Datasets:

parameterlab
/

scaling_mia_the_pile_00_DM_Mathematics

Dataset card Data Studio Files Files and versions Community

Split (3)

train · 63.5k rows

text stringlengths 518 8.19k	meta dict
34015 to one dp. 143.3 Round 53449.39 to the nearest 10000. 50000 Round -0.001466023 to 4 dps. -0.0015 Round -4873693 to the nearest one hundred thousand. -4900000 What is 0.00001415845 rounded to six decimal places? 0.000014 Round 0.00186293 to 4 dps. 0.0019 What is -0.000151645 rounded to six decimal places? -0.000152 Round 6894.4 to the nearest one hundred. 6900 Round 529.867 to the nearest 100. 500 Round -0.002688903 to four decimal places. -0.0027 What is 0.088549 rounded to 2 decimal places? 0.09 Round -0.004659964 to four dps. -0.0047 Round 1.180477 to 1 dp. 1.2 Round -31077.66 to the nearest one hundred. -31100 Round 12.453171 to zero dps. 12 Round 0.1816898 to 4 dps. 0.1817 Round 409064.4 to the nearest 10000. 410000 Round -61592277 to the nearest 100000. -61600000 What is 10139600 rounded to the nearest one hundred thousand? 10100000 Round -0.0001215928 to 6 decimal places. -0.000122 Round 188.75195 to 1 dp. 188.8 Round -4117.06 to the nearest ten thousand. 0 What is -21537.1 rounded to the nearest one thousand? -22000 Round 0.000751248 to 4 decimal places. 0.0008 Round -51434710 to the nearest 10000. -51430000 What is -0.768362 rounded to one dp? -0.8 Round -0.00003205042 to six dps. -0.000032 What is 635.297 rounded to the nearest one thousand? 1000 Round 666.5253 to zero dps. 667 What is 25834 rounded to the nearest one thousand? 26000 What is 1.56014 rounded to 1 dp? 1.6 What is -0.000003012882 rounded to seven dps? -0.000003 What is -449948.9 rounded to the nearest 1000? -450000 Round -35.97425 to zero dps. -36 Round -0.0002089761 to five decimal places. -0.00021 What is 0.00000474931 rounded to 6 dps? 0.000005 Round -0.007607299 to 5 decimal places. -0.00761 Round -13041490 to the nearest 100000. -13000000 Round 0.0547017 to three dps. 0.055 Round 0.0068974 to 5 decimal places. 0.0069 What is -0.00008781754 rounded to 5 decimal places? -0.00009 Round 384.3842 to the nearest one hundred. 400 What is 123967880 rounded to the nearest 1000000? 124000000 What is -314.79214 rounded to the nearest ten? -310 What is 8385.27 rounded to the nearest 10? 8390 What is 0.001710848 rounded to 5 dps? 0.00171 What is -29787.96 rounded to the nearest one hundred? -29800 What is -343791 rounded to the nearest one hundred thousand? -300000 Round 0.00000729279 to 6 decimal places. 0.000007 Round 4831707 to the nearest 10000. 4830000 Round -0.0701287 to 2 dps. -0.07 Round -4.088072 to two dps. -4.09 What is -0.000719619 rounded to 5 decimal places? -0.00072 What is 548089000 rounded to the nearest one million? 548000000 What is -0.0001162997 rounded to five dps? -0.00012 What is -0.00000070408 rounded to seven dps? -0.0000007 Round -1128.486 to the nearest ten. -1130 Round 233437.1 to the nearest 100000. 200000 Round -759.188 to the nearest one hundred. -800 Round -11843000 to the nearest one million. -12000000 What is -5190700 rounded to the nearest ten thousand? -5190000 What is -0.01423791 rounded to 2 dps? -0.01 What is -6547657 rounded to the nearest 100000? -6500000 Round -0.00000713479 to seven decimal places. -0.0000071 What is -5.28948 rounded to the nearest integer? -5 Round -0.0001424579 to six dps. -0.000142 Round 21304800 to the nearest 1000000. 21000000 What is 0.0000137624 rounded to 5 dps? 0.00001 What is -0.000008280988 rounded to 7 decimal places? -0.0000083 Round -0.00766293 to 4 decimal places. -0.0077 Round 0.5863805 to 1 decimal place. 0.6 Round 1371.5618 to the nearest 10. 1370 Round -0.003744863 to 5 dps. -0.00374 What is 0.0001548667 rounded to 7 dps? 0.0001549 What is 0.00000460617 rounded to six dps? 0.000005 What is -0.00033839648 rounded to 6 dps? -0.000338 Round 376.819 to the nearest 10. 380 Round -0.0143785 to 4 decimal places. -0.0144 What is -11593.91 rounded to the nearest ten? -11590 Round -423838700 to the nearest one million. -424000000 Round 46.433733 to one decimal place. 46.4 What is -35915.6 rounded to the nearest 100? -35900 What is 0.3165981 rounded to one decimal place? 0.3 Round -828.1304 to the nearest one hundred. -800 Round -3588040 to the nearest one million. -4000000 Round 333.596 to the nearest 100. 300 Round -0.00062659 to 6 decimal places. -0.000627 Round -5.96933 to the nearest integer. -6 Round -5452.2 to the nearest 10000. -10000 What is 41202.5 rounded to the nearest one hundred? 41200 Round 0.00002357369 to six dps. 0.000024 What is -44290050 rounded to the nearest one million? -44000000 What is -0.000364666 rounded to five dps? -0.00036 Round 0.0000771735 to 7 decimal places. 0.0000772 What is -0.000682643 rounded to six decimal places? -0.000683 Round 0.05989365 to two decimal places. 0.06 Round 0.12946786 to four decimal places. 0.1295 Round 0.0001635405 to 6 decimal places. 0.000164 What is -14502.01 rounded to the nearest 10? -14500 What is 1960.708 rounded to the nearest one hundred? 2000 What is 0.092369 rounded to 4 dps? 0.0924 Round 3843.41 to the nearest one hundred. 3800 What is 0.0001599763 rounded to 6 decimal places? 0.00016 What is -2590040000 rounded to the nearest one million? -2590000000 Round 0.0006655405 to five decimal places. 0.00067 What is -0.00059677 rounded to four decimal places? -0.0006 What is -186189.73 rounded to the nearest ten thousand? -190000 Round -36051.28 to the nearest one hundred. -36100 What is 0.414 rounded to two decimal places? 0.41 What is 0.0000187229 rounded to 7 dps? 0.0000187 What is 0.00000208867 rounded to 6 dps? 0.000002 Round -5914.2137 to the nearest integer. -5914 What is -135866320 rounded to the nearest one million? -136000000 What is 59352 rounded to the nearest 10000? 60000 Round -30251.63 to the nearest one hundred. -30300 Round 1007500 to the nearest one hundred thousand. 1000000 What is -41021.508 rounded to the nearest 100? -41000 What is -0.002759914 rounded to 3 dps? -0.003 Round -6431.47 to the nearest 10. -6430 Round -0.01992107 to 4 dps. -0.0199 What is 424457.08 rounded to the nearest 100? 424500 Round -0.3354899 to four dps. -0.3355 What is -2832068 rounded to the nearest one million? -3000000 Round 1480119 to the nearest one hundred thousand. 1500000 Round 78119400 to the nearest one hundred thousand. 78100000 Round 6074520 to the nearest ten thousand. 6070000 What is 133.64 rounded to the nearest 10? 130 What is -0.004854 rounded to 4 decimal places? -0.0049 What is 0.00821728 rounded to 5 decimal places? 0.00822 What is -17123.53 rounded to the nearest one thousand? -17000 Round 0.055034 to one dp. 0.1 Round -0.05928629 to 3 dps. -0.059 What is -0.007114191 rounded to 6 dps? -0.007114 Round 0.000205106 to 5 dps. 0.00021 What is -68280520 rounded to the nearest 1000000? -68000000 What is 162.18461 rounded to 1 decimal place? 162.2 What is 0.0000769606 rounded to five dps? 0.00008 What is -2070.88 rounded to the nearest 100? -2100 Round 1.4191 to the nearest integer. 1 Round -0.254463 to three dps. -0.254 What is 0.000331301 rounded to six decimal places? 0.000331 Round 8551.85 to the nearest one thousand. 9000 What is 4174120 rounded to the nearest one thousand? 4174000 What is 0.00000426368 rounded to six decimal places? 0.000004 What is 25790000 rounded to the nearest 100000? 25800000 Round -23401700 to the nearest one hundred thousand. -23400000 What is -26891600 rounded to the nearest ten thousand? -26890000 What is 0.15859 rounded to three decimal places? 0.159 Round 2.742283 to three decimal places. 2.742 Round 11.28081 to two dps. 11.28 What is 0.000005332997 rounded to 6 decimal places? 0.000005 What is 2.92281 rounded to 1 decimal place? 2.9 What is 7106.46 rounded to the nearest 1000? 7000 What is 0.12942801 rounded to 4 dps? 0.1294 What is -0.000895934 rounded to five decimal places? -0.0009 Round 492.6231 to the nearest ten. 490 Round 17875.68 to the nearest 1000. 18000 What is -13626.89 rounded to the nearest 10000? -10000 Round 0.00004007784 to seven dps. 0.0000401 What is 1043.2072 rounded to the nearest one hundred? 1000 Round -0.00008796306 to six dps. -0.000088 What is -0.0002066887 rounded to seven decimal places? -0.0002067 Round 9.94734 to the nearest integer. 10 What is 211.461 rounded to the nearest one hundred? 200 What is 70320.7 rounded to the nearest ten thousand? 70000 Round 825.1666 to 1	{ "pile_set_name": "DM Mathematics" }
osest to -2/15? (a) 0.2 (b) 3694 (c) -1 a Which is the nearest to -2/3? (a) -6 (b) 0.06 (c) 25/46 (d) 3/2 (e) 0.1 b Which is the nearest to 1/3? (a) 2/11 (b) 38 (c) -2 (d) 8 (e) 3.3 a Which is the nearest to 1? (a) -30512/13 (b) -2/7 (c) 2 c Which is the nearest to -2? (a) -1 (b) 198/25 (c) -2/9 a Which is the nearest to 4/5? (a) 3.4 (b) 0.4 (c) 4 b What is the closest to 5 in 21/4, -0.9, -0.1, -15, -4? 21/4 Which is the closest to 0.1? (a) 1/191 (b) -102 (c) -2/3 a What is the closest to -105 in -4, 0.1, -0.2, -49? -49 What is the nearest to -3 in 6, -1, 0.018, -0.1? -1 What is the closest to 1 in 7, -0.01, 1/13, -1? 1/13 What is the nearest to 1 in -3, -0.3, 3/8, -2/13, 0.9814? 0.9814 What is the nearest to 69 in 0.2, 0.09, -0.1, 7? 7 What is the nearest to -1274 in -0.2, 1/5, 4/5? -0.2 What is the closest to 0.2 in 0.09, -2/7, -2/13, -9? 0.09 Which is the nearest to -48? (a) -8 (b) 5 (c) 0.5 a What is the closest to 167 in -286, 1, 2/19? 1 Which is the nearest to -0.658? (a) -34 (b) -19 (c) 0.3 c What is the nearest to 0.3 in 2/21, -2/15, -3.3, 0.5, 0.32? 0.32 Which is the nearest to 1/4? (a) -4/7 (b) 0.5 (c) 5 (d) 0.0299 d Which is the nearest to 36? (a) 359 (b) 3 (c) 4 (d) -4 (e) 0.1 c Which is the nearest to 1? (a) -0.54 (b) 5 (c) -18/2419 c What is the closest to -0.2 in -2/13, 2/5, 2/565? -2/13 Which is the closest to 371? (a) -3/7 (b) -3 (c) -1 (d) 33 d Which is the nearest to -6? (a) 185 (b) 38 (c) -5 c What is the nearest to -0.5 in 40, 0, 0.126, 1? 0 Which is the nearest to -1? (a) -4 (b) 1/10 (c) -4/15 (d) -0.1 (e) -1/11 c What is the nearest to 2 in 1.28, 2, 5, 0.2, 3? 2 What is the nearest to 2 in -2, 0.13, 3/67, 5? 0.13 What is the nearest to -0.29 in 1/4, 0, -489? 0 What is the nearest to 1/2 in -1/3, -318, 3/20? 3/20 Which is the closest to 0? (a) -1/5 (b) 1.5 (c) 2/21 (d) -13 (e) -3 c What is the nearest to 2 in -2/15, -2/57, 5363? -2/57 Which is the closest to -1? (a) 2/9 (b) 0 (c) 4/1059 (d) 1 b What is the nearest to 5 in 0.032, 14, 0.1? 0.1 Which is the nearest to 0? (a) 80 (b) 2/129 (c) -0.1 b Which is the nearest to -3? (a) 4 (b) -2/5 (c) 1 (d) 14/3 b Which is the nearest to -3? (a) 4 (b) -2.32 (c) -0.23 b What is the nearest to 2.2 in -14/5, 5, 9/5? 9/5 Which is the closest to 2/237? (a) -4 (b) 0.2 (c) -3 (d) -2 (e) 1 b Which is the closest to -1.7569? (a) -0.3 (b) -4 (c) 0.1 a What is the nearest to -0.2 in -14, -0.3, 4/97, -3? -0.3 Which is the nearest to -1? (a) -1/5 (b) 0.2 (c) -0.14 (d) 127 a What is the nearest to 0 in -2, -13/2, 0.08, 0.1? 0.08 What is the nearest to -15 in -596, -3, 0, -4/7, 3? -3 Which is the nearest to -3? (a) 2 (b) -4 (c) -12 (d) 11/2 b What is the closest to 3/5 in 9, -1, -3822? -1 What is the closest to 0.04 in 45, 3, -4, 0.1? 0.1 What is the closest to 15 in -6, -24, 0.4, 5? 5 Which is the nearest to -6/23? (a) 0.4 (b) 11 (c) -15 (d) -2/9 d Which is the closest to 0.3? (a) -6 (b) -2/7 (c) -19 (d) -2/9 (e) 3 d What is the nearest to 1/2 in 4, -1, -0.5, -4? -0.5 What is the closest to -5 in 7, 2, 1/85? 1/85 Which is the closest to -0.2? (a) -3 (b) -2 (c) 4/7 (d) -654 c Which is the nearest to -351? (a) -2 (b) 1.1 (c) 0 (d) -0.1 a What is the closest to -2 in -12/11, -4/5, -1, 51? -12/11 What is the nearest to -3/85 in 0.4, -9/4, -2? 0.4 What is the closest to -1/2 in 1/10, -1/658, -4/7, 5? -4/7 What is the closest to -2/3 in 1/3, 5, 2769? 1/3 Which is the nearest to 0.8? (a) -0.08 (b) 0.07 (c) 0.38 c Which is the closest to -1538? (a) -2/9 (b) -3 (c) 0 b Which is the closest to 0.3? (a) 1 (b) 0.11 (c) -2 (d) 0.4 (e) 14 d Which is the nearest to -2? (a) -328 (b) -5 (c) 30 b Which is the nearest to 11? (a) -5 (b) 0.4 (c) 0.04 (d) 3 d Which is the closest to -5? (a) -0.2 (b) -2057 (c) 0.1 (d) 2/29 (e) 1 a What is the nearest to 2 in -1019, 2/9, -4, -0.2? 2/9 What is the closest to 2/889 in 15, -0.5, 0.01, 5? 0.01 What is the closest to -1/2 in -25/2, 7, -7, -0.06? -0.06 What is the nearest to 2 in 0.6, 3, -0.2, -7, -0.5? 3 Which is the nearest to -0.1? (a) 37 (b) 9 (c) -82 b What is the closest to -895 in -0.5, -2, -109? -109 What is the nearest to -2 in -1164, 13, -7, -2/15, -5? -2/15 Which is the closest to -2? (a) -699 (b) -1/6 (c) -0.5 c What is the nearest to 3 in 5, 18/679, -0.5? 5 Which is the closest to -1/3? (a) 0.5 (b) -16/3 (c) 2.1 a Which is the closest to -1? (a) -2 (b) 27 (c) -5 (d) 3.17 a What is the nearest to 25.7 in -5, -3, 4.6, -0.1, 1? 4.6 Which is the closest to 12? (a) -0.7 (b) 1 (c) -493 (d) -2/17 b Which is the closest to -255? (a) -1 (b) 0.1 (c) 207 (d) -2 d Which is the nearest to -5.68? (a) 2/7 (b) -0.08 (c) 1/6 b What is the closest to -3/7 in 1.196, 0.5, 0.1? 0.1 What is the nearest to 0.1 in -2, -3038, 5, -4/9? -4/9 Which is the closest to 0? (a) 4/9 (b) -2 (c) -1 (d) -357 (e) 0.5 a Which is the nearest to -18? (a) 0.044 (b) 0.2 (c) -0.4 c Which is the nearest to -1/26? (a) -11 (b) 2/17 (c) -4 (d) -0.4 (e) 0.1 e What is the nearest to -1 in 0.634, 0.1, -22? 0.1 Which is the nearest to -2/5? (a) -0.2 (b) 2.5 (c) 32 a What is the closest to -6 in 1349, -0.4, -2/9, 3, -1? -1 What is the nearest to -39.2 in -4, -0.2, 1/109, -3? -4 Which is the closest to 0? (a) 2 (b) 57 (c) 0.08 (d) 4 (e) 5 c Which is the nearest to 0.56? (a) -1/8 (b) -54 (c) 0 (d) 5 c What is the closest to 2 in 205, 0, 16/15? 16/15 What is the nearest to -73 in 0.5, -124, 1/3? -124 Which is the nearest to 0? (a) 4 (b) -18 (c) 6 (d) 1 (e) -0.6 e What is the closest to -2/3 in -49780, 1/2, -4? 1/2 What is the nearest to -15 in -0.4, -30, 2, -0.1? -0.4 Which is the closest to -2? (a) -4 (b) -2/3 (c) -1/5 (d) 1/3 (e) 49/4 b Which is the nearest to 0.3? (a) -0.04 (b) 5 (c) -0.1 (d) -1/5 a Which is the nearest to 1? (a) 0.01 (b) -1/11 (c) -1/5 (d) 8 (e) 2/5 e Which is the closest to -8? (a) -3 (b) 5/14 (c) -1 a What is the nearest to -2/7 in -0.2, -10/3, -2, -20.7, 0.02? -0.2 Which is the closest to -0.1? (a) 3/5 (b) -5 (c) -2/9 (d) 4.994 c Which is the nearest to 1? (a) 1/13 (b) 2/9 (c) -2/15 (d) -149 (e) -3 b Which is the nearest to -2? (a) 32 (b) 39 (c) -2/13 c What is the closest to -0.77 in 1562, 5, 0.1? 0.1 What is the closest to -1 in 4, -21, 0.08, -1? -1 What is the nearest to -6/11 in 26, 0.5, -3, -0.1, -1/5? -1/5 What is the nearest to 0.2 in 7, -1, -631? -1 Which is the nearest to -2/7? (a) 0.39 (b) -15/4 (c) -1.05 a Which is the nearest to 2? (a) -3 (b) -265 (c) 0.6 (d) -0.1 (e) 0.4 c What is the nearest to 157/3 in -3, -4, -0.2? -0.2 What is the closest to -1/3 in -3, 3/2, 0.3, -1/45? -1/45 What is the nearest to -5 in -1/2, 3, 8/11, -0.018? -1/2 What is the nearest to 0 in 2, 2/9229, -0.2, 0.1? 2/9229 What is the nearest to -1 in -7.777, 0.2, -2, 1? -2 What is the closest to -0.3 in -2383, 0, -1/5, -2/3? -1/5 Which is the closest to 1.21? (a) 1 (b) -2/37 (c) -0.3 (d) -0.5 (e) 5 a What is the closest to 2/5 in 0.0523, 5, -5, 0, 4? 0.0523 Which is the closest to 2? (a) -0.3623 (b) 0.05 (c) 1/4 (d) 1 (e) 5 d Which is the closest to -2? (a) 7 (b) 2/3 (c) 51 (d) 0.1 d Which is the closest to -10? (a) 0.1 (b) -4.892 (c) 0 b Which is the nearest to 1? (a) -0.5 (b) 0.06 (c) 0.4 (d) -7 (e) -73 c What is the closest to 1 in 1, 96, 17/5? 1 Which is the nearest to -0.2? (a) -1/43 (b) -8 (c) -3 (d) 4/5 a Which is the nearest to -1288? (a) 1/29 (b) -0.2 (c) -5 c Which is the nearest to 25? (a) -100.9 (b) 5 (c) -1 (d) 0.5 b Which is the closest to -268? (a) 0.1 (b) -4 (c) -3 (d) -5 d Which is the nearest to 0? (a) 3 (b) -5/4 (c) 0.191 (d) 1 c What is the nearest to 4/5 in -2/3, 23/13, 3, -55? 23/13 What is the nearest to 2/45 in 3, 0.4, 84, -2/9, 2/7? 2/7 What is the nearest to -1/5 in -3, -231/2, -0.1, 0.061? -0.1 What is the nearest to -8 in -0.38, -13, -7? -7 Which is the closest to 6? (a) 37/11 (b) 3 (c) -0.08 (d) -1 (e) -12 a Which is the closest to 0.24? (a) 0.1 (b) 0.03 (c) 113 (d) 3/4 a Which is the closest to -0.1? (a) 5 (b) -3 (c) 3 (d) -2.5 d What is the closest to 90/7 in -28, 2/5, 1? 1 Which is the closest to -1/3? (	{ "pile_set_name": "DM Mathematics" }
ch that -2vs + v5 + v2 + 3v*3 + 0v*3 - 3v4 = 0. 0, 1 Let x(k) be the first derivative of -k5/15 + 7k4/12 - k3 - 9k*2/2 + 18k + 37. Factor x(m). -(m - 3)*3(m + 2)/3 Let o = 611 + -609. Factor -6/5 - 8/5l - 2/5l*o. -2(l + 1)(l + 3)/5 Let f(v) be the first derivative of v6/9 - 2v5/15 - v4/3 + 4v3/9 + v2/3 - 2v/3 + 3. Factor f(c). 2(c - 1)3(c + 1)*2/3 Let y be (-104)/782/10-3. Solve -yl*2 + 0 + 0l + 2/5l3 = 0 for l. 0, 2 Let m be (70/(-25) - -3) + (-43)/(-35). Solve -2a + 6/7 - 2/7a3 + ma*2 = 0. 1, 3 Let h = 10 - 5. Factor -2r*4 - 4r4 - r5 - 2r2 + 3r*h + 6r*3. 2r*2(r - 1)*3 Let r be (-3 - 45) + 2 + 1. Let k = r - -181/4. Factor k + 1/4b*2 - 1/2b. (b - 1)2/4 Let u(o) = o3 + o*2 - o. Let r be u(0). Factor -1/2f - 1/2f3 + r - f2. -f(f + 1)*2/2 Suppose 3q = -5a + 2a + 3, -2a - 16 = -4q. Let 16s2 - 15s2 - s3 + s + 0sq + 2s*4 - 3s*4 = 0. Calculate s. -1, 0, 1 Suppose 0 = 5c + 1 - 11. Let p(m) be the first derivative of -2/7m2 + 2/21m*3 + 0m - c. Determine s, given that p(s) = 0. 0, 2 Determine z, given that -3z2 + z2 + 5z*2 = 0. 0 Let h = 176 - 111. Factor -8i3 - i2 - 3i2 - hi + 73i + 4i*4. 4i(i - 2)(i - 1)(i + 1) Let x be 2 + -1 + 5 + -3. Suppose 4/3l*2 + 0 - 2/3l*x + 0l = 0. What is l? 0, 2 Let b(m) be the third derivative of 0m4 - 1/20m*5 - 3/70m*7 + 5m*2 + 0m + 0 + 0m3 + 3/40m*6 + 1/112m*8. Factor b(t). 3t*2(t - 1)*3 Suppose -10p - 12 = 4y - 6p, 3y + 5p + 15 = 0. Factor 0k3 + yk - 2/5k4 + 4/5k*2 - 2/5. -2(k - 1)*2(k + 1)2/5 Let x(y) be the first derivative of -y4/18 + 10y3/27 - 4y*2/9 + 21. Factor x(d). -2d(d - 4)(d - 1)/9 Let f(b) = -b3 + b2 + 2. Let p be f(0). Let z(q) be the second derivative of 0 - 4q + 1/42q*4 + 2/21q*3 + 0q*p. Suppose z(j) = 0. What is j? -2, 0 Let f(g) = -4g*3 + 5g*2 - 6g - 5. Let j(u) = -3u3 + 4u*2 - 5u - 4. Let q(i) = 4f(i) - 5j(i). Factor q(t). -t(t - 1)(t + 1) Let s be 0 + (-12)/(-9)(-6)/(-28). Factor so*2 - 6/7o + 4/7. 2(o - 2)(o - 1)/7 Let l be ((-6)/(-4))/((-135)/35). Let g = l + 8/9. Suppose -1/2t2 - t - g = 0. Calculate t. -1 Let r be (-7 + 8)/(-2 - 102/(-36)). Factor 0 + 6/5t - rt3 - 3/5t*4 + 3/5t*2. -3t(t - 1)(t + 1)(t + 2)/5 Let q(g) be the second derivative of g7/42 + 7g*6/30 + 2g*5/5 - 4g*4/3 - 14g. Determine u, given that q(u) = 0. -4, 0, 1 Let a(v) be the first derivative of v*7/7 - 11v*6/15 + 4v*5/5 + 2v*4/3 - 5v - 4. Let o(h) be the first derivative of a(h). Let o(c) = 0. What is c? -1/3, 0, 2 Let k(h) = 3 - 4h3 + 4h - h*3 + 3h*3 - 2h*2 + 0h. Let x(z) = -9z3 - 8z*2 + 17z + 13. Let q(t) = 26k(t) - 6x(t). Suppose q(v) = 0. Calculate v. 0, 1 Let r(z) be the third derivative of -z5/420 - z4/14 - 6z3/7 + 17z*2. Suppose r(y) = 0. What is y? -6 Factor 10c*2 + 20 + 9353c*3 - 9348c*3 - 35c + 0c. 5(c - 1)*2(c + 4) Let c(q) be the first derivative of 5q6/21 + 34q*5/35 + 3q*4/2 + 22q*3/21 + 2q*2/7 + 16. Find r such that c(r) = 0. -1, -2/5, 0 Let -28/9v - 16/9v2 + 8/9 = 0. Calculate v. -2, 1/4 Let l(x) be the third derivative of -x6/720 - x5/180 + 7x*2. Determine o, given that l(o) = 0. -2, 0 Suppose -2 - 30 = 4j. Let q = -5 - j. Let -1/4d + 1/4d*q - 1/4d*4 + 0 + 1/4d2 = 0. What is d? -1, 0, 1 Let r(x) be the third derivative of -x7/70 + x6/40 + x5/20 - x*4/8 - 2x*2. Factor r(s). -3s(s - 1)2(s + 1) Suppose -25 = -7a + 2a. Let q(j) be the second derivative of -1/18j4 + 1/3j*2 + 1/30j*a - 1/9j*3 - j + 0. Let q(k) = 0. What is k? -1, 1 Factor -5 + 11l - 2l2 + 6 - 9 - l. -2(l - 4)(l - 1) Factor -2/7k + 2/7k3 + 0 + 2/7k*4 - 2/7k*2. 2k(k - 1)(k + 1)*2/7 Solve -4/3x + 4/9 + 4/3x2 - 4/9x*3 = 0. 1 Let f be (-40)/7014/(-4). Let x(y) be the first derivative of 2 + 0y - 1/2y*3 - 1/4y*f. Determine i, given that x(i) = 0. -1/3, 0 Let f(y) be the third derivative of 0y*5 + 0y + 0y7 + y2 + 1/112y*8 + 0 + 0y*3 + 0y*4 - 1/40y*6. Factor f(m). 3m*3(m - 1)(m + 1) Determine s, given that 2/3s + 0 - 4s4 - 14/3s*3 + 0s*2 = 0. -1, -1/2, 0, 1/3 Let p(i) be the third derivative of 2i7/105 + i6/30 - 19i2. Factor p(o). 4o*3(o + 1) Let q(r) be the second derivative of -2r7/105 + 26r*6/75 - 12r*5/5 + 112r*4/15 - 128r*3/15 - 3r. Factor q(n). -4n(n - 4)*3(n - 1)/5 Factor -2d3 - 16/5d*2 + 0 + 8/5d. -2d(d + 2)(5d - 2)/5 Let i(q) = 3 + 17q3 - 16q*3 + 4 - 8q. Let l(p) = p*3 - 9p + 8. Let x(s) = -6i(s) + 5l(s). Determine v, given that x(v) = 0. -2, 1 Let g(w) be the first derivative of 2/7w2 + 2/35w*5 + 0w*3 - 1/7w*4 - 3 - 2/7w. Factor g(y). 2(y - 1)3(y + 1)/7 Let z be (10 - (2 - -3)) + 42/(-9). Factor 0 + 1/3y2 - zy. y(y - 1)/3 Let r(h) = h5 - 3h*4 + 10h*3 - 12h*2 + 7h - 3. Let d(z) = z*5 - 2z*4 + 10z*3 - 13z*2 + 8z - 4. Let v(t) = -2d(t) + 3r(t). Factor v(l). (l - 1)*5 Factor -8/11 - 12/11j*2 - 18/11j - 2/11j3. -2(j + 1)*2(j + 4)/11 Let c(b) be the first derivative of 5b3/3 - b2/2 + 3. Let p(a) = 4a*2 - a. Let l(q) = 3c(q) - 4p(q). Let l(n) = 0. Calculate n. 0, 1 Let t = -100 + 104. Let a(c) be the second derivative of 8/9c*3 - 3c - 17/36ct + 0 - 2/3c*2 + 1/12c*5. Factor a(v). (v - 2)(v - 1)(5v - 2)/3 Let s(x) be the second derivative of -3x3 + 27/2x*2 + 6x + 1/4x4 + 0. Factor s(p). 3(p - 3)2 Let o(n) be the second derivative of n5/80 + n*4/12 + 5n3/24 + n2/4 + 3n. Let o(t) = 0. What is t? -2, -1 Let x(t) be the first derivative of -t6/480 - t5/240 - t2 + 1. Let b(a) be the second derivative of x(a). Factor b(y). -y2(y + 1)/4 Let l be (-87)/360 - (-3)/12. Let o(w) be the third derivative of -2w2 + 0 + 0w*3 + 0w + 1/48w4 - lw*5. Factor o(d). -d(d - 1)/2 Let b(d) = d*3 - 6d*2 + d + 1. Let g be b(3). Let n = -14 - g. Find v, given that nv - 8v2 - 9v + 8v3 - 2v*4 = 0. 0, 2 Let x be 1/(((-1)/(-1))/8). Let t be (-3)/(-12) + (-2)/x. Solve -18/11d*5 + 8/11d*2 + t - 24/11d*4 + 4/11d*3 - 2/11d = 0. -1, 0, 1/3 Let l(d) be the second derivative of -d4/60 - d3/15 + 15d. Find j such that l(j) = 0. -2, 0 Let m(q) = -2q - 3. Let i be m(-4). Suppose -3s - y = 3y - 9, s - iy - 3 = 0. Factor -sx + 2 - 2x2 + 3x. -2(x - 1)(x + 1) Solve 7i2 + 10 + 5i - 18i2 - 4i2 = 0 for i. -2/3, 1 Let q(s) be the second derivative of -s6/75 + s*5/50 + 2s*4/15 - 4s*3/15 - 8s. Suppose q(l) = 0. Calculate l. -2, 0, 1, 2 Suppose 3j3 + 8j*4 - 5j*3 - 3j*5 - 3j*5 = 0. Calculate j. 0, 1/3, 1 Let s be -1 - (-3 + 0/(-3)). Suppose 2l - 3l4 - sl*3 - 2l*4 + 3l*4 + 0l + 2l2 = 0. What is l? -1, 0, 1 Let b(m) be the third derivative of -m7/3360 + m6/480 - m5/160 + m4/96 + 7m*3/6 + 4m2. Let k(t) be the first derivative of b(t). Factor k(w). -(w - 1)3/4 Let u be 16/(-64)(-1 - 15). Let n(k) be the second derivative of -1/15k*6 + 0k*2 + 0 + 1/2k*u + 0k*5 - 2/3k*3 + 2k. Suppose n(r) = 0. Calculate r. -2, 0, 1 Let c(w) be the third derivative of 1/21w4 - 3w*2 + 1/1260w*6 + 0w + 1/6w3 + 0 + 1/105w*5. Let i(a) be the first derivative of c(a). Factor i(l). 2(l + 2)*2/7 Let i = -14 + 17. Let c(b) be the second derivative of 1/15b*6 - 3/20b*5 + 0 + b + 0b*i + 0b*2 + 1/12b*4. What is n in c(n) = 0? 0, 1/2, 1 Let h = 167 - 311/2. Let a = 73/6 - h. Suppose 1/3g + 1/3g2 - a = 0. What is g? -2, 1 Let v(i) be the first derivative of -7i*4/26 - 10i*3/39 + 2i*2/13 + 3. Factor v(x). -2x(x + 1)(7x - 2)/13 Suppose 0 = -2l + 3u + u + 20, l - 3u = 15. Let r(v) be the first derivative of 4 + 1/3v6 + 0v*2 + 2/5v*5 + lv*4 + 0v*3 + 0v. Factor r(n). 2n4(n + 1) Find t such that -4/3t2 + 0 - 2/3t - 2/3t3 = 0. -1, 0 Let l be (-1 - 1)18/4. Let j = l - -11. Factor 4/3b + 0 - jb*3 - 2/3b*2. -2b(b + 1)(3b - 2)/3 Factor 5l*4 - 5l*4 - 2l4 - l5 - l*5. -2l*4(l + 1) Suppose 4z + g - 3 = 0, -3g - 2g = 25. Let f(w) be the first derivative of -1/2w*z + 3 + 0w - 1/4w4 - 2/3w**3. Le	{ "pile_set_name": "DM Mathematics" }
ivative of 0i - zi*5 + 0i*3 + 0 - 2i*2 + 0i4. Factor r(m). -m2 Let m = 26 - 19. Let y(k) be the second derivative of 1/90k6 + k + 1/18k*3 - 1/18k*4 + 0 + 1/126k*m - 1/30k*5 + 1/6k2. Factor y(z). (z - 1)2(z + 1)3/3 Let h = 5 - 3. Find z, given that -2z*4 + 4z2 - z2 + 3zh - 4z + 0z4 = 0. -2, 0, 1 Let g be (-32)/((-22)/6 + 20/30). Factor 8/3q*2 + gq + 2/9q3 + 128/9. 2(q + 4)*3/9 Suppose 10 = 5j + s, -5j - 3s + 8s = -40. Let y(t) be the third derivative of 0t - 1/15t5 - t2 - 1/9t*j - 1/72t*6 - 1/8t4 + 0. Factor y(h). -(h + 1)2(5h + 2)/3 Let t(z) be the first derivative of 81/10z5 - 2z - 9z2 - 77/6z*3 + 3 + 9/2z4. Solve t(u) = 0. -1, -2/9, 1 Let y(n) = n2 + 2n - 1. Let k be y(-3). Let z be 10/(-15)-13. Solve -ck - 3c*2 - 2c3 - c4 + 3cz = 0 for c. -1, 0 Let h = 138 - 134. Let r(g) be the third derivative of 0g + 0 + 1/300g5 + 1/60g*4 + hg*2 + 1/30g3. Let r(i) = 0. What is i? -1 Let b(r) be the second derivative of -r6/900 - r5/300 + r4/30 - 2r3/3 - 2r. Let y(s) be the second derivative of b(s). Suppose y(u) = 0. Calculate u. -2, 1 Let h be (3/6)/((-1)/(-10)). Let a = h + -3. Factor -ar3 + 2r + 4r2 - 2r*2 - 4r*2 + 1 + 1. -2(r - 1)(r + 1)2 Let b(i) be the third derivative of -i6/180 - i5/90 + i4/36 + i3/9 - 3i*2. Factor b(u). -2(u - 1)(u + 1)2/3 Let i(k) = -k2 - 6k + 2. Let u be i(-6). Let s(x) be the first derivative of u - 2/15x3 - 4/5x*2 - 8/5x. Let s(w) = 0. What is w? -2 Find f such that 1 + 0f2 + 1 - f4 + 2f2 - 3 = 0. -1, 1 Let z(d) = d3 - d*2 - d. Suppose 5j + 15 = 0, 4o - 4j = 5 - 1. Let n(x) = -2x3 + x2 + 4x + 2. Let i(h) = oz(h) - 2n(h). Factor i(a). 2(a - 2)(a + 1)*2 Let i be ((-1)/(-126))/((-24)/(-9) + -1). Let t(y) be the third derivative of 0y + 1/60y6 - y2 - iy*7 + 0y*5 - 1/12y*4 + 1/6y3 + 0. Factor t(d). -(d - 1)3(d + 1) Let s(j) be the third derivative of j9/7560 - j8/1680 + j7/1260 - j4/8 - j2. Let n(d) be the second derivative of s(d). Factor n(a). 2a*2(a - 1)*2 Suppose t + 638 = -4r, -5r + t = -t + 804. Let u = r + 803/5. Find y, given that -3/5y*4 + 3/5y*2 - uy + 3/5y3 + 0 = 0. -1, 0, 1 Let s(k) = 13k*4 + 16k*3 - 33k*2 - 25k + 11. Let y(t) = -3t4 - 4t*3 + 8t*2 + 6t - 3. Let x(h) = -2s(h) - 9y(h). Factor x(q). (q - 1)*2(q + 1)(q + 5) Let p(m) be the third derivative of -m6/540 + m5/180 + m3 - 8m*2. Let a(o) be the first derivative of p(o). Factor a(w). -2w(w - 1)/3 Suppose -f - 7c + 15 = -4c, c - 37 = -3f. Suppose -2w - 2w = -f. Solve -4m - m2 + 2m + wm2 = 0 for m. 0, 1 Let z = 119 - 116. Let q(u) be the second derivative of 1/12u*4 + 0u*2 - 1/30u*6 + 0 - 2u - 1/20u5 + 0u*z + 1/42u7. Factor q(c). c2(c - 1)2(c + 1) Let m(a) be the first derivative of a*4/66 - 4a + 2. Let n(s) be the first derivative of m(s). Let n(g) = 0. Calculate g. 0 Suppose 0 = 9r - 67 - 149. Find v such that -16/3 - 20v*2 - 14/3v*3 - rv = 0. -2, -2/7 Let a(c) be the third derivative of -5c6/6 + 9c*5/4 - 5c*4/24 - 5c*3 + 24c*2. Factor a(w). -5(w - 1)(4w - 3)(5w + 2) Let q be -2 - (2/(-2) + -4). Factor 4m4 - 4m4 + mq - 2m4 + m5. m3(m - 1)2 Let x(j) = j3 - 2j2 - j - 4. Let u(t) = 1. Let f(i) = i2 + 3i + 2. Let z be f(-4). Let d be (-3)/z - (-3)/(-6). Let a(g) = dx(g) - 6u(g). Factor a(s). -(s - 2)(s - 1)(s + 1) Suppose -8p - 6p = 0. Let v(w) be the third derivative of 0w3 + p + 1/40w*6 - 1/20w*5 - 3w*2 + 1/70w*7 + 0w + 0w4 - 1/112w8. Solve v(t) = 0. -1, 0, 1 Let f(y) = -y2 - 22y + 77. Let m be f(-25). What is s in 48/7s*4 + 0s + 2/7sm + 32/7s*5 + 18/7s*3 + 0 = 0? -1, -1/4, 0 Let j = 5 + -19/4. Let 0 + 1/2y*2 + jy + 1/4y3 = 0. What is y? -1, 0 Let x(i) be the second derivative of 0i*2 + 0 - 1/10i*5 + 1/45i*6 - 4i + 0i3 + 0i*4. Determine b so that x(b) = 0. 0, 3 Suppose 4m = 11m. Solve m + 1/2t - 1/2t2 = 0. 0, 1 Let n(t) = -11t*4 + 11t*3 + 11t*2 - 11t - 9. Let z(y) = -3y4 + 3y*3 + 3y*2 - 3y - 2. Let j(g) = -2n(g) + 9z(g). Factor j(x). -5x(x - 1)*2(x + 1) Suppose -4n - 4l = -36, l = 4n - 0n - 16. Suppose 0 = -na - 0a. Factor 1/4s2 - 1/4s + a. s(s - 1)/4 Let v(r) be the first derivative of -r5/150 - r4/30 - r3/15 + r2 - 1. Let k(s) be the second derivative of v(s). Factor k(b). -2(b + 1)*2/5 Solve 10/7o*3 - 4/7o*2 + 2o*4 + 0o + 0 = 0. -1, 0, 2/7 Factor 27/4b + 3/4b*2 + 6. 3(b + 1)(b + 8)/4 Let n(d) = d3 + 3d*2 - 4d. Let q be n(-4). Let v = -831/7 - -119. Factor -2/7 + qy + vy*2. 2(y - 1)(y + 1)/7 Let t = 8 - 4. Suppose -3z + 3 = -3h, 3h + t = z + 7. Factor m + m*5 - 2m*z + 4 - 4. m(m - 1)*2(m + 1)*2 Let n(b) be the first derivative of 0b*3 - 2 + 0b - 1/6b4 + 1/3b*2. Let n(a) = 0. Calculate a. -1, 0, 1 Let z(j) = 4j*3 + 53j*2 + 143j + 73. Let g(c) = c*3 + 27c*2 + 72c + 37. Let d(a) = 7g(a) - 3z(a). Solve d(l) = 0 for l. -1, 8 Suppose 0 = -0j + 5j - 10. Factor 24 - 3l3 - 6l*2 + 10l - jl + 4l. -3(l - 2)(l + 2)2 Let x(m) = m2 - 5m + 3. Let f be x(5). Factor -q - 4q*f + 6q3 - q3. q(q - 1)(q + 1) Factor 19j2 - 6j*2 - 6j*2 - 6j*2 + 6j + 9. (j + 3)*2 Let g(i) = 2i*3 + 6i*2 + 2. Let v be g(-3). Factor 0 + 1/2n*v - n. n(n - 2)/2 Let j be (-5 + 7)(-6)/(-9). Solve 2x*4 + 2/3x*3 - j - 6x - 6x2 = 0. -1, -1/3, 2 Let v(u) be the first derivative of 13/4u*4 - 7/4u*2 + u - 5 + 7/4u*6 - 2u*3 + 5u*5. Find f such that v(f) = 0. -1, 2/7, 1/3 Let r(x) = 5x*3 - 6x*2 - 6x + 6. Let v(i) = 4i3 - 5i*2 - 5i + 5. Let z(f) = 5r(f) - 6v(f). Determine q so that z(q) = 0. 0 Let u(k) be the second derivative of k*4/54 + 11k*3/27 - 4k*2/3 + 29k. Factor u(y). 2(y - 1)(y + 12)/9 Factor 2/5z + 0 + 1/5z*3 + 3/5z*2. z(z + 1)(z + 2)/5 Let q(x) be the third derivative of 0x*3 - 1/24x4 + 0 - x2 - 1/120x6 + 1/30x*5 + 0x. Determine b, given that q(b) = 0. 0, 1 Let x(i) be the second derivative of -i6/2160 - i5/360 - i*3/2 - 6i. Let s(a) be the second derivative of x(a). Factor s(d). -d(d + 2)/6 Let u be (20/15)/(2/6). Suppose 0 = -v - 3s + 5, -v - uv + 6 = -4s. Factor -2d4 - 2/3d*v - 2d*3 + 0d + 0 - 2/3d5. -2d*2(d + 1)3/3 Let d(o) be the third derivative of o5/20 - 3o4/8 + o3 - 3o*2. Suppose d(u) = 0. What is u? 1, 2 Let j(b) be the first derivative of -2b5/35 + b4/14 - 26. Factor j(w). -2w3(w - 1)/7 Suppose -2s + 6s = 2s. Let n(l) be the third derivative of 0l + 0 + 0l4 + sl3 + l2 + 1/60l5. Factor n(a). a2 Let n(h) be the third derivative of -h6/180 - h5/45 + h4/36 + 2h*3/9 + 4h*2. Let n(b) = 0. Calculate b. -2, -1, 1 Let j(q) = -4q2 - q. Let l(d) be the first derivative of -d3/3 + 3. Let k(z) = -2j(z) + 10l(z). Factor k(w). -2w(w - 1) Let m(h) be the second derivative of -h*4/3 - 4h*3 - 10h*2 - 3h. Factor m(l). -4(l + 1)(l + 5) Let w(k) be the third derivative of 7k7/1080 - 7k6/540 + k5/90 + k*4/12 - 2k*2. Let l(c) be the second derivative of w(c). Factor l(q). (7q - 2)2/3 Let n(k) = -k3 + k*2 + 2k - 1. Let o(f) = f. Let z(j) = n(j) - o(j). Factor z(l). -(l - 1)*2(l + 1) Let o(s) be the second derivative of s*6/30 + 4s*5/15 + 2s*4/3 + 5s*3/6 + s. Let a(c) be the second derivative of o(c). Determine l so that a(l) = 0. -2, -2/3 Find p such that -26/7p*3 + 12/7p*4 - 2/7p*5 - 8/7p + 24/7p2 + 0 = 0. 0, 1, 2 Let z(l) be the second derivative of -l7/210 - l6/75 + l4/30 + l3/30 - 10l. Determine s, given that z(s) = 0. -1, 0, 1 Factor -5j2 - j3 - j2 - 4 + 3j*3 + 10j - 2j2. 2(j - 2)(j - 1)2 Let d be 2 + (99/(-21) - -3). Suppose -5w + 4u + 22 = -1, 4u + 8 = 0. Factor 2/7v - 2/7v*4 - dv*w + 0 + 2/7v*2. -2v(v - 1)(v + 1)2/7 Let m(f) be the first derivative of -f6/180 + f*5/90 + 2f*2 - 5. Let r(j) be the second derivative of m(j). Solve r(b) = 0 for b. 0, 1 Suppose -5l - 5p - 25 = -2l, -4l + p + 5 = 0. Factor 4/5q*2 + 0q + lq3 - 2/5q*4 - 2/5. -2(q -	{ "pile_set_name": "DM Mathematics" }
19977hq*2 wrt h? 80h*3q + 12924h2q*2 Find the second derivative of 2t*4 - 36t*3 - 5t*2 - 5t + 28498 wrt t. 24t2 - 216t - 10 Find the third derivative of -1953936s3w*2 + 237s*2w*2 - 8786s*2 wrt s. -11723616w*2 What is the derivative of -203771x - 874067 wrt x? -203771 What is the second derivative of -16chn2 + 50chn + 477ch - 445cn*2 + 24n*2 - n wrt n? -32ch - 890c + 48 Find the second derivative of -58c3 + 212c*2 + c + 2551 wrt c. -348c + 424 What is the derivative of i*2k*2l - i*2k - 104i2 + 33593k*2l - 42k2 wrt l? i2k*2 + 33593k*2 What is the third derivative of 27b*4oy - b3oy - 3b*3o - 967b2oy + boy - oy - 2o wrt b? 648boy - 6oy - 18o Find the second derivative of -36141jy3 + 4jy2 + jy + 625136y wrt y. -216846jy + 8j What is the second derivative of -3a2h*3 + 604a*2h*2p3 - a2 - 831ah*3 + 10ahp*3 - 2h*3p*3 wrt a? -6h*3 + 1208h*2p*3 - 2 Find the second derivative of 785936c*2i + 21ci - 16i - 4 wrt c. 1571872i Find the first derivative of -2486z2 - 24420 wrt z. -4972z What is the third derivative of 2a6 - 8758a*3 - 34210a*2? 240a*3 - 52548 Differentiate 184536h*3 + 68323. 553608h*2 Find the second derivative of -2509f*3j*2o + 103f3jo2 - 29f*3jo + fj*2o*2 + 3fjo*2 wrt j. -5018f*3o + 2fo*2 What is the second derivative of 83n*4 + 93n*2 + 33721n wrt n? 996n2 + 186 Find the second derivative of -65369c*2 - 120307c wrt c. -130738 Find the second derivative of -106289l3 + 919081l + 2 wrt l. -637734l Find the third derivative of 4114l*4 + 45l*3 + 94l*2 + 436l. 98736l + 270 Find the second derivative of 96f*5v*3 - 9115f*2v*3 - 2fv2 - f - 4v*3 - 1058v - 7 wrt f. 1920f3v*3 - 18230v*3 Differentiate -313i*4m - 12i2m*3 - 20i - 541m3 + 87m + 3 wrt i. -1252i3m - 24im*3 - 20 Find the second derivative of 1450m*2r*3 + 2m*2 + 7mr3 - 110mr - r2 + r wrt m. 2900r*3 + 4 Find the second derivative of 51402t*3 + 10859t wrt t. 308412t Find the first derivative of -b3o*2 + 67044b*3 - b + 185554o*3 wrt o. -2b*3o + 556662o2 What is the second derivative of 2tx4 - 9309tx3 + tx - t + 147x wrt x? 24tx2 - 55854tx What is the derivative of -463611n - 969430 wrt n? -463611 What is the second derivative of 2a3u*3 + 184a*2u*3 - 8a*2uv + 33au3v - 2au*2 - 5u*2v wrt a? 12au*3 + 368u*3 - 16uv Find the third derivative of 44b*4f + 2b4 + 28b*3 - 37b*2f - 2b + 64 wrt b. 1056bf + 48b + 168 Differentiate 33697z - 41551. 33697 Find the first derivative of 2p*3 - 2p*2 - 1074951p + 3904857. 6p2 - 4p - 1074951 What is the third derivative of 3n4 + 198518n*3r*2 + 87n*2r*2 + 4193n*2r + 2nr*2 wrt n? 72n + 1191108r2 What is the third derivative of -71431m*6 + 14m*2 + 127m - 3 wrt m? -8571720m3 Find the second derivative of -3i*5 - 15438i*4 + 191384i + 2. -60i3 - 185256i*2 What is the third derivative of -24622d*5 + 2d*4r - d*2r - 2d2 + 9d - 81r wrt d? -1477320d*2 + 48dr Find the third derivative of -1535bj2o*3 + 13bj2o*2 + 47bjo - 3bo*3 + bo*2 + 7b + 2j2o*3 - 4jo wrt o. -9210bj2 - 18b + 12j2 What is the derivative of 775809q - 2119569 wrt q? 775809 Find the second derivative of -33l5 - 324l3 - l2 - 22999l wrt l. -660l*3 - 1944l - 2 What is the third derivative of -1019004k6 + 18k*2 - 48391k wrt k? -122280480k3 What is the second derivative of 110n*4 + 2599n*2 + 41390n? 1320n2 + 5198 What is the second derivative of -r4 + 3r*3 + 356r*2 - 144823r? -12r2 + 18r + 712 Find the first derivative of -340718y2 + 748582. -681436y What is the third derivative of 3c3x*3 - 31c*3x + 5548c3 - 2c*2x*3 + 8943c*2x*2 - 53 wrt c? 18x*3 - 186x + 33288 Find the second derivative of 42dt*2 + 2dt - 5308t*2 - t + 17209 wrt t. 84d - 10616 What is the third derivative of 110887o4 + 1529o*2 + 2? 2661288o Find the second derivative of -6o4 + 65o*3 - 27o*2 - 26o + 7898. -72o2 + 390o - 54 What is the third derivative of 197h4t + h*4 + 7h*3t*3 + 33586h*2t*3 - 3ht3 wrt h? 4728ht + 24h + 42t3 Find the first derivative of 2f*3z3 + f3 - 4525f + 31814z*4 + 2 wrt z. 6f*3z*2 + 127256z*3 What is the derivative of 272256w - 149389? 272256 Find the second derivative of -29380r3 + 29353r. -176280r Find the first derivative of 5147021w + 239905 wrt w. 5147021 Differentiate -2ny*2 + 420n + 2421y2 - 3 wrt y. -4ny + 4842y Find the third derivative of -35b5 + 748b*3y + 9b2y + 19b2 - 10 wrt b. -2100b*2 + 4488y Differentiate 46144p2x*3 - 6p*2x + x*3 + 65x + 2482 with respect to p. 92288px*3 - 12px Find the second derivative of 2018339b*3 + 2607860b wrt b. 12110034b What is the second derivative of -5120c*3 + 30c*2 + 330497c wrt c? -30720c + 60 What is the third derivative of 105628d*2m*3 + 2d*2m*2 - 221d*2m + 15 wrt m? 633768d2 Differentiate -32296n + 40048. -32296 Find the third derivative of -22591np*2w*2 - np*2 - 517nw3 + 3p*2w*3 wrt w. -3102n + 18p2 Find the second derivative of 55k*5n - 235k3 + 13kn + 2014n + 1 wrt k. 1100k3n - 1410k What is the derivative of 13s*2w*4 + 4s*2 + 1441sw3 - s - 377 wrt w? 52s*2w*3 + 4323sw2 What is the third derivative of -450771a*3 + 3a*2 + 5453a - 2? -2704626 What is the first derivative of 6f2g2 + f2 + 716fg*3 - 448477 wrt g? 12f*2g + 2148fg*2 Differentiate -33698s*3 + 48778 wrt s. -101094s*2 Differentiate 491097p*2 + 149518 with respect to p. 982194p What is the third derivative of 506878r4 - 1602074r*2? 12165072r Find the third derivative of -1034622w6 - 2w*2 - 3w + 22102 wrt w. -124154640w3 Find the second derivative of 2690177z*5 - 3028940z wrt z. 53803540z3 What is the derivative of 1754386c + 434581? 1754386 Find the second derivative of 814268d2p*2 - 605dp2 + 1872dp wrt d. 1628536p*2 Find the second derivative of -8426l*2z*2 + 3l*2z + 11l2 - 4lz + 29l + 2z2 wrt z. -16852l*2 + 4 Find the third derivative of -116704i5 - i4 + 3i3 - 1893274i*2 wrt i. -7002240i*2 - 24i + 18 Find the third derivative of -1165d2p*3r*2 + 2d*2p*2r - 10188d2r + 145dp*3r*2 - 104dpr*2 wrt p. -6990d*2r*2 + 870dr2 Differentiate 27i*3 + 26627i*2 + 1920391 with respect to i. 81i*2 + 53254i Find the second derivative of 6937q2 + 67q - 189 wrt q. 13874 What is the second derivative of 2411448c4 + 1307352c wrt c? 28937376c2 What is the third derivative of -159739w*4 - 83w*2 - 34w - 7 wrt w? -3833736w What is the first derivative of -59542u + 14364 wrt u? -59542 What is the third derivative of -69b6 - 1017b*4 + 348839b*2 wrt b? -8280b*3 - 24408b What is the second derivative of -150535x5 - 863x - 7? -3010700x3 What is the third derivative of 37315b*2i6 - b2i2 + 5294b*2 - 2bi2 - i2 wrt i? 4477800b*2i*3 What is the second derivative of -377183h*2q*3 - 9hq + 4h - 35q3 + 6q*2 wrt h? -754366q*3 Find the second derivative of 6q*3 + 31412q*2 - 5587q + 1 wrt q. 36q + 62824 What is the third derivative of 110i*2r*3 + 81i*2r2 + i2r - 15ir3 + 44r*3 + 13r*2 wrt r? 660i*2 - 90i + 264 Find the third derivative of -dh5 - 194d - 14h5 + 15965h*3 + 1027h*2 wrt h. -60dh2 - 840h*2 + 95790 Find the first derivative of -16768c + 144474 wrt c. -16768 Differentiate -101750j4 + 26382 with respect to j. -407000j*3 What is the derivative of 2n*3qs + 13n*3q + 4540nqs + 2nq + 79q wrt s? 2n3q + 4540nq What is the third derivative of -5p3v*3 - 2p*3v - 199450p2v*3 + 1598887p*2v*2 + 2pv3 + 2v*2 wrt v? -30p*3 - 1196700p*2 + 12p What is the derivative of 16454g3y - 50744g3 wrt y? 16454g3 What is the third derivative of -d4x + d4 - 847d*3x	{ "pile_set_name": "DM Mathematics" }
ijjjjjjj? 1/20 Four letters picked without replacement from {v: 3, o: 7}. Give prob of sequence vovv. 1/120 Calculate prob of sequence cvv when three letters picked without replacement from cvcccvcvvc. 1/10 What is prob of sequence att when three letters picked without replacement from aataaaaataaaa? 1/78 What is prob of sequence xgu when three letters picked without replacement from ussfsgx? 1/210 Calculate prob of sequence fccq when four letters picked without replacement from {z: 6, q: 2, c: 4, f: 1, l: 2}. 1/1365 Four letters picked without replacement from yhdynynhynnkyyd. What is prob of sequence dynn? 2/455 Three letters picked without replacement from {a: 1, n: 3, b: 5, f: 3, i: 5, z: 1}. What is prob of sequence fnf? 1/272 Four letters picked without replacement from rrrrgrrrrrrre. What is prob of sequence rreg? 1/156 Three letters picked without replacement from {e: 1, l: 1, n: 1, o: 2, g: 1, y: 1}. Give prob of sequence oeg. 1/105 Calculate prob of sequence mdmm when four letters picked without replacement from dddddmmddddddddm. 1/560 Four letters picked without replacement from dbbbdabadbbbdababbd. Give prob of sequence dadb. 25/2907 Three letters picked without replacement from awgcf. Give prob of sequence wcc. 0 Calculate prob of sequence cu when two letters picked without replacement from ucccqqq. 1/14 Four letters picked without replacement from {z: 3, f: 2}. Give prob of sequence zffz. 1/10 Three letters picked without replacement from {v: 7, b: 1, g: 3, n: 4, z: 2}. What is prob of sequence nvz? 7/510 Three letters picked without replacement from bjnnjnsnntbsnsx. What is prob of sequence xjs? 1/455 Three letters picked without replacement from {y: 2, b: 6}. Give prob of sequence yyb. 1/28 Two letters picked without replacement from {v: 5, o: 4, k: 8}. What is prob of sequence vk? 5/34 Three letters picked without replacement from bygpl. What is prob of sequence gyy? 0 Four letters picked without replacement from {b: 10}. Give prob of sequence bbbb. 1 Calculate prob of sequence fhf when three letters picked without replacement from {k: 4, h: 4, m: 1, s: 3, f: 3, l: 5}. 1/285 Two letters picked without replacement from mltiptix. What is prob of sequence pl? 1/56 Two letters picked without replacement from pkorrskhokrrrhkpk. Give prob of sequence pr. 5/136 Calculate prob of sequence aa when two letters picked without replacement from {o: 2, p: 1, l: 1, a: 3}. 1/7 What is prob of sequence zz when two letters picked without replacement from {h: 1, a: 1, e: 1, z: 5, q: 3, b: 3}? 10/91 Calculate prob of sequence ixz when three letters picked without replacement from rixppiwppxiziip. 1/273 Calculate prob of sequence ii when two letters picked without replacement from ijibibiibgggbiib. 7/40 Four letters picked without replacement from plliliprlirl. What is prob of sequence plpr? 1/594 Three letters picked without replacement from {r: 3, j: 7, o: 7, c: 2, v: 1}. Give prob of sequence jjv. 7/1140 What is prob of sequence xk when two letters picked without replacement from {k: 1, s: 7, x: 3, w: 1}? 1/44 Calculate prob of sequence nvvn when four letters picked without replacement from {n: 5, v: 7}. 7/99 Two letters picked without replacement from {f: 4, b: 7}. Give prob of sequence bb. 21/55 What is prob of sequence xxs when three letters picked without replacement from ngxnggttxsxx? 1/110 Four letters picked without replacement from krkllrrrllqrq. Give prob of sequence lrlr. 2/143 Two letters picked without replacement from eezieax. What is prob of sequence ze? 1/14 What is prob of sequence nmhn when four letters picked without replacement from {w: 2, n: 4, d: 3, h: 3, k: 6, m: 1}? 1/2584 Three letters picked without replacement from wbb. Give prob of sequence bwb. 1/3 Three letters picked without replacement from ooonooldo. Give prob of sequence ndl. 1/504 Two letters picked without replacement from {i: 1, u: 2}. What is prob of sequence ui? 1/3 Two letters picked without replacement from thjhh. What is prob of sequence hj? 3/20 Two letters picked without replacement from {k: 1, x: 1, o: 1, f: 1, p: 1}. Give prob of sequence kp. 1/20 What is prob of sequence tblt when four letters picked without replacement from {b: 7, l: 8, t: 2, p: 1}? 7/4590 What is prob of sequence ss when two letters picked without replacement from dshqdhshshssdhssh? 21/136 Two letters picked without replacement from {x: 1, q: 6, f: 3, u: 3, l: 1}. What is prob of sequence xl? 1/182 Four letters picked without replacement from {o: 4, l: 4, n: 5, m: 1, g: 3, u: 1}. Give prob of sequence ggmu. 1/12240 What is prob of sequence nu when two letters picked without replacement from {u: 2, n: 3, e: 3, j: 9}? 3/136 Calculate prob of sequence nne when three letters picked without replacement from ednnenndnnnndnneenng. 22/285 Two letters picked without replacement from {p: 2, u: 6, f: 2, m: 3, z: 2}. What is prob of sequence mu? 3/35 Calculate prob of sequence hmc when three letters picked without replacement from mmmdddmdchmcmmmm. 3/560 What is prob of sequence qrlr when four letters picked without replacement from {q: 4, l: 6, r: 9}? 6/323 Three letters picked without replacement from {g: 4}. What is prob of sequence ggg? 1 Four letters picked without replacement from xcxximxix. Give prob of sequence ixxm. 5/378 What is prob of sequence vtqv when four letters picked without replacement from vvvwvtjjvvvvtvvvvvvq? 91/29070 Three letters picked without replacement from {l: 4, d: 4, j: 1, w: 3, g: 1, y: 5}. Give prob of sequence ldw. 1/102 Three letters picked without replacement from {m: 1, t: 2, l: 3, b: 2, g: 3, z: 3}. Give prob of sequence llg. 3/364 Calculate prob of sequence zhc when three letters picked without replacement from xxhxxhhxxxcxcxzx. 1/560 Two letters picked without replacement from {k: 4, p: 2, r: 1, l: 1, q: 3}. What is prob of sequence kp? 4/55 Four letters picked without replacement from {b: 2, u: 1, p: 1, o: 1, z: 2, q: 1}. Give prob of sequence buzz. 1/420 Four letters picked without replacement from mwwmemmmwwmbmwmmp. What is prob of sequence memw? 3/476 What is prob of sequence rr when two letters picked without replacement from {b: 3, r: 5, c: 1, x: 7}? 1/12 Three letters picked without replacement from {p: 1, v: 4, y: 2, s: 1}. What is prob of sequence vys? 1/42 Four letters picked without replacement from iliiiiiilkeiili. What is prob of sequence keii? 1/364 Two letters picked without replacement from {b: 1, z: 1, o: 4, c: 3, n: 4}. What is prob of sequence nb? 1/39 Calculate prob of sequence le when two letters picked without replacement from {e: 1, l: 4, n: 7, t: 2}. 2/91 Four letters picked without replacement from {o: 2, f: 2, u: 4, i: 1, q: 9, t: 2}. Give prob of sequence ftfo. 1/14535 Calculate prob of sequence bop when three letters picked without replacement from pepeobpoopbeoeepo. 5/408 Calculate prob of sequence zyyy when four letters picked without replacement from vyvyvzzvzvzzyzzzyzz. 5/1938 Calculate prob of sequence oooo when four letters picked without replacement from vvovo. 0 Four letters picked without replacement from xjjnjjnnjjn. Give prob of sequence xjjj. 1/66 Four letters picked without replacement from ldbtbdttbtbldldf. Give prob of sequence dlft. 1/910 Three letters picked without replacement from {d: 1, u: 2, g: 4, o: 1}. Give prob of sequence uud. 1/168 Three letters picked without replacement from pqozdoopopqqpp. Give prob of sequence qoz. 1/182 Two letters picked without replacement from {y: 1, x: 6, t: 3, j: 1, v: 1}. What is prob of sequence jt? 1/44 Two letters picked without replacement from {d: 4, s: 4, i: 1, l: 2, j: 7}. Give prob of sequence ss. 2/51 Three letters picked without replacement from {o: 4, y: 1, r: 1, p: 1, q: 2}. What is prob of sequence pro? 1/126 Four letters picked without replacement from {k: 4}. Give prob of sequence kkkk. 1 Three letters picked without replacement from {x: 3, m: 9}. What is prob of sequence xmm? 9/55 Calculate prob of sequence bjom when four letters picked without replacement from {m: 1, o: 9, b: 1, j: 5}. 3/2912 Two letters picked without replacement from {u: 2, e: 1, a: 3, q: 1}. What is prob of sequence qu? 1/21 What is prob of sequence gnhn when four letters picked wi	{ "pile_set_name": "DM Mathematics" }
(50). -158 Let p(j) = 9j2 - 34j - 8. Give p(7). 195 Let x(m) = -m*3 + 2m*2 - 14m - 39. Determine x(-2). 5 Let p(v) = 5v3 - 39v*2 + 30v - 18. What is p(7)? -4 Let y(w) = 14w2 + 1973w - 147. What is y(-141)? -6 Let x(q) = -q*3 - 37q*2 + 49q + 437. What is x(-38)? 19 Let r(y) = -220y2 + 1326y + 3. Give r(6). 39 Let k(c) = -165c + 1057. Give k(6). 67 Let j(b) = 2393b - 4758. Determine j(2). 28 Let h(l) = -l*2 - 18l - 45. Determine h(-7). 32 Let i(d) = -d*3 + 12d*2 - 29d - 6. Calculate i(12). -354 Let v(a) = -14a + 159. Determine v(12). -9 Let j(i) = i2 - 35i + 81. What is j(22)? -205 Let d(c) = 4c2 - 112c + 214. Give d(26). 6 Let k(t) = -t + 4. Determine k(-10). 14 Let l(o) = -84o + 754. Calculate l(9). -2 Let u(j) = 86j*2 - 8166j - 380. Calculate u(95). 0 Let l(u) = u*2 - 141u + 5027. What is l(73)? 63 Let v(i) = -i + 72. Calculate v(-7). 79 Let j(c) = -28c + 248. Calculate j(9). -4 Let x(q) = -q3 + 45q*2 + 99q - 445. Give x(47). -210 Let r(c) = 7c2 - 12c + 34. Determine r(8). 386 Let o(w) = -7w3 + 69w*2 + 17w - 23. Determine o(10). 47 Let r(b) = -b*3 + 8b*2 - 19b + 28. What is r(5)? 8 Let v(u) = 19u - 173. Give v(7). -40 Let g(f) = f2 - 82f - 14187. What is g(-85)? 8 Let j(h) = -28h3 - 12h*2 - 3h + 11. Determine j(-1). 30 Let v(c) = -5c2 - 93c - 266. Give v(-15). 4 Let x(u) = -u*3 + 5u*2 - 15. Give x(6). -51 Let y(m) = 216m - 47306. Calculate y(219). -2 Let k(j) = j*3 - 4j*2 - 102j - 286. Give k(-5). -1 Let s(n) = -489n + 1474. What is s(3)? 7 Let n(z) = z3 - 5z*2 + 2z + 48. What is n(-4)? -104 Let c(o) = o*3 + 44o*2 + 45o + 167. What is c(-43)? 81 Let v(g) = -6g3 + 1. Calculate v(1). -5 Let y(i) = i3 - 31i*2 - 50i - 530. What is y(33)? -2 Let u(n) = n*3 - 40n*2 - 159n + 1296. Give u(43). 6 Let z(v) = -v*3 + 6v*2 - 103v + 950. Calculate z(8). -2 Let y(f) = 3f + 1. Determine y(2). 7 Let n(i) = -i3 - 13i*2 - 27i - 25. What is n(-11)? 30 Let z(g) = g*2 + 118g + 468. Give z(-4). 12 Let c(i) = -3i2 - 80i - 551. What is c(-12)? -23 Let y(j) = j*3 + 10j*2 + 54j + 119. Determine y(-5). -26 Let r(a) = 106a - 1314. Calculate r(16). 382 Let y(n) = 3n*2 + 71n + 545. Calculate y(-13). 129 Let x(w) = w*3 - 36w*2 + 67w + 109. What is x(34)? 75 Let o(s) = 41s + 322. What is o(-8)? -6 Let r(b) = 5b*2 + 7b - 26. Calculate r(2). 8 Let f(s) = -s3 - s2 - 47s - 449. Give f(-7). 174 Let j(h) = -3821h - 42032. What is j(-11)? -1 Let j(x) = -745x - 1617. What is j(-2)? -127 Let w(z) = -67z + 2008. Determine w(30). -2 Let j(q) = 142q3 + q2 + 11q - 11. What is j(1)? 143 Let c(g) = 6g2 + 236g - 178. Calculate c(-40). -18 Let v(z) = 1249z - 5. Determine v(0). -5 Let z(m) = 3m*3 - 321m*2 + m - 145. What is z(107)? -38 Let g(k) = 3k*2 - 44k - 24. Determine g(16). 40 Let m(i) = -4i3 + 7i*2 + 11i - 28. Give m(6). -574 Let l(i) = 2i2 + 51i + 126. Give l(-23). 11 Let y(t) = -10t2 + 205t - 68. Give y(20). 32 Let j(c) = 12c + 44. Determine j(-5). -16 Let t(k) = -59k + 389. Give t(6). 35 Let m(y) = -13y2 + 961y + 67. What is m(74)? -7 Let f(h) = 161h - 22864. Give f(142). -2 Let v(n) = -4n*3 + 2n*2 + 20n - 3. Determine v(6). -675 Let v(r) = -13r + 454. Calculate v(36). -14 Let z(g) = 2g*2 - 6g + 28. Give z(-5). 108 Let p(u) = -22u2 + 34u + 246. Calculate p(-4). -242 Let p(w) = -48w3 - w2 - 4w + 4. Calculate p(0). 4 Let n(o) = -4o2 - 24o + 15. Calculate n(0). 15 Let m(w) = -w*3 + 3w*2 + 60w + 186. Determine m(-4). 58 Let c(d) = -16d2 - 2d. What is c(-2)? -60 Let m(r) = r*3 - 21r*2 + r - 17. What is m(21)? 4 Let l(s) = -23s*2 + 14s - 20. Determine l(2). -84 Let i(d) = d*2 + 4d - 79. Determine i(7). -2 Let c(z) = 1889z - 5672. Give c(3). -5 Let o(z) = 5z*2 + 195z + 56. Calculate o(-38). -134 Let d(v) = -3v2 - 492v + 6824. What is d(-177)? -79 Let t(z) = 24373z - 365595. Calculate t(15). 0 Let s(j) = j3 + 34j*2 - 66j - 1133. What is s(-35)? -48 Let h(s) = 2s2 + 98s - 299. Calculate h(3). 13 Let u(r) = -2r2 - 34r - 142. Give u(-10). -2 Let g(a) = -4a3 + 2a*2 + 8a - 1. Determine g(-3). 101 Let s(q) = -3q2 - 67q - 167. Calculate s(-3). 7 Let t(q) = 304q + 3639. Determine t(-12). -9 Let r(o) = 60o3 + o2 - 22o + 21. Calculate r(1). 60 Let i(u) = 35u*2 - 249u - 15. What is i(7)? -43 Let s(g) = -g*3 - 76g*2 + 16g + 1218. What is s(-76)? 2 Let o(j) = -129j - 240. Determine o(-2). 18 Let r(t) = 47t*2 + 741t - 41. What is r(-16)? 135 Let m(f) = -172f2 - 3. Give m(0). -3 Let m(s) = 226s*2 + 8s + 9. Give m(-1). 227 Let g(q) = 6q3 - 3q*2 - 6q + 7. Determine g(-3). -164 Let d(r) = r*2 + 17r - 198. What is d(-25)? 2 Let r(z) = -27z - 54. Calculate r(-9). 189 Let m(l) = l2 - 75l + 475. Give m(68). -1 Let q(z) = -z*2 + 237z - 8336. What is q(43)? 6 Let a(h) = -33h3 - 2h2 - h. Give a(-1). 32 Let b(t) = t2 + 433t + 46703. Calculate b(-203). 13 Let a(v) = v3 + 18v*2 - 23v - 93. What is a(-19)? -17 Let z(t) = -2t2 + 7t - 1. Determine z(-7). -148 Let v(x) = -8x3 - 119x*2 + 14x - 5. What is v(-15)? 10 Let p(o) = 3o2 + 146o - 150. Determine p(-51). 207 Let q(l) = -l*3 + 19l*2 - 27l + 109. Give q(18). -53 Let d(w) = 2w3 + 113w*2 - 55w + 111. Determine d(-57). -3 Let a(t) = -t*2 + 14t + 1360. Calculate a(43). 113 Let r(c) = -100c2 + 11c. Determine r(-2). -422 Let g(c) = -c*3 + 4c*2 + 34c - 84. What is g(8)? -68 Let f(d) = -d*3 + 11d*2 + 726d + 1. Determine f(-22). 1 Let m(k) = k*3 + 17k*2 + 50k - 12. Determine m(-14). -124 Let h(z) = 16z - 243. Give h(39). 381 Let j(p) = p3 - 30p*2 - 61p - 125. Determine j(32). -29 Let w(j) = 2222j + 84438. Calculate w(-38). 2 Let v(u) = -2u*2 - 29u + 222. What is v(-19)? 51 Let c(m) = -55m + 2221. Calculate c(42). -89 Let g(w) = -1177w - 2356. Determine g(-2). -2 Let n(s) = s*2 - 22s + 118. Determine n(10). -2 Let j(q) = -15q2 + 176q - 22. Determine j(11). 99 Let m(u) = -540u - 3239. Determine m(-6). 1 Let q(u) = -14u + 108. Give q(24). -228 Let s(l) = 280l + 17061. Give s(-61). -19 Let t(y) = 47y - 538. Determine t(11). -21 Let g(o) = 8o3 + 15o*2 - 18o + 2. Determine g(1). 7 Let a(k) = 3k2 - 659k + 7475. Calculate a(12). -1 Let k(s) = -10s2 + 14s - 53. What is k(5)? -233 Let l(g) = 2607g + 5194. Determine l(-2). -20 Let q(i) = 212i - 8497. Give q(40). -17 Let l(x) = 46x - 1. Determine l(-6). -277 Let n(u) = 164u + 282. Give n(2). 610 Let r(k) = k*2 + 75k + 1254. What is r(-29)? -80 Let r(v) = 2768v + 24909. What is r(-9)? -3 Let z(v) = v3 - 14v*2 - 4v + 90. Give z(14). 34 Let w(f) = 2f2 + 101f - 371. What is w(-54)? 7 Let g(q) = -q*3 + 43q*2 - 86q + 169. Determine g(41). 5 Let v(u) = 2u2 - 313u + 6684. Determine v(131). 3 Let d(c) = -3c3 + 44c*2 - 6c - 23. Calculate d(14). 285 Let j(n) = 11n2 + 24n + 65. Give j(-3). 92 Let c(n) = 68n2 + 1159n + 35. What is c(-17)? -16 Let d(a) = 2a2 - 24a - 25. Calculate d(13). 1 Let b(a) = 495a + 3465. Calculate b(-7). 0 Let r(o) = 11o + 1066. Calculate r(-97). -1 Let r(d) = d*3 + 73d*2 + 110d - 2245. Calculate r(-71). 27 Let f(r) = 33r - 1343. What is f(41)? 10 Let c(f) = 4f*2 - 75f + 112. What is c(17)? -7 Let n(f) = -2f2 - 208f + 6762. What is n(-130)? 2 Let b(c) = 2c2 + 12c - 3. What is b(-2)? -19 Let t(f) = -f*2 - 32f - 233. Determine t(-8). -41 Let n(x) = -x*3 - 18x*2 + 36x + 155. Determine n(-19). -168 Let b(v) = -v*2 + 644v - 3842. Determine b(6). -14 Let o(x) = -29x - 337. What is o(-11)? -18 Let r(a) = -a3 + 17a*2 - 5a + 20. Determine r(17). -65 Let c(l) = -l*2 - 30l - 234. Give c(-18). -18 Let m(b) = -42b - 559. Determine m(-13). -13 Let w(v) = -v3 - 18v*2 + 231v - 28. Determine w(8). 156 Let m(j) = -2j2 + 31j - 23. Determine m(5). 82 Let t(k) = -37k + 820. Give t(23). -31 Let b(t) = -t2 + 44t - 74. What is b(42)? 10 Let m(q) = 615q + 3072. What is m(-5)? -3 Let n(p) = 3p*3 - 8p*2 - 11p + 66. What is n(-6)? -804 Let h(k) = -k*3 - 26k*2 - 25k - 39. Calculate h(-25). -39 Let q(a) = -2a3 + 16a*2 + 173a - 1396. Give q(8). -12 Let d(v) = -5v	{ "pile_set_name": "DM Mathematics" }
-11o + 90 = 46 for o. 4 Solve 0 = h - 77h for h. 0 Solve 82c + 93c - 1575 = 0 for c. 9 Solve 72 - 73 = -n for n. 1 Solve 402x - 76 = 383x for x. 4 Solve -61 + 73 = -3w for w. -4 Solve 8f - 27 = -f for f. 3 Solve 117j - 115j + 2 = 0 for j. -1 Solve 98r - 97r = -2 for r. -2 Solve p - 22 = -21 for p. 1 Solve -j + 15j = -14 for j. -1 Solve -4c - 5 = 11 for c. -4 Solve 322h + 21 = 329h for h. 3 Solve -15c - 38 = 22 for c. -4 Solve 13f + 21f - 68 = 0 for f. 2 Solve 0 = 16f - 25f + 36 for f. 4 Solve -55 = -15h - 10 for h. 3 Solve 152r - 144r = -32 for r. -4 Solve -2c + 15 = -7c for c. -3 Solve 0 = 22f - 26f + 4 for f. 1 Solve 6a = 7 - 25 for a. -3 Solve -968 - 392 = 136v for v. -10 Solve -15 = -11v + 18 for v. 3 Solve -42 = -31n - 11 for n. 1 Solve 111 = -4t + 139 for t. 7 Solve 25v - 9 = 41 for v. 2 Solve -49y + 42y - 21 = 0 for y. -3 Solve -25o + 12 = -28o for o. -4 Solve 11t - 15t - 20 = 0 for t. -5 Solve 0 = -60h + 61h for h. 0 Solve -6o + 27 = 9 for o. 3 Solve 11 = 2d + 5 for d. 3 Solve -5b = -20b - 45 for b. -3 Solve 2l - 24 = -32 for l. -4 Solve 10b + 38 = -12 for b. -5 Solve 3y = -63 + 48 for y. -5 Solve p - 9p = -16 for p. 2 Solve 0 = s - 27 + 31 for s. -4 Solve -42 = -12x + 18 for x. 5 Solve 3519l = 3520l + 1 for l. -1 Solve -43y + 40 = -51y for y. -5 Solve -1526z + 1523z = 15 for z. -5 Solve 32d = -64d - 480 for d. -5 Solve 6t + 1 = -47 for t. -8 Solve 8 = 4q + 28 for q. -5 Solve 16 = -r - 7r for r. -2 Solve 2q - 3q = 0 for q. 0 Solve 418t + 16 = 414t for t. -4 Solve 5n = 46 - 41 for n. 1 Solve -21 = 19s - 12s for s. -3 Solve -7s + 6s + 3 = 0 for s. 3 Solve 11 = -8u - 29 for u. -5 Solve 0 = 14h + 2h for h. 0 Solve -36b + 18 = -18b for b. 1 Solve 0 = -6q + 69 - 87 for q. -3 Solve 11 = 2w + 19 for w. -4 Solve 0j - 5j + 10 = 0 for j. 2 Solve 96 = -26u - 6u for u. -3 Solve -30k = -28k for k. 0 Solve 18z = 7z + 7z for z. 0 Solve -9x - 204 = 42x for x. -4 Solve -3 + 23 = -4d for d. -5 Solve 13q = 27q for q. 0 Solve -3a = -85 + 91 for a. -2 Solve -25 + 9 = 4m for m. -4 Solve 43 - 49 = -2i for i. 3 Solve 11m = -160 + 116 for m. -4 Solve -91 = 66z + 173 for z. -4 Solve -83 = -32s - 307 for s. -7 Solve -73z = -64z + 27 for z. -3 Solve 3 = 5t + 18 for t. -3 Solve 181x - 96 = 165x for x. 6 Solve 2 = 5t - 3 for t. 1 Solve 0 = v + 41 - 36 for v. -5 Solve 24 = -j + 19 for j. -5 Solve -12r + 11r = -1 for r. 1 Solve 23 = 5b + 3 for b. 4 Solve 0 = -18c + 120 - 66 for c. 3 Solve -32o + 53o = 84 for o. 4 Solve 2640 = 5j + 2630 for j. 2 Solve 50a - 45a = -20 for a. -4 Solve 16 = -35i - 159 for i. -5 Solve -9m - 7 - 11 = 0 for m. -2 Solve -3k + 6k + 4k = 0 for k. 0 Solve 0 = -24j + 21j + 15 for j. 5 Solve -15 = -26c - 171 for c. -6 Solve -5g + 26 = -18g for g. -2 Solve 41 = 6f + 11 for f. 5 Solve 0 = 5a - 41 + 36 for a. 1 Solve 0 = 6b - 1011 + 993 for b. 3 Solve 5b - 21 = 4 for b. 5 Solve 124w - 132w - 16 = 0 for w. -2 Solve 39z + 37 = -41 for z. -2 Solve -48 - 30 = 13j for j. -6 Solve 0 = -15k + 11 + 64 for k. 5 Solve -109 = -38v + 157 for v. 7 Solve -179t + 70 = -169t for t. 7 Solve 10 + 26 = -9q for q. -4 Solve -27m = -22m + 5 for m. -1 Solve 154c - 156c + 8 = 0 for c. 4 Solve 1 = p - 0p for p. 1 Solve -11 = -7z + 24 for z. 5 Solve 0 = -12m + 1639 - 1567 for m. 6 Solve 4b - 8 = -0 for b. 2 Solve 0 = -2711k + 2700k - 22 for k. -2 Solve -10 = 28c - 23c for c. -2 Solve 6o - 14 = 4 for o. 3 Solve -11h - 60 = 4h for h. -4 Solve -710w + 718w - 48 = 0 for w. 6 Solve 28 = -15n - 2 for n. -2 Solve -25i = -34i - 18 for i. -2 Solve -11l - 3l = -70 for l. 5 Solve -7 = -9v + 11 for v. 2 Solve 7g - 21g = 0 for g. 0 Solve -168u + 3 = -167u for u. 3 Solve 21h + 116 = -8h for h. -4 Solve 232 = -16b - 42b for b. -4 Solve -131 + 16 = -23s for s. 5 Solve 0 = 55j - 66 - 99 for j. 3 Solve -24l + 68 = 164 for l. -4 Solve 126 - 266 = 20a for a. -7 Solve 3q + 6 = 15 for q. 3 Solve 0q + 4 = -q for q. -4 Solve 50v - 20v + 23v = 0 for v. 0 Solve -80q = -14 - 386 for q. 5 Solve -6w + 15 + 21 = 0 for w. 6 Solve 78x = 82x + 20 for x. -5 Solve 668 - 674 = 6t for t. -1 Solve -8p + 188 = -55p for p. -4 Solve -6n = 20 + 10 for n. -5 Solve 242r - 261r = -38 for r. 2 Solve 10m + 21m + 186 = 0 for m. -6 Solve -4i = -0i + i for i. 0 Solve 174n = 159n + 30 for n. 2 Solve 76m = 74m - 4 for m. -2 Solve 41l - 44 = 30l for l. 4 Solve -4r + 174 - 162 = 0 for r. 3 Solve 7d - 2d = -5 for d. -1 Solve 291u = 269u - 88 for u. -4 Solve 0 = -6c + 171 - 201 for c. -5 Solve 13b - 9b - 16 = 0 for b. 4 Solve -14q + 14 = -7q for q. 2 Solve r - 7r = 0 for r. 0 Solve 0 = -4t + 8t + 8 for t. -2 Solve 0 = -8f + 36 - 60 for f. -3 Solve -15 = -26d - 41 for d. -1 Solve 1067 = -14u + 1207 for u. 10 Solve 2s - 16 = -26 for s. -5 Solve 170 = -11s - 23s for s. -5 Solve 11n = n + 10 for n. 1 Solve -47l + 35l + 60 = 0 for l. 5 Solve -1541n = -1538n + 18 for n. -6 Solve -4s = 5s - 27 for s. 3 Solve -7 = -0j - 7j for j. 1 Solve -48 + 54 = 3a for a. 2 Solve 0 = -8o + 49o + 246 for o. -6 Solve 2f = -6 - 2 for f. -4 Solve 2w - 157 + 153 = 0 for w. 2 Solve 19s + 4s + 138 = 0 for s. -6 Solve -6a + 24 = -0 for a. 4 Solve 0 = 90p - 100p - 90 for p. -9 Solve 0 = -0h - 7h - 14 for h. -2 Solve -74u + 105 = -59u for u. 7 Solve 0 = 1294o - 1281o - 13 for o. 1 Solve 14 = 2r + 20 for r. -3 Solve -20c - 6c - 104 = 0 for c. -4 Solve -13h - 8h = -168 for h. 8 Solve -8 + 13 = 5b for b. 1 Solve -2d - 17 = -13 for d. -2 Solve 14f = 285 - 187 for f. 7 Solve 33r - 52 = -19 for r. 1 Solve 0 = -4a - 30 + 22 for a. -2 Solve 16l = 106 - 58 for l. 3 Solve -54j + 42 = -228 for j. 5 Solve 19d - 31d - 60 = 0 for d. -5 Solve 0 = -32o - 12o - 176 for o. -4 Solve -234 = -2w - 248 for w. -7 Solve -7l + 3l = 4 for l. -1 Solve -272 = 64q + 112 for q. -6 Solve 153 = -735l + 752l for l. 9 Solve 20 = -13c + 9c for c. -5 Solve 92g - 28 = 78g for g. 2 Solve 11x - 28 - 5 = 0 for x. 3 Solve 0n - n = 5 for n. -5 Solve 5w - 20w = 60 for w. -4 Solve 126z + 306 = 75z for z. -6 Solve 593g - 621g - 28 = 0 for g. -1 Solve 3m + 38 - 41 = 0 for m. 1 Solve -5f + 105 = 110 for f. -1 Solve -14f + 1 = -13f for f. 1 Solve -15 = -0c + 3c for c. -5 Solve -2o - 29 = -25 for o. -2 Solve -17x + 148 = 20x for x. 4 Solve -9d + 1200 = 1236 for d. -4 Solve -9o + 8 = -o for o. 1 Solve 19x - 92 = 42x for x. -4 Solve 8k - 18 - 6 = 0 for k. 3 Solve -1009 = -17j - 1043 for j. -2 Solve 383y + 3 = 386y for y. 1 Solve 9z - 3z - 6 = 0 for z. 1 Solve -20 = 5h - 15 for h. -1 Solve 2a + 55 - 65 = 0 for a. 5 Solve 32l - 29 + 125 = 0 for l. -3 Solve 42c - 89 = -509 for c. -10 Solve 0b - 4b = -4 for b. 1 Solve -120 = 30j - 180 for j. 2 Solve -123c + 125c - 2 = 0 for c. 1 Solve 0 = -57q + 58q - 1 for q. 1 Solve 4k + 9 = -7 for k. -4 Solve -2o + 20 = -12o for o. -2 Solve 19u - 27u - 16 = 0 for u. -2 Solve 0 = 16c - 11c - 40 for c. 8 Solve -11s - 30 = 25 for s. -5 Solve 115 = -2i + 25i for i. 5 Solve 10 = 7i - 25 for i. 5 Solve -74l - 15 = -79l for l. 3 Solve 4 - 52 = 6z for z. -8 Solve 0 = -29i + 3i + 52 for i. 2 Solve -11h = -12h - 2 for h. -2 Solve 53l - 107 = 52 for l. 3 Solve 245 = -80h + 5 for h. -3 Solve 35m + 3 = 38m for m. 1 Solve 72y - 18 = -306 for y. -4 Solve 16i - 22i = -12 for i. 2 Solve 143f + 14 = 157f for f. 1 Solve 121u = 125u - 12 for u. 3 Solve 9u - 8u - 1 = 0 for u. 1 Solve 4 = f + 5 for f. -1 Solve -9u + 15 - 42 = 0 for u. -3 Solve -65a + 10 = -60a for a. 2 Solve 15 = 21c + 36 for c. -1 Solve 0 = -22q + 58q + 144 for q. -4 Solve 0 = -9g + 43 - 61 for g. -2 Solve -44 = 49k - 60k for k. 4 Solve 17x + 12 = 20x for x. 4 Solve 5p - 10 + 10 = 0 for p. 0 Solve 0 = -12m - 26 - 22 for m. -4 Solve 150 = -3d + 144 for d. -2 Solve -6n - 80 = -110 for n. 5 Solve 382r - 372r - 80 = 0 for r. 8 Solve -7f + 88 = -29f for f. -4 Solve 323m = 328m for m. 0 Solve 0 = -811q + 810q + 6 for q. 6 Solve -93 = 2d - 89 for d. -2 Solve 156c - 140c = 0 for c. 0 Solve -13f = -25 - 14 for f. 3 Solve 4o = 11o - 21 for o. 3 Solve 8*i + 17 = 1 for i. -2 Solve -	{ "pile_set_name": "DM Mathematics" }
ate (-6)/(-8)137/(-111). -1/4 (-6)/(-9)5(-12)/200 -1/5 Calculate (20(-1)/(-475))/(2/5). 2/19 What is ((-38)/(-456))/((-1)/(-4))? 1/3 Calculate (1/8)/((-1)/(-4)). 1/2 Calculate ((-8)/36)/((-8)/18). 1/2 What is (-50)/(-15)27/315? 2/7 What is the value of 2/4(-10)/(-25)? 1/5 Calculate -1(9/(-1))/(-3). -3 Evaluate (9/20)/((1122/(-85))/22). -3/4 1715/2551-3 -3 (14/42)/(2/(-30)) -5 Calculate ((-2)/(-78))/((-6)/(-36)). 2/13 Evaluate 3/((63/(-9))/(-14)). 6 Evaluate ((-19)/152)/(1/(-8)). 1 Calculate ((-4)/1)/(-56)(-8)/6. -2/21 What is the value of 176/(-66)(-6)/(-4)? -4 What is (-10)/2(-24)/40? 3 What is the value of 1(13/(-104))/(1/(-4))? 1/2 Evaluate (-1)/((-12)/(-8)-2). 1/3 Calculate (1/(20/16))/(3/5). 4/3 Evaluate ((-115)/(-30))/2318/4. 3/4 (2/4)/((-7)/(-14)) 1 What is (-28)/(-21)(6/4)/(-1)? -2 -31/(-2)4020/(-1206) -5 1/(-2)36/(-81) 2/9 Calculate (8/((-48)/(-18)))/(-3). -1 What is (-2)/(-104/(-100))? -5 Evaluate (14/2)/(((-27)/9)/3). -7 Evaluate 4/(-112)(-24)/3. 2/7 What is the value of (-13)/(-78)(-8)/(-60)5? 1/9 What is the value of (8/252)/(4/6)2? 2/21 Evaluate (18/27)/((4/(-9))/2). -3 Evaluate 14/((-308)/(-33))2/(-1). -3 4(-15)/404/3 -2 Calculate (-1)/(-1)(-2)/23. -3 What is the value of (-2)/123(-18)/12? 3/4 Calculate 66/(-24)3/27. -1/6 Evaluate (-2)/(-12)4(-1)/1. -2/3 32(-3)/18 -1 Calculate -1(-4)/(-10)16/8. -4/5 What is the value of (12/75)/(((-12)/(-10))/3)? 2/5 (1/(6/4))/((-133)/57) -2/7 Calculate (9/6)/(18/15). 5/4 Evaluate (3/24-4)/(3/8). -4/3 Calculate -3(24/(-54))/((-2)/(-6)). 4 (-130)/845(-13)/(-1) -2 (6/7)/(8/28) 3 Calculate 3/4210/(-25)-10. 2/7 Calculate ((-6)/5)/((-102)/340). 4 Calculate ((-3)/(45/(-6)))/((-3)/5). -2/3 Calculate (-3)/(-7)4/(-4). -3/7 (-32)/(-30)5(-12)/80 -4/5 What is the value of ((0/(-1))/6)/4? 0 Evaluate (12/32)/(((-9)/6)/(-1)). 1/4 What is the value of 48/90(-3)/12? -2/15 What is the value of (-8)/(-10)(-50)/(-120)? 1/3 6/(((-60)/8)/(-1)) 4/5 What is the value of (-59)/59(-3)/3? 1 Evaluate (-16)/40-5(-1)/2. -1 ((-8)/28)/((-31)/651) 6 ((-1)/6)/(25/(-50)) 1/3 (95/(-57))/(75/(-6)) 2/7 What is the value of (-88)/(-33)(-27)/90? -4/5 What is the value of ((-12)/(-32)2)/(63/24)? 2/7 What is (8/70)/((-102)/(-357))? 2/5 Evaluate (-2)/(-3)(-11)/((-66)/(-9)). -1 What is the value of 255/(-68)2/10? -3/4 Calculate (3(-4)/8)/(-6)4. 1 (6/(-9))/((-2)/(18/(-15))) -2/5 What is the value of -224/(-16)? 1 What is ((-16)/(-4))/(-28)-1? 1/7 (-6)/1(-8)/96 1/2 What is (-12)/(-3)(-4)/(-116)? 1 Evaluate ((-50)/(-4))/((-15)/12). -10 What is the value of (-1)/((-18)/120)6/5? 8 What is ((-9)/18)/((-8)/128)? 8 (48/32)/(2/(-4)) -3 What is the value of (-40)/567(-2)/(-75)? -2/15 Calculate 469/(-67)((-3)/3)/(-1). -7 What is ((-2)/18)/(3(-4)/72)? 2/3 Calculate -13/10(-30)/36. 1/4 1/((-3)/(-9)-9) -1/3 (3(-6)/(-216)6)/1 1/2 What is ((-18)/12(-4)/30)/(-1)? -1/5 What is the value of 2/(5(-15)/150)? -4 Evaluate (4/((-12)/(-3)))/(2/6). 3 What is ((-1)/16)/(3(-6)/108)? 3/8 What is (-1)/(-1)(-5)/(-15)? 1/3 What is (-65/(75/20))/2? -4 4/(14((-4)/(-2))/2) 2/7 Evaluate -84/1442. -4/9 What is ((-32)/112)/(1/7)? -2 Calculate ((-1)/(-4))/((-2)/(-3)3). 1/8 What is (-4(-2)/40)/((-1)/(-3))? 3/5 What is the value of 0/(2(-1)/1)? 0 What is -33/338/(-12)? 2/11 Evaluate 3/((63/(-28))/(-3)). 4 Evaluate 415/80(-8)/(-6). 1 Calculate 1/((25/(-20))/(-1)). 4/5 288/(-54)(-18)/16 6 What is the value of 112/(-8)0? 0 What is the value of 42/73/(-9)? -2 What is (-7)/105(-20)/(-12)2? -2/9 Evaluate (4/(132/9))/(6/(-4)). -2/11 Evaluate ((-14)/(-7))/((2/(-1))/(-2)). 2 What is the value of (-3)/(270/8)(-45)/18? 2/9 What is 39/(-286)-33(-8)/6? -6 (8/24)/(3/(-18)) -2 What is the value of 15/((-135)/14)(-14)/(-49)? -4/9 What is the value of (10/(-10))/(-51/(-30))? -6 What is ((-14)/98)/((-39)/26)? 2/21 Evaluate 4/(-2)(-8)/(-2)1. -8 What is the value of 4/99-3(-3)/2? 2/11 Evaluate (-8)/(-2)22/28. 4/7 What is (2/4-2)/(22/198)? -9 What is (-5)/6-63/(-3)? -5 Calculate 56/45-9. -6 Evaluate ((-60)/240)/(2/8). -1 (-4)/(-6)180/40 3 What is the value of -3((-2)/3)/(4/(-6))? -3 What is the value of (204/(-102))/((-2)/3)? 3 ((-59)/708)/(((-1)/(-4))/1) -1/3 What is 24/2015/(-6)? -3 ((-77)/22)/((-35)/60) 6 What is the value of 1/(((-21)/(-3))/7)? 1 Calculate 3/(-12)(-20)/15. 1/3 What is the value of 1/(-4)(-48)/(-96)? -1/8 Calculate -21/21. -1 Evaluate ((0/3)/(-4))/4. 0 What is 12((-54)/(-24))/9? 1/2 (3/2)/3190/19 5 1-185/17 -5 Evaluate (450/20)/312/(-15). -6 (3/(-6))/((-33)/(-22)) -1/3 What is (1/(-2))/(3/24)? -4 (9/((-36)/(-8)))/(63/7) 2/9 What is the value of ((-24)/(-15))/((-2)/10-2)? 4 Calculate (80/(-48))/(6/18). -5 Calculate (-8)/6(-13)/(-1820)-7. 1/15 ((-3)/(-16))/((-159)/(-424)) 1/2 Calculate -5(-3)/(15/5). 5 What is the value of (156/104)/(3/2)? 1 What is the value of -71(-8)/140010? 2/5 Evaluate (4/(-18))/(((-32)/(-12))/(-2)). 1/6 What is the value of (16/20)/(22/5)? 2/11 What is the value of 764/420? 2/5 What is the value of 108/216(-1)/((-10)/(-4))? -1/5 What is (11/165-9)/(6/(-4))? 2/5 What is the value of (10/504)/(1/(-5))? -4 Calculate (-3)/((-18)/(-3))1. -1/2 What is (-3)/(-1)(-2)/(-24)4? 1 What is the value of ((-2)/(-2))/(-1)0/(-31)? 0 What is the value of (8/24)/((9/(-3))/9)? -1 ((-9)/(-15))/((-3)/2)5 -2 What is 3/((-1)/(-2)(-4)/2)? -3 Calculate (14/(-7))/((-16)/(-4)). -1/2 Calculate (15/(-15))/(5/9). -3/5 (-12)/70(-210)/(-84) -3/7 (-1)/(((-132)/2)/6) 1/11 What is the value of 2/(10/(35/(-7)))? -1 Calculate ((-15)/(-4))/(276/368). 5 What is -21/(27/(-3))? 2/9 (((-1)/(-6))/(9/12))/1 2/9 Evaluate (7/(-7))/(4/12). -3 What is (48/(-28))/(-4)10/30? 1/7 What is the value of 2/(-1(-2)/4)? 4 Evaluate (-10)/15-15(-15)/(-25). 6 What is ((-4)/((-12)/6))/(-1)? -2 ((-4)/(-10))/(35/(-175)) -2 What is ((-1)/(-46))/((48/16)/(-12))? -2/23 Evaluate (1/2)/((-8)/16). -1 Calculate 3(-2)/244. -1 Evaluate (-15)/6(-2)/20. 1/4 Calculate (2/8)/((-243)/(-108)). 1/9 ((-1)/(-2))/((-2)/(-4)) 1 Calculate 6/(810/9)-2. -2/15 What is (264/484)/((-10)/(-22))? 6/5 What is the value of (09/(-81))/(-4)? 0 What is (-77)/6166/3? -1/4 What is ((-6)/(-9))/((16/(-9))/(-8))? 3 Evaluate (44/22)/(26). 1/6 Calculate 8/(-70)(-160)/(-64). -2/7 What is 20/(-6)(-21)/(-14)? -5 (6/20)/((-48)/(-40)) 1/4 (-10)/58/(-12)3 4 Calculate -2110/20. -1 Evaluate (-30)/(-105)(-1)/2. -1/7 (2/9)/((-5)/(90/(-4))) 1 Calculate (1/2)/((-1)/(24/(-4))). 3 Evaluate (-2)/(-5)(-80)/(-16). 2 Calculate (24/28)/((-9)/(-63)). 6 ((-1)/((-10)/(-18)))/(102/340) -6 4/((-3)/155) -4 Calculate (8/4)/(5/1). 2/5 ((-3)/6)/(3/(-288)-8) -6 (12/3)/12162/9 6 Evaluate ((-2)/6)/((-33)/(-495)). -5 (((-20)/(-550))/(-1))/(1/(-5)) 2/11 (0/(-3))/((-108)/36) 0 Calculate (41/((-4920)/(-225)))/(6/8). 5/2 What is the value of (-1)/(1(-4)/(-20))? -5 ((224/(-60))/(-14))/(-2) -2/15 Evaluate (4/(8/4))/(-14). -1/7 What is -2((-21)/70)/((-6)/(-5))? 1/2 Calculate 1((-5)/15)/((-18)/(-27)). -1/2 What is the value of 4(-4)/(-16)(-1)/(-3)? 1/3 Calculate ((-590)/(-177))/(1/(3/2)). 5 (-23)/(690/36)15/(-6) 3 Calculate 45/((-6)/((-30)/25)). 9 What is the value of (-27)/(-3)(40/12)/5? 6 What is the value of (-20)/4(2/(-5))/(-1)? -2 What is the value of ((-11)/(-44))/(39/(-24))? -2/13 What is (34/(-612))/((-2)/(-30))? -5/6 Calculate 6/108943. 6 What is (-6)/72-2815/(-5)? -7 Evaluate (-8)/840-257. 5/3 What is 0/3((-3)/(-6))/(-1)? 0 23/3-2 -4 What is (0/2)/(12/4)? 0 Evaluate 0/(2((-9)/6)/(-3)). 0 What is the value of ((-21)/(-98))/((-4)/((-32)/(-6)))? -2/7 ((-6)/5)/((-8)/((-280)/(-7))) 6 What is the value of ((-6)/(-5))/(42/(-30))? -6/7 Calculate ((-264)/(-924))/(3/(-7)). -2/3 What is 9/(-162)-91? 1/2 Calculate 80/(-12)36/48. -5 2(14/(-2))/(-7) 2 Evaluate ((5/4)/5)/((-9)/(-6)). 1/6 Evaluate 93/(-217)-1(-3)/(-3). 3/7 ((-4)/6)/(133/(-57)) 2/7 What is ((-360)/(-160))/(3/8)? 6 What is 2/(-4)(-18)/(-21)? -3/7 What is 20/2(-10)/(-20)? 5 What is the value of (1(-4)/12)/(168/48)? -2/21 Calculate (9/27)/((-1)/(-9)). 3 Evaluate (-1368)/(-1026)3/(-10). -2/5 What is 105/63(-6)/(-5)? 2 Calculate (-4)/3(-1)/((-7)/42). -8 Evaluate (10/(-25))/(((-16)/(-180))/1). -9/2 Calculate (-7)/(-7)*(12/6)/(-2). -1 What is -	{ "pile_set_name": "DM Mathematics" }
scending order. 5, -23, -34596 Sort -4, 0, -16026 in decreasing order. 0, -4, -16026 Put -0.59622, -0.7, 5 in increasing order. -0.7, -0.59622, 5 Sort 9.17, -3/14, 1. -3/14, 1, 9.17 Put -4, -1, 198, -97 in decreasing order. 198, -1, -4, -97 Sort -1/4, -1, 10, -7, -0.181 in increasing order. -7, -1, -1/4, -0.181, 10 Sort -1, 4927, -2, -5 in descending order. 4927, -1, -2, -5 Sort 110, 103, 2, -4, -3, -1 in descending order. 110, 103, 2, -1, -3, -4 Put 1/4, 41, -1/3, -129 in increasing order. -129, -1/3, 1/4, 41 Sort 3/7, 3, 0.269 in descending order. 3, 3/7, 0.269 Sort 0, 157689, -1. -1, 0, 157689 Sort 1, 0, 0.02855 in decreasing order. 1, 0.02855, 0 Sort 82, -3/2, -1, 1/3, -1/6. -3/2, -1, -1/6, 1/3, 82 Sort 0.1, -0.4, -5, 169, -1/3, 0.3. -5, -0.4, -1/3, 0.1, 0.3, 169 Sort -9, 50, 14 in decreasing order. 50, 14, -9 Put -17, -4, 0, 1/8, 11/3 in descending order. 11/3, 1/8, 0, -4, -17 Sort -23, 3, 4, -92, 9 in descending order. 9, 4, 3, -23, -92 Sort 0, -5, -10, -4, 199 in ascending order. -10, -5, -4, 0, 199 Put -4, 85, 11, 10 in increasing order. -4, 10, 11, 85 Sort 2, -2, -9/2, 111, -0.4, -6 in decreasing order. 111, 2, -0.4, -2, -9/2, -6 Put -28, 5, 1, -4 in decreasing order. 5, 1, -4, -28 Put -0.3, -5, -1/2567, 2/5 in decreasing order. 2/5, -1/2567, -0.3, -5 Sort -1/2, -7, -4, 2/11, 0 in increasing order. -7, -4, -1/2, 0, 2/11 Sort -0.01, -26, -5, 0.2, -2/13 in ascending order. -26, -5, -2/13, -0.01, 0.2 Sort -285, -3, -11 in descending order. -3, -11, -285 Sort 1, -2, 0.66, 8, 0 in decreasing order. 8, 1, 0.66, 0, -2 Put -5.5, -4, 0.2, -2/7 in descending order. 0.2, -2/7, -4, -5.5 Put 31, -292, 4, 0 in decreasing order. 31, 4, 0, -292 Put -4, 1, 2, -2, -181, -1 in ascending order. -181, -4, -2, -1, 1, 2 Put 5, -11, 1972 in decreasing order. 1972, 5, -11 Sort -0.3, -14, 0.2, -981 in descending order. 0.2, -0.3, -14, -981 Put -29.4, -5, -1.1, -10 in decreasing order. -1.1, -5, -10, -29.4 Sort -2, 5/2, -186, -150/7 in descending order. 5/2, -2, -150/7, -186 Sort 5, 0, -6, -234, 4. -234, -6, 0, 4, 5 Sort -30.6, -2, 8, -1/4, 0.02, 0.3 in descending order. 8, 0.3, 0.02, -1/4, -2, -30.6 Put 1, 0, 59/53 in decreasing order. 59/53, 1, 0 Sort 14, -13, 5, 1, 3 in increasing order. -13, 1, 3, 5, 14 Sort 0.4, 0, -2, 0.240637. -2, 0, 0.240637, 0.4 Sort -1015, -3, -2, 0, -11 in ascending order. -1015, -11, -3, -2, 0 Put 7, -3/8, -1, -0.04, -11, 4 in descending order. 7, 4, -0.04, -3/8, -1, -11 Sort 4, 1.8, 5, -13 in descending order. 5, 4, 1.8, -13 Put 5, 2/5, -0.3, -0.025, 0.2 in decreasing order. 5, 2/5, 0.2, -0.025, -0.3 Sort -1, 18, 3073 in ascending order. -1, 18, 3073 Put -2, 0.5, -3443 in decreasing order. 0.5, -2, -3443 Sort 0, -6, -2, 4, -24 in decreasing order. 4, 0, -2, -6, -24 Put -4, -30836, -9 in ascending order. -30836, -9, -4 Sort -444, 0, 1, -3, -4, 11 in descending order. 11, 1, 0, -3, -4, -444 Sort -292, -5, 5/2, 1/5 in descending order. 5/2, 1/5, -5, -292 Put 21, 0.01, -6252/13 in descending order. 21, 0.01, -6252/13 Sort 0.3, -22, -420, 1 in increasing order. -420, -22, 0.3, 1 Put -1, 0.242, -16 in decreasing order. 0.242, -1, -16 Put -9, 0.4, 180, -2 in decreasing order. 180, 0.4, -2, -9 Put -4, -1.885, -4/3 in decreasing order. -4/3, -1.885, -4 Sort 8, -4, 4, 5, 0, -1229 in ascending order. -1229, -4, 0, 4, 5, 8 Put -0.2, 928, 0.3, 1, -2 in ascending order. -2, -0.2, 0.3, 1, 928 Put 0.3, 50/9, -18, -3/2 in descending order. 50/9, 0.3, -3/2, -18 Sort 0, 1, -0.834477 in descending order. 1, 0, -0.834477 Put -2/7, 3/506, 0.1, 3, -1, -3 in decreasing order. 3, 0.1, 3/506, -2/7, -1, -3 Sort 4, 2.3, 172, -0.146 in ascending order. -0.146, 2.3, 4, 172 Sort 0.4, -0.1, 535 in descending order. 535, 0.4, -0.1 Put 2039, 4, 3 in increasing order. 3, 4, 2039 Sort -2/5, 2/7, 784.54 in decreasing order. 784.54, 2/7, -2/5 Sort 2, -8, -5, -20 in decreasing order. 2, -5, -8, -20 Sort 0.02, 1316, -8 in decreasing order. 1316, 0.02, -8 Sort 5, 15180, -3. -3, 5, 15180 Put 1, 2, 12, 13, 154 in decreasing order. 154, 13, 12, 2, 1 Sort 6, -1, 0.1, 0.4, 174, 2. -1, 0.1, 0.4, 2, 6, 174 Sort 4.5, 0.02, -2.8, -2, -0.4. -2.8, -2, -0.4, 0.02, 4.5 Put 3, -1, 6723 in descending order. 6723, 3, -1 Put -62/5, -15/421, 0.3 in increasing order. -62/5, -15/421, 0.3 Put 0, -1/5, 3, -1.8393, 6/11 in ascending order. -1.8393, -1/5, 0, 6/11, 3 Sort 36, -6, 1, 54, -3. -6, -3, 1, 36, 54 Put 6, 56, 3, 0 in descending order. 56, 6, 3, 0 Sort -5, 5, 2, 1, 0, -1005 in ascending order. -1005, -5, 0, 1, 2, 5 Sort -3/2, 21413, -2 in ascending order. -2, -3/2, 21413 Sort -498, 20, 4, -5 in decreasing order. 20, 4, -5, -498 Put -7, -5, -4, 14 in descending order. 14, -4, -5, -7 Put 0.3, -1, 3, -106, 3/2 in ascending order. -106, -1, 0.3, 3/2, 3 Sort -1/6, 0.4, -3/5, 2/7 in decreasing order. 0.4, 2/7, -1/6, -3/5 Put -4, 331, 0.5, -5, -0.1, 1/7 in descending order. 331, 0.5, 1/7, -0.1, -4, -5 Sort -2/13, -10, 6.8, 1/3. -10, -2/13, 1/3, 6.8 Sort 16, 69, -3. -3, 16, 69 Sort 5, 1670, 3, -2, 7. -2, 3, 5, 7, 1670 Sort 1/13, -1, 0, 0.2, 45 in decreasing order. 45, 0.2, 1/13, 0, -1 Sort -5, 4, -4, -1723558 in descending order. 4, -4, -5, -1723558 Sort -2/17, 24, 2/25 in decreasing order. 24, 2/25, -2/17 Sort -0.2, -677/2, -3, 0.5, 15, -1. -677/2, -3, -1, -0.2, 0.5, 15 Put -4, -354, 4, -17, -2 in ascending order. -354, -17, -4, -2, 4 Sort 0.017, -0.02, -3/2, -0.03 in decreasing order. 0.017, -0.02, -0.03, -3/2 Sort 1.15, 0.4, -0.1, -2/5, -4, -5 in decreasing order. 1.15, 0.4, -0.1, -2/5, -4, -5 Put 0.4, -1, -0.03992, 0.5 in ascending order. -1, -0.03992, 0.4, 0.5 Sort -5, 6, -1, 2, -11 in increasing order. -11, -5, -1, 2, 6 Sort -0.4, -119, -76, 2 in descending order. 2, -0.4, -76, -119 Put -14, -2, -624 in increasing order. -624, -14, -2 Put -293, 234, -3 in decreasing order. 234, -3, -293 Sort 2, 25, 69 in decreasing order. 69, 25, 2 Sort -21/5, 2/3, 0.1947 in increasing order. -21/5, 0.1947, 2/3 Sort 9, 5, 1, -13, 10, 2 in increasing order. -13, 1, 2, 5, 9, 10 Put 24, 20, 2, 3 in decreasing order. 24, 20, 3, 2 Sort 183, -5, -35/8, -3 in descending order. 183, -3, -35/8, -5 Sort 1, 11026, 30 in ascending order. 1, 30, 11026 Sort -31, -38, 13 in ascending order. -38, -31, 13 Put -341, 0, -4, 5 in increasing order. -341, -4, 0, 5 Sort -3, 2, -4858 in increasing order. -4858, -3, 2 Put -1/5, -6, 0.4, 1/7, -1.54 in descending order. 0.4, 1/7, -1/5, -1.54, -6 Put 2673, 0.6, 1/3 in decreasing order. 2673, 0.6, 1/3 Sort -0.4, -1, 11, -0.081, -4 in ascending order. -4, -1, -0.4, -0.081, 11 Put -3, -5, 9935, -1, 2, -4 in increasing order. -5, -4, -3, -1, 2, 9935 Sort -24/11, 6, -1.1. -24/11, -1.1, 6 Sort 4, 2, 127934 in ascending order. 2, 4, 127934 Sort 2, -7, 1, 5. -7, 1, 2, 5 Sort -2, -1, 4, -10, -15 in increasing order. -15, -10, -2, -1, 4 Sort 1431, 20, -2, -3, 1. -3, -2, 1, 20, 1431 Put -6854, 0.1, -5, -6, 0 in descending order. 0.1, 0, -5, -6, -6854 Put -5, 2, 4, -46505 in increasing order. -46505, -5, 2, 4 Sort 449, 0.09, 4 in increasing order. 0.09, 4, 449 Sort 4, 124, -0.03. -0.03, 4, 124 Put 5, 1410, -3, 1 in descending order. 1410, 5, 1, -3 Sort 242, -3, 11, 3. -3, 3, 11, 242 Put 1, -3, 13, -5, -1, 81 in increasing order. -5, -3, -1, 1, 13, 81 Put 7/6, 1/58, 6, -2/3 in ascending order. -2/3, 1/58, 7/6, 6 Sort -3, 3, -4, -585. -585, -4, -3, 3 Put 0, 2, -3, 3, -2, -133 in increasing order. -133, -3, -2, 0, 2, 3 Sort 10, -4, 5, -0.39, 4, 0.1 in decreasing order. 10, 5, 4, 0.1, -0.39, -4 Put -169, 5, 0, 21, 4 in decreasing order. 21, 5, 4, 0, -169 Put -1, 241, -111, 0, 5 in increasing order. -111, -1, 0, 5, 241 Sort 67, 5, 109, 2, 3. 2, 3, 5, 67, 109 Sort -5, 3, 25, -873 in decreasing order. 25, 3, -5, -873 Sort 0.3, -0.2, 6620, -3/5 in increasing order. -3/5, -0.2, 0.3, 6620 Put 2, -204, -195, -0.4 in decreasing order. 2, -0.4, -195, -204 Sort 6, 5, -11, 15, 3 in ascending order. -11, 3, 5, 6, 15 Put 191, 2, -4, -12, -3, 3 in increasing order. -12, -4, -3, 2, 3, 191 Sort -6243, 6, 5, 4, 2. -6243, 2, 4, 5, 6 Put 3, -166, 1, -5 in decreasing order. 3, 1, -5, -166 Sort -3, 0, -39177, 1 in descending order. 1, 0, -3, -39177 Sort -4, -1, -84/13, 44/5, -2/17 in increasing order. -84/13, -4, -1, -2/17, 44/5 Put -9, -1, -85, 36 in ascending order. -85, -9, -1, 36 Sort 4, 2251, -20, -5 in decrea	{ "pile_set_name": "DM Mathematics" }
71.072247 to the nearest 10. -470 Round 3526887.203 to the nearest 1000. 3527000 What is 3498.84089 rounded to the nearest 10? 3500 Round 12.986789 to one dp. 13 Round 31856.484 to the nearest one thousand. 32000 Round 190.26874107 to one decimal place. 190.3 Round -281789021 to the nearest 10000. -281790000 Round -775221.555 to the nearest one hundred. -775200 What is 186.47968 rounded to the nearest integer? 186 Round 0.00000544515118 to 7 decimal places. 0.0000054 What is -41041.6108 rounded to the nearest integer? -41042 Round 0.00000047924775 to 7 decimal places. 0.0000005 What is 703.6341702 rounded to the nearest 100? 700 Round -149129.626 to the nearest one hundred. -149100 Round 0.00353679981 to three decimal places. 0.004 What is -3482.3507 rounded to the nearest 10? -3480 What is 8152.5655 rounded to the nearest one thousand? 8000 Round 40725.147 to the nearest ten. 40730 What is -0.00046637399 rounded to 5 decimal places? -0.00047 What is -6925.42463 rounded to the nearest 10? -6930 What is 0.0000647794896 rounded to seven dps? 0.0000648 What is 5.372882378 rounded to 1 decimal place? 5.4 What is 3986629.3 rounded to the nearest ten thousand? 3990000 Round -222957.797 to the nearest 10000. -220000 Round -0.37102264 to 4 dps. -0.371 What is 27882.8236 rounded to the nearest one hundred? 27900 Round -1290.21714 to the nearest 10. -1290 What is -0.000578815337 rounded to 6 decimal places? -0.000579 Round 476631.88 to the nearest 100000. 500000 What is -3801227.51 rounded to the nearest one million? -4000000 Round 0.431329502 to five decimal places. 0.43133 Round -0.00364932002 to 2 dps. 0 What is -1730820.84 rounded to the nearest one thousand? -1731000 Round -0.065408317 to 4 decimal places. -0.0654 What is 26.1095898 rounded to 3 dps? 26.11 Round -0.016808129057 to 5 decimal places. -0.01681 What is 0.00257658241 rounded to 6 dps? 0.002577 What is 5413022.9 rounded to the nearest 100000? 5400000 Round 0.000797327433 to seven dps. 0.0007973 What is 547.432537 rounded to the nearest 100? 500 Round -3.789042719 to four dps. -3.789 What is -6.47947317 rounded to the nearest integer? -6 Round 1.860352933 to four decimal places. 1.8604 What is -0.00002957342837 rounded to seven decimal places? -0.0000296 What is -126.7531037 rounded to one dp? -126.8 Round 0.0000123838778 to six dps. 0.000012 What is -192.6896966 rounded to 2 dps? -192.69 Round 1417098.24 to the nearest 1000. 1417000 What is -0.0006586291 rounded to 6 dps? -0.000659 Round 0.0007364369183 to four dps. 0.0007 Round -11765.2629 to the nearest one hundred. -11800 Round -0.46029127 to one dp. -0.5 Round 2390963085 to the nearest 1000000. 2391000000 Round -65381945400 to the nearest 1000000. -65382000000 Round -0.0002460550737 to seven decimal places. -0.0002461 What is -0.001848276076 rounded to 6 decimal places? -0.001848 Round -0.004695014458 to 7 dps. -0.004695 What is 294944.4747 rounded to the nearest 10000? 290000 Round 49884.463 to the nearest ten. 49880 Round 25677.7476 to the nearest 10. 25680 What is 2168.97677 rounded to the nearest ten? 2170 Round -0.05306663 to four dps. -0.0531 Round -774124237 to the nearest one million. -774000000 Round -0.0004639598862 to five decimal places. -0.00046 What is 2669.0861 rounded to 1 dp? 2669.1 What is -25.7305247 rounded to the nearest integer? -26 Round 284.1350005 to 0 decimal places. 284 Round -0.00092331096 to 6 decimal places. -0.000923 Round -8.539016072 to 1 dp. -8.5 Round 11.9320596 to 2 decimal places. 11.93 What is -7780.682024 rounded to the nearest one thousand? -8000 Round -37151.6881 to the nearest integer. -37152 What is -0.01214228938 rounded to 3 decimal places? -0.012 Round 13.7021928 to one dp. 13.7 What is -40943594.2 rounded to the nearest one million? -41000000 Round 0.02423585646 to six decimal places. 0.024236 What is -0.00406970045 rounded to six decimal places? -0.00407 What is 1891.959625 rounded to the nearest ten? 1890 Round 4.76930296 to 1 decimal place. 4.8 What is 1060832538 rounded to the nearest 1000000? 1061000000 What is -1624006.28 rounded to the nearest one hundred thousand? -1600000 Round 204.0185939 to two dps. 204.02 Round 0.01792445082 to four decimal places. 0.0179 What is -0.0120219276 rounded to 6 dps? -0.012022 What is -2399.5591502 rounded to the nearest ten? -2400 What is -224611060.6 rounded to the nearest one million? -225000000 Round -0.0005931682945 to 7 dps. -0.0005932 What is -0.00014433662 rounded to 6 decimal places? -0.000144 Round 31323.6 to the nearest ten. 31320 Round 0.02374596664 to two decimal places. 0.02 Round 69738.2118 to the nearest 10000. 70000 Round -0.00000056474877 to 7 decimal places. -0.0000006 Round -96.65300645 to 2 decimal places. -96.65 Round 235383350 to the nearest 10000. 235380000 Round -0.1398300193 to 5 dps. -0.13983 Round 49.181115 to the nearest integer. 49 Round 0.0000020949095 to 6 decimal places. 0.000002 Round 9483.69847 to the nearest one thousand. 9000 Round 545.462685 to the nearest 10. 550 Round 319704.1121 to the nearest one hundred. 319700 What is 0.00000310806735 rounded to seven dps? 0.0000031 Round 0.0346020674 to 5 dps. 0.0346 Round -510668.2998 to the nearest one hundred thousand. -500000 Round -36000665.4 to the nearest one hundred thousand. -36000000 What is 15.292807 rounded to 3 dps? 15.293 What is -0.6697118041 rounded to four decimal places? -0.6697 What is -93250859.1 rounded to the nearest 100000? -93300000 Round 710.941569 to the nearest integer. 711 What is 9524378.12 rounded to the nearest one hundred thousand? 9500000 Round 1.6067078 to 3 dps. 1.607 Round 344484.08 to the nearest 100000. 300000 What is -0.0218689441 rounded to five decimal places? -0.02187 What is 1089.223645 rounded to 1 dp? 1089.2 What is -0.00134580399 rounded to six dps? -0.001346 Round 13419.0003 to the nearest ten thousand. 10000 Round -2360414.231 to the nearest one hundred. -2360400 Round -5507.14019 to the nearest 100. -5500 Round -24034.95 to the nearest 1000. -24000 What is 0.5850643 rounded to two decimal places? 0.59 What is 0.05281317786 rounded to 5 dps? 0.05281 What is 1884780231 rounded to the nearest 1000000? 1885000000 What is 0.00478131609 rounded to three dps? 0.005 Round -36596548.8 to the nearest ten thousand. -36600000 What is 24463375.84 rounded to the nearest one million? 24000000 What is -4535.953951 rounded to the nearest integer? -4536 Round -0.000125182093 to 5 decimal places. -0.00013 What is 7117.197093 rounded to the nearest ten? 7120 What is 1418185415 rounded to the nearest one million? 1418000000 Round -5703.93779 to the nearest 1000. -6000 What is 1074973709 rounded to the nearest 100000? 1075000000 What is 0.000113049064 rounded to seven decimal places? 0.000113 What is 21120.63264 rounded to the nearest 10? 21120 What is -504576.31 rounded to the nearest one thousand? -505000 Round -8.650060277 to 4 dps. -8.6501 Round -402.99373 to the nearest one hundred. -400 Round -30171973.7 to the nearest 1000000. -30000000 Round 9.681192 to 3 dps. 9.681 Round -33008.382 to the nearest 100. -33000 What is 58.24144659 rounded to the nearest integer? 58 What is 67707.25781 rounded to the nearest one hundred? 67700 Round -2.544782631 to 1 dp. -2.5 Round -0.0031890074 to 5 dps. -0.00319 Round -0.000264644881 to seven dps. -0.0002646 Round 22809421405 to the nearest 100000. 22809400000 What is -5747573.94 rounded to the nearest ten thousand? -5750000 What is -444.24539 rounded to the nearest one hundred? -400 What is 130330.11 rounded to the nearest 10? 130330 Round 4032177.9 to the nearest one thousand. 4032000 Round 0.44997977 to 3 dps. 0.45 Round -299.4067868 to 1 dp. -299.4 Round 0.0001426885175 to six decimal places. 0.000143 Round -0.002267126079 to seven decimal places. -0.0022671 Round -3511.1804 to the nearest ten. -3510 Round 2.88001626 to three decimal places. 2.88 Round 208.7947288 to the nearest ten. 210 What is 0.0099166169 rounded to 5 dps? 0.00992 What is 0.0001770286854 rounded to four decimal places? 0.0002 What is -3851573754 rounded to the nearest 100000? -3851600000 Round 379.0931848 to two decimal places. 379.09 Round -99.489702 to 1 decimal place. -99.5 What is -27022.182 rounded to the nearest 10? -27	{ "pile_set_name": "DM Mathematics" }
f(-2/5))(-2/157) assuming f is positive. f(28031/14130) Simplify (z(-3)zzzz/(zzz*(-7))z)(-4/7)/((z(1/3))(-2/117))(2/19) assuming z is positive. z(-26672/6669) Simplify (((g/(g/g8)g)/g)/g)/gg*(2/13)(g(-1/2)/g)(12/5)g(-2/17)g*(1/3)g*4g(-7/2) assuming g is positive. g(21677/6630) Simplify ((((g/(g*14g))/g)/(g/(g*(-14)/gg)))/(g(-1))(22/3))(3/17) assuming g is positive. g(-4) Simplify (qq(-2/5))(-1/7)/(q(-6)/q(-1/5))(q(-1/2))2/(q*(-2)q*5qq) assuming q is positive. q(-2/7) Simplify ((a(3/4)aa(2/15)a)/(a/a*(-2/7)a5/a))/((a(2/5)/(a/(a/a5)))/(((a/a(-1))/a)/a)49) assuming a is positive. a(923/420) Simplify ((((x/(x/(xx(-3/2)/xx)))/(x/x(-6/7)))(-11/4))(-3/10))(-2) assuming x is positive. x(1089/280) Simplify (((v1/v)/v)*(-12)v*(-3/8)/vvv(2/15))/(v(2/7)v(-5))17 assuming v is positive. v(77197/840) Simplify ((d(-4/9)d)/(d/d(-5)))/(ddd/(dd*(3/2))dd(-2/11))(d*(2/19)(ddd*(1/2)dd)/d)21 assuming d is positive. d(129691/1881) Simplify ((i/((i/(i(-1/2)i))/i))/i)10/(i(-2/7)i(-5/3))(i/i*(-1/5)i/(ii/(i(-10)i)))(35/2) assuming i is positive. i(-3088/21) Simplify (((h/h(2/5))/h(-2/53))/(h*(22/5)/(hh34/h)))(-45) assuming h is positive. h(-72117/53) Simplify ((k(-1/4)/k)/kk)(1/7)/((kkk((k/((k*9kkk)/k))/k)/k)/kk/k(-1))(k/k1)(1/8)/(k(-4)/(k/k(-8))) assuming k is positive. k*(583/28) Simplify (((t(t/(tt(-1/16)))/t)/tt(5/9))/(t(-1/3))(-10/9))(-28) assuming t is positive. t(2275/108) Simplify (i(-4/7)/i(-4))(-1/12)/((iii(-1/6))/(i/i(-1/2)i)(i/(i/(i*(-1/4)i)))/i(-1/8)) assuming i is positive. i(-83/168) Simplify m*(2/17)mmm*(-5)/m(mmm*(-4/7)/mm)/mmmm(-2)(mm(-6)m*4)/(m/(mm*6)((m*(-2/25)m)/m)/m) assuming m is positive. m(7813/2975) Simplify ((i(3/8)i(-2/9)i)/((i*(-5)i)/i0))/((i6/(ii/(i(i*(-2/25)/i)/i)i))/(i(-2/5)/i2)) assuming i is positive. i*(1499/1800) Simplify ((r/(rr*(-2/13)r)r)/(r(-1)r))/((r*(-5)r)/r*(-2/3))r*(-1/5)/(rr/(rr6/r))(rr(1/7)/r)/(r/(rr/r(-2/9))) assuming r is positive. r(35431/4095) Simplify ((yy(-2/7)y)(-4/9)/(((y3y)/y)/((y6/y)/y)))/(y6/yy/(yy(1/3))yy(-5/4)yy(-2)) assuming y is positive. y(-89/28) Simplify ((((p/p(-1/3))/p)/((p/p(2/11)pp)/p))/(pp/(pp2p)pp/p(2/3)))/(p(-1/14)p0p)(4/13) assuming p is positive. p(-85/77) Simplify ((f*26/f)/ff/(f/(f*(19/2)f))f(f(-23))(-2))(-15/7) assuming f is positive. f(-2445/14) Simplify (n*(4/5)nn/(n/(n(1/10)/nn)))*(-12)(n/n*(2/11))/nn*(2/7)(n(-1)/n)29 assuming n is positive. n*(-31068/385) Simplify ((uu*(-2)u/u*(1/8)u)/(((u*(-1)u)/u)/u(uu(5/4))/u))/((u1)27)(16/3) assuming u is positive. u*(-1139/8) Simplify ((qq*2)/qq*7/q)/((q/((qq*(-3/4)/qqq)/q))/q(-1/6))(q/(q*1qq))/q(-1/3)(q(2/7))(-29) assuming q is positive. q(-241/84) Simplify (((h(-7)h)/hhh)/h5)(-6)/(hh*(-5)h*(1/6)(hh(1/2))49) assuming h is positive. h(-29/3) Simplify ((y(y*(-1)/y)/yy)/y)13/((y2y)/yyy/(y/y3))((y((yy*(-3)y)/y)/y)/(y2/y))/(y/(y(1/4)y))18 assuming y is positive. y(-61/2) Simplify ((k(-1/3)/k(-1/16))(-46))40 assuming k is positive. k(1495/3) Simplify ((kk*(2/47)k)/k)*(-2/45)(k17/k)(-4/11) assuming k is positive. k(-136438/23265) Simplify (w(-1/11))16/(w/w(-1/23))(-17) assuming w is positive. w(4120/253) Simplify (jjj(-1))(-10)((j/(j/(j(-1)/j)))/j)/(j/(j/((j/(j(-4)/j)j)/jj)j))(((j(-2)j)/j)/j(2/11))37 assuming j is positive. j(-1097/11) Simplify (((c(-24)/c)/c)/(c*19/c)c/c*(-11)c(-2))(1/23) assuming c is positive. c*(-34/23) Simplify ((ii(6/5))(-13/4)(i(-23))(-1))(-1/2) assuming i is positive. i(-317/40) Simplify (jj(((j(-5)/jj)/j)/j)/jj/(j/((j(3/4)jj)/j)))/(((jj/(jj3jj))/j)/j3)(j*(-2/5)jj)34/(j(-8)/jj(-5)) assuming j is positive. j(1443/20) Simplify (l/(lll*(1/7))l*1((ll(-1/3))/l)(8/7))/(((l/(l/(l(3/10)l)))/((ll3ll)/l))/(l(1/4))49) assuming l is positive. l(6479/420) Simplify (((w/w7)/ww)/w*11((w(ww/(w*(3/2)w)w)/w)/w)/w(1/4))(3/13) assuming w is positive. w(-213/52) Simplify (uuu(-1/2))(-1/38)/(u(2/7)uu(-1/14))((uu(-5))/(uu3/u))(20/7) assuming u is positive. u(-11307/532) Simplify (m1m(4/5)(m(-1/3))(-2))/(((m(1/10)/m)/m(-1/3))/(m*1/mm3/m)) assuming m is positive. m(151/30) Simplify ((h(1/10)/h(-3))/(h6/h4))/((h*2hh/(h/h(5/2))hh)/(h(1/2))(2/33)) assuming h is positive. h(-1051/165) Simplify (v/v(3/8)vvv7)/(v/v(-2)vvv/(v/(v/v(-1/3)))v)(v0)(3/10)v5/(v/(v(-3/2)/v)) assuming v is positive. v(91/24) Simplify ((c(-9/7))(-25)/(c(-11/3))(1/2))(2/89) assuming c is positive. c(1427/1869) Simplify h19h(6/7)/hh(-5/11)/h5 assuming h is positive. h(1032/77) Simplify w44ww*(-14)w*14(w/(w/w(10/11)))/w assuming w is positive. w(494/11) Simplify (f/(f/(f/f*29f)))*22(f(2/17))46 assuming f is positive. f(-10006/17) Simplify (x(1/18)/xxx(-2))29((xxx6x)/xx3x)/(x*(5/2)x/x(-2/17)) assuming x is positive. x(-7345/153) Simplify (d*(-2/23)d*(-5/4)d(d1dd)(-23))12 assuming d is positive. d(-19137/23) Simplify (((t/(tt*(-2))t)(-44)/(t/(t/(t(1/4)/t))t(-2/3)))19)33 assuming t is positive. t(-327503/4) Simplify (p18pppp(-2/23)p(p(-3/4))47)(-21) assuming p is positive. p(25767/92) Simplify u30u*(-10/11)(u(-11/4))0 assuming u is positive. u(320/11) Simplify ((w(2/7)/w)/(www*(-5/3)ww)(ww1)(-21))/((w1w)/w*(-6)(w1)(-34)) assuming w is positive. w(-400/21) Simplify (x(-2/3))(-3/8)/(x(4/9)x(-2))((xx0/x)/xxxx)*(-11/6)xxx*(-1/2)(x(-4/3)/x)/x assuming x is positive. x(-133/36) Simplify (c*12c*5/c(c/(c*(-2/9)c))(-1/24))10 assuming c is positive. c(8635/54) Simplify ((a/(a(14/3)/a))/(aaa*(-2/31))(a*(-2/133)a)26)(-25) assuming a is positive. a(-6495850/12369) Simplify (s6/(s10/s))(-4/41)/(s(-1/17)/(s(1/12)/s))(-11) assuming s is positive. s(81373/8364) Simplify (c*5/c)/cc*(-2)cc(-1/2)cc/c(7/4)c((c/(c(-1/3)c))/c(1/8))(-1/14) assuming c is positive. c(919/336) Simplify (c8c/(ccc(-1))c(c/c(-3/10))(-1/6))(-24) assuming c is positive. c(-1054/5) Simplify ((v(-2/3))(-46)(v(2/7))(-2/7))/((v*(-1)/vv)/(v*(1/5)v))(-8/13) assuming v is positive. v(279304/9555) Simplify (s(2/7))(5/8)(s/s(-3))/s(3/7)(s0)(-10/17)(s(2/3))(-2/17) assuming s is positive. s(749/204) Simplify (l(7/2)/ll/(ll(-11)l)l(l(1/3))(2/23))(-2) assuming l is positive. l(-1867/69) Simplify ((w/(((w/w*3)/ww)/w))(-2/19))(-46)/(((((w/(w*(9/2)/ww)w)/w)/w)/ww)/w(2/33))(-1/60) assuming w is positive. w(1451561/75240) Simplify (b/(b0/b))*(3/2)(bb/b(2/27))/(b(-7)b)(b/(b(1/4)/b)b(b/b(-4))/bb)/(b/(b/(b(2/5)/b)))(-17) assuming b is positive. b*(4577/540) Simplify (((g(g/(gg2))/g)/g)(-20))(-48)(g(2/5)/((g/(g(-1)g))/g))22 assuming g is positive. g(-14356/5) Simplify ((vv22)(-2/5)(v/v7vv)(-1/17))(-14/13) assuming v is positive. v(10668/1105) Simplify f(-8/3)/(f(24/11)f)f(-8/5)fff*(-5/13)f assuming f is positive. f(-10367/2145) Simplify (a(2/9))*46(a/((a/(a*1a))/a))/a*(2/5)(a*(-8)a)/(a((a(-4)a)/a)/a)a(-2/5)aa(2/5)/a assuming a is positive. a(442/45) Simplify ((h(1/2))(-4/19)(h*(1/10)hh)/(h/h2))(-5/2) assuming h is positive. h(-569/76) Simplify ((w(-1))(22/5))(4/37)/((w(-2/3))14(w*(-2/5)w)22) assuming w is positive. w(-482/111) Simplify nnnn/(n/(((n/(n/((((n6nn)/n)/n)/n)))/n)/n))n*0((n((nn*16)/nn)/n)/n)15 assuming n is positive. n246 Simplify (((u*15u)11)(1/15))(-3/41) assuming u is positive. u(-176/205) Simplify ((p*(9/5)p/(ppp*9)p*10p(-1/3))(-19/2))*	{ "pile_set_name": "DM Mathematics" }
e -3i + d = -2w, -5i + w + 8 + 7 = 0 for i. 3 Let t = -361 - -367. Solve 0 = w + 2w, t = -2y - 2w for y. -3 Suppose 15 = 5f - 7a + 12a, 0 = a - 1. Solve fl - 3 = 3o + 5, -2o - l = 3 for o. -2 Suppose -3j - a + 19 = 0, -21a - 17 = -5j - 19a. Solve 2l = -4w + 2w + 20, jw - 15 = 2l for w. 5 Let u be (-6)/(-63) - (-1872)/189. Solve -5m = 3g + 20, 5g - 2m - u = -2 for g. 0 Let g = -9 + 11. Suppose h + c - 6 = 0, -5h - 5c + 24 = -gc. Suppose hy - 11 = 1, -26 = -2a - 3y. Solve -a = -b + 3i, -4i + 3 + 5 = 3b for b. 4 Suppose -2j = -5 + 1. Let g(m) = 4 - mj - 4m + 12m - 2. Let p be g(8). Solve t = 5z - 24, pt - 5t + 5z - 22 = 0 for t. 1 Let q = -6 + 8. Let h be (1/1)/((-7)/126). Let k = h + 22. Solve -3o = -qy + 9, 4y + y = ko + 12 for o. -3 Suppose -2f - 34i + 33i + 5 = 0, 3i = 5f - 18. Solve 3v = fc + 6, -v - 2 - 1 = 4c for v. 1 Suppose -4u + 8u + 15 = 5g, 3u + 6 = 3g. Let j be 280/30 - (-4)/(-3). Suppose -4h - j = 0, 0 = -m - h - 2. Solve 3n = 2n + b - g, m = 5b - 20 for n. -3 Suppose 0 = -58q - 7q. Let u be -4 - -3 - (-1 + -4). Solve 2p = 3p - 2y - 9, q = -p - uy - 21 for p. -1 Let k be (-129)/(-21) - 4/((-56)/(-2)). Suppose -58 = -kb + 2b + j, 2b - 5j = 38. Solve -b = 2m - 2o - 2, -3m - 2o = 8 for m. -4 Let y be (-10)/((-20)/(-14)) + 10. Solve 0 = -2j + yv - 6v, v = -2j for j. 0 Let c be (-22)/(-4) - 33/(-22)-1. Solve -10 = u - 5v, 0u - cu = 5v - 10 for u. 0 Let q be (12/14)/((-6)/(-42)). Suppose qc = 37 + 5. Solve -6 = 4u - x, -x = -3u + x - c for u. -1 Suppose -5i = -26i + 84. Solve ix = -3b + 1, b = -4x - 0 - 5 for b. 3 Let x(r) = 2r*2 + 33r - 27. Let o(s) = s*2 + 17s - 14. Let h(f) = -7o(f) + 4x(f). Let l be h(-14). Solve w - 2u = -4, -4w + lu - 2 = w for w. 2 Let t(a) = -a2 + 4a + 16. Let r be t(-2). Solve -5 = rm - 3q, -3m - 4 + 13 = 2q for m. 1 Let n(q) = q3 - q2 - 2q + 3. Let h be n(2). Solve -15 = ha + 3p, 10p - 8 = -2a + 14p for a. -2 Let a = -1470 - -1475. Solve -i = -3t - 2, 0 = -ai - 4t - 12 + 3 for i. -1 Let w(d) = 29d + 205. Let c be w(-7). Let u = -18 - -19. Solve 3k = 5t + 8, 3k = ck - 2t - u for k. 1 Let w be 126/12(-8)/3. Suppose -2g + 21 + 61 = 0. Let z = w + g. Solve -3t + 8 = 3i + 26, 3t - 2i = -z for t. -5 Let a(h) = -2h*2 + 5h + 4. Let g be a(0). Solve 0 = -2k + 3f + 5, 2k + f - g = -3k for k. 1 Let i(w) = w*3 - 3w*2 + 2w - 1. Let q be (-1 - -1 - -3)4/4. Let y be i(q). Solve 15 = yp + 5t, -2p - 2t = -t - 8 for p. 5 Suppose -4 = -3v - 5y, -1 = -v + 2y + 4. Suppose -5d + vd + 6 = 2r, -d = -r + 1. Solve 0 = -rb + 2n - 14, 2n + 4 = -6b + 2b for b. -3 Let z be 25 - (-10 + 11)(-1 + -1). Solve 5y = v + z, -3v + y - 9 = -v for v. -2 Let r be -3 + 3/(4 - 1). Let n = 10 - r. Suppose 4h + n = 0, 0 = w + h - 0 + 1. Solve 0 = j - 0j - 3q - 7, -j = wq + 8 for j. -2 Let w = 928 + -926. Solve 4y + 16 = -wa, -2y = -y + 3a - 1 for y. -5 Suppose -2w + 2 = -4w. Let t be w - 2 - ((-69)/3 - -2). Let s = -6 - -11. Solve -3z - 5y + t = 0, sz - 11 = -0z - 2y for z. 1 Let g(k) = -5k - 20. Let a(i) = i3 + 5i*2 - 21. Let y be a(-4). Let h be g(y). Solve -3p - 5r = -0p - 11, -20 = -hr for p. -3 Let r = 49 - 45. Suppose m - 14 = j - 4j, m - 17 = -rj. Solve -5b + 2h - 2 = 0, -h = -mh - 16 for b. -2 Let k = -1089 + 1090. Solve -5b + 5l = k + 4, 0 = -4b + l - 7 for b. -2 Let f be 0/((-22)/(-2 - -4)). Let o(m) = -m*2 + 2. Let x be o(f). Solve -i + 1 = 4h, 4h - 4i = -xi + 10 for h. 1 Let x(a) = a. Let y be x(-3). Suppose -10 = 13c - 15c. Let m be c + y2/3. Solve 0 = -mu - 4j - 25, 0 = 3u + u - 2j + 4 for u. -3 Let o = -2 - -4. Let w(n) = -n*2 - 15n - 11. Let s be w(-14). Solve ol + 1 = -sz, l = 2l - z + 8 for l. -5 Suppose z - 2n = -3n, -18 = -2z + 4n. Suppose 2r + 1 - z = 0. Solve 5k = f + 24, 0 = 2k + 5f - r + 13 for k. 4 Let w be (5 + (5 - 18))(-20)/8. Solve -a + 10b - w = 6b, -3a = -2b + 10 for a. 0 Suppose 3h = -3, 0b - b = 2h - 3. Solve 0 = -o - 3q - b, -2o = 3q - 4q + 10 for o. -5 Let v be (3-4)/(-2 - -1). Let g(s) = -2s + s - 2s*2 + 5s2 + s3 + 3s2 + 3. Let u be g(-6). Solve b = -2p + u, 6b - v = 4p + 2b for p. 2 Suppose 2i + 8h - 12 = 5h, 0 = i - 5h + 20. Solve 0 = -2n + 3b + 17, n - b - 7 = -ib for n. 4 Suppose -16u = -339 + 51. Solve 0 = -3t + 5n - 3 + u, 3n = t - 5 for t. 5 Let n be (-4 - -16)/(-3) - -5. Let l(j) = 2j2 - j + 2. Let o be l(n). Solve -2i + t = -2, -2i + 10 = -ot - 2t for i. 0 Let f(p) = 2p*3 - 33p*2 - 54p + 2. Let g be f(18). Solve -u - 2k + 7 = 0, 0k + k - 8 = -gu for u. 3 Suppose 22h - h = 588. Solve 5f = -2c - 15, -5c - h = 4f - f for c. -5 Let o(m) = -m*3 + 5m*2 + 8m - 7. Let v be o(6). Let x = v + 0. Suppose -10 = -4w + xq, -2w + 12 + 0 = q. Solve -3 = -i + 3l + 1, -wi = l - 4 for i. 1 Let c(a) = a2 - a + 3. Let v be c(2). Solve -7x - vy + 15 = -2x, 2x = y + 3 for x. 2 Let w = 19 - 37. Let v = w - -21. Suppose 3b + vu = 7 - 4, 8 = -4u. Solve -5 = -3l + d, bl - 4l - 2d = 10 for l. 0 Suppose 2d + 12 = -34. Let n = d + 27. Solve 4w = w + 2q + 6, -nq + 2 = w for w. 2 Let d(g) = 12g + 9. Let l(h) = -h - 1. Let x(o) = d(o) + 9l(o). Let n be x(5). Let b(y) = -y + 17. Let k be b(n). Solve w = -5z - 24, -z = kz - 3w for z. -4 Let h be 30/4(125/(-15) - 5). Let r be (0 + (-5)/(h/(-8)))-10. Solve -2b + r = 2d, -2d = 7b - 2b - 19 for b. 5 Let v = -15 - -51. Suppose -vn + 39n = 60. Let r(d) = d*3 - 3d*2 + 1. Let j be r(3). Solve -n = -2y + 5t - 8, y = -t - j for y. 1 Suppose 10 = 5k - 0. Let g be 423/108 + 3/36. Suppose -3q - 4 = -b - 3, 2q = 2. Solve -2o - km = 2 - b, 4o - g = -m for o. 1 Let g(f) = 6f + 77. Let d be g(-12). Solve dx - 2c = 18, x = -2c - c + 7 for x. 4 Let g = -4 - -2. Let d be (-12)/8 - 3/g. Let l = 7 - d. Solve 3y + 9 = -4z, -2z - l = -0z - y for z. -3 Let f = -3090 - -3095. Solve -4q + 2h = -10, fh + 2 = -3q - 10 for q. 1 Let l be -42((-18)/4 + 4). Let k = l - 19. Suppose 5o + 0v - 4v - 25 = 0, 2o - kv = 8. Solve 8 = -4m, z + 3m - o = 6m for z. 3 Let h = 994 - 987. Solve y + 2w = -0y - h, 5y - w - 9 = 0 for y. 1 Suppose -58 + 22 = -9l. Solve -lx + 15 = -5v, -v - 3 + 0 = -3x for x. 0 Let g be (-8)/3 + (-10)/(-15). Let t(q) be the first derivative of -3q*2/2 - 3q - 3. Let f be t(g). Solve 3k - 5k - 5n + 6 = 0, 12 = -3k + fn for k. -2 Let m(g) = -g2 - 12g - 9. Let z be (1 - 1) + (1 - 0). Let q be (23 - z)4/(-8). Let v be m(q). Solve -j + vo + 12 = 0, -4j + o = -2j - 12 for j. 4 Suppose -53d + 43d + 420 = 0. Solve 5l - 10 = 4v - d, 0 = -4v + 12 for l. -4 Let h(s) = -10s - 230. Let m be h(-23). Solve r = -2g - mg - 2, -5g + 2 = -r for r. -2 Let l = 225 + -224. Solve 0 = -2d + 3w + 2, 2 = 3d + 5w - l for d. 1 Let s = -116 - -140. Solve 1 = r - 3, -5p - s = -r for p. -4 Let p = -821 - -828. Solve -2r - 2k = 0, -4k - 5 = p for r. 3 Let o = 8 - -2. Let l = -9 + 12. Let a(t) = 4t + 31. Let x be a(-7). Solve 2 = -2n - xv, -n + 5v = -ln - o for n. 5 Let k(w) = 2w2 - 24w + 56. Let l be k(9). Solve lq - 6 = -2s, 3q + 2q = 0 for s. 3 Let h(k) = k*3 - 2k - 1. Let u be h(-1). Suppose 0 = 2t + 4w - 28, -2w - 245 = 3t - 267. Solve -5b - 18 + u = -2g, t = -2b for g. 4 Let g = -1233 + 1236. Solve 0 = -3v, -gj + 9 = -5v + 12 for j. -1 Let t(m) = 43 - 14 - m*2 - 14 - 18 - 6m. Let v be (4/10 - 0)-5. Let y be t(v). Solve -yb - 30 = 3c, -3b - c = -3c - 1 for b. -3 Suppose -2k = 4y - 8, -11y + 12y - 2 = -3k. Solve -yb = 4c - b, 0 = -3c + b - 7 for c. -1 Suppose 12 = -o - 5r, -2o - 4r - 6 = -0o. Suppose -1852 = -267q + 284. Solve -3x = 4p - 1, -ox + 2p = -qx + 11 for x. 3 Suppose -3r + 2r + 4 = 0. Let t be (-2 + -1)/((2/(-12))/1). Suppose 2l + l - 2g = 11, -4l + g + t = 0. Solve -2v = -0v - rd - 16, 3v - ld = 19 for v. -2 Let r(o) = o2 - 12o - 84. Let d be r(17). Solve d = g + b - 0, 0 = 3g + b - 1 for g. 0 Suppose 0n + 10 = 2n + q, 5n = -4q + 28. Let b = 8 - n. Let a(j) = j2 + j + 5. Let w be a(0). Solve wc + 12 = -3d, -bc + 2*d - 6 = 8 for c. -3 Let j = -1419 + 1423. Suppose 3 = -f,	{ "pile_set_name": "DM Mathematics" }
86025, 3d + lz + 785985 = 0. Round d to the nearest 10000. -260000 Suppose 3q - 424560010 = 5m, -15q - 283039990 = -17q - 5m. Round q to the nearest 1000000. 142000000 Let k(g) = 657g + 40. Let a be k(19). Let i = a - 17963. What is i rounded to the nearest one hundred? -5400 Let q = 3.974 - -0.026. Let v = 401 + -396.848. Let r = v - q. Round r to 2 decimal places. 0.15 Let y be ((-10)/4)/((-60)/144). Suppose 3040 = yr - 10r. Round r to the nearest one hundred. -800 Let b = 18.65442 + -18.75. What is b rounded to two decimal places? -0.1 Let w(a) = a*3 + 8a*2 + 5a - 35. Let t be w(-9). What is t rounded to the nearest 10? -160 Suppose 192 = -4p - 1136. Let l = p + 138. What is l rounded to the nearest 10? -190 Let y = -3310 - -3309.99993589. What is y rounded to 5 dps? -0.00006 Let a = 1869 - 1876. What is a rounded to the nearest 10? -10 Suppose 59 - 68 = -3k. Let f be (-1)/5 + 1902/10. Suppose -kv + 5x + f = 14, 5x = 25. What is v rounded to the nearest 10? 70 Let f = -10 + 11.2. Let c = -22.92125 + 21.72. Let v = f + c. Round v to four decimal places. -0.0013 Suppose -5i + 0l - 67016 = 4l, 0 = -3i - 5l - 40220. Round i to the nearest ten thousand. -10000 Let n = 0.25614 + 150.67686. Let g = n - 151. Let s = 0.052 - g. What is s rounded to 2 dps? 0.12 Let v = -1594.152913478 + -0.386496522. Let f = v - -1595.47. Let c = -0.93 + f. What is c rounded to 4 dps? 0.0006 Let v(l) = -732l2 - 10l + 10. Let r be v(-10). What is r rounded to the nearest 10000? -70000 Let m(a) = -3422a3 - 24a*2 - a - 25. Let v be m(19). Let i = v - -34880206. Round i to the nearest 1000000. 11000000 Let g = -1115 + -6376. Let k = g + 13491. Round k to the nearest 1000. 6000 Let u = 3378 - 3371.988. What is u rounded to one dp? 6 Let d = 303.29 + -301. Let y = d - 2.2899873. What is y rounded to 6 decimal places? 0.000013 Let k be -4 + 3 - (11479998 - -1). What is k rounded to the nearest 100000? -11500000 Let r = -214.1646656 - -168.16466. Let s = r - -46. Round s to six decimal places. -0.000006 Suppose -2t = j - 11119997, 5t - 2j = 20020062 + 7779944. What is t rounded to the nearest 100000? 5600000 Let m = -31633823670.74 + 31633825714.740001149. Let f = 2044 - m. What is f rounded to 7 decimal places? -0.0000011 Let z = 125 + -218. Let n = -92.15 - z. Round n to 1 dp. 0.9 Let q = 3.294 + -3.6. Let x = -0.41 - q. Round x to 2 decimal places. -0.1 Let k = 12.06 + 2.04. What is k rounded to 1 decimal place? 14.1 Let z = -322 + 321.9963. Round z to 4 dps. -0.0037 Let v = 36 + -43. Let s = v + 7.013. What is s rounded to two decimal places? 0.01 Let f(l) be the first derivative of 0l + 2 - 5779/4l*4 - 1/2l*2 - 4/3l3. Let s be f(-3). What is s rounded to the nearest 10000? 160000 Let i(q) = q2 - q - 12200000. Suppose 0 = 4k - k. Let y be i(k). Round y to the nearest one million. -12000000 Let l be 9/(9/(-4)) - -15. Suppose -10p + lp = 700000. Round p to the nearest one hundred thousand. 700000 Let k = -0.79 - -0.4. Let m = k + 0.72. Let q = -0.330013 + m. Round q to 5 dps. -0.00001 Let z = -471.9999796 + 472. Round z to 6 dps. 0.00002 Let o = -122.7 + 4.7. Let y = o - -117.13. What is y rounded to one decimal place? -0.9 Suppose 2s - s = 2. Suppose n - 2u = -722, sn - u = 7n + 3599. Round n to the nearest one hundred. -700 Let x be 420601/2 + 44/(-8) + 5. What is x rounded to the nearest one thousand? 210000 Let z = -600 - -600.0599. What is z rounded to 2 decimal places? 0.06 Let q = 0.2 - 0.87. Let p = q + 0.6700045. Round p to 6 dps. 0.000005 Let m = 0.0066 + 697.9934. Let j = -697.693 + m. Let n = -0.186 + j. Round n to two dps. 0.12 Let g(k) be the second derivative of k5/20 - 2k*4/3 + 7k*3/6 + 5k*2/2 + k. Let n be g(7). Suppose nt - 484 = t. Round t to the nearest 10. 120 Let m = 231.066 - 231. Round m to two dps. 0.07 Let j = 45150.81 + -45343. Let p = j + 191. Round p to the nearest integer. -1 Let q = 5204.00004093 + -5204. Round q to six decimal places. 0.000041 Suppose 322463 = 8j + 955263. Round j to the nearest 1000. -79000 Let t = -95098 - -95098.39991. Let i = 0.1 - 0.5. Let n = i + t. What is n rounded to four decimal places? -0.0001 Let q = 34 - 43. Let f = q + 8.9997. Round f to four decimal places. -0.0003 Let y be 250((-58392)/20 - (-4)/(-10)). What is y rounded to the nearest 100000? -700000 Let s = 2560.561 - 2562. Let x = s - -0.039. What is x rounded to zero decimal places? -1 Let b = 0.88 - -105573.12. Let n = -105631.149 + b. Let h = 57 + n. What is h rounded to two dps? -0.15 Let b = 158557 - 158593.0084. Let m = 47 - 83. Let a = m - b. Round a to three dps. 0.008 Let u = -267 + 267.00014. Round u to 3 dps. 0 Let c = -2.5 + -1.5. Let x = 3.2 + c. What is x rounded to one decimal place? -0.8 Let p = -7867416 + 21097416. Round p to the nearest one hundred thousand. 13200000 Let p be (-4 + 5)(3 - 124). Let f = p - 79. Round f to the nearest one thousand. 0 Suppose -1376542 = 16k + 3383490. Let u be (-22)/(-55) + k/5. Round u to the nearest 10000. -60000 Let h = 25.03 + -14.43. What is h rounded to zero decimal places? 11 Let q = 385.8 + -658. What is q rounded to the nearest 10? -270 Let v = -276.46 - -196.25. What is v rounded to 0 dps? -80 Let c = 4640 + -4667.034. Let t = -27 - c. Round t to 2 decimal places. 0.03 Let t = -641 - -655.8. Round t to the nearest integer. 15 Let g = -0.064 - 25.936. Let r = g + 26.082. What is r rounded to 2 decimal places? 0.08 Let q be (-14)/(-70) - (-11)/(-5). Let o be q/9 + (-224)/(-36). Suppose r - o = 37. Round r to the nearest ten. 40 Let s = -17 - -16.7. Let b = s - -0.300042. What is b rounded to 5 decimal places? 0.00004 Let b = -180966721.8999599 - -180966737. Let s = -15.1 + b. Round s to 6 dps. 0.00004 Let l = -8.89 + 9. Let r = 0.46 - l. Let n = r + -0.34999994. What is n rounded to 7 decimal places? 0.0000001 Let r = 331.5 + -322. What is r rounded to the nearest 10? 10 Suppose -8v + 10v = 50. Suppose 22o + 1686000 = vo. Round o to the nearest 100000. 600000 Let p = 29 - 44. Let a = p - -17. Suppose -950000 = -i + ai. Round i to the nearest 100000. -1000000 Let d be 8/(-32) + (-19123346)/(-8). Let n be (-1)/(-4) - d/72. What is n rounded to the nearest 1000? -33000 Let s = -32.5302247 - 151554884.4697753. Let p = -151555080.999798 - s. Let k = -164 - p. Round k to 5 decimal places. -0.0002 Let q be (13 - (-92152)/16)(0 + 24). Let b = -103051 - 147489. Let j = q + b. What is j rounded to the nearest 10000? -110000 Let a = 5447.2 + -5451.1737. Let q = a + 4.17. Let v = q - 0.188. Round v to 3 dps. 0.008 Let r = 70.3 - 235. Round r to the nearest ten. -160 Let h(q) = -60395q - 75. Let f be h(15). Round f to the nearest 100000. -900000 Let y = 120.961 - 121. Round y to 3 dps. -0.039 Let c = -2521190 - -5749999. Let y = 2387315 + -216126. Suppose -o - 5u = -1800010, 0 = 3o - u - c - y. What is o rounded to the nearest 1000000? 2000000 Let z = 31.84 - 31. Let s = -0.7 + z. Let o = s - 0.052. What is o rounded to 2 decimal places? 0.09 Let s = 1.17 + -0.79. Round s to 1 dp. 0.4 Let x = 39 + -27. Let h = x - 12.3. Let i = h + 0.29956. Round i to four dps. -0.0004 Let l = -421783873.9974 + 421740326. Let q = -43571 - l. Let h = q + 23. What is h rounded to three dps? -0.003 Let v(b) = -6b*3 + 4b + 3. Let p be v(-1). Let c be (-21600004)/6 + (20/6)/p. Round c to the nearest 100000. -3600000 Suppose -20 = -x - 3x. Suppose 4z + xg = 1, -1 = -2z - 5g - 8. Let o be 2/(((-24)/213)/z). Round o to the nearest ten. -70 Let s be 17380/(-6)(-483)/(-322). What is s rounded to the nearest 100? -4300 Let k be (-3561)/7 - ((-14)/(-49) + 0). Let o = k + 889. What is o rounded to the nearest 100? 400 Let x be 24/(-20)10/(-2). Suppose -3m - 123879 = -xm. Suppose -8793 + m = -5u. Round u to the nearest 1000. -7000 Let g = -83208.017 + 83148. Let y = 60 + g. Round y to three dps. -0.017 Let j = -9 + -26. Let y = j - -34.908. What is y rounded to 2 dps? -0.09 Suppose -2 = -5u - 3v, v - 26 = 3u - 4v. Let a be 3 + -5 - 2u. Suppose -aq = j - 46, 43 = 4j + 2q - 141. What is j rounded to the nearest ten? 50 Let r = -608 + 608.40288. Let g = -0.4 + r. Round g to four decimal places. 0.0029 Let l = -115.89997949 + 115.9. Round l to 5 de	{ "pile_set_name": "DM Mathematics" }
1647, 4 in increasing order. -0.1, 4, 1381647 Put 0, 1, 8, -2, 5, -245 in descending order. 8, 5, 1, 0, -2, -245 Sort 10, -212, 2, 43, 3, -1 in ascending order. -212, -1, 2, 3, 10, 43 Sort -4, 0, 88, -43, 2 in descending order. 88, 2, 0, -4, -43 Sort -4, 14, 1, -2, -689. -689, -4, -2, 1, 14 Sort -0.2, 3/37, -1, 0, 5, 11 in ascending order. -1, -0.2, 0, 3/37, 5, 11 Put 95.7, -32, -5, -1/4, -1/45 in descending order. 95.7, -1/45, -1/4, -5, -32 Put -1, -14, 596, 3, -106, -5, -3 in ascending order. -106, -14, -5, -3, -1, 3, 596 Sort 1, 4002, 4 in ascending order. 1, 4, 4002 Sort -41, 0.4, -2/5, 8.445 in decreasing order. 8.445, 0.4, -2/5, -41 Put 27, 0.2, -0.5, -822, -1, 5 in ascending order. -822, -1, -0.5, 0.2, 5, 27 Sort -134, 1, -4, -26, -5, 5 in descending order. 5, 1, -4, -5, -26, -134 Sort -5, 0.5, -116934.009 in decreasing order. 0.5, -5, -116934.009 Sort 0.4, -8/15451, -2/5, 0.25 in increasing order. -2/5, -8/15451, 0.25, 0.4 Sort 1, -13, -16, 14, -18 in descending order. 14, 1, -13, -16, -18 Sort -5, 6, 16, 9, -6, 4, -2. -6, -5, -2, 4, 6, 9, 16 Put 9, -5, 3, 5, -49, -17, 11 in decreasing order. 11, 9, 5, 3, -5, -17, -49 Sort 1, -3, -9, -913, 3, 114, 5 in decreasing order. 114, 5, 3, 1, -3, -9, -913 Sort -91, -3882, -9, 4. -3882, -91, -9, 4 Sort -0.7, 0.056, 3060. -0.7, 0.056, 3060 Sort 3827, 173, 8, -5. -5, 8, 173, 3827 Put -3, 3, -2, 62082, 4 in increasing order. -3, -2, 3, 4, 62082 Put -3, -1195, -11464 in descending order. -3, -1195, -11464 Put -1369, 0, 1, -34, 2, -4 in increasing order. -1369, -34, -4, 0, 1, 2 Put 0.2, -3/10, 0.351, -2/7, 2, 16 in decreasing order. 16, 2, 0.351, 0.2, -2/7, -3/10 Put 0.668, -1/4, 3, -1/35 in descending order. 3, 0.668, -1/35, -1/4 Sort 1, -3, 7058, -46, -4, 4 in decreasing order. 7058, 4, 1, -3, -4, -46 Put 4, 0, 2, 1, 420, 3 in decreasing order. 420, 4, 3, 2, 1, 0 Sort 158553, -5, 51 in ascending order. -5, 51, 158553 Sort 130, -2, 2156, 0 in ascending order. -2, 0, 130, 2156 Put -4, 36, 2, -552770 in descending order. 36, 2, -4, -552770 Sort -7, 3, 19, 4, 1, 2, -4 in descending order. 19, 4, 3, 2, 1, -4, -7 Sort 12, 3, -13759, 4 in descending order. 12, 4, 3, -13759 Sort -48, -2105, 2 in descending order. 2, -48, -2105 Sort -7, -5, -126, 14, -2, 440 in descending order. 440, 14, -2, -5, -7, -126 Sort 17, 3, 20, 0, -5, -1 in ascending order. -5, -1, 0, 3, 17, 20 Put -3, 2, -2, -111634243 in descending order. 2, -2, -3, -111634243 Sort -2, 10, 2, -33, -2/1697 in descending order. 10, 2, -2/1697, -2, -33 Sort 0.02, 2, -1/286, -2/17, 49 in descending order. 49, 2, 0.02, -1/286, -2/17 Put 0.068, -2, -3/316 in increasing order. -2, -3/316, 0.068 Sort 9865, 98, 2/9. 2/9, 98, 9865 Sort 4, -5280, -3, -124. -5280, -124, -3, 4 Put -10, -41/3, -18498 in increasing order. -18498, -41/3, -10 Put -5, -9505142, 4 in ascending order. -9505142, -5, 4 Put -12.09, 3, 50 in ascending order. -12.09, 3, 50 Sort -5, 4, -515, 5, 2, -28, -18 in decreasing order. 5, 4, 2, -5, -18, -28, -515 Sort 1, 246925, -44 in descending order. 246925, 1, -44 Put 1, 5046, -22, 11 in decreasing order. 5046, 11, 1, -22 Sort 0.3, 15/4, 0.2, -1.335, -2/11 in decreasing order. 15/4, 0.3, 0.2, -2/11, -1.335 Put 4, 64/11, -22602 in ascending order. -22602, 4, 64/11 Put 3, 975, -674 in ascending order. -674, 3, 975 Put -5, 5, 4, 196, 10, -83 in increasing order. -83, -5, 4, 5, 10, 196 Put 2/13, -2, 0.3, 7444/559 in ascending order. -2, 2/13, 0.3, 7444/559 Sort 711, 1, -5, -4, -2, -1, 64 in increasing order. -5, -4, -2, -1, 1, 64, 711 Sort -3, 0, -1/6, 1.3861007 in increasing order. -3, -1/6, 0, 1.3861007 Sort 4, 0, 3610, 2, 201. 0, 2, 4, 201, 3610 Sort 4, 12501, 286. 4, 286, 12501 Put -3849, -3/2, 8724 in decreasing order. 8724, -3/2, -3849 Put 1, -17, -2450011 in descending order. 1, -17, -2450011 Put -1/132, 4, 1/6, 1, 3405 in ascending order. -1/132, 1/6, 1, 4, 3405 Put 4/5, 0, 1, -0.14, -71, -4, -3 in descending order. 1, 4/5, 0, -0.14, -3, -4, -71 Put -2, 1840, 8, -4 in ascending order. -4, -2, 8, 1840 Put -626, 4, -55.564 in increasing order. -626, -55.564, 4 Sort -2, 880, 1, 0, -4, 230, 4. -4, -2, 0, 1, 4, 230, 880 Put -1.5, 25/37, 5, 15, 3/5 in descending order. 15, 5, 25/37, 3/5, -1.5 Put -4, -2, 5, -5, 56, 29, 198 in decreasing order. 198, 56, 29, 5, -2, -4, -5 Put 1, 2716, 4, 174 in descending order. 2716, 174, 4, 1 Sort 1708, 3, -1, -43, 4 in increasing order. -43, -1, 3, 4, 1708 Put 2, 422, 54, -1, 7, 1, -2 in descending order. 422, 54, 7, 2, 1, -1, -2 Sort -4, -13892, 0, 21 in decreasing order. 21, 0, -4, -13892 Put -1, -39, -12, 3 in increasing order. -39, -12, -1, 3 Put -1, 0.4, 1317644, -51, -0.3 in decreasing order. 1317644, 0.4, -0.3, -1, -51 Put 3/4, -1/17, -0.26, 3, 0.111, 4 in ascending order. -0.26, -1/17, 0.111, 3/4, 3, 4 Sort 1, -4, -53, -5, 4062 in ascending order. -53, -5, -4, 1, 4062 Put -1440, -224, 2, 0.5, 1, -0.5 in decreasing order. 2, 1, 0.5, -0.5, -224, -1440 Put -7, -866, -1, 100, 5 in descending order. 100, 5, -1, -7, -866 Sort -2, 4, -521, 2, 0, 197 in increasing order. -521, -2, 0, 2, 4, 197 Sort 3, 332533, -3, -5 in decreasing order. 332533, 3, -3, -5 Sort 1, -167/5, -5, 401.6 in descending order. 401.6, 1, -5, -167/5 Sort -8, 91, -2, -990, -5, -7 in descending order. 91, -2, -5, -7, -8, -990 Put 0.3, 7370, -0.308 in descending order. 7370, 0.3, -0.308 Sort 184, 3, 11, 5775, -2, -1 in ascending order. -2, -1, 3, 11, 184, 5775 Put -0.2, 4, -655.343 in ascending order. -655.343, -0.2, 4 Put -4, -1, -6, 737, 0, -98, -5 in decreasing order. 737, 0, -1, -4, -5, -6, -98 Sort 4, -17143, -4, 0, 5, -3, 3 in increasing order. -17143, -4, -3, 0, 3, 4, 5 Put 0.04, -14, 64, -0.243, 1 in descending order. 64, 1, 0.04, -0.243, -14 Sort -1, 4, -18, 3, -4110, -5. -4110, -18, -5, -1, 3, 4 Put 1, -2431, 35, 4, 5, -1, -2 in decreasing order. 35, 5, 4, 1, -1, -2, -2431 Sort -54198, 2, 19, 3 in descending order. 19, 3, 2, -54198 Put 1461, -5, -382 in descending order. 1461, -5, -382 Put -19, 737, 2, 1, 22 in decreasing order. 737, 22, 2, 1, -19 Sort 3.878, -174/65, 0.5 in increasing order. -174/65, 0.5, 3.878 Put -0.2, -1/36, -1494.093 in descending order. -1/36, -0.2, -1494.093 Sort 1/4, 2/11, 40852/65747 in decreasing order. 40852/65747, 1/4, 2/11 Sort -259, -88, 11 in decreasing order. 11, -88, -259 Sort 2, -1, 3, -7, 3822, 0 in decreasing order. 3822, 3, 2, 0, -1, -7 Sort 3, -2, 5, 316, -874 in increasing order. -874, -2, 3, 5, 316 Sort 2259, 4, -1/5, 1/3, 0.2, 76 in ascending order. -1/5, 0.2, 1/3, 4, 76, 2259 Sort -0.4, -26, -100894/3, -4. -100894/3, -26, -4, -0.4 Sort 3, 1, 44350, 2, -4, -1, -2. -4, -2, -1, 1, 2, 3, 44350 Put -5516, -44, -5, 2, -1 in increasing order. -5516, -44, -5, -1, 2 Sort -482, 5, -5, 2, 3, 227, -3 in decreasing order. 227, 5, 3, 2, -3, -5, -482 Sort -0.2, -114, -0.03, 3, 0.5, 2/7 in decreasing order. 3, 0.5, 2/7, -0.03, -0.2, -114 Put -5, -24, 1202 in ascending order. -24, -5, 1202 Sort 0.24, -12427, 1 in ascending order. -12427, 0.24, 1 Put 8, -4, -3, -10, 0, -186 in ascending order. -186, -10, -4, -3, 0, 8 Sort 14, 7471, 9 in increasing order. 9, 14, 7471 Sort 3/5, 0.3, 79/4, -53/5, -1, 4. -53/5, -1, 0.3, 3/5, 4, 79/4 Sort 5287, 3, 4, -2, -23. -23, -2, 3, 4, 5287 Sort -2/17, 44, -54.6, 3.4 in ascending order. -54.6, -2/17, 3.4, 44 Sort 6, 5, 34, 4, 2, -4, -57 in descending order. 34, 6, 5, 4, 2, -4, -57 Put -1384912, -3, -258 in descending order. -3, -258, -1384912 Sort 3, -30, -1064, -1, -3, -2, -25 in descending order. 3, -1, -2, -3, -25, -30, -1064 Sort 0, -4, -5, 2, -2, -9, 436 in decreasing order. 436, 2, 0, -2, -4, -5, -9 Sort -1/6, 0.4, -3/589787 in descending order. 0.4, -3/589787, -1/6 Put -6072, -12.73, 0.3 in increasing order. -6072, -12.73, 0.3 Sort -5, -3, -319858, 3, -7, -1, 4 in decreasing order. 4, 3, -1, -3, -5, -7, -319858 Sort 6, 3242588, 1. 1, 6, 3242588 Sort 4.9775, 1, 5, -0.2, -6, -4 in decreasing order. 5, 4.9775, 1, -0.2, -4, -6 Sort 3110674, -5, -8, 2 in decreasing order. 3110674, 2, -5, -8 Sort 35, 5, 10939, 1, -2 in decreasing order. 10939, 35, 5, 1, -2 Sort 5, 69, -831, -3556 in descending order. 69, 5, -831, -3556 Put 1, -44, 8, -5, -3, 82 in descending order. 82, 8, 1, -3, -5, -44 Sort -750072, -8, -3 in ascending order. -750072, -8, -3 Put -1255, 0.3, 4, 2, 0, -	{ "pile_set_name": "DM Mathematics" }
uppose -561b = -552b - 2187. What is the remainder when b is divided by 235? 8 Let b(n) = -6n + 23. Let g be b(3). Let m be ((-8)/g)/(15/25 + -1). Calculate the remainder when 249 is divided by 54/m12(-3)/(-27). 15 Suppose -2f = -3f. Suppose z + 2j - 29 = 4j, -3z + 77 = 4j. Calculate the remainder when (f - -1 - 2)-106 is divided by z. 25 Suppose 235 = w + 2w - 4p, 2p - 85 = -w. Calculate the remainder when 1295 is divided by w. 80 Suppose -x - 1066 = -14x. Let n = x + 72. What is the remainder when n is divided by 32? 26 Let t = -220 + -91. Let n = t - -406. Calculate the remainder when n is divided by 11. 7 Calculate the remainder when (-1 + 913/7)/((-5)/(-70)) is divided by 121. 118 Suppose 23188 = -18573x + 18584x. Calculate the remainder when x is divided by 57. 56 Suppose 5u - 365h - 998 = -363h, u - 232 = 4h. Let y(w) = -w + 4. Calculate the remainder when u is divided by y(-5). 7 Let t(g) = -2g + 34. Let l(d) = -d + 17. Let o(z) = -15l(z) + 6t(z). What is the remainder when o(19) is divided by 4? 2 Calculate the remainder when 82 is divided by (6/(-30)34)/((-8)/60). 31 Suppose 31p = 25p + 900. Suppose -231 = -3a - p. What is the remainder when 348 is divided by a? 24 Calculate the remainder when (70/100 + (-9)/(-30))(1 - -996) is divided by 7. 3 Let w(u) = 6u3 - 3u*2 + 4u + 5. Let n be w(-3). Calculate the remainder when ((-9)/(-18))/((-2)/n) is divided by 12. 1 Let o be (-7 - -4)/(2/(-14)). What is the remainder when 6/o + 9 + 4015/35 is divided by 35? 19 Let a(c) = 23c - 689. What is the remainder when 515 is divided by a(32)? 45 Suppose -11x + 2132 = 1228 - 2671. Calculate the remainder when x is divided by 126. 73 Suppose z - 2s - 33 = 0, -2s = -z + 3z - 96. Suppose -zd = -47d + 112. What is the remainder when 102 is divided by d? 18 Suppose 3d = -6g + 7g + 1615, 2d + 8g - 1016 = 0. What is the remainder when 1086 is divided by d? 14 Suppose -5v + 67 + 2 = -4c, 0 = -5v + 2c + 67. Calculate the remainder when 4223 is divided by v. 11 Suppose -74q + 364 = -70q - 2c, 4q - 360 = 3c. What is the remainder when q is divided by 32? 29 Suppose -30p = -83p + 42p + 1441. Calculate the remainder when 382 is divided by p. 120 Let x = 105618 - 105516. Let l be (6/(-4))/(3/(-30)). Suppose 3g - 24 = l. Calculate the remainder when x is divided by g. 11 Let s(g) = -g3 - 10g*2 + 46g + 518. Calculate the remainder when 1857 is divided by s(-10). 1 Suppose 64h - 70707 = -47h. Calculate the remainder when h is divided by 129. 121 Suppose 5v - 54 = 2p + 31, -2p + 17 = v. Suppose 105 + 6 = 3t. Let z = t - 12. Calculate the remainder when z is divided by v. 8 Let l = -1 + 4. Let g(z) be the first derivative of 7z2/2 + 5z - 1274. Calculate the remainder when 127 is divided by g(l). 23 Suppose -5s - 3a = -88, 2a = -2s + 40 - 8. What is the remainder when 733 is divided by s? 13 Let n(g) = g*3 + 11g*2 + 10g + 148. Calculate the remainder when n(-7) is divided by 165. 109 Suppose 667s = 1466299 - 71602. Calculate the remainder when s is divided by 519. 15 Calculate the remainder when 1132 is divided by 3 + (-138)/(-21) + (-8)/14. 7 Let u(f) = 2f*3 + 12f*2 + 4f - 12. Let j be u(-5). Let b(x) = x*2 - 10x - 71. Calculate the remainder when 215 is divided by b(j). 69 Let o be 1122/(7 + -13) - (2 - -2). Let t = -161 - o. Let r(x) = x*2 - 4x - 10. Calculate the remainder when t is divided by r(7). 8 Let a(v) = 10v - 71. Let i be a(19). Let c = i - 107. Calculate the remainder when c is divided by 9. 3 Let h = -295 - -483. Let z = h + -176. Calculate the remainder when z is divided by ((-30)/18)/(1/(-3)). 2 Calculate the remainder when 339 is divided by ((-1)/14)/(5/(-4910)) - 203/1421. 59 Let u(z) = z2 - z - 1. Let c be u(-2). Calculate the remainder when 99 is divided by 1/((-10)/(-178)) + 1/c. 9 Suppose 0m + 8 = m. Let n(k) = -k*3 - 4k*2 - 5k - 5. Let u be n(-5). Suppose -u = 12v - 129. Calculate the remainder when m is divided by v. 1 Suppose -3b - 13 + 48 = x, -5x + 3b + 139 = 0. Let k(f) = 150f3 + f2 + 8f - 9. Let q be k(1). What is the remainder when x is divided by -3018/q-5? 11 Let f be (-7 + (-10)/(-8))-368. What is the remainder when (1 - (-26)/(-22)) + f/22 is divided by 87? 9 Let g = 531 - 538. Suppose -3n = 2b - 41, -4n - 34 = -2b - 0b. What is the remainder when b is divided by g1 + -20 + 38? 8 Let s be 0 - 1/(2/(-338)). Suppose 0 = 2y - 23 - s. What is the remainder when y is divided by 11? 8 Calculate the remainder when 682 is divided by (-3)/(-7) + (-9)/(-21) + 339/21. 2 What is the remainder when 14 is divided by 8/((-280)/(-21)) - (-546)/65? 5 Suppose 2x + 4l = 56 - 46, 5x - 30 = -5l. Suppose -xn = 1 - 85. Calculate the remainder when (-93)/(-2) + (-2)/(-4) is divided by n. 11 Let o(m) = m2 + 21m + 10. Let x(w) = w*2 - w + 5. Let p(j) = -o(j) + 4x(j). Calculate the remainder when 167 is divided by p(10). 47 Let m = 21058 + -20745. Calculate the remainder when m is divided by 3. 1 Let z = 406 - 402. Suppose -7a + 545 = -2a + 4q, -4a + zq + 400 = 0. What is the remainder when a is divided by 37? 31 Suppose 2y - 3n = 9, 4n + 0 = -5y + 11. Let i(u) = -107 - 100 + 208 + 4u. What is the remainder when 48 is divided by i(y)? 9 Calculate the remainder when 358 is divided by 289/2 - (8 - (-240)/(-32)). 70 Suppose -30 = -0r - 5r. Let a(l) = 2l2 - 11l - 2. Let d be a(r). Let m(s) = 2s2 + s + 2. What is the remainder when 149 is divided by m(d)? 35 Suppose -5i = -g + 91 - 73, -11 = -g - 2i. What is the remainder when 433 is divided by g? 4 Suppose 2o - 482 = -5i - 133, 2i = 2o + 134. Let j = i - 63. What is the remainder when 22 - ((-2 - 2) + 0) is divided by j? 2 Suppose -3a + 3u + 6 = -0, -12 = -4a + 2u. Suppose -4v - 2b = -82, -v = ab - 13 - 18. Calculate the remainder when 164 is divided by v. 12 Suppose 472f + 15204 = 486f. What is the remainder when f is divided by 3? 0 Let c be 3/(-9)(-9 + 6)82. Let w = c - -23. Suppose 4g - w = -5n + 2g, -5n - 3g = -105. What is the remainder when 61 is divided by n? 19 Let u be (-99)/(-27) + (-6)/9. Suppose -2q + 5m - 3m + 26 = 0, 3q + um = 15. What is the remainder when 93 is divided by q? 3 Suppose 0 = -6c + 298 - 94. Let o be (-29 + c)4/5. Suppose -d + 27 = -o. Calculate the remainder when 61 is divided by d. 30 Suppose 3b - k - 201 = 2k, 0 = 2k + 4. Let d = b - 3. Suppose 0 = 2x + 3z - d, 2z + 203 = 5x + 10. What is the remainder when x is divided by 20? 17 Let r = -6872 + 6969. What is the remainder when r is divided by 61? 36 Suppose k + 36 = 3k. Suppose 4i + 2i = -2274. Let l = 480 + i. Calculate the remainder when l is divided by k. 11 Let r(w) = -4w + 3. Suppose -35d = -2d - 297. Suppose 5p = -4a + 585, -3p + 388 = -da + 4a. What is the remainder when p is divided by r(-7)? 28 Let y be (111/6)/(3/6). Let p(l) = 2 + 95l2 + yl*2 - 5l*2 + 3l. Calculate the remainder when p(-1) is divided by 32. 30 Suppose 65 = -4l - 55. Let c be (l/(-135))/(1/9). Calculate the remainder when 5/20c142 is divided by 25. 21 Let g = -220 + 256. Calculate the remainder when 62 is divided by -17 + 15 - (-5)/(10/g). 14 Let i(x) = 24x3 - x2 + 4x + 1. Let n be i(2). Let f = 300 - n. Suppose 5c - f = 52. Calculate the remainder when 91 is divided by c. 29 Suppose -112f = 6f + 255 - 6745. Calculate the remainder when 2251 is divided by f. 51 Suppose -495 = 9a - 24a. Suppose 4c - s = 51, -as + 53 = 2c - 28s. Calculate the remainder when 54 is divided by c. 12 Calculate the remainder when ((-4)/(-6))/(138/288144) is divided by 49. 20 Let y be (-4672)/7 + 162/378. Let a = y - -731. What is the remainder when a is divided by 22? 20 Suppose 2t - 158 = -12. Suppose tw = 7w + 1122. Suppose 0 = -2g - z + 5 + 8, -4g + 21 = z. Calculate the remainder when w is divided by g. 1 Suppose 5o = 6o - 23. Let h = -45 - -58. Let w = h + o. Calculate the remainder when w is divided by 3. 0 Let y(k) = 6k + 83. Let h = -2388 - -2422. Calculate the remainder when y(20) is divided by h. 33 Let t(i) = 2i3 - 18i*2 - 9i - 4. Let d be t(11). Let l = -357 + d. What is the remainder when 25 is divided by l? 1 Let l = -11818 - -	{ "pile_set_name": "DM Mathematics" }
w + 12 = -5a for a. -4 Let w(o) = -o2 + 21o - 30. Let b be w(5). Suppose 5v + 4u = 35, v = 5u - b + 28. Solve -l - vl = -4 for l. 1 Let r(y) = -4y3 - y. Let i(t) be the second derivative of t4/12 - 10t3/3 - t2/2 + 2t. Let x be i(20). Let g be r(x). Solve -gj = -j + 12 for j. -3 Suppose -9 = b - 3y, 3y + 10 = 5y. Let u be b + ((-8)/(-28))/((-4)/(-238)). Solve -6t + 5 - u = 0 for t. -3 Suppose -4v - 10 = -4z + 10, -2v - 4 = 0. Suppose u = -t + 3 + 6, u - zt - 13 = 0. Solve -4g - u = -14g for g. 1 Suppose -4h = -3h + 38. Let p = 152 + -110. Let x = h + p. Solve -x = -4s + 5s for s. -4 Suppose 435 = 38c + 93. Solve -47a - c = -38a for a. -1 Suppose -892 = -19m - 59m + 1370. Solve 7n + mn = 36 for n. 1 Suppose 25 = 5d + 5s, 0 = 5d - 2d + 5s - 19. Let w = -12 + 20. Solve -dj = -j + w for j. -4 Let x be (-75)/(-50) + (2 - (-2)/(-4))/3. Solve 38 = xp - 21p for p. -2 Let x(b) = -4b + 13. Let c be x(0). Suppose -47 = -12s + c. Solve sj - 17 = 8 for j. 5 Let f = -30151 + 30231. Solve -fy + 22y = 174 for y. -3 Suppose 0 = -23v - 507 + 576. Suppose 0 = -4h + 3z + 14, 4z + 8 = -0z. Suppose vg = h + 10. Solve 6i = gi for i. 0 Suppose 168d - 152d = 298 + 2438. Solve -d = 794u - 813u for u. 9 Let y(r) = -2r2 - 36r + 13. Let i be y(-20). Let d = -63 - i. Solve -dk - 10 - 2 = 0 for k. -3 Let l be (69 + -69)(-4)/(-24). Solve 22g - 18g - 28 = l for g. 7 Let a = -2212 - -2228. Solve 0 = 8m + 40 + a for m. -7 Let r be (356/(-2))/(160/(-144)6/10). Solve 0 = -7x - r + 218 for x. -7 Let q be 639/36 - (-8)/(64/18). Let a be 6/(-2) - (-75)/15. Solve -3y = ay - q for y. 4 Suppose -2i = 8, 4a = 2i - 9 - 19. Let n(z) = -z*3 - 6z*2 + 27z + 3. Let p be n(a). Let d be 3 - 2 - 1-2. Solve dl = 18 - p for l. 5 Suppose -4r = -41 + 5. Let k be 2355/(-27) + 2/r. Let f = k + 92. Solve -f + 25 = -5u for u. -4 Let x = -88 - -111. Suppose 4w - q = 124, xw - 19w - 132 = -q. Solve -36k + wk = -12 for k. 3 Suppose 2 = -t, 2f + 4t - 171 = 133. Solve fg = 136g - 120 for g. -6 Let y be ((-24204)/9)/((-11)/((-297)/(-36))). Solve 12c = 2053 - y for c. 3 Let b be (54 - 54)8/(-16). Solve b = -29n + 18n + 11 for n. 1 Let x be (-8)/(-144)6 + 110/3. Suppose 90 = -0h - 3h. Let l = x + h. Solve 0 = -lv + 3v for v. 0 Let w(x) be the second derivative of -x*4/12 - 23x*3/6 + 14x*2 - 3x + 12. Let g be w(-21). Solve 0 = -6j - g + 40 for j. -5 Let u(o) be the second derivative of 4o*3/3 - 2o*2 + 23o. Let q be u(1). Solve -5m = -m - q for m. 1 Let s(f) = 79f*2 - 3f + 2. Let u be s(-1). Solve -u + 12 = -12c for c. 6 Let c(u) = -u3 - 17u*2 - u - 9. Let s be c(-17). Suppose 9t + s = 53. Solve -th = -7h + 10 for h. 5 Let o = -2272 + 3977. Suppose 0 = -oh + 1708h - 6. Solve -hc + 16 = 8 for c. 4 Let j(n) = -n3 - 4n*2 - 2n + 4. Let p be j(-3). Let v be 20/(7 - 2) - p. Solve -2a = -va for a. 0 Let x = -2272 - -2344. Solve 34y - x = 16y for y. 4 Let j be (57/(-6))/(4 + 27/(-6)). Suppose -jd = -39d + 60. Solve dv - 6 = 6v for v. -2 Let s be -7 - (-56)/4 - (-2 + 5). Solve -106 = -sh - 126 for h. -5 Let a = 6020 - 6020. Solve a = 4n + 3693 - 3665 for n. -7 Suppose -290u = -287u - 36 + 12. Solve ux + x - 9 = 0 for x. 1 Let j be (12 - -74) + ((-6)/2 - 0). Let d = j + -81. Solve 7 = 3s - d for s. 3 Suppose 85f + 73 = 498. Solve -fi = 26i + 31 for i. -1 Let b(t) = -t2 + 4t + 19. Let a be b(7). Let d be a/(-5)85/2. Solve -7s - d = 4 for s. -3 Let u = -5905 - -5912. Suppose -5p = -52 + 47. Solve 2r - p - u = 0 for r. 4 Let s = -753 + 755. Suppose 5r - 13 = -2a + 13, 0 = sa - 6. Solve -k - k = -rk for k. 0 Suppose 2w + o - 7 = 2o, 2o = -2w + 16. Suppose 0 = -11d + 31 + 2. Solve du = wu for u. 0 Let f be (-2 - -1 - -1)/(-1). Let s be (-5 + (-156)/(-28))/((-2)/(-7)). Solve v + s = -fv for v. -2 Suppose -3x + 48 = 3h, 3h - 10x - 60 = -7x. Let v be (10/h)/((-9)/(-81)). Solve 4i + i = -v for i. -1 Suppose m - 5 = 0, 0 = -10q + 5q - m + 55. Let r(g) = g*2 - 6g - 20. Let f be r(q). Let n be 1 - ((-5)/f - (-22)/(-8)). Solve 0s = ns + 20 for s. -5 Let u(t) = -2t2 + 63t - 36. Let w be u(27). Let r = -198 + w. Solve -4b = -rb - 15 for b. -3 Let q be (5 - 2)/(-4 + (-28)/(-8)). Let l be (-56)/q - (88/(-24) + 3). Suppose 19f = lf. Solve fg - 3 = g for g. -3 Let z(i) = -i2 + 19i - 35. Let r be z(9). Suppose 2d = 2f + 52, 4d + 3f = 42 + r. Solve 0 = 32l - 27l - d for l. 5 Let j be (-22)/(-8) + 33/(-44). Suppose -z - jz + 12 = 0. Suppose 12b = zb. Solve b = 4m + 1 + 3 for m. -1 Let k = -3818 + 3922. Solve 113y = ky - 18 for y. -2 Suppose -2u = 0, 30 - 135 = -z - 3u. Suppose 12s - z = 7s + 5l, -s - 4l = -1. Solve -12d + sd + 20 = 0 for d. -4 Let i(x) = -x*3 - 3x*2 + 21x + 22. Let d be i(-6). Let u be 3/(-15) + (-48)/(-15). Suppose -uo = 1 - 4. Solve dp + o + 3 = 0 for p. -1 Let c(y) = y*3 - 12y*2 + 5y - 58. Let f be (-10 - (-230)/35)/((-4)/14). Let s be c(f). Solve sv - 10 = -10 for v. 0 Let m(a) = -a + 1. Let t be m(-3). Let u be -87(2 - t)/6. Suppose -8s = -3s - o - u, 0 = o - 1. Solve 14 = 2v + s for v. 4 Let j = -207 + 260. Suppose 39 = r - 20. Let p = r - j. Solve -4h = -h + p for h. -2 Let l be (0/1 - 3)620/(-186). Let t be (2 - 0 - 2)/(l/5). Solve 0h - h - 1 = t for h. -1 Let y be (1 - 4/8)-4. Let i be 120/32 - (y + 14/8). Let k = -36 + 37. Solve -k - 11 = -im for m. 3 Let u be 2(1 - 2) - -2. Let r be (u - 0)/(-8 - -9). Solve -2v + 3v - 3 = r for v. 3 Let z(t) = -t + 13. Let r be z(10). Suppose h - 6 = 4g, -2h - 2g + 3 = -7g. Let x be h/(2 - (-23)/(-10)). Solve 8n = rn + x for n. 4 Let c be -34/30 - 7416/(-40). Suppose 0q - 4q + 148 = -5g, 0 = -5q - 5g + c. Let x = q - 26. Solve 2j - x = -3 for j. 4 Let m = -484 + 223. Let o = 265 + m. Let f = 6 + 5. Solve oy - f - 1 = 0 for y. 3 Suppose 7x + 4x + 62x = 11680. Solve xf - 153f = -28 for f. -4 Suppose -6 = -3b + 2u + 2u, -3u - 8 = -4b. Suppose -d = d - 4v - 10, 0 = 5d + 2v - 37. Suppose 4k - dk + 6 = 0. Solve kp = -bp + 8 for p. 2 Suppose -4b = -197 + 545. Let h be ((-4)/(-3))/((-29)/b). Solve -3v + h = -2v for v. 4 Let u be 5/(30/17)(-1 + 7). Let r be 18/(-15)(-4 + u/(-2)). Solve -5t + r = 25 for t. -2 Let u = -385 - -389. Suppose ul = 5p + 6, -4l - 19 = 4p - 43. Solve -lc = 22 - 2 for c. -5 Let o be (15/30)/(1/(-230)). Let g = o - -117. Suppose 0 = -2n, -2n = -4y - 3n + 4. Solve y + g = d for d. 3 Let p = 18716 - 18706. Solve -7s - p = -31 for s. 3 Let f(w) = -w*2 - 24w + 64. Let x be f(-23). Let c = 97 - x. Solve 3g = -c - 2 for g. -4 Suppose -34w - 3 = -2o - 33w, -2o + 4w = 12. Solve oq + 9q + 65 = 0 for q. -5 Let w be (-3 + (-52)/(-8))/(224/384). Solve -4j + 6j = w for j. 3 Let z = 1 + 0. Suppose -5v + z = -4l - 0l, -33 = -3l - 3v. Suppose 2a - 16t = -12t + 22, -5a = -2t - 23. Solve -l = -ad - 0 for d. 2 Suppose -5t - 152o + 155o + 3 = 0, t - 5 = 5o. Solve -2b - 175 + 179 = t for b. 2 Let a = -902 - -905. Suppose al - l - 6 = -3t, -5l + t - 2 = 0. Solve ly = 3y - 9 for y. 3 Let i(c) = -564c*2 - 3989c - 17. Let k be i(-7). Solve 114 = -232x + kx for x. 3 Let v(h) = -h*3 - 39h*2 + h + 51. Let q be v(-39). Solve qr = 43 + 17 for r. 5 Let z(v) = 43v - 760. Let i be z(18). Solve 0 = 16t - it - 8 for t. 4 Suppose 3c + 0 = -9. Let x be 7 - 2/(2/c). Let m(t) = -t*3 + 5t*2 - 4t + 1. Let y be m(2). Solve x = 5w - y for w. 3 Let w be (-63)/7(5 + 7780/(-12)). Solve 5776 = 7j + w for j. -2 Suppose -12h + 9 + 3 = 0. Suppose h = -r + 12. Solve 4 = -5m - r for m. -3 Let q be 0 + (-2)/(-8) - (-446)/(-1784). Solve q = x + 7x - 2x for x. 0 Suppose 3t = 0, d + 12 = -3t + 249. Let y = 281 - d. Solve 42r = yr + 6 for r. -3 Suppose -766 = 3l - 1135. Solve -lq + 125q - 14 = 0 for q. 7 Let r be (-192)/621/(-6). Let v = -76 + r. Let u = v + -33. Solve 2i + 2 = ui for i. 2 Let l(n) = 2n*2 + 2n + 8. Let f be l(-6). Let m = f - 68. Solve -4a - 7 + 3 = m for a. -1 Let p(w) = -44w - 300. Suppose 8z = -39 - 17. Let d be p(z). Solve -6l = -dl + 6 for l. 3 Let t(d) = d + 10. Let x be t(-6). Suppose 2h - 6 = -x. Suppose k + h = 3j - 2j, 3*j - 3 = k. S	{ "pile_set_name": "DM Mathematics" }
558, 1875633, 1875708, 1875783, 1875858, 1875933? 75i + 1875483 What is the n'th term of 146, 232, 308, 314, 190? -10n*3 + 55n*2 - 9n + 110 What is the l'th term of -92332, -184664, -277018, -369406, -461840? -2l3 + l2 - 92321l - 10 What is the a'th term of -5862155, -5862366, -5862589, -5862830, -5863095, -5863390, -5863721? -a*3 - 204a - 5861950 What is the o'th term of 9679, 77141, 260179, 616585, 1204151? 9632o3 - 4o*2 + 50o + 1 What is the o'th term of 11969, 10748, 9527? -1221o + 13190 What is the z'th term of -29106, -24916, -20726, -16536, -12346? 4190z - 33296 What is the m'th term of -8218297, -8218305, -8218313, -8218321? -8m - 8218289 What is the u'th term of -3832, -900, 2032, 4964, 7896, 10828? 2932u - 6764 What is the l'th term of -24839, -48044, -69609, -89534? 820l2 - 25665l + 6 What is the l'th term of 10320, 11307, 12294, 13281, 14268? 987l + 9333 What is the z'th term of 490292, 1961167, 4412628, 7844675, 12257308, 17650527, 24024332? 490293z*2 - 4z + 3 What is the y'th term of 1046377, 2092750, 3139123, 4185496? 1046373y + 4 What is the d'th term of -1785, -3564, -5295, -6984, -8637, -10260? -d3 + 30d*2 - 1862d + 48 What is the w'th term of 393689, 393700, 393713, 393728? w*2 + 8w + 393680 What is the r'th term of 71854, 143244, 214634, 286024, 357414, 428804? 71390r + 464 What is the n'th term of 142828, 142739, 142582, 142351, 142040, 141643, 141154, 140567? -n3 - 28n*2 + 2n + 142855 What is the v'th term of -665093, -1330196, -1995301, -2660408? -v*2 - 665100v + 8 What is the w'th term of 1431, 2848, 4211, 5520? -27w2 + 1498w - 40 What is the q'th term of 770, 3108, 7108, 12860, 20454? 15q3 + 741q*2 + 10q + 4 What is the p'th term of -648960, -648998, -649036? -38p - 648922 What is the f'th term of -15299, -34093, -52885, -71675? f2 - 18797f + 3497 What is the r'th term of -36179, -36106, -36029, -35948, -35863? 2r2 + 67r - 36248 What is the l'th term of 3532338, 3532337, 3532336, 3532335? -l + 3532339 What is the w'th term of 364, 1965, 5988, 13645, 26148? 202w3 - w2 + 190w - 27 What is the r'th term of 995227, 995201, 995153, 995071, 994943, 994757, 994501? -2r3 + r2 - 15r + 995243 What is the s'th term of -138361, -139107, -139853, -140599, -141345, -142091? -746s - 137615 What is the k'th term of -21846601, -21846606, -21846609, -21846604, -21846585? k3 - 5k*2 + 3k - 21846600 What is the h'th term of -1610, -2879, -3488, -3107, -1406, 1945, 7276? 55h3 - 1654h - 11 What is the w'th term of -2673, -11231, -25499, -45483, -71189, -102623? -w*3 - 2849w*2 - 4w + 181 What is the m'th term of -96971, -97595, -98219? -624m - 96347 What is the k'th term of 49253, 49256, 49263, 49274, 49289, 49308? 2k*2 - 3k + 49254 What is the j'th term of -2376, -4138, -5894, -7644? 3j2 - 1771j - 608 What is the g'th term of 964486, 1928794, 2893102? 964308g + 178 What is the r'th term of -9702, -9879, -10362, -11307, -12870? -26r*3 + 3r*2 - 4r - 9675 What is the f'th term of -4567, -3735, -2439, -679, 1545? 232f2 + 136f - 4935 What is the y'th term of 26106, 24889, 22872, 20061, 16462, 12081, 6924? y*3 - 406y*2 - 6y + 26517 What is the u'th term of -22751342, -45502676, -68254010? -22751334u - 8 What is the s'th term of -3316, -26718, -90234, -213922, -417840, -722046, -1146598, -1711554? -3343s3 + s2 - 4s + 30 What is the m'th term of 2698785, 2698779, 2698769, 2698755? -2m*2 + 2698787 What is the o'th term of -18587, -18478, -18295, -18038, -17707? 37o*2 - 2o - 18622 What is the w'th term of -3335, -9782, -16251, -22754, -29303, -35910, -42587? -2w3 + w2 - 6436w + 3102 What is the m'th term of -3317, -2990, -2907, -3062, -3449, -4062, -4895? m*3 - 128m*2 + 704m - 3894 What is the g'th term of -42110599, -42110598, -42110597, -42110596, -42110595? g - 42110600 What is the m'th term of 3109057, 3109041, 3109011, 3108967, 3108909, 3108837, 3108751? -7m2 + 5m + 3109059 What is the j'th term of 559569, 1119220, 1678871, 2238522, 2798173? 559651j - 82 What is the m'th term of 2673, 10960, 24863, 44382, 69517, 100268? 2808m*2 - 137m + 2 What is the w'th term of -7271, -7289, -7317, -7355, -7403, -7461, -7529? -5w2 - 3w - 7263 What is the v'th term of -9100, -18057, -26840, -35449, -43884, -52145? 87v2 - 9218v + 31 What is the t'th term of 12725, 10828, 8931, 7034, 5137, 3240? -1897t + 14622 What is the r'th term of 345277, 345049, 344821, 344593? -228r + 345505 What is the z'th term of 555968, 555676, 555384? -292z + 556260 What is the c'th term of 11852949, 11852947, 11852945, 11852943? -2c + 11852951 What is the u'th term of 1230, 5635, 12986, 23289, 36550, 52775, 71970, 94141? u*3 + 1467u*2 - 3u - 235 What is the f'th term of 231440, 464483, 697526, 930569, 1163612? 233043f - 1603 What is the p'th term of 700730, 700741, 700748, 700745, 700726, 700685, 700616? -p3 + 4p*2 + 6p + 700721 What is the i'th term of -33548, -134224, -302022, -536942, -838984? -33561i2 + 7i + 6 What is the l'th term of 12557, 12510, 12429, 12314, 12165? -17l2 + 4l + 12570 What is the q'th term of -1590, -1680, -1796, -1938, -2106, -2300, -2520? -13q2 - 51q - 1526 What is the y'th term of 18492566, 36985130, 55477696, 73970264, 92462834, 110955406, 129447980? y*2 + 18492561y + 4 What is the y'th term of 5642, 23146, 52306, 93122? 5828y2 + 20y - 206 What is the p'th term of 2010, 4072, 6134, 8196? 2062p - 52 What is the z'th term of 13379, 13360, 13343, 13328, 13315? z2 - 22z + 13400 What is the b'th term of 7127, 7144, 7167, 7196, 7231, 7272? 3b2 + 8b + 7116 What is the b'th term of -3720, -5346, -8056, -11850? -542b2 - 3178 What is the f'th term of -5788, -7263, -9706, -13105, -17448, -22723? 2f*3 - 496f2 - f - 5293 What is the w'th term of -1147, -6034, -14657, -27010, -43087, -62882, -86389? w3 - 1874w2 + 728w - 2 What is the s'th term of 4936235, 9872476, 14808711, 19744934, 24681139, 29617320, 34553471? -s*3 + 3s*2 + 4936239s - 6 What is the m'th term of -53313, -106629, -159961, -213309, -266673? -8m2 - 53292m - 13 What is the p'th term of 11506, 10897, 10288, 9679, 9070, 8461? -609p + 12115 What is the c'th term of 6407620, 12815239, 19222858? 6407619c + 1 What is the v'th term of -112504, -212474, -312442, -412408, -512372, -612334? v*2 - 99973v - 12532 What is the q'th term of 4751, 4745, 4829, 5003, 5267, 5621, 6065? 45q2 - 141q + 4847 What is the s'th term of -1027, -1353, -1709, -2089, -2487, -2897, -3313? s*3 - 21s*2 - 270s - 737 What is the g'th term of -5912, -23586, -52984, -94070, -146808? 6g3 - 5898g*2 - 22g + 2 What is the t'th term of 56, 858, 3522, 8978, 18156, 31986, 51398, 77322? 155t3 + t2 - 286t + 186 What is the l'th term of -35, 1027, 2085, 3139, 4189, 5235, 6277? -2l2 + 1068l - 1101 What is the y'th term of -40205, -41500, -43657, -46676, -50557, -55300? -431y2 - 2y - 39772 What is the j'th term of -33059229, -33059230, -33059231, -33059232? -j - 33059228 What is the c'th term of -4483, -18290, -41409, -73840? -4656c2 + 161c + 12 What is the p'th term of -2087, -6379, -10667, -14951, -19231, -23507, -27779? 2p2 - 4298p + 2209 What is the o'th term of 3079, 4661, 6243, 7825? 1582o + 1497 What is the c'th term of 1875601, 3751247, 5626893, 7502539, 9378185? 1875646c - 45 What is the m'th term of -2141, -8169, -18107, -31955, -49713, -71381, -96959? -1955m2 - 163m - 23 What is the o'th term of 4960, 15329, 32610, 56803, 87908, 125925, 170854? 3456o2 + o + 1503 What is the h'th term of -1861, 1542, 4943, 8342? -h2 + 3406h - 5266 What is the m'th term of -55740823, -55740820, -55740819, -55740820, -55740823, -55740828, -55740835? -m*2 + 6m - 55740828 What is the k'th term of -1181014, -1181033, -1181052, -1181071? -19k - 1180995 What is the z'th term of 1553185, 6212717, 13978597, 24850825, 38829401, 55914325, 76105597? 1553174z*2 + 10z + 1 What is the u'th term of 112730788, 112730787, 112730786, 112730785, 112730784? -u + 112730789 What is the b'th term of 2949, 14139, 32875, 59163, 93009, 134419, 183399, 239955? b*3 + 3767b*2 - 118b - 701 What is the l'th term of 80	{ "pile_set_name": "DM Mathematics" }
e -2p - 565 = -5z - 6p, -hp + 565 = 5z. Is z prime? True Let q be 27/5 - (-4)/(-10). Suppose 3f - 4v - 7 = 2f, -3f + qv = -7. Is 15/(-2 + 1)f prime? False Is 4/(((-4)/16)/(82/(-16))) a composite number? True Let t be 765/(-10). Let i = -10 - t. Is i a prime number? True Suppose 0k - 4s = 3k + 7, 0 = -3k + 3s + 21. Is k - (-1 + -105) - 3 composite? True Let b(a) = -406a3 + 4a*2 + 3a + 2. Is b(-1) a composite number? False Let x be ((-2)/(-2))/(1 + -2). Suppose -4f - 3j + 5 = -8f, 3j + 3 = 0. Is (-8)/f - -1 - x a composite number? True Let l = 157 - 111. Is l a prime number? False Suppose -9545 = -5t - 2o, 10o - 5o - 5746 = -3t. Is t prime? True Let y = 54 - -157. Is y composite? False Let g be ((-1)/(-3))/(3/27). Let m be 32/18 + (-2)/(-9). Suppose -5q + 3q = -2u + 58, gq = mu - 54. Is u composite? True Suppose -w = 5p + 196, 2w + 5p = -0w - 377. Is w(-1 - (0 - 0)) a composite number? False Let v = 299 + 198. Is v prime? False Suppose -4h + 7 = -9. Let o be (-230)/(-2) - (4 - h). Let k = -36 + o. Is k a prime number? True Let f(m) = 340m + 25. Is f(12) a composite number? True Let j(f) = 29f*3 - 3f*2 + 2f - 1. Is j(2) a prime number? True Let x(n) be the third derivative of n*5/6 + 4n*2. Is x(-1) a composite number? True Suppose n = -0n + 185. Is n composite? True Let z(n) = -n*3 - 6n*2 + 2n + 6. Suppose 0 = -4c - 36 + 12. Let r be z(c). Is (763/21)/((-2)/r) a composite number? False Suppose -5v + 4a - 201 + 674 = 0, 3v + 5a - 306 = 0. Is v a composite number? False Is 97 + (0 - 0)-1 prime? True Suppose -3f + 24 = -f. Let z be (-65 + 2)/(f/(-16)). Is z/(-9)(-6)/4 composite? True Let s(z) = 54z2 - z. Suppose 3i - 2 = o - 0o, -o = -5i + 4. Is s(i) composite? False Suppose 0c + 8 = 2c. Suppose 4r + 25 = cq - q, 0 = 3q - r - 22. Is q a prime number? True Let r(n) = -6n2 - 1. Let g be r(-5). Let y be (-2)/(-8) + 911/4. Let v = y + g. Is v a composite number? True Let b(y) = y3 - 4y2 + 2y + 3. Let p be b(3). Let r = 5 + p. Suppose 2o = rh - 8, 2o - 4o + h + 8 = 0. Is o prime? False Suppose -2x + 0x = -12. Suppose 0 = -q + xq - 295. Is q a composite number? False Let o(h) = -2h - 2. Let d be o(-2). Suppose 2m = -dz + 4, m = 4z + 4 - 2. Suppose z = -4n + n + 66. Is n a composite number? True Let g = 11 - -17. Let m = -17 + g. Is m a composite number? False Suppose 4v - 1268 = 2v. Is v a composite number? True Let u(b) = -b*3 + 8b*2 + 5b + 11. Let j be u(8). Suppose -2f + 91 + j = 0. Is f a composite number? False Let l = 0 + 0. Let o = 0 - l. Suppose 15 = 5x, om = m + 5x - 134. Is m a composite number? True Let x = -7 + 15. Let q = x + -2. Suppose 0 = 2t + 2o - 100, 0 = 4o - 2o + q. Is t a composite number? False Suppose -10 = -4i + 2. Suppose im - 4m + 335 = 0. Is m composite? True Suppose u = 22 - 1. Let a(x) = x3 - 8x*2 + 9x - 10. Let d be a(7). Suppose -w + 4c + 114 = dw, -c = w - u. Is w prime? False Suppose 0i - 3i + 13839 = 0. Is i a prime number? False Suppose 3 = -g + 4g. Let u(p) be the second derivative of 127p4/6 - p3/6 - 3p. Is u(g) a prime number? False Suppose 0v + 4v - 8 = 0. Let k(d) = -5 - 4d + d*2 + 0 - vd. Is k(8) composite? False Suppose -x - 1 = -3. Let s be 36(x + 10/4). Suppose 2q - 4m = 3q - s, 0 = q + 3m - 158. Is q prime? False Let c = 95 + 280. Let l = -244 + c. Is l a prime number? True Let o(k) be the first derivative of k2/2 + 14k + 3. Is o(11) a prime number? False Suppose -2y = 2 - 8. Let b be (-4)/(-6) - (-418)/y. Suppose 4g + 4 - b = 0. Is g a composite number? True Let a be (-4)/(-14) + 4681/7. Suppose 0 = 2k + a - 2167. Let t = -526 + k. Is t a prime number? True Suppose 0 = -g - g - 10. Let d(h) = 9h*2 + 2h - 4. Is d(g) composite? False Let o be (-2 + 14 + 1)-52. Let g be (o/(-2))/(-4 - -6). Let v = g - 110. Is v a prime number? True Suppose -4y = 2y - 7278. Is y composite? False Suppose -135 = 2v - 961. Is v prime? False Let k be 1(3 - (-3 + 1)). Suppose 0 = 5y - 2m - 1059, -3m - k - 1 = 0. Is y a composite number? False Suppose 0 = 5d - 212 - 273. Is d a prime number? True Let m(y) = 1889y + 8. Is m(1) a composite number? True Suppose -4o - 3 = -5o. Suppose 99 = g - 5d, -og + 203 + 24 = -d. Is g a composite number? True Let a(y) = -3y + 4. Let w(o) = -8o + 11. Let m(h) = 11a(h) - 4w(h). Let i be m(-2). Is (i/3)/((-2)/(-57)) a composite number? False Let v(y) = -y - 2. Let g be v(-5). Suppose 5t + go - 457 = 0, -t - 93 = -2t - o. Is t a composite number? False Suppose 2u = u + 2. Let j be (6/(-15))/(u/(-410)). Suppose 2v - j = 4x, v - 53 = -x - 0x. Is v composite? True Let g(n) = n3 - 2n*2 + 5n - 1. Suppose -5q + 3d = -26, 3q + q + 4d = 8. Is g(q) composite? True Suppose -5c = 4b - 400, 2b - b - 79 = -c. Let w(s) = s2. Let j be w(-1). Let o = c - j. Is o composite? False Let d be ((-8)/6)/((-8)/(-12)). Let p be (8/6)/(d/3). Is 109 + 0/(p + 4) prime? True Suppose -f = 2, 2f + 7 = 4i - 5. Suppose -2a + ik = a - 295, 0 = 4a - 2k - 392. Is a a prime number? True Suppose 19 = v + 2b, 2v - 56 = -b + 3b. Is 3 + -2 + v + -1 composite? True Let j(k) = -17k. Let c be j(-7). Suppose b - c + 22 = 0. Is b a composite number? False Is (-338)/(-4)2 + 0 prime? False Suppose 0 = -6k + k - p - 159, -2k = 3p + 61. Let a be (k/20)/(2/(-120)). Suppose -4f - 93 = -g, 3g = 4g - f - a. Is g a composite number? False Suppose 7 = 4d - 1. Suppose db = -b. Is (76/2)/(2 - b) prime? True Let g(u) = 5u - 31. Let o(w) = -w + 6. Let t(a) = -2g(a) - 11o(a). Let f be t(7). Is 46/f + 2/(-6) prime? False Suppose -i = 4g - 11, 0 = 5i - 5g - 2 - 3. Is -39(1 + i)/(-4) a composite number? True Suppose -3v - 6 = -4v. Suppose -3l - 12 = -vl. Suppose -3k + 4m + 287 = 0, -lk + 5m = -0k - 381. Is k composite? False Let v be ((-9)/3)/((-7)/343). Suppose q = v + 104. Is q prime? True Suppose -3j = -j + q - 2557, -2j = -5q - 2539. Is j prime? True Let t = 856 + -437. Is t a composite number? False Suppose 25 = -2v + 5q + 452, 0 = 5v + 4q - 1051. Is v prime? True Let z(b) = b3 + 13b*2 - 4b + 2. Let p be z(-8). Suppose h = -y + 346, 0 = -h - 2y + 3y + p. Suppose -h = -4u + 3i + 161, 3i - 124 = -u. Is u prime? True Let u = -48 - -23. Let r(f) = f3 + 6f*2 - 13f - 12. Let q be r(-8). Let y = u - q. Is y prime? True Suppose -p - 274 = 26. Let r = -185 - p. Is r a composite number? True Let d = -1726 - -2417. Is d prime? True Suppose 2f = 5s - s + 8, 0 = -3s - 3. Suppose 62 = -fi + 216. Is i prime? False Is -2(1115/(-10) + 0) composite? False Suppose c = -4c. Suppose 2d - 6 + 0 = c. Suppose -4i = -0i + x - 125, 0 = di + 2x - 95. Is i prime? True Is 3 + -4 - 542/(-1) composite? False Suppose 3t = t + 632. Suppose x + 3x = t. Suppose 4c - 61 - x = 0. Is c composite? True Suppose -2k = -6k + 1068. Is k a composite number? True Let v(q) = -q*3 - 5q*2 + 6q + 4. Let d be v(-6). Let f(o) = -o*2 + do - 7o + 37 + 3o. Is f(0) a prime number? True Let m be (-4)/(-10)15. Let d be 6/5(-40)/12. Is ((-14)/d)/(1/m) a prime number? True Let q be (0 + -2)3/2. Let d = -2 + 2. Is 0 + d/q + 86 composite? True Let q(w) be the second derivative of -w3/2 - w2/2 - w. Let h be q(1). Is (6/h)/(2/(-8)) a prime number? False Let b be (-3)/27-351. Let v = b + -12. Suppose 4i - i - vf = 115, 0 = 3i + 3f - 99. Is i composite? True Suppose -2b + b - j = -3, -5b - 4j + 15 = 0. Let d(i) = 117i - 4. Let k(x) = 58x - 2. Let r(g) = -3d(g) + 7k(g). Is r(b) prime? True Let o(w) be the second derivative of 0 + 5/2w*2 + 2w - 8/3w3. Is o(-5) a prime number? False Suppose -341 = -9r + 352. Is r composite? True Let c = 7 + -3. Suppose cq = -q - 25. Let u(w) = -2w*3 - 6w*2 + 4w + 5. Is u(q) a composite number? True Is -3 - (-10)/((-2)/(-2)) a prime number? True Let k be (1 - 2)(-5 - 0). Suppose 632 = km - 153. Is m composite? False Suppose -14 = -4q + 42. Is q prime? False Let h(w) = -w - 3. Let r be h(-6). Is 287/r + (-8)/12 prime? False Suppose -2r - 3r + 1913 = 4v, -8 = -4v. Is r composite? True Let w(n) = -214n3 + n2 + 3n + 1. Is w(-1) prime? False Let r = 1 + 1. Suppose 2c - 3*v = -4 - 5, -2	{ "pile_set_name": "DM Mathematics" }
*2 + 611k + 62. Give z(-9). 719 Let l(a) = -62a3 - 2a*2 - 9280a - 9279. Give l(-1). 61 Let b(t) = 2149t - 66648. Calculate b(31). -29 Let q(d) = -26d*3 + 11d*2 - 1165d - 5797. Calculate q(-5). 3553 Let z(t) = -6t2 - 746t + 507. Give z(-125). 7 Let x(h) = h*2 + 96h + 1877. Give x(-37). -306 Let t(j) = -5j3 + 2j*2 + 409j - 1988. Give t(5). -518 Let g(o) = -71o3 - 572o*2 + 137o + 1354. Determine g(-8). 2 Let h(d) = -7d2 + 93d + 17. Calculate h(14). -53 Let m(b) = -b*3 - 20b*2 + 12b + 408. Calculate m(-19). -181 Let u(w) = -158w2 - 1092w + 7. What is u(-7)? -91 Let f(n) = n*3 - 24n*2 + 47n - 552. Calculate f(23). 0 Let w(z) = -1210z + 377. What is w(2)? -2043 Let n(p) = -20789p + 186945. Determine n(9). -156 Let u(r) = -3r2 - 1053r + 8583. Give u(8). -33 Let n(l) = -l*2 + 73l + 5603. Calculate n(114). 929 Let y(c) = -383c - 52936. Determine y(-138). -82 Let s(x) = 3240x - 100467. Calculate s(31). -27 Let g(a) = a*3 - 1522a*2 - 86735a + 10. What is g(-55)? 10 Let k(x) = 47519x + 142520. Determine k(-3). -37 Let x(r) = -2r*3 - 597r*2 + 366r + 20042. Give x(-299). 9 Let o(h) = 13h3 - 5356h*2 + 112h - 46142. Calculate o(412). 2 Let h(u) = u*2 + 393u + 38354. Calculate h(-218). 204 Let v(l) = 3l2 - 1425l + 74729. What is v(60)? 29 Let n(g) = -49g - 780. Calculate n(-22). 298 Let n(o) = 156815o + 2038588. What is n(-13)? -7 Let y(t) = 8t3 + 4632t*2 + 307t + 177747. What is y(-579)? -6 Let g(t) = 2634t - 74358. Give g(29). 2028 Let q(d) = d2 - 50d - 831. Give q(-13). -12 Let i(s) = -s*3 - 343s*2 + 1460s + 25126. Give i(-347). 142 Let u(j) = j*3 - 103j*2 + 584j + 712. Determine u(97). 906 Let m(g) = g*3 + 23g*2 - 184g + 814. Calculate m(-30). 34 Let a(v) = -160335v - 160342. Calculate a(-1). -7 Let b(p) = 5p*2 - 23p - 319. What is b(14)? 339 Let k(m) = 33m2 - 5009m + 8847. Determine k(150). -3 Let s(x) = 10x3 + 27x*2 - 473x - 502. Calculate s(-1). -12 Let z(w) = 4249w - 42491. What is z(10)? -1 Let w(r) = -r2 - 449r + 10398. Calculate w(21). 528 Let i(h) = 6h2 - 3387h + 24268. Determine i(557). -797 Let c(y) = y*3 - 222y*2 + 685y - 102545. Give c(221). -1 Let r(h) = 42923h - 429230. Determine r(10). 0 Let v(l) = l2 - 37l - 407. Determine v(18). -749 Let f(a) = 82511a - 70464394. Give f(854). 0 Let x(w) = -6w*2 + 4020w - 12055. Give x(3). -49 Let u(h) = -h*3 + 45h*2 - 433h + 11017. What is u(41)? -12 Let p(m) = -m*3 - 237m*2 - 13977m - 886. Determine p(-127). 3 Let v(d) = 51d2 - 241d + 151. Calculate v(4). 3 Let w(v) = v*3 + 535v*2 + 30147v + 1404. Give w(-471). -9 Let l(n) = 2n3 + 82n*2 - 613n - 2. Calculate l(8). 1366 Let k(y) = y*3 + 49y*2 + 452y + 1251. Calculate k(-38). -41 Let n(k) = -2k3 + 211k*2 + 358k - 152. Calculate n(-2). -8 Let o(p) = 5875p - 5854. What is o(1)? 21 Let g(a) = 2a*2 + 746a + 69481. Calculate g(-180). 1 Let n(m) = -m*2 - 178m - 6829. Determine n(-44). -933 Let r(d) = 548d - 470. Calculate r(0). -470 Let m(y) = -3y*3 + 43y*2 + 149y - 205. Calculate m(17). 16 Let v(k) = 5k3 + 401k*2 + 70k - 792. Determine v(-80). 8 Let l(o) = -26505o + 477013. Give l(18). -77 Let v(k) = -k3 + 6k*2 + 660k - 5348. Give v(8). -196 Let q(i) = -i*2 + 2829i - 11277. Determine q(4). 23 Let i(n) = 17369n + 3699677. Calculate i(-213). 80 Let y(g) = -2g*2 + 15049g + 60232. Determine y(-4). 4 Let c(w) = -w*3 - 61w*2 - 237w - 14431. Calculate c(-61). 26 Let g(i) = 69019i + 138121. Give g(-2). 83 Let r(i) = 2i*3 + 100i*2 - 1208i - 469. What is r(-60)? 11 Let d(k) = -4609k - 1972711. Determine d(-428). -59 Let v(g) = 20088g + 1285643. Give v(-64). 11 Let w(r) = 11r2 + 1563r - 3023. Give w(-144). 1 Let f(w) = 4633w - 23263. Calculate f(5). -98 Let h(j) = -213j*2 + 1291j + 78. Determine h(6). 156 Let u(n) = -1635n - 45738. Give u(-28). 42 Let u(h) = 664688h - 19275944. Calculate u(29). 8 Let w(l) = 2l2 - 473l + 20682. Calculate w(58). -24 Let f(w) = 444w + 69. Give f(3). 1401 Let k(v) = -11v*3 - 208v*2 - 9v - 543. What is k(-19)? -11 Let l(a) = -3a2 + 556a - 7036. Determine l(172). -156 Let r(j) = -4j3 - 46j*2 + 326j - 187. What is r(6)? -751 Let p(q) = -q*3 - 1610q*2 - 901q + 1139178. What is p(-1609)? 6 Let t(n) = -17n2 - 2121n + 15040. Give t(7). -640 Let c(z) = 12z2 - 255z + 6. Give c(15). -1119 Let h(u) = -3u2 - 11699u + 46842. What is h(4)? -2 Let z(b) = -1830b - 64026. Determine z(-35). 24 Let a(d) = -7d*3 - 156d*2 - 35d + 204. Calculate a(-22). 6 Let l(a) = a*2 - 3525a - 247990. Give l(-69). -4 Let k(b) = 9039b - 189848. What is k(21)? -29 Let t(i) = i2 - 445i - 80431. Calculate t(-138). 23 Let d(n) = -5n2 - 1351n - 74379. What is d(-77)? 3 Let t(g) = 798g - 29763. What is t(38)? 561 Let s(w) = 28949w - 984280. What is s(34)? -14 Let o(v) = -589v + 1395. What is o(2)? 217 Let i(t) = 2t*3 + 204t*2 - 1292t + 407. Give i(-108). -25 Let q(x) = -1847x + 50345. Calculate q(26). 2323 Let v(q) = -43288q + 19652764. What is v(454)? 12 Let q(h) = 2569h + 7569. What is q(-3)? -138 Let x(v) = -80v*3 - 2v*2 + 14. What is x(2)? -634 Let w(z) = -46691z + 793753. Determine w(17). 6 Let w(h) = -463h + 67131. Determine w(145). -4 Let t(z) = 27063z + 49308799. Give t(-1822). 13 Let b(l) = -l*3 - 18l*2 - 106l - 718. Determine b(-14). -18 Let f(g) = -g*3 - 22g*2 + 178g + 208. Calculate f(-25). -2367 Let m(n) = 39356n - 26840779. What is m(682)? 13 Let v(o) = 9649o - 569553. Calculate v(59). -262 Let m(j) = -4j3 + 58j*2 + 10j + 39. Give m(15). -261 Let f(n) = -9n3 - 15n*2 - 3n - 6. Determine f(-2). 12 Let t(q) = -5q3 - 732q*2 + 4416q + 5. Determine t(6). -931 Let j(g) = -2g3 - 8g*2 - 31g + 14. Calculate j(-9). 1103 Let y(i) = 3i3 - 1925i*2 + 113985i - 191. What is y(66)? 7 Let m(y) = -475253y - 3326778. Give m(-7). -7 Let x(v) = -2v*2 - 2623v - 17980. What is x(-7)? 283 Let w(x) = -6x3 - 6x + 13. Determine w(3). -167 Let b(d) = d*2 - 92d + 963. Give b(80). 3 Let z(o) = -9o2 - 483o + 1004. Give z(-58). -1258 Let r(n) = -125n - 125. Calculate r(-10). 1125 Let m(y) = 112553y - 4277019. Give m(38). -5 Let o(x) = x*3 - 208x*2 - 1486x + 146. Calculate o(-7). 13 Let w(t) = -3732t - 10854. What is w(-3)? 342 Let v(c) = 3c*3 + 831c*2 + 4079c - 96. Determine v(-272). 176 Let t(i) = -4i2 - 270i + 5361. Determine t(-82). 605 Let n(b) = -b - 1015. Give n(74). -1089 Let m(q) = 20q - 382. Give m(18). -22 Let m(u) = -527u + 24862. Determine m(48). -434 Let n(s) = -840s + 29781. Calculate n(38). -2139 Let n(s) = 5s*2 + 76s - 538. Calculate n(7). 239 Let x(m) = -454m2 - 4513m + 20. Calculate x(-10). -250 Let m(x) = -2x3 - 12x*2 - 814x - 5694. Calculate m(-7). 102 Let r(u) = -u*2 - 400u - 27059. Determine r(-86). -55 Let c(l) = 9663l + 241405. Determine c(-25). -170 Let f(n) = -22327n + 446537. Give f(20). -3 Let i(a) = -932a + 7002. What is i(7)? 478 Let g(m) = -m3 + 246m*2 + 506m - 63991. What is g(247)? -18 Let v(f) = f*3 + 61f*2 + 438f - 38. Calculate v(-10). 682 Let s(g) = 3g2 + 70285g + 1544811. Determine s(-22). -7 Let q(g) = 8g - 2113. What is q(6)? -2065 Let k(x) = -x3 + 15x*2 + 85x - 612. Determine k(14). 774 Let g(c) = 78c2 + 5925c - 46. What is g(-76)? 182 Let t(a) = a*2 + 6142a - 12280. Determine t(2). 8 Let z(u) = -u*3 + 791u*2 + 3271u + 357. Calculate z(-4). -7 Let j(h) = -48769h + 341221. Determine j(7). -162 Let h(q) = 86853q - 955354. Calculate h(11). 29 Let f(y) = -3y2 + 135y - 526. Calculate f(4). -34 Let v(d) = -180995d - 904975. Calculate v(-5). 0 Let r(q) = 6q*2 - 5891q - 83642. Calculate r(-14). 8 Let t(u) = u*3 + 286u*2 - 10543u - 5100. Determine t(-319). 4 Let m(d) = -d*2 - 1268311d - 10. Give m(0). -10 Let b(j) = j*3 + 1152j*2 - 16333j - 10445. What is b(-1166)? 49 Let r(c) = -c*3 - 29c*2 + 101c - 2438. Determine r(-34). -92 Let a(o) = -6o3 + o2 - 58o - 2250. What is a(0)? -2250 Let f(u) = u*3 - 27u*2 - 190u + 6513. Give f(19). 15 Let m(k) = -126k + 4230. Determine m(28). 702 Let r(n) = -161n - 9874. Give r(-65). 591 Let l(k)	{ "pile_set_name": "DM Mathematics" }
ce ffg when three letters picked without replacement from {u: 1, f: 2, t: 4, g: 7}? 1/156 What is prob of sequence fwfw when four letters picked without replacement from {w: 7, f: 6, l: 2}? 1/26 Four letters picked without replacement from wqqqqwwqr. Give prob of sequence rqqq. 5/252 Two letters picked without replacement from ytglgeyleylgegggyfy. What is prob of sequence tf? 1/342 Three letters picked without replacement from zzrzzowozotarzooatot. What is prob of sequence ztw? 1/380 Calculate prob of sequence nnrd when four letters picked without replacement from {f: 1, d: 1, c: 3, r: 13, n: 2}. 13/58140 Two letters picked without replacement from {y: 6, l: 1, n: 1, u: 1, i: 2, f: 4}. Give prob of sequence yl. 1/35 Three letters picked without replacement from kkkkkbbkkk. Give prob of sequence kbb. 1/45 What is prob of sequence dd when two letters picked without replacement from {d: 15, r: 4}? 35/57 Two letters picked without replacement from llnlfflffffnlnffll. Give prob of sequence fn. 4/51 Three letters picked without replacement from {t: 2, m: 1, z: 2, s: 1}. Give prob of sequence ztm. 1/30 Four letters picked without replacement from ajjmrrjamhjjjrz. Give prob of sequence azra. 1/5460 Calculate prob of sequence so when two letters picked without replacement from {z: 3, s: 2, g: 3, o: 1, e: 10}. 1/171 What is prob of sequence my when two letters picked without replacement from mkvnyvgmg? 1/36 What is prob of sequence mz when two letters picked without replacement from {z: 7, m: 1}? 1/8 Calculate prob of sequence kkkk when four letters picked without replacement from {k: 7}. 1 Two letters picked without replacement from onoodnonondo. Give prob of sequence dn. 2/33 What is prob of sequence jjjm when four letters picked without replacement from mmjmmmmjmjmmjmmmmm? 7/1530 Two letters picked without replacement from {v: 2, i: 8, o: 1, e: 8, t: 1}. What is prob of sequence tv? 1/190 Three letters picked without replacement from iaaiaiaaaaaa. Give prob of sequence aii. 9/220 Calculate prob of sequence nodb when four letters picked without replacement from lndnqboq. 1/840 Calculate prob of sequence vv when two letters picked without replacement from {q: 4, v: 3, p: 2, y: 6}. 1/35 What is prob of sequence ae when two letters picked without replacement from {y: 4, e: 3, a: 5}? 5/44 Three letters picked without replacement from {f: 11, a: 3}. Give prob of sequence aaf. 11/364 Four letters picked without replacement from {r: 2, u: 2, l: 5, y: 9}. Give prob of sequence rurl. 1/3672 What is prob of sequence wp when two letters picked without replacement from {t: 3, p: 1, y: 2, w: 10}? 1/24 Two letters picked without replacement from {a: 3}. What is prob of sequence aa? 1 What is prob of sequence llll when four letters picked without replacement from llllllllll? 1 Two letters picked without replacement from dbdbbddddbdb. Give prob of sequence bb. 5/33 Four letters picked without replacement from tsssetttstssttstrr. Give prob of sequence ress. 7/6120 Two letters picked without replacement from {v: 1, m: 1, e: 4, s: 1, u: 1}. Give prob of sequence ms. 1/56 Calculate prob of sequence wfxm when four letters picked without replacement from smmmwkkwkmwwkxwwfxmx. 1/1292 Calculate prob of sequence gjj when three letters picked without replacement from gggggggjggggjggggg. 1/153 Three letters picked without replacement from {e: 1, d: 3, b: 3, u: 7, g: 5}. Give prob of sequence gbd. 5/646 What is prob of sequence zz when two letters picked without replacement from gkgkggzkkgkzg? 1/78 Calculate prob of sequence iim when three letters picked without replacement from {p: 6, m: 1, i: 3, c: 7}. 1/680 Calculate prob of sequence vn when two letters picked without replacement from innhavvk. 1/14 Two letters picked without replacement from {t: 4}. Give prob of sequence tt. 1 Two letters picked without replacement from bcccg. Give prob of sequence cb. 3/20 What is prob of sequence zoo when three letters picked without replacement from {o: 2, h: 1, z: 2, w: 1}? 1/30 What is prob of sequence rx when two letters picked without replacement from rsxskxrsxr? 1/10 Three letters picked without replacement from {z: 2, h: 1, m: 1, y: 2, k: 2}. Give prob of sequence yzy. 1/84 Three letters picked without replacement from xxhhxddh. What is prob of sequence ddx? 1/56 Calculate prob of sequence wwb when three letters picked without replacement from {s: 9, w: 2, b: 8}. 8/2907 Four letters picked without replacement from yeeeeeeeeeeeeee. What is prob of sequence eeey? 1/15 Two letters picked without replacement from {g: 1, w: 1, q: 2, v: 3}. Give prob of sequence vg. 1/14 Calculate prob of sequence cvvc when four letters picked without replacement from {v: 5, c: 7}. 7/99 Three letters picked without replacement from {v: 2, n: 1, r: 2, l: 4, i: 3, g: 3}. Give prob of sequence ggl. 4/455 Three letters picked without replacement from {s: 7}. Give prob of sequence sss. 1 Calculate prob of sequence rk when two letters picked without replacement from {g: 2, k: 1, r: 4, j: 4}. 2/55 Three letters picked without replacement from {u: 7, a: 2, h: 5, g: 4}. Give prob of sequence agg. 1/204 Calculate prob of sequence gnyn when four letters picked without replacement from {n: 2, g: 1, v: 4, y: 3}. 1/840 Three letters picked without replacement from {v: 1, b: 1, y: 5, f: 1, g: 1, r: 5}. Give prob of sequence fyy. 5/546 Four letters picked without replacement from yohuyqk. Give prob of sequence yhoy. 1/420 Four letters picked without replacement from eeeelbaw. What is prob of sequence albw? 1/1680 Calculate prob of sequence uu when two letters picked without replacement from {w: 1, u: 2}. 1/3 Calculate prob of sequence bb when two letters picked without replacement from {b: 4}. 1 Four letters picked without replacement from uuouuvuuvoouvo. Give prob of sequence vuov. 1/143 What is prob of sequence sg when two letters picked without replacement from sygy? 1/12 Four letters picked without replacement from {h: 5, y: 7, f: 2, t: 4}. Give prob of sequence httf. 1/612 What is prob of sequence oq when two letters picked without replacement from zoq? 1/6 Calculate prob of sequence soc when three letters picked without replacement from {z: 4, o: 6, c: 4, b: 1, s: 2}. 1/85 What is prob of sequence fkf when three letters picked without replacement from {f: 15, k: 3}? 35/272 Two letters picked without replacement from vvvvhhhvvhvvvvvvvv. What is prob of sequence vv? 91/153 What is prob of sequence kaca when four letters picked without replacement from {n: 4, k: 2, o: 2, c: 1, a: 3}? 1/990 Two letters picked without replacement from owooavwto. Give prob of sequence at. 1/72 What is prob of sequence ii when two letters picked without replacement from {i: 4, c: 3}? 2/7 Calculate prob of sequence gut when three letters picked without replacement from {t: 2, u: 4, k: 2, y: 1, x: 1, g: 2}. 2/165 Calculate prob of sequence phd when three letters picked without replacement from {p: 2, y: 5, h: 2, d: 2, x: 2}. 2/429 Two letters picked without replacement from grrvvqv. Give prob of sequence vv. 1/7 Two letters picked without replacement from {x: 1, y: 10, g: 2, i: 3}. Give prob of sequence ii. 1/40 Calculate prob of sequence nbnb when four letters picked without replacement from {b: 5, n: 4, f: 2}. 1/33 What is prob of sequence mmc when three letters picked without replacement from mcksm? 1/30 Three letters picked without replacement from {z: 9, p: 5}. Give prob of sequence zpz. 15/91 Four letters picked without replacement from {w: 1, i: 7, o: 2}. What is prob of sequence ooii? 1/60 What is prob of sequence jm when two letters picked without replacement from {d: 4, j: 4, z: 5, m: 6}? 4/57 Calculate prob of sequence zdp when three letters picked without replacement from {t: 1, d: 9, p: 1, z: 6}. 9/680 Calculate prob of sequence wzq when three letters picked without replacement from wzzqo. 1/30 What is prob of sequence uuue when four letters picked without replacement from {s: 1, q: 5, e: 11, u: 3}? 11/19380 Calculate prob of sequence jj when two letters picked without replacement from fedffdehffjejjjffdd. 2/57 What is prob of sequence ttmm when four letters picked without replacement from {j: 2, r: 2, g: 4, m: 1, t: 1, v:	{ "pile_set_name": "DM Mathematics" }
n 21557, 21513, 21469, 21425? 21381 What comes next: -3148, -3534, -3920, -4306, -4692? -5078 What is next in 296, 1331, 3312, 6455, 10976? 17091 What is the next term in 13652, 13656, 13664, 13676, 13692, 13712, 13736? 13764 What comes next: 49053, 49076, 49099, 49122, 49145? 49168 What is next in -10, -3, 26, 89, 198? 365 What is the next term in 10293, 10312, 10331, 10350, 10369, 10388? 10407 What is the next term in -1941, -3710, -5477, -7242? -9005 What is next in -1689, -3327, -4965, -6603, -8241? -9879 What is next in -2206, -2253, -2382, -2635, -3054, -3681, -4558? -5727 What is next in 389, 403, 417, 431, 445, 459? 473 What is next in 325, 703, 1081? 1459 What is next in -690, -697, -704? -711 What comes next: 939, 1820, 2701, 3582, 4463, 5344? 6225 What comes next: -1050903, -2101807, -3152711, -4203615? -5254519 What is next in -11225421, -11225423, -11225425? -11225427 What is next in -100676, -100664, -100652, -100640, -100628? -100616 What is next in 3530, 4548, 5568, 6590? 7614 What is the next term in 10831, 21595, 32359, 43123, 53887? 64651 What is next in -235, -932, -2095, -3724? -5819 What is the next term in 724, 799, 874, 949, 1024? 1099 What comes next: 373, 406, 441, 478, 517, 558? 601 What comes next: 661, 370, -417, -1946, -4463, -8214, -13445, -20402? -29331 What is the next term in 35, 124, 345, 764, 1447, 2460? 3869 What comes next: -543, -384, 123, 1176, 2973, 5712, 9591? 14808 What comes next: -1340, -2496, -3586, -4604, -5544, -6400? -7166 What is the next term in -140, -500, -1078, -1880, -2912, -4180, -5690? -7448 What comes next: 4267, 4276, 4285, 4294? 4303 What is next in 1555, 6174, 13873, 24652, 38511, 55450, 75469? 98568 What is next in -16138, -32269, -48410, -64567, -80746, -96953, -113194? -129475 What is next in 29592, 29533, 29434, 29295? 29116 What is the next term in -3758, -7458, -11148, -14822, -18474, -22098? -25688 What comes next: -3512, -3518, -3526, -3536? -3548 What is the next term in 1232, 5435, 12608, 22751, 35864? 51947 What is next in 505, 698, 1217, 2224, 3881? 6350 What comes next: -1735, -6394, -13977, -24484, -37915? -54270 What comes next: 10741, 10782, 10823, 10864, 10905, 10946? 10987 What is the next term in 87, 244, 461, 732, 1051? 1412 What is the next term in 17664, 17668, 17672? 17676 What is the next term in 50, -171, -392, -613, -834? -1055 What is next in 448019, 448017, 448015, 448013, 448011, 448009? 448007 What is the next term in 61686, 61687, 61688, 61689, 61690? 61691 What is the next term in 101701, 101667, 101611, 101533, 101433, 101311? 101167 What comes next: 52148, 52149, 52150, 52151? 52152 What comes next: -12, -94, -314, -744, -1456, -2522, -4014, -6004? -8564 What is the next term in -56, -159, -294, -455, -636, -831? -1034 What is next in 1887, 2382, 2877, 3372? 3867 What is next in 885, 1775, 2663, 3549? 4433 What comes next: 24301, 48603, 72901, 97195, 121485, 145771? 170053 What comes next: 65, 44, 23, 2, -19, -40? -61 What comes next: 1747, 1685, 1621, 1555, 1487? 1417 What is next in 1463805, 1463806, 1463815, 1463838, 1463881? 1463950 What is the next term in -2440, -9769, -21970, -39031, -60940, -87685, -119254? -155635 What is the next term in -26742, -53482, -80222, -106962? -133702 What is next in -14011, -28032, -42063, -56110, -70179? -84276 What is next in 32010, 31686, 31152, 30414, 29478, 28350? 27036 What is next in 122, 616, 1442, 2606, 4114, 5972? 8186 What is the next term in 111748, 111754, 111772, 111808, 111868, 111958, 112084? 112252 What is the next term in 3681, 3463, 3243, 3021, 2797, 2571, 2343? 2113 What comes next: 20, 21, -16, -121, -324, -655? -1144 What is next in -339, -1554, -3643, -6606, -10443, -15154, -20739? -27198 What comes next: 163, 160, 151, 136? 115 What is the next term in 291979, 291975, 291969, 291961, 291951, 291939? 291925 What is the next term in -85546, -85551, -85560, -85573, -85590, -85611, -85636? -85665 What is next in 117, 205, 299, 399, 505, 617? 735 What is next in 109, 108, 133, 190, 285, 424? 613 What comes next: 73, 203, 443, 847, 1469, 2363, 3583? 5183 What is next in 1116, 2669, 4222, 5775, 7328? 8881 What is next in 39, 92, 143, 186, 215? 224 What comes next: 32, 46, -60, -346, -872? -1698 What is next in 17101, 34202, 51305, 68410, 85517, 102626, 119737? 136850 What is next in 307, 469, 631, 793, 955, 1117? 1279 What is the next term in 1687, 1681, 1677, 1675, 1675, 1677, 1681? 1687 What is the next term in 302, 966, 1630? 2294 What is the next term in -107713, -215424, -323135? -430846 What is next in 2358, 3527, 4700, 5877? 7058 What comes next: 44, -68, -198, -352, -536, -756? -1018 What is the next term in -35075, -70149, -105223, -140297? -175371 What is next in -507, -524, -541? -558 What is next in -26, -207, -388, -569? -750 What is next in -45155, -45154, -45153, -45152, -45151? -45150 What is the next term in 1638, 3241, 4844, 6447, 8050? 9653 What comes next: -7223, -28883, -64953, -115409, -180227, -259383? -352853 What is next in -4227, -4207, -4173, -4125, -4063? -3987 What is the next term in 4, 3, 44, 139, 300, 539, 868, 1299? 1844 What is next in -1041, -8262, -27819, -65868, -128565, -222066, -352527? -526104 What comes next: -405, -441, -465, -471, -453, -405, -321, -195? -21 What is next in 175, 168, 149, 124, 99, 80, 73, 84? 119 What is the next term in -16752, -33553, -50354, -67155? -83956 What comes next: 12576, 25146, 37716, 50286, 62856? 75426 What is next in -37, -259, -819, -1873, -3577, -6087, -9559, -14149? -20013 What comes next: -12594, -12657, -12762, -12909, -13098, -13329? -13602 What is the next term in -6154, -12569, -18994, -25435, -31898, -38389, -44914? -51479 What comes next: 832, 717, 400, -221, -1248, -2783, -4928? -7785 What is next in 435, 899, 1363, 1827, 2291? 2755 What is next in -529, -966, -1403, -1840, -2277, -2714? -3151 What is the next term in 264448, 264447, 264446, 264445? 264444 What is next in -1704, -3426, -5124, -6786, -8400, -9954, -11436? -12834 What comes next: -386, -373, -356, -335, -310, -281, -248? -211 What is next in 76, 162, 240, 322, 420? 546 What comes next: -461, -2048, -4761, -8600, -13565, -19656? -26873 What comes next: 1617, 1663, 1713, 1767? 1825 What is next in 564, -425, -3116, -8361, -17012, -29921, -47940? -71921 What comes next: -170, -700, -1578, -2804, -4378, -6300, -8570? -11188 What is the next term in 221, 327, 525, 833, 1269? 1851 What comes next: -2489, -4966, -7443, -9920, -12397, -14874? -17351 What is next in -5443, -8032, -10633, -13252, -15895, -18568? -21277 What is the next term in -66429, -66432, -66435, -66438, -66441, -66444? -66447 What is the next term in -64963, -129933, -194903? -259873 What is the next term in -4, 43, 108, 185, 268, 351? 428 What comes next: 14131, 56566, 127291, 226306, 353611, 509206, 693091? 905266 What comes next: 23963, 47945, 71941, 95957, 119999, 144073? 168185 What comes next: 9643, 9619, 9579, 9523, 9451, 9363? 9259 What is next in 827, 1079, 1331? 1583 What is next in 254, 216, 170, 116, 54, -16, -94? -180 What is next in 13271, 106172, 358327, 849362, 1658903, 2866576, 4552007, 6794822? 9674647 What is next in 13247, 52991, 119245, 212021, 331331, 477187, 649601, 848585? 1074151 What is the next term in -116, -76, -28, 28, 92, 164, 244? 332 What is the next term in -4838, -8261, -11698, -15155, -18638, -22153, -25706, -29303? -32950 What is next in -6573, -13143, -19713, -26283, -32853, -39423? -45993 What is the next term in -325165, -325159, -325141, -325105, -325045, -324955, -324829? -324661 What is next in 2050, 8206, 18466, 32830, 51298, 73870, 100546? 131326 What is the next term in 1497, 12025, 40599, 96243, 187981, 324837? 515835 What is next in 3309, 2766, 2223, 1680, 1137? 594 What is the next term in 9388, 9363, 9320, 9259, 9180, 9083? 8968 What is next in -129, -148, -191, -270, -397, -584, -843, -1186? -1625 What is the next term in 1774, 2362, 2948, 3532, 4114, 4694, 5272? 5848 What is the next term in -151, -466, -949, -1594, -2395, -3346, -4441? -5674 What comes next: 70299, 140592, 210885? 281178 What comes next: 679, 2694, 6049, 10744? 16779 What comes next: 26, 2, -116, -382, -850, -1574? -2608 What is the next term in -168, -323, -476	{ "pile_set_name": "DM Mathematics" }
49 What are the prime factors of 15401535? 3, 5, 53, 19373 List the prime factors of 647064. 2, 3, 11, 19, 43 What are the prime factors of 1543980? 2, 3, 5, 25733 List the prime factors of 2923565. 5, 584713 List the prime factors of 12239252. 2, 17, 179989 What are the prime factors of 188705? 5, 11, 47, 73 List the prime factors of 169627. 169627 List the prime factors of 1582476. 2, 3, 7, 18839 List the prime factors of 1871209. 73, 25633 List the prime factors of 12314772. 2, 3, 342077 What are the prime factors of 3073851? 3, 11, 61, 509 What are the prime factors of 68094? 2, 3, 13, 97 List the prime factors of 689666. 2, 61, 5653 List the prime factors of 5551936. 2, 13, 6673 List the prime factors of 949338. 2, 3, 13, 4057 What are the prime factors of 184458? 2, 3, 71, 433 List the prime factors of 485564. 2, 19, 6389 List the prime factors of 346776. 2, 3, 14449 List the prime factors of 20776320. 2, 3, 5, 3607 What are the prime factors of 1935443? 1935443 List the prime factors of 334646. 2, 13, 61, 211 List the prime factors of 651748. 2, 162937 List the prime factors of 494193. 3, 7, 101, 233 List the prime factors of 450461. 11, 31, 1321 List the prime factors of 4994928. 2, 3, 34687 What are the prime factors of 9468377? 2731, 3467 List the prime factors of 1627611. 3, 542537 What are the prime factors of 895598? 2, 11, 40709 List the prime factors of 802472. 2, 11, 829 List the prime factors of 3356587. 13, 31, 8329 What are the prime factors of 7242? 2, 3, 17, 71 What are the prime factors of 2436593? 17, 143329 What are the prime factors of 140652? 2, 3, 3907 List the prime factors of 9116. 2, 43, 53 List the prime factors of 1185339. 3, 395113 What are the prime factors of 5429349? 3, 22343 List the prime factors of 156969. 3, 107, 163 What are the prime factors of 15769569? 3, 353, 14891 List the prime factors of 1374853. 41, 33533 List the prime factors of 307128. 2, 3, 67, 191 List the prime factors of 2628777. 3, 131, 6689 What are the prime factors of 12222000? 2, 3, 5, 7, 97 List the prime factors of 8512642. 2, 131, 32491 What are the prime factors of 1314412? 2, 11, 29873 List the prime factors of 20134. 2, 10067 List the prime factors of 4229903. 89, 47527 List the prime factors of 704421. 3, 23, 41, 83 List the prime factors of 16759503. 3, 761, 2447 What are the prime factors of 22532? 2, 43, 131 List the prime factors of 944527. 944527 What are the prime factors of 14938812? 2, 3, 7, 59281 What are the prime factors of 4566744? 2, 3, 7, 13, 17, 41 What are the prime factors of 2927492? 2, 29, 25237 List the prime factors of 79729. 13, 6133 What are the prime factors of 663937? 663937 List the prime factors of 1818262. 2, 19, 59, 811 What are the prime factors of 1075633? 13, 97, 853 List the prime factors of 68728. 2, 11, 71 List the prime factors of 2290268. 2, 572567 What are the prime factors of 498313? 19, 26227 List the prime factors of 13901505. 3, 5, 926767 List the prime factors of 3285413. 337, 9749 What are the prime factors of 423657? 3, 13, 17, 71 List the prime factors of 2063819. 2063819 What are the prime factors of 1790474? 2, 7, 17, 7523 List the prime factors of 296947. 7, 59, 719 List the prime factors of 6112545. 3, 5, 407503 List the prime factors of 342322. 2, 171161 List the prime factors of 42744. 2, 3, 13, 137 What are the prime factors of 200116? 2, 7, 1021 List the prime factors of 12991143. 3, 11, 393671 List the prime factors of 6334881. 3, 7, 31, 37, 263 List the prime factors of 313395. 3, 5, 17, 1229 List the prime factors of 458627. 13, 35279 What are the prime factors of 632179? 17, 41, 907 What are the prime factors of 147792? 2, 3, 3079 What are the prime factors of 9737691? 3, 3245897 What are the prime factors of 120264? 2, 3, 5011 What are the prime factors of 15390456? 2, 3, 19, 33751 List the prime factors of 3744073. 137, 27329 What are the prime factors of 1320625? 5, 2113 What are the prime factors of 1282813? 7, 183259 List the prime factors of 2260622. 2, 7, 13, 12421 What are the prime factors of 8453865? 3, 5, 7, 80513 List the prime factors of 6926284. 2, 1731571 What are the prime factors of 610246? 2, 7, 13, 479 What are the prime factors of 45309? 3, 11, 1373 List the prime factors of 1024756. 2, 256189 List the prime factors of 7733661. 3, 13, 59, 3361 List the prime factors of 1845785. 5, 311, 1187 List the prime factors of 27817827. 3, 9272609 List the prime factors of 173190. 2, 3, 5, 23, 251 What are the prime factors of 17212? 2, 13, 331 List the prime factors of 1312904. 2, 164113 What are the prime factors of 877253? 13, 67481 What are the prime factors of 191034? 2, 3, 10613 List the prime factors of 73432. 2, 67, 137 What are the prime factors of 503608? 2, 7, 17, 23 List the prime factors of 29286. 2, 3, 1627 List the prime factors of 10082878. 2, 13, 23, 1297 What are the prime factors of 21259119? 3, 7, 19, 53281 What are the prime factors of 678752? 2, 21211 List the prime factors of 17432556. 2, 3, 1452713 List the prime factors of 1743727. 1743727 What are the prime factors of 429104? 2, 13, 2063 List the prime factors of 1230884. 2, 127, 2423 List the prime factors of 5477402. 2, 7, 239, 1637 What are the prime factors of 430167? 3, 223, 643 What are the prime factors of 1967105? 5, 7, 31, 37 What are the prime factors of 2347042? 2, 1173521 List the prime factors of 113914. 2, 56957 What are the prime factors of 34785? 3, 5, 773 What are the prime factors of 20739176? 2, 29, 89393 List the prime factors of 2460342. 2, 3, 17, 24121 What are the prime factors of 5822470? 2, 5, 582247 List the prime factors of 162091. 162091 What are the prime factors of 155381? 155381 List the prime factors of 90220. 2, 5, 13, 347 List the prime factors of 231071. 269, 859 List the prime factors of 490670. 2, 5, 139, 353 List the prime factors of 4746653. 563, 8431 List the prime factors of 310071. 3, 103357 What are the prime factors of 824814? 2, 3, 45823 What are the prime factors of 9869872? 2, 53, 103, 113 What are the prime factors of 2269937? 53, 42829 What are the prime factors of 563950? 2, 5, 11279 What are the prime factors of 269353? 7, 23, 239 List the prime factors of 1360759. 1360759 What are the prime factors of 879603? 3, 293201 What are the prime factors of 2674832? 2, 167177 What are the prime factors of 185448? 2, 3, 7727 What are the prime factors of 892333? 13, 83, 827 List the prime factors of 532129. 13, 40933 What are the prime factors of 1201755? 3, 5, 113, 709 List the prime factors of 12598722. 2, 3, 37, 18917 List the prime factors of 206198. 2, 103099 What are the prime factors of 1445765? 5, 17, 73, 233 List the prime factors of 564644. 2, 141161 What are the prime factors of 221444? 2, 23, 29, 83 List the prime factors of 468979. 7, 17, 563 List the prime factors of 3487196. 2, 149, 5851 What are the prime factors of 755310? 2, 3, 5, 17, 1481 List the prime factors of 2574252. 2, 3, 23, 3109 What are the prime factors of 480550? 2, 5, 7, 1373 List the prime factors of 2126347. 19, 111913 What are the prime factors of 4890729? 3, 1630243 What are the prime factors of 5101356? 2, 3, 13, 53, 617 What are the prime factors of 231594? 2, 3, 11, 29 List the prime factors of 6344849. 7, 23, 39409 What are the prime factors of 147833? 7, 431 List the prime factors of 137915. 5, 27583 What are the prime factors of 457993? 43, 10651 List the prime factors of 4092031. 31, 132001 What are the prime factors of 625326? 2, 3, 13, 8017 List the prime factors of 1864554. 2, 3, 109, 2851 What are the prime factors of 2215958? 2, 23, 67, 719 What are the prime factors of 244919? 17, 14407 What are the prime factors of 85496? 2, 10687 List the prime factors of 565593. 3, 7, 23, 1171 What are the prime factors of 1357612? 2, 97, 3499 What are the prime factors of 326450? 2, 5, 6529 List the prime factors of 420590. 2, 5, 137, 307 List the prime factors of 4085892. 2, 3, 113497 List the prime factors of 9985119. 3, 3328373 What are the prime factors of 836406? 2, 3, 1721 List the prime factors of 2278833. 3, 17, 44683 What are the prime factors of 272586? 2, 3, 181, 251 What are the prime factors of 2757772? 2, 47, 14669 What are the prime factor	{ "pile_set_name": "DM Mathematics" }
385bb In base 16, what is -b5ebe7 + -1? -b5ebe8 In base 16, what is -6 - -2da5b69? 2da5b63 In base 9, what is 13355574 - 3? 13355571 In base 8, what is 44112 + -101731? -35617 In base 11, what is 163a79 - 180? 1638a9 In base 9, what is -2822232 - 476? -2822718 In base 8, what is 3672 - 33631? -27737 In base 8, what is -12110 - 23336? -35446 In base 16, what is -7e8 - -254? -594 In base 16, what is -ad500 - a0? -ad5a0 In base 14, what is -3d65c - -83? -3d5b9 In base 5, what is 20 - 124302130134? -124302130114 In base 4, what is 123230211100 + -11? 123230211023 In base 4, what is 3 + 1233330213301? 1233330213310 In base 13, what is -13a53 + 233? -13820 In base 11, what is 5689 - 15a91? -10403 In base 4, what is -3300232 + 31201? -3203031 In base 9, what is -231165 - 3684? -234860 In base 4, what is 12111033 - 11122? 12033311 In base 7, what is -1 - 3331656? -3331660 In base 9, what is -1355442 + 104? -1355337 In base 9, what is 150084810 - -2? 150084812 In base 8, what is 1274 + 13721? 15215 In base 4, what is 10 - 1201021320? -1201021310 In base 8, what is -4643075224 - 1? -4643075225 In base 12, what is 754b8 + -718? 749a0 In base 7, what is 213 + 4041113? 4041326 In base 3, what is 212002122012112120 + 10? 212002122012112200 In base 6, what is 1105133132 - -4? 1105133140 In base 9, what is 742276 - -216? 742503 In base 8, what is -453574 + 713? -452661 In base 10, what is 31922 + -412? 31510 In base 3, what is 11 - 11111202201? -11111202120 In base 15, what is -2e604 - b6e? -30273 In base 12, what is -19 + a477? a45a In base 8, what is -166721 - 635? -167556 In base 13, what is -1828c - -1b54? -16438 In base 7, what is 12643 + 12244? 25220 In base 5, what is 43040 + 1240? 44330 In base 4, what is -10 + -22113201330331? -22113201331001 In base 12, what is -7 + -2b5028? -2b5033 In base 8, what is -3 + -11635112? -11635115 In base 6, what is -4 + 11141411? 11141403 In base 5, what is 1103 + 20110344? 20112002 In base 2, what is -101 + 1001000101000000110101111000? 1001000101000000110101110011 In base 14, what is -202 + 3bd0? 39cc In base 14, what is -1dd48a + 1a0? -1dd2ca In base 7, what is 114 + -624440? -624323 In base 13, what is 4 - -3096813? 3096817 In base 8, what is 3 + 366356756? 366356761 In base 9, what is 4687175 + -25? 4687150 In base 5, what is -3233422324 - 10? -3233422334 In base 15, what is 174cea - -5a? 174d55 In base 6, what is -20420 + -2140421? -2201241 In base 11, what is 36 + 353911? 353947 In base 15, what is 1bbbc + 387? 1c054 In base 6, what is -5 + -32354053452? -32354053501 In base 16, what is -58e7aee - -5? -58e7ae9 In base 10, what is -473241626 - 2? -473241628 In base 12, what is 8224 + -486? 795a In base 10, what is -21586 + 728? -20858 In base 16, what is 2b5a3f7 + 1? 2b5a3f8 In base 10, what is 220 - 32202? -31982 In base 9, what is 2 - -13848513? 13848515 In base 2, what is -110 + 10010100011001101010? 10010100011001100100 In base 10, what is -124 - 148549? -148673 In base 13, what is -c688 - 6c0c? -16597 In base 5, what is -43401221 + 2? -43401214 In base 2, what is 10011101110110101100100 + 1001? 10011101110110101101101 In base 7, what is -553040665 - 1? -553040666 In base 3, what is -11 + -12002020110011? -12002020110022 In base 14, what is -21 + -d64962? -d64983 In base 6, what is -21001501 + -41? -21001542 In base 8, what is 5 - 512436036? -512436031 In base 13, what is -a7 - 138c4? -1399b In base 10, what is 841977 + -38? 841939 In base 13, what is 1b4360 + -a? 1b4353 In base 16, what is -2f8f54 - 1f? -2f8f73 In base 14, what is a7abc - 53? a7a69 In base 15, what is -1806a + 1767? -16803 In base 9, what is -330026 + -2374? -332411 In base 4, what is -2132123110 + -211? -2132123321 In base 8, what is -30 - -10253165? 10253135 In base 10, what is 5 - -2788669? 2788674 In base 6, what is 5 - -1545125024? 1545125033 In base 3, what is 212210200111001 - -2? 212210200111010 In base 13, what is 5 - 5306a3? -53069b In base 4, what is 1001321 - 22223? 313032 In base 14, what is 437459 - 10? 437449 In base 10, what is 326791 + -77? 326714 In base 14, what is 17 + 55d3d7? 55d410 In base 15, what is a1b702 - 8? a1b6e9 In base 8, what is 167522 - 315? 167205 In base 16, what is 663ccb7 - 5? 663ccb2 In base 7, what is -2450 + 1143123? 1140343 In base 14, what is 1 + 131974? 131975 In base 13, what is 295735 - 4? 295731 In base 2, what is 100100100110100100111 - 10011100? 100100100110010001011 In base 16, what is -49 + 165f70? 165f27 In base 13, what is -18278 - -494? -17ab4 In base 8, what is 2245 - -226665? 231132 In base 5, what is 11101223234 - 10? 11101223224 In base 3, what is 12 - -120210120221212? 120210120222001 In base 13, what is 837045 - 1? 837044 In base 15, what is -743ab - -260? -7414b In base 14, what is -2 - -10c73b22? 10c73b20 In base 16, what is 4 - 91ee9a? -91ee96 In base 8, what is 34 + 106050367? 106050423 In base 13, what is 10908 + -1b6? 10722 In base 13, what is 4 - 71739? -71735 In base 6, what is -13515 + -2100231? -2114150 In base 8, what is -133 + -1517726? -1520061 In base 11, what is -24 + -3721a2? -372216 In base 8, what is 12023750 + -5? 12023743 In base 14, what is -441 - -3c6? -59 In base 11, what is 0 - -44306168? 44306168 In base 6, what is 1000 - 455353? -454353 In base 5, what is -124302202231 + -2? -124302202233 In base 8, what is -1122207120 - -4? -1122207114 In base 5, what is 1 + 432403132? 432403133 In base 13, what is 84c4 + c43? 9437 In base 14, what is -89daa1b - -5? -89daa16 In base 16, what is -171967 + -27? -17198e In base 13, what is -34904 + 24? -348b0 In base 6, what is 1015 + 3432314? 3433333 In base 11, what is -5302167a - 4? -53021683 In base 6, what is 21313221 + -51? 21313130 In base 10, what is -59637 + -151? -59788 In base 15, what is -351d + -111cc? -146ea In base 11, what is -2948 + -3295? -6132 In base 13, what is -9 - 10027aa? -10027b6 In base 14, what is -9c658 + -c9? -9c743 In base 8, what is -3074101 - 142? -3074243 In base 9, what is -7384 - -36267? 27773 In base 5, what is -2212012 + 1013212? -1143300 In base 9, what is 1868001524 + -3? 1868001521 In base 14, what is -10ac8c - 547? -10b3d5 In base 14, what is -6800 - 16? -6816 In base 14, what is 1814b1a + -2? 1814b18 In base 14, what is 4 + 39ad37? 39ad3b In base 10, what is -46325 + -2375? -48700 In base 15, what is 25a6d + a8? 25b26 In base 7, what is 42463242551 + -3? 42463242545 In base 6, what is 4034 + 43422? 51500 In base 9, what is -5588578 + 271? -5588307 In base 7, what is 43 + 200453? 200526 In base 7, what is -11362624 + -10? -11362634 In base 6, what is 202 + -5054135? -5053533 In base 14, what is -8aa90c + -21? -8aa92d In base 14, what is b21 - -39cab? 3a9cc In base 11, what is 0 - -70a51a? 70a51a In base 12, what is 5776 - -b689? 15243 In base 13, what is -2 + -1709b9c4? -1709b9c6 In base 13, what is 18bc8b - -108? 18c096 In base 2, what is -101110010 + 1001001010110001010? 1001001010000011000 In base 5, what is -414104424 + 12? -414104412 In base 4, what is -13200120 - 2020223? -21221003 In base 14, what is 10482 - 28d? 101d3 In base 5, what is -30214122 + -1103? -30220230 In base 3, what is -2 - 102022101102? -102022101111 In base 4, what is 321 - -112032123? 112033110 In base 2, what is -100 + 11011100010111011000111? 11011100010111011000011 In base 4, what is -101331200 + 112302? -101212232 In base 2, what is -100 - -1111001011011? 1111001010111 In base 3, what is -210 - 2100021101010? -2100021101220 In base 12, what is -545a9 + 14? -54595 In base 5, what is -1330 + -4012433? -4014313 In base 3, what is 101001201111000001 + 1? 101001201111000002 In base 6, what is 51044344242 + -1? 51044344241 In base 16, what is 1dd3c96 - 4? 1dd3c92 In base 8, what is 1331 - 62062? -60531 In base 14, what is -1d03 + 48cd? 29ca In base 3, what is -10101 + -22210111222? -22210122100 In base 16, what is -b4baa - -3? -b4ba7 In base 5, what is -33204 - -2420143? 2331434 In base 16, what is b626a - f3? b6177 In base 9, what is -53711706 + -5? -53711712 In base 5, what is 1 - 113300444? -113300443 In base 4, what is 2322 + -11032331? -11030003 In base 10, what is 789 + -8318? -7529 In base 13, what is 5 - -712a543? 712a548 In base 11, what is -28648a8 - -8? -28648a0 In base 12, what is -6a33a + 363? -	{ "pile_set_name": "DM Mathematics" }
+ y. Solve -zo - t = -4, 0 = -2t + 1 - 5 for o. 3 Let x be 6/(((-16)/(-4))/(-8)). Let w be (8/12)/((-2)/x). Let n = -6 - -7. Solve 5h = wv - 8, 2v + n = -5 for h. -4 Suppose 4m + 4 - 5 = -p, -4p + 5m = 17. Let t be (4 + p)/(3/9). Let x be (10 - 6/2) + -3. Solve 2g - 2 = -tc, 2c = -3c - 3g + x for c. 2 Let n(o) = o3 - 4o*2 - 5o - 14. Suppose 6 = 3w - 12. Let a be n(w). Solve s = -5c + a - 4, -2c + 28 = 5s for s. 4 Let d(n) = -8n + 157. Let x be d(19). Solve 0 = -3h - 3t + 15, -3h + xh + 3t = 10 for h. 5 Suppose -6 = -63u + 246. Let w be (1 + 2)31. Let v be (-3 - 14/(-4))4. Solve 6o - 3o - 21 = -ua, a + vo - w = 0 for a. 3 Suppose 3z - 1 + 17 = 5o, -2z + 21 = 3o. Solve o = -3i + 7i - x, 20 = -2i - 4x for i. 0 Let c = -67 - -70. Solve -3f + 0r = 5r + 23, 9 = cf - 3r for f. -1 Let u = -194 - -196. Solve b - 2o + 8 + u = 0, 3b - 14 = -5o for b. -2 Suppose 5u - 80 = -2v, -36u - 64 = -40u + 2v. Solve -a = -4s + 18, 2a - s - u = -6s for a. -2 Suppose 0 = -2d - 0d, -i + 3 = -4d. Solve p + 10 = -4p, iz + 1 = 4p for z. -3 Suppose 6c = 4c, -4t - 2c + 8 = 0. Solve -34w + ty + 10 = -31w, 0 = w + 2y + 10 for w. 0 Let j = 33 - 27. Suppose 22 = 4b + j. Solve bp + 16 = -r, -3r - 4p - 15 = 1 for r. 0 Let x(i) = 11 + 43 + 0i - 7 + 2i. Let w be x(-22). Solve -4t = -wc + 28, -5t + 0t - 20 = 0 for c. 4 Suppose -h = -i + 2, 0h + 5h + 4 = 4i. Suppose -2t + o - 2 + i = 0, 0 = 4o. Solve -7 = -3q - ty + 8, -5q = 5y - 30 for q. 3 Let p be (-6)/(-5) - (-1 + 2) - 1599/(-205). Let y be -8((-1)/2 + 0). Solve -4v + 5 = -3, -4c + p = yv for c. 0 Let h be 85/7 + (-79)/553. Suppose -4r + 2 + 6 = 0. Solve 4w = w + 3i + 24, -rw + i = -h for w. 4 Suppose -17 = -2z - 3. Suppose 8 = -x + 15. Let s be (-2)/z - (-156)/x. Solve -4g + 3h = s, -9 - 9 = 3g - 3h for g. -4 Suppose -15o = -14o - 3. Solve -ob + 5b + 8 = n, 3b - 2n = -13 for b. -3 Let h = 32 - 28. Suppose 2a = 3f - 3, 3f + a - 3 = 6a. Let y be 16/(5 - f) + -2. Solve 26 = -0j - yj - 5c, 7 = 3j - hc for j. -3 Let x = -198 - -203. Solve 2a + 0l + 2 = -xl, 3a + 3l = -3 for a. -1 Let k(n) = n - 17. Let b(s) = s. Let u(i) = -5b(i) + k(i). Let w be u(-6). Solve -5z = 3v + 3, 2z - wz + 1 = -v for z. 0 Suppose 2n = 23 - 15. Solve -nx - 2s = -2, 3x + 15 + 11 = 4s for x. -2 Suppose 0b + 5b = 2l + 24, -l = 3b - 10. Suppose -q = -2h + 8, 0 = -bq - h + 18 - 5. Solve g + j = -3, -g + qj - j - 3 = 0 for g. -3 Suppose -y + 3z - 3 = -42, y = -z + 39. Let d = -19 + y. Suppose 4q + q = d. Solve -qo + 4 + 12 = 0, -5w - 4o = -31 for w. 3 Let i be (2(-1 + -3) + 8)/2. Solve i = 2z - 3y - 6, -2z - 2 = -5z + y for z. 0 Suppose -1 + 4 = -3n. Let g be n(-4 + -1 + 1). Let m be (-12)/9(g + -7). Solve x - 17 + 3 = mw, x - 8 = 2w for x. 2 Let u be (-7 - 122/(-18))-9. Solve o - 5w = 13 + u, 0 = -3o - 5w - 15 for o. 0 Let s = 248 + -240. Solve 0 = -o - u + 4 - s, -2u = 4o + 8 for o. 0 Let q = -3 + 4. Let i = q + 6. Let z = i + -5. Solve 4w - zt = 1 + 1, 2w - 4t - 10 = 0 for w. -1 Let u be 6/(-9)39 - -2. Let w be 18/4u/(-12). Solve 5z = -r + w, 10 = 3z - 2z - 2r for z. 2 Let w(z) = -8z3 - z2 - 2z - 1. Let b be w(-1). Suppose -b + 0 = -8i. Let m = 13 + -8. Solve -2p + f = p - i, f = -3p + m for p. 1 Let m(x) = -3x + 29. Let k be m(9). Suppose 0 = ko - 8o + 2o. Solve o = -2j - 0 - 6, -4w + 3j = -25 for w. 4 Suppose -5r = -3d + 85, 0 = -r + 3d - 8d - 17. Let j = r - -17. Solve z - 22 = 5p, -z + jz - 23 = 4p for z. -3 Let y(q) = -q*2 + 22q - 84. Let u be y(16). Solve -3r - 3s = -18, 2s - 6s - u = -5r for r. 4 Let h(k) = k + 10. Let i be (-3)/(-1 - 2)-6. Let z be h(i). Solve o + zl + 2 = 0, 6 + 4 = -5o - l for o. -2 Let z(a) = -3a2 + 6a + 17. Let w(v) = 2v2 - 3v - 9. Let l(i) = 5w(i) + 3z(i). Let s be l(-2). Solve -10 = -2x, sx = 4t + 13 + 19 for t. -3 Let l(w) = -w3 + 14w*2 + 2w - 19. Let x be l(14). Suppose xj - j - 32 = 0. Solve 2v = jb - 22, 1 = v - 4b + 18 for v. -5 Let h(v) = 2v3 - 7v*2 + 8v - 2. Let c be h(2). Solve -3n = 0, cn = s - 1 - 1 for s. 2 Suppose 65 = -5d - 2o - 0o, 5o - 30 = 5d. Let g = -5 - d. Solve -3x - g = -z, -5z + 0x = 2x + 4 for z. 0 Let l be 21/(-28)6(-4)/(-6). Let n be 2 - 3 - (l + -2). Solve -2i = k + n, -i - 2 = k + k for i. -2 Let g be 6/(1 - 3) + 10. Suppose -1 = -q + g. Let j = -6 + q. Solve 5u - 4z - j = 0, -3u + 5z - 4 = -0 for u. 2 Suppose -5t + 178 = 3l, -5 = 3t - 2l - 127. Suppose 2n + t = -0n. Let x = 24 + n. Solve z = -5b + 3b + x, 3z + 3 = 0 for b. 3 Suppose 0 = c + m - 3m + 4, -3m = -12. Let q(d) = -2d - 1. Let j be q(-2). Suppose -f = -jf + c. Solve -3u + 5u = -4w + 20, fu = 3w - 1 for u. 4 Suppose -3f + 147 - 132 = 0. Solve -20 = -3z - fl, 0l + 4 = 4l for z. 5 Suppose 0 = -183d + 189d. Solve -2a + 10 = d, 2a = -4h - 0a + 26 for h. 4 Let t be (7 - 13)(-1)/2. Suppose 4l - 63 = -tl. Solve -5p = -0p - 2a + l, p - 2a + 5 = 0 for p. -1 Suppose 0 = -4z + 2q + 14, -5 = 5q - 0. Solve -2i + n - 2 = -n, 4n - z = 3i for i. -1 Let x(i) = -i + 9. Let t be x(9). Solve -3z + 0j - 2j = -17, -4j + 4 = t for z. 5 Let l be 07/21(-1 + 0). Suppose -5g + 15 = -lg. Solve 4d - 29 = 5y, 3y - 2d + 20 = g for y. -5 Let m(v) = v*3 + 6v*2 + 5v + 3. Let f be m(-5). Suppose 3i - i = 0, 3l = 4i - f. Let n = l + 6. Solve 0 = a - n, -28 = -3h - 5a for h. 1 Suppose 87d + 88 = 109d. Solve x = 2h - 4 - 5, -4x = -dh + 28 for h. 2 Let z = 2483 - 2479. Solve -u + 2d - 6 = -2d, -z = -4u + 2d for u. 2 Suppose g = -l - 2g + 3, -3g = 2l - 3. Suppose -2s - 2s + 20 = l. Solve sk - 5q = 25, k + 5q + 0q - 5 = 0 for k. 5 Let u be 20/(-15)(-3 + 0). Let t(w) = -6w3 + 4w + 3. Let p be t(-1). Suppose -l + 3f + 11 = -p, -f = -l + 6. Solve 0 = -s + k, us + 2k = -l - 11 for s. -2 Suppose 2h = -5o + 10, -h = -3o + 3h + 6. Let f = 2 + 2. Suppose 2w + o = w - 2l, -4 = -4w + fl. Solve -2v - 2 = w, 0 = r + 2r - v + 11 for r. -4 Let o = 316 + -312. Solve -a - 3l = a + 1, 4l - o = -4a for a. 4 Let n(b) = -4b2 - 17b + 2. Let r(p) = -5p2 - 16p + 1. Let s(v) = 4n(v) - 3r(v). Let h be s(-20). Solve m + 5c = -2m + 5, -hc + 15 = m for m. -5 Suppose 2y + 3y = 0. Let l be (0 - 0)/((y - 4) + 6). Solve l = 2k, -k - 16 = 4p - 8p for p. 4 Suppose 22 = -13m + 61. Solve p - 5c = 23, 4 - 25 = -3p + mc for p. 3 Let v be (6/4)/(((-117)/18)/(-13)). Solve 5w + vp - 10 = -0w, -5w - 4p = -15 for w. -1 Let j be -9(-2 + (-21)/(-9)). Let p be (j/12)/(4/(-32)). Suppose -u - u + 2 = -a, pa + u - 6 = 0. Solve -4l - 8 = aw, 0 = 2w - 5l - 0l + 8 for w. -4 Suppose -71v + 70v + 1 = 0. Let i(n) = -n*3 + 4n*2 - 2n - 2. Let p be i(3). Let r = v - p. Solve t = r, -15 = 5o - 0t + t for o. -3 Let l(t) = -8t + 3. Let p be l(0). Solve 0 = -pc - 4b - 3, 16 = -2c + 3b - 3 for c. -5 Let l(c) = c - 3. Let f(p) = -p + 2. Let u(b) = 3f(b) + 4l(b). Let d be u(6). Suppose -20 = -4k - d. Solve 6i + 2z = i - 5, -2z = -5i - k for i. -1 Let d be (-4)/10 + 12852/630. Solve 2u - 3g = -0 + 15, -5u + d = -4g for u. 0 Suppose -5v + 20 = 0, -6m + 2m - 3v = -12. Suppose m = 2q - 4q + 28. Suppose 148r = 152r - 16. Solve -12 = -j + rh + 2, 5h = 3j - q for j. -2 Let r(k) = k3 + 3k*2 + 1. Suppose 2n + 4 = -0n. Let y be r(n). Solve yd + q + 15 = 0, q - 2q = -3d - 9 for d. -3 Suppose -9w = 724 - 751. Solve wp = -0n - 2n - 15, p + 5 = 0 for n. 0 Let d = 10 + -6. Let b be 92/(-12)-3 - d. Suppose 0 = -5p - v + b, p + v - 1 = 2. Solve po + 15 = 3a - 11, 0 = -3o - a - 13 for o. -5 Suppose 2u = -2q + 10 + 56, -2u = 4. Let a = q - 29. Solve -4 = -5b + a, -5x - 4b - 17 = 0 for x. -5 Suppose 0 = 4s - i + 5 - 2, -9 = -3i. Solve -4g - 10 - 2 = 2f, 4g - 4f = s for g. -2 Let h be (-22)/(-6) + 10/(-15). Let a = 3 - -9. Suppose 5t + 9 = -11, 3t + a = w. Solve w = -hl + 2b + b + 3, -12 = 3b for l. -3 Let f = -22 - -26. Let s be (12/(-24))/((-1)/f). Solve 1 = -l - 2c, -3l + l - s = -3c for l. -1 Let g be 10/7952/272. Solve 0 = -f - 4c - 0c - 9, -10 = g*c for f. -1 Let r(y) = y + 3. Let i be r(-3). Suppose	{ "pile_set_name": "DM Mathematics" }
p and 6. 3 Let n = -25 + 51. What is the highest common factor of 104 and n? 26 Let g be 80/(14/(-18) - -1). Suppose -3x = 2x - g. Suppose 21 = p + 3f, -p - 1 = f - 14. What is the highest common divisor of x and p? 9 Let g be (-90)/(-8) - (-30)/(-24). Calculate the greatest common factor of 90 and g. 10 Let m = 13 + 20. Calculate the greatest common divisor of 22 and m. 11 Let n(q) = q2. Let a(s) = -6s + 8. Let g(d) = -a(d) + 2n(d). Let i be g(-10). Let h = -11 - -23. What is the highest common divisor of h and i? 12 Suppose -25 - 59 = -6b. What is the greatest common factor of 126 and b? 14 Let k = -12 - -17. Suppose -3d + 40 = 2l, 5d + 2l - 56 = 4. Suppose -d = -kh, 2h + 2 = q - h. What is the highest common divisor of q and 2? 2 Suppose 0 = 4r - 71 + 19. Let f(g) = 5g*2 - g + 7. Let l be f(-4). What is the highest common factor of l and r? 13 Let x(t) = -6t + 4. Let h be x(-4). Let j(z) = -43z - 1. Let m be j(-1). Calculate the highest common factor of m and h. 14 Let z = -11 + 0. Let u = z - -26. Let x(y) = 12y*2 - 3y + 3. Let h be x(2). Calculate the greatest common factor of u and h. 15 Let m = -3 + 3. Suppose m = -4p - 0p. Suppose pz = -3z + 30. What is the highest common factor of z and 15? 5 Let s(x) = 159x - 5. Let a be s(5). Suppose 4m - 5w = 650, 3m + 2m + 5w = a. What is the highest common factor of m and 20? 20 Let p be (9/(-5))/(36/(-90)). Let t = -22 - -85. What is the greatest common factor of t and p? 9 Let j be (-1)/(2 - 2 - 1). Suppose -16 = -4n - 5q - j, n - 6 = q. Calculate the greatest common divisor of 5 and n. 5 Let w = -10 - -14. Let o(u) = 2 + 4u - w + 46u. Let t be o(2). Calculate the greatest common factor of t and 14. 14 Let c be 2/4 - (-546)/4. Suppose -c + 27 = -5u. Let d = -16 + u. What is the greatest common factor of 54 and d? 6 Let u = -12 - -70. Calculate the highest common factor of 638 and u. 58 Let b = 18 + -13. Let c = 20 + 17. Suppose 0 = k - c - 3. What is the greatest common divisor of k and b? 5 Let b = -72 + 48. Let x be (-9)/(-6)b/(-9). What is the highest common factor of x and 4? 4 Suppose 4j - 4 = -4x, -2j + 4j + 5x = -13. Suppose -t - 4m + 74 = 0, 4t - 2t - 5m - 83 = 0. Calculate the greatest common factor of t and j. 6 Suppose 0 = -2v + 2p + 24, -v - 4p + 22 = 2v. Calculate the highest common factor of 4 and v. 2 Let q = 161 + -113. What is the greatest common divisor of q and 6? 6 Let d be -9 + -2 + (3 - 0). Let f be d/(-44) + (-62)/(-22). Suppose 57 + 63 = 5k. Calculate the highest common divisor of k and f. 3 Suppose 2u = -1 + 7. Suppose -14 = -2m + c, -m + 0m - u = 2c. What is the highest common divisor of m and 2? 1 Suppose 0 = 2a - 4b - 10, -3a - b + 18 = -4b. Suppose 0 = 5g - 141 + 36. Let i = -14 + g. What is the greatest common factor of i and a? 7 Let s(r) = r*2 + 5r + 1. Let c be s(-7). Calculate the highest common divisor of c and 75. 15 Let g be (3 + -6)(-6)/9. Suppose 2z - 258 = -4x, -4x + gz + 95 + 167 = 0. Calculate the highest common divisor of x and 26. 13 Suppose 5a + 135 = 3j + 2j, 0 = -j + 4a + 18. Calculate the greatest common factor of 12 and j. 6 Suppose -5b - 3q = -38, b + 0b + 5q = 12. Suppose 0 = -7j + 3j + 112. Calculate the highest common divisor of j and b. 7 Let i(s) = s - 10. Let h be i(9). Let n be -15 + (h - (-1)/1). Let q = n + 22. Calculate the greatest common factor of q and 7. 7 Let x be (-4)/(-10)(-7 - -12). Suppose c - xc + 1 = 0. Let w = -3 - -4. What is the highest common factor of w and c? 1 Let s = -103 + 115. Calculate the greatest common factor of s and 36. 12 Let j(v) = -v2 - 6v + 6. Let u be j(-6). Let m be (-188)/(-4) - (0 + 1). Let d = -28 + m. Calculate the highest common factor of u and d. 6 Suppose 5o - 95 - 80 = 0. Let j be ((-6)/(-7))/(5/o). What is the highest common factor of 15 and j? 3 Suppose -3q - 5d - 30 = -140, 3q - 150 = 3d. Suppose -23 - 29 = 2f. Let o = 56 + f. Calculate the greatest common divisor of q and o. 15 Suppose -4t + 221 = 153. What is the highest common factor of 187 and t? 17 Suppose -2h = -4l - 0h + 466, 5l = 4h + 581. Suppose -3f + 44 = 5. Calculate the highest common factor of f and l. 13 Suppose 14 + 10 = 4x. Let p = -4 + x. Let k be -1 + (2 - -17) + 0. What is the greatest common factor of k and p? 2 Suppose -5s = -28 - 122. What is the greatest common factor of s and 45? 15 Suppose 0 = 3r - 3 - 3. Suppose -rx - 2x + 144 = 0. What is the greatest common divisor of 90 and x? 18 Let f = 17 + -11. Let q = -2 + f. Let m(k) = 3k2 + 6k + 4. Let c be m(-4). What is the highest common factor of q and c? 4 Suppose 2z + 2z - 8 = -s, 2s + 2z = -14. Let o be 295/30 + (-2)/s. What is the highest common divisor of 10 and o? 10 Let u(s) = -s*2 + 7s - 6. Let m be u(4). Suppose 0 = b + b - m. What is the highest common factor of 12 and b? 3 Suppose 37 = 5s - 23. Calculate the greatest common divisor of s and 12. 12 Let c be 1 + 13 + -1 + 0. Let z(h) = h2 - 4h - 23. Let i be z(-10). Calculate the greatest common factor of i and c. 13 Let q(n) = -n*3 + 2n2 + 9. Let b be q(0). What is the greatest common divisor of b and 45? 9 Let b(q) be the first derivative of -q4/4 - 11q3/3 - q2 - 10q + 3. Let k be b(-11). What is the highest common factor of k and 96? 12 Let a = 14 + -8. Suppose 4r + 6 = 6r. What is the greatest common divisor of r and a? 3 Let v(b) = -b*3 - 2b*2. Let y be v(-2). Suppose y = f + 4f - 120. Calculate the greatest common factor of f and 3. 3 Suppose 20 = 3f + 2t, 44 = 5f + 4t + 12. Let a = 18 - 28. Let p = 26 + a. Calculate the greatest common factor of f and p. 8 Let j(k) = -k*3 + 6k*2 - k - 4. Let l be j(5). What is the highest common divisor of 16 and l? 16 Suppose 7z - 20 = 2z. Let m be (0 - -2) + z + 0. What is the greatest common divisor of m and 42? 6 Let p(x) = x3 - x2 - 3. Let s be p(0). Let c = -4 + -2. Let r = s - c. What is the highest common factor of 33 and r? 3 Let g be (-1)/(-4) + (-33)/(-12). Let p be (g/3)/(1/14). What is the highest common factor of 42 and p? 14 Suppose 0 = 2m - 0m - 22. Let o = 4 - 6. Let v = o - -3. Calculate the greatest common divisor of v and m. 1 Suppose -2c + 24 = 3g, 3g - 8 = 2g - 3c. Let w(a) = -a*2 + 10a - 5. Let u be w(g). What is the highest common factor of 22 and u? 11 Let a = 23 + -12. Let t = 7 - 4. Suppose 2m = -5l + 57, -m + 34 = tl - 0m. What is the greatest common divisor of a and l? 11 Let m(t) = t*2 - 4t + 2. Let r be m(6). Suppose 2z - 26 - r = 0. Calculate the greatest common factor of z and 50. 10 Let h be 3 - (3/(-9))/(2/6). Calculate the highest common factor of h and 2. 2 Suppose -3x = 3, 13 = 6b - 2b - 5x. Suppose -5p = br - 48 - 22, 4r + 16 = 3p. Calculate the greatest common factor of 12 and p. 12 Suppose -6z = -0z - 420. Let y = z - -70. Calculate the highest common divisor of y and 56. 28 Suppose 0 = -4y - 6 + 2. Let v = y - 3. Let q(i) = i + 9. Let x be q(v). What is the greatest common divisor of x and 5? 5 Let y be (4/80)/2. Suppose yb - 81 = -3b. What is the greatest common divisor of 3 and b? 3 Let q(b) = -b3 + 8b*2 - 4b + 3. Let k be q(5). What is the greatest common factor of 87 and k? 29 Let g = -33 - -44. Calculate the greatest common divisor of 1 and g. 1 Suppose u + 5c = 22, 0 = u - 0c - 3c + 10. Suppose 3p = ud + 68, 3p + 2d = -d + 63. What is the highest common divisor of p and 11? 11 Let x(u) = -24u - 8. Let b be x(-5). Calculate the highest common divisor of b and 7. 7 Let l(m) = -m*3 - 7m*2 + 5m - 11. Let h be l(-8). What is the highest common divisor of 26 and h? 13 Suppose -h = 5t - 1579, 0 = 3t - 0h + 5h - 965. What is the greatest common factor of t and 35? 35 Let v(b) = -4b - 3. Let n be v(-2). Suppose q = -0y + 3y - 19, 0 = -4q + 8. Let a = y - 2. What is the greatest common factor of a and n? 5 Suppose 22 = o + 2. Let g = o - -4. What is the highest common factor of g and 12? 12 Suppose -3x = -0 - 6. Let b be (1 - -1)15/x. Calculate the highest common divisor of 15 and b. 15 Let x(i) = i*3 + 5i*2 + 2i + 5. Let q be x(-4). Calculate the greatest common divisor of 104 and q. 13 Suppose -2o = -3r - 2r + 55, -3r	{ "pile_set_name": "DM Mathematics" }
. Which is the closest to y? (a) q (b) 2 (c) r a Let p = -83.9 + 88. Let z = -4.1 + p. Let a(d) = -d*2 + d - 2. Let n be a(0). What is the nearest to n in 5, z, -0.1? -0.1 Let i = 0.35 + -0.05. Let j = -146.639 - 0.361. Let g = -146.6 - j. What is the nearest to 2/5 in g, i, -0.4? g Let g = -0.7 + 0.5. Let i = -13.35 - 0.15. Let p = i + 13. What is the closest to 1 in -3, p, g? g Let n = -298 - -301. What is the closest to 10 in n, 0, -1, -0.3? n Let q = 1.3 - 0.8. Suppose 0 = k - 0k - 64. Suppose -68j - 24 = -kj. What is the nearest to j in -2/15, q, 4? -2/15 Let v = -251/7 - -36. Let k = 1 - 0.9. Let j = -0.0113 - -4.0113. Which is the nearest to k? (a) v (b) 2 (c) j a Let i = 2.143 + -0.143. Which is the nearest to 0.1? (a) 7 (b) i (c) -4 b Let t = 7.918 - 8.318. Let f = 0.3 + -0.5. Which is the closest to f? (a) -0.02 (b) -1 (c) t a Suppose r + 61 = -4a - 24, -5a = 3r + 283. Let d = r - -907/9. What is the nearest to 1 in d, 5, -2/7? d Let u = 2846.8 - 2847. Let g be (1/(-2))/(1/8). What is the nearest to -1 in g, u, -3/7? -3/7 Let l = -5 + 8. Let w = 855 + -855.2. Which is the closest to l? (a) -1 (b) 4 (c) w b Let r = -0.06 - 0.24. Let n = -251 + 248. Which is the closest to -4/9? (a) r (b) 5 (c) n a Let w = 3.2 - -2.1. Let r = 5 - w. Let o be 2/12 - 75/18. Which is the closest to 1? (a) o (b) r (c) -1 b Let r = 2.38 - 0.38. Which is the closest to r? (a) 0.1 (b) 5 (c) 5/4 (d) 0.2 c Let v = -33 - 36. Let u = 74 + v. Let d = -2 + 2. Which is the closest to 0? (a) 2 (b) u (c) d c Let n = 24 - 15. Let f = 9 - n. Suppose -4w - 2w - 6 = f. What is the closest to w in -1, -3/8, 0.1? -1 Let i(v) = -2v*2 + 15v - 27. Let g be i(5). Which is the closest to g? (a) -0.24 (b) 5/2 (c) 4 (d) -2 d Let l(p) = -p*2 - 3p - 4. Let j be l(-3). Let h be -3 + (0 - j) + 39. Let g = -118/3 + h. Which is the nearest to 1? (a) -5 (b) g (c) -0.1 b Let z(j) = -2j2 - 9j - 6. Let g be z(-7). Let d = g + 286/7. Let y be 3/(-7) - (-432)/420 - 0. Which is the closest to -1? (a) d (b) 3 (c) y a Let l = -8.1 - -4.2. Let m = -3.5 - l. Let z = 14 + -10. Which is the nearest to 1? (a) 1/5 (b) m (c) z b Let y = 11 - 11. Let l = 151.1 - 151. What is the closest to y in l, -2, 5? l Let a = 32.2 + -34.2. What is the nearest to a in 2/13, 7, 5? 2/13 Let k = 0.07 + -16.07. Let q = k + 17. What is the nearest to 1 in -4, 0, q? q Let t = -401/4 - -100. Which is the closest to 0? (a) 0 (b) 27 (c) t (d) 4 a Let g = -2158 - -2158.1. Which is the closest to 4? (a) g (b) 0.3 (c) -0.3 (d) 2/5 d Let s = 180 - 24. Let r be (-24)/s + (-150)/39. Let l = -17.3 + 16. What is the closest to -1 in r, 3, l? l Let z(n) = n*2 + 50n + 402. Let q be z(-40). Which is the closest to -1/4? (a) -8/5 (b) -0.03 (c) q b Let v = 273/4 + -69. What is the closest to 2/7 in 0.5, -0.1, v, -2/9? 0.5 Let i = -0.02 - -0.42. Let w = -36.9 + 34.9. Let t be -2 - -3(-2)/(-3). What is the nearest to t in i, 2/9, w? 2/9 Let f be ((-7)/868)/((-22)/11). What is the closest to f in -5, -2, -1/2? -1/2 Let g = -1141 + 1142. Let k = 0.74 - -0.06. Let j = -0.3 + k. What is the nearest to g in 1, j, 5/3? 1 Let q = 421 + -7997/19. Let u = -552797/10580 - 2/2645. Let v = u - -52. What is the closest to 0.1 in 1, q, v? q Let g = 68 + -46. Let j = -21.64 + g. Let v = 0.04 + j. Which is the nearest to 2? (a) v (b) -0.3 (c) 0.5 c Let v = -4 + 4. Which is the closest to -0.1? (a) 5 (b) -4 (c) v c Suppose m + 1 = 0, 5m = 5y - 4y. Let v = 85 + -83. Let i = -2/67 - -73/201. Which is the closest to v? (a) -0.1 (b) i (c) y b Let l = 52/45 + -14/9. Let k = -7/24 - -1/24. Which is the closest to l? (a) k (b) -1 (c) 0 a Let l = 0.835 - 1.835. Which is the closest to l? (a) 3 (b) 4 (c) 2 c Let l = -7 + 11. Let m = l - -1. Suppose -121j + 4 - 4 = 12j. Which is the nearest to 0.1? (a) j (b) m (c) -4 a Let q = -77.815 + 0.615. Let o = -77 - q. What is the closest to -2/9 in 44, -2/15, o? -2/15 Let r = -13889/9 - -1543. Which is the nearest to -0.1? (a) r (b) 4 (c) -4/7 a Let h = 2008 + -1988. What is the nearest to 3/16 in -3, h, 0? 0 Let v = 375.831 - 373.6. Let s = v + -0.071. Let p = 0.16 - s. What is the nearest to -1 in p, 1, 0.5? p Let o be 13/(65/30)-1. Let z be (o6/(-45))/10. Which is the closest to 0.1? (a) z (b) -2/5 (c) 5 a Let p = -6.93 + 9.93. Which is the closest to -0.1? (a) p (b) 3.3 (c) 4 (d) 0.1 d Let m be 28/2015/54. Let l = m - -1/9. Which is the nearest to 4? (a) 0 (b) l (c) -4 b Let k = 365 - 365.1. What is the closest to k in 4, -1/2, -6? -1/2 Let t = -535 - -1591/3. Let w = -5 - t. Suppose 2i - 4i = 0. Which is the nearest to w? (a) i (b) -1/3 (c) 2 b Let s be 2/(-18)(-279)/31. What is the nearest to s in -0.1, 2, 8/19, -2/7? 8/19 Let s = -260 + 260.5. Which is the nearest to -3/2? (a) s (b) 3/8 (c) -3 c Let z = -113 + 117. Which is the closest to -1? (a) 7 (b) -0.3 (c) z b Suppose 3d + w - 9 + 4 = 0, 2w - 8 = -4d. Let u be (20/(-8))/((-25)/15). Let x = u - d. What is the nearest to 0 in x, 5, -2? x Suppose 0 = -4d + 3d + 4. Suppose 0 = p - dp - f - 7, -19 = 3p + 4f. Which is the nearest to 2? (a) p (b) 3 (c) -3 b Let y = 1035 - 67273/65. What is the closest to y in 3, 1, 0.5? 0.5 Let q = 28 - 27.4. Let s = -61 - -61. What is the closest to 0.1 in -2/11, q, s? s Let i(w) = 5 + 17w - w + w2 - 2. Let v = 23 + -39. Let h be i(v). What is the closest to 0 in -4, h, 0.2? 0.2 Let y = -1090 + 1075. Which is the closest to 2? (a) y (b) 0.4 (c) -2/15 (d) 2/3 d Let n = -494/7 - -71. Suppose m - 3 = 0, 3v - 3m - 88 = 5. Suppose -16i + 36 = -vi. Which is the nearest to 0? (a) i (b) n (c) 1/4 c Suppose -8q + 0q = -48. Suppose qn + 45 = -3n. Suppose y = -2f - 15 - 1, -5y - 35 = f. Which is the nearest to 0.1? (a) y (b) n (c) -1/4 c Let d = 0.12 + 0.08. What is the nearest to d in 0.1, 8, -1? 0.1 Let w = -197/174 + 28/29. What is the closest to 0.01 in -5, 5, w? w Let t = 1205/2772 + 3/308. Let j be -1 + 5 + (23 - 32). Let n = -4 + 7. Which is the nearest to n? (a) t (b) j (c) -1/5 a Let v be (35/(-25))/(16/(-10)). Let j = 3/4 - v. Let u = -11.2 + 11. Which is the closest to 2? (a) j (b) u (c) 1/7 c Let z = 8 - 4. Let n = 61.33 - 1.33. Let j = n - 62. What is the nearest to 0.1 in -4, j, z? j Let h be 2028/108 + -7 - 12. Let f = 1.7 + -2. What is the closest to f in -2, 0, h? h Let d = 0 + 0.06. Let q = -5.06 + d. Let n = -11/20 - -101/220. Which is the closest to 2/5? (a) q (b) n (c) 0.3 c Let d = 0.028 + -0.011. Let j = -0.183 - d. Which is the closest to 8? (a) j (b) 3 (c) -3 b Let w = -144/913 - 2/83. Let h = 28837/7 - 4111. Let o = h + -58/7. Which is the nearest to o? (a) -1/2 (b) w (c) -0.4 b Let i = -1030 - -1032. What is the closest to -3 in 3/2, 12, i, 5? 3/2 Let k = -150 + 754/5. Let t = -0.057 - 32.443. Let z = t + 33. Which is the closest to 0.1? (a) z (b) -0.2 (c) k b Let v = -659 + 949. Let o = v - 1444/5. Let w = 0.1 + -0.2. Which is the closest to -1/2? (a) o (b) w (c) 2 b Let x = -5.561 - -0.561. Which is the closest to x? (a) -9/7 (b) 0.5 (c) -5 c Let u = 25/27 + 11/27. Which is the nearest to 2/7? (a) u (b) -2 (c) -3 (d) 2 a Let w = 1116 + -1117. Which is the closest to w? (a) 11 (b) -5 (c) -1/5 c Let g = -0.01 + -0.39. Let k = -1.0034 - -0.0034. Let j be (-1)/5 - (-104)/320. What is the nearest to k in j, g, -2/7? g Let r = -393/77 - -37/7. Which is the nearest to -0.2? (a) r (b) 4 (c) -6 a Let x = -185 + 182.975. Let d = x - -0.025. Which is the closest to -0.3? (a) 1/4 (b) 5 (c) d a Let k(g) = -g2 + 4g - 4. Let q be k(0). Which is the nearest to -1/4? (a) -1/3 (b) -9 (c) q a Let d = 2013/5 + -403. Which is the nearest to -3? (a) -1/2 (b) d (c) -4 c Let n = -3.3 - -1.8. Let g = 4 - 2. Let q = n + g. What is the nearest to 2 in -1, q, 2/5? q Let t = -697216/45 - -15493. Let x = 1/45 + t. Suppose 2v + 5y - 2 = 0, 0v + y + 4 = 4v. Which is the closest to -1/3? (a) v (b) 1/3 (c) x c Let d be -13 + -1 + 132/30. Let n be (0 + (-4)/(-21))77/(-66). What is the closest to n in 0.1, -2, d? 0.1 Let z = -514 - -511. Which is the nearest to 0.03? (a) 3/7 (b) -2 (c) z a Let q = -283 - -565/2. Let l = -1.89 + 0.9. Le	{ "pile_set_name": "DM Mathematics" }
2 + a2) + (2 - a2 - 2)(29 - 29 + 3a))(0a - 2a - 3a). -15a4 Expand (3 - 2x - 3)(-3 + 2 + 3) - 6x - 12x + 2x - 3x + 3x + 2x. -18x Expand (2o2 - 5o2 + o2)(58 + 202o + 69 - 127). -404o3 Expand (-12149x + 188x3 + 12149x)(2x + 0x + 4x). 1128x4 Expand 3o + 0o - 2o - o + 3o + 0o + (0 - 2 + 4)(1 - 1 + o) - 5o + 10o + 0o. 10o Expand (2r - r - 3r)(3 - 5 - 1)(-7r + 5r + 48r*2 + 10r*2). 348r*3 - 12r*2 Expand -5d - d + 2d + (-1 - 1 + 1)(-6 - 9 + 0)(-2d + d - 2d). -49d Expand (1 - 1 - 1 + f - 3f + 0f + 4f - f + 2f + f + (-4f + 0f + 5f)(-2 + 5 - 2))(0 - 5 + 2)(0 - 2 - 3). 75f - 15 Expand 25t + 12t - 275t + (-3 + 0 + 5)(1 - 2 + 0)(-4 - 2 + 4)(4t - 1 + 1). -222t Expand 2x*4 + 13x*2 - 13x*2 - 7x - 2 - x*4 + 2x*4 + 0x*4 + (3x*2 - 2x2 + x2)(4x*2 - 4x2 - x2). x*4 - 7x - 2 Expand (3 + 0 - 1)(-3j + 18j - 12j)(-2j*3 - 4j*3 - 5j*3). -66j*4 Expand (39x - 14x2 - 39x)(49x + 3x - 29x). -322x3 Expand (-5t*2 + 4t*2 + 3 - 3t*2)(-3t + 3t - t) + (-2t + 2t - t*3)(-5 - 1 + 4). 6t3 - 3t Expand (i + 5i - 4i)(-2i - 2i - 4i). -16i2 Expand 0i3 - i3 + 2i3 + (-i2 + 2i*2 - 3i*2)(i - i + i) - 2i3 - 4i*3 + 5i*3 + (8i*2 + 9i*2 + 0i*2)(26 + 67 + 21)(i + 0i - 2i). -1940i3 Expand (l3 + 2l3 - 13l*4 + 2l2 - l3)(1 + 0 + 0)(2l + l - 4l). 13l5 - 2l*4 - 2l*3 Expand (-28x - 2x2 + 28x)(-2x - 2x + 5x + (-1 + 0 + 0)(-3x - 2x + 4x) + x + 2 - 2 + x - 5x - 3x). 8x3 Expand (23 + 37 + 171)(2 - 1 + 1)(0 - 2v*3 + 0) + 3v*2 - 3v2 + v3. -923v3 Expand (3d*4 - 2d*4 - 3d*4)(-19 + 1357d + 1349d - 2708d). 4d*5 + 38d*4 Expand (-139 - 167 + 27)(-3 + 3 - 2s3 + s3 + 2s3 - s3 - 5s3 + 3s*3 + 3s3 - s3 - 5s2 + 5s*2 + (-s + 1 - 1)(-4s2 + s2 + s2)). -558s*3 Expand 9v - 9v - 5v*5 + (2v + v - 5v)(4v4 - 4v*4 - 2v*4) + 676v*5 - 424v*5 - 441v*5. -190v*5 Expand (-1 + 0 - 114s + 119s)(17s2 - 10s*2 - 11s*2). -20s*3 + 4s*2 Expand (5h - 2h + 0h)(-1 + 0 - 1)(201 + 33 - 6). -1368h Expand (5v3 + 0 + 1 - v3)(-2 - v + 2)(-8v - 7 + 7). 32v*5 + 8v*2 Expand (18d*3 - 815d*2 + 815d*2)(-6d2 + 0d*2 + 3d*2) - 3d*5 + 6d5 + d5. -50d5 Expand (-f + 2f - 4f2 + 2f*2)(-181f + 181f + f*3). -2f5 + f4 Expand (0 + 0 - 2r)(2 + 0 + 6) + (1 - 2 - 6)(-r - 3r + 3r). -9r Expand (-44 - 46 - 112 - 111)(3 - 3 + 2i*3). -626i*3 Expand (-9029x*3 - 10x + 18049x3 - 9029x*3)(0 + 4 - 1). -27x3 - 30x Expand (-38c2 + 146c*2 + 28c*2 + 60c*2)(-c - 1 + 1)(5c - 4c - 2c). 196c4 Expand -44y*5 - 37y*4 + 37y*4 + (-2y2 - y2 + 4y2)(7y3 - 1 + 1) + 2y5 - y4 + y*4. -35y*5 Expand (13 + 3 - 4 + (-2 + 0 + 5)(1 - 2 + 2))(3 + 1 - 5)(-3 + 2 - 1)(-3 + 0 + 5 - 2w). -60w + 60 Expand (-5 + 1 - 5)(-1 + 4 - 2)(-7 + 7 - 2o*2)(3 - 1 + 0). 36o2 Expand (-3k + 3k - k3)(24 + 518 + 679 + 333). -1554k3 Expand (-13f - 117f - 52f)(0 + 0 + f). -182f*2 Expand (160t - 83t - 25 - 80t)((1 - 1 - 2t)(1 + 1 - 4) + 3 - 3 - 2t - t + 3t - 3t + 1). -3t2 - 28t - 25 Expand f - f*4 - f + 6f*4 - 3f*4 - 83f*4 + (4 + 1 - 3)(-f*4 - 2f*2 + 2f*2) + 7 + 4f4 - 7 - f4 + 1 - 1 + f - 2f4 - f. -82f*4 Expand (6x*4 + 6x*4 - 36x*4 + (3x + x - 3x)(0 - 2x3 + 0) + 2x*4 - 3x*4 + 2x*4 - 2x*2 - 2x*4 + 2x*2)(-3 + 2 - 1). 54x4 Expand (-725c + 386c + 195c)(-1 - 1 + c + 0)(-2 + 2 + 2)(-4 - 3 + 4). 864c*2 - 1728c Expand (-5f - 3f + 6f)(-f - 2f + 5f)(1639f*2 - 780f*2 - 1197f*2). 1352f4 Expand z5 + 0z5 - 2z*5 + (-2 - 2z*2 + 2)(-53z3 + 111z*3 + 27z*3) + (3z*2 - 6z2 + z2)(0z + z*3 + 0z) - 4z5 + 0z*5 + 2z*5. -175z*5 Expand (-5v*2 + 3v*2 + 0v*2)((1 + 0 + 2)(-5 + 1 + 2) + 17 + 48 - 10). -98v*2 Expand (31921 + 5j - 2j3 - 66j - 31926)(-j2 + 6j*2 - 3j*2). -4j*5 - 122j*3 - 10j2 Expand (w2 - 3w2 + 0w*2)(-59w3 - 62w*3 + 142w*3). -42w*5 Expand ((35q - 17q + 10q)(1 + 1 - 4) - q - q + q)(2q + 0q - q). -57q2 Expand (-4 + 2 + 0)(1 - 1 - w) - w - 2w + w + w - 2w + 0w + (-2 + 3 + 1)(-w + 0w - 2w). -7w Expand (2b + 4 - 4 + (0 + 1 + 1)(2b - 3 + 3) - 2 + 2 + b)(-6 + 6 - 3). -21b Expand -4h3 + h3 + 2h*3 + (4h2 - h2 - h*2)(0 + 0 + h) + 41h3 + 1166h*3 - 2645h*3. -1437h*3 Expand (-257c + 41c + 82c)(2 - 2 + 1). -134c Expand 2d + d - 5d + (0 + 3 - 4)(d + 2 - 2) + 0d - 4d + 3d + 13d - 188 - 36d + 21d + 0d + 2d - d. -5d - 188 Expand (3a2 - 3a*2 + 5a*3)(a - a + a) - 13a4 - 15a*4 + 4a*4. -19a*4 Expand (-o + o + 2o*2)(72o - 24o + 55o)(2o + 0o - o). 206o4 Expand (-2n + 2n - 2n)(2n + 0n + 0n) + 13 + 9n2 - 5n*2 - 3n*2 - 2n + n*2 + 2n*2 - 4n*2 + (-n + 2n - 3n)(n - 4n + 4n). -6n2 - 2n + 13 Expand -17a + 7a + 4a + 51 + 11a - 51 + (0 + 1 - 2)(-3a + 4a + 0a). 4a Expand (7y*4 + 2261 - 2261)(y + 3y - 5y) + 2y5 - 4y*3 + 4y*3. -5y5 Expand j2 + 5j2 - 4j*2 + (-3j + 4j + 2j)(0 - 6 + 5)(12j - 4j - 4j). -10j*2 Expand (9w*2 + 58 + 5w*4 - 58)(13w - 2w - 4w). 35w*5 + 63w*3 Expand (-2n + 2n - 5n - 5n + 4n - n + n + 0 + 0 + (0n - 3n + n)(-4 + 4 + 2) - 4n - 4n + 6n - 5 + n + 5)(n - n + n)(-3 + 1 + 3). -11n2 Expand (-3 + 0 + 2)(-5 - f + 5)(29 + 31 - 116)(1 - 1 + 1). -56f Expand (1 + 8q*2 + 3q*2 - 5q*2)(-25 + 6q + 25). 36q*3 + 6q Expand ((1 - 2 + 0)(-4 + 5 + 0) - 1 + 3 - 8)(-3s - s + 0s). 28s Expand (31 - 31 + 11x)((2x - 1 + 1)(x - 2x + 2x) + x2 - 9x*2 + 0x*2). -66x*3 Expand (2o*2 - o + o)(2o3 - 9o3 + o3 + (-4o + 2o + 0o)(11o2 - 30 + 30)). -56o*5 Expand (-160c*2 + 2c + 9c + 155c*2 + 2)(-5c + 5c + c*2). -5c*4 + 11c*3 + 2c2 Expand p4 - 2p3 + 2p3 + (1 - p2 - 1)(-p2 - p2 + p2) + 53p*4 + 52p*4 - 36p*4 + (-3p - 2p4 + 3p)(1 - 1 - 1). 73p*4 Expand (-2k + 0k - 3k + 2k)(-31 - 154 + 43). 426k Expand (k + 2k + 0k)(-377k - 375k + 776k + 2k*2). 6k*3 + 72k*2 Expand (-10l - 7l - 2l)(-23 + 7l + 23). -133l2 Expand (-1 + u2 - 3u*2 + 0)(-130u3 - 409u + 409u). 260u*5 + 130u*3 Expand (5 - 3 + 1)(-2k + k - k)(-4 + 2k2 + 4). -12k3 Expand (-v2 + 0v + 0v)(5v*2 + 0v + 0v) + (v2 - 3v*2 + 6v*2)(2v2 - 5v*2 + 4v2). -v4 Expand (-5g3 - g3 + 4g*3)(154g + 104g - 10g + 156g). -808g4 Expand (p2 + 3p*2 - 2p*2)(-p + p - 2p3) + 35p*5 - 76p*5 - 38p*5. -83p*5 Expand -b - 406b*4 + b - 69b*4 + (-2b + 2b - b)(0b3 + 0b*3 + 2b*3). -477b*4 Expand (-1 + 1 + 2w*2)(-19w - 7 - 4w + 4). -46w3 - 6w*2 Expand -18k - 3 + 3 - 13k - 10k + 4k + (-4k + 0k + 3k)(2 - 3 + 3). -39k Expand 7w2 - 24w*3 + 8w - 8w2 + 27w*3 + (4w*2 - 2w2 - w2)(3 - 3 - w) - w3 - 2w*2 + 2w*2 + 0w3 - w3 + 2w3. 2w3 - w2 + 8w Expand (-1 - 3 + 1)(-6 + 4 - 7)(-5h*2 + 5h*2 + 6h*2). 162h*2 Expand (-97 + 37 + 32)(3i - 3i - 3i5). 84i*5 Expand (0j - j + 0j)(-1 + 1 - j)(-17j - 37j + 8j). -46j3 Expand (-9 + 5 - 2)(0t + t - 2t)(-32 - 147 + 74)(2 + 1 - 4). 630t Expand -2q3 - q3 + 2q3 + (293q - 280q + 11q*2 - 4q*2)(q + 5q - 5q). 6q3 + 13q*2 Expand (-2w - 1 + 1)(6w - 350 - w + 375). -10w2 - 50w Expand (-1 + 0 + 4)(-2w*2 + 2w2 + w2) - 6w + 2w + w*2 - 2w*2. 2w*2 - 4w Expand (2z2 - z2 + 3z*2)(2z2 - 2z*2 + 2z2) - z4 + 17z4 + 20z*4 + 4z4 - z4 + 0z4 + (2z*4 + 0z*2 + 0z*2)(-2 + 1 + 2). 49z4 Expand (-l + 6l - 3l)(89l3 + 93l*3 + 76l*3). 516l*4 Expand (-2p*3 - 3p*3 + 6p*3)(167 - 283 - 891 + 134 - 1069). -1942p3 Expand (1 + 164v + 1 - 167v)(-v + 5v3 + v). -15v*4 + 10v*3 Expand (-4 + 4 - 2b)(6b - 3b - 2b) + 0b2 - 2b*2 + 3b*2 - 2 + 2 - 2b*2 + 193 + 2331b*2 - 2329b*2 + 0b + 2b. -b2 + 2b + 193 Expand 2n3 - 6n*3 + 2n*	{ "pile_set_name": "DM Mathematics" }
- 7 + 7 + 198d. -64d Collect the terms in -3147 + 47n + 3146 - 33n. 14n - 1 Collect the terms in -12x*2 - 25x*2 + 37x*2 - 20x*2. -20x*2 Collect the terms in 8806976 + g - 8806976 - g + 8g*2. 8g*2 Collect the terms in s - 115739 + 115739. s Collect the terms in 11085g*3 - 2g - 22167g3 + 11086g*3. 4g*3 - 2g Collect the terms in 0c - 9c + 9c - 71c. -71c Collect the terms in -186f*3 - 222f*3 + 688f*3 + 779f*3. 1059f*3 Collect the terms in -4z - 6z + 17z - 22z + 13z. -2z Collect the terms in -2k*2 - 28188k - 7k2 - 28183k + 56371k. -9k*2 Collect the terms in -373p - 12p3 + 11p*3 + 2p*2 - 802p. -p*3 + 2p*2 - 1175p Collect the terms in -74692x - 74688x + 224067x - 74684x. 3x Collect the terms in -97u - 309u - 104u. -510u Collect the terms in 3m*2 + 23m*3 - 10m*2 + 35m*3 - 6m*2. 58m*3 - 13m*2 Collect the terms in 21j*3 - 88j*3 + 82 + 2j - 149 + 67. -67j3 + 2j Collect the terms in 2834i + 2826i - 6i3 - 5660i. -6i3 Collect the terms in 41n - 15n2 + 6n*2 + 4n*2. -5n*2 + 41n Collect the terms in -26t3 + 617t - 1238t + 621t + 20t3. -6t*3 Collect the terms in 23s*2 - 188s*2 + 117s*2 + 33s*2. -15s*2 Collect the terms in 1 - 1 - 15c - 87c + 139c - 19c. 18c Collect the terms in 43d3 + 20d*3 + 20d*3. 83d*3 Collect the terms in -3924h - 8h3 - 3830h + 7754h - 1. -8h*3 - 1 Collect the terms in -108r + 46r + 55r + 12r. 5r Collect the terms in -1074 - 11b2 - 1042 + 2116. -11b*2 Collect the terms in j + 25590 - 3j - 51241 + 25651. -2j Collect the terms in -5255x*3 + 2542x*3 + 2708x*3. -5x*3 Collect the terms in -13567x - 4 + 4 + 2082x. -11485x Collect the terms in -1098k2 + 2195k*2 - 3267k*3 - 1097k*2. -3267k*3 Collect the terms in -346y + 146y + 201y. y Collect the terms in -59v - 64v - 15v - 40v. -178v Collect the terms in -17 + 53p - 9 - 25p + 26p. 54p - 26 Collect the terms in 18791h*3 + 1 - 18808h*3 - 1. -17h*3 Collect the terms in 75k - 256k + 109k + 104k. 32k Collect the terms in 5 - 355m3 - 2 - 3 + 359m*3. 4m*3 Collect the terms in 1 + 177908d + 177904d - 355813d - 1. -d Collect the terms in 30j2 + 46j*2 + 31j*2 + 37j*2 + 46j*2 - 155j*2. 35j*2 Collect the terms in 99y*3 + 89y*3 - 46y*3 + 66y*3. 208y*3 Collect the terms in -208q + 16q - 262q + 12q + 2q*2. 2q*2 - 442q Collect the terms in 44n3 - 312n + 153n + 159n. 44n3 Collect the terms in 74426w - 2w2 - 74426w + 41. -2w2 + 41 Collect the terms in 1 + 7965654f*2 - 7965538f*2 - 1. 116f*2 Collect the terms in -210p*2 + 963p*2 - 173p*2 + 1270p*2. 1850p*2 Collect the terms in -9742g - 9747g + 19489g + 3g3. 3g*3 Collect the terms in 33k*3 + 18k*3 - 46k*3 + 4k*2. 5k*3 + 4k*2 Collect the terms in -130r + 21r + 239r. 130r Collect the terms in 2 - 1508p*2 + 1508p*2 + 26p*3. 26p3 + 2 Collect the terms in 7 + a2 - 3 + a*2 + 4a*2 - 26. 6a2 - 22 Collect the terms in 21 + 16 - 40 - o2. -o*2 - 3 Collect the terms in 53w*2 + 49w*2 + 92w*2 + 45w*2 + 45w*2 - 280w*2. 4w*2 Collect the terms in -429j - 437j + 875j. 9j Collect the terms in 3976n*3 - 2079n*3 - 2134n*3. -237n*3 Collect the terms in 282 - y + 19 - 35 + 3y*2 + 24. 3y*2 - y + 290 Collect the terms in 5192 + 5185 - 24o*3 - 10375. -24o*3 + 2 Collect the terms in 66g + 6 - 264g + 17. -198g + 23 Collect the terms in 3d2 - 4193 + 2097 + 8d*2 + 2096. 11d*2 Collect the terms in -50 + 8u*2 - 59 + 165 - 56. 8u*2 Collect the terms in 18f*2 - 37f*2 + 87f*2. 68f*2 Collect the terms in -287p*3 - 28p*3 + 313p*3. -2p*3 Collect the terms in 5t*2 - 2t*2 - 12t*2 - 7t*2 + 2t*2. -14t*2 Collect the terms in -492 + 492 - 57r. -57r Collect the terms in -17 - 527s*2 + 3s*3 + 17 + 2086s*2. 3s*3 + 1559s*2 Collect the terms in 124q*2 - 259q*2 - 105q*3 + 135q*2. -105q*3 Collect the terms in -14g*2 - 24g*2 - 28g*2 - 21g*2. -87g*2 Collect the terms in -150 + 873q - 291q - 287q - 294q. q - 150 Collect the terms in 4 - 4 + 3 + 92g + 0. 92g + 3 Collect the terms in -2 + 2 + 434j*3 + 477j*3 + 0 - 918j*3. -7j*3 Collect the terms in 2 + 2a*3 - 2 + 169a - 344a + 175a. 2a3 Collect the terms in 58615b*3 + 58620b*3 - 117248b*3. -13b*3 Collect the terms in 3s*2 - 10 - 10s*2 - 3 + 13. -7s*2 Collect the terms in -7338548b + 7338550b + 5 - 5. 2b Collect the terms in 311x3 + 26597x*2 + 1 - 26597x*2. 311x*3 + 1 Collect the terms in 7 - 5p*2 - 5p*2 - 36p + 11p2 - 82p. p*2 - 118p + 7 Collect the terms in l*3 - 9l*3 - 2 + 4l*3 + 75l2 + l3. -3l3 + 75l*2 - 2 Collect the terms in 29p - 318 + 163 + 158. 29p + 3 Collect the terms in 501o*2 + 1437o + 52o2 - 1437o. 553o2 Collect the terms in -3x + 16x - 818 + 816 - 2x + 2x. 13x - 2 Collect the terms in 44j3 - 198j*3 + 47j*3 + 51j*3 + 50j*3. -6j*3 Collect the terms in 716 + 181i*2 - 716. 181i*2 Collect the terms in -4655r*3 + 3r - 5r - 4185r*3 - 121r*3. -8961r*3 - 2r Collect the terms in -125u2 - 456u*2 + 8u - 12u - 27u. -581u2 - 31u Collect the terms in 304b - 61b - 82b - 9 - 79b - 80b. 2b - 9 Collect the terms in 5r2 - 18 + 4r*2 - 11r*2. -2r*2 - 18 Collect the terms in -21v + 2v + 22 + 10v - 22 - 3v. -12v Collect the terms in 486p - 962p + 481p - 5 + 5. 5p Collect the terms in 0 + 34b2 - 16b*2 - 55b*2 + 0 + 41b*2. 4b*2 Collect the terms in 26x - x - 8x - 9x - 6x. 2x Collect the terms in 8g3 + 15204 - 7592 - 7612. 8g*3 Collect the terms in 6g - 13g + 5g + 2g2 - 22g - 17g. 2g*2 - 41g Collect the terms in -2 + 211u3 + 2 - 2633u*2 + 2629u*2 - 74u*3. 137u*3 - 4u*2 Collect the terms in -6 + 12068r*3 + 6. 12068r*3 Collect the terms in 271x*2 + 127x*2 + 63x*2 - 461x2 + x3. x*3 Collect the terms in -10 + 13y*3 + 0y*2 - 2y*2 + 2y*2 - 11y*3. 2y*3 - 10 Collect the terms in -13 - 7731z + 13. -7731z Collect the terms in -218704 + t - 218710 + 0t + 656119 - 218705. t Collect the terms in 43952740 - 43952740 + 17s2. 17s*2 Collect the terms in 2390v - 1222v - 1170v. -2v Collect the terms in -1852i*3 - 1829i*3 - 1831i*3 + 5495i*3. -17i*3 Collect the terms in -19w2 + w2 + 9w2 + w. -9w*2 + w Collect the terms in 936b - 44b2 + 2 - 936b. -44b2 + 2 Collect the terms in 133358x*3 - 266716x*3 + 133354x*3. -4x*3 Collect the terms in 51g*3 - 14g*3 - 58g*3. -21g*3 Collect the terms in -261z - 4 - 7 + 83z + 5. -178z - 6 Collect the terms in 14 - 2o + 5 + 7 - 3. -2o + 23 Collect the terms in -111x2 - 240x*2 + 360x*2. 9x*2 Collect the terms in 113k*2 + 2k - 2k - 194k*2 + 145k*2. 64k*2 Collect the terms in 4n*3 + 167 - 167 - 83n*2 - 8n*2. 4n*3 - 91n*2 Collect the terms in 37 - 95c*3 + 15 + 259c*3 - 52. 164c*3 Collect the terms in 17m + 10m + 20m + 22m - 66m. 3m Collect the terms in 21v*2 + 10v*2 - 6v*2 - 12v*2. 13v*2 Collect the terms in -5 + 28g + 5 - 302g. -274g Collect the terms in -28 + 96l - 28 - 33 + 89. 96l Collect the terms in -94h - 55h - 101h + 78h. -172h Collect the terms in -1603y*3 + 797y*3 + 802y*3. -4y*3 Collect the terms in -250n*2 - n + 500n*2 - 247n*2 + n. 3n*2 Collect the terms in -1 - 2 - 27490n + 27476n. -14n - 3 Collect the terms in -39m2 - 3m*2 + 22m*2 - 12m*2. -32m*2 Collect the terms in -3l2 + l2 + 3l2 + 8l2 - l2 - 10l2. -2l*2 Collect the terms in -2 - 935g - 2 + 12 - 9. -935g - 1 Collect the terms in 897f + 0 + 1017f + 38f + 2. 1952f + 2 Collect the terms in -15 + 2q + 2q + 2q - 5q. q - 15 Collect the terms in -3w*2 - 5w - 5w2 - 2w*2 - 34 + 34. -10w*2 - 5w Collect the terms in 687t2 - 4t - 677t2 - 2t. 10t2 - 6t Collect the terms in 4y + 3y - 7y + 3 - 397y*2 + 406y*2. 9y*2 + 3 Collect the terms in 1595f + 7230f - 1433f. 7392f Collect the terms in 75s - 40s + 362s. 397*s Collect the terms in -	{ "pile_set_name": "DM Mathematics" }
y) = 28y2 - 4y - 437. Give -6d(t) + 13r(t). t*2 - 2t - 225 Let h(a) = 10a3 + 11a*2 - 8. Suppose 72 = 8m + 8. Let v(l) = -3l3 - 4l*2 + 3. Calculate mv(c) + 3h(c). 6c3 + c2 Let a(j) = 5j2 - 4j - 1. Let v(s) = 15s2 - 11s - 3. Determine -8a(p) + 3v(p). 5p2 - p - 1 Let m(q) = -579q - 2. Let n(d) = -4d + 1. Give -m(c) - 4n(c). 595c - 2 Let j(h) = 3h - 5. Let b(d) = -3d + 4. Suppose -14w + 16w - 6 = 3s, w = -3. Determine sb(x) - 3j(x). 3x - 1 Let c(t) = 11t*3 + 3t*2 + t + 6. Let a(s) = 5s3 + s2 + s + 3. Give 7a(h) - 3c(h). 2h3 - 2h*2 + 4h + 3 Let h(r) = 2r - 1. Let k(v) = -7v + 42. Give 5h(a) + k(a). 3a + 37 Let b(h) = -4h - 4. Let u(a) be the first derivative of -3a*2/2 - 3a + 1. What is -5b(m) + 7u(m)? -m - 1 Let c(d) = 2d2 - 394d + 7. Let g(k) = -k*2 + 262k - 5. Determine -5c(y) - 7g(y). -3y2 + 136y Let f be 212/28 - 3/(-7). Suppose -z = -21 + f. Let c(g) = -g - z + 19 - 6. Let h(x) = 6x - 1. What is 4c(v) + h(v)? 2v - 1 Let g(k) = 14k. Suppose -5t + 24 = -1. Let x(j) = j. What is tx(m) - g(m)? -9m Let p(c) be the first derivative of 2c*2 - 3c + 1. Let q(g) = 8889 - 3g - 8887 + 0g. What is -4p(t) - 5q(t)? -t + 2 Let t(i) = -41i2 + 84i. Let p be t(2). Let q(o) = -o3 - o2. Let k(n) = -2n3 - 4n*2 - 2n. Calculate pq(m) - k(m). -2m*3 + 2m Let r(n) = 5n2 + 2n + 5. Let b(l) be the second derivative of 4l4/3 + l3 + 8l*2 + 2l. Give -3b(g) + 10r(g). 2g2 + 2g + 2 Let i(l) = -2l - 6. Let z(p) = -2p - 10. Let m be z(-3). Let b = 10 - m. Let w(c) = 28 - b - 15. Calculate -i(o) + 6w(o). 2o Let i(x) be the third derivative of -5x4/6 - 10x*3/3 - 7x*2 - 10x. Let o(m) = -5m + 2. Let p be o(-3). Let c(a) = -7a - 7. Give pc(d) - 6i(d). d + 1 Let q(j) = -31j3 - 7j*2 + 6j - 10. Let r(k) = 31k3 + 6k*2 - 5k + 9. Determine 6q(f) + 7r(f). 31f3 + f + 3 Let q(z) = 333z*3 + 74z*2 - 74z. Let w(t) = -t3 - t2 + t. Calculate -q(a) - 74w(a). -259a*3 Let z(g) = -29g*3 + 9g*2 - g + 6. Let o(a) = -15a*3 + 4a*2 - a + 3. What is 9o(q) - 4z(q)? -19q*3 - 5q + 3 Let a be 3 - 8(2 + 25/(-10)). Let l(r) = -9r - 14. Let d(m) = 8m + 13. Give ad(j) + 6l(j). 2j + 7 Let h(r) = -124r + 8. Let n(j) = 122j - 7. What is -6h(w) - 7n(w)? -110w + 1 Let s(t) = 119t. Let m(x) = -5415x. What is 5m(v) + 228s(v)? 57v Let r(m) = m*2 + 6m - 6. Let w(l) = -l + 1. Let h be (5/(125/(-30)))/(3/(-15)). Give hw(c) + r(c). c2 Let v(a) = 10a*2 - 3a - 2. Let n(d) = 21d2 - 5d - 5. Give -3n(j) + 5v(j). -13j2 + 5 Let y(b) = 5b - 25. Let z be y(12). Let s(n) = -50n. Let r(j) = 3j. What is zr(a) + 2s(a)? 5a Suppose 3o = 5a - 10 - 2, -4o - 16 = -2a. Let k(p) = 3p*2 + 2p. Let s(b) = 12b2 - 28b*2 + 17b*2. Suppose 0i = 3i - 3. What is ik(q) + os(q)? -q2 + 2q Let t(o) = 2o3 - 2o - 2. Let i(q) = -2q2 - 15q + q*3 + 9q + 4q. Let b(k) = k3 - k2 - k. Let g(w) = -2b(w) + i(w). What is -3g(l) - t(l)? l3 + 2l + 2 Let p(q) = -32q3 - 14q*2 - 5q + 10. Let s(z) = -64z3 - 25z*2 - 9z + 19. Calculate 9p(w) - 5s(w). 32w3 - w2 - 5 Let s(h) be the second derivative of -5h*3/6 + 5h*2/2 + 452h. Let d(g) = 2g - 1 - 1 + 0. Give 14d(a) + 6s(a). -2a + 2 Let p(r) = -4r3 + 44r*2 + 3r + 1. Let w(q) = -9q3 + 87q*2 + 7q + 2. Determine 7p(u) - 3w(u). -u*3 + 47u*2 + 1 Let c(u) = 14u*2 + 3u + 2. Let s(g) = 13g2 + 2g + 2. What is -2c(j) + 3s(j)? 11j2 + 2 Let u(m) = -6m*3 + 4m*2 + 3m + 2. Let w(f) = -f*2 - 1. Determine u(b) + 2w(b). -6b3 + 2b*2 + 3b Let s(d) = -d*2. Let t(j) = -7j*2 + j - 2. Let v be (0 - 3/(-9))1098/(-61). What is vs(k) + t(k)? -k2 + k - 2 Let l(b) = 5b. Let t(z) be the second derivative of -8z3/3 + z. Let r be 1/((-4)/(-60)5). Let f be 2/(r/3)5. What is fl(v) + 3t(v)? 2v Suppose -4j + j + 4z = -33, -j = -3z - 16. Let t(d) = -7d*2 + 9d - 2 - j - d*2. Let h(y) = -2y*2 + 2y - 2. Give 9h(o) - 2t(o). -2o2 Let r = 4 + 0. Let w(h) = h3 + 5. Let s(k) = k3 + 4. Let l = 151 - 147. Suppose 9 = -li - 2q - 7, 3i + q = -13. Determine is(x) + rw(x). -x*3 Let z(n) = -6n - 9. Let b be (-6 - (-3 - -2)) + -2. Suppose -10s + 77 - 127 = 0. Let c(v) = 9v + 13. Give bz(w) + sc(w). -3w - 2 Let x(t) = 7t + 15. Let l(h) = 4h + 8. Let s(z) = -5l(z) + 3x(z). Let j(a) = -a - 3. Let u(o) = -3o - 12. Let w(b) = 2j(b) - u(b). Give 4s(p) - 3w(p). p + 2 Let s(g) = -20g*2 + 11g - 19. Let p(v) = 2v - 5. Determine 6p(q) - s(q). 20q2 + q - 11 Let l(i) = 11i + 4. Let m(n) = 9n + 4. Determine 5l(z) - 6m(z). z - 4 Let h(v) = -20v*2 + v + 2. Let i(c) = -14c*2 + 2. What is 3h(j) - 4i(j)? -4j*2 + 3j - 2 Let a(b) = 23b3 - 2b - 5. Let p(s) = -s*3 + s + 1. What is a(j) + 2p(j)? 21j3 - 3 Let s(z) = -17z*2 + 2z - 4. Let t(j) = 19j2 - 2j + 3. What is -4s(r) - 5t(r)? -27r2 + 2r + 1 Let u(z) be the second derivative of 0z2 + 0 + 8z + 1/2z3. Suppose 5x = 18 - 3. Let s(l) = -7l. Give xs(d) + 6u(d). -3d Let r(n) = -3n + 3. Let q(i) = 0 - 7i - 14 + 8 + 11. Determine 2q(s) - 5r(s). s - 5 Let t(c) = -5c2 + 6c. Let d(w) = 3w2 - w + 1. Let r(f) = -22f*2 + 11f - 6. Let k(s) = -6d(s) - r(s). Suppose -2n + n + 6 = 0. Give nk(h) + 5t(h). -h2 Let b(o) = o3 - o. Let f(g) = -g*2 - 2g + 1. Let i = 4 + -18. Let m(y) = -y*3 - 15y*2 - 15y - 12. Let k be m(i). Give kb(r) - f(r). 2r3 + r2 - 1 Let g(x) = -5x + 13. Let a(c) = -3c + 6. Let u = -192 + 179. Calculate ua(m) + 6g(m). 9m Let v(f) = 20f + 44. Let a(z) = -4z - 9. Determine -24a(b) - 5v(b). -4b - 4 Let n(h) = 8h3 - 4h*2 - 11h - 4. Let i(g) = -17g3 + 9g*2 + 20g + 9. Determine -4i(v) - 9n(v). -4v3 + 19v Let n(p) = 2p3 - 10. Let u(r) = 1. Let d(w) = -4w3 + w2 + 11w + 9. Let o be d(-1). Give on(i) + 30u(i). 6i*3 Let d(v) = 1. Let a(t) = -3t + 1. Let m(o) = o*2 - 27o - 323. Let c be m(36). Give cd(u) - a(u). 3u Let g(c) = 10c3 + 8c*2 + 8c. Let n(l) be the second derivative of l5/20 + l4/12 + l*3/6 + 5l - 5. What is -3g(p) + 24n(p)? -6p3 Let n(i) = -4i - 41. Let r(j) = -j - 3. What is -n(x) + 5r(x)? -x + 26 Let k(i) = -i - 14. Let m(l) = -l2 + l + 16. Determine -7k(x) - 6m(x). 6x*2 + x + 2 Let m(d) = -49d + 1. Let v(j) = 146j - 3. Calculate -7m(t) - 2v(t). 51t - 1 Let o(v) = -60v3 - 3v*2 - 3v. Let a(n) = -20n3 - n2 - n. Calculate 8a(y) - 3o(y). 20y3 + y2 + y Let x(v) = -3v - 3. Let n(y) = -52y - 19 + 4 - 62y + 99y. Give -4n(l) + 21x(l). -3l - 3 Let h(a) be the third derivative of -a5/30 - a4/12 - a3/2 - 3a*2 - 11. Let c(d) = -10d*2 - 11d - 16. Calculate 2c(q) - 11h(q). 2q2 + 1 Let q(r) = 2r - 1. Let o(a) = -4. What is 2o(l) - 10q(l)? -20l + 2 Suppose 2z - 281 + 283 = 0. Let j(o) = 4o3 - 3o*2 + 3o + 3. Let i(a) = -a3 + a2 - a - 1. Determine zj(g) - 3i(g). -g*3 Let k = -1929 - -1923. Let i(f) = -1. Let b(m) = 2m + 5. Give ki(r) - 2b(r). -4r - 4 Let s(q) = q + 6. Suppose -4f = -14 + 22. Let w(k) = -3k - 18. Calculate fw(i) - 7s(i). -i - 6 Let h(c) = 4c*2 + 5c + 9. Let r(d) = -5d2 - 4d - 10. Let y(v) = -v. Let s(u) = r(u) + 2y(u). Determine 6h(q) + 5s(q). -q2 + 4 Let c(a) = -18a*3 + 3a*2 + 2a - 1. Let u(r) = 55r3 - 8r*2 - 6r + 2. Calculate 8c(j) + 3u(j). 21j3 - 2j - 2 Let x(b) = 5 - 5 - 10b2 + 2b + 6b + 29b*2. Let d(v) = 6v*2 + 3v. Give 8d(h) - 3x(h). -9h2 Let z(t) = 4t - 1. Let r(g) be the second derivative of 2g3/3 - g2 - g + 74. Give 2r(q) - 3z(q). -4q - 1 Suppose 3j - 2 = 4. Let b(t) = t. Suppose 61 + 49 = 11o. Let c(w) = 3 - 1 - 23w + 10w + ow. Calculate jb(z) + c(z). -z + 2 Let k(b) = 0 - b*3 + 3 - 2. Let m(r) = -4r*3 - r + 7. Suppose -18 = -18z + 15z. Give zk(l) - m(l). -2l3 + l - 1 Let n(o) = -4o - 4. Let l be ((-2)/3)/(8/12). Suppose 24 = 5d - s, 4s + 24 = -2d + 4d. Let a(p) = -d + 1 + 3p - 2p + 4. Give ln(b) - 5a(b). -b - 1 Let s(w) = 5w2 - 4w - 7. Let g(v) = -4v2 + 5v + 5. Calculate 3g(h) + 2s(h). -2h2 + 7h + 1 Let c(d) = -4*d - 10. Let k(n)	{ "pile_set_name": "DM Mathematics" }
i. Calculate n(m(x)). 14x*2 Let o(u) = -u + 2. Let a(f) = 2f - 2 - 4f + 7. Let b(j) = -2a(j) + 5o(j). Let n(m) = -2m. What is b(n(v))? 2v Let p(b) = -2b. Let s(z) = -5z. Let o(v) = -7p(v) + 3s(v). Let r(t) = -3t + 3 - 3. Determine o(r(g)). 3g Let b(k) be the third derivative of 0k + 0k3 - 4k*2 - 1/24k*4 + 0. Let h(v) = -2v. Determine b(h(m)). 2m Let b(n) = -n. Let j(g) = -7g*2 + 4. Let u(i) = -8i*2 + 5. Let w(o) = 5j(o) - 4u(o). Calculate w(b(f)). -3f2 Let k(o) = -o2. Let s = 12/11 - 14/33. Let z(d) be the first derivative of 0d + sd*3 + 0d*2 + 1. Determine k(z(m)). -4m*4 Let y(v) = v. Let r(i) = -7i. Let c(j) = 2r(j) + 18y(j). Let x(p) = -p*2 + p + 1. Let z(g) = -2g*2 + 3g + 3. Let o(u) = 3x(u) - z(u). Give o(c(h)). -16h*2 Let a(c) = -5c. Let v(o) be the third derivative of 0 + 0o3 + 1/20o*5 + 0o - 2o2 + 0o*4. Calculate a(v(d)). -15d*2 Let p(l) = -21l. Let v(k) = -k. What is v(p(a))? 21a Let l(v) = -8 + 9 - v2 + 2v*2 + 28v*2. Let q(m) = -2m*2. What is q(l(h))? -1682h*4 - 116h*2 - 2 Let u(g) = -g. Let p(x) = -4x. Let s(l) = -p(l) + 5u(l). Let v(t) be the first derivative of -t2 + 5. What is v(s(d))? 2d Let t(n) = 2n. Let g(h) = 2h + 8h2 - 9h + 7h. Give t(g(o)). 16o*2 Let l(x) = x + 2028. Let t(b) = b. Give t(l(n)). n + 2028 Let o(d) = 129d*2. Let n(p) = -5p. What is n(o(r))? -645r2 Let n(v) = 734v*2. Let y(s) = 2s. Determine n(y(l)). 2936l2 Let n(g) = g2. Let d(b) = 21b + 18. Let h(x) = -x - 1. Let c(z) = d(z) + 18h(z). Determine n(c(q)). 9q2 Let f(x) be the second derivative of -x4/6 - x. Let u be (-1)/((-1)/11) + 0. Let r(c) = -c - 11 + u. Give r(f(q)). 2q2 Let l(y) be the second derivative of -y4/6 + y. Let f(u) = 5u2 - u2 + 3u2. What is l(f(d))? -98d*4 Let s(m) = 3928m + 2. Let x(o) = -4o. Give x(s(f)). -15712f - 8 Let w(u) = 3u2. Let c(s) = 2s*2. Let j(v) = 7c(v) - 5w(v). Let m(l) = 4l. What is m(j(k))? -4k2 Let o(c) = c - 1. Let v(n) = 1. Let d(m) = 6o(m) + 6v(m). Let q(r) = 3608 + 2r - 3608. Determine q(d(h)). 12h Let i be (35/(-10))/((-2)/(-4)). Let z(u) = 2u - 3. Let f(v) = -4v + 7. Let q(g) = iz(g) - 3f(g). Let h(l) = 3l + l - 5l. Determine q(h(p)). 2p Let l(v) be the second derivative of -v*3/3 - 14v. Let k(a) be the first derivative of a*2/2 - 1. What is k(l(q))? -2q Let j(w) = -236w. Let r(n) = -19n*2. What is j(r(l))? 4484l*2 Let s(y) = 3y. Let f(q) = -3327q2. Give f(s(j)). -29943j*2 Let m(z) = -3z. Let f(t) be the first derivative of -t*3/3 + 7. Give m(f(r)). 3r*2 Let s(n) = -2n2 - n2 + 8n2. Let g = -7 - -12. Let a(m) = -3m + 4. Let u(p) = -4p + 5. Let y(t) = ga(t) - 4u(t). Determine s(y(x)). 5x*2 Let a(r) = r. Let i(p) = 6p + 5p - 2p + 0p. What is a(i(c))? 9c Let d(z) = 2z. Let v(b) = 4b + 8. Let x(y) = 3y + 5. Let c(p) = -5v(p) + 8x(p). Determine d(c(g)). 8g Let p(c) be the second derivative of c*4/12 - 3c*2/2 + 3c. Let r(i) = 4. Let z(w) = -4p(w) - 3r(w). Let m(j) = -2j. Determine z(m(a)). -16a*2 Let m(u) = -2u. Let o(r) = 537r2. Determine o(m(v)). 2148v*2 Let q(g) = -2g. Let m = 209 + -209. Let s(h) be the second derivative of -1/6h3 + mh*2 - 2h + 0. Calculate s(q(o)). 2o Let s(z) = -24z*2. Let n(a) = -3a*2 - 5a. Let l(i) = -5i2 - 8i. Let r(b) = 5l(b) - 8n(b). Give s(r(m)). -24m4 Suppose 3h + 4 = 10. Suppose 0 = -y + v + h, -3y = -0y + 5v + 10. Let c(m) = -m + 0m + ym. Let g(i) = 2i. Calculate g(c(k)). -2k Let h(p) = 9p + 3p + 4p - p. Let f(l) = -l*2. Determine h(f(t)). -15t*2 Let s(m) = 3m. Let b(x) = x. Let z(f) = -15b(f) + 6s(f). Let v(q) = -2q2. Determine v(z(u)). -18u*2 Let m(y) = 2y*2. Let i(b) = 2691b*2. Give m(i(t)). 14482962t*4 Let q(x) = 39x. Let m(v) = -2v2. Give q(m(l)). -78l*2 Let u(b) = -b. Let c(h) = -2h*2 - 17h. Determine u(c(x)). 2x2 + 17x Let s(q) be the first derivative of 0q - 1/2q*2 + 0q*3 - 1/24q*4 - 1. Let d(g) be the second derivative of s(g). Let l(n) = -4n*2. What is l(d(a))? -4a*2 Let i(o) = 2o2. Let v(x) be the first derivative of x3 - 1. Give i(v(u)). 18u4 Let n(j) = -4647j. Let q(y) = 4y. Calculate n(q(u)). -18588u Let x(q) = -404q. Let m(o) = -o2. What is m(x(a))? -163216a*2 Let w(f) be the first derivative of 10f*3/3 + 7f + 1. Let k(m) = 3m2 + 2. Let n(g) = 7k(g) - 2w(g). Let d(o) = -o. Determine d(n(u)). -u2 Let t be 6/10 - (-160)/25. Let b(v) = t + 9v - 7. Let s(m) = 4m + m2 - 2m - 2m. Give b(s(f)). 9f*2 Let c(w) = 4w - 9w + 3 + 0. Let n(y) = -36y + 22. Let z(v) = 44c(v) - 6n(v). Let j(i) = i. Determine j(z(d)). -4d Let l(b) = -b + 1. Let h(z) = 3z - 1. Let c(m) = h(m) + l(m). Let q(p) = -p*2 + 30 - 30. Calculate q(c(f)). -4f*2 Let n(v) = -20v. Let w(g) be the second derivative of -g*4/6 - 6g. Determine n(w(i)). 40i2 Let r(h) = 17h*2 + 3. Let k(o) = -11o. Calculate k(r(w)). -187w2 - 33 Let m(i) = -i + 18. Let o(q) be the first derivative of -q2/2 + 10. What is o(m(s))? s - 18 Let b(v) be the first derivative of 2v*3/3 + 6. Let c(h) = -4h. What is c(b(u))? -8u2 Let t(p) = 28p*2. Let m(v) = -116v*2. Determine m(t(a)). -90944a*4 Let t(l) = 9l*2 + 6l. Let m(w) = w. Let r(a) = -6m(a) + t(a). Let k(g) = g. Give r(k(o)). 9o*2 Let b(u) = -14u*2. Let a(l) = 67l. Determine a(b(v)). -938v2 Let j(u) = -2446u. Let m(z) = -z*2. Give m(j(l)). -5982916l2 Let l(g) = g2. Let y(i) = 0i - 2i - 9i. Calculate l(y(q)). 121q2 Let l(d) be the third derivative of d4/12 + 5d3/6 + d2. Let s(n) = 2n + 6. Let m(c) = -6l(c) + 5s(c). Let j(t) = t*2. Give j(m(p)). 4p*2 Let l(k) = 4k*2 - 37k. Let c(n) = 3n. Give l(c(x)). 36x*2 - 111x Let u(t) be the first derivative of -37t3/3 - 20. Let y(m) = m2. What is y(u(b))? 1369b*4 Let i(u) be the second derivative of 3u + 1/3u3 + 0 + 0u*2. Let o(k) = -2k*2. Calculate i(o(z)). -4z*2 Let c(o) = 23o*2. Let q(i) = 10i*2. What is c(q(z))? 2300z*4 Let n be -1 - (1 + -6 + 2). Let a(u) = -nu + 3 + 6u - 3. Let i(c) = -c2. Calculate a(i(o)). -4o*2 Let j(c) = -5c*2. Let k(s) = -2s*2. Let w(z) = 3j(z) - 8k(z). Let m(b) = -8b*2. Calculate m(w(p)). -8p4 Let t(n) = -n2. Let l(d) be the second derivative of -2/3d3 + 0 + 3d + 0d2. Determine t(l(r)). -16r2 Let v(a) be the second derivative of -a4/3 - 29a. Let n(p) = -14p. Give n(v(c)). 56c2 Let f(b) = b2. Let k(o) be the second derivative of o4/8 - 5o*2/2 + 4o. Let d(r) be the first derivative of k(r). Determine f(d(j)). 9j2 Let f(w) be the second derivative of 3w*4/4 + 6w. Let t(z) = -2z. What is t(f(y))? -18y*2 Let l(v) = -7v. Let j(y) = y + 14 - 14. Calculate j(l(u)). -7u Let a(m) = -5m + 7. Let d(u) = 4u - 6. Let y(f) = 2a(f) + 3d(f). Let x(n) = 3n - 5. Let i(v) = 4x(v) - 5y(v). Let j(s) = 3s2. Give j(i(t)). 12t2 Let y(l) be the third derivative of l4/24 + 4l2. Let h(r) = -4r*2. What is y(h(c))? -4c*2 Let w(s) = 4s*2. Let v(k) = 65k + 39. Let h(l) = 8l + 5. Let b(a) = -39h(a) + 5v(a). What is b(w(j))? 52j*2 Suppose -f + 10 = 5s, 2s - 4 = 3f - 8f. Let r(n) be the second derivative of fn*2 - 1/6n*3 + 0 - n. Let a(v) = 2v. Calculate r(a(o)). -2o Let a(x) = x. Let l(q) = q + 1. Let h(b) = 3b + 1. Let y(c) = -3h(c) + 3l(c). Determine a(y(u)). -6u Let o(d) = -d2. Let k(f) = -f2 - 4f. Let x be k(-3). Let a(p) = xp - p + 4p - 4p. Determine a(o(z)). -2z2 Let r(k) = -k2. Let d(z) = -3z2. Give r(d(i)). -9i*4 Let x(t) = 9t*2. Let n(z) = -3z*2 + 5z - 5. Let y(q) = q*2 - 2q + 2. Let b(p) = -2n(p) - 5y(p). Calculate b(x(w)). 81w4 Suppose -f + 2 = -2. Suppose l = -2l. Let x(g) = -fg + lg + 3g. Let h(b) = 3b*2. Determine x(h(m)). -3m2 Let l(t) be the first derivative of t6/60 - 2t3/3 - 2. Let o(a) be the third derivative of l(a). Let r(s) = 3s. Give o(r(n)). 54n2 Let n(f) = -2f*2. Let g(u) = 4u*2 + 5u + 5. Let c(b) = b*2 + b + 1. Let p(w) = 5c(w) - g(w). Give p(n(q)). 4q4 Let w(b) = -39b*2. Let u(p) = -15p*2. Determine w(u(x)). -8775x*4 Let a(g) = 3g + g - 2g. Let k(s) = 9s**2.	{ "pile_set_name": "DM Mathematics" }
-39? -26 What comes next: 20, 30, 52, 92, 156, 250, 380, 552? 772 What is next in 76, 116, 144, 166, 188, 216, 256? 314 What is the next term in -2056, -4123, -6190, -8257, -10324, -12391? -14458 What is next in 20, 66, 158, 320, 576, 950, 1466, 2148? 3020 What is next in -1, 10, 21, 32, 43? 54 What is next in -25, -95, -207, -355, -533, -735, -955, -1187? -1425 What is the next term in 1, -4, -7, -8, -7? -4 What comes next: -493, -986, -1479? -1972 What comes next: 3646, 3648, 3650, 3652, 3654, 3656? 3658 What is the next term in -106, -115, -126, -139, -154, -171? -190 What comes next: 212, 213, 214? 215 What is next in -61, -119, -177, -235, -293? -351 What is the next term in -15, -77, -247, -579, -1127, -1945? -3087 What is the next term in -41, -58, -85, -122? -169 What is the next term in 6, 17, 28? 39 What is next in 391, 393, 395, 397, 399? 401 What is the next term in 272, 240, 158, 2, -252, -628, -1150, -1842? -2728 What is next in 22, 31, 34, 31, 22? 7 What is the next term in -31, -66, -97, -118, -123? -106 What comes next: 5, 8, 13, 20, 29? 40 What is next in -54, -103, -150, -195? -238 What comes next: -948, -946, -942, -936? -928 What is next in 19, 40, 61? 82 What is next in 926, 937, 952, 971, 994, 1021, 1052? 1087 What is the next term in 8, 38, 126, 302, 596, 1038, 1658, 2486? 3552 What is next in -41, -86, -131, -176, -221, -266? -311 What comes next: -63, -141, -237, -357, -507? -693 What comes next: -525, -591, -657? -723 What is next in -540, -516, -470, -396, -288, -140, 54? 300 What is the next term in -24296, -24297, -24298, -24299, -24300? -24301 What comes next: 157, 300, 447, 598, 753? 912 What is the next term in -1173, -1175, -1177, -1179, -1181, -1183? -1185 What comes next: 169, 183, 197, 211, 225? 239 What comes next: 1075, 1074, 1073, 1072, 1071? 1070 What is next in 67, 136, 205, 274, 343? 412 What comes next: -85, -91, -99, -109, -121, -135, -151? -169 What comes next: 32, 76, 150, 254? 388 What comes next: 51, -15, -81? -147 What is next in -327, -656, -985, -1314, -1643, -1972? -2301 What comes next: 13, 19, 31, 49, 73, 103? 139 What comes next: 464, 930, 1386, 1826, 2244? 2634 What is the next term in 47, 85, 117, 143, 163, 177, 185? 187 What is the next term in 2, 1, -2, -7, -14? -23 What comes next: 113, 226, 339, 452, 565, 678? 791 What is next in -282, -283, -284, -285, -286? -287 What comes next: -1894, -1884, -1860, -1816, -1746, -1644, -1504? -1320 What is the next term in 20350, 40702, 61054, 81406, 101758? 122110 What is the next term in -7, -26, -45, -64? -83 What is next in -90, -202, -314? -426 What comes next: 430, 439, 448, 457, 466? 475 What is next in 0, 22, 68, 150, 280, 470, 732, 1078? 1520 What comes next: 113, 418, 927, 1640? 2557 What comes next: -35, -26, -19, -14, -11, -10? -11 What comes next: -117, -219, -307, -375, -417, -427? -399 What is the next term in 13, 8, 3, -2, -7? -12 What is next in 34, 139, 322, 589, 946, 1399, 1954, 2617? 3394 What is the next term in -146, -290, -434, -578, -722, -866? -1010 What is the next term in 10159, 10161, 10165, 10171, 10179, 10189, 10201? 10215 What is next in 0, 2, 18, 54, 116, 210, 342? 518 What is next in -572, -1150, -1730, -2312, -2896, -3482? -4070 What comes next: 25, 66, 171, 370, 693, 1170, 1831? 2706 What is the next term in -4, 1, 14, 41, 88? 161 What comes next: -53, -120, -197, -284, -381, -488? -605 What is the next term in 115, 126, 151, 196, 267, 370, 511, 696? 931 What is next in 214, 230, 254, 286, 326, 374, 430? 494 What is next in 38, 68, 98, 128, 158? 188 What is the next term in -45, -177, -403, -729, -1161? -1705 What is the next term in 66, 37, -40, -189, -434, -799, -1308, -1985? -2854 What comes next: 37, 30, 27, 28, 33? 42 What is the next term in 11, 69, 165, 299, 471? 681 What is the next term in 7457, 7458, 7459, 7460, 7461, 7462? 7463 What is the next term in 29, 75, 147, 257, 417, 639? 935 What is next in 2781, 2783, 2785, 2787, 2789? 2791 What comes next: 59, 112, 165, 218? 271 What is next in -76, -281, -618, -1087? -1688 What is the next term in 1923, 1925, 1927, 1929? 1931 What is next in -49, -33, 9, 89, 219, 411? 677 What is next in -7, 3, 17, 35? 57 What comes next: 69, 172, 309, 480, 685? 924 What is the next term in -215, -214, -217, -224, -235, -250? -269 What is next in -28, -29, -30, -31, -32, -33? -34 What is next in 32, 70, 108, 146? 184 What is the next term in 1766, 1768, 1772, 1778, 1786? 1796 What comes next: 768, 856, 1098, 1572, 2356? 3528 What is the next term in 180, 347, 500, 633, 740, 815, 852? 845 What is next in 73, 306, 695, 1240, 1941, 2798, 3811? 4980 What is the next term in -5, -14, -45, -110, -221, -390? -629 What is next in 329, 337, 357, 395, 457, 549, 677? 847 What comes next: 85, 81, 75, 67, 57, 45? 31 What is next in -10, -8, -4, 2? 10 What comes next: -1011, -1012, -1013, -1014, -1015, -1016? -1017 What comes next: 489, 490, 493, 498, 505, 514, 525? 538 What is next in -152, -162, -170, -176, -180, -182, -182? -180 What comes next: -207, -230, -253, -276? -299 What comes next: 14, 18, 56, 146, 306? 554 What is the next term in -33, -132, -297, -528, -825, -1188, -1617? -2112 What is the next term in 0, -4, -10, -18, -28? -40 What is next in -897, -905, -919, -939, -965? -997 What is the next term in 14, 0, -32, -88, -174, -296? -460 What is the next term in 52, 104, 158, 214, 272? 332 What is the next term in -1165, -2316, -3467? -4618 What comes next: -5944, -11887, -17830, -23773, -29716, -35659? -41602 What is next in -1686, -3373, -5060? -6747 What comes next: 30, 1, -30, -63, -98? -135 What is the next term in 258, 1021, 2292, 4071, 6358, 9153, 12456? 16267 What is the next term in 4934, 4935, 4934, 4931? 4926 What is next in 1092, 2192, 3302, 4428, 5576? 6752 What comes next: 331, 658, 985? 1312 What is next in -5937, -5932, -5917, -5886, -5833? -5752 What is the next term in -44, -43, -42, -41? -40 What is next in 18, 105, 250, 453? 714 What is next in -45, -47, -61, -93, -149, -235, -357, -521? -733 What comes next: 167, 339, 511, 683? 855 What is the next term in -789, -1575, -2359, -3141, -3921, -4699, -5475? -6249 What is the next term in -27, -110, -249, -444? -695 What is next in 5, 8, 1, -22, -67, -140? -247 What comes next: -14, -45, -122, -269, -510, -869? -1370 What is the next term in 1013, 2025, 3035, 4043, 5049, 6053, 7055? 8055 What is next in 0, -18, -42, -72, -108? -150 What is next in 6566, 6560, 6550, 6536, 6518, 6496, 6470? 6440 What comes next: 7918, 7920, 7922? 7924 What comes next: -10, -19, -28? -37 What is next in 165, 170, 177, 186, 197, 210, 225? 242 What comes next: 270, 1134, 2574, 4590, 7182? 10350 What is the next term in 8905, 8914, 8937, 8980, 9049, 9150, 9289? 9472 What is the next term in 4, 6, 20, 52, 108, 194, 316? 480 What is next in -3254, -3259, -3276, -3311, -3370, -3459? -3584 What is next in 36, 42, 46, 48, 48, 46? 42 What comes next: 6, 7, 6, 3, -2, -9? -18 What is the next term in 32, 111, 242, 425, 660, 947, 1286? 1677 What comes next: -8152, -8151, -8150, -8149? -8148 What is next in 1897, 1882, 1843, 1768, 1645, 1462? 1207 What is the next term in 796, 3182, 7160, 12730, 19892? 28646 What is the next term in -117, -124, -133, -144, -157, -172? -189 What is next in -696, -1388, -2080, -2772, -3464, -4156? -4848 What is next in -6, 2, 22, 60, 122, 214, 342, 512? 730 What is the next term in 842, 841, 840, 839, 838? 837 What is next in 127, 256, 385, 514, 643, 772? 901 What is the next term in 32, 44, 44, 26, -16, -88, -196? -346 What is the next term in 675, 677, 689, 717, 767, 845, 957, 1109? 1307 What is next in -30, -94, -208, -378, -610, -910, -1284, -1738? -2278 What is the next term in 7, 62, 119, 178, 239? 302 What is next in -121, -139, -169, -211, -265, -331, -409? -499 What is the next term in 34, 113, 248, 445, 710, 1049, 1468? 1973 What comes next: -13, 9, 31, 53? 75 What is next in 401, 411, 429, 461, 513, 591? 701 What is next in -6834, -6835, -6836? -6837 What is the next term in 589, 556, 509, 454, 397, 344, 301, 274? 269 What is the next term in -1, -30, -61, -94, -129, -166, -205? -246 What is the next term in -58, -124, -234, -388? -586 What is next in 309, 308, 307, 306, 305? 304 What is next	{ "pile_set_name": "DM Mathematics" }
/2y2 + 7y - 1/60y5 + 2/3y*3 + 0 + 1/8y*4. Let o(c) be the first derivative of h(c). Find i such that o(i) = 0. -1, 4 Let g(l) be the second derivative of 82/3l*3 - 15l + 52l2 + l4 + 1. Suppose g(k) = 0. What is k? -13, -2/3 Let y be 4390/3951(-54)/(-10). Find p such that -y + 9/2p - 3/4p*2 = 0. 2, 4 Let l be (-2)/((-32)/24) - 9/(-2). Let o be 6/(-90) - l/(-15). Factor -og + 0 - 1/3g2. -g(g + 1)/3 Let l(g) be the third derivative of -g*7/15 - 29g*6/30 + 481g*5/30 + 172g*4/3 + 52g*3 - 39g*2 + 15g. Let l(i) = 0. What is i? -13, -1, -2/7, 6 Let o be (-70)/10 + 11 - 8422/2104. Let x = o - -529/1052. Determine t, given that x - 7/4t - t2 = 0. -2, 1/4 Let r = -29281/30 - -4881/5. Factor 0 + 7/6i*3 - ri*4 - 2/3i*2 - 2i. -i(i - 6)(i - 2)(i + 1)/6 Suppose -97w = -26w - 933 - 771. Let y(b) be the first derivative of 16b - 22 + 9b4 + wb*2 - 100/3b*3. Let y(g) = 0. What is g? -2/9, 1, 2 Solve -26/5o - 4/5o4 - 43/5o*3 + 0 + 23o*2 = 0. -13, 0, 1/4, 2 Factor -4q*2 - 1058q + 4q3 + 501q + 556q + 6 - 5q*3. -(q - 1)(q + 2)(q + 3) Suppose 4w - 4f - 68 = 0, 0f = -3w - 5f + 51. Factor -12z2 + wz*2 - 2z - 12z + 3z + z. 5z(z - 2) Let s be (-660)/(-2898) + 11 - 11. Let l = 4/69 + s. Factor 16/7f2 + 20/7 + 38/7f - lf3. -2(f - 10)(f + 1)2/7 Let z(m) be the first derivative of m3/3 - 146m*2 + 1152m + 10597. Factor z(n). (n - 288)(n - 4) Let s(k) be the third derivative of 2k*7/315 + 2k*6 + 178k*5/15 + 266k*4/9 + 118k*3/3 - 29k*2 + 4k. Determine r, given that s(r) = 0. -177, -1 Let x(r) = -r*2 + 5r + 1. Let g(o) = 5o2 + 4593o - 2677305. Let p(i) = -g(i) - 7x(i). What is q in p(q) = 0? 1157 Let d(f) = -76 + 35 - f + 2f + 21. Let g be d(23). Factor 0q - 2/15q*g - 2/15q*2 + 0. -2q*2(q + 1)/15 Let f be 64/(-512)-29. Let b = f + 1/4. Factor -1/2i3 + bi*2 - 3/2i - 9/2. -(i - 3)*2(i + 1)/2 Let z be (10/36)/(70/42) + 7/42. Let v(y) be the third derivative of -1/90y5 - zy*3 + 0 - 3y*2 - 1/9y*4 + 0y. Factor v(d). -2(d + 1)(d + 3)/3 Suppose -87w2 + 9w*5 - 2w*3 + 99w*2 + 3w*5 + 4 - 21w*4 + 5 - 52w*3 + 42w = 0. Calculate w. -1, -1/4, 1, 3 Let f be ((-784)/120 + 260/195)/(-3). Suppose fk2 + 2/5k - 6/5k3 - 22/15k*4 - 4/15 + 4/5k*5 = 0. What is k? -1, -1/2, 1/3, 1, 2 Factor 71/3 - 73/6o + 1/6o3 - 35/3o*2. (o - 71)(o - 1)(o + 2)/6 Let n(c) = 2c*2 - c - 12. Let j(k) = 6k*3 - 87k*2 - 366k - 135. Let u(h) = j(h) - 2n(h). Let u(q) = 0. Calculate q. -3, -1/3, 37/2 Let v(i) be the first derivative of -i4/6 - 22i*3/3 + 135i*2 - 2150i/3 + 1412. What is m in v(m) = 0? -43, 5 Suppose 2r - 4r + 122 = 0. Let y = r + -58. Factor 4h2 - 4h3 - h2 - 3hy + 4h*3. -3h*2(h - 1) Let m(g) be the second derivative of -g*6/50 - 27g*5/25 + 3g*4/20 + 11g*3 + 108g*2/5 + 2199g. Determine j so that m(j) = 0. -36, -1, 2 Let g(q) be the first derivative of 1/14q4 + 9 + 4/35q*5 + 0q - 1/21q6 + 0q*2 - 4/21q*3. Suppose g(b) = 0. What is b? -1, 0, 1, 2 Suppose 23d - 28d = -5f + 105, 0 = -f - 5d + 33. Suppose -16 + 25l*2 - 34 + 2l*3 + 25l*2 + 21l - fl = 0. What is l? -25, -1, 1 Let s(z) be the third derivative of z6/300 + 3z5/5 - z4/60 - 6z3 - 1374z*2. Factor s(h). 2(h - 1)(h + 1)(h + 90)/5 Suppose 752 = 5g - 1138. Let j = g + -378. Factor j + 0w*2 - 1/6w*3 + 1/6w. -w(w - 1)(w + 1)/6 Let c(o) be the third derivative of -o7/840 + o6/48 - 3o5/20 + o4/8 + o3/6 + o2 + 2. Let b(h) be the second derivative of c(h). Factor b(i). -3(i - 3)(i - 2) Suppose -s = -2x + 1, 2x = 2s + 3x - 8. Find i such that -44i - 4is + 3i*3 + 3i*2 + 42i = 0. 0, 1, 2 Let k be (5 - 29559/(-33)) + -7. Let p = k + -893. Factor -6/11m - pm*2 + 2/11. -2(m + 1)(4m - 1)/11 Let j(q) be the first derivative of 4q5/5 - 7q*4 - 32q*3/3 + 918. Factor j(a). 4a*2(a - 8)(a + 1) Let g(a) be the first derivative of -a7/2240 - a6/120 + 9a*5/320 - 3a*3 - 7a*2/2 - 231. Let x(t) be the third derivative of g(t). Factor x(m). -3m(m - 1)(m + 9)/8 Suppose 120 = -10c - 82c + 396. Let g(s) be the first derivative of 0s + 20 + 1/12s*2 + 1/18s*c. Let g(z) = 0. What is z? -1, 0 Let m(w) be the first derivative of -5w*3/3 - 175w*2 + 720w + 914. Suppose m(u) = 0. Calculate u. -72, 2 Suppose 0 = -16c - 6c + 3784. Factor cw3 + 169w*3 - 18 + 21w - 344w3. -3(w - 2)(w - 1)(w + 3) Let b(d) be the third derivative of d*5/270 + 601d*4/108 + 200d*3/9 - 1963d*2. Suppose b(w) = 0. What is w? -600, -1 Let a = 904 + 1543. Let o = -1490 + a. Determine j so that -oj - 2j2 + 0 - 2 + 953j = 0. -1 Let q(u) be the third derivative of -u*6/420 + 10u*5/21 - 64u*4/3 - 1792u*3 + 2805u2. Find p such that q(p) = 0. -12, 56 Let w(u) be the second derivative of u6/120 + 11u5/80 + 7u*4/24 - 11u*3/6 - 9u*2 + 1073u + 1. Factor w(y). (y - 2)(y + 2)2(y + 9)/4 Let y = 147 + -421/3. Let c(m) = 237m - 12795. Let u be c(54). Factor -4w*2 + 4/3w*u - yw - 8/3 + 4/3w4. 4(w - 2)(w + 1)3/3 Suppose 104 = 122a - 384. Let x(c) be the third derivative of 5/6c3 + 5/16c*a + 0c + 0 + 1/24c5 - 4c*2. Factor x(y). 5(y + 1)(y + 2)/2 Let b(t) be the second derivative of 160t*2 + 208/3t*3 + 7t*4 + 281t - 9/5t5 + 0. Determine j so that b(j) = 0. -4/3, 5 Let z(r) be the first derivative of -r8/1680 + r7/840 + r6/180 - 6r*3 + 15. Let o(w) be the third derivative of z(w). Determine s, given that o(s) = 0. -1, 0, 2 Let a = 953 - 1757. Let j = a - -5630/7. Suppose 4/7n*2 - 4/7 + jn - 2/7n3 = 0. Calculate n. -1, 1, 2 Let z be (-8 - 3) + 6 + 462/3. Suppose -5o - z + 169 = 0. Find i, given that 2/7i3 - 4/7i*o + 0i + 2/7i5 + 0i*2 + 0 = 0. 0, 1 Let l be (-32)/(-2) - (749736/594)/89. Solve 0p + 0 + 6/11p3 + lp*2 - 2/11p*4 = 0 for p. -2, 0, 5 Let k(n) = 36n + 9. Suppose -5u + 26 = -4. Let f be k(u). Suppose 5g*2 + 5g*3 + 225 - f = 0. Calculate g. -1, 0 Let h(u) = -10u*3 + 68u*2 - 14u. Let f(g) = 19g3 + 14g*2 - 41g*3 + 20g*3 - 3g. Let d(j) = 28f(j) - 6h(j). Factor d(l). 4l2(l - 4) Let x(b) be the first derivative of 3/4b4 + 0b*2 - 3/5b*5 + 0b + 2b3 + 59. Let x(j) = 0. Calculate j. -1, 0, 2 Solve 0 + 1444/3c*3 + 1/3c*5 + 0c*2 + 0c + 76/3c4 = 0 for c. -38, 0 Let i(u) = 240240u*2 + 12380u + 170. Let p(c) = 360359c2 + 18568c + 256. Let j(x) = -8i(x) + 5p(x). Factor j(z). -5(155z + 4)*2 Let u = 184374 + -184374. Factor 2r - 1/6r2 + u. -r(r - 12)/6 Let c be 1 - (-1)/((7/(-3))/(-7)). Solve 898xc - 358 - 705x*2 - 142 - 110x*3 - 903x*4 - 1100x = 0. -10, -1 Let b(i) be the third derivative of i8/5880 - i7/2940 - i6/1260 + i5/420 - 37i3/3 + i2. Let q(f) be the first derivative of b(f). Factor q(r). 2r(r - 1)2(r + 1)/7 Let s(v) = -11v3 - 10v*2 + 2v - 2. Suppose 57 = -3p + 60. Let i(x) = 2x*3 + 2x*2 - x - 1. Let n(m) = ps(m) + 6i(m). Factor n(g). (g - 2)(g + 2)*2 Find i, given that 89 - 16i*4 - 25i*4 - 105i*2 - 40i + 11 + 46i4 + i3 + 39i*3 = 0. -10, -1, 1, 2 Let p be 1650/((-6)/(-3) - (-16 - -16)). Let m = 827 - p. Factor 0v*m + 0 + 0v*4 + 0v + 2/7v3 - 2/7v*5. -2v*3(v - 1)(v + 1)/7 Factor 2/3k*2 - 742/3k - 248. 2(k - 372)(k + 1)/3 Let n(z) be the first derivative of -z6/720 - z5/120 + z*4/6 - 73z*3/3 - 55. Let g(t) be the third derivative of n(t). Factor g(v). -(v - 2)(v + 4)/2 Solve 27/4l - 3/2l*2 - 9 + 1/12l3 = 0 for l. 3, 12 Let c(t) = -t3 - 7t2 - 12t - 4. Let y be c(-5). Let x(w) be the second derivative of 0 + 27/2w2 + 1/4w*4 - yw + 3w3. Factor x(j). 3(j + 3)*2 Let l = -373829 + 373831. Factor -1/2v*3 - 7/2v*l - 5v + 0. -v(v + 2)(v + 5)/2 Let n(g) be the first derivative of g3/21 - g2/2 - 44g/7 + 2814. Factor n(z). (z - 11)(z + 4)/7 Let r(a) be the first derivative of 2a5 - 15/4a*4 + 5/6a*6 - 20/3a*3 + 0a + 15 + 10a2. Factor r(q). 5q(q - 1)2(q + 2)2 Let t(o) = -o3 - 20o2 + 57o + 272. Let r be t(-22). Let w be 5 + (-2)/r(-561)/17. Solve 20/7 - wi*2 - 18/7i = 0 for i. -10,	{ "pile_set_name": "DM Mathematics" }
t u(q) = -7 + 2q - 2 + 4. Let s be u(5). Suppose 2f + y - 32 = 0, 2f - 36y = -38y + 34. What is the greatest common factor of s and f? 5 Let l be (6/(-10))/(75/(-250)). Suppose 4b - 12 = -2i, -5b = 4i - 4b - 31. Calculate the highest common divisor of i and l. 2 Suppose 4b - 11 - 69 = 0. Let s be 106/4 + 10/b. Suppose 0 = -36p + 38p + 3t - 477, -2p = -t - 489. Calculate the greatest common divisor of s and p. 27 Suppose -4q = -5t - 101, -17 = 5t + 8. Suppose -521 = -3m + 4j, -qj + 849 = 5m - 16j. Calculate the highest common factor of m and 38. 19 Let m be (-12)/8(-23 + -1). Suppose 0 = -3i + 11i - 32. Let s be (10/i)/((-20)/(-96)). What is the greatest common factor of s and m? 12 Let k be ((-66)/(-8))/(3/721). Suppose 5c - 264 = -2g, 7c - 39 = 6c - 5g. Calculate the highest common factor of c and k. 18 Suppose 4r - 24 = -2i, 3r = 3i - 275 + 212. Suppose -w + 7 = -2. Calculate the greatest common divisor of w and i. 9 Let u(k) = k + 10. Let p be (-40)/6(-2 + -1 + 6). Let y be (-196)/p - 2/(-10). Let g be u(y). What is the highest common divisor of 20 and g? 20 Let r(t) = t3 - 12t*2 - 11t + 2. Let z be r(13). Suppose 20b - 283 = 677. Calculate the greatest common factor of b and z. 4 Let a = 56 + -36. Let c(h) = h3 - 28h*2 + 55h - 28. Let f be c(26). What is the highest common divisor of a and f? 10 Let x be ((-2)/(-2))/(-3535/(-51450)). What is the highest common factor of x and 2334? 6 Let q(f) = -f + 16. Let u be q(-20). Let i(r) = -r3 - 10r*2 + 2r + 24. Let k be i(-10). Calculate the highest common factor of u and k. 4 Let g = -59 + 62. Suppose -3w - g = -4z - 6, 5 = w. Suppose -d = -s - 4s + 11, -17 = -zs - 2d. What is the highest common divisor of 24 and s? 3 Let y(z) = -642z - 2573. Let a be y(-5). Calculate the highest common factor of a and 784. 49 Let y(t) = 2t3 - 13t*2 + 34t - 56. Let l be y(15). Calculate the greatest common divisor of l and 11. 11 Let t = -16611 - -23622. What is the greatest common divisor of 171 and t? 171 Suppose -55w + 17w = -1710. Let z be 29 + -1 + (-8)/(-4). Calculate the greatest common factor of z and w. 15 Suppose -3l + 45 = t, -2t + 5t - 135 = 3l. Let c be ((-55)/15 - 1)/(2/(-45)). Suppose -cs + 825 = -94s. Calculate the greatest common divisor of t and s. 15 Suppose -13842 + 77297 = 173n - 171825. What is the highest common divisor of n and 64? 16 Let b = 113 + -113. Suppose b = -13v + 12v - 213. Let n = v - -303. Calculate the highest common divisor of n and 30. 30 Suppose 9g + 38g - 423 = 0. Suppose 0h - h = 0. Let d be 7 + -5 - (h + 0). Calculate the highest common factor of g and d. 1 Let t = 3843 - 3826. Calculate the greatest common divisor of 2227 and t. 17 Suppose -j - 3y + 11181 = 0, -5y + 7y = 6. Calculate the greatest common factor of j and 21. 21 Let q(l) = 159l - 6177. Let k be q(39). Let r = 10 + -1. Let d be (-6)/(-27) - (-52)/r. What is the greatest common divisor of d and k? 6 Suppose -109x + 8x = 0. Let r = -4 + 6. Suppose 2l = 4i + 22, -3l + ri + 2i + 27 = x. Calculate the highest common divisor of l and 45. 5 Let a(s) = -s + 32. Suppose 0 = -5r + 2k - 31, 3r = -r + 3k - 22. Let l be a(r). Calculate the highest common divisor of 13 and l. 13 Let p = -623 - -617. Let d be 493((-12)/(-36))/((-2)/p). What is the greatest common factor of d and 17? 17 Let g(z) = 22z2 + 25z + 4. Let p be g(-6). Suppose -238 = -v + 5c - 72, 4v - p = 2c. Calculate the highest common divisor of 69 and v. 23 Let a(u) = u3 - 10u*2 + 9u - 39. Let n be a(10). What is the highest common divisor of n and 69? 3 Suppose 3n + 24 = 5n. Let d(b) = b*3 - 26b*2 - 471b + 1302. Let p be d(38). What is the highest common divisor of p and n? 12 Let b = 0 + 2. Suppose -u - 501 = 4u + f, -4f - 504 = 5u. Let v be (u/35)/((-10)/35). Calculate the highest common divisor of v and b. 2 Let t(p) = p3 - 11p*2 - 4p + 61. Let k be t(11). Suppose -k = 16f - 21f + 3h, 5f = 2h + 13. Calculate the greatest common divisor of 4 and f. 1 Let p(q) = 665q*3 + 15q*2 - 54q + 36. Let k be p(3). Calculate the highest common factor of k and 12. 12 Suppose 12y = 11y + 9. Suppose 231 = yc - 849. Let m be (-14 + (-1 - 0))-1. Calculate the highest common factor of m and c. 15 Suppose -5j + 104 = -3j. Suppose -237m - 14496 = -7369 - 99557. What is the highest common divisor of j and m? 26 Let w(t) = 3t*2 - 52t - 24. Suppose 3j - 2j - 18 = 0. Let k be w(j). Calculate the greatest common factor of 324 and k. 12 Let m be (-15 + -5)/((-9)/48)(-30)/(-25). What is the greatest common divisor of m and 5120? 128 Let s be 33/32/1. Let n be (-3 - 2) + (2 + 2 - -5). Let f be ((-384)/(-84) - n) + 1228/7. What is the greatest common divisor of s and f? 22 Suppose -5i + 42 = 4g, -4i = -15 + 7. What is the greatest common factor of g and 1120? 8 Suppose -6b = -4b - 6. Suppose -5n + 12 = -bn. What is the greatest common divisor of n and 162? 6 Suppose -23b = -19b - 20. Suppose -4t + bt = -3c + 81, 2t - 3c = 144. What is the highest common factor of 90 and t? 15 Let z(u) = -u3 + u2 + 6u + 3. Let p be z(3). Let r be (36/4)/(p/(-2)). Let x be ((-14)/(-4) + -4)(r + 2). What is the greatest common divisor of 16 and x? 2 Suppose 37p + 43p - 10031 = 26369. What is the greatest common divisor of p and 40? 5 Let f(d) = 3d2 - 105d + 522. Let n be f(30). Let g be 2(7 - (0 + -1)). Calculate the greatest common divisor of n and g. 8 Let t be -4 - (-3)/(9/15). Suppose t = -2c + 19. Suppose 0 = cg - 7g - 180. What is the greatest common divisor of 10 and g? 10 Let f be (-186)/(-24) + 1 + 21/(-12). Suppose -12 = -4x - m, 3x - 3m = -m - 2. Let k be f - 6 - -6x/4. What is the greatest common factor of k and 3? 1 Suppose -63 = -5q + 2t, 3t - 53 = -4q - 44. Let j(y) = -y*3 - 2y*2 + 4y - 1. Let d be j(-4). Calculate the highest common factor of d and q. 3 Let u(p) = 2p2 - 65p - 135. Let z be u(35). Calculate the highest common divisor of z and 968. 8 Suppose 5b + a = 48, 0 = 4b - 5b + 5a - 6. Suppose 0 = -5m - 30, 65j = 63j - 4m - 12. What is the greatest common divisor of j and b? 3 Let m be (1-7)/(2/(-54)). Let l = 5336 - 5210. Calculate the highest common divisor of l and m. 63 Let y = -292 - -294. Suppose 0 = 12v - 15v - 15, -yo + 257 = -3v. What is the greatest common factor of o and 11? 11 Suppose 3d + 2o - 1938 = 0, 3o - 1632 = -2d - 335. Calculate the greatest common factor of d and 46. 46 Suppose -5f - 234 = -2v, 5v + f = 415 + 143. Let i = v + -77. Let b be 3 - 20/i(-21)/(-6). What is the highest common factor of 2 and b? 1 Let x be ((-246)/8)/((-75)/100). Suppose 89 = 2v + x. What is the highest common factor of v and 84? 12 Let m be (-27)/5 + 30/(-50). Let h(g) = -4g - 17. Let r be h(m). Suppose rk - 144 = 3k. What is the highest common divisor of 12 and k? 12 Let k be (-60)/3505 + (-159648)/(-56). Calculate the greatest common factor of 225 and k. 75 Let n be 1/(2 + 831/(-417)). Let m = n + -83. Suppose q + 50 = 5c, -4q - m = -4c - 0q. What is the highest common divisor of c and 99? 9 Let b be 126-2(-35)/70. Let n = 52 - 10. Calculate the highest common factor of n and b. 42 Let y = -20246 - -20290. Let t = -3 + 399. Calculate the greatest common divisor of y and t. 44 Suppose 2k + 0k = -10. Let x(p) = p*3 + 7p*2 + 3p. Let b be x(k). Calculate the greatest common divisor of b and 21. 7 Suppose 2v = -4g + 20, -2g + 10 = -2v + 6. Let n(x) = 11x + 21. Let w be n(g). Calculate the greatest common divisor of w and 26. 13 Let i(g) = -g3 + g2 - 54g - 31. Let n be i(-9). Calculate the greatest common divisor of 805 and n. 115 Let b(i) = -i*3 + 2i - 283. Let y be b(0). Let g = 433 + y. What is the greatest common divisor of g and 10? 10 Suppose -5a - 1415 = -5n, 0 = 5a + 20. Let x be 0 + -164. Let h = x + 55. Calculate the greatest common factor of h and n. 31 Suppose -3b = -2x - 46, 2x + 49 - 67 = -b. Calculate the greatest common factor of b and 144. 16 Let p(d) = d*3 + 13d*2 + 145d + 1178. Let h be p(-10). Suppose 2*f - 97 = 99. What is the highest common factor of h and f? 14 Let w be (-37110)/(-70) + (1 - (-18)/(-21))/(-1). Let	{ "pile_set_name": "DM Mathematics" }
-173ab (base 12) to base 5 -2032040 What is a186 (base 15) in base 12? 17899 What is 221100012200020 (base 3) in base 8? 63277255 What is -313233321 (base 5) in base 6? -43551445 17f02 (base 16) to base 13 35824 -11324066 (base 7) to base 2 -11110011100111001011 Convert 56696 (base 12) to base 16. 1c152 Convert 2113022 (base 8) to base 4. 2021120102 -14337324 (base 8) to base 3 -20010122001001 Convert -c2750 (base 16) to base 6. -25023252 What is 1133102002 (base 4) in base 9? 654317 What is -266c59 (base 13) in base 2? -11100010110111010100 What is -23313442 (base 5) in base 2? -110100001001110110 Convert -b2a34 (base 14) to base 16. -68ff6 Convert -5574312 (base 8) to base 16. -16f8ca What is 56532 (base 10) in base 4? 31303110 Convert -153053 (base 7) to base 10. -29879 What is 2461564 (base 10) in base 8? 11307574 Convert -202220212002020 (base 3) to base 12. -3882073 11111010001001000011 (base 2) to base 7 11465053 Convert -12332112131 (base 4) to base 9. -3385802 -1103526 (base 7) to base 8 -411106 -1011001101110010 (base 2) to base 3 -2100000102 Convert -139011 (base 10) to base 2. -100001111100000011 What is -3163276 (base 8) in base 7? -10121010 What is -3403223 (base 5) in base 4? -32212211 Convert 24d85a (base 15) to base 12. 7126aa Convert c224d (base 14) to base 11. 299902 100101220221 (base 3) to base 4 231030112 What is 4362500 (base 7) in base 5? 114130404 -958988 (base 11) to base 16 -176a21 -1930199 (base 14) to base 15 -116963b Convert -27de2 (base 16) to base 9. -268002 What is 84423 (base 10) in base 7? 501063 Convert 1100101011100010 (base 2) to base 7. 304265 66424035 (base 8) to base 6 1230234205 Convert 101110011101100110000 (base 2) to base 16. 173b30 -781121 (base 10) to base 5 -144443441 What is -1a6191 (base 13) in base 9? -1231517 Convert -223302113102 (base 4) to base 14. -174b198 102432145 (base 6) to base 11 1025766 What is -8b998 (base 14) in base 10? -339410 Convert -d96d3 (base 14) to base 12. -214109 4107761 (base 8) to base 15 16691a What is 6e561 (base 15) in base 16? 55fd8 What is 8908 (base 13) in base 10? 19105 What is -62812 (base 14) in base 12? -b5594 Convert -101101011010111 (base 2) to base 12. -1155b 134412231 (base 5) to base 14 143633 1001101000001001111 (base 2) to base 14 82d79 -1697 (base 10) to base 2 -11010100001 -148453 (base 12) to base 4 -1110201333 Convert -a2244 (base 13) to base 8. -1067136 What is -2311002022 (base 4) in base 10? -741514 What is -310302123212 (base 4) in base 13? -2b367c9 165a652 (base 12) to base 16 46341e What is -1000102100000221 (base 3) in base 7? -234600661 Convert -163b5 (base 14) to base 4. -31211023 -112510124 (base 6) to base 12 -84b344 Convert 1002202030 (base 4) to base 10. 272524 57443a6 (base 11) to base 16 9957f9 What is 2114313110 (base 5) in base 12? 15a6029 Convert -eab0f (base 16) to base 14. -1b047d -20964 (base 10) to base 2 -101000111100100 What is 15882b3 (base 13) in base 8? 32336636 29a9061 (base 12) to base 14 1197ac1 -50745 (base 10) to base 11 -35142 What is 26681 (base 11) in base 2? 1001010011000011 Convert 101100111110011101111 (base 2) to base 6. 51331011 Convert 32213303012 (base 4) to base 5. 1440124110 What is -287574 (base 10) in base 3? -112121110220 What is 206800 (base 10) in base 5? 23104200 -7474a1 (base 12) to base 5 -432300221 Convert 187eb98 (base 15) to base 9. 36555758 243452 (base 8) to base 4 110130222 394210 (base 11) to base 15 c3cb9 Convert -3031300 (base 6) to base 4. -203030310 What is 315252 (base 7) in base 13? 1bb67 6123132 (base 7) to base 10 728604 Convert -5a768 (base 14) to base 2. -110101111100111000 Convert 403132201 (base 5) to base 2. 110001010001101010100 What is -13032100223 (base 4) in base 7? -22044113 Convert 666064 (base 9) to base 11. 252102 What is -276007 (base 8) in base 12? -48373 -b0795d (base 14) to base 15 -7c422e -21bbc0 (base 14) to base 16 -117ecc -116a53 (base 14) to base 10 -594737 Convert 22952 (base 16) to base 15. 2be85 -4432135 (base 6) to base 4 -312032123 What is -102268 (base 9) in base 8? -166473 115a243 (base 12) to base 10 3356115 Convert -51635 (base 10) to base 11. -35881 Convert 7801a (base 11) to base 4. 123220010 -6505458 (base 9) to base 10 -3487913 What is -2166027 (base 10) in base 7? -24260643 Convert -63727 (base 16) to base 11. -259045 What is 5963c (base 13) in base 7? 1251044 What is -1000030100322 (base 4) in base 8? -100142072 a7c0 (base 13) to base 6 255525 110102012201 (base 3) to base 4 323222101 -3826e (base 15) to base 11 -112898 1243004 (base 6) to base 11 47139 Convert 9311 (base 16) to base 12. 19955 210102100110 (base 3) to base 11 268849 Convert -100300 (base 7) to base 14. -6270 Convert -4723621 (base 8) to base 15. -1a69c1 What is -2a4904 (base 15) in base 7? -23226031 Convert -125345 (base 10) to base 5. -13002340 Convert 213202232201 (base 4) to base 12. 357a915 Convert -21421 (base 16) to base 10. -136225 Convert 1069139 (base 15) to base 7. 201442521 20022210212022 (base 3) to base 16 334d00 Convert 59ac56 (base 15) to base 9. 8056400 Convert -12ba07 (base 15) to base 16. -dbba7 Convert 4110332 (base 5) to base 8. 201446 Convert -403446 (base 11) to base 7. -5341226 What is 2002240 (base 6) in base 16? 16e90 Convert -4b48d (base 14) to base 6. -3543205 What is -66921c (base 14) in base 12? -11bb44a Convert 30310101131 (base 4) to base 14. 636605 Convert -22033224 (base 5) to base 12. -91a1a -100021220011012 (base 3) to base 5 -2231011414 Convert -36360 (base 12) to base 11. -4a9a7 What is 1bc394 (base 16) in base 13? 4b9268 -44c8a3 (base 13) to base 6 -54513345 Convert -2030043 (base 6) to base 5. -11102402 What is 2148751 (base 9) in base 4? 10121320330 Convert -1042247 (base 10) to base 6. -34201115 What is 163532 (base 10) in base 3? 22022022202 1200004421 (base 5) to base 16 29bb8a Convert -623569 (base 13) to base 5. -1041324103 14521513 (base 7) to base 16 151c96 Convert 11299c (base 13) to base 2. 1100011000110001010 d3047 (base 15) to base 4 2203022131 -bcc29 (base 14) to base 15 -90a13 101102001012120 (base 3) to base 12 1a29336 What is 855b16 (base 14) in base 16? 44d368 -86d2ca (base 15) to base 12 -2199201 Convert -301033020 (base 4) to base 13. -70a43 What is 13ba727 (base 13) in base 12? 2129165 What is -3230230121 (base 5) in base 2? -11010010000011101011001 Convert 15529 (base 16) to base 4. 111110221 Convert -124110530 (base 6) to base 4. -21102210312 What is 280392 (base 13) in base 16? ed3b4 108037 (base 10) to base 5 11424122 -12111121030 (base 4) to base 14 -3131c8 -121011221000 (base 3) to base 11 -1a8343 What is -1210101111221 (base 3) in base 12? -39b22a What is 120545020 (base 6) in base 16? 22dc64 What is 1450625 (base 8) in base 13? 11663c Convert -320010000 (base 4) to base 6. -4531040 What is 17a889 (base 13) in base 9? 1105637 -1123775 (base 9) to base 11 -384694 What is 371037 (base 8) in base 10? 127519 -5778360 (base 9) to base 8 -13722654 Convert -131a5 (base 16) to base 12. -39345 212824a (base 11) to base 8 16221217 Convert 33a77aa (base 13) to base 14. 217b32a 2422314220 (base 5) to base 12 1a934a2 What is 4554454 (base 6) in base 5? 24424101 123066 (base 7) to base 14 83a6 2312312201 (base 4) to base 15 ebdab Convert b01926 (base 12) to base 4. 22130333232 What is 378632 (base 10) in base 11? 239521 What is -23014441 (base 6) in base 16? -ab6d9 What is 1111011001101001011 (base 2) in base 3? 221122020210 What is 2f9340 (base 16) in base 11? 183a574 What is -118265 (base 10) in base 4? -130313321 446304 (base 9) to base 15 541e1 -1000111000111000010110 (base 2) to base 3 -11101101100021 Convert 3333232032 (base 4) to base 14. 1d3a10 What is 133be (base 15) in base 11? 42314 Convert 5c5007 (base 16) to base 3. 102101100202122 3000154 (base 8) to base 9 1427833 -340422 (base 7) to base 14 -17d49 -7ba06c (base 13) to base 16 -2cc9f2 What is 132200001 (base 4) in base 14? 33757 What is -550f7c (base 16) in base 13? -1202447 What is -1233313012 (base 5) in base 12? -101b1b3 Convert -273af4 (base 16) to base 7. -30565421 Convert -120200011122002 (base 3) to base 8. -37614106 Convert 2233012 (base 6) to base 12. 55768 What is 21413042 (base 5) in base 3? 100102022120 What is 3e5475 (base 15) in base 8? 133545	{ "pile_set_name": "DM Mathematics" }
00sqrt(2) + 7297 Simplify -21(4 + (6sqrt(192))*2). -13832 Simplify ((sqrt(832) + sqrt(832) + sqrt(832) + -2 + sqrt(832))-3-5-6)*2. -1036800sqrt(13) + 107859600 Simplify (sqrt(209) - -6(sqrt(209) - (sqrt(209)5 + sqrt(209))) - sqrt(209))/(sqrt(1100) + sqrt(1100)3). -3sqrt(19)/4 Simplify (5(sqrt(304) + -4-1sqrt(304) + 1 + sqrt(304) + -1))2. 273600 Simplify 0 + (sqrt(84)/sqrt(3)3)/(sqrt(4) - sqrt(4)-13). 3sqrt(7)/4 Simplify (((sqrt(80) - sqrt(80)4)/sqrt(5))/sqrt(8) - (sqrt(400) + (sqrt(400)-1 - sqrt(400)) - sqrt(400) - sqrt(400))/sqrt(8))2. 288 Simplify ((-1sqrt(17))*24 - ((sqrt(2057) + 2 + sqrt(2057))*2 + sqrt(17)))-5 + 5. 445sqrt(17) + 40825 Simplify 1 + sqrt(200) + sqrt(2)2 + 5 - sqrt(6)/(1sqrt(147)). 6 + 83sqrt(2)/7 Simplify (-6-2sqrt(384) + sqrt(384) - sqrt(384))/(-2sqrt(2352)). -12sqrt(2)/7 Simplify (-4 + (3sqrt(119)/sqrt(7) - (sqrt(51)2 + sqrt(51))/sqrt(3)))*2. 16 Simplify (-1 + 4(0 + sqrt(117))-3-3)*2. -216sqrt(13) + 151633 Simplify 0 + (sqrt(605) + sqrt(605) + 3 - sqrt(605)) + 2 + -4. 1 + 11sqrt(5) Simplify (3 + sqrt(3) + sqrt(3) + (-1sqrt(12)/sqrt(4) - sqrt(3)) + sqrt(108) + -2)*2. 12sqrt(3) + 109 Simplify 4 + (3((1sqrt(85) - sqrt(85)) + sqrt(85)) - sqrt(85))/(sqrt(5) - sqrt(45)/sqrt(36)). 4 + 4sqrt(17) Simplify (sqrt(288) + sqrt(288)1)/(1sqrt(81)) - ((sqrt(2)-1-4 - sqrt(24)/(1sqrt(12)))-3)2. -162 + 8sqrt(2)/3 Simplify (6sqrt(3388)-2)/(sqrt(324)-11). 44sqrt(7)/3 Simplify -2 + ((sqrt(252)-1-6 - sqrt(252))/((sqrt(12) - (sqrt(12) - (-1sqrt(144))/sqrt(12)))/sqrt(3)))*2. 1573 Simplify (-6(5(sqrt(15) + sqrt(1500)))/(sqrt(500)2))*2. 3267/4 Simplify ((-2(sqrt(612) + 1) - (sqrt(612) + -2sqrt(612) + -1)) + 4 + sqrt(612) + sqrt(612)-2 + sqrt(612) + -5(1 + sqrt(612)))2. 144sqrt(17) + 22036 Simplify -4(-6(sqrt(204) + sqrt(204) + (sqrt(204) - (sqrt(204)1 + sqrt(204))) + sqrt(204) + sqrt(204)))/(sqrt(96)/sqrt(200)). 360sqrt(17) Simplify (5(sqrt(187) - 2sqrt(187)) - sqrt(187))/((sqrt(33)2 + sqrt(33))/sqrt(3))-3. 6sqrt(17) Simplify 5 + (sqrt(1911)-2 + sqrt(1911))/(sqrt(3)-32). 7sqrt(13)/6 + 5 Simplify -4 + (-5(sqrt(117) - sqrt(117)-1-3))/(sqrt(18)/(-2sqrt(2) - sqrt(2))-1). -4 + 30sqrt(13) Simplify (0 + -2 + ((sqrt(1539) + sqrt(1539)-1 + sqrt(1539))-2 - sqrt(1539)))-51. 10 + 135sqrt(19) Simplify (-5sqrt(102)-2 - (sqrt(102) + (sqrt(102)-2 - sqrt(102)) + sqrt(102) + sqrt(102) - sqrt(102))-3)/(sqrt(36)/(1sqrt(18)/sqrt(3))). 7sqrt(17) Simplify (sqrt(147) - (sqrt(147) + -5(sqrt(147) + 0))) + 2 - (0 + (sqrt(147) + sqrt(147)-1)*2 + -1). 3 + 35sqrt(3) Simplify (-3(5(0 + sqrt(1700)) - sqrt(1700))-4)255. 97920000 Simplify -1(5 + (sqrt(2) - (sqrt(2)1 + -5))) + -1. -11 Simplify -6sqrt(99)/(sqrt(72)/(1sqrt(8)))-22. 24sqrt(11) Simplify sqrt(110)/(sqrt(30)/sqrt(3)) - ((-2sqrt(88))/sqrt(8))2 - ((sqrt(110)-2-3)/sqrt(10))2. -440 + sqrt(11) Simplify (sqrt(162) - (sqrt(162) + sqrt(162)-1))/(sqrt(144)1) + (-1((sqrt(200) - (0 + sqrt(200)1)) + sqrt(200)))2. 3sqrt(2)/4 + 200 Simplify (-4 + sqrt(1700) + sqrt(1700) + 1 + -2)5 + 5. -20 + 100sqrt(17) Simplify (2sqrt(96))/(sqrt(18)6). 4sqrt(3)/9 Simplify ((2sqrt(104)3 - sqrt(104)) + sqrt(104)2-3)/(1sqrt(128) - sqrt(64)/(sqrt(8) + sqrt(24)/sqrt(3))). -2sqrt(13)/7 Simplify (12sqrt(104))/(sqrt(24)/sqrt(12) + sqrt(8)) - (-2 + 5(sqrt(637) + 0 + sqrt(637)))*2. -63704 + 844sqrt(13)/3 Simplify (-2 + 3(sqrt(468) - 5sqrt(468)1 - (3 + sqrt(468) + -5)))2. -720sqrt(13) + 105316 Simplify (-3 + (sqrt(162)/(sqrt(6) - sqrt(6)-2))/((sqrt(27)/sqrt(3) + sqrt(9))-1) + -2)*2. 5sqrt(3)/3 + 301/12 Simplify (sqrt(12) - (-6sqrt(300) + sqrt(12) - sqrt(12)) - sqrt(12))/sqrt(4) + (5 + 2 + sqrt(12))2. 61 + 58sqrt(3) Simplify (0 + sqrt(275) + 1 + 3 + 1)*2. 50sqrt(11) + 300 Simplify ((sqrt(272) - (sqrt(272) + 1sqrt(272) + sqrt(272))5) + -3 - (sqrt(272) + sqrt(272) + sqrt(272)-1 + 5)-4)*2. -1360sqrt(17) + 27489 Simplify (-2sqrt(882)-5)/((sqrt(162)/(sqrt(36)/sqrt(4)))/sqrt(2)). 70sqrt(2) Simplify -3 + (sqrt(343) + 2 + -1 + sqrt(343) + 5(sqrt(343) + -1))*2. -392sqrt(7) + 16820 Simplify (sqrt(21)/(6sqrt(75)) + -4 + 4sqrt(7) + -4)*2. -968sqrt(7)/15 + 160087/900 Simplify (-4 + ((sqrt(1053) + (sqrt(1053)-4 + sqrt(1053) + sqrt(1053) + sqrt(1053))2)1 - (sqrt(1053) + -1 + sqrt(1053) + sqrt(1053))*24))-3. -675sqrt(13) + 110589 Simplify 0 + -3(-1 + sqrt(153))2 - -3(0 + sqrt(153) + -5 + sqrt(153))*2. -162sqrt(17) + 1449 Simplify (-1(2 + -4 + (sqrt(396)-2 - sqrt(396))4))2. 288sqrt(11) + 57028 Simplify (-1 + (sqrt(75) + -5 - -2sqrt(3)-1)*2 + -1)-6. -300 + 180sqrt(3) Simplify 3(-2 + sqrt(208) + 3 + sqrt(208))*2-3 + -5. -7502 - 144sqrt(13) Simplify (sqrt(3264) + -6sqrt(3264)2)/(sqrt(297)/sqrt(275)). -440sqrt(17)/3 Simplify (-5 + (-2(sqrt(1053) + (sqrt(1053) - sqrt(1053)2)) - (((sqrt(1053) + -5sqrt(1053))-6 - sqrt(1053)) + sqrt(1053) - sqrt(1053))))*2. 2070sqrt(13) + 557062 Simplify (3(sqrt(5) + (sqrt(5) - (sqrt(5) + (sqrt(45) - sqrt(5)))2)) - (1 + sqrt(20)/sqrt(4))) + -2 + (sqrt(20)/sqrt(4) - sqrt(5)) + -5. -143 + 5sqrt(5) Simplify 5sqrt(85)/sqrt(5) + -2 - (5 + sqrt(17) + (sqrt(17) + 3 + (sqrt(17) - 2sqrt(17)))*2). -16 + 4sqrt(17) Simplify ((1 + 5 + sqrt(19)-1)1 + -3 + sqrt(2299) + 2sqrt(2299)5)*2. 720sqrt(19) + 273609 Simplify (4sqrt(220)/sqrt(4))/(sqrt(5) + (sqrt(245) - sqrt(245)3) + sqrt(5)). -sqrt(11)/3 Simplify ((6(1 + sqrt(325)))2 + 5)-1. -11741 - 360sqrt(13) Simplify -5 + (sqrt(20) + sqrt(500)3)/(sqrt(10) + (sqrt(1210) - sqrt(1210)2)). -5 - 8sqrt(2)/5 Simplify 4 + (sqrt(180) + 0)*2 + 2(sqrt(500) + -3). 20sqrt(5) + 178 Simplify (-3-2-2sqrt(1377) - (-2(sqrt(68) + sqrt(68)-2))/(sqrt(4)21))*2. 201977 Simplify sqrt(17) + (1sqrt(119))/sqrt(7) + (4sqrt(153))2 + ((sqrt(1088) + 0)-4)*2. 2sqrt(17) + 19856 Simplify (0 + -1 + sqrt(396) + (-1 + sqrt(88)/sqrt(8))2)22. -96sqrt(11) + 1426 Simplify (1(2 + sqrt(176)) + 1 + 2sqrt(176) + -3)2. 1584 Simplify (((6((2sqrt(360) - sqrt(360)) + sqrt(360) + sqrt(360)) + sqrt(360))/sqrt(8) + -5 + 2sqrt(405))-5)2. -18750sqrt(5) + 703750 Simplify sqrt(972) + 5(1 + sqrt(972)) + sqrt(972) - (sqrt(288)/sqrt(128))/((1sqrt(120))/sqrt(10)). 5 + 503sqrt(3)/4 Simplify (3(-4 + -3 + sqrt(931)))*2 - (1sqrt(931)1 - (sqrt(931) + sqrt(931) + (4 + sqrt(931) + 1 - sqrt(931))))2. -952sqrt(19) + 7864 Simplify (1sqrt(171)6 - 6-1sqrt(171))/((sqrt(441) + (sqrt(441) - (sqrt(441) + (sqrt(441) - -1sqrt(441) - sqrt(441)))) + sqrt(441))-5). -12sqrt(19)/35 Simplify (-4(4(sqrt(162) - -4sqrt(162)) - (1-2sqrt(162) - sqrt(162))))*2. 1371168 Simplify (((sqrt(63) - (sqrt(252) + sqrt(63)))/sqrt(3)2)/((sqrt(7) - 5((sqrt(7) - sqrt(7)-2) + sqrt(7))) + sqrt(63)/sqrt(81)))*2. 27/196 Simplify (-1 + -1 + (sqrt(176) + 0 + -4)-3)*25. -1200sqrt(11) + 8420 Simplify ((sqrt(144) - (-1sqrt(144) + sqrt(144)))/sqrt(6))/(sqrt(800) + sqrt(800) + sqrt(800) + sqrt(800)-1). sqrt(3)/20 Simplify 1 + (-2 + sqrt(1088))2 + 1 - (-6(sqrt(1088) - -1sqrt(1088))2 - (-5 + (sqrt(1088) + -2 - sqrt(1088)))2). -32sqrt(17) + 27255 Simplify (5(sqrt(931)3 + -1)-6)25. -189000sqrt(19) + 37710000 Simplify -2(-2sqrt(25)-6)/(sqrt(245)-1 + sqrt(245) - sqrt(245) - sqrt(245)). 12sqrt(5)/7 Simplify (5 + -3sqrt(272) + -5 + 1)2. -24sqrt(17) + 2449 Simplify 2 + (31sqrt(52)1)/(sqrt(20)/sqrt(5)-1-4). 2 + 3sqrt(13)/4 Simplify (-1 + sqrt(20)/sqrt(4) + -2 + 2sqrt(720)1)*2. -150sqrt(5) + 3134 Simplify (sqrt(1584) + -6(sqrt(1584)-2 - sqrt(1584)))*2 + (-2sqrt(88))/sqrt(8) + 5. -2sqrt(11) + 571829 Simplify (((sqrt(153)1 - sqrt(153))-5)/(sqrt(72)/sqrt(2)) - (sqrt(272) + 4(sqrt(272) + 2sqrt(272)))6)*2. 1654848 Simplify (sqrt(448) + ((sqrt(448) + 1 - sqrt(448)) + -5 - sqrt(448)) - (-5(2 + sqrt(448)))*2)-1-5. -56520 - 4000sqrt(7) Simplify ((sqrt(320)1 + sqrt(320))1)/(sqrt(24)/(sqrt(36)/(1sqrt(6))))6. 48sqrt(5) Simplify -5 + ((-3(sqrt(567) + 0))*2 - (sqrt(14)/(sqrt(288)2 + sqrt(288) + sqrt(288) + sqrt(2)))*2). 1748613/343 Simplify (-2(sqrt(5) + 1 + -5 + sqrt(5)) - sqrt(10)/(sqrt(6)/(sqrt(15)/sqrt(5))))*2. -80sqrt(5) + 189 Simplify (-4(-3 + (sqrt(684) + -2)-3))**2. -	{ "pile_set_name": "DM Mathematics" }
the second smallest value? (a) 4 (b) 0 (c) q b Let u be (-50)/(-12)3798/1055. Which is the second biggest value? (a) 1 (b) -14 (c) 3 (d) -0.5 (e) u c Let m = 3962 + -3949. What is the second smallest value in 0.03, -3, m? 0.03 Let g = -0.1 - 0. Suppose 553 = 9k + 3370. Let d = -301 - k. Which is the second biggest value? (a) g (b) 0.1 (c) d b Suppose 15p = 10p - 5g + 150, 0 = -p + 2g + 36. Which is the second smallest value? (a) 5 (b) 1/3 (c) p a Let j be (-2)/393 - 4488/1248. Which is the second biggest value? (a) -0.3 (b) -2/117 (c) j a Let s = -15853 - -380471/24. Which is the biggest value? (a) 4 (b) 3 (c) -2 (d) s a Let t = 4322 - 739064/171. Let a = -328/1197 + t. What is the third biggest value in a, 0, -13? -13 Let x(d) = d3 - 8d*2 + 4d + 15. Let v be x(7). Let i = 75 + -44. Let u = -30.7 + i. Which is the second biggest value? (a) v (b) u (c) 0.4 b Let j = 192 - -129. Let b = -306 + j. Let q = -12/35 - 2/35. What is the second biggest value in q, b, -5? q Let i = -8068.9 + 8069. Which is the smallest value? (a) i (b) -0.2 (c) -36 (d) 0.4 c Let j = 80 - 78. Let p = -2 - 1. Let m = -0.4 - -0.9. Which is the fourth biggest value? (a) j (b) p (c) m (d) -0.2 b Let i = -3 + 0. Let t = -125986 + 125986.3. Which is the fourth smallest value? (a) -20/3 (b) t (c) i (d) 5 d Let k be ((-54)/63)/(3/(-14)). Let q be (-7)/(-2) + k/(-4)2. Let a = 18 + -20. What is the biggest value in 0.3, 0.4, q, a? q Let v = 8.391 - -1.609. Let y = 13.7 + -18.7. Which is the third biggest value? (a) -2 (b) -2/23 (c) v (d) y a Let d be (-4 + (-511)/(-90))/(16/(-20)). Let l = d + 15/8. What is the smallest value in -2, l, -1, 4? -2 Suppose 78d - 33 = 67d. Suppose 5s + 3n = -40 + 30, 0 = ds - n + 20. What is the third biggest value in -0.08, -2/3, s? s Let q = -7182 + 7179. Which is the fourth smallest value? (a) -1 (b) 3 (c) 1/6 (d) 3/2 (e) q d Let s = -1388 + 1387.5. Let w = -11.1 + 11. Let d = 2.5 - 2. What is the fourth biggest value in 2/5, w, s, d? s Suppose 32 = 2p - 4t, 24 = -23p + 25p - 2t. Let k(j) = -11j + 92. Let i be k(p). Let u = 1.5 - 1. Which is the third biggest value? (a) u (b) i (c) -9 c Let q(k) = k*3 + 10k*2 + 342k + 2980. Let p be q(-9). Let l = -0.58 - 5.82. Let f = 6 + l. Which is the second smallest value? (a) -1/3 (b) p (c) f c Suppose 0 = 3i - 4q - 47, 144i - 148i - 3q - 54 = 0. Let l = -3 - -2.5. What is the third biggest value in l, i, -2/11? i Let m = -1549 + 1546. Which is the smallest value? (a) 1/5 (b) m (c) 0.228 b Let q = 21 + -20.78. Let y = q + -0.02. Let n = -309 - -312. Which is the second smallest value? (a) n (b) y (c) -1/3 b Let h = -102 - -66. Let p be ((h/(-8))/1)/((-105)/(-28)). What is the third biggest value in 3, -3, p? -3 Let y = 19 + -16. Let g = 7994 + -7992. What is the second smallest value in g, -0.11, -0.3, y? -0.11 Let g = -3 - -3.3. Let z = 0.065 - 0.065. Let l(h) = -27h + 102. Let b be l(4). What is the third biggest value in -0.1, g, b, z? -0.1 Let p = -830/23 - -1683/46. Let m be (-6)/21 + (-26)/(-42). Which is the third smallest value? (a) -1 (b) p (c) 1 (d) m b Let y = 0.189 + 4.111. Let t = 0.7 + y. Let o = -926/11 + 84. Which is the third smallest value? (a) o (b) 2 (c) t c Let h(q) = 2q + 0 + 2 - q. Let j be h(0). Let z = 1122/65 - 214/13. Which is the fourth smallest value? (a) 3/2 (b) j (c) z (d) -5/6 b Suppose -10 = -7s - 38. Let p be (s + (-13)/(-2))18/105. Let v = 0 + 2. Which is the third smallest value? (a) v (b) -4 (c) p (d) 0.4 c Let y be (2/24)/((-2071)/(-114) + -18). What is the third smallest value in -5/22, y, 2, 0.2? y Suppose 35t - 7593 = -17t - 1977. What is the second smallest value in -0.48, t, 2/7? 2/7 Let r = -0.05932 + 0.45932. Which is the smallest value? (a) -1 (b) -2 (c) 0.1 (d) r (e) 3/2 b Let c be (19057021/18)/(100/15). Let k = c - 158798. Let v = 83/8 - k. What is the second smallest value in v, -1/3, -3/7? -1/3 Let n = 6.2 - 1.2. Let t = -427 - -467. Suppose -3b - 3r - 2r = 40, t = -4b - 4r. What is the fourth smallest value in -1/3, 0.5, n, b? n Let i = 39.68 + -40. Let r = i - 20.68. Let d = -23 - r. Which is the second smallest value? (a) d (b) 3 (c) -1/11 c Let w(u) = u*2 - u - 4. Let s be w(7). Let f be s/84 - 2/7. Let h = 110.2 - 110. Which is the second smallest value? (a) f (b) -4 (c) h (d) 9 a Let v(k) = 7 - 4k*3 - 6k + 5 + 5k2 + 5k*3. Let w be v(-6). Suppose 37 = 5m + w. What is the second biggest value in -3, -4/7, m? -4/7 Let m = 619.5 - 627.5. What is the third biggest value in -3/10, m, -1/4? m Let r = 15 + 18. Let n be (-340)/(-112) + -2 - r/44. Let w be 3/(-1 - 2) + 2. What is the smallest value in n, 0.1, -2/3, w? -2/3 Suppose 3o - 7c + 108 = -10c, 0 = o - c + 28. Let i be (o/(-20))/(-2)1/4. What is the biggest value in -5, 3, -0.11, i? 3 Let n = -5353 - -5352.8. What is the third smallest value in -29, 6, n, 0.2? 0.2 Let z = -831.4 + 831.8. What is the fourth smallest value in 0.15, 1/2, z, -4? 1/2 Let l(i) = -2i3 + 18i*2 + 3i + 8. Let c be l(10). Let y = c + 160. What is the fourth smallest value in -0.3, 2, y, -0.2? 2 Let k = -395 + 3553/9. Let q = -122 + 150. What is the third biggest value in q, -5, -3, k? -3 Let i = -2 - -1.5. Let g = 7858/7 + -1123. Which is the biggest value? (a) i (b) 65 (c) g b Let c = 7.45 + -71.45. What is the second biggest value in 3, c, 2/5? 2/5 Let i = 261/7 + -37. Let m be (18/30)/((59 - 58) + (-2)/20). What is the second smallest value in 0.1, -4, m, i? 0.1 Suppose 2a = 10 - 2. Suppose -6j = 5 - 203. What is the second smallest value in a, j, 1/4, -5? 1/4 Suppose 0 = 54g - 48g - 6. Let j = 4 + 9. Let l = -13 + j. Which is the third biggest value? (a) 2 (b) g (c) l c Let x = -23118 - -23117.9. What is the second biggest value in x, 3, -18, 4? 3 Let k = -690 - -687. Let g = 1/1248 - -11/96. Which is the smallest value? (a) k (b) -1 (c) g a Suppose -28x + 22x = -990. Let n be 4/(-22) + ((-126)/x)/(-2). Which is the second biggest value? (a) 2 (b) -0.2 (c) n (d) -1/7 c Let z be (8/10)/4 - 1214/(-1530). Let o = -15/17 + z. Which is the smallest value? (a) -0.1 (b) -12/11 (c) o b Let u be 15/14021/6. Let t = 3.93 - 3.9. Let a = 1.4 - 6.4. What is the second smallest value in a, u, t, -0.2? -0.2 Let q = -151 - -169.5. Let o = 24.5 - q. What is the second biggest value in -2, o, -1/2, 5? 5 Let p be (-5)/(-2) + (140/(-40) - -4). Let q be 1(-5 - -9)/28. Which is the second smallest value? (a) 4/5 (b) -0.4 (c) p (d) q d Let m = 0.15126 + -0.05126. Which is the second biggest value? (a) -8 (b) m (c) -1.78 c Let b be ((2 + -3)-353)/3. Let p = -117 + b. Suppose -1 = x - 0. What is the smallest value in x, p, 4, 1/7? x Let n = 1424/5 - 284. Let b = -2024161/9 + 225156. Let i = b + -249. What is the fourth biggest value in -1/6, -3, i, n? -3 Let p = -0.8 + 0.4. Suppose 14 = -150m + 143m. Let s be 0 + (3 + m - -4). What is the smallest value in p, -5, s, -4? -5 Let d be ((-32)/(-320))/((-1)/(-906)). Let y = -90 + d. Which is the third biggest value? (a) -0.05 (b) 3 (c) y a Let w = 323.5 - 323. Let k = 17.26 - 2.26. What is the second biggest value in k, w, -0.5, 4? 4 Let s = 3.2 + -4.66. Let x = 0.54 - s. What is the third biggest value in 3, 0.5, 0.1, x? 0.5 Let w = 0.25904 - -0.04096. What is the second biggest value in 763, w, 2? 2 Suppose 0 = 4y + 5f - 35, -4y + 29 = 5f - 2f. Which is the smallest value? (a) 2/13 (b) y (c) 3/7 (d) -1/6 d Let g = -16.09 + 15.69. What is the fourth biggest value in g, 3/7, 5/2, -34, -5? -5 Let v = 175.5 + -91. Let n = -107 + v. Let d = n - -22. Which is the second smallest value? (a) d (b) -1/69 (c) 4 b Let r = -1970 + 9854/5. Let j = -42.5 + 46. Which is the fourth biggest value? (a) 0.5 (b) r (c) j (d) -2/5 d Let y be ((-17)/102 - 205/(-510))/2. What is the third smallest value in y, 0.14, -0.24? 0.14 Let d = -95/6 - -2173/138. Let q = 323.963 - 324. Let v = -3.037 - q. What is the second biggest value in -4, d, v, -5? v Let s be 4 + (-1 - 1) + -2. Suppose 4v = -3f - 4, sv = 4f + 3*v + 10. Let w = -4 - 1. Which is the biggest value? (a) w (b) f (c) -0.2 (d) -0.1 d Let l = -3964331/549 - -7221.	{ "pile_set_name": "DM Mathematics" }
y + 40y - 13y for y. 12 Solve -12b - 23b = -2585 + 1535 for b. 30 Solve 55r - 979 = 114 - 213 for r. 16 Solve -49i - 205 = 350 - 114 for i. -9 Solve 52w - 199w = 113w + 7020 for w. -27 Solve -16z + 15z = -68z - 1005 for z. -15 Solve -77v - 1061 = -830 for v. -3 Solve 0 = 45i - 92i + 282 for i. 6 Solve 167p - 20 = 165p for p. 10 Solve -1960d + 7 = -1967d for d. -1 Solve 0 = 11k + 16k - 4k + 322 for k. -14 Solve -42i + 12259 = 12301 for i. -1 Solve -9n = -26n - 43n - 840 for n. -14 Solve 0 = 74i + 9556 - 8668 for i. -12 Solve 684c + 9021 + 555 = 0 for c. -14 Solve 1162 = -260l + 19l - 2212 for l. -14 Solve -16f - 154 = -21f - 72f for f. 2 Solve 101r - 2494 + 676 = 0 for r. 18 Solve -91o = -547o - 11o + 8873 for o. 19 Solve 0 = 507v + 30448 - 40588 for v. 20 Solve 2q + 15706 - 15730 = 0 for q. 12 Solve 13 - 1042 = 20r - 69r for r. 21 Solve -238x + 320x - 246 = 0 for x. 3 Solve -49n + 64n = -50n + 130 for n. 2 Solve 531 = 32k - 91k for k. -9 Solve 71n + 4048 = 32n + 292n for n. 16 Solve -134i + 480 = -185i - 132 for i. -12 Solve -16644t - 12 = -16646t for t. 6 Solve -237j + 796j - 6708 = 0 for j. 12 Solve 180h + 101h - 32h - 4482 = 0 for h. 18 Solve 119j + 22j - 1782 = -21j for j. 11 Solve 289d + 30d = 20d - 2691 for d. -9 Solve 105g + 3g = -93g - 1407 for g. -7 Solve -366 = 3t - 381 for t. 5 Solve -74z - 755 = 135z - 2218 for z. 7 Solve 0 = -37y + 213 + 342 for y. 15 Solve -123o - 1204 = 764 for o. -16 Solve 185f = 47 - 1342 for f. -7 Solve 9f - 1461 + 1497 = 0 for f. -4 Solve 17v + 559 = 58v - 220 for v. 19 Solve -126z - 104z = -213z - 442 for z. 26 Solve 0 = 152g - 75g - 616 for g. 8 Solve 69d - 21d = -37d - 510 for d. -6 Solve 0 = -68q + 47q - 63 for q. -3 Solve -15m + 86 + 96 = 182 for m. 0 Solve 0 = 20565y - 20552y - 416 for y. 32 Solve -145r = -450r - 6405 for r. -21 Solve 353u - 234u = -1428 for u. -12 Solve 25y + 416 = -446 + 162 for y. -28 Solve -89u + 736 = 1524 + 1081 for u. -21 Solve -10d = -68d - 760 + 64 for d. -12 Solve -33s - 133 = -3s - 11s for s. -7 Solve -91r = r + 45r - 2740 for r. 20 Solve -580a + 870a = 5220 for a. 18 Solve 1303n = 1335n + 47 + 17 for n. -2 Solve 0 = -109r + 985 + 661 - 229 for r. 13 Solve 0 = 34r - 1949 + 2459 for r. -15 Solve 55s - 91s = -576 for s. 16 Solve -44n - 805 = 34n - 259 for n. -7 Solve 21 = 64z + 277 for z. -4 Solve -128r - 1054 = 2018 for r. -24 Solve -160w = -41w - 44 - 3288 for w. 28 Solve -495 = 251h - 244 for h. -1 Solve 8v + 16v + 23 = -217 for v. -10 Solve 2350w - 2297w = 583 for w. 11 Solve -1917g + 1768g = 1639 for g. -11 Solve -445v + 479v = -408 for v. -12 Solve -262 + 2112 = 22y - 96y for y. -25 Solve 198 = -9k - 16k - 41k for k. -3 Solve -920 = 141x - 95x for x. -20 Solve 722c + 4743 = 195c for c. -9 Solve -12m = -24m + 192 for m. 16 Solve -30d + 260 = 119 - 219 for d. 12 Solve -3m + 252 = -19m - 47m for m. -4 Solve 444y = 374y - 350 for y. -5 Solve 42n - 1000 - 1106 = -120n for n. 13 Solve 0 = -715u - 32u + 5976 for u. 8 Solve -374 = 106a - 120a + 46 for a. 30 Solve -284 = -52g + 272 + 16 for g. 11 Solve -1793w = -1814w for w. 0 Solve -403v + 18239 = 390v for v. 23 Solve 153c - 340c - 269c = -4104 for c. 9 Solve -271v + 807 = -6 for v. 3 Solve -2u + 180u + 28u - 618 = 0 for u. 3 Solve -10w - 10w + 94 - 54 = 0 for w. 2 Solve -159y - 967 = -39y + 833 for y. -15 Solve 638 = 440m - 498m for m. -11 Solve -15h + 8 = -34h - 30 for h. -2 Solve -95o = 201 + 179 for o. -4 Solve -484p + 755p - 7317 = 0 for p. 27 Solve 36w = -64w - 46 + 446 for w. 4 Solve -52650f = -52661f + 121 for f. 11 Solve -17l - 300 = -11l + 14l for l. -15 Solve -16q - 38 = -q + 142 for q. -12 Solve -2168 = -204w - 99 - 233 for w. 9 Solve -7d = -66 - 6 + 9 for d. 9 Solve 61u - u = 240 for u. 4 Solve -247h = -5h + 4356 for h. -18 Solve -161s + 80 + 48 = -129s for s. 4 Solve 4418h + 6810 = 4645h for h. 30 Solve -9024 = 964i - 682i for i. -32 Solve 3176 = 15j + 3476 for j. -20 Solve -235h = -3794 - 1083 - 293 for h. 22 Solve -565 = 16p - 293 for p. -17 Solve -130 - 194 + 144 = 12y for y. -15 Solve 388 = 214c - 596 - 728 for c. 8 Solve -3964f + 3986f = 88 for f. 4 Solve 218 = -28c - 118 for c. -12 Solve -112 = 915c - 943c for c. 4 Solve -633 - 87 = -176n + 160 for n. 5 Solve 1941y + 624 = 1917y for y. -26 Solve -39c - 349c = 1530 - 4246 for c. 7 Solve 403v = 1703 + 3106 + 1236 for v. 15 Solve 0 = -169d + 1203 + 57 + 430 for d. 10 Solve -27q - 709 = -655 for q. -2 Solve -30x = 36 + 54 for x. -3 Solve 88f + 202 - 1456 = 1826 for f. 35 Solve 126l = 344l - 1962 for l. 9 Solve -46 + 68 = -9r + 67 for r. 5 Solve -115z + 6678 = 256z for z. 18 Solve -13l + 14373 = 14347 for l. 2 Solve 40u + 102 = -18 for u. -3 Solve 0 = -163o - 175o + 314o + 552 for o. 23 Solve 20c - 2697 = -2977 for c. -14 Solve -29j + 132j - 771 = 362 for j. 11 Solve 188t + 692t - 236t + 23184 = 0 for t. -36 Solve 173 = -40n + 372 + 561 for n. 19 Solve 314n - 3375 = 449n for n. -25 Solve -157f - 1968 - 2387 = -430 for f. -25 Solve -86 - 49 = -27x for x. 5 Solve 3595 - 3364 = -11n for n. -21 Solve 3179 = -174d - 55d + 42d for d. -17 Solve 0d = 15d + 3d + 162 for d. -9 Solve 8y - 12y = -3y - 9 for y. 9 Solve -984 = -1640d + 1886d for d. -4 Solve 0 = -101d + 53d - 240 for d. -5 Solve -143h - 204 = 82 for h. -2 Solve -1082d + 1171d = 0 for d. 0 Solve -86r = -r - 1530 for r. 18 Solve -3s + 10 = 32 - 16 for s. -2 Solve -66c = 229 + 497 for c. -11 Solve 237f + 471 - 4263 = 0 for f. 16 Solve -86v - 355 = 419 for v. -9 Solve 12j - 92691 = -92595 for j. 8 Solve -40572 = 889z + 1043z for z. -21 Solve -145v - 180 = -325v for v. 1 Solve -30i + 35 = 101 - 6 for i. -2 Solve 87f + 73f - 1105 = 75f for f. 13 Solve 58f = -55f + 142 + 1214 for f. 12 Solve 47q - 313q - 2692 = -830 for q. -7 Solve -12t + 65 = 77 for t. -1 Solve -72 = -168h + 506 + 262 for h. 5 Solve -311b = -360b - 539 for b. -11 Solve -1592r = -1602r + 30 for r. 3 Solve 31b - 54b = -314 + 38 for b. 12 Solve -34t + 73t = 117 for t. 3 Solve 980n - 985n = 0 for n. 0 Solve 102b - 49b + 490 = -17b for b. -7 Solve 72b = -0b - 27b - 693 for b. -7 Solve 33 - 26 - 167 = 8p for p. -20 Solve 189y + 101 + 963 = 56y for y. -8 Solve 12 = -19r - 197 for r. -11 Solve 14f - 22668 = -22514 for f. 11 Solve 0 = -106f + 243 + 393 for f. 6 Solve 29b - 2762 + 2733 = 0 for b. 1 Solve 0 = 18d - 4d + 11d + 425 for d. -17 Solve 200z + 2097 - 2697 = 0 for z. 3 Solve 486b = 307b for b. 0 Solve -103m - 1968 = 50m - 30m for m. -16 Solve -130o - 94 - 88 = 598 for o. -6 Solve 16 + 6 = -7d + 1 for d. -3 Solve 4g - 167302 + 167378 = 0 for g. -19 Solve 136g = 154g - 306 for g. 17 Solve 62f - 320 - 47 = 191 for f. 9 Solve 0 = -1212f + 1213f - 4 for f. 4 Solve 417854n + 37 - 187 = 417848n for n. 25 Solve -166 - 102 = -3r - 199 for r. 23 Solve -11x - 23x - 15x = -13x for x. 0 Solve -1004 + 238 = -383t for t. 2 Solve -937l - 1584 = -1036l for l. 16 Solve -17z - 37z + 1620 = 36z for z. 18 Solve 0 = 24g + 8g - 224 for g. 7 Solve -6k = -395 + 347 for k. 8 Solve -2698h + 2709h = 73 + 48 for h. 11 Solve -188 = 32n - 96n + 388 for n. 9 Solve 17u + 18474 = 18508 for u. 2 Solve 0 = -241l + 310l - 621 for l. 9 Solve -193 + 8 = 58k - 1403 for k. 21 Solve 736 = -990m + 958m for m. -23 Solve 1860 = -191p - 1387 for p. -17 Solve 233j + 478 - 314 = 2960 for j. 12 Solve 204i + 388 + 1328 + 732 = 0 for i. -12 Solve 236o - 52o + 59o + 2916 = 0 for o. -12 Solve 1023 = 101u + 398 - 2001 for u. 26 Solve 0 = -91f + 124f + 330 for f. -10 Solve -452 = -10q - 662 + 350 for q. 14 Solve -283 = -129d + 1523 for d. 14 Solve -142v + 547v + 2657 = 9137 for v. 16 Solve 75 = 8318q - 8303q for q. 5 Solve 95q + 638 = -517 + 15 for q. -12 Solve 109r + 124r - 184 = 210r for r. 8 Solve 0 = 44p - 21p - 138 for p. 6 Solve -11f - 10f = -240 + 408 for f. -8 Solve 9c + 637 = 52c + 1497 for c. -20 Solve 86q + 716 + 118 - 60 = 0 for q. -9 Solve -1629 = -361o - 5600 for o. -11 Solve -3005j + 143 = -3018j for j. -11 Solve -2448 = 62*u -	{ "pile_set_name": "DM Mathematics" }
. What is s rounded to seven dps? 0.0000082 Let c = 0.79001 - 27.79951. Let z = 65 + -92. Let t = c - z. What is t rounded to 3 dps? -0.01 Let w = 187 - 186.9998025. Round w to five decimal places. 0.0002 Let y = -332786 - -332752.9951. Let v = 33.055 - 0.055. Let i = y + v. What is i rounded to three decimal places? -0.005 Let t be -80403 - (6/10 + (-2)/(-5)). Suppose 5s = 261394 + 390626. Let i = s + t. Round i to the nearest ten thousand. 50000 Let q = 0.07326 + -0.12589. What is q rounded to three decimal places? -0.053 Let f = 0.00651732632 - 2014.86960432632. Let u = -2006.163 - f. Let x = u + -8.7. What is x rounded to five dps? 0.00009 Suppose 902 = 3o + 2y, 5y - 7 = -2. Round o to the nearest 100. 300 Let x = 4733.3968 + -4733.19680017. Let s = 2.53 + -2.73. Let y = x + s. What is y rounded to 7 decimal places? -0.0000002 Let b = 31.9 - 41. Let j = -63792587 + 63792577.8999891. Let d = b - j. Round d to 6 dps. 0.000011 Let d = 319 - 457. Let p = 40773247.999683 - 40773386. Let c = p - d. What is c rounded to 5 decimal places? -0.00032 Let a(q) = -1841434 - 685198 - q - 2101732 - 1071636. Let m = -3 - -3. Let s be a(m). What is s rounded to the nearest one million? -6000000 Let t = 175739120.076948 - 175738060. Let l = t - 1063.077. Let k = l - -3. What is k rounded to five decimal places? -0.00005 Let a = -24.2988616 + -2.5007964. Let c = a - -26.8. What is c rounded to 5 dps? 0.00034 Let b = -283 + 282.93. Let s = -5.96008 + 6.03. Let c = b + s. What is c rounded to four decimal places? -0.0001 Let r be 1-2(-7)/2. Let v(b) = -24b + 0b - 510 - 5b - 514 + 1017. Let q be v(r). Round q to the nearest 10. -210 Let d = 8797 + -8797.000005529. Round d to seven decimal places. -0.0000055 Let a = -102.087 + 102. What is a rounded to two dps? -0.09 Let h = 10406105 + -3366105. Round h to the nearest 1000000. 7000000 Suppose 3o - 15 = -5z, -4z + 5o + 17 - 42 = 0. Let c be 2 - (550002/1 + z). Round c to the nearest one hundred thousand. -600000 Let c = 14822 + -14824.99975. Let p = -2 + -1. Let k = c - p. Round k to four decimal places. 0.0003 Let l = 16.5 + -19.61. Let u = l + 3.110153. Round u to 5 decimal places. 0.00015 Suppose 65d = 15d + 631300000. What is d rounded to the nearest one hundred thousand? 12600000 Let j = 1136.999994098 + -1137. What is j rounded to 6 dps? -0.000006 Let b be (-3)/6 + 19203/(-6). Let h = b - 4930. Let m = h + 14231. What is m rounded to the nearest one thousand? 6000 Let p = -2991141 + -2189763. Let q = p + 1460904. Round q to the nearest one million. -4000000 Let x = -431945364064602 + 431945379584963.33999955. Let i = -15520361 + x. Let c = -0.34 + i. Round c to seven decimal places. -0.0000005 Let m = 1.7 - 2.6. Let z = 0.87 + m. Let f = -0.16 - z. What is f rounded to 1 dp? -0.1 Let c = 41.1 - -0.9. Let m = c + -40.98. Round m to one decimal place. 1 Let j = 34.100149 - 34.1. What is j rounded to five decimal places? 0.00015 Suppose -y + 0y + 4 = 0. Let n = 13 - 9. Suppose np - 51991 = 3j, 3p - yj = 8p - 65012. What is p rounded to the nearest ten thousand? 10000 Let b = -1225 - -1297.9. Let d = b - 79. Round d to the nearest integer. -6 Let c = -6224 + 6223.9997421. Round c to five dps. -0.00026 Let d = 769.7446 + 0.4554. Round d to the nearest ten. 770 Let r = 95.9638162 - -0.0282838. Let f = -167 + 263. Let d = f - r. What is d rounded to 3 decimal places? 0.008 Let h = 73.0601 - 73. Round h to two dps. 0.06 Suppose 2c - 2558300 = -670356. Suppose 11o - 420769 - 612923 = 0. Let y = o - c. Round y to the nearest 100000. -900000 Suppose -a - 3 - 3 = 0. Let r(n) = 299999n*2 - 3n + 2. Let m be r(a). Suppose 0 = -d - 4s + m, 4 = -4s + 3s. What is d rounded to the nearest one million? 11000000 Let r = -767 + 767.0000593. What is r rounded to 6 dps? 0.000059 Let t = -2139.842 + 2135.242165. Let w = -4.6 - t. What is w rounded to five dps? -0.00017 Suppose 111280 = -675m + 679m. Round m to the nearest ten thousand. 30000 Let p = -229 + 84. Let z = -144.99999858 - p. Round z to seven dps. 0.0000014 Let f(g) = 12946g*3 - 11g*2 + 7g + 4. Let w be f(4). Round w to the nearest ten thousand. 830000 Let m be 1 - 4/1 - (2 - -1106). Let q = -719 + m. Round q to the nearest one hundred. -1800 Let m = -5.3 + 5.61. Let r = 0.355 - m. Round r to two dps. 0.05 Let s = -0.011 - 32.989. Let u = s + 61. Let m = -28.00083 + u. Round m to 4 dps. -0.0008 Let w = -3790 + 3790.00010605. What is w rounded to 6 dps? 0.000106 Suppose -4l - 89295 = -5l. Let m = l - 37595. Round m to the nearest 10000. 50000 Let v = 407721.99755 - 407732. Let x = v - -10. What is x rounded to 4 decimal places? -0.0025 Let x = -26480.23 - -26477.88000936. Let a = 2.35 + x. Round a to six decimal places. 0.000009 Let x = -0.646 - -0.6459148. Round x to 6 dps. -0.000085 Let q(m) be the first derivative of -3450001m4/4 + m3/3 + m2/2 - m + 5. Let t be q(1). Round t to the nearest 100000. -3500000 Let s = -0.055 + -32.945. Let c = s + -8. Let x = -41.033 - c. What is x rounded to 2 decimal places? -0.03 Let u(k) = 86k*2 - 5k + 17. Let b be u(20). Let n = b - 22957. Round n to the nearest 1000. 11000 Let i = -1233102 - -1854977. Let b = 621875.04999916 - i. Let q = -0.05 + b. What is q rounded to seven decimal places? -0.0000008 Let a = -5 + 14. Suppose 3w + 2m - 9 = 0, am + 10 = -w + 4m. Suppose 4o - wp = 5, 0 = o - 6o - 5p - 5. Round o to two dps. 0 Let i = -17.9 + -11.1. Let a = -577113 + 577141.9979. Let o = a + i. What is o rounded to three dps? -0.002 Let k(v) = 2v2 - 2v + 2. Let g = -11 + 12. Let b be k(g). Suppose br + 92000 = -2r. What is r rounded to the nearest ten thousand? -20000 Let v be 1/(6/57804)27/2. Let o = v - 86659. Round o to the nearest 1000. 43000 Let q = 275.1 - 275.100002414. Round q to seven decimal places. -0.0000024 Let b = 0.62581 + -0.636. Round b to 3 decimal places. -0.01 Let a = 3.5 + 2.5. Let g = -6.02 + a. Round g to 1 dp. 0 Let g = -8265981 + 13092689. Let a = -9473292 - g. Round a to the nearest 1000000. -14000000 Let h(x) be the third derivative of 0x + 3x2 - 8333/2x*4 + 4/3x3 + 0. Let c be h(-2). What is c rounded to the nearest one hundred thousand? 200000 Let l(r) = r2 - 2r + 9. Let v be l(0). Let o be (15/v - 1)6. Suppose 3a - 3d = -21599997, 0 = 5d + o + 1. What is a rounded to the nearest 1000000? -7000000 Let t(n) = 2n*2 + 2n - 3. Let p be t(-3). Suppose 0 = 10m - pm + 366000. Round m to the nearest 10000. -370000 Let v = -1448 + 1449.231. Round v to 1 decimal place. 1.2 Suppose -2v - 3f = -4183252, -6v + 10v = 4f + 8366544. Suppose v = -7i - 1828368. Round i to the nearest one hundred thousand. -600000 Let u = -0.073 + -4.427. Let h = -4.499906 - u. What is h rounded to 5 decimal places? 0.00009 Let q = -2.714 - -3.62. Round q to 1 decimal place. 0.9 Let s = 57 + -53. Let f = -2452997.9999904 - -2453002. Let h = f - s. What is h rounded to 6 decimal places? 0.00001 Let d = 62.117 - 0.117. Let i = -67.4 + d. What is i rounded to 0 decimal places? -5 Let a = -0.44 + 2.25. Let k = -1.81000605 + a. What is k rounded to 6 decimal places? -0.000006 Let d = 6.16 + -8. Let h = d - -12.54. What is h rounded to zero decimal places? 11 Let f = -0.347 - 20.353. Let n = 21 + f. Let g = n - 0.299976. Round g to five dps. 0.00002 Let p = -463 + 898. Let c = -1184.4564 - -749.4795. Let t = p + c. What is t rounded to 3 decimal places? 0.023 Let a = 453 + -453.00742. Round a to four decimal places. -0.0074 Let n = -466 - -404.5. Round n to the nearest integer. -62 Let g(o) = -o*3 + 4o2 + o - 2. Let m(p) = -p2 + p + 1. Let i(a) = -g(a) + 2*m(a). Let v be i(-7). What is v rounded to the nearest one hundred? -600 Let c = 31686863114662247 + -31686860333003124.9999877. Let p = -2781659381 + c. Let b = p + 259. What is b rounded to six dps? 0.000012 Let o = 13 + -36. Let r = -23.37 - o. What is r rounded to two dps? -0.37 Let x = -0.115 + 0.037. Let t = x - -0.077864. Round t to 5 dps. -0.00014 Let z = 9.34 - 9.3398188. Round z to five dps. 0.00018 Let b = 228295 + -228307.09356. Let r = b + 12.1. Round r to three dps. 0.006 Let t = 54 - 53.962. Let l = t - -0.242. What is l rounded to 1 dp? 0.3 Let t = -0.039 + 0.045. Let h = t - 0.0060	{ "pile_set_name": "DM Mathematics" }
7g2. Let t(l) be the first derivative of c(l). Calculate t(o(v)). -1458v*2 Let u(i) = 7i. Let z(v) = 126279v2. Determine u(z(b)). 883953b*2 Let a(y) = -y. Let q(x) = 3x. Let z(f) = -f*2 - 20f - 5. Let n be z(-20). Let s(p) = -2p. Let j(g) = ns(g) - 2q(g). Calculate a(j(h)). -4h Let h(a) = -6a. Let i be 25(20/(-5))/(-2). Let o(y) = 95y - iy - 47y. Determine o(h(x)). 12x Let w(y) be the third derivative of y*4/6 + 2y*2. Let k be 1/(28/(-40)4 + 3). Let r(p) = -7p2 + kp2 + p2. Determine r(w(c)). -16c2 Let l(w) = 2w*2 - 2w. Let j(z) = -5z2 + 6z. Let s(c) = 2j(c) + 6l(c). Let h(u) = 22u. Let t(m) = 21m. Let k(v) = 5h(v) - 6t(v). Calculate k(s(i)). -32i2 Let b(t) = 3096t. Let o(y) = -8y. Determine b(o(s)). -24768s Let w(u) = -11u2. Let b(v) = v3 - 5v*2 + 5v - 4. Let d be b(4). Let t(l) = -l - l + dl + l. Determine t(w(n)). 11n2 Let g(d) = d2. Let w(i) = -152i2 - 3. Let z(s) = -198 + 271 - 3835s*2 + 292 + 22377s*2. Let p(t) = -365w(t) - 3z(t). Determine g(p(y)). 21316y*4 Let b(q) = 9q + 6. Let t(w) = w + 1. Let f = -26 - -32. Let y(l) = ft(l) - b(l). Let o(z) = -14z*2. Determine o(y(h)). -126h*2 Let a(t) = t. Let r(f) = -8895f*2 - 3f + 5. Calculate r(a(l)). -8895l2 - 3l + 5 Let i(q) = 87q. Let w(z) = z. Let n(x) = -6x. Let s(k) = -n(k) - 5w(k). Determine s(i(p)). 87p Let l(q) = 250 - 250 + 11q + 11q. Let o(a) = 6a2. Calculate o(l(p)). 2904p*2 Let k(q) = -3q*2 - 2q. Let d(h) = -8h2 - 5h. Let i(r) = -2d(r) + 5k(r). Let m(w) be the third derivative of -w*4/24 - 6w2. Determine i(m(f)). f2 Let f(i) = -3i. Let q(c) be the first derivative of 3c*2 - 15c - 170. What is f(q(j))? -18j + 45 Let i(c) = -102c*2. Let o(t) = 2t*2 + 192. Calculate o(i(s)). 20808s*4 + 192 Let o(d) = -48d*2 + 57d*2 - 12d*2. Let g(m) = -10m*2. Determine g(o(i)). -90i*4 Let u(h) = 4h*2 + 3h. Let j(w) = 18w2 + 14w. Let i(o) = -6j(o) + 28u(o). Let z(p) = 9p2. What is i(z(k))? 324k*4 Let v(t) = 2t - 422t2 - 398t*2 - 2t + 844t2. Let m(f) = 6f. Give m(v(x)). 144x2 Let v(s) = -2s*2. Suppose 0 = -4j - 2n + 64, 3j + n + n - 48 = 0. Let b(y) = jy2 - 5 + 17y*2 + 5. Calculate b(v(m)). 132m*4 Let f(y) = -17y - 40. Let d(q) = -69q. Calculate f(d(m)). 1173m - 40 Let p(h) = -h*2 + h - 1. Let z(g) = -14g*2 - 3g + 3. Let x(q) = 3p(q) + z(q). Let d(m) = -1 + 6m*2 - 5m*2 + 1. What is x(d(l))? -17l*4 Let t(s) be the first derivative of 2s*3/3 + 172. Let i(b) = 117b. Calculate i(t(a)). 234a2 Let r(y) = 0y - 15y - 23y - 8y. Let l(x) be the third derivative of x4/24 + 21x*2. Give l(r(t)). -46t Let l(f) = 34609f2. Let a(c) = -2c. Give l(a(z)). 138436z2 Let d(t) = -t2 + 2466t - 1. Let r(m) = 5m2. Calculate d(r(o)). -25o*4 + 12330o*2 - 1 Let d(z) = -5z. Let w(b) = -5539 + 20b - 5538 + 2b*2 + 11077. What is d(w(l))? -10l*2 - 100l Let y(c) = -10c2 + 2294. Let h(i) = 4i. Give h(y(a)). -40a2 + 9176 Let t = 12 - 9. Let q(j) = -5j. Let d(a) = 16a. Let o(m) = td(m) + 10q(m). Let s(z) = 3z*2 + 3z*2 - 4z*2. Determine s(o(g)). 8g*2 Let b(r) = -24r - 1. Let q(h) = 5h2 - 6h. Let z(k) = 4k2 - 5k. Let i(w) = -5q(w) + 6z(w). What is i(b(p))? -576p2 - 48p - 1 Let j(w) = -4w2. Let i(v) = 2666v + 3. Determine j(i(a)). -28430224a2 - 63984a - 36 Let c(l) = -2l - 108. Let j(f) = -f - 104. Let g(h) = 3c(h) - 4j(h). Let w(d) = 3d. Give g(w(n)). -6n + 92 Let g(a) be the first derivative of -a6/360 + 4a3/3 + 1. Let j(y) be the third derivative of g(y). Let r(t) = -32 + 32 + t2. What is r(j(h))? h*4 Let w(a) = a. Let v(u) be the second derivative of -13u*4/4 + u + 41. Determine v(w(m)). -39m*2 Let j(u) = -24u. Let c(v) = 2v2 - 110. Determine j(c(y)). -48y*2 + 2640 Let m(k) = -55k - 10. Let v(a) = 55a + 12. Let z(p) = -6m(p) - 5v(p). Let s(y) = -y. Calculate z(s(c)). -55c Let u(l) = 22710 - 22710 - 51l2. Let y(o) = 3o. Determine y(u(m)). -153m2 Let z(a) = 24a*2 + 0a + 0a - 27a2. Let n(i) be the third derivative of i4/6 + 4i2. Determine n(z(f)). -12f*2 Let q(c) = 2c + 262. Let i(f) = 691f2. Give q(i(o)). 1382o*2 + 262 Let i(k) = -2k*2. Let u(t) be the third derivative of 0t*4 + 0t*3 + 0t - 11t2 + 0 - 1/10t*5. Determine u(i(d)). -24d*4 Let s(h) = 302367h. Let z(t) = -2t. What is z(s(k))? -604734k Let z(h) = 658h - 21. Let s(r) = -437r + 15. Let w(y) = 7s(y) + 5z(y). Let t(o) = 3o. Give w(t(j)). 693j Let l(h) = -2h. Let w = -8233/12 - -687. Let o(p) be the second derivative of -3p + 0p3 + 0 + 0p*2 - wp*4. Give l(o(j)). 22j2 Let a(o) be the second derivative of o4/6 - 64o. Let c(r) = 99r. What is a(c(p))? 19602p2 Let k(i) be the first derivative of -i2/2 + 64i - 170. Let v(z) = -z2. Determine k(v(l)). l2 + 64 Let p(r) = 3r. Let a(c) = 3c*2 + 2c - 4385. What is p(a(l))? 9l2 + 6l - 13155 Let o(d) = -36d. Let r(f) = 3300f + 7. Determine o(r(k)). -118800k - 252 Let q(b) = -3b2. Let a(x) be the second derivative of x4/12 - 61x. Give q(a(i)). -3i*4 Let g(w) = -3w + 3w + w. Let x(l) = -1 - 2 + 2 + 1 + 19l. Calculate x(g(y)). 19y Let w(l) = -4l*2 - 1. Let t(p) = -p - 1. Let f(g) = 2g + 5. Let o(c) = f(c) + 5t(c). Calculate o(w(m)). 12m*2 + 3 Let s be (-5)/(105/(-6)) - (-30)/(-252). Let u(h) be the second derivative of 0h*2 + 2h + sh3 + 0. Let i(y) = y. Give u(i(v)). v Let h(r) = 34r*2. Let k(o) be the third derivative of 0o - 30o2 + 0 + 0o*3 - 1/12o*4. Calculate k(h(n)). -68n*2 Let g(d) = 2d*2. Let w(j) be the first derivative of 12j*3 + 34. Calculate w(g(h)). 144h4 Let j(p) be the third derivative of p4/8 + 84p2 + p. Let z(h) = -3h + 3. Calculate z(j(y)). -9y + 3 Let q(l) = -3l. Let b(d) = -98444d2. Determine b(q(u)). -885996u2 Let s(m) be the second derivative of -m3/3 - 2m. Let x(h) = -2h + 10. Let c(f) = 3f - 18. Let l(a) = -5c(a) - 9x(a). Calculate l(s(v)). -6v Let v(x) be the third derivative of -8x2 + 0 + 0x*3 + 0x*4 + 0x - 13/60x5. Let w(z) = -2z. Calculate v(w(l)). -52l2 Let s(o) be the first derivative of -4o*3/3 - 133. Let p(y) = -2y*2 - 40y. What is p(s(w))? -32w4 + 160w*2 Let y(j) = -3j*2. Let u(l) = -133l*2 + 77l + 231. Let s(c) = -7c2 + 4c + 12. Let o(p) = -77s(p) + 4u(p). What is y(o(t))? -147t4 Let b(r) = -719r*2 + 145r - 1. Let x(g) = g. What is x(b(i))? -719i2 + 145i - 1 Let g(o) = -2o2. Let d(x) be the third derivative of 5x*4/24 - 2x*2 + 7. What is d(g(c))? -10c2 Let t(o) be the third derivative of -o6/90 - 11o3/2 + 5o*2. Let r(j) be the first derivative of t(j). Let w(q) = 14q. What is r(w(x))? -784x2 Let a(s) = 8s. Let r(u) = 31374u2 - 2u. What is a(r(w))? 250992w2 - 16w Let q(c) = 2c2. Suppose -65l + 63l = -4. Let u(o) = -7652o + 7652o - 31o*l. What is q(u(z))? 1922z4 Let u(x) = x2 - x. Let p(j) = 32j2 - 28j. Let f(z) = 2p(z) - 56u(z). Let o(g) = 0g + 22g*2 - 19g*2 + 0g. Determine o(f(h)). 192h4 Let b(k) = k2 - 4k*2 + 4k*2. Let z = 14 + -12. Let w(d) = -d + zd + 7d. What is w(b(i))? 8i*2 Let a(h) = -24h. Let y(d) be the second derivative of d*4/4 + 156d. Determine y(a(p)). 1728p2 Let s(f) = 30f*2. Let d(n) = -14n*2 - 49n. Let t(r) = -r*2 - 3r. Let h(z) = -3d(z) + 49t(z). Determine h(s(j)). -6300j4 Let d(w) = 67w*2. Let l(c) be the first derivative of -6c*2 + 517. Give l(d(q)). -804q*2 Let u(b) = -35b*2. Let h(r) = -r + 692. Calculate u(h(a)). -35a*2 + 48440a - 16760240 Let b(x) = 3x. Let t(u) = 20u + 440. Let w be t(-22). Let p(r) be the third derivative of -7r2 + 0r + 0r4 + 1/30r*5 + w + 0r*3. Calculate p(b(q)). 18q*2 Let p(w) = -w. Let h(f) = -46f - 9. Let d(i) = 70i + 14. Let c(g) = -5d(g) - 8h(g). What is p(c(u))? -18u - 2 Suppose 2 = g, -3d = -2d - 3g + 6. Let r(c) = 2c - c + dc. Let q(b) = 5b + 2. Let s(h) = 6h + 2. Let a(w) = -3q(w) + 3s(w). Give a(r(y)). 3y Let v(o) = -26o. Let k(x) = 3048x. Calculate v(k(u)). -79248u Let s(u) = 95u*2. Let f(m) = 3159 - 3159 + m + 0m. Give s(f(l)). 95l*	{ "pile_set_name": "DM Mathematics" }
(b) 2 (c) u c Let r = 0.03 - 3.03. Let f be 27/3(-2)/(-42). Which is the second biggest value? (a) -4 (b) r (c) f b Let z = 55 + -55. What is the second biggest value in z, -3, 1.2? z Let x(g) = g2 - 6g - 9. Let s be x(7). Which is the third biggest value? (a) 6 (b) s (c) 4 b Let d = 0.18 + -0.1. Let n = -1.58 + d. Let v = -0.5 - n. What is the second smallest value in -2/7, 4, v? v Let r = -29/84 - -2/21. Suppose -2o - 55 = -13o. Which is the second biggest value? (a) 2 (b) r (c) o a Let v = 184/85 + -30/17. Which is the second smallest value? (a) -0.1 (b) 0.5 (c) -2 (d) v a Let o be (-3)/(7 - 4)-1. Which is the biggest value? (a) 1/3 (b) -3 (c) -7 (d) o d Let q be 66/15 - 8/20. What is the second smallest value in 1, q, 2/3? 1 Let u = -5.6 + 6. Let y = -16327/22 - -742. Let t = 4/11 - y. What is the third biggest value in u, -4, t? -4 Let z = 19 - 33. Let a = -14 - z. Let h = 2.03 - 0.03. What is the second biggest value in a, h, -0.2? a Let g be (4/(-21))/(12/14). Let y = -1 - -0.8. Which is the third biggest value? (a) g (b) 4 (c) y a Let f = 0.1 - 0.2. Suppose -2i + 15 = 3l, -3i - 5l + 25 = -2i. Let x be (0 - i)/(4 - 5). What is the biggest value in f, x, 0.5? 0.5 Let z = -17 - -22. What is the second smallest value in 1, 3, 1/2, z? 1 Let v(u) = u*3 - 11u*2 - u + 5. Let y be v(11). Let t = y + 7/2. Which is the biggest value? (a) t (b) 0.3 (c) 4/9 c Let y be (-5)/(-2)(-24)/(-15). Let u be (-1)/y + 2/(-4). What is the biggest value in u, 2/3, 0? 2/3 Let y = -0.2 + -0.3. Let o = -0.2 - 2.4. Let q = 2.4 - o. Which is the third biggest value? (a) y (b) -5 (c) q b Suppose 3k - 4n = k + 8, -3k - 9 = n. Let j be ((-6)/(-20))/((-2)/(-4)). Which is the second biggest value? (a) k (b) 5 (c) j c Let d be -1 + (-6)/(-8) - 0. Let n be ((-2)/4)/(10/(-12)). What is the second smallest value in n, d, 0.4? 0.4 Let h = -0.3 + 2.8. Let j = h - 2. Let n = -0.4 - 0.1. What is the second biggest value in n, -4/5, j? n Let g be 10/6(-12)/8. Let m be (-1 - (-1 + 3))/(-1). Suppose 7a - 20 = ma. What is the third biggest value in g, a, -1/3? g Let n = 2032/9 + -226. What is the third smallest value in -3, n, -2/5? n Let w = 83 + -88. What is the third biggest value in w, -0.1, 1? w Let t(d) = -d*2 + 7d + 8. Let k be t(8). Let y = k + 0. Suppose y = -3m - 0m. Which is the third smallest value? (a) -5 (b) 1 (c) m b Let u = 1.5 + 4.5. Let x = u + -2. Let t = 0.8 + -1.1. Which is the biggest value? (a) x (b) t (c) -0.2 a Suppose u - 10 = -5. What is the biggest value in 3, 1, u? u Let q = -0.23 - 0.07. Let b = -14 + 10. Let l = -61 - -243/4. What is the second biggest value in b, l, q? q Let i = 11 + -6. Let f = i - 5.5. Let u = f - 0.5. Which is the third biggest value? (a) 0.5 (b) 2/21 (c) u c Suppose -3l - 2l - 10 = 0. Let q be 2 - 0 - 114/(-6). Let j be q/(-6) - 4/l. Which is the biggest value? (a) j (b) 0 (c) 1/9 c Let y = -3 - 3. Let k = y - -8. What is the second smallest value in -5, k, 4? k Let m = 1.9 - -0.1. What is the biggest value in m, -2, 11? 11 Let s = -27 - -24. What is the third biggest value in s, -2, 0.4? s Let y be 4/32 + (-2)/16. What is the biggest value in -2, 2, y, 35? 35 Suppose 0 = 2h - 48 + 16. Suppose 6y - 25 = 3y - 4z, -4y - z + h = 0. Let k be (3/4)/((-5)/(-4)). Which is the biggest value? (a) k (b) 2/7 (c) y c Let l be 0 - (-3 + 4/(-4)). Suppose 0 = -lo + 12. What is the biggest value in o, -3, -0.1? o Let u = -975/7 + 139. Let q = 178 - 179. What is the third biggest value in u, q, 3? q Let v = -0.8 - -1. What is the biggest value in 1/7, -2, v? v Let h = 21 - 20.8. Which is the second biggest value? (a) -5 (b) h (c) 5 (d) 4 d Let o = -41 - -41. Which is the fourth smallest value? (a) o (b) -4 (c) -5 (d) -11 a Let h = -0.9 - -4.5. Let k = h + -4. Let c = 0 + 0. What is the second biggest value in 2/9, c, k? c Let g be 2/(-5) + 9/(-15) + 5. Which is the fourth biggest value? (a) -4 (b) -4/3 (c) g (d) -0.5 a Let s be ((4/(-2))/(-2))/(-2). Let b(z) = -z - 7. Let p be b(-5). Let t = p - 0. What is the second biggest value in t, 5, s? s Let g = -422/5 - -84. Which is the biggest value? (a) g (b) -0.09 (c) -1/5 b Suppose 3u = -14 - 19. What is the second biggest value in 0.1, u, 4? 0.1 Let f = -0.001 + 0.301. Let r = 9 - 5. What is the smallest value in f, r, 1? f Let y = -1 - -5. Let s = -0.9 - -1.2. What is the smallest value in s, y, -0.1? -0.1 Let q = 12 - 18. Let w = 2 + q. What is the second smallest value in -2, w, 2/3? -2 Let g = 64.1 + -64. Which is the smallest value? (a) 4 (b) g (c) 0.5 (d) -34 d Let v = 0.49 + -0.79. What is the third biggest value in 0.1, v, 0.7, -0.2? -0.2 Let j = 37/576 + 3/64. Let k = -6 - -10. What is the second smallest value in k, j, 0.4? 0.4 Let s = 8 - 11. What is the second smallest value in s, 1/4, 4? 1/4 Let x = -360 - -360.2. Let r = 984/8987 - 2/473. Which is the biggest value? (a) x (b) r (c) -0.05 a Let f = -3 - -21. Let j = f - 13. What is the biggest value in 0, -4, j? j Let z = -13 - -10. Let m be (z - -3) + 0/2. Let o = -4 - 0. Which is the second biggest value? (a) 1/2 (b) o (c) m c Let t(n) = -n3 - 2n2 + n + 1. Let s be t(-2). What is the second biggest value in s, 5/3, -5? s Let b = -1 - -5. Let g = 1/8 - -1/8. Let d(j) = -j3 - 5j2 + 7j + 5. Let n be d(-6). What is the smallest value in n, g, b? n Let g be -1 + (-12)/(-9) - (-20)/(-6). What is the second biggest value in 5, g, -0.9? -0.9 Let m = 27 + -30. Let y = 0.39 + 0.01. Which is the smallest value? (a) y (b) m (c) 1 b Let x = 0 + -3. Which is the smallest value? (a) -1/4 (b) x (c) -2 b Let l = -0.14 + 5.14. Let q(i) = -i*2 + 8i + 12. Let x be q(9). Which is the second smallest value? (a) x (b) l (c) -2/3 a Let z be (64/(-12))/((-4)/(-30)). Let o be z/(-28) - (0 + 2). Which is the second biggest value? (a) 0 (b) -2/17 (c) o b Let k = -247/36 + 64/9. Which is the biggest value? (a) -2/9 (b) 2/17 (c) -3 (d) k d Let x be 19308/38 + 4 + 0. Let j = x + -512. Which is the second biggest value? (a) 1 (b) 2/3 (c) j b Let y = -0.05 - 0.05. Let k = -10.3 + 10. Which is the third biggest value? (a) y (b) k (c) 0.2 b Let s(q) = -13q - 26q + 10q. Let o be s(3). Let l = o - -611/7. What is the third biggest value in -5, l, -0.5? -5 Let x = -34 + 40. Which is the fourth smallest value? (a) x (b) 3 (c) 0.3 (d) 2/3 a Let s = 0.76 + -1.06. Let l = -1.4 - -0.4. Which is the third biggest value? (a) s (b) l (c) -2/5 b Let t = 48 + -48.3. Which is the biggest value? (a) -1 (b) -0.5 (c) t c Let n = 0.08 + 0. Let a = n - 4.08. Let g = 139/3 + -46. What is the biggest value in a, g, 0.4? 0.4 Let w = -14 - -14.9. Let m = 0.5 - w. Which is the third smallest value? (a) -4/5 (b) 1/5 (c) m b Let q(m) = 0m*3 + 7m + m*3 + 0 - 5 - 7m*2. Let k be q(6). Let l be k - 3/((-30)/(-4)). What is the biggest value in -2/5, l, 0? l Let h = 7.6 + -5.6. Which is the second smallest value? (a) -2/13 (b) 0.04 (c) h b Let p = 3 - 0. Let d be 5/(10/(-52)) + -1. Let g be d/30 + (-3)/(-6). Which is the biggest value? (a) p (b) 0.1 (c) g a Let l = 118.9 - 119. Which is the biggest value? (a) -4 (b) l (c) -3/7 (d) 1/4 d Let u be ((-10)/(-4))/((-1)/(-2)). Suppose -x = z + 12 - u, 2x = 5z + 14. Which is the biggest value? (a) 1 (b) x (c) -5 a Let y be 75/103/(-30). Which is the second smallest value? (a) y (b) 2 (c) -0.2 c Let l = 2/181 - -169/1086. Let k = -1 + 0. Suppose 25 = 4y + 5. What is the biggest value in l, y, k? y Let x = 45/68 + 3/34. Let c(f) = -f2 - 2f + 3. Let q be c(3). Let s be 3/(-4)(-8)/q. What is the smallest value in x, s, 1? s Let d = 19 + -16. Which is the second biggest value? (a) 0.5 (b) d (c) -4 a Let h be (-51)/12 + (-6)/8. Let l = 19/4 + h. What is the second smallest value in 2/3, 4, l? 2/3 Let c(b) = -7b3 - b2 + b - 7. Let k(h) = 4h3 - h + 4. Let f(j) = 3c(j) + 5k(j). Let g be f(-2). What is the smallest value in 0, g, -2? -2 Let g = -0.03 + 0. Let y = -0.17 + g. Which is the second smallest value? (a) 2 (b) -1/6 (c) y b Let j = -10 + 9.6. What is the biggest value in j, 4, -4? 4 Suppose 0 = 10p + 33 + 17. What is the biggest value in -0.2, 5, -0.3, p	{ "pile_set_name": "DM Mathematics" }
alculate the lowest common multiple of l and t. 44 Let y be 7460/18525 + 8/(-20). Let g = 2325/23218 + y. What is the common denominator of g and 23/20? 2820 Suppose 0 = 13w + w - 1652. Let s = -103 + w. Calculate the lowest common multiple of 12 and s. 60 Let s be (-6)/(-18) - 7021/3. Let p be (-9)/(-15) - (-67671)/s. Let y = 335/13 + p. What is the common denominator of y and 21/22? 220 Suppose -m + q + 52 = 0, -m = -0m - 3q - 54. Let n = -74 - -84. What is the lowest common multiple of (-9)/3 - (0 - m) and n? 240 Let w be (((-1)/2)/1)/(42/(-252)). Suppose 16s + ws = 1710. Calculate the lowest common multiple of 6 and s. 90 Suppose 4x - 4 = 2x. Suppose xn + 6 = 0, -g - 1352 = 3n - 0n. Calculate the lowest common multiple of 1/4 + g/(-68) and 36. 180 Let t = -206/9 - -1730/63. Let w = 16696 - 34471/2. Let x = w - -525. Find the common denominator of x and t. 14 Let g = -1858 - -1875. Calculate the least common multiple of 845 and g. 14365 Let r = 1533367/36 - 42590. Find the common denominator of 115/96 and r. 288 Let q = 12243/5 - 2439. Let k(n) = n*3 + 12n*2 - 41n - 60. Let b be k(-15). Calculate the common denominator of q and (-4)/30 - 332/b. 30 Let c be -3 + -4 + (-57936969)/(-7900200). Let p = -50/4389 - c. What is the common denominator of p and -49/220? 2200 Let h = -499/120 - -74/15. What is the common denominator of 139/2280 and h? 2280 Calculate the least common multiple of -12(10 - 261/18) and 24. 216 Suppose 2u + 172 = 5x + 465, 2u = -x + 263. Let b = 37661 - 37655. What is the lowest common multiple of u and b? 402 Let s(g) = -57g + 19. Let r(f) = -86f + 28. Let a(t) = 5r(t) - 8s(t). Let c be a(2). Suppose 3m - c = -m. Calculate the least common multiple of 16 and m. 80 Let s(o) = 179o*2 + o - 9. Let m be s(-5). Suppose -d + 1435 = -m. Let p = -35279/6 + d. Find the common denominator of p and -93/4. 12 Let d be 111 - (2 + -5)1. Suppose -6j - 102 = -3n - 2j, -4n - 2j = -d. What is the lowest common multiple of 12 and n? 60 Let c be (0 + 6 + -4)2. Suppose -5k + ck = -12. Let w = 98 + -89. What is the lowest common multiple of k and w? 36 Let t be (-30 - -29)0/(-2). Let i(j) = -j2 - 7j - 4. Let h be i(-3). Suppose t = g + 3 - h. What is the least common multiple of 5 and g? 5 Let c be 0-3(-8)/(-72). Suppose -5y - f + 0f + 448 = c, -10 = 5f. What is the smallest common multiple of 90 and y? 90 Suppose -4a + 222 = 42. Find the common denominator of -103/10 and 10/(-8)3/a93. 20 Calculate the lowest common multiple of (-11(-1053)/(-1716))/((-2)/81) and 300. 2700 Calculate the common denominator of (-12)/(-21) - -4 - 1 and 285/(-6175)(-10)/12. 182 Let t(p) = -175390p*2 - 6p - 4. Let v be t(-8). Let z = 112340089/10 + v. Let g = z - 9083. Calculate the common denominator of g and 22/3. 30 Let o = 9623149/360 - 26731. Let l = 1703/360 + o. Calculate the common denominator of l and 1/((-2368)/1124 - -2) - -4. 30 Let r(v) = v*3 - 6v*2 + 11v - 4. Let o be r(3). Find the common denominator of (180/56 - o)-6 - -2 and 19/42. 42 Let o(b) = b3 - b2 + b + 4876. Let a be o(0). Let c = a - 112096/23. Find the common denominator of c and -43/9. 207 Suppose -137n + 12939 = -91181. Calculate the smallest common multiple of n and 240. 4560 Let l = -88495/18168 + 60/757. Let f = -107 - 60. What is the common denominator of l and (-175)/25 + f/(-30)? 120 What is the common denominator of 137/174 and (-164)/40 - -1 - (-4 + 3 + -2)? 870 Let v = -425061/2783500 - 74/5567. Find the common denominator of v and -23/500. 500 Let z = 54 + -49. Let u be (-155242)/97328 - z/(-5). Let g = 5/869 + u. Find the common denominator of g and 73/18. 504 Find the common denominator of -143/24 and 8/(-22)(-2562)/2352. 1848 Let j = -23 + 13. Calculate the least common multiple of 31 + 4454/(-136) + (-139)/(-4) and 6/(-4) - 315/j. 330 Suppose -h = 5a + 2686 + 690, a + 692 = 4h. What is the common denominator of 91/216 and (-1)/12 - a/480? 1080 Suppose -3j + 2n = -114, 0n - 3n = j - 38. Calculate the smallest common multiple of 6/(-8) - -2561/88 and j. 228 Suppose 0 = 32s - 22s - 140. Suppose -4g - 182 = -3p + g, -5g + 88 = 2p. What is the lowest common multiple of s and p? 378 Let z be (-24)/((-2)/(-4)84/609). What is the common denominator of 44/27 and 2 + (-14)/4 + (-490)/z? 783 Let a = 1745/624 + 5/312. Suppose -2r + 569 + 639 = 0. What is the common denominator of ((-2)/(-88))/(6/r) and a? 528 Let f = 1492 + -26869/18. Let q(h) = -h*3 - 10h*2 + 37h - 25. Let t be q(-13). What is the common denominator of 135/75((-36)/(-8) + t) and f? 90 Let l = -5/4136 + 385/376. Let b = -378499/40 - -37861/4. Calculate the common denominator of l and b. 440 Let k(n) = n3 - 2n*2 - 7n - 3. Let c be k(-2). Let p be c + 2 - (2 - -6617). Let l = -198757/30 - p. Find the common denominator of l and 74/9. 90 Suppose 813 = 2l + q, 1 = q + 4. Let x = 227/2 - 97. Calculate the common denominator of (-2 - l/(-44))/(1 - 3) and x. 22 What is the common denominator of 85/2 and ((-20)/28400)/((-7)/889)? 1420 Suppose 4j - 3b = -1039, b + 20 = 5b. Find the common denominator of 79/14 and ((-6)/(-16)1)/(1152/j). 84 Let z(t) = -12t*2 + 206t + 1. Calculate the lowest common multiple of z(11) and 30. 4890 Let g = 6318 + -6159. What is the least common multiple of 7 and g? 1113 Let x be 6/10 + (-42)/(-30). What is the common denominator of x + 2 + (-2076)/360 and 141/(-20)4/18? 30 What is the smallest common multiple of -1 - -18 - 2758/197 and ((-4)/6)/((-3)/27)? 6 Let f = 29583809/289 - 102366. What is the common denominator of f and 7/3? 867 Let f = -22594 - -2078615/92. What is the common denominator of f and -79/2415? 9660 Suppose -2v + 3578 = 3n - 4v, -4754 = -4n + 6v. What is the smallest common multiple of n and 4? 1196 Calculate the common denominator of (10/18)/(30 + (-1752)/60) and -49/20. 180 Let z = -16225/3 - -5408. What is the common denominator of z and 10/99? 99 Let r(i) = -i*2 - 10i + 1370. Calculate the least common multiple of r(0) and 16. 10960 Let p(x) = x*2 + 93x + 1407. What is the smallest common multiple of p(-15) and 3? 237 Let j be (-4)/(-16) + (-2379)/12. Let s = -163 - j. Calculate the least common multiple of 8 and s. 280 Let a = 26787 - 2571613/96. Calculate the common denominator of 29/1080 and a. 4320 Let o = -138860 + 247640. Let z be (-438809)/o - (-2)/7. Let u = 1/555 - z. Calculate the common denominator of 7/3 and u. 12 Suppose -4l + 19y - 17y = -916, 3y + 690 = 3l. What is the lowest common multiple of 48 and l? 912 Let c(j) = 68j*2 - j + 2. Let z be c(1). Let t = z - 61. What is the least common multiple of t and 94/(8 - (12 - 6))? 376 Let a = 193/72 + -11/36. Let x be ((-830889)/(-63909) - 13)/((-2)/42). Let y = -118243/37872 + x. What is the common denominator of y and a? 48 Let a = -83 - -84. Let l be (1 - 11)/a + -5. What is the smallest common multiple of (54/l)/(4/(-10)) and 18? 18 Let n = 1671/7 + -237. Let k be -5((-4)/(-20) + 1). What is the common denominator of n and 4/k - (-831)/72? 56 Suppose -4s = -p + 65378, -p + 2s = 2p - 196184. What is the common denominator of p/45600 + 2/(-25) and -187/60? 240 Let k = -7304 + 7334. Calculate the least common multiple of k and 7/(-7) - (-1 + -7). 210 Let o be 3((-2855)/(-75) + 1). Let j = o + -5654/45. Calculate the common denominator of 47/3 and j. 9 Find the common denominator of 855/494((-580)/(-1380) - 4/46) and 1 + (-3)/487. 208 Suppose -4w = -3p - 385, -10w + 5w - 4p = -458. Suppose 0 = 4z - 8, 0 = 3n + 12z - 7z - w. Calculate the common denominator of n and -55/357. 357 What is the common denominator of (12/(-1148))/(-8 - 1182/(-150)) and 7/410? 2870 Let r = 2794 + -2425. What is the lowest common multiple of r and 9? 369 Let v = -72 + 132. Suppose v = -m - m. Calculate the least common multiple of 2/2-340/m and 19. 76 Let l = 7 + -2. Let m(h) = 76h - 68. Calculate the lowest common multiple of m(1) and l. 40 Let n(b) = b + 18. Let k be n(-17). Let s = 1/14345 + -702923/258210. Find the common denominator of s and ((-2)/(-12))/k + (-147)/14. 18 What is the smallest common multiple of (-32)/24(-54)/(-396) + (-9618)/(-22) and 23? 437 Suppose 78t - 3975 = 73t. Suppose 0 = -3x	{ "pile_set_name": "DM Mathematics" }
)(-6)/(-13352). Let w = 2/5007 + d. Find the common denominator of w and -53/20. 60 Let r be (-142)/(-90) + 2/(-5). Let j = r + 2/9. Calculate the common denominator of j and -53/6. 30 What is the smallest common multiple of (3 - 5)3 + 20 and 54? 378 Let f = -10 - -8. Let r = -1 - f. What is the least common multiple of r and 5? 5 What is the smallest common multiple of (10 + -6)/((-12)/(-9)) and 1? 3 Suppose 2h - 4u + 10 = 0, 0u - 3u = 2h - 25. Suppose 0l + hl = 0. Let i = l - 9. Find the common denominator of -85/8 and i. 8 Let m = -1845645/383504 - -2/23969. Calculate the common denominator of 87/16 and m. 16 Find the common denominator of -3 + (-986)/(-36) + 4/(-18) and -43/4. 12 Let m = 160 + -66. Calculate the common denominator of 6/2 - m/9 and -53/4. 36 Suppose -7r + 2r = -90. What is the least common multiple of r and 12? 36 Calculate the common denominator of -45/16 and -26(-3 - 67/(-20)). 80 Let g be ((-3)/(-3))/(4/104). Let c = g + -48. Find the common denominator of c and -25/3. 3 Find the common denominator of -5/18 and 11/132582/(-4). 72 Let m(k) = k3 - 5k*2 - 3k - 3. Let y be m(5). Let j = y + -16. Find the common denominator of j and -14. 1 Let s = 4 - 1. Suppose 0 = -4d + sd + 5. Calculate the lowest common multiple of 6 and d. 30 Let n(t) = -t*2 + 10t - 11. What is the smallest common multiple of n(8) and 1? 5 Calculate the common denominator of -149/6 and (-7 + 740/4)2/72. 18 Let q be 0 + 1 + (64 - 2). Find the common denominator of 95/6 and 6(-12)/q - 3. 42 Suppose 6q - 30 - 18 = 0. Calculate the lowest common multiple of 7 and q. 56 Let g = 51405983/6237385 - 6/178211. Let s = 84/55 - g. Calculate the common denominator of s and 34. 7 Let j be (-97)/(-3) + (-2)/6. Suppose j = 4a + n, 4a - 3n + 8n - 32 = 0. What is the lowest common multiple of 8 and a? 8 Let j be -4 + 1 + (-42)/(-2). Let c = j + 0. Let o(t) = 3t - 3. What is the least common multiple of o(5) and c? 36 Let i = -1728/11 + 28495/176. Calculate the common denominator of i and 27/8. 16 Suppose p - 24 - 36 = 0. Find the common denominator of 31/5 and (-2)/(-1) - p/(-8). 10 Let z(h) = 2h3 - h + 1. Calculate the lowest common multiple of 7 and z(1). 14 Suppose 7k - 20 = 2k. Suppose -z = kz - 10. What is the least common multiple of 2 and z? 2 Suppose -4s + 5s - 4 = 0, -t = 2s - 8. Suppose -3v + p - 5 = 0, tp = -v + 3p + 9. What is the least common multiple of 14/(-2 - 0 - v) and 2? 14 Let o = 2755/13 + -242971/1170. Let a = 27/10 - o. Find the common denominator of 33/7 and a. 63 Let u = 5 + 4. Calculate the lowest common multiple of 14 and 1u - (6 + -9). 84 Let o be (104409/(-60))/(3576/10). Let b be -5(2 + 2996/(-1490)). Let n = o + b. What is the common denominator of 29/2 and n? 16 Let b = 3512 - 1621. Let c = -3865/2 + b. Let p = 11/1708 + 55389/18788. Calculate the common denominator of p and c. 22 Let z = 64333/134407 + -100/211. Let b = z - 35047/2548. Calculate the common denominator of b and -111/10. 20 Find the common denominator of ((-12)/(-14))/((-128)/(-2576)) and -20. 4 Let j = 13 + -11. Calculate the lowest common multiple of 4 and j. 4 Calculate the least common multiple of -3(-3 - (1/3)/1) and 6. 30 Suppose -2b - 2i = -32, 2b = -0b - i + 32. Suppose b = -f + 5f. What is the lowest common multiple of f and 5? 20 Suppose 5o = 3j - 103, 2o - 11 = 2j - 85. Calculate the common denominator of -2 + (-1 - 32/(-14)) and j/6(2 + -3). 42 Suppose w - 4 = -1. Let u = 6 - w. Suppose n - 16 = -un. What is the least common multiple of 20 and n? 20 Suppose 6 + 26 = -4n. Let z = 16 + n. Calculate the smallest common multiple of 12 and z. 24 Let b(z) = 3z - 3. Let h be b(2). Let o(q) = 2q - 2. Let w(l) = l3 + 6l*2 - 4l - 4. What is the least common multiple of w(-6) and o(h)? 20 Let x be 02/(-6)-3. What is the common denominator of 33 and (x - 3) + 246/20? 10 Let a = 29 - 9. Find the common denominator of 97/2 and (172/a + 3)/4. 10 Calculate the smallest common multiple of 14 and (8/1)/((-10)/(-20)). 112 Let l = -17/62 + -935/434. Let t be (-41813)/(-15)(-5)/(-2). Let g = t - 6944. Find the common denominator of g and l. 42 Let b(t) be the third derivative of t5/20 + t3/6 + 3t*2. Calculate the smallest common multiple of 6 and b(-1). 12 Let k(z) = 6z*2 + 4z + 2. Suppose -s + 47 = 31. Calculate the least common multiple of k(-2) and s. 144 Suppose x = -1 + 17. Suppose 0 = 10w - 17w + 98. Calculate the least common multiple of x and w. 112 Suppose 0 = -0q + 2q, -3q = -2d + 6. Calculate the least common multiple of d and 10. 30 Let h(i) = -i*3 + 2i*2 + 3i - 1. Let f be h(2). Suppose -4n = -2n - 5c - 16, 0 = fc. Calculate the least common multiple of n and 8. 8 Let l(o) = o - 11. Let t be l(12). Let i be 216939/975t/25. Let h = i - 1/16250. Find the common denominator of h and 89/18. 90 Let f = -261 - -267. Let k(o) = o - 7. Let h be k(7). Suppose ha + 7 = a. Calculate the least common multiple of a and f. 42 Let s = 52 + -43. What is the least common multiple of 69 and s? 207 Let s be (-22)/(-10) + 16/20. Suppose 40 = 3l + 5h, 5l + 2h = s + 51. What is the least common multiple of l and 18? 90 Let f = 84082147/406 + -207099. Calculate the common denominator of -75/16 and f. 3248 Let b(y) = -y*3 + 5y*2 + 5. Let v be b(5). Suppose -vr - 2z = -52, -3r - z = 4z - 16. Calculate the least common multiple of r and 6. 12 Let h = 3241/15264 - -13/477. Calculate the common denominator of -79/4 and h. 96 What is the common denominator of 91/4 and (-69)/48 + (-3)/(-4)4? 16 Suppose l + 7209 = -4s, -3l - 7764 = -s + 13889. Let n = 43207/6 + l. What is the common denominator of n and -95/12? 12 Let k(t) = -t*3 + 8t*2 + t. Suppose 0 = -2q + 3q - 13. Let u = q + -3. Calculate the lowest common multiple of u and k(8). 40 Let w be 2093/22 - 4/(-8). Let l = -9908/99 + w. What is the common denominator of -39/7 and l? 63 Suppose 5m = -3z - 246, -16 = 3m + 4z + 136. Calculate the common denominator of 29/10 and (10/m)/((-5)/(-285)). 40 Let k = -10 + 26. Let m = 22 - k. Suppose 11i = -43 + 131. What is the least common multiple of m and i? 24 Let s = -39008/4661 + 546/79. Let g be (-49251)/1062 + 4/(-6). Let y = s + g. Calculate the common denominator of y and 123/10. 10 Let t = -2065/6 + 332. Find the common denominator of t and 37/8. 24 Calculate the common denominator of ((-1)/(-4))/((-20)/(-424)) and (4/(-18))/((-4)/237). 30 Let i = -1109 - -12165/11. Suppose 184 = -4k - 48. Calculate the common denominator of i and k/515/(-9). 33 Let z(x) = 6x2 - 2. Let p(m) = 0m*2 + 4m + 9m - 5m + 5 - m*2. What is the lowest common multiple of z(-2) and p(7)? 132 Let y = 15 - 3. Find the common denominator of (54/y)/(2/18) and ((-12)/(-110))/(20/175). 22 Let k = 0 + 5. Suppose -s - 8 = -ks. Find the common denominator of (34/14 - -1)/s and 9/7. 7 Suppose -6j = 5k - j - 95, -j = 5k - 107. Suppose f = g - 11, -f - 19 = -2g - 0f. Suppose 0 = -3m - 2 + g. What is the least common multiple of m and k? 22 Suppose 2j = 3d - 17 - 43, 2d + j - 40 = 0. What is the least common multiple of 2 and d? 20 Let k = -17 + 35. What is the smallest common multiple of 28 and k? 252 Let i = -31 + 67. Calculate the common denominator of i and 21/2. 2 Let z(j) = 2j*2 - 5j + 6. What is the least common multiple of 2 and z(3)? 18 What is the least common multiple of ((-1)/(-4))/((-1)/(-8)) and 20? 20 Let r = 3 + -4. Let s be (3 - 4) + (-8)/r. What is the least common multiple of (-30)/(-35)(s + 0) and 18? 18 Let y(r) = -4r - 2. Let n = 12 + -6. What is the smallest common multiple of y(-3) and n? 30 What is the common denominator of (-195)/(-108)(-6)/4 and 97/2? 24 Let x(w) = -w3 + 6w*2 - 3w. Let z be (-4)/(-16) - (-246)/8. Suppose 5 = -2v - 5, -3d + 5v = -z. Calculate the lowest common multiple of 4 and x(d). 20 Let q = -21125/24588 + -4/2049. What is the common denominator of q and -107/40? 360 Let j = -5 - -7. What is the lowest common multiple of j and (-38)/95 + (-64)/(-10)? 6 Let a = -988 + 15801/16. Find the common denominator of a and 2/(-9) - 470/396. 176 Suppose -4f = -2f + 2s, 0 = 5s + 20. What is the common denominator of -10/7 and f/(-144)-4*49? 63 Find	{ "pile_set_name": "DM Mathematics" }
l(c) = 322c2 - 5c - 10. Let k(i) = -46l(i) - 5n(i). Let x(p) = 2p. Calculate k(x(g)). -1288g2 Let o(t) be the first derivative of -t5/20 + 3t2/2 + 16. Let a(r) be the second derivative of o(r). Let n(y) = -y2. Give a(n(c)). -3c*4 Let z(i) = -18i*2 - 15i. Let t(f) = 44f2 + 36f. Let k(n) = 5t(n) + 12z(n). Let j(l) = 3l + 32. Calculate j(k(d)). 12d*2 + 32 Let c(j) = 1955j - 506. Let a(p) = -31p + 8. Let b(x) = -253a(x) - 4c(x). Let l(k) = -14k. Determine l(b(u)). -322u Let b(q) = -3q + 8q - 9q + 2q. Let y(v) be the first derivative of -2v*3/3 + 5v*2/2 - 2. What is b(y(w))? 4w*2 - 10w Let x(b) = b*3 - 6b*2 + 8b - 4. Let q be x(3). Let h(v) = -3v - 7. Let u(z) = 2z + 5. Let y(m) = qu(m) - 5h(m). Let i(w) = 4w. Give i(y(p)). 4p Let v(g) = 2g. Let t(p) = 3p2. Let q(u) be the third derivative of u5/12 - 3u2. Let j = 60 + -63. Let o(i) = jq(i) + 6t(i). Calculate o(v(l)). 12l*2 Let f(p) = -p + 3. Let s(c) = 2c + 14. Let w(a) = 10f(a) - 2s(a). Let b(l) be the third derivative of l*4/12 + 2l*2. What is w(b(v))? -28v + 2 Let r(m) = -46160 + 46160 + m*2 + 0m*2. Let n(d) = 13d - 26. Calculate r(n(t)). 169t2 - 676t + 676 Let i(w) = 5w + 3w - 5w + w. Let t(h) = -5h - 1. Let l(a) = -1. Let z(j) = -l(j) + t(j). Give i(z(k)). -20k Let k(d) = -2d*2. Let c(f) = -2. Let o(m) be the third derivative of 0m + m*2 - 5/6m*3 + 0 + 1/24m*4. Let r(t) = 5c(t) - 2o(t). Determine k(r(i)). -8i*2 Let l(a) = 27a. Let g(w) = -5w2 - 40w - 4. Calculate l(g(s)). -135s2 - 1080s - 108 Let z(n) = 2n2. Let h(a) be the first derivative of -2a3 - a2 + 2a - 8. Let b(q) = 7q*2 + 3q - 3. Let k(d) = 2b(d) + 3h(d). Calculate k(z(y)). -16y4 Let v(c) = -3691c. Let l(d) = -6d2 + 25. What is v(l(a))? 22146a*2 - 92275 Let t(g) be the second derivative of 14g*3 + 2g + 17. Let i(p) = -2p2. What is t(i(h))? -168h*2 Suppose -2x = -2f + x + 24, 3x + 33 = 3f. Let k(q) = -fq + 9q - q. Let s(n) = -81n. Let h(i) = 5i. Let z(r) = 33h(r) + 2s(r). Determine z(k(j)). -3j Let i(l) = 6l. Let t(d) = -d. Let n(h) = -5h. Suppose -4z + 3c - 12 = 0, -z + 0c - 22 = 4c. Let w(p) = zt(p) + n(p). Determine w(i(a)). 6a Let m(s) = -s*2. Let n(l) be the first derivative of 3l*3 - 36l + 40. Let v(x) = -x*2 + 2. Let o(p) = n(p) + 18v(p). What is o(m(z))? -9z4 Let c(g) = -2g. Let m(r) = -4r + 3. Suppose -4l + 7l = -30. Let q(a) = -8a + 5. Let y(p) = lm(p) + 6q(p). Calculate c(y(b)). 16b Let q(h) = -7h*2 + 12h - 2. Let k(v) = 2v2 - 2v - 1. Let t(s) = 2k(s) - q(s). Let z(p) = -p. Give z(t(c)). -11c*2 + 16c Let r(n) = 7n + 6. Let l(u) = -u2 - 41u. Give l(r(y)). -49y2 - 371y - 282 Let f(v) be the first derivative of -4v2 + 80. Let w(d) = 12d*2. Determine f(w(l)). -96l*2 Let p(v) = -v. Let w(i) be the third derivative of -55/24i*4 + 0 + 0i + 0i3 + 21i*2. Determine w(p(r)). 55r Let j be 4/14 + 852/(-42). Let o = 23 + j. Let c(q) = 3q + q - oq - 5q. Let u(r) = -r. Give c(u(x)). 4x Let m(w) = 8w - 6. Let o(q) = -7q + 5. Let a(l) = -5m(l) - 6o(l). Let u(k) = -14k - 14k - 17k + 41k. Calculate u(a(n)). -8n Let b(m) be the first derivative of 20m*3/3 - 77. Let u(c) = 3c*2. What is b(u(p))? 180p*4 Let x(m) = m. Let p(i) = -2i - 89. Let s(n) = -2n - 90. Let h(v) = -3p(v) + 2s(v). Give h(x(l)). 2l + 87 Let u(q) be the second derivative of 0q3 + 0q*2 - 5q + 0 + 5/6q4. Let c(m) = 2m*2. What is c(u(i))? 200i*4 Let i(q) = 2q*2. Let g = -63 + 65. Let t(a) = -g - 57a + 2 + 76a. Calculate t(i(x)). 38x*2 Let m(p) = 18p*2 - 35p*2 + 15p*2. Let q(o) = 39o*2 - 47o*2 + 4 + 0. Give q(m(v)). -32v*4 + 4 Let f(c) = -2730c - 6. Let l(d) = 6d. Calculate l(f(t)). -16380t - 36 Let d(p) = 144441p2. Let r(f) = -6f*2. Determine d(r(j)). 5199876j*4 Let z(h) = h. Let p(t) be the third derivative of -26t*2 - 1/3t*4 + 0t + 0 + 5/6t3. What is p(z(o))? -8o + 5 Let p(t) = -4t2. Let y(a) = 1. Let k(x) = x - 12. Let j be k(11). Let l(v) = 3v*2 + 3. Let g(c) = jl(c) + 3y(c). Determine p(g(h)). -36h*4 Let j(i) = 0i*2 + 2i*2 + 5012 - 5012. Let d(z) = -2z*2 - 4z2 + z2. Calculate d(j(k)). -20k4 Let w(i) = 6i*2 - 3i - 3. Let v(g) = -13g2 + 7g + 7. Let q(j) = -3v(j) - 7w(j). Let y(r) = -r - 76. Calculate q(y(d)). -3d2 - 456d - 17328 Let w(u) = 8u2 - 5u. Let n(g) = 44g2 - 28g. Let h(p) = 5n(p) - 28w(p). Let b(y) = 10y2. Calculate b(h(i)). 160i4 Let v(q) be the second derivative of -q4/24 + 13q2 + 5q. Let b(i) be the first derivative of v(i). Let c(o) = 2o - 5. Give c(b(u)). -2u - 5 Let v(f) = -4f. Let l(w) be the third derivative of 0w + 14w2 - 1/12w*4 + 0w*3 + 0. What is l(v(o))? 8o Let n(z) = -16z. Let g(h) = -39h*2 + 11h + 1. What is n(g(q))? 624q2 - 176q - 16 Let y(k) be the second derivative of 5k3/6 + 62k + 3. Let q(s) = 51s2. What is q(y(t))? 1275t*2 Let w(q) = -108q*2 + 65q*2 + 81q2. Let p(n) be the second derivative of n3/2 - n. Calculate p(w(k)). 114k2 Let s(q) = -3q*2. Let g(m) = 154956m*2 - 3. Give g(s(i)). 1394604i*4 - 3 Let g(u) = 87u*2 - 157u*2 + 72u*2. Let o(c) = -172c*2. Calculate g(o(t)). 59168t*4 Let w(i) = -353i. Let h(q) = 1873q2. What is w(h(d))? -661169d*2 Let c(l) = 3l + 50. Let k(w) be the first derivative of -w*2 - 34. What is k(c(q))? -6q - 100 Let k be -1 - (0 + -5)/5. Let t(i) be the third derivative of 0i - 2i*2 + 0 + 0i*3 + 1/30i*5 + ki*4. Let w(y) = 11y. Calculate t(w(m)). 242m2 Let m(u) be the third derivative of u4/12 + 20u2. Let o(i) be the second derivative of -i3 + 6i. Calculate o(m(a)). -12a Let k(w) = 4w2. Let o(x) = 1508x - 1506x + 15x2 + x2. What is o(k(q))? 256q4 + 8q*2 Let w(i) = 53 - 4i - 53 + 3i. Let o(q) = 13q*2. Let j(h) = 42h*2. Let g(m) = 2j(m) - 7o(m). What is g(w(d))? -7d2 Let x(v) be the second derivative of v4/12 + 2v. Let d(g) be the third derivative of g5/30 - 7g*2. Calculate x(d(q)). 4q*4 Let l(y) = y. Let r(u) = -22u*2 + 66u. Let v(o) = -66l(o) + r(o). Let t(m) be the first derivative of -m2 - 4. Calculate t(v(f)). 44f2 Let k(u) be the third derivative of u4/3 - u*3/3 + 39u*2. Let m(q) = 4q*2. Give k(m(p)). 32p*2 - 2 Let r(v) = -11v - 4. Let d(b) = 120b + 45. Let o(p) = 4d(p) + 45r(p). Let n(u) = -9u*2. Calculate n(o(s)). -2025s*2 Let f(a) be the third derivative of -11a*5/60 + 4a*2. Let k(d) = -275 + 134 - 4d + 141. Determine k(f(q)). 44q2 Let z(n) = -6n*2 - 139n - 7. Let d(b) = 3b. Give d(z(q)). -18q*2 - 417q - 21 Let v(q) = -5q2 - 6q. Let w(z) = 11z2 + 13z. Let t(s) = 13v(s) + 6w(s). Let d(o) = 5o. What is d(t(b))? 5b*2 Let r(t) = -2t + 2 - 2. Suppose 14g = 12g + 4. Let w(j) = 2jg - 856j + 856j. What is r(w(m))? -4m2 Let x(n) be the second derivative of n3/6 - 10n. Let r(q) = 85q + 6. Let v(p) = -128p - 8. Let b(o) = -7r(o) - 5v(o). Give x(b(l)). 45l - 2 Let x(r) = -2r2 + 2r + 257. Let z(c) = -4c2. What is x(z(n))? -32n*4 - 8n*2 + 257 Let r(k) = -k. Let x(t) = -4t*2 - 5t - 884. Determine r(x(d)). 4d2 + 5d + 884 Let a(v) = -8v2. Let x(d) be the second derivative of 19d*3/6 + 52d. What is x(a(b))? -152b2 Let p(t) = -2t - 10419. Let d(a) = -27a - 2. Determine d(p(b)). 54b + 281311 Let k(b) = 283b. Let y(p) = -17p + 4. Let l(z) = -13z + 3. Let j(t) = -4l(t) + 3y(t). Calculate k(j(o)). 283o Let x(u) = -2u - 5. Let v(d) = -51d + 19. Determine v(x(w)). 102w + 274 Let k(o) = 10o + 112. Let i(c) = 3c + 35. Let a(h) = -16i(h) + 5k(h). Let l(n) = 10n*2. Calculate l(a(m)). 40m*2 Let p(f) = -75f + 28f + 25f + 24f. Let n(s) = 461s*2. Determine n(p(q)). 1844q2 Let w(h) be the second derivative of -h3/3 + 2h. Let v(i) be the first derivative of -5/2i*2 + 0i + 3. Determine w(v(p)). 10p Let b be (-4)/4 + 0/(-1). Let z(x) = -81 - x + 81 - 2x. Let h(l) = l. Let c(j) = bz(j) - 2h(j). Let i(v) = -v2. Determine i(c(w)). -w2 Let i(w) = -7w2. Suppose 2b - 93 - 230 = -3c, -5c = 5b - 530. Let v(d) = 111 - 4d - c. What is i(v(a))? -112a	{ "pile_set_name": "DM Mathematics" }
2y + 7y for y. -1 Solve -16q + 8q = 16 for q. -2 Solve -34 = 4v - 38 for v. 1 Solve -33n - 48 = -39n for n. 8 Solve -7f = -f - 30 for f. 5 Solve -20k + 33 + 27 = 0 for k. 3 Solve 91 = 41h - 114 for h. 5 Solve 0 = 17h - 0h - 68 for h. 4 Solve -4g = -g for g. 0 Solve -6d = 2d + 48 for d. -6 Solve -152 + 116 = -9v for v. 4 Solve -6x + 3 = -9 for x. 2 Solve 6 = -17d + 6 for d. 0 Solve -52 = 9u - 88 for u. 4 Solve 455i = 452i + 12 for i. 4 Solve 80 = 435r - 443r for r. -10 Solve -4a - 36a = -200 for a. 5 Solve 4r + 8 = 8 for r. 0 Solve 26 = -14d + d for d. -2 Solve -8q + 20 = 60 for q. -5 Solve -2c - 29 = -21 for c. -4 Solve 9i - 21i = 48 for i. -4 Solve v = -0v - 4v for v. 0 Solve 9m + 4 = 5m for m. -1 Solve 0 = -5o + 10 + 10 for o. 4 Solve -3 = -3i + 2i for i. 3 Solve -4m - 7m = -6m for m. 0 Solve 16l + 136 = -18l for l. -4 Solve 14n - 11n + 12 = 0 for n. -4 Solve -7s + 24 = -13s for s. -4 Solve 0 = 12w - 9w + 18 for w. -6 Solve -6j + 17j + 66 = 0 for j. -6 Solve 658i - 654i - 16 = 0 for i. 4 Solve -8b - 366 + 358 = 0 for b. -1 Solve 45l - 44l = -4 for l. -4 Solve n - 1 = -0 for n. 1 Solve 106k = 87k - 38 for k. -2 Solve 0 = -956f + 953f + 18 for f. 6 Solve -2n - 30 = 13n for n. -2 Solve -132m - 16 = -128m for m. -4 Solve 0 = -4g - 4g - 16 for g. -2 Solve 0 = 137o - 1171 + 75 for o. 8 Solve 29p = 111 - 227 for p. -4 Solve 282 = 2u - 143u for u. -2 Solve 84f = 79f + 30 for f. 6 Solve -8h + 312 - 344 = 0 for h. -4 Solve -33l = -76 - 23 for l. 3 Solve -w - 2w = 12 for w. -4 Solve 43 = 26p - 9 for p. 2 Solve -60 = -24i + 4i for i. 3 Solve -50j + 45j = 20 for j. -4 Solve 32 = 17t + 66 for t. -2 Solve m = 6m + 10 for m. -2 Solve 2t - 16 = 10t for t. -2 Solve -198 = -5f - 193 for f. 1 Solve 2l + 122 = 114 for l. -4 Solve u + 7 = 4 for u. -3 Solve 7a - 29 = 6 for a. 5 Solve 0 = 5325x - 5333x - 88 for x. -11 Solve -100h - 223 = 577 for h. -8 Solve 24k = -50k + 518 for k. 7 Solve 4a = 35 - 47 for a. -3 Solve 23v = -48v for v. 0 Solve 0 = -10w - 3w + 13 for w. 1 Solve -619 + 583 = 9n for n. -4 Solve -7w = -6w + 5 for w. -5 Solve -69p - 3 = -66p for p. -1 Solve 5u + 15 = -15 for u. -6 Solve -10b + 50 + 0 = 0 for b. 5 Solve -11i = 79 - 13 for i. -6 Solve 21r = 113 + 34 for r. 7 Solve -7q + 4 = -3 for q. 1 Solve -177 - 87 = 66m for m. -4 Solve 4y + 1 + 11 = 0 for y. -3 Solve 7 = 10v - 23 for v. 3 Solve -4l = 2l + 6 for l. -1 Solve 11u - 7 = -40 for u. -3 Solve -6c + 650 = 638 for c. 2 Solve 18 = 381r - 390r for r. -2 Solve 0 = -3b + 26 - 41 for b. -5 Solve -72s - 48 = -80s for s. 6 Solve -64 - 32 = -48q for q. 2 Solve 0 = -92p + 58p + 102 for p. 3 Solve 3f + 4 - 7 = 0 for f. 1 Solve 0 = -232z + 240z - 32 for z. 4 Solve 0 = 30i - 34i + 12 for i. 3 Solve 2f + 0f = -4 for f. -2 Solve 106f - 105f = 5 for f. 5 Solve -45 = 64n - 55n for n. -5 Solve 20w - 3 = 23w for w. -1 Solve 363k - 355k - 32 = 0 for k. 4 Solve 28k + 24 = 16k for k. -2 Solve 0 = 19q - 48 - 28 for q. 4 Solve 2u = 5u + 15 for u. -5 Solve 18 - 83 = 13c for c. -5 Solve 161 = 2n + 181 for n. -10 Solve 91m - 78m = -26 for m. -2 Solve 20o + 20 = 30o for o. 2 Solve -16a + 57 = 9 for a. 3 Solve -243 = -23b - 105 for b. 6 Solve -4 = -4s - 0 for s. 1 Solve -12f + 6f - 7f = 0 for f. 0 Solve 55q - 7q = 96 for q. 2 Solve 35 - 19 = 8j for j. 2 Solve w + 36 - 33 = 0 for w. -3 Solve 4 = -89h + 93 for h. 1 Solve -38t - 26 = -12t for t. -1 Solve -589 = -9o - 589 for o. 0 Solve 0 = -43h - 17 + 146 for h. 3 Solve -7n + 0 + 35 = 0 for n. 5 Solve -134 = -16n - 38 for n. 6 Solve 8v - 44 = -20 for v. 3 Solve 203k - 200k + 15 = 0 for k. -5 Solve -97v + 133 = 36 for v. 1 Solve -29v - 150 = -14v for v. -10 Solve 33t = 34t + 4 for t. -4 Solve -15y + 19y = 0 for y. 0 Solve -25j = -85j + 540 for j. 9 Solve 46r + 18 = 49r for r. 6 Solve 7z = -5z - 36 for z. -3 Solve -27y + 54 = -9y for y. 3 Solve 133r - 14 = 126r for r. 2 Solve -5m + 115 = 18m for m. 5 Solve 0 = -88q + 825 - 33 for q. 9 Solve -9f = 1705 - 1768 for f. 7 Solve -6g = 129 - 99 for g. -5 Solve 15h + 34 = -11 for h. -3 Solve 19k - 72 = -15 for k. 3 Solve 0 = -2h - 49 + 43 for h. -3 Solve 0 = -4z - 10 + 2 for z. -2 Solve 25 - 19 = -2c for c. -3 Solve 0 = 292r - 287r for r. 0 Solve 3a - 5 = -17 for a. -4 Solve -225z - 1 = -226z for z. 1 Solve -152x = -168x + 96 for x. 6 Solve -771 = -145m + 99 for m. 6 Solve -90 = 4t + 14t for t. -5 Solve 92 = -7f + 57 for f. -5 Solve 26 - 20 = 3p for p. 2 Solve 16 = 5d - 4 for d. 4 Solve 39i - 33i = -6 for i. -1 Solve -183x - 30 = -198x for x. 2 Solve 32h = 29h + 12 for h. 4 Solve 114 = 26p + 270 for p. -6 Solve 157a - 158a = -3 for a. 3 Solve 0 = -10f + 27f - 34 for f. 2 Solve 73q + 16 = 77q for q. 4 Solve 7j = -3j for j. 0 Solve 0 = 47y + 24 - 24 for y. 0 Solve 15 = -2q + 21 for q. 3 Solve t + 70 = 62 for t. -8 Solve -23q = -58 - 103 for q. 7 Solve 231 = -2k + 221 for k. -5 Solve 0 = -5z - 29 + 49 for z. 4 Solve 2u = -u + 3 for u. 1 Solve 2g - 6g = -8 for g. 2 Solve -4t - 35 = -11t for t. 5 Solve g = -40 + 43 for g. 3 Solve 4z + 68 = 68 for z. 0 Solve -8d = 5 + 27 for d. -4 Solve 7g = -116 + 172 for g. 8 Solve -16a - 145 = 13a for a. -5 Solve -15o = -29o for o. 0 Solve 15b = -263 + 218 for b. -3 Solve -19 = 9f - 10 for f. -1 Solve -502k = -508k for k. 0 Solve -2g = -1370 + 1384 for g. -7 Solve -13 = 11a - 46 for a. 3 Solve 0 = -71a + 68a + 3 for a. 1 Solve 0 = -4d + 6 + 2 for d. 2 Solve 456n - 447n = 63 for n. 7 Solve 15a = -50 + 125 for a. 5 Solve 9s + 0 = -45 for s. -5 Solve -15 = -w - 2w for w. 5 Solve 0 = -2u - 0u + 6 for u. 3 Solve -6g - 122 + 164 = 0 for g. 7 Solve -12 + 32 = -10c for c. -2 Solve 10u + 39 = -21 for u. -6 Solve 33 = 12h - h for h. 3 Solve -b = -0b for b. 0 Solve -31y + 61y = -240 for y. -8 Solve 282 = 125a - 93 for a. 3 Solve 0 = 4i - 42 + 58 for i. -4 Solve 0 = -8z + 7z - 1 for z. -1 Solve 0 = -21u - 470 + 491 for u. 1 Solve 9i = 3i + 24 for i. 4 Solve 0 = -15o + 37 + 8 for o. 3 Solve -10z = 7 - 57 for z. 5 Solve -i - 2 + 0 = 0 for i. -2 Solve -13 = -64w - 333 for w. -5 Solve 0 = -8w - 8 - 24 for w. -4 Solve 0 = 5h + 8h - 39 for h. 3 Solve 13b = -29 - 23 for b. -4 Solve 0 = -84c + 83c - 1 for c. -1 Solve -5l - 17l = 66 for l. -3 Solve -114 = h - 109 for h. -5 Solve 16b - 10 = 21b for b. -2 Solve 3u - 24u = -63 for u. 3 Solve -5 = 89v + 173 for v. -2 Solve -1917g + 144 = -1933g for g. -9 Solve -3 = 3f - 12 for f. 3 Solve -9 = -9k - 0 for k. 1 Solve 547 = 143g - 25 for g. 4 Solve 2o + 26 = 16 for o. -5 Solve -71x + 73x + 2 = 0 for x. -1 Solve -2c + 47 - 31 = 0 for c. 8 Solve 0 = 25m + 146 + 54 for m. -8 Solve 0 = 6f - 15f + 45 for f. 5 Solve -22 = -16h + 58 for h. 5 Solve 6g - 44 = -2 for g. 7 Solve 3j = 5j - 4j for j. 0 Solve 57 + 9 = 11j for j. 6 Solve -190p = -188p - 12 for p. 6 Solve -17 + 12 = -5j for j. 1 Solve -21r + 2r = -7r for r. 0 Solve -6h + 0 = 6 for h. -1 Solve 129 = -67a - 407 for a. -8 Solve 0 = -6s + 2 - 14 for s. -2 Solve -14 = -36h + 58 for h. 2 Solve -65g - 12 = -69g for g. 3 Solve -14i - 136 = -52 for i. -6 Solve 20 = 4t - 8t for t. -5 Solve 0f + 15 = 3f for f. 5 Solve -21b + 14b - 56 = 0 for b. -8 Solve -75w - 21 = -72w for w. -7 Solve 0 = o - 25 + 27 for o. -2 Solve -15k + 55k = -240 for k. -6 Solve 66n - 69n = 18 for n. -6 Solve -18x - 36x - 378 = 0 for x. -7 Solve 0 = -66c + 51c + 60 for c. 4 Solve -760y + 754y = 0 for y. 0 Solve 41x - 56x = 90 for x. -6 Solve 28 = -216m + 209m for m. -4 Solve 4a = -0a - 8 for a. -2 Solve -60d + 161 = 41 for d. 2 Solve 0 = -v + v + v for v. 0 Solve -85g = 40g + 125 for g. -1 Solve 0 = -2p - 21 + 33 for p. 6 Solve 10n = -1079 + 1029 for n. -5 Solve 36f + 4 = 32f for f. -1 Solve -25v + 25 = -20v for v. 5 Solve -14t + 16 = -10t for t. 4 Solve 35z - 24z = 22 for z. 2 Solve -10 = 7p - 12p for p. 2 Solve -u = -4 + 3 for u. 1 Solve 241f - 91 = 254f for f. -7 Solve -6009v + 6019v = 0 for v. 0 Solve -11n - 20 = 24 for n. -4 Solve 35s = 32 - 32 for s. 0 Solve 0 = -15j + 16j + 3 for j. -3 Solve -19a + 67	{ "pile_set_name": "DM Mathematics" }
base 7) to base 16. -26e0e1 What is 142a1c1 (base 14) in base 11? 5583a71 Convert -3693937 (base 13) to base 2. -1000000101111111001010000 -20112121202 (base 4) to base 13 -5b840a -4aa59 (base 11) to base 7 -423155 10111001010001110110100 (base 2) to base 14 b40788 What is 1059031 (base 13) in base 2? 10011000010000111110011 1412513 (base 6) to base 4 103130331 1111001000111010000100 (base 2) to base 12 13b4804 -3cb3e (base 15) to base 11 -123490 What is 68765 (base 10) in base 14? 1b0bb Convert 70940 (base 14) to base 11. 175450 113014340 (base 5) to base 16 7e2ed -3350251 (base 7) to base 10 -415507 What is 64680 (base 10) in base 8? 176250 -21132031233 (base 4) to base 14 -488c91 What is 100001101001001100000 (base 2) in base 7? 12241042 What is -2796f (base 16) in base 5? -20142114 483627 (base 11) to base 13 20a903 What is 122120201112 (base 3) in base 16? 547d9 565715 (base 8) to base 7 1425061 -1121020210121 (base 3) to base 4 -3033311332 -110010111010110011 (base 2) to base 15 -41be3 What is 4003644 (base 8) in base 15? 15b407 -176377 (base 10) to base 9 -287844 -10111112220000 (base 3) to base 8 -7062700 Convert -20b2c (base 13) to base 9. -88856 17ee5 (base 15) to base 16 12f2f Convert 4400144 (base 6) to base 15. 447e7 Convert 114094 (base 10) to base 3. 12210111201 Convert 1201201012 (base 3) to base 9. 51635 What is -6ac1b (base 13) in base 16? -2fb3c Convert -1066955 (base 10) to base 6. -34511335 -11110100100000011 (base 2) to base 7 -1030656 What is 4543143 (base 7) in base 11? 35682a Convert -11123653 (base 7) to base 15. -140a27 What is 829860 (base 11) in base 16? 144e0f Convert -193262 (base 10) to base 12. -93a12 -4d02f (base 16) to base 5 -40043224 What is 313430145 (base 6) in base 7? 64460636 -63231312 (base 7) to base 3 -101001001221220 Convert 1001010010011111010111 (base 2) to base 12. 9951b3 Convert -16a920 (base 13) to base 8. -2121640 Convert -1021110301 (base 4) to base 9. -506877 What is -1341022100 (base 5) in base 13? -93c594 Convert -112000002010212 (base 3) to base 5. -3401113421 54491a (base 11) to base 12 35b751 -114224551 (base 6) to base 3 -11002000100211 Convert 312550 (base 7) to base 15. 10e0d Convert 111110221200 (base 3) to base 16. 40c68 -8765111 (base 9) to base 11 -2726196 What is -112660 (base 10) in base 14? -2d0b2 1360675 (base 8) to base 12 1670a5 What is -11523499 (base 10) in base 8? -53752653 426684 (base 11) to base 14 13a910 Convert -160026 (base 10) to base 12. -78736 What is -3153532 (base 7) in base 4? -1131201100 43551 (base 13) to base 9 205003 Convert -101221100222 (base 3) to base 4. -310210130 What is 827b2 (base 12) in base 11? 1070a8 Convert 1111101110011110011001 (base 2) to base 5. 2023410041 Convert 1bcaea (base 15) to base 12. 556704 What is 3185281 (base 9) in base 2? 110100001011010101100 102112020001 (base 3) to base 5 24230012 -1101110111011100111101 (base 2) to base 16 -37773d What is -1000010110111101011 (base 2) in base 3? -111220201102 -26b73b5 (base 14) to base 9 -38214656 What is 10100100001111110 (base 2) in base 4? 110201332 Convert -34404b (base 12) to base 10. -836411 Convert 1103320102 (base 4) to base 16. 53e12 Convert 245400053 (base 6) to base 9. 8828636 What is -405011 (base 6) in base 16? -7dbf 286d1 (base 14) to base 9 162330 What is 12121101021 (base 3) in base 15? 22a71 What is -44de7a (base 15) in base 14? -617d1a -1010100100110110 (base 2) to base 3 -2012102101 Convert 118b42 (base 15) to base 9. 1518558 -71eb3f (base 16) to base 9 -15038123 Convert 218a29 (base 13) to base 10. 790448 Convert -136241 (base 8) to base 16. -bca1 -4aba85 (base 14) to base 2 -1001110010111000100101 Convert -147727 (base 15) to base 11. -6146a5 What is -52425 (base 15) in base 4? -333223022 What is 296131 (base 14) in base 16? 15f18f What is 4441221 (base 5) in base 12? 38b5a Convert 60a2e (base 16) to base 6. 12252302 What is -34434302 (base 5) in base 16? -4c213 95155 (base 10) to base 5 11021110 -140525 (base 10) to base 11 -96640 -1230401 (base 6) to base 16 -102c1 157a3a1 (base 12) to base 6 234054321 2447077 (base 8) to base 3 1021022110111 What is -330342 (base 7) in base 5? -3322201 Convert ca794 (base 13) to base 4. 1121112312 What is -3c8d2 (base 14) in base 10? -149928 Convert -1102002001121 (base 3) to base 11. -472093 Convert 9b5ca5 (base 13) to base 4. 31333233130 Convert -83560 (base 9) to base 3. -2210122000 What is -8992 (base 15) in base 4? -13013222 b8067c (base 14) to base 15 82e538 60a12 (base 12) to base 2 11110101110101110 What is -21853 (base 11) in base 12? -16387 Convert 55405 (base 10) to base 8. 154155 298310 (base 10) to base 12 124772 Convert -25534150 (base 7) to base 2. -1000111000010111011001 112100102012 (base 3) to base 10 282425 Convert 23535221 (base 6) to base 3. 1101210021011 Convert 20538 (base 12) to base 10. 42236 -526255 (base 9) to base 16 -4c679 What is 11142113 (base 5) in base 8? 302512 What is 414a (base 16) in base 15? 4e44 5528 (base 12) to base 15 2bb2 51a (base 13) to base 4 31210 -155727 (base 11) to base 10 -241787 What is 380a675 (base 11) in base 12? 22714a1 Convert 448122 (base 9) to base 12. 10b385 Convert 20213204 (base 5) to base 15. 336d9 What is -1a638d (base 14) in base 5? -220023121 172681 (base 15) to base 3 2010000001111 Convert -2d6a0 (base 14) to base 10. -113820 Convert -1111000101011110111001 (base 2) to base 4. -33011132321 Convert 123331 (base 12) to base 14. 79bdb Convert 1341040 (base 8) to base 3. 201011122220 -179875a (base 12) to base 11 -2867533 What is -1233344032 (base 5) in base 13? -820335 9254 (base 15) to base 8 74270 What is -1617722 (base 9) in base 2? -11011011001111000010 Convert -a2905 (base 11) to base 15. -2e761 What is 6c2d5 (base 15) in base 4? 1110031010 Convert -5840890 (base 10) to base 12. -1b5818a 981a62 (base 11) to base 12 638124 What is -279700 (base 14) in base 11? -856856 Convert 2022222202 (base 3) to base 14. 12a40 -17611136 (base 8) to base 3 -21210000001111 What is -3342417 (base 9) in base 12? -729474 63ac77 (base 14) to base 12 1167535 What is -10aee3 (base 15) in base 6? -25023240 -10647a6 (base 11) to base 15 -26cbe9 Convert 27877 (base 14) to base 4. 113312301 Convert 5561001 (base 7) to base 15. d8870 301312111032 (base 4) to base 14 1a4235c What is 235302520 (base 6) in base 5? 2120100042 -25c1c (base 14) to base 6 -1554122 Convert 31118 (base 9) to base 5. 1124020 Convert -10101001110101111010 (base 2) to base 15. -db1d4 -273450 (base 9) to base 13 -5aa8c What is -21233201 (base 5) in base 6? -3511150 What is 10012312220 (base 4) in base 8? 4066650 Convert 225642 (base 7) to base 2. 1001111000000111 Convert -313430434 (base 6) to base 2. -10100111101010010010110 -2210233011 (base 4) to base 3 -1021021121000 Convert 100001012222 (base 3) to base 4. 223131311 -629d (base 15) to base 3 -1001121011 Convert -1201011100 (base 3) to base 15. -9e86 What is -767ca (base 14) in base 5? -33140201 What is d48a9 (base 14) in base 11? 31a827 112013030 (base 4) to base 11 62059 What is 130a914 (base 13) in base 8? 26600644 10011110001100001 (base 2) to base 7 455063 121014430 (base 7) to base 9 15152044 -110001111220 (base 3) to base 8 -717364 Convert 1020515 (base 6) to base 9. 74732 What is 11223133 (base 5) in base 6? 2102404 What is -101100011110001010 (base 2) in base 15? -38e89 -1428844 (base 9) to base 5 -200143104 What is 1413540 (base 6) in base 10? 79908 -10100011101100000011010 (base 2) to base 3 -101002111122222 What is -11011000111100110 (base 2) in base 11? -76500 Convert 14216055 (base 9) to base 15. 94042b -159469 (base 12) to base 16 -5a051 Convert -218863 (base 10) to base 9. -363201 120101000112 (base 3) to base 6 10252405 Convert -332186 (base 9) to base 8. -603457 Convert -b7dc (base 15) to base 8. -113773 43b80 (base 14) to base 16 28144 -1729 (base 15) to base 14 -1b65 What is -675ca8 (base 14) in base 11? -1a89747 Convert 111000010110010001 (base 2) to base 13. 8108c What is 232414 (base 5) in base 13? 3b28 What is -106249 (base 10) in base 5? -11344444 Convert 1151657 (base 9) to base 11. 397274 Convert -11668273 (base 9) to base 10. -5714130 What is -415434145 (base 6) in base 15? -98856b 750163 (base 12) to base 16 1c29db 158b2 (base 12) to	{ "pile_set_name": "DM Mathematics" }
xpand (-2 + 2 - 1)(1 + 0 + 2 + (1 - 3 + 0)(5 - 1 - 5))(4y*4 - 4y*4 - 4y*5). 20y*5 Expand 23 - 23 + 8z*5 + (3 + 2 - 3)(z2 - z2 - 2z5) + 0z + z*5 + 0z + (z*4 - 2z5 - z4)(2 - 6 + 2) - 26z*3 + 26z*3 + 45z*5. 54z*5 Expand (22d*3 + 44 - 44)(-3d + 4d + 0d)(-25d + 156 - 156). -550d*5 Expand (-5 + 2 + 1)(-1 + 3 - 4)(d + 69d*3 - 63d*3 + 43 - 47). 24d*3 + 4d - 16 Expand -5y3 + 2y*3 + 2y*3 + (6y - 4y - 3y)(8 + 9y*2 - 8) + (-2 + 2 - 4y)(19y*2 + 17y*2 + 6y*2). -178y*3 Expand -3j*3 - 4j3 + j3 + (-1 + 1 + 2j2)(0j - 2j + j) + 3j3 - 2j*3 + 0j*3 + 2j*3 - 2j*2 + 2j*2 - 47j*3 - 49j*3 + 98j*3 - 104. -3j*3 - 104 Expand (1 + 2 - 2)(-56g + 56g + 5g2)(2g - 2 + 2 + (-28 - 2 - 11)(0g - 3g + 4g) + 0g - g - g). -205g3 Expand -8n*2 - 96 + 18n + 96 + (-1 + 5 - 2)(2n2 - n2 + 0n2). -6n*2 + 18n Expand -2c + 2c + 3c4 + (579c*3 - 614c*3 + 1554c*3)(-2c - 3c + 6c) + c4 + 0c4 + c4. 1524c4 Expand (5 - 4 - 3)(1081c + 22375c + 3875c). -54662c Expand (3q3 + 1 + 1117q*2 - 1117q*2)((5q - 3q - q)(4 + 1 - 3) + 3q - 3q + 3q). 15q4 + 5q Expand (64t2 - 32t*2 - 42t*2)(104t - 15t + 4 - 4 + 115t). -2040t*3 Expand (-128 + 128 + c)(6 + 5 - 5)(-3 - 2 + 3). -12c Expand (2068 - 2068 - 38y)(-15y - 8y + 7y) + (y - 4y + y)(0 + 0 - y). 610y*2 Expand 74l - 5l2 + 4l*3 - 74l + (-821 - 18l + 821)(2l - 6l + 2l)(0l + 4l - 2l). 76l*3 - 5l*2 Expand (-4p + 2p + 3p)(4388p*2 + 3p - 6446p2 + 9p - 6p) + p3 - 5p*2 + 5p*2. -2057p*3 + 6p*2 Expand -4i3 - i3 + 4i3 + (-2 - i + 2)(3i2 - i2 - i2) + 3i - 3i + i3 + 3i*3 - 6i3 + i3 + (i - i + 4i3)(-30 - 32 + 63). i*3 Expand -250c*2 - 365c*2 - 109c*2 + (1 + 1 - 1)(-3c + 0 + 0)((-1 + 0 + 0)(-c + 2c + 0c) - 3c + 0 + 0). -712c2 Expand (7k*3 - 1 + 1)(3k + 3k - 4k + (3k - k + k)(-1 + 1 - 2)). -28k*4 Expand 0z*2 + 0z2 - z4 + (6z - 2z - z)(32z*3 + 619997z - 619997z). 95z*4 Expand (8 - 2r*2 - 8)(2r + 0r - 5r) + 23r*2 - 32r*3 - 24r*2 + 14 + 30r*3. 4r3 - r2 + 14 Expand (20u + 31 - 7 - 23)(-u - 3 - u + 1). -40u2 - 42u - 2 Expand (3 + 0 - 5 + (-324 - 142 + 41)(-3 - 3 + 4))((3z2 - z2 - 3z*2)(-2z - 2z*3 + 2z) + 5 - 5 + 2z5 + z5 + z5 - z5)(-4 + 6 + 0). 8480z5 Expand (-161c*2 + 161c*2 - 11c*4)(0c - 11c + 4c + (0c - 4c + 2c)(0 + 4 + 9)). 363c*5 Expand (52k - 34k3 - 52k)(5k - k + 9k) + (-4k3 + k3 + 2k3)(0 - 3 - 2)(2k - 2k - k). -447k*4 Expand (41 - 41 - 3f)(-21 + 2 - 7)(47f2 + 45f*2 - 94f*2). -156f*3 Expand -863h*4 - 2772h*2 + 2772h*2 + 4h*4 + 2h*4 - 5h*4 + (-1 - 2h*4 + 1)(-2 - 1 + 5). -866h4 Expand (4 + c - 4)(-2 + 2 - 3c) + 232c*2 - 1157 + 223c*2 - 457c*2. -5c*2 - 1157 Expand (539p*3 - 8p + 543p3 - 28 - 1084p*3)(0p2 - 3p*2 + 5p*2). -4p*5 - 16p*3 - 56p*2 Expand ((1 - 1 - 3r)(-1 + 0 - 1) + 54r - 9r - 1 - 5r)(-r + r + 2r). 92r2 - 2r Expand (6w + 0w - w)(407 + 696 + 217 + 164 + 106). 7950w Expand (-108 - 188 - 112 + 51)(104k*4 + 120k*4 - 186k*4). -13566k*4 Expand (-2 + 4 - 4)(183x + 393 - 393)(7x + x - 4x)(3x*2 - 2x2 - x + x2). -2928x4 + 1464x*3 Expand (-3a*3 - 3a*3 + 5a*3)(a - a + 2a) - a2 + 3a4 + a2 + (-7a2 + 2a*2 + 1 + 4a*2)(-51a2 - 28a*2 + 23a*2). 57a*4 - 56a*2 Expand (81z - 148z2 - 81z)(-2 + 2 + 2)(4 + 8 - 9). -888z2 Expand (-69 + 69 - 19d)(-2d*4 + 2d*2 - 2d*2) + (-4 + 3 - 1)(0d5 - d5 - d5) - 71d*5 - 116d*5 + 2d*5. -143d*5 Expand (4 - 6 + 1)(2g + 0 + 0) - 654g - 184g - 100g - 88g. -1028g Expand (3 + 2 - 15)(-5q + 34q + 63q)(2q*2 + 4 - 4). -1840q*3 Expand (4n - 6n + 4n)(-7n*2 + 3n*2 + 6n*2)(-11n2 - 11n + 9n - 2 + 13n*2). 8n*5 - 8n*4 - 8n*3 Expand (-1 + 0 + 4)(-3 + 3 - 2m) + 2 + 2m - 2 + (-2m + 0m + 0m)(-4 + 3 + 3) - 201m - 328m - 432m + (5m - 4m - 3m)(-3 + 6 - 2). -971m Expand (0f - f - f + (-1 + 0 + 0)(-159f - 8290 + 8290))(0 - 1 - 1 + (5 + 1 - 4)(-4 + 2 + 0) + 5 - 4 + 0 - 3 + 1 + 1). -942f Expand (54 - 54 + 52b)(-4b - 13b - 2b). -988b*2 Expand 23832d*3 - 11926d*3 - 103d - 11934d3 + d3 - d3 + d3 + 4 + d3 - 4 + (0d2 - d2 - d*2)(-2 + 2d + 2). -30d*3 - 103d Expand (4 - 33 - 8)(-108s*4 + 68s*4 + 55s*4). -555s*4 Expand (-3 + 67p - 46p + 5)(-38p2 + 15p*2 + 16p*2). -147p*3 - 14p2 Expand f4 + f*4 - 5f*4 + (245f*2 - 532f*2 + 388f*2)(f*2 + 0f*2 - 2f*2). -104f*4 Expand ((20j - 42j - 29j)(2j + 0j - 5j) + (3j2 - 5j*2 + 0j*2)(-2 + 5 - 2))(2 + 9 + 8). 2869j*2 Expand 4o*2 - 2o*2 - 3o*2 + (-3 + 19 - 3 - 3 + 3 + 1 + (1 + 2 - 2)(0 - 2 + 1) - 1 + 0 + 2)(-21o + 74 + 83 - 159)(o + 0o - 3o). 587o*2 + 56o Expand 10u2 + 7 - 13 + 2 + (1 + 2u - 1)(3u + 0u + 0u) + 0u2 - u2 + 0u*2. 15u*2 - 4 Expand (-2d*2 + 0d + 0d)(-3d - d + 2d) + (-6 - 4d + 5d + 7)(166d - 173d + 5 - 9 + d2). 5d*3 - 6d*2 - 11d - 4 Expand (-4m2 + 3m2 - m2)(-4m + 5m + 0m) + 220m3 - 707 + 355 + 354. 218m*3 + 2 Expand (4w*2 - 3w2 + w2)(-2w + 4w - w + (-3 + 2 + 0)(-w + 4w - 2w) - w + 0w + 0w)(0 - 5 + 1)(555w2 + 854 + 104w*2 - 861). 5272w*5 - 56w*3 Expand (22 + 17 - 712r + 19 - 58 - 1649r)(-57r - 6r*2 + 57r). 14166r3 Expand ((-3 + 4 + 1)(2g - g + g) - 5g + g + 3g)(59 + 6g2 + 32 + 3g - 110). 18g3 + 9g*2 - 57g Expand -662369x + 1324743x - 662374x + 16838x4 + (-x4 + 0 + 0)(-1 - 3 + 2) + x4 + x4 + 0x*4. 16842x*4 Expand (2c*3 + 3c - 3c)(5 - 4 + 2148c - 2139c). 18c4 + 2c*3 Expand (-37p*5 + 1128p*5 - 57p*5)(6 - 5 + 0)(-14 + 4 + 29 - 2 + 38). 56870p*5 Expand ((-2s - 2s + 3s)(0 + 1 - 2) - 1186167 + 1186167 + 1837s)(-2s*2 - s + s + (4s - 6s + s)(5s - 4s + 0s)). -5514s*3 Expand 3z*3 + 83z*2 - 83z*2 - 2z*3 + 2z3 + z3 + 4z - 4z - 2z3 + (2z*3 + 3 - 3)(-5 + 4 + 0) + 0z3 + 13z*3 + 5z*3. 18z*3 Expand 34 - 34 + 10n*2 + (-1 - 5 + 2)(n2 - n2 - 13n2). 62n*2 Expand (-2h*3 + 2h*5 + 2h*3 + (2h*5 + 1 - 1)(3 - 5 + 4) - 5h3 + 4h*5 + 5h*3)(-1 + 0 - 1) - 2h4 - 33h - 29h + 5h*5 + 60h. -15h5 - 2h*4 - 2h Expand 0y + y + 0y + (-1 + 2 + 1)(-292y - 129y - 96y). -1033y Expand (70 + 48 - 32x - 118)(x2 - 2x3 - x2). 64x4 Expand (372 + 467 + 254)(-2 + 0 + 0)(-c3 + 0c*3 + 2c*3). -2186c*3 Expand (5 - 11 + 26)(3 - 2 + 3)(0k - 5k - 9k). -1120k Expand (3n*2 - 5n*2 + 0n*2)(-288n + 513n + 323n). -1096n*3 Expand (-10v*3 + 2v*3 - 3v*3)(-3v + 7v - 12v) - 7v*2 - 2v*4 + 7v*2. 86v*4 Expand 0a*3 - 3a*3 + 4a*3 + (-61a + 46a + 173a)(a2 - 2a*2 - 2a*2). -473a*3 Expand ((-3g + 3g - g)(1 + 2 - 1) + 71g + 58g - 102g - 3)(116g + 174g - 91g). 4975g*2 - 597g Expand (5i5 - i5 - 3i*5)(-27 + 33 + 36) + (i4 + i4 - i*4)(3 - 3 + 3i) + 3i*5 - 2i*5 - 3i*5. 43i*5 Expand (3 + 2 - 3)(-2 + 0 + 0)(-8 - 31 + 8)(-4a + 6a - a). 124a Expand 85a*2 - 5a*2 + 133a*2 + (2a - 3 + 3)(a - 2a + 2a) - 5a*2 - 2 + 2. 210a2 Expand (300 + l2 - 20l - 300)(-14 + 29 - 5l - 9). -5l*3 + 106l*2 - 120l Expand (4 + u - 4)(1 - 1 + 2u) + (-u - 1 + 1)(-29 - 122 + 404)(8u - 3u - 2u). -757u*2 Expand 64p*2 + 27p*2 - 7p*2 - 2p*2 + 2 - 2 + (3 - 3 - 6)(-1 + 1 - 2p2) - 2p*2 - 2p + 2p. 92p*2 Expand (36y*4 - 30y*4 + 62y*4)(40 - 51 - 67 + (0 + 5 - 4)(-1 - 2 + 4)). -5236y*4 Expand (0 + 0 - 107o + 35o)(-37o4 + 21o*4 - 157o*4). 12456o*5 Expand (131 - 9 + 16)(24d - 14d - 18d). -1104d Expand (-992 - 873 + 971 - 785)((0 + 1 + 1)(-b*2 + 5b*2 - 5b*2) - 18b*2 + 20 - 20). 33580b*2 Expand -16c*4 + 74c*3 - 74c*3 + (-6c*2 + 6c*2 + 8c*3)(1 - 1 + 3c). 8c*4 Expand (-4t3 - t3 + 4t3)(-306 - 257 + 154)(0 - t + 0)(-5 + 3 - 3). 2045t4 Expand (-4 - v + 4)(-547 + 547 - 1	{ "pile_set_name": "DM Mathematics" }
y 93? 90 Let k = -47 - -51. Suppose 0q = kq - 8. Suppose -2 = -c + q. What is the remainder when 7 is divided by c? 3 Let q = 240 - 237. Suppose -a = 5b - 115, qa = 7b - 2b + 265. What is the remainder when a is divided by 15? 5 Suppose -5w + 2m + 4072 = 0, -4w - 4m + 7m = -3252. What is the remainder when w is divided by 30? 6 Suppose -40n = -25188 + 22508. What is the remainder when 308 is divided by n? 40 Suppose 276b = 2296 + 1016. What is the remainder when 21 is divided by b? 9 What is the remainder when (-26)/(-2366)-14 + (-8062)/(-13) is divided by 42? 32 Let f(d) = 4d2 - 8d - 29. What is the remainder when 1799 is divided by f(6)? 57 Let o(i) = 2i2 - 22i + 12. Let f be o(12). Suppose 5k = -9 - f. Calculate the remainder when k(-6 + 2 + 1) is divided by 15. 12 Suppose -3f + 7a + 37 = 12a, 3f - 2a = 23. Suppose -2r - 183 = -3j - 6, 0 = -3r. Calculate the remainder when j is divided by f. 5 Let p = 32826 + -32822. What is the remainder when 7582 is divided by p? 2 Let h = 141 + -138. Suppose 11o - 12o + 11 = -ha, 36 = 4o - 4a. What is the remainder when 46 is divided by o? 6 Suppose -4m = 3m - 77. Let d(r) = r2 - 6r + 27. What is the remainder when d(m) is divided by ((-4)/(-6))/((-46)/(-1449))? 19 Let i(v) = -75v - 901. Calculate the remainder when 435 is divided by i(-13). 65 Suppose 5o = 84 + 31. Let a = 253 - 259. What is the remainder when o is divided by 2 + 92/12 + 4/a? 5 Let p be -22(8/(-16) - 0). Let m(j) = j3 - 11j*2 + 8j + 8. Let o(a) = 19a + 1. Calculate the remainder when m(p) is divided by o(1). 16 Let y(n) = -2n - 38. Let p(t) = -t + 1. Let h(a) = -p(a) - y(a). Calculate the remainder when 45 is divided by h(-4). 20 Let g(r) = -5r3 - 225r*2 - 5r - 106. Calculate the remainder when g(-45) is divided by 20. 19 Let c(b) = -b*3 - 10b*2 + 12b + 12. Calculate the remainder when 125 + -1 + -272 + 272 is divided by c(-11). 0 Let k(q) = 90q*2 + 294q + 2261. Calculate the remainder when k(-8) is divided by 63. 62 Let s be (-1108)/(-7) + (-6)/21. Suppose -5p + 3j + 582 - s = 0, 4p - 336 = 4j. What is the remainder when p is divided by 8 + 8(-63)/(-36)? 20 Let l(p) = p2 - 10p + 48. Suppose -4z + 28 - 5 = -3o, 0 = -5o - 5. What is the remainder when 89 is divided by l(z)? 20 Let p = 203 + -201. Suppose r + 27 = po + 2r, -3r + 9 = 0. What is the remainder when 22 is divided by o? 10 Let r be (3 - (8 + 0))(-8 + 5). Suppose -4s = 4s - 520. What is the remainder when s is divided by (-4 - 39/r)-5? 32 Let k = -21 - -18. What is the remainder when (56 - -7)/(k/(-9)) is divided by 38? 37 Let r = -2595 + 2665. What is the remainder when 2233 is divided by r? 63 Let y = -136 - -237. Suppose 1199 = 6c + y. What is the remainder when c is divided by 23? 22 Suppose -12765 = -24x + 25352 - 29. Calculate the remainder when x is divided by 196. 19 What is the remainder when -152/(-12)42/5 is divided by (-32/(-21))/((-10)/(-700))? 1 Let g(d) = 7d - 130. Let k be g(19). Suppose 2x + 4v = 76, -kx - 16v = -12v - 116. Calculate the remainder when 77 is divided by x. 37 Let b = -17 + 19. Let w be 7/(7/b)7. Suppose -w = -5u + 26. Calculate the remainder when 37 is divided by u. 5 Let v(k) = k3 - 3k*2 - 2k - 5. Let f be v(4). Let b be f/4 - 55/4. Calculate the remainder when (-340)/b - (-34)/(-221) is divided by 5. 1 Let y(s) = 6s2 - 10s - 6. Suppose -35 = -5d + 30. Let w = 32 - d. What is the remainder when y(5) is divided by w? 18 Let d = 9042 - 8775. Calculate the remainder when d is divided by (0 + 1)/(3/54). 15 Let h = 78 + -48. Let q = -25 + h. Let i(y) = 3y + 6. Calculate the remainder when 165 is divided by i(q). 18 Let x(j) be the second derivative of -13j3/3 + 90j*2 + 3j + 3. Calculate the remainder when 70 is divided by x(6). 22 Suppose -3s + 2v = -9286, -2 + 26 = 6v. Calculate the remainder when s is divided by 35. 18 Let d = -22 + 36. Suppose -26m + 1431 = -1871. Let j = -103 + m. Calculate the remainder when j is divided by d. 10 Suppose 9q - 2258 = 35 - 70. Calculate the remainder when q is divided by 232. 15 Suppose -13s = -52 - 0. Suppose 4z - 5y - 33 - 395 = 0, -sy = 0. What is the remainder when 1711 is divided by z? 106 Let q(a) = 1930a - 556. Calculate the remainder when q(1) is divided by 77. 65 Let r(z) = 7z3 - 14z*2 + 31z - 12. Calculate the remainder when 1836 is divided by r(2). 36 Let h = 6 + 110. Calculate the remainder when h is divided by 4 - (-29 - (-5 + 12)). 36 Let m(z) = 2z2 - 65z - 272. Calculate the remainder when 494 is divided by m(-4). 14 Let s = 14 - -4. Let r(u) = -u*3 + 5u*2 + 6u + 7. What is the remainder when r(6) is divided by ((-13)/(-39))/(1/s)? 1 Let h(f) = f*2 - f - 126. Let l(p) = -4p*2 + 57p - 29. Let c be l(14). Calculate the remainder when h(c) is divided by 13. 10 Let g(w) = w*3 - 111w*2 - 111w - 5. Calculate the remainder when g(112) is divided by ((-18)/(-4))/((-2)/(-12)). 26 Let a = 354 + -367. What is the remainder when 61((1 - 0) + 0) is divided by -1 - (a - 0 - (6 - 2))? 13 Suppose l = -29 + 33. Calculate the remainder when 32 is divided by -3 + 4 + 8 + (-8)/l. 4 Calculate the remainder when 754 is divided by -8(1/((-24)/46))/((-16)/(-48)). 18 What is the remainder when 168/252(-549)/(-6) is divided by 26? 9 Suppose 12 = -3u, -14v + 2u = -16v + 194. Calculate the remainder when 278 is divided by v. 76 What is the remainder when 202 is divided by (22/(-6) + 1/(-3))(-2268 - -2249)? 50 Let i(o) be the third derivative of -o*4/3 - 7o*3/6 + 8o*2. Let b be i(-2). Suppose q - 5 - b = 0. Calculate the remainder when 96 is divided by q. 12 Suppose -56c = -16494 + 2158. Calculate the remainder when 70 is divided by ((-74)/3)/(10 + c/(-24)). 33 Let p(i) = 3i2 - 4i. Let w = -13944 + 14058. Calculate the remainder when w is divided by p(-3). 36 Suppose -2808 = 378x - 414x. Calculate the remainder when 482 is divided by x. 14 Let i(x) = -x*2 + 19x - 9. Suppose -4f = 3c - f - 78, 36 = c + 3f. Calculate the remainder when i(5) is divided by c. 19 Suppose -56h + 1346 + 950 = 0. What is the remainder when 625 is divided by h? 10 Let i = 33325 + -30617. What is the remainder when i is divided by 108? 8 Let j(w) = 6w3 + 6w*2 - 2w + 1. Let c(x) = x3 + x2 - x - 1. Let y(s) = 5c(s) - j(s). What is the remainder when 37 is divided by y(-3)? 16 Suppose 1065 = z + i + 2i, 5i - 2135 = -2z. Suppose 25a - 5a - z = 0. Calculate the remainder when a is divided by 4. 2 Suppose 10j - 120 = 5j - 5a, -a - 20 = -j. Suppose -67i + 54i = -1261. Let h = i - 55. What is the remainder when h is divided by j? 20 Suppose 0 = 8p - 22p + 56. Calculate the remainder when p/7 + (-4626)/(-63) + -6 is divided by 20. 8 Let o(p) = -3p*2 + 14p + 33. Suppose 0 = -100j + 91j + 54. Calculate the remainder when 41 is divided by o(j). 5 Let u be 22/10 - 52/(-65). Let b(p) = -10 - u + p*3 + 4p - 2p + 12 - 7p*2. What is the remainder when b(9) is divided by 13? 10 Let k = 190 - 187. Suppose 134 = 4l - 3x, 5x - 100 = -kl + 7x. Calculate the remainder when 189 is divided by l. 29 Suppose -36g + 679 = 413 - 922. What is the remainder when 3396 is divided by g? 30 Suppose 14r = -14r - r + 464. Suppose 6d - 8 - 16 = 0. What is the remainder when r is divided by d? 0 Suppose -a + 1048 = 287. Suppose -8u - 113 + a = 0. What is the remainder when u is divided by 9? 0 Let c(j) = 7j + 17. Suppose 0 = -9b - 3b + 624. Let z = -49 + b. Calculate the remainder when c(z) is divided by 9. 2 Suppose 0 = 4f - 3z - 272 - 5, 2z - 128 = -2f. What is the remainder when f is divided by 14? 11 Let v be (2 - -4)3/6. What is the remainder when -2v-251/9 is divided by 14? 12 Calculate the remainder when 19 + 198/(-18) - 72-1 is divided by 13. 2 Let y(z) = -7z + 7. Suppose 2h = -5a + 9a + 1038, -h + 546 = -5a. Calculate the remainder when h is divided by y(-7). 53 Suppose -37k + 2 = -35k. Suppose 2x + x = 96. Calculate the remainder when x is divided by (k-3)/(41/(-123)). 5 Let c = -3396 - -3412. Calculate the remainder when 4878 is divided by c. 14 Suppose 4m - 6m = -282. Calculate the remainder when m is divided by 348/8*(-146)/(-219). 25 Let b	{ "pile_set_name": "DM Mathematics" }
255x + 52814593 - 52814593 for x. 0 Solve 11232n - 11777n - 21800 = 0 for n. -40 Solve -408k - 1422k - 30996 = -108k for k. -18 Solve 706w - 71w + 56088 = -687w - 46w for w. -41 Solve -512w + 4237 = -115w + 18132 for w. -35 Solve 148187p = 155121p - 48538 for p. 7 Solve 6554m = 3202m - 281568 for m. -84 Solve 498y - 225y + 1149y = 29862 for y. 21 Solve -718g - 704g + 14734 = 683g - 1966g for g. 106 Solve 0 = 917a - 1074a - 5809 for a. -37 Solve 187v = -6v - 1544 for v. -8 Solve 25400 + 13499 + 11601 = 389w + 111w for w. 101 Solve -120k - 18774 = 4749k + 15309 for k. -7 Solve 1054a - 707a - 28801 = 0 for a. 83 Solve 36x + 934 + 1039 + 423 - 164 = 0 for x. -62 Solve -193b - 160 = -1704 for b. 8 Solve -946 - 7528 = -561j + 784j for j. -38 Solve -4293q = -5574q + 21777 for q. 17 Solve -393 = -3588j + 3457j for j. 3 Solve 366r - 1243r + 848r + 3248 = 0 for r. 112 Solve 730k + 195021 = -6493k for k. -27 Solve 106o = 504o - 11144 for o. 28 Solve -2002l - 501413 = -581493 for l. 40 Solve -560w - 481w = 676w - 413w - 32600 for w. 25 Solve -69052z = -68976z - 3572 for z. 47 Solve 1901k - 3582k - 3098k - 9558 = 0 for k. -2 Solve 24938 = -223o + 18025 for o. -31 Solve -81152 + 42256 - 291476 = 7182m for m. -46 Solve 340 - 917 + 334 = -81h for h. 3 Solve 0 = 4471j - 1589j - 2119j + 13776j - 901418 for j. 62 Solve 3140 = -5545i - 20219 + 60255 + 234809 for i. 49 Solve 209c + 358 = -330 - 984 for c. -8 Solve 156767 + 81602 = 5573y + 2608y + 66568 for y. 21 Solve 0 = 2748z - 1648z - 39600 for z. 36 Solve -54413 = 3438q + 344q + 17445 for q. -19 Solve 3842 + 1809 + 3013 = 132a + 20a for a. 57 Solve 1291o - 1191o + 1496 + 3004 = 0 for o. -45 Solve -2372l - 39371 + 40837 + 60206 = 0 for l. 26 Solve 1529i = -259i + 206i - 1214i + 78288 for i. 28 Solve -28u + 202 = 11u + 406 + 1083 for u. -33 Solve 347j - 2161 - 2243 = -30776 for j. -76 Solve 533t - 157t + 1433t + 60294 = 263t for t. -39 Solve -147s - 257s = -3188s - 722s - 315540 for s. -90 Solve -189210 = -11174l + 16580l for l. -35 Solve 15845 = 990c + 21785 for c. -6 Solve 597y - 99y = -238y - 478y for y. 0 Solve 0 = -53d + 83d + d + 148d for d. 0 Solve 0 = 16q + 86q + 415q - 43945 for q. 85 Solve 643623g - 4096 = 643495g for g. 32 Solve 0 = -94j + 114j - 493 - 338 + 11 for j. 41 Solve -233255 = -416t - 214535 for t. 45 Solve -2153r + 1183 - 753 - 401 - 10794 = 0 for r. -5 Solve -400253g + 442 - 142 = -400258g for g. -60 Solve 48g - 509g = 3046g + 294588 for g. -84 Solve 502g = 3164g - 34236 - 9749 - 3931 for g. 18 Solve -1308 = 848r + 446r + 701r - 43203 for r. 21 Solve -150z - 364 = 850 + 436 for z. -11 Solve -2413 + 1705 + 1639 = 19v for v. 49 Solve -4890 - 5975 = 345a - 860 for a. -29 Solve 11x + 2563 = 40x - 19x + 1323 for x. 124 Solve 1888404f = 1888333f + 6958 for f. 98 Solve 2479 + 6452 = -229s for s. -39 Solve 1546v - 572v + 899v + 1738v = -176939 for v. -49 Solve 489p = -147p - 1011p + 131760 for p. 80 Solve 1389t = -28920 - 48183 - 47907 for t. -90 Solve 1475u - 3264 = 1161 for u. 3 Solve 344r + 148526 = 148182 for r. -1 Solve -3967i - 5437i + 305508 = -4824 for i. 33 Solve 464l - 32470 = -7414 for l. 54 Solve 96p - 56p - 20 = 35p for p. 4 Solve -3185l - 41159 + 32932 = 45932 + 41391 for l. -30 Solve 209d + 26656 = -82d - 284d + 183d for d. -68 Solve 708s - 61827 = -939 for s. 86 Solve -52j - 37j = -47j - 1512 for j. 36 Solve 260p - 1925 - 55 = 5820 for p. 30 Solve 3495 - 7789 = 368i + 2519 + 7171 for i. -38 Solve 69m = -52m - 9m - 3510 for m. -27 Solve 356d - 975d - 156044 + 36650 = 587d for d. -99 Solve 1233o - 32831 = 15256 for o. 39 Solve -30g + 776 = -26g - 101g for g. -8 Solve 1161c - 8624 = 2445c - 1186c for c. -88 Solve 0 = -251z - 983 + 6505 for z. 22 Solve -1811v - 772v = 185976 for v. -72 Solve -960r + 12917 = -4010 + 607 for r. 17 Solve 691 + 209 = -67y + 92y for y. 36 Solve 151j + 1121j + 49708 = -190j for j. -34 Solve 22370t - 22316t = -1944 for t. -36 Solve -297g + 1161 = -196g + 7423 for g. -62 Solve 176o + 134o + 6o + 253o = -34140 for o. -60 Solve 93x + 237x = -230x + 27410 + 10670 for x. 68 Solve 736s - 10603 - 10741 = 0 for s. 29 Solve -1216s = 996s + 55300 for s. -25 Solve -495 - 13977 = 1540x + 147228 for x. -105 Solve 11x + 22414 + 6713 = -500x for x. -57 Solve 917c - 2707c - 4272c = 5483c + 531070 for c. -46 Solve -258p - 4721 + 4182 = -386p + 7653 for p. 64 Solve -724z = 31676 - 93216 for z. 85 Solve 3693o - 65164 - 72249 - 32561 = -780o for o. 38 Solve -2021b - 1012 + 5064 = 1160b - 8672 for b. 4 Solve 1610w - 24855 - 72941 = -31166 + 52510 for w. 74 Solve -3046h + 158729 = 19467h - 580824 + 199241 for h. 24 Solve 63 + 92 = 272a - 117 for a. 1 Solve 1305 - 224 = 77x - 3321 - 3375 for x. 101 Solve 7933l = 7789l + 443 - 11 for l. 3 Solve 1523p - 36 - 70022 = 0 for p. 46 Solve -4810w + 640 + 2538 + 2212 = 580 for w. 1 Solve -1673244z = -1673155z - 6675 for z. 75 Solve 111 = 34k - 713 - 117 - 725 for k. 49 Solve -329086p = -329442p + 9612 for p. 27 Solve 357h - 1085 = 388h for h. -35 Solve -87v - 1826 = 1147 - 1108 + 1354 for v. -37 Solve -663w - 245720 = 803w + 2631w + 217241 for w. -113 Solve 0 = 88d - 527 + 126 - 567 for d. 11 Solve -3725 + 3890 = 55j for j. 3 Solve -9z = 3 + 119 + 256 for z. -42 Solve 390f - 14785 - 27815 = -320f for f. 60 Solve 6185o - 19114 = 5493 + 160943 for o. 30 Solve -14977 - 7083 + 5139 = 4713j + 16070 for j. -7 Solve -7896 - 6062 = 424i + 3002 for i. -40 Solve -26848l + 205128 = -9754l for l. 12 Solve 7948v = 7095v - 31561 for v. -37 Solve 108641 = 2863v + 297599 for v. -66 Solve -12640y = -12540y + 11700 for y. -117 Solve -107j + 20756 = -1080j + 110272 for j. 92 Solve 0 = 6x - 140x - 557442 + 550876 for x. -49 Solve 333p = 288p - 1402p + 162064 for p. 112 Solve -601t - 3017 - 20114 = 10525 for t. -56 Solve -4016 + 1152 - 2674 = 78g for g. -71 Solve 294x - 461x - 189x = 883x - 45843 for x. 37 Solve 11738 = -1174u - 8798 + 5274 for u. -13 Solve 1514w - 2944w = -1486w - 3360 for w. -60 Solve 87n - 9757 = -10714 for n. -11 Solve 0 = 117a + 52a - 26a + 9438 for a. -66 Solve 90894 - 68901 = -2819x - 103838 - 85594 for x. -75 Solve 0 = 540p - 186p + 239p + 84p + 73793 for p. -109 Solve -12208 = 14t - 11354 for t. -61 Solve -90v + 24v + 1664 = 6482 for v. -73 Solve 261r - 188r - 2292 = 777r + 6860 for r. -13 Solve 120g - 2160 = 346g - 122g - 124g for g. 108 Solve 11n + 65 = -40 - 126 for n. -21 Solve -27d = -119d - 6d + 1372 for d. 14 Solve 602a - 288a - 918 = 297a for a. 54 Solve 130y + 227y = 35y + 19y - 6969 for y. -23 Solve 0 = 83n + 1809 - 2214 + 1982 for n. -19 Solve -182r + 24r + 2641 = -0r - 9051 for r. 74 Solve -211832a + 211869a - 183 = -812 for a. -17 Solve 2132n - 29751 - 43786 = 8724 + 20075 for n. 48 Solve 5453i + 628848 = 14187i for i. 72 Solve 10710986 - 10713265 = -53z for z. 43 Solve -106429 = 138w - 94423 for w. -87 Solve 56130 = 513u + 46383 for u. 19 Solve 0 = 822r + 14123 - 4259 for r. -12 Solve -4476 = -463v + 8057 + 3209 for v. 34 Solve 0 = -19i + 253313 - 253978 for i. -35 Solve 0 = 819656k - 819601k - 3417 + 392 for k. 55 Solve 4726m - 1767m - 175 = 236545 for m. 80 Solve 318v + 84132 = 289v - 1529v for v. -54 Solve -1260 = 306a + 583a + 178a + 1941 for a. -3 Solve 6795 = 446y - 322y - 275y for y. -45 Solve -7145469 = 73a - 7140067 for a. -74 Solve -12621w - 13416 = -13137w for w. 26 Solve 0 = -3402i + 134665 + 47201 + 29058 for i. 62 Solve 651w + 179w + 503w = 286w - 137157 for w. -131 Solve 24219 = -183h + 8847 for h. -84 Solve 695 = 839y + 19992 for y. -23 Solve -1180c = -3764c - 193800 for c. -75 Solve 1494000 = 41p + 1493016 for p. 24 Solve -1454y + 16412 = -81y - 64 for y. 12 Solve -994l - 923l = -691l + 296l + 13698 for l. -9 Solve -1721p - 635p - 2280 - 27139 = -93p for p. -13 Solve 0 = 815w - 24602 - 15333 for w. 49 Solve -263i = 687i + 328i - 824i + 32688 for i. -72 Solve -302a + 224 = -1088a - 53282 + 1630 for a. -66 Solve 384z + 6750 = -939z - 9126 for z. -12 Solve 636	{ "pile_set_name": "DM Mathematics" }
7k2 + 18k - 1 Expand (2m2 - 2m2 + m4)(-2 + 1 - 11)(-1 + 4 - 2)(0m + m + 0m + (-2 - 2 + 5)(80m - 175 + 175)). -972m*5 Expand (3a + 3a - a)(6 - 4 - 99). -485a Expand (21455 - 3p + 21398 - 43307)(2 - 4 - 3). 15p + 2270 Expand (0b3 + b3 + 6b*3)(-4089 - 527b + 10b + 4089). -3619b4 Expand v3 - 2v*3 + 0v*3 + (-114 - 46 - 6)(2v3 + 3v*3 - 3v*3) + 22v*3 - 58v*3 + 22v*3. -347v*3 Expand (5 - 4 + 1)(-4r3 + 4r3 + r4) + (6r3 + 5r*3 + 5r*3)(-3r + 10r + 14r). 338r*4 Expand (2v4 + v4 - 5v4)(1 - 1 - 3v) - 2v*5 + 3v*5 - 3v*5 + 2976 - 2978 - 2v*5 + 23v*2 + 3v*2. 2v*5 + 26v*2 - 2 Expand 3v + v + 0v + (0v + 4v - v)(9 - 20 + 17)(3 - 5 - 1). -50v Expand (-2b + 3b - 4b + (1 + 5 - 2)(-2b + 5b + 4b))(-2 - 3 + b*2 - 2b + 8). 25b3 - 50b*2 + 75b Expand 27m2 - 27m*2 - 23m5 + (m3 - m4 - m3)(-4m + m - m) + 13 - 13 - 19m5. -38m*5 Expand (-28 + 1 + 83)(h + 4h - 3h) + 88h + 585 - 585 + (3 + 0 - 2)(2h - 3h + 0h). 199h Expand (-444w + 7w - 290w2 + 292w*2)(-2 + 16 + 9)(-2w*2 + w - w). -92w*4 + 20102w*3 Expand 34d*2 - 2331d*5 - 4d*2 + 57d*2 + 2403d*5 + (6d*5 - 3d5 - d5)(3 + 3 - 4). 76d*5 + 87d*2 Expand (10 + 2y*2 - 10)(-1140 + 625 - 655 + 2y - 532). 4y*3 - 3404y*2 Expand (-5x - 4x + 3x)(3x + 3x - 2x) - 3x2 - 3x*2 - 5x*2 + 0x*2 + 3x*2 - 4x*2. -36x*2 Expand (19 + 14r*2 - 19)(5r3 - 4r*3 - 9r*3) + 1 + 2r*5 + 1 + 1 + 7r*5 - 15r*3 + 15r*3 + 2r*4. -103r*5 + 2r*4 + 3 Expand (160d*2 - 160d*2 + 35d*3)(3d + 3d + 5d)(-3 + 3 - 1). -385d4 Expand ((-x + 4x - x)(x + 0x - 3x) - 671x*2 - 767x*2 - 116x*2)(-3x - 3 + 7 - 2). 4674x*3 - 3116x*2 Expand -33a*2 + 13a - 13a - 26a*2 - 156a*2 + 47a*2 - 97a*2 + (2a - 2 + 2)(-2a + 0a + 0a). -269a2 Expand (-2 + 0 + 5)(774u + 177375 - 177375) + (-1 + u + 1)(-1 - 2 + 1) + 2 - 2u - 2 + u + 0u + u. 2320u Expand (126 - 667 - 161)(l - l + 2l3)(7l + 2l - 5l). -5616l*4 Expand (-3 + 2 + 2)(56h3 + 49h - 49h)(0 - 5 + 1 + (-2 + 1 + 6)(2 - 1 - 3)). -784h3 Expand (x3 + x*3 - 4x*3)(-2x + 2x + 3x2) - 1408x - 2x5 + 6x*5 + 1431x. -2x5 + 23x Expand (6f2 - 59f + 59f)(-45 - 154 + 39)(1 - 1 - 2)(3 - 4 + 0). -1920f2 Expand (268z - 742 + 1486 - 742)(-10z + 14z + z). 1340z*2 + 10z Expand (-67g3 + 25g*3 - 35g*3)((4 + 2 - 4)(-g + 2g + 0g) + 3 - 3 - g + 0g - 2g + 0g + 0 + 0 - 2g)(0 + 3 - 2). 231g4 Expand (553 - 1509 - 413)(a + 1 - 1)(-4a - 58 + 58). 5476a2 Expand ((-1 + 0 - 1)(-s2 - s2 - s2) + s2 + 1 + 1 + 2s - 3s)(183s + 45997 - 45997) - 4s + s3 + 4s + (s + 2s - s)(s - s + s*2). 1284s*3 - 183s*2 + 366s Expand (-4n + 9n - 10n)(40 + 288 + 209). -2685n Expand (-1390d + 21 + 1389d + 20)(4 - 4 + 3d2). -3d*3 + 123d*2 Expand 2o*3 - 4o*3 + 0o*3 + (-3o + 6o - o)(2o2 - 2o*2 + 2o2) + 1 - o3 - 1 + 19233o2 - 19233o*2 + 19o*3 + 8o*3 - 4o*3 + 17o*3. 41o*3 Expand 3 - 2m*3 - 3 + (-8m*2 + 4m*2 - 6m*2)(22m - 33m - 36m)(-5 + 17 + 1). 6108m3 Expand -2y - 22 + y2 + 22 + y3 + (-16y + 117 - 117)(0y2 - y2 - 6y*2). 113y3 + y2 - 2y Expand (25 - 7x - 8x - 29)(-596 - 59x + 596). 885x*2 + 236x Expand (2u2 - u2 - 2u*2)(-2u3 + 2u*3 + 2u*3) + (2 - 2 + u)(-5 + 4 + 4)(-4u + 12u4 - 6u*4 - 14u*4). -26u*5 - 12u*2 Expand (-1 + 5k + 0k - 34k)(-16k*3 + 6k - 6k). 464k*4 + 16k*3 Expand (7i - 2 + 1 + 2)(i - 5i + 3i + (-2 + 3 - 2)(i - 5 + 5) + 54i - 42i + 63i). 511i*2 + 73i Expand (4 - 5 + 3 + (-1 + 3 - 1)(1 + 0 + 0) - 1 - 1 + 3 + 4 - 1 - 5 + 1 + 2 + 4 + 2 - 7 + 0)(z + 2 + z - 4z)(z - z + 2z2). -16z*3 + 16z*2 Expand (k + 0k + 0k)(-2k + 4k + 0k) - 44k*2 + 102k*2 + 123k*2 + (0k2 + k2 + 2k2)(0 - 1 - 1). 177k2 Expand (-6s - 4s2 + 6s)(232s + 1 - 508s + 227s). 196s3 - 4s*2 Expand (0 + 0 - 3)(-2503v + 3017v + 6429v + 1650v). -25779v Expand (-215c + 191 - 191)(-2c - 2c - 4c) - c*2 + 2c*2 - 2c*2. 1719c2 Expand (a3 + 0a3 - 8a*3)(-5a + 3a + 0a) + (16a*2 - 12a*2 - 6a*2)(-1 + 1 - 2a2). 18a*4 Expand (-8w*2 + 6w*2 + 3w*2 + 13w*2 - 3)(5 - 4 + 5). 84w2 - 18 Expand (-3q*2 + 3q*2 - 3q*2)(2q2 - 3q*2 - 2q*2) + (5q*3 - 9q*3 - 5q*3 + (0q*3 + 2q3 - q3)(3 - 1 + 0))(0q + q - 5q). 37q4 Expand (-4h*3 + 2h*3 - 2h3 + (1 - 1 - h2)(5 + 2h - 5) - h*3 + 0h*3 - 5h*3)(2h + h + 0h). -36h4 Expand (-2u*2 - 5u*2 + 5u*2)(-u*2 + 3u*2 + 0u*2) + 245u*2 - 493u*2 + 245u*2 - 63u4 + (u2 + 0u2 + 0u*2)(-4u2 + u2 + 0u*2). -70u*4 - 3u*2 Expand (h - 3 + 3)(2 - 1 - 2) + h + 4h + h + 2h + 3h - 4h + (2 - 2 + h)(1 - 6 + 3) - 7h + 7h + 11h. 15h Expand (-20310r + 2 - 9895r - 2)(0r2 + 0r2 - r4). 30205r5 Expand (1 + 12 + 4)(-5 + 5 - x)(-11 - 12 - 8)(6x2 - 20 + 20). 3162x*3 Expand (-100i*2 - 759i*2 + 1501i*2)(0 + 6 - 3). 1926i2 Expand (-12l + 9l3 + 12l)(-3l*2 + 0l*2 + 2l*2) - 2l5 + l5 + 3l5 + (-2l*4 - 2 + 2)(2l + 4l - 4l) + 5l*5 + 19l5 - l5. 12l5 Expand -809b + 782b + 580b + (4 - 3 + 0)(b - 5b + 3b) - 1 + 1 - 2b - 2 + 2 - 4b. 546b Expand ((4 - 8 + 3)(4t - 3t + 0t) - t + 7t + 32t)(t2 + 0 + 0) + 400t - 2t3 + t3 - 400t. 36t3 Expand (-6q + 5 - 5)(-3 + 0 + 5 + (-3 + 6 - 1)(-3 - 2 + 6) + 0 + 0 + 1 - 1 + 3 + 0 + (0 - 6 + 4)(-26 - 30 + 77)(3 - 1 + 1)). 714q Expand (24 + 24 + 13)(3x - x - 4x) + (-17x + 12x + 20x)(-11 - 4 + 10). -197x Expand (-25 + 106 - 47)(5446 + 124m - 5446). 4216m Expand (6u2 - 2u2 - u2)(3 + 1 - 3) + 2u*2 - 1 - 7u - 1 + 5u + (-2 - 5 - 2)(2u2 - 4u*2 + 12 + 10). 23u*2 - 2u - 200 Expand (2v2 + v - v)(-974 - 967 + 1997 + (-2 + 0 - 1)(-5 + 2 + 0)). 130v*2 Expand (8 - 1 + 7)(y*2 - 2 + 2) + 3y*2 + 2y*2 - 7y*2 + (-1 - 2 - 1)(-2y2 + 5y2 - y2). 4y2 Expand (16 - 16 - 4i*2)(-4 - 4i + 4) + 589i*3 - 1070i*3 + 644i*3. 179i*3 Expand (3y*2 - 2y2 + y2)(384y + 382y + 378y - 20094 - 1143y). 2y*3 - 40188y*2 Expand (-2p - 11 - 3 + 3p + p2)((-p + 8p - 2p)(2p2 + p2 - p*2) + 11p*3 + 8p*3 - 2p*3). 27p*5 + 27p*4 - 378p*3 Expand -2593 + 2593 + 1132d - 3d + 2d - d - 1 + 1 - 2d + (0d + 3d - 5d)(-3 + 2 + 2) + 2d + 3 - 3. 1128d Expand (5u*3 + 3u*3 - 34u*3)(-10 - 62 + 21) + 3u3 - 2u*3 - 2u3 + 1 - 1 - u3 + (0u2 + 2u*2 - 3u*2)(0u + 2u + 0u) - u3 + 0u + 0u. 1321u*3 Expand (-38c*4 + 6c*4 - 51c*4 + (-5c + c + 2c)(c2 + c3 - c*2))(12c - 3c + 3c). -1020c*5 Expand (0 - 2 + 0 + 2 - 3 + 0 - 3 + 4 - 3 + 3 - 2 + 0 + (4 - 2 - 3)(2 - 5 + 1) + 0 + 2 - 1 + 3 - 5 + 1)(46 + 255 + 284)(1 - 4x - 1). 4680x Expand -p - 2p + p - 5p + p + 3p + (-3 + 0 + 4)(-3p - 2p + 3p) + 3 - p - 3 + 2p - p + 0p - 2 - 63p + 167p - 31p. 68p - 2 Expand (3a - 2a - 3a)(79 + 23 - 3)(5 - 4 - 4). 594a Expand 12l*3 + 15l*3 + 3l*2 - 31l*3 + (1314 - 1314 - 49l)(-6l2 + l2 + 2l2). 143l*3 + 3l*2 Expand (f + 3 - 3)(-4f4 - 2f*4 + 4f*4) + 4f*4 + 94850489f*5 - 4f*4 - 94927111f*5 + (-2f*2 + 3f2 + f2)(-2f3 + f3 + 3f3). -76620f*5 Expand (-3x - x + 3x)(1 - 4 + 2) + 3x + 3x - 2x + 2x - x + 0x + 11x + 9x + 196 - 199. 26x - 3 Expand 101v4 + 92v*4 - 192v*4 + (2v*3 - 3v*3 + 3v*3)(-v + 0v + 7v). 13v4 Expand (-2 + 0 + 1)(-1 + 4 - 4)(-26 - 20 + 45)(-57i + 3i - 41i + 22i). 73i Expand (5 + 1 - 4)(-10q + q - 4q) - 11q - 3q - 3q + q - 3 + 3 + (0 + 0 - 2)(-2q + q + 0q) - 3q + 10q - 5q. -38q Expand (-u3 - u3 + 0u3)(139 + 108 - 29)(10 + 0 - 1). -3924u*3 Expand (0 + 0 + u + 5 - 5 + 3u + (-u + 5u - 5u)(3 - 19 - 13) - 2 + 2 - 2u)(-u2 - 18u*3 - 51u + 51u). -558u*4 - 31u*3 Expand ((-2b + 3b + 0b)(0 + 1 + 1) - 157b - 586 + 586)(-31 - 5b + 31). 775b2 Expand ((0 - 1 - 1)(-q + 2q + 0q) - 4285*q	{ "pile_set_name": "DM Mathematics" }
-1/5, f, -0.3? -1/5 Let f = -162 + 162.4. Which is the closest to 14? (a) f (b) 2 (c) -1 b Let u = -0.15 - 3.85. Let w(o) = o*3 - 5o*2 - 4o - 2. Let x be w(6). Let s be ((-1)/x)/((-3)/(-12)). What is the closest to 2/7 in u, 1/3, s? 1/3 Let j = -330 + 331. What is the closest to 6 in 0.1, 3/5, -2, j? j Let c = -64 + 26. Let t = -42 - c. What is the closest to 1 in -1, t, -2/7? -2/7 Let j = -9.08 - -9. Let x = -0.52 + j. Let r = 4.4 - x. What is the closest to 1 in r, 4, 0? 0 Let x = -2621 - -2606.91. Let k = x - -14. Let a = k - 0.21. What is the closest to -0.1 in 2/19, a, -0.2? -0.2 Let f = 0.288 + -3.288. Which is the closest to 0.1? (a) f (b) -45 (c) 2 c Let i(s) = 2s2 - 50s - 607. Let m be i(-9). Let v = -0.01 + -0.05. Which is the nearest to v? (a) m (b) -0.2 (c) -5 b Let z = 0.58 + -0.88. Let d = 4.88 + 0.12. Which is the closest to 0? (a) 4 (b) z (c) d b Let g = 4/119 - -440/1071. Let a = 0.035 + -0.035. What is the nearest to a in g, 0.3, -5? 0.3 Let i = -944.94 + 945. What is the closest to i in -5/3, 4, 8? -5/3 Let y be (-6)/(-5)353/63. What is the nearest to y in -0.4, -3/2, -34? -0.4 Let t = 2.77 + -2.87. What is the closest to -1 in t, 0.4, 2/13? t Let p be 33/20 + 4/(-10). Let q = 16.6 - 16.8. What is the closest to q in 0.2, 2, p? 0.2 Let t = 4.27 + -2.27. Which is the nearest to -2/5? (a) t (b) 2/7 (c) 24/11 b Suppose 2v - 6v + 4 = 0, -4 = f - v. Let y be 9/(-36) + 9/4 + f. What is the nearest to 1 in 0.2, -2, y? 0.2 Let p = -2/609 + -4259/1218. Let u be (1 - 50/(-12)) + -2. Let s = u + p. What is the closest to s in 1, -2/13, 3? -2/13 Let r = -47393.9 - -47394. Let s = 0.41 + -0.01. What is the closest to s in -2, 1.9, r? r Let d = -270 - -141. Let z = -127 - d. Which is the nearest to -1/4? (a) 1 (b) z (c) 0 c Let j = 517 + -12923/25. Let i be (-2)/(-4) - (221/(-130) - -2). Which is the closest to 2/3? (a) i (b) -1/2 (c) j a Let x = 913 + -916. Which is the closest to x? (a) 0.5 (b) -0.5 (c) 47 b Let i be (2/(-4))/(14/(-4)). Let u = 3/8372 + 34/161. Let p = u + -6/13. Which is the nearest to p? (a) i (b) 0 (c) 1 b Let q = -2.35 - -0.45. Let a = 2 + q. Let d be ((-57)/(-30) + -1)(-5)/(-6). What is the closest to 2/5 in a, d, -2/11? a Let g be -5 - -12 - (-51)/(-7). What is the closest to 3/5 in g, 1/5, -2/5? 1/5 Let y be 10/55/6 - 1. What is the nearest to 1 in -1/3, 0, y? y Let m = -50/17 - -117/34. What is the closest to m in 0.4, 2, 5, -0.3? 0.4 Suppose 25h + 35 = 18h. Let t = 0 - 1. Which is the nearest to t? (a) h (b) 0.04 (c) -1 c Suppose -3m - 3h + 15 = 0, -2h - 5 = -5m - 3h. What is the closest to m in 7, 1, -2/7? -2/7 Let i be (735/(-150) - 3/(-30)) + 4. Let f = 9.14 - 9. What is the nearest to -1 in -0.4, f, i? i Let s = -0.034 - -54.034. Let k = 46 - s. Let t = -0.6 - -1.1. Which is the nearest to 0.1? (a) k (b) t (c) -4 b Let m be (-990)/(-792)(-18)/(-10). What is the nearest to m in -0.5, -2, -0.01? -0.01 Let p = -1/73 - 63/730. Suppose 4g = 5u + 211, 0u - 4u - 157 = -3g. Let x = 415/7 - g. What is the closest to -0.1 in 2, p, x? p Let s be (6/(-32))/(6/(-4)). Suppose -5z - 20 = -3h, h + 4h + z + 4 = 0. Which is the closest to h? (a) -2/3 (b) s (c) 0.3 b Let i = -8 + 5. Let q = 5.55 - 7.55. Let r = -0.2 - -0.4. Which is the nearest to 2/5? (a) q (b) i (c) r c Let j = 49/2 - 335/14. Which is the nearest to 3? (a) 0.06 (b) j (c) -0.5 b Let m(d) = -3d + 6. Let p(s) = s3 + 8s*2 - 9s + 4. Let n be p(-9). Let k be m(n). Which is the closest to 1/3? (a) 2 (b) 1 (c) k b Let d = -2.68 - -3.68. What is the nearest to d in 3/4, 0.3, 2, 3/5? 3/4 Let y = 7.2 - 7.31. Let u = 0.153 - -2.737. Let i = y - u. Which is the closest to 0? (a) -0.3 (b) i (c) 1/7 c Let l(a) = -2a2 - 9a + 40. Let j be l(3). What is the nearest to 0 in j, -3/4, -0.24, -4? -0.24 Suppose -2h = 5k, 3h + 4 - 17 = -k. Let o = -54 + 52. Let a be o/(4 + -2 - 8). What is the nearest to 0.1 in a, -2/3, k? a Let p = 25.8 - 9.8. What is the nearest to -0.1 in 3/8, 1, p? 3/8 Let p = 0.023 - 0.223. Let c be (-8)/12 + 12/9. What is the nearest to 1/4 in c, p, 2? c Let d be 1 + (-240)/(-39) + -7. Which is the nearest to -63? (a) d (b) -0.3 (c) 3/2 b Let z be 74/(-629) + (-4)/255. Which is the closest to -0.12? (a) 1/2 (b) -2/7 (c) z c Let w = -5677/16 - -355. Which is the closest to -1? (a) -5 (b) w (c) -2/5 c Let f = -2.8 - -2.77. Let v = 5 - 4. Let z = 39.4 + -39. What is the closest to v in -1/3, f, z? z Let g = 0.045 + 8.155. Let p = 8 - g. Let x = 5.99 + -1.99. What is the closest to x in p, 1, -1/4? 1 Let k = -24 + 7. What is the closest to k in 0, -4, 2/3, 4? -4 Let g be (24/20)/(2/5). Let v = 84.3 - 79. Let q = -1.3 + v. What is the closest to -2 in g, q, 5? g Let f = -20/99 - 13/99. Let b = 0 + 0. Let x = -1 - b. What is the closest to x in f, 1/10, -9? f Let i = 1417 + -1451. Which is the nearest to -1? (a) 7 (b) 0 (c) i b Let o = 1293 + -1293.3. What is the nearest to 0 in o, 1/7, 1, -1/5? 1/7 Let w be (2/6)/(11/33). What is the closest to -2/7 in 0.3, w, -0.4? -0.4 Let n = 87 - 29. Let i = n + -175/3. What is the closest to i in 2, 0, -7? 0 Let y = 33.9 + -30.1. What is the nearest to -0.2 in 3, y, -1/4, 5? -1/4 Let k be (2 - 10/6)/1. Let x be 2/3(-27)/18. Which is the closest to x? (a) k (b) 5 (c) 1 a Let y = -9.16 + 9.2. What is the nearest to 0.1 in 6, 1, y? y Let c = -59.8 - 3.2. Let r = c - -62.6. What is the closest to 0.4 in r, -5, -0.2? -0.2 Let p be (-23)/(-2)(-17)/(-391). Suppose 0 = -5o + 25 - 5. Let j = o - 0. What is the closest to p in j, -1/3, -5? -1/3 Let d = 22 + -5. Let q = d - 13. Which is the closest to 0.1? (a) -0.3 (b) 0 (c) q b Let a(c) = c*3 + 3c*2 + 1. Let x be a(-3). What is the closest to -3 in 0.05, -1.2, x? -1.2 Let n = -4 - -3.5. Let i = -0.013 + -0.407. Let m = 0.12 + i. What is the closest to 0 in n, 0.2, m? 0.2 Let l be -831/6. Let t = -16.08 - -16. Let n = 0.18 + t. What is the closest to n in 2/11, -2/7, l? 2/11 Suppose 3v = -2m + 4 - 2, 6 = 2m + 5v. Let j be (3 + 1)18/(-24). Suppose 2r + 0 = 4. Which is the closest to r? (a) m (b) j (c) 1 c Let j = -0.1 - -0.1. Let g = j - 0.2. Let r = -7168.5 + 7169. Which is the nearest to -3? (a) r (b) g (c) 4 b Let c(n) = -n2 - 8n - 4. Let v be c(-7). Let x = -1026 + 1028. What is the nearest to 2/5 in -1, v, x? -1 Suppose -2r + k - 9 = 0, -4r + 3k - 17 = 2k. Let n = -1 - r. Suppose 0 = -5l - p + 4, -4p - n = l. What is the closest to 2 in -5, l, 2/7? l Let h = -435 + 458. Which is the closest to 0? (a) 0 (b) 3 (c) 2/9 (d) h a Let j be (-1)/(21/(-9)-1). Let l = -78.4 + 78. What is the closest to j in 4, l, 2/9? l Let s = 5 + -2. Let v be -24/28 + (-60)/(-14). Let f be 1 + (3 - 13/v). Which is the closest to s? (a) f (b) 1/2 (c) -0.3 a Let y = -1 + 1.1. Let r = -1.9 + -0.1. Let j be 24/16 - (-14)/(-40)2. What is the nearest to -1 in j, r, y? r Let p be (-10)/6 + 1/(-3). Let g = -5 - -4.8. Suppose -7i = -3i - 4l, -3i + 5l = 0. Which is the nearest to p? (a) g (b) i (c) 2 a Let a = 663.6 - 664. What is the nearest to 0.1 in a, 0.4, -8, -2/3? 0.4 Let w be 31/(-93)(0 - 0/(-3)). Let m = 2.7 - 3. Let i = m + 0.2. Which is the nearest to w? (a) -3/4 (b) i (c) 2/3 b Suppose -5m + 7 = -23. Let u be (m/(-28))/(1/(-2)). Let r = 26.7 + -27. Which is the nearest to -0.1? (a) r (b) 4 (c) u a Suppose -32 = 3q + 4. Let i be (6/60)/((-2)/q). Suppose -2s - 39 = -41. What is the closest to s in -0.2, i, 1? 1 Let h = 479 - 10061/21. Let n be 4/(-15)20/(-24). Let q be -1(1 + 8/(-7)). What is the closest to n in h, 3, q? q Let r = 116 - 583/5. Let s be (-20 - -19)/(2/8). Which is the closest to -2? (a) s (b) 2/13 (c) r c Let l = 6 + -5.8. Let g = -1.029 + 0.029. Let m be (01/2)/2. What is the closest to g in l, m, -2/7? -2/7 Let k = -0.05 - -8.05. Let m = -77.97 + 75.97. What is the nearest to m in -2, k, 4/9? -2 Let n = 0.3 - 0.8. Let s = -1.6 + -0.4. Let k = 0.096 + 0.004. Which is the closest to k? (a) -0.1 (b) n (c) s a Let n = 0.103 - -42.897. Let s = n + -43.1. Which is the closest to -2/7? (a) 1/2 (b) s (c) -3 b Let x be 110/30 + 2/6. Suppose 0 = -xz + 6 + 10. Let f be 16/(-7) + (-2)/(-1). What is the closest to f in -	{ "pile_set_name": "DM Mathematics" }
3o. Let x(g) = -h(g) + 2p(g). Calculate x(w(b)). -11b2 Let d(c) = -14c*2 + 14. Let x(j) = 5j*2 - 5. Let u(r) = 6d(r) + 17x(r). Let n(z) = -z2. Determine n(u(g)). -g4 + 2g*2 - 1 Let l(t) be the second derivative of 0t*2 + 0 - 13t + 0t3 + 1/3t4. Let a(k) be the second derivative of k3/3 - k. What is l(a(i))? 16i2 Let d(i) = 5i - 4. Let u(c) = c + 1. Let o(v) = -d(v) - 4u(v). Let a(y) = 0y*2 - 4y*2 + 3y*2. Determine a(o(z)). -81z*2 Let k(f) = 5539224f. Let g(j) = 2j. Give g(k(u)). 11078448u Let z(s) = -3s2. Let q(p) = 5p - 5. Let r = -50 - -47. Let i(x) = -2x + 3. Let m(k) = rq(k) - 5i(k). What is z(m(b))? -75b*2 Let s(w) = 13w - 75 + 29 + 23 + 23. Let c(i) be the second derivative of i*4/12 - i. What is c(s(t))? 169t*2 Let q(x) be the second derivative of 11x4/12 - x2/2 - 9x + 1. Let a(f) = f2. Calculate q(a(v)). 11v*4 - 1 Let v(k) = -k. Let q(x) be the third derivative of 0x*3 + 0 + 0x - 4x2 + 1/3x*4. Calculate v(q(p)). -8p Let q(h) be the second derivative of h*4/6 - h. Let x(f) = -4 + 6 - 33f - 35f + 57f. Give x(q(w)). -22w2 + 2 Let l(c) = -46 + 65 - 19 + 3c. Let a(z) = -48z. What is l(a(r))? -144r Let x(u) = -21u2 + 137. Let j(k) = -4k. What is x(j(g))? -336g2 + 137 Let b(q) = -37q - 2. Let d(z) = -6806z - 369. Let y(i) = -369b(i) + 2d(i). Let p(r) = 16r. Determine y(p(w)). 656w Let h(f) = f2 - 222f. Let z(y) be the first derivative of y2/2 + 12. Determine h(z(d)). d2 - 222d Let v(q) = -q2 + 2q - 3q - 1 + 0q + q. Let b(t) = -2t2. Determine v(b(x)). -4x4 - 1 Let r(d) be the first derivative of d5/30 - 4d3/3 + 28. Let l(f) be the third derivative of r(f). Let v(t) = 12t*2. Give v(l(c)). 192c*2 Let s(y) = 3y*2. Let d(f) = -25f + 5. Let r be (-3)/220/6. Let a(v) = 13v - 3. Let l(b) = ra(b) - 3d(b). Determine l(s(x)). 30x2 Let g(k) = -14k + 1. Let y(w) = -794w. Calculate g(y(x)). 11116x + 1 Let b(t) be the first derivative of t*6/180 - 5t*3 - 6. Let f(s) be the third derivative of b(s). Let i(g) = 4g*2. Determine i(f(k)). 16k*4 Let r(q) = -4q + 1. Let b(i) = 1. Let a(f) = b(f) - r(f). Let j(l) = -3l - l + 3l. What is j(a(p))? -4p Let g(x) = -x2. Let q(h) be the third derivative of -2h*5/15 - 50h*2. Calculate g(q(n)). -64n*4 Let i(l) = 85l*2. Let k(b) = -1071b - 4. Give k(i(h)). -91035h2 - 4 Let f(w) be the third derivative of 121w*4/24 + 11w*2 - 7w. Let q(t) = 6t. What is f(q(o))? 726o Let n(w) = 6w - 10w + 4w - 2w*2. Let k(j) = 16j - 8. Let c(z) = 104z - 52. Let r(x) = -5c(x) + 32k(x). Calculate n(r(y)). -128y*2 + 128y - 32 Let m(v) = -v + 2. Let t(u) = 3u - 9. Let j(k) = 9m(k) + 2t(k). Let n(w) be the first derivative of -3w*2/2 - 44. Determine n(j(a)). 9a Let d(n) = -2n - 1331. Let v(u) = 2u*2. Determine d(v(g)). -4g*2 - 1331 Suppose l - 4t = 3l - 30, -5l - 4t + 51 = 0. Let k(z) = 3z - lz - z + 0z. Let s(i) = 5i2. Give s(k(x)). 125x2 Let t(z) = z2. Suppose 6g - 27 - 27 = 0. Let a(x) = -8x + gx - 86 + 86. Give t(a(h)). h2 Let x(d) be the first derivative of 189d*2/2 + 258. Let p(j) = -4j. Give x(p(r)). -756r Let h(p) = -p2. Let n(z) = -786z - 32. What is n(h(x))? 786x2 - 32 Let i(q) = -184q*2. Let a(v) = 19v. Determine a(i(f)). -3496f2 Let i(r) = 8r*2. Let h = -10 - -13. Let x(n) = -4n + 2n + hn + 0n. What is x(i(f))? 8f2 Let o(w) = w2. Let m(r) = 375r2 + 4r + 4. Let s(f) = 9372f2 + 99f + 99. Let i(g) = -99m(g) + 4s(g). Give o(i(z)). 131769z4 Let b(x) be the first derivative of 4x*3/3 + 561. Let k(y) = 38y. Give k(b(l)). 152l2 Let u(h) = 6h*2. Let o(b) = -2b. Let r(n) = 3n. Let d(f) = -6f. Let v(l) = 3d(l) + 7r(l). Let i(g) = -6o(g) - 5v(g). Calculate i(u(p)). -18p2 Let u(d) be the third derivative of 161d*4/12 - 29d2. Let r(v) = v2. Calculate r(u(o)). 103684o2 Let v(j) = 2j. Let h(n) = -n + 1. Let w(t) = 10t - 12. Let p(q) = -q2 - 4q. Let l = 27 - 33. Let d be p(l). Let a(g) = dh(g) - w(g). Give a(v(x)). 4x Let p(i) be the first derivative of -3i2/2 - 54. Let q(x) = -43x*2. What is q(p(j))? -387j*2 Suppose 7x = 38 - 3. Let r(u) = 10u + u - xu + 3u. Let m(s) = -4s*2 - 3s - 3. Let g(h) = -h*2 - h - 1. Let f(v) = -6g(v) + 2m(v). Determine r(f(z)). -18z*2 Suppose -4x - 2c + 1 = 9, 4c = 4x - 16. Let v(q) be the second derivative of 1/6q*4 + x - 5q + 0q2 + 0q*3. Let d(l) = 7l*2. What is d(v(g))? 28g*4 Let t(y) = -40y. Let p(s) = -8s2 - 9s*2 + 32 - 64 + 32. What is p(t(z))? -27200z*2 Let q(j) = 2j. Suppose 0 = 35i - 15 - 55. Let w(p) be the first derivative of 12 + 0p*i + 0p + 5/3p3. Give q(w(y)). 10y*2 Let s(t) = 5239t - 1. Let l(c) = -5c. What is l(s(q))? -26195q + 5 Let c(m) be the first derivative of -2m3/3 - 1. Let q(b) = 155b + 770. Let f(k) = -9k - 44. Let d(j) = 35f(j) + 2q(j). What is c(d(r))? -50r*2 Let k(q) = -2. Let a(d) = 22d - 12. Let i(m) = a(m) - 6k(m). Let l(j) = 0 + 2j*2 + 0. What is l(i(g))? 968g*2 Let l(g) = -4g*2. Let i(m) be the first derivative of -1/3m*3 + 0m - 1 + 0m2. What is l(i(n))? -4n*4 Let i(p) = -2936p. Let t(f) = 8f. What is t(i(o))? -23488o Let v(p) = 10p2. Let y = 38 - 20. Let q = 26 - y. Let o(f) = -2f + 8. Let u(x) = 1. Let t(m) = qu(m) - o(m). Determine t(v(b)). 20b*2 Let v(d) = d + 5. Let h(c) = -119c*2. Determine h(v(g)). -119g*2 - 1190g - 2975 Let x(i) = -1236i + 15. Let h(r) = -r + 7. What is x(h(n))? 1236n - 8637 Let t(g) = 14g + 1920. Let q(n) = n. Give q(t(y)). 14y + 1920 Let d(o) = -o - 597. Let q(z) = -2251 + 2251 + 2z. What is q(d(y))? -2y - 1194 Let z(v) = -2v2 - 9950174. Let o(g) = -2g. Give z(o(s)). -8s2 - 9950174 Let b(z) = 5z. Let j(s) = 6612s2. Give j(b(d)). 165300d*2 Let z(n) be the third derivative of 0n*3 + 0 - 3/10n*5 - 44n*2 + 0n + 0n4. Let v(w) = -2w*2. Give v(z(k)). -648k*4 Let l = 38 - 33. Let r(j) = 5j - 8j + lj. Let a(f) = -10f. Determine a(r(t)). -20t Let s(q) = -126q - 60q + 247q. Let p(u) be the first derivative of -u3/3 - 2. Calculate p(s(c)). -3721c*2 Let l(v) = -13v. Suppose 12 = 10n - 7n. Let f(a) = -4a2 + na*2 + 5a*2 - 3a*2. Determine f(l(h)). 338h*2 Let h(p) = 2p*2. Let s(k) = 248k + 1179k + 117k + 35k. What is s(h(z))? 3158z*2 Let l(n) = 901132n*2. Let c(i) = -2i*2. Calculate l(c(t)). 3604528t*4 Let k(p) = p + 15152. Let j(z) = -6z. Give j(k(c)). -6c - 90912 Suppose -5j = 3d - 2d - 17, -2d + 7 = j. Let x(n) = nd + 0n*2 + 0n*2. Let c(w) = 4w + 205 - 102 - 103. Determine c(x(m)). 4m2 Suppose 0 = -5y + 4r + 37 + 73, 85 = 5y + r. Let d(s) = 18s + ys + 9s - 49s. Let q(w) be the third derivative of -w5/30 + w2. Calculate q(d(c)). -32c2 Let h(s) = 18s*2. Let j(p) = 2p*2 - 8883p - 2. Calculate j(h(z)). 648z4 - 159894z*2 - 2 Let k(x) = 3x - 29. Let b(w) = 11w2 - 28w. What is b(k(r))? 99r2 - 1998r + 10063 Let q(r) = 14 - r + 19 - 33. Let t(z) be the second derivative of -5z3/3 + 12z. Determine q(t(k)). 10k Let a(h) = h3 - 6h*2 - 4h - 16. Let x be a(7). Let m(o) = -xo + 2o - 6o. Let u(k) = -3k. What is m(u(i))? 27i Let d(v) = -3v*2. Let u(p) = -5p - 4. Let k(a) be the third derivative of -a4/6 - a3/2 - 3a2. Let o(y) = 4k(y) - 3u(y). Calculate o(d(b)). 3b*2 Let n(g) = 8g + 17984. Let s(d) = 2d2. Give n(s(u)). 16u*2 + 17984 Let j(u) = 158u*2 - 237u - 237. Let r(c) = c*2 - c - 1. Let y(g) = 4j(g) - 948r(g). Let l(a) = -2a*2. Give y(l(z)). -1264z*4 Let d(k) = -3k*2. Suppose 12 = j + 2. Suppose -u - j = -19. Let c(o) = -1 + u - 8 - o. Calculate d(c(f)). -3f2 Let y(s) be the second derivative of -s3/3 + 2s2 + 625s. Let c(l) = l*2. Calculate c(y(q)). 4q*2 - 16q + 16 Let l(d) = d. Let z(t) be the first derivative of -2t5/15 - 7t*2 + 24. Let b(u) be the second derivative of z(u). What is b(l(q))? -8q*2 Let d(o) = 3o. Let f(a) = a. Let y(t) = -2d(t) + 3f(t). Let s(z) = -3z2 + 3. What is s(y(k))? -27k2 + 3 Let k(m) be the third derivative of -m6/360 - 13m3/6 + 14m**2. Let a(x) be the first derivative of k(x). Let f(	{ "pile_set_name": "DM Mathematics" }
is the nearest to j? (a) 1/10 (b) -3 (c) n a Let d = -289 - -291.96. Let n = -0.09 + 0.05. Let x = d - n. Which is the closest to 1? (a) 5 (b) -0.4 (c) x b Let z be 2/(-4) - (-2)/(-4). Let u be -1(1/3 + z). Let d be ((36/(-945))/((-81)/405))/(4/(-6)). Which is the nearest to d? (a) -1/5 (b) u (c) 0.2 a Let f(j) = -j3 - j2 - 5. Let l be f(0). Let i = -1.56373 - -1.26373. Which is the nearest to i? (a) -4 (b) l (c) -0.05 (d) -0.2 d Let x = -0.007 - -0.507. Which is the nearest to x? (a) -5 (b) -2/211 (c) -0.03 b Let r = 17 - 40. Let v = r + 22.6. Let t = -0.154 - 2.846. Which is the nearest to v? (a) 2 (b) -2/17 (c) t b Let h be (6/(-30) - 0)(-140)/7. Suppose -f - 16 = 15f. Which is the closest to f? (a) -0.5 (b) -2/7 (c) h (d) 0.3 a Let h = 10/489 - -1886/3423. What is the closest to -4 in 1/5, 0.1, -0.8, h? -0.8 Let r = 0.6 - 0.2. Let k = 0.75 - -205.25. Let o = k + -206. What is the closest to -0.1 in r, -4, o? o Let k = 6039 - 5776.7. Let j = k - 262. Which is the nearest to -3/8? (a) 0.4 (b) j (c) 1 b Let j = 1549.5 + -1167. Let f = j + -383. What is the nearest to -1 in f, 0.5, 1? f Suppose -x = 5n - 19, -2x + 21n - 18 = 17n. Let q = -527/6 - -88. Which is the closest to x? (a) 1/4 (b) 0.6 (c) q c Suppose -6g + o + 18 = -2g, 0 = -5g + 3o + 19. Let y be (-6)/44(-19)/((-228)/8). What is the nearest to -1 in -4, g, y? y Suppose 3g = 5h + 3, -14 = -125h + 123h + 5g. What is the nearest to -3 in -8/9, 5, h? h Let o be (-7)/12(-9)/21. Let u = -34 - -32.7. Which is the nearest to o? (a) -0.2 (b) 0 (c) u b Let r be 28/(-42)(-21)/2. Suppose -r - 5 = 6g. Let n = 6 + -5. What is the closest to -0.1 in n, -3, g? n Let b = -34992 + 34992. What is the nearest to -1/28 in b, 2/9, -0.1, -2? b Let h = -7 + 7. Let j = -45 + 95. Let l = j + -48. Which is the closest to -0.1? (a) h (b) 2/5 (c) l a Let n be (339/230)/(5 + (-63)/14). Let f = -54/23 + n. Which is the nearest to -0.09? (a) 0.1 (b) -0.11 (c) f b Let v(d) be the second derivative of 16d3/3 + 128d*2 + 170d. Let m be v(-8). Which is the closest to m? (a) -0.08 (b) 2 (c) -4 a Suppose 2f = -4g + 2, 7f + 3g = 8f + 29. Which is the closest to 0.4? (a) f (b) 4 (c) 3 c Let g = -1.1 + 1.4. Let y be (-1 - (0 - 4))/(9/(-2)). Which is the closest to y? (a) g (b) 0 (c) -2/23 c Let i = 22789 + -22792. Let w = -0.1 + 12.1. Which is the closest to i? (a) w (b) 0.2 (c) 3 (d) 2/17 d Let u = -0.03394 + -0.36606. What is the nearest to -2/3 in 4, 5, u, -1/61? u Let u = 5 - 2. Let j(n) = 13n*2 - 195n + 178. Let q be j(1). Which is the nearest to u? (a) -0.1 (b) q (c) 5 c Let g = 315 + -203. Let r = g + -111.8. Which is the closest to r? (a) 32 (b) 0.4 (c) 0.5 b Let i = 14 + -12.3. Let j = 65.7 - i. Let a = j - 59. What is the nearest to 1 in a, 4, -0.2? -0.2 Let i be (-49/18)/(-1 + -5). What is the closest to 4 in 4, i, 108, 2/7? 4 Let l be (3 + (-63)/15)(-3)/(-18). Which is the closest to l? (a) -6/7 (b) -2/5 (c) 2/3 b Let h = -11.71 + 12.01. Which is the closest to 0.1? (a) 1.6 (b) 2/9 (c) h (d) 0.1 d Let m = -1.038 - -0.858. Which is the nearest to -0.1? (a) 3 (b) m (c) -5/3 b Let u = 2.7 + 1.3. Suppose -2p + 16 = 5v - 5, -5p + 15 = 0. Suppose 0 = vn + 4a + 12, 6n - 6 = n + 2a. What is the closest to -0.1 in 0.4, n, u? n Let d(p) = -p2 - 6p + 1. Let w be d(-6). Let x = 0.0425 - -0.0695. Let j = -0.888 - x. What is the closest to 7/2 in 2/3, j, w? w Suppose 5t - 13 = -88. Let v = t - -11. Let p = 797.3 - 797. Which is the nearest to 0.1? (a) v (b) p (c) -6 b Let f = 30232 - 30230. What is the closest to f in 3/8, -0.4, 3? 3 Let q = 3 - -1. Let f(m) = 8m - 107 + 63 + 85. Let y be f(-5). What is the nearest to y in -3/4, q, 1? 1 Let a = 121 + -119. Suppose 0 = -d + a - 4. What is the nearest to d in 1, -7, 2? 1 Let t = 3534 - 3533.9. What is the closest to t in 3, -1/4, -2, -3? -1/4 Let w = -2.5332 + 2.5532. Which is the closest to 1? (a) 0.1 (b) w (c) -9 a Let s = -1.924 + 1.071. Let d = -0.753 - s. Let m = 0 + 1. Which is the nearest to m? (a) d (b) 3 (c) 2 a Let m = 418/3 + -141. Let k = -36409.4 + 36409. Let n = -226/3 - -2947/39. Which is the nearest to -2? (a) k (b) n (c) m c Let j(k) = k*2 - 13k + 27. Let q be j(11). Suppose -3x - 26 = -x. Let y be (-4)/((-160)/(-136)) + 3. Which is the closest to x? (a) q (b) y (c) -4 c Let s = -0.7446 + 1.1446. What is the nearest to -5/11 in -1, -1/3, s? -1/3 Let s be 16/(-60)510/68. Which is the closest to 0? (a) s (b) 0.1 (c) 2.4 (d) -4 b Let l be -24 - (-42 - -26) - (-300)/38. Let k = 0.3 + -0.2. Which is the nearest to 2? (a) -2 (b) k (c) l b Let q be 4/24 - (-92)/24. Let v = -45.046 + 0.046. Let j = v + 44. Which is the nearest to -0.1? (a) q (b) 2/5 (c) j b Let j = 230 - 229.244. Let p = j - -0.244. Let g = 1.5 + -1.3. Which is the nearest to p? (a) 3 (b) g (c) 5 b Let k = 37 + -39. Let o = 7.02 + -6.92. What is the nearest to -4/81 in k, 0.5, o? o Let r = 3610 + -3610. What is the closest to 0 in -130, r, -1/2? r Let j = -16 + 18. Let z be j/(5 + -13) - 0. What is the nearest to 7 in 5, z, -1.4? 5 Let r = -92 - 185. Let t = r + 272. Which is the nearest to t? (a) -4 (b) 0.3 (c) 0 a Suppose m + 81 = 2s - 114, -2s = 0. Let a be 3/(-15)2 + m/(-675). What is the closest to 0.5 in a, 0.5, 0.2, 1/6? 0.5 Let z = 160.75 + -160.87. Which is the nearest to -2? (a) z (b) -1 (c) 4/13 b Let h = -1/7 + 17/21. Let m = -28.761 + 28.461. What is the nearest to 10 in m, h, -4? h Let l = 194 - 192.18. Let o = 0.92 - l. What is the closest to -0.1 in -3, 2/13, o? 2/13 Let v = 0.17501 - 0.17501. Suppose -2x = -6 + 4. What is the closest to v in x, 2/11, 4? 2/11 Let p = -133692/5 - -26738. Which is the closest to -0.01? (a) p (b) -0.3 (c) -0.114 c Let x = -628 - 386. Let i = 1013 + x. Let g = 0 - 1. What is the nearest to i in 1/3, g, 0.2? g Let j = 141 - 250.6. Let o = j + 110. Which is the nearest to 2? (a) 3 (b) o (c) -0.04 a Let p be 250/(2/(-1) - (4 - 8)). Let l be (-4)/22 - p/825. What is the closest to l in -5/3, 0.5, 17/5? 0.5 Let l = -341831 - -3076481/9. Let p be (1/(-5))/((-1)/(-2)). What is the nearest to l in p, 16, 0.5? 0.5 Let n = -7012.5 - -7013. Which is the nearest to 0? (a) -3/5 (b) 1 (c) n c Let y = 166 + -272. Let b = y - -110. What is the closest to 0 in -2.6, 2/7, b? 2/7 Let f(s) = s*3 + 13s - 9. Let g be f(0). Let o be 24/9 - g/27. What is the closest to -0.1 in -5, o, -0.5? -0.5 Let i = 2420 + -2420. Which is the closest to 2/27? (a) -0.3 (b) 5/3 (c) i (d) -2 c Let s be ((-7)/7 + 2)/(-7 - 91/(-14)). Which is the nearest to s? (a) 2/7 (b) 41/3 (c) -1/9 (d) -5 c Suppose 0 = -3j + 47 - 167. Let y = j - -43. Suppose ym = 2m - 1. Which is the nearest to -1? (a) m (b) 0.1 (c) -6/7 a Let z = 75493 - 75505. Let n = 2.05 + -0.05. What is the nearest to n in 0.5, -4, z? 0.5 Suppose 7w - 994 + 896 = 0. What is the nearest to -1 in -3/4, w, 1/5? -3/4 Let i be (-1 + 4-1)-1. Let f = 771/1760 + 57/352. What is the closest to -2/7 in -2, f, i? f Let j be -12105/(-420)2/7. What is the closest to 2/3 in -2, -4/3, 0, j? j Let h = 29/4 - 17/3. Let d = 9/4 - h. What is the nearest to d in 0, 0.1, 71? 0.1 Let n(b) = -b*2 - 4b. Let m be n(-3). Let v = 827.3 + -827.5. What is the nearest to 0.1 in v, m, -3/7? v Let d be 28/(-30) + (-1)/(-3). Let j(p) = -p*2 + 544p - 10482. Let t be j(20). Which is the closest to t? (a) d (b) 3/4 (c) 0.04 a Let o = -70.46 - -71. Let n = 0.34 - o. Which is the closest to -2/3? (a) n (b) -1/2 (c) 0 b Let f = -204 + 195. Let w = -0.02 + -0.48. Which is the closest to -2? (a) f (b) -0.3 (c) w c Let r = 6890 - 6871. What is the nearest to 112 in r, -4/9, 4? r Let d = 32/31 - 97/124. Which is the nearest to 1? (a) d (b) 38 (c) -3 a Let h(z) = 2z2 + 16z - 4. Let x(v) = -4v + 33. Let o be x(10). Let p be h(o). Let n be 5 - (-3)/p26. What is the nearest to 0 in -5/2, 2/7, n? 2/7 Let o(d) = -18*d - 10. Let h = 365 - 365. Let z be o(h). Which is the nearest to 2? (a) -1 (b) z (c) 3 c Let y = -11286 - -11286. Which is the nearest to -1? (a) 2 (b) -3/7 (c) y (d) -0.04 b Let l = 472388.4 - 472385. Let d = -257 - -3343/13. What is the nearest to -2/7	{ "pile_set_name": "DM Mathematics" }
sing order. 474, 2, -4 Sort 1, -3, 7 in increasing order. -3, 1, 7 Sort -3, -2, -1, 42 in decreasing order. 42, -1, -2, -3 Sort -0.3, -28, 0.4. -28, -0.3, 0.4 Sort 0.4, 286, -0.5 in descending order. 286, 0.4, -0.5 Sort 2, -0.5, 5.41, -2. -2, -0.5, 2, 5.41 Sort -4, 42, 3. -4, 3, 42 Sort 0.2, -350, 5 in decreasing order. 5, 0.2, -350 Sort 4, -193, 1, -4 in decreasing order. 4, 1, -4, -193 Sort -4/7, -4, -5, 3/4. -5, -4, -4/7, 3/4 Put 1, 4, -7, -2 in decreasing order. 4, 1, -2, -7 Put -11, 0.4, -2/3, -1/2 in decreasing order. 0.4, -1/2, -2/3, -11 Put 4, 3, 36, -1 in increasing order. -1, 3, 4, 36 Put 4, -0.6, 0, 61 in increasing order. -0.6, 0, 4, 61 Put -2, 1, 7 in decreasing order. 7, 1, -2 Sort -4, 4, 7 in increasing order. -4, 4, 7 Sort -3, -1, 4, 296. -3, -1, 4, 296 Put -0.5, -4, 10 in decreasing order. 10, -0.5, -4 Put -2, -0.5, -2/13, -0.04 in ascending order. -2, -0.5, -2/13, -0.04 Sort 3, -1, -18, 4 in descending order. 4, 3, -1, -18 Put 0.3, -252, 1 in increasing order. -252, 0.3, 1 Sort -2, 38, -1 in ascending order. -2, -1, 38 Put -2/19, 30, 0.05 in decreasing order. 30, 0.05, -2/19 Sort 5, 0, 4, 3, -8. -8, 0, 3, 4, 5 Sort 5, 2/75, 4 in decreasing order. 5, 4, 2/75 Sort 0, -302, -4. -302, -4, 0 Put 72, -4, -11, -5, 1 in ascending order. -11, -5, -4, 1, 72 Sort -2/7, 1, 7 in decreasing order. 7, 1, -2/7 Sort -1, 7, 4, -8 in decreasing order. 7, 4, -1, -8 Sort 5, 6, 17, -1, -3 in decreasing order. 17, 6, 5, -1, -3 Sort -3, -1, 0, -2, -43 in increasing order. -43, -3, -2, -1, 0 Sort 9, -0.5, 0.3, 5. -0.5, 0.3, 5, 9 Sort -3, 57.53, 0.1 in decreasing order. 57.53, 0.1, -3 Sort -4, 4, 193. -4, 4, 193 Sort -0.05, -5, 6. -5, -0.05, 6 Sort 5, -3, 0, -15, 10 in decreasing order. 10, 5, 0, -3, -15 Sort -2, 3, -7. -7, -2, 3 Sort 2, 3584, -3 in decreasing order. 3584, 2, -3 Sort -4, -4/7, 1007. -4, -4/7, 1007 Sort 8, -2/3, 0.29 in descending order. 8, 0.29, -2/3 Sort 23/4, 4, -4, 1, 5. -4, 1, 4, 5, 23/4 Put 0, -1, 31, 5, -5 in decreasing order. 31, 5, 0, -1, -5 Put 0.5, 167, 2/5 in decreasing order. 167, 0.5, 2/5 Sort 6/11, 2/5, 2 in increasing order. 2/5, 6/11, 2 Put -3, -2798, -1 in ascending order. -2798, -3, -1 Put 64, 5, -2, -4 in ascending order. -4, -2, 5, 64 Put -5, 1, 59, 0, -4 in increasing order. -5, -4, 0, 1, 59 Sort -294, 0, 5, 3, 4. -294, 0, 3, 4, 5 Put -3, 2/7, 1/23 in decreasing order. 2/7, 1/23, -3 Sort -0.5, 2, -4/7, -1 in ascending order. -1, -4/7, -0.5, 2 Put 188, -5, 4 in decreasing order. 188, 4, -5 Sort 3.01, -6, 2 in descending order. 3.01, 2, -6 Put -0.5, 19, -3, 1 in decreasing order. 19, 1, -0.5, -3 Sort 361, -1/3, 1 in ascending order. -1/3, 1, 361 Put 4, -1, 0, -96 in ascending order. -96, -1, 0, 4 Put 3, 5, -1, -2, -817 in decreasing order. 5, 3, -1, -2, -817 Sort 8, -4, 4, 1, 70 in descending order. 70, 8, 4, 1, -4 Sort -3, 5, 1, 16 in decreasing order. 16, 5, 1, -3 Sort 0, -3, 791, 2. -3, 0, 2, 791 Sort 10, 117, 2 in ascending order. 2, 10, 117 Sort 2, 0, -3, -10. -10, -3, 0, 2 Sort 3, 2, 474. 2, 3, 474 Put -48, -4, -0.1 in descending order. -0.1, -4, -48 Put 0, -2/9, -2, 2/3, -4.3 in ascending order. -4.3, -2, -2/9, 0, 2/3 Sort 7, -2, 3, -5 in decreasing order. 7, 3, -2, -5 Put -8, 3, -1, -3, -5 in increasing order. -8, -5, -3, -1, 3 Sort -0.5, 1/18, 1, 5 in decreasing order. 5, 1, 1/18, -0.5 Sort 0, 3, 13. 0, 3, 13 Put 3/13, 4/3, 0.5, 11, 2/7 in descending order. 11, 4/3, 0.5, 2/7, 3/13 Sort 2, 187, 1, 4 in descending order. 187, 4, 2, 1 Sort 2, 30, 11, -5, 5 in decreasing order. 30, 11, 5, 2, -5 Sort 2, 6, -0.4, -0.2, 21 in descending order. 21, 6, 2, -0.2, -0.4 Sort -5, -1, 3. -5, -1, 3 Put -5, -10, 2, 4 in increasing order. -10, -5, 2, 4 Put 45, -3, -3/4 in decreasing order. 45, -3/4, -3 Put 5, -690, -5 in ascending order. -690, -5, 5 Sort -39, 1, -4/21 in descending order. 1, -4/21, -39 Sort -23/4, 1/2, -1/116 in descending order. 1/2, -1/116, -23/4 Sort -0.3, 2, 5/2, 0, 6. -0.3, 0, 2, 5/2, 6 Sort -221, -16, -3 in ascending order. -221, -16, -3 Sort 0, -5, -4, -9 in decreasing order. 0, -4, -5, -9 Sort -11, 109, 2 in descending order. 109, 2, -11 Sort 18, 7, -2 in increasing order. -2, 7, 18 Put 8, -2/39, 2, 2/15 in increasing order. -2/39, 2/15, 2, 8 Sort 14, 4, -4, 2 in increasing order. -4, 2, 4, 14 Sort -351, -16, 4, -3 in descending order. 4, -3, -16, -351 Sort 3, 3/4, -10.29, -2/5 in decreasing order. 3, 3/4, -2/5, -10.29 Sort 2, 5, 0. 0, 2, 5 Sort 1, -40, -4. -40, -4, 1 Put -4, 11, -4/5, -2/13 in ascending order. -4, -4/5, -2/13, 11 Put -1/3, 0.4, -2, 1.1 in ascending order. -2, -1/3, 0.4, 1.1 Put -1, 5, -4/7, -2/233, 0 in decreasing order. 5, 0, -2/233, -4/7, -1 Sort -5, -6, -2, -3. -6, -5, -3, -2 Sort 3, 51, -17 in descending order. 51, 3, -17 Sort 1, 319, 5 in increasing order. 1, 5, 319 Put 0.09, 0.4, 0.2, 0.03, 0 in ascending order. 0, 0.03, 0.09, 0.2, 0.4 Put -0.3, 1, -3 in descending order. 1, -0.3, -3 Sort -4, -2, 2, 0. -4, -2, 0, 2 Put 0, 1, -5, -102 in increasing order. -102, -5, 0, 1 Sort 2, -3, -1680 in increasing order. -1680, -3, 2 Put 28, 15, 5 in decreasing order. 28, 15, 5 Put 5, -4, 50, -3 in ascending order. -4, -3, 5, 50 Put 4, -3, 3, -6, 7 in descending order. 7, 4, 3, -3, -6 Put 4/7, -9, -2, 2, 2/33 in ascending order. -9, -2, 2/33, 4/7, 2 Put 2, 3, -3, 5 in ascending order. -3, 2, 3, 5 Sort 0, -9, -1 in descending order. 0, -1, -9 Sort -1, -114, -3 in descending order. -1, -3, -114 Put -2/105, -4, -2/13 in increasing order. -4, -2/13, -2/105 Sort -0.07, 0.4, 33, 1 in increasing order. -0.07, 0.4, 1, 33 Put 0.1, -1/7, -1/4, 4 in decreasing order. 4, 0.1, -1/7, -1/4 Put 5, -1, 45, 4, -2 in descending order. 45, 5, 4, -1, -2 Put 1/3, 321, -1/6 in decreasing order. 321, 1/3, -1/6 Put -5, -1/12, 2/7 in increasing order. -5, -1/12, 2/7 Sort 0.1, 15, -0.3, 7. -0.3, 0.1, 7, 15 Sort -7, 2/5, -0.03, -6, -0.5 in descending order. 2/5, -0.03, -0.5, -6, -7 Sort -0.2, -2, -1, 1/9 in ascending order. -2, -1, -0.2, 1/9 Put 8, 4, -6 in decreasing order. 8, 4, -6 Sort -14/11, 1/7, 4, 0, 5. -14/11, 0, 1/7, 4, 5 Put 1, -188, 0, -5, 2 in increasing order. -188, -5, 0, 1, 2 Sort 19, 4, -17. -17, 4, 19 Sort -397, -1/7, 1/4 in descending order. 1/4, -1/7, -397 Sort -0.05, -6/7, 3, 0.5, 5 in ascending order. -6/7, -0.05, 0.5, 3, 5 Sort 5, 2, -8 in decreasing order. 5, 2, -8 Sort -15, 27, -5, 0.3 in decreasing order. 27, 0.3, -5, -15 Put 1, 3, -134 in ascending order. -134, 1, 3 Sort 4, -5, -4, 0, 7 in descending order. 7, 4, 0, -4, -5 Sort 2, -1, -5 in increasing order. -5, -1, 2 Sort -1/6, 0.5, 0.08, -3 in descending order. 0.5, 0.08, -1/6, -3 Sort -1, -25, -2, 3 in increasing order. -25, -2, -1, 3 Sort -0.5, -4, -3, 1 in descending order. 1, -0.5, -3, -4 Sort 6, -4, -2/3, -17. -17, -4, -2/3, 6 Sort -5/2, 2, 250, -1 in ascending order. -5/2, -1, 2, 250 Put 47, 5, -2/9, -1/15, -1 in decreasing order. 47, 5, -1/15, -2/9, -1 Sort 1, -5, 9, 21 in decreasing order. 21, 9, 1, -5 Sort -0.06, -1, -0.3, 5, 13 in ascending order. -1, -0.3, -0.06, 5, 13 Sort -1/3, -0.2, 16, -1, -1/14. -1, -1/3, -0.2, -1/14, 16 Sort -0.3, 0, -2461, 4. -2461, -0.3, 0, 4 Put 1, 2/21, -11, 5 in decreasing order. 5, 1, 2/21, -11 Put 3/4, 4/5, 3/47, -0.5 in descending order. 4/5, 3/4, 3/47, -0.5 Sort 3, -41, 5, 1, 4 in decreasing order. 5, 4, 3, 1, -41 Sort -6/11, 231, -0.6, 1 in decreasing order. 231, 1, -6/11, -0.6 Put 0.5, 1, -0.2, 0.71 in decreasing order. 1, 0.71, 0.5, -0.2 Sort 0, -5, -7, -29, -3. -29, -7, -5, -3, 0 Sort -2, -149, 3 in increasing order. -149, -2, 3 Put -2/3, -0.15, 4 in decreasing order. 4, -0.15, -2/3 Put -2, 11, -1, 5/13 in ascending order. -2, -1, 5/13, 11 Sort -433, 2/5, 0. -433, 0, 2/5 Sort 0.159, -1/7, 0.2 in ascending order. -1/7, 0.159, 0.2 Put 6, -2, -66 in increasing order. -66, -2, 6 Sort 17, -156, -5 in ascending order. -156, -5, 17 Sort 0.03, -21, -1, 4 in decreasing order. 4, 0.03, -1, -21 Put 3, 1, -3, 0 in ascending order. -3, 0, 1, 3 Sort 0.21, -2, 1, 3/8 in descending order. 1, 3/8, 0.21, -2 Put 1, -5, 4, 3, 291 in decreasing order. 291, 4, 3, 1, -5 Put 7, 2, 3 in decreasing order. 7, 3, 2 Sort 2, 17/120, 1/5 in descending order. 2, 1/5, 17/120 Sort 0.3, 0, -385/4 in decreasing order. 0.3, 0, -385/4 Sort 2, -1, 130. -1, 2, 130 Sort 0, -2, 431 in increasing order. -2, 0, 431 Put 5, 216, 3 in	{ "pile_set_name": "DM Mathematics" }
- t = 834, -rj = -t - 727 - 661. List the prime factors of j. 277 What are the prime factors of (3/((-54)/(-30612)))/((-4)/(-12))? 2, 2551 Let y = 17623 - 3123. What are the prime factors of y? 2, 5, 29 Suppose 0 = -4k + 5x - 28, 0 = -5k + x - 14 - 21. Let c(u) = 8u2 + 20u - 4. List the prime factors of c(k). 2, 31 Suppose 2m - 6709 = -q - 329, -3m = 5q - 9570. List the prime factors of m. 2, 5, 11, 29 Suppose -319 = -3k - 5n - 92, -4k + 5n = -256. Let r be (200/(-15))/((-2)/k). Suppose r = 5w + 2h, 0 = w + h - 0h - 95. List the prime factors of w. 2, 3, 5 Let u = 27 - -194. Suppose 4g + p - u = 0, -2g + p + 121 = -2p. What are the prime factors of g? 2, 7 Let d = -1058 - -1881. Let t = d - 500. List the prime factors of t. 17, 19 Let k = 124 - -102. Let a = 228 + k. What are the prime factors of a? 2, 227 Suppose 5x + 16o = 21o + 248385, 4x + 3o = 198729. What are the prime factors of x? 2, 3, 5, 23 Let s be (30/(-18))/(15/(-9)). Let p(f) = s - 492f3 - 2 + 2f + 579f3 - f2. List the prime factors of p(1). 3, 29 Suppose -126467 - 71139 = -32y + 55706. What are the prime factors of y? 2, 1979 Suppose 46o = -48o + 728688. List the prime factors of o. 2, 3, 17, 19 Let z(w) = 132w - 424. What are the prime factors of z(55)? 2, 1709 Let t(y) = -8y + 171. Let i be t(22). Let d(z) = -209z - 204. List the prime factors of d(i). 29 Let a(d) = d2 + 7d - 8. Let n be a(-9). Let p(q) = q*2 - nq + 1 + q*3 + 0 - 7q + 5q. What are the prime factors of p(4)? 3, 11 Suppose 64 = 4c + 4p, 4c = 3c + 5p + 16. Let h be (-1)/((-68)/c + 4). Suppose hl + 765 = 13l. List the prime factors of l. 5, 17 Let q = -279 + 315. List the prime factors of ((-10)/(-4))/(15/q) - -759. 3, 5, 17 What are the prime factors of 56/(-126)(-9)/24 - (-23662)/12? 2, 17, 29 Let v be (-1504)/112 - (-9)/21. Let o(a) = -32a - 31. List the prime factors of o(v). 5, 7, 11 Suppose 0k + 7k = -189. Let t(r) = -20r - 35. What are the prime factors of t(k)? 5, 101 Let m(o) = o2 + 3o - 6. Let j be m(-4). Let g be (-8)/j + (110 - -9). Suppose -y = g - 317. List the prime factors of y. 2, 97 Let z = -110 + 112. Suppose zh + c - 655 = 3h, 3h + 1955 = -2c. Let m = -421 - h. List the prime factors of m. 2, 29 Suppose -148i + 160 = -156i. Let m(r) = -11r + 150. What are the prime factors of m(i)? 2, 5, 37 Suppose 507n + 14672 = 509n. Suppose -u = 3b - 4393, -14 - n = -5b + 4u. What are the prime factors of b? 2, 733 Suppose -6p - 17 = 25. What are the prime factors of (-215 + -1)((-42)/(-4))/p? 2, 3 Suppose 119793 = -36c + 761817. What are the prime factors of c? 2, 37, 241 Suppose 0 = -14i + 15337 + 81417. What are the prime factors of i? 6911 Suppose -5o + 4 = -2s, -14o + 13o + 4 = -2s. Let q(p) = -p3 + p + 691. List the prime factors of q(o). 691 List the prime factors of (4/5)/((-235)/(-12885050)). 2, 5483 What are the prime factors of 13/(143/22)257? 2, 257 Suppose 3s = 6s + 4p + 23, 5s = -5p - 35. Let t(w) = 23w*2 - 18w - 95. List the prime factors of t(s). 2, 3, 5, 19 Suppose -f + 154 = 5x, 5x + 7 - 27 = 0. What are the prime factors of f? 2, 67 Suppose 4y - 3w = -y - 184, 4w - 117 = 3y. Let b = 39 + y. Suppose -58 = 2s - bs - 4f, 126 = 4s - 2f. List the prime factors of s. 31 Suppose -4s - 18 = -18. Let j be -1 - 56 - (3 + s). Let l = -20 - j. What are the prime factors of l? 2, 5 Let n be 46/5 - 2/10. Let z(x) = -2x2 + 20x + 7. Let u be z(n). Suppose c = u + 20. List the prime factors of c. 3, 5 Let s = -40 + 76. Suppose -8u - 196 = -u. Let m = u + s. List the prime factors of m. 2 Suppose 2g - o = g + 13542, 2o = -5g + 67717. List the prime factors of g. 29, 467 Let y be 9(-6 - (-128)/24). List the prime factors of 164(-4 - y) + -2. 2, 163 Suppose 25 = 48x - 71. Suppose 5j = u - 6u + 35, u - 3j - 19 = 0. What are the prime factors of ((-156)/(-15))/(x/u)? 2, 13 Let m(d) = -1194d - 6. Let l be m(-7). Suppose -u + l = 8u. What are the prime factors of u? 2, 29 Suppose 5l = -2i + 9123, i - 5l + 696 = 5235. List the prime factors of i. 2, 3, 11, 23 Let d(g) = -g3 - 13g*2 - 43g - 6. Let j be d(-6). Suppose r + 5r - 240 = j. What are the prime factors of r? 2, 5 Suppose -11z = -7z - 88. Let s = z - 20. Suppose -w = sw - 90. What are the prime factors of w? 2, 3, 5 Let o be (-1 + 44/28)/(4/33838). Suppose 15s = o + 4931. List the prime factors of s. 3, 7, 31 What are the prime factors of (-18)/(-3 + 35055/11688)? 2, 3, 487 Suppose 2d + 4n + 2 + 12 = 0, -3n = -2d + 7. Let g be (-72)/(-6)d(-64)/6. Suppose 96 = 8f - g. What are the prime factors of f? 2, 7 Let p(s) = 49s3 - 6s*2 - 8s - 1. List the prime factors of p(4). 31, 97 Suppose 0 = 5w + 5, -2i - i + 20 = -5w. Suppose 11y - 8y = -h + 3656, -iy = -3h - 6084. What are the prime factors of y? 2, 3, 7, 29 What are the prime factors of (2791 - (13 - 33))51 - -4? 17, 827 Suppose 0 = 406r - 408r - 6, 4p + 4r = 29132. What are the prime factors of p? 2, 3643 Let s = 157 + 375. Suppose -78u + s = -71u. What are the prime factors of u? 2, 19 Suppose 0 = -641q + 731q - 865080. List the prime factors of q. 2, 3, 89 Suppose -2t = 3t. Let u(i) = 60i*2 - 390i - 5. Let k be u(7). Suppose a + 4a - k = t. List the prime factors of a. 41 Let g be (-2)/((-8)/602) + 12/(-8). Suppose -o + 23 = 3r, 0 = 2r + r - 4o + 2. Suppose 533 - g = rv. What are the prime factors of v? 2 Let q = 5454 + 1537. List the prime factors of q. 6991 Let v(d) = 8d*2 + 699d + 224. List the prime factors of v(-114). 2, 12253 Let h(y) = 13y + 62. Let l be h(-5). Let a be l/(5 + (-17)/4). List the prime factors of 14 - (a + 1 + 0)/(-1). 11 Suppose 8 = -3f + 5f. Suppose fq - 8567 = -3w, 0 = -3w + 2q - 7q + 8572. Suppose 16h - 5h = w. List the prime factors of h. 7, 37 Let n(h) = -7h3 + 4h*2 + 4h + 4. Let r be n(-4). Let z be (9 + -3)(2187/(-6))/9. Let m = r + z. List the prime factors of m. 257 Let k(p) = 3p*2 - 15p + 15. Let l be k(11). Suppose -s - 2 = 3x + 49, -5s - l = x. Let g = -23 - s. List the prime factors of g. 19 Let v(h) be the third derivative of -h5/30 + h4/6 + 1309h3/6 - 203h*2. What are the prime factors of v(0)? 7, 11, 17 Let k(y) = -50y - 226. What are the prime factors of k(-52)? 2, 1187 Let v(r) = -13r + 7. Let s be v(-6). Suppose -z + s = -n, -5z - 3n + 267 + 190 = 0. Let i = 149 - z. List the prime factors of i. 2, 3, 5 What are the prime factors of ((-8664)/76)/(13/(-80))? 2, 5, 19 List the prime factors of 41744/12 - (6 - (-64)/(-12)). 2, 37, 47 Let x be 51/18 - 6/(-36). Suppose -a = -4b - 8, -xa + 60 = -2b - b. Suppose ac - 20c = 932. List the prime factors of c. 233 Let p(d) = 22d*3 - 9d*2 - 2d + 6. Let w be p(3). Let v = 586 + w. What are the prime factors of v? 7, 157 Let k = -3382 - -15728. List the prime factors of k. 2, 6173 Suppose -67g + 246025 + 732718 = 83757. List the prime factors of g. 2, 6679 List the prime factors of ((-4690 - 2) + 8)/(3 + 40/(-12)). 2, 3, 1171 Let b(x) = 24x - 188. Let z be b(8). Suppose -5i = -i - 16. Suppose -4n + 2n + 96 = -zf, -in + 162 = -2f. What are the prime factors of n? 2, 19 Let m be 0 + 1/412. What are the prime factors of 718/4 + m - (-4)/8? 3, 61 Suppose -5x + 6f + 5006 = 7f, -3f + 3 = 0. Let b = x - 340. List the prime factors of b. 661 Let u be 22/(-26) + (-160)/1040. List the prime factors of u + 2 + (-528)/(-3) + -1. 2, 11 Let v(b) = -b3 + 15b*2 - 3b - 3. Let r be -2 - (-3 + -5)1. List the prime factors of v(r). 3, 101 Let n(t) = -516t - 340. What are the prime factors of n(-6)? 2, 13, 53 Suppose -22p - 11p + 159545 = -16p. What are the prime factors of p? 5, 1877 Let n(o) be the third derivative of 7o*4/24 + 43o*3/3 + 2o*2 + 78o. What are the prime factors of n(2)? 2, 5 Suppose -14x + 42668 + 81387 + 25255 = 0. What are the prime factors of x? 3, 5, 79 Suppose 4y + 7 = 3b + 21, b = -y + 7. Suppose -2o - 1162 = l - 5l, -yo + 318 = l. What are the prime factors of l? 293 Let a(t) = 35t2 - 5t + 15. Let o(u) = -u*2 - 1. Let z(x) = a(x) + 15o(x). Let h be z(-3). Suppose -4w + h = w. What are the prime factors of w? 3, 13 List the prime factors of (1 + -4888)455/	{ "pile_set_name": "DM Mathematics" }
Let w = 3999 - 3975. What is the remainder when 4463 is divided by w? 23 Let t(h) = -h3 - h2 + h - 20. Calculate the remainder when t(-4) is divided by 23. 1 Let z be 60/68 - (-24)/204. Calculate the remainder when 126/18 + z3 is divided by 3. 1 Let d(g) = g3 + 12g*2 + 23g - 10. Let b = 34 + -42. Let x be d(b). Suppose 4o + x = 6o. Calculate the remainder when o is divided by 8. 7 Let r be 7(-9 - -7)9/(-2). What is the remainder when 25 is divided by 24/252 + 435/r? 4 Let t(v) be the first derivative of 3v3 - v2/2 + 3v - 140. Calculate the remainder when 122 is divided by t(-2). 40 Calculate the remainder when 16876 is divided by -10(-2231)/(-115)(-1)/2. 95 Suppose 3p - 26 = -11, 159 = 4m + 3p. What is the remainder when 244 is divided by m? 28 Suppose -2c - 1816 = -6c + 4n, -896 = -2c - n. Let h(a) = -3a*3 - 2a*2 - 4a - 3. Calculate the remainder when h(-3) is divided by (-1)/(-3)7/(42/c). 22 Suppose -50v + 5010 = -5636 + 946. What is the remainder when v is divided by 7? 5 Let h(y) = y*3 - 7y*2 - 26y + 21. Let i(t) = 2t2 - 10t - 2. Let j be i(6). Calculate the remainder when 181 is divided by h(j). 59 Suppose -28w + 12 = -25w. Suppose 9o + a = 6o + 11, -2o + wa = 2. Calculate the remainder when 17 is divided by o. 2 Let r = 136 + -131. Suppose -ro = -28s + 30s - 11, 4o = -s + 7. What is the remainder when 2 is divided by o? 0 Suppose -474h = -486h + 21024. Calculate the remainder when h is divided by 15. 12 Let z = 2822 - 2699. Calculate the remainder when z is divided by 8. 3 Let h(d) = -d3 + d2 + 55. Suppose -2c - 3n = -43, -7c + 8n = 12n - 183. What is the remainder when h(0) is divided by c? 26 Let v(h) = 4h + 1. Suppose 0 = 7u - 12u + 55. Calculate the remainder when v(u) is divided by 24. 21 What is the remainder when (-8)/12(7 + -754)/1 is divided by 191? 116 Let v be 16/12 + 2/3. Suppose 0 = vl - 10l + 56. Suppose 23 = 2r - l. What is the remainder when 58 is divided by r? 13 Suppose 4m = 16, 0 = 2r + 2m - 14 - 62. What is the remainder when 3875 is divided by r? 33 Suppose -2v = k - 68, 3v = -10k + 7k + 219. Suppose 0 = 1695g - 1701g + 102. Calculate the remainder when k is divided by g. 10 Let c be ((-1)/2)/(22/(-8) + 3). Let m = 262 + -158. What is the remainder when m is divided by (-6 + 1 + c)(1 + -4)? 20 Let d = -4869 - -5053. What is the remainder when d is divided by 51? 31 Suppose -2b + 596 + 1754 = 4j, -4b = -3j + 1768. Calculate the remainder when j is divided by 11. 5 Let l(o) = 5o + 18. Suppose -5w - 3 = 4u - 31, -2w + u + 6 = 0. What is the remainder when l(w) is divided by (210/40)/((-2)/(-8))? 17 Suppose -60 = -0w - 15w. Let b(z) = z3 - z2 - 9z. Calculate the remainder when 150 is divided by b(w). 6 Suppose -4n - 11 = -495. Let o = 6159 + -6116. Calculate the remainder when n is divided by o. 35 Suppose -7p + 22 = -13. Suppose 5z + 236 = -j + 4j, -5j = pz - 340. What is the remainder when 157 is divided by j? 13 Let n be 1/4 + 235/20. Suppose -j + n = -1. Let x(y) = -y2 + 27y - 78. What is the remainder when x(19) is divided by j? 9 Let o = 3746 - 3633. Let v(z) = 8z2 - 4z - 3. What is the remainder when o is divided by v(-2)? 2 Let n = 24435 - 24374. Calculate the remainder when 8172 is divided by n. 59 Let c(h) = -h*2 + 34h + 395. What is the remainder when 1429 is divided by c(43)? 5 Let a(m) = -2m3 - 2. Let z be a(-2). Let r = z - -13. Suppose -5 = 3w - 35. What is the remainder when r is divided by w? 7 Let o(c) = c2 + c + 11. Let h(b) = -b3 - 7b2 - 5b + 6. Let g be h(-6). Let i(l) = l*2 + 4l + 21. Calculate the remainder when i(0) is divided by o(g). 10 Let z(i) be the first derivative of -i*4/4 - 11i*3/3 + 4i*2 + 27i + 25. Let p be z(-14). Let w = p + -345. What is the remainder when w is divided by 40? 38 What is the remainder when (276/10)/((-224)/280)-8 is divided by 267? 9 Suppose -3 = 2z + 6s - s, 4z + 3s + 13 = 0. What is the remainder when 289/4 - (7/z - -2) is divided by 15? 12 Suppose -28x + 7320 + 6512 = 0. Let c = x + -420. What is the remainder when 363 is divided by c? 67 Suppose -1480 = -r + 4w, 5r - 7490 = -10w + 15w. What is the remainder when r is divided by 499? 7 What is the remainder when 7/((-392)/(-7440)) - (-7)/49 is divided by 40? 13 Let p = 21275 + -21254. Calculate the remainder when 4283 is divided by p. 20 Suppose -6048 = 180a - 15048. What is the remainder when ((-2)/(-4) + -1)-292 is divided by a? 46 Suppose 2c - 123 = -3c - 4h, 5c + 3h - 126 = 0. Suppose 20 = -25x + cx. Calculate the remainder when 40 is divided by x. 0 Suppose -16p - h = -19p + 19646, 4h = -20. Calculate the remainder when p is divided by 91. 86 What is the remainder when (5 - 6 - -3)1166 - 3 is divided by 163? 3 Let u be (-6)/9(5 - (35 - -6)). What is the remainder when 30u-14/(-30) is divided by 28? 12 Suppose 3o + 3o - 18 = 0. Suppose 5j + ok - 55 = 0, -j = -0j - k - 11. What is the remainder when 35 is divided by j? 2 Let s = -535 + 535. Suppose -21u + 33u - 1188 = s. Let v(r) = -13r - 4. Calculate the remainder when u is divided by v(-3). 29 Suppose 98 = -3o - 82. Calculate the remainder when ((-20)/o)/(1/249) is divided by 17. 15 Let u(v) = -9v - 1. Let k be u(-1). Suppose -2q - 16 = -k. What is the remainder when 116 is divided by q(28/(-16) + (-3 - -1))? 11 Suppose 5i + 0i - 10 = 0, 0 = -4p + 4i + 552. Calculate the remainder when p is divided by ((-15)/(-120) + 3/(24/7))/(7/511). 67 Let k = -549 + 558. Let f = 0 + 0. Suppose fu - 3u = -3r - 69, 3u + r - 69 = 0. What is the remainder when u is divided by k? 5 Let a(d) = 3d2 - 11d + 2. Let u(v) = v*3 + 9v*2 - 10v + 21. Let z be u(-9). Let y = z + -106. Calculate the remainder when 41 is divided by a(y). 19 Let b = -3112 + 4398. What is the remainder when b is divided by 43? 39 Suppose -5h + 25 = 0, -8n + 10n = -2h + 246. Suppose -5k + 3u = -181 + 25, u = -4k + n. What is the remainder when 58 is divided by k? 28 Suppose d = 62 + 245. Suppose 3b - 33r = -35r + 299, 0 = 3b + 6r - 279. Calculate the remainder when d is divided by b. 101 Let z(r) = -49r + 10. Let a be z(-1). Suppose 8j - 293 - a = 0. What is the remainder when 126 is divided by j? 38 Suppose 28g - 404 = 1388. Suppose -g = -10y + 66. Let i = 423 - 296. What is the remainder when i is divided by y? 10 Let x(r) = -12r - 21. Let s be x(-4). Let y = 289 - s. What is the remainder when y is divided by 5? 2 Suppose 4z = -3r + 277, 0 = -5r - 16z + 18z + 401. Suppose 0 = 2o + 2, -5o + 3720 = 7b - 2b. What is the remainder when b is divided by r? 81 Suppose 0t + 3t - 2h - 295 = 0, -t - 4h = -75. Suppose t - 116 = -3p. What is the remainder when 41 is divided by p? 6 What is the remainder when 1(-3)/(-3) + 267 is divided by 17? 13 Calculate the remainder when 147 is divided by (-4)/(-2)-2650/(-20). 17 Suppose 7u = -11454 + 11748. Calculate the remainder when u is divided by -82/2-1. 2 Calculate the remainder when ((502/(-7))/((-14)/49))/1 is divided by 246. 5 Let k = 520 - 344. Let m be 1 + 22/(-16) - (-103734)/144. Suppose m = -31g + 43g. Calculate the remainder when k is divided by g. 56 Let g = 3787 - 3780. What is the remainder when 327 is divided by g? 5 Let f = 1 + 2. Suppose 3l - 212 = 4x, -384 = -2l - fl - x. Suppose -4t = -a + 43, 4t + 82 = -3a + 5a. Calculate the remainder when l is divided by a. 37 Suppose 27 - 63 = -9f. Suppose 0l - l - 17 = -m, 2l + 68 = fm. Calculate the remainder when 99 is divided by m. 14 Let f(s) = 12s + 278. Let b be f(42). Suppose 208d - 231d = -b. What is the remainder when 233 is divided by d? 29 Calculate the remainder when ((-11 + (-31)/(-3))84)/((-2)/11) is divided by 10. 8 Suppose 0m - 34 = -m - 3y, 0 = -5m - 2y + 209. Let u(k) = -3k - 40. Let p be u(-15). What is the remainder when (p - (-294)/(-9))/(1/(-3)) is divided by m? 40 Let x = 3 - -1. Suppose -3c + 387 = 3l, 0 = 2l + xc + c - 258. Suppose -4858d + 60050 = 1147d. What is the remainder when l is divided by d? 9 Let u = -77 - -138. Let l(i) = -2i2 + 9i + 26. Let b(y) = y*3 + 16y*2 - 34y + 41. Let h be b(-18). What is the remainder when u is d	{ "pile_set_name": "DM Mathematics" }
= 0 - n. Let v = 6 - 4. Solve q = -vs - s for s. -4 Let d(l) = 2l*2 - 5l - 5. Let a be d(5). Solve 2i - a = -3i for i. 4 Suppose -2o = -3w + 6, 2o - 3w - 22 = -7w. Let t = 2 - 3. Let q be (6 - (2 - t)) + o. Solve d - 3d = -q for d. 3 Suppose -3m - m + 12 = 0. Suppose 2t = -l + 5, -l + 2 = -5t - m. Solve -5 = -c - t for c. 5 Suppose 0d + 1 = -d + r, 3d - 3 = r. Solve do + 5 = -1 for o. -3 Suppose -7s + 21 = -7. Solve -3r + sr - 5 = 0 for r. 5 Let i(q) = q + 4. Let m be i(-7). Let w be 4 + m + (0 - -1). Solve -a + wa + 4 = 0 for a. -4 Let x = 35 + -35. Solve 5p + 7 + 13 = x for p. -4 Suppose 7 = c - 5. Solve o = -2o + c for o. 4 Let k = -9 + 10. Let o be k + (0 - (-2 - -1)). Suppose -25 = -4z + p, 0 = -3z - 2p + 2 + 3. Solve 1 = oh + z for h. -2 Let g = -8 - -3. Let b = g + 7. Solve -2f = bf + 20 for f. -5 Let u be 44/16 - (-6)/(-8). Suppose -4x + 2z - 2 - 4 = 0, 5x - 5 = 5z. Let k be 1/u - 10/x. Solve 1 = 2o - ko for o. -1 Let p = 96 - 92. Solve 0 = o - 0 + p for o. -4 Suppose -6z + 9 = -3z. Suppose -zk = 2k. Solve kl + 5l = 15 for l. 3 Suppose -5j = 3b - 2j - 42, -j = -5b + 82. Let n = 19 - b. Solve -4y - 1 = -ny for y. -1 Suppose -w - 9 = -o - 2o, 3w = o + 5. Solve -20 = n + wn for n. -5 Let c be 1 - 1 - (0 + 0). Let v(l) be the second derivative of l4/12 - 7l*3/6 + l. Let m be v(7). Solve mo + 4o + 20 = c for o. -5 Let u(p) = -p2 + 8p + 3. Let x be u(8). Suppose t = -xt - 100. Let w be 4/(12/(-9)) - t. Solve -4v - 2 + w = 0 for v. 5 Let w = 15 - 15. Let m be 1/(-1 - -2) + 1. Solve -m = -wz - 2z for z. 1 Let j(z) = z*2 - 5z + 6. Let l(i) = -i*3 - 12i*2 - 12i - 6. Let t be l(-11). Let s be j(t). Solve sg - 8 = 2g for g. 2 Let v(m) = m - 5. Let y be v(6). Suppose 0 = p - y - 0. Let r be 0/(p/(-1) - 0). Solve r = k - 2k for k. 0 Suppose 4q - 6 = p, 4p - 8p = -q + 9. Solve a - q = -6 for a. -5 Suppose 0 = 5i - i - 28. Let b = i + -2. Let r be 18/b + (-6)/(-15). Solve 4w + 0w + r = 0 for w. -1 Let p(o) = o3 - 2o*2 - 2o + 2. Suppose -4a + 25 = 9. Suppose 16 = 4r + a. Let u be p(r). Solve -3m - 2m + u = 0 for m. 1 Suppose -c - 1 = -2g, -6 = -4g + 2. Let o be 1 - (1 + 1 - c). Solve -2 = ox - 4 for x. 1 Let z = -2 - -2. Suppose zt + 5t = 0. Suppose 0 = -3q + 3, m = -tm - q + 5. Solve md - 8 = 8d for d. -2 Suppose 12 - 27 = -3v. Suppose 0 = -2c - 1 + v. Solve -c = -2y + y for y. 2 Suppose -3j - 11 = 2z, -2 = z + j + 1. Solve -3 = -za - 5 for a. -1 Let s(w) = -w3 + 5w*2 - 4w + 3. Let q be s(4). Suppose 2r = -0t + 3t - 3, 2t = qr + 2. Solve -2 + r = -2m for m. 1 Suppose 0 = d + 2d + 4f - 31, 5d - 41 = -4f. Solve -dq + 6 = 1 for q. 1 Suppose 24 = 4u + 8. Let i be (1 - 5) + (u - -2). Solve 0n = in - 10 for n. 5 Suppose 21 = 5f - x, f + 0f - 1 = -3x. Solve 6 = 7t - ft for t. 2 Let m be 0 - 1 - (5 - 13). Let v = -3 + m. Suppose -i - 15 = -vi. Solve 0 = iw - 9 - 16 for w. 5 Let g(f) = -2f + 38. Let k be g(17). Solve 1 = kc - 3 for c. 1 Suppose -4 = -4y + 8. Solve 7o = 4o - y for o. -1 Suppose -x = -4m + x + 6, 3x + 2 = -m. Let u = 3 - m. Suppose p + 17 + 3 = 5o, 0 = -uo - 3p - 9. Solve -ol = -17 + 2 for l. 5 Let o = -42 + 42. Solve 2a + 2a - 20 = o for a. 5 Suppose -4h = -12 - 4. Suppose -2i = -5w - 23, 0i - 2i - 22 = 4w. Let x be 1/((1/(-2))/i). Solve -xf + h = -4 for f. 4 Suppose 2q - 18 = 4r + 12, 30 = 3q - 3r. Let j be 04/16 + 2. Suppose 2n = -qv + 11, 3v + 2 = n + jv. Solve 0 = 2i - n - 5 for i. 4 Suppose 2k = -2k + 20. Suppose -kd + v - 1 + 5 = 0, 4d = 5v + 20. Solve -l + 2l = d for l. 0 Suppose 5z - 3 = 17. Solve zf - 14 = 6 for f. 5 Let l = 23 + -19. Suppose -lu + 3u + 2 = 3i, -i - u = -2. Solve i = -5a + 15 for a. 3 Let d(l) = l3 + 6l*2 + 6l + 5. Let h be d(-6). Let k = 51 + h. Suppose -20 = -x - 4x. Solve k = -0b - xb for b. -5 Suppose -3u + 2w - 428 = -0u, 2w - 140 = u. Let p = u - -201. Suppose -3b + 4i + p = 0, -18 = 2b - 4b - 4i. Solve -5k + 0k = b for k. -3 Let d = -39 - -41. Solve dy = -0y - 10 for y. -5 Let t(o) = o3 - o2 - 2o + 3. Let r be t(0). Suppose -10 = -ra + 5. Solve 0 = as + 2 - 12 for s. 2 Let a = 99 - 99. Solve 4j - 4 - 4 = a for j. 2 Let n = 4 + -6. Let m = 2 - n. Solve -mp = 8 - 20 for p. 3 Suppose 5y + 3m - 15 = -0y, -4y - 5m + 25 = 0. Solve -2l = -yl - 8 for l. 4 Let x(h) = 93h2 - 2h - 1. Let p be x(-1). Suppose 5t = -d + t - 37, 4d - 2t + p = 0. Let i = d - -40. Solve 0 = 5c - 0c + i for c. -3 Let g(b) = b3 - 9b*2 + 8b + 4. Let k(y) = y*3 - 5y*2 + 3y - 7. Let f = -5 + 10. Let t be k(f). Let j be g(t). Solve -j + 0 = z for z. -4 Let x(w) = 0w2 + w2 + 6w2 - w3 - 3w - 4w - 1. Let r be x(5). Suppose -3j + r = -16. Solve -j = -0s - 5s for s. 2 Suppose -4q + 5 = -11. Solve 0 = -qr + r + 9 for r. 3 Let x be 4/10 - 4/10. Let i be x - (-6)/3 - -1. Solve 9 = -ia - 6 for a. -5 Let q = -5 - -20. Solve -q = -4b + 5 for b. 5 Let a be -2 + (-8)/(-2) + 0. Suppose -18 = -x - ax. Let f = x + -4. Solve -f = -5p + 3 for p. 1 Let q(v) = -v3 + 26v*2 - 25v + 4. Let k be q(25). Suppose 6 = -i + 21. Solve 0 = ky + 1 + i for y. -4 Suppose -4o + 2u + 28 = -4, 5u = -4o + 4. Solve -ob = -b + 20 for b. -4 Let w(p) = -4p - 19. Let m be w(-6). Solve mj + 1 = -9 for j. -2 Suppose -5 = 2j - 5q, -5j + 5q = -39 + 14. Solve -t = 4t + j for t. -2 Suppose -4l = -4s - 1 - 7, 0 = s - 2l + 6. Suppose sb - 4 = -2h + 6, -3h = -5b - 15. Solve b = -2q - 3 - 1 for q. -2 Let k(v) = 9v - 11. Let l(o) = 2o - 2. Let j(i) = 2k(i) - 11l(i). Suppose 0 = 4u + 3g + 11, -7g - 5 = -2g. Let c be j(u). Solve -3t + ct = 0 for t. 0 Let z be (16/(-6))/(2/6). Let x be 13/3z. Let t be ((-16)/(-6))/(x/(-12)). Solve 0g + tg = 0 for g. 0 Let o = -17 + 22. Solve -ot = -t + 20 for t. -5 Suppose -b + 2d = -d + 4, -7 = -2b + d. Suppose bw = w. Suppose 4u = -wu. Solve u = -z + 4z + 15 for z. -5 Suppose 0 = 3j + 3n - 27, -4j - 2n + 41 = 3n. Suppose 0 = -2h + j - 0. Solve -6s + 4s = h for s. -1 Suppose 10z + 8 = 12z. Let j = 3 + -2. Solve zo - j = -5 for o. -1 Suppose 55 = 47l - 42l. Let o be 41 + 0/2. Solve -5y - l = o for y. -3 Let p = 57 + -52. Let x be (-3)/((-3)/(-4)-1). Suppose -4m + 12 = -h, 3h + xm + 4 - 32 = 0. Solve pu = hu for u. 0 Suppose 0 = 2d + 2, -2d - 7 = -h - 0d. Suppose hr - 3 = 17. Solve -rm + m + 6 = 0 for m. 2 Suppose 0 = -4g - 4 + 20. Suppose 2j = -j + 3p + 3, -4p = gj - 20. Suppose 0 = 4q - c - 51, 4c + 22 = -0q + 2q. Solve -2z - j = -q for z. 5 Suppose 4v + 0 = 4. Suppose 0 = -7x + 2x + 20. Solve -5k + xk = v for k. -1 Let g(u) = u - u - 7 + 2u. Let v = -8 + 13. Let t be g(v). Solve -3b = -t - 12 for b. 5 Suppose 0 = 9t - 3t - 120. Let c(j) = j2 + 3j - 4. Let w be c(-4). Solve -s - 4s + t = w for s. 4 Let q = 9 - 7. Suppose -o + j + 6 = 1, -qj = -3o + 10. Solve o = -2m + 5m + 12 for m. -4 Let n = 14 + -21. Let q = 22 + n. Solve -q = -t - 4t for t. 3 Let o be 4/(-5) - (-1932)/(-10). Let u be o/(-10) + 2/(-5). Solve 4 = 5x + u for x. -3 Let k(n) = -5n. Let a be k(-5). Let z(t) = 4t + 4. Let y be z(0). Solve -yo = -9o - a for o. -5 Suppose 3a - 16 + 4 = 0. Suppose 4q + j - 13 = 0, -j = -3q - 2j + 9. Solve -q = -0o - ao for o. 1 Let t(s) = s3 - 14s*2 - 16s + 15. Let w be t(15). Solve -2n + wn - 8 = 0 for n. -4 Let a(m) = -m*2 + 16m - 13. Let y be a(15). Suppose 2t = y + 8. Solve tf = 3f - 8 for f. -4 Suppose 0a - 5a + 20 = 0. Suppose 48 - a = 4z + 5c, 3z - 3c = 6. Solve zk - 2k = 20 for k. 5 Let z = -37 - -42. Solve 2 = -4m + zm for m. 2 Let t(g) = 2g + 19. Let x be t(-8). Suppose v - 10 = -0v. Let z = v + 6. Solve -h - z = xh for h. -4 Let d be (72/20)/((-24)/(-160)). Solve -d = -5h + 1 for h. 5 Let h = 15 - 11. Let c(a) = -a - 2. Let b(k) = -k2 - 9k + 5. Let o be b(-10). Let u be c(o). Solve -r + h = ur for r. 1 Let a(t) = -t - 3. Let m be a(-7). Suppose -4y + 0y + 16 = 0, -4y = md - 20. Solve d = -2f + 11 for f. 5 Let i = 9 - 5. Solve 0 = -ih - 0h - 4 for h. -1 Let v(z) = -z*2 - 10z - 12. Let p be v(-8). Suppose 2u + 3s = 6u - 23, 7 = u - s. Suppose -6 = ul - 22. Solve -l - p	{ "pile_set_name": "DM Mathematics" }
without replacement from kbkbabbukkubb. Give prob of picking 2 b, 1 u, and 1 k. 24/143 Two letters picked without replacement from {f: 5, x: 11}. Give prob of picking 1 f and 1 x. 11/24 Two letters picked without replacement from bjjxjjbbj. Give prob of picking 1 b and 1 x. 1/12 What is prob of picking 1 u and 1 h when two letters picked without replacement from {e: 1, u: 1, d: 1, t: 2, i: 1, h: 1}? 1/21 Calculate prob of picking 2 g and 1 p when three letters picked without replacement from ggggogmppggppgog. 9/35 Three letters picked without replacement from ysyvsyvgyeeysysvssag. Give prob of picking 3 s. 1/57 What is prob of picking 2 y when two letters picked without replacement from yyyyy? 1 Three letters picked without replacement from vvzdozooovodooz. What is prob of picking 1 z, 1 d, and 1 v? 18/455 What is prob of picking 1 t and 1 p when two letters picked without replacement from {p: 1, z: 1, t: 7}? 7/36 Calculate prob of picking 3 i and 1 z when four letters picked without replacement from {z: 1, u: 1, a: 2, o: 6, i: 3}. 1/715 Four letters picked without replacement from nnnnannnnnntntnntaa. Give prob of picking 2 a and 2 t. 3/1292 What is prob of picking 4 w when four letters picked without replacement from dwdd? 0 Calculate prob of picking 1 f and 1 v when two letters picked without replacement from bsrfv. 1/10 Calculate prob of picking 1 f and 1 m when two letters picked without replacement from {v: 1, f: 1, q: 1, l: 1, m: 1}. 1/10 Four letters picked without replacement from vvovvvvvo. Give prob of picking 3 v and 1 o. 5/9 Calculate prob of picking 2 z when two letters picked without replacement from zppzz. 3/10 Calculate prob of picking 1 w, 1 c, and 1 g when three letters picked without replacement from gcwgccggg. 5/28 Four letters picked without replacement from {s: 4, k: 4, x: 3}. Give prob of picking 1 x, 2 s, and 1 k. 12/55 Two letters picked without replacement from lccacchcjheccejl. What is prob of picking 1 a and 1 j? 1/60 Four letters picked without replacement from qqqffqqvqffffqqfqqfq. What is prob of picking 4 q? 22/323 Calculate prob of picking 1 a and 1 r when two letters picked without replacement from jsajjrjsjhhjshjhs. 1/136 Two letters picked without replacement from pfowpfwfwfffpgfp. Give prob of picking 1 f and 1 g. 7/120 What is prob of picking 3 u when three letters picked without replacement from {u: 3, v: 2, i: 5}? 1/120 Calculate prob of picking 2 j when two letters picked without replacement from jjjsssjsjj. 1/3 Two letters picked without replacement from {k: 2, o: 2}. Give prob of picking 1 k and 1 o. 2/3 Two letters picked without replacement from {e: 5, h: 1, l: 1, f: 2, q: 3}. What is prob of picking 1 f and 1 e? 5/33 Three letters picked without replacement from sssfhhnhnsssgnf. Give prob of picking 1 f, 1 s, and 1 n. 36/455 Two letters picked without replacement from {g: 4, e: 15}. What is prob of picking 2 g? 2/57 Calculate prob of picking 4 e when four letters picked without replacement from {e: 10}. 1 Three letters picked without replacement from kuspkks. What is prob of picking 1 k, 1 p, and 1 u? 3/35 Two letters picked without replacement from vhcxxwhcwcrhhcw. What is prob of picking 1 r and 1 h? 4/105 What is prob of picking 2 k, 1 h, and 1 r when four letters picked without replacement from ffhfkkfffhkhrffr? 9/910 What is prob of picking 1 p and 2 v when three letters picked without replacement from {p: 7, v: 6, l: 1}? 15/52 Calculate prob of picking 1 d and 1 x when two letters picked without replacement from vdocssxdcscoscsddos. 4/171 Calculate prob of picking 3 w and 1 k when four letters picked without replacement from orwwrrwkwrrorwwrwr. 7/612 Calculate prob of picking 2 u and 1 t when three letters picked without replacement from tqmbmctutttmutm. 6/455 What is prob of picking 3 h when three letters picked without replacement from {h: 4}? 1 Three letters picked without replacement from rurur. What is prob of picking 1 u and 2 r? 3/5 What is prob of picking 2 c when two letters picked without replacement from cchh? 1/6 Three letters picked without replacement from dgmwmdwnmmmmdwdnnd. Give prob of picking 1 g and 2 n. 1/272 What is prob of picking 1 m and 1 t when two letters picked without replacement from bbtbmtbtbtbbbtwtt? 7/136 Two letters picked without replacement from {i: 1, w: 2, q: 4}. Give prob of picking 1 i and 1 q. 4/21 Four letters picked without replacement from weweedde. Give prob of picking 2 e and 2 w. 3/35 Two letters picked without replacement from {c: 1, o: 4, a: 2, b: 4}. Give prob of picking 1 o and 1 a. 8/55 Three letters picked without replacement from {e: 2, c: 1, t: 1, u: 1, k: 4}. What is prob of picking 1 k, 1 u, and 1 e? 2/21 Four letters picked without replacement from iiiicc. Give prob of picking 3 i and 1 c. 8/15 Four letters picked without replacement from {l: 1, b: 2, p: 3, y: 1, k: 1, s: 3}. What is prob of picking 2 b, 1 y, and 1 l? 1/330 Calculate prob of picking 2 f when two letters picked without replacement from {f: 10, v: 2}. 15/22 Two letters picked without replacement from {u: 6, b: 7, s: 5, i: 1}. What is prob of picking 1 b and 1 s? 35/171 What is prob of picking 2 w and 2 p when four letters picked without replacement from {c: 3, g: 2, w: 2, p: 4, f: 8, a: 1}? 2/1615 Two letters picked without replacement from oooo. What is prob of picking 2 o? 1 Four letters picked without replacement from ccaccciayaao. Give prob of picking 1 a, 1 c, 1 o, and 1 i. 4/99 Calculate prob of picking 2 e when two letters picked without replacement from {b: 2, e: 1}. 0 Calculate prob of picking 3 i and 1 q when four letters picked without replacement from iqqiqqqqqqiiiiiqii. 21/85 Calculate prob of picking 2 r when two letters picked without replacement from {c: 2, r: 16}. 40/51 Three letters picked without replacement from {u: 2, f: 1, h: 1, w: 1}. What is prob of picking 1 f, 1 h, and 1 w? 1/10 Four letters picked without replacement from {o: 11, d: 6, u: 1}. Give prob of picking 1 u, 1 d, and 2 o. 11/102 Calculate prob of picking 3 e when three letters picked without replacement from {y: 1, c: 4, f: 7, e: 3, k: 3}. 1/816 Two letters picked without replacement from nqyzyqgnznqqvg. What is prob of picking 1 q and 1 z? 8/91 What is prob of picking 1 k and 3 u when four letters picked without replacement from {u: 3, k: 11}? 1/91 Three letters picked without replacement from {d: 2, j: 8, o: 2, c: 5, t: 2}. Give prob of picking 1 j and 2 o. 8/969 Calculate prob of picking 1 p and 2 y when three letters picked without replacement from pppyypyypypyy. 63/143 Four letters picked without replacement from hzczqcqpccqzpzqz. Give prob of picking 1 q, 1 p, 1 h, and 1 z. 2/91 Three letters picked without replacement from {r: 8, b: 5}. What is prob of picking 1 r and 2 b? 40/143 Two letters picked without replacement from vshhvhshhhhhvzvvhz. Give prob of picking 1 s and 1 h. 2/17 Three letters picked without replacement from {i: 5, u: 5}. What is prob of picking 3 u? 1/12 What is prob of picking 2 z when two letters picked without replacement from iziikiz? 1/21 Two letters picked without replacement from zthpzhtzhz. What is prob of picking 1 t and 1 h? 2/15 What is prob of picking 1 e and 3 j when four letters picked without replacement from eejejeeeje? 1/30 What is prob of picking 2 d, 1 w, and 1 p when four letters picked without replacement from {p: 1, w: 3, a: 1, u: 1, d: 4, n: 4}? 18/1001 Calculate prob of picking 4 d when four letters picked without replacement from {u: 2, w: 1, g: 1, d: 5}. 5/126 Three letters picked without replacement from {b: 1, f: 12}. Give prob of picking 3 f. 10/13 Two letters picked without replacement from vpnvppappavnppapvpp. Give prob of picking 2 p. 5/19 Three letters picked without replacement from mimuiummbluubiiueu. Give prob of picking 1 l and 2 u. 5/272 Two letters picked without replacement from ssssssslsssl. Give prob of picking 2 s. 15/22 What is prob of picking 1 n and 1 e when two letters picked without replacement from enx? 1/3 What is prob of picking 2 s when two letters picked without replacement from {s: 4, d: 5, n: 3}? 1/11 What is prob of picking 1 v and 1 d when two letters picked without replacement from {v: 5, d: 3, a	{ "pile_set_name": "DM Mathematics" }
/(-21) + 138/(-126))/(38/(-13338399)) a composite number? False Suppose -2l - 565262 = -14p + 10p, 4l = -20. Is p a prime number? False Let g(u) = 82u + 23. Let y(b) = -82b - 15. Let r(a) = 6g(a) + 5y(a). Is r(4) a composite number? True Suppose -2q = -46 + 14. Suppose q - 10 = 3l. Suppose -li + 318 = -2092. Is i a prime number? False Is (1865456/(-40))/((-11)/(275/10)) a composite number? True Suppose -85 = 6c - 23c. Suppose 2b = -cr + 9119, 5b + 21r = 24r + 22720. Is b a prime number? True Suppose 3j = 4r + 3, 0r - 3r = 2j - 2. Let u be (32/j)/(4/256). Let x = -1321 + u. Is x a prime number? True Let h = 446308 + -276741. Is h a prime number? True Let l = -223 + 352. Let j(d) = l + 79 + d + d3 - d2 + 163. Is j(0) a prime number? False Suppose -3t - 96 = 2v, 0 = 2t - 5t - 4v - 102. Let j = 34 + t. Suppose 4k = -4c + 552, 2k + c = jc + 251. Is k a prime number? False Let i(f) = f*3 - 28f*2 + 30f - 39. Let x be i(27). Suppose -xm + 45463 = -31m. Is m a composite number? False Suppose 0 = -4d + 5u + 4964371, u = 552d - 564d + 14893065. Is d a composite number? True Suppose 50h + 15134 = 54h - 474414. Is h prime? True Let g(v) = v*2 - 7v - 43. Let o be 2/(-7) + (-605)/(-35). Is g(o) a composite number? False Suppose k + 2z - 3 = 0, -5z = k + k - 5. Suppose km + 3h - 5944 = 4m, 0 = 5m + h - 29706. Is m a prime number? False Let u = -484 - -501. Let o(x) = -12x3 + 37 - 5x*2 - 7x*3 + 20x*3. Is o(u) a prime number? False Let y = -464 + 111. Let k = 353 - y. Is k composite? True Suppose 1 = -0p + p - 5w, -p = -4w - 2. Let s be 1(-3 + 2) + p + -3. Suppose -1106 = -2d + sr, 0 = -3d + 2r + 1956 - 293. Is d a prime number? True Let z(g) = -g + 13. Let d be z(13). Let i(r) be the second derivative of r5/20 - r3/6 + 1373r*2/2 - 18r. Is i(d) a prime number? True Let k(l) = 12931l - 362. Is k(3) a prime number? True Let l(v) = 50v*2 + 8v + 11. Let h(y) = 25y2 + 4y + 6. Let a(d) = -11h(d) + 6l(d). Let k be a(-5). Let n = k - 124. Is n prime? False Let d(p) = -3p - 81. Let f be d(-29). Is -2(f + 1772/(-8)) a composite number? False Let t = -14830 - -21869. Is t a composite number? False Suppose m + 21 = 2f + 6m, 4f = 4m. Let w(k) = 32k2 - 10 - 5k - f + 4 + 4. Is w(6) prime? True Let h be 4/(-3 - -2)274. Let j = -492 - h. Let z = j + -273. Is z a composite number? False Let j(b) = 355b*2 - 12b + 4. Let p(t) = 14t - 77. Let k be p(6). Is j(k) prime? False Suppose 4t - 34885 = 5k, 4k + 10t + 27872 = 6t. Let c = k - -13746. Is c composite? True Let x be 4 - 7(-5 + -2078). Let h = x - 8476. Is h a composite number? True Let a(y) = 4y - 151 - 18y - 10y + 2y. Is a(-47) a prime number? True Is (2 - 328924/(-10)) + 28/(-770)11 composite? True Let g be -474(5 + 14/(-6)). Let s = g - -2363. Is s prime? False Let v(m) = 2m*3 - 25m*2 + 15m - 24. Let j be v(12). Suppose -7871 + 2483 = -ju. Is u a composite number? False Suppose -24o + 21o = -z + 44695, -z = 5o - 44671. Is z prime? False Suppose -24 = -0z - 4z. Let k be (63/z)/(12/64). Is ((-111)/12)/((-2)/k) prime? False Suppose -880502 = -420n + 406n. Is n a composite number? True Let o be 1 + 1691784/30 + 3/15. Suppose 5r + 7949 - o = 0. Is r a prime number? True Let r(c) = -c2 - 4c + 7. Let h be r(-5). Let m be 68465/35 + (-3)/21. Suppose 6o - m = ho. Is o a composite number? True Let j(m) be the first derivative of 76m2 - 42m + 26. Let k be j(-5). Is 14/42 - k/6 prime? False Suppose 5q = -5s + 1015, 614 = -3s + 6s - 2q. Suppose 6y = 936 + s. Suppose -1382 = -12v + y. Is v a composite number? False Is 881793/72 - (-6)/(-48) a prime number? False Let u be 46((-334)/8 - 6/24). Let o(m) = 30m2 + m - 14. Let c be o(-11). Let i = u + c. Is i prime? False Suppose 64221 = 33x - 226278. Is x composite? False Suppose 4v - a - 408619 = 0, 0 = 11a - 6a - 5. Is v composite? True Let t(h) = -7h - 11719. Let r be t(0). Let c = 22746 + r. Is c composite? False Let q(t) = 109t - 11. Let v(h) = -218h + 21. Let n(m) = 13q(m) + 6v(m). Is n(7) a prime number? False Let v(h) = -11657h - 368. Is v(-5) a prime number? True Let b be ((-6)/(-30))/(2/7690). Suppose -d = -105 - b. Is 8/(32/(-12)) + d a composite number? True Suppose 7p - 1341895 = -4z, z - 30p + 27p = 335488. Is z a composite number? True Let m(u) = -95890u + 243. Is m(-4) a prime number? False Let l(j) = j*3 + 3j*2 + 5j. Let r be 66/(-30) - 3/(-15). Let n be l(r). Let v(p) = -63p + 3. Is v(n) a composite number? True Let o = -153953 + 242994. Is o a composite number? False Suppose 26w + 402 = 27w. Suppose -5a = -4k - 50, 4a - k + 4k - 9 = 0. Suppose w = 8g - ag. Is g composite? True Let z = 5644 + -8428. Let c be 210/40752/(-6)(-9)/(-6). Let p = c - z. Is p composite? True Is 224562/4 + ((-567)/42 - 84/(-6)) prime? False Let f(w) = 2 - 7w + 28w - 8w - 11w. Let d be f(1). Suppose 4p - dh = 1628, 3p = p + 5h + 808. Is p a prime number? True Let f(d) = 6d + 20. Let w be f(13). Let u(j) = 11 - 12j + 32j*2 - 1 + wj*2 + 3. Is u(6) a composite number? False Let u(s) = 10s*2 + 4s + 5. Let j(q) = 8q2 + 3q + 1. Let c(t) = -t - 6. Let v be c(-5). Let r be j(v). Is u(r) a prime number? True Let t(n) = 5n2 + 9n + 9. Let m(a) = a*2 + a + 1. Let s(k) = 2m(k) + t(k). Let l(h) = h*3 + 10h*2 - 10h + 2. Let b be l(-11). Is s(b) prime? True Suppose 268d - 260d - 507760 = 0. Suppose -14s = -36s + d. Is s prime? False Let h be (-9 + (0 - -8))/((-2)/(-8)). Is ((-6)/h)/(((-360)/275696)/(-15)) a prime number? True Let d(l) = -2l2 - 40l + 49. Let n be d(-21). Suppose 56925 - 13112 = ni. Is i prime? False Suppose -2t + 2p = -1067406, -2p = 5t - 8t + 1601117. Is t a prime number? True Let r = 628 + -449. Let v = 3768 + r. Is v composite? False Let y(c) = -116c3 + 3c*2 - 8c + 1. Let v be y(4). Let w be v/6 - (-9)/6. Let x = w - -2320. Is x a composite number? False Suppose 5b - 2y - 5232481 = 0, 28b - y + 6278967 = 34b. Is b a prime number? False Let b be 1/(-3) + 658/21. Suppose 31 - b = -5l. Suppose lt + 129 = y + 2t, -4y + t = -471. Is y composite? True Let v = 13655 + 1284. Is v composite? False Suppose -81647 = -f - 5k, 0 = f - k + 35935 - 117582. Is f a composite number? False Let b(s) = -s3 + 9s*2 + 11s - 22. Let r be b(10). Let q be (-6)/24 + (-99)/r. Suppose 6g + 1906 = qg. Is g composite? False Suppose 2 = -8w + 82. Let q = 7 + w. Let k(a) = a3 - 15a*2 + 40a + 15. Is k(q) a prime number? False Suppose 16 = -4r, -2h + 3r + 4368 = 8r. Suppose -13u + 13107 = -h. Is u composite? True Let b(a) = -37445a + 6569. Is b(-49) a prime number? False Let h(w) = -285w + 1598. Is h(-105) a composite number? True Let b(v) be the third derivative of v5/30 + 19v*4/24 + 4v*3 + 5v*2. Let t be b(16). Suppose 4u - t = -4j + 1704, j - u = 626. Is j prime? True Let x(a) = -4013a + 2285. Is x(-12) composite? False Is (0 + 3655504/20)(-30)/(-12) a prime number? False Let f(m) = -63m*3 + 5m*2 - 7m - 5. Let p(g) = 63g3 - 6g*2 + 7g + 6. Let c(y) = 6f(y) + 5p(y). Let j be c(-3). Suppose -6r = -j - 396. Is r prime? True Suppose -3p + 12 = 2l - 0l, 0 = -5p + 10. Let o be l + (-13 - (-5 - -3)). Is (-12)/o(-3764)/(-6) prime? True Let q = 4 - 1. Let u(l) = -l*2 - 28l + 489. Let i be u(-40). Suppose 0 = qa + i, 2p + 650 = 4p + 4a. Is p prime? True Suppose -2c + 2632 = -c - 5s, -2c = -3s - 5285. Let o = 7313 - c. Is o a prime number? False Let o be 3 + -8 + 1 - 2289. Let b = o + 3680. Suppose -b = -3a + 56. Is a prime? False Suppose -4n + 424u + 195100 = 420u, -4u + 97574 = 2n. Is n prime? True Suppose 483b - 481b = -5x + 960011, -2x = -b - 383990. Is x composite? False Let c be -446-15(35/10)/(-7). Suppose 0 = k - 4w + 1, -48 - 5 = 5k + 4w. Is c/(-10)(-6)/k a composite number? False Suppose -21u - 1069620 = -41u. Is u a composite number? True Suppose 17y = 14y + 57. Is 5 + y/((-95)/(-72630)) composite? True Suppose -26z + 20z = 53808. Let w = 5229 - z. Is w a composite number? False Let z(h) = -7h3 + 2h*2 - 4h + 2. Let o be z(2). Is (156 + 1)(-2 - o)/4 prime? False Suppose 4x - 2i - 9 = 221, 3x + 4*i =	{ "pile_set_name": "DM Mathematics" }
-1 - m) - -7? 7 Suppose -278 - 340 = -3m. List the prime factors of m/6 - 2/6. 2, 17 Let t = 36 - 15. What are the prime factors of t? 3, 7 Let c = -4 - -7. Suppose 0i = ci - 33. What are the prime factors of i? 11 List the prime factors of 4/(-22) - (-2656)/88. 2, 3, 5 Let w = -19 - -83. List the prime factors of w. 2 Suppose 6m = 2m + 48. Suppose 1 = c - 1. Suppose cj - m = -2j. What are the prime factors of j? 3 Let w(o) = -4o*3 + 2o*2 + 2o + 1. Let t(a) = a3 + a2 + 1. Let b be t(-2). Let f be -2b/(-12)2. List the prime factors of w(f). 5 Let h = -5 - 0. List the prime factors of h((-9)/15 - 1). 2 Let k = 13 - 6. Let l(t) = -t2 + 8t - 7. Let b be l(k). Suppose b = -2m - 1 + 7. What are the prime factors of m? 3 Suppose 60 = -4y + 8y. What are the prime factors of y? 3, 5 Let p = 1 - -5. Suppose n - pn = -50. What are the prime factors of n? 2, 5 Suppose -8d - 76 = -10d. List the prime factors of d. 2, 19 Let c(v) = v*3 + 3v*2 - 2v + 4. Let i be c(-3). Suppose -s = -i - 17. What are the prime factors of s? 3 Let w(a) = -a + 2. Let s be w(11). Let q = s + 11. List the prime factors of q. 2 Suppose -5t + 367 = -8. What are the prime factors of t? 3, 5 Let y(p) = p3 - 3p*2 + 2p - 2. Let v be y(3). Suppose -vk = -k + 9. List the prime factors of -4k/67. 2, 7 Let m(r) = r3 + r2 + 3r + 2. Let s be m(-2). Let b(c) = -c - 6. List the prime factors of b(s). 2 Suppose -5z - 305 = -5p, 5z - 151 = 4p - 7p. What are the prime factors of p? 3, 19 Let a(j) = -14j3. What are the prime factors of a(-1)? 2, 7 Let y(g) be the second derivative of -g3/3 - 3g2/2 + 2g. What are the prime factors of y(-6)? 3 Let t be 8/(1 - (-2)/2). Suppose 5o + t = 29. Let k = o - 2. List the prime factors of k. 3 Suppose -3r - 1 = -49. What are the prime factors of r? 2 Suppose -4k + 5 = -5b - 7, -3k + 9 = 2b. Let m(q) = q + 8. Let l be m(b). Let u(c) = c*2 - 8c + 11. List the prime factors of u(l). 11 Suppose -5v + 705 = 5l, -4v = -9v - 4l + 710. List the prime factors of v. 2, 73 Suppose -6a + a + 75 = 0. Suppose 2f - 3f = -a. Suppose -n + f = 6. What are the prime factors of n? 3 Let n(b) = -b*2 + 6b - 2. Let m = -9 - -15. Let o be n(m). Let k = 20 - o. What are the prime factors of k? 2, 11 Suppose -3o - 4i = -25, 1 = -5o + 5i - 4. What are the prime factors of o? 3 Suppose 0 = -5c + 2c + 9. List the prime factors of (c - -8 - 2) + 1. 2, 5 Suppose -4d + 5d - 2 = 0. Suppose 4 = di, 4i + 0i + 49 = 3r. What are the prime factors of r? 19 Let w = 1 - -3. Suppose -68 = -5n + c, -wn - 5c = -98 + 32. List the prime factors of -2(n/(-4) - 2). 11 Let h be (-6)/(-10)125. Suppose -c - 5 = 5g, -3g + 8g + h = c. Suppose cx = -4s + 62, s = -s - 4. List the prime factors of x. 2, 7 Let l(q) be the third derivative of q5/60 + q4/12 + q3/2 - 3q*2. List the prime factors of l(-3). 2, 3 Suppose -5j - 41 = 3p, 37 = -p - 0p + 3j. Let l = 1 + 0. List the prime factors of 1/(-2)pl. 11 Suppose 0c - 12 = -4c. Suppose -25 - 32 = -cl. List the prime factors of l. 19 Let n = -7 - -11. Let s be 75/n + 2/8. Suppose -w = w - y - s, 4w = y + 41. What are the prime factors of w? 11 Suppose 1217 = 12f + 233. What are the prime factors of f? 2, 41 Suppose -4i = -8 - 12. Let s(h) = -h3 + 5h*2 + 3h + 1. List the prime factors of s(i). 2 Let i = 324 + -231. List the prime factors of i. 3, 31 Let n = -39 - -12. Let r be (n - 0)/(9/(-6)). Suppose a - r = -3. What are the prime factors of a? 3, 5 Suppose 5s - 94 = 31. List the prime factors of s. 5 Let i(y) = y2 - 4y. Let v be i(5). Suppose vw = -2 + 52. Let o = -4 + w. List the prime factors of o. 2, 3 Let o(s) be the first derivative of s4/12 - s3 + 2s*2 - 2s + 3. Let u(l) be the first derivative of o(l). What are the prime factors of u(6)? 2 Let y(k) = -k*2 - 6k + 2. Let n be y(-7). List the prime factors of 41(-3 - n). 2 Suppose 0 = -3z + q - 16, -3q + 6q - 28 = 4z. Let s be (-6)/(-4)z/(-3). Suppose sb + 2n + 1 = 3, -b - 7 = 5n. What are the prime factors of b? 3 Suppose -4f - 5s = -0f - 129, 0 = -5f + 5s + 195. Let q = 74 - f. List the prime factors of q. 2, 19 Let t = -4 + 2. Let u = -6 - t. Let d(j) = j3 + 3j*2 - 6j - 4. List the prime factors of d(u). 2 Let x(j) = j*3 - 5j*2 + 13j - 19. What are the prime factors of x(7)? 2, 5, 17 Suppose 3x = 2s + 22, 5s - 3 + 28 = 0. Suppose f = n - 31, 8n - 154 = 3n + xf. What are the prime factors of n? 2, 3, 5 Let m(i) = i3 - i2. Let b be m(-1). What are the prime factors of (-7 - -5)11/b? 11 Let m(o) = -3o - 3. Let b be m(-2). Suppose -g - 165 = -5x - b, 5x = 2g + 159. List the prime factors of x. 3, 11 Let m(w) = -w2 - 2w + 39. Let d be -9 + 5 + 4/1. List the prime factors of m(d). 3, 13 What are the prime factors of (-11 + (14 - -16))4? 2, 29 Let q be (-6)/(-4)28/6. Let x = q - 10. Let u = 0 - x. List the prime factors of u. 3 Suppose -5u - 50 = -0u. What are the prime factors of u/4(-32)/20? 2 Let i be (7/14)/((-1)/(-34)). Let b = 37 - i. List the prime factors of b. 2, 5 Suppose 2n + 2n + 5x = 16, 4n - x = 16. Suppose g = 3d - 28, -5d + 0g + ng + 35 = 0. What are the prime factors of d? 11 Let x(n) be the third derivative of -n*5/60 - 5n4/24 - n3/3 + n2. Let g(z) = -z3 + 3z2 + 4z - 3. Let k be g(4). List the prime factors of x(k). 2 Let l(s) = 3s - 5. Let b(d) = 2d. Let a be b(2). List the prime factors of l(a). 7 Suppose 0 = 4q + 3a - a - 6, 4a + 8 = -3q. Suppose -qo + 241 = 49. Suppose -5u - 13 + o = 0. List the prime factors of u. 7 Suppose 4r + q = 0, 4r = -r - 3q - 7. Let k be (-6)/4r-10. List the prime factors of ((-24)/k)/((-1)/5). 2 Suppose -28 + 9 = -s. Let n = s - 27. Let w = n + 12. List the prime factors of w. 2 Let p = -33 + 20. Let a = 28 + p. What are the prime factors of a? 3, 5 Let o(k) = k + 8. Let u = -14 + 8. Let i be o(u). Suppose -2g = -3w + 16, 2g + 0 = -4w - i. What are the prime factors of w? 2 Suppose -v - 4v + 40 = 0. Let k = 48 - v. Suppose -k = 3w - 7w - 3q, 50 = 5w - q. List the prime factors of w. 2, 5 Suppose 6l - 1498 = -484. List the prime factors of l. 13 Let u be -5 + 1/((-3)/(-6)). Let l = -1 + 11. Let h = l + u. List the prime factors of h. 7 Let t = -2 + 2. Let r be (-1)/(2 + 23/(-11)). List the prime factors of (t + r)/(-2 - -3). 11 Let r(m) = 76m. Let j be r(3). Suppose j = 7g - g. What are the prime factors of g? 2, 19 Let r(l) = -7l + 3. Let a be r(-7). Let m = a + -22. List the prime factors of m. 2, 3, 5 Let o = 3 + -1. Suppose -2h - 4 = -4p, 6 = oh - h + 2p. Suppose -3j = -m - 17, 5m + 15 = 3j + hm. List the prime factors of j. 2, 3 Let f = 310 - 198. Suppose 3g = 5u + 8g - 160, 0 = 3u - 5g - f. Suppose -84 = -4l + 4p, 4l + 2p - 26 - u = 0. List the prime factors of l. 17 Suppose 0m + 8 = 2m. Suppose 6f - 2f - 4v = -m, -v = 0. Let h = 6 - f. List the prime factors of h. 7 Let j be 22/8 - (-15)/(-20). Suppose -2i - 5n + 40 = 0, ji + 5n = 3n + 28. Let k = i + 0. What are the prime factors of k? 2, 5 Let g = 1 + 1. Let x = -35 + 65. Suppose -gs + x = s. What are the prime factors of s? 2, 5 Suppose -98 + 463 = 5l. List the prime factors of l. 73 Let z(k) = k2 - 6k + 2. Let l be z(7). List the prime factors of 120/l - (-3)/(-9). 13 Suppose 0 = 3a + 2a - 15. Suppose 4d = -l - a, 5l + 2d - 57 = -0d. What are the prime factors of l? 13 Suppose -280g + 276g + 132 = 0. What are the prime factors of g? 3, 11 Suppose -3f - 3 = m + m, 15 = 2m - 3f. Suppose 4o = 4h + mo - 109, 124 = 4h - 4o. Let s = h + -14. What are the prime factors of s? 2, 3 Suppose 0 = -2f - 4n + 8, -n + 6n = 4f - 68. Suppose h + 3 = f. List the prime factors of h. 3 Suppose -5 + 23 = j. Suppose y + j = 2y. List the prime factors of y. 2, 3 Suppose -15n + 34 = -14n. What are the prime factors of n? 2, 17 Let g(n) = n + 4. Let y be g(0). Suppose -yd + 3d = -120. Suppose 5x + 15 - d = 0. What are the prime factors of x? 3, 7 Suppose -y + 3y = 6. Let w = y - 0. Suppose 0i = wi - 36. List the prime factors of i. 2, 3 Suppose 2a + n = 9, 4a - 6 = -0a + 2n. Suppose 2y = 5j - 43, 4j + a*y - 20 = y. Suppose -j = -5	{ "pile_set_name": "DM Mathematics" }
Is 341 composite? True Is 101081 composite? False Is 8914 prime? False Is 8329 a composite number? False Is 815333 prime? True Is 50069 composite? False Is 521617 prime? False Is 79 a composite number? False Is 231529 a prime number? True Is 4019 a prime number? True Is 143329 composite? False Is 46727 composite? False Is 151709 prime? False Is 109 a prime number? True Is 33339 prime? False Is 33401 prime? False Is 14813 a composite number? False Is 15727 composite? False Is 41077 a prime number? True Is 2897 a composite number? False Is 167711 a prime number? True Is 4547 prime? True Is 7523 composite? False Is 225033 a composite number? True Is 21531 a prime number? False Is 8323859 composite? False Is 4487 composite? True Is 2256781 a prime number? True Is 2379203 a prime number? True Is 366013 a prime number? True Is 38573 a prime number? False Is 99401 a composite number? False Is 1255 a prime number? False Is 7817 a prime number? True Is 35519 prime? False Is 9169 a prime number? False Is 30169 composite? False Is 493345 composite? True Is 565 composite? True Is 52669 a composite number? True Is 341839 a composite number? False Is 42787 prime? True Is 3557 a composite number? False Is 31307 prime? True Is 103793 composite? True Is 18101 prime? False Is 8119 a composite number? True Is 12071 prime? True Is 170219 prime? False Is 6343 composite? False Is 855059 a composite number? False Is 22613 composite? False Is 9953 a prime number? False Is 14857 a prime number? False Is 411469 prime? True Is 14441 prime? False Is 13613 prime? True Is 27139 a composite number? True Is 16921 composite? False Is 55963 a prime number? False Is 32117 prime? True Is 409 a composite number? False Is 16603 composite? False Is 8413 composite? True Is 40981 a prime number? False Is 733963 composite? False Is 68863 composite? False Is 3042437 prime? True Is 64466 a prime number? False Is 1151807 composite? False Is 37819 prime? False Is 77131 a composite number? True Is 236066 a prime number? False Is 299 prime? False Is 474713 a composite number? True Is 5273 composite? False Is 14621 prime? True Is 262 composite? True Is 14047 a prime number? False Is 535303 prime? True Is 170707 a prime number? True Is 3225653 a composite number? False Is 7499 a composite number? False Is 673391 a composite number? False Is 10279 a prime number? False Is 339187 a composite number? False Is 955462 a composite number? True Is 485131 composite? False Is 146273 a prime number? True Is 10847 a composite number? False Is 326473 a prime number? False Is 50411 a composite number? False Is 229351 a prime number? True Is 56687 composite? False Is 21431 a prime number? False Is 6180373 prime? False Is 89627 a prime number? True Is 785857 a prime number? True Is 328357 composite? False Is 907 a prime number? True Is 115633 composite? True Is 463181 a composite number? False Is 44753 composite? False Is 11677 composite? False Is 3643 a composite number? False Is 916259 composite? False Is 2262583 composite? True Is 196759 prime? False Is 2153 a prime number? True Is 24517 a composite number? False Is 9809 composite? True Is 726941 a prime number? True Is 4391 composite? False Is 121829 a prime number? False Is 11731 composite? False Is 21403 prime? False Is 499615 composite? True Is 133979 prime? True Is 209759 prime? False Is 29837 a composite number? False Is 130213 composite? True Is 32105 composite? True Is 7499 a composite number? False Is 44351 prime? True Is 151549 composite? False Is 2503 a composite number? False Is 2947 composite? True Is 39499 composite? False Is 117601 a composite number? True Is 52907 prime? False Is 184561 a composite number? True Is 45529 a composite number? True Is 3659 prime? True Is 2461223 composite? False Is 357377 prime? True Is 2213 a prime number? True Is 866773 a prime number? False Is 24611 a prime number? True Is 304597 a composite number? False Is 82373 a prime number? True Is 145583 a prime number? False Is 235 composite? True Is 43523 prime? False Is 54907 composite? False Is 7393 composite? False Is 78635 a composite number? True Is 73237 a composite number? False Is 27581 composite? False Is 983 composite? False Is 2018 composite? True Is 98309 prime? False Is 8923 a composite number? False Is 55439 prime? True Is 3821 a prime number? True Is 418045 a composite number? True Is 4981 a composite number? True Is 97397 composite? False Is 4561 prime? True Is 16519 a prime number? True Is 46171 a composite number? False Is 3613 a composite number? False Is 2357 a prime number? True Is 7393 prime? True Is 388261 a composite number? True Is 31 composite? False Is 94379 prime? True Is 1841657 prime? True Is 16691 composite? False Is 13327 prime? True Is 20653 a prime number? False Is 521329 a composite number? False Is 2041 composite? True Is 33107 composite? False Is 11183 a composite number? True Is 541 prime? True Is 16753 composite? True Is 457 a prime number? True Is 14311 prime? False Is 1181911 composite? False Is 36901 prime? True Is 33661 a prime number? False Is 7661 a prime number? False Is 108359 prime? True Is 15013 a prime number? True Is 142867 prime? True Is 7745 composite? True Is 64937 composite? False Is 7241 a composite number? True Is 257053 composite? False Is 1117 a composite number? False Is 13637 prime? False Is 2355857 a composite number? True Is 8543 a prime number? True Is 7297 prime? True Is 767203 a composite number? False Is 68767 prime? True Is 122677 a composite number? True Is 4151 prime? False Is 49499 a prime number? True Is 112687 a composite number? False Is 308677 prime? False Is 1252717 a composite number? False Is 96233 composite? False Is 33703 a prime number? True Is 88463 prime? True Is 77005 prime? False Is 76649 a prime number? True Is 192707 prime? False Is 3191 composite? False Is 125551 composite? False Is 2431393 prime? True Is 74813 a composite number? True Is 2012905 a composite number? True Is 21583 composite? True Is 787 prime? True Is 114329 a composite number? False Is 208733 a composite number? True Is 59821 a prime number? False Is 46793 composite? True Is 128077 composite? True Is 285029 a composite number? True Is 975133 prime? True Is 23761 prime? True Is 53569 a composite number? False Is 1286617 prime? True Is 189179 prime? False Is 2177405 prime? False Is 80863 prime? True Is 51847 prime? False Is 62695 composite? True Is 487 a prime number? True Is 296071 prime? True Is 79301 a prime number? True Is 171161 a prime number? True Is 102643 a prime number? True Is 78367 composite? False Is 144103 composite? False Is 191683 a prime number? False Is 15229 a prime number? False Is 134611 composite? True Is 197551 prime? True Is 29243 prime? True Is 286367 a prime number? True Is 9977 prime? False Is 12071 composite? False Is 73498 a composite number? True Is 191417 composite? True Is 1308247 a composite number? False Is 229891 prime? False Is 10729 prime? True Is 8461 a composite number? False Is 4241 composite? False Is 39941 a composite number? True Is 86447 a prime number? False Is 103471 a composite number? False Is 1949 a composite number? False Is 29461 a prime number? False Is 18119 a prime number? True Is 29503 composite? True Is 53953 composite? True Is 6999 a composite number? True Is 13121 a composite number? False Is 65339 a composite number? True Is 7555 composite? True Is 63967 composite? True Is 2117 a composite number? True Is 520909 composite? True Is 29597 prime? False Is 1285 a prime number? False Is 19373 a prime number? True Is 23957 prime? True Is 26889 composite? True Is 260441 a prime number? True Is 2927 a composite number? False Is 46957 prime? True Is 27509 a composite number? False Is 1088807 composite? False Is 32937 prime? False Is 759089 prime? True Is 100313 composite? False Is 29269 prime? True Is 521 prime? True Is 266233 a composite number? True Is 68559 prime? False Is 75731 a prime number? True Is 3506 prime? False Is 45827 a prime number? True Is 1061959 prime? True Is 373447 composite? False Is 4127 prime? True Is 337 a composite number? False Is 1511 a composite number? False Is 676649 a prime number? True Is 156977 composite? True Is 207121 prime	{ "pile_set_name": "DM Mathematics" }
ment from {f: 5, u: 2}? 10/21 Two letters picked without replacement from {s: 3, z: 4, a: 2, c: 2, u: 1}. What is prob of picking 1 u and 1 a? 1/33 What is prob of picking 1 l and 1 h when two letters picked without replacement from {l: 16, h: 2}? 32/153 Three letters picked without replacement from {u: 1, a: 2, g: 1, r: 2}. Give prob of picking 1 a and 2 r. 1/10 What is prob of picking 1 l and 1 n when two letters picked without replacement from {l: 1, t: 7, n: 1}? 1/36 Calculate prob of picking 4 k when four letters picked without replacement from kkjjkjkjjgkkkggk. 1/26 Three letters picked without replacement from {a: 10}. Give prob of picking 3 a. 1 Two letters picked without replacement from {s: 2, o: 3, h: 3}. Give prob of picking 1 h and 1 s. 3/14 Calculate prob of picking 1 g and 1 u when two letters picked without replacement from {g: 2, j: 1, q: 1, n: 2, u: 1}. 2/21 Calculate prob of picking 1 p and 2 h when three letters picked without replacement from wpffhhhhfpp. 6/55 What is prob of picking 1 v, 1 p, and 2 m when four letters picked without replacement from {e: 1, v: 1, m: 2, p: 4}? 2/35 Calculate prob of picking 1 l and 1 e when two letters picked without replacement from {l: 10, e: 1, b: 1, p: 2, d: 2}. 1/12 Two letters picked without replacement from {k: 1, n: 1, l: 2, q: 2, u: 1, z: 1}. Give prob of picking 1 l and 1 z. 1/14 Two letters picked without replacement from ciuixwiaaucuxcc. What is prob of picking 1 x and 1 a? 4/105 What is prob of picking 2 q when two letters picked without replacement from qvvqqqqqqqqqqqqqqq? 40/51 Three letters picked without replacement from {k: 1, y: 2, t: 1, h: 4}. What is prob of picking 1 k, 1 t, and 1 y? 1/28 What is prob of picking 1 t and 1 o when two letters picked without replacement from otu? 1/3 Three letters picked without replacement from {t: 2, m: 11}. What is prob of picking 2 m and 1 t? 5/13 Calculate prob of picking 4 z when four letters picked without replacement from {x: 2, z: 5}. 1/7 Calculate prob of picking 1 b and 2 d when three letters picked without replacement from {b: 3, d: 12}. 198/455 Calculate prob of picking 1 n and 1 j when two letters picked without replacement from neejeejj. 3/28 Calculate prob of picking 1 k, 1 n, and 1 h when three letters picked without replacement from {k: 4, l: 1, m: 3, o: 1, n: 2, h: 1}. 2/55 Two letters picked without replacement from {g: 1, e: 1, p: 1, s: 6, u: 1, i: 1}. Give prob of picking 1 g and 1 u. 1/55 Four letters picked without replacement from vtlvrprrxrvt. What is prob of picking 1 r, 1 l, 1 v, and 1 x? 4/165 Three letters picked without replacement from {w: 5, f: 1, j: 7, g: 5}. Give prob of picking 1 f, 1 w, and 1 j. 35/816 Calculate prob of picking 2 r and 1 j when three letters picked without replacement from rhrrrrjrrhrrrr. 55/364 Two letters picked without replacement from jijmm. Give prob of picking 1 j and 1 i. 1/5 Two letters picked without replacement from {j: 12, k: 7}. What is prob of picking 1 j and 1 k? 28/57 What is prob of picking 1 q, 1 z, and 2 v when four letters picked without replacement from vytqdzdyv? 1/126 Two letters picked without replacement from bvvvbbbbvvbbb. Give prob of picking 2 b. 14/39 Calculate prob of picking 1 m and 1 x when two letters picked without replacement from xxmzz. 1/5 Calculate prob of picking 4 s when four letters picked without replacement from dsdddsddsfsxd. 1/715 Four letters picked without replacement from ljbblblb. Give prob of picking 4 l. 0 Calculate prob of picking 1 a and 1 t when two letters picked without replacement from {v: 2, t: 6, u: 1, a: 1, w: 1, p: 4}. 2/35 Four letters picked without replacement from ccwewxwxaxwtat. Give prob of picking 1 e, 1 c, and 2 x. 6/1001 Calculate prob of picking 4 i when four letters picked without replacement from iiiiiii. 1 Two letters picked without replacement from kkujwiz. What is prob of picking 1 k and 1 w? 2/21 Calculate prob of picking 2 c, 1 d, and 1 r when four letters picked without replacement from rvrvcrvrdrrcdxrv. 1/130 Two letters picked without replacement from {h: 3, f: 2, u: 1, q: 1}. Give prob of picking 2 h. 1/7 Four letters picked without replacement from {b: 4, m: 7, g: 3}. Give prob of picking 2 b and 2 g. 18/1001 What is prob of picking 4 b when four letters picked without replacement from bbebbbbb? 1/2 Calculate prob of picking 2 g when two letters picked without replacement from jvnnwnvgnjggngvn. 1/20 Two letters picked without replacement from {p: 1, s: 2, d: 1, n: 1, j: 1, u: 2}. Give prob of picking 1 p and 1 j. 1/28 Two letters picked without replacement from jjjpjjepepejjprpjjjr. What is prob of picking 1 e and 1 p? 3/38 What is prob of picking 3 t when three letters picked without replacement from {t: 9, e: 10}? 28/323 What is prob of picking 3 g when three letters picked without replacement from {g: 6, v: 4, l: 2, k: 1, i: 3}? 1/28 What is prob of picking 1 s and 1 d when two letters picked without replacement from dpdmsmd? 1/7 What is prob of picking 2 i when two letters picked without replacement from {b: 5, i: 3, o: 4}? 1/22 Calculate prob of picking 1 f and 1 s when two letters picked without replacement from apaaaaseeappf. 1/78 Four letters picked without replacement from {b: 2, c: 4, z: 3, o: 2}. What is prob of picking 1 z, 2 b, and 1 c? 2/55 Three letters picked without replacement from zjajjaajfaazjyjaja. Give prob of picking 1 z, 1 y, and 1 f. 1/408 Two letters picked without replacement from {b: 1, e: 3, r: 7, c: 3}. Give prob of picking 1 r and 1 e. 3/13 Calculate prob of picking 1 y and 2 h when three letters picked without replacement from hhyvyk. 1/10 What is prob of picking 2 f and 2 r when four letters picked without replacement from {r: 3, f: 4}? 18/35 Calculate prob of picking 2 r when two letters picked without replacement from {m: 2, r: 2, b: 1}. 1/10 Two letters picked without replacement from {v: 1, n: 1, u: 2, e: 2}. What is prob of picking 1 v and 1 e? 2/15 Two letters picked without replacement from nngbbbggnngnmbb. Give prob of picking 1 m and 1 n. 1/21 Calculate prob of picking 1 j and 2 q when three letters picked without replacement from {g: 1, j: 8, q: 2, p: 1, a: 4}. 1/70 Calculate prob of picking 2 l and 1 a when three letters picked without replacement from laaablaal. 5/28 Two letters picked without replacement from {i: 2, q: 1, t: 1, h: 1}. What is prob of picking 1 q and 1 i? 1/5 Calculate prob of picking 2 h when two letters picked without replacement from {p: 2, y: 7, g: 1, q: 1, i: 4, h: 3}. 1/51 What is prob of picking 2 i when two letters picked without replacement from zizzzizzzzz? 1/55 Two letters picked without replacement from xvtwqvvqgxq. What is prob of picking 1 x and 1 g? 2/55 Three letters picked without replacement from aanacaaaatgcan. What is prob of picking 2 n and 1 g? 1/364 Two letters picked without replacement from vvnvzzzvzvzzazzv. Give prob of picking 1 v and 1 z. 2/5 Three letters picked without replacement from iikkikikiiiiii. What is prob of picking 3 k? 1/91 Four letters picked without replacement from {v: 2, r: 1, a: 3, b: 5, j: 6}. What is prob of picking 1 a and 3 b? 3/238 Three letters picked without replacement from nozznkppppkknnnonnoz. What is prob of picking 1 k and 2 n? 21/380 Calculate prob of picking 1 t and 2 c when three letters picked without replacement from {c: 2, m: 10, j: 1, v: 4, t: 1}. 1/816 Two letters picked without replacement from varvbryasvvyavravr. Give prob of picking 2 y. 1/153 Calculate prob of picking 2 w when two letters picked without replacement from nwbwnrgwnyy. 3/55 What is prob of picking 1 o and 1 v when two letters picked without replacement from {v: 3, o: 5}? 15/28 Three letters picked without replacement from {d: 5, w: 3, v: 2, l: 2, f: 7, b: 1}. What is prob of picking 3 w? 1/1140 What is prob of picking 1 w, 1 m, 1 r, and 1 e when four letters picked without replacement from {e: 1, w: 1, z: 1, m: 2, x: 2, r: 1}? 1/35 Two letters picked without replacement from tclttfllfela. What is prob of picking 1 t and 1 a? 1/22 Three letters picked without replacement from zwhwhawawazawgzz. Give prob of picking 2 a and 1 g. 3/280 Two letters picked without replacement from pntfffttfnfffffft. Give prob of	{ "pile_set_name": "DM Mathematics" }
fy ((sqrt(76) + (sqrt(76) + -1 + sqrt(76))5 + -3)-1 - (-3sqrt(76) + sqrt(76) + 0 - (sqrt(76) + 2 + -5)))2-1. -4889 + 160sqrt(19) Simplify ((-5sqrt(84)2 - 1(sqrt(84) + (sqrt(84) - sqrt(84)2)))1)/(65sqrt(12) - sqrt(72)/(sqrt(6) + sqrt(36)/sqrt(6))). -20sqrt(7)/59 Simplify 3((sqrt(700) + -3 + sqrt(700) + sqrt(700))*2 - sqrt(2016)/sqrt(8) - (5-3(-1sqrt(175) + sqrt(175)))*2). -558sqrt(7) + 18927 Simplify (6(sqrt(84)24 - sqrt(84)11))/(2sqrt(132)/(((sqrt(11) - sqrt(99)) + sqrt(11))1 - sqrt(11) - sqrt(11))). -63sqrt(7) Simplify (-4sqrt(156)1-2-5)/((2sqrt(36)3)/(sqrt(36)/(-2sqrt(12)))). 10sqrt(13)/3 Simplify 4-5(2 + (((sqrt(1216) - (sqrt(1216) + (-6-3sqrt(1216) - sqrt(1216)))) + sqrt(1216) - sqrt(1216)) + 0 + 3)*2)2. -14057400 + 32640sqrt(19) Simplify 1(4 + ((sqrt(88)/(sqrt(8)/sqrt(4)))/sqrt(4) + -2sqrt(11) + -3 + 4)-3)*2. 6sqrt(11) + 100 Simplify (-1(5 + (2 + -3 + sqrt(99) - sqrt(99)) + (sqrt(99) + -1)-3) + -1)*2. -144sqrt(11) + 955 Simplify ((4(sqrt(420) + sqrt(420) + 1sqrt(420)))/(sqrt(7) + sqrt(28)2 + sqrt(28)))/(sqrt(12) + ((sqrt(36)2)/sqrt(3) - sqrt(12)) - sqrt(108)/(2sqrt(9))). 8sqrt(5)/7 Simplify (6-5(2sqrt(77) - sqrt(77)))/((2sqrt(99))/sqrt(9) - (-1sqrt(704) - sqrt(11))) + 1. -30sqrt(7)/11 + 1 Simplify 6(sqrt(102)/((sqrt(3) + sqrt(9)/sqrt(3) - sqrt(3))-5))/(-32sqrt(72) - sqrt(72)). sqrt(17)/35 Simplify 5 + ((sqrt(832) + (1 + sqrt(832))-1 + sqrt(832) + sqrt(832))2 - sqrt(832)) + sqrt(832) + (sqrt(832) - -2(sqrt(832)3 + sqrt(832)))2 + 3 + 0. -32sqrt(13) + 70729 Simplify (-5 + 2 + (sqrt(98) + -1)-1 + sqrt(98)21 + 4 + 5)2. 98sqrt(2) + 147 Simplify 11(4 + 62sqrt(325)3-6)*2. -8640sqrt(13) + 15163216 Simplify -5((sqrt(448) - (-1 + sqrt(448))) + 3 - (2 + (sqrt(7) - (sqrt(7) + -1)) + 3))23 + -1. -61 Simplify 3sqrt(6)/sqrt(3) + (sqrt(2) - 4(sqrt(18)/sqrt(9) + sqrt(2))) - (-3(2sqrt(242))*2 + -1). -4sqrt(2) + 2905 Simplify ((-1sqrt(1944))/(sqrt(32)/(sqrt(8)1)))/(-3(2sqrt(192)-4 - sqrt(192))). -sqrt(2)/24 Simplify -1(sqrt(121)/(1sqrt(11)) + -5 + 1sqrt(11) + -4-1sqrt(11)-6)4-3. -264sqrt(11) - 60 Simplify (sqrt(76)1 - (sqrt(19) - -6((sqrt(19) - -2sqrt(19)) + sqrt(19)))) + 3 - ((-5 + sqrt(1539) + 2)2 - (5 + 4sqrt(1539) + sqrt(1539) + sqrt(1539))). -1540 + 85sqrt(19) Simplify (((sqrt(190) - (sqrt(190) + -1sqrt(190)4)) + -5sqrt(190)-2)/(sqrt(90)/(sqrt(675)/sqrt(3))) + 0)2. 93100 Simplify ((-3 + (sqrt(192) - (sqrt(192) + 1)) - sqrt(192))-2-4)2 - (sqrt(192)-2-52)*2-5. 4096sqrt(3) + 397312 Simplify (1(-11sqrt(72) + 0 - (-1 + -2(-1 + sqrt(72))))4 + -3)*2. -336sqrt(2) + 1201 Simplify ((sqrt(300) + 1)*2 - sqrt(300))26 + (sqrt(288) - ((sqrt(288) - sqrt(288)-1) + sqrt(288)) - sqrt(288))/(5sqrt(6)2). 594sqrt(3)/5 + 3612 Simplify 1 + -1(-6(1sqrt(70)1 - sqrt(70)))/(sqrt(50)/(sqrt(20)-1 - sqrt(20) - sqrt(20))). 1 Simplify ((sqrt(1700) + 6(sqrt(1700) + 0) - (-4 + sqrt(1700) + 1 + sqrt(1700))) + -2 - -4(-2(sqrt(1700) - sqrt(1700)1) + -2))*2. -700sqrt(17) + 42549 Simplify (3(1(sqrt(5) + -2) + 3)*2 - ((sqrt(320) + 5 + sqrt(320)2)*2 + -4))3 + -4. -8653 - 702sqrt(5) Simplify 3 + -53(-13sqrt(144))/(sqrt(8) + sqrt(72)-5). -135sqrt(2)/14 + 3 Simplify (sqrt(162)/(sqrt(1296)/sqrt(4)) - (sqrt(72)/sqrt(64) + (sqrt(18) + -5sqrt(162))*2 + sqrt(18) + sqrt(18))) + 5. -3523 - 25sqrt(2)/4 Simplify ((sqrt(1300)-1 + (sqrt(13) + -1)6 - (2 + -2 + sqrt(52)/sqrt(4)))-1)2. 60sqrt(13) + 361 Simplify (-2(sqrt(800) + sqrt(800) + ((sqrt(800) - sqrt(800)2-3) + sqrt(800) + sqrt(800) - sqrt(800))))/((sqrt(24)-1 + sqrt(24))/sqrt(6) + sqrt(484)1). -200sqrt(2)/11 Simplify (-1 + sqrt(6336))*2 + sqrt(3564) + -2 - (sqrt(528) - 2sqrt(528)6)/(sqrt(12) + (sqrt(108) - (sqrt(108) + sqrt(108)-1))/sqrt(9)). -19sqrt(11) + 6335 Simplify 4 + (((sqrt(704) + 0)-1 + 5)3 - (((sqrt(704)2 - sqrt(704))-6 - sqrt(704)) + -2 + 1)2). -34478 - 136sqrt(11) Simplify (-65(sqrt(156) + ((-2sqrt(156) - sqrt(156))-2 - sqrt(156))))/(sqrt(12) + (sqrt(48) - sqrt(1728)) - (sqrt(108)-1 + sqrt(108))). 20sqrt(13) Simplify (sqrt(468)/(sqrt(27)/(sqrt(15)/sqrt(5))))/(sqrt(20)/(sqrt(5) - (sqrt(405) - -1sqrt(405))))-6. 102sqrt(13) Simplify (-6(-1 + (sqrt(1053) - (sqrt(1053) + -1 - sqrt(1053))) + sqrt(1053) + 4 + sqrt(1053) + -1)2 + -2)2. 24624sqrt(13) + 1366132 Simplify 0 + (-65sqrt(11)5)2 + (6(2sqrt(66) + sqrt(66)))/(1(sqrt(6) - sqrt(150))). -9sqrt(11)/2 + 247500 Simplify (-5((sqrt(77)/(sqrt(22)/sqrt(2)) - (-4 + 3sqrt(7))) + (1 + sqrt(28)/(sqrt(16)/sqrt(4)))5))*2. 1350sqrt(7) + 3600 Simplify ((sqrt(54)/(sqrt(2)-2) - -4(sqrt(27)-1 - sqrt(27)))1)/(-4(sqrt(405) - sqrt(45))/sqrt(5)-5). -17sqrt(3)/80 Simplify (3 + 0 + -1 + sqrt(1900) + 2 + -5(0 + sqrt(1900) + -3)-4)2. -23520sqrt(19) + 841036 Simplify (5(-1(sqrt(1584) + sqrt(1584)1) - sqrt(1584)) + -5)2 + 3(sqrt(1584) - ((sqrt(1584)2 - sqrt(1584)) + 3) - sqrt(1584))1. 1764sqrt(11) + 356416 Simplify 4(-3 + (3 + 0 + sqrt(2592) - (sqrt(2592) + -1 + -4))*2)-1. -244 Simplify (1-2sqrt(91)5-1)/(2-6(2sqrt(175) + sqrt(175))). -sqrt(13)/18 Simplify (-1 + ((sqrt(847) - (-2 + sqrt(847))) + sqrt(847) + sqrt(1008)/sqrt(9) - ((-3(0 + sqrt(448)) - sqrt(448)) + (2sqrt(448)3 - sqrt(448))))5)2. 630sqrt(7) + 8656 Simplify (2(sqrt(2880) + 3(sqrt(2880)3 + sqrt(2880)) - (-2 + sqrt(2880)-5)) + 5)*2. 15552sqrt(5) + 3732561 Simplify ((sqrt(52) + sqrt(104)/sqrt(2))6)/((sqrt(220)/sqrt(5))/sqrt(11)) + (-1sqrt(650))/((sqrt(2) - (sqrt(48)/sqrt(2))/sqrt(12)) + sqrt(2)). 7sqrt(13) Simplify (-6(0 + 1(sqrt(408)/(sqrt(80)/sqrt(10)))/(sqrt(3072) + sqrt(3))))2. 68/121 Simplify (((sqrt(35) + sqrt(2835)-1 - sqrt(35)) + -6sqrt(175)/sqrt(5))/((-1sqrt(3584))/(sqrt(96)/(sqrt(12)2))))2. 1125/256 Simplify 1 + -2 + (4(sqrt(28)/sqrt(4))*2 + 2 - -1((sqrt(28)1)/sqrt(4))2) + -4. 32 Simplify (sqrt(150)-1-2)/((sqrt(162) - 3sqrt(162) - sqrt(162))2) + 4. -5sqrt(3)/27 + 4 Simplify ((4 + (sqrt(2057) + 1)-1 + (sqrt(2057) - (sqrt(2057) + sqrt(2057)1 + -3)) + 0)-3)24. -9504sqrt(17) + 297504 Simplify -46(0 + (-2 + (sqrt(275) - -6(3 + sqrt(275))))*2). -329544 - 26880sqrt(11) Simplify 2 + (-1(sqrt(66)-1 + sqrt(66)))/(sqrt(6) - sqrt(6)21) + (4 + sqrt(99) + 0 - (-3 + -1sqrt(99))2)-4. 60sqrt(11) + 418 Simplify 4(sqrt(243) + 3 + sqrt(243)) + 0 - (-6(sqrt(3) + sqrt(3) + 5) - (sqrt(84)/sqrt(7))2). 54 + 84sqrt(3) Simplify -4(1 + (sqrt(448)-1)*2 - (-1 + sqrt(175))4)-2 + -3. -160sqrt(7) + 3621 Simplify (4 + sqrt(153)1 + 5 + sqrt(153) + -1 + (sqrt(153)-2 - sqrt(153)) + sqrt(153) - -3(sqrt(153) + -2)41)2. -1152sqrt(17) + 22288 Simplify (2sqrt(320)1 + (sqrt(320)2 + sqrt(320) - sqrt(320)) + 5 + sqrt(35)/(sqrt(175)2) + -2)*2-5. -103221/4 - 963sqrt(5) Simplify 5 + ((5 + -2sqrt(162))2 + sqrt(162) - (4 + (sqrt(162) - (1 + sqrt(162))) - sqrt(162) - sqrt(162))2) - (-3 + (sqrt(162) + -2)45)*2. -66628 + 15417sqrt(2) Simplify 2 + (3(-3sqrt(1377)-1 + (-1sqrt(1377) + sqrt(1377) + sqrt(1377))1)-6 + 0)*2. 7138370 Simplify (sqrt(726) + (sqrt(726) - 11sqrt(726)) - ((1sqrt(726) + sqrt(726))1 + sqrt(726)))/(-5sqrt(450)-3). -22sqrt(3)/225 Simplify ((sqrt(77)-2)/sqrt(11) + (sqrt(70)-2 + sqrt(70) - sqrt(70))/sqrt(10))*22 + ((sqrt(1008)-1)/sqrt(9))2 + 2. 338 Simplify 1 + 4 + ((sqrt(80)/sqrt(8))/sqrt(2) - (sqrt(405) + (sqrt(405) + -1 - sqrt(405))))2-3-3. -144sqrt(5) + 2894 Simplify (-5((1sqrt(576)-3)/(((2sqrt(128) - sqrt(128))5 - sqrt(128)) + sqrt(128) - sqrt(128) - sqrt(128)) + -2))2. 150sqrt(2) + 425/2 Simplify (-1 + (2sqrt(2268)-3 - (-2sqrt(2268) + 5 - sqrt(2268))) + 5(0 + sqrt(448) + -1 + sqrt(448)))*2. -572sqrt(7) + 4853 Simplify (3(2sqrt(1029)1 - sqrt(1029)))/(4sqrt(7)3 - -2sqrt(343)). 21sqrt(3)/26 Simplify (sqrt(3993)61)/(3sqrt(44)/sqrt(4) - (6sqrt(33)/sqrt(3) + sqrt(11))) + 5. -33sqrt(3)/2 + 5 Simplify (sqrt(126)/(-1sqrt(3)) + (sqrt(2058) - ((sqrt(2058) - 1sqrt(2058)) + sqrt(2058)) - sqrt(2058)))/(sqrt(24) + sqrt(24)-11 - sqrt(96)-3). -2sqrt(7)/3 Simplify (-21sqrt(56))/(sqrt(16)/(sqrt(2)3) - sqrt(8)) + (-4sqrt(84)/sqrt(6))/(sqrt(50)-6). 47sqrt(7)/15 Simplify 5*((sqrt(128)/(sqrt	{ "pile_set_name": "DM Mathematics" }
)/(-2sqrt(847)-1 + sqrt(847) + sqrt(847)))*2. 1620/121 Simplify 6-1(((sqrt(448) - 3sqrt(448)-4)2 - sqrt(448))-2 + -162sqrt(567)). 552sqrt(7) + 908544 Simplify -43sqrt(192)3 + -5(-2(4 + sqrt(108)))2. -2480 - 1248sqrt(3) Simplify (-4-1(sqrt(84) + sqrt(84)4))/(sqrt(432)3-5). -2sqrt(7)/9 Simplify 2(-3 + ((sqrt(18) - (sqrt(1458) + -3)) + sqrt(18) + sqrt(162)-3)*2)-3-4. -6912sqrt(2) + 110736 Simplify (5(sqrt(243) + -2)-2)*2 - (sqrt(12)/(4sqrt(4) + sqrt(4)) + sqrt(3) - 2sqrt(432)). -17886sqrt(3)/5 + 24700 Simplify -5 + (sqrt(90)/(sqrt(12)/sqrt(2) + sqrt(6))5)/((sqrt(12)/(-1sqrt(4)) + sqrt(3) - sqrt(3)) + sqrt(6)/sqrt(2)3). -5 + 5sqrt(5)/4 Simplify ((-3(-1sqrt(135) + sqrt(135))-5)/(sqrt(20)4 + -2sqrt(35)/sqrt(7)))2 + 0. 0 Simplify ((-2sqrt(220))/sqrt(10))/(5(sqrt(2) - (sqrt(8) + sqrt(2))) + sqrt(2)) + (sqrt(44)2 + 5)*2 + 1 + (sqrt(11) - sqrt(22)/sqrt(2)) + 1. 362sqrt(11)/9 + 203 Simplify (5(sqrt(51) + sqrt(612)/(sqrt(12)-1) - sqrt(3264)2))/(sqrt(9)/(sqrt(18)/sqrt(6)) - sqrt(192)-3). -16sqrt(17)/5 Simplify 3 + ((sqrt(245) + -4 + 1 + -4 + 4)-5)*2. -1050sqrt(5) + 6353 Simplify ((1sqrt(153)2 - 5(sqrt(153) + (sqrt(153) - ((sqrt(153) - -2sqrt(153)) + sqrt(153)))))-1)/(sqrt(27)/sqrt(3)-2 + sqrt(27)/(sqrt(33)/sqrt(11))). 12sqrt(17) Simplify -1-5(4 + 1 + sqrt(304) + -3(sqrt(190)-2)/sqrt(10))-4. -200sqrt(19) - 100 Simplify -5 + (2((sqrt(72) - sqrt(72)3)/sqrt(8))/(sqrt(3) - (sqrt(3) - (4sqrt(300) + sqrt(300))))-3-1)*2. -3017/625 Simplify (3(sqrt(162) + 2) + 4(5 + sqrt(18)))2 + -4 + -2. 2028sqrt(2) + 3712 Simplify (2sqrt(170)-1-36)/((((sqrt(1800) - sqrt(1800)2) + sqrt(1800) - sqrt(1800)) + sqrt(50))/(sqrt(30)/sqrt(150))). -36sqrt(17)/25 Simplify ((-2sqrt(66)/(3sqrt(12)))/((-2(sqrt(6)1 + sqrt(6)))/((2sqrt(363) - sqrt(363)) + sqrt(363) - sqrt(3))))2. 539/16 Simplify -4 + ((sqrt(18)-1 + 4)*2 + sqrt(162) + -3 - 2sqrt(16)/(sqrt(64)/(sqrt(24)/sqrt(3)))). -17sqrt(2) + 27 Simplify (-4(2sqrt(5929) + sqrt(5929) - 2sqrt(196))/(sqrt(49)/(sqrt(7) - (sqrt(7) - (sqrt(28) + sqrt(7)))2 - sqrt(7))))2. 1507072 Simplify ((-2(sqrt(684) + -1) + 0 - ((sqrt(684) - -62sqrt(684)) + sqrt(684) - (2 + (sqrt(684) - (sqrt(684) + 1))))) + 2)*22. -1920sqrt(19) + 350258 Simplify ((2((sqrt(704) - (sqrt(704) + 2)) + sqrt(704) + sqrt(704))3)2 + 3 - (-1 + -3 + sqrt(704) + sqrt(704) + -1 + sqrt(704) + -3 + sqrt(704))2)-5. -450975 + 8960sqrt(11) Simplify -6(sqrt(343) + -1 - sqrt(343)) + (-1 + sqrt(343) + 1)*2 - (3(sqrt(343) + 1 - sqrt(343))*2 + (sqrt(343)1)*2-5 + 2). 2059 Simplify (0 + 4 + ((sqrt(84) - (sqrt(84) + sqrt(84)-3 - sqrt(84)) - sqrt(84))-4)/((sqrt(1728) - sqrt(1728)-3) + sqrt(1728) + sqrt(12) - sqrt(12)) + 1)2. -2sqrt(7) + 632/25 Simplify -5 + ((-1sqrt(4320) + sqrt(4320) + sqrt(30) - sqrt(30))/(-1sqrt(128) + sqrt(2)))/((-1sqrt(60)-2)/(sqrt(60)/(sqrt(5) - sqrt(80)))). -5 Simplify ((2sqrt(95)-23)/(2sqrt(245) + (sqrt(320)-1 - sqrt(320))) + -4)2-3. -2100 + 144sqrt(19) Simplify -4(2((5sqrt(76)4 - (-2(sqrt(76) - -2sqrt(76)) - sqrt(76))) + -3))2 + 2. -886606 + 5184sqrt(19) Simplify 0 + 4sqrt(153) + (1sqrt(833))*2 - (-5 + (sqrt(68) + -5 + -2sqrt(68))*2). -8sqrt(17) + 745 Simplify (1 + (sqrt(1539) - ((0 + sqrt(1539))5 - sqrt(1539))) + -4)2 - (3(sqrt(1539) + 1 + sqrt(1539)-1) + 3). 162sqrt(19) + 13854 Simplify 2((sqrt(3) + -2)4 + sqrt(48) + 0 + sqrt(27)/(sqrt(54)/sqrt(6)) + 1)*25. -1260sqrt(3) + 2920 Simplify (((sqrt(1900) + sqrt(1900) + 3 - sqrt(1900))-6)*2-6 + ((-3sqrt(1900)5 - sqrt(1900))-1)2)-5. -370280 + 64800sqrt(19) Simplify (sqrt(1100) - (-2 + -3 + sqrt(1100))2)-2 - ((sqrt(176) - sqrt(176)1 - sqrt(176))-2 + -4)*2. -156sqrt(11) + 1530 Simplify (((3sqrt(32))/sqrt(2))/sqrt(8)6 - sqrt(1152)-23)*2. 52488 Simplify ((sqrt(250) + (sqrt(250) - (5sqrt(250) + sqrt(250)))3)2)/(-2sqrt(5)-6 + 2sqrt(125) + sqrt(125))-3. 140sqrt(2)/9 Simplify -3 + (((-1sqrt(102) + sqrt(102))6)/(2sqrt(6)-5 - sqrt(6)) - sqrt(136)/(sqrt(8) - sqrt(96)/(sqrt(12) - sqrt(12)4))3). -9sqrt(17)/4 - 3 Simplify (2 + (((sqrt(176) + (2 + sqrt(176) - sqrt(176)))-6 - sqrt(176)) + sqrt(176) + 3 + 5)2)5 + 4. 960sqrt(11) + 31774 Simplify -3(((5 + ((sqrt(80)1)/sqrt(8))/sqrt(2) + -2)6)*2 + 5)5. -7635 - 3240sqrt(5) Simplify 1 + (-1sqrt(539))*2 - (sqrt(539) - -2sqrt(539))*21 - (sqrt(66) + (sqrt(66)-2 + sqrt(66))4)/((sqrt(36)/sqrt(2))/sqrt(3)). -4311 + 3sqrt(11) Simplify (15(3 + sqrt(33)/(sqrt(30)/(sqrt(10) + sqrt(250) + sqrt(10)))2 + 1)-3)2. 25200sqrt(11) + 488700 Simplify 0 + 0 + (-2sqrt(10)/(3sqrt(5)))2 + ((sqrt(42)/sqrt(3))/sqrt(7) + sqrt(2) + -5 + sqrt(8)/sqrt(4))2-4. -1540/9 + 120sqrt(2) Simplify (-4 + -6(sqrt(27) + sqrt(27) + (sqrt(27) - sqrt(54)/sqrt(2) - sqrt(27))) + 4)2 + (-2sqrt(363) + 5 + sqrt(363) - (1 + 0 + sqrt(192))). -19sqrt(3) + 976 Simplify (-13sqrt(44)/(sqrt(20)/sqrt(5)) - ((sqrt(121) + 6(sqrt(121) + sqrt(121)2 + sqrt(121)))/(sqrt(11) - (sqrt(11) - sqrt(110)/sqrt(160))))2) + -3. -110003 - 3sqrt(11) Simplify -4(2 + ((sqrt(847) - (2 + sqrt(847)-2)) + -1 + sqrt(343) + 0)*2). -44844 + 960sqrt(7) Simplify (((sqrt(28)/(sqrt(2) + sqrt(2)1)-5)/((sqrt(77) + -2sqrt(77) - sqrt(77))/sqrt(11)-1) + 4)1)2-6. -459/4 + 60sqrt(2) Simplify ((-2sqrt(78)-1)/(-2sqrt(96)) + 1(2 + sqrt(13)) + sqrt(52)/(sqrt(4)-3 + sqrt(4)))3. 3sqrt(13)/4 + 6 Simplify (-4(5 + 6(0 + sqrt(2))) - (-2 + sqrt(126)/sqrt(7) + -1))*2. 918sqrt(2) + 1747 Simplify (((0 + sqrt(405) + 4)4 - (-3 + 2sqrt(405))-4)2 + 5)-2. -116682 - 1728sqrt(5) Simplify -1((-2 + sqrt(800) + -2 + -5)*2 + -3) + 4. -874 + 360sqrt(2) Simplify sqrt(77)/(sqrt(22)/sqrt(50)) + -2 - (-1 + sqrt(847) + sqrt(42)/sqrt(6)4). -10sqrt(7) - 1 Simplify ((sqrt(70) + -5(sqrt(70) - (sqrt(70) - sqrt(70)2 - sqrt(70))))33)/((sqrt(40)-1)/sqrt(4) + 1sqrt(40)). -126sqrt(7) Simplify -3 + (sqrt(6292) - (sqrt(6292) + 2))2 + (-2 + sqrt(208)/sqrt(4) + sqrt(312)/(sqrt(18)/sqrt(3)))2 + 0. -16sqrt(13) + 213 Simplify (sqrt(150)/(sqrt(36)/(sqrt(12)-1))-45 + -5(0 + sqrt(5000))54)*2. 48020000 Simplify (5sqrt(114)-16-6)/(sqrt(726)2-1-2). 45sqrt(19)/11 Simplify (6((2 + sqrt(475))-6 + sqrt(475)) + 2 - ((0 + sqrt(475))-2 + -3(-2 + sqrt(475) - sqrt(475))))2. 21280sqrt(19) + 378176 Simplify -2 + 2(4 + sqrt(612)-1)1 + 3. -12sqrt(17) + 9 Simplify ((-3sqrt(66)-5 - sqrt(66) - (1sqrt(66)3 - sqrt(66)))/(-5(sqrt(294)1 - sqrt(108)/sqrt(2))))*2. 99/25 Simplify (-3(5(sqrt(136) + 3(sqrt(136)-2 + sqrt(136)) - sqrt(136))-6)/((sqrt(16) + sqrt(1024)-1)/(sqrt(4)/(sqrt(2)2))))2. 309825/49 Simplify (sqrt(68)/sqrt(256))2 - -1sqrt(1088) - (3sqrt(2057)-5 + 4). -239/64 + 173sqrt(17) Simplify 3 + 4 + (((sqrt(272) + -4 + -1 + sqrt(272))4)2 - (-5 + sqrt(272) + -1 + sqrt(272) - (-3sqrt(272)-1)2)) + -3. -1288sqrt(17) + 20266 Simplify (2-5(sqrt(19) + 3)4 - (5 + sqrt(171)-4 + 2)*2)-5. -640sqrt(19) + 14525 Simplify (6sqrt(30)1 - (sqrt(30) + 1sqrt(270) + sqrt(270)))/((sqrt(294) + (sqrt(294) - -1(sqrt(294) + sqrt(294)1 + sqrt(294))) - sqrt(294))-6). sqrt(5)/168 Simplify (((((1sqrt(2000) + sqrt(2000))-6 - sqrt(2000)) + sqrt(2000))2)/(sqrt(10)-23 + (sqrt(10) + sqrt(100)/(sqrt(20)/sqrt(2)) - sqrt(10))))*2. 4608 Simplify 0 + 2((sqrt(4455)-4 + sqrt(4455) + sqrt(4455))-3)/((sqrt(891)-4 + sqrt(891))6). -2sqrt(5)/3 Simplify -5 + -5-1(((sqrt(100)1 + sqrt(100))1)/sqrt(2) + sqrt(500)/(sqrt(90)4)). -5 + 625sqrt(2)/12 Simplify ((22sqrt(95) - (sqrt(95)1 - sqrt(95) - sqrt(95))-4)/((sqrt(240) - sqrt(15))/(-1sqrt(48))))*2. 0 Simplify 1 + ((sqrt(1377) + 2)-31)2 + (-6(-3sqrt(1377) + 3))2. -5508sqrt(17) + 458902 Simplify -1(-2(-1 + -6sqrt(1300)-3)*2-3 + 4). -2527210 + 2160sqrt(13) Simplify ((sqrt(6) - -1sqrt(6)-2)6)/((sqrt(3) - sqrt(384)/sqrt(8))6) + 0 + 0. sqrt(2)/3 Simplify (-4(sqrt(288) - (sqrt(288) + -1sqrt(288) + 0)) + 4 + 1 + 4)24. -3456sqrt(2) + 18756 Simplify (sqrt(48)/sqrt(2)5 + sqrt(216)2)/((5-1sqrt(32))/(sqrt(4)22 + sqrt(4))). -11sqrt(3) Simplify (-6(sqrt(168)/(sqrt(12) + sqrt(300)) - (sqrt(224)-2 - sqrt(14))))/((sqrt(112) + sqrt(112)-1)5 - (-2sqrt(7)	{ "pile_set_name": "DM Mathematics" }
ulate the remainder when 56 is divided by 3. 2 What is the remainder when 244 is divided by 58? 12 Calculate the remainder when 518 is divided by 5. 3 What is the remainder when 220 is divided by 71? 7 What is the remainder when 260 is divided by 58? 28 What is the remainder when 22 is divided by 5? 2 What is the remainder when 1768 is divided by 51? 34 Calculate the remainder when 66 is divided by 60. 6 What is the remainder when 147 is divided by 23? 9 What is the remainder when 636 is divided by 13? 12 What is the remainder when 2852 is divided by 51? 47 What is the remainder when 487 is divided by 121? 3 Calculate the remainder when 4244 is divided by 118. 114 Calculate the remainder when 549 is divided by 131. 25 Calculate the remainder when 135 is divided by 62. 11 What is the remainder when 403 is divided by 91? 39 What is the remainder when 2589 is divided by 369? 6 Calculate the remainder when 1085 is divided by 23. 4 What is the remainder when 4052 is divided by 52? 48 Calculate the remainder when 558 is divided by 1. 0 What is the remainder when 85 is divided by 22? 19 What is the remainder when 153 is divided by 37? 5 Calculate the remainder when 138 is divided by 48. 42 What is the remainder when 3625 is divided by 39? 37 Calculate the remainder when 751 is divided by 13. 10 Calculate the remainder when 309 is divided by 41. 22 What is the remainder when 7865 is divided by 19? 18 What is the remainder when 2945 is divided by 29? 16 What is the remainder when 179 is divided by 15? 14 Calculate the remainder when 711 is divided by 23. 21 Calculate the remainder when 10244 is divided by 42. 38 Calculate the remainder when 48 is divided by 29. 19 Calculate the remainder when 119 is divided by 57. 5 Calculate the remainder when 824 is divided by 9. 5 What is the remainder when 116 is divided by 40? 36 Calculate the remainder when 112 is divided by 48. 16 What is the remainder when 80 is divided by 41? 39 What is the remainder when 386 is divided by 143? 100 What is the remainder when 92 is divided by 5? 2 What is the remainder when 77 is divided by 4? 1 Calculate the remainder when 1808 is divided by 79. 70 What is the remainder when 447 is divided by 16? 15 Calculate the remainder when 74 is divided by 26. 22 Calculate the remainder when 69006 is divided by 227. 225 Calculate the remainder when 21900 is divided by 181. 180 Calculate the remainder when 207 is divided by 56. 39 Calculate the remainder when 235 is divided by 58. 3 Calculate the remainder when 34 is divided by 7. 6 Calculate the remainder when 266 is divided by 84. 14 What is the remainder when 70 is divided by 34? 2 What is the remainder when 986 is divided by 52? 50 What is the remainder when 3335 is divided by 6? 5 Calculate the remainder when 100 is divided by 7. 2 What is the remainder when 523 is divided by 75? 73 What is the remainder when 936 is divided by 21? 12 Calculate the remainder when 511 is divided by 91. 56 Calculate the remainder when 13963 is divided by 147. 145 Calculate the remainder when 245 is divided by 69. 38 What is the remainder when 2035 is divided by 9? 1 Calculate the remainder when 890 is divided by 230. 200 What is the remainder when 746 is divided by 58? 50 Calculate the remainder when 2498 is divided by 25. 23 Calculate the remainder when 107 is divided by 32. 11 Calculate the remainder when 421 is divided by 132. 25 What is the remainder when 114 is divided by 24? 18 Calculate the remainder when 294 is divided by 288. 6 Calculate the remainder when 758 is divided by 309. 140 What is the remainder when 207 is divided by 77? 53 What is the remainder when 60 is divided by 13? 8 Calculate the remainder when 300 is divided by 109. 82 What is the remainder when 356 is divided by 44? 4 What is the remainder when 6 is divided by 4? 2 What is the remainder when 1477 is divided by 37? 34 What is the remainder when 1036 is divided by 251? 32 What is the remainder when 8265 is divided by 39? 36 Calculate the remainder when 118 is divided by 66. 52 Calculate the remainder when 936 is divided by 310. 6 What is the remainder when 418 is divided by 84? 82 What is the remainder when 1542 is divided by 34? 12 Calculate the remainder when 1829 is divided by 115. 104 Calculate the remainder when 47 is divided by 28. 19 Calculate the remainder when 1173 is divided by 38. 33 Calculate the remainder when 1366 is divided by 72. 70 What is the remainder when 1930 is divided by 121? 115 What is the remainder when 1559 is divided by 13? 12 What is the remainder when 636 is divided by 91? 90 Calculate the remainder when 21 is divided by 5. 1 What is the remainder when 232 is divided by 93? 46 What is the remainder when 65 is divided by 26? 13 Calculate the remainder when 1527 is divided by 85. 82 Calculate the remainder when 135 is divided by 18. 9 What is the remainder when 23373 is divided by 16? 13 What is the remainder when 39 is divided by 26? 13 What is the remainder when 119 is divided by 92? 27 What is the remainder when 1785 is divided by 294? 21 What is the remainder when 7134 is divided by 2372? 18 What is the remainder when 317 is divided by 108? 101 What is the remainder when 1453 is divided by 44? 1 Calculate the remainder when 109 is divided by 28. 25 Calculate the remainder when 472 is divided by 48. 40 Calculate the remainder when 2902 is divided by 481. 16 What is the remainder when 29 is divided by 9? 2 What is the remainder when 1428 is divided by 65? 63 Calculate the remainder when 172 is divided by 94. 78 What is the remainder when 260 is divided by 33? 29 Calculate the remainder when 201 is divided by 17. 14 Calculate the remainder when 76 is divided by 39. 37 Calculate the remainder when 2071 is divided by 104. 95 What is the remainder when 57 is divided by 15? 12 Calculate the remainder when 2364 is divided by 782. 18 Calculate the remainder when 401 is divided by 174. 53 Calculate the remainder when 658 is divided by 16. 2 What is the remainder when 559 is divided by 72? 55 What is the remainder when 22 is divided by 7? 1 What is the remainder when 169 is divided by 46? 31 What is the remainder when 6079 is divided by 64? 63 Calculate the remainder when 85 is divided by 26. 7 What is the remainder when 129 is divided by 36? 21 Calculate the remainder when 191 is divided by 87. 17 Calculate the remainder when 431 is divided by 123. 62 Calculate the remainder when 552 is divided by 139. 135 What is the remainder when 142 is divided by 33? 10 Calculate the remainder when 489 is divided by 14. 13 Calculate the remainder when 45 is divided by 29. 16 Calculate the remainder when 191 is divided by 47. 3 What is the remainder when 1461 is divided by 3? 0 Calculate the remainder when 135 is divided by 17. 16 What is the remainder when 679 is divided by 166? 15 What is the remainder when 157 is divided by 10? 7 Calculate the remainder when 69 is divided by 18. 15 What is the remainder when 115 is divided by 37? 4 What is the remainder when 45 is divided by 8? 5 Calculate the remainder when 33 is divided by 5. 3 What is the remainder when 1602 is divided by 528? 18 What is the remainder when 119 is divided by 57? 5 Calculate the remainder when 2848 is divided by 30. 28 What is the remainder when 81 is divided by 31? 19 What is the remainder when 767 is divided by 182? 39 What is the remainder when 467 is divided by 143? 38 What is the remainder when 183 is divided by 95? 88 Calculate the remainder when 48 is divided by 9. 3 Calculate the remainder when 960 is divided by 41. 17 What is the remainder when 12115 is divided by 60? 55 What is the remainder when 2578 is divided by 216? 202 What is the remainder when 9511 is divided by 432? 7 Calculate the remainder when 344 is divided by 14. 8 What is the remainder when 69 is divided by 10? 9 What is the remainder when 63 is divided by 22? 19 What is the remainder when 907 is divided by 27? 16 What is the remainder when 60 is divided by 25? 10 What is the remainder when 40 is divided by 8? 0 What is the remainder when 423 is divided by 108? 99 What is the remainder when 418 is divided by 103? 6 Calculate the remainder when 50 is divided by 27. 23 What is the remainder when 1162 is divided by 572? 18 W	{ "pile_set_name": "DM Mathematics" }
f 253777180 and 10? 10 What is the highest common factor of 847 and 11585497? 77 Calculate the highest common factor of 139 and 217432557. 139 What is the greatest common factor of 70130841 and 69? 69 What is the highest common factor of 14766 and 167660547? 7383 Calculate the greatest common divisor of 74 and 82680422. 74 What is the greatest common factor of 282812332 and 1808? 452 Calculate the highest common divisor of 112816 and 140096. 176 Calculate the greatest common factor of 74290 and 66891590. 4370 What is the greatest common factor of 744 and 103783908? 372 Calculate the highest common divisor of 4693 and 24688638. 247 What is the greatest common divisor of 918 and 2399193? 459 Calculate the highest common divisor of 18480649 and 5291. 407 What is the greatest common divisor of 1305 and 8295740? 145 Calculate the greatest common divisor of 50695 and 255. 5 Calculate the highest common divisor of 5870390 and 575390. 3530 Calculate the greatest common divisor of 6984 and 68904. 72 What is the greatest common divisor of 1298 and 174966? 22 What is the greatest common factor of 285885 and 720? 45 What is the greatest common divisor of 3185 and 7675213? 637 Calculate the greatest common divisor of 4 and 454278588. 4 What is the greatest common divisor of 290833875 and 13770? 2295 What is the greatest common factor of 89850405 and 120? 15 Calculate the highest common factor of 630 and 38895381. 63 Calculate the highest common factor of 18 and 8394579. 9 What is the highest common factor of 13509 and 1954539? 711 What is the highest common divisor of 381632 and 12115744? 2144 What is the greatest common factor of 102 and 74732646? 102 What is the highest common factor of 22689 and 44775? 9 Calculate the greatest common divisor of 24855884 and 6304. 788 Calculate the highest common factor of 14237 and 142462. 23 Calculate the highest common divisor of 62445 and 67505. 115 Calculate the highest common factor of 4268438 and 129. 43 Calculate the greatest common divisor of 4372755 and 475. 95 Calculate the greatest common divisor of 3659432 and 566125. 4529 Calculate the highest common factor of 20 and 9956460. 20 Calculate the highest common divisor of 54 and 4073463. 27 Calculate the highest common divisor of 69641 and 13637461. 487 What is the greatest common factor of 5426348 and 2124? 236 Calculate the highest common divisor of 1302587 and 1287. 143 Calculate the highest common divisor of 96 and 5906568. 24 What is the highest common divisor of 110 and 30361665? 5 Calculate the highest common divisor of 532646 and 95630. 262 Calculate the greatest common divisor of 57 and 3935691. 3 What is the greatest common factor of 7533 and 1855164? 93 Calculate the greatest common divisor of 880175 and 2403450. 2725 What is the greatest common divisor of 33274925 and 725? 25 What is the greatest common divisor of 529576 and 3320? 8 What is the greatest common factor of 124268 and 534108? 188 Calculate the highest common factor of 994 and 603571. 71 Calculate the highest common factor of 20585 and 200. 5 Calculate the highest common divisor of 1173 and 22508. 17 What is the highest common factor of 21207 and 12912? 3 What is the highest common factor of 156 and 39677079? 39 What is the greatest common divisor of 55 and 142296935? 55 What is the highest common divisor of 43809012 and 13? 13 Calculate the greatest common factor of 780 and 281730. 30 What is the greatest common factor of 45158 and 397660? 674 What is the highest common divisor of 34165539 and 747? 747 What is the greatest common factor of 390420 and 55430? 2410 Calculate the highest common divisor of 3468 and 12509943. 867 Calculate the greatest common divisor of 666 and 1644369318. 666 Calculate the greatest common divisor of 794 and 10591166. 794 What is the greatest common factor of 147 and 294666? 3 What is the highest common divisor of 110662333 and 1? 1 What is the greatest common factor of 1547097 and 258? 129 What is the highest common divisor of 5152 and 288883? 7 What is the greatest common divisor of 514842 and 18285? 159 Calculate the greatest common divisor of 179857125 and 270. 135 What is the greatest common factor of 261229428 and 108? 108 Calculate the highest common divisor of 8534440 and 160. 40 What is the greatest common factor of 5663798 and 14? 14 Calculate the greatest common divisor of 28712 and 217240. 8 Calculate the greatest common divisor of 39191712 and 672. 672 Calculate the highest common divisor of 3360 and 844185. 15 What is the highest common divisor of 2596 and 24077428? 236 Calculate the highest common factor of 43534052 and 8. 4 What is the highest common divisor of 11987244 and 867? 51 What is the greatest common divisor of 14801 and 79294? 41 What is the highest common factor of 13177945 and 1310? 655 Calculate the greatest common factor of 33033 and 429195228. 2541 What is the highest common factor of 63 and 4571553? 21 What is the greatest common factor of 592 and 2807560? 296 Calculate the greatest common factor of 128304 and 137016. 792 What is the highest common factor of 1740 and 4011420? 60 Calculate the greatest common factor of 598969 and 7749. 287 Calculate the highest common factor of 84660 and 23572. 332 Calculate the highest common factor of 7764 and 639018608. 2588 Calculate the greatest common divisor of 403430 and 120. 10 Calculate the greatest common divisor of 464 and 135968588. 116 What is the highest common factor of 55494 and 3546? 18 What is the greatest common divisor of 188 and 6528441? 47 What is the highest common divisor of 11190501 and 2268? 189 What is the highest common divisor of 48 and 409236024? 24 What is the highest common divisor of 1107 and 31670491? 41 What is the highest common divisor of 7 and 129872? 1 Calculate the greatest common factor of 33422 and 34816. 34 Calculate the highest common divisor of 5589 and 476523. 243 What is the greatest common divisor of 270 and 6992410? 10 Calculate the highest common factor of 513 and 400011237. 513 Calculate the highest common divisor of 800 and 129720. 40 Calculate the highest common divisor of 837942 and 294. 42 Calculate the greatest common factor of 606963504 and 2672. 2672 Calculate the highest common divisor of 103920 and 6000. 240 Calculate the greatest common divisor of 10722116 and 12188. 1108 Calculate the highest common divisor of 3175660 and 2135. 305 Calculate the greatest common divisor of 885385 and 6555. 115 Calculate the highest common divisor of 1489 and 38127. 1 What is the greatest common factor of 11871 and 23661541? 1319 What is the highest common factor of 17297823 and 51? 51 Calculate the highest common factor of 7572796 and 111188. 308 Calculate the highest common factor of 204 and 292587. 51 What is the highest common factor of 3195 and 2352150? 45 What is the highest common factor of 61294 and 62795? 19 What is the highest common factor of 517440 and 10824? 264 What is the greatest common factor of 358622 and 3014? 22 Calculate the greatest common factor of 3487903 and 118. 59 Calculate the greatest common divisor of 7802891 and 127225. 727 What is the greatest common factor of 26860813 and 133? 133 What is the highest common divisor of 81004 and 187572? 308 Calculate the greatest common factor of 12300 and 66453900. 300 What is the highest common factor of 385231 and 83083? 77 Calculate the greatest common divisor of 1107 and 4175973. 369 Calculate the highest common factor of 148548088 and 332. 332 Calculate the greatest common factor of 11012 and 1089962254. 5506 Calculate the highest common factor of 316920460 and 2890. 170 Calculate the greatest common factor of 4060 and 99380. 20 Calculate the greatest common factor of 3346 and 1116836. 14 Calculate the highest common factor of 602291424 and 2471. 2471 Calculate the highest common factor of 155 and 3543769960. 155 Calculate the greatest common divisor of 18029974 and 1349. 19 Calculate the highest common factor of 5445 and 1291002240. 1815 What is the highest common factor of 10112 and 31902412? 316 What is the greatest common factor of 13086472 and 112? 56 What is the greatest common divisor of 3306943632 and 816? 816 What is the greatest common divisor of 11260425 and 61050?	{ "pile_set_name": "DM Mathematics" }
3, -760 in decreasing order. 108, 3, -2, -760 Put -4, -9, -5, 74 in decreasing order. 74, -4, -5, -9 Put 3, 6, 2, -6, -2, -60 in decreasing order. 6, 3, 2, -2, -6, -60 Put -7, -2, 6.2, 17, 6 in decreasing order. 17, 6.2, 6, -2, -7 Put 1, 6, 0.024, 14, -4, -1 in ascending order. -4, -1, 0.024, 1, 6, 14 Put -3/8, -81, 1/3 in descending order. 1/3, -3/8, -81 Put -397440, -0.4, 0.2 in ascending order. -397440, -0.4, 0.2 Sort 16, 3, 0, -6, 5 in increasing order. -6, 0, 3, 5, 16 Sort -4/3, -25, -6, -0.04, 0 in descending order. 0, -0.04, -4/3, -6, -25 Put 20, 45, 17 in ascending order. 17, 20, 45 Put 1/8, -0.277, 2/3, 4, 1/6, -0.2 in increasing order. -0.277, -0.2, 1/8, 1/6, 2/3, 4 Put -1, 147, -3, 5, -29 in descending order. 147, 5, -1, -3, -29 Sort -138, 5, 25, -2, -4. -138, -4, -2, 5, 25 Sort -0.2, -1/2, 2, -3, -1012 in increasing order. -1012, -3, -1/2, -0.2, 2 Sort 5, -553, -3, -35 in decreasing order. 5, -3, -35, -553 Sort -2, 0, -51, -10, -1. -51, -10, -2, -1, 0 Put 1, 2, 15, 0, -257 in ascending order. -257, 0, 1, 2, 15 Sort 6, 4, 1, -1, 0, 12 in decreasing order. 12, 6, 4, 1, 0, -1 Sort 0, 1, -9212 in increasing order. -9212, 0, 1 Put -1246, 6, -5 in ascending order. -1246, -5, 6 Sort -5, 6, 1096, 0. -5, 0, 6, 1096 Sort 4117, -4, 34 in descending order. 4117, 34, -4 Put 3020, -24, -4, 3 in descending order. 3020, 3, -4, -24 Sort 8/43, 10, 1/3, -0.4, 0.4, 5 in increasing order. -0.4, 8/43, 1/3, 0.4, 5, 10 Put -13, 4, 5, 21, 743 in decreasing order. 743, 21, 5, 4, -13 Put -0.08, -7, -0.5, 4, 3, -7/8 in descending order. 4, 3, -0.08, -0.5, -7/8, -7 Sort -4, 31832, 0 in increasing order. -4, 0, 31832 Sort -80, -52, 2, -1, 5, -4. -80, -52, -4, -1, 2, 5 Put 8, 2, 3, -33, -5 in decreasing order. 8, 3, 2, -5, -33 Sort 13, -3, -1, -12, 4, 0.55. -12, -3, -1, 0.55, 4, 13 Sort -1, 6, 2247, -5, 0 in decreasing order. 2247, 6, 0, -1, -5 Put 2220, 4, -28, 2 in ascending order. -28, 2, 4, 2220 Sort 4, 17, 33, 5, -5 in descending order. 33, 17, 5, 4, -5 Put -172, -10, -0.2 in increasing order. -172, -10, -0.2 Put 1.3, -0.0601, -1 in decreasing order. 1.3, -0.0601, -1 Put 0, -6, 2604 in descending order. 2604, 0, -6 Sort -2226, -4, -1, -5. -2226, -5, -4, -1 Put -5, 0, 1828, 3 in decreasing order. 1828, 3, 0, -5 Sort -341, 0, -1/15, 3 in descending order. 3, 0, -1/15, -341 Sort -1, 4, 2, -1503, 1 in ascending order. -1503, -1, 1, 2, 4 Put 1, -4, -88, 4, -17 in descending order. 4, 1, -4, -17, -88 Sort -9/10, 4629, 0, 2/5, -2/7 in descending order. 4629, 2/5, 0, -2/7, -9/10 Sort 10, 16, 6, -0.2, -2/7, 0 in descending order. 16, 10, 6, 0, -0.2, -2/7 Sort -506, 0.6, 1 in descending order. 1, 0.6, -506 Put -48871, 1, 5, -3 in ascending order. -48871, -3, 1, 5 Sort -176, -0.3, 1/13, 78 in ascending order. -176, -0.3, 1/13, 78 Put 2/11, -15/4, -5, -0.03 in descending order. 2/11, -0.03, -15/4, -5 Sort -0.2, -4/15, 2, 533 in descending order. 533, 2, -0.2, -4/15 Sort 0, -21, -3013 in descending order. 0, -21, -3013 Sort 0, 88930, 4 in descending order. 88930, 4, 0 Put 0.1, 2, -2, -4, -0.18 in decreasing order. 2, 0.1, -0.18, -2, -4 Sort 0, 5, -20, 1, -5, -4. -20, -5, -4, 0, 1, 5 Sort 0.5, -19, -1, 2/3, 1, -0.039 in descending order. 1, 2/3, 0.5, -0.039, -1, -19 Sort 943, -1, 18, 0 in descending order. 943, 18, 0, -1 Sort -2/7, 4, -7, -128, -100. -128, -100, -7, -2/7, 4 Put 1/2, -2/9, -1, -128, -0.07 in decreasing order. 1/2, -0.07, -2/9, -1, -128 Put 4, -1, 26545 in ascending order. -1, 4, 26545 Sort 3, 0, -114, -5 in ascending order. -114, -5, 0, 3 Put -4, 1455, 3, 5 in descending order. 1455, 5, 3, -4 Sort 1, 384, -4, 5, -5 in descending order. 384, 5, 1, -4, -5 Sort -2, -0.6, 2, 4/3, -1.6 in ascending order. -2, -1.6, -0.6, 4/3, 2 Put -7/30, 5, 2/7, 1, -36 in decreasing order. 5, 1, 2/7, -7/30, -36 Put -2, -674, 5, 1 in decreasing order. 5, 1, -2, -674 Sort -0.1, -4, -10/3, 5, 830 in descending order. 830, 5, -0.1, -10/3, -4 Sort -65, 456, 0, -3. -65, -3, 0, 456 Put 4/7, 4, 1/4800 in decreasing order. 4, 4/7, 1/4800 Sort -82, 2, -70 in decreasing order. 2, -70, -82 Put 308, 40, -1/2 in decreasing order. 308, 40, -1/2 Sort 6, 20, -1, -30. -30, -1, 6, 20 Put 389, -0.3, 6/11, -16 in ascending order. -16, -0.3, 6/11, 389 Put -2, 1, -1543, -0.3 in descending order. 1, -0.3, -2, -1543 Sort -2, -4, -3662, 1/3 in descending order. 1/3, -2, -4, -3662 Sort -12, 1, -1/5, -1, 0.089 in descending order. 1, 0.089, -1/5, -1, -12 Put 0, -38, 2142 in descending order. 2142, 0, -38 Sort 18, 0, -21, -4, 4, 0.002 in descending order. 18, 4, 0.002, 0, -4, -21 Put 1, -903, 2, 134, 3 in decreasing order. 134, 3, 2, 1, -903 Sort 0.249, -0.4, -2/25, -2, 2/11. -2, -0.4, -2/25, 2/11, 0.249 Sort -2, -26, -3, -5, -15. -26, -15, -5, -3, -2 Put -5, -16, 0, 880, 5 in increasing order. -16, -5, 0, 5, 880 Put -15, 0, -1, -5, 2161 in decreasing order. 2161, 0, -1, -5, -15 Sort 0, -5, 2, -10, 5 in descending order. 5, 2, 0, -5, -10 Sort -111, -371, 3, -5. -371, -111, -5, 3 Put -0.1, 202, -1, -3 in increasing order. -3, -1, -0.1, 202 Sort 0.5, -1.2, -1/2, 2, -19/4, 6.3 in decreasing order. 6.3, 2, 0.5, -1/2, -1.2, -19/4 Put -116, 3, 6, -5, -2 in decreasing order. 6, 3, -2, -5, -116 Put -1, 49/218, 1/7 in descending order. 49/218, 1/7, -1 Sort 6, 1, 4, -10, -1 in decreasing order. 6, 4, 1, -1, -10 Put 7, -3006, -5 in descending order. 7, -5, -3006 Sort 5, -1, 0.1, 195.48 in descending order. 195.48, 5, 0.1, -1 Put -0.02, -28, 0.1, 1, 14/27 in descending order. 1, 14/27, 0.1, -0.02, -28 Sort 344/7, 2/135, 0.4, 0.2 in descending order. 344/7, 0.4, 0.2, 2/135 Sort 2, -5, 0, -1, 290. -5, -1, 0, 2, 290 Put 2, 25, 8, -545 in ascending order. -545, 2, 8, 25 Put -1/6, -2, -3, 1536, -1 in increasing order. -3, -2, -1, -1/6, 1536 Put 3/7, 1/10, 1, -147645 in increasing order. -147645, 1/10, 3/7, 1 Sort -3, 5, -1659, -5, -4 in descending order. 5, -3, -4, -5, -1659 Sort 4, -2, -3, -1, 48300, 2. -3, -2, -1, 2, 4, 48300 Put 7, -2, 55, 0, 1 in increasing order. -2, 0, 1, 7, 55 Put -1, -0.33261, 13 in descending order. 13, -0.33261, -1 Sort -1/6, -2, 10, -0.2, 5 in decreasing order. 10, 5, -1/6, -0.2, -2 Sort -49663, -21, 3, -1 in decreasing order. 3, -1, -21, -49663 Put -3, -13930, 5, 1 in ascending order. -13930, -3, 1, 5 Sort 724, -0.2, -1/8, -3/2, -5 in decreasing order. 724, -1/8, -0.2, -3/2, -5 Put -12/5, -0.1, -20.37 in ascending order. -20.37, -12/5, -0.1 Sort 3, -5, -2, 28, 13434 in decreasing order. 13434, 28, 3, -2, -5 Put 0.5, 14, 1763 in decreasing order. 1763, 14, 0.5 Sort 0.1, 3, -52/9, -1, 9/5, -2/5 in ascending order. -52/9, -1, -2/5, 0.1, 9/5, 3 Sort 53, -1, -5, -4, -2, 4 in ascending order. -5, -4, -2, -1, 4, 53 Sort -56, 0, -7, -4 in increasing order. -56, -7, -4, 0 Sort 378589/4, 0.2, -1/4 in increasing order. -1/4, 0.2, 378589/4 Sort -2, 0, -193515 in increasing order. -193515, -2, 0 Sort 717, 73, -1, -3 in decreasing order. 717, 73, -1, -3 Put 9, 7, -3/4, 2/13, 0.2, -5/4 in descending order. 9, 7, 0.2, 2/13, -3/4, -5/4 Put 4, -2, 359013 in ascending order. -2, 4, 359013 Sort -3, 4, -15302 in descending order. 4, -3, -15302 Put -1/13, 2/5, 1, -8/11, -71 in ascending order. -71, -8/11, -1/13, 2/5, 1 Sort 380, -223, -0.4, -1 in decreasing order. 380, -0.4, -1, -223 Put 0.4, 5, -1176.5 in ascending order. -1176.5, 0.4, 5 Put 37, 1, 14.1, 2 in ascending order. 1, 2, 14.1, 37 Sort -9, 75, -5, 20, 2, -1. -9, -5, -1, 2, 20, 75 Sort -3, -665, 3 in descending order. 3, -3, -665 Sort 1/3, 30, -0.5, -3, -19, -2/93 in decreasing order. 30, 1/3, -2/93, -0.5, -3, -19 Sort 1/4, -3, -0.6, -2.7, 5 in ascending order. -3, -2.7, -0.6, 1/4, 5 Sort -3, 2/9, 0.788, -0.4. -3, -0.4, 2/9, 0.788 Put -2, 10, 4, 71, -35, -1 in decreasing order. 71, 10, 4, -1, -2, -35 Sort 27, 365, -2, 5 in descending order. 365, 27, 5, -2 Sort 4, 2274, -3 in decreasing order. 2274, 4, -3 Sort -19, 749, 3 in descending order. 749, 3, -19 Sort -1, 397, 3, -7 in increasing order. -7, -1, 3, 397 Sort -0.08, -2, -44 in decreasing order. -0.08, -2, -44 Put -2/5, 0, 28, -1.8 in decreasing order. 28, 0, -2/5, -1.8 Put -10/9, 0.02, 0.5, 1, 2/19, -4 in increasing order. -4, -10/9, 0.02, 2/19, 0.5, 1 Sort -6, 5, -19, -13, -4 in descending order. 5, -4, -6, -13, -19 Sort 3, 1/1611, 29, -1 in descending order. 29, 3, 1/1611, -1 Sort 1, -2/9, 0.0	{ "pile_set_name": "DM Mathematics" }
(y) = -4n(y) - 5w(y). Let m(t) = 0. Calculate t. -1, 1 Let q(v) be the second derivative of -3v7/56 + v6/10 + 3v5/80 - v4/8 - 6v. Factor q(h). -3h*2(h - 1)*2(3h + 2)/4 Let y(k) be the second derivative of -k4/14 - k3/14 + 3k*2/14 + 11k. Determine c, given that y(c) = 0. -1, 1/2 Let v(m) be the first derivative of 0m + 6 - 5/3m3 - m2. Factor v(s). -s(5s + 2) Factor -2 - 818w2 + 823w*2 + 12 - 15w. 5(w - 2)(w - 1) Let w = -19 - -18. Let g(h) = -2h2 + 4h - 6. Let q(o) = -o*2 + o - 1. Let c(d) = wg(d) + 4q(d). Factor c(b). -2(b - 1)(b + 1) Let y = 223 + -386. Let p = 493/3 + y. Let 0 + 2/3b*2 + pb = 0. What is b? -2, 0 Let z be ((-4)/5)/((-10)/25). Suppose -zt - 2s = 7 - 3, 4t + 4 = -2s. Factor 1/4d2 + t + 1/4d. d(d + 1)/4 What is d in 50d3 - d + d2 - d - 49d3 = 0? -2, 0, 1 Let 28 - 36d + 150d4 - 174d*2 + 63d*5 + 4 - 8 - 27d3 = 0. Calculate d. -2, -1, -2/3, 2/7, 1 Let d(l) be the first derivative of l4/8 - 3l2/4 + l + 1. Factor d(r). (r - 1)2(r + 2)/2 Let h(z) = z - 1. Let p(f) be the second derivative of f6/15 + f5/10 + f*3/2 - 3f*2/2 - 2f. Let a(j) = 3h(j) - p(j). Determine r so that a(r) = 0. -1, 0 Suppose -8 = -2h - 2. Let z(a) be the second derivative of a + 0a2 + 0 + 1/9a*h - 1/18a*4. Factor z(s). -2s(s - 1)/3 Let n(m) = -6m*4 + 5m*3 - 4m*2 - m + 3. Let j(z) = 25z*4 - 20z*3 + 17z*2 + 4z - 13. Let k(c) = 6j(c) + 26n(c). Factor k(y). -2y(y - 1)*2(3y + 1) Let h(v) be the third derivative of v6/30 - v5/15 - 5v*4/6 - 2v*3 - 6v*2. Factor h(o). 4(o - 3)(o + 1)2 Solve 4g*2 - 6g*4 - 44g*4 - 14g*4 + 64g*3 - 4g = 0. -1/4, 0, 1/4, 1 Let y(p) be the second derivative of 0 + 0p3 + 1/40p*5 + 3p + 0p2 - 1/48p*4 - 1/120p*6. Let y(n) = 0. What is n? 0, 1 Let l(c) = -9c3 + c2 - c - 3. Suppose 2t - 8 = -2. Let m(j) = 3j*2 - 9j3 - 5 - j + jt - 9j3. Let s(r) = -5l(r) + 3m(r). Factor s(x). -2x(x - 1)(3x + 1) Suppose -5j + 0j = -3j. Factor 0z + 1/2z*3 - 1/2z*2 + j - 1/2z*5 + 1/2z4. -z2(z - 1)2(z + 1)/2 Let j(h) = 5 + 2 + h - h*3 + 3 - 2h2 - 3. Let r(s) = -s3 - s*2 + s + 3. Let l(n) = 4j(n) - 10r(n). Suppose l(a) = 0. What is a? -1, -1/3, 1 Solve -8/5j*3 + 12/5j*2 - 8/5j + 2/5j4 + 2/5 = 0. 1 Let h(w) be the first derivative of w4/14 + 2w*3/7 + 2w*2/7 - 16. Let h(x) = 0. What is x? -2, -1, 0 Let n be 0/42/(-4). Let f(x) be the first derivative of 0x - 2 + nx*2 + 2/27x*3 + 2/45x*5 + 1/9x*4. Suppose f(k) = 0. What is k? -1, 0 Let g be (-3)/(-12) + 60/16. Factor -3d + 8 - 3d + 2d*2 - g. 2(d - 2)(d - 1) Let c = -113134/237 - -1432/3. Let h = 87/316 + c. Factor 0 - 1/4v*2 + 0v - 1/4v3 + hv*4 + 1/4v5. v2(v - 1)(v + 1)2/4 Let g(c) be the third derivative of -c8/1008 + 4c7/315 - 5c*6/72 + 19c*5/90 - 7c*4/18 + 4c*3/9 - 15c2. What is j in g(j) = 0? 1, 2 Let g(y) = -y2 - 4y - 2. Let q be g(-2). Factor qm*5 + 1/2m*3 + 0m*2 + 5/2m*4 + 0 + 0m. m*3(m + 1)(4m + 1)/2 What is k in -4k5 - 8k - k*2 + 4k*4 - 103k*3 + 115k*3 - 3k*2 = 0? -1, 0, 1, 2 Suppose -8r + 18r = 0. Factor -4/5h*2 + 16/5h*3 + r + 0h - 12/5h4. -4h*2(h - 1)(3h - 1)/5 Let v be 6 + (1 - 9) - (-18)/5. Solve vn - 14/5n*4 + 8/5 + 52/5n*3 - 54/5n*2 = 0 for n. -2/7, 1, 2 Let l(o) be the second derivative of -3/70o*7 + 1/100o*5 - 1/60o*4 + 0o*3 + 0 + 3o + 3/50o6 + 0o2. Solve l(q) = 0 for q. -1/3, 0, 1/3, 1 Let c(k) be the third derivative of k5/15 + k*2. Find p, given that c(p) = 0. 0 Let a(h) = -5h*2 + 2h + 6. Let l(u) = 13u2 - 7u - 18. Let p(b) = 8a(b) + 3l(b). Factor p(i). -(i + 2)(i + 3) Let t(w) = -3w + 15. Let f be t(5). Factor f + 2/9c2 - 4/9c*3 + 2/9c*4 + 0c. 2c2(c - 1)2/9 Let o(h) be the third derivative of h8/1680 - 4h7/525 + 2h*6/75 - 4h2. Factor o(x). x3(x - 4)2/5 Find k, given that 4/3 + 26/3k*2 + 10k = 0. -1, -2/13 Let d(m) be the first derivative of -m3/15 + m2/10 + 2m/5 - 16. Factor d(r). -(r - 2)(r + 1)/5 Let y(p) be the second derivative of -1/15p4 + 0p*2 - 3p + 0 + 1/15p3 + 1/50p*5. Factor y(z). 2z(z - 1)2/5 Suppose -3l - f = -5, l - 4 = -f - 5. Solve 6/13 - 8/13i - 4/13i*2 + 8/13i*l - 2/13i*4 = 0. -1, 1, 3 Let j = 177 - 177. Factor jp*2 + 2/5p - 2/5p3 + 0. -2p(p - 1)(p + 1)/5 Let r = 95 + -92. Factor 0b + 6b*2 + 0 - 36b*r + 105/2b*4. 3b*2(5b - 2)(7b - 2)/2 Let q = -16 + 20. Let k(h) be the first derivative of -h2 - 2/3h*3 + qh + 2. Factor k(f). -2(f - 1)(f + 2) Let a(v) be the first derivative of -16v6/15 - 16v*5/25 + 7v*4/10 - 2v*3/15 + 10. Suppose a(f) = 0. Calculate f. -1, 0, 1/4 Let t be (6/6 - -3) + -2. Factor 4/5x - 4/5x3 + 0x*t + 2/5x*4 - 2/5. 2(x - 1)*3(x + 1)/5 Suppose -k - 2m = 7, 3k + 2m - 4 = -5. Factor 1/2p*k - 1/2p*2 + 0 + 0p. p*2(p - 1)/2 Let i(g) be the first derivative of -g*5/35 - 5g*4/28 - 2g*3/7 + 2g*2/7 + 8g/7 + 4. Factor i(f). -(f - 1)(f + 2)3/7 Let c be 3/1(-12)/(-18). Determine s so that 2/7s - 4/7 + 4/7s*c - 2/7s*3 = 0. -1, 1, 2 Let d(f) be the third derivative of 0f + 1/60f6 + 3f*2 + 0f*3 + 0 + 1/30f*5 - 1/6f*4. Determine p, given that d(p) = 0. -2, 0, 1 What is z in 0 + 0z*2 + 1/3z*3 + 0z = 0? 0 Let w(y) = -1 + 0 + 2 + 17y2 - y - 9y*4 - 4y3 + y4. Let j(l) = 4l4 + 2l*3 - 8l*2. Let p(h) = -5j(h) - 2w(h). What is q in p(q) = 0? -1, 1/2, 1 Find h, given that 1/2h + 9/4h3 + 0 + 7/4h*2 + 5/4h*4 + 1/4h*5 = 0. -2, -1, 0 Factor -4/3 - 1/3o*2 + 4/3o. -(o - 2)*2/3 Let t(b) be the third derivative of -7b*8/120 + 2b7/15 + b6/100 - 2b5/15 - b4/15 - 13b*2. Factor t(j). -2j(j - 1)2(7j + 2)2/5 Let v(f) be the third derivative of f6/40 + 2f5/105 - f4/42 - 2f2. What is q in v(q) = 0? -2/3, 0, 2/7 Let q(i) be the third derivative of i7/735 + i6/210 - i4/42 - i3/21 + 12i*2. Determine c so that q(c) = 0. -1, 1 Let m(c) be the second derivative of 3c - 1/2c2 + 0 - 1/12c*4 - 1/3c*3. Find r such that m(r) = 0. -1 Suppose 1/6k*2 + 0 + 0k = 0. Calculate k. 0 Find o such that -21/8o5 + 27/8o*3 - 3/4o + 15/8o4 - 15/8o2 + 0 = 0. -1, -2/7, 0, 1 Let h = -6 + 9. Let k2 - 3kh - 3 - k2 - 3 + 9k = 0. What is k? -2, 1 Let x(d) be the first derivative of d*3/24 - d/2 + 19. Factor x(z). (z - 2)(z + 2)/8 Let j be (0/(-43))/((-2)/1). Let i(k) be the second derivative of jk2 + 0 + 1/50k*5 + 4k + 0k4 - 1/15k*3. Factor i(p). 2p(p - 1)(p + 1)/5 Factor 21/4h + 3/2h*3 - 3/4h*5 - 3/2h*4 + 6h*2 + 3/2. -3(h - 2)(h + 1)4/4 Factor -4x*2 - 13x*3 + 4x*3 + 2x*4 + 7x*3. 2x*2(x - 2)(x + 1) Let o(x) = x3 - 3x*2 + 3x + 3. Let t(c) = -3c2 + 3c + 3. Let k(n) = -3o(n) + 4t(n). Factor k(i). -3(i - 1)(i + 1)*2 Let d(l) = 2l*2 + 8l - 16. Let c(w) = -11w2 - 48w + 96. Let i(s) = 4s2 - 2s + 4. Let f be i(3). Let o(a) = fd(a) + 6c(a). Solve o(m) = 0 for m. 4 Let h(z) be the third derivative of z8/84 - z6/6 + 2z4/3 - z2. What is l in h(l) = 0? -2, -1, 0, 1, 2 Let h(j) = -8 - 2j + j*2 + 9 - 3j2 - j3. Let v be h(-2). Factor -1/2tv + 1/2t*2 + 3/2t*4 + 0 + 0t - 3/2t3. -t2(t - 1)3/2 Let d(r) be the first derivative of -r4/2 + 2r3 - 8r - 4. Suppose d(v) = 0. What is v? -1, 2 Let h(d) be the third derivative of 2d7/735 - d6/210 - 2d*5/105 - 7d*2. Factor h(u). 4u*2(u - 2)(u + 1)/7 Suppose m = 4 + 5. Factor -2 + 8r*2 + 10r - 10r2 + mr*3 - 14r2 - r3. 2(r - 1)(2r - 1)2 Let h(s) be the first derivative of 49s*4 - 112s*3/3 + 8s*2 + 18. Solve h(y) = 0. 0, 2/7 Let y = 287/5 - 57. Let q(w) be the first derivative of -1/2w*6 - 1/2w*2 - yw*5 + 2/3w*3 + 0w + w*4 + 3. Let q(j) = 0. Calculate j. -1, 0, 1/3, 1 Let q = -6 - -15. Let i be ((-15)/q)/(3/(-9)). Factor 2g5 - gi + 2g3 - 2g*5 - g. -g(g - 1)*2(g + 1)*2 Let x be -3(-51)/(-36) - (-7 + 2). Suppose 0 + 0d - 1/4d*5 + 3/4d*4 - xd*3 + 1/4d*2 = 0. Calculate d. 0, 1 Let f be 2/6 + 10/6. Suppose -2k = 5w, -fw + 0k + 3k = 0. Factor	{ "pile_set_name": "DM Mathematics" }
nd derivative of 3qp + 3q*2 - 2q*2 + q - 6q*2 wrt q. -4 What is the second derivative of -12r*3 + 6r*3 - 6r*3 - 4r wrt r? -72r Let p(z) be the second derivative of 0 + 4z + 3/2z2 + 0z*3 + 1/4z*4. Find the first derivative of p(w) wrt w. 6w Let x(p) be the third derivative of -6p7/35 + 13p*5/60 - 21p*2. What is the third derivative of x(r) wrt r? -864r Let k = -26 + 36. Suppose 3w + 4h + k = 2w, -2h = -5w + 16. Find the second derivative of 0f - 5f2 + 2f + 2fw wrt f. -6 Let z(m) be the second derivative of -m6/180 - m4/4 - m3 - m. Let d(c) be the second derivative of z(c). Differentiate d(a) wrt a. -4a Let x(u) = 7u5 - 5u*4 + 5u*2 - 15u. Let w(z) = -3z5 + 3z*4 - 3z*2 + 8z. Let o(v) = 5w(v) + 3x(v). What is the second derivative of o(q) wrt q? 120q3 Suppose -2m + 47 + 2 = 3s, -2m + 50 = 2s. Let r be 4/m + (-120)/(-65). Find the second derivative of 3y*2 - 2y - 4yr - y2 wrt y. -4 Let n(r) = -r6 + r3 + 1. Let w(y) = 5y*6 + 3y3 + y2 + 3. Let c(h) = 3n(h) - w(h). Find the third derivative of c(z) wrt z. -960z3 Let z(a) = a3 + 2a2 - a - 1. Let n be z(-2). Let v be 15/(-10) + (-14)/(-4). What is the derivative of -q + n + 2 - v wrt q? -1 Find the third derivative of 4q - 22q3 + 4q - 10q2 - 10q + 86q3 wrt q. 384 Let v(n) = -n - 1. Let x be 3 - (3 + 9 + -3). Let b be v(x). What is the first derivative of -6g*3 - b + 9g*3 + 1 wrt g? 9g*2 Find the third derivative of 5j*2 + 4j*2 + 0j*5 - 23j*6 + 0j*5 wrt j. -2760j*3 Let d(k) = 2k*3 - 2k2 + 5. Let i(n) = -n2 + 1. Let p(w) = -d(w) + 2i(w). What is the derivative of p(q) wrt q? -6q2 Let i(s) = s2 - 5. Let p(y) = -2y2 + 14. Let b be (4/3)/((-6)/(-18)). Let h(g) = bp(g) + 11i(g). What is the derivative of h(f) wrt f? 6f Suppose -4y + 22 = f, 7y - 15 = 2y. What is the first derivative of -6d*3 + 11 - f + 2d*3 wrt d? -12d*2 Differentiate 26 + p + 8p - 23 with respect to p. 9 Differentiate -49l3 + 9l*3 - 7l*3 + 38 - 17l*3 wrt l. -192l*2 Let z(t) be the first derivative of 1/5t*5 + 0t*2 + 0t - 2 + 0t4 + t3. Find the third derivative of z(w) wrt w. 24w Let m(s) = -s - 9. Let y be m(-15). What is the derivative of -yl3 + 3 - 3 + 5 wrt l? -18l2 Let w(k) be the second derivative of -k6/90 - k4/12 + k3/6 - 4k. Let n(l) be the second derivative of w(l). What is the first derivative of n(t) wrt t? -8t Let u(i) = -i*2 + 6i - 5. Let h be u(4). Let v(q) be the first derivative of 3 + 0q - 1/2q*4 + 1/3q*h + 0q*2. Find the third derivative of v(r) wrt r. -12 What is the third derivative of -74k - k*2 + 34k*3 - 22k*2 + 72k wrt k? 204 Let y(j) = -33j4 - 3j*3 - 28j + 3. Let x(t) = -34t4 - 4t*3 - 29t + 4. Let r(p) = -3x(p) + 4y(p). Find the second derivative of r(f) wrt f. -360f2 Let l be 4/96-94 + 4. Let t(j) be the second derivative of 1/30j6 + 0j*3 + 0 + 0j*5 + 2j + lj4 + 0j*2. Find the third derivative of t(i) wrt i. 24i Let g(d) be the third derivative of -d10/37800 + d6/360 - d*5/20 + 4d*2. Let j(b) be the third derivative of g(b). Differentiate j(k) with respect to k. -16k*3 Let h(t) be the first derivative of 8t*5/5 + 5t*3/3 + 4. What is the third derivative of h(x) wrt x? 192x What is the second derivative of 4p4 - 14p*5 - 5p - 4p4 + 7p*5 wrt p? -140p3 Let u(y) = -y2 - 1. Let c(x) = 19x5 - 2x*2 - 3. Let z(f) = c(f) - 3u(f). Find the third derivative of z(h) wrt h. 1140h2 Suppose 2n - 5n = -9. What is the second derivative of -5a + 53a3 - 53a*n + 11a*4 wrt a? 132a*2 What is the third derivative of -7g2 + g2 - 4g6 + 6g*6 + 6g*6 wrt g? 960g*3 Let w(k) be the third derivative of 1/120k*6 + 0k*3 + 0 - 1/12k4 - k2 + 0k + 0k*5. Find the second derivative of w(z) wrt z. 6z Let w(q) = q*3 - 4q*2 + 2. Let z be w(4). What is the second derivative of -5s - zs2 + 4s + s*2 + 3s wrt s? -2 Let i(u) be the second derivative of -u*5/20 + 5u*3/2 + 39u*2/2 + 40u. Differentiate i(g) with respect to g. -3g2 + 15 Let r(i) be the first derivative of -3i*7/280 - 5i*4/24 - 3i*3 - 3. Let s(c) be the third derivative of r(c). Differentiate s(t) wrt t. -27t*2 Let f(z) = 9z*3 + 35z*2 + 11z. Let m(q) = -2q3 - 7q*2 - 2q. Let w(j) = -2f(j) - 11m(j). Find the third derivative of w(a) wrt a. 24 Let k(m) be the first derivative of 3m4 + 9m*2/2 - 14. What is the second derivative of k(a) wrt a? 72a Let n(g) = -g*2 - 7g + 11. Let p be n(-8). Let u be p + 1/(0 + -1). Find the third derivative of 0i2 + 0i*4 - 3i*u + 2i*4 wrt i. 48i What is the third derivative of -271l3 + 112l*3 + 140l*3 + 32l*2 wrt l? -114 Find the third derivative of 5m*2 - 2m*5 + 2m*2 - 13m*2 wrt m. -120m2 Let g(o) be the first derivative of o3/3 - o*2 + 2. Find the second derivative of g(c) wrt c. 2 What is the second derivative of 11t*5 - 26t + 77t - 24t - 8t wrt t? 220t*3 Suppose 0 = 2h - h - 2. Differentiate -2s - 3 + 3s*h + 3s - s with respect to s. 6s Let m = -12 - -16. Find the third derivative of -y3 - my2 + 52 - 52 - y3 wrt y. -12 Let w be (10/4)/((-1)/(-2)). Suppose 0 = wf - 13 + 3. What is the derivative of -fi*2 - 1 - 2i*2 + 5i*2 wrt i? 2i Differentiate -3t2 - 15t + 0t - 47 - 3t + 4t2 wrt t. 2t - 18 Find the third derivative of -3l2 + 7l*2 - 2l*4 + 2l*4 + 4l*6 wrt l. 480l3 Let j(n) be the first derivative of n4/4 - 17n2/2 - 1. What is the second derivative of j(k) wrt k? 6k Find the third derivative of -9p2 + p4 + 21p*4 + 18p*2 + 21p*2 wrt p. 528p Suppose -4t = -c + 6, 10 + 1 = 4c - 3t. Differentiate 8y3 - y3 - cy3 + 3 - 2y*3 with respect to y. 9y*2 What is the first derivative of 57w*2 + 3 - 2w*4 - 57w*2 wrt w? -8w*3 Let o(i) be the third derivative of 25i*8/168 + 5i4/24 + i3/6 + 2i2 - 3i. What is the second derivative of o(v) wrt v? 1000v3 Find the first derivative of 22 - 5o - 15 + 3 wrt o. -5 Let b(l) = 2l2 + 2 - 6 + 3l + 3. Let t(f) = 1. Let c(o) = -o + 2. Let r(z) = c(z) - 2t(z). Let x(g) = b(g) + 3r(g). What is the derivative of x(d) wrt d? 4d Let x(i) be the second derivative of 13i*7/42 + 2i*3/3 + 10i. Find the second derivative of x(q) wrt q. 260q3 Let j be (-1 - 0) + 15 + -11. Find the third derivative of jo*3 - 3o2 - o2 + 2o2 wrt o. 18 Let n(d) be the first derivative of -11d*6/6 + 4d*3 - 4. What is the third derivative of n(x) wrt x? -660x*2 Let v(k) = 3k - 7. Let h be v(3). What is the third derivative of -2c2 - ch + 5c*2 - 10c*5 + 9c*5 wrt c? -60c*2 Let k(x) be the second derivative of 0 - 2x + 0x2 + 0x*4 - 1/3x*3 - 1/14x*7 + 0x*5 + 0x*6. Find the second derivative of k(g) wrt g. -60g*3 Let y(r) = -3r*4 - 5r + 9. Let m(p) = -5p + 2p + 1 + 2p. Let h(f) = -5m(f) + y(f). Differentiate h(q) wrt q. -12q3 Let y(w) be the second derivative of 0 - 1/2w*2 + 0w*3 + 0w*4 + 2w + 1/15w6 + 0w*5. What is the derivative of y(j) wrt j? 8j*3 Let f be (6(-2)/4)/(-1). Suppose 1 + f = r. Differentiate -2y + r - 4 + 5 - 4 with respect to y. -2 Let a(i) = 27i*4 + 15i*2 + 36i. Let x(d) = -4d4 - 2d*2 - 5d. Let o(f) = 4a(f) + 30x(f). What is the second derivative of o(z) wrt z? -144z2 Let g(q) be the first derivative of 8q*2 - 34q - 6. What is the derivative of g(h) wrt h? 16 Suppose 2j + 1 - 5 = 0. Let t(f) be the first derivative of -1/3f3 + f2 + 0f - j. Find the second derivative of t(l) wrt l. -2 Let x(r) be the second derivative of -2r*6/5 + 3r5/20 - r3/6 - 17r2/2 + 46r. What is the second derivative of x(g) wrt g? -144g2 + 18g Differentiate 25w2 + 64 + 17w*2 + 31w*2 wrt w. 146w Find the third derivative of -8i4 - 8i*2 + 0i + 0i - 7i*2 wrt i. -192i Let x(d) = -d - 2. Let u be x(7). Let w(c) = -c*3 - 9c*2 + c + 11. Let a be w(u). What is the first derivative of -8z*2 - 3z*3 + 8z*2 - a wrt z? -9z*2 Let c = -8 + 12. Let m be c/6(-1 - -7). Find the second derivative of -3k + 2k*2 + mk + 0*k wrt k. 4 What is the third	{ "pile_set_name": "DM Mathematics" }
w2 + w. Let y be m(1). Calculate the highest common divisor of y and 451. 11 Let u = 5025 + 7595. What is the highest common factor of u and 20? 20 Suppose 0 = g - 3g + 56. Let h = 55 + 149. Suppose -205 = -f + 3c + 3, f - 2c = h. Calculate the greatest common factor of f and g. 28 Let s = -1 - -14. Suppose sh + 25h = 988. Calculate the greatest common factor of h and 130. 26 Suppose 104g + 460 = 219g. What is the highest common factor of g and 256? 4 Let f = 46 + -16. Suppose fb = 28b + 12. Calculate the greatest common divisor of 294 and b. 6 Let v be (9/4)/(-3)-784. Suppose 0 = 3w + 3w - v. Suppose 12 = -3d - 2f + 67, 5d = 3f + w. Calculate the greatest common factor of d and 19. 19 Suppose 2j - 3j = -4n - 380, -5n + 1457 = 4j. Let l be 52(-3)/(-12) + 3. Calculate the highest common divisor of l and j. 16 Let w(f) = f2 + 17f + 19. Let v be w(-13). Let u = v - -97. Let x be -21/(-5)240. Calculate the greatest common divisor of u and x. 32 Suppose -124u + 27736 = -13184. Calculate the highest common factor of 390 and u. 30 Let l be 1 + 2 + -3 + 95. Let r be (88/6)/(8/60). Suppose 5p = -3d + r, 4p - 5d = 37 + 14. What is the highest common divisor of p and l? 19 Let t = 227 - 222. Suppose 422 = -tz + 7z - s, -4z + 856 = -5s. Calculate the highest common divisor of 38 and z. 19 Let n = 452 + -453. Let v be (-14)/10 - n - 23392/(-430). What is the highest common factor of v and 513? 27 Suppose o + 4s = -28, 0 = -85s + 88s + 12. Let f(b) = 3b - b + 22 + 7. Let j be f(o). What is the greatest common divisor of j and 5? 5 Let m(z) = 3z + 25. Let a be m(0). Suppose t = -3i + a, 5t + 2 - 1 = -i. What is the highest common divisor of i and 3? 3 Let y(p) = -2p2 + 44p - 14. Let c be y(12). Calculate the highest common divisor of 1582 and c. 226 Let t = -5007 - -5063. What is the greatest common divisor of t and 3032? 8 Let s(i) = 6i + 53. Let h be s(-8). Suppose hp = 0, r = -2p + 3p + 4. Calculate the greatest common factor of 38 and r. 2 Let m(n) = 8n2 + 393n - 35. Let t be m(-50). Calculate the highest common divisor of t and 49. 7 Suppose -89l = -2l - 21924. Calculate the greatest common divisor of 1701 and l. 63 Let i = -221 - -342. What is the highest common divisor of i and 341? 11 Suppose 0 = 27n + 78n - 11340. What is the greatest common factor of n and 720? 36 Suppose -4d + 2m - 1846 = -4, -2d = 3m + 925. Let p = d - -505. Calculate the highest common divisor of 341 and p. 11 Let f = 97354 - 52044. Calculate the greatest common divisor of f and 46. 46 Let o be -1119(-6)/(-6)-1. Let z = 176 - o. What is the highest common divisor of z and 6? 3 Let p(u) = u2 - 2u - 3. Let s be p(3). Suppose -8z + 13356 = 4z. Suppose 15h - z - 42 = s. What is the highest common divisor of h and 11? 11 Suppose 287 = p + j, -p + 5j + 333 - 52 = 0. What is the highest common factor of p and 390? 26 Suppose b = 8 + 1. Let h be (-42)/(-4)b(-4)/7. Let w = -42 - h. What is the greatest common divisor of w and 36? 12 Let g(p) = p*3 - 7p*2 - 5p + 11. Let r be g(8). Let t be (-105)/(-75) + (-215)/(-25). What is the greatest common divisor of r and t? 5 Let l be 324 + -1 + 0 + 7. Suppose -b - 5b = -l. What is the greatest common factor of b and 44? 11 Let w(r) = 5r + 47. Let i be w(8). Let c = 114 - i. Suppose 2d = p - 17, -3p + 76 = -0d - d. What is the greatest common factor of p and c? 27 Let n(q) = 13q*3 + 16q*2 - 72q + 220. Let z be n(7). Calculate the highest common divisor of 76 and z. 19 Suppose 430b = 444b - 1065 - 993. What is the greatest common factor of b and 3? 3 Let c(z) = 93z - 161. Let t be c(2). What is the highest common factor of t and 4825? 25 Let j(w) = -w3 - 2w*2 - w - 16. Let f be j(0). Let z = -29 - f. Let p = z + 31. Calculate the greatest common divisor of 2 and p. 2 Suppose 0 = c + 3c - 288. Suppose 27s - 1808 = -s - 184. Let k = c - s. What is the highest common divisor of k and 112? 14 Let x be (270/65 + 2/(-13))-44. Let g be (-1)/((-6)/(-8))5544/x. What is the greatest common factor of 42 and g? 42 Suppose 3274d - 3245d = 6670. What is the highest common divisor of d and 2576? 46 Let h be 6(-1 + 5 + 143/(-33)). Let c be -552(3/2 + h). What is the greatest common divisor of 6 and c? 6 Let r(x) = x2 + 13x + 6. Let p(d) = -d - 34. Let q be p(-19). Let l be r(q). Calculate the greatest common divisor of l and 27. 9 Let m = 114 - -163. Suppose -271z + mz - 126 = 0. What is the highest common divisor of 3 and z? 3 Let w be -413(-2 + (-24)/(-28)). Calculate the greatest common divisor of w and 4012. 236 Let n = 121 + -73. Suppose 17i = 15i + 70. Suppose 12w + i - 419 = 0. Calculate the highest common factor of n and w. 16 Let o(v) = -v*3 + 2v*2 - 5v + 12. Let x = -19 - 60. Let j = -77 - x. Let a be o(j). What is the greatest common factor of 7 and a? 1 Let m = -26433 + 26453. What is the highest common factor of m and 178? 2 Suppose -303v - 72v + 20818 + 3182 = 0. Calculate the greatest common divisor of 2 and v. 2 Let f(n) = -14n. Let g be f(-4). Let o(z) = -z3 - 27z*2 - 13z + 101. Let q be o(-26). Let p = q + 245. What is the greatest common divisor of g and p? 8 Let f be (2906/(-11))/(-1) - (-118)/(-649). Suppose f - 57 = 3g. What is the greatest common divisor of 1173 and g? 69 Suppose -2w = -q - 33, 2q + 84 = 5w - 2q. Let b(z) = -z2 + z2 + 18z + 347 - z*2 - 357. Let h be b(w). What is the greatest common divisor of h and 11? 11 Suppose 0 = 147a + 1101 - 21681. Calculate the highest common divisor of 805 and a. 35 Let q be 89 + ((-28)/(2128/(-95)))/(2/(-8)). Let a = 86 + 10. What is the greatest common factor of q and a? 12 Let y be -6(2 + 6 - (-83)/(-6)). Calculate the highest common factor of 581 and y. 7 Let y = 2033 - 898. Let l = -830 + y. What is the greatest common divisor of 244 and l? 61 Suppose 51w = 53w - 260. Suppose 410 = 10h + w. Calculate the highest common divisor of h and 182. 14 Let p(j) = -j*3 - 8j*2 + 6j - 22. Let y be p(-9). Suppose yc - 131 = -91. Suppose -2x = -15 - 25. Calculate the highest common factor of x and c. 4 Let j(d) = 2d + 14. Let x be j(-5). Suppose -5k = -2h + 35, 0 = -2k - 0k - 6. Let r = -4 + h. What is the greatest common factor of x and r? 2 Suppose -2f - 4v = -8, -3v + 10 = 3f + 2v. Suppose l = 3b - 103 + 22, f = -l. Let t = 165 + -147. What is the highest common factor of t and b? 9 Suppose 5m - 205 - 155 = 0. Suppose r + f = 203 + 109, 5f - 30 = 0. Calculate the greatest common factor of m and r. 18 Let b = 4333 - -68. What is the highest common factor of 54 and b? 27 Let c(x) = 2x*3 - 29x*2 + 83x - 679. Let f be c(22). Calculate the highest common divisor of f and 7. 7 Let s be (-18)/(144/16)3/(-3)44. Calculate the greatest common factor of s and 649. 11 Let q(u) = -2u2 - u. Let b be q(1). Let z be ((-8)/b)/(1/3). Let f = -127 + 128. What is the greatest common factor of z and f? 1 Let c(h) be the third derivative of h4/12 - h3/2 - 5h*2 - 2. Let j = -18 + 27. Let u be c(j). Calculate the greatest common factor of 30 and u. 15 Suppose 8 + 562 = 3j. Suppose 0 = -5c - j + 1345. Let r = c + -126. Calculate the highest common factor of 15 and r. 15 Let v(m) = 15m + 131. Let i be v(-7). Suppose -if + 1750 + 434 = 0. Calculate the greatest common divisor of f and 56. 28 Suppose -6o + 2o = -180. Let m be ((-280)/(-196))/(8/28(-2)/(-2)). Calculate the highest common factor of o and m. 5 Let v = -42 + 45. Let m(d) = -vd3 + 2 - 2 - 4d + 3 + d. Let z be m(-2). What is the highest common factor of 55 and z? 11 Let k(t) = -t - 20. Let o(v) = -v*2 - 24v - 121. Let y be o(-19). Let h be k(y). Calculate the highest common factor of h and 750. 6 Let g = 2008 - 1180. Calculate the greatest common divisor of g and 72. 36 Suppose -2g - 3z = 86, -3g + 5z = -7g - 170. Let n(a) = -a3 - 41a*2 - 43a - 72. Let w be n(g). Calculate the highest common factor of w and 42. 6 Let q be 8 + -5 - 2/(-2). Suppose 0 = 5x + 3t - 534, -4x + 7t + 434 = 6t. Calculate the greatest common divisor of q and x. 4 Suppose 312 = 13b - 17b. Let x = b - -210. Calculate the greatest common factor of 176 and x. 44 Let l be (-12)/(-66)11 + (-7)	{ "pile_set_name": "DM Mathematics" }
comes next: -55721, -57452, -59183? -60914 What is the next term in -1102, -4051, -9004, -15973, -24970, -36007, -49096? -64249 What is the next term in 104609, 206689, 308771, 410855, 512941? 615029 What is next in -31099, -66551, -102003? -137455 What comes next: -435, -1843, -4197, -7497, -11743, -16935? -23073 What is the next term in 546761, 546756, 546751, 546746, 546741? 546736 What is next in 553349, 1106221, 1659091, 2211959, 2764825? 3317689 What is the next term in -97138, -192510, -287882, -383254, -478626? -573998 What comes next: -18089976, -18089982, -18089988? -18089994 What is the next term in 135245, 263545, 391833, 520103, 648349? 776565 What is the next term in 1067483549, 1067483547, 1067483545, 1067483543? 1067483541 What is next in -8459, -16351, -23671, -30413, -36571? -42139 What comes next: 89871503, 89871504, 89871505, 89871506, 89871507, 89871508? 89871509 What comes next: -1348, -1637, -1920, -2197, -2468? -2733 What is the next term in 16210, 32749, 49272, 65779, 82270, 98745, 115204? 131647 What comes next: 28959, 57866, 86755, 115632, 144503, 173374, 202251, 231140? 260047 What is the next term in 27180, 108554, 244126, 433890, 677840? 975970 What is next in 55586, 56628, 57674, 58724, 59778, 60836, 61898? 62964 What comes next: -25998, -104141, -234426, -416853, -651422? -938133 What is the next term in -43706, -350191, -1182076, -2802059, -5472838, -9457111, -15017576? -22416931 What is the next term in 124062, 124691, 125320? 125949 What is next in 56690, 453437, 1530320, 3627407, 7084766, 12242465? 19440572 What comes next: 11759, 46731, 104939, 186371, 291015, 418859, 569891? 744099 What is the next term in -16631, -16303, -15975, -15647? -15319 What is the next term in -6350227, -6350223, -6350215, -6350203? -6350187 What comes next: -3895954, -3895953, -3895952? -3895951 What comes next: -201968, -404480, -606990, -809498, -1012004, -1214508? -1417010 What is the next term in -27549880, -55099764, -82649648? -110199532 What is next in 705603, 1411231, 2116863, 2822499, 3528139, 4233783? 4939431 What is the next term in -155284, -310357, -465430, -620503? -775576 What is the next term in -192874204, -385748412, -578622622, -771496834? -964371048 What is the next term in 492318, 492390, 492474, 492576, 492702, 492858, 493050, 493284? 493566 What is next in -15500, -31137, -46906, -62807, -78840, -95005? -111302 What is next in -4876, -9907, -14970, -20059, -25168, -30291, -35422? -40555 What is the next term in 55716, 221061, 496646, 882477, 1378560, 1984901, 2701506, 3528381? 4465532 What is next in 70635938, 70635939, 70635940, 70635941, 70635942, 70635943? 70635944 What comes next: -167760, -168334, -169290, -170628? -172348 What is the next term in 4273, 2615, -1887, -10655, -25111, -46677? -76775 What is next in 111749, 224757, 337765? 450773 What comes next: -2484, -6729, -13886, -23955? -36936 What is next in -732631, -732635, -732639? -732643 What is next in -63236, -125966, -188696? -251426 What comes next: 135384350, 135384342, 135384324, 135384290, 135384234, 135384150? 135384032 What is the next term in 3087, 6051, 9031, 12027, 15039? 18067 What is the next term in 6995, 41563, 135389, 318101, 619327? 1068695 What is the next term in 38189, 45622, 53055, 60488, 67921, 75354? 82787 What is next in -526848, -526736, -526550, -526290, -525956, -525548? -525066 What is next in -9838, -78541, -265006, -628111, -1226734? -2119753 What comes next: 100959, 808416, 2728655, 6468066, 12633039, 21829964, 34665231? 51745230 What is next in 5175645, 10351281, 15526919, 20702559, 25878201, 31053845? 36229491 What is next in -2471, -9127, -20221, -35753? -55723 What is next in -1588, -704, 1698, 6374, 14080, 25572, 41606, 62938? 90324 What is the next term in -71379590, -71379582, -71379574, -71379566, -71379558? -71379550 What comes next: 136871, 137065, 137259? 137453 What is the next term in 16769432, 33538873, 50308314, 67077755, 83847196, 100616637? 117386078 What is the next term in 10465701, 10465703, 10465705, 10465707? 10465709 What is next in -2444374, -9777500, -21999380, -39110014, -61109402? -87997544 What is next in -1145, -1300, -1643, -2264, -3253, -4700, -6695, -9328? -12689 What is the next term in -68341, -274211, -617337, -1097725, -1715381, -2470311, -3362521, -4392017? -5558805 What is the next term in 631, 898, 725, 112? -941 What comes next: -7255, -7170, -7065, -6934, -6771? -6570 What comes next: -82666, -162851, -243036, -323221, -403406? -483591 What comes next: -688057, -5504697, -18578423, -44037775, -86011293, -148627517, -236014987? -352302243 What comes next: 25024, 26104, 27910, 30448, 33724, 37744, 42514, 48040? 54328 What comes next: 360160, 1440703, 3241604, 5762863, 9004480, 12966455, 17648788? 23051479 What comes next: 66649, 67287, 67915, 68527, 69117? 69679 What comes next: 81462, 330270, 744950, 1325502, 2071926? 2984222 What is next in -519, -1043, -1489, -1851, -2123, -2299, -2373? -2339 What is next in -1392, -9299, -30770, -72591, -141548, -244427, -388014, -579095? -824456 What is the next term in 2308, 9308, 20882, 37030, 57752? 83048 What is next in 15940, 63844, 143714, 255550, 399352, 575120? 782854 What is the next term in 540, 2396, 5680, 10548, 17156? 25660 What is next in -166658, -666535, -1499664, -2666045? -4165678 What is next in -7104087, -14208166, -21312245, -28416324? -35520403 What is the next term in -6258, -12312, -18340, -24330, -30270, -36148, -41952? -47670 What comes next: 1422, 2933, 4206, 5121, 5558, 5397? 4518 What comes next: -2957203, -2957144, -2957085, -2957026, -2956967, -2956908? -2956849 What is the next term in 56047, 55833, 55457, 54913, 54195? 53297 What is the next term in -7905, -6899, -5889, -4875? -3857 What comes next: 805183, 805184, 805185? 805186 What is the next term in 1026060, 2052121, 3078182, 4104243, 5130304? 6156365 What is the next term in 19677, 18868, 18059? 17250 What is next in 347816, 695653, 1043490, 1391327, 1739164, 2087001? 2434838 What is the next term in 14681, 29862, 45043? 60224 What is next in 1573, 2587, 3009, 2803, 1933, 363, -1943? -5021 What is the next term in -202, -546, -890, -1228, -1554, -1862, -2146? -2400 What is the next term in 2221, 3049, 4425, 6349, 8821? 11841 What is the next term in -4355224, -8710455, -13065686, -17420917? -21776148 What is the next term in 49846, 50038, 50230? 50422 What is the next term in 2174515, 4349036, 6523557, 8698078? 10872599 What is next in -33742, -25521, -17300, -9079? -858 What comes next: 31, -158, -1155, -3386, -7277, -13254? -21743 What is next in 30862287, 61724578, 92586869? 123449160 What comes next: -4434, -18678, -42838, -76920, -120930? -174874 What is next in -24666, -95993, -214872, -381303, -595286? -856821 What comes next: -210598, -210627, -210694, -210811, -210990, -211243, -211582, -212019? -212566 What comes next: -2086406, -2086342, -2086278, -2086214, -2086150, -2086086? -2086022 What is the next term in -5017, -3782, -2547, -1312, -77? 1158 What is next in -15200321, -15200319, -15200317, -15200315? -15200313 What is next in -480094, -1920407, -4320928, -7681657? -12002594 What is the next term in -944071, -944072, -944073, -944074? -944075 What is next in 235206, 470374, 705502, 940590, 1175638? 1410646 What is next in -763, -4701, -11595, -21445, -34251, -50013, -68731? -90405 What comes next: 766323, 765971, 765619, 765267, 764915? 764563 What is the next term in -1605138, -1605160, -1605186, -1605216, -1605250? -1605288 What comes next: 234473, 469062, 703657, 938258, 1172865, 1407478? 1642097 What is next in -2860844, -2860840, -2860834, -2860826, -2860816? -2860804 What is the next term in 8082543, 8082537, 8082529, 8082519, 8082507, 8082493, 8082477? 8082459 What is next in -13812298, -27624593, -41436882, -55249165, -69061442, -82873713, -96685978? -110498237 What is the next term in 3068, 4182, 6058, 8714, 12168? 16438 What is the next term in -3016, -5574, -8126, -10672, -13212, -15746, -18274? -20796 What comes next: -7113, -28614, -64441, -114588, -179049? -257818 What is next in -38820, -46968, -60548, -79560? -104004 What comes next: 86656, 172675, 258694, 344713, 430732? 516751 What is the next term in -4893, -	{ "pile_set_name": "DM Mathematics" }
culate the common denominator of -59/219880 and 93/29164. 69701960 Calculate the common denominator of -83/3427652 and -83/1648744. 130250776 What is the least common multiple of 18 and 180220566? 540661698 What is the least common multiple of 18244422 and 23751? 237177486 What is the lowest common multiple of 18576816 and 12? 18576816 Calculate the common denominator of -67/1632 and -23/107840. 5499840 Find the common denominator of -83/210 and -57/3218036. 337893780 What is the smallest common multiple of 8869320 and 93? 274948920 Find the common denominator of 29/18787584 and -149/293556. 18787584 Calculate the lowest common multiple of 4945 and 7951560. 7951560 Calculate the least common multiple of 66 and 687478. 2062434 What is the common denominator of 67/1260036 and 16/1431? 66781908 What is the least common multiple of 810955 and 161380045? 161380045 What is the least common multiple of 974 and 841218? 409673166 What is the lowest common multiple of 450 and 31309659? 1565482950 Calculate the common denominator of -95/2568 and -143/2730384. 292151088 What is the common denominator of -23/11963644 and 149/84833112? 933164232 Find the common denominator of 31/16354 and -147/3761420. 3761420 Find the common denominator of -19/470646257 and 95/8. 3765170056 Calculate the least common multiple of 92744 and 13308764. 26617528 Calculate the smallest common multiple of 115761 and 192114. 9029358 Calculate the least common multiple of 14874 and 11745502. 35236506 What is the lowest common multiple of 90240 and 98640? 37088640 Calculate the common denominator of -64/12633 and -163/114504. 482176344 Calculate the smallest common multiple of 19092148 and 6. 57276444 What is the smallest common multiple of 1010669 and 28758127? 316339397 What is the common denominator of 76/65445 and 28/2475? 10798425 What is the least common multiple of 28945 and 62025? 434175 Calculate the smallest common multiple of 292702 and 46100565. 92201130 What is the lowest common multiple of 31785 and 2457? 2002455 Calculate the smallest common multiple of 32667792 and 74584. 32667792 Calculate the lowest common multiple of 27 and 857613. 7718517 Calculate the lowest common multiple of 2082 and 215688. 74843736 What is the common denominator of -35/48 and 35/3540052? 42480624 Calculate the smallest common multiple of 3798 and 19075. 72446850 What is the lowest common multiple of 501 and 2366223? 2366223 What is the common denominator of 82/18931263 and 37/104? 151450104 Find the common denominator of 79/1242666 and 97/912. 188885232 What is the least common multiple of 285 and 959709? 4798545 Calculate the smallest common multiple of 28877376 and 6336. 86632128 Calculate the lowest common multiple of 414660 and 54569256. 272846280 Calculate the least common multiple of 40260 and 7381. 442860 What is the common denominator of 179/303120 and -85/4668048? 23340240 Calculate the smallest common multiple of 2409336 and 3747856. 33730704 What is the common denominator of -31/145197130 and -41/180? 2613548340 What is the smallest common multiple of 6200 and 1826400? 56618400 Calculate the common denominator of -17/38600324 and 73/6118. 887807452 Calculate the least common multiple of 23088 and 198. 761904 Calculate the least common multiple of 6442596 and 6. 6442596 Calculate the lowest common multiple of 5309160 and 76104. 111492360 What is the smallest common multiple of 6012 and 54276? 27192276 Calculate the lowest common multiple of 112 and 274067. 30695504 What is the least common multiple of 124611 and 82417? 140685819 Calculate the common denominator of 131/48414740 and -41/57217420. 629391620 Find the common denominator of 3/28610953 and 59/31562. 57221906 What is the least common multiple of 3882645 and 1287? 42709095 Calculate the common denominator of -187/713160 and 59/48384. 68463360 Calculate the common denominator of 151/414178344 and 47/18949336. 2899248408 Find the common denominator of -67/15390 and 67/38475. 76950 Calculate the common denominator of 139/24943740 and 79/39909984. 199549920 Find the common denominator of -113/1155 and 7/6129750. 42908250 What is the least common multiple of 5664598 and 18? 50981382 What is the common denominator of 43/652842 and -71/1728? 62672832 Calculate the common denominator of -97/432 and 167/188640. 565920 Calculate the lowest common multiple of 5764507 and 77. 63409577 Calculate the common denominator of -113/190 and -41/37262952. 186314760 Calculate the smallest common multiple of 242 and 138555428. 1524109708 What is the common denominator of 107/4226970 and 97/59177580? 59177580 Calculate the common denominator of 49/373404 and -67/2146. 373404 What is the smallest common multiple of 988 and 983866? 37386908 What is the least common multiple of 27434142 and 18? 27434142 Find the common denominator of 101/18668 and 85/1982864. 711848176 Calculate the common denominator of 17/277604 and 99/20. 1388020 Calculate the lowest common multiple of 4160 and 1782508. 142600640 Find the common denominator of -71/16240900 and -67/260. 16240900 Calculate the common denominator of -53/53713672 and 103/1952. 214854688 What is the least common multiple of 231242256 and 40? 1156211280 Calculate the lowest common multiple of 1314 and 5623044. 16869132 Calculate the common denominator of -25/377936 and -43/240. 5669040 What is the common denominator of -107/17995992 and -97/20566848? 143967936 Calculate the common denominator of 1/5138883 and 35/3235593. 87361011 What is the lowest common multiple of 378198909 and 66? 756397818 What is the common denominator of 43/214130 and 31/139104? 92504160 Find the common denominator of 83/9588075 and -9/108664850. 325994550 Calculate the smallest common multiple of 33500040 and 1520. 67000080 Calculate the common denominator of -131/7336878 and 7/1784646. 66031902 Calculate the lowest common multiple of 1680 and 46524. 6513360 What is the least common multiple of 2466 and 81840? 33636240 Calculate the lowest common multiple of 91516 and 892281. 3569124 Calculate the lowest common multiple of 30736 and 60146. 54371984 What is the common denominator of -71/666 and -97/201060? 7439220 Calculate the lowest common multiple of 5677 and 1175950. 8231650 Calculate the common denominator of 52/225 and 83/68556. 5141700 What is the least common multiple of 12 and 8627232? 8627232 Calculate the lowest common multiple of 15548 and 3569280. 82093440 Calculate the common denominator of 21/137107267 and 57/87250079. 959750869 Calculate the common denominator of -80/3297 and 121/24002160. 24002160 Calculate the common denominator of -37/84558 and 193/31590. 445197870 What is the least common multiple of 51423 and 101509002? 101509002 What is the smallest common multiple of 1083684 and 2096073? 159301548 What is the common denominator of -87/8800 and 11/30874? 135845600 Find the common denominator of 89/15 and -43/27988965. 27988965 Calculate the lowest common multiple of 5471060 and 64011402. 640114020 Find the common denominator of -61/145318992 and 25/4389. 1598508912 Find the common denominator of -13/155837 and 71/17732. 8103524 Calculate the least common multiple of 1118057 and 15. 16770855 Calculate the smallest common multiple of 1262010 and 2019216. 10096080 Calculate the smallest common multiple of 217974935 and 68. 871899740 What is the common denominator of 17/196063092 and 115/3888? 784252368 Calculate the common denominator of -23/884480 and 143/3840. 2653440 What is the common denominator of -41/352 and 149/1291200? 14203200 What is the smallest common multiple of 798965 and 3195860? 3195860 What is the common denominator of -92/103273875 and 13/90? 206547750 Calculate the common denominator of -41/15568700 and 73/29010. 46706100 Calculate the common denominator of 51/83692 and 47/562520. 34313720 What is the least common multiple of 2159938 and 24741108? 272152188 Calculate the least common multiple of 99448 and 232580. 14419960 Calculate the common denominator of 82/15 and -49/27477210. 27477210 What is the least common multiple of 15168 and 4495416? 35963328 Calculate the common denominator of 67/422680 and 11/10000. 105670000 What is the lowest common multiple of 59988 and 582? 5818836 Calc	{ "pile_set_name": "DM Mathematics" }
is prob of sequence ifb? 1/330 What is prob of sequence rrb when three letters picked without replacement from oorrcoobo? 1/252 Three letters picked without replacement from {u: 3, e: 1, d: 1, k: 3, h: 6}. Give prob of sequence kdh. 3/364 What is prob of sequence dssd when four letters picked without replacement from {s: 16, d: 2}? 1/153 Two letters picked without replacement from aiquukp. Give prob of sequence ak. 1/42 What is prob of sequence oeo when three letters picked without replacement from ooooooeoooooo? 1/13 Four letters picked without replacement from {r: 1, x: 4, m: 6}. Give prob of sequence xrxx. 1/330 Calculate prob of sequence jy when two letters picked without replacement from {c: 1, y: 1, j: 2}. 1/6 Four letters picked without replacement from {l: 2, k: 7, q: 8, a: 2}. What is prob of sequence alkl? 7/23256 What is prob of sequence cbct when four letters picked without replacement from {c: 4, t: 4, b: 12}? 8/1615 What is prob of sequence uww when three letters picked without replacement from fufffwuumf? 0 Calculate prob of sequence aaw when three letters picked without replacement from lakaakalwllw. 1/55 Three letters picked without replacement from {z: 1, s: 3, l: 1, t: 4, b: 8}. Give prob of sequence bzt. 2/255 Two letters picked without replacement from vudvdvdududdvvvwud. What is prob of sequence wu? 2/153 Two letters picked without replacement from ykyyyyykyykyyyyyyy. What is prob of sequence yk? 5/34 What is prob of sequence xy when two letters picked without replacement from {f: 1, e: 1, y: 1, v: 1, r: 2, x: 1}? 1/42 What is prob of sequence bb when two letters picked without replacement from bdbrbdb? 2/7 Three letters picked without replacement from {b: 3, o: 1, v: 4, l: 2, w: 3, f: 2}. Give prob of sequence vbo. 2/455 Calculate prob of sequence nnnn when four letters picked without replacement from {n: 15, g: 5}. 91/323 Four letters picked without replacement from eqqrlr. What is prob of sequence qqrl? 1/90 Four letters picked without replacement from zbbzbbbzzb. Give prob of sequence bzzb. 1/14 What is prob of sequence xxu when three letters picked without replacement from ffuxffxufuuuxfuufu? 1/102 Three letters picked without replacement from {i: 17, b: 2}. What is prob of sequence iib? 16/171 Three letters picked without replacement from {b: 1, m: 1, y: 1, w: 1, d: 1}. Give prob of sequence bwy. 1/60 Four letters picked without replacement from {t: 1, m: 1, k: 6, c: 1, o: 1, d: 1}. Give prob of sequence okmc. 1/1320 Calculate prob of sequence gg when two letters picked without replacement from {g: 3, l: 12}. 1/35 Three letters picked without replacement from syxjdhj. What is prob of sequence jhs? 1/105 Four letters picked without replacement from isisisssciciiisiists. What is prob of sequence icic? 2/1615 Three letters picked without replacement from {y: 4, a: 1, p: 2, x: 3}. What is prob of sequence xpx? 1/60 Two letters picked without replacement from {d: 3, r: 1, l: 4, v: 1, m: 2, u: 4}. What is prob of sequence ur? 2/105 Calculate prob of sequence gjs when three letters picked without replacement from sqsgjqqqsasaqgqaq. 1/510 What is prob of sequence rva when three letters picked without replacement from {r: 1, v: 6, a: 8, w: 1}? 1/70 Two letters picked without replacement from ggggqqggggqqqg. Give prob of sequence qg. 45/182 What is prob of sequence xxm when three letters picked without replacement from {x: 2, h: 3, w: 1, c: 1, m: 3, n: 5}? 1/455 Two letters picked without replacement from wbwwwwbwwbww. What is prob of sequence wb? 9/44 Calculate prob of sequence ilki when four letters picked without replacement from ttlietqiqkikk. 3/2860 What is prob of sequence ll when two letters picked without replacement from {o: 1, a: 5, w: 1, k: 1, l: 4, t: 1}? 1/13 What is prob of sequence zzhh when four letters picked without replacement from {z: 11, h: 3}? 5/182 Four letters picked without replacement from {t: 5, q: 5, h: 4, l: 1, e: 3}. What is prob of sequence etet? 1/612 What is prob of sequence dd when two letters picked without replacement from {j: 7, d: 4}? 6/55 Four letters picked without replacement from {k: 8, u: 5}. Give prob of sequence ukku. 28/429 Four letters picked without replacement from djevdqevfvd. What is prob of sequence qedj? 1/1320 Two letters picked without replacement from {k: 3, p: 1, h: 1, z: 5, r: 3}. What is prob of sequence pz? 5/156 Calculate prob of sequence sas when three letters picked without replacement from asalqaqnaaqqsalanl. 7/2448 What is prob of sequence pf when two letters picked without replacement from {l: 2, p: 1, y: 2, f: 1, o: 1, s: 1}? 1/56 What is prob of sequence oy when two letters picked without replacement from {o: 2, z: 3, g: 2, n: 1, w: 3, y: 3}? 3/91 Four letters picked without replacement from {z: 4, p: 3}. Give prob of sequence pzzp. 3/35 What is prob of sequence lpl when three letters picked without replacement from {l: 2, p: 7}? 1/36 What is prob of sequence nnu when three letters picked without replacement from nnununu? 6/35 Calculate prob of sequence rd when two letters picked without replacement from {d: 7, r: 4, t: 3}. 2/13 What is prob of sequence waa when three letters picked without replacement from {w: 12, a: 5, l: 2}? 40/969 Two letters picked without replacement from {a: 2, p: 11}. What is prob of sequence pp? 55/78 Two letters picked without replacement from qabxxqqxtxx. Give prob of sequence xt. 1/22 What is prob of sequence wwll when four letters picked without replacement from {l: 13, w: 3}? 3/140 Two letters picked without replacement from keekkkkkekeeee. Give prob of sequence ee. 3/13 What is prob of sequence ttt when three letters picked without replacement from {u: 4, t: 9, i: 3}? 3/20 Two letters picked without replacement from qqxqxxfqddx. Give prob of sequence dq. 4/55 What is prob of sequence yym when three letters picked without replacement from {m: 4, g: 3, e: 7, t: 1, y: 2}? 1/510 Calculate prob of sequence vamq when four letters picked without replacement from {a: 3, v: 3, q: 6, i: 2, m: 1}. 3/1820 Calculate prob of sequence ns when two letters picked without replacement from {s: 2, n: 6}. 3/14 Four letters picked without replacement from ododsojjodd. What is prob of sequence oddo? 1/55 Calculate prob of sequence xxnn when four letters picked without replacement from {n: 5, x: 2, b: 7}. 5/3003 Two letters picked without replacement from {p: 3, o: 4, k: 1, d: 10}. What is prob of sequence dp? 5/51 What is prob of sequence tu when two letters picked without replacement from tuttjunt? 1/7 Two letters picked without replacement from {x: 1, j: 3, q: 4}. Give prob of sequence qj. 3/14 Three letters picked without replacement from {d: 3, f: 1, u: 1}. What is prob of sequence ddf? 1/10 Two letters picked without replacement from {g: 2, a: 8}. What is prob of sequence aa? 28/45 Four letters picked without replacement from {d: 2, h: 2, w: 3, f: 6, m: 1}. What is prob of sequence fwwd? 3/1001 Two letters picked without replacement from cykqellccklcqlk. Give prob of sequence lc. 8/105 Three letters picked without replacement from {q: 13, d: 3, v: 3, a: 1}. What is prob of sequence qda? 13/2280 Calculate prob of sequence zlal when four letters picked without replacement from lallblzo. 1/140 Calculate prob of sequence dd when two letters picked without replacement from ddddhhdd. 15/28 Calculate prob of sequence xxfx when four letters picked without replacement from {x: 7, f: 7}. 35/572 Calculate prob of sequence rrru when four letters picked without replacement from {r: 13, u: 3}. 33/280 Calculate prob of sequence vb when two letters picked without replacement from {v: 1, f: 3, b: 1, l: 4, x: 2}. 1/110 Three letters picked without replacement from {n: 1, e: 1, v: 7, h: 6}. What is prob of sequence nvh? 1/65 Four letters picked without replacement from {e: 5, k: 1, i: 7, w: 2, n: 2, o: 3}. Give prob of sequence oeoi. 7/3876 Four letters picked without replacement from hhhhhohphphohhp. Give prob of sequence phoh. 3/182 Four letters picked without replacement from wwwwwww. Give prob of sequence wwww. 1 Two letters picked without replacement from uzzbzubzbubzzu. Give prob of sequence bb. 6/91 What is prob of sequence mi when two letters picked	{ "pile_set_name": "DM Mathematics" }
at is the square root of 192654 to the nearest integer? 439 What is the eighth root of 746255 to the nearest integer? 5 What is 2090217 to the power of 1/7, to the nearest integer? 8 What is the square root of 335654 to the nearest integer? 579 What is the square root of 282332 to the nearest integer? 531 What is the square root of 2240466 to the nearest integer? 1497 What is the square root of 300880 to the nearest integer? 549 What is the ninth root of 6887835 to the nearest integer? 6 What is the fourth root of 284222 to the nearest integer? 23 What is the square root of 2583672 to the nearest integer? 1607 What is the third root of 366139 to the nearest integer? 72 What is 2348838 to the power of 1/10, to the nearest integer? 4 What is the cube root of 354784 to the nearest integer? 71 What is 758525 to the power of 1/7, to the nearest integer? 7 What is the seventh root of 412586 to the nearest integer? 6 What is the third root of 1361120 to the nearest integer? 111 What is the square root of 1483561 to the nearest integer? 1218 What is 1272644 to the power of 1/3, to the nearest integer? 108 What is the square root of 226081 to the nearest integer? 475 What is 994471 to the power of 1/2, to the nearest integer? 997 What is the seventh root of 4349105 to the nearest integer? 9 What is 151330 to the power of 1/2, to the nearest integer? 389 What is the square root of 9730668 to the nearest integer? 3119 What is 233918 to the power of 1/8, to the nearest integer? 5 What is 251183 to the power of 1/2, to the nearest integer? 501 What is the fifth root of 27827783 to the nearest integer? 31 What is 189365 to the power of 1/3, to the nearest integer? 57 What is 676257 to the power of 1/2, to the nearest integer? 822 What is 3056501 to the power of 1/5, to the nearest integer? 20 What is 324258 to the power of 1/7, to the nearest integer? 6 What is 157252 to the power of 1/3, to the nearest integer? 54 What is the fifth root of 31857 to the nearest integer? 8 What is the third root of 9613987 to the nearest integer? 213 What is the square root of 127237 to the nearest integer? 357 What is the square root of 698364 to the nearest integer? 836 What is the third root of 640324 to the nearest integer? 86 What is 828556 to the power of 1/3, to the nearest integer? 94 What is the square root of 617033 to the nearest integer? 786 What is 30813454 to the power of 1/6, to the nearest integer? 18 What is the seventh root of 16840806 to the nearest integer? 11 What is 674835 to the power of 1/3, to the nearest integer? 88 What is 1496650 to the power of 1/2, to the nearest integer? 1223 What is the third root of 44922 to the nearest integer? 36 What is 6502588 to the power of 1/2, to the nearest integer? 2550 What is the fifth root of 8068864 to the nearest integer? 24 What is the ninth root of 230195 to the nearest integer? 4 What is 395380 to the power of 1/8, to the nearest integer? 5 What is 616607 to the power of 1/2, to the nearest integer? 785 What is the square root of 457932 to the nearest integer? 677 What is 26601483 to the power of 1/2, to the nearest integer? 5158 What is the square root of 735620 to the nearest integer? 858 What is 278212 to the power of 1/8, to the nearest integer? 5 What is the square root of 379293 to the nearest integer? 616 What is the ninth root of 313014 to the nearest integer? 4 What is the square root of 1860926 to the nearest integer? 1364 What is the fourth root of 5747283 to the nearest integer? 49 What is 683949 to the power of 1/5, to the nearest integer? 15 What is the square root of 1208271 to the nearest integer? 1099 What is the third root of 249039 to the nearest integer? 63 What is the third root of 2401117 to the nearest integer? 134 What is the square root of 4206268 to the nearest integer? 2051 What is 2309542 to the power of 1/3, to the nearest integer? 132 What is the seventh root of 213491 to the nearest integer? 6 What is 441373 to the power of 1/3, to the nearest integer? 76 What is the square root of 81352 to the nearest integer? 285 What is 51063 to the power of 1/10, to the nearest integer? 3 What is 3114747 to the power of 1/2, to the nearest integer? 1765 What is 127956 to the power of 1/3, to the nearest integer? 50 What is the square root of 1956039 to the nearest integer? 1399 What is the square root of 1314435 to the nearest integer? 1146 What is the square root of 26959697 to the nearest integer? 5192 What is 4300327 to the power of 1/3, to the nearest integer? 163 What is the third root of 2945040 to the nearest integer? 143 What is the square root of 758915 to the nearest integer? 871 What is the third root of 4764879 to the nearest integer? 168 What is 4043374 to the power of 1/2, to the nearest integer? 2011 What is 753422 to the power of 1/10, to the nearest integer? 4 What is the square root of 5964637 to the nearest integer? 2442 What is the cube root of 21623217 to the nearest integer? 279 What is 1287311 to the power of 1/5, to the nearest integer? 17 What is the tenth root of 1628871 to the nearest integer? 4 What is the ninth root of 352642 to the nearest integer? 4 What is 227668 to the power of 1/2, to the nearest integer? 477 What is the third root of 429141 to the nearest integer? 75 What is 54104 to the power of 1/9, to the nearest integer? 3 What is 113711 to the power of 1/10, to the nearest integer? 3 What is the third root of 3422419 to the nearest integer? 151 What is 221891 to the power of 1/6, to the nearest integer? 8 What is 8753639 to the power of 1/2, to the nearest integer? 2959 What is 165997 to the power of 1/3, to the nearest integer? 55 What is 6191209 to the power of 1/3, to the nearest integer? 184 What is the third root of 199039 to the nearest integer? 58 What is the cube root of 224570 to the nearest integer? 61 What is the square root of 36924 to the nearest integer? 192 What is the third root of 2408506 to the nearest integer? 134 What is the cube root of 1051877 to the nearest integer? 102 What is the square root of 3033608 to the nearest integer? 1742 What is 519480 to the power of 1/3, to the nearest integer? 80 What is the cube root of 755215 to the nearest integer? 91 What is 22295696 to the power of 1/3, to the nearest integer? 281 What is 14973806 to the power of 1/10, to the nearest integer? 5 What is the square root of 430942 to the nearest integer? 656 What is 6886789 to the power of 1/3, to the nearest integer? 190 What is 1393678 to the power of 1/5, to the nearest integer? 17 What is the fourth root of 6618267 to the nearest integer? 51 What is the third root of 48194 to the nearest integer? 36 What is the tenth root of 7416074 to the nearest integer? 5 What is the tenth root of 100674 to the nearest integer? 3 What is the third root of 4566 to the nearest integer? 17 What is the tenth root of 252179 to the nearest integer? 3 What is the cube root of 9737481 to the nearest integer? 214 What is 10306032 to the power of 1/3, to the nearest integer? 218 What is the ninth root of 3426571 to the nearest integer? 5 What is 3274281 to the power of 1/7, to the nearest integer? 9 What is the fifth root of 3080207 to the nearest integer? 20 What is 365901 to the power of 1/5, to the nearest integer? 13 What is the tenth root of 34924363 to the nearest integer? 6 What is the fifth root of 241125 to the nearest integer? 12 What is 18683343 to the power of 1/8, to the nearest integer? 8 What is the square root of 39097972 to the nearest integer? 6253 What is the square root of 95251 to the nearest integer? 309 What is 189222 to the power of 1/9, to the nearest integer? 4 What is 159751 to the power of 1/4, to the nearest integer? 20 What is the square root of 75284 to the nearest integer? 274 What is the ninth root of 10645754 to the nearest integer? 6 What is the fifth root of 3376821 to the nearest integer? 20 What is 3047186 to the power of 1/2, to the nearest integer? 1746 What is 905441 to the power of 1/2, to the nearest integer? 952 What is 1445453 to the power of 1/5, to the nearest integer? 17 What is the third root of 290337 to the nearest integer? 66 What is the fifth root of 6021087 to the nearest integer? 23 What is the square root	{ "pile_set_name": "DM Mathematics" }
+ 2014809/857. Let p = a + 807/21425. Do 0 and p have the same value? False Let n be 91/35 + (-4)/(-10). Suppose -s = -2p + 12, -2s - 16 = -5p + np. Which is bigger: p or 2? p Let s = 492829/53 - 9299. Is s at most -1? False Let l be 3/15 + -1 + 7/(-35). Let d be 1 + 2/(-3) + l/(-1). Is d at least 0? True Let b = -7065143/361 + 19571. Is b bigger than -1? True Let s(r) = 13r - 1. Let v(b) = b2 - 7b + 7. Let i be v(6). Let n be s(i). Suppose x - 4x + n = 0. Is 3 at most as big as x? True Let y = -49608626878/30955317 - -2/1820901. Let v = -1602 - y. Which is bigger: 0 or v? v Let s(x) = -7x + 0x2 + x2 + 2x + 4. Let f be s(5). Let g = -87 - -86.8. Does f = g? False Suppose 11 = 45n - 34n. Does -30/271 = n? False Let p = 2157 - 2153. Let n = -0.1 + 2.1. Which is smaller: n or p? n Let o be 3(755/190 - 4). Which is bigger: 0 or o? 0 Suppose -c = i + 2i + 62, 0 = c - 1. Let b be 8 - (-7)/(i/(-12)). Let f be ((-18)/(-12))/(b/2). Which is smaller: f or 11? f Let f = 19 - 33. Let n be 1/((-9)/(-6)) + f/21. Does n = -1/115? False Let o = 3.5 + -0.5. Let q = 2.12 - 1.854. Let t = 0.034 + q. Which is greater: o or t? o Let h(s) = 3s3 - s2 - 2s. Let c be h(2). Suppose 4y + c = -2a, -2y + 20 = -7y. Let w = 1 + a. Is 2 at least as big as w? True Let p(h) = -90002h + 4. Let w be p(8). Let m = w - -7913791/11. Let b = m - -577. Which is greater: 1 or b? 1 Let g = 8.3 - 6.3. Let h = 183 - 1284/7. Is g >= h? True Let h(r) = 15r*2 + 2r + 4. Let m be h(-2). Let l be (-355)/m - 4/(-6). Is l smaller than -4? True Let x = 116148/145 - 801. Which is smaller: 0 or x? 0 Suppose 5m + 2j - 44 + 431 = 0, 2m - 4j + 174 = 0. Is m at least as big as -78? False Suppose 1 = -3g + 13. Let c be 412/90 + (-108)/(-486). Which is bigger: c or g? c Let r be ((-7)/(-12) + 8/(-16))(-632)/4582. Let m be 21/(-1 - -3). Which is bigger: r or m? m Let y = -525 + 597. Is y <= 71? False Let y be ((-10)/4 + -1)(-4 + 0). Suppose 5q = 4d - 10 - 1, 5d = -3q - y. Is -3 < q? False Let g = -1.59 - -1.79. Let u = -31 + 34.8. Let z = g + u. Which is smaller: -1 or z? -1 Let z(c) = 26c2 + 67c - 2. Let h be z(-2). Is -41 greater than or equal to h? False Let v be (-1 + 1 - 0) + (-560)/152. Which is smaller: v or -3? v Let l be (-2169)/(-12) - 3/1. Let z = l + -117. Let c = 60 - z. Is c smaller than -2? False Let a = 973.9 + -963. Is -2 < a? True Let h(q) be the first derivative of -q*3/3 + 3q*2/2 + q - 5. Let f be h(0). Is 2/105 at least f? False Let n = -49 - -59. Which is smaller: n or -0.1? -0.1 Let o(w) = -6w + 105. Let v be o(-27). Which is greater: v or 265? v Let y = 8 + -8.3. Let c be ((-10)/190)/((-10)/10). Which is smaller: y or c? y Let m = 8 + -3. Let x = m - -3. Let p = 9 - x. Which is smaller: p or -3? -3 Let h(g) = -72g + 541. Let m be h(8). Does m = -21? False Let i = -20.87 - -9.87. Which is greater: i or 55? 55 Let r be (-9045)/20 + (-2)/(-8). Which is bigger: r or -451? -451 Suppose -5o - 36 = 184. Let y be (-12)/(-66) + 30/o. Which is smaller: 0.7 or y? y Suppose 2k - 3 = 7. Suppose 9 = ka - 21. Let d = -9 + a. Is d not equal to -5? True Suppose 0 = -11a + 3a - 32. Let h(t) = t*2 - 5t - 4. Let z be h(5). Are z and a unequal? False Let i = 5516551698/2225 - 2479349. Let d = i + 1/445. Which is smaller: 1 or d? d Let i = 42 + -66. Let b be 4 + 44/(-10) + i/(-10). Is 5 < b? False Let d = -3.99 - -2.99. Which is greater: 378 or d? 378 Let p(f) = 3f3 - 2f*2 + 1. Let a be p(1). Let b = 68 - 40. Suppose 2n + 5z = z - 8, -3z - b = -4n. Which is smaller: a or n? a Suppose -h - 27 = -2y, -2h - 7 = -5y + 45. Let n be h/(-3) + 5/(-15). Let t be 14 + -13 - 7/n. Which is smaller: 0 or t? 0 Let a(c) = -c - 1. Let y be a(-3). Let i = 2 - y. Suppose -20 = -4z, -5t + 2z - 11 + 81 = i. Is t < 16? False Let o = 1.35 - -56.65. Let t = -59.8 + o. Is -0.1 equal to t? False Suppose 4z + 22 = -2b, -2b + 0 + 2 = -4z. Let i = -13 - -15. Suppose -3u = -4s - 6, -5u = is - 0s + 16. Is z at least as big as u? False Let g = -12 + 17. Suppose 3s - g = 7. Suppose 2w + 5 = 13. Is w less than or equal to s? True Let w(h) be the third derivative of -h6/120 + h5/12 - h4/6 + h2. Let p be w(4). Are p and 5 nonequal? True Suppose -2o - 4 = -4o. Let f = o + 7. Let d be (0/(f/3))/(-2). Which is bigger: d or -9/7? d Let v = 329 - 328.5. Which is smaller: -49 or v? -49 Let z = -92514792/637 + -943883361979/114660. Let l = z - -8377306. Let s = 205/4 - l. Is -1 at most as big as s? True Let p = 0 + -2. Suppose 5l - 19 = 3z - 0, 3l = 15. Let g = z + p. Are g and 1 unequal? True Suppose 2o = 3o - 2668. Let v = o + -8081/3. Let j = -2843/111 - v. Which is smaller: 1 or j? j Let f(v) = -v - 10. Let o be f(-7). Let y be 4/o - 1/(-3). Let g be -1 + 3 + (-91)/45. Is y at least as big as g? False Let r be 784/280(-6)/7. Which is greater: -1 or r? -1 Let l(s) = -s*3 + 14s*2 + 10s - 15. Let m be l(14). Let z = -4873/39 + m. Which is bigger: z or 1? 1 Let k = -346.6534 - 0.2466. Let m = 326 + k. Let f = 21 + m. Is -21 less than or equal to f? True Suppose 0 = h + 20c - 16c + 552, 5h + 2c = -2850. Is h at most -572? True Let x = 1054 + -7348/7. Which is bigger: 3 or x? x Let y be 3/(-8) + 187/136. Is y < -15/59? False Let a = 15 + -10. Suppose n = -an + 6. Let z be (7 - 6) + 4n. Is z != 6? True Suppose 0r + r = -5. Let c be (-13)/r - 4/(-10). Suppose -3 = 2l - cl. Is 12/7 at most l? True Suppose 4h = -8 - 0. Let z = -7664 + 7663. Does z = h? False Let c = -2 + 1. Let w = 2.54 + -0.44. Let v = w + -3.1. Is c greater than v? False Let y = -128 + 149. Let j be (-55)/(-2)4/5. Are y and j equal? False Let d = -495 - -495.2. Which is greater: 553 or d? 553 Let v be (-25)/(-6) - (-12)/(-72). Suppose -2h - 4l = -0h - 28, 20 = vl. Suppose 5w - 5 = d, -hd - 5 = d - 5w. Are 11 and d equal? False Suppose 4k - k = -3d + 27, -2d = 5k - 42. Let j = k + -12. Are -4 and j unequal? False Let y = 47.8 - 1.8. Let l = -45 + y. Is -0.41 greater than l? False Suppose -2l = -12 + 36. Suppose -10s - 1 = -9s, -i = -5s + 7. Is i greater than or equal to l? True Let p = -43 - -48. Suppose 0 = 3u + u, pu = -3a + 3. Which is smaller: 1/7 or a? 1/7 Suppose 5q - 14 = 16. Let b = q + -11. Let u = b + 6. Is u equal to 1? True Let k = 0 + 0.1. Let v = 108 - 106. Let w be (-2(-3)/(-8))/(v/8). Which is smaller: w or k? w Let n(v) = v2 + 5v + 1. Let r be n(-4). Let z be 1 - (r - 627/(-156)). Let u = z + 137/1716. Is u at most as big as 1? True Let s be (-1)/((-5864)/1956 + 3). Let m = 949/2 + s. Is m less than or equal to -15? False Let i = -909569/9 - -101601. Let l = i + -539. Which is greater: 0.1 or l? 0.1 Let b = -6 + 4. Let w(n) = -12n - 9. Let m be w(7). Let k be 8/28 - m/(-105). Which is bigger: k or b? k Let c be (1 + -2 + 0)/(-1). Suppose 6i - 5v = 4i + 93, 4v = 2i - 88. Let p = 103/3 - i. Which is greater: c or p? c Let h = -1287 - -1289. Which is bigger: h or 100/59? h Let r be 44/35 + 2 - (-20)/(-50). Which is smaller: r or 4? r Let i = 51/31 + -5275/3131. Is 1 greater than i? True Let z be (-3)/371. Suppose 0c - 5c - 10 = -3d, -5c - 2d - 10 = 0. Let p be (2 + -4 - z) + c. Is p not equal to 0? True Let w(s) = -s3 + 5s + 33. Let r be w(5). Is r less than or equal to -68? False Let w = 41802/2359 + -2/337. Is 17 >= w? False Let j = 0 + -25. Let q be ((-20)/j)/(-5 - -3). Let z = -2 + 2.06. Is q at most z? True Let z = -26 + 26.41. Let f = z - 0.31. Is 2/5 < f? False Let f = 21 - 12. Let k(y) = -4y2 - 15y + 1. Let b(n) = 3n2 + 14n. Let v(i) = 5b(i) + 4k(i). Let l be v(f). Which is bigger: 14 or l? 14 Let s be 8/2 + (-465)/117. Let n = -4/39 + s. Is n at most as big as -1? False Let x = 204 - 347. Let r = 139.95 + x. Let f = 0.05 + r. Which is greater: f or -1/3? -1/3 Suppose -3t - 13d + 9d - 605 = 0, -215 = t - 2d. Is t less than or equal to -206? True Suppose 4n + 3r - 256 = 0, -5r = n - 82 + 18. Which is bigger: 62 or n? n Let q(l) = -l + 29. Let v be q(30). Do 14/67 and v have the same value? False Let d(j) be the third derivative of -j6/10 - j5/60 - 8j*2. Suppose 4 = -5l - 1. Let u be d(l). Which is greater: u or 12? 12 Let f = -1928/9 - -214. Let r = -13/63 + f. Which is greater:	{ "pile_set_name": "DM Mathematics" }
ndred? 1300 Let l = 6268.72 - 6167. Let w = 0.28 + l. Let z = w + -102.0041. What is z rounded to 3 dps? -0.004 Let a be -3 - (-12)/(-4)-1. Suppose a = -0p - 2p - 70. Let d = p + -155. What is d rounded to the nearest one hundred? -200 Let b = -49 + 49.0464. Let n = -0.03 + b. What is n rounded to 3 dps? 0.016 Let j(h) = -1375004h - 32. Let b be j(-8). Round b to the nearest one million. 11000000 Let v = -403 - -427. What is v rounded to zero dps? 24 Let t = 3.264 - 2.6634. What is t rounded to two decimal places? 0.6 Let t = 783.5 - 2028.9. What is t rounded to the nearest ten? -1250 Suppose -3h + 6 = 2w, w + w = 5h + 22. Let p be 82/26 - (-4)/(-26). Let v be 4/w171 + p. What is v rounded to the nearest ten? 120 Let s = -70.75 - -11.746. Let r = s - -59. Round r to two decimal places. 0 Let i = -2485.6226 - -2398.622624. Let c = i + 87. What is c rounded to five dps? 0.00002 Let j = -116.36 + 138.3546. Let n = -51 - -73. Let g = n - j. Round g to three dps. 0.005 Let y = 42539.3791 - 42792.39. Let o = 250 - 503. Let u = y - o. Round u to 3 decimal places. -0.011 Let n = 13.06 - 7.3. What is n rounded to 0 dps? 6 Let v be (16 + -6)(-94000)/2. What is v rounded to the nearest 100000? -500000 Let w = -122.77 - -122. Let d = w + 0.77066. Round d to 4 dps. 0.0007 Let b(z) = -255z - 4. Let p be b(-4). Suppose -4r - r = 2c - 1242, -4r + 4c = -p. Let d be r/(12/3 + -3). Round d to the nearest 100. 300 Let o = 52.5 - 52.5673. What is o rounded to 2 decimal places? -0.07 Let r = -2742 - -5110. Suppose -5t - r = -9t. Let s be (t/(-3))/((-26)/24375). What is s rounded to the nearest ten thousand? 190000 Let a = -187272 - -187121.887. Let q = a - -0.113. Let u = 142.7 + q. Round u to the nearest integer. -7 Let s = -82.99999176 - -83. Round s to 6 dps. 0.000008 Let d = 845.7998531 + -722.79985348. Let g = d + -123. What is g rounded to 7 decimal places? -0.0000004 Let k = 108.6 - 99. Let a = k - -45.8. What is a rounded to the nearest 10? 60 Let y = 182790151 + -120419923. Suppose -5j + 37129772 + y = 0. What is j rounded to the nearest one million? 20000000 Let r = 0.0774 + -0.0184. What is r rounded to 2 dps? 0.06 Let u = -3433.3 + 3642. Round u to the nearest ten. 210 Let w = -95.0244981 - -5.0245391. Let k = 90 + w. What is k rounded to five dps? 0.00004 Let j(c) = 35236c*2 + 6c - 17. Let i be j(6). Let h = i - -2041485. What is h rounded to the nearest 100000? 3300000 Let w = 49.964 + -66.9664. Let y = w + 17. Round y to 3 decimal places. -0.002 Let p = 4607813947.00000051 - 4607813912. Let k = -35 + p. Round k to seven decimal places. 0.0000005 Let p be (36 - -5) + (-6)/2. Suppose -9600000 = 42b - pb. What is b rounded to the nearest one million? -2000000 Let t(v) = 134029v3 + 2v*2 + 25v + 12. Let a be t(4). What is a rounded to the nearest 1000000? 9000000 Suppose -3c - 3v = -2c - 1335, -2669 = -2c - 5v. What is c rounded to the nearest 100? 1300 Let d = -2588.3 - -2777. What is d rounded to the nearest one hundred? 200 Let a = -7.880176 - -7.88. Round a to five dps. -0.00018 Let l = -10.66 + 1.26. Let i = 9.67 + l. Round i to one dp. 0.3 Let j = 0.1438997501 + -0.1439. Round j to 7 dps. -0.0000002 Suppose -62588 = -36f - 232724. Round f to the nearest one hundred. -4700 Let y = 83235.34443 + -83235. Let s = y + -0.343. What is s rounded to four dps? 0.0014 Suppose 0 = 3h + 6h - 2745. Let l = h + -218. Round l to the nearest 10. 90 Let n = 44 - 40. Suppose 0 = -5u + u - nj + 1860, 0 = -4u - 5j + 1862. What is u rounded to the nearest ten? 460 Let b = -64 - -91. Let a = -27.21 + b. Let l = a + 0.210024. What is l rounded to 6 decimal places? 0.000024 Let d = -610467059 + 610467120.7000633. Let r = d - 61.7. Round r to 5 dps. 0.00006 Suppose -2v - 2v = -i - 10, 0 = 3v + 3i - 15. Suppose -2s + 44 = -vx + 9, 4x = 3s - 45. Let t be (-5)/(x/(-8))48. Round t to the nearest ten. -130 Let c = 2.25 - -139.75. Let s = -17730313248 + 17730313106.00000107. Let i = c + s. Round i to 7 decimal places. 0.0000011 Let l(s) = s2 - 8s - 5. Let a be l(9). Let t be (-6 + a)-19500. Suppose 4w - t = 5w. Round w to the nearest ten thousand. -20000 Let v = -93 + 89.74. What is v rounded to 1 dp? -3.3 Let g = -3119 + 3258.1. What is g rounded to 0 dps? 139 Let w be 7 + (-9)/(4 - 1). Let r be (-40524)/21 + w/(-14). Round r to the nearest one hundred. -1900 Let z be (2160/7)/(17/(-6545000)). Round z to the nearest one million. -119000000 Let w be (-3)/(12/28) - -3. Suppose 0 = -k + 5k + 36. Let g be ((-210)/w)/(k/84). What is g rounded to the nearest 100? -500 Let v = -1331.46 - -1312. Round v to 0 dps. -19 Let z = -0.479653 + 0.059569. Let n = 0.42 + z. What is n rounded to 5 decimal places? -0.00008 Let d = -0.0366 - -0.039532. Round d to 3 dps. 0.003 Let y(k) = -19184k + 452. Let d be y(-22). What is d rounded to the nearest ten thousand? 420000 Let i(d) = 88002d2 + 4d - 96. Let l be i(6). What is l rounded to the nearest 1000000? 3000000 Let t = 279614.69721 + -279456.69720709. Let z = t - 158. Round z to 6 decimal places. 0.000003 Let z = -0.176998235 - -0.177. What is z rounded to six decimal places? 0.000002 Let b = 0.076343558 + 5.423658602. Let w = 5.5 - b. Round w to seven decimal places. -0.0000022 Let u = 45 + -49.6. Let i = u + -0.3. What is i rounded to zero dps? -5 Let r(h) = 4550h. Let p be r(-10). What is p rounded to the nearest ten thousand? -50000 Let y = -764.9999827 + 765. Round y to five dps. 0.00002 Let y(v) = 44v + 181. Let o be y(-4). Suppose -a + 2d - 345886 - 954106 = 0, -2d + 3899996 = -3a. Let f be o/(10/a) - -1. Round f to the nearest 100000. -700000 Let g = 147 - 2737. What is g rounded to the nearest one thousand? -3000 Let o = 2.44 + 99.56. Let h = -102.069 + o. What is h rounded to 2 decimal places? -0.07 Let x(y) = -2y*2 - y + 304700. Let g be x(0). Suppose -3c - 8c = g. What is c rounded to the nearest one thousand? -28000 Let v = -602.21948 + 602.5. Let o = 0.28 - 0.56. Let j = o + v. What is j rounded to 4 dps? 0.0005 Let h = -6025.3 + 5732. Let v = 307 + h. Round v to the nearest 10. 10 Let i be -3512(-1476708)/(-18). Let j = i - -59456520. What is j rounded to the nearest one million? 25000000 Let w = -0.06152 - -0.035. What is w rounded to 3 decimal places? -0.027 Let s = 933 + -653. Let o = s - 286.04. What is o rounded to 0 decimal places? -6 Suppose -4l + 5v + 354037 = 14032, 2v = 3l - 255002. What is l rounded to the nearest one hundred thousand? 100000 Let n = 42 - -106. Let d = n + -148.0000011. What is d rounded to 6 decimal places? -0.000001 Let z = 0.004 - 51.004. Let a = 3380.42 - 3432. Let n = z - a. Round n to one dp. 0.6 Let q = -0.0461 - -0.1497. What is q rounded to two decimal places? 0.1 Let l = -935 - -2005. Round l to the nearest one thousand. 1000 Let z = 869 + -562. Let u = z + -339.4. What is u rounded to the nearest integer? -32 Suppose -g + 3g - 16 = 0. Suppose 0 = gy - 5y + 18. Let r be y/39 + (-6695010)/(-65). What is r rounded to the nearest 10000? 100000 Let d = -29.1962852 - -28.06626. Let t = -1.13 - d. What is t rounded to six dps? 0.000025 Let m = -0.0187662 + 0.01951. Round m to 5 dps. 0.00074 Let j = -1861.6 - -2268. Let o = j - 201.5. Let z = o - 215. What is z rounded to 0 decimal places? -10 Let k = -157 - -49. Let b = -658 - k. What is b rounded to the nearest 1000? -1000 Let s = -607 - -606.99998876. What is s rounded to six dps? -0.000011 Let n = -383.004 - -139.41. Let w = 244 + n. Round w to 2 dps. 0.41 Let z = 21 + -19. Suppose -j = 5d - 3005, 3j - d + zd - 9001 = 0. Suppose -4c = c + j. What is c rounded to the nearest one thousand? -1000 Let t = 1.22 - 1.2. Let n = 14.007 + -14. Let q = n + t. What is q rounded to two decimal places? 0.03 Let z = -687 + 686.998019. Round z to three decimal places. -0.002 Let u = -24 - -3. Let s = u - -21.24. Let q = -0.24086 + s. What is q rounded to 4 dps? -0.0009 Let m = -0.7388 - 45.3912. What is m rounded to the nearest integer? -46 Let b = -61.2039 - 0.7361. Round b to the nearest 10. -60 Let s = 1.8 + -1.03. Let w = -0.7700013 + s. Round w to 6 dps. -0.000001 Let i = -2549 + 2547.051. Let k = 2.07 + i. What is k rounded to two decimal places? 0.12 Let a = -6 + 5.99	{ "pile_set_name": "DM Mathematics" }
from znhnfunupnun? 5/66 Two letters picked without replacement from rkvylyyy. What is prob of picking 2 y? 3/14 Calculate prob of picking 1 t and 1 y when two letters picked without replacement from {x: 2, f: 6, a: 1, y: 4, t: 3}. 1/10 Calculate prob of picking 1 k, 1 a, and 1 e when three letters picked without replacement from akxke. 1/5 Two letters picked without replacement from gnznkggkgkngk. What is prob of picking 2 g? 5/39 Two letters picked without replacement from {g: 7, j: 7}. Give prob of picking 1 j and 1 g. 7/13 Three letters picked without replacement from {f: 15, u: 5}. Give prob of picking 3 f. 91/228 Calculate prob of picking 1 y, 1 t, and 1 z when three letters picked without replacement from {y: 2, n: 1, g: 1, z: 2, r: 1, t: 1}. 1/14 Three letters picked without replacement from {a: 2, b: 2, f: 2, t: 4}. What is prob of picking 1 b and 2 f? 1/60 Four letters picked without replacement from {a: 3, e: 3, g: 5, r: 2}. Give prob of picking 3 a and 1 e. 3/715 What is prob of picking 2 k, 1 u, and 1 j when four letters picked without replacement from {j: 2, k: 7, u: 3, c: 3}? 6/65 What is prob of picking 3 w when three letters picked without replacement from {w: 7, k: 4}? 7/33 Four letters picked without replacement from pvqpvqwwqwvpvp. What is prob of picking 1 q, 2 v, and 1 p? 72/1001 Two letters picked without replacement from {k: 13, w: 3}. Give prob of picking 2 w. 1/40 Two letters picked without replacement from {o: 8, f: 4, d: 1}. What is prob of picking 1 d and 1 o? 4/39 Three letters picked without replacement from ccccpcccqccqqqccqcqq. What is prob of picking 1 p and 2 q? 7/380 Three letters picked without replacement from {o: 2, k: 1, u: 8, z: 7, m: 2}. What is prob of picking 1 m, 1 u, and 1 o? 8/285 Calculate prob of picking 1 k, 1 g, and 1 m when three letters picked without replacement from {m: 1, k: 7, o: 1, g: 6}. 6/65 Three letters picked without replacement from {f: 8, x: 8, j: 1}. What is prob of picking 2 x and 1 j? 7/170 Three letters picked without replacement from {y: 1, j: 3, b: 1, h: 2, x: 3, d: 5}. What is prob of picking 2 j and 1 y? 3/455 Calculate prob of picking 1 z and 1 f when two letters picked without replacement from {z: 1, p: 1, n: 1, f: 3, t: 1}. 1/7 What is prob of picking 1 r and 2 z when three letters picked without replacement from {z: 3, r: 17}? 17/380 What is prob of picking 1 l, 1 j, and 1 w when three letters picked without replacement from iiilwiwwijii? 3/220 What is prob of picking 4 s when four letters picked without replacement from sjssssssssssj? 6/13 Calculate prob of picking 2 e when two letters picked without replacement from xxxxexxexexxxxxxxxe. 2/57 What is prob of picking 1 m and 2 s when three letters picked without replacement from {f: 1, s: 2, m: 1, z: 1}? 1/10 Two letters picked without replacement from {c: 1, y: 2, g: 1}. What is prob of picking 2 y? 1/6 Four letters picked without replacement from cvjyllyvjjjlll. What is prob of picking 2 v and 2 j? 6/1001 Calculate prob of picking 4 r when four letters picked without replacement from {n: 9, r: 9}. 7/170 Four letters picked without replacement from {j: 5, t: 1, m: 3}. What is prob of picking 1 t and 3 j? 5/63 Two letters picked without replacement from elyll. Give prob of picking 1 l and 1 e. 3/10 Four letters picked without replacement from mmjammxammmxamaz. What is prob of picking 1 j, 1 m, and 2 x? 2/455 Calculate prob of picking 2 x when two letters picked without replacement from vxhkmvhmnxmhx. 1/26 Four letters picked without replacement from jtmjjjjmjjttt. What is prob of picking 1 m and 3 j? 14/143 Calculate prob of picking 1 f and 2 i when three letters picked without replacement from {f: 2, e: 3, n: 4, d: 4, i: 3}. 3/280 Four letters picked without replacement from {l: 1, p: 2, a: 2, i: 4}. What is prob of picking 3 i and 1 a? 4/63 What is prob of picking 2 t, 1 c, and 1 a when four letters picked without replacement from {d: 2, t: 2, x: 2, a: 1, c: 2, l: 5}? 2/1001 Four letters picked without replacement from jtzymmjtymzymtzymzz. Give prob of picking 1 j, 1 z, and 2 m. 25/969 Calculate prob of picking 1 q and 2 d when three letters picked without replacement from qadvdhddqd. 1/6 What is prob of picking 4 a when four letters picked without replacement from aaaaanaaaan? 21/55 Calculate prob of picking 1 h and 1 m when two letters picked without replacement from {m: 2, d: 1, h: 1}. 1/3 Calculate prob of picking 1 a and 2 r when three letters picked without replacement from {f: 3, r: 6, a: 6}. 18/91 Four letters picked without replacement from rmmmmmmmmmrmmrmrrrm. What is prob of picking 1 m and 3 r? 65/969 Calculate prob of picking 3 l when three letters picked without replacement from {l: 3, j: 8}. 1/165 Two letters picked without replacement from skstsststti. Give prob of picking 1 k and 1 i. 1/55 Two letters picked without replacement from {u: 1, z: 1, v: 1, w: 3, g: 2, a: 4}. What is prob of picking 1 z and 1 g? 1/33 What is prob of picking 2 k when two letters picked without replacement from {l: 2, k: 3, m: 3, g: 5}? 1/26 Calculate prob of picking 1 b and 1 d when two letters picked without replacement from oodobzdzpzbe. 2/33 What is prob of picking 3 u when three letters picked without replacement from dssdduuudduussd? 2/91 Calculate prob of picking 4 w when four letters picked without replacement from {w: 5}. 1 Two letters picked without replacement from {q: 1, k: 2, z: 6, d: 2, g: 5}. Give prob of picking 2 z. 1/8 Calculate prob of picking 2 b when two letters picked without replacement from bbbb. 1 Calculate prob of picking 1 v and 2 r when three letters picked without replacement from rrrddvwdrghgwhhhwdw. 2/323 Three letters picked without replacement from {e: 2, l: 2, y: 1, q: 1, u: 1}. Give prob of picking 1 q, 1 y, and 1 l. 2/35 Calculate prob of picking 1 w, 1 l, and 2 q when four letters picked without replacement from dhbhhdhlqdwwdlwlq. 9/2380 What is prob of picking 1 s, 1 n, and 1 m when three letters picked without replacement from {s: 4, n: 2, g: 2, m: 3, z: 2}? 12/143 What is prob of picking 2 t when two letters picked without replacement from ppptttptttt? 21/55 Three letters picked without replacement from nnnnncnccnncnnnc. What is prob of picking 2 n and 1 c? 55/112 Calculate prob of picking 1 f and 1 t when two letters picked without replacement from qtf. 1/3 Calculate prob of picking 2 h, 1 z, and 1 b when four letters picked without replacement from bhgebzh. 2/35 Three letters picked without replacement from {x: 1, l: 4, i: 3, q: 4, j: 2}. Give prob of picking 2 i and 1 j. 3/182 Three letters picked without replacement from oaalmmmsljoalassl. Give prob of picking 2 a and 1 m. 9/340 What is prob of picking 2 s and 1 a when three letters picked without replacement from kkkxkxxrssxsaxkak? 3/340 Two letters picked without replacement from aklkkpkkl. What is prob of picking 1 k and 1 p? 5/36 Calculate prob of picking 1 s, 1 y, and 2 z when four letters picked without replacement from slyzlzz. 3/35 What is prob of picking 1 k, 1 o, and 1 x when three letters picked without replacement from wxkto? 1/10 What is prob of picking 1 w, 1 r, and 1 t when three letters picked without replacement from itirrriwtwtwwww? 54/455 Calculate prob of picking 1 u, 1 c, and 1 l when three letters picked without replacement from ulcuc. 2/5 Four letters picked without replacement from {s: 2, i: 3}. Give prob of picking 2 s and 2 i. 3/5 Calculate prob of picking 2 w when two letters picked without replacement from xwxoxejooooewoooo. 1/136 Calculate prob of picking 2 a and 1 m when three letters picked without replacement from aaaammduasmmuuffsa. 5/68 Calculate prob of picking 1 k and 3 f when four letters picked without replacement from {k: 6, f: 7}. 42/143 Two letters picked without replacement from {o: 10, d: 2, x: 1, n: 1}. What is prob of picking 1 x and 1 n? 1/91 Four letters picked without replacement from {e: 5, n: 3, w: 1, f: 1, z: 1}. What is prob of picking 1 w and 3 f? 0 Calculate prob of picking 2 p when two letters picked without replacement from tptppppptpp. 28/55 Calculate prob of picking 2 w and 1 d when three letters picked without replacement from {d: 9, w: 6, k: 4}. 45/323 Four letters pi	{ "pile_set_name": "DM Mathematics" }
is the tens digit of 178? 7 What is the tens digit of 12431? 3 What is the thousands digit of 27186? 7 What is the hundreds digit of 547? 5 What is the units digit of 18374? 4 What is the units digit of 1440? 0 What is the units digit of 132? 2 What is the tens digit of 46128? 2 What is the units digit of 3219? 9 What is the tens digit of 1846? 4 What is the units digit of 13213? 3 What is the ten thousands digit of 11623? 1 What is the units digit of 823? 3 What is the hundreds digit of 11580? 5 What is the hundreds digit of 355? 3 What is the thousands digit of 71717? 1 What is the tens digit of 311? 1 What is the units digit of 58049? 9 What is the thousands digit of 17183? 7 What is the ten thousands digit of 41361? 4 What is the thousands digit of 38187? 8 What is the tens digit of 122? 2 What is the thousands digit of 24481? 4 What is the tens digit of 31183? 8 What is the hundreds digit of 22889? 8 What is the thousands digit of 1421? 1 What is the thousands digit of 54325? 4 What is the tens digit of 1629? 2 What is the hundreds digit of 8458? 4 What is the hundreds digit of 2160? 1 What is the tens digit of 36? 3 What is the tens digit of 1289? 8 What is the ten thousands digit of 39151? 3 What is the tens digit of 6960? 6 What is the units digit of 2149? 9 What is the thousands digit of 36781? 6 What is the hundreds digit of 60757? 7 What is the thousands digit of 1133? 1 What is the tens digit of 12020? 2 What is the ten thousands digit of 43757? 4 What is the units digit of 1771? 1 What is the units digit of 2660? 0 What is the tens digit of 354? 5 What is the tens digit of 1024? 2 What is the ten thousands digit of 55041? 5 What is the units digit of 6442? 2 What is the units digit of 61330? 0 What is the units digit of 524? 4 What is the units digit of 5683? 3 What is the hundreds digit of 25934? 9 What is the units digit of 8262? 2 What is the units digit of 1621? 1 What is the units digit of 2941? 1 What is the units digit of 7883? 3 What is the hundreds digit of 1090? 0 What is the units digit of 15437? 7 What is the hundreds digit of 37927? 9 What is the units digit of 49434? 4 What is the units digit of 673? 3 What is the units digit of 3750? 0 What is the ten thousands digit of 23255? 2 What is the tens digit of 1640? 4 What is the hundreds digit of 845? 8 What is the units digit of 7021? 1 What is the hundreds digit of 5378? 3 What is the thousands digit of 2420? 2 What is the units digit of 9667? 7 What is the tens digit of 39188? 8 What is the units digit of 114977? 7 What is the tens digit of 1689? 8 What is the ten thousands digit of 60723? 6 What is the thousands digit of 1936? 1 What is the tens digit of 12083? 8 What is the units digit of 129632? 2 What is the hundreds digit of 6865? 8 What is the units digit of 17? 7 What is the hundreds digit of 949? 9 What is the units digit of 72173? 3 What is the units digit of 29817? 7 What is the thousands digit of 5206? 5 What is the units digit of 9253? 3 What is the tens digit of 962? 6 What is the thousands digit of 1405? 1 What is the tens digit of 70197? 9 What is the units digit of 73840? 0 What is the units digit of 30390? 0 What is the units digit of 12471? 1 What is the units digit of 2204? 4 What is the tens digit of 77000? 0 What is the thousands digit of 43498? 3 What is the units digit of 1018? 8 What is the units digit of 9451? 1 What is the ten thousands digit of 21192? 2 What is the units digit of 1188? 8 What is the units digit of 7820? 0 What is the hundreds digit of 29746? 7 What is the units digit of 2492? 2 What is the thousands digit of 5623? 5 What is the tens digit of 102? 0 What is the units digit of 411? 1 What is the tens digit of 1195? 9 What is the tens digit of 25100? 0 What is the thousands digit of 9040? 9 What is the thousands digit of 58646? 8 What is the tens digit of 110? 1 What is the thousands digit of 75653? 5 What is the ten thousands digit of 56457? 5 What is the thousands digit of 51548? 1 What is the tens digit of 330? 3 What is the hundreds digit of 39944? 9 What is the units digit of 98629? 9 What is the ten thousands digit of 18856? 1 What is the hundreds digit of 453? 4 What is the units digit of 3131? 1 What is the ten thousands digit of 22342? 2 What is the tens digit of 35394? 9 What is the units digit of 8548? 8 What is the hundreds digit of 812? 8 What is the hundreds digit of 69790? 7 What is the ten thousands digit of 10928? 1 What is the ten thousands digit of 57961? 5 What is the thousands digit of 23810? 3 What is the hundreds digit of 473? 4 What is the tens digit of 32634? 3 What is the hundreds digit of 22517? 5 What is the units digit of 16? 6 What is the thousands digit of 1884? 1 What is the tens digit of 1354? 5 What is the thousands digit of 1911? 1 What is the thousands digit of 2787? 2 What is the units digit of 264? 4 What is the hundreds digit of 155239? 2 What is the ten thousands digit of 96897? 9 What is the units digit of 5926? 6 What is the tens digit of 15280? 8 What is the tens digit of 921? 2 What is the tens digit of 11787? 8 What is the tens digit of 103908? 0 What is the units digit of 78? 8 What is the thousands digit of 1259? 1 What is the tens digit of 851? 5 What is the hundreds digit of 103014? 0 What is the hundreds digit of 892? 8 What is the units digit of 48998? 8 What is the units digit of 10434? 4 What is the units digit of 808? 8 What is the units digit of 39839? 9 What is the thousands digit of 15287? 5 What is the thousands digit of 43756? 3 What is the hundreds digit of 307? 3 What is the hundreds digit of 33594? 5 What is the units digit of 20879? 9 What is the hundreds digit of 6587? 5 What is the hundreds digit of 3281? 2 What is the ten thousands digit of 55115? 5 What is the thousands digit of 9256? 9 What is the thousands digit of 3974? 3 What is the thousands digit of 3184? 3 What is the hundreds digit of 22019? 0 What is the ten thousands digit of 39402? 3 What is the units digit of 321? 1 What is the tens digit of 2562? 6 What is the units digit of 1085? 5 What is the units digit of 9920? 0 What is the tens digit of 936? 3 What is the thousands digit of 43630? 3 What is the hundreds digit of 21317? 3 What is the units digit of 541? 1 What is the units digit of 681? 1 What is the hundreds digit of 257? 2 What is the tens digit of 96813? 1 What is the units digit of 8075? 5 What is the tens digit of 756? 5 What is the hundreds digit of 86417? 4 What is the thousands digit of 10223? 0 What is the tens digit of 19327? 2 What is the units digit of 1109? 9 What is the hundreds digit of 1557? 5 What is the units digit of 1659? 9 What is the ten thousands digit of 18692? 1 What is the hundreds digit of 1242? 2 What is the thousands digit of 18483? 8 What is the thousands digit of 1179? 1 What is the tens digit of 12564? 6 What is the tens digit of 2777? 7 What is the thousands digit of 1376? 1 What is the hundreds digit of 1091? 0 What is the hundreds digit of 164776? 7 What is the tens digit of 1650? 5 What is the tens digit of 1814? 1 What is the units digit of 19875? 5 What is the hundreds digit of 100830? 8 What is the thousands digit of 43855? 3 What is the ten thousands digit of 98701? 9 What is the tens digit of 16323? 2 What is the tens digit of 91060? 6 What is the tens digit of 16873? 7 What is the units digit of 172? 2 What is the thousands digit of 50681? 0 What is the tens digit of 5174? 7 What is the tens digit of 124302? 0 What is the tens digit of 25214? 1 What is the units digit of 20190? 0 What is the tens digit of 2199? 9 What is the ten thousands digit of 163726? 6 What is the hundreds digit of 4304? 3 What is the units digit of 8508? 8 What is the units digit of 1208? 8 What is the thousands digit of 3866? 3 What is the ten thousands digit of 25043? 2 What is the units digit of 11351? 1 What is the hundred thousands digit of 155919? 1 What is the units digit of 900? 0 What is the thousands digit of 15307? 5 What is the units digit of 989? 9 What is the units digit of 32258? 8 What is the hundred thousands digit of 142432? 1 What is the thousands digit of 25303? 5 What is the tens digit of 575? 7 What is the tens digit of 810? 1 What is the thousands digi	{ "pile_set_name": "DM Mathematics" }
(458/75) Simplify (p(-28)p)/p31 assuming p is positive. p(-58) Simplify y(-2/5)/(y/(y/(y/y(-1/26)))) assuming y is positive. y(-187/130) Simplify ((d(-1)/d)/ddd/(d*(-5)d))(-8/3) assuming d is positive. d(-8) Simplify (aa/(((a(13/5)/a)/a)/a))(-25) assuming a is positive. a(-60) Simplify ((yy(2/11)/y)/y)32 assuming y is positive. y*(-288/11) Simplify (((jjj(1/4)j)/j)/j(-3))(-41) assuming j is positive. j*(-861/4) Simplify (d(d/(dd/(d/d(-2/5)d)d))/d)(-28)(d(1/3)/d)(-24) assuming d is positive. d*(24/5) Simplify (x(x/(x/(x/(x/(x(xxx20/x)/x)))))/x)/((x/(xxx/x(-1/48)))/x) assuming x is positive. x(1153/48) Simplify (p/p21)/((p/(pp/p*(4/13)))/pp) assuming p is positive. p(-251/13) Simplify (m(1/6)m/(m(-1/5)/m))/(m(3/2)/(mm/(m*(1/3)m)m)) assuming m is positive. m(38/15) Simplify ww*(-1)ww(-9) assuming w is positive. w(-8) Simplify (aaa(-7/2))/(aa*11/aa) assuming a is positive. a(-27/2) Simplify (g1)20/(g0/(g/((gg(2/9))/g))) assuming g is positive. g(187/9) Simplify ((o/o(-5/6))(-47))4 assuming o is positive. o(-1034/3) Simplify (a/a(-1))(-4/3)/((a(a/(((aa(-5))/a)/a))/aa)/aa((a/((aa(a(a/(aa*(-8)a))/a)/a)/a))/a)/aa) assuming a is positive. a(-11/3) Simplify (y(-30)/y)/yyy/((((yy/y*(-13))/y)/y)/y)y assuming y is positive. y(-41) Simplify (k/(k/(k/k1)k))50((((kk(2/3))/k)/k)/k)(2/19) assuming k is positive. k(-2858/57) Simplify (nn((n9/n)/n)/nn3)(-23/5) assuming n is positive. n(-253/5) Simplify (v(-1/2)/v)/((v/(vv0/v)v)/v)(v(-2))(-2/15) assuming v is positive. v(-67/30) Simplify ((j/(jj(-9)/j))/j(-4))/(j*(-3/2)j/j(-2/15)) assuming j is positive. j(431/30) Simplify y(-7)/(y(-19)y) assuming y is positive. y11 Simplify (c(1/3))19 assuming c is positive. c(19/3) Simplify i(-10/13)ii(-19) assuming i is positive. i(-244/13) Simplify o6/o8o*(-1/5)/o(o*0o)/o assuming o is positive. o(-16/5) Simplify (g19)(2/141) assuming g is positive. g(38/141) Simplify ((aa/a(4/11)aa)/(a(a/(aa/a(-7/3)))/a))(-7) assuming a is positive. a(-1610/33) Simplify (h/h(-6)hh4)5 assuming h is positive. h60 Simplify (b/b28b)(6/11) assuming b is positive. b(-156/11) Simplify (s4)(-18) assuming s is positive. s(-72) Simplify (k(-9)/(kk(2/11)k))(-21) assuming k is positive. k(2583/11) Simplify (s(2/19)/((s(-1/4)s)/s))(-9/7) assuming s is positive. s(-243/532) Simplify ((w/(w/(w5ww)ww))/(w(-2/3)w))/(w*4w(-4)) assuming w is positive. w(14/3) Simplify (w*(-9)ww6)/(www0)(5/9) assuming w is positive. w(-28/9) Simplify (uu(-4))/(u(-13/2)u) assuming u is positive. u(5/2) Simplify ((b/b(8/7)b)/(b/(bb14/b)))21 assuming b is positive. b291 Simplify d24/d(24/5) assuming d is positive. d(96/5) Simplify ((kk(-2/7))(27/4))15 assuming k is positive. k(2025/28) Simplify ((d/(d*3d))(-4))(-6/17) assuming d is positive. d(-72/17) Simplify o11/(oo(-4/5)) assuming o is positive. o(54/5) Simplify (i1)(-42)(i(1/4))(-9/2) assuming i is positive. i(-345/8) Simplify (((a/a(-6))/a)/(a*(-8)a))/((a/a(-1))/a(-9)) assuming a is positive. a*2 Simplify (rrr/(rr/r*2)rr)8r*8/(rrr(-2/9)rr) assuming r is positive. r(398/9) Simplify (x(-9/2)/x(4/7))(-3/4) assuming x is positive. x(213/56) Simplify u/u(-2/9)uu(uu(u/((u/u*(-7))/u))/uu)/uu/(u/(uuu(1/2)/uu))uu(-6) assuming u is positive. u(-77/18) Simplify (ccc*5c)/(c/(c/c*6))c*(-1/3)/(cc*(2/7)cc) assuming c is positive. c(-34/21) Simplify r24/(rr/r(-3/29)) assuming r is positive. r(635/29) Simplify (t*0tt/t(3/4))/(t0t(-1)) assuming t is positive. t(9/4) Simplify ((v/((v/(v/v(-4/13)))/v))/v(-1/5))/(v*(-10)/(vv(2/11))) assuming v is positive. v(9788/715) Simplify (k*(-2/19)/(kkkk/(k/(k/((k/(k*(-2)k))/k))k)))/((k/k(-2))/kkk(-5/4)k) assuming k is positive. k*(-369/76) Simplify (u/((uu*9u)/uu)u)/u(-6) assuming u is positive. u(-3) Simplify (j(-3))(-3/16)(j(1/4))(1/87) assuming j is positive. j(787/1392) Simplify j(1/46)/j(35/6) assuming j is positive. j(-401/69) Simplify (l(-2/3)l)(3/4)/(l(2/7)l(-2/17)) assuming l is positive. l(39/476) Simplify (z(-3)z(zz0)/z)/(z0)(1/13) assuming z is positive. z(-2) Simplify (u(6/5))33 assuming u is positive. u(198/5) Simplify ((d(8/5))(-30))(1/4) assuming d is positive. d(-12) Simplify (x/x(2/3))(-1)/(x(-2/3))(-1/3) assuming x is positive. x(-5/9) Simplify (a*22aa)/(aaa(-3/11)aa) assuming a is positive. a(223/11) Simplify xx*(-2/9)xxxxx(x(-6)/x)/x(xx(xx/(((x(x*4/x)/x)/x)/x))/xx)/(x/((x/(x/(xx(-5/2)x)))/x)) assuming x is positive. x(-31/18) Simplify r3/r(r(1/10)r)/r(rr0)(-48) assuming r is positive. r*(-459/10) Simplify (((l/(ll/(l/(l*15l))))/l)/(l*4l))(-1/45) assuming l is positive. l(22/45) Simplify ((ii22i)/i)1 assuming i is positive. i23 Simplify (y(-13/4))(-30) assuming y is positive. y(195/2) Simplify l(-2/69)l(1/4)/l assuming l is positive. l(-215/276) Simplify h(1/4)h/((hh/h(13/2))/h) assuming h is positive. h(27/4) Simplify ((((uu0)/u)/u)/u(1/4))(2/17) assuming u is positive. u(-5/34) Simplify ((l*(-7/2)l)/lll)/(l/(ll/l(-2/11)ll))(l*(-1/9)l)/l(-5/4) assuming l is positive. l(1513/396) Simplify ((k/(kk11))/k)(1/6) assuming k is positive. k(-2) Simplify (n/(nnn/(n/(n(((n*3n)/n)/nn)/n))))4/(n0/(n(n/n7)/n)) assuming n is positive. n(-22) Simplify (hh(-8)/h)/h(-2/19)(hh/h(-1))28 assuming h is positive. h(1446/19) Simplify ((((tt/(tt2))/t)/t)/((t1/t)/tt))(-39) assuming t is positive. t117 Simplify (dd/d1d)(-1/4)/(d(-1/4))(-31) assuming d is positive. d(-33/4) Simplify (c/(c/c*0cc))(-2/13)(c/c(1/3))11 assuming c is positive. c(298/39) Simplify (j(1/2))*(1/45)j(-3/4)/(j(-6)/j) assuming j is positive. j(1127/180) Simplify ((s7)9)(-21/4) assuming s is positive. s(-1323/4) Simplify (u(-3/11))33 assuming u is positive. u(-9) Simplify p*(-6/17)pp(-1/68) assuming p is positive. p(43/68) Simplify a/(a/(aa*(3/2)/a))(a/(aa(9/2)a))/a assuming a is positive. a*(-5) Simplify (m/(m/(mm*1/m)))/(mm/((m/m*(4/7))/m))(m(-2/5)/m)(6/5) assuming m is positive. m(-569/175) Simplify p28ppp/(pp/(p/(pp(-5)p))p) assuming p is positive. p32 Simplify u(-16/5)uu/(u(-1/4)u)u assuming u is positive. u(-19/20) Simplify (m(-4)/m)(1/10) assuming m is positive. 1/sqrt(m) Simplify (p/p(5/3)p/p*8)/((pp/((pp6p)/p))/p(4/11)) assuming p is positive. p(-76/33) Simplify tt2ttt*(-1/6)t((((ttt1/t)/t)/t)/t)/tt*4t assuming t is positive. t(53/6) Simplify (d/((d3d)/dd)d/(d/(d(-1/6)/ddd)))15 assuming d is positive. d(-65/2) Simplify (q/q(-13))/q(2/17) assuming q is positive. q(236/17) Simplify ((d(-1/12)d)/d(-8))/(d/d(-1/2)dd/(d/(d/(d/d(-2/7))))) assuming d is positive. d(563/84) Simplify u*4u*6u4/(u(-2/3)u) assuming u is positive. u(41/3) Simplify (yyyy/(yy1)yy)(-1/4)/(y(-4)/(y(1/6)y)) assuming y is positive. y(25/6) Simplify (h/(h/(h/(h/(h3/hh))h)))18 assuming h is positive. h72 Simplify l*(-2/19)ll(2/27)l(l/(l/(((l(-5)/l)/l)/ll)l))/((l0/l)/l) assuming l is positive. l(-2068/513) Simplify l(-7)l(-8/9) assuming l is positive. l(-71/9) Simplify (b(-13)/b)24 assuming b is positive. b(-336) Simplify (q(4/33)/qq)/(q/q(-2/7)) assuming q is positive. q(-269/231) Simplify ((d(-4/5)/d)/d(-1/8))/(d(d*9/d)/dd(-5)) assuming d is positive. d(-187/40) Simplify ((((ww/(w/(w/((w(1/5)/w)/w)))w)/w)/w)(-2/13))(-5/2) assuming w is positive. w(14/13) Simplify (k1/k4)/(k/((k(-2/7)/k)/kk))(5/3) assuming k is positive. k(-143/21) Simplify ((w/(w/((w(-20)w)/w)w))/w)/w(1/9) assuming w is positive. w(-199/9) Simplify (h0/h*4)/(h	{ "pile_set_name": "DM Mathematics" }
t i = 13513/6 - 2258. Find the common denominator of i and 333/(-108) - (-2)/8. 6 Let j(d) = d*2 - 4d + 8. Suppose 4 = -4x, 5o - 4x - 218 = -6x. Calculate the lowest common multiple of j(6) and o. 220 Let s = -46595 - 4693. Let v = -3692609/72 - s. What is the common denominator of 38/27 and v? 216 Let x = 313 + -301. Let q(p) = 25p - 58. Calculate the lowest common multiple of 10 and q(x). 1210 Let c = -153626 - -36716773/239. Let y = -4353/20554 + c. Find the common denominator of y and 59/14. 602 Suppose -3l + 4k = -168, 0l + 112 = 2l + 3k. Let d = -42 + l. What is the least common multiple of 2 and d? 14 Let n(x) = 6x - 6. Let q be n(3). Suppose 4 = f + q. Calculate the common denominator of 47/33 and f/28 - 785/168. 264 Let s = -61/336 + 34/21. Calculate the common denominator of -7 + (11544/(-96))/13(-7)/10 and s. 80 Let l = 330 + -235. Let m be 3/(-4) - l/(-20). Suppose -mg = -2u - 30, -3u = -u - 2. Calculate the smallest common multiple of g and 6. 24 Suppose 9 = 3z - 0. Suppose -5s - 20 = 0, -5o - 236 = 2s - zs. What is the common denominator of 61/21 and (116/o)/(-5 + 4)? 84 Find the common denominator of ((-11459)/(-1274) - 9)217/(-56) and -143/168. 4368 Let a = -8416 + 8608. Calculate the lowest common multiple of a and 64. 192 Let h = -6 + 29. Suppose -5o + 44 = 3f, -f + h = 3o - 5. Let q(a) = -a*3 - 51a*2 - 129a - 3940. Calculate the smallest common multiple of q(-50) and o. 10 Let b(c) = -c*3 - 2c*2 - 3c + 1. Let y be b(-2). What is the common denominator of -4 + (-100)/(-32) - y and 85/56? 56 What is the common denominator of (-1)/613398/4988 and -21/43? 172 Let g be ((-3653)/(-7))/((-2052)/81). Let z = g - 20/133. What is the common denominator of z and -41/6? 12 Suppose 0 = -6v + 94 + 14. Let o = 22 - v. Suppose 5d = 11 + 89. What is the least common multiple of d and o? 20 Let c = 771569/13144560 - -1/74685. Calculate the common denominator of c and -151/336. 3696 Suppose 0 = -4g + 39 - 3. Let q = -3026141/12 + 252167. Find the common denominator of 710/(-36)g/(-30) and q. 12 Let y = 25105/57 - 1315/3. Let h = y + -669/760. Let w = 766/3 - 6017/24. Calculate the common denominator of h and w. 40 Suppose 7k - 3k - 4x = 116, 0 = 4x + 4. Find the common denominator of -93/22 and k/(-77)321/24. 22 Let d = 316303/120 - 7910/3. What is the common denominator of 13/16 and d? 240 Let q(a) be the second derivative of 0 + 10a - 3a*2 - 5/3a*3. What is the smallest common multiple of q(-2) and 8? 56 Let d = 5242/7 - 347099/462. What is the common denominator of -77/160 and d? 5280 Suppose 0 = 62o - 52 - 1581 - 1777. What is the smallest common multiple of o and 1555? 17105 Find the common denominator of 49/8654 and (((-135)/441)/((-4)/7))/((-92)/161). 69232 Suppose 9t - 45 = 4t. Suppose -s + 47 = t. What is the common denominator of s3/36 - 1/(-6) and -143/54? 54 Let d be (-12)/(-72) + 27580250/(-1586046). Let p = 1398/3433 - d. Let w = p - 168/11. Calculate the common denominator of 16/9 and w. 126 Suppose 10l - 1137 = 1733. Suppose -l = -8c + 361. What is the smallest common multiple of 108 and c? 324 Let s = -30596 + 1835803/60. Find the common denominator of -71/1410 and s. 2820 Suppose -5l - 10 = -4s + 22, 8 = s - 3l. Calculate the smallest common multiple of (-10 - (-234)/(-27))(-2 - 2 - -1) and s. 56 Suppose -5o - 10 = 0, o = 5v + 3o - 121. Suppose p + u + 7 = 0, 3 = p + 4u - 2. Let n = v + p. Calculate the lowest common multiple of n and 8. 56 Let a be (5 + -828)33/24. Let n = a - -1137. Let k = 1024 + -38837/38. Find the common denominator of n and k. 152 Suppose 4q - 44 = -4k, -2q + 0k + 4k + 40 = 0. Let r = 4457 - 4405. Calculate the smallest common multiple of r and q. 364 Let v = -113 + 32. Suppose 2s + 165 = 3a, -5s - 355 = -0a + 4a. Let t = s - v. What is the lowest common multiple of 28 and t? 84 What is the smallest common multiple of 78 and ((-30)/6 - 151)/((-106)/159)? 234 Let v = -17/620936 + -59657077/1110233568. Let d = -1/596 - v. Let q = -89/18 + 265/9. Find the common denominator of q and d. 96 Suppose -5p - 395 = -5s, 73 = -0s + s - 4p. Let n = s + -84. Calculate the common denominator of 476/(-64) - (n - 2) and 19/18. 144 Let v = 60982 - 1951525/32. Let d = -84559/28 - -3024. Calculate the common denominator of v and d. 224 Suppose 0 = 19f - 21f - 12. Find the common denominator of (-58)/66 + 9 + f and 1 - -142/30. 165 Let j(v) = -15 - 274v*2 - 41v*2 + 14 + 0v + v. Let p be j(1). Calculate the common denominator of 369/p5/(-2) and 17/18. 126 Let h(r) = -3r*2 - 29r + 22. Let c = -772 - -762. What is the least common multiple of (228/(-16))/((-1)/4) and h(c)? 228 Let h(j) = -j - 1. Let l be h(-17). Suppose -88 = 12w - lw. Suppose 100 = 8f - 44. Calculate the smallest common multiple of w and f. 198 Let f(m) = -11m - 106. Let p be f(-10). Find the common denominator of 61/5 and 19/1995234/p. 70 Calculate the common denominator of -2/39 and (37/(-24))/((-3120)/(-160)). 468 Let s(x) = -5x - 1. Let q = 1 + -4. Suppose -9i = 5h - 10i - 74, 4h = -i + 52. What is the smallest common multiple of s(q) and h? 14 Suppose 6 = -4b + 38. Let x(g) = -4g + 53. Suppose -93 = -5t + a, -3t + a - 4a = -45. What is the least common multiple of x(b) and t? 126 Let y = -1268592045287/5036 - -251904694. Let c = y - -2/1259. Let k = -23269/11 - -2119. Calculate the common denominator of k and c. 44 Suppose -64b = -51b - 208. Let j(h) = -2h - 4h + 4h - 5h + 11. What is the lowest common multiple of j(-7) and b? 240 Let l = -5710 - -114197/20. Calculate the common denominator of l and (-4)/6 + (-247)/(-348). 580 Let h(z) = 3z - 11. Let y be h(4). Let f be (y - -2 - -3) + 0. Calculate the lowest common multiple of 0/1 + (8 - f) and 7. 14 Let b(v) = v*2 - 35v + 64. Let i be b(33). Calculate the smallest common multiple of i(-1)/11 - 3504/(-88) and 2. 40 Let s = 26863/6903 - 2/767. Let u = -2/2605595 + 3110559329/23450355. Let d = u - 626/5. What is the common denominator of s and d? 9 Let s = 735/16 - 11257/240. Find the common denominator of s and 72/(-102)(-14)/20. 510 Suppose -5o = -76 + 91. Calculate the common denominator of 87/536 and (-323)/(-30) - (-5)/o. 2680 Let d = 8 - -8. Let k(q) = -2q*2 + 20q + 54. Suppose -108 = -12t + 3t. Calculate the least common multiple of d and k(t). 48 Let l = -16023 - -1217803/76. Find the common denominator of 155/1026 and l. 2052 Let n be (-104444)/141/(-20). Let h = n - 2560/7. What is the common denominator of h and (-23)/(1/((-2)/3(-21)/(-84)))? 30 Let n(h) = 3h2 - 5h - 50. Let d = 214 - 208. Calculate the smallest common multiple of n(d) and 14. 28 Suppose 5 = i + 2c, -i - 5c + 17 = 3i. Suppose 8k = 4k - 4, -3 = p + ik. Let x = p - -2/21. Calculate the common denominator of x and 41/30. 210 Let p = -1083 + 1086. What is the lowest common multiple of p and (-2)/(-3)9/2? 3 Suppose -c = -2w + 4, 5 = -c + 3w - 2. What is the common denominator of (-4)/38(c - -6) and (1 + 12)20/(-32)? 152 Find the common denominator of 4363/(-340) + (-2652)/(-204) and 37/50. 1700 Suppose q = -3x + 24 + 668, -3x - 9q = -684. Calculate the least common multiple of 363 and x. 2541 Suppose 4g + 16 = 5o, -5o + 5 - 13 = 2g. Suppose o = 4z - 19 + 15. Calculate the lowest common multiple of (-18 + 20)(z + 1/2) and 6. 6 What is the common denominator of (-4428)/360 - 24/(-16) and 2/(-11) + (-1130)/(-44)? 10 Let v = 3079 + -3069. Suppose 2u + 60 = 3u. What is the smallest common multiple of v and u? 60 Suppose -16b = -3b - 24037. Suppose 3n + b + 5673 = -4g, 0 = -4n - 4g - 10024. Let q = 55031/22 + n. Find the common denominator of -143/18 and q. 198 Suppose u - 10 + 3 = 0. Find the common denominator of -36 + 41 + 16/(-5) and (15/u)/(16/280). 10 Let m = 34667/4 - 8828. Let y = m + 35481/220. Find the common denominator of -1/20 and y. 220 Suppose 53t = 46t + 560. Suppose -3l = -11r + 15r - t, -5l = -3r - 114. What is the smallest common multiple of 27 and l? 216 Suppose -4m = 3a + 18, 19a - 16*a - 12 = m. Calculate the smallest common multiple of a and 4451. 8902 Find the common denominator of ((-102)/(-176))/(199/796) and 24/11. 22 Let d = -20 - -4. Calcula	{ "pile_set_name": "DM Mathematics" }
emainder when p is divided by 34? 31 Let u(c) = -c*3 + 8c*2 - 6c + 17. Let w be u(7). Let q(r) = 11 + 4 - r*2 - w + 6 + 12r. What is the remainder when 38 is divided by q(11)? 6 Suppose 0 = 3w - 3 - 9. Suppose -4y + w = -12. Suppose -yt = -41 - 11. What is the remainder when t is divided by 8? 5 Let q(s) = 14s - 18. Let b be q(2). Suppose 9o - bo = -2. Suppose 0 = -3h + 3p + 13 + 14, -10 = oh + 5p. Calculate the remainder when 31 is divided by h. 1 Let u(f) = -f*2 + 2f - 2. Let a be u(-3). Let o = 29 + a. Let l = -6117 - -6176. What is the remainder when l is divided by o? 11 Suppose k + 554 = 3z + 303, 171 = 2z + 3k. Calculate the remainder when 753 is divided by z. 81 Let i = -781 + 767. What is the remainder when 50(8/i)/(470/(-329)) is divided by 11? 9 Let t = 4504 + -4069. Calculate the remainder when t is divided by 109. 108 Suppose -g - 2a + 38 = 15, 0 = 5g - 4a - 143. Suppose -3z + 165 = 4s, gs - 5z = 23s + 205. Calculate the remainder when 177 is divided by s. 42 Let r = 16571 - 15478. Calculate the remainder when r is divided by 378. 337 Suppose -5y - 4u = -1037, 126y = 124y + 5u + 428. Calculate the remainder when y is divided by 53. 50 Let o = -3579 - -2223. Let m be 8/36 - (-1)/(27/o). Let d = 63 + m. Calculate the remainder when d is divided by 5. 3 Let k = -28614 - -28644. Suppose 3g - 5a - 20 = 0, 2g - 3a + 4a = 9. Calculate the remainder when k is divided by g. 0 Suppose -3s - 61 = -70. Suppose -f = -sy + 145, -3y + 2f - 7f + 175 = 0. What is the remainder when y is divided by 16? 2 Suppose -9t + 388 = 361. Let p(s) = -s*2 - 5s - 6. Let w be p(-6). What is the remainder when 147 is divided by t/(w/(-164)) - 4? 36 Let x(t) be the third derivative of 0t - 1/2t*3 + 5/12t*4 + 1/60t*5 - 20t*2 + 0. Calculate the remainder when 30 is divided by x(-12). 9 What is the remainder when ((-15336)/(-9) - 3) + 4 is divided by 18? 13 Let g = 210 - -6. Suppose g + 114 = 10t. Calculate the remainder when 80 is divided by t. 14 Suppose 77x = 151 - 74. Calculate the remainder when 185 is divided by x. 0 Let r(d) = 2d*2 - 23d. Let p(m) = 3m2 - 15m + 17. What is the remainder when p(10) is divided by r(12)? 11 Let c(u) = 7u2 - 68u - 172. Calculate the remainder when c(17) is divided by 170. 15 Suppose 45i + 42i - 21i = 1716. What is the remainder when 510 is divided by i? 16 Let s = -5405 - -5443. Calculate the remainder when 1319 is divided by s. 27 Let a be (-4)/6 + 4/6. Suppose a = -0r - 2r - 5s + 37, -5r = 3s - 64. What is the remainder when (-1)/((-7)/644) - -6 is divided by r? 10 Let j = -512 - -780. Calculate the remainder when j is divided by 30. 28 Suppose -466 + 154 = -24n. Suppose -11q - 60 = -nq. What is the remainder when (178/(-4) + 1)-2 is divided by q? 27 Let z(t) = 104t + 5. What is the remainder when z(1) is divided by 40? 29 Let u = -1 - -27. What is the remainder when 57 is divided by u? 5 Let l(r) = -r - 2. Suppose 0 = -5a + 2 + 18. Suppose p - a = -13. What is the remainder when 19 is divided by l(p)? 5 Suppose 3650 = 5b + w + 4w, 2b - 1460 = 4w. Let s = b - 718. Calculate the remainder when 40 is divided by s. 4 Suppose -4b + 4 = 4j, 0 = 15j - 16j - 4. Let g(n) = n*3 + 10n - 10. What is the remainder when g(b) is divided by 24? 21 Suppose -15 = 6q + 3. What is the remainder when (q + 9)/(27/99) is divided by 4? 2 Let y(l) = 2l*2 - 49l - 42. Let k be y(19). Let i = -84 - k. Calculate the remainder when i is divided by 34. 31 Let a = 13702 + -13647. What is the remainder when 1869 is divided by a? 54 Suppose -3i + 4546 = 45l - 50l, -1510 = -i - l. Calculate the remainder when i is divided by 51. 33 Suppose -13f = 566 - 2191. What is the remainder when f is divided by 6? 5 Suppose 4j + 4c + 12 = 0, 0 = j + 11c - 6c + 23. Suppose 3g - 68 = -p + 6, jp - 48 = -2g. What is the remainder when 274 is divided by g? 24 Let k(x) = 3x*2 - 626. What is the remainder when k(-22) is divided by 64? 58 Suppose 4m + d = -24, 5d = 5m - 6m - 25. Calculate the remainder when 38 is divided by 39((-2)/9 - m/9). 12 Suppose 26d - 555 = 906 + 229. Suppose 5t - 229 - 1706 = 0. What is the remainder when t is divided by d? 62 Suppose -8 = -4q + 12. Let b(w) be the third derivative of 7w*4/24 + 7w*3/6 - 3w*2 - 9. What is the remainder when 122 is divided by b(q)? 38 Let m = 17231 + -13605. Calculate the remainder when m is divided by 39. 38 Let m be 2 + 16/(-7) - 443/(-7). Suppose 102 = -60f + mf. Calculate the remainder when f is divided by 17. 0 Suppose -6c + 85 = -239. Suppose 865n = 859n + c. What is the remainder when 24 is divided by n? 6 Let k = 903 + -593. What is the remainder when k is divided by 13? 11 Let k(g) = -2g2 + 31g + 3. Suppose -i + 2i + 23 = 0. Let b = 11 - i. Calculate the remainder when b is divided by k(0). 1 Suppose 63g - 62g = -2a + 61, -g = 1. What is the remainder when 67 is divided by a? 5 Let n = -18098 - -18771. What is the remainder when n is divided by 174? 151 Suppose -2t - 385 - 777 = -4y, 5y = 4t + 1463. Calculate the remainder when 639 is divided by y. 65 Calculate the remainder when 2806 is divided by (312/3)/((0 - (-2)/1)/2). 102 Let n be (6 + -2)/4 + 0. Let a be (16 - 17) + 19/n. Suppose 0 = 6q - aq + 32. What is the remainder when 27 is divided by q? 11 Let p(u) = u3 - 22u*2 + 9u - 169. Let o(r) = 3r + 67. Let t be o(-15). Calculate the remainder when 53 is divided by p(t). 24 Suppose 3x - 39 - 180 = 0. Suppose 0 = -12994d + 12433d + 83206 + 39092. What is the remainder when d is divided by x? 72 Let r(v) = v*2 + 38v + 379. What is the remainder when 27 is divided by r(-21)? 5 Suppose -2140k + 2105k + 33565 = 0. Calculate the remainder when k is divided by 251. 206 Let t = 141 + -107. Suppose 21k + t = 23k. What is the remainder when 115 is divided by k? 13 Suppose 4z = -i - 6, -3z - 2i - 9 = -2. Let o = 1203050 - 1202817. Calculate the remainder when o is divided by (z + (1 - 1))-47. 45 Let j = 8 - 1. Let x be (1 - 2)/((-46)/24 - -2). Let i(h) = -3h - 32. What is the remainder when j is divided by i(x)? 3 Let v(j) = j3 - 23j*2 + 23j + 504. Calculate the remainder when 431 is divided by v(21). 11 Suppose -10v + 24 = -6v. Let b(q) = 7q + 32 - vq - 4. Calculate the remainder when 50 is divided by b(-15). 11 Let d = 91 + -14. Let x = 479 + -291. Suppose x = 17p - 84. What is the remainder when d is divided by p? 13 Let l be (-4)/22 - 92/(-22). Suppose 3m - 4m = -l, -x + m + 8 = 0. What is the remainder when 68 is divided by x? 8 Let n = -199 - -201. Suppose 2i = -4o + 98, -2o - 6i = -ni - 40. Calculate the remainder when o is divided by (2/2)/((-1)/(-9)). 8 Suppose 5x - 4k - 310 = 0, -5x - 20k + 18k + 310 = 0. Let v = -20 + 37. Calculate the remainder when x is divided by v. 11 Let p(o) = 3o*2 + 266o + 6408. Suppose -183 = -n - 2n. What is the remainder when p(-41) is divided by n? 57 Let f = 3268 - 2915. Calculate the remainder when 354 is divided by f. 1 Suppose -2r - 36r + 506 = -558. Let o be ((-21)/6)/(1/(-46)). Suppose -5d - 165 = -2w, d + o = 2w - 0d. What is the remainder when w is divided by r? 24 Let f = 63 - -6. Suppose 3b + 2v = 20, 4b - 26 = 262v - 265v. What is the remainder when f is divided by b? 5 Suppose -3u - 1 + 22 = 0. Suppose ur = 43 - 8. Calculate the remainder when 54 is divided by r. 4 Let n(c) = -23c - 138. Let f be n(-6). Suppose f = 6y - 5y - 28. Calculate the remainder when 83 is divided by y. 27 Let h be 16/(-6)(5 + 78/(-12)). Let m(f) = f + hf + 7 - f + 15. Calculate the remainder when m(7) is divided by 14. 8 Let r(f) = -2f*3 + 11f*2 - 41f + 216. What is the remainder when 367 is divided by r(5)? 7 Suppose 2m = 4k + 184, -3m + 276 = -k - 4k. Let q = 104 - m. Calculate the remainder when 35 is divided by q. 11 Suppose 2u - 204 = 3t, -1074t + 12 = -1071t. Calculate the remainder when 15875 is divided by u. 107 Suppose 0 = -4l - 4x + 8, 10l - 7l = -5x. What is the remainder when 108 is divided by l? 3 Suppose 3d + 6d = 495. Let a = 15 - d. Let n = a - -105. Calculate the remainder when n is divided by 33. 32 Let t(b) be the first derivative of -5b*3/3 + 36b	{ "pile_set_name": "DM Mathematics" }
s the units digit of n? 6 Let s(p) = -2p - 3p*3 - 1604p*2 + 2p*3 + 11 + 1600p*2 + 11. What is the tens digit of s(-6)? 0 Suppose -10x - t - 6 = -12x, 0 = 4x - 4t - 12. Suppose xq - 1363 = 1520. What is the hundreds digit of q? 9 Suppose -2 + 5 = -5u - 3i, -2i = 2. Suppose u = 2b + 2b + 24. What is the tens digit of ((-38)/3)/(1/b)? 7 Let v = -17 + 25. Suppose -h - 4c + 3c - v = 0, -3c - 9 = 0. What is the units digit of (50/h - -5) + 165? 0 Let d(a) = 2a2 - 14a + 12. Let z be d(10). Let j = z + -74. What is the tens digit of 2j/(5/((-215)/4))? 4 Let g be (84/168)/(1 - 3/2). Let x(w) = -9w + 5. Let j(h) = -h - 1. Let d(c) = gx(c) + 2j(c). What is the units digit of d(4)? 1 Suppose 4w + 1554 = 5362. Let h = w - 363. What is the tens digit of h? 8 Suppose -5j = 2z - 24550, -20j = z - 17j - 12273. What is the tens digit of z? 8 Suppose 5f - 74775 = -5v, 4f - 158v - 59824 = -163v. What is the ten thousands digit of f? 1 What is the tens digit of 41/(533/78) + 6237? 4 Let o(f) = 8f2 - 9f + 9. Let d be o(5). Suppose 5c - 132 = -w, 2w - 88 - d = 2c. What is the hundreds digit of w? 1 Let z(c) = 2c*2 + 3c + 9. Let f be z(-6). Let i = f + -112. What is the units digit of (-16)/48 + i/(-3)? 6 Let n = -14 + 6. Let x be (-4 - n) + 5 + -5. What is the tens digit of (-3 + (-4)/x)-16? 6 Let z(i) = 7i*2 - 81i - 335. What is the thousands digit of z(102)? 4 Let a = 19 + -25. Let b(s) = -5s3 - 7s*2 + 20s - 4. What is the units digit of b(a)? 4 Let a(g) = g*2 - 7g + 11. Let i be a(6). Suppose -h - 3s = 103, ih + s - 3s = -447. Let t = -57 - h. What is the tens digit of t? 3 Suppose -4c - 34196 = -1273a + 1269a, 5c = 4a - 34202. What is the thousands digit of a? 8 What is the hundreds digit of ((-34)/(-3))/((-25)/(-300))? 1 Let k = 17 - 8. Let b be (k - 9)/(12). Suppose 0g - 3g = 3r - 279, -2g - 5r + 198 = b. What is the tens digit of g? 8 Let h be 266 + 0/(-1) + -1. Suppose 0 = -5a - 2x - 439, 5a + x = 4a - 89. Let b = a + h. What is the tens digit of b? 7 Suppose -197097 = -22b - 6159. What is the thousands digit of b? 8 Suppose 24 = 22a - 18a. Let i be (17 + -18)/((-2)/a). Suppose 5f - ib = 301, -9 = -5b + 2b. What is the tens digit of f? 6 Suppose -5j - 99 = -4p - 2j, -3p - 2j + 53 = 0. Let g be -1 + -1 + 0/p. What is the tens digit of g/(-8) + 1452/16? 9 Suppose 3 + 1 = -2l, 0 = -5j - l + 6788. Suppose -5b + 0r + j = -2r, 5b + 2r - 1342 = 0. What is the units digit of b? 0 Suppose -32055 - 61211 = -14g + 12532. What is the hundreds digit of g? 5 What is the thousands digit of ((-8592)/(-9) - 10)12? 1 What is the hundreds digit of -11 + 13 - (-5 + -4165)? 1 Let p(m) = 29m - 108. Let k(i) = 10i - 36. Let s(y) = 8k(y) - 3p(y). Let l(v) = v. Let x(z) = 4l(z) + s(z). What is the units digit of x(9)? 9 Let s = -628 + 804. Suppose -h = -3n + 777 - s, -5n = 2h - 1009. What is the units digit of n? 1 Let s(j) = 6j*2 - 12j + 7. Let m be s(3). Let o = m - -347. What is the units digit of o? 2 Let x(f) = -12f + 10 + 24 - 4f. Let l be x(8). Let v = l - -171. What is the units digit of v? 7 Suppose -319 = i + 307. Let z = 210 - i. What is the units digit of z? 6 What is the units digit of ((-180)/(-8))/(-15)(-40 + 2)? 7 Let h be -6 + (-1288)/(-10) + 1/5. Let z be (h2)/(-7 - (-119)/14). Suppose -z = -r + 34. What is the units digit of r? 8 Let z(j) = 43j + 28. Let u(f) = -42f - 29. Let w(l) = -4u(l) - 5z(l). What is the hundreds digit of w(-14)? 6 Let a(w) = -w*2 - 140w + 509. What is the units digit of a(-100)? 9 Suppose -110w = -109w + 4m - 21840, -2m - 16 = 0. What is the tens digit of w? 7 Suppose -141 = -y + 7w - 5w, -285 = -2y + 3w. Suppose 3q + 366 = -q + 5n, -5n - 10 = 0. Let x = y + q. What is the tens digit of x? 5 Let z = 67 + -66. Let v(h) = 5h + 2h2 + z + 1 + 10. What is the units digit of v(-5)? 7 What is the tens digit of 8033 + (90/240 - 86/16 - -2)? 3 Suppose 5j = -5u + 40, 3u - 4 - 8 = 3j. Let b = 695 - 692. Suppose bt = -ut + 144. What is the units digit of t? 6 Suppose -51c - 199689 + 924195 = 0. What is the ten thousands digit of c? 1 Let w be ((-1480)/(-111))/((-2)/(-3)). Suppose -12n + wn - 1512 = 0. What is the units digit of n? 9 Let n(w) = -3w + 19. Let d be n(5). Suppose 2s - d = -86. Let o = 123 - s. What is the units digit of o? 4 Let s(j) = 6j2 - 13j - 43. Let p be s(-24). Suppose 302 - p = -7a. What is the units digit of a? 9 Suppose -8c + 3c + 110 = -4g, 0 = 3g + 5c + 65. What is the tens digit of (164/5)/((-10)/g) + 3? 8 Let j = -755 - -12269. What is the hundreds digit of j? 5 Let w(t) = -3t - 61. Let p be w(-22). Suppose -a = pn - 70, 0 = -3n + 4a + 45 + 20. Suppose -18j = -nj - 204. What is the units digit of j? 8 Suppose 17 = 7a - 25. Suppose 0 = -ar + 4r + 2n - 2, 6 = 2r + 2n. Suppose -4p + 276 = j + 3j, 0 = j - r. What is the units digit of p? 8 Let g(k) = 6040k - 75. What is the ten thousands digit of g(2)? 1 Suppose 0 = q + 5p - 24632, 144p - 147p - 123272 = -5q. What is the hundreds digit of q? 6 Let m(r) = -7r + 136. Let g be m(19). Suppose -2009 - 1243 = -gi + q, 5i + 5q = 5440. What is the thousands digit of i? 1 Let y = 36946 - 22436. What is the units digit of y? 0 Suppose -24b = 2z - 25b - 14127, 0 = 5z + 2b - 35331. What is the hundreds digit of z? 0 Let n be (-2)/(-4)2 - 58. Let b = -68 - n. What is the hundreds digit of 214 + b - 22/4? 2 Suppose 16638y + 1242339 = 16659y. What is the units digit of y? 9 Let j(i) be the first derivative of -i4/12 - i3/6 + 27i2/2 + 12i - 14. Let a(u) be the first derivative of j(u). What is the units digit of a(0)? 7 Let b = 13220 - 22700. What is the thousands digit of ((60/25)/(-6))/(3/b)? 1 Let s(u) be the second derivative of u*5/20 - 5u4/12 + u3/2 - 9u2 - 6u. Let f be s(7). Let w = f + -19. What is the units digit of w? 2 Let k(p) be the second derivative of -p*5/20 + 5p4/6 + p3/3 + 33p2/2 + 5p. Let t be k(10). What is the tens digit of t/(3/3 - 0)? 5 Suppose -5a - 4u = -6107 - 74672, -4a + 5u = -64574. What is the units digit of a? 1 Suppose 5y - 2v - 18 = 0, 2y - 12 = -v - 3. What is the units digit of (-3)/((y/(-34))/(3060/54))? 5 What is the ten thousands digit of (-97)/(((-208)/(-8336))/(-13))? 5 Suppose -32b - 3643 = -34b - 3m, -5432 = -3b + 2m. Let d = b - 739. What is the hundreds digit of d? 0 Let k = 109 - 103. Let j be -4 - (k/27 + 370/(-45)). Suppose 0 = 15c - jc - 1672. What is the hundreds digit of c? 1 Let y(f) = f*3 - 36f*2 - 19f + 88. Let a(n) = -3n2 - 78n - 38. Let t be a(-25). What is the hundreds digit of y(t)? 7 What is the thousands digit of (-29243)/(-7) + -26 + (-185)/(-7)? 4 Suppose -27o - 318873 = -898678 - 739091. What is the units digit of o? 8 Let p(j) = -2j*2 + 23j - 57. Let q(x) = -8x2 + 92x - 226. Let b(h) = -9p(h) + 2q(h). What is the tens digit of b(22)? 2 Let b = 28 + -24. Suppose -bm + 0w = 5w - 1437, -2m + 5w = -711. What is the hundreds digit of m? 3 Suppose 0 = -18q - 49934 + 170156. What is the thousands digit of q? 6 Suppose -1905 + 253 = 4r. Suppose -2w = 3n + 679, -5n - 1105 = -4w + 2w. Let l = n - r. What is the hundreds digit of l? 1 Let v(y) = -1319y - 6804. What is the units digit of v(-8)? 8 Suppose 0 = 8d - 115 - 45. Let y be (-2 - 196/(-10)) + 8/d. Suppose 2f - y = 276. What is the units digit of f? 7 What is the hundreds digit of (-15)/12 - (591716/16)/(-29)? 2 What is the hundreds digit of 1830/366 + 4073 + 1? 0 What is the units digit of ((0 - 7386) + 11)15/(-15)? 5 Let h = -106 + 329. Let j = 148 + h. What is the units digit of j? 1 Let s(y) be the third derivative of -y*5/60 + 7y*4/12 + 19y*3/6 - 15y*2. Let g be s(9). Suppose -7o = -3o - g. What is the units digit of o? 6 Let r(y) = -22y + 7. Suppose -9s - 44 = -5s. Let p be r(s). Suppose -9l + 6l = -p. What is the units digit of l? 3 Let q = 5049 - -14434. What is the thousands digit of q? 9 Let a(d) be the third derivative of d6/40 + d5/60 - d*4/24 + 28d**2. Let f be a(1). What is the tens digit of (-34)/51 + 143/f? 4 Let r = -1916 + -7238. What is the hundreds digit of r/(-22) - (374/121 - 3)? 4	{ "pile_set_name": "DM Mathematics" }
= -3b. Suppose 4r - 19 - 41 = b. What is the remainder when 44 is divided by r? 14 Let x be (-1 + -3)243/(-4). Let k be x - (-1 - (2 - 2)). Suppose i + 4r - 54 - 7 = 0, 4i + r - k = 0. What is the remainder when i is divided by 21? 19 Let o be (-94)/10 + 8/20. What is the remainder when 39/9 - 6/o is divided by 2? 1 Suppose -d + 6d = 475. Suppose -h + 3 = -21. Calculate the remainder when d is divided by h. 23 Suppose -3l - 2l + 287 = j, 0 = -4l + 5j + 218. What is the remainder when l is divided by 12? 9 Let n(p) = 11p + 22. Calculate the remainder when n(11) is divided by 36. 35 Let h be (-2 - (1 - 2))-1. Suppose -4a = -9 + h. Suppose 2x - aj - 58 = 0, 0x - x - 5j - 1 = 0. Calculate the remainder when x is divided by 13. 11 Let k(w) = -4w*2 - 6w. Let m be k(-4). Let g = m - -79. Calculate the remainder when g is divided by 14. 11 Calculate the remainder when 14 - (0 + (1 - 1)) is divided by (4 + -6)/(1/(-2)). 2 Let l(d) = -d*3 + 5d*2 + 5d - 7. Suppose 19 = -5g + 69. Calculate the remainder when l(5) is divided by g. 8 Let s be 311 - (-3)/(6/8). Suppose 0 = 27v - 22v - s. What is the remainder when v is divided by 22? 19 Suppose 0 = 2l - k - 60, 3l - 3k = 8 + 85. Let u = 46 - l. Calculate the remainder when 65 is divided by u. 14 Suppose -5t = -0s - s + 22, 2s = -4t + 58. What is the remainder when s is divided by 7? 6 Let x(r) = r*2 - 3r - 3. Let y = 87 + -81. What is the remainder when x(-3) is divided by y? 3 Let g(r) = -r*3 - 5r*2 - 6r + 7. Calculate the remainder when g(-6) is divided by 27. 25 Let h be ((-2)/(-6))/((-2)/6). Calculate the remainder when 17 is divided by (h30/(-3))/1. 7 Let r(h) = -21h*3 + 3h + 2. What is the remainder when 77 is divided by r(-1)? 17 Let t(f) = 6f2 - 4f + 13. What is the remainder when t(3) is divided by 19? 17 Let t = 25 + -16. Let f be (-3)/(22/(-8)). Let p(m) = m2 - 4m + 4. Calculate the remainder when p(f) is divided by t. 7 Suppose -3p + 49 = 5z - 87, -5z + 133 = 4p. Calculate the remainder when z is divided by 16. 13 Suppose -l - 2i - 2i = 14, -4l - 5 = -i. What is the remainder when 94 is divided by 6/l + (-105)/(-3)? 30 Let i be (-1)/(-1 - 2/(-3)). Suppose iv - 18 = -3. Let d = 16 - v. Calculate the remainder when 31 is divided by d. 9 Let t = -159 + 183. Calculate the remainder when 68 is divided by t. 20 Suppose -y - 140 = -6y. Let f = 12 - 8. What is the remainder when y is divided by (-34)/(-4) - (-6)/f? 8 Suppose -12i + 1290 = -2i. What is the remainder when i is divided by 33? 30 Calculate the remainder when 179 is divided by ((-20)/(-24))/((-4)/(-12))18. 44 Suppose 5 = -2i + 1. Let y(c) = 22c*2 - c + 2. What is the remainder when y(i) is divided by 31? 30 Suppose 2o - 69 + 13 = -g, 5 = -5o. Suppose 2j - g = -4p, 0p - p = 3j - 62. What is the remainder when j is divided by 11? 8 Let q(v) be the second derivative of 2v*3/3 - 7v*2/2 - 3v. What is the remainder when 33 is divided by q(6)? 16 Suppose -4l + 87 = 2r - 17, -48 = -r - 3l. What is the remainder when r is divided by 21? 18 Let w = 28 + -9. Suppose -181 + w = -3m. Let x = m + -37. Calculate the remainder when x is divided by 10. 7 Let x be (0 - -4)1/(-2). Let b(k) = k3 + k2 - 2k. Let d be b(x). Let c = d - -4. What is the remainder when 7 is divided by c? 3 Let m(h) = -h*3 + 5h*2 - 3h - 4. What is the remainder when 8 is divided by m(3)? 3 Let a(p) = -5p - 3. Let k = -14 - -18. Suppose -r = -u - 12 + 49, 138 = ku + r. What is the remainder when u is divided by a(-3)? 11 Let v(u) = u + 8. Let j be v(-9). Let q be j/2(0 - 0). Suppose qw - 32 = -2w. What is the remainder when w is divided by 9? 7 Let l(q) = -1 + 0q + 0q - 5q3 + q2. Let o(c) = c*3 - 19c*2 + 20c - 37. Let i be o(18). Calculate the remainder when 12 is divided by l(i). 2 Let c(p) = -p*3 + 11p*2 + 9. Calculate the remainder when c(11) is divided by 6. 3 Let n(r) = r + 4r*2 + 0r - 2r3 + r3 + 2r. Suppose 1 = -5c + 21, 5y - 2 = -3c. Calculate the remainder when 34 is divided by n(y). 16 Suppose 2g - 7 = -3d, 0g - d = -g + 1. Let j = 1 - -4. Suppose -3m - 6 = jw + 1, -12 = 3m. Calculate the remainder when g is divided by w. 0 Let u(f) = f3 + 6f*2 - 11f - 9. What is the remainder when u(-7) is divided by 6? 1 Suppose -6g = -g - 55. Suppose 2f = -2v - 0 - 4, 0 = 3f + 15. Calculate the remainder when g is divided by v. 2 Suppose -6c = -455 + 131. Calculate the remainder when c is divided by 14. 12 Suppose 0 = 5m + 2c + 3c + 45, -4m = c + 24. Let d = 9 - 4. What is the remainder when d is divided by (-4)/(-1)(-4 - m)? 1 Let j(u) = u*3 + 10u*2 + 4. Suppose 0 = 3y + 5q + 5, -4y - 51 + 6 = -q. Let k be j(y). Let d = 13 + k. What is the remainder when 49 is divided by d? 15 Suppose 0 + 6 = 2p. Suppose -u + 80 = 5m - 0m, pm = -2u + 48. What is the remainder when 30 is divided by m? 14 Let k(x) = -2x + 79. What is the remainder when k(16) is divided by 8? 7 Let d = -19 - -27. Let v(m) = -23m3 + m2 + 2m + 1. What is the remainder when v(-1) is divided by (-49)/(-4) - 2/d? 11 Let f(q) = q3 + q2 - 1. Let r(w) = -7w3 - 12w*2 + 3w + 2. Let y(t) = -6f(t) - r(t). What is the remainder when 42 is divided by y(-6)? 20 Suppose 0x - 30 = -3x. Suppose 0 = 6f - f - x. What is the remainder when (f/(-4))/(3/(-66)) is divided by 3? 2 Suppose 3p - 45 = 4l + l, 4p + l = 83. Suppose -3u + 3n + 27 = 9, 4n = p. Calculate the remainder when 32 is divided by u. 10 Suppose -n + 7 = -0. Calculate the remainder when 6/(-36) - (-302)/12 is divided by n. 4 Let c = -9 + 13. What is the remainder when c is divided by 3? 1 Suppose -2x = -x - 15. Calculate the remainder when 41 is divided by x. 11 Let l(x) = -x2 - 2x - 16. Let o be l(0). Let r = o - -27. What is the remainder when 31 is divided by r? 9 Suppose 0 = 2j + 3j - 20. Suppose 2s = -v + 99, -3v = 5s - jv - 251. Let g = 21 - 4. Calculate the remainder when s is divided by g. 16 Let w(z) = 3z2 + 15z. What is the remainder when w(-6) is divided by 5? 3 Suppose 0j = -j + 53. Let y = 49 - 35. What is the remainder when j is divided by y? 11 Let g(x) = -x3 + x2 - 2x + 9. What is the remainder when g(-4) is divided by 10? 7 Let d be 90/4 + (-2)/(-4). What is the remainder when 46 is divided by 2 + d + (-2)/2? 22 Suppose -4u - 4g - 1 + 13 = 0, -5u = 4g - 19. Let q = 1 - -1. Suppose 28 + 10 = qt. What is the remainder when t is divided by u? 5 Let d(n) = 8n*2 + 2. Let w be (18/(-8))/((-9)/24). Suppose 2l = -2j + 30, 2j - wj = 5l - 72. What is the remainder when d(-2) is divided by l? 10 Suppose -3d + 30 = -d. Suppose 16g = 5g + 473. Calculate the remainder when g is divided by d. 13 Let t(r) = -r3 + 9r*2 - 8r - 8. Let w = 25 - 15. Suppose 2z = w + 14. Calculate the remainder when t(7) is divided by z. 10 Let r(l) = l3 + 13l*2 + 11l - 4. Let n be r(-12). Calculate the remainder when n + 4 + (-4)/(-2) is divided by 3. 2 Suppose 0 = -g + 4g - 45. Suppose -3q = -8q + g. Calculate the remainder when 25 is divided by (-2)/(-6) - (-26)/q. 7 Let w = -34 - -47. Suppose 3k - 570 = -2k. Suppose -2l + k = 3p - l, -5p + 3l = -190. What is the remainder when p is divided by w? 12 Let b = 11 + -9. Suppose -d = -4h - b, 38 = 3d - 7h + 3h. Calculate the remainder when 70 is divided by d. 16 Suppose -2v + 55 - 1 = 0. What is the remainder when 80 is divided by v? 26 Let r be (5 + -6)/((-2)/(-10)). Let w be ((-4)/10)/(1/r). Calculate the remainder when w + 16 + 1/1 is divided by 7. 5 Let y(a) = a*2 - 2a - 1. Let n be y(3). Suppose -92 = -2g - 4b, -3b - nb = -5. What is the remainder when g is divided by 15? 14 Suppose 16 = -4h, d - 4 = -0d + 3h. Let m = -1 - d. Let t = 30 - 17. Calculate the remainder when t is divided by m. 6 Let y(r) = -71r*3 + 2r*2 - 1. What is the remainder when y(-1) is divided by 25? 22 Suppose 5n = 4r - 146, -4n - n = 3r + 153. Suppose 4z - 4 = -3c + 114, 5z + 136 = 3c. Let l = n + c. Calculate the remainder when 23 is divided by l. 11 Suppose -5w = -5l + 90, -2l - 5w + 4 = 3. What is the remainder when l is divided by 7? 6 Suppose -27 = -5f - 4*f. What is the remainder when 16 is divided by f? 1	{ "pile_set_name": "DM Mathematics" }
46093/2772) Simplify ((z(1/2)/z(4/3))/(z/(zz(4/5))zz(-2/5)))/((z0z)/z*(-2/19)z*2z(2/5)) assuming z is positive. z(-2359/570) Simplify ((((f*(-33)f)/ff)/(f(-18)f))/((f/(ff/(ff*(11/5)f)))/ff(3/25)))(-29) assuming f is positive. f(12557/25) Simplify ((t/(t(-3)/t))/(t/t(-14)))(-8)((t(-1/7))(2/17))34 assuming t is positive. t(556/7) Simplify (((rrr(-1))/r)(-3)r(-2/7)/r(2/5))/((rr/r*7rr(2/9)r)/(r*7/rrr7)) assuming r is positive. r(5069/315) Simplify (((u(-4/5)/(u(2/11)u))/(u/(u/(u/u*(-3/8)))u/u(-1/3)))(-3/7))45 assuming u is positive. u(55719/616) Simplify ((h*(14/9)/h)/((hh*(-12/7))/h)(h6/h)(4/31))(16/5) assuming h is positive. h(91088/9765) Simplify (((c/c(-2/5))/c)8/(cc1(((cccc(1/3)c)/c)/c)/c))/(c*(-2)(c/(c*(-3)/cc)c)/c)10 assuming c is positive. c(-302/15) Simplify ((uu/(uuu*(-2/67)u))41/(((u(9/5)/u)/u)/(uu(-2/9)/uuu)))(-3/2) assuming u is positive. u(56981/1005) Simplify (((yy/(y*5y))/y)/(y/y(-2)))(-31/2)((y(-1))1)35 assuming y is positive. y89 Simplify ((n/(n/n12))/n(-2/43))(-22)/(n(nn/n(-4/3))/nnnn*(-10)n)(-9) assuming n is positive. n(-12815/43) Simplify (kk3k*(-5))/(kk/k0)(-3/29)((((kk/k*(-2/17)k)/k)/k)8)(-8/3) assuming k is positive. k(-36437/1479) Simplify ((q7q(qq(-1/7))/qq)/(q*(2/9)q(-6)))(12/11) assuming q is positive. q(3688/231) Simplify (v10/v)(-47)/(v(-1)v(2/39)) assuming v is positive. v(-16460/39) Simplify ((((z0/z)/z)/zzz)(-14)z*6/((zz*(-2/5))/z))/((zzzzz6zzz/(zz(-2)))/(zz*7z/((zzz*(-4)z)/zz)z)) assuming z is positive. z*(87/5) Simplify ((cc*(2/35)/ccc42)/(c(-5/8)cc/c4))(-13) assuming c is positive. c(-166283/280) Simplify (c(-2/55)c(-6/25))/(c15)24 assuming c is positive. c(-99076/275) Simplify ((gg/(g(-1)g)gg)/g)*(-2/67)/(g/(gg*(1/7))(gg(-3/4)gg)/g)(g1)(1/3)(g(-2)g)/(gg(-2/13)g) assuming g is positive. g(-271403/73164) Simplify (v(-4)/(v/v*(2/7))v*1v/v*(1/2))/((((v/(v/(vvv4/v)v))/v)/v6)/(v(-2/9))(-19/2)) assuming v is positive. v(239/126) Simplify (a/(a/(a/(a/(a/a(-1/3))))))(-2/79)(aa*(-7)a)/(aa(-6/7)/a)(a*7(a*(-11)a)/a)(-49) assuming a is positive. a(318235/1659) Simplify ((w/(w(41/3)/w))(7/4)/(w*31w(-11/2)))(5/2) assuming w is positive. w*(-2755/24) Simplify ((((dd*(-1))/ddd(-1)d)/(d/(d((((dd/d*0ddd)/d)/d)/d)/dd))(-1/9))(-5))(-40) assuming d is positive. d(-400/9) Simplify ((tt/(t/(t*(2/63)/tt)))/(t/t*(-21)t)tt*(-21)t14)(-20/9) assuming t is positive. t(35240/567) Simplify ((l(2/3)l)(-3/20)l(-4)/(l(-5)l))/((l/l(-5))/(l(1/8)l)l/(ll*(4/9))lll*(3/8)ll) assuming l is positive. l(-163/18) Simplify ((ffff(-15/8))/f11)/(f(-2/21)/f)10 assuming f is positive. f(181/168) Simplify (((m(-5)/m)/(m/m1))/(m(-1/4)mmm/m5))/((m(-1/4)m)(-9/5)/(m/m0)39) assuming m is positive. m(183/5) Simplify ((jj5)(-11/3)(j(-1/4))47)32 assuming j is positive. j(-1080) Simplify (x*(-2/3)xxx*0(x1)(1/3))/((((x*7x)/x)/((xx(-1/4))/xx))/(xx/x(-2/5)xxx/x*(3/8)x)) assuming x is positive. x*(173/120) Simplify ((oo(-2))/o(-2/15))38/((o(-1)/o)*(1/24)(o(-1/5)/o)/(o(-1)o)) assuming o is positive. o(-633/20) Simplify p(-3/4)pp4p*(1/3)/(p/(pp*(-1/7))ppp)(((pp/p*10pp)/p)/(p/(p(-5)/p)))(13/6) assuming p is positive. p(-809/28) Simplify (p(-2/9)/pp(-8))/(p(1/4))*(-37)(p*4/(ppp/((pp/p*(1/5)p)/pp)p))30 assuming p is positive. p(3025/36) Simplify (o*(-15)/(o/(oo*3o)o)(o(7/3)/o)(-45))(-3/8) assuming o is positive. o27 Simplify ((y/(y/(yy(-4/7))))/y(1/3))(-1/31)(y(y/(y/y(-1/4)))/yy)*(-16)y5/y(-5) assuming y is positive. y(-1304/651) Simplify (h25hhh(5/7))/(((h(-36)h)/h)/hh(-22)) assuming h is positive. h(607/7) Simplify (((o(-1/2)/(o7/o))35)12)35 assuming o is positive. o(-95550) Simplify (x/((xx/x*(-21))/x)x/x*30x(x/(x27/x))/x(-2/3))(-7) assuming x is positive. x(1540/3) Simplify (((k(7/2)kk(-6))/(k2k)(-4/9))(5/6))(-1/4) assuming k is positive. k(5/144) Simplify (d*4dd(-6))(-10)/((d/(d/((dd/d(-1))/d)))(-23)/((d/(dd/((dd*5/dd)/d))d)/d5)) assuming d is positive. d56 Simplify (((w2)(1/7)/(w(-1/4))(-22))4)(-7/5) assuming w is positive. w(146/5) Simplify (b7/((b3/b)/b))/((b(-2)/bb)/(bb(-5)/b))((b/((b*(-2/13)/b)/b))/(b/(bb/(b/(bb2/b)b))))(-2/53) assuming b is positive. b(1959/689) Simplify ((i(-3/7)/i)/i(-2))(27/4)/(i(-6)/ii/(i/(i/(i1/i)))(i(1/8)/i)/i4) assuming i is positive. i(825/56) Simplify (x/(x/((x3/x)/x)x)x/(x/x*(7/5))(x*(-6)/x)/xx(10/9))(-1/15) assuming x is positive. x(247/675) Simplify (((k0k)/k(2/3))/(k(-2/9)kk(-3/5)))/((k(1/4)kk)24(k(-2))(-27)) assuming k is positive. k(-4853/45) Simplify ((z/(z/((z(-9)/zz)/z))zzz)/z*(2/15)(z/(((zz(-2)z)/z)/z))(-37))/((z(-1/5))(-20))(-4) assuming z is positive. z(-1532/15) Simplify (x(-15/4)/(xx34)(x(xx/(x*27/x))/xx)(1/65))22 assuming x is positive. x(-111837/130) Simplify (i(-7)i(i*(1/5)/ii)/i)/(i/i*(2/33)ii3/i)i*2/iii/i(3/4)((ii(-4/3))/i)/i(5/2) assuming i is positive. i(-2711/220) Simplify ((p(1/7)p/(p*1/pp)p)/(pp/(p/(p/p(2/7))))(-2/47))/((p*(-1/11)pp/(p/(p2/p)))/((p(-4/9)p)/(pp3))) assuming p is positive. p(-134770/32571) Simplify ((mm(-1))(-2/27))*(2/9)mm/((m(-3)m)/m)m(-2)((((m(((m(2/3)/m)/m)/m)/mm)/m)/mm)/m)(4/35) assuming m is positive. m(55/21) Simplify ((n(-14)/n)/(n/(n/n(-3/8)))n*(-15)/(nnnnn(-2/3)n))(7/3) assuming n is positive. n(-5705/72) Simplify ((b(-8)/((b/b(-3))/b))/((bb1)/b)(-6/23))(-16) assuming b is positive. b(3952/23) Simplify (t(-27)t)/(t*(-28)/t)((tt(1/47)t)/t)/t1 assuming t is positive. t(142/47) Simplify (o*(2/5)(o*(-9)o)/ooo/o*7ooo(2/27))16 assuming o is positive. o*(-24896/135) Simplify (w((ww(-4)w)/w)/w)/((w/(w*0w))/w)wwww/(w*(-7)/ww)w/w(-2/21)(w(1/2))(6/19)/(w/(w*0/w)w)(-1/3) assuming w is positive. w(4490/399) Simplify ((k1/k)(31/3)(k/((kk*(-6)/k)/k))/(kk(1/2)))/(((k(1/3)/k)/kk)(-18)(kk/(k1/k)k)(3/5)) assuming k is positive. k(-73/10) Simplify (t*4/tt6)(19/5)/(tt1tt(2/5))4 assuming t is positive. t(103/5) Simplify (m(-1/10)/(mmm/(m/(m/(m(-6)m)mm)))(m(-8/3)mm)/(m(1/3)m))(-10) assuming m is positive. m121 Simplify (f(7/5)/(f/f3)(f(-2/7))4)/((((f/f(-3))/f)/f(-7/2))/(f2)31) assuming f is positive. f(4043/70) Simplify (i(2/19)/ii(i/(i/(i(i*(1/6)/i)/ii)i)i)/i(i(1/4)/i)(-5))/((i(-1)i)(-14/5))(-20) assuming i is positive. i(689/228) Simplify (n(-4)nn*(-6/11)(n/(nn(3/4)n))/(nn/(n/(n(-4/15)/nn))n))41 assuming n is positive. n(-190199/660) Simplify (y(-2)yy/y(-12))(-44)/((y/y(1/3)yy(1/5)/y)/(y3/yy(3/5))) assuming y is positive. y(-7894/15) Simplify (m(2/7)/(m/(((m/((m/(m/m4m)mm)/m))/m)/m)))4/((mmm0m)*(-36)m*0/mmmm(-3/4)) assuming m is positive. m(2377/28) Simplify ((c*7cc/c(-3/5))/(c(c/c(2/3))/c)(1/29))/((c/(c/c0))28)(-12) assuming c is positive. c(4171/435) Simplify (((r/r(-2/5))/r)(-40)/((r/(r/r*(-1/8)))/(r(rr(-1/2))/r)))/((r/r(-1))(-7/3)(r(r/(rr(4/5)))/r)/r(-1/3)) assuming r is positive. r(-1229/120) Simplify (b(2/7))*19(b(1/3))(-2/7)(b5/((b/(b/(b/(b(-5)/bb))))/b))/(b*(1/9)/(b/(b/(bb/b*(2/21)bb)bb)b)) assuming b is positive. b(512/63) Simplify ((i(1/12)/i(-3))/(i(10/7))(-15/7))27 assuming i is positive. i(32517/196) Simplify ((((x/(x/x3))/x)/x)/x(-5))/(x/x(-1/3)xx)*(2/27)((x*(-1)x)(5/4))(-24) assuming x is positive. x(466/81) Simplify (r(-1/3)r(r/r*0)/rrr)(-9)((rr(-2)/r)6)*(-1/47) assumin	{ "pile_set_name": "DM Mathematics" }
nearest 100? -5300 What is 0.00000208 rounded to six decimal places? 0.000002 What is 2764230 rounded to the nearest one hundred thousand? 2800000 What is 99.5 rounded to zero decimal places? 100 Round -51.783 to the nearest 10. -50 What is 176.92 rounded to the nearest ten? 180 Round -0.000020977 to seven dps. -0.000021 What is -9.3917 rounded to 2 decimal places? -9.39 What is 106.25 rounded to the nearest integer? 106 What is -0.4277 rounded to 2 dps? -0.43 Round -2932240 to the nearest ten thousand. -2930000 What is -124376 rounded to the nearest ten thousand? -120000 What is -0.22848 rounded to 3 decimal places? -0.228 Round -24.446 to 1 decimal place. -24.4 What is 13350000 rounded to the nearest one hundred thousand? 13400000 Round -14960 to the nearest 10000. -10000 Round 1089 to the nearest ten. 1090 Round -0.145 to zero dps. 0 What is -0.0000489 rounded to five dps? -0.00005 Round 0.41082 to one dp. 0.4 Round 613300 to the nearest one hundred thousand. 600000 Round -1077.24 to the nearest one hundred. -1100 What is -3757500 rounded to the nearest 100000? -3800000 What is 4633 rounded to the nearest one hundred? 4600 What is 0.667 rounded to one dp? 0.7 What is -171.666 rounded to zero decimal places? -172 What is -0.000009202 rounded to 6 dps? -0.000009 What is -0.0018101 rounded to five dps? -0.00181 Round 13791.4 to the nearest 1000. 14000 Round 0.00002268 to five decimal places. 0.00002 What is -3.372 rounded to the nearest integer? -3 What is 0.01507 rounded to 3 decimal places? 0.015 Round -0.002603 to four decimal places. -0.0026 Round -0.829 to the nearest integer. -1 What is -2.6929 rounded to 1 decimal place? -2.7 Round -1157 to the nearest one hundred. -1200 What is 615000 rounded to the nearest 1000? 615000 What is 2188.2 rounded to the nearest one hundred? 2200 What is -0.000001585 rounded to six dps? -0.000002 What is 0.000000304558 rounded to seven dps? 0.0000003 Round 4428.6 to the nearest one thousand. 4000 What is 159 rounded to the nearest one hundred? 200 Round -16797 to the nearest one hundred. -16800 What is 10012000 rounded to the nearest one million? 10000000 What is 1020000 rounded to the nearest one hundred thousand? 1000000 Round 0.4633 to one decimal place. 0.5 What is -0.00014325 rounded to 5 dps? -0.00014 Round 5137 to the nearest one hundred. 5100 Round -564.3 to the nearest ten. -560 Round 9433700 to the nearest one million. 9000000 Round 0.000077595 to 5 dps. 0.00008 What is 736.6 rounded to the nearest one hundred? 700 Round -0.09967 to 2 dps. -0.1 What is -734900 rounded to the nearest one hundred thousand? -700000 What is -20358600 rounded to the nearest 100000? -20400000 Round 0.00637 to four decimal places. 0.0064 Round -0.001364 to 5 decimal places. -0.00136 What is 0.000000917 rounded to 7 decimal places? 0.0000009 What is 62800 rounded to the nearest one thousand? 63000 What is -0.0003546 rounded to 5 decimal places? -0.00035 What is -1175200 rounded to the nearest 10000? -1180000 Round 1446 to the nearest one hundred. 1400 Round 41120000 to the nearest one million. 41000000 What is 2030900 rounded to the nearest one hundred thousand? 2000000 Round -1520 to the nearest 1000. -2000 Round -3.405 to 2 decimal places. -3.41 What is 0.00000106 rounded to six decimal places? 0.000001 What is 644.3 rounded to the nearest 10? 640 Round -247700 to the nearest one thousand. -248000 Round 81070 to the nearest ten thousand. 80000 What is -0.0030099 rounded to five dps? -0.00301 Round -0.010643 to 4 decimal places. -0.0106 Round 53200000 to the nearest one million. 53000000 What is 93550 rounded to the nearest 10000? 90000 What is -1.9376 rounded to one decimal place? -1.9 Round -1133000 to the nearest 10000. -1130000 Round 69600 to the nearest ten thousand. 70000 What is 10860000 rounded to the nearest one hundred thousand? 10900000 What is 0.000030411 rounded to 6 decimal places? 0.00003 What is -4880000 rounded to the nearest 100000? -4900000 Round 6.3839 to zero dps. 6 What is 1.48965 rounded to 3 decimal places? 1.49 What is 2.4287 rounded to two dps? 2.43 What is -160380 rounded to the nearest 10000? -160000 Round 3353.5 to the nearest 10. 3350 Round 8.6901 to one decimal place. 8.7 What is 19.72 rounded to the nearest one hundred? 0 What is -105520 rounded to the nearest one hundred? -105500 What is -4969000 rounded to the nearest one hundred thousand? -5000000 What is 0.0005383 rounded to four decimal places? 0.0005 What is 3619000 rounded to the nearest 1000000? 4000000 What is 168800 rounded to the nearest ten thousand? 170000 What is 0.5196 rounded to 2 dps? 0.52 Round 0.0002217 to five dps. 0.00022 Round -0.099796 to three dps. -0.1 What is 0.0000072 rounded to five decimal places? 0.00001 What is 0.008967 rounded to four dps? 0.009 Round -8.86 to one dp. -8.9 Round -0.0000010367 to 7 dps. -0.000001 Round -0.0022766 to five decimal places. -0.00228 Round -7920000 to the nearest one million. -8000000 Round 26200 to the nearest 10000. 30000 What is -77000000 rounded to the nearest one million? -77000000 Round -0.0001388 to 4 dps. -0.0001 What is -0.0050302 rounded to four decimal places? -0.005 Round 460.5 to the nearest one hundred. 500 What is -8145000 rounded to the nearest 100000? -8100000 What is 43.42 rounded to the nearest 10? 40 Round 0.0000000189 to seven decimal places. 0 Round -0.0467333 to 4 dps. -0.0467 What is 119.23 rounded to the nearest ten? 120 What is 9422000 rounded to the nearest 1000000? 9000000 Round -0.00173375 to 4 dps. -0.0017 What is -96800 rounded to the nearest ten thousand? -100000 Round -84.09 to zero decimal places. -84 What is 3175.9 rounded to the nearest ten? 3180 What is -3.409 rounded to 1 dp? -3.4 What is -0.000051907 rounded to 5 dps? -0.00005 What is 0.0042675 rounded to 4 dps? 0.0043 Round 3288 to the nearest 100. 3300 Round 0.0097117 to three dps. 0.01 Round -557810 to the nearest 10000. -560000 What is 0.14884 rounded to two decimal places? 0.15 What is -0.036844 rounded to two dps? -0.04 What is -0.0095462 rounded to 3 decimal places? -0.01 Round -1810 to the nearest one hundred. -1800 Round 10.9768 to 1 dp. 11 What is -0.0000058382 rounded to seven decimal places? -0.0000058 Round 7799000 to the nearest 1000000. 8000000 What is -0.00087555 rounded to 5 decimal places? -0.00088 Round 722609 to the nearest 100000. 700000 What is -0.3316 rounded to 3 dps? -0.332 What is 15.58 rounded to the nearest integer? 16 Round -0.0005366 to five decimal places. -0.00054 Round -2258400 to the nearest 100000. -2300000 Round 0.00415 to 3 decimal places. 0.004 Round -0.5335 to one dp. -0.5 Round 0.02637 to 3 dps. 0.026 What is -0.00001706 rounded to 6 dps? -0.000017 What is -11410 rounded to the nearest 1000? -11000 Round -0.00052568 to 5 decimal places. -0.00053 What is -0.01543 rounded to four dps? -0.0154 What is 33802000 rounded to the nearest 1000000? 34000000 What is -1.6424 rounded to one dp? -1.6 Round 76720 to the nearest 1000. 77000 Round -0.00021092 to five decimal places. -0.00021 What is 0.145 rounded to two dps? 0.15 Round 31.996 to one dp. 32 What is -0.000008757 rounded to seven decimal places? -0.0000088 Round -0.0000008705 to seven decimal places. -0.0000009 What is -0.00001799 rounded to five dps? -0.00002 Round 455 to the nearest 10. 460 What is 50500 rounded to the nearest 100000? 100000 Round 0.08661 to one dp. 0.1 What is 0.00624 rounded to four decimal places? 0.0062 What is 56420000 rounded to the nearest 1000000? 56000000 What is -0.0000000727 rounded to seven dps? -0.0000001 What is -1109 rounded to the nearest 100? -1100 Round -0.3712 to 2 dps. -0.37 What is 0.423 rounded to 1 decimal place? 0.4 What is 0.0096919 rounded to four decimal places? 0.0097 What is -0.00085499 rounded to 5 dps? -0.00085 What is -0.71714 rounded to 2 dps? -0.72 What is 0.000008462 rounded to seven dps? 0.0000085 Round -0.0989 to two dps. -0.1 Round -0.00001073 to 6 dps. -0.000011 What is 63.3 rounded to the nearest integer? 63 What is 4.1887 rounded to two decimal places? 4.19 What is -0.0000002552 rounded to seven dps? -0.0000003 Round -0.021577 to 4 decimal places. -0.0216 Round 0.107872 to 4 decimal places. 0.1079 What is 0.0002773 rounded to 5 decimal places	{ "pile_set_name": "DM Mathematics" }
50 How many grams are there in 11018.93t? 11018930000 What is 0.5576923 weeks in minutes? 5621.538384 What is 4006.865kg in tonnes? 4.006865 What is 9/10 of a millimeter in micrometers? 900 What is eighteen fifths of a tonne in kilograms? 3600 Convert 93043.04 nanograms to milligrams. 0.09304304 What is 3/40 of a minute in milliseconds? 4500 What is 5/4 of a gram in milligrams? 1250 Convert 2.656256 years to millennia. 0.002656256 What is 772449.2ml in litres? 772.4492 How many litres are there in 202.5965 millilitres? 0.2025965 How many millilitres are there in 11/10 of a litre? 1100 How many days are there in 30.41766us? 0.00000000035205625 What is 8.469448ug in kilograms? 0.000000008469448 What is 42384.54l in millilitres? 42384540 Convert 4.868482ml to litres. 0.004868482 What is 0.5805587m in nanometers? 580558700 Convert 417937.5um to meters. 0.4179375 What is 66181.88 decades in millennia? 661.8188 How many millilitres are there in fourty-five halves of a litre? 22500 How many micrometers are there in 0.9397051 meters? 939705.1 How many years are there in thirty-one fifths of a millennium? 6200 How many millimeters are there in 1/4 of a meter? 250 What is 2205.557 millennia in centuries? 22055.57 Convert 559.4539ml to litres. 0.5594539 Convert 1755936.9 milliseconds to hours. 0.48776025 What is 98422.41 decades in millennia? 984.2241 How many years are there in 41/2 of a millennium? 20500 How many seconds are there in 6/25 of a day? 20736 What is twenty-seven quarters of a millennium in decades? 675 Convert 69874.17 millimeters to micrometers. 69874170 What is 68.03501 millilitres in litres? 0.06803501 What is 1/5 of a gram in milligrams? 200 What is 3/5 of a millennium in months? 7200 What is fourty-three quarters of a litre in millilitres? 10750 How many litres are there in 53.16927 millilitres? 0.05316927 Convert 9.510193m to centimeters. 951.0193 What is 1.353239 litres in millilitres? 1353.239 How many millilitres are there in one quarter of a litre? 250 Convert 57768.06 centuries to years. 5776806 What is 2.1473919 months in millennia? 0.000178949325 Convert 81.69674 litres to millilitres. 81696.74 What is 48/5 of a litre in millilitres? 9600 How many micrometers are there in fifteen quarters of a centimeter? 37500 How many minutes are there in thirty-one halves of a hour? 930 What is one fifth of a gram in milligrams? 200 What is 25/4 of a microgram in nanograms? 6250 What is eleven eighths of a micrometer in nanometers? 1375 What is 45/4 of a minute in seconds? 675 How many grams are there in 997641.9ng? 0.0009976419 Convert 408930.3 hours to nanoseconds. 1472149080000000000 What is fifty-two thirds of a year in months? 208 How many nanograms are there in 5/8 of a microgram? 625 How many millilitres are there in 32/5 of a litre? 6400 Convert 61.9984ug to nanograms. 61998.4 Convert 3735.651l to millilitres. 3735651 Convert 3.51264 millilitres to litres. 0.00351264 How many centimeters are there in three fifths of a kilometer? 60000 How many centimeters are there in 1/5 of a meter? 20 What is seven halves of a meter in millimeters? 3500 How many months are there in 1/24 of a century? 50 What is 9.294668m in centimeters? 929.4668 How many grams are there in 969224.7 tonnes? 969224700000 How many milligrams are there in 742086.9t? 742086900000000 How many litres are there in 0.2410938ml? 0.0002410938 Convert 0.514244nm to millimeters. 0.000000514244 How many milliseconds are there in seven halves of a second? 3500 What is 75/2 of a day in hours? 900 How many months are there in 574023.7 millennia? 6888284400 What is three fifths of a gram in milligrams? 600 Convert 899140.7 hours to microseconds. 3236906520000000 What is 6085.162mg in micrograms? 6085162 What is 6736.224ug in nanograms? 6736224 How many milliseconds are there in 3/5 of a second? 600 What is three eighths of a litre in millilitres? 375 What is 8816.604 hours in minutes? 528996.24 Convert 26.1315 millennia to months. 313578 How many kilograms are there in 768.9704mg? 0.0007689704 Convert 2.07905 centuries to years. 207.905 Convert 0.1073416ug to nanograms. 107.3416 What is 433136.2nm in kilometers? 0.0000004331362 What is sixty-one quarters of a litre in millilitres? 15250 How many meters are there in twenty-seven halves of a kilometer? 13500 How many months are there in 0.6167018 decades? 74.004216 How many centuries are there in 2363.51 years? 23.6351 What is 9/10 of a kilometer in centimeters? 90000 What is seventeen halves of a milligram in micrograms? 8500 How many millimeters are there in 3/10 of a centimeter? 3 What is 575.3546km in meters? 575354.6 How many grams are there in 92.36346mg? 0.09236346 How many micrometers are there in one twentieth of a millimeter? 50 How many centimeters are there in fourty-one halves of a meter? 2050 Convert 62.95032g to milligrams. 62950.32 How many nanometers are there in eleven halves of a micrometer? 5500 What is twenty-seven fifths of a gram in milligrams? 5400 What is four thirds of a week in hours? 224 How many micrometers are there in 1508.308 millimeters? 1508308 What is 0.9339931cm in micrometers? 9339.931 How many milliseconds are there in 16/15 of a minute? 64000 How many centimeters are there in 12/25 of a meter? 48 How many grams are there in 42/5 of a kilogram? 8400 Convert 0.8469345 millennia to centuries. 8.469345 What is 51/5 of a litre in millilitres? 10200 How many litres are there in 14438.66ml? 14.43866 What is 216296.5 centimeters in micrometers? 2162965000 What is 1/5 of a hour in minutes? 12 What is seven thirds of a millennium in months? 28000 Convert 64845.78 millilitres to litres. 64.84578 How many litres are there in 9.249342ml? 0.009249342 How many millilitres are there in 51/4 of a litre? 12750 How many microseconds are there in 74811.17 weeks? 45245795616000000 How many grams are there in 17/4 of a kilogram? 4250 How many nanometers are there in 7/8 of a micrometer? 875 What is seven thirds of a decade in months? 280 How many nanograms are there in thirty-seven fifths of a microgram? 7400 What is fifteen quarters of a millennium in decades? 375 How many millilitres are there in 1/10 of a litre? 100 What is 1881.719 weeks in nanoseconds? 1138063651200000000 What is 3/5 of a kilometer in centimeters? 60000 How many centimeters are there in 3/5 of a kilometer? 60000 How many minutes are there in 18/5 of a week? 36288 What is one quarter of a litre in millilitres? 250 What is fourty-five halves of a litre in millilitres? 22500 How many hours are there in twenty-seven halves of a day? 324 How many milliseconds are there in nine tenths of a minute? 54000 How many nanometers are there in eleven halves of a micrometer? 5500 How many nanometers are there in 13/8 of a micrometer? 1625 Convert 757490.7 millimeters to kilometers. 0.7574907 What is 12/25 of a litre in millilitres? 480 How many nanoseconds are there in 7.324083 seconds? 7324083000 What is twenty-one quarters of a hour in seconds? 18900 How many milligrams are there in 0.3140306 grams? 314.0306 What is 1.5822594 months in centuries? 0.0013185495 What is 15/4 of a kilometer in meters? 3750 How many millimeters are there in 18/5 of a centimeter? 36 Convert 3237.505 litres to millilitres. 3237505 What is 27.40107 micrograms in kilograms? 0.00000002740107 What is 11/2 of a milligram in micrograms? 5500 What is 8118.996 millilitres in litres? 8.118996 What is 1029.56589 milliseconds in days? 0.000011916271875 Convert 313133.9 weeks to nanoseconds. 189383382720000000000 What is one quarter of a hour in seconds? 900 What is 66248.4km in centimeters? 6624840000 Convert 2993.088 decades to years. 29930.88 How many months are there in 7/4 of a century? 2100 What is 3.186765 milligrams in micrograms? 3186.765 What is 88.40484 millilitres in litres? 0.08840484 How many hours are there in 7.8146568 nanoseconds? 0.000000000002170738 How many millilitres are there in fifty-nine fifths of a litre? 11800 What is 153.6827 years in months? 1844.1924 What is fourty-seven quarters of a kilometer in meters? 11750 What is 164.6599t in nanograms? 164659900000000000 What is one tenth of a millisecond in microseconds? 100 What is one tenth of a microsecond in nanos	{ "pile_set_name": "DM Mathematics" }
What is the smallest value in q, 0.3, l? l Let o = 114 + -208.1. Let v = -94 - o. Which is the second biggest value? (a) v (b) -4 (c) 3/7 (d) 1 c Let i = 10.932 - 11. Let y = -0.262 + 0.37. Let b = y + i. What is the smallest value in -0.4, 5, b? -0.4 Let h be (-26)/1183(-434)/10 + (-2)/13. What is the smallest value in -116, h, -2? -116 Let u = 7/4 - 2. Let d = -147 - -149.96. Let m = 0.96 - d. What is the fourth smallest value in u, -0.4, -0.5, m? u Suppose -5r - 58w + 63w - 485 = 0, 3r - 4w = -294. Which is the smallest value? (a) 20 (b) r (c) -2/3 b Let i = 12 - 12.02. Let f = 0.22 + i. Let m be 120/66 + (-3 - -1). Which is the second biggest value? (a) m (b) f (c) -4 a Let z be (-264)/88 - (-158)/(-2). Which is the smallest value? (a) z (b) -6 (c) 2/11 a Let k = 13 + -79/6. Let f be 25/(-10)20/25. Let i be (1 - 3) + (3 + -5)/f. What is the smallest value in i, -14, k? -14 Let j = 618 - 669. Let y = -57.17 - -6.07. Let n = y - j. What is the second biggest value in n, -5, 3? n Let o = -103 - -100. Let h = -353 - -353. What is the third biggest value in 5, 2/13, h, o? h Let s = 283/20 - 55/4. Let m = -2.26 - -2.5. Which is the second biggest value? (a) s (b) -2/5 (c) m c Let i = -0.062 + 0.792. Let l = -0.27 - i. Which is the smallest value? (a) l (b) 0.02 (c) 1/5 a Let i = -105 - -91. Let t = 64 - i. Let r = -73 + t. What is the third smallest value in -5, 3, r, -4? 3 Let l = -0.8 + 0.9. Let h = 0.1 + 1. Let p = h - 0.9. What is the third smallest value in l, p, -7? p Let j be 5032/6126/4(-3 - -9). Which is the second smallest value? (a) 2/11 (b) j (c) 2.6 c Let d = -24.974 + -0.026. Let p = 24.94 + d. Let l = p + 6.06. Which is the third smallest value? (a) -0.1 (b) l (c) 0 b Let n = 16 + -65/4. Let f = 76.99 + -66.99. Which is the third biggest value? (a) -0.1 (b) 0.01 (c) f (d) n a Let k be 2/(-7) - (-9)/105. Let m = 88 - 88. Let c = -8 - -7.9. What is the third biggest value in m, c, k? k Suppose -15 = 6u - 111. Suppose -3y = -4p + 14, -9 = -3p - 5y + u. Which is the biggest value? (a) -1 (b) 0 (c) -2/9 (d) p d Let f = 20/181 - -302/543. Which is the fourth smallest value? (a) 5 (b) 1 (c) f (d) 0.3 (e) 0.059 b Let u = 1.404 + 112.576. Let w = -113 + u. Let j = w - 1.1. What is the biggest value in 1, -0.1, j? 1 Let c be (-12)/(-144)(-1 + 2 + 2). Let s = -169/2 + 86. What is the second biggest value in s, 1/9, 9/7, c? 9/7 Let u = -2.9 - 0.1. Suppose 5j = 0, 0 = -5v + 3j - 4j + 60. Let f(h) = h - 8. Let d be f(v). Which is the second smallest value? (a) d (b) 3 (c) u b Let n = -0.1823 - 51.8177. Let s = -404.8 - -353. Let y = n - s. Which is the fourth biggest value? (a) y (b) 0.3 (c) -3 (d) 5 c Let k(w) = w3 + 9w*2 + 32w + 45. Let r be k(-3). Let a = -85/3 + 28. What is the fourth biggest value in r, 0.3, a, 0.5? a Let t = 3 - 3.4. Let k = -148.07 + 148.07. Which is the second biggest value? (a) t (b) k (c) -6/7 a Let y = 1802.8 - 1630.8. Which is the second smallest value? (a) -5 (b) -0.13 (c) y b Let f = 4.316 - 0.316. What is the biggest value in -0.169, f, -0.4? f Let b = 7.136 - 7.136. What is the second biggest value in -2/25, 1, -4, b, 64? 1 Let j = 0.347 + 56.553. Let b = j + -56.8. What is the fourth biggest value in -1/4, -1/6, b, -1/7? -1/4 Let j = -3323/45924 + -42/3827. Let f = 0.05 + -0.45. Which is the fourth biggest value? (a) f (b) 0 (c) -3 (d) j c Let m = -0.9 - 0.1. Let r = -16/7 - -81/14. Let g = -17.063 + 16.963. Which is the third smallest value? (a) m (b) -1/2 (c) g (d) r c Suppose 0 = -u - v + 1, 0 = 5u + 3v + 4 - 17. Let g = -25204 - -25203.5. What is the smallest value in g, u, -16? -16 Let y = 72 - 36. Let o = y - 11. Let s = 24 - o. What is the second biggest value in s, 0.3, 0? 0 Let f = 0.4969 - -2.5031. Which is the biggest value? (a) f (b) -33 (c) 0 (d) 0.4 (e) 10 e Let w = -287.2 + 5.2. Let o = w - -282. Which is the third biggest value? (a) 2 (b) 6 (c) o c Let z = -0.066 - 0.034. Let n = -3.708 - -0.708. What is the smallest value in 1/10, n, z, 4/7? n Suppose 70 + 21 = 7j. Let o be 25/60 - j/(-30). Which is the smallest value? (a) o (b) -6 (c) 2 (d) -2 b Let n = -80.48 + 83.48. What is the second smallest value in -3/7, n, -6/5, 2, 0? -3/7 Let s = -0.165 - -4.065. Let v = 6.9 - s. Which is the second biggest value? (a) -1/2 (b) 5 (c) v (d) -0.4 c Let f = -107 + 181. Let z = 61 - f. What is the second smallest value in z, 4, -3? -3 Let z = 550.89 + -548. Let p = z + -2.59. Let n be (0/2)/(12). Which is the second biggest value? (a) n (b) 5 (c) p c Let g = -3830 + 3829.7. Which is the third biggest value? (a) -1 (b) -21.9 (c) g (d) 1 a Let g = -186.02 - -0.02. Let p = g - -187. Let h = -41/6 + 299/42. What is the second smallest value in h, -8/5, p? h Let j(g) = 819g - 9831. Let y be j(12). Which is the fourth biggest value? (a) y (b) 2/9 (c) 1/2 (d) 4/9 (e) -0.258 e Suppose 27m + 76m - 704 = -189. Which is the smallest value? (a) -3 (b) -4 (c) m (d) 25 b Let m = 4152 - 4154. Which is the second smallest value? (a) m (b) 4/9 (c) 40 (d) -1 d Let z = 185.4 + -54.4. Let m = 131.4 - z. What is the biggest value in 2/13, 1, 4, m? 4 Let b(g) = 2g3 + g + 4. Let w be b(3). Suppose -3c - 3v = -4v + w, -2c - 2v = 38. What is the third smallest value in 0.5, c, 3/5? 3/5 Let z(x) = -x*3 + 27x*2 + 52x - 67. Let s be z(28). Let c = s - 638. What is the smallest value in c, -2/9, -4? c Let r = -39744 + 39742. Let t = -6 + 2. Which is the fourth biggest value? (a) -1 (b) 0 (c) r (d) t d Let i = 15 + -5. Let n be 48/40i/(-3). Let b = -400/231 - -18/11. What is the biggest value in b, n, 3/2, 5? 5 Let k = 3 - 2. Let y be 175/(-147) - k/7. Suppose 17n + 5n = 0. What is the third biggest value in n, y, 5? y Suppose 19q + 23 = 5f + 15q, 5f - 2q - 29 = 0. Let i be (-9 - (f + -15))3/(-1). Which is the third smallest value? (a) 0.4 (b) 2/3 (c) 5 (d) i d Let a = 0.0393 - -16.5607. Let j = 16.77 - -0.23. Let d = a - j. What is the smallest value in 2/9, d, 0? d Let g be 275/(-20)(-312)/(-195). Which is the biggest value? (a) -42 (b) -2/15 (c) -4 (d) 0 (e) g d Let d = -0.94 - 0.76. Let v = d - -1.3. Let x = 12 + -11.6. What is the smallest value in 1/4, v, x? v Let i = 0.2 + 0.3. Let v = 48.5 - -11.4. Let y = 60.9 - v. Which is the smallest value? (a) 4 (b) i (c) 2/13 (d) y c Let a(g) = 4g2 - 8g + 9. Let t be a(10). Let i = t - 360. What is the second biggest value in -5, i, 2? -5 Let h = -5920 + 5925. What is the fourth smallest value in -43, -0.7, h, 4, -0.2? 4 Let c be 102/27 + 0 + -4. Let o be (5382/2093)/((-9)/(-14)). Let r = 226/371 - 2/53. What is the third smallest value in r, c, o? o Let n = -3041 - -33453/11. Which is the biggest value? (a) -0.3 (b) -1 (c) 0.5 (d) n (e) -0.2 c Let i = 0.099 + 138.901. Let k = 139.1 - i. Which is the smallest value? (a) k (b) -2/7 (c) -1/2 c Let k = 6381 + -6381.3. Let u = 0 + 1. What is the fourth biggest value in 9.9, u, -0.1, k? k Let y = 0.1284 + -0.6514. Let j = y + 0.223. Let p = 32/185 + 1/37. What is the biggest value in -0.2, p, j, 2/9? 2/9 Let i be ((9152/(-182))/44)/(21). What is the biggest value in -0.7, 336, 1/7, 2, i? 336 Let h = 174.99 - 174.49. Let o = -349 - -2081/6. What is the second biggest value in h, 0, o? 0 Let f be (375/384 + -1)/((-57)/(-988)-2). What is the third smallest value in 3, f, -3/2? 3 Let f be (-15)/9 + (-440)/(-120). Suppose 0 = 5y - 2x - 23, -3 = -y + 3x - x. Suppose -y = fs - 13. What is the second biggest value in 8, s, -2, 1? s Suppose 43o + 29o - 23o = -441. What is the biggest value in o, 3/5, 0? 3/5 Let l = -6364 + 6363.6. Let r = 79 - 80. Which is the fourth smallest value? (a) r (b) -0.05 (c) l (d) 0.4 d Let z = 3621/452 + -18331/2260. Let y = 0.29 + 0.01. Let f be (-1 + 2)(-2)/(-6). What is the fourth biggest value in y, f, -1, z? -1 Let p be (-6)/(-14) + (-50)/70. What is the smallest value in 0.02, 2/17, p, 1? p Let m = 169 - 159. Let k be 4/(-54)15/m. Which is the third smallest value? (a) k (b) 5 (c) -5 b Let s(i) = 7i - 2 - 6 + 31 + 16. Let l be s(-5). Which is the second smallest value? (a) l (b) -0.2 (c) -14 b Let b = 3047914/143 - 2	{ "pile_set_name": "DM Mathematics" }
(a) i (b) -5 (c) w (d) 1 b Let f = 2/9593 - -19180/28779. Let n = -0.09 - 0.71. Let i = n + 1.3. Which is the biggest value? (a) f (b) 0.9 (c) i b Let i = 0.013 + 0.126. Let j = i - -64.861. Let f = 64.5 - j. Which is the second smallest value? (a) -4/3 (b) 0.3 (c) f c Suppose -n + 5n = 0. Let v = 14079.5 + -14080. What is the biggest value in -7/9, n, v? n Let d = -0.4851 + 0.0501. Let f = d + 0.735. What is the third smallest value in -0.04, -2, f? f Suppose n + 4v = 5, 0n - 4n + v + 37 = 0. Let u = 0.6 - 4.6. Let w = 58672 - 58677. Which is the fourth smallest value? (a) u (b) n (c) w (d) -3 b Let t = 0.1396 + -1.1396. What is the smallest value in 3, t, 37? t Let l(w) = w*3 - 25w*2 + 9w - 43. Let j be l(25). Let v be j/(-40) + 462/(-385). Let z = 0.3 - 0.7. What is the third biggest value in z, v, -3? v Let j = 279 + -161. Let w = j - 100. Which is the smallest value? (a) w (b) 0 (c) 4/3 b Let c(o) = 86o - 6192. Let t be c(72). What is the biggest value in -1/6, t, 0.033? 0.033 Let a = -8373 - -8247. What is the third biggest value in 0.18, 1, a, -0.3, 0? 0 Let z = -20318 + 19116.1. Let b = 1078 + z. Let w = -124 - b. What is the biggest value in 3/4, -2/15, w? 3/4 Let n = 37.5 + -37.211. Let q = n - -0.011. Let x be 4 + ((-1)/3)/((-2)/6). Which is the fourth smallest value? (a) x (b) q (c) 4 (d) 2 a Let o = -588 + 366. Let x = o + 221.95. What is the smallest value in 0.5, 0.1, x, -2/3? -2/3 Let b = 8.348 + 0.052. Let w = b - 7.4. Let c be 6/4 + (-35)/26. What is the third smallest value in w, 3/2, c? 3/2 Suppose -28o = 31o - 413. Which is the fourth smallest value? (a) -4 (b) -0.31 (c) o (d) 2/13 c Let k = 4733.59 + -4733. What is the second biggest value in k, -3, 2? k Let p be 2 - (-28)/20 - (5 + (-207)/45). Which is the fourth biggest value? (a) 2/7 (b) p (c) -48 (d) -4 c Let l = 16.4 - 16. Let s = -3028 - -3028. Which is the smallest value? (a) 2 (b) l (c) s c Let c = -1318/7 + 188. Let l = 12.16 - 12. Let x = l + -0.46. What is the biggest value in -5/2, c, x? c Let y be (125/(-30))/5 - (-9)/(-18). Let q be 357/(-153)(-2)/(-7). Which is the third smallest value? (a) q (b) y (c) 2 (d) 3 c Let o be 520/(-52) + 252/27. Which is the fifth biggest value? (a) o (b) -10/21 (c) -2 (d) -3 (e) -1 d Let o = -18779 + 18778.8. Let i = 7/4 + -13/12. Which is the third smallest value? (a) o (b) i (c) -0.07 (d) -2 c Let m = -3 + 0. Let v be -5(3 + (-78)/(-30)). Let y be ((-6)/(-14))/(2 - (-24)/v). What is the second biggest value in m, y, -5? m Let w = -0.05316 - -5.05316. What is the second smallest value in -0.1, -0.03, -1/5, w? -0.1 Let o be (178/534)/((-7)/6). Let k be 12/10(-120)/(-18). Suppose 5b - 5v + v = -36, 5v = -3b + k. What is the third biggest value in -25, o, b? -25 Let f be (-4 - 44/(-12))(-357)/(-1547). Suppose -4w = -9w + 15. What is the second smallest value in 0, -2, f, w? f Let m = -176 + 295. Let x = -511.2 + 630. Let o = x - m. What is the second smallest value in -0.32, -3, o? -0.32 Let v be (-2)/(3(-8)/4164). Let o = v + -351. Which is the smallest value? (a) o (b) 0.09 (c) -2/21 (d) -2 a Suppose 3f - 124 = 3q - 121, 4 = -2f + q. Let j be (2/4)/(4/32). What is the second biggest value in -3, f, -19, j? -3 Let r = 14066/7 + -2010. Let s be (1 - 3)(-14 - -10). Let k be (1 - -1)2/7. What is the fourth biggest value in r, k, 0, s? r Let o = -2.54 + 2.34. Let p = -334 + 6344/19. Let t be -2 + (6/(-4) - -2). Which is the smallest value? (a) o (b) p (c) t c Let f = -4 + 7. Suppose 5n + 3z - 45 = 0, -3n + 5z = 2z - 51. Let x be n/(-18)15/(-2). Which is the second biggest value? (a) x (b) f (c) -1 b Let o be 870/(-75) + 16 + (-5)/1. Let d = -5.03 - -0.03. What is the third smallest value in 0.07, d, o, 5? 0.07 Let t = 267 + -254. Suppose 0 = -tp + 7p - 6. What is the second biggest value in p, 0.97, -4? p Let x = 3077 - 3135. What is the fifth smallest value in x, 3/7, 1/4, 0.5, -5? 0.5 Let r = 41 - 41.2. Let n = 0.153 - -3.847. Which is the third smallest value? (a) 0.3 (b) n (c) r b Let o = 1146.9 + -1147. What is the biggest value in o, 41, -1, 3? 41 Suppose -4d + 21 = -3. Suppose 5 + 7 = dp. What is the third biggest value in p, 12/7, -2/5? -2/5 Suppose 5g + 850 = -72u + 67u, 0 = -4u + 2g - 674. Which is the biggest value? (a) 1 (b) u (c) -0.12 a Let y = -292363/2 - -146181. Let r be 1 + -1 + (-2)/(-2). Which is the biggest value? (a) y (b) r (c) 0.1 (d) 133 d Let g be 1/(-2) - 1040/(-400)10/(-4). Which is the fourth biggest value? (a) g (b) -2/163 (c) -0.1 (d) -5 a Let l be (-35)/(-14)(-3 + (-8329)/65). Let n = -328 - l. Which is the third smallest value? (a) -5 (b) n (c) -0.4 b Let u(i) = i*3 + 9i*2 - 12i - 25. Let n be 1/(3/(-42)) - -4. Let p be u(n). Which is the smallest value? (a) 1/5 (b) p (c) -4 b Let n = 6929/3 + -51991/24. Let g = -143 + n. Which is the fourth biggest value? (a) g (b) -4/7 (c) -4 (d) 3 c Let n = 22 - -5. Let k = -13345.3 - -13345. What is the second biggest value in k, n, -3? k Let n = 38760 + -38760.1. Which is the smallest value? (a) -4 (b) 9/2 (c) -3 (d) n (e) -2/13 a Let k(l) = 123l - 767. Let w be k(-15). What is the third biggest value in -5, w, 0, 0.5? -5 Let z = -6 + 2. Suppose -1 = 5j - 6j, -4q + 7 = -5j. Let x be -1 + 3/((-27)/(-12)). What is the second biggest value in -0.2, x, q, z? x Let m = 9 - 4. Let f = -1280 - -1275. Which is the fourth biggest value? (a) f (b) m (c) -14 (d) -0.2 c Let n = -20692 + 20690. What is the biggest value in -2/11, 42, 3, -5, n? 42 Let s(z) = z3 - 3z*2 - 2z + 1. Let i be s(3). Let k = 4.665 + 0.575. Let q = k + -4.74. What is the smallest value in 0.02, q, i? i Suppose -17m - 1450 = -1348. What is the second biggest value in m, -4, -1.9, -2/5? -1.9 Let y = 3566 + -3571. Which is the smallest value? (a) -0.5 (b) 3 (c) 0 (d) -0.25 (e) y e Let g = -3481/3 + 1160. Which is the smallest value? (a) g (b) 3 (c) 5 (d) 6 a Let k be (-12)/(-66)(-1452)/(-352). Which is the second smallest value? (a) -350 (b) k (c) 1 (d) 0.1 (e) 0.2 d Let v be -1 + 8/20 + (-20349)/135. Let o = 152 + v. Suppose -2w = -3 + 1. Which is the fourth biggest value? (a) -5 (b) w (c) o (d) -4 a Suppose 7q + 323 = 358. Let y = -0.112 - 0.888. Which is the biggest value? (a) q (b) 1 (c) -0.1 (d) y a Let j = 227/17300 - 4/173. Let r = -193/700 + j. What is the second smallest value in 3/2, 3/7, r? 3/7 Let s be (1/(-9))/((-1)/3). Let q = -193/192 - 21/64. Which is the fourth smallest value? (a) s (b) q (c) -4/5 (d) -3 a Let m = 92459.9 - 93458.917. Let o = m + 1001. Let b = -0.017 - o. What is the second biggest value in b, 0.1, 18, -3/2? 0.1 Let o = -352/5 - -71. Let w be ((-8)/(-140))/((-1)/(56/16)). Let x = -5 - -9. Which is the second biggest value? (a) x (b) o (c) w b Suppose -3l = -k - 2, 2l - 4k - 352 + 344 = 0. Which is the second smallest value? (a) -0.2 (b) l (c) -3 (d) -4/9 (e) 214 d Let h = -36 + 145/4. Let p = 3/25 + 63/100. Let z = -13214 - -13214. Which is the third smallest value? (a) p (b) z (c) h a Let j = 5615 - 5615.1. Let o be (-12)/2(-1)/2. What is the second smallest value in o, j, -6, -4? -4 Let k = 7606 - 7605. Which is the fourth smallest value? (a) -13/7 (b) k (c) 3 (d) 2/3 (e) 1/5 b Let l = -14.86 + 8.86. Let m = -1 + 0. Let x = l - m. What is the third biggest value in -2/37, x, -0.1? x Let w = -45326.5 - -45327. What is the third biggest value in w, -0.4, 0.2, -4, 1? 0.2 Let h = 0.11987 - -1.88013. What is the fourth smallest value in 5.6, 1, 0.4, h? 5.6 Suppose 4s = -5i - 31, -2s = 5i + 14 + 9. What is the second biggest value in 2, 0.07, -35/9, i, 0.2? 0.2 Let d be 7 - 10 - (348/(-143) - 1). Let j = -8/13 + d. What is the biggest value in -0.5, j, 0.06, 3? 3 Let w(r) = 281r + 276. Let z be w(-1). What is the fourth smallest value in z, -4, 2/3, 8/11, -2? 2/3 Suppose 0z - 2o + 5 = -z, -6 = 2z - 5*o. Let r = -4.7877 + -0.2123. What is the third biggest value in r, z, -2/3? z Let h = 19.326 - 19.1. Let i = h - -0.684. Let q = 4.91 - i. Which is the fourth biggest value? (a) q (b) -3 (c) -4 (d) 2/11 c Let m = -28756 - -28765. What is the biggest value in m, 4/23,	{ "pile_set_name": "DM Mathematics" }
y = d + 291, -4d + 4y - 2y - k = 0. Is 3 - (d - -2)8 composite? True Let v be (3/(-3) - 34)1. Let x = v + 37. Is (-1 - (-1085)/x) + (-2)/4 prime? True Let k(y) = -y3 - 3y*2 + 4y - 2. Let u be k(2). Let w be (-36)/u + (-39)/(-91). Let g = w + 10. Is g a prime number? True Let h(j) = j*3 + j + 1. Let o(k) = 4k*3 + 26k*2 + 22k - 21. Let b(s) = -3h(s) + o(s). Let w be 7/(-21)615 + 7. Is b(w) a prime number? False Let m = 865 + -1222. Let g = 2564 - m. Is g a prime number? False Let d = -421 - -424. Is (10/d - 2)14622/8 a composite number? False Suppose 428z + 20 = 423z. Is (-32699)/(-57)1(-1 - z) composite? False Suppose -2y + 2t = 3y - 20, -y - 23 = 5t. Suppose 5f - 12 = -4b, -3f + 9 = 5b - yb. Suppose fs + 232 = 4s. Is s a composite number? True Suppose -2873p - 4c + 172333 = -2870p, -114897 = -2p - c. Is p a composite number? True Let n(k) = -5305k - 131. Is n(-4) prime? True Let l(n) = 780n - 107. Is l(41) composite? False Let f(q) = 43q*2 - 6q + 1. Let h be f(-6). Let z = -5897 + 5899. Suppose -zi = 5o - 2788, 3i - 3o - 2618 = h. Is i prime? True Let s = -774475 + 1236152. Is s a composite number? False Let m be (3 - (-352)/(-121)) + (-508)/22. Let x(g) = -365g + 352. Is x(m) prime? True Suppose 83m + 52758454 = 289m. Is m a composite number? True Let a = 310 - 307. Suppose -ar = -5625 - 15492. Is r composite? False Let v be -6 + -1775(-7 + 6)1. Let s be (-3)/(-12) - (-2295)/4. Let f = v - s. Is f a composite number? True Let j = 238866 - 100159. Is j prime? False Suppose -6l - 12 = -8l. Let p(o) = 19o2 - 2o + 3. Let s be p(l). Suppose 2d - 595 = s. Is d composite? True Let q(w) be the first derivative of 9w*4/4 + 5w*3/3 - 5w*2 - 5w - 13. Let r be q(5). Suppose 0 = 3m - 9628 + r. Is m a prime number? False Let w(k) = 2k + 7. Let i be 3 + (13/26 - (-26)/(-4)). Let h be w(i). Is (h - 3)(-1)/24909 a prime number? True Let b = -484085 - -861733. Suppose b + 247095 = 31d. Is d prime? False Is (-15 - (-999)/(-108))-4076 prime? False Let h(p) be the first derivative of p6/40 - p5/20 - 7p4/24 - p3/3 - 5p*2 - 6. Let d(g) be the second derivative of h(g). Is d(5) a prime number? True Is (-2)/((-18)/339711) + (-820)/(-615) a prime number? True Let y(q) = 7q - 26. Let x be y(6). Let v(t) = 5t2 + 26t - 51. Let z be v(x). Let w = z + -894. Is w composite? False Suppose 3a + 4p - p = 30, 2p + 4 = 0. Is 6/4a/(-9) + 4959 a prime number? True Let q(t) = -187t + 8. Let p = -42 + 38. Let w be -9 + -5p/5. Is q(w) prime? False Suppose 4o - 8o - 5f - 3292 = 0, o - 3f = -840. Suppose 0 = -s + 2s - 3p - 43, -51 = -s - p. Let r = s - o. Is r a composite number? False Suppose a = -4z - 309, 2a - 5z + 1570 = -3a. Let i = a + 181. Let n = -75 - i. Is n a prime number? False Suppose -312f - 5l + 563855 = -307f, 2f - 225530 = 4l. Is f a prime number? False Let m(h) = -6355h - 2946. Is m(-19) composite? True Let d = -6 + 8. Suppose 1928 = -r + dr. Suppose 6y - 7390 = r. Is y a prime number? True Is 2(56406690/150)/((-6)/(-5)) a composite number? False Let h(d) = -261d*3 + 7d*2 - 40d - 5. Is h(-8) prime? False Suppose -5720648 = 37u - 157u + 2036512. Is u a composite number? True Let v = 78999 - 48784. Is v prime? False Let r = -26 - -26. Suppose 4 = -w, 2j + 2 = -rw - 2w. Suppose 4k = 4m + 1716, jm + 0m = -4k + 1730. Is k composite? False Let d be ((-16)/(-16))/((-3)/18). Is (d/9)/((-2)/(-23799))-3 prime? False Let h(d) = -8d*3 + 5d*2 + 4d - 17. Let p be h(7). Is ((-87)/(-58))/((-6)/p) a composite number? True Let o be -616 + -4 + 0 - 0. Let u = 2060 + o. Suppose -4n + 3h = -1153, 7n - u = 2n + 5h. Is n a prime number? False Let b be (-2)/10 - (1 - (-2223)/(-15)). Let n = b + -142. Suppose -nq + z + 1076 = -412, -1484 = -5q + 3z. Is q composite? True Suppose 4n + 4i = 3n - 136, -384 = 3n + 4i. Let w be n151/6. Let y = w + 665. Is y composite? True Let j(l) = l3 - 5l*2 + l - 7. Let g be 116/20 - (-24)/(-30). Let t be j(g). Is (t - 16/(-6))(-2478)/(-4) composite? True Let j = 16514 - -219. Suppose h + 1157 = 3r + 4498, -5h = -r - j. Suppose 6d = 1321 + h. Is d a prime number? False Let v(g) = -g3 + g2 + g. Let p be v(3). Suppose -14f - 20f = -340. Is f/p - 89219/(-9) a prime number? False Let y = 3514 + 122343. Is y a prime number? False Let v = -397 + 378. Let a(k) = 2k2 - 33k + 12. Is a(v) prime? True Suppose -37d = -39d - g + 189424, 0 = -d + 2g + 94697. Is d a prime number? True Let l(j) be the third derivative of -37j6/60 + j5/60 + j4/24 - j3/6 - 87j2. Is l(-2) prime? True Let n(s) = -2s*2 - 11s - 7. Let r be n(-4). Suppose -3d + 361 + 232 = -p, -2d - 2931 = rp. Is -4 - (-1 - 2/(-1)p) prime? True Suppose -17n + 20n - 141563 = 4u, -25 = 5u. Is n prime? False Suppose -367m = -365m - 8. Suppose k + 177564 = mc, -24552 = -c + 5k + 19839. Is c a prime number? False Let j = 732 - 737. Is (12/36j)/(1/(-5223)) prime? False Let z(q) = 713302q*2 - 317q + 316. Is z(1) a prime number? False Let i(n) = 12 - n*2 + 12 + 15n + 15. Let b be i(17). Suppose -l + p + 6350 = 0, 3l + bp = -0p + 19042. Is l a composite number? True Let a be (-7 - -5)(-2 - 13/(-2)). Let s(x) = -11x3 - 7x*2 - 31x - 16. Let v be s(a). Suppose -4u = u - v. Is u a prime number? True Suppose 8q - 36 = 6q. Suppose -31h + 7969 = -qh. Is h a prime number? True Suppose -24q - 34960 = -34q. Let d = q + -1097. Is d composite? False Let v(t) = t3 + 96t*2 - 181t + 91. Is v(-94) composite? True Suppose i - n = 7, -3i + 3n + 35 = 2i. Let a = 2884 - -1878. Suppose 5y = -15, ik - 2k - a = -y. Is k composite? False Let x be 7((-570)/(-7))/(-5). Let s be -16(2/(-5))/((-20)/(-725)). Let p = x + s. Is p composite? True Let u be 170/51(-6)/(-5). Suppose -un = -n - 1275. Suppose -3d - p + n = -3p, 5p = -4d + 582. Is d prime? False Let n(d) = 46d2 + 8d - 23. Let h be 3/(-6) + (-45)/6. Let x be n(h). Suppose 1023 - x = -2u. Is u prime? False Let d be (2/(-6))/(6/(-54)) - 807. Let f = d + 1385. Is f prime? False Suppose -6v = -1521 - 14445. Suppose c - v = -2c. Is c prime? True Suppose 6u + 14 = 5u. Let k(p) = p2 + 10p - 28. Let j be k(u). Is (7882/j)/((-2)/(-4)) prime? True Suppose 9 + 15 = -2p - 4m, p = m + 3. Let w(j) = -392j3 + 2j*2 + 7. Is w(p) a composite number? True Suppose 372p - 573356 = 344p. Is p a prime number? True Let q(w) = 289w*2 + w - 41. Suppose -236u - 30 = -231u. Is q(u) a prime number? True Suppose -3t + 9 = 8r - 7r, t = -4r + 14. Is r/(3/1259(5 + -4)) prime? True Let w be ((-2308)/(-50))/2 - 4/50. Suppose -wu + 214773 + 239270 = 0. Is u a composite number? True Let g = -24676 - -52061. Is g prime? False Suppose 4z + 5y - 1209764 = 0, -1209756 = -4z - 18y + 14y. Is z prime? False Let g be 109/(-9) + 3/27. Let j = g + 23. Let q(k) = -k*3 + 16k*2 - 21k + 17. Is q(j) a composite number? True Let j = -15 + 23. Suppose 0 = -2p + j, 4u - 31609 - 5903 = -5p. Suppose 7h = 20h - u. Is h composite? True Suppose 5u - 4u + 4g = 4997, -5g = 15. Let c = u + -2431. Is c prime? False Let s = -8 - 4. Let f be (-3)/(s/(-116)) + -3. Let m = f - -38. Is m a prime number? False Let t = 360 + 1948. Suppose t = 4i - 2296. Is i a composite number? False Suppose -111z - 3 = -112z. Suppose 6p = 5p + 1, -2k + 11555 = -zp. Is k a composite number? False Let x(j) be the second derivative of 163j2 + 0 + 16j + 1/2j3. Is x(0) composite? True Let p = 17095 + 31308. Is p a prime number? False Suppose d - 4k - 654935 = 0, 3d - 14k - 1964839 = -19k. Is d composite? False Let t(s) = 2985s + 20. Let j(q) = -5969q - 39. Let h(k) = -6j(k) - 11t(k). Is h(3) a prime number? True Suppose 87a + 25a = 346416. Let o be -1 + 1 + -2 - 1580. Let d = o + a. Is d composite? False Let y(j) = 15j - 1. Suppose 37q = 33q + 40. Is y(q) prime? True Suppose -58i = -99i + 4043461. Is i a composite number? False Let x(t) = -40t - 1. Let g(i) = -11i + 14. Let u be g(4). Let k be (1/2)/(5/u). Is x(k) prime? False Let x(k) = k*2 + 5k - 94. Let s be x(8). Suppose sg - 12g = -c + 6606, -5c + 32986 = g. Is c prime? False Suppose 18m - 51 = 57. Suppose -	{ "pile_set_name": "DM Mathematics" }
8 Calculate prob of sequence bn when two letters picked without replacement from nzbsz. 1/20 Calculate prob of sequence unr when three letters picked without replacement from {u: 1, n: 2, x: 2, k: 1, r: 2}. 1/84 Three letters picked without replacement from {z: 9, e: 4, a: 4}. What is prob of sequence eze? 9/340 What is prob of sequence td when two letters picked without replacement from tdpdpyp? 1/21 Calculate prob of sequence fyf when three letters picked without replacement from yfvemffevmfgf. 5/429 What is prob of sequence hr when two letters picked without replacement from {h: 4, r: 1, s: 7, x: 1, b: 3}? 1/60 Calculate prob of sequence vaa when three letters picked without replacement from ecaivca. 1/105 Two letters picked without replacement from {d: 5, j: 1, m: 3, p: 1}. What is prob of sequence mp? 1/30 Four letters picked without replacement from {u: 6, e: 5, m: 4}. Give prob of sequence emem. 2/273 What is prob of sequence kky when three letters picked without replacement from {q: 1, s: 5, y: 1, a: 1, k: 3}? 1/165 Three letters picked without replacement from jooooqtq. Give prob of sequence oqq. 1/42 Four letters picked without replacement from veeepseeetstessee. What is prob of sequence vest? 3/2380 Four letters picked without replacement from {r: 1, e: 6, i: 1, b: 5, j: 2}. Give prob of sequence jiee. 1/546 Two letters picked without replacement from rrrrprrrrrrrr. Give prob of sequence rp. 1/13 Three letters picked without replacement from bkbkkkkkkkk. What is prob of sequence kkb? 8/55 Four letters picked without replacement from tuuuuuotttu. Give prob of sequence uuou. 1/66 Calculate prob of sequence vvyy when four letters picked without replacement from {r: 1, t: 5, v: 6, y: 2, s: 2}. 1/728 Three letters picked without replacement from ssstssssssss. What is prob of sequence sst? 1/12 Calculate prob of sequence zzzz when four letters picked without replacement from pzpzzzpppp. 1/210 Two letters picked without replacement from {z: 1, x: 1, r: 1, i: 1, t: 1}. What is prob of sequence ri? 1/20 Three letters picked without replacement from {p: 1, y: 3, n: 3}. What is prob of sequence yyn? 3/35 Two letters picked without replacement from jjjmjdjmjjjjmjjmm. What is prob of sequence mj? 55/272 Three letters picked without replacement from lkwle. Give prob of sequence wek. 1/60 What is prob of sequence uq when two letters picked without replacement from squqssqsjsqss? 1/39 Two letters picked without replacement from {p: 15, y: 3}. Give prob of sequence py. 5/34 Three letters picked without replacement from iriiriiiiriiiiriiiii. What is prob of sequence iri? 8/57 Two letters picked without replacement from xuxuxx. Give prob of sequence xu. 4/15 Calculate prob of sequence qnr when three letters picked without replacement from qqnrn. 1/15 Three letters picked without replacement from twwyttkwtw. Give prob of sequence wky. 1/180 Four letters picked without replacement from sdsesssdesevsdedsses. What is prob of sequence dess? 5/323 What is prob of sequence bv when two letters picked without replacement from llmlldvmlmblvml? 1/105 Three letters picked without replacement from {c: 13, t: 6}. Give prob of sequence ttt. 20/969 What is prob of sequence ss when two letters picked without replacement from {m: 1, h: 14, s: 2}? 1/136 What is prob of sequence mjmj when four letters picked without replacement from {m: 6, j: 12}? 11/204 Two letters picked without replacement from {x: 1, j: 2, p: 1, c: 1}. What is prob of sequence jc? 1/10 Calculate prob of sequence ya when two letters picked without replacement from gbgabbbgyawbwabbbyb. 1/57 Calculate prob of sequence qod when three letters picked without replacement from {q: 1, o: 4, d: 3}. 1/28 What is prob of sequence qmae when four letters picked without replacement from {q: 3, f: 1, a: 1, e: 4, m: 5, u: 1}? 1/546 Three letters picked without replacement from {k: 2, s: 3, i: 1, n: 1, b: 3}. Give prob of sequence nsb. 1/80 What is prob of sequence iy when two letters picked without replacement from {y: 3, i: 5}? 15/56 What is prob of sequence nu when two letters picked without replacement from {u: 8, n: 6, h: 1}? 8/35 What is prob of sequence ycyc when four letters picked without replacement from {m: 2, u: 4, f: 1, c: 2, y: 5}? 5/3003 What is prob of sequence flf when three letters picked without replacement from llllflllllff? 9/220 Calculate prob of sequence iaj when three letters picked without replacement from ijjiaiaaa. 1/21 Four letters picked without replacement from uluuuuldlllluduuuluu. What is prob of sequence duld? 77/58140 Two letters picked without replacement from {m: 2, n: 10}. Give prob of sequence mn. 5/33 What is prob of sequence rr when two letters picked without replacement from aaaraaaaraaaaraaaaaa? 3/190 Calculate prob of sequence wj when two letters picked without replacement from {w: 1, k: 1, j: 1}. 1/6 Three letters picked without replacement from aoaa. Give prob of sequence aaa. 1/4 Two letters picked without replacement from dcsdbep. What is prob of sequence bp? 1/42 What is prob of sequence jqce when four letters picked without replacement from qjjjcee? 1/140 Two letters picked without replacement from pppsnccpl. Give prob of sequence pp. 1/6 Three letters picked without replacement from llllllluluulluul. What is prob of sequence lul? 55/336 Four letters picked without replacement from iididddd. What is prob of sequence ddid? 3/28 Calculate prob of sequence slss when four letters picked without replacement from {s: 12, l: 7}. 385/3876 What is prob of sequence ptt when three letters picked without replacement from tcplplpplpclpplcttpp? 3/380 Four letters picked without replacement from yyypzyzp. What is prob of sequence pzyy? 1/35 Calculate prob of sequence eee when three letters picked without replacement from {e: 9}. 1 What is prob of sequence vv when two letters picked without replacement from {v: 4, m: 3}? 2/7 What is prob of sequence xl when two letters picked without replacement from {x: 1, l: 4, m: 9, u: 1}? 2/105 Two letters picked without replacement from mhoomhmmmmmho. Give prob of sequence oo. 1/26 Three letters picked without replacement from wgrrgrggjrrrr. Give prob of sequence rwg. 7/429 Two letters picked without replacement from vxfrvdfor. Give prob of sequence do. 1/72 What is prob of sequence wa when two letters picked without replacement from {a: 3, k: 2, h: 3, w: 1, o: 6}? 1/70 Calculate prob of sequence uuw when three letters picked without replacement from wuwwuwwww. 1/36 Three letters picked without replacement from chhhhhhhhhhc. What is prob of sequence chh? 3/22 Three letters picked without replacement from jbjjbbjbbbbjjbjjbbbj. What is prob of sequence jjj? 7/95 What is prob of sequence bb when two letters picked without replacement from bbbbbbibbbbb? 5/6 Calculate prob of sequence ne when two letters picked without replacement from {n: 1, a: 1, e: 1}. 1/6 What is prob of sequence qur when three letters picked without replacement from {q: 1, u: 1, i: 1, r: 4, k: 2}? 1/126 Two letters picked without replacement from {z: 1, g: 1, a: 5, b: 4, f: 4}. What is prob of sequence za? 1/42 Two letters picked without replacement from yws. What is prob of sequence ws? 1/6 Four letters picked without replacement from xxuxxxxxuu. What is prob of sequence xxux? 1/8 Calculate prob of sequence jok when three letters picked without replacement from jojoxkj. 1/35 Three letters picked without replacement from bjlacjblljjlljj. What is prob of sequence bbl? 1/273 Three letters picked without replacement from jzvzvjzvz. What is prob of sequence jvv? 1/42 Three letters picked without replacement from {b: 5, h: 1, t: 14}. What is prob of sequence bth? 7/684 Calculate prob of sequence vv when two letters picked without replacement from vvdd. 1/6 Calculate prob of sequence kp when two letters picked without replacement from peikpsesssse. 1/66 Two letters picked without replacement from qqqqqnrqrqqqqf. What is prob of sequence rf? 1/91 Calculate prob of sequence hhtm when four letters picked without replacement from {h: 2, t: 3, p: 4, k: 6, m: 1}. 1/7280 What is prob of sequence qoe when three letters picked without replacement from oheeehqeheeeeee? 1/273 What is prob of	{ "pile_set_name": "DM Mathematics" }
e d(7). Suppose kf + 2f = x. Solve -3n = 4v + 31, n = -3n - 2v - f for n. -5 Let t(r) = 2r - 10. Let k be t(8). Let o = k + -2. Solve 0 = 5w + ov - 4 - 3, -4v - 17 = -3w for w. 3 Let v(s) = -7s*2 + 3 - 5s*3 + 2s*3 - 13 - 2s + 2s3. Let f be v(-7). Solve -fx - 12 = -2z, -z = -x - 5z + 6 for x. -2 Let u = -2 - -2. Suppose u = -5b + 6b. Suppose -p + 9 = -d, 0 = -bd + 4d + 12. Solve -2a + p = -n, -4a - n + 12 = 2n for a. 3 Let s(y) = -y2 - 9y + 2. Let j be s(-7). Let l = -11 + j. Solve g + 4 = lp + 19, 0 = g for p. -3 Let x(r) = 9r + 2. Let f be x(2). Suppose a + 0b = 2b, 5a = 5b + f. Let p be 1/((-14)/a - -2). Solve 5w - 3j = p, -5j = -3w - 2j for w. 2 Let l(z) = -z2 - 6z - 4. Let p be l(-4). Suppose pw = 5 - 37. Let h be 8w2/(-4). Solve 4t - h = -n - 3n, 20 = 4n for t. 3 Let b(r) = r*3 - 7r*2 + 2. Let k be b(7). Let p = 9 + -5. Suppose kz = pz. Solve 3g + 5u = 2u + 21, z = -5g + u + 17 for g. 4 Let k = 11 - 15. Let d be (k/(-10))/((-1)/(-5)). Solve 5s = -dq + 2, -2s + 5q = 3s + 5 for s. 0 Let t(c) = -c*2 - 8c - 10. Let b be t(-6). Solve -2m = -4o - 12, -o + b = m - 1 for o. -1 Let c = 6 + -3. Solve -2r + 11 = t + 2, 2t - cr = 4 for t. 5 Let y(b) = -2b - 6 + 0 + 3 + 6. Let n be y(-8). Suppose 3q = n - 4. Solve 0 = -5u + 4g - 45, 3u + 3g + 25 = qg for u. -5 Let r(j) = j + 17. Let l be r(-13). Solve -5x + 3k = 23, -4x - l = k + 11 for x. -4 Let z(n) = 5n*3 - 2n*2 - n. Suppose 0u = -5u - 5. Let m be z(u). Let x = m + 11. Solve -5p - 10 = xk, 2p = k - 4 - 3 for p. -3 Suppose -4i - 3d + 20 = -2d, -4i + 20 = -d. Suppose -ip - 2g + 9 = 0, -p = -3g - 8 - 4. Solve 5s = 5z - 20, ps + 3z = -s - 23 for s. -5 Suppose 8v = 3v + 10. Solve -a + r + r = -1, va + 5r + 16 = 0 for a. -3 Let y be 2(2 + 0/1). Solve 7h - 2h + 4i = -35, 3i = yh - 3 for h. -3 Let i = -18 + 38. Solve 0 = -4c + i, 2c + 0c - 13 = -3n for n. 1 Suppose -3b + 4 = d - 14, 2d - 5b - 58 = 0. Solve -3v = o - 4v - 1, o = -4v - d for o. -4 Suppose -2q - 3q - 27 = -3o, -q + 13 = 4o. Solve -oz - k = -7, -k = z + 3k + 17 for z. 3 Let r be 8/5(-20)/(-8). Let x be 93/(-9)-3 + 4. Solve -x = m - 6m + 5j, -12 = 4m + rj for m. 2 Let b(y) = y - 2. Let r be b(6). Suppose x - 2x = 0. Solve 2u - 12 = -2n + 3n, -ru + 4n + 28 = x for u. 5 Let j be 1/((-5)/(-5))0. Suppose 5u + 4m = -5, 0 = u - 0u - 3m - 18. Solve -s + uz - 7 = j, -s + 4z = -0s + 8 for s. -4 Let p(b) = -b3 - 5b*2 - 4b - 2. Let k be p(-5). Let m(u) = 2u - 7. Let i be m(6). Let j = 1 - -1. Solve 1 = 2c + 7t - jt, -k = -ic + 3t for c. 3 Let w = 18 - 14. Suppose -wh + 0h + 24 = 0. Solve hj = 2c + j + 5, -j - 6 = c for c. -5 Let o be (48/30)/(4/10). Solve ov = -10g + 5g - 26, -2g = 4v + 20 for v. -4 Suppose 4c + 3 = a - 3, 4c + 24 = 4a. Let j be -1(-7 - (2 + 0)). Solve -4o + a = -m - j, -3m - 10 = -5o for o. 5 Suppose -29 = -5j - 4. Let l be 6/j50/20. Solve 2n + 2n = 3c - 20, -10 = -lc - n for c. 4 Suppose -r = -4t + 8, -5t - 3r + 17 + 10 = 0. Solve tz = 7l - 3l + 25, 3l + 12 = 0 for z. 3 Suppose 3w + 3y = -y + 32, 5y = -4w + 41. Solve w = -4q - 0h + 3h, h + 4 = 0 for q. -4 Let g be ((-8)/10)/(2/(-10)). Let f = 6 - -2. Solve -13 = -c - 4r, -gr + 2r = -f for c. -3 Suppose 0 = n - 5y - 16 - 10, -5n + y = -82. Solve o - n = -4t, o - 2 + 10 = 4t for o. 4 Let r = -1 + 7. Let s(u) = -11u - 9 + 5u + 8u. Let c be s(r). Solve -cn - 2h - 1 = 0, -h - 2 = 3 for n. 3 Suppose 2x - 15 = -3x. Suppose 1 = xh + d, -d = -5h + 3d - 4. Suppose -t + 3 = -h. Solve -y - 11 = 3u + 2, 0 = -4u + ty for u. -3 Let j = -16 - -19. Let g be (6 - j)(-2)/(-3). Solve -4q - 2c = gc, c = 2q + 3 for q. -1 Let a = -9 - -13. Suppose -p = ap - 10. Solve 5m - 3f - 16 = 0, pm - 3f - 8 = -f for m. 2 Let p be 0 - (-6 - (-12)/4). Solve 1 = -3r - 4s, -3r = 2s + p + 2 for r. -3 Suppose -o - 3t = 9, 0o + 9 = -4o - 3t. Suppose 5c - 7 - 13 = 0. Solve ok - 20 = cq + 2k, q + 2k = -11 for q. -3 Let c(z) = z2 + 3z + 2. Let b be c(-3). Suppose bf + 0f = 16. Let y = 13 - f. Solve 0w - w - yo = 7, -3w - 3o = -3 for w. 3 Let y(s) = -s3 - s2 + 3. Let a be y(0). Suppose -21 = -j + a. Solve 5n - j = -c, n = 4c + 5n - 32 for c. 4 Suppose 2a = a - 7. Let t = a + 13. Solve 2q + 2 = -2w - t, -2w - 13 = -3q for w. -5 Let t be 2 + 4/4 - 0. Suppose 0 = ty - 4y. Solve y = -5n + 3n + 4c + 6, -3n + 8 = -5c for n. 1 Let a = -4 - -7. Solve 0 = -4x - 5b - 7, 2x - ab = -0b - 9 for x. -3 Let p be 2/(-6) - (-16)/3. Let o(u) = u + 15. Let h be o(-12). Solve hl + 17 = 5f, pl + 15 = -6f + f for l. -4 Let c(y) = -y + 24. Let f be c(16). Solve -4a - 8 = 0, -f = -2z + z + 2a for z. 4 Let w(y) = -y + 16. Let h be w(11). Solve hz + 22 = 3m, -5z + 6m - m = 30 for z. -2 Let m = 1 - -3. Let p = 12 - m. Let r = p + -3. Solve 2y + 4x = -0y - 14, ry + x = -26 for y. -5 Let r be 10 + -1 + (-2 - -2). Suppose -6 = -rq + 6q. Let g be (0 + 2)/(0 - 2) + 4. Solve -1 = -5y - 3z, y + q + g = 2z for y. -1 Suppose -5n = -4h - 145, -5h = -4n - 0h + 125. Suppose -5a = -n - 45. Solve 0 = 5t - v + 26, -3t = -t - 4v + a for t. -5 Let t = -2 - 0. Let h be 85/25 - t/(-5). Solve 0 = z + n + 3, z - n - 2 = -h for z. -2 Let m = -50 + 52. Solve -3s + 3w = -0s + 6, -2 = s + mw for s. -2 Let h be -64/(-2) + 0. Suppose 0 = 4i - 4 - h. Solve io - 3t = 3o + 14, 5t + 25 = 0 for o. -1 Suppose 2y - 24 = -y. Solve 4i - h + 0 - 10 = 0, h - y = -5i for i. 2 Let p(b) = -b*2 - 9b + 10. Let o be p(-9). Let v = o + -7. Solve 0 = -2q - vn, 4n - 1 = 7 for q. -3 Let o be (-189)/12(4 + -8). Suppose o = 4b - b. Solve -b = -3l - 0l + 5h, 7 = -l - 3h for l. 2 Suppose 4k = 7 + 5. Suppose -2t + 9 = u, -4u + 4 = -kt - 10. Solve 19 = j - 4f, 3j + 3f + 1 = -t for j. 3 Suppose n = -4o - 8, 7n - 8 = 2n - 4o. Suppose 0 = -0m - m. Let g be 5/2 - (-1)/2. Solve 3j = -i - 3i, m = nj + gi - 7 for j. 4 Suppose 0 = t - 1. Let u(b) = -b3 - 3b*2 + 4b + 1. Let l be u(-4). Let f be t + l - (-1 - -1). Solve -5c + 13 = fg, 7 - 18 = -3c + 2g for c. 3 Let u be 7/(28/(-16))-1. Suppose -ua - a = 0. Solve 3d - 24 = -5y, 5y + 2d - 5d - 6 = a for y. 3 Suppose 4p + 1 = 5. Let i be 4/(p2/1). Solve 5m - il = -6, -l - 10 + 2 = 3m for m. -2 Suppose 0 = -3u + 2u. Suppose 2 = -2w - l + 9, 3w - 3l = 33. Suppose 3j = j + w. Solve -jk + 9 = -4q - 20, 2k - 6 = u for q. -5 Let i = 16 + -10. Let n be (-1 - -2)/(1/i). Let j be ((-15)/(-4))/((-3)/(-12)). Solve -j = l - 0l + 5b, 0 = 3l - 2b - n for l. 0 Let j(b) = 4b + 4. Let l be j(-7). Let q = l + 27. Solve -4z - 4 - 6 = qc, -4z = -2c for c. -2 Let b(s) = -s*2 + s - 4. Let k be b(-4). Let r = 35 + k. Solve -4x - 2 = -3o, -2x + 1 + r = 5o for x. 1 Suppose -p + 11 = -3. Solve 5s + 3k - 20 = 0, -5s = 2k - 1 - p for s. 1 Let b(z) = z3 + 7z*2 + z + 8. Let v be b(-7). Let y be (-3 + 2 + 1)v. Solve y = -3n - 4d - 10, n = 3n - 3d - 16 for n. 2 Let h = -13 - -26. Let q = -8 + 12. Solve qy + w = 2 + 9, h = -3y - 5w for y. 4 Let n = 24 - 11. Suppose -4x = -s + 16, 19 = 3s - 2s - x. Suppose 0 = -4q + s, 4i - 4q + n = q. Solve -5z + 2d + 1 = -d, 3z = 3d + i for z. -1 Let k be 6/(-12)(-1 + -1). Let o be 0/(k(2 - 3)). Solve o = 3a + 2a + 5x + 20, -4a = -2x + 16 for a. -4 Suppose -16 = 2p - 6p. Suppose -x - 129 = -px. Solve 4h + 20 = 0, -5c + x - 18 = -5h for c. 0 Let x be -2(-3)/6-11. Let q be ((-6)/(-8))/(x/(-44)). Solve -4r - 4j = 24, -qr + j - 2 = -0r for r. -2 Let p(o) = -o*3 + 6o*2 + 7. Let h be p(6). Suppose -4q - 8 = -2q. Let w = q + h. Solve 5y + 3u - 23 = 4u, -wy + 2u = -11 for y. 5 Suppose 7 + 5 = 4b. Suppose bt - 5t = -26. Solve 2h - 10 = -v, t - 3 = 3h - v for h. 4 Let l = -8 + -7. Let o = l - -19. Solve -2v = oc + 19 + 1, -3c = -2v + 8 for c. -4 Suppose b + 1 = 2, 0 = -3a + 2b + 16. Solve -5r - 23 = 4w, w - ar + 2r = 10 for w. -2 Let o be -3(-2 + 1) - 2. Solve 0 = 2f - g + 15, g = 4 + o for f. -5 Suppose -5m = -1 - 9. Suppose -3s = -2a + 7, -a - 14 = 3s + 4a. Let v be ((-4)/3)/(2/s). Solve -4c - u - 16 = vu, m*u + 7 = c	{ "pile_set_name": "DM Mathematics" }
hat is the highest common divisor of c and 27? 9 Suppose m - 4l = -8l + 36, -4l + 4 = -m. Let f be (0 + -30)m/(-10). Calculate the greatest common factor of f and 12. 12 Let v = 164 - 144. Let g(c) = -c*2 - 4c + 4. Let i be g(-4). Suppose -8 - 4 = -4b, -5b = im - 95. What is the highest common divisor of m and v? 20 Let m(c) = 49c + 71. Let g be m(9). What is the highest common divisor of 96 and g? 32 Suppose 0 = -3x - 6, 5d - d + x = 298. Suppose 2i + 7u - 42 = 10u, -3i = 2u - 37. Calculate the highest common divisor of d and i. 15 Let r be (30/8)/((-19)/(-5320)). What is the highest common divisor of 140 and r? 70 Suppose -4v = -3p + 4, -5p - v = -29 + 7. Let q be ((-20)/(-4) - p)92. Suppose -2o = -q - 28. Calculate the greatest common factor of o and 20. 20 Let k = 88 + 137. What is the highest common divisor of 50 and k? 25 Suppose -23y = -15y - 56. Let n(k) = 21k - 66. Let l be n(y). What is the highest common factor of 54 and l? 27 Let y = 48 - 45. Suppose ya = -0n - n + 28, 4n + 32 = 4a. What is the greatest common factor of 99 and a? 9 Let m(c) = 3c*2 + 24c - 59. Let g be m(3). Suppose 4l = 3u + 33, -15 = -0u - 3u. Suppose ln - g = 4n. Calculate the greatest common factor of 40 and n. 5 Suppose -8 = o + o, -3o + 803 = 5k. Suppose k = 5m - 17. Calculate the highest common divisor of m and 4. 4 Let p(k) = -8k - 12. Let d be p(-3). What is the highest common divisor of d and 276? 12 Let r be (-8)/56 + ((-132)/7 - -1). Let j(c) = c*3 - 5c*2 - 4c + 3. Let t be j(3). Let q = r - t. What is the highest common divisor of 9 and q? 9 Let p be 10727/(-68) + 1/(-4). Let f = 348 + p. Calculate the highest common divisor of 38 and f. 38 Suppose 25 = -10v - 735. Let f = v + 196. Calculate the highest common divisor of f and 40. 40 Suppose 183 - 103 = 8m. Calculate the greatest common factor of m and 1250. 10 Suppose 5w - 36 = -4w. Suppose 5c - 36 = -7i + 5i, wi + 3c - 58 = 0. What is the greatest common divisor of 117 and i? 13 Let i = -99 - -403. Let p be 6 + 35 + (9 + 0)/(-3). What is the greatest common factor of p and i? 38 Suppose -5u + 2u = -189. Let q = u - 21. What is the greatest common divisor of q and 6? 6 Let a(i) = 3i + 81. Let h be a(5). Calculate the greatest common factor of h and 72. 24 Suppose -r - 27 = 4l - 515, -r = l - 119. What is the greatest common factor of l and 3? 3 Suppose -24r - 263 = -1871. What is the greatest common divisor of r and 134? 67 Suppose -6p + 7467 = 1383. Calculate the highest common factor of 312 and p. 78 Let n = 102 - 100. What is the greatest common divisor of n and 16? 2 Let n = -887 - -976. What is the greatest common divisor of 2047 and n? 89 Suppose c = -120 + 128. What is the greatest common factor of c and 32? 8 Let q(t) = -t + 28. Let i be q(0). Suppose 8k - 6k = 6. Let u be (-1341)/(-6) - k/6-1. Calculate the greatest common factor of i and u. 28 Let t be (9 + -8)/2 - 54/(-4). What is the greatest common divisor of 2 and t? 2 Let a(d) = 44d - 285. Let l be a(8). Calculate the greatest common divisor of 201 and l. 67 Suppose -17j + 25j - 56 = 0. Calculate the greatest common divisor of 1351 and j. 7 Suppose 0t = 2t - 6. Suppose -ts + 15 + 0 = 0. Suppose -3j - 4p + 246 = -2p, 3j - sp - 225 = 0. What is the greatest common divisor of j and 10? 10 Let z(b) = -b3 - 8b*2 + 6b - 12. Let t be z(-10). Let l be 1 + (-3 - (-32 - 2)). What is the highest common divisor of t and l? 32 Let m(b) = -b*2 + 12b. Let d be m(11). Suppose 0u = u - d. Let y = -4 + u. Calculate the highest common divisor of y and 7. 7 Suppose 0 = 3n - 5d - 1, -5n = 5d - 15. Suppose -i + ni + 7 = o, 53 = 3o + 5i. What is the greatest common factor of o and 99? 11 Suppose -14q - 8 = -10q. Let z be (-7 + 10)/(3/q). Let u(t) = t*2 - 3t - 7. Let k be u(z). What is the greatest common factor of 33 and k? 3 Let y(j) = -j + 13. Let i be y(-9). Suppose x = l - i, 3l - l - 3x = 48. What is the greatest common divisor of 198 and l? 18 Let t(h) = 4h - 104. Let w be t(35). Calculate the highest common factor of 258 and w. 6 Suppose 0t + t = 10. Suppose 7n - 5n - 140 = -5i, 0 = 3i. Suppose 0 = 5m + 4s - n, -2s + 0 = -10. What is the greatest common divisor of m and t? 10 Let c(q) = -8q - 2 + 20q + 350q. Let j be c(1). What is the highest common factor of 45 and j? 45 Let o(b) = -b + 10. Let k be o(7). Let f(r) = -r + 28. Let x be f(16). What is the greatest common divisor of k and x? 3 Let l(p) = -6p3 - p - 2. Let v be l(-1). Suppose 0 = -2x + vm + 102, 9x + 3m = 4x + 193. Calculate the greatest common divisor of x and 369. 41 Let z(p) = -8p2 + 26p*2 + 7p - 4 - 22p2 + p3. Suppose -v = v - 8. Let n be z(v). Calculate the highest common divisor of n and 60. 12 Suppose 3z + 2p = -12, -2z + p = 3z + 33. Let f be (16/3)/(z/(-9)). Suppose -12t + 24 = -ft. Calculate the greatest common factor of t and 30. 6 Let a = -4 + -4. Let h = -4 - a. Suppose i = -hi + 550. What is the highest common factor of 10 and i? 10 Let l(g) = 10g2 + 4g - 1. Let t be l(-3). Let h = 41 - 30. What is the greatest common divisor of h and t? 11 Let b = -350 + 566. Calculate the highest common factor of b and 180. 36 Let a be ((-628)/(-14))/(6/21). Let q = a + -150. Calculate the greatest common factor of q and 1. 1 Let k = -35 - -75. Let p be 434/(-124)52/(-7)1. Let u = k - p. Calculate the greatest common divisor of 7 and u. 7 Suppose -2j - 5 = -17. Let q = 0 + j. Suppose -4b - 2r + q = 0, 1 + 6 = 5b + 3r. Calculate the greatest common factor of b and 18. 2 Suppose 6m = 72 + 96. Calculate the highest common factor of 700 and m. 28 Suppose -2j = 4j - 30. Suppose -js + 476 = 5m + 21, 5s = -m + 439. Calculate the greatest common factor of 58 and s. 29 Suppose -2v + 5401 = -11559. Let r be v/50 - 42/(-20). Calculate the highest common divisor of r and 10. 10 Let d = 28 + -24. Suppose -4w + 59 = -w + do, 3o = w + 2. What is the greatest common divisor of w and 91? 13 Let u(a) = a*3 + 4a*2 + 1. Let t be u(-3). Let p(f) = f - 3. Let i be p(-2). Let o be i(-321)/4. What is the highest common divisor of o and t? 10 Let o be -1 + (-7)/(-2) - 3/(-6). Suppose 0 = 2k + ok - 100. Suppose f + 10 = 3f. Calculate the greatest common factor of f and k. 5 Let m(o) = -o*2 - 8o - 2. Let k be m(-7). Suppose 2c - 2z = 6, kz = -7c + 3c + 57. What is the greatest common divisor of c and 6? 2 Let g be (3/9)/(3145/(-1050) + 3). What is the highest common factor of 875 and g? 35 Let i = -39 - -43. Suppose -5m + 370 = 5a, ia - 7a - 268 = -4m. Calculate the highest common divisor of 10 and m. 10 Let c be (-85)/(-3) - 4/12. Let n(x) = -13x. Let p be n(-1). Let h(j) = j2 - 11j + 2. Let r be h(p). What is the highest common factor of c and r? 28 Suppose 5s + 742 = 3s. Let d = 536 + s. What is the greatest common divisor of d and 15? 15 Suppose 110l - 104l - 684 = 0. What is the highest common factor of 3 and l? 3 Let j be 7 - 1(4 + -5). Let h(x) = 2x + 8. Let k be h(6). What is the greatest common factor of k and j? 4 Let m be (-27)/5 - 2/(-5). Let t(q) = -q - 3. Let b be t(m). Let h be -2 - (-1)/b46. What is the greatest common divisor of h and 42? 21 Let y be 6 - -1 - (-565 - 52). Calculate the highest common divisor of 48 and y. 48 Let q(r) = -38r3 - r2 - 2r - 1. Let i be q(-1). Let z = -4 + i. Calculate the highest common factor of z and 85. 17 Suppose 34 = -5i + 154. Suppose 11 = 4t + 5r - 1, -4t - 2r = -i. Let u be (1/(-2))/((-2)/256). Calculate the highest common divisor of u and t. 8 Let c(s) = -s*3 - 5s2 + 78. Let j be c(0). What is the greatest common divisor of 130 and j? 26 Let a(w) = -w2 - 7w + 1. Let d be a(-6). Suppose -dt - 10 + 52 = 0. Calculate the greatest common divisor of t and 12. 6 Let q(a) = -64a - 180. Let k be q(-3). What is the highest common divisor of k and 92? 4 Let d be (-8)/7 - 6731/(-371). What is the greatest common factor of d and 5? 1 Suppose 4460p - 4466p + 2550 = 0. What is the greatest common divisor of 102 and p? 17 Let z(v) = -84v + 33. Let b(d) = 126d - 50. Let c(m) = -5b(m) - 8*z(m). Let u be c(2). Calculate the greatest common factor of u and 10. 10 Suppos	{ "pile_set_name": "DM Mathematics" }
Is t a composite number? True Let h = -8433067 + 12049530. Is h prime? True Let d = 256978 - 129635. Is d prime? True Suppose g - 9g + 24 = 0. Let b = g - 12. Let y = b + 95. Is y composite? True Suppose -3n - 30 = -2g + 3g, -5n - 57 = 4g. Let z(y) = 20y3 + 22y*2 + 9y - 5. Let x be z(n). Is x/6(11/(-2) - -4) a composite number? False Let r(u) = 10u + 11. Let z(s) = s*3 + 11s*2 - s - 5. Let i be z(-11). Is r(i) composite? False Suppose 0 = -33r + 30r + 9. Suppose 0 = t - g - 206, 0g + 5g = rt - 620. Is t a prime number? False Let n be (3(-410)/(-6))/((-3)/174). Let f = -147 - n. Is f composite? False Suppose 0 = 4c - 2c + 2, s - 4 = 4c. Suppose -5d - 4q + 20 = s, 7q = -d + 2q + 4. Suppose -dz + 3440 = -2676. Is z a prime number? False Suppose s - 354 = 5i + 94, 5s - 2200 = 5i. Suppose -447w = -sw - 3771. Is w composite? False Let m(c) = c*3 + 7c*2 + 11c + 5. Suppose 2i + 35 = -5i. Let w be m(i). Suppose -2t + k - 6k + 163 = w, -3t + 5k + 282 = 0. Is t composite? False Let w = -298332 + 458831. Is w a prime number? True Let x(k) = -76k + 191. Let t be x(37). Let i = t - -8602. Is i a composite number? False Suppose 1106 + 586 = 9t. Let j = t - -332. Suppose -3i + i + j = 2n, 3n + 2i - 779 = 0. Is n prime? False Let a(t) = t*2 - 6t + 2. Let q be a(-4). Suppose qs = 41s + 457. Is s a composite number? False Suppose 4s - 2s = -3f - 15, -4s = -4f. Let y be (4/18 - (-14)/18) + s. Is (-3)/((-27)/14673) + y/(-3) composite? True Suppose -62y + 60y - 1368 = 0. Let f = -476 - y. Suppose s - i - f = 0, -5s = 2i - 3i - 1052. Is s a prime number? True Let u(q) = 525q2 - 8q - 68. Is u(-9) a prime number? False Suppose -53 = 3g - 2d - 166, -2d + 72 = 2g. Suppose -4h - g + 57 = 0. Is -4 + 12373/h - 4/(-10) a composite number? True Suppose 82f + 513023 = 975299 + 5863450. Is f composite? True Let a = -99049 + 216002. Is a a prime number? True Suppose 51q = 26q + 62q - 3892363. Is q composite? False Suppose l - 5z = 93068, -4l - 164230 = 3z - 536525. Suppose 0 = 5y + 3v - l, -4y = 2v - 33585 - 40875. Is y a prime number? True Let h be 1117(-4)/((-4)/(-1)). Suppose -520 = j + 40. Let d = j - h. Is d a composite number? False Let w = 1114 + -3905. Let j = 11256 - w. Is j prime? False Let q(j) = 10j*2 - 5j + 7. Let x be q(-11). Let v(h) = -h*2 + h - 631. Let p be v(0). Let z = x + p. Is z composite? False Let i be ((-2076)/8)/((-1)/2). Suppose 3x = 4c + 1 - 7, 4 = 5c - 2x. Suppose -v + i = -cv. Is v a composite number? True Suppose -3o - 4q + 86077 = -3q, -2 = q. Suppose 7a = -4102 + o. Is a a composite number? True Suppose -2 = a, -5x + a - 12189 = -2a. Is (x - -28)/(0 - 1) composite? False Let r = 842 + 7739. Suppose -8434 = -f + 3d, 0 = -4f - 2d - r + 42247. Is f a composite number? False Let g be (-13)/(-26) + (1 - (-4691)/2). Suppose 6q - g = 347. Is q a composite number? False Suppose 43i - 41i = 53582. Is i composite? True Let u = 47531 - 15624. Is u a prime number? True Suppose -18766 = 18x - 48088. Is -1(6 + (0 - x)) composite? True Let g = -183 - -259. Let z = 71 - g. Is (-24)/(-9) - z/15 - -1171 a composite number? True Suppose -v + 10 - 2 = -o, -5o = 3v - 24. Let n(y) be the first derivative of -y*4/2 + 7y*3 - 5y*2 + 11y - 1. Is n(v) a composite number? False Suppose 388 = 2n - 4h - 0h, 2n - 391 = 5h. Suppose 4b - n = -4u, 3 = -2b - 3. Let l = u - 25. Is l a prime number? False Suppose 0 = 5a + 5l - 43175 - 35465, -62913 = -4a - 5l. Is a composite? False Let o(s) = -s*3 + 2s - 1. Let r be o(1). Suppose 3g - 19037 - 7618 = r. Is g a composite number? True Let m be 1264/(-36)(-6 - 0). Suppose -ma + 145390 + 262798 = 0. Is a a prime number? True Let v = -322 - -256. Is 6/(v/(-44)4/10533) composite? True Let v = 142120 + 69457. Is v a prime number? False Suppose 44762 = 2l + m + 14970, -29786 = -2l - 4m. Is l a composite number? False Let p(j) = j*2 - 51j + 312. Let s be p(44). Suppose -4i = -6i + 8. Suppose -1681 = -ib + 3k - 281, 0 = 2b - sk - 710. Is b a prime number? True Suppose -3y = 3, -4y + 6y = c - 464. Suppose -ci + 454i = -443512. Is i a prime number? True Suppose -25060 = -4r - 4v, -v - 31301 = 11r - 16r. Let x = r - 1856. Is x composite? True Let t(y) = -y3 + 7y*2 + 5y - 3. Let p = 62 - 55. Let k be t(p). Suppose -s = -5m + 707, 0 = -2m - s + 255 + k. Is m composite? True Suppose -24948 = -k + 5t + 8061, -5t = -5k + 164965. Is k a composite number? True Let c(n) be the second derivative of -6n5 - n4/2 - 5n3/3 + n2 + 170n. Is c(-2) composite? True Suppose 1947 = 3y + 2j, -j = 5y + j - 3245. Let k = 310 + y. Let c = -562 + k. Is c prime? True Suppose 2z - 3604 = -3r, -5r + 5z + 5129 = -861. Let o = 1985 - r. Is o composite? True Let q = 5026 - 287. Suppose 0 = 5s - 3f - 2948 - 20793, -s = 4f - q. Is s a prime number? False Suppose 31 = 4s + 23, 3s = 4d - 264878. Is d composite? False Let v = 272 - 293. Let r(p) = -640p - 73. Is r(v) composite? False Let k = -322823 - -671812. Is k composite? False Let w(d) be the first derivative of -4/3d3 + 9d + 1/4d4 - 11/2d*2 + 12. Is w(6) a prime number? False Suppose -199k + 14710094 = -101k. Is k composite? True Suppose 2u - q - 15012 = -2347, 4q = 4u - 25324. Suppose 0 = -2n + 4i + u, 0 = -2n - i - i + 6322. Is n composite? False Let j(c) = -918c*3 + 9c*2 + 128c + 522. Is j(-5) a composite number? True Let y be (3-3)/((-14)/(-21154))1. Is y/6(-44)/66 a prime number? True Suppose -4o - 12 = 0, 0 = 3b - 43o + 38o - 800406. Is b composite? False Suppose 4z - 5 = 55. Suppose -zh + 11045 + 10540 = 0. Is h a composite number? False Let t be 10/(-6) + (-31840)/(-15). Let i = -995 + t. Let q = i - 641. Is q prime? False Let x(h) = 13h*2 + 129h - 10. Let d be x(-10). Let y(v) = 7v + v2 - 8v + 0v + 2722. Is y(d) a composite number? True Suppose -2t = 2q - 20326, 4q - 8165 = -2t + 32485. Let o = -2639 + q. Is o prime? True Let w(y) = 113y + 5. Suppose 5t - 245 = -5m, t - 2m = 54 - 11. Suppose -4g + t = -0g - c, 0 = 4c - 4. Is w(g) prime? True Let k(a) be the third derivative of 11a5/10 + 5a*4/12 + 17a*3/6 - 2a*2 + 10. Is k(-7) prime? True Let b = 269 - 0. Suppose -3n - 1235 = -b. Let r = 57 - n. Is r a prime number? True Let u = 48390 + -21856. Is u a composite number? True Suppose -5r + 5f = -26106 - 349609, 0 = 2r + 3f - 150316. Is r prime? True Is 132908 + 7 - (54/(-9) + 14) prime? False Suppose -5z - n + 20 = n, 10 = -5z + 4n. Suppose -657 = -j - zj. Suppose 0 = c + 5d - j, 2c = -2d + 5d + 373. Is c prime? False Let w = -233 - -1035. Suppose b - 5h - w = 0, h + 2h = b - 804. Suppose 2j - 5d - 1613 = 0, 2j + b = 3j - 2d. Is j a composite number? False Suppose 755936 = 98x - 2814498. Is x a prime number? True Suppose -3q + 40 = -2i, 3q + 2i = 7i + 46. Suppose qa - 24861 = 6111. Is a prime? False Suppose 8g - 4616 = 4g. Let t = 6553 - g. Is t prime? True Let q(r) = 1274r - 2594. Is q(32) a composite number? True Suppose -3t = 4x - 5646923, -2t + 3x + 4266886 - 502248 = 0. Is t prime? True Let d(x) = 2x + 12. Let b be d(-5). Let a(t) = -6t + b + 21t + 16t. Is a(5) composite? False Let r(x) be the third derivative of x4/24 - 7x*3/3 + 18x*2. Let j be r(18). Suppose 559 + 457 = jm. Is m a prime number? False Let f(i) = i*3 - 20i*2 - 24i + 34. Let m be f(10). Let q = 16528 - m. Is q prime? False Suppose 2m + 45k - 42k = 218038, 0 = -4m - k + 436056. Is m a prime number? True Suppose 3f + 144489 = 8f - 4y, y = f - 28897. Let m = f + -15514. Is m a prime number? False Let a be (-629)/148 + (-1)/(-4) - -123359. Suppose -3f = v - 74013, 0f + 5f + v - a = 0. Is f composite? False Let m be (-3)/(-12) - (-675)/(-12). Let z = 52 + m. Is (-2)/z + (-325)/(-2) a composite number? False Let y(l) = 2l2 + 33l + 112. Let j be y(-12). Let o be 2/(-8) + 957/4. Suppose -o - 9129 = -jc. Is c a prime number? False Let n = 355802 - -183359. Is n a composite number? True Let y = -85 + 1422. Suppose y = 5d + 2d. Is d composite? False Suppose -1659317 - 655606 = -13p. Is p a prime number? False Let l(g) = g*3 + 12g*2 + 6g -	{ "pile_set_name": "DM Mathematics" }
r(q). -5q Let k(w) = -96w2 + 7w + 48. Let b(m) = -64m2 + 5m + 34. Calculate -7b(x) + 5k(x). -32x2 + 2 Let x(a) = -a + 6a*2 + 7a*2 + 11a*2 - 23a2. Let s be 6/2 - 12/6. Let b(t) = t2 - 4t. Calculate sb(g) - 4x(g). -3g2 Let i(q) = -377 - 384 + 760 + q2. Suppose 5j + 2c + 14 = j, -8 = 3j + 2c. Let x(s) = s3 - s2 + 1. What is jx(z) - 6i(z)? -6z3 Let o(c) = -5c*2 + 5c - 5. Let k(v) be the third derivative of -v5/30 + v4/8 - v*3/2 - 236v*2. Suppose -u = 5 - 2. Calculate uo(p) + 5k(p). 5p2 Let p(w) = w2 + 7w + 9. Let l(k) = k2 + 4k + 5. Let c(i) = -16i + 14. Let r be c(2). Let h be (2 + 4)/(r/12). What is hp(t) + 7l(t)? 3t*2 - 1 Let n(q) = 0q*3 - 13q*3 + 3q*3. Suppose 0 = -o - 5k + 8, -6 = -o + k - 5k. Let y(s) = -3s*3. Determine on(h) + 7y(h). -h3 Let b(v) = 5v - 29 + 66 - 29 - 19. Let q(i) = -6i + 11. Let s(o) = 3b(o) + 2q(o). Let u(j) = j - 4. Determine 4s(r) - 11u(r). r Let d(z) = -z2 - 8z + 3. Let y = 1383 - 1387. Let a(i) = 2i2 + 9i - 4. Give yd(w) - 3a(w). -2w2 + 5w Let v(w) = -6w3 + w2 - 4w + 8. Let a(f) = 13f3 - 2f*2 + 7f - 14. Give -4a(s) - 7v(s). -10s3 + s2 Let w(v) = -v + 7. Let z(b) = 1. Let a(y) = -40. Let o(g) = -1. Let l(j) = 3a(j) - 96o(j). Let u(x) = l(x) + 20z(x). Give -5u(f) - 3w(f). 3f - 1 Let w(d) = 2d + 34. Let x be w(-17). Suppose -5p + 4 + 0 = 2k, 4p - 8 = x. Let i(l) = -l2 + 2l + 2. Let g(f) = 2f + 2. Calculate kg(c) + 2i(c). -2c*2 - 2c - 2 Let k(u) = 162u + 3 + 5u*2 - 154u + 2. Let n(d) = 6d2 + 9d + 6. What is -7k(t) + 6n(t)? t*2 - 2t + 1 Let j(r) be the first derivative of -r*2/2 - r + 2. Let x(u) = -3u. Let b = -4337 - -4336. What is bj(n) + x(n)? -2n + 1 Let j(p) = -32p + 7. Let r(m) = 33m - 9. Calculate 3j(t) + 2r(t). -30t + 3 Let u(q) = 20q*3 + 8q*2 - 14q. Let k(t) = -7t3 - 3t*2 + 5t. Suppose v = -z - 11 + 16, -2v + 10 = -5z. Calculate vu(f) + 14k(f). 2f3 - 2f*2 Let u(r) = 5r*2 - 4r - 7. Suppose -8 = 4n - 2n. Let t(j) = -4j2 + j - 3. Let p(k) = -2k*2 + k. Let i(l) = 3p(l) - t(l). Calculate nu(f) - 9i(f). -2f2 - 2f + 1 Let l(i) = 11i2 - 5i - 5. Let m(w) = -15w2 + 3w + 3. Let s(v) = -3v + 4v - 1 - 7v2 + 2. Let j(k) = -3m(k) + 5s(k). Calculate -5j(p) + 4l(p). -6p*2 Let d(x) = 3x*2 - 2x. Suppose 8 = 27g - 23g. Let c be (-2)/(-4) + 3/2. Let s(u) = -u - cu + 4u*g + u. Calculate 6d(j) - 5s(j). -2j*2 - 2j Let r(f) = f*3 + 9f*2 + 2f. Let o(p) = p*3 + 9p*2 + 2p. Let w be ((-4)/(-8)1)/(2/(-24)). Determine wo(y) + 5r(y). -y3 - 9y*2 - 2y Let v(j) be the second derivative of -42j5/5 - 16j*4/3 - 32j*3/3 + 32j*2 + 71j. Let s(l) = 8l3 + 3l*2 + 3l - 3. Determine 64s(n) + 3v(n). 8n3 Let i(q) = -53q*3 - 5q + 6. Let r(g) = 106g3 + 11g - 13. Determine 13i(a) + 6r(a). -53a3 + a Let v(j) = 2j + 5. Let m(r) = -14. Let h(o) = 17. Let f(b) = -5h(b) - 6m(b). What is 6f(d) + v(d)? 2d - 1 Let t(z) = -1295z - 63. Let p(c) = -324c - 15. Calculate 21p(a) - 5t(a). -329a Let v = -3 + 7. Let q(x) = -x2 + 4x + 4. Let s(o) be the first derivative of o*2/2 + o + 2827. Determine vs(m) - q(m). m*2 Let g(c) = -10c - 16c + 17c + 4. Let n be (0/(-3))/(1 - 2). Suppose 4t = -nt - s + 30, -t = 5s - 17. Let k(v) = -5v + 2. What is tk(a) - 4g(a)? a - 2 Let x(s) = -11s3 + 19s*2 + 6. Let c(u) = -155u*3 + 265u*2 + 85. Calculate -6c(k) + 85x(k). -5k*3 + 25k*2 Let a(g) be the second derivative of -2g3/3 - g2/2 - g. Let l(h) be the second derivative of h3/2 + h2/2 - 70h. Give 2a(y) + 3l(y). y + 1 Let t(m) = -m2 - 3m + 2. Let b(a) = -2a2 - 18a + 9. Give b(v) - 3t(v). v2 - 9v + 3 Let u(p) = 167p2 - 15p - 2. Let o(g) = -111g2 + 9g + 1. What is -8o(m) - 5u(m)? 53m2 + 3m + 2 Let a(n) = -7n2 - 4n - 7. Suppose -2t + 2 = -0. Suppose -t - 1 = 2x. Let u(b) = -b*2 - b - 1. Give xa(w) + 5u(w). 2w*2 - w + 2 Let y(j) = 2j + 4. Let l(v) = 2v + 4. Let m = 131 - 129. Determine my(w) - 3l(w). -2w - 4 Let c(d) = 7d2 + 7d - 2. Let z(b) = -21b2 - 19b + 6. What is 11c(l) + 4z(l)? -7l2 + l + 2 Let p(o) = 223o + 8. Let w(u) = 111u + 3. Determine 2p(l) - 5w(l). -109l + 1 Let v(i) = i. Let r(a) = a*3 - 35a*2 + 30a + 135. Let l be r(34). Let y(d) = -d. What is ly(q) + 2v(q)? 3q Let r(a) = -4a*2 + 2a - 2. Let o(z) = 9z2 - 4z + 5. Suppose -30 = -5t + 3t - 4d, 1 = 3t - 5d. Determine tr(i) + 3o(i). -i2 + 2i + 1 Let s(m) = 9m - 16. Let j(b) = 26b - 50. Calculate -3j(q) + 8s(q). -6q + 22 Let p(k) = -2k + 1. Suppose -u - 7 = -4a, 4a = -4u + 34 - 2. Let g(x) = -9x - ax + 10x + 2. Let c be 0 - -2 - (-1 + 5). Give cg(y) + 3p(y). -2y - 1 Let h(t) = t3 + 8t*2 + 8t - 5. Let n be h(-7). Let u(l) = -1. Let p(i) = 3i + 9. Calculate nu(v) - p(v). -3v + 3 Let i(z) = -4z + 5. Let o(q) = -12q - 167. Let r be o(-14). Let m(g) = -g + 1. Determine ri(c) - 6m(c). 2c - 1 Let u(i) be the third derivative of 7i6/120 - i4/4 + 555i*2. Let m(q) = 6q*3 - 5q + 1. Give 6m(x) - 5u(x). x*3 + 6 Let y(j) be the third derivative of 7j*6/120 + 7j5/60 - j3/3 - 9j2 + 2. Let n(b) = 8b*3 + 8b*2 - 3. What is 5n(v) - 6y(v)? -2v*3 - 2v2 - 3 Let z(g) = g2 + 9g - 7. Let w = 355 - 248. Suppose 4k - 277 - w = 0. Let h be 2/(-10) + k/(-20). Let p(j) = -4j + 3. Give hp(a) - 2z(a). -2a*2 + 2a - 1 Let k = -461 - -455. Let l(h) = h*3 - 6h*2 + 3h - 7. Let u(g) = -g*3 + 5g*2 - 3g + 6. Calculate kl(m) - 7u(m). m3 + m2 + 3m Let i(l) = 7l*3 - 10l*2 - 130l + 7. Let b(t) = -6t3 + 8t*2 + 128t - 6. Calculate 5b(g) + 4i(g). -2g3 + 120g - 2 Let o(g) = 5g + 2. Let k(w) = 973w*2 + 695w + 278. Calculate k(j) - 139o(j). 973j*2 Let f(k) = 14k*2 + 20k. Let v(r) = -7r + 0 - 59r*2 + 0 + 54r*2. Let a = -29 - -23. What is af(l) - 17v(l)? l2 - l Let v(d) = 7d + 2. Suppose 4m - u + 4u - 32 = 0, -u + 14 = 2m. Suppose -3 = mg - 43. Let c(r) = -7r - 5 - gr + 0. Determine -4c(t) - 9v(t). -3t + 2 Let p(m) = -m3 - 1. Let i(c) = 5c*3 - 2c*2 + 30c + 2. Give i(a) + 3p(a). 2a*3 - 2a*2 + 30a - 1 Let s(r) = 23r - 29. Let c(g) = 12g - 16. Calculate -5c(m) + 3s(m). 9m - 7 Let d(m) = -m2 + 12m - 13. Let r be d(11). Let s be (-78)/(-18) + r/6. Let u(a) = -2a - sa - 5a. Let c(y) = -16y. Give -5c(w) + 7u(w). 3w Let a(c) = 2c*3 - 5c*2 + 10c + 7. Suppose 130 - 100 = 6u. Let z(k) = -2k*3 + 4k*2 - 9k - 6. Determine uz(r) + 4a(r). -2r3 - 5r - 2 Let h(t) = 54t - 22. Let g(c) = -80c + 33. What is -5g(n) - 8h(n)? -32n + 11 Let f(j) = -2j*3 + 4j*2 - 5j. Let b(n) = -n*3 + 7n*2 - 7n. Let x(q) = -q*3 - q. Let c(t) = -b(t) - 2x(t). Calculate -4c(y) - 7f(y). 2y3 - y Let o(s) = -2s + 1. Let d(n) = -24n + 4. Determine -d(a) + 16o(a). -8a + 12 Suppose 2x = -4c - 4, 4c + 16 = -13x + 17x. Let z(j) = -6j2 + 3j - 1. Let a(n) = 5n2 - 2n. What is xz(b) + 3a(b)? 3b2 - 2 Let a be (-39)/5 + 1 - (-16)/20. Let j(x) = -x2 - 6. Let d(n) = 1 - 3 + 1. Determine ad(l) + j(l). -l*2 Let h(s) = s - 1. Let i = 39 - 41. Let q(k) = -2k + 1. Determine iq(u) - 3h(u). u + 1 Let t be ((-19)/4)/((-7)/28). Let u(p) = 1 - tp - 2 + 18p. Let s(a) = a + 1. Calculate s(r) + 3u(r). -2r - 2 Let x(i) = 58i - 41. Let n(t) = -39t + 28. Determine -7n(j) - 5x(j). -17j + 9 Let v(l) = -l. Let h(s) = 7s*2 + 5s. Let d be 102/(-66) - 36/(-66). Determine dh(j) - 5v(j). -7j2 Let q(j) = 3j*2 - 132j - 13. Let g be q(44). Let v(b) = 14b2 + 13b + 6. Let p(a) = -7a2 - 6a - 3. Calculate gp(t) - 6v(t). 7t2 + 3 Let y(g) = -5g + 2. Suppose 56 = -62h + 70h. Let k(t) = 5t - 2. What is hk(r) + 6y(r)? 5r - 2 Let q(h) = h. Let b(z) = z. Let p(s) = -b(s) + 2q(s). Let f = -471 - -470. Let r(o) = o2 - 3o + 2. Give fr(v) - 2p(v). -v*2 + v - 2 Let k(h) = -3h*3 - 2h*2 - h - 4. Let s(c) = -6c*3 - 4c*2 - 2c - 7. Let y(b) = -4b2 - 3b. Let p be y(1). What is pk(u) + 4s(u)? -3u3 - 2u*2 - u Let n(y) = -416y*3 - 16y*2 - 3y + 8. Let m(t) = -139t3 - 6t**2 - t + 3. What is	{ "pile_set_name": "DM Mathematics" }
ommon factor of 160082 and 624. 26 What is the highest common factor of 171 and 504? 9 What is the greatest common factor of 70 and 2189488? 14 What is the greatest common factor of 9 and 9606? 3 What is the greatest common divisor of 490 and 413? 7 What is the highest common factor of 140 and 1665230? 70 Calculate the greatest common divisor of 603258 and 12. 6 What is the greatest common divisor of 55350 and 108? 54 What is the greatest common divisor of 804 and 191955? 201 What is the highest common divisor of 14079 and 15808? 247 Calculate the highest common divisor of 30 and 361695. 15 Calculate the greatest common factor of 11 and 3621277. 11 What is the greatest common factor of 270 and 2510? 10 Calculate the greatest common divisor of 451 and 114185. 41 What is the highest common factor of 15 and 7005? 15 Calculate the highest common factor of 10230 and 264. 66 Calculate the highest common divisor of 21 and 1807932. 21 Calculate the highest common divisor of 1158 and 51338. 386 Calculate the highest common factor of 1146114 and 82. 82 Calculate the greatest common factor of 1292 and 2376634. 646 Calculate the greatest common factor of 272 and 468112. 272 What is the greatest common factor of 68 and 105944? 68 Calculate the highest common divisor of 713 and 8113940. 713 Calculate the highest common divisor of 36 and 1119078. 18 Calculate the greatest common factor of 32269 and 299. 23 Calculate the greatest common divisor of 40 and 162152. 8 Calculate the highest common factor of 196 and 779002. 98 Calculate the highest common factor of 4077 and 1057. 151 Calculate the greatest common factor of 629 and 1924. 37 Calculate the highest common divisor of 244744 and 32. 8 What is the highest common divisor of 52 and 63817? 13 What is the greatest common divisor of 26645 and 65408? 73 What is the highest common divisor of 1848 and 49392? 168 Calculate the greatest common divisor of 20 and 85110. 10 Calculate the highest common divisor of 12797 and 335. 67 What is the greatest common divisor of 149392 and 80? 16 What is the greatest common divisor of 404 and 1236644? 404 Calculate the greatest common factor of 180 and 90020. 20 What is the highest common factor of 1819 and 39576? 17 What is the greatest common divisor of 283816 and 1768? 104 What is the highest common divisor of 1540 and 5460? 140 Calculate the greatest common divisor of 1272911 and 74. 37 Calculate the greatest common factor of 672 and 29792. 224 Calculate the greatest common factor of 1408 and 24684. 44 What is the highest common divisor of 745 and 12955? 5 What is the highest common factor of 928683 and 189? 63 Calculate the highest common factor of 336160 and 10887. 191 What is the greatest common factor of 4788 and 64? 4 Calculate the highest common divisor of 60146 and 290. 58 What is the greatest common factor of 16548 and 1680? 84 Calculate the highest common divisor of 34864 and 48. 16 Calculate the greatest common factor of 10471 and 22923. 283 What is the highest common factor of 2124 and 1368? 36 What is the greatest common factor of 32 and 34108? 4 Calculate the greatest common divisor of 307678 and 21. 7 What is the greatest common divisor of 1536 and 60000? 96 Calculate the greatest common factor of 54000 and 960. 240 What is the greatest common divisor of 397385 and 8010? 445 Calculate the highest common factor of 459 and 48467. 17 Calculate the greatest common factor of 92120 and 1540. 140 What is the highest common divisor of 338 and 143962? 26 Calculate the greatest common factor of 147 and 91630. 49 What is the highest common divisor of 1122 and 142698? 102 Calculate the greatest common factor of 367972 and 88. 44 Calculate the highest common factor of 309 and 47792. 103 What is the highest common factor of 56064 and 832? 64 Calculate the greatest common divisor of 108 and 115686. 18 What is the highest common factor of 8 and 1166584? 8 What is the highest common divisor of 2327 and 8398? 13 What is the greatest common divisor of 55 and 1250590? 55 What is the greatest common divisor of 153 and 58531? 17 What is the greatest common factor of 588 and 4233936? 84 Calculate the highest common factor of 12 and 17044. 4 Calculate the highest common divisor of 118446 and 3306. 114 Calculate the greatest common factor of 6799365 and 45. 45 What is the greatest common factor of 2356 and 1292? 76 What is the highest common divisor of 130 and 125060? 130 What is the highest common divisor of 94018 and 2030? 58 Calculate the highest common factor of 200 and 21625. 25 Calculate the greatest common divisor of 12290 and 15. 5 Calculate the highest common divisor of 9338 and 341504. 1334 Calculate the greatest common divisor of 7176 and 10994. 46 Calculate the highest common divisor of 6 and 131. 1 What is the greatest common divisor of 5785695 and 18? 9 What is the highest common divisor of 126464 and 468? 52 What is the greatest common divisor of 2719 and 2033812? 2719 What is the highest common factor of 3261 and 33? 3 Calculate the greatest common factor of 384 and 150. 6 What is the highest common factor of 475857 and 1665? 333 What is the greatest common factor of 81187 and 19? 19 Calculate the highest common factor of 7580 and 22361. 379 What is the greatest common divisor of 84 and 270102? 42 What is the highest common divisor of 3800 and 4408? 152 Calculate the greatest common factor of 518034 and 6. 6 What is the highest common factor of 2079 and 1080? 27 Calculate the greatest common factor of 9 and 26266689. 9 What is the highest common factor of 10120 and 29920? 440 What is the greatest common factor of 647550 and 18? 18 What is the highest common factor of 1315740 and 60? 60 What is the highest common factor of 108248 and 392? 56 Calculate the highest common divisor of 74661 and 123. 123 What is the greatest common factor of 732 and 52560? 12 What is the greatest common divisor of 1748 and 304? 76 Calculate the highest common divisor of 1183489 and 68. 17 What is the highest common factor of 1599 and 26199? 123 What is the greatest common divisor of 399 and 2128? 133 Calculate the greatest common divisor of 70 and 3473400. 70 What is the highest common factor of 120 and 2127280? 40 What is the highest common divisor of 24 and 20994? 6 What is the highest common factor of 6086 and 782? 34 What is the highest common divisor of 84 and 757524? 12 What is the highest common factor of 1370 and 22742? 274 Calculate the highest common divisor of 9 and 19959. 3 What is the highest common factor of 24 and 199308? 12 What is the greatest common factor of 90 and 1551996? 18 Calculate the greatest common factor of 294938 and 98. 14 Calculate the highest common factor of 816 and 1666. 34 What is the highest common factor of 415833 and 132? 33 What is the highest common divisor of 32757 and 915? 183 Calculate the greatest common factor of 90 and 960270. 30 What is the greatest common factor of 1084 and 12737? 271 What is the highest common factor of 396 and 7227? 99 Calculate the highest common factor of 177930 and 270. 270 Calculate the highest common divisor of 315 and 1708812. 63 What is the highest common divisor of 13673 and 4114? 121 What is the highest common divisor of 2493 and 38503? 277 What is the highest common divisor of 116 and 273992? 116 What is the highest common factor of 524 and 57116? 524 What is the highest common factor of 2730 and 147? 21 Calculate the greatest common factor of 57421 and 13. 13 Calculate the highest common divisor of 1196 and 92. 92 What is the highest common factor of 723898 and 232? 58 What is the greatest common factor of 5863 and 209? 11 Calculate the greatest common factor of 215549 and 3073. 439 What is the highest common factor of 20127 and 12? 3 Calculate the greatest common divisor of 192 and 130656. 96 Calculate the greatest common divisor of 375 and 28965. 15 Calculate the greatest common divisor of 164148 and 12. 12 What is the highest common factor of 420 and 100820? 20 Calculate the highest common divisor of 630 and 31068. 18 What is the highest common divisor of 9734 and 30458? 314 Calculate the greatest common factor of 57 and 668667. 57 Calculate the highest common factor of 102515 and 202. 101 Calculate the gre	{ "pile_set_name": "DM Mathematics" }
remainder when o(-7) is divided by l(-3)? 4 Suppose -7n = -9n + 24. Suppose -2v + 6v - 20 = 0. What is the remainder when n is divided by v? 2 Let x(o) be the second derivative of 13o3/2 + o2/2 + 2o. Let j be x(1). Let c = -22 + j. What is the remainder when c is divided by 10? 8 Suppose 3c + 2s - 35 = 0, -5c - s + 19 = -44. Calculate the remainder when 23 is divided by c. 10 Suppose -8p = -16 - 0. What is the remainder when 4 is divided by p? 0 Let u(t) = t + 23. Let g(y) = -y + 17. Let s = -6 + 11. Calculate the remainder when u(0) is divided by g(s). 11 Suppose 3l - 7l = -16. Suppose lt - 8 = -2x + 4, -48 = -2x + 5t. Calculate the remainder when x is divided by 4. 2 Let l(u) be the first derivative of -u3/3 + u2/2 + 28u + 1. Let w(b) = b3 - 24b*2 - b + 34. What is the remainder when l(0) is divided by w(24)? 8 Let f be -3(2/6 + -2). Let m(t) = 4t - 7. Calculate the remainder when 24 is divided by m(f). 11 Suppose -5g + 14 = 4i, -4g + 3i - 6i + 12 = 0. Calculate the remainder when 22 is divided by g. 4 Suppose -84 + 74 = -5l. What is the remainder when 3 is divided by l? 1 Let v = -84 - -41. Let i = -11 - v. What is the remainder when i is divided by 11? 10 Suppose 0 = 5q + 10, 0 = -4l - 4q + q + 14. Suppose 0 = lm - 64 - 16. Calculate the remainder when 30 is divided by m. 14 Let f = -376 - -627. Calculate the remainder when f is divided by 11. 9 Let x(s) = 7s + 1. Calculate the remainder when x(4) is divided by 6. 5 Suppose 3x + c - 26 = -c, 5x + 2c - 38 = 0. What is the remainder when 22 is divided by x? 4 Let p be -18 + (-3 - (0 + -1)). Suppose 0 = -3w + 4w - 33. What is the remainder when w is divided by 4 + 6p/(-15)? 9 Suppose 0 = 3l + 7 - 37. Calculate the remainder when l is divided by 7. 3 Let s(v) = -v3 + 5v*2 + v. Let q be s(5). Suppose -25 = -qo + 65. Calculate the remainder when o is divided by 5. 3 Let y = -18 - -47. Suppose 2o + 8 = 4z, -5o - 3z + 24 = -2z. Suppose x - 3g = -ox + 72, -2g = -x + 13. What is the remainder when y is divided by x? 14 Suppose 2j - 5j + 141 = 0. Calculate the remainder when j is divided by 10. 7 Suppose 4l - 27 - 21 = 0. What is the remainder when 22 + 0/(-1 - -4) is divided by l? 10 Let o = 9 - 23. What is the remainder when 2 + o/(-1) + -2 is divided by 5/(10/(-8)) + (-135)/(-15)? 4 Let w be (-2 - -5)(-10)/6. Let b = w + 7. Suppose -n + 2 = -bh, 5h + 2n = 7n - 15. What is the remainder when h is divided by 1? 0 Let m(a) = 8a - 7. Let c be m(-5). Let b = c + 68. What is the remainder when b is divided by 11? 10 Let m = -16 - -19. Calculate the remainder when 14 is divided by m. 2 Suppose -3p = 3k + 6, 5p = 2p - 15. Suppose -5t = -9t + 12. What is the remainder when t is divided by k? 0 Suppose 5l + 22 - 2 = 0, 5l + 29 = f. Suppose -4x + 19 = -f. Calculate the remainder when x is divided by 2. 1 Let b(s) = -2s2 + 21s - 9. What is the remainder when 90 is divided by b(8)? 28 Calculate the remainder when 40 - (2/(-3))/(4/6) is divided by 21. 20 Suppose 2u + 23 = 2j + u, -3j - 3u = -30. Let c = j + -6. What is the remainder when c is divided by 3? 2 Suppose -4 = -5d + 4d + 3j, 3d + j - 32 = 0. Suppose 5w = -d, w - 4 = p + 3. Let q = 22 + p. What is the remainder when 38 is divided by q? 12 Suppose 5b = -13 + 28. Calculate the remainder when 6 is divided by b. 0 Let c = 0 - -12. What is the remainder when (-2)/((-380)/94 - 12/(-3)) is divided by c? 11 Let m(v) be the second derivative of v4/12 - v2/2 - 5v. Let l = -42 + 60. What is the remainder when m(6) is divided by l? 17 Suppose 0 = -4l + 6l - 28. Let i(y) = -12y - 43. Calculate the remainder when i(-7) is divided by l. 13 Let g = 47 - 28. What is the remainder when g is divided by 7? 5 Let w = -24 + 35. Suppose d - 18 = -2d. Calculate the remainder when w is divided by d. 5 Suppose 56 = 6d + 8. Let c(r) = 9r - 5r - 3r + 37 + r2. Calculate the remainder when c(0) is divided by d. 5 Calculate the remainder when 35 is divided by (72/(-14))/((-14)/49). 17 Suppose -10 = -2y, 5k + 7y = 3y + 105. Calculate the remainder when k is divided by (99/(-22))/(-1 + (-1)/(-4)). 5 Let s = -27 + 40. Calculate the remainder when 54 is divided by (s/(-26))/(2/(-112)). 26 Suppose m + 1 = 10. Let s = 6 - 10. What is the remainder when s/18 + 236/m is divided by 9? 8 Suppose 4g - 6 - 2 = 0. Suppose 4w - 5c + c = 176, -10 = -gc. What is the remainder when w is divided by 17? 15 Suppose 0 = -3g + g + 8. Suppose 7o - go + 3i - 3 = 0, -3o + 4i + 31 = 0. Calculate the remainder when 8 is divided by o. 3 Suppose 16 = -2i + 6i. Suppose v = -v + 4z + 54, 0 = -5v - iz + 65. Let b(m) = -6m - 3. What is the remainder when b(-6) is divided by v? 16 Let d(x) be the third derivative of -x5/60 - 11x*4/24 + 8x*3/3 - 4x2. Let y(t) = -t2 + t + 9. What is the remainder when y(0) is divided by d(-12)? 1 Let y(o) = 29o2 + 4o - 1. Let c be y(-3). Suppose 4p + 25 = 2a + 3p, 0 = -5a - 5p + 25. What is the remainder when c/14 + 26/91 is divided by a? 8 Let n = -22 - -8. Calculate the remainder when -1 - (-1 + 0) - n is divided by 8. 6 What is the remainder when 7/(21/117) - 1 is divided by 10? 8 Suppose y + 2y - 48 = 0. Suppose 2z + 2z = 184. What is the remainder when z is divided by y? 14 Suppose -z + 6z - 85 = 0. Suppose 2y + 5d = -1 - 10, -3d - z = -4y. Suppose 4n - 36 = -4a, n + 0 - y = 0. What is the remainder when 19 is divided by a? 5 Let a = 126 + -100. Calculate the remainder when 153 is divided by a. 23 Let l be ((-1472)/3)/(-4)-3. Let i(s) = -s*3 - 4s*2 + 3s + 2. Calculate the remainder when i(-6) is divided by (-3)/(-5) + l/(-20). 18 Let k(w) = -11w - 2. What is the remainder when k(-4) is divided by 22? 20 Suppose 0a = 2a - 28. Suppose 3p - 32 = -p. Calculate the remainder when a is divided by p. 6 Let b(j) be the second derivative of j*5/20 + 3j4/4 + j3 - 3j2/2 + 6j. Calculate the remainder when b(-8) is divided by ((-2)/3)/((-1)/6). 1 Suppose -2 = -w + 2w. Calculate the remainder when ((-3)/w)/((-9)/(-84)) is divided by 8. 6 Let x(j) = -j3 + 5j*2 + 15j + 1. What is the remainder when x(7) is divided by 3? 2 Suppose 0 = u - 2u. Let p(r) = -2r + 15. Suppose 0 = -4i + i + 24. What is the remainder when p(u) is divided by i? 7 Let l = -4 + 7. Let o = -51 + 74. What is the remainder when o is divided by -3 - (6/l + -13)? 7 Suppose 3x - 5x = -3h + 5, -2x + 5 = -h. Calculate the remainder when -2 - ((-44)/2 + 2) is divided by x. 3 Let j(i) = 15i + 6. Let l(f) = 14f + 5. Let o(k) = 3j(k) - 4l(k). What is the remainder when o(-3) is divided by 16? 15 Let r = 28 - -7. Let j(b) = b2 - 4b - 3. What is the remainder when r is divided by j(-2)? 8 Calculate the remainder when 59 is divided by (-2 - (-25)/15)/(2/(-126)). 17 Let h(m) = -2m + 55. What is the remainder when h(-20) is divided by 3? 2 Let z(a) be the third derivative of a5/60 - a4/24 + a3 - 2a*2. What is the remainder when 15 is divided by z(0)? 3 Let y = -190 + 198. Calculate the remainder when 13/(2 + 1/(-1)) is divided by y. 5 Calculate the remainder when 21 is divided by ((-16)/(-6))/((-10)/(-30)). 5 Suppose -32 = -p + 3g, 3g - 5 = -2g. What is the remainder when p is divided by 18? 17 Let t(n) = -n*2 - 13n - 10. Let o be t(-10). Suppose -4q = 8 - o. Let m(x) = x2 - 4x + 3. Calculate the remainder when m(5) is divided by q. 2 Suppose a - 3k = 47, 2a - k - 72 = -6k. Let r = -25 + a. Calculate the remainder when 62 is divided by r. 14 Suppose 0y = 5y + 5. Let g be (5/15)/((-3)/(-9)). Let z = g - y. Calculate the remainder when z is divided by 2. 0 Let r be 2/(-3 + 4 - 0). Calculate the remainder when 3/r + (-97)/(-2) is divided by 17. 16 Suppose 4x - 198 = -4a + x, -4a + 184 = -4x. Calculate the remainder when a is divided by 17. 14 Let h = 26 - -16. What is the remainder when h is divided by 106/10 - 10/(-25)? 9 Let u be 195/12 + 2/(-8). Let f be (3 - 1)/(8/76). Let a = f + u. Calculate the remainder when a is divided by 12. 11 Suppose 5b = 4s - s - 22, 2 = -b. Calculate the remainder when s is divided by (-2)/3(-18)/4. 1 What is the remainder when (3 - 2)/((-3)/(-111)) is divided by 13? 11 Let g(x) =	{ "pile_set_name": "DM Mathematics" }
xpand -3d2 + 3d*2 - 2d2 + (-d2 - 2d2 + 2d*2)(5 + 1 - 4) + 2 - 2 + d*2 - 2d*2 - 2d*2 + 3d2 - d2 + 0d2 + 3d*2 - 4. -2d*2 - 4 Expand (-2r + 0 + 0)(5 - 12 + 9)(-2 - 1 + 2). 4r Expand (2k*3 + 1 - 1)(k - 6k + 4 - 1). -10k*4 + 6k*3 Expand 3j*5 - 7j*5 + 3j*5 + (2j*2 - 3j + 3j)(2j2 + j - j)(3j + 0j - 2j). 3j*5 Expand -g - 3 - 3g - 3g - 3g + 2g + 0g + (-2g + 2 - 2)(2 - 3 - 1) - 1 + 1 - 2g + 0g + 4g - 3g - 1 + 1 - 2g - 2g + g - g. -9g - 3 Expand (22 - 4 + 21)(-2p2 - 1 + 1). -78p*2 Expand (-2q*3 - 5q*3 + 2q*3)(-3q + 2q - q) - 4q4 + q4 + 4q*4 + 3q*2 + 3q*4 - 3q*2. 14q*4 Expand (3b - 5b + 4b)(3 - 5 + 3)(-449 + 449 - 47b - 4 - b + 4 + 3 - 2b - 3 + (-2 + 2 - 2b)(2 + 0 + 0) + 1 - 1 - 2b). -112b2 Expand -j + j3 + j + j*2 + 2j2 - j3 - 2j2 + (4j*2 + 10j - 10j)(-j + 2 - 2) + 3j3 + 0j*3 - 2j*3. -3j3 + j2 Expand (-4 + 3g + 0 + 2)(-4 - 2g3 + 4). -6g*4 + 4g*3 Expand (-14w*2 - 21w + 21w)(2w3 + 0w*3 + 0w3) - w5 + 3w5 - w5 + (w - w + 2w*2)(2w3 - 2 + 2) - 2w*5 - 3w*5 + 3w*5. -25w*5 Expand 36r*3 - 36r*3 + 3r*4 + (2r - 2r3 - 2r)(-2 + 2 - r). 5r*4 Expand 3m + 11m + 7m - 2 + (-1 - 1 + 1)(4m + m - 6m). 22m - 2 Expand (16t5 - 9t*5 - 5t*5)(6 + 4 - 4). 12t5 Expand (-a + 0a + 2a)(-1 + 1 - 2) - 2a + 0a + a + 2 + 2a - 2 + (7 - 2 + 2)(-2 + 2 + a). 6a Expand -6l - 15l + 78l + (0 + 0 + 2)(2 - 2 - 2l). 53l Expand 0m*4 + 5m*4 - 2m*4 + (-2 + 2 + 2m*3)(-1 + 0 + 0)(6m - 2m - 3m)(-3 - 4 - 1). 19m*4 Expand (3 + 1 - 2)(-1 + 1 + d)(17d + 6d2 - 17d). 12d3 Expand (-3j2 + j2 + 4j2)(10j + 16j - j). 50j3 Expand (1 - 2 - 2)(-2 + 4 + 0)(2 - 3 - 1)(-r*2 - 10r*2 + 0r*2). -132r*2 Expand (-3 + 2 + 3)(-5s + 2s + 2s)(7 - 2 - 1) + (2 - 1 + 4)(-4s - s + 3s). -18s Expand (6 - 2 - 5)(-3h - 4h + 2 + 3h). 4h - 2 Expand (-2k + 2k + 2k)(6k - 20k2 - 4k + 16k2). -8k*3 + 4k*2 Expand (5 + 4d - 5)(-d3 + d3 - 2d*3). -8d*4 Expand (5n2 - n2 - 3n2)(4n + 4 - 4) + (n2 - n2 - n2)(-2 - n + 2). 5n3 Expand (-3p*2 - 3p + 3p)(51 + 7p - 51). -21p*3 Expand (1 + 2t - 1)(-3t*4 + 0t4 + t4) + (-4t - 2t + 7t)(-2t4 - 4t*3 + 4t*3). -6t*5 Expand (4k*3 + 60k - 60k)(-3k + 2k + 0k). -4k*4 Expand (9 + 8 - z - 13)(0z2 + 2z2 - z2). -z*3 + 4z*2 Expand (h + 2h - 5h)(-2h3 + 3h*3 - 3h*3) + 0 + 3h4 + 0 + h4 - h*2 - 2h4 - h4. 5h4 - h2 Expand (3w*4 + 0w*4 + 3w*4)(-1 + 1 + 1)(9w + w - 2w). 48w*5 Expand (-2k + 2k + 2k*3)(21k - 7k + 3k)(0k - 3k + k). -68k5 Expand -2l*4 + 2l4 - l4 + (l*3 - 4l*3 - 25l*3)(-2l - l + 2l). 27l4 Expand (0j*4 - 4j*4 + 3j*4)(-2j + 2j - 2j) - 4 + 4 + j5 - j5 + j4 - j4 - 4j*3 - 9j*5 + 4j*3. -7j*5 Expand 2 - 5v*2 - 2 + 0v + 3v2 + 0v - 2v2 + 2v2 + v2 - 4 + 4 + 2v2 + (7v*2 - 4v2 - v2)(0 + 1 + 0). 3v*2 Expand (-22 - 2 - 21)(l + 3l - 2l). -90l Expand 2l*2 + 4l*2 - 2l2 - l2 + l2 - l2 + (2l + l - 4l)(2l - 1 + 1). l*2 Expand (4 - 1 - 2)(2 - 9 + 1)(1 - 2g - 3g + 0). 30g - 6 Expand (-1 + 1 - r)(0 + 0 - 1 + 4 + 0 + 0 + (0 - 2 + 3)(-4 + 4 - 2) + 3 + 0 - 2)(-1 + 2 - 2). 2r Expand ((2v3 + 3v3 - v3)(-4 + 2 + 1) - 4v*3 + 5v*3 + 0v*3)(22v - 22v - 25v2). 75v*5 Expand (2 + 0 - 1)(0w + 4w - 2w) - w - w - 4w - 5w + 2w + w. -6w Expand (0 + 0 - 3b)(-1 + 1 + 1 + (0 + 0 - 1)(-2 + 4 + 0) + 2 - 1 - 2). 6b Expand 3f - 5f - 5f + (-3 + 1 - 2)(4f - 5f + 0f). -3f Expand 2b*3 - 3 + 3 + 0b*3 - 2b3 - b3 + (-2b3 - 2b*3 + 6b*3)(1 - 2 - 1) + 0b3 + 2b3 - b3. -4b3 Expand (-5 + 5 - 2)(20 - 39 - 47)(2s*2 - 1 + 1). 264s*2 Expand (0 + 2 + 2)(0p + p - 11 + 12). 4p + 4 Expand (-z*3 + 0z*2 + 0z*2)(-4z - 3z + 5z + (-1 - 1 + 0)(3z - 9z - 5z)). -20z*4 Expand (5 - 3 + 2)(-4 + 0 + 5 + 3b). 12b + 4 Expand (-2t2 + 653 - 1304 - 8t + 653)(t2 + 3 - 3). -2t*4 - 8t*3 + 2t*2 Expand (-44 - 8t + 44)(2t*2 + 5t*2 - 4t*2). -24t*3 Expand (-2g + 3g + 0g)(2g*4 - 3g*3 + 3g*3) + (0g*2 - 4g*2 + 6g*2)(-4g2 + 2g*3 + 4g2) + g5 + 3g5 - 5g*5. 5g5 Expand (t2 - t*2 - 2t*3)(-2t + 5t + 6t). -18t*4 Expand (50 + 11s - 50)(-4 + 4 - 3). -33s Expand (1 - 1 - 2m + (2m + 0 + 0)(-3 + 6 - 4) - m - 4m + 0m)(-3m2 + 4m*2 + 0m*2). -9m*3 Expand 7p - 5p3 - 7p + (9p - 2p*2 + 3p*2 + 2p)(3p - p - 4p). -7p*3 - 22p*2 Expand 0m - m - 2m - 2m - m + 2m + (-5 + 1 + 3)(-m + 5m - 2m) - 4 + 2 - 2m + 0. -8m - 2 Expand (1 + 0 + 1)(b3 - b3 + 2b*3) + 23b*2 + 2b*3 - 4b*3 - 21b*2. 2b*3 + 2b*2 Expand (-5t*2 - 79 + 79)(-2 + 2 - 2t). 10t*3 Expand (8 - 3 - 3)(-p4 + p4 - 3p4) + 29p*4 - 280p*3 + 280p*3. 23p*4 Expand (-3 + 12m - 9m + 6m)(-2m - m + m). -18m2 + 6m Expand k - 3k + 3k + (k - 2k + 5k + (0 - 3 + 1)(0k + 4k - 5k))(-2 + 1 + 3). 13k Expand (4n - 4n - 2n)(2 - 3 + 9)(2n - 3n + 0n). 16n2 Expand ((-3b + b + 0b)(0 - 1 - 1) + b + 2b - b + 0b - b + 4b)(-2b2 - 4b*2 + 0b*2). -54b*3 Expand (-2 + 1 - 3)(6s - s - 3s). -8s Expand h + 1 - 1 - 1 - 2h + 1 + (5h - 3h - h)(-2 + 1 - 1) + 2h + 0 + 0 + 2h - 1 + 1 - 3 + h + 3 + 2h + 3h - 10h. -3h Expand (m + 2m - 2m)(-6 - 2m2 + 4 + 4m + 0m2). -2m*3 + 4m*2 - 2m Expand (-4j + 0j + 2j)(2 - 2 + 2j2) + (30j*2 - 10j + 10j)(-2j + 3 - 3). -64j*3 Expand (0 + 0 + 3)(4g - 1 + 1). 12g Expand (3a2 + a2 + a2)(6a - 13a + 2a3 - a3). 5a*5 - 35a*3 Expand (4 + 1 + 3)(-3t + 5 - 5)(-t + t*4 + t). -24t*5 Expand (0f - 2f + 0f)(-1 - 4 + 4) + f - f - f. f Expand 3r - 3r - r - 12r + 8r - 7r + (-3 + 1 + 1)(-2r - 3r + 6r). -13r Expand (r - 2r + 3r + (2r - 3r + 0r)(3 - 5 + 1))(-5 + 2 + 0). -9r Expand ((-5a + 0a + a)(2a2 + 1 - 1) - 2a*3 + 0 + 0)(5a2 - 3a*2 + 0a*2). -20a5 Expand (-u3 + 0u2 + 0u*2)(112u + 109u - 58u). -163u*4 Expand (-11 + 3 - 4)(-2 - l + 2). 12l Expand (2t*2 + 0t*2 - 5t*2)(0t + 2t*3 + 0t). -6t5 Expand (-3h - 2h + 6h)(1 - 2h - 6 - 2) + 2h2 - 4h*2 + 0h*2. -4h*2 - 7h Expand -4j2 + 4j*3 + 4j*2 - 5j + 5j + 2j*3 + (2 + 3 - 3)(-j*3 + 4j3 - j3) + 17 - 43j3 - 8 - 9. -33j*3 Expand (7p*2 - 10p*2 - 11p*2)(-2 + 4 + 0). -28p2 Expand (1 - 2 - 11)(3 + 3m - 1 - 5m) - 5m + 4m - m. 22m - 24 Expand (3o2 + o2 - 3o2)((-1 + 4 - 2)(-o - 2o + 5o) - 3o - 2 + 2 + 2o - 2o - o). -2o3 Expand (0j3 - j3 + 0j3)(-5j + j + 2j) - 105j3 + 56j*4 + 105j*3 + 283j*4. 341j4 Expand -m5 - 306m3 + 301m3 - m2 - 3m5 + (-3m + 0m + m)(-m*4 + 5m*4 - 5m*4). -2m*5 - 5m3 - m2 Expand -1 + 1 + 2j2 + (-j - 3 + 3)(-j + 1 - 1) + (-7 + 2 + 2)(2 - 2 - 2j*2). 9j*2 Expand -2n - 4n - n + (-3 + 2 - 4)(7n - 3n - n). -22n Expand (10r + 13r - 11r)(-7 + 3 + 0). -48r Expand (2p + 1 - 1)(-6 + 3 + 2) - 2 + 10p + 2. 8p Expand d3 + 0 + 0 - d2 + d3 + d2 + 2d3 - 4d*2 + 4d*2 + (-2d - 2 + 2)(d2 - d2 - d2) + d2 - d2 + 3d*3 + 0 - 2d*3 + 0. 7d*3 Expand -4 + 3u + 1 + 2 + u + 2u - 4u + (3 - 1 - 1)(-2u + 4u + 0u). 4u - 1 Expand 12n + 10n + 20n - 15n + 3n - 3n - n + (3 - 6 + 4)(2n + 2 - 2). 28n Expand (-2 - 1 + 1)(-r3 + 5r*3 - 2r*3) + 0r*3 - 4r*3 + 0r*3 + (-2r + 2r - r)(4r2 + 2r*2 - 7r*2). -7r*3 Expand (0 + 1 - 2)(-2x3 + 5x3 - x3) + 2x - 2x - x*3 + 3x*3 - 2x*3 - 8x*3 + (-2x + 3x + x)(2x2 + 0x + 0x) + 6x*3 - 3x3 - x3. -4x3 Expand (4 - 2 + 1)(1 + 3 - 3)(2z*2 + 0z*2 - 3z*2). -3z*2 Expand (12 - 12 - 3m + 10m4)(3 + 4m - 3). 40m*5 - 12m*2 Expand 2l + 3l - 3l + (l - 3l + 3l)(1 - 4 + 1) - 3l + 3l + 3l - 3l + 4l - 3l. l Expand (-6q + 0q + 0q)(-1 + 3 + 0 + 4 - 4 - 1 + (1 + 1 + 0)(0 - 1 + 2) + 1 + 1 - 1 + 5 - 1 - 2 - 2 + 3 + 0). -42*q Expand ((-3 + 3	{ "pile_set_name": "DM Mathematics" }
- 61 = 5h, 4h + 5g = -39 + 36 for h. -2 Solve 3w = s - 43, s + 7w + 16028 = 16041 for s. 34 Solve -t - 18t = -2t - 5h + 149, 2h + 5 = -t + 10 for t. -7 Solve -9n - 2 - 2 = 5f, 3n + 1474 = f + 1494 for f. -8 Solve -31 + 23 = 3w + w, -3w + 7w - 9 = 3c + w + 9 for c. -8 Solve -16w = -4t + 52, 107w + 4t + 197 + 240 = t for w. -4 Solve 5t - 29 + 222 = 32j, -12616 + 12663 = -t - 2j for t. -45 Solve 0 = 3v - 10j - 40, -208v = 180v - 387v + 5j + 20 for v. 0 Solve 4o - 3677d - 174 = -3684d, 3d - 6 = 0 for o. 40 Solve j - 5381714 + 5381734 = -9f, -3f = 3j + 180 for f. 5 Solve -4y - 49 = -y - 28q, -54q + 58q = 3y + 25 for y. -7 Solve 2b + 3b = 0, 5b + 14964 = 5w + 14949 for w. 3 Solve -4440 = 2i - 4472, i = 3p + 22 for p. -2 Solve 90a - 91a + 7 = 4i, -25i - 77 = -9i - 3a for i. -2 Solve -3f - 9b = 29 - 52 - 46, -4b + 47 = 5f + 20 for f. -1 Solve 5v = 3y - 16, -14v + 6 = -3y - 2 + 15 for y. 7 Solve 2z = -2p - 0z + 8, 68p - 66p - 6 = -5z + 2 for p. 4 Solve 2x - q - 61 = -75, 242 = -42x - 5q for x. -6 Solve 0 = 3q + n - 74, 502q + 22 = -509q + 1010q + 9n for q. 23 Solve -7b - 272 = 116z - 115z, 4z - 20b - 784 = 0 for z. 1 Solve -l + 6 + 13 - 41 = 2k + 137, 24k + 2l + 1938 = 0 for k. -81 Solve -462b + 8 = -250b - 210b, 6b = -k + 26 for k. 2 Solve 9z + 4f = -3129 + 3130, -f = 4z - 2 for z. 1 Solve 2p = -5z + 17, -2140p + 2141p - 1 = -z for z. 5 Solve 0a + 39 = -4a + 5a - c, 20a - 27a - 3c + 273 = 0 for a. 39 Solve -2c - c = -8i - 44, -5c - 3i + 62 = 54 for c. 4 Solve 6z - 194 = -8z + 20z - 5o, 0 = 2o - 7o - 10 for z. -34 Solve 6437 - 6475 = -2r - 3c, 0 = 6r + 4c - 134 for r. 25 Solve -180826 = w + 3v - 180819, 4v + 10 = -w for w. 2 Solve -y + 12u - 63 = -2y - 183, 26u = -260 for y. 0 Solve c + 14t - 77 = 0, 63993c - 63994c + 2 = -t for c. 7 Solve 5y - 6553h = -6558h + 40, 3y - 5h = -2y + 60 for y. 10 Solve 3d + 2l - 3 = 0, 0 = -3d + 10l - 3045009 + 3044976 for d. -1 Solve 4u + 436 = 5c, -4845c - 259 = 5u - 4848c for u. 1 Solve -48 = -3j - z - 2z, -54j - 93z - 71 = -94z - 330 for j. 5 Solve -p - 47o + 126 = -16o - o, 5p - 3o = 18 for p. 6 Solve d + 4b + 7 = 0, b + 4b + 2 + 3 + 0 = -2d for d. 5 Solve -5f - f - 69 = -f - 2c, 12f - 4c + 233 = 65 for f. -15 Solve 1963c - 9o = 1973c - 10o - 25, 0 = 36o - 35o + 5 for c. 2 Solve 0 = -6z - 3j - 255, 2z + z - 2j + 5j - 4077 = -4203 for z. -43 Solve -5s = 2r - 105, 6s = -60r + 5s - s - 62 + 400 for r. 5 Solve -v - 2168 + 2177 = 0, 6t - 5v = -33 for t. 2 Solve 2z + 3z = -15, 65t - 5887 = -140t - 3z + 3739 for t. 47 Solve -5w - 54 - 28 = -4a, -4a + 12w = -3w - 262 for a. -2 Solve -663c + 634c - 83 = 2p, 5c - 5p + 180 = 310 for c. -1 Solve 5m - 19m - 66 = -3m + 10m - q, -10m + 3q = 39 for m. -3 Solve 2r + 5i - 2i + 10i + 85 = 15, 0 = -3r + 5i + 42 for r. 4 Solve 12p = 17n - 13n - 88, 118p - 121p - 14 = -5n for n. -2 Solve f - 2f = -40v + 133 + 78, -4f - 39 = v for v. 5 Solve 23 + 37 = 15h, 3k + 8h - 5h = -39 for k. -17 Solve -24 = 3z - 2u, -124z + 3u = -127z + 6 for z. -4 Solve 0 = 176t - 223t - 4p - 102, 4t - p + 154 = 7t + 162 for t. -2 Solve 3s - 83h = -88h - 217, h = -2s - 6h - 295 for s. -4 Solve 9x + g - 3g = -134, -2g + 108 + 40 = -16x for x. -2 Solve -o + 4x = 6, -4o - x = o - 7008 + 7080 for o. -14 Solve 3i = -4s + 17, 18s + 27i = 30i + 27 for s. 2 Solve 3561k - 3558k + 9f = -117, k - 1 = 5f for k. -24 Solve -5r + 190 = 5d, 0 = -4d + 8475r - 8477r + 72 for d. -2 Solve 2s = -3z - 56, 5s - 5z + 375 = 485 for s. 2 Solve 6r + 0r - 47x = r + 128, -7r + 143 = -3r + 3x for r. 35 Solve -5j = 3d + 30, 6609j - 6606j = 3d + 6 for d. -5 Solve g - 107 = 5o, 2o + 5g + 40907 = 40848 for o. -22 Solve -3v + 261 = 0, -33387a - v = -33384a - 87 for a. 0 Solve -2p - 6y + 2 = 0, 5324p - 10643p + 3y + 3 - 2 = -5318p + y for p. 1 Solve 2b + 11j = 58, -2b + 3j - 269642 = -269644 for b. 7 Solve 0 = 3o - 72h - 2455 + 2302, 0 = 2o - 4h - 14 for o. 3 Solve 5j + 39 = 13k + 133 - 68 - 105, 14 = 2k - 2 for j. 5 Solve -4o - 7l - 20 = 6l - 9l, 0 = -2o + 5l + 11 for o. -2 Solve 0 = 4j + 5v - 275, -1274634v - 143 = 5j - 1274636v for j. -5 Solve 3f = -4n + 34, -12f + 3313n = 3316n - 84 for f. 6 Solve 5c + 5020 = d + 5037, 3d = -2c + 34 for c. 5 Solve 20b - 21b - 41c + 156 = 321, -2b = -2c - 6 for b. -1 Solve -49 = -9p + o, -3o = 50p - 31p - 37 for p. 4 Solve -2l - 20 = -3b + 22, -580b - 649 = 3l - 438b for l. -27 Solve 14d - w = -3d + 13d + 65, -2w + 56 + 90 = 10d - 12 for d. 16 Solve -2j - 19344l + 19346l - 8 = 0, -5j + 207l = 20 for j. -4 Solve 0 = 3i + 144, 60f - 56f + 3i + 151 = 3 for f. -1 Solve 239v + 4l - 7l = -244v - 74v + 43v + 11816, -l = -1 - 1 for v. 23 Solve 4 = -a + 4t + 207, -5a - 85915t + 148 = -85918t for a. -1 Solve -770m = -768m + 69h - 199, 0 = -5h + 15 for m. -4 Solve -j - 77 - 9 = 3v + 2v + 64, -4j + 4v + 144 = 0 for j. 5 Solve -m + 180y - 8 = 179y + 12, -2m = 3y + 45 for m. -21 Solve -21o - 118 = -4r - 6o, -702r - o + 86 = -698r for r. 22 Solve -3j + 0u - 32 = -13u - 159 - 68, -6u = 16j + 45 + 45 for j. 0 Solve -522 = 117i - 36i - 77i - 2x, 0 = -5i - x - 670 for i. -133 Solve -5o - 9668 = f - 9657, -8f + 44 = -4o for f. 4 Solve 83277n = 83274n + 3, 1 = -o - 3n for o. -4 Solve 48 - 8 = -4r - 5n + 2, 0 = -13r - n - 93 for r. -7 Solve -5w + 37n = 254, -3n + 209 = 3w + 185 for w. 1 Solve 3h + 66 = -4s, -1028 = -h + 4s - 1034 for h. -18 Solve 5z - v = 2z + 5, -40z = -45z + 142v - 1395 for z. 5 Solve -21v - 145 = -41r + 37r, -93v + 13 = 2r - 94v - 12 for r. 10 Solve -2k - 2r - 28 = 0, 146k + 172k + 10r = 131k - 226k + 8r - 4549 for k. -11 Solve -w = 143y - 43y + 93, 137w + 5y = 134w + 16 for w. 7 Solve 4p = p - 0p - 20b + 25b + 34, -3b = 76p - 991 for p. 13 Solve -3i + 2x + 11 = 0, -36x - 4x - 39 = 4i - 90x - 101 for i. 3 Solve 1997o - 1973o + 3t - 108 = 0, 2o + 3o + 2t + 3t - 40 = 0 for o. 4 Solve -56 = -2d - 4l, 147d - 90d + l = 59d + 9 for d. 2 Solve d = -177i - 172i + 354i + 5, 0 = -8i - 3d + 15 for i. 0 Solve 4y + 3l = -2, 5y - 5l = 9y - 5018 + 5016 for y. -2 Solve -20m = -13814r + 13809r + 65, 0 = 4r + 3m + 5 for r. 1 Solve -3t + 164 = 5g, -5g - 7437 = 6t - 7610 for t. 3 Solve 4p + 19 = -2h - 40 + 85, 4h - 16 = -2p for h. 1 Solve 0 = 5k - 0t + 2t - 130, -4t - 12t + t = -75 for k. 24 Solve -3m = -155 + 170, -75 - 19 = 7f + 2m for f. -12 Solve w + 10y + 9y - 451 = 14y, -31w - 367 = 38w - y for w. -4 Solve 3k - 1466q + 1467q - 18 = 0, -2q = k - 11 for k. 5 Solve 4x - 150 + 22 = 0, 871b - 875b + 336 = 10x for b. 4 Solve -8u + 7u + 9 = -14h - 1 - 7, 9h + 3u + 51 = 0 for h. -2 Solve -13z - 2u = -52, 3z = 692u - 694u + 12 for z. 4 Solve -60337o = t - 60339o + 21, 7t - 5o + 93 = 0 for t. -9 Solve 3i - 16943 = -0i - 16955, 8 = -2t - 2i for t. 0 Solve 3o = -8c + 171 + 4, o - 5o - 65 = -9o - 2c for o. 5 Solve -5v - 1978657k + 310 = -1978663k, 0 = 2v + 4k + 196 for v. 2 Solve 0 = -3l + 2s - 5s + 3, -6s + 13s = 4s + 6 for l. -1 Solve 32h - 694 = -2j - 512, 0 = 2h - 3j - 27 for h. 6 Solve 4a = 2a - 5y - 28, -73a + 34a + 40a - 7 = y for a. 1 Solve -30n + 68n - 29n + 2c - 46 = -0c, -2 = -n - c for n. 6 Solve 2x + 10 = 5x + 47h, -x + 30h - 31h - 26 = 0 for x. -28 Solve 3s = -4x - 0s - 10, 3x = 16s + 38027 - 37925 for x. 2 Solve -5v = 3r + 4, 69598v = 69596v + 5r + 17 for v. 1 Solve 4u + 176 = 8i, 33541i + 4u + 71 + 96 = 33540i for i. 1 Solve -4i + 2h + 28 = 0, -3i - 14 + 51 = -4h + 6 for i. 5 Solve 3v + 476 = 5x + 488, -1622v - 1622 = 0 for x. -3 Solve -3x - 4o + 7o - 23 + 79 = -7x, 5o = -100 for x. 1 Solve -239871v + 239892v = -u - 40, 8 = -4v for u. 2 Solve 5q - 3w - 11w + 42 + 86 = -w, -5q + 70 = 5w for q. 3 Solve -2i - 3a + 2a = -33, 0 = 3a + 476 - 563 for i. 2 Solve -14x + 10 = b, -60x + 59x = 15b - 14b + 3 for b. -4 Solve -4r - 3i + 35 = 0, 3r - 1116i + 1117*i - 20	{ "pile_set_name": "DM Mathematics" }
vide 83203288 by 3556. 23398 727 divided by 8164 727/8164 Calculate -219989360 divided by 10999468. -20 What is 2 divided by -804545? -2/804545 Divide -16306954 by 2. -8153477 -26885568 divided by 6 -4480928 -87127236 divided by -764274 114 Divide 11159 by 24304. 11159/24304 What is 6801152 divided by 219392? 31 Divide -364697545 by -72939509. 5 Calculate -3433 divided by 3957. -3433/3957 What is 10 divided by -17159556? -5/8579778 6823 divided by -1921 -6823/1921 Divide -31526925 by -3. 10508975 Divide 1607051 by -138. -1607051/138 Calculate 2171104 divided by 120. 271388/15 -209814344 divided by -2 104907172 What is -2798298 divided by 466383? -6 -91893004 divided by 156814 -586 What is 21445928 divided by 6? 10722964/3 Divide -5376322 by -768046. 7 Calculate -2530220 divided by -4774. 530 What is 43630077 divided by 43? 43630077/43 What is -9364453 divided by -4? 9364453/4 3566721504 divided by 6 594453584 Calculate 125892242 divided by 3702713. 34 Calculate -7 divided by 17186274. -1/2455182 Calculate 0 divided by -111479985. 0 What is 188400390 divided by 4957905? 38 What is -175 divided by -2478? 25/354 Calculate 23768640 divided by -495180. -48 Divide -1 by 198192478. -1/198192478 31350 divided by 172 15675/86 What is 47893350 divided by -15? -3192890 -22674486 divided by -51 7558162/17 What is 906 divided by -464332? -453/232166 2340744 divided by 94 1170372/47 What is 1 divided by -106524796? -1/106524796 What is -30475170 divided by -102610? 297 3342598 divided by 58 57631 0 divided by 228371 0 114495 divided by -135 -7633/9 What is -7187247 divided by -798583? 9 What is -5031153 divided by -6? 1677051/2 What is 67069872 divided by -24? -2794578 Divide 85271 by -4108. -85271/4108 Divide -810 by 337334. -405/168667 Calculate -24198760 divided by -131515. 184 What is -98625 divided by 22? -98625/22 Calculate 15860354 divided by -41089. -386 What is 207943852 divided by -4? -51985963 Calculate -4232140 divided by -5. 846428 Divide -71149 by 122. -71149/122 -3045539 divided by -2 3045539/2 Calculate 318748078 divided by 135407. 2354 Calculate -1409258970 divided by -615. 2291478 Calculate -170895010 divided by -4705. 36322 What is -398 divided by 53216? -199/26608 Divide -19747234 by 6. -9873617/3 Divide -3341046 by 3341046. -1 Calculate 32864832 divided by 18018. 1824 What is 1734060 divided by 5? 346812 2 divided by 16136673 2/16136673 Divide 1596 by -94101. -76/4481 Divide -30 by -776870. 3/77687 Divide -92651 by -94. 92651/94 Calculate -563484117 divided by 40269. -13993 Divide 21132958 by -2. -10566479 Divide 63678479 by -4. -63678479/4 234634023 divided by -668473 -351 Calculate 3 divided by -143985202. -3/143985202 4142 divided by -9472 -2071/4736 -113081 divided by 338 -113081/338 What is -419208 divided by -24? 17467 Calculate 3184089 divided by -2. -3184089/2 What is -53904 divided by -4653? 17968/1551 What is -624507458 divided by -2? 312253729 Divide 11416631 by 1. 11416631 -9593290 divided by -100982 95 Divide 395271129 by -2343. -168703 What is 6481041 divided by -20? -6481041/20 Divide 7380 by 14. 3690/7 What is -44429500 divided by -88859? 500 Divide -7290054 by -2286. 3189 Calculate 7446175 divided by -676925. -11 What is -1292547380 divided by -323136845? 4 Calculate -9420088 divided by -1636. 5758 -2 divided by -19319480 1/9659740 What is -20592957 divided by -717? 28721 Divide 32670560 by 314140. 104 Divide -15325432 by 68. -225374 What is 13681500 divided by 1368150? 10 Calculate 0 divided by 9493747. 0 What is 6617850 divided by 3? 2205950 What is -2228826 divided by -22? 1114413/11 5577877 divided by -30817 -181 Divide 65913510 by -130. -507027 What is -141270290 divided by -4? 70635145/2 Calculate 18321186 divided by 6. 3053531 What is 83182812 divided by 161207? 516 -143811 divided by 71 -143811/71 What is 842317326 divided by -93590814? -9 -179704845 divided by 292203 -615 Calculate 801 divided by -199794. -267/66598 -15 divided by -602492 15/602492 Divide 29907336 by -7476834. -4 Calculate -309424635 divided by 203435. -1521 282595872 divided by 78 3623024 Divide -9034542 by 2658. -3399 Divide -643199 by 5. -643199/5 What is 18543883 divided by 2? 18543883/2 Calculate -411 divided by 9633. -137/3211 What is 2617 divided by 212442? 2617/212442 Divide 2852555 by 165. 570511/33 25824 divided by -475 -25824/475 Divide -180215 by 118. -180215/118 Divide -519 by 24917. -519/24917 3 divided by -6917280 -1/2305760 Divide 30848520 by 30848520. 1 What is 309 divided by -214175? -309/214175 What is -13054713 divided by -136? 13054713/136 What is 17928106 divided by -82618? -217 3121 divided by -346931 -3121/346931 99309 divided by 71 99309/71 What is 525288 divided by -567? -175096/189 1585 divided by -2366 -1585/2366 Calculate 53142995 divided by 23. 2310565 -229609550 divided by -3950 58129 Divide -14348 by -9158. 7174/4579 Divide -973 by -13662. 973/13662 Divide -217288 by 15. -217288/15 2024 divided by -11573 -2024/11573 Divide 36577 by -306. -36577/306 -51907086 divided by -63 823922 What is 50134047 divided by -4? -50134047/4 What is -618309 divided by -3? 206103 What is 94242705 divided by -18848541? -5 Calculate 14650776 divided by -24. -610449 Calculate 320364 divided by -6. -53394 -1643074 divided by 17 -1643074/17 Calculate 14023040 divided by -1. -14023040 Divide -57520 by -6. 28760/3 What is 13827520 divided by 864220? 16 What is -4 divided by -6377805? 4/6377805 Calculate -430289430 divided by 345614. -1245 What is 8220295 divided by -205? -40099 70294754 divided by -2539 -27686 Divide 10243307 by 1. 10243307 Divide -216344250 by 32051. -6750 What is 24726656 divided by 74? 334144 What is 15 divided by -19873? -15/19873 What is -38297284 divided by -660298? 58 Calculate 1 divided by -100428. -1/100428 Calculate 34225369 divided by -34123. -1003 -2389560 divided by -36 199130/3 Calculate 3310560 divided by 4. 827640 Calculate -421576920 divided by -5. 84315384 What is 602810888 divided by 346? 1742228 What is -601557663 divided by -2? 601557663/2 Divide 69 by 1217883. 23/405961 What is 36507142 divided by 6? 18253571/3 What is -7291644 divided by 83812? -87 What is 72 divided by -51949? -72/51949 What is -566714218 divided by -7? 80959174 What is 4 divided by -54011? -4/54011 -550 divided by -11317 550/11317 What is -30815150 divided by -9950? 3097 Divide 4 by 3847340. 1/961835 What is 2244309444 divided by 1? 2244309444 Calculate 2237846 divided by 4. 1118923/2 Calculate 26083 divided by 4817. 26083/4817 Calculate -6793192 divided by -6. 3396596/3 Divide -293151 by 328. -293151/328 1 divided by 46012054 1/46012054 Divide -86829 by 1223. -86829/1223 180249564 divided by 5462108 33 93 divided by 16967 93/16967 What is -244320318 divided by 3? -81440106 13699315 divided by -7 -1957045 Calculate 15287590 divided by 179854. 85 -827581749 divided by 3 -275860583 Calculate -18142 divided by 862. -9071/431 5174574 divided by 14334 361 Divide -28749830 by -5749966. 5 Calculate -4626 divided by -12004. 2313/6002 Divide -1986908 by -12902. 154 Calculate 2727094 divided by 2. 1363547 -67968094 divided by -700702 97 -378944 divided by 64 -5921 0 divided by -71030330 0 Calculate -136 divided by -8361182. 68/4180591 -2044 divided by 936 -511/234 2560512 divided by -1280256 -2 6518 divided by 896 3259/448 What is 3625 divided by -8612? -3625/8612 Divide 6 by 368554. 3/184277 Calculate -32392424 divided by -398. 81388 Calculate -1744372 divided by -124598. 14 What is -3959220 divided by -1979610? 2 Divide 12 by 127747. 12/127747 Divide 50241510 by 22. 2283705 247230510 divided by 852519 290 What is 10 divided by 21340888? 5/10670444 Divide -4 by 7965445. -4/7965445 What is -53 divided by 855455? -53/855455 10728795 divided by -2145759 -5 What is -3 divided by -1734570? 1/578190 Divide -1 by -168810311. 1/168810311 Calculate -166292719 divided by 166292719. -1 Divide -20232770 by 11. -20232770/11 12186512 divided by 2 6093256 5 divided by -2415172 -5/2415172 60 divided by 4508 15/1127 -41159 divided by -521 79 7 divided by 288365 1/41195 Divide -1438485 by -124. 1438485/124 What is -25163559 divided by -15? 8387853/5 13760292 divided by -21 -655252 Calculate -8642520 divided by -120. 72021 Divide -1486 by -12050. 743/602	{ "pile_set_name": "DM Mathematics" }
the nearest integer? 4 What is the third root of 953527 to the nearest integer? 98 What is the cube root of 8992 to the nearest integer? 21 What is the square root of 25377 to the nearest integer? 159 What is 470035 to the power of 1/7, to the nearest integer? 6 What is the square root of 182482 to the nearest integer? 427 What is the fifth root of 34274 to the nearest integer? 8 What is the fifth root of 26147509 to the nearest integer? 30 What is the seventh root of 2732798 to the nearest integer? 8 What is the seventh root of 2959469 to the nearest integer? 8 What is 40287 to the power of 1/8, to the nearest integer? 4 What is the third root of 27918093 to the nearest integer? 303 What is 7993601 to the power of 1/7, to the nearest integer? 10 What is the eighth root of 62418 to the nearest integer? 4 What is the fourth root of 19741994 to the nearest integer? 67 What is 612793 to the power of 1/4, to the nearest integer? 28 What is 291413 to the power of 1/3, to the nearest integer? 66 What is 6396448 to the power of 1/8, to the nearest integer? 7 What is 3153735 to the power of 1/5, to the nearest integer? 20 What is the cube root of 185047 to the nearest integer? 57 What is the cube root of 331460 to the nearest integer? 69 What is the square root of 586136 to the nearest integer? 766 What is the third root of 5068975 to the nearest integer? 172 What is the square root of 42562252 to the nearest integer? 6524 What is 9844223 to the power of 1/2, to the nearest integer? 3138 What is 656969 to the power of 1/3, to the nearest integer? 87 What is 6819645 to the power of 1/7, to the nearest integer? 9 What is 3034951 to the power of 1/10, to the nearest integer? 4 What is the square root of 1381917 to the nearest integer? 1176 What is the sixth root of 14668916 to the nearest integer? 16 What is the ninth root of 2859583 to the nearest integer? 5 What is the seventh root of 253665 to the nearest integer? 6 What is 184849 to the power of 1/8, to the nearest integer? 5 What is the cube root of 23344 to the nearest integer? 29 What is the cube root of 767728 to the nearest integer? 92 What is the cube root of 255203 to the nearest integer? 63 What is the cube root of 337243 to the nearest integer? 70 What is 5606612 to the power of 1/3, to the nearest integer? 178 What is 240234 to the power of 1/2, to the nearest integer? 490 What is 1743408 to the power of 1/2, to the nearest integer? 1320 What is 5963987 to the power of 1/5, to the nearest integer? 23 What is the third root of 304020 to the nearest integer? 67 What is the fifth root of 2445408 to the nearest integer? 19 What is 216658 to the power of 1/3, to the nearest integer? 60 What is 30364 to the power of 1/9, to the nearest integer? 3 What is the square root of 285051 to the nearest integer? 534 What is 3539224 to the power of 1/2, to the nearest integer? 1881 What is 342819 to the power of 1/8, to the nearest integer? 5 What is the third root of 415285 to the nearest integer? 75 What is 1593143 to the power of 1/2, to the nearest integer? 1262 What is the cube root of 17273 to the nearest integer? 26 What is the square root of 1705484 to the nearest integer? 1306 What is 2838952 to the power of 1/2, to the nearest integer? 1685 What is the square root of 1017052 to the nearest integer? 1008 What is the fifth root of 56908 to the nearest integer? 9 What is the square root of 1549982 to the nearest integer? 1245 What is 167872 to the power of 1/5, to the nearest integer? 11 What is 4541930 to the power of 1/2, to the nearest integer? 2131 What is the square root of 663597 to the nearest integer? 815 What is 2638821 to the power of 1/2, to the nearest integer? 1624 What is 25785474 to the power of 1/5, to the nearest integer? 30 What is 1949552 to the power of 1/2, to the nearest integer? 1396 What is 5842081 to the power of 1/3, to the nearest integer? 180 What is 700204 to the power of 1/2, to the nearest integer? 837 What is the fifth root of 418481 to the nearest integer? 13 What is the sixth root of 359925 to the nearest integer? 8 What is the third root of 367030 to the nearest integer? 72 What is the cube root of 2775689 to the nearest integer? 141 What is the cube root of 196651 to the nearest integer? 58 What is 1266600 to the power of 1/2, to the nearest integer? 1125 What is 34662 to the power of 1/10, to the nearest integer? 3 What is the cube root of 212127 to the nearest integer? 60 What is 1293645 to the power of 1/3, to the nearest integer? 109 What is the seventh root of 16827222 to the nearest integer? 11 What is the fourth root of 192403 to the nearest integer? 21 What is 16047596 to the power of 1/6, to the nearest integer? 16 What is the square root of 119200 to the nearest integer? 345 What is 1483186 to the power of 1/2, to the nearest integer? 1218 What is 7351 to the power of 1/3, to the nearest integer? 19 What is the square root of 3565732 to the nearest integer? 1888 What is the third root of 270776 to the nearest integer? 65 What is 141752 to the power of 1/2, to the nearest integer? 376 What is the square root of 96961 to the nearest integer? 311 What is the square root of 702721 to the nearest integer? 838 What is 15445383 to the power of 1/2, to the nearest integer? 3930 What is 529436 to the power of 1/7, to the nearest integer? 7 What is the cube root of 785825 to the nearest integer? 92 What is the cube root of 342398 to the nearest integer? 70 What is the cube root of 1237970 to the nearest integer? 107 What is the third root of 1979365 to the nearest integer? 126 What is 27024136 to the power of 1/10, to the nearest integer? 6 What is the sixth root of 255413 to the nearest integer? 8 What is the third root of 7074895 to the nearest integer? 192 What is 7188128 to the power of 1/3, to the nearest integer? 193 What is 1220077 to the power of 1/2, to the nearest integer? 1105 What is 441704 to the power of 1/2, to the nearest integer? 665 What is the third root of 249454 to the nearest integer? 63 What is the square root of 444449 to the nearest integer? 667 What is the third root of 2738482 to the nearest integer? 140 What is 2634967 to the power of 1/4, to the nearest integer? 40 What is 14919128 to the power of 1/10, to the nearest integer? 5 What is the square root of 877413 to the nearest integer? 937 What is the eighth root of 2404427 to the nearest integer? 6 What is the third root of 22154957 to the nearest integer? 281 What is the third root of 981415 to the nearest integer? 99 What is 144700 to the power of 1/10, to the nearest integer? 3 What is 7539700 to the power of 1/3, to the nearest integer? 196 What is the fifth root of 4293403 to the nearest integer? 21 What is the cube root of 1604906 to the nearest integer? 117 What is the third root of 227034 to the nearest integer? 61 What is 26264489 to the power of 1/8, to the nearest integer? 8 What is 1493554 to the power of 1/9, to the nearest integer? 5 What is 1796488 to the power of 1/2, to the nearest integer? 1340 What is 659632 to the power of 1/8, to the nearest integer? 5 What is the tenth root of 13135930 to the nearest integer? 5 What is the tenth root of 1440490 to the nearest integer? 4 What is 1192663 to the power of 1/3, to the nearest integer? 106 What is the square root of 271241 to the nearest integer? 521 What is the fourth root of 2865318 to the nearest integer? 41 What is the square root of 844618 to the nearest integer? 919 What is 799953 to the power of 1/3, to the nearest integer? 93 What is the ninth root of 94215 to the nearest integer? 4 What is the eighth root of 932849 to the nearest integer? 6 What is 934283 to the power of 1/2, to the nearest integer? 967 What is the third root of 343498 to the nearest integer? 70 What is 6982272 to the power of 1/9, to the nearest integer? 6 What is the cube root of 635349 to the nearest integer? 86 What is 372821 to the power of 1/2, to the nearest integer? 611 What is 1044686 to the power of 1/3, to the nearest integer? 101 What is the third root of 10756230 to the nearest integer? 221 What is the cube root of 38521716 to the nearest integer? 338 What is 1627871 to the power of 1/10, to the nearest integer? 4 What is the	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.