second smallest value in 2/7, 4/3, -193/4? 2/7 Which is the second biggest value? (a) 7 (b) -3 (c) -471 (d) 3 d What is the third smallest value in -3, -1, -1/8? -1/8 What is the second biggest value in 11, -2/13, 1/2, 3? 3 What is the second biggest value in -2, 17, -0.2, -0.3? -0.2 Which is the biggest value? (a) 0.5 (b) -4 (c) 194 c Which is the third smallest value? (a) -1 (b) 2/359 (c) 8 c Which is the third smallest value? (a) 1 (b) 2/19 (c) -2.4 (d) -5 (e) -0.4 e Which is the third smallest value? (a) -5 (b) 3 (c) -0.5 (d) -63 c Which is the fourth biggest value? (a) -4/7 (b) 3 (c) -0.5 (d) 0.3 a Which is the third biggest value? (a) -6 (b) -10/9 (c) -0.2 (d) -0.05 b Which is the biggest value? (a) 1.36 (b) 0.1 (c) -0.3 (d) -6 a What is the third biggest value in -2/5, 0.4, -0.3467? -2/5 What is the biggest value in -19, -12, 2? 2 Which is the third smallest value? (a) 0.3 (b) 4 (c) -5 (d) -2 a Which is the second smallest value? (a) 0.4 (b) 1 (c) -2/153 a What is the smallest value in 1.2, 0.203, 5? 0.203 Which is the third smallest value? (a) 68 (b) -0.5 (c) -0.107 (d) 3 d What is the third biggest value in -3, 2/9, 84, 2? 2/9 Which is the third biggest value? (a) 2/411 (b) -10 (c) 2 b What is the third biggest value in 3.93, -0.4, 3/7? -0.4 What is the biggest value in 2/7, 1/7, -4, 4? 4 Which is the biggest value? (a) -2/17 (b) -43 (c) -2/5 a Which is the third biggest value? (a) -319 (b) -0.4 (c) -1/10 a What is the third biggest value in -1/12, 0.4, 10, -4/5? -1/12 Which is the biggest value? (a) 2.2 (b) 1/3 (c) -0.4 a What is the second smallest value in 1/42, 1, 3? 1 Which is the fourth smallest value? (a) -8 (b) 0.5 (c) 3 (d) -0.06 c Which is the third smallest value? (a) 1/7 (b) -2/13 (c) -638 a What is the third smallest value in -1/6, 0.3, -6/109, -0.5? -6/109 What is the smallest value in -0.2, 45, 2/7? -0.2 Which is the fourth smallest value? (a) -6 (b) -0.4 (c) 4 (d) -2/7 (e) -15 d What is the biggest value in 2/11, -19/30, 3/7? 3/7 What is the third biggest value in 5, -73, 0.2? -73 What is the fifth smallest value in 5, -0.2, -1, 0.3, 0? 5 What is the third smallest value in 1.9, -2/3, -0.1, 3, 4? 1.9 Which is the fourth smallest value? (a) 5/2 (b) -1/706 (c) -2/13 (d) 2/7 a What is the third smallest value in 1, 5, 852? 852 What is the third biggest value in -3, -2/3, 0.4? -3 Which is the smallest value? (a) -0.5 (b) -3 (c) 26 b What is the biggest value in -1/2, 0.3, 0.05? 0.3 What is the third smallest value in -7, -3, -0.4, 2? -0.4 Which is the third biggest value? (a) -6 (b) -5 (c) 2/9 (d) -2/11 b Which is the third smallest value? (a) 4 (b) -2 (c) 5/7 a Which is the biggest value? (a) -57 (b) -0.2 (c) -4 b What is the smallest value in -4, -1/49, 3? -4 Which is the smallest value? (a) -1 (b) 0.04 (c) 2/523 a Which is the fifth biggest value? (a) 2 (b) -1/6 (c) -2/9 (d) -0.5 (e) 22 d What is the fourth smallest value in 0.5, -4/5, 5, 83/19? 5 What is the second smallest value in -7, -1/3, 2? -1/3 Which is the third biggest value? (a) 3 (b) 0.1 (c) -31 c Which is the smallest value? (a) -1 (b) 3 (c) -2/7 a What is the second smallest value in 3, 0.3, 1/4, -35? 1/4 What is the second biggest value in 8, -4/87, -5? -4/87 Which is the biggest value? (a) 0 (b) -0.0051 (c) 5 c What is the second biggest value in 1/11, -3, 2, -80, -5/2? 1/11 What is the biggest value in 0.12, 40/13, -0.3, -2/5? 40/13 Which is the third biggest value? (a) 1/5 (b) 2 (c) 1.7 a Which is the second biggest value? (a) 1/5 (b) 0 (c) -3/7 b Which is the second biggest value? (a) 3/7 (b) -5 (c) 0.4 (d) 2/13 (e) -2719 c Which is the second biggest value? (a) 1 (b) -14.86 (c) -0.1 c Which is the fifth biggest value? (a) -0.4 (b) -4 (c) -1 (d) 6 (e) 1/5 b What is the fifth smallest value in -2/9, 0.3, -2, -1/9, 2/11? 0.3 Which is the biggest value? (a) -0.1 (b) 10 (c) -5 (d) 4 (e) -3/4 b What is the fifth smallest value in 0, -0.3, 0.5, 72, -0.2? 72 Which is the third smallest value? (a) -2/3 (b) -5.64 (c) -5 a What is the third smallest value in -16, -0.032, -5, -2, -2/9? -2 What is the fourth biggest value in 1, -2/13, -1/5, -3/7? -3/7 Which is the second biggest value? (a) -6 (b) 0.2 (c) 0.13 (d) 1 b What is the third biggest value in -9, -6, 12? -9 What is the second biggest value in 1/3, -1359, -4/3? -4/3 Which is the fourth biggest value? (a) 2 (b) -2 (c) -2.4 (d) -1/5 c What is the third biggest value in 0, -0.4, -20? -20 Which is the second biggest value? (a) 3/2 (b) -5 (c) 18 (d) 4 (e) 3/7 d Which is the fourth smallest value? (a) 0.6 (b) 5 (c) -2 (d) -4 (e) -1 a What is the biggest value in -5/4, 9/17, -1/4? 9/17 Which is the third smallest value? (a) -2/21 (b) 25 (c) -24 b What is the smallest value in -9, -124, -2/7, -1/3? -124 What is the fourth smallest value in -2, -2/7, 0, -5, -1.43? -2/7 What is the second smallest value in 67, -10/3, 1/4? 1/4 Which is the third smallest value? (a) 2/19 (b) -2/69 (c) -0.3 a What is the third biggest value in -3, 3, 0, 4? 0 What is the fifth biggest value in 4, 1, 0.2, -7, -2/3? -7 Which is the second smallest value? (a) 31 (b) -1 (c) -0.0311 c Which is the third smallest value? (a) 2 (b) 3/8 (c) -4 a What is the fourth smallest value in -5, 3, -1, -1/2, -2/3? -1/2 What is the fourth biggest value in 2/9, 11/3, -2, -2/15? -2 What is the smallest value in -4, 0.0189, 1/6? -4 Which is the second biggest value? (a) 2 (b) -34 (c) -1.2 (d) 4 a What is the second smallest value in -12/11, 1/4, 0.5, 0, -17? -12/11 Which is the second biggest value? (a) 0.1 (b) -2 (c) 11 a Which is the second biggest value? (a) -67 (b) 2/7 (c) -23/4 c What is the third biggest value in -9, 1, -4/3, 9? -4/3 What is the second smallest value in 0.1, 0.26, -1/2, -4? -1/2 Which is the second biggest value? (a) -0.015 (b) 3 (c) -1/8 a Which is the biggest value? (a) 0.4 (b) -15 (c) -12/11 (d) -1/2 a What is the fifth biggest value in 1, -5, -0.2, 4/15, -2/25? -5 Which is the third smallest value? (a) -111 (b) -0.1 (c) 0 c What is the second smallest value in 3, -10, -4, 7? -4 What is the biggest value in 3, -25, -266? 3 Which is the third biggest value? (a) -2 (b) 3/5 (c) -1/2 (d) -15896 a Which is the smallest value? (a) 30 (b) 18 (c) 0	{ "pile_set_name": "DM Mathematics" }
t from {j: 3, g: 5, k: 1, a: 1, n: 2}. Give prob of picking 2 g. 5/33 Calculate prob of picking 1 a and 1 k when two letters picked without replacement from kkakkaaaaakaa. 20/39 Three letters picked without replacement from mvmlrlmrrlrlmmr. What is prob of picking 2 m and 1 r? 10/91 What is prob of picking 1 c and 1 w when two letters picked without replacement from {c: 11, w: 1, q: 7}? 11/171 What is prob of picking 2 e and 1 j when three letters picked without replacement from blnnjlbeerrlnerne? 3/340 Calculate prob of picking 2 b and 1 n when three letters picked without replacement from nnnbnubbbnb. 10/33 Two letters picked without replacement from {m: 2, q: 6, y: 4, v: 6}. What is prob of picking 1 y and 1 q? 8/51 Three letters picked without replacement from wccccccwcc. What is prob of picking 2 c and 1 w? 7/15 What is prob of picking 4 o when four letters picked without replacement from ooddooooooodoo? 30/91 What is prob of picking 1 k and 1 u when two letters picked without replacement from {u: 6, l: 10, n: 2, k: 2}? 6/95 What is prob of picking 1 e and 1 o when two letters picked without replacement from {a: 1, o: 2, e: 1, w: 4, h: 2}? 2/45 Two letters picked without replacement from bdgxp. What is prob of picking 1 g and 1 b? 1/10 Calculate prob of picking 1 i and 1 k when two letters picked without replacement from aikpjajiaaoaiaajp. 3/136 Calculate prob of picking 3 f when three letters picked without replacement from gwwfwfgff. 1/21 What is prob of picking 2 y when two letters picked without replacement from cyccycyc? 3/28 Three letters picked without replacement from alss. What is prob of picking 2 s and 1 a? 1/4 What is prob of picking 1 q and 2 e when three letters picked without replacement from qeqqeqqq? 3/28 Two letters picked without replacement from {r: 2, e: 18}. Give prob of picking 2 r. 1/190 Two letters picked without replacement from {v: 2, y: 1, k: 1, w: 3}. What is prob of picking 2 w? 1/7 Three letters picked without replacement from nnnnnn. Give prob of picking 3 n. 1 Three letters picked without replacement from aaaapaapfaaffaiffff. Give prob of picking 2 p and 1 a. 3/323 What is prob of picking 1 l and 1 q when two letters picked without replacement from qrqlqrlrqrqqbbb? 4/35 Two letters picked without replacement from slsllsppsspppsssppml. Give prob of picking 1 l and 1 m. 2/95 Three letters picked without replacement from {k: 3, z: 17}. What is prob of picking 3 k? 1/1140 Three letters picked without replacement from eeyeeeyeeeeeeeeeeee. What is prob of picking 2 e and 1 y? 16/57 Calculate prob of picking 2 s and 1 y when three letters picked without replacement from syss. 3/4 Two letters picked without replacement from tmmujugumtmo. What is prob of picking 1 u and 1 g? 1/22 Calculate prob of picking 1 h and 1 m when two letters picked without replacement from {x: 3, h: 5, m: 4}. 10/33 Calculate prob of picking 1 x and 2 e when three letters picked without replacement from {g: 1, k: 10, e: 2, x: 1}. 1/364 Two letters picked without replacement from {w: 1, m: 7, f: 5}. What is prob of picking 1 m and 1 w? 7/78 What is prob of picking 2 m and 2 g when four letters picked without replacement from {g: 8, f: 1, y: 3, p: 1, h: 1, m: 2}? 1/65 Two letters picked without replacement from {k: 4, m: 2, p: 3, e: 1}. Give prob of picking 1 k and 1 e. 4/45 Two letters picked without replacement from oloordooolrrodloor. What is prob of picking 1 d and 1 r? 8/153 Four letters picked without replacement from {q: 8, k: 2, r: 4}. Give prob of picking 1 q, 2 k, and 1 r. 32/1001 Calculate prob of picking 1 x and 1 p when two letters picked without replacement from {j: 7, x: 4, p: 1, q: 2, a: 2}. 1/30 Three letters picked without replacement from zwwwwwwwwwwwwzwwwwww. Give prob of picking 2 w and 1 z. 51/190 Three letters picked without replacement from {k: 2, t: 7, n: 1}. Give prob of picking 2 t and 1 k. 7/20 Four letters picked without replacement from {v: 2, n: 1, w: 2}. What is prob of picking 2 w, 1 n, and 1 v? 2/5 Two letters picked without replacement from iiiliiidbisiiisd. Give prob of picking 1 d and 1 s. 1/30 Three letters picked without replacement from {d: 3, j: 2}. Give prob of picking 2 j and 1 d. 3/10 Calculate prob of picking 2 l and 2 a when four letters picked without replacement from {s: 2, o: 4, b: 1, l: 2, a: 3}. 1/165 Four letters picked without replacement from mzhzqhjhnhhmjjj. Give prob of picking 1 z and 3 j. 8/1365 Two letters picked without replacement from stt. Give prob of picking 1 t and 1 s. 2/3 Calculate prob of picking 3 l when three letters picked without replacement from lwrlwrrrlwrrrrlrrrrr. 1/285 Four letters picked without replacement from {m: 10, x: 9}. Give prob of picking 4 x. 21/646 What is prob of picking 1 f and 1 x when two letters picked without replacement from pfxiqqr? 1/21 Four letters picked without replacement from {b: 16, h: 4}. What is prob of picking 1 b and 3 h? 64/4845 Two letters picked without replacement from {z: 9, k: 10}. Give prob of picking 2 z. 4/19 Two letters picked without replacement from {t: 2, h: 2}. Give prob of picking 2 h. 1/6 What is prob of picking 1 z, 1 b, 1 q, and 1 m when four letters picked without replacement from {b: 1, z: 1, r: 1, c: 1, m: 2, q: 1}? 2/35 What is prob of picking 2 v when two letters picked without replacement from {v: 3, k: 1, o: 1}? 3/10 Calculate prob of picking 2 e when two letters picked without replacement from ceeg. 1/6 Calculate prob of picking 3 y and 1 w when four letters picked without replacement from wwyyywhwlltelw. 5/1001 What is prob of picking 2 g and 2 q when four letters picked without replacement from gegqgggqgeg? 7/110 What is prob of picking 3 m when three letters picked without replacement from mmmccmmm? 5/14 Calculate prob of picking 2 t and 1 z when three letters picked without replacement from tuttutuuuzttztu. 6/65 Calculate prob of picking 2 i when two letters picked without replacement from immimimm. 3/28 Three letters picked without replacement from ppppfpfpfpppffppfp. Give prob of picking 3 p. 55/204 What is prob of picking 2 y and 2 w when four letters picked without replacement from yyyyywyyyw? 2/15 Calculate prob of picking 1 m, 1 g, and 1 n when three letters picked without replacement from iginskm. 1/35 Calculate prob of picking 1 z and 2 q when three letters picked without replacement from zzzzqqz. 1/7 Three letters picked without replacement from {y: 9, a: 7, b: 2, u: 1}. What is prob of picking 2 b and 1 u? 1/969 Calculate prob of picking 3 u and 1 j when four letters picked without replacement from ujjjujjujju. 14/165 Calculate prob of picking 1 o and 2 l when three letters picked without replacement from ykkolcwwkkyoklcokkk. 1/323 Four letters picked without replacement from {q: 4, i: 7, u: 2, j: 1}. What is prob of picking 1 j and 3 q? 4/1001 Two letters picked without replacement from xxb. Give prob of picking 1 b and 1 x. 2/3 What is prob of picking 1 c and 2 x when three letters picked without replacement from {x: 7, a: 2, c: 2}? 14/55 Calculate prob of picking 3 a when three letters picked without replacement from {a: 2, q: 2}. 0 Two letters picked without replacement from ncbcnnbcbnnbncc. Give prob of picking 2 n. 1/7 What is prob of picking 3 n when three letters picked without replacement from nnn? 1 Three letters picked without replacement from {d: 5, g: 1, f: 2, k: 2, l: 4}. Give prob of picking 2 l and 1 k. 3/91 Four letters picked without replacement from pjjpjnppphjppojzhoop. Give prob of picking 1 z, 1 o, and 2 h. 1/1615 Three letters picked without replacement from {l: 1, t: 6, r: 6, n: 1, v: 5, f: 1}. What is prob of picking 1 r, 1 l, and 1 v? 1/38 What is prob of picking 3 c and 1 z when four letters picked without replacement from zzcczcz? 4/35 What is prob of picking 2 j and 2 n when four letters picked without replacement from {n: 3, j: 11}? 15/91 Calculate prob of picking 2 p when two letters picked without replacement from bubbbbbbbbpgbbbbuggp. 1/190 Calculate prob of picking 2 k and 2 u when four letters picked without replacement from cccgukccgguccuucggk. 1/646 Calculate prob of picking 3 x and 1 c when four letters picked without replacement from xcxxxxxx. 1/2 What i	{ "pile_set_name": "DM Mathematics" }
3). Let n = -12 + q. Let w = n - 6. Calculate the lowest common multiple of 22 and w. 44 Let d be 6/12(2 - 2). Suppose 3l - 5l + z = -3, 3l - 3z - 12 = d. Let y = 7 - l. What is the lowest common multiple of y and 5? 40 Let r = 602641/630210 - -8/9003. Calculate the common denominator of -66/35 and r. 70 Calculate the common denominator of 3 + 2/3 + (-149)/12 and 4 + (-597)/42 + 2. 28 Suppose -2i = -0i + 2, 4i - 8 = -4f. Let b be 5 - (-2 + 2 - 1). Let x = b - f. Calculate the smallest common multiple of 3 and x. 3 Let t(u) = -u + 12. Let f be t(15). Calculate the lowest common multiple of 9 and (-5 - f)/((-2)/3). 9 Let l be (-15)/6898/8. Let k = -275 - l. Calculate the common denominator of k and 326/(-56) - (-9 - 59/(-7)). 8 Let m be 36/2 - 2(0 + -1). What is the common denominator of (0 + m/15)(-67)/(-12) and 62/9? 9 Let n be 0 - (3 - (0 - -3)). Suppose j = -nj + 5. Calculate the smallest common multiple of 2 and j. 10 Let z be -4 + (-4 - -12) + 1 + -11. Calculate the smallest common multiple of 5 and (-6)/(-3) - z - 4. 20 Let v = 28631 - 28604. Calculate the lowest common multiple of -1 + 1 + (5 - -1) and v. 54 Suppose 0 = 2z - z + 279. Let m = z - -829/3. Calculate the common denominator of m and 9/7. 21 Let w = -3313 + 33159/10. Find the common denominator of 41/56 and w. 280 Let g(q) = -11q + 87. Calculate the lowest common multiple of 30 and g(6). 210 Let i(m) = 39m*2 + 13m - 5. Let x(p) = 10p2 + 3p - 1. Let o(s) = -2i(s) + 9x(s). What is the smallest common multiple of o(-1) and 10? 60 Suppose -s + 2v + 1321 = -102, 0 = -s + 3v + 1418. Suppose 0 = -5f + s + 1282. Let b = 9715/18 - f. Find the common denominator of -121/12 and b. 36 Let u(q) = -2q + 6. Let v be u(-6). Let l = 0 + v. What is the least common multiple of 284/l + 12/54 and 22? 176 Suppose -5 = 5n - 20. Let q = -118 - -120. Suppose 2g = -2g - w + 60, qg - nw - 16 = 0. What is the lowest common multiple of g and 22? 154 What is the common denominator of -13/21 and (-1216)/4752 + 2/11? 189 Let w = -1314 - -1317. Calculate the least common multiple of w and 1. 3 Calculate the common denominator of 83/8 and ((-573)/(-12) - -3)(-60)/(-490). 56 Suppose 2w - 4w - 96 = 0. Find the common denominator of (5 + 69/(-12))26/5 and (-908)/w + (-1)/4. 30 Let z = 136 - 2259/16. Find the common denominator of z and 3/4. 16 Calculate the least common multiple of (32/(-72))/(((-28)/63)/4) and 19/2 + 1/2. 20 Suppose -9 = -r + 8. Calculate the lowest common multiple of -16 + r - (1 + -4) and 10. 20 Let v = 187 - 174. Suppose -vy + 76 + 2 = 0. Suppose x - 3x = -b - 5, 10 = 2b + x. What is the least common multiple of y and b? 6 Suppose -r - 594 = -5h, -2h + 9r + 239 = 10r. Suppose -117x - 68 = -hx. What is the lowest common multiple of x and 20? 340 Let w = -52442/885 + 898/15. Let m = -4194902/5605 + 14148/19. Let n = m - w. Find the common denominator of 9/4 and n. 20 Let x = -13 - 7. Let r = 0 - x. What is the common denominator of 1 + r/(-24) + -12 and 51/11? 66 Calculate the common denominator of 23530/(-3276) - (-2)/18 and ((-3)/8)/((-3)/27). 56 Let k(c) = -5c + 41. Let v be k(7). Suppose -d - v = -4d. Calculate the least common multiple of d and 5(-5)/((-50)/12). 6 Let w be -27 + (0 - 0/2). Let j be ((-1002)/w)/((-16)/(-12)). Let l = j + -499/21. Calculate the common denominator of l and -83/10. 70 Let o = 7 - 5. Let c be o - 2/3-3. Suppose 49 + 31 = cs. Calculate the smallest common multiple of s and 12. 60 Let t = -202 + 209. Calculate the least common multiple of t and 32. 224 Suppose -2 = -b + 34. What is the lowest common multiple of 30 and b? 180 Suppose 2y - 63 = -4u - y, -4y + 4 = 0. Suppose 2a = 5p - a - 125, 3a = -u. Calculate the lowest common multiple of 20 and p. 220 Find the common denominator of -79/20 and ((-16)/1520)/(((-1)/61)/(-1)). 380 Suppose 19 = -2r + 13, -5n = 3r - 2441. Calculate the least common multiple of 50 and n. 2450 Suppose -199 + 23 = -4h. Suppose -o - o + h = 0. Suppose 3k - 2q = 2, 0 = 4k - 0k - q - 11. Calculate the least common multiple of k and o. 44 Let t = -26 - -17. Let g(k) = -k2 - 9k + 2. Let n be g(t). Find the common denominator of -31/5 and (-26)/(-91)22/n. 35 Let r = -75 + 86. What is the least common multiple of r and 34? 374 Let k be (-28898)/(-10) + 1/5. Let z = -17287/6 + k. Let u = -2131/5 + 17253/40. What is the common denominator of z and u? 24 Let o = -1003/2 + 492. Calculate the common denominator of o and (-182)/3(-13)/156. 18 Let m(d) = -3d - 6 + 3d + 3d. Suppose 4b = 4y - 16, -14b - 4 = -y - 11b. What is the smallest common multiple of y and m(6)? 12 Suppose -3t = -3g, 20 = -3t + 8. What is the smallest common multiple of 9 and 1 + -4 + (-36)/g? 18 Calculate the common denominator of -51/10 and (-33)/(2970/84) - -22. 30 Let m = 119/3 + -155/6. Let d = -123/38 - -679/380. Calculate the common denominator of m and d. 60 Suppose p - 30 = -33. Let f(h) = -h2 - 8h - 11. What is the smallest common multiple of f(p) and 29? 116 Let z = 19 - 28. Let g be 0/z - (-18)/(-1). Find the common denominator of 3/(-72)(-264)/g and -79/16. 144 Let k = -19/16936 + -58937147/118552. Let v = k + 492. Find the common denominator of v and -16/3. 21 Suppose 16 = -4m, 0m - 2m - 26 = -3x. Let z(f) = 2f - 25. Let b be z(16). Suppose bw - 18 = xw. What is the least common multiple of w and 4? 36 Suppose 2c - 54 = 22. Let p = -30 + c. What is the lowest common multiple of p and 3? 24 Let f(q) = 2q - 7. Let p be f(5). Suppose -pi + i + 2 = 0. Suppose 0 = -17w + 72 + 30. What is the smallest common multiple of w and i? 6 Suppose 3v - 156071 = -23768. Let f be 2/9 + v/15498. Let a = 4/1107 + f. Find the common denominator of a and 77/20. 140 Let h = 485177/24 - 20220. Calculate the common denominator of -77/4 and h. 24 Let v = 73 - 123. Calculate the common denominator of 99/32 and (2/(-12))/(v/(-275)). 96 Let b = -1497 - -49430/33. Find the common denominator of 115/198 and b. 198 Let s = 36647/73764 + 17/1366. What is the common denominator of 65/18 and s? 108 Let t(j) = j + 8. Suppose 55 = 4n - 2c - 45, -15 = -n - 2c. Suppose -4 - 21 = 5f, 0 = -v + f + n. What is the smallest common multiple of t(0) and v? 72 Let g be 132/(-49/(-96)). Let a = -2821/8 + g. Calculate the common denominator of a and (118/(-12))/((-12)/(-8)). 72 Let k = 1378 + -6849/5. What is the common denominator of 83/34 and k? 170 Suppose -48 = -3i + i. Let r = -2546 - -2561. Calculate the lowest common multiple of i and r. 120 Let n = -3892123/604 + 25775/4. Calculate the common denominator of n and -11/14. 2114 Let q(r) = -r3 - 2r*2 + 3r - 12. Suppose 2z + 3o + 6 = 28, 40 = 4z + 5o. Calculate the smallest common multiple of z and q(-4). 40 Let y = 232 - 183. What is the smallest common multiple of 49 and y? 49 Suppose 24c - 20c = 64. Calculate the lowest common multiple of c and 100. 400 Suppose 49r + 84 = 53r. What is the least common multiple of 81 and r? 567 Let z = 67243471/540 + -124525. Find the common denominator of z and 23/20. 540 Let k = 340423/1713936 + 4/5101. What is the common denominator of k and -57/616? 3696 Let y = 226 - 1134/5. Let g = -200 + 1798/9. Find the common denominator of g and y. 45 Let i = 545 - 539. What is the least common multiple of 13 and i? 78 Let r = 21760/172679 + -43/359. Let v = -16859/3848 + r. What is the common denominator of v and -39/4? 8 Let c be (1/1 - 3) + (24 - -10). Calculate the common denominator of ((-92)/c - -2)12 and (-30)/(-39) + 0 + -1. 26 Let f = 118501/28 + -4229. What is the common denominator of f and 15/182? 364 Suppose 0 = -3b + 4h + 128, -5b - 4h + 195 = -7h. Let a = -24 + b. What is the smallest common multiple of 4 and a? 12 Let a = -21897661759/2156 + 789217144/77. Let j = -92957 + a. Let p = j - -5/147. Find the common denominator of p and 97/6. 12 Calculate the common denominator of -75/14 and (-2216)/224 - 35/(-20). 14 Suppose 2b - 3x = 78, -5x = 6b - 10b + 154. Calculate the smallest common multiple of 24 and b. 72 Suppose 21g - 205 - 1265 = 0. Let w(d) = -5d - 14. Calculate the least common multiple of g and w(-4). 210 Let n be 0/(1/((-1)/2)). Suppose 7c - 3*c + 8 = n. What is the lowest	{ "pile_set_name": "DM Mathematics" }
ext in -794, -799, -804, -809, -814, -819? -824 What is the next term in 9, 36, 81, 150, 249, 384? 561 What is the next term in -2398, -4797, -7196, -9595, -11994, -14393? -16792 What comes next: 128, 261, 394, 527, 660, 793? 926 What is the next term in -1515, -3036, -4557, -6078, -7599, -9120? -10641 What is the next term in 23, 30, 51, 92, 159, 258, 395, 576? 807 What is next in 879, 1771, 2677, 3603, 4555? 5539 What is next in -3, -14, -31, -54? -83 What comes next: -1, 8, 17, 26, 35? 44 What is the next term in 265, 268, 271, 274, 277? 280 What comes next: 181, 360, 539, 718, 897, 1076? 1255 What is next in -6066, -6051, -6010, -5931, -5802, -5611, -5346, -4995? -4546 What is next in -198, -191, -178, -159, -134? -103 What is next in -8, -51, -124, -227, -360? -523 What is next in -11, 1, 15, 25, 25, 9, -29, -95? -195 What is next in -148, -245, -342, -439, -536, -633? -730 What is the next term in 419, 416, 411, 404, 395? 384 What comes next: 74, 177, 280, 383? 486 What is the next term in -330, -347, -398, -501, -674, -935, -1302, -1793? -2426 What is next in -26, -88, -148, -206? -262 What comes next: 79, 84, 91, 100, 111, 124, 139? 156 What comes next: 26, 284, 1000, 2408, 4742, 8236? 13124 What is the next term in 47, 84, 117, 146, 171, 192, 209? 222 What is the next term in -17600, -17599, -17598, -17597, -17596, -17595? -17594 What is the next term in -3604, -7206, -10810, -14416? -18024 What is the next term in -1345, -1345, -1355, -1381, -1429, -1505, -1615, -1765? -1961 What comes next: -71, -104, -137, -170, -203? -236 What comes next: -29, -20, 11, 76, 187, 356? 595 What is next in 432, 869, 1306, 1743? 2180 What is the next term in 52, 222, 500, 880, 1356? 1922 What comes next: -5485, -5489, -5495, -5503, -5513, -5525? -5539 What is next in -46, -141, -394, -883, -1686, -2881, -4546? -6759 What is the next term in 246, 502, 922, 1500, 2230, 3106, 4122, 5272? 6550 What comes next: 859, 829, 797, 763, 727? 689 What comes next: 12, 1, -10? -21 What is next in 149, 145, 141, 137? 133 What comes next: -32, -44, -36, -8, 40, 108, 196? 304 What is the next term in 61, 156, 251, 346, 441? 536 What is the next term in -248, -254, -260, -266? -272 What is next in -276, -1107, -2494, -4437, -6936? -9991 What is the next term in -28, -36, -48, -64, -84? -108 What comes next: 248, 242, 226, 194, 140, 58, -58, -214? -416 What is next in 25, 24, 23, 22? 21 What comes next: -1496, -2990, -4484, -5978, -7472? -8966 What is the next term in 698, 1386, 2086, 2804, 3546, 4318, 5126, 5976? 6874 What is the next term in -79, -180, -281, -382, -483? -584 What is next in 396, 387, 378, 369, 360, 351? 342 What is next in 48, 58, 68, 78, 88? 98 What is next in 1503, 1495, 1475, 1437, 1375, 1283? 1155 What comes next: -61, -54, -43, -28? -9 What comes next: -734, -734, -736, -740? -746 What is next in 3, 8, 21, 48, 95, 168? 273 What is next in 46, 53, 76, 115, 170? 241 What is next in 1235, 1251, 1267, 1283? 1299 What comes next: 1, 20, 73, 178, 353, 616, 985, 1478? 2113 What is the next term in -1662, -3316, -4966, -6612? -8254 What is the next term in 22, 17, 12? 7 What is next in 87, 360, 815, 1452? 2271 What is next in -431, -861, -1291, -1721? -2151 What is the next term in 0, 23, 46, 69? 92 What comes next: 29, 38, 49, 62, 77, 94, 113? 134 What is next in -430, -852, -1274, -1696, -2118? -2540 What is next in -1405, -1401, -1397? -1393 What is next in 2, 57, 158, 311, 522? 797 What comes next: -2, -1, 8, 31, 74, 143, 244? 383 What comes next: -2691, -2693, -2695, -2697? -2699 What comes next: 113, 459, 1027, 1811, 2805, 4003, 5399? 6987 What comes next: -1182, -2357, -3530, -4701, -5870? -7037 What is the next term in 45308, 45314, 45334, 45374, 45440, 45538, 45674? 45854 What is next in 2013, 4025, 6037? 8049 What is the next term in 8, 39, 90, 161, 252, 363? 494 What is the next term in -4, -33, -86, -169, -288, -449? -658 What is next in -20, -5, 36, 115, 244, 435? 700 What is next in -52, -54, -58, -64, -72? -82 What comes next: -697, -699, -701, -703, -705? -707 What comes next: -1547, -1541, -1531, -1517? -1499 What comes next: 14, 15, 14, 11, 6, -1? -10 What is next in -433, -875, -1317, -1759? -2201 What is the next term in 16167, 16172, 16181, 16194, 16211? 16232 What is next in 12, 50, 106, 180, 272, 382? 510 What comes next: 1, -80, -229, -452, -755, -1144, -1625? -2204 What is next in 32, 76, 106, 122? 124 What comes next: -60, -65, -70? -75 What is next in -23, -19, -15, -11? -7 What is next in 39, 53, 83, 135, 215, 329? 483 What is the next term in 3, -21, -91, -231, -465, -817, -1311? -1971 What comes next: -82, -147, -212, -277? -342 What is the next term in 10, 13, 28, 61, 118, 205? 328 What is the next term in 18, 4, -10? -24 What is the next term in -215, -227, -251, -293, -359, -455, -587? -761 What is next in -21, -5, 27, 81, 163, 279, 435, 637? 891 What is the next term in -89, -155, -213, -257, -281, -279? -245 What is the next term in -137, -343, -559, -791, -1045, -1327, -1643, -1999? -2401 What is next in 64, 72, 80, 88, 96? 104 What comes next: -425, -427, -429, -431, -433, -435? -437 What is the next term in -15, -2, 11, 18, 13, -10, -57, -134? -247 What is the next term in 26, -22, -108, -250, -466, -774, -1192, -1738? -2430 What is the next term in -12, 0, 32, 96, 204, 368? 600 What is next in 371, 720, 1059, 1382, 1683, 1956, 2195? 2394 What comes next: -2091, -2096, -2111, -2142, -2195? -2276 What comes next: -91, -287, -585, -985? -1487 What comes next: 34, 105, 224, 391, 606? 869 What comes next: 1, 20, 71, 166, 317? 536 What is next in -8, -35, -76, -137, -224, -343? -500 What is next in -187, -428, -671, -916, -1163, -1412? -1663 What comes next: -123, -759, -1811, -3273, -5139? -7403 What comes next: -28, -73, -136, -217? -316 What comes next: -230, -234, -248, -278, -330, -410, -524? -678 What comes next: 57, 42, 29, 24, 33? 62 What is next in 968, 967, 966, 965? 964 What is next in -8703, -8699, -8693, -8685? -8675 What is next in 27, 101, 221, 387, 599, 857, 1161? 1511 What is the next term in 1377, 2750, 4123, 5496, 6869? 8242 What is next in -1963, -1967, -1983, -2017, -2075, -2163, -2287, -2453? -2667 What is the next term in 52, 232, 532, 952? 1492 What is next in 31, 69, 119, 187, 279, 401? 559 What comes next: -26, -10, 4, 16, 26, 34? 40 What comes next: -1, 2, 9, 20? 35 What comes next: 109, 110, 127, 166, 233, 334? 475 What is the next term in -160, -163, -154, -127, -76? 5 What is next in 9, 19, 17, -3, -47, -121? -231 What comes next: 67, 133, 199, 265? 331 What is next in -422, -414, -392, -350, -282, -182, -44? 138 What comes next: -8839, -17679, -26519? -35359 What is next in 94, 91, 88, 85, 82? 79 What is next in 1, 2, 3, 4, 5? 6 What is next in 28, 42, 56, 70, 84, 98? 112 What is next in 190, 183, 176? 169 What comes next: 70, 281, 642, 1159, 1838, 2685, 3706? 4907 What comes next: 73, 138, 203, 268, 333, 398? 463 What is the next term in 477, 484, 495, 510, 529? 552 What comes next: -16, -17, -18, -19? -20 What is next in -8, 0, 18, 46? 84 What comes next: 215, 864, 1945, 3458, 5403, 7780, 10589? 13830 What is next in 7, -42, -123, -236, -381? -558 What is the next term in 43, 163, 363, 643, 1003, 1443? 1963 What comes next: -23302, -23298, -23292, -23284? -23274 What is the next term in -935, -937, -941, -947, -955? -965 What is next in -7, -13, -23, -37, -55, -77, -103? -133 What is next in 55, 69, 73, 61, 27? -35 What is next in -64, -123, -180, -235, -288, -339? -388 What is next in -10, 17, 60, 125, 218, 345, 512? 725 What comes next: -108, -116, -124? -132 What is next in 68, 408, 990, 1826, 2928, 4308, 5978? 7950 What comes next: 146, 290, 426, 554, 674, 786? 890 What is the next term in -12, -53, -128, -243, -404? -617 What is next in -94, -270, -746, -1672, -3198, -5474, -8650, -12876? -18302 What is next in -78, -92, -106, -120, -134, -148? -162 What is next in 406, 395, 370, 325, 254? 151 What is next in -477, -959, -1443, -1929, -2417? -2907 What comes next: 3, -8, -27, -54? -89 What is the next term in -46, -15, 36, 107, 198, 309? 440 What is next in 16, 22, 42, 82, 148, 246, 382? 562 What comes next: 18, 18, 8, -18, -66, -142? -252 What is next in 8039, 8022, 7991, 7940, 7	{ "pile_set_name": "DM Mathematics" }
t m(d) = 4n(d) - 5p(d). Give m(y(j)). 84j Let d(v) be the second derivative of -v4/6 - v2 - 3v. Let s(o) be the first derivative of d(o). Let t(g) = -g + g + g*2. Give s(t(f)). -4f*2 Let k(v) = -2v. Let w(z) be the second derivative of 0 + 3z - 2/3z*3 + 0z*2. Give k(w(g)). 8g Let y(s) be the third derivative of s*2 + 0s + 0 + 0s3 + 1/24s*4. Let g(p) be the first derivative of 2p*3/3 + 1. Give g(y(r)). 2r*2 Let b(x) = 4x*2. Let g(n) be the third derivative of -5n*4/24 + 6n*2. Calculate g(b(s)). -20s*2 Let z(l) = -5l*2 + 3l*2 - 3l*2. Let v(s) = -4s. Let a(y) = 3y. Let b(k) = -3a(k) - 2v(k). What is z(b(w))? -5w*2 Let h(c) = 4c2. Let y(l) = l3 + 4l2 + 3l + 2. Let o = 2 + -5. Let a be y(o). Let m(s) = -4 + a + s*2 + 2. Determine h(m(x)). 4x4 Let p(f) be the first derivative of -f2 - 1. Let a(s) = 1075 - 2s2 - 1075. Calculate a(p(n)). -8n*2 Let f(k) = -k. Let w(s) = -6s. Let z(l) = -8f(l) + w(l). Let b(t) = -18t*2. Calculate z(b(a)). -36a*2 Let k(x) = -35x*2. Let z(v) = -5v*2. Calculate z(k(h)). -6125h4 Let v(q) be the third derivative of q4/12 - 2q2. Let k(h) be the second derivative of 0h*2 - 3h + 0 - 1/3h3. Give v(k(s)). -4s Let z(a) be the first derivative of -1/2a2 - 1 + 0a. Let s(y) = -170 - y + 170. Determine z(s(o)). o Let l(t) = 2t. Suppose -r = 4r + 5. Let m(q) = -q*2 + q - 1. Let o(j) = -7j*2 + 6j - 6. Let z(p) = ro(p) + 6m(p). Determine z(l(d)). 4d2 Let i(f) be the second derivative of -5f*3/6 - 3f. Let m(t) = 2t2. Calculate i(m(h)). -10h*2 Let a(f) be the second derivative of 0f*2 - 1/2f*4 + 0 - 3f + 0f3. Let c(m) = m. Calculate c(a(z)). -6z*2 Let q(x) = -x. Let f(k) = 17k - 107. What is q(f(b))? -17b + 107 Let c(q) = 7q*2 - 49. Let i(x) = 2x*2. Calculate c(i(n)). 28n*4 - 49 Let k be 70/7 - 6/2. Let g(l) = -2l + k - 7. Let z(i) = -i. Calculate z(g(t)). 2t Let q(w) be the third derivative of 3w*2 + 0w*3 + 0w + 0 + 0w4 + 1/20w*5. Let l(g) = -2g - g + 4g. What is l(q(z))? 3z*2 Let f(k) = -2k. Suppose -10 = 4y - 6y. Suppose 2b + 2 = 8. Let l(c) = bc + 0c - yc. Calculate f(l(u)). 4u Let b(k) = k - 2k + 5k. Let z(r) = 5r*2 - 7r - 7. Let n(y) = -3y2 + 4y + 4. Let v(x) = 7n(x) + 4z(x). Give b(v(p)). -4p2 Let f(q) = 9 + q2 - 9. Let m(h) = -4h. Calculate f(m(l)). 16l2 Let n(p) = 2p*2. Let j(z) = -3z*2. Let t(v) = -v. Let c(y) = -12y*2 - 16y. Let h(l) = c(l) - 16t(l). Let d(b) = -2h(b) + 9j(b). Calculate n(d(k)). 18k*4 Let h(f) = 2f. Let j(n) be the first derivative of 13n2/2 - 10. Determine h(j(u)). 26u Let y(w) = -17w - 2. Let t(v) = 30v. Calculate y(t(j)). -510j - 2 Let a(x) = 4x. Let z(g) = g + 7. Let u be z(-6). Let l(i) = 4 - 3 - u + i. Give a(l(k)). 4k Let q(h) be the first derivative of h4/12 + 2h - 1. Let l(w) be the first derivative of q(w). Let n(o) = o2. Determine n(l(f)). f4 Let j(g) = 0g2 + g2 + 0g2. Let v(h) be the second derivative of h4/12 + 9h. Determine j(v(t)). t4 Let b(l) = 16l + 1. Let g(s) = 14s - 1. Calculate b(g(x)). 224x - 15 Let w(z) = 11z2 - 6. Let r(h) = 10h*2 - 5. Let a(n) = 6r(n) - 5w(n). Let x be (0 + 2/(-1))/(-1). Let m(c) = -xc + 0c + 3c. Determine a(m(u)). 5u2 Let u(b) = -3b*2. Let z(p) = 1082p. Determine z(u(h)). -3246h2 Let x(w) = 7w + 5. Let g(l) = l + 12. Let h be g(-9). Let a(m) = 4m + 3. Let q(r) = hx(r) - 5a(r). Let j(s) = 5s. Determine j(q(t)). 5t Let v(p) = p2. Let u(x) = 3x - 3x - 3x + 2x. What is v(u(s))? s2 Let c(p) = 5p*2 - 4. Let z = 7 + -12. Let l(k) = -6k*2 + 5. Let s(r) = zc(r) - 4l(r). Let a(u) = 2 + 6u*2 - 2. Determine a(s(b)). 6b*4 Let f(y) = -6y + 10. Let t(h) = 2h - 3. Let o(m) = 3f(m) + 10t(m). Let v(r) = -30r. Calculate v(o(w)). -60w Let z(a) = -a. Let w(h) be the third derivative of 4h*2 + 0h + 0h3 + 1/12h*4 + 0. Calculate z(w(x)). -2x Let c(f) be the second derivative of f*3/3 - 15f. Let q(d) = d. Give q(c(t)). 2t Let z(k) = -k2. Let l(b) = 3430b. Calculate z(l(i)). -11764900i2 Let t(y) = -3y. Let g(c) = -4c - 2. Let i be g(2). Let n be (-6)/15 - 24/i. Let f(r) = -2r*n + 4r*2 + 0r*2. Give f(t(q)). 18q*2 Let i = -44 + 78. Let u(z) = 1 + iz - 1 - 35z. Let j(t) = -4t*2. Determine u(j(n)). 4n*2 Let n(k) = 2k*2. Let v(d) = -3729d. Determine v(n(q)). -7458q2 Let x(c) be the second derivative of -c3/6 - 9c. Let a(i) = 7i2. Calculate a(x(d)). 7d*2 Let p(y) = -44y - 56. Let q(j) = 8j + 10. Let s(z) = -5p(z) - 28q(z). Let o(t) = 10t. What is o(s(k))? -40k Let v(p) = p2. Let f = 6 - 5. Let n(b) = b + 1. Let d(m) = 2m*2 - 6m - 6. Let o(z) = fd(z) + 6n(z). Determine v(o(y)). 4y4 Let c(m) be the first derivative of -20m*3/3 + 13. Let z(d) = 2d*2. Give c(z(s)). -80s*4 Suppose -8 + 3 = 5h - 4j, -5j + 40 = 5h. Let a(i) = 2i*2 + hi - 3i - i2. Let q(m) = -2m. Determine q(a(z)). -2z2 Let o(s) be the first derivative of 11 + 0s*2 + 1/3s*3 + 0s. Let d(m) = 10m. Let l(g) = -21g. Let b(t) = 13d(t) + 6l(t). Determine o(b(j)). 16j2 Let m(l) = -5l. Let h(f) = 2f3 - 4f*2 + 3f - 1. Let s be h(2). Let p(c) = sc - 3c - 3c. Determine m(p(g)). 5g Suppose 0 = -0p - 3p + 18. Let j(i) = -4i - pi - 4 + 4. Let c(k) = k. Determine c(j(u)). -10u Let j(t) = -t2. Let y(s) be the second derivative of -5/6s*3 + 0 + 0s*2 + s. Calculate j(y(g)). -25g*2 Let g(r) = -2r*2. Let x(w) = -143w - 2. Calculate x(g(f)). 286f2 - 2 Let q(f) = f2. Let v(d) be the first derivative of -2d*3/3 + 10. Give q(v(w)). 4w*4 Let o(p) = 4p + p - 3p - 3p. Let m(d) be the third derivative of d5/30 + d2. What is m(o(i))? 2i2 Let n(l) = -l2. Let r = -10 - -13. Let h(t) = -4t - 2t + rt. Determine h(n(b)). 3b2 Let b(j) = 2j + 78. Let m(f) = 2f2 - 68. What is m(b(o))? 8o*2 + 624o + 12100 Let y(s) = 3s2. Let k(f) = f - 2. Let d(x) = 4x - 9. Suppose -3w - 4r + 10 = 0, -4w + 5r = -2 - 1. Let u(q) = wd(q) - 9k(q). Calculate u(y(b)). -3b2 Let j(m) = 6m. Let a(l) = -l + 2. Let u(s) = 5 + s - s - 3s. Let o(r) = 5a(r) - 2u(r). Determine o(j(q)). 6q Suppose 2y + 2y - 8 = 0. Let g(r) = -19 + 19 + yr. Let t(q) = 17q. What is t(g(u))? 34u Let w(r) = r. Let b(z) be the second derivative of 13z*4/12 - 13z. Give w(b(j)). 13j2 Let y(k) be the third derivative of -k5/120 - k3 + 2k*2. Let q(s) be the first derivative of y(s). Let v(o) = 3o. Give v(q(b)). -3b Let g(v) = -5v + 7. Let s(i) be the third derivative of -i4/12 + i3/2 - 3i2. Let d(r) = 3g(r) - 7s(r). Let j(w) = w2. Determine d(j(q)). -q2 Let j(c) be the first derivative of -35c*2/2 - 8. Let l(z) = -2z*2. What is j(l(v))? 70v*2 Let u(i) = -3i. Let v(b) = 266b. Calculate v(u(z)). -798z Let u(a) be the first derivative of -a*2 - 1. Let p be (1 - 1)/((-12)/6). Let i(g) = -g + g - 4g + pg. Determine i(u(h)). 8h Let w(o) be the first derivative of -o2/2 - 3. Let x(l) be the third derivative of l5/60 + 11l2. Determine w(x(k)). -k2 Let x(n) be the first derivative of -n4/12 + n2/2 - 1. Let b(d) be the second derivative of x(d). Let r(p) = -4p*2. Give r(b(a)). -16a*2 Let s(x) = -4 + 4 - 13x + 0x. Let z(y) = -y2. What is z(s(w))? -169w*2 Let o(l) = -6l*2 + 2l. Let m(g) = -g. What is m(o(q))? 6q2 - 2q Let w(g) = -3g. Let c(l) = -21l*2. Calculate c(w(x)). -189x*2 Let l = 15 - 13. Let a(r) = r + lr - 7r. Let q(p) = 3p*2. What is q(a(m))? 48m*2 Let w(u) = -2u*2. Let t(m) be the third derivative of -7m*5/30 - 2m*2 - 3. What is t(w(v))? -56v*4 Let n(d) = -d. Let c(j) = 24j. Let f(p) = c(p) + 20n(p). Let x(z) = -2z*2. What is f(x(u))? -8u*2 Let g(m) = -2m. Let h(r) = -r*2 - r. Let o(z) = -z. Let f(b) = 3h(b) - 3o(b). Calculate g(f(k)). 6k2 Let z(d) be the second derivative of d4/12 + 3d. Let y(o) = 15o. Give z(y(f)). 225f2 Let q(p) = 111p*2. Let w(f) = -7f*2. What is q(w(j))? 5439j4 Let a(h) be the third derivative of -h5/20 + 6h2. Let k(d) = -6d*2. Calculate k(a(l)). -54l4 Let b(l) = l2. Let i(d) = 2d2. Let a(p) = -13b(p) + 6i(p). Let r(v) = 13v - 13*v +	{ "pile_set_name": "DM Mathematics" }
r m. -2 Solve 0 = -5x + p - 31, -48p + 101 = -16x - 43p for x. -6 Solve 0 = 4j - 2i - 12, j + 22685i - 22690i + 6 = 0 for j. 4 Solve 0 = 2l - 8, 5l + 101 = 4f + 129 for f. -2 Solve -3g - 4p = -35, -3g - 2p + 25 = -0g for g. 5 Solve 0 = -10d + 20d - 2f - 16, 0 = 2f + 6 for d. 1 Solve 2s - 4 = 3g, 105s = 107s - 5g + 4 for s. 8 Solve 0 = -4m - 3q - 50, 5m - 2q = 7 - 58 for m. -11 Solve -5j - 20 = 0, -42o + 38o - j = 4 for o. 0 Solve 5c = 5n + 160, n = -8c + 5c + 92 for n. -1 Solve 10k + 4k + 9 = -z + 10k, -7k - 22 = 3z for z. -5 Solve -5y - 24 = -3a, 5y = -3a - 2584 + 2578 for a. 3 Solve 4s + 2o = 26, -5s + 62 = o + 40 for s. 3 Solve 5b = -5m - 5, -b + 5m + 2454 - 2425 = 0 for b. 4 Solve 2i + 10 = 0, 8897i + 21 = -4h + 8900i for h. -9 Solve -5b - 30 = 0, -11q - b - 4 = -5q - 8q for q. -1 Solve 0 = -5i - 939v + 940v - 1, -3v = i + 13 for i. -1 Solve -131h + 135h + 5j = -9, 4j = -15h + 40 for h. 4 Solve 3m - 2y + 125 = 132, 4m - 5y = 14 for m. 1 Solve 12400n + 13 = 12405n + g, -2n + 29 = -3g for n. 4 Solve u - 4z + 72 = 91, 5u + 2z - 7 = 0 for u. 3 Solve 5y - g - 82 = -95, 3y + g + 11 = 0 for y. -3 Solve -15 = -5m, -2z + 165 - 138 = 5m for z. 6 Solve 3c = 7t + 31, -3c = -3t + 381 - 396 for c. 1 Solve -1547l + 12 = -4v - 1550l, -2l = -2v - 6 for v. -3 Solve 3a - 329 + 282 = 4v, -2a + 4v = -42 for a. 5 Solve -11f = 3l - 221, -850l + 853l - 69 = -3f for f. 19 Solve -4u = -45002v + 45007v - 33, 0 = -5u - 3v + 25 for u. 2 Solve r = n - 299 + 285, -2n + 22r + 348 = 0 for n. -2 Solve -k - 3358 = -2p + 5p - 3366, 0 = 4k - 2p + 10 for k. -1 Solve -5y - 507h + 511h + 8 = 0, -4h = 5y - 32 for y. 4 Solve 5l + 317 - 320 = 3k, -5l = -2k - 7 for k. 4 Solve -i = -2f - 11, 47i - 17 = 5f + 46i for f. -2 Solve 5d = y - 27, d = -1067y + 1067y - 4 for y. 7 Solve -3d - 394c = -393c - 2, -2d - 4 = -2c for d. 0 Solve -4v - 1233c + 1230c + 3 = 0, -2v = 2c for v. 3 Solve 26 = -5h + 3h, -18m - 4h = -13m + 67 for m. -3 Solve 2j = -g + 10, -28j = -27j - 5 for g. 0 Solve 4i = 4p - 8, -12p + 16p = -12 for i. -5 Solve 238 = -5o - w + 268, -2o = -4w + 10 for o. 5 Solve -4l + 81 = -5g, -238g + 243g = 2l - 83 for g. -17 Solve 3a - 34 = -2s, 1911a - s = 1906a + 74 for a. 14 Solve -i = -3q - 11, 4i + 2q - 177 = -175 for i. 2 Solve 5s + f - 10 = 0, 6s + 7f - 8f = 5s + 8 for s. 3 Solve -8u - 3m - 8 = -6u, 0 = 4u - 7m - 0 + 16 for u. -4 Solve w - 17 = -3h, -11w + 15w - 2h - 96 = 0 for w. 23 Solve v = r - 11, -r - 22 = 3v - 1 for v. -8 Solve -1219m = -1218m + 5r + 28, 2m - 2r - 4 = 0 for m. -3 Solve 3t = -4u - 5, 3u - 5t + 57 - 104 = 0 for u. 4 Solve -113w + 112w = 3q - 44, 15q + 2w = 223 for q. 15 Solve 2 = -g - 2n, -561n - 8 = g - 557n for g. 4 Solve 395d = -5p + 391d + 28, -3d = -3p + 6 for p. 4 Solve 3j + 25 = 7s, -176j - 9 = -177j - 2s for j. 1 Solve k - 4 = c, -36865 = 4k + 5c - 36845 for k. 0 Solve n - 3z + 7 = 0, 19z = -5n + 17z - 52 for n. -10 Solve 4n - 6 = -2h, 3n + 64 - 79 = 2h for n. 3 Solve -2x + 10574r + 10 = 10578r, 0 = x - 3r + 10 for x. -1 Solve -67w + 72w - 2p = 35, 0 = 2w + 4p + 34 for w. 3 Solve 5w + 3c = 12, 3w - 196c + 199c - 6 = 0 for w. 3 Solve -r - 33 = 4t + 2r, -4t - 11 = r for t. 0 Solve -21t + 26t - z = 5, 5t + 5 = 3z for t. 2 Solve -6b - 87f + 30 = -84f, 4b + 4f = 36 for b. 1 Solve 2g - 287 + 294 = 5x, 0 = 4x + 4g - 28 for x. 3 Solve -62f + 2g = -63f + 3, 3g - 12 = f for f. -3 Solve -4m - 21u + 20u - 1 = 0, -2m - 17 = -5u for m. -1 Solve 120y - 21 = 5a + 121y, 5a = -4y - 24 for a. -4 Solve -3c = -0c + 9, -2 = 4y - 2c for y. -2 Solve -4n - 28 = -9n - 2i, -i - 1 = 0 for n. 6 Solve 5i = 2f + 25, -69i - 3 = 3f - 65i for f. -5 Solve 5l - 34 = 4d, -l - 15 + 22 = -d for l. 6 Solve 3b + 42 = -5t, 0 = -833b + 834b + 4t + 28 for b. -4 Solve 10n - 106 = -4u, 167u + 2n = 170u - 89 for u. 29 Solve 3x = 408c - 403c + 3, -4 = 2c - 4x for c. 0 Solve -3h = 5n, -32h + 0n - 9 = -29h + 2n for h. -5 Solve -5i + 2r = 23, -414i = -401i - r + 64 for i. -5 Solve -32 = -4n - 2o, 0 = 24o - 21o - 30 for n. 3 Solve -206a + 199a - 17 = v, 4v - 5a = 31 for v. 4 Solve b = -7p + 6p + 9, 4b - 11p = -174 for b. -5 Solve -5w = 35, -4i + 3i + 3 = -w for i. -4 Solve j - 34527d + 40 = -34532d, -4d - 13 = -3j for j. -5 Solve -2x = 5j + 15, 17 = -5j + x + 2 for j. -3 Solve 2323o - 2328o - 25 = 4k, -3o = 3 for k. -5 Solve 3m - 3 = -0m + 18x - 17x, -51m - 21 = -5x for m. -1 Solve 58233i = 58236i + b - 5, 2b + 8 = 0 for i. 3 Solve 3k = -4h + 20, 0 = -4k - 2h - 6172 + 6192 for k. 4 Solve -5h + 4g - 117 = 0, -4g + 128 - 6 = -6h for h. -5 Solve -1234n + 1239n + k + 58 = 0, -n - k - 14 = 0 for n. -11 Solve 11m - 9 = 12m - q, -3q + 30 = -4m for m. -3 Solve -5d = 5q + 35, 2d = 58q - 64q - 20 + 6 for q. 0 Solve -4o + 2w = 12, 2o - 2 = 5w - 16 for o. -2 Solve -38b = -36b - 4w + 42, 2 = 3b - 2w + 49 for b. -13 Solve 0 = -4r - 4a - 8, -31 = 8r + 3a - 15 for r. -2 Solve -5v - 45 = -1114a + 1129a, -2v - 14 = 5a for v. 3 Solve -2 = -z - 4 - 2, 0 = 5h - 3z - 27 for h. 3 Solve 0 = -3s + 4i + 11 + 4, -4s - 5i = -20 for s. 5 Solve -16i + 14i + 39 = 5p, 2i = 2p - 10 for p. 7 Solve -5j - 54 = 3y, -12y = -3j - 9y - 18 for j. -9 Solve w + 6 = 3a, -646a = -641a - w - 8 for a. 1 Solve -1472u + d = -1470u - 14, 5u - 5d = 30 for u. 8 Solve -49 = 5l - 5w + 1, w = 3l + 20 for l. -5 Solve -8d + 29 = -7d - 5l, 2 = -2d - 5l for d. 9 Solve 24u - 22u + 6y - 61 = -59, 3y + 14 = -4u for u. -5 Solve -1 = -3c + q, c + 48926 = q + 48929 for c. -1 Solve -c - 12 = -2g, -218c - 60 = -216c + 5g for c. -20 Solve 0 = 6r + 2a - 82, -6 = -21a + 19a - 2 for r. 13 Solve -4284n - 8 = 3x - 4286n, -5x + 2n = 12 for x. -2 Solve t = 43j - 48j + 4, 3j = 3 for t. -1 Solve 4f = 4, -65i = -69i + 15f - 16f - 23 for i. -6 Solve -18258i - 32 = -18263i + t, 3t = -21 for i. 5 Solve -3x = 4w - 21, x + 8w - 104 = -37 for x. -5 Solve 0 = -92j + 87j - 3w - 7, 3w = -12 for j. 1 Solve 5 = 4q + 5f, 5f + 16547 = -2q + 16552 for q. 0 Solve m = 2z - 6, -2m - 2z + 81 - 99 = 0 for m. -8 Solve 4m = -2j + 4, 2m - 4 = 18j - 20j for j. 2 Solve -2t - 191h - 10 = -189h, 0 = -4t - 3h - 21 for t. -6 Solve 7499c - 7502c - 21 = -2a, 4a + 3c = 69 for a. 15 Solve 2b - 10 = -4t, 81 = -5t - 2b + 93 for t. 2 Solve 9f + b - 83 = 0, -3b = 5f - 9 - 42 for f. 9 Solve 3c - k + 11731 = 11725, -3k - 8 = 4c for c. -2 Solve 0 = -5u + 3x + 6, 66x - 6 = u + 63x for u. 3 Solve 3s + 6 = -2m, -57s + 59s - m - 3 = 0 for s. 0 Solve 5y = -4l - 51 + 72, 4y + 4l - 16 = 0 for y. 5 Solve 3v + 953 - 970 = -2m, -11 = -m - 4v for m. 7 Solve -5g = -14j + 22, 0 = j + 818g - 820g + 5 for j. 3 Solve -2v - 28 = 1329y - 1325y, 0 = -5y - 3v - 36 for y. -6 Solve -17u + 15u - 3n + 24 = 0, -31 = -3u - 2n for u. 9 Solve -4u - 429i = -425i - 28, -i = 2u - 4 for u. -3 Solve 4b - 39u + 38u = -1, -2b + 3 = 3u for b. 0 Solve 0 = -2p - 3j - 7, -16p - 5j - 50 = -5p for p. -5 Solve 10 = -5d, -w + 20 - 13 = -3d for w. 1 Solve 2w + 98 = 4a, 4w - 3a + 777 - 691 = 0 for w. -5 Solve -3 = 23p - 22p + 2y, y = p for p. -1 Solve 3v + 559 - 548 = p, -2 = 2p for v. -4 Solve 29a + 88 = 2l + 155, 4a = 4l - 28 for a. 3 Solve 3a = 5m + 8, -12m - 4 = -9m - a for m. -1 Solve -30 = -2p - 3l, -p - 575l + 8 = -577l for p. 12 Solve 57t - 55t + 16 = j, -2j + 36 = -5t for j. 8 Solve -4l + 55 + 110 = b, -2b = -2l + 70 for b. 5 Solve -2b - 6 = 5y, -5y + 3b + 9 = -0b for y. 0 Solve 3 = 3o + 3i, -2o - 5 - 5 = -2i for o. -2 Solve -2x = 3u - 6, -2x + 5u - 95 + 133 = 0 for x. 9 Solve -8z + 14 = -2q, q = 73z - 68z - 8 for z. 1 Solve 5g = 3w - 16, 86g + 2w - 44 = 96g for g. -5 Solve 432p - 435p + 32 = -2s, 2s + 8 = p for p. 12 Solve -2v + 9 = v - 5x + 37, 0 = 3v - 12x + 42 for v. -6 Solve -3a = 5o - 69, 420o = 416o + 4a - 60 for o. 3 Solve -3i = 3f + 12, 921f - 919f + 18i = -8 for f	{ "pile_set_name": "DM Mathematics" }
o letters picked without replacement from xxrrrrxrrrxrx? 5/39 Two letters picked without replacement from psqmsmqpss. What is prob of picking 2 s? 2/15 Calculate prob of picking 1 n, 1 b, and 1 e when three letters picked without replacement from {b: 4, z: 4, n: 7, x: 1, v: 3, e: 1}. 7/285 What is prob of picking 2 e when two letters picked without replacement from {e: 5}? 1 Four letters picked without replacement from ttttrttttttttttttt. Give prob of picking 4 t. 7/9 Two letters picked without replacement from {h: 2, b: 4, m: 9, x: 1, v: 1}. Give prob of picking 1 b and 1 v. 1/34 What is prob of picking 1 w and 1 h when two letters picked without replacement from {l: 2, h: 2, y: 1, m: 1, w: 6, f: 3}? 4/35 What is prob of picking 4 m when four letters picked without replacement from {m: 4, o: 6}? 1/210 Two letters picked without replacement from {q: 5, u: 6, z: 1, h: 1, d: 1}. Give prob of picking 1 q and 1 h. 5/91 What is prob of picking 1 x and 2 y when three letters picked without replacement from {u: 1, e: 7, c: 1, x: 2, y: 4, r: 5}? 1/95 Calculate prob of picking 2 k when two letters picked without replacement from {k: 2, l: 2}. 1/6 Two letters picked without replacement from gogcoccggcgbgg. Give prob of picking 1 b and 1 g. 1/13 Two letters picked without replacement from wuhzzzwzzzuwzwzzzzw. Give prob of picking 2 w. 10/171 Two letters picked without replacement from {c: 1, s: 1, b: 3, v: 5, g: 5, p: 3}. What is prob of picking 2 b? 1/51 Calculate prob of picking 2 l when two letters picked without replacement from {l: 2, z: 1}. 1/3 Two letters picked without replacement from vyvwvvjvjvvddys. Give prob of picking 1 v and 1 w. 1/15 Three letters picked without replacement from {m: 5, b: 1, j: 2, g: 1}. Give prob of picking 2 m and 1 b. 5/42 Two letters picked without replacement from {m: 4, o: 5, h: 7}. Give prob of picking 2 h. 7/40 Calculate prob of picking 1 n and 1 e when two letters picked without replacement from nnnnnnpeepopppxppnpp. 7/95 What is prob of picking 1 r and 1 c when two letters picked without replacement from {c: 1, a: 1, k: 1, r: 1, q: 4}? 1/28 Four letters picked without replacement from rrhhrwhhwrwwwhrrhhw. What is prob of picking 1 r and 3 h? 35/646 Calculate prob of picking 1 b and 1 o when two letters picked without replacement from sbriossboccoosscsoss. 1/19 What is prob of picking 1 m and 2 i when three letters picked without replacement from aavvazamiiuvvii? 6/455 What is prob of picking 2 l and 1 d when three letters picked without replacement from dldjjdllljljllldlld? 75/323 Calculate prob of picking 2 n when two letters picked without replacement from {h: 3, d: 3, n: 2}. 1/28 Calculate prob of picking 2 w when two letters picked without replacement from yrbbwrjbwri. 1/55 Three letters picked without replacement from jjgggjkjkkgkjjj. What is prob of picking 1 g and 2 j? 12/65 What is prob of picking 1 w and 3 l when four letters picked without replacement from wlwwlllwwllllwlw? 21/65 Two letters picked without replacement from {c: 2, j: 2, m: 1, h: 1, y: 1, l: 1}. What is prob of picking 1 m and 1 y? 1/28 Three letters picked without replacement from {y: 2, t: 6, m: 4}. What is prob of picking 1 m and 2 y? 1/55 Two letters picked without replacement from woyrxuu. What is prob of picking 1 o and 1 w? 1/21 Two letters picked without replacement from {g: 1, t: 2, s: 2, f: 2, e: 3, q: 2}. Give prob of picking 1 e and 1 q. 1/11 Four letters picked without replacement from sccccceeeeecjccscj. What is prob of picking 1 s and 3 c? 14/255 What is prob of picking 1 h and 2 e when three letters picked without replacement from hhhhehhhhhhhehhehhhe? 8/95 Two letters picked without replacement from {j: 3, s: 2, v: 1, e: 1, i: 3, n: 1}. Give prob of picking 1 i and 1 j. 9/55 What is prob of picking 1 p and 2 k when three letters picked without replacement from kkkpggkmk? 5/42 Calculate prob of picking 1 d, 1 r, and 2 o when four letters picked without replacement from {o: 3, r: 1, d: 1, s: 7, i: 2}. 3/1001 What is prob of picking 2 c when two letters picked without replacement from {a: 4, c: 6}? 1/3 Calculate prob of picking 3 g and 1 t when four letters picked without replacement from {l: 7, t: 2, g: 6}. 8/273 Three letters picked without replacement from ewioled. What is prob of picking 2 e and 1 o? 1/35 Two letters picked without replacement from ppkp. What is prob of picking 1 p and 1 k? 1/2 Calculate prob of picking 2 e when two letters picked without replacement from {a: 2, f: 1, e: 6, k: 9}. 5/51 Calculate prob of picking 1 e and 1 t when two letters picked without replacement from {d: 11, t: 1, e: 3}. 1/35 Four letters picked without replacement from {v: 7, i: 4, x: 4, d: 1, j: 1, e: 3}. What is prob of picking 3 x and 1 j? 4/4845 Four letters picked without replacement from unnnnnun. What is prob of picking 1 u and 3 n? 4/7 Calculate prob of picking 1 t and 2 f when three letters picked without replacement from ttfffeefeftt. 2/11 Calculate prob of picking 2 q when two letters picked without replacement from {q: 3, z: 3}. 1/5 Four letters picked without replacement from aiiaiwhwwiawahtw. Give prob of picking 2 i, 1 w, and 1 h. 3/91 What is prob of picking 2 z when two letters picked without replacement from azzbzmbbmb? 1/15 Two letters picked without replacement from rruhrrruuuurrruhzuz. Give prob of picking 1 z and 1 u. 14/171 Two letters picked without replacement from xmo. What is prob of picking 1 x and 1 o? 1/3 Three letters picked without replacement from {e: 4, l: 3, s: 6}. What is prob of picking 1 e, 1 s, and 1 l? 36/143 Calculate prob of picking 2 r and 1 b when three letters picked without replacement from bhnnhchdnbbbddr. 0 Two letters picked without replacement from {y: 11, p: 1}. Give prob of picking 2 y. 5/6 Two letters picked without replacement from {z: 9, o: 5, k: 1, n: 1}. Give prob of picking 1 o and 1 k. 1/24 Two letters picked without replacement from {m: 3, q: 1, p: 1, n: 1, s: 4, w: 4}. What is prob of picking 1 p and 1 n? 1/91 Three letters picked without replacement from {c: 4, r: 6}. Give prob of picking 2 r and 1 c. 1/2 What is prob of picking 3 d when three letters picked without replacement from daddada? 4/35 What is prob of picking 2 w when two letters picked without replacement from {t: 2, u: 9, w: 5, y: 3}? 10/171 What is prob of picking 3 b and 1 i when four letters picked without replacement from bbbibibbbbbbibibbbbb? 448/969 Three letters picked without replacement from sjscyjsssh. Give prob of picking 1 j, 1 y, and 1 s. 1/12 What is prob of picking 1 d and 1 l when two letters picked without replacement from {q: 5, d: 4, l: 3, w: 4}? 1/10 Four letters picked without replacement from {n: 6}. What is prob of picking 4 n? 1 What is prob of picking 2 m when two letters picked without replacement from {m: 2, z: 9}? 1/55 What is prob of picking 2 t and 1 x when three letters picked without replacement from {x: 1, w: 12, b: 3, t: 2, y: 1}? 1/969 Four letters picked without replacement from kggggggkkg. What is prob of picking 2 g and 2 k? 3/10 Two letters picked without replacement from dludabqau. Give prob of picking 2 a. 1/36 Three letters picked without replacement from {f: 3, r: 11}. What is prob of picking 1 r and 2 f? 33/364 What is prob of picking 3 g when three letters picked without replacement from {b: 5, s: 1, g: 4, v: 1, d: 5}? 1/140 Calculate prob of picking 2 h when two letters picked without replacement from {n: 3, h: 3}. 1/5 Two letters picked without replacement from llllldlllllllllllld. What is prob of picking 2 d? 1/171 Three letters picked without replacement from kkpkppkzczckpkkmkkk. Give prob of picking 1 m and 2 c. 1/969 Two letters picked without replacement from {i: 11, d: 2}. What is prob of picking 1 d and 1 i? 11/39 Calculate prob of picking 1 f and 2 r when three letters picked without replacement from zzefebbzrrrfb. 3/143 Two letters picked without replacement from {a: 2, o: 1, z: 1, v: 2}. Give prob of picking 1 z and 1 o. 1/15 Calculate prob of picking 1 u and 1 i when two letters picked without replacement from iuiiiiiuuiu. 28/55 Two letters picked without replacement from {v: 10, i: 4}. What is prob of picking 2 v? 45/91 Calculate prob of picking	{ "pile_set_name": "DM Mathematics" }
4 - o3 - o*2 + o - 1. Let x(d) = 2d*4 - 3d*3 - 32d*2 + 3d - 3. Let k(w) = 3g(w) - x(w). What is the third derivative of k(z) wrt z? 24z Let y(q) be the first derivative of -16q5/5 + 16q - 2. Let d(o) = 11o4 - 11. Let i(n) = -7d(n) - 5y(n). What is the derivative of i(m) wrt m? 12m*3 Let a(y) = -2y - 6. Let v be a(-4). Find the second derivative of 0h - h + vh - 2h - 2h*5 wrt h. -40h*3 Let s be 1/(33/9). Let j(k) = 6k3 - 2k + 1. Let z be j(s). Find the third derivative of 0az + a2 + 3a*5 + 2a*2 wrt a. 180a*2 Find the second derivative of -28c - 2c2 + 3c - 4c2 - 4c*2 wrt c. -20 Suppose 6i - 11 = 1. Suppose 4w - 16 = -z - 2, -3w - 3z = -15. What is the first derivative of 0m4 - mi + w + m4 + m2 wrt m? 4m3 What is the derivative of 2d*2 - 7d*2 + 2 + 1 wrt d? -10d Let n(a) = -a. Let v(u) = 32u - 25. Let w(z) = 2n(z) - v(z). What is the derivative of w(g) wrt g? -34 Suppose -3 = a + 2a - 3k, -2a + 5 = 5k. Let j be (a - -4) + -1 - 0. What is the second derivative of b*3 - 6b*5 + 7b5 - bj + 2b wrt b? 20b3 Let z(j) be the first derivative of j6/60 + j*4/24 + 3j*2/2 + 4. Let s(x) be the second derivative of z(x). Find the second derivative of s(p) wrt p. 12p Let q(k) be the first derivative of 0k + 0k*4 - 2 + 0k*2 + 7/5k*5 - 2k*3. What is the third derivative of q(j) wrt j? 168j Let u(l) be the first derivative of 3l4/2 - 8l3/3 - 3. Find the third derivative of u(a) wrt a. 36 Let k(w) = -w5 + 25w - 5. Let l(z) = z5 - 12z + 3. Let m(f) = 6k(f) + 10l(f). Find the second derivative of m(c) wrt c. 80c3 Let u be 21/(4 + -1) + -1. Let r be 13/u4. Find the third derivative of 5c*2 + 2c*3 - 4cr - c3 wrt c. 6 Let m(f) be the first derivative of -4f5/5 + f3 + 2f + 31. What is the third derivative of m(q) wrt q? -96q Let n be 3/(-18) - 75/(-18). Let c(a) be the first derivative of -1/2an + a2 + 0a3 - 2 + 0a. Find the second derivative of c(r) wrt r. -12r Let z(l) = -l + 3. Let y be z(-3). Let n be 0/(3 - (1 + 1)). Differentiate -y + 4 + 2q*3 + nq*3 wrt q. 6q*2 Let b(i) be the first derivative of -7i*3/3 + 2i*2 + 1. What is the second derivative of b(m) wrt m? -14 Let g be (1/5 - (-132)/(-60)) + 4. Let q(u) be the first derivative of -3/2u2 - g - u. Differentiate q(o) with respect to o. -3 Let a = -17 + 19. Find the third derivative of -c2 + 7c5 - 6c*a + 14c*2 wrt c. 420c2 Let w(m) be the third derivative of -m6/120 + m*3/6 - 3m*2. Differentiate w(v) wrt v. -3v*2 Let u(b) = 4b*4 - 49b*2. Let g(y) = -3y*4 + 48y*2. Let a(d) = 5g(d) + 4u(d). What is the third derivative of a(p) wrt p? 24p Suppose u - 14 = -u. Suppose 4o - 1 - u = 0. Find the third derivative of -4v*o - 2v + 2v2 - 3v*4 + 2v wrt v. -72v Let g(z) be the first derivative of 7z*5/5 + 2z*3 - 16. What is the third derivative of g(y) wrt y? 168y Let s(h) = -h3 + h2 - h - 2. Let d(g) = -3g4 - 3g*3 - 9g*2 - 6g + 10. Let a(k) = d(k) - 3s(k). What is the second derivative of a(i) wrt i? -36i*2 - 24 What is the derivative of -9o*2 - 2o*2 + 7o*2 - 1 wrt o? -8o Let q(c) be the third derivative of -c7/840 + c4/12 + c*3/6 + 3c*2. Let d(i) be the first derivative of q(i). Find the first derivative of d(r) wrt r. -3r2 Let y(k) be the second derivative of k8/560 - k6/120 + k3/2 - 3k. Let v(t) be the second derivative of y(t). Find the third derivative of v(a) wrt a. 72a Let o = -8 - -15. Differentiate -2i2 + o - 4 + i2 with respect to i. -2i Let c(z) be the first derivative of 19z4/4 - 44z + 7. Find the first derivative of c(m) wrt m. 57m2 Let s(d) = 6d*5 - 4d*3 + 7d*2 + 4d. Let i(r) = -5r5 + 3r*3 - 7r*2 - 3r. Let y(f) = -4i(f) - 3s(f). What is the third derivative of y(o) wrt o? 120o2 Let x = -2 + 5. What is the first derivative of 5c*2 - 4c*2 - 3c*2 - 3c*2 + x wrt c? -10c Let h(p) be the third derivative of 4p2 + 0 + 0p*4 + 0p*3 - 4/105p*7 + 0p - 1/20p5 + 0p*6. Find the third derivative of h(i) wrt i. -192i Let u(v) = -3v3 + 4v*2 - 4v - 7. Let k(c) = c3 + c2 - c + 1. Let n(b) = 4k(b) - u(b). Differentiate n(o) wrt o. 21o*2 Suppose -i = -6i + 25. What is the third derivative of -g*i + 22g*2 + 0g*5 - 18g*2 wrt g? -60g*2 Let i(n) = 1. Let a(h) = -5h*3 + 2h + 6. Let k(r) = -a(r) + 6i(r). What is the second derivative of k(l) wrt l? 30l Suppose 2u - 5u = -9. Find the third derivative of -7i3 + 9i*2 + 0i*u - 7i*2 wrt i. -42 Let x = 3 + -2. Let p be 1(-3 + 3)/x. Differentiate -2 + 3v2 - 1 + 6 + p wrt v. 6v Suppose -i - 5k + 4k = -7, 2k = -4i + 20. What is the second derivative of -j*4 - 5j + 6j4 - ij*4 + 4j*4 wrt j? 72j*2 Let d = -12 + 27. Suppose -u + 3h - 9 = -h, 0 = -5h + d. Find the third derivative of 0fu + f3 + 4f2 - 2f2 wrt f. 6 Let a(y) = y5 - y3 - y2 - y + 1. Let m(p) = -p*3 - 3p*2 - p + 1. Let v(w) = -2a(w) + 2m(w). Find the third derivative of v(l) wrt l. -120l2 Let b(v) be the first derivative of -v5 + 13v3/3 + 2. What is the third derivative of b(p) wrt p? -120p Let s(h) be the third derivative of 0 + h*2 + 0h*5 + 0h*3 + 0h - 1/6h4 + 1/40h*6. What is the second derivative of s(k) wrt k? 18k Let s(y) be the second derivative of -20y7/21 - y3/6 - 33y. Find the second derivative of s(v) wrt v. -800v3 What is the third derivative of -12q*3 + 35q*6 + 10q*3 + 2q*3 - 32q*2 wrt q? 4200q*3 Let x(s) = s. Let o be x(3). Find the first derivative of 3m4 + 2 - 4 + m4 - om4 wrt m. 4m*3 Let p be (22/(-66))/((2-1)/2). Let h(n) be the second derivative of -1/12n4 + pn*3 - 2n + 0n2 + 0. What is the second derivative of h(m) wrt m? -2 Suppose -4t + 2 + 2 = 0. Let p be 1(0 + t)2. What is the second derivative of 6u4 + 2u - u*4 - pu*4 + 0u wrt u? 36u2 What is the second derivative of -9v + 30v - 3v*5 + 4v*4 - 4v*4 wrt v? -60v*3 Find the first derivative of -410i*2 - 2i + 410i2 + 41i*3 + 28 + 39 wrt i. 123i*2 - 2 Let m = 5 - 2. What is the derivative of 3v - 3 + 3v2 - mv wrt v? 6v Find the third derivative of 112h*2 + 22h*4 - 49h*2 - 40h*2 wrt h. 528h Let v(m) = 6m3 - 3m + 3. Let n(d) = 7d3 - 3d + 4. Let y be 1/((-3)/(-12)) + 0. Let l(h) = yv(h) - 3n(h). What is the second derivative of l(c) wrt c? 18c Let v(h) be the second derivative of h + 0h*2 + 0h*3 - 1/4h*4 + 0h*5 + 0 - 1/42h*7 + 0h*6. Find the third derivative of v(p) wrt p. -60p*2 Let p(w) be the second derivative of 7w6/30 + w3/3 + 3w. What is the second derivative of p(i) wrt i? 84i2 Let h(p) = -p2 - 8p + 8. Let z be h(-7). Let v = z - 11. What is the second derivative of -2l + 4l4 + 3l*v - 3l*4 wrt l? 48l*2 Let v(u) = -5u + 16u - 9u - 2. Let p(q) = 2q - 3. Let y(f) = -3p(f) + 4v(f). Find the first derivative of y(m) wrt m. 2 Suppose 3p - 13 = -o, p + 5 = 4p + 5o. Suppose -ps + 13 - 3 = 0. Find the third derivative of -t6 - t6 - 2ts + t6 wrt t. -120t3 Find the first derivative of 2u*4 - 2 - 4u*4 - 6u*4 wrt u. -32u*3 Let p(k) be the second derivative of -1/2k*2 + 0 + 4k + 0k3 - 1/6k*4. What is the derivative of p(f) wrt f? -4f Suppose 4v - 3v = 2. Let h be ((-1)/2)/((-1)/4). Find the third derivative of 2wv - w2 - 2wh + w6 wrt w. 120w3 Let j(k) be the second derivative of -k8/3360 + k7/504 + k4/3 - k. Let n(x) be the third derivative of j(x). What is the third derivative of n(g) wrt g? -12 Let n(d) = 2d - 2. Let q be 6 - 1 - (2 + -1). Let o be n(q). Find the first derivative of -3a - 2 - 1 + o wrt a. -3 Let l be 10/(-6)(1 + -4). Suppose 0 = 4x - 4c - 2 - 34, 4x - lc - 39 = 0. What is the second derivative of 61i2 - xi + 4i4 + 3i - 61i2 wrt i? 48i2 Let a(r) be the first derivative of -r4/4 + r*3/6 + 3r + 2. Let u(m) be the first derivative of a(m). What is the second derivative of u(x) wrt x? -6 Let c be ((-11)/(-66))/(4/3). Let m(s) be the third derivative of -cs4 + 0s - 1/6s3 - s*2 + 0. Find the first derivative of m(k) wrt k. -3 Le	{ "pile_set_name": "DM Mathematics" }
the closest to -8? (a) -5 (b) 1/4 (c) 2/37 (d) 321 (e) 0.8 a Which is the closest to 2? (a) -8 (b) 0.5 (c) -0.08 (d) -1 (e) 7 b Which is the nearest to -256? (a) 0.2 (b) 1 (c) -1 (d) 0 (e) 0.4 (f) -5.9 f What is the closest to 0 in 2/3, -368, -3/4, -18, 3.2? 2/3 What is the closest to -3.6 in 0.0439, -0.01, 16/3, -1/6, 0.2? -1/6 Which is the closest to -0.1? (a) -2 (b) 13936 (c) -2/1515 c Which is the nearest to 11279? (a) -5/4 (b) -0.6 (c) 5 (d) -1 c What is the closest to 0.4999 in -276, -1/2, -1, -4? -1/2 Which is the closest to 0.4? (a) 10 (b) 1.621 (c) 130 b Which is the nearest to 83874? (a) -3/10 (b) 1 (c) -0.03 b What is the closest to -2 in -4, -3/4, -1/2, 0.2, -6? -3/4 What is the closest to 1/57 in 0.02, -0.9, 4.1, -25? 0.02 Which is the nearest to -1? (a) 0.1309 (b) 5 (c) 5/2 (d) -1 (e) 0.4 d What is the nearest to 0.19056 in 0, 328, -1/9? 0 Which is the closest to 1? (a) 5 (b) -95 (c) -2 (d) 2/283 d What is the nearest to -0.2 in 2, -7, -1.3, -0.1, 0.1, 33369? -0.1 What is the nearest to -4 in 2/805, 2/5, 0.6, 1/8? 2/805 Which is the nearest to 3? (a) 0.4 (b) -8.7 (c) 3/2 (d) 1507/5 (e) -3/5 c Which is the closest to 1/2? (a) -4 (b) 5/32 (c) 11 (d) 1.79 b Which is the nearest to 0.2? (a) -0.032 (b) 0.0107 (c) 5 (d) 0.5 (e) -0.5 b Which is the closest to -2? (a) 3/4 (b) -5/3 (c) 9851 b Which is the closest to 1/2? (a) 4/5 (b) -1.7 (c) -5 (d) 23 (e) -1.2 (f) 2 a Which is the closest to 159/4? (a) -0.07 (b) 0.174 (c) 1/4 c Which is the nearest to -26.0202? (a) -33 (b) -2/9 (c) 1 a Which is the closest to -14.3799? (a) -0.3 (b) -3 (c) -98 b Which is the closest to -2/3? (a) -25 (b) -2 (c) 0.2 (d) 5/3 (e) 9.53 c What is the nearest to -1 in -40975, 4.5, -1/2? -1/2 Which is the nearest to -159? (a) -9 (b) 16 (c) -23/2 (d) -0.3 (e) -0.1 c What is the closest to -2/3 in -1/4, 3, 7021/5, 4.36? -1/4 Which is the closest to 0.01? (a) 0.5 (b) -3 (c) 138 (d) -0.2 (e) 71.3 (f) -1 d Which is the nearest to -0.6? (a) -52 (b) -2 (c) 9/59 c What is the closest to -20535 in 28, -0.5, -4, 1? -4 What is the closest to -1 in 2/45, -2, 19, -3, -12.6? -2 Which is the closest to 9? (a) 21 (b) -0.05 (c) -1 (d) -1183 b Which is the closest to -23? (a) -15/26 (b) 1 (c) 0.4 (d) -1/44 a What is the nearest to -0.4 in -1, 41, 1330? -1 Which is the nearest to -0.3? (a) 478 (b) 29175 (c) 1 c Which is the closest to -1? (a) 12 (b) -1/3 (c) 3/8 (d) 4547 (e) 0.4 b What is the nearest to -3/169 in 0.7, -1, -35, 0.1, -2/7? 0.1 Which is the closest to -1/3? (a) -13 (b) -2/13 (c) -60/13 (d) 2/3 (e) 2/295 b What is the closest to 0.29 in 0.589, -1/3, 15? 0.589 What is the closest to -2 in 4/865, -11, -0.01, 1.1? -0.01 Which is the nearest to 0.05? (a) 366 (b) 3 (c) 5/2 (d) 5 (e) 1 e What is the nearest to 0.07 in -155, -1, -0.11, 14? -0.11 What is the closest to -1 in -0.03, -83503/3, -1/8? -1/8 What is the nearest to 2 in 10, -0.1, -12.1, 1, 5? 1 Which is the closest to -70884? (a) -2/7 (b) -1 (c) 2 b What is the closest to -2/5 in 3513/22, -1.1, 2? -1.1 What is the closest to 0.1 in 1.8, 0.2, 11789, 2, -1/2? 0.2 Which is the closest to 1? (a) -4/3 (b) 0.005 (c) -1599 b Which is the nearest to -20386? (a) -2 (b) -0.4 (c) -4 c What is the closest to -0.3 in 242504, 4, 2/7, -2? 2/7 Which is the nearest to -8? (a) 3/4 (b) 14 (c) -9403 a What is the closest to 6077625 in 5, 0.1, -0.054? 5 Which is the closest to -0.0995? (a) -0.2 (b) 0.2 (c) -2/81 (d) 3 c What is the nearest to -0.1 in -5, -2, 1/4, 3667, 0.5? 1/4 Which is the nearest to 1? (a) 2/5 (b) -21/18208 (c) -4 a What is the closest to 169.9 in 5, 4, 454? 5 Which is the nearest to 1? (a) 2 (b) 30616588 (c) 4 a What is the nearest to 20 in -2/3, -5345, 2/7, 0? 2/7 Which is the nearest to 7? (a) -5 (b) -1.15 (c) 1/17 (d) 3/38 d What is the closest to -0.11 in -1/4, -2, 2/11, 7425? -1/4 Which is the closest to 9? (a) 79/5 (b) -10/3 (c) -5 (d) -2 a What is the nearest to -15.3 in -2/7, -3324, -3/8, 8? -3/8 Which is the nearest to -12630? (a) -2/61 (b) -2/11 (c) -2 c Which is the closest to 1.7? (a) 4 (b) 5 (c) -16 (d) 0.3 (e) 2 (f) 5177 e What is the closest to -1/5 in 3/2, -635, -2, 1.3? 1.3 Which is the nearest to -7? (a) 0.2 (b) -612 (c) -4.2 c Which is the closest to -0.2? (a) 1 (b) 6308 (c) -0.065 (d) -5 c What is the nearest to -0.8 in 4, -95, -279, -2/3, -4? -2/3 What is the closest to 0.02 in -3/2, -1673, 0, -30? 0 What is the nearest to 68 in -3, -2, -1, 5, -860.9? 5 What is the nearest to -172 in 5/4, -1/3, -1/2, 5, 0.3? -1/2 Which is the closest to 3/7? (a) 3200 (b) 1/5 (c) 0.219 (d) 0 c Which is the closest to 0.1? (a) 5/141 (b) 40 (c) 593 a What is the nearest to -1 in -4/541, 0.2, 5, -4? -4/541 What is the nearest to 21 in -0.1, -11/5, -1, 8/111? 8/111 What is the closest to -36 in 0.287, -3, -19? -19 Which is the closest to 307? (a) -49 (b) -2/21 (c) -0.01 c Which is the nearest to -0.1? (a) 2/37 (b) 101 (c) -20 (d) -1.4 (e) 0.3 a What is the nearest to -12/7 in -0.06, 8, -2/23? -2/23 What is the closest to 0.1 in -158, -3, -7, 0.4, 3? 0.4 Which is the nearest to 7/13? (a) -1 (b) -313 (c) -10/3 (d) -1/4 (e) 5/2 d Which is the nearest to 0.2? (a) -6/13 (b) -340 (c) 2/11 (d) 1/5 (e) -35 (f) 9 d What is the closest to -0.151 in -2/915, -4/5, 1? -2/915 Which is the closest to 23? (a) -5 (b) -1/8 (c) 8407 b What is the closest to -5673 in 2, -0.2, 8, -141, 3? -141 What is the nearest to 1 in 3, -426/5, -0.5, -102.4, -4? -0.5 What is the nearest to 2 in -13, 20, 23, -52? -13 What is the nearest to -1 in -2/7, -29092, -2, -1, -1/3? -1 What is the closest to -1.039 in -1/32, 3, 1? -1/32 Which is the nearest to -2/5? (a) 7 (b) -2/9 (c) -745 (d) 5/7 (e) -1 b Which is the nearest to -82271? (a) 2/9 (b) -3 (c) -4 (d) 2/13 c What is the nearest to 0.1 in -0.22, -577, 1, 2/45, -5? 2/45 What is the nearest to 12 in 186, -0.03, 0.101, -0.2? 0.101 Which is the nearest to 0.3? (a) -0.3 (b) 0.02381 (c) -146 b Which is the nearest to 5370? (a) 1/2 (b) 3 (c) 1/4 (d) -3 (e) -1/6 (f) -4 b What is the nearest to 1/4 in 8, -3, 3/62, -5, -0.5? 3/62 Which is the closest to -1/2? (a) -51.53 (b) 1/4 (c) -10 (d) 0.1 (e) -28 d What is the nearest to -241 in -0.94, -0.05, 0.3, -0.2, -1? -1 What is the closest to 139 in 1.25, -5, -2/21, -2? 1.25 Which is the closest to -0.2? (a) -7.2 (b) 0.4 (c) -4 (d) 24 (e) 1 b What is the closest to 0.35 in 0.015, -3, -0.066? 0.015 What is the closest to 1 in 100, -0.5, -0.6, 1, -262, -7? 1 What is the nearest to -4/19 in -0.5, 4068, -2/11? -2/11 What is the closest to 0.2 in 2/11, -1.28, -6, -22/5, -5? 2/11 What is the nearest to -1 in 20, 22, 2, 0.5, -1/69? -1/69 What is the closest to -55/2 in 3/7, 74, -1, 2/7, 3? -1 What is the nearest to 2 in 0.046, 1, -4/9, 156/25, -3/29? 1 What is the nearest to -18 in -19/25, 0.2, 0.4, -526, -10, 2? -10 What is the nearest to 0.41 in 0, -0.8, 1/4, -0.061? 1/4 Which is the closest to 0.8? (a) 2/19 (b) 4270 (c) -0.183 (d) 2 a What is the nearest to -84 in 12, 152, 5, 6, -1, 2/3? -1 What is the nearest to 15.2 in 238/3, 0.24, -5, -2/9, -1/8? 0.24 What is the nearest to 27976 in -5/3, 4, -0.3, 3, -3, -163? 4 What is the closest to -2/1095 in 4, 126, -0.5? -0.5 What is the nearest to 294.9 in -1/6, 1/4445, -1? 1/4445 Which is the closest to 1.9? (a) -0.2 (b) -1935.8 (c) 3/7 c What is the closest to 91 in -1170/11, 1/5, -1/3? 1/5 Which is the closest to 0.1? (a) -16 (b) -5 (c) 14/235 c Which is the closest to -5/3? (a) -3 (b) 1/2 (c) -0.1 (d) -4 (e) 529 a Which is the nearest to -5/484? (a) -2/5 (b) -1/11 (c) -159 (d) -3 b What is the nearest to -1 in -104, 0, 24, 6? 0 Which is the closest to -0.335? (a) 1 (b) -515 (c) 5 (d) 0 d Which is the nearest to 7.6? (a) 391697 (b) 0.1 (c) 1 (d) 2 d What is the nearest to 3/11 in -1, -13, -8.84, -3/2, -2, 0.13? 0.13 Which is the nearest to 0.31722? (a) 22 (b) -7 (c) -4 c What is the nearest to 5 in 0.3, 9/148, 1, -844, 2? 2 Which is the nearest to -107283? (a) 3/4 (b) 0.02 (c) 2/23 b Which is the closest to 0? (a) 32/3 (b) -3 (c) 2 (d) 4/11 (e) -2/189 (f) 1/2 e Which is	{ "pile_set_name": "DM Mathematics" }
actor -m*4/4 + 1447m*3/4 - 1444m*2 + 1443m. -m(m - 1443)(m - 2)*2/4 Solve 6a*5 + 2595a*4 + 1287a*3 - 3891a*2 - 1293a + 1296 = 0. -432, -1, 1/2, 1 Solve 2a5/3 + 4064a*4/3 - 17724a*3 - 4064a*2/3 + 53170a/3 = 0 for a. -2045, -1, 0, 1, 13 Solve j*3/9 - 64j*2/9 - 52j/3 + 176 = 0 for j. -6, 4, 66 Solve -4c5 - 187c*4 - 1721c*3 + 442c*2 = 0. -34, -13, 0, 1/4 Let 4d*2 + 4980d + 102816 = 0. Calculate d. -1224, -21 Suppose -3b5/4 + 339b*4/4 - 2904b*3 + 24708b*2 + 116352b - 138240 = 0. Calculate b. -4, 1, 20, 48 Factor 605s3 - 6270s*2 + 18720s - 17280. 5(s - 6)(11s - 24)2 Factor -5w*3 + 9535w*2 + 221840w + 212300. -5(w - 1930)(w + 1)(w + 22) Suppose 2m*4 - 1422m*3 - 2m*2 + 1422m = 0. What is m? -1, 0, 1, 711 Find s, given that 4s4 + 2152s*3 + 204912s*2 + 4195800s - 73871028 = 0. -423, -63, 11 Factor -2n3/9 - 1204n*2/9 - 179992n/9 + 364816/9. -2(n - 2)(n + 302)2/9 Let v2/3 + 4586v/3 - 1529 = 0. What is v? -4587, 1 Suppose x4/3 - 16961x*3/3 + 101735x*2/3 - 84775x/3 = 0. What is x? 0, 1, 5, 16955 Solve -2q2/7 + 185044q/7 - 370080/7 = 0 for q. 2, 92520 Let f*4/3 + 433f*3/3 - 3979f*2/3 - 433f/3 + 1326 = 0. Calculate f. -442, -1, 1, 9 Factor 5j4 + 40j*3 - 3165j*2 - 16200j. 5j(j - 24)(j + 5)(j + 27) Factor -u*2/5 - 664u/5. -u(u + 664)/5 Find p, given that -2p*5/9 - 226p*4 - 174040p*3/3 - 2487496p*2/9 + 2048288p = 0. -506, -9, 0, 4 Solve -2h5 + 498108h*4 + 1992452h*3 + 2988688h*2 + 1992462h + 498116 = 0. -1, 249058 What is j in -4j4 + 243064j*3 - 3691291236j*2 - 36931144160j - 92343054400 = 0? -5, 30388 Factor -4g4 + 12716g*3 + 25448g*2. -4g*2(g - 3181)(g + 2) Factor 3k*3 + 1092k*2 + 15705k. 3k(k + 15)(k + 349) Find i, given that 4i*3 + 5984i*2 + 53612i + 118960 = 0. -1487, -5, -4 Let -z*2/3 + 54586z/3 - 744907849/3 = 0. What is z? 27293 Factor -g*3/12 + 703g*2 - 5927695g/4 - 17799961/6. -(g - 4219)*2(g + 2)/12 Solve -4y2 + 266y - 516 = 0. 2, 129/2 Factor -4f3 + 704f*2 - 2084f + 1384. -4(f - 173)(f - 2)(f - 1) Solve 4f*2/9 + 400120f/9 + 10006000900/9 = 0. -50015 Factor -5t3 - 3428t*2 - 115628t + 46800. -(t + 36)(t + 650)(5t - 2) Find v such that 3v*2/2 + 1510401v/2 + 755199 = 0. -503466, -1 What is z in 3z5 - 36z*4 + 144z*3 - 240z*2 + 144z = 0? 0, 2, 6 Factor -4s2 - 12640s + 50624. -4(s - 4)(s + 3164) Solve -2h4/5 + 868h*3/5 - 2592h*2/5 + 2588h/5 - 862/5 = 0. 1, 431 Factor 2c5/7 - 7486c*4/7. 2c*4(c - 3743)/7 Solve -2u5/17 + 54u*4/17 + 1514u*3/17 - 16078u*2/17 + 44688u/17 - 30176/17 = 0 for u. -23, 1, 4, 41 Factor -3k2 - 150k + 477. -3(k - 3)(k + 53) Let w*3/3 + 1810w*2 - 43632w = 0. What is w? -5454, 0, 24 Factor 25m4 + 6490m*3 - 2600m*2. 5m*2(m + 260)(5m - 2) Let -11a2/9 + 145a/9 + 52/3 = 0. Calculate a. -1, 156/11 Find y such that -y*4 - 45702y*3 - 522259597y*2 - 2088489996y - 2088307204 = 0. -22849, -2 Factor 4w4 - 56w*3 - 448w*2 + 5120w. 4w(w - 16)(w - 8)(w + 10) Factor -q*3/6 + 266q*2/3 - 3685q/6 + 875. -(q - 525)(q - 5)(q - 2)/6 Factor 4q3 + 27808q*2 - 306332q + 278520. 4(q - 10)(q - 1)(q + 6963) Determine g, given that g2/4 + 5511g - 22045/4 = 0. -22045, 1 Determine a, given that -2a4 + 6a*3 + 4800a*2 - 4808a - 9600 = 0. -48, -1, 2, 50 Find f such that -f*4/5 + 2859f*3 + 71532f*2/5 - 457636f/5 + 102960 = 0. -9, 2, 14300 Solve 2f2 + 1156f + 31842 = 0. -549, -29 Determine v, given that 51v3 - 10304v*2 - 9949v + 406 = 0. -1, 2/51, 203 Factor 363x3/2 - 17886x*2 - 26304x - 9600. 3(x - 100)(11x + 8)2/2 Determine w, given that 2w*2 - 682w - 12924 = 0. -18, 359 Solve -3y2 - 894y - 3528 = 0 for y. -294, -4 Let 4h4 + 11859h*3 + 1351251h*2 - 1704634h + 341520 = 0. What is h? -2846, -120, 1/4, 1 Factor p*2/4 - 235p/4 + 1075. (p - 215)(p - 20)/4 Determine q, given that -3q*2 - 516q + 12159 = 0. -193, 21 Find r, given that 614r3 + 602r*2/3 - 4r/3 = 0. -1/3, 0, 2/307 Let 5o3 - 335o*2 + 2710o - 5800 = 0. Calculate o. 4, 5, 58 Factor 23763s5 - 211731s*4 + 622425s*3 - 584361s*2 - 56376s - 1296. 3(s - 3)3(89s + 4)2 Solve 183d*3 + 7125d*2 - 15474d + 984 = 0. -41, 4/61, 2 Solve -p*5/5 - 1274p*4/5 + 511p*3 + 3828p*2/5 = 0 for p. -1276, -1, 0, 3 Suppose -5j*4 + 2790j*3 - 16605j*2 + 24860j - 11040 = 0. Calculate j. 1, 4, 552 Let 3x4 + 1677x*3 - 115506x*2 = 0. What is x? -621, 0, 62 Factor 3o*3 - 18822o*2 + 29541120o - 59006976. 3(o - 3136)2(o - 2) Determine k, given that -3k5 + 618k*4 + 5760k*3 + 9750k*2 - 16125k = 0. -5, 0, 1, 215 Determine d, given that -53d4/5 + 108d*3/5 + 1639d*2/5 + 1422d/5 - 56/5 = 0. -4, -1, 2/53, 7 Solve 5x3 - 11785x*2 - 35390x - 23600 = 0. -2, -1, 2360 Determine t so that -4t2 - 12368t/3 + 4124/3 = 0. -1031, 1/3 Factor 4h3/9 + 628h*2/9 - 28568h/9 + 3104. 4(h - 36)(h - 1)(h + 194)/9 Factor -a3 - 243a*2 - 240a + 484. -(a - 1)(a + 2)(a + 242) Determine y so that -y*2/7 - 1249y + 8744/7 = 0. -8744, 1 Suppose -4d3 - 2457568d*2 - 377479987220d - 754950144200 = 0. What is d? -307195, -2 Find r such that r*5 - 235r*4 + 1387r*3 - 2989r*2 + 2752r - 916 = 0. 1, 2, 229 Factor -g*4/4 - 9g*3 + 144g2. -g2(g - 12)(g + 48)/4 Determine c so that c*5/2 - 3c*4 - 487c*3/2 - 1080c2 = 0. -16, -5, 0, 27 Let -s5/5 - 3026s4/5 + 42608s*3/5 + 29194s*2 + 152017s/5 + 10336 = 0. What is s? -3040, -1, 17 Suppose 24y2 + 284y + 840 = 0. What is y? -6, -35/6 What is y in -2y3/9 + 152y*2/9 + 23432y/9 + 91168/9 = 0? -74, -4, 154 Factor -5t3 + 4105t*2 + 12350t + 8240. -5(t - 824)(t + 1)(t + 2) Suppose 21a*2 + 25975a - 2474 = 0. What is a? -1237, 2/21 Suppose -2j2 + 404470j + 404472 = 0. What is j? -1, 202236 Let -6a5 - 7864a*4 - 106744a*3 - 506604a*2 - 1004418a - 700380 = 0. What is a? -1297, -6, -3, -5/3 Solve 2f4 - 590f*3/3 + 6018f*2 - 53054f - 114308/3 = 0 for f. -2/3, 17, 41 Suppose 405h4 - 33165h*3 + 61640h*2 - 35280h + 6400 = 0. What is h? 4/9, 1, 80 Determine h, given that 2h2 + 247846h + 743520 = 0. -123920, -3 Solve -3j4/2 - 393j*3/2 + 1071j*2 + 6816j - 16320 = 0. -136, -5, 2, 8 Factor -3x3 + 42x*2 + 9117x + 9072. -3(x - 63)(x + 1)(x + 48) Suppose 3t*4 - 834t*3 - 6813t*2 - 14556t - 8580 = 0. What is t? -5, -2, -1, 286 Factor -4t5 - 316t*4 + 1680t*3. -4t*3(t - 5)(t + 84) Factor f2/6 + 9139f/6 + 50204/3. (f + 11)(f + 9128)/6 Let 4x*4/5 - 35208x*3/5 + 70404x*2/5 - 7040x = 0. Calculate x. 0, 1, 8800 Let -5z5 - 865z*4 + 9925z*3 - 35655z*2 + 41400z = 0. Calculate z. -184, 0, 3, 5 Determine x, given that 1444x5 - 504260x*4 + 42259360x*3 + 311381920x*2 - 66956480x + 3548608 = 0. -7, 2/19, 178 What is p in -p*5/7 - 761p*4/7 - 3022p*3/7 + 4546p*2/7 + 3023p/7 - 3785/7 = 0? -757, -5, -1, 1 What is z in -z*3 - 12519z*2 = 0? -12519, 0 What is g in 35g*5/6 - 126017g*4/6 - 21611g*3/2 + 54017g*2/6 - 3601g/3 = 0? -1, 0, 1/5, 2/7, 3601 Find i, given that -i*3/11 + 270008i*2/11 - 540013i/11 + 24546 = 0. 1, 270006 Find n, given that 4n4 + 168n*3 + 1760n*2 - 168n - 1764 = 0. -21, -1, 1 Factor -3t2/2 - 81t/2 + 4515. -3(t - 43)(t + 70)/2 Solve 5j3 - 245j*2 - 11680j - 103680 = 0 for j. -16, 81 Factor -2k2 + 90k - 88. -2(k - 44)(k - 1) Factor n*3/5 - 319423n*2/5 + 638843n/5 - 319421/5. (n - 319421)(n - 1)2/5 Suppose -2l*5/15 - 24l*4/5 - 100l*3/3 - 24l*2 + 502l/15 + 144/5 = 0. What is l? -27, -8, -1, 1 Determine p, given that -5p2 - 609050p - 18547095125 = 0. -60905 Solve 9w5 - 127w*4 + 130w*3 = 0 for w. 0, 10/9, 13 Determine h, given that 4h*2/7 + 1386548h/7 - 1386552/7 = 0. -346638, 1 What is b in -245b5 - 63070b*4 - 3995200b*3 + 8244640b2 = 0? -908/7, 0, 2 Suppose -b4 - 235774b3 - 13897580541b*2 - 27794453764b - 13897108996 = 0. What is b? -117886, -1 Factor -5w4 + 51135w*3. -5w*3(w - 10227) Let -2v2/5 + 9969v/5 - 4984/5 = 0. What is v? 1/2, 4984 Suppo	{ "pile_set_name": "DM Mathematics" }
t is the millions digit of 12175839? 2 What is the units digit of 412948? 8 What is the tens digit of 1135608? 0 What is the hundreds digit of 602515? 5 What is the tens digit of 1399798? 9 What is the ten thousands digit of 294794? 9 What is the millions digit of 13996240? 3 What is the tens digit of 1503202? 0 What is the tens digit of 179278? 7 What is the tens digit of 77180? 8 What is the hundred thousands digit of 137233? 1 What is the hundred thousands digit of 221732? 2 What is the ten thousands digit of 13199856? 9 What is the thousands digit of 28353? 8 What is the ten thousands digit of 11479430? 7 What is the ten thousands digit of 34187? 3 What is the hundreds digit of 130190? 1 What is the thousands digit of 1087202? 7 What is the hundreds digit of 820158? 1 What is the thousands digit of 2403797? 3 What is the hundred thousands digit of 9616842? 6 What is the millions digit of 6162680? 6 What is the ten thousands digit of 594815? 9 What is the ten thousands digit of 11671? 1 What is the ten millions digit of 25383363? 2 What is the thousands digit of 3990042? 0 What is the tens digit of 73869? 6 What is the tens digit of 291743? 4 What is the millions digit of 30609118? 0 What is the tens digit of 2899644? 4 What is the ten thousands digit of 3387086? 8 What is the thousands digit of 94458? 4 What is the units digit of 649681? 1 What is the units digit of 4420? 0 What is the tens digit of 98449? 4 What is the millions digit of 33808902? 3 What is the thousands digit of 22527? 2 What is the hundreds digit of 5341902? 9 What is the millions digit of 6198484? 6 What is the tens digit of 447158? 5 What is the thousands digit of 9430580? 0 What is the thousands digit of 2129505? 9 What is the thousands digit of 8468665? 8 What is the thousands digit of 531870? 1 What is the millions digit of 2361169? 2 What is the ten thousands digit of 2258867? 5 What is the hundred thousands digit of 993399? 9 What is the thousands digit of 280412? 0 What is the units digit of 1451? 1 What is the tens digit of 5111646? 4 What is the millions digit of 9336339? 9 What is the hundred thousands digit of 2191289? 1 What is the thousands digit of 143473? 3 What is the hundreds digit of 20618648? 6 What is the hundreds digit of 866781? 7 What is the ten thousands digit of 166475? 6 What is the millions digit of 30413456? 0 What is the units digit of 2114928? 8 What is the thousands digit of 275579? 5 What is the hundreds digit of 4665337? 3 What is the thousands digit of 533431? 3 What is the millions digit of 2348501? 2 What is the millions digit of 8607609? 8 What is the hundred thousands digit of 4087585? 0 What is the thousands digit of 1538486? 8 What is the units digit of 175375? 5 What is the units digit of 591137? 7 What is the tens digit of 576253? 5 What is the thousands digit of 1473304? 3 What is the thousands digit of 79285? 9 What is the millions digit of 2343224? 2 What is the hundreds digit of 14110398? 3 What is the ten thousands digit of 33645? 3 What is the ten thousands digit of 193649? 9 What is the tens digit of 22673676? 7 What is the tens digit of 5300168? 6 What is the tens digit of 739386? 8 What is the tens digit of 65439? 3 What is the ten thousands digit of 209907? 0 What is the units digit of 7491485? 5 What is the thousands digit of 5830? 5 What is the ten thousands digit of 364824? 6 What is the units digit of 489468? 8 What is the ten thousands digit of 462775? 6 What is the hundred thousands digit of 1359350? 3 What is the tens digit of 539498? 9 What is the ten thousands digit of 2134536? 3 What is the hundreds digit of 282025? 0 What is the thousands digit of 9835991? 5 What is the hundred thousands digit of 122910? 1 What is the hundred thousands digit of 16670434? 6 What is the tens digit of 12695818? 1 What is the thousands digit of 587209? 7 What is the tens digit of 684023? 2 What is the hundreds digit of 28304? 3 What is the thousands digit of 27608? 7 What is the ten thousands digit of 1232920? 3 What is the ten thousands digit of 399349? 9 What is the thousands digit of 4760690? 0 What is the hundreds digit of 3093169? 1 What is the ten thousands digit of 892791? 9 What is the tens digit of 1749464? 6 What is the tens digit of 36189? 8 What is the units digit of 9866064? 4 What is the hundreds digit of 16694126? 1 What is the hundreds digit of 276353? 3 What is the thousands digit of 1042974? 2 What is the units digit of 731168? 8 What is the thousands digit of 5410939? 0 What is the tens digit of 13571301? 0 What is the hundred thousands digit of 465781? 4 What is the ten thousands digit of 159038? 5 What is the millions digit of 1200232? 1 What is the units digit of 960901? 1 What is the tens digit of 2243653? 5 What is the hundreds digit of 866? 8 What is the hundred thousands digit of 647674? 6 What is the ten thousands digit of 1926576? 2 What is the hundred thousands digit of 276834? 2 What is the millions digit of 1048360? 1 What is the thousands digit of 1150137? 0 What is the tens digit of 131961? 6 What is the units digit of 476181? 1 What is the units digit of 1606339? 9 What is the ten millions digit of 11241440? 1 What is the tens digit of 132323? 2 What is the units digit of 8587488? 8 What is the ten thousands digit of 4240175? 4 What is the thousands digit of 924039? 4 What is the tens digit of 1801835? 3 What is the units digit of 29480350? 0 What is the tens digit of 5102504? 0 What is the hundreds digit of 155871? 8 What is the units digit of 2631799? 9 What is the thousands digit of 266178? 6 What is the units digit of 14743350? 0 What is the hundred thousands digit of 23443583? 4 What is the tens digit of 549380? 8 What is the units digit of 1343939? 9 What is the hundred thousands digit of 788890? 7 What is the tens digit of 1088413? 1 What is the thousands digit of 1443839? 3 What is the hundreds digit of 2338388? 3 What is the tens digit of 187066? 6 What is the units digit of 239265? 5 What is the millions digit of 11405279? 1 What is the hundreds digit of 609175? 1 What is the ten thousands digit of 2099637? 9 What is the ten thousands digit of 23704421? 0 What is the thousands digit of 2025143? 5 What is the hundreds digit of 1764917? 9 What is the hundred thousands digit of 485797? 4 What is the units digit of 7789631? 1 What is the tens digit of 65122? 2 What is the tens digit of 80633? 3 What is the units digit of 16833507? 7 What is the hundreds digit of 3795545? 5 What is the millions digit of 6327441? 6 What is the units digit of 902405? 5 What is the units digit of 3485616? 6 What is the ten thousands digit of 823345? 2 What is the hundreds digit of 1747088? 0 What is the tens digit of 65615? 1 What is the hundreds digit of 569708? 7 What is the tens digit of 6459688? 8 What is the thousands digit of 11892658? 2 What is the units digit of 962696? 6 What is the thousands digit of 379970? 9 What is the hundred thousands digit of 3018164? 0 What is the hundreds digit of 18892023? 0 What is the thousands digit of 1916049? 6 What is the ten thousands digit of 3223765? 2 What is the ten thousands digit of 1008364? 0 What is the thousands digit of 27533285? 3 What is the thousands digit of 710129? 0 What is the tens digit of 105259? 5 What is the tens digit of 7143282? 8 What is the hundreds digit of 273329? 3 What is the thousands digit of 612075? 2 What is the millions digit of 1559855? 1 What is the hundreds digit of 1138909? 9 What is the units digit of 41978? 8 What is the thousands digit of 748055? 8 What is the hundred thousands digit of 1253288? 2 What is the hundred thousands digit of 607037? 6 What is the ten thousands digit of 2357267? 5 What is the millions digit of 16583952? 6 What is the ten thousands digit of 8946076? 4 What is the ten thousands digit of 16929624? 2 What is the thousands digit of 1055150? 5 What is the ten thousands digit of 430378? 3 What is the ten thousands digit of 6082139? 8 What is the tens digit of 575065? 6 What is the hundred thousands digit of 239032? 2 What is the units digit of 121953? 3 What is the units digit of 1272022? 2 What is the units digit of 7757784? 4 What is the thousands digit of 6571175? 1 What is the hundreds digit of 7164	{ "pile_set_name": "DM Mathematics" }
= 0, 0 = 4q - 2f - 6. Suppose -3b + 0b + 33 = 0. Let x(o) = -o*3 + 8o*2 - 6o - 2. Let j be x(7). Solve qh = j + b for h. 4 Let w be ((-3)/2)/(6/(-32)). Let u(n) = -3n - 5. Let f be u(-3). Let y = f + w. Solve y = -h + 5h for h. 3 Let v = 1 + -1. Suppose 0d + 3d - 6 = v. Suppose -3g + 5g + 2 = 2k, -4k = dg + 2. Solve 3q + 9 + 0 = k for q. -3 Let j be (45/(-12))/(2/8). Let r = -9 - j. Solve z - r = -2z for z. 2 Suppose h - v = 12, -3h = -0h - 5v - 30. Suppose -q + 6q - h = 0. Let t be (-46)/(-4) + q/6. Solve 0 = x + 2x - t for x. 4 Let k(m) = -m3 + 6m*2 + 17m - 7. Let s be k(8). Solve -s = z - 2 for z. 1 Suppose 2j - 10 = -5p, 5j + 0p - 25 = 3p. Suppose 0 = jw - 8w + 12. Solve -w = 3b - 2b for b. -4 Let l(c) = -4c - 8. Let k be l(-3). Solve 8p - kp = 0 for p. 0 Let m(c) = 9c - 71. Let h be m(8). Solve n + h = -3 for n. -4 Let y be 285/(-30) + 3/(-2) + 2. Let g(q) be the second derivative of q4/12 + 3q*3/2 - q. Let i be g(y). Solve o + i = 2 for o. 2 Suppose 0 = -l + 4u - 2u + 6, 5u = 0. Solve ls = 4s + 8 for s. 4 Let g = 9 - 5. Suppose -5u = -gv + v - 6, -2u - 3 = -3v. Suppose -50 = -5i + 5w, -5i - 3w = -0i - 26. Solve -us + i = -5 for s. 4 Let n(u) = u*2 - 3u - 10. Let l be n(5). Solve lx + 4x = -12 for x. -3 Suppose -7 + 61 = 9t. Solve tk + 20 = 2k for k. -5 Let x(t) = 2t + 2. Let q be x(0). Solve qy = -2y for y. 0 Let h(c) be the third derivative of c5/10 - c3/6 + 2c2. Let g be h(-1). Solve -11 = gz - 36 for z. 5 Suppose 4z = k + 2z + 2, -k + 2 = 2z. Solve kl = -5l for l. 0 Let n = 38 + -36. Solve -3x = nx + 5 for x. -1 Suppose -2m + 5m = 15. Solve mx = x + 8 for x. 2 Let j be (-60)/(-35) + 6/21. Suppose -jq + 2r = -14, -q + 4r - 6 = -22. Solve 0 = -x + 3x + q for x. -2 Suppose -3v + 5w + 14 = 0, 7 - 21 = -4v + 2w. Suppose 4c - d - d = 48, 26 = vc + d. Solve 0 = 2p - 0p - c for p. 5 Let z(f) = -2f3 - 10f*2 + f + 8. Let x be z(-5). Solve -xt = t for t. 0 Suppose 10m - 2 = 8m. Solve 5a = -m - 9 for a. -2 Let o be 7 + 0 + -6 - -14. Let p(u) = -u. Let d be p(-3). Solve o = -t + d for t. -2 Suppose -1 = -i - 0i. Let f(m) = 2m*3 + 2m*2 - 1. Let g be f(i). Suppose -gj = -j. Solve 2d + j = 6 for d. 3 Let d = 8 - 4. Suppose x - 5 = -d. Solve -2h + x + 1 = 0 for h. 1 Let l(q) = 2q2 + 11q - 2. Let b be l(-6). Suppose ba = 8a - 12. Solve a = -5g - 12 for g. -3 Suppose 4l = -a + 11, 4l + 1 = a + 2a. Solve i + a = 6 for i. 3 Suppose -34 = -5y - 9. Suppose 2u - 26 = 2c, y = -c - 0c. Solve -3k + uk = 0 for k. 0 Let f be (-3 - -2)/((-2)/6). Let t be 20/4 - (7 + -3). Solve t = -fw - 11 for w. -4 Suppose -w + 3w - 8 = 0. Let t be (0 - -1)(3 - -8). Let m = t - w. Solve 3x = mx for x. 0 Suppose w = -4h - 3, 3w - h = 4w. Let s be (w - 0/(-1))13. Let f = s + -9. Solve -f - 1 = r for r. -5 Suppose -20 = 5z, i + 2i = 2z + 8. Solve ip = 4p + 8 for p. -2 Let n = 35 + -33. Solve -no + 10 = 3o for o. 2 Let i be (-6 - -3) + (-12)/(-4). Let j = 5 - i. Solve 0h = h + j for h. -5 Suppose -3r + 0r = r. Let v(p) = p - p2 - 2 + 0 + 3p*2. Let k be v(-2). Solve r = -3f + f - k for f. -2 Suppose -l + 3l - d = 12, 4l + d = 18. Solve -lo + 2 + 8 = 0 for o. 2 Let a(g) = -g - 1. Let m be a(-5). Suppose -2k - 2k = -124. Suppose 4f + 32 = 2q, 5f + k = 3q - 16. Solve -m + q = 2u for u. 5 Let i(r) = -4r3 - r2 - r. Let u be i(-1). Solve -3a - 2 = u for a. -2 Let s(v) = v*2 + 9v + 3. Let r be s(-9). Suppose 1 = h - r. Solve -hm = -0m for m. 0 Let j(p) = p*3 + 3p*2 - 4p + 3. Let c be j(-4). Suppose y + 0y - 3b = -3, cy + 2b = 13. Solve -a = ya + 4 for a. -1 Let k = 118 - 117. Solve -k = 2g - 5 for g. 2 Suppose -7 = -b + 2b. Let l = b - -8. Solve -m - l = 4 for m. -5 Let j(u) = 4u*3 - u + 1. Let b be j(1). Suppose 4y + b = 6y. Solve yw = 4 - 0 for w. 2 Suppose 5f + 25 = 0, -q + 5f + 26 = -3. Solve 4i + 0 = -q for i. -1 Let z(m) = -7m - 5. Let d be z(-2). Let i = 2 - 0. Solve is - d = -3 for s. 3 Suppose -2n - 4j - 5 = -19, -4n + 3j - 5 = 0. Let h(x) = 0x - x*3 + x + 0x*3 + 5x*2 - n. Let r be h(5). Solve 3z = 4z - r for z. 4 Let c be 2 - 0 - (0 + 0). Suppose -10 = -9l + 8. Suppose -a + l = cf, -f - 4f + 5 = 4a. Solve -3o + 8o - 10 = a for o. 2 Let t(p) = p2 - 16p + 2. Let z be t(16). Solve 5b + 9 = zb for b. -3 Suppose -2g + g = 0. Suppose 3i - 6 - 3 = g. Solve 0 = -il + 7l for l. 0 Let w(y) = 15y3 - y2 + y - 1. Let g be w(1). Suppose -b + 4 = 2. Solve bu + g - 6 = 0 for u. -4 Let c(r) be the third derivative of -r*4/24 + 2r*3/3 - 3r*2. Let l be c(3). Solve -4t = 21 - l for t. -5 Suppose v + 21 = 4c, c - 2v = -3v - 1. Solve 0 = 4j - 4 - c for j. 2 Suppose -32 = -0y - 4y. Let b(u) = 5u2 - 14u. Let o be b(3). Solve og + y + 7 = 0 for g. -5 Let j = 67 + -65. Solve 10 = jc - 0 for c. 5 Suppose q - 2 = 1. Suppose -3i + 15 = -5m, m = -4i + qm + 6. Let t be (-15)/2(-4)/6. Solve 3y - 4y - t = i for y. -5 Suppose -x + 0x = 3a - 6, 3x = -4a + 3. Solve -af = -6f + 6 for f. 2 Suppose -15 = 2u + u. Let k = -5 - u. Suppose 5 + 5 = 5m. Solve k = -mg + 4 - 14 for g. -5 Suppose 34r - 33r = 3. Solve -4 - 5 = -rz for z. 3 Let u be ((-2)/60)/(-2). Suppose 5s + f + 2f + 3 = u, -2s = -3f - 3. Solve -3l + sl = -9 for l. 3 Suppose -4r = -27 - 5. Suppose -12y + ry + 32 = 0. Solve 4u + 0u + y = 0 for u. -2 Let r(x) = x + 2. Let m(g) = -g + 1. Let f be m(-5). Let d be r(f). Solve -w - w + d = 0 for w. 4 Let f(y) = y3. Let t be f(0). Suppose 4 = -n - 2j + 2, n - 12 = 5j. Suppose t = -ni, 2d - 6i + 2i = 2. Solve 2k - k = d for k. 1 Let k = -2 - -5. Suppose 0 = -d - d + 8. Solve kt - 3 = dt for t. -3 Let a be 2 - (1 + 2 + -1). Let s(y) = 2y2 + 29y - 17. Let o(w) = -w*2 - 14w + 8. Let g(p) = 13o(p) + 6s(p). Let u be g(-8). Solve -u = b - a for b. -2 Let v = -14 - -12. Let k = 8 + v. Solve 0 = -5a - 19 - k for a. -5 Let z be (-8)/63/(-2). Let c be 1 + 0 - (-2 - z). Solve 0 = -0h + ch for h. 0 Let g(d) = -8d3 - 11d*2 + 9d + 11. Let a(y) = -7y3 - 10y*2 + 8y + 10. Let z(x) = -7a(x) + 6g(x). Let n be z(-4). Solve -15 + 7 = -nf for f. 2 Let q = -6 + 9. Suppose 0 = -2f + 3p + 3, p - 12 = 7f - 2f. Let l be 2 + (0 + 6)/f. Solve -qb = -lb - 9 for b. 3 Suppose -3z + 5z = 3d - 35, d - 5z = 3. Let i = -8 + d. Solve if - 11 = -1 for f. 2 Suppose 8 = 4j - 0j. Suppose m - 12 = -jm. Solve -2r + 8 = -mr for r. -4 Suppose m - 4 + 0 = 0. Let z = m + -8. Let o be ((-3)/(-4))/((-1)/z). Solve os + 20 = -2s for s. -4 Let h be -3 - (-3 + 0 - 5). Let s = 3 - h. Let o = 4 + s. Solve 25 = or + 3r for r. 5 Let b(l) = -l - 1. Let u be b(8). Let c = u - -9. Let k be c/3 - 2 - -11. Solve j - k = 4j for j. -3 Suppose 2t - 5y = 35, 3t - 38 + 3 = 4y. Solve 0v - tv = 0 for v. 0 Suppose 5m + 1 = 31. Suppose a + 0a = 3. Suppose -l - 5 = ay - 1, 0 = -2y - m. Solve 6 + 14 = -lc for c. -4 Suppose x = 4x + 9. Let v be (-8)/(x - (1 - 2)). Solve 4s - 16 + v = 0 for s. 3 Let k be (-86)/(-8) - (-48)/(-64). Solve 0 = -z + 11 - k for z. 1 Let k(j) = j3 + 5j*2 + 2. Let s be k(-5). Suppose -sf + f = -8. Solve 0 = 2m + f - 4 for m. -2 Let z(l) = l3 - l2 - l. Let g be z(0). Solve 8 = -gx - 2x for x. -4 Let t = 90 + -89. Solve i + 2 = -t for i. -3 Suppose -i + 2r - 12 = -3r, -2r - 33 = 5i. Let n be 3 - 32/(-41). Let z = i + n. Solve z + 6 = 2b for b. 5 Let n(j) = -j3 + 5j*2 + 7. Let y be n(5). Let i = -10 + y. Let g be 0 + 6(-10)/i. Solve g = -0u - 5u for u. -4 Let a(o) = 3o2 - 3o + 4o2 - 4o*2 - 4o*2. Let f be a(-3). Solve fx = x for x. 0 Suppose -2j + j = 0. Let x be (1 + j)/((-2)/(-8)). Solve 0 = f + xf for f. 0 Let s(x) = x3 - x2 - x + 6. Let t be s(0). Let d = -63 - -65. Solve p + dp = t for p. 2 Suppose 2z - 28 = -4i + 54, -i - 2z = -16. Let s = 38 - i. Solve -3p - s = -1 for p. -5 Let g(u) be the first derivative of -u2 - 9u - 11. Let r be g(-6). Solve rs = 2s - 1 for s. -1 Let m = 48 + -48. Solve 0i + i + 4 = m for i. -4 Let p(h) = -h3 + h2 - 2h + 3. Let f be p(0). Solve -3g = -f - 9 for g. 4 Suppose -5b + 7 + 13 = 0. Suppose -12 = y - by. Let v(d) = 12d	{ "pile_set_name": "DM Mathematics" }
2 + 17v - 27. Let y(k) = -11k2 + 25k - 41. Let x(o) = -8m(o) + 5y(o). What is the hundreds digit of x(17)? 1 Let n(o) = o*2 - 23o - 20. Let x be n(24). Suppose -454 = -5s + xu, u - 2 + 3 = 0. What is the tens digit of s? 9 Let k(x) = x*2 - 5x - 8. Let t be k(6). Let y(d) = -d*2 - 5d + 4. Let p be y(-6). What is the tens digit of t(p - (-75)/(-6))? 2 Let a = 439 - -65. What is the hundreds digit of a? 5 Let i(f) = -5f + 0 - 13 + f - 13f. What is the hundreds digit of i(-7)? 1 What is the hundreds digit of (9/(-6))/(-3 + (-903)/(-302))? 1 Suppose -6m + 4m = 0. Suppose -2c - 6 = m, -75 - 35 = -x - 4c. Suppose 3 = -3i, 2i - 4i + x = 4y. What is the tens digit of y? 3 Let h be (54/(-7))/((-2)/168). Suppose -5n = -n - l - 654, -4n = -4l - h. What is the tens digit of n? 6 Suppose -181 + 1255 = l + 2w, 4w = l - 1044. What is the thousands digit of l? 1 Suppose 1 - 6 = -2p - q, -3p + 15 = 3q. Suppose -5a - 400 = -5y, p = 5y + 4a - a - 416. Let w = -53 + y. What is the units digit of w? 9 Suppose -793l = -798l + 9270. What is the hundreds digit of l? 8 Let a(z) = 14z*3 + 2z*2 - 1. Let f be a(1). Suppose 16b - 16 = fb. Suppose 0 = -4j + 4, -2j - b = -r - 6j. What is the units digit of r? 2 Let w(y) = -y3 + y2 - 2y + 150. Let m be w(0). Let j = -90 + m. What is the tens digit of j? 6 Suppose 20f = 25f + 70. Suppose 175 = -9y + 4y. Let w = f - y. What is the units digit of w? 1 Let z be (-1182)/27 + (-2)/9. Let c = z - -8. Let r = c + 57. What is the tens digit of r? 2 Let k(r) = -r2 + 4r + 1. Let t be k(3). Suppose -g - 4h + 5 = -3h, 0 = 4h - t. Suppose 0v + 36 = gv. What is the units digit of v? 9 Let b(c) = -c2 + 1. Let z(v) be the first derivative of 2v*3/3 + 5v*2/2 - 2v + 2. Let l(k) = -6b(k) - 2z(k). What is the tens digit of l(7)? 2 Let r(a) = 66a - 118. What is the units digit of r(5)? 2 Let o(y) = 52y - 37. Let s(f) = -f*2 + 3f + 15. Let r be s(5). What is the hundreds digit of o(r)? 2 Suppose -3r + 3u + 393 = -0u, -5r - 4u = -682. Suppose -3t + t = -r. What is the units digit of t? 7 What is the units digit of (-6)/9(-34515)/130? 7 Let j be -2 - (1 - 4) - -3. What is the tens digit of (-24)/(-18)138/j? 4 Let u be (1 + 0)/(1/27). Suppose u - 7 = 5r. Suppose 26 = l + w, -w + 78 = rl - l. What is the units digit of l? 6 Suppose y - 243 = 5u, u = 2y + y - 771. Suppose -x - y = -4x. What is the tens digit of x? 8 Let t(b) be the second derivative of b6/360 - b3/2 - 2b. Let p(z) be the second derivative of t(z). What is the units digit of p(-3)? 9 Let u = -1945 + 3361. What is the tens digit of u? 1 Let a(j) = 10j - 11j + 0 + 3. Let q be a(-3). Suppose -qt + 145 = -t. What is the units digit of t? 9 Let h(j) = 8j - 12. Let w be h(6). Suppose g = 4g - w. Suppose 0i = -4i + g. What is the units digit of i? 3 Suppose 15 - 159 = -4t. Suppose -5h + 2h = t. What is the units digit of (h - (-1 + -2))-1? 9 Let r = 254 + -252. What is the units digit of r? 2 Let l(o) = 3o + 13. Suppose -2d - 6 = 0, -5m + 0d + 5d = 70. Let v = m - -24. What is the units digit of l(v)? 4 Let o = 8257 - 5043. What is the hundreds digit of o? 2 Let k be ((-668)/6)/(4/(-6)). Suppose 0 = 3f - 3r - k - 430, 2f + 3r = 423. What is the hundreds digit of f? 2 Let w(l) = 15l2 - 1. Let t(y) = 8y*2 - 1. Let r(h) = 5t(h) - 2w(h). What is the units digit of r(-3)? 7 Let x(m) = 100m + 75. What is the hundreds digit of x(7)? 7 What is the tens digit of 4/(-2) - (-6212 + 2)/3? 6 Let h(d) = -d + 16 - 10d + 16 + 0. What is the hundreds digit of h(-8)? 1 Suppose 8k - 165 = 3k. Suppose -s + k = -3o, 0 = -0s + 5s - 15. Let b = o + 38. What is the units digit of b? 8 Let p(c) be the second derivative of -7c3/2 - 9c*2/2 + 34c. What is the units digit of p(-2)? 3 Let x = -58 + 100. Suppose -k = -4k + x. What is the units digit of k? 4 Let z = -9 + 9. Suppose f = -zf. Suppose -5s + d + 48 = f, -4s = -4d - 50 + 2. What is the units digit of s? 9 Let q(f) = 16f + 146. What is the units digit of q(-9)? 2 Suppose -3c + 2j + 2j = -26, 2j + 20 = 5c. Suppose -2f + 290 = -5k + 1060, -2k + cf = -302. What is the units digit of k? 6 Let h be ((-3 + 3)/(-4))/1. Suppose h = -3a + 12 + 3. Suppose 2p - 1 - a = 0. What is the units digit of p? 3 Let l = 1603 + -1113. What is the tens digit of l? 9 Let l(m) = 131m*2 - 14m - 2. What is the hundreds digit of l(2)? 4 Suppose -2h = 6 + 4. Let y = 9 + h. Suppose 3o - 49 = -4x, -2x = -yo - 0x + 80. What is the tens digit of o? 1 Let k(z) = z + 8. Let p be k(-3). Suppose 4f + 11 = -c, pc = c - 4f - 8. What is the units digit of c? 1 Let r(j) = j3 + j2 - 2j. Let t be r(-2). Let z = 41 + -39. Suppose t = 7d - zd - 115. What is the units digit of d? 3 Let x(w) = 23w - 75. What is the units digit of x(18)? 9 Suppose -10a - a = 1177. Let p = 170 + a. What is the tens digit of p? 6 Let r be (-126)/284/(-3). Let k be 8/141113/r. Suppose -2w - 4l + 14 + k = 0, -w - 3l + 60 = 0. What is the tens digit of w? 6 Suppose 5x = 4m + 5986, 8m - 6m = -4x + 4794. What is the thousands digit of x? 1 Let t = -5203 - -8261. What is the hundreds digit of t? 0 Let l(x) = 6x2 + 14x + 10. Let a(z) = 3 + 3z2 - 1 + 8 + 13z + 2z2. Let d(m) = 7a(m) - 6l(m). What is the tens digit of d(7)? 1 Let k(v) = -v3 - 10v*2 - 8v - 8. Let s be k(-12). Suppose s = 4i - 0i. What is the units digit of i? 4 Let u(k) be the third derivative of k6/180 + k5/20 + k*4/4 + 4k*3/3 - 12k2. Let j(i) be the first derivative of u(i). What is the tens digit of j(-6)? 4 Let x(q) = q3 - 42q2 - 30q + 23. What is the units digit of x(43)? 2 Suppose 3m + 3u = 245 + 295, -5u = 0. Suppose 3c + m = 6c + b, 0 = -3c + b + 174. What is the tens digit of c? 5 Suppose c + 4c - 110 = 0. Let m = c - 18. Suppose -123 = -3q + x, mq + q - 2x - 205 = 0. What is the tens digit of q? 4 Suppose 0 = 4z - 2z - 3k + 4127, -4z = 5k + 8199. What is the hundreds digit of 16/(-72) + z/(-18)? 1 Let k be 22 + -6 + (-2)/(-1). Suppose 21j - 108 = kj. Let w = -11 + j. What is the tens digit of w? 2 Let j(k) = 111k - 92. What is the units digit of j(7)? 5 Let v(l) = 77l3 - 2l*2 + l. Let c be v(1). Let y be -2 + (2 - 6/(-2)). Suppose -f - c = -yf. What is the tens digit of f? 3 Suppose -3j + 4d + 1774 + 616 = 0, 0 = -3j + d + 2393. What is the hundreds digit of j? 7 Let y(h) = -258h + 20. What is the units digit of y(-7)? 6 Suppose 8 = 8j - 16. Let l(z) = 25z - 8. What is the units digit of l(j)? 7 Let a(j) = j*3 + 9j*2 - 13j - 12. Let u be a(-10). What is the tens digit of u/(-12)820/(-6)? 0 Let r = 1225 - -535. What is the units digit of r? 0 Let d = -1355 + 3008. What is the hundreds digit of d? 6 Let w(q) = 28q*3 + 28q*3 - 2 - 55q*3 - 3q*2 + q. What is the tens digit of w(6)? 1 Let z(l) = -209l*3 + 5l*2 + 10l - 2. What is the tens digit of z(-2)? 7 Suppose 4m + k = 23, 2m = 6m - 5k - 53. Suppose mh = 9h - 18. What is the units digit of h? 9 Let q be (-17)/(4 - (-63)/(-15)). Suppose -i + q = 4k, 6i = 2i - 2k + 368. What is the units digit of i? 3 Suppose -3f - 2036 = 3c - 7193, -4f + 6c + 6926 = 0. What is the hundreds digit of f? 7 Suppose -312 = -h + 5y, -5h + 4y - 5y + 1430 = 0. What is the hundreds digit of h? 2 Let i be 1(6/(-2) - -4). What is the hundreds digit of (0 + 17)/(i/7)? 1 Suppose -7n + 34 = -1. Suppose 3a = 15, na - 2a + 535 = 2l. What is the hundreds digit of l? 2 What is the thousands digit of (-38568)/24(-2 - -1)1? 1 Let h = 47 + -34. Let a = h - 11. What is the tens digit of 14 + -4 + a/1? 1 Suppose -v + 4c = -11, 0 = 3c + 3 + 3. Suppose 69 = -vi + 252. What is the tens digit of i? 6 What is the tens digit of (-1327)/(-5) + 7/(-5)? 6 Suppose 4x = -0x + 64. Let a = 1 - x. What is the units digit of ((-84)/a)/((-2)/(-5))? 4 Suppose -2270 = -2l + o + 502, o + 5544 = 4l. What is the thousands digit of l? 1 Suppose 12 = -3i, 5r + 3i - 951 = 2r. What is the tens digit of r? 2 Let d(o) = -56o*2 - 11o - 15. Let p(x) = 28x2 + 5x + 7. Let b(g) = 6d(g) + 13p(g). Let h be 8/2 + (-33)/11. What is the units digit of b(h)? 8 Suppose 4c = 7c -	{ "pile_set_name": "DM Mathematics" }
/q + 2/(-4). Is 50/m(-136)/(-10) prime? False Let u(n) = 801n*2 + 98n - 2. Is u(9) prime? True Suppose 4 = 2n + 5z - 3z, 20 = -4z. Let s(k) = k - 1. Let r be s(n). Let v(g) = -g*3 + 12g*2 - 3g - 7. Is v(r) a composite number? False Let q(u) = 5u + 15. Let r(c) = -4c - 15. Let p(y) = -2q(y) - 3r(y). Let z be p(-8). Is (-334 - z)4/(-12) a prime number? False Let u be (-1)/(-4) + (-26200)/(-32). Let y be u/33 + 4/22. Let q = 10 + y. Is q composite? True Suppose y - 2w - 2 = -9, -5w - 35 = 5y. Let m(a) be the second derivative of -a*5/20 - 5a*4/12 - 2a*3/3 + 7a*2/2 - 8a. Is m(y) a composite number? True Suppose 5 = 5b, -3g - 2b = -4169 - 52476. Is g composite? True Let v = -2 - -3. Let c be (-5)/((-2 - v) + 2). Suppose -3o = -2j - 221, co + 5j = o + 333. Is o composite? True Let w(c) = 185c*3 + 2c. Is w(3) prime? False Suppose 3b + 3116 = -b. Let c = -1428 - b. Let x = c - -1190. Is x composite? False Let x = 6492 - 4183. Is x a composite number? False Is (-2 + 4 + -1)/((-1)/(-42865)) a prime number? False Let y(t) = -114t - 11. Let j(r) = -r*3 - 11r*2 - 2r - 26. Let h be j(-11). Is y(h) composite? True Let o = 1787 - -798. Let s = 4386 - o. Is s a prime number? True Let m(v) = 1156v3 - 3v*2 + v + 1. Let k be m(1). Suppose -k - 310 = -5j. Is j composite? False Let r = 7 - 4. Let q(o) = -5o + o3 + 1 - 2o*r + 0o*3 + 0 + 5o*2. Is q(-6) a prime number? False Suppose 1889r = 1901r - 195516. Is r a prime number? False Suppose 21 - 9 = 4a. Suppose g = -aq - g + 13459, 3q - 3g - 13464 = 0. Is q a composite number? True Is (2 - (0 + -1))(-325177)/(-87) prime? True Let d = 8205 + 6166. Is d prime? False Is 3/9612 - 30346/(-16) prime? False Suppose -2b + 0b - 2g = 0, g = -2. Suppose -3y = -x + 143, -by = 5x - 631 - 84. Suppose 5 = -3z + x. Is z a prime number? False Let t = 17761 + 6268. Is t prime? True Suppose -3n - 3v = -18, -9 = -2n + v + 12. Suppose ni - 321 = 156. Is i a composite number? False Suppose -4l + 6l + r - 42 = 0, 4l = -4r + 88. Let h be -724(55/l - -1). Is h/(-9) + 16/(-24) a prime number? False Suppose -i + 14569 = -b, 72833 = -7i + 12i + b. Is i a composite number? True Suppose 4s + 2w = 8, -4w = -2w. Suppose -st + 11 = -5h, -4t + h + 67 = -0h. Suppose -d + 113 = -t. Is d a prime number? True Let n = -21 + 23. Let d = -4 - n. Let g = 33 - d. Is g composite? True Let r(l) = 2l - 6. Let b = 27 - 21. Let y be r(b). Suppose ym + 7494 = 12m. Is m a prime number? True Let p(n) = n*3 - 11n*2 + 16n - 14. Let q be p(11). Is 142(q/12 + -5) composite? True Is 8886 - (5 - (6 + 0)) composite? False Let m be 3/((-12)/(-2)(-4)/(-24)). Suppose 0 = -ma + 3, n + a - 210 = 260. Is n a prime number? False Let z be (1/2)/((-3)/(-18)). Suppose -zn + 8 + 4 = 0. Suppose -i + 785 = ni. Is i a composite number? False Let q(y) = 13y2 + y + 7. Let c(l) = -l3 + l*2 - l - 4. Let k be c(0). Is q(k) prime? True Let x(g) be the second derivative of 5g4/4 + g3/3 + g*2 + 17g. Is x(-1) composite? True Let z be 279/(-18) - (3/3)/(-2). Is 1/(-2(z/(-3774))/(-5)) a composite number? True Suppose -y + 0 = -3. Suppose -5s = -2z - 5, 5s = yz - 0z + 10. Let k = s - -8. Is k a prime number? True Suppose t = 3l - 13795, 7l - 8l = 3t - 4585. Is l a prime number? True Is ((-104)/16)/(-13)319810 prime? False Suppose 20n - 16n - 111381 = q, 0 = -2n + 2q + 55692. Is n prime? False Suppose -10t = i - 15t - 4746, -18874 = -4i - 2t. Is i prime? True Is ((-58)/4)/(0 - (-6)/(-348)) a composite number? True Suppose -3j = 3q - 29 - 1633, 4q - 2217 = -5j. Is q a prime number? False Let u(r) = -11r + 2. Let b be u(1). Is 79/(2/b(-9)/4) prime? False Let o = 30158 - -15221. Is o prime? False Let s(d) be the first derivative of -41d*2/2 - 2d - 3. Is s(-11) a prime number? True Let p be (92/6)/(16/(-1560) - 0). Let m = p + 2577. Is m composite? True Let k = -314 - -568. Let t = 895 - k. Is t a prime number? True Suppose 0 = 5i + 2m - 1820, 3m - 1083 = -5i + 2i. Let w = -205 + i. Is w a prime number? False Let g = -65 + 77. Suppose -gr - 2219 = -15167. Is r prime? False Let n = 402 - 271. Let k = 203 - n. Let w = k + -50. Is w a composite number? True Let w = -11121 + 17408. Is w a prime number? True Suppose -5j - a - 982 + 369 = 0, -2a = j + 119. Let y = 136 - j. Is y prime? False Suppose 6w - 2647 = 7823. Is w composite? True Suppose 3x + 3n - 3 = 0, 3 = -3x - 8n + 3n. Suppose 3u = 5z - 508, -5z + xu = -z - 400. Suppose 41 = r - z. Is r a prime number? False Suppose 0 = -f - i + 8919, -5f + 44607 = -0i + 2i. Is f prime? True Suppose 5o - 3o - 4f = -4, 4o = -4f + 16. Suppose 5v - 2877 = 3b, 1162 = -0v + ov - 4b. Let u = v - 256. Is u composite? False Suppose -16t + 175161 + 152183 = 0. Is t prime? False Let m be (-54)/(-126) - (216/14 + -2). Let l = 328 - m. Is l a composite number? True Let k be 8/3 + (-3)/(-9). Suppose ku + 16 = 7u. Suppose 4r + t + 84 = 233, -4r + 152 = ut. Is r composite? False Let u = -64 + 428. Suppose -2c - 2c = z - 294, 5c + 3z - u = 0. Is c a prime number? False Let o = 26 - 22. Let x be (-8)/(-6)(7 - o). Suppose -xn + 51 = 3w, 4w + n - 33 = 22. Is w a prime number? True Suppose 0 = -17b + 20b - 5316. Suppose -895 = -2w - o, -3o - o = -4w + b. Is w a prime number? False Suppose 1519 + 9657 = 8a. Is a a composite number? True Suppose -3l - 840 = 9l. Is (-14)/l - (-14228)/10 composite? False Let m be 42/20 - (-24)/(-240). Suppose 0 = -mz + 581 + 5. Is z a composite number? False Suppose -14 - 16 = 2c. Let r be 3/(2 - (-21)/c). Suppose 0 = ri + 4z - 779, i + 2z - 628 = -3i. Is i a composite number? True Let s be 1(-2 + (3 - -130)). Suppose -2h - s + 513 = 0. Is h composite? False Let u be 4(3 + (-6)/3). Suppose 5562 = 5d + 4q - q, -2d + q = -2227. Suppose 2o - 448 = -2f, 9o = uo + 2f + d. Is o a composite number? False Let f(k) = 366k2 - k - 4. Let w be f(3). Suppose -p + w = 3s, -3p + 5s + 5554 + 4335 = 0. Is p composite? True Suppose -4783 = 41l - 42l. Is l a composite number? False Suppose 6 = 3f - 5w - 11, -f + 3w = -7. Is 1521/12 + 1/f prime? True Let b(c) = -c3 + c2 - c - 1. Let z(m) = 13m*3 - 6m*2 + 5m + 6. Suppose -34t + 15 = -37t. Let v(n) = tb(n) - z(n). Is v(-2) prime? True Let k = 17941 + -8648. Is k prime? True Suppose -2 = r - 8. Is 50/15153/r a composite number? True Let s(t) = 6t2 - 2t + 2 + 1 - 4t + 5t. Let v be s(-4). Suppose -f - 148 = -q - 6f, 4f = q - v. Is q prime? False Let x(b) = 129b3 - 5b*2 + 6b + 47. Is x(6) a composite number? False Let b(k) be the second derivative of 7k4/12 + 7k*3/6 + 13k*2/2 + 16k. Is b(-6) a composite number? False Suppose -64 = -3c + 19c. Is ((-6)/9)/(c/39594) a composite number? False Suppose -26f + 27f - 4 = 0. Is 1654 + (4 - (f/(-4) - -2)) prime? True Suppose -32t + 36t - 64324 = 0. Let w = -11304 + t. Is w composite? True Let j be ((-1)/(-1))/(-1)6. Let c = 9 + j. Suppose -cd = -2d - 787. Is d a composite number? False Suppose -3 = z - 0z. Let t be (3 + -4 - z) + 111. Suppose 3w - t + 20 = 0. Is w composite? False Let c = 97 - 94. Suppose 1266 = 3f + cf. Is f a prime number? True Let y(x) = 4x3 + x2 - 2x - 1. Let u be y(-3). Let o = u - -57. Let s = -23 - o. Is s a prime number? False Let q be 35/(-15) + 7. Suppose 5x - qx + 1679 = 0. Is x composite? True Let j(a) = a - 14. Let t be j(18). Suppose -6 = -2h + t. Suppose hq + 184 = 9q. Is q composite? True Suppose -2r + 3r = 8. Suppose -i + 3i + r = 0. Is -53((-4 - i) + -3) a composite number? True Let l(j) = 3j*3 - 5j*2 - 11j + 15. Let b be (-8 - -9) + 4 + 1. Is l(b) a composite number? True Suppose 0 = -3o - 4l + 1, -5o + 3o - 4 = 5l. Suppose -oy = -y. Suppose y = -4w - 588 + 1544. Is w composite? False Let l(p) = 2p*2 + 13p - 19. Let z be l(-8). Suppose u = -2, 6393 = 2y + zu + 1465. Is y composite? True Let v(g) = -311g3 + 2g - 2. Let t be v(2). Let n = t + 3657. Is n prime? True Let b be (-3)/(-12) + 10314/(-8). Let w = -852 - b. Is w composite? True Let c(p) be the first derivative of -p4/4 - p3 + 3p2 - 6p + 2. Suppose 4f + 10 = 5n, -f - 4n + 0n = 1	{ "pile_set_name": "DM Mathematics" }
g - 16, -8 = 2y + g - 4g. Let q be (-8 - -6)/(-4)-102. What is the hundreds digit of ((-644)/q + y)/(2/5)? 1 Let q = 101 - -253. Let t = -204 + q. What is the units digit of t? 0 Let x = -66 + 74. Let c(o) = -o3 + 10o*2 - 15o. Let q be c(x). Suppose -4b = -qb + 372. What is the units digit of b? 3 Let d(a) = 2a2 + 31a + 140. Let g(i) = -2i2 - 31i - 141. Let c(n) = -2d(n) - 3g(n). What is the tens digit of c(-15)? 2 Let k be -5 - (16/(-4) - 1105). Suppose 10p + k = 14p. What is the tens digit of p? 7 Suppose 0 = 3z - 2d + 24 + 34, 0 = 3z + 2d + 38. Let h(j) = -j*3 - 12j*2 + 14j - 17. What is the units digit of h(z)? 3 Let g(y) = -5y2 + 4y - 23. Let i(w) = -w*2 + w - 1. Let z(r) = g(r) - 6i(r). Suppose 0 = -16f + 5f + 77. What is the tens digit of z(f)? 1 Let s be 2((-694)/4 - -5)-11. Suppose 11y - s + 66 = 0. What is the tens digit of y? 3 Suppose c + 24 = 5r + 47, 2c + 2r = -2. Suppose -9w - 1576 = -3f - 5w, 0 = f + cw - 521. What is the hundreds digit of f? 5 What is the tens digit of 18806 + -818/8? 8 Let o(z) = 22z + 5. Let q be o(-2). Let m be (-2)/(-13) - 2724/q. Suppose -4r + m = r. What is the units digit of r? 4 Suppose -13 = n - 4h, -2h + 5h = -n + 8. Let s(c) = -26c - 8. Let k(z) = z + 1. Let r(o) = ns(o) - 4k(o). What is the tens digit of r(7)? 5 Let q be 3 - (-3 + 0 + 2). Suppose -qi - 12 = -m - 43, 20 = 2i - 2m. What is the tens digit of -1 + (-1342)/(-8) + i/28? 6 Let o(m) = 252m + 1. Let s be o(1). Let z be 6 + (-12)/3 + s. Let c = z - 158. What is the units digit of c? 7 Let c(v) = -v2 + 3v + 15. Let m be c(11). Suppose 3g = 4s - 2s - 55, 144 = 5s - g. Let t = s - m. What is the units digit of t? 2 Let q be (3/(-21) - 7/(-49))/2. Suppose q = r - 5r + 12, 2r + 1430 = 2i. What is the units digit of i? 8 Let m(c) = -2c + 129. Let i be m(0). Let r = i + -66. What is the units digit of r? 3 Let l(b) = 2b2 - 11b - 37. Let h be (0 + 4 + 1)(5 + -7). What is the hundreds digit of l(h)? 2 Let n(p) = -8p + 30. Let h be (-7 - 4) + 7 + (-24 - 1). Let k = -48 - h. What is the tens digit of n(k)? 8 Let k = 39 - 45. Let s be ((-4)/k)/((6 + -4)/12). Let w(q) = q*3 + 4q*2 + 2q - 1. What is the hundreds digit of w(s)? 1 Suppose -6j = -8j + 196. Suppose -90 + j = 2d. Suppose 59 + 115 = x - dg, 5g = -2x + 296. What is the tens digit of x? 5 Suppose -3t + 45 = d, 0 = 3t - 7d + 4d - 45. Suppose -r - 380 = -3y + r, 3r - t = 0. Suppose 0 = w - 3w - 4n + y, 0 = n. What is the tens digit of w? 6 Let i be (-122)/45/(-10)-4. Let t = -73 - i. What is the units digit of (-552)/(-5) + t/30? 0 Let k be (-28)/16-28 + 1 + -1. Suppose -3j + 4b = -0j - k, 0 = j - 4b - 11. Suppose -15s = -js + 316. What is the tens digit of s? 7 Let t(f) = -1016f - 8. Let g be t(-3). Suppose -g = -u - 7u. Suppose u = -0r + 4r. What is the tens digit of r? 9 Let u = -26242 + 50175. What is the tens digit of u? 3 Let d be (-1254)/(-34) + (-14)/(-119). Suppose 214 - d = h. What is the hundreds digit of h? 1 Suppose 0 = -3y - 2m + 25, y = 5y - 3m - 39. Suppose yv - 5464 = 2429. What is the hundreds digit of v? 8 Let h(k) = -3k + 66. Let x be h(16). What is the units digit of x/((-3)/27-6)? 7 Suppose 10570 = c + 5s, -c + 12411 - 1845 = 3s. What is the units digit of c? 0 Suppose 51516 - 1494 = 9g. What is the units digit of g? 8 Let l(c) be the third derivative of 31c*4/12 - 43c*3/3 - 78c*2. What is the tens digit of l(13)? 2 Suppose 2o - 6 - 14 = -4r, -5r + 26 = 3o. Let s be (3/o - 1) + (-33)/(-6). Suppose -sn + 6 = -0. What is the units digit of n? 1 Let x = 2068 - -7778. What is the thousands digit of x? 9 Let p be (-2143)/15 - ((-129)/45 + 3). Let j = -114 - p. What is the tens digit of j? 2 Suppose 0 = 5l - 10, -5d + 2l = -3d + 114. What is the hundreds digit of (-981)/(-1) + 0/d? 9 What is the tens digit of 1/(38/247 + (-59556)/387452)? 5 Let i(g) = 96g + 8914. What is the ten thousands digit of i(40)? 1 Suppose -2t - 2p + 42358 = -26638, -3p = -12. What is the hundreds digit of t? 4 Let m = 4490 - 2583. Suppose m + 5166 = 11z. What is the units digit of z? 3 Let w(y) = 46y + 167y2 - 53y - 8 + 1 + 45y2. What is the hundreds digit of w(3)? 8 Suppose 0 = h - 3h - 12. Let b(d) = d*3 + 11d*2 + 14d + 16. What is the tens digit of b(h)? 1 Suppose -2z - 11q - 65986 = -5z, -20 = 4q. What is the hundreds digit of z? 9 Let a(l) = -2l2 + 50l - 4. Let b be a(25). What is the tens digit of (2334 - 6)/(-8)b/3? 8 Let h(i) = 3i*2 + 90i + 24. Let l be h(-38). Suppose 3m + m - l = 4v, 0 = -m - v + 224. What is the hundreds digit of m? 2 Let s(r) = -r*2 - 25r - 19. Let t(l) = -l*2 - 24l - 17. Let a(q) = 4s(q) - 5t(q). What is the units digit of a(-21)? 0 Let x be 5/33 - -173. Suppose -4d = -x - 62. What is the tens digit of d? 6 Suppose 4m = 750 + 510. Let u = 561 - 360. Let v = m - u. What is the units digit of v? 4 Let u(w) = -61w + 192. Let h be -30 - (12/12 + -1 + 0). What is the thousands digit of u(h)? 2 Let o(h) = -3h2 - 3h + 4. Let f be o(2). What is the hundreds digit of 23/161 - 16644/f? 1 Let h = -143 + 145. Suppose -z + 276 = 3z - 4u, 2z = -hu + 150. What is the units digit of z? 2 Let t = 1672 - -2586. What is the hundreds digit of t? 2 Let d(h) = 211h2 + 48h + 388. What is the tens digit of d(-8)? 0 Let n be 557 - (7 + -6)/1. Suppose z + 4x - n = 0, -5z - 3x - 151 = -2122. What is the units digit of z? 6 Let w(p) = 3p2 - 5p + 10. Suppose 8u + 11 = 43. Suppose 5 - 25 = -us. What is the units digit of w(s)? 0 Suppose 60t - 59t + q - 7613 = 0, -3q + 7603 = t. What is the units digit of t? 8 Let h = 3926 - 579. What is the tens digit of h? 4 Suppose -2g = 3g + 25, 2t - g - 563 = 0. Let i = -27 + t. Suppose -o = -13o + i. What is the tens digit of o? 2 Let c be ((-1)/(-2))/(2/548). Suppose -4u = 12, u - c = -r + 28. Let g = r - -43. What is the hundreds digit of g? 2 Suppose 186h - 192h + 24 = 0. What is the tens digit of (3 + 9850/(-70))(-14)/h? 8 Let w = 128 - 188. Let d(r) = -213r + 108. Let v be d(1). Let u = w - v. What is the tens digit of u? 4 Let z = -2449 + 1371. Let u = 1565 + z. What is the tens digit of u? 8 Let x = 7375 - -2213. What is the thousands digit of x? 9 Let b(p) = 42p2 + 16p + 123. What is the thousands digit of b(-11)? 5 Suppose -19f + 32652 = -2f - 50036. What is the hundreds digit of f? 8 Let x = -116 + 121. Suppose -xt - 532 = -12t. What is the tens digit of t? 7 Let k be ((-1)/(-2))/(14/308). Let a = k + 44. Suppose 0 = -f - a + 193. What is the hundreds digit of f? 1 Let i(y) = 4 + 38 + 4 + 2y. Let o be i(-21). Suppose -4x + 141 = d, -2x - 3x - od + 179 = 0. What is the units digit of x? 5 Let m = 2244 + -3228. What is the tens digit of (-15)/(-2)m/(-15)? 9 Suppose 4d = -4p + 19 + 37, 2p - 4d - 34 = 0. Suppose 5w - 2392 = 4b, pw - 19w + 1918 = -b. What is the tens digit of w? 8 Let z be 176/(-18) - 8/36. Let p = z - -14. Suppose 5b = k - 108, 0b = -k + pb + 107. What is the hundreds digit of k? 1 Suppose 0 = -5w + 2a + 17087, 29w + 3a = 30w - 3433. What is the units digit of w? 5 Let o(p) = 308p2 + 91p + 186. What is the hundreds digit of o(-2)? 2 What is the units digit of (-16 + 0)/(7/(-49))5262/24? 6 Let l = -427 - -1272. Let x = l - 337. Suppose -4s + s = 3k - 384, -2s + x = 4k. What is the tens digit of k? 2 What is the thousands digit of (-32 + -5)-645 - -4? 3 Suppose 0 = 26j - 20j - 13236. Suppose 2p = -3p + 2v + j, -1332 = -3p + 4v. What is the units digit of p? 0 Let c(x) = 399x*2 + 69x - 443. What is the units digit of c(6)? 5 Let p(u) = 3u + 24. Let d be p(-7). Suppose dr + a = 105, 167 = -0r + 5r - a. Suppose -r = -b + 43. What is the tens digit of b? 7 Suppose 0 = 9v + 65 + 16. Let y(z) = 19z + 7. Let q be y(v). Let m = -114 - q. What is the units digit of m? 0 Let l(a) = 8a2 - 533a - 96. What is the tens digit of l(70)? 9 Let a(j) = 89j - 80. Suppose 21 = 3w + 3k, 5k - 19 = 2w + w. What is the units digit of a(w)? 8 What is the ten thousands digit of (3/(-6))/((-2)/(-18))1011080/(-345)? 1 Let i(d) = 7d3 + 4d*2 - 4d - 7. Let h(q) = 8q3 + 5q*2 - 5q - 7. Let j(	{ "pile_set_name": "DM Mathematics" }
7 + -4)? 4 (202 - 90) + -174 - 46 -108 What is the value of (37 - 39) + 60 + (-7 - -4) + -4? 51 Calculate 183 + -163 + -82 - (2 + -4). -60 Evaluate -4 + (-57 + 11 - -47) + -1 + -58 + 1. -61 Calculate -47 - 6 - ((9 - 10) + (0 - -4) + -4). -52 What is (-3 + -4 + (20 - 18) + 9 - -4) + -55? -47 Evaluate -12 - 6 - 5 - -44. 21 159 + -47 + (-170 - -134) 76 Evaluate 8 + -2 + -16 - (-10 + (-29 + 17 - 51)). 63 Calculate -10 - -60 - -24 - (-9 + 4 + -6). 85 What is the value of (-71 - -9) + (14 - (5 - 14))? -39 What is the value of -200 + 176 - (-3 + -64)? 43 3231 - 3153 - (4 - (4 + (0 - 2)) - 2) 78 38 - (111 - -14) - -43 -44 Evaluate 14 - ((1 - 1) + 18 - (-49 - -35)) - 0. -18 (-2 - 2) + 12 + 5 + (-158 - -74 - -79) 8 Calculate (4 - ((-8 - -9) + (0 - -5))) + 21. 19 What is -51 - (79 + -66) - -52? -12 Calculate 82 + (1 - -16 - 51) + 9. 57 2 - 9 - ((-37 - 14) + 23) 21 Calculate 28 + -6 + -4 + -35 + (-1 - 54). -72 Evaluate -107 - (-187 + 83) - (2 - 0 - -6). -11 What is the value of 26 + 14 + -38 - (28 - 119)? 93 Calculate (8 + -8 - -13) + (9 - (-15 - -33)). 4 Evaluate (54 - (2 - 0)) + (1 + -3 - (-2209 - -2206)). 53 (-684 - -708) + (0 - -115) - 18 121 Evaluate -133 + (5 - (-5 - 1)) + (4 - (17 - -1)). -136 What is (12 - -1) + (156 - 119 - 55)? -5 What is 40 - -67 - (-11 - -67)? 51 Evaluate 18 - (-13 + 10 + -24 + 28 - -28). -11 -24 + (-10 - -12) - (-70 - -90) -42 What is -130 + (-64 - -184) + -2? -12 What is the value of (2 - 8) + -17 + 110 + -43 + 34? 78 What is -13 - (-33 - (-44 - -22))? -2 (-230 - -31 - -75) + (-1 - -3) + (-3 - -15) -110 Evaluate -12 + (117 + (1 - 4) - (32 + -44 + 9)). 105 Evaluate 58 + -7 - (-5 - (-3 - 10 - 2)). 41 What is the value of 2 + (68 - (83 + 47))? -60 Calculate (20 - (35 + -19)) + -3 - (54 - 5). -48 What is the value of -11 + 4 + 17 + 24 + -64? -30 Calculate (-29 + -12 + 40 - -53) + -10. 42 Calculate -37 - (23 + (-99 + 28 - -34)). -23 What is the value of -3 - (13 + (39 + 66 - (2 - (-2 - 1))))? -116 What is -16 - (7 - (13 + -6 + (12 - 9)))? -13 (15 + -24 + -7 - -37) + (-2 - -1 - 0) 20 What is the value of (-15 - (20 + -16)) + (28 - -19)? 28 Calculate -24 + ((8 - 3) + -34 - (-127 - -109)). -35 Evaluate (-2616 - -2594) + -4 + -16. -42 Calculate 10 + (47 - (-1 - -1)) + 1 + 3. 61 Evaluate (-1 - -9) + (-114 - -113) + (-77 - (-23 + 13)). -60 Calculate (39 - (-40 + 56)) + 8. 31 What is 8 - (-16 - -57 - 22) - (-3 - 28)? 20 Calculate -161 + 172 + (-1 - 1) - (3 + -1 + -62). 69 (15 - (-14 + 126 + -7 + 9)) + -1 + -12 -112 What is (46 - -73 - -36) + -69? 86 Evaluate 1 + 3 - (-10 - (34 - (3 + -21))). 66 Calculate (-4 - 0 - (31 + 3)) + -12 + (9 - 5). -46 What is the value of 52 - (0 + -1) - (-5566 + 5586)? 33 -8 - ((8 - -9 - 15) + -90 + 10) 70 (5 - 14) + 5 + 35 + -33 -2 Evaluate (33 - (110 - 17)) + 57. -3 Evaluate 87 - (-16 + 10 + -2 - (-6 + 2)). 91 What is the value of -39 + 47 + (-66 - -34)? -24 (-63 + 6 - (-21 + 18 - 3)) + -8 -59 What is 0 + (-9 - (-1 - (5 + -5 + 3)))? -5 Evaluate -21 + 89 - 35 - 48. -15 What is (-3 - 48) + 1807 + -1714? 42 Evaluate -14 + -67 + 30 + 16. -35 What is (12 + 5 - 10) + -17 + (21 - 13)? -2 What is (-13 - (-4 + 0) - 5 - -18) + 18? 22 Calculate -39 + (-4 + 3 + -8 - 9) + 7. -50 Calculate 4358 - 4369 - ((0 - -69) + -1). -79 31 + (-86 - -20) - -21 - 33 -47 Evaluate -48 - (-35 - -13 - -15). -41 (-20 - -10) + (-7 + 2 - -6) -9 What is 413 + (-485 - -67) + 0 + 57 + -1? 51 What is the value of 2 - (16 + (4 - -1)) - (-8 + -6)? -5 What is (-1432 - -1437) + (-16 - (-3 + 0)) - 60? -68 What is (-39 - (-55 + 35)) + 25 + 42? 48 What is (-30 - (61 + -57)) + 128? 94 What is -26 + -3 - (-63 - -24 - -47)? -37 -7 + 2 + 1 + -264 + 324 56 -7 + (8 - -4) + (910 - 843) 72 Calculate -180 + 191 - (25 + -2) - (-1 + 25). -36 -41 + -71 - (-170 - 53) 111 What is the value of 0 + (-103 + 78 - (-5 + 15))? -35 Calculate 1429 + -1458 + (-87 - 6). -122 (6 - -3) + -15 + (0 + 1 + -4 - -56) 47 Calculate -1031 + 1051 + (-2 - 64). -46 Calculate 8 + (33 + -14 - 13) + -5 + 38. 47 What is the value of 31 - 72 - (64 - 80)? -25 What is 507 + -519 + (49 - -2)? 39 Calculate (633 - 639 - (-7 + -1)) + 12 + -22. -8 Evaluate (-2 + 27 - 27) + -6 + 1 + (158 - 171). -20 Calculate -1051 + 1033 - (-22 - (-3 - 0)). 1 4 - (-3 - 11 - (227 + -252)) -7 Calculate (23 - (41 - 10)) + 53. 45 Calculate 74 - ((11 - 1) + 14 + -10 + -12 + 2). 70 What is -27 + -3 - (-9 + -16 + -11 - -22)? -16 -19 + -1 + (-410 - -416) -14 What is (-50 + 21 - 13) + 23? -19 What is -1 - 35 - (4913 - 4947)? -2 What is the value of (13 - 10) + 7 - 2 - (-2 - -17 - -97)? -104 Calculate -81 - (-2 + -2 + (-6 - 1) - (75 + -76)). -71 Calculate -10 - (11 - -9 - 22 - (-4 + -39 - -3)). -48 17 + (29 - (28 - -1)) + (-10 - -2) 9 1 + -17 + (-17 + 66 - 100) -67 Calculate (-5 + -9 - -54) + -12 + 1 + 6 + -8. 27 What is the value of 47 + 0 + (29 - (16 + 44)) + 32? 48 What is the value of -89 - (-37 + -51) - (12 - 1)? -12 -22 + -6 + (-15 - -37) - (-1 + -15) 10 What is the value of (-69 - (-14 - (5 + 3))) + (-20 - -12)? -55 What is the value of (9 + 8 + -9 - (32 - 11)) + 26? 13 What is (8 - 4) + 8 + (15 - -1) - -11? 39 Evaluate 39 + (-8 - 19) + (-29 - -1) - 11 - -8. -19 What is the value of (31 - (-28 - -16)) + (-1 - 74)? -32 What is the value of (58 + -10 - (-3 - -6)) + -21? 24 Evaluate 106 + -38 - (3 + (-8 - -1) + (81 - 68)). 59 Evaluate -3 + -3 + (-11 - (30 + -7 + -7)). -33 What is -20 - (79 - (64 + 35))? 0 Evaluate 13 - 11 - (-28 + 12) - 32 - -117. 103 Calculate -50 + (-28 - -58) - (1 - 8). -13 What is 8 + -10 - -4 - (13 - 15) - 19? -15 What is -5 - (-28 + 12 + 3 + (-2 - 43))? 53 What is the value of (20 + -5 - (-15 + 20 - 8)) + 31? 49 Evaluate -2 + -11 + (1 + 13 - (26 - 23)). -2 -1 - 43 - (-2 + (15 - 6) + (-13 - -3)) -41 Calculate -9 + (65 + -18 + -10 - (8 + -5)). 25 2 + 75 - (24 + 25 + -56) 84 What is 14 - (-47 + -21 + 65 - (11 - 2) - 42)? 68 What is (-3 - 0 - (-4 - -1)) + (5 - (-22 + 16))? 11 What is the value of 6 + (-4 + -23 + 35 - (1 + -3))? 16 Calculate -34 - (28 - ((32 - 32) + -41)). -103 (790 - 691) + (-18 - -1) 82 Calculate 55 + (-20 - (-5 + (17 - 20))). 43 What is the value of 804 - 805 - (-2 + 1 + 7)? -7 Calculate -3 + (-34 - -35) - 15. -17 What is (25 - (-1 - (-3 + 11 + -16))) + -14 + 13? 17 (16 - (15 + (-9 - 12))) + 23 45 What is the value of 19 + -17 + (-19 - -32) - (66 + -14)? -37 What is 3 - (33 + -14 + -16 - 0)? 0 What is -44 + (154 - 34) + -68? 8 -105 + (100 - (166 + -100)) -71 (0 - -5) + (-52 + 15 - (41 + -36)) -37 Calculate (-4 + 19 + 10 - 24) + 15 + 47. 63 Evaluate (90 - 138) + (61 - 5). 8 What is 49 - -65 - 47 - -9? 76 Calculate (30 - (-13 + (30 - -4))) + 8 + -97. -80 What is the value of 7 - (-1 + 6) - ((-4 + 0 - -10) + 4)? -8 Evaluate 0 + (-39 - 3) + 33 + -22. -31 Evaluate -57 + 2 + 48 + (76 - 106). -37 Evaluate (-9 + 11 - -84) + 1 - (-8 - -25). 70 What is (7 + 11 - (-9 + 15) - (9 - 2)) + 3? 8 Evaluate 196 + -218 + (-1 - -10). -13 Evaluate 1603 + -1648 + 0 + 95. 50 Calculate -31 - (-87 + (28 - 5)) - 18. 15 -12 - ((-185 - -178) + (1 - (3 - -2))) -1 -3 + (-11 - (-5 + (-4 - -5))) - (1 - -1) -12 What is (-92 + 194 - 123) + 50 + -2? 27 What is (27 - (-25 + 42)) + -1 + 3 + -77? -65 (-113 - 0) + -2732 + 2792 -53 Calculate 100 + 19 + -211 - -126. 34 Calculate (-2461 - -2503) + 2 + -12. 32 What is -3 + (3 + -5 - (1 - 16)) + (100 - 179)? -69 Calculate -24 - 0 - (7 - ((-12 - -21) + -8)). -30 10 - 0 - (32 - ((111 - 113) + 4 + -1)) -21 What is 13 + (-27 + (36 - 20) - 20)? -18 Evaluate -16 + (-13 - -25 - 9 - 0) + 0 + -2. -15 Evaluate 43 - (42 + (26 - (16 + 25))). 16 30 + -8 + (-85 - -61) - (2 - -43) -47 What is the value of 9 + -11 + -8 - (0 + (-11 - -5) - 34)? 30 Evaluate 0 + 0 + 47 + -1749 + 1737. 35 (-134 - (8 - 116)) + -82 -108 What is the value of (1 - -5) + (16 - (3 - -14)) + -4 - 7? -6 104 + (-23 + 20 - 23) + 40 + -24 + 1 95 Calculate -3 - -14 - (37 - 124). 98 -6 + 14 + 10 + -32 + 8 - 7 -13 Evaluate 23 - (-18 + -26 - -9). 58 Evaluate -54 + (111 - 34) - (-65 + -3). 91 What is 60 + -76 - (4 + -7 + 44)? -57 What is the value of 55 + -4 + 1 + 2 + (8 + -4 - 2)? 56 Evaluate (-138 - -138 - -57) + -58. -1 3 + 0 - (-22 + 13 - 4 - -102 - -8) -94 What is 170 - (8 + 4 + -67 + 91)? 134 -3 - (39 + 5 - (-79 - -210)) 84 Evaluate -115 - -16 - (-92 - -4). -11 Evaluate 234 + (-204 - 52) + -59 + -1. -82 Evaluate 31 + -6	{ "pile_set_name": "DM Mathematics" }
ange -4z3 + 1 + 5z*3 + 3z + 0 + 4z3 + z3 - 2z*3 + (0z*2 - 3z2 - z2)(5 - z - 5) to the form pz + nz2 + m + kz*3 and give p. 3 Express (-3w3 + w3 + 7w3 + (-4w + 5w + 0w)(7w*2 - 3w*2 - 2w*2))(-5 + 5 - 2w) as hw*2 + lw + rw4 + d + zw*3 and give r. -14 Rearrange -3q - 3q + q - 2q to n + xq and give n. 0 Express (5x - x - 3x)(3x2 + 0x*2 - 5x*2 + (4 - 4 + x)(3x - 4x + 0x) + x2 + 5x2 - x2) as yx3 + kx*2 + a + ix and give y. 2 Express (10f + 79f + 18f)(-f*3 - 4 + 4) in the form yf*2 + g + sf + df3 + hf*4 and give h. -107 Rearrange 209 - 209 - 38p to the form w + yp and give y. -38 Express -p2 - p3 + 11 - 25 + 13 as dp*2 + yp + fp3 + u and give d. -1 Express (-20s*3 + 130s - 130s)(1 + 2 - 4)(-3 + 1 - 1) as is*2 + ys*3 + h + bs and give y. -60 Rearrange (21 + 16 - 14)(-n + 0n - 2n) to ln + g and give l. -69 Express 4p2 + 3p*2 - 6p*2 in the form gp*2 + np + l and give g. 1 Rearrange -1 - 7t2 + 23t*2 - 5t*2 to pt*2 + wt + i and give i. -1 Rearrange -74b + 0 + 2 + 73b + 5 to the form zb + p and give p. 7 Rearrange -5 + 7 + 14z*2 - 3 to the form nz + uz2 + s and give u. 14 Rearrange 4y*3 - 2y3 - y3 + 40 - 42 to qy + by*2 + a + ny*3 and give n. 1 Rearrange 0w2 - w4 - 8w + 2w2 + w3 + 0w2 to fw + hw3 + qw*4 + o + jw*2 and give j. 2 Rearrange 0x + 2x2 - 4x - 2x2 - 2x*2 to q + rx*2 + gx and give g. -4 Express (0 + 5 - 4)(-12v + 28v + 2 - 4v) as rv + y and give r. 12 Express -19 - 1 - 60 + 2w in the form l + cw and give l. -80 Express -1 + 1 + c2 + (11 - 11 - 2c)(-3c - 2c + 3c) + 6 - c*2 - 6 in the form q + fc*2 + kc and give f. 4 Rearrange c - 2c3 - 36 + 36 + c4 - c2 to vc + s + uc4 + pc*2 + ac*3 and give v. 1 Express (-2l + 4l + 0l)(-3l + 2l - 2 + 0l) in the form d + pl2 + xl and give p. -2 Rearrange 7k2 + k2 - 2k*2 - 9k*2 + 4k*3 to the form tk*2 + fk + yk3 + p and give y. 4 Rearrange 24 - 3d - 15 + 0d + 2d to the form yd + i and give i. 9 Express 820 - 820 + 116t as j + at and give a. 116 Rearrange 9560t + t*3 - 4t*4 - 9560t - 3t2 + 2 to yt*2 + o + xt + at3 + mt*4 and give a. 1 Express -3c*2 + 3c + 19 - 2c3 - 32 + 12 as jc*2 + y + nc + wc3 and give y. -1 Rearrange 3 + 7x2 - x2 + 7x2 - 9x*2 to the form px*2 + a + nx and give a. 3 Express -135w4 + 270w4 + w2 - 138w4 - 3w + 2w3 - 1 + 4 as lw*4 + cw*3 + jw + tw2 + g and give l. -3 Rearrange (u - 2 + 0u + u)(1 - 13u3 - 1 - 2 + 2 - u3 + (1 - 1 + 2u)(-4 + 4 - 2u2)) to vu*3 + ou*4 + yu*2 + t + ku and give v. 36 Express 11k3 + 3k + k*4 + 163 - 5k - 161 in the form xk + pk*4 + i + hk*2 + qk*3 and give q. 11 Rearrange (-4p*4 + 0p*4 + 2p*4)(-1 + 1 + 3) + 2p4 - 2p*4 + 7p*4 to n + wp*4 + yp*3 + tp + mp2 and give w. 1 Rearrange -5b*2 + 6b*2 - 3b*3 + 2b*3 to jb + qb3 + db*2 + r and give d. 1 Express -5v + 31 - 2v4 + v4 + 2v*2 - 32 as wv*3 + uv*4 + i + nv*2 + bv and give b. -5 Express -3o + 0o - o + o*3 - 2 + o as ko*2 + c + uo*3 + wo and give u. 1 Express 0k3 - 7k*3 + 4k + 2k3 as wk*2 + sk*3 + uk + b and give s. -5 Rearrange (-3p2 - 4p*2 + 2p*2)(1 - 2 + 4)(3p - p - 4p) to rp*3 + wp + cp2 + t and give r. 30 Rearrange 2 - 2 - 18c + 0 to u + lc and give l. -18 Express -k + 2k*2 - 6k*3 - 1 - 4k3 + k4 - 8k3 + 20k*3 in the form wk*4 + sk + pk3 + ak*2 + q and give p. 2 Rearrange (0 - u + 0)((-u - u + 3u)(1 + 2 - 4) + (-2u - 3u + 4u)(-4 + 3 + 3) + u - 4u + 2u) to t + ou2 + qu and give o. 4 Express (0k + 2k - k)(-5 + 0 + 3) + 0k - k - 3k - 2k + 3 - 3 + (-3 + 3 + k)(-2 + 3 - 3) - 6k + 3k + k in the form dk + m and give d. -12 Express s*2 - 5s + 0s2 - 2s + s*4 - 2s*3 + 4s as vs4 + bs*2 + r + ls + ps3 and give l. -3 Express -i3 + 0i*3 + 0i*2 + 2i*3 + 3i*2 as b + qi*2 + ui + si3 and give q. 3 Rearrange -2q*2 + 17 + 10 - 7 to the form t + aq*2 + fq and give t. 20 Express (3i3 + 13i*3 - 2i*3)(-5 + 2i + 5)(4 - 3 + 1) in the form ki2 + ai*3 + w + si + ni4 and give n. 56 Express 1222g - 1224g - 2g*2 + 3g*2 in the form l + vg*2 + ng and give n. -2 Rearrange (4 - 4 - 11d)(-2d + 1 + 1 + 0d) to ad2 + cd + b and give a. 22 Rearrange 8a4 + 22a*4 - 6a4 + (-a3 + 0a + 0a)(-a - 5 + 5) to the form fa*3 + ha*4 + ga + ua2 + o and give h. 25 Rearrange (5d + 7d - 70d)(0 + 0 + 2d) to the form i + rd + gd*2 and give r. 0 Rearrange (-2 - 3 - 3)(-2c3 + 4c*3 + 0c*3) + (4c3 - c3 - 4c3)(-3 + 1 + 1) to the form w + kc + tc*3 + hc*2 and give t. -15 Rearrange (-2x*3 - 3 + 3)(0x + 3x - 9 - 2x) + 3x2 - x4 - 3x2 to l + hx*2 + zx*4 + rx*3 + gx and give r. 18 Rearrange 8g2 - 14g*2 + 2g*3 - 2g*4 + 5g*2 - 3g to kg2 + sg*3 + ng*4 + yg + i and give s. 2 Rearrange -4 - z*2 + 9 - 5 + 33z to the form uz2 + iz + c and give i. 33 Rearrange -2 + 2 + 17o - 7o to the form t + go and give g. 10 Express (b - 2b - 16b)(b*3 - 9b*2 + 9b*2) in the form hb*4 + w + yb + ob3 + qb*2 and give h. -17 Rearrange (-5y*2 + 3y*2 + 3y*2)(2y + y2 - 2y) + (1 + 8 + 2)(-y4 - 4y + 4y) to the form xy*4 + ay + zy2 + wy*3 + u and give x. -10 Rearrange -8a3 + a - a2 - a to the form qa + u + za*2 + la*3 and give l. -8 Rearrange d - 4d*3 + 3 + 0d2 - d2 + d2 - d2 to the form i + gd + pd*3 + bd*2 and give i. 3 Rearrange -28n - 104n + 10n to the form a + hn and give h. -122 Rearrange 9m*4 - 9m*4 - 7 + 2m*2 + 2m3 + m4 to fm + jm*4 + xm*2 + u + dm3 and give j. 1 Rearrange -2 + z4 - z + 2z + z4 + z4 to b + cz*4 + dz + yz3 + kz*2 and give b. -2 Express (-6p - 13p + 14p - 1)(0p + 2p - 4p) as bp2 + ip + o and give b. 10 Express -k*2 - 2k*2 - 10k*2 + 8k*2 as l + jk*2 + nk and give j. -5 Rearrange v4 - v4 + 2v4 + (41v + 104 - 104)(-2v*3 + 3v*3 + 0v*3) to m + nv*2 + kv + tv4 + dv*3 and give t. 43 Rearrange -3 - l + 1 + 3 to bl + o and give o. 1 Rearrange (116x + 98x - 29x)(3 + 2 - 3) to the form f + mx and give m. 370 Express -2f*3 + 0f*3 - 5 + 2f + 5 as i + kf3 + jf*2 + tf and give i. 0 Rearrange (-2i + 4i - 5i)((2 + 2 - 5)(3i + 0i - 2i) - i + 0i + 4i - i + 7 - 3i - 5) to h + di + xi2 and give d. -6 Rearrange -1 - x2 + 1 - 24 - 2x*2 + 14 + 3x*2 + (-1 + 3 + 0)(-2x2 - x2 + 4x*2) + 3x2 - x2 + x*2 to jx + ix2 + p and give p. -10 Rearrange 5l4 + 2 - l2 - 15 + 5 + 9 to fl3 + ul + nl4 + zl*2 + x and give z. -1 Express 2w3 - w2 + 2 + 12w4 - w2 - 15w*4 as aw*3 + zw*4 + xw*2 + jw + o and give x. -2 Express 2v3 + 1 + 2v*3 + 25v*2 - 3v*3 - 28v*2 as fv*2 + zv*3 + i + wv and give i. 1 Rearrange (-6 - 19 - 34)(-4j*3 + 3j*4 + 2j*3 - 2j*4) to wj + lj4 + x + nj*2 + dj*3 and give l. -59 Rearrange (-k + k - k)(3 + 4 - 5)(0 - 13 - 3) to the form a + vk and give v. 32 Express 4w + 3 + 5 - 3w - 5 as uw + x and give u. 1 Rearrange (0 + 0 + 3p)(-3 + 2p + 3) + (-1 + 1 + 1)(p2 - 1 + 1) + (0p + 5p - 3p)(0p + 0p + 2p) to op + ap*2 + d and give a. 11 Rearrange 23d*2 - 6 + 4 - 26d*2 - 2d*3 to xd*3 + zd + u + id2 and give z. 0 Express 247 + 41g - 247 as og + q and give o. 41 Rearrange 15j*2 - 12j2 - j3 + 2j3 to uj*3 + sj + c + pj2 and give u. 1 Express 4 + 37u - 74u - 2 as ku + f and give k. -37 Express 274r - 274r - 30r2 in the form mr + c + nr2 and give n. -30 Express -30s + 12s + 14s as l + hs and give h. -4 Rearrange -10z*4 + 7z*2 - 2 + 24z*4 + 3z*3 - 5z*4 - 7z*4 to wz*4 + rz*2 + nz + d + yz3 and give y. 3 Express (s + s - s)(-4s2 - 2s*2 + 4s*2) + 4 - 2s3 - s2 + s*2 + 9s*3 - 4s*3 + 4s*3 as ms + p + ws2 + is*3 and give i. 5 Express -36g + 11g - 22g as bg + o and give b. -47 Express -2o*4 + 0o - 3o	{ "pile_set_name": "DM Mathematics" }
/86785-2178/(-24)? 89 Calculate (450/525)/(-1221/(-980))153/15. 34 What is the value of ((-2460)/(-40))/41414/(-9)? -69 Evaluate 4363/(-308)2((-476)/(-120))/17. -11/5 Evaluate (75/(28350/(-546)))/((-2)/1082). 39 -2((-13)/(-39))/(522/(-12)) 1/13 What is 43/((-6880)/48)(-3)/((-27)/(-12))3? 6/5 What is the value of 185/19203((-12)/8)/(10/(-8))? 2/173 Calculate 19254087/31825. 61 What is the value of ((-6)/5)/(136/170)? -3/2 Calculate ((-184)/69)/((-2660)/105). 2/19 What is (13/117-18)/(31/2)? -4/31 Calculate (108/8)/((-99)/(-242)). 33 Evaluate (-6(-61)/732)/(6/4). 1/3 (-90)/428/(-36)(26220/399)/23 50 ((-381180)/44471)/(((-7)/(-21))/(28/(-6))) 120 Calculate (-25(-17)/(-1530))/(242/(-484)). 5/9 (41778/4254393)/(5/((-130)/8)) -3/94 Calculate -21(-84)/2646(-45)/18. -5/3 Evaluate 2/(-9)((-30240)/(-2))/56. -60 1690350/(-45500)1/(2/2) -13 Calculate 4/14((-3)/((-522)/8))/(19708/310401). 6/29 Calculate 2128/342207/4614/(-4). -98 What is the value of 14098/1113(-27)/(-57)? 6 What is the value of (24/(-54))/(3042/(-4563)22/300)? 50 12/(-409)244/(-61) 2/15 What is (-16898)/46718(48/136)/6? -1/47 What is the value of 72/24790/(-15)? -158 What is 5873/(-1022)-7? 29 What is (-74)/(-814)-957(-8)/(-12)? -58 What is the value of (2308/(-1154))/(17/2)? -4/17 What is (581/7)/(160/(-840)(-99)/66)? 29 What is the value of 1(990/(-935))/18? -1/17 What is the value of 4943/63210-5? -1/6 ((-70)/28)/((-14)/(-287)(-10)/4)-2 -41 (-13)/(-52)(-2368)/518 -8/7 What is (-55)/18((4/6)/1)/(38435/(-92244))? 44/9 Calculate 219/(-12775)50/636/(-30). 6/35 814176/86352(-14)/(-374) 6/17 What is (-23/5)/((-28)/(-10290)49)? -9 Calculate ((-2)/(-58))/(14/((64/(-4))/(-4))). 1/29 What is (4/48)/((163/(-168))/(15/(-5)))? 2/3 What is the value of -2(-144)/(-168)(-385)/110? 6 Calculate (-675)/45(31/837)/(-22/3). 5/12 64700/(-219980)(-51)/(-3) -5 What is (44/48)/((-36)/165623)? -11/6 What is -101/(-20)(-280)/350? -2/5 What is (9/(-1)(459/(-27))/306)/(1/34)? 17 What is the value of ((-4)/55)/(((-4)/11)/(28810/31691))? 2/11 (12885/(-38655))/(1/(-120)) 40 What is (19/114-8)/((-8)/(-138))? -23 Calculate (9/(-69))/(606/6969). -3/2 Calculate (-1)/((69/46)/((-6)/(-16)188)). -47 What is the value of ((-3)/(45/10)18/(-144))/(12/(-80))? -5/9 -3((-1053)/(-27))/1287 -1/11 What is 4/(-14)(-87087)/(-638)? -39 (14/(-332))/((-196)/(-7)75/(-1200)) 2/83 Evaluate (24/(-12))/(96/21960(-45)/(-6)). -61 Calculate -1((-103)/(18746/(-455)))/((-2)/(-14)). -35/2 Evaluate (-57)/3825/(-15)24/(-10). -6 What is (((-25)/15)/((-65)/(-234)))/(-8)84? 63 What is the value of (1/1)/((-29(-32)/464)/(-62))? -31 -4(-4)/(-108)8472/706 -16/9 Evaluate 23400/175563/(-24). -35 What is ((-87243)/13422)/((4/10)/((-4)/(-5)))? -13 What is 45/(-3)27/1084-1? 15 What is the value of ((-2)/124)/(6/8)178/((-34710)/1755)? 6/31 Evaluate 1582/45239/(-4732)1-48. 18/13 What is (-1)/(162/(-162)(-1)/101)? -101 Evaluate ((-27)/(-81))/(11/(-63/2)). -3/11 What is (7/98-60)/(((-108)/(-21))/(-12))? 10 What is the value of 18/(-4)64/24023/(-9)15? 46 Calculate -26(6/(-9))/(8502/8829). 18 Calculate (-1566)/756927/81. -2/29 Evaluate (668/1980)/(2/5). 2/3 Evaluate ((-775)/4650)/((-1)/240). 40 Calculate (36/289/455)/((-1)/(-7)). 9 (-79(-40)/(-347600))/(11/(-1)) 1/110 What is ((-1)/(-5))/((-2)/451)38410/(-2505)? 69 What is (-15)/(-31)224223/2411? 45 What is the value of ((-3)/13)/(((-209952)/5265)/144)? 5/6 What is the value of (-270)/55806/9-2? 2/31 Calculate 3/(1/(-7)114/(-6916)-26). -49 Calculate (3/147)/(35(-71)/4970). -2/49 Calculate (2080/(-2860))/((-504)/(-198)). -2/7 Calculate (-2)/(-50)(1/11)/((-1827)/1827). -1/275 (-4)/(-36)(-72)/12(-54)/(-14) -18/7 What is the value of 21040/(-526)20/(-192)? 25/6 Evaluate ((-224)/(-63))/(-8)((-98)/2352)/(1/10). 5/27 What is (-61504)/57665/(15/(-36))? 128 ((-63)/60)/7((-1440)/5)/(-12)15 -54 1285/68(-4)/(-6) 10 What is the value of ((-5)/((-100)/18))/(12/20)4/(-51)? -2/17 3/((-3)/(-1))443/(-886)(-5282)/19 139 Evaluate 19/(1197/2754)782/(-164). -153 What is the value of 58149/(-1846)40/35? -36 What is the value of (30976/15488)/(((624/(-105))/4)/(4/(-10)))? 7/13 Evaluate (15/((-630)/574))/((32/(-12))/8). 41 What is 3((-10)/160)/((-12)/216-18)? -3/16 What is the value of ((-1342)/183)/((-8)/(-12))51? -55 Evaluate 1828/(-914)(-52)/(-8). -13 (253/(-33))/((((-2145)/18)/55)/(-13)) -46 What is the value of (192456/7128)/(2/(-6))? -81 What is (((-22)/48411)/(10/180))/((-6)/(-28))? -42 What is the value of (((-4437)/34)/87)/(383/(-48)6)? 2/19 654/3((-64)/((-88192)/(-159)))/((-6)/26) 109 What is (((-168)/(-504))/(4/6))/(6/(-552))? -46 Evaluate (-1)/34158/882. -11/7 Calculate (2/((-138)/23))/(-415/36). 1/5 What is the value of (326/351)/(-925/(-30))? 1/69 Evaluate 2/((166/(-332))/(26/2)). -52 Evaluate (-1073)/(-16095)5-57. -19 What is the value of ((-29986)/(-2726))/(121/(-45))? -45/11 What is (143/((-10439)/5548))/2? -38 What is the value of (2/25)/((-66)/(-30))27/((-297)/110)? -4/11 (4386/170)/((-111)/185) -43 What is (-4)/(64/48)((-20)/120)/(2/(-64))? -16 Calculate (8/4)/(19/(-38950)-41). 100 Calculate (31/(6/6))/(7866/3059). 7/6 What is -32/(-4)4/(-21)(-74774)/(-331142)? -2/31 What is ((-3)/(-6))/(2611/8008)? 14 Evaluate (13(-168)/(-624))/((-28)/(-40)). 5 Evaluate 3045/(-25230)((-16)/7)/(-4). -2/29 What is the value of 28512/(-2808)-39-2(-1)/12? 66 ((-904)/1356(-150)/16)/(10/48) 30 Calculate 7/435/((-9)/((-297)/(-385))). -3/43 (-8)/14-998/25269/(-2) -69 Calculate (24/(-28))/((-928)/(-406)). -3/8 Evaluate ((-72)/8)/(30/60). -18 What is ((-1992)/16)/(-83)(16/(-732))/2? -1/61 What is the value of ((-7)/(-14))/(-18(-287)/(-45756)(-1)/14)? 62 What is the value of (14/(-24))/((-117)/(-351))(-6)/14? 3/4 Evaluate 30(-18)/(-144)52/(-13). -15 What is (((-44)/(-6))/(76/(-57)))/((-10)/4018)? 11/9 Calculate ((-320)/168)/(21/((-11466)/52)). 20 What is ((14/((-784)/126))/3)/((162/4)/9)? -1/6 What is the value of ((540/(-198))/(-30))/(1566/198)? 1/87 What is (-12/48)/((-1)/(-108(-45)/810))? 1/4 What is the value of ((-8)/(-440))/((1740/(-150))/58)? -1/11 Evaluate ((-7)/210414)/(4/(40/3)). -46 Evaluate (((-1980)/(-44))/5)/6. 3/2 What is the value of (-4)/((((-480)/(-70))/(-8))/((-78)/(-4004)))? 1/11 (100/40)/((180/1608)/3) 67 Evaluate (12/15)/(77/(12320/3264)). 2/51 What is the value of (-3)/(24/(-20))(-8206)/373? -55 What is (27/(-351))/(3/6)? -2/13 (2/122/2)/(209059/(-30594)) -1/41 Calculate ((-1)/2)/((1/((-123)/(-9)))/(7338/(-1223))). 41 Evaluate ((-2954)/(-3376))/(8554/(-416)). -2/47 What is ((285/5)/57)/(35-34/(-10))? 1/42 What is the value of (((-84)/234)/(8/(-13)))/((-1)/(-15))? 35/4 (-462)/(-176)-2((-25)/9)/25 7/12 What is (-703)/1335757/(-3)? 1 Calculate (29610/55272)/((-2)/56). -15 Calculate 12/9018(-14740)/(-402). 88 What is the value of (-63756)/(-4186)299/138? 33 102/1615(15/3)/((-4)/4) -6/19 10/(-9(-18)/27)-12 -20 Evaluate 1/(((-51)/(-2652))/((10/(-4))/((-25)/5))). 26 Evaluate 14/1198296/5856. 1/6 Calculate 6-1(-2)/24(-2268)/(-25515). 2/45 Calculate (-1(-2)/(-26))/((12546/1989)/(-41)). 1/2 What is (3/100129/(-903))/((-6)/16)? 2/175 Evaluate (144/351)/((-620)/(-12090)). 8 Calculate (1158/(-2))/(93/186)5/10. -79 (-35)/10(-450)/70(-7)/(42/(-8)) 30 Evaluate (50/(120/(-12)))/((-6)/(-4)(-869)/237). 10/11 What is the value of (-58)/((-580)/(-5))(-852)/6? 71 Calculate (80/120)/(104/(-6708)). -43 Evaluate (68/(-2006))/(8/8). -2/59 What is (-98)/(-105)2622/3059430/4? 86 Calculate (-22(-26)/858)/(152/(-108)-6). 3/38 Evaluate ((-32)/20)/(((-1503)/15)/(45/60)). 2/167 What is the value of 6(-63)/(-114)(10998/329)/(-117)? -18/19 Evaluate ((-1232)/(-33))/(-7)(561/(-22))/17. 8 What is the value of (-717915)/(-42823)34/6? 95 ((-9)/114)/(335/12730) -3 Calculate (11/(2288/(-140)))/(90/(-144)). 14/13 What is the value of ((-372)/5642)/(8/(-26))462/30? 33/10 What is the value of ((-15)/12)/(-1)16694/235? 83 What is ((0/(-25))/34)/(((-35)/(-5))/(-7))? 0 Calculate ((1620/(-240))/(-27))/((-1)/(-4)(-1)/(-71)). 71 What is the value of (146-2640/1280)/(-38/6)? 73/2 What is the value of -558/(480/3)? -11/4 Calculate (5/(-15))/(-1)(-6)/(-4)(-450)/525. -	{ "pile_set_name": "DM Mathematics" }
2 = 7q - 25 for q. -1 Solve -6n = -3n - 12 for n. 4 Solve -884x + 874x = 30 for x. -3 Solve 25g - 24 = 33g for g. -3 Solve -12a = 16a - 28 for a. 1 Solve 0 = -p - 24p - 100 for p. -4 Solve 6i + 64 - 94 = 0 for i. 5 Solve 144f + 70 = 158f for f. 5 Solve -30 + 44 = -2l for l. -7 Solve 0 = 14s - 57s + 86 for s. 2 Solve 26i - 3i = -161 for i. -7 Solve 11w = -46 - 20 for w. -6 Solve 64u - 168 = 152 for u. 5 Solve -54q + 84 = -26q for q. 3 Solve -8m + 5m = -12 for m. 4 Solve 51s - 18 = 186 for s. 4 Solve 51v - 12 = 54v for v. -4 Solve -4 + 2 = 2c for c. -1 Solve -m = -0m + 2 for m. -2 Solve 26w + 148 + 8 = 0 for w. -6 Solve 8u + 13 - 29 = 0 for u. 2 Solve -2d + 10 = 8 for d. 1 Solve -79c + 105c = -26 for c. -1 Solve -14w = 2w - 2w for w. 0 Solve 62 = 46c - 398 for c. 10 Solve -1 = 13c + 12 for c. -1 Solve -4a + 11 = 19 for a. -2 Solve 7w + 24 = -4 for w. -4 Solve -7a - 118 = -104 for a. -2 Solve -125 = 32t - 29 for t. -3 Solve -39 + 11 = -7n for n. 4 Solve -15166o = -15162o for o. 0 Solve -7k + 7 = -0 for k. 1 Solve 0 = -87t - 96 + 444 for t. 4 Solve -20 + 11 = -9d for d. 1 Solve 54a + 144 = -126 for a. -5 Solve 4x - 49 = -3x for x. 7 Solve 33w + 54 = 24w for w. -6 Solve -251t + 256t = -5 for t. -1 Solve 0 = 4y + 15 - 3 for y. -3 Solve 0 = -u - 4u - 15 for u. -3 Solve 9u - 9 = 8u for u. 9 Solve 0 = -64c + 241 + 15 for c. 4 Solve -n - 9n = -20 for n. 2 Solve -15 = -3d - 2d for d. 3 Solve -132 - 57 = -27j for j. 7 Solve 0 = 14h + 2h - 16 for h. 1 Solve -15p - 12 = -18p for p. 4 Solve -9d = 7 - 34 for d. 3 Solve -21w + 11w - 40 = 0 for w. -4 Solve 13q + 6 = 16q for q. 2 Solve 12i - 15i = 0 for i. 0 Solve 0 = -3x + 12 - 6 for x. 2 Solve -2h = 48 - 54 for h. 3 Solve -12y + 260 = -64y for y. -5 Solve 4x - 8 = 12 for x. 5 Solve 16m + 660 = 580 for m. -5 Solve -3v + 28 = 4v for v. 4 Solve -173 = 27t - 38 for t. -5 Solve -9g = 981 - 954 for g. -3 Solve 89y - 62y = 27 for y. 1 Solve -16d + 22d = 18 for d. 3 Solve -16 + 1 = 3p for p. -5 Solve 29d - 219 = -44d for d. 3 Solve 0 = -i - 6 + 1 for i. -5 Solve 127r = 117r + 50 for r. 5 Solve 4f = 12 + 8 for f. 5 Solve 0 = 20t - 6t + 28 for t. -2 Solve -5q = -3q + 4q for q. 0 Solve 10h + 174 = 214 for h. 4 Solve -9w = -50w - 287 for w. -7 Solve -2u + 3u + 4 = 0 for u. -4 Solve 9 + 16 = 5l for l. 5 Solve 8m + 20 = 13m for m. 4 Solve -115 = 6g - 91 for g. -4 Solve -27z = -20z + 7 for z. -1 Solve -7b = 9b for b. 0 Solve -39 - 10 = 7n for n. -7 Solve -75 = -23o + 17 for o. 4 Solve 0 = -18m + 14m - 12 for m. -3 Solve -443 = 4v - 447 for v. 1 Solve 75u + 7 = 82u for u. 1 Solve 2v - 14 = -24 for v. -5 Solve 92s - 178 = 6 for s. 2 Solve 3p + 18 - 12 = 0 for p. -2 Solve 0 = 32o + 8o + 240 for o. -6 Solve 18x = 15x for x. 0 Solve 4 = -8l - 12 for l. -2 Solve 2 = -20b + 19b for b. -2 Solve l + 117 - 121 = 0 for l. 4 Solve 54 = -18c + 36 for c. -1 Solve -54l + 200 = -14l for l. 5 Solve 10z = -16 + 36 for z. 2 Solve -26 = -5p - 1 for p. 5 Solve 60n - 68 = 43n for n. 4 Solve 3g = -30 + 18 for g. -4 Solve -11 - 9 = 4a for a. -5 Solve 34o + 15 = 19o for o. -1 Solve -14 + 2 = -6l for l. 2 Solve 0 = 62j + 100 + 86 for j. -3 Solve 43g = -80g - 861 for g. -7 Solve 9p - 3 = -12 for p. -1 Solve -223m = -221m + 10 for m. -5 Solve 0 = -144m + 154m for m. 0 Solve -10h - 29 - 71 = 0 for h. -10 Solve -11n = -10n for n. 0 Solve 6g - 16g + 20 = 0 for g. 2 Solve -8y + 6 = -2 for y. 1 Solve -12h + 18h + 44h = 0 for h. 0 Solve -8t - 29 = -5 for t. -3 Solve -9z + 20 = -7 for z. 3 Solve 37i + 49 = 30i for i. -7 Solve 55n - 16n - 273 = 0 for n. 7 Solve -39a + 64 = -53 for a. 3 Solve 0 = 4l - 49 + 29 for l. 5 Solve -624 + 127 = -71b for b. 7 Solve -128z = 677 + 91 for z. -6 Solve -195 = -v + 40v for v. -5 Solve 40v - 10 = 35v for v. 2 Solve -22p - 5 = -27p for p. 1 Solve 2y + 45 = 11y for y. 5 Solve 0 = 10j - 20 + 30 for j. -1 Solve 3j + 25j - 168 = 0 for j. 6 Solve 1251w - 1246w = 40 for w. 8 Solve -12 = -31u + 35u for u. -3 Solve 0 = -18h + 16h - 2 for h. -1 Solve 0j = 38j + 152 for j. -4 Solve 393b = 387b for b. 0 Solve 18w = 13w + 25 for w. 5 Solve -72k - 21 = -69k for k. -7 Solve -14z = -8z + 24 for z. -4 Solve 8u + 68 = -9u for u. -4 Solve 172u - 214u + 168 = 0 for u. 4 Solve -7w = -11w for w. 0 Solve -28r + 20r + 32 = 0 for r. 4 Solve 4l - 31 = -11 for l. 5 Solve 0 = -10l + 29l - 190 for l. 10 Solve 2u + 12 = 6u for u. 3 Solve 4r - 6 = r for r. 2 Solve -4 = g - 2 for g. -2 Solve 0 = 2f + 5f - 21 for f. 3 Solve 4q + 5 = -35 for q. -10 Solve 0 = -65b - 11b - 152 for b. -2 Solve 3c - 2c - 5 = 0 for c. 5 Solve -15 = -18d + 21d for d. -5 Solve 116c - 5 = 115c for c. 5 Solve -f + 18 - 25 = 0 for f. -7 Solve 0 = 4s - 9s for s. 0 Solve 24 = -q - 3q for q. -6 Solve 19u - 49u + 210 = 0 for u. 7 Solve -26k = 88 - 10 for k. -3 Solve -4 = -60w + 62w for w. -2 Solve -79n + 62n = 0 for n. 0 Solve -30u = -28u for u. 0 Solve 8v + 2 = 10v for v. 1 Solve 7w - 9w - 6 = 0 for w. -3 Solve -25y - 223 = -48 for y. -7 Solve 0 = 9h - 416 + 434 for h. -2 Solve -9o - 1445 = -1499 for o. 6 Solve 17y = 11y + 30 for y. 5 Solve -12d + 47 = 11 for d. 3 Solve 0 = -5q - 2691 + 2726 for q. 7 Solve -302r + 307r + 25 = 0 for r. -5 Solve -15n = -14n - 1 for n. 1 Solve 12c + 15 = -9 for c. -2 Solve -45c - 219 - 6 = 0 for c. -5 Solve -6q = -6042 + 6090 for q. -8 Solve -3w + 2w = 5 for w. -5 Solve -62q + 49q = 26 for q. -2 Solve -172r + 174r + 10 = 0 for r. -5 Solve 7s - 15 = 4s for s. 5 Solve -7x - 2 + 16 = 0 for x. 2 Solve -52 + 44 = 2r for r. -4 Solve 21y - 100 = 26 for y. 6 Solve 13 + 13 = -26k for k. -1 Solve 17 = 5l + 32 for l. -3 Solve 0 = -11t + 18t + 42 for t. -6 Solve 0 = 45o - 9o + 252 for o. -7 Solve 11 + 0 = -11b for b. -1 Solve 0 = 9b - 72 + 108 for b. -4 Solve -31q + 94q + 315 = 0 for q. -5 Solve 0 = -24l + 16l - 8 for l. -1 Solve 733u - 722u + 33 = 0 for u. -3 Solve y + 3 = -0y for y. -3 Solve -408z + 402z = 0 for z. 0 Solve 308 - 317 = -3a for a. 3 Solve 6 = 17f - 16f for f. 6 Solve -12l + 6 = -6 for l. 1 Solve -4v - 3v = 0 for v. 0 Solve -5q + 28 - 63 = 0 for q. -7 Solve -137k - 2 = -136k for k. -2 Solve -149a + 143a - 18 = 0 for a. -3 Solve -2l + 20 = -6l for l. -5 Solve -101 = 11k - 2 for k. -9 Solve 0 = -43p + 73p + 30 for p. -1 Solve -151 = -6q - 187 for q. -6 Solve 56o = -o - 228 for o. -4 Solve -8n = -1 - 7 for n. 1 Solve 0 = 39g + 101 - 23 for g. -2 Solve -29s - 51 = -12s for s. -3 Solve 52 = -0v - 13v for v. -4 Solve 35 = -192d + 199d for d. 5 Solve -18f - 279 + 315 = 0 for f. 2 Solve -47s = -50s + 6 for s. 2 Solve 2b - 14 = -18 for b. -2 Solve 4u = 18u - 56 for u. 4 Solve 91u + 45u + 272 = 0 for u. -2 Solve 0 = -33d + 28d - 25 for d. -5 Solve -25 = -77v + 72v for v. 5 Solve 0 = 10x + 228 - 248 for x. 2 Solve -494 = 7w - 508 for w. 2 Solve 10j + 160 = 110 for j. -5 Solve -8n + 88 = 112 for n. -3 Solve 46w + 253 = -23 for w. -6 Solve 23h = -219 + 288 for h. 3 Solve 62t = 5t - 570 for t. -10 Solve -10g - 127 = -37 for g. -9 Solve -2t + 13 = 15 for t. -1 Solve -2o - 489 + 491 = 0 for o. 1 Solve 40u = 54u - 84 for u. 6 Solve -226q = -218q - 24 for q. 3 Solve -32y - 14y - 414 = 0 for y. -9 Solve -86w - 871 + 183 = 0 for w. -8 Solve 0 = -0p + 9p + 18 for p. -2 Solve 17y + 50 = 118 for y. 4 Solve -44v = -23v + 63 for v. -3 Solve -18 + 62 = -11o for o. -4 Solve -123h + 127h = 8 for h. 2 Solve 2y = -y - 15 for y. -5 Solve -6x + 35 = -13x for x. -5 Solve -154d - 315 = -199d for d. 7 Solve 16v - 3 = 29 for v. 2 Solve 28n - 42n = -70 for n. 5 Solve -40u = -38u + 4 for u. -2 Solve 4o - 20o = 80 for o. -5 Solve 8a - 11 - 5 = 0 for a. 2 Solve 5a - 17 + 2 = 0 for a. 3 Solve 4 = 4j - 12 for j. 4 Solve 6q - 3q = -8q for q. 0 Solve -556 = -2v - 548 for v. 4 Solve -3d + 30 = 3d for d. 5 Solve 3t - 16 = 7t for t. -4 Solve 6u - 52 = -7u for u. 4 Solve 174u - 172u - 10 = 0 for u. 5 Solve -2g + 110 = 100 for g. 5 Solve 24y + 154 + 62 = 0 for y. -9 Solve 206 = -7y + 164 for y. -6 Solve 15n + 0*n + 30 = 0 for n. -2	{ "pile_set_name": "DM Mathematics" }
the first derivative of 0o4 + 1/35o7 + 2 - o2 + 0o + 0o*5 + 1/60o*6 + 0o*3. Let k(t) be the second derivative of q(t). Factor k(y). 2y*3(3y + 1) Let t(j) be the first derivative of -j7/735 + j6/105 - j5/35 + j4/21 - j3/21 + 3j*2/2 + 4. Let c(u) be the second derivative of t(u). Factor c(h). -2(h - 1)*4/7 Factor 13o*2 - 10o*2 + 1 - 6o - 3o + 5. 3(o - 2)(o - 1) Let v(h) = h2 - h - 1. Let j(y) = -2y*3 + 2y + 4. Let b(g) = j(g) + 4v(g). Solve b(w) = 0. 0, 1 Let p(s) be the second derivative of -s6/20 - 3s5/20 + s4/8 + s*3/2 + 4s. Factor p(q). -3q(q - 1)(q + 1)(q + 2)/2 Factor 75 - 2y - 33 - 39 - y2. -(y - 1)(y + 3) Let p = 306 + -1526/5. Suppose 2k - k = 0. Factor 3/5w*4 - pw*2 + 4/5w - w*3 + k. w(w - 2)(w + 1)(3w - 2)/5 Suppose 6 = -s + 3s. Find m, given that -448m4 - 508m*2 + 1 - 229m - 3 + 77m - 14 - 722m*s - 98m*5 = 0. -2, -1, -2/7 What is z in 20/9z - 20/9z3 - 50/9 + 16/3z*2 + 2/9z*4 = 0? -1, 1, 5 Factor -3a + 5a2 + 14a*4 - 20a*4 + 3a3 + a2. -3a(a - 1)(a + 1)(2a - 1) Let i be 1 - (-1 - -2)-2. Find z, given that 2 + z - 5z2 + 5z*2 + 2z*3 - iz - 2z2 = 0. -1, 1 Let i = -82 - -13. Let r = 347/5 + i. Factor w2 + 0 + rw + 3/5w3. w(w + 1)(3w + 2)/5 Suppose h = 16 - 14. Factor 1/3fh + 0f - 4/3. (f - 2)(f + 2)/3 Suppose 13 = 5j - 0j + h, -2h - 4 = -5j. Let l be (20/(-8))/((-1)/j). Factor 0b*3 + lb + 11b2 - 10b*3 - 5b*2 - b. -2b(b - 1)(5b + 2) Let r(h) be the second derivative of 0 - 1/4h*5 + 0h*2 - 1/4h*4 + 1/3h*3 - 4h. Find j, given that r(j) = 0. -1, 0, 2/5 Let n(q) be the third derivative of -2q6/5 - 14q*5/5 - 25q*4/8 - 3q*3/2 - 26q*2. Find m, given that n(m) = 0. -3, -1/4 Let x = -6 + 6. Suppose 3 + x = m. Find k, given that 0 + 2 + 2k*2 - 2k*3 - 4 + 2k + 0km = 0. -1, 1 Let y be 42/(-27)24/(-208). Let o = y - -2/13. Suppose oc2 + 2/3c + 1/3 = 0. Calculate c. -1 Let s(x) be the third derivative of x7/30 + x6/24 - 3x5/20 - 5x4/24 + x3/3 + 32x2 + 2x. Solve s(c) = 0. -1, 2/7, 1 Let q = -91702951/12726 - -100887/14. Let z = q + -4/101. Solve -2/9f + zf*3 - 4/9f2 + 4/9 = 0. -1, 1, 2 Let z(v) be the second derivative of -v5/10 + v*4/2 - 2v*3/3 + 31v. Factor z(s). -2s(s - 2)(s - 1) Find b, given that 0 - 4/5b*3 + 0b + 2/5b2 + 2/5b*4 = 0. 0, 1 Let c be (2 + 45/(-6))-2. Suppose cy = 6y + 15. Determine s, given that ys3 - 2s*2 + 2 - 5s*3 - 2s + 4s3 = 0. -1, 1 Let q(n) be the second derivative of n5/4 - 65n*4/12 + 40n*3 - 90n*2 + 9n. Factor q(s). 5(s - 6)2(s - 1) Let p(t) be the third derivative of t8/294 - t7/245 - 13t6/420 + t5/210 + 3t*4/28 + 2t*3/21 - 6t*2. Suppose p(j) = 0. Calculate j. -1, -1/4, 1, 2 Suppose 9a + 6a2 - 17a*2 + 8a*2 = 0. What is a? 0, 3 Let h be (44/(-70))/((-6)/33). Let l = h + -13/5. Find p, given that -2/7 - 6/7p*2 + lp + 2/7p3 = 0. 1 Let o = -1075969/2207280 - 1/27591. Let s = 27/16 + o. What is x in -sx + 8/5x2 - 2/5 = 0? -1/4, 1 Let m(y) be the first derivative of -2/15y*3 + 0y - 3/5y2 + 1 + 2/25y*5 + 3/10y*4. Let m(j) = 0. Calculate j. -3, -1, 0, 1 Let y = -1 - -3. Let -3w*3 - yw*2 + 3w - 5w2 + w2 + 6 = 0. What is w? -2, -1, 1 Let y(w) = -w2 + w. Suppose 2 - 4 = -2x. Let r(m) = -18m3 - 15m*2 + 43m - 16. Let z(g) = xr(g) - 3y(g). Determine d, given that z(d) = 0. -2, 2/3 Suppose 343v - 350v + 21 = 0. Factor -1/8nv + 3/8n*2 + 0n + 0. -n*2(n - 3)/8 Suppose 31 = 5g + 3h - 6h, -4h = -2g + 18. Suppose -l - 3l - z = -1, -5z = gl - 5. Find a, given that 0a + la + a*2 = 0. 0 Factor 3/8k*5 - 15/8k*3 - 3/8k*2 + 3k + 3/8k4 - 3/2. 3(k - 1)*3(k + 2)*2/8 Let f = 1375 - 147127/107. Let c = 99/428 - f. Solve 1/4d*4 + cd*5 + 0 - 1/4d*2 - 1/4d*3 + 0d = 0 for d. -1, 0, 1 Let p = 355 - 1759/5. Let c be (1 - 14/6)/(44/(-66)). Find h, given that -2/5h3 - p - 2/5h*5 - 8/5h*4 + 8/5h + 4hc = 0. -2, 1 Let o(k) be the third derivative of -k7/420 - k6/48 - k5/30 + 17k*2. Let o(s) = 0. Calculate s. -4, -1, 0 Determine q, given that -97 + 178 + 6q*2 - 89 + 2q3 = 0. -2, 1 Let w(i) be the second derivative of i5/10 - i4/4 + i2/2 + 10i. What is f in w(f) = 0? -1/2, 1 Let u(k) be the first derivative of 2 + 0k*2 + 0k + 1/4k4 + 0k*3 + 1/5k5. Factor u(r). r3(r + 1) Let b(m) = 4m*2 + 14m - 12. Let y be (-116)/(-10) + 10/25. Let q(j) = j*2 + j - 1. Let d(o) = yq(o) - b(o). Find s, given that d(s) = 0. 0, 1/4 Let b(j) be the third derivative of 1/112j8 + 0j*3 + 3/10j*6 + 0 + 0j + 2/5j5 + 3/35j*7 - 3j*2 + 0j*4. Factor b(m). 3m*2(m + 2)3 Let j(k) = k3 - k. Let o(d) = d*4 - 4d3 - d2 + 4d. Suppose 0 = -2h - 3 + 13. Suppose h = 3z - 10. Let i(p) = zj(p) + o(p). Factor i(x). x(x - 1)(x + 1)2 Let q(c) be the third derivative of c5/20 + 7c4/24 - c3 - 4c*2. Determine p so that q(p) = 0. -3, 2/3 Let m(d) be the second derivative of 3d*5/140 + 3d*4/28 + 9d. Factor m(h). 3h2(h + 3)/7 Let m be (0 + -2 + 0)-1. Suppose -5i = -5z - 25, 3i + mz + 0z = 5. Let 18n3 + 3n + in5 - n4 - 12n*2 - 2n*4 - 5n*4 - 4n*4 = 0. What is n? 0, 1 Suppose -28 = -5z - 3. Let t(h) be the first derivative of 0h2 - 2/3h*3 + 1/2h4 + 3 + h6 + 2hz + 0h. Find c such that t(c) = 0. -1, 0, 1/3 Factor 0i + 0i*3 + 3/4i*2 - 3/8i*4 - 3/8. -3(i - 1)*2(i + 1)2/8 Let i(s) be the second derivative of -s7/21 - s*6/4 - 3s5/10 + s4/6 + 35s. Factor i(k). -k2(k + 2)*2(4k - 1)/2 Let y(w) = -2w - 5. Let k be y(-4). Factor 3f3 + 6f*5 - 9f*k + 2f + f - 3f5. 3f(f - 1)2(f + 1)*2 Let b(y) be the third derivative of -1/6y*3 + 2/15y6 + 0 - y2 + 0y + 3/8y*4 - 2/5y*5. Factor b(p). (p - 1)(4p - 1)2 Let b = -5 - -6. Let n(i) = -3i*4 - 6i*3 + 12i*2 - 6i - 6. Let q(t) = t4 - t3 + t + 1. Let m(r) = bn(r) + 6q(r). Determine j so that m(j) = 0. 0, 2 Let l(j) = 2j3 + 9j*2 + j - 10. Let t be l(-4). Factor 48r + 125/2r5 - 70r*3 + 64r*t - 225/2r*4 + 8. (r - 2)(r - 1)(5r + 2)*3/2 Let d(k) be the first derivative of 2k5/35 + k4/7 - 2k3/7 - 8k*2/7 - 8k/7 + 24. Factor d(q). 2(q - 2)(q + 1)*2(q + 2)/7 Let v(z) be the first derivative of 0z - z2 - 2/3z*3 + 2. Factor v(m). -2m(m + 1) Let c(b) be the first derivative of b4/12 - 2b*3/9 - 5b*2/6 + 2b + 11. Determine h, given that c(h) = 0. -2, 1, 3 Let j(s) = -s*5 + 4s*4 + 3s*3 + 2s*2 - 2s. Let y(g) = 2g5 - 9g*4 - 6g*3 - 5g*2 + 4g. Let f(u) = 7j(u) + 3y(u). Factor f(c). -c(c - 2)(c - 1)(c + 1)2 Determine g so that 0g - 5/2 + 5/2g2 = 0. -1, 1 Suppose -2/17g*4 + 10/17g*3 - 4/17 - 18/17g*2 + 14/17g = 0. What is g? 1, 2 Let n = -4 - -6. Let -2j + 10j*2 - 6j*3 + 3j*3 - 3j*3 - n = 0. Calculate j. -1/3, 1 Let p = -829 + 14101/17. Let y = 41/51 - p. Factor 0o - yo2 + 0. -o2/3 Let w(z) = -10z*3 - 17z*2 + 77z - 37. Let s(f) = 5f3 + 9f*2 - 39f + 19. Let m(a) = 13s(a) + 6w(a). Factor m(d). 5(d - 1)2(d + 5) Suppose -4i = -3k - 7i - 3, 5k = -4i - 3. Let n = k + 1. Let p3 - 7p*3 + 9p*n - 7p2 = 0. What is p? 0, 1/3 Let l(j) be the third derivative of j7/420 - j*2. What is k in l(k) = 0? 0 Let n(u) be the second derivative of -2u*5/15 - 7u*4/12 + 2u*3/3 - 4u*2 - 2u. Let c(q) be the first derivative of n(q). Factor c(r). -2(r + 2)(4r - 1) Let d(x) be the second derivative of x4/72 + x3/12 + x2/6 + 8x. Factor d(y). (y + 1)(y + 2)/6 Factor 16/5m + 8/5m2 - 16/5m*3 - 1/5m*5 - 16/5 + 7/5m4. -(m - 2)4(m + 1)/5 Let -2u - 3 - 1/3u2 = 0. Calculate u. -3 Suppose 3s + 25 = 5y - 3, 2y = s + 11. Factor k3 - k - k2 - yk4 + 2k*4 + 4k*4. k(k - 1)(k + 1)2 Let 3/2x*2 + 0 - 1/2x*3 - x = 0. Calculate x. 0, 1, 2 Let z(s) be the first derivative of -686s*6/3 + 588s*5 + 112s*4 - 1376s*3/3 - 288s*2 - 64s - 7. Determine c so that z(c) = 0. -2/7, 1, 2 Let f(m) be the second derivative of -m*5/20 - 3m*4/4 + 3m*2 - m. Let u be f(-9). Solve 2t - ut - 1 + 2t**2 + 3 = 0 for	{ "pile_set_name": "DM Mathematics" }
/33 Evaluate ((-371)/(-231) - (-24)/(-88))/((-20)/6). -2/5 Calculate (-137)/(-9) - (18 - 3). 2/9 Calculate (-704)/(-120) - -2 - 4 - (-5 - -9). -2/15 What is the value of (92/(-48))/(-23) + (-14)/(-120)? 1/5 What is 48/(-30)(41 + -46)? 8 (-62)/(-30) + ((-42)/60)/(-7)-4 5/3 Evaluate (-46)/(-2) - (4 + (-164)/(-41)). 15 Evaluate (-13 + 8/2)/(584/16 - 8). -6/19 What is (-500)/280042/(-15)? 1/2 What is (6/(-285))/(7/(-140)-4)? -2/19 What is 54/(-1326) - (23 - (-1490)/(-65))? -2/17 (0 + 9)1425/(-513) + 20 -5 What is the value of (1(3 - 1) + (-33 - -27))/7? -4/7 Evaluate 91((-8)/(-49))/(652/1141). 26 What is (-6118)/2185320/(-28)? 32 58/(-29)121/22 -11 What is the value of ((-3)/(-4) + -2)(-756)/315? 3 (-8)/2 + (138/15 - (-90 - -96)) -4/5 Calculate (0 + -8)19/38(-49)/147. 4/3 Calculate -11 + (19/(190/(-70)) - -8). -10 Evaluate (-111)/(-11) + 16/240 + 26/(-165). 10 Calculate 49/6 - -4230/(-160). 1/4 What is ((-24)/(-10))/((-10)/(-25))? 6 (-476)/255 - (-2 - 8/(-6)) -6/5 What is 5/4080? 0 Calculate (-56)/14 + (-12)/6. -6 Calculate 12 + 0 - 452/(-113). 16 What is (17 - 8 - 12) + 21? 18 What is ((-1608)/(-144) - -2) + -13? 1/6 Calculate (-1)/(-3)0/(-859). 0 Calculate (9 - 1080/126) + 130/(-42). -8/3 What is 22427/(-30632) + (-6)/(-56)? -5/8 16/2 + (-3)/((-42)/(-104)) 4/7 What is 484/(-66) - (-150)/25? -4/3 Evaluate ((-1598)/(-1974))/((-3)/(-63)). 17 Calculate ((-11)/22 - 3)(-270)/63. 15 Calculate (9 + 912/(-95))(-4)/(-6). -2/5 What is the value of (-9 - 2373/(-266))/((-92)/(-16) + -5)? -2/19 Calculate (-45)/544(-42)/5. 28 Calculate (-2)/(-25) - ((-920997)/(-113400) - 24). -1/24 Calculate 362/325854/14. 3/7 What is (450/(-54) - -9)/(11/(-3))? -2/11 -30 + 28/1 - 1/(1/(-10)) 8 (12075/(-126))/115 + 105/54 + 0 10/9 Calculate ((-54)/3)/(40 + -46). 3 Calculate -3(84/(-8) - -10)2/6. 1/2 Evaluate 1010/18180(-4 - -1). -1/6 Evaluate 6/(-14) + (-13)/(-91) + (-384)/(-21). 18 What is (-12)/14(-469)/670? 3/5 1/(-2 + 0 + 405/(-15) + 16) -1/13 Evaluate (-4)/(-34) - (-4 + ((-1540)/(-85) - 0)). -14 (105/546)/(30/273) 7/4 What is ((-2)/5)/((-78)/(-585)) + 21? -1 Calculate (-4)/1 - 3 - (12 - 1218/63). 1/3 1/(((-192)/(-112))/12) 7 What is (5 - -12)(4 - 5)/(1 + 0)? -17 Evaluate (374/(-121))/(2/(-4)) + 46/(-253). 6 What is ((-3496)/2392)/(1/(-13))? 19 Evaluate ((-880)/(-24))/10(-2 + -5)/(-7). 11/3 What is the value of ((-1095)/75 - -15)-15? -6 What is the value of ((-14)/(392/(-70)))/(1/(-2))? -5 (0 - 16/(-2)) + 206 + -219 -5 What is the value of -52(-3638)/(-2140)? -17 What is the value of -57 + 60 + (-476)/231 + (-4)/6? 3/11 Evaluate 2/(-18)(-92 - -95). -1/3 What is (1 - 0)(-2)/7 - (-1545)/(-105)? -15 What is the value of -424(-18)/432? 7 ((-8)/42)/(13 + 2044/(-196)) -2/27 What is (-9 + 204/60)(-45)/(-18)? -14 Evaluate (-783)/(-378) - (10/(-16))/(10/(-40)). -3/7 Calculate (-217795)/52676 - 8/13. -19/4 (33/(-55) + 0)/(4/(-400)-4) -15 What is the value of 45/(-12) - (-132)/176? -3 Evaluate (-2)/8(-339 + 387). -12 Evaluate -15 + (76/68)/((-60)/(-510)). -11/2 Calculate (-160)/(-120)9/(-6). -2 What is the value of 6 + (4 - 2849/286)? 1/26 Evaluate 783 + -752 + (-3 + -1 - (-2)/2). 28 What is the value of (-4)/((-34)/51 - 2)? 3/2 What is (28188/2088)/((-9)/(-12))? 18 Calculate (-2)/((-11)/(44/(-8)) - 0). -1 (1 - 9)/(15 - 16) + -4 4 Evaluate (-4)/(-7) - (180/385)/18. 6/11 ((56/(-24))/((-11)/(-33)))/9 -7/9 (-24 - -16) + -6 + 19 5 What is the value of 30/6(26/(-7))/((-20)/28)? 26 310/(-154) - (-13056)/5712 3/11 What is -863 + 883 + (-48 - -2)? -26 (0 + 1)/(155 - 158)(-12)/38 2/19 63/18(6 - 5 - 3) -7 (0 + (-20)/(-7))/((-142)/497) -10 (3 + -1)/(2268/(-558) + (-2)/(-31)) -1/2 What is the value of -6 + (12/14 - (954/(-63) + 4))? 6 Calculate 4(-750)/440 + 1/((-5)/(-45)). 24/11 (-3)/2242(274 + -275) 12/11 ((-19)/(-285))/((-6)/50) -5/9 Calculate (78/2886-74)/(-2(-1)/(-3)). 3 What is (-152)/(-1232) - (-3)/(-14)? -1/11 Calculate (9/9)/(-5 - 14)1/1. -1/19 What is the value of (-9(-10)/(-990))/(5/((-40)/(-4)))? -2/11 What is the value of (19 - 17)/(1/(5/2))? 5 Evaluate (1156/680 - (-33)/(-15))176/24. -11/3 What is 7/(-49)4/((-20)/(-5))? -1/7 (-4)/(-5)((-10)/(-6))/((-58)/(-174)) 4 Calculate 24/(-360) + 239/(-15). -16 7/(-34)(-130)/(-455) -1/17 Evaluate (207/(-66))/(-3) - (25 + (-6187)/253). 1/2 What is 7735/(-357) + (-28)/12? -24 (420/175)/(3/(-10)) -8 Calculate (3((-2)/3 + 0))/((-3892)/77840). 40 Evaluate (0 - -4) + 13/(-273)60. 8/7 (70/16 - (-30)/48)(-1 + 0) -5 What is the value of (-190)/26 - (-364)/65(-75)/(-60)? -4/13 What is (550/150)/(8/(-12))? -11/2 What is the value of ((-304)/24 - -16)(21/(-5) + 0)? -14 What is (-3370)/1050 + (-36)/(-540)? -22/7 (-504)/420 - (4 - (-620)/(-225)) -22/9 Evaluate 56/10 - 6 - 6/(-10). 1/5 Evaluate 6/14(-3)/(-9)56/72. 1/9 What is 2(-2)/(((-8)/12)/(7/(-399)))? -2/19 What is -20(2 + (-1566)/725)? 16/5 (1152/4806/8)/(2/20) 18 Calculate 92/126 - ((-54)/(-315))/((-3)/(-5)). 4/9 12/(45/(-15)) + (-24)/10 + 6 -2/5 Calculate 1026/855(-5)/22. -3/11 1((4 - -38) + -28) 14 Calculate 1350/(-18225) + (241/36)/((-3)/4). -9 What is the value of (-24)/(-476)((-3)/(-4) + 300/48)? 6/17 Evaluate (-145)/9 + (-59 - -75). -1/9 Evaluate (2 - 2)/(2(-25)/50). 0 What is 4(-3 + 45/20)5/9? -5/3 What is (-6)/27 - (-195)/5616? -3/16 Evaluate 9 - (12 - 10) - 39(-2)/(-14). 10/7 (-9 + 189/18)-6 -9 What is the value of 56/8016/28? 2/5 (-1 - -6)/((-220)/264) -6 Evaluate 29/((-783)/18)(-9)/4. 3/2 Evaluate -11(-42)/616 - 1/(-4). 1 Calculate 2/(((-6)/(546/7))/((-34)/221)). 4 (136/102 - 222/(-9)) + -9 17 Calculate (-4)/10 - 98/840-7. 5/12 What is -1 - -16 - (-4488)/(-297) - 35/9? -4 (540/368)/((-207)/(-138)) - 1 -1/46 What is the value of ((-1)/4 + 0)11/66-30? 5/4 What is (-564)/56 - (-75)/304? -1/14 Evaluate (2 + 64)/(-6) + 16. 5 What is the value of (-4)/18 + (3458/(-315) - -12)? 4/5 (15 - 2054/78)/((-4)/6) 17 What is (32/(-12) - -3)/((39/(-54))/13)? -6 What is the value of (128/12)/8((-2180)/(-320) + -7)? -1/4 What is ((-53)/((-106)/4))/((-2)/2)15? -30 What is the value of (5(-10)/50)/(1/16)? -16 What is -8 + (13 + 47)/(-10)? -14 Calculate 3/(((-1395)/390)/31). -26 What is (6 - 2)/(20/(-66) - (-4)/6)? 11 What is the value of 25/(150/(-12))5? -10 What is 391/17 + -33 - (1 + 35/(-3))? 2/3 What is 33/(297/342) + -18? 20 Evaluate 6/147 - (1/2 + 7458/(-2156)). 3 What is the value of (-5 + (-481)/(-65))(-8 - 21/(-2))? 6 Calculate 3(2 - 14/6). -1 Evaluate (8/(-5) - -2)/(2/(-35)). -7 What is 7 - ((-16324)/(-2254) + 2/(-7))? 1/23 Calculate ((-2)/(-9)(-315)/(-140))/(127/(-3302)). -13 Calculate ((9/(-2) - -3) + 2)(-72)/432. -1/12 What is the value of 1323/(-630) - ((-3)/(-5))/(-1)? -3/2 What is the value of (280 - 259)(34/14 + 3 + -5)? 9 Calculate 4176/4320 + 26/(-12). -6/5 Calculate 14/(-20)-80(-22)/1056. -1/3 Evaluate (-12(-13)/(-117))/((-38)/(-3)). -2/19 What is (485/(-25))/(10/(-25))? 24 What is 2/84/12156? 13 What is (-90)/54 - 528/(-252)? 3/7 (-171 + 3)/(-12) + 272/(-18) -10/9 14/(-8) - -5 - (-1974)/168 15 What is the value of (-7018)/(-406) + -2 + -15? 2/7 Calculate (-4 + -2 - 16) + 16 - (1 - -2). -9 Evaluate (-64)/(-285 - 35) + -2 + 2. 1/5 (73/6 - 2)/1 + 1230 + -1240 1/6 ((-8)/(-6))/(-7(-14)/(-147)) -2 0 + 12/14 - 7230/(-15183) 4/3 Calculate 9 + ((-1573)/260 - 12/16). 11/5 Calculate (-1 + (-10)/((-40)/(-22)))/((-6)/(-12)). -13 Calculate ((-2100)/5400)/((-4)/(-3) + -3 + 2). -7/6 Calculate ((-54)/8)/3 - 11661/2028. -8 (-57)/(-12) - (-112)/448 5 What is (51/(-11) - -5)/(590/55)? 2/59 (6 - 0/5) + 7136/1776 + -10 2/111 50 + -46 + (-3)/18 + -3 5/6 24 - 12350/513 - (-64)/135 2/5 Evaluate (9/(-4))/((0 + 7/112)-4). 9 (7 - 0 - 5)/((-2)/1) + 5 4 Evaluate (-1)/6 + (835/(-1200) - (-1)/16). -4/5 Evaluate 8/(-5) - 13/325-15. -1 Evaluate 1((12 - (-2 + 3)) + -3). 8 Calculate (1/(-13))/(-7 + (-27)/((-891)/242)). -3/13 What is (-39)/(174/(-957) + 31/(-11))? 13 Calculate 169 - 172 - ((-3)/3 + 12). -14 What is (984/1476)/(-1 + (-44)/(-18))? 6/13 Calculate ((12/(-45))/(82/(-1353)))/((-2)/(-5)). 11 What is the value of (1/(-12))/(40/(-64)) + (-560)/(-525)? 6/5 What is (1/((-594)/45 - -13))/1? -5 Calculate 3/4(-20)/(-38) + (-84)/(-798). 1/2 What is (-12)/(-15) - (3/10 + 0/2)? 1/2 Calculate 3/(84/(-668)) + 23. -6/7 Evalua	{ "pile_set_name": "DM Mathematics" }
5w + 2r, 0 = -2w - 0w + 2r - x for w. -4 Let v be (0 + -1)/(2/(-14)). Suppose 2u - vu + 10 = 0. Solve 2r + 4a + 12 = -ur, 4r = -a for r. 1 Let x(u) = -u3 + 8u*2 + u + 6. Let d be x(7). Suppose 4f + 10 - d = 0. Solve 4z + 0 = q - 17, -3z = -q + f for q. 1 Suppose 0 = 3l + 2f - 44, -3f = -7 - 5. Let z = l + -37. Let w be (5/(-5))/(1/z). Solve -h - 22 = -5h - 2g, 0 = 4h + 5g - w for h. 5 Let x be -2 + 3/(9/96). Suppose 0 = 2c - c - 5a - x, 2c = 2a + 20. Suppose -4l + 4 = -8. Solve -c = -5v + 5g, -v - lg + 0 = -9 for v. 3 Let s(w) = w3 + 2w*2 - 3w + 2. Let l be s(-3). Suppose -12 = -lj - j. Solve -j = -2q - 3f, 5q - 10 = -3f + 5f for q. 2 Let c(d) = d + 11. Let b be c(8). Solve 3j = k + b, 5j - 37 = 2k - 4 for j. 5 Let s(g) = g3 - 4g*2 + 3g + 1. Let n be s(3). Let x be n/(-6) + 170/12. Solve 4h - z = -0z - x, -z + 6 = -2h for h. -4 Let d(j) = j3 + 3j*2 - j + 4. Let q be d(-3). Solve -i - 2p - q = 0, 5i - 5p + 18 = -2 for i. -5 Let y(n) be the third derivative of -n5/60 + n4/24 + 5n3/2 + 2n*2. Let b be y(0). Solve -4i + 5i = 2r + 6, 5r = -3i - b for i. 0 Let n = -20 - -54. Let f(r) = -r*2 + 4r - 3. Let s be f(3). Suppose 0 = -sa - a + n. Solve 3i + 30 = -5x, 9i + 3x + a = 4i for i. -5 Suppose -2n + 5t = -0t - 14, 5n = -3t + 35. Suppose 2a - 7a - 20 = 0. Let x = n + a. Solve 2k - 4 - 17 = 3z, xk = 9 for z. -5 Let h(q) = 2q2 + q. Let j be h(-1). Suppose -5v + v = -4. Let u be v - (j-2 + -1). Solve ud - 12 = 2g + 2g, -5g = -10 for d. 5 Suppose 0 = 4r + 8 - 36. Solve rm - 2m + 8 = -c, 6 = -4m - c for m. -2 Let d(s) be the third derivative of -s4/8 - s3/3 - 4s*2. Let c be d(-2). Solve 3x + 5m = -3 - 7, -5x - cm = -5 for x. 5 Let q be 23/(-3) + 2. Suppose q = 5l - l. Suppose -2a = -4 - l. Solve 0 = u + 4m + 25, 6u - au - 3m = -5 for u. -5 Let i(h) = h*3 + 13h*2 + 2. Let d be i(-13). Solve p + 31 = 5s + 11, -8 = -3p - ds for p. 0 Let v = -68 - -68. Solve 2i = -3u, -2i + vu = 2u for i. 0 Let z(j) = -j + 6. Let s be z(5). Let l be -1 - (0/(-2) + s). Let a = l + 6. Solve -af + v = -16, -4f + 4v + 16 = -0 for f. 4 Let j be -2((-9)/6)/(-3). Let m = 3 + j. Suppose mx = 5t - 17 - 8, 5x - 5t = -25. Solve 0d + 3y = -d - 5, 3d + 2y + 8 = x for d. -2 Let h(j) = j2 + 12j + 12. Let s be h(-8). Let a be ((-12)/10)/(6/s). Solve -aq + 0l - 32 = 3l, 4q - 5l = 0 for q. -5 Suppose 0k - 9 = -5k - 3b, 2b + 1 = -k. Suppose -4a - kd + 1 = 0, -4a = -7a - 3d - 3. Suppose 0 - a = -q. Solve 2 = 5f - qn - 13, f - 3 = 4n for f. 3 Suppose 4 - 16 = -3j. Solve -3x - jn + 6 = -0n, -2x = 3n - 4 for x. 2 Suppose -4c - 5y = 0, 0 = -2c - 2y + 7y. Solve ca - 15 = -2a - 3n, 4n - 20 = 5a for a. 0 Suppose 0 = -z + 6 - 3. Let i(m) = -m2 - 4m. Let p be i(-3). Suppose 4s + 31 - 51 = 0. Solve 2r + pa = 5 + 2, 0 = -zr + a + s for r. 2 Suppose 2p - 10 = -2q + p, 0 = 4q - 2p - 20. Solve 15 = -2j + 5n, 3n = 8n - q for j. -5 Let t = 0 - -3. Let c(i) = -i*2 + 9i - 10. Let v be c(7). Suppose tg = 7x - 2x + 24, -18 = -2g + vx. Solve -2h + 6 = -0q - 4q, 4q - gh = -9 for q. 0 Suppose 20 = 4t + 5n + 3, 3t = 3n + 6. Solve x + 1 = -tg + 9, -10 = -4x - g for x. 2 Let i = -43 + 75. Let d = -20 + i. Solve 0 = -3w - 3p - d, 2w - p = -5p - 14 for w. -1 Let i be 11/31 - 1/(-3). Solve 4t - 3b + b - 8 = 0, -5t + 13 = -ib for t. 1 Suppose -129 = -4g - 25. Suppose -10 = -3n + g. Solve -4r + n = 3k, 3r + 3k = -2k + 9 for r. 3 Suppose 6j = j. Let d(h) = -h + 2. Let a be d(j). Solve -2x + 2y = -8, 4y - 2y + 4 = -ax for x. 1 Suppose j - 12 = -2j. Solve -ja + 0 = t + 18, -t - 10 = 2a for a. -4 Let g be 9/(-27) + (-32)/(-6). Suppose 0s + 5z - 5 = -gs, 2z + 4 = 0. Solve -7 = -3l - 5j, -4l = -sl + 4j for l. 4 Suppose 0 = -3s + 4k - 9, -s = -2s + 5k - 3. Let p be s/4 + 33/12. Solve 0 = -5y - 7 - 3, pb - 2y + 6 = 0 for b. -5 Suppose -2q - 2q = 0. Suppose u - 2u + 20 = q. Let w be ((-2)/5)/((-4)/u). Solve 0o + v = o + 3, 0 = wo - 5v + 6 for o. -3 Suppose 12z = 15z - 9. Solve -r - p = 2r + 5, 0 = -zr + 3p - 21 for r. -3 Let m(d) = 5d2 - 1. Let p be m(-1). Suppose -4 + 12 = pc. Solve 2q = -10, -q + cq + 25 = -4k for k. -5 Let i be 1/((-2)/((-8)/(-1))). Let n = i + 13. Let b be 3/n3 + -1. Solve -6g = -2g + 8, -5r + 3g + 31 = b for r. 5 Let m be -2 + 5 - (5 - 5). Suppose -3c - 6 + 3 = -mi, 0 = -i + 4. Solve 0 = -k + 5, -2q + ck + 0k - 19 = 0 for q. -2 Let o(x) = -2x*2 + 10x - 6. Let r be o(4). Solve -3i - 2p + 3 = -7p, -2i + 4p + r = 0 for i. 1 Let b(w) = -w3 + 9w*2 - 2w + 10. Let k be b(9). Let f = -8 - k. Solve -3h - t = -1, f = -2h - 0t - 4t - 16 for h. 2 Suppose l = -2l + 6. Suppose -lr = -r - 3. Solve ra + 2a - 16 = u, 4a - 17 = 5u for u. -1 Let b be 1(-3 - -2)1. Let a(g) = 4g2. Let c be a(b). Solve cy = 5h - 1, -5h + 11 = -5y - 2h for y. -4 Let d be 36/28 - 4/14. Solve -4n = 4, -2i + 0i - n + d = 0 for i. 1 Let x = -45 - -48. Solve -v - 1 = 0, 0 = 2z + 4v + 13 - x for z. -3 Suppose -5i = 4c - 33, -5i - 14c + 18c + 17 = 0. Solve h + 2g = 7g + 6, -ih + g = -6 for h. 1 Let r = 21 + -11. Solve 5n - 5q = 5, 0n + r = n + 2q for n. 4 Suppose -z + 0 = -4. Suppose j - 4y - 3 - 11 = 0, -zy - 12 = 0. Solve 0 = q - 5c + 12, jq = 4q - 5c + 9 for q. 3 Suppose 5q = -2c + 8, 0c - 5q + 50 = 5c. Solve 7o = -k + 3o + 15, 2k = 3o - c for k. -1 Let z(c) be the second derivative of -c5/20 + c4/2 + c*2/2 - c. Let t be z(6). Let w be (-11)/(11/(-1)). Solve -4k + 5b = -t - 7, 5k = b - w for k. -3 Let b be 17 - (-2)/(-4)-6. Solve -4u = -b, 0z + 11 = z + 3u for z. -4 Let f(m) = 0 - m + 3 - 2 - 6. Let h be f(-8). Solve h = n + 3j + 12, 4j = -n - 12 for n. 0 Suppose 9q = 15q. Solve -5l = -2l + 3n + 30, 2l - 5n - 15 = q for l. -5 Let l = -7 - 0. Let h = 0 - l. Solve -1 - h = 2v - 4s, 4v + 4s - 32 = 0 for v. 4 Let q be (-4)/((-4)/1) + 3. Suppose -2r + 12 = -4i, -7r + qi + 16 = -3r. Solve s - 5s = rx - 12, -3s - 3x + 15 = 0 for s. 1 Let x = 6 + -7. Let b = x + 1. Solve -4d = -bd - f - 15, 3f = 3d - 18 for d. 3 Let t = 27 + -13. Solve -u = 4u - 4k + 6, -t = 5u + 4k for u. -2 Suppose -o = -n - 17, 3o - 47 = -0n + 2n. Solve 2f + 4j - 1 = o, 0 = j - 4 for f. -1 Suppose 0 = 3l - 4 - 68. Solve 4k = 5c, 2k + c = -2k - l for k. -5 Let h be (-3 + 1 + 4)/2. Let k = 1 - h. Let z(f) = -f. Let w be z(-4). Solve -3d - 5s + 7 = k, ws = 5d - 6 - 18 for d. 4 Suppose -5s - 8s = -143. Solve -s = 2g + r, -3r - 2r - 25 = 0 for g. -3 Let r be (-4)/7(-21)/6. Solve -ra + 4m = -20, -34 = -5a + 4m - 8 for a. 2 Let l be (-2 - (-1 + 1))435/(-30). Solve 5x + 2y = 5y - l, -3x - 4y = 0 for x. -4 Let m = 6 - 1. Suppose mh = 0, -9 = -5r + h + 6. Solve -2c = -2q - 8, 4q + 17 = -rc - 6 for c. -1 Let w be -2 + -82 + 3. Let q = w - -5. Let b = 13 + q. Solve -7d = t - 3d + 20, -d = bt + 16 for t. -4 Let b(r) = 4r*2 - r. Let y be b(1). Suppose 0 = 2n + 4a - 12, -n + ya + 6 = -0. Suppose -f - 25 = -nf. Solve -c = -fw - 16, -5c = 2w - 5w - 14 for w. -3 Suppose 5d - 91 = -3p, 0 = 4p + d + 4d - 118. Solve 4l - 5q = 4, -2q - 1 = 5l + p for l. -4 Suppose 2b - 4i = -1 - 3, -5i + 5 = 0. Solve b = 2s - 0s + 2, -14 = 4o - 2s for o. -4 Let p(n) = n*3 - 3n*2 - 3n + 13. Let b be p(3). Solve -bw = -4x + 20, -2w = 4x - 3 - 11 for w. -1 Let i(c) = 4c - 4. Suppose 2k + 0k - 10 = 0. Let f be i(k). Suppose -f = -4a + o, -3a - 2o = -0o - 1. Solve -3l = v + a, 5l - 4l - 2v = -1 for l. -1 Let i be (-8)/((-4)/4) - 4. Suppose 2m = 4p + 4 - 28, 3p + 2m - 11 = 0. Solve 0a + pa - in = -4, 3a + 2 = 2n for a. 0 Suppose -20r + 15r = 0. Solve w + 13 = 3h, 4h + r = -w + 15 for w. -1 Suppose 0s = 3s + 12, 2s + 10 = a. Suppose p = -0p + a. Solve -pg + 5 = 2g - b, -4g = -4b - 20 for g. 0 Suppose -2w - 3c = 3w - 28, 2w - 9 = c. Suppose 0 = -0j - wj - g + 15, 4j + g = 13. Solve 5m - 20 = m + n, 3m - jn = 20 for m. 4 Let j be (13 + -13)-11. Solve 0 = -2l, -3p + 3 = -l - j for p. 1 Suppose -2h + 3q + 11 = -7, 4*h - 56 = q. Let j	{ "pile_set_name": "DM Mathematics" }
-4i(y) + n(y). Let b(h) = 0. Calculate h. 1/2, 1, 3 Suppose z - r = 0, 14z = 9z - 3r. Factor 0 + zw + 0w*2 - 3/5w*3. -3w*3/5 Suppose -28 - u + 3u*2 - 5u + 31 = 0. What is u? 1 What is q in -176 + 173 - 3q + 3q*2 + 2q3 + q3 = 0? -1, 1 Let x(v) be the third derivative of v5/15 - v3/6 - 2v2. Let f be x(1). Factor d3 + 0d*2 + 2d*2 - fd2. d2(d - 1) Let m(r) be the first derivative of r5/10 - r4/6 - r3/3 - 3r*2 - 3. Let h(i) be the second derivative of m(i). Factor h(v). 2(v - 1)(3v + 1) Suppose -4u - 8 = -2t, 4u + 10 - 8 = -t. Factor 10/7c*3 + 0 - 4/7c - 6/7ct. 2c(c - 1)(5c + 2)/7 Determine g, given that -1/3g*3 - 8/3 + 5g - 2g2 = 0. -8, 1 Let y = 366 - 364. Find b, given that 4/5b + 4/5 + 1/5by = 0. -2 Let k(j) = -j + 12. Let s be k(11). Let i(h) be the first derivative of 8/5h - 2/3h3 - s + 8/5h2. What is q in i(q) = 0? -2/5, 2 Let m(w) be the first derivative of w2 - 1/6w4 + 2w + 1 + 0w3. Let k(d) be the first derivative of m(d). Factor k(x). -2(x - 1)(x + 1) Let c(o) be the second derivative of 4o + 0 - 1/3o3 + 2o*2 - 1/6o*4. Factor c(z). -2(z - 1)(z + 2) Suppose 125/3i - 20/3 - 20/3i4 + 125/3i*3 - 70i*2 = 0. What is i? 1/4, 1, 4 Suppose 14 = 2g + c - 7, 57 = 5g + 4c. Factor 1/3h3 - 3h*2 - g + 9h. (h - 3)*3/3 Factor 2/9r*2 + 0r - 8/9. 2(r - 2)(r + 2)/9 Let v(i) be the first derivative of -i*3 + 3i*2 - 3i + 10. Factor v(h). -3(h - 1)2 Let v be (-18)/(-162) - (-26)/(-288). Let z(g) be the second derivative of 0 + 1/8g*3 + 1/4g*2 - 4g + vg4. Solve z(n) = 0. -2, -1 Let p = 0 + 0. Let i be 5 + 0 - (1 - p). Determine k so that 0 + 1/4k*3 + 2k*i + 0k - 1/2k2 + 5/4k*5 = 0. -1, 0, 2/5 Factor -4/5o - 1/5o2 - 4/5. -(o + 2)2/5 Let w(u) be the first derivative of 2u*3/15 - 2u*2/5 - 6u/5 + 3. Factor w(q). 2(q - 3)(q + 1)/5 Factor 13s3 - 52 + 100s + 0s + 2s*3 - 70s*2 + 12. 5(s - 2)*2(3s - 2) Let t(w) be the first derivative of 1/9w*3 + 1/60w*5 - 1/12w*4 - 1 + 0w*2 - w. Let n(q) be the first derivative of t(q). Solve n(r) = 0 for r. 0, 1, 2 Let t(r) be the first derivative of 2r*3 + 2r*2 + 2r - 4. Let s(u) = 7u2 + 5u + 3. Suppose -c - 5 = -0c. Let b(o) = ct(o) + 4s(o). Solve b(i) = 0. -1, 1 Let g(v) be the third derivative of v6/120 + 11v*5/20 + 121v*4/8 + 1331v*3/6 + 67v*2. Find k, given that g(k) = 0. -11 Suppose -693f*2 + 0f3 - f4 - f*5 + 694f2 + f3 = 0. What is f? -1, 0, 1 Let l be 0/((1 - 0) + -3). Let r(o) be the first derivative of -7/4o4 + lo + 5/3o3 + o2 + 2. Factor r(j). -j(j - 1)(7j + 2) Let k(t) be the third derivative of 2t2 + 1/420t*7 + 0 + 1/240t*6 + 0t - 1/672t8 + 0t*4 - 1/120t*5 + 0t3. Factor k(v). -v2(v - 1)2(v + 1)/2 Let h(w) be the first derivative of -w*3/7 - 9w*2/7 + 3w - 8. Factor h(m). -3(m - 1)(m + 7)/7 Let n(c) = c - 1. Let i(j) = -j*2 + 5j + 1. Let g(z) = -z - 1. Let h(d) = -4g(d) - i(d). Let s(u) = h(u) + 3n(u). What is k in s(k) = 0? -2, 0 Let m be 18/10 + 6/30. Factor 1/4g + 0 + 0g*m - 1/4g*3. -g(g - 1)(g + 1)/4 Let n(f) = -f2 + 5f + 6. Let p be n(6). Let b(u) be the first derivative of pu + 4/21u*3 - 1 - 1/14u*4 + 0u*2. Factor b(h). -2h*2(h - 2)/7 Let k(l) = -l*4 - 1. Let r(v) = 3v*5 + 4v*4 - 12v*3 - 6v*2 + 9v - 2. Let b(f) = 2k(f) - r(f). Solve b(a) = 0. -3, -1, 0, 1 Let v(y) = y3 + 4y*2 - 8y - 11. Let l be v(-5). Let x be l/22 + (-357)/(-154). Let 0 + 5/2o4 - xo*2 + 7/2o*5 + o - 9/2o*3 = 0. Calculate o. -1, 0, 2/7, 1 Let r(j) = 8j*4 + 2j*3 - 6j*2 - 2j + 4. Let x(y) = 9y4 + 3y*3 - 7y*2 - 3y + 5. Let k(c) = 7r(c) - 6x(c). Find t such that k(t) = 0. -1, 1 Let t(x) be the first derivative of 3x5/25 - 3x4/5 + x3 - 3x2/5 + 6. Factor t(z). 3z(z - 2)(z - 1)*2/5 Let h = -308 + 926/3. Factor 4/9q - h + 2/9q2. 2(q - 1)(q + 3)/9 Let x(r) be the second derivative of r5/12 - 35r*4/36 + 25r*3/6 - 15r*2/2 + 18r. Suppose x(b) = 0. What is b? 1, 3 Let a = 1537 + -63012/41. Let q = 129/287 + a. Factor qc + 10/7c*2 + 8/7c*3 + 2/7c*4 + 0. 2c(c + 1)2(c + 2)/7 Let s(d) be the first derivative of -2d5/5 - 7d*4/4 - 3d*3 - 5d*2/2 - d - 7. Suppose s(w) = 0. Calculate w. -1, -1/2 Factor 5z - 8z2 + 15z*2 - 12z*2. -5z(z - 1) Find i such that 1/2i*3 + 1/2i*2 + 0i + 0 = 0. -1, 0 Let q(s) be the third derivative of -1/360s6 + 1/504s*8 + 0s + 4s2 - 1/630s*7 + 0s*3 + 0s*5 + 0 + 0s*4. Let q(f) = 0. Calculate f. -1/2, 0, 1 Let l = 2/209 - -826/1045. Let a be ((-3)/2)/((-3)/8). Solve -38/5i*2 + l - 66/5i*3 + 2i + 18ia = 0. -1/3, 2/5, 1 Let d(a) = a3 + 2a*2 - 3a - 4. Let l be d(-1). Let lp - 2/9p*3 - 2/9p*2 + 0 = 0. What is p? -1, 0 Factor 0 + 1/2j*2 - j. j(j - 2)/2 Let r = -114 - -118. Let i(k) be the third derivative of 0 + k*2 + 1/28k*r + 0k - 2/21k3 - 1/210k*5. Factor i(s). -2(s - 2)(s - 1)/7 Suppose 0 = -2c + 18 - 4. Suppose -4u4 + cu*2 - 2u*2 + 2u5 + u - u2 - 3u = 0. What is u? -1, 0, 1 Factor 40 + 20w + 5/2w2. 5(w + 4)2/2 Let o(i) be the second derivative of i6/135 - 2i5/45 + i4/9 - 4i3/27 + i2/9 + 6i. Factor o(u). 2(u - 1)*4/9 Factor -15y*3 - 9y*4 - 11y*3 - 4y - 27y2 - 4y*3 - 2y. -3y(y + 1)(y + 2)(3y + 1) Let l(j) be the first derivative of -3j4/2 - j2 - 2. Let v(z) = 5z3 + z. Suppose -7 = 4o + 9. Let k(b) = ov(b) - 3l(b). Factor k(m). -2m(m - 1)(m + 1) Suppose 2 + 4 = 3z. Let f(s) be the second derivative of -1/60s5 + zs - 1/6s3 + 1/12s*4 + 0 + 1/6s2. Factor f(a). -(a - 1)3/3 Let o(c) be the second derivative of c4/12 - c3/6 - 3c2/2 - 3c. Let r be o(3). Determine d so that -9d + 13d + 3d2 - rd*2 + 2d*2 = 0. -2, 0 Suppose -t = -2t - 9t. Let q(u) be the first derivative of -1/14u*4 + 1/7u*2 + 0u*3 - 4 + tu. Solve q(y) = 0. -1, 0, 1 Let t = -95 + 99. Let d(b) be the first derivative of 2/5b5 + 0b + 0b2 - 1/15b*6 - 4/5b*4 + 8/15b*3 + t. Factor d(i). -2i*2(i - 2)*2(i - 1)/5 Let m(z) = z*2 + z. Suppose 3b - 5v + v - 1 = 0, b + v = -2. Let a(f) = 21f*3 + 32f*2 + 5f - 6. Let r(q) = ba(q) - 4m(q). Factor r(w). -3(w + 1)2(7w - 2) Let o(f) be the first derivative of -f4/34 + 16f*3/51 - 7f*2/17 + 13. Find n, given that o(n) = 0. 0, 1, 7 Let n = -239/10 + 24. Let c(k) be the second derivative of -1/60k*4 + 2k + 0 + nk3 - 1/5k*2. Factor c(s). -(s - 2)(s - 1)/5 Suppose -2c + 16 = 6m - 2m, m - 4c + 14 = 0. Suppose 0 = 4w + 4, mw + 3 = -j - w. Factor 1/2u2 + u3 + ju + 1/2u4 + 0. u2(u + 1)2/2 Let s(u) be the second derivative of -u7/12 - 3u6/20 + u5/8 + 3u4/8 + u3/6 - 14u. Find i such that s(i) = 0. -1, -2/7, 0, 1 Factor -25/3s*3 - 5/3s*4 + 20/3s + 40/3 - 10s2. -5(s - 1)(s + 2)3/3 Let h = -1 + 4. Let d be ((-2)/h)/((-1)/3). Let m(w) = -w3 + w - 1. Let x(o) = -o3 - 15o*2 - 26o - 10. Let t(u) = dm(u) + x(u). Factor t(r). -3(r + 1)(r + 2)2 Let r(u) be the third derivative of 1/30u5 + u2 + 0u + 0u*3 - 1/12u*4 + 0. Let r(k) = 0. What is k? 0, 1 Let j = 100/9 - 317/18. Let p = j + 9. Factor -1 - ph + h*2 + 5/2h*3. (h - 1)(h + 1)(5h + 2)/2 Let g(c) be the first derivative of -c*4/20 - c - 1. Let w(d) be the first derivative of g(d). Determine x, given that w(x) = 0. 0 Suppose -z + 0 + 2 = 0. Factor 0p + 0p + pz + 0p*2 - p. p(p - 1) Let a(o) be the first derivative of 0o2 + 0o - 4 + 2/9o3 - 1/2o*4 + 7/36o*6 - 3/10o*5. Find r, given that a(r) = 0. -1, 0, 2/7, 2 Let c(a) be the third derivative of 27a*7/700 - 3a6/100 + a5/150 - 17a2. Find j, given that c(j) = 0. 0, 2/9 Let o = -19 - -21. Let d(n) be the second derivative of 2n + 0 + 1/24n3 - 1/80n*5 + 0n*4 + 0n*o. Factor d(t). -t(t - 1)(t + 1)/4 Determine o, given that -8/21o*4 + 0 + 8/21o + 32/21o2 - 2/21o*3 = 0. -2, -1/4, 0, 2 Let p(c) be the first derivative of -1 + 1/22c*4 + 4/33c*3 + 0c*2 + 0c. Find x, given that p(x) = 0. -2, 0 Let r(x) be the second derivative of -x5/40 + x4/12 - x*3/12 + 7x. Facto	{ "pile_set_name": "DM Mathematics" }
of 1/2, to the nearest integer? 756 What is the eighth root of 2316369525 to the nearest integer? 15 What is 446809058 to the power of 1/2, to the nearest integer? 21138 What is the sixth root of 274765812 to the nearest integer? 25 What is the seventh root of 1702840616 to the nearest integer? 21 What is 60198704 to the power of 1/3, to the nearest integer? 392 What is 12635760 to the power of 1/9, to the nearest integer? 6 What is 76469191 to the power of 1/6, to the nearest integer? 21 What is 292799696 to the power of 1/2, to the nearest integer? 17111 What is 1071897951 to the power of 1/2, to the nearest integer? 32740 What is the third root of 3602710752 to the nearest integer? 1533 What is 58061339 to the power of 1/3, to the nearest integer? 387 What is the square root of 766598068 to the nearest integer? 27688 What is 981464368 to the power of 1/7, to the nearest integer? 19 What is 33493285 to the power of 1/2, to the nearest integer? 5787 What is the third root of 1586765122 to the nearest integer? 1166 What is the cube root of 75667614 to the nearest integer? 423 What is 553184093 to the power of 1/3, to the nearest integer? 821 What is 3545223307 to the power of 1/2, to the nearest integer? 59542 What is 3894343589 to the power of 1/8, to the nearest integer? 16 What is the square root of 1210811582 to the nearest integer? 34797 What is the sixth root of 117220275 to the nearest integer? 22 What is the seventh root of 936027537 to the nearest integer? 19 What is 429971004 to the power of 1/2, to the nearest integer? 20736 What is the cube root of 35337518 to the nearest integer? 328 What is the square root of 20645955 to the nearest integer? 4544 What is the fifth root of 270922043 to the nearest integer? 49 What is 153624227 to the power of 1/3, to the nearest integer? 536 What is the square root of 407469409 to the nearest integer? 20186 What is the tenth root of 43576578 to the nearest integer? 6 What is 34752034 to the power of 1/4, to the nearest integer? 77 What is 585136962 to the power of 1/9, to the nearest integer? 9 What is the cube root of 152226587 to the nearest integer? 534 What is 199622051 to the power of 1/4, to the nearest integer? 119 What is the sixth root of 19009381 to the nearest integer? 16 What is the seventh root of 41738660 to the nearest integer? 12 What is 1607935750 to the power of 1/9, to the nearest integer? 11 What is the sixth root of 1821121062 to the nearest integer? 35 What is the fourth root of 221001705 to the nearest integer? 122 What is 6642539 to the power of 1/8, to the nearest integer? 7 What is the third root of 1447287913 to the nearest integer? 1131 What is 645815310 to the power of 1/8, to the nearest integer? 13 What is the square root of 1121030427 to the nearest integer? 33482 What is 118521851 to the power of 1/3, to the nearest integer? 491 What is 556578141 to the power of 1/3, to the nearest integer? 823 What is the fourth root of 5780975121 to the nearest integer? 276 What is the eighth root of 26166585 to the nearest integer? 8 What is the third root of 32704279 to the nearest integer? 320 What is the cube root of 5344456166 to the nearest integer? 1748 What is the ninth root of 3753990763 to the nearest integer? 12 What is the cube root of 672244041 to the nearest integer? 876 What is the square root of 336621549 to the nearest integer? 18347 What is the sixth root of 4253728695 to the nearest integer? 40 What is the sixth root of 4837472 to the nearest integer? 13 What is the fifth root of 1006678915 to the nearest integer? 63 What is the cube root of 640182664 to the nearest integer? 862 What is 88339460 to the power of 1/9, to the nearest integer? 8 What is 257384686 to the power of 1/9, to the nearest integer? 9 What is 26313233 to the power of 1/2, to the nearest integer? 5130 What is 2435419784 to the power of 1/8, to the nearest integer? 15 What is the seventh root of 41804228 to the nearest integer? 12 What is the square root of 49987580 to the nearest integer? 7070 What is 111771505 to the power of 1/2, to the nearest integer? 10572 What is 262567709 to the power of 1/2, to the nearest integer? 16204 What is the square root of 2259717 to the nearest integer? 1503 What is the fourth root of 71053008 to the nearest integer? 92 What is the square root of 1349471938 to the nearest integer? 36735 What is 1722605861 to the power of 1/10, to the nearest integer? 8 What is the square root of 23447011 to the nearest integer? 4842 What is the fifth root of 780417384 to the nearest integer? 60 What is 67643726 to the power of 1/6, to the nearest integer? 20 What is the fourth root of 1400566203 to the nearest integer? 193 What is the tenth root of 333244630 to the nearest integer? 7 What is the fifth root of 1399763 to the nearest integer? 17 What is the fourth root of 432931957 to the nearest integer? 144 What is the cube root of 145725525 to the nearest integer? 526 What is the square root of 1030461167 to the nearest integer? 32101 What is the cube root of 847749829 to the nearest integer? 946 What is the eighth root of 188883310 to the nearest integer? 11 What is 87524883 to the power of 1/3, to the nearest integer? 444 What is 285978127 to the power of 1/2, to the nearest integer? 16911 What is the square root of 69063049 to the nearest integer? 8310 What is 71361024 to the power of 1/2, to the nearest integer? 8448 What is the cube root of 5676883571 to the nearest integer? 1784 What is the eighth root of 80169216 to the nearest integer? 10 What is the third root of 256091493 to the nearest integer? 635 What is the square root of 19086582 to the nearest integer? 4369 What is the eighth root of 349254081 to the nearest integer? 12 What is 318280038 to the power of 1/7, to the nearest integer? 16 What is 36017462 to the power of 1/7, to the nearest integer? 12 What is the square root of 1895462462 to the nearest integer? 43537 What is the third root of 3520913781 to the nearest integer? 1521 What is 594305519 to the power of 1/10, to the nearest integer? 8 What is 1980434659 to the power of 1/10, to the nearest integer? 9 What is 1131251628 to the power of 1/3, to the nearest integer? 1042 What is 30490515 to the power of 1/2, to the nearest integer? 5522 What is the cube root of 51358231 to the nearest integer? 372 What is the square root of 37369771 to the nearest integer? 6113 What is the square root of 16978304 to the nearest integer? 4120 What is 1862948272 to the power of 1/3, to the nearest integer? 1230 What is the square root of 231982978 to the nearest integer? 15231 What is 107737148 to the power of 1/2, to the nearest integer? 10380 What is the cube root of 102459398 to the nearest integer? 468 What is 44410162 to the power of 1/3, to the nearest integer? 354 What is 15112765 to the power of 1/10, to the nearest integer? 5 What is 383061238 to the power of 1/7, to the nearest integer? 17 What is the square root of 670359259 to the nearest integer? 25891 What is 221916215 to the power of 1/3, to the nearest integer? 605 What is 1722200646 to the power of 1/2, to the nearest integer? 41499 What is the square root of 29261916 to the nearest integer? 5409 What is 129894217 to the power of 1/3, to the nearest integer? 506 What is the cube root of 92790489 to the nearest integer? 453 What is the square root of 5767557109 to the nearest integer? 75944 What is 6104490840 to the power of 1/8, to the nearest integer? 17 What is 130240890 to the power of 1/2, to the nearest integer? 11412 What is the square root of 107922185 to the nearest integer? 10389 What is the fourth root of 175564292 to the nearest integer? 115 What is the cube root of 240367084 to the nearest integer? 622 What is 189357411 to the power of 1/10, to the nearest integer? 7 What is the third root of 90770723 to the nearest integer? 449 What is 291684619 to the power of 1/9, to the nearest integer? 9 What is the third root of 387318384 to the nearest integer? 729 What is the square root of 354423074 to the nearest integer? 18826 What is the square root of 16888592 to the nearest integer? 4110 What is 154829255 to the power of 1/6, to the nearest integer? 23 What is the third root of 421922493	{ "pile_set_name": "DM Mathematics" }
564/(-80) + 9. -37 What is the value of (2580/(-1075))/((-132)/((-132)/(-12)))? 1/5 What is the value of 2/(-46) - (-30)/(((-5888)/392)/16)? -32 Evaluate ((-216)/(-15300))/(81/918). 4/25 Calculate (692/(-1211))/((-12)/(-294)). -14 Calculate (-42)/(-147)147/60(-12)/273. -2/65 Evaluate (-657)/5694(-8)/(-3). -4/13 ((-49)/(-117) - 4/36) + (-5)/402 3/52 What is the value of (0 + 3)/((-17)/((-391)/69)) + -60? -59 What is (-28)/(-10)(-28 + ((-166)/664)/(45/(-5240)))? 28/9 What is the value of 5/(5/42)(70824/234 - 303)? -14 What is the value of (-4732)/476 - (177/(-18) + ((-7)/42)/1)? 1/17 -1383(-2)/63 - (2405/105 - 23) 44 What is (33003/(-1158))/(((-15)/2)/(17 + -19))? -38/5 Evaluate 7 + (-5858)/202 - (-8)/(-2). -26 What is the value of (15 - 0 - 1)/(246/(-85 + 2053))? 112 What is the value of ((-3010)/86)/(-96 + 46)? 7/10 Calculate -27 + ((-145)/(-4) - (-143)/(-572)). 9 (54/60)/(3684/10745) 21/8 What is (-4 - 80/70)259/74? -18 Evaluate 64 + (-987)/(117 + 24). 17 (((-1938)/15)/19 - (0 + -7))-9 -9/5 12 + 274/8(-18)/27 - 5/(-6) -10 What is the value of -425/(927 - 27)? -1/9 Calculate (-1210)/305 - (-5048)/(-153964). -4 816/(-510)-352/363/(-49) -48 Evaluate 5230/4515 + 1448/(-1267). 2/129 Evaluate (254(3 + 96/(-40))-5)/(-6). 127 What is the value of -76 + (1462/68 - (-10)/(-4))? -57 What is the value of (2/(-224)8)/((-18)/(-5764))? -64/7 217/105(-1905)/254 -31/2 Evaluate 1149056/15744 + 17260/2460 + -7. 73 What is ((-89 + 92)/((-4)/(-22)))/(7/(-14))? -33 Evaluate 9 - ((-114)/24)/((-99)/216). -15/11 Calculate (1 + (-2 + 0)/((-4)/(-6)))1801917/(-138609). 26 (-54)/7 + -383157/(-10824) -5/7 Evaluate (0 + 60)2/32806/2806. 40 What is the value of 15/27 + (-56)/((-6048)/180)? 20/9 Evaluate 134/1675 - ((264/121 - 2) + 21753/(-275)). 79 8/(-432)(6 - (-16 - -7)) -5/18 What is -96 + (10/(-12))/(880/(-26400)) - (10 - 1)? -80 What is the value of 138/(-230)((-5250)/(-36))/(-25)? 7/2 What is the value of ((-36)/(-60))/(1/75-3)? -15 What is (717/(-63) + 11)((-328)/32 - 2)? 14/3 Evaluate (34 - 36)(-1 + 2)/(((-28)/413)/4). 118 Calculate -55 + (-22)/(-561) + 55. 2/51 (16 + (-281520)/17600)(6 - 1) + 1/4 3/11 Calculate (484/4356)/((-14)/(-378)). 3 Evaluate (-113)/33918/40 - (-847)/8580. -2/39 Calculate -52-18(-15 - 15786/(-1053)). -8 Evaluate 9545/575 - (-5370)/(-325). 1/13 (5168/(-6460)(-25)/2)/((-4)/(-18)) 45 4 + (-3)/(8/(-36) + (-705)/(-135)) 17/5 Calculate (1/(-2))/(((-2051)/980)/(-293)). -70 (12/(-48))/(78/494(-3)/36) 19 Calculate (-20)/(-46 + 14240/240). -3/2 What is the value of 4252/(-118) - 1128/(-33276)? -36 1494/(-50796)(-68)/(-6) -1/3 What is the value of (-60)/8(14 - (-472)/(-36))? -20/3 What is 798/84((-45)/(-30))/((-4)/((-64)/(-6)))? -38 Evaluate 6 - 18 - (18/(-4))/(259 + -257). -39/4 Evaluate ((-4)/(-5))/((-30256)/(-832040)). 22 Calculate -53 - (3030/(-144) - 1/(-4)). -47 What is (-48)/(-31 + 83 + -58)? 8 Calculate 109 + 176055/(-1573) - (0 - 3) - 1513/65. -116/5 (-165)/(13530/(-7462)) - (-3 + -2) 96 What is (21 - (-34012)/(-1617))/(94/(-156) - 21/91)? 2/49 Calculate (-8596)/308 - (23 - 51) - (-4)/22. 3/11 Evaluate (3/(-1) - 16/35) + 1155/(-825). -34/7 ((-53)/((-1696)/(-112)) + 49/(-6))6/5 -14 What is the value of (-18)/(-42) - (-4)/14(-2466)/1602? -1/89 Calculate (-7)/98-21499/(-71856). -1/96 Evaluate (1410/40)/((-3021)/4028). -47 What is (-2394)/180 + -12 - (2 + (-92)/40)? -25 Evaluate 128956/1299448 + 34/(-323). -1/166 Calculate (-7553)/(-6474)12/(-1). -14 What is -8 - (156/4524 + (-2382)/116)? 25/2 Calculate (-810)/85533/297. -2/19 What is -8 - 41449/(-84)? 61 What is (82/26 - (-22)/(-143)) + (2424/70)/(-12)? 4/35 What is (18 + 3)(59 + (-14292)/252)? 48 Calculate 1/21 + 18288250/201075. 91 Calculate 4(4/6)/((-374)/306-18). 4/33 (-460/(-144))/((-791)/399 + 2) 95 What is 21/27 + (4830/(-819) - -6 - (-45)/195)? 10/9 What is (641775/(-1150))/43 - 26/(-2)? 1/46 Evaluate ((-38)/(-3591)21 - (-2552)/(-468)) + 5. -3/13 Calculate 1/(-3(-2)/(-36)) + 0 + 3 + -35. -38 What is the value of -39133774/(-18759)? 102 Evaluate -8 + (2/(-3) - ((-84)/189 - 1750/18)). 89 Evaluate ((-3)/(-1))/(-1)1 - 128077/(-43097). -2/71 What is ((-39)/(-4))/((-53833)/(-480356))? 87 ((-209)/63 - -3) + (-4)/(-42) + 490/7875 -4/25 Evaluate ((-40)/(-39))/52079/(-1386). -4/13 Evaluate 11802/(-4215)(-10)/(-32). -7/8 Calculate (-10)/75(-5130)/798 - (153/(-56))/(-3). -3/56 What is the value of ((-24)/(-104))/((-1917)/2769)? -1/3 What is the value of (-79 - -210)/393-133? -13 20223/(-4494)(-2 - (-28)/18) 2 What is the value of (-144 - -156)/((-27)/(-18) + 10/(-12))? 18 10/3 + (-79851)/774 + 2/(-12) - -14 -86 Calculate 8 - ((-42)/7 + 18)/(-6(-5)/20). 0 (84/24)/(((-304)/57 + (3 - 0))/(-2)) 3 Calculate 127/((-89154)/216) - 4608/(-104). 44 Calculate 4588/370 - (-3 - -1 - -13). 7/5 (-2 - (2 + -2))/(2/(-61) - (-871740)/15402744) -84 Calculate 21/12 + 357/(-204) + (-8)/(-48). 1/6 Calculate 19 - ((-10)/6 + 2/(-6) - 5). 26 (-26467)/(-323) - 376/(-6392) 82 Calculate 45/((-1170450)/7463) - (-28)/16(-30)/(-175). 2/153 Calculate 2427084/47443 - (-9)/(-57). 51 Evaluate (44/8)/(-11)-10 + 632/(-128). 1/16 Calculate 687/2977 - 12217/(-26). 80 (89/((-423640)/765))/((-14)/(-8) - 1 - 0) -3/14 Calculate (34/36)/(-47 - -44 - (132/18 + -10)). -17/6 Evaluate ((-4)/7)/((-45)/356240/3510). 1/4 Evaluate ((-70)/6)/(2044/(-1584)). 21 Evaluate (2/(-5) - -1)/((-41331)/(-6819615)). 99 What is the value of 18 - -4(646/(-152) - 2)? -7 Evaluate ((-1)/4)/(31 + (-1333)/62). -1/38 What is 2030/56 - 2142/504? 32 Evaluate (-69)/24610104/6. -2/107 What is ((1200095/6475)/(-499))/(26/(-4))? 2/35 What is ((-594)/(-288) + -2)8/(-12)? -1/24 (60/(-2430) - 504/(-729)) + 4/(12/(-239)) -79 Evaluate (-126)/44 + 1 - (-21 + 6799/325)25. 3/22 What is the value of (10 - (-3577)/(-357))/((-269)/(-538))? -2/51 70/8 + -25 + (-828)/(-46) 7/4 Evaluate -3(-724)/120 - 54/360(0 + 4). 35/2 Calculate -9 - (936/16)/13-2 - (-14 - -106). -92 What is 768/64((-3)/(-4))/(93/(-434))? -42 Calculate -3(4688/168 + -28). 2/7 What is the value of 7683/393015 + (294/(-266) - -1)? -3/35 What is (-7 + 14 - -13)(-348)/6090? -8/7 Calculate (4/30)/(-84 - (-3707)/44). 8/15 Evaluate 89 + (-166784)/1664 - (-10 - 3/3). -3/13 231/(-84) + ((-1425)/(-60))/(-19) -4 What is the value of (3276/(-4641))/(1 - (-6 + 10))? 4/17 Calculate 5/(-3)4/10(-11172)/(-114 - -212). 76 Calculate 2/(-4) + ((-87066)/(-300))/7 + 40/1000. 41 What is the value of (-344)/(-8) - (6 + -13 + 15)2/2? 35 What is the value of (((-35)/3500)/((-4)/(-30)))/(((-216)/(-16))/(-9))? 1/20 ((-1655)/993)/((130/(-126))/13) 21 ((-1)/3)/(90/(-834300)-103) -30 Evaluate (-32 - -22 - -26)/(75/(-450)). -96 What is the value of (-2)/6-63736/(-6762)? -16/7 What is 213/6 + (-143460735)/4041994? 2/269 What is (52/(-24) - -2) + ((-495)/81 + 6)111? -25/2 Calculate (1704(-173)/24912)/((-1)/(-6)). -71 What is the value of 25460/540 - (40 - -7)? 4/27 Calculate (-5144)/321505/2. -2/5 What is the value of 19 + (-28 - (-43 + 8))? 26 -11 - ((-63)/(-28))/(((-175)/(-9310))/(20/42)) -68 What is (96900/557175)/(8/6)? 3/23 What is the value of (-2(6 - 1) + 423/42)/((-2)/6)? -3/14 What is (((-368550)/108)/65)/(40/(-48))? 63 Evaluate (-1128652)/(-36330) - (-1)/(-15). 31 Evaluate (-12)/550139675/(-11174). 3/11 1113/(-39) + 19/2 + (-21)/42 6/13 Calculate 1540/(-455840)((-2 - -3) + 22/(-6)). 1/111 (4 + -6)1 - ((-4392)/400 + 9) -1/50 Evaluate 98/2822/(-77)(-34)/(-2). -17 What is the value of ((-4)/279)/(21120/1890)? -1/93 What is 0 + (1888/708 - 23/3) + -2? -7 Calculate -148108/(-378) + (-9)/7. 41 What is 33(84/12 + -6) + -29? 4 What is 139 + (3128/68 - 120)? 65 What is (-2 + -2 - (-224)/70)/((-294)/(-20) + -15)? 8/3 What is the value of ((-24)/18)/(33173/(-735) + 47)? -5/7 What is (-33)/((-3927)/70)9/30? 3/17 Evaluate ((21/(-252))/(1/12))/((-6)/24)1. 4 Evaluate (-3718)/(-6864)-56 - 1-26. -13/3 Calculate ((-4680)/196)/3 - (2 - (-1 - -11)). 2/49 What is the value of (-27 - (-6012)/216) + ((-95)/90 - 8/(-36))? 0 (-339)/(-565) + 3/((-420)/304) -11/7 Calculate (4/7 - 0)(-36953)/116138. -2/11 Calculate -63(-33)/775(-12)/(-990). 18/11 What is the value of (9/(-10))/(14634/390240)? -24 Calculate ((-2)/(-4)(-6)/18)/(8/(-24)15). 1/30 -19 - (5 + (369706/(	{ "pile_set_name": "DM Mathematics" }
ve. m*(-32/15) Simplify v/(v((v/((v/((v*(-1/6)v)/v))/v))/vv)/v)v*1(v/((vv((v/v*(-1/3))/v)/v)/vv))/(v*(-11)vvvvv) assuming v is positive. v*(41/6) Simplify i/(i((i*(-2/51)i)/i)/i)((i/(ii*(-35)))/i)/i(i(2/11))(-5/8) assuming i is positive. i*(76129/2244) Simplify ((oo/(o(2/61)/o))31)8 assuming o is positive. o(44888/61) Simplify (x/(x/(x/(xx/x(2/23)xx)))xxxx(6/5))/(x(-2))16 assuming x is positive. x(3828/115) Simplify ((t(2/3))(-3/5)(t(2/5))(2/7))(-2/119) assuming t is positive. t(4/833) Simplify (k(2/5))(-30)k/k(-3/2)k/k(2/11) assuming k is positive. k(-191/22) Simplify (k*(-21)k)*(6/13)k/(k*(-8/3)/k)kk/k(-5) assuming k is positive. k(95/39) Simplify (hh*(-4/5)hh)(-4)(h/h*(1/28)h)/h(-2/3) assuming h is positive. h(-2591/420) Simplify ((u*(-1/18)u)/uuu((u/(uu/u*(14/5)))/uu)/u)/(u*(-9/8)/(uu*(2/37)u)) assuming u is positive. u*(78901/13320) Simplify ((vv*25v)/(v(vv(-3))/v))/(v(-16)/(vv/(v/v(-24)))) assuming v is positive. v22 Simplify (z(1/3))(-2/5)(z*1/zz)(7/4) assuming z is positive. z(97/60) Simplify ((p/p(-2/15))37/(p*12/(pp/(p*3pp))))(5/8) assuming p is positive. p(101/6) Simplify ((((l3l)/l)/l)/(ll/(((l/(lll(4/11)))/l)/l)))(-25) assuming l is positive. l(925/11) Simplify (r(-1/5)rrr)/rrrr(1/3)(r(-1/6))(6/11) assuming r is positive. r(667/165) Simplify (j(-5)jjjjj(j/(((j/(j/j*(8/5)))/jj)/j))/jjj)/(j(-10))(-19) assuming j is positive. j(-943/5) Simplify (((b1b)(-4))(-2/11))(-35) assuming b is positive. b(-560/11) Simplify t(3/2)t*8t*(1/4)/(t/(tt/(t/t(-24)))) assuming t is positive. t(-57/4) Simplify ((n*28n)/((((n/n*8)/n)/n)/nn))(-27) assuming n is positive. n(-1026) Simplify ((gg/(gg25/g))/((((g/g(-29))/g)/g)/g))/((ggg*(-38)gg)/((g(-2/23)/g)/g)) assuming g is positive. g(-416/23) Simplify (((k/(k/k(-1/2))k)/k)/k)*10(((k/k*(4/3))/kk)/k)/((k(-8)/k)/k) assuming k is positive. k(-19/3) Simplify (l20)(8/11)/(l(-2/5)/l(-7)) assuming l is positive. l(437/55) Simplify (f(-8)/f)(-3/4)/(f/f(6/11)ff(-2/59)/f) assuming f is positive. f(16431/2596) Simplify ((l*(-1)l)*26/(ll*6/llll(2/5)))(22/7) assuming l is positive. l(-132/5) Simplify (a(-19)aa*5/aaa)/(a/a(-4/7)aa)(-17) assuming a is positive. a(341/7) Simplify q8/(q/q(-3))(qqq*(-1)q)(-34) assuming q is positive. q(-64) Simplify ((m/m*(-5))/(mm*(-1/9)m))/(m*5mmm*(-5)m) assuming m is positive. m(10/9) Simplify (i(-8)i)(-34)/(i20)50 assuming i is positive. i(-762) Simplify j(-8)/jj/j*(-12)j/(jj(-11))(jj(-1/8))/j assuming j is positive. j(119/8) Simplify ((qq(-23/3)/q)/q(-1/2))/(q(-4/13))(1/7) assuming q is positive. q(-3889/546) Simplify (l/(l(14/3)/l)l)/(l(6/13)/l)(l(-6)/l)(-2/11) assuming l is positive. l*(62/429) Simplify (rr/(r/r*(-12)r)r)(1/46)r*(-5/7)r(-1/14) assuming r is positive. r(-165/161) Simplify (((pppp2/pp)/(p(p(1/2)p)/pp))/(p(2/17)/(p(-1)/p)))(1/4) assuming p is positive. p(13/136) Simplify (m(-1))(-35/2)/(m(-2/5)(m(mmm(-6))/m)/mm) assuming m is positive. m(219/10) Simplify (i/i0)(-31/2)/((i(1/24)/i)/i(-1/2)) assuming i is positive. i(-361/24) Simplify ((m/(m/(mmm/m33)))(-13))(27/2) assuming m is positive. m5265 Simplify ((k(k4/k)/k)/k)/(k(1/7)/k)k(2/11)/k(-3) assuming k is positive. k(465/77) Simplify i(5/8)i(7/4)(i*(-3)/ii)/ii7 assuming i is positive. i(43/8) Simplify (v/((vv*(-3/7))/vvv)vv(3/10)vv/((vv*8/vv)/v)vv(v(2/17)v)/vv)6 assuming v is positive. v(-7689/595) Simplify (o(6/5)/((o/(o(13/3)/o))/oo))/((oo/o31)/(oo*(-11/4)oo)) assuming o is positive. o(1967/60) Simplify (r(-1/6))(-22)/((r(-1/4)/r)/r(-24)) assuming r is positive. r(-229/12) Simplify (g/(g/(g(-6/7)/g)))/(gg/((gg/(ggg/(g(-3/7)/g))gg)/g)g)g/(g/(gg/(g/g*(-7/4)))g)g(-4) assuming g is positive. g(-337/28) Simplify (ii*(-11)i)(-49)/(i(-1/5)/ii)13 assuming i is positive. i(2218/5) Simplify (tt(tt*(2/31))/tt)/(t/(t*(-1/3)/t)tt)(t*5/t)/tt9 assuming t is positive. t(998/93) Simplify (i*4i(-1/10))/(i(-5)(i/(i5i))/i) assuming i is positive. i(149/10) Simplify ((v(2/9)/v)/v(3/2))/(v(-1/18)vv/v(2/27)) assuming v is positive. v(-112/27) Simplify (r*(-9/8)rr(2/19)r)/(r(-2/5))(-2/11) assuming r is positive. r(7587/8360) Simplify (((i(2/3)/i)/(i5/i))(-41))(8/9) assuming i is positive. i(4264/27) Simplify (oo(ooo*(-2/13))/oo(o(-2/11)/o)/oo)/((o/(oo/o(1/7)o))/((o/(o/(o/(o/(oo4)))))/o)) assuming o is positive. o(8530/1001) Simplify (w(-1/42)/(w15w))(3/8) assuming w is positive. w(-673/112) Simplify (((yy(2/5)y)/(yy(-2/15)))(-20))35 assuming y is positive. y(-3220/3) Simplify d37d*(-32)d/(d*24d)d(ddd(6/5)/d)/d assuming d is positive. d(-84/5) Simplify (y(2/79))(26/9)/((yy(1/7))/y)43 assuming y is positive. y(-30209/4977) Simplify (ggg/(g/(g(2/3)g))g)/(gg*(1/10)gg)((g/g*(2/19))/gg)/(g*(-6)gg) assuming g is positive. g(3683/570) Simplify (q/q(2/17)qqq)(-2/25)/((q/q(-2/37))/qqq(-10)) assuming q is positive. q(135791/15725) Simplify (((x*(2/15)/x)/xxx3/x)(2/15))29 assuming x is positive. x(986/225) Simplify (w(4/5)ww(w/(ww(-4/5)w))/w)/(w(-3/20)/(w/(w(6/5)/ww))) assuming w is positive. w(31/20) Simplify ((ffff*(-1/2)ff)/f(-2/5)(f(2/3))(-4/7))(2/49) assuming f is positive. f(949/5145) Simplify (w(1/3))(-22)(w(-2/5))(-2/169) assuming w is positive. w(-18578/2535) Simplify (m(-4/3))(10/13)/(m(-6/5)mm(-15)) assuming m is positive. m(2764/195) Simplify ((i/(i(2/19)/ii))/i*(-5)(i/((i*(4/7)i)/i)i)/((i/i4)/i))(3/10) assuming i is positive. i(2259/665) Simplify j/j5j*29(j*(3/8)jj)/j37 assuming j is positive. j(-77/8) Simplify p(2/17)p*(1/6)p(p(-6/11)pp)/(p/((p(-15)/p)/p)) assuming p is positive. p(-17123/1122) Simplify ((z1/z)49(z/(z(z/z3)/z))/z(-5))(-29) assuming z is positive. z(-232) Simplify (b/(b/b(-2/7))b*25)/(bb*(-1/14)(b/(b/(b/((bb(-2/25))/b))))/b) assuming b is positive. b(8297/350) Simplify ((r(3/22)r)/(rr/(r/r(-9)rr)))(-9/7) assuming r is positive. r(-315/22) Simplify ((m(-5/2)m(-1/2))(-4/21))(13/2) assuming m is positive. m(26/7) Simplify (o/o*(1/6)o(-2/9))/(o(2/21)/(o/(o((o/(o11o))/o)/o))) assuming o is positive. o*(1703/126) Simplify (aa(a/((aa/(a*(-6/7)a))/aa))/a)(3/13)a*(2/31)a(1/17) assuming a is positive. a(7496/47957) Simplify (ii(-1)i*(-2)(i(3/2)/i)/(i/i(-3/4)))(-3/11) assuming i is positive. i(39/44) Simplify (j(18/5)/(j(-26)/j))/((jj/(j/j(-2/21)))/(((jj(-6/13))/j)/j)) assuming j is positive. j(38539/1365) Simplify ((d/d(-16))/d)(-12)/(dd(-6)dd)(-6/17) assuming d is positive. d(-3282/17) Simplify (j(-2/11))(29/5)jj2jj(5/4) assuming j is positive. j(923/220) Simplify (v(-9/7)/vvv(14/9)/v)22 assuming v is positive. v(-1012/63) Simplify (l(-2/7)l(13/4))/(l(3/11))25 assuming l is positive. l(-1187/308) Simplify g/g*(-2/7)(g/(g*(-14)/g))/gg(((gg/(g(18/5)/g))/g)/g)/g(2/13) assuming g is positive. g(6612/455) Simplify (j0)*(37/4)((j*(-2)j)/j)/((j*(-1)j)/j) assuming j is positive. 1/j Simplify (w*0w*(2/27)(ww(-2))34)16 assuming w is positive. w(-14656/27) Simplify (n(((nn(1/2))/n)/nn)/n)*(16/3)(n/(n/(n/(n/(n/((n/n*(-1/9))/n))))n))/n2 assuming n is positive. n(5/9) Simplify (oo(9/5)/o(o/o*(1/3)o)/o)/(o(-1/10)/o(1/6)) assuming o is positive. o(41/15) Simplify (k(-20)k(-4/5))/(k8)(19/2) assuming k is positive. k(-484/5) Simplify (h(-2))18/((h(8/3)hh)/hh(1/9)) assuming h is positive. h(-358/9) Simplify ((hhh*19h)/h)/(h*21h)h(-1/6)/(h(h/(hh/(h/(h(-14/9)h)h)))/h) assuming h is positive. h*(-49/	{ "pile_set_name": "DM Mathematics" }
= -6c. Let t be (c/10)/((-3)/(-15)). What is the second derivative of k2 + 2 + 11k - tk2 - 2 wrt k? -44 Let w(k) be the second derivative of -37k*4/12 - 85k*3/3 + 5k - 18. Find the second derivative of w(u) wrt u. -74 Let l be 21/(270/(-55) - -5). What is the derivative of l - 127 - 130 + 60p wrt p? 60 What is the second derivative of -2r*4 - 4288 - 4297 + 1718r*3 + 451r + 8588 wrt r? -24r2 + 10308r What is the third derivative of -281x2 + 138x*6 - 4x*4 + 295x*2 + 49 - 130 wrt x? 16560x*3 - 96x Let i be (1 + -5 - -9) + -1 + 1. Suppose -iv - 15 = -10v. What is the third derivative of 4o2 - 73 + 4o*v + 22o*2 + 73 wrt o? 24 Let i(t) = 3t - 11. Suppose r + 19 - 13 = 0. Let w(m) = 5m - 10. Suppose 2j - 12 + 2 = 0. Let b(u) = ji(u) + rw(u). Differentiate b(n) with respect to n. -15 Let d(j) = -29316j - 9407. Let b(w) = 7363w + 2352. Let u(z) = -11b(z) - 3d(z). What is the derivative of u(c) wrt c? 6955 Let q(m) be the second derivative of 2147m3/6 - 4750m*2 + 10m - 442. Differentiate q(a) wrt a. 2147 Let u(o) be the second derivative of 0 + 11/6o3 - 11/60o*5 - 13/2o*2 + 13o + 0o4. Let c(k) be the first derivative of u(k). Differentiate c(a) wrt a. -22a Let g(z) be the first derivative of -687z6 - 4202z*2 - 7422. What is the second derivative of g(q) wrt q? -82440q*3 Suppose -5k + 103 = -r - 3k, -3r = 5k + 265. Let j = r + 98. Find the third derivative of 18m*2 - 10m*3 + 15m*3 - 10m*j wrt m. -30 Differentiate 17727c - 5874c - 13545 - 3282c with respect to c. 8571 Suppose 61 + 0 = f. What is the second derivative of -16 - 11 + 43 - 15 + fm2 + 32m wrt m? 122 Let d = 2 + 3. Suppose -3y = -0y + ds - 20, -5y = 5s - 30. What is the third derivative of 7 - 7 + 19r*3 - 10r*2 - yr*3 wrt r? 84 Let i = 755 + -719. Find the second derivative of 36t*2 - 80t5 + 1 + t3 - it2 + 146t - 64t5 wrt t. -2880t*3 + 6t Let s = 7612 - 7612. Let d(n) be the third derivative of -3/4n4 + 53n*2 + 22/3n*3 + 0n + s. Find the first derivative of d(x) wrt x. -18 Let k(j) = -153j - 761. Let g be k(-5). Let q(n) be the third derivative of 0n + 0 - 1/2ng + n3 - 5n*2. What is the derivative of q(w) wrt w? -12 Let n = -80 - -92. Suppose n = -4b + 28. What is the third derivative of -100 + 100 - 11m4 + bm*4 - 14m*2 wrt m? -168m Let c(a) = 655a2 + a + 25. Let n(g) = -1311g*2 - 3g - 50. Let o(r) = -7c(r) - 4n(r). Find the second derivative of o(w) wrt w. 1318 Find the second derivative of 79o - 390 + 2153 + 72o - 2193o4 - 150o wrt o. -26316o2 Let w(p) be the first derivative of 2p*5/5 + 559p*3/3 - 1046p - 320. What is the first derivative of w(r) wrt r? 8r3 + 1118r Let l(g) be the third derivative of g*7/210 + 719g*5/12 - 1565g*4/6 + 6384g*2. Find the second derivative of l(y) wrt y. 12y*2 + 7190 Differentiate 273371 + 1520o + 133o - 273580 with respect to o. 1653 Let n = -42 - -68. Let m = 255 - 253. Find the third derivative of -mv*3 - nv*2 - 10v*3 - 17v3 wrt v. -174 Let r(d) = -d3 - 32d2 - 6d + 2743. Let x(j) = -j3 - j2 - 3j. Let c(s) = r(s) - 2x(s). What is the derivative of c(k) wrt k? 3k2 - 60k Let r = 199 + -191. Find the second derivative of 68p5 - 7p + 55p5 - rp + 16 + 11p wrt p. 2460p*3 Let y(j) = 27j + 275. Let l be y(-8). Find the third derivative of 344k4 - 94k*4 + lk + k*2 + 41k*4 wrt k. 6984k Suppose -5j + 2j + 90 = 3h, -j - 4h + 27 = 0. Differentiate -107 + j + 92l - 10l with respect to l. 82 Find the third derivative of -4j4 + 1533j*2 + 1 + 0 + 6620j + 1650j5 - 6620j wrt j. 99000j2 - 96j Let f(l) be the third derivative of 22l5/5 + l4/8 + 325l*3 + 33l*2 + 16l + 2. Find the first derivative of f(j) wrt j. 528j + 3 Let j(f) be the first derivative of -3f*4/4 - 37f*3/3 + 19f*2/2 + 9865f - 2870. Find the first derivative of j(g) wrt g. -9g2 - 74g + 19 Let z(j) be the third derivative of -1/40j5 - j2 - 19/6j*3 + 5/12j*4 + 0 + 0j. Let r(l) be the first derivative of z(l). Differentiate r(f) wrt f. -3 Suppose 0 = 7z + 4z - 33. Find the third derivative of 20g + 23g*z - 85g*2 - 20g - 21g3 - 5g*4 wrt g. -120g + 12 Let w = 60 - 57. Differentiate 39y3 + 101y*4 + 55y*w - 103y*4 + 129 wrt y. -8y*3 + 282y*2 What is the second derivative of -6604 - 328j + 396j4 + 6604 wrt j? 4752j*2 Let m = -637 + 639. Find the third derivative of -9w*2 - 6w*2 + 25w*m - 8w*2 + 8w - 3w3 - 8w*2 - 12w*4 wrt w. -288w - 18 Let w(m) = -59m2 + m. Let f be w(-1). Let r = -59 - f. Find the first derivative of -2 - r - 6p*4 + 0p*4 - 7 wrt p. -24p3 Let v(k) = k3 - 22k2 + 85k + 3. Let b be v(17). Find the second derivative of 1387h2 - 2h - 1479h2 - bh + 4h wrt h. -184 Let f(o) = -4o*2 - 17o - 1419. Let c(n) = -5n2 - 16n - 1425. Let p(a) = -5c(a) + 6f(a). Differentiate p(j) with respect to j. 2j - 22 Let s(r) be the third derivative of r8/28 + r5/30 + r4/12 + 851r*2 - 2r. Find the third derivative of s(o) wrt o. 720o2 Suppose q = w - 6w + 20, -3w = 4q - 12. Suppose q = -4o + o. What is the second derivative of -7s3 - s3 - 20s - 7s + os wrt s? -48s Let n(u) be the second derivative of -u*7/7 - 805u*3/6 + 70u. Find the second derivative of n(d) wrt d. -120d3 Suppose 4s = 4b - 4, 5b = 3s - 4s + 11. Find the first derivative of -9n2 - 22n*b - 31n*2 + 94 - 8 + 136 wrt n. -124n Let l be (-3)/(-15) - (-2044)/730. Let h(n) be the first derivative of 12n + 17 - 20/3n*l + 0n*2. Differentiate h(d) with respect to d. -40d Differentiate 2374s - 959s - 751s - 2s*2 + 2328s + 7507 wrt s. -4s + 2992 Differentiate -1913 + 26727x - 1378x3 - 13366x - 13361x with respect to x. -4134x*2 Let n(u) be the third derivative of 0 + 0u*3 + 0u - 1/30u5 - 92u*2 + 0u*4 - 27/40u*6. Find the third derivative of n(k) wrt k. -486 Let k = -9 + 5. Let x be 9 + 4/k-1. What is the third derivative of 15g2 - xg - 9g6 - 2g*2 + 10g wrt g? -1080g3 Let d(o) = -o + 14. Let p be d(7). Suppose 10x - 18x + 16 = 0. Find the third derivative of 15j*x + 5j*5 + 2j*6 - pj*2 - 5j*5 wrt j. 240j*3 Let p be (1/(-2))/(26/(-208)). Suppose -4o + 4v = -9o + 39, -3o + pv + 17 = 0. Find the second derivative of -21b - 56b*3 + 17b*3 + ob*3 wrt b. -192b Suppose 0 = -19i + 16i + 81. Find the second derivative of -y*2 + 2y - 17y5 + 9y*5 + 0y - iy5 wrt y. -700y*3 - 2 Let n(o) be the second derivative of 61/2o*2 + 0 + 147o - 1/6o3 + 1/12o*4. What is the second derivative of n(j) wrt j? 2 Suppose -2q + 35 = 5q. Suppose -qa + 338 = 4m, 3a = -0m + m - 76. What is the third derivative of 82 - 11p*6 + 8p*2 - m wrt p? -1320p*3 Suppose 5b - 15 = -2u - 1, -5b = -5u. What is the third derivative of 4q*4 - 10q*4 + 6q*3 - 67q*2 - 49q*2 - 44q*b wrt q? -144q + 36 Let b(z) = 3z2 + 23z - 6. Let x be b(-8). Find the third derivative of -10jx - 25j*3 + 24j*3 - 46j*2 - 12j*2 wrt j. -6 Let v(u) be the third derivative of -2583u*6/40 - 791u*4/2 + 2392u*2. What is the second derivative of v(x) wrt x? -46494x Let n(d) be the second derivative of -d*4/12 - 361d*3/3 + 678d*2 - 4354d. Find the first derivative of n(r) wrt r. -2r - 722 Differentiate -1826t*3 + 333t*3 - 134t*3 + 340 with respect to t. -4881t2 What is the third derivative of r2 - 47908006 + 2r3 - 4r - r + 47908393 + 15r5 + 97r*4 wrt r? 900r*2 + 2328r + 12 Let v(p) = 4p2 - 4p - 4. Let h be v(-2). Suppose -7w + 2w + h = 0. Find the third derivative of f*2 + 6f*3 + 2f*2 + 18f*3 - wf*2 wrt f. 144 Let j = -110 + 184. Let k = -71 + j. What is the third derivative of 21p*3 + kp3 + p2 + p2 wrt p? 144 Let s(b) = -b2 + 2b - 2. Let o(h) = -h4 - 3302h3 - h2 + 4h - 2551. Let r(v) = -o(v) + 2s(v). Find the third derivative of r(i) wrt i. 24i + 19812 Let j(m) = -155m*2 + 86. Let h(b) = -15b + 96. Let w be h(6). Let f(y) = -51y2 + 29. Let u(v) = wj(v) - 17f(v). What is the derivative of u(k) wrt k? -126k Suppose -10 = -2q, 0 = 5l	{ "pile_set_name": "DM Mathematics" }
olve -63s + 2s = -549 for s. 9 Solve 4j = -48 + 40 for j. -2 Solve -195 = 8l + 31l for l. -5 Solve -4l = 1 + 15 for l. -4 Solve 5p = -69 + 59 for p. -2 Solve -3r + 92 = 101 for r. -3 Solve 62m = 57m - 20 for m. -4 Solve -7q + 30 + 5 = 0 for q. 5 Solve 14b = 11b + 3 for b. 1 Solve -6a - 8a = 56 for a. -4 Solve -14x = -12x - 2 for x. 1 Solve 0 = -99b + 95b + 8 for b. 2 Solve -z + 6z + 8z = 0 for z. 0 Solve -7j + 190 - 148 = 0 for j. 6 Solve -5 = -15g + 10g for g. 1 Solve -x - 20x = 0 for x. 0 Solve 20o - 12 = 17o for o. 4 Solve 18v = 19v + 2 for v. -2 Solve -55a = -91 + 421 for a. -6 Solve 44 = 8i + 3i for i. 4 Solve -302m + 45 = -311m for m. -5 Solve 397g + 48 = 391g for g. -8 Solve -31z = 109 + 46 for z. -5 Solve 0 = 452g - 454g - 12 for g. -6 Solve -6g = -8 - 10 for g. 3 Solve -30b + 40 = -20b for b. 4 Solve 199 = 35n + 304 for n. -3 Solve -3q - 17 = -5 for q. -4 Solve 0 = -5n + 10n - 10 for n. 2 Solve 11g = 8g + 12 for g. 4 Solve 50 = -8l + 10 for l. -5 Solve -10u + 11 = -39 for u. 5 Solve -33 = 2g + 9g for g. -3 Solve -5 = 4q - 5q for q. 5 Solve 12i - 1 - 23 = 0 for i. 2 Solve 389w = 391w + 2 for w. -1 Solve 16l + 15 = -65 for l. -5 Solve 8 - 77 = -23b for b. 3 Solve 0 = -5i + 1 + 4 for i. 1 Solve 3i = -16 + 10 for i. -2 Solve -143w - 32 = -135w for w. -4 Solve f + 51 = 56 for f. 5 Solve -47u + 64 = -218 for u. 6 Solve 37 = -8n - 3 for n. -5 Solve 0 = 112n - 4n + 216 for n. -2 Solve -w + 7w - 12 = 0 for w. 2 Solve 19 - 54 = 35d for d. -1 Solve -6 = 8r - 10r for r. 3 Solve -130 = -20o - 30 for o. 5 Solve 13 = 3s - 5 for s. 6 Solve -71m = -21m - 400 for m. 8 Solve 5n - 15 = 2n for n. 5 Solve 55f - 97 = 13 for f. 2 Solve -448r + 451r - 15 = 0 for r. 5 Solve 10 = 6c - 11c for c. -2 Solve 85s - 51s = -136 for s. -4 Solve -29x + 23x + 12 = 0 for x. 2 Solve q = 7q - 30 for q. 5 Solve -8p = -15p + 14 for p. 2 Solve 6b + 36 = -6b for b. -3 Solve 0 = -2q - 2q + 16 for q. 4 Solve 188 = -18j - 29j for j. -4 Solve 45s + 52 = 19s for s. -2 Solve 4x + 144 = 140 for x. -1 Solve 2w + 5w = -9w for w. 0 Solve 13z + 4z = -102 for z. -6 Solve -59s - 60s = -16s for s. 0 Solve -3377k = -3386k - 72 for k. -8 Solve 60 = 8h - 20h for h. -5 Solve -6r - 147 = -183 for r. 6 Solve 0 = 134u + 250 + 18 for u. -2 Solve -88h - 30 = -94h for h. 5 Solve 66 = -0i - 22i for i. -3 Solve -3i = 3i - 12 for i. 2 Solve 756 = -9t + 783 for t. 3 Solve -71 = -s - 70 for s. 1 Solve u + 2u = -8u for u. 0 Solve s - 545 = -550 for s. -5 Solve 184 = 41v - 144 for v. 8 Solve -29k + 189 + 14 = 0 for k. 7 Solve -116 = t - 113 for t. -3 Solve -3f = -2f + 1 for f. -1 Solve 39t - 65 = 26t for t. 5 Solve -8 = -7n - 22 for n. -2 Solve -3x - 5x - 8 = 0 for x. -1 Solve -17v = 7v - v for v. 0 Solve -3 = 74x - 71x for x. -1 Solve 12 = -6b + 10b for b. 3 Solve 8l + 2 = 34 for l. 4 Solve -19i - 15 = -22i for i. 5 Solve 216 + 34 = 25z for z. 10 Solve -6g = -11g - 15 for g. -3 Solve -681 = -6a - 717 for a. -6 Solve -351 = -42d + 3d for d. 9 Solve -850i = -867i - 136 for i. -8 Solve -267 + 222 = 9x for x. -5 Solve 0 = -32q + 174 - 14 for q. 5 Solve -5l = -4l for l. 0 Solve -13a = -25a for a. 0 Solve -17 + 21 = 4n for n. 1 Solve 9o = 46o - 37 for o. 1 Solve -110 - 97 = -23r for r. 9 Solve -49a + 140 = -21a for a. 5 Solve 11 - 3 = -4n for n. -2 Solve 19 - 7 = -4w for w. -3 Solve -27z = -24z - 9 for z. 3 Solve 0 = -5p + 8p - 15 for p. 5 Solve 41 = -22h - 19h for h. -1 Solve 15 = -26a + 21a for a. -3 Solve -174 + 138 = -6i for i. 6 Solve 18 = 4g + 34 for g. -4 Solve -11a = 4 - 26 for a. 2 Solve -3d - d = -16 for d. 4 Solve -5k + 2 = 7 for k. -1 Solve -9 + 9 = -3q for q. 0 Solve -114 = 5a - 109 for a. -1 Solve -186a = -146a - 40 for a. 1 Solve 2r = 5r + 9 for r. -3 Solve 2u = -5 + 13 for u. 4 Solve 0 = 317r - 321r - 4 for r. -1 Solve -10d - 48 = 2d for d. -4 Solve -4 = n - 2 for n. -2 Solve 3f = 196 - 190 for f. 2 Solve -149b + 167b = -36 for b. -2 Solve 69y - 106 = 32 for y. 2 Solve 0 = 4v + 14v + 11v for v. 0 Solve 0 = 24h + 1406 - 1190 for h. -9 Solve 0 = -6o - 835 + 829 for o. -1 Solve 22 = 2n + 26 for n. -2 Solve 19x = 15x - 16 for x. -4 Solve 71z + 483 = 2z for z. -7 Solve 0 = -4q - 12 - 8 for q. -5 Solve 3x = -15x for x. 0 Solve 64d = 39d + 125 for d. 5 Solve 84q + q - 850 = 0 for q. 10 Solve 32b - 100 = 22b for b. 10 Solve 57 = -x + 53 for x. -4 Solve i + 18 = 24 for i. 6 Solve -6i = 8 - 26 for i. 3 Solve 26k - 71 = -19 for k. 2 Solve -21 = u - 24 for u. 3 Solve -138n = -141n + 12 for n. 4 Solve 3l = 23 - 5 for l. 6 Solve -60q + 5 = -55q for q. 1 Solve -6w = 7w + 78 for w. -6 Solve 47k = 13k + 204 for k. 6 Solve -42q - 12 = -39q for q. -4 Solve -25i - 23i = -384 for i. 8 Solve 0 = -102j + 92j + 60 for j. 6 Solve 0 = -43s + 41s + 12 for s. 6 Solve r = -18 + 13 for r. -5 Solve 0 = -37b + 38 - 297 for b. -7 Solve 28y = -2y - 5y for y. 0 Solve -3l - 47 = -44 for l. -1 Solve -259 + 265 = -2b for b. -3 Solve 0 = -i - 7 + 11 for i. 4 Solve -3 = 18n + 51 for n. -3 Solve -2v + 16 = 10 for v. 3 Solve 168c = 184c + 96 for c. -6 Solve 0 = v + 4 - 2 for v. -2 Solve 0 = -5f + 24f + 57 for f. -3 Solve -29g = -37g for g. 0 Solve 0 = 50z - 45z - 5 for z. 1 Solve -65 + 23 = 6h for h. -7 Solve 17r = 8217 - 8234 for r. -1 Solve 41b + 24 = 45b for b. 6 Solve -390 = -6t - 378 for t. 2 Solve -1305 = -11h - 1283 for h. 2 Solve -7 = -o - 8 for o. -1 Solve 2z = -11z + 39 for z. 3 Solve 39 - 9 = -6s for s. -5 Solve 7a = 31a for a. 0 Solve -28d = -183 + 295 for d. -4 Solve -16m = -32m - 96 for m. -6 Solve 26 = 17x - 25 for x. 3 Solve -1926i = -1927i + 1 for i. 1 Solve 419 = -2h + 419 for h. 0 Solve -2h - 228 = -40h for h. 6 Solve -102m + 101m = 0 for m. 0 Solve -7w + 74 = 123 for w. -7 Solve 14 = 5r - 11 for r. 5 Solve 3887 - 3855 = 4v for v. 8 Solve 5y + 1 + 14 = 0 for y. -3 Solve 1 = 5k + 21 for k. -4 Solve 47r - 23 = -211 for r. -4 Solve j + 24 = 27 for j. 3 Solve 8b = 10b for b. 0 Solve 5 + 1 = -2x for x. -3 Solve 6x - 12x = -24 for x. 4 Solve -13u + 4 = -17u for u. -1 Solve -67 = 80l + 93 for l. -2 Solve -128w + 39 = -115w for w. 3 Solve 35 = 12y + 11 for y. 2 Solve -15s - 24 = -3s for s. -2 Solve 11s + 17 = 28 for s. 1 Solve 0 - 16 = 4s for s. -4 Solve -5d = 19 - 39 for d. 4 Solve -260 = -77m + 142m for m. -4 Solve -3j = 14j + j for j. 0 Solve 0 = -21a - 11 - 52 for a. -3 Solve 4o - 18 = 6 for o. 6 Solve 2w = -23w - 125 for w. -5 Solve -33t - 4 = -29t for t. -1 Solve -10 = -12w + 26 for w. 3 Solve 0 = -12a - 13 + 25 for a. 1 Solve 4 = -49u + 4 for u. 0 Solve -20 = 5m - 30 for m. 2 Solve -620 + 636 = 16z for z. 1 Solve v - 22 = -21 for v. 1 Solve -65 = 26m - 169 for m. 4 Solve 76v - 78v = -12 for v. 6 Solve 0 = -52b + 47b + 5 for b. 1 Solve -14 = -3i - 29 for i. -5 Solve -4g + 8g = -8 for g. -2 Solve -6z = -8z - 6 for z. -3 Solve 41t - 312 = -11t for t. 6 Solve 3z = -2z - 15 for z. -3 Solve -36 = -49q + 111 for q. 3 Solve -32 = 38o + 6 for o. -1 Solve 0 = -60j + 58j + 10 for j. 5 Solve -4 - 5 = 9b for b. -1 Solve o + 7o + 16 = 0 for o. -2 Solve 0 = 7t + 3t + 6t for t. 0 Solve 22f - 5 = 27f for f. -1 Solve -104 = 22n + 4n for n. -4 Solve 124 + 100 = -28x for x. -8 Solve 30b + 45 = 39b for b. 5 Solve 17j - 40 = -6 for j. 2 Solve 7w = 2w for w. 0 Solve 35 = 10s - 3s for s. 5 Solve 148 = -187o + 224o for o. 4 Solve 2w = 4w + 4 for w. -2 Solve -9u = 536 - 581 for u. 5 Solve 8o = -4o - 36 for o. -3 Solve -56f = -59f - 12 for f. -4 Solve 0 = 8q - 2 - 30 for q. 4 Solve 256o = 263o - 7 for o. 1 Solve 0 = 519b - 526b for b. 0 Solve 66z = -628 + 100 for z. -8 Solve 22 = -2b + 22 for b. 0 Solve -86s = -70s + 80 for s. -5 Solve 17i + 592 - 422 = 0 for i. -10 Solve -4 = -7b + 3 for b. 1 Solve -36i = -10i + 78 for i. -3 Solve -31 = 15d - 106 for d. 5 Solve -6a - 70 = -58 for a. -2 Solve 664 - 682 = 3u for u. -6 Solve 5u = -10u - 60 for u. -4 Solve 95s - 77s = 18 for s. 1 Solve -7t - 25 = -12t for t. 5 Solve -4d = -3d - 4 for d. 4 Solve -6l - 41 = -11 for l. -5 Solve 23*b =	{ "pile_set_name": "DM Mathematics" }
is the hundred thousands digit of 1373990? 3 What is the thousands digit of 232516? 2 What is the ten millions digit of 13637783? 1 What is the units digit of 846514? 4 What is the tens digit of 102148? 4 What is the units digit of 26782? 2 What is the hundreds digit of 894033? 0 What is the hundreds digit of 2492079? 0 What is the tens digit of 5489444? 4 What is the ten millions digit of 13964785? 1 What is the units digit of 936026? 6 What is the hundred thousands digit of 4261523? 2 What is the hundred thousands digit of 220433? 2 What is the hundred thousands digit of 4671537? 6 What is the hundreds digit of 279439? 4 What is the units digit of 3232894? 4 What is the thousands digit of 2308000? 8 What is the hundred thousands digit of 34797342? 7 What is the millions digit of 4379405? 4 What is the thousands digit of 260159? 0 What is the ten millions digit of 17639514? 1 What is the thousands digit of 6056917? 6 What is the hundred thousands digit of 368458? 3 What is the thousands digit of 378521? 8 What is the millions digit of 14938792? 4 What is the tens digit of 92883? 8 What is the hundred thousands digit of 215730? 2 What is the hundreds digit of 146334? 3 What is the thousands digit of 399581? 9 What is the tens digit of 351782? 8 What is the hundred thousands digit of 11869804? 8 What is the ten thousands digit of 314838? 1 What is the hundreds digit of 1056866? 8 What is the tens digit of 13625556? 5 What is the ten thousands digit of 1665787? 6 What is the thousands digit of 28388443? 8 What is the millions digit of 5517402? 5 What is the millions digit of 1588759? 1 What is the hundred thousands digit of 506106? 5 What is the hundred thousands digit of 988412? 9 What is the thousands digit of 194450? 4 What is the ten thousands digit of 152063? 5 What is the units digit of 17648826? 6 What is the hundred thousands digit of 1323733? 3 What is the hundred thousands digit of 10776196? 7 What is the ten thousands digit of 2306062? 0 What is the hundreds digit of 205209? 2 What is the hundred thousands digit of 425764? 4 What is the hundred thousands digit of 2435630? 4 What is the hundreds digit of 6599347? 3 What is the millions digit of 1248822? 1 What is the millions digit of 1864420? 1 What is the hundreds digit of 230847? 8 What is the hundreds digit of 248492? 4 What is the hundred thousands digit of 1425518? 4 What is the ten thousands digit of 18674602? 7 What is the hundreds digit of 17583606? 6 What is the ten thousands digit of 469649? 6 What is the hundreds digit of 5815714? 7 What is the tens digit of 4222278? 7 What is the ten thousands digit of 601608? 0 What is the millions digit of 4171859? 4 What is the units digit of 841237? 7 What is the tens digit of 245969? 6 What is the tens digit of 7054011? 1 What is the units digit of 173292? 2 What is the ten thousands digit of 524167? 2 What is the ten thousands digit of 575794? 7 What is the tens digit of 805296? 9 What is the ten millions digit of 11032243? 1 What is the thousands digit of 111983? 1 What is the hundreds digit of 538063? 0 What is the millions digit of 1650805? 1 What is the units digit of 3098095? 5 What is the units digit of 333335? 5 What is the hundred thousands digit of 530075? 5 What is the ten millions digit of 17090661? 1 What is the thousands digit of 2082691? 2 What is the tens digit of 243224? 2 What is the units digit of 3719865? 5 What is the ten thousands digit of 148222? 4 What is the ten thousands digit of 1686434? 8 What is the hundreds digit of 12131966? 9 What is the hundred thousands digit of 562290? 5 What is the hundred thousands digit of 554664? 5 What is the thousands digit of 3959439? 9 What is the millions digit of 2112388? 2 What is the thousands digit of 153853? 3 What is the tens digit of 21064982? 8 What is the tens digit of 51893? 9 What is the thousands digit of 2940776? 0 What is the hundreds digit of 144654? 6 What is the ten thousands digit of 2241825? 4 What is the hundreds digit of 459980? 9 What is the thousands digit of 19115? 9 What is the millions digit of 1752693? 1 What is the thousands digit of 149824? 9 What is the tens digit of 2975221? 2 What is the units digit of 13285744? 4 What is the units digit of 1266202? 2 What is the thousands digit of 394657? 4 What is the tens digit of 68396? 9 What is the millions digit of 11828082? 1 What is the hundred thousands digit of 1049962? 0 What is the tens digit of 90080? 8 What is the units digit of 1288652? 2 What is the millions digit of 2488673? 2 What is the hundreds digit of 1016810? 8 What is the tens digit of 610954? 5 What is the thousands digit of 18277? 8 What is the thousands digit of 255215? 5 What is the millions digit of 15424068? 5 What is the thousands digit of 18537? 8 What is the hundred thousands digit of 305718? 3 What is the thousands digit of 1138896? 8 What is the ten thousands digit of 217142? 1 What is the hundred thousands digit of 168811? 1 What is the hundreds digit of 271901? 9 What is the hundreds digit of 1297350? 3 What is the hundreds digit of 71567? 5 What is the thousands digit of 172629? 2 What is the millions digit of 2654878? 2 What is the hundreds digit of 195760? 7 What is the ten thousands digit of 23681? 2 What is the thousands digit of 177888? 7 What is the hundreds digit of 159007? 0 What is the hundred thousands digit of 269035? 2 What is the ten thousands digit of 1533944? 3 What is the hundreds digit of 2554784? 7 What is the units digit of 18498462? 2 What is the tens digit of 62467? 6 What is the hundreds digit of 81316? 3 What is the ten thousands digit of 1671968? 7 What is the hundred thousands digit of 582740? 5 What is the thousands digit of 254742? 4 What is the units digit of 1595530? 0 What is the units digit of 182775? 5 What is the units digit of 198772? 2 What is the hundreds digit of 3465984? 9 What is the hundreds digit of 1873970? 9 What is the tens digit of 1653701? 0 What is the tens digit of 58960? 6 What is the thousands digit of 2102243? 2 What is the tens digit of 16510032? 3 What is the tens digit of 4565720? 2 What is the millions digit of 18390194? 8 What is the tens digit of 153277? 7 What is the millions digit of 4344961? 4 What is the hundreds digit of 335063? 0 What is the thousands digit of 26120458? 0 What is the units digit of 134263? 3 What is the hundreds digit of 7228434? 4 What is the hundreds digit of 29609301? 3 What is the hundred thousands digit of 15029564? 0 What is the hundred thousands digit of 2662643? 6 What is the thousands digit of 1904496? 4 What is the hundred thousands digit of 4014559? 0 What is the hundred thousands digit of 1449231? 4 What is the hundreds digit of 457105? 1 What is the ten thousands digit of 17667456? 6 What is the hundred thousands digit of 3596968? 5 What is the units digit of 279600? 0 What is the units digit of 4174? 4 What is the ten millions digit of 13553565? 1 What is the tens digit of 3237539? 3 What is the hundred thousands digit of 689520? 6 What is the units digit of 7056923? 3 What is the millions digit of 1628811? 1 What is the tens digit of 305647? 4 What is the units digit of 2796445? 5 What is the hundred thousands digit of 2457899? 4 What is the tens digit of 5507934? 3 What is the tens digit of 425584? 8 What is the thousands digit of 386274? 6 What is the thousands digit of 32244366? 4 What is the hundreds digit of 435175? 1 What is the tens digit of 569968? 6 What is the millions digit of 4635864? 4 What is the thousands digit of 62986? 2 What is the hundreds digit of 51023? 0 What is the units digit of 7831665? 5 What is the thousands digit of 5491692? 1 What is the hundred thousands digit of 7352015? 3 What is the tens digit of 7660177? 7 What is the thousands digit of 841675? 1 What is the thousands digit of 113598? 3 What is the ten thousands digit of 10561696? 6 What is the units digit of 278474? 4 What is the tens digit of 20163849? 4 What is the units digit of 371056? 6 What is the hundred thousands digit of 10396132? 3 What is the tens digit of 18494999? 9 What is the units digit of 1431287? 7 What is the hundreds digit of 2086699? 6 What is the hundred thousands digit of 168707? 1 What is the units digit of 487512?	{ "pile_set_name": "DM Mathematics" }
(2/(-390)-3)/(-5515/(-20625))? 5/13 ((-40)/(-15))/((-51)/(-459)) 24 Evaluate (5316/2658)/(124/(-2)). -1/31 24(220/(-105))/22-7 16 What is the value of (-297)/22192/(-1296)? 2 6(-3)/(-84)-2(-2)/(-3) -2/7 Evaluate 18/189(-14)/((-8)/8). 4/3 What is the value of 75/4572/149? 15 Evaluate -13-19(-13)/(-117). 13 Evaluate 12/(-4)122/66. -1 Calculate (-10)/(-8)(-10)/((-50)/7). 7/4 ((-510)/(-1530))/((-34)/18) -3/17 Calculate (-21)/1832(-12)/(-336). -4/3 What is 9/675(-40)/24? -1/45 Evaluate 30/126(-111)/370. -1/14 Calculate -235/84(-120)/(-450). -2/9 What is (-185)/25949/(-7)? 5 What is (4/2)/((-43)/(-1290)-12)? -5 42/44592/(-3444) -14 What is the value of ((-46)/207)/((-4)/(-27))? -3/2 What is the value of (-50)/135(-10)/(-250)15? -2/9 What is the value of ((-21)/63)/(((10/5)/(-10))/6)? 10 Evaluate -1(-24)/(-40)40/72. -1/3 What is the value of (11/((-2233)/116))/((-16)/952)? 34 Calculate 6/(-273)(-3276)/252. 2/7 Evaluate (-8(-273)/(-84))/(56/(-7)). 13/4 What is the value of (408/48)/(7/(-14))? -17 Evaluate ((-3)/5)/(16992/(-960)). 2/59 Calculate (1155/(-22))/(-21)(-24)/(-30)1. 2 Calculate (-5)/26(-27)/(-60)(-688)/(-129). -6/13 What is the value of (219/(-2628)40/(-2))/((-10)/(-6))? 1 What is (-10)/459(-3)/(-26)? -3/13 What is the value of (((-40)/84)/(-5))/(-2(-6)/(-90))? -5/7 (-2040)/(-765)(-6)/(-40) 2/5 Calculate ((-15)/85)/((-48)/408). 3/2 Calculate ((-2840)/(-2130))/((-2)/9). -6 Calculate (-26)/(-6)((-180)/70)/(-6)-7. -13 What is ((-2)/(-4)(-207)/(-46))/(15/180)? 27 What is the value of (((-2)/(-12))/(1/26))/((-11)/(-33))? 13 What is (-2(-12)/15)/((-8)/((-160)/(-4)))? -8 Calculate ((-504)/(-210))/((18/(-20))/((-18)/(-6))). -8 168/((-336)/(-8))(-1)/(4/(-9)) 9 Calculate 56/(-6)427/(-144). 7 (3/(-39))/(-3(-2)/(-12)) 2/13 What is the value of 50/90(-972)/(-45)? 12 What is the value of ((-3)/(-20))/(((-36)/(-144))/(35/168))? 1/8 Calculate ((1664/78)/32)/(39/(-54)). -12/13 What is (-270)/1352/2-9? 18 Evaluate (-316)/79(-3)/(-2). -6 What is the value of (1/(5/18))/((-20)/(-50))? 9 What is the value of 2631/1754((-3)/(-3))/(-48)? -1/32 Evaluate (-18)/88(-160)/240(-22)/(-12). 1/4 Calculate (-6)/(((-57)/6)/19). 12 What is ((-14)/422)/((-8)/6-2)? -1/4 Evaluate -1720/(-187)(-4)/20. -4/11 Calculate 2-12(-17)/(-7140). -2/35 26/1320/(-4) -10 What is the value of (-10)/(-36)12/30? 1/9 Evaluate (-123)/82(-11)/(99/(-84)). -14 What is the value of (4/(-40))/((-3)/183)? 1/5 Evaluate ((2/3)/(((-130)/(-39))/(-5)))/2. -1/2 ((-3808)/42)/(72/(-27)) 34 ((-15)/10)/(4(-3)/(-312)) -39 Evaluate (1/(-3))/(((-1508)/78)/58). 1 Evaluate (-51)/((-612)/(-8))9/((-9)/3). 2 What is 156/312((-20)/1)/1? -10 What is the value of -208(-45)/480? 15 What is the value of 4/18(-11286)/660? -19/5 What is (-27)/(-261)4/6? 2/29 Evaluate 65/1562/((-6)/9). -5/4 Calculate (-2)/(-24)(-1584)/(-33). 4 What is 9/(-33)-11(-34)/(-561)? 2/11 Evaluate (((-105)/45)/((12/(-4))/(-6)))/(-2). 7/3 Evaluate 6/60-24(-100)/660. 4/11 What is (372/155)/(140/(-150))? -18/7 Calculate 8/719964/(-2139)6/(-4). 16 (31/(-217))/(1/(-2))28/12 2/3 Evaluate 23/(-110/15102/68). -23 Evaluate 340/(-34)(-2)/(-24). -5/6 What is (-136/(-42))/((-156)/(-3640))? 20 What is the value of ((-28)/12)/((-10)/(-30))? -7 What is the value of 1/(145/(-30))? -3/7 ((-4)/2)/(1/(-5)(-1000)/800) -8 What is (-2)/(-10)1595/(-29)? -11 What is the value of (-1)/(-35)8344/2384? 1/10 What is ((-192)/(-240))/(1/(-15))? -12 What is the value of 3204/240? 1 What is (-4)/46647/448? -2/23 Calculate 20/((-21)/(-21)(-52)/39). -15 Evaluate ((-328)/(-246))/(-14)2. -2/3 Calculate (((-1)/(-3))/(5/270-6))/19. -3/19 What is (1/2)/(6/12)19? 19 What is (-1)/610-1(-99)/(-11)? 15 Calculate 4/110(-1035)/(-69). 6/11 What is 33/(-11)396/(-144)? 6 Evaluate (-3939/(-169))/(53). 3/5 Calculate (-8)/((-24)/15)12/(-12). -5 (8/1)/((-79)/((-1501)/(-114))) -4/3 Calculate (-172)/(-2064)(-12)/10. -1/10 (-3)/(((-1078)/7)/14) 3/11 Calculate ((-15)/(1170/13))/2. -1/12 Evaluate (4/(-3))/((-3244)/(-55959)). -23 18/105(-45)/180 -9/4 What is the value of ((-1)/(2/16))/(((-420)/(-14))/30)? -8 Evaluate (21/3012/28)/(6/(-2)). -1/10 (20/(-2))/(((-360)/75)/6) 25/2 ((-4232)/(-5290))/(-21/35) -14 Calculate ((-210)/70)/(180/(-16)). 4/15 Calculate 48/(-20)15/(-18)-3. -6 Evaluate ((-4)/(-10))/(33/(-330)). -4 What is the value of 1/(((-1)/18)/(322/198))? -6 3/24(-11)/(-11) 1/8 What is 32/(-72)51/3430/(-4)? 5 (6/(-15))/(6/(12/1)2) -2/5 What is (17/((-561)/(-22)))/(2/(-156)4)? -13 (92/(-161))/(10/210) -12 What is the value of (4/(-10))/(4/3(-261)/(-1218))? -7/5 (-4)/(-6)(-20)/(-80)2 1/3 10/25(-760)/(-988) 4/13 What is 17/(-17)-51(-8)/24? -17 What is the value of (8/30(-6)/4)/((-120)/(-50))? -1/6 Calculate 1276/414(-1)/((-6)/(-243)). -27 What is the value of (646/289)/((-46)/391)? -19 (720/12)/(-30)((-5)/(-6))/5 -1/3 What is (-122)/3055/6? -1/3 Calculate 1296/2882/(-24). -3/8 Calculate (-8)/(1217/102). -4 (42/(-616)-11)/(21/133) 19/4 What is ((-204)/54)/(1(-24)/108)? 17 What is (10/3)/((-1764)/378)? -5/7 What is the value of (6/(-7)525/(-300))/((-8)/(-112))? 21 Calculate (-366)/10980(-1)/(-2). 0 What is (4/238)/(1325/(-1855))? -2/85 ((-180)/42)/5(-1617)/2541 6/11 Evaluate ((-3)/((-12)/((-21)/(-7))))/(9/(-2)). -1/6 What is ((2610/240)/29)/(6/(-56))? -7/2 Evaluate ((-1038)/(-2595))/(1/(-5)). -2 11(-10)/85 -2/17 Calculate ((-1503)/(-167))/((-12)/(-2)). 3/2 Evaluate ((-1)/1)/((42/(-6))/140). 20 Evaluate (8/(-3))/(7(-6)/(-189)). -12 What is the value of 39/(((-2)/(44/(-6)))/((-216)/(-1188)))? 26 (-5(2262/(-65))/6)/(6/6) 29 Evaluate (2/1(-18)/(-56))/((-21)/56). -12/7 Calculate 42/(-147)1(-45)/10. 9/7 Evaluate (-30)/2(-3)/((-24)/3228). -15/7 What is (29/(-58))/((-20)/(-24))? -3/5 What is 330/551/(-2)? -3 Evaluate (702/(-108))/(11/(-2)). 13 What is the value of ((-4)/22/(-4))/(53/106)? 2 1060/(-477)(-9)/2 10 Calculate 1411(-9)/(-330)(-20)/(-70). 6/5 Calculate ((-25)/15018)/((-3)/6-111). -2/37 What is (3/(-18))/((-34)/(-12))? -1/17 Evaluate 21535/(-525). -7 ((-4)/21)/(13/364-2) 8/3 Evaluate 18/(-12)((-4)/15)/((-8)/(-100)). 5 (-75(-87)/10150)/(2/4) 9/7 What is (19/((-1463)/(-132)))/(((-69)/(-14))/(-23))? -8 Evaluate 126/756(-1)/(-2)6. 1/2 What is the value of 544/(-4488)(-11)/6? 2/9 ((-1400)/(-400))/(357/12) 2/17 What is (-6)/((40/(-2700)9)/((-1)/20))? -9/4 What is (12/35)/((-2)/(-5)1)? 6/7 20/(-1120)(-273)/13 3/8 Calculate ((-156)/8)/13280/(-270). 14/9 207/2070(4/6)/((-4)/(-30)) 1/2 What is (6/9)/(4/(-216))(-3)/(-6)? -18 What is 1/(-25)((-1380)/36)/(-23)? -1/15 Evaluate ((-12)/(-5))/(16170/1225). 2/11 Calculate 36/(-60)10/428/6. -7 What is 5/(-42)21(-36)/126? 5/7 What is the value of 4/2133/(-11616)48? -3/11 What is (-17)/22((-80)/(-16))/5? -17 Calculate 3375/6075(8/10)/(2/6). 4/3 What is the value of 2-20(-14)/(-5600)? -1/10 Evaluate (-1)/(-1)5340/(-712)2/(-3). 5 What is (17/(-1139))/((-58)/(-116))? -2/67 Calculate (1124/(-6182))/(1(-1)/11). 2 Calculate (15261/(-1464))/(1/(-3)). 19 What is the value of 19/381470/(-21)? -35 Evaluate 1((4/5)/2)/(70/35). 1/5 (-675)/(-54)(-8)/20 -5 Calculate (132/(-54)3)/(24/36). -11 Calculate 41/((-25830)/28)(-5)/75-9. -2/75 Evaluate 1-3((-3)/(-6))/((-33)/(-22)). -1 What is the value of 11/211622/4917? 13 8(-1)/(-3)282/846 8/9 Evaluate ((-36)/(-84))/((-2)/(-70)). 15 What is the value of (-62)/(-620)6/(-7)28/(-3)? 4/5 ((-1)/(-6))/(((-4)/4)/10) -5/3 What is 43/(-70)(-43)/(1161/42)? 4/15 What is the value of ((-1)/4)/(426/284)? -1/6 What is the value of (2/56)/((12/(-32))/(288/128))? -3/14 (16/52013)/((-22)/15) -3/11 What is (25(-15)/300)/(1/12)? -15 What is ((-28)/210)/(4/(-285))-2? -19 (2/69)/(22(-58)/1914) -1/23 What is the value of (1128/(-9024))/(1/(-4))? 1/2 Calculate 2/(-7)177/(-88). 1/4 Calculate 14((-891)/(-189))/(-3). -22 Evaluate ((-2)/(-4))/((525/20)/21). 2/5 1074/(-39380)40/(-18) 2/33 What is the value of 295/(-354)4/2003? -1/20 What is the value of 42/10(-1090)/(-763)? 6 Evaluate 1((-16)/((-256)/40))/(5/2). 1 -6(-15)/4(-348)/(-870) 9 What is 1/(1/(-44)-2)? 22 Calculate ((-18)/21)/(410/(-287)). 3/5 What is 185/(-119)-7? 5 What is the value of ((91/(-18	{ "pile_set_name": "DM Mathematics" }
2o2 + 0o*2)(44 + 4o + 7o - 12o) to qo*4 + go*2 + j + io + do3 and give q. 26 Express (-9797 + 2686 + 2860 + (1 - 4 + 2)(1 + 2 - 1) + 2 - 1 - 3)(-3 + 5 - 3)(2x + 0x - 3x)(-1 - 2 + 7) in the form c + lx and give l. -17020 Rearrange 53371v*3 + 2 - 2 - 53369v*3 + 240v*2 to the form uv + a + jv3 + iv*2 and give j. 2 Rearrange -723h + 1510h - 2 - 768h + 3h3 + 6h*2 to v + ph*3 + qh*2 + fh and give q. 6 Rearrange (-30863 + 12956 + 34731 + (2 - 3 - 1)(-2 + 4 - 1))(2u4 + u2 - u2) to the form ru*2 + zu + i + nu4 + bu3 and give i. 0 Rearrange (2 + g2 + 0 + 2g - 4g)(8g - 2g - g)(2 - 1 + 1) - 10g3 + 4g*3 + 16g*3 to fg*3 + dg*2 + s + wg and give w. 20 Express (1 + 3d3 - 1)(-2d + 13 + 4 - 4d) as sd + hd*2 + pd*4 + td*3 + r and give s. 0 Rearrange 55 - 36h*2 + 28374h - 28376h + 23 + (-2h - 2h + h)(3h + 0h - 4h) to the form sh + u + oh2 and give o. -33 Express (-2m + m*2 + 2m)(m - 7m*2 - m) + (28 - 31 - 78)(3m4 - 4m*3 + 4m*3) in the form ym*3 + am + g + dm4 + lm*2 and give d. -250 Rearrange -248 + 29y - y*3 + 30y + 1793y4 - 66y - 1791y4 to the form oy*2 + wy*3 + my + v + ty4 and give m. -7 Express (-190t*2 + 33t*2 - 463t*2 - 739t*2)(0 - 34 - 2) as jt2 + l + xt and give j. 48924 Express (0 - 1 - 1)(2h + 5h - 6h)(-922 - 1131 + 219)((4 - 4 + 1)(-2 + 2 - 4) + 0 + 1 + 1) in the form mh + q and give m. -7336 Express 3194f - 210f + 1451f + 3393f as a + sf and give s. 7828 Rearrange -230 + 688 - 225 - 23589o*2 - 233 to no + b + fo2 and give f. -23589 Rearrange 78c*2 - 12 + 34 - 25 to gc*2 + mc + s and give s. -3 Rearrange 94c4 + 18c*2 - 7c*2 - 2 - 93c*4 + 19c to the form t + uc + pc*4 + yc*3 + oc*2 and give p. 1 Rearrange -7819 - 7874 + 6368 + 2y to n + cy and give c. 2 Rearrange -1203l - 3299l - 661l to the form bl + c and give b. -5163 Rearrange -2 + 4m - 29m2 - 3 + 51m*2 - 25m*2 to the form km*2 + p + jm and give j. 4 Rearrange -50 + 398r - 844r - 19 + 373r to the form ir + t and give i. -73 Rearrange 267 + 4w - 241 + 192 to the form x + fw and give f. 4 Express (l + 9l - 4l)(-4 + 2 + 1) + (138 - 12 - 1)(-2l - 3 + 3) in the form w + jl and give j. -256 Express -17h4 - 19h4 + h3 - 9h4 + h2 - 17 + 48h*4 + 3h*3 as jh*3 + ph*4 + m + oh*2 + lh and give j. 4 Rearrange (-5 + 2 - 1 - j)(-4j + 2j + 2 + 0)(5 - 6 + 2) + (-j - j + j)(-2j - 4j + 0j) - 3j2 - 2j*2 + 9j*2 to qj*2 + gj + p and give q. 12 Express r*2 + 6r - 16r4 + 9357871 - 57r*4 - 9357869 - 2r*3 as br*3 + dr*4 + lr + h + jr2 and give h. 2 Express 165298y*3 - 20y*2 + 1 + y - 165297y*3 + 7y2 + y4 + 3 as sy + u + hy*2 + py*3 + ly*4 and give u. 4 Express (-22o + 176 - 209 + 239o)(1 - 4 + 2) in the form t + uo and give t. 33 Rearrange (6x - 2x + x)(18x + 3x + 6x2 - 12x) to the form ox2 + g + hx + rx3 and give r. 30 Express 3575n - 4038n - 15982n as mn + r and give m. -16445 Express 2d*2 - 7522 - 238d - 7516 - 7527 + 22564 as fd2 + vd + b and give b. -1 Rearrange (-117t + 115t - 107 + 2571)(-t - 2t*3 + t) to mt + rt3 + gt*2 + v + zt*4 and give r. -4928 Rearrange -92246555g + 4g2 + 170 + 92246555g to the form l + dg2 + bg and give l. 170 Rearrange -h*2 - 6646h - 3 + 3 + 1546h + 28h to ph + z + jh*2 and give j. -1 Express (-1717n*3 + 3762n*3 - 1790n*3)(0n + 3n - 5n) + 4n4 - n4 + 0n4 as mn + tn2 + o + wn*3 + yn*4 and give y. -507 Express (-1 - 2i + 0i + 8i)(-3 + 3 + 2i) + (-4038 + 4038 + i)(2 - 2 - 3i) in the form q + wi2 + ui and give w. 9 Rearrange (271 + 118 - 119)(168t - 21 - 211t - 305t + 21) to n + kt and give k. -93960 Rearrange (x + 4x - 1 - 4x)(-191995x2 + 2x + 2x + 192096x*2) to ux + lx3 + bx*2 + h and give l. 101 Rearrange 4 - 41g - 4 + g*2 + 43g - 2 + 14g3 + 10g*3 to bg*2 + rg*3 + x + og and give x. -2 Rearrange -151030d2 - 151035d*2 - 35d + 1 + 302078d2 to sd*2 + ad + f and give s. 13 Express (3 + 0 - 2)(-281n + 281n + 6n3) + 444 - 446 + n2 + 3n2 - n + 4n*3 as gn*2 + pn*3 + un + o and give p. 10 Express (3 - 5 + 4)(3518 + 3500 - 7048 + 36w) in the form q + kw and give q. -60 Express 7b + 27b - 5b + (-3b - 3b + 3b)(145 - 55 + 139) in the form xb + y and give x. -658 Rearrange 8r*3 - 43r*3 + 2r*4 + 3030r*2 - 2809r2 + (1 - 1 - r3)(-r - r + 5r) to the form z + dr + vr*4 + qr*3 + or*2 and give v. -1 Rearrange (-64 - 82n*2 + 64)(0n - n - n) - 180n + 64n3 + 180n to sn2 + rn*3 + d + pn and give r. 228 Express v*2 - 8v*3 + 203v*4 + 202v*4 - 3 - 3v + 207v4 - 611v*4 in the form tv*4 + nv + m + xv2 + sv3 and give x. 1 Rearrange (-d2 + 9d2 + 4d*2)(457 - 172 - 17) to xd2 + l + hd and give x. 3216 Express (72 - 23 - 15v2 - 60)(2 - 3 - 1)(4 - 1 - 1)(1 - 3v + 2v + 3v) as kv*2 + rv*3 + hv + f and give r. 120 Express (-34h3 - 34h*3 - 18h*3)(162h + 34h - 318h) in the form dh*2 + ph*3 + o + lh + th4 and give t. 10492 Rearrange ((0 - 2 + 9)(-6 + 4 + 5) + 4 - 3 + 1)(294u - 181u + 25u)(-4u + u + u) to the form lu2 + fu + m and give l. -6348 Express 3 - 4j - 3 + 0 + 304014 + 149j - 304014 + (-j + 2j + 2j)(0 + 1 + 1) + 0j - 2j + j in the form p + hj and give h. 150 Express 1243 + 242 + 201500o - 201499o in the form wo + z and give z. 1485 Rearrange -4 + 2 - 3j + 4 - 6 + 18j to the form xj + t and give t. -4 Rearrange -38j3 + 45j*3 - 13j + 26j + 63j*3 - 14j to qj + n + lj*2 + pj*3 and give q. -1 Express (-2y*2 + 0y*2 + 18y*2)(2 - 1 + 0)(13 - 22y - 13) + (-5 + 5 - 3y)(0y2 - y2 + 3y*2) as qy*3 + py + ry2 + t and give q. -358 Express 84v*3 - 154v*3 + 2v*2 + 72v3 - v + v2 + 311 + 2v as xv*2 + d + cv + kv3 and give x. 3 Rearrange ((2o + 0o - 4o)(11 - 15 + 10) + 19 + 7o - 19)(-87 + 7o*3 + 87) to the form k + mo*4 + yo + qo2 + zo*3 and give m. -35 Express 451b*3 - 443b*3 + 21b*2 - 293b*3 as ob*3 + nb*2 + v + ub and give n. 21 Rearrange (6i2 + 5 - 5)(-66 - 145 - 114)(i - 3i - i)(2 - 3 - 2 - 1) to o + ri*3 + mi + ti2 and give r. -23400 Express (-13i - 11i + 6i + (-5i + 8i - 2i)(-1 + 1 - 2))(-2i + 3 - 3) in the form ci2 + b + mi and give c. 40 Rearrange (-2g + 0g + 14g)(2g3 - 4g*2 + 4g*2 + (-3g2 - g2 + 3g2)(3 - 3g - 3)) to the form tg + bg4 + q + jg*2 + wg*3 and give b. 60 Rearrange 5117z + 2870z - 2116z to the form gz + j and give g. 5871 Express 2880 + 5453 - 5g*2 - 4937 + 2g*2 in the form j + xg*2 + zg and give j. 3396 Rearrange -49 - 41 + 17 + 2 + 6b + 4 to the form fb + o and give f. 6 Rearrange (-27d + 10d + 22d)(-3 + 5 - 3) + d + 4d + d + (2d - 2 + 2)(4 + 1 - 3) to the form i + wd and give w. 5 Express -d2 + d4 + 2 + 985d + 0 - 987d + 16d3 in the form od + wd2 + b + pd*4 + sd*3 and give b. 2 Rearrange 128y*3 - 143y*3 + 85y*3 + (-2y*2 + 6y*2 - 3y*2)(1 - 1 + 2y) - 4 + 4 - 3y*3 - 2 to c + hy*3 + jy*2 + wy and give c. -2 Express -s*3 - 2s*2 + 353s + 40 - 630s + 263s in the form ps3 + v + zs*2 + us and give p. -1 Rearrange -34795100 + 34795100 - 748s2 - 4s to the form ns2 + gs + d and give g. -4 Express (0s2 + 0s*2 - 2s*3)(-4905 + 4352s + 4905) in the form ls*4 + js*3 + vs + z + fs2 and give l. -8704 Express (18 + 2g - 18 + (-4g + 5g - 2g)(-2 + 0 + 1) - g - g + 4g)(-g + 104g2 - 463g*2 + 187g*2) as ag*2 + fg*3 + n + bg and give f. -860 Express 45t2 - 46t*2 + 246t*3 - 25t - 125t3 - 126t*3 in the form wt*3 + lt + st2 + z and give l. -25 Express (584 + 254 + 31z + 548 - 306 - 111)(-2z + 3z - 4z) as kz + tz*2 + d and give t. -93 Rearrange -3 - 4890p + 3 - 3581p + 12809p to xp + i and give x. 4338 Express 103f*3 - 684f + 660f + 19f*2 - 105f*3 as wf + bf2 + v + hf*3 and give v. 0 Express -6n + 0n + 0n + (-14 + 25 + 15)(2 + 1 - 2)(20 + 6*n - 20)	{ "pile_set_name": "DM Mathematics" }
-703 - 35. What is the tens digit of c? 8 Let u = 36759 + -14933. What is the tens digit of u? 2 Let m(s) = -2s3 - 7s*2 - 28s - 103. What is the tens digit of m(-10)? 7 Let x(p) = 6p2 + 50p + 14. Let j(m) = m*2. Let v(q) = -3j(q) + x(q). What is the tens digit of v(-24)? 4 Let j(t) = 325t2 - 2464t - 63. What is the tens digit of j(19)? 4 Suppose 5k + 3o - 915 = -o, 4k = 2o + 732. Suppose 27 + 56 = -p + 2t, -2t = 6. Let h = k + p. What is the tens digit of h? 9 Suppose -v - 6 = 5c, -c + 3c = v + 20. Let j(k) = -2k - 30. Let z be j(v). Suppose zq = 5b + 85 + 34, 5b - 216 = -3q. What is the tens digit of q? 6 Suppose 7b - 5s = 9b - 1, -4 = -2b - 2s. Suppose bn + 5k - 1014 = 901, 5n - 3245 = 5k. What is the tens digit of n? 4 Let j(m) = -m*3 - 56m*2 - 77m - 89. Let z be (11 - 0)/(8/(-40)). What is the tens digit of j(z)? 2 Let f(x) = 1306x3 + 8x*2 - 22x - 2. What is the ten thousands digit of f(3)? 3 What is the thousands digit of (12/(-9))/(12 + (-4569704)/380799)? 4 Let q(r) = -4r3 - 10r*2 - r - 76. What is the thousands digit of q(-12)? 5 Suppose 13n + 5n - 570507 = -31n. What is the tens digit of n? 4 Let c = 1 - -3. Let j(u) = -u*2 + 17u - 13. Let h be j(16). Suppose cx + 242 = 2p + x, -6 = hx. What is the hundreds digit of p? 1 Let f = -8311 - -16402. What is the hundreds digit of f? 0 Suppose -k = -3, 5y - 9k - 28 = -10k. Suppose -yi - w = -6w - 35, 2i - 10 = 4w. What is the units digit of 2/(-2) + 190 - (-7 + i)? 7 Let b = 19 + -21. Let g = b - -4. Suppose -r + 183 = gr. What is the units digit of r? 1 Let x = -12821 - -49473. What is the units digit of x? 2 Suppose -3q - y = -4 + 7, 2y + 6 = 0. Suppose qa = -11a + 198. Let c(g) = 9g + 47. What is the tens digit of c(a)? 0 Suppose 3s = -o - 31, 0 = -3o - 0o + 2s - 93. Let j(d) = d*2 + 26d - 99. What is the units digit of j(o)? 6 Let r(z) = -z - 3. Suppose 1 = -8p - 71. Let o be r(p). Suppose -522 = -3f - of. What is the tens digit of f? 5 Let p = -883 - -641. Let i = 465 - p. What is the tens digit of i? 0 Suppose -9j + 7j + g + 10 = 0, 10 = 3j + g. Suppose 2r - 2 = 0, -2s - 3r = -js + 2755. What is the units digit of s? 9 Let b be (-1648)/40 + 1/5. Let a = -38 - b. Suppose 4v + 667 = ac, -v + 1150 = 2c + 3c. What is the hundreds digit of c? 2 Suppose -4m = -11m. Let x(b) = -b3 + b2 - 2b + 139. What is the tens digit of x(m)? 3 Suppose -30k = 273 + 27. What is the tens digit of (592 - 58)/(-1 - k/6)? 0 Suppose 15 = 5j - 0j. Let z(h) = h + 1. Let t be z(j). Suppose 0o - 11 = -x - 2o, 3x + to = 29. What is the units digit of x? 7 Suppose 19v - 201727 + 32095 = 0. What is the thousands digit of v? 8 Suppose 0 = -10d + 2d + 24. Let k(l) = 10l*2 + 2l - 2. What is the tens digit of k(d)? 9 Let l = -45 - -40. Let h be 9/15 + 33/l. What is the units digit of h/(-4) + (-444)/(-24)? 0 Let c(b) = b*3 + 43b*2 + 3b + 27. What is the tens digit of c(-10)? 9 Let f = -9469 - -16275. What is the thousands digit of f? 6 Let s(c) = -c*2 + 3c - 9. Let h(r) = -r*3 - 6r*2 + 5r - 14. Let j be h(-7). Let g be s(j). What is the hundreds digit of 80g/(-6) - 2? 1 Let p(w) = 7w. Let x be p(1). Suppose 12s = xs + 5725. Suppose -5z + 0z = -s. What is the tens digit of z? 2 Suppose -12u + 3346 = -974. Suppose 4z = z + u. What is the units digit of z? 0 Let u = 101 - 102. Let m be u/(-5) - (119/(-5) - 0). What is the units digit of (m/30)/(1/260)? 8 Let u = 110 - 114. Let r(a) = a*3 + 5a*2 + a - 7. Let l be r(u). Suppose 5i - 3q - 1330 = 0, -2i + i + 244 = -lq. What is the units digit of i? 9 Suppose -48 = 6p - 0. Let u be (-1264)/(-14) + p/28. Let m = -18 + u. What is the tens digit of m? 7 Suppose -2q - 2158 = 3f - 4f, 8 = -4f. Let y = 1926 + q. What is the tens digit of y? 4 Let t(z) be the third derivative of 7z5/15 - z4 + 3z*3/2 + 267z*2. What is the hundreds digit of t(4)? 3 Suppose -3o - 28536 = -g, -2g + 2o + 84477 - 27385 = 0. What is the thousands digit of g? 8 Suppose 26r = 22r - 4520. Let u = -527 - r. What is the hundreds digit of u? 6 Suppose 27744 = 75m - 63m. What is the units digit of m? 2 Suppose -m - 5g = -397, 2m + 103g - 106g = 755. What is the units digit of m? 2 Let m(z) = 2 + 8z2 - z + 0 + 4z - z. Suppose 13 = 5l - h - 4, 4h + 20 = 4l. What is the units digit of m(l)? 0 Let z(a) = 8a*2 + 2a + 36. Suppose -5t + 39 = -4r, 10r - 13r - 53 = t. What is the thousands digit of z(r)? 2 Let i = -19162 + 37510. What is the units digit of i? 8 Let n(y) = 1245y2 - 16y - 17. Suppose -35q - 62 = -27. What is the hundreds digit of n(q)? 2 Let o be 96/528 + (0 - 171/33). Let h(d) = -3d*2 - d. Let k be h(-1). What is the units digit of k/o - (-2322)/45? 2 Let m(q) = -6q*3 + 22q*2 - 42q + 3. Let u(t) = -5t3 + 22t*2 - 43t + 3. Let p(a) = -6m(a) + 7u(a). What is the units digit of p(-24)? 7 Let v = 58786 - 25174. What is the hundreds digit of v? 6 Let k(i) = i*3 + 53i*2 - 263i + 79. What is the units digit of k(-56)? 9 Suppose -157x + 148x = -328518. What is the units digit of x? 2 Suppose 21u + 815664 = 50u - 5u. What is the hundreds digit of u? 9 Let m be (-8)/(1/((-3)/6)). Suppose -mq + b + 1685 = 0, -q + 4b = 3q - 1688. Suppose w + 2u = 89, w - 6w + 2u + q = 0. What is the tens digit of w? 8 Let r = -429 + 434. Suppose -rk + 7679 = 2704. What is the hundreds digit of k? 9 Suppose 3o + 44520 = b, -5o - 35741 = -b + 8771. What is the hundreds digit of b? 5 Let h = 98 - 91. Suppose -hl + 871 = -2482. What is the hundreds digit of l? 4 What is the thousands digit of ((-12)/10)/(6 - (-1272060)/(-97850) - -7)? 1 Let m(b) be the first derivative of 2b*3/3 - 15b*2 + 23b + 20. Let t(o) be the first derivative of m(o). What is the tens digit of t(17)? 3 Let g = -377 + 1437. Suppose -7n + 305 = -g. What is the units digit of n? 5 Let t(q) = q3 + 12q*2 + 2q + 24. Let l be t(-12). Suppose lo - 2o + 5g + 15 = 0, o = -2g + 30. What is the units digit of o? 0 Let c = -113 - -112. What is the tens digit of 1/((c/(-44))/(143/22))? 8 Suppose 9l = 42l + 8l - 329804. What is the units digit of l? 4 Let n(t) = 437t + 86. Let u be n(-40). What is the units digit of (-126)/294 + u/(-14)? 2 Let g(n) = 4n + 58. Let b be g(0). Let i = b + 0. What is the units digit of 5/(15/6)i? 6 Let b(j) = -j*3 - 14j*2 - 15j + 8. Let c be b(-13). Suppose -92 - c = 2h. What is the tens digit of (3 + (-10)/(-5))h/(-5)? 6 What is the tens digit of (1018/4 + 1)/((-2)/(-192)48)? 1 Let z be 7/(-14)(1 - 7) - 1. Suppose -z - 558 = -10r. Suppose -5m - 51 + r = 0. What is the units digit of m? 1 What is the tens digit of 466/((-302)/102 - -3)? 8 What is the hundreds digit of 8(684 - (-10 + 5)1)1? 5 Let z(f) = -3f*3 + 11f*2 + 3f + 1. Let k be z(9). Let d = 1828 + k. Suppose d = -7c + 9c. What is the tens digit of c? 8 Let y = 71 + -22. Let x = y - -111. What is the tens digit of x? 6 Let p(s) = 87s2 - 9s + 452. What is the thousands digit of p(6)? 3 Let i = 207 - 193. What is the units digit of (i/4)/(3/84)? 8 Suppose 5z - 4x = -9x + 90860, 0 = 4z + 3x - 72685. What is the units digit of z? 9 Suppose 61b - 59b - x = 20489, 3b + 3x - 30747 = 0. What is the thousands digit of b? 0 Let r(i) = 858i + 4504. What is the units digit of r(22)? 0 Let q(k) = 4k2 + 20k + 31. Let t be q(-10). Suppose 5v + 9 - 101 = -m, 0 = m + 3. Suppose -vi + t = -16i. What is the tens digit of i? 7 What is the hundreds digit of (-8)/40 - 25201/(-55)? 4 Suppose 2x - 24 = -8. Suppose -1008 = -xs + 1848. Suppose -2o + s = 2n + 85, -5o + 680 = -n. What is the hundreds digit of o? 1 Let y(m) = -26m3 + 3m - 13. Let g be 52/(-6) + 4 - 5/(-3). What is the hundreds digit of y(g)? 6 Let o(z) = -z*3 + 56z*2 - 40z + 319. What is the thousands digit of o(50)? 3 Let l be (-25 - (-2 - 2))/(-1). Let b(m) = -2m + 4m - m - 3m + l. What is the units digit of b(-9)? 9 What is the units digit of 31519/19 + (-90)/(-855)? 9 Suppose 4z - 67 = 3n, -2z = -5n - 39 - 12. Suppose -5j - 3q = -2005, -zj - q - 791 = -15*j. What is the hundreds digit of j? 3 What is the hundreds digit of -9 + (3220 - (-12 + 5))? 2 Let b(i	{ "pile_set_name": "DM Mathematics" }
. What is the hundreds digit of 2(-1133)/(-8) + 25/i? 2 Let q(p) = p2 + 22p - 29. Let z be q(-23). Let w(i) = i*2 + 3. Let u be w(z). Suppose -65 = -4x + u. What is the tens digit of x? 2 Suppose v + 3x - 929 = 0, 3v + 9x - 2769 = 6x. Suppose v = 3y + 17y. What is the units digit of y? 6 Suppose 0 = -35z + 43z + 47z - 2290695. What is the units digit of z? 9 Let h = -6274 - -42864. What is the hundreds digit of h? 5 Let l(g) = 2g*3 - 7g + 8. Let q be l(3). What is the tens digit of q(-2)/(-4)168/6? 7 Let r be (-32 + 2)(-165)/75. Suppose 69z - rz - 1590 = 0. What is the hundreds digit of z? 5 Let s = -86 + 144. Let n = s - 55. Suppose 2x - 4x + o = -405, -o + 620 = nx. What is the tens digit of x? 0 Let q(w) = 6w2 + 172w + 14. What is the thousands digit of q(20)? 5 What is the tens digit of (1 - (-2)/4)/(-26 - 240653672/(-9255904))? 4 What is the units digit of (-28 + 15 + 12083)2? 0 Let t be (1746/(-30) - -5)/(1/(-5)). Suppose -6s = -286 - t. What is the tens digit of s? 9 Suppose 4q - 2y = -2012, 4q + 4y + 697 + 1327 = 0. Let v = 1104 + q. What is the units digit of v? 0 Let b = -11077 + 19716. Suppose -14t + 9225 = -b. What is the tens digit of t? 7 Let v = -145 - -77. What is the hundreds digit of (v/(-6))/(3/54)? 2 Let s be -278-16/12. Suppose -sw + 350 = -137w. What is the units digit of w? 5 Suppose -6u + 3120 = -426. What is the units digit of u? 1 Suppose 5r + 63 = -4y, 2r - 3r - 5y = 0. Let i(w) be the first derivative of -w3/3 - 11w*2 - 11w - 4. What is the units digit of i(r)? 4 Let g = 12835 - 8910. What is the tens digit of 0/(28/7) + g/5? 8 Suppose 19y - 8063 + 1546 = 1634. What is the hundreds digit of y? 4 Let j(i) be the third derivative of i5/15 + 11i4/6 + i3/6 - 34i2. Let s(b) be the first derivative of j(b). What is the tens digit of s(16)? 7 Let m(i) = -9i - 149. Let y be m(4). Let z(d) = 73d - 5. Let k be z(5). Let x = y + k. What is the units digit of x? 5 Let i(b) = b2 - 17b - 1. Let t(l) = -l*2. Let y(j) = -i(j) - 2t(j). Let r = 76 - 69. What is the hundreds digit of y(r)? 1 Suppose -5f + 4f + 830433 = 18f. What is the ten thousands digit of f? 4 Let f = 19790 - 8477. What is the tens digit of f? 1 Let q(j) = 1150j - 3919. What is the tens digit of q(12)? 8 Suppose 0 = 6r - 6637 - 24395. What is the units digit of r? 2 Let m = -384 + 221. What is the hundreds digit of (4/(-10)m)/((-2)/(-10))? 3 Let i = 25 + 23. Suppose -b = 4b + r - i, -4r + 12 = 0. What is the tens digit of 6/(-9) + 1104/b? 2 Let d(y) = 3y3 + 10y*2 + 8y - 3. Let k be d(8). Suppose 6017 = 10w + k. Suppose 5x - w = 182. What is the units digit of x? 2 Suppose -10z + 2227 = -7z + 5n, 0 = n + 1. Suppose -o - 5j = -730, 5o - z = 4o + 2j. What is the hundreds digit of o? 7 Let z = 22 - 18. Let m be (-24)/(1 - 4)2/z. What is the units digit of 22 + (m - -7)? 5 Let a(h) = -1. Let l(y) = y - 25. Let s(w) = a(w) - l(w). Let n be s(21). What is the units digit of ((-74)/3)/((-1)/n)? 4 Let n(t) = 194t*2 + 13t + 154. What is the ten thousands digit of n(-8)? 1 Let r be (12/30)/(4/40). Suppose 5v = 3p + 1451, 4v - 1156 - 8 = rp. What is the tens digit of v? 8 Let i = 50 + -110. Let x = i - -285. What is the hundreds digit of x? 2 Let h be 0 + 416/2 - 1. Suppose 123u - 127u = 3j - 104, u - 107 = -3j. Suppose 0 = jc - 27c - h. What is the tens digit of c? 2 What is the hundreds digit of (26/(-13))/((42/36484)/((-9)/4))? 9 Let a = -312 + 1018. Let p = a - 324. What is the hundreds digit of p? 3 Let t be (-4)/(-3 - (-510)/168). Let q be 5/10 + (-1 - (-405)/(-2)). Let y = t - q. What is the units digit of y? 1 Let a(n) = 32n3 + 2n*2 - 70n + 86. What is the tens digit of a(7)? 7 Suppose 166w + 150612 = 178w. What is the thousands digit of w? 2 Suppose -2g + 16 = -158. Suppose 5c = -2i + 63 + 82, -3c = i - g. What is the tens digit of 2/(-2) - -5c? 4 Let a be 209/(-5) - (112/35 - 3). Let q = a + 22. Let r(v) = v2 + 12v - 12. What is the hundreds digit of r(q)? 1 Let y = -486 - -421. What is the hundreds digit of 6298/6 + (y/(-15) - 4)? 0 Let d be (-17)/(-4) + 1/(-4). Suppose dj + 4s + 500 = 2160, 0 = 4j - 3s - 1688. What is the hundreds digit of j? 4 Let n be 0/(-2 + 0) - (0 - 4). Suppose -3q = 5b, nb + 2 = -10. Suppose -2h - g = -11 - 12, -65 = -qh + 5g. What is the tens digit of h? 1 Let b(u) = -12u3 - 11u*2 + 2u + 100. What is the units digit of b(-13)? 9 Let w(m) = 15m - 1. Let g be w(-1). Let x be (-6)/(((-8)/(-30))/(g/40)). What is the tens digit of 961/9 - (-2)/x? 0 Suppose 566600 = 13w - w + 38w. What is the tens digit of w? 3 Let c be 4/8(4 - (-3 - 5429)). Let q = -1385 + c. What is the thousands digit of q? 1 Let r be (-2)/((6/8)/((-27)/24)). Suppose -7q + 2920 = -rq. What is the hundreds digit of q? 7 Suppose -37 = -12l - 109. What is the units digit of ((-814)/l)/((-1)/(-3))? 7 What is the tens digit of (-5061 + -2)/(8/(-40)5)? 6 What is the tens digit of (18 + 169579/(-69))/((-1)/3)? 1 Let i = 10432 + 500. What is the hundreds digit of i? 9 Suppose -3w = 2w - 15, -2w + 24651 = 3n. What is the thousands digit of n? 8 Let p(d) = -63d - 5. Let w be 20/25(0 - 5). Let k be p(w). Let r = k - 174. What is the tens digit of r? 7 Let f be ((-130)/(-25) - 4)(-266 - -1). Let y = f - -456. What is the tens digit of y? 3 What is the units digit of ((-3153)/(-1))/(2(-25)/(-50))? 3 Let t = 1589 - -8952. What is the hundreds digit of t? 5 What is the hundreds digit of (-20)/140 - (-457520)/49? 3 Suppose 9x - 22 - 5 = 0. Suppose 5g - 67 = -xq, 4g = -3q + 2g + 79. Let i = q - 25. What is the units digit of i? 4 Let b be (-310)/(-4) - (-14)/(-11 + -17). What is the tens digit of (-42)/(-4)-30(-44)/b? 8 Suppose -f = 3s - 1270, s - 138 = f - 1424. Suppose 5j - f = -2t, -3j + 4j + 5t - 261 = 0. What is the tens digit of j? 5 Suppose 4r = 5d + 5500, r - 3d - 1019 = 349. Suppose 27q - r = 21q. What is the hundreds digit of q? 2 Let t(l) = 2355l - 63. What is the units digit of t(16)? 7 Let a(h) be the second derivative of 5h4/3 - h3 - 5h*2/2 - 32h. What is the units digit of a(-2)? 7 Let p(m) = 12m2 - 138m - 2566. What is the hundreds digit of p(-39)? 0 What is the tens digit of (70/42)/(2 - 7035/3519)? 5 Let z(b) = -b*3 + 7b*2 + 9b + 6. Let i be z(8). Suppose -16l + i - 62 = 0. What is the hundreds digit of ((l - 34)/1)/(2/(-6))? 1 Let b(g) = 59g*3 + 36 + 18g*2 - 8 - 60g*3 + 34g. What is the thousands digit of b(16)? 1 Suppose z = -z + 3o - 600, 0 = 5o. Let d = z - -781. What is the tens digit of d? 8 Let o(y) = -3y - 74. Let t be o(-6). What is the hundreds digit of (-287)/t - 5 - (-3527)/8? 4 Let y(m) = -528m*3 + 5m*2 + 9m + 2. What is the tens digit of y(-2)? 2 Let v = 49 - 40. Let t be (16 - v)12/(-14). Let w(b) = 3b*2 + 15b + 6. What is the tens digit of w(t)? 2 Let v(p) = 11p2 + 31p + 27. Let u be v(-1). Let x(n) = -5n3 - 11n + n*3 - 4n*2 + 13 + 5n*3. What is the units digit of x(u)? 3 Let i be 2/(-9) - (-184184)/198. What is the hundreds digit of (-6)/(-12)i - 4? 4 Let j be (80/10 - 9)(-12 + 1). Suppose 2347 + 3010 = jv. What is the units digit of v? 7 Let p be 19 + 0 + -12 + 16. Suppose 0 = ph - 11h - 2580. What is the hundreds digit of h? 2 Suppose 0 = -14t + 19t - 20605. Suppose -22u = -10303 + t. What is the hundreds digit of u? 2 Let z be (-4)/(-8)-1(3 + -3). Suppose 4p + 358 + 526 = z. What is the tens digit of 7/(-14)1 - p/2? 1 What is the units digit of -9 + (-317 + -11)-62? 7 Let u = 444 + -66. Suppose 2g = -7g + u. What is the tens digit of g? 4 Let c(l) = 78l + 41. Let z(m) = -57 + 30 - 14m - 38m. Let n(j) = -5c(j) - 8z(j). What is the tens digit of n(3)? 8 Suppose 518 = -10a + 2808. Let x = 559 - a. What is the hundreds digit of x? 3 Let j(l) = -27353l - 360. What is the hundreds digit of j(-2)? 3 Suppose 3222 = 3x - 1785. Suppose -5y - 4 + x = 0. What is the tens digit of y? 3 Suppose -10 + 25 = 5y, -3749 = -4a + 5y. What is the hundreds digit of a? 9 Let o be -48 - (92/28 + 6/(-21)). Let h = o + 55. Suppose -hc = 2s - 108, -99 = -3s + s + 5c. What is the tens digit of s? 5 Let b be (2/4)/(2/96). Let q be	{ "pile_set_name": "DM Mathematics" }
97825? 5, 9147913 List the prime factors of 49508250. 2, 3, 5, 11, 17, 353 What are the prime factors of 350357731? 350357731 List the prime factors of 626619617. 13, 29, 1662121 What are the prime factors of 1946319605? 5, 191, 2038031 What are the prime factors of 2861832186? 2, 3, 739, 215143 What are the prime factors of 162666495? 3, 5, 1204937 What are the prime factors of 1096000? 2, 5, 137 List the prime factors of 945183599. 59, 16020061 List the prime factors of 2103803704. 2, 262975463 What are the prime factors of 6963995307? 3, 2321331769 List the prime factors of 3230988417. 3, 358998713 What are the prime factors of 499368777? 3, 29, 331, 17341 List the prime factors of 146133142. 2, 19, 1051, 3659 What are the prime factors of 18681181? 17, 739, 1487 List the prime factors of 238647986. 2, 127, 631, 1489 List the prime factors of 675817569. 3, 7, 557, 19259 What are the prime factors of 760213174? 2, 7, 17, 37, 131, 659 List the prime factors of 66582670. 2, 5, 7, 11, 1123 List the prime factors of 81641282. 2, 2411, 16931 What are the prime factors of 2497671988? 2, 7, 211, 422761 What are the prime factors of 80455588? 2, 197, 102101 List the prime factors of 1142433035. 5, 228486607 What are the prime factors of 339393858? 2, 3, 103, 233, 2357 List the prime factors of 43126244. 2, 7, 1540223 List the prime factors of 444098596. 2, 3221, 34469 List the prime factors of 47267005. 5, 9453401 What are the prime factors of 37248380? 2, 5, 13, 143263 What are the prime factors of 101750465? 5, 20350093 List the prime factors of 1258782684. 2, 3, 104898557 What are the prime factors of 480347440? 2, 5, 6004343 List the prime factors of 181305277. 19, 9542383 What are the prime factors of 3718016451? 3, 47, 2929879 List the prime factors of 1779408873. 3, 11, 617, 29131 List the prime factors of 4949965627. 107, 46261361 List the prime factors of 306358274. 2, 1019, 150323 List the prime factors of 73525314. 2, 3, 103, 118973 What are the prime factors of 212104153? 13613, 15581 List the prime factors of 40144200. 2, 3, 5, 23, 2909 What are the prime factors of 126919912? 2, 7, 2266427 What are the prime factors of 1569312930? 2, 3, 5, 3001, 17431 What are the prime factors of 62156266? 2, 619, 50207 List the prime factors of 79765. 5, 7, 43, 53 What are the prime factors of 1395718259? 13, 383, 280321 List the prime factors of 196841092. 2, 7, 7030039 List the prime factors of 878440963. 878440963 What are the prime factors of 238131453? 3, 7, 11339593 List the prime factors of 101821637. 211, 653, 739 List the prime factors of 1817015967. 3, 13, 29, 61, 8779 What are the prime factors of 2655459372? 2, 3, 221288281 List the prime factors of 200809046. 2, 100404523 List the prime factors of 1295198669. 17, 19, 857, 4679 What are the prime factors of 151551359? 47, 3224497 List the prime factors of 49960623. 3, 23, 31, 23357 List the prime factors of 7519526775. 3, 5, 157, 212867 What are the prime factors of 300895855? 5, 13, 4629167 List the prime factors of 3534359347. 17, 19, 257, 42577 List the prime factors of 139350757. 7, 13, 218761 What are the prime factors of 316561905? 3, 5, 11, 213173 List the prime factors of 458078350. 2, 5, 23, 379, 1051 What are the prime factors of 415066207? 103, 829, 4861 List the prime factors of 254335104. 2, 3, 23, 29, 331 List the prime factors of 60420063. 3, 11, 1830911 What are the prime factors of 219919930? 2, 5, 21991993 What are the prime factors of 166294341? 3, 191, 96739 What are the prime factors of 78680331? 3, 8742259 List the prime factors of 178751105. 5, 13, 47, 58511 List the prime factors of 117996205. 5, 23599241 List the prime factors of 754396604. 2, 13, 29, 151, 3313 What are the prime factors of 1438292? 2, 103, 3491 List the prime factors of 11914450. 2, 5, 17, 107, 131 List the prime factors of 8471475919. 8471475919 What are the prime factors of 1410927489? 3, 2833, 55337 List the prime factors of 22878117. 3, 71, 35803 What are the prime factors of 3289656663? 3, 365517407 What are the prime factors of 517544167? 7, 89, 830729 What are the prime factors of 259184584? 2, 17, 101, 18869 What are the prime factors of 2063198042? 2, 881, 1170941 List the prime factors of 210590380. 2, 5, 7, 11, 13, 67, 157 List the prime factors of 1881198775. 5, 59, 353, 3613 List the prime factors of 931777649. 11, 84707059 What are the prime factors of 4271331? 3, 139, 10243 List the prime factors of 4773792449. 109, 43796261 List the prime factors of 622658330. 2, 5, 7, 433, 20543 What are the prime factors of 449826452? 2, 1627, 69119 What are the prime factors of 70549333? 70549333 What are the prime factors of 1663578796? 2, 11, 37808609 List the prime factors of 109627477. 67, 1636231 What are the prime factors of 839695314? 2, 3, 17, 43, 191449 What are the prime factors of 93925463? 59, 197, 8081 List the prime factors of 60712486. 2, 19, 29, 37, 1489 List the prime factors of 36705729. 3, 59, 207377 List the prime factors of 38331556. 2, 37, 41, 6317 What are the prime factors of 156165370? 2, 5, 19, 173, 4751 What are the prime factors of 252917447? 229, 641, 1723 List the prime factors of 914809692. 2, 3, 43, 47, 67, 563 List the prime factors of 384761414. 2, 251, 766457 List the prime factors of 1832760273. 3, 19, 613, 52453 What are the prime factors of 47182792? 2, 5897849 What are the prime factors of 322244616? 2, 3, 2411, 5569 List the prime factors of 48523719. 3, 16174573 What are the prime factors of 764855877? 3, 313, 814543 List the prime factors of 301138467. 3, 7, 19, 137, 787 What are the prime factors of 3921980916? 2, 3, 7, 46690249 What are the prime factors of 115610071? 115610071 What are the prime factors of 1450528930? 2, 5, 145052893 List the prime factors of 421623222. 2, 3, 17, 4133561 What are the prime factors of 17440621? 11, 41, 38671 List the prime factors of 4172533216. 2, 37, 3524099 What are the prime factors of 22436898? 2, 3, 11, 61, 5573 List the prime factors of 4341543653. 67, 139, 466181 What are the prime factors of 57099539? 7, 8157077 What are the prime factors of 584035435? 5, 23, 293, 17333 List the prime factors of 71275656. 2, 3, 577, 5147 List the prime factors of 83956508. 2, 29, 199, 3637 What are the prime factors of 203299386? 2, 3, 37, 915763 What are the prime factors of 1457518249? 11, 2207, 60037 List the prime factors of 138312597. 3, 137, 336527 List the prime factors of 206812370. 2, 5, 43, 480959 List the prime factors of 331833789. 3, 7, 331, 15913 What are the prime factors of 89716362? 2, 3, 353, 42359 What are the prime factors of 183011237? 67, 2731511 What are the prime factors of 1097426958? 2, 3, 73, 2505541 What are the prime factors of 2531536198? 2, 17, 31, 79, 30403 List the prime factors of 300828084. 2, 3, 25069007 List the prime factors of 435024884. 2, 7, 15536603 List the prime factors of 2443180113. 3, 11, 19, 61, 107, 199 List the prime factors of 26425171. 26425171 List the prime factors of 218650490. 2, 5, 907, 24107 What are the prime factors of 67846832? 2, 109, 38903 List the prime factors of 118384723. 118384723 List the prime factors of 359940364. 2, 7, 12855013 What are the prime factors of 525702318? 2, 3, 71, 103, 11981 What are the prime factors of 318928207? 13, 89, 275651 What are the prime factors of 63302881? 659, 96059 List the prime factors of 1919166541. 89, 521, 41389 What are the prime factors of 93666202? 2, 7, 1973, 3391 What are the prime factors of 195771483? 3, 113, 192499 What are the prime factors of 693128592? 2, 3, 13, 370261 What are the prime factors of 50115034? 2, 31, 808307 List the prime factors of 188476375. 5, 23, 65557 List the prime factors of 54315629. 17, 3195037 What are the prime factors of 58727746? 2, 7, 11, 19, 20071 What are the prime factors of 5313388978? 2, 2656694489 List the prime factors of 332476101. 3, 36941789 List the prime factors of 281818630. 2, 5, 28181863 List the prime factors of 37684142. 2, 18842071 List the prime factors of 123525221. 123525221 What are the prime factors of 23495516? 2, 11, 533989 What are the prime factors of 370932714? 2, 3, 3491, 5903 What are the prime factors of 35212884? 2, 3, 7, 419201 What are the prim	{ "pile_set_name": "DM Mathematics" }
olve 2o - 4y - 14 = 0, -5o - 5y = -2y + 4 for o. 1 Solve -2v - 4 = 3a - v, 5a + 2 = 3v for a. -1 Solve 4u + 2g + 22 = 0, 2u + 0u - g + 5 = 0 for u. -4 Solve 0 = 2t - 6, 0h + 2h + 11 = 5t for h. 2 Solve 3y - 2y = -d + 4, 3d = 0 for y. 4 Solve -10 = 3r + 2b, -r + 2r + 1 = -3b for r. -4 Solve 27 = 2j - 3d, -2j + 24 = -8d + 6d for j. 9 Solve -4b = 5x - 3, 0 = 18x - 13x - 2b - 21 for x. 3 Solve -2c + j + 3 = 0, 3c + 3j + 9 = -0j for c. 0 Solve x + 4j - 41 = -4x, 5 = 5x - 5j for x. 5 Solve 0 = y + 4w + 29, -18y - 22 = -17y + 3w for y. -1 Solve 10x - 4 = 5x + n, -5x - 2n - 8 = 0 for x. 0 Solve -2u + 5u + 2q = 23, 4u = -3q + 32 for u. 5 Solve -11 = f - 2o - 8, -4 = 2f - 3o for f. 1 Solve -7 = -l + 2a, 384l = 379l + 3a for l. -3 Solve -l - f - 2 = 0, 63 = -2f + 53 for l. 3 Solve -8a + 6a - 2c = -8, 0 = 4a - 2c - 22 for a. 5 Solve 0 = -n - 3b + 9, 5n + 9b - 4b - 5 = 0 for n. -3 Solve -3g + 2m = m + 12, -3m + 6 = -3g for g. -5 Solve -5v = 5q - 0q - 10, -2v = -4q + 14 for q. 3 Solve 3w - 2n = -0n - 14, -5w + 2n - 22 = 0 for w. -4 Solve 2f - 7f - 20 = 0, 2h + f + 12 = 0 for h. -4 Solve 7b - 28 = -4o + 5b, b - 4 = 0 for o. 5 Solve -p + 3 = k, -5k + 2k + 4p = -9 for k. 3 Solve 0 = 3f + u + 1, -13 = -40f + 35f + 2u for f. 1 Solve 0 = -3k + 4k - 5y - 16, -2k - 24 = 4y for k. -4 Solve -3v - 5k = -8, 2k - 16 = -2k for v. -4 Solve -2l + 13 = -4l + 5k, 3k = 3 for l. -4 Solve -l + 3a = 4a + 2, 4l + 3a = -4 for l. 2 Solve -2k + 14 = 4p, 4k = 9p - 8p + 1 for k. 1 Solve 0 = x + 3h - 4, 34x - 12 = 31x + 5h for x. 4 Solve -g - 7 + 1 = -2l, 0 = 3g - 6 for l. 4 Solve -61g = -58g - 2j + 13, 0 = 3g + 3j - 12 for g. -1 Solve -h + 5h = -3x - 1, x = -4h + 5 for h. 2 Solve 5z + 11 = 4j, j = -0z + 2z + 5 for z. -3 Solve -u = 0, -5z = -z - 2u - 16 for z. 4 Solve -6 + 56 = 5h - 5p, 0 = -4h - p + 15 for h. 5 Solve 0 = 5h, -5z + 8h = 12h + 25 for z. -5 Solve -2r + 5i + 15 = 0, -3i - 3 = 4r - 2i for r. 0 Solve -5p - f + 20 = 0, 52p = 57p - 5f + 10 for p. 3 Solve -n - 6q = 25, q + 30 = -4n + 9n for n. 5 Solve z = -14t + 15t - 7, 5z - 1 = -t for z. -1 Solve 16 = 4w, 6 = -6p + 4p + w for p. -1 Solve -9 + 10 = 2a - 5v, 5v = a - 3 for a. -2 Solve -4z + 7z + 18 = 3i, 4z - 2i + 12 = 0 for z. 0 Solve -s + 7 = -2l + 7l, 4s + 12 = 0 for l. 2 Solve -i - 3 = 5r, 4i = -2r + 7i - 8 for r. -1 Solve 18s - 5 = -2q + 17s, 4s = -q - 15 for q. 5 Solve -4b - 36 = 16q - 21q, -3b = -5q + 32 for b. -4 Solve -w = -q - 1, q - 5q + 3w - 3 = 0 for q. 0 Solve -5d = 2r - 9, 2d = r + 2r + 15 for r. -3 Solve -3q + 5k + 5 = 0, -35k - 5 = q - 40k for q. 5 Solve -2g = c - 1, -3c = 3g - 129 + 123 for g. -1 Solve 94m - 91m + 19 = 5a, 4m - 3 = a for a. 5 Solve -4s = 4r - 40, -4s = r - 2s - 15 for r. 5 Solve -p - 4p = 2j + 3, -2 = 3p + j for p. -1 Solve 0 = u - 3x + x - 4, 8 = 2u + 4x for u. 4 Solve 15 = n + 5w, -15n = -17n + 2w - 18 for n. -5 Solve 5h = 2q + 6, -5q = 26h - 31h + 15 for q. -3 Solve 0 = -5t, 3p - 3t - 7 = 8 for p. 5 Solve -2b - 10 = 0, -2l + b + 9 + 0 = 0 for l. 2 Solve -3w - 3x = 3, -26x + 29x = -2w + 2 for w. -5 Solve 0 = 3w + 2w - 3a - 30, 0 = -5w - 4a - 5 for w. 3 Solve 0 = -5w + 12a - 15a - 2, 3a = 5w + 8 for w. -1 Solve 2k + 0k - 6 = 0, -t + 2k = 2 for t. 4 Solve 5w + z = -6, 6z + 24 = 4w - 12 for w. 0 Solve 0 = v + 3c + 8, -v - 14 = 3c + 2c for v. 1 Solve 0 = -3q - g + 7, -q - 2q + 11 = 5g for q. 2 Solve 3i = -149n + 147n + 11, -5n = -4i - 16 for i. 1 Solve 24 = -4r - 3x, -5r + 15x = 12x + 3 for r. -3 Solve 0 = -5s + 268h - 271h + 2, -3s + 4h = -7 for s. 1 Solve 4v - 2z - 2 = 0, -4v + 10 + 12 = 2z for v. 3 Solve 4l = -g + 1, 3l + 4g - 7 - 10 = 0 for l. -1 Solve -l - p = -2, 2l + p - 6 = -3l for l. 1 Solve -4k + 4p - 20 = 0, 4k + 66p = 69p - 21 for k. -6 Solve 5g - 7u - 19 = -11u, -4u - 2 = -2g for g. 3 Solve -2a = 3v - 18, 11 = 5v - 18a + 15a for v. 4 Solve 0 = c - 2y - 7 + 6, -y + 4 = c for c. 3 Solve -2t = 5l - 1, 8 = -6t + 2t for l. 1 Solve -3x - 5n - 40 = 0, -3 = 4x - 3n + 2 for x. -5 Solve 5l = 4i + 19 + 1, -3i + 2l - 15 = 0 for i. -5 Solve -3h + 5o + 27 = 0, -14h + 10h = 3o - 7 for h. 4 Solve -5p = 12q - 9q + 14, 0 = 4p - 5q + 26 for p. -4 Solve 4l + 24 = i - 0i, -6 = l - 5i for l. -6 Solve r + 2z - 6 = -0, 4z = 16 for r. -2 Solve -2i = -i + k, 0 = -3i - 2k - 2 for i. -2 Solve -4w = 4n - 4, -2 = n - w + 5w for n. 2 Solve -4g = -b - 2, -3b = 15g - 11g - 10 for g. 1 Solve -38a + 3 = -37a + u, 2a - 3u = -19 for a. -2 Solve 0 = -4u + 4, 0 = -0f - 3f - 4u + 1 for f. -1 Solve -5x - 8 = -2b - b, 2b = -5x - 28 for b. -4 Solve s - 4a = 2, -4s - 5a = -0s - 8 for s. 2 Solve -3 = 5j + 4x, 5j - 4x + 0 - 13 = 0 for j. 1 Solve 0 = 2u + 3i, 18 = 5u - i + 35 for u. -3 Solve o = -2i + 5, 3o - 3i + 4 = 10 for o. 3 Solve -5y + 24 = -3q + 2q, 0 = 2y + 3q + 4 for y. 4 Solve -q + 36v - 33v = 6, -5q - 7 = 8v for q. -3 Solve 0 = 2g, 4v = 5v - 3g for v. 0 Solve 0 = 3h + 3n, 4n + 1 + 5 = 2h for h. 1 Solve 16c - 20c = 4l - 12, l = -2c + 3 for l. 3 Solve -n + 3u = -1, -2n = u - 3u - 2 for n. 1 Solve -4m - h + 20 = 0, 3 = -m + 4h - 9 for m. 4 Solve 6 = 2f, -2q - 2q = -5f + 31 for q. -4 Solve -b - 24 = 5j, -j - 11 = 4b + 2j for b. 1 Solve 4a + 20 = 4j, a + 14 - 1 = 5j for j. 2 Solve 16f + u = 15f - 2, 4f + 2u + 12 = 0 for f. -4 Solve 3s = 4l + 8, 3l + 6 = -s - 0 for l. -2 Solve -5 = -a - 15t + 9t, -2a - t = -10 for a. 5 Solve -2v - 2 = -x - 3, 4v = 4 for x. 1 Solve -2n + 4r - 3 = 3, 4r = 12 for n. 3 Solve -w + g + 1 = 0, -6 = -2w - 3g - 14 for w. -1 Solve 12 = -2l - 4k, -415l + 419l - 5k = 41 for l. 4 Solve -7 = 2g - 5g - 4c, -c = 2g + 2 for g. -3 Solve -3p = 3k + 18, p = 3p - 3k - 13 for p. -1 Solve -3k - 32 = -q - 37, 0 = -k - 2q + 11 for k. 3 Solve -n + 5t = 13, 0 = -4n - n + 5t - 25 for n. -3 Solve -2x = 2m - 8, 0x - 1 = -4x - m for x. -1 Solve -t - 3z - 8 = 0, -4z = 16 - 0 for t. 4 Solve 5x - 5t = x + 10, 10 = -x - 5t for x. 0 Solve 5 = 2g - s, -4g + 4s - 8s - 20 = 0 for g. 0 Solve 2j - 5b + b - 24 = 0, 5j - 32 = 3b for j. 4 Solve 2q - 5 = -z - 1, 3z + 21 = 5q for z. -2 Solve 3m - 9 = 4u - 30, -2u - 2m = -14 for u. 6 Solve i + 5a = -22, 0i - a = -2i for i. -2 Solve -2i - 4 - 6 = 0, 2h + 21 = -3i for h. -3 Solve 3t = 4m + 8, 3t - 25m + 23m = 4 for t. 0 Solve -24 = -4x - 4h, 11 + 14 = 5h for x. 1 Solve -7 = 4d + 4k + 1, -2d = 4k + 12 for d. 2 Solve -7o = 3n - 5o + 19, 4n = -3o - 27 for n. -3 Solve 2k = 4r - 0r - 12, -2r = 5k + 18 for k. -4 Solve -2m + 25z + 2 = 21z, -3m - z = -10 for m. 3 Solve 5z + 2y = 5y - 30, 4y = 2z + 26 for z. -3 Solve -3g = o - 71 + 64, g + 2o - 9 = 0 for g. 1 Solve 5c = 3s - 20, -3c + 2 = -4s + 5s for c. -1 Solve 3z - h = -7, 3h + 60 = -5z + 39 for z. -3 Solve -3u + 22 + 9 = -5q, -q = -5u + 15 for u. 2 Solve -l + 3 = s, 3l - 2l - s = 7 for l. 5 Solve -4k - 5d + 15 = 0, 5k - 3d - 3 = -4d for k. 0 Solve 19z + 6 = 16z, -4 = 2i + 5z for i. 3 Solve -2g + 2r - 3r = 7, 5g + 2r + 17 = 0 for g. -3 Solve 4k = 7i - 6i - 4, -2k + i = 0 for k. -2 Solve -16 = -2r - 3f, -19r - 2f + 18 = -14r for r. 2 Solve -2a - 17 = 5u + 8, 35 = -4a - 5u for a. -5 Solve -3 = 3s - 3y, -18s = -13s - 4y + 7 for s. -3 Solve -5i - 5h + 25 = 15, 0 = 3i - 2h - 6 for i. 2 Solve 0 = -2y + 5l + 1, 2y - 48l + 8 = -52l for y. -2 Solve -2j + 4n = 2, -33n + 29n + 5 = -j for j. 3 Solve c - 5t = 16, -2c + t = 2t + 12 for c. -4 Solve 3a + 7h = 2h - 5, -5a - 23 = h for a. -5 Solve 3x + 9 = 0, -5g + 2x + 13 = 6x for g. 5 Solve -2i - 5k = -17, i + 8k = 10k - 5 for i. 1 Solve 0 = -2w + 4, 3j + w = -0w + 17 for j. 5 Solve 3r - 3 = 4s, -4r + s + 4 = -2s for r. 1 Solve -3p = -6, -5p = -2w - 2w - 26 for w. -4 Solve 9o = 4o + 3v - 10, 3v = 2v for o. -2 Solve 0 = -2y - 5t + 2, 0 = 3t - 6t for y. 1 Solve -3g - 3m - 2 = 10, 4 = 3g - 5m for g. -2 Solve 4l + 5m - 4 = -6	{ "pile_set_name": "DM Mathematics" }
r 3l3 + 319473l*2 + 319464l - 638940. 3(l - 1)(l + 2)(l + 106490) Find q, given that -3q*3/7 + 3831q*2/7 + 7674q/7 = 0. -2, 0, 1279 Let -1323c2 + 620802c - 72825987 = 0. Calculate c. 4927/21 Suppose 2r4/15 - 24742r*3/15 + 98944r*2/15 - 98936r/15 = 0. Calculate r. 0, 2, 12367 Factor 2s2/7 + 24456s + 523333944. 2(s + 42798)2/7 Factor -3n*3 + 1041n*2 - 90825n + 89787. -3(n - 173)2(n - 1) What is h in 128h5/3 - 8420h*4/9 + 39698h*3/9 - 17408h*2/3 - 518h + 96 = 0? -1/6, 3/32, 3, 16 Solve 2h2 + 54842h - 54844 = 0. -27422, 1 Factor 7260125y3 - 96400y*2 + 320y. 5y(1205y - 8)2 Solve -5b*4/3 + 1430b*3/3 - 42795b*2 + 3508120b/3 - 6514060/3 = 0. 2, 46, 119 Factor 30v2 + 265v - 10920. 5(v + 24)(6v - 91) Factor i2/4 + 6969i - 27877/4. (i - 1)(i + 27877)/4 Factor -m2/4 + 8679m/4 - 8677/2. -(m - 8677)(m - 2)/4 Factor -u3 - 458u*2 + 2779u - 2320. -(u - 5)(u - 1)(u + 464) Find z, given that -z*4 - 51680z*3 + 51685z*2 + 206720z - 206724 = 0. -51681, -2, 1, 2 Factor -5y3 + 320y*2 + 5100y - 41040. -5(y - 76)(y - 6)(y + 18) Solve -n4/10 - 99n*3/10 + 164n*2/5 + 222n - 1224/5 = 0 for n. -102, -4, 1, 6 Solve -o*3 + 12o*2 + 64o - 768 = 0 for o. -8, 8, 12 Let 4u3/5 - 27808u*2/5 + 55604u/5 - 5560 = 0. Calculate u. 1, 6950 Factor -2j3 - 5338j*2 + 5340j. -2j(j - 1)(j + 2670) Solve -y4/6 + 31y*3/6 - 59y*2/6 + 29y/6 = 0. 0, 1, 29 Factor -4z2 + 4872z - 434948. -4(z - 1121)(z - 97) Factor -3g2 - 3561g - 31806. -3(g + 9)(g + 1178) Factor -2m3 + 2210m*2 - 178814m - 181026. -2(m - 1017)(m - 89)(m + 1) Suppose -2g*2 + 192365g + 96183 = 0. Calculate g. -1/2, 96183 Solve -27243j2 - 54496j - 20 = 0 for j. -2, -10/27243 Find o, given that -5o4 + 7875o*3 + 55295o*2 + 118605o + 71190 = 0. -3, -1, 1582 Factor 4639156488t2/7 - 192648t + 14. 2(48162t - 7)2/7 Factor -r4/2 + 8117r3 - 65869453r*2/2 - 65893806r - 32950962. -(r - 8118)*2(r + 1)2/2 Solve -b2/4 + 855b/2 - 26336 = 0. 64, 1646 Factor -y4/4 - 43361y*3/2 - 1880176321y2/4. -y2(y + 43361)2/4 Factor -t3 - 141t*2 + 1501t - 1359. -(t - 9)(t - 1)(t + 151) Factor 5l3 + 6260l*2 + 1632025l - 212876630. 5(l - 94)(l + 673)*2 What is r in 3r*5/2 - 447r*4/2 - 1371r*3/2 + 447r*2/2 + 684r = 0? -3, -1, 0, 1, 152 Suppose -v*4 + 9v*3 - 18v*2 - 4v + 24 = 0. What is v? -1, 2, 6 Suppose -2g3/21 - 2152g*2/7 - 26506g/3 = 0. Calculate g. -3199, -29, 0 What is m in 40m5 - 1636m*4 + 16453m*3/2 + 1231m*2 - 4113m/2 + 315 = 0? -3/5, 1/4, 6, 35 Determine j so that -4j5/5 - 6214j*4/5 - 21702j*3/5 - 3086j*2/5 + 21706j/5 + 1860 = 0. -1550, -3, -1, -1/2, 1 Factor 45x4/4 + 1621x*3/2 + 14616x*2 + 648x. x(x + 36)2(45x + 2)/4 Factor -12p*2 - 119564p + 279048. -4(p + 9966)(3p - 7) Factor -3l*2 - 45l + 648. -3(l - 9)(l + 24) Let -2g3/5 + 11522g*2/5 + 46208g + 231240 = 0. Calculate g. -10, 5781 Factor -d*2/3 + 926d/3 - 69208/3. -(d - 844)(d - 82)/3 Find p such that 2p*5 - 106p*4 + 372p*3 + 4936p*2 + 11728p + 8448 = 0. -2, 11, 48 Suppose 12y4/7 - 5860y*3/7 + 19364y*2/7 + 17476y/7 - 7760/7 = 0. What is y? -1, 1/3, 4, 485 Suppose 30z5 + 59438z*4 + 1308090z*3 - 1022958z*2 - 705056z + 360456 = 0. Calculate z. -1959, -23, -2/3, 2/5, 1 Factor -v*2 + 5116v - 353220. -(v - 5046)(v - 70) Suppose -l2/3 + 140l - 7497 = 0. Calculate l. 63, 357 Factor -104t2/5 + 626t/5 - 12/5. -2(t - 6)(52t - 1)/5 Factor b4 - 496b*3 - 10220b*2 - 51600b. b(b - 516)(b + 10)*2 Solve -2w*3 + 40660w*2 - 812600w + 4062000 = 0 for w. 10, 20310 Find u such that -2u3 - 3922u*2 - 1784640u + 137778264 = 0. -1014, 67 Factor m*4 + 218m*3 - 220m*2 - 218m + 219. (m - 1)*2(m + 1)(m + 219) Factor 4i*2 - 347184i + 7533545616. 4(i - 43398)2 Let -b5 + 2b*4 + 58b*3 - 140b*2 - 825b + 2250 = 0. Calculate b. -6, -5, 3, 5 What is p in p*2 + 215p + 636 = 0? -212, -3 Suppose j*5/2 + 41j*4 + 1134j*3 + 10935j*2 + 19683j/2 = 0. Calculate j. -27, -1, 0 Factor w*4/5 + 34w*3/5 + 319w*2/5 + 102w. w(w + 2)(w + 15)(w + 17)/5 Solve h2/3 - 794h/3 + 528 = 0 for h. 2, 792 Let 2v2 - 213749v/2 + 53437/2 = 0. Calculate v. 1/4, 53437 Find h, given that -5h2 - 85920h + 257805 = 0. -17187, 3 Factor -3c2/8 + 2400c. -3c(c - 6400)/8 Suppose -g*3/5 - 30876g*2/5 - 47660193g + 476725442/5 = 0. What is g? -15439, 2 Determine j so that j*3 + 19j*2 - 900 = 0. -15, -10, 6 Determine l so that 5l*4 + 40l*3 - 4420l*2 - 41760l + 100800 = 0. -28, -12, 2, 30 Let b*3/5 - 922b*2/5 + 919b/5 + 1842/5 = 0. What is b? -1, 2, 921 What is q in -3q5/2 - 16833q*4/4 - 11734443q*3/4 + 100784817q*2/4 - 124717887q/4 = 0? -1407, 0, 3/2, 7 Find g such that 2g5/9 - 874g*4/9 - 8740g*3 - 858736g*2/9 - 3320512g/9 - 1450240/3 = 0. -66, -4, 515 Factor -s*4 - 867s*3 - 11073s*2 + 24751s - 12810. -(s - 1)*2(s + 15)(s + 854) Factor c2 + 11014c + 30327049. (c + 5507)*2 Find i such that 5i*5 - 22525i*4 + 895190i*3 - 9782150i*2 + 16968805i - 8059325 = 0. 1, 19, 4465 Factor 5m2 - 5700m + 45280. 5(m - 1132)(m - 8) Determine w, given that -2w3 - 52w*2 - 112w + 1408 = 0. -22, -8, 4 Factor 450f2 + 27420f + 417698. 2(15f + 457)*2 Find v such that 2v*4/13 + 2248v*3/13 - 20382v*2/13 + 13628v/13 + 36256/13 = 0. -1133, -1, 2, 8 Determine q, given that 3q3 - 61893q*2 + 319197672q + 319259568 = 0. -1, 10316 Determine n so that 85n3 + 140770n*2 + 58291200n + 6855840 = 0. -828, -2/17 Factor 4l2/3 - 26420l/3 + 26416/3. 4(l - 6604)(l - 1)/3 Factor -2w2/5 + 1698724w/5 - 360707903522/5. -2(w - 424681)2/5 Factor 4x*3 + 20892x*2 + 41772x + 20884. 4(x + 1)2(x + 5221) Determine d so that -3d3 - 1716d*2 - 174303d + 21638610 = 0. -321, 70 Find s such that -s*5/4 - 15s*4/2 - 5s*3/2 + 135s*2 - 349s/4 - 435/2 = 0. -29, -5, -1, 2, 3 Factor 2v4/9 + 3532v*3/9 + 556102v*2/3 + 96183424v/9 + 1483163648/9. 2(v + 32)2(v + 851)*2/9 Factor 3f*2/2 - 644019f + 138253490787/2. 3(f - 214673)2/2 Solve -4l*2 - 79568l - 395691664 = 0 for l. -9946 Determine h so that -28h2/5 - 72042h/5 + 5146/5 = 0. -2573, 1/14 Factor 5f3 + 6720f*2 + 3003945f + 446706050. 5(f + 427)2(f + 490) Solve -2c4 - 22c*3 + 364c*2 - 1128c + 1008 = 0. -21, 2, 6 Find l such that 78l3/7 - 1719l*2/7 + 9504l/7 - 363/7 = 0. 1/26, 11 Determine b, given that b*4/4 + 27b*3/4 + 197b*2/4 - 3b/4 - 1287/2 = 0. -13, -11, -6, 3 Solve -2c4/11 + 40c*3/11 + 5974c*2/11 + 77652c/11 - 408240/11 = 0. -27, 4, 70 Let 2w2 + 32w - 384 = 0. Calculate w. -24, 8 Factor -l*3/5 + 45l*2 - 16107l/5 + 356083/5. -(l - 91)*2(l - 43)/5 Determine s, given that -2s5 - 774s*4 - 77548s*3 - 516056s*2 - 1016880s - 577600 = 0. -190, -4, -2, -1 Factor -2f2/11 - 4882f/11 - 859500/11. -2(f + 191)(f + 2250)/11 What is h in -7h5/4 - 377h*4/4 - 505h*3/2 + 265h*2/2 + 1017h/4 - 153/4 = 0? -51, -3, -1, 1/7, 1 Factor -8823675v3/2 + 529415355v*2/2 + 1234797v/8 + 45/2. -3(v - 60)(3430v + 1)2/8 Factor 5o*3 - 4155o*2 + 625675o + 629835. 5(o - 633)(o - 199)(o + 1) Determine t so that -2t*4/3 - 38t*3 + 240t*2 + 7200t = 0. -60, -12, 0, 15 Factor -2w2/3 + 8378w. -2w(w - 12567)/3 Factor -4o2/7 - 5208o + 218880/7. -4(o - 6)(o + 9120)/7 Factor -3z4/7 + 20283z*3/7 + 40578z*2/7. -3z*2(z - 6763)(z + 2)/7 Solve -15f*4 + 2649f*3 + 1113f*2 - 8985f - 7434 = 0. -7/5, -1, 2, 177 What is k in 3k3 + 153k*2/7 - 1404k/7 + 2028/7 = 0? -13, 2, 26/7 Solve -3v4 - 270v*3 - 5436v*2 + 45816v + 761760 = 0. -46, -10, 12 Find m such that 2m5/3 + 2359m*4/3 - 1201m*3/3 - 8257m*2 + 3549m + 10620 = 0. -1180, -3, -1, 3/2, 3 Find x, given that 15x4/4 + 883x*3/4 + 1201x*2/2 - 84x = 0. -56, -3, 0, 2/15 Let -76m2 + 12384m + 13120 = 0. Calculate m. -20/19, 164 Factor 4t2 - 1124t + 66192. 4(t - 197)(t - 84) Let -2f5/7 + 236f*4/7 - 1530f*3/7 - 2720f*2/7 + 6152f/7 + 7104/7 = 0. Calculate f. -2, -1, 2, 8, 1	{ "pile_set_name": "DM Mathematics" }
29 Rearrange -3d3 + 0 + 14 + 0 + 4d*2 - 3 to the form wd + x + yd2 + qd*3 and give w. 0 Express -3 - 5 + 11k*4 + 6k4 - k3 - 18k4 - k3 - 10k as fk2 + g + tk*3 + lk + vk4 and give t. -2 Express -13x*3 + 39x*3 - 13x*3 + (-13x - 17x + 39x)(-x2 + x2 + 2x*2) as g + sx*2 + nx*3 + jx and give n. 31 Rearrange -15n3 - 2n*2 + 38n + 18n3 - 5n to cn + jn*2 + zn*3 + a and give z. 3 Rearrange (3n + 5n - 5n)(-1 + 2 + 2) - 14n + 13n - 27n to dn + u and give d. -19 Rearrange 195 + 3j - 274 + 238 + 0j + 0j to dj + k and give k. 159 Rearrange (-5v*2 - 9v + 9v)(3 - 3 + 7) - 7v + 7v - 7v2 to the form qv + lv2 + j and give j. 0 Express -9y + 3 + 25y - 5y*2 - 30 + 27 in the form g + iy*2 + my and give m. 16 Express t*2 + 2t*3 - 10916 + 10989 + 2t*3 in the form mt*2 + ft + at3 + s and give f. 0 Rearrange -31i - 14 + 38 - 23 + 0i to the form hi + t and give t. 1 Express (-2 + 2 - 2g)(g - 4g + 2g) + 0g2 + 2g2 - g2 + 586g2 - 2g + 8g - 621g*2 as h + vg + mg2 and give m. -32 Express 1499j + 472j + 666j as d + rj and give r. 2637 Rearrange -7w*4 - 2 + 0w*2 + 10w*4 - 4w*2 + 5w*2 + 18w to hw4 + ow*3 + iw + y + mw2 and give y. -2 Express -4f + 7 - 1141f4 + 1143f*4 + 3f + 2f3 + 2f*2 as wf*3 + hf + df4 + uf*2 + q and give h. -1 Express -19h*4 - 4 + 4 + 20h*4 - 13h3 - h2 in the form sh + zh*2 + l + kh*3 + ph*4 and give z. -1 Rearrange 3z + 6z - 3z - z - 3 + 3 + (2z + 2z - 5z)(0 - 2 + 3) + 3z - 4z - z + 2z + 0z - 3z - 3 + 3 + 3z to the form tz + p and give t. 4 Express ((-2 - 3 + 3)(-x + x + x) + 6x + 2x - 4x)(-2 + 4 + 2) in the form ux + g and give u. 8 Rearrange -16k*4 - 2k*2 + 5k*4 + 13k + 12k4 + 27k + 2k3 - 1 to the form ak + zk3 + tk*4 + f + yk*2 and give y. -2 Express (-188g + 11g2 + 188g)(-10g + 51g - 24g)(-g - 4 + 4) in the form kg*2 + tg*3 + hg + jg4 + i and give j. -187 Rearrange 761w + 3 - 1 - 760w + 23w*4 to the form y + rw*2 + pw*4 + dw*3 + aw and give p. 23 Rearrange -35n - 87n + 16n - 44n to the form vn + j and give v. -150 Rearrange 0 + 0 - c2 + (c - 2c + 2c)(-1 - 3 - 1)(-5 + 17 + 6)(c + 1 - 1 + (2c + 1 - 1)(2 + 1 - 2) - c - 5 + 5) to the form xc2 + y + rc and give x. -181 Express 0v + 0v + 14 + 2v + (1 - 1 - 3v)(1 + 3 - 2) - 5v - 17 + 17 in the form pv + x and give p. -9 Express 185 - x - 12x4 + x4 - 90 - 2x2 + 0x - 93 in the form rx4 + ax*3 + px + z + ix2 and give r. -11 Express (3p + 155 - 156 + 0p)(3 - 3 - p*2)(2p + 23 - 23) in the form xp + vp2 + hp*3 + n + lp4 and give h. 2 Rearrange (v4 - 6v4 - 6v*4 + 4v*4)(48 + 307 + 120)(0 + 2 - 3) to nv*3 + av + q + cv4 + wv*2 and give c. 3325 Rearrange (19n*2 - 10n*2 - 56n*2)(4n - n - n) to the form qn*3 + l + vn + bn2 and give q. -94 Express (-1 + 5 + 2)(55 + 20 - 154m + 157m) in the form w + cm and give c. 18 Express 375b*3 - 736b*3 + 2 - 4b*2 + 366b*3 - 3b*2 as sb*3 + vb*2 + n + hb and give n. 2 Rearrange (9 - 18w - 9)(-6 + 3w - 7 + 13) to the form x + iw*2 + qw and give i. -54 Rearrange ((0g - 2g + g)(0g2 - g2 + 5g2) + g3 + g3 - 3g*3)(3 - 1 + 0 + (-1 - 2 + 5)(13 - 2 - 3)) to fg*3 + wg*2 + jg + d and give f. -90 Rearrange 286h - 279h + 3 - 22 to t + fh and give t. -19 Express (3b - 5b - 3b + (-6b + 0b + 4b)(1 + 1 - 1) + (3 - 2 - 2)(-2b + 1 - 1))(-2b*2 - 5b*2 + 0b*2) as gb + vb2 + m + rb*3 and give r. 35 Express (-4b + 6b - 3b + (1 - 1 + 1)(b + b + 0b))(4b - 6b + 6b + (b + 2 - 2)(-1 - 2 + 4) - 2b + 5b - 6b) in the form gb + d + qb*2 and give q. 2 Rearrange -r + 24 + 19 - 47 - 2r4 + r2 to gr + xr*4 + t + wr*2 + fr*3 and give g. -1 Rearrange ((1 + 2 - 1)(1 - 1 - 2) - 38 + 77 + 43)(-3c - c*2 + 3c) to w + gc + xc*2 and give x. -78 Rearrange -2n*3 - 728n*4 + 2n*2 + 192 + 730n4 + n3 to the form dn + pn*4 + bn*3 + v + in*2 and give v. 192 Express -48k + 100 - 100 + (3 + 2 - 3)(k - 4k + 2k) + (3k + k - 5k)(-6 + 3 + 1) as vk + u and give v. -48 Express -10 - z3 - 175z*2 + 0z*3 + 175z*2 in the form az + f + nz2 + uz*3 and give f. -10 Rearrange -3f + 0f - 8f + (-4 + 0 + 6)(-5f + f - 18f) to m + if and give i. -55 Rearrange ((-1 - 2 + 4)(-11y + 2y + 5y) + 49 + 20y - 49)(y*2 + 3y*2 - 3y*2) to the form qy + jy3 + cy*2 + k and give j. 16 Rearrange 0z2 + z2 + 5 - 3 + 219z + 103z - 4 to the form l + fz + bz*2 and give b. 1 Express 12w + 82 + 54 - 24w - 2w*2 + 12w as pw2 + i + cw and give p. -2 Rearrange -2b2 - 3b*2 + 6b*2 + (30b + 75b - 139b)(2b + 1 - 1) to mb + i + xb*2 and give x. -67 Rearrange 12248l + 12255l + 5 - 24370l to gl + m and give g. 133 Express 1024j*2 - 32196 + 32196 in the form d + tj + bj2 and give b. 1024 Rearrange (-18 - 6 - 36)(-6 - 5u + 6) to the form pu + g and give p. 300 Express 2 - 2 - 2c + 62c + 71c - 88c + (2 + 1 - 4)(2 - 2 + 6c) in the form f + kc and give k. 37 Rearrange 2 - 2 - 7w + 5 - 3 to the form o + dw and give o. 2 Rearrange 2s*3 + 12s + 5 - 12s + (7 - 4 - 1)(-2s3 + 2s*3 - 2s*3) + 32s*3 + 22s*3 - 6s*3 to the form h + os*2 + bs*3 + ns and give h. 5 Rearrange (-3d2 + 448 + 8d*2 - 439)(-2d + 5 - 5) to td*3 + yd*2 + k + id and give t. -10 Express 16y3 + y2 + y - 73y*3 + 33y*3 - 110y*3 as my + n + iy2 + gy*3 and give i. 1 Rearrange -4h - 72h2 + 4071 - 4071 to sh + jh2 + y and give j. -72 Express 10 + 275r - 55r - 142r as f + yr and give y. 78 Rearrange -7q - 3q + 15q + 37q3 - 9q to xq + tq*2 + p + oq*3 and give x. -4 Express (2r - 4r + 0r)(-6r + 23184 + 10r - 23464) as d + ur*2 + ar and give u. -8 Rearrange -2298x - 1 + 3 + 368x + 137x - 642x to n + wx and give n. 2 Rearrange 3q - 31q - 3q + 10q to tq + g and give t. -21 Express (-3 + 1 + 4)(1 - 4 + 1)(-8 + 1 - 3)(-4 + 4 - 2)(-18k + 33k - 11k) + 6k - k - 4k in the form o + hk and give h. -319 Rearrange (5 - 2 + 1)(0 + d + 0) - 4d - d + 3d + 158d - 200d + 219d to k + xd and give x. 179 Express (2l*4 - 2l4 + l4)(-27 - 91 - 102) in the form wl*4 + fl*3 + t + al*2 + ul and give w. -220 Rearrange y - 389y3 - 182y*3 - 3 + 8 + 55y*3 - 3 to fy + oy3 + dy2 + t and give f. 1 Express (-o2 - 3o2 + 5o*2)(9o - 23 + 16o + 22) in the form zo2 + co + i + ro3 and give z. -1 Express -2787q*3 + 1387q*3 - 2q - 2q2 + 1383q3 + q4 as dq + w + jq*4 + yq*3 + aq*2 and give y. -17 Express (-3 + 9 + 10)(-5g + 5g + 4g2) as o + kg*2 + lg and give k. 64 Express (-1 + 5 + 0 + (-1 - 1 - 1)(12 - 7 + 14))(-u*4 + 0u4 - u4) as mu3 + xu*2 + ku*4 + s + yu and give k. 106 Rearrange (-3p + 0p + 6p)(6p + 7p - 9p)(0 + 1 - 3)(2p + 0p + 0p) to the form n + qp3 + bp*2 + up and give q. -48 Express (-3 - m*3 + 3)(0 + 3 - 1) - m*3 + 1 - 1 + (25 - 16 - 7 + 26m)(-2m*2 + 4m*2 - 3m*2) in the form s + nm*3 + rm*2 + fm and give n. -29 Rearrange -266 - 410n - 4n - n2 - n4 + 266 + 0n4 to the form kn + mn2 + un*4 + c + ln*3 and give c. 0 Express 277o - 778o - 1279o - 488o + 178o as qo + i and give q. -2090 Rearrange 0u + 0u - 2u + (-2 + 6 - 1)(-2u + 7u + 8u) + 2u - u - 4u to the form yu + p and give y. 34 Rearrange 61 + 80q + 106q + 289q - 61 to the form t + hq and give h. 475 Rearrange (0 - 2u + 0)(0u + u - 4u) + 24u*2 - 26u*2 + 10u + 9u - 2u - u*2 + 2u to cu2 + fu + p and give c. 3 Express 5h - 2h + h + 25 - 28 in the form fh + o and give o. -3 Rearrange -2v*4 - 187 + 214 + 0v*4 + 4v*4 - v - 2v*2 to p + av*2 + zv*4 + yv + cv3 and give z. 2 Express (589 + 1472 - 825)(0 + 3b + 0) as g + mb and give m. 3708 Express 2 - 96h - 92h - 2h3 + 282h - 95h + 2h*4 - 2h*2 in the form oh*4 + uh*3 + f + zh + ih2 and give u. -2 Rearrange 2h + 3h2 + 4h2 - h2 + 4 - 2h2 to ah + ih*2 + s and give i. 4 Rearr	{ "pile_set_name": "DM Mathematics" }
site number? False Let g = -4133 + 10383. Suppose -4v + 3x = x - g, -4v + 6229 = 5x. Is v composite? True Suppose -78065 = -14y + 140419. Suppose y = 4f - 726. Is f prime? False Suppose -4902957 + 26965086 = 226u - 15425169. Is u a prime number? False Let o(z) be the first derivative of -1/2z*2 - 1/4z*4 + 6z*3 - 8 - 29z. Is o(15) composite? False Let d(f) be the first derivative of -31f4 + 5f3/3 + f2/2 - 7f - 223. Is d(-2) a prime number? False Suppose 4746065 + 410333 = 448w - 435w. Is w prime? False Let c(d) = -d3 - 6d*2 + 5d - 10. Let a be c(-7). Suppose -37u = -32u. Suppose u = -at + 5l + 87 + 636, -4l = 12. Is t a prime number? False Suppose 2f = 3f + 4o - 31, -5o = -f - 5. Suppose a - f = -4v, 11 = 5v + 2a - 7. Is (-262)/v(-39 + 13) composite? True Let d be ((-351)/26)/((-5)/4 - -2). Let k(n) = -331n - 5. Is k(d) composite? False Let v(u) = 187u3 + 16u*2 - 132u + 1177. Is v(10) a prime number? False Suppose -2s + 7s = 20. Let d be s/(-6)(7 - 13). Suppose -m - 1022 = -4x + 1506, -3x + dm = -1909. Is x a prime number? True Let f = -219 - -221. Is 2339/2 - (7/(-2) + f) a composite number? False Let n(v) = 164v2 + 2v - 11. Let o be n(3). Let k = o - -4086. Is k a prime number? True Let y(n) = 1907n + 10. Is y(3) prime? False Is (-22)/(-33) + 558736/48 + (1 - 1) a composite number? True Suppose 0 = 15n - 8n + 36778. Let r = n + 11651. Is r prime? True Let s(b) = 6b*2 - 2b - 3. Let a be s(-1). Suppose -au + 19 = v + v, 3u - 21 = 2v. Suppose uq + 4w - 380 = 3717, -2465 = -3q + w. Is q prime? True Let x(w) = 3w3 - 4w3 - 15 - w2 + 0w3 + 4w. Let y = 718 - 729. Is x(y) a composite number? False Suppose -4w + 2h = -0h + 5376, -2w + 5h - 2696 = 0. Let a = w - -2556. Let g = -164 + a. Is g a prime number? True Let q(u) = -4u*3 - 310u*2 + 168u + 126. Let m be q(-78). Let a be 1/(1(-1)/(-1511)). Let x = m + a. Is x prime? True Let i = -33013 - -70970. Is i prime? True Let l = 468085 - 190398. Is l a prime number? True Let n = 2469570 - 1674499. Is n a prime number? True Let b(h) = 60h*2 - 30h + 59. Is b(-30) a prime number? True Let h = -7498 + 9935. Is h a prime number? True Let u(s) = -2584s - 385. Let d(c) = -1293c - 193. Let o(b) = -5d(b) + 2u(b). Is o(10) prime? False Let l = -390 + 394. Is 1l + 488358/26 prime? True Let b be -1 - ((2 - 6) + 0). Suppose 0 = h - 2f + 59, 21 + 101 = -2h + bf. Let n = 66 - h. Is n prime? False Suppose -9v - 71 = -260. Let c(x) = 2x*3 - 23x*2 - 52x + 34. Is c(v) prime? True Let h(n) = 89n2 - 18n + 25. Let v(p) = 89p2 - 16p + 24. Let g(d) = -5h(d) + 6v(d). Is g(3) a prime number? False Let x = 2861 - 2851. Let w(y) be the third derivative of 2y5/5 - 2y*4/3 + 11y3/6 - y2. Is w(x) a prime number? True Let i be 158/8 + (45/36 - 1). Suppose p - 2528 = -4x, 0 = -6p + p - i. Is x a prime number? False Suppose 4a + 3323 + 45 = 0. Let c = a + 1611. Is c composite? False Let t(n) = -2782n*2 - n - 3. Suppose -3h + 8 = h. Let c be t(h). Let x = 16300 + c. Is x a prime number? True Let i be 672/16(-2 - (-10)/4). Suppose -31055 + 249266 = ic. Is c composite? False Let t = 13 - 9. Suppose -11j + 13j - 6510 = -2u, tj + 2u = 13024. Suppose 2m - 2w - 5130 = 0, 4w - j = -2m + 1861. Is m prime? False Let c be (-2)/10 - (-146808)/15. Suppose -7m - 1016 + c = 0. Is m a composite number? True Suppose 72641 = w - 7o, -9w + 11w = 3o + 145238. Is w a prime number? True Suppose -4h - 150538 = -10a, -8a + 3a = -3h - 75271. Is a composite? False Is (0 + 2)((-3)/(-2) + 3413292/69) a composite number? False Let b(h) = 40h3 + 5h*2 + 96h + 205. Is b(17) a prime number? False Suppose n = -2o + 53, -9o - 77 = -12o - n. Suppose -9l - ol + 70257 = 0. Is l a prime number? True Let l = -12 - -15. Is 22113/l + 0 + -2 prime? True Suppose 0c - 5c - d + 617 = 0, 0 = -3c + 3d + 363. Suppose -10b = 6947 + c. Let k = b + 1126. Is k a composite number? False Let t(u) = 11u - 7 + 2u - 5u2 - 22u*3 + 3u*3 - 7u. Is t(-5) a composite number? False Let a(q) = -q*2 + 5q + 10. Let j = 45 - 39. Let y be a(j). Is (-2)/((-7)/(938/y)) a composite number? False Let p = 20 - 20. Suppose -33 = -3w - pw. Suppose 0 = wn - 7n - 2036. Is n a composite number? False Suppose 9663 + 4071 = 3n. Is (n/9 + -1)6 prime? False Suppose -2z + 5d - 3438 = 0, 35z - 30z + 8629 = 4d. Let l = 2942 + z. Is l composite? False Let p be ((-678)/12)/((-3)/18). Suppose h = f - 497, f = 4f - 4h - 1492. Let w = f - p. Is w a prime number? True Suppose f - 1439 = -5a, -6f - 2a = -3f - 4291. Let l = f + 1680. Is l composite? False Is (-20)/(-100) + (-25438658)/(-35) a composite number? True Let s(t) = 7t3 + t2 + 4t - 5. Let h be s(1). Let z(q) = q3 - 5q*2 - 6q + 9. Is z(h) a prime number? False Let s = -305 + 313. Let q = -11 - -7. Is (-2)/q - 276/s-261 a composite number? True Let d(o) = -21285o + 53. Is d(-4) a composite number? False Let s = 358631 - -701430. Is s a composite number? False Let y(w) = w*3 + 18w*2 + 8w + 65. Let n(g) = 2g3 + 36g*2 + 17g + 130. Let u(k) = -3n(k) + 5y(k). Is u(-23) a prime number? True Let d = 44 + -38. Let h(r) = 67r2 + 12r - 5. Is h(d) prime? False Is (14/5)/(364/5934110) composite? True Suppose -22z + 14z = -32. Suppose zv = 2059 + 18169. Is v a prime number? False Suppose 4c - 5c = 0. Let f be c/(-4 - (-6)/1). Suppose f = -5g + 358 + 37. Is g prime? True Let y(g) = 21374g - 28. Let r be y(7). Suppose 3p - 18011 = r. Is p/14 + 12/(-8) a prime number? True Let h = -262 - -610. Suppose -2u = g - 3u - h, 2g + u = 693. Is g prime? True Suppose -135628 = 21x + 42200. Let k = x - -17619. Is k a prime number? True Let h(l) = -2746l + 1559. Is h(-26) a composite number? True Let v be (0/(-2))/(2/1). Suppose -5x - 2y + 11 - 57 = v, -3x - 21 = -y. Is 6459/96(-4)/x prime? True Let l(o) be the first derivative of -2o4 + 4o3/3 + o2/2 + 2o - 276. Suppose 0 = -4t + 4n - 32, t + 5n = -0t + 22. Is l(t) prime? True Suppose 8 = v - 3l - 14, 3v - l = 50. Suppose 88774 - 13526 = vh. Is h composite? False Let u = -187469 - -694762. Is u composite? True Let j(d) = 707d2 - 51d - 147. Is j(-19) a prime number? True Let m(c) = 3 + c*3 + 0c*3 - 6 + 2. Let z(p) = 3p*3 + 14p*2 + 20p - 6. Let j(d) = 4m(d) - z(d). Is j(16) prime? False Let t(q) = -131q + 514. Is t(-17) a composite number? False Let o = -123 + 158. Let l(p) = 8p2 - 24p - 75. Is l(o) a prime number? False Suppose -5i - 3d = -5d - 39, -5d = 3i - 42. Is 1/i + 184490/171 a prime number? False Suppose -5w + 312n - 316n = -1136450, 3w - 681897 = 3n. Is w a composite number? True Is ((3/(-2))/(64/404864))/(-3) composite? False Let y be (-2)/(-66/(-72)). Is 3 + -80178/y composite? True Let u(k) = 49036k + 1725. Is u(17) a prime number? False Let w = -2 + 48. Let i = -39 + w. Suppose 0 = -ia + 10a - 3447. Is a a composite number? True Let j = 4 + 1. Suppose jb - 5s - 2590 = 0, 0 = -5b - 3s - 141 + 2715. Let g = b + 157. Is g composite? False Let z = -3900279 - -5561320. Is z composite? True Let y = 79305 + 3044. Is y a composite number? False Let w be 24/(-40)1/((-9)/30). Is 2/((-16)/(-33924)) - w/(-4) a composite number? False Suppose -p + 4b = -125357, -p + 410b + 125375 = 409b. Is p composite? True Suppose -2h - 4a = -314932, 5h = 5a + 109148 + 678242. Is h a composite number? True Let w(q) = -286q + 23. Let u(i) be the first derivative of -572i2 + 92i - 2. Let s(b) = 2u(b) - 9w(b). Is s(7) a prime number? True Suppose 3x + u + 10419 = 42818, 4x - 14u = 43260. Is x a prime number? False Suppose 3q + 96 - 30 = 0. Let n(d) = d*3 + 22d*2 + 5. Let x be n(q). Suppose s - 6390 = -xt, 0 = 3t - 3s - 1416 - 2436. Is t prime? True Suppose 2p + b = 958807, -1408743 - 988271 = -5p - 3b. Is p composite? True Let u(i) = 247 - 97 - 101 + 79i. Is u(12) prime? True Let y be (12/14)/(2/7). Let o be y/(-15) + (-122)/(-10). Is (-2)/o-31106 a composite number? True Let i = 5482 - 1161. Is i a composite number? True Let k(i) = -i*2 - 5i - 6. Let b be k(-4). Let q be (4/12b)/(1/(-3)). Suppose 0 = r - 0y + y - 770, q*y + 761 = r.	{ "pile_set_name": "DM Mathematics" }
+ 5c2ks3 - 10cs3 + 2ks - 7k + 22s wrt c? 132ks - 16302s*3 What is the third derivative of 3u*4 + 5414u*3 - 20u*2 + 2087u? 72u + 32484 Find the second derivative of -81473q*4 + 2q*2 + 233294q. -977676q2 + 4 Differentiate -127c*3i + 1290321c3 - 162ci with respect to i. -127c*3 - 162c Find the third derivative of -24u4 - 25676u*3 - 411341u*2 wrt u. -576u - 154056 Find the second derivative of -171498d3 + 67841d + 2 wrt d. -1028988d What is the second derivative of 331ah2 + 2ah - 23h*2 + 58376h wrt h? 662a - 46 Find the second derivative of 932659r*3 + 2537878r wrt r. 5595954r What is the third derivative of 2t*5 + 90t*4 - 23t*3 - 10558t*2 + 14? 120t*2 + 2160t - 138 What is the first derivative of 10dor + 14439dr + 2d + 3or + 8o + r + 802 wrt d? 10or + 14439r + 2 What is the first derivative of 635686i3 - 1252749 wrt i? 1907058i*2 What is the first derivative of -81472r*3x + 13r2x - 1369x + 9 wrt r? -244416r*2x + 26rx What is the second derivative of 5363820w2 + 6511964w wrt w? 10727640 What is the second derivative of -75017u5 - 4u*3 + 11998u - 81 wrt u? -1500340u3 - 24u What is the third derivative of 11cd*4 + 4cd2 + 39cd - 34c - 180d4 + 2d*2 wrt d? 264cd - 4320d Differentiate 1775326h + 3010722. 1775326 Differentiate -95m*2q - 3m2v2 + m2vw - mqvw - 2mv2 + mvw + 109mv + 10m - 208qv*2 wrt q. -95m*2 - mvw - 208v*2 Find the second derivative of -4294b*2o*2 - 3b*2 - 5530bo2 - 2o*2 - 2 wrt b. -8588o*2 - 6 Differentiate 735639d*2 - 977451 wrt d. 1471278d Differentiate 40915c2 - 1275208. 81830c What is the first derivative of al + 352201a + 263282l wrt l? a + 263282 Find the third derivative of 20389i*3 + 33i*2 + 310i. 122334 Find the second derivative of -3639171b2 - 4162477b. -7278342 Find the second derivative of 129444g2 + 119924g wrt g. 258888 What is the second derivative of -309518p2 + p + 122366 wrt p? -619036 Differentiate -5p*2z - 8273pz - 4p - 2470627z wrt p. -10pz - 8273z - 4 What is the second derivative of -73364k*4 - 2k*2u - 7ku + 2k - 24494u - 1 wrt k? -880368k2 - 4u What is the second derivative of n*4 - 6713n*3 + 18n*2 + 265708n? 12n2 - 40278n + 36 What is the derivative of -11167bds - 44888bd - 2bs + 2ds wrt s? -11167bd - 2b + 2d Differentiate 1899861z + 1452269. 1899861 What is the derivative of 4h4 - 1533h*3 - 53692 wrt h? 16h*3 - 4599h2 Find the second derivative of o3v3 + 2o*3 + 77325o*2v*3 - 18ov + v2 - 36v - 4 wrt v. 6o3v + 463950o2v + 2 Differentiate -388am*2 - 13am - 741221a + 20m2 - 2m with respect to m. -776am - 13a + 40m - 2 Differentiate -38326ay + 6a - 3459 wrt y. -38326a Find the third derivative of -278q6 - 19q*5 + 7q*3 + 615610q*2 wrt q. -33360q*3 - 1140q*2 + 42 Find the third derivative of 675v*4x + 9v3x - 12v3 - 5v*2 - 2v - 48x + 328 wrt v. 16200vx + 54x - 72 What is the third derivative of -736515u6 + 3u*2 + 6984u + 15? -88381800u3 Find the third derivative of h3j*3 + 3607h*3jr + 8h*3r*2 - 413h*2j*3r + 2h2j*3 + 2h*2jr2 - 5hj3r - 18r2 wrt h. 6j*3 + 21642jr + 48r*2 Find the third derivative of -52070l*4 + 43l*2 - 285l wrt l. -1249680l What is the second derivative of 183792d*3 - 74956d + 2? 1102752d What is the derivative of 804bw4 - 2bw2 - 36b + 5 wrt w? 3216bw*3 - 4bw Find the third derivative of -774837d*4 - 798d*2 - 487 wrt d. -18596088d Find the second derivative of -622683m2o + 162822mo wrt m. -1245366o Differentiate -j4 - 102j*3 - 39j*2 - 10j - 1348215 wrt j. -4j3 - 306j*2 - 78j - 10 What is the first derivative of 14c4 + 43319c + 3696761 wrt c? 56c3 + 43319 Find the third derivative of -12a*4 - 2795a*3 + 2a*2 - 415016a wrt a. -288a - 16770 Find the second derivative of -39442v*5 + 18v*3 + 69v - 3337 wrt v. -788840v3 + 108v What is the third derivative of 3353j6 - 31j*3 + 290j*2 - 8j + 61? 402360j3 - 186 Differentiate 2bhx + 50bm*2x + 6bmx - 6bx2 + 47hm3 + 2hx2 + m3 wrt h. 2bx + 47m*3 + 2x*2 Find the third derivative of 2m*4 + 1377849m*3 + 20823m*2 - 46 wrt m. 48m + 8267094 Differentiate -cf2 + 21cf + 2790489c - 2067f2 wrt f. -2cf + 21c - 4134f What is the second derivative of 80415t*4 + 238t - 728? 964980t2 What is the third derivative of 58627f*3 - 2f*2 - 64873 wrt f? 351762 Differentiate 148q*3 + 12q*2 + 11q + 1827158 with respect to q. 444q2 + 24q + 11 Find the second derivative of 3m4 - 24579m*2 - 9569m - 6 wrt m. 36m2 - 49158 What is the second derivative of 63278t*3z*4 - 2t*3 + 5t*2z + 1241 wrt z? 759336t3z*2 What is the derivative of 7fo2 + 423fow + f - 709o2w + o*2 - 3ow + w wrt f? 7o*2 + 423ow + 1 What is the first derivative of 2qx2 - 633q + 178274x + 182 wrt x? 4qx + 178274 What is the first derivative of -f3 + 33814f*2 + 33242 wrt f? -3f*2 + 67628f What is the derivative of -53684j - 70908? -53684 What is the derivative of 7164g*2x*2 + 711017g*2 - 36gx2 wrt x? 14328g*2x - 72gx Find the second derivative of 182m3 + 8273m*2 - 1206359m - 1 wrt m. 1092m + 16546 Find the first derivative of 61432o - 48833. 61432 What is the derivative of -9057c3k + 32c3 + 14c*2h - 2chk wrt k? -9057c*3 - 2ch What is the first derivative of -q2u*3 - 39q*2u*2 - 702qu - 2u*3 + 666u*2 + 35u - 1 wrt q? -2qu*3 - 78qu2 - 702u Find the second derivative of -k*3 - 81417k*2 + 14046k. -6k - 162834 Find the second derivative of -12060m*3 - 92554m wrt m. -72360m What is the second derivative of 19c*2x2 - c2x - 125928c*2 + 133cx2 wrt x? 38c*2 + 266c What is the third derivative of 240044b6 - 15344b*2 + b + 1? 28805280b*3 Find the third derivative of 186y*6 + 14y*4 + 23319y*2 - 3 wrt y. 22320y*3 + 336y What is the third derivative of 2d3r*2 - 3d*3r + 72194d3 - 3d*2r + 5d2 - 29dr2 + 6dr + 4r*2 wrt d? 12r*2 - 18r + 433164 Differentiate 62u4 - 2495u - 47858. 248u3 - 2495 Differentiate 13105a*2cl2 + 2a*2c + 3a2l2 + a2 + 161l2 + 7 with respect to c. 13105a*2l*2 + 2a*2 What is the first derivative of -31nw2y + 11nw*2 + 11nw + 252ny - w2y - 7w + 2y + 3 wrt y? -31nw*2 + 252n - w*2 + 2 Find the first derivative of -74cgq + 54cg - 3cq - 3c - gq + 17q + 146 wrt q. -74cg - 3c - g + 17 Find the third derivative of 25721t3 - t2 - 2t + 63373 wrt t. 154326 Differentiate j*4 + 14836j*3 - j - 43089 with respect to j. 4j*3 + 44508j*2 - 1 Differentiate 2668341av - 2565078v with respect to a. 2668341v Find the third derivative of 37735f*4 + 13f*2 - 5f - 2. 905640f Differentiate -11bt + 83553b + 189522t - 12 with respect to t. -11b + 189522 Find the third derivative of 352430i3 - 118127i*2 wrt i. 2114580 What is the second derivative of -2k*5 - 3053k*3 - 10k*2 - 941271k wrt k? -40k3 - 18318k - 20 What is the third derivative of 21119h6 + 147h*2 + h + 19 wrt h? 2534280h*3 Differentiate -5az - 46109a - 2770z2 + 2z + 3 wrt z. -5a - 5540z + 2 Find the first derivative of -19j3n + 95j3 + 31jn + 7j - 4n - 2 wrt n. -19j*3 + 31j - 4 What is the first derivative of 1330774g - 886071? 1330774 Find the first derivative of 3o*2w*3 - 216490o*2w*2 + 14w*3 + 61w*2 + 6w + 1 wrt o. 6ow*3 - 432980ow2 What is the second derivative of -15p*2x + 863p2 - 69px + 2p + x - 25 wrt p? -30x + 1726 Differentiate -39649l3 + l2 + 2l - 74988. -118947l*2 + 2l + 2 Find the third derivative of 16f3x*4 - 1966f*3x*2 - 56f*3x - f*2x*2 + 169fx4 + 13fx3 wrt x. 384f*3x + 4056fx + 78f Find the second derivative of 3i*3 - 254i*2n*2 - 160i*2n + i*2 + 313182in2 + 2n - 2 wrt i. 18i - 508n*2 - 320n + 2 What is the first derivative of -187679	{ "pile_set_name": "DM Mathematics" }
o(q) = 14q - 2. Calculate the remainder when o(1) is divided by 4. 0 Let h be ((-44)/(-5))/(4/20). Suppose -3r - h = -4r. Suppose 3d - 30 = d. What is the remainder when r is divided by d? 14 Suppose 2v + 10 = 7v. Suppose -6g + 184 = -vg. What is the remainder when g is divided by 12? 10 Let b = -9 - -22. Let f = -68 - -29. Calculate the remainder when b is divided by f/(-9) - (-2)/3. 3 Suppose -o + 4 = -5u, -o = -2u - 0 - 4. Suppose -s = -us - 28. Suppose 5k - 61 = 14. Calculate the remainder when s is divided by k. 13 Suppose 3i = -40 + 97. Suppose -4l + 216 = 4k, -k - 218 = -5k - 2l. What is the remainder when k is divided by i? 17 Let h = -160 - -282. What is the remainder when h is divided by 32? 26 Let f = -2 + -1. Let r(q) = 4q*3 + 4q2 - q. Let x(y) = y3 - y - 1. Let s(k) = r(k) - 3x(k). Calculate the remainder when s(f) is divided by 4. 2 Let h = 4 + 10. Let y = 10 + h. Calculate the remainder when y is divided by 7. 3 Let u be 6/(-8) - (-2)/(-8). Let x = u - 3. Let l = x - -43. Calculate the remainder when l is divided by 14. 11 Let g = -109 + 67. What is the remainder when (-4)/7g/12 is divided by 2? 0 Let n be 6808/14 + (-4)/14. Let k = 210 - n. What is the remainder when 38 is divided by k/(-14) + 4/14? 18 Suppose -j - 3j - 20 = -l, 0 = -l - 2j + 50. Suppose -l = p - 6p. What is the remainder when 14 is divided by p? 6 Let i be (1 - 2 - 1) + 40. Suppose 0y = 3y - 3p - 42, 0 = -2y - 3p + i. Calculate the remainder when y is divided by 6. 4 Let j(i) = -31i3 + i2 + 3i + 1. Calculate the remainder when j(-1) is divided by 11. 8 Suppose 8j - 95 = 3j. Let c be (-4)/14 + (-1976)/(-56). Suppose u = 6u - c. Calculate the remainder when j is divided by u. 5 Let i(b) = 2b + 18. Let p be i(-9). Suppose a - 6 = -0j - j, 3j - 3a - 30 = p. Calculate the remainder when 22 is divided by j. 6 Let u(g) = -g2 - 11g - 7. Let v be u(-7). Let b = -12 + v. What is the remainder when b is divided by 5? 4 Let z(u) = -5u - 3. Let x be 3(-8)/12 + 14. Let k = x - 9. Calculate the remainder when z(-2) is divided by k. 1 Let y(j) = -j*3 + 5j*2 - 4j + 4. Let l be y(3). Let c(p) = -p*2 - 9p - 4. Calculate the remainder when c(-6) is divided by 11/2l. 4 Suppose -2 = -s, 4s = 3q - 6q + 329. Let u be ((-66)/(-5))/((-3)/(-15)). Let y = q - u. What is the remainder when y is divided by 14? 13 Let p = -10 - -13. Suppose 0 = -pt - t + 48. Calculate the remainder when 34 is divided by t. 10 Suppose 5s - 15 = -0s + 5z, 4s = z + 9. Calculate the remainder when 2 + 16/(s/1) is divided by 6. 4 Let z = 85 - 55. Let p = z - 0. What is the remainder when 87 is divided by p? 27 Let m = 109 + 51. Calculate the remainder when m is divided by 27. 25 Suppose 3y + 4 = -4i, 2y - 8 = -y - i. Suppose ys - k - 67 = 0, -4k = -3 - 1. Calculate the remainder when 32 is divided by s. 15 Let q = -4 - -3. Let c(v) = -5v - 1. Let b be c(q). What is the remainder when 5 is divided by b + (1 - 1) - 1? 2 Suppose 0 = 4n - 2a - 4, -n - a + 3a = 5. What is the remainder when -20n/((-15)/4) is divided by 6? 4 Suppose 0 = n - 4n + 12. Suppose -ny + 8 = -0y. Calculate the remainder when 7 is divided by (4/3)/(y/6). 3 Suppose 2r - 6r = -220. Let c = r - 23. What is the remainder when c is divided by 11? 10 Let r(d) = -10d - 19. Suppose -4 = -4s + 2a, 3a - 4 + 5 = s. Let x(p) = 41p*2 - 2p + 1. Calculate the remainder when x(s) is divided by r(-4). 19 Suppose 18 + 17 = -g. Let k = -16 - g. Suppose 11 = -3f + 4f. Calculate the remainder when k is divided by f. 8 Suppose -3z + z = -10. Suppose -3p = -za + 50, 0 = -4a + 3a - 2p + 10. What is the remainder when 38 is divided by a? 8 Let c = -134 - -209. What is the remainder when c is divided by 39? 36 Let h(n) = -5n3 + 4n*2 + 3n. Let g = 5 + -7. What is the remainder when h(g) is divided by 17? 16 Suppose 5n - 14 = 1. Suppose nr - 3 = 2r. Suppose q = 4i - 1, -q + 43 = 4q + 4i. What is the remainder when q is divided by r? 1 Let v(f) = f*2 - 2f - 7. Let d be v(7). Suppose 0x = x - 20. Let h = d - x. What is the remainder when 23 is divided by h? 7 Let q be (-4)/(-2) - -7 - 0. Let i(h) = 17h - 4h - 4h - 2 + qh. Calculate the remainder when i(2) is divided by 12. 10 Suppose -3d + 4d = 9. Let u(l) = -9l + 14 - 5l2 + 4l*2 - 11. What is the remainder when u(-7) is divided by d? 8 Suppose 3r - r - 49 = -3v, -5v = 3r - 76. Suppose -5j = -197 - 53. Calculate the remainder when j is divided by r. 16 Let h(b) = 14b + 4. Let d(u) = -15u - 3. Let i(z) = 5d(z) + 4h(z). Suppose 2q - 10 = q. What is the remainder when i(-2) is divided by q? 9 Suppose 2z + 4k + 12 = 0, 4k - 6k = 2z + 2. Let h be (3 + -5)/440. Let m = -10 - h. What is the remainder when m is divided by z? 2 Suppose -4q = q - 170. What is the remainder when 64 is divided by q? 30 Suppose 0n + 2n = 10. Suppose n = -s + 9. Calculate the remainder when 11 is divided by s. 3 Let a be (1 - 0)16/2. Suppose 4c + 0c = 16. Let k = a + c. Calculate the remainder when 34 is divided by k. 10 Suppose 0 = -5z - 2k - 368, 0 = -0z - 3z + 2k - 224. Suppose 0 = -r - 4, n + n - 46 = 5r. Calculate the remainder when z/(-3) - 6/9 is divided by n. 11 Let t(d) = -d3 + d2 + d + 16. Calculate the remainder when 78 is divided by t(0). 14 Suppose 4r + 0d + 2d - 130 = 0, -2d + 98 = 3r. Calculate the remainder when r is divided by 11. 10 Suppose -10 = -5o + 55. Calculate the remainder when ((-1)/3)/(1/(-69)) is divided by o. 10 Calculate the remainder when (2/6)/((-2)/(-66)) is divided by (1 - 6)3/(-5). 2 Let l = -23 - -17. Let j = l - -25. Calculate the remainder when j is divided by 10. 9 Let f be 9/2 - 4/(-8). Suppose 2d - 3z + 8z = 25, 0 = 2d - fz + 5. Let k = d + -3. Calculate the remainder when k is divided by 2. 0 Let y(v) = -v2 - 8v - 4. Suppose 29 = r - 4x, -r + 0r = 3x - 29. Calculate the remainder when r is divided by y(-6). 5 Let r(n) = -26n + 2. Let b be r(2). What is the remainder when ((-1)/1)/(2/b) is divided by 9? 7 Suppose -3r = -2j - 47, 0 = 2r - j - 17 - 15. Calculate the remainder when r is divided by 5. 2 Suppose 6w = 3w. Suppose w = -3p - 39 + 117. Suppose -5j = -6j + 14. Calculate the remainder when p is divided by j. 12 Suppose 3j - 15 = 3u, 2u - 63 = -5j - 24. Let r(x) = x*3 - 7x*2 + 3x + 4. Calculate the remainder when r(7) is divided by j. 4 Let i = -13 + 13. Suppose 2f + if - 24 = 0. Calculate the remainder when 22 is divided by f. 10 Calculate the remainder when -3 - -1 - 2 - -51 is divided by 24. 23 Suppose 52 + 23 = 3d. Let z(x) = 2x - 1. Let t be z(-2). Let c = t - -14. Calculate the remainder when d is divided by c. 7 Suppose -2k + 90 + 12 = 0. Calculate the remainder when k is divided by 18. 15 Let c(o) = 2o*2 - 3o + 8. What is the remainder when c(-4) is divided by 11? 8 Suppose 0 = 3x + 4v - 21, v - 8 = -x - 0x. Calculate the remainder when (64/(1 - 3))/(-1) is divided by x. 10 Suppose 14d = 192 + 186. What is the remainder when 50 is divided by d? 23 Suppose 0 = -5t - 4r + 163, -t + 2r = 7 - 48. Suppose t = 4g + g. What is the remainder when g is divided by 3? 1 Suppose -2b + 108 = 2q, 112 = 2b - 2q + 3q. Calculate the remainder when b is divided by 31. 27 Suppose 55 = 2x - 39. Calculate the remainder when x is divided by 24. 23 Let a(w) = w*2 + 6w. Let p be a(-6). Let m = -79 - -127. Suppose 4v - m + 4 = p. Calculate the remainder when 30 is divided by v. 8 Suppose -2a = -g - 210, 5a - g - 376 = 149. Suppose 7 + 5 = x. What is the remainder when x is divided by a/5(-1)/(-3)? 5 Let y(l) = l*3 - 5l*2 + 7l - 1. Calculate the remainder when 5 is divided by y(3). 1 Let n(w) = -w*3 - 7w*2 - 4w - 9. Let k(a) = -6a2 - a. Let l be k(1). Let r = 29 - -7. Calculate the remainder when r is divided by n(l). 17 Suppose 5y = -0y + 25. What is the remainder when 16 is divided by y? 1 Let w(l) = -3l*3 - l + 2. Let t = -5 - -2. Let b = t + 1. What is the remainder when w(b) is divided by 10? 8 Let i = 33 + -12. What is the remainder when 59 is divided by i? 17 Suppose 2k = 5s + 5 + 8, -s - 4k = 7. What is the remainder when (-3)/(s/(-3)-1) is divided by 2? 1 Suppose 10 = 2y, 10*	{ "pile_set_name": "DM Mathematics" }
1/(-5) + (-209)/(-55). Let w be (-20)/(-12) + (-1 - 0). What is the fourth biggest value in w, u, -0.2, 5? -0.2 Let l be 391/759 + 4/(-12). Let n be (-7)/(-10) - (-32)/40. What is the smallest value in l, -1/8, n? -1/8 Let z = 25781 - 232024/9. What is the second biggest value in z, 52/19, 1? 1 Let n = 7.973 - 9.073. What is the second biggest value in n, -19, 5? n Let l = 2829 + -2829.02. Which is the smallest value? (a) 2/5 (b) -4 (c) l (d) -0.3 b Let c = 982 - 756. Let p = 222 - c. What is the third smallest value in 2/5, p, -1/13? 2/5 Let d = -36.59 - -38. Let a = 2.91 - d. What is the third biggest value in a, 4, 1? 1 Let v = 47 + -143/3. Let q = 560 + -549. Which is the third smallest value? (a) q (b) -1 (c) v a Suppose 3q + 24 = 4j, -5 = 2q + 3. Suppose 0 = -jb + 4u - 11, 2b - 2u + 4 + 2 = 0. What is the biggest value in 4, -2, b, 1/5? 4 Let i(v) = -v2 + 4v - 1. Let s be i(2). Let q = 6.92 - 3.74. Let m = q + -3.14. Which is the biggest value? (a) 2 (b) s (c) m b Let u = -22993 + 23081. What is the second biggest value in u, -1, 0.2, 3, 0.08? 3 Let z = 28 + 71. Let q = -99.115 + z. Let x = 0.125 + q. Which is the biggest value? (a) x (b) -0.5 (c) 0.4 c Let k = -3.7864 + 3.361. Let w = k + 0.0254. Which is the fourth biggest value? (a) w (b) 0.4 (c) 0.13 (d) 1/5 a Suppose -2q + 7 = 17. Let m = 22 + 72. Let s = m - 93. Which is the third biggest value? (a) 1/5 (b) -5/6 (c) q (d) s b Let x be 3 + (1 - -8) - (-6 - -8). Suppose -15z + xz + 10 = 0. Which is the fourth smallest value? (a) -5 (b) z (c) -0.2 (d) 5 d Let v = -3712.6 + 3713. What is the third biggest value in v, 4, 22? v Let k = 86 - 182. Let l = k - -99. Which is the third biggest value? (a) l (b) 3/2 (c) -0.04 c Let x = 42 - 40. Let u = -999.8 + 1000. Which is the fourth smallest value? (a) u (b) x (c) 5/6 (d) 5 d Let y be (8-12)/((-15)/20). Let j = y - 131. Let x(l) = -l - 2. Let v be x(0). Which is the second smallest value? (a) -0.4 (b) -2/11 (c) j (d) v d Let c be (20/(-5) + 5)66/(-165). What is the third biggest value in 2/15, c, -11, 1.2? c Let z = -0.34264 + 0.35964. Let k be 21/(-6)-2. What is the third biggest value in z, -0.1, k? -0.1 Let n = 4.95387 + 0.04613. What is the fourth biggest value in 0.08, n, 1, 0? 0 Let s = -0.0088 - 5.0112. Let f = s + 0.02. Suppose -5g + 4x + 30 = 7x, -4g = -x - 7. Which is the third biggest value? (a) g (b) f (c) -0.2 b Let q(u) = 3u + 64. Let s be q(-19). Suppose sk = -207 - 185. Which is the smallest value? (a) -0.4 (b) -1/3 (c) k c Let b = 0.15 + -0.3. Let n = 81672 + -81670. What is the second smallest value in b, 0.1, -3/7, n? b Let g = -2694 - -2696. Which is the biggest value? (a) -16/3 (b) 8 (c) g b Let x = -0.04 + -51.96. Let n = 52.79 + x. Let i = 0.39 - n. Which is the biggest value? (a) 4 (b) 2/5 (c) -2 (d) i a Let m(t) be the first derivative of -t2/2 - 7t - 18. Let f be m(-8). Let p be (-72)/(-81) - (-4)/(-6). Which is the smallest value? (a) f (b) 0.1 (c) p b Let t = -1342 + 812. Let v = -528 - t. What is the second biggest value in v, 26, 0? v Let w = 9335/9 - 1037. Let r = -13 - -10. Which is the biggest value? (a) w (b) r (c) -3/2 a Let q = 362.2 + -315.2. What is the smallest value in q, 0, -1? -1 Let o = 11 - 17. Let p = -767 - -767. What is the third biggest value in -1/3, p, o? o Suppose 2i = -2b + 16, -2i + 4b = 2i. Let w = -0.061 + -10.939. Let n = 11.3 + w. What is the second smallest value in 5, n, i? i Let j = 17 - 16. Let u = -8437/30 + 826/3. Let w = -22/5 - u. What is the third biggest value in 2/9, j, w? 2/9 Let z(v) = v3 - 17v*2 + 30v - 1088. Let o be z(18). Which is the third biggest value? (a) -2/7 (b) 2/5 (c) o c Let v = -107/206 + 2/103. Which is the third biggest value? (a) 2/3 (b) 6 (c) 2/17 (d) v c Let p be -16/(-4)28/(-6). Let c be -3(p + (-318)/(-45)). Let r be (-1)/2 + (-25)/(-2). What is the third biggest value in r, c, -1, -1/8? c Let r = -203 - -209. Suppose -p = -4z - 47, -r = 2p - 12. Which is the second biggest value? (a) 3 (b) z (c) -2 c Let v = -93.6 - -94. Let m = -1139.5 + 1138. Which is the fourth smallest value? (a) -4 (b) m (c) 0.5 (d) v c Let x = -5.07 + -0.53. Let u = x + 6. Let y = u - 0.1. What is the third biggest value in 0.08, y, 0.1? 0.08 Suppose 4s + 1 - 69 = 0. Let i = -2 + 5. Let r = -372176 + 372172. Which is the biggest value? (a) s (b) i (c) r (d) 5 a Let p = -0.669 + -0.331. Let b = 4/11 + -5/44. What is the second biggest value in p, b, 2? b Suppose -2s - 5q - 10 = -7s, -3s - 4q + 20 = 0. Let m be (-2)/s1/2. Which is the third smallest value? (a) 4 (b) 1 (c) 6 (d) m a Suppose -4i = -p - 23, 5i = -4p + 6i - 2. Which is the smallest value? (a) -0.14 (b) 2/7 (c) 1/4 (d) p a Let d = -59 + 163. Let t = 128.7 + -129.2. What is the third biggest value in t, -0.1, d? t Let p = 0.1 + 0.9. Let n = 10 + p. Let r be (-2)/60485 + 11 - 2/(-12). Which is the smallest value? (a) n (b) r (c) 0.5 b Let q be 56/171 + (3852/228 - 17). Which is the fourth biggest value? (a) -4.5 (b) -3 (c) 2 (d) q a Let w = -0.2 - -1.2. Let q be 18/(-246) + (-603)/1845. Which is the biggest value? (a) -1 (b) w (c) q (d) -3 b Let s = 1596 + -1595.7. Which is the third smallest value? (a) s (b) -1/8 (c) 4 (d) -11 (e) -3 b Let u be (-420)/(-80)(-4)/14. Which is the second biggest value? (a) u (b) 2/109 (c) 0.4 b Let b = 3.15455 + -0.15455. What is the third smallest value in -4, 4, 0, b, -7/8? 0 Let j = 13.6 - 14. Let i = 0 - -0.1. Let v be (-6270)/(-242) - 19 - 7. What is the biggest value in -0.6, v, i, j? i Suppose -3z = 2q + 7, -29z = -33z + 3q - 15. Let p be 20/(-25)3/(-4). Let w = 16 + -17. Which is the smallest value? (a) p (b) w (c) -0.5 (d) z d Let p(a) = a*3 + 8a*2 + 9a + 12. Let h be p(-6). Suppose -6x + h = -5x. Let g = 132.5 - 132. What is the smallest value in x, g, -0.2? -0.2 Let y(w) = 10w2 - 8w - 16w2 - 13 + 7w*2. Let m be y(19). Suppose 15z = m - 1. What is the biggest value in z, -2/3, 4? z Let t = 1259 + -1259.3. What is the smallest value in -0.4, 1, t, 0.5, -25? -25 Let l be 110/140(-84)/(-231). Which is the third smallest value? (a) l (b) 4/25 (c) 1/5 (d) -3 (e) -0.5 b Let h = -0.2 + 1.2. Let y = -142/35 + 27/7. Let f = -2356 - -2355. Which is the second biggest value? (a) y (b) f (c) h a Let r = 0.5 + -0.3. Let i be (4113/(-459) + 9)/((-2)/(-6)). What is the fourth biggest value in i, -2, r, 0.4? -2 Let g = -15211 - -15211. Which is the fourth biggest value? (a) -2 (b) g (c) -58 (d) -5 c Let n be 0 + 4 - (0 + 1). Let z = -147.68 - -154.68. What is the second smallest value in 4/3, n, z? n Suppose -t = 2d + d - 3, -2t - 4d = -6. Let k be (-209)/(-66) - (-2 - (-6)/4). Let h = k - t. What is the second biggest value in h, 1, -3? h Let g = 2.03 - 0.03. Let u = 7 - g. Let z(w) = 3w3 + 49w*2 + 130w - 5. Let s be z(-13). What is the second biggest value in u, -1, s, 1/3? 1/3 Let o = 0.9 + -0.4. Let m = 38 - 184.2. Let c = -148 - m. What is the third biggest value in c, 2, o? c Let u = -66.5 - -66.5. Let z = 56.948 + 0.052. Which is the third smallest value? (a) u (b) z (c) 2/9 b Let n = -2.0438 - -0.0438. What is the third smallest value in n, 1/8, 13/3, 5? 13/3 Let t = 5.1515 + -0.1515. What is the smallest value in -5, t, -0.3, 2/9, -4.6? -5 Let i = -1.552 + 1.53. Let t = i - 3.978. Let g = 2.6 + -3. Which is the smallest value? (a) 3 (b) -0.3 (c) g (d) t d Let d = 0.8 - -0.2. Let k = -13282/3 + 4371. Let n = k + 56. What is the biggest value in 7, n, d? 7 Let a be ((-244)/(-183))/((-256)/24). Let l be 1/4 - 5/12. What is the fourth biggest value in -0.04, a, -5, l? -5 Let r be (-6)/27 - (1372/180)/(-1). Let p = -301/40 + r. Suppose 13w - 17w = 100. Which is the third biggest value? (a) w (b) p (c) 3 a Suppose -g - 2g + q + 6 = 0, 4g - 2q - 8 = 0. Suppose -73 = 3l + h, gh = -l + 2l + 36. Which is the biggest value? (a) -2/3 (b) -0.2 (c) l b Let f = -53/3 - -695/39. Let v = -0.9 - -4.9. Let z = -197 + 1771/9. Which is the second smallest value? (a) v (b) -3 (c) z (d) f c Let x = 100 - 100. Let m be (x - 4/12) + -1. Let d = 0.011 + -0.021. Which is the third sma	{ "pile_set_name": "DM Mathematics" }
e 10 = 2w - 0. Suppose -h - 1 = -3m - w, -4h + m + 38 = 0. Let q be (h/(-6))/((-8)/24). Solve qt - f = 2f - 37, 5f - 45 = 5t for t. -5 Let m(p) = 29p. Let f be m(0). Solve -y + 8 = 4c, 0 = 4y - fy - c + 19 for y. -4 Let l be (56/(-252))/((-1)/18). Suppose -ln = 3c + 1 - 3, -5c + 8 = 2n. Solve -5f - 5g = 0, 0f + 3g + c = -2f for f. 2 Suppose -2n - n + b = -79, 25 = n + b. Let w(q) = -7q + 183. Let h be w(n). Suppose 2 = s - 3. Solve sd - 5v = 0, v - 3 = -h for d. 2 Suppose 2m - 3m - 2k - 6 = 0, 5m + 2k = -6. Suppose 3d - 9 = 5n - 9n, 5d + 2n - 29 = m. Solve 5j + h - 3 = 0, d - 1 = -3h for j. 1 Suppose -1445 = 7b - 10076. Suppose 1231a - ba = -24. Solve a = -2j - 4r, 5j - j + 2r + 18 = 0 for j. -4 Let c = -5 + 10. Let f = 6 - 3. Let k be (1 + 0)/((-1)/(-7)). Solve -cl + k = s + fs, 9 = 3l for s. -2 Let u(q) = 2q - 143. Let i be u(0). Let l = 168 + i. Let d be (20/8 + -2)0. Solve 5v + w + l = d, 4v + 3w - 4 = -24 for v. -5 Let m be (-6)/(-14)((-20 - -8) + 19). Solve -4b = -2p - 16, -mp = -p + b - 4 for p. 0 Let a = -5805 + 5807. Solve 4 - 1 = t, -ag = 2t - 14 for g. 4 Suppose 3w - r = 75, 4w - 4r + 3r = 101. Let f(i) = -2i + 57. Let g be f(w). Solve -3y + 18 = 2p, -gy + 0p - p + 23 = 0 for y. 4 Suppose 555f = -z + 551f + 6, z - 4f + 2 = 0. Solve 2 = -zv + 2o, -4o = 10v - 6v - 4 for v. 0 Let r(y) = -3 - y + 1 + 2. Let w be r(-6). Let g = -83 - -83. Solve h - 4h + 3a - w = 0, 2h + 2a + 12 = g for h. -4 Suppose -9b = 119b. Solve -6 = -4s - 2q, -5s + 3q - q + 3 = b for s. 1 Let u be (-9)/(-2)120/45. Let i = 10 - u. Let s be (-9)/i14/21. Solve -5k + sx - 9 = 7x, 0 = 3k + 4x + 7 for k. -1 Let h be (-28)/(-5) + 34/85. Let m(x) = 2x - 3. Let q be m(h). Solve 2t = 3u + q, 5u = -0t + 5t - 20 for t. 3 Let r = 6285 - 6074. Solve 5a + 214n = rn - 19, -3n = 2a + 13 for a. -2 Suppose -3j = 3m - 774, 0 = j - 6j - 4m + 1293. Suppose -6u = 147 + j. Let g = -67 - u. Solve -2h + 8 + g = d, 4d - 21 = -3h for h. 3 Let n(m) = 2m2 + 55m + 89. Let z be n(-26). Solve 3a + 16y + 14 = zy, -2y = -2a - 4 for a. -3 Let x = 46 + -43. Let u be x/8 + 154/16. Suppose -4z + 1 = -5c + 30, -c + 5z = -u. Solve 0 = 4b - 2h, -5b - 3h - 1 = -ch for b. -1 Let t be 21/(-3)(29 + -23) - -8. Solve 0 = 3f + tr + 4, 2f = -f + 2r + 2 for f. 0 Let f(p) = 100p - 79. Let h be f(5). Let s = -392 + h. Solve 2l + 2l = -5i + s, 2l + 3i - 17 = 0 for l. 1 Suppose 2b = -5u + 31, -5u + 2b + 26 = 7. Solve -8v - i + 3 = -6v, -uv = 3i - 7 for v. 2 Let b(f) = f3 + 5f*2 + 25f + 89. Let w be b(-4). Solve -2k - 17 - 3 = -4x, -wx - 3k + 14 = 0 for x. 4 Suppose -48 = -4d + 2r, 4527r - 4529r = -d. Solve 3p - 4i = -6, -21i + di = 2p - 19 for p. 2 Suppose -4a = -g - 4, -5a + 27g - 28g = 4. Solve a = -3y + n + 24 - 4, -y + n = -8 for y. 6 Suppose q = -5r - 34 + 140, 3q - 3 = 0. Solve 2p - 1 = m, -14p = -5m - 17p + r for m. 3 Suppose 3g + 35f - 30f = 99, 15 = 5f. Solve 5x + d + 19 = 4d, 4x + g = -4d for x. -5 Let h be (6/(-15))/(-1)1180. Let z be ((-1)/((-2)/2))/(6/h). Suppose 2i = zi - 20. Solve 0 = -3m - 2u + 11, -im + 0m + 12 = -u for m. 5 Let u be 15 - 52/(0 - -4). Solve 2g + 4q - 5q - 5 = 0, 0 = -uq + 10 for g. 5 Suppose -395 = 57y + 4222. Let r(q) = -2q*2 - 16q + 15. Let o be r(-12). Let z = y - o. Solve z = -5f + 2x + 5, -5x - 15 = -5f + 5 for f. -1 Let f(k) = k + 48. Suppose -5o - 3c - 50 = 11, -2o - 5c = 32. Let n be f(o). Let y = n - 35. Solve -3r = -q - 10, -5q - 17 = -yr - 2r for r. 3 Let g = -7 + 11. Let h = 61954 + -61923. Solve 3c + h = -4t, 5t = -gc - 48 + 8 for t. -4 Suppose r - 5g - 4 - 25 = 0, 0 = 4r - g - 59. Suppose 4d = rd - 70. Solve 27 = -4j + dj - 4m, -3j = -2m - 21 for j. 5 Let f(g) = 16 + 68g*2 - 130g*2 + 63g*2 + 9g. Let c be 4/(-18) + 316/(-36). Let x be f(c). Solve -5o + 4 + 2 = -4i, -5i = -2o + x for i. -4 Let a(n) = n*3 - 5n*2 - 12n - 10. Let u be a(7). Suppose -uz = -z + 9. Let m be (4 - 3) + (0 - z). Solve 0d + 22 = d + 5r, -mr + 23 = -d for d. -3 Suppose 131 - 236 = -7l. Suppose 2b - x - 4x = 6, 0 = -5b - x + l. Solve j = 2c - 0j + 1, -3 = 5c - bj for c. 0 Suppose -8s - 25 = -65. Suppose 0 = 4q - sa - 1, 5q - 2a = 3a + 5. Suppose 20 = qk + 12. Solve kp + 3w - 24 = -w, -p = -5w + 16 for p. 4 Let v(z) = -18z3 + z + 1. Let m be v(-1). Let k(x) = 131x - 1832. Let q be k(14). Solve qd = -5g - 22 + 6, 3g + 4d = -m for g. -2 Let k = -23 + 30. Suppose 3h = 4w - k, h = w - 6w + 4. Let f be -2 + 3/1 + w. Solve -m + 2i = 4, fm + 2i - 4i + 4 = 0 for m. 0 Let v = 477 + -477. Suppose 5a - 18 = 12. Solve 3m = 5b + a, -6 = 2b - v for m. -3 Let n(r) = -2r*2 - 178r - 2648. Let q be n(-70). Solve j - 5g = -13, -4j + q = 4g - 8 for j. 2 Let c(m) = 76m + 4183. Let k be c(-55). Solve 31 = kl - 4q, 7 = 4l + 3q - 1 for l. 5 Suppose -329u + 188u + 1056 = 211u. Solve -4y + 19 = -uf + 4f, -2y + 11 = f for f. 3 Suppose 66w - 162 = 57w. Let l(b) = 2b*2 - 38b + 41. Let t be l(w). Solve -4d + ts = 7, 2s - 2 + 4 = 0 for d. -3 Let d be -1 + (-4)/(-12) + (-64)/(-6). Suppose -5 + 55 = df. Solve -4i = c + 25, fi + 19 + 11 = -c for c. -5 Let n(x) = -x*2 - 14x - 31. Let l be n(-5). Suppose -la + 73 - 3 = 0. Solve -11 = -2m - 3c, 4c + 6 = am - 10 for m. 4 Let b(l) = 5l*2 + 8l + 6. Let u be b(-3). Suppose u = -6h + 39. Solve -3s + 4m = -h, 4s - 3m + 7m = 12 for s. 2 Suppose 0 = -12c + 7c + 40. Suppose -3o + 13 = 2l, -16 = -cl + 3l - 2o. Let s be (-9)/l8/(-12). Solve 0 = j + j - sf - 11, -5 = 5f for j. 4 Suppose -185x + 60 = -331x + 166x. Solve -i = n - 4n + 13, xi + 6 = -2n for n. 3 Let g(d) = d*2 + 12d + 3. Let v(p) = 3p - 93. Let z be v(27). Let l be g(z). Suppose -1 - 3 = -b. Solve -15 = -lc + bh, -3c + 0h = h - 15 for c. 5 Let h(i) = -2i*2 + 54i - 245. Let d be h(21). Solve -4p = 3v - dv - 20, -15 = -3p - 5v for p. 5 Let k(r) = 3r3 + r2 + 10r - 17. Let p be k(3). Suppose 0 = -pl + 84l. Solve l = -c - c - 4y + 6, -4y - 12 = -4c for c. 3 Suppose 0 = 23k - 18k - 10. Suppose -2o - 57 = -5o. Suppose -4v - kt = -22, 3v + 2t - o + 0 = 0. Solve 3x = p - 0p + 2, -p - 2x + v = 0 for p. 1 Suppose 10a - 9a = 0. Suppose 5x + 5r - 15 = a, -x + 3r - r = 0. Solve 0 = -3z, 5 = -3c + xc - 2z for c. -5 Suppose q + 12 = -f - 389, -4f - 804 = 2q. Let o be (q/16)/(0 - 1). Solve -4 = t + 3t, o = -4i - 5t for i. -5 Suppose n = -z + 49, -2n + 36 + 77 = -z. Let t(v) = 1 + 6 + n - 3v. Let p be t(19). Solve 18 = -5c + pg, -4c - c - 3g = 4 for c. -2 Let x = -74 + 74. Let q be x/(-11) + -2(-15)/6. Solve l - 10 = 4l - 4y, q = 5y for l. -2 Let p(o) = -34o*2 - 2o - 2. Let n = -8 + 7. Let s be p(n). Let l = s - -37. Solve -b = -2f - lb + 4, f = 2b + 11 for f. 5 Let h be -1 + (2 - -12)4. Let a = -56 + h. Let c be (a/1 - 1) + 19. Solve 3o - 2y + 9 = 0, 0o + o + c = -4y for o. -5 Let t be (((-6)/(-12))/1)/(11/264). Solve -12 = -4z - 3l, 51z + t = 49z + 3l for z. 0 Suppose 19w = 42 + 15. Solve 2t = d - 14, wd + d - 3t - 31 = 0 for d. 4 Suppose -9s + 4s + 20 = 0. Suppose s - 8 = f, -3b - 3f - 3 = 0. Solve 5l = bq + 16, -2q + 2 = -4l + 14 for q. -2 Let h be 5/20-10(-2 + 0). Solve -hb + 10 = 2n, 5n = 4b + 2n - 31 for b. 4 Let q(v) be the first derivative of v*3/3 + 11v*2/2 - 20v + 12. Suppose -5n + 10 = 80. Let o be q(n). Solve f - 2x + o = -3f, 3x = f + 8 for f. -5 Suppose 0 = -76r - 42r + 1534. Solve 8q = 3q + 15, q = -2i + r for i. 5 Let t = -35 + 41. Let u = -64 + 64. Suppose 11g - 10g = u. Solve -s = x - gx - 1, t = x - 4s for x. 2 Let m be 1/(-4) - (-747)/12. Suppose 3g = 4p - 0p + 158, 244 = 4g + 3p. Let o = m - g. Solve n + 5 = -oq, -5q + 3q - 15 = 3n for n. -5 Let r(p) = 4p2 - 1531p - 1530. Let u be r(-1). Solve -12 = 3o - 3d, -uo = -d + 11 + 13 for o. -5 Let x(w) = -22w + 178. Let g = 17 + -9. Let s be x(g). Solve -1 - 2 = 4v + 5l, 0 = -2v - sl - 2 for v. -2 Let t(z) = -z*3 - 3z*2 - z + 3. Let c be t(-2). Let i = -20 + 25. Suppose iu - 5x = 20, -3x - 2*x = u + 20. Solve g -	{ "pile_set_name": "DM Mathematics" }
3 What is the tenth root of 26962 to the nearest integer? 3 What is the square root of 2251 to the nearest integer? 47 What is the cube root of 8816 to the nearest integer? 21 What is the ninth root of 33543 to the nearest integer? 3 What is the fourth root of 76290 to the nearest integer? 17 What is 21096 to the power of 1/3, to the nearest integer? 28 What is the square root of 6807 to the nearest integer? 83 What is 3208 to the power of 1/2, to the nearest integer? 57 What is 20622 to the power of 1/2, to the nearest integer? 144 What is 8012 to the power of 1/2, to the nearest integer? 90 What is the third root of 208 to the nearest integer? 6 What is 24597 to the power of 1/7, to the nearest integer? 4 What is 31279 to the power of 1/5, to the nearest integer? 8 What is 18658 to the power of 1/5, to the nearest integer? 7 What is 4397 to the power of 1/3, to the nearest integer? 16 What is 53681 to the power of 1/3, to the nearest integer? 38 What is 15428 to the power of 1/2, to the nearest integer? 124 What is 1484 to the power of 1/3, to the nearest integer? 11 What is 865 to the power of 1/5, to the nearest integer? 4 What is the fourth root of 9885 to the nearest integer? 10 What is the ninth root of 867 to the nearest integer? 2 What is 2851 to the power of 1/2, to the nearest integer? 53 What is the cube root of 512 to the nearest integer? 8 What is the cube root of 4079 to the nearest integer? 16 What is the square root of 8830 to the nearest integer? 94 What is 4601 to the power of 1/9, to the nearest integer? 3 What is the sixth root of 4541 to the nearest integer? 4 What is the square root of 7181 to the nearest integer? 85 What is 31041 to the power of 1/6, to the nearest integer? 6 What is 13741 to the power of 1/8, to the nearest integer? 3 What is the square root of 108886 to the nearest integer? 330 What is the third root of 2825 to the nearest integer? 14 What is the cube root of 1136 to the nearest integer? 10 What is the third root of 1052 to the nearest integer? 10 What is the third root of 17880 to the nearest integer? 26 What is the square root of 28471 to the nearest integer? 169 What is the square root of 339 to the nearest integer? 18 What is the square root of 64331 to the nearest integer? 254 What is the square root of 16711 to the nearest integer? 129 What is the cube root of 697 to the nearest integer? 9 What is the ninth root of 31137 to the nearest integer? 3 What is the fourth root of 773 to the nearest integer? 5 What is the sixth root of 6471 to the nearest integer? 4 What is the cube root of 1093 to the nearest integer? 10 What is the square root of 12848 to the nearest integer? 113 What is 1987 to the power of 1/7, to the nearest integer? 3 What is the ninth root of 2364 to the nearest integer? 2 What is 52679 to the power of 1/3, to the nearest integer? 37 What is 1988 to the power of 1/6, to the nearest integer? 4 What is the eighth root of 35770 to the nearest integer? 4 What is the eighth root of 8773 to the nearest integer? 3 What is the ninth root of 1696 to the nearest integer? 2 What is 22821 to the power of 1/3, to the nearest integer? 28 What is the cube root of 7868 to the nearest integer? 20 What is 21643 to the power of 1/2, to the nearest integer? 147 What is 24260 to the power of 1/2, to the nearest integer? 156 What is the eighth root of 312 to the nearest integer? 2 What is 3944 to the power of 1/4, to the nearest integer? 8 What is 42 to the power of 1/2, to the nearest integer? 6 What is 858 to the power of 1/2, to the nearest integer? 29 What is 1092 to the power of 1/2, to the nearest integer? 33 What is the sixth root of 857 to the nearest integer? 3 What is the third root of 36586 to the nearest integer? 33 What is the third root of 103525 to the nearest integer? 47 What is the fifth root of 60350 to the nearest integer? 9 What is the tenth root of 5297 to the nearest integer? 2 What is the eighth root of 6698 to the nearest integer? 3 What is 181 to the power of 1/3, to the nearest integer? 6 What is the square root of 2210 to the nearest integer? 47 What is 1094 to the power of 1/3, to the nearest integer? 10 What is the eighth root of 158 to the nearest integer? 2 What is the square root of 441 to the nearest integer? 21 What is the cube root of 31463 to the nearest integer? 32 What is the cube root of 8434 to the nearest integer? 20 What is the seventh root of 3736 to the nearest integer? 3 What is 1098 to the power of 1/4, to the nearest integer? 6 What is the third root of 8207 to the nearest integer? 20 What is 14811 to the power of 1/2, to the nearest integer? 122 What is 725 to the power of 1/3, to the nearest integer? 9 What is the ninth root of 164 to the nearest integer? 2 What is the tenth root of 1196 to the nearest integer? 2 What is the sixth root of 6583 to the nearest integer? 4 What is 1443 to the power of 1/2, to the nearest integer? 38 What is the square root of 25227 to the nearest integer? 159 What is the cube root of 3619 to the nearest integer? 15 What is 85621 to the power of 1/3, to the nearest integer? 44 What is 11835 to the power of 1/8, to the nearest integer? 3 What is the square root of 8917 to the nearest integer? 94 What is 51320 to the power of 1/2, to the nearest integer? 227 What is 139757 to the power of 1/2, to the nearest integer? 374 What is the fourth root of 6554 to the nearest integer? 9 What is 4794 to the power of 1/5, to the nearest integer? 5 What is the square root of 889 to the nearest integer? 30 What is the fourth root of 1318 to the nearest integer? 6 What is 6499 to the power of 1/9, to the nearest integer? 3 What is the tenth root of 72856 to the nearest integer? 3 What is the square root of 442 to the nearest integer? 21 What is the square root of 1715 to the nearest integer? 41 What is the eighth root of 12160 to the nearest integer? 3 What is 591 to the power of 1/3, to the nearest integer? 8 What is the square root of 960 to the nearest integer? 31 What is the third root of 69488 to the nearest integer? 41 What is the eighth root of 1382 to the nearest integer? 2 What is 3680 to the power of 1/8, to the nearest integer? 3 What is the cube root of 6257 to the nearest integer? 18 What is 24452 to the power of 1/2, to the nearest integer? 156 What is 2863 to the power of 1/2, to the nearest integer? 54 What is 23274 to the power of 1/9, to the nearest integer? 3 What is 829 to the power of 1/3, to the nearest integer? 9 What is the square root of 2790 to the nearest integer? 53 What is 68 to the power of 1/3, to the nearest integer? 4 What is 4673 to the power of 1/2, to the nearest integer? 68 What is 1884 to the power of 1/5, to the nearest integer? 5 What is 29845 to the power of 1/9, to the nearest integer? 3 What is the cube root of 1016 to the nearest integer? 10 What is 644 to the power of 1/2, to the nearest integer? 25 What is the square root of 72343 to the nearest integer? 269 What is the eighth root of 13078 to the nearest integer? 3 What is the square root of 1541 to the nearest integer? 39 What is 472 to the power of 1/2, to the nearest integer? 22 What is 1909 to the power of 1/2, to the nearest integer? 44 What is the seventh root of 764 to the nearest integer? 3 What is the tenth root of 1183 to the nearest integer? 2 What is the cube root of 5845 to the nearest integer? 18 What is 5067 to the power of 1/5, to the nearest integer? 6 What is 24085 to the power of 1/4, to the nearest integer? 12 What is the ninth root of 33 to the nearest integer? 1 What is 11819 to the power of 1/3, to the nearest integer? 23 What is the cube root of 687 to the nearest integer? 9 What is the cube root of 2949 to the nearest integer? 14 What is the fifth root of 739 to the nearest integer? 4 What is 39813 to the power of 1/5, to the nearest integer? 8 What is 90162 to the power of 1/9, to the nearest integer? 4 What is the seventh root of 16552 to the nearest integer? 4 What is 5465 to the power of 1/2, to the nearest integer? 74 What is the cube root of 153234 to the nearest integer? 54 What is 57995 to the power of 1/2, to the nearest integer? 241 What is 2364 to the power of 1/8, to the nearest integer? 3 What is the e	{ "pile_set_name": "DM Mathematics" }
nded to the nearest 100? 20900 What is -406.6669799 rounded to the nearest 10? -410 Round -55.15766578 to 2 decimal places. -55.16 What is 0.000652990299 rounded to five decimal places? 0.00065 What is 39.57601092 rounded to the nearest 10? 40 Round -0.002051869704 to six decimal places. -0.002052 Round -0.00075136491 to 4 dps. -0.0008 What is 0.00019597162 rounded to 5 dps? 0.0002 What is 232912.028 rounded to the nearest one thousand? 233000 What is 89798.8692 rounded to the nearest ten? 89800 Round 198.79465453 to the nearest ten. 200 Round -358.395931 to the nearest 100. -400 Round -36452265000 to the nearest 1000000. -36452000000 Round -4178.911 to the nearest one thousand. -4000 What is 6.18219448 rounded to zero decimal places? 6 What is -0.00557430854 rounded to 3 dps? -0.006 What is 0.012278990374 rounded to seven dps? 0.012279 What is -612.686748 rounded to one decimal place? -612.7 Round 0.000001239657949 to 7 dps. 0.0000012 What is -89847437.5 rounded to the nearest ten thousand? -89850000 Round -225359845.59 to the nearest 100000. -225400000 Round -6868.349 to the nearest ten. -6870 Round 0.00332144837 to six decimal places. 0.003321 Round 0.000052776197 to six decimal places. 0.000053 What is 140271913 rounded to the nearest one hundred thousand? 140300000 What is -433000.92 rounded to the nearest 100000? -400000 What is 0.050168483 rounded to 2 decimal places? 0.05 What is 5623799.1 rounded to the nearest one hundred thousand? 5600000 What is 7524413.2 rounded to the nearest one thousand? 7524000 Round -0.00294417091 to four dps. -0.0029 Round 0.94543222 to 4 decimal places. 0.9454 What is -51008.9587 rounded to the nearest 1000? -51000 What is 130.444267 rounded to 1 decimal place? 130.4 What is 701779.839 rounded to the nearest 10000? 700000 What is -0.00156370517 rounded to 4 dps? -0.0016 Round 0.0001419229888 to seven dps. 0.0001419 What is -19241.6702 rounded to zero decimal places? -19242 Round -493.8098 to the nearest 10. -490 What is 1.32301349 rounded to 1 dp? 1.3 What is 7172.4937 rounded to the nearest ten? 7170 What is -0.0256626395 rounded to three dps? -0.026 What is -1727.733839 rounded to 2 decimal places? -1727.73 Round -26.148971 to one dp. -26.1 What is -0.2448853149 rounded to four dps? -0.2449 What is -0.0001942790737 rounded to 5 decimal places? -0.00019 Round -89293455.7 to the nearest 1000000. -89000000 Round -0.00479487443 to five decimal places. -0.00479 What is 0.0863902627 rounded to 2 dps? 0.09 Round 26175545.74 to the nearest one hundred thousand. 26200000 Round 836.97882 to 1 dp. 837 Round -24528452 to the nearest 1000000. -25000000 Round 0.0311953153 to 2 decimal places. 0.03 What is 2083433378 rounded to the nearest one hundred thousand? 2083400000 Round -267.791997 to 2 dps. -267.79 What is -16237542 rounded to the nearest 100000? -16200000 Round -6707109.372 to the nearest 1000000. -7000000 Round 46401668.9 to the nearest ten thousand. 46400000 What is 925.75595 rounded to 0 dps? 926 Round -0.0172983 to 5 decimal places. -0.0173 Round 101001648.94 to the nearest one thousand. 101002000 What is -315.072328 rounded to one decimal place? -315.1 Round 254.644869 to two dps. 254.64 Round 200052252 to the nearest one hundred thousand. 200100000 What is -0.03838657322 rounded to three decimal places? -0.038 What is -0.00000078909 rounded to 7 decimal places? -0.0000008 What is 0.000195103291 rounded to five decimal places? 0.0002 What is -52938.38136 rounded to the nearest 10? -52940 Round 0.024093312 to two dps. 0.02 What is -3.783870077 rounded to three dps? -3.784 What is 28.892375 rounded to one dp? 28.9 Round -0.0120340284 to four dps. -0.012 What is -0.000000064380926 rounded to 6 dps? 0 What is -2.942856114 rounded to 4 dps? -2.9429 What is 1.3126754071 rounded to 2 decimal places? 1.31 Round -0.0148415244 to three dps. -0.015 Round -2164.1477 to the nearest one hundred. -2200 Round 321.877068 to one dp. 321.9 Round 45377.4622 to the nearest 10. 45380 Round 0.00008035117435 to five decimal places. 0.00008 Round -601.3987365 to one decimal place. -601.4 Round 28.20635529 to the nearest integer. 28 Round -2.201992283 to two decimal places. -2.2 What is -14653022.46 rounded to the nearest 1000? -14653000 What is -21133482.2 rounded to the nearest 100000? -21100000 Round -12268.7198 to the nearest one hundred. -12300 What is 263512.5658 rounded to the nearest 10000? 260000 Round -0.002401732 to five dps. -0.0024 Round -6477068.3 to the nearest 100000. -6500000 What is 159.20364787 rounded to 3 decimal places? 159.204 Round -5808102850 to the nearest 1000000. -5808000000 What is 0.001813142831 rounded to four dps? 0.0018 What is -0.001707977371 rounded to 7 decimal places? -0.001708 What is -0.09345350476 rounded to 2 dps? -0.09 Round 23179.843 to the nearest 10000. 20000 What is 1269597324 rounded to the nearest 100000? 1269600000 What is -0.49826576 rounded to 5 decimal places? -0.49827 What is -0.123439149 rounded to 5 dps? -0.12344 What is 20606.9367 rounded to the nearest 100? 20600 What is 2563760110 rounded to the nearest one hundred thousand? 2563800000 Round 24.3214752 to three dps. 24.321 Round 0.0000677664532 to five decimal places. 0.00007 Round -0.00000734607333 to seven decimal places. -0.0000073 Round -10858256.418 to the nearest 10000. -10860000 Round -4464.898723 to zero decimal places. -4465 What is -4982.445818 rounded to zero decimal places? -4982 Round -2271.4189 to the nearest 10. -2270 What is -374920710 rounded to the nearest 100000? -374900000 What is 0.06640502078 rounded to five dps? 0.06641 What is -45207258.3 rounded to the nearest 100000? -45200000 Round 2849.49845 to one decimal place. 2849.5 What is 0.006661164461 rounded to 5 dps? 0.00666 What is -0.000023466085 rounded to 5 dps? -0.00002 What is 17378202.3 rounded to the nearest one hundred thousand? 17400000 Round -0.214954152 to 3 dps. -0.215 Round -0.00506031143 to six dps. -0.00506 What is -0.009555652331 rounded to three decimal places? -0.01 Round 0.000319809501 to 5 dps. 0.00032 Round 0.00410310922 to 5 decimal places. 0.0041 Round 11971.57853 to the nearest 100. 12000 Round 250680144800 to the nearest 1000000. 250680000000 Round 1572.244 to the nearest integer. 1572 Round -1.02839184 to one dp. -1 What is -0.00793384 rounded to two decimal places? -0.01 Round 5169691.98 to the nearest 1000. 5170000 Round 0.0002248769 to 4 decimal places. 0.0002 What is -6.1587529 rounded to three decimal places? -6.159 Round -913603.801 to the nearest 100000. -900000 What is -0.0002683070142 rounded to seven dps? -0.0002683 Round 1841.283304 to the nearest 1000. 2000 What is -2257.7891 rounded to the nearest ten thousand? 0 Round 4.6135937 to 2 dps. 4.61 Round -2.4419102589 to 3 decimal places. -2.442 Round -3700.12005 to the nearest 100. -3700 What is -5117679.45 rounded to the nearest 100? -5117700 What is 0.0021355728 rounded to 3 dps? 0.002 Round 0.000180226042 to seven dps. 0.0001802 What is 0.00801734105 rounded to five decimal places? 0.00802 Round 0.0006860443992 to seven decimal places. 0.000686 Round 0.0000018242705 to six dps. 0.000002 Round 51305993.4 to the nearest one hundred thousand. 51300000 What is -198.921689 rounded to the nearest integer? -199 What is 3761425.52 rounded to the nearest 100000? 3800000 What is 34205.3548 rounded to the nearest integer? 34205 Round -10117408450 to the nearest one hundred thousand. -10117400000 Round 4071250770 to the nearest one million. 4071000000 What is -560165.791 rounded to the nearest 100? -560200 What is -187.595822 rounded to the nearest ten? -190 What is 0.0000064796047 rounded to 6 dps? 0.000006 What is 1216088.331 rounded to the nearest 100? 1216100 Round -155737061.55 to the nearest one hundred thousand. -155700000 What is 0.070482111 rounded to two decimal places? 0.07 Round -0.0013865171 to six dps. -0.001387 What is 37.295768 rounded to 1 dp? 37.3 What is 0.0000056857129 rounded to 6 dps? 0.000006 What is -5339675.38 rounded to the nearest one hundred thousand? -5300000 What is -6679.94448 rounded to the nearest one thousand? -7000 What is 0.0002151763417 rounded to five dps? 0.00022 Round -2.6035542 to 1 dp. -2.6 Round -2409880.03 to the nearest 100000.	{ "pile_set_name": "DM Mathematics" }
give n. -183 Express (-j*2 + 3j*2 + 0j*2)(-3j + 73 - 73 - 113j) as qj + v + sj*2 + mj*3 and give m. -232 Express (2 + 5 - 4)(-o + 7o - 4o)(4o - 4 + 4) as wo2 + ko + l and give w. 24 Rearrange -7k - 18k + 25k - 11k to ok + z and give o. -11 Express 13 + 0v*2 + 2v - 3v - v2 as w + dv*2 + pv and give d. -1 Rearrange -u*2 - 7u*2 + 4u*2 - 5 to the form x + yu + gu2 and give g. -4 Express 16s - 29s - 16s - 1 + 3 in the form h + ns and give h. 2 Express (62g + 667 - 667)(-3 + 1 + 1) as s + mg and give m. -62 Rearrange -30i2 - i - 9 + i + 27i*2 to n + fi + ci2 and give c. -3 Express 4j + j - 4j + (-3j - 4 + 4)(-1 + 1 + 1) - 3j + 0 + 0 + 3j - 4j + 1 + 0j as mj + v and give v. 1 Rearrange ((4 - 4 + o)(3o - 17o - 4o) - 3o2 - 2o*2 + 3o*2)(3o - 3o + 2o2) to i + ro*2 + uo*4 + vo*3 + zo and give u. -40 Express -4s4 + 2s + 2s4 + 3s*3 - 5s + 11s2 + s as ms*2 + bs*3 + js + fs4 + z and give b. 3 Express -2u - 2u2 + 4u*2 + 1 + 6u*3 + 2u*2 + 3u as iu2 + s + bu + xu3 and give i. 4 Express (2 + 2 - 2)(2 - 3 - 1)(71 - 71 - 17t*4) + 10 + 5t*4 - 10 in the form kt*4 + at*3 + lt + z + vt2 and give l. 0 Express (0d*3 + 3d*3 + 0d*3)(2 + d - 6 - 2)(5 - 2 - 2) as n + xd*4 + sd*2 + hd + yd3 and give y. -18 Express (0v + 1 + 3v + 0v)(2 - 8 - 1) as gv + b and give b. -7 Express (2w - w - 2w + (1 + 2 - 1)(2w + 2w - 3w) + w + 2w - 2w + w + 3w - 3w)(-w - 2w - w) as dw2 + aw + b and give d. -12 Rearrange 6k2 - 4k*2 + 7k*3 + 2k - 3k2 to the form b + sk*3 + rk + zk2 and give b. 0 Express -73t - 10t3 + t2 - 3t*4 + 5t*4 + 72t as ot4 + z + qt*2 + vt + nt3 and give o. 2 Rearrange -2m - 3 + 3 - 15 - 15 to the form v + jm and give v. -30 Rearrange -19 - 20p*2 + 18p*2 + 7 to the form c + gp + ip2 and give c. -12 Rearrange 2z*2 - 1 + 2 + 7z*4 - 5z*4 to the form hz*2 + oz + j + lz4 + bz*3 and give j. 1 Express (-3g*2 + 5g*2 - 4g*2)(1 + 3 - 3)(560 - 278 - 284) as bg*2 + c + ug and give b. 4 Express (2 + 5m - 2)(m + 6m - m)(-m + 1 - 1) in the form l + zm3 + ym + tm2 and give z. -30 Rearrange -70 + 127 - 146b - 57 to v + zb and give z. -146 Rearrange 0v*3 + 0v2 - v3 + 3v2 to the form mv*3 + yv*2 + l + fv and give m. -1 Rearrange -13r - 150 + 150 to the form sr + q and give s. -13 Express -2r + 0r - r - r + 2r + r + (-r - 3r + 2r)(0 - 3 + 1) - 3r + 5r - r + (1 - 1 - r)(1 - 1 - 2) + 3r - r - 7r as yr + w and give y. 1 Rearrange -5r2 + 7r*2 + 3r + 3r to the form kr + c + dr2 and give k. 6 Express (-3x*3 - 3x*3 + 5x*3)(-3 - 2 + 2) + (-4 + 1 + 2)(0x3 + x3 + 8x3) as tx*3 + lx*2 + hx + m and give l. 0 Rearrange -11 - 65 - 41 - 24 - l to y + ml and give m. -1 Express 2 + 2 - 2 - 14t*3 in the form qt*2 + yt + it3 + l and give i. -14 Express -6k - 3k - k - 6k as p + ck and give c. -16 Rearrange -o2 - 10 - 5o*3 + 7o*3 - 6o*4 + 4o*4 to yo + uo3 + no*2 + vo*4 + f and give n. -1 Rearrange (2 - 4 + 0)(-7 + 3 + 3)(84i + 111i + 3i) to the form w + oi and give o. 396 Express 21 - 14 + 8 + 6u as c + lu and give c. 15 Rearrange -t2 + 5t*2 + 8t*2 to w + bt + st2 and give s. 12 Rearrange -7w*4 + w - 29w*3 - 9w*4 + 32w*3 to rw*4 + iw + d + jw2 + tw*3 and give t. 3 Express -9s*4 - 4 + 13s*2 + 6 + s - 7s*4 + 15s*4 as us*4 + xs*3 + r + fs + ps2 and give r. 2 Express (-9 - 3 - 2)(-4m + 0m + 2m) in the form n + im and give i. 28 Rearrange 0 + 71m2 - 33m*2 + 32m*2 + 1 to the form j + am*2 + fm and give j. 1 Express 118 + 2b3 + 6b - 234 + 114 as xb2 + u + fb + kb3 and give k. 2 Rearrange -13 + 19 - 3v - 6v4 + 3v*4 + 5v - v*2 to xv*2 + kv*4 + hv + ov3 + m and give x. -1 Rearrange (s - 2s - s)(0 + 0 - 3) to ds + w and give d. 6 Rearrange 2g4 + 2 - 2g + 0 + g - 3g4 to the form tg*4 + ng*2 + u + mg*3 + dg and give u. 2 Express (-3v + 6 - 6)(-4 - 4 + 6) as y + mv and give m. 6 Express 2v + 5v - 5v + 45 - 20 as d + gv and give d. 25 Rearrange (4 - 4 + 2)(82y3 + 68y*3 - 120y*3) to m + iy*2 + jy + ky3 and give k. 60 Rearrange -19n + 17 + 21 - 38 to kn + i and give k. -19 Rearrange ((3p + p - 2p)(-6 + 1 - 10) - 2p + p + 0p)(-p3 - 3p*3 + 3p*3) to v + tp*2 + gp*4 + xp*3 + cp and give g. 31 Rearrange (2h2 - 6h*2 + 3h*2)(-4 - 5 + 9 - 38h) to gh*3 + b + ph*2 + uh and give g. 38 Express 3h - 2h + 7h + (4 - 4 + 1)(-2h + h + 2h) as oh + x and give o. 9 Rearrange (2 + 0 - 3)(-2 + 1 - 3)(-4o + 4o - 6o + (0 + 2 + 0)(4 - 4 - 2o)) to the form t + mo and give t. 0 Express -5l2 - l2 - 3l2 + (0 + 0 + 1)(-l*2 - 2l*2 + 2l*2) - 8l*2 - 2l*2 + 0l*2 as ml + xl2 + w and give x. -20 Express -1 - 14g*3 + 2g3 + g3 - g*4 + 9g*3 - 4g as og3 + ag*2 + jg*4 + dg + u and give o. -2 Rearrange (3 + 0 - 1)(0 + h + 0) - 7h - h + 3h + (2 + 2 - 2)(-3h + 0h + 2h) - 2h - 2h + 5h to gh + f and give g. -4 Express 9w*2 - 12w3 + w2 + 2w + 2 - 3w*4 - 4w*2 - 5w*2 in the form cw*4 + f + pw*2 + aw + xw3 and give x. -12 Rearrange -47 + 94 - 47 - 144x to lx + z and give l. -144 Rearrange 23 + 16r - 54 + 28 to m + vr and give m. -3 Rearrange -60d*3 - 22d*2 + 4d*2 + 6d*2 + 11d*2 to the form o + cd + pd2 + hd3 and give h. -60 Rearrange -d3 + 2d3 + 1 + 2d4 - d2 - d*3 - 2d to id2 + yd + jd4 + nd*3 + w and give n. 0 Rearrange 142m - 142m - 20m*2 to the form ym*2 + im + j and give y. -20 Express -6 - 5 - 7 + 24 - 10i in the form ri + s and give s. 6 Express (3q3 - q3 - q3)(0 + 1 + 1)(-127 - 6q + 127) as kq2 + iq + gq3 + zq4 + l and give z. -12 Rearrange -46 + 24 + z2 + 23 + z*3 - 5z to the form bz + qz*2 + vz*3 + h and give b. -5 Express -16r - 21r - 2 + 34r + 29r2 as xr*2 + yr + l and give x. 29 Rearrange -g + g + 22g2 + 0g*2 to s + og*2 + ng and give o. 22 Rearrange -8i + 8i + 5i + 17i to mi + d and give d. 0 Rearrange (2k - 3k + 0k)(k2 + 23 - 24 - 3k*2) + (3k*2 - k + k)(3k + k - 6k) to u + hk2 + ck*3 + gk and give g. 1 Rearrange 14l2 + 37l*2 - 23l*2 to the form cl*2 + v + bl and give c. 28 Express -2p3 - 2p*2 + 3p*2 + 7p - 6p in the form dp*3 + tp*2 + x + rp and give t. 1 Rearrange -2q2 + 17q - 7 + 3q4 - 16q + 4 to the form gq + bq*3 + z + jq*2 + fq*4 and give g. 1 Express 3p*2 + 5p*2 - 4p*2 + 2p + 5p2 in the form jp + r + op2 and give j. 2 Express -13 - 6o + 15 + 5o in the form r + ko and give k. -1 Rearrange -12v3 + 3v*3 + 8v3 - v2 + v - v*4 to the form j + zv*4 + kv*3 + fv + qv2 and give q. -1 Express 71t*3 + 3t*2 - 73t3 - t2 - 1 as rt2 + wt*3 + x + vt and give x. -1 Rearrange (-m + 2m + m + (2 - 1 + 1)(-4m + 2m + 3m) + 4m + m - 3m)(-6m - 2m + 6m) to tm + im2 + h and give i. -12 Express (2h*2 + 29h - 6h3 + 0h*3 - 30h)(-3 + 3 + h) in the form xh + d + gh4 + uh*3 + ih*2 and give u. 2 Rearrange -2c4 - c3 + 4c2 + 158c - 158c to the form a + tc + bc4 + nc*2 + pc*3 and give n. 4 Express (-3 + 1 + 0)(-3a - 3 + 3) - a + a + 5a as qa + v and give q. 11 Rearrange -13q*3 + 5q*2 - 3q - 4q2 + q to the form oq*3 + jq + nq2 + f and give o. -13 Rearrange -1 - v - 2v + 2 + 3v2 - 2 to gv + c + av2 and give g. -3 Rearrange 5 - 2 + 6k*2 + 2 - 4 to the form t + ck*2 + qk and give c. 6 Rearrange 0w2 - 2w*2 - 3w*2 to mw*2 + q + hw and give m. -5 Express 36y + y2 + 6y3 + y4 + 0y2 - 34y as jy3 + gy + ry2 + ny*4 + a and give g. 2 Express (-7 + 2 - 198j + 199j)(2j2 + j2 - 5j*2) as g + kj*3 + dj*2 + uj and give d. 10 Express a - 7a + 3a2 + a4 + 2 + 0a4 + a in the form ua + ta2 + v + sa*3 + fa*4 and give s. 0 Express ((-1 + 0 - 1)(g - 2g + 3g) + 2g + 0g + 0g - g - 2g + g - 3g - 4g + 4g)(-3 + 3 - 2)(2 - 2 + g) in the form zg + rg*2 + a an	{ "pile_set_name": "DM Mathematics" }
e -5o = 5i - 8 - 2, 5o + 2i - 22 = 0 for o. 6 Solve -3n = 5a - 29, -a + 5n - 5 = 6 for a. 4 Solve -24 = 5q + 4v + 6, 2q - 2v = 6 for q. -2 Solve -5w = -3b - 29, w + 3b - 2b - 1 = 0 for w. 4 Solve -4o = 12, 0 = -i + 8o - 12o - 8 for i. 4 Solve 5n + 27 = 2z, 6n = 8n + 5z + 5 for n. -5 Solve -2j + l = -16 + 25, -4l = -12 for j. -3 Solve 3 + 3 = 3f + 3u, 0 = 4f - u - 3 for f. 1 Solve 9 = 3s + 3w, 5s - 8s - 31 = -5w for s. -2 Solve 4c - 14v - 4 = -10v, -12 = -3v for c. 5 Solve -84g + 20 = -4y - 80g, 0 = -2g for y. -5 Solve 0 = a - 2g + 5, -3a + g - 20 = -5 for a. -5 Solve 2h + 4i = 7 + 13, -16 = 2h - 5i for h. 2 Solve 2m + 8 = m - 3z, 2m = 4z + 24 for m. 4 Solve 0 = -5h - i + 20, 272 = -2h + 4i + 258 for h. 3 Solve -3b + 23 = 5c, -23b = -4c - 18b - 26 for c. 1 Solve 0 = -d - 2z + 9 - 7, 3z = -5d + 3 for d. 0 Solve -4y + 8 = a, 7y + 4 = 11y for a. 4 Solve -5c + m - 24 = 0, -9m - 16 = 3c - 8m for c. -5 Solve -4j + 4 = -2o, -16o + j = -17o + 1 for o. 0 Solve 13 - 25 = -4g, 4n - 2g = -18 for n. -3 Solve 2a = 2w + 18, -60w + 55w + a - 25 = 0 for w. -4 Solve -2 = 2a + 2t, 4t + 19 = a + 5 for a. 2 Solve -2p - 2 + 8 = 4r, 4p = 2r - 18 for p. -3 Solve h = 35t - 36t + 5, -4h + t + 5 = 0 for h. 2 Solve -4g + 2 = 3d - 1, 5d = 3g + 34 for d. 5 Solve 4d - 16 = 0, -2d + 9 = -x + d for x. 3 Solve 3i + 3 = -9o + 7o, -10i + 7 = o for o. -3 Solve 0 = 2j + 4a + 10, 4a = 2j + 2a - 2 for j. -1 Solve 3b = 5z + 4, -4z - 2 = -6b + 3b for z. -2 Solve c + 4c - 10 = 4b, 4 = 2b + 2c for b. 0 Solve 3a + 1 = 2d + 3, 5 = -5d for a. 0 Solve k + 4 = 0, 504i - 5 = 501i + 5k for i. -5 Solve 3z - 3g + 3 = z, -5g = 4z - 27 for z. 3 Solve 4a + 65p = 69p + 20, -2a - 3p = 15 for a. 0 Solve 2w + 1 = 7, -4l + 2w = -14 for l. 5 Solve -10 = a + 5z + 15, -2z - 18 = 2a for a. -5 Solve -4n - 4y = -32, -4n + 3y - 7 = -4 for n. 3 Solve -3g + 3 = r, -2g - 5r + 62 = 73 for g. 2 Solve -3b - 15 = 0, 20b - 16b = -2z - 28 for z. -4 Solve -3y - 5i + 10 = 0, 31y - 26y + 4 = 2i for y. 0 Solve -4n = 5h - 28, -n - 3n - 12 = -5h for h. 4 Solve -3x = -3o + 15, -432o + 4x = -433o + 5 for o. 5 Solve -2y + z + 2 = 0, -5y = -3y - 5z - 2 for y. 1 Solve -3c = -2p - 16, 6c + p = 5c + 2 for c. 4 Solve -5s - u - 11 = 0, -4s - 210 = 5u - 218 for s. -3 Solve 0 = -5u - 20g + 25g + 20, 0 = -2g - 8 for u. 0 Solve 10 = 5a - 2j, -6a + 7a - 2j = 2 for a. 2 Solve -u + 11r - 16r = 20, 3u - 3r = 12 for u. 0 Solve -5y - w + 6 = -4w, -2y + 5w = -29 for y. -3 Solve -41j + 3k = -40j - 5, 0 = k + 2 for j. -1 Solve -15 = -5k, 46l + 2k = 47l + 2 for l. 4 Solve -3p - w + 3 = 0, 73p + 4w = 72p + 12 for p. 0 Solve -5z + 5w = -15, 2z - 1 = w + 1 for z. -1 Solve -6 = r + 3k, 3r + 1 = -5k - 9 for r. 0 Solve 5l = -5c + 10, -4c = 2l - 1 + 3 for c. -3 Solve 3k = -4t + 1 - 30, 0 = -5k + 3t for k. -3 Solve 3v + 5 = -2t, 5t - 4t - 2v = 15 for t. 5 Solve a + m + 26 = 5m, 0 = a - 5m + 31 for a. -6 Solve -16 = 2a + 2z, -4 = -2a + 5a - z for a. -3 Solve -2v = d, -3v + 2d - 3d = 2 for v. -2 Solve 16 = -2o + 5f - 9f, -4f - 4 = -o for o. -4 Solve 6b - 3b + 19 = 5c, 4b = 4c - 20 for c. 2 Solve k = -3, 0 = u + 3k + 7 + 5 for u. -3 Solve 0 = -4d + 5i - 13, 2d - 5 = -3i - 6 for d. -2 Solve -5b + 36 = 4u, -5b - 2u = -34 + 6 for b. 4 Solve -4w + 4b + 8 = 0, -13w + 10w + 2b + 9 = 0 for w. 5 Solve -11 = -3s + 4d + 1, 4d = 4s - 16 for s. 4 Solve -3p - 30s + 25s = 14, 3 = -2p + 3s for p. -3 Solve -4q + 28 = -8v + 4v, 0 = -3v - 2q - 11 for v. -5 Solve 4b - 7 = 13, 23 = -g + 4b for g. -3 Solve -23v - 3m = -18v + 12, 3v + 16 = -4m for v. 0 Solve 5a + 10 = -u, -48u = -44u - 3a - 6 for u. 0 Solve -2f - 7 = p, 0 = -4f + 540p - 536p + 4 for f. -2 Solve 0 = -5h - k + 21, -3h + 3k + k = -8 for h. 4 Solve 4m + 0j - 4 = -3j, 18 = m + 5j for m. -2 Solve -12d = -11d + 4v - 2, -2 = 2v for d. 6 Solve 3l - 56w = -55w + 3, -17 = -l - 5w for l. 2 Solve -6s + 2s = 4p - 16, -2p + 6 = 0 for s. 1 Solve 0 = 4w - 20, -3q - 20 = 2q - 4w for q. 0 Solve -4m - 28 = 4f, 3f = 9m - 6m + 3 for f. -3 Solve 2t - 9 = 3t + 2w, -17 = 5t + 3w for t. -1 Solve 0 = -4r - 5v + 10v - 29, -v + 2 = 3r for r. -1 Solve 0 = -3x - 0x + 4m + 5, 3x + 25 = -2m for x. -5 Solve 4n = 2w + 9 - 21, 0 = 4w - 3n - 19 for w. 4 Solve -l + 4l = -4g - 25, 3l - 4g = 7 for l. -3 Solve 0 = -18w + 20w + 5q - 35, -w - 5q + 30 = 0 for w. 5 Solve 3s - 6 = s + 4w, -2s + 3w = -3 for s. -3 Solve -3a = -2o - 23, -27 = -2a + o - 13 for a. 5 Solve 4c - m = -4, 2c - 14m = -12m + 4 for c. -2 Solve -m - 4i - 11 = 0, 5m - i = -4i - 21 for m. -3 Solve 3j - 5a = -28, -j + 5a - 2a - 16 = 0 for j. -1 Solve -3l - 5b - 1 - 1 = 0, 0 = -4l + 2b - 20 for l. -4 Solve -u - 8 - 6 = -5p, -5u - 2p + 11 = 0 for u. 1 Solve -5k - 8t + 32 = -12t, 0 = -4k - 2t + 10 for k. 4 Solve -12h - 4 = -11h + 4a, -4a = 0 for h. -4 Solve 0 = -a - 2g - 16, 3g - 5 + 28 = -a for a. -2 Solve -3p + 22 = -4k, 106k = -5p + 111k + 30 for p. 2 Solve 3u = 5s + 12, -u + 5 = 15s - 17s for u. -1 Solve -5 + 16 = -3g + 2i, 0 = g - 5i + 8 for g. -3 Solve 0 = 7k - 2k - 5p - 25, -k - p = 1 for k. 2 Solve 11q - 55 = 2z + 6q, -17 = -2z - 3q for z. -5 Solve 0 = -h + 3i + 7 - 0, -h - 5i - 25 = 0 for h. -5 Solve 167g - 162g = -m - 30, -35 = 5m + 2g for m. -5 Solve 5 = -m + 27h - 29h, 4m + 4h + 20 = 0 for m. -5 Solve -2s - 3h + 10 = 0, 7 = -5s + 2s + h for s. -1 Solve 4d = i + 26 - 5, -5d + 3i + 35 = 0 for d. 4 Solve 2b - 165j - 14 = -160j, -b + j = -1 for b. -3 Solve 5p - 7 = -2r, 2p - 5r = 27 - 1 for p. 3 Solve -2u - 10 = -z, -u - 6z = -2z + 5 for u. -5 Solve 0 = 4g + k + 192 - 189, -2k = -2g + 6 for g. 0 Solve 5t = -5q, -2t - 20q = -19q + 2 for t. -2 Solve -4g + 12 = 0, 20g - 8 = 5j + 19g for j. -1 Solve 3z + 4q + 594 - 599 = 0, 0 = z - 4q - 7 for z. 3 Solve -3z + 12 = 2c, 5c = 5z + 118 - 63 for z. -2 Solve -3y + 3 = 3f, -f = -2f + 5y + 25 for f. 5 Solve 3a = 3b, 4a - b - 2b + 2 = 0 for a. -2 Solve 5r + 5 = 3f, 2f - 26r = -23r + 3 for f. 0 Solve 16h = 12h + 5d - 27, 4h + 2d = -6 for h. -3 Solve -5s - 17 = -4c, -14 = 5s - c - 2c for s. -1 Solve -2d + 13 = -6d - k, 0 = 5k - 15 for d. -4 Solve 24q = -u + 20q - 1, 0 = -2u + q - 2 for u. -1 Solve 5b - v = b + 18, -15 = -5b + 5v for b. 5 Solve -3s - 18 = -3m, -21 = 2m - 3m + 4s for m. 1 Solve -5b + y - 24 = 0, -52b + 56b + 28 = 3y for b. -4 Solve 2k - 434v = -430v - 8, -2k - 4v = 0 for k. -2 Solve 3o - 14 = -d, -3o = -d - 2o - 2 for d. 2 Solve -3v = -5y + 5 - 0, 3y = 4v - 8 for v. 5 Solve -5a - 15 = -2d, -17a + 5d - 12 = -13a for a. -3 Solve 3 = -3s, 3s = 82o - 79o - 18 for o. 5 Solve -5k + 10 = 0, 3k + 16 = 4h + 6 for h. 4 Solve -4u = l - 13, 2l + 2u - 63 = -55 for l. 1 Solve 16 = 5c - 2d, 0 = 100c - 98c - 3d - 2 for c. 4 Solve 12 - 1 = -4w + l, -4w + 3l = 1 for w. -4 Solve -4h = -4d - 0h + 24, -5d + 2h + 24 = 0 for d. 4 Solve w = 5i - 12 - 11, 5w = -4i + 30 for i. 5 Solve 16h + 2c = 19h - 14, 3h - 4c = 16 for h. 4 Solve 5m = 4v + 1, 18v - 23v + 7 = 2m for m. 1 Solve g + 14 = 4m - 4, -5g - 48 = m for g. -10 Solve 3l - d - 5 = 2, 0 = -l + 2d + 4 for l. 2 Solve 4l - 3c = 1, 4l + c - 16 = 5 for l. 4 Solve 4k + 5h = 30, k - 13 = 4h - 16 for k. 5 Solve 4k = 5v + 5, -3v - 4k = 2v + 5 for v. -1 Solve -2b + 3v = 22, -3v - 8 = -5b - 45 for b. -5 Solve -4f - 2t = -3f - 8, 4f + 2t = 20 for f. 4 Solve 3r = 4j + 6, -4r - 14 = -j + 3j for r. -2 Solve t - 5g = 7, 4 = 3t - 3g - 5 for t. 2 Solve 0h + 3 = h - o, 4h + 2o - 12 = 0 for h. 3 Solve -3a + m + 0m - 8 = 0, 3m - 15 = 0 for a. -1 Solve z + 3 = -2u - 2z, -3z + 6 = 5u for u. 3 Solve -11j - o = -8j + 16, 2j = -4o - 24 for j. -4 Solve -3d = -5g - 12 + 29, -d - g - 3 = 0 for d. -4 Solve -13 = h - 4c, -2c = -10h + 12h - 4 for h. -1 Solve 30 = -3w - 5q, -24w + 2q + 21 = -27w for w. -5 Solve -2v + 3v + 9 = b, -b - 4v = 11 for b. 5 Solve	{ "pile_set_name": "DM Mathematics" }
c) = -2c3 + 19c*2 + 8c + 23. Let p be m(10). Let w(v) = v + 9 - 11vp - 25 + v2 + 17. What is w(a)? 12 Let i(d) = -46d - 370. Let x = -6319 + 6311. Determine i(x). -2 Let y = -8 - -17. Let f(h) = -4h2 - 2h - 5. Let k(z) = 21z2 + z + 32. Let w(s) = -5f(s) - k(s). Give w(y). -7 Let w(i) be the second derivative of i*3/6 - 13i*2/2 + 242i. Determine w(-10). -23 Suppose -22t = -5t - 3213. Let m(d) = -92 + t - 91 + 2d. What is m(9)? 24 Let h(a) = -17a - 83. Let c(o) = -o*2 - o + 23. Let z(n) = -3c(n) - h(n). Determine z(-6). 2 Let t = 726 + -724. Let n(p) be the second derivative of -23p - 5/2p*t + 1/12p*4 - 4/3p*3 + 0. Give n(5). -20 Let h(m) = -63m - 12. Let d(a) = -110a - 22. Let i(v) = 4d(v) - 7h(v). Calculate i(1). -3 Let r(h) = 0 + 2h3 - h2 + 4 - 3h3. Suppose 0 = -6y - 8 + 32. Suppose k + 4d = 6d + y, 3k - 2 = d. Calculate r(k). 4 Suppose 0 = -16z + 10z + 18. Suppose 2h + zc + 21 = 5h, 2h - 5c = 26. Let a(k) = 2k - 4. Calculate a(h). 2 Let v(s) = s3 + 9s*2 - 3s + 12. Let a(b) = 105b + 936. Let d be a(-9). What is v(d)? 39 Let v(q) = -q2 - 10q - 9. Let g(h) = h*3 + 42h*2 + 212h - 27. Let i be g(-6). Calculate v(i). 12 Let h(i) = -10i2 + 103i - 50. Let q(l) = 6l2 - 68l + 35. Let p(o) = 5h(o) + 8q(o). Give p(-15). 15 Let b(n) = -n*2 - n - 1. Let l(m) = 6m*2 + 2m + 2. Let f(z) = 3b(z) + l(z). Let u = 24 + -22. Suppose 0 = uj + 2t + 2t - 4, 6 = -4j - t. Give f(j). 13 Suppose -2s + 2j = -20, j - 3 = -3s + 3. Let w(a) = a*2 - 2a - 14. What is w(s)? -6 Let v(c) = 25c - 4. Let q(t) = 13t - 2. Suppose -6a + 2 = -34. Let p(g) = av(g) - 11q(g). Determine p(3). 19 Let x = 700 + -698. Let t(i) = 0i - 5i2 - 2i - 3 + 9 - x + 4i2. Give t(-5). -11 Let g(z) = 365z*2 - 2297 - 12z + 2291 - 368z2. Determine g(-6). -42 Let s(r) = -r + 9. Let t(m) = m3 + 3m*2 - 7m + 3. Let q be t(2). Suppose -5j + 25 = -2h, -5h + qh = 0. Determine s(j). 4 Let k be (-336)/(-180) + (-4)/(-30). Let r(y) = -3y - 19 + 8 - 2y*k + 11. Calculate r(-3). -9 Let o(b) = 9b - 161. Let v be o(18). Let w(x) = 0x - 5x + 2x - v - 5x. Determine w(1). -9 Let s(b) = -13b - 2. Let z(y) = -53y + 11. Let h(n) = 7s(n) - z(n). What is h(-1)? 13 Let r(z) = -105z*2 - 118z*2 + 222z*2 + 7z + 6z + 19. Suppose -46 = -2s - 20. Determine r(s). 19 Let q(m) = -8m - 143. Let x = -6633 + 6614. What is q(x)? 9 Let h(a) be the first derivative of -a3/3 + 3a*2 + 2a + 6444. What is h(2)? 10 Let z(g) = -g*2 - g + 12. Suppose -22 = -3v + 6y - 2y, -4y - 16 = 0. Let j(o) = 6 + o3 - vo*2 - 4 - 1. Let w be j(1). What is z(w)? 12 Let j(k) = 5 - k + 2 + 2k. Let b(r) = -2r - 40. Let n be b(-5). Let g be -4n/(-12)16/20. Determine j(g). -1 Let t(b) be the third derivative of 29b*4/24 + 97b*3/3 - 281b*2 + 7. Determine t(-7). -9 Suppose 2t + 8 = 4l, 0t - 18 = -4l - 3t. Let k(j) be the first derivative of j*3 + 4j + 0j2 - 1/4j4 - 16. What is k(l)? 4 Let w(l) be the second derivative of l6/180 - 3l5/40 + 16l4 + l - 114. Let r(s) be the third derivative of w(s). Determine r(7). 19 Let b(j) = j3 + 2j2 - 2j + 2. Suppose -4t + 91 = 11. Let x(k) = 19k - 378. Let s be x(t). Calculate b(s). 14 Let k(f) = -12f2 + 28f + 15. Let d(m) = -7m2 + 16m + 8. Let u(s) = 7d(s) - 4k(s). Calculate u(-3). -13 Let q = 42 - 35. Let y be -4 + 2 + (-3)/((-3)/q). Suppose 0 = 5r + 3t - 12, 2r = -2t + y - 1. Let m(z) = -z*2 + 5z - 3. Determine m(r). 3 Let l(r) be the first derivative of r*3 - 10r*2 + 18r - 3895. Give l(7). 25 Let m(x) be the second derivative of -x*3/3 + 11x*2/2 + 2x. Let s be (-4616)/(-48) - 4/24. Let k = 104 - s. What is m(k)? -5 Suppose x + 4 = 0, 205x + 8 = -2r + 203x. Let p(t) = -t3 + t2 - t + 13. Determine p(r). 13 Let r = -101 - -88. Let h(d) = d2 + 15d + 28. Let v be h(r). Let p(l) = -l*v + 0 - 4l - 5l + 10 + 2l. Calculate p(-9). -8 Let p(r) = 9r2 - 4r + 1. Let l be (4 + 2)(-182)/(-3). Let h = l - 363. What is p(h)? 6 Let w(m) = 2m*2 + 10m - 18. Suppose -6u + v - 29 = -2u, -u = -3v + 21. Let y be w(u). Let c(b) = 1 - 2b*2 - 7b + 11 - 4. Determine c(y). -22 Suppose -3r - 8 - 4 = 0. Suppose 2x - 22 = -4p, 5x + 2p = x + 74. Let b(d) = -56 + x + 14 + 5d + 16. Calculate b(r). -25 Let m(l) = 36 - l*2 - 37 + 2l + 2l + l. Let i be m(3). Let u(g) be the third derivative of 5g4/24 - g3/2 - 70g2. Calculate u(i). 22 Let n(w) = -3 - 12w + 5w + 5w. Let q be (-585)/(-65) - (-52)/(-4). What is n(q)? 5 Suppose -91b + 69 = -3o - 96b, -5b - 30 = 0. Let w(p) = 0p + 5 + p + 6. What is w(o)? -2 Let q be (-6)/(-27) + 200/72 + 6. Let x(d) = 4d - 40. Determine x(q). -4 Suppose 0 = -2g - 7 + 15. Suppose 1 = 3s + g. Let c(t) be the third derivative of t4/4 - t3/6 + 234t2. Calculate c(s). -7 Suppose 0 = -2q - 3q + 25. Let d be 9/q - (-2)/10. Let m(z) = -13z + 6z + 8z + d + 7. Calculate m(-8). 1 Let p(o) be the second derivative of 19o5/120 - o4/24 - 7o*3/3 - 3o*2/2 + 3o + 2. Let b(i) be the second derivative of p(i). What is b(1)? 18 Let t be (2 + 1)/(18/12). Let o(w) = 6 - 2 + 282w - tw2 + w3 - 287w. What is o(3)? -2 Let y(h) be the third derivative of -2h*5/15 + 17h*4/24 + 7h*3/6 + 27h*2 + 2h. Let f(q) = -4q2 + 7q + 3. Let w(b) = 7f(b) - 3y(b). What is w(2)? -20 Let f(t) = -2t3 - 6t2 - t + 2. Let k be (-90)/21 + 8/28. Calculate f(k). 38 Let m(f) = -f2 + 19f - 13. Let v be m(13). Let s(a) = 3a*3 + 61 - v + 4a*2 - 6a + a - 2a3. Let z be 8(-2)/4 - 1. Give s(z). -4 Let b(i) = -i*3 - 6i*2 + 9i + 10. Let x(r) be the first derivative of -r3/3 - r2/2 - 10r + 4. Let k be x(0). Let n = 3 + k. Give b(n). -4 Let w(u) = 5u*3 + 102u*2 + u + 6. Let r(s) = 14s*3 + 290s*2 + 3s + 19. Let q(m) = 6r(m) - 17w(m). Determine q(7). -30 Suppose -16k - 39 = -13k + 3w, w = -5k - 61. Let g(c) = -c*3 - 12c*2 + 2c + 3. Give g(k). -21 Suppose 25y + 4335 = -1140. Let i = y + 208. Let g(m) = -m3 - 11m*2 + 7. Determine g(i). 7 Let f(t) = 5t + 2t - 46 + 55 - 2t - 22. Determine f(2). -3 Let x(h) = 402 + 8h + 16h - 478 + 16h - 2h*2. Give x(18). -4 Let i(u) = u + 3. Suppose -4d = -9d + 120. Let r be 217/21 + 6/9. Suppose -rq + 7q + d = 0. What is i(q)? 9 Let q(m) be the second derivative of -7m + 0m2 + 0 - 2/3m*3. Let p(y) = -y - 1. Let u(j) = -3p(j) + q(j). Determine u(-3). 6 Let y(a) = a*3 + 2a*2 - a + 15. Let t = 7433 + -7438. What is y(t)? -55 Let c(x) = 7 + 125x + x*3 - 56x - 65x. Let n be c(0). Let j(g) = g2 - 8g + 7. What is j(n)? 0 Suppose 10 = -5b - j + 33, -20 = -2b - 4j. Let c be -4 + b - 35/5. Let q(p) = -p3 - 6p*2 + 8p - 1. Determine q(c). -8 Let b(a) = a - 6. Let d be b(6). Let o(t) = -3t + t + dt. Suppose -1163v + 580v + 576v = -35. Calculate o(v). -10 Let j be 9/(-18) - (-88)/16. Suppose 0 = 3f - 14 - 1, -f = -2c - 5. Suppose jz + 2z = c. Let b(u) = -u - 9. Calculate b(z). -9 Let g be (-6)/(-66) + (-224)/(-77). Let x(y) = -3y + 39. Let i(o) = -2o + 21. Let h(r) = gx(r) - 5i(r). What is h(-8)? 4 Let r(k) = -8k - 34. Let o be 2 + -1 + 2-3. Let n be r(o). Let c(x) = x2 - 6 - 4x + 15 + 0x2 - 2x. Calculate c(n). 9 Let c(m) be the third derivative of -m6/120 + m5/15 - m*4/12 + 2m*2 - 702. Give c(1). 1 Suppose -2s = -4j - 140, -4j - 148 = -0s + 2s. Let u = j + 50. Let t = u + -13. Let a(q) = 2q2 + q - 1. What is a(t)? 2 Let g(v) = -65v3 + v2 - v. Suppose 5a = -24744 + 24739. What is g(a)? 67 Let c = -101 + 104. Let q(n) = 9n*2 + 0n + 50 + 66 - 109 - 9n - nc. Calculate q(8). -1 Let m(h) = 5h*2 + 4h + 7. Let l(b) = 27b2 + 22b + 38. Let g(q) = -2l(q) + 11m(q). What is g(1)? 2 Let s = -3 + 11. Suppose 6q + s = -16. Let t(l) = l2 + 5l - 5. Give t(q). -9 Let s(g) = 85g3 + 15g*2 - 44g - 41g3 + 13 - 45g*3. Determine s(10). 73 Let n(a) = -3a*2 - 10a + 6. Let w(v) = 4v2 + 11v - 7. Let c(y) = -5n(y) - 4w(y). Let r = 960 - 845. Suppose -10x = -33x + r. What is c(x)? 3 Let c = 252 + -247. Suppose -5p - c + 10 = 0. Let y(w) = -3w. Calculate y(p). -3 Let u(g) be the third derivative of -1/60g5 + 1/24g*4 + 4/3g**3	{ "pile_set_name": "DM Mathematics" }
2). Solve -to + 0o = s for o. 0 Suppose 0 = y - 14 - 1. Solve y = 4x - 1 for x. 4 Let t(q) be the second derivative of q3/6 - 2q*2 + 2q. Let n be t(2). Let r be (-4(n - -1))/2. Solve -o - 5 = -r for o. -3 Let z be 87/27 + 8/(-36). Let x(y) = -y3 - y2 - 2y. Let o be x(-3). Suppose -o = -5w - p + 5p, -4w + 12 = -5p. Solve -w = r + zr for r. -2 Let y(d) = -d - 1. Let q be y(-5). Let p = -5 + 14. Solve u + p - q = 0 for u. -5 Let g be (-8)/(-1) - 7/(28/(-12)). Solve -31 = 4o - g for o. -5 Suppose -4v - v = 0. Suppose z = -vz + 34. Suppose -z - 6 = -5k. Solve -c = c + k for c. -4 Let p be (-3 - 0)/(-6)-22. Let l = p - -18. Solve -2k - 3 = -l for k. 2 Let r = 11 + -19. Let f = -8 - r. Solve fn - 4 = -n for n. 4 Suppose 2n - 16 = -5m, 0 = m + 3m - 3n + 1. Suppose 0 = 2d - m. Suppose -g + d = -2. Solve -4 - 8 = ga for a. -4 Let x(p) = -2p2 + 2p + 2. Let v be x(2). Let s be (-1)/(v/14) + 1. Solve -1 - s = -3g for g. 3 Let d = 7 - 7. Suppose 7 = -5v + 37. Solve -3x = -d - v for x. 2 Suppose -u + 6u - 25 = 0. Suppose m - u = -1. Solve mi - 3i = 3 for i. 3 Suppose 4o = 4, 5o - 19 = -5q + o. Solve -4n + 4 = -qn for n. 4 Let h be 2/6-3-5. Solve h = 5y + 10 for y. -1 Let y be 0 + -1 + (-7)/((-28)/8). Solve 2a - 5 = -y for a. 2 Let f = 7 - 9. Let n be 0(-1 - 0) - f. Solve -nt + 4t - 10 = 0 for t. 5 Let w(d) = d*2 - 4d + 3. Let o be w(4). Suppose -r + 8 = or. Solve -ru + 7u = -15 for u. -3 Suppose t - 6t = 0. Let k(x) = x*3 + 2x*2 - x + 2. Let f be k(-2). Suppose -fm = -tm - 12. Solve -4h + 3h = -m for h. 3 Suppose -2c + 14 - 2 = 0. Let p be (2 - -2) + (1 - 1). Solve p = -2z + c for z. 1 Let p(l) = -l - 1. Let f be p(-3). Suppose -2u - 2 = -4u + b, 0 = -5u + b + 2. Suppose -2i + 3 = g + i, u = 2g + 3i - 6. Solve -gz - fz + 15 = 0 for z. 3 Suppose -14 - 25 = -i. Suppose 5w - i = -0q - q, -2w = q - 18. Solve wm = 3m + 4 for m. 1 Suppose 0 = 3g - g. Suppose -3i - 4 = -5s - gi, 4i + 10 = 2s. Let k = s + 1. Solve k = -4j - j - 10 for j. -2 Suppose -k = k - 2c - 4, 2c = k. Suppose -4b + 3d = -2d - 15, -12 = 5b + kd. Suppose -q + 3 = -bq. Solve h = qh for h. 0 Suppose 5 = -5x + 10. Solve v - x = -2 for v. -1 Suppose -3m - 1 = -0a - a, -56 = -5a - 2m. Solve 5t + 0 + a = 0 for t. -2 Suppose -x - 4x + 15 = 0, s + 5x - 24 = 0. Let m be (24/s)/((-1)/(-18)). Suppose 6w - m = 3w. Solve 0 + w = 4p for p. 4 Suppose 4v = -v + 10. Let l be 0 + v - -1 - 1. Solve -l = s - 0s for s. -2 Suppose 0 = -m - 12. Let u be -1(-1 + (5 - 1)). Let d be u2/m0. Solve d = 2c - 1 - 1 for c. 1 Suppose 3w = -2 + 14. Suppose w = j - 9. Let l(z) = -z*3 + 14z*2 - 12z - 11. Let x be l(j). Solve -2m - xm + 8 = 0 for m. 2 Let u = -34 - -34. Solve h = 1 - u for h. 1 Suppose -o - p + 0 + 4 = 0, 3p - 7 = 2o. Let d(c) = c + 0 - o + 11. Let v be d(-8). Solve 0g = vg for g. 0 Let f be (-5)/(1 - 3 - -3). Let y = -5 - f. Let j = 8 - 6. Solve -m - jm = y for m. 0 Let x(u) = -u - 3. Let o be x(-5). Solve on = -2n for n. 0 Let m = -4 + 6. Solve -ms = -2 - 0 for s. 1 Let w(o) = -2o2 + 4o + 3. Let c(i) = i*2 - i - 1. Let a(l) = 3c(l) + w(l). Let b be a(-4). Solve -d = 2d + b for d. -4 Let s(i) = -i2 - 9i - 6. Let o be s(-6). Let l be 10/4o/10. Solve -4 = u - l for u. -1 Let i(j) = 3j. Let y be i(1). Suppose -l + 56 = yl. Solve -3f - l = -2 for f. -4 Let q be 11/((-2)/(8/(-2))). Suppose -3n + q + 2 = -4h, 4n - 3h - 25 = 0. Solve 10 = -nr + 2r for r. -5 Let v(y) = -y - 4. Let a be v(-6). Solve -au = 3u for u. 0 Let t = 0 + 3. Let q = 3 - t. Solve q = 4n - 5 - 7 for n. 3 Let z(m) = -m3 - m2 - 5. Let t be z(0). Let k(x) = 0x - x + 6x2 + x3 + 5x - 5 + 0x. Let g be k(t). Solve -7j + 2j - 25 = g for j. -5 Let r = 135 + -132. Solve 0 = -l - rl - 8 for l. -2 Let v = 3 - 1. Let l = -4 - 2. Let o = l - -11. Solve vd - od + 15 = 0 for d. 5 Let m = -1 - -5. Let y = 12 + -8. Let l be y - (0 - (1 - 0)). Solve lr + m = -1 for r. -1 Let w be 12(-1)/(-4 + 0). Solve -7 = -wa - 1 for a. 2 Let p be (4 + -10)(-1)/2. Suppose 3y + 6n - 3n - 3 = 0, -3n + p = 5y. Solve t + 1 - 2 = y for t. 1 Let y(u) = 2u*2 + 9u - 6. Let t be y(-6). Let d be -2 + 4(-1 - -2). Solve l + dl - t = 0 for l. 4 Suppose 5j + 0j = 0. Suppose 0n + 40 = 5n + 4k, -3n + 4k - 8 = j. Solve nu + 20 = -0u for u. -5 Suppose z + 2 - 3 = -2y, -3z = -4y - 13. Solve zd + 2 = -1 for d. -1 Let u = -52 + 77. Solve 6d = d + u for d. 5 Let z(o) = 2o2 + 6o - 15. Let v(m) = -3m2 - 9m + 22. Let n(j) = -5v(j) - 7z(j). Suppose 2g + 3g + 35 = 0. Let f be n(g). Solve -4b - f = -3 for b. -5 Suppose 2t - 3t = -5. Suppose 3w = 5w. Solve -i = -wi + t for i. -5 Suppose m - 2m + 2 = 0. Let l = 2 - 2. Let i = l + 0. Solve i = -my - y for y. 0 Suppose 3c - 24 = 51. Solve 2r = -3r + c for r. 5 Let c(k) = k3 + 5k*2 + 2k + 4. Let b be c(-5). Let n = b - -10. Solve 20 = nv + v for v. 4 Let a(b) = 6b*2 + b + 1. Let o be a(-1). Let r = 23 - 23. Solve r = 2f + f - o for f. 2 Let g be (-119)/(-42) + (-2)/(-12). Solve 2o = -go for o. 0 Let c be (10/4)/((-2)/(-4)). Suppose 0 = -5t + 20, 0 = -0w + cw - 2t - 12. Solve wy + 7 = -1 for y. -2 Let l be (-4)/14 + 20/70. Solve y + 0y = l for y. 0 Let g be 3 + (2 - (0 + 3)). Suppose l = -gf + 3, -4f = l - 7 - 4. Suppose -4o + 52 = -fi, o + 5i + 1 = 2. Solve -6r - 15 = -or for r. 3 Let q = 2 + -2. Suppose 5n - 5 = 5. Solve ng + q = -6 for g. -3 Let u be (-32)/24(-4)/((-32)/(-102)). Solve 20 = -13o + uo for o. 5 Suppose -4x = k - 2, -5x + 0 = -5k + 10. Suppose 0 = 2o - xo - 26. Let v be 4/14 - 38/(-14). Solve -vy + 2 = -o for y. 5 Let d(g) = g*3 - 6g*2 - 6g - 7. Let c be d(7). Suppose c = s - 3r + 5r, 3s - r - 7 = 0. Solve -6 + s = -w for w. 4 Let i = -109 + 113. Solve is - 2s + 8 = 0 for s. -4 Let r = -8 + 19. Let w = 15 - r. Solve 4t = 2t - w for t. -2 Suppose -10 = -i + a, -4i - a = -0a - 65. Solve -5 = 4t + i for t. -5 Let t be (-4)/6 - 24/(-9). Suppose -3s + 9 = 4w, 0 = s - w + 2w - t. Let y be 1/s(-4 + -1). Solve -yr = 24 - 4 for r. -4 Let n(l) = -5l - 1. Let u(z) = -14z - 2. Let q(p) = -17n(p) + 6u(p). Let h be q(7). Solve 0s = 4s + h for s. -3 Let t(p) = p3 - 8p*2 - 8p + 3. Let m be t(9). Let f(o) = o - 15. Let v be f(m). Let k be 14 - 9/v. Solve -ki - 8 = -3i for i. -2 Suppose 5 = -5v + 55. Solve v + 5 = -5h for h. -3 Suppose 0 = 2i - 0 - 4. Suppose 5x + o = 14, -x - 14 = -4x - io. Suppose -2b - 6 = -4b. Solve -xm - b + 5 = 0 for m. 1 Let k(b) = -b - 4. Let q be k(-6). Suppose -4s - i + 8 = 0, 4s - 2s - qi - 4 = 0. Solve -n - 2 = -sn for n. 2 Let k(g) be the first derivative of 2g*2 + 4g - 1. Let r(l) = 9l + 9. Let d(v) = -14k(v) + 6r(v). Let a be d(-3). Solve 5y = ay for y. 0 Suppose 0 = -5q - 2 + 7. Let z be q/2 - 6/(-4). Suppose 0 = 5s - s - 8. Solve -n - s = z for n. -4 Suppose 2o - 2 = -0o. Suppose 6x - 20 = -5b + x, 4b - 4x - 24 = 0. Let d be (o - 1)/(b + -3). Solve -2 = 2v - dv for v. -1 Let s = 9 + -7. Let p be s + 4/63. Let x(l) = -l*3 + 9l*2 - 7l - 2. Let o be x(8). Solve py - 6 = o for y. 3 Let b be 90/70 + (-2)/7. Let n be 4 + b + (1 - 1). Solve -3k + 8k - n = 0 for k. 1 Let h be ((-12)/10)/(3/(-20)). Suppose 2y + 0y - h = 0. Suppose yo = o + 15. Solve -c - o + 1 = 0 for c. -4 Suppose 1 = -2s + 5q, -4q + 0 = -3s + 2. Suppose -sy + 3 = o, 2y - 12 = y - 4o. Solve y = 2i - 6 for i. 3 Suppose -2w = -3w + 3. Suppose -4z = 5t - 19, wt - 6 - 8 = -5z. Solve ts = 8 + 1 for s. 3 Suppose 4w - 4k - 28 = 0, -40 = -5w + 2k - 14. Solve -g = g + w for g. -2 Suppose 0g - 5g = 0. Suppose g = 3h + 1 - 13. Solve -hb = b for b. 0 Let l be 15/5 - (2 - -1). Solve l = 2f - 0f + 8 for f. -4 Let p be 0/(-1 + 4 + -2). Solve -u = -pu for u. 0 Let l(m) = m. Let f be (-2)/16/(-4). Let j be l(f). Suppose -2o + 0o + 16 = 0. Solve 0 = jr - o - 1 for r. 3 Suppose 8l + 46 = 10l. Solve 0 = -h - 18 + l for h. 5 Let n = 38 + -33. Solve 3b = -2b + n for b. 1 Suppose -3j = 4l - 6 - 9, -j - 3l = -5. Suppose -j = -2y + 3. Solve y = -0h + 2h for h. 2 Suppose 2u - 3 + 5 = 0, 4u = -4v + 8. Let d(f) = f3 + 6f**2. Let w	{ "pile_set_name": "DM Mathematics" }
der when l is divided by 3. 0 What is the remainder when 28 is divided by 70/5 - 0 - 6? 4 Let s(z) = -z*3 + 12z*2 - 21z + 14. Let n be s(10). Suppose 5m + 2a - 79 = 0, 2a - 74 = -nm + 4a. What is the remainder when 84 is divided by m? 16 Calculate the remainder when 73(2 - 4)/(-10 + 8) is divided by 31. 11 Let d(p) = -61p + 12. What is the remainder when 134 is divided by d(-1)? 61 Suppose 2y - 4y = 4w - 16, -4y + 12 = -2w. Suppose -j + 3j + yx = 78, 144 = 4j + 4x. What is the remainder when j is divided by 9? 6 Suppose 0 = 16t - 25t + 54. Calculate the remainder when 255 is divided by t. 3 Suppose 6s = -17 + 167. What is the remainder when 99 is divided by s? 24 Calculate the remainder when 31 is divided by (0 - -31) + (-54 - -62). 9 Calculate the remainder when 39 is divided by 2/(-2)(7 - 13) - 1. 4 Suppose -38w + 4935 = 9w. What is the remainder when 221 is divided by w? 11 Suppose u - 4o + 6o - 35 = 0, o = -2. Calculate the remainder when u is divided by 7. 4 What is the remainder when (15/2 + -6)28 is divided by 41? 1 Let w(o) be the third derivative of o*5/20 - 11o*4/12 + 5o*3/6 + 29o2. What is the remainder when w(-4) is divided by 48? 45 Let f = -5 - -43. Let d(x) = x2 + 7x + 16. Calculate the remainder when f is divided by d(-6). 8 Let b(i) = i3 + 22i*2 + 34i - 22. What is the remainder when b(-20) is divided by 17? 13 Let f(g) be the third derivative of g5/30 - g4/8 + 2g3 - 6g*2 + 3. Calculate the remainder when f(5) is divided by 28. 19 Let l be 249 - (-3 + -3 + 4). Let a = l - 157. Suppose -8b = -6b - a. Calculate the remainder when b is divided by 17. 13 Suppose -40 = -14c - 12. Suppose -ci + 16 = 3j - 16, -2j = 8. What is the remainder when i is divided by 8? 6 Suppose 17p = 19p - 446. What is the remainder when p is divided by 57? 52 Let v = 1 - -3. Suppose -vw - 4h = -464, 5h + 49 = 5w - 521. Let n = w + -44. What is the remainder when n is divided by 18? 17 Let b(p) = -p3 + 4p*2 + 2p - 4. Let c be b(3). Let d be (-3)/(2/6 - (-4 + 4)). Let x = d + c. What is the remainder when x is divided by 2? 0 Suppose 38 = -t + 15t - 46. Let q(r) = r3 + 5r*2 - 8r - 3. What is the remainder when q(-6) is divided by t? 3 Calculate the remainder when ((-18)/21)/(42/(-8820)) is divided by 14. 12 Suppose 3j + 392 = 437. Let s = -90 - -176. What is the remainder when s is divided by j? 11 Let f(r) = 41r + 182. Calculate the remainder when f(-2) is divided by 53. 47 Suppose -3n + 183 = -3s, -42 - 202 = -4n + 3s. Let j = n - 103. What is the remainder when (110/(-6))/(14/j) is divided by 14? 13 Suppose 4s + 4a - 36 = 0, 3s - 3 - 18 = -5a. Calculate the remainder when 38 is divided by s. 2 Suppose 7z - 10 - 277 = 0. Let h(o) = 11o. Calculate the remainder when z is divided by h(2). 19 Let z(w) = 64w - 38. Calculate the remainder when z(3) is divided by 77. 0 Let x = -28 - -316. Suppose 5b - 4g = 514, -3b - g = -x - 34. Calculate the remainder when b is divided by 22. 18 Let r(v) = -v*3 + 5v*2 + 5v - 1. What is the remainder when r(5) is divided by (-696)/5801-15? 6 Suppose -46m - 4x - 169 = -49m, 3x + 3 = 0. What is the remainder when m is divided by 29? 26 Let z = -11 + 11. Let f = 2 + z. Suppose -fx + 80 = -3v, 3x - v = 2v + 117. Calculate the remainder when x is divided by 10. 7 Let u be -2 + 3 + 3/(-3). Suppose -5p + 12 + 13 = u. Suppose -3o - 3h + 2h + 136 = 0, po - 234 = 2h. Calculate the remainder when o is divided by 12. 10 Suppose 8j + 120 = 3j. Let i be ((-1)/(-1))/((119/126)/(-17)). Calculate the remainder when 73/3 - j/i is divided by 5. 3 Let m(w) = 6w2 + 13w + 25. What is the remainder when m(-6) is divided by (-22)/(-8)12/1? 31 Let j = -452 + 895. What is the remainder when j is divided by 37? 36 Suppose -144 = -6m - 3m. Calculate the remainder when 79 is divided by m. 15 Let g(o) = 17o + 4. What is the remainder when g(7) is divided by (-64)/224 + 2192/14? 30 What is the remainder when 195 is divided by (-8)/10-69(-25)/(-30)? 11 Let j(a) = -10a*2 - 92a - 1. Calculate the remainder when j(-7) is divided by 22. 21 Let k be (3 + -85)2(-27)/12. Suppose -k = 7u - 16u. Suppose j + 3b + b = -1, 2b + 28 = 2j. What is the remainder when u is divided by j? 8 Suppose 3w - 59 = 40. Let l(b) = -b + 4. Suppose -5o - 16 = 9. What is the remainder when w is divided by l(o)? 6 Suppose 4b - 64 = 5f, -5b + 5f = 2f - 80. What is the remainder when 25 is divided by (21/12)/(4/b)? 4 Let o be -3 + 2 + 1 + 3. Suppose 0 = -2a + oa - 30. Let t = 58 - a. Calculate the remainder when t is divided by 15. 13 Let b = 126 - 89. Calculate the remainder when b is divided by (54)/(3 - 1). 7 Suppose 9f - 12f = -870. Suppose -5m + f = -5n, -5n = -0m + 4m - 196. Calculate the remainder when m is divided by 14. 12 Suppose -2h - 3h - 3w + 121 = 0, -4h - 4w + 100 = 0. What is the remainder when 152 is divided by h? 14 Let b(k) be the first derivative of -4k*3/3 - 3k*2/2 + 5k - 12. Let v be b(3). Calculate the remainder when (v/(-15))/(3/153) is divided by 23. 21 Let g be 4/24 + (-339)/(-18). Suppose -x + g = 7i - 2i, 4i = -2x + 20. Calculate the remainder when 11 is divided by x. 3 Let w(n) = -10n - 355. What is the remainder when w(-39) is divided by 18? 17 Suppose 5 = 4b + 3k, 2b - 40 = 4k - 10. What is the remainder when 179 is divided by b? 4 Let b = -47 - -31. What is the remainder when (-633)/(-7) + b/(-28) is divided by 23? 22 Suppose 71 = 3b - 5x - 4, -4b + 100 = -x. What is the remainder when b is divided by 55/3 + (-7)/21? 7 Let f be 4 - 1 - (-1 + 7). Let k be 2 - (-75)/(-2 - f). Let j = k + -32. Calculate the remainder when j is divided by 16. 13 Let q = -10 + 20. Let l = -3 + q. What is the remainder when 12 is divided by l? 5 Calculate the remainder when 164 is divided by 2 - (-4 + (-4 - -5)). 4 Let n(w) = -w + 11. Let y be n(9). Let r be y(21/(-2) - 1). Calculate the remainder when 2(r/(-2) + -3) is divided by 10. 7 Suppose 0 = k - 6k + 440. Suppose 4u = 6s - 2s + k, s = -5. Calculate the remainder when 64 is divided by u. 13 Suppose 76 = -a + 151. What is the remainder when a is divided by 7? 5 Let i(q) = -q*2 + 11q. Let w be i(8). Suppose u + 4s = 26, 4u - 3s = w + 4. What is the remainder when u is divided by 6? 4 Suppose 3a - 2a = 0. Let w = -285 + 289. Suppose -7f = -2f + wh - 361, 2f - 4h - 150 = a. Calculate the remainder when f is divided by 19. 16 Let i(t) = 2t2 + 5t - 7. Suppose 5f - o - 7 = f, -2f - 3o = 7. Suppose -2p = f - 41. What is the remainder when i(-6) is divided by p? 15 Suppose -192 = -2y - 6x, 3x = -3y - 2x + 300. Calculate the remainder when y is divided by 54. 51 Let u = 166 - 136. What is the remainder when 116 is divided by u? 26 Let i = -48 - -63. Suppose iw = 13w + 30. What is the remainder when 42 is divided by w? 12 Let u = 530 - 455. Let c = -19 + 35. What is the remainder when u is divided by c? 11 Suppose 2w + c = 13 + 10, -4w + 2c = -26. Calculate the remainder when 4 is divided by w/66/92. 0 Let r = -30 - -39. Let i = 39 + r. Suppose -51 = -3o - 0o. Calculate the remainder when i is divided by o. 14 Let r(a) = -a + 2a2 + 9 + 0a + 4a + 3a. Let l be r(-7). Suppose 5v - l + 15 = 0. Calculate the remainder when 37 is divided by v. 7 Let s(r) = 96r + 580. Calculate the remainder when s(3) is divided by 10. 8 Let h = -551 - -574. Calculate the remainder when h is divided by 9. 5 Let k(t) = -44t - 214. Suppose 0j + 2j - 20 = 0. What is the remainder when j is divided by k(-5)? 4 Let w = 279 + -263. What is the remainder when 78 is divided by w? 14 Suppose 4 = -o + 2b + 17, 3o - 84 = -3b. Let w = 15 + o. Calculate the remainder when w is divided by ((-15)/27)/(5/30)-6. 18 Suppose -3d - 2 = -8. Suppose 4i + b = 57, -2i + 21 = -3b + db. Let g = 13 + 37. What is the remainder when g is divided by i? 11 What is the remainder when -2 + 42/22 - (-15485)/209 is divided by (1 - 5)/2 - -21? 17 Let d(h) = h*2 - 8h. Let q be d(9). Let l = -5 + q. Suppose -lv + 32 = -16. What is the remainder when v is divided by 7? 5 Let t be -2 + 9 - (3 + -1). Suppose -th - 3f = -f - 410, -2f - 150 = -2*h. What is th	{ "pile_set_name": "DM Mathematics" }
is the remainder when o(-10) is divided by l? 3 Let c = -17 - -28. Let n = -4 - -7. Let w(g) = -g*3 + 5g*2 + 2g - 3. Calculate the remainder when w(n) is divided by c. 10 Suppose 0 = -5i + 19 + 6. Calculate the remainder when 18 is divided by i. 3 Let h(w) = w3 - 7w*2 + 7w + 1. Suppose a - 18 = -2a. Suppose 2v - 44 = -18. Calculate the remainder when v is divided by h(a). 6 Let x = -1 + 2. Suppose -2f = 2f. Suppose f = w + 2w - 5k + 4, -2w + k + 2 = 0. Calculate the remainder when w is divided by x. 0 Suppose 25 + 0 = 5l. Calculate the remainder when l is divided by ((-8)/1)/(1 + -3). 1 What is the remainder when 12 is divided by 17/5 + 3 + (-34)/10? 0 Suppose -5c - 5z = -265, 2c - 93 = 4z + 7. Suppose -2k = -42 - c. What is the remainder when k is divided by 12? 11 Suppose -5z - 20 = -0z. Calculate the remainder when 261/4 + z/16 is divided by 22. 21 Suppose -6n - 108 = -18n. Let i(k) = k2 + k + 25. What is the remainder when i(0) is divided by n? 7 Suppose 2w = 6w + 4. Let d be (-3)/(w6)-6. Calculate the remainder when d + (1 - -17) + -3 is divided by 7. 5 What is the remainder when 9 is divided by 6/(6(2 + 14/(-8)))? 1 Let p(w) = w*2 + 5w - 10. Let x be p(-7). Suppose xj = -4n + 32, -1 = 5n - 3j - 81. What is the remainder when n is divided by 4? 1 Suppose -3c = -70 + 1. Calculate the remainder when 66 is divided by c. 20 Let q(h) = h3 + 7h*2 - 21h - 7. Calculate the remainder when q(-9) is divided by 4. 0 Let o = -107 - -124. What is the remainder when 33 is divided by o? 16 Let q(z) = 11z - 12z - 5 + 132z3 + 4. Let d be q(-1). Calculate the remainder when (2/3)/((-2)/d) is divided by 15. 14 Suppose 0 = 2g - 14 + 74. Let n = 42 + g. Suppose -5i = 2m - 33 - 30, 4m = 2i + 138. Calculate the remainder when m is divided by n. 10 Let m = -5 - -23. Let k = m - 5. Calculate the remainder when 23 is divided by k. 10 Let n = 158 + -60. Let d = n - 58. Calculate the remainder when d is divided by (-355)/(-25) - 1/5. 12 Let a be (15 - 0) + 0/3. Let i = 11 - a. Calculate the remainder when 23 is divided by (i/6 - -2)9. 11 Let v be (-1)/(-2)-5-2. What is the remainder when 15 is divided by (6/v)/(2/10)? 3 Suppose 11 = -3r + 5d, 3r + 2d = -d + 21. Suppose -117 - r = -4x. Suppose 3g - g - x = 0. Calculate the remainder when g is divided by 8. 7 Let i(v) = 0 + 1 - v3 + 12v*3. Calculate the remainder when 45 is divided by i(1). 9 Suppose -14 = 3o - 62. Let y(g) = g*2 + 7g + 9. What is the remainder when o is divided by y(-7)? 7 Suppose -4m + i + 9 + 10 = 0, 0 = m + 3i - 8. Suppose -mb + 62 = -4b. What is the remainder when b is divided by 21? 20 Let a = -48 + 80. Calculate the remainder when a is divided by 11. 10 Let s = 1 - 0. Let k(l) = 43l. Let g = 0 - -15. Calculate the remainder when k(s) is divided by g. 13 Suppose 0 = -3i - 4f + 52, i - 27 + 3 = -3f. Let m(o) = 8o2 - 2o - 2. What is the remainder when m(-2) is divided by i? 10 Suppose -h - 44 = -5h. Calculate the remainder when 42 is divided by h. 9 What is the remainder when 24 is divided by ((-5)/15)/(43/(-42) - -1)? 10 Let v(x) = x3 + x2 + 5. Let m be v(0). Suppose mr - 18 = 12. Calculate the remainder when (-3)/(-27)3r is divided by 1. 0 Let g(n) = -n*2 + 7n - 10. Let y be g(5). Let d = 3 - y. Calculate the remainder when 9 is divided by d. 0 Let l be 42/10 + (-1)/5. Suppose -3 = b, lh + 4b - 66 - 86 = 0. Calculate the remainder when h is divided by 15. 11 Let f(d) = 6d - 5. Let p be f(-5). Suppose 4g = h - 0h - 52, 0 = -2g + 4. Let n = h + p. Calculate the remainder when n is divided by 14. 11 Let v = 112 + -64. What is the remainder when 141 is divided by v? 45 Let v = 118 - 51. Suppose 2t - v = -0t - k, 0 = k - 5. What is the remainder when t is divided by 8? 7 Let z(x) = -5x + 1. Let n(o) = -2o*2 + 21o + 14. Calculate the remainder when z(-2) is divided by n(11). 2 Suppose 0 = -5i - 3g + 166, 0i = i - 3g - 44. What is the remainder when (21/(-14))/(6/(-28)) is divided by 1/(-2) + i/10? 1 Let p = 2 + -2. Suppose pq - q + 3 = 0. Suppose -12 = 16z - 156. Calculate the remainder when z is divided by q. 0 Suppose 24t - 34t = -1450. What is the remainder when t is divided by 50? 45 Suppose 4n = 2n - 4. Let p = -4 - n. Let i = p + 6. Calculate the remainder when 6 is divided by i. 2 Suppose -3t + z + 238 = 0, -2 = 5z - 27. What is the remainder when t is divided by 21? 18 Suppose 2v = 7v + 5. Let j be ((-78)/9)/(v/3). Suppose o + j = 3o + 3q, 0 = -3o + q + 61. What is the remainder when o is divided by 10? 9 Let v(g) = 2g + 1. Suppose 175 = 7c - 2c. Calculate the remainder when c is divided by v(4). 8 Suppose -5j + 30 = -40. Let t(s) = -4s - 1. Let a be t(-1). What is the remainder when (4/a)/((-2)/(-81)) is divided by j? 12 Suppose 2m - 4 = 0, -5j - 200 = 5m - 0m. Calculate the remainder when 2/(-14) - 300/j is divided by 4. 3 Suppose 4p + 245 = 5c - p, 2c = 4p + 94. What is the remainder when c is divided by (26/4)/((-1)/(-2))? 12 Let g = 91 - -6. What is the remainder when g is divided by 25? 22 Let o(c) = -3c + 1. Let m be o(-1). Suppose 0 = -3a - 3d - 9, 4a - 8 = md + 12. What is the remainder when 2 is divided by a? 0 Suppose -5z + 4f - 7 = -54, -z = 4f + 5. What is the remainder when z is divided by 3? 1 Suppose 0 = s + 2c - 28, -4s + 5c + 47 + 13 = 0. Let p be (-2)/21/1. Calculate the remainder when s is divided by (-42)/(-4) + p/(-2). 9 Let k(l) = -l*2 + 8l - 4. Let x be k(7). Suppose -4z - 16 = -2r, -xz + 29 = 4r - 8z. What is the remainder when r is divided by 2? 0 Let z(c) = c3 + 5c*2 + 4c + 3. Let l be -1 - -1 - (-5 + 1). Let x = l + 0. What is the remainder when z(-2) is divided by x? 3 Let h(j) = -8j + 1. What is the remainder when 0 - ((-76 - 1) + 31) is divided by h(-3)? 24 Let n(i) = 46 - 16 - 17 - i. Calculate the remainder when n(7) is divided by 4. 2 Suppose -110y - 438 = -113y. What is the remainder when y is divided by 37? 35 Suppose 5o - 32 = 3o. What is the remainder when o is divided by (8/6)/((-8)/(-36))? 4 Let q = -5 - -29. Suppose i - 14 = 6. Let k = -7 + i. Calculate the remainder when q is divided by k. 11 Let f be (-157)/(2 + -1 + 0). Let b = -90 - f. Calculate the remainder when b is divided by 17. 16 Suppose 4n - 27 = -f, -8 = 5n - f - 44. Calculate the remainder when 60 is divided by n. 4 Let u(d) = d3 + d2 - 3d + 12. What is the remainder when 70 is divided by u(0)? 10 Let k be 2/10 + (-22)/10. Suppose -2l + 27 = -5c, -7l + 32 = -4l + c. What is the remainder when l is divided by (-192)/(-33) - k/11? 5 Suppose 80 = -105t + 109t. Calculate the remainder when 77 is divided by t. 17 Let r be ((-9)/(-36))/(2/24). Suppose 4x = -rt + 182, 3t - 172 = 3x - 2x. What is the remainder when t is divided by 20? 18 Let n(u) = -u*2 + 8u + 11. Let z be n(9). Suppose 2j - 164 = -zj. What is the remainder when j is divided by 14? 13 Suppose -u + 28 = 5l, 2u = 4l + u - 26. Suppose -2a + l = -10. Suppose -3y - a = -4y. Calculate the remainder when 22 is divided by y. 6 Suppose 0 = 11n - 2n - 45. What is the remainder when 24 is divided by n? 4 Let j(k) = 6k. What is the remainder when j(5) is divided by 4? 2 Let n be (-3 + 3)/(-2) - -255. Suppose 2x - n = 7x. Let c = 86 + x. Calculate the remainder when c is divided by 18. 17 Suppose o = 2o - 104. Let j = 147 - o. What is the remainder when j is divided by 22? 21 Suppose -3g + 98 = 4g. Let l = -76 - -116. What is the remainder when l is divided by g? 12 Let f = 4 + -1. Let s = f - -10. Suppose 4c + c = 185. Calculate the remainder when c is divided by s. 11 Let r = 624 - 63. Let m be (2/(-6))/((-1)/r). Let j = m - 122. What is the remainder when j is divided by 22? 21 Let b be 1 + -19 - (-5 + 8). Let g = b + 41. Calculate the remainder when g is divided by 7. 6 Suppose 5o - 70 = 4w, w = o - w - 20. Calculate the remainder when 25 is divided by o. 5 Let c = 28 - -11. Suppose 4q + 3 - c = 0. Let b = -25 - -42. What is the remainder when b is divided by q? 8 Suppose -32 = -3o + 4q, -q - q = 10. Suppose 0 = or - 4s - 21 - 67, 2r = 5s + 59. Suppose -49 = 4v - 5v. Calculate the remainder when v is divided by r. 15 Calculat	{ "pile_set_name": "DM Mathematics" }
Let k(z) = 2z3 + 22z*2 - 16z - 5. Let a(v) = -21v3 - 245v*2 + 175v + 56. What is 5a(d) + 56k(d)? 7d3 + 7d*2 - 21d Let v(f) = -21f - 7042. Let z(r) = -8r - 2349. What is -3v(a) + 8z(a)? -a + 2334 Let d = 10707 + -10703. Let u(c) = 7c - 8. Let v(x) = 8x - 8. Determine dv(g) - 5u(g). -3g + 8 Let v(d) = 10d + 173 - 182 + 11d. Let x(w) = 2 + w + 2w - 7w - w. Give 2v(f) + 9x(f). -3f Let k(s) = 17305s + 9. Let r(f) = 8652f + 4. Calculate 4k(t) - 9r(t). -8648t Let u(j) = -3j*3 - 2j*2 - 4j + 2. Suppose 55m - 57m = -2i + 6, 0 = -i + 4m + 21. Let k(z) = 3z3 + 3z*2 + 5z - 2. Give iu(g) - 2k(g). 3g3 + 2g - 2 Let o(p) = p*3 - 2p*2 + 24p + 8. Let k(i) = -i*3 + 2i*2 - 29i - 11. Determine 5k(z) + 6o(z). z*3 - 2z*2 - z - 7 Let s(v) be the second derivative of -v + 1/2v*2 + 0 - 1/6v*3. Let m(b) = -27b*2 + 4b + 55b2 - 26b*2 - 5. Give -m(t) - 6s(t). -2t2 + 2t - 1 Let v(i) = 1. Let z(k) = -k - 1. Suppose 133m + 360 = 223m. What is mv(d) + 6z(d)? -6d - 2 Let y(z) = -14z*3 - 6z*2 - 5z + 4. Let s(j) be the third derivative of 7j6/60 + 7j5/60 + j4/4 - 5j3/6 + j2 + 678j. Determine 5s(v) + 6y(v). -14v3 - v2 - 1 Let p(a) = -15a*2 + 4a. Let g(r) = -4r2 + r. Let d = 130 + -136. What is dp(y) + 22g(y)? 2y*2 - 2y Let p(o) = -4o + 20. Let f(q) be the third derivative of q4/8 - 13q*3/6 + 88q*2 + 2q + 1. What is -7f(d) - 5p(d)? -d - 9 Let r be (111/(-12))/((-8)/32). Let q = -15 - r. Let o = -46 - q. Let u(k) = -k + 1. Let p(d) = 4d - 6. Calculate ou(b) + p(b). -2b Let x(t) = 29t + 361. Let m(b) = 13b + 180. Calculate -9m(f) + 4x(f). -f - 176 Let u(b) = -6b*3 + 4b - 3. Suppose -19a - 1680 = -12a. Let q be a/20 + 1 + 6. Let o(m) = 4m3 - 3m + 2. What is qu(l) - 7o(l)? 2l3 + l + 1 Let f(z) = -13z*2 - 3z - 1. Let l(h) = -15h2 - 4h + 2. Calculate 5f(g) - 4l(g). -5g2 + g - 13 Let b(j) = -30j - 8. Let h(i) = 27i + 146. Let o be h(5). Let k = 284 - o. Let p(f) = 10f + 3. Determine kb(n) + 8p(n). -10n Let f(w) = w2 - w - 1. Let u(n) be the first derivative of 5n*3/3 - 6n*2 - 4n - 1375. Determine -6f(k) + u(k). -k2 - 6k + 2 Let o = 12 - 9. Let x(z) = -2z2 - 3z + 3. Let a be (-1)/2-1361. Let t(s) = 2s*2 - 2 - 11s + as - 5s. Give ot(m) + 2x(m). 2m2 Let b(y) = -2y*2 - 10y + 5. Suppose 12j - 12 = 2 - 2. Let h(v) = -v2 - v + 1. Determine jb(r) - 5h(r). 3r*2 - 5r Let p(k) = 19k. Let d(y) = -247y. Let u = -13480 - -13483. Give ud(s) + 38p(s). -19s Let r(m) = -7646m - 11. Let n(g) = -2g + 6. Calculate -2n(x) - r(x). 7650x - 1 Let o(l) = 15243817l*2 + 35127l - 11709. Let s(r) = -5208r2 - 12r + 4. What is 4o(p) + 11709s(p)? -5204p2 Let y(c) = c. Let u(t) = -t2 + 13t + 1. What is u(b) - 5y(b)? -b2 + 8b + 1 Let j(r) = 33594r2 - 15r - 30. Let g(b) = 8397b2 - 4b - 8. Give 15g(l) - 4j(l). -8421l2 Let p(b) = b2 - 2b + 1. Suppose -5k + 31 = -159. Suppose -53 + k = -3n. Let t(s) = -s*2 + 4s - 1 + 0s - 6s + 5s. Give np(m) + 3t(m). 2m*2 - m + 2 Let u(z) = 5z - 5. Suppose -5y + 5v - 1075 = 0, -15y - 1065 = -10y + 5v. Let f = y + 213. Let c(n) = -n + 1. Calculate fu(d) - 3c(d). -2d + 2 Let p(o) = -3o3 - 2o*2 - 5o + 2. Let w(q) = -q3 - q2 - q. Let i(y) = 165y + 16. Let d be i(-2). Let s = 309 + d. What is sw(x) + p(x)? 2x3 + 3x2 + 2 Let g(u) = u3 + 7u2 - 9u - 5. Let q be g(-8). Let m(f) = -6f - 1 - 2 + q. Let a(x) = -4x. What is -7a(y) + 5m(y)? -2y Let m(d) = 227d*2 - 2d + 3. Let s(w) = 228w2 - w + 2. Calculate 2m(v) - 3s(v). -230v*2 - v Let k be 2/((-28)/21 - 112/(-120)). Let f(s) = 3s*3 - 5. Let q(l) = -4l*3 + 6. Let d be -1((-2)/2 - -7). Calculate df(u) + kq(u). 2u3 Let u(n) = -54882570n*2 - 36306n - 54459. Let x(t) = -12094t2 - 8t - 12. Determine -4u(p) + 18153x(p). -12102p2 Let a(d) = -2d - 5. Let t(w) be the third derivative of -w4/8 - w3 - 9w2 - 32w - 51. Suppose -4n = -0n + 16. Calculate na(z) + 3t(z). -z + 2 Let d(x) = x*2 - 2x - 1. Suppose 0 = 3b - 2c - 26, 5 = -3b - 2c + 15. Let n(s) = -s + 2 + 0s - 3s*2 + bs. Let j = 62 + -66. Give jn(w) - 10d(w). 2w2 + 2 Let x(b) = -53b*3 + 5b - 5. Let f(i) be the third derivative of 493i6/24 - 29i*4/3 + 116i*3/3 + 5i*2 - 217. Give -5f(a) - 232x(a). -29a*3 Let l(d) = -2d*2 - 5. Let z(s) = -3s - 167. Let v be z(49). Let r = v + 317. Let o(m) = -3m2 - 9. Calculate ro(q) - 5l(q). q2 - 2 Let c(q) = q. Let h(s) = 3s + 10. Let k(x) = -12. Let p(l) = -5h(l) - 4k(l). Determine -6c(j) - p(j). 9j + 2 Let d = -202 + 24. Let x = d - -174. Let o(p) = p + 1. Let g(s) be the second derivative of s4/4 + s3/3 + 5s2/2 - 4s. Give xo(l) + g(l). 3l*2 - 2l + 1 Let o(x) = -1576x + 11. Let j(w) = -781w + 5. Give 7j(c) - 3o(c). -739c + 2 Let i(t) = 15t*3 + 8t*2 + 116t - 2. Let b(d) = -16d3 - 12d*2 - 114d + 3. Calculate 2b(w) + 3i(w). 13w3 + 120w Let l(f) = -72f2 - 1774f + 22. Let u(p) = 14p2 + 355p - 4. What is -2l(s) - 11u(s)? -10s2 - 357s Let p(k) = -14705k3 - 55k*2 + 22. Let q(t) = -3676t*3 - 15t*2 + 6. Calculate -6p(c) + 22q(c). 7358c*3 Let x(c) = 5c*3 + 2c*2 - 2c + 1. Let f(h) = -21h3 + 7h*2 + 8h - 9. What is -f(u) - 4x(u)? u3 - 15u*2 + 5 Let y(f) = 3f - 592. Let s(b) = b - 209. Let v(h) = -17s(h) + 6y(h). Let a(t) = 3t3 + 10 + 5 + 6 + 3t + 15t. Give -a(n) + 18v(n). -3n3 - 3 Let f(d) = -d3 - d2 + 704d - 22. Let s(j) = -j*2 - 10. Give -f(k) + 2s(k). k3 - k2 - 704k + 2 Let c(k) = -k3 - 14k2 + k + 40. Let t(i) = i3 + 12i2 - i - 39. Calculate 5c(q) + 6t(q). q3 + 2q*2 - q - 34 Suppose 59 - 1 = 5h - 3b, -3h + 35 = -2b. Let y(l) = -8l + 2. Let o(x) = -1. Let i(u) = 6o(u) + y(u). Let p(s) = -15s - 7. Determine hi(m) - 6p(m). 2m - 2 Suppose 16588 = -114z + 166z. Let n(h) = -29h*2 + 6h + 6. Let k(w) = 1537w2 - 319w - 319. Calculate zn(g) + 6k(g). -29g2 Let l(p) = 3p*2 + 5p - 6. Let a(z) be the second derivative of z4/3 + z3 - 3z2 + 1631z. Give 6a(n) - 7l(n). 3n2 + n + 6 Let g(p) = -2 - 3p2 + p2 - 4p2 - 3p. Let o be (3/(-6))/(3/(-12)). Let i(j) = -7j2 - 4j - 3. Suppose 13 = -7n - 8. Calculate ng(m) + oi(m). 4m*2 + m Let i(t) = 3t - 3. Let b(u) = -u - 9. Let a be b(-8). Suppose -2 = -5q - 17. Let l(h) be the third derivative of h3/6 + 14h*2. What is ai(s) + ql(s)? -3s Let c(r) = 2r2 + 233. Let w(x) = -x - 1. Give c(s) + w(s). 2s2 - s + 232 Let n = 20415 - 20413. Let p(s) = -s2 - s. Let z(v) = -2v2 + v. Let a = 9 + -3. Let b = 8 - a. Calculate bz(o) + np(o). -6o*2 Let x(a) = -7a*3 + 7a*2 + 7a + 7. Let j(l) = 7l2 + 3 - 4l*2 - 2399l + 2402l - 4l*3. Give -7j(t) + 3x(t). 7t*3 Let v = 787 + -779. Let j be 72/(v - 0) - 6. Let c(f) = -2f*2 + 3f. Let u(d) = 5d2 - 7d - 1. Determine ju(h) + 7c(h). h*2 - 3 Let a = -62 - -71. Suppose 23 = 7w + a. Let s(o) = 4o2 + o - 3. Let z(v) = -v2 + 1. What is ws(y) + 6z(y)? 2y*2 + 2y Let o(w) be the second derivative of w*3 + 7w*2/2 - 2w. Let l = 361 - 366. Let i(d) = 3d + 3. Calculate li(k) + 2o(k). -3k - 1 Let o(a) = 7a3 - 691a*2 + 12a - 6. Let l(d) = -8d3 + 691d*2 - 14d + 6. What is 6l(h) + 7o(h)? h*3 - 691h*2 - 6 Let k(f) = 5f - 12. Let v be 6 - 1 - ((-18)/(-18) + 4 + 1). Let w(h) = h. Determine vk(l) + 4w(l). -l + 12 Let b(p) = 30p2 - 202p + 38. Let k(h) = -14h2 + 103h - 19. Give 6b(a) + 13k(a). -2a2 + 127a - 19 Let i(n) = 1. Let t(s) be the first derivative of 2s3/3 + s2/2 + 5s + 45. Suppose 0 = g + 2g - 2r - 12, 5g = -4r + 20. Calculate gi(p) - t(p). -2p*2 - p - 1 Let v(m) = -1830m + 37. Let j(k) = -7k + 6. Calculate 6j(b) - v(b). 1788b - 1 Let p(i) = 2i*2 - 24i + 71. Let h be p(6). Let z(g) = 9g + 3. Let s(x) = -x. Determine hz(j) - 4s(j). -5j - 3 Let n(p) = -3p3 + 5p2 - 9. Let q(x) = -x3 + 2x2 - 4. Let l = -7 - -12. Let b(y) = -6y*2 - 301y - 52. Let s be b(-50). Give lq(v) + sn(v). v*3 - 2 Let s(x) = 3 + 0x + 0x - 9 - 9x. Let i(j) = 45*j - 5	{ "pile_set_name": "DM Mathematics" }
- 6614297493264/7 = 0. What is k? -401652, -41 Let -a*3 - 7895083a*2 - 15583087841763a - 15583079946681 = 0. Calculate a. -3947541, -1 Determine w so that 2w2 + 38906w - 9731800 = 0. -19700, 247 Find g, given that -7921g5/4 + 198737g*4/4 - 210400g*3 + 177032g*2 - 14656g + 320 = 0. 4/89, 1, 4, 20 Factor 4m2 - 8750360m + 4785550008100. 4(m - 1093795)2 Factor 3k*3 + 52644k*2 + 368307k - 947214. 3(k - 2)(k + 9)(k + 17541) Factor 289593o*2/2 - 95o/2. o(289593o - 95)/2 What is l in -3l4 - 5292l*3 - 320271l*2 + 2070162l - 2816856 = 0? -1701, -69, 2, 4 Factor -v*4 + 52806v*3 - 697751793v*2 + 16723237752v - 100293822864. -(v - 26391)*2(v - 12)*2 Factor 5t*3 + 38140t*2 - 534820t + 917040. 5(t - 12)(t - 2)(t + 7642) Let -4a*5 - 37488a*4 - 87908948a*3 - 347625784a*2 + 8004468864a + 43002117760 = 0. Calculate a. -4684, -7, 10 Factor 5i4 - 203110i*3 + 2081888805i*2 - 390076817200i + 18441985352000. 5(i - 20216)2(i - 95)*2 What is d in -4d*2 - 19376648d + 116260032 = 0? -4844168, 6 What is s in 2s4 + 116s*3 - 4326s*2 - 82224s - 204768 = 0? -79, -12, -3, 36 Factor -5d2 + 23340d + 5504625. -5(d - 4893)(d + 225) Find p such that -2p4/9 + 4888p*3/9 - 35456p*2/3 - 484192p/9 - 503776/9 = 0. -2, 26, 2422 Determine y so that -y*3/7 - 1635720y*2/7 - 95556893004y - 2675566832656/7 = 0. -817858, -4 Suppose 4j2 - 4219852j - 29539160 = 0. Calculate j. -7, 1054970 Solve -2r4/9 + 442r*3/9 - 22954r*2/9 + 21638r/9 + 5004 = 0 for r. -1, 2, 81, 139 Let -3f5/5 - 3174f*4/5 + 64743f*3/5 + 67914f*2/5 = 0. What is f? -1078, -1, 0, 21 Solve 3n*5 - 1179n*4 - 35313n*3 - 24201n*2 + 1149330n = 0 for n. -26, -7, 0, 5, 421 Let 2v3/7 - 487250v*2/7 = 0. What is v? 0, 243625 Find k such that 12k*5 - 2512k*4 + 29172k*3 - 2784k*2 - 72304k - 37824 = 0. -1, -2/3, 2, 12, 197 Factor -q*2/3 - 660979q + 3965878/3. -(q - 2)(q + 1982939)/3 Factor 3w*3 - 23574w*2 + 1565787w + 1589364. 3(w - 7791)(w - 68)(w + 1) Solve -2k*4/5 + 8644k*3/5 + 269714k*2/5 + 748604k/5 + 487536/5 = 0 for k. -28, -2, -1, 4353 Factor t*2 - 1240575t + 140172206. (t - 1240462)(t - 113) Factor 6j*2/5 + 27873j + 209034/5. 3(j + 23226)(2j + 3)/5 Factor -3w*2 + 8751w - 26226. -3(w - 2914)(w - 3) What is b in -2b2/15 + 987316b/3 - 609245552410/3 = 0? 1234145 Let -2h2 + 39008252h - 190205465511938 = 0. What is h? 9752063 Determine n, given that 3993n5/2 + 43621347n*4 - 95177115n*3/2 + 16223544n*2 - 1769850n = 0. -21850, 0, 3/11, 6/11 Let -7b3/4 + 10425b*2/4 - 896832b + 256025 = 0. Calculate b. 2/7, 539, 950 Solve 4k4/7 - 260k*3/7 - 200k*2/7 + 41280k/7 + 27648 = 0. -8, -6, 16, 63 Factor 2l3 - 430022l*2 - 39574720l - 910315896. 2(l - 215103)(l + 46)*2 Factor 3f*2 - 1259712f - 25195440. 3(f - 419924)(f + 20) Determine a so that -4a2 - 226496a + 13150224 = 0. -56682, 58 Factor -2f2 + 188848f - 20749080. -2(f - 94314)(f - 110) Determine d, given that 2d4/3 + 470d*3/3 + 10030d*2/3 + 59170d/3 + 16536 = 0. -212, -13, -9, -1 Factor -y*2 - 1085961y + 21719620. -(y - 20)(y + 1085981) What is l in 5l*3 + 19657l*2 - 103758598l - 41506584 = 0? -6927, -2/5, 2996 Factor 3k2/5 - 4020k + 719712/5. 3(k - 6664)(k - 36)/5 Let 15y4 + 227500y*3 + 862224890y*2 - 2876383700y + 862983375 = 0. What is y? -7585, 1/3, 3 Factor 2b2/11 + 3155464b/11 + 18932712/11. 2(b + 6)(b + 1577726)/11 Let 3y4 + 1250817y*3 + 130379222691y*2 + 130375470255y - 260755943766 = 0. Calculate y. -208469, -2, 1 Factor i*2/2 + 55263562i + 1527030642463922. (i + 55263562)*2/2 Let -3628y*2 + 1251676y/5 - 1104/5 = 0. Calculate y. 4/4535, 69 Factor -2z2/3 + 7034z/3 - 2723564/3. -2(z - 3074)(z - 443)/3 Factor 2m5 + 980m*4 + 7760m*3 + 23200m*2 + 30880m + 15424. 2(m + 2)4(m + 482) Factor o*3/2 + 5907o*2/2 + 8079651o/2 - 1934466543/2. (o - 207)(o + 3057)2/2 Factor -2z*2 + 95412z - 108712768. -2(z - 46538)(z - 1168) Factor -14l2/3 + 110560l/3 - 42112. -2(l - 7896)(7l - 8)/3 Let -3l*3 - 17754l*2 + 15199608l + 122731584 = 0. Calculate l. -6676, -8, 766 What is g in -5g2/2 - 13700995g/2 = 0? -2740199, 0 Suppose -20w5 + 1345w*4 - 15755w*3 - 8205w*2 + 143415w - 35100 = 0. Calculate w. -3, 1/4, 3, 15, 52 What is a in -2a4/7 + 20710a*3/7 - 8120184a*2 + 16467600536a/7 - 64962266464/7 = 0? 4, 323, 5014 Find z, given that 2z3/9 + 121976z*2/9 - 3134186z/3 + 9851820 = 0. -61065, 11, 66 Factor -6v2/7 + 16032v - 11273418/7. -6(v - 18603)(v - 101)/7 Let o*4/7 + 526207o*3/7 - 3683490o*2/7 + 4209728o/7 + 8419424/7 = 0. Calculate o. -526214, -1, 4 Factor 4n2/5 + 4924956n. 4n(n + 6156195)/5 Find h such that -3h3/5 - 924h*2/5 + 187743h/5 - 186816/5 = 0. -448, 1, 139 Determine i, given that -2i5/3 - 770i*4/3 - 3932i*3 + 5660i*2/3 + 453398i/3 - 148830 = 0. -369, -11, 1, 5 Factor l*4/2 - 485l*3 + 125025l*2/2 + 26723500l + 1518005000. (l - 580)*2(l + 95)*2/2 Suppose -5p*4/2 + 1461p*3/2 - 47539p*2/2 + 310083p/2 - 270720 = 0. What is p? 3, 5, 141/5, 256 Determine s so that -s*3/3 - 395s*2/3 + 5777s/3 + 6953 = 0. -409, -3, 17 Find c, given that 2c3 + 10418c*2 + 556630c - 567050 = 0. -5155, -55, 1 Find u, given that 4u4 - 18552u*3 + 2342484u*2 + 51902511968u + 155685952320 = 0. -1415, -3, 3028 Suppose 33w4 - 8621w*3/4 + 31884w*2 - 38721w/4 - 473/2 = 0. What is w? -1/44, 1/3, 22, 43 Find g such that -g*3/5 - 291g*2/5 - 19331g/5 - 249441/5 = 0. -201, -73, -17 Factor -4h3/7 - 2428352h*2/7 - 368543697684h/7 + 3685679816040/7. -4(h - 10)(h + 303549)*2/7 What is q in 2q*4/3 + 5536q*3/3 - 230786q*2/3 - 1258984q/3 - 516856 = 0? -2809, -3, -2, 46 Suppose -2b5 - 104264b*4 + 521436b*3 + 3440888b*2 - 8029018b + 4170960 = 0. Calculate b. -52137, -5, 1, 8 Suppose 2q2/7 - 16470q/7 - 6403608/7 = 0. Calculate q. -372, 8607 Solve -3b5/2 + 13509b*4/2 - 174693b*3 + 402627b*2 + 2712717b/2 + 1544565/2 = 0. -1, 5, 23, 4477 Determine n so that 20n5 - 17865n*4 + 338885n*3 - 2098305n*2 + 4436675n - 983250 = 0. 1/4, 5, 9, 874 Find z, given that -5z3 + 1507050z*2 + 3014120z = 0. -2, 0, 301412 Find k such that k*4/2 - 751k*3/2 - 17234k*2 - 202624k - 712320 = 0. -28, -8, 795 Factor -2j2/13 + 2568264j/13 - 2568262/13. -2(j - 1284131)(j - 1)/13 Determine x, given that 4x5 + 2428x*4 - 10663036x*3 + 21313892x*2 + 10663032x - 21316320 = 0. -1965, -1, 1, 2, 1356 Find s such that -s*3/4 - 1801s*2/4 - 123060s = 0. -1465, -336, 0 Solve 3o2/7 - 9350664o/7 + 7286243103408/7 = 0 for o. 1558444 Factor 3s3/5 + 1305s*2 + 4609521s/5 + 1046068599/5. 3(s + 493)(s + 841)*2/5 Suppose 5s*2 - 414266060s + 8580818423396180 = 0. What is s? 41426606 Factor -10y2 - 6441476y - 5186576632322/5. -2(5y + 1610369)*2/5 Find p such that -5p*4 - 25010p*3/3 - 4271105p*2 - 618939720p + 414527220 = 0. -711, -246, 2/3 Let -y*4/7 + 2713y*3/7 - 90855y*2/7 - 618489y/7 - 964440/7 = 0. What is y? -3, 40, 2679 Factor 2y2 - 14009564y + 24533485433762. 2(y - 3502391)2 Factor -4i*2 + 444i + 348880. -4(i - 356)(i + 245) What is x in 6x5 - 2438x*4 - 4782310x*3 + 2498987190x*2 - 3325071536x + 830869088 = 0? -931, 1/3, 1, 668 Suppose 35260w3/3 - 493598w*2/3 + 1727152w/3 + 686 = 0. What is w? -21/17630, 7 Solve -3t3 - 4887t*2 + 4587840t + 7782220800 = 0. -1440, 1251 Solve -5b4 + 20295b*3 + 305235b*2 + 1283065b + 998130 = 0. -7, -1, 4074 Factor -5d3 - 97335d*2 + 34526625d - 3034478125. -5(d - 175)2(d + 19817) Let -2x2/3 + 1162364x - 506658775686 = 0. Calculate x. 871773 Factor -3l3 - 7329l*2 - 231252l + 491844. -3(l - 2)(l + 34)(l + 2411) Factor -5n*3 - 3125n*2 - 330500n - 9000000. -5(n + 45)(n + 80)(n + 500) Factor -v2/4 + 88187837v/2 - 7777094594738569/4. -(v - 88187837)*2/4 Factor -2t*3 + 1583538t*2. -2t*2(t - 791769) Find s, given that -45s4 - 14935s*3 + 634815s*2 - 6713745s + 6696550 = 0. -371, 10/9, 19 Suppose 5k4 - 8495k*3 - 51195k**2 + 76455	{ "pile_set_name": "DM Mathematics" }
est common divisor of 8228 and 23716? 484 What is the greatest common factor of 4 and 14264? 4 What is the highest common factor of 1020 and 32980? 340 What is the highest common factor of 1633 and 3611? 23 What is the highest common divisor of 1162 and 667818? 166 Calculate the highest common factor of 2450 and 2050. 50 What is the highest common factor of 85428 and 774? 18 Calculate the greatest common factor of 10 and 2864740. 10 Calculate the greatest common factor of 45 and 3110505. 15 Calculate the greatest common factor of 4445 and 240919. 889 Calculate the highest common factor of 63 and 44046. 9 Calculate the greatest common factor of 75252 and 36. 12 Calculate the highest common divisor of 174 and 50866. 58 Calculate the greatest common divisor of 6720234 and 916. 458 What is the highest common divisor of 979 and 51909? 11 Calculate the greatest common divisor of 522 and 1962. 18 What is the greatest common factor of 14066 and 2795? 13 Calculate the greatest common divisor of 240374 and 124. 62 What is the highest common factor of 10687956 and 228? 228 Calculate the greatest common factor of 38566 and 88. 22 What is the highest common divisor of 828 and 3633? 3 What is the highest common divisor of 169985 and 5? 5 Calculate the highest common factor of 990 and 130482. 198 Calculate the greatest common factor of 24682 and 215. 43 What is the highest common divisor of 696 and 1842486? 174 What is the greatest common divisor of 122715 and 505? 505 What is the greatest common divisor of 325 and 2546765? 65 Calculate the greatest common factor of 264920 and 68080. 1480 What is the highest common factor of 2290 and 190? 10 Calculate the greatest common factor of 373 and 183143. 373 Calculate the greatest common divisor of 401636 and 820. 164 What is the greatest common divisor of 136 and 1411? 17 What is the greatest common divisor of 111 and 1183445? 37 Calculate the greatest common divisor of 18 and 1053333. 9 Calculate the highest common divisor of 78 and 55302. 78 What is the highest common factor of 8920 and 99012? 892 Calculate the highest common factor of 255840 and 45. 15 Calculate the highest common factor of 1050 and 9345. 105 Calculate the greatest common factor of 918 and 681. 3 Calculate the highest common factor of 294 and 3300. 6 What is the greatest common factor of 945 and 3285135? 315 Calculate the highest common divisor of 428 and 1127887. 107 What is the highest common divisor of 216275 and 41? 41 What is the highest common factor of 105 and 212835? 105 Calculate the greatest common factor of 4785 and 7755. 165 What is the greatest common divisor of 2265 and 2316? 3 Calculate the greatest common factor of 7569 and 119625. 87 Calculate the greatest common divisor of 57430 and 96. 2 What is the highest common divisor of 82684 and 77? 7 Calculate the greatest common factor of 860 and 370. 10 Calculate the greatest common factor of 1749559 and 1526. 763 What is the greatest common factor of 124 and 2397292? 124 Calculate the highest common divisor of 9746 and 862078. 886 What is the greatest common divisor of 843 and 2644491? 843 Calculate the greatest common divisor of 1594761 and 63. 21 Calculate the highest common divisor of 2690 and 210. 10 Calculate the greatest common divisor of 210 and 1392265. 35 What is the highest common factor of 11099 and 77? 11 Calculate the highest common divisor of 8844 and 77. 11 Calculate the highest common divisor of 3708 and 1336528. 412 Calculate the highest common divisor of 1260685 and 445. 445 Calculate the greatest common factor of 166 and 417739. 83 What is the highest common factor of 3664 and 6183? 229 What is the highest common factor of 219102 and 78? 78 Calculate the greatest common divisor of 6 and 14048. 2 Calculate the greatest common divisor of 367906 and 385. 77 Calculate the highest common divisor of 2356 and 12524. 124 What is the greatest common divisor of 18 and 42888? 6 What is the greatest common divisor of 10490 and 60? 10 Calculate the highest common divisor of 46 and 1367649. 23 Calculate the highest common divisor of 369 and 283843. 41 What is the highest common factor of 70868 and 2128? 28 Calculate the greatest common factor of 102899 and 43. 43 What is the greatest common factor of 423563 and 7? 7 What is the greatest common divisor of 18340 and 924? 28 Calculate the greatest common divisor of 2 and 17247. 1 What is the greatest common factor of 34 and 4426528? 34 Calculate the highest common divisor of 388028 and 48. 4 Calculate the highest common divisor of 41822 and 198. 22 What is the highest common divisor of 83752 and 2494? 58 Calculate the greatest common divisor of 910 and 39494. 182 Calculate the highest common divisor of 410509 and 11. 11 Calculate the greatest common divisor of 38489672 and 13. 13 What is the highest common factor of 27439 and 184? 23 Calculate the greatest common divisor of 696 and 12093. 87 Calculate the highest common factor of 14911 and 8177. 481 What is the greatest common factor of 4045626 and 102? 102 What is the highest common factor of 42 and 75354? 6 Calculate the highest common divisor of 70410 and 555. 15 What is the greatest common factor of 2727 and 299667? 303 What is the greatest common divisor of 69864 and 216? 24 What is the highest common factor of 9498 and 4608? 6 What is the highest common factor of 298 and 2? 2 Calculate the highest common divisor of 122793 and 732. 183 Calculate the greatest common factor of 8 and 24392. 8 What is the greatest common divisor of 7776 and 9882? 162 What is the highest common factor of 80 and 20890? 10 Calculate the highest common factor of 363462 and 132. 66 Calculate the greatest common factor of 33651 and 18. 9 What is the highest common divisor of 212 and 47276? 212 Calculate the greatest common factor of 34 and 1756. 2 What is the highest common divisor of 30336 and 9006? 474 Calculate the highest common divisor of 800 and 253200. 400 Calculate the greatest common divisor of 748839 and 84. 21 Calculate the highest common factor of 6208 and 21631. 97 What is the highest common factor of 6970 and 6630? 170 What is the highest common divisor of 3180 and 25320? 60 Calculate the greatest common factor of 156 and 4531371. 39 Calculate the greatest common divisor of 11866 and 115519. 349 What is the greatest common factor of 400 and 4210? 10 Calculate the highest common divisor of 296 and 236356. 148 Calculate the greatest common divisor of 464132 and 372. 124 Calculate the greatest common factor of 2 and 48302. 2 Calculate the greatest common factor of 5123 and 7739. 109 Calculate the greatest common factor of 11248 and 1026. 38 What is the highest common factor of 1530 and 7339410? 1530 Calculate the greatest common divisor of 7948 and 8. 4 What is the highest common factor of 90 and 4428? 18 Calculate the highest common factor of 678596 and 12. 4 What is the greatest common factor of 54209 and 302? 151 Calculate the highest common factor of 75345 and 45. 15 What is the greatest common factor of 22 and 504053? 11 Calculate the highest common factor of 1859464 and 8. 8 Calculate the greatest common divisor of 220 and 2695. 55 What is the highest common factor of 7968 and 424? 8 What is the highest common divisor of 2475 and 2530? 55 Calculate the greatest common factor of 30099 and 381. 381 Calculate the highest common factor of 4914 and 10374. 546 Calculate the highest common factor of 2398 and 18094. 218 What is the greatest common divisor of 218 and 439706? 218 Calculate the highest common factor of 1749037 and 417. 139 Calculate the greatest common factor of 963 and 24824. 107 What is the highest common divisor of 61607 and 49? 7 Calculate the highest common factor of 66 and 13716. 6 Calculate the greatest common divisor of 1833 and 1989. 39 What is the greatest common divisor of 297 and 117018? 297 Calculate the highest common divisor of 2336 and 288. 32 Calculate the highest common divisor of 31 and 1487287. 31 Calculate the highest common divisor of 120 and 49650. 30 Calculate the highest common divisor of 1013597 and 377. 13 What is the greatest common divisor of 1295 and 9435? 185 What is the greatest common factor of 4888 and 442? 26 What is the highest common divis	{ "pile_set_name": "DM Mathematics" }
ers picked without replacement from {v: 3, m: 2, a: 2, q: 2, p: 4}. Give prob of sequence ama. 1/429 Three letters picked without replacement from {o: 12, g: 7}. What is prob of sequence ggg? 35/969 Calculate prob of sequence zcc when three letters picked without replacement from {u: 1, t: 1, g: 1, c: 5, z: 9}. 3/68 What is prob of sequence mvzv when four letters picked without replacement from {z: 3, v: 4, h: 2, m: 6}? 3/455 Two letters picked without replacement from esseswcesessejucjess. What is prob of sequence cw? 1/190 Two letters picked without replacement from {a: 6, p: 4, z: 10}. Give prob of sequence ap. 6/95 Four letters picked without replacement from {k: 1, w: 2, v: 1, o: 1, p: 4}. Give prob of sequence opkp. 1/252 Calculate prob of sequence ggl when three letters picked without replacement from {l: 18, g: 2}. 1/190 What is prob of sequence lquw when four letters picked without replacement from lwuoq? 1/120 Two letters picked without replacement from jljvvji. What is prob of sequence lv? 1/21 Calculate prob of sequence gi when two letters picked without replacement from {e: 1, t: 1, l: 1, w: 2, g: 2, i: 1}. 1/28 Calculate prob of sequence gtmt when four letters picked without replacement from {u: 2, g: 2, t: 5, m: 9}. 1/204 Two letters picked without replacement from {x: 1, q: 1, m: 1, p: 2}. What is prob of sequence qx? 1/20 Calculate prob of sequence sr when two letters picked without replacement from {p: 2, k: 2, r: 1, s: 6, f: 1}. 1/22 Three letters picked without replacement from yjlhy. Give prob of sequence yhl. 1/30 Three letters picked without replacement from {x: 1, i: 2, z: 7, s: 7}. Give prob of sequence ssx. 7/680 What is prob of sequence nn when two letters picked without replacement from {r: 4, n: 10}? 45/91 What is prob of sequence wwma when four letters picked without replacement from {a: 9, m: 3, w: 4}? 27/3640 Two letters picked without replacement from {w: 5, d: 14}. What is prob of sequence dd? 91/171 Four letters picked without replacement from {a: 1, o: 1, h: 3, f: 1, i: 6, q: 1}. What is prob of sequence ihoa? 3/2860 Two letters picked without replacement from {a: 1, w: 1, o: 1, m: 1, i: 1}. Give prob of sequence wo. 1/20 Calculate prob of sequence mb when two letters picked without replacement from {o: 3, m: 5, b: 5}. 25/156 Calculate prob of sequence bx when two letters picked without replacement from {c: 1, s: 1, b: 4, x: 2}. 1/7 What is prob of sequence aua when three letters picked without replacement from auaauuuuuuauauauuu? 5/68 What is prob of sequence jw when two letters picked without replacement from mwjcm? 1/20 Calculate prob of sequence mtmt when four letters picked without replacement from {t: 4, e: 1, s: 2, u: 1, m: 7}. 1/65 Four letters picked without replacement from ddsddbnssbdd. What is prob of sequence ssnb? 1/990 Three letters picked without replacement from {q: 1, o: 1, x: 1, t: 1, j: 3}. Give prob of sequence otj. 1/70 Calculate prob of sequence vvn when three letters picked without replacement from vvnnvnnvvvvvvnvvvv. 65/408 Calculate prob of sequence bz when two letters picked without replacement from {b: 1, z: 1, l: 1}. 1/6 What is prob of sequence nkkk when four letters picked without replacement from {k: 8, n: 5}? 14/143 What is prob of sequence wmwx when four letters picked without replacement from mhxww? 1/60 Three letters picked without replacement from {j: 2, f: 1, a: 2}. What is prob of sequence ajf? 1/15 Four letters picked without replacement from qppppppppqqp. What is prob of sequence qpqq? 1/220 Two letters picked without replacement from rrvvvrrrrvvvrrvr. What is prob of sequence rv? 21/80 What is prob of sequence aw when two letters picked without replacement from faffffapaaffffawa? 3/136 Calculate prob of sequence hhhz when four letters picked without replacement from {z: 2, h: 3}. 1/10 What is prob of sequence iv when two letters picked without replacement from {i: 3, r: 8, v: 5}? 1/16 What is prob of sequence vwm when three letters picked without replacement from vmwvvwmm? 3/56 What is prob of sequence wg when two letters picked without replacement from {o: 1, h: 4, w: 2, g: 8, t: 2, c: 3}? 4/95 Calculate prob of sequence ld when two letters picked without replacement from {f: 4, d: 2, l: 10}. 1/12 Calculate prob of sequence zz when two letters picked without replacement from zjjjjjzzzjzzjjzjjzz. 4/19 What is prob of sequence ara when three letters picked without replacement from qmammrmra? 1/126 Three letters picked without replacement from {c: 14, f: 4}. What is prob of sequence cfc? 91/612 Four letters picked without replacement from jgggjgzbzbgjqqzqgg. Give prob of sequence qzbq. 1/2040 What is prob of sequence uff when three letters picked without replacement from fuffu? 1/5 Calculate prob of sequence ruju when four letters picked without replacement from {b: 2, m: 2, g: 1, r: 2, j: 1, u: 12}. 11/4845 Two letters picked without replacement from {k: 2, f: 1, l: 4, u: 4, n: 3, o: 1}. What is prob of sequence no? 1/70 Three letters picked without replacement from vovllllvbovhllool. Give prob of sequence hvv. 1/340 Two letters picked without replacement from ktvpakkpvtktat. What is prob of sequence av? 2/91 Four letters picked without replacement from cfccfcfccfcfffccfccf. Give prob of sequence fccc. 99/1292 Three letters picked without replacement from {h: 1, p: 7}. What is prob of sequence pph? 1/8 Calculate prob of sequence gg when two letters picked without replacement from tttngtgntgtnnnnnttt. 1/57 What is prob of sequence sj when two letters picked without replacement from {j: 5, s: 2, m: 2, w: 4}? 5/78 Calculate prob of sequence ooo when three letters picked without replacement from {o: 10}. 1 What is prob of sequence pi when two letters picked without replacement from {i: 3, p: 5}? 15/56 Two letters picked without replacement from atafttfxxaa. What is prob of sequence ax? 4/55 Calculate prob of sequence cv when two letters picked without replacement from vvciciciicwvwwwiiic. 5/114 Two letters picked without replacement from {g: 7, o: 1, c: 4, t: 3, e: 3}. What is prob of sequence to? 1/102 Three letters picked without replacement from lgfqglwlwwngww. What is prob of sequence gfn? 1/728 Three letters picked without replacement from {g: 3, o: 7, v: 2, l: 3}. Give prob of sequence vov. 1/195 Four letters picked without replacement from {w: 2, g: 2, a: 5}. Give prob of sequence gaag. 5/378 Calculate prob of sequence uiam when four letters picked without replacement from ijumujuuiuiajiji. 5/8736 What is prob of sequence uum when three letters picked without replacement from {u: 15, m: 4}? 140/969 Three letters picked without replacement from {s: 1, c: 2, b: 4}. What is prob of sequence scc? 1/105 Three letters picked without replacement from {j: 7, t: 1, z: 3, c: 1, x: 1}. What is prob of sequence cjj? 7/286 What is prob of sequence lmfa when four letters picked without replacement from lamfrla? 1/210 Four letters picked without replacement from {g: 3, s: 9, x: 1, f: 6}. Give prob of sequence ggsg. 3/5168 Three letters picked without replacement from {h: 2, v: 1, t: 2, m: 4, w: 1, y: 2}. Give prob of sequence myh. 2/165 What is prob of sequence wf when two letters picked without replacement from {f: 9, w: 2}? 9/55 Four letters picked without replacement from uoouppuuupupu. Give prob of sequence uuou. 7/286 Two letters picked without replacement from {u: 1, d: 3, e: 6, i: 5}. Give prob of sequence ue. 1/35 What is prob of sequence my when two letters picked without replacement from yymwyyymmyyyymmym? 15/68 What is prob of sequence sxsx when four letters picked without replacement from {x: 10, s: 4}? 45/1001 Three letters picked without replacement from {k: 17, v: 1}. Give prob of sequence kkv. 1/18 Two letters picked without replacement from {q: 1, i: 1, t: 1}. Give prob of sequence it. 1/6 Two letters picked without replacement from rirtriairjriiri. What is prob of sequence ti? 1/35 Two letters picked without replacement from xxxxxixxxxxxx. What is prob of sequence xi? 1/13 What is prob of sequence dgi when three letters picked without replacement from ricggryyrrdrcgggrgr? 1/969 Three letters picked without replacement from {h: 1, p: 6, c: 3, v: 7}. What is	{ "pile_set_name": "DM Mathematics" }
(-4)/k(2/19))(-31) assuming k is positive. k(405977/3192) Simplify (((f4f/f(3/8))/(f(-6)fff(2/29)))(-29))(34/5) assuming f is positive. f(-6749/4) Simplify (yy9yy/y4)(-16)/(y(-8)/(y/y(7/6)))(-17) assuming y is positive. y(-1567/6) Simplify (((ss/(s/((s*(-3/2)s)/s))s/s(-17))(-33))(2/49))(2/15) assuming s is positive. s(-22/7) Simplify (((q(-1)q)/q2)/(q(-1/2)/(q/q*(4/5))))/((q/(qq*(-4/5)q)q)/(q/(qq*(-7)))(q/(qq5)q)/((q*(1/2)qq)/q)) assuming q is positive. q(52/5) Simplify (v12v*(-1/5)v)*(-41)((vv(-2/9)v)/(v/v(-2/17)))28 assuming v is positive. v*(-387332/765) Simplify (l/(lll(1/2)))2/((l/l6)/l(1/2))((l*(2/5)l)38)46 assuming l is positive. l*(24497/10) Simplify (xx*(-5)x4)(5/3)x/(xx*(-6))x/(x*(-1/5)/x)(xx/(x/x1)x)6 assuming x is positive. x(131/5) Simplify ((qqq16)/(q3/q))/(((q(q(2/13)q)/q)/q)/((q/(q/q(-8)))/q)) assuming q is positive. q(89/13) Simplify ((p(-1/6))(-7)/(p*(2/29)p/(p/p(-2/37))))(-3) assuming p is positive. p(-7415/2146) Simplify (f(-1))*48(fff/f*(-1/2)ff)/(ff*(-1)ff)(ff/(f/(f0f)))(-48)/(f(-1/3))27 assuming f is positive. f(-263/2) Simplify (h(1/3))(1/30)h(-2/7)/hh*1(h/(h/(hh/(h(-2/7)/h)h))hh*(3/5)hh)/(h(-1/5)h/(hh/h(-5))) assuming h is positive. h(1243/90) Simplify ((q7qq5/qq(qq/(q/((qqq/(q/q*(-8)))/q)))/(((qq*(-3)q)/q)/q))(-8/3))36 assuming q is positive. q(-960) Simplify (((k(1/2)k)22/(k(-6)k(4/7)))(3/5))(-2/77) assuming k is positive. k(-1614/2695) Simplify (o*2o*(-13)o/(o*19o)(o/o(3/29))/o)(15/2) assuming o is positive. o(-13095/58) Simplify n6/n(-9)(n(-2/3))33(n(-6)/n(1/10))/(n5/(n/(n/(((n(2/21)n)/n)/n)))) assuming n is positive. n(-3991/210) Simplify (((u(2/7))(-10)/(u2(uu(-6))/u))26)(-26) assuming u is positive. u(-5408/7) Simplify ((d/d(-1))(-2/15)/((dd(1/2))/dd/d0))(2/119) assuming d is positive. d(-53/1785) Simplify q(1/5)/(q/q*(-1/7))q*3q*(-8)((qq/(qq0))/(q/q(1/3)q))/(q(1/4)(q/q(2/15))/q) assuming q is positive. q(-565/84) Simplify ((i/((i/(ii(-8)/ii))/i)i/(ii(-6)))/(i0)(-3))/((i(1/2))*(-11)(ii/(iii(-6)/ii)ii)/i(-1/9)) assuming i is positive. i(-47/18) Simplify (w(-1)/w17w12/(w/((((w/w(6/17))/w)/ww)/w)w))5 assuming w is positive. w(-795/17) Simplify (w/w(-5))8/(w(-43))19 assuming w is positive. w865 Simplify (t/(t/((t/(tt*26/t)tt)/t))ttttt*(-6/11)t(tttt(-4))(-18))(-6/37) assuming t is positive. t(102/407) Simplify ((v*(-4)v)/vvv(-2/17))(3/26)(v(-2/5))26/(v3/(v(1/6)v)) assuming v is positive. v(-41746/3315) Simplify ((j(2/83)jj*9)/(jj*(3/22)j)10)(-18) assuming j is positive. j(186354/913) Simplify (o(1/19))42/(o(16/3))(-33) assuming o is positive. o(3386/19) Simplify (r(5/7))(-16)(r(-2/29))37 assuming r is positive. r(-2838/203) Simplify (z(-4)zz(-13)z)*(-28)(z*2z)*(-42)z*(-1/7)/zz*7z assuming z is positive. z(2106/7) Simplify (t/(t(-4/5)tttt)t/(t(2/7)ttt)t(t/(t/(ttt5)))/(t/t3))/(t(2/5)/(t4/t))30 assuming t is positive. t(2923/35) Simplify (((d/(d/d*(-7)))/(dd(-2)))/(d(-1/4))(-1/11))/((d(-8)dd)/(d((d/d(1/12))/d)/dd))(-10/3) assuming d is positive. d(-11515/396) Simplify (((z/z(-5))/z(1/5))/(z/z(-1))(-4/7))/(((zz6)/z(-4))/(z(-6)/z(1/5))) assuming z is positive. z(-359/35) Simplify ((m(1/5)/mm)/(m/(m/(m/(m(m(-2/43)m)/m))))(m/m(-5)m)(-4/31))(-21) assuming m is positive. m(104937/6665) Simplify (g/(g/g(-1/4)))*(-5/19)(gg/(g0g)gg)*19g(-5)/(g/(g/(g/(g(-3/4)g))gg))(ggg/(gg(-2/3)/g)gg)(-1) assuming g is positive. g(2716/57) Simplify ((o/o(-6/13)o*11(o(4/5))(-1/28))(8/5))(-40) assuming o is positive. o*(-362048/455) Simplify (((uu*10uu)/u)14/(u8/u)29)34 assuming u is positive. u(-1190) Simplify (j0/j)27((jj(1/4)j)/j)*(-3/34)(((j*(-2)/jjj)/j)/jjj/j(-10))(-39) assuming j is positive. j(-51423/136) Simplify y(5/4)/y(1/2)y6/y(22/7) assuming y is positive. y(101/28) Simplify (t/t(-1/4))*(-2)t*0t*(2/11)(t*0/tt)46/(t(2/7)ttt/(tt(t/(ttt(1/4)))/t)t) assuming t is positive. t(-2111/308) Simplify (c(-2/13)c2(c/c*9)/(cc((cc*(-7))/c)/c))/((c/(cc0))30c/((c/((cc*8)/ccc))/c)c/(c/(cc(3/4))cc)) assuming c is positive. c(-567/52) Simplify (((z(1/4))(-10/17)/((zz(z/(zz(-2/11)/z))/z)/(z/z(-5/7))))(-13/5))(2/65) assuming z is positive. z(1609/32725) Simplify ((o8/(o*(3/11)o))/(o/(o/(o*1o)o))(-22))/((o(-3/10)oo4)/(o(2/3))(-27)) assuming o is positive. o(663/110) Simplify (((u/u(2/41))/(u(-13)uu))/(u(6/13)/u(1/26)))20 assuming u is positive. u(122890/533) Simplify (h(1/4)hhh*2hhh*(2/7)h/(h/h0))/((((h/(h/h(-1/3)))/hh)/h)(-11)h/h*2h(-1)) assuming h is positive. h(-515/84) Simplify ((j(2/11))5)*37/((j(j/(j/j*2)j)/jj)(2/55)/((j/(jj(-7)))/j6)) assuming j is positive. j*(1897/55) Simplify (kk*4k/k(-2/9))(-3/17)/((k/(k(-2/9)/k))/k(6/5)(kk*(-1/4))/(kk(((k(-1/3)k)/k)/k)/k)) assuming k is positive. k(-9803/3060) Simplify (((((d(2/15)d)/d)(18/7))31)(-49))(2/121) assuming d is positive. d(-5208/605) Simplify ((l0)(-4/31)l*2/((l(l/(l/(l*(2/3)l)))/lll)/l))/((l*(1/3)l)*41(l(-2/7))23) assuming l is positive. l(-1024/21) Simplify (((m1m)/mm)/(mm(-5/6))m(-3)/(m/(m(-4)/mmm)mm))/(((mm/(m(m*12/m)/mm))/m)/(m/(m*(-4)/m)m))(-8/13) assuming m is positive. m(-1423/78) Simplify (((q0/q(-5/2))(-12/5))5)(-45/2) assuming q is positive. q675 Simplify (p(-1))22(p2)(-6/7)p*4ppp*(-2/9)p(p3p)/(ppp*(2/7)p) assuming p is positive. p(-146/9) Simplify ((c(-1/3)ccc)(-27/4)/(c(c*(-1)c)/c)*(-8/7))/((ccc(-1/4)/ccc(-1/7))/(c/(c/(c/(c/(c6c)c)c))c5)) assuming c is positive. c(-213/28) Simplify (f6/f3f/(f*(-2/3)/ff)ff(f/f(-1/5)f)/ff)/((f(-1))(-2/37))(-19) assuming f is positive. f(5491/555) Simplify (m(-4/11)/m9m(-3/5)/m(-1/2))(-37) assuming m is positive. m(38517/110) Simplify ((yyy*(1/2)y)(-5))(34/9)(y0)(1/28)(yy/(y/((yy/(y/(yy/(y(-1/4)yyy))))/y)y))34 assuming y is positive. y(-1649/18) Simplify (s(-1))(-4)/(s(-1))41ssss0s/(s*(-5)/s)(s*(1/3)s)(-35) assuming s is positive. s(25/3) Simplify ((hh(-5/12))/h20)/(h(3/25)/((h(-37)h)/h)) assuming h is positive. h*(-16961/300) Simplify ((ww*(-45)w)/(w(w(w/(w*(-2/63)w))/w)/w))/(w(-3/8))(-38) assuming w is positive. w(-14435/252) Simplify ((u0u)/u)/u5uu4uu5((u(-1))(-23))(-18) assuming u is positive. u(-408) Simplify i/(i/((ii/(ii/(i*38/i)i)i)/i))i/i*(-13/5)i/i*(31/4)iii*(13/2)ii assuming i is positive. i(867/20) Simplify ((j/(j/(jjj(-14)jjj)))(-32)/(j(-3/7)/j)(-7/3))(1/39) assuming j is positive. j(854/117) Simplify (x(1/7)x(2/3)xx1xx(-6)x)/((xx(-1)xx)(-1/3)(x/(((x/(xx1xx))/x)/xx))/(x/((xx5/xx)/x))) assuming x is positive. x(-200/21) Simplify ((h(1/5))(-16/5)/(h(-2)hh)(-26))/(h(-3/5)/(hh(-1/11))(((h(hh7)/h)/h)/h)/((h(2/19)h)/h)) assuming h is positive. h(-26259/5225) Simplify ((ccc/(ccc/(c/(c/(c0c)))))(-1/3))(-31)c0cc(-2/13)c*0ccc/c(-1/2) assuming c is positive. c(1145/78) Simplify (i(2/5))(-2/7)/(i*(-3/2)ii/(i/(i1/i))i)(i(2/5))(-10/17)(i/(ii4/iii))/ii*(4/9)i assuming i is positive. i*(-57889/10710) Simplify ((wwww/((w/w*(-1))/w)w)(-13))(8/9)w1w*(-2)/w(w/w(-1/2))39 assuming w is positive. w*(185/18) Simplify ((f/(ffff*(-16))ff/(((f(f(ff*(-4))/f)/f)/fff)/f))/(f(1/7)/(ff(-38))))11 assuming f is positive. f(-1397/7) Simplify ((a/a(-10)aa)*(-1/15)a*(-2/9)((a*22aa)/a)/a)*(25/4) assuming a is posi	{ "pile_set_name": "DM Mathematics" }
240. Let t be m(12). Let b(i) be the third derivative of 10i2 + 0i + 1/120i5 + 0 + ti*3 + 0i*4. Determine j, given that b(j) = 0. 0 Let f(o) = -14o*5 - 6o*4 + 19o3 + o2 - 5o. Let a(p) = -21p*5 - 8p*4 + 28p3 + p2 - 7p. Let x(s) = 5a(s) - 7f(s). Find r such that x(r) = 0. -1, 0, 2/7, 1 Factor h2 - 13h - 5h + 3h*2 - 96 + 110h. 4(h - 1)(h + 24) Let a(x) be the first derivative of x8/9240 - x6/660 + x5/330 + x3/3 + 13. Let w(g) be the third derivative of a(g). Determine j, given that w(j) = 0. -2, 0, 1 Let k(a) = -36a2 + 63a - 27. Let x(c) = -5c2 + 9c - 4. Suppose -4 = -5y + 3u, 4 = -2y + 2u + 2u. Let t(q) = yk(q) - 15x(q). Factor t(w). 3(w - 2)(w - 1) Let y = 2/5331 - -18954/1777. Factor 2/3x*2 - 16/3x + y. 2(x - 4)2/3 Let s(n) be the first derivative of 6n*5/25 + 47n*4/10 + 72n*3/5 + 52n*2/5 + 421. Suppose s(x) = 0. What is x? -13, -2, -2/3, 0 Let r(t) be the third derivative of 0 - 1/18t*4 + 5/9t*3 + 0t + 1/450t5 + 37t*2. Determine h so that r(h) = 0. 5 Let 9468w*2 + w - 9467w*2 - 3w*4 + w - 4w*3 = 0. What is w? -1, 0, 2/3 Let a be -8(75/10 - 0). Let m be (a/35)/6 - (-2)/1. Factor 2/7l2 + 18/7 + ml. 2(l + 3)2/7 Suppose 0 = 3j - 1 - 8. Let o(w) be the first derivative of j + 0w4 + 0w - 1/4w3 + 0w*2 + 3/20w*5. Factor o(g). 3g*2(g - 1)(g + 1)/4 Solve -5z*5 - 23557z + 16 + 23545z - 16z*2 + 4z*5 + 13z*3 = 0. -4, -1, 1, 2 Factor 21/2z*2 + 15/2z - 3. 3(z + 1)(7z - 2)/2 Let l be (-651)/(-9) + (-1)/31. Let s = 72 - l. Factor -2/5o4 - 2/5o + s - 6/5o3 - 6/5o*2. -2o(o + 1)3/5 Let i = 12505/9 - 1389. Let i + 8/9h*2 + 4/3h = 0. Calculate h. -1, -1/2 Let d(j) = j4 + j3 + j*2 + 2j + 2. Let w(m) = m*5 - 2m*4 - 3m*3 + 6m*2 + 12m + 12. Let r(n) = 6d(n) - w(n). Determine i, given that r(i) = 0. -1, 0, 9 Let m be 10/15 + (-39)/(-9). Let s be 0 - (0 - 2) - (m + -3). Factor j + s - 1/2j*2. -j(j - 2)/2 Suppose 0 = 50a + 11 - 161. Let i(f) be the first derivative of -12/7f - 1/7fa - 11 + 6/7f*2. Factor i(k). -3(k - 2)2/7 Let z(k) be the third derivative of k8/2352 - k6/280 + k5/210 + 87k2. Let z(o) = 0. What is o? -2, 0, 1 Let b be (-12 - -10)/((-4)/2). Let f(w) = -4 + 3w*2 + 3w - w*2 - 9w - b. Let z(v) = 2v2 - 6v - 4. Let j(l) = -4f(l) + 5z(l). What is r in j(r) = 0? 0, 3 Let o be 2-1 + 1/(120/1086). Let b = o + -25/4. Suppose -4f - 8/5 - bf3 - 16/5f2 = 0. Calculate f. -2, -1 Let d(o) be the first derivative of o6/30 + o5/25 - o4/4 - o*3/15 + 4o*2/5 - 4o/5 - 61. Factor d(g). (g - 1)*3(g + 2)2/5 Let d(i) be the second derivative of -i6/10 + 27i5/20 - 23i*4/4 + 3i*3/2 + 54i*2 - 141i. Factor d(n). -3(n - 4)(n - 3)*2(n + 1) What is t in 3 + 33/4t2 + 3/4t*5 - 9t - 9/4t4 - 3/4t*3 = 0? -2, 1, 2 Suppose a - 5m - 629 = 0, 4m + 1942 = a + 2a. Factor -5f - 654f*2 + 5f*3 + af*2. 5f(f - 1)(f + 1) Suppose -5b + 3u = 2u + 2, -4u + 8 = 3b. Let m be b + (2 - (5 + -5)). Solve -2/7f*3 + 0f + 0 - 4/7fm = 0. -2, 0 Let v = -31 - -34. What is c in 2c*4 - 3c - 2cv + 2c*5 + 3c + 15c2 - 17c*2 = 0? -1, 0, 1 Let z(q) be the first derivative of -1/5q*5 + 0q - 4 + 0q3 + 3/4q*4 - 2q2. Suppose z(p) = 0. Calculate p. -1, 0, 2 Let l(k) be the third derivative of -k8/10080 + k7/2520 - k5/360 + k*4/144 + 3k*3/2 + 7k2. Let y(w) be the first derivative of l(w). Factor y(a). -(a - 1)3(a + 1)/6 Solve -60g3 + g4 + 32g3 - 7g*2 + 27g*3 + 5g2 = 0. -1, 0, 2 Let v(m) be the third derivative of m6/24 + 65m5/6 + 21125m*4/24 + 552m*2. What is g in v(g) = 0? -65, 0 Let s(x) = 2x*2 + 26x - 134. Let i be s(-17). Factor 7/4k - 2 + 1/4k*i. (k - 1)(k + 8)/4 Let c(m) = m*4 + 3m*2 - 1. Let k(h) = 8h*4 - 24h*3 - 708h*2 - 2592h - 4. Let d(p) = 4c(p) - k(p). Factor d(j). -4j(j - 18)(j + 6)*2 Let l(h) = 60h*2 + 65h + 29. Let s(u) = 300u2 + 324u + 152. Let b(y) = -16l(y) + 3s(y). Determine t, given that b(t) = 0. -1, -2/15 Let f = 2/795 - -3496/795. Factor 16/3t2 + ft + 6/5 + 32/15t3. 2(t + 1)(4t + 3)*2/15 Suppose 6p = 8p. Let t be 4/4(1 + p). Let i(n) = -n*3 + n. Let q(w) = 2w*4 + 6w*3 + 6w*2 - 2. Let h(m) = ti(m) - q(m). Find d, given that h(d) = 0. -2, -1, 1/2 Let a(c) = c - 1. Let h be a(3). Suppose hq - 2q = 8q. Let -1/2p + 1/2p4 - 3/2p*3 + 3/2p*2 + q = 0. What is p? 0, 1 Let j(k) = 2k*3 - 167k*2 + 73k + 830. Let p be j(83). Factor 13/2n + 1/2n*2 + p. n(n + 13)/2 Let t(q) = -q*2 + 72q - 894. Let w be t(16). Factor -2/23v3 + 2/23v - 6/23 + 6/23vw. -2(v - 3)(v - 1)(v + 1)/23 Suppose 3w - 38 + 26 = 0. Factor -8f*4 + 14f*w + 6f - 4f2 - 2 - 4f*3 + 0f*2 - 2f*5. -2(f - 1)*4(f + 1) Suppose -3i = n - 5, 792i - 795i + 7 = 2n. Find v such that 0 - 2/7v3 - 12/7v - 10/7vn = 0. -3, -2, 0 Let d be 21/(-6) - -1 - 221/(-78). Let b(z) be the first derivative of -dz*2 + 4/9z + 2/27z3 + 1. Factor b(x). 2(x - 2)(x - 1)/9 Let h(c) be the first derivative of -c4/20 - 22c*3/15 - 41c*2/10 - 4c - 33. Factor h(t). -(t + 1)*2(t + 20)/5 Factor -2/3p2 - 14/3p + 0. -2p(p + 7)/3 Let a be (-18 - -16) + 3 + 1. Determine k, given that -10k4 + 22k*5 + 25k + 3k5 - 20k*a - 90k*3 - 2k + 30 + 42k = 0. -1, -3/5, 1, 2 Let v(c) be the third derivative of c5/120 - 23c*4/12 + 529c*3/3 - 102c*2. Determine k, given that v(k) = 0. 46 Let v(w) = -2w*2 + 87w - 40. Let h be v(43). Factor 0m2 + 6m + 0 - 3/2mh. -3m(m - 2)(m + 2)/2 Let k(f) be the third derivative of 0f6 + 0 + 1/30f*3 + 0f + 1/1050f7 - 1/150f*5 + 0f4 + f2. Find n, given that k(n) = 0. -1, 1 Let m be (-1)/((-30)/275) - 9. Factor 1/6w4 + 2/3w + m + 2/3w3 + w2. (w + 1)4/6 Let a = -14562946 - -30116173843/2068. Let h = a + -1/188. Determine j so that 0 - 40/11j*4 + hj + 10/11j3 - 18/11j*5 + 40/11j*2 = 0. -2, -1, -2/9, 0, 1 Suppose -g + 27g - 8g - 36 = 0. What is c in 0 + 12/11c*3 - 6/11c + 6/11cg = 0? -1, 0, 1/2 Let p be (-2)/(6/(-3)) + -4. Let z be ((-3)/12)/(p/24). Solve 5f*z + 20f*2 - 4f*2 + 4 - 22f - 3f2 = 0. 2/9, 1 Let r be 815/(-90)-3 - -5. Let t = r - 32. Factor -1/6 + 1/6q2 + 1/6q*3 - tq. (q - 1)(q + 1)2/6 Suppose -2x = -4s - 2 + 16, 5s = 5x + 15. Let n(b) be the second derivative of -2/21b*3 + 0b*2 + 0 - 2b + 1/42bs. Factor n(q). 2q(q - 2)/7 Suppose 0 = 5k + 11k - 80. Let b(f) be the first derivative of k + 12f*2 + 4f*3 + 1/2f*4 + 16f. Solve b(s) = 0 for s. -2 Suppose -a + 3a - 5l + 38 = 0, 4l = -2a - 2. Let j be (6/a)/((-1)/3) - -1. Let 0w2 + 1/3w - 1/3wj + 0 = 0. What is w? -1, 0, 1 Factor -d2 + 4520 - 9019 + 3d + 4517. -(d - 6)(d + 3) Let i be (35/7 - 4)5. Let j(l) be the second derivative of 2/3l4 - 1/15l*6 - 4l - 1/15li + 8/9l*3 + 0 + 0l*2. Suppose j(x) = 0. Calculate x. -2, -2/3, 0, 2 Suppose 2i = 6i + 16. Let w(f) = f + 8. Let q be w(i). Factor 2p + 16p3 + 6p*2 + 6p*3 - qp*3 - 18p*2. 2p(3p - 1)*2 Find a, given that -41a*4 - 2304a - 3a5 - 488 - 735a*3 + 3a*4 - 46a*4 - 2094a*2 - 459 + 83 = 0. -12, -2, -1 Let j(c) = -2c*2 - 17c - 17. Suppose -4a + 2 = -2x, 2x + 5a = -0x - 29. Let q be j(x). Factor -19y*3 - 1 - 13/2y - 16y2 - 5/2y*5 - 11yq. -(y + 1)4(5y + 2)/2 Let r(c) be the second derivative of 1/60c4 + 11c + 1/30c3 - 1/100c*5 + 0 - 1/10c*2. Let r(a) = 0. What is a? -1, 1 Let k be 3 + (1 - (-8)/(-4)). Let f be 14/4 + k/4. Let -11l3 + l2 + l*4 + 9l*3 + fl*3 = 0. What is l? -1, 0 Let f(r) = -167r + 4681. Let g be f(28). Factor 0 - 8/7d2 - 8/7d*4 + 2/7d*g + 2/7d + 12/7d3. 2d(d - 1)4/7 Let n(p) = p3 + 4p*2 - 7p - 6. Let h be n(-5). Let l be 23/h + 3/12. Let -4k2 - 2 + 8k - 8k3 + lk*4 + 4k*2 - 4k*2 = 0. Calculate k. -1, 1/3, 1 Let j(g) = 6g*2 + 30g + 24. Let x(c) = -2c2 - 10c - 8. Let w = 87 - 95. Let f(r) = wx(r) - 3j(r). Solve f(v) = 0 for v. -4, -1 Let x(a) be the third derivative of a5/210 - a4/28 + 2a3/21 + 39a*2 - 3a. Factor x(v). 2(v - 2)(v - 1)	{ "pile_set_name": "DM Mathematics" }
? 79480440 What is the common denominator of -107/526820 and -9/17437? 24760540 What is the lowest common multiple of 1872 and 325224? 8455824 What is the least common multiple of 8998 and 3495723? 6991446 What is the common denominator of -91/421025016 and 45/42383? 4631275176 What is the common denominator of -67/6 and -71/48847542? 48847542 What is the least common multiple of 19310 and 29764434? 148822170 Find the common denominator of -31/8269712 and 31/1447952. 3580785296 Calculate the smallest common multiple of 916678 and 22358. 916678 Find the common denominator of -151/10821276 and -29/378. 75748932 What is the smallest common multiple of 29934 and 89802? 89802 What is the smallest common multiple of 45337 and 725392? 725392 What is the common denominator of -29/146575440 and 157/190080? 1172603520 Calculate the lowest common multiple of 194199460 and 8. 388398920 What is the least common multiple of 97798 and 8560? 3911920 Find the common denominator of -1/42089382 and -79/10404. 84178764 Calculate the smallest common multiple of 20032 and 147164. 736997312 Calculate the smallest common multiple of 55965 and 591370. 509169570 Calculate the common denominator of 63/190 and 99/412850. 7844150 What is the common denominator of 97/308 and 37/55426168? 609687848 What is the lowest common multiple of 60698 and 333839? 667678 What is the least common multiple of 3534084 and 18? 3534084 Find the common denominator of 79/12 and -99/3551242. 21307452 What is the smallest common multiple of 35232 and 18816? 6905472 Calculate the common denominator of -11/9802968 and -1/5313. 107832648 Find the common denominator of 57/95050594 and 30. 95050594 Calculate the smallest common multiple of 478566 and 6844944. 225883152 What is the common denominator of 69/318195845 and -1/57853790? 636391690 Calculate the lowest common multiple of 34915365 and 7. 244407555 Calculate the common denominator of -77/12 and 137/26016936. 26016936 Find the common denominator of -29/73680 and -105/1768. 16283280 Find the common denominator of -63/9401782 and -127/86996. 131624948 What is the common denominator of -3/5656 and -45/26824? 2709224 Calculate the common denominator of -26/5805 and 33/1601621. 216218835 What is the least common multiple of 3017456 and 1612? 93541136 Calculate the smallest common multiple of 240 and 1880010. 15040080 Calculate the least common multiple of 55 and 17688. 88440 What is the lowest common multiple of 53499 and 481491? 481491 What is the least common multiple of 17028 and 25542? 51084 Calculate the least common multiple of 18898 and 336728. 3704008 What is the common denominator of 5/6190662 and -121/96? 99050592 Find the common denominator of 23/52224 and 143/443904. 887808 What is the smallest common multiple of 20304 and 98316? 55450224 What is the common denominator of 10/36697131 and -4/109269? 697245489 What is the common denominator of 29/470220 and 39/2203580? 112382580 What is the least common multiple of 16348485 and 3269697? 16348485 Calculate the least common multiple of 180615 and 1685740. 5057220 What is the common denominator of 131/525060 and 119/396? 5775660 Calculate the common denominator of 157/83292 and 99/1259476. 41562708 Calculate the least common multiple of 4340293 and 8680586. 8680586 Find the common denominator of -93/84880 and -109/4900. 20795600 Calculate the least common multiple of 793368 and 2909016. 8727048 What is the smallest common multiple of 15338546 and 22? 168724006 What is the smallest common multiple of 24 and 6248736? 6248736 Calculate the smallest common multiple of 3697028 and 1848514. 3697028 What is the least common multiple of 171 and 1899288? 36086472 What is the least common multiple of 15432 and 44181816? 44181816 Find the common denominator of 67/13020 and -41/2580. 559860 What is the least common multiple of 16940 and 115954300? 115954300 What is the lowest common multiple of 413080 and 37590280? 37590280 What is the common denominator of 41/3912 and -155/609294? 2437176 What is the lowest common multiple of 33 and 2655243? 29207673 What is the lowest common multiple of 1217395 and 14? 17043530 What is the smallest common multiple of 3013647 and 184509? 9040941 Find the common denominator of 67/23536252 and -69/2. 23536252 What is the least common multiple of 25854 and 2027214? 281782746 Find the common denominator of -113/138866 and 83/1755. 18746910 Calculate the common denominator of -97/19888 and -39/80144. 99618992 What is the least common multiple of 29710 and 399090? 1185696390 What is the common denominator of 151/120 and 59/9176430? 36705720 What is the common denominator of 25/852 and -35/1537912? 327575256 What is the common denominator of 79/19187970 and 79/66? 211067670 Calculate the common denominator of 75/722 and 123/829700. 299521700 Calculate the least common multiple of 2724628 and 15666611. 62666444 Calculate the common denominator of 25/399098 and -93/55048. 1596392 Calculate the smallest common multiple of 64988 and 14037408. 14037408 Find the common denominator of -115/69594 and -33/33140. 695940 Calculate the least common multiple of 24927 and 18761722. 56285166 What is the smallest common multiple of 397676 and 600? 59651400 Calculate the common denominator of -139/330672 and -65/4648. 2314704 Find the common denominator of -7/206802 and 40/3. 206802 Calculate the common denominator of -113/85973268 and 31/588858. 85973268 What is the common denominator of 55/84 and -37/67346256? 471423792 What is the common denominator of 73/1537344 and 47/105504? 10761408 What is the least common multiple of 22495 and 23770? 106941230 Calculate the smallest common multiple of 8708294 and 14952. 104499528 What is the lowest common multiple of 162 and 11521116? 11521116 What is the common denominator of -89/556 and 51/207578? 57706684 What is the smallest common multiple of 1613953 and 44? 6455812 What is the smallest common multiple of 59808 and 692776? 8313312 Calculate the common denominator of -127/295932 and 55/644. 6806436 Calculate the lowest common multiple of 154709932 and 1482. 464129796 Calculate the common denominator of 12/8735 and 19/2230. 3895810 Calculate the smallest common multiple of 125190 and 71007768. 355038840 Calculate the lowest common multiple of 944354 and 806766. 121821666 What is the least common multiple of 254585 and 207120? 12220080 Calculate the lowest common multiple of 1498320 and 333292960. 2999636640 What is the least common multiple of 10194704 and 32? 20389408 Calculate the common denominator of 26/4611 and 81/98474. 8567238 What is the smallest common multiple of 33 and 1074660? 11821260 Find the common denominator of -9/8 and 69/236045674. 944182696 Calculate the least common multiple of 3074088 and 24. 3074088 What is the smallest common multiple of 32827716 and 87030? 164138580 Calculate the lowest common multiple of 24 and 96258. 385032 What is the smallest common multiple of 300 and 100984? 7573800 Calculate the common denominator of 13/2116092 and -157/980628. 40205748 What is the smallest common multiple of 2045082 and 2874? 979594278 What is the lowest common multiple of 5216288 and 1606? 5216288 What is the common denominator of 103/594877686 and -71/78? 594877686 Calculate the least common multiple of 138664 and 14109062. 56436248 What is the smallest common multiple of 237202 and 5574247? 11148494 Calculate the smallest common multiple of 325568 and 34. 5534656 Calculate the common denominator of -37/17933066 and 67/18. 161397594 What is the least common multiple of 2200 and 185405? 7416200 Calculate the common denominator of -79/5324 and 5/6546. 17425452 What is the lowest common multiple of 1554150 and 51805? 1554150 What is the smallest common multiple of 473 and 7248725? 7248725 Calculate the lowest common multiple of 1848 and 166296. 12804792 Find the common denominator of -113/27880 and 49/357272. 73240760 Calculate the smallest common multiple of 62461 and 7807625. 7807625 Calculate the lowest common multiple of 6128824 and 61288240. 61288240 Calculate the common denominator of -151/56928 and 65/9177. 174142752 What is the common denominator of -27/4 and -101/54166316? 54166316 Calculate the common denominator of	{ "pile_set_name": "DM Mathematics" }
068? 2, 11, 23, 53, 313 What are the prime factors of 2345891? 2345891 What are the prime factors of 5506299? 3, 67979 List the prime factors of 17415706. 2, 7, 11, 113089 List the prime factors of 17915. 5, 3583 List the prime factors of 860852. 2, 19, 47, 241 What are the prime factors of 619489? 13, 47653 What are the prime factors of 369516? 2, 3, 7, 53, 83 What are the prime factors of 1582606? 2, 257, 3079 What are the prime factors of 437033? 437033 List the prime factors of 6692845. 5, 19, 70451 What are the prime factors of 288931? 288931 What are the prime factors of 7529780? 2, 5, 383, 983 What are the prime factors of 1807668? 2, 3, 149, 337 List the prime factors of 8924362. 2, 4462181 What are the prime factors of 316829? 17, 18637 What are the prime factors of 6715303? 7, 19, 7213 What are the prime factors of 3145749? 3, 1048583 List the prime factors of 2822047. 43, 65629 What are the prime factors of 408934? 2, 41, 4987 List the prime factors of 834526. 2, 7, 11, 5419 What are the prime factors of 112750? 2, 5, 11, 41 What are the prime factors of 63366? 2, 3, 59, 179 What are the prime factors of 16180760? 2, 5, 31, 13049 List the prime factors of 544696. 2, 68087 What are the prime factors of 13403027? 11, 1218457 List the prime factors of 25180891. 821, 30671 List the prime factors of 671069. 7, 37, 2591 What are the prime factors of 2727781? 7, 179, 311 What are the prime factors of 380467? 101, 3767 What are the prime factors of 98344? 2, 19, 647 List the prime factors of 7660083. 3, 757, 3373 What are the prime factors of 2554269? 3, 851423 List the prime factors of 1083967. 23, 47129 What are the prime factors of 24135085? 5, 13, 151, 2459 List the prime factors of 3486700. 2, 5, 7, 17, 293 What are the prime factors of 6507895? 5, 197, 6607 List the prime factors of 232910. 2, 5, 23291 List the prime factors of 1735258. 2, 7, 17, 23, 317 List the prime factors of 17260068. 2, 3, 7, 205477 What are the prime factors of 2346124? 2, 11, 71, 751 What are the prime factors of 2521577? 157, 16061 What are the prime factors of 108178? 2, 7, 7727 List the prime factors of 1235122. 2, 7, 88223 List the prime factors of 20004979. 20004979 What are the prime factors of 9145911? 3, 41, 74357 List the prime factors of 196098. 2, 3, 7, 23, 29 List the prime factors of 2818764. 2, 3, 13, 19, 317 What are the prime factors of 89032? 2, 31, 359 What are the prime factors of 309006? 2, 3, 17167 What are the prime factors of 23136962? 2, 11568481 What are the prime factors of 2372894? 2, 17, 101, 691 List the prime factors of 620802. 2, 3, 7, 13, 379 What are the prime factors of 3773882? 2, 7, 97, 397 List the prime factors of 12575702. 2, 239, 26309 List the prime factors of 1023261. 3, 341087 What are the prime factors of 876093? 3, 23, 12697 What are the prime factors of 313236? 2, 3, 7, 11, 113 What are the prime factors of 16440171? 3, 11, 61, 8167 What are the prime factors of 3093568? 2, 48337 List the prime factors of 515202. 2, 3, 17, 5051 What are the prime factors of 620953? 89, 6977 List the prime factors of 2838436. 2, 709609 What are the prime factors of 4911137? 7, 11, 63781 List the prime factors of 1437414. 2, 3, 11, 29, 751 What are the prime factors of 407761? 173, 2357 List the prime factors of 1156787. 199, 5813 List the prime factors of 110373. 3, 36791 What are the prime factors of 767315? 5, 19, 41, 197 What are the prime factors of 1153533? 3, 29, 13259 List the prime factors of 934496. 2, 19, 29, 53 What are the prime factors of 2110944? 2, 3, 11, 1999 List the prime factors of 220087. 7, 23, 1367 List the prime factors of 1384915. 5, 7, 39569 List the prime factors of 751223. 11, 31, 2203 What are the prime factors of 136200? 2, 3, 5, 227 What are the prime factors of 9238924? 2, 577, 4003 What are the prime factors of 1348913? 1348913 What are the prime factors of 139016? 2, 17377 What are the prime factors of 3005182? 2, 1502591 List the prime factors of 770369. 61, 73, 173 What are the prime factors of 56801? 79, 719 List the prime factors of 9080157. 3, 19, 241, 661 What are the prime factors of 378197? 131, 2887 What are the prime factors of 559116? 2, 3, 31, 167 What are the prime factors of 294701? 11, 73, 367 What are the prime factors of 231366? 2, 3, 38561 What are the prime factors of 337966? 2, 29, 5827 List the prime factors of 204346. 2, 83, 1231 List the prime factors of 4117979. 4117979 What are the prime factors of 1355330? 2, 5, 135533 What are the prime factors of 1016822? 2, 131, 3881 What are the prime factors of 1818389? 431, 4219 List the prime factors of 1866279. 3, 41, 15173 List the prime factors of 11394254. 2, 5697127 What are the prime factors of 294354? 2, 3, 23, 79 What are the prime factors of 428678? 2, 19, 29, 389 List the prime factors of 6942433. 6942433 What are the prime factors of 77353? 103, 751 List the prime factors of 880822. 2, 37, 11903 What are the prime factors of 7001553? 3, 13, 179527 List the prime factors of 598675. 5, 7, 11, 311 List the prime factors of 1624448. 2, 7, 37 List the prime factors of 2423563. 2423563 List the prime factors of 19741291. 23, 858317 What are the prime factors of 1102667? 29, 47, 809 List the prime factors of 6971383. 6971383 What are the prime factors of 2450197? 181, 13537 What are the prime factors of 6174334? 2, 3087167 List the prime factors of 5344345. 5, 419, 2551 List the prime factors of 282306. 2, 3, 47051 List the prime factors of 2204681. 919, 2399 What are the prime factors of 252340? 2, 5, 11, 31, 37 List the prime factors of 1103797. 1103797 List the prime factors of 7350. 2, 3, 5, 7 What are the prime factors of 179298? 2, 3, 7, 1423 List the prime factors of 3126149. 13, 240473 List the prime factors of 286050. 2, 3, 5, 1907 What are the prime factors of 9044483? 7, 1292069 What are the prime factors of 6725650? 2, 5, 134513 List the prime factors of 638217. 3, 70913 List the prime factors of 78831. 3, 19, 461 List the prime factors of 31004050. 2, 5, 7, 11, 8053 What are the prime factors of 22159606? 2, 7, 31, 51059 What are the prime factors of 855594? 2, 3, 47533 What are the prime factors of 4730295? 3, 5, 23, 13711 List the prime factors of 1132148. 2, 383, 739 What are the prime factors of 359394? 2, 3, 7, 43, 199 What are the prime factors of 30561852? 2, 3, 17, 37, 4049 What are the prime factors of 114372? 2, 3, 353 What are the prime factors of 22955? 5, 4591 What are the prime factors of 205848? 2, 3, 953 What are the prime factors of 966001? 41, 23561 List the prime factors of 2259364. 2, 683, 827 List the prime factors of 4815584. 2, 61, 2467 List the prime factors of 6168. 2, 3, 257 What are the prime factors of 2401329? 3, 7, 41, 2789 List the prime factors of 924834. 2, 3, 17, 9067 What are the prime factors of 4891371? 3, 1630457 List the prime factors of 898010. 2, 5, 89, 1009 What are the prime factors of 1796743? 13, 41, 3371 What are the prime factors of 2717232? 2, 3, 7, 8087 What are the prime factors of 21015796? 2, 1051, 4999 What are the prime factors of 422636? 2, 19, 67, 83 What are the prime factors of 402831? 3, 11, 13, 313 List the prime factors of 27245. 5, 5449 What are the prime factors of 7375281? 3, 2458427 What are the prime factors of 5141684? 2, 17, 83, 911 List the prime factors of 22019. 97, 227 List the prime factors of 362269. 67, 5407 What are the prime factors of 11834401? 977, 12113 What are the prime factors of 2265715? 5, 453143 What are the prime factors of 47830? 2, 5, 4783 What are the prime factors of 5646359? 59, 95701 What are the prime factors of 3899659? 29, 134471 What are the prime factors of 3023037? 3, 335893 What are the prime factors of 49038? 2, 3, 11, 743 List the prime factors of 932361. 3, 167, 1861 List the prime factors of 1465304. 2, 151, 1213 What are the prime factors of 1089382? 2, 7, 77813 What are the prime factors of 506496? 2, 3, 1319 List the prime factors of 20746638. 2, 3, 11, 53, 659 What are the prime factors of 9003166? 2, 17, 23, 29, 397 What are the prime factors of 40516? 2, 7, 1447 What are the prime factors of 8874412? 2, 23, 96461 List the prime factors of 4019872. 2, 125621 List the prime factors of 6657800. 2, 5, 33289 W	{ "pile_set_name": "DM Mathematics" }
e (6/(-44))/((-6)/8). Let k = -163 - 243. Let n be (-4)/7 - k/882. Put j, -2/5, n in ascending order. -2/5, n, j Suppose 2z = -z + 60. Let j be (-10)/(-2)(-16)/z. Let r = 9 + j. Put -4, r, 2 in descending order. r, 2, -4 Suppose -5k + 30 = -0k - 3s, 0 = -k + 5s + 28. Let n = 2 + k. Let u = 22 + -20. Put n, u, 0 in increasing order. 0, u, n Suppose h = -5i + 75 - 8, -4h + 47 = 3i. Suppose -5g = f - i, 4g = -5f - 1 + 24. Let b be (-1 - 3)(-1)/g. Sort 0.1, -0.3, b. -0.3, 0.1, b Let m = -2 + -1. Let k = 0 + m. Sort 0, k, -4 in increasing order. -4, k, 0 Suppose -2u + t - 15 = 0, 6u - u - 3t + 40 = 0. Sort -1, u, 17. u, -1, 17 Suppose 2 = -5w + 3w. Suppose -3l - 2q + 4 = 0, 4l + q = -0 - 3. Let i be l + -2 + (-34)/(-8). Put -5, w, i in increasing order. -5, w, i Let r = -44 + 43.7. Let d = -11 + 8. Put 0.04, r, d in descending order. 0.04, r, d Let u be (-4656)/(-23)(-36)/27. Let f = -270 - u. Sort 0.3, f, -3 in increasing order. -3, f, 0.3 Let x(z) = z - 11. Let f be x(9). Suppose 3h - 6 = -k, -4h + 0h + 8 = -k. Sort f, -3, k. -3, f, k Let p = 76 - 71. Sort -2, 3, p in decreasing order. p, 3, -2 Let l(w) = w3 + 9w*2 - 4. Let h be l(-9). Sort -11, -2, h in increasing order. -11, h, -2 Suppose 0r = 5r - 15. Suppose -rd = d + 8. Let b = -28 + 28. Sort 2, b, d. d, b, 2 Let o = -0.2 + 0.1. Let l = 113/3 - 1475/39. Put 5, o, l in decreasing order. 5, o, l Let r be ((-20)/30)/((-2)/(-9)). Sort r, 2, -1 in ascending order. r, -1, 2 Let d be -26(-1)/6 + 1/(-3). Sort d, -8, -1, -5 in ascending order. -8, -5, -1, d Suppose 0p + 4 = -p. Let i = 0 - 2. Sort -5, i, p in descending order. i, p, -5 Let n = -17 + 13. Sort 3, 2/23, n in descending order. 3, 2/23, n Suppose 2l + 4f = 10, l = -4f + 9 - 0. Let h = -471/22 - -43/2. Put -0.3, h, l in decreasing order. l, h, -0.3 Suppose 6l = l + 965. Let a = -1739/9 + l. Let t = 1.6 + -1.5. Put -2/5, t, a in increasing order. -2/5, a, t Suppose 2i = -4q - 12, 0 = 4q - 2i - 3i + 26. Sort -2, q, -27 in descending order. -2, q, -27 Let n = -0.59 - -0.69. Sort 2/11, n, -1 in ascending order. -1, n, 2/11 Suppose 1 = -r + 3s, 0r - r - 5s = -7. Suppose -rv - 6 = 4. Put v, -3, -4 in ascending order. v, -4, -3 Let w be -14 + 13 - 2/2. Sort 1, -11, w, -5. -11, -5, w, 1 Let n = 4 - 4. Let d = 26 + -25. Sort 5, n, d in ascending order. n, d, 5 Let i = -1.5 + 1.8. Sort 0, i, -0.4 in ascending order. -0.4, 0, i Let f = 5.7 - 0.7. Let v = f + -7. Let b = 1.9 + v. Sort 3, -4, b in decreasing order. 3, b, -4 Let z be -2 + 22 + 3. Suppose 0 = -3o - 5r - 29, 2o + r = -2o - 33. Let b be (z/(30/o))/6. Sort -5/2, -0.1, b in increasing order. -5/2, b, -0.1 Let i = 453/7 - 65. Let h = -2.97 - 0.03. Put i, h, 0.4 in descending order. 0.4, i, h Let h = -5 - -9. Let z = 0 + 0.5. Let b = -0.8 + z. Put 1/6, b, h in decreasing order. h, 1/6, b Let r = 3.97 + 0.03. Let b = -16 + 11. Put -2, b, r in descending order. r, -2, b Suppose -2a + 0a - 24 = 0. Put a, -3, -0.3, 2 in descending order. 2, -0.3, -3, a Let i = -2 + 7. Suppose 0f - 20 = if. Let o be f(-2 - 15/(-6)). Sort -3, -1, o. -3, o, -1 Suppose -2y = l - 2l - 5, 2y = 2l + 2. Sort 33, y, 1, 3. 1, 3, y, 33 Let r be 10/(-3) - -2 - -2. Let j be 1/(-3) + 40/12. Suppose h - jq = -5, 3q - 32 = -5h - q. Put -4, r, h in decreasing order. h, r, -4 Suppose 5j - 4 = -3z, -4j + 0z - 2z = -4. Put j, 3, -2, 5 in decreasing order. 5, 3, j, -2 Let j = 19.1 + -3.1. Let w = j - 16. Sort 1, -0.3, w in descending order. 1, w, -0.3 Let s(m) = -m + 5. Let o be s(3). Let g = o - 3. Let i be (1 + 0)/g + 4. Sort -5, i, 4 in increasing order. -5, i, 4 Let p = -2 + -5. Let u = 0.05 + -2.05. Sort p, u, -0.2 in decreasing order. -0.2, u, p Suppose 0 = -6r + r. Suppose r = 3k - 3 - 3. Let h be 16/(-4)k/(-4). Sort -3, h, 3. -3, h, 3 Let l = 0.245 + -10.145. Let t = 10 + l. Put t, 2, 3/8 in decreasing order. 2, 3/8, t Suppose 4j + 0j - 8 = 0. Suppose -4f - 4c = -jf + 16, 5f - 20 = 5c. Sort f, -2/13, -1 in increasing order. -1, -2/13, f Let x be (-4)/10 - 32/20. Sort x, 0.3, -0.1 in decreasing order. 0.3, -0.1, x Suppose -g + c - 1 = 0, -2g = 2c - 7c + 17. Suppose b - 11 = -3n - 0, 5n + gb = 30. Let t be (n/(-5))/((-6)/(-30)). Put t, 0, 3 in decreasing order. 3, 0, t Let j = -0.8 + -0.2. Let v = j - -0.7. Let r = -0.38 + 3.38. Sort -0.5, v, r in descending order. r, v, -0.5 Let h be 10(133/(-45) + 3). Let b = -12 + 17. Sort b, h, -1 in descending order. b, h, -1 Let d = -191 - -195. Sort 2, 3, d, -6/17. -6/17, 2, 3, d Let y = 294157/413595 - 1/9191. Let x = -10/9 + y. Let o = 202 + -1820/9. Put o, x, 0.5 in descending order. 0.5, o, x Let z = -2.7 + 2.8. Put z, 3, -3 in increasing order. -3, z, 3 Suppose 0u = u. Let j be (-2 - (-15)/(-6)) + (-1)/2. Let b(a) = -a2 - 2a - 1. Let s be b(-2). Sort j, u, s. j, s, u Let q = 55 - 56. Sort q, 0, 3, 5 in decreasing order. 5, 3, 0, q Let r be 1/(-4) - (-26)/8. Suppose 4a - 6 - 2 = 0. Suppose -3g = 2d + a - 0, 1 = -d - 3g. Sort -4, d, r in increasing order. -4, d, r Let f = 321.3 + -296. Let j = -25 + f. Let a = 0.12 + 4.88. Sort j, 3, a in decreasing order. a, 3, j Let m = -2 - -2. Let h = 703/7 - 101. Put m, h, -0.3 in decreasing order. m, -0.3, h Let k = 55 - 51. Put k, -6, -3, 5 in decreasing order. 5, k, -3, -6 Let r be -21((-4)/8 - -1). Put r, 0, -2, -5 in ascending order. -5, -2, r, 0 Let p = -157 + 156.9. Put p, -1/33, 2, -2/13 in increasing order. -2/13, p, -1/33, 2 Let h = -3 - -4. Let z(i) = i + 16. Let j be z(-17). Sort j, -3, h in descending order. h, j, -3 Let g = 2/91 + 75/728. Let t be 10/(-25) + 22/5. Suppose 5h - tj + 8 - 20 = 0, -4h = -2j - 6. Sort h, g, 5 in descending order. 5, g, h Let o(d) = -6d + 1. Let v be o(-1). Suppose -5m + 6 = p, 0 = 3p - m + 3m + 8. Let r = v + p. Put 4, r, -1 in increasing order. -1, r, 4 Let g be 2/1 + (-6)/3. Let j be 3/1 - (0 + -1). Sort g, j, -2 in descending order. j, g, -2 Let x = -0.066 - 0.034. Let w = -33/70 - -1/14. Put x, 4, w in increasing order. w, x, 4 Let f be 27/62/3. Let n be (2/4)/(1/2). Sort f, n, 5 in increasing order. n, f, 5 Let r(h) = h2 - 8h + 4. Let s be r(7). Let a = s + 3. Suppose -b - 4b + 5 = a. Put -3, b, 3 in increasing order. -3, b, 3 Let m = -1.4 + 1.3. Put -0.5, m, 0.2 in ascending order. -0.5, m, 0.2 Let i be (-1)/(-2)(-7 - (4 - 1)). Suppose 0s = -4s - 24. Let q be 4/14 - (-4)/(-14). Put s, i, q in decreasing order. q, i, s Suppose 2f - 4c = -6, -f - 2f - c = 9. Sort 22, -5, f in descending order. 22, f, -5 Suppose -4f + 20 = 4. Suppose -3s + f = -s. Sort s, 5, -5 in increasing order. -5, s, 5 Let t(g) = g3 + 7g*2 + 1. Let p be t(-7). Let m be -3 + (3/(-3) - p). Put 0, -0.3, m in decreasing order. 0, -0.3, m Let l be ((-2)/(-5))/(-1)1. Sort l, -1/3, 3 in descending order. 3, -1/3, l Let k be (-26)/(-65)(-30)/8. Sort k, -2, 0.05 in descending order. 0.05, k, -2 Let o = 5 - 3. Let g = -31 + 21. Let t = 6 + g. Put 4, t, o in descending order. 4, o, t Suppose -5d = -5n - 15, 4n + n = -10. Let k = 27 + -27. Let u = -7 + 3. Sort u, k, d in decreasing order. d, k, u Suppose 0 = -5t + n - 30, -3n + 15 = -0n. Let l be -3 + (84/3)/4. Let x be (l/14)/(t/10). Sort -0.1, x, -1. -1, x, -0.1 Let g = 13/15 + -2/3. Let y = 5.07 - 0.07. Sort g, 3, y in increasing order. g, 3, y Let d = -659 + 659. Let y = 0.8 + 0.2. Sort y, d, 2/5 in increasing order. d, 2/5, y Let b(d) be the first derivative of -5d*2/2 - d + 5. Let p be b(-1). Put 0, p, -4 in ascending order. -4, 0, p Suppose -7 = -2a - u, 5a + 3u = a + 13. Let m = a + 1. Put 3, 0, m in increasing order. 0, 3, m Let q be (-110)/(-35) - 2/14. Suppose -3i = -4u + 50 - 140, 0 = 3i - u - 99. Suppose -2g + 18 = -g - ql, -5l - i = -3g. Put g, 5, -5 in ascending order. -5, g, 5 Let k = -458/55 - -96/11. Put -4, -2/23, -0.4, k in descending order. k, -2/23, -0.4, -4 Suppose -5s + 2 = -13. Put 4, 2, s in decreasing order. 4, s, 2 Let t be 2(-1 + 30/4). Let l = t + -8. Let x be 10/(-3)36/(-30). Sort l, -5, x. -5, x, l Let l be 2/((-6)/9-1). Let j be (-2)/(-4)(-1 + 1). Sort j, -5, l. -5, j, l Let b = -2.5 + 7.4. Let k = -5 + b. Let v = k + 0.1. Sort v, 1/2, -2/5 in increasing order. -2/5, v, 1/2 Let z = 1 + -1. Let q be ((-10)/(-15))	{ "pile_set_name": "DM Mathematics" }
3 + 19d3 + 8d to id + gd*2 + x + zd*3 and give x. -12 Rearrange 15u - 57u - 8u*4 + 14u + 3u3 + 10u + 16u to su*3 + xu*4 + d + lu*2 + iu and give s. 3 Rearrange (-2 + 4 - 1)(658 + 1309 - 240)(3h3 - h3 - 3h*3) to kh*3 + xh*2 + y + ah and give k. -1727 Express -9f3 + 13f*2 - 18f*2 + 4f + 4f2 + 2 as vf + cf3 + of*2 + t and give v. 4 Express 157t - 89330 + 89330 - 2t3 in the form z + at*3 + kt*2 + vt and give a. -2 Express 4x3 - 2 + 5x + x*3 - 19x*3 - 4x + x in the form tx3 + vx*2 + y + dx and give y. -2 Express (2 - 2 - 2)(0 - 2 + 4)(-23b + 1 + 104b + 42b) in the form w + db and give d. -492 Rearrange (2z + 3 - 3)(-6 + 3 + 2) + 0 - 58855z + 0 + 57635z to gz + v and give g. -1222 Rearrange 3z*3 - 221z + 223z + 3 - 2 + z3 + 4z*3 + 9z*2 to the form d + yz + tz3 + wz*2 and give t. 8 Rearrange 18 + 244h - 491h + 262h to the form p + oh and give p. 18 Express -2z*2 + 2z*3 - 47051z*4 + 3z + 47050z4 - 4z*3 as iz*3 + cz + fz2 + h + oz*4 and give f. -2 Express 34s - 39s + s3 - 4 - 3s*3 + 2 in the form os + z + is3 + ys*2 and give o. -5 Rearrange (-2x*2 + 5x*2 + 0x*2)(32x2 - 684x*2 - 25x*2) to zx*2 + i + rx*3 + yx + dx4 and give d. -2031 Express -8n + 1219n2 - 7n - 606n2 - 614n*2 as an + o + jn2 and give a. -15 Express -3b2 + b2 + b*2 + (b - 3 + 3)(176b + 121b - 98b) as o + rb*2 + gb and give r. 198 Express -396o - 48o - 90o + 41o as uo + g and give u. -493 Express -28 - 33o*3 + 18o*3 + 17o*3 + (o + o - o)(1 + 2o2 - 1) in the form do*3 + x + go*2 + qo and give d. 4 Rearrange (-6c + c + 2c)(-5 - 58 - 69)(-1 + 0 - 1) to the form p + tc and give t. -792 Rearrange 5x - 3x + 0x + (7 - 5x - 7)(-9 - 13 - 1) + (-2x + 3x + 0x)(1 + 0 - 2) - x - 4x - x to h + yx and give y. 110 Rearrange -6701 + 6701 - 3n3 + 23n*4 + n to g + mn*3 + kn + hn2 + rn*4 and give k. 1 Rearrange (2 + 3 - 3)(68r + 218r - 96r) + (-5r + r + 3r)(3 - 2 + 3) to the form pr + i and give p. 376 Rearrange -18b*2 + 3b*2 + 2b*2 + 1 + 2b*2 + 7b*3 + 2b*2 to the form j + cb*2 + zb + mb3 and give c. -9 Express 209k + 46k + 57k as uk + n and give u. 312 Rearrange (21 + 13 + 68)(2q - q + 10q) to the form jq + u and give j. 1122 Rearrange i2 - 1770i + 2i2 + 1761i to bi2 + oi + p and give b. 3 Express -3v2 + 4v + 59 - 68 - 6v in the form yv*2 + kv + u and give y. -3 Express 3w3 + 0w*3 - w + 5 - 11 in the form dw*2 + n + rw*3 + jw and give j. -1 Express -427 + 2d2 - 397 + 866 in the form gd*2 + v + ld and give g. 2 Rearrange (-5v - 29v - 50v + (1 + 3 - 6)(4v - 3v + 0v))(-2v3 + 4v3 - v3) to the form hv + kv*3 + jv*2 + g + rv*4 and give r. -86 Rearrange -84i*3 - i + 10i + i + 87i3 to m + li + wi2 + zi*3 and give l. 10 Express (-5j*4 + 2j4 - j4)(-444 + 120 + 213) in the form bj + r + mj2 + dj*3 + lj*4 and give d. 0 Rearrange -j + 0j - j + (-9 - 14 - 13)(0 - 3j + 0) to the form l + qj and give q. 106 Rearrange 2n2 + 16 + n2 + 2n3 - n2 + n2 to the form rn + g + ln3 + kn*2 and give l. 2 Express (-5r - 1 + 1)(0r - 5r + 4r) + 10r2 - 69r*2 + 4r*2 in the form sr + ur2 + a and give u. -50 Express (-4 + f3 - 4f*4 + 1 + 6f*4)(-172 + 320 - 174) as nf2 + d + of*3 + lf*4 + xf and give d. 78 Express (-1 + 1 + 2)(-2f - f + f) + 3 - 3 + 2f - 1 + 59f - 23f + 48f in the form n + gf and give n. -1 Express ((-2 - 3 + 7)(0 + 0 + 2) - 3 - 3 + 3)(20 + 33k - 20) + k - 14k - 2k in the form hk + n and give h. 18 Express 56 - 54 + o3 - 3o4 - o4 - 10o2 + 7o + 10o2 in the form yo*4 + bo*2 + xo*3 + g + do and give d. 7 Express (208 - 208 + 272k)(-2k + 0k + 3k)(1 + 3 - 2) in the form i + mk2 + ck and give m. 544 Rearrange 391y - 142y - 40y to q + fy and give f. 209 Rearrange 56k2 + 2 + k3 + 38k*2 - k - 76k*2 to pk + s + uk3 + dk*2 and give u. 1 Rearrange 3a*3 - 47662 + 47635 + 2a + a*3 to da*2 + ka + o + qa3 and give k. 2 Express -86y - 60 - 823y + 29 + 31 as f + oy and give o. -909 Rearrange 10i2 - 218 + 13i*2 + i + 433 - 219 to v + qi + bi2 and give v. -4 Rearrange (4 + t2 - 4)(1 - 2 - 1)(1 - 3 - 5) to dt + xt2 + r and give x. 14 Express (d2 + 3d*2 + 0d*2)(-3 - 27 + 2)(-1 - 7 + 5) in the form od + hd2 + v and give h. 336 Express 5a*2 - 3a*2 + 308 - 765 as n + ka*2 + ra and give k. 2 Express (-2k + 2k - 2k3)(5 - 1 - 2) - 66 + 66 + 53k3 as nk*2 + ck + w + jk3 and give j. 49 Express 191 - 191 - 36x - 278x as fx + g and give g. 0 Rearrange 113 + 3b3 - b2 - 2b*4 - 53 - 58 to mb + k + ab2 + ob*3 + ub*4 and give a. -1 Express -14a*2 - 5a*2 + 0a*2 - a - 5a*2 + 2a*3 as ma*3 + ka + t + ca2 and give c. -24 Express 142o - 287o - 2o2 + o3 - 1 - 6o4 + o3 + 147o in the form go + jo*3 + wo*2 + qo*4 + a and give g. 2 Rearrange (-3 + 4 - 4)(3p + 2p*2 - 4578 + 4578) to c + yp*2 + jp and give j. -9 Rearrange -4f - 11f*2 + 1299 + 8f - 1299 + 21f to wf + d + pf2 and give p. -11 Rearrange (0 + 1 + 2)(-1 + 4 - 1)(1 - 1 - 2)(-3h4 + 24 - 24) to z + wh*4 + lh*3 + rh*2 + uh and give w. 36 Express (-2 + 5 - 1)(4k + k - 2k) + 4k - 3k + k as tk + z and give z. 0 Rearrange -2j2 - 18j - 2j3 + 31j - 4 + 6j - j4 + 2j*2 to fj*2 + uj*4 + xj + q + sj3 and give x. 19 Rearrange (-5g + 5g - 2g)(2g - g - 3g) + 902053 + g2 + 264g - 902053 to the form vg + fg*2 + a and give a. 0 Express 14c - 472 + 472 in the form hc + w and give h. 14 Express 53f - 50f - 25f*3 - 8 - 2f*4 + 9f*2 + 24f*3 in the form if*4 + qf*3 + z + of + cf2 and give z. -8 Rearrange 2g*2 - 22g*4 + 7g*4 + 3g*4 + 2g + 6g4 - 5g*3 to the form lg*4 + wg*3 + m + ig*2 + ng and give m. 0 Rearrange (-2m2 + 4 - 4)(-5 + 2 + 4) - 5077m2 - 37m + 109m - 39m - 33m to km*2 + x + tm and give k. -5079 Express -4050r2 + 0r3 - r3 + 4151r2 - 7r*3 + 2 - 2 + (-r + 0 + 0)(r2 + r2 - 3r2) in the form nr*3 + gr*2 + wr + o and give o. 0 Rearrange -2 + 624x - 1943x - 2 + 4 to the form nx + s and give n. -1319 Rearrange (-123x - 130x + 59 + 248x)(-1 + 2 - 2) to o + zx and give o. -59 Express (0 + 0 + 1)(2k + 0k + 7k)(2 + 5 + 12) in the form mk + l and give m. 171 Express (-9c2 - 37c*2 - 4c*2)(2c + 40 - 19 - 11 - 16) in the form rc + vc3 + l + qc*2 and give v. -100 Express 15h - 4h + 918 - 924 as kh + f and give k. 11 Rearrange -15t2 + 127 + 17t*2 + 0 + 19 to the form o + kt + pt2 and give p. 2 Rearrange (0x - 3759 + 3546 + x)(-x3 + 3 - 3) - x4 - x4 + 0x*4 to the form mx*2 + l + gx*3 + zx*4 + jx and give g. 213 Express (-6p + 8p + 8p)(-14p2 - 7p*2 + 13p2) + p3 + 2p3 - 5p*3 as np*3 + w + zp*2 + tp and give n. -82 Rearrange (3 - 3 + 2)(-4 + 4 - 2j) - 3156j - 3 + 1574j - 35 + 1574j to dj + z and give d. -12 Rearrange (2v - 5v + 2v)(-2 + 6 - 2) + 27287v + 3 + 5 - 27688v to the form tv + q and give q. 8 Rearrange (-x3 - 2x*3 - 109x*4 + 150x*4)(-2 - 6 + 2) to the form rx2 + o + sx + zx4 + kx*3 and give z. -246 Express (90c*3 + 2504c - 2504c)(9c - 5 + 5) in the form jc*3 + zc + qc2 + i + yc*4 and give y. 810 Express 5r*2 + 4 - 16r - 4 + 3r + 11r as cr + k + gr*2 and give g. 5 Rearrange 83u*2 - 26u*2 + 121u*2 to the form n + ku + bu2 and give b. 178 Express -z2 + 166z - 17z + 1 + 0z*2 as bz*2 + jz + l and give l. 1 Rearrange 524d - 44d - 190d to p + cd and give c. 290 Rearrange ((4 - 1 - 1)(2 + 3 - 3) + 3 - 1 - 1)(4g - 12g - 138g) to the form vg + q and give v. -730 Express -314b - 2b*3 + 5b*4 - 308b + 11b2 + 625b in the form db + fb*3 + jb*2 + tb*4 + s and give d. 3 Express (0z - z + 0z + (-2 - 1 + 2)(-2z - 2 + 2) - 4z - 16 + 16)(1 - 3 - 5)(-1 - 4 - 4)(-2 + 2 - 1)(2 + 2 - 3) in the form h + dz and give d. 189 Express -7n*3 + 10n + 6*	{ "pile_set_name": "DM Mathematics" }
, -141, -238, -371, -546? -h*3 - 3h*2 - 9h + 7 What is the a'th term of -38, -174, -408, -740, -1170? -49a2 + 11a What is the q'th term of 500, 2011, 4530, 8057, 12592? 504q2 - q - 3 What is the t'th term of -741, -727, -695, -639, -553, -431? t3 + 3t*2 - 2t - 743 What is the g'th term of 122, 879, 2918, 6881, 13410, 23147? 107g3 - g2 + 11g + 5 What is the h'th term of 24, 117, 368, 855, 1656, 2849, 4512, 6723? 13h3 + h2 - h + 11 What is the h'th term of 144, 284, 420, 552, 680, 804, 924? -2h*2 + 146h What is the k'th term of 4395, 8791, 13187, 17583, 21979? 4396k - 1 What is the m'th term of 0, -8, -30, -72, -140, -240, -378? -m3 - m2 + 2m What is the c'th term of 109, 214, 317, 418, 517, 614? -c*2 + 108c + 2 What is the p'th term of 92, 106, 120, 134, 148, 162? 14p + 78 What is the w'th term of -16, -64, -146, -262? -17w*2 + 3w - 2 What is the p'th term of 98, 55, -16, -115, -242? -14p2 - p + 113 What is the n'th term of -334, -343, -358, -379? -3n*2 - 331 What is the a'th term of 1161, 1165, 1169? 4a + 1157 What is the s'th term of 2943, 2947, 2961, 2991, 3043, 3123? s3 - s2 + 2943 What is the q'th term of 7, -12, -41, -86, -153, -248? -q3 + q2 - 15q + 22 What is the u'th term of 192, 798, 1816, 3252, 5112, 7402, 10128, 13296? u3 + 200u2 - u - 8 What is the a'th term of -1383, -1382, -1395, -1428, -1487, -1578, -1707, -1880? -a3 - a*2 + 11a - 1392 What is the s'th term of 177, 211, 245, 279, 313? 34s + 143 What is the q'th term of -19, -10, 13, 56, 125, 226, 365? q3 + q2 - q - 20 What is the p'th term of -184, -324, -466, -610, -756, -904, -1054? -p2 - 137p - 46 What is the z'th term of 222, 214, 214, 234, 286, 382? 2z3 - 8z*2 + 2z + 226 What is the i'th term of 25, 27, 31, 37, 45? i2 - i + 25 What is the q'th term of -53, -51, -39, -11, 39, 117, 229? q3 - q*2 - 2q - 51 What is the y'th term of -12, -21, -28, -33, -36? y*2 - 12y - 1 What is the n'th term of 45, 13, -17, -45? n*2 - 35n + 79 What is the p'th term of -28, -21, -12, -1, 12, 27, 44? p*2 + 4p - 33 What is the s'th term of -5008, -5008, -5006, -5002, -4996, -4988? s*2 - 3s - 5006 What is the p'th term of -1, 1, 3, 5? 2p - 3 What is the o'th term of 1, -4, -7, -2, 17, 56, 121? o3 - 5o*2 + 3o + 2 What is the n'th term of -36, -34, -30, -24, -16, -6, 6? n*2 - n - 36 What is the s'th term of 102, 201, 300, 399, 498, 597? 99s + 3 What is the i'th term of 124, 248, 372, 496, 620? 124i What is the i'th term of 309, 662, 1015, 1368, 1721, 2074? 353i - 44 What is the x'th term of 150, 283, 496, 783, 1138, 1555? -x*3 + 46x*2 + 2x + 103 What is the b'th term of 9, 10, 9, 0, -23? -b*3 + 5b*2 - 7b + 12 What is the k'th term of 3456, 6901, 10334, 13749, 17140, 20501, 23826? -k*3 + 3452k + 5 What is the g'th term of -931, -945, -975, -1027, -1107? -g*3 - 2g2 - g - 927 What is the s'th term of -8, -2, 14, 46, 100, 182, 298, 454? s3 - s*2 + 2s - 10 What is the w'th term of -28, -38, -70, -136, -248? -2w3 + w2 + w - 28 What is the d'th term of -551, -1112, -1689, -2288, -2915, -3576? -d3 - 2d*2 - 548d What is the j'th term of 4634, 9271, 13908, 18545, 23182, 27819? 4637j - 3 What is the d'th term of -31, -36, -51, -82, -135, -216? -d3 + d2 - d - 30 What is the b'th term of 15, 50, 109, 192, 299, 430, 585? 12b*2 - b + 4 What is the b'th term of -107, -164, -259, -392, -563, -772, -1019? -19b2 - 88 What is the x'th term of 590, 586, 580, 572, 562, 550, 536? -x2 - x + 592 What is the k'th term of 2151, 4302, 6453, 8604? 2151k What is the s'th term of -52, -87, -110, -115, -96? s3 - 42s - 11 What is the w'th term of 175, 329, 485, 643? w*2 + 151w + 23 What is the b'th term of -6081, -12160, -18239, -24318? -6079b - 2 What is the t'th term of 165, 354, 543, 732? 189t - 24 What is the j'th term of -2, 10, 30, 64, 118? j*3 - 2j*2 + 11j - 12 What is the s'th term of -8, -2, 4, 10? 6s - 14 What is the c'th term of -13, -45, -81, -109, -117? 2c*3 - 14c*2 - 4c + 3 What is the w'th term of -24, -11, 22, 87, 196, 361? 2w3 - 2w*2 + 5w - 29 What is the a'th term of -318, -332, -356, -390? -5a2 + a - 314 What is the f'th term of -886, -1772, -2658, -3544, -4430? -886f What is the q'th term of 3, 19, 59, 135, 259, 443, 699, 1039? 2q3 + 2q - 1 What is the u'th term of -11, -4, 3, 10? 7u - 18 What is the d'th term of 38, 33, 24, 11, -6? -2d*2 + d + 39 What is the x'th term of -394, -1412, -3108, -5482? -339x2 - x - 54 What is the z'th term of -72, -74, -78, -84? -z2 + z - 72 What is the l'th term of 7, 36, 95, 190, 327, 512, 751? l*3 + 9l*2 - 5l + 2 What is the g'th term of -123, -487, -1093, -1941, -3031? -121g2 - g - 1 What is the z'th term of -268, -238, -210, -184, -160, -138? -z2 + 33z - 300 What is the f'th term of -1580, -1581, -1584, -1589, -1596, -1605, -1616? -f*2 + 2f - 1581 What is the a'th term of 233, 231, 229, 227? -2a + 235 What is the b'th term of 124, 131, 142, 157, 176, 199, 226? 2b2 + b + 121 What is the i'th term of 74, 69, 72, 89, 126? i3 - 2i2 - 6i + 81 What is the v'th term of -11, -12, -17, -26, -39, -56? -2v2 + 5v - 14 What is the q'th term of -240, -493, -754, -1023, -1300, -1585, -1878? -4q2 - 241q + 5 What is the x'th term of -25, -66, -137, -238, -369, -530, -721? -15x2 + 4x - 14 What is the o'th term of -171, -167, -151, -117, -59, 29, 153, 319? o*3 - 3o - 169 What is the c'th term of 24, 52, 92, 150, 232? c*3 + 21c + 2 What is the x'th term of 4820, 4821, 4822, 4823? x + 4819 What is the b'th term of -301, -306, -315, -328, -345, -366, -391? -2b2 + b - 300 What is the w'th term of 5, 32, 97, 218, 413, 700? 3w3 + w2 + 3w - 2 What is the q'th term of -45, -74, -103? -29q - 16 What is the d'th term of -15, -46, -97, -168, -259, -370, -501? -10d2 - d - 4 What is the y'th term of 72, 144, 220, 300, 384, 472? 2y*2 + 66y + 4 What is the u'th term of 990, 1010, 1044, 1092, 1154, 1230? 7u2 - u + 984 What is the r'th term of 327, 638, 957, 1290, 1643? r3 - 2r*2 + 310r + 18 What is the x'th term of -8, 19, 84, 205, 400, 687, 1084? 3x3 + x2 + 3x - 15 What is the k'th term of 281, 565, 847, 1127, 1405, 1681? -k*2 + 287k - 5 What is the z'th term of 292, 289, 286, 283, 280, 277? -3z + 295 What is the m'th term of 2493, 2476, 2453, 2430, 2413, 2408, 2421? m3 - 9m*2 + 3m + 2498 What is the q'th term of 1291, 2581, 3871? 1290q + 1 What is the z'th term of 1951, 1945, 1929, 1897, 1843, 1761? -z3 + z2 - 2z + 1953 What is the u'th term of -64, -98, -132? -34u - 30 What is the h'th term of -144, -145, -146, -147, -148? -h - 143 What is the c'th term of -51, -52, -55, -60, -67, -76, -87? -c2 + 2c - 52 What is the v'th term of 5, 28, 53, 80, 109? v*2 + 20v - 16 What is the b'th term of 6, -5, -26, -63, -122, -209? -b3 + b2 - 7b + 13 What is the z'th term of 10, -9, -54, -137, -270, -465? -2z3 - z2 - 2z + 15 What is the g'th term of 63, 63, 61, 57? -g2 + 3g + 61 What is the m'th term of -299, -1189, -2673, -4751, -7423, -10689? -297m2 + m - 3 What is the h'th term of 407, 819, 1231, 1643? 412h - 5 What is the x'th term of 200, 401, 602? 201x - 1 What is the w'th term of -274, -413, -554, -697? -w2 - 136w - 137 What is the v'th term of 192, 409, 626? 217v - 25 What is the x'th term of -8201, -8209, -8223, -8243? -3x*2 + x - 8199 What is the d'th term of -611, -614, -617, -620, -623? -3d - 608 What is the q'th term of -1354, -1360, -1370, -1384, -1402, -1424, -1450? -2q2 - 1352 What is the h'th term of 434, 435, 436? h + 433 What is the h'th term of -9, -42, -59, -54, -21? h3 + 2h*2 - 46h + 34 What is the h'th term of 69, 104, 143, 186, 233, 284? 2h2 + 29h + 38 What is the c'th term of 568, 567, 566, 565, 564, 563? -c + 569 What is the w'th term of -288, -286, -284, -282? 2w - 290 What is the o'th term of -177, -356, -549, -762, -1001, -1272, -1581, -1934? -o3 - o2 - 169o - 6 What is the r'th term of 21, 36, 59, 90, 129? 4r2 + 3r + 14 What is the z'th term of -25, -131, -419, -979, -1901, -3275? -15z3 - z2 + 2z - 11 What is the f'th term of 211, 209, 207, 205, 203, 201? -2*f + 213 What	{ "pile_set_name": "DM Mathematics" }
. Let s be (-2)/(12/(-24)). Calculate the lowest common multiple of 3/bs/9 and 18. 36 Suppose 28t = 24t + 36. Calculate the lowest common multiple of 8 and t. 72 Let l be (0 + 2)-14. Let t(r) = r*3 + 7r*2 - 7r + 9. Let c be t(l). Suppose -3h = -c - 5. Calculate the smallest common multiple of 7 and h. 14 Find the common denominator of -10(-305)/420 - 1/3 and -85/16. 112 Let b = -950405/110724 + 2/9227. Find the common denominator of 57/10 and b. 60 Let x = -16 + 26. What is the smallest common multiple of x and 4? 20 Find the common denominator of -13/12 and (-1)/2 - 4/(-10) - -3. 60 Let m = -207809/18 - -11548. What is the common denominator of -49/30 and m? 90 What is the common denominator of 11/35 and ((-8)/(-44) + 69/(-198))10? 105 Let d = 12 + -22. Let q = 2 + d. Calculate the common denominator of -57/22 and 2/(q/29) - -2. 44 Let w = 75784040/187 + -405264. Let d = w + -47/34. Calculate the common denominator of -41/22 and d. 22 Let m(f) = -f + 4. Let a be m(4). Suppose an - 5n - 2v + 40 = 0, -n - 3v + 8 = 0. What is the least common multiple of 16 and n? 16 Let f(c) = -c - 1. Let o(d) = 8d + 9. Let j(l) = 51f(l) + 6o(l). Calculate the least common multiple of 20 and j(-5). 180 Suppose -4c = -4b + 24, -5c + 4c - 3 = 2b. Calculate the common denominator of (34 - -3)1/(-3) and b + -2 + (-46)/(-6). 3 Let k(q) = -q. Let m(u) = 2u - 1. Let d(g) = -3k(g) - m(g). Let b be d(-6). Calculate the common denominator of 42/b + (2 - 0) and 59/7. 35 Let b = 25 + -49. Let u be (32/b)/((-4)/(-30)). What is the least common multiple of 8 and (-6)/u - 312/(-30)? 88 Suppose 4k = -938 - 894. What is the common denominator of -76/3 and k/170 - 8/(-20)? 51 Let v be ((-267)/9 - -1)-9. Let z be 3/((-573)/v - -2). Let w = 2259/95 + z. What is the common denominator of -101/10 and w? 10 Suppose -4k - 142 = -3z, z - 2k - 47 - 3 = 0. Find the common denominator of (-29)/9 + (-4 - -1 - -2) and z. 9 Suppose 5w - 45 = -0w. Suppose 3k - 5k + 14 = 0. Let y = 11 - k. What is the lowest common multiple of w and y? 36 Let q be ((-4)/(-2) - 2) + -44. Let u = -22 - q. Suppose -b + 1 + 5 = 0. Calculate the lowest common multiple of u and b. 66 Let w(c) = -4c - 1. Find the common denominator of 24/7 and w(4). 7 Let t = 3898 - 5619. Let l = t - -18958/11. Find the common denominator of -9/11 and l. 11 Calculate the lowest common multiple of 4 and (3 + -3 + (-2 - 8))-2. 20 Let u(f) = -f3 - 3f*2 - 3f - 3. Calculate the least common multiple of u(-3) and 8. 24 Let f(w) = w*3 + 6w*2 + 4w + 6. Let u(i) = -i*3 - 2i*2 - 4i - 2. What is the least common multiple of f(-5) and u(-2)? 66 Let g = -12304 + 270641/22. Find the common denominator of -99/4 and g. 44 Let q(x) = x*2 + 7x - 8. Calculate the lowest common multiple of q(-9) and 9. 90 Let f(r) = 14r2 + 4. Calculate the lowest common multiple of 9 and f(2). 180 Find the common denominator of 2/9 - (-669)/(-54) and 2((-6)/(-15))/2. 30 Let n = 72 - 54. What is the lowest common multiple of 6 and n? 18 Calculate the common denominator of 99/10 and ((-195)/66 - 1) + 2. 110 Let c = -132379/18 - -7357. Suppose -2w = -5w - 66. Calculate the common denominator of 1/2 - w/(-1) and c. 18 Let j = 227/16 + -99/8. Let l = -407/48 + j. Find the common denominator of -37/15 and l. 15 Let n be 6/(-75)-5-10. Suppose -3m - 3o = 33, 3m + 0o + 27 = 3o. Let c = n - m. What is the smallest common multiple of 6 and c? 6 Find the common denominator of ((-279)/30)/((-16)/(-10)) and 43/22. 176 Find the common denominator of -5 + 5 + 13/2 and -54/7. 14 Let t = 31/45 - -3397/360. Calculate the common denominator of t and 45/8. 8 Let t(v) = 11v*2 - 2v - 2. Calculate the least common multiple of t(-1) and 9. 99 Let h(k) = -5k - 1 + 0k - 2. What is the least common multiple of (-1 - 0)1 - -27 and h(-3)? 156 Let h be (-3 - 0)/((-5)/(-20)). Let m be ((-142)/4)/((-3)/h). Calculate the smallest common multiple of 12 and (-6)/21 - m/7. 60 Suppose 2d - 5 = 13. Calculate the lowest common multiple of 1 and d. 9 Let f be (-1)/3-3 - -2. Suppose 4z - f = 77. What is the lowest common multiple of z and 22? 220 Let y be 12/1(-21)/(-6). Find the common denominator of (44/y)/((-24)/(-14)) and -9/2. 18 Let r be (-2)/515/(-3). Let y(j) = j + 7jr + j + 2j*2 - 1 - 4j2. What is the least common multiple of 8 and y(1)? 24 Let n = 47635/2343 - -2/781. Find the common denominator of n and 55/58. 174 Let n = 177549/171127376 + -6/52687. Let l = -2055/406 - n. Let s = 1239/34 + 1/17. What is the common denominator of s and l? 16 Let y = -1971/2 - -1034. What is the common denominator of y and 75/14? 14 Let l = -1/26032089590 - -2933712368452987/477610747707730. Let f = -1/2621 - l. Calculate the common denominator of 2/9 and f. 63 Let u(g) = -g2 + 13g + 6. What is the least common multiple of u(13) and 2? 6 Suppose -l + 5l = -136. Let q = -22 - l. Let k = 4 + q. Calculate the smallest common multiple of 14 and k. 112 Let u = -32684855/6066336 + -5/209184. Let c = 4/29 + u. Find the common denominator of -111/22 and c. 44 Let n be -7 + 9 - (-56639)/(-14). Let y = -4046 - n. Calculate the common denominator of 5/6 and y. 42 Calculate the lowest common multiple of 22/4 - 3/(-6) and 0/2 + (-1 - -3). 6 Suppose -7r + 168 = -0r. What is the smallest common multiple of r and 3? 24 Suppose 0 = -3k + 62 + 4. Suppose -3f + 4 = -2. Suppose -18 = -fl - 6. Calculate the least common multiple of l and k. 66 Suppose -36 = 10f - 19f. What is the smallest common multiple of 22 and f? 44 Let g be (-3)/256/21. Find the common denominator of (414/(-60))/(g/5) and 53/22. 88 Let j be (-128167859)/(-20) + 1/(-2). Let y = 6404394 - j. Let g = 3995 + y. Find the common denominator of 13/10 and g. 20 Let i = 3 + -1. Suppose ip + 0p = 24. What is the least common multiple of p and 18? 36 Let u = 15520/7 + -2221. Let r = u + 248/77. Let l = -4132 - -45486/11. What is the common denominator of r and l? 11 Suppose -2a + 18 = w - 8, 4a + 3w - 56 = 0. Suppose ac = 7c + 16. Calculate the lowest common multiple of 6 and c. 12 Find the common denominator of 171/860 + ((-3)/5 - -1) and -9/20. 860 Suppose 2i + 2046 = -2d, -2d + 4d - 2i = -2038. Let c = d - -11193/11. What is the common denominator of -47/11 and c? 11 Let o = -1/1442 - -876/721. Calculate the common denominator of o and 73/14. 14 Let k be ((-39)/(-6))/((-2)/(-92)). Calculate the common denominator of 12/(-30) - k/(-60) and 5/22. 132 Suppose 160 = 4l + l. Suppose l = -2i + 4i. Let w = -1018 + 1028. What is the smallest common multiple of w and i? 80 Let w = -158765/18 + 8825. Let o = -2 + 1. What is the common denominator of o + (-2)/(-16) + -2 and w? 72 Suppose 2c = -0c + 8. Suppose -2j + 0j + 2 = 0, -cj - 1 = 5r. Let h(t) = -8t*3 + 2t*2 + 2t + 1. What is the smallest common multiple of h(r) and 4? 36 Let h be (6/(-2408))/(135/(-104022)). Let m = -6/301 + h. Find the common denominator of 44/3 and m. 30 Let x = 2046/17 + -45607/374. Find the common denominator of -30/11 and x. 22 Suppose 0 = -k - 5b + 23, -3k - 14 = -k - 5b. Suppose -kx - x = 0. Suppose 3n - n - 4 = x. What is the lowest common multiple of 8 and n? 8 Let y = 13 + -11. Calculate the smallest common multiple of y and 6. 6 Suppose 12 = 3v, -2z + 82 = 3z - 2v. Calculate the least common multiple of z and 3. 18 Suppose 3s - 35 = 34. Let k = s - 13. What is the common denominator of 103/22 and ((-102)/k)/(24/30)? 44 What is the lowest common multiple of (1/3 - (-266)/(-6))/(-2) and 16? 176 Let p = 1 + 0. Calculate the least common multiple of 10 and -5(3/(-5) - p). 40 Let r(d) be the third derivative of d4/24 + d2. Calculate the least common multiple of r(6) and 20. 60 Let a be ((-30)/7)/((-12)/56). Calculate the common denominator of -139/18 and 4/(-4) - (-262)/a. 90 Suppose -3t = t - 8. Let q be (-4)/(6/3) - -2. Suppose -25 = -3c - 0x + x, q = -tc + 4x + 10. Calculate the smallest common multiple of 6 and c. 18 Suppose 0 = -v - 3j + 10, 4j + 2 - 16 = -2v. Let s(r) = -6r*3 - 2r*2 - r. Let h = 3 - 4. What is the smallest common multiple of s(h) and v? 5 Suppose -10q = -11*q - 45. Find the common denominator of (10/3)/((-48)/153) and q. 8 What i	{ "pile_set_name": "DM Mathematics" }
0.5? -2/13 What is the fourth biggest value in 0, 0.1, 11, 5/4? 0 Which is the smallest value? (a) -19 (b) -13/2 (c) 10 a Which is the biggest value? (a) -1/2 (b) -0.4 (c) 4/2719 c What is the third smallest value in -1/6, -5, -3/29? -3/29 What is the biggest value in -3, -2.9, -5, -7/2? -2.9 Which is the second biggest value? (a) -127.6 (b) -2/3 (c) -5 (d) 0.4 b Which is the third biggest value? (a) -3/14 (b) 0.5 (c) -1/83 a What is the biggest value in -0.1, -9, 11/5? 11/5 Which is the biggest value? (a) -0.17 (b) 0.2 (c) -2/3 b Which is the third smallest value? (a) 0.1 (b) -284 (c) 1/4 c Which is the fifth biggest value? (a) 3/4 (b) -2/13 (c) 1 (d) -19 (e) -5 d What is the fifth smallest value in -2/3, -0.5, 4, 3, -77? 4 Which is the fifth smallest value? (a) 3/7 (b) -1/4 (c) 4/13 (d) -0.5 (e) 1/2 e Which is the third smallest value? (a) 0.2 (b) 5.2 (c) -6 b What is the second biggest value in 10, 4, 1, 1/5, 3? 4 What is the fourth smallest value in 1/3, 0.4, 0, -1/5? 0.4 What is the fifth biggest value in 1, -6, 3/8, 5, -3? -6 What is the biggest value in -0.054, 1/3, 1? 1 What is the second smallest value in -2/5, 0, 0.4, 70? 0 What is the second smallest value in -8, -2/3, 0.234? -2/3 Which is the second biggest value? (a) -5 (b) -3 (c) -1/3 b Which is the third biggest value? (a) -1/2 (b) 3 (c) -0.093 (d) -0.3 (e) -0.2 e Which is the smallest value? (a) 2 (b) -4/3 (c) -5/3 c What is the biggest value in 81, -2, 3? 81 What is the smallest value in -5, 2.9, 2/3? -5 What is the fourth biggest value in -1, 0.9, -2, -0.5, -6/7? -1 What is the smallest value in 1, 1.3, 2/13, -1/6? -1/6 Which is the smallest value? (a) 0 (b) 2/13 (c) -0.5 (d) 5 (e) 0.01 c What is the fourth biggest value in 0.03, -5/2, -0.12, 4? -5/2 What is the third biggest value in 0.2, -4/3, -0.5? -4/3 What is the smallest value in 5/4, 0.1, -2/33, -2/5, -3? -3 What is the second biggest value in -1, -20, -4? -4 Which is the biggest value? (a) 17 (b) -4/9 (c) 2 (d) 0 a What is the biggest value in -0.2, -0.8, -2/3, 2? 2 What is the biggest value in -1/4, -4/7, 3/163, 5/3? 5/3 Which is the biggest value? (a) 5/3 (b) -0.5 (c) -1151 a What is the third biggest value in 82, -3, -0.3, -2/3? -2/3 Which is the third biggest value? (a) 7 (b) 4 (c) 1/7 c What is the fifth biggest value in -6, -4, -3, -2/7, 11? -6 Which is the second smallest value? (a) -2/5 (b) 4 (c) 4.5 (d) -4 a Which is the biggest value? (a) -255 (b) 2 (c) -3 b Which is the third biggest value? (a) 2 (b) 3/2 (c) 0.18 (d) 0.07 c What is the third smallest value in 0, -145, 0.5? 0.5 What is the third biggest value in -6/5, 4, 2/3? -6/5 Which is the smallest value? (a) -1/30 (b) 2 (c) -1/3 c What is the third smallest value in 2.1, 1/4, -5, 0? 1/4 Which is the smallest value? (a) -0.5 (b) 2/13 (c) -3 (d) 0.1 (e) 0.168 c What is the second biggest value in 3, 403/5, -0.2, 5? 5 What is the second smallest value in -3, -8, -22/3? -22/3 What is the fifth biggest value in 0.3, -2/13, -4, -6, 8? -6 Which is the smallest value? (a) 0.2 (b) 5 (c) -24 c What is the fourth smallest value in -1, 7, -31, 5? 7 What is the third biggest value in 4, -4, 183, -2/9, 2/9? 2/9 What is the third smallest value in -2/7, 2, -0.05, -3? -0.05 What is the biggest value in 2/7, -0.128, 0.5? 0.5 Which is the third biggest value? (a) 3/2 (b) 8 (c) 75 a Which is the smallest value? (a) -2 (b) 228 (c) 0.2 a Which is the fourth smallest value? (a) 0 (b) -0.5 (c) 0.5 (d) 415 d Which is the second biggest value? (a) 18 (b) 1 (c) -4 b What is the second biggest value in -4, -5, 2/3, 3/7, 106? 2/3 Which is the third biggest value? (a) 2 (b) -1/5 (c) -3/7 (d) 3 (e) -0.3 b Which is the second smallest value? (a) -1/4 (b) -3/10 (c) 0.2 (d) 5 (e) 3/2 a Which is the third smallest value? (a) -4 (b) -2/5 (c) 5 (d) 4 (e) 2 e Which is the third smallest value? (a) -2/5 (b) 0.1 (c) 5 c Which is the third biggest value? (a) 0.1 (b) -24 (c) 2/25 (d) -0.4 d What is the smallest value in -1, 5, -4, 4? -4 Which is the second biggest value? (a) -59 (b) -1 (c) 1/4 (d) 3/8 c What is the smallest value in 0.6, 8/3, 2, -0.2? -0.2 Which is the third biggest value? (a) 1/2 (b) -3 (c) 36 (d) 0.2 d Which is the second smallest value? (a) -77 (b) -0.4 (c) 0 (d) -2 (e) -1 d Which is the biggest value? (a) -0.3 (b) -3 (c) -1.3 (d) -2/9 (e) -2/5 d Which is the fourth smallest value? (a) 5 (b) -4 (c) -0.14 (d) 0.3 a What is the second biggest value in -0.04, 0.03, -10, -0.13? -0.04 Which is the fourth biggest value? (a) -4 (b) 0.076 (c) -0.5 (d) 2 a What is the second biggest value in 0.3, 8/47, 2/9? 2/9 Which is the smallest value? (a) -1 (b) 2 (c) -0.4 (d) 6 (e) 3 a What is the smallest value in -1/5, 2, -2, -5, 78? -5 Which is the fourth smallest value? (a) -2 (b) 1 (c) -4 (d) -6/7 (e) -3.32 d Which is the smallest value? (a) -3 (b) 0.2 (c) -0.6 (d) -2 a Which is the biggest value? (a) 327 (b) 5 (c) 2/3 a Which is the third smallest value? (a) 4 (b) -3 (c) 8 (d) 1 (e) 0.5 d What is the fourth smallest value in -5, -0.6, 1/4, -12, -0.1? -0.1 Which is the third smallest value? (a) -2/13 (b) -0.1 (c) 2 (d) 3/4 d What is the third smallest value in -6, 0.2, -4, -3/8? -3/8 Which is the second smallest value? (a) 6 (b) -3/65 (c) 4 c What is the second biggest value in 0.3, -35, 2, -4? 0.3 What is the smallest value in 0.3, -3/2, 1/2, 3/5? -3/2 Which is the third smallest value? (a) -878 (b) -6 (c) 5 c What is the second biggest value in -3, -2/7, 0.05, -1/5? -1/5 What is the third biggest value in -2/11, 5, 6, 2? 2 What is the third biggest value in -27/2, 5, 0.4? -27/2 Which is the fourth smallest value? (a) 5 (b) 3 (c) 1 (d) -5 a Which is the second smallest value? (a) -5/2 (b) -29 (c) 1 (d) -1 a Which is the third biggest value? (a) -3/2 (b) -1/3 (c) -6 (d) -0.6 a Which is the third smallest value? (a) -2/5 (b) 2 (c) 7/6 (d) -1/4 (e) -3/4 d What is the third biggest value in -18, -0.5, 1, -2/5? -0.5 What is the fourth smallest value in -2/11, -2/15, 20, 2? 20 What is the smallest value in -84, -5, -1, -1/3? -84 Which is the third smallest value? (a) 1/7 (b) 0.04 (c) 0 a Which is the third biggest value? (a) -0.3 (b) -1.66 (c) -3 c What is the fourth biggest value in 3, 5, 194, -2/11? -2/11 What is the third biggest value in 15, -1, -0.38? -1 Which is the third smallest value? (a) -5 (b) -1/19 (c) 0.5 (d) 0.01 d What is the second biggest value in -0.5, -67, 3? -0.5 What is the fifth smallest value in 4, -0.1, 2, -22, -0.5? 4 Which is the third biggest value? (a) 1.4 (b) 1/3 (c) 32 (d) -4 b What is the biggest value in -1580/7, 2/11, -4, -2/5, 0.1? 2/11 What is the biggest value in -2/3, 0, 2/9? 2/9 Which is the third smallest value? (a) 0.5 (b) -0.0532 (c) 0.01 (d) 2/7 d What is the second biggest value in -10, -1/8, 33, -4? -1/8 Which is the smallest value? (a) 4/3 (b) 4 (c) 2/19 (d) 0.11 c What is the biggest value in -0.2, -2/3, 14, 0.3? 14 Which is the fourth smallest value? (a) -35 (b) 2/11 (c) -0.4 (d) 5 (e) -2/3 b What is the smallest value in -22.8, 0, 1? -22.8 What is the second smallest value in -0.5, -0.07, -3/8, 0.3? -3/8 Which is the third biggest value? (a) -2/9 (b) -0.01 (c) -4 c What is the smallest value in 0.004, -24, 0.1? -24 Which is the second biggest value? (a) -1/6 (b) 33/7 (c) -0.5 a Which is the fourth biggest value? (a) -0.9 (b) -0.5 (c) -8 (d) 0 (e) 0.5 a What is the smallest value in 0, -0.1, 1/6, -0.288, 2? -0.288 What is the fourth biggest value in -1/2, -19, -1/7, -3? -19 What is the third biggest value in -14/5, -3, 2/9? -3 Which is the second biggest value? (a) -35 (b) 0.2 (c) -4 c What is the second smallest value in -0.039, 5, 3? 3 What is the fifth biggest value in -0.3, 3/10, -1, 2, 1/5? -1 What is the fourth smallest value in 4, 4/5, 0, -0.5? 4 Which is the third smallest value? (a) 124/3 (b) -1 (c) 1 (d) 3 (e) -3/2 c What is the biggest value in 1/4, 42, 0.5, -3/10? 42 What is the third biggest value in -1, 27, 11.3? -1 Which is the smallest value? (a) 0 (b) 5104 (c) -1/5 c What is the smallest va	{ "pile_set_name": "DM Mathematics" }
. What is the highest common factor of 9 and f? 3 Suppose -2o = o - 1296. Suppose -14f = -2f - o. Calculate the greatest common divisor of 54 and f. 18 Let s(d) = -3d*2 - 4d - 2. Let j be s(-2). Let u be (-106)/j + 2/(-3). Let l = -3470 + 3555. What is the greatest common factor of u and l? 17 Let r = 17 + 19. Let h(t) = -23t + 1. Let l be h(-1). Calculate the greatest common divisor of r and l. 12 Let i be 10 - ((-68)/(-14) - 2/(-14)). Let v be (-5 - 1)/3 + 17. What is the highest common factor of v and i? 5 Let f = 650 - -598. Let v = f + -872. What is the greatest common factor of v and 47? 47 Let w be (-3696)/(-16) - (-1)/(0 + 1). Let t be 1/4 - 1150/(-40). What is the greatest common factor of w and t? 29 Let m(i) = 4i - 4. Let d be m(-4). Let r be 1/(-4) - 25/d. Let v be ((-48)/(-20))/(r/5). Calculate the highest common divisor of 30 and v. 6 Let a = 26 + -15. Suppose -4m - t = -0t + 57, -2m = -t + 27. Let g = a - m. What is the highest common factor of 275 and g? 25 Let y(f) = -f3 + 11f*2 + 16f + 12. Let h be y(12). What is the highest common divisor of 140 and h? 20 Suppose -1758 = -7v + 979. What is the greatest common factor of v and 23? 23 Suppose 15g + 10912 - 34852 = 0. What is the greatest common divisor of g and 12? 12 Let n = 12 - 7. Suppose -3f + 4f = 4. Suppose -3l = -4i - 16 + f, 3i + 20 = nl. What is the highest common divisor of 44 and l? 4 Let m(j) = -j3 - j2 + 5j - 1. Let c be m(-2). Let h(f) = -46f + 47. Let p be h(c). What is the highest common factor of 41 and p? 41 Suppose -2h - h + 3b + 111 = 0, 0 = -3h + 4b + 108. What is the greatest common factor of 180 and h? 20 Let o = 195 - 189. Let b be 10 + 0/2 - -2. What is the greatest common divisor of o and b? 6 Let t = -2082 + 3479. Calculate the highest common factor of 11 and t. 11 Suppose -y = -6d + 3d + 309, -90 = -d - 4y. Let c be (-310)/(-18) + 8/(-36). Calculate the greatest common divisor of d and c. 17 Let s(a) = 106 + 74 + 2a - 133 + 6a. Let i be s(6). What is the highest common factor of i and 38? 19 Suppose -g + 268 = 3x, 33 = -3x + 3g + 285. Suppose -4y + x = -0y. Suppose -458n - 396 = -243n - 227n. Calculate the highest common divisor of n and y. 11 Let p = -77 + 62. Let k = p + 37. Calculate the greatest common factor of 22 and k. 22 Suppose -5v + 416 = -u, 5v - 1533u = -1530u + 408. Let b be 22 + (0 - -1)/(-1). Calculate the highest common divisor of v and b. 21 Let p(a) = 4a*2 + a - 1. Let x(n) = -n + 2. Let r be x(4). Let m = r + 5. Let i be p(m). Calculate the highest common factor of i and 57. 19 Let r = 2 - -4. Suppose 0 = 3t + r, 2t + 87 = 4k - 61. Calculate the greatest common factor of k and 54. 18 Let y(g) = g*3 - 3g*2 + g - 1. Let b be y(2). Let q be ((-30)/(-4))/(b/(-6)). Let i = -301 + 311. What is the greatest common factor of q and i? 5 Let w be 22 + ((-26)/(-6) + -3)-3. Suppose -7j = -wj + 352. Calculate the greatest common divisor of j and 16. 16 Let c = 70 - 47. Let v(q) = 3q3 + q2 - 1. Let z be v(1). Suppose o = -5i + 233, 3o - i + zi = 751. What is the greatest common divisor of o and c? 23 Let o = 181 - 121. What is the highest common factor of 132 and o? 12 Let z = 1655 - 1598. Calculate the greatest common divisor of z and 532. 19 Suppose -5q + 4h - 101 = 62, 0 = -5h - 15. Let c = -83 + q. Let v = c + 202. What is the highest common divisor of v and 12? 12 Suppose -5l = -9o + 4o + 180, 0 = 5l + 4o + 144. Suppose -124b + 123b = 48. Let r = l - b. What is the greatest common factor of r and 128? 16 Suppose -y + 3z + 2 = 0, -5y - 2z = -6 - 72. Let n = y - 6. Let b = 160 - 112. What is the greatest common factor of n and b? 8 Suppose -7s = -0s + 210. Let k = s + 63. What is the highest common divisor of k and 22? 11 Let m = -664 - -822. Calculate the highest common factor of 2 and m. 2 Let t = 6 - 10. Let a be 6/t + (-2)/(-4). Let g be 1 + 0 - 31/a. Calculate the greatest common divisor of g and 32. 32 Let f(k) = -k2 - 6k - 3. Let b be f(-5). Let q = -37 + 65. Let j = 38 - q. What is the highest common divisor of j and b? 2 Suppose 0 = -2b + 3y + 19, 4y + 20 = 0. Suppose -bj = 2c - 342, j = -2j + c + 501. Calculate the highest common factor of 24 and j. 24 Suppose -26t + 42 = -20t. What is the highest common divisor of 77 and t? 7 Let s(j) = j*2 - 6j + 12. Let v be s(4). Suppose 5r + x - 49 = 2r, vr - 64 = -x. Calculate the greatest common divisor of 60 and r. 15 Let p be 136/10 + ((-16)/(-20))/2. Let i(q) = 5q*3 - 4q*2 + 4q - 4. Let s be i(2). What is the greatest common divisor of s and p? 14 Let g(t) = 37t + 44. Let n be g(2). What is the greatest common divisor of 2 and n? 2 Suppose -5q - y = -71, -6y + y + 5 = 0. Calculate the greatest common factor of q and 1694. 14 Let w be (-4 - -9 - -63) + -8. What is the highest common factor of 940 and w? 20 Suppose -3n - 31 - 29 = 0. Let w = -15 - n. What is the greatest common factor of w and 55? 5 Let r be ((-64)/(-10) - 6)/(2/3180). Calculate the highest common factor of r and 12. 12 Suppose d = -3n + 65, n + 3d = 3 + 8. Let y = -1642 - -1665. What is the highest common divisor of n and y? 23 Let y be 32 + -24 - 22. Suppose yr = -2r + 378. Calculate the greatest common divisor of 42 and r. 21 Suppose 3y = -0m - 5m - 235, -2y = -3m - 160. Let l = 127 + m. Let h(s) = -48s - 85. Let n be h(-2). What is the highest common divisor of l and n? 11 Suppose -5o + 4h + 113 = 0, -o = -6o - 3h + 134. Suppose -oi = -13i - 480. What is the greatest common factor of i and 16? 8 Suppose 664m - 728 = 656m. Calculate the highest common divisor of m and 234. 13 Suppose 8 = 3v + v. Suppose 0 = 5l - h - 717, 0l + 282 = 2l - vh. Suppose -32 = -d - d. What is the greatest common divisor of l and d? 16 Suppose -122b - k + 556 = -117b, 0 = 2b - 2k - 232. What is the highest common factor of b and 308? 28 Suppose 2g = -5o + 9 + 27, -3o = 2g - 28. Suppose -gd = -2d - 420. Let z = -11 - -21. Calculate the greatest common factor of z and d. 10 Let u = 2750 - 2050. What is the highest common factor of u and 420? 140 Let r = -11 + 10. Let k be ((-3)/5 - r)20. What is the highest common factor of k and 1? 1 Let k(o) = o2 + 8o + 110. Let l be k(12). Calculate the greatest common divisor of 30 and l. 10 Let a(z) = 23z - 10. Let c(w) = -w2 - 4w. Let j be c(-3). Let l be j + (-2)/2 + 3. Let f be a(l). What is the highest common divisor of f and 15? 15 Suppose -t + 29 = 2s, -64 - 7 = -3t - 2s. Let c = 0 + -51. Let h = 93 + c. What is the greatest common divisor of t and h? 21 Let f = 24 - 19. Suppose -25 = -fh, 0s + h = 3s - 25. Let m be 72/s25/5. Calculate the greatest common divisor of 24 and m. 12 Let x(g) = 883g - 3. Let v be x(1). Calculate the highest common factor of v and 55. 55 Let i be 1530/(-50) - -8. What is the greatest common factor of i and 3? 1 Let k(w) = 2w - 7. Let z be k(5). Let l be 8 - -1 - (-1 + z). Let i = 11 - l. Calculate the greatest common divisor of 32 and i. 4 Let v be ((-7)/(-4))/((-5)/60). Let r = v + 20. Let z = 10 + r. Calculate the greatest common divisor of 18 and z. 9 Let l(z) = -z + 21. Let h be l(0). Let p(y) = -y + 7. Let b be p(7). Suppose b = m - 7. Calculate the highest common factor of h and m. 7 Let z be (-20)/(-12)(-12)/(-10). Let u be 3/(-2) - 1/z. Let h(c) = 89c2 + 3c + 2. Let m be h(u). Calculate the highest common divisor of m and 32. 32 Suppose 11a - 169 = 227. Calculate the greatest common factor of a and 936. 36 Let d = 1029 + -1001. Calculate the highest common factor of d and 8. 4 Let g(w) = 3w*2 - 11w + 8. Let f be g(7). Suppose 12y - f = 15y. Let v = y - -42. Calculate the highest common factor of 144 and v. 16 Let k = 238 + 34. Let i = -292 - -326. Calculate the greatest common divisor of k and i. 34 Let g = 24 - -15. Suppose 0 = -15n + 12n + g. What is the greatest common factor of n and 39? 13 Let v = 12 + -14. Let i(m) = -6m. Let g be i(v). Calculate the highest common factor of 132 and g. 12 Let m be 4 - -336 - (13 - 6). Calculate the highest common factor of 37 and m. 37 Suppose -10h + 2871 = 23h. What is the highest common factor of 3 and h? 3 Let t(i) = 2i*3 + 33i*2 - 21i - 47	{ "pile_set_name": "DM Mathematics" }
ive o. -8 Rearrange 3q2 + 19q*4 - 9q - 3 + 3q3 - q3 + 48q - 18q4 to the form bq + oq2 + a + hq*3 + uq*4 and give b. 39 Rearrange 103 - 222 - 61 - 5z*2 - 136 to cz*2 + w + lz and give c. -5 Rearrange ((-r + 3 - 3)(-r - 2r + 5r) + 2 + r2 - 2)(-10 + 7 + 80) + (r - 1 + 1)(6 + r - 6) + 0r + 0r + r2 to qr*2 + a + kr and give q. -75 Express -5a4 + 3a*2 - 20a*3 - 33a*2 + 35a*2 + 4a*2 - 1 - 10a*2 in the form ga*2 + ja*4 + na*3 + la + d and give j. -5 Rearrange -2i3 + 2i4 + i2 - 14 - 19i4 - i + 16i*4 to the form ji*2 + si*4 + ai + pi3 + t and give s. -1 Express 2r*2 + 2691r - 1131r - 4 - r2 - 1312r as xr + l + vr*2 and give v. 1 Express 257208p + 54 - 54 - 238279p as jp + g and give j. 18929 Express 187g + 502g - 27g + (2g + 3g - 3g)((-3 + 1 + 4)(-4 + 1 + 1) + 2 + 2 - 3 + 0 + 4 + 1) in the form dg + k and give d. 666 Express -119x*2 + 2199x - 121x2 + 439x + 238x2 in the form ux*2 + w + jx and give j. 2638 Express (-3z2 + z2 + 3z*2)(-2z + 3z - 2z) - 1111z*3 - 1088z*3 + 2196z*3 - 454 in the form fz*2 + kz*3 + m + hz and give k. -4 Express -4o3 + 3 + 85o*2 + 3 - 10o*3 - 54o*2 - 35o*2 + o in the form do*2 + b + xo*3 + co and give c. 1 Express -3232f2 - 51f*3 + 82f*3 - 28f*3 in the form j + kf*3 + df*2 + sf and give d. -3232 Rearrange (82813 - 82813 - 173x + (0 - 2 + 0)(3x - x - 3x))(-x + 3x + 3x) to p + zx + rx2 and give r. -855 Express 321 - 895 + 10158q + 243 + 331 as kq + f and give f. 0 Rearrange 4735s - 1125s + 4277s + 42s + 52s to the form ms + f and give m. 7981 Rearrange (-2x + 0x - 2x + (-4x + 6x - x)(1 + 1 - 1))(32x3 - 126x*3 - 162x*3) to b + dx*3 + tx + jx2 + fx*4 and give f. 768 Express 3i - 8i3 - 277 + 11i*2 - 16i*2 + 279 in the form ti*2 + ui + bi3 + m and give u. 3 Express 5r + 4r4 - 2784r*2 + 2786r*2 - 66r in the form tr4 + zr*3 + o + mr + xr2 and give t. 4 Express 20875 - 4j4 - 21621 + j3 - 2j4 as aj + v + mj3 + sj*4 + ij*2 and give s. -6 Express (134r*3 - 19982r + 19982r)(-1970 - 2r + 3921 - 1993) in the form cr*3 + p + ar*4 + ir + xr2 and give p. 0 Express -76541 - 76536 - 1067h + 153082 in the form ih + z and give i. -1067 Express z - 2z + 4497z3 - 2z + 137z2 - 4494z*3 as lz*2 + x + bz + iz3 and give b. -3 Rearrange 1748l*2 - 284l*2 + 12 - 9 - 3 to rl + v + dl2 and give d. 1464 Rearrange 8747k*2 - 7576k*2 + 10992k*2 + k - k - 2k*2 + (2k*2 + 2k*2 - 2k*2)(0 - 1 + 3) to the form nk2 + w + bk and give n. 12165 Express -154 - 881 - 6z + 9z - 4z in the form jz + i and give j. -1 Rearrange 180z - 423z*2 - 93z - z*3 + 3z*3 + 252z + 426z2 + 1 to the form f + uz*2 + iz + dz3 and give u. 3 Rearrange -26g*3 - 2g*4 + 115g + 42g + 2g*2 + 0 + 28g*3 + 93g - 1 to b + dg4 + sg + kg3 + tg*2 and give k. 2 Express -323x + 2 + 972x - 10x*3 - 329x - 2x4 - 323x - 15x2 in the form cx + yx4 + tx*2 + p + rx*3 and give p. 2 Express -119 + 10 - 19 + 3h - 260 + 48 as o + yh and give o. -340 Express 104r*2 - 3 - 124r*2 - 246r*2 + (-3r - r*2 + 3r)(1 - 1 - 1) in the form fr + a + mr2 and give a. -3 Rearrange -i + 72638 - 72638 + 16255i*2 to the form z + ci*2 + yi and give c. 16255 Rearrange 292b2 + 195 - 12b + 12b - 198 to the form ab*2 + f + jb and give a. 292 Rearrange (2256 - 2256 - 123z)(1 - 2z - 1)((13 + 8 - 8)(4 + 2z - 4) + 0z - 1 + 0 - z) to the form rz + bz3 + wz*2 + u and give b. 6150 Rearrange -52 - 633 - 8730359y + 8730363y to uy + d and give d. -685 Express (426 - 53 - 84)(89 - 16x - 9x - 88) as rx + a and give r. -7225 Rearrange (813i + 5569i + 1417i)(-2 + 2 - 1) to a + ji and give j. -7799 Rearrange 56r*2 - 79r*2 + 9264r*3 + 58r*2 - 9257r*3 - 3r + 501r2 to zr + w + mr3 + sr2 and give m. 7 Express l2 - 10l2 + 13l*2 + 26l - 3447 - 26l as cl + s + ul2 and give u. 4 Rearrange 103 - 13f*3 - 1 - 97 - 4f to the form h + jf2 + rf*3 + zf and give z. -4 Rearrange 52572228 + 13y2 - 52572308 + 16y*2 to the form b + cy*2 + ky and give c. 29 Express -3520450h3 + 3520430h*3 + 0h + 3h2 + 5h as ph + uh*3 + lh*2 + k and give k. 0 Rearrange (70s - 122s - 111s)(1 + 0 + 1) + 5s - s - 2s - 5s + 22s - s to ds + r and give d. -308 Express a - 4a3 - 38a*2 + 5a*3 - 354 + 177 + 7a*2 + 165 in the form da + j + ba3 + ya*2 and give y. -31 Rearrange (3 - 5 - 1)(-4s + 2s + 0s) - 1179s - 61s - 620s to the form os + q and give o. -1854 Rearrange (0 - x + 0)(6x - 3x - 25x) - 3x*2 + 3x*2 + 2x*2 + (x - 2x - 2x)(x + 2x + 2x) to rx2 + f + px and give r. 9 Rearrange (-4548 + 4548 - 11161p)(-2p + p + 6p) to the form ap2 + up + x and give u. 0 Express 2t2 + 2t*3 + 1031 + 2t*2 - 177 - 2t*2 in the form l + yt*2 + ht + rt3 and give r. 2 Rearrange 3 + 2w + 2368w2 + 443w*4 + 2w*3 - 158w*4 - 2370w*2 to nw*2 + iw + gw3 + s + pw*4 and give n. -2 Rearrange (-2067 - 1888 - 2550)(-y - y + 0y) to f + my and give m. 13010 Express -630f2 - 184f*2 + 700f3 - f4 - 2f - 699f*3 in the form gf*4 + df*3 + pf + r + hf2 and give g. -1 Rearrange -c3 + 2c - 143 + 68c2 - 2c + 426 - 289 to bc3 + t + nc + wc2 and give w. 68 Rearrange 20249v*2 + 8v*3 - 20248v*2 + 2v*4 + 2v - 9v3 + (7v*3 + 0v*3 - 3v*3)(2 + v - 2) to hv4 + av*3 + kv*2 + tv + n and give h. 6 Rearrange 13j2 + 6j - 14j - 20 - 9j*2 + 4j*2 + 4j to the form y + aj + nj*2 and give n. 8 Rearrange 2s3 - s2 + 113s - 7909 + 7907 + s2 + 0s*2 to the form ps*2 + zs*3 + g + is and give g. -2 Rearrange -677r2 + 2858r*2 + 6383r*2 to f + dr + tr2 and give t. 8564 Express -z2 + 7z*4 - 17 + 28240621z - 28240621z as yz*3 + u + tz + fz2 + nz4 and give n. 7 Express -t2 - 17 + 16 - 1739t3 + 1735t*3 + 5t - 121t in the form gt*3 + vt + ft2 + w and give w. -1 Express 5741c + 3221c - 4946c + 23624c + (2 + 3 - 4)(c + c - c) - 4c + 4c + c as r + uc and give u. 27642 Express 105 + 97m - 14m - 83m - 3m3 - 4m*2 as lm*3 + o + dm*2 + pm and give l. -3 Express 293 - 292 - 5558z4 - 17z*3 - 2z*2 + 5564z*4 in the form rz + lz3 + iz*2 + f + vz*4 and give r. 0 Express -2203d*4 - 407d + 4367d4 + 2 - 2161d4 - d2 as l + td3 + id + ad2 + cd*4 and give c. 3 Rearrange 138v + 3007v - 1478v + 2202v + 1913v to the form kv + h and give h. 0 Rearrange -38 + 63q + 68q - 259q + 62q + 65q to s + jq and give j. -1 Express (1 - 2 + 0)(14 - 12 + 188589c - 190143c) as vc + p and give v. 1554 Rearrange -166f - 2f3 + 168f + 3f3 - 1112f*2 + 2 to the form a + of*3 + nf*2 + wf and give n. -1112 Express -271p2 + 15p + 139p2 + 22 - 22p + 129p2 in the form wp*2 + h + bp and give b. -7 Express -347y + 348y - 2y2 + y4 + 2y*3 - 3 - 1 + 6 + 7y*4 as ky*3 + fy + s + gy2 + zy4 and give z. 8 Rearrange w2 + 122 - 31021w3 + 15508w*3 - 5w*2 + 15508w3 + w2 to the form fw2 + gw + nw3 + i and give f. -3 Rearrange -9020s - 1 - 60s2 - 9023s + 18038s to d + is + qs2 and give d. -1 Rearrange (-348 + 121 + 23b*2 - 18b*2)(-4b2 + 2b*2 + 0b*2) to mb*3 + yb + wb2 + n + xb*4 and give w. 454 Rearrange 12p*3 + 15 - 109p - 9p3 + 93p - 2p3 - 2p*3 to vp*2 + n + zp + kp3 and give n. 15 Express 30n - 387 + 13n - 90n + 41n in the form o + an and give o. -387 Express 5628g4 - 10g + 5g3 - g2 + 3 - 3g*3 - 5622g*4 in the form mg*4 + kg*3 + b + sg*2 + og and give o. -10 Rearrange -122c3 + 61c*3 + 18c3 - c2 + 2 to uc2 + xc + w + pc3 and give p. -43 Express (579 + 124 + 312)(-20 + 20 - 8b2) as kb*2 + qb + c and give c. 0 Rearrange 488i3 + 483i*3 - 8 + 1 + 3 - 977i*3 + 18i*2 to the form mi*3 + n + si*2 + ri and give r. 0 Express 6186m + 3 - 7 - 6373m as j + y*m and give y. -187 Express (-3 - 2	{ "pile_set_name": "DM Mathematics" }
5w - 3t - 1 = 0. Let n(y) be the second derivative of 0y3 + 1/6y*4 + 0y*w + 0 - 4y. Let c(s) = -s*2. Calculate n(c(f)). 2f*4 Suppose 30 + 12 = 2q. Let a(z) = -43z + z2 + 22z + qz. Let t(w) = 10w + 11. Let m(d) = -d - 1. Let l(r) = 22m(r) + 2t(r). What is l(a(o))? -2o2 Let w(y) be the second derivative of y3/2 - 67y. Let c(u) be the second derivative of -2u3/3 + 3u. What is w(c(d))? -12d Let w(j) = 154j*2. Let i(y) = 344y*2 - 682y*2 + 339y*2. Give i(w(h)). 23716h*4 Let b(j) = 8j*2 - 4j. Let u(x) = -2x. Let l(m) = -b(m) + 2u(m). Let o(d) = -9 - 4d + 9. What is l(o(i))? -128i*2 Let y(g) = -29g*2. Let p(h) = -47856h. Give y(p(v)). -66415705344v2 Let c(m) = -7m + 37. Let u(l) = -l*2 + 31l. What is c(u(b))? 7b2 - 217b + 37 Let r(m) be the second derivative of m*3/3 + 17m. Let x(o) be the third derivative of -5o4/4 - 18o*2. What is x(r(v))? -60v Let l(j) = -7j2 - 27j. Let n(u) be the first derivative of -u*3 - 53. Determine l(n(o)). -63o*4 + 81o*2 Let u(a) = -7a + 52. Let d(f) = -14. Let m(h) = -4d(h) - u(h). Let c(x) = 2x. Give m(c(v)). 14v + 4 Let i(h) be the first derivative of -17h3/3 - 21. Let m(d) be the third derivative of -d5/20 + 2d2 - 20d. Give i(m(v)). -153v4 Let b(y) = -12y + 2. Let u(p) = 25p - 9. Let w(r) = -2b(r) - u(r). Let c(k) be the second derivative of k*4/6 + k. What is w(c(d))? -2d*2 + 5 Let b(j) = -43j. Let v(c) = 16c. Let h(n) = -3b(n) - 8v(n). Let a(l) be the first derivative of 9l*2/2 + 2. What is a(h(u))? 9u Let u = 26 + -26. Let g(n) be the third derivative of 0n3 - 1/15n5 + 0 - n2 + un4 + 0n. Let v(m) = 2m2. Calculate g(v(o)). -16o*4 Let p(y) = 158y. Let m(j) be the first derivative of -4j3/3 - 425. Calculate m(p(s)). -99856s*2 Let i(l) = 2 - 622l - 2 + 628l. Let k(p) = -6p. Give k(i(x)). -36x Let w(z) = -6382z*2. Let t(q) = 155q. Give w(t(r)). -153327550r2 Let o(n) = 39n - 7. Let i(a) = 13a - 2. Let p(s) = -7i(s) + 2o(s). Let q = 11112 + -6627. Let b(y) = -q + y + 4485. Determine p(b(c)). -13c Let z(s) = 10s + 60. Let d(b) = -1476b. What is d(z(i))? -14760i - 88560 Let a(d) = d + 1088. Let x(t) = 6t - 3. Calculate x(a(b)). 6b + 6525 Let v(j) = 11j. Let z(q) = -393q - 399q + 794q. Calculate z(v(c)). 22c Let m be 4/10 + 9/(45/8). Let k(j) = -mj - 7j + 0j - 8j. Let a(y) = -y*2. Calculate a(k(d)). -289d*2 Let x(o) be the first derivative of -2o*3 + 179. Let i(w) = -30w*2. What is i(x(l))? -1080l*4 Let u(w) = 45463w. Let n(z) = -16z2 - z. Give n(u(i)). -33070149904i*2 - 45463i Let w(g) = -g*2 - 64g*2 + 0g*2 - 14g*2. Let b(r) = r. Give w(b(l)). -79l*2 Let p(m) = -485m. Let d(z) = z*2 + 386. Determine p(d(g)). -485g*2 - 187210 Let u(i) = 1276i + 1. Let k(l) = 3292l. Give u(k(d)). 4200592d + 1 Let l(y) be the second derivative of y*5/4 - 6y*2 + 14y. Let p(c) be the first derivative of l(c). Let o(g) = 2g. Calculate o(p(r)). 30r*2 Let s(g) = 556g*2 - 42. Let n(y) = 2y*2. Give s(n(x)). 2224x*4 - 42 Let t(p) = 97p. Let f(o) = -41o2 - 6. Give t(f(a)). -3977a*2 - 582 Let s(i) = 9i. Let n = -19 - -26. Let a(p) = 8p - np + 0p. Determine s(a(w)). 9w Let u(v) = -v. Let b(j) = 11450j - 16. Determine u(b(l)). -11450l + 16 Let b(k) = -46 + 56 - 8k2 + 4k*2. Let j(m) = m. Determine b(j(l)). -4l*2 + 10 Let w(n) be the third derivative of -7n5/10 - n4/12 + 105n2. Let o(p) = p. What is w(o(g))? -42g*2 - 2g Let x(a) = -78a. Let h(d) = -2d*2 + 54d + 26. Determine h(x(s)). -12168s2 - 4212s + 26 Suppose 7z - 19 = 93. Let u(j) = 10 + 2j*2 + z - 26. Let c(s) = -19s. Give c(u(w)). -38w2 Let i(o) = -15601o*2. Let g(w) = -7w. Give i(g(k)). -764449k2 Let d(o) = 4o*2. Let q(m) = -41173m*2. What is d(q(p))? 6780863716p*4 Let g(f) be the third derivative of 5f4/24 + f2 + 12f. Let i(n) = -14n*2. Determine g(i(p)). -70p*2 Suppose -4p = -7 - 5. Suppose -2d + 8 = 3m, -pd + 2d + 5m = -4. Let l(f) = -f + df - f. Let c(n) = -n. Give c(l(k)). -2k Let x(c) = 3c*2 - 2c + 4. Let a(p) = -2p2 + 3p - 6. Let u(b) = 4a(b) + 6x(b). Let w(t) = 9t. Calculate u(w(i)). 810i*2 Let k(q) = q + 15. Let f(b) = 6b + 33. Let a(w) = -w - 6. Let p(n) = 11a(n) + 2f(n). Calculate k(p(t)). t + 15 Let m(k) be the third derivative of k*4/8 - 96k*2. Let t(u) = 61u*2. What is m(t(c))? 183c*2 Let w(d) = 1411d. Let s(j) = 100j. Calculate w(s(b)). 141100b Let f(c) = 12c. Let r(d) = 2d - 4. Let b be 9/(-27) + 39/9. Let h(q) = 2q - 5. Let a(u) = bh(u) - 5r(u). What is f(a(l))? -24l Let h(d) = -9d2 + 1. Let v(u) = 439u*2. What is v(h(p))? 35559p*4 - 7902p*2 + 439 Let a(d) = 5d*2. Let i(v) = 224v. Calculate a(i(s)). 250880s2 Let s(a) = -a - 49. Let r(o) = 5o*2 - 3o + 3. Let u(m) = 4m2 - 2m + 2. Let t(c) = -2r(c) + 3u(c). What is s(t(g))? -2g2 - 49 Suppose -a = 4a - 4s - 22, 3a + 5s = -9. Let k(m) be the third derivative of 1/6m*5 + 0m*4 + 2m*a + 0m + 0m3 + 0. Let o(y) = 2y. Give o(k(i)). 20i2 Let l(a) = 12212a + 12218a - 24429a. Let h(c) be the first derivative of c5/40 - c3/3 + 1. Let z(j) be the third derivative of h(j). Determine z(l(d)). 3d Let c = -268 + 270. Let w(z) be the first derivative of 3 + 0z*c - 2/3z*3 + 0z. Let t(d) = -2d2. Determine t(w(h)). -8h*4 Suppose -a + 8 = 3. Suppose 11 = ax - 64. Let o(q) = 3 - 4q - 3 + xq. Let n(b) = -2b2. What is n(o(f))? -242f*2 Let t(q) = -331q. Let k(r) = 7936r2. Calculate k(t(o)). 869476096o*2 Let j(i) = 16006i + 1. Let o(s) = -4s. What is j(o(c))? -64024c + 1 Suppose 2t - 3v = -8, -t - v - 1 = -7. Let y(k) = -6k2 + 29k - k*t - 29k. Let r(b) = -b*2. Give r(y(c)). -49c*4 Suppose v - 5v = -j - 1, -j + 1 = -5v. Let k(a) = a3 + 8a*2 - 9a. Let b be k(j). Let f(c) = 4c + bc - 4c + 3c. Let p(y) = y*2. What is f(p(r))? 3r*2 Let i(n) = -2n - 3. Let o(u) = -2u - 2. Let h(v) = -2i(v) + 3o(v). Let a(f) = -129f - 2. Calculate h(a(b)). 258b + 4 Let q(b) = 21b. Let g(l) be the second derivative of 11l4/12 - 230l. Give q(g(z)). 231z2 Let i(f) = 6f*2 + 5f + 5. Let w(c) = -7c2 - 4c - 4. Let q = 0 - 4. Let t(x) = qi(x) - 5w(x). Let j(h) = -h. Determine j(t(o)). -11o2 Suppose 4g + 0b + b - 5 = 0, 5g - 3b = 19. Let l(n) = -n2 + 7n*2 - 2n*g - 7n*2. Let m(j) = 5j. Determine l(m(s)). -75s2 Let n(q) = -q. Let g(h) = 1216055h. What is n(g(f))? -1216055f Let f(w) = 5w*2 + 5w*2 + 32 - 12w2 - 32. Let i(c) be the first derivative of -c3/3 + 8c2 + 3. Give i(f(o)). -4o*4 - 32o*2 Let i be (2/(-2))/((-1)/2). Let f(q) = -2q*i + 0q2 + q2. Let g(r) = -2r2 + 4r*2 - 14r*2 + 10r*2. What is g(f(p))? -2p4 Let n(v) = v + 30. Let c(j) be the third derivative of -j4/24 + 22j2. What is n(c(k))? -k + 30 Let h(i) = -3i*2. Let k(d) = 7d*2 - 5d + 5. Let y(u) = -5 + 5u + 3 + 7u - 10 - 18u2. Let t(w) = -12k(w) - 5y(w). What is h(t(p))? -108p*4 Let j(h) = 5h*2 + 5h - 5. Let y(x) = 2x2 + 3x - 3. Let q(i) = -3j(i) + 5y(i). Let l(t) = 4t - 4t - t. What is l(q(g))? 5g2 Let u(j) be the third derivative of -j5/12 - 15j*2. Let b(h) = -11h*2 - 5h*2 + 16h*2 - 5h*2. Determine b(u(p)). -125p*4 Let s(r) = -13r*2 + 42r + 7. Let v(m) = 4m2 - 12m - 2. Let q(b) = 2s(b) + 7v(b). Let t(i) = 2i - 170. Determine t(q(x)). 4x*2 - 170 Let s(a) = 3a. Let d(q) = 45q2 - 6q + 8. Let x(k) = -44k2 + 5k - 7. Let o(n) = 5d(n) + 6x(n). Determine s(o(f)). -117f2 - 6 Let t be (-4)/4(1 - 3). Let d(p) = 6pt - 8p*2 + 5p*2. Let i(c) = -11c*2. Give i(d(h)). -99h*4 Let z(w) = -5w - 27. Let a(n) = -24n - 24n + 89n - 17n - 23n. Determine a(z(m)). -5m - 27 Let n(l) = -2l2. Let p(z) = 2z + 12873. Give n(p(w)). -8w2 - 102984w - 331428258 Let h(j) be the second derivative of j*3/2 + 7j + 8. Let a(p) = 81p. Determine a(h(m)). 243m Let d(i) be the third derivative of i*4/24 - 345i2. Let w(b) be the second derivative of -b3/3 + b. Determine w(d(t)). -2t Let x(k) = -k. Let a(u) be the first derivative of 14u*2 - 15u + 13u - 12 + 2u. Give x(a(o)).	{ "pile_set_name": "DM Mathematics" }
+ 0g + 1/2g*2 + 0 - 5/4g*k = 0. 0, 2/3, 1 Let 181m*4 - 183m*4 + 0m + 2m - 2m*2 + 0m*2 - 4m*2 + 6m3 = 0. What is m? 0, 1 Let s(p) be the third derivative of -p5/12 + 145p4/2 - 25230p*3 - 3p*2 + 3. Determine y, given that s(y) = 0. 174 Let a = -249 + 4983/20. Let v(n) be the first derivative of 0n - 3/8n4 + an*5 - 2 + 0n*2 + 1/4n*3. Suppose v(u) = 0. What is u? 0, 1 Let c(t) be the first derivative of -27t4/8 - t3 + 27t2/4 + 3t + 13. Factor c(l). -3(l - 1)(l + 1)(9l + 2)/2 Let h(z) = -2z. Let g(y) = y2 + y + 6. Let j(u) = -g(u) - 3h(u). Let j(d) = 0. Calculate d. 2, 3 Let v(s) be the third derivative of -s8/2520 - s7/840 + s6/360 + s5/180 - 5s3/3 - 22s*2. Let o(k) be the first derivative of v(k). Factor o(h). -h(h - 1)(h + 2)(2h + 1)/3 Let h(f) be the second derivative of 5f*4/12 - 20f*3/3 - 11f. Factor h(l). 5l(l - 8) Let l(c) = -c5 - c4 + c*3 - c + 1. Let y(q) = -8q*5 - 2q*4 + 18q*3 - 4q*2 - 20q + 6. Let t(w) = 20l(w) - 2y(w). Factor t(f). -4(f - 1)(f + 1)*3(f + 2) Let a(t) be the first derivative of t*5/35 + 5t*4/14 + 25t3/21 - 180. Factor a(s). s2(s + 5)2/7 Let c be (5 - 3)1 - 8. Let z be -2 + 3/(c/(-10)). Determine s so that 0 + 4s2 - 5/2s*z - 2s + 1/2s4 = 0. 0, 1, 2 Let s be (4/82)/((-2)/(-4)). Factor -h*2 + 3h - 18 - 2hs + 12h. -3(h - 3)(h - 2) Suppose 3m = 3v - 24, -5m - 7 = 3v + 9. Suppose -2x = -2d + d - 2, -vx + 4 = -d. Factor 24c*d + 12c - 4c - 28c*2. -4c(c - 2) Let q(n) be the first derivative of 2n*3/3 - 16n*2 + 128n + 53. Factor q(p). 2(p - 8)2 Let i(v) be the third derivative of -v5/20 + 5v*4 - 175v*3/2 + 4v*2 - 3. Factor i(k). -3(k - 35)(k - 5) Let o(y) = 37y*2 - 11y - 41. Let b(x) = -13x2 + 4x + 14. Let r(a) = 17b(a) + 6o(a). Factor r(v). (v - 2)(v + 4) Let v(k) be the first derivative of 3k*4/32 - 5k*3/8 + 3k*2/2 - 3k/2 + 64. Factor v(w). 3(w - 2)2(w - 1)/8 Let v(g) be the second derivative of -g*6/15 + 8g*5/5 - 23g*4/3 - 48g*3 - 81g*2 - 90g. Determine u, given that v(u) = 0. -1, 9 Let k(b) be the first derivative of -12b2 + 3b*5 + 12b*3 - 23 + 0b + 27/2b4. Factor k(v). 3v(v + 2)2(5v - 2) Let f(c) be the first derivative of 13c*5/20 + 15c*4/16 - 11c*3/12 - 15c*2/8 - c/2 + 10. What is z in f(z) = 0? -1, -2/13, 1 Let u = 22721/160 - 142. Let i(a) be the third derivative of 1/12a*3 - 1/32a*4 + 0a + ua6 - 1/840a*7 + 0 - 1/240a*5 + 5a*2. What is n in i(n) = 0? -1, 1, 2 Suppose 4r + 5p - 10 = -23, -3r = -p - 14. Let d(b) be the first derivative of 1/14b4 + 2/35b*5 + 3/7b*2 + 5 - 10/21b*r + 0b. Factor d(y). 2y(y - 1)*2(y + 3)/7 Let j(g) = -7g4 - 15g*3 + 15g*2 + 54g + 31. Let w(k) = 2k4 + k - 1. Let a(f) = j(f) + w(f). Factor a(s). -5(s - 2)(s + 1)2(s + 3) Let h(m) = -m*3 + 5m*2 - 6m + 7. Let o be h(3). Factor -ob4 - 3b3 - b3 + b*3 + 10b*4. 3b*3(b - 1) Let c(w) = 2w4 - 2w*3 - 10w*2 + 2w + 2. Let d(t) = -3t4 + 3t*3 + 23t*2 - 3t - 5. Let n(b) = -5c(b) - 2d(b). Find q such that n(q) = 0. -1, 0, 1 Let y(s) be the second derivative of -1/70s7 + 1/10s*4 - 1/50s*6 - 3/10s*2 + 3/50s*5 + 0 - 1/10s*3 + 6s. Factor y(m). -3(m - 1)2(m + 1)*3/5 Let w = -993 + 993. Let x(j) be the first derivative of 2/3j*2 + wj + 23/12j4 - 7/15j*5 + 6 - 20/9j*3. Factor x(a). -a(a - 2)(a - 1)(7a - 2)/3 Let c(n) be the second derivative of n6/1620 - n4/108 - 8n*3/3 + 11n. Let i(x) be the second derivative of c(x). Factor i(f). 2(f - 1)(f + 1)/9 Let z = -88 + 93. Let a(j) = j*3 + 48j*2 + 121j + 103. Let g(c) = -24c2 - 60c - 51. Let r(t) = zg(t) + 3a(t). Factor r(k). 3(k + 2)(k + 3)*2 Let u = -38021/4 - -9506. Determine o, given that -uo - 3/2 + 3/4o2 = 0. -1, 2 What is h in -2/21h*4 + 2/21h*5 - 8/21h*2 + 32/21h + 0 - 8/7h3 = 0? -2, 0, 1, 4 Let o(a) be the second derivative of a6/1080 + a5/180 + 7a*3/6 + 45a. Let q(h) be the second derivative of o(h). Determine m so that q(m) = 0. -2, 0 Let g(x) = -x - 3. Let f be g(-6). Suppose -29 + 57 = 14i. Factor -1/2d + 1/2df - 1/2di + 1/2. (d - 1)2(d + 1)/2 Let l(o) = 3o*2 - 1. Let f be l(-1). Suppose -fw = 2w - 12, 3w + 77 = 2h. Find g such that -7g*2 - 12g*4 - 16 - 8g*2 + hg*2 - 4g*3 + 4g*5 = 0. -1, 1, 2 Determine i, given that 33/2 - 101/4i + 3/4i2 = 0. 2/3, 33 Let j(n) be the first derivative of 7/30n*5 + 11/9n*3 + 1/2n + 13/12n2 + 1/36n*6 + 3/4n4 + 2. Factor j(k). (k + 1)4(k + 3)/6 Let a(h) be the third derivative of h7/105 + h6/10 - 7h*5/30 + 130h*2. Factor a(b). 2b*2(b - 1)(b + 7) Factor 3s*3 + 16 - 40s*3 - 340s - 79 - 57 + 2s3 + 270s*2. -5(s - 6)(s - 2)(7s + 2) What is a in -224a*2 - 605a*3 - 106a*2 - 19a - 26a = 0? -3/11, 0 Let g = -37 - -47. Suppose -s = -gs. Factor s + 3/4j4 - 3/2j*3 - 3j - 21/4j2. 3j(j - 4)(j + 1)*2/4 Suppose 4v + 76 = -68. Let p be v/(-48) - 17/(-4). Factor -x3 + xp - 2x3 - x3 + 3x*5. 4x*3(x - 1)(x + 1) Let a(n) be the second derivative of 5n*4/12 - 115n*3/3 - 240n*2 + 2n + 40. Find l such that a(l) = 0. -2, 48 Let m(n) be the first derivative of n*3 - 9n*2 + 11. Suppose m(f) = 0. Calculate f. 0, 6 Let a(c) be the second derivative of 3c*5/10 - 5c*4/3 + 3c*3 - 2c*2 - 216c. Solve a(t) = 0 for t. 1/3, 1, 2 Let c(a) be the first derivative of a*4/2 + 25a*3/3 - 13a*2/2 - 348. What is u in c(u) = 0? -13, 0, 1/2 Suppose 4l = 3k + 5, -2k = l + 3 - 7. Factor 4 - 3f + 0f - 3f + 0f + lf2. 2(f - 2)(f - 1) Let d(g) = 77g*4 + 33g*3 - 90g*2 - 33g. Let j(w) = -39w4 - 16w*3 + 45w*2 + 16w. Let k(y) = -6d(y) - 13j(y). Find l such that k(l) = 0. -1, -2/9, 0, 1 Let n(a) be the third derivative of 0a3 + 0a - 2/105a7 + 11a*2 - 13/150a*6 - 4/75a*5 + 0 + 2/15a4. Suppose n(o) = 0. What is o? -2, -1, 0, 2/5 Let p(d) = -d2 - 5d - 3. Let q be p(-3). Suppose 2v*3 - 8v*2 + 2v3 - vq + v*3 = 0. What is v? 0, 2 Let o be 7 - 21/(-2 - (-1 + -4)). Find x, given that -1/11x*3 + 0x*2 + 4/11x + o = 0. -2, 0, 2 Let l(m) be the first derivative of -3/4m4 - 3/4m*2 - 4/3m*3 + 0m*5 + 0m + 1/12m6 + 35. Factor l(f). f(f - 3)(f + 1)3/2 Let t(p) be the third derivative of p5/120 - 4p*4 + 768p*3 - 54p2 + 3. Let t(h) = 0. Calculate h. 96 Let u(q) be the third derivative of -q5/270 - q*4/18 - 191q*2. Find t such that u(t) = 0. -6, 0 Suppose -2g + 16 = 4w - 0, -4g = -4w - 32. Find z, given that -12z*4 + 8z*2 + 6z*3 + 3z*5 + 6z*3 - gz2 = 0. 0, 2 Let w(d) be the third derivative of -d8/588 - 8d7/245 - 6d*6/35 - 4d*2. What is u in w(u) = 0? -6, 0 Suppose -4n - 300 = -312. Let s(m) be the second derivative of -18/5m5 + 0m*2 - 20/3m*4 - 3m - 2/21m7 + 0 - 14/15m*6 - 16/3m*n. Factor s(q). -4q(q + 1)(q + 2)*3 Suppose 76h = 17h + 16 + 102. Determine a so that 0 - 2/11a*4 - 6/11a*h + 2/11a + 6/11a3 = 0. 0, 1 Let d = 36 + -34. Factor -25y*d - 49y + 9y + 169y*5 + 355y*3 + 1 - 5 - 455y4. (y - 1)3(13y + 2)*2 Let d = 446 - 891/2. Let i(f) be the first derivative of df + 7/8f2 - 1/3f3 - 3. Suppose i(k) = 0. What is k? -1/4, 2 Let m(l) = -l3 - 52l2 - 131l + 157. Let k(z) = 3z3 + 110z*2 + 263z - 313. Let o(p) = 6k(p) + 14m(p). Determine v so that o(v) = 0. -4, 1, 20 Let b = -11 - -12. Let -2q - 5q - 3q2 - b + 7 = 0. What is q? -3, 2/3 Let q(w) be the first derivative of 2/3w*6 + 8/3w*3 + 15 - 12/5w*5 + 2w*4 - 6w*2 + 4w. Determine h, given that q(h) = 0. -1, 1 Let y be 14/15 + 28/(-245)105/90. Solve ya*2 - 24/5 - 4a = 0. -1, 6 Let w(u) be the second derivative of u*4/15 - 5u*3 - 117u*2/5 - 269u. Suppose w(q) = 0. Calculate q. -3/2, 39 Let w = 31/48 + 5/48. Factor -3/4z5 + 9/4z*3 + 3/2z + wz4 + 0 - 15/4z*2. -3z(z - 1)3(z + 2)/4 Suppose -91 = -b + f - 93, 3f = -5b + 6. Factor 9/5 + br - 1/5r*2. -(r - 3)(r + 3)/5 Solve 3b5 - 6b*5 + 3b*3 + 6b*4 + 0b*3 - 2 + 2 - 6b**2 = 0. -1, 0, 1, 2 Let p(b) be the third derivative of -	{ "pile_set_name": "DM Mathematics" }
141 List the prime factors of 614208. 2, 3, 7, 457 What are the prime factors of 5230234? 2, 2615117 What are the prime factors of 10260403? 29, 353807 What are the prime factors of 60088? 2, 7, 29, 37 List the prime factors of 356245. 5, 71249 List the prime factors of 3909993. 3, 1303331 What are the prime factors of 242022? 2, 3, 11, 19, 193 What are the prime factors of 6922121? 163, 42467 What are the prime factors of 25282249? 67, 377347 What are the prime factors of 2313962? 2, 7, 197, 839 What are the prime factors of 9333997? 19, 109, 4507 List the prime factors of 2371660. 2, 5, 118583 List the prime factors of 10240495. 5, 1097, 1867 List the prime factors of 4079139. 3, 37, 36749 List the prime factors of 827919. 3, 67, 1373 What are the prime factors of 571808? 2, 107, 167 List the prime factors of 214907. 7, 11, 2791 What are the prime factors of 5259847? 23, 61, 163 List the prime factors of 494444. 2, 71, 1741 What are the prime factors of 17372031? 3, 5790677 List the prime factors of 232186. 2, 17, 6829 List the prime factors of 643172. 2, 23, 6991 What are the prime factors of 22806287? 7, 3258041 List the prime factors of 805131. 3, 89459 List the prime factors of 567518. 2, 7, 5791 List the prime factors of 405919. 101, 4019 What are the prime factors of 6728973? 3, 757, 2963 What are the prime factors of 1431053? 13, 31, 53, 67 What are the prime factors of 25062254? 2, 7, 19, 94219 List the prime factors of 8790428. 2, 17, 257, 503 List the prime factors of 364774. 2, 182387 What are the prime factors of 453294? 2, 3, 25183 List the prime factors of 574643. 574643 List the prime factors of 664793. 664793 What are the prime factors of 55448? 2, 29, 239 List the prime factors of 1081589. 79, 13691 List the prime factors of 1914778. 2, 17, 199, 283 What are the prime factors of 506475? 3, 5, 2251 List the prime factors of 719513. 67, 10739 List the prime factors of 5183215. 5, 17, 211 What are the prime factors of 13953958? 2, 37, 101, 1867 What are the prime factors of 254514? 2, 3, 13, 251 What are the prime factors of 4115411? 17, 242083 List the prime factors of 2034095. 5, 7, 89, 653 What are the prime factors of 526014? 2, 3, 17, 191 What are the prime factors of 2578843? 47, 54869 What are the prime factors of 726455? 5, 23, 6317 List the prime factors of 21211191. 3, 2356799 List the prime factors of 412404. 2, 3, 34367 List the prime factors of 953046. 2, 3, 37, 53 What are the prime factors of 4783631? 4783631 What are the prime factors of 494756? 2, 179, 691 What are the prime factors of 16234029? 3, 7, 127, 2029 List the prime factors of 9714314. 2, 79, 61483 What are the prime factors of 114745? 5, 53, 433 List the prime factors of 2315235. 3, 5, 13, 31, 383 List the prime factors of 188741. 7, 59, 457 List the prime factors of 121905. 3, 5, 7, 43 List the prime factors of 124052. 2, 31013 What are the prime factors of 3478754? 2, 1739377 What are the prime factors of 3842? 2, 17, 113 What are the prime factors of 1084068? 2, 3, 30113 List the prime factors of 231570. 2, 3, 5, 31, 83 List the prime factors of 7964887. 7, 103, 11047 What are the prime factors of 4879262? 2, 71, 34361 What are the prime factors of 2924375? 5, 4679 List the prime factors of 857702. 2, 428851 What are the prime factors of 140158? 2, 70079 List the prime factors of 159715. 5, 17, 1879 List the prime factors of 6074613. 3, 674957 What are the prime factors of 145442? 2, 11, 601 List the prime factors of 1888781. 457, 4133 What are the prime factors of 2339083? 373, 6271 List the prime factors of 237342. 2, 3, 7, 5651 List the prime factors of 6100701. 3, 29, 70123 What are the prime factors of 9657023? 9657023 List the prime factors of 524259. 3, 19417 What are the prime factors of 615255? 3, 5, 41017 List the prime factors of 5601033. 3, 622337 What are the prime factors of 6674? 2, 47, 71 List the prime factors of 32107964. 2, 7, 1146713 What are the prime factors of 726096? 2, 3, 7, 2161 What are the prime factors of 310270? 2, 5, 19, 23, 71 List the prime factors of 16809492. 2, 3, 7, 83, 2411 What are the prime factors of 4692300? 2, 3, 5, 15641 List the prime factors of 428093. 428093 List the prime factors of 13675492. 2, 59, 57947 List the prime factors of 11153295. 3, 5, 27539 What are the prime factors of 682908? 2, 3, 56909 List the prime factors of 378201. 3, 126067 What are the prime factors of 9797374? 2, 4898687 List the prime factors of 43399. 43399 List the prime factors of 132252. 2, 3, 103, 107 List the prime factors of 16022149. 11, 13, 19, 5897 List the prime factors of 1316072. 2, 17, 9677 What are the prime factors of 1983808? 2, 139, 223 List the prime factors of 11513420. 2, 5, 17, 33863 List the prime factors of 43090. 2, 5, 31, 139 What are the prime factors of 7864612? 2, 7, 280879 List the prime factors of 170640. 2, 3, 5, 79 What are the prime factors of 13155752? 2, 19, 41, 2111 List the prime factors of 224928. 2, 3, 11, 71 List the prime factors of 863623. 211, 4093 What are the prime factors of 10552386? 2, 3, 13, 59, 2293 List the prime factors of 861910. 2, 5, 7, 1759 What are the prime factors of 3355316? 2, 31, 27059 List the prime factors of 4913560. 2, 5, 122839 What are the prime factors of 7105920? 2, 3, 5, 3701 What are the prime factors of 16054111? 1669, 9619 List the prime factors of 144160. 2, 5, 17, 53 List the prime factors of 119561. 13, 17, 541 List the prime factors of 3608927. 7, 31, 16631 What are the prime factors of 18654453? 3, 29, 71473 What are the prime factors of 61943? 7, 8849 What are the prime factors of 15795644? 2, 3948911 What are the prime factors of 333933? 3, 79, 1409 List the prime factors of 2575709. 1277, 2017 What are the prime factors of 527477? 173, 3049 List the prime factors of 5546356. 2, 109, 12721 List the prime factors of 210807. 3, 59, 397 What are the prime factors of 440970? 2, 3, 5, 14699 What are the prime factors of 60264? 2, 3, 31 List the prime factors of 1083005. 5, 7, 11, 29, 97 List the prime factors of 91319. 53, 1723 What are the prime factors of 253758? 2, 3, 42293 List the prime factors of 711480. 2, 3, 5, 7, 11 List the prime factors of 44440. 2, 5, 11, 101 What are the prime factors of 209487? 3, 69829 List the prime factors of 5909884. 2, 541, 2731 What are the prime factors of 2769472? 2, 109, 397 List the prime factors of 89016. 2, 3, 3709 List the prime factors of 452620. 2, 5, 7, 53, 61 List the prime factors of 3830108. 2, 659, 1453 List the prime factors of 33274751. 433, 76847 What are the prime factors of 15378687? 3, 569581 What are the prime factors of 7015681? 37, 189613 What are the prime factors of 11732776? 2, 11, 133327 What are the prime factors of 41640645? 3, 5, 97, 28619 What are the prime factors of 125777? 125777 List the prime factors of 451694. 2, 449, 503 List the prime factors of 1537269. 3, 107, 4789 List the prime factors of 5171886. 2, 3, 287327 What are the prime factors of 13856851? 113, 149, 823 What are the prime factors of 2438203? 2438203 List the prime factors of 1306880. 2, 5, 1021 What are the prime factors of 5354370? 2, 3, 5, 7, 2833 What are the prime factors of 105409? 23, 4583 List the prime factors of 966601. 251, 3851 What are the prime factors of 127912? 2, 59, 271 What are the prime factors of 148136? 2, 18517 List the prime factors of 3733762. 2, 131, 14251 List the prime factors of 14806786. 2, 47, 157519 List the prime factors of 620978. 2, 310489 What are the prime factors of 2771518? 2, 41, 73, 463 What are the prime factors of 495258? 2, 3, 197, 419 What are the prime factors of 3451820? 2, 5, 107, 1613 What are the prime factors of 7502? 2, 11, 31 List the prime factors of 36000962. 2, 197, 91373 List the prime factors of 1761172. 2, 7, 31, 2029 List the prime factors of 1772225. 5, 7, 13, 19, 41 List the prime factors of 300515. 5, 60103 List the prime factors of 419338. 2, 209669 List the prime factors of 1230618. 2, 3, 205103 What are the prime factors of 1112634? 2, 3, 61813 What are the prime factors of 8505152? 2, 132893 What are the prime factors of 3394319? 419, 8101 What are the prime factors of 31367167? 13, 43, 56113 List the prime factors of 121853. 121853 What are t	{ "pile_set_name": "DM Mathematics" }
the nearest to 0? (a) -7 (b) 12 (c) 5 (d) 0 d What is the nearest to -0.1 in 21.7, -1/4, 14? -1/4 Which is the closest to 4/3? (a) -2 (b) -1 (c) -1/8 (d) -0.5 c Which is the closest to -0.1? (a) 4 (b) 7 (c) -0.5 (d) 15 c What is the nearest to -1 in -2, 6.61, 1, 4? -2 What is the closest to -2/19 in 1, -2/11, 3? -2/11 What is the nearest to 3 in 1, 2, -2, 0.1? 2 Which is the nearest to 0.1? (a) -5/6 (b) 2/19 (c) 0.2 (d) 5 b Which is the nearest to 1? (a) -2/17 (b) 2/7 (c) -2/7 (d) 2/13 b Which is the nearest to 0.1? (a) 4/7 (b) -4 (c) -3/5 a Which is the closest to -2? (a) -16 (b) 4/3 (c) -12/11 c Which is the nearest to 0.49? (a) -2/3 (b) 2/3 (c) 3/5 c What is the closest to -1/2 in 1, 0.02, -1? -1 What is the closest to 2/5 in -3/7, 35/4, -2, 3? -3/7 Which is the closest to 0? (a) 0.1 (b) -1 (c) -8 (d) -1/5 a What is the closest to 1 in -0.02, 2/3, -0.06, -0.1? 2/3 What is the closest to 5 in -5/4, 2, -2/3, -4? 2 What is the nearest to -85 in -3, 2, -0.1? -3 What is the closest to 1 in 0.2, 2, -1097? 0.2 Which is the closest to -0.2? (a) 0.8 (b) -3 (c) 0.3 c What is the nearest to 2.9 in 1, -5, -0.5? 1 What is the closest to 2 in 2/15, 6, 3/7? 3/7 What is the closest to 3/4 in 3/4, -4, -16? 3/4 What is the nearest to -0.1 in 1/2, 13, -0.5? -0.5 What is the nearest to 0.1 in -25/16, 0.5, 0.2, 9? 0.2 What is the closest to -0.2 in -3/5, 0, 3/2, -2.2? 0 Which is the closest to -1? (a) 2 (b) -19 (c) 1 c What is the closest to 0 in 2/9, -1/7, -0.5, -5? -1/7 Which is the nearest to -2/11? (a) -0.4 (b) -7 (c) -10 (d) 5 a Which is the closest to 0.02? (a) 39 (b) 0.5 (c) 5 b What is the closest to 2/27 in -1.3, 2, -3? -1.3 Which is the closest to 0.3? (a) -44 (b) 0.2 (c) -0.5 b What is the nearest to 1 in -3, 0, 2/47? 2/47 What is the closest to 3 in 7/6, -116, -1? 7/6 Which is the closest to 3? (a) -5 (b) 4/5 (c) -0.2 b Which is the nearest to 0.2? (a) -0.2 (b) 1/3 (c) 2 (d) -16 b Which is the closest to 2/5? (a) 4/7 (b) 1 (c) -0.1 (d) -1 a Which is the closest to -1? (a) 2/9 (b) -1/2093 (c) -3 b Which is the closest to 8/51? (a) -2 (b) -5 (c) 0.1 (d) 6 c Which is the closest to 0? (a) -1 (b) -0.1 (c) -8/3 (d) 3/2 b What is the closest to 2/7 in 2, 0.3, 59? 0.3 Which is the nearest to -17/3? (a) -3/11 (b) -3/5 (c) 3 b What is the nearest to 0 in 2, -0.3, -2/11, 9? -2/11 Which is the closest to -0.1? (a) 0.3 (b) -3/2 (c) -24 (d) 1/2 a Which is the closest to -1/2? (a) -0.5 (b) -12 (c) -0.2 a What is the closest to 0.3 in 11, 0.5, -0.03? 0.5 What is the closest to 1/3 in 1/5, -2, 1, -0.048? 1/5 What is the closest to 0 in 0.015, -0.5, -2/9, 3? 0.015 Which is the nearest to -0.08? (a) 5 (b) -2/3 (c) 2/5 (d) -0.3 d Which is the closest to 2/3? (a) -5 (b) 4 (c) -1/12 (d) 3 c Which is the nearest to 1? (a) -1.29 (b) -0.3 (c) 0.3 c Which is the nearest to -1.1? (a) -3 (b) 0 (c) 2/21 b Which is the nearest to 0.5? (a) -5/2 (b) 0.09 (c) 2 b Which is the nearest to -0.1? (a) -1/3 (b) 0.2 (c) 0.1 (d) 19 c What is the nearest to -25/6 in 0.4, 1/5, -1/2? -1/2 Which is the closest to -2/7? (a) -4/5 (b) 53 (c) -6 (d) -0.6 d What is the closest to 0.63 in 4/5, -4, 5, -0.2? 4/5 Which is the nearest to -2/9? (a) -4 (b) 0.5 (c) -21 (d) 3/2 b What is the closest to 4 in 1, 2/15, 0.1? 1 What is the nearest to 468 in -2, -1, -2/3? -2/3 What is the closest to 0 in 1/4, 15, 5? 1/4 Which is the closest to 0.1? (a) 6/31 (b) -1/2 (c) 2/3 (d) -20 a Which is the nearest to 0? (a) -28 (b) -0.5 (c) 0.2 (d) -3 c Which is the closest to -0.2? (a) 29.5 (b) 0.2 (c) 4 b Which is the nearest to -0.5? (a) -4 (b) 4 (c) -3 c Which is the nearest to 1? (a) 0.4 (b) -0.02 (c) 4.1 a Which is the closest to -3/4? (a) -4 (b) -0.1 (c) -5 (d) 0.2 b Which is the nearest to 9? (a) -3.2 (b) 1/5 (c) -1 b What is the closest to -2/5 in 12, 0, -0.5, 0.4? -0.5 Which is the closest to 637? (a) 10 (b) -1 (c) 1/4 (d) 0.3 a What is the nearest to -1.1 in -4, 1, 2/3? 2/3 Which is the nearest to -1? (a) 0.1 (b) 17 (c) 2/7 (d) -0.1 d Which is the closest to 14? (a) -4 (b) 5/2 (c) 4 c What is the closest to -1/5 in 2, -4, -5.4, -1? -1 Which is the closest to 22? (a) -3 (b) 0.1 (c) -4 (d) -2 b Which is the closest to 0? (a) 1.24 (b) -2/7 (c) -0.4 b Which is the nearest to -2? (a) 5 (b) 0 (c) 0.16 (d) -2/3 d What is the nearest to 1 in -3/7, -0.2, 1, 0.4? 1 What is the nearest to -2 in 3, -1, 1/3, -15? -1 Which is the nearest to 3? (a) 0.027 (b) -5 (c) -0.5 a Which is the closest to 2? (a) 3/4 (b) 4 (c) -3 a Which is the nearest to -23/2? (a) 3 (b) -1 (c) 1 b Which is the nearest to 2/7? (a) 1 (b) -5 (c) -0.65 a What is the closest to -1 in -2/19, -1/12, -1/4? -1/4 Which is the nearest to -2? (a) 29 (b) 2 (c) 0 (d) 1 c What is the closest to -0.063 in 5, 3, -0.5, 1/4? 1/4 What is the closest to 0 in 3, 1, 11, 0.5? 0.5 What is the nearest to 0.03 in -5, -7/3, 0.3, 0.5? 0.3 Which is the nearest to 1? (a) -4/7 (b) -5 (c) 2/23 c Which is the closest to 0? (a) 0 (b) 0.3 (c) -0.13 a What is the nearest to -2 in 4/3, -2, -0.74, 4/5? -2 Which is the nearest to 1/2? (a) 5 (b) -0.4 (c) -0.22 (d) -0.5 c What is the closest to -2/47 in -10/11, 1/3, 4? 1/3 Which is the closest to -1/9? (a) 0.3 (b) -3 (c) -18 a What is the closest to 0.4 in 0.5, 0, -49/27? 0.5 Which is the closest to -1/13? (a) -5/9 (b) 0.1 (c) -1/5 (d) -0.3 c Which is the closest to -56? (a) 1/4 (b) 3 (c) -3 c Which is the closest to -2/9? (a) -0.3 (b) 2/11 (c) -3 (d) 2/7 a What is the closest to -0.161 in -0.3, -1/3, 3/5, 1? -0.3 What is the nearest to 0.1 in 40/7, -3/7, 4, -0.1? -0.1 What is the nearest to 0.1 in 8, 2/3, -2/15, 1/2? -2/15 What is the closest to 2 in -663, -2/9, 1/6? 1/6 Which is the closest to 0? (a) -0.2 (b) 1/4 (c) -1/3 (d) -0.07 d Which is the closest to -1? (a) 2/7 (b) -7 (c) 0 c What is the closest to -0.1 in -1/2, -2.66, -1/10, 4? -1/10 What is the nearest to -8 in 1/4, -12, 5, -0.2? -12 Which is the closest to 3/13? (a) -0.4 (b) 1/3 (c) -11/5 b Which is the closest to 2? (a) -1/4 (b) -0.11 (c) -1/3 (d) 1/2 d Which is the closest to -18? (a) -3 (b) -0.4 (c) -0.019 a What is the closest to -0.02 in -0.3, -25, -2/7, -1/3? -2/7 Which is the closest to 3? (a) 13/6 (b) -4/7 (c) 4/7 (d) 4 a Which is the nearest to -18? (a) -0.2 (b) 2 (c) 8 a Which is the nearest to 7/2? (a) -2 (b) 0.02 (c) 5 (d) 0 c Which is the nearest to -1/5? (a) 3/5 (b) 0.3 (c) 4 (d) 2 b What is the closest to 0 in 1425, -4/5, -2? -4/5 What is the closest to -4/7 in -3/7, 1/29, 3, -0.4? -3/7 What is the nearest to -49/3 in -1/3, -0.5, -5? -5 Which is the nearest to -1? (a) 2 (b) 1/3 (c) 5 (d) -1/3 d Which is the closest to 0? (a) -2 (b) -5/2 (c) 2/19 (d) -0.4 c What is the nearest to -0.2 in 3, -0.34, -1, 4? -0.34 Which is the nearest to 1/9? (a) -0.3 (b) -1.1 (c) 1 a What is the nearest to 5 in 235.2, 2, 0? 2 What is the nearest to 14 in 4, -0.3, 0? 4 Which is the closest to -1/3? (a) -1/5 (b) 6 (c) -26 (d) -2 a Which is the closest to -0.4? (a) -2 (b) 1/4 (c) 3/19 (d) -11 c Which is the nearest to -1? (a) -3/10 (b) 3 (c) 2 a What is the closest to -1/3 in -10, 7, 0.3? 0.3 Which is the closest to -3? (a) 0.1 (b) 7 (c) -4/3 c What is the nearest to 2/11 in 2, 1/3, -0.2, -22? 1/3 What is the closest to -2/5 in -0.4, -2, -53, 5? -0.4 What is the nearest to -0.1 in 4/7, 5, 1.8, -3? 4/7 Which is the closest to 2? (a) -4 (b) 3 (c) 2 c What is the nearest to 0.051 in 3, -4, -2? -2 What is the nearest to 0 in 5, -0.4, -2/11? -2/11 Which is the closest to 0.2? (a) -0.2 (b) 2/7 (c) -1.05 (d) 3/7 b Which is the nearest to 12? (a) 2 (b) -1/5 (c) -7/9 (d) -4/5 a Which is the nearest to 2/7? (a) -0.3 (b) 6 (c) -3/4 (d) -79 a Which is the nearest to -5? (a) 5 (b) -3/5 (c) 2/7 b What is the closest to 3 in -1, 3, 1/4, 1? 3 What is the nearest to 1 in 3, 2, -1/5, -4? 2 Which is the nearest to 6? (a) -0.3 (b) 0.17 (c) -3/5 (d) 0.3 d Which is the nearest to 1/2? (a) 1 (b) 47 (c) 2/3 (d) -2/3 c What is the closest to -6 in 0.3, 1/11, 0.4, -3? -3 What is the closest to -4/33 in -2, 9, -3/2, -4? -3/2 Which is t	{ "pile_set_name": "DM Mathematics" }
164525.9 What is the difference between 770.751 and -751744? 752514.751 What is -147642050109 minus 0.4? -147642050109.4 What is -0.00533 minus -1827199? 1827198.99467 What is -204009 less than -62832494? -62628485 What is -0.000983822337 take away -0.0675? 0.066516177663 What is -17745125 minus 22.6123? -17745147.6123 Calculate 351027021496 + 5. 351027021501 What is -9.365852 take away 25915.8? -25925.165852 Put together -4.183 and -30742116.91. -30742121.093 Add together 86623097459497 and 2. 86623097459499 Subtract -1990 from -28.971724. 1961.028276 Add together 2292676968 and 55.28. 2292677023.28 What is -5 - -589656831551? 589656831546 Calculate 7.2864065926186 + -7. 0.2864065926186 What is the difference between -94771130935819 and 0.4? 94771130935819.4 Work out -3100.4287831 - -1.6. -3098.8287831 What is -0.17 + -184427174041? -184427174041.17 Calculate -13588 - -60611.2. 47023.2 -5 - 3499392323 -3499392328 What is the distance between 2900350.123 and -0.69? 2900350.813 Subtract 10591962.2504 from -2. -10591964.2504 Add -0.33429 and 1536947. 1536946.66571 What is 15941380.128 minus 68.4? 15941311.728 What is 4122497018 plus -2465? 4122494553 Add together 77180713879.6 and 5. 77180713884.6 Calculate 169.1 + 72332611567. 72332611736.1 What is -5 less than -902607648698? -902607648693 What is -7941 minus -29.706573705? -7911.293426295 Calculate 12547 - 100.526030185. 12446.473969815 What is -5 minus 18349447.536896? -18349452.536896 What is -1200.5986043 take away -2.106? -1198.4926043 337.6836356363 + 0.02 337.7036356363 Work out 4 + -338649918405. -338649918401 What is -25.632 take away 16327892? -16327917.632 Add -6880239614 and -1391. -6880241005 Work out -0.21395 + 138463.0579. 138462.84395 -153.440537185847 - 3 -156.440537185847 0.1+29146341041 29146341041.1 What is 675994945.3 take away 103632? 675891313.3 What is the distance between 9813 and -481337.20253? 491150.20253 What is 113.7483 less than -0.02023754? -113.76853754 What is 87839637561 - -0.622? 87839637561.622 What is 0.05 take away -59763686969? 59763686969.05 Calculate 347363583 + 0.0111. 347363583.0111 Calculate -1990403046387.53 + -0.5. -1990403046388.03 Subtract -0.31 from -41467138037. -41467138036.69 What is -5700 minus 28772965836? -28772971536 What is -0.9 minus -5406126.82? 5406125.92 What is the distance between 3 and 2538019689868.5? 2538019689865.5 Sum -389167 and -45670630. -46059797 Work out -2.451204 - -0.017486. -2.433718 Total of 238.250139683344 and 5. 243.250139683344 40517.34+-804.845 39712.495 109.78+311858284 311858393.78 What is -2409265313080.6 minus 15? -2409265313095.6 Work out -15611154 + -19493. -15630647 What is -2152.5873545 plus -5? -2157.5873545 What is 166014507 take away 1495.947? 166013011.053 Total of 0.0067384 and 0.2890913. 0.2958297 What is -2.8256261528 take away 306? -308.8256261528 Calculate -31.1 - 544588319009. -544588319040.1 Work out 49.880088437248 + -0.09. 49.790088437248 Calculate 5534850 + -3754815. 1780035 Put together 868272.03592 and 37. 868309.03592 Sum 35402052 and 0.05159. 35402052.05159 What is 265929830258869 + 0.2? 265929830258869.2 What is the difference between 5350140.095 and -2653? 5352793.095 Calculate -128477.948845 + 0.5. -128477.448845 Add together -35233 and 104.67555. -35128.32445 Add together 0.144586822563 and 0.2. 0.344586822563 Subtract -599541651 from -77784. 599463867 What is -143.028107 + -1022162? -1022305.028107 What is the distance between -2956745880729 and 0.2? 2956745880729.2 What is the distance between 0.2 and 749853922.863? 749853922.663 Work out 48 + -0.94625387132. 47.05374612868 Add 5512523910 and -1044. 5512522866 Total of 183530 and -0.33619353. 183529.66380647 Subtract -54034 from -1917462.6. -1863428.6 What is -5.7020455 take away 311? -316.7020455 What is 3787271628 - -2323? 3787273951 Add together 83115735.3 and -509. 83115226.3 What is 0.8318395021444 take away 92? -91.1681604978556 What is -263.2565 plus -0.54966896? -263.80616896 What is -1743041.6668 minus 8.5? -1743050.1668 What is 1.880638 + 38737634? 38737635.880638 What is the difference between 9943020826 and 4? 9943020822 What is -3776285501 take away 0.027209? -3776285501.027209 Put together 0.9110212057 and 3. 3.9110212057 What is -0.2 less than 1399006861310? 1399006861310.2 What is -1188.396277 plus 3.19? -1185.206277 Add together -1.019153 and 11.0896755. 10.0705225 Total of -0.312230486 and -8744. -8744.312230486 What is -22 plus 20685.31439584? 20663.31439584 11700565650.5 + 65 11700565715.5 What is the difference between 2997548376 and -2? 2997548378 Total of -732232 and -7352.879. -739584.879 Calculate -0.0011 - 47139936323. -47139936323.0011 Calculate -2.702 + -4653419538. -4653419540.702 30952 - -38513.2323 69465.2323 -4 - -362722412.2082 362722408.2082 -682661 + -818019295 -818701956 Add together -13446505100 and -362. -13446505462 Put together -14.116432784019 and 0.1. -14.016432784019 -1621258309 + -229.7 -1621258538.7 What is the difference between 4573152267 and -4032? 4573156299 Work out 0.08 + 60059837446. 60059837446.08 What is the difference between 313557 and 1390249? 1076692 Calculate -229757.4598124 - -0.27. -229757.1898124 Work out 1.811 - 1283.8390005. -1282.0280005 -252726283591+-5.2 -252726283596.2 271 + -5537763926 -5537763655 What is -6127301 take away 317.83? -6127618.83 Calculate 7 - -12316649290. 12316649297 What is -157 less than 27713436767? 27713436924 Work out -9488.3963 - -200. -9288.3963 Subtract -0.601489422 from 0.0951821. 0.696671522 What is 43866372 + 7629? 43874001 Add 3811680844 and 0.0807. 3811680844.0807 What is -1076.0432 plus -22231? -23307.0432 What is 57 - 257955209.2314? -257955152.2314 What is -281300547529.82 take away -4? -281300547525.82 What is 240852498364 plus 5? 240852498369 What is 2377711833467 minus 0.5? 2377711833466.5 What is -0.02 take away -3389939563? 3389939562.98 What is the difference between -0.0586 and 5390080.9772? 5390081.0358 What is 31.1 minus 0.059401096011? 31.040598903989 What is -12101 less than -189751144? -189739043 Work out -21067556642233 - 7. -21067556642240 What is the difference between 20332.09 and 232931.6? 212599.51 2.6+-10969.846394 -10967.246394 Add -98.2 and 372626429. 372626330.8 What is 32.195032 take away 1784.4? -1752.204968 What is 1.6 minus -325508153028? 325508153029.6 What is the difference between 34050 and 12106146? 12072096 What is -2392225998502 less than 0.11? 2392225998502.11 What is 361253648286 less than 9.75? -361253648276.25 Put together 0.708234 and 308599628. 308599628.708234 What is -2751.5603285 take away -148? -2603.5603285 What is 0.9 - -459009461878? 459009461878.9 Work out 820201 - 138566604. -137746403 What is 32430988 take away -12786656? 45217644 Work out 79085912.9 + 15.5. 79085928.4 Work out 120 - 1707654369.1. -1707654249.1 Subtract 363755496570646 from -0.4. -363755496570646.4 What is 114 minus 428754696235? -428754696121 7 - 1.79312776359 5.20687223641 What is -363 - 26301084269? -26301084632 What is the distance between 4.3 and 45185229511? 45185229506.7 What is 25 - 1336011267? -1336011242 -5526182+742399 -4783783 What is -268.6452 minus 0.07037? -268.71557 What is the difference between 0.01 and -0.59499610005? 0.60499610005 Total of -25152452404 and -0.2. -25152452404.2 Put together -123204 and -4824793. -4947997 Put together 197 and 0.164586166927. 197.164586166927 What is -815313632 plus -0.0918? -815313632.0918 What is -0.19791 - 124172273? -124172273.19791 Add 1458 and 8700.7928. 10158.7928 What is -20.31 less than -2123834126? -2123834105.69 Add together 0.06 and -107188140476.63. -107188140476.57 Work out -5 + -53246252103. -53246252108 What is -16390 - -425175560? 425159170 Work out 3 - 238895369221. -238895369218 What is -22.57883328971 less than 12? 34.57883328971 1.61 - -0.3038095800124 1.9138095800124 What is the distance between 931.21983 and -1.33? 932.54983 268898 + -601824.93 -332926.93 What is 229 - 0.142774937? 228.857225063 Work out 541537994488 + 5. 541537994493 -14099383959 - 849.2 -14099384808.2 Subtract 10430938171 from -0.4. -10430938171.4 What is -9066022240 - 60182? -9066082422 Sum -108.461 and 585250. 585141.539 What is -0.5 + 3997263268.3392? 3997263267.8392 Ca	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.