Datasets:

parameterlab
/

scaling_mia_the_pile_00_DM_Mathematics

Dataset card Data Studio Files Files and versions Community

Split (3)

train · 63.5k rows

text stringlengths 518 8.19k	meta dict
2286385 to the power of 1/3, to the nearest integer? 132 What is the square root of 177341 to the nearest integer? 421 What is the cube root of 19062799 to the nearest integer? 267 What is 826333 to the power of 1/2, to the nearest integer? 909 What is the cube root of 3297998 to the nearest integer? 149 What is the square root of 329671 to the nearest integer? 574 What is the third root of 572263 to the nearest integer? 83 What is the ninth root of 1876694 to the nearest integer? 5 What is the square root of 34075769 to the nearest integer? 5837 What is 208773 to the power of 1/3, to the nearest integer? 59 What is the tenth root of 107559 to the nearest integer? 3 What is the square root of 10613897 to the nearest integer? 3258 What is 8243941 to the power of 1/2, to the nearest integer? 2871 What is the square root of 19513439 to the nearest integer? 4417 What is the third root of 4339920 to the nearest integer? 163 What is the sixth root of 66159 to the nearest integer? 6 What is 3453442 to the power of 1/3, to the nearest integer? 151 What is the cube root of 651044 to the nearest integer? 87 What is the square root of 23082783 to the nearest integer? 4804 What is the square root of 702467 to the nearest integer? 838 What is the third root of 1717457 to the nearest integer? 120 What is the tenth root of 3352552 to the nearest integer? 4 What is 1097579 to the power of 1/10, to the nearest integer? 4 What is 24756007 to the power of 1/2, to the nearest integer? 4976 What is the seventh root of 214185 to the nearest integer? 6 What is the seventh root of 732155 to the nearest integer? 7 What is the square root of 2446 to the nearest integer? 49 What is 303812 to the power of 1/9, to the nearest integer? 4 What is the square root of 673066 to the nearest integer? 820 What is the cube root of 1866307 to the nearest integer? 123 What is 637482 to the power of 1/2, to the nearest integer? 798 What is the third root of 4584768 to the nearest integer? 166 What is the fourth root of 541830 to the nearest integer? 27 What is the cube root of 621067 to the nearest integer? 85 What is 49945 to the power of 1/2, to the nearest integer? 223 What is 11739132 to the power of 1/5, to the nearest integer? 26 What is 721415 to the power of 1/3, to the nearest integer? 90 What is the square root of 777215 to the nearest integer? 882 What is 2745025 to the power of 1/2, to the nearest integer? 1657 What is the square root of 19799662 to the nearest integer? 4450 What is 498162 to the power of 1/7, to the nearest integer? 7 What is the ninth root of 6317897 to the nearest integer? 6 What is the eighth root of 318739 to the nearest integer? 5 What is 8415358 to the power of 1/7, to the nearest integer? 10 What is 2044341 to the power of 1/3, to the nearest integer? 127 What is the square root of 205087 to the nearest integer? 453 What is the square root of 240560 to the nearest integer? 490 What is the fourth root of 1554717 to the nearest integer? 35 What is the cube root of 697188 to the nearest integer? 89 What is the third root of 7589902 to the nearest integer? 197 What is 254727 to the power of 1/10, to the nearest integer? 3 What is 170949 to the power of 1/2, to the nearest integer? 413 What is 22754777 to the power of 1/2, to the nearest integer? 4770 What is the square root of 1643053 to the nearest integer? 1282 What is 298084 to the power of 1/5, to the nearest integer? 12 What is 434828 to the power of 1/2, to the nearest integer? 659 What is the third root of 364178 to the nearest integer? 71 What is 13138705 to the power of 1/2, to the nearest integer? 3625 What is the third root of 677504 to the nearest integer? 88 What is 20912811 to the power of 1/2, to the nearest integer? 4573 What is the sixth root of 229944 to the nearest integer? 8 What is the fourth root of 361618 to the nearest integer? 25 What is the square root of 23473621 to the nearest integer? 4845 What is 6116214 to the power of 1/8, to the nearest integer? 7 What is the third root of 2297328 to the nearest integer? 132 What is the cube root of 174359 to the nearest integer? 56 What is 1012528 to the power of 1/3, to the nearest integer? 100 What is the cube root of 58317 to the nearest integer? 39 What is the third root of 9036664 to the nearest integer? 208 What is 228325 to the power of 1/7, to the nearest integer? 6 What is the third root of 561061 to the nearest integer? 82 What is 985166 to the power of 1/4, to the nearest integer? 32 What is 599391 to the power of 1/7, to the nearest integer? 7 What is 15536 to the power of 1/3, to the nearest integer? 25 What is 672601 to the power of 1/5, to the nearest integer? 15 What is 94808 to the power of 1/2, to the nearest integer? 308 What is the third root of 998057 to the nearest integer? 100 What is 4434529 to the power of 1/2, to the nearest integer? 2106 What is the third root of 1650539 to the nearest integer? 118 What is 1227660 to the power of 1/3, to the nearest integer? 107 What is the eighth root of 1841173 to the nearest integer? 6 What is 756389 to the power of 1/5, to the nearest integer? 15 What is the sixth root of 15335464 to the nearest integer? 16 What is 19841821 to the power of 1/7, to the nearest integer? 11 What is the third root of 295851 to the nearest integer? 67 What is 1023172 to the power of 1/3, to the nearest integer? 101 What is 2153114 to the power of 1/2, to the nearest integer? 1467 What is 38983330 to the power of 1/2, to the nearest integer? 6244 What is the sixth root of 3355890 to the nearest integer? 12 What is the fourth root of 2240821 to the nearest integer? 39 What is 86911 to the power of 1/9, to the nearest integer? 4 What is the third root of 3710120 to the nearest integer? 155 What is 571728 to the power of 1/6, to the nearest integer? 9 What is 4780481 to the power of 1/9, to the nearest integer? 6 What is the square root of 2287851 to the nearest integer? 1513 What is the square root of 8655987 to the nearest integer? 2942 What is the seventh root of 2955218 to the nearest integer? 8 What is the square root of 5756155 to the nearest integer? 2399 What is the third root of 4918936 to the nearest integer? 170 What is the square root of 2433523 to the nearest integer? 1560 What is 10631481 to the power of 1/3, to the nearest integer? 220 What is the seventh root of 29762231 to the nearest integer? 12 What is the cube root of 620768 to the nearest integer? 85 What is 421976 to the power of 1/3, to the nearest integer? 75 What is the cube root of 3180030 to the nearest integer? 147 What is the third root of 2285035 to the nearest integer? 132 What is 324890 to the power of 1/2, to the nearest integer? 570 What is 389922 to the power of 1/2, to the nearest integer? 624 What is the third root of 1401461 to the nearest integer? 112 What is 1725241 to the power of 1/6, to the nearest integer? 11 What is the fourth root of 150239 to the nearest integer? 20 What is the cube root of 3265750 to the nearest integer? 148 What is the third root of 1151940 to the nearest integer? 105 What is 2835334 to the power of 1/3, to the nearest integer? 142 What is 1991939 to the power of 1/5, to the nearest integer? 18 What is 385990 to the power of 1/2, to the nearest integer? 621 What is the fourth root of 251533 to the nearest integer? 22 What is the square root of 357321 to the nearest integer? 598 What is the square root of 1371396 to the nearest integer? 1171 What is the eighth root of 3816670 to the nearest integer? 7 What is 2703836 to the power of 1/2, to the nearest integer? 1644 What is 7969 to the power of 1/3, to the nearest integer? 20 What is the seventh root of 2707079 to the nearest integer? 8 What is the square root of 33122598 to the nearest integer? 5755 What is 18417022 to the power of 1/2, to the nearest integer? 4292 What is 53480 to the power of 1/6, to the nearest integer? 6 What is 1752418 to the power of 1/9, to the nearest integer? 5 What is the cube root of 325233 to the nearest integer? 69 What is the fifth root of 1074512 to the nearest integer? 16 What is the square root of 1059828 to the nearest integer? 1029 What is 4821546 to the power of 1/2, to the nearest integer?	{ "pile_set_name": "DM Mathematics" }
l) = -f(l) - s(l). Find the second derivative of w(k) wrt k. 380k3 Let f(u) be the first derivative of 0u*3 - 4 + 1/2u*4 - 2u*2 + 0u. Find the second derivative of f(q) wrt q. 12q Let q be 0 - 8/(-12). Suppose -23 = d - 5d + t, d + q = -3t. What is the second derivative of -3f - fd + 2f*5 - 2f*5 wrt f? -20f3 Let v(s) be the first derivative of -s4/12 + s*3/2 - 3s*2/2 - 2. Let y(x) be the second derivative of v(x). What is the derivative of y(q) wrt q? -2 Let o = -1159/10 - -116. Let v(w) be the second derivative of 0 + 0w3 + w2 + ow5 + 0w*4 + w. What is the derivative of v(k) wrt k? 6k*2 Suppose 3b + 4l + 7 + 1 = 0, b - 2l = 4. What is the first derivative of 2y + 6 - 14 + by wrt y? 2 Let c(u) = u*3 - 4u - 4. Let a(m) be the first derivative of -m*4/4 + m + 4. Let k(d) = 4a(d) + c(d). Find the second derivative of k(z) wrt z. -18z What is the derivative of p3 - p3 - 2 - 467p*4 + 459p*4 wrt p? -32p*3 Let o be (-26)/5 + (-2)/(-10). Let b(v) = -4v + 2. Let f(r) = -3r + 1. Let c(k) = of(k) + 4b(k). Find the first derivative of c(g) wrt g. -1 Let y(d) = -18d*3 - 15d*2 + 15d + 30. Let r(g) = g3 + g2 - g - 1. Let x(t) = -15r(t) - y(t). Differentiate x(k) wrt k. 9k*2 Suppose 0 = -4o - 2h - 2h + 16, 0 = 4h. Let y(r) = r - 3. Let w be y(5). What is the first derivative of -bo + b4 + 2 + wb*4 wrt b? 8b*3 Suppose -o - i = o, -4i = -3o + 22. Suppose 0 = 2r - 3r + 4. Find the third derivative of 2u*o - 4u*2 - ru*4 + 4u*3 - 4u*3 wrt u. -96u Let j(o) be the second derivative of 19o5/20 - 29o*4/12 + 27o. What is the third derivative of j(g) wrt g? 114 Suppose 5b = -2h + 10, -11 = 4b - 3b + 3h. Find the second derivative of -4m*b - m - 5m*4 - 6m wrt m. -108m2 Let z(v) = -v2 + 6v - 5. Let u be z(4). What is the third derivative of 3p2 - p3 + p3 - 3p*u wrt p? -18 Let b be 3/931. Let t be 12/(-4)(-2)/2. Differentiate -1 + 5d2 - td*2 - b with respect to d. 4d Let p(z) = -25z3 + 10z*2 - 9z - 9. Let r(y) = -12y3 + 5y*2 - 4y - 4. Let n(b) = -4p(b) + 9r(b). What is the third derivative of n(c) wrt c? -48 Suppose -11 = -2n - 5z, 4z = 5n - 7 - 4. What is the third derivative of -dn + d3 - 3d2 - d5 wrt d? -60d2 Let m(a) = a3 + 5a2 + 5a + 3. Let n be m(-2). Let t(c) be the first derivative of 0c3 - 1/5c*n + 2c - 3 + 0c4 + 0c*2. Differentiate t(w) wrt w. -4w*3 Let g(n) = 15n*3 - 8. Let u(o) = -14o*3 + 7. Let q(v) = -3g(v) - 2u(v). Differentiate q(d) wrt d. -51d*2 Let o(p) be the third derivative of 0 + 0p + 0p4 + 6p2 + p3 + 1/120p6 + 0p*5. Find the first derivative of o(z) wrt z. 3z2 Let n(v) = v3 + 7v2 + 6v - 6. Let r be n(-5). Suppose -o + 8 = 5i, 0o = -3i + 4o + r. Differentiate -3b2 - i + 2b*2 + 1 with respect to b. -2b Let a(s) be the second derivative of -4s6/15 + 7s*3/3 - 14s. Find the second derivative of a(v) wrt v. -96v2 Let y(r) be the first derivative of 11r*3/3 - 34r - 15. Differentiate y(w) wrt w. 22w Let s(c) be the first derivative of -c9/504 + c5/30 - c2/2 - 2. Let v(d) be the second derivative of s(d). Find the third derivative of v(y) wrt y. -120y*3 Let g(h) = -4h*2 - 39h + 6. Let c(z) = -8z2 - 79z + 11. Let p(i) = 6c(i) - 11g(i). Find the second derivative of p(k) wrt k. -8 Let j(t) = t3 + t2 + t - 1. Let f(h) = -14h4 - 3h*3 - 9h*2 - 3h + 3. Let n(o) = f(o) + 3j(o). What is the third derivative of n(y) wrt y? -336y Let c(r) be the second derivative of 39r8/56 - 13r*4/6 - 33r. What is the third derivative of c(k) wrt k? 4680k3 Find the second derivative of -7o*2 + 3o - 4o - 2o wrt o. -14 Let n(h) be the third derivative of 0h + 0 - 1/2h*3 - 4h*2 - 1/8h*4. Differentiate n(a) wrt a. -3 Let v = 8 - 8. Find the second derivative of -75r*2 - 4r*3 + vr*3 + 75r*2 - 7r wrt r. -24r Let k(w) = -3w*2 + 6. Let d(x) = -7x*2 + 12. Let u(r) = -2d(r) + 5k(r). Let h be u(0). Find the second derivative of 0c + c + 4c5 - hc*5 wrt c. -40c*3 Let k(n) be the first derivative of -13n*4/4 - 23n3/3 - 23. What is the third derivative of k(h) wrt h? -78 Let p(n) be the first derivative of n3 + 1/7n7 + 0n + 0n2 + 0n*4 + 3 + 0n*5 + 0n*6. Find the third derivative of p(d) wrt d. 120d*3 Let y(v) = -3v2 - 4. Let m(r) = 2 + r2 - 6 + 1 + 4. Let c(b) = 7m(b) + 2y(b). Differentiate c(h) wrt h. 2h Let j = 4 + -2. Find the second derivative of 2p*j + p - p - 2p + 3p wrt p. 4 Suppose -4d = -4b + 4, 4b - d + 1 = 8. Find the first derivative of -j2 - 3 - j2 + b wrt j. -4j What is the second derivative of 2n - 49 - 2n3 + 16n + 49 wrt n? -12n Let z be (-84)/16 + (-1)/(-4). Let r = -1 - z. What is the derivative of 4c + c*4 - rc + 1 wrt c? 4c3 Let f be 3/4 + 40/32. Let l(y) be the second derivative of -yf + 1/6y*4 + 0 + 0y*3 - 2y. Differentiate l(w) wrt w. 4w Let l(j) be the second derivative of -3/14j*7 + 0j*2 + 0j*4 + 8j + 0j6 + 3/2j*3 + 0j*5 + 0. Find the second derivative of l(x) wrt x. -180x*3 Let v = 37 + -32. Let k(g) be the third derivative of 0g + 1/60g6 + 0g*4 + 1/3g*3 + 0gv + 0 + g2. What is the first derivative of k(j) wrt j? 6j2 Let u(w) = w4 + w3 + w - 1. Let k(t) = -31t*4 + 6t*3 + 37t - 6. Let a(x) = k(x) - 6u(x). Find the second derivative of a(l) wrt l. -444l2 Let w(d) be the first derivative of -d5/24 + d*4/24 - 2d*3 - 4. Let q(h) be the third derivative of w(h). What is the derivative of q(g) wrt g? -5 Let k(v) = 5v*2 - 2v2 - v - v2. Let l(z) = 2z4 - z4 - 2z - 9z2 + 7z. Let i(m) = 9k(m) + 2l(m). Find the second derivative of i(j) wrt j. 24j2 Let a(h) be the first derivative of -h3 - 2 + 0h - 3/4h4 + 0h2. What is the third derivative of a(k) wrt k? -18 Let o(d) = d4 + 5d2 + 4. Let k(a) = -a4 - a2 - 1. Let r = 13 + -17. Let u(j) = rk(j) - o(j). What is the third derivative of u(n) wrt n? 72n Let g(b) be the second derivative of -4b*3/3 + 3b*2 - 5b. Find the first derivative of g(v) wrt v. -8 Find the third derivative of 5j2 - 121j*5 + 121j*5 - 9j*6 + 2j*6 wrt j. -840j3 Let v(l) be the third derivative of -l6/40 + l3/6 + l2. What is the first derivative of v(x) wrt x? -9x2 Let n(d) be the second derivative of 11d*5/20 + 11d*4/12 + 5d. What is the third derivative of n(r) wrt r? 66 Suppose 0 = -c + 1 + 1. Differentiate 4 - 2 + 6i - ci + 1 with respect to i. 4 Let b(a) be the first derivative of -a5 + a3 + 53a - 31. What is the first derivative of b(k) wrt k? -20k*3 + 6k Let p(t) = -7t2 - 7. Let v(m) = 7m*2 + 7. Suppose 5i + 3h + 18 = -0i, 3h - 42 = 5i. Let x(g) = iv(g) - 7p(g). Differentiate x(q) with respect to q. 14q Let c(n) = -6n. Let d be c(-1). Let o = -4 + d. What is the second derivative of 3h2 + oh + h - 2h wrt h? 6 Let i(s) = -14s*3 - 5s*2 + 9s - 5. Let p(l) = l3 - l2 + l - 1. Let r(q) = -i(q) + 5p(q). What is the second derivative of r(w) wrt w? 114w Let n(o) = o*2 + 2o - 4. Let v be n(-4). What is the second derivative of -r + 5r - 3r4 - rv wrt r? -48r2 Let i(x) be the third derivative of -3x*7/35 + 23x*5/60 - 3x*2. What is the third derivative of i(h) wrt h? -432h Let v(b) = 16b3 + 2b - 37. Let k(p) = 16p3 + 3p - 38. Let i(f) = -2k(f) + 3v(f). Find the first derivative of i(x) wrt x. 48x2 Let l = -12 + 7. Let w(x) = 7x*2 + 3x - 1. Let i(f) = 13f2 + 5f - 2. Let s(r) = lw(r) + 3i(r). What is the derivative of s(o) wrt o? 8o Let y(o) = 6o*3 + 52o*2 + 25o. Let g(s) = 7s3 + 53s*2 + 26s. Let h(b) = -4g(b) + 5y(b). Find the second derivative of h(w) wrt w. 12w + 96 Let g(f) be the third derivative of f6/120 - f5/30 + 3f2. What is the third derivative of g(i) wrt i? 6 Let g(r) = -r3 - 12r2 - 11r + 4. Let w be g(-11). What is the first derivative of wp4 + p4 + 2p*4 - 3 - 5p*4 wrt p? 8p*3 Let w(y) be the second derivative of 0 - 3y + y*2 + 0y*3 - 1/4y*4. What is the first derivative of w(l) wrt l? -6l What is the second derivative of -54n - 15n**2 -	{ "pile_set_name": "DM Mathematics" }
-3 Solve 3s - 4k - 25 = -26, -4k = -2s - 6 for s. 5 Solve 3q + 14 = -201g + 221g, 5q + 2g - 4 = 4q for q. 2 Solve 0 = -2s + 36, 2a = -0s - 3s + 4s - 18 for a. 0 Solve 0 = 5m - 9l + 28, -5m - 214l + 219l - 40 = 0 for m. -11 Solve -7v + 10v = 14d + 74, 0 = 4d + 4v - 76 for d. -1 Solve d + 84r + 5 = 82r, 0 = 4d - 4r - 16 for d. 1 Solve i + 3s - 2 = 0, -272s + 12 = 2i - 274s for i. 5 Solve 9d + 24 = y, 2y + 30 = -3y + 21d - 26d for y. -3 Solve 4z + 2w + 67 = 55, 0 = 2z + 5w - 2 for z. -4 Solve -5l + a = 26, 4a = 10075l - 10076l + 20 for l. -4 Solve 4376 = -5s - 5z + 4411, 10s = z + 37 for s. 4 Solve 0 = -t - 3d - 4, -15t - 700d + 702d = 107 for t. -7 Solve -5j = -2q - 33, 0 = -2q + 92j - 89j - 23 for q. -4 Solve 37s = 38s + 4r + 11, 5r = -2s - 16 for s. -3 Solve 34w = 4m - 124, -24 = 3w + 3m + m for w. -4 Solve -318 = 3o + 2c - 307, 3o - 4c - 13 = 0 for o. -1 Solve -1930l = -3c - 959l - 967l - 28, -10 = -l for c. 4 Solve 2422t + 7p = 2419t - 18, p + 3 = 0 for t. 1 Solve 0s + s - 56o = -27o - 30o - 9, 5o = -20 for s. -5 Solve 0 = 2f - 5n - 38, -15f - 101 + 131 = 5n for f. 4 Solve 4y + 90 = -2a + 92, -3a + 4y - 17 = 0 for a. -3 Solve 3c - 28 = -h, -5h + c - 170 + 150 = 0 for h. -2 Solve r + 8 = -2t, -4r + 4t - 7 = 1 for r. -4 Solve 48 = -8t - 8v, -4v - 83 = -25 - 42 for t. -2 Solve 5l + 37 = 2x, 1313l - 1311l = -5x - 38 for l. -9 Solve t + r = -7, 32 = 4t - 5r + 24 for t. -3 Solve -4i + 2z + 1 - 1 = -2z, -8z = 3i for i. 0 Solve 0w + y = -3w - y - 15, -7 = y - 4 for w. -3 Solve 14m = -3g + 10m - 26, -g - 16 = 5m for g. -6 Solve 370u - 369u - 19 = -4t, 2u = t + 11 for t. 3 Solve -12z = -7z + 4n + 2, 2n = 3z - 12 for z. 2 Solve -11v = -12v - j, 3j = v - 20 for v. 5 Solve -2p = -2n + 8, 4p = 2n - 6 - 2 for p. 0 Solve -79v + 35 = -5k - 80v, -3k + 40v = 21 for k. -7 Solve 4m - 12 = -2b, -m = 29b - 38b + m + 14 for b. 2 Solve -3x - 5c - 42 = 0, 0 = -4x - 186c + 190c + 8 for x. -4 Solve -2j + 419i + 6 = 2j + 420i, 3i = -7j + 3 for j. 3 Solve 0 = 5t + 3h - 31 + 36, 9 = 4t + 5h for t. -4 Solve 2s + 4g - 4 = 0, -4s = -51g + 56g + 1 for s. -4 Solve 76 = 17l - 5b, -2b = 123l - 122l + 7 for l. 3 Solve -72l - 3b = -70l + 1, 0 = -5l - 5b for l. 1 Solve -u - 213a + 210a - 34 = 0, 0 = -4u - 4a - 56 for u. -4 Solve 5r + 4f = 11, 0 = 3r - f - f + 11 for r. -1 Solve -4t - 2n = -30, 2595t + 20 = 2600t - n for t. 5 Solve 2f = -5d + 111 - 125, -f + 2d - 16 = 0 for f. -12 Solve 1280t - 11 = s + 2s + 1282t, 11t = 3s - 80 for s. 1 Solve -b = -4j + 10, 2j - b - 430 + 428 = 0 for j. 4 Solve 2z + 1152 = 52s, -5z - 130 = 317s - 322s for s. 22 Solve -8d + 2 = -4b - 11d, 4d + 8 = -8b for b. -2 Solve 69g - 954 = -3s, -35g + 4s + 2 = -36g for g. 14 Solve 6k = 4g + 6, 4g + 4 = -0k + 4k for k. 1 Solve 2a - 8 = -l, 693 = 3l - 2a + 677 for l. 6 Solve -46 = i - 4l - 23, i - 13 = -5l for i. -7 Solve -2r + 14 = -3r + 19, -12c - 29 = -r for c. -2 Solve 2m + 4 = 2y, 0 = 123m - 117m - 5y + 7 for m. 3 Solve 5124f - 5119f = -4k - 9, 2k - 5f - 3 = 0 for k. -1 Solve 6m - 3y - 417 = -348, 3y = -m + 29 for m. 14 Solve -24 = -13f - p, -5p - 8 = 15f - 14f for f. 2 Solve 3d = 572h - 571h - 4, 0 = 2h + 5d - 19 for h. 7 Solve 265i - 260i = 15, -4r = -i - 3 - 26 for r. 8 Solve 2p - 2750 = -z - 2760, -2z = -2p + 8 for z. -6 Solve 6 = 4f - 3k, -10 = -4f - 24k + 25k for f. 3 Solve 4r = 43g - 44g - 25, 0 = -5r + 3g - 10 for r. -5 Solve 6m + 16 = n, -4m - 68n = -66n for m. -2 Solve -5z = -3x + 66, -297z = -301z + 8x - 176 for z. 0 Solve -2i + 87 = 7j, 47 = 1903i - 1907i + 3j for i. -2 Solve -33v + 37v + 27 = 19x, -3v + x = 7 for v. -2 Solve -23a + 22a + 44 = -5u, 16 = -u + 2a for u. -8 Solve 0 = o + 2 + 3, 0 = 4s - o + 305 - 318 for s. 2 Solve 3t - 3q + 50 = 71, 0 = 4t - 5q - 3 - 28 for t. 4 Solve -5n + 55 = 0, -v + 3n - 15 - 16 = 0 for v. 2 Solve -a + 338d - 334d + 51 = 0, 43 = -3a - 2d for a. -5 Solve -95i + 6m - 4m - 8 = 0, -3m + 12 = 0 for i. 0 Solve 3y - 114 = -4u - 129, u = -14y - 17 for y. -1 Solve 0 = -3b - 2s + 16, 133s = -b + 136s - 2 for b. 4 Solve 74y - 2v + 14 = 71y, -4y + 2v - 12 = 0 for y. 2 Solve 34m = -h - 1, 9 + 0 = m - 4h + 5 for m. 0 Solve -3b - 218s = -217s - 1, 27 = 3b + 3s for b. -4 Solve 0 = -5t - 5m - 10, 11 = 527t - 529t + 5m for t. -3 Solve 4f = -3g - 30, 8f - 2g + 8 = 6f for f. -6 Solve p = 5t + 425790 - 425799, 0 = 4t + p for t. 1 Solve -21y + 23y + 2c = -4, -4y + 3c - 29 = 0 for y. -5 Solve 3i + 12 = c, 3i - 64 + 76 = -2c for i. -4 Solve 37c - 10 = 43c - t, 3c = 4t + 2 for c. -2 Solve -2t + u = 2, 4t + u + 51 = 53 for t. 0 Solve 3c + l = -0c, 101c = 99c + 6l - 20 for c. -1 Solve 0 = 50314v - 50313v - 5k + 61, -2v + 5k = 57 for v. 4 Solve 2m - 55 = 3h - 70, -6 = -5h - 3m for h. 3 Solve -5d + 5t - 15 = 0, -2d - 3d - 85 = -19t for d. 2 Solve -3j + 4m - 657 + 661 = 0, -m - 4 = 0 for j. -4 Solve 321u - 319u + 60 = -14p, -5p - 2u = 33 for p. -3 Solve -8 = 120r - 118r - 5w, -5r = -3w + 1 for r. 1 Solve -2k - 8027p + 2 = -8025p, 5p - 15 = 0 for k. -2 Solve -5o = 289n - 293n + 25, 5o - 5 = -2n for n. 5 Solve 24 = 4g + 2b, 413g - 30 = 408g - b for g. 6 Solve 0 = 4o + f + 1, 4o + 2102f - 2106f = 4 for o. 0 Solve -40 = -5s - 15b + 12b, 2s = 5b - 15 for s. 5 Solve 2j + 2d = 14, 1532d = -4j + 1537d - 26 for j. 1 Solve 25i - 22i + 6 = -3b, -b = -3i - 18 for i. -5 Solve -2g = 2a - 14, 4g + 61a - 66a + 8 = 0 for g. 3 Solve -2w + 46d + 16 = 44d, -4d = 3w + 11 for w. 3 Solve 16v - 18v + 5g + 17 = 0, -10 = 2g for v. -4 Solve 3t - 11770 = -3j - 11761, 0 = 3t + 6 for j. 5 Solve 0 = -2z - 5p - 13, 2685z - 2686z - 9 = 5p for z. -4 Solve 917r + 4 = 4g + 921r, -36 = -4g + 4r for g. 5 Solve 0 = p - 3h - 9, -5h - 159 + 144 = -5p for p. 0 Solve 3t = 3k + 33, -3k - 1725 = -5t - 1702 for t. -5 Solve 5f + 35 = -5a, -5f = 94a - 93a + 27 for a. -2 Solve -8 = -2a - 3l, 0 = a - 115963l + 115962l + 1 for a. 1 Solve 0 = 4i - 5j + 69, 16 = -4i + 3j - 51 for i. -16 Solve 45 = -5z + 5h + 20, -2h - 14 = 4z for z. -4 Solve i - 475 + 487 = 0, 3p = -0i - 2i - 9 for p. 5 Solve 0 = 3y - 5o - 5, -5y + 3o - 1158 + 1177 = 0 for y. 5 Solve 2a = -4l - 4, -21 = -13l + 8l + 4a for l. 1 Solve -t - 25 = -3v, 3t = 3v + 342 - 399 for t. -16 Solve -2r = -5d + 9, -43r = 32r - 13r - 496 for d. 5 Solve 5s - 5m = 20, 2s - 320m + 299m + 68 = 0 for s. 8 Solve -4k = s - 28, -3k = 440s - 442s - 32 for s. -4 Solve -61r - 4q = -52r + 93, -1 = 5r - 2q for r. -5 Solve 15954g - 15959g + 13 = -w, -3g - 21 = 9w for w. -3 Solve -s - 2z = 5, s - 318z = -313z + 9 for s. -1 Solve 2q - 320 + 322 = -y, -3y - 9q - 6 = 0 for y. -2 Solve 4n - 3h = 149 - 133, 2n - 10 = 2h for n. 1 Solve w = -31x + 7x - 74, 6 = -3w for x. -3 Solve 171330s - 171338s = 3x - 1, 0 = -4x + 3s - 26 for x. -5 Solve 2h - 8 = 0, 107s - 56s - 10h = 47s - 24 for s. 4 Solve 2j = -10, 5r - 9j = -10j + 4j for r. -3 Solve 35o - 32o + 3a - 48 = 0, 2a - 22 = 0 for o. 5 Solve 32 = 2h, -2n - 5508 = -5h - 5426 for n. -1 Solve -4 = -w, 36w - 34w = -5j + 28 for j. 4 Solve -4s + 7n + 90 = 0, -3s - 2s = 4n + 66 for s. -2 Solve 3s + 3z = -3681 + 3669, 3z + 16 = s for s. 1 Solve -3a = -z + 23, -2a + 130 = 3z + 149 for z. -1 Solve 0 = -4v + 727y - 729y + 12, -5v = -5y - 30 for v. 4 Solve 2s - 12 = -4f, -25f + s + 29 = -20f for f. 5 Solve -2p = -274x + 276x - 4, 4x = -7p + 2 for p. -2 Solve 0 = -7q + 3x - 82, 12 = 2q + 4x + 50 for q. -13 Solve 297n = 4q + 300n + 1, -q - 6n = -26 for q. -4 Solve 5x - 411p + 23 = 3x - 6x - 414p, -3x - 4p = 0 for x. -4 Solve 3901d = 3899d - c + 3, -15 = -3d - 5c for d. 0 Solve y + 151a - 155a + 14 = 0, -82 = y - 21a for y. 2 Solve 16x + 2m = 8, 143x = 148x + 5m - 20 for x. 0 Solve 4o - 66 = 3x, -14x - 177 - 190 = o for x. -26 Solve 5 = 2h - 6h - 3y, -11h + 3y = -20 for h. 1 Solve 3a = -2q -	{ "pile_set_name": "DM Mathematics" }
Find the third derivative of 2w2 - 22w*6 - 378 + 4w*2 + 378 wrt w. -2640w*3 Let o be (-65)/7 + 32/112. Let j(t) = -28t*2 - 9t + 16. Let s(l) = -7l2 - 2l + 4. Let h(n) = os(n) + 2j(n). Differentiate h(f) with respect to f. 14f Let x(y) be the first derivative of 5y*3 + 6y*2 - 5. What is the second derivative of x(r) wrt r? 30 Let d = 8 - 6. What is the first derivative of 80m*d - 2m*3 - 1 - 80m*2 wrt m? -6m*2 Let t(i) be the third derivative of -19i5/60 - i4/2 + 21i2. What is the second derivative of t(f) wrt f? -38 Let w(t) = 5t*4 + 5t*3 + 4t2 - 5. Let p(v) = v5 + v4 + v3 + v*2 - 1. Let y(s) = 5p(s) - w(s). What is the third derivative of y(o) wrt o? 300o2 Let t(i) be the first derivative of i8/560 + i4/6 + 4i*3/3 - 2. Let c(v) be the third derivative of t(v). Differentiate c(r) wrt r. 12r*3 Find the second derivative of 6w*3 - w + 617w*2 + 7 - 28w*3 - 615w*2 wrt w. -132w + 4 Suppose 4r - 5q - 2 = 6, 2r = 4q + 4. Let h(o) be the first derivative of 0o3 + 2 - 3/4o*4 + 0o*r - 3o. Differentiate h(u) with respect to u. -9u2 Suppose -4t + 125 = t. Let o = t - 11. Differentiate 3 + of3 - 10f*3 + 0 wrt f. 12f*2 Suppose 5k - 12 - 3 = 0. What is the second derivative of l*2 - kl - 3l2 + l2 - l2 wrt l? -4 Let s(y) = -y3 + 4y*2 + 6y - 2. Let n be s(5). Suppose 4o - n = o. What is the second derivative of -h4 - 2h + 1 - o wrt h? -12h2 Let h(u) = -u2 + 4u + 3. Let l(n) = 2n2 - 5n - 4. Suppose -3t - 3 = -18. Let m(v) = th(v) + 4l(v). What is the derivative of m(w) wrt w? 6w Let z(j) be the second derivative of -j*4/24 + 2j*3/3 - 3j*2/2 + 2j. Let y(k) be the first derivative of z(k). What is the first derivative of y(u) wrt u? -1 Let a(m) be the third derivative of -m*7/30 - 4m*5/15 + 7m*2. Find the third derivative of a(o) wrt o. -168o Let b be 14 - 6/93. Suppose -4t = v - 8t - 11, -3t - b = -2v. What is the third derivative of vq*2 + 0q*3 - 2q3 + q3 wrt q? -6 Let i(s) = -s*3 - s + 1. Let c be -3(1/1 - 0). Let z(t) = 3t4 - 3t*3 - 3t + 5. Let l(w) = ci(w) + z(w). Find the first derivative of l(a) wrt a. 12a3 Let p be (60/(-25))/(4/(-10)). What is the third derivative of x2 - 4x3 - 2x*2 + px*2 wrt x? -24 Let a(y) = 3y*2 - 2y + 3. Let q(r) = -r + 1. Let s(j) = -a(j) + 2q(j). Find the first derivative of s(o) wrt o. -6o Let q(v) = -22v3 + 30v*2 + 17. Let k(c) = 7c*3 - 10c*2 - 6. Let z(s) = 17k(s) + 6q(s). What is the third derivative of z(x) wrt x? -78 Let t(d) = d + 1. Let n(g) = -17g - 23. Let m(y) = n(y) + 2t(y). What is the derivative of m(p) wrt p? -15 Let l(u) = -9u*2 - 24u - 1. Let b(s) = -s + 1. Let r(z) = -b(z) - l(z). Find the second derivative of r(d) wrt d. 18 Let k(g) = 1. Let t(f) = f*2 - 5. Let l(r) = 18k(r) + 4t(r). What is the first derivative of l(v) wrt v? 8v Let m(l) be the first derivative of l*6/2 - 5l*2/2 - 3. What is the second derivative of m(s) wrt s? 60s*3 Let u(h) be the second derivative of -14h*6/15 + 5h*3/2 - 10h. What is the second derivative of u(s) wrt s? -336s2 Let o(h) be the first derivative of -h6/30 + 5h*3/6 + 2h*2 - 4. Let n(d) be the second derivative of o(d). Find the first derivative of n(u) wrt u. -12u2 Let n be (-2)/3 + 39/(-9). Let x = -2 - n. What is the third derivative of -t5 - x - 3t2 + 3 wrt t? -60t*2 Let t = 10 - 4. Find the third derivative of 3j2 + jt - j*2 - 3j*6 wrt j. -240j*3 Let o(y) = 30y*4 + 8y - 26. Let f(z) = z - 1. Let d(b) = 8f(b) - o(b). Differentiate d(j) with respect to j. -120j3 Let u(g) be the first derivative of g4/12 + g*2 - g - 1. Let f(d) be the first derivative of u(d). Differentiate f(c) with respect to c. 2c Let b be (-1 - -4)(-2 - -3). Suppose -2 = -4m + bm. Find the second derivative of -2k + 2k2 - 2k2 + km wrt k. 2 Let q(g) = 16g - 12. Let w(b) = b + 1. Let v(z) = -q(z) + 3w(z). What is the derivative of v(t) wrt t? -13 Let u = -25 + 25. Let f(m) be the third derivative of 0m - 2m*2 + 0m*5 + 0 + um*3 - 1/24m*4 - 1/60m*6. Find the second derivative of f(t) wrt t. -12t Let a(j) = -j*2 - 13j + 2. Let c(s) = -s*2 + 1. Let o(z) = -a(z) + 2c(z). What is the second derivative of o(q) wrt q? -2 Let b(t) be the second derivative of 2t6/15 - 4t*3/3 + t. Find the second derivative of b(a) wrt a. 48a*2 Let w(a) = 4a*2 + 4. Let f = 2 + -4. Let v(p) = -1. Let s(c) = fv(c) - w(c). Differentiate s(g) wrt g. -8g Let j(k) be the first derivative of -3k*2/2 + 6k + 6. What is the first derivative of j(m) wrt m? -3 Let y(d) = d4 + d3 - d2 - d + 1. Let j(i) = -i4 + 2i3 - 4i*2 - 2i + 2. Let r(p) = j(p) - 2y(p). What is the third derivative of r(m) wrt m? -72m Let v(s) = -s*3 - 8s*2 - s - 6. Let d be v(-8). What is the first derivative of 3 - 25q*d + 25q2 + q3 wrt q? 3q2 Let j(x) be the first derivative of 29x*4/4 - 47x - 28. What is the derivative of j(q) wrt q? 87q2 Suppose -3q = q - 24. Let l = 9 - q. Find the third derivative of -p*2 - lp*3 + 4p2 - p2 wrt p. -18 Let v(o) be the second derivative of 0o3 - o + 0 + 0o*5 + 1/14o*7 + 0o*6 + 1/4o*4 + 0o*2. What is the third derivative of v(a) wrt a? 180a2 Find the second derivative of i2 + 5i2 + 5i - i - i2 wrt i. 10 Let q be (-2)/(-4) + 10/20. What is the first derivative of -4 + q - j3 - 1 wrt j? -3j2 Let n be (-6 - -6 - 1) + 0 + 0. Let d(s) = s4 - 3 + 3. Let g(h) = -h4 - 3. Let f(q) = ng(q) - 3d(q). Differentiate f(x) with respect to x. -8x*3 Let k(h) = 2h*2 - 8h + 4. Let m be k(6). Find the third derivative of 0y2 + my*5 - 27y*5 - 3y*2 wrt y. 60y*2 Let q be 4/6(-3 + 6). Differentiate 3a3 - qa*3 - 3a*3 - 4 + 5 with respect to a. -6a*2 Suppose 2j = j + 2. What is the second derivative of -6r + r3 + jr + 6r wrt r? 6r Suppose 2o + 1 = 5. Let c(i) be the first derivative of -1/4i*4 - i + 0i*3 - o + 0i*2. What is the derivative of c(m) wrt m? -3m*2 Let p(a) be the third derivative of -3a*2 + 0a*5 + 0a*3 + 1/40a*6 + 0a + 0 - 1/24a4. Find the second derivative of p(w) wrt w. 18w Suppose q + 2 + 19 = 2t, 0 = 4t - 4q - 44. Let c = t - 7. What is the third derivative of -7m*2 + 2m*6 - cm*6 + 8m*2 wrt m? -120m*3 Let w(p) be the third derivative of 29p*7/210 - 31p*5/60 + 4p*2. Find the third derivative of w(s) wrt s. 696s Let f(c) be the first derivative of c*5 - 5c*2/2 - 1. What is the second derivative of f(b) wrt b? 60b*2 Suppose 5k + 2 = k - 2x, 2k + 5x = -21. Differentiate 4l + 6 + 0l - kl - 3 wrt l. 2 Let a(f) = 4f4 + 5f2. Let b(u) = -u4 + 0u2 - u4 + 4u*2 + 5u*4. Let x(r) = 6a(r) - 7b(r). Find the third derivative of x(g) wrt g. 72g Let o(v) = -v*2 - 1. Let b be -1 + (0/1)/2. Let f(i) = -3i*2 + i - 6. Let a(n) = bf(n) + 6o(n). What is the second derivative of a(k) wrt k? -6 Let h be ((-12)/(-10))/((-15)/(-50)). Suppose -hm - 2 = 4p - 14, -2m + 6 = -5p. What is the second derivative of -mv*5 + 0v + 2v + 2v*5 wrt v? -20v*3 Let p(j) be the second derivative of -1/2j*4 + 0 - 7j + 0j3 + 0j*2 - 1/4j*5. Find the third derivative of p(u) wrt u. -30 Let o(u) = u + 13. Let j be o(-11). What is the second derivative of -5f - f - 5f5 + jf5 - f5 wrt f? -80f3 Let c(y) be the first derivative of -1/2y*3 + 0y + 2y2 + 3 - 1/6y*4. Let b(i) be the second derivative of c(i). Differentiate b(u) wrt u. -4 Let w(n) = 22n - 25. Let o(x) = -22x + 25. Let b(m) = -5o(m) - 4w(m). Differentiate b(q) with respect to q. 22 Let z(p) be the second derivative of 3/10p*5 + 6p + 0p3 + 0 + 0p*2 - 1/3p4. Find the third derivative of z(m) wrt m. 36 Let z(g) be the first derivative of -g4 + 0g2 - 11 + 11/3g*3 + 0g. Find the third derivative of z(o) wrt o. -24 Suppose 2i + 2 = -2f - 4, -4f = i. Let w be 48/26 + i/(-26). Find the second derivative of 2h*2 + 4h + 0h + hw wrt h. 6 Let u(k) = k2 + 3k*2 + 3 - 4k3 + k3 - 4k. Let p(j) = 4j*3 - 5j*2 + 5j - 4. Let r(t) = 4p(t) + 5u(t). Find the first derivative of r(z) wrt z. 3z*2 Let x(	{ "pile_set_name": "DM Mathematics" }
4 + 2)(-22012u - 353u - 1265u + 345u - 4083u) in the form vu + f and give v. 54736 Express (129 - 82s - 129)(1 + 0 + 0)(-42s - 32s + 53s)(4 - 3 + 1) as qs2 + vs + c and give q. 3444 Express ((1 + 3 - 3)(6 - 9 + 20) - 1 + 3 - 3 + 11 + 8 - 22 + (1 + 0 + 3)(3 + 3 - 5))(j - 1 + 1) in the form o + kj and give k. 17 Rearrange 215j2 + 6 - 6 - 1 - 34j - 45j + 64j to d + vj + tj*2 and give t. 215 Express 2x + 2479x2 - 7x + 3x - 1766x*2 - 3 in the form f + ux*2 + kx and give k. -2 Express 10 + 238w + 249w - 483w as k + iw and give k. 10 Rearrange -7006n + 11211 + 11203 + 11212 - 33626 to o + sn and give s. -7006 Rearrange (-7 + 11 - 12)(4 - 2 + 0)(q*2 - 3q2 + q2)(-16 - 28q - 51q + 92q - 4q2) to l + pq + cq4 + kq*2 + fq*3 and give f. 208 Rearrange 38 - 105d + 253d + 4d2 + d2 - 141d to ld*2 + r + hd and give l. 5 Rearrange -30 + r + 16 + 8 - 25 + 25 - 2r + (-4r + 5r - 3r)(4 + 1 - 3) - 3 - 5r + 3 to the form or + h and give h. -6 Rearrange (19 - 17u - 19)(2 - 4 + 0)(2u + 50u + 2 + 22u) to cu*2 + d + bu and give b. 68 Rearrange 32638f2 + 32600f*2 - 3711f - 65239f2 to the form y + if + df2 and give d. -1 Rearrange -4153 - 43o + 39o + 1085 to the form t + xo and give x. -4 Rearrange (-15v2 - 13v*2 + 233v - 234v)(24v + 2070 - 2070)(-9v - 28 + 28) to sv*4 + fv*2 + r + av + iv3 and give s. 6048 Express (5 - 5 + 2)(-1166 - 14059o3 + 28114o*3 - 14056o*3) in the form bo + w + do3 + go*2 and give d. -2 Rearrange 16s - 42s + 12s + 4s + 3143 + 8s to the form f + hs and give f. 3143 Express -4f + 1147 - 3f - 2f*2 + 1139 + 1144 - 3420 as jf + bf2 + w and give j. -7 Rearrange -6i*4 - i + i + (0i*4 - 2i*4 + 6i*4)(13 + 88 + 228) to ai + yi*4 + c + qi*2 + mi*3 and give y. 1310 Rearrange v - 4v + 4v - 423v*2 - 422v*2 - 238v*2 to the form uv + a + yv2 and give u. 1 Express 2223d*3 - 2220d*3 - 13d*4 - 7d + 2d2 - 5d as bd4 + yd*3 + kd + o + nd2 and give y. 3 Rearrange (-7 + 6 + 5)(s - 3s + 3s)(-371560 - 2078s + 371560)(s - s - 4s*2) to the form bs*4 + ts*3 + as + ds2 + k and give b. 33248 Express 6s - 35s3 - 3157s*2 + 3082s*2 + 82s*3 + 1 - 41s*3 as ps*2 + d + ls*3 + ys and give y. 6 Rearrange -268h + 268h - 57 + 16h2 + 53 to f + dh + zh2 and give f. -4 Express ((-1 - 5 + 3)(3 + 2 - 4) - 1 - 2 + 1)(-4297359 + 4297359 - 10259o) in the form yo + x and give y. 51295 Rearrange -v4 + 17v*2 + 10 + 5 - 3671v - 9v2 - 2v*2 + 3669v to the form zv3 + i + hv + fv4 + rv*2 and give r. 6 Express -8 + 0 - 3f*2 + 9 + 46f*3 + 0f - f*4 - 17f*3 + f as df*3 + z + af*2 + pf*4 + xf and give p. -1 Express 21q2 - 22q*2 + 11q*2 - 258 - 291 + 3q*2 in the form gq + yq2 + b and give b. -549 Express -4280b + 119b3 - 4b3 + b2 + 4274b in the form wb + yb2 + ob*3 + j and give w. -6 Express (216 - 1304g + 1435g - 218 + 2672g)(-3 - 8 + 24) as j + qg and give q. 36439 Express (-4 + 4 + 6m)(-3m + 5m - 4m)(214 - 57 + 576) as w + um2 + km and give u. -8796 Express 307k2 + 0k - 330k2 + 2 + 0k + k*3 in the form o + rk*2 + hk*3 + fk and give o. 2 Rearrange -271a + 26 - 234a + 515a - a2 to the form ba*2 + w + ga and give b. -1 Express 7w4 + 0w3 - w3 + 1 - 6w4 - 81w - 87w - 3 in the form uw*3 + yw*2 + lw*4 + mw + b and give b. -2 Rearrange 6222 - 12475 + 6256 - 8095l2 to tl + j + il2 and give j. 3 Rearrange z4 + 122z3 + z2 + 5662 - 120z3 + 3z - 5666 + 2z to nz + lz3 + qz*4 + fz2 + c and give l. 2 Express (0 + 0 - r2)(140 + 49r - 19r - 26r) in the form nr3 + cr + a + yr2 and give y. -140 Express 8y + 6 + 70y + 223y + 20 - 31 in the form h + oy and give h. -5 Express -82530k*3 - 103k*4 + 2k*2 + 595k*4 + 82529k*3 - 3k in the form q + yk + fk*3 + dk*2 + uk*4 and give y. -3 Express -615k*2 + 1014k*2 + 2137k*2 as w + xk + ik2 and give i. 2536 Rearrange -3m - 1041m3 - 1071m*3 - 135m*2 + 2113m*3 to km + z + am2 + vm*3 and give a. -135 Rearrange (-3c - c*2 + 3c)(-2 - 2c + 2) + 18404c3 - 9354c*3 + 13751c*3 to the form nc*2 + fc*3 + vc + z and give f. 22803 Rearrange 611646x + 4 - 5 - 611638x - 9x2 to px + c + ix2 and give p. 8 Rearrange 17526 + 784 - 2o*2 - 616 to wo + f + lo2 and give w. 0 Express -r2 + 16r + 169r4 + 3r*3 - 4r*3 - 444r*4 + 273r*4 as fr*3 + tr*2 + gr + br4 + o and give g. 16 Express (-4q*2 - 41q*2 + 91q*2)(-2 + 2 + 2q)(-5 - 12 - 1) as hq2 + dq + b + oq3 and give o. -1656 Express (0h - 5h + 2h)(5570 - 2h - 2866 - 3049) in the form kh2 + c + xh and give k. 6 Rearrange -1296k - 57k - 1694k - 603k to sk + z and give s. -3650 Express (12x*2 + 7x*2 - 16x*2)(2 - 2 - 4x) + 12x*3 - 27x*3 + 7x*3 in the form yx*3 + n + sx + lx2 and give y. -20 Rearrange 1 - 1734w*2 - 7501w + 7501w to jw + z + tw2 and give t. -1734 Rearrange -15j*2 - 114j + 12j2 + 1 + 37j to the form q + wj + bj*2 and give q. 1 Express -68r + 30r + 5r*3 + 80r + 4r3 - 2 as pr*2 + lr + wr3 + q and give l. 42 Express (-1090 - 944 - 1095 + 895)(2f + 0 + 0) in the form wf + q and give w. -4468 Rearrange 3694r2 + 64628 - 64628 to the form kr + t + xr2 and give t. 0 Rearrange -45q + 37 - 59 + 43q - 2q*2 + 19 - 645q*3 to aq*3 + xq + c + mq2 and give x. -2 Rearrange (1 - 4 - 2)(3n - 6n + 36n) - 9 + 5n + 9 + (-6n + 0n - n)(4 - 3 - 2) - 3n + 0n + 2n to the form u + rn and give r. -154 Rearrange 7933z*2 + 31408z + 16398z2 - 31408z - 900z2 to the form lz*2 + dz + o and give l. 23431 Rearrange -3b3 - 4b3 + b4 + 12598 - 12604 + 0b3 - b2 - 7b*3 to the form gb*2 + wb*4 + cb + j + tb3 and give t. -14 Express 586m*2 + 247m*2 - 259m*2 + (-3m + 2m - m)(-3 - 1 + 2)(-3m - 3m + 9m) in the form zm + am*2 + t and give a. 586 Express -6 + 1 - 11k - 2k - 4 + 3 in the form uk + r and give u. -13 Rearrange -2 - 10b + 620b2 - b3 + 11b - 560b*2 - 2b*4 to mb + sb2 + o + pb*3 + zb*4 and give z. -2 Rearrange 2507418 + 0h3 + h3 - 2503848 to qh2 + d + th*3 + kh and give q. 0 Express (-w*2 + 2w*2 - 3w*2)((0 - 2 - 2)(3 + 3 - 5) + 4 - 3 + 6)(0w - 3 + 0w + w) as qw + kw*2 + bw*3 + z and give k. 18 Rearrange 98 + 2t*2 - 45t*3 + 126 - 420 + 5t*4 + 2t + 96 + 99 to the form bt2 + i + pt*4 + dt + mt3 and give b. 2 Express (-16 + 10 - 11)(0o + 4o + 0o)(o2 + o2 - 6o + o2) as qo*2 + wo*3 + s + ko and give w. -204 Express -72 - 31053z - 31058z + 62117z as m + dz and give m. -72 Rearrange (43p2 - 17p*2 - 261p*2)(1 + 4 - 3 + (3 + 1 - 5)(1 - 4 + 5) - 1 - 3 + 2) to the form vp + xp2 + i and give x. 470 Express (4o - o - 2o)(0o + 2o - o) + o*2 + 10o*2 - 8o*2 + (-97o + 6o - 95o)(-o + o - o) in the form to + s + no2 and give n. 190 Express 79p*3 - 4p + 251p3 - 15p*3 - 2p*2 + 7p - 73p3 - 3 as r + gp*2 + wp + fp3 and give r. -3 Rearrange -10a3 - 9225 - a2 - 9222 + 18450 - 22a to the form ja*2 + ya + p + xa3 and give j. -1 Rearrange (0a - 7a - 20a)(86a + 188 - 188 + (-a + 5a - 2a)(0 - 1 + 0)) to u + za*2 + ga and give g. 0 Express -133046 + 133046 - 1018q2 - 556q*2 in the form k + aq*2 + cq and give a. -1574 Express 33502a3 + 2a - 3 - 33251a3 - 4a - 2a2 - 3a*4 - 2a in the form da4 + ca*2 + ra + q + ja3 and give r. -4 Express 1443a*3 - 38a - 5a - 180 - 1448a*3 - 3a*2 + 181 + 2a*2 as h + sa + oa2 + ca*3 and give o. -1 Rearrange -52 - 50 + 2p - 34 - 2707p2 + 136 to ip*2 + cp + t and give t. 0 Express 210 - 625 + 204 + 88d + 205 - 2073d in the form o + cd and give c. -1985 Rearrange 472q - 454q + 12q*3 - 13q*3 + 58q*2 to the form uq*2 + kq*3 + gq + y and give u. 58 Rearrange (683w2 + 672w*2 - 1355w*2 + 4311w*3 + 4155w*3)(-2w + 4 + 3 - 2) to nw*3 + o + gw + qw4 + hw*2 and give q. -16932 Express 4v*	{ "pile_set_name": "DM Mathematics" }
78061? 0 What is the tens digit of 2030? 3 What is the tens digit of 19459? 5 What is the thousands digit of 16975? 6 What is the hundreds digit of 9858? 8 What is the hundreds digit of 574? 5 What is the hundreds digit of 1980? 9 What is the tens digit of 2308? 0 What is the thousands digit of 185455? 5 What is the units digit of 140? 0 What is the tens digit of 391? 9 What is the tens digit of 349? 4 What is the tens digit of 48125? 2 What is the units digit of 2657? 7 What is the tens digit of 10883? 8 What is the thousands digit of 1152? 1 What is the hundreds digit of 3615? 6 What is the ten thousands digit of 85298? 8 What is the hundreds digit of 1885? 8 What is the units digit of 1140? 0 What is the hundreds digit of 371? 3 What is the units digit of 10556? 6 What is the hundreds digit of 1060? 0 What is the units digit of 967? 7 What is the ten thousands digit of 24208? 2 What is the tens digit of 12684? 8 What is the units digit of 4864? 4 What is the tens digit of 1852? 5 What is the units digit of 7882? 2 What is the units digit of 5502? 2 What is the units digit of 261? 1 What is the units digit of 16418? 8 What is the hundreds digit of 20992? 9 What is the thousands digit of 4020? 4 What is the hundreds digit of 40258? 2 What is the tens digit of 376? 7 What is the hundreds digit of 1213? 2 What is the tens digit of 467? 6 What is the tens digit of 1197? 9 What is the hundreds digit of 116837? 8 What is the thousands digit of 6324? 6 What is the ten thousands digit of 170967? 7 What is the tens digit of 25448? 4 What is the units digit of 2632? 2 What is the thousands digit of 17618? 7 What is the tens digit of 6071? 7 What is the units digit of 1286? 6 What is the hundreds digit of 584? 5 What is the thousands digit of 7966? 7 What is the hundreds digit of 90662? 6 What is the hundreds digit of 5051? 0 What is the tens digit of 3061? 6 What is the tens digit of 237? 3 What is the units digit of 3920? 0 What is the tens digit of 9467? 6 What is the hundreds digit of 1041? 0 What is the hundred thousands digit of 128489? 1 What is the tens digit of 2460? 6 What is the thousands digit of 1567? 1 What is the units digit of 13355? 5 What is the units digit of 1622? 2 What is the units digit of 3340? 0 What is the tens digit of 11394? 9 What is the ten thousands digit of 50493? 5 What is the units digit of 502? 2 What is the units digit of 2659? 9 What is the tens digit of 1856? 5 What is the units digit of 543? 3 What is the hundreds digit of 1256? 2 What is the tens digit of 97298? 9 What is the tens digit of 1024? 2 What is the units digit of 11509? 9 What is the tens digit of 894? 9 What is the units digit of 1043? 3 What is the units digit of 3189? 9 What is the hundreds digit of 2533? 5 What is the tens digit of 30153? 5 What is the units digit of 1567? 7 What is the hundreds digit of 50966? 9 What is the units digit of 3129? 9 What is the thousands digit of 46873? 6 What is the hundreds digit of 548? 5 What is the hundreds digit of 8126? 1 What is the tens digit of 1511? 1 What is the units digit of 9496? 6 What is the hundreds digit of 1558? 5 What is the hundreds digit of 2712? 7 What is the hundreds digit of 17591? 5 What is the tens digit of 2773? 7 What is the tens digit of 911? 1 What is the tens digit of 504? 0 What is the units digit of 432? 2 What is the hundreds digit of 335? 3 What is the hundreds digit of 346? 3 What is the tens digit of 3662? 6 What is the tens digit of 1257? 5 What is the tens digit of 2571? 7 What is the units digit of 36561? 1 What is the units digit of 30018? 8 What is the tens digit of 139027? 2 What is the units digit of 766? 6 What is the thousands digit of 5481? 5 What is the units digit of 7378? 8 What is the thousands digit of 1571? 1 What is the ten thousands digit of 136202? 3 What is the units digit of 5253? 3 What is the units digit of 40355? 5 What is the tens digit of 470? 7 What is the thousands digit of 5994? 5 What is the units digit of 2642? 2 What is the hundreds digit of 1694? 6 What is the thousands digit of 1668? 1 What is the units digit of 43867? 7 What is the thousands digit of 2252? 2 What is the thousands digit of 11801? 1 What is the units digit of 1931? 1 What is the units digit of 146382? 2 What is the units digit of 2971? 1 What is the thousands digit of 3999? 3 What is the ten thousands digit of 90608? 9 What is the tens digit of 31329? 2 What is the tens digit of 10602? 0 What is the thousands digit of 31929? 1 What is the thousands digit of 21932? 1 What is the hundreds digit of 12944? 9 What is the thousands digit of 11068? 1 What is the thousands digit of 79988? 9 What is the ten thousands digit of 17725? 1 What is the ten thousands digit of 20129? 2 What is the ten thousands digit of 121959? 2 What is the hundreds digit of 549? 5 What is the hundreds digit of 194? 1 What is the hundreds digit of 78011? 0 What is the tens digit of 2431? 3 What is the thousands digit of 3207? 3 What is the hundreds digit of 5343? 3 What is the tens digit of 760? 6 What is the hundreds digit of 5589? 5 What is the units digit of 105695? 5 What is the hundreds digit of 1884? 8 What is the hundreds digit of 8568? 5 What is the units digit of 7881? 1 What is the units digit of 10985? 5 What is the units digit of 1428? 8 What is the thousands digit of 85220? 5 What is the ten thousands digit of 67945? 6 What is the units digit of 2496? 6 What is the thousands digit of 4862? 4 What is the ten thousands digit of 11251? 1 What is the tens digit of 14880? 8 What is the hundreds digit of 12470? 4 What is the hundreds digit of 3331? 3 What is the thousands digit of 1047? 1 What is the hundreds digit of 3952? 9 What is the hundreds digit of 158? 1 What is the ten thousands digit of 24903? 2 What is the hundreds digit of 68053? 0 What is the units digit of 1072? 2 What is the thousands digit of 5639? 5 What is the units digit of 16000? 0 What is the ten thousands digit of 63694? 6 What is the units digit of 243? 3 What is the tens digit of 5998? 9 What is the hundreds digit of 3899? 8 What is the thousands digit of 77711? 7 What is the units digit of 49455? 5 What is the tens digit of 4305? 0 What is the units digit of 1429? 9 What is the thousands digit of 23116? 3 What is the units digit of 43849? 9 What is the hundreds digit of 422? 4 What is the units digit of 32703? 3 What is the thousands digit of 16832? 6 What is the units digit of 633? 3 What is the thousands digit of 27729? 7 What is the units digit of 3640? 0 What is the ten thousands digit of 53689? 5 What is the tens digit of 753? 5 What is the thousands digit of 2090? 2 What is the ten thousands digit of 62278? 6 What is the hundreds digit of 5534? 5 What is the units digit of 69351? 1 What is the hundreds digit of 97852? 8 What is the hundred thousands digit of 126965? 1 What is the ten thousands digit of 12481? 1 What is the units digit of 240? 0 What is the thousands digit of 14522? 4 What is the units digit of 3480? 0 What is the tens digit of 1909? 0 What is the units digit of 1795? 5 What is the tens digit of 190? 9 What is the units digit of 38941? 1 What is the units digit of 375? 5 What is the units digit of 80? 0 What is the tens digit of 1428? 2 What is the ten thousands digit of 31622? 3 What is the hundreds digit of 384? 3 What is the hundreds digit of 95554? 5 What is the units digit of 6? 6 What is the hundreds digit of 2423? 4 What is the thousands digit of 63256? 3 What is the tens digit of 8271? 7 What is the thousands digit of 1426? 1 What is the units digit of 6404? 4 What is the thousands digit of 15382? 5 What is the tens digit of 59043? 4 What is the hundreds digit of 11508? 5 What is the hundreds digit of 1016? 0 What is the hundreds digit of 833? 8 What is the units digit of 3134? 4 What is the thousands digit of 2298? 2 What is the tens digit of 12344? 4 What is the tens digit of 39124? 2 What is the units digit of 3580? 0 What is the thousands digit of 1134? 1 What is the units digit of 201? 1 What is the hundreds digit of 26437? 4 What is the hundreds digit of 7319? 3 What is the tens digit of 7708? 0 What is the hundreds digit of 4081? 0 What is the hundreds digit of 20929? 9 What is the units	{ "pile_set_name": "DM Mathematics" }
e ((-2)/(-2))/(7/28). Let j be (z/(-10))/(153/(-15)). Let p = j - 59/204. Are 1 and p equal? False Let o(d) = d*2 + 3d - 2. Let m be o(-4). Let w be -13/6m. Is 1 less than or equal to w? False Let i = -22 + 25. Let j = -0.6 + 3.7. Let a = i - j. Which is smaller: a or 0? a Let g = -0.1 - -0.15. Let y = -0.09 - 0.16. Let q = y + g. Which is greater: q or -2? q Suppose -z - 5 = 0, -9z = 5t - 4z. Suppose 8 = -r + tp - 12, 0 = r + 3p - 12. Which is greater: -2/9 or r? r Let z(f) = -2f3 - f2 - 1. Let x be z(-2). Suppose 13v - 5g - 5 = 12v, 4v - g - 39 = 0. Is x >= v? True Suppose -9u = -8u + 2. Suppose 3f = 3l, 2l = f - 5 - 0. Is l not equal to u? True Let t be 6/244/1. Let l(g) = g*3 + g + 4g*2 + 5g + 0g + 4g*2 - t. Let p be l(-7). Are p and -1 non-equal? True Let s be -1 - 170/(-8) - 27/108. Which is greater: s or 41/2? 41/2 Let o = -4 - -4. Are 8/15 and o equal? False Let v be ((-3)/(-9))/((-14)/(-12)). Is 1/4 bigger than v? False Suppose g = -3g. Which is bigger: g or -1/4? g Let m = 75 - 77. Which is bigger: -6/7 or m? -6/7 Let m = 62/195 - -1/65. Is 7 at least as big as m? True Let m = 37 - 32. Which is smaller: 4 or m? 4 Let u = -9778/11 - -890. Do 1 and u have the same value? False Let d be ((-3)/6)/((-2)/(-4)). Let n(m) = -2m + 12. Let w(p) = -2p + 12. Let b(t) = 7n(t) - 6w(t). Let z be b(6). Which is smaller: z or d? d Let j = 2497 + -262187/105. Is j at least as big as 0? False Let j = 0.21 + -0.22. Which is bigger: 3/4 or j? 3/4 Suppose 3f = t - 4t + 3, -5t = 4f - 1. Suppose 0 = fj - j + 6. Which is smaller: j or -8/7? j Suppose -2x - 2j = 10, -2j = 7x - 2x + 13. Which is smaller: x or -65? -65 Let j = 9 + -9. Let o be (-34)/(-6) - 4/6. Suppose om + 6 - 1 = 0. Is m greater than or equal to j? False Let b be 22 + (-12)/((-4)/(-1)). Suppose -b - 1 = -4t. Is 5 greater than t? False Let m = 15 - 11. Suppose 9n = mn - 25. Let a = 8 + n. Are -2 and a nonequal? True Suppose j = 4j - 3. Let h = j + 0. Let b be (h - (-7)/(-3))/2. Which is bigger: 0 or b? 0 Suppose g + 10 = 5i, 3g + 21 - 4 = 2i. Suppose f + 4 - i = 0. Suppose -4w - 19 = 3p, -2p - 2w - 14 = 2w. Which is smaller: p or f? p Let u = -6 + 8. Suppose 0 = ur - 4r. Let k be r/2 + 1/2. Is k at most 1? True Let d = 1.1 + -1. Which is smaller: 0.03 or d? 0.03 Let h = 0.16 - 0.16. Is h at least as big as 2/67? False Let q(l) = l3 + 5l*2 + l + 7. Let h be q(-5). Let k be h/(-1) - (-1 + -2). Let p = 61/161 + -12/23. Is k bigger than p? True Suppose -q - 29 = 2i, -i - 14 = q - 4i. Which is bigger: -22 or q? -22 Let l be 2/3 - (-3792)/(-42462). Let p = l + -2/337. Let c be (-12)/54 + 4/18. Is c < p? True Let f = -0.317 + 0.217. Let v = -1 - 0. Is v >= f? False Let t be -1(-3 - -2) + -2. Let k be ((-6)/8)/(2/(-136)). Let a = 460/9 - k. Which is bigger: a or t? a Let b = -11.97 + 12. Let f = b - -0.17. Which is smaller: f or 0? 0 Let s = -15 + 14.9. Which is greater: -0.8 or s? s Let u be (12/(-24))/(5/2). Let a(v) = -v*3 - 2v*2 + 2v + 3. Let z be a(-2). Let g be z/(2/(-2) + 0). Is u smaller than g? True Let g be (-2)/1896/(-16). Let v = 48 - 145/3. Which is smaller: g or v? v Let r be (-5)/(-1)12/15. Let x be (r/(-18))/((-10)/(-15)). Which is smaller: 2/17 or x? x Let r be 1 - ((-7)/(-3) - 2). Let z = -5 + 9. Suppose 3k = 5h, 2h = -2k + zk. Which is bigger: k or r? r Let z be (-1)/(-70)(-15 - -9). Which is greater: 2/3 or z? 2/3 Let t = 0.048 + -11.048. Which is smaller: -1 or t? t Let w be ((-18)/33)/3 - 20/495. Which is greater: 0.27 or w? 0.27 Let g = -0.2 - 0. Let b = 0.2 + -2.2. Is g < b? False Suppose 0 = -4k + 4d + 36, 4k - 2 - 4 = -2d. Suppose -ks = q - 4, -2s + 2 = -q + 3q. Let z be 1 - s - 2/2. Which is greater: -2/15 or z? -2/15 Let j be 4/14 + 58/(-7). Let s be (j/90)/((-6)/(-15)). Let g = -13.1 + 13. Which is smaller: g or s? s Let k = 1399 - 11165/8. Is k > 4? False Let d = -10 + 16. Let i(b) = -b3 - 14b*2 + 14b - 12. Let h be i(-15). Suppose -h = o - 1, -o = -x + d. Which is bigger: x or 5? 5 Suppose -19 + 4 = -5p. Let t(g) = g - 3 - 3g*2 + 2 - pg. Let b be t(-1). Are b and -2 nonequal? False Let v(q) be the second derivative of q*4/12 - 5q*3/3 - 11q*2/2 - q. Let w be v(11). Let g = 4 + -3. Which is bigger: w or g? g Let o = -31 - -33. Let j(s) = 3s + 2. Let h be j(-2). Is o at least h? True Suppose 0 = -4w + 2r + 8, 4w - 3 = 3w + r. Let x be 3/(5 + (-1)/1). Are w and x nonequal? True Let l = 4 - 3. Let o = 0 - l. Let x be 32/(-63) - 2/(-7). Do o and x have the same value? False Suppose -x = -5x - 12, -p = 3x + 10. Let l(r) = 2r - 3. Let c be l(2). Let g be 2c/(-2) - -2. Which is bigger: p or g? g Let z = 274 - 300.8. Let l = 26 + z. Are -1 and l equal? False Suppose 22 = -4z + 2, 0 = -2l - 2z + 2. Is 5 less than l? True Suppose 3m - 9 + 99 = 0. Which is bigger: m or -29? -29 Suppose -5j + 69 + 36 = 0. Let r = j - 64/3. Which is bigger: 0.3 or r? 0.3 Let k = -4 - 5. Let x = 9 + k. Is x greater than 1/5? False Let p = 247921/163 + -1521. Which is bigger: -1 or p? p Let p = 0.08 - -0.02. Let k = 1 + -5. Does p = k? False Suppose -2x - x - 28 = -2l, 0 = 2x - 5l + 37. Let u(z) = -z - 6. Let v be u(x). Let b(r) = r - 5. Let g be b(5). Is g equal to v? True Let j = 1.7 - -0.3. Let t = 30 - 30. Let a = t + j. Which is greater: a or 1/5? a Suppose 0c = 4c - 12. Let u = 5 - c. Which is bigger: u or 0? u Let q = 2 + 0. Suppose -m = -qm. Let f be 16/3 - 20/5. Which is bigger: f or m? f Let a = 0.01732 - -26.07268. Let l = a - 24.1. Let t = l - -0.01. Is t >= 2/5? True Let h = -0.05 - 0.35. Let n = 7 + -6.5. Let b = h + n. Which is greater: 1/5 or b? 1/5 Let k = 2.56 + -2.9. Let q = -0.02 - -0.06. Let n = k + q. Which is smaller: n or -1? -1 Let i(f) = -2f2 + 14f - 9. Let u be i(13). Let t be (-1)/3 - 43/u. Let l = -7/660 + t. Do l and -1 have the same value? False Let s(f) = -11f2 + 39f - 25. Let q(l) = 7l2 - 26l + 17. Let r(y) = 8q(y) + 5s(y). Let z be r(12). Are -2/9 and z nonequal? True Let j be (-108)/(-30) + -5 + 1. Which is greater: -26 or j? j Let l = 368/45 - 42/5. Which is smaller: 0.4 or l? l Let t(f) = -f*3 + 10f*2 - 2f + 20. Let d be t(10). Let o be 0 - 2(-5)/2. Let z(v) = -v3 + 4v*2 + 5v + 1. Let h be z(o). Is d bigger than h? False Let b = 2198/11 - 198. Is b smaller than 1? False Let g = -0.07 - -7.07. Let y = g + -7.3. Which is smaller: y or -2/3? -2/3 Suppose r = -3b + 8, r = -3r + 2b + 46. Let l = r - 16. Which is greater: -4 or l? -4 Let u = 6 + -8. Let c = -2 - u. Let w = c + -0.1. Which is greater: w or 2/7? 2/7 Let v(i) = i2 - 5i + 6. Suppose -4 - 12 = -4x. Let n be v(x). Let k = 16 - 13. Which is smaller: k or n? n Let s = 168 - 108. Is s greater than or equal to 59? True Let s = 10 + -10. Suppose s = 4f + f. Which is bigger: -1 or f? f Let c = 8.7 + -8.6. Let v = -9103/19 - -479. Is c at least v? True Let q be 1/(-4) + (-13)/(-4). Let b(n) = -n*2 - 3n + 1 + 1 + 0. Let l be b(-3). Which is bigger: q or l? q Let h(a) = 4a - 2. Let t be h(5). Let l be 2(2 - 33/t). Suppose 0i + 2i = 0. Is l >= i? True Suppose 2u = 3u + 6. Let t be (-6)/(-9) - 2/u. Which is bigger: 2 or t? 2 Let z = -0.15 - 5.85. Let p = z - -8. Let v = 2 - 2. Which is greater: v or p? p Let g be -33/904. Which is smaller: 0 or g? g Let b(j) = -j*3 + 9j*2 + 4. Let w be b(9). Let g be 2/2 - w/3. Let d = g + -1/15. Do d and 0 have the same value? False Suppose -2l = 4b - 28, 2l - 30 = -3l - 2b. Which is bigger: l or 36/11? l Let a be (2/26)/(1 + -2). Let m = 14 - 14. Is m less than a? False Let n(c) = -c + 4. Let u = 4 + 0. Suppose -a - ua = 0. Let b be n(a). Is 4 at most as big as b? True Let i be 4 + 0 + 1380/(-330). Is 0.2 equal to i? False Suppose -x = 3x + 16. Let c = 3 + x. Suppose 0k + 3k = 0. Is c smaller than k? True Let w(y) = y*3 - 5y*2 + y + 4. Let m be w(5). Suppose 3b = 3h - 4h + 9, 3b = h + m. Suppose -ba - 7 + 1 = 0. Is -2 bigger than a? False Let y = -5783/65 + 89. Which is smaller: -1 or y? -1 Suppose 298 = -6q + 4. Is -51 at most q? True Let o(f) = -3f**2 + f + 1. Let w be o(-1). Let k = 0 + w. Is -1 at least as big as k? True Let o be ((-4)/10)/(42/(-10)). Let w = -4/105 - o. Let m = -0.2 + -0.8. Is w	{ "pile_set_name": "DM Mathematics" }
. y(133/10) Simplify (h7h(-10))/(h(-4/11)h(-4/3)) assuming h is positive. h(-43/33) Simplify ((u/u0)(-22))(14/11) assuming u is positive. u(-28) Simplify (a/a(-1/8))(1/20) assuming a is positive. a(9/160) Simplify (q1)*18/((q/(q(qq(-1/4))/q)q)/(qq(-5)/qq)) assuming q is positive. q*(51/4) Simplify ((((tt*(-2))/tt)/t)/t)(-24/7) assuming t is positive. t(72/7) Simplify p*(1/35)p(ppp(-4/11)ppp)/pp assuming p is positive. p(2181/385) Simplify pp*6ppppp*(2/17)/p(p0)(-3/40) assuming p is positive. p*(172/17) Simplify ((((c/(cc/(((cc/c(-1/3)c)/c)/cc)c))/c)/cc)/cc/(c/(cc(-3))))/(((cc/(c/(c/c0)))/c)/c)(-38) assuming c is positive. c*(-11/3) Simplify (uuu(-2/15)/u)(3/32) assuming u is positive. u(13/160) Simplify w(-3/8)w*7(w0)(-1) assuming w is positive. w(53/8) Simplify (g1g)(-11/5)/(((g/(g(2/3)/g))/gg)/((ggg*4/gg)/g)) assuming g is positive. g(-11/15) Simplify (k2/kk/k2)/(k(-5/3)/(k/(k/(kkk/(k(k*(-7)kk)/k))))) assuming k is positive. k(29/3) Simplify (((((ss/(s(-2/5)/s))/s)/s)/s)(-1/43))(-11) assuming s is positive. s(22/215) Simplify (l/(ll(27/4)/l))18 assuming l is positive. l(-207/2) Simplify (c(-1/3))(5/8)(c(-2/5))(-10) assuming c is positive. c*(91/24) Simplify h/(h/((hh*(1/9))/h))h*(-2/7)(h(-1))(2/11) assuming h is positive. h(-247/693) Simplify k(-29)/(kk(-15)) assuming k is positive. k(-15) Simplify (f((f*3/f)/f)/ff(-16))(-5/9) assuming f is positive. f(25/3) Simplify (o2)*(34/7)/((o/(o(oo/(oo(3/2)))/o))/(o/(o/o(-10))o)) assuming o is positive. o(-11/14) Simplify (z(5/9)zzz(-1/32))23 assuming z is positive. z(16721/288) Simplify (l(-2/13)l)/((l/(ll*0))/l)l(1/9)/l2 assuming l is positive. l(-5/117) Simplify n33n(nnn/(n/n38))/n assuming n is positive. n73 Simplify (n0)37n6n/((n/(n*(1/2)n))/n)n assuming n is positive. n(19/2) Simplify q(-5)/q(-1)(q/q*(1/3))/q(q/(q(-5/3)/q))/q assuming q is positive. q(-5/3) Simplify ((jj(-1/6))/j(2/19))(6/7) assuming j is positive. j(83/133) Simplify (h5hh(-1/13))(10/13) assuming h is positive. h(770/169) Simplify (a(-13)/(a(2/13)/aaa))31 assuming a is positive. a(-5704/13) Simplify (v/v21v)/v(-13) assuming v is positive. v(-6) Simplify ((((p/(p/(p*2p)p))/p)/pp)/p(-5))/(p(2/11)/ppp(-6)) assuming p is positive. p(130/11) Simplify ((s*0s)/(ssss/(((ss/s*(-2))/s)/s)ss))/(s0s)(-8/3) assuming s is positive. s(-1/3) Simplify a*1/(aa*(7/2)a) assuming a is positive. a*(-9/2) Simplify ((cc/c0)(-5/2))(-16/9) assuming c is positive. c(80/9) Simplify (w/((w*(2/5)/w)/w)w)*49/(ww/(www*(1/2))w/(ww/(ww(2/7)/w))) assuming w is positive. w(12433/70) Simplify (g*(-2/23)g)33 assuming g is positive. g(693/23) Simplify (llll(-3/4))(-19) assuming l is positive. l(-171/4) Simplify ((g(-4))(2/29))(35/6) assuming g is positive. g(-140/87) Simplify ((c/c(-1/4)c)/c)/(c*(1/7)c)(cc*0cc)/(c(-1/17)/c) assuming c is positive. c(1983/476) Simplify (a(-1/5)a)(-2/75) assuming a is positive. a(-8/375) Simplify xx/(x/(((x/(x/x(-1/3)))/x)/xx))xxx(-1/14)(x/(x/(x/x1)))(-1/29) assuming x is positive. x*(67/42) Simplify (j(j*(2/7)j)/j)/(j/(j*(8/3)/j)j) assuming j is positive. j(20/21) Simplify (h/(h(1/6)h))/h(-2/19) assuming h is positive. h(-7/114) Simplify q(-1/12)q(1/26) assuming q is positive. q(-7/156) Simplify (nn/n(-1/35)n)49 assuming n is positive. n(742/5) Simplify g9/(g/(g(-1/9)/gggg)) assuming g is positive. g(89/9) Simplify c5/c(-13) assuming c is positive. c18 Simplify ((oo/o*1o)/o(-2/13))/(o2/oo(oo(-1/3))/o) assuming o is positive. o(19/39) Simplify (q8/((q(-1/4)qq)/q))(-43) assuming q is positive. q(-1247/4) Simplify (k(-2/7))49/(k(-2/11)k(-1/4)) assuming k is positive. k(-597/44) Simplify kkk*(-7/6)kk(-7/3)/kk assuming k is positive. 1/sqrt(k) Simplify c*9c(2/11) assuming c is positive. c(101/11) Simplify f*3/ffff*(-2/15)f*1/(((ff/(f/(f*0/f)))/ff)/fff) assuming f is positive. f*(58/15) Simplify aa(aa*(-4/7))/aaaaa(a((aa*(4/5)/a)/a)/a)/a(aa(1/4)/aaa)/(a/a6a) assuming a is positive. a(1467/140) Simplify (i(-1/6)/i)(-10/9) assuming i is positive. i(35/27) Simplify u*(-2/7)/(uu/(uu(3/2)))(u0)(12/11) assuming u is positive. u(3/14) Simplify (y(-2/5)y)(26/7)(y/(((y*5y)/y)/y))/yy4/y assuming y is positive. y(43/35) Simplify (c(-4)c*(-5)/c)/(cc*(-2/27)/cccc/(c/(cc(-2)c))c) assuming c is positive. c(-349/27) Simplify n1n/(n/(nn(-1/8)))(n(-1))(4/5) assuming n is positive. n*(43/40) Simplify (mm/m*(-1)(m*(-1/2)m)/m)/((m/(m(-1/7)/m))/(m/(m/m(1/3)))) assuming m is positive. m(29/42) Simplify n(1/3)n9 assuming n is positive. n(28/3) Simplify (y/(y((y*1y)/y)/y))*(-31)(y/(y*(-1/3)y))/y(2/21) assuming y is positive. y(5/21) Simplify (o(-1/6))(-38) assuming o is positive. o*(19/3) Simplify ((ff(ff/f*1f)/ffff)/f)13(f/f*(-5/4))/f(ffff5f)/ff assuming f is positive. f(301/4) Simplify o23/o5 assuming o is positive. o18 Simplify (x(-1/3))(-4)(xx(-5))/x5 assuming x is positive. x(-23/3) Simplify (o/(oo(-1/5)))/o(-5/6)(o/(o/(o(-2)oo))o)/(o*(2/7)o) assuming o is positive. o*(157/210) Simplify ((y(y(yy(3/4))/y)/y)/y)21 assuming y is positive. y*(63/4) Simplify (xx(-1/4))(22/5) assuming x is positive. x*(33/10) Simplify (((hh(h/((h((h/h*(-1/8)h)/h)/h)/h))/hh)/h)/h(h(-2/9)/h)/h)/((h(1/3)/h)/(h(2/5)/h)) assuming h is positive. h(-461/360) Simplify ((((h/h*2)/hh)/hh)/h(h/h*(-4)h)/h)33 assuming h is positive. h99 Simplify ((f*(-19/2)/f)/(ff(ff*(-9))/fff))(3/4) assuming f is positive. f(-33/8) Simplify k(11/6)k(-7)/k assuming k is positive. k(-37/6) Simplify ((x*(-6)x)/x(-9/4))(-3) assuming x is positive. x*(33/4) Simplify ((vv5)/(v/(v/(v/v(-2/7)v)v)v))(5/8) assuming v is positive. v(65/28) Simplify ((x(-2))(-4/37))(2/35) assuming x is positive. x(16/1295) Simplify (q3)(-3) assuming q is positive. q(-9) Simplify k(2/81)k/k21 assuming k is positive. k(-1618/81) Simplify ((d*18/dd)/(d(-16)/d))41 assuming d is positive. d*1435 Simplify (h/(hhh(-1)h))*10/(hh(2/7))(-14/3) assuming h is positive. h*(-4) Simplify (v(v/v(4/3))/v)(-34) assuming v is positive. v(34/3) Simplify p4/p*(-2/21)p(-3)/((p/p(-7)p)/p) assuming p is positive. p(-145/21) Simplify (v(-2/3))45/(vvv(-1/4)(vv2)/vv) assuming v is positive. v(-139/4) Simplify (n(-7))2 assuming n is positive. n(-14) Simplify (jj7j)/j*5(j/(j/((j/j*(1/3))/j)))/(jj*4/jj) assuming j is positive. j(-4/3) Simplify n/n(1/14)n(-9/5) assuming n is positive. n(-61/70) Simplify (a8a*0)/(((aa((aaa(-2/3))/aaa)/aa)/a)/a)(-6) assuming a is positive. a22 Simplify ddd/d*16ddd(-1/21)/d assuming d is positive. d(-253/21) Simplify (d/(d(-4/3)/d))/(d/d(-3/2))(d/(d(-2)/d))(-5/13) assuming d is positive. d(-55/78) Simplify (j/j(1/2))(-6/11)(j1)(-1/5) assuming j is positive. j(-26/55) Simplify (h0)*(2/21)/(hh*(2/9)h/(hh/h(4/5)h)) assuming h is positive. h(-1/45) Simplify (q(-3)qq)41 assuming q is positive. q(-41) Simplify (a*(-30)a)(14/9) assuming a is positive. a(-406/9) Simplify ((v/v(-1))32)(-46) assuming v is positive. v(-2944) Simplify a4/((a/a(1/8))/a)(aa*(-4)/a)/aa(-2/7) assuming a is positive. a(-65/56) Simplify ((d/(d*(3/13)d))/d)/(dd(-16)d) assuming d is positive. d(166/13) Simplify ((((q(-5)/q)/q)/q)/(qq/((q/q(-2/5))/q)))/(q(1/4)/q)(1/24) assuming q is positive. q(-1531/160) Simplify (s(s*23/ss)/s)/s26 assuming s is positive. s(-3) Simplify (c(-2/3))(1/2) assuming c is positive. c(-1/3) Simplify (q(6/7))(-33/4) assuming q is positive. q(-99/14) Simplify (j/j**(	{ "pile_set_name": "DM Mathematics" }
ose 5u - 10 = -4i, -4u - 2 + 10 = 3i. Suppose -24f + 23f = -2. Let b(x) = -2 + i + 8x - 4 - xf. Give b(6). 6 Let d(h) = -h2 + 7h - 6. Let q be 2/(-3)(21 + -1 + -2). Let b be (q - -10)-131. Determine d(b). 0 Let j(b) = b*3 - 5b*2 - 4b - 6. Suppose -3g - 7 - 26 = 0. Let c = 14 + g. Suppose -m - 2m + cd = -30, -m - 2d - 2 = 0. What is j(m)? 6 Let s(i) = -1 + 9751i - 8i*2 - 9745i + 5 + i*3. Determine s(7). -3 Let p = 644 - 643. Let t(j) = -16j*3 + 2j*2 - j. Give t(p). -15 Let q(y) = 2 - y - y - y. Suppose -124 = 7i + 44. Let w be 2/(-1) - -10 - i/(-8). Give q(w). -13 Let n(c) = c - 2. Suppose p + 2 = -s, -s - 4 = -3p + 6. Let t be n(p). Let m(i) = -i2 + i - 8. Determine m(t). -8 Suppose 0 = 5g - w + 72, g + 0g + 30 = -5w. Let v(b) = -b + 1. Calculate v(g). 16 Let c(y) = 114y - 111. Let q be c(1). Let s(v) be the first derivative of 0v*2 - 1/3v*q + v - 4. What is s(-2)? -3 Let m(z) = 4z*2 - 5. Let j(l) = -5l*2 + 6. Let f(r) = -5j(r) - 6m(r). Suppose -2v + u - 4 = 0, -3u = -8u. Let s be ((-6)/2)/(v/2). Determine f(s). 9 Let o be -5(-7)/153. Let m(q) = -q + 1. Calculate m(o). -6 Let b = 596 + -593. Let n(f) = f*2 - 5f. Let a(u) = u*2 - 5u. Suppose -w - 1 = -4. Let p(s) = wn(s) - 4a(s). Calculate p(b). 6 Let k be -2 - (-2 + 6 - 1). Let i(p) be the second derivative of 5/12p4 + 2p*2 + 1/6p*3 + 1/20p*5 + 0 + 2p. What is i(k)? -1 Let w(a) = a*3 - 4a*2 - 5a - 2. Let z = -9 - -14. Let b be w(z). Let n be (b/6)/(1/(-15)). Let i(r) = -r*3 + 5r*2 + 5. Give i(n). 5 Let j(h) = -5h - 3. Let q = 29 - 26. Determine j(q). -18 Let c(u) be the first derivative of -u*5/60 + 7u4/24 + u3/3 + 2u2 + 7. Let s(z) be the second derivative of c(z). Give s(5). 12 Let o(b) = -5b*3 - 15b*2 + b + 3. Let t = 46 + -42. Let a(v) = -3v*3 - 8v*2 + 2. Let l(c) = to(c) - 7a(c). Give l(2). -2 Let n = 78 + -79. Let o(p) = -2p - 3. Let c be o(n). Let m(h) = -13h3. Determine m(c). 13 Let f(p) = p2 + 7p + 12. Let u be f(-6). Let m(z) = -3 - z*2 + z + 5z + 3z. Calculate m(u). 15 Let y(n) = n3 - 4n*2 + n - 3. Suppose 239j = 237j + 6. Give y(j). -9 Let j(p) = p2 + 6p - 6. Let v = 9 - 1. Let i = v - 15. Determine j(i). 1 Let d(q) = -q*2 - 17q - 19. Let m(w) = w*2 + 19w + 20. Let t(i) = 4d(i) + 3m(i). What is t(-9)? 2 Let x(p) = -p*2 - 4p + 2. Let n = 11 + -6. Suppose na - 32 = a. Let d be 1 - ((-4)/4 + a). Calculate x(d). -10 Let n(r) = r2 + 5r - 5. Let u = -96 + 106. Suppose 3x + u + 8 = 0. Calculate n(x). 1 Let i(c) be the third derivative of -c6/40 - c5/60 - c4/24 - 418c2. Let t(q) = -q2 + 6q + 1. Let a be t(6). Let u = -2 + a. Determine i(u). 3 Let d(o) = -o2 + 7o - 5. Suppose -4y + 68 = -2y. Let s = y - 28. Suppose 5i = 4i + s. Give d(i). 1 Let h be ((-50)/20)/(1/(-2)). Let d(f) = 2f + 2. Calculate d(h). 12 Let w(k) = k2 - 1. Let x be 2/9 - (-644)/(-63). Let g be x/(-4)28/35. Suppose 3b - 5 = -gb. Calculate w(b). 0 Suppose 9 + 7 = 4w. Suppose k = -wk + 15. Suppose 4h + 0h - 15 = -x, 2h = -5x + k. Let c(r) = -3r + 1. Give c(x). 4 Let w(i) = 2i. Let r(z) = -5 + z + 2 + 2 + 2. Let l(t) = -3r(t) + 2w(t). Let v(p) = -1. Let m(f) = l(f) - 4v(f). Calculate m(3). 4 Let m(g) = -19g*3 + 2g*2 - 10g + 1. Let t(k) = 3k3 + k2 - 1. Let a(z) = m(z) + 6t(z). What is a(5)? 20 Let u(z) = -7 + 3 - 2 + 1 - 2z. Suppose -4t - 16 = 2g, -5g - t + 2t = -15. Suppose 0 = -k - 2 - g. What is u(k)? 3 Let j(i) = 2i + 3. Let g(w) = -w - 1. Let c(d) = 15g(d) + 6j(d). Let s(f) = f + 1. Let k(q) = c(q) + 4s(q). What is k(-9)? -2 Let c(n) = 3n - 20. Let p(l) = l - 7. Let s(i) = -6c(i) + 17p(i). Let t be 24/(-60) + 0 + 6/15. Determine s(t). 1 Let i(r) = -3r - 5. Suppose -117 = -5c + 4q, -3q = 5c - 4q - 108. Let l be (-4)/6 - (-35)/c. Let a = l - 5. Give i(a). 7 Let v(i) = i3 - i2 - 1. Let c(g) = 4g3 - 5g*2 - g. Let q(f) = c(f) - 2v(f). Let z be 36/14(-32)/247. Let d = z + 26. What is q(d)? 4 Let p be 8/(-28) + 38/(-14). Let s(h) = -10 + 7 + 7 - 3h - 5. What is s(p)? 8 Let i(n) = -19 - 11 + 43 + 11n - 16. Give i(-4). -47 Let y = -8/133 + 979/798. Let a(q) be the third derivative of -q*2 + 1/24q*4 + 0q + 0 + yq3. Calculate a(0). 7 Let a(d) = -75 + 2d*2 + 12d*3 + 74 - 13d*3. Suppose 4r - 2r = -8, -28 = -4m + 2r. Let n = -2 + m. Determine a(n). -10 Let d(c) = -4c - 31. Let p(f) = -4f - 25. Let q(r) = 3d(r) - 4p(r). What is q(-5)? -13 Suppose 0 = d + 36 - 2. Let r = -40 - d. Let x(f) = -4f + 1. Let h(q) = q - 1. Let j(k) = -3h(k) - x(k). What is j(r)? -4 Let k(f) = -9f - 7. Let q = 2072 + -2077. Determine k(q). 38 Let v(z) = -11z2 - 10z + 4. Let n(l) = 5l2 + 5l - 2. Let b(t) = -13n(t) - 6v(t). Suppose -5 = -p + 10. Let f = -10 + p. Determine b(f). 2 Let k(g) = g. Let f = 667 + -671. Give k(f). -4 Let x(m) = m*2 - 3m - 23. Let a = 1115 - 1108. Calculate x(a). 5 Let n = -618 - -629. Let b(y) = -y + 7. What is b(n)? -4 Let w(m) = 2 - 5m3 + 7m*3 + m - 12m*2 + 14 - 3m*3. Give w(-12). 4 Suppose -6w - 36 = -48. Let r(x) = -wx3 - x2 - 23x + 1 + 23x + 3x*2. Let s be (-4)/(-3)6/4. Calculate r(s). -7 Let o(k) = -k*2 + 3k - 2. Let i be (-104)/(-10) - ((-36)/15)/(-6). Let s be 1/5 - (-28)/i - 0. Give o(s). -2 Let w be 156/30 - 5 - 95/(-25). Let v(c) = -c*2 + 5c + 3. What is v(w)? 7 Let p be (-9 + (13 - 8))/(0 + -2). Let o(z) be the first derivative of z + 5 + 3/2zp. What is o(-4)? -11 Let i(o) be the second derivative of o4/4 + 11o*3/6 - 3o*2/2 + 2o + 111. What is i(-4)? 1 Suppose 3i = -2a + 13, -2a = a + 3i - 24. Suppose 26k = 12k + 28. Let g(r) = -r*k - ar*3 + 0r + 2r - 3 + 2 + 0r. Calculate g(1). -11 Let d(c) be the first derivative of 1/6c3 - 13 + 3c*2 - 1/30c*5 + 0c - 1/12c4. Let q(k) be the second derivative of d(k). What is q(1)? -3 Suppose 0 = -l - 6 + 6. Let a be (-1 - (-3 - (-24)/3)) + l. Let n(j) = -4j - 7. What is n(a)? 17 Let i(m) = -m - 2. Let d(a) = 2a + 22. Let g be d(-7). Let j(b) = 2b + 9b - gb + 4 + 2b. Let f be j(-2). Determine i(f). 4 Suppose z = -3, -9z = -l - 13z - 7. Let d(j) be the third derivative of -j6/120 + j5/10 - 7j*4/24 + 7j3/6 - j2. Determine d(l). -3 Let u(z) = -2z + 11. Let t = -40 + 32. Let w be (6/(-4))/(t/(-384)-9). Calculate u(w). -5 Let y = 2 + -1. Let k(g) = -3 - y + 6 + g. Let l(p) = 2p2 - 7p + 6. Let n be l(2). Give k(n). 2 Let v = 91 + -88. Let g(c) be the second derivative of 0 - c - 1/2c2 - 1/3cv. Determine g(-2). 3 Let n(l) = -l2 - 5l - 2. Let m(h) = 4h*2 + 6h*2 - 8h*2. Let a be m(1). Suppose ao - 4s - 6 = 0, -4o - 23 = s - 8. Determine n(o). 4 Let w(p) = -2p3 - 15p*2 - 28p + 4. Let v be w(-4). Let x(b) = -3b + 13. Calculate x(v). 1 Let l(h) = -2h*2 - 2h. Suppose 0 = 20n + 43 + 17. Calculate l(n). -12 Let l(p) be the second derivative of p4/3 - p3/6 + 107p. Let r be (-5)/4 - (-5)/20. Calculate l(r). 5 Let h(f) = -7f + 20. Suppose -5l - 2r = -2l - 5, -2l - 2r = -2. Let o be h(l). Let u(t) = -4t3 + 2t + 1. Calculate u(o). 3 Let t(c) = 2c - 8. Suppose 445 = 13w + 354. What is t(w)? 6 Let h(a) = -a*3 - a + 7. Let v be 0 + 2 + -3 + -1. Let n be 3 + 12/(v - 2). Calculate h(n). 7 Let a(j) = -3j*2 + 4j*3 - 29 - 3j*3 + 10 + 12. Give a(4). 9 Let x be 1 - (-2)/(2/7). Suppose 5l = xl - 9. Let t(v) = v2 - 4v. Calculate t(l). -3 Suppose 79 = -6u + 103. Let z(t) = -t2 + 3t + 1. Determine z(u). -3 Let p(v) be the second derivative of v*4/12 - 5v*3/3 - 7v*2/2 - 161v. What is p(9)? -16 Let j = -2001 - -1999. Let l(y) = 2y3 + 2y*2 - 2. What is l(j)? -10 Let p(y) = -4y + 1. Let d(h) = 14h + 1. Let n(o) = -d(o) - 3p(o). Give n(0). -4 Let i(l) = 108l2 - l3 - 2l + 2l - 112l*2 + 3. Calculate i(-3). -6 Let m(a) = 1 + 14a*2 + 3 - 3a*3 - 9 + 2a*3 - 11a - 6a2. Calculate m(6). 1 Let k = 53 - 37. Let o(r) = kr - 18r + 2 - 7. Calculate o(5). -15 Let y(p) = p + 3. Let q(u) = u + 3. Suppose n - 4 = -0. Let t(l) = ny(l) - 6q(l). Calculate t(-7). 8 Let v(r) = -124r - 98. Let l(i) = 23i + 20. Let c(o) = -16l(o) - 3v(o). Give c(10). 14 Let f = 143 - 140. Let u(v) = -v3 - v2 - 3v - 2. Determine u(f). -4	{ "pile_set_name": "DM Mathematics" }
20 minutes after 12:04 PM? 12:24 PM What is 543 minutes before 3:23 PM? 6:20 AM How many minutes are there between 11:29 PM and 4:51 AM? 322 What is 670 minutes after 2:43 PM? 1:53 AM How many minutes are there between 3:41 PM and 4:25 PM? 44 What is 391 minutes before 10:54 AM? 4:23 AM What is 677 minutes after 10:57 PM? 10:14 AM How many minutes are there between 8:51 PM and 5:36 AM? 525 What is 525 minutes before 5:20 PM? 8:35 AM How many minutes are there between 3:04 PM and 5:50 PM? 166 What is 490 minutes after 5:34 PM? 1:44 AM What is 576 minutes after 8:02 PM? 5:38 AM How many minutes are there between 3:42 AM and 9:35 AM? 353 How many minutes are there between 8:20 PM and 5:48 AM? 568 What is 96 minutes before 2:50 AM? 1:14 AM How many minutes are there between 6:55 PM and 3:08 AM? 493 What is 677 minutes before 8:15 AM? 8:58 PM How many minutes are there between 9:39 PM and 7:31 AM? 592 How many minutes are there between 12:05 AM and 9:29 AM? 564 What is 274 minutes after 3:25 PM? 7:59 PM What is 588 minutes before 3:05 PM? 5:17 AM What is 538 minutes after 12:07 AM? 9:05 AM How many minutes are there between 4:01 AM and 7:05 AM? 184 How many minutes are there between 2:19 AM and 7:34 AM? 315 What is 91 minutes before 7:19 PM? 5:48 PM What is 699 minutes before 10:17 PM? 10:38 AM How many minutes are there between 1:50 PM and 10:13 PM? 503 What is 581 minutes after 8:03 AM? 5:44 PM What is 627 minutes after 10:30 AM? 8:57 PM How many minutes are there between 6:10 AM and 12:35 PM? 385 How many minutes are there between 6:38 AM and 2:28 PM? 470 What is 324 minutes after 6:46 PM? 12:10 AM How many minutes are there between 5:26 AM and 1:36 PM? 490 How many minutes are there between 4:50 AM and 3:01 PM? 611 What is 244 minutes after 1:06 PM? 5:10 PM What is 158 minutes before 5:12 AM? 2:34 AM How many minutes are there between 6:04 AM and 7:45 AM? 101 What is 25 minutes before 10:08 PM? 9:43 PM How many minutes are there between 9:06 PM and 6:57 AM? 591 What is 121 minutes after 2:49 PM? 4:50 PM What is 264 minutes before 10:52 AM? 6:28 AM How many minutes are there between 2:04 AM and 1:44 PM? 700 How many minutes are there between 5:38 AM and 1:40 PM? 482 What is 430 minutes after 4:02 AM? 11:12 AM What is 572 minutes before 12:35 PM? 3:03 AM What is 560 minutes before 12:26 AM? 3:06 PM What is 165 minutes before 12:22 PM? 9:37 AM How many minutes are there between 12:58 AM and 8:41 AM? 463 How many minutes are there between 4:08 AM and 9:01 AM? 293 How many minutes are there between 10:37 PM and 6:48 AM? 491 What is 155 minutes after 8:29 AM? 11:04 AM How many minutes are there between 9:52 PM and 5:02 AM? 430 What is 173 minutes after 4:17 AM? 7:10 AM What is 77 minutes before 11:58 PM? 10:41 PM What is 238 minutes before 6:10 AM? 2:12 AM What is 127 minutes after 5:13 PM? 7:20 PM How many minutes are there between 4:21 PM and 3:53 AM? 692 How many minutes are there between 8:39 AM and 11:40 AM? 181 What is 291 minutes before 7:34 PM? 2:43 PM What is 195 minutes before 12:40 PM? 9:25 AM How many minutes are there between 6:27 AM and 8:52 AM? 145 How many minutes are there between 12:35 PM and 2:51 PM? 136 What is 142 minutes before 5:54 AM? 3:32 AM What is 286 minutes after 12:51 PM? 5:37 PM How many minutes are there between 8:10 PM and 7:35 AM? 685 What is 644 minutes before 2:45 PM? 4:01 AM How many minutes are there between 6:32 AM and 5:48 PM? 676 What is 628 minutes before 7:40 PM? 9:12 AM What is 27 minutes after 10:54 PM? 11:21 PM What is 402 minutes after 12:22 PM? 7:04 PM What is 252 minutes before 8:39 AM? 4:27 AM How many minutes are there between 3:20 AM and 11:25 AM? 485 What is 547 minutes before 10:55 PM? 1:48 PM What is 98 minutes after 5:51 AM? 7:29 AM What is 33 minutes before 12:11 PM? 11:38 AM What is 503 minutes after 9:55 PM? 6:18 AM What is 331 minutes before 2:10 PM? 8:39 AM How many minutes are there between 5:50 PM and 4:13 AM? 623 What is 502 minutes after 2:18 AM? 10:40 AM How many minutes are there between 11:01 AM and 6:40 PM? 459 What is 304 minutes after 1:15 PM? 6:19 PM What is 328 minutes after 4:32 PM? 10:00 PM What is 596 minutes before 1:28 PM? 3:32 AM How many minutes are there between 1:08 AM and 3:30 AM? 142 How many minutes are there between 12:46 PM and 6:45 PM? 359 What is 677 minutes after 2:46 PM? 2:03 AM How many minutes are there between 11:21 PM and 12:14 AM? 53 What is 186 minutes before 4:46 AM? 1:40 AM How many minutes are there between 6:43 PM and 12:08 AM? 325 How many minutes are there between 10:23 PM and 1:54 AM? 211 What is 680 minutes after 4:37 AM? 3:57 PM What is 623 minutes after 11:44 PM? 10:07 AM What is 159 minutes after 5:04 AM? 7:43 AM What is 573 minutes before 5:42 AM? 8:09 PM What is 52 minutes after 9:26 PM? 10:18 PM What is 597 minutes before 3:00 PM? 5:03 AM What is 132 minutes before 10:36 AM? 8:24 AM How many minutes are there between 11:51 AM and 10:25 PM? 634 How many minutes are there between 4:13 AM and 4:38 AM? 25 How many minutes are there between 12:32 AM and 8:10 AM? 458 What is 90 minutes after 5:40 PM? 7:10 PM How many minutes are there between 5:29 AM and 11:41 AM? 372 What is 560 minutes before 1:18 AM? 3:58 PM How many minutes are there between 9:08 AM and 11:44 AM? 156 What is 289 minutes after 12:42 AM? 5:31 AM How many minutes are there between 8:00 AM and 6:17 PM? 617 What is 507 minutes before 4:18 AM? 7:51 PM How many minutes are there between 7:10 AM and 11:30 AM? 260 How many minutes are there between 4:53 PM and 10:17 PM? 324 What is 387 minutes after 4:05 AM? 10:32 AM How many minutes are there between 9:46 AM and 7:18 PM? 572 What is 44 minutes before 10:02 PM? 9:18 PM How many minutes are there between 2:00 AM and 8:25 AM? 385 How many minutes are there between 8:33 AM and 7:25 PM? 652 What is 56 minutes after 4:20 PM? 5:16 PM What is 322 minutes before 9:50 PM? 4:28 PM How many minutes are there between 9:10 PM and 4:18 AM? 428 What is 624 minutes after 12:39 PM? 11:03 PM How many minutes are there between 11:24 AM and 9:10 PM? 586 What is 25 minutes after 7:34 AM? 7:59 AM How many minutes are there between 9:18 PM and 2:28 AM? 310 How many minutes are there between 8:22 AM and 4:23 PM? 481 How many minutes are there between 1:57 AM and 7:14 AM? 317 What is 595 minutes after 3:12 AM? 1:07 PM What is 4 minutes before 1:22 AM? 1:18 AM What is 719 minutes before 1:48 AM? 1:49 PM What is 291 minutes after 6:51 PM? 11:42 PM What is 611 minutes before 1:18 PM? 3:07 AM What is 616 minutes after 5:18 AM? 3:34 PM What is 391 minutes after 6:52 PM? 1:23 AM How many minutes are there between 3:05 PM and 8:25 PM? 320 How many minutes are there between 1:47 AM and 5:50 AM? 243 What is 296 minutes after 6:59 AM? 11:55 AM How many minutes are there between 3:14 PM and 4:21 PM? 67 What is 374 minutes after 9:20 PM? 3:34 AM How many minutes are there between 10:16 AM and 9:44 PM? 688 What is 186 minutes after 4:13 PM? 7:19 PM How many minutes are there between 1:00 AM and 9:59 AM? 539 How many minutes are there between 6:47 PM and 10:24 PM? 217 How many minutes are there between 3:03 AM and 8:47 AM? 344 How many minutes are there between 9:46 PM and 5:05 AM? 439 How many minutes are there between 2:10 PM and 6:01 PM? 231 How many minutes are there between 10:24 AM and 8:29 PM? 605 How many minutes are there between 6:17 AM and 8:32 AM? 135 How many minutes are there between 9:26 AM and 1:24 PM? 238 How many minutes are there between 7:00 AM and 6:54 PM? 714 How many minutes are there between 5:46 PM and 6:26 PM? 40 How many minutes are there between 11:29 PM and 9:25 AM? 596 What is 556 minutes after 6:17 AM? 3:33 PM How many minutes are there between 8:34 AM and 7:54 PM? 680 What is 421 minutes after 8:05 PM? 3:06 AM What is 277 minutes after 8:38 PM? 1:15 AM How many minutes are there between 1:22 PM and 11:31 PM? 609 What is 643 minutes before 9:14 PM? 10:31 AM What is 186 minutes after 2:19 AM? 5:25 AM What is 249 minutes after 7:29 PM? 11:38 PM What is 391 minutes after 7:37 PM? 2:08 AM How many minutes are there between 1:25 PM and 3:15 PM? 110 What is 359 minutes before 1:08 AM? 7:09 PM How many minutes are there between 9:18 AM and 11:0	{ "pile_set_name": "DM Mathematics" }
4. Let o(j) = -2j - 13. Let c(n) = 7k(n) - 2o(n). Give 4c(x) + 7p(x). -5x - 1 Let x(u) be the second derivative of -u5/20 - u4/12 + 5u3/6 + 10u. Let r(n) = n. Let p = -3 + 3. Suppose 0 = -3k - pk + 15. Determine kr(y) - x(y). y3 + y2 Let i(x) = 12x + 5. Let m(k) = 35k + 14. Let w = -75 + 92. Calculate wi(j) - 6m(j). -6j + 1 Let z(i) = -11i. Let j(c) = -6c. What is 5j(t) - 3z(t)? 3t Let f(l) = -2. Let r = 14 - 19. Let y(a) = a2 - 4. Give rf(v) + 2y(v). 2v*2 + 2 Let f(s) = s - 2. Let v(b) = -3b + 5. Let w(t) = 5f(t) + 2v(t). Let c(r) = -7r + 3. Let u(o) = c(o) - 6w(o). Let m(n) = n. Calculate 2m(l) + u(l). l + 3 Let b be 0 - 0 - 6/3. Let v(s) = -5s*2 + 8s + 13. Let j(n) be the first derivative of -n3/3 + n2 + 3n + 1. What is bv(p) + 9j(p)? p2 + 2p + 1 Suppose 4k + 0 = 4. Let f(d) = 2d*2 + 4d - 1. Let b(x) = -x*2 - x. Let n(h) = -3b(h) - f(h). Let v(j) = -j3 - j2 + j - 2. Give kn(p) + v(p). -p3 - 1 Suppose -4p - 36 = -4u, 47 = 5u + 2p - 5. Let y(r) = -2r*3 - 5r*2 - 3. Let x(s) = 6s*3 + 16s*2 + 10. What is uy(k) + 3x(k)? -2k*3 - 2k*2 Let f(u) = 4u - 4. Let w(h) = -6h + 6. Let z(s) = 6s - 6. Let j(l) = -3w(l) - 4z(l). Determine -8f(m) - 5j(m). -2m + 2 Let f(y) = -14y - 7y3 + 37y + 5 - 14y - 12y. Let n(a) be the second derivative of a5/5 + a3/3 - 3a2/2 - a. Give 3f(j) + 5n(j). -j3 + j Let v(o) be the first derivative of 13o*4/4 + 11o*2/2 - 15. Let q(m) = 6m*3 + 5m. Give -9q(j) + 4v(j). -2j3 - j Let q(o) = -7o*2 + 4o - 5. Let c(g) = 13g2 - 9g + 11. What is -3c(j) - 7q(j)? 10j2 - j + 2 Let w(z) = -28z*2 - 4z - 4. Let x(n) = n*2 - n - 1. Calculate w(d) - 4x(d). -32d2 Let i be 48/3618/(-2). Let n(a) = 4a2 - 3a. Let m(y) = y*2 - y. Give im(b) + 4n(b). 4b*2 Let w(a) = 19a. Let d(o) = 4o. Calculate -22d(l) + 4w(l). -12l Let i(p) = 0p - 15 + 15 - 3p. Let v(a) = 4a. Give -6i(k) - 5v(k). -2k Let z(m) = -m + 4. Suppose 155 - 159 = 4i. Let j(b) = b3 + 2b*2 + b. Let o be j(-2). Let n(f) = f - 1. Give iz(t) + on(t). -t - 2 Let u(w) = w3 + w2 + w. Let v(a) = -5a*3 - 7a*2 - 4a + 2. What is -4u(l) - v(l)? l3 + 3l*2 - 2 Let b(y) = 21y*3 + 12y2 - 12. Let u(s) = -s3 + s*2 - 1. Determine -b(t) + 12u(t). -33t3 Let u(x) = -2x*3 - 9x. Let z(i) = -2i - 9. Let l(n) = n + 4. Let q(p) = -9l(p) - 4z(p). Give 6q(h) - u(h). 2h3 + 3h Let i = -8 + 14. Let s(a) = a - 2 + ia - 11. Let w(v) = -12v + 38. Let q(p) = 4p - 13. Let r(z) = 17q(z) + 6w(z). Calculate -11r(h) - 6s(h). 2h + 1 Let a(v) = 3v. Let i(g) be the third derivative of g4/8 - 53g*2. Determine -6a(u) + 7i(u). 3u Let i(b) = -13b3 + 3b - 3. Let z(g) = 14g3 - 2g + 2. Determine -2i(a) - 3z(a). -16a3 Suppose 2b + 2b = -20. Let a(z) = 7 - 3 - 5z + 2z2 - 5z*3 + 1 + 2z*3. Let p(c) = -6c - 4 + 10 - 3c3 + 2c2 - c3. Determine bp(d) + 6a(d). 2d3 + 2d2 Let x(v) = -v2 - 9v - 6. Let j(t) = 1. What is -6j(u) - x(u)? u*2 + 9u Let l(q) = q*2 - 1. Let k(c) = -4c*3 + 6c*2 + 3c - 3. Determine k(w) - 6l(w). -4w*3 + 3w + 3 Let o be (-3)/(-3) + -4 - 0. Let y be (-132)/(-55) - (-4)/(-10). Let i(g) = -g + 3. Let a(r) = 2. Give oa(z) + yi(z). -2z Let l(a) = -a + 1. Let h be ((-3)/5)/((-2)/10). Suppose -hd + 0d = 3. Let y(r) = -1 - 2r - r + 5r - r. Determine dy(q) - 2l(q). q - 1 Let k(s) = -27s*3 + 12s + 12. Let i(z) = -11z3 + 5z + 5. Determine -12i(x) + 5k(x). -3x3 Let l(g) = 22g*2 + 16g - 28. Let p(w) = -7w2 - 5w + 9. Give 5l(o) + 16p(o). -2o2 + 4 Suppose -1 = -2s - 13. Let w(j) = -2j - j + 98 - 93. Let p(a) = -5a - 25. Let k(i) = i + 6. Let l(z) = 26k(z) + 6p(z). Calculate sw(o) + 5l(o). -2o Let k(w) = 3w + 4. Let a(d) = 3d + 4. Let g(c) = -5a(c) + 4k(c). Suppose 40 = -5s - 30. Let h(m) = m + 1. Give sh(q) - 4g(q). -2q + 2 Let g(j) = -2j*3 + 11j2 - 11. Let c(r) = -r3 + 4r2 - 4. Give -11c(z) + 4g(z). 3z*3 Let p(i) be the first derivative of 10i - 5 - 8i2 + 2 + 2. Suppose t + 25 = -0t + 5j, 3t = -5j - 15. Let k(h) = -5h + 3. What is tk(r) + 3p(r)? 2r Let r(j) = 5j*3 - 6j*2 + 7j - 6. Let y(m) = -10m3 + 9m3 + m - 1 - m2 + 2m3. Let u = -2 + 3. Calculate ur(x) - 6y(x). -x3 + x Let b(o) = -o + 27 + 32 + o2 - 64. Let c(t) = -t3 + 5t*2 + 5t - 7. Let s be c(6). Let g(l) = -3l2 + 0 - 2l + 5l2 - 11. Determine sb(m) + 6g(m). -m2 + m - 1 Let i(v) be the third derivative of v6/30 + v5/20 + v4/24 - v3/2 - 16v*2. Let a(p) = 3p*3 + 2p*2 - 2. Give 3a(x) - 2i(x). x3 - 2x Let l(h) be the third derivative of -1/24h4 + 0h + 0 - 1/30h5 - 1/3h*3 - 2h*2. Let y(u) = 2 - 4 + 5u*2 + 3u + u*2 + 7. Give 8l(m) + 3y(m). 2m*2 + m - 1 Let m(i) = 10i*2 + 10i + 4. Let w(a) = 7a2 + 7a + 3. Suppose 3x + 29 = -2z, -5 + 25 = -5z. Give xw(c) + 5m(c). c2 + c - 1 Suppose -4h = -5x - 33, 3h - x = -0 + 11. Let g(b) = hb + 4 - 3b - 3. Let i(n) = 7n + 1 + 0 - 7. Calculate -5g(p) - i(p). -2p + 1 Let l be (-1 + 5)12. Let c = -114 + 109. Let k(v) = -3v*3 + 9v + 4. Let b(q) = -5q3 + 14q + 6. What is cb(g) + lk(g)? g*3 + 2g + 2 Let t(y) = 11y + 13. Let n(v) = 5v + 6. Determine -7n(g) + 3t(g). -2g - 3 Let u(k) = 4k - 2 + 1 + 3. Let w(s) = -17s - 8. Let g = -62 - -53. What is gu(t) - 2w(t)? -2t - 2 Let p(o) = 3o2. Let n be 10/36/4. Let b(q) be the first derivative of -4/3q3 + 0q*2 + 0q + 1. What is np(l) + 4b(l)? -l*2 Let c(s) = -s + 1. Let b(y) = -2y*2 - y. Let d(r) be the first derivative of 4r3/3 + r2 - r + 1. Let i(a) = 5b(a) + 3d(a). Determine -3c(n) - i(n). -2n*2 + 2n Let u(c) = -11c - 16c*3 - 8c*2 + 18c*3 - 13c*3 - 8. Let q(p) = -7p*3 - 5p*2 - 7p - 5. What is 8q(k) - 5u(k)? -k*3 - k Let v(f) = -5f - 5 + f - f - 7f3. Let x(s) be the first derivative of 0s*3 - 3/2s2 + 2 - s4 - 3s. What is 3v(g) - 5x(g)? -g3 Let r = 6 + -8. Let w be -3 + 1r + -2. Let i(h) = -2 + 2h - h + 0. Let d(k) = -k + 3. What is wi(u) - 5d(u)? -2u - 1 Let z(x) = x*2 - x + 1. Let m(c) = 3c*2 - 1. Give -m(h) - 3z(h). -6h2 + 3h - 2 Suppose 0 = 47g - 49g - 30. Let u(i) = i*2 - 3i - 3. Let d(a) = a + 1. Determine gd(b) - 5u(b). -5b2 Let k(n) = 3n. Let m(u) = -13u - 7. Let j(b) = 9b + 5. Let q(h) = 7j(h) + 5m(h). Determine -5k(r) - 6q(r). -3r Let u(z) = -22z*3 + 2z*2 - z + 2. Let h(d) = -21d*3 + 3d*2 - d + 3. Give -2h(j) + 3u(j). -24j*3 - j Let g(u) = 6u*2 - 8u. Let f(k) = -17k2 + 24k. Determine 3f(n) + 8g(n). -3n2 + 8n Let t(u) = -8u2 - 10. Let x(w) = -w2 - 1. What is -t(q) + 5x(q)? 3q2 + 5 Let d(n) = -n3 - 12n*2 + 12n. Let a(m) = m*2 - m. Suppose 2 = 3z - 4z. Suppose 0 = t + 11 + 11. What is ta(c) + zd(c)? 2c*3 + 2c*2 - 2c Let i(z) = z + 1. Let u(w) = 2w2 - 3w - 9. Let m(x) = 5x2 - 6x - 20. Let d(q) = 4m(q) - 9u(q). What is d(j) - 3i(j)? 2j2 - 2 Let w(g) be the first derivative of -g2 + 3g + 2. Suppose 1 = i - 3. Let t(u) = 0u - 5 + 4 - 4 + iu. Give -3t(p) - 5w(p). -2p Let r(x) = 5x - 2x + 0x - 4x + 1. Let u(f) = f + 2. What is -3r(j) + u(j)? 4j - 1 Let q(o) = -o*3 + 3o*2 + 3o. Let v(f) = 3 + 4f3 - 7f*2 - 6f3 - f3 + 2f3. Let d be v(-7). Let y(t) = t2 + t. Calculate dy(u) - q(u). u3 Let k(n) = -n2 + 10n + 18. Let j be k(12). Let r(m) = 3m*2 + 8m + 5. Let d(q) = -6q2 - 17q - 11. Give jd(l) - 13r(l). -3l2 - 2l + 1 Let d(b) = 7b - 6. Let t(l) = -2 + 7 + 17 - 5 - 20l. Determine 17d(s) + 6t(s). -s Let d(z) = z + 2. Let a(y) = 11 - 2y2 - 10y - y - 6y2 + 24y*2. Let n(b) = -3b*2 + 2b - 2. Let c(p) = -2a(p) - 11n(p). Calculate -2c(f) - d(f). -2f*2 - f - 2 Let q(l) = -l + 1. Let d(n) = 4n - 7. Let m(z) = -1. Suppose 7 + 5 = -4b. Let h(y) = bm(y) + d(y). Calculate 2h(s) + 7q(s). s - 1 Let y(v) = v*2 + v - 1. Let p = -41 - -37. Let q(r) = 5r*2 + 4r - 4. Determine py(j) + q(j). j2 Let d(h) = 5h + 9. Let g(b) = -6b - 10. Give -7d(y) - 6g(y). y - 3 Let l(g) = 6g*3 + 6g*2 + 14g. Let v(t) = -2t3 - 2t*2 - 5t. Calculate 6*l(z)	{ "pile_set_name": "DM Mathematics" }
109? y*2 - 92361y + 21 What is the g'th term of 408268, 816538, 1224808, 1633078, 2041348? 408270g - 2 What is the z'th term of 2049, 3321, 4593? 1272z + 777 What is the y'th term of 141, 495, 849, 1203, 1557? 354y - 213 What is the q'th term of -2245, -4488, -6717, -8926, -11109, -13260? q3 + q2 - 2253q + 6 What is the o'th term of -166, -357, -548, -739, -930? -191o + 25 What is the n'th term of -7200, -7205, -7210, -7215? -5n - 7195 What is the y'th term of 88, 86, 80, 70, 56, 38, 16? -2y2 + 4y + 86 What is the b'th term of -1207, -1138, -1069? 69b - 1276 What is the g'th term of 7104, 7071, 7038, 7005, 6972, 6939? -33g + 7137 What is the c'th term of -21, -6, 17, 48? 4c2 + 3c - 28 What is the j'th term of -381, -844, -1615, -2694, -4081, -5776, -7779? -154j2 - j - 226 What is the t'th term of -675, -1260, -1847, -2436, -3027, -3620, -4215? -t2 - 582t - 92 What is the k'th term of 2727, 6381, 10961, 16467? 463k2 + 2265k - 1 What is the h'th term of 159, 263, 253, 75, -325, -1001, -2007? -9h3 - 3h*2 + 176h - 5 What is the t'th term of 934, 2946, 8412, 19060, 36618, 62814, 99376, 148032? 288t3 - t2 - t + 648 What is the b'th term of 16268, 16263, 16258, 16253, 16248, 16243? -5b + 16273 What is the w'th term of 4883, 18958, 42417, 75260, 117487, 169098, 230093? 4692w2 - w + 192 What is the x'th term of 919, 933, 957, 991, 1035, 1089, 1153? 5x*2 - x + 915 What is the q'th term of 562886, 1125771, 1688656, 2251541? 562885q + 1 What is the g'th term of -690, -761, -876, -1035, -1238, -1485, -1776? -22g2 - 5g - 663 What is the x'th term of -618, -503, -388, -273, -158, -43? 115x - 733 What is the q'th term of 1842, 1862, 1894, 1938, 1994? 6q*2 + 2q + 1834 What is the j'th term of 233, 786, 1703, 2978, 4605, 6578, 8891? -j*3 + 188j*2 - 4j + 50 What is the z'th term of -4778, -19065, -42886, -76253, -119178, -171673? -2z3 - 4755z*2 - 8z - 13 What is the d'th term of -376, -358, -340? 18d - 394 What is the o'th term of -1519, -3009, -4495, -5971, -7431, -8869, -10279? o3 - 4o*2 - 1485o - 31 What is the a'th term of 3340253, 6680506, 10020759, 13361012, 16701265? 3340253a What is the d'th term of -186, -735, -1646, -2919, -4554, -6551? -181d*2 - 6d + 1 What is the l'th term of 14856, 14647, 14438? -209l + 15065 What is the n'th term of 21808, 21807, 21804, 21799, 21792, 21783? -n2 + 2n + 21807 What is the i'th term of -1587, -1311, -1049, -801? -7i2 + 297i - 1877 What is the k'th term of 214, 532, 942, 1438, 2014, 2664? -k*3 + 52k*2 + 169k - 6 What is the p'th term of 43638, 43641, 43644, 43647, 43650, 43653? 3p + 43635 What is the i'th term of -91, -71, -23, 59, 181, 349, 569? i3 + 8i*2 - 11i - 89 What is the o'th term of 2535, 5086, 7637, 10188, 12739, 15290? 2551o - 16 What is the v'th term of -269684, -269687, -269690? -3v - 269681 What is the g'th term of -24656, -24652, -24648? 4g - 24660 What is the c'th term of 262713, 262712, 262711, 262710, 262709? -c + 262714 What is the w'th term of -15, -100, -311, -714, -1375, -2360, -3735, -5566? -11w*3 + 3w*2 - 17w + 10 What is the r'th term of 255, 454, 577, 624, 595, 490? -38r2 + 313r - 20 What is the i'th term of -25515, -25515, -25513, -25509, -25503, -25495? i*2 - 3i - 25513 What is the l'th term of 3315, 3345, 3433, 3609, 3903, 4345, 4965? 5l3 - l2 - 2l + 3313 What is the c'th term of 847, 3356, 7539, 13402, 20951, 30192, 41131, 53774? c*3 + 831c*2 + 9c + 6 What is the m'th term of -241, -1096, -2561, -4630, -7297, -10556, -14401? m*3 - 311m*2 + 71m - 2 What is the f'th term of -3106, -6209, -9310, -12409? f*2 - 3106f - 1 What is the q'th term of -95, -138, -89, 112, 525, 1210, 2227, 3636? 10q3 - 14q*2 - 71q - 20 What is the p'th term of 1747936, 1747937, 1747938, 1747939? p + 1747935 What is the s'th term of -1830, -1864, -1896, -1926, -1954, -1980? s*2 - 37s - 1794 What is the x'th term of 1685, 3364, 5043, 6722, 8401, 10080? 1679x + 6 What is the s'th term of 31675, 63361, 95047? 31686s - 11 What is the g'th term of -1409766, -1409765, -1409764? g - 1409767 What is the q'th term of -383, -612, -841? -229q - 154 What is the m'th term of -1188, -4720, -10598, -18822, -29392, -42308? -1173m*2 - 13m - 2 What is the c'th term of 131025, 131001, 130977, 130953? -24c + 131049 What is the p'th term of -12469, -25044, -37631, -50236, -62865, -75524? -p3 - 12568p + 100 What is the d'th term of -2094, -4575, -7424, -10635, -14202, -18119? d*3 - 190d*2 - 1918d + 13 What is the a'th term of -3372, -3235, -3098, -2961, -2824, -2687? 137a - 3509 What is the i'th term of -852, -1091, -1330? -239i - 613 What is the o'th term of -11, -702, -2579, -6236, -12267, -21266? -99o3 + o2 - o + 88 What is the b'th term of 2432228, 4864461, 7296696, 9728933, 12161172, 14593413, 17025656? b2 + 2432230b - 3 What is the r'th term of 247, 2063, 6981, 16549, 32315? 258r3 + 3r*2 + r - 15 What is the o'th term of -593443, -593444, -593445? -o - 593442 What is the c'th term of -76, -301, -682, -1219, -1912, -2761? -78c*2 + 9c - 7 What is the o'th term of -985, -1181, -1679, -2629, -4181, -6485, -9691? -25o3 - o2 - 18o - 941 What is the d'th term of -933079, -933080, -933081, -933082, -933083, -933084? -d - 933078 What is the i'th term of 1451, 1472, 1493, 1514, 1535, 1556? 21i + 1430 What is the b'th term of 422, 851, 1278, 1703? -b2 + 432b - 9 What is the y'th term of 463, -386, -1235, -2084, -2933, -3782? -849y + 1312 What is the i'th term of -3532228, -3532231, -3532234? -3i - 3532225 What is the n'th term of -233, -1671, -5545, -13073, -25473, -43963, -69761? -203n3 - 17n - 13 What is the i'th term of -817, -3220, -7223, -12820, -20005, -28772, -39115, -51028? i*3 - 806i*2 + 8i - 20 What is the f'th term of -362, -592, -1198, -2366, -4282? -31f3 - 2f*2 - 7f - 322 What is the k'th term of 152784, 305558, 458330, 611100? -k*2 + 152777k + 8 What is the w'th term of -160, 3, 440, 1289, 2688, 4775, 7688, 11565? 23w3 - w2 + 5w - 187 What is the v'th term of -786329, -786331, -786333? -2v - 786327 What is the x'th term of -510, -986, -1464, -1944? -x2 - 473x - 36 What is the d'th term of -20042, -20039, -20036? 3d - 20045 What is the y'th term of 486, 425, 378, 351, 350? y3 + y2 - 71y + 555 What is the b'th term of -36, -10, 34, 96? 9b2 - b - 44 What is the b'th term of 521, 1035, 1547, 2057, 2565, 3071? -b2 + 517b + 5 What is the r'th term of -95871, -191752, -287635, -383520? -r*2 - 95878r + 8 What is the n'th term of -400053, -400048, -400043, -400038, -400033, -400028? 5n - 400058 What is the f'th term of -5081645, -5081649, -5081655, -5081663, -5081673? -f2 - f - 5081643 What is the l'th term of 3113, 3245, 3593, 4265, 5369, 7013, 9305? 18l*3 + 6l + 3089 What is the g'th term of -116, -306, -812, -1790, -3396? -26g3 - 2g*2 - 2g - 86 What is the v'th term of 376, 249, 40, -251, -624, -1079, -1616? -41v2 - 4v + 421 What is the t'th term of -2706, -2718, -2754, -2826, -2946, -3126, -3378? -2t3 + 2t - 2706 What is the p'th term of 3042, 4173, 5308, 6453, 7614, 8797, 10008, 11253? p*3 - 4p*2 + 1136p + 1909 What is the i'th term of 279, 298, 327, 366, 415, 474? 5i2 + 4i + 270 What is the y'th term of 16635, 33269, 49903? 16634y + 1 What is the v'th term of -109, -214, -299, -358, -385, -374, -319? v3 + 4v*2 - 124v + 10 What is the y'th term of -6291, -12526, -18627, -24528, -30163, -35466? 11y3 + y2 - 6315y + 12 What is the n'th term of -86, -378, -656, -914, -1146, -1346? n3 + n2 - 302n + 214 What is the a'th term of -878, -1753, -2648, -3569, -4522? -a3 - 4a*2 - 856a - 17 What is the n'th term of 4052, 4047, 4042? -5n + 4057 What is the s'th term of -5308, -10312, -15336, -20386, -25468, -30588, -35752? -s3 - 4s*2 - 4985s - 318 What is the s'th term of 410, 1634, 3672, 6524, 10190, 14670? 407s2 + 3s What is the x'th term of -180, -209, -256, -321, -404? -9x2 - 2x - 169 What is the r'th term of -751, 921, 2593, 4265, 5937? 1672r - 2423 What is the t'th term of -1081, -2186, -3291, -4396, -5501? -1105t + 24 What is the a'th term of 1461, 11726, 3958	{ "pile_set_name": "DM Mathematics" }
o rounded to the nearest ten thousand? -340000 Let w = -0.07032 + 79.17032. What is w rounded to the nearest 10? 80 Let d = 0.6056 - 0.6056002321. Round d to 7 decimal places. -0.0000002 Let n be (-4 - 627599286/(-24)) + 2/(-8). Suppose 20u + 107949966 = n. What is u rounded to the nearest 1000000? -4000000 Let z = -1.62281 + 0.18291. What is z rounded to one dp? -1.4 Let p = 735.988 + -736. Let i = -981076.98799998 + 981077. Let j = p + i. What is j rounded to 7 dps? 0 Let k = -902333.647606 + -3887.340594. Let p = 906315 + k. Let g = p + -94. Round g to three decimal places. 0.012 Let h = 1661.292648 - 1661.3. Round h to three dps. -0.007 Let x = -15014.8661 + 15015. Round x to one decimal place. 0.1 Let c(u) = 7u - 74. Let k be c(11). Suppose g + 2m - 4 = 0, kg - 2m + 6m = 8. What is g rounded to the nearest 100? 0 Let s = 2576478.455000668 - 2576484.045. Let x = s + 5.59. What is x rounded to seven decimal places? 0.0000007 Let t be 108/(-116) - 26/377. Let c be ((-2)/(-4))/((-1)/(-6)). Let f be c + 2100004/(-1) - t. Round f to the nearest one million. -2000000 Let g = 10238387 + 125979195.4. Let z = g - 136217472.3999902. Let b = z + -110. What is b rounded to 6 decimal places? 0.00001 Let w = -11.789 - -11.7853332. Round w to 5 decimal places. -0.00367 Let k(v) = 1354v2 + 2v. Let w be k(4). Suppose 0 = -74p + 69p - 7q - 53339, 5q = p + 10687. Let z = p + w. Round z to the nearest 1000. 11000 Let x = 6.1332054021 + -6.1332. What is x rounded to seven dps? 0.0000054 Let b = -114.38 + 102.509. Round b to zero dps. -12 Suppose 67 = -3m - 86. Let o = m - -53. Suppose l - 4x - 5526 = 0, 0 = -ol + 6l + 2x - 22122. Round l to the nearest one thousand. 6000 Let k = -3.55296 + -161.35004. Let t = 0 - 165. Let w = t - k. Round w to 2 decimal places. -0.1 Let y be (1 + 87/(-6))/(4/(-8)). Let c(l) = yl*2 - 9l*3 + 10l - 42l2 - 12l*3 - 16. Let t be c(-16). Round t to the nearest one hundred thousand. 100000 Suppose -9383964 = -90a + 1336836. Round a to the nearest 10000. 120000 Suppose -5 = -4g + 3g. Let p be g/3(30/(-25))/(-1). Suppose -1080002 = -4q - pv + v, 269998 = q - v. What is q rounded to the nearest ten thousand? 270000 Let h = -3543040.03700123 - -3543040. Let g = -2.787 - -2.75. Let i = g - h. What is i rounded to seven dps? 0.0000012 Suppose -45p + 44p = 3f + 130969988, -4p = -5f + 523880020. Round p to the nearest one million. -131000000 Let r = -7581 + 7580.91624. Round r to two dps. -0.08 Let u be 6/(-9)11/(22/(-9)). Suppose 0 = 5x - 0j - uj + 748515, 5x - 5j = -748525. Round x to the nearest ten thousand. -150000 Suppose -2n - 4w - 28 = 2n, 3w = -5n - 35. Let x = n - 5. Let i be 4/x - (-38699999)/(-3). Round i to the nearest 1000000. -13000000 Let b = -143 - -81. Let a = -61.9999848 - b. Round a to 6 decimal places. 0.000015 Let w = 0.024 + -277.024. Let i = 424.6 + w. What is i rounded to the nearest 10? 150 Suppose 29a + 777 = -2877. Let c = 34074 - a. What is c rounded to the nearest 10000? 30000 Suppose 0 = 4k - 632386 - 6733914. Suppose -73425 = z + k. Round z to the nearest one hundred thousand. -1900000 Let w = -9185 + 13949. Let c = -4732.41 + w. Let q = c - -7.31. Round q to the nearest 10. 40 Let o(i) = -124992i*2 - 4i - 6. Let a be o(6). Let z = a + 3197742. What is z rounded to the nearest one hundred thousand? -1300000 Let x = 19.709987219 - 19.71. Round x to seven dps. -0.0000128 Let v = 199.92 + -144. Let r = 55 - v. Let q = r - -1.74. Round q to one dp. 0.8 Let n(l) = -l*2 - 2l + 24. Let w = 29 + -35. Let t be n(w). Suppose 0 = 4j - ti + i + 536000, 0 = 2j + 5i + 268000. Round j to the nearest 100000. -100000 Let w = -254.9072 + 375.8653. Let k = -24.0611 + w. Let m = -97 + k. What is m rounded to two dps? -0.1 Let w = -1298.29 + -4124.61. What is w rounded to the nearest one thousand? -5000 Let p(n) = 4n + 20. Let v be p(11). Suppose 2o = 10o - v. Let y be 1586/o(-40)/(-6). What is y rounded to the nearest one hundred? 800 Let l = -8.8 + 18.2. Let d = -84.4 + l. Let j = -73.65 - d. What is j rounded to 1 decimal place? 1.4 Let c = 781.0885 + -781. Let s = 123.4885 - c. Round s to zero decimal places. 123 Let l = 3004.9121 + -0.1121. What is l rounded to the nearest 100? 3000 Suppose 4a = -2f - 0f + 48, 3f - 52 = -4a. Suppose -9w + 1 = -aw. Let q be (-5375)/(w/(-16)-1). Round q to the nearest ten thousand. 90000 Let t = 21.93 + -599.53. What is t rounded to the nearest 10? -580 Let p = 0.045 + 25.955. Let n = 27.5 - p. Let u = n - 5.02. Round u to 1 decimal place. -3.5 Let x = -78153553.995265 + 78154023. Let z = 469 - x. Round z to 3 decimal places. -0.005 Let n be 24 - (-42)/(-2 - 5). Suppose 27h = nh + 1323000. Round h to the nearest ten thousand. 150000 Suppose 2i + a = -103822 - 97279, 402198 = -4i + 2a. What is i rounded to the nearest one thousand? -101000 Let d = 860933725.609004379 - 860933724. Let x = 1.609 - d. What is x rounded to 7 decimal places? -0.0000044 Let r = -10063927922.9997942 - -10063929203. Let g = 1280 - r. What is g rounded to five decimal places? -0.00021 Let x = 408.2 + -408.20000005078. Round x to 7 dps. -0.0000001 Let q = -8.9094055 + 11.07940355. Let v = q + -2.17. Round v to seven dps. -0.000002 Let v = 15 + -16. Let n be ((-6)/(-4) - 0)/(v/50). Let s be (-36 + -4 + 2)/(3/n). Round s to the nearest one hundred. 1000 Let s = -2.7095 + 0.374. Round s to 1 dp. -2.3 Let i = 0.1142 - 0.053944. Let f = 3.06 - 3. Let h = i - f. What is h rounded to five decimal places? 0.00026 Let f = -57.633 + 68.8316. Let r = 11.2 - f. Round r to three decimal places. 0.001 Let t be ((1 - 4)/(-3))/(2/14). Suppose tx - 24 = 102. Suppose -22w = -xw + 1108000. Round w to the nearest 100000. -300000 Let c be 2(-7)/(-21)342/2. Suppose -cn = -110n - 3184. Round n to the nearest one hundred. 800 Let f = 64 - 7.4. Let y = -56.58404 + f. What is y rounded to 3 decimal places? 0.016 Let n = -74 + 2. Let q = 72.0438 + n. What is q rounded to 2 decimal places? 0.04 Let a = -0.56 - 18.44. Let f = a + 19.00578. Round f to three dps. 0.006 Let r = 14555861255.500000035 - 14555861287. Let j = r - -31.5. Round j to seven decimal places. 0 Let q = 16 + -19.81. Let v = 3.8099963 + q. Round v to seven dps. -0.0000037 Let u = -100547273 + 50317273. What is u rounded to the nearest one million? -50000000 Let a = -157135 + 9795. Round a to the nearest ten thousand. -150000 Suppose 60 = -1675z + 1660z. Let j(r) = 659r - 6 - 232r + 309r. Let i be j(z). What is i rounded to the nearest 100? -3000 Let s = -12.3 - 3.1. Let w = 14.793 + s. Let f = -0.60361 - w. What is f rounded to four decimal places? 0.0034 Let w = 0.01283905 - 0.01308. Round w to 5 dps. -0.00024 Suppose 992a - 1992a + 989a - 1039060 = 0. Round a to the nearest one thousand. -94000 Let g be (-2314)/(-38) + (-80)/(-760). Round g to the nearest 100. 100 Let u = -594 + -794. Let k = 1387.7687 + u. What is k rounded to two dps? -0.23 Let w be 18(-1)/(-2) - (6 - 2). Suppose 3p = 0, 577060 = wi + 3p - 227940. Round i to the nearest ten thousand. 160000 Let s = 110171083538.094049 + -110170988099. Let d = -95439 + s. Let o = d - 0.094. What is o rounded to five decimal places? 0.00005 Let g(f) = -2f*2 - 224f + 1485. Let h be g(7). Round h to the nearest 100. -200 Let n = -826.7 + 788. Let q = -102.6 - n. Round q to the nearest ten. -60 Let a = 456 + -128. Let y = a + -322.41. What is y rounded to the nearest integer? 6 Let l(q) = 23q3 + 57q*2 - 201q - 299. Let k be l(61). Round k to the nearest 1000000. 5000000 Let h = 32.87405 - 5.87535. Let d = 9 - -18. Let o = d - h. What is o rounded to 4 decimal places? 0.0013 Let j = -401.13 - -402. Let m = j + -0.469. What is m rounded to 2 decimal places? 0.4 Suppose -a + 5u = 186639985, 4a + 0a = -7u - 746560021. Round a to the nearest one million. -187000000 Let l be ((-3)/(-1))/(1(5 - 4)). Suppose -661999 = -2b - a, la - 4a - 1 = 0. What is b rounded to the nearest 100000? 300000 Let r = 186 - 186. Let f be 4/(-20)r + 767000. Round f to the nearest one hundred thousand. 800000 Let n be 32/(1 - -3 - 2). Let r(q) = -2389q*2 - 15q - 5. Let k be r(n). Let g = 188171 - k. Round g to the nearest 1000000. 1000000 Le	{ "pile_set_name": "DM Mathematics" }
, 2, 5? 5 What is the third biggest value in 171, -1/4, 0.3? -1/4 What is the third biggest value in -0.3, -1/2, 1? -1/2 What is the third smallest value in -46.6, -3, 5? 5 Which is the fifth biggest value? (a) 1 (b) 5 (c) 0.073 (d) 4 (e) -2/15 e What is the second biggest value in 11/6, 0.4, -2/9? 0.4 Which is the smallest value? (a) -2/3 (b) 1 (c) 0.6 (d) 7/2 a What is the second biggest value in -0.1, 0.1, -4599? -0.1 What is the second biggest value in 0, -0.21, -2/11, -2/31? -2/31 What is the fourth biggest value in -39, -1/3, 2/7, 17? -39 What is the third smallest value in 0.17, -1, 0.05, -5/3, -4? -1 Which is the third biggest value? (a) 0.11 (b) -3 (c) 27 b Which is the second biggest value? (a) -2 (b) 0.3 (c) -2/17 (d) -0.026 (e) 2/5 b Which is the smallest value? (a) 0.3 (b) 1 (c) 0.42 (d) 0.9 (e) 0.5 a Which is the second biggest value? (a) -172 (b) 0.1 (c) -8 c Which is the third smallest value? (a) -5/2 (b) -0.6 (c) 1 c Which is the fourth biggest value? (a) -0.4 (b) -7 (c) -2 (d) 1/6 b Which is the fourth biggest value? (a) 0.1 (b) 5 (c) -1/2 (d) -1410 d What is the second biggest value in 3, -4/3, -228, 0.3? 0.3 What is the second biggest value in -43, -1/2, 241, 4? 4 What is the fourth biggest value in 4, -1/10, 0, 3? -1/10 Which is the third smallest value? (a) 5/3 (b) 0.08 (c) -0.3 a Which is the biggest value? (a) 3 (b) -7560 (c) -2 a Which is the smallest value? (a) 4/5 (b) 1/19 (c) 0.5 b Which is the fifth biggest value? (a) -0.3 (b) -0.4 (c) -3 (d) 3 (e) 0.05 c What is the fifth biggest value in 2/3, -11/4, 2/5, -2/9, 1.3? -11/4 What is the second biggest value in -2/9, -3, -4, 4? -2/9 Which is the third biggest value? (a) -5 (b) 4/5 (c) 29/5 a Which is the third biggest value? (a) -2/3 (b) -1 (c) 2/55 (d) -1/5 (e) 2/5 d What is the fourth smallest value in -2, 2/5, -1/6, -2/11? 2/5 What is the fourth smallest value in -4, 2/13, 2/5, 1? 1 What is the fourth biggest value in -2, 49/4, 5, -5? -5 Which is the fourth smallest value? (a) 2 (b) -1/5 (c) 3 (d) -4/65 (e) -5 a Which is the second smallest value? (a) -9 (b) 5 (c) 2/7 c What is the second smallest value in 0.05, 0, 0.02? 0.02 What is the second biggest value in -0.6, -9, -0.1, 1? -0.1 Which is the biggest value? (a) 2 (b) -0.1 (c) 2/3 (d) -284 a Which is the biggest value? (a) 0.3 (b) -4 (c) 19 (d) 3/4 c Which is the second smallest value? (a) 1/7 (b) 0.4 (c) 7 (d) 3/2 b What is the second smallest value in 5/3, 0.1, 3? 5/3 Which is the third biggest value? (a) 2 (b) -0.0965 (c) 0 b Which is the third smallest value? (a) -1/9 (b) 0.2 (c) 3/19 b Which is the fourth biggest value? (a) 2 (b) 4 (c) -0.2 (d) -2/21 c What is the second smallest value in 0.5, 0.06, -0.2, -1? -0.2 What is the fourth biggest value in -3, -1, -39, 4, 65? -3 What is the fourth smallest value in 0.5, 2/3, -3, -0.02? 2/3 What is the biggest value in -0.05, 26, 5, 2, 0.2? 26 Which is the smallest value? (a) 4 (b) 146 (c) -3 c Which is the fourth biggest value? (a) 0.1 (b) 0.5 (c) 1.4 (d) -0.6 (e) -0.5 e Which is the biggest value? (a) 0.0206 (b) 5 (c) -2/5 (d) -2/7 b What is the second biggest value in 2/11, -1/11, -4? -1/11 Which is the fourth biggest value? (a) -3/7 (b) -0.2 (c) -1 (d) -1/29 c Which is the second smallest value? (a) -2 (b) -14 (c) 3 (d) -6/17 a What is the smallest value in -2/399, -2/15, 2? -2/15 What is the smallest value in 6/5, -1/4, 1/74, 2/11? -1/4 Which is the third biggest value? (a) -0.01 (b) 0.4 (c) -0.2 (d) 5 a Which is the biggest value? (a) 5 (b) 2/3 (c) -34 (d) 1 a What is the second biggest value in 5, -1/20, -12, -0.4? -1/20 Which is the third smallest value? (a) 3/4 (b) -2/27 (c) 5 c Which is the biggest value? (a) -1 (b) 38 (c) -2/5 b What is the second biggest value in -4, 5, -5, -0.2? -0.2 Which is the fourth biggest value? (a) -2/3 (b) -1/3 (c) -0.1 (d) 0 a What is the fourth biggest value in 2, -0.1, -0.5, -1/43? -0.5 What is the smallest value in -2/9, -1, -54/11? -54/11 Which is the second smallest value? (a) -194/3 (b) 0.2 (c) 3 b Which is the third smallest value? (a) 1/9 (b) -0.6 (c) -0.1 (d) 0.1 d Which is the smallest value? (a) -1/10 (b) -0.8 (c) -10 (d) -4 c What is the smallest value in 2/5, 3/8, -400, -3? -400 Which is the second smallest value? (a) 0.4 (b) 2 (c) -2/3 (d) -2.4 (e) 3/2 c What is the fifth biggest value in -0.6, 3, 4, -2/31, 2? -0.6 What is the fourth biggest value in -0.17, 1, 1/5, -4, -3/8? -3/8 What is the third smallest value in -0.7, 14, 12, 0, 5? 5 What is the smallest value in 8, -11, 0.2, -0.1? -11 Which is the second biggest value? (a) 1/7 (b) -4 (c) -2/13 (d) -2/273 d Which is the second biggest value? (a) -0.3 (b) 0 (c) 18 (d) 3/5 (e) -2/3 d Which is the biggest value? (a) 10 (b) -5 (c) 186/11 (d) 5 (e) -1/6 c What is the second smallest value in 5.27, 6, -0.5? 5.27 Which is the second biggest value? (a) 87 (b) -2 (c) 0.2 (d) 5 d Which is the third smallest value? (a) 0 (b) 1/33 (c) -8 b Which is the third biggest value? (a) 0.03 (b) 2/3 (c) -1/3 (d) 0.5 (e) -76 a Which is the third biggest value? (a) -5 (b) 0.124 (c) -3 a Which is the second biggest value? (a) -7 (b) -1 (c) -6/7 b Which is the third smallest value? (a) 0.34 (b) 3/4 (c) 0.4 (d) 0.3 c Which is the third smallest value? (a) -0.2 (b) -1/10 (c) -3/2 (d) -120 (e) -2/15 a What is the fourth biggest value in 0, -3, -55, -2, -5? -5 Which is the fourth biggest value? (a) 244 (b) 2/19 (c) 0 (d) -1/10 (e) -1 d Which is the biggest value? (a) 4/5 (b) -2/3 (c) -0.4 (d) -8 a Which is the smallest value? (a) 372 (b) -0.1 (c) -4 (d) 5 (e) 2 c Which is the second biggest value? (a) 11 (b) 22 (c) -2 (d) -0.01 (e) 0.4 a Which is the second smallest value? (a) 1.86 (b) 4 (c) 2 c Which is the third smallest value? (a) 0.04 (b) 1.2 (c) 5 (d) 4 (e) -4/19 b What is the second smallest value in -5, -1.2, 40? -1.2 Which is the third smallest value? (a) -5 (b) 41 (c) 2/5 b Which is the second smallest value? (a) 57 (b) 20.9 (c) -2 b What is the second smallest value in -2/5, 0, 107, -1, 2? -2/5 Which is the second biggest value? (a) 2/5 (b) 1 (c) -0.1 a Which is the third smallest value? (a) -13 (b) -1/4 (c) 1/7 c Which is the fourth smallest value? (a) -0.4 (b) -3/2 (c) 3 (d) 825 d Which is the biggest value? (a) 3 (b) 5 (c) 7 c Which is the fourth smallest value? (a) -9 (b) -2 (c) 0 (d) -0.4 (e) 0.038 c Which is the third smallest value? (a) -0.03 (b) -4 (c) -10 (d) -1 d What is the third biggest value in 26, -4, 0, -8? -4 Which is the second smallest value? (a) -4 (b) 2/9 (c) -502 a Which is the smallest value? (a) -2/7 (b) 0 (c) -5 (d) 0.062 (e) -2 c Which is the second biggest value? (a) -5 (b) 2 (c) 4 (d) -3 b What is the third biggest value in 0, 8/7, 0.5? 0 What is the smallest value in -1, -92, 0? -92 Which is the second smallest value? (a) -0.6 (b) -0.05 (c) 2 b Which is the smallest value? (a) -1 (b) -3 (c) 1 (d) 0.1 (e) 94/35 b What is the third smallest value in 0.125, 3, 20? 20 Which is the second biggest value? (a) -4 (b) 3 (c) 1/4 c Which is the second smallest value? (a) 45 (b) 2 (c) 3 (d) -2 b What is the fourth smallest value in 4/3, -18, 4, -14, -5? 4/3 What is the third biggest value in -3, -2/39, -15? -15 What is the second smallest value in -2/19, -4, -0.5, -9, -3? -4 What is the smallest value in -4, -5, 1, -100/17? -100/17 What is the biggest value in -20, 1, 0? 1 Which is the smallest value? (a) -1.9 (b) -2/9 (c) 4/3 a What is the biggest value in 1, 9, 3/5, -0.4, 7? 9 Which is the second biggest value? (a) 1 (b) -4/5 (c) -21 b Which is the fifth biggest value? (a) -2 (b) -2/7 (c) 5 (d) 0.7 (e) -0.2 a What is the biggest value in 2.4, -2, -70? 2.4 Which is the second smallest value? (a) -1/7 (b) -2 (c) 1859 a Which is the third smallest value? (a) -1.8 (b) -2/7 (c) 0 (d) 2/3 c What is the second smallest value in -4, -1, 0, -2/7, -3.9? -3.9 Which is the third biggest value? (a) 0.4 (b) -6 (c) -4 (d) 0.73 (e) -0.5 e What is the second smallest value in -2925, 2/17, 0	{ "pile_set_name": "DM Mathematics" }
be v(0). Suppose -6 + 116 = -fp. Find the common denominator of -55/6 and (p/231)/((-12)/497). 18 Let n(u) = -2u*2 - 51u + 84. What is the least common multiple of 34 and n(-27)? 102 Let c be 223739/756((-24414)/3486 - -7). Let d = c + 1/4067. Let r = 12299 - 270525/22. Calculate the common denominator of d and r. 594 Let d = -2088 - -2094. Calculate the smallest common multiple of d and 534. 534 Calculate the lowest common multiple of 1150 and (-3 + (14 - 10))/((-1)/(-8)). 4600 Let h(t) = 2t*2 + 12. Calculate the smallest common multiple of h(3) and 96. 480 Let y = -22 + 37. Calculate the lowest common multiple of 0 + (3 + -234)/(-7) and y. 165 Let p = 797 - 6353/8. Find the common denominator of p and -7/10. 40 Let a be (-2 + 348/(-8))6. Let d = a - -1023/4. Let l = -113185/18 + 6284. Calculate the common denominator of l and d. 36 Let k(r) = 3r + 15. Let s be k(-11). Calculate the common denominator of -17/14 and 731/855/s. 126 Suppose -3n - 8 = n, 3z + 94 = -2n. Find the common denominator of z/(-50) + (118/(-320))/(-1) and 139/6. 96 Suppose -4r = -18 - 62. What is the least common multiple of 276 and r? 1380 Let k = -368 + 371. Let q(d) = -d*2 + 3d. Let h be q(3). Suppose 0 = -5v - hv + 115. Calculate the smallest common multiple of k and v. 69 Let j(f) = f*2 + 21. Let t be j(0). Calculate the common denominator of 17/9 and (-3)/((-83)/6 - (-7)/t). 9 Let q(t) = -7t. Let k be q(-9). Calculate the common denominator of (-31)/(-10) + -1 - 0 and k/294 + 3/(-1). 70 Let r be 12/18 + 1091/(-30). Suppose -6j + 2j = -116. Let x = r + j. What is the common denominator of x and -73/4? 20 Let m(z) = -7z - 187. Calculate the lowest common multiple of m(-29) and 546. 4368 Let b be (-20685)/(-20) + -9 - (-2)/8. Let p = b + -997. Calculate the common denominator of p and 79/12. 12 Let a be (6/9)/((-2)/12). Let g = -1067 + 1061. What is the common denominator of (-780)/495g/a and -3? 11 Let f be 8/28 + (-5021172)/154. Let l = f + 185012633/5676. Let y = l + -7/172. What is the common denominator of y and -7/18? 18 Suppose -39i = -37i + 12. Let z = -35757/5335 + 5/2134. What is the common denominator of z and (-1391)/312 - (-1 - 10/i)? 40 Suppose 17 = -3m + 4s, 0 = -3m - s + 4s - 15. Calculate the lowest common multiple of 13/(8 + -47) - 10/(-3) and ((-9)/1)/m3. 9 Suppose -5y - 9 = -69. What is the common denominator of -5/4 and 3/y - (0 - 37/(-2))? 4 Let u be 1/(-1)-1-2 - -4. Suppose 11h - 13h - 3f - u = 0, 0 = 2h + 2f. Calculate the lowest common multiple of h and 6. 6 Let h = 134 + -118. Let d(z) = z2 - 3z - 2. Let g be d(-3). Suppose 0w + g = 4w. What is the least common multiple of w and h? 16 Let m = 31 - 26. Suppose -b - b - 88 = -mg, -5g + 89 = -b. What is the lowest common multiple of g and 4? 36 Let n = 88 + -80. What is the least common multiple of 136 and n? 136 Let m = -50515 + 11163794/221. Let c = 3053/5083 - m. Find the common denominator of c and 38/11. 253 Let c = 8 - -12. Calculate the least common multiple of c and 5/1048 - 12. 60 Let l(o) = o + 15. Let u be l(-15). Suppose -3j - 4 + 22 = u. What is the lowest common multiple of j and 20? 60 Suppose 0 = h - 2n - 6, 2h - 4 - 2 = -2n. Calculate the least common multiple of 114 and h. 228 Find the common denominator of 27/16 and 77/14 - (-1422)/(-336). 112 Let u = -3431 + 339707/99. Find the common denominator of u and 13/6. 198 Let i(h) = 4747841h*3 - 5h*2 + 6h - 1. Let b be i(5). Let u = -3016065529381/5082 + b. Let v = -10/363 + u. Find the common denominator of v and -103/12. 84 Let c = -12/85 + 373/2040. Find the common denominator of c and 86/75. 600 Let g be 165/12 - 1/(-4). Suppose 3x - 7 - g = 0. What is the least common multiple of x and (-2 - 1) + 13 + -2? 56 Let i(f) = -5f - 76. Let k be 6/(-2 + (-22)/(-12)). Calculate the smallest common multiple of i(-16) and (6/9)/((-3)/k). 8 Suppose -5v - 3l = -92, -17 + 13 = -l. Calculate the least common multiple of 1956 and v. 7824 Let z = 236128/11 + -477755/22. Let s = z + 250. What is the common denominator of s and 8? 22 Let c = -2243/170 - -328/17. Calculate the common denominator of c and ((-82)/16)/(1 + -4). 120 Suppose 0 = -81b + 82b - 2. Suppose 4u = -0u - g + 193, -5g = 3u - 149. Calculate the lowest common multiple of b and u. 48 Let w = -252 - -264. What is the least common multiple of 126 and w? 252 Suppose 3u - 377 = -0u + 5l, 3u - 376 = 4l. Suppose -42 = 3z - 3w, -u = 5z + 4w - 18. Find the common denominator of 43/16 and ((-36)/(-48))/(11/z). 176 Let z = -4 - -8. Suppose g = 2w - 18, 0 = -g + zg + 6. Calculate the lowest common multiple of 20 and w. 40 Calculate the common denominator of 19/368 and (-4)/(-1150)2320/(-64). 1840 Let l(s) = 11s + 1. Let d = -23 + 22. Let z be l(d). Find the common denominator of 101/32 and (-1)/812/z. 160 What is the lowest common multiple of 42/(0 - -1) + (-26 - -32) and 5? 240 Let c(v) = -1838v2 + 2v - 1. Let x be c(-2). Let f = x + 4904. Let t = f + 24429/10. What is the common denominator of t and -13/16? 80 Let a(h) = h*2 - 7h - 8. Let q be a(8). Suppose -y + q + 6 = 0. What is the lowest common multiple of y and 6? 6 Let o(p) = 8p2 - 5p - 12. Calculate the least common multiple of 55 and o(2). 110 Let n = 693 - 678. Let w = -4 + 16. Calculate the lowest common multiple of n and w. 60 Calculate the lowest common multiple of 10 and (1456/(-260))/((-6)/615). 2870 What is the lowest common multiple of 4 and 36/6 + 4/3-3? 4 Suppose 0 = -4o - 80 - 280. What is the common denominator of 2 - (265/o - -3) and 89/8? 72 Suppose 2r + 270 = 7r. Suppose 7q = -2q + 108. What is the smallest common multiple of r and q? 108 Let q = -1588/7 - -13005/56. Calculate the common denominator of 339/36 - 1-2 and q. 24 Suppose -5a = 22 + 3, 4v + 68 = -4a. Let x be (21206/(-96))/(2445/v). Let b = 2/2445 - x. Find the common denominator of -15/22 and b. 132 Let b = -145 - -144. Let t(s) = 8s + 11. Calculate the least common multiple of t(b) and 8. 24 Let a = 424 + -418. Suppose -4l + 45 = l. What is the lowest common multiple of a and l? 18 Let v be 18861/10778 + (-2 - -2). Let c = v + 14/317. Calculate the common denominator of -45/8 and c. 136 Find the common denominator of ((-27)/21)/((-72)/48) and -45/149. 1043 Suppose 0 = 6h - 8h + 686. Suppose 2x - 8 = -2z + 132, -2z - h = -5x. Suppose x + 111 = 5a. Calculate the smallest common multiple of a and 12. 36 Suppose 41 + 9 = -2y. Calculate the least common multiple of 22 and 24/5y/(-10). 132 Suppose -f = 2v + 4, -5f - 5v - 8 = -v. What is the common denominator of (18/(-396))/(2/158) and -2 + f + 157/50? 550 Calculate the common denominator of 89/18 and (-4 - (-18)/5)/((-8)/(-490)). 18 Let r = 2687/5 - 1061/2. What is the common denominator of r and (-171)/7 + (-27)/(-63)? 10 Let r = 123 - 75. Suppose 5p - 2d = r, -2d - 28 = p - 4p. Calculate the lowest common multiple of 42 and p. 210 What is the lowest common multiple of 224 and 66 + 3 - (1 + -6 + 10)? 448 Let v = -1293 + 1453. Calculate the smallest common multiple of v and 352. 1760 Let k = 2791/354 + -3/59. Calculate the common denominator of k and 58/147. 294 Let t(o) = -49o + 451. Suppose 3u + 0u = 3z + 30, 2z + 62 = 5u. What is the smallest common multiple of u and t(9)? 70 Suppose 4z = -4 + 8. Suppose -10a - 20a = -90. What is the least common multiple of a and z? 3 Let y be -2 - (-4 + 0/3). What is the common denominator of (-87)/(-45) + (-1)/y and 79/8? 120 Suppose -22 = 4l - 86. Calculate the lowest common multiple of 4 and l. 16 Let a(p) = 24p2 - 20p + 19. Let r be a(13). Let f = r + -15181/4. Calculate the common denominator of -49 and f. 4 Let z = 3802 + -76079/20. Suppose -22 = -3k - 5a, -5k - 15 - 5 = -3a. Calculate the common denominator of z and ((-25)/6)/(k/4). 60 Let c be (-190)/(-7) - 3/21. Let i be (1 - -2648)/(c/36). Let g = i - 63457/18. Calculate the common denominator of g and -53/8. 72 Suppose 0 = 2p + 5p - 210. Calculate the lowest common multiple of ((-36)/14)/((-24)/112) and p. 60 Let l(r) = 4r - 3. Let c be l(1). Suppose 5 = -a + c. Calculate the common denominator of 31 + a - 1/2 and 85/16. 16 Suppose 9n = 8n + 4. Suppose 0 = z - nz +	{ "pile_set_name": "DM Mathematics" }
Let k = -3/19 - 1/114. What is the third biggest value in -2, k, 0.8, 0? k Let q be (-2)/(-4)8/1804. Let z = -885/7667 - q. Which is the biggest value? (a) 0 (b) z (c) 1 c Let s = -26 + 26.1. Suppose 0 = 5l + 9 + 11. Let z be (-40)/42 - (-2)/3. What is the third smallest value in l, z, s? s Let h be (-3)/9 + 4002608/33. Let i = h + -121420. Let u = 129 + i. Which is the second smallest value? (a) -0.4 (b) -1 (c) u a Let x = 1307/12236 + -1/644. What is the smallest value in -1, x, 3/4, 2/5? -1 Let x = 4 - 10. Let g = x - -11. Let u = -0.6 + -4.4. Which is the second biggest value? (a) u (b) -1/2 (c) g b Let s(o) = -o*3 - 7o*2 - o. Let p be s(-5). Let x be p/102/(-3). Let v = 5.4 + -5. Which is the biggest value? (a) 1/2 (b) x (c) v b Let o = 110 + -437/4. What is the third biggest value in o, 1, -2? -2 Let m be (-2)/4 + (-5)/(-2). Let d = -20 - -12. Let n = d - -9. Which is the second smallest value? (a) -1 (b) n (c) m b Let o = 0.8 - -1.2. Let b = -1522 - -2987/2. Let h = b - -28. What is the smallest value in h, o, 0.4? h Let n = -2 - -5. Suppose -w + 2 = -nw. Let r be 0 - (-3 - w - -3). Which is the biggest value? (a) 2 (b) -1/5 (c) r a Let z = 8 - 8.3. Let b = 6 + -6.3. Let u = z - b. What is the smallest value in -1, u, -0.3? -1 Let i = 0 - 5. Let c be i/(-30)9/(-4). Let w = 48 - 47.8. What is the third biggest value in c, 0.4, w? c Let p = -36 - -34. What is the third smallest value in 0.2, -2/3, p? 0.2 Let q = 32 - 37. Let k = 0.8 + -0.4. Let x = k - 0.3. Which is the second smallest value? (a) q (b) 5 (c) x c Suppose -26 = 5x - 6. What is the third biggest value in -5, -2, x? -5 Let y = 2 + -1.8. Let o = -32/35 + 5/7. Which is the second smallest value? (a) y (b) o (c) -1/6 c Let j = 27 - 24. What is the third biggest value in -0.4, 5, j? -0.4 Let t = 0 - 5. Let i = -91 + 89. Suppose w + 14 = -f + 5f, -5f - 3w + 9 = 0. Which is the second smallest value? (a) f (b) i (c) t b Let x = -170/3 + 56. What is the second smallest value in -2/17, 0.4, x? -2/17 Let t = 1.4 - -0.6. Let y be (2/(-8))/(1/(-2)). What is the second smallest value in t, 0.3, y? y Let n = -8 + 6. Let o = 0.11 - -5.89. Let i = o - 11. What is the smallest value in i, 0.5, n? i Let l = 0.24 - 0.1. Let j = -0.063 - -0.023. Let w = j + l. What is the second biggest value in w, 0.4, -5? w Let m = 3 + -2.5. Suppose -4b - 20 = 12. Let f be (b/(-6) - 1)0. What is the smallest value in -1, m, f? -1 Let x = 2.6 + -3.1. Let h = -1/52 - 49/156. Which is the third smallest value? (a) x (b) h (c) -2 b Suppose 3f - 10 = f. Let u = -55/6 + 28/3. Which is the biggest value? (a) f (b) -2 (c) u a Let l = -5.1 + 0.1. What is the third smallest value in l, 5, 4, 0? 4 Let y = -0.4 + 0.3. Let j = y - -1.1. Which is the second biggest value? (a) 2 (b) j (c) 0.3 b Let a = 1 - 2. Let n = 0.65 - 4.65. What is the smallest value in a, n, 5/2? n Let o = 3.4 - 3. Let h = 0.69 - 0.09. Let l = h + o. What is the smallest value in l, 1/4, -3/5? -3/5 Let s be (8/4-1)/(-6). Let r = -0.2 - -0.1. Which is the smallest value? (a) s (b) 0.1 (c) r c Let x = -21.4 + 21. Which is the second biggest value? (a) -0.06 (b) -3 (c) x c Let t = 15 - 10. Let i be 68/(-144) - (-2)/9. Which is the third biggest value? (a) 2/13 (b) i (c) t b Let n = -6 - -6.2. Let u = n - 0.6. What is the biggest value in -4, u, 1? 1 Let h = 10681/39 - 274. Let k = 113/273 + h. Let f = -0.7 - -1. Which is the biggest value? (a) k (b) f (c) 0.2 b Let s = -206 + 206.4. Let l be 4/6 + 10/(-24). Which is the third smallest value? (a) l (b) s (c) -0.2 b Let k = 158 - 68. Let l be 42/k - (-4)/(-6). Which is the third smallest value? (a) l (b) 4 (c) 1/4 b Let f be 39/60 - (-1)/(-4). Which is the third smallest value? (a) 1/7 (b) f (c) -0.3 (d) -0.1 a Let q = 0.8 + 2.2. Let o be (4/16)/((25/4)/5). Which is the biggest value? (a) o (b) -2 (c) q c Suppose -2p - 3k = -0k - 16, -5p + k + 6 = 0. Suppose pz - 2 = 4v, z = -z + 5v. What is the smallest value in z, -4, 2? -4 Let q = -6.6 - -1.6. What is the biggest value in q, 1/3, -4? 1/3 Let f = 1.1 + -0.1. Let m = 1.2 - 2.2. Which is the second smallest value? (a) 2/7 (b) f (c) m a Let s = -170.2 + 170. Let f = -19 - -77/4. What is the biggest value in f, 3, s? 3 Let w = -0.55 - -0.25. Suppose 4z = -n + 21, 2n + 3 + 5 = 2z. Which is the third biggest value? (a) w (b) -1 (c) n b Let g be ((-2)/(-1) - 12) + -4. Let y be (-2)/g(-4 - -3). Which is the biggest value? (a) -4 (b) y (c) 0 c Let p = 0.3 + -0.2. Let w = -1.9 + p. Let v = w + 2. Which is the second smallest value? (a) -4 (b) -0.5 (c) v b Let g = 0.2 - 0. Let t = g - -0.3. Let n = 0.2 + 0. Which is the second biggest value? (a) 4 (b) n (c) t c Let s be (-104)/(-306) - 16/72. Suppose 3f = 5a - 20, 2f - 4 = -f - a. What is the second smallest value in s, -0.3, f? f Let j = -1.8 - 9.2. Let r = j - -8. Let y = -2/41 + 45/82. Which is the biggest value? (a) y (b) r (c) -0.2 a Let k = 39 - 58. Which is the biggest value? (a) 0 (b) -2 (c) k a Let o be (-1 + 3)11/44. Which is the third smallest value? (a) -2/11 (b) o (c) 0.4 b Let z(h) = h2 + 3h + 3. Let o be z(-3). Let d = 3.2 - 3. What is the biggest value in -0.5, d, o? o Let m(y) = -2y + 1. Let j be m(-4). Let k(i) = -i - 9. Let v be k(-6). Let x be 3/j - (-2 - v). Which is the biggest value? (a) -0.3 (b) x (c) -2 a Let u = 19 - 41. Let r = u - -18. Which is the third smallest value? (a) -0.5 (b) r (c) -3 a Let i be (51/15 + -3)/((-6)/10). Let a = -3 + 3.2. What is the third biggest value in -0.5, i, a? i Let p be (28/42)/(-1 - -4). Which is the third smallest value? (a) p (b) -1/6 (c) 0 a Let z = -7 - -18. Let i = -8 + z. Let r = 8 - 12. Which is the third biggest value? (a) i (b) r (c) -2 b Let x be 112/(-231) - 6/(-9). Which is the third smallest value? (a) x (b) 4 (c) -1 b Let c be (2/(-6))/(6/(-36)). Let n = -0.4 - -0.1. What is the third smallest value in c, n, -0.1? c Let f(i) = i2 + 2i - 5. Let d be f(-4). Let p = 12 - 20. Which is the third biggest value? (a) d (b) p (c) -3 b Suppose 4m - 243 = 117. Let h be (-6 - -3 - -4)m. Let t be (-1)/(-2) - 33/h. What is the second biggest value in -5, 1, t? t Let n be (-31)/10 + 33/55. Which is the second smallest value? (a) -0.4 (b) n (c) 2/15 a Let b(j) = 0j + 0j + 0 + j - 2. Let g be b(-2). What is the third smallest value in -2, 4, g? 4 Suppose 14 = 5v - 6. Which is the smallest value? (a) v (b) 0.5 (c) 2 (d) 0.2 d Let v(q) = q. Let m be v(2). Let n = m - -7. Let o be -2 + (-3)/n - -2. Which is the third biggest value? (a) o (b) 2/9 (c) 0.4 a Let d = -29 + 26. Let i = -0.5 + -1.5. Which is the second smallest value? (a) 0.04 (b) i (c) d b Let n = -5.7 + 10.6. Let y = -5 + n. What is the third biggest value in y, -5, -2/5? -5 Let y = 85723/6 + -14220. Let l = -67 + y. What is the biggest value in l, -1, -2? l Let w = -11.3 + 10.9. Which is the third biggest value? (a) 2 (b) -0.1 (c) 0.5 (d) w b Let q be (6/(-9))/((3 - 5)-1). What is the third smallest value in 1/9, 1, q? 1 Let s be -4 + (45/39 - -3). Which is the fourth smallest value? (a) 3.5 (b) 0.4 (c) s (d) -4 a Let f = -12 + 17. What is the biggest value in 2, f, 1/11? f Let n = 0.7 - 1. Let g = 3 + -3.1. Let b = g - -3.1. What is the second biggest value in -0.5, n, b? n Let b = -29 - -28.8. What is the biggest value in 1/8, -1/8, 5, b? 5 Let z = 1.7 - 2.1. Which is the third biggest value? (a) -3 (b) -0.06 (c) z a Let k = 1.2 + -0.2. Let h = -0.8 + k. Let x = h + -0.3. What is the smallest value in 1, x, -5? -5 Let d = 0.03 - -0.37. Let w(v) = -v + 4. Let i be w(0). Suppose 0 - 4 = -iu. Which is the third biggest value? (a) u (b) d (c) -1/5 c Let g = -2.3 + 0.3. Let r = 3 + g. Let j = 0.2 - 1.2. What is the third smallest value in r, -2/7, j? r Let w(q) = q - 1. Let u be w(6). Let f = -4 + u. Let y = -145/3 + 48. Which is the biggest value? (a) -0.2 (b) y (c) f c Suppose -2k = -k + 3u + 22, -u = -5k - 46. Let q be 15/(-36)4/k. What is the biggest value in 0, q, -1/2? q Let t be (-1)/22 + 17. Let d be (-6)/4*t/84. Let j be 1/(-4) - 2/(-8). Which is the biggest value? (a) -1/2 (b) j (c) d b Let u = -1/12 +	{ "pile_set_name": "DM Mathematics" }
7c5 Expand (-14y - 52y - 23y)(2 + 1 - 1). -178y Expand (-3 + 1 + 1)(9 + 38q - 9)(9q - 2q2 - 9q). 76q3 Expand 5z*2 + 2z*2 - 5z2 - z2 + z*2 - 2z*2 + (-2z + 3z + z)(3 - 2z - 3) + 0 + 3z*2 + 0 + (0 - z + 1 + 1)(3 + 1 + 2)(5z - 3z - z). -7z*2 + 12z Expand (2 - 3 - 1)(d2 + 0d*2 - 3d*2) - 3d*2 - 3d*2 + 5d*2 + (0d + 0d - d)(-9d + 35d - 7d). -16d*2 Expand (-21 + 12z + 21)(0z + 0z2 + z + z2). 12z*3 + 12z*2 Expand (2 + 2 - 1)(-7w + 0w + 3w) - 24w + 15w - 18w. -39w Expand (0l*2 + 2l*2 - 17l + 8l)(l*3 - 1 + 1). 2l*5 - 9l*4 Expand (0 + 0 - 2i)(2i*4 + 0i*4 - 4i*4)(0 + 694 + 290). 3936i5 Expand -4f*3 - 20f*3 - 3f*3 + (-2 + f + 2)(-3f2 - 5f*2 + 3f*2) + 2f*3 - 3f*2 + 3f*2. -30f*3 Expand (3u*2 + 2u - u + u)(-24u - 74u - 25u). -369u3 - 246u*2 Expand (530 + 1347 + 445 + 366)(-3c2 + c2 + 0c*2). -5376c*2 Expand (-2 + 2 - 1)(0w + 0w - w) + 5790 - 5790 + 1164w. 1165w Expand -110q4 + 22q*3 + 2q*4 - 20q3 + (q4 + 2q3 - 2q*3)(5 - 1 - 3). -107q4 + 2q*3 Expand (-5c + 2c + 2c + (0 + 0 + 2c)(2 - 8 + 3))(112 - 242 + 109) + 2 - c - 2 + (-1 - c + 1)(2 + 2 - 2) + c + 3c - 3c. 145c Expand (30 - 22 - 26)(0 + 2q + 1 + 1). -36q - 36 Expand (57t2 - 191 + 191 + 2t*2 - 3t + 3t + (-1 + 1 + t)(-4t - 2t + 5t) + 8t2 + t2 - 2t2)(1 + 0 - 3). -130t2 Expand (0y - y + 2y)(35y - 79y + 200y + 374y). 530y2 Expand (0 - 6 + 1)(-2r4 + 2r*4 - 23r*5). 115r*5 Expand (4025u*2 - 4025u*2 + 269u4 + (u3 + u*3 + 0u*3)(u - 2u - u))(-1 + 1 + u)(6 - 4 - 3). -265u*5 Expand ((-1 + 0 + 3)(o - 2 + 2) + 2o + o - 4o + 4 - 4 + 4o + 1 + o - 1)(-1 + 2o2 + 1) + (2 + 2o*2 - 2)(3 - 3 + o). 14o3 Expand (-16 + 26 + 15)(4w + 4w - w + (4 - 2 + 0)(4 - 4 - w)). 125w Expand (-2t + t3 + 2t)(0t + t - 2t) + (t3 + 2t*3 + 9t*3)(-8t + 12t + 8t). 143t*4 Expand (12 - 425j + 851j - 423j)(-2 + 2 - 1). -3j - 12 Expand (37 - 37 - 31)(-4p - 2p + 5p)(4p*2 - 4p2 - p3). -31p4 Expand (3 + 4f - 3)(2 + 3 + 3)(16f - 2f - 5f). 288f*2 Expand (-5t + 0t + 3t)(17t*3 - 20 + 20) + (-3t - t + 2t)(-2t2 + 2t*2 + 2t*3) + t - t - 3t*4. -41t*4 Expand (66m - 45m + 29m)(0 + 2m + 0)(0 + 0 - 3)(-2m + 2m + 2m2). -600m*4 Expand -2q5 - q3 + q*3 + (0q*3 - 2q3 + q3)(-6 - 12 - 1075q*2 + 1072q2). q5 + 18q3 Expand -3m - 2m4 + 3m + (-m - 2m3 + m)(-1 + 1 + 2m) + (56m*3 - 15m*3 - 16m*3)(m - 2 + 2). 19m4 Expand 3l*4 + 2l*4 - 2l*4 + (5l - 3l + l)(130l - 14l*3 - 130l). -39l4 Expand 136u*4 - 71u - 137u4 + 24u - 2 + u*4 + 2 + 2u*4 + 0u*4 - 3u*4 + 3u*4 - 4u*4 + 2u*4 + (0u + 2u - u)(-1 + 2u3 + 1). 2u*4 - 47u Expand (0p + 0p + 2p2)(5p3 + 0p*3 - 2p*3) + 2p*5 + 0p*4 + 0p*4 + 1 + 47p*5 - 41p*5 - 27p*5. -13p*5 + 1 Expand -249r*2 + 528r*2 - 217r*2 + (0r - 3r + r)(-1 - 3 + 3)(-3r + 0r + 5r). 66r2 Expand (-4i*2 + 3i2 - i2)(-2 + 2 + 4i*2) + (-7i*3 + 3i*3 + 3i*3)(-2i + 57i + 12i). -75i*4 Expand (-3t + 0t + 5t)(-13t*3 - 14t*3 + 21t*3) + 3t*4 - 4t*4 + 0t4 + t2 - t2 + t4 + (-2t4 + 0t*4 + 0t*4)(5 - 2 - 2). -14t4 Expand ((13 + 48 + 22)(4 - 1 - 5) + 0 - 2 + 5)(u5 - 2u3 + u5 - u*5). -163u*5 + 326u*3 Expand (-2n + 0n + 0n)(1 + 2 + 5)(-3 + 2 + 0)(2 + 3n - 2). 48n2 Expand (-651 - 98 - 155)(-v*5 + 0v5 - v5). 1808v5 Expand (0z*2 + 0z2 + z2 + (-z + 4z - 5z)(-2z - z + z) + 2z + 2z*2 - 2z)(-8z*3 + 888 - 888). -56z*5 Expand (-3 + 7 - 3p*2 - 2)(3 - 6 + 2)(7 - 10 + 22). 57p*2 - 38 Expand -8h5 + 0 + 0 + (h3 - 4h3 + 10h*3)(2h2 - 3h*2 + 3h*2) + 7h*5 - 5h*5 - 6h*2 - 11h*2. 8h*5 - 17h*2 Expand (-26v + 43v - 18v + 3v - v - 3v + (-2v + 0v + 0v)(3 - 1 - 1))(4 - 2v*3 - 4). 8v*4 Expand (1 - 4 + 2 - 1 - 1 + 0 + 3 + 9 - 6 + (1 + 3 - 6)(-5 + 3 + 4) + 4 - 1 - 1 - 2 - 3 + 3 + 3 + 3 + 0)(-3u + 0u + 2u). -5u Expand -2v + 2v2 + 2v + (-4v + v - v)(5 - v - 5) - 2v2 + 4v*2 + 0v*2 + (-2v - 2v + 3v)(3v + v - 3v). 7v*2 Expand -158g*2 - 166g*2 - 2g*4 + 324g*2 + 97g + (-2 - 3g2 + 2)(-1 + g*2 + 1). -5g*4 + 97g Expand (0g2 - g2 - 2g*2)(10 + 0 - 3)(-131 - 22g + 131). 462g3 Expand (2 - 3 + 2)(-2s2 - s4 + 2s*2) - 304s*4 + 144s*4 - 49s4 + (s4 + 2s2 - 2s*2)(-5 + 3 + 1). -211s4 Expand (0z + z*2 + 0z + (0 - 3 + 1)(-4z*2 + 5z*2 - 2z2) - 2 + 2 + z2 + 0 + 15z2 + 0)(2z - 4z + 0z). -38z*3 Expand (-3f*2 - 22f + 15f + 21f)(2 - 2 + 2 - 4 + 1 + 1 + (-4 + 3 - 1)(2 + 1 - 4) + 0 + 6 - 4 + 4 + 1 - 3). -18f2 + 84f Expand -x*5 - 2x*5 + 5x5 + (-2 - x4 + 2)(-3x + 9x - 16x) + 5x3 - 4x*5 - 5x*3. 8x*5 Expand (5g - 31 + 3g + 32 + (-4 + 4 - 2)(3g - 4g + 3g))(1 + 5 - 4)(4 - 6 + 1 + (0 - 1 - 1)(-3 - 4 + 4)). 40g + 10 Expand -124 - 21t + 124 + (-2t + 2t - t)(-6 + 1 + 3) + t + 0t - 2t. -20t Expand 25b3 - 1 - 29b*3 - 34b*3 + (2b*2 - 4b2 + b2)(3b + 0b - 4b). -37b3 - 1 Expand (50u - 58u + 123u + (-u + 3 - 3)(0 - 3 + 2) + 0u - u + 3u - 3u - u + 3u)(-u + 3u - 4u + (3u + 0u - 2u)(2 - 1 - 2) - 2u + 2 - 2). -585u*2 Expand -6z + 6z + 3z3 + z2 - z*2 + 2z*3 + (5z - z - 2z)(-z*2 - 3z*2 + 2z*2) + 4z*3 - 2z*3 - 4z*3 - 88z*3 + 26z*3 - 74z*3. -137z*3 Expand 0g*4 + 10g*4 - 2g*4 + (-2g*2 + 3g - 3g)(-6g2 + 2g2 + g2) + 0g4 + g4 - 8g*4. 7g*4 Expand ((-2 + 3 + 3)(0 + 0 + 2) + (-3 + 2 + 2)(-2 + 4 - 3))(-31 + 31 - 4o). -28o Expand (3 + 3 + 1)(-3 + 3 - 3)(-4 - r + 4). 21r Expand (-1614 + 4940l - 1619 - 1614 + 4847)(-3l - l + 2l). -9880l*2 Expand (111 + 18 - 3)(4m - 2m - m) + 8m + 4m - m. 137m Expand (-2 + 3 + 1)(-28h2 + 2 + 49h*2 + 32h*2). 106h*2 + 4 Expand 2u*5 - 1 + 1 + (0u + 0u + u4)(u - 3u + u) + 13u - 13u + 30u*5. 31u*5 Expand (1 + 2 + 0)(-19g + 9g + 66g)(-2 + 3 - 3). -336g Expand (2z2 + z2 - 2z2)(4 - 4 - 2z) - 9z*3 + 3z*3 - 10z*3 + (-z + 5z + 2z)(3z2 - 4z*2 + 3z*2). -6z*3 Expand 84u*4 - 14u*3 - 161u*4 + 75u*4 + (-1 + 1 + 2u)(-u3 + 2 - 2) - 4u*4 + 3u*4 + 0u*4. -5u*4 - 14u*3 Expand ((-1 - 2 + 1)(2 - 1 - 3) - 1 + 3 + 0 - 3 + 5 - 5)(3 + 2d*4 - 3). 6d*4 Expand (64o*2 + 626o - 626o)(2o + 3o - 3o). 128o*3 Expand (-59q*2 + 62q2 + 13 - q2 + 4q)(4q - 2q - 4q). -4q*3 - 8q*2 - 26q Expand (m - 3m + 5m)(-25 + 3m*2 + 3m4 + 25) + (-m2 + 2m2 + 0m*2)(0m + 2m*3 + 0m) + 3m5 - m5 + m5. 14m*5 + 9m*3 Expand (16 - 25 + 32)(2 + 1 - 1)(-3 - 3m*2 + 3). -138m*2 Expand (-3 + 1 + 0)(-4272x2 - 71x*5 + 4272x*2) + (0x*4 + 5x*4 - 3x*4)(2x - 4x + 3x) + 2x*5 + 2x*4 - 2x*4. 146x*5 Expand (-2 - 4 + 5)(2k - 2k + 3k) - 34 + 19k + 34 + (-1 + 0 + 0)(-k - 4 + 4). 17k Expand 5j5 - 3j*5 - 3j*5 + (0j*3 + 0j*3 - 2j*3)(-j2 - j2 + 0j2) - 17j*5 - 8j*5 + 134j*5. 112j*5 Expand (0 + 0 + 2)(-2m + 6m - 3m)(0m + 0m - m + (2m + 2m - 2m)(-7 + 1 + 1)). -22m2 Expand (-9f*2 - 7 - 6f + 10f - 7f)(2f - f + 3f). -36f*3 - 12f*2 - 28f Expand (52b2 - 84b*2 - 117b*2)(-b - b*3 + 0b*3 + 3b). 149b5 - 298b3 Expand (u2 - u2 - u3)(-u2 + 0 + 0) + 2u*5 - 3u*2 + 3u2 - u5 + 2 - 2 + u*5 - u + u + (4u*3 - 6u*3 + 0u*3)(7u2 - 7u + 7u). -11u*5 Expand (8p + 7p - 9p)(-2 + 11 - 3). 36p Expand (-4b + 4b - b*2)(10b + b - 4b + 4b - b - 4b - 2b + 2b + 2b + (1 - 4 + 1)(-2b - b + b))(b + 2b + 0b). -36b4 Expand (-1333 - 50v + 1333)(-1 - 4 + 6)(-1 - 4 + 4). 50v Expand (20v + 4v2 - 20v + 3)(v - 4v + 7v). 16v*3 + 12v Expand -8 - 3n3 + 8 + 0n*3 - 7n*3 - 7n*3 + (-1 + 2 + 0)(0n2 + 0n2 - n3). -18n3 Expand (27b + 8 - 5 - 4)(b + 2b - 2b). 27b*2 - b Expand -4g - 6g + 6g + (-g + 2g - 2g)(7 - 11 - 6). 6g Expand (0h + 0h - 2h*2)	{ "pile_set_name": "DM Mathematics" }
? -2, -1 Suppose -3l + 0l + 9 = 0. Suppose 5d = -5c + 25, lc - d - 2 + 7 = 0. Let -1 + y3 + 3y*2 + cy - 2y2 - y = 0. What is y? -1, 1 Let j(x) be the first derivative of 7x*4/8 - 11x*3/2 + 8x*2 + 6x + 63. Determine q so that j(q) = 0. -2/7, 2, 3 Let u be (-2 + (-8)/(-6))-3. Suppose x + 4a + 12 = 5x, 0 = ua. Factor -1/7c2 + 0 + 2/7c - 3/7cx. -c(c + 1)(3c - 2)/7 Let h = 1255 - 1248. Let v(r) be the second derivative of -2/15r6 + 0 - 1/5r*5 + 13r + 0r3 + 1/3r*4 + 0r*2 + 2/21r*h. Factor v(o). 4o*2(o - 1)*2(o + 1) Let c = -61 + 64. Solve -z - 21z2 - 15z*4 - 27z*c - 5z - 3z5 + 14 - 14 = 0. -2, -1, 0 Let m = 206268/39665 + -2/7933. Find s such that ms*2 + 14/5s*4 - 6s*3 - 2/5s*5 + 0 - 8/5s = 0. 0, 1, 4 Find q such that -35/2q - 35/6q*2 + 45/2 + 5/6q*3 = 0. -3, 1, 9 Let m be -11 + (14/9)/(166/1494). Factor 16/5o*2 + 0o + 0 + 4/5om. 4o*2(o + 4)/5 Let c(y) be the first derivative of -1/6y4 + 0y + 8/9y3 - 33 + 0y*2. Suppose c(d) = 0. Calculate d. 0, 4 Let n(h) be the third derivative of 0h + 9/2h3 - 15/8h*4 - 10h*2 - 1/40h*6 + 7/20h*5 + 0. Let n(w) = 0. What is w? 1, 3 Solve r + 2/3 + 1/3r*2 = 0 for r. -2, -1 Let b(t) be the first derivative of 3t6/40 + t5/20 - t*4/3 - 2t3/3 + t2/2 - 5. Let l(s) be the second derivative of b(s). Factor l(j). (j - 1)(3j + 2)*2 Find d such that 13 + 5d - 2d2 - 2d*3 + 2d3 + d5 - d*4 - 10 - 6d*3 = 0. -1, 1, 3 Let x(m) = 5m - 15. Let w be x(5). Suppose 0 = f - 2b - w, -3f + 12 = -3b - 6. Factor 0r*2 + 0rf - r2 + 9 - 5. -(r - 2)(r + 2) Suppose 10 = -33m + 38m. Let h(g) be the first derivative of 0g*m + 0g - 2/39g3 + 3. What is d in h(d) = 0? 0 Let z = -42/73 + 944/1387. Factor 4/19i + zi4 + 0 + 8/19i*3 + 10/19i*2. 2i(i + 1)2(i + 2)/19 Let t(f) = -f*3 - 6f*2 - 10f - 1. Let h be t(-2). Solve -33/2o4 + 15o*2 + 15/2o*5 - 21/2o + 3oh + 3/2 = 0 for o. -1, 1/5, 1 Solve -2/5 - 4/5l - 6/5l4 + 4/5l*3 + 8/5l2 = 0 for l. -1, -1/3, 1 Let k(y) be the second derivative of -y6/360 - 7y5/120 + 8y*3/3 + 7y. Let v(n) be the second derivative of k(n). Factor v(i). -i(i + 7) Let h(c) = c2 - 5c - 11. Let q be h(7). Factor -32x2 + 128x*3 - 6x - 8x + 3x + 2 + qx. 2(4x - 1)2(4x + 1) Let d(z) be the second derivative of 5z*4/12 + 235z*3/6 + 191z. Suppose d(y) = 0. Calculate y. -47, 0 Let y(p) be the third derivative of -p*8/21 + 2404p*7/105 - 482401p*6/120 + 812015p*5/3 - 1003750p*4/3 + 500000p3/3 + p2 - 530. Factor y(d). -(d - 100)*3(4d - 1)2 Suppose 5a = 20, -3w + 2a = 8 - 6. Let -2/3sw - 2/3 - 4/3s = 0. Calculate s. -1 Let p(c) = 4c4 + 6c3 + c2 + 4c. Suppose 2r - 48 = -18. Let x(k) = k4 + k3 + k. Let t(d) = rx(d) - 3p(d). Suppose t(h) = 0. Calculate h. -1, 0, 1 Let n(w) be the second derivative of -5/18w3 - 2/3w*2 - 1/72w*4 + 20w + 0 + 1/120w5. Find b, given that n(b) = 0. -2, -1, 4 Let c(h) = 56h*2 - 328h - 392. Let r(v) = -v*3 - 225v*2 + 1308v + 1568. Let g(y) = 18c(y) + 4r(y). Factor g(n). -4(n - 14)2(n + 1) Let m = -97 - -101. Factor -2w4 - m + 6w*2 + 21w*3 - 34w*3 - 2w + 15w3. -2(w - 2)(w - 1)(w + 1)*2 Let a = 31 - 25. Let t be 16/203/a. Find h, given that 2/5 - 4/5h - th*4 + 0h*2 + 4/5h*3 = 0. -1, 1 Factor 1/4q*3 - 17/2q - 9/4q2 - 6. (q - 12)(q + 1)(q + 2)/4 Let q(z) be the second derivative of z5/20 + 19z*4/12 + 56z*3/3 + 96z*2 - 332z. Factor q(a). (a + 3)(a + 8)2 Let h(d) be the first derivative of d5/10 - d4/4 - d3/6 + d2/2 + 28. Let h(w) = 0. What is w? -1, 0, 1, 2 Let u(s) = -s2 + s - 1. Let t(g) = -4g*2 - 38g - 40. Let x(p) = -2t(p) + 4u(p). Let x(h) = 0. What is h? -19, -1 Let t(n) be the second derivative of -2n + 1/30n*5 + 1/9n*4 + 4 + 1/9n*3 + 0n*2. Factor t(l). 2l(l + 1)2/3 Let j(m) be the third derivative of 3m*2 + 62/15m*5 + 12/5m*6 + 0 + 0m*7 + 4/3m*3 + 0m + 19/6m4 - 9/28m*8. Let j(y) = 0. What is y? -1, -1/3, 2 Let w(o) be the first derivative of -1/2o*3 + 12o*2 + 29 - 96o. Solve w(d) = 0. 8 Factor -5/2f3 - 10f*2 + 0f + 0. -5f2(f + 4)/2 Factor -27z + 0 + 3/2z*3 - 9/2z*2. 3z(z - 6)(z + 3)/2 Factor -4j3 + 1494 + 336 + 164j*2 - 230 - 1760j. -4(j - 20)2(j - 1) Suppose 3f + g = -g + 4, -2f - 8 = 4g. Let j be f19/12. Factor 4y*3 - 4y - 3y3 + jy3 + y4 - 4 + 3y2 + 0. (y - 1)(y + 1)(y + 2)2 Let m be (-13 + 1 - -12)/21. Suppose -2/5c*3 + 0 + mc + 2/5c2 = 0. What is c? 0, 1 Let n(d) be the third derivative of d5/180 + 133d*4/36 + 17689d*3/18 - 667d2. Factor n(x). (x + 133)2/3 Let b(o) = -o*2 + 10o - 19. Let t be b(7). Let a be (8/48)/(t/6)0. Factor as + 0s3 + 2/3s*2 - 1/3 - 1/3s4. -(s - 1)2(s + 1)2/3 Let k(y) = y5 + 2y4 + y3 - 2y2 - 2. Let c(r) = 2r5 - r4 - r*3 + 4r*2 + r - 5. Let h(m) = c(m) - k(m). Factor h(f). (f - 3)(f - 1)*2(f + 1)2 Let w(m) = m4 - 8m3 + 3m*2 - 6m. Let l(y) = -3y4 + 20y*3 - 7y*2 + 14y. Let a(p) = -3l(p) - 7w(p). Determine g so that a(g) = 0. 0, 2 Let c(q) = 5q2 - 288q + 12165. Let n(h) = -9h2 + 584h - 24331. Let z(g) = -10c(g) - 6n(g). Factor z(o). 4(o - 78)2 Let 2/7w*5 - 8/7w*4 + 46/7w + 20/7 + 20/7w2 - 16/7w*3 = 0. Calculate w. -1, 2, 5 Let o(t) be the first derivative of 6t - 24 + 5/2t2 + 1/3t*3. Factor o(h). (h + 2)(h + 3) Suppose -19w + 453 = -1998. Let d = w + -126. Solve 0 + 2/5v - v*d - 3/5v*2 = 0 for v. -1, 0, 2/5 Let r = -1328 - -1328. Let m(k) be the third derivative of 0k*6 + 0k*4 + 1/90k*5 - 1/315k*7 + 0k*3 + 11k*2 + r + 0k. Solve m(u) = 0 for u. -1, 0, 1 Suppose 5l + 3g = -17, -4g = -4l - 5g - 15. Let y be ((-21)/(-28))/((-3)/32l). Find w such that -3/5w + 3/5w*y + 0 = 0. 0, 1 Let y be (-87)/(-207) - ((-2)/30 + 28/70). Solve -4/23s + 0 + 2/23s2 + ys*3 = 0. -2, 0, 1 Let -13 + 14x + x*2 - 33x - 13 - 6x = 0. Calculate x. -1, 26 Suppose -4k + 40 = -9k. Let z be 30/7 + k/28. Suppose -15i*3 - 2i*4 - 10i + 17i3 + 6i*2 + 0i + z = 0. What is i? -2, 1 Factor 23/4 - 1/4a3 - 23/4a*2 + 1/4a. -(a - 1)(a + 1)(a + 23)/4 Suppose 19r - 539 = -58r. Suppose -5i - n + 12 = -i, -2i + 6 = 4n. Factor 4b4 + b2 + b*2 - 3b2 - b5 - 3bi - rb4. -b2(b + 1)3 Let l = -437659/505 - 217/101. Let i = l - -876. Find z, given that -28/5z*2 + 4/5z*5 + iz*3 - 4z*4 + 8/5z + 0 = 0. 0, 1, 2 Suppose -8q - 26q*3 - 8/9 - 8q*4 - 214/9q*2 = 0. What is q? -2, -2/3, -1/3, -1/4 Let x(g) = 2g*3 - 104g*2 + 70g + 38. Let m(f) = 2f3 - 208f*2 + 140f + 77. Let o(u) = 6m(u) - 11x(u). Factor o(s). -2(s - 1)(s + 11)(5s + 2) Let m(s) be the first derivative of 4s5/35 - 16s3/21 - 78. Find i, given that m(i) = 0. -2, 0, 2 Let n(g) = -g2 - 35g + 4. Let a be n(-35). Let u(p) be the second derivative of 5/4p*a + 2p + 0 - p*3 + 0p*2. Let u(h) = 0. Calculate h. 0, 2/5 Let s = -9/86 + 221/1290. Let k(p) be the third derivative of sp*3 + 0p + 1/150p5 - 1/30p*4 + 0 + 7p*2. Factor k(r). 2(r - 1)*2/5 Let c(v) be the first derivative of -15v*4/16 + 11v*3/4 - 3v*2/4 + 59. Determine u, given that c(u) = 0. 0, 1/5, 2 Let s be 0/(-1)(-197)/591. Determine l, given that s + 96/7l2 + 2/7l*4 - 26/7l*3 - 72/7l = 0. 0, 1, 6 Let 0 + 2/5l3 + 0l + 24/5l2 = 0. Calculate l. -12, 0 Let w = -152/15 - -34/3. Let s = -90 - -93. Determine z, given that 8/5z*s - wz*2 - 2/5z*4 + 8/5 - 8/5z = 0. -1, 1, 2 Let z(i) = i*2 + 2i + 5. Let o be z(-7). Suppose 3d + 2d = o. Solve 4 + 4m2 + m2 - m2 + dm = 0. -1 Let m(j) be the third derivative of 0j + 7/30j*6 + 0 + 13/6j4 + j5 + 8/3j3 + 2/105j*7 + 24j*2. Suppose m(o) = 0. Calculate o. -4, -1 Let d(v) be the third derivative of 0v*3 + 0v + 1/270v5 + 5/108v*4 + 0 + 38v*2. Factor d(y). 2y(y + 5)/9 Let w(m) be the third derivative of -1/24m*3 + 1/1680m*7 + 0 - 1/160m*5 + 0m + 2m2 + 5/192m*4 - 1/960m6. Factor w(q). (q - 1)3(q + 2)/8 Let f = -9 + 9. Let d be -2 - (f - -1 - 9). Solve 2z2 + z2 + 0	{ "pile_set_name": "DM Mathematics" }
m in 14, 20, 26? 32 What is next in 16, 17, -4, -53, -136? -259 What is the next term in 62, 80, 102, 122, 134, 132, 110, 62? -18 What is the next term in 1081, 2162, 3243, 4324, 5405, 6486? 7567 What is the next term in -1440, -2881, -4322? -5763 What comes next: -43, -51, -65, -85, -111? -143 What comes next: 410, 408, 406? 404 What comes next: -22, -87, -192, -337, -522, -747, -1012? -1317 What comes next: 11, -21, -67, -121, -177, -229, -271? -297 What comes next: -5, 42, 119, 226, 363, 530? 727 What is next in 1035, 1042, 1049, 1056? 1063 What is next in -277, -315, -355, -397? -441 What comes next: -1578, -3155, -4732, -6309? -7886 What is the next term in -720, -1434, -2148, -2862, -3576, -4290? -5004 What is next in 1940, 1938, 1936, 1934, 1932? 1930 What is the next term in -9828, -9827, -9826, -9825? -9824 What is next in 1935, 1934, 1933? 1932 What is next in -18, -66, -146, -258? -402 What is the next term in 2210, 2217, 2234, 2267, 2322, 2405, 2522? 2679 What is next in -13, -52, -161, -376, -733, -1268? -2017 What is the next term in -11, -83, -285, -683, -1343? -2331 What is the next term in -16, -20, -22, -22, -20? -16 What comes next: -9, -17, -27, -39, -53? -69 What is the next term in 37, 49, 67, 91, 121, 157, 199? 247 What comes next: -3774, -7550, -11326, -15102, -18878, -22654? -26430 What is the next term in 10, 29, 60, 103, 158, 225, 304? 395 What comes next: 394, 778, 1162, 1546, 1930? 2314 What is the next term in 127, 503, 1131, 2011, 3143, 4527? 6163 What comes next: -45, -83, -121? -159 What comes next: -82, -86, -90? -94 What is the next term in -3193, -3194, -3195, -3196, -3197? -3198 What comes next: -743, -755, -767? -779 What is next in -68, -294, -904, -2090, -4044, -6958, -11024? -16434 What is next in -88, -182, -264, -328, -368, -378? -352 What is the next term in -5, 10, 51, 130, 259, 450, 715, 1066? 1515 What comes next: 171, 341, 511, 681? 851 What comes next: 125, 559, 1277, 2273, 3541, 5075, 6869, 8917? 11213 What is the next term in 180, 374, 578, 792, 1016, 1250, 1494? 1748 What comes next: -89, -88, -89, -92, -97? -104 What comes next: -1619, -1654, -1701, -1766, -1855, -1974, -2129? -2326 What comes next: -511, -510, -509? -508 What comes next: 476, 474, 470, 464, 456, 446? 434 What is the next term in -103, -101, -99, -97? -95 What is the next term in -457, -456, -455, -454? -453 What comes next: 57, 237, 537, 957, 1497? 2157 What comes next: -11, -75, -191, -365, -603, -911? -1295 What comes next: 2093, 2098, 2099, 2090, 2065, 2018, 1943, 1834? 1685 What is the next term in 1594, 3184, 4774? 6364 What comes next: -172, -359, -560, -781, -1028, -1307, -1624? -1985 What is the next term in 5, 46, 101, 176, 277? 410 What is the next term in -144, -192, -240? -288 What is next in 28, 23, 28, 55, 116, 223? 388 What is the next term in -81, -139, -259, -471, -805? -1291 What is next in 57, 74, 101, 138? 185 What is next in 131, 140, 155, 176, 203? 236 What is the next term in -54, -116, -184, -258, -338? -424 What is next in -259, -255, -225, -163, -63, 81, 275, 525? 837 What is the next term in -40, -29, -4, 41, 112, 215? 356 What is the next term in 0, 28, 54, 78? 100 What is the next term in -3735, -3729, -3721, -3711, -3699, -3685, -3669? -3651 What is next in 1032, 1038, 1046, 1056, 1068? 1082 What is the next term in 40, 205, 480, 865, 1360? 1965 What is next in 131, 530, 1187, 2096, 3251, 4646, 6275, 8132? 10211 What is next in -1, 6, 17, 32? 51 What is the next term in -2, -13, -32, -59? -94 What is the next term in -542, -538, -536, -542, -562, -602? -668 What is next in 4405, 4407, 4411, 4417, 4425, 4435, 4447? 4461 What comes next: -533, -520, -507, -494, -481, -468? -455 What is the next term in 841, 836, 829, 820, 809? 796 What is next in 17, 31, 39, 41, 37? 27 What is next in -17, -35, -49, -59, -65, -67, -65? -59 What comes next: -1078, -1061, -1044, -1027? -1010 What is the next term in -73, -79, -85? -91 What is next in -9, -20, -35, -54, -77, -104? -135 What comes next: 5438, 5439, 5440, 5441, 5442? 5443 What comes next: 7670, 7661, 7640, 7601, 7538, 7445, 7316, 7145? 6926 What comes next: -18, -26, -38, -54, -74? -98 What is next in 22, 76, 168, 298, 466, 672? 916 What is the next term in 3, -10, -27, -48, -73? -102 What comes next: 4142, 4143, 4144, 4145? 4146 What is the next term in -401, -486, -627, -824? -1077 What comes next: -13, -18, -9, 20, 75, 162? 287 What is the next term in 36, 48, 74, 120, 192? 296 What is next in -13, -75, -179, -325, -513, -743? -1015 What is next in -27, -3, 43, 117, 225, 373? 567 What is the next term in -268, -528, -780, -1024? -1260 What comes next: 23407, 23406, 23405, 23404? 23403 What is next in -3080, -3078, -3076, -3074? -3072 What comes next: 7142, 14282, 21422, 28562, 35702? 42842 What is next in -34, -31, -24, -13, 2, 21, 44? 71 What is the next term in 7, -9, -43, -95, -165, -253? -359 What is the next term in 71, 275, 611, 1073, 1655, 2351, 3155? 4061 What comes next: -301, -597, -887, -1171, -1449? -1721 What is next in -8598, -17196, -25784, -34356, -42906, -51428, -59916? -68364 What comes next: 93, 92, 91? 90 What comes next: -31, -25, -17, -7, 5, 19? 35 What comes next: 53, 59, 67, 77, 89, 103? 119 What is the next term in 32036, 64071, 96106? 128141 What comes next: -743, -728, -713, -698? -683 What comes next: 363, 741, 1119, 1497, 1875? 2253 What comes next: 65, 73, 93, 131, 193, 285, 413? 583 What is next in 68, 70, 72, 74, 76? 78 What is next in -46, -74, -100, -130, -170, -226, -304, -410? -550 What is the next term in 104, 97, 84, 65? 40 What is next in -5, 27, 127, 331, 675? 1195 What is next in 144, 142, 138, 132, 124? 114 What comes next: -1843, -1841, -1839, -1837, -1835? -1833 What comes next: -13448, -26898, -40348, -53798? -67248 What is the next term in -263, -262, -261, -260? -259 What is next in -13, -8, -13, -34, -77, -148? -253 What is next in -26, -75, -154, -263, -402? -571 What comes next: 45, 30, 15? 0 What comes next: 309, 318, 333, 354? 381 What is the next term in -20, -38, -16, 88, 316, 710? 1312 What is next in -1, -2, -15, -46, -101, -186, -307, -470? -681 What comes next: -11, -10, 13, 70, 173, 334? 565 What comes next: 21, 24, 41, 78, 141, 236, 369, 546? 773 What is next in 2154, 2153, 2152? 2151 What comes next: -7, -59, -195, -457, -887, -1527, -2419, -3605? -5127 What is next in 105, 431, 975, 1737, 2717, 3915? 5331 What comes next: -3471, -6930, -10387, -13842, -17295, -20746? -24195 What is the next term in -13, -19, -31, -55, -97, -163, -259, -391? -565 What comes next: -74, -78, -82, -86, -90? -94 What is next in 1106, 1102, 1096, 1088, 1078, 1066, 1052? 1036 What is next in 30, 60, 92, 126, 162, 200, 240? 282 What comes next: 659, 1307, 1953, 2597? 3239 What comes next: 178, 189, 216, 265, 342, 453, 604, 801? 1050 What comes next: 1669, 3336, 5003, 6670, 8337, 10004? 11671 What is next in -35, -169, -385, -677, -1039, -1465, -1949, -2485? -3067 What is next in 318, 320, 308, 276, 218, 128, 0? -172 What comes next: -37, -34, -17, 20, 83, 178? 311 What is next in -29, -18, 9, 58, 135, 246, 397, 594? 843 What is next in -354, -352, -348, -342, -334, -324? -312 What is the next term in 79, 142, 225, 322, 427? 534 What is the next term in -255, -273, -293, -315? -339 What is next in 19, 50, 81, 112, 143? 174 What is next in -163, -161, -159? -157 What comes next: 34, 51, 58, 55, 42, 19, -14? -57 What is the next term in -84, -85, -86, -87? -88 What is next in 69, 140, 217, 306, 413, 544? 705 What comes next: -11, -17, -23? -29 What is next in -251, -242, -229, -212? -191 What comes next: 38, 33, 20, -7, -54, -127? -232 What is the next term in -1575, -1577, -1581, -1587, -1595, -1605? -1617 What is next in -1968, -1964, -1950, -1920, -1868, -1788, -1674, -1520? -1320 What is next in -460, -920, -1380, -1840? -2300 What comes next: 3, 14, 27, 36, 35, 18, -21? -88 What is next in -32, -30, -30, -32? -36 What comes next: -189, -361, -537, -717, -901, -1089, -1281? -1477 What is next in -7, -13, -35, -73? -127 What comes next: 383, 739, 1097, 1457, 1819? 2183 What comes next: 49, 51, 63, 91, 141, 219, 331? 483 What is next in 530, 530, 520, 494, 446, 370, 260? 110 What is the next term in 284, 283	{ "pile_set_name": "DM Mathematics" }
4159242 = -12f. Is f a composite number? False Let a(t) = -t2 - 21t - 52. Let i be a(-3). Is (i/(-1))/(62/(-16151)) a composite number? False Let t(l) = -2l3 + 4l*2 + 7l - 10. Let d = -342 + 334. Is t(d) a composite number? True Is (-1)/(-4) - -2667458/96 composite? False Suppose 2 + 1 = -3k, z = -5k - 161. Let x be (508 - 1) + -4 + (7 - -1). Let a = x - z. Is a a composite number? True Let h = 117167 + 79262. Is h a composite number? False Let o be (-5)/((-15)/(-3)) + 4. Suppose -ou = 1 - 7. Is u/6 - 7998/(-9) a prime number? False Let l(q) be the second derivative of 2477q5/20 - q4/6 - q3/3 + q2 + 13q. Let m be l(1). Suppose 290 = 5x - m. Is x a prime number? False Let z be (-581)/(-1) - (2 + -6). Suppose -10 + z = 5x. Let v = 90 + x. Is v prime? False Let t = 664 - 930. Let m = 491 - t. Is m prime? True Is (-66)/792 - 58045/(-12) a composite number? True Is (-50782)/(-6)(90 - 69) prime? False Suppose 0 = 66r - 64r - 1042. Is r6/(6 + 0) composite? False Let x(l) be the third derivative of 34l5/15 + l4/12 + 23l*3/6 - 9l*2 + 2l. Is x(-5) prime? True Let y = -25974 + 179585. Is y a composite number? False Let t be -1 + (-65)/(-75) - (-10264)/30. Let q = -2600 - t. Is (-26 + 23)q/6 a prime number? True Let l be (5 + (-2)/2)20/16. Suppose -2q = lq - 21217. Is q a prime number? False Let u be 144/648 - (-874105)/9. Suppose u = 4x + 3o - 12507, -4o - 54826 = -2x. Is x a composite number? False Suppose -25054 = 15v - 218239. Suppose -f + g + g = -v, -2g - 25760 = -2f. Is f prime? False Is (-8555382)/(-26) - (-6 - 640/(-104)) prime? True Let v = -7958 - -10017. Is v a composite number? True Suppose u + 7u = -512. Let d = 16 - u. Is ((-420)/d)/((-2)/8) prime? False Let o be (1/(-1))/(12/(-60)). Suppose 0 = -od + 2i - 8, i + 4 = -d + 2i. Suppose -5k + 5990 + 9335 = d. Is k a prime number? False Suppose -53v + 3i + 63535 = -52v, 0 = -3i - 12. Is v composite? True Suppose -v + 28036 + 14748 = 3r, r + 171201 = 4v. Is v a composite number? True Let u(h) = -55h3 - 3h*2 - 2h + 1. Let z be u(-1). Is ((-22)/z)/((12/225410)/(-3)) a prime number? True Is 8654/4(9/(-6) - 95/(-2)) a composite number? True Let k = -145 - -207. Is 337156/k - (-2)/(-2) a composite number? False Let u(x) = -5x3 + x2 - 2x - 3. Let v be u(-1). Suppose vd - 1137 = -t, 2t - 541 = 3d + 1798. Suppose t = -5a + 4067. Is a a composite number? True Let j = 175 + -170. Suppose 0 = -js + t + 9924, 5954 = 5s - 2s - t. Is s composite? True Let f(o) be the first derivative of o*2 - 34o - 2. Let v be f(19). Suppose -946 = -2s - 2s + 3z, 2z = -v. Is s prime? False Is (4 + -3)16/(208/4525001) composite? False Suppose -2q + 266 = -5f - 376, 4 = f. Let g = -8 - -54. Let d = q + g. Is d composite? True Let j(r) be the first derivative of -24 - 13r - 1/3r3 + 1/4r*4 - 3r*2. Is j(6) composite? False Is (286383/(-4))/(361/(-76) - -4) a prime number? True Suppose 4n - 3c - 2c - 100935 = 0, -2n - 2c + 50472 = 0. Let s = -15228 + n. Is s a composite number? False Suppose -7 = -5l - 2c, -12c = -14c - 8. Suppose 0 = lx - 1669 - 998. Is x prime? False Suppose 0 = -3u - 4f + 103183, 2u = 23f - 22f + 68785. Is u a composite number? True Let i = -268 - -293. Is (-5494)/(-5) + -2 + 5/i prime? True Let s = 106980 + -14101. Is s composite? True Let f = 266651 + -184264. Is f a prime number? True Is (1/11)/(12/3815436) a prime number? False Let h(s) = -401s + 27. Let t = 34 - 29. Let f(r) = 601r - 40. Let w(m) = tf(m) + 8h(m). Is w(-9) composite? True Let m = -81428 + 231745. Is m composite? True Suppose -5m + 394 = 29. Suppose 114 = q - 5. Let f = q - m. Is f a prime number? False Let b(t) = -3t3 + 7t*2 + 29t - 110. Is b(-21) a prime number? False Suppose -9a = -125880 - 68760 + 2733. Is a prime? True Let q = 1525 - -422. Let f = q + -1262. Is f composite? True Let h(i) = 1869i + 1292. Is h(3) a prime number? True Suppose 4p - 2t - 20 = 0, 5p = -5t - 4 - 1. Let s(d) = 7dp - 4 - 2d*2 - 10 - 4d + 9 + 11d3. Is s(6) a prime number? False Suppose 4c + q = 5q + 18892, 0 = -c - 2q + 4711. Suppose -2j = -u + c, -j = u - 2242 - 2480. Is u composite? False Let r be 36922 + 7/7. Suppose 4a + h - 7285 = 3531, 3a - h = r. Is a prime? False Let a = 9499 - 4774. Suppose 5d = 4i + 2084 + a, 2i + 2724 = 2d. Is d prime? True Let q = 499 - 74. Suppose 13b + 342 = -q. Let r = b + 270. Is r composite? False Suppose 3h - 379 = -70. Let k = 694 + h. Is k prime? True Let i = 123 + -217. Let h = 63 - i. Is h prime? True Let b(g) = g*2 - 2g + 1. Let t(n) = -129n2 - 22n + 36. Let h(d) = 5b(d) - t(d). Is h(-6) a prime number? True Suppose g - 23276 - 31995 = 4r, -2r = -4g + 221154. Is g a prime number? True Suppose -2n - 22 = -2h, -2 - 33 = -3h + n. Suppose -5005 = hz - 16513. Is z prime? False Let o(y) be the third derivative of -y*6/120 - 9y5/20 - y4/24 - y*3/3 - 2y*2 + 19. Is o(-29) a prime number? True Let s be 42/(-7)(-18)/12. Suppose 0 = -7m - sm + 18608. Is m composite? False Let y be -1 - 9((-52)/(-12) + -5). Let m = 7115 - 77. Suppose m = yr + 1843. Is r a composite number? False Suppose 0j - 139 = -j - 5u, -4j = -2u - 600. Let f(s) = 24s2 + 5s + 3. Let h be f(5). Let z = h - j. Is z a prime number? True Let o(d) = d*3 - 6d*2 - 7d + 1. Let a be o(7). Let k be a/(-2)(-1 - -3). Is 0 - (-3 - k) - (-634 - -2) a prime number? False Suppose 8l - 28718462 = -30l. Is l prime? False Let l(q) = -q3 - 2q + 5153. Suppose -2y - 3w - 2w = 244, -5w = -4y - 458. Let d = 117 + y. Is l(d) prime? True Suppose 0 = -5k + 5 + 5. Suppose 1095 = -u + 2u - 5h, -2u = kh - 2214. Suppose -2t = -y - u, 0y - 3y = -4t + 2209. Is t a composite number? True Is (-4595154)/(-12) + (-1)/(3 - (-91)/(-35)) a composite number? True Let o = 18 - 14. Suppose w = -q + 3, 3q - 3 = -ow + 10. Is (q/(-2 - 1))/((-20)/(-20820)) prime? True Suppose 16l = 21l + 1695. Let g = 1005 - -277. Let f = g + l. Is f composite? True Let i(x) = 77x + 161x + 595 - 620. Is i(15) prime? False Let b = -46 - -213. Let i = 1456 + b. Is i composite? True Let b(n) = n*3 - 2n*2 - 3n + 8. Let c be b(2). Is (c + -5905)/((-2)/42) a prime number? True Suppose -4r - l = 2l - 24, 0 = -2r + 4l + 34. Is 124571/r + 6/(-27) composite? False Let r = -702 - -705. Suppose -f = rs - 12412, 49681 = 4f - 6s + 7s. Is f composite? False Suppose -75r = 26r - 834563. Is r composite? False Let u be 723/18 + (-14)/84. Suppose 20205 = 5t - 4g, -45t + ut = 4g - 20165. Is t prime? False Let m(x) = -47273x - 4088. Is m(-5) a prime number? False Let n = 17 - 52. Let s be (-29247)/(-7) - (-5)/n. Suppose 2x - 11l - 1672 = -9l, 5x - 3l = s. Is x prime? False Let q be (-62592)/42 - (-4)/14. Let t = 5263 - q. Is t composite? True Suppose 2n - 4r = 2940, -3n + 3r = 2415 - 6819. Let x = n - -540. Suppose -x = -3v + j, 2j = v - 3j - 692. Is v a composite number? True Let z(w) = -w2 - 18w - 41. Let t be z(-15). Suppose -tf + 13l + 21724 = 15l, 3l - 27155 = -5f. Is f a prime number? True Let r(h) = h3 - 7h*2 + 6h + 3. Let u be r(6). Let t be (-10)/((-280)/2364) + 8/14. Is ((2 - u)-7)/(5/t) a prime number? False Let r(l) = l3 + 5l*2 + 4l + 32. Let x be r(-5). Let z(d) = 81d + 77. Is z(x) a composite number? False Let u(p) = -14 + 0 + 220p - 9 - 8 - 2026p. Is u(-5) composite? False Let j(h) = 16705h*2 - 15h - 41. Is j(-3) a composite number? True Suppose 43j = 48j - 2870. Is 0 + (-3 + j)(-6)/(-6) a composite number? False Let h(t) = 529t - 117. Let l be h(-4). Let y = 7934 + l. Is y prime? True Let o be (-8)/(-8) - (-1)/1. Let x be (-5)/o + 21/(-2). Is (1/(-3))/(x/21567) a prime number? False Let x(s) be the second derivative of 13s3/2 - 67s*2/2 + 3283s. Let u(r) = 3r - 2. Let b be u(6). Is x(b) a composite number? False Let c = 110 - 106. Suppose -4x + 561 = -3r, 7r + 560 = cx + 3r. Is x a prime number? False Suppose 25163591 - 19352025 = 18p - 29249032. Is p a composite number? False Let v(l) = -6l3 - l2 - l - 1. Let s be v(-1). Suppose -s*b + 1 = -39. Is (8/(-12))/(b/(-2652)) prime? False Let a = -76280 + 209583. Is a a composite number? False	{ "pile_set_name": "DM Mathematics" }
4 In base 12, what is -2 + 3816aa15? 3816aa13 In base 3, what is -201220111 + -12000200? -220221011 In base 9, what is 116 - -208471? 208587 In base 4, what is -10 - 20233323001? -20233323011 In base 10, what is -14283 + 3662? -10621 In base 4, what is -20112 - -132? -13320 In base 3, what is 111101 - -10000212022? 10001100200 In base 13, what is 5204 - -7081? c285 In base 7, what is -1150165 - -2226? -1144636 In base 13, what is -172c + 441? -12bb In base 4, what is -1002232130 + 1303? -1002230221 In base 2, what is -1110 - 10101100010100011100? -10101100010100101010 In base 3, what is 20222210201211 - 21? 20222210201120 In base 14, what is 9 + 8211b2? 8211bb In base 5, what is -112340 - -33230? -24110 In base 6, what is -423551 + -1334? -425325 In base 15, what is 9c65 + 99? 9d0e In base 9, what is -3 + 56477871? 56477867 In base 12, what is -2485 - -3356? a91 In base 11, what is 1064 - 114a6? -10442 In base 15, what is 14 - 4e9b45? -4e9b31 In base 14, what is 40 + c254? c294 In base 8, what is 11420 + 6540? 20160 In base 9, what is 403517 - -108? 403626 In base 8, what is 1104251545 + 3? 1104251550 In base 4, what is -11002003 - -3022? -10332321 In base 11, what is 11211a - -117? 112236 In base 14, what is -18d - 1022784? -1022933 In base 11, what is 598 - -22394? 22981 In base 10, what is -240 - 364297? -364537 In base 4, what is 213 + -1001333120? -1001332301 In base 4, what is -231 - -13032310023? 13032303132 In base 6, what is 25102513550 + -3? 25102513543 In base 2, what is -10 + -1000101110010010101110? -1000101110010010110000 In base 13, what is b + 4a6945b? 4a69469 In base 2, what is -1001100001 - -11100010100? 10010110011 In base 16, what is -1d03 - -4229? 2526 In base 13, what is 6 - -945a1? 945a7 In base 8, what is -1627315223 + 3? -1627315220 In base 15, what is 873b0 - -b? 873bb In base 8, what is 25045014 + -5? 25045007 In base 4, what is -2233013 + 2122230? -110123 In base 16, what is 4b62 - 238d? 27d5 In base 11, what is -89244 - 5151? -93395 In base 13, what is 85bb6c + -9b? 85baa1 In base 12, what is 48 + -23433b6? -234336a In base 16, what is -762 - -4a75? 4313 In base 6, what is -13523 - -20035551? 20022024 In base 13, what is 51c29 - 118? 51b11 In base 2, what is -1110011 - 1011000010111000000100? -1011000010111001110111 In base 3, what is 1201210211112 - 22? 1201210211020 In base 12, what is -2222991 - -3? -222298a In base 4, what is 3 + 22002333331? 22003000000 In base 5, what is 2221 + -30111301? -30104030 In base 9, what is -22 + -13773241? -13773263 In base 5, what is 110110 - -24004311? 24114421 In base 7, what is -62040110 + -34? -62040144 In base 16, what is -73df8 + 3? -73df5 In base 9, what is 5 - 33311558? -33311553 In base 5, what is -101 - -121004033? 121003432 In base 10, what is -55638781 + 2? -55638779 In base 13, what is 10 + 246a249? 246a259 In base 15, what is 6 + -206836? -206830 In base 5, what is 31 + -20133010? -20132424 In base 9, what is -37011 + 66? -36834 In base 5, what is -11 + 111201144? 111201133 In base 4, what is 320122212 - 100001? 320022211 In base 4, what is -32120300 - 23323? -32210223 In base 12, what is 496 - 238a46? -238570 In base 8, what is -2 + 754557162? 754557160 In base 11, what is -145157 + -58? -145204 In base 3, what is 10221001 + 2212122? 20210200 In base 13, what is 131177a - 70? 131170a In base 15, what is -19 - 45dc5? -45dde In base 16, what is -26 - -355381? 35535b In base 14, what is -c45b7ab + 4? -c45b7a7 In base 16, what is -a - -a046d? a0463 In base 3, what is 2 + 210202121002212211? 210202121002212220 In base 13, what is -136531c4 - -1? -136531c3 In base 16, what is -c8e9 + -295? -cb7e In base 7, what is 5 - -210366232? 210366240 In base 7, what is -1220265 + 1153? -1216112 In base 10, what is 1 - 1391901? -1391900 In base 11, what is -52384 + 3? -52381 In base 2, what is 111000 - 110000101110011001? -110000101101100001 In base 16, what is -4c895b89 - -3? -4c895b86 In base 3, what is -1121 + 121021000000221? 121020222222100 In base 5, what is 23344231304 - 32? 23344231222 In base 9, what is -10401527246 - 5? -10401527252 In base 14, what is 79d9985 + 4? 79d9989 In base 8, what is -520262 - -7? -520253 In base 9, what is -3 + 24070150? 24070146 In base 3, what is -20021 + 1210002121101? 1210002101010 In base 5, what is 122403 - 110304? 12044 In base 7, what is -210 - -1605160? 1604650 In base 16, what is -b75114f + -1? -b751150 In base 11, what is -5aa762 - -117? -5aa646 In base 3, what is 1221 + 1012121112? 1012200110 In base 10, what is -264537 + -4? -264541 In base 12, what is -113 + 4739b? 47288 In base 4, what is -13301033322121 - -3? -13301033322112 In base 13, what is -2b + 24a3c5? 24a397 In base 7, what is 45 + -2156616? -2156541 In base 6, what is 143 - 3054401? -3054214 In base 15, what is 32d4ee + 5? 32d504 In base 5, what is 323 - 10020224? -10014401 In base 4, what is -3222300 + -1000331? -10223231 In base 14, what is 18095 - 333? 17b62 In base 12, what is 437549 + -7? 437542 In base 8, what is 204130 + -250? 203660 In base 13, what is 16b28022 - -1? 16b28023 In base 13, what is -10b0 - -641a3? 630c3 In base 3, what is -11220 - -20221211012221? 20221211001001 In base 2, what is 1101001100111011 + 1100101101110? 1110110010101001 In base 3, what is 1220 + 1112102222211? 1112110001201 In base 14, what is -2c3 + -b2c14? -b30d7 In base 10, what is 4 - -31438258? 31438262 In base 14, what is 6d3d3987 + -5? 6d3d3982 In base 16, what is 29ca934 - 3? 29ca931 In base 7, what is 15153315 - 251? 15153034 In base 4, what is -2 - -1010232212012? 1010232212010 In base 16, what is d6 + -e9899? -e97c3 In base 9, what is 4 - -121720107? 121720112 In base 6, what is 23321554 + -421? 23321133 In base 7, what is 161102320 - 2? 161102315 In base 13, what is 1006 + -4b637? -4a631 In base 2, what is 1010000101110101000111110100 + -101? 1010000101110101000111101111 In base 13, what is 5 + 668508? 668510 In base 10, what is -2 + -23900461? -23900463 In base 11, what is -1 + -4a80493? -4a80494 In base 13, what is 4 + -18057292? -1805728b In base 6, what is 5200120 + 512? 5201032 In base 5, what is 3424 - -30032432? 30041411 In base 7, what is 1320506 - 13? 1320463 In base 4, what is -10310312112 - 11? -10310312123 In base 5, what is -223 + -14423023? -14423301 In base 13, what is -3 - 12786b? -127871 In base 16, what is 15d91c3 - -3? 15d91c6 In base 12, what is -127 + -3a30? -3b57 In base 5, what is -2010 - -2040021? 2033011 In base 15, what is 0 - d04ce10? -d04ce10 In base 2, what is 1 - 11101000100000111010111? -11101000100000111010110 In base 5, what is 132 + 143341030? 143341212 In base 12, what is -361 + -21a23? -22184 In base 15, what is 31d7943 - -a? 31d794d In base 4, what is 20012002301 - -2302? 20012011203 In base 10, what is 197 + 108606? 108803 In base 14, what is -5 + -105386? -10538b In base 8, what is 1 + -34441441? -34441440 In base 15, what is -7 + 1222198? 1222191 In base 8, what is -140 - 2246444? -2246604 In base 11, what is -4 + 1587361? 1587358 In base 11, what is 4 - -11098963? 11098967 In base 12, what is -15263 + -2958? -17bbb In base 10, what is -2 - -2934564? 2934562 In base 14, what is 2a0c2d - -11a? 2a0d49 In base 7, what is -3 + 313250? 313244 In base 9, what is 151 + 380135? 380286 In base 5, what is 1130 + -11210213? -11204033 In base 4, what is -3101321 - -13220002? 10112021 In base 8, what is -12415 - 254270? -266705 In base 14, what is 1023 - -7c4? 1807 In base 5, what is -3 + -114221412? -114221420 In base 3, what is -11122 - 10220002? -11001201 In base 7, what is 4 + 11345626? 11345633 In base 15, what is -11677 - 60? -116d7 In base 14, what is 11d + -3ba962? -3ba843 In base 15, what is -3 - -52d752? 52d74e In base 2, what is 11 - 110101111011111100101110? -110101111011111100101011 In base 13, what is -74394a - 1? -74394b In base 7, what is 2 - 551332322? -551332320 In base 2, what is -110000111011100010001 - -1011110? -110000111011010110011 In base 6, what is 2142230 + -135? 2142051 In base 9, what is 5 + 45687165? 45687171 In base 14, what is -1a - 641c93? -641cad In base 10, what is 85781 - 619? 85162 In base 6, what is -130 - 15534233? -15534403 In base 2, what is -100010000001010101011 - 11001? -100010000001011000100 In base 15, w	{ "pile_set_name": "DM Mathematics" }
oduct of -465 and -2. 930 0.36 times -7 -2.52 -2.8-4 11.2 360.1 3.6 832 * -4 -3328 5 * 127 635 What is -0.4 times -711? 284.4 54-14 -756 Work out 1 -0.99. -0.99 What is 6 times -1.1? -6.6 Calculate -0.0342.35. -0.0799 Calculate 438. 152 20-86 -1720 2541 254 -0.009-4 0.036 -1.6 -1331 2129.6 Calculate -69.4-2. 138.8 Multiply 1 and -345. -345 Work out 30.8 -3. -92.4 Calculate 34.73. 14.19 -0.085 times -4 0.34 890-4 -3560 -127 * -59 7493 17 * -0.248 -4.216 What is 126 times -0.04? -5.04 Work out -3.2 * 48. -153.6 What is -8.6 times 0? 0 Multiply 4.7 and -20. -94 What is the product of 0.169 and -0.12? -0.02028 -6 * -2342 14052 Work out -57 * -20. 1140 Multiply 2 and 4.58. 9.16 -122 * 0.3 -36.6 Work out -0.22 * 8. -1.76 2.14 times -0.04 -0.0856 Multiply 0.4 and -4411. -1764.4 -10 times -3.3 33 Calculate 330.7. 23.1 Work out -4 -2932. 11728 What is 0.32 times 0.2? 0.064 -9-0.061 0.549 84-0.029 -2.436 Work out -11.2 * 0.5. -5.6 Product of -1 and 332.2. -332.2 4-2.9 -11.6 -5.613 -16.83 -27228 -7616 Calculate 271-0.4. -108.4 What is -35 times 20? -700 Product of -3 and 1108. -3324 What is 0.9 times 0.003? 0.0027 What is the product of -802.1 and 5? -4010.5 -2 times 9.2 -18.4 What is the product of -0.18616 and -0.3? 0.055848 Multiply 695 and -3. -2085 0.09427 times 1 0.09427 Work out -0.6 * 411. -246.6 What is the product of 0.16 and -244? -39.04 5 times 943 4715 -7 * 3.4 -23.8 Calculate -0.730.5. -0.365 161-0.5 -80.5 -1.11.99 -2.189 -9.7 times -2 19.4 Product of 0.1 and -21. -2.1 Product of 1 and 3. 3 -0.2 times -185 37 Calculate 0.4-0.354. -0.1416 Work out -0.165 * 0.1. -0.0165 What is -35 times -1.5? 52.5 -0.5 times 0.91 -0.455 0.0430.07 0.00301 -74 times 0.13 -9.62 3 times -29 -87 Work out -1 -1631. 1631 What is the product of -24.2 and 0? 0 Work out 587 * 0.2. 117.4 Multiply -110 and -2. 220 -1-0.07 0.07 0 -38 0 5274 1370 Work out 0.193 4. 0.772 -21.4-3 64.2 -0.450 0 2.81 * 0 0 Work out -4 * -101. 404 -0.69 times -5 3.45 Work out -89.9 * -3. 269.7 Multiply 188.7 and -0.2. -37.74 Work out 0.045 * -10.5. -0.4725 -0.018631 -0.5766 Calculate -0.510. -5 What is the product of -0.11 and -0.28? 0.0308 Calculate 13-0.7. -9.1 Multiply 184 and -0.32. -58.88 Multiply -0.4 and 5.4. -2.16 Calculate 7-121. -847 Multiply 9669 and 4. 38676 What is 51.02 times 4? 204.08 Work out 111 * -2. -222 Work out -0.06 * 0.211. -0.01266 What is the product of -117 and -0.1? 11.7 Multiply -0.066 and 0.31. -0.02046 -4 times -0.05 0.2 -205.9-4 823.6 0.4 -17.87 -7.148 304 * 0.2 60.8 -0.01-0.12 0.0012 What is 2 times 777? 1554 1 1.7 1.7 -42 * -13 546 Calculate -0.2-30. 6 -10 times -34 340 What is 4 times 684? 2736 Product of 6 and 0.045. 0.27 5 127 635 What is -2 times -0.17? 0.34 Multiply 0.1 and -64. -6.4 Calculate -1111. -121 Multiply -3 and -243. 729 Multiply 0.2 and -258. -51.6 542 1.7 921.4 Product of 10.1 and -20. -202 -20 * 2.1 -42 Work out -0.92 * -7. 6.44 -12.23 -36.6 -0.085-11 0.935 Multiply 0.03 and 0. 0 Work out 135 * -1. -135 Calculate -8244. -3608 What is the product of -1.1 and 4? -4.4 Multiply -1.46 and 4.3. -6.278 Work out 3412 -4. -13648 What is the product of 36 and 7? 252 What is -32 times 65? -2080 Calculate 58-0.5. -29 What is the product of -3.2 and 8? -25.6 What is -0.4 times -22? 8.8 Work out -0.1 14.5. -1.45 5572 1114 What is 8143 times 0.5? 4071.5 What is the product of 151 and -17? -2567 Calculate 0.04680.1. 0.00468 22 * 2.16 47.52 Calculate -0.1-59. 5.9 -3 times -22 66 Product of -345 and 0. 0 Product of -0.267 and -0.04. 0.01068 -0.2-4611 922.2 What is -23 times 0.114? -2.622 Work out -0.135 * 0.021. -0.002835 Work out -9.2 * -0.07. 0.644 What is -6.6 times 22.2? -146.52 Work out -5 * -0.19. 0.95 What is -25 times -4? 100 Work out -0.5 * 32. -16 -1140.6 times 1 -1140.6 What is the product of -25 and -0.69? 17.25 What is 0.4 times -687? -274.8 Calculate -15481. -1548 7.8 times -4 -31.2 Work out 0.02 0.023. 0.00046 What is -0.06 times 316? -18.96 What is the product of 2.73 and 2? 5.46 What is the product of 0 and 43? 0 -0.4 times -173 69.2 Work out 13 * -1. -13 -0.5 times -1297 648.5 1-683 -683 What is the product of 6 and -37? -222 -0.2 times -0.0389 0.00778 Multiply 83 and -0.3. -24.9 What is the product of -12944 and 5? -64720 -0.3 -826 247.8 What is the product of 0.04 and -305? -12.2 44-0.303 -13.332 Calculate 5-14.6. -73 0.4 times 77 30.8 Calculate -0.1391.16. -0.16124 -3 times -2387 7161 1.061 4 4.244 What is -0.2 times -71? 14.2 3 times 48 144 Multiply -725 and 0.12. -87 What is the product of 0.8 and -184.7? -147.76 -90 * 0 0 373 * -10 -3730 -580.3 -17.4 119-1.5 -178.5 Work out -123 * 2. -246 Multiply -10428 and 3. -31284 Work out -2508 * -0.5. 1254 Product of 1351.8 and 1. 1351.8 -24 * 5.5 -132 Calculate -15.75. -5.75 -48 times 2 -96 Calculate 2150.1. 21.5 What is 0.04 times 0.33? 0.0132 Product of -4 and -2899. 11596 What is the product of -0.5 and 4909? -2454.5 -2110 0 Work out 0.5 -427. -213.5 -15.16 -90.6 Work out 5 0.183. 0.915 1.7 * -5 -8.5 Multiply -1147 and -4. 4588 -3.3 times -99 326.7 Multiply -0.35 and 0.1. -0.035 0.4 * -106 -42.4 -6 times -0.14 0.84 What is the product of -40 and 0.03? -1.2 Calculate 60.138. 0.828 Work out 4163 0.2. 832.6 What is 64 times 0.02? 1.28 Multiply -23.98 and -0.1. 2.398 -0.48 -3.2 Multiply -0.1 and 1404. -140.4 What is 0.2819 times -0.1? -0.02819 What is the product of -1.1 and -0.219? 0.2409 What is the product of 14559 and 0.1? 1455.9 Calculate 1.9102. 193.8 Calculate -0.006-61. 0.366 Work out -3 0.1387. -0.4161 What is -0.66 times -5.8? 3.828 0.250.14 0.035 Multiply 15 and -0.3. -4.5 What is the product of -426 and -2? 852 Multiply 318 and 0.2. 63.6 -151 -1.9 286.9 What is the product of 23 and -127? -2921 What is the product of -0.125 and 0.12? -0.015 Product of -0.03 and -204. 6.12 What is -587 times -0.1? 58.7 0.030.15 0.0045 Work out -3.5 3. -10.5 Calculate 1-6.39. -6.39 Calculate 394-3. -1182 Calculate 0.128645. 0.6432 Product of -0.1 and 0.104. -0.0104 Calculate 420.24. 10.08 Multiply 0.5 and 3511. 1755.5 Product of -0.4 and 0.509. -0.2036 Calculate -0.2-1.32. 0.264 -0.1 -928 92.8 94.2-0.1 -9.42 What is the product of -55.06 and -0.4? 22.024 Multiply -0.5 and 0.73. -0.365 What is the product of -28 and -0.033? 0.924 What is the product of 5 and 166? 830 Calculate -0.030.1. -0.003 Product of 1074 and 0.4. 429.6 -0.07 * -8 0.56 -2 * -169 338 4 times 0.107 0.428 -0.7-0.126 0.0882 Calculate 3-1.6. -4.8 Calculate -0.04-0.16. 0.0064 244 times -6 -1464 What is -0.2 times 142? -28.4 -4-171 684 Calculate 1-67. -67 0.319 5.7 What is -1 times -28? 28 -140.02 -0.28 Multiply -539 and -2. 1078 Multiply 4421 and 0.5. 2210.5 -4 times 1.2 -4.8 2.82.3 6.44 What is the product of 17 and 2? 34 Product of -0.1688 and 3. -0.5064 12 * 0.1 1.2 What is the product of -26 and -3? 78 What is the product of 0.0318 and -0.3? -0.00954 -0.34 * 111 -37.74 Calculate 11-19. -209 What is the product of -7 and -255? 1785 0.80.14 0.112 Multiply -7 and -0.06. 0.42 -537 * -0.4 214.8 What is the product of 0.4 and 284? 113.6 Product of -580 and -35. 20300 Work out -34 * 0.149. -5.066 -2178 -356 Multiply 11 and -8. -88 What is 1 times -166.2? -166.2 Multiply -452 and 0.8. -361.6 4-0.39 -1.56 Calculate -7506-4. 30024 0.70.2 0.14 What is the product of -8 and -2168? 17344 -0.113 * -0.1 0.0113 Multiply 0.08 and -0.4. -0.032 Work out 5 * -2. -10 3.1 * 0.1 0.31 What is 185 times -6? -1110 What is the product of 0.025 and -0.28? -0.007 Product of -3024 and 0.2. -604.8 Work out 180 * 4. 720 0.4-6.1 -2.44 What is the product of -1.144 and 0.4? -0.4576 What is the product of -0.5 and -169.9? 84.95 Product of -8 and -0.0701. 0.5608 0.011 times -1 -0.011 What is 21 times -0.18? -3.78 0.4 83 33.2 -90.5 times -1.2 108.6 Work out 0.6 * 0.333. 0.1998 1 times 3342 3342 What is the product of 1 and 0.1548? 0.1548 What is the product of 0.17 and -4.1? -0.697 2-0.298 -0.596 Product of -4.8 and 1.8. -8.64 Calculate -14-0.1459. 2.0426 Product of -0.4 and 129. -51.6 What is the product of -0.255 and -5? 1.275 Work out 43 * 0.3. 12.9 -0.81 * -51 41.31 -2*0.602 -1.204 What is the product of -0.4 and 26? -10.4 Calculate 0.	{ "pile_set_name": "DM Mathematics" }
te k(w(d)). 28d4 Let w(u) = -40u2. Let p(y) = y2 + 6y + 3. Let t be p(-6). Let v(k) = -13k*2 + tk*2 + 11k*2. Calculate v(w(l)). 1600l4 Let i(h) = -h2. Let a(j) = j - 3j + 3j - 2j + 1. Let r(l) = 32l - 18. Let p(y) = 36a(y) + 2r(y). Calculate p(i(q)). -28q2 Let n(v) = 17v - 60 - 20v - 5. Let y(c) = 2c*2. Determine y(n(t)). 18t*2 + 780t + 8450 Let h(w) = -4w2. Suppose 0 = -4i - 5k - 17, -4i - 4k - 12 = -0i. Let v(l) = -6l2 - 2l + 7l2 + il. Determine h(v(b)). -4b4 Let b(n) = 9n + 452. Let k(r) = 42r. Determine k(b(s)). 378s + 18984 Let l(k) = -k*2 + 6k + 2. Let a(t) = -3t2 + 15t + 5. Let u(z) = 2a(z) - 5l(z). Let n(j) = -47j2 + 2. Give n(u(v)). -47v*4 + 2 Let n(c) = 2c. Let h(i) be the second derivative of i*5/30 - 24i*2 + 4i. Let v(u) be the first derivative of h(u). Give v(n(l)). 8l2 Let k(v) = -2v. Let t(m) = 2m + 113. Calculate k(t(r)). -4r - 226 Suppose q + 9 = 4h, -3h - 4q + 3 = 1. Let m(c) = 5c*h + 9c*2 - 11c2. Let o(u) be the first derivative of -u3 - 1. Calculate o(m(p)). -27p4 Let f(v) = -12v*2 + 16v - 8. Let a(y) = 4y2 - 6y + 3. Let g(p) = -8a(p) - 3f(p). Let z(b) = 22b2. Determine z(g(i)). 352i*4 Let q(d) = 8d. Let y(z) = 119051z2. Determine y(q(x)). 7619264x*2 Let d(f) be the second derivative of -1/6f*3 + 0f*2 - f + 0. Let o(q) be the first derivative of 13q*3/3 - 69. What is d(o(j))? -13j*2 Let j(n) = -2n. Let r(v) be the second derivative of 0v3 + 0 + 0v*2 + 18v + 1/4v4. What is j(r(q))? -6q*2 Let p(w) = -43w*2 + 2. Let x(q) = 20q - 1. Give p(x(a)). -17200a2 + 1720a - 41 Suppose 5z - 1656 = -3z. Let t(a) = 205a - 414a + za. Let p(w) = 7w + 2 - 2. Calculate p(t(y)). -14y Let c(h) = 367689h. Let n(b) = -b*2. Give c(n(m)). -367689m*2 Let g(x) be the third derivative of 3x*5/10 + 377x*2. Let c(z) = -3z*2. Calculate c(g(y)). -972y*4 Let o(f) = -26309f. Let l(u) = 3u2. Calculate o(l(s)). -78927s*2 Let y(i) = 27i. Let p(r) = -963r2 + 1887r*2 - 961r*2. Give p(y(m)). -26973m*2 Let j(x) = -2x2. Let u(p) be the third derivative of -p5/60 - p4/24 - p2 + 11p. Calculate j(u(g)). -2g*4 - 4g*3 - 2g*2 Let d(c) = -1 - 89393c + 89380c + 1. Let l = 13 + -8. Let t(v) = -lv - 4v + 8v. Calculate d(t(k)). 13k Let n be -3 - ((-2)/(-1) + -3 + -2). Let f(h) be the third derivative of 0h + 0h3 + n - 1/12h*4 + 6h*2. Let s(t) = 2t*2. Give s(f(v)). 8v*2 Let v(j) be the third derivative of 0j - 17/24j4 + 0j*3 + 0 + 26j2. Let t(g) be the first derivative of -g2 - 1. Give t(v(y)). 34y Let a(r) = 15r*2. Suppose -7t + 119 = -14. Let v(n) = tn - 36n + 19n. Determine a(v(c)). 60c*2 Let g = 136 - 406/3. Let b(q) be the first derivative of 1 + 0q*2 + 0q + gq3. Let c(w) = w. Calculate c(b(d)). 2d*2 Let m(n) = 420927n. Let h(t) = 2t. Give h(m(f)). 841854f Suppose -3p + 50 + 10 = 0. Let q(o) = 15o + po - 33o. Let b(x) = 3x - 3x - 5x. Determine b(q(z)). -10z Let a(z) = 272z2. Let o(v) = v2 + 1056v. What is o(a(c))? 73984c4 + 287232c2 Let d(h) = -h2. Let s(y) = 87y + 6. Let l(v) = -90v - 5. Let m(z) = 6l(z) + 5s(z). Calculate m(d(a)). 105a2 Let n(l) = 8 + 10 + 9 - 4l - 16. Let c(q) = 2q. Calculate n(c(s)). -8s + 11 Let r(v) = -2v2. Let u(n) be the second derivative of n4/3 + n2 + 2n. Let w(m) = -m*2 + 1. Let z(d) = u(d) - 2w(d). Determine z(r(y)). 24y4 Let q(u) = -2u*2 + 5u*2 - 3u*2 - 2u*2. Let v(r) = 153r*2 - 38r*2 - 68r*2. Give v(q(o)). 188o*4 Let y(w) = 9w*2. Let j(v) be the first derivative of -3v*2 - 7. What is y(j(b))? 324b*2 Let k(r) = -r. Let f(o) = 277794o*2. What is k(f(d))? -277794d*2 Let g(t) be the third derivative of -55t*4/24 - 5t2. Let h(f) = -f2. Give g(h(n)). 55n2 Let o = -1 - -1. Let u(c) = oc*2 + 2c*2 + 5c*2 - 5c2. Let n(s) be the second derivative of -s4/2 - 159s. Determine n(u(k)). -24k*4 Let q(s) = 228s*2. Let c(h) = -76h + 2. Determine q(c(b)). 1316928b2 - 69312b + 912 Let z(y) = 7y. Let h(g) = 337g*2 - 9. Determine z(h(x)). 2359x*2 - 63 Let z = -16 + 18. Let x(q) = 2q + 23qz - 3q*2 - 2q. Let b(m) = -m*2. Calculate b(x(t)). -400t*4 Let y(m) = 374m*2 + 2. Let u(r) = -147r. Determine y(u(v)). 8081766v2 + 2 Let w(x) = 3x2. Let y(u) be the second derivative of u5/60 + 17u3/6 - 26u. Let o(j) be the second derivative of y(j). What is o(w(m))? 6m2 Let d(t) = -57t*2 - 2t*2 + 12t2. Let u(m) = -m2 + 2m + 2. Let g(c) = -2c*2 + 3c + 3. Let z(o) = -2g(o) + 3u(o). Calculate d(z(w)). -47w4 Let b(y) = -43119 - 6y + 22y + 43119. Let l(d) be the second derivative of d3/3 + 2d. Determine b(l(j)). 32j Let d(z) = 37z + 39z + 35z - 108z. Let k(f) be the third derivative of 11f4/24 - f2. What is k(d(s))? 33s Let d(m) = -m2. Let g(v) = 15v. Suppose -4l + 4r = 0, 5l + 3r - r - 14 = 0. Let t(n) = 15 - ln + 3n - 15. Let q(x) = g(x) - 18t(x). Calculate d(q(b)). -9b*2 Let f(n) = 2n. Suppose -3a + p + 105 = 0, -2p + 15 = -7p. Let h(k) = 34 - a - 6k*2. Calculate h(f(x)). -24x*2 Let s(z) = 2z - 1007 + 1007. Let c(n) be the second derivative of 0n2 + 1/3n*4 + 0 - 6n + 0n3. Determine c(s(y)). 16y2 Let n(b) = -b2. Suppose -l - i = 12, 4l + 0i = -i - 54. Let a be ((-8)/l)/((-14)/(-49)). Let g(t) = 11t2 + 4ta - t2. Calculate g(n(h)). 14h4 Let k(i) = 2i2 - i2 - 2i2. Suppose 5x - 7 = 3. Let z(s) = -2s - 2. Let t(a) = -a2 - 3a - 3. Let f(q) = xt(q) - 3z(q). Determine k(f(v)). -4v4 Let u(w) = -11w - 45. Let g(r) = 189r2. Determine g(u(x)). 22869x*2 + 187110x + 382725 Let i(g) = 4g + 12. Let f(q) = q + 2. Let k be -2 + 8/129/6. Let j(t) = ki(t) + 6f(t). Let d(p) = 44p2. Determine d(j(n)). 176n*2 Let q(m) = -24m. Let z(g) = -g. Let j(u) = -3q(u) + 63z(u). Let t(k) be the first derivative of -k*2 + 138. Calculate t(j(n)). -18n Let k(h) = -4h. Let t(q) = -203q*2 + 2q + 1. Determine k(t(r)). 812r2 - 8r - 4 Let q(s) = 3s2. Let m(d) = 92215d. Determine q(m(g)). 25510818675g2 Suppose d + 2o + 1 = 0, 6o = -2d + o - 4. Let l(v) = -v - 1. Let i(p) = 9p + 2. Let k(g) = di(g) + 6l(g). Let s(t) = -2t*2. What is k(s(m))? -42m*2 Let r(o) = -3630o*2 - 95. Let z(b) = b. Determine z(r(q)). -3630q*2 - 95 Let v(a) = -a. Let g(k) = -18k*2 - 2k - 14. Let c(r) = -89r2 - 11r - 77. Let f(l) = 4c(l) - 22g(l). Calculate v(f(x)). -40x2 Let l(s) = -11s. Let d(x) = 46x + 47x - 83x. Calculate l(d(v)). -110v Let g(h) = -2h. Let w(j) be the third derivative of 8j*5/15 - 13j*3/3 - 7j*2. Let t(s) be the first derivative of w(s). What is g(t(f))? -128f Let a(j) = -4j2 + j2 + j2 + j2. Let m(b) = 4897b - 332. Let i(x) = 89x - 6. Let c(l) = -166i(l) + 3m(l). Calculate c(a(h)). 83h*2 Let i(n) = -7n + 15n + 4n. Let t(w) = 3w + 7w + 9w + 4w - 21w. What is i(t(r))? 24r Let w(v) = -24v2 + 7v + 133. Let i(u) = 7u2 - 2u - 38. Let p(l) = 7i(l) + 2w(l). Let z(s) be the first derivative of 15s3 - 1. Calculate z(p(y)). 45y*4 Let u(c) = -2c + 6. Let n(t) = -t. Let r(q) = -10q + 41. Let k be r(4). Let f(i) = kn(i) - u(i). Let a(x) = -2x. Give a(f(b)). -2b + 12 Let u(n) be the third derivative of -n*4/24 - 8n*2. Let q(f) = -33f*2. Determine q(u(s)). -33s2 Let h(c) be the third derivative of c5/30 + c2. Let d(u) be the second derivative of -u3 + 6u + 8. Calculate d(h(f)). -12f2 Let s(x) = -x2. Let z(f) = -100f + 2. Suppose 0o + 3o + 6 = 0. Let c be z(o). Let t(d) = -c + 8d + 202. Give s(t(r)). -64r2 Let q(n) be the third derivative of 0n + 0 - 1/60n5 + 0n*4 - 15n*2 + 0n3. Let u(i) = i2. Give q(u(z)). -z*4 Let i(x) = -7x - 4. Let k(u) = -5u - 3. Let d(t) = -3i(t) + 4k(t). Let s(o) = 2o*2 - 10. Determine d(s(a)). 2a*2 - 10 Let c(m) = -11m + 33. Let b(u) = -1. Let v(k) = -33b(k) - c(k). Let g(d) = 19d. Determine v(g(q)). 209q Let t = 80 - -95. Let m(i) = 2i*2 - t + 175. Let a(x) = 5x. Give m(a(j)). 50j2 Let f(m) = 10m + 8m - 28m + 4m. Let w(j) = 2j*2 - 4j*2 + 5j*2. What is w(f(o))? 108o**	{ "pile_set_name": "DM Mathematics" }
-4 Suppose 2z - w = -68 - 67, 0 = 2z - 3w + 125. Let c be z/(-4)8/14. Solve -5k = -3d - d - 25, 0 = -2k - d + c for k. 5 Suppose 1656v - 875 = 1481v. Solve -4p - 4h = -15 + 3, -vp - h - 5 = 0 for p. -2 Let j(o) = -o*2 - 28o - 192. Let d be j(-13). Solve 0x - dp = -4x - 1, -5x - p = 25 for x. -4 Let a(v) = v*3 + 41v*2 + 237v - 32. Let n be a(-34). Solve no + 6 = -2u, -2o + 2 = -4u + 14 for o. -4 Suppose 107l = -149l. Solve 5n + 4q + q + 15 = l, 0 = 5n - 4q + 6 for n. -2 Suppose b + 71 = 6b + 4m, 0 = 4b + m - 48. Let k(y) = -y + 8. Let h be k(b). Let a be -10(-3)/(-18)h. Solve -ar = 7j - 3j - 11, r = 4j - 17 for r. -1 Let w be 29/((-3393)/18)1 - 186/(-26). Solve 0 = -p + 3y + 4, -5 = 3p - 4y - w for p. -2 Let q(v) = -13124v + 78771. Let n be q(6). Suppose -4h + 2a + 36 = -2a, -5 = 5h + 5a. Solve -s - 3i - 24 = hs, 4i + n = -5s for s. -3 Let x = 104 - -63. Let o = x + -163. Solve 0 = 2r - 4n - 4, -6r = -10r - on - 4 for r. 0 Let k(c) = 66c - 1379. Let l be k(21). Let r(b) = b2 + 6b - 11. Let a be r(-8). Solve 15 = -au, 5o + 8 = -5u - l for o. 0 Let m = 731 - 728. Suppose -29g = -84 - m. Let l(o) = o*2 - o - 2. Let t be l(4). Solve t = -3f - 5k - 0, gf = k + 2 for f. 0 Suppose 108s - 114s + 36 = 0. Solve sm + 1 = 4m + 3k, 4m + 5 = 3k for m. -2 Suppose -3w - 5h = -34, w - 4h + 11 = -2w. Suppose 11k - 13k = -10. Solve -6 = -2b - 2n, -b + kb + n + w = 0 for b. -2 Let c(a) = -4a2 + 23a - 10. Let h be (45/(-27))/(2/(-6)). Let j be c(h). Solve jz = -t + 20, 0t = -t - z + 4 for t. 0 Let g be 2 - 3 - (24/(-36))/(4/6). Solve b - 6 = -4v, 3b + g + 6 = 0 for v. 2 Let v = 5070 - 5068. Solve 33h = vo + 35h + 2, 0 = 3h + 12 for o. 3 Let z = 34 + 161. Let j = z - 195. Solve -4n - y - 6 = j, 5y = 4n + n - 5 for n. -1 Suppose -109r + 57 = 56r - 273. Solve 21 = 4u + 9, -4j - ru = -10 for j. 1 Suppose -5r = -2p - 18 + 2, -p = -r + 2. Solve 3q - 20 = pf, -5q - 4f = f for q. 4 Let b = -4159 - -4163. Solve 3y = 2x - 11, b = -x - x for y. -5 Suppose -3j = 12, 4o - 3 = -o - 3j. Suppose -162b - 1171b + 31992 = 0. Solve 3t + t - b = -a, -3a - ot = -27 for a. 4 Suppose -3f + 2l = -6f + 70, 0 = 4f - 5l - 78. Suppose 0 = -5y - 2p + 18, -3p = 5y - 5p - f. Solve 0 = -yb + 3z + 20, -3z = -b - 2b + 18 for b. 2 Let p(v) = -v*3 + 9v*2 - 6v + 8. Let g be p(9). Let i be g - -46 - (-1 + 2 - 2). Solve d - s + 0 = -i, 9 = -d + 5s for d. 1 Let t = 1324 + -1313. Solve -m = 2, 21 = 2v - m + t for v. 4 Let w be -19 - (15 + (-30 - 6)). Solve wg = 2, -4z - g + 6g = 9 for z. -1 Let t be -8(3/6 - 1). Suppose tp - 131 = -p + 4o, 76 = 4p + 4o. Solve -k = j - 6, 2j + 2j = -3k + p for k. 1 Suppose -43s = -755 - 191. Solve -3g = 15, -8m - 5g = -9m + s for m. -3 Let p be 5((1 + -1)/(-5) + 1). Suppose 3 - 7 = -2q, 75 = 5k - pq. Solve n + 21 = 4x, 5n - 3n - 3x = -k for n. -1 Suppose 3h - 2h = -2p + 6, 0 = -4h + 8. Let a = 13 + -10. Solve -n + 23 = -5f, -a = -3f - pn - 3n for f. -4 Suppose 0 = -o + a + 2a - 8, 2a = -o + 12. Suppose r - 16 = -2r + oh, -5h + 50 = 5r. Let w = 6 + -4. Solve 4n - 4 = wm + 2n, 4n = 2m + r for m. 0 Let q(z) = z2 + 28z - 1. Let k be q(-15). Let a = -192 - k. Solve -2m - 6 = -au, 0u - u + 5m = 21 for u. 4 Let l be ((-80)/(-64))/((-100)/(-160)). Solve -8 = -4i + li, 0 = 4x + 4i for x. -4 Let l be 4/(-2)2 + 49-1. Let s = l + 56. Solve 5a + sm = 2m - 28, 0 = -2m - 6 for a. -5 Suppose 0 = -4n + 8, -n + 2 - 8 = -4h. Suppose -1843y - 3 = -1846y. Solve -5p - 5r = -30, hp = r + 8 + y for p. 5 Suppose -11a + 220 = -k - 13a, 4k + 892 = -5a. Let w = k - -239. Solve 3y = 5o + w, -y - 11 - 4 = 3o for y. -3 Let f = -135 - -139. Solve -4z + f = -5k, 7k + 3z = 2k - 32 for k. -4 Suppose 10 = 5n + w, 2n = -2w - 87 + 99. Let f = -23 - -30. Solve -5h - g + n = 9, -4h - f = g for h. -1 Let f(v) = 3v - 4. Let c be f(3). Let s(z) = 18z + 144. Suppose -7r - 48 = 8. Let k be s(r). Solve -2d = -0d + 4i, k = -cd + 2i - 24 for d. -4 Suppose -9r = 210 - 255. Solve 12 = -s - rp, 4 = -3p - 2 for s. -2 Suppose -2b + 3a = -23, -29b + 3a = -37b + 17. Solve 31q - 30q - 12 = -bz, q - z - 2 = 0 for q. 4 Let x(f) = f2 + 11f + 22. Suppose -7 = 4i + 9. Let d be -2 + ((-40)/6 - i/(-12)). Let g be x(d). Solve 3t - 4w - w - 15 = 0, -t - gw = 12 for t. 0 Let o = -309 - -312. Let f(p) = p*2 + 3p - 15. Let h be f(o). Solve -h - 8 = -3u + 2z, -5u + 2z = -13 for u. 1 Suppose -6q + 12 = -2q. Let y be q/(-6)(-193 - 1). Suppose 0 = 4c - y - 47. Solve 3s + s - c = -4h, -5s + 2h = -10 for s. 4 Suppose 5r - 10 = j - 13, -2j + 6 = 2r. Solve 0 = -4t - 3x - 12, -jx - 5 - 7 = -t for t. 0 Let p be 25/((-225)/(-36)) + (0 - (3 - 1)). Solve 6 = -3n, 4s + pn - 14 = -22 for s. -1 Suppose -5h + 34 = 3k, 0 = -2k - 2h - 3h + 26. Let z be 4 - 1 - (-16 + k - -7). Solve 3p - 2 = 2g - 10, -z = -4g + 3p for g. -2 Let d(h) be the third derivative of h6/120 - h5/20 + 7h4/24 - 3h3 - h2 + 1. Let i be d(3). Solve 0 = 3t + 5r - 20, t - 12 = -3t - ir for t. 0 Let z be (7 - 1224/(-8))/2. Suppose -94 = -3o - q, -z = -28o + 26o - 5q. Let r = -15 + 25. Solve 3d + r - o = 4x, -3x - 15 = 3d for d. 0 Suppose -3v + 4d = -100, 44 = 3v - 3d - 52. Solve -q + 4 = 0, -vq + 33q - 15 = 5x for x. 1 Let m(z) = -z3 + 30z*2 - 4z + 120. Let n be m(30). Let x be (-5 - 123/(-21))(14 + n). Solve -3p = -3f + x, 0 = -5p - 3f - 2 + 14 for p. 0 Let f(d) = -d2 + 80d + 707. Let l be f(-8). Solve -ly = 3n - 10 + 19, 1 = -3y - n for y. 1 Let l be (-1380)/5060198/(-2). Solve -5g = 2a - l, -7g + 5g = -3a - 7 for g. 5 Suppose -4f = -2j + 20, 56j + 4f = 54j - 20. Solve 0 = -q - 4w + 20 - 4, -5w + 20 = j for q. 0 Let c(v) = v*2 - 33v - 1619. Let x be c(60). Suppose -3p = -2a + 76, p = -4a + 109 + 15. Solve -3w - a = 4g - x, 0 = 2w - 2g + 2 for w. -5 Let v be 0/(1/((-1)/(-2))). Let u be (12 - 31) + 126/6. Solve 0 = -w - 2l - 2, -2w + 6l - ul + 12 = v for w. 2 Let g(o) = -86o + 1094. Let r be g(12). Let s = 87 - 24. Let d = s - r. Solve -3a + 4j + 12 = 0, -3j = -2a - d + 9 for a. 4 Suppose -14r = -3r + 2002. Let g = 198 + r. Solve 0 = 2p + 2d + 2d + g, 4p - 8 = 2d for p. 0 Suppose 5v + 16 = -2f, 5f - 2v - 14 = -v. Suppose -27o + 76 = -36 - 23. Solve 5w - oh = 25, 0 = fw - 5w + 2h + 10 for w. 0 Suppose 50s - 72s = 946. Let n(z) = z2 + 38z - 212. Let k be n(s). Solve ky - 9 = 0, 0 = 5j - 2y + 4y + 9 for j. -3 Suppose 5c + 3u = -245, -4u = 5c - 146 + 391. Let v = c + 47. Let o(s) = -s*3 + s + 2. Let n be o(v). Solve -5z - 3h = 31, -3z - 9 - n = h for z. -5 Suppose 3x + 8 - 14 = 0. Suppose -h + 0f = -f, xh + f = 9. Solve 4d + 6 = 6t - t, -d - t = -h for d. 1 Suppose -11 = -s + 4r - 5r, 0 = -4s - 2r + 36. Let d(v) = -66v + 344. Let t be d(5). Solve 5g - t = 3b, 3g - s - 11 = 5b for g. 1 Let n = -7 + 8. Suppose 0v - v = n. Let h be (0 - v) + (15 - 11). Solve s = 3t - 11, 23 = -hs + t - 2t for s. -5 Suppose -5l + 43 = 2w + w, -2w = 2l - 22. Suppose 40 = 5q - 3v, 0 = -wq + q - v + 20. Solve c + 0g = 4g + 21, qc - 5g - 30 = 0 for c. 1 Let z(h) = h2 - 10h - 17. Let r be z(12). Suppose 0 = rl - 97 - 50. Suppose 7p - l = 7. Solve -4i + 14 = -2j - 2i, pi - 3 = -j for j. -5 Let m(b) = 89b + 3026. Let s be m(-34). Solve s = -3f + 21, -k - f = 17 - 29 for k. 5 Suppose 0 = 593v - 654v + 122. Solve -5f = 3n + 15 - 37, 4n - 20 = -vf for f. 2 Let u be 65/(20/(-4)) + 16. Solve 3w - 2l = 18, -ul + 2l - 7 = -w for w. 4 Let k be 4 + (-2)/6 + 221/(-3). Let g be (40/k)/(2/(-21)). Solve 0 = -5v - 3q - 16, 2q - g = -0q for v. -5 Let u be (-5 + 0 + 3)/((-20)/100). Solve 15f - 5p + 6 = 19f, 3f + p - u = 0 for f. 4 Suppose -2362j + 2366j - 8 = 0. Let k be (-1)/(-3)(-255)/(-34)j. Solve -m = -ko - 5m - 28, -3o + 3m - 6 = 0 for o. -4 Suppose -s - 71 + 467 = 0. Let d = s + -396. Solve dp + 5f = -p - 24, -5p = -5f for p. -4 Suppose 18i = -i - 417 + 474. Solve 29 = 3k + 5r, -ik - 3r + 3 = -18 for k. 3 Suppose 0 = -70f - 73f + 144f. Solve 5*h = -o - 8, f = 1	{ "pile_set_name": "DM Mathematics" }
or 2/179657057? 1 Are 8101810 and 24305432/3 equal? False Which is smaller: -265500 or -265427? -265500 Is 146610710 bigger than 146610706? True Is 1172990563/5 > 234598112? True Is 6 less than or equal to -8484.83? False Which is greater: -943192/1437 or -656? -656 Which is smaller: 69157 or 69152? 69152 Which is smaller: 373.10256 or -2/5? -2/5 Which is smaller: 0.0955186 or 1172? 0.0955186 Which is greater: 1803/216158 or 0? 1803/216158 Which is smaller: -5/9 or -0.041191? -5/9 Is 1034172 equal to 1034170? False Is -0.4 != -50/144471? True Is -147.2 >= 4/303? False Is 0 < 1/833231830? True Are 2267/1290 and 1 nonequal? True Is 0 at most -185/1929961? False Which is bigger: -838679 or 21? 21 Is -6905839 > -6905741? False Which is bigger: 0 or 2/264453? 2/264453 Which is smaller: -233329182/19 or -12280482? -233329182/19 Which is bigger: -589462/217 or -2716? -2716 Which is bigger: 5105009 or -9? 5105009 Which is greater: 21154 or -0.248? 21154 Which is smaller: 0 or 2/476335989? 0 Is 101 equal to -16494? False Is 0 greater than -3367/180693? True Which is smaller: -67347 or -740822/11? -740822/11 Which is bigger: 8817656/25 or 352706? 8817656/25 Which is smaller: 98041 or 0.3? 0.3 Are 517960/33 and 15695 unequal? True Which is bigger: 19554723 or -50? 19554723 Which is smaller: -142952 or -142947? -142952 Which is greater: 6198 or 6544? 6544 Is -9/7481 at least 109? False Is 8 < 10/649691? False Is -934355 < -6540493/7? False Which is smaller: -3840 or 2354? -3840 Is -93272 not equal to -93269? True Which is greater: 26/5894243 or 0? 26/5894243 Is 1/11 greater than 2791888? False Is -1/2 <= 17699904? True Which is smaller: -3 or -1549/423? -1549/423 Do 20 and 881.66 have the same value? False Which is smaller: 1 or 3087/79346? 3087/79346 Is 45 <= 3/336146? False Is 1/32 > 285589? False Is -974999 <= -975039? False Is 199571 <= 6186702/31? True Which is smaller: 0 or -4418/16661? -4418/16661 Which is bigger: 4857/54829 or 0? 4857/54829 Which is greater: -596246 or -596234? -596234 Is -41645 greater than 24? False Which is smaller: 95265 or -332? -332 Which is smaller: 1 or 2/381914581? 2/381914581 Is 8529163 bigger than 8529161? True Is -55808/56061 greater than -1? True Which is greater: 313934 or -2473? 313934 Is -2666978/25 at most -106680? False Is -2625454 less than -2625450? True Which is greater: -18 or -24852/1279? -18 Are -1 and 909/4624 equal? False Is -3.17 less than 564544? True Are 5010 and 5604 unequal? True Which is smaller: -571325701 or -571325700? -571325701 Which is bigger: 958.1 or -1.4? 958.1 Are -2 and 1164786 unequal? True Is 0.509 at most -112015? False Are -11405105 and 2/9 nonequal? True Is -18 equal to -280812? False Which is bigger: 62.8 or 25136? 25136 Which is smaller: 0 or -73571701/5? -73571701/5 Which is smaller: 255710105 or 255710108? 255710105 Which is smaller: -5452 or -365239/67? -5452 Are -4/7 and 2957425 nonequal? True Is -0.48 at most -104/14719? True Is 140323660 less than or equal to 140323661? True Do -7 and 130273349 have the same value? False Which is smaller: -102948301 or -11? -102948301 Which is smaller: 88421 or 86813? 86813 Are 88 and 189263/2126 equal? False Is -1 >= 0.008691541? False Is -52404804 equal to -104809607/2? False Which is smaller: -329966 or -11548812/35? -11548812/35 Is -6/1653817393 equal to -1? False Which is bigger: -54 or 5.373213? 5.373213 Which is greater: -10487893 or -62927359/6? -10487893 Which is greater: 467/47 or -25? 467/47 Is 149242594 less than or equal to 149242596? True Which is smaller: 1 or 83/366772? 83/366772 Which is smaller: -0.72 or -92153.8? -92153.8 Is 4477 > -7146? True Which is smaller: 154642 or 155087? 154642 Is 1 greater than or equal to 7792/48403? True Is 0.686307 < -0.1? False Is -2117 at least as big as -275059/130? False Is -22392824 at most as big as -22392825? False Which is bigger: -26531221 or -26531220? -26531220 Which is greater: -68472913/9 or -7608101? -7608101 Which is bigger: -158001/2768 or -57? -57 Which is smaller: 21 or -1695927? -1695927 Which is bigger: -6.51 or 2017471? 2017471 Are -150635 and -151184 unequal? True Is -1 equal to -21881/13398? False Which is greater: -733123 or -733116? -733116 Which is greater: -31/256991 or 1? 1 Which is smaller: -5366/1523 or -5? -5 Which is smaller: -49330.8 or 2.4? -49330.8 Is 3200/1947 less than or equal to 1? False Are -54759016/5 and -10951804 nonequal? True Which is smaller: -496929/247 or -2011? -496929/247 Is -1 <= -2/1267700701? True Which is bigger: 52792 or 88? 52792 Is -6 at least -6422058? True Which is greater: 179850 or -47.7? 179850 Which is smaller: 62/11 or -3590700? -3590700 Which is bigger: 2302220.9 or 0? 2302220.9 Which is smaller: 141174484 or 0.2? 0.2 Which is greater: 12/450809 or 1? 1 Which is bigger: 1019039 or 1019106? 1019106 Which is bigger: 20199553 or 20199552? 20199553 Which is smaller: -74 or 2/425903? -74 Is -273 smaller than 0.27154? True Which is smaller: -2.000651 or -2? -2.000651 Is -62 less than or equal to -71292/1123? False Which is bigger: -387/531736 or 0? 0 Which is greater: -473387/2 or 0.05? 0.05 Which is bigger: 16163782 or 16163781? 16163782 Which is greater: -1 or -11/30320779? -11/30320779 Are 54941250 and 4 unequal? True Is 168 greater than or equal to 75794/455? True Is 1 at most 1/18716371? False Which is smaller: 313 or -134672? -134672 Is 149706 less than or equal to 149798? True Which is smaller: -18505 or -1623? -18505 Which is bigger: -41 or 2131444? 2131444 Is -22.2603 > -948? True Do -52/3224235 and 1 have the same value? False Which is smaller: -22/17264733 or -0.2? -0.2 Is 19440916 smaller than -13? False Is 4/68645279 at least 0? True Does -931/108317 = 0? False Is -1413227 at least as big as -1413230? True Which is smaller: 0.35769 or 21? 0.35769 Is 84 equal to 2540.57? False Which is greater: -2/7 or 64046409.9? 64046409.9 Which is smaller: 321425 or 321422? 321422 Which is smaller: -3/286968781 or -1? -1 Which is bigger: -19 or -102141/5158? -19 Are -1979706 and -17817347/9 non-equal? True Are 2820875 and 2820870 unequal? True Is -335505 less than or equal to -333996? True Is -396574 less than -396548? True Is -0.0255 greater than 1065? False Which is greater: 1.28472 or 1.7? 1.7 Which is smaller: 3/149136760 or 1? 3/149136760 Is -186266275 at most as big as -186266273? True Is -0.04819822 less than -0.12? False Is 3 greater than or equal to 32323/11574? True Is 1 >= 6313/310655? True Which is smaller: 5126123 or 5126121? 5126121 Is 913 at most as big as -9930? False Is 58070 > 2032402/35? True Is 58381/10374 less than 7? True Which is bigger: 379 or 756348/1993? 756348/1993 Are 2 and -26178044 unequal? True Which is smaller: -17.955 or 419/2? -17.955 Which is greater: -75/100721 or 1? 1 Which is smaller: 1784209 or 30331548/17? 30331548/17 Which is smaller: 100969/129 or 0.07? 0.07 Which is smaller: 176275405 or 881377023/5? 881377023/5 Are -49 and -42240/871 non-equal? True Is -243/483523 >= 1? False Which is smaller: 4111187 or -22? -22 Which is bigger: -38849006 or -38849009? -38849006 Which is smaller: -14237 or 6728? -14237 Are -121696135 and -121696134 non-equal? True Which is smaller: -323644 or -1/6? -323644 Is -40249/1191 bigger than -34? True Which is smaller: -527204 or -527210? -527210 Which is bigger: -483382 or -2900285/6? -2900285/6 Is -2 != -1599513? True Is -25301/2063 greater than or equal to -11? False Is 155731374 at least 155731374? True Do 31823 and 35412 have the same value? False Which is bigger: -239142127/9 or -26571346? -26571346 Which is smaller: 8125 or 311? 311 Is -2695298 equal to -2695282? False Which is bigger: -114240111 or -114240112? -114240111 Which is smaller: 990157 or 990162? 990157 Which is smaller: 46921 or 46268? 46268 Which is greater: 1/4 or 34244065? 34244065 Which is smaller: -11.5071 or -482? -482 Which is greater: 39985 or 40031? 40031 Which is smaller: 8484934 or 8484932? 8484932 Is 3 >= 131/363388? True Are -1645242753 and -1645242753 non-equal? False Which is smaller: -148/283101 or -1? -1 Which is greater: 1108510 or -21.4? 1108510 Is 14/19227 > -6? True Are 22435 and -71 unequal? True Which is bigger: 456 or -167129? 456 Are 11 and -34/59561 nonequal? True Which	{ "pile_set_name": "DM Mathematics" }
59 List the prime factors of 41738371. 41738371 List the prime factors of 5817982. 2, 41, 70951 What are the prime factors of 31215634? 2, 293, 53269 What are the prime factors of 28033715? 5, 2053, 2731 List the prime factors of 63910761. 3, 21303587 List the prime factors of 95262603. 3, 31754201 List the prime factors of 1021903650. 2, 3, 5, 2270897 What are the prime factors of 29100215? 5, 83, 70121 List the prime factors of 101832782. 2, 50916391 What are the prime factors of 41698977? 3, 17, 19, 23, 1871 What are the prime factors of 2804277791? 7, 233, 35089 What are the prime factors of 1566660? 2, 3, 5, 26111 List the prime factors of 228752513. 11, 179, 116177 What are the prime factors of 133095331? 9803, 13577 List the prime factors of 79515161. 11, 7228651 What are the prime factors of 882460853? 13187, 66919 List the prime factors of 58143479. 107, 523, 1039 List the prime factors of 459048709. 7, 9368341 What are the prime factors of 55946120? 2, 5, 23, 60811 List the prime factors of 379290109. 11, 257, 12197 List the prime factors of 2052257275. 5, 82090291 What are the prime factors of 1341303592? 2, 29, 463, 12487 List the prime factors of 24394813. 17, 199, 7211 List the prime factors of 443196968. 2, 3187, 17383 List the prime factors of 3797543272. 2, 29, 79, 207199 List the prime factors of 536522691. 3, 178840897 What are the prime factors of 3212622322? 2, 7, 13, 41, 263, 1637 List the prime factors of 48962545. 5, 9792509 List the prime factors of 47803409. 47803409 What are the prime factors of 1688519275? 5, 67540771 List the prime factors of 20091975. 3, 5, 267893 What are the prime factors of 87138963? 3, 3227369 List the prime factors of 136997472. 2, 3, 607, 2351 What are the prime factors of 655628410? 2, 5, 151, 434191 What are the prime factors of 13130424? 2, 3, 23, 881 What are the prime factors of 174272244? 2, 3, 14522687 List the prime factors of 329468757. 3, 37, 233, 12739 What are the prime factors of 86165241? 3, 47, 611101 List the prime factors of 22383620. 2, 5, 7, 101, 1583 List the prime factors of 321411211. 11, 113, 2137 List the prime factors of 63149873. 63149873 What are the prime factors of 48310643? 48310643 What are the prime factors of 998834790? 2, 3, 5, 33294493 What are the prime factors of 430834535? 5, 113, 762539 List the prime factors of 336653779. 7, 11, 29, 107, 1409 List the prime factors of 44302280. 2, 5, 11, 107, 941 What are the prime factors of 72586506? 2, 3, 12097751 What are the prime factors of 25023744? 2, 3, 10861 List the prime factors of 93848558. 2, 46924279 List the prime factors of 920048296. 2, 17, 43, 157327 List the prime factors of 304118767. 5039, 60353 What are the prime factors of 145284680? 2, 5, 307, 11831 What are the prime factors of 6816329557? 6816329557 What are the prime factors of 8067502? 2, 31, 130121 What are the prime factors of 38356603? 38356603 What are the prime factors of 3130291481? 17, 2069, 88997 List the prime factors of 1446414801. 3, 13, 47, 789097 What are the prime factors of 10859979? 3, 13, 23, 12107 List the prime factors of 49304259. 3, 19, 373, 773 What are the prime factors of 710962593? 3, 11, 17, 563, 2251 What are the prime factors of 211083360? 2, 3, 5, 157, 2801 What are the prime factors of 119408968? 2, 7, 2132303 What are the prime factors of 812582852? 2, 203145713 List the prime factors of 3281111664. 2, 3, 68356493 What are the prime factors of 25457041? 17, 29, 51637 What are the prime factors of 12154229? 79, 137, 1123 What are the prime factors of 102377459? 61, 1678319 What are the prime factors of 329404817? 7, 719, 65449 List the prime factors of 67056586. 2, 19, 353, 4999 List the prime factors of 361894656. 2, 3, 471217 List the prime factors of 3127046127. 3, 1042348709 List the prime factors of 537097626. 2, 3, 13, 17, 135017 List the prime factors of 7028501249. 7, 11, 13039891 List the prime factors of 241863041. 7, 1423, 24281 List the prime factors of 99467398. 2, 383, 129853 List the prime factors of 565533636. 2, 3, 2389, 19727 List the prime factors of 1321249913. 33359, 39607 What are the prime factors of 97826753? 89, 1099177 What are the prime factors of 445920442? 2, 11, 191, 106121 What are the prime factors of 2772283131? 3, 102677153 List the prime factors of 3910376416. 2, 122199263 What are the prime factors of 7625774? 2, 13, 37, 7927 What are the prime factors of 956340423? 3, 17, 6250591 List the prime factors of 13142300. 2, 5, 19, 6917 What are the prime factors of 104487355? 5, 7, 17, 25087 What are the prime factors of 228867803? 181, 1039, 1217 List the prime factors of 753135886. 2, 31, 12147353 List the prime factors of 2592643748. 2, 648160937 List the prime factors of 22394275. 5, 895771 List the prime factors of 386495761. 89, 4342649 What are the prime factors of 4536322488? 2, 3, 21001493 What are the prime factors of 213803145? 3, 5, 527909 List the prime factors of 298509272. 2, 23, 1622333 What are the prime factors of 805664303? 3121, 258143 What are the prime factors of 56484246? 2, 3, 7, 13, 103451 What are the prime factors of 232912332? 2, 3, 1201, 5387 What are the prime factors of 7976576956? 2, 53, 37625363 List the prime factors of 83578603. 79, 1057957 List the prime factors of 1581266. 2, 790633 List the prime factors of 1908413285. 5, 17, 22451921 List the prime factors of 226991421. 3, 53, 467, 1019 What are the prime factors of 48409717? 71, 181, 3767 What are the prime factors of 496584763? 73, 997, 6823 What are the prime factors of 93963162? 2, 3, 15660527 List the prime factors of 69275227. 7, 47, 193, 1091 List the prime factors of 5347911301. 41, 293, 337, 1321 What are the prime factors of 5898471? 3, 281, 6997 What are the prime factors of 56527826? 2, 1033, 27361 What are the prime factors of 4572456788? 2, 61, 3023, 6199 What are the prime factors of 159162236? 2, 109, 223, 1637 What are the prime factors of 337823530? 2, 5, 11, 89, 3137 List the prime factors of 116178834. 2, 3, 19363139 What are the prime factors of 18191009? 101, 233, 773 List the prime factors of 733634820. 2, 3, 5, 191, 2371 List the prime factors of 934314263. 53, 67, 107, 2459 What are the prime factors of 51773689? 11, 19, 31, 61, 131 What are the prime factors of 672396157? 89, 7555013 What are the prime factors of 3064825211? 7, 73, 113, 53077 List the prime factors of 117082818. 2, 3, 1697, 3833 List the prime factors of 107638354. 2, 73, 163, 4523 What are the prime factors of 51170239? 23, 29, 76717 What are the prime factors of 23868355? 5, 7, 41, 16633 List the prime factors of 22215615. 3, 5, 1481041 What are the prime factors of 49187566? 2, 24593783 List the prime factors of 101944684. 2, 59, 487, 887 What are the prime factors of 1562621275? 5, 19, 109, 30181 List the prime factors of 103900706. 2, 7, 13, 23, 24821 What are the prime factors of 15428702? 2, 617, 12503 List the prime factors of 113839721. 113839721 List the prime factors of 812536187. 149, 239, 22817 List the prime factors of 223217869. 7, 4129, 7723 List the prime factors of 32474584. 2, 53, 191, 401 What are the prime factors of 58254551? 19, 43, 113, 631 What are the prime factors of 84250476? 2, 3, 641, 1217 What are the prime factors of 55169180? 2, 5, 11, 23, 10903 List the prime factors of 37462616. 2, 163, 28729 What are the prime factors of 108059372? 2, 1237, 21839 List the prime factors of 15343911. 3, 11, 17, 1013 What are the prime factors of 34066973? 37, 920729 What are the prime factors of 536547936? 2, 3, 419, 13339 List the prime factors of 372820277. 43, 8670239 List the prime factors of 23088177. 3, 7, 366479 List the prime factors of 376419580. 2, 5, 107, 175897 List the prime factors of 31530240. 2, 3, 5, 7, 17, 23 List the prime factors of 23574671. 23574671 List the prime factors of 44156843. 44156843 What are the prime factors of 138564675? 3, 5, 7603 What are the prime factors of 510496363? 13, 37, 1061323 What are the prime factors of 66361865? 5, 883, 15031 What are the prime factors of 161527849? 7, 23075407 What are the prime factors of 275567511? 3, 53, 1733129 What are the prime factors of 1492055907? 3, 6199, 80231 List the prime factors of 6392501356. 2,	{ "pile_set_name": "DM Mathematics" }
8 Work out 0.5 * 1386526. 693263 Product of 0.1 and 2786658.1. 278665.81 -42-2097599 88099158 327 -106709 -34893843 Work out -0.13714369 * -6. 0.82286214 Work out -1202.1 * -4903. 5893896.3 What is the product of 34.76919 and 15? 521.53785 What is -0.11611902 times 0.4? -0.046447608 What is the product of 3 and 145660? 436980 Work out -361 * -2455.6. 886471.6 Work out -10136.029 * 0.3. -3040.8087 Product of -46214.5832 and -5. 231072.916 Work out -0.4 * -62505261. 25002104.4 -39374.67-0.3 11812.401 Calculate -43065651.39. -5986125.35 981 times 1149 1127169 0.2 * -30135808 -6027161.6 Calculate 1.135-2.6. -2.951 What is the product of -6.24651 and 25? -156.16275 Work out -767 7.4. -5675.8 Work out 7 * -198017.64. -1386123.48 What is the product of 26404996 and -1.9? -50169492.4 537 times 312341 167727117 What is -0.0030048 times 124? -0.3725952 Calculate 0.305192-39. -11.902488 -0.0397 2678.43 -106.333671 What is the product of -2241205 and 310? -694773550 What is the product of -4216 and -17511? 73826376 -73-4363581 318541413 What is the product of -951564 and 0.4? -380625.6 1568626.40.3 470587.92 Work out -4.84014 * 30. -145.2042 Multiply -3 and -0.10804862. 0.32414586 -39 * 25842 -1007838 Calculate 156071.364-1. -156071.364 1035 -13317 -13783095 What is -27.9247 times 0.07? -1.954729 Multiply 422715682 and 0.4. 169086272.8 Product of -1.7358 and 15757. -27351.0006 -122 times 24629.76 -3004830.72 -0.24117261 -28142.64 -8.3988 3109 -26111.8692 4 times 1.7619687 7.0478748 Multiply -15439.4 and -0.5. 7719.7 Multiply 2416930.4 and 5. 12084652 Work out -317.98 * -1428.9. 454361.622 Multiply 170600 and -2068. -352800800 Multiply -1.5 and 138.523. -207.7845 What is the product of 0.0136385 and -0.5? -0.00681925 -0.290321449 times -5 1.451607245 -21514482 * 0 0 What is 114.44 times 548? 62713.12 -29167621 * 2 -58335242 Calculate -5.6321-0.9. 5.06889 What is the product of -3973 and 3618? -14374314 Product of -3652.2261 and -0.8. 2921.78088 Work out -5 5923919. -29619595 -0.7 times 308656 -216059.2 What is the product of -20972 and 3011? -63146692 Calculate -42-32678. 1372476 34.94139-1 -34.94139 -0.058 times 6222770 -360920.66 1 times -1632.637 -1632.637 -1624 * -15803 25664072 Calculate -9908-53688. 531940704 Multiply 0.4 and -28550852.7. -11420341.08 What is 9210 times 0.29086? 2678.8206 What is the product of 838495 and -0.01? -8384.95 Work out 0.001194 15722. 18.772068 What is -25403697 times 2? -50807394 What is the product of 1 and -0.3601588? -0.3601588 44192.96 * 0.43 19002.9728 Work out -0.15 * -5331.19. 799.6785 -8.458 * -0.08006 0.67714748 Product of -2048 and -44855. 91863040 Work out 3 * 33881858. 101645574 4218617 * -2 -8437234 What is the product of 9446405 and -0.03? -283392.15 Calculate -150.07721812. -1.1582718 Work out 118 -20363. -2402834 69.278644-0.4 -27.7114576 -196280-15.1 2963828 What is the product of -12129134 and -0.3? 3638740.2 Work out -15.89 * 16348. -259769.72 -0.033-3916701 129251.133 -1863 times 0.27903 -519.83289 What is 10 times -0.229521? -2.29521 Multiply 936.16 and -2154. -2016488.64 What is the product of -111730288 and 0.3? -33519086.4 -4.1258829-1 4.1258829 -146 times 29.4793 -4303.9778 What is the product of 1795.9192 and 16? 28734.7072 Product of 7 and 2120937.21. 14846560.47 0.687819008 13073.7024 Calculate 26566415-0.2. -5313283 -7 times 11341.7 -79391.9 0.5 times -11195578 -5597789 1.6944849 1511758.4 Calculate -150.08690.08. -12.006952 Work out -83241 * 1947. -162070227 1022.01 * 151 154323.51 Multiply -58280586 and 2. -116561172 Work out -3.11 * -16552. 51476.72 Multiply -36931 and -2.96. 109315.76 415 times -3018531 -1252690365 -125.597828 -3516.7384 Multiply 37.2306 and -160. -5956.896 Work out -758455 0.29. -219951.95 Product of -1 and 1247.22. -1247.22 -59681.6 times 6.23 -371816.368 Calculate 17.54-6070. -106467.8 What is -19693 times -2.4? 47263.2 What is 27 times 6030198? 162815346 0.0316026 -3.6 -0.11376936 Calculate 1289936589. 1207263221 -8.31 -12772 106135.32 0.03763 times -0.17491 -0.0065818633 Work out 0.05 * -30.991327. -1.54956635 -35 * -396766 13886810 Product of -0.036 and 12166906. -438008.616 -995.4 * -33 32848.2 Work out 436078 * -421. -183588838 What is the product of 780 and -262977? -205122060 Product of 5163 and -11761. -60722043 50518 times -6.4 -323315.2 Product of -243.63948 and -0.2. 48.727896 What is 0 times -90.9738? 0 Calculate -51-81.7229. 4167.8679 -10-772.822 7728.22 373873686 times 1 373873686 Multiply 491.4 and 0.404. 198.5256 -58.160.0619 -3.600104 Calculate 1855648508-0.4. -742259403.2 What is -17092 times -47.462? 811220.504 What is the product of -351410 and -0.2? 70282 Calculate 108530.016. 173.648 What is -271 times 44461? -12048931 What is 0.724 times -6066? -4391.784 Calculate 992070818. 178572744 Work out 185540 * -468. -86832720 Calculate 438222039. 97253082 -0.6747290.13 -0.08771477 -118452.8 * -1 118452.8 What is -246929553 times 0.5? -123464776.5 What is the product of 1015118 and -20? -20302360 565907.47 329537.35 Product of -1.196 and 415. -496.34 What is the product of 0.04 and -50.33691? -2.0134764 Calculate 0.052982565.5. 0.29140408 What is 30.03 times -13.595? -408.25785 92.12904-6 -552.77424 What is the product of -11.522 and 0.05992? -0.69039824 Multiply 36281 and 2.1158. 76763.3398 What is the product of 0.1936 and -302526? -58569.0336 Product of -1318 and 20.877. -27515.886 -3.712895994 -47715177.8 -245921-0.129 31723.809 Product of 9 and -52231352. -470082168 Multiply 16.9338 and -225. -3810.105 Multiply -81 and -274.9. 22266.9 What is the product of -17 and 397.026? -6749.442 Work out -0.03 24654815. -739644.45 129-0.056989 -7.351581 Multiply -46.9 and -13159. 617157.1 1 times -1263811.8 -1263811.8 What is 0.0277 times 4.33371? 0.120043767 -14876.5 times 5.5 -81820.75 0.105554-31 -3.272174 -1010.5344 times -0.3 303.16032 3731502 * 0.1 373150.2 Multiply -298.7 and 0.0573. -17.11551 0.3126314 37894.2 33485 times 9 301365 Work out -75 -113.0722. 8480.415 What is the product of -128368.99 and -0.5? 64184.495 Multiply -18119230 and 0.5. -9059615 Product of 0.11 and -76809443. -8449038.73 What is -2 times 41231.12? -82462.24 2249 times 3.879 8723.871 -18548121 * -5 92740605 395 * -377.3 -149033.5 -223.798.37 -22005.369 What is 0.01972809 times 7.7? 0.151906293 What is -87081385 times 4? -348325540 Work out 3771 1.40091. 5282.83161 Work out 16 * -693596. -11097536 18583478 8882674 -2 0.072064 -0.144128 -0.089249 times 913 -81.484337 What is 5486 times 0.0842? 461.9212 Multiply -34.169 and -6482. 221483.458 824188550 155365200 12.9181 times 0.8 10.33448 Multiply -22128475 and -3. 66385425 Work out -0.33 -4157.552. 1371.99216 Work out 343.619 * -1.1. -377.9809 Product of -2 and -0.01055012. 0.02110024 0.1100687974 10068797.4 503.78-2354 -1185898.12 What is the product of -0.37 and 0.0615587? -0.022776719 82814-5.9 -488602.6 What is the product of 24174770 and 1? 24174770 What is the product of -3 and -797.62541? 2392.87623 168091 times 1106 185908646 -40 times -144443.8 5777752 What is the product of -1179103 and -0.06? 70746.18 What is 3 times 7578598.8? 22735796.4 Multiply 1.284737 and 0.1. 0.1284737 Multiply 3.92 and -41792. -163824.64 -0.5 times 78475177 -39237588.5 Work out 5390345 0.1. 539034.5 What is the product of -19059 and -683? 13017297 Multiply -0.02712 and -23822. 646.05264 1367930.39 415704.81 Product of -586.1725 and -0.06. 35.17035 -178616.394 -29279.684 Calculate 321309495. 41903840 Work out -2929386 -0.3. 878815.8 0.03978-0.8923 -0.035495694 -551-8955 4934205 Multiply -0.2 and 11.57195. -2.31439 Calculate -159267.3-0.7. 111487.11 What is 2 times 3477? 6954 What is -0.487 times -2462.4? 1199.1888 Work out 8.277793 0.4. 3.3111172 -0.01-2.045456 0.02045456 Work out -0.3 -1692203. 507660.9 Multiply 26.6 and 3.1736. 84.41776 5 times -235676048 -1178380240 What is 1457 times 4.8544? 7072.8608 What is the product of -45.3 and -21126? 957007.8 Product of 7.864 and 4.43. 34.83752 -130506-0.079 10309.974 Calculate 91046-589. -53626094 3611893186 428154696 7.96441.42 50887.218 35*213676 7478660 Product of 3505 and -128.71. -451128.55 Product o	{ "pile_set_name": "DM Mathematics" }
/(0 - (-6)/40). 8/7 -17 - (21 - 28) - (0 + -2) -8 Evaluate (-12)/3 - (12 + ((-222456)/1068)/13). 2/89 What is the value of (-1)/(-6) + 9/2165? 3/8 Evaluate (-12)/(-14) - ((-14)/(-147) - (-16)/24). 2/21 What is the value of (-11 + (-1000)/(-90))15/5? 1/3 What is the value of (-3)/(6/(-8))(0 + 42 + -43)? -4 What is the value of ((-225)/15)/(-5) - 27? -24 What is the value of (140/10 - 18) + 156/38? 2/19 Evaluate 8/(-126) + 102/(-459). -2/7 876/132 - 21 - 8/(-22) -14 Evaluate (5 + 0)66/231. 10/7 23218/(-384) - ((-1 - -2) + -12) 1/8 What is the value of (7/(-42))/((-4)/(-18))632/4503? -2/19 What is the value of (3/4)/(51/136)(-15)/30? -1 What is (6 - (-2)/6)(24 + 0)/8? 19 Evaluate 1 + 15/2100 + 17. 18 What is 0 + (-255)/(-78) + -3 + (-36)/72? -3/13 Evaluate 12/8((-21)/(-35))/(72/160). 2 What is the value of (-140)/630(-18)/(-20)? -1/5 -6 - (110/(-70) + -4) -3/7 Calculate (-32)/(-4)18/(-24) - 624/(-108). -2/9 -4 + 351/45 + (-7 - -3) -1/5 What is the value of 36243/(-432) + 21? 3/4 7((-176)/(-630) + 2/63-7) 2/5 Calculate ((-8)/(-420)-7)/((-10)/(-345)). -23/5 Evaluate (-5 + (-248)/(-48))-78. -13 (0 - -2)/(-63 + 58)75/24 -5/4 Calculate ((-21)/((-294)/(-28)))/((36/(-32))/(-9)). -16 Calculate (-15)/(0 - -3) - 27/(27/4). -9 Evaluate -4 + 104(-15)/(-120). 9 What is the value of ((-10)/3)/(2620/(-2358))? 3 Evaluate (-13 - -24 - 4)(4 + -7). -21 What is (-15)/(-20)32/(-12) + -6 + 2? -6 What is the value of 8/((-1 + 4)(-4)/(-3))? 2 -9 + (3764/390 - (9 - (-4537)/(-507))) 3/5 What is (-116)/(-6) - (259 + -240)? 1/3 What is the value of (4137/(-60282))/(1 + 11/(-4))? 2/51 Evaluate (13/((-780)/(-24)))/(-2 - 324/(-165)). -11 What is (1/((-125)/(-10)))/((357/15)/17)? 2/35 Calculate (-70)/(-25)(10/(-4))/(-1)1. 7 Calculate ((-384)/126 + 250/75)/((-10)/14). -2/5 What is -110 - (-21385)/2115? 1/9 Calculate (-636)/(-960) - 1/16. 3/5 Evaluate (3 - 25)/(2/13 - (-1485)/1755). -22 What is 9/(-8) + ((-6)/(-144) - 18/(-216))? -1 What is the value of (1/(-6))/(161/(-11592))? 12 What is the value of (-274)/822 - (-13)/57? -2/19 What is -45 + (-1308)/(-30) + 0? -7/5 Evaluate (((-168)/(-408))/7)/1. 1/17 What is ((-44)/(-341)31)/(6/9)? 6 What is 35 - -63(-80)/180? 7 What is 10/(-3)5670/1575? -12 What is the value of (4/(-3) + 1)/2(-603)/(-804)? -1/8 (-2385)/(-115) - 9 - (-1 - -9 - -4) -6/23 Evaluate ((-9)/42)/(463/2778). -9/7 What is the value of 43/172(-8)/6? -1/3 Evaluate 649/59 + -16 + -1. -6 What is (((-28)/182)/(55/(-143)))/(4/310)? 31 Calculate (6/10)/(7/(140/(-174))). -2/29 What is (0 - 0)/((-156)/130 + 7/35)? 0 What is ((-708)/885)/(104/(-30))? 3/13 What is the value of (-2)/7 + ((-2)/3)/(308/(-160))? 2/33 Calculate (-4477)/(-740) + (-2)/40. 6 Evaluate -46 + 52 - (14/(-3) + (-3)/9). 11 Evaluate (413/21 - 16) + (-6 - -7). 14/3 -3(-1 - (1378/(-273) - -4)) -1/7 What is ((-398)/5572)/(1 - (-3)/(-2))? 1/7 Calculate 35/(-2 + 9) - 8. -3 Calculate ((-68)/4)/(-153) - (-170)/9. 19 What is the value of -7(7 - 2483/91 - -19)? 9 What is (-184)/(-425) - (-682)/(-8525)? 6/17 Evaluate 4/2 + 1/(3/(30/5)). 4 (-70)/(50/(-5)) - 158/22 -2/11 -1588(-26)/(-1976) + 21 2/19 36 + -12 + (10 - 16) 18 What is 115/(-28) - 24/294(-798)/76? -13/4 Evaluate 4(-4)/2 - (-28 + 6612/330). -2/55 Evaluate (-273)/26 + (-35)/(-14). -8 Evaluate (-45)/132(-88)/220. 3/22 What is (-8)/26649/14? -2/19 ((-19344)/3472)/(12/(-28)) 13 What is the value of (-3)/(-18) - (-1)/(-2) - 22103/4278? -11/2 Calculate (0(-2)/2)/(-1(4 + -1)). 0 What is (190 - 184)(-5)/896/(-10)? 36 What is the value of -16 - 14807/(-323) - 30? -3/19 (45/(-2) - 0)/((-2256)/(-3008)) -30 5 + -2 + 5 - ((-209)/88 + 11) -5/8 ((-45)/(-27) - 92/48)/((-3)/(-2)) -1/6 Evaluate ((-1991)/1991)/((-2)/(-16)2 - 0). -4 -35 - (-19)/(7980/14660) -2/21 (-163 - -163)/((-2 - 0)/(-1)) 0 Calculate ((3/(-2))/((-10)/8))/(3152/7880). 3 What is 392/63 + 4 + -2 - 10/45? 8 (-6 + (-412)/(-56))10 - (-104)/(-182) 13 What is ((-1)/4)/((-126)/(-36) - 6)? 1/10 Calculate (-2)/(((-342)/117)/(-19)). -13 What is the value of 24/((-528)/1342) - -33? -28 ((-16)/(-72))/(31/(-558)) -4 Calculate -6((-20)/(-24) + 35/10 + -4). -2 Calculate ((-7)/(63/(-18)) - 11)1. -9 What is 814/(-37) - (7 + -33)? 4 (-76)/(-57)9/(-12) -1 What is -6((-33)/(-12) + -3)? 3/2 What is ((-1130)/190 + 9 + -4 + 1)-2? -2/19 (-14)/1(13 + (-64)/(-40)-8) -14/5 What is the value of (-17)/((-476)/(-120)) + -8 + (-4 - -15)? -9/7 Calculate (6/8)/(10 + 32571/(-3276)). 13 What is the value of (75 - (52 - 1))3/(-4)? -18 What is (-16 + 18)/(5/((-30)/(-27)))? 4/9 What is ((-3)/((-300)/8))/(((-280)/(-25))/(-7))? -1/20 Evaluate ((-7 - -5) + (-13)/(-5))/((-1)/(-20)). 12 Evaluate (2/(-34))/((-351)/11934). 2 What is the value of (-6385/(-198) - 11)/(2/3)? 1 Calculate (50/(-43 + 18))/((-22)/(-77)). -7 What is the value of ((-8)/(-18) - 429/702)6/15? -1/15 -44 + 23 - 1443/(-69) -2/23 What is (-21547)/2229 + (-1)/3? -10 133/(-49) - ((-45)/(-84) - (-2)/(-8)) -3 56803/30702 + 96/(-5712) 11/6 What is the value of 3/10 + (-34)/80? -1/8 What is the value of -1(-2)/(-3)(-216)/(-16)? -9 Evaluate 1780/712((-21)/(-15) - 3). -4 Calculate 69/1035 + (-166)/15. -11 Evaluate 59 - 13800/322 - 2/14. 16 What is (-2)/111154/(-12)? 9 What is 7 - 2 - (10/((-30)/9) + 1)? 7 What is the value of 5616/(-378) - 68/(-56)? -14 What is the value of ((-13)/(-3) + -3)(-549)/(-4026)? 2/11 Calculate (-10)/16 - 5694/(-8112). 1/13 What is the value of (-6)/(75/(-10) + 9)? -4 Calculate (8/(-30))/(68/(-612))(-75)/10. -18 What is 426 + -428 - 4-2? 6 (180/(-420))/(18/(-7)) 1/6 What is ((-88)/6)/(-2 + 28) - 1420/(-1065)? 10/13 (-17 - (-1826)/110)/(6/(-45)) + -28 -25 What is (11/(-2))/((-26)/(-416))? -8 Evaluate 33/60 + 99/(-55) - 57/(-4). 13 ((-4)/(-14))/((-54)/(-117)) + 2/3 9/7 What is the value of (19/(-1368)-120)/((-10)/(-12))? 2 1/(8 - (-328)/(-40)) -5 Evaluate (0 - 3/(-8))/(18/(-8208)-19). 9 Calculate ((-16182)/(-812) - 21)(-1)/(-2 - -7). 3/14 Evaluate (-29)/(-116)(3 + -3 - -4). 1 Evaluate (-1 - (-32)/33) + (-180)/(-495). 1/3 2/(-2)(-191 + 188) 3 What is (-12 + 1659/105)/(1/(-5))? -19 Evaluate (440/30)/((-2)/3)(-35)/(-70). -11 Evaluate (97 - 109) + -13 + 49. 24 102/(-238) - (-96)/126 1/3 Calculate (-175)/45 - ((-2)/(-39) - (-2475)/(-351)). 28/9 Evaluate (-638)/(-55) + (-112)/70. 10 ((-36 - -8)/7)/(8 - 10) 2 Calculate (-358/(-40))/(-3 - -2). -7 Evaluate 20/6(4/(-5) - (-96 - -95)). 2/3 Calculate (-119)/34(-12)/42. 1 What is 82/(-30) - -49(-24)/(-840)? -4/3 What is ((-4)/(-34) - 79/((-8058)/(-420))) + 23? 19 Calculate (5/(-21))/((-1000)/400). 2/21 418/570 - (0 - ((-8)/(-2))/(-12)) 2/5 What is the value of 1/3((-1414)/(-28) - 4)-2? -31 What is the value of (-1)/(-6) + (312/208)/((-36)/4)? 0 What is 156/(-91)9(-77)/(-66)? -18 19/(-209) + (-24)/(-22) - 5 -4 Calculate (-13 - -22) + -9 - (-2)/52. 1/26 ((-55)/(-22))/((-4)/(-16)) 10 Evaluate 8/(-28) - (-1794)/644. 5/2 What is the value of (-736)/580 + 1 - (-2 - (-36)/20)? -2/29 Evaluate (-620)/55 + 1512/1188. -10 What is (4/(-4))/((-24)/1440-6)? -10 What is 247/361(-60)/(-390)? 2/19 What is the value of (6/40)/(117/455)(-9)/(-7)? 3/4 What is (10 + 51/(-6))/(14/(1344/(-54)))? -8/3 Calculate (-352)/(-840) + (5 - (-74)/(-14)). 2/15 Evaluate (-8368)/(-560) - (-7 + 16) - (-2)/35. 6 What is ((-284 - -285)(-5)/(-29))/5? 1/29 What is the value of ((-1710)/(-20))/(-19)(-6)/(-9)? -3 (18/(-14))/3 + -13(-261)/26390 -3/10 What is the value of (-2451)/190(-5)/(-7) - -9? -3/14 What is the value of 12/16 + (1 - 15/(-12))? 3 What is -5 - -3 - 72/(0 - -8)? -11 ((-12 - -17) + -2)(-5 + (-7 - -7)) -15 What is the value of (8/(-3) - -2)549/1464? -1/4 Calculate ((-432)/9)/(-6) + 5 - (1 + 1). 11 What is (-3 - (-18)/(-12))60/18? -15 Calculate 3/(-5)(100/(-6) + (-325)/195). 11 Calculate (804/(-2211))/((-82)/22 + 4). -4/3 Evaluate 1232/224(-2)/(-22). 1/2 Evaluate -16 - -2 - (261/(-29) + -5). 0 Calculate -3 + 5 + 1855/(-945). 1/27 (9/(-6))/(((-990)/(-40))/(-11)) 2/3 Evaluate -8(52/16 - 0 - (20 - 16)). 6 What is the value of ((-10)/(-32))/(-115 + 120)? 1/16 (-27772)/1378 - 5-4 -2/13 What is (-21)/1 - (-440 + 437)? -18 What is 3/(-6) + (-91)/(-26) + 1? 4 What is the value of 1/(-1 + 88/80)1/(-6)? -5/3 What is the value of (-208)/(-585) + (-6)/4 + (-420)/(-216)? 4/5 Evalu	{ "pile_set_name": "DM Mathematics" }
is divided by 22? 19 Suppose -75 + 30 = -9t. Calculate the remainder when 29 is divided by t. 4 Let g(s) be the second derivative of 4s*3/3 - 105s*2/2 + 3s + 11. What is the remainder when g(20) is divided by 4/6 + (-55)/(-3)? 17 Let a be (4/18-3)/(32/(-16464)). Suppose -5 = 3g + 2g, 5b + 2g - a = 0. Calculate the remainder when b is divided by 36. 33 Let t = -164 - -110. Suppose -5v = 4w - 23, -18 = 5v + 7. What is the remainder when w is divided by (-2)/5 + t/(-10)? 2 Suppose -2m + 194 = -2k, -2k - 6 = -k. Let l = -53 + 84. Calculate the remainder when m is divided by l. 29 Suppose 2j = -2m - m - 61, -5m + 3j - 70 = 0. Let b(s) = s2 + 14s - 21. Calculate the remainder when 118 is divided by b(m). 28 Let c(h) = h*3 - 10h*2 - 7h - 21. Let f = -97 - -142. What is the remainder when f is divided by c(11)? 22 Let n = 38 + -38. Suppose -3u - c + 50 = 0, n = 4c - 14 - 6. Calculate the remainder when u is divided by 8. 7 What is the remainder when (-1325)/(-10)36/30 is divided by 39? 3 Calculate the remainder when 80 is divided by ((-152)/16 + 9)/(4/(-112)). 10 Let t(a) = -a2 + 25a - 7. Let z be (-825)/15(-2)/5. Calculate the remainder when t(z) is divided by 20. 19 Let n(g) = 18g*2 + g. Suppose -5u = -2j - 10, u + 32 = -3j - 0u. Calculate the remainder when ((3 - -3)/1)/(j/(-55)) is divided by n(-1). 16 Let z = -52 + 25. Let g = -17 - z. What is the remainder when 17 is divided by 1 - g/(-6 - -4)? 5 Suppose -6n + 1100 = 19n. Calculate the remainder when n is divided by 16. 12 Suppose -12 = 3a, -s + 2a + 36 = s. What is the remainder when (15/10)/((-2)/(-32)) is divided by s? 10 Let n = 74 - 46. What is the remainder when n is divided by 5? 3 Let w = 306 - 295. What is the remainder when 361 is divided by w? 9 Suppose -3y = 2a + 9 - 34, 0 = -3a - 3y + 45. What is the remainder when 96 is divided by a? 16 Suppose -4s + 6s = 60. Suppose 0 = -3r + 24 + s. What is the remainder when r is divided by 13? 5 Suppose 4j = -i + 59, -38 = -4i + 5j + 198. What is the remainder when i is divided by 20? 19 Suppose 92a = 91a + 8. What is the remainder when 23 is divided by a? 7 Let k(s) = 12s - 7. Calculate the remainder when 33 is divided by k(3). 4 Suppose -4f + 2c = -2f, 0 = -2f - 2c + 12. What is the remainder when 26 is divided by f? 2 Let b = 30 - 4. Suppose 24g - b = 22g. What is the remainder when g is divided by 7? 6 Let s be (-2)/((42/(-225))/7). Let r = 214 - s. What is the remainder when r is divided by 37? 28 Suppose -33 - 162 = -2u - o, -3u + 4o + 265 = 0. Suppose u + 181 = 4r. What is the remainder when r is divided by 24? 21 Suppose -1520 = -62o + 42o. What is the remainder when o is divided by 48? 28 Suppose -l = 13 - 9. What is the remainder when (-4 + -7)(3 + l) is divided by 3? 2 Suppose 0 = 5f + 15, o - 9 = 3f + 166. What is the remainder when o is divided by 87? 79 Let a(q) = 19 + 15q + 0q*3 + 2q*3 - 30 + 12 + 33q*2. Calculate the remainder when 82 is divided by a(-16). 14 Let m(i) = 83i - 2561. Calculate the remainder when m(32) is divided by (64/10)/((-1)/(-5)). 31 Let d(v) = 28v + 1. Suppose -2 = -n - n. Suppose 2w - 62 = -5h, 3h - 4h = -6. Calculate the remainder when d(n) is divided by w. 13 Let x = -136 - -205. Let y be 60/18(-36)/(-15). Suppose 0f - 288 = -yf. Calculate the remainder when x is divided by f. 33 Let z = 69 - 26. What is the remainder when (z - 2) + (4 - 7) is divided by 20? 18 Let h(k) = -20k + 9. Let u(b) = -21b + 10. Let x(q) = -5h(q) + 4u(q). Calculate the remainder when x(3) is divided by 17. 9 Suppose 4j - 2j - 8 = 0, -5g + 135 = -5j. What is the remainder when g(2 - (0 + 1)) is divided by 11? 9 Let a(r) = -r3 + 6r*2 - r - 6. What is the remainder when a(3) is divided by 1? 0 Let q(s) = 15s - 25. Let y(z) = -13z + 24. Let h(r) = -3q(r) - 2y(r). Calculate the remainder when h(-7) is divided by 18. 16 Suppose 151 + 116 = 3v. Let a(j) = -j + 0 + 6 + 3. Calculate the remainder when v is divided by a(-14). 20 Let p = 10 - 6. Suppose -k = -pk. Suppose k = -3q + 5l + 98, -q + 4l = -0q - 21. What is the remainder when q is divided by 11? 8 Let d = 600 + -585. Suppose -3v = j - 71, -7 + 2 = -v. Calculate the remainder when j is divided by d. 11 Suppose 624 = -23o + 39o. Calculate the remainder when o is divided by (-3)/(1 - 3/2). 3 Let d(m) = m*2 + 4m - 11. Let r be d(-6). Calculate the remainder when (-13 - -2)/(r/(-1)) is divided by 4. 3 Let b be (-3 + (-1 - -3))/(-1). Let p(m) = m - 9. Let d be p(5). Calculate the remainder when (b - -2)(1 - d) is divided by 8. 7 Let p = 41 + -35. Let h = 149 + -128. Calculate the remainder when h is divided by p. 3 Let s(j) = 5j + 238. Calculate the remainder when s(17) is divided by 110. 103 Let i = 251 - 211. What is the remainder when i is divided by 3? 1 Let u = 502 + -20. What is the remainder when u is divided by 27? 23 Suppose -27d = 5y - 26d - 75, 2y - 4d = 30. Calculate the remainder when 131 is divided by y. 11 Let a(k) = -3k*2 + 4k - 15. Let f be a(10). Let d = f + 172. Let z = 200 + d. Calculate the remainder when z is divided by 20. 17 Let g(b) = 45b2 - b - 2. Calculate the remainder when g(-1) is divided by (3/(-6))/(5/(-150)). 14 Suppose 186 = -43l + 44l. What is the remainder when l is divided by 21? 18 Let b = -4 + 9. Suppose 7 = l + 3u - b, -3l - 16 = -4u. Suppose l = -k + 66 + 8. Calculate the remainder when k is divided by 19. 17 Suppose -4v - 10 = v. Let c(o) = 3o + 3. Let k be c(1). What is the remainder when 8 is divided by ((-1)/v)/(1/k)? 2 Let x(y) = y*3 - 9y*2 - 9y. Suppose -5o + 2z = -346, 2z - 3z = -3o + 208. Suppose 6m - o = -10. Calculate the remainder when 27 is divided by x(m). 7 Suppose -5j - 58 = -213. Calculate the remainder when 495 is divided by j. 30 Let j = 6 - 3. Calculate the remainder when 102 is divided by j + 469/12. 24 Suppose 5t + 24 = 5w + 9, -2w - t + 6 = 0. Suppose -wc - 15 + 348 = 0. What is the remainder when c is divided by 16? 15 Let d(h) = 18h + 1. Let x(t) = -22 - 2t + 3t2 - 2t*2 + 10 - 14. Calculate the remainder when x(11) is divided by d(1). 16 Calculate the remainder when 85 is divided by 44 + 0/(2/((-4)/4)). 41 Suppose 67j + 140 = 71j. Calculate the remainder when 136 is divided by j. 31 Suppose -4t + 16 = 0, 4w - t = w - 139. Let f = 169 + w. Suppose -3y - 63 = -3j, f = 4j - 5y + 42. What is the remainder when j is divided by 10? 3 Suppose 2x - q - 4q = 170, 3q = -2x + 202. What is the remainder when x is divided by 2/11 - 7700/(-242)? 31 Suppose 306 = 7a + 47. Suppose 14g = a + 89. What is the remainder when 24 is divided by g? 6 Let g = -1971 + 2027. Calculate the remainder when 238 is divided by g. 14 Let o = 2443 - 2222. What is the remainder when o is divided by 6? 5 Suppose -3 = -t + 1. Suppose 3k - 2f = 2f + 26, 0 = -tk - 3f + 68. What is the remainder when 38 is divided by k? 10 Suppose 3a + y - 87 = 5y, 19 = a + 2y. Let z be (0 - 0)7/14. Suppose -2f + 8b = 3b - 8, z = 2f - b - 16. What is the remainder when a is divided by f? 7 Let m = -278 + 312. Calculate the remainder when 161 is divided by m. 25 Suppose -24d + 1134 = 3d. Calculate the remainder when 187 is divided by d. 19 Suppose -35 = -5k - 5d, -3d = -5k + 2d - 5. Suppose -a - 2t - 106 = -4a, 4t - 76 = -ka. What is the remainder when a is divided by 11? 10 Suppose 4q - 13 = -1. Let t(k) = -k*2 + 15. Let x be t(0). Suppose 0 = qy - x, -42 = l - 2l - 4y. Calculate the remainder when l is divided by 8. 6 Suppose 24 = x + 5x. What is the remainder when 6/(-3)(0 - (-2 - -5)) is divided by x? 2 Let b = -565 + 594. Calculate the remainder when 102 is divided by b. 15 Let b(l) = -4l - 13. Suppose -12x + 7x - 20 = 0. Let u be b(x). Suppose -uz = -26 - 31. What is the remainder when z is divided by 11? 8 Suppose 2q - 1053 = 2w + w, -q = -4w - 519. Calculate the remainder when q is divided by 38. 37 Suppose 2j - 11 = 3l, 2j - 26 = 7l - 9l. Suppose 285 = ja + 35. What is the remainder when 124 is divided by a? 24 Let g(x) = -x3 - 7x*2 - 7x + 30. Calculate the remainder when g(-6) is divided by 13. 10 Let j(a) = 24*a - 430. What is the remainder when	{ "pile_set_name": "DM Mathematics" }
iggest value? (a) -3 (b) -0.2 (c) -5 (d) 2 (e) 2/995 (f) 2525 b Which is the fourth smallest value? (a) -3 (b) -39/71 (c) 8 (d) -18 c Which is the fifth biggest value? (a) -77699 (b) 6 (c) -15/2 (d) -0.3 (e) -1 a What is the third biggest value in 292, -1, -0.23, -102? -1 Which is the sixth smallest value? (a) 946 (b) 1449 (c) -0.4 (d) -8 (e) -3 (f) -1/5 (g) 0.1 a Which is the fourth smallest value? (a) 7 (b) 1 (c) -23 (d) -65 (e) 0.2 (f) 36/5 b What is the third biggest value in 0.4, 1/10, -142, -45676? -142 Which is the biggest value? (a) 115 (b) 1/7 (c) 1/3 (d) 842/17 a Which is the third smallest value? (a) -7.756 (b) 10 (c) -77/6 b Which is the fourth smallest value? (a) -2/11 (b) 1/2 (c) -6 (d) -2.3 (e) -1244 a What is the biggest value in 3/4, 4340, -0.11? 4340 Which is the second smallest value? (a) -5451 (b) -0.3 (c) 1.9 (d) 14 (e) 1/5 b Which is the third biggest value? (a) 3/7 (b) 30 (c) 3 (d) 6/13 (e) -10 (f) 1 f Which is the third biggest value? (a) 16 (b) -39 (c) -137 (d) 4/417 b What is the fourth biggest value in -0.4, 647129, 0.3, -5? -5 What is the biggest value in -1, 27/20, -5/6, 0.12? 27/20 Which is the fifth smallest value? (a) 8870 (b) 0.4 (c) -1/7 (d) 22 (e) -2 (f) -4 d What is the second biggest value in 10/7331, -0.5, -11? -0.5 Which is the fifth biggest value? (a) -0.2 (b) 0 (c) 0.13 (d) -28 (e) 14 (f) 4 (g) -3 a What is the second biggest value in -1524/17, -3/5, 23/5, 1/4? 1/4 Which is the third biggest value? (a) 0 (b) -1137/4 (c) 3 (d) -4 (e) 0.2 (f) -14 a What is the sixth smallest value in -1/3, -0.0034, 0.4, 0, 1/4, 2/81? 0.4 What is the fifth biggest value in 372, -1/2, -3, -6, 1, 6/5, 61? -1/2 Which is the second biggest value? (a) 2/7 (b) -34 (c) 17 (d) 102 (e) 0.07 c What is the third biggest value in 0.033, 5, -0.2, -23.5, -0.5? -0.2 What is the fourth smallest value in 68558, 0.2, 2, 1, 0.4? 2 What is the second smallest value in -9, 929.2, -251? -9 What is the fourth biggest value in 3, -5/2, -113, -2/13, 36, -1? -1 Which is the fifth biggest value? (a) 4 (b) -86 (c) -3 (d) 151 (e) 2/9 b What is the second smallest value in 0.03621, 527, 1/4? 1/4 Which is the fourth smallest value? (a) -6/77 (b) -0.47 (c) -0.4 (d) -0.2 (e) -0.5 (f) 5 (g) 13 d What is the fourth biggest value in 7, 0.0364, -2.5, -60? -60 Which is the second biggest value? (a) -436534 (b) -2 (c) 11 (d) 3 d Which is the second smallest value? (a) 89.9 (b) 2/19 (c) -6/7 (d) 1.39 b What is the third smallest value in 5, -3.148212, -2, -1? -1 What is the second biggest value in -1/6, -112/9, 861? -1/6 Which is the sixth smallest value? (a) -5 (b) 0 (c) 0.2 (d) -1/6 (e) -2/11 (f) 0.46 (g) -0.09 c Which is the smallest value? (a) -585033 (b) -0.8 (c) -2 a Which is the fifth smallest value? (a) 108 (b) 16 (c) 0.3 (d) 4 (e) -17 a What is the fourth smallest value in -1.11, 5, 577, 13/4? 577 Which is the biggest value? (a) -2/5 (b) -122 (c) -187 (d) -1 (e) -4/5 a What is the second biggest value in 1/3, 0.27, -6337/10, -3/2? 0.27 Which is the biggest value? (a) -5/516 (b) 0 (c) -2/583 (d) 3 d Which is the fifth smallest value? (a) 5 (b) -0.09 (c) 3 (d) -1/8 (e) -2/2373 a What is the third biggest value in 0.2, 1297.16, -19? -19 Which is the fifth smallest value? (a) -0.19 (b) 0.3 (c) 1/195 (d) -2 (e) -23 b What is the third smallest value in -317.7205, -4/9, 3/7, -5, 3? -4/9 Which is the fifth biggest value? (a) -5 (b) 3.6 (c) 1140/17 (d) 2/11 (e) 0.5 (f) -18 a Which is the third smallest value? (a) 1 (b) -1/6 (c) -11.78 (d) 0.44 (e) -0.4 b What is the fourth smallest value in 0.5, 9, 20, 2/19, 10549? 20 What is the biggest value in 2/681, 1/5, -2/3, -203, -2, 1/7? 1/5 Which is the smallest value? (a) 1/5 (b) 468 (c) -50 (d) 224/9 c Which is the third biggest value? (a) 1/5 (b) 3 (c) 0.21 (d) -2 (e) 7 (f) 4116.6 (g) 1/2 b Which is the third smallest value? (a) -191160 (b) -3/8 (c) 28/17 c Which is the fourth smallest value? (a) 0.1 (b) -2 (c) 55 (d) 1 (e) 4 (f) 7 e Which is the third smallest value? (a) 0.374 (b) -161 (c) -0.2 (d) 225 (e) 0.3 e Which is the smallest value? (a) -1 (b) 2 (c) -2/17159 a What is the second smallest value in 2/3, -1, 993235, -4? -1 Which is the second smallest value? (a) 3.145 (b) 1/80 (c) 0.08 (d) -1/5 b What is the fifth biggest value in -2, 0.2, 27, 282, 2/35, -1/5, 1? 2/35 What is the third biggest value in -5, 1/41, 1/21, 21/5, 27? 1/21 What is the seventh smallest value in 1/4, 0.3, -102, 4, -0.01, -4, -3/11? 4 What is the biggest value in 1, -0.6, 37.2, 0.5, -343, 3/5? 37.2 Which is the third biggest value? (a) 2 (b) -572 (c) -38761 c Which is the smallest value? (a) 4 (b) 1/6 (c) -1454/9 (d) -1/3 (e) 0.067 (f) -4/5 (g) 0.4 c What is the smallest value in 11990, 3/17, 7? 3/17 What is the fourth biggest value in -12988, -2, -0.432, 3? -12988 Which is the third biggest value? (a) -1 (b) -0.3 (c) 204917 a What is the third biggest value in -1/3, -3/27031799, 1? -1/3 Which is the biggest value? (a) -43 (b) -142 (c) 180 c Which is the third biggest value? (a) 3/8 (b) -5 (c) -0.2 (d) -156669827 b What is the second smallest value in -152, -31/46, 23? -31/46 What is the sixth biggest value in 1, 3, 1/5, 0.06, 5, 23, 0.05? 0.06 Which is the third smallest value? (a) -51 (b) -4/13 (c) -2/9 (d) -0.05 c Which is the fifth biggest value? (a) 41/8 (b) 2/11 (c) 10/11 (d) -3 (e) -10 (f) -0.1 d What is the biggest value in 2.7, -5, -33749, -0.4? 2.7 Which is the smallest value? (a) 26/9 (b) 6226 (c) -54 c What is the fourth smallest value in -3/11, 1.8, -4, 4, -0.2, 1/49, -7? -0.2 What is the third smallest value in 0.04855, 1/6, 3, 1, 0.3, -5, 17? 1/6 Which is the fourth biggest value? (a) 0.01 (b) -0.009 (c) -1.2 (d) -8/13 (e) -2 c Which is the second smallest value? (a) 3 (b) 1576/5 (c) -449/2 a What is the biggest value in 4/9, -44, -28/13401? 4/9 Which is the second smallest value? (a) 0 (b) 1280 (c) 7 (d) 0.3 (e) -2/9 (f) 3 (g) 0.17 a Which is the third smallest value? (a) -1/5 (b) 4 (c) 2762.021 c What is the fifth biggest value in -76, 3, 0.01, -0.09, 2, 2/61, -2/7? -0.09 Which is the second biggest value? (a) -1/5 (b) -26095 (c) -5 (d) 0.2 a What is the biggest value in 0.0037, 2, -1, 19? 19 What is the fourth smallest value in -0.5, 2522/9, 4, -0.037, 0, -3, -1/9? -0.037 What is the third biggest value in 1/4, 2886571, -4, 4? 1/4 Which is the third biggest value? (a) -0.5 (b) -3 (c) 0.5 (d) -1/5 (e) 2775/19 (f) -209 d Which is the third smallest value? (a) -3 (b) 0.02 (c) 0.4 (d) 7/8 (e) -1/55 b What is the biggest value in 2440, 9/2, 1, 2/5, -5, 0, -0.1? 2440 What is the second smallest value in -1/12, 2/13, 4, -809.429? -1/12 What is the biggest value in 0.1167, 5, 3, -8/27, -5, 1? 5 Which is the seventh biggest value? (a) 4 (b) -12 (c) -14/11 (d) 5 (e) -0.2 (f) 28 (g) 0.06 b Which is the third biggest value? (a) -23 (b) 0.2 (c) 4 (d) 34 (e) 1 (f) 2.37 f What is the biggest value in 2/569, -0.3, -2/27, -1/18, -0.5? 2/569 What is the sixth smallest value in 3, 129, 30, -4, 2/381, 1/4, 1/3? 30 What is the fourth biggest value in -0.09, 248.4, -56, -1/4? -56 Which is the third smallest value? (a) -1/4 (b) -20 (c) 1/5 (d) -20.9 (e) 8 (f) -5/14 f Which is the second biggest value? (a) 6 (b) -0.3 (c) -3/29 (d) -3/7 (e) 167/15 a Which is the sixth smallest value? (a) 3/5 (b) -6/5 (c) 1 (d) 3 (e) 306 (f) -5 e What is the second biggest value in 3, -3, 1/8, 1/6, 27, 9, 0? 9 Which is the third biggest value? (a) -2/11 (b) -567877 (c) -2/683 b What is the smallest value in 147144336, -4/5, 2/7? -4/5 What is the second biggest value in 0.1, -0.0333, 213364? 0.1 What is the sixth smallest value in -6/11, -0.5, 21/5, 1.4, -30, -2/17, -4? 1.4 What is the third smallest value in 78, 5, 0.92367? 78 Which is the second biggest value? (a) 8 (b) 11 (c) -26/57 (d) -9 (e) -2.5 a Which is the third biggest value? (a) -0.10456 (b) 41/6 (c) -6 c Which is the fourth smallest value? (a) -445 (b) 204 (c) 0.6 (d) 4/7 b Which is the smallest value? (a) -1/8	{ "pile_set_name": "DM Mathematics" }
) assuming a is positive. a*(-923/126) Simplify (mm/(mm(m*2/mm)/m)m/m10m)/(mmm/((mm(mmm*(-2/13)m)/mm)/m)m*1mmm) assuming m is positive. m(-158/13) Simplify (g(1/4)g(-9)/g)/(gg(-2))(2/25) assuming g is positive. g*(-967/100) Simplify (aa/(a/a(-1)))(-2)a/((aa*(2/3))/a)a*6a assuming a is positive. a(22/3) Simplify (k(-4/7)/(k/((((k(k/k(-3/8))/kk)/k)/kk)/k)))25 assuming k is positive. k(-1675/56) Simplify (v/((vvv(-2)v)/v))*26((v*(-10)v)/vv)/vvv(-8) assuming v is positive. v9 Simplify (h(-1/56))(-5) assuming h is positive. h(5/56) Simplify ((t/(t(5/4)/t))/(tt/(t/(t/t*(-4/7))ttt)))(-1) assuming t is positive. t(-33/28) Simplify ((y/y6)/y1)/(y((y/((y/(y/y(-1)))/yy))/yy)/y)(-6/7) assuming y is positive. y(-30/7) Simplify ((z/z1)/z(1/15))(-38) assuming z is positive. z(38/15) Simplify ((h(-2/5))(-1))11 assuming h is positive. h(22/5) Simplify (r(-16)rr)/r(rrr*(2/15))/rr assuming r is positive. r(-193/15) Simplify ((y17/y)/y)/(y/y11) assuming y is positive. y25 Simplify m/m*(-8/9)m(-18) assuming m is positive. m(-145/9) Simplify (s/(s*(2/35)s)s)/(s/(s/(s/s(4/9)))) assuming s is positive. s(122/315) Simplify y11yy(-4/21) assuming y is positive. y(248/21) Simplify b(-20)b(-16/5) assuming b is positive. b(-116/5) Simplify (u/u1)(-38)uuu(3/7)uu1 assuming u is positive. u(31/7) Simplify ((mm*(-3/10)/m)/mm)1 assuming m is positive. m(-3/10) Simplify (c*6cc1)/(c2c/(cc(-5)c)) assuming c is positive. c2 Simplify o(-1)o(-7/3)(o/(o/o*(1/4))o)(16/7) assuming o is positive. o(-10/21) Simplify zzz*(-30/11)z(-1) assuming z is positive. z(-19/11) Simplify ((((d/d(2/21))/d)/d)/((((d(-6)d)/d)/d)/d))32 assuming d is positive. d(4640/21) Simplify (r(-2/15))(-4/7) assuming r is positive. r(8/105) Simplify (d7/(dd*(-2/5)d))/((dd/(d(-2/3)dd))/dd)(-9) assuming d is positive. d(57/5) Simplify q/(q*(-5/6)q)q(-3/2) assuming q is positive. q(-2/3) Simplify (ff*18)/(f(f(-18)/f)/f) assuming f is positive. f38 Simplify ((kk/(k/(k(-8)k)))/k8)/(k(-1/7)k1) assuming k is positive. k(-104/7) Simplify u(-44)/(u/u(-2/91)) assuming u is positive. u(-4097/91) Simplify ((p5pp)/p)(-2/21) assuming p is positive. p(-4/7) Simplify o(-17/3)oo/((o/(o/o(5/2)))/o) assuming o is positive. o(-31/6) Simplify (q(-38)/qq)/(q/q*(3/10)q) assuming q is positive. q(-397/10) Simplify (k/(k(-4)/kk))(-7/4) assuming k is positive. k(-35/4) Simplify (c0)29/(c(-2)c/((((c4/c)/c)/c)/c)) assuming c is positive. c Simplify (o(-6)/o(-7))/(o(-6)/o3) assuming o is positive. o10 Simplify (i(-1/3))42/((i*1/ii)/i)(12/11) assuming i is positive. i(-14) Simplify ((qq(-3/5)q)(-5))(-6) assuming q is positive. q42 Simplify (m19)(-15) assuming m is positive. m(-285) Simplify (g*(1/18)g(-4)/g)(-19) assuming g is positive. g(1691/18) Simplify (v/((v(-2/7)vvv)/v))(-1/7) assuming v is positive. v(5/49) Simplify w/(ww*5)((w/(w/(ww((ww5)/w)/w)))/w)/w(w/(w*(-2/3)/w))/(ww(-6)/w) assuming w is positive. w(23/3) Simplify b/b*(-11)b(1/30) assuming b is positive. b(361/30) Simplify ((bb(-2)bb)/(b1/b))(-12/5) assuming b is positive. b(-12/5) Simplify (bb*(-16)b)/((b/b12)/b) assuming b is positive. b(-2) Simplify ((d/(d(d5d)/dd))(-43))(9/4) assuming d is positive. d(1161/2) Simplify ((o/(((oo/o*(-1/3)oo)/o)/oo))/o)*(20/7)(o0)(-1/19) assuming o is positive. o*(-200/21) Simplify (uuu/u6uuuu(-2/9)/u)(-25) assuming u is positive. u(275/9) Simplify (l(-3/7)/(l(-2/5)l))17 assuming l is positive. l(-612/35) Simplify w*28(ww/w(-19))/w assuming w is positive. w48 Simplify (d(dddd(-3))/d)/d(9/4) assuming d is positive. d(-9/4) Simplify (w(10/9)w)/w(-5/4) assuming w is positive. w(121/36) Simplify ((cc(-5))/cccc)/(c/c*(-1/6))((c(-1)/c)/c)32 assuming c is positive. c(-595/6) Simplify (f(1/5))*0 assuming f is positive. 1 Simplify (d(d(-17)/d)/d)/d(-6/13) assuming d is positive. d*(-228/13) Simplify (h/(hh/h*(-1/3))h/h(1/2))/(h(1/3))48 assuming h is positive. h(-101/6) Simplify (((n*(2/11)n)/n)25)(-18) assuming n is positive. n*(-900/11) Simplify vv*(-1/4)v*(-3/8)v((((v/((v/(v/(vvv/v(-1)v)))/v))/v)/v)/v)/(((v/v(-1/13))/v)/v) assuming v is positive. v(-385/104) Simplify u*(5/7)/(uu(-2)/u) assuming u is positive. u(19/7) Simplify (i/(i/i(2/11)))(-12) assuming i is positive. i(-24/11) Simplify (f0f(-3/7)f)(-32) assuming f is positive. f(-128/7) Simplify (a*(-6)a)32 assuming a is positive. a(-160) Simplify (y/y*(-3/11))/(((yyy(-11/3)y)/y)/y) assuming y is positive. y(130/33) Simplify g(-2/69)/((g/(g/g*(1/8))g)/g) assuming g is positive. g*(-85/552) Simplify (ggg(2/19))(2/25) assuming g is positive. g(16/95) Simplify ((r(-1)rr)(1/6))(-43) assuming r is positive. r(-43/6) Simplify v(-2/5)/(v/(((v(11/3)/v)/v)/v)) assuming v is positive. v(-11/15) Simplify u(2/45)u(-2/17) assuming u is positive. u(-56/765) Simplify (d(-2)/d(-11/2))(-11/4) assuming d is positive. d(-77/8) Simplify ((p/(p*(-2/9)/p)p)/(p/p*(-2/21)p))46 assuming p is positive. p(3266/63) Simplify f9/((f/(f/(f15/ff)f))/f) assuming f is positive. f(-4) Simplify ((r(1/2)rr)/rrrr(-6/11)r)/((r/((rr(5/3))/r)r)/(r/(rr5))) assuming r is positive. r(-91/66) Simplify (v(-1/2)/v)31 assuming v is positive. v(-93/2) Simplify (hh(-1/23))/h(-2/3) assuming h is positive. h(112/69) Simplify (s/s11)/s13 assuming s is positive. s(-23) Simplify g*(-1/49)g/(g/(g(-35)/g)) assuming g is positive. g(-1765/49) Simplify (w(1/3))(-2/59)/(w*(3/4)w(-2/3)) assuming w is positive. w(-67/708) Simplify (p(p(-6)/p)/pp)/((p*(4/7)/p)/p)(pp/p2)(-14/11) assuming p is positive. p(-32/7) Simplify ((s/(s(((s(1/5)/s)/s)/s)/s))(-48))(-35/2) assuming s is positive. s3192 Simplify (v*(-8)/vvv/(v/(v/(v/(v(2/27)v)v))))34 assuming v is positive. v(-7276/27) Simplify (z((z/((((((z(2/3)/z)/z)/z)/z)/z)/z))/z)/z)12zz*4(z/(zzz/(zzz(-1/3)/z)))/z assuming z is positive. z(200/3) Simplify (((y/(y*(-5)y))/yy)/yy)/(yy(-6)/y)y*(-6)(y/y4)/y assuming y is positive. y Simplify (n(-4)n3)(-5/6) assuming n is positive. n(5/6) Simplify (x(-1)/x)(-13)(x/(x*(-1/2)x))(18/5) assuming x is positive. x(139/5) Simplify (t*(2/7)/ttt(-2/15))/(t(-2/9)tt/(ttt/(t(-6)/t)tt)) assuming t is positive. t(3268/315) Simplify ((u1u)14)(-33) assuming u is positive. u*(-924) Simplify (vv(-2/19))(3/14) assuming v is positive. v(51/266) Simplify (p7)(-5/6) assuming p is positive. p(-35/6) Simplify (wwww2)(-42)/(w0/w)(14/13) assuming w is positive. w(-2716/13) Simplify (f(1/2)/ff(-3/8))/(f1)(-23) assuming f is positive. f(177/8) Simplify (hh(2/19))/(hhh(-4))(hh/h6h)/h8 assuming h is positive. h(-150/19) Simplify ((u/u0)/(u/u(-2/13)))/((uu/(u(u/u*(-2/5))/uu))/(uuu*4/uu)) assuming u is positive. u(406/65) Simplify (s(3/5)/s)46 assuming s is positive. s(-92/5) Simplify (h(-3/8))(3/19) assuming h is positive. h*(-9/152) Simplify k/(k/(kk*(-10)))k/(k/(k/k(-1/22))) assuming k is positive. k(-175/22) Simplify ((z(z/(z/z0z))/z)/z(zz/(zzzz(-6)zz))/z)(-2/17) assuming z is positive. 1 Simplify (a/a(9/2))/(a/a(-6/13)) assuming a is positive. a(-129/26) Simplify ((l/(ll/(l/l(-1/3))))/l(-2/21))/(l(-1))28 assuming l is positive. l(199/7) Simplify a(-4/9)/(aa(-2)a)a(1/7)/(a/(a/(a/(a/(a8a)))a)) assuming a is positive. a(-523/63) Simplify (qqq/(q(1/3)/qq))(-18)/(q(-3)/(q/(q/(q*(-2/9)/q)qq))) assuming q is positive. q(-434/9) Simplify ((x/x(7/2))/x)(-3/47) assuming x is positive. x(21/94) Simplify g8/(g(-23/4)g) assuming g is positive. g(51/4) Simplify (w(-2/3)/w	{ "pile_set_name": "DM Mathematics" }
g Find the second derivative of -361g - 76g2 + 312g*3 + 73g*2 - 536g + 18g3 + 2 wrt g. 1980g - 6 Let w(y) be the third derivative of -4y7/35 - y5/30 - 145y*4/24 + 2687y*3/2 - 3y*2 + 67y. Differentiate w(a) with respect to a. -96a3 - 4a - 145 Let k(c) be the third derivative of -95/3c3 + 0c*4 - 34/15c*6 + 0c + 0 + 0c5 - 248c*2. Find the first derivative of k(n) wrt n. -816n*2 Suppose -1 + 161 = j. What is the second derivative of 6 - 86i - 25i3 - i2 - 84i - 2 + ji wrt i? -150i - 2 Let q(t) = -2t3 - 40t*2 + 53. Let h(z) be the first derivative of -3z*4/4 - 13z*3 + 52z - 73. Let i(x) = -3h(x) + 4q(x). Differentiate i(v) wrt v. 3v2 - 86v Suppose -4q - 6v + 9v = 560, -3q = -5v + 420. Let x = 142 + q. What is the second derivative of -3y + 0yx + 6y*2 + 7y*2 - 3y2 wrt y? 20 Let z(y) = y3 - 7y2 - 2y + 18. Let c be z(8). Suppose 4k - c = -5f, 4f - 16 - 28 = -k. What is the second derivative of 6q - 70 + 70 + fq2 wrt q? 20 Let k = 46 - 24. Find the third derivative of -6q*5 + 3q*3 + 46q*2 + 25q*5 - kq*5 wrt q. -180q*2 + 18 Let a(c) be the first derivative of -1585c3/3 - c2/2 - 211c - 1249. What is the second derivative of a(s) wrt s? -3170 Let q(x) = -x3 - 9x*2 - 11x - 20. Let c be q(-8). What is the first derivative of 0 - y - cy3 + 0y - 26 - 5 wrt y? -12y2 - 1 Let j = 10 - 0. Differentiate -8 + j + 68l*2 - 1 + 36 wrt l. 136l Let q(c) be the second derivative of -3613c5/10 + 9c*3/2 + 13c*2/2 - 3272c. What is the second derivative of q(y) wrt y? -43356y Let l(b) be the third derivative of -53b*7/210 - 2b*6/15 - 533b*3/3 - 399b*2. Differentiate l(m) wrt m. -212m*3 - 48m*2 Let q(d) be the first derivative of 4d + 69 - 3/2d2 + 14d*3. Find the second derivative of q(v) wrt v. 84 Let o(w) = -10 - 4w + 10w + 8 - 7w. Let a(n) = -20n - 2. Let u(q) = a(q) - 2o(q). What is the first derivative of u(i) wrt i? -18 Let a = 96 + -96. Suppose -6x + 14 = 4w - 3x, -2w + 2x = a. What is the third derivative of 173j*2 - w + 2 + 18j*4 - 157j*2 wrt j? 432j What is the second derivative of -728 + 79i - 276i*3 - 254i + 2i2 - 726 + 1450 wrt i? -1656i + 4 Differentiate 810a2 + 430 + 541 - 259 - 224a*2 + 967 with respect to a. 1172a Let o(b) be the first derivative of -1281b2/2 + 567b - 662. Differentiate o(d) wrt d. -1281 Let u(t) be the third derivative of -5/12t5 + 0 + 0t*3 + 0t + 0t4 + 0t*7 + 43/168t*8 + 0t*6 + 151t*2. Find the third derivative of u(p) wrt p. 5160p*2 Suppose 2n - 16 = -2z - 4, -n = -3z + 2. Let o(m) be the third derivative of -11/24m4 + 0 + m3 + 0m - 13mz. What is the derivative of o(x) wrt x? -11 Let d = 8 - -17. Suppose dv = 10v + 240. Find the third derivative of -22b*2 - 25b*2 + vb*2 - 20b*5 - 2b*2 wrt b. -1200b*2 Let p(r) = 9r - 13. Let o be p(3). Let m be (-12)/o154/(-33). Find the third derivative of 12y*4 + 10y*2 + 16y*6 - 12y*m wrt y. 1920y*3 What is the derivative of 175r*2 + 777r*2 + 7031 + 1416r*2 wrt r? 4736r Let z(u) be the first derivative of -2/5u5 + 0u*4 + 55u - u*2 - 73 - 67/3u*3. What is the second derivative of z(t) wrt t? -24t*2 - 134 Let q(g) be the second derivative of -69g*7/7 + 1091g*4/12 + 11g - 26. Find the third derivative of q(z) wrt z. -24840z2 Find the third derivative of -22p*2 + 10586p*4 + 621p - 7p2 + 38p*2 + 2779p*4 wrt p. 320760p Let d(i) = i4 - i2 - 2i + 12. Let b(g) = 7g*4 + 812g*3 - 3328g*2 - 18g + 108. Let s(r) = -b(r) + 9d(r). What is the third derivative of s(l) wrt l? 48l - 4872 What is the first derivative of -235 - 562 + 206 - 854 + 1255a wrt a? 1255 Let f(h) = -12907h*2 + 9224h + 48. Let w(l) = -12907l2 + 9223l + 38. Let p(c) = 4f(c) - 5w(c). Find the second derivative of p(m) wrt m. 25814 Let a(t) = t*3 + 9t*2 - 2t - 12. Let n be a(-9). Find the third derivative of -225v4 + 217v*4 + 4v*2 + 0v*6 + 15v*2 + 2v*n wrt v. 240v*3 - 192v Let b(u) = 80 - 30u - 122 + 60. Let c(w) = -1. Let t be -1 - 0 - (1 + 2). Let m(x) = tc(x) + b(x). Find the first derivative of m(v) wrt v. -30 Let j(x) = 2684x3 - 2x*2 - 2x - 2414. Let d(b) = 2684b3 - 3b*2 - 3b - 2412. Let a(n) = 2d(n) - 3j(n). What is the derivative of a(p) wrt p? -8052p2 Let b = 53 - -41. Differentiate -102l*2 + 18 + 19 + bl*2 - 238 - 12l with respect to l. -16l - 12 Let v be 2/2 + 24/3210/15. Let q(p) be the second derivative of vp4 + 0 + 5/6p*3 + 0p*2 - 19p. Find the second derivative of q(y) wrt y. 36 Let t(w) be the third derivative of -45w2 + 0w + 0w4 + 1/15w*5 + 2w*3 + 1/30w*6 + 0. What is the first derivative of t(l) wrt l? 12l*2 + 8l Let k(b) = -7b4 + 3b*2 - 155b + 923. Let q(h) = 2h4 - h2. Let t(f) = k(f) + 3q(f). Differentiate t(z) with respect to z. -4z3 - 155 Let q(x) = x3 + 7x + 7 + 1 + 3x2 - 10x*2 - 6. Let n be q(6). Find the first derivative of -1 + 12 + 8p*4 + n wrt p. 32p3 Let w(j) = -j3 + 6j2 - 5j + 7. Let i be w(5). Suppose -q + 3h + 2 = 0, 26q + 5h - 2 = 25q. What is the derivative of -i + 3 + 62mq - 47m*2 wrt m? 30m Suppose -302a = -300a - 6. What is the third derivative of 72i3 + 5i*2 + a - 2 - 26i*2 - 63i*2 wrt i? 432 What is the third derivative of 25 + 46z*2 - 166z - 704z4 + 7 + 166z wrt z? -16896z Find the second derivative of 2200i*4 + 8i - 1105i4 - 1095i*4 - 1685i*5 + 11 - 3i wrt i. -33700i3 Let p(s) be the second derivative of -381s*3/2 + 575s*2 - 920s. Differentiate p(y) wrt y. -1143 Let u(o) = 3o2. Let y(m) = 11m*3 - 69m*2 + m - 38. Let b(h) = -4u(h) - y(h). Find the first derivative of b(d) wrt d. -33d2 + 114d - 1 Let j = 8455/18 - 4214/9. Let v(s) be the first derivative of js2 + 21s + 37. Differentiate v(o) wrt o. 3 Suppose -r + 2n = -10, n + 4 = r - 2. Find the third derivative of 13s*5 - 233s*2 + 219s*r + 116s*2 wrt s. 780s*2 Let s(f) be the second derivative of 4f*3/3 + 39f*2 - 75f. Let x(t) = -6t - 78. Let i(c) = 5s(c) + 4x(c). Differentiate i(r) with respect to r. 16 Suppose 8k = 310 + 34. Find the second derivative of 6j - 6188j*2 + kj + 0j + 6179j*2 wrt j. -18 What is the second derivative of -316j - 884j - 4321j*2 + 1582j*2 - 55j + 114j wrt j? -5478 Let k(d) be the first derivative of -66 + 8d + 0d3 + 0d*4 - 86/5d*5 - 9/2d*2. Find the second derivative of k(t) wrt t. -1032t2 Let j(u) = -u2 - 53u + 36. Let i be j(-52). What is the second derivative of 5 - 37o*2 + io - 38o - 4 + 3o wrt o? -74 What is the third derivative of -6k3 - 865k*6 + 2 + 1005k*2 + 6k*3 - 1000k*2 wrt k? -103800k*3 Let x(v) = 32v*2 + v + 1. Let r(h) = -2351h*2 + 2209h + 1. Let y(c) = r(c) - x(c). What is the second derivative of y(f) wrt f? -4766 Let a(j) = -497j3 + 3j*2 + 81j + 16. Let v(x) = 994x3 - 6x*2 - 162x - 29. Let m(b) = 7a(b) + 4v(b). What is the second derivative of m(w) wrt w? 2982w - 6 What is the second derivative of -1 + 198x + 3099041x4 + 1314x*5 - 3099041x*4 wrt x? 26280x*3 Let c be 0 + 40/(-16)-2. Find the third derivative of -cy6 - 50 - 14y*4 + 39y*4 - 4y*2 + 50 wrt y. -600y*3 + 600y Find the second derivative of -1175g4 - 25g + 420g4 + 4 + 1 wrt g. -9060g*2 Let a(k) be the second derivative of 17k*4 + 553k*2/2 + k - 481. What is the derivative of a(h) wrt h? 408h Let q(i) be the second derivative of 1495i7/42 - 117i*4/2 - i + 159. What is the third derivative of q(j) wrt j? 89700j*2 Find the second derivative of 67l + 107 + 116l - 206 - 5204l*5 + 107 wrt l. -104080l*3 Let u(f) = -4f - 2. Let g(a) = -505a2 + 1603a - 10. Let y(w) = g(w) - 5u(w). Find the second derivative of y(s) wrt s. -1010 Let z(m) be the first derivative of -573m*5/5 + 82m*3 + 830. Find the third derivative of z(o) wrt o. -13752o Let a = -1518 - -2177. Find the first derivative of aj + 254 - 325j + 72j3 - 333j wrt j. 216j2 + 1 Suppose 140 = -18r + 788. Let o be 37/(21/4). What is the first derivative of -13i + 5 + ri + o + 6i wrt	{ "pile_set_name": "DM Mathematics" }
uppose 0 = -4l + v + 7. What is the remainder when p is divided by l? 4 Let a(d) = 3d - 86. Calculate the remainder when 96 is divided by a(37). 21 Let s(f) = f*2 + 9f - 1. Let g be s(-10). Suppose gx - 222 = 3x. What is the remainder when x is divided by 13? 11 Suppose 4z + 72 = -0z. Let x(y) = -7y + 6. Let w be x(-5). Let n = w + z. What is the remainder when 89 is divided by n? 20 Calculate the remainder when (-2)/9 + 3970/45 + 11 is divided by 5. 4 Let s(c) be the first derivative of -1/2c*4 - 4 - 2c3 - c - c2. Calculate the remainder when s(-4) is divided by 21. 18 Calculate the remainder when 2 - 6 - (4 + -7 - 108) is divided by 28. 23 Suppose 0 = -0r + 2r + t + 13, 4r - t + 29 = 0. Calculate the remainder when -2 - 4(-2 + r) is divided by 18. 16 Let n be (-6 - -7)/(2/4). Calculate the remainder when (-1)/((-3)/(n - -205)) is divided by 24. 21 Let s be 93/22/3. Suppose -5 = d - s. Calculate the remainder when 73 is divided by d. 21 Suppose -100 = -8i + 3i. Let h be -3 + 5/(i/96). Suppose -2w = -9 - h. Calculate the remainder when w is divided by 4. 3 Let w(z) = 2z2 + 4z - 3. Suppose d + 322 = -6d + 861. Calculate the remainder when d is divided by w(2). 12 Suppose 795 = 2l + 3l. Let f = -70 + -42. Let v = l + f. Calculate the remainder when v is divided by 12. 11 Suppose -2s + 298 = 3y - s, 5s - 118 = -y. Suppose -4t - 2p + 57 - 9 = 0, -4t = 5p - 66. Calculate the remainder when y is divided by t. 8 Suppose 0 = -56i + 69i - 1612. Calculate the remainder when 241 is divided by i. 117 Suppose 17 = 6v - 205. Let x = v + -7. What is the remainder when x is divided by 6? 0 Calculate the remainder when (-18)/12-4(-554)/(-12) is divided by 31. 29 Let s(g) = 2g - 14. Suppose -2k + 38 = 2x, x - 3k = 3 + 8. Calculate the remainder when x is divided by s(10). 5 Let o = -791 + 903. Calculate the remainder when o is divided by 19. 17 Let s be (-3)/((-22)/(-4) - 4). Suppose -5z - 3i = -255 + 65, 10 = 2i. What is the remainder when (-4669)/(-46) - 3/s is divided by z? 33 Let h(w) = 4w - 1. What is the remainder when h(12) is divided by 3? 2 Suppose -m = 3m + 280. Let l = -60 - m. Calculate the remainder when 17 is divided by l. 7 Calculate the remainder when (-72)/2110/(-30) is divided by ((-4)/(-6))/((-8)/(-228)). 18 Let b = 2054 - 2043. What is the remainder when 494 is divided by b? 10 Calculate the remainder when (-57 - 1)/((-74)/222) is divided by 15. 9 Let l(k) = 3k*2 - 2k - 2. What is the remainder when l(2) is divided by 2 + -1 - (5 - (-6 + 13))? 0 What is the remainder when (-41 + 11)/(-6) + 183 is divided by 49? 41 Let q(y) = -23y - 127. Calculate the remainder when 50 is divided by q(-6). 6 Let z = 57 - 18. Calculate the remainder when z is divided by (124/(-496))/(2/(-104)1). 0 Let u = 139 - 102. What is the remainder when 182 is divided by u? 34 Let g = 1 - -1. Let a = 2 + 4. Calculate the remainder when (a/(-9))/(g/(-93)) is divided by 11. 9 Let k = 198 + -126. What is the remainder when k is divided by 11? 6 Let c be (-80)/(-36) + (-4)/18. Suppose 15 + 35 = k - 3o, -co + 30 = k. Let y = -32 + k. Calculate the remainder when 14 is divided by y. 2 Suppose 2a + a = -3s + 48, 3s + 4a - 44 = 0. What is the remainder when (-5 + (-87)/(-2))2 is divided by s? 17 Let x = 7 + -3. Suppose 2i + 88 = xi. Suppose 3u + u = 60. Calculate the remainder when i is divided by u. 14 Let i(h) = -3h + 285. What is the remainder when i(41) is divided by 37? 14 Let h(f) = -2f*2 - 43f - 152. Calculate the remainder when h(-15) is divided by 20. 3 Suppose 0l + l - 36 = 0. Suppose 2h + 54 = 3s + 336, -h - 4s = -141. What is the remainder when h is divided by l? 33 Suppose -73 - 95 = -14n. Suppose 5o - 195 = -4g - 53, 0 = -4g + n. What is the remainder when 93 is divided by o? 15 Let s(f) = -3f - 4. Let m be -1 + (4 - 0 - 15). What is the remainder when s(m) is divided by 11? 10 Suppose -5z = x + 22, 2x + 27 = -3z + 6x. Calculate the remainder when (-1 - z/15)/(1/(-33)) is divided by 12. 10 Suppose -2r - 2p = 34, 4r + 38 = -5p - 34. Let u(x) = x2 + 8x - 5. What is the remainder when u(r) is divided by 16? 12 Let a(l) = -4l - 3. Let p be a(-14). Suppose 5w - 143 = -p. Calculate the remainder when w is divided by 7. 4 Suppose 6p = 4p + 24. Let c = 22 - 31. Let d = p + c. Calculate the remainder when 5 is divided by d. 2 Let d(m) = 16m3 - m2 - 2m - 2. Let l be d(-1). Let u = l - -21. Let h = -1 + 6. What is the remainder when h is divided by u? 1 Suppose c - 4d - 17 = 0, 9 = c - 2d - 6. Let j be (-2)/(-5)(186 - 1). Suppose 3b = b + j. Calculate the remainder when b is divided by c. 11 Let j = 65 - 37. Suppose 4d - j = 12. Calculate the remainder when 37 is divided by d. 7 Let o = 119 + -64. Let k = -32 + o. What is the remainder when k is divided by 6? 5 Let b be (4 - 6 - -6) + 6. Calculate the remainder when (-1(-5)/b)/(1/22) is divided by (-2)/(2/(-3)) - 1. 1 Let w = -16 - -27. Calculate the remainder when 40 is divided by w. 7 Let i be 2/(-3) + 560/(-6). Let n = i + 105. Calculate the remainder when n is divided by 7. 4 Suppose 3q + 2 = 5. Suppose f - 3 - q = 0. Suppose fh = 3k + 16, 8 - 2 = 2h - 2k. Calculate the remainder when 27 is divided by h. 6 Let y = -23 + 32. Let l(j) be the second derivative of 25j4/12 + j3/6 + j*2/2 + 2j. Calculate the remainder when l(-1) is divided by y. 7 Let t(z) = -11z - 183. What is the remainder when 101 is divided by t(-19)? 23 Suppose -h - 13 = -5s, -42 = -5h - 4s + 9. Calculate the remainder when 145 is divided by h. 5 Let c = -158 - -220. Calculate the remainder when 238 is divided by c. 52 Suppose 8a + 2s - 461 = 3a, -4s = a - 103. What is the remainder when a is divided by 47? 44 Suppose 10r - 5r = 940. Suppose -4k - 4q + r = 0, k - 4q - q = 23. What is the remainder when k is divided by 13? 4 Let s(p) = -4p*2 + 7p - 4. Let n be s(4). Let m = -17 - n. Calculate the remainder when 42 is divided by m. 19 Let k be 58/(-4)(-1 + -1). Let n = 33 - k. What is the remainder when n is divided by 1? 0 Let r = 16 - -40. Suppose 5w = -2w + 105. What is the remainder when r is divided by w? 11 Suppose 5n - 182 = 88. Calculate the remainder when 483 is divided by n. 51 Let g = 165 - 109. Suppose 0l - g = -4l. Calculate the remainder when 135/3 + 1 - (13 + -8) is divided by l. 13 Let v(a) = -a - 391. Let c = -5 - -5. Let z be v(c). What is the remainder when (-8)/(-32) - z/4 is divided by 25? 23 Suppose -8l = 245 - 469. What is the remainder when 74 is divided by l? 18 Let t(p) = 0p2 - p2 - 2p2 + 3 - 3p + 2p2. Calculate the remainder when 11 is divided by t(-3). 2 Let o(h) = 2h*2 + 29h + 193. Calculate the remainder when o(-20) is divided by 23. 22 Suppose 234 = 3t + 3t. Calculate the remainder when 233 is divided by t. 38 Let l(v) = v*3 - 10v*2 - 8v - 7. Calculate the remainder when 204 is divided by l(11). 22 What is the remainder when (-9)/(-9) - (2006/(-1) - 5) is divided by 65? 62 Let c = 227 - 104. Calculate the remainder when c is divided by 42. 39 Suppose 0 = 4u - 0x - 4x - 20, 4u - 11 = -5x. What is the remainder when 92 is divided by ((-2)/u)/(6/(-228))? 16 Let x(c) = -c3 + 5c*2 - 2c - 3. Let b be x(2). Suppose -2o = -a + b, a + 4o - 23 = 12. What is the remainder when 87 is divided by a? 12 Let x(s) = -4s + 0s + 20 - 22. Calculate the remainder when 71 is divided by x(-10). 33 Suppose 4f - 4k = 152, -7f + 2f + 182 = -k. What is the remainder when 46 is divided by f? 10 Let l(x) = x*2 + 8x - 27. Let q be l(-13). Suppose -33u = -qu + 215. Calculate the remainder when 128 is divided by u. 42 Let k(l) = -125l - 1. Let u be k(-1). Let h = 173 - u. What is the remainder when h is divided by 13? 10 Let c(t) = 3t + 1. Calculate the remainder when (170/(-7) + 2)/(70/(-245)) is divided by c(7). 12 Let z(x) = 5x - 36. Suppose -39 = -5o - 4w, 3w + 26 + 19 = 3o. Calculate the remainder when z(o) is divided by 2. 1 What is the remainder when 481/111(0 + 12) is divided by 14? 10 Suppose 0 = -v + 3i + 500, -980 = -2v - 6i + 2i. Calculate the remainder when v is divided by 55. 54 Let o = -66 - -29. Let u = o + 52. Suppose 0 = 2g - 3g + u. Calcul	{ "pile_set_name": "DM Mathematics" }
llest value? (a) 4/7 (b) -1 (c) -2 (d) 0.006 b Which is the biggest value? (a) 23 (b) -0.4 (c) 3 (d) -0.5 a What is the second smallest value in 13/6, 5, 2, 0, 14? 2 What is the third biggest value in -0.5, 311, -2/9? -0.5 What is the second biggest value in 6, -0.5, -5, 4/3, 0.3? 4/3 Which is the fourth smallest value? (a) -1 (b) -13 (c) -0.3 (d) -5 (e) -4 a What is the fourth biggest value in 5, 2/7, 3/8, -5, 3.2? 2/7 What is the second biggest value in 2/7, 2/3, 21? 2/3 What is the biggest value in -1048, -2, 0.4? 0.4 What is the fourth biggest value in -17, 3, 0.8, -2? -17 Which is the fifth smallest value? (a) -2 (b) -13 (c) -4 (d) 0.04 (e) 1/6 e Which is the second smallest value? (a) -0.1 (b) 0.2 (c) -56 (d) -0.5 d What is the third biggest value in -2395, -3, 3? -2395 Which is the fourth smallest value? (a) 0.27 (b) 21 (c) -4 (d) 1 (e) 1/4 d Which is the fourth smallest value? (a) 0.2 (b) -1/5 (c) 2 (d) 0 (e) -14 a Which is the fourth smallest value? (a) -4 (b) 4 (c) -2/5 (d) -2 b What is the second biggest value in 0.06, 5, -18? 0.06 What is the third smallest value in 20, -0.2, 2/5? 20 Which is the fourth smallest value? (a) -40 (b) 1/3 (c) -2 (d) 0.4 d What is the third smallest value in -2/11, -7, -2, 2? -2/11 What is the third biggest value in 2, 6, 20/9? 2 Which is the biggest value? (a) -0.81 (b) 5 (c) 1 b What is the third biggest value in 0, -73, 1/5? -73 Which is the second smallest value? (a) 5 (b) -4 (c) -269 b Which is the third smallest value? (a) 0.3 (b) 49 (c) 1/7 (d) -8 a Which is the third biggest value? (a) 0.5 (b) -238 (c) -3 b What is the biggest value in -2/15, 0, 3, 0.1? 3 What is the fourth smallest value in -194, -0.2, -8, -0.3? -0.2 What is the fourth smallest value in -0.02, -1, 1, 0.4? 1 Which is the smallest value? (a) 1/9 (b) 0.2 (c) 4 (d) 3/2 a What is the third smallest value in -2, -0.12, 3/8, -1, 2/9? -0.12 What is the third biggest value in -0.3, -0.5, -4, 4/215? -0.5 What is the third smallest value in 19, -2, 77? 77 Which is the second smallest value? (a) 157 (b) -5 (c) 2 (d) 3 c What is the third smallest value in 0.1, 17.8, -1? 17.8 Which is the fourth smallest value? (a) -1/2 (b) -110 (c) 2 (d) 0.4 c Which is the smallest value? (a) 1.13 (b) -0.03 (c) -0.1 (d) 2 (e) -1 e Which is the second smallest value? (a) -11 (b) 0.08 (c) -2/37 c What is the smallest value in 1/5, -13, -0.8? -13 Which is the fourth biggest value? (a) 4/17 (b) -5 (c) 2 (d) 1/2 (e) 0.4 a What is the second smallest value in 32, -1/7, -0.39? -1/7 Which is the fourth biggest value? (a) -12 (b) 1/41 (c) -1/2 (d) -5 a What is the second smallest value in 5, 86, -0.3? 5 Which is the biggest value? (a) -16 (b) 1 (c) 4/7 (d) -5 b What is the fourth smallest value in 12.2, -1/3, 0.07, -0.5? 12.2 What is the second smallest value in -3, -21.64, 1? -3 Which is the second biggest value? (a) -9 (b) 0.3 (c) 0.03 (d) -5 c Which is the third biggest value? (a) 2 (b) 0.1 (c) -5 c What is the second smallest value in 0.1, 0.0643, -0.4? 0.0643 Which is the fourth biggest value? (a) -1/2 (b) -0.2 (c) 0.3 (d) 4/5 a Which is the second smallest value? (a) -4/7 (b) -2/27 (c) 0.1 b What is the third smallest value in -0.3, 4, -68? 4 What is the second biggest value in 1.16, 2/11, -5, 5, -0.5? 1.16 Which is the third biggest value? (a) 0.078 (b) -1/2 (c) 6 (d) -1/4 d What is the third biggest value in -5/3, -2, 21? -2 Which is the smallest value? (a) 3 (b) 125 (c) -17 (d) 0.3 (e) 2 c Which is the third biggest value? (a) -1 (b) -1.5 (c) 0.1 b Which is the smallest value? (a) 3 (b) -173 (c) -2 b Which is the second smallest value? (a) 2/13 (b) -2 (c) -2/5 (d) -4 b What is the second biggest value in -3, 0.4, -8/3, 8? 0.4 Which is the third smallest value? (a) -1 (b) -17 (c) 20 c What is the fifth smallest value in -3, 4, -2/7, -0.4, 5? 5 Which is the second biggest value? (a) -4 (b) 50 (c) 4 c What is the biggest value in -6, 9, -0.5, -2? 9 What is the third biggest value in -0.1, 0.7, -0.3? -0.3 What is the fourth biggest value in -36, -3, -1, 1? -36 What is the third smallest value in 23, 0.06, 8? 23 Which is the smallest value? (a) -2.2 (b) 0.07 (c) 2/3 a Which is the second smallest value? (a) 1 (b) 1/6 (c) 1/11 b Which is the second smallest value? (a) 1.2 (b) 9 (c) -2 a Which is the third smallest value? (a) -2.5 (b) -0.4 (c) -1/4 (d) -3 b Which is the fourth smallest value? (a) -2/3 (b) -4 (c) -13 (d) -0.7 (e) -2 d Which is the smallest value? (a) 7 (b) -0.19 (c) 15/14 b Which is the fourth biggest value? (a) -0.058 (b) 0.4 (c) 2/15 (d) -7 d Which is the third smallest value? (a) 12 (b) -4 (c) 7/12 (d) 4 d What is the second smallest value in 3, 0.39, -16? 0.39 What is the fourth smallest value in -25, -1, 1, -2? 1 What is the third smallest value in -0.1, 32/5, 3? 32/5 What is the biggest value in 0.5, 30, -0.06, 0? 30 What is the second biggest value in 15, -3.5, -4? -3.5 What is the second smallest value in 2, 75, 0.2? 2 What is the second biggest value in -1/5, -2/9, -2, -29? -2/9 Which is the third biggest value? (a) 4/3 (b) -1/15 (c) -0.3 c Which is the biggest value? (a) -2 (b) 4/3 (c) 12 (d) 0.2 (e) -12.4 c What is the third smallest value in -0.181, -1, -0.4, 0.2? -0.181 Which is the fifth biggest value? (a) 4 (b) -6 (c) -2/5 (d) -0.1 (e) -4/15 b Which is the second smallest value? (a) 1/2 (b) 2 (c) 1/3111 a Which is the second biggest value? (a) 5 (b) 6/25 (c) -5 (d) 0.1 b Which is the biggest value? (a) 1/6 (b) 1 (c) 146 (d) -7.6 c Which is the third biggest value? (a) -0.2 (b) -0.1 (c) -38 (d) 1 (e) 3 b What is the biggest value in 0.1, -2, -1/3, 35? 35 Which is the second biggest value? (a) -2/7 (b) -1/8 (c) 1 b What is the second smallest value in -0.1, -2, -1/21, -1, -1/5? -1 What is the second biggest value in -0.5, 3/29, -1/4, -32? -1/4 Which is the second smallest value? (a) -3/5 (b) 2.578 (c) -3 (d) -0.2 (e) -5/4 e What is the biggest value in -3, 5, 63, 1/2, -5? 63 What is the third biggest value in -2/5, 18/17, 1/9? -2/5 What is the biggest value in 0, 2/3, 2/11? 2/3 What is the fifth biggest value in 2, -3, 3/7, 3, -65? -65 What is the second smallest value in 43, 1, -4, 3? 1 Which is the biggest value? (a) -20 (b) 4 (c) 0.2 (d) -1/4 b Which is the biggest value? (a) 82 (b) 5 (c) -7 a Which is the second biggest value? (a) 1/4 (b) -4/17 (c) 0.3 (d) -0.1 a Which is the second smallest value? (a) -6 (b) 3 (c) -2/11 (d) -0.2 d Which is the biggest value? (a) -0.2 (b) -4 (c) -5 (d) 0.038 d What is the second smallest value in 3, -3, 9/7, 3/5? 3/5 Which is the fourth biggest value? (a) 118 (b) -1 (c) -0.4 (d) 4/7 b Which is the biggest value? (a) 7 (b) 0.4 (c) -5 (d) 0.5 a What is the fourth biggest value in 19, 1, 2/17, 0.4? 2/17 Which is the third smallest value? (a) 1 (b) -0.07 (c) 0.1 a Which is the second smallest value? (a) -3 (b) 13.9 (c) 0.4 c What is the third smallest value in 7, 1, -2/13, -2/7? 1 Which is the second smallest value? (a) -56 (b) -2/3 (c) 0 b What is the second biggest value in -0.4, -4, -1460? -4 What is the smallest value in 2, 0.4, 2/11, 3? 2/11 What is the second smallest value in -1/4, -14/5, -8, -3? -3 Which is the second biggest value? (a) 4 (b) 6/11 (c) -3 b Which is the second biggest value? (a) 1/5 (b) -28 (c) -5 (d) 2/3 a What is the fourth biggest value in -0.2, -95/2, 0.3, -0.3? -95/2 What is the biggest value in -2/7, -7/3, 1? 1 Which is the third smallest value? (a) -3/4 (b) 0.5 (c) -0.16 (d) 2 (e) -0.2 c What is the biggest value in 2, -6, -67, 6? 6 What is the third smallest value in -3, -13, 0.2? 0.2 What is the smallest value in -15, 0.3, -2/15, 4? -15 What is the second biggest value in -1/5, 4, -1? -1/5 Which is the second smallest value? (a) 4 (b) -0.3 (c) -15 (d) -5 d Which is the second biggest value? (a) 0 (b) -0.7 (c) 3/8 (d) 4 c Which is the third smallest value? (a) 5/2 (b) 2/9 (c) -3 a Which is the biggest value? (a) -0.1 (b) 3 (c) 31/8 c Which is the fifth smallest value? (a) 3 (b) -0.2 (c) 10 (d) -137 (e) -0.1 c Wh	{ "pile_set_name": "DM Mathematics" }
-21823, -27763, -33037? 333q2 - 8271q - 7 What is the k'th term of 972229, 1944291, 2916357, 3888427, 4860501, 5832579? 2k2 + 972056k + 171 What is the p'th term of 1711, -1393, -6569, -13817, -23137, -34529, -47993? -1036p2 + 4p + 2743 What is the b'th term of 358, 630, 880, 1102, 1290? -b*3 - 5b*2 + 294b + 70 What is the h'th term of 229610, 229613, 229616, 229619? 3h + 229607 What is the b'th term of -20569, -31353, -42139, -52927, -63717, -74509, -85303? -b2 - 10781b - 9787 What is the z'th term of 361, 405, 495, 649, 885? 3z3 + 5z*2 + 8z + 345 What is the f'th term of -634841, -1269651, -1904433, -2539187, -3173913, -3808611, -4443281? 14f2 - 634852f - 3 What is the s'th term of -27, 792, 1821, 3060, 4509, 6168, 8037? 105s2 + 504s - 636 What is the q'th term of -206118, -412998, -619878, -826758? -206880q + 762 What is the n'th term of -35129, -140373, -315727, -561191, -876765? -35055n*2 - 79n + 5 What is the g'th term of -117681, -463410, -1039633, -1846356, -2883585, -4151326, -5649585, -7378368? -g*3 - 115241g*2 + g - 2440 What is the p'th term of 8520, 15423, 22326, 29229? 6903p + 1617 What is the a'th term of -3009081, -6018180, -9027289, -12036414, -15045561, -18054736, -21063945? -a3 + a2 - 3009095a + 14 What is the p'th term of -137274065, -137274066, -137274067, -137274068, -137274069? -p - 137274064 What is the u'th term of 12101451, 12101489, 12101529, 12101571, 12101615? u2 + 35u + 12101415 What is the o'th term of -223892, -223917, -223958, -224015, -224088, -224177, -224282? -8o2 - o - 223883 What is the l'th term of 2298, 5025, 12420, 26817, 50550, 85953, 135360, 201105? 389l*3 + 4l + 1905 What is the v'th term of -4384, -17715, -39882, -70885, -110724, -159399, -216910? -4418v2 - 77v + 111 What is the g'th term of 7758, 59925, 201518, 477249, 931830? 7452g3 + g2 + 305 What is the d'th term of -927, -4027, -9233, -16545, -25963, -37487? -1053d*2 + 59d + 67 What is the t'th term of -304074, -304280, -304486, -304692? -206t - 303868 What is the t'th term of 97403, 195362, 293323, 391292, 489275, 587278, 685307? t3 - 5t*2 + 97967t - 560 What is the b'th term of -135423, -270845, -406289, -541761, -677267? -b*3 - 5b*2 - 135400b - 17 What is the w'th term of 535269, 1070259, 1605237, 2140197, 2675133, 3210039, 3744909, 4279737? -w*3 + 534997w + 273 What is the u'th term of -477925, -955847, -1433769, -1911691, -2389613? -477922u - 3 What is the p'th term of -1580425, -1580434, -1580443, -1580452, -1580461? -9p - 1580416 What is the y'th term of -7048117, -14096260, -21144403? -7048143y + 26 What is the y'th term of 13392, 26147, 38902, 51657, 64412? 12755y + 637 What is the y'th term of 3691, 3235, 2585, 1741, 703, -529, -1955? -97y2 - 165y + 3953 What is the b'th term of 948344, 948358, 948402, 948494, 948652, 948894, 949238, 949702? 3b3 - 3b*2 + 2b + 948342 What is the t'th term of -953194, -1906366, -2859538, -3812710, -4765882, -5719054? -953172t - 22 What is the y'th term of 97554, 390214, 877980, 1560858, 2438854, 3511974, 4780224, 6243610? y3 + 97547y*2 + 12y - 6 What is the f'th term of -140624347, -281248695, -421873043, -562497391, -703121739, -843746087? -140624348f + 1 What is the q'th term of -258729, -258730, -258731, -258732, -258733, -258734? -q - 258728 What is the x'th term of -8772041, -8772043, -8772045, -8772047, -8772049, -8772051? -2x - 8772039 What is the i'th term of 114641, 458471, 1031521, 1833791, 2865281, 4125991? 114610i2 + 31 What is the i'th term of 197191, 197153, 197089, 196999, 196883, 196741? -13i*2 + i + 197203 What is the w'th term of -151334421, -151334425, -151334429, -151334433, -151334437, -151334441? -4w - 151334417 What is the k'th term of 568288, 1136580, 1704866, 2273146, 2841420, 3409688, 3977950? -3k2 + 568301k - 10 What is the u'th term of -8249, -8131, -8013, -7895, -7777? 118u - 8367 What is the i'th term of 1148139, 2296060, 3443981? 1147921i + 218 What is the y'th term of -13649, -31729, -61859, -104039, -158269, -224549? -6025y2 - 5y - 7619 What is the t'th term of 382888, 382963, 383088, 383269, 383512? t*3 + 19t*2 + 11t + 382857 What is the b'th term of -171, -898, -2399, -4914, -8683, -13946? -40b3 - 147b*2 - 6b + 22 What is the r'th term of 17769, 33932, 50095, 66258, 82421? 16163r + 1606 What is the k'th term of 2064, 8047, 18014, 31965? 1992k*2 + 7k + 65 What is the l'th term of 265359, 265359, 265365, 265377, 265395, 265419? 3l2 - 9l + 265365 What is the b'th term of 1512, 8332, 19698, 35610, 56068, 81072? 2273b2 + b - 762 What is the v'th term of 583102, 1166097, 1749102, 2332123, 2915166, 3498237, 4081342, 4664487? v3 - v2 + 582991v + 111 What is the v'th term of -88622, -354718, -798258, -1419236, -2217646? v*3 - 88728v*2 + 81v + 24 What is the t'th term of 436, 775, 918, 763, 208? -17t3 + 4t*2 + 446t + 3 What is the t'th term of 28550678, 57101665, 85652664, 114203681, 142754722, 171305793, 199856900, 228408049? t*3 + 28550980t - 303 What is the f'th term of 934, 3176, 6630, 11296, 17174, 24264? 606f2 + 424f - 96 What is the n'th term of -100477571, -100477573, -100477575? -2n - 100477569 What is the v'th term of -1727, -2331, -1745, 31, 2997? 595v*2 - 2389v + 67 What is the k'th term of -333541, -1334111, -3001729, -5336395? -333524k2 + 2k - 19 What is the z'th term of -107126, -856978, -2892284, -6855770, -13390162, -23138186, -36742568? -107121z3 - z2 - 2z - 2 What is the h'th term of 441, 1669, 3561, 5991, 8833, 11961? -21h3 + 458h*2 + h + 3 What is the y'th term of -220952, -220855, -220692, -220463, -220168, -219807, -219380? 33y*2 - 2y - 220983 What is the l'th term of -1916202, -1916243, -1916304, -1916379, -1916462, -1916547, -1916628? l*3 - 16l*2 - 1916187 What is the j'th term of -7595931, -7595910, -7595889, -7595868, -7595847? 21j - 7595952 What is the t'th term of -273941, -547448, -820955, -1094462? -273507t - 434 What is the f'th term of 99498, 99316, 99134, 98952, 98770? -182f + 99680 What is the j'th term of -33987, -33954, -33889, -33786, -33639, -33442, -33189, -32874? j*3 + 10j*2 - 4j - 33994 What is the s'th term of 533610, 533670, 533730, 533790, 533850, 533910? 60s + 533550 What is the z'th term of -715517, -715533, -715549, -715565, -715581? -16z - 715501 What is the v'th term of -1282, -1571, -1860, -2149, -2438, -2727? -289v - 993 What is the w'th term of -12925833, -12925835, -12925837, -12925839? -2w - 12925831 What is the k'th term of 68, 35, 258, 965, 2384, 4743? 38k3 - 100k*2 + k + 129 What is the b'th term of -436630, -436075, -435152, -433861? 184b*2 + 3b - 436817 What is the f'th term of 119016056, 119016059, 119016062, 119016065, 119016068, 119016071? 3f + 119016053 What is the u'th term of -3207, -4240, -895, 9018, 27689? 365u3 - u2 - 3585u + 14 What is the m'th term of -138162359, -138162363, -138162369, -138162377, -138162387, -138162399, -138162413? -m2 - m - 138162357 What is the s'th term of -96412, -386903, -871064, -1548901, -2420420, -3485627? -s3 - 96829s*2 + 3s + 415 What is the l'th term of 3206752, 12827015, 28860788, 51308071, 80168864, 115443167, 157130980? 3206755l2 - 2l - 1 What is the h'th term of -56, -137, -344, -695, -1208, -1901, -2792? -3h3 - 45h*2 + 75h - 83 What is the o'th term of 7698063, 15396045, 23094027? 7697982o + 81 What is the v'th term of -910324, -3641275, -8192860, -14565079, -22757932, -32771419, -44605540? -910317v*2 - 7 What is the n'th term of 4593530, 18374114, 41341756, 73496456, 114838214, 165367030, 225082904? 4593529n*2 - 3n + 4 What is the q'th term of -40889, -81271, -121653, -162035? -40382q - 507 What is the s'th term of -1951069, -1950050, -1949029, -1948006, -1946981? s2 + 1016s - 1952086 What is the f'th term of -961, -7845, -26491, -62779, -122589? -980f3 - f2 - 21f + 41 What is the l'th term of -74817525, -149635051, -224452577, -299270103, -374087629? -74817526l + 1 What is the r'th term of 240972, 1927146, 6503890, 15416484, 30110208, 52030342, 82622166, 123330960? 240880r*3 + 5r**2 - r + 88 What is the u'th term of 1026657	{ "pile_set_name": "DM Mathematics" }
the same value? False Let x(f) = -2f + 16. Let u be x(9). Let n be ((-5)/5)/(u + 3). Do n and 0.02 have the same value? False Let o = -361 - -368.4. Which is smaller: o or -2/5? -2/5 Suppose -12 = 2j - 2y, 0 = -5j - 0y + 2y - 18. Let x be (j/(-4))/(4/(-16)). Let n(h) = h + 1. Let l be n(x). Which is greater: 6/13 or l? 6/13 Suppose 2q - 8 = -w, -2w + 6 = 5q - 3w. Suppose 0 = 2k, -qj + 4k = 11 + 13. Let g be (-2 - -3) + 8/j. Which is bigger: g or 5? 5 Let k = -1097 + 1007. Which is greater: k or -88? -88 Suppose -3h = 2x - 14, h - 2 = -2x + 4x. Is 2/1079 != x? True Let h = 3.0016 - 0.0016. Is -51 >= h? False Let i = 1645 - 1637. Are 9/5 and i equal? False Let j = -1093475/247 + 4427. Let m = -1/13 - j. Suppose 0 = -3n + 10v - 5v - 12, v = 3n. Is m greater than n? False Let f(d) = d3 - 8d*2 + 5d. Let c be f(3). Let y = c + 23. Is y smaller than -8? False Let w be 6968/234 + 2/9. Suppose -62 = 2f - 4f. Which is greater: f or w? f Let s be (-360)/529212/(-10). Is s > 0? True Let t(x) = 16 + x - x2 - x2 - 19 + x3. Let j be t(2). Which is greater: j or -15/8? j Let m be 22/(-7) + 1 + 1. Suppose -4a = -a. Suppose -3d = -ad. Which is smaller: d or m? m Let c = -229 + 231. Let q = -21 + 32. Is c greater than q? False Let w(h) = -h*3 + 59h*2 - 116h + 117. Let l be w(57). Is l bigger than 20? False Let p(j) = j*2 + j - 3. Let n be p(-3). Suppose -3r = -ns - 4r - 2, -2s + r = 8. Let w = -0.05 + 0.25. Is w at least s? True Let v = 5 + -3.9. Let p = 1.3 - v. Let b = -0.08 + 4.08. Is b > p? True Let z(k) = -k - 18. Let y be z(0). Let g be (-623)/63 + 2/y. Let p(u) = u3 + 11u*2 + 11u + 8. Let x be p(g). Is x equal to -2? True Let f be ((-38745)/1430)/(-9) - (-6)/(-2). Which is smaller: -1 or f? -1 Let b = 1240 - 8655/7. Suppose -4 = -2s, -2r + 3r = -3s + 3. Let a = b + r. Is a bigger than -1/3? True Let d = -1582.8 + 1583. Let m = -2 - -1.97. Let i = -0.37 + m. Which is smaller: i or d? i Let d = -1.1 + 0.1. Let t = -118 + 114. Is d at least as big as t? True Let m = 10 + -14. Let n = -77 + 68. Let s(v) = -v - 11. Let b be s(n). Which is smaller: m or b? m Let i be ((-4)/(-10))/((-1)/10). Let n be ((-16)/(-20))/(i/(-30)). Let z = n + -11. Is z at most as big as -3? True Let u = 7 + 5. Let f be 1(u - -3)-1. Let b be 26/(-10) - (-6)/f. Are -2 and b nonequal? True Suppose 5i = 4q + 9, 6q = 5i + q - 10. Suppose l - 195 = 4l. Let g be 3/(1 - l)-4. Which is greater: g or i? i Suppose 2m + 5o + 31 = 0, -m + 4m - 1 = 2o. Is -40/11 less than m? True Let z(n) = -2n + 27. Let c be z(11). Which is bigger: c or -33? c Suppose 0 = -44t + 46t + 5b - 17, 15 = 5b. Is -10/73 at most t? True Suppose -3v = 7 - 1. Let i(z) = -z*3 - 11z*2 - 9z + 5. Suppose a - 25 = 2b, -5b + 12 = 5a + 37. Let f be i(b). Is v less than f? False Let p = -10989/70 - -157. Which is bigger: 0 or p? p Suppose -8o + 95 + 145 = 0. Let m be (-9)/(-2) + o/20. Is 14 at least as big as m? True Let u = 16927/39 + -434. Let p(x) = x*3 + 18x*2 + 46x + 14. Let a be p(-15). Which is smaller: a or u? a Let b = 286 + -146. Let f = 140 - b. Which is greater: -2/25 or f? f Let y = -85 + 147. Let l = y - 41. Are l and 21 unequal? False Let x be (6 - (-392)/(-70))/(4/(-10)). Is -26/37 <= x? False Suppose -5 = 5u - 15. Suppose uc = 3c + 2. Let l = -984/5 + 196. Is l at least as big as c? True Let o = 22 + -20. Let k(f) = -f2 - f. Let h(d) = -13d*2 + d + 2. Let z(l) = ok(l) + h(l). Let q be z(1). Which is greater: q or -13? -13 Let j(u) = -22u - 13. Let o be j(7). Let p = 1839/11 + o. Are 1 and p non-equal? True Let b = -18 - -19. Let v be (-11)/(-55)(b + 4). Let m be v - (-1 + 10/4). Is -2 less than m? True Let p = 3/53 - -147/212. Which is greater: 2 or p? 2 Let l be ((-26)/(-12) - (-12)/(-72))-2. Let r be l + 10/42. Which is bigger: r or -2/75? r Let w(r) = 2r + 11. Let n = 6 + -12. Let x be w(n). Let o = 8 - 11. Which is greater: x or o? x Let p = -3078 - -674080/219. Which is smaller: p or 0? p Let a be (8/(-50))/(38/(-95)). Which is bigger: a or 5.5? 5.5 Let r = -45 - -41. Let k = r + 3.9. Is k > -2/51? False Let l = -556 + 551.696. Let r = l - 0.726. Let a = r - -0.03. Is a at least as big as -1? False Let i(w) = w - 9. Let a be i(-7). Let n = a - -18. Suppose ny - y - 17 = 0. Which is smaller: y or 18? y Suppose -13 = -5c - 8. Let x be -16 - c/(-2)0. Are x and -33/2 equal? False Let j = -5.652 - -0.052. Let v = 5.3 + j. Is -0.2 at most as big as v? False Let l(q) be the first derivative of q*4/2 - 4q*3/3 + 2q*2 + 3q - 15. Let a be l(4). Is a greater than 82? True Let b be 3-2(-4)/12. Let u be b/7 - (-8)/(-28). Which is bigger: -3/68 or u? u Suppose -99s + 247s = -10952. Suppose 4v = v - 225. Which is smaller: s or v? v Suppose 3b - 3 = 3. Let s = 2.9 - 2.69. Let p = s - 0.21. Which is smaller: b or p? p Suppose -2g + 20 = -4l + 2g, 4l + 4g - 20 = 0. Let p(v) = v3 + 8v*2 + 9v + 10. Let h be p(-7). Let i be 100/72 + h/18. Is l equal to i? False Let b = 0.7 - 0.3. Let m = -0.7 + b. Let f = 1450.01 - 1450. Is m bigger than f? False Let z be 24((-9)/(-36) + -1). Which is greater: -200/31 or z? z Let t = -3.1 - -3. Let g be (-2)/10 - (1 - 17592/(-65)). Let p = g + 272. Which is smaller: t or p? t Let n = 76 + -77.64. Let p = n + -0.36. Which is smaller: p or 1? p Let l be -16 - ((-4)/4 - -4). Which is smaller: l or -26? -26 Let v(w) = w*3 - 6w*2 + 7w - 11. Let d be v(5). Which is smaller: 1/77 or d? d Let k(t) = 2t3 - 29t*2 - 23t + 12. Let d be k(15). Let a = d - -113. Which is bigger: a or 2? a Let r = 0.05 - 7.05. Does -27 = r? False Let w(x) = 12x - 604. Let p be w(51). Which is greater: p or -0.3? p Let c = 2 - 1. Let j be (-132)/363(-2)/(-16). Is j at most as big as c? True Suppose 4j - 3r - 29 = 2r, -3j + 2r + 13 = 0. Let a = 41 - 37. Let c be ((-9)/132)/(1(-6)/a). Which is greater: c or j? j Let y = -62 + 68. Suppose -3d - 6 = 3. Let g be (-18)/84 - d/y. Is g less than or equal to 2/11? False Suppose 0 = 5f - 3f + 26. Let p(g) = g2 - 3g - 12. Let j be p(0). Which is greater: f or j? j Let b = -4755 + 4754.93. Let w(c) = c*2 - 3c + 4. Let n be w(3). Which is greater: b or n? n Let a be (-4)/2 + 47 + 0. Suppose i + a = -4i. Is -9 >= i? True Let g = 1 + 5. Let b be (-6)/15 + 395/(-75). Let v = g + b. Which is smaller: 4/7 or v? v Let a = -87 - -87. Let u be a - -1 - (-2 + -1). Suppose 0f = 3f - 18. Which is smaller: f or u? u Let q(r) = r - 5. Let v be q(-7). Let t(m) = -m - 8. Let z be t(v). Let n be -3 + z + 33/15. Which is bigger: n or 4? 4 Suppose -16m + 19m + 93 = 0. Let w = m + 19. Let y = w + 12. Is -2/57 < y? True Let z be 13/(-6) - (3 + 18)/(-7). Is 2 bigger than z? True Let f = -839/3 - -279. Let t = -0.41 - -1.03. Do t and f have the same value? False Suppose 0 = 8w + 12 + 4. Let k be (w/63)/((-2)/484). Is -0.1 < k? True Let y be (1/(-3))/(12/(-504)). Let j = -12 - y. Is -23 at least j? True Let s = 313 - 317. Which is smaller: 36 or s? s Let f = -1.142 + 0.142. Is f <= 472? True Let x(s) = -3s*3 - 44s*2 + 20s - 30. Let r be x(-15). Is -105 equal to r? True Let q = 32605/38 + -858. Is q bigger than 1? False Let q = 14 - 14. Suppose -8f + 5y + 28 = -5f, q = f - 5y - 6. Is f at least 13? False Let x be (-1 - 0)/((-1)/(-19)). Let n be 14/28 - (-54)/4. Let c = n + x. Which is bigger: -4 or c? -4 Suppose 9o - 5o = 24. Let t be (o - 2)(-8 - 0). Is -32 at most as big as t? True Let r = -0.309 + 0.339. Which is smaller: r or -3/2? -3/2 Let g(f) = -8f + 282. Let n be g(39). Is -26 greater than n? True Let p = 8/47 + 476/517. Suppose 4r - 4 = -3o + 15, r = 4o. Is o bigger than p? False Let d = -13/834 + 9401/549606. Is d not equal to 1? True Suppose 5d = -7 - 3. Let p be 315/(-84) - 8/d. Which is bigger: p or -0.01? p Suppose -2g = s + 199, 4g + 4s + 396 = -0g. Are -100 and g unequal? False Suppose -3l + l = a + 6491, 5l + 2a = -16229. Let r = l + 246767/76. Let k = r + -13/19. Do 1/2 and k have different values? True Suppose -5f = f + 18. Let v(w) = w + 2. Let y be v(f). Let i = -272/15 - -52/3. Do y and i have the same value? False Let v = -1 + -26. Let x = v - -28. Are -2/9 and x nonequal? True Suppose 1 + 0 = -t. Let h be (-2	{ "pile_set_name": "DM Mathematics" }
in y, h, 0.4? h Let k = 9/4 + -2. Suppose 666b = 655b + 44. Let x = 0.5 - 0.3. What is the closest to b in x, 1/2, k? 1/2 Let s = 19627 - 19624. What is the closest to 2/7 in s, -43/2, -1/2? -1/2 Let n be (-138)/((15/20)/(9/(-40))). Let v = n + -41. Let m = 7 - 6. What is the nearest to 0 in v, m, 0.3? 0.3 Let y = -4 + 2. Let z = 752/1865 - 6/1865. What is the closest to 0 in z, y, -0.05? -0.05 Suppose 226 = 13n + 148. What is the closest to -6.3 in n, -2/3, -5, 1/8? -5 Let j = -659 - -662. Which is the closest to -1? (a) j (b) -4 (c) -0.5 (d) 1/74 c Let h = -16.8 - -17. Which is the closest to -2/7? (a) -4 (b) -2/5 (c) 0.1 (d) h b Let x be 6/(-9) + 8/3. Let p be x15/72 + 39/(-52). Let w = -11 - -7. Which is the nearest to p? (a) 0.1 (b) w (c) -0.4 c Let f = -47 - -143/3. Let o = 89751/2 + -362389/8. Let w = o + 423. What is the closest to 1 in f, w, -2/7? f Let l = -8010 - -24031/3. Which is the closest to -1/4? (a) l (b) 8/5 (c) -4 (d) 4 a Let v = -2011 + 2019. Let l = -50 + 352/7. What is the closest to v in 5, l, -0.5? 5 Let g be (-569343)/(-1988462) + (-1 - 10/(-14)). Let w = g + -6573/8210. Which is the closest to 2? (a) -1 (b) w (c) -4 b Let r = 212 + -208. Suppose -rv + 38 = -42v. Let n = -5 + 10. What is the closest to v in -1/5, n, 0.3? -1/5 Let p = 1589 - 1589. Which is the closest to 1? (a) p (b) 72 (c) 3/7 (d) -2 c Let d = -4 + 3.8. Let y be 0 + 3 - 588/168. Let s = -0.2 + 0.7. What is the closest to y in s, 6, d? d Let q = 54 - 61. Let z = q - -46/7. Let h = -18.4 + 18.7. Which is the closest to -2? (a) h (b) z (c) -2/5 b Let n = -42.1 - -42. Let k = -349 + 349. Let t = -50/7 + 7. Which is the nearest to 3? (a) k (b) n (c) t a Let g = 191/204 - -27/68. What is the closest to 0.2 in g, -1/29, -4, 0.4? 0.4 Let a = -4247 - -4248. What is the closest to -0.1 in -3, -0.035, a? -0.035 Let v be (-238)/28 - (-55)/10. What is the closest to 0 in v, -2/7, 0.2, -2/51? -2/51 Let u be (-36)/520-14 + (-1)/1. Let r = -3.91 + -0.09. Let h = -7 - r. Which is the nearest to u? (a) h (b) -1/3 (c) 0.1 c Let q = -2 - -3. Let a = 69.9 + -70.154. Let u = 0.554 + a. What is the nearest to q in u, 4/5, 3? 4/5 Let q = -10407 - -2154254/207. Let m = q + -1/9. What is the closest to -1 in m, 2/5, -5? m Let m be 3/27 + (-1992)/(-2160) + (-5)/6. What is the closest to 0.1 in m, -0.3, -0.062, -2/11? m Suppose d - 264 - 19 = 0. Let p = 1985/7 - d. What is the closest to -1 in 0, 0.02, p? 0 Let o = -6 + 5. Let b be 1022/49 - 12/14. Let f be (7/70)/(12/b). What is the closest to o in -1/3, -2, f? -1/3 Let o = -55501 + 55495. Let k = -5 - -9. What is the closest to 1 in o, k, -0.4? -0.4 Suppose -3d = v + 114, -19v - 219 = 6d - 14v. Which is the closest to 0.2? (a) -0.5 (b) d (c) -4 a Let h = 707 - 695. Suppose q - 2z - 3 - 1 = 0, h = -3z. Let d = 5/16 - -3/16. Which is the nearest to d? (a) 0.1 (b) q (c) 11 a Let z = -102760/17 + 6044. What is the nearest to 0 in z, -3/2, 1/33? 1/33 Let j = 0.10974 - 77.10974. Which is the nearest to 2? (a) 5 (b) j (c) 1/3 (d) -0.06 c Let c be 40/(-28)((-153)/68 + 4). Suppose -2v + 2 = 4. What is the nearest to 1 in 1, c, 1/5, v? 1 Suppose 431z = 405z - 78. What is the closest to z in -2/15, 1, 2, -3/4? -3/4 Let s be 0 + 1 + 1 - (7 + -13 - -5). Which is the closest to 2? (a) -2 (b) s (c) -4 (d) -271/2 b Let x be (-27)/(-21) - (-1855)/(-2205). What is the closest to 9 in -26, x, 4, 6? 6 Let r = -0.09 + -0.41. Suppose 0 = 2y - 4b + 4 + 10, 2y = -5b + 31. What is the nearest to -0.1 in y, r, -3/19? -3/19 Let a = 589.31 - 586.31. Suppose -4t = 4w - 4, 4t - 11 = 3w - 0w. Let l be w/5 - 54/(-170). What is the nearest to -5 in -3, a, l? -3 Let m be 45/42 + (-20)/35. Suppose 0 = -336x + 339x + 6. What is the nearest to m in -0.5, 0.1, x? 0.1 Let a be ((-3)/21)/(27/54). Let m be ((-2)/5)/(32/(-20)). What is the closest to m in a, -3, 3? a Let g(r) = -183r - 2657. Let o be g(-15). Which is the nearest to o? (a) -2/7 (b) -0.4 (c) 0.3 c Let o = 11265 + -11263. Which is the nearest to o? (a) 5 (b) -3 (c) -128 (d) 1 d Let j = 102 + -100. Suppose jp - 4 = 8. Let n be (-15)/(-27) + p/(-27). Which is the closest to n? (a) -2/21 (b) 4 (c) -1/4 a Let a = -3194.4 + 3194. What is the nearest to -0.2 in 1, 0.2, -7, a? a Let u = 1237/4964 + 1/1241. Suppose 84 = 46p - 25p. What is the closest to -1 in u, p, -2, -1/18? -1/18 Let v = 1.12 + 0.03. Let s = -0.45 + v. Let h be 392/520 + (-6)/39. Which is the closest to s? (a) h (b) -1 (c) 1 a Let p = 193/4 + -48. Let t = -1.8515 - -5.8515. Which is the nearest to 2/5? (a) p (b) 3/2 (c) t a Let h be 2/69/(-12). Let l = 765.0728 + -0.6728. Let y = l + -764. What is the nearest to -2 in h, -3, y? -3 Let m = 22282/3 - 7428. Which is the closest to 1? (a) 5 (b) m (c) -5/2 (d) -1/3 d Let n = -424.864 + -8.436. Let r = 489 + n. Let k = r + -56. Which is the closest to k? (a) 5 (b) -0.2 (c) 2/17 b Suppose 0 = -5s - 970 + 980. Let j = 0 + -6. Let i be 3j/(-99)-1. Which is the nearest to 1/4? (a) s (b) 1 (c) i c Let s = -4769/9550 + -3/4775. Let o = -25.6 - -26. What is the nearest to 1 in 1/2, s, o? 1/2 Let n = -0.21 - 0.09. Let t = -141 + 142. Which is the closest to 6? (a) n (b) t (c) -5 b Let n(x) = -14x - 29. Let z be n(-2). Let c be z + 0 - 3/(-9)2. What is the closest to c in 0.3, 0.5, 1.1, -4? 0.3 Let d = 2.09 + -0.09. Let k = 19786 + -19786. What is the nearest to d in 1/7, k, -5, 3/7? 3/7 Let u = 3545.2 - 4225. Let f = u + 680. Let p be -3 + (-4)/(0 - 2). What is the closest to f in 0.1, p, 1/4? 1/4 Let q = 0.013887 - 0.113887. Let j = -19 - -17.2. What is the nearest to q in 0.3, 1/3, j? 0.3 Let g(n) = n*3 - 9n*2 - 3n + 15. Let c be g(9). What is the closest to 3 in 5/2, 0.5, c, 0.1? 5/2 Let t = -0.068 + -16.432. Let q = t + 16.5. Suppose -18 = o - d + 5d, d + 7 = o. What is the nearest to q in -4, 0.5, o? 0.5 Let o = -0.2 + -0.3. Let f be 12/(-588)27. Which is the nearest to f? (a) o (b) 1 (c) -2 a Let k = -213 + 206. Let o = -0.153 - -3.153. What is the closest to 0.1 in o, 0.1, k? 0.1 Let y = -78.3 + 78. Let z = -55.9 - -56. Let p = -0.3 - -0.5. Which is the closest to p? (a) y (b) -1 (c) z c Let g = -9908.9 + 9909. Which is the nearest to g? (a) -1/12 (b) -1.4 (c) 0.5 a Let c(r) = 3r - 10. Let b be c(4). Suppose 2o + 3p = -bo - 71, o - 5p - 11 = 0. Let l = -12 - o. What is the closest to -0.3 in 1, 1/3, l? 1/3 Suppose 0 = -14n + 10n - 16. Let h be (11 - 13)/(n/10). Let p = -6/5 - -32/35. Which is the nearest to -0.1? (a) h (b) p (c) 0 c Let i = -3512.9 + 3790. Let x = i - 319. Let s = x + 42. Which is the closest to s? (a) -0.5 (b) 1/5 (c) -1 b Let k = 2631/13150 + -1/13150. Which is the nearest to 0.3? (a) -0.05 (b) 0 (c) 1/17 (d) k d Let w(j) = j*3 - 8j*2 + 21j - 25. Let d be w(5). Let p be (3 - -3) + -6 - 2/(-4). Which is the nearest to -3? (a) p (b) d (c) -2/5 c Let i = -98650 - -590353/6. Let n = i - -258. Which is the closest to 0.05? (a) 1 (b) 0.05 (c) n b Let x = -0.579 + 0.079. Let w = -38.5 - -40.5. What is the closest to w in 1/10, x, -5? 1/10 Let f = -9 + 12. Suppose 21m - 17 = -13m + 51. What is the closest to m in 0, f, 3/10? f Let p = 4974 + -4991. What is the nearest to 0.2 in p, -4, -0.2, 1? -0.2 Let t = 0.2 + -0.4. Let h = -20 + 61/3. Let z = -245267 + 245266.7. Which is the nearest to h? (a) z (b) -14 (c) t c Suppose -4p = 8p + 144. Let m be 3 - (-4 + 129/18). What is the closest to p in -0.5, m, -2/5? -0.5 Let k = -15706.21 - -15706. What is the nearest to 0 in -3, k, -1? k Let s be 7 + 2/(-4)4. Suppose o - s = -0. Let c be -3(2(-4)/(-8))/(-1). What is the nearest to -1 in -1/2, c, o? -1/2 Let x = -9.89 + 9.39. What is the closest to -2 in 31, -0.22, x? x Let v = -0.03561 + -0.27129. Let r = v + 0.0069. What is the nearest to -1 in 1, -5, r, 0? r Let g(r) = -2r*2 - 27r + 8. Let s be g(-14). Let l be -7 - (-15 - s) - 5/3. What is the closest to 1/4 in -0.3, 0, l? l Let v = -0.0471 + 41.0471. Let r = -62 + v. What is the nearest to r in 4, 5, -2/5? -2/5 Let k = -260.793 - -261. Let y = -0.093 - k. Let g = -0.5 + 0.9. What is the closest to -1/3 in g, y, -2/5? y Let r(x) = x3 + x2 - 4*x - 4. Let l be r(2). Let k =	{ "pile_set_name": "DM Mathematics" }
on multiple of 394800 and 3760? 394800 What is the smallest common multiple of 261 and 149901? 449703 Calculate the common denominator of 19/2672 and -65/34402. 275216 Calculate the common denominator of 56/38621 and -31/688156. 7569716 What is the smallest common multiple of 1076 and 47075? 188300 What is the least common multiple of 400380 and 40038? 400380 Calculate the smallest common multiple of 572000 and 22880. 572000 What is the common denominator of 149/3696 and 61/105? 18480 Calculate the lowest common multiple of 7533 and 9207. 82863 Find the common denominator of 93/4360 and 101/320. 34880 Calculate the lowest common multiple of 1152 and 707088. 16970112 What is the smallest common multiple of 5130 and 585? 66690 What is the smallest common multiple of 10168 and 1312? 40672 Calculate the common denominator of 185/2184 and 58/273. 2184 What is the common denominator of -13/5467 and -67/265540? 1858780 What is the smallest common multiple of 31955 and 38346? 191730 Find the common denominator of -33/303478 and -103/303478. 303478 What is the least common multiple of 560 and 9730? 77840 Calculate the common denominator of 149/15210 and -16/9. 15210 What is the common denominator of -5/5768 and -25/20248? 14598808 Calculate the lowest common multiple of 1033494 and 22. 1033494 Calculate the lowest common multiple of 35 and 1201130. 1201130 Find the common denominator of -17/16510 and -87/910. 115570 Calculate the common denominator of 12/964915 and -15/304. 15438640 What is the lowest common multiple of 2158 and 10790? 10790 Calculate the least common multiple of 1325 and 6095. 30475 Calculate the common denominator of -17/130400 and 179/120. 391200 Calculate the smallest common multiple of 62 and 8452. 262012 Calculate the smallest common multiple of 112 and 18368. 18368 What is the common denominator of 119/69192 and -83/16? 138384 What is the smallest common multiple of 735 and 1851? 453495 What is the common denominator of -113/666 and 15/158? 52614 What is the least common multiple of 36860 and 760? 73720 What is the smallest common multiple of 6832 and 75152? 75152 Calculate the common denominator of 55/45752 and 33/45752. 45752 Find the common denominator of 21/5227 and 51/41816. 41816 Calculate the common denominator of 8/4681761 and -1/30. 46817610 What is the smallest common multiple of 25916 and 2356? 25916 Find the common denominator of 26/7097 and 41/1128. 170328 Calculate the common denominator of -99/20 and 33/452326. 4523260 Calculate the least common multiple of 8 and 152337. 1218696 Find the common denominator of -95/164 and 103/35328. 1448448 What is the common denominator of -149/65562 and -11/21? 65562 Find the common denominator of 53/132164 and 5/423. 1189476 Calculate the lowest common multiple of 1536 and 16. 1536 What is the common denominator of 53/9 and -47/12342? 37026 What is the lowest common multiple of 504 and 828? 11592 Calculate the smallest common multiple of 1103760 and 7154. 7726320 Calculate the common denominator of -64/105 and 52/14511. 72555 Find the common denominator of 10/35061 and 74/285. 3330795 What is the lowest common multiple of 47707 and 481407? 5295477 Calculate the smallest common multiple of 4478 and 90. 201510 What is the lowest common multiple of 552 and 138? 552 Find the common denominator of -37/100485 and -83/168. 803880 Find the common denominator of 101/700 and -1/395. 55300 What is the lowest common multiple of 477546 and 494? 6208098 What is the smallest common multiple of 1 and 84544? 84544 Calculate the common denominator of -49/8 and -91/639684. 1279368 Calculate the common denominator of -137/7104 and -17/613312. 1839936 Calculate the common denominator of -38/255 and -89/6120. 6120 Calculate the common denominator of 131/17808 and 85/28938. 231504 What is the common denominator of -75/179648 and -43/24? 538944 What is the smallest common multiple of 25771 and 5? 128855 What is the common denominator of -97/864 and 67/68688? 137376 What is the common denominator of -38/69 and 76/30345? 697935 Find the common denominator of 139/72 and 17/36984. 110952 Calculate the common denominator of -55/6723 and -25/162. 13446 Calculate the lowest common multiple of 123648 and 1664. 1607424 Find the common denominator of 62/5 and -23/18826. 94130 Find the common denominator of 19/307940 and -38/519. 923820 Find the common denominator of 67/21 and -97/132525. 927675 Calculate the smallest common multiple of 12852 and 3556. 1632204 What is the common denominator of 11/100035 and -37/2679? 4701645 Calculate the smallest common multiple of 6 and 249238. 747714 Calculate the lowest common multiple of 84840 and 700. 424200 What is the common denominator of -7/276552 and 29/46? 276552 Calculate the smallest common multiple of 15 and 8545. 25635 What is the lowest common multiple of 34440 and 960? 275520 What is the lowest common multiple of 213 and 28045? 84135 What is the common denominator of 56/261 and -113/612? 17748 What is the smallest common multiple of 1424 and 224? 19936 What is the common denominator of -1 and -89/2930400? 2930400 What is the least common multiple of 4675 and 7225? 79475 Find the common denominator of -83/162 and -52/441. 7938 Calculate the smallest common multiple of 3528 and 396. 38808 Calculate the smallest common multiple of 272 and 147084. 588336 What is the common denominator of 119/7510 and 3/141188? 705940 What is the common denominator of -107/3114 and -73/306? 52938 Find the common denominator of -23/2069 and -61/135. 279315 Calculate the lowest common multiple of 229330 and 76. 458660 What is the least common multiple of 52152 and 24? 52152 Calculate the smallest common multiple of 11583 and 2249. 2003859 What is the lowest common multiple of 594 and 92070? 92070 Calculate the common denominator of 133/2040 and -91/436560. 436560 Calculate the smallest common multiple of 80 and 255. 4080 Find the common denominator of -133/5940 and 133/18. 5940 What is the smallest common multiple of 9592 and 654? 28776 What is the smallest common multiple of 792 and 627? 15048 Calculate the common denominator of -59/13409 and 27/1771. 93863 Calculate the common denominator of -41/6795 and -47/20385. 20385 Calculate the lowest common multiple of 51595 and 22780. 13827460 Calculate the common denominator of -43/45736 and 25/48. 274416 Find the common denominator of -23/4 and 69/7420. 7420 Calculate the least common multiple of 410 and 1164. 238620 Calculate the common denominator of 80/21 and 79/1617. 1617 What is the common denominator of -67/72074 and 50/396407? 792814 What is the lowest common multiple of 38912 and 109440? 1751040 Find the common denominator of 89/353912 and -7/52. 353912 Calculate the least common multiple of 58520 and 1848. 175560 What is the smallest common multiple of 31820 and 22? 350020 Find the common denominator of 39/2125 and -41/111775. 558875 What is the smallest common multiple of 10481 and 235? 52405 Find the common denominator of -81/362 and 131/5082. 919842 What is the lowest common multiple of 54516 and 2772? 163548 Calculate the common denominator of 97/30 and 11/520. 1560 What is the smallest common multiple of 582214 and 16? 4657712 Calculate the smallest common multiple of 5769 and 2564. 23076 Calculate the common denominator of -71/15264 and -77/63600. 381600 Calculate the smallest common multiple of 22 and 6. 66 What is the common denominator of 99/1088 and 55/1632? 3264 Calculate the least common multiple of 22 and 232. 2552 Calculate the common denominator of 7/72 and -81/9136. 82224 Calculate the smallest common multiple of 5376 and 48384. 48384 Calculate the lowest common multiple of 10392 and 2598. 10392 Calculate the common denominator of 101/8100 and 143/666. 299700 Calculate the lowest common multiple of 27795 and 510. 55590 What is the common denominator of 71/6095454 and 13/10? 30477270 What is the common denominator of -151/106092 and 31/7578? 106092 What is the common denominator of -149/11730 and 71/1104? 93840 Calculate the smallest common multiple of 10 and 891024. 4455120 Calculate the least common multiple of 16896 and 128. 16896 Calculate the least common multiple of 34740 and 80. 138960 What is the lowest	{ "pile_set_name": "DM Mathematics" }
iply 72 and -3. -216 -11-77 847 Calculate -0.3-15. 4.5 0.05793 times 4 0.23172 -338 * 0.1 -33.8 -5-61 305 -5057 times 1 -5057 Calculate 25-113. -2825 Calculate -13517. -6721 0.6720.35 0.2352 What is 4 times 37? 148 0.052 * 19.4 1.0088 -0.526 -13 Calculate 487. 348 What is 0.2175 times -0.2? -0.0435 Product of -4 and 0.048. -0.192 -163 * -0.08 13.04 8 * -0.81 -6.48 2.9 times 659 1911.1 -2 * 112 -224 -0.025590.2 -0.005118 Work out 0.87 0.08. 0.0696 -2 * -98 196 Product of -181 and 5. -905 6 times 10 60 What is -0.3 times -2.628? 0.7884 Product of -13 and -13. 169 Work out -0.071 * 3. -0.213 Calculate -0.05-0.2. 0.01 Multiply -6 and 35. -210 -0.1 6.78 -0.678 What is the product of -226 and -25? 5650 -0.1118 -11.8 Product of -9 and 94. -846 Product of -304 and -0.2. 60.8 What is the product of 2 and -359? -718 Calculate -1116. -116 Calculate 0.08346. 0.5004 -0.071 -1 0.071 What is the product of -58.4 and 2? -116.8 6936 times 0.5 3468 What is -2 times -460? 920 What is 0.04 times 0.071? 0.00284 Work out 2 * 95. 190 -4 * -4633 18532 Work out -0.5 * -0.67. 0.335 -0.4 * 388 -155.2 What is 0.16 times -547? -87.52 Product of -0.9 and -0.4. 0.36 0.067 times -268 -17.956 0.3 * -142.7 -42.81 Work out -440 * -0.05. 22 16.09 times 3 48.27 Product of -0.4 and 63. -25.2 -0.80.7 -0.56 3.2 times -1.4 -4.48 What is -853 times 3? -2559 What is 0.07 times -0.253? -0.01771 Calculate 0.1330. 33 What is the product of 701 and 0.1? 70.1 Product of 0.5 and 339. 169.5 Product of -572 and 0.5. -286 What is -0.6 times -105? 63 What is -0.3 times -2.9? 0.87 Multiply -0.3 and -25. 7.5 -0.02-0.2514 0.005028 0.5 2668 1334 Multiply 13 and -3. -39 Calculate -13.33. -39.9 -1.31.58 -2.054 Work out 8 * 0.125. 1 -9445 * 5 -47225 -0.1 times 1493 -149.3 Calculate 0.073493. 0.22047 Multiply 0.3 and -144. -43.2 What is the product of -46 and 3? -138 -0.0492 -0.098 0.1530.1 0.0153 Product of -129 and 0.11. -14.19 Product of 0.05 and -212. -10.6 Multiply 0.2 and -483. -96.6 What is 16 times -2.21? -35.36 -791 -0.4 316.4 Multiply 188 and -0.3. -56.4 0.2-0.227 -0.0454 Calculate -0.32.8. -0.84 Product of -532 and 0.9. -478.8 What is -78.3 times 0.07? -5.481 Calculate 3-45. -135 -0.01 47 -0.47 What is the product of 3 and -260? -780 -0.2 * -46 9.2 -61-39 2379 Work out -450 -1. 450 Multiply -1904 and 0. 0 What is the product of 2.6 and -2? -5.2 -17.9 * 0 0 -15-0.0576 0.864 Product of -816 and -0.5. 408 Work out -155.82 0.3. -46.746 What is -0.392 times 6? -2.352 Multiply 0.41 and 0.8. 0.328 -0.41.921 -0.7684 -26 times -24 624 What is the product of -0.02 and 0.7? -0.014 Product of 10285 and 0.1. 1028.5 What is 3.1 times 0.4? 1.24 -0.720.1 -0.072 Calculate 8.4-0.062. -0.5208 Calculate -558-6. 3348 Multiply -3 and -73. 219 Product of -189.94 and -0.4. 75.976 Multiply -2 and -0.17. 0.34 What is the product of -1.57 and -1? 1.57 -0.0962 * 1 -0.0962 1.41-5 -7.05 0 243 0 0.1169 16.9 What is the product of -3781 and -0.2? 756.2 0.0225 times -4 -0.09 Calculate 17214. 6884 0.2 * 85 17 What is the product of -4 and -1.56? 6.24 Multiply 374 and 4. 1496 Calculate 4-257. -1028 What is the product of -0.0333 and 4? -0.1332 -244.3 -88.6 524 * -5 -2620 -0.01-0.08 0.0008 Work out 1.7 0.96. 1.632 -98 times 6 -588 2162 times 4 8648 What is -0.0432 times 5? -0.216 3 * -24.31 -72.93 Calculate 585235. 292615 What is -0.6 times -76? 45.6 Calculate -194. -94 Calculate 46.51. 26.04 Work out -0.4 -21. 8.4 Calculate 0.80.6. 0.48 0.1 85 8.5 Calculate -1598-0.4. 639.2 Calculate 6098. 5880 Work out 0.01307 * -0.5. -0.006535 8 times 0.09 0.72 What is the product of 57 and -12? -684 0.54 * -0.03 -0.0162 What is 8 times -13.2? -105.6 0.081 times -0.4 -0.0324 0.36-5 -1.8 Work out 30 2. 60 Calculate 0.40.79. 0.316 What is the product of 0 and -0.823? 0 What is -2 times 2.63? -5.26 Work out 0.5 -5133. -2566.5 What is 3156 times 0.4? 1262.4 -13762 * 0.2 -2752.4 Calculate 0-178. 0 Work out 1450 0.2. 290 Calculate 40.296. 1.184 Work out 22 -21.8. -479.6 -404 * 0.1 -40.4 -1.4-352 492.8 Calculate 0.033460.3. 0.010038 Work out -0.07 * 1. -0.07 What is -4 times 0.46? -1.84 What is -84 times -46? 3864 Product of 4 and -540. -2160 Calculate 20552. 4110 0.42-197 -82.74 What is the product of 3 and -27.12? -81.36 -737 times -5 3685 Calculate 1.0111-1. -1.0111 202.73 54.6 What is the product of 1 and 35? 35 -0.59 times 5 -2.95 2984 times 5 14920 0.1 * 393 39.3 -4-45 180 Multiply -0.022 and 55. -1.21 What is the product of -614 and -0.5? 307 Product of -10.7 and 2. -21.4 What is -2 times 1918? -3836 Work out 5149 -0.3. -1544.7 -0.1 times 973 -97.3 Calculate 0.4-0.0586. -0.02344 3 0.071 0.213 -617 * -4 2468 43157 12628 Work out -40 0.08. -3.2 What is the product of 0.5 and 688? 344 132 * -0.06 -7.92 -0.3-1.32 0.396 Product of 0.47 and -4. -1.88 Multiply 15920 and 0.1. 1592 -68.94 times -4 275.76 4.3 times 1 4.3 -216 times 0.03 -6.48 Calculate -22.230.1. -2.223 Calculate -1994. -796 Work out 763 2. 1526 0.0009 * -1 -0.0009 Calculate 399-0.4. -159.6 Product of 6720 and 3. 20160 5-169 -845 -1 * 3.1 -3.1 Multiply -1132 and -8. 9056 2-68 -136 Work out 0.1 294. 29.4 -118 * -3 354 -4.2 times 0.5 -2.1 Work out 0.0384 * -0.8. -0.03072 Product of 5 and -8.6. -43 What is -18 times 0.047? -0.846 Calculate 250.033. 0.825 What is 0.1841 times 4? 0.7364 Multiply 0.63 and -0.2. -0.126 -0.1483 times -0.2 0.02966 Product of -3.9 and 6. -23.4 Product of 0.0121 and -0.04. -0.000484 What is the product of -0.2 and -3.42? 0.684 Calculate 1430.2. 28.6 -49 times 0.3 -14.7 0.9 times -2.16 -1.944 Work out -3516 * 0.5. -1758 What is the product of 0.2 and 0.0771? 0.01542 Work out -6.6 * 109. -719.4 Product of 82 and -0.1. -8.2 0.4-7133 -2853.2 -15 times 462 -6930 What is 10.2 times 0.3? 3.06 Product of -112 and -0.3. 33.6 Product of -3 and -8. 24 Calculate 4564-4. -18256 Product of -0.085 and 45. -3.825 What is the product of 2 and 6.9? 13.8 Multiply 0.2 and -0.42. -0.084 Work out -1 * 74. -74 Multiply -10.2 and -0.1. 1.02 -412 times 20 -8240 Multiply -0.3 and 105. -31.5 Calculate 0.05131. 6.55 What is -9 times 44? -396 Product of -46 and 0.22. -10.12 Multiply -0.039 and -2.6. 0.1014 Product of 49.6 and 4.4. 218.24 -48.61 -48.6 Work out -8.1 * 1.8. -14.58 Multiply 1364 and 0.1. 136.4 18 times -21 -378 Calculate -14-0.07. 0.98 211 times 4 844 Calculate -0.528. -14 Calculate -4-16. 64 What is the product of 1.12 and 65? 72.8 -195.1 -0.3 58.53 What is the product of 3341 and 0.2? 668.2 Work out 5.98 * 4. 23.92 Calculate 1.9631. 60.76 Product of 0.194 and 0.5. 0.097 1-0.24 -0.24 -0.25 times -0.53 0.1325 -376 -222 Work out 0.5 0.4. 0.2 What is -0.0417 times 1.9? -0.07923 Product of 0.03 and -0.04. -0.0012 Product of 24.1 and -0.5. -12.05 Calculate 2.3-12. -27.6 Product of 0.0079 and -5. -0.0395 What is 83.6 times -5? -418 -0.0564 -0.224 0.3 times 6.253 1.8759 Multiply 8.5 and -2.9. -24.65 What is the product of 16.2 and -4.2? -68.04 What is the product of -13.1 and 3? -39.3 What is -3 times 4.5? -13.5 5 times -47 -235 2 * 0.06 0.12 Product of -78 and 19. -1482 Product of 0.12 and -24. -2.88 Product of -11.45 and 0.4. -4.58 Product of -19 and 0.212. -4.028 Product of -0.3 and 0.0434. -0.01302 Multiply -68 and -0.4. 27.2 5 * 16.8 84 -0.097 times -2 0.194 Work out -88.1 * 2. -176.2 Work out -0.79 * -22. 17.38 Product of 1084 and -0.5. -542 What is -1 times 1.37? -1.37 What is the product of 1 and -28? -28 What is -3.58 times -1? 3.58 -38 times 38 -1444 -11.79 * -19 224.01 Multiply 52 and -2.7. -140.4 Calculate -0.41574. -629.6 Product of -28988 and 0.3. -8696.4 What is the product of 31 and -22? -682 Calculate 251. 102 0.38-39.3 -14.934 Product of 1 and 0.38. 0.38 What is the product of 371 and -0.01? -3.71 Work out -33 -0.1. 3.3 Calculate 0.32179. 653.7 Multiply -3135 and -4. 12540 Multiply -0.8 and 0.447. -0.3576 Calculate 536.40.3. 160.92 Product of 4863 and 1. 4863 0.23 * -0.2 -0.046 Work out 2.6 * 0.0753. 0.19578 -4678-2 9356 Multiply -0.06 and -3.6. 0.216 What is 0.3 times 9? 2.7 12895-0.4 -5158 -18 * -2 36 -98 times -2 196 Calculate -12-2446. 29352 What is 194 times 7? 1358 12 times 29 348 What is 9 times 0.02? 0.18 60.421 2.526 6*852	{ "pile_set_name": "DM Mathematics" }
the smallest common multiple of u and 6. 6 Let p = 2/18233 - 948170/492291. Find the common denominator of 137/24 and p. 216 Let g(p) = p*3 - 11p*2 + 9p + 14. Suppose -i - i + 20 = 0. Calculate the smallest common multiple of 4 and g(i). 4 Let o(f) = f*3 + 16f*2 - f - 5. Let x = 0 + -1. Calculate the least common multiple of 2/((x/(-2))/1) and o(-16). 44 Let z(r) = 3r*2 + 11r - 2. Let q be z(8). Let p = q + -2771/10. Calculate the common denominator of p and -67/12. 60 Let q = 3 + 2. Suppose -4 = w - q. What is the least common multiple of 6 and (-2 + 4 + -1)w? 6 Let z be (14/(-63))/((-1)/(-2435)). Let t = z + 540. Let y = 6/5 - 69/20. What is the common denominator of t and y? 36 Suppose -5b = -28 - 32. Suppose -v + 4v - b = 0. Suppose 2a - 34 = -5c, c - 4c + 5a = -39. Calculate the lowest common multiple of v and c. 8 Let p = -5 + 7. Let k be (3/(-6))/(2/(-4)). What is the common denominator of p/k - (-15)/(-2) and -23/2? 2 Let l = -23 + 32. What is the smallest common multiple of l and 4 + 5/((-10)/(-4))? 18 Let t = 25561/6 + -4277. Find the common denominator of t and ((-1)/4)/((-2)/(-348)). 6 Let n(f) = -f - 1. Let k be n(0). Let g(u) = 11u*2. Calculate the least common multiple of 1 and g(k). 11 Suppose 7b - 51 = -2d + 2b, 4b = 12. Suppose v = 43 - d. Let o = 35 - v. What is the lowest common multiple of o and 8? 40 Let y be ((-1)/(-8))/(2/109). Let u = -9/16 + y. Calculate the common denominator of u and ((-4)/50 + 0)-95. 20 Suppose m + 5y = 0, 2m + 2y + 2y - 24 = 0. Suppose -p - 14 = -2p. What is the smallest common multiple of m and p? 140 Let y be (9/(-6))/(2/(-4)). Calculate the common denominator of (5 - y) + (-31)/8 and 40/7. 56 Let g = 1277663/45 - 28391. Calculate the common denominator of -101/10 and g. 90 Suppose -2b + 4b = -22642. Let l = b + 113331/10. Calculate the common denominator of l and -44. 10 Suppose 4v + 11 - 31 = 0. What is the least common multiple of v and 1 - -1(1 - -2)? 20 What is the common denominator of -25/6 and (-64)/6(-5)/(5 + 25)? 18 Let c = -4 - 7. Let m = -3 - c. Let s = 33 - 15. Calculate the least common multiple of m and s. 72 Let i = -20/1927 + 837991/346860. Let k = 1/180 - i. Calculate the common denominator of k and -127/6. 30 Let f = -124/57 + -3/19. Find the common denominator of ((-3)/9)/(3/219) and f. 3 What is the lowest common multiple of 1/(-2)(-9 + 5) and ((-1)/(-1))/(1 + 0)? 2 Find the common denominator of -87/2 and 4/6 + (-604)/24. 2 Let k = -835/98 - -22/49. What is the common denominator of 53/48 and k? 336 Suppose 0 = -w - w + 16. Let s be (-4422)/w - (-7)/(-28). Let j = s + 5014/9. What is the common denominator of j and -14/11? 99 Calculate the common denominator of -37/6 and ((-10)/(-15))/(40/114). 30 Suppose -4i - 22 = -2a - i, -5a + 29 = -i. Suppose r - 20 = -2d - r, 2r = -ad + 50. What is the smallest common multiple of 16 and d? 80 Let s = -3312 - -1705681/515. Let a = -2327/412 - s. Calculate the common denominator of a and -3 - (18/(-20) - 0). 20 Let w(y) = -5y - 1. Suppose 47 = 2l + 2l - 3g, 0 = 4l + 2g - 42. Calculate the least common multiple of w(-1) and l. 44 Calculate the common denominator of (-248)/(-36) + 3-1 and 4/(-14) + 608/70. 45 Let p = -355910/27 + 13180. Calculate the common denominator of -83/6 and p. 54 Let n(f) = -2f - 10. Let d(t) = -t3 + 6t*2 + 5t + 4. Let a be d(7). Suppose 0 = 2v - 0v - 4. Calculate the lowest common multiple of v and n(a). 10 Calculate the least common multiple of 20 + (-5 - -2) + 1 and 18. 18 Suppose -g = 2g + 2n - 30, -4g + 60 = -4n. Calculate the smallest common multiple of 1 and g. 12 Let r be -61/(6/9). Let p = r - -12. Calculate the smallest common multiple of 1 and p. 3 Let f(r) = r3 - 6r*2 + r + 4. Suppose -g + 8 = 2. Calculate the smallest common multiple of 6 and f(g). 30 Let w = 13 + -10. What is the smallest common multiple of 2 and w? 6 Suppose 2c + c = 0. Let r be (-1 - c)(-2)/(-346). Let q = 153/3460 - r. Calculate the common denominator of 47/6 and q. 60 Calculate the lowest common multiple of (2 + (1 - -1))/(-5 + 7) and 4. 4 Let y = -1243583/48 + 25909. Calculate the common denominator of y and -71/12. 48 Let t(s) = -s - 6. Let v be t(-9). Suppose -vc = -0c - 6. What is the smallest common multiple of 22 and c? 22 Let j = -5372657260 + 31301101279367/5826. Let l = j - 12/971. Let x = 4/3211 + 176581/19266. Find the common denominator of x and l. 6 Let p = -36/7 - -713/140. Let m = -1416 + -465. Let s = m + 37687/20. Calculate the common denominator of p and s. 20 Suppose -t - t + 24 = 0. Let q be (t/(-14))/(7/49). What is the least common multiple of 2/q - 26/(-6) and 20? 20 Suppose -4t + 23 - 5 = 3a, -2t + 8 = a. Suppose ay = -y - 18. Find the common denominator of 1/(0 - y/(-77)) and 49/18. 18 What is the common denominator of 79/6 and (972/(-141))/2 - -3? 282 Let f be ((-33771445)/42 - 0) + -1. Let u = f + 804045. Let k = u - -209/7. Find the common denominator of k and 53/18. 18 Suppose 2n + 37 = 3p - 0n, 0 = 3p - 4n - 47. Suppose -w + 6 = -0w. Calculate the smallest common multiple of p and w. 18 Let h = -141 - -223. Find the common denominator of (-6)/(-20)375/6 and (-10)/15 - h/(-8). 12 Find the common denominator of (1 - -3) + 1247/258 and -1 + 2/(120/302). 30 Suppose -2f + 24 = 4. Calculate the smallest common multiple of (0 - 1) + 18 and f. 70 Suppose 5m = 9m - 4. What is the lowest common multiple of m and 27? 27 Let c = 249120253625/2334 + -106735305. Let g = c - 3/389. Find the common denominator of g and 55/24. 24 Let f = -187829/91992 - -1/7666. Find the common denominator of -76/9 and f. 72 Suppose -2b - 40 = -6b. What is the smallest common multiple of -3((-22)/(-3))/(-2) and b? 110 Let m be (1-1)/((-1)/2). Suppose 3c + 0c = 0. Suppose -t - 2v = -ct - m, -2t = -5v - 31. Calculate the lowest common multiple of 12 and t. 24 Suppose 0 = -3o - 24826 - 20297. Let g be 1623381/108 + (-2)/9. Let j = o + g. Calculate the common denominator of -71/18 and j. 36 Suppose -5v = 2g + 13, -v + 2g - 5g = 0. Let b(a) = -a2 - 2a + 5. What is the lowest common multiple of 10 and b(v)? 10 Let t(s) = -13s3 - s2 - s. Let c be t(2). What is the common denominator of (81/60)/((-12)/c) and 16/3? 24 Calculate the common denominator of 37/(-8)-11 and 69/14 + -3 + 1. 56 Let o(q) = -q + 12. Calculate the lowest common multiple of 14 and o(10). 14 What is the common denominator of 25/11 and (-2)/((-32)/364) - -1? 44 Let r = -2221/420 + 4/105. Calculate the common denominator of 5/10 - (-55)/(-8) and r. 8 Let s be (-7542051)/502 + -2 + -1. Let k = s - -15027. Let q = -8156/251 + k. Calculate the common denominator of q and 17/20. 20 Let t be 84 + 1 + -2 - 3. Suppose 4v = -v + t. Calculate the lowest common multiple of v and 8. 16 Let b be 56/61-3. Find the common denominator of (-1254)/b + (-2)/7 and 109/6. 6 Find the common denominator of (-5325)/(-30)(-2)/10 and -95/2. 2 Let v be 508/16 - (-3)/(-4). Suppose -5q + v + 4 = 0. Suppose 8 = -g - q. Calculate the common denominator of g and -41/6. 6 Suppose 2g - 7g - 31 = -2s, -5s = 2g - 92. Suppose 0i + 3i = s. What is the lowest common multiple of i and 8? 24 Let o = 79 + -59. Calculate the smallest common multiple of o and 4. 20 Let i(q) = -2q - 32. Let a(t) = t + 13. Let p(k) = 12a(k) + 5i(k). What is the lowest common multiple of 20 and p(4)? 20 Let s = -21 + 41. Calculate the least common multiple of 16 and s. 80 Let l = -7433/27278 + -6/593. Calculate the common denominator of l and 63/4. 92 Suppose 2f = 5f + 5s + 1086, 5f + 1810 = s. Let i be 2 + (-186)/20440f. Let v = i + 3/511. Find the common denominator of v and 32/5. 10 Let q(t) = t3 - 14t2 - t + 20. What is the least common multiple of 12 and q(14)? 12 Let f(b) = b3 - 4b2 + 4b - 2. Suppose 0 = l + 2c + 14, -3l + l - 30 = 5c. Let j = 14 + l. What is the least common multiple of f(j) and 4? 28 Let j be 454/(-10) + (-2)/(-5). Let m be 6/(-524)1/j. Let i = m - -198463/7860. What is the common denominator of -101/20 and i? 20 Let w be ((-576)/60)/((-2)/(-35)). Find the common denominator of (-18)/w*(-50)/(-3) and -59/8. 56 Let f = 42 - 18. Calculate the smallest common multiple	{ "pile_set_name": "DM Mathematics" }
-42, -65? -23h + 4 What is the l'th term of 38, 65, 70, 41, -34? -2l3 + l2 + 38l + 1 What is the n'th term of -33, -30, -11, 36, 123? 2n*3 - 4n*2 + n - 32 What is the m'th term of -30, -33, -36? -3m - 27 What is the l'th term of -6, -12, -22, -36, -54, -76? -2l2 - 4 What is the c'th term of -17, -29, -41? -12c - 5 What is the f'th term of 1391, 2780, 4169? 1389f + 2 What is the d'th term of 595, 1187, 1791, 2413, 3059, 3735, 4447? d3 + 585d + 9 What is the i'th term of 1326, 1327, 1352, 1413, 1522, 1691? 2i3 - 13i + 1337 What is the o'th term of -63, -52, -31, 6, 65, 152, 273? o3 - o2 + 7o - 70 What is the s'th term of -513, -542, -573, -606, -641? -s2 - 26s - 486 What is the d'th term of -11094, -22186, -33278, -44370, -55462, -66554? -11092d - 2 What is the q'th term of 206, 821, 1848, 3287, 5138, 7401? 206q*2 - 3q + 3 What is the z'th term of 19, -58, -267, -674, -1345, -2346? -11z3 + 30 What is the l'th term of 2, -53, -152, -301, -506, -773, -1108? -l3 - 16l2 + 19 What is the s'th term of -13, -11, -17, -37, -77, -143? -s3 + 2s2 + 3s - 17 What is the m'th term of -275, -274, -273, -272, -271, -270? m - 276 What is the d'th term of 370, 717, 1064? 347d + 23 What is the q'th term of -18, -6, 24, 78, 162, 282, 444? q3 + 3q*2 - 4q - 18 What is the n'th term of -1051, -1034, -1005, -958, -887, -786, -649, -470? n*3 + 10n - 1062 What is the i'th term of -147, -574, -1285, -2280, -3559, -5122, -6969? -142i2 - i - 4 What is the j'th term of 0, -7, -18, -33? -2j2 - j + 3 What is the g'th term of 6, -2, -8, -12, -14, -14, -12? g2 - 11g + 16 What is the i'th term of -226, -204, -182, -160, -138? 22i - 248 What is the q'th term of -39, -15, 7, 27? -q*2 + 27q - 65 What is the m'th term of -3, 1, 9, 21, 37, 57? 2m2 - 2m - 3 What is the z'th term of -99, -119, -141, -165, -191, -219? -z*2 - 17z - 81 What is the m'th term of 45, 77, 123, 189, 281, 405, 567, 773? m3 + m2 + 22m + 21 What is the u'th term of 17, 38, 61, 86? u2 + 18u - 2 What is the j'th term of 57, -43, -313, -837, -1699, -2983? -14j3 - j2 + j + 71 What is the n'th term of 3586, 7167, 10748, 14329, 17910, 21491? 3581n + 5 What is the l'th term of -111, -224, -337, -450, -563? -113l + 2 What is the c'th term of 10, 18, 30, 46, 66, 90? 2c*2 + 2c + 6 What is the a'th term of -62, -114, -164, -212, -258? a*2 - 55a - 8 What is the x'th term of -1234, -2468, -3702, -4936, -6170? -1234x What is the y'th term of 363, 374, 391, 414, 443? 3y*2 + 2y + 358 What is the q'th term of 356, 364, 372, 380? 8q + 348 What is the j'th term of -35, -93, -145, -185, -207, -205, -173? j3 - 3j*2 - 56j + 23 What is the n'th term of 62, 77, 108, 161, 242? n*3 + 2n*2 + 2n + 57 What is the j'th term of -4828, -4825, -4822, -4819, -4816? 3j - 4831 What is the r'th term of 16, 23, 30, 37, 44, 51? 7r + 9 What is the j'th term of 22, 11, -22, -89, -202, -373? -2j3 + j2 + 23 What is the b'th term of -3, -13, -23, -33, -43? -10b + 7 What is the c'th term of 1, -7, -27, -59, -103? -6c2 + 10c - 3 What is the i'th term of -111, -90, -43, 42, 177, 374, 645? 2i3 + i2 + 4i - 118 What is the g'th term of -972, -955, -938, -921? 17g - 989 What is the s'th term of -62, -63, -64, -65, -66? -s - 61 What is the x'th term of -4, 17, 44, 71, 92, 101, 92? -x3 + 9x*2 + x - 13 What is the l'th term of 5413, 10826, 16239, 21652, 27065? 5413l What is the w'th term of 342, 341, 340, 339? -w + 343 What is the j'th term of -121, -140, -187, -274, -413? -2j3 - 2j2 + j - 118 What is the z'th term of 34, 55, 78, 103, 130, 159, 190? z2 + 18z + 15 What is the h'th term of -23, -69, -197, -449, -867, -1493? -7h3 + h2 - 17 What is the h'th term of -2572, -5144, -7716, -10288, -12860? -2572h What is the m'th term of -64, -14, 130, 416, 892? 8m3 - m2 - 3m - 68 What is the y'th term of -10934, -10933, -10932, -10931, -10930? y - 10935 What is the p'th term of 39, 45, 51, 57? 6p + 33 What is the m'th term of -1429, -1432, -1435, -1438, -1441? -3m - 1426 What is the m'th term of 461, 902, 1359, 1838, 2345, 2886, 3467? m3 + 2m*2 + 428m + 30 What is the g'th term of 77, 64, 27, -46, -167, -348, -601? -2g3 + g + 78 What is the s'th term of 505, 1002, 1499? 497s + 8 What is the q'th term of -58, -122, -210, -334, -506, -738, -1042, -1430? -2q3 - 50q - 6 What is the f'th term of -2, 8, 18, 28, 38? 10f - 12 What is the v'th term of 30, 58, 84, 108, 130? -v2 + 31v What is the n'th term of 614, 620, 626? 6n + 608 What is the w'th term of 20, 77, 134? 57w - 37 What is the v'th term of 14, 48, 94, 158, 246, 364, 518? v*3 + 27v - 14 What is the b'th term of 3921, 3918, 3905, 3876, 3825, 3746? -b3 + b2 + b + 3920 What is the t'th term of 2120, 4238, 6356, 8474, 10592, 12710? 2118t + 2 What is the f'th term of -3854, -3856, -3858, -3860, -3862, -3864? -2f - 3852 What is the m'th term of 23, 22, 5, -34, -101, -202, -343? -m*3 - 2m*2 + 12m + 14 What is the f'th term of 223, 209, 195, 181, 167, 153? -14f + 237 What is the j'th term of -1, -21, -29, -19, 15, 79, 179, 321? j3 - 27j + 25 What is the m'th term of -816, -810, -792, -756, -696, -606, -480, -312? m*3 - m - 816 What is the d'th term of 11, 45, 101, 179, 279, 401? 11d*2 + d - 1 What is the g'th term of 665, 1325, 1985, 2645, 3305, 3965? 660g + 5 What is the i'th term of 428, 858, 1288, 1718, 2148? 430i - 2 What is the k'th term of 150, 148, 146, 144? -2k + 152 What is the u'th term of -303, -304, -305? -u - 302 What is the i'th term of -138, -276, -414, -552, -690? -138i What is the h'th term of -128, -253, -378, -503, -628? -125h - 3 What is the y'th term of 67, 253, 561, 991, 1543? 61y2 + 3y + 3 What is the j'th term of 34, 76, 130, 202, 298, 424? j*3 + 35j - 2 What is the f'th term of 498, 968, 1436, 1902? -f*2 + 473f + 26 What is the w'th term of 32, 152, 354, 638, 1004? 41w2 - 3w - 6 What is the t'th term of -798, -1630, -2462, -3294, -4126, -4958? -832t + 34 What is the u'th term of 1, -3, -11, -23? -2u*2 + 2u + 1 What is the n'th term of 51, 64, 77, 90, 103, 116? 13n + 38 What is the g'th term of 26, 38, 26, -22, -118, -274, -502, -814? -2g*3 + 26g + 2 What is the s'th term of -51, -191, -423, -747, -1163, -1671? -46s2 - 2s - 3 What is the g'th term of 400, 1589, 3586, 6403, 10052? 2g3 + 392g*2 - g + 7 What is the k'th term of 2222, 4446, 6670, 8894, 11118? 2224k - 2 What is the y'th term of -5546, -5545, -5544, -5543, -5542, -5541? y - 5547 What is the h'th term of -2, 76, 224, 478, 874? 6h3 - h2 + 39h - 46 What is the w'th term of 334, 354, 418, 550, 774? 4w3 - 2w*2 - 2w + 334 What is the i'th term of 14, 5, 10, 35, 86, 169, 290? i3 + i2 - 19i + 31 What is the a'th term of -4, -21, -38, -55? -17a + 13 What is the r'th term of -68, -71, -74, -77? -3r - 65 What is the x'th term of -171, -351, -531, -711, -891? -180x + 9 What is the r'th term of 119, 130, 137, 140, 139? -2r2 + 17r + 104 What is the x'th term of 417, 418, 419, 420? x + 416 What is the d'th term of -703, -1396, -2089? -693d - 10 What is the y'th term of 43, 51, 53, 43, 15? -y3 + 3y*2 + 6y + 35 What is the v'th term of -80, -70, -56, -38, -16, 10? 2v2 + 4v - 86 What is the c'th term of 407, 1620, 3641, 6470? 404c2 + c + 2 What is the b'th term of 78, 79, 82, 87, 94? b2 - 2b + 79 What is the b'th term of -173, -341, -507, -671? b*2 - 171b - 3 What is the m'th term of -195, -191, -173, -135, -71, 25, 159, 337? m3 + m2 - 6m - 191 What is the g'th term of 299, 586, 857, 1106, 1327, 1514? -g3 - 2g*2 + 300g + 2 What is the y'th term of -52, 20, 140, 308, 524? 24y2 - 76 What is the i'th term of 48, 44, 38, 30, 20? -i2 - i + 50 What is the c'th term of 50, 101, 152? 51c - 1 What is the v'th term of -311, -330, -365, -422, -507, -626? -v*3 - 2v*2 - 6v - 302 What is the n'th term of 767, 761, 745, 713, 659, 577? -n3 + n2 - 2n + 769 What is the r'th term of 25, 29, 33? 4r + 21 What is the o'th term of -762, -1521, -2276, -3027, -3774, -4517? 2o2 - 765o + 1 What is the y'th term of -31, -99, -211, -367, -567? -22y2 - 2y - 7 What is the c'th term of 1,	{ "pile_set_name": "DM Mathematics" }
d 676. 13 What is the highest common factor of 449879 and 2? 1 Calculate the highest common factor of 2264 and 27192904. 2264 Calculate the greatest common divisor of 45865220 and 920. 460 What is the highest common divisor of 1176 and 55284887? 49 Calculate the greatest common divisor of 224 and 107525152. 224 Calculate the highest common divisor of 4799015 and 643370. 6565 What is the highest common factor of 2748390 and 3060? 510 Calculate the highest common divisor of 830708 and 2716. 388 Calculate the greatest common factor of 3623981 and 476417. 5353 Calculate the highest common factor of 1630533 and 657119. 1291 What is the greatest common factor of 92717 and 35? 1 Calculate the highest common divisor of 4548714 and 228. 114 What is the greatest common divisor of 29821 and 537233448? 2711 What is the highest common factor of 25652863 and 353? 353 What is the greatest common divisor of 4312 and 501336? 88 What is the highest common factor of 339261270 and 1011? 1011 Calculate the greatest common factor of 152 and 412243. 19 Calculate the highest common factor of 356966 and 170. 34 What is the greatest common factor of 229514 and 10? 2 What is the highest common factor of 4141 and 44401418? 101 Calculate the highest common divisor of 35379256 and 176. 88 What is the greatest common factor of 2282570 and 1150? 10 What is the highest common factor of 2946728 and 10784? 2696 What is the greatest common factor of 18755 and 416485? 155 What is the greatest common divisor of 418 and 56072401? 209 Calculate the greatest common divisor of 1372297 and 208803. 163 What is the highest common divisor of 826828 and 68773? 97 Calculate the highest common divisor of 8610250 and 6868. 202 Calculate the greatest common factor of 5997477 and 4371. 93 Calculate the highest common divisor of 4 and 362339948. 4 What is the highest common factor of 14230682 and 685580? 9794 Calculate the greatest common divisor of 1474168 and 8. 8 What is the highest common factor of 345783 and 18? 3 What is the highest common factor of 20184 and 86955195? 2523 What is the greatest common divisor of 192 and 40159232? 64 Calculate the greatest common divisor of 1159 and 8491444. 61 Calculate the highest common factor of 38038 and 933166. 494 What is the highest common divisor of 28005 and 498? 3 Calculate the highest common factor of 66 and 4215002. 22 Calculate the greatest common factor of 2720310 and 110. 10 What is the highest common divisor of 52107267 and 9? 3 What is the highest common divisor of 1110177 and 1236? 3 What is the greatest common divisor of 1078 and 684922? 98 What is the highest common divisor of 76 and 30328294? 38 What is the greatest common divisor of 46757006 and 1448? 362 Calculate the highest common factor of 6222 and 453084. 102 What is the highest common divisor of 642 and 3983824? 214 What is the highest common factor of 776 and 478896? 8 What is the greatest common divisor of 477 and 823248364? 53 What is the highest common divisor of 2946 and 177748874? 982 Calculate the highest common factor of 606 and 4377180. 6 What is the highest common factor of 4334274 and 100044? 126 What is the greatest common divisor of 38485902 and 735? 21 Calculate the highest common factor of 1049789550 and 954. 318 What is the highest common factor of 82739 and 363455? 157 What is the greatest common divisor of 436464949 and 59? 59 What is the greatest common factor of 101190922 and 98? 14 Calculate the highest common factor of 54910 and 1276515. 95 What is the highest common divisor of 307454 and 98? 14 Calculate the greatest common divisor of 4800 and 10775400. 600 What is the highest common divisor of 43640295 and 120? 15 Calculate the greatest common divisor of 2921 and 1691005. 127 What is the greatest common factor of 5030896 and 4? 4 What is the greatest common factor of 10099593 and 567? 189 What is the greatest common divisor of 31469 and 125? 1 What is the greatest common factor of 67592055 and 345? 345 Calculate the greatest common factor of 627 and 2486264. 209 Calculate the greatest common divisor of 59146150 and 1735. 1735 What is the highest common divisor of 107043 and 13708410? 3453 What is the greatest common factor of 1850 and 8913490? 10 Calculate the greatest common divisor of 11332640 and 16115. 55 Calculate the highest common factor of 1134 and 15214122. 378 What is the greatest common factor of 4462 and 48737068? 194 Calculate the highest common factor of 2588 and 2357546364. 2588 What is the highest common factor of 7537610 and 148780? 1730 Calculate the highest common divisor of 64621617 and 1353. 123 Calculate the highest common factor of 1601125 and 375. 125 Calculate the greatest common factor of 35052 and 2166366. 762 Calculate the highest common factor of 783 and 29696. 29 Calculate the highest common factor of 7 and 457699991. 7 Calculate the highest common factor of 174552370 and 110. 10 Calculate the highest common factor of 5421 and 2687704. 139 Calculate the highest common factor of 5541550 and 2982. 994 What is the greatest common divisor of 20120840 and 920? 40 Calculate the greatest common factor of 3664 and 464672. 16 Calculate the highest common divisor of 11653 and 3948199. 271 Calculate the greatest common divisor of 4452 and 9294292. 1484 Calculate the greatest common divisor of 23797 and 118084. 53 What is the highest common divisor of 45552381 and 21? 21 What is the greatest common factor of 554829 and 7871? 17 Calculate the highest common factor of 96 and 20668032. 96 What is the highest common factor of 55 and 203517? 1 Calculate the greatest common factor of 289056 and 94368. 96 Calculate the greatest common factor of 685122 and 624821. 1283 What is the highest common divisor of 6123 and 410055269? 2041 What is the highest common divisor of 615625462 and 74? 74 Calculate the greatest common divisor of 12 and 157559252. 4 Calculate the greatest common divisor of 22067496 and 459. 153 Calculate the greatest common divisor of 44 and 30222423. 11 What is the greatest common factor of 111885026 and 1298? 22 What is the greatest common factor of 15 and 60983265? 15 Calculate the greatest common divisor of 172931 and 1392138. 869 Calculate the highest common factor of 768588 and 608. 76 Calculate the highest common factor of 1990180 and 1120. 20 Calculate the highest common factor of 664 and 30785032. 664 Calculate the greatest common factor of 2040 and 25254520. 680 What is the highest common factor of 52 and 68085524? 52 What is the greatest common divisor of 140694 and 7467? 393 What is the highest common factor of 10270 and 55490864? 2054 What is the highest common divisor of 16 and 3559638? 2 Calculate the highest common divisor of 20301604 and 2516. 2516 What is the greatest common factor of 90 and 84414636? 18 Calculate the highest common factor of 2890 and 8550. 10 Calculate the highest common divisor of 155 and 46311045. 5 What is the highest common divisor of 4254889 and 74? 37 What is the highest common factor of 24466323 and 5628? 1407 Calculate the greatest common factor of 56327 and 372899. 713 Calculate the greatest common factor of 3599019 and 68. 17 Calculate the highest common factor of 39 and 8020272. 39 Calculate the greatest common factor of 1002046 and 3. 1 Calculate the highest common divisor of 32209 and 4819921. 1039 What is the highest common divisor of 34408 and 719624? 184 Calculate the highest common factor of 14729490 and 54. 18 Calculate the highest common factor of 7075651 and 46. 23 Calculate the highest common divisor of 1856710943 and 118. 59 What is the highest common factor of 2000 and 56296720? 80 What is the greatest common divisor of 353 and 327961357? 353 Calculate the highest common divisor of 75464580 and 2280. 1140 What is the greatest common factor of 1430 and 3142100? 130 What is the greatest common factor of 145403 and 1932211? 1499 Calculate the greatest common divisor of 3276 and 437325525. 819 What is the greatest common divisor of 370300 and 10220? 140 Calculate the highest common factor of 2403000 and 29125. 125 Calculate the highest common divisor of 45750 and 32757. 183 Calculate the greatest common factor of 55080 and 162. 162 What is the greatest common divisor of	{ "pile_set_name": "DM Mathematics" }
2 - 258k + 2 - 1380k*2 to bk*2 + mk + d and give b. -3 Express 4 - 20100t - 4 + 7815t in the form x + zt and give z. -12285 Express -372221a*4 + 372217a*4 - 12a - 19a3 + a2 - 29a*3 in the form na*2 + pa*3 + o + wa*4 + ca and give w. -4 Rearrange (2f - 3f - 14f)(-5 + 4 + 2)(-f + 2f - 3f) - 2f*2 - 4f*2 + 3f*2 to b + yf + tf2 and give t. 27 Express -944b + 729b + 489b - 1 in the form xb + t and give t. -1 Rearrange -2q*3 + 417q*2 + 4q*2 + 1 + 74q*2 to yq + g + aq2 + iq*3 and give a. 495 Express (-44 - 2v - 79 + 17)(-452 + 96v + 452) in the form r + dv2 + pv and give d. -192 Rearrange (10609818 - 12z3 - 10609818 - 1022z)(-4 - 2z + 4) to the form w + qz + pz*2 + iz*3 + dz*4 and give p. 2044 Rearrange 13p + 55p2 + 123p*2 - 11p + 617p2 + 382p*2 to a + gp + jp2 and give g. 2 Rearrange 0u*3 - 26u + 65u - 425u - 2 + 1 + u3 - u2 to the form fu2 + i + qu*3 + ku and give f. -1 Express -17514 + 17514 - 1003p as v + gp and give g. -1003 Express -28m3 + 89m*3 + 2m*2 - 155m*3 + 12m + 0m2 as bm*2 + sm + l + cm3 and give l. 0 Express 626f - 308f - 1483f*2 - 3 - 318f in the form of2 + cf + n and give o. -1483 Express -34w3 + 67w + 2 + 21w - 152w + 66w - 9w*2 as hw*2 + p + qw*3 + tw and give q. -34 Rearrange -1165o2 + 10798o*2 + 4686o*2 + 294o*2 to the form lo*2 + fo + n and give l. 14613 Rearrange (8u - 4u - 10u)(-2062u3 - 536u*3 + 733u*3) to the form iu + xu3 + ju*2 + tu4 + c and give x. 0 Express 0 + i2 - 3i2 - 2 + 1 + 4 + 133i*3 as g + di*2 + pi*3 + ki and give d. -2 Express -3 + 4f3 - 2339f*4 - 3f*3 - 2341f*4 + 4683f*4 + 112f*2 as df + bf3 + x + tf*4 + rf*2 and give r. 112 Express 15 + y - 99035y*3 + 99437y*3 + 11 + (2y*2 - 3y2 - y2)(-3y + 3y - y) in the form d + gy*3 + iy + my2 and give i. 1 Express 17p*2 - 5p*2 - 12p - 3 + 41p + 0 + 14p as qp2 + h + sp and give h. -3 Rearrange (517 + 199 + 56 + 43)(-2 + 4 - 4)(-3u + 6u - 2u) to qu + y and give q. -1630 Rearrange -5115a2 + 2558a*2 + 2561a*2 + 249a*3 to the form y + ua + ba2 + xa*3 and give x. 249 Rearrange 917s*2 - 914s2 + s3 + 507 - 6s3 + 4s*3 + 798 to vs + xs3 + fs*2 + c and give c. 1305 Express 16 - 26i - 1 - 13i - i - 10i as ti + q and give t. -50 Express -f - 27f*4 + 28105f*2 - 28166f*2 + 26f*4 + 2f*3 as nf*2 + zf*3 + u + hf*4 + vf and give z. 2 Express 331w2 + 2w + 2 + 2w4 + 2w3 - w4 - 318w2 + 3w*4 as rw + tw2 + iw*4 + cw*3 + x and give r. 2 Express -5530 + 15d + 12d + 5558 as wd + v and give v. 28 Rearrange 1093d + 4620d + 2694d + 5814d - 3070d to the form l + ad and give a. 11151 Express (16 - 11 + 14)(-4 + 4 - 1)(28 + 97 + 65)(4l + 4l - 4l) as d + vl and give v. -14440 Express -46x*4 - 209x*4 + 36x4 - x4 - 3x + 3x + (-x*2 - 2x*2 + 5x*2)(826 - 7x2 - 826) as sx + q + jx4 + vx*2 + ox*3 and give j. -234 Express 27x*2 + 3x - 3 - 26x2 + 1158x*4 - 1159x*4 in the form sx*4 + dx*2 + cx + i + kx3 and give d. 1 Rearrange (-4 - 3 + 3)(-2o3 - 482o - 10 - 72 + 483o) + (-2o + 1 - 1)(0 - 2 + 0)(-5o + 5o - o*2) to wo*2 + so + jo3 + q and give s. -4 Express 62564 + 4t + 0t + 6t4 + t3 + 0t4 - 28t*2 - 62562 as it*2 + b + ot*3 + ct + vt4 and give o. 1 Rearrange 4603a + 1481a - 1775a to va + y and give v. 4309 Express -19z*3 + 3z*4 - 5z*4 + 6z*4 - 2z - 915z2 + 916z*2 in the form gz + tz4 + wz*2 + b + sz*3 and give t. 4 Express -44g + 5g2 + 23g + 5g3 + 26g + 3g4 + 3 - 2g*2 - 4g*2 in the form rg*2 + wg*4 + ug*3 + ag + j and give w. 3 Rearrange -3988 + 2y + 23y*2 - 2y - 2y - 3y*4 + 1990 + 1994 - 2y*3 to ay + hy3 + z + my*4 + oy2 and give z. -4 Rearrange (v3 - v*3 + 8v*3 + (2v - 2 + 2)(-2v2 - v2 + v*2))(172v + 419v - 8v) to nv*2 + pv*4 + w + fv*3 + qv and give p. 2332 Rearrange -95 + 411q - 243q - 198q to the form tq + h and give h. -95 Rearrange -1 - 9p2 - 5p*2 + 11p*2 + 8p*2 - 3p*2 - 19p*3 + 2p to kp3 + d + ip + cp2 and give c. 2 Rearrange (15m*2 + 48m - 48m)(11051m - 11051m + 358m2) to the form cm*3 + km*2 + jm + hm4 + i and give h. 5370 Rearrange 114s*3 + 4 - 82s*3 + 22s*4 - 30s*3 + 4s*2 to the form ds*3 + vs + as2 + os*4 + b and give d. 2 Express (-3 - 2 + 1)(-1 + 1 - 4v) + 1658v - 465v + 1060v - 113 + 113 as t + cv and give t. 0 Rearrange (-4 + z + 2z + 1)(-3 + 15 + 2)(14z - 7z + 9z + (-7 + 3 + 3)(4z - 7z + 10z)) to wz + jz2 + i and give j. 378 Express 4o*2 + 1113002o - 1112845o - 3o*2 as ko + m + uo2 and give k. 157 Express -40k*3 + 5k*2 + 38k*2 + 2k + 38k3 as j + ik + ok2 + pk*3 and give j. 0 Express 7245k + 5885 - 2953 - 2931 in the form pk + w and give w. 1 Rearrange (3305 + 2955 - 7250)(7s4 - 11 + 11) + s2 + s4 - s2 to ls + bs3 + m + cs*2 + as*4 and give a. -6929 Rearrange 2k*2 - 11k2 - k2 + (3k + k - 5k)(0 - 4 + 2)(3 - 1 + 1)(5 - k - 5)(0 + 5 + 2) to the form tk2 + pk + o and give t. -52 Express -26z3 - 36 - 15z*3 + 64z*3 - 11z*3 - 6z*2 + 5z*2 in the form sz*3 + uz*2 + cz + y and give s. 12 Express (8769 - 8769 - 826x)(-6x + 17x + 15x)(-2x2 - 2x*2 + 2x*2) as y + mx*3 + gx*2 + px*4 + qx and give p. 42952 Express -12h - 6h*3 + 4h + 4h3 + (1 - 2 + 3 + (-3 + 3 - 4)(7 - 9 + 24))(-12h*3 + 5h*3 + 15h*3) as ph + vh2 + ch*3 + n and give c. -690 Rearrange -360x*2 - 2 - 595x*2 + 1246x*2 - 950x*2 to the form vx*2 + jx + u and give v. -659 Rearrange 63 - 223n2 + 6n - 2n - 61 - 66 + 65 to r + on + vn2 and give o. 4 Express (1 + 2 - 4)(21 + 18 - 34)(-5n*2 + 2n2 + n2)(n2 - 6n*2 + 3n*2) as yn + pn2 + jn*3 + qn*4 + w and give q. -20 Express 16826u + 17192u - 4 - 34585u as t + mu and give m. -567 Rearrange -3 - 32000j + 68051j - 24121j + 3 to b + sj and give b. 0 Express (-7 - 79 - 10)(-5r + 2r + 0r + 3 - 3 + 4r + (4r - r - 5r)(-4 + 6 - 3)) as or + y and give o. -288 Express -1594c2 + 141c*2 - 1130c*2 in the form kc + q + xc2 and give x. -2583 Rearrange -1319u*2 - 17879 + u + u + 17879 to the form nu*2 + ku + i and give k. 2 Rearrange (54o - 26o + 11 - 29o)(-16 + 37 + 17) to ko + m and give m. 418 Express (6 - 4 - 2l*2 - 1)((0 + 0 + 2l)(-2 + 3 - 4) + (39l + 1 - 1)(-2 - 17 - 2)) in the form tl + ol*3 + g + kl*2 and give t. -825 Rearrange 27s - 13s3 + s2 - 17s - 15s4 - 6s + 6 + 12s4 - 2s to ls2 + os*4 + zs + t + fs3 and give t. 6 Rearrange (2o - 2o + 2o)(32681 - 32681 + 146o)(-3o + 4o + o) to qo + p + go3 + mo*2 and give p. 0 Rearrange 2n*3 - 2295n*2 + 45 + 1044n*2 + 1251n*2 + 19n to xn + hn*3 + wn*2 + j and give x. 19 Express 122 - 61h*3 - 72h*3 + 10h*3 - 112 - 2h*3 in the form p + lh + zh2 + fh*3 and give f. -125 Rearrange 25v - 2 + 12 - 27v + (590 - 297 - 297)(-3v + 3v - v) to gv + c and give c. 10 Express 1289m*2 - 44m*3 + 1131m*2 + 86m*3 - 47m*3 + 599m*2 in the form o + fm*3 + sm + lm2 and give l. 3019 Express -160 + 32h*2 + 121 - 13h*2 + 2h*3 + 5h*3 - 5h*3 in the form zh*2 + nh + c + dh3 and give c. -39 Express (-364 + 764 + 502)((2u - 2u + 2u)(2 + 0 + 0) + u - 5u + 2u - 3 + 3 + u - 2u - 2 - 2 - 4) as ju + s and give j. 902 Rearrange -4835q - 7060q + 71 - 71 to the form l + vq and give v. -11895 Express -4 - 2c*4 + 0c*2 + 22c*4 + 171c*3 - 3c*2 + 6c*4 - 172c*3 in the form g + tc*4 + fc*3 + yc*2 + zc and give f. -1 Rearrange (2 - 1 + 0)(1 - u4 - 1) + 20u*4 + 3u*2 - 15u*4 + 19u*4 - 3u - 15u + 9u*4 + 15u to wu + pu*3 + iu*4 + v + bu*2 and give b. 3 Express -b + 18 + 3b*3 - 2b*3 - 15b4 - b2 + 32b4 - 24b*4 in the form hb*3 + cb + rb2 + nb*4 + u and give n. -7 Rearrange (67 + 16 + 33)(m2 + m2 - 13 - 4) to gm + dm**2 + c and give c.	{ "pile_set_name": "DM Mathematics" }
53/150 and 18/925? 5550 Calculate the common denominator of 15/2 and 137/60. 60 Find the common denominator of -14/13 and -79/286. 286 What is the common denominator of 113/1210 and -87/110? 1210 Calculate the least common multiple of 1 and 99. 99 Find the common denominator of 21/220 and 89/726. 7260 Find the common denominator of 3/5 and -57/3620. 3620 Calculate the least common multiple of 4 and 12. 12 Calculate the lowest common multiple of 18 and 144. 144 Calculate the common denominator of -88/45 and 121/174. 2610 What is the least common multiple of 1690 and 195? 5070 What is the common denominator of 127/630 and -73/540? 3780 Find the common denominator of -41/16 and -69/6656. 6656 What is the common denominator of -87/50 and -36/1055? 10550 What is the least common multiple of 210 and 30? 210 Calculate the common denominator of 127/42 and 3/2. 42 Calculate the least common multiple of 15 and 35. 105 What is the lowest common multiple of 1700 and 4675? 18700 What is the smallest common multiple of 3 and 336? 336 What is the common denominator of 9/2 and 97/256? 256 What is the common denominator of -43/3 and 109/308? 924 Find the common denominator of 73/35 and -26/175. 175 Calculate the lowest common multiple of 80 and 50. 400 Calculate the common denominator of 29/66 and -13/54. 594 Calculate the lowest common multiple of 6 and 12. 12 Calculate the smallest common multiple of 52 and 8. 104 What is the common denominator of -19/84 and 59/70? 420 What is the common denominator of 67/7575 and 29/125? 37875 What is the least common multiple of 546 and 84? 1092 What is the common denominator of 4/2793 and -61/39? 36309 Calculate the common denominator of -4/3 and 89/66. 66 Calculate the lowest common multiple of 84 and 231. 924 What is the smallest common multiple of 6 and 48? 48 Calculate the common denominator of -107/2790 and 93/80. 22320 What is the smallest common multiple of 44 and 33? 132 Find the common denominator of -45/37 and 43/7. 259 Calculate the smallest common multiple of 66 and 15. 330 What is the common denominator of 60/119 and -137/350? 5950 Calculate the smallest common multiple of 737 and 132. 8844 Calculate the least common multiple of 98 and 24. 1176 What is the smallest common multiple of 2 and 13? 26 What is the common denominator of 69/70 and -101/80? 560 What is the lowest common multiple of 98 and 126? 882 Calculate the least common multiple of 1212 and 444. 44844 Calculate the least common multiple of 30 and 480. 480 Calculate the common denominator of 81/16 and 157/13056. 13056 What is the smallest common multiple of 104 and 8? 104 Calculate the lowest common multiple of 11 and 184. 2024 What is the lowest common multiple of 493 and 145? 2465 What is the least common multiple of 2 and 624? 624 What is the least common multiple of 6 and 304? 912 Find the common denominator of -4/243 and -97/540. 4860 What is the common denominator of -33/665 and -32/63? 5985 Find the common denominator of 65/14 and -23/876. 6132 Calculate the least common multiple of 166 and 20. 1660 Calculate the lowest common multiple of 90 and 36. 180 What is the smallest common multiple of 78 and 1644? 21372 Calculate the common denominator of -5/16 and -81/5212. 20848 What is the common denominator of 25/249 and -79/30? 2490 What is the lowest common multiple of 6 and 3401? 20406 What is the common denominator of 1/726 and -11/16? 5808 What is the common denominator of 89/90 and 137/12? 180 Calculate the common denominator of -41/52 and -59/117. 468 What is the common denominator of 43/16 and -131/66? 528 What is the common denominator of -17/48 and -41/72? 144 What is the lowest common multiple of 6 and 38? 114 Calculate the least common multiple of 294 and 490. 1470 Find the common denominator of -45/22 and 187/210. 2310 What is the common denominator of -12/5 and -68/75? 75 What is the common denominator of 13/54 and -121/54? 54 What is the least common multiple of 714 and 498? 59262 What is the least common multiple of 2 and 8? 8 What is the common denominator of 181/60 and -19/15? 60 What is the common denominator of 71/22 and -47/13918? 153098 What is the common denominator of -35/6 and -51/2770? 8310 Calculate the lowest common multiple of 44 and 30. 660 Calculate the smallest common multiple of 8 and 314. 1256 Find the common denominator of -121/12 and -77/32. 96 Calculate the least common multiple of 96 and 928. 2784 Calculate the common denominator of -127/30 and 113/66. 330 Find the common denominator of 57/460 and 39/92. 460 Calculate the common denominator of -1/763 and 17/2. 1526 What is the lowest common multiple of 684 and 380? 3420 Find the common denominator of -32/3 and -143/3144. 3144 Calculate the lowest common multiple of 800 and 112. 5600 Calculate the least common multiple of 840 and 672. 3360 What is the smallest common multiple of 380 and 36? 3420 Find the common denominator of 113/84 and 107/930. 13020 What is the smallest common multiple of 220 and 40? 440 Calculate the common denominator of 49/711 and -11/189. 14931 Calculate the least common multiple of 316 and 869. 3476 Calculate the common denominator of 39/3956 and 29/11. 43516 What is the smallest common multiple of 150 and 150? 150 Find the common denominator of -137/2800 and 33/20. 2800 Find the common denominator of 125/72 and 97/180. 360 What is the smallest common multiple of 370 and 259? 2590 What is the common denominator of 59/6 and 54/221? 1326 What is the lowest common multiple of 35 and 30? 210 Calculate the lowest common multiple of 40 and 92. 920 Calculate the lowest common multiple of 8 and 794. 3176 What is the least common multiple of 3 and 51? 51 What is the smallest common multiple of 8 and 40? 40 Find the common denominator of -39/1250 and -121/6. 3750 Find the common denominator of -47/340 and 7/12. 1020 Calculate the common denominator of 81/700 and -73/350. 700 Calculate the least common multiple of 8 and 133. 1064 What is the common denominator of -29/27 and 74/3? 27 What is the common denominator of 22 and 55/4? 4 Calculate the common denominator of 97/7623 and 29/252. 30492 What is the least common multiple of 2530 and 1610? 17710 Calculate the least common multiple of 4 and 40. 40 What is the smallest common multiple of 1920 and 64? 1920 Calculate the smallest common multiple of 42 and 105. 210 Calculate the lowest common multiple of 2709 and 2709. 2709 Calculate the common denominator of -29/27 and 89/54. 54 What is the smallest common multiple of 1059 and 6? 2118 What is the least common multiple of 8 and 152? 152 What is the common denominator of -67/1666 and 111/4522? 31654 Calculate the common denominator of 61/734 and -71/6. 2202 What is the common denominator of -54/299 and 97/208? 4784 What is the smallest common multiple of 120 and 1875? 15000 What is the common denominator of -33/1015 and 9/667? 23345 What is the lowest common multiple of 612 and 16? 2448 Calculate the common denominator of 17/12 and -77/12. 12 Calculate the common denominator of -6/35 and -69/40. 280 Find the common denominator of -37/18 and 93/44. 396 Calculate the least common multiple of 328 and 1. 328 What is the smallest common multiple of 132 and 198? 396 Calculate the common denominator of -71/6 and 34/5. 30 Calculate the lowest common multiple of 6 and 2476. 7428 What is the least common multiple of 69 and 92? 276 Calculate the common denominator of 23/5 and -97/350. 350 Calculate the smallest common multiple of 18 and 348. 1044 Find the common denominator of -83/40 and 47/130. 520 What is the lowest common multiple of 18 and 9? 18 What is the lowest common multiple of 4948 and 36? 44532 Find the common denominator of 23/6 and 73/36. 36 Calculate the least common multiple of 32 and 40. 160 Find the common denominator of -64/195 and 82/255. 3315 What is the smallest common multiple of 644 and 782? 10948 What is the lowest common multiple of 223 and 2? 446 What is the common denominator of 13/60 and -11/180? 180 Calculate the least common multiple of 31972 and 14. 223804 What is the lowest common multiple of 182 and 70? 910 What is the common denominator of -73/81 and 31/57? 1539 Calculate the common denominator of 64/327 and 181/60. 6540 C	{ "pile_set_name": "DM Mathematics" }
closest to 0.2 in 0.1, -2/5, -18, -0.8, 91? 0.1 Which is the nearest to -65? (a) 0.5 (b) 32985 (c) -2 (d) 1/5 c What is the nearest to -950 in -4.14, 3/8, -3/5, 3? -4.14 Which is the closest to 0? (a) -1.7 (b) -1/2 (c) -0.07 (d) 4 (e) -6 (f) 5/121 f Which is the nearest to 1? (a) 1/2 (b) 2 (c) 0.1 (d) 76 (e) -102 (f) -1.59 a Which is the nearest to 6/7? (a) -262.34 (b) -1/4 (c) 22 b Which is the closest to 0? (a) -0.1 (b) 2/39 (c) 1/268 (d) 0 (e) 12 d What is the closest to -4 in 0.125, 1/3, -2/15, -11, -4? -4 Which is the closest to 2.58? (a) 2 (b) -2460/13 (c) -2 (d) -2/11 a What is the closest to 0 in -728, -0.1, -0.28, -5/57, -0.4? -5/57 What is the closest to 6/25 in -1, 15, -3028? -1 Which is the closest to 0.027? (a) -1/3 (b) 2/7 (c) 0 (d) -209 c What is the nearest to -3 in 2/63, -0.4, 0.3, 14/51, -14, -9? -0.4 Which is the nearest to -1/11? (a) 4/3 (b) 6 (c) -0.3 (d) -1/4 (e) 814/15 d Which is the closest to -3878? (a) -5 (b) 0.1 (c) 0.3 (d) 14 (e) 3/4 a What is the closest to -1 in -1, -8, -0.2, -838, -2? -1 Which is the closest to -7/4? (a) -0.1 (b) 2/199 (c) -1 c Which is the closest to -98? (a) 1.402 (b) 1 (c) -3/16 c Which is the nearest to 5? (a) 678 (b) -3 (c) -1/257 c What is the nearest to -0.033 in -15, -15/11, -0.02, 2/137? -0.02 Which is the nearest to 0.1? (a) 0.1 (b) -0.293 (c) -5/32 (d) 5 (e) 2 a Which is the closest to 0? (a) 3/7 (b) 5 (c) 189 (d) 1/467 (e) 0.4 d Which is the nearest to -1? (a) -2/37 (b) 5 (c) -2.1678 (d) 5/4 a Which is the closest to 76.3? (a) 10 (b) -1/2 (c) -2/11 (d) 3/4 (e) 3/11 a Which is the nearest to -19? (a) 4.4 (b) -4436 (c) 3 c Which is the closest to 2/3? (a) 3 (b) 49016 (c) 5 (d) 2 d Which is the closest to 6? (a) -99 (b) 3 (c) 2756 b Which is the closest to -3? (a) 1369 (b) -2/7 (c) 24.98 (d) -2 d What is the closest to -0.2 in -5, -464, 13/4, -23? 13/4 Which is the nearest to 0.639? (a) -5 (b) -3/64 (c) 0.2 (d) -0.6 c Which is the nearest to -0.0274? (a) -0.09 (b) 8 (c) 4/7 (d) 3/7 (e) -2 (f) 2/15 a Which is the nearest to -1/3? (a) 210 (b) 6 (c) -2 (d) -2570 (e) 5 c What is the nearest to -1 in -1, -4, 72148656, 1/3? -1 Which is the nearest to 4.4? (a) 2/3 (b) 1/8 (c) 5/4 (d) -602 c Which is the closest to 0? (a) 2 (b) 0.3 (c) 0.5 (d) -1/925199 d What is the nearest to -839750 in 2, -0.1, -1, 12? -1 Which is the nearest to 1/14? (a) -1/15 (b) 1343 (c) 1 (d) -0.4 a Which is the nearest to 8? (a) -143 (b) 0.116 (c) 1/7 c What is the closest to -1.1 in 1, 1/139, -2, -347? -2 Which is the nearest to 0.0548? (a) -13 (b) -9 (c) 0.256 c Which is the nearest to 25/6? (a) -5155 (b) -0.04 (c) -2/5 b Which is the closest to -3/10? (a) 1/8 (b) 0.3 (c) -212/13 (d) -0.02 (e) -0.4 e What is the closest to -2 in -0.1, -0.3, 4, 409730? -0.3 What is the nearest to -40610 in 1, 2/3, -40/9? -40/9 Which is the nearest to -1/2? (a) 116 (b) -6/11 (c) -25 (d) -4 (e) -5 (f) 26 b What is the nearest to -19 in -0.5, -51, -5, 32, 9? -5 Which is the closest to 0.06? (a) 15.9212 (b) -1/5 (c) 35 b Which is the closest to -4366? (a) -13 (b) -3/2 (c) 41.1 a Which is the closest to -63/8? (a) -1113 (b) -0.4 (c) -1 c Which is the closest to -1/3? (a) 10 (b) -29/9 (c) -1/5 (d) 0.9 (e) -0.4 e Which is the nearest to 10/7? (a) -2 (b) 0.1 (c) -186/11 b Which is the closest to 0.33? (a) 29 (b) 0.3 (c) 547 (d) 2 b What is the closest to -22 in 5, 89, -1/2, 0.57? -1/2 What is the nearest to 2 in -2/17, 1/2, -4/3, -5, -13/9? 1/2 What is the closest to -4 in 2, 0.3, 3/5, 4730.4, 5? 0.3 Which is the closest to 0.2? (a) -14/61 (b) -43.6 (c) -3 a Which is the nearest to 2/5? (a) -2 (b) -2471 (c) -1045 (d) 0 d What is the nearest to -2 in 3, 0.01, -569, -8, -0.3? -0.3 Which is the closest to -2? (a) 0 (b) 0.6 (c) 61 (d) 0.2 (e) -1 (f) -46 e What is the closest to -0.07 in -4/23, 0.1, 2/13, 13/4, -3? -4/23 Which is the closest to -11? (a) -0.3 (b) 3 (c) 0.1 (d) 0.08 (e) 2/77 (f) 28 a What is the closest to -2/5 in -2, -3, 134, -15.21? -2 Which is the nearest to 0.1? (a) 2/5 (b) -0.5 (c) -144 (d) -5 (e) 2607 a What is the closest to 0 in 70/19, -157, 1, 0.1, 5? 0.1 Which is the nearest to -0.3? (a) -953 (b) -0.809 (c) -3 b Which is the nearest to -1/2? (a) -0.089 (b) -1/3 (c) 4/21 (d) 0 (e) 9 b What is the closest to 4 in 97, 4, -44, 0.016, -3, 5? 4 Which is the closest to 137? (a) 0 (b) -0.1 (c) -3 (d) 16 (e) -0.092 d What is the closest to -8 in -3, 1/2, -44, 3, 110? -3 What is the closest to 2 in -9, 3/35, 38, -1/353? 3/35 Which is the closest to 0.2? (a) -1204 (b) -1/2 (c) 1295 (d) -2 b Which is the closest to -7282? (a) -1/7 (b) -23 (c) 0.06 b What is the closest to 9 in 3559, -2/3, -3, -1, -0.03? -0.03 Which is the closest to -3? (a) 710 (b) 1929 (c) -3 (d) -0.4 (e) -1 c What is the nearest to -9/2866 in 0.3, 2, 101, -2/7? -2/7 Which is the closest to -9924? (a) -10 (b) -0.13 (c) -0.5 a What is the nearest to -1 in -1855, 13/7, -2, -0.3, -0.1? -0.3 Which is the closest to -3? (a) -1/65 (b) -2.84 (c) 1.5 b What is the closest to 0.1 in 0, 5207845, -1, 6/11? 0 Which is the closest to 85.013? (a) 0.4 (b) -1/4 (c) -2 (d) -3/2 (e) -1/3 a Which is the nearest to -0.43? (a) 48 (b) -2/3 (c) 18 (d) -3.8 (e) -3 b Which is the closest to 2/3? (a) -3/8 (b) 10.7114 (c) 3 (d) -0.3 (e) 0.03 e What is the closest to 2/7 in -0.802, 2/15, 79, 2/3, 5, -8? 2/15 Which is the closest to -2? (a) 906 (b) -0.02 (c) -25 (d) 2 b Which is the closest to 100? (a) -15/8 (b) -3 (c) 476 a What is the closest to 25 in -3/8, 11.4, -2/7? 11.4 What is the closest to 1/3 in 3/5, -5, 1/20, 331? 3/5 Which is the nearest to -7? (a) 21 (b) -0.2 (c) -0.01 (d) 1 (e) -49 (f) 0.3 b What is the nearest to 0.8 in -2/9, -7/145, -4, 3, -0.4, -0.79? -7/145 Which is the nearest to -41525? (a) 4 (b) -7 (c) 24/11 (d) -3 (e) 3 b What is the nearest to -6 in -61, 4, -0.1, -0.011, -1/4? -1/4 What is the nearest to -15 in -2, 44/3, -0.018? -2 What is the closest to -0.2 in 12/7, 1520/9, 30, 0.5? 0.5 What is the nearest to -76758 in 1/2, -0.2, 4, -17? -17 What is the closest to 0 in 4, 35803, 2, 11? 2 Which is the closest to 3/1004? (a) -2/9 (b) -98 (c) -8 a What is the closest to -2/3 in 68310, 2, 0.1, 10, -1/3? -1/3 Which is the nearest to -0.02? (a) -203913 (b) -4 (c) 0.5 (d) -5 c What is the closest to 2 in 1/9, -188, 0.047, -0.6? 1/9 What is the closest to 0.2 in -33, -0.2, 1856? -0.2 Which is the nearest to 63? (a) -5 (b) -3/5 (c) 59 (d) 0 (e) 0.064 c Which is the closest to -1/5? (a) -54 (b) 0.6906 (c) 3/5 (d) -4 c Which is the closest to 0? (a) 0.09 (b) -15/8 (c) -2/57 (d) -0.07 (e) 1 c What is the closest to -15 in -0.2, -0.18, 1/8, -132/163? -132/163 Which is the closest to -0.13? (a) -2/5 (b) 15/2 (c) -6 (d) 1/3 (e) 4 a What is the nearest to -0.2 in -2/7, -1/832, 4, -0.099, -4, 0.1? -2/7 What is the closest to -3/7 in 26820, -2/9, -8/3, 18? -2/9 Which is the nearest to -445? (a) -0.3 (b) -3/7 (c) 3 (d) 0.68 (e) -0.53 e Which is the nearest to -2/5? (a) -34 (b) 1/3 (c) -0.067 (d) -2 (e) -230 c What is the closest to -0.3 in 2/311, -322, -14, -2/3? 2/311 Which is the nearest to -1? (a) -6 (b) -95 (c) -4 (d) -5 (e) 2/101 (f) 1 e Which is the nearest to -4.804802? (a) -0.3 (b) -4 (c) -1/10 b Which is the closest to 0.7? (a) -0.1939 (b) 0.26 (c) -5 b Which is the closest to -12.2? (a) -6 (b) -2.31 (c) -3 (d) 2/19 (e) 2 a What is the closest to 1 in 176, -3/5, -239, 0.09, -4? 0.09 What is the closest to -3.103 in 0.044, 1, 5, -2/17, -4/3? -4/3 Which is the closest to -501/7? (a) -2/3 (b) -21 (c) -0.02 (d) 3 (e) -0.5 b What is the nearest to 11 in -2.2624, -3/5, -2/7, 0.1? 0.1 Which is the closest to -18? (a) 1.6 (b) -1/31 (c) -1525 (d) -0.2 d What is the nearest to -2 in -110, 130, 0.3? 0.3 Which is the nearest to -32? (a) -56 (b) 2/9 (c) 106 a What is the nearest to -5/11 in 0.75, -0.08, 5, 22? -0.08 What is the closest to -5 in 15/8216, 1, -5, -1/2, 0? -5 What is the closest to 0.1 in 1/11, 443/26, -3, 1, -0.4? 1/11 Which is the closest to -2/3? (a) 2 (b) -2/19 (c) 28/77	{ "pile_set_name": "DM Mathematics" }
- 13m2 + 12m - 6. Let s(y) = y*2 - 9y + 12. Let c be s(8). Let v = c + -18. Is p(v) a multiple of 16? False Suppose -5v + 0m = 3m - 5839, 4m = 12. Is 11 a factor of v? True Let v be 4/(-26) - 756/(-182). Let u(h) = h3 - h2 - 8h - 2. Does 12 divide u(v)? False Let m(g) = g3 + 9g*2 - 13g - 4. Let j(y) = -3y3 - 27y*2 + 39y + 12. Let s(z) = -4j(z) - 11m(z). Suppose -31x - 278 = 32. Is 6 a factor of s(x)? False Let p be (-4)/(-34) + (-18)/153. Is (p - (-80)/(-15))/(6/(-9)) a multiple of 2? True Suppose -2h + 391 = -45. Let q = h + -99. Is q a multiple of 30? False Suppose 4 - 4 = 2z. Suppose z = -3c - 6, -7c + 12c + 874 = 4d. Is d a multiple of 19? False Let o(m) = 0m*2 + 6 - 3m*2 - 9 + 5m*2 + 2m*2 - 3m. Let d = 3 - 6. Is o(d) a multiple of 14? True Suppose -64s = -24510 - 14850. Does 15 divide s? True Let n(l) = 3l*2 - 2 - 2l - 9l2 + 7l*2. Let f be n(3). Let r = 35 + f. Does 20 divide r? False Let w = 52 + -49. Suppose wf + 36 = 150. Is f a multiple of 5? False Suppose -9t + 38816 = 11447. Does 9 divide t? False Suppose -72l + 6889 = 409. Is l a multiple of 32? False Suppose 2q = 7q - 75. Suppose 0 = n - 3h - q, -2n = -3h - h - 38. Suppose -11w + 8w = -n. Does 3 divide w? True Let h be (13 + -1)(-4)/6. Let q = h + 60. Suppose -6d + d = 3c - 54, 2c - 2d - q = 0. Is c a multiple of 12? False Suppose -3c = c. Suppose c = -37h + 35h + 20. Is 5 a factor of h? True Suppose -s - 22 = 8. Let h = s - -114. Is 28 a factor of h? True Suppose 3g + 4t = -61 + 630, 0 = 3g - 3t - 597. Is g a multiple of 65? True Suppose 0f - 70 = -2j + 2f, 2j - 79 = -f. Is j a multiple of 3? False Let r be (-4)/((-91)/336 + (-1)/(-3)). Let i = r + 90. Is 26 a factor of i? True Let a(q) = q2 - 4q - 2. Let k be a(5). Let f = k - -41. Is f a multiple of 8? False Let l = 223 + 105. Suppose -4s - l = -48. Let o = s + 110. Does 20 divide o? True Suppose 489 = -6s + 7569. Is s a multiple of 20? True Let a be (0 + -2)(-19)/(-19). Let i(y) = 4y*2 - 2y - 3. Is 17 a factor of i(a)? True Suppose 3k + 5o + 54 = 0, 7o = -4k + 4o - 61. Let p(g) = -g + 9. Is p(k) even? True Let g = -791 - -7010. Is 17 a factor of g? False Suppose -5 + 21 = 4u. Suppose 4x = -3w, -3x + uw + 31 = 2x. Suppose -xl - l + 100 = 0. Does 5 divide l? True Suppose 150 = 12r - 17r. Does 4 divide (-20)/(-6)(-108)/r? True Let d(y) = -258y + 3. Let z be d(-3). Suppose -1293 = -5h - v, -2h + z = h + v. Suppose 4g - 4u = 200, -5g + u = -0g - h. Is 27 a factor of g? False Let c(v) = -v*3 - 7v*2 - 5v + 12. Suppose -170z + 171z + 8 = 0. Is c(z) a multiple of 29? True Let l = 18 - 22. Let i be ((-8)/10)/(l/40). Suppose -105 = 3j - ij. Does 9 divide j? False Let z = -342 + 497. Is 9 a factor of z? False Let t = 0 + 42. Let b = -9 + t. Does 33 divide b? True Suppose 10 = -3g - g + 3s, 3s = -4g - 22. Let p be (-144)/(-40) + g/(-10). Suppose 2k - 10 = -p. Is k a multiple of 2? False Let q(l) = -l2 - 11l - 5. Let z(p) = -3p2 - 23p - 10. Let v(g) = 5q(g) - 2z(g). Let b be v(6). Let n = 7 - b. Is 15 a factor of n? True Let t = -251 - -539. Let v = t - 171. Is 6 a factor of v/12 - 1/(-4)? False Let u(o) = -o*2 - 22o + 25. Let q be u(-23). Does 3 divide 5/(-10)q4/(-1)? False Is 6 a factor of (-1680)/(-40) - (-10)/2? False Suppose 0 = -2h + 3 + 7. Let v = -73 - -154. Let g = h + v. Does 19 divide g? False Let g(h) = 74h - 8. Let k be g(2). Suppose 7u = 2u + k. Is 14 a factor of u? True Let q = -127 + 15. Let n = -35 - q. Does 7 divide n? True Let j = 124 - -136. Let v = -184 + j. Let d = 109 - v. Is 10 a factor of d? False Suppose 0j = -5x + 3j + 19, 4x = 3j + 14. Let t be 2/10(29 - 4). Suppose -p - xb = -29, -tp = b - 23 - 26. Does 2 divide p? False Let m(l) be the first derivative of -l6/12 + l5/20 + l4/24 - l3/6 - l*2 + 9. Let j(y) be the second derivative of m(y). Is 28 a factor of j(-2)? False Suppose 0h - 15 = 3h, -3h = 4i - 269. Does 13 divide i? False Let u(n) = 12n3 + n2 - 2n + 1. Suppose 1 = 3c - o, c - 4o - o + 9 = 0. Let k be u(c). Let t = k - 2. Does 10 divide t? True Let w(c) = c3 - 10c*2 - c + 10. Let b be w(10). Suppose br + 4r + 458 = 3o, -2o + 306 = -2r. Is o a multiple of 14? True Suppose 8a + 182 = 710. Is a a multiple of 13? False Suppose 15x + 10 = 13x. Let h(i) = i3 + 10i*2 + 2i + 5. Does 16 divide h(x)? False Let m(p) be the first derivative of -1/2p2 + 1/3p*3 - 4 + 5p. Is m(-6) a multiple of 16? False Let u be 10/(-75) - 34/(-30). Let a be u/5 - (-99)/55. Suppose -4g + 5g + 56 = ap, -3g = -3p + 78. Is 8 a factor of p? False Let h(o) = 10o - 4. Let p be h(-3). Let s(x) = -x*2 + 4x + 8. Let f be s(8). Let t = f - p. Is t a multiple of 5? True Let x = 26 - 13. Is 12 a factor of x - -6 - 3-1? False Suppose 2c = 2i - 8, -2c - 3 = c. Suppose 2v - 3v - 5a = -7, a = -v + i. Suppose -10s = -vs - 200. Does 7 divide s? False Let m(g) = -4g + 1. Let h be m(-1). Suppose 5t + hz - 76 = -16, -2 = 2z. Does 10 divide t? False Suppose 0 = -20x + 1279 + 3921. Is x a multiple of 13? True Let v be (9/(-6))/(-3(-2)/(-8)). Suppose 195 = r - 0u + vu, -3u = -4r + 802. Is r a multiple of 28? False Let b(x) = 3x - 3. Let w be b(1). Suppose w = 4v - 79 - 29. Is v a multiple of 9? True Let q(f) = f2 + 16f + 21. Let t be q(-12). Does 29 divide t/(-216) + 927/8? True Suppose -2 = 2f - 0f - 2o, 4o = -5f - 32. Is (-78)/f(-8)/(-6) a multiple of 13? True Suppose -2l = -2n - 3172, 2l - n + 3n - 3192 = 0. Does 29 divide l? False Let b = 0 + -9. Is 5 a factor of -2 + 55 + (-18)/b? True Let q = -3148 + 5651. Does 16 divide q? False Let f(q) = -2q - 5. Let u be f(-13). Let b = u + -21. Suppose -4c - 4o = -68, b = -o + 5 - 2. Is 14 a factor of c? True Suppose -2s - 5g = -829, -5s + 2g = -3g - 2020. Is 19 a factor of s? False Suppose -3a + 118 = -299. Does 9 divide a? False Let y(z) = 17z*2 - z - 2. Let f be y(-1). Suppose -106 - 58 = -3i - 2n, f = 4n. Does 13 divide i? True Suppose 9566 = -13p + 33408. Is 56 a factor of p? False Suppose -4a + 2p + 1794 = 0, 6a + 0p - 2697 = p. Does 20 divide a? False Let z be 2/(-8) - 545/(-20). Let b = -19 - -36. Suppose -z = -2i + b. Is 17 a factor of i? False Suppose -4l - 9 = -3y + 17, 2l + 10 = y. Let b be y2/(-4) - -28. Suppose i + 5 = 2v, -2v + i = -6v + b. Is v even? False Let v(k) be the second derivative of k7/2520 - k6/180 + k5/24 - 5k*4/12 + 2k. Let f(x) be the third derivative of v(x). Is f(5) a multiple of 5? True Let x(c) = -10c - 1. Let y be x(-5). Let z = 97 + y. Is 9 a factor of z? False Let q(g) = -g - g + 3g. Let k be q(-11). Let d = 63 + k. Is d a multiple of 26? True Let f(o) = 631o2 + 633o*2 - 1263o*2 - o + 29o3. Let k(l) = -l2 - 4l - 3. Let h be k(-2). Is 6 a factor of f(h)? False Let i(q) = q2 + 8q + 14. Let g be i(-11). Let h = 98 + g. Suppose 2d = v + h, -7v = -5d - 2v + 350. Is d a multiple of 17? False Let z(y) be the first derivative of -y3/3 + y2 + 6y + 5. Let a be z(3). Suppose -4r + 232 = -0r + al, 0 = r - 2l - 47. Is 11 a factor of r? True Let d(n) = -3n - 7. Let r be d(-1). Let k(j) = j*3 + 2j*2 - 12j - 10. Is k(r) a multiple of 6? True Let g = 3604 + -1976. Does 11 divide g? True Suppose 5i - i - 12 = 0. Suppose 3c = 5q - 365, 0q - iq - 2c = -200. Does 35 divide q? True Let g(b) be the second derivative of b*4/12 - 11b*3/6 + 7b*2 + 8b. Let r be g(10). Suppose 0x + x = 5v - 362, -r = 2x. Is 19 a factor of v? False Suppose 5p = 1060 - 80. Suppose 2j + p = 2r, r - 131 = 5j - 25. Is 12 a factor of r? True Suppose 23253 - 4173 = 30v. Is 114 a factor of v? False Let a be 2(3 - -3)4. Does 15 divide a + 5 - 6/3? False Let o(x) = x*3 - 37x*2 + 71x + 22. Is o(35) a multiple of 8? False Is 6 a factor of -3(-2)/(-18)(0 - 156)? False Let i = -61 + 173. Suppose 4r = 5p + 142, 2r - p = -r + i. Is 19 a factor of r? True Suppose -8 = 4v, 5h + 8v = 11v + 3341. Is h a multiple of 29? True Suppose 4s - r - 2944 = 3r, -5r + 1500 = 2s. Suppose -2g + s = 2g. Is g a multiple of 49? False Suppose 20c + 13246 - 92286 = 0. Does 15 divide c? False Suppose 101 = 4*n + 33	{ "pile_set_name": "DM Mathematics" }
Solve -5h + 1788 = -29h - 2o + 1458, -2h + 3o = 37 for h. -14 Solve -l + 0w + 60 = -7w, -l - 7401w + 40 = -7404w for l. 25 Solve 0 = 5x - 2q - 7, 209x - 215x - 2q + 26 = 0 for x. 3 Solve 4t = -t - 10q + 8q - 47, 4t - 30 = q for t. 1 Solve 5m + 33 = b, 6b + m - 99 = 3b + 6m for b. 33 Solve 0 = -4i - 183k + 182k + 144, 2i - 90 = -5k for i. 35 Solve -83n = -82n - 4, 0u - 2n = -3u + 7u - 96 for u. 22 Solve 0l = -4c + 3c + 3l + 12, -382c + 388c = 6l + 60 for c. 9 Solve 3w + 930 - 973 = 5o, -2o - 22 = -2w for w. 6 Solve -f = -0f + 6, -3a - 13f - 11f - 2 = -22f + 10 for a. 0 Solve 13l = 4o - 459, 69112o = 6l + 69111o + 211 for l. -35 Solve -6t + 62 = -4j - 0j, -6j - 104 = -84t + 86t for j. -17 Solve 229q + 457 = u + 239q, -3q = -8u - 162 for u. -3 Solve 2a + 4005 - 3970 = 3s, -3s + 5a + 47 = 0 for s. 9 Solve 20 - 77 = -3j + 3y, y + 4 - 5 + 16 = 0 for j. 4 Solve 5g - j - 12 = 4j - 62, -2j + 12 + 2 = 0 for g. -3 Solve -7x - 138 = y, -20y + 95x + 100 = 92x for y. 2 Solve 0 = -3c + 5r - 43, -128c + 3495r - 11 = -133c + 3493r for c. -1 Solve -7316b - 330 = -21h - 7332b, 2b + 96 = 5h for h. 18 Solve -3w = 66, 40j - 15j = 24j + 5w + 47 + 63 for j. 0 Solve -88t + 884 = -2274s + 2278s, -2s = t - 12 for t. 10 Solve 11 = -3f - 2a, -3452f + 56 = -3492f - 4a for f. -1 Solve 26h = -2y + 24, 247h = 252h + 4y - 1 for h. 1 Solve 5w = -90j + 95j + 120, 0 = -20w + 17w + 5j + 114 for w. 3 Solve 60a - 60a - 2m - 3m = -0m + 25, -2m + 62 = -8a for a. -9 Solve 0 = -3u + u - 5m, 0 = 3u - 6u + 22m + 59 for u. 5 Solve -14l = -8m - 13l - 149, 64m + 3l + 1225 = 0 for m. -19 Solve 5d - 109 + 18 = 24t, -6t - 27 = -3d - 6 for d. -1 Solve 4z + 2p = -923 + 457 + 426, -18p = -5z + 524 for z. 4 Solve -2m = -5s - 150, -114s = -m - 72s + 1260 for m. 0 Solve 0x + 3w = -3x + x, -5x - 413w = -412w for x. 0 Solve 0 = 4p - 0o + 3o + 16, -204 = 582p - 676p + 2o for p. 2 Solve 3o = -727b + 730b - 12, 0 = 23o + 2b - 8 for o. 0 Solve 8x - 38 = 175n - 173n, 4n - x + 2x = -76 for n. -19 Solve 3o - k - 19 = 0, 0o - 7o + 18o = 2o - 5k - 1 + 50 for o. 6 Solve 6n + 5k + 51 = 0, -2n + 2714k - 2790k = 240 for n. -6 Solve 198a - 199a = -j + 2, -2a = -4j + 10 for j. 3 Solve 5v - 2 = v - i, -650v - i = -649v - 2 for v. 0 Solve -3629h - 5v = -3624h - 110, -2h + v = -53 for h. 25 Solve -209k + 424k + 2w + 1 = 214k - 6, 22k = -w - 240 for k. -11 Solve -p = 4k - 1, 71828 = k + 8p + 71758 for k. -2 Solve 10d - 4g - 50 = -132, -5d - 2g - 20 - 12 = 17 for d. -9 Solve 3w = 4n - 22, -5n + 570 = -7n - 9w - 31w for n. -5 Solve 26p = -2j + 114, j + 31 = -4p + p - 36 + 84 for p. 4 Solve -5c - 5556h = -5552h, -c = -3h for c. 0 Solve 6y - 9g + 16g = 7g + 6g + 54, -31 = -3y + 6g + 8 for y. 5 Solve -11734d + 11725d = 3g - 249, 4g + 5d = 143 for g. 2 Solve -9p + 1 = -z, 1 = 5p + 4z + 3 + 43 for p. -1 Solve 0 = -2p - 4d, 402069p + 34d - 88 = 402074p for p. -4 Solve 458x + 1172 = 2q - 680, 117 = -3x + 5q + 55 for x. -4 Solve -104o + 101o + 18 = -2h, -19 = -3h + h - 78o + 449 for h. 0 Solve -69 = 12o - 3a, o + a - 12 - 3 + 17 = 0 for o. -5 Solve -2n + 3 - 79 = 2g - 22n, 5g - 3n + 49 = 0 for g. -8 Solve -19858 = -1417b - 4n, 23998n - 9 = -b + 23999n for b. 14 Solve 15a + 10a - 4d + 106 = 21a + d, 2d = -0d + 36 for a. -4 Solve 0z + 3z + 9n = -48, 33z = 13z - 2n - 146 for z. -7 Solve 3m - 76 = -66g + 71g, m - 42 = 5g for g. -5 Solve 10c - 6 = -4h + 4, 43695c - 43694c - 1 = -4h for c. 1 Solve -19 = -5z - 2f - 15, -2z = f - 32 + 31 for z. 2 Solve 125 = -9p + 4g, -5p - g - 3169383 + 3169320 = 0 for p. -13 Solve 33a = 5g - 76 - 34, -7a = -4a - 2g - 0g + 44 for a. 0 Solve 0 = 3z - 4g - 102, 10z - 491g = -494g - 52 for z. 2 Solve -4u + u - 8 - 23 = 2n, 36n - 12 - 77 = -3u - 392 for n. -8 Solve -3v - 5h = 2v - 128 - 12, -22h + 491 = 7v + 10v for v. 25 Solve 0 = 87m - 2a + 91, -24m + 13m + 12m + 5a = 9 for m. -1 Solve 5w = u - 86 + 81, -2u + 23 = 3w for w. 1 Solve k = -n - 20, 788883n - 4k - 58 = 788886n for n. -22 Solve y - 7j = 7y + 4j - 1176, 2y = 2y + 4j - 432 for y. -2 Solve -49 + 22 = -3g - 8f - 28, -f = -5g - 16 for g. -3 Solve 0 = 3x - 9y + 117, -4x + 844y = 839y + 177 for x. -48 Solve -8o - 2c + 28 + 13 = 1, -5o = -18c + 52 for o. 4 Solve 3c - 4i + 76 + 49 = 0, 352c - 348c + 204 = -4i for c. -47 Solve -3b - n + 3 - 11 = 0, 4b + 15n = 16n - 6 for b. -2 Solve 41o + 14 = 39o + 3h, -82o - 72 - 266 = -5h for o. -4 Solve -516442 = -5z - 3n - 516717, -291 = -3z + 2n + n for z. 2 Solve 0 = 3t - 2k + 102, -3k + 4134 = -3t + 3981 for t. 0 Solve 2j + 4b + 2 = 0, -3j + 8 = 15b - 3 + 14 for j. -1 Solve -22d = v - 26d - 53, 0 = -2v + 41d + 37d + 456 for v. 33 Solve 2 = p, -16x + 83p - 66 = 66p for x. -2 Solve 10r - 72 = 6r - 4i, r + 8 - 46 = 3i for r. 23 Solve 2l + w + 27 - 4 = 0, -47l - 3w = -48l - 22 for l. -13 Solve -x - 11w + 12 = 0, -1478x + 1475x + 2w - 69 = 0 for x. -21 Solve -6m - 2c = 24, 575904c + 31 = -5m + 575906c for m. -5 Solve -2x + h + 55 = 0, 142665x + h + 111 = 142669x for x. 28 Solve 945o - 18k = 1895o - 946o + 44, 3k = 2o - 26 for o. 7 Solve 456d - 452d - 76 = p, -5p = -2d + 56 for p. -4 Solve -2u + 2p = 20, 3p = -565u + 566u + 14 for u. -8 Solve -2t = -t - 2u - 21394 + 21445, 4t + 2u = -174 for t. -45 Solve -71769j + 35883j = -35879j + 3r + 9, -3j - 6 = 2r for j. 0 Solve -c + 3 = -7m + 19m, -c + 48 = 11m - 14m for m. -3 Solve 2n = -0x - 5x + 69, -26n = 17n - 45n - 45x + 669 for n. -3 Solve -30c = 8u - 32c - 94, 2u - c - 39 = 0 for u. 4 Solve 4n - 184 = 0, 269n = 3t + 549n - 275n - 236 for t. 2 Solve 0 = v - 10n + 18, -7v - 2n + 8 = -13 + 3 for v. 2 Solve -39366s = 4j - 39256s + 436, -5s - 24 = -4j for j. 1 Solve 76 = -22d + 26d + 4j, -4d + 51j = 749 for d. 4 Solve 0 = 5n + g - 50, 603n - 602n = -44g + 10 for n. 10 Solve 2w = 2f - 18, 1474w + 6f - 99 = 1471w for w. 5 Solve -15x + 5g = 15, 2x + 3g - 2837392 = -2837438 for x. -5 Solve 7q - 4a = 11q + 92, -q - 5a = -0a + 59 + 36 for q. -5 Solve 128972k + 2q = 128967k - 65, 2k = -4q - 42 for k. -11 Solve 3f = -7z - 2, 5468f - 5463f = -2z - 13 for f. -3 Solve d + 20 = w - 4d, 4w - 3317d = -3313d for w. -5 Solve 96z - 56 = 94z + 2c + 22 + 42, -4z + c = -243 for z. 61 Solve -3q + 4v - 20 - 20 = -0q, 0 = -2q - 17v + 52 for q. -8 Solve -3p + 5 = -4m, -1862p + 6 = 12m - 1864p for m. 1 Solve -5p = -5v + 45, 232v - 231v = -2p + 5p + 23 for v. 2 Solve 9q = 2r - 11, 7r - 2q + 0q + 5q + 422 = 357 for r. -8 Solve 5y - 23770w + 90 = -11888w - 11883w, -3y = -4w + 54 for y. -18 Solve 5d + 1432n = 1436n - 137, -3d = -8n + 239 for d. -5 Solve 33n + 125 = 8n - 2t - t, 28 + 188 = 16n - 4t for n. 1 Solve -2g - 8 = -y - 5 + 4, 22g - 10g + 15y - 21 = 0 for g. -2 Solve -4f + 177 = 3b + 153, 3b - 12 = -2f + 6 for f. 3 Solve 13q = 15q + 24q + 5u + 157, -1 = -2q - 3u - 0 for q. -7 Solve 13k + 50 = 13k - 5j, -2j - 39 = -3k + j for k. 3 Solve -6 + 9 = -4y + 2q - 99, -6q - 6 = y for y. -24 Solve 213d = -717o + 715o - 498, -d - 4o + 34 = -5o for d. -2 Solve v - 3u = -66, 245765v - 245764v + 9u = 198 for v. 0 Solve -8 = 11w - g + 27 - 10, 9w - 23g + 24 = -21g for w. -2 Solve -256 = -16z, 3873z - 3871z - 29 = 3f for f. 1 Solve b + 5 = 0, 315b - 310b + 619 = 27m for m. 22 Solve -c + 5292 = -4q + 5312, -26c - 2q + 10 = -27c for c. 0 Solve -k + 330 = -5p, -231 = 3p - 39k + 45k for p. -67 Solve -3f - 1498 = -2f - 0f - 4z - 1491, -5f = 2z + 101 for f. -19 Solve t = 18i + 288, 5i - 4t + 48 = -23 - 9 for i. -16 Solve -3a - f - 4f - 266 = 0, 10a - 11a = -2f - 113 for a. 3 Solve -58t - l - 24 = -61t, -119t + 640 = 3l - 8l for t. 5 Solve -54g = 4u - 55g + 45, -u = 3g + g - 180 for u. 0 Solve -4z + 12f - 28 = 0, z + 1892f + 0 = 1889f + 11 for z. 2 Solve -2l - 9u + 6u + 73 = -10l, -l - 12u + 9u = -1 for l. -8 Solve -3b = 2n - 5	{ "pile_set_name": "DM Mathematics" }
+ 0 + 0 + 131q. 33q Collect the terms in 2y3 - 7y*3 + 2y*3 + 2y3. -y3 Collect the terms in 58h2 + 1 - 1 + 14h*2. 72h*2 Collect the terms in -19h*2 - 35h*3 + 19h*2 + 37h*3. 2h*3 Collect the terms in 5138 + 4a*2 - 5138. 4a*2 Collect the terms in -7 + 7 - 2q. -2q Collect the terms in -33r*2 + 0 + 0 + 13r*2 + 25r*2. 5r*2 Collect the terms in 53t - 26t - 27t - t3. -t3 Collect the terms in 68k3 - 310k*3 + 112k*3. -130k*3 Collect the terms in 2i*2 + 41i*2 + 53i*2. 96i*2 Collect the terms in 12y*2 + 9y*2 + 9y*2 - 25y*2. 5y*2 Collect the terms in 98s*3 - 195s*3 + 117s*3. 20s*3 Collect the terms in 31 + 36 - 67 - 4q*3. -4q*3 Collect the terms in 96 + 7j*3 - 96. 7j*3 Collect the terms in 71y - 7y2 - 3 - 142y + 71y. -7y*2 - 3 Collect the terms in -3c3 - c2 + 2c2 + 52c*3. 49c3 + c2 Collect the terms in 5n + 2n - 12n. -5n Collect the terms in -7w2 + 177 - 89 - 88. -7w*2 Collect the terms in 3 + 0t + 9 - 44 - 4t. -4t - 32 Collect the terms in -149c3 - 147c*3 - 140c*3 + 470c*3. 34c*3 Collect the terms in -34q*2 + 7q*3 - 29q*2 + 63q*2. 7q*3 Collect the terms in 3v*2 + 2v - 2v. 3v*2 Collect the terms in -22a*2 + 9a*2 + 7a*2 + 10a*2. 4a*2 Collect the terms in 4t*3 + 3t*3 + 0t*3 + 0t*3. 7t*3 Collect the terms in -15m*3 + 20m*2 - 20m*2. -15m*3 Collect the terms in 2d + d - 3d - 32d*2. -32d*2 Collect the terms in 2b + 25b - 3b - 11b. 13b Collect the terms in -37l - 32l + 58l. -11l Collect the terms in 42o2 - 2o*3 - 2o*3 - 42o*2. -4o*3 Collect the terms in 31w - 57w + 29w. 3w Collect the terms in 2i*3 - 20076i + 20076i. 2i*3 Collect the terms in -149 + 149 - 6z. -6z Collect the terms in 3 + 4 - 7 + 4o. 4o Collect the terms in -22r - 17r - 24r + 78r - 16r. -r Collect the terms in 125k3 - 126k3 + k - k. -k3 Collect the terms in -5c + 5c + 6c + c. 7c Collect the terms in -187g + 68g + 51g + 66g. -2g Collect the terms in 134h*3 - 280h*3 + 137h*3. -9h*3 Collect the terms in -5h + 21h + 11h. 27h Collect the terms in 280q*2 + 6 - 6. 280q*2 Collect the terms in -26c*2 - 2 + 21c*2 + 2. -5c*2 Collect the terms in -8c*3 - 86c*3 + 5c*3. -89c*3 Collect the terms in 7x + 10 + 2x - 3x. 6x + 10 Collect the terms in -2c*2 - 2 - 14c + 2. -2c2 - 14c Collect the terms in 2u2 + 36u*3 + 31u*3 - 6u3 - u3. 60u3 + 2u*2 Collect the terms in -184a - 195a + 387a. 8a Collect the terms in -702u - 11 - 6u2 + 702u + 11. -6u2 Collect the terms in -143q + 15q - 4q. -132q Collect the terms in 39q - 21q - 16q. 2q Collect the terms in 624y - 3 + 2 + 2 - 3. 624y - 2 Collect the terms in 19d + 12d2 - 10d*2 - 19d. 2d2 Collect the terms in -7 - 14 - 3k*2 + 21. -3k*2 Collect the terms in -32k2 - k3 + 24k2 + 8k2. -k3 Collect the terms in 6896 + 11a - 6896. 11a Collect the terms in 0t2 - 11t*2 + 34t*2 + 3t*3. 3t*3 + 23t*2 Collect the terms in -x + 9x - x. 7x Collect the terms in -7n - 81n2 + 7n. -81n2 Collect the terms in 19l*2 - 10l*2 - 13l*2. -4l*2 Collect the terms in 30z - 97z + 32z + 31z. -4z Collect the terms in -9c2 + 6c2 + c2 - 3c2. -5c2 Collect the terms in v3 - 7v3 + 8v*3. 2v3 Collect the terms in 11 - 22 - t3 + 11. -t*3 Collect the terms in 13q - 13 - 11q + 2. 2q - 11 Collect the terms in -11q + 15 - 15 + 10q + 7q. 6q Collect the terms in -l*2 - 2l*2 - 5l*2 + 5l*2. -3l*2 Collect the terms in -4 + 4 - 16u*3 - 4u*3. -20u*3 Collect the terms in -8t - 10t - 2t*2 + 9t + 9t. -2t*2 Collect the terms in 5r*3 - 2r*3 - 2r*3 + 2r*3. 3r*3 Collect the terms in -17a + 23a2 - 22a*2 - 19a + 36a. a2 Collect the terms in -42y*3 + 46y*3 + 91y*2 - 91y*2. 4y*3 Collect the terms in 32i*2 - 60i*2 + 26i*2 + 4i - 4i. -2i*2 Collect the terms in 0 - 27b + 0 + 2. -27b + 2 Collect the terms in 5c*2 - 126c + 126c. 5c*2 Collect the terms in -58l + 163l - 47l - 56l. 2l Collect the terms in 9n2 + 3n*2 - 2n*2 + 0n*2. 10n*2 Collect the terms in -5 - 36j + 5. -36j Collect the terms in 3w - 3w + 32w*2 - 34w*2. -2w*2 Collect the terms in 2l - l - 17l. -16l Collect the terms in 16b2 + 27b*2 + 11b*2 + 14b*2 - 94b*2. -26b*2 Collect the terms in -2p*2 + 2p*2 + 1332p*3 + 2p*2. 1332p*3 + 2p*2 Collect the terms in -16p*2 - 186198 + 186198. -16p*2 Collect the terms in 2b + 10b - 12b - 31b2. -31b*2 Collect the terms in -9b + 16b - 82b. -75b Collect the terms in -5 - 19l*3 + 2 + 5l*3 + 3. -14l*3 Collect the terms in -5f - 8f2 + 5f + 3f2. -5f2 Collect the terms in -y2 + y*2 + 4y*2 + 0y*2. 4y*2 Collect the terms in -97l + 21l + 163l. 87l Collect the terms in -5l - 5l + 24l - 12l. 2l Collect the terms in 2y2 - 2y + y + 2y - y. 2y*2 Collect the terms in 14s - 11 - 14s + s2. s2 - 11 Collect the terms in -2p*3 - 2p*3 + 8p*3. 4p*3 Collect the terms in -3q*2 - 72q + 26q + 33q + 13q. -3q*2 Collect the terms in 12i + 3i - 7 + 0 + 9i. 24i - 7 Collect the terms in 3v + 0v - v - 55. 2v - 55 Collect the terms in 5g2 + 0g*2 + 2g2 + g2. 8g2 Collect the terms in -59d - 200d - 78d. -337d Collect the terms in 11t*2 + 27t*2 - 12t*2 + 9t*2. 35t*2 Collect the terms in -3c*3 - 14c*3 - 16c*3. -33c*3 Collect the terms in 2a2 + a3 - 2a2. a3 Collect the terms in -74g*2 - 70g*2 + 211g*2 - 67g*2 - 6g*3. -6g*3 Collect the terms in 4v + v - 6v - 389. -v - 389 Collect the terms in 17g + 15g + 4g. 36g Collect the terms in -8k*2 - 5k*2 - 14k*2 + 22k*2. -5k*2 Collect the terms in 2c + 5c - 4c + 17c2. 17c*2 + 3c Collect the terms in 9062 - 3p - 9062. -3p Collect the terms in -28n3 - 9n*3 + 36n3. -n3 Collect the terms in 61 + 34 + 30 + v. v + 125 Collect the terms in -291d + 151d + 139d. -d Collect the terms in -1894 - 16b + 0b + 1894. -16b Collect the terms in -25g2 - 588g*3 + 584g*3 + 25g*2. -4g*3 Collect the terms in 5y + y - 6y2 - 6y. -6y2 Collect the terms in -i3 - 19i + 19i + 6i*3. 5i*3 Collect the terms in 5 + 36c*3 + 24c*3 - 5. 60c*3 Collect the terms in -4t*2 + 673 - 673. -4t*2 Collect the terms in 13r*3 + 14r*3 + 7r*3. 34r*3 Collect the terms in 5q*2 + 86 - 41 - 45. 5q*2 Collect the terms in 2x - 32x - 11x. -41x Collect the terms in -4417i - 46 + 46. -4417i Collect the terms in -926v + 25v2 - 22v*2 + 926v. 3v2 Collect the terms in -15b*3 - 10b*3 + 39b*3 - 15b3. -b3 Collect the terms in 34a2 - 53a*2 - 4a*2 - 47a*2. -70a*2 Collect the terms in 10x*3 - 2x*3 - 3x*3 - 9x*3. -4x*3 Collect the terms in 48t - 184t - 22t. -158t Collect the terms in 2 - 2 - 501i. -501i Collect the terms in 52r + 85r - 4r. 133r Collect the terms in 328 + 4n - 328. 4n Collect the terms in p2 + 43859 - 43859. p2 Collect the terms in 12z - 12z - z2 - 3z + 3z. -z2 Collect the terms in -2 - 7t - 24 - 17. -7t - 43 Collect the terms in 1138 - 1138 - 6t*3. -6t3 Collect the terms in h3 + 3h3 + 3h*3 - 2h - 10. 7h3 - 2h - 10 Collect the terms in -8 + 7 + 1 + 7t2. 7t*2 Collect the terms in 2f*3 - 10181f*2 + 10181f*2. 2f*3 Collect the terms in -115m*2 + 73 + 119m*2 - 73. 4m2 Collect the terms in y2 - 2788100 + 2788100. y*2 Collect the terms in 3d - d - 5d - d. -4d Collect the terms in -4 - 60y2 - 442y*2 + 4. -502y*2 Collect the terms in -29o*2 + 34o*2 + 0o*2. 5o*2 Collect the terms in 9u*3 + 341u - 340u - u3. 8u*3 + u Collect the terms in -15f*3 + 2f*3 - 10f*3. -23f*3 Collect the terms in 8h + h - 4h. 5h Collect the terms in 0 + 8p3 + 8 - 9p3 - 8. -p3 Collect the terms in -256k2 + 256k*2 - 31k*3 + 29k*3. -2k*3 Collect the terms in 162 + 23i*2 - 80 - 82. 23i*2 Collect the terms in -5d + 398 - 398. -5d Collect the terms in -4c*3 + 3c*3 + 10c*3. 9c**3 Collec	{ "pile_set_name": "DM Mathematics" }
54798159 + p. 39p2 + p - 2 Collect the terms in -962937q - 850567q - 9 + 9. -1813504q Collect the terms in 495251m + 4m*2 - 495251m. 4m2 Collect the terms in 0x + 8975329x3 + 0x - 8973251x3. 2078x*3 Collect the terms in 2014622w*2 + 6241w*2 + 220933w*2. 2241796w*2 Collect the terms in -110 - 16 + 27 - 13410t. -13410t - 99 Collect the terms in -17532x*3 - 243x - 235x + 717x - 239x. -17532x*3 Collect the terms in 13 + 21 - 34 + 20795n*2. 20795n*2 Collect the terms in -560234s + 1120616s - 560377s. 5s Collect the terms in 69257z*2 - 35219z*2 - 35185z*2. -1147z*2 Collect the terms in -14 + 14 - 11141409s + 11141409s + 18s*3 + 12s*3. 30s*3 Collect the terms in 13867s - 28453s + 13703s. -883s Collect the terms in -5 + 2012p*2 + 3 + 185p - 185p. 2012p*2 - 2 Collect the terms in 16 - 15 - 12p + 1 - p. -13p + 2 Collect the terms in 593f*3 - 6225f*3 - 7464f*3. -13096f*3 Collect the terms in 1492195q - 4 + q*2 - 1492195q + 336q3 + 4. 336q3 + q2 Collect the terms in 6964u - 9 - 11 - 12 + 33 - 6960u. 4u + 1 Collect the terms in -1693i*2 + 361 + 2072i*2 - 182 - 179. 379i*2 Collect the terms in -38261h + 77325h - 37872h. 1192h Collect the terms in 3360d*3 + 3456d*3 + 0d*2 + 0d*2 - 4482d*3. 2334d*3 Collect the terms in 29 + 1145x*3 - 539x*3 - 29 + 2123x*3. 2729x*3 Collect the terms in 19y*3 - 27y*3 - 358027 - 38y*3 + 358027. -46y*3 Collect the terms in -4 - 1038p + 4 + 1 + 3152p - 1050p - 1041p. 23p + 1 Collect the terms in -446 + 203 - f*2 + 10f*2 + 6f*2 - 18f*2 + 243. -3f*2 Collect the terms in -790790m - 115252m - 11653m - 415948m. -1333643m Collect the terms in -3972x + 672x + 3 + 914x - 3. -2386x Collect the terms in 3678b2 - 54b*3 - 135358b - 3 + 135358b - 3678b*2 + 3. -54b*3 Collect the terms in 42u - 104527u3 + 104525u*3 + 5u. -2u3 + 47u Collect the terms in 4704 + 24t2 + 4617 - 9328 + 15t*2. 39t*2 - 7 Collect the terms in -y + 0y*3 - 2y*3 + 2y3 + y3 + 362 - 728y2. y3 - 728y*2 - y + 362 Collect the terms in -3353 + 1111 + 4f*2 + 1032 + 1099 - f. 4f*2 - f - 111 Collect the terms in 112b + 38b - 873 + 247b + 873. 397b Collect the terms in 4848q + 445 - 223 - 222. 4848q Collect the terms in 57 - 13 - 99045p - 34 - 10. -99045p Collect the terms in -25 + 3a*2 + 58 + 2408a*3 - 34 - 3a*2. 2408a*3 - 1 Collect the terms in -1962576 + 217l + 1962576 - 1851l. -1634l Collect the terms in -6z - 518z*2 - 44z - 43z + 524z*2. 6z*2 - 93z Collect the terms in -1825a3 - 219009 + 219009. -1825a*3 Collect the terms in -240f + 127f + 127f*2 + 116f. 127f2 + 3f Collect the terms in 91 - 56814715b - 56814715b + 113629431b. b + 91 Collect the terms in 28663b - 69042 + 69042. 28663b Collect the terms in 50b - 25b - 135 + 36b + 6645. 61b + 6510 Collect the terms in 506867037934 - 506867037934 - 18y*3. -18y*3 Collect the terms in -1 + 1 - 962i*2 + 5016258i + 5016265i - 10032523i. -962i2 Collect the terms in -98 - 59y*2 - 93 - 101 - 91 + 385. -59y*2 + 2 Collect the terms in 7192544t - t*3 + 66t*3 - 7192544t. 65t3 Collect the terms in -32g - 2293 + 4589 + 38g - 2298. 6g - 2 Collect the terms in -534205 + 534205 - 14w + 2w. -12w Collect the terms in 1914319q + 1 - 1. 1914319q Collect the terms in -x2 + 21041 - 57x + 54x - 21041 + 47x. -x*2 + 44x Collect the terms in 3251 + 901531k - 3251 - 901562k. -31k Collect the terms in -481r*2 + 46r*2 + 223r*2 + 222r*2. 10r*2 Collect the terms in -55a + 201 - 607 - 193. -55a - 599 Collect the terms in -36r + 9 - 395r2 + 2 + 0r*3 - 2r*3. -2r*3 - 395r*2 - 36r + 11 Collect the terms in 6o2 + 1163572o - 581820o - 581735o. 6o2 + 17o Collect the terms in -25s2 + 39s*2 - 16s*2 - 52636s*3. -52636s*3 - 2s*2 Collect the terms in -10s - 387 + 2112 - 436 - 427 - 426 - 431. -10s + 5 Collect the terms in -9t*2 - 525393t*3 - 4t + 6t - 2t. -525393t3 - 9t*2 Collect the terms in -107 + 393 + 7j*2 - 127 - 174 - 100. 7j*2 - 115 Collect the terms in 337o*3 - 8712276o*2 + 8712281o*2 + 46o - 46o. 337o*3 + 5o*2 Collect the terms in c - 27c - 9c3 - 8c*3 + 9c*3 - 16c*3. -24c*3 - 26c Collect the terms in -1792u3 + 0u - 7413u3 + u - 250u*2 + 250u*2. -9205u*3 + u Collect the terms in 43b*3 + 2474b*3 + 1659b*3. 4176b*3 Collect the terms in 208302z*2 - 104155z*2 + 6z - 104153z2. -6z*2 + 6z Collect the terms in 123s2 + 141s*2 - 315s*2 - 92s*2 + 145s*2. 2s*2 Collect the terms in -8527n*3 - 1769n*3 - 1547n*3 - 1978n*3 - 1680n*3. -15501n*3 Collect the terms in -2269w*3 - 3758w*2 + 3758w*2 - 9058w*3. -11327w*3 Collect the terms in -14b + 14 - 268b - 115b + 34b - 2. -363b + 12 Collect the terms in 2270171a - 1135030a - 1135045a. 96a Collect the terms in 422c - 220c + 743c + 685c + 568c - 28c. 2170c Collect the terms in 99748p*2 - 199433p*2 + 99671p*2. -14p*2 Collect the terms in 28 + 6645z + 29 + 32 - 114 + 26. 6645z + 1 Collect the terms in 69h + 448h - 15 + 318h - 162h + 15. 673h Collect the terms in 24525j2 - 49042j*2 + 24542j*2 + 3j. 25j2 + 3j Collect the terms in 5540305 + 6x2 - 1846812 - 1846742 - 3x*2 - 1846751. 3x*2 Collect the terms in -262q + 43q - 185q - 10q + 13q*2. 13q*2 - 414q Collect the terms in -14655c3 + 28985c*3 - 13839c*3. 491c*3 Collect the terms in 6578 + 6511 + 38408z*3 - 13089. 38408z*3 Collect the terms in -2077r + 680r + 529r + 869r. r Collect the terms in -429704 + 859551 - 429849 - 8n*2. -8n*2 - 2 Collect the terms in 4108d + 4118d + 4114d + 4120d + 4113d - 20571d. 2d Collect the terms in 3540q2 - 3540q*2 - 399022q*3. -399022q*3 Collect the terms in -1057298i*3 + 41i*2 - 41i*2. -1057298i*3 Collect the terms in -1303s + 2898s3 + 7861s*3 + 2s*2 - 10757s*3 + 1303s - 2s2. 2s*3 Collect the terms in -1 + 905a*3 - 63349a*2 + 63349a*2. 905a*3 - 1 Collect the terms in -6237o*2 + 18693o*2 - 6237o*2 - 6231o*2. -12o*2 Collect the terms in 10029i + 10023i + 10022i + 10005i - 40106i. -27i Collect the terms in -90l*3 - 111l*3 - 78l*3 - 98l*3 + 407l*3 - 80l*3. -50l*3 Collect the terms in -1272u - 12 - 7 - 1454u + 4 + 2728u. 2u - 15 Collect the terms in 41x - 210x3 + 72x + 429x3 - 221x*3. -2x*3 + 113x Collect the terms in -226w - 233w + 1051 + 705w - 232w - 1049. 14w + 2 Collect the terms in 115659 + 2769f*2 - 2770f2 + 10593 + 598885. -f2 + 725137 Collect the terms in u*2 + 5729u*3 + 2059u3 + u2 - 7820u3 - 5u*2. -32u*3 - 3u*2 Collect the terms in -2062 + 52i*3 - 36i*3 - 3i + 6194 - 2067 - 2064 + 3i. 16i*3 + 1 Collect the terms in -170 + 4m*3 - 96 + 193. 4m*3 - 73 Collect the terms in 120b + 127b + 123b - 501b + 131b + 794b2. 794b*2 Collect the terms in 5w + 3 - 6 + 5 - 4 + 509949w3. 509949w*3 + 5w - 2 Collect the terms in -2021324h3 + 673764h*3 + 673769h*3 + 673774h*3. -17h*3 Collect the terms in 30830x - 5432x + 25209x. 50607x Collect the terms in -8062 - l - 8172 - 8070 + 32371 - 8067. -l Collect the terms in -1416t - 1253t + 4077t - 1412t. -4t Collect the terms in -3x - 3x - 1335883150 + 5x + 1335883150 + x - 3x. -3x Collect the terms in 2912b*2 + 0 - 4 - 10 + 12 - 2893b*2. 19b*2 - 2 Collect the terms in 3 - 5 + 2 + 27206r*2. 27206r*2 Collect the terms in 38772q*3 - 1617q*3 - 2946q*3. 34209q*3 Collect the terms in -8781 - 8576 + 8y*2 + 17y + 17358. 8y2 + 17y + 1 Collect the terms in -295147i2 - 4232i*2 - 100521i*2 - 152487i*2. -552387i*2 Collect the terms in 1 - 7 + 8 + 16x - 61x - 3 + 27x. -18x - 1 Collect the terms in 223884402742h*2 - 223884402742h*2 + 3h*3. 3h*3 Collect the terms in 2b*2 + 2264967710b*3 - 2264967715b*3 - 2b*2. -5b*3 Collect the terms in -10256k*2 + 8096k*2 - 15107k*2. -17267k*2 Collect the terms in 6938147 - 3469069 + 0g - g - 3469078. -g Collect the terms in 110983*h -	{ "pile_set_name": "DM Mathematics" }
687. What is the units digit of b? 9 What is the units digit of (-4)/30 - (-7 + ((-468244)/30 - 6))? 1 Suppose -330 = -6w + w. Suppose -3j = 9, -5n + 8j - 6j - 119 = 0. Let z = w - n. What is the units digit of z? 1 Let l be 22/(-12) + (-112)/24. Let y(o) = -4o + 6. Let b be y(l). Let a(m) = -m2 + 34m - 27. What is the tens digit of a(b)? 8 Let v = 57 - 47. Suppose q = -3b + 127, -4b + q + 157 = -v. What is the units digit of (2 + (-544)/6)b/(-28)? 3 Let h(p) = p3 + 12p*2 + 13p + 29. Let g be h(-14). Let o = 93 - g. What is the tens digit of o? 3 Suppose -21r + 424688 - 189665 = -944547. What is the thousands digit of r? 6 Let j(a) = 521a - 1294. What is the hundreds digit of j(13)? 4 Let q(x) = -x*3 + 70x*2 + 26x - 10. What is the units digit of q(18)? 6 Suppose 2h - 5409 = -4j - 1655, -5h + 9450 = -3j. Suppose 0 = 17g - 14g - h. What is the hundreds digit of g? 6 Suppose -5q + 8q + 5v + 207 = 0, -2q - 119 = -3v. Let s be ((888/(-4))/(1 - 3))/1. Let h = s + q. What is the units digit of h? 7 Suppose 2b = b + 96. Suppose 7l + 84 = 21l. Suppose 2u = lu - b. What is the units digit of u? 4 Let u = 18 + -2. Let b = u + -13. What is the units digit of 67 + (b - (-10)/(-5))? 8 What is the tens digit of ((-2663)/7)/(94/(-2632))? 5 Let m(w) = 22w2 - 19w - 85. Let h be m(-7). Let s = 1736 - h. What is the tens digit of s? 1 Let u(h) = -2h2 - 27h + 23. Let c = -36 + 24. Let t be u(c). Suppose -27 = -2w + t. What is the units digit of w? 3 Let a(y) = y - 19. Let r be a(-1). What is the tens digit of 42-235/r? 4 Suppose -5w + 80s + 184656 = 78s, 5s + 73896 = 2w. What is the tens digit of w? 2 Suppose -4r = -4c - 114548, 24c = -3r + 19c + 85863. What is the ten thousands digit of r? 2 Suppose -4n - r = -17, n + r = 6 + 2. Suppose -ns = -2y + 1, 0 = -4s - 2y + 7 + 1. Let o(j) = 179j - 1. What is the units digit of o(s)? 8 Let l(j) = j3 - 2j*2 - 7. Suppose 0 = -7w + 2w - i + 30, 0 = 4w - 4i. Let f be l(w). What is the units digit of (51/34)/(139/f - 2)? 4 Suppose -5s - 22 = 3, 4s = k - 809. What is the tens digit of k? 8 Let c(b) = 379b + 265. What is the hundreds digit of c(6)? 5 Let h be (2 + -8)7/(-14). Let s be (-4)/(h + 2 - 4). What is the hundreds digit of (102 - s)(-1 + 3)? 2 Let y(s) = s*3 + 5s*2 - s - 1. Let n be y(4). Let q be (-2053)/(-7) - (-6)/231-11. Suppose n + q = 3h. What is the hundreds digit of h? 1 Let z = 1063 - 151. Suppose -i - z = -3i. What is the hundreds digit of i? 4 Let n = 4709 + -3550. What is the units digit of n? 9 Let f = 1419 - -940. What is the tens digit of f? 5 Suppose -2f - 3w + 1882 + 902 = 0, -5588 = -4f + 4w. What is the hundreds digit of f? 3 Suppose -9w - 31 + 4 = 0. Let g = w + 2. What is the units digit of (3 + 0/(-2) - -38) + g? 0 What is the thousands digit of ((80/(-30))/(-4))/((-6)/(-153009))? 7 Let v = -13843 - -28885. What is the hundreds digit of v? 0 Suppose -8j - 6120 = 5g - 5j, 3672 = -3g - 2j. What is the tens digit of 2(g/(-5) + 8/(-10))? 8 Let l be (-8)/((-280)/(-651)) + 6/10. Let t = l + 17. Let y(k) = -80k3 + k2 + 4k + 3. What is the tens digit of y(t)? 8 Let t(l) = -l + 7. Let k = -52 + 72. Suppose -k = 7a - 5a. What is the units digit of t(a)? 7 Let x(j) = -5j + 27. Let q be x(-7). Suppose 0 = 2m - 10 - q. What is the tens digit of (1 - -3)603/m? 6 Suppose -2p - 4w = -12654, -87p + 90p = -5w + 18976. What is the thousands digit of p? 6 Suppose -79q + 105q - 473484 = -99162. What is the hundreds digit of q? 3 Let t(o) = o3 - 60o*2 - 229o - 155. What is the hundreds digit of t(65)? 0 Suppose -100x + 6 = -98x. Suppose xc = -3k + 420, 3k + 2c + 75 = 490. Suppose k = 6q - 273. What is the tens digit of q? 6 Suppose s - 4236 = -0s + n, -2n = 2s - 8488. What is the tens digit of s? 4 Suppose -4v = -v + 2a - 53, 3a - 12 = 0. Let h be ((-48)/(-20))/(v/50). What is the tens digit of 2/h103 - (-5)/20? 2 Let q(j) = -544j3 - 9j*2 - 19j - 11. What is the ten thousands digit of q(-5)? 6 Let f = -61 - -97. Let x be 24/f + 16/(-6) + 1. What is the tens digit of (75 - x) + (-1 - (0 - 1))? 7 Let h(r) = -r*3 - 8r*2 + 8r - 8. Let c be h(-9). Let z be c/((-3)/(18/(-2))). Suppose 0 = zg + 9, -b + 165 = b + g. What is the units digit of b? 4 Suppose 5r - 4v - 55 = 0, -3r + 4r + 8 = -3v. Let j(d) = d*3 - 7d*2 - 7d + 19. Let l be j(r). What is the tens digit of (l/4 - -2)(-68)/2? 8 Let p be 8/(-56)-1 - 197314/(-14). Suppose p = -14o + 43o. What is the units digit of o? 6 Let t(r) = 5r2 - 46r + 112. What is the units digit of t(39)? 3 Suppose 3s = -7 - 8. Let l be 24 + (s - -3)(-1)/2. Suppose -5 + l = g. What is the tens digit of g? 2 Let s = 22 + -24. What is the tens digit of ((6/(-3))/s)/(1/1591)? 9 Let r(j) = 841j2 + 135j + 1175. What is the ten thousands digit of r(-8)? 5 Let q be 682/4 - ((-324)/(-24))/(-9). Let p = 358 - q. What is the tens digit of p? 8 Suppose -7d - 10247 = -2l - 12d, -20489 = -4l - 5d. Suppose 0 = -17f + 3583 + l. What is the tens digit of f? 1 Let r(i) = 3i2 - 13i. Let t be (10/(-35))/((-2)/7). Let k(a) = a. Let n(c) = tk(c) + r(c). What is the units digit of n(9)? 5 What is the units digit of (-58)/(-3)(-170 + 518)? 8 Let r = -135 - -127. Let x(v) = -15v2 - 27v - 107. Let h(t) = -7t2 - 14t - 53. Let k(w) = -9h(w) + 4x(w). What is the units digit of k(r)? 7 Let u(q) = -4q - 22. Let s be u(15). Let i = 46 + s. What is the hundreds digit of (-7228)/i + 5(-8)/(-180)? 2 Let r(f) = 36f - 2. Let s be r(2). Suppose 3a + s - 25 = 0. Let q = a - -37. What is the units digit of q? 2 Suppose 0 = -4n - 3u, n + 2n + u = 0. Suppose 25t + 5r = 20t + 1090, t - 5r - 200 = 0. What is the units digit of t/2(n + 2)? 5 Let k be -279(745/45 - 8/36). What is the hundreds digit of -3k/117 - 2/(-13)? 1 Let u(x) = -79x2 + 6x + 14324. What is the hundreds digit of u(0)? 3 Suppose -5q = 3d - 286047, 14q + 171651 = 17q - 2d. What is the thousands digit of q? 7 Let t be (20/(-15))/(1/((-3)/2)). Let k(n) = -5n*2 - 20 + 2n + 29 - 15 + 4nt + n3. What is the tens digit of k(4)? 5 Suppose 4m = -2p + 362522, 157m - 2p + 90644 = 158m. What is the hundreds digit of m? 6 Let t(f) = -f*2 + 24f - 17. Let y be t(22). Suppose -48o + y = -6693. What is the hundreds digit of o? 1 Let w = 18726 - 10119. What is the tens digit of w? 0 Suppose 0 = 5r + 2r - 91. Suppose -rn + 4n - 4392 = 0. What is the units digit of n/(-10) + -4 + (-105)/(-25)? 9 Suppose 514u - 10734798 - 26444364 = 0. What is the ten thousands digit of u? 7 Let f = -81 + 84. Suppose -t + z = -0 + 5, 0 = -ft + z - 17. What is the units digit of t/9 - 143/(-3)? 7 Let c(d) = -d3 + 6d - 28 - 2d - 14d*2 + 19d*2 + 12. Let t be c(5). Suppose -w + 2w = -2q + 102, tw - 4q - 360 = 0. What is the tens digit of w? 9 Suppose -q - 4445 = -31568. What is the hundreds digit of q? 1 Let f be 10/(-4) + (-56)/(-16). Let y(m) = 10m3 - m2 + m. Let z be y(f). What is the hundreds digit of 15/z-2 + (165 - 1)? 1 Suppose 2d - 6 + 12 = 0. Suppose -6w + 0w = -3w. What is the units digit of 129/3 - (-1 + w)d? 0 Let p be 2879/7 + (-253)/77 + 3. Let y = 1310 - p. What is the hundreds digit of y? 8 Let q(d) = -d*3 - 2d*2 + 4d + 7. Let u be q(-3). Let y(t) = 3t - 11. Let s be y(u). What is the units digit of (s - -193) + 5 + -9? 0 Let i(n) = -n - 51. Let s(w) = w - 2. Let k(t) = -i(t) + 4s(t). What is the units digit of k(-8)? 3 Let k(y) = y*2 + 7y - 5. Let q be k(-8). Suppose -2j + 6625 = qj. What is the tens digit of j? 2 Let f(j) = -6j - 36. Let b be f(-6). Suppose 2i = -5o - 2928, bo + 2o = -5i - 7341. What is the tens digit of i/(-26) - (-6)/4? 5 Let v(u) = -u. Let x(c) = c*3 + 2c*2 - 11c - 18. Let y(w) = -2v(w) - x(w). What is the hundreds digit of y(-9)? 4 Let y(d) = -d3 + 125d*2 + 41d + 650. What is the units digit of y(124)? 0 Let z(s) = 314s2 + 4s + 5. Let p(x) = 315x2 + 3x + 3. Let l(u) = 3p(u) - 2z(u). What is the units digit of l(-1)? 5 Let w(s) = -3s2 + 2s*3 + 16s - 1 - 17s + 0s*2. What is the units digit of w(3)? 3 Let r = 8616 + 997. What is the units digit of r? 3 Suppose -2r + 1283 = -	{ "pile_set_name": "DM Mathematics" }
8). Is (-6)/r(-8972)/(-2) prime? True Suppose 27764 = 8g - 45252. Is g prime? True Let d be ((-25)/10 - -5)/((-1)/(-2)). Suppose 3q - 6q + 4u = -2239, -u + 3770 = dq. Is q a prime number? False Let i = -25 + 29. Is (-1)/(i/3) - (-21450)/120 a prime number? False Suppose 37 = -2z - j, 3z + 5j + 72 = 27. Let k be (z + -182)/(2/(-17)). Suppose 6b + 5c = 3b + 1008, -5b = -4c - k. Is b prime? False Let o be (-109)/(-2) - (-1)/(-2). Suppose 4p + 7p = 11. Let h = o + p. Is h a composite number? True Is (-209)/(-22)(0 - -622) a composite number? True Let j be (7 - 3)(3 - (-18)/(-8)). Is j + (-4 - 1072/(-4)) a composite number? True Let s(x) = x*3 + 6x*2 + 4x - 3. Let k be s(-5). Suppose -y = ky - 297. Let f = y - 46. Is f composite? False Let q = 0 - -3. Let t(j) = 20j + 3j - j - 5 - qj. Is t(4) a composite number? False Suppose -8q = -4q + d - 16, -3q + 4d = 7. Suppose s = 5t - 10, qt = -s + 18 + 4. Suppose -2k + 875 = k - 2u, -5u = -s. Is k composite? False Let v(r) = -747r + 12. Is v(-3) prime? False Let s(c) = 27c2 + 22c + 47. Is s(-18) a composite number? True Let z(o) = 577o3 + 6o*2 - 7o - 23. Is z(4) a composite number? False Let w be -2 + 3 - (-3 - (-3 + 7)). Suppose -wy = -y - 259. Is y prime? True Let j(v) = 7v + 25. Let x be j(-11). Let h = -42 - x. Is h prime? False Suppose 20w - 121375 - 89285 = 0. Is w a prime number? False Let y = 343 + 646. Suppose -v + y = -5m, m = 4m. Is v prime? False Suppose 4999r - 5014r + 342135 = 0. Is r a prime number? False Let y = 113 + -120. Let i(w) = 10w*2 + 17w. Is i(y) a composite number? True Suppose 4u + 4t = -16, -3u = 4t + t + 20. Suppose u = -5r - 5. Is 406 + 3 + (-1 - r) composite? False Suppose 6u - 488 = 2u. Let h(g) = -6g - 6. Let l be h(-9). Let r = u - l. Is r a prime number? False Let n = 670 + 28. Let a = n - -1401. Is a prime? True Let i = -4 + 10. Let r be -636(15/(-6) - -2). Suppose -r = -iq + 3q. Is q prime? False Let d(h) = -h. Let o be d(-5). Suppose -4g - 2683 = p, 0g - og + 5p - 3385 = 0. Let f = -263 - g. Is f a prime number? True Suppose -3t + 2t = 3q - 50762, -84608 = -5q + 3t. Is q composite? False Let i be 6/(-10) - 11406/(-10). Let p be i/8 - 4/(-8). Let t = p + 164. Is t composite? False Let s = 2 - 5. Let f be s/1 + 11 - 0. Let y(u) = 7u + 3. Is y(f) composite? False Suppose 5s + 496818 = 23s. Is s a composite number? True Suppose 4l - 3d - 8180 = 3l, 4l + 5d - 32703 = 0. Suppose l = 5b - 2s, 2s = 5s - 12. Is b composite? False Let p = 7536 + -4230. Let o = -1585 + p. Is o a composite number? False Let a = -69 + 4. Let f = 87 + a. Is f composite? True Suppose 5b - 4m = 61, -m + 0m = 4. Suppose -3k = c - 5k - 108, 4k = 8. Let v = c - b. Is v a prime number? True Suppose -406 = z - 5739. Is z a composite number? False Let p be 0 + 2 - (-2 - -108). Suppose 30v - 34v - 12 = 0. Is v + 7p/(-4) a prime number? True Let b be 0(-1 + 3/2). Suppose -203 = -4t + 3d, bd - 103 = -2t + d. Is t composite? False Let p be (-5 - -5) + -3 + 0. Is p - 3(-708)/9 prime? True Suppose 0m + 9010 = 2m + 4a, -5m - 4a = -22543. Let w be (-4 - -5) + 6/3. Suppose 0 = -2u - v + 1800, -8u + 3v = -wu - m. Is u composite? True Is 52/2(-3114)/(-36) prime? False Suppose 6p = 14101 + 7973. Is p a prime number? False Suppose -12 = -4s - 0s. Suppose u + 4u + 170 = 5h, 138 = -4u + sh. Is -3 + 0 + (0 - u) prime? False Suppose 0 = 2i + 3s - 23, -64 = -5i - 4s + 3s. Let h = -7 + i. Is (-3)/h + 839/2 prime? True Let a = 3103 + -1075. Suppose 0 = 5q - a + 373. Is q a prime number? True Let c be -253/(-30)-8. Let z be (c/(-8))/((-2)/(-456)). Suppose 4r + 2w = z, -165 = -r - 2w + 6w. Is r prime? False Let n(d) = -d*2 + 3d. Let a be n(4). Let g be 44/(-3) + a/(-6). Let i(v) = -v*2 - 22v - 19. Is i(g) prime? False Let b(j) = 241j + 214. Is b(43) a composite number? True Suppose -2152n - 12035 = -2157n. Is n prime? False Let d(o) be the first derivative of 3o3 + o2 - 10o - 5. Is d(-5) prime? False Let s = 4433 - -4830. Is s composite? True Is (11 + (-543127)/(-39))/((-4)/(-6)) composite? True Suppose 3o = 2m + 15159, 2o - 10m - 10111 = -7m. Is o prime? True Suppose -5w - 5s + 385965 = 0, -21w + s = -18w - 231563. Is w a composite number? True Suppose 42q - 100511 = 322891. Is q prime? False Suppose -4s + q = -1723, 2s + 0s - 860 = 2q. Let b = s - -6. Is b composite? True Suppose 3w - 9 = -4i + 2, 0 = -2w + 2i - 16. Let p be (8 + w)/(1/1). Suppose 277 = u - 2q, q = 2q - p. Is u a composite number? True Suppose 2u - 5o + o = 4, -o = -4u + 8. Let q(a) = -16a + 20a + 0a + 5a*u + 20a - 27. Is q(16) prime? True Suppose 46 = 2q + i + 175, -2q - 2i - 132 = 0. Let a be (q/12)/((-2)/392). Suppose 5j + n = a + 659, -j - 5n = -352. Is j prime? True Is (-9)/2 - 3/(-6) - -1781 a composite number? False Let y be (-23)/(-6) + -5(-3)/90. Suppose 0 = 2v + yw + 1025 - 3359, 0 = -5w - 5. Is v a composite number? True Let n = 1 - 11. Let k be (-610)/(-2) - 0/n. Is k/(3/31) a composite number? True Let n = -13 + 8. Let k(x) = -x + 5. Let z be k(n). Is 15/z(-1218)/(-9) composite? True Let a(t) = -7t - 24. Let p be a(-4). Let k(h) = h*3 - 3h*2 + 4h - 2. Let w be k(3). Is 17/p(w + -2) prime? False Suppose 0 = c + s - 9, -1 = -3c + 2s + 1. Suppose h = -cr + 123, r - 6r = 20. Is h a prime number? True Suppose 22488 = 4n - 4j - j, 4n = 4j + 22492. Is n a composite number? True Is 2/(-8) - (-156064)/128 a prime number? False Let d(j) be the second derivative of -j5/60 + 113j*3/6 + 2j*2 - j. Let f(h) be the first derivative of d(h). Is f(0) a prime number? True Let s(j) = -7j*3 - 13 + 8j*2 + 7j + 6j + 6j*3. Let f be s(9). Suppose y = -f + 114. Is y a composite number? True Suppose 4j = -5u - 92, -10 = u + 4j + 18. Is (-2 - 55)u + -1 composite? False Is 500015/55 + 2/(-11) prime? True Let b(v) = -2 - 4 + 17v*2 - 1 - 5v. Let g = 32 - 27. Is b(g) a prime number? False Let i = 659 + -637. Is i a prime number? False Let p(q) = 9q - 30q - 7 - 16q - 48q. Is p(-2) a prime number? True Suppose -27481 = -11d + 52. Is d a composite number? False Suppose 4g = -y + 7, -y - 3y - 8 = -2g. Let h(p) = 20p2 + 57p*2 - 81 + 10p*2 + 37 + 43 - p. Is h(y) composite? True Is (-12)/(-2)((-2970)/(-20))/27 a prime number? False Let f = -26302 - -75317. Is f composite? True Is (3 - 5) + 3 - -6030 composite? True Let z(m) = 231m2 - 178m - 7. Is z(10) a composite number? False Let d(z) = 10z2 - z + 5. Let p be 15 - 1(-6)/(-2). Let v(k) = k*2 - 13k + 16. Let q be v(p). Is d(q) composite? True Let h be (-18)/816/(-3). Let c = 15 - h. Is -3 + 89 + (c - 0) a prime number? True Let m = -15 + 15. Suppose m = 3x - 17 + 5. Suppose -361 = -xv - 45. Is v a composite number? False Let v = 1024 - 533. Let k = v + -45. Is k a prime number? False Let j(o) = -o3 + 5o*2 + 2o - 5. Let d be 2 - (-60)/(-27) - 38/(-9). Is j(d) prime? True Suppose -2m = 0, -4m = -5g - 9m. Suppose -14r + 1072 = -10r. Suppose gh - 2h = -r. Is h a prime number? False Suppose -5k = 4o - 11912, 1 + 1 = -o. Suppose 18s = 2s + k. Is s a composite number? False Let x(v) = 424v2 - 9v - 14. Is x(-9) composite? True Let f(o) = -63o + 13. Let z be f(-9). Let r = 1094 - z. Suppose 4j + 384 = q + 127, -2q + 5j + r = 0. Is q a composite number? False Let s = 51 - 47. Suppose 0 = -4m + 5c + 261, sm - 3c - 39 = 228. Is m a composite number? True Suppose -l + 10 = 4l + 2o, 2o + 18 = 2l. Suppose 530 = ld + 142. Is d composite? False Let z = 72311 + -41508. Is z prime? True Let h = 422 - -95. Is h a composite number? True Suppose 0 = -0z + 4z + 760. Let f = -131 - z. Is f a prime number? True Let x be -2 - (-1 + -2)/(3/2). Suppose x = -c - 4i + 213, -5c + 731 + 370 = 2i. Is c a prime number? False Suppose -21u = -18u + 112461. Is (0 - 1)/(19/u) prime? True Is (-30)/(13 + -7) - -9202 composite? True Suppose 4o = -s + 2835, 2825 = s - 3o + 5o. Is s a composite number? True Suppose 4u - 2261 - 1091 = 0. Is u a composite number? True Let y be 0 - ((2 - 4) + -6). Suppose x + 555 = 4x. Suppose -3d = -y*d + x. Is d composite? False Let v be 4/(-22) - 38	{ "pile_set_name": "DM Mathematics" }
)? 56 Let b(w) = 5w - 13. Let f be b(3). Calculate the common denominator of (-2)/(-3)f42/(-60) and 46/27. 135 Let k(b) = 5b*2 - 4b - 4. What is the least common multiple of k(-2) and 9? 72 Let v(x) = x*2 + 3x + 2. Let m be v(-5). Let g = -81889/20 + 4097. Calculate the common denominator of (-12)/10 - 9/m and g. 20 Let x = -526 + 592. Calculate the lowest common multiple of x and 63. 1386 Let p = 19/46 + -1769/1610. Find the common denominator of 17/25 and p. 175 Suppose -8m + 5 + 443 = 0. Calculate the least common multiple of 40 and m. 280 Suppose 0 = c - 2 + 5, 166 = 5g - 2c. What is the lowest common multiple of 8 and g? 32 Suppose 2a - 6389 + 1163 = 0. Let m = -20875/8 + a. Find the common denominator of -95/16 and m. 16 Suppose -3j + 101 = -v - 4j, 0 = 3v - 5j + 303. Let k = v - -151. Calculate the lowest common multiple of 20 and k. 100 Let i(o) = -o*3 + 7o*2 - 5o - 8. Let r be i(6). Let q(l) = -6l3 + 2l*3 + 3l*3 + 2l*2. What is the smallest common multiple of q(r) and 14? 112 Suppose 0 = -2i - g - 11 - 31, 0 = -g + 2. What is the least common multiple of (-4)/i + 18335/165 and 12? 156 Let r = -9 + 12. Let s(b) = b2 + 5b + 4. Let v be s(-4). Let j(d) = d + 10. What is the lowest common multiple of j(v) and r? 30 Suppose -61 = -4d + w + 4w, -2d = -4w - 32. Suppose d = 12f + 2. Suppose 60 = 5u + 10. What is the smallest common multiple of u and f? 10 Let o(i) = -i*3 + 18i*2 - 10i + 89. What is the least common multiple of 104 and o(17)? 208 Let d(i) = 1. Suppose 6u = 3u - 18. Let k(p) = p + 1. Let n(f) = ud(f) + k(f). What is the smallest common multiple of n(11) and 46? 138 Let j be (-111)/1614180/(-30). Let x = j - 3284. Let q = 205/8 - x. What is the common denominator of -101/6 and q? 6 Find the common denominator of 456/(-170) - (2 + -4) and -62/25. 425 Suppose 33 = 4n - 3. Let p = 34 - 24. What is the lowest common multiple of 8 and n/(-6)p/(-15)? 8 Let c be 1/(-1) - (-105129)/63. Let a = c + -1663. Calculate the common denominator of -52/3 and a. 21 Let q = -282 - -286. Let m = -6 - -11. Suppose -2p - 2p + 12 = 0, mp - 37 = -2z. Calculate the least common multiple of z and q. 44 Let i = 12 - 7. Let g = 21 + -13. Suppose -w - 2v + g = 3w, 0 = -w + v - 1. Calculate the smallest common multiple of w and i. 5 Suppose 0 = -f - 2f + 42. Suppose 31d - 28d = -165. Let y = d + 65. What is the smallest common multiple of f and y? 70 Let f = 187 - 167. Calculate the lowest common multiple of 18 and f. 180 Let w = 1 - 0. Let s = 70 + -67. Suppose -sh + 6h = 21. Calculate the smallest common multiple of h and w. 7 Suppose 3d = -5t + 49, 0d - 4t + 32 = 2d. Let m = -19 - -37. What is the least common multiple of d and m? 18 Let b = -348/37 + 6121/222. Let x = 2074 + -74555/36. What is the common denominator of x and b? 36 Suppose -14 = -5m - x, -2x - 2x + 14 = -m. What is the lowest common multiple of 6 and 12 + -2 + m + -3? 18 Suppose 95 = -l + 65. Calculate the common denominator of 6/(-33) + l/77 and 97/6. 42 Suppose -3g - 50 = -13g. Calculate the least common multiple of g and 5. 5 Let j = 133 + -128. Suppose 0 = -2t - jc + 14 + 26, -70 = -4t - 5c. What is the least common multiple of 9 and t? 45 Suppose -65 = -i + 16. Suppose 0 = 5p + 26 - i. What is the least common multiple of 11 and p? 11 Calculate the common denominator of (333/(-243))/(-1 + 4/3) and 2(86/20 - 3). 45 Let s = 29 + 16. Let x = -23 + s. Calculate the lowest common multiple of 24 and x. 264 Let q be (-3 + (-219)/(-6))2. Suppose 14 = -3v + 4z + q, 0 = v + 2z - 11. Let a = 19153/9081 - -2/1009. Calculate the common denominator of a and v. 9 Let g = 56 - 52. Let f be 1/1 + 48 + 0. Suppose -31 - f = -gy. Calculate the least common multiple of 10 and y. 20 Let i = -64 + 59. Let m be 3 + 1 + (-3 - -2). What is the lowest common multiple of 4 and (1 - -1 - i) + m? 20 Let j = 315 - 271. Calculate the least common multiple of j and 16. 176 Calculate the common denominator of (237/2 - (-2)/(-4))/18 and -53/7. 63 Suppose 50 = 4v + v. Let u = 650 - 646. Calculate the lowest common multiple of v and u. 20 Let l = 9 + -3. Suppose -16 = -0d - d. Calculate the smallest common multiple of d and l. 48 Let o(y) = -y + 12. Let z be o(-11). Let x = -19 + z. What is the smallest common multiple of x and 10? 20 What is the lowest common multiple of 16 and (-5)/3(4504/(-40) - 11)? 1648 Let z = -630 + 632. What is the lowest common multiple of z and 117? 234 Suppose 278 = 3c - 3x - 73, -5x = c - 87. Suppose -2l = -6a + 7a - 2, -4 = a + 4l. What is the smallest common multiple of a and c? 112 Let t be (-4)/(-6) - (-271594)/(-60). Let a = -4521 - t. What is the common denominator of (-9)/((-198)/10) + 3/(-2) and a? 110 Let o(a) = -a*3 - 2a*2 + 2. Let l be o(-14). Let u = 47049/20 - l. Calculate the common denominator of ((-1)/6)/(1/(-71)) and u. 60 Let c = -83 - -91. Suppose -2l + 0l + 44 = 0. Calculate the lowest common multiple of l and c. 88 Suppose 31 - 11 = -5f. Calculate the common denominator of (-7395)/(-1365) - f/26 and (122/(-16))/(10/(-8)). 70 Let x = 215 + 38. Calculate the lowest common multiple of x and 88. 2024 Suppose -5l - 2z + 933 = 185, -l - 2z + 148 = 0. Calculate the least common multiple of l and 6. 150 Suppose -5l - 319 = 356. Calculate the common denominator of (-77)/(-8)(-1)/2 and (-2)/(-6)l/330. 176 Suppose -26v + 155 = -495. Suppose -4a - 5r - 11 = 0, -8 - 1 = 3a + 4r. Calculate the smallest common multiple of a and v. 25 Let q(f) = 2f - 1. Let i be q(3). Suppose iu - 2 = 13. Suppose t - ut = -6. Calculate the least common multiple of 4 and t. 12 Suppose 4b - 96 = -0. Let t = b + -14. Let r = 327 + -309. What is the lowest common multiple of r and t? 90 Suppose 9k = 7k + 32. Calculate the least common multiple of 2/(-4) - (-51)/6 and ((30/(-4))/3 + 3)k. 8 Let t(m) = -267m2 - 13m + 2. Let r be t(-9). Let k be r/(-15) - 3/(-9). Let q = k - 1445. Calculate the common denominator of q and -32. 5 Calculate the lowest common multiple of 6 and ((-1)/1)/(14/(-28)). 6 Suppose -n = 2 - 7. Suppose 3t + 4 = -3o + t, -nt = -2o - 9. Calculate the smallest common multiple of (o - (0 + -4)) + 0 and 9. 18 Find the common denominator of (1/(-48 - 0))/((-82)/5043) and -97/24. 96 Suppose 28 = 2d + 5d. Suppose -16 + d = -3t. What is the smallest common multiple of (13)/((-6)/(-40)) and t? 20 Let a = -502 + 504. Let h(g) = -2g3 - 2g*2 + g - 2. What is the least common multiple of h(-2) and a? 4 Let t(v) = 8v3 - v2 - 5v + 10. Let d = -10 - -13. Calculate the smallest common multiple of d and t(2). 60 Let r = 7397 - 59255/8. Find the common denominator of r and (0 - 1)/(7(-160)/(-6328)). 40 Let d = -1409857/30 + 47000. What is the common denominator of d and 56/9? 90 Suppose -390n + 385n + 360 = 0. Calculate the least common multiple of n and 48. 144 Suppose -3j = 5s - 36, 2j = -s - s + 16. Calculate the lowest common multiple of 309 and s. 618 Let h be (-3 + -63)/(-4 + (-13)/1). Let u = -259/34 - h. Find the common denominator of u and (17/(-8))/((-1)/(-2)). 4 Calculate the common denominator of 41/24 and 2/(-13) + (-115804)/(-89232). 264 Let l = -7/390 + 2843/260. Calculate the common denominator of ((-4)/10-1)/((-4)/(-75)) and l. 12 Suppose -m = -3n + 108 - 69, 0 = 5n - 3m - 69. Calculate the least common multiple of n and 183. 732 Let i = -6 - -16. Let x be (0 - 3)/(3/i). What is the common denominator of 41/8 and x - -13 - (-1)/8? 8 Let t be 1704455/182 - (-1 + (-15)/(-21)). Let l = t + -9362. Find the common denominator of l and 1 - (-1 - (-166)/28). 182 Let o = -48 + 64. Suppose -4b - 13 = 3. Let n = 22 + b. What is the lowest common multiple of o and n? 144 Let i(f) = f*3 + 4f*2 - 5f + 7. Let k be i(-7). Let q = -45 - k. Suppose q - 5 = 5r. What is the lowest common multiple of 8 and r? 88 Suppose -2h + 4 = -3h. Calculate the common denominator of 83/10 and 12/128(632/3)/h. 80 Let z(l) = 6l2 + 8l - 6. Let b be z(3). Calculate the common denominator of 6/20(-6 - (-1520)/b) and 19/33. 165 Let s = 42 - 82. Let d = s - -29. Let y = -9 - d. What is the smallest common multiple of y and 6? 6 Let r(y) = 2y**2 - y + 1. Let q be r(-	{ "pile_set_name": "DM Mathematics" }
)-2)/(-2sqrt(10)-2). -507 + 23sqrt(17)/2 Simplify ((4 + sqrt(33)/sqrt(3))6 + 3 + 2)-3 + 3. -84 - 18sqrt(11) Simplify -3 + (6sqrt(220) - sqrt(275)/(1sqrt(5)))/(sqrt(22)/sqrt(128)). -3 + 88sqrt(5) Simplify (5sqrt(240)-2 + (sqrt(240) - (sqrt(240) - 3(sqrt(240) + sqrt(240)1))))/((sqrt(605) + (sqrt(605) - sqrt(605)3-6 - sqrt(605)))-3). 16sqrt(3)/627 Simplify ((-2-65(sqrt(243) + 1) + (-5(sqrt(243) + 2) - (0 + sqrt(243) + 3)))-6)2. 1644624sqrt(3) + 25588692 Simplify 5 + -2 + -2 + (sqrt(242) + (sqrt(242) + sqrt(242) + -1)*2)2 + 1 + (sqrt(242) + 2sqrt(242))2. -66sqrt(2) + 4118 Simplify (4 + 3 + -1 + (1 + sqrt(300))-3 + 3 + -3)2 + -4. -180sqrt(3) + 2705 Simplify ((-5sqrt(70)/sqrt(2)6)/(sqrt(63)/(sqrt(90)/(-1sqrt(10)))))2-2. -9000 Simplify ((2sqrt(189)3-2-3)/((-2sqrt(1728) - sqrt(1728))5))*2. 63/100 Simplify -2(-3 + (-5((sqrt(637) - (-2 + sqrt(637))-6) + 5))*263). -28135794 + 617400sqrt(13) Simplify (4 + 1(-2 + sqrt(162)-1)3 + 2)2. 1458 Simplify (2(-5(-1 + sqrt(7)) + sqrt(112) + -2sqrt(112)) + 1sqrt(28) + -2 + sqrt(7) + -1)2. -210sqrt(7) + 1624 Simplify -2 + -6(sqrt(1053) + 2 - (sqrt(78)/sqrt(24))2 - (-2sqrt(65)-5)/sqrt(5)). 11/2 + 6sqrt(13) Simplify (sqrt(200) + ((sqrt(200) + sqrt(200) + -4 + sqrt(200) + 4)*2 - sqrt(200)))-4 - (0 + (sqrt(200) - 2sqrt(200))2)6. -8400 Simplify ((-1sqrt(156)-3 - sqrt(156))/sqrt(3)2)/(((1sqrt(288))/sqrt(8) + sqrt(36))/(sqrt(9) - (sqrt(36) - sqrt(108)/sqrt(3)))). 2sqrt(13) Simplify (6(6sqrt(133)-2-2)/((2sqrt(189))/sqrt(3))-3)2. 98496 Simplify -6(-4 + (3 + sqrt(1216) + -1 + -2 + 4 + -1)*2). -7326 - 288sqrt(19) Simplify (((sqrt(143) - (sqrt(143)-25 - sqrt(143))) + -1sqrt(143)4)5)/(((sqrt(539) - (1sqrt(539)-1 - sqrt(539)) - sqrt(539)) + sqrt(539))-2)-6. 40sqrt(13)/7 Simplify -3 + 5(4((-1sqrt(833) - sqrt(833) - sqrt(833))26 + -5) + -5). 899512 Simplify (6-1sqrt(15)-12)/(6(-1sqrt(432) + sqrt(243)-1)). -2sqrt(5)/21 Simplify (-41sqrt(102)1-6)/(23sqrt(294)-4). -sqrt(17)/7 Simplify (-2 + sqrt(18)/(sqrt(6) + sqrt(96)3) - (5 + -1 + sqrt(147) + 3))*2. 1620sqrt(3)/13 + 37989/169 Simplify 4 + ((sqrt(275) + -2)2 - (-4 + -3 + sqrt(275)))2 + 3. 30sqrt(11) + 291 Simplify ((-3(sqrt(242) - (sqrt(242) + 0)))2 + 5 + -5sqrt(242)-1-6 + 3)-1 + 2. -6 + 330sqrt(2) Simplify ((sqrt(110) + (-5-2sqrt(110) - sqrt(110) - sqrt(110)) + sqrt(110))/sqrt(5)4)/((-2sqrt(72) - sqrt(2)) + (sqrt(42)/sqrt(7))/sqrt(3)). -10sqrt(11)/3 Simplify -4 + ((sqrt(612) + 0)4-5 - ((sqrt(612) + 1 + sqrt(612) + 5)2 - (sqrt(612) - 61sqrt(612) - sqrt(612)))) + -3. -2491 - 300sqrt(17) Simplify -5(3 + -5 + 2sqrt(567)) - (0 + (4 + (sqrt(567) - (sqrt(567) + -1))*2 - (sqrt(567) + -1sqrt(567) + 1)*2)). -90sqrt(7) + 6 Simplify 5((sqrt(96) - ((sqrt(96) - (-2sqrt(96) + sqrt(96))-4) + sqrt(96) - sqrt(96)))/sqrt(12))/(sqrt(12)/sqrt(3)5 - sqrt(144)-2). 20sqrt(2)/17 Simplify -2 + (sqrt(210)/sqrt(96)2)/(sqrt(1008) - ((sqrt(1008) - 12sqrt(1008) - sqrt(1008)) + sqrt(1008))) + -3. -5 + sqrt(5)/48 Simplify ((sqrt(1331)-1-6 - (sqrt(1331)-3 + sqrt(1331) + 0) - (-1 + -2 + sqrt(1331) + -2 + 5)) + 1)*2. 154sqrt(11) + 65220 Simplify 4 + ((sqrt(32)3 - sqrt(160)/sqrt(5)) + (5sqrt(32) + sqrt(8))/(sqrt(128)/sqrt(2)))2 + -5. 1841/8 Simplify 3 + ((sqrt(19) - sqrt(57)/sqrt(3))2 + 3 - (sqrt(19) + (sqrt(133) - (sqrt(133) - -2sqrt(133)))/sqrt(7))) + 0 - -6((1 + sqrt(2736) + -2)*2 + -1). -143sqrt(19) + 16422 Simplify 1 + ((sqrt(180) - 2(1sqrt(180) + sqrt(180)))*2 + sqrt(180))-3 - ((sqrt(45) - sqrt(180)/sqrt(4))2 - (-4 + (-1sqrt(125))*2 + sqrt(125))). -4738 - 13sqrt(5) Simplify 2((sqrt(720)-2-3 + sqrt(720) + 5)21 - 56(sqrt(720) + sqrt(720)1-2)). 2400sqrt(5) + 70610 Simplify (-65-1sqrt(896))/(sqrt(7) + (sqrt(21)/(1sqrt(3)) - sqrt(7)) - (sqrt(168)/sqrt(6) - sqrt(28) - sqrt(28))). 80sqrt(2) Simplify -6((4 + 4 + 6(sqrt(448) - -2(sqrt(448) + sqrt(448) + 1)))-1)*2. -2421600 - 57600sqrt(7) Simplify -5((sqrt(468) + 2)2 + 0 + sqrt(13) + (sqrt(1300)1)2)-4-5. -130400 - 1300sqrt(13) Simplify (((sqrt(121) + sqrt(121)1)-43)/((sqrt(7920) + (sqrt(7920) - (sqrt(7920) - 2sqrt(7920))))/sqrt(5)) + 4)*2 + 0. -16sqrt(11)/3 + 188/9 Simplify 4 + 6((-2 + (sqrt(168)/((2sqrt(72))/sqrt(9)))/((1(sqrt(15) - (sqrt(60) - sqrt(15))) - sqrt(15))/sqrt(5)))2 + -2). 53/2 + 12sqrt(7) Simplify ((3(-2sqrt(120) - sqrt(120)))/(sqrt(5) + (sqrt(5) - (sqrt(40)/(sqrt(32)/sqrt(4)) + sqrt(5)) - sqrt(5))))/(-332sqrt(968)). -sqrt(3)/22 Simplify ((0 + 5sqrt(44) - 2sqrt(539)5) + 5(-1sqrt(132)/sqrt(4))/(-1(sqrt(3) - (sqrt(3) - sqrt(48))) + sqrt(3)))2. 336875/9 Simplify 5(sqrt(72) + -1)6 + ((1sqrt(162) - sqrt(162)) + 3 - sqrt(162) - sqrt(162) - sqrt(162) - (-1 + (sqrt(162) + 1 - sqrt(162))))*2. 18sqrt(2) + 1437 Simplify (((sqrt(3) + sqrt(15)/(sqrt(25)/sqrt(5)) - sqrt(3))5 - -4(sqrt(147) + 2 + sqrt(3))) + 2)*2-2. -8414 - 1480sqrt(3) Simplify (4(4 + (-4 + -1 + sqrt(80) + -5 + sqrt(80) + 2 - (sqrt(80)-4-4 + sqrt(80) + -1))))*2. 5760sqrt(5) + 288144 Simplify -3 + (sqrt(209) + (sqrt(209) + sqrt(209)-1)3 + (sqrt(209) - (-1sqrt(209) - sqrt(209)))3)/((3sqrt(132) + sqrt(132))/sqrt(12)-1). -5sqrt(19)/2 - 3 Simplify -2 + (5(2 + (sqrt(7)3)2) - ((4sqrt(70)3)/sqrt(10))2) + -1. -686 Simplify (sqrt(3) + -2 + -2sqrt(3) - (sqrt(3) + sqrt(1080)/sqrt(10)))3 + (sqrt(108)/sqrt(4) - sqrt(27) - sqrt(27))26-13. -492 - 24sqrt(3) Simplify 2((sqrt(528)1 - sqrt(528))-6 + (sqrt(528) - sqrt(528)2-3))/((sqrt(11) + sqrt(55)/sqrt(5))53). 28sqrt(3)/15 Simplify (-1(1(sqrt(432) + sqrt(432)-2) - sqrt(432) - sqrt(432) - sqrt(432) - sqrt(432))*2 - -2(sqrt(432)1 + -2)) + -2 + 5 + -5. -10806 + 24sqrt(3) Simplify (sqrt(102) + -31sqrt(102) - 3(1sqrt(102) - sqrt(102)))/(sqrt(216) - -2-1sqrt(216)). sqrt(17)/3 Simplify (-5 + 0 + ((4 + sqrt(1100)-1 - sqrt(1100)) + -4 - (-21sqrt(1100) + -4)))2. 1 Simplify ((sqrt(45) - (1sqrt(45)1 - sqrt(45)))/(sqrt(720)/sqrt(5)))2 - (3(1sqrt(180) - sqrt(180)) - (sqrt(180)2 + -4))*2. -11771/16 + 96sqrt(5) Simplify 4((1(-2 + -6sqrt(931)1))*2 + 2)1. 672sqrt(19) + 134088 Simplify ((sqrt(152)-34)/(1sqrt(36)))/((sqrt(3168) + sqrt(22))/sqrt(11) + (-6sqrt(22))/sqrt(11)). -4sqrt(19)/7 Simplify ((-1 + -3sqrt(684))6 - ((sqrt(171) - (sqrt(171) + 1(sqrt(171) + 1sqrt(171)) - sqrt(171))) + (-2 + sqrt(171))5))2. -960sqrt(19) + 273616 Simplify ((sqrt(3300) - (sqrt(3300) - (-1sqrt(3300) + sqrt(3300) - sqrt(3300)))-2)4)/((sqrt(11) + sqrt(66)/(sqrt(18)/sqrt(3) + sqrt(6)) + sqrt(275)-1)-4). 100sqrt(3)/7 Simplify (5(sqrt(288)2 + sqrt(288)))/(sqrt(54) + -2sqrt(3456)). -4sqrt(3)/3 Simplify (-4(sqrt(170)2 + sqrt(170) - sqrt(170))1-3)/((sqrt(1210) + (-2-1sqrt(1210) - sqrt(1210)))5). 12sqrt(17)/55 Simplify ((sqrt(320) + sqrt(320)-2)-3 - (1 + sqrt(320))1 - (1 + (sqrt(320) + -3(sqrt(320)1 + sqrt(320)))2))*2. -384sqrt(5) + 46084 Simplify (6sqrt(36)/sqrt(6))/((sqrt(27)3)/sqrt(9)) + (sqrt(48)/(sqrt(20)/sqrt(5)))/(-3sqrt(150) - sqrt(150) - sqrt(150)). 49sqrt(2)/25 Simplify ((1sqrt(228) + sqrt(228))5-46)/(sqrt(108)/(sqrt(36)/sqrt(4)) + sqrt(12) + sqrt(432)1)4. -120sqrt(19) Simplify (-1 + 3(-2sqrt(1088) + -3 - (sqrt(1088) - (-6(sqrt(1088) - (sqrt(1088)2 - sqrt(1088))) + sqrt(1088)))) + (2 + -5 + sqrt(1088)2)-3)2. 192sqrt(17) + 156673 Simplify -5(((sqrt(77) - sqrt(77)23 - sqrt(77)) + sqrt(77))/(-5sqrt(44) - sqrt(11)) - (((sqrt(84)1)/sqrt(12))2 + (4sqrt(7)2)2)). -25sqrt(7)/11 + 2275 Simplify 1 + (13-2sqrt(153)-2)/(-3-33sqrt(27)/sqrt(3)). 1 + 4sqrt(17)/9 Simplify 22(-2 + 1 + (-1 + (sqrt(684) - (sqrt(684) + 0 + -4)))*2 + 2). 40 Simplify (1 + 3sqrt(1900)-3 + -1 + sqrt(1900) + 1 + -5 + 0)2 + 3. 640sqrt(19) + 121619 Simplify 5 + -1(sqrt(272) + (sqrt(272) + (sqrt(272) - sqrt(272)2) + sqrt(272))*2) + (sqrt(272)-1 - sqrt(272))-4 + (-3 + -1sqrt(272))*2-2 + 2. -827 - 20sqrt(17) Simplify 1((sqrt(1331) - (sqrt(1331) - -4sqrt(1331)))6 + 5 - -4(-4 + (sqrt(11) - sqrt(11)2 - sqrt(11)) - (sqrt(22)/(sqrt(8)/sqrt(4)))*2)). -272sqrt(11) - 55 Simplify (((sqrt(136)1)/sqrt(8) - (sqrt(85)/sqrt(5) + -1)) + 4(sqrt(612)	{ "pile_set_name": "DM Mathematics" }
llect the terms in d + 213 + 665 + 20d - 25d. -4d + 878 Collect the terms in 20463 + 240 + 11500 - b. -b + 32203 Collect the terms in 154m*2 + 6462m*3 - 6466m*3 - 43m*2. -4m*3 + 111m*2 Collect the terms in 119329b + 9 - 40022b - 39746b - 39976b - 9. -415b Collect the terms in 6450x2 + 25x*3 - 8x*3 + 6473x*2 - 9x*3 - 9x3. -x3 + 12923x2 Collect the terms in -209 - 229 - 2u*2 - 240 + 678. -2u*2 Collect the terms in -6423759a*2 + 2141318a*2 + 2141259a*2 + 2141253a*2. 71a*2 Collect the terms in -2501f*3 + 883f*3 - 273f*3 + 1892f3. f3 Collect the terms in 309f + 7f*2 - 97f - 143f - 69f. 7f2 Collect the terms in -406971615 - 406971616 + 813943231 - 7i*2. -7i*2 Collect the terms in -518a*2 + 1013a*2 - 510a*2 - 9 + 11 - 2 - 4. -15a*2 - 4 Collect the terms in 879o + 873o + 667 - 198. 1752o + 469 Collect the terms in -13a2 - 56a*2 - 465a*2 + 73a*2 - 606a*2. -1067a*2 Collect the terms in 4128d - 2683d2 + 3346d + 2733d2. 50d*2 + 7474d Collect the terms in 30 + 24 + 26 - 16 + 14 - k. -k + 78 Collect the terms in 7047695l - 783l*3 - 7047695l. -783l3 Collect the terms in 4 + 261d*3 - 4 + 289d*3 - 661d*3 + 103d*3. -8d*3 Collect the terms in k - 6331 + 40881 + 0k + 0k. k + 34550 Collect the terms in -209576l*2 - 209576l*2 - 30l*3 + 628736l*2 - 209584l*2. -30l*3 Collect the terms in 56x - 26x - 10794860 + 10794860 - 25x. 5x Collect the terms in 2459 - 621 - 620 - 625 - 593 - 3d*3. -3d*3 Collect the terms in -2247s*2 + 338 - 338 - 3193s*2 - 671s*2 - 864s*2. -6975s*2 Collect the terms in -5r*2 + 1478 + 5r*2 + 2r*2 + 21r*3 - 37r*3 - 3r*3 + 22r*3. 3r*3 + 2r*2 + 1478 Collect the terms in -27127 + 4471j*2 - 161j*2 + 27128. 4310j*2 + 1 Collect the terms in 2865224l*3 + 2864468l*3 - 5729693l3. -l3 Collect the terms in 1904q2 - 9292q*2 - 3700q*2 - 9q*3. -9q*3 - 11088q*2 Collect the terms in 14u*3 + 77u*3 + 2u - 342u3 + 127u*3 + 48u*3. -76u*3 + 2u Collect the terms in -2883a - 2891a - 2918a + 8694a. 2a Collect the terms in -128582247862n + 128582247862n + 3n2 - n2. 2n2 Collect the terms in -1240 + 922 + 916 - 8j - 598. -8j Collect the terms in 5j*3 + 150j + 19j - 52j*3 - 169j. -47j3 Collect the terms in -u2 + 3u*2 + 7581u*3 - 14837u*3 - 2u*2 + 0u*2 + 7273u*3. 17u*3 Collect the terms in 9180 - 4590 + 1383d - 4590. 1383d Collect the terms in -3216l - 3207l + 16040l - 3205l - 3209l - 3211l. -8l Collect the terms in 0o3 - 4o*3 - 40787o*2 + 81598o*2 - 40811o*2 - 2o*3. -6o*3 Collect the terms in 28672w*3 - 137990w*3 + 4044485w - 4044485w. -109318w*3 Collect the terms in -55 - 129529r*2 + 129529r*2 - 2r*3 - 77. -2r*3 - 132 Collect the terms in 162116v + 1347169 - 1347169 - 162117v. -v Collect the terms in 1 + 3786p*3 + 3790p*3 - 11373p*3 - 3 + 3790p*3. -7p*3 - 2 Collect the terms in -193k*2 - 213k*2 - 261k*2 - 182k*2 + 851k*2. 2k*2 Collect the terms in 814 - 638o*3 - 1629 + 5706o*3 + 815. 5068o*3 Collect the terms in -29108 + 9677 + 9761 + 5q*3 + 9670. 5q*3 Collect the terms in -44 + 4 + 10 - 25128b*2 + 31 - 1 + 25127b2. -b2 Collect the terms in 106d - 14d + 87d. 179d Collect the terms in 0y + y + 19y*2 - 84310y*3 - 4y*2 - 15y*2. -84310y*3 + y Collect the terms in -1673g*3 - 1664g*3 - 1674g*3 - 1666g*3 + 8352g*3 - 1671g*3. 4g*3 Collect the terms in -48057272g*2 - 48057265g*2 + 96114526g*2. -11g*2 Collect the terms in 5p*2 - 2540p - p*2 + 50 + 2390p - 5p2. -p2 - 150p + 50 Collect the terms in 2786 + 5i - 1104 - 19i - 1682. -14i Collect the terms in -26 + 70 + 10w + 12w - 118w - 44. -96w Collect the terms in 30h*2 + 135h*3 + 2h - 48h3 - 12h*2 + 0h. 87h3 + 18h*2 + 2h Collect the terms in -868732362 + 1737464728 + 0p - 868732366 - p. -p Collect the terms in -596 - 36 + 17s - 45s - 34s. -62s - 632 Collect the terms in 25 - 12860h*3 - 3907h*3 + 21 - 46 - 3h*2. -16767h*3 - 3h*2 Collect the terms in -11546p*2 + 9923p*2 + 12698p*2. 11075p*2 Collect the terms in -64841b + 259395b - 64852b - 64849b - 64849b. 4b Collect the terms in -758z + 307z + 402z - 8z2. -8z*2 - 49z Collect the terms in -22 + 22 - 511g3 + 398g*3. -113g*3 Collect the terms in 98 + 1298j*3 - 1300j*3 + 38 - 161 + 25. -2j*3 Collect the terms in -39033140 + 39033140 - 6258b. -6258b Collect the terms in -4805j*2 - 9j + 35j - 26j. -4805j2 Collect the terms in 106781233s + 106781229s - 320343694s + 106781234s. 2s Collect the terms in 4 + 6 - 134257u + 66923u + 67070u - 10. -264u Collect the terms in -2k - 407956911826 + 407956911826. -2k Collect the terms in 14078 - 6h3 + 13742 - 27779. -6h*3 + 41 Collect the terms in 80625m + 80139m - 160765m. -m Collect the terms in -11961d - 7 + 5984d - 18 + 5977d + d2. d2 - 25 Collect the terms in -413p + 163p - 412p - 415p - 407p + 1492p. 8p Collect the terms in -37 + 9 - 4 - 2623l. -2623l - 32 Collect the terms in -1870d2 + 7471d*2 - 1863d*2 - 9 - 1864d*2 - 1869d*2. 5d*2 - 9 Collect the terms in -21s*3 - 29827s*2 + 7448s*2 + 7459s*2 + 7464s*2 + 7456s*2. -21s*3 Collect the terms in 125g*2 - 125g*2 + 1319g*3 - 2015g*3 + 701g*3. 5g*3 Collect the terms in -2 + 2w + 35 + 52 + 33 + 15 - 11. 2w + 122 Collect the terms in 9 - 11 + 622v - 2 + 7. 622v + 3 Collect the terms in -5238t*2 + 2644t*2 + 2587t*2 - 114. -7t*2 - 114 Collect the terms in -18c*3 + 2065c*2 - 4146c*2 + 2081c*2 - 12c*3 - 19c*3 + 52c*3. 3c*3 Collect the terms in 3w - 2w - 4 - 41w*3 + 4w - 7w + 14. -41w*3 - 2w + 10 Collect the terms in 8r2 + 6r*2 - 855884 + 6r*2 - 15r*2 + 855884. 5r*2 Collect the terms in -11 - 5888h - 3686h + 7 + 3508h. -6066h - 4 Collect the terms in -3f*2 - 4f2 - f2 - 6 - 40f + 3 + 0. -8f*2 - 40f - 3 Collect the terms in x*3 + 92774083577893x*2 - 92774083577893x2. x3 Collect the terms in 34437q + 91337q + 10375q. 136149q Collect the terms in -89138200q + 89138200q - 2623q2. -2623q*2 Collect the terms in -52704 + 26630 + 11k + 26074. 11k Collect the terms in 1834b - 132 - 137 + 413 - 143. 1834b + 1 Collect the terms in 36m*2 + 11 + 5m*2 + 30m*2 - m + 25m*2 - 12m*2. 84m*2 - m + 11 Collect the terms in -2 - 18r*2 - 453r*2 + 3r - 15r2. -486r*2 + 3r - 2 Collect the terms in -179257n2 + 537771n*2 + 2n - 179258n2 - 2n - 179258n2. -2n*2 Collect the terms in 11u*2 - 1482u*2 - 226u*2 + 278u*2 + 246u*2. -1173u*2 Collect the terms in -18955n + 18929n + 54066 - 27022 - 27044. -26n Collect the terms in 219148d - 55644d + 80389d. 243893d Collect the terms in -39195640n + 117586930n - 39195653n - 39195664n. -27n Collect the terms in -2895t*2 - 285t*3 + 4436t*2 - 771t*2 - 770t*2. -285t*3 Collect the terms in -55g + 2276420685 - 2276420685. -55g Collect the terms in -232620y - 396709y - 270871y. -900200y Collect the terms in -24190 + 58033 - 3a*2 + 55167 - 1533. -3a*2 + 87477 Collect the terms in -27n*2 + 37n*2 + 121n*2 - 53n*2 - 28n*3 + 123n*2. -28n*3 + 201n*2 Collect the terms in -82v + 158v - 146618 + 146618. 76v Collect the terms in 62619k3 + 217217k*3 - 31183k*3 + 60496k*3. 309149k*3 Collect the terms in -911 - 4c - c - 944 + 3c - 744 + 2599. -2c Collect the terms in -698590 + 349239 + b + 349246. b - 105 Collect the terms in -1446l - 1438l - 1446l - 1442l + 5748l. -24l Collect the terms in -2849s - 7 + 748s + 705s + 698s + 702s. 4s - 7 Collect the terms in -180 - 97 + 7h2 - 93 + 358. 7h*2 - 12 Collect the terms in -53s + 18s + 58 + 18s + 9s + 10s. 2s + 58 Collect the terms in -2 - 1 - 2 - 2865921l + 2 + 2865910l. -11l - 3 Collect the terms in 233i2 + 213i*2 - 221i*2. 225i*2 Collect the terms in 66 + 2g + 78 - 136 + 91g2. 91g*2 + 2g + 8 Collect the terms in 255468l - 26l*3 - 127734l + 21l3 - 127734l. -5l*3 Collect the terms in	{ "pile_set_name": "DM Mathematics" }
2. 24sqrt(5) + 189 Simplify (3(-1 + sqrt(10)/sqrt(2) - (sqrt(200)/sqrt(4))/sqrt(10))-3)2. 81 Simplify 0 + sqrt(2) + -1 + 0 + sqrt(8). -1 + 3sqrt(2) Simplify -1(3 + -5 + sqrt(162) + -1). -9sqrt(2) + 3 Simplify -3 + sqrt(117)2. -3 + 6sqrt(13) Simplify (0 + sqrt(468) + 5)*2. 60sqrt(13) + 493 Simplify (1 + sqrt(21)/(sqrt(56)/sqrt(8)))*2. 2sqrt(3) + 4 Simplify (0 + sqrt(19) + sqrt(76) + -1)*2. -6sqrt(19) + 172 Simplify sqrt(176) + -1 - (5 + sqrt(11) + -2 + sqrt(11))*2. -54 - 8sqrt(11) Simplify 3 + sqrt(24)/sqrt(3). 2sqrt(2) + 3 Simplify -4(-6((sqrt(5) - sqrt(15)/sqrt(3)) + sqrt(5)) - (sqrt(20)/(sqrt(8)/sqrt(2) + sqrt(4)) + sqrt(5) - sqrt(5))). 26sqrt(5) Simplify sqrt(20)/((sqrt(40)/sqrt(2))/sqrt(5)). sqrt(5) Simplify -4 + sqrt(38)/sqrt(2) - -3sqrt(19)2. -4 + 7sqrt(19) Simplify ((sqrt(152) - -1sqrt(152))-5)/(sqrt(16)/(sqrt(50) + sqrt(2))). -60sqrt(19) Simplify sqrt(44)/(2sqrt(196)). sqrt(11)/14 Simplify 4 + sqrt(85)/(sqrt(45)-2). -sqrt(17)/6 + 4 Simplify 0 + ((0 + sqrt(245))6)2. 8820 Simplify -6sqrt(19)-3 - (sqrt(19) - sqrt(57)/(sqrt(12)/sqrt(4))). 18sqrt(19) Simplify -1(0 + sqrt(128))2. -128 Simplify (2 + 1 + 1(sqrt(17) + 0))*2. 6sqrt(17) + 26 Simplify 0 + sqrt(1053) + sqrt(1053) + (sqrt(208))*2-5 + sqrt(13). -1040 + 19sqrt(13) Simplify (sqrt(102)/(sqrt(12)/sqrt(4)))/(sqrt(288) - (2sqrt(288) + sqrt(288) - sqrt(288)) - sqrt(288)). -sqrt(17)/24 Simplify ((sqrt(2448) - (0 + sqrt(2448) + sqrt(2448))*2) + -4)-4. -48sqrt(17) + 39184 Simplify (-4(sqrt(78)-2 - sqrt(78)))/sqrt(6). 12sqrt(13) Simplify (sqrt(54) - sqrt(6))/sqrt(2) + ((sqrt(75) + -1 + sqrt(75))*2 - sqrt(75)). -23sqrt(3) + 301 Simplify (-5(3 + sqrt(190)/sqrt(160)))2. 75sqrt(19)/2 + 4075/16 Simplify ((sqrt(176) + 4 + sqrt(176) - sqrt(176)) + 4)*2. 64sqrt(11) + 240 Simplify 11sqrt(475) + (0 + -1sqrt(475))2. 5sqrt(19) + 475 Simplify ((sqrt(1573) - (sqrt(1573) + 2)) + sqrt(1573))*2 - (3sqrt(156))/sqrt(12). -47sqrt(13) + 1577 Simplify sqrt(4)/(sqrt(2)-2) + sqrt(288) + 1. 1 + 23sqrt(2)/2 Simplify sqrt(36)/(sqrt(36)/sqrt(3)-4). -sqrt(3)/4 Simplify ((sqrt(162) + sqrt(162) + 0)4 - sqrt(162))2. 7938 Simplify 0 + (sqrt(448) + 4)-1. -8sqrt(7) - 4 Simplify ((sqrt(242) + 0 + -3 - -4(sqrt(242) - (1 + sqrt(242)))) + 0)*2. -154sqrt(2) + 291 Simplify 5 + (-5 + sqrt(176)2)2. -80sqrt(11) + 734 Simplify (sqrt(11) + 5sqrt(33)/sqrt(3))2. 12sqrt(11) Simplify (sqrt(1053) + sqrt(1053) + sqrt(1053)-1)*2 - sqrt(156)/(-2sqrt(12)). sqrt(13)/2 + 1053 Simplify -4(((sqrt(3) + 1)3)*2 - sqrt(3)) + ((sqrt(6) - (sqrt(6)-2 - sqrt(6)))/sqrt(2) - sqrt(33)/(sqrt(44) - sqrt(11))). -144 - 65sqrt(3) Simplify sqrt(17) + ((sqrt(2448) - sqrt(2448)-1) + sqrt(17))*2 + (6sqrt(68)/sqrt(4))*2. sqrt(17) + 11237 Simplify (sqrt(19) + (-4 + 1 + sqrt(19) - sqrt(19)) - (sqrt(190)/(sqrt(10)2) + sqrt(19)))5. -15 - 5sqrt(19)/2 Simplify 5(-2sqrt(300))*2-3. -18000 Simplify -2 + -2 + (3 + sqrt(7))*2. 12 + 6sqrt(7) Simplify sqrt(187)/sqrt(176) + sqrt(17) - (-1 + 0 + sqrt(17))*2. -18 + 13sqrt(17)/4 Simplify 3sqrt(192)3. 72sqrt(3) Simplify (sqrt(245) - sqrt(245)-2) + sqrt(30)/sqrt(54). 64sqrt(5)/3 Simplify -6(sqrt(720)1 + -2(sqrt(5) - sqrt(5)-1)) + -2. -48sqrt(5) - 2 Simplify sqrt(36)/(sqrt(48)/(1sqrt(4) + sqrt(4) + sqrt(4))) + 3 + 0 + (2sqrt(3))*2. 3sqrt(3) + 15 Simplify -2(-2sqrt(448) - sqrt(448))*2. -8064 Simplify (1sqrt(20)2)/(sqrt(90) + -2sqrt(90)). -2sqrt(2)/3 Simplify ((sqrt(112) - sqrt(28)) + -2)2. -8sqrt(7) + 32 Simplify sqrt(24)/sqrt(108) + -5(sqrt(2)-1)*2. -10 + sqrt(2)/3 Simplify 5(-1 + sqrt(1088) + 2). 5 + 40sqrt(17) Simplify (sqrt(280)/sqrt(7)-2)/sqrt(8) + 2. -2sqrt(5) + 2 Simplify sqrt(19) + sqrt(19) + 1 + sqrt(19) + 5 + -5 + -2 + sqrt(19). -1 + 4sqrt(19) Simplify (sqrt(57)/(sqrt(3) - sqrt(108)) - -6(sqrt(19) + 0))2. 15979/25 Simplify (0 + sqrt(325) + -5)-1. -5sqrt(13) + 5 Simplify (sqrt(1573) + -4 + 1)2. -66sqrt(13) + 1582 Simplify 44(sqrt(17) - sqrt(153)). -32sqrt(17) Simplify -3 + (-1 + sqrt(1300))2. -20sqrt(13) + 1298 Simplify (-2sqrt(704)-2 + 4 + -3)*2. 64sqrt(11) + 11265 Simplify (sqrt(48) + -1)*2. -8sqrt(3) + 49 Simplify (-3sqrt(304)-2)*2. 10944 Simplify sqrt(108)-5 + 4. -30sqrt(3) + 4 Simplify 3 + -2 + sqrt(343) + sqrt(7). 1 + 8sqrt(7) Simplify (-1sqrt(325))2 + 4. 329 Simplify ((sqrt(1300)2 + sqrt(1300))1)2. 11700 Simplify sqrt(64)/sqrt(2) + (sqrt(12)/sqrt(2))/sqrt(3). 5sqrt(2) Simplify 1sqrt(49)/(sqrt(14)/sqrt(2)) - (-2sqrt(448))*21. -1792 + sqrt(7) Simplify (sqrt(1216) + 0)*2 + 1. 1217 Simplify (-1((sqrt(192) + 0)4 + -5 + sqrt(192)-1))*2. -240sqrt(3) + 1753 Simplify sqrt(3) + sqrt(6)/sqrt(2) + -1 - sqrt(75)2. -8sqrt(3) - 1 Simplify (sqrt(11) + (sqrt(99) + sqrt(99)-3)/sqrt(9))-23. 6sqrt(11) Simplify sqrt(1573)-3 + -2. -33sqrt(13) - 2 Simplify 3(2 + (sqrt(102)1)/sqrt(6)). 6 + 3sqrt(17) Simplify (0 + sqrt(1088) + -2 - sqrt(1088) - (2 + sqrt(1088) + -1))2. 48sqrt(17) + 1097 Simplify 4((-2sqrt(3))*21 + 5). 68 Simplify (4(-1sqrt(7) + 0))*2. 112 Simplify (((sqrt(68) - -2sqrt(68))3)/(-5sqrt(4)-2))2 + -3. 1077/100 Simplify (2sqrt(567) + -5)*2. -180sqrt(7) + 2293 Simplify (2(sqrt(396) + -1 + -3 + sqrt(396))-1)*2. -384sqrt(11) + 6400 Simplify 4sqrt(12)/sqrt(4)6. 24sqrt(3) Simplify sqrt(17) + 1 + sqrt(153) + sqrt(68)-4. -4sqrt(17) + 1 Simplify ((sqrt(110) + sqrt(110)4 + sqrt(110))/sqrt(10))*21. 396 Simplify (-3 + (sqrt(13) - (sqrt(13) + -2)) - 3sqrt(208))3. -36sqrt(13) - 3 Simplify sqrt(60)/sqrt(192) + 4 - (4 + -1 + (sqrt(5) + 0 - sqrt(5)))2. -5 + sqrt(5)/4 Simplify (1sqrt(5760))/(2sqrt(40)/sqrt(5)). 6sqrt(5) Simplify (sqrt(34)/(sqrt(6)/(sqrt(21)/sqrt(7))))*2. 17 Simplify ((sqrt(405) + (sqrt(405) - ((sqrt(405) + (sqrt(405) - (sqrt(405) - (sqrt(405) + sqrt(405)-2))) - sqrt(405)) + sqrt(405))))/sqrt(9))*2 + -2. 178 Simplify sqrt(68)/(sqrt(20)/(sqrt(5)-1)). -sqrt(17) Simplify (sqrt(832) + sqrt(832)1 - sqrt(832) - sqrt(832))5. 0 Simplify (sqrt(78) - ((1-2sqrt(78) - sqrt(78)) + sqrt(78) + sqrt(78) - sqrt(78)))/(sqrt(6) - sqrt(36)/sqrt(54)). 9sqrt(13)/2 Simplify ((sqrt(3) + 6sqrt(27))*2 - (sqrt(27)3)*2)6. 5040 Simplify 2 + (2 + (sqrt(99))*2-1)-6. 584 Simplify (5 + sqrt(7) + 0)6. 6sqrt(7) + 30 Simplify (-2 + 1 + sqrt(60)/(sqrt(12) + sqrt(108) + -2sqrt(108)))*2. sqrt(5) + 9/4 Simplify 3(2 + sqrt(75))*2. 60sqrt(3) + 237 Simplify ((sqrt(8)-2)2 - (sqrt(32) + -3))3-2. -210 + 24sqrt(2) Simplify sqrt(3) + sqrt(12)/sqrt(4)6 - (sqrt(3) + 1sqrt(3) + 1). -1 + 5sqrt(3) Simplify ((sqrt(98)-1 - sqrt(98)) + sqrt(98))*2 + sqrt(72) + 2. 6sqrt(2) + 100 Simplify (sqrt(119)-1)/sqrt(7)-2 + 2. 2 + 2sqrt(17) Simplify sqrt(2187) - (5 + sqrt(2187) + -2sqrt(2187)). -5 + 54sqrt(3) Simplify (2sqrt(1584) + 1)*2. 48sqrt(11) + 6337 Simplify (4(sqrt(539) + sqrt(539) + -1)-6)*2. -16128sqrt(11) + 1242432 Simplify (sqrt(11) - (sqrt(396) + 0)) + sqrt(44)/sqrt(144). -29sqrt(11)/6 Simplify (sqrt(396) + 4 + sqrt(11) + sqrt(1100)/sqrt(4) + sqrt(11))2. 104sqrt(11) + 1875 Simplify ((sqrt(17)3)2 - sqrt(17)) + -2 - (sqrt(17) + sqrt(170)/(sqrt(10)-4)). -7sqrt(17)/4 + 151 Simplify sqrt(42)/(2sqrt(726) - sqrt(726))-6. -6sqrt(7)/11 Simplify 4(1sqrt(192))*2. 768 Simplify sqrt(20)/(sqrt(20)/sqrt(2)) - sqrt(22)/(-2sqrt(11)). 3sqrt(2)/2 Simplify (sqrt(42)/(2sqrt(6)))*26. 21/2 Simplify (-2 + sqrt(102)/((sqrt(6) + sqrt(6)-2)-3))*2. -4sqrt(17)/3 + 53/9 Simplify (2-1sqrt(931) - ((-1 + sqrt(931))-1 + sqrt(931)))2. 28sqrt(19) + 3725 Simplify (-1-2sqrt(17)5)2. 1700 Simplify (sqrt(3) + (sqrt(75)4 - sqrt(75))*2)-4. -2700 - 4sqrt(3) Simplify sqrt(38)/(sqrt(8)/sqrt(4))-3. -3sqrt(19) Simplify -6(0 + (sqrt(637) - 4(-1 + sqrt(637))) + sqrt(637)). -24 + 84sqrt(13) Simplify (sqrt(55) + ((sqrt(220) - -3sqrt(220)) + sqrt(220))/sqrt(4))/((sqrt(11)2 - sqrt(11))-1). -6sqrt(5) Simplify ((sqrt(14) - sqrt(42)/sqrt(3))-3)/sqrt(7). 0 Simplify (-5 + 5sqrt(275)-2)-1. 5 + 50sqrt(11) Simplify 0 + (-5 + 1sqrt(7))*2 + -5. -10sqrt(7) + 27 Simplify (sqrt(200)/(sqrt(30)/sqrt(3)))/(sqrt(30)/(sqrt(9)/sqrt(3))). sqrt(2) Simplify 1(4 + (sqrt(13) - ((sqrt(13) + -2)-2)*2)). -64 + 17sqrt(13) Simplify 3*(	{ "pile_set_name": "DM Mathematics" }
- 396/84. Let w be r(g). Suppose -3m = wq - 517, 0q = 5q + 2m - 1265. Is q composite? False Suppose -18h = b - 22h - 8793, 5b - 44075 = -2h. Is b a prime number? False Let z be -1 - (1 + 0) - 87. Suppose -3d - 13h = -17h - 18, -2d = h + 10. Is (d - z) + (-8)/(-4) a prime number? True Suppose 67i + 72763317 = 313i + 9708351. Is i a prime number? False Suppose 18d - 47133 = 890928 + 364761. Is d a prime number? True Suppose 0 = -5t - 818 + 6638. Suppose -169 = 14c + 11269. Let o = t + c. Is o a prime number? True Suppose -11700 + 2544 = 6w. Let s = 4873 + w. Is s a composite number? False Let l be (-1149)/(-9) - 20/(-15). Suppose z + 2q + l = 0, -4z - 10q - 506 = -7q. Let n = z - -342. Is n prime? False Suppose -2b - 3h = 27, -4h + 34 = -3b - 2h. Let o(g) = -2g3 - 5g*2 - 3g + 47. Is o(b) a prime number? True Suppose 0 = -18t + 82t + 135t - 29488417. Is t a composite number? True Suppose -v + 3c + 301432 = 0, -2v + 12c = 11c - 602889. Is v composite? False Suppose 5w - 29 = -4. Suppose 21 = 2u + d, -wu = 4d - 72 + 12. Is 2/u(0 - -4772) a prime number? True Let i = -15579 + 32978. Is i a prime number? False Is 18/9922 + 1274 + -1 composite? False Suppose -33506 = -26r + 108974. Suppose -5p = -n - r, n = -3p + 235 + 3061. Is p a composite number? False Suppose -48o + 40o - 24 = 0. Is 12/o(-529)/4 a prime number? False Let t(w) = w2 - 25w - 146. Let u be t(-5). Is (-9)/(-6)((-188148)/(-18) + u) prime? False Suppose -7o = -3o - 2d - 8388, o + 4d - 2115 = 0. Suppose -o = -5n + 4n. Is n a prime number? True Let p = -97 - -278. Suppose v + 2z + 2z = p, 0 = -2v + z + 317. Is v prime? False Is (-24427/108)/(2/(-1042)) a prime number? False Let l be 3/(((-4)/(-799 + -1))/(-2)). Suppose 2v + 6090 = -2f - 2f, 0 = -4f - 4. Let h = l - v. Is h prime? False Let x be ((-4)/(-2))/(6/(-675)). Let a = -86 - x. Suppose -u = 12 - a. Is u a composite number? False Suppose 49469 + 516701 = 10n. Is n composite? True Let s be 0/(-4 + 8) + 3. Suppose 3f = 4u + 4197, su - 4f - 2126 = 5u. Let k = u - -2168. Is k composite? True Let q be (12229/4)/(1/(-8)). Let b = 51675 + q. Is b composite? True Suppose -11j + 25 = 3. Suppose -1225 - 9947 = -4k - 4y, jk + 3y - 5582 = 0. Is k prime? True Suppose -27874 = -43m + 29m. Suppose 0 = -4k + 3v + 9618 - m, -5v - 5 = 0. Is k composite? True Suppose 4v + 5x - 1831 = v, 3v - 3x = 1815. Let a(d) = -8d + 51. Let c be a(6). Suppose 0i + 5i - v = -4h, -ci = 15. Is h a composite number? True Suppose 0 = 194k - 206k + 2014332. Is k a composite number? False Is -9(-10)/(-540)-44994 composite? False Let q(r) = -1255r2 - 4r - 16. Let w be q(-2). Let g = -659 - w. Is g a composite number? True Suppose -2b - 10200 = -2h - 3h, -4b = -20. Let v = h + -1099. Is v a composite number? True Suppose 0 = 3s - 59x + 58x - 163385, -3x + 12 = 0. Is s a prime number? False Let q(h) = 2h3 + 205h*2 + 230h - 301. Is q(-90) prime? True Is (-10)/36 + (-1)/(-6) - (-120984408)/486 composite? True Let z(x) = 136x + 33. Let h(i) = -68i - 16. Let q(j) = -7h(j) - 3z(j). Is q(8) prime? True Let f be ((-24)/4)/(-6) - 1400. Let s = f + 4782. Is s composite? True Let a(q) = -q*2 + 12q - 2. Let z be a(12). Let g be z/7 - 176/(-77). Suppose 4p - 2791 = -t, -gp - 3482 = -7p + t. Is p a prime number? False Let b(h) = 11h*2 - h - 39. Let s be b(8). Let a = s - -16. Is a a prime number? True Let t = 25 + -25. Suppose t = -9l + 3951 + 5094. Is l/(-2)38/(-57) a prime number? False Suppose -4n - 5c - 11905 = 20582, -c = -4n - 32517. Is (-1 + 0)/(n/(-2712) - 3) a prime number? False Suppose 0g = -14g + 112. Suppose -gj + 9j = 0. Is (-1 + j)/((-5)/11245) a composite number? True Suppose 0 = -3l - 9l - 5478912. Is -2 + (-22)/(-14) - l/84 prime? False Let z(j) = j3 + j2 + 2j + 120. Let t be z(0). Let u(q) = tq + 266q - 9 - 118q. Is u(2) prime? False Suppose l = -5l + 312. Is 8/l - 31861/(-13) - -2 composite? True Let l(v) = v3 + 3v*2 - 2v - 4. Let s be l(-3). Let m(a) = 2a + 0a + a + as + 1 - a3. Is m(-6) a prime number? False Suppose -400h + 171152392 + 133846408 = 0. Is h a prime number? False Suppose -28074 = 54j - 60j. Let b = 6906 - j. Is b prime? False Let d(f) = f2 - 5f - 1613. Let k be d(0). Let x = 2508 + k. Is x prime? False Let d = 529135 - 1853052. Is d/(-84) + 1/12 a prime number? True Let w be (2/4)/(4 - (-1722)/(-432)). Let j(d) = 40d + 103. Is j(w) a prime number? True Let t(j) be the second derivative of -89j3/3 + j2/2 + 11j. Let x be t(-2). Suppose b = -2b + x. Is b prime? False Suppose 5y - 824800 = 5w, -35y + 659777 = -31y + 5w. Is y a composite number? False Let q = 350 - 340. Let g(o) = o3 - 2o*2 - 28o + 1. Is g(q) a composite number? False Let n(l) = -97480l - 99. Is n(-2) a prime number? True Is (-391076914)/(-1898) - 4/(-26) prime? True Suppose -825z = -829z + i + 225409, 5z - 281735 = -4i. Is z a prime number? False Let y = 70807 - 27146. Is y composite? False Suppose -12453806 = -44b - 54b + 9566304. Is b a prime number? False Let v = -263 - -268. Suppose 3927 = vm - 2o, o = -0m - 3m + 2365. Is m a prime number? True Let z(o) = 4505o - 4. Is z(7) composite? False Suppose -1561a = -1532a - 482009. Is a prime? False Suppose 39 + 31 = -7m. Is -5(-22)/275 + (-5326)/m prime? False Let h = -1517 - -1521. Let m(b) = -b*2 - 8b + 3. Let g be m(-8). Suppose -r + 683 = hv, -gv + 1198 = 2r - 178. Is r prime? True Suppose -689d = -687d - 288142. Is d composite? False Let g(s) = 25770s*2 - 19s - 37. Is g(-2) composite? True Let b be -3251 - (7/(-2) + (-24)/(-48)). Is b/(7 + -14) - -2 prime? False Suppose 117 = 3a - 5502. Suppose 72 = -2u + 5q, 4u + 2q + 122 = -u. Let d = u + a. Is d a composite number? False Suppose 6q = -55 + 73. Is 21821/6 + 4/q a prime number? False Let a(u) = 10607u*2 - 15u + 2. Let b be a(-2). Suppose 15413 + b = 3h. Is h prime? False Suppose -p + 112984 = 5g, 0 = -14g + 10g - 3p + 90385. Let z = g - 14084. Is z a composite number? False Let n(y) = 277y + 151. Let l(d) = d*2 - 7d + 20. Let s be l(8). Is n(s) a prime number? True Let n = -63 - -73. Let x(m) = -54m2 - 11m - 2. Let f be x(n). Let q = -3889 - f. Is q composite? True Suppose 5l - 6 = 14. Suppose lw + 3v + 57 - 10 = 0, 36 = -3w - 3v. Is (557/(-2))/(w/22) a prime number? True Suppose 4b - 24 - 4 = -3o, 2b + 8 = 4o. Suppose 0 = -2c - bd, 0 = 5c - 5d + 5 - 20. Is 377 - ((-8)/8)/(1/c) composite? False Suppose 2m - 13 = p, -2m + 5p - 10p - 17 = 0. Is m - (-1 + (-4 - 0) - 202) a prime number? True Suppose -33w = -20w - 1809197. Is w a prime number? True Let f(w) = -169w - 6. Let q(c) = 1. Let x(n) = f(n) - q(n). Is x(-2) prime? True Let r(q) = -q*3 + 3q*2 + 5q - 4. Let n be 1/((-4)/(-20 - -4)). Let a be r(n). Suppose a = c + 2c - 1113. Is c composite? True Let s(f) = 28f*2 - 3f + 1. Let j be s(1). Let w = -22 + j. Suppose 4i - 4b - 436 = 0, -b + wb + 101 = i. Is i composite? False Let n(x) = x2 - 5x - 2. Let c be n(6). Suppose -2g - 5m + 13 = 0, -6m = 4g - cm - 2. Let j(a) = -984a + 5. Is j(g) composite? True Let n(m) = -4m2 - m2 + m3 + 4m*2 - 1. Suppose 34j + 2u = 35j - 8, -3j + 3u + 27 = 0. Is n(j) composite? True Let b(l) = -18l - 36. Let p be b(-4). Suppose 0 = -32f + pf - 6964. Is f a prime number? True Suppose -2g = -s - 83513, 4g + 57970 = s + 225001. Is g prime? True Let a(h) = 14h + 2. Let r be a(0). Let p be 0 + (18960/(-3))/(-2). Suppose -z + 2z - 1581 = -rk, -4z + p = 4k. Is k a prime number? False Let r(x) = 2x3 - 9x*2 + 18x - 73. Let w(z) = z*3 - 1. Let q(y) = r(y) - 4w(y). Is q(-20) prime? True Let x = 14706 + -22578. Let j = x - -14941. Is j a composite number? False Let t = -107916 - -295265. Is t prime? True Let j be -68/(-22) - (-4)/(-22). Suppose -jq = 5q + 7. Let t = 30 - q. Is t composite? False Let n(m) = 2m3 - m2 - m - 3. Let p be n(9). Suppose 0 = -k + 5s - p, -4k - 5424 = -2s - 0s. Let i = k - -1986. Is i a prime number? True Let q be ((-6)/(-18) - (-5962)/6)1. Let j = q + -332. Is j a composite number? True Let s = -716 - -730. Suppose sh + 23315 = 19*h	{ "pile_set_name": "DM Mathematics" }
ors of n(-3). 31 Suppose 3h - 4 = 5g, 4h - 10 = 6g - 4g. Suppose 65 = 4v - hv. List the prime factors of v. 5, 13 Let k(a) = 18a*2 - 7a - 9. Let j be k(-3). Suppose 11n = 8n + j. What are the prime factors of n? 2, 29 Suppose 312 = 15a - 18. List the prime factors of a. 2, 11 Suppose -j - 3c = -208 + 45, -3j = 5c - 493. What are the prime factors of j? 2, 83 Suppose 0u - 2u = 2m - 84, 4u - 92 = -2m. Let o = m - 13. What are the prime factors of o? 5 Suppose 24 = 4q - 4w, q - 4 = -5w + 4w. Let p(x) = x + 0x - 3x + x2 - 6. List the prime factors of p(q). 3 Let x(q) = q2 - 10q + 19. Let c be x(8). Suppose -652 = -ct - 5v, 403 = 2t + v - 27. What are the prime factors of t? 2, 107 Let m be ((-3)/(-6))/((-3)/(-6)). Suppose 2t + m = -11. Let o = t - -11. List the prime factors of o. 5 List the prime factors of 9/(-6)8500/(-6). 5, 17 Suppose 0 = 6v - 0v - 156. Suppose vq = 14q + 1572. What are the prime factors of q? 131 Let g = -34 + 72. Let j = 92 - g. Suppose 3b - j = 18. List the prime factors of b. 2, 3 Suppose -3w - w = -12. Suppose -113 = wr - 602. List the prime factors of r. 163 Let v(l) = 2l - 9. Let t be v(6). Let c be 2 + (3 - (5 - t)). Suppose -78 = -cf - 3r, -5r - 2 = -f - 0r. What are the prime factors of f? 2, 11 Let x(q) = -29q - 7. Let i be x(-5). Let a = 199 - i. List the prime factors of a. 61 Suppose -6m = -11m + 15. Let q = 0 + m. List the prime factors of -3 + q + 12 - 1. 11 Let u(v) = 112v - 135. What are the prime factors of u(10)? 5, 197 Let u = -1139 - -3153. List the prime factors of u. 2, 19, 53 Let c be 33 - (4 + -1 + 0). Let l = c - 25. Suppose 4j + 31 = lj. What are the prime factors of j? 31 Suppose 2u + 0x = -x + 3, x + 6 = u. Suppose -3k = -9, 384 = f + uk + 123. List the prime factors of f. 2, 3, 7 Let s(w) = -w3 - 23w*2 + 15w + 206. List the prime factors of s(-26). 2, 461 Let t be ((-2)/1)/(-2 + (-8)/(-6)). Suppose tl + 727 = 5m, l = 2l - 1. List the prime factors of m. 2, 73 Suppose 0 = -6d - 1 - 29. Let k(p) = 5p - p2 - 6p - p*3 + 3p - 12. List the prime factors of k(d). 2, 3, 13 Suppose -2q + 6 = -q. Suppose 2m - 4r = -2, 0 = -4m + qr - r - 1. Suppose k - 3 = m. What are the prime factors of k? 2 Let u be 1310/18 - (33/(-27) + 1). Suppose -u = 2x - 5x - 4i, -5x + 160 = -i. What are the prime factors of x? 31 List the prime factors of -3 - (-6 - (910 + 4)). 7, 131 Let g(s) = 3s - 7. Let b = 23 - 20. Let w be g(b). Suppose 0y + 64 = wy. What are the prime factors of y? 2 Let y(z) = -z*3 - 8z*2 + 2z + 10. Let b be y(-8). Let a = b + 18. Let d = a + 3. What are the prime factors of d? 3, 5 Let u be 1(-2 + 2) + -9. Let f(b) = -2b*2 + 7b + 6. Let n(g) = -g*2 + 8g + 8. Let o(i) = -2f(i) + 3n(i). What are the prime factors of o(u)? 3 Suppose 2u - 784 = -232. List the prime factors of u. 2, 3, 23 Suppose -1746 = -8h + 670. What are the prime factors of h? 2, 151 Suppose -3v - 1 = m - 5, 2 = 4m - 2v. List the prime factors of m/(246/243 + -1). 3 What are the prime factors of 1/11 - 237544/(-253)? 3, 313 Suppose -6 + 2 = -z. Let h be 16 - 4z/16. Suppose -2a = l - h, -l + 2a + 11 + 20 = 0. What are the prime factors of l? 23 Let b(l) = -124l3 + 1. Let h be b(-1). Let i = 43 - h. Let q = -46 - i. List the prime factors of q. 2, 3 Let s be 52/10 + 3/(-15). Suppose 0 = o - 0o - s. List the prime factors of 208/o - 20/(-50). 2, 3, 7 Let r(b) = -b - 50. Suppose -5m + 2u = 4 - 14, -4m = -5u - 25. Let d be r(m). Let h = d + 90. List the prime factors of h. 2, 5 Suppose 4c - 626 = -q, 2c = -4q + 2786 - 338. Suppose 4f + s + 0s = 501, -5f + q = -2s. List the prime factors of f. 2, 31 Suppose 376f - 384f = -1376. List the prime factors of f. 2, 43 Suppose 0 = -7h + 8h - 123. List the prime factors of h. 3, 41 Let f = 94 - 89. List the prime factors of (f - 3)73 - -2. 2, 37 Let c = 2002 + 1256. List the prime factors of c. 2, 3, 181 Let p(c) = 3c3 + 2c*2 + 9c - 82. What are the prime factors of p(7)? 2, 277 Let u be (0 + 3 - 3)/4. Suppose -5c + uc + 138 = -3g, 2c + 2g = 52. List the prime factors of c. 3 Let t = 50 + 684. What are the prime factors of t? 2, 367 Let w = 10 + -5. Let u be 76 - 01/(-3). List the prime factors of (u/20)/(1/w). 19 Let l(d) = d*2 + d - 1. Let t be l(4). Suppose -t = -3j + x, -2j - 9 = -3j - x. Suppose -4f = -jf + 180. What are the prime factors of f? 2, 3, 5 List the prime factors of (-204)/(-136)5/((-30)/(-13652)). 3413 Let i(b) = 0b*2 + 0b2 + b2 - 3b + 34 + b. What are the prime factors of i(0)? 2, 17 Let v = -35 + 33. Let s be (-2 - 2 - v) + -76. Let w = s + 146. List the prime factors of w. 2, 17 Suppose -d - 4w = -3w, 5d = w - 18. Let q(h) be the first derivative of 2h3/3 + h2/2 - h - 80. What are the prime factors of q(d)? 2, 7 Let z(o) = 8o - 7. Let s be z(3). Let d = s + -12. Suppose -5r = -3n - 0n + 138, -4r = dn - 193. What are the prime factors of n? 41 Let p be ((0 - 0) + 1)12. Suppose -5l - p = 13. What are the prime factors of ((-7)/(-4))/(l/(-20))? 7 Let k be 42/10 - 9/45. Let n = k - -2. Suppose s = -n + 33. List the prime factors of s. 3 Suppose 0 = -5g + 5, 2g - 1 = b - 44. What are the prime factors of b? 3, 5 Let j(r) = 600r*2 + 13r - 22. List the prime factors of j(2). 2, 601 Suppose -s - 3t = 30 + 36, -5t - 210 = 3s. Let f = 66 - s. What are the prime factors of f? 3, 47 Suppose -19h + 12h - 343 = 0. Let t(b) = b3 - 3b*2 + 4b + 6. Let o be t(5). Let a = o + h. What are the prime factors of a? 3 Let w = 162 - -114. What are the prime factors of w? 2, 3, 23 Let b = -309 - -2452. What are the prime factors of b? 2143 Let v be 21/(-12)4/(-1). Let g be 63/v(-2)/(-3). Suppose -3j + 4 = -t, 3t = -0t + g. What are the prime factors of j? 2 Let a(b) be the second derivative of -b3/3 - 7b*2/2 + b. Suppose 0 = -4f - 12 - 20. What are the prime factors of a(f)? 3 Suppose -2c + 30 = 26. Let r(w) = w3 - 2w*2 + 2w - 2. Let k be r(c). Suppose 0 = -3t + 2b + kb + 122, 5t + b = 165. List the prime factors of t. 2, 17 Suppose -3m = 2v - 283, 3v = 3m - 181 - 107. Suppose 349 + m = 4a. List the prime factors of a. 3, 37 Let q be 93/((-12)/(-16)2). List the prime factors of q + (0 - 3/1). 59 Let l be -17 - (0 + (-8)/(-4)). Let v = l - -23. Suppose 0 = vw - 8w + 100. List the prime factors of w. 5 Let y = 14 - 13. Let r be (-3)/(y1/(-1)). Suppose 23 = rh + 2d + 3, 2h = 4d + 40. List the prime factors of h. 2, 5 Suppose -25m = -15m - 5030. List the prime factors of m. 503 List the prime factors of (-25)/102 + 2643 + -8. 2, 5, 263 Suppose -2z = d - 4 + 1, 2d - 8 = -2z. Suppose 0 = 4r - 5g + 95, 2r - 3r - 5 = -dg. List the prime factors of r4/(-6) - -1. 3, 7 Let t be 74/9 + (-2)/9. Let y be 0/1(-4)/t. Suppose y = -r - 11 + 43. What are the prime factors of r? 2 Let c = -78 + 78. Suppose o + 106 + 251 = 4g, -4g - 5o + 351 = c. List the prime factors of g. 89 Let x be 3/(18/4) + 232/(-24). Suppose 0 = -o - 1. List the prime factors of o/1 + (49 - x). 3, 19 Suppose 2p + 3m - 698 = 0, 3p - 42m + 37m - 1066 = 0. What are the prime factors of p? 2, 11 Let d(l) = 4l + 51. Let z be d(-12). Suppose -236 = 5y + 2a - 917, 403 = zy + 4a. List the prime factors of y. 137 Let t(c) be the third derivative of 0 + 0c*3 + 1/24c4 - c2 + 0c + 2/5c5. What are the prime factors of t(-1)? 23 Let u(x) = -x3 + 6x2 + 4x. Let z(a) = -a*2 + 14a - 7. Let w(k) = k*3 + 9k*2 - k + 4. Let b be w(-9). Let t be z(b). List the prime factors of u(t). 2, 3 Suppose -22 = -5y + 28. Let u be (-12)/y(-220)/6. Suppose 0 = 2n + 3z - u, 2n + 83 = 5n - 4z. List the prime factors of n. 5 Suppose 2 = -6t + 14. Suppose b = -tg - 9, -5b - 2g - 21 = -0g. Let w(f) = -f3 - 3f - 2. What are the prime factors of w(b)? 2, 17 Suppose -18565 = -16s - 2821. List the prime factors of s. 2, 3, 41 Suppose 0 = -46u + 10u + 1044. List the prime factors of u. 29 Let n be 1/((-22)/24 - -1). Let t(c) = -c3 - 3c*2 + 2c + 6. Let x be t(-3). Suppose -4h + 5 = -3p + 6, 3h + 2p - n = x. List the prime factors of h. 2 Let j = -20 - -14. Let f(w) = -2w - 18. Let m be f(j). Let o(y) = 2y**	{ "pile_set_name": "DM Mathematics" }
ress 69t2 - 61t*2 - 235t*2 as at*2 + r + ft and give a. -227 Rearrange 13 + 7 - 153w - 22 + 3 to d + sw and give d. 1 Express 30f - 4f*2 + 0f*3 - 15f - 16f - 2f*3 + 7f*4 - 1 as uf*2 + of*4 + i + af*3 + sf and give s. -1 Rearrange 854f + 2 + 240f - 278f + 172f - 220f to gf + p and give g. 768 Rearrange ((1 - 5 - 4)(-22 + 15 + 8) - 2 + 0 + 1)(-n - 2 - 3 + 6) to wn + g and give g. -9 Express (-25 - 8 - 1 + a)(-6 + 2 - 5) in the form ma + c and give c. 306 Express 26f - 9f + 4f - 7f - 17 + 6f in the form uf + c and give u. 20 Express (11 - 32 - 34 - 25)(5s - 3s + s) in the form f + cs and give c. -240 Express (11b*2 - 11b*2 + 3b*3)(-8 + 11 - 11b - 1) as o + ub + zb4 + lb*2 + pb*3 and give p. 6 Rearrange (0j + 0j - 2j*2)(-361j2 - 1666j - 399j2 - 1 + 763j*2) to the form zj*2 + fj*4 + y + bj*3 + ij and give z. 2 Express 0c + 2c*4 + 3c3 + c4 + 3 + c*2 + 2c + 0c2 - 4c*4 as pc + lc3 + rc*2 + dc*4 + v and give v. 3 Rearrange -4v + 5v + 9967 + 47v*2 - 9967 - 4v to the form jv2 + f + cv and give j. 47 Rearrange 122l3 - 225l - 309l3 + 186l*3 to pl*3 + gl*2 + jl + k and give j. -225 Express 39z - 37z + 256 - 7 in the form jz + a and give j. 2 Express 12 - 136f*3 - 2 - 3 + 130f*3 in the form kf + pf3 + o + uf*2 and give o. 7 Rearrange (0y - 194 - 28y + 25y)(-1 + 4 - 2) to the form a + jy and give j. -3 Express (-9a - 6a + 81a)(-4 - 2a3 + 4) + (-3a + 1 - 1)(a3 - 5a*3 + 2a*3) as v + ja*3 + ka + za4 + sa*2 and give z. -126 Express 0a*2 + 2a*2 - 8a3 - 55 - a3 + 11a3 - 3a - 4a3 in the form ya + ba2 + m + za*3 and give m. -55 Express 25r*2 + 8r*2 - 7r*2 + 1 - 13r*2 as g + jr + sr2 and give g. 1 Rearrange -196x + 194x - 789 + 197 - 17 to s + bx and give s. -609 Rearrange 6n2 - 8n*2 + 6n*2 - 48n - 3n2 to tn*2 + on + i and give o. -48 Rearrange 12 + 45s2 - 21s*2 - 2s + 3 - 31s2 - 5 + 2s*4 to the form ns + xs4 + qs*3 + a + ds*2 and give q. 0 Express -1 - 2n*3 + 1 + (-19n*2 - 32n*2 + 11n*2)(n + 2n + 2n) as f + cn2 + in + rn3 and give r. -202 Express -149918x + 149918x + 454x*2 + (-6x + x + 3x)(x + 4 - 4) in the form sx2 + o + cx and give s. 452 Rearrange 137t + 25t + 11t to the form kt + f and give k. 173 Rearrange 2u2 + u3 - 319u + 0u2 - 2 - 6u*2 + 250u + 3u2 to nu + bu2 + qu*3 + i and give i. -2 Rearrange -4879c + 4879c + 323c*2 to uc + a + zc2 and give z. 323 Express 18m*2 - 108m - 10m2 - 10m*2 as wm*2 + sm + g and give w. -2 Rearrange -10t - 9t + 6t2 + 3t - 11t - 12t*2 to the form b + mt*2 + qt and give m. -6 Rearrange 279k2 + 233k*2 + 252k*2 - 223k*2 + 225k*2 to the form pk*2 + m + qk and give p. 766 Rearrange -56x + 103x - 3x3 - 48x - 5x3 - 21x + 21x + (-x2 + x2 - 2x*3)(-1 + 5 - 5) to hx3 + b + vx + lx2 and give v. -1 Rearrange -451d*2 + 216d*2 + 206d*2 + 8d*3 + 4d to the form u + jd3 + wd*2 + zd and give w. -29 Express 30z + 3z*3 - 102z + 71z + 12 as gz + sz3 + o + az*2 and give s. 3 Rearrange (-6 - 12 - 12g + 13)(-4 + 2 + 3) to the form ug + k and give u. -12 Rearrange 0s + s3 - 647 + 0s + 8 to us + hs*3 + vs*2 + d and give h. 1 Express -76j*3 - j - 15j + 449j3 + 12j + 37j3 in the form zj + r + qj2 + pj*3 and give p. 410 Rearrange 3 + 0r*4 + 1 - 17r - 6r2 - 16r + 30r - r4 to g + xr + ar4 + fr*3 + vr*2 and give x. -3 Express -155b + b*2 + 309b - 536b as cb*2 + w + mb and give m. -382 Express 29o2 + 7o + 19o - 25o as k + wo2 + go and give g. 1 Express 707n - 199n + 22n + 336n in the form k + rn and give r. 866 Express (1 - 1 - 3z)(-1 + 0 + 2)(55z - 18z - 68z) - 4z*2 + 5z*2 + 2z*2 in the form iz + wz2 + j and give w. 96 Rearrange (-1076 + 2164 + 3207x - 1088)(1 - 1 - x) to wx + sx2 + y and give s. -3207 Rearrange 96a + 7a2 - 14a*2 - 95a + 6a2 - a3 to the form k + za*3 + ta + ga2 and give z. -1 Express 4z - 3z - 10z + 2z as jz + n and give j. -7 Express 181m + 30 + 27 - 80 - m3 + 25 as a + wm*2 + fm + bm3 and give f. 181 Express (-133w + 7892 - 7892)(w2 + 0w*2 - 2w*2) as tw*3 + l + uw*2 + jw and give t. 133 Rearrange -251y - 825 + 825 to the form m + by and give b. -251 Rearrange -t*3 + 2t - 2t + (-1 - 2 + 0)(-3t3 + 2t3 - t3) + (t*2 - 1 + 1)(3t - 3t + t) to the form ct + n + lt*3 + pt*2 and give l. 6 Rearrange -8s*4 + 2s - 206 + 4s3 - s2 + 203 + 0s to the form ds3 + cs + us4 + xs*2 + k and give c. 2 Rearrange ((2r - 2r + r)(3 - 1 - 1) + 0r - 3r + 4r)(5r - r - r) + (5r + 0r + 2r)(2 - 4r - 2) to the form vr + lr*2 + o and give l. -22 Rearrange (-15b*2 + 14b*3 + 15b*2)(101 - 5 + 133) to the form h + fb3 + db + mb2 and give d. 0 Express (1 + 0 + 2)(7 + 15 + 1)(-2 + 2 + 4m) as a + xm and give x. 276 Express 2 - 159g + 0 - 53g + 310g + 282g as xg + i and give i. 2 Express -383 + 36y2 + 380 + 60y*2 in the form sy + q + ay2 and give q. -3 Express (0z*2 + 0z2 + z2)(-2z + 3z + z) + 235 + 18z*3 - 235 as nz + p + sz2 + uz*3 and give u. 20 Rearrange 1024u - 335u - 16 + 14 to j + su and give s. 689 Rearrange -9m - 11m*4 - 20m*4 + 42m4 + m2 - 16 - 12m4 to d + xm + rm4 + km*2 + om*3 and give d. -16 Express -2m - 5m2 + 13m - 3m - 2m - 8m in the form gm + xm2 + o and give x. -5 Express -13a + 2 - 3a + 5a + 4a2 + 43a - 6a in the form da + fa2 + p and give p. 2 Express 200 + n2 - 2n + 2n - 67 - 94 as dn + vn2 + f and give f. 39 Rearrange 0p + 150p4 - 4p - 149p4 - 5p*2 + 3p*2 to the form t + rp + gp2 + op*3 + wp*4 and give r. -4 Rearrange 438k - 822k + 413k - 3 - k + 3 + k + k - k - 1 - 2k + 1 + (-3 + 3 - 2)(3 - 2k - 3) to bk + c and give c. 0 Rearrange -4t - 7t - 150 + 18t - 7t - 2t2 to the form jt + ut2 + z and give z. -150 Rearrange -18 + 40p - 6p2 - 37p + 4p2 + 3 to ap*2 + j + gp and give j. -15 Rearrange 23t - 1 + 0 + 1 + 1 to the form mt + b and give b. 1 Express 334 - 111 + 302c - 109 - 114 in the form lc + r and give l. 302 Rearrange (-6r - 28 + 28)(-4r2 - 4r*3 + 4r*2) + 18r*4 - 34r*4 + 27r*4 to qr*3 + i + lr + ur4 + nr*2 and give u. 35 Express 2k*3 - 3k*2 + 0 - 134k*4 + 138k*4 - 1 + 2k in the form yk2 + ak*3 + b + xk + ok4 and give y. -3 Express 4 + 3o + 32o3 + 10o - 34o3 as r + no*2 + ao*3 + lo and give l. 13 Rearrange -18j2 + 7j*2 + 8j*2 + 4 + 2j to the form mj2 + dj + s and give d. 2 Express -1005b + 2803b + 19 - 8 - 11 as y + hb and give h. 1798 Rearrange -16 + 34 + 6u*2 + 2 + 6 + 4 to the form ru*2 + q + zu and give q. 30 Rearrange (-3 + 0 + 2)(-3 + 3 + k) + (1 + 3 - 5)(-2k - 2k + 5k + (2 - 1 + 1)(7k - 2k - 3k) + 2k - 4k + 0k - k + 13k - 77k) to uk + n and give u. 61 Rearrange 4d + 207 - 7d + 2d to o + cd and give o. 207 Express f2 + 2f*2 - 2f*2 + (5f*2 - 5f*2 + 8f*2)(-2 - 1 + 2 + 4 + 2 - 2 + (1 + 1 - 4)(2 - 3 - 1)) as kf*2 + u + df and give d. 0 Rearrange -7 - 16o3 + 11 - 15o*3 - 39o*2 + 41o*2 to the form lo*3 + m + ao*2 + yo and give l. -31 Express (-61 + 27 + 35 - 2y + 47y*2)(y*2 - 3y2 + y2) as gy4 + xy + iy3 + o + ny*2 and give i. 2 Express 349z + 5z3 - 2z*2 - 708z + 356z + 1 in the form k + dz*2 + tz + vz3 and give v. 5 Express -268s + 7s - 285s + 59s in the form ks + w and give k. -487 Express (-19u2 - 780u*3 + 1 + 1585u*3 - 796u*3)(-3u + 5u - u) in the form vu4 + hu + ku3 + l + tu*2 and give v. 9 Rearrange 45x + 42x - 158x + 35x2 + 37x + 41x to ax + k + dx2 and give a. 7 Express -3t + 0t2 - 126 + 67 - 5t*3 + 5t - 4t2 + 60 as at*3 + rt + it2 + b and give a. -5 Express -12b - 14b - 24b*2 + 4b*2 + 16b as zb2 + tb + o and give z. -20 Rearrange (7v - 26v - 16v)((0 + 3 - 2)(-4 + 4 - 2v) + 12 + 0v - 10 - 5v) to	{ "pile_set_name": "DM Mathematics" }
lve ld = 3d for d. 0 Let r(v) = v*3 - 21v*2 + 19v + 20. Let d be 1044/52 - (-6)/(-78). Let g be r(d). Let t = -2 + 2. Solve t = -gj - 3j - 6 for j. -2 Let s = -81 + 109. Let f = s + -28. Let g be f/((20/(-5))/(-4)). Solve 3x - x + 8 = g for x. -4 Let l = 795 - 265. Let n = -528 + l. Solve -14 = nr - 14 for r. 0 Let l(h) = 3h2 - 226h + 227. Let m be l(1). Let w = 0 - -5. Let v be (-6)/w(m + (-52)/8). Solve 0 - v = -r for r. 3 Let r(c) = -c3 + 15c*2 + 28c - 412. Let i be r(15). Solve -is - 4s + 48 = 0 for s. 4 Let p(o) = 8o - 53. Let b be ((-44)/99)/((-4)/18). Let r be (-214/(-6))/b. Let s be p(r). Solve -16 = sv - 7v for v. 4 Let m(t) = -337t + 714. Let u be m(2). Solve 53q - u - 13 = 0 for q. 1 Let p be -4 - (-11)/((-44)/(-52)). Let o(w) = -w + 9. Let h be o(8). Suppose 0 = -5u + 3f + 4, -4u + 3 = -3f + h. Solve -p = -uv - v for v. 3 Let t = 3631 - 3618. Solve -tm = 10m + 46 for m. -2 Suppose -c + 19 = 3y - 5y, 4y + 56 = 4c. Let k = 119757 - 119732. Solve -cf + 4f = -k for f. 5 Suppose -3p = -5l - 4p + 20, -5p = l + 20. Suppose -135 = lk - 2k. Let x be 20(4 + k/12). Solve 5t + 30 = x for t. -5 Let s(z) = -z3 + 47z*2 + 138z + 602. Let d be s(50). Suppose 0 = -3o + 1 + 2. Solve -7 + o = -dp for p. 3 Suppose -5b + 5p + 1013 = -172, 7b - 5p = 1647. Solve -44a = -77a + b for a. 7 Let m = 36574 - 36136. Solve 0 = -5w + 398 - m for w. -8 Let z = -2132 + 2279. Solve 0 = -30f - 33 - z for f. -6 Let t be (-69)/(-12) + 18/72. Suppose -s = 5i - t, -7 = 5i - s - 21. Solve 0 = iq + 2 for q. -1 Let p(v) = -v3 - 48v*2 + 380v - 275. Let t be p(-55). Solve 7o - 6 - 8 = t for o. 2 Suppose -335m + 339m = -448. Let t = m + 114. Let v = -12 + 27. Solve tl - v = -l for l. 5 Let o(t) = 3t + 1. Let x(r) = -16r - 30. Let u(p) = -2o(p) - x(p). Let i be u(-2). Solve -i = 3f + 4 for f. -4 Suppose 6a - a = 0. Let o = 606 - 623. Let w(s) = s2 + 27s + 172. Let k be w(o). Solve ay = ky for y. 0 Let d be -1030(6 - 26/4). Let y = -513 + d. Solve -6p + y = -16 for p. 3 Let d be (-26)/(-13)(-6)/4 + 8. Suppose 3a + 2g = 5a - 40, -2a + 26 = dg. Solve a = -0f - 6f for f. -3 Suppose -2l - 3t + 21 = 0, 3t - 10 = t. Let c(q) = -q2 - 2q + 6. Let a be c(-3). Suppose -m = 2r - 1 - a, 0 = 3r - l. Solve y = -my for y. 0 Let w(h) = 2h*2 - h - 11. Let y be w(6). Let c be 2/6 + y/15. Let f be (-3)/(-1) - (c + (4 - 9)). Solve 0 = -fm + 4 - 0 for m. 1 Let t be 10/1219/126. Suppose -4d = -q - 4, 2q - 2 = td - 12d. Solve -18 = qm - 10m for m. 3 Let p(o) = -2o2 + 7o + 24. Let x be p(5). Let h be 5 - (11 + (-72)/x). Solve -hi - 3i = -0i for i. 0 Let z = -2751 + 2825. Let j be 5/(-10)(1 - 1). Solve j = d + 76 - z for d. -2 Let f be (0 - (-8)/(-20)) + (-84)/(-10). Suppose fp = 272 + 320. Let w = 77 - p. Solve wq = 7 - 1 for q. 2 Let u be ((-195)/91)/((-100)/840). Solve -4 - u = -11g for g. 2 Let x(s) = 3s*3 + 19s*2 - 54s - 265. Let l be x(-6). Solve 9u - l + 59 = 0 for u. 4 Let h(m) = -36m - 2. Let g(r) = 71r + 2. Let i(p) = -3g(p) - 5h(p). Let w be i(0). Solve 10 = ws - 9s for s. -2 Let q be -1 + (4 - (-3 - -5)). Let u be 722/4q + 2. Let g = u - 38. Solve -7x + 3x - 4 = g for x. -1 Suppose 0 = -2c - o + 19, 33c + 4o - 41 = 30c. Solve cx = 3x - 4 for x. -1 Let k be (700/210)/((-5)/(-12)). Solve 2h = h + kh for h. 0 Let s be -4 - (408/(-12) - -1). Solve -10n - s = -19 for n. -1 Suppose 3i - i - v - 122 = 0, 3v = -2i + 138. Let p = i + -58. Suppose 5r - 3 - 11 = 2h, 0 = -h + 2r - p. Solve l = hl for l. 0 Suppose -6p = -7p - 10p. Solve 11u - 18 + 62 = p for u. -4 Suppose 3l = 8l - 1335. Suppose 18 = -3g + l. Let r = g + -79. Solve -r = b + 1 for b. -5 Let m = -133 - -142. Let k be m/(-7)14/(-3). Solve -2 + k = -q for q. -4 Suppose 40 = -8s - 0s. Let k(g) = g3 + 6g*2 + 4g + 1. Let i be k(s). Suppose -12 = 5a - ia. Solve -r - a = 2r for r. -4 Suppose -5n - 714 = 2d, 3n + 4d - 197 = -617. Let b = n + 110. Let h = b - -39. Solve -4f = -hf - 1 for f. -1 Suppose 3s + 2s = 5b + 300, -4s - 3b = -268. Suppose 33d - 41d = -s. Solve -5z = -dz + 9 for z. 3 Let k(h) = 22h - 2087. Let s be k(95). Let o(q) = 3q - 1. Let w be o(1). Solve 0 = sa - 10 - w for a. 4 Let p(q) = -q2 + 6q + 44. Suppose 0 = -j + i + 7, -5j + 3j - 5i + 35 = 0. Let y be p(j). Solve ya - 6 = -14 for a. -2 Let q = 384 + -395. Let t be q - -5 - (2 - 11). Solve -ts - 3s + 6 = 0 for s. 1 Let f be (-27)/((-15)/(-5)) - 3. Let v be 0(-1)/2 - (f - -10). Solve -v = c + 3 for c. -5 Let s(k) = 3k*2 + 160k - 321. Let j be s(-58). Solve -j = 3p - 491 for p. 0 Suppose -54g - 5 = -1355. Solve -g = -26o + 27 for o. 2 Suppose -7q + 190q - 428586 = 0. Solve qg = 2339g for g. 0 Let h = -13900 - -13944. Solve 21s = 40 + h for s. 4 Let l be 23/138 - (164/(-24) + 3). Solve -x + 4x + lx = 0 for x. 0 Let y(u) = -u*3 + 11u*2 + 5u + 8. Let p be y(11). Suppose 0 = -8h + p + 1. Let d = -287 - -287. Solve d = -4f - 8 - h for f. -4 Suppose 2g - 29 = -r, 349 - 366 = -g + 2r. Solve -go - 90 = -0 for o. -6 Let m be 0 + 2/9 + (-143080)/(-252) - -5. Solve -m = -11l - 518 for l. 5 Let y = 2393 + -2353. Solve ya = 6a - 102 for a. -3 Let o be ((3 - 8)/15)/(2/(-294)). Suppose -10b = -51 - o. Solve -6q + q + b = 0 for q. 2 Let u be (-2)/(-14) + (-78)/(-42). Suppose 208 = 3f + ut, 4 - 10 = -3t. Solve f = -12x + 8 for x. -5 Suppose 176 = 2v - 73z + 77z, -z + 234 = 3v. Solve -vd + 96d = -100 for d. -5 Let l = 30441 - 30333. Solve 29w = -7w + l for w. 3 Let a(o) = 32o + 97. Let i be a(-2). Suppose iz = 45z - 72. Solve -zp + 0 + 18 = 0 for p. 3 Suppose 0 = -f - 56j + 54j + 2, -2 = 2f - 2j. Suppose -3 + 6 = 3g. Let v be (3 - 12)g/(-3). Solve f = k + v + 2 for k. -5 Let d = -91 - -93. Suppose 0q + q = 4i + 169, dq + 6 = 0. Let w = 46 + i. Solve -w + 5 = o for o. 2 Let c be ((-67)/134)/(2/(-12)). Suppose -h = ch + 10h. Solve 4q + h = -20 for q. -5 Let f be ((-63)/12)/(-3)40. Let x = -54 + f. Let l = x + -13. Solve 0 = li - 3 - 6 for i. 3 Let k(z) = z*3 + 7z*2 + 7z + 8. Let n be k(-6). Let a(f) = 3f + 125f*n + 3 + 7 - 126f*2. Let r be a(5). Solve rq = -4q for q. 0 Let a(j) = 12j*2 + 242j + 15. Let k be a(-21). Solve 280 = 11v + k for v. 5 Let h(d) = d3 + 11d*2 - 12d - 71. Let o be h(-9). Solve 209u - 60 = ou for u. 6 Suppose 4m - a = 18, -79 + 61 = -2m - a. Solve 3b = -mb + 18 for b. 2 Suppose -149 = -7x + 103. Suppose x - 34 = o. Solve -o + 6 = 2y for y. 2 Let f = -2362 - -2380. Solve fm - 143 = -215 for m. -4 Let s be -1 + (52/(-39))/(1/(-3)). Let w be 0/(3 + s + -4) - -4. Solve wb - 8 = 2b for b. 4 Suppose -12c - 177 = -5b - 14c, b = c + 34. Solve -17 = 18l - b for l. 1 Let o(b) = -186b - 6491. Let i be o(-35). Solve -16l = i + 109 for l. -8 Suppose -a = 2z - 45, -133z + 131z = 2a - 44. Solve 0 = -zg + 68 + 47 for g. 5 Suppose 11s = -s - 7s. Suppose s = -4b + r + 2 + 9, -3r + 31 = 4b. Solve -ba - 7 + 19 = 0 for a. 3 Suppose 7x = -31x + 2242. Suppose 60n - xn - 5 = 0. Solve -24 = -nv - 19 for v. 1 Suppose -23i + 20i = -54. Let m = -9 + i. Suppose -3l + 3t = -21, 0 = -5l - 3t + 5 - 2. Solve lu + 0u = -m for u. -3 Let j be 25/100 - (2/16)/(1/(-366)). Solve n + j = 42 for n. -4 Suppose 2k + n + 150 = 0, k - 5n = 4k + 225. Let r be 100/k - ((-186)/(-9))/(-2). Solve 0 = o + 13 - r for o. -4 Suppose -19o - 5529 = -115o + 7143. Solve -l - o + 131 = 0 for l. -1 Let x be ((2/(-3))/((-8)/36))/((-177)/(-5428)). Solve -18h - 2 + x = 0 for h. 5 Let l(n) = 3n*2 - 2n + 2n + 17n + 36 + 11n. Let w be l(-8). Solve -27 + 47 = wj for j. 5 Let x(o) = -5o3 + 2o*2 + 6o + 1. Let h be x(3). Let d be (-14)/h - (-180)/14. Solve 18f - df + 25 = 0 for f. -5 Suppose -2v - 289f = -292f - 211, 3f = 3v - 318. Solve va - 110a - 15 = 0 for a. -5 Suppose 0 = -h - 2h + 21. Suppose 7544 = 210s + 118s. Solve hr = -s + 9 for r. -2 Suppose 0 = -4p + 2o - o + 29, 5o = -4p + 47. Let j(w) = -w2 + 17w - 55. Let t be j(8). Suppose -p = -5d + t. Solve -4n + d = -3n for n. 5 Suppose -3j + 0 = w - 17, 4j - 4 = w. Let d(i) = -i2 + 11i - 21. Let n be d(w). Suppose 6*x - 36 =	{ "pile_set_name": "DM Mathematics" }
ssyyyyssyy. 1/646 Calculate prob of sequence ncr when three letters picked without replacement from {r: 2, f: 1, z: 5, c: 2, n: 4}. 2/273 Four letters picked without replacement from qtzctvzjvvtc. What is prob of sequence jcct? 1/1980 Calculate prob of sequence iq when two letters picked without replacement from ttcqttiqe. 1/36 What is prob of sequence hshs when four letters picked without replacement from chscscshchs? 1/110 Four letters picked without replacement from {d: 1, t: 1, i: 3, b: 2}. What is prob of sequence tbdi? 1/140 Four letters picked without replacement from {p: 6, b: 5, z: 3, u: 1}. What is prob of sequence bbzz? 1/273 Four letters picked without replacement from azoeoe. Give prob of sequence zeoe. 1/90 Two letters picked without replacement from zzzmzzzzzzmzmz. Give prob of sequence zz. 55/91 Two letters picked without replacement from {q: 2, u: 8, n: 1, j: 3, w: 1, t: 5}. Give prob of sequence tu. 2/19 Four letters picked without replacement from {a: 2, c: 2, v: 1, l: 4}. Give prob of sequence lcll. 1/63 Two letters picked without replacement from ooooooooozzooooooo. What is prob of sequence oo? 40/51 Four letters picked without replacement from {h: 3, y: 2, x: 7, c: 5}. Give prob of sequence yxxh. 3/680 What is prob of sequence mg when two letters picked without replacement from mcomgfmczcmffccccf? 2/153 Two letters picked without replacement from {z: 1, g: 2, b: 10, s: 7}. What is prob of sequence bg? 1/19 Three letters picked without replacement from {r: 1, a: 1, v: 3}. What is prob of sequence var? 1/20 Three letters picked without replacement from qlnnnilniisnnqil. What is prob of sequence nqn? 1/56 Four letters picked without replacement from gqiqqiqiiggqgi. What is prob of sequence iiqi? 25/2002 Three letters picked without replacement from xxvfuii. Give prob of sequence iiv. 1/105 What is prob of sequence vv when two letters picked without replacement from zzvzbbbvvfzfvzffzzz? 2/57 What is prob of sequence jmjj when four letters picked without replacement from vjjjbmb? 1/140 Two letters picked without replacement from {j: 5, h: 3}. Give prob of sequence hh. 3/28 Three letters picked without replacement from {u: 7, p: 3, g: 2}. What is prob of sequence guu? 7/110 Calculate prob of sequence mxtx when four letters picked without replacement from {t: 5, x: 2, m: 2}. 5/756 Three letters picked without replacement from thtoh. What is prob of sequence hto? 1/15 Two letters picked without replacement from {d: 2, o: 5, e: 1, z: 2, v: 5, b: 2}. Give prob of sequence eo. 5/272 What is prob of sequence xx when two letters picked without replacement from {p: 10, x: 4}? 6/91 What is prob of sequence ww when two letters picked without replacement from ggwgwww? 2/7 Two letters picked without replacement from {e: 3, h: 1, a: 1, i: 5, l: 4, m: 3}. Give prob of sequence la. 1/68 Calculate prob of sequence hivh when four letters picked without replacement from {i: 4, h: 4, v: 9, s: 2}. 3/646 Four letters picked without replacement from zeeeqveveezdeeeez. Give prob of sequence qzzd. 1/9520 What is prob of sequence yhd when three letters picked without replacement from dhtdtytyhyty? 2/165 What is prob of sequence sw when two letters picked without replacement from {w: 2, s: 2}? 1/3 What is prob of sequence kzz when three letters picked without replacement from zekezbzz? 1/28 Calculate prob of sequence mq when two letters picked without replacement from {k: 2, m: 1, s: 1, g: 1, y: 1, q: 2}. 1/28 Four letters picked without replacement from eppprppkkkrppkggrmkp. Give prob of sequence rekr. 1/3876 What is prob of sequence zsi when three letters picked without replacement from sjzjjiqijajqjjaaq? 1/2040 What is prob of sequence ju when two letters picked without replacement from stukj? 1/20 Four letters picked without replacement from ycfcfcfyfc. What is prob of sequence cfyy? 2/315 Two letters picked without replacement from kdssdblq. Give prob of sequence qb. 1/56 Four letters picked without replacement from {e: 5, n: 6, q: 4}. What is prob of sequence eenq? 4/273 Three letters picked without replacement from wwrrrrrrwrr. What is prob of sequence rwr? 28/165 What is prob of sequence iw when two letters picked without replacement from iiwiwwiiiiiiqiwwii? 10/51 Calculate prob of sequence soss when four letters picked without replacement from {s: 6, o: 6}. 2/33 Three letters picked without replacement from xlnxqnxnqqxlqqxxxnl. Give prob of sequence lqx. 35/1938 Two letters picked without replacement from tknttktlkllktnltknxn. What is prob of sequence xt? 3/190 Two letters picked without replacement from yfcchcgcqfcgy. Give prob of sequence cq. 5/156 Calculate prob of sequence eio when three letters picked without replacement from {i: 3, e: 5, q: 1, x: 3, p: 2, o: 1}. 1/182 What is prob of sequence soka when four letters picked without replacement from {s: 1, a: 1, k: 5, w: 2, z: 2, o: 5}? 5/8736 Two letters picked without replacement from pppppccp. What is prob of sequence pp? 15/28 What is prob of sequence bboo when four letters picked without replacement from {o: 14, b: 4}? 91/3060 Three letters picked without replacement from {g: 2, h: 5, o: 3}. Give prob of sequence ogo. 1/60 Two letters picked without replacement from ghugjphjghjuujghgujj. What is prob of sequence pu? 1/95 What is prob of sequence vt when two letters picked without replacement from kttttvtvvsbj? 5/44 Three letters picked without replacement from {s: 4, j: 5, a: 3, f: 4, v: 1, g: 1}. What is prob of sequence jjv? 5/1224 Three letters picked without replacement from {s: 5, l: 1, m: 1, r: 3}. Give prob of sequence rlm. 1/240 What is prob of sequence aaad when four letters picked without replacement from {v: 1, d: 2, a: 14}? 13/170 Calculate prob of sequence uee when three letters picked without replacement from eeuueuuuuu. 7/120 What is prob of sequence izh when three letters picked without replacement from {i: 2, z: 1, h: 2, b: 1}? 1/30 Two letters picked without replacement from esdeeeeddeidsddeiee. Give prob of sequence si. 2/171 Calculate prob of sequence gff when three letters picked without replacement from fqdqwqfwqwqqwfgqgf. 1/204 Calculate prob of sequence ge when two letters picked without replacement from {t: 1, j: 2, e: 1, g: 2}. 1/15 What is prob of sequence ls when two letters picked without replacement from slt? 1/6 Two letters picked without replacement from zwzzmmzkmkmwkkzw. What is prob of sequence km? 1/15 Calculate prob of sequence tttt when four letters picked without replacement from tttttt. 1 Three letters picked without replacement from {i: 1, v: 3, j: 4, r: 2, p: 1, y: 4}. Give prob of sequence rji. 4/1365 Calculate prob of sequence rywp when four letters picked without replacement from lywybrprppppprprr. 1/816 What is prob of sequence bq when two letters picked without replacement from uqbbqbunbqbubqqbnu? 35/306 Calculate prob of sequence ju when two letters picked without replacement from {u: 8, y: 1, j: 2, i: 1, o: 2}. 8/91 Two letters picked without replacement from oopg. What is prob of sequence pg? 1/12 Calculate prob of sequence mrrr when four letters picked without replacement from ssrmrsrsmsrmsmrss. 1/238 What is prob of sequence fc when two letters picked without replacement from dmdfefdefdpcfmf? 1/42 What is prob of sequence hhbh when four letters picked without replacement from {k: 4, b: 6, h: 4}? 6/1001 Calculate prob of sequence xxg when three letters picked without replacement from gnxnnjnjgxxjjxtjjj. 1/204 Calculate prob of sequence cttt when four letters picked without replacement from tteeetclteleetettt. 7/1530 Four letters picked without replacement from {s: 1, x: 7, v: 5, e: 3}. Give prob of sequence evxv. 1/104 Two letters picked without replacement from {w: 5, d: 3}. What is prob of sequence wd? 15/56 Two letters picked without replacement from {m: 2, c: 5, v: 5}. Give prob of sequence vc. 25/132 Calculate prob of sequence tivr when four letters picked without replacement from ktviekkvktetrkikete. 1/5814 Calculate prob of sequence vzv when three letters picked without replacement from {i: 1, g: 3, v: 5, z: 1, e: 2}. 1/66 Four letters picked without replacement from fffiiiefe. Give prob of sequence eiif. 1/63 What is prob of	{ "pile_set_name": "DM Mathematics" }
112 and 34? -3808 0.5-100 -50 What is -0.05 times -0.31? 0.0155 Calculate -53.3-0.2. 10.66 -730 * 1 -730 What is 7 times 16? 112 Product of -1 and -248. 248 What is the product of 1 and -442? -442 What is -1 times 1390? -1390 Work out 0.5 * -1876. -938 Calculate -5-14.6. 73 -0.4 -2.66 1.064 What is the product of -0.19 and -0.08? 0.0152 -3.5 times 1 -3.5 What is 9.4 times 0? 0 What is the product of 5 and 3869? 19345 -0.12 times -6.21 0.7452 Calculate -2.3-0.06. 0.138 Work out 24 3.1. 74.4 Calculate -6779-1. 6779 3615 -0.4 -1446 Calculate 1-0.03. -0.03 What is 0.2 times 4.44? 0.888 Work out 105 5. 525 What is -6.44 times 7? -45.08 Multiply -0.4 and 97. -38.8 Calculate -470.07. -3.29 -1094-0.1 109.4 Multiply -29 and 438. -12702 0.5 times 332 166 What is -0.1 times -0.051? 0.0051 Work out 0.19 * 0.5. 0.095 Multiply -227 and 0.2. -45.4 Product of -3 and 0.134. -0.402 Work out 0.057 * 5. 0.285 What is the product of 143 and -0.06? -8.58 What is the product of -0.043 and 1? -0.043 What is the product of 0.0734 and 0.3? 0.02202 -220.2 -4.4 30793-4 -123172 0.3 * 949 284.7 What is 0.7 times 36? 25.2 0.2 * -120 -24 0.07 * 0.0517 0.003619 0.2 * 1.324 0.2648 Product of -1.35 and -2. 2.7 What is -40 times 0.4? -16 Calculate 15-3. -45 What is -49 times -0.9? 44.1 -0.3-33 9.9 Multiply -13 and -6. 78 Calculate 2-29.85. -59.7 What is the product of -0.16 and 2.5? -0.4 Product of -0.106 and 157. -16.642 What is the product of -1 and 3415? -3415 What is -0.3 times -15? 4.5 Calculate 2.531-2. -5.062 7946-3 -23838 What is -0.1 times -65? 6.5 -0.5 times -17 8.5 What is -1.76 times -84? 147.84 Calculate 2.15-0.2. -0.43 23407 * -0.1 -2340.7 -0.03 * 0.01 -0.0003 What is 0.3 times 89? 26.7 Calculate 1318.7. 243.1 Calculate 4-0.778. -3.112 Work out -2661 * 11. -29271 Product of -113 and 0.5. -56.5 -0.35 times -0.21 0.0735 Multiply -0.13 and 0.85. -0.1105 Calculate -3-0.0251. 0.0753 Work out 0.0203 0.03. 0.000609 Multiply 856 and -3. -2568 -2 * 38 -76 Calculate 0.27230.2. 0.05446 What is 219 times 0.1? 21.9 0.063 -0.39 -0.02457 -15 times 0.234 -3.51 Work out 0.015 * -2. -0.03 Multiply -0.1 and 3.01. -0.301 What is 0.03 times 0? 0 Product of 628 and -0.15. -94.2 -2.9 times 0.2 -0.58 Calculate 141.12. 15.68 167 times -1.3 -217.1 Calculate -0.02320.08. -0.001856 -0.06 * 0.1153 -0.006918 21 2 Product of 0.2 and 0.6. 0.12 Product of -15 and 8. -120 Product of 1669 and 4. 6676 0.14 2.1 0.294 Product of 0.46 and -1.28. -0.5888 Work out 3 * 16.6. 49.8 Work out 18 * 0.02. 0.36 0 * 70 0 Calculate -1.52. -3 What is the product of 140.5 and 2? 281 7 -14 -98 Work out 3 * -595. -1785 What is -4 times -561? 2244 Product of 0.25 and -0.1. -0.025 Work out -0.5 * -161.9. 80.95 -2.47 times 0.32 -0.7904 -6 * -0.036 0.216 -3 * -0.087 0.261 Work out 16 * -17.3. -276.8 Calculate -7.3-0.01. 0.073 Work out -932 2. -1864 Multiply -360 and 1. -360 Multiply 6 and -155. -930 Work out 0 * -1244. 0 What is the product of -3.9 and 9? -35.1 What is the product of 55 and 0.02? 1.1 What is the product of 70.8 and 0.4? 28.32 -0.1 * -2.4 0.24 What is the product of 6914 and -4? -27656 Product of -19 and -0.33. 6.27 Multiply 4 and -0.88. -3.52 What is -0.2 times 3158? -631.6 -0.341-4 1.364 Product of 0.035 and 0.06. 0.0021 -0.174 times -2 0.348 Product of -412 and -3. 1236 -0.13 4.59 -0.5967 Product of -5 and -0.138. 0.69 Calculate -1-445. 445 Calculate -49-1. 49 What is the product of -1.2 and -0.3? 0.36 Multiply 2087 and -2. -4174 -5 times -0.038 0.19 -0.3 times 8459 -2537.7 Work out -0.3 * 969. -290.7 Calculate 349-0.1. -34.9 -1.5 -118 177 Multiply 0.05 and -43. -2.15 What is the product of 0.2 and -9.3? -1.86 Product of -4.51 and -0.2. 0.902 1.3 * -125 -162.5 Calculate 11755. 1755 -1.4 times -0.078 0.1092 -0.2 times 671.5 -134.3 Work out -0.004 -8. 0.032 3 * -378 -1134 Work out 0.119 * -78. -9.282 Multiply -5 and -2.3. 11.5 What is -0.5 times 0.2316? -0.1158 Multiply 242 and -4. -968 Product of 0.6 and -10. -6 Work out -99 * -1.2. 118.8 What is 93 times 2? 186 -3-0.88 2.64 What is 5 times 53.9? 269.5 -0.181.6 -0.288 -20.56 -123 -10217 3 -30651 -360.09 -3.24 70.3 2.1 -3 * -21.4 64.2 Work out -5 * -3.4. 17 Work out 1.67 * 0.3. 0.501 Multiply -435 and 0.2. -87 What is the product of -5 and -11? 55 -12 times -30.3 363.6 0.278 times -0.1 -0.0278 0.0115 times -2 -0.023 Work out 575 * 5. 2875 -1.309 * -0.4 0.5236 Product of -0.13 and -28. 3.64 Multiply 0.8 and 83. 66.4 What is 0.02 times 15? 0.3 -0.30.653 -0.1959 43478 20554 -245 * 0.26 -63.7 3 times 57 171 -0.34 * 4 -1.36 What is -0.4 times -11? 4.4 Calculate -142320.3. -4269.6 Product of -0.06 and 19. -1.14 0.07 times 0.33 0.0231 0.02951 0.1 0.002951 Calculate 45.40.1. 4.54 What is the product of -13 and 0.02? -0.26 Calculate 0.3-81. -24.3 Product of -2 and -878. 1756 Multiply -6 and -0.115. 0.69 -262 times -82 21484 3.6-1.1 -3.96 5200.07 36.4 -41.819 -7.276 -0.278.9 -2.403 0.2 times -31 -6.2 Work out -0.3311 * 0.7. -0.23177 Calculate -0.462. -24.8 Calculate 4649. 2596 Work out 30 * -6. -180 -39 times 27 -1053 -139 times -3 417 Calculate 0.09-0.36. -0.0324 What is the product of -0.5 and -338.4? 169.2 8.31 times 4 33.24 What is the product of 1 and -0.111? -0.111 -2 times 337 -674 30.06 0.18 Work out 0.03 * 0.153. 0.00459 What is the product of -0.2 and 0.627? -0.1254 What is the product of 0.22 and 0? 0 Work out -0.046 * -6. 0.276 What is -172 times -0.3? 51.6 What is 348 times 1? 348 Product of -7 and 17. -119 -0.029 times -5 0.145 0.249 * -4 -0.996 -126.25-3 378.75 40.01 0.04 0.052 times -5 -0.26 -46 -24 Multiply 2 and 120. 240 Product of -0.5 and -31. 15.5 Calculate -142-2. 284 3 times -0.75 -2.25 -0.0240 0 Multiply 11 and 16. 176 Product of -21 and -69. 1449 Calculate 267-5. -1335 Calculate -0.2-0.0148. 0.00296 Work out 14 0.45. 6.3 Product of 0.02 and -0.101. -0.00202 Calculate -25953. -7785 -0.188614 -2.6404 Product of -3 and 1.504. -4.512 Calculate 00.0479. 0 -278 -3 834 1147 798 -25 times -10 250 69.4 -0.04 -2.776 Work out -0.5 * -2.7. 1.35 Calculate 655-26. -17030 Work out -116 -3. 348 Calculate 712. 84 Work out 0.4 137. 54.8 -1.4 times -211 295.4 Calculate -3-21. 63 Multiply 60 and -242. -14520 -0.9 -0.5 0.45 Multiply 3 and -6.79. -20.37 587 435 -105-329 34545 357 245 Calculate -63560.3. -1906.8 Product of -13698 and 0.5. -6849 Product of -31 and -0.5. 15.5 Calculate 48-2. -96 -2.1 times 9 -18.9 Work out 2 -0.046. -0.092 -17.4 * 0.1 -1.74 -0.5 times -0.05 0.025 -17 * 14 -238 What is the product of -4 and 0.2? -0.8 What is the product of -3.6 and -159? 572.4 0.61-182 -111.02 Work out -2 -0.44. 0.88 Work out -0.204 * 6.1. -1.2444 What is the product of 3.1 and 0.3? 0.93 Product of 79 and 0.1. 7.9 What is the product of 7 and 0.08? 0.56 Product of 0.2 and 0.061. 0.0122 Calculate 2461. 246 Calculate -4.14. -16.4 0.04-1.2 -0.048 What is the product of 197.9 and -0.04? -7.916 Multiply 1.97 and 0.3. 0.591 Multiply -22 and -5. 110 Calculate -0.40.005. -0.002 Multiply 10 and 0.22. 2.2 What is -14 times 0.051? -0.714 421 84 Multiply 0.4 and -0.0118. -0.00472 What is the product of -0.4 and 2475? -990 Product of 314 and 0.2. 62.8 302 -0.3 -90.6 Work out 90 * 1. 90 Work out 0.3 * 0.246. 0.0738 Multiply -10 and 19. -190 What is -2.8 times 0.9? -2.52 What is 3 times -859? -2577 Calculate 4.33-22. -95.26 Product of -0.4 and 216. -86.4 Work out 2 1.17. 2.34 Product of 0.3 and 0.126. 0.0378 Multiply 4 and 3.49. 13.96 -7.7 * -3 23.1 1176 times 0.1 117.6 Product of -46211 and 4. -184844 What is 1 times 1.76? 1.76 1 times -3.415 -3.415 0.1 times -68 -6.8 What is 0.03 times -175? -5.25 Multiply -0.55 and -2. 1.1 Product of 8 and -0.43. -3.44 What is -64 times -0.5? 32 34 times 57 1938 Calculate 0.0243. 0.072 What is the product of 16 and 6.27? 100.32 What is the product of 3.22 and 2? 6.44 -27 -0.2 5.4 Product of 5 and -10.5. -52.5 1.3 * -0.2638 -0.34294 What is the product of 0.05 and 0? 0 Product of -1 and -0.034. 0.034 Calculate -3-0.68. 2.04 -915 -0.1 91.5 What is 41 times -141? -5781 -0.06542 -0.1308 Work out -5.728 0.3. -1.7184 Multiply 0.4 and -0.4759. -0.19036 8*56 448 What is the product of -0.04 and -0.4? 0.016 What is -19 t	{ "pile_set_name": "DM Mathematics" }
(192))3 + 1)6 + -2)2)2 + -5)-2. -499222 + 32256sqrt(3) Simplify ((((-6sqrt(85)-2 - sqrt(85)) + -6sqrt(85)-2)6)/(((sqrt(660) + -2sqrt(660))/sqrt(12) - sqrt(55))/(2sqrt(891) - sqrt(11))))*2. 23390793 Simplify (-4sqrt(102)6)/(sqrt(6) + sqrt(6) + (sqrt(72) + sqrt(72)4 + sqrt(72) + sqrt(72))/sqrt(12) + sqrt(6))-6 + -5. -5 + 72sqrt(17)/5 Simplify (6(sqrt(153)-1 - sqrt(153))-36)/(-6-2sqrt(1089)-4)-3. 27sqrt(17)/22 Simplify (-26(sqrt(192) + -1)2 + -1(2 + sqrt(192)) + 3)1. -2315 + 184sqrt(3) Simplify (5 + 0 + (2 + (sqrt(833) - (sqrt(833) + 1)-3)-6)-5)2. 142800sqrt(17) + 12002425 Simplify (-6-5-1sqrt(1000))/(sqrt(48)/sqrt(54) + sqrt(800)2 + sqrt(800)). -450sqrt(5)/91 Simplify (22sqrt(2000) + -5(sqrt(2000) - (sqrt(2000)1 - sqrt(2000)) - sqrt(2000)))/(sqrt(810)1 + (1sqrt(20))/sqrt(2)). 4sqrt(2) Simplify (-2(sqrt(256) - 21sqrt(256)))/((sqrt(56)-1)/(2sqrt(700))). -160sqrt(2) Simplify ((sqrt(180) + ((2sqrt(180) - sqrt(180)) + sqrt(180))-4)/(5sqrt(3)-1))/(sqrt(48)/(sqrt(4)-2 - sqrt(4)) + sqrt(12) - 2sqrt(192))-6. 63sqrt(5)/55 Simplify (-6sqrt(1280)3)/((sqrt(90) + sqrt(90)2 + sqrt(90))/sqrt(9) - (sqrt(10) - (sqrt(10) - sqrt(360)/sqrt(4)) - sqrt(10))). -72sqrt(2) Simplify (sqrt(2736) + 1 - ((sqrt(931) - (5 + sqrt(931) - sqrt(931))) + sqrt(931)))*2 + ((-2sqrt(2736) - sqrt(2736))-2 - (-2 + sqrt(2736))6). -24sqrt(19) + 124 Simplify (sqrt(8) + (sqrt(48)/sqrt(3))/sqrt(2) - (sqrt(72) - sqrt(72)1))/(2sqrt(100)-3)-4. 4sqrt(2)/15 Simplify ((-66sqrt(66))/sqrt(2)-5)/(((sqrt(1100) + 4sqrt(1100))1 - sqrt(1100))-2). -9sqrt(3)/4 Simplify (((sqrt(336) - -1sqrt(336)4)/((-2sqrt(144))/sqrt(12)))/((sqrt(144) - (sqrt(144) - (sqrt(144) + (sqrt(144) + 4sqrt(144))-1)))4))2. 175/36864 Simplify (2(-1 + (-5 + sqrt(176)-6 - -5(sqrt(11) + -6sqrt(176))) + 5))2. 1112sqrt(11) + 850128 Simplify -6(-3 + 3(sqrt(108) + (sqrt(108) + 1)*2) + -5)-1 + 0. 324sqrt(3) + 1914 Simplify -5 + 5 + sqrt(612) + 0 - (sqrt(204)/sqrt(100))/(sqrt(300) + 2sqrt(300)). 899sqrt(17)/150 Simplify -2(6(1 + -1 + sqrt(320) - ((0 + sqrt(320) - sqrt(320))-5)*2) + -1)-4-2. -768sqrt(5) + 16 Simplify (6sqrt(196)3 - sqrt(196) - sqrt(196))/(-3(sqrt(448) - sqrt(448)-2)) + 2. -4sqrt(7)/9 + 2 Simplify 2((-62sqrt(720)4 + -1(3 + sqrt(720)-3 + sqrt(720)))-6)*2. 238464sqrt(5) + 109694088 Simplify (-4(4(sqrt(200)-3-5 - -6(0 + sqrt(200))) + 5))2. 134400sqrt(2) + 22579600 Simplify (-1(5 + sqrt(2) + -1)-5 - sqrt(80)/(sqrt(10) - (sqrt(40)/sqrt(4)-2 + sqrt(10)))) + -4. 4sqrt(2) + 16 Simplify (0 + -4(-4 + -1sqrt(245) - (sqrt(245) + 6(sqrt(245) + 0) + sqrt(245)) - -5(sqrt(245) + -3 + -5)))*2. 39424sqrt(5) + 93696 Simplify -5 + (1(sqrt(132) - ((sqrt(132) - -2sqrt(132))2 + sqrt(132))))/(((sqrt(108) + 2sqrt(108))/sqrt(9) - sqrt(12))-6)-6. -3sqrt(11) - 5 Simplify 4 + 3 + -5 + -2 + (sqrt(117) - (sqrt(117) + -1 - sqrt(117))2) + sqrt(117)2 + sqrt(117) + -3 + 2. -2 + 12sqrt(13) Simplify ((sqrt(448) - sqrt(448)1) + sqrt(28) - sqrt(168)/sqrt(6)-6)/(-4((sqrt(576) + 1sqrt(576))6 + sqrt(576))). -7sqrt(7)/624 Simplify (0 + (sqrt(19) + sqrt(19) + sqrt(475)3 + sqrt(19) - sqrt(133)/sqrt(448))-1 + -5 + 3)2. 143sqrt(19)/2 + 388787/64 Simplify (sqrt(13) - (sqrt(13) - sqrt(468))) + 5 + 2 - (-3(-3 + sqrt(7488) + sqrt(7488) + sqrt(7488)))2. -606602 + 3894sqrt(13) Simplify ((sqrt(99) + 4)-25 + (sqrt(308)/(sqrt(42)/sqrt(6)))/(1sqrt(36)))2. 7120sqrt(11)/3 + 101531/9 Simplify (5(sqrt(99) - sqrt(99)24))/(1sqrt(1296) + sqrt(81)/(sqrt(9)-2)). -70sqrt(11)/23 Simplify ((sqrt(250) + 62sqrt(250))4)/(-6(sqrt(245) - (sqrt(245)-2 - sqrt(245)) - sqrt(245)))5. -650sqrt(2)/63 Simplify -5 + 1 + sqrt(27) + -1 + ((sqrt(3993)1 - sqrt(3993))/(sqrt(44)-1))2. -5 + 3sqrt(3) Simplify ((-4(-6(sqrt(112) + 1) - sqrt(112)))*2 + (5 + 2(sqrt(112) + 0))*2)2. 10912sqrt(7) + 177714 Simplify ((0 + sqrt(68) + sqrt(17) + sqrt(17) - -4sqrt(425)) + (-3sqrt(153)-1 + sqrt(153))/sqrt(9)-5)2. 272 Simplify (-3 + -6sqrt(176)-3)2 + sqrt(11) + sqrt(55)/(sqrt(40)/sqrt(8)) + sqrt(11) + 2sqrt(1100). -409sqrt(11) + 57033 Simplify (4 + -2 + sqrt(475) + 0 + -1 + (-5 + sqrt(475) + 0)6-6)2. -63350sqrt(19) + 614636 Simplify -5 + 1sqrt(450) - -3sqrt(450)-6 - ((-2sqrt(450)1 - sqrt(450))5 + 4)*2. -101271 + 1545sqrt(2) Simplify (-5 + (sqrt(88)-4)/sqrt(8) + sqrt(11) - (6sqrt(44)/sqrt(4) - (-3sqrt(11) + 1)))2 + 1. 96sqrt(11) + 1601 Simplify (-6sqrt(1176))/(sqrt(1728) - sqrt(1728)-2) - (sqrt(10) + (sqrt(160)-2 - sqrt(160)))/(-2sqrt(15)/sqrt(3) - sqrt(5)). -29sqrt(2)/6 Simplify ((sqrt(54)/sqrt(3))/sqrt(3) - sqrt(6))/(sqrt(2) + -31sqrt(2) - sqrt(2)) + (-2 + sqrt(3)3)*2 + sqrt(27)/(sqrt(9)1). -11sqrt(3) + 31 Simplify ((-1sqrt(931))*21 - (sqrt(57)/sqrt(3) + -5 + 3sqrt(2736))2) + 2. -25103 + 370sqrt(19) Simplify (sqrt(300) + 2 + -2 - -3sqrt(300)-5 - (-2 + 2(-3(1sqrt(300) + sqrt(300)))2))-1. 140sqrt(3) + 21598 Simplify ((sqrt(1008) + -3(sqrt(1008) - (sqrt(1008) + -2)) - (sqrt(1008)-1 + -5)) + 4(sqrt(1008) + 3 + 1 + sqrt(1008) - (1sqrt(1008) + sqrt(1008))-5))*2. 18000sqrt(7) + 2520225 Simplify ((-2 + ((0 + sqrt(2736) - sqrt(2736))-13 + (1sqrt(2736)6 - (sqrt(2736) - (sqrt(2736) + 3sqrt(2736)-2 + sqrt(2736)))))1)-21)2. -192sqrt(19) + 10960 Simplify 1 + 1(-4 + (5(sqrt(1700) + (sqrt(1700) + sqrt(1700) + -3 + sqrt(1700))1 + sqrt(1700)) + 2)2) + 0. -6500sqrt(17) + 1062666 Simplify (-5(-6sqrt(1331)1 + 1) + -6(-3(sqrt(1331) - (sqrt(1331) + -1) - sqrt(1331)) - (5 + sqrt(1331) + 0)))-2. -396sqrt(11) - 86 Simplify ((-2sqrt(108) + sqrt(27) + sqrt(27) - sqrt(27))/sqrt(9) - (-3 + sqrt(12)/sqrt(4) + 5)) + (5 + 5 + sqrt(33)/(sqrt(132)/sqrt(48)))*2. 36sqrt(3) + 110 Simplify 2 + (sqrt(700)-21 + sqrt(700) - (-5 + sqrt(700) + (sqrt(700) + -2 + sqrt(700))*2 - sqrt(700)) - -42-2sqrt(700)). -2797 - 90sqrt(7) Simplify (1 + sqrt(17) + 1 - 1sqrt(68)/sqrt(4))-3 - (-2 + (sqrt(425) - (1-2sqrt(425) - sqrt(425)))2 + sqrt(425) + 5). -6809 - 5sqrt(17) Simplify -3 + -1 + (sqrt(847) + 1)*2 - (sqrt(1400)1 - sqrt(14))/(2sqrt(2)-4). 185sqrt(7)/8 + 844 Simplify (-2((sqrt(100) + -1sqrt(100) - sqrt(100)) + sqrt(100) + sqrt(100) + sqrt(100)) - 5sqrt(100)-2)/((sqrt(18) + 2sqrt(882))/(sqrt(9) - 2sqrt(9)3)). -10sqrt(2) Simplify 2 + 1 + 1(3 + (4 + sqrt(288) + 2 - sqrt(288) - sqrt(288))*2 + -3). -144sqrt(2) + 327 Simplify 4 + (((-1-1sqrt(143) + sqrt(143) + sqrt(143) + -2sqrt(143)-6 + sqrt(143))6)/(2sqrt(1100)2-2))*2. 568/25 Simplify (((sqrt(180)2)/sqrt(3))/(-5-2sqrt(6)))/((sqrt(405) - (sqrt(405) - 2sqrt(405))-5) + sqrt(405) + -5-2sqrt(405)). sqrt(2)/315 Simplify (sqrt(231)/(sqrt(11) + sqrt(99)) + (sqrt(84)/sqrt(4) + sqrt(21))4 + sqrt(21))/(11sqrt(252)-5). -37sqrt(3)/120 Simplify (-3 + ((sqrt(833) - (sqrt(833) + 0)) + 2 - (3 + sqrt(833)-1)))*2 + (3(4 + sqrt(833)2-2))*2. -2072sqrt(17) + 120945 Simplify 0 + (sqrt(52) + -2sqrt(6292))/(-6sqrt(16)) + -5 + 1 + 1 + 5. 2 + 7sqrt(13)/4 Simplify (-2(-4sqrt(242) + 1)-5 + 2sqrt(242)-1-1 + -5)2. -4180sqrt(2) + 349473 Simplify 2 + 6(-1 + (2 + sqrt(68) - sqrt(68)) + (-4 + sqrt(68) + 1 + sqrt(68))2) + 0. -144sqrt(17) + 1694 Simplify ((-2((sqrt(85) - (sqrt(85)3 - sqrt(85)))1 + sqrt(85))-6)/(((2sqrt(120))/sqrt(2))/(sqrt(48)/(sqrt(4)2))))*2. 0 Simplify 1 + (3-2(sqrt(832)-1-5 + (sqrt(832) - (sqrt(832) + -2))-2)-3)2. -103680sqrt(13) + 6744385 Simplify (sqrt(55) - (sqrt(220)-1 + sqrt(220) - sqrt(220)) - -1sqrt(1980))/(5(sqrt(405) + (sqrt(405) - (sqrt(405)-1 - sqrt(405))))). sqrt(11)/20 Simplify ((-2-6((sqrt(152) - (((sqrt(152) + (sqrt(152) - sqrt(152)2))-4 - sqrt(152)) + sqrt(152))) + sqrt(152)))/((-61sqrt(72))/(sqrt(441)-1)))2. 14896 Simplify ((5 + -2(sqrt(405)-3 + 4)2)2)2-2. -467528 + 19008sqrt(5) Simplify (-5sqrt(196) - sqrt(4))/(sqrt(2) - (sqrt(98)2 - sqrt(98))) + (sqrt(360)1 - sqrt(360))/(sqrt(35)/(sqrt(49)/sqrt(7))). 6sqrt(2) Simplify (6(5 + -3 + -5(-1sqrt(1800) + 2)))*2. -86400sqrt(2) + 1622304 Simplify ((1(sqrt(1300)2 + sqrt(1300)) + 52sqrt(1300) + (-11sqrt(13) - 2sqrt(325)) + -3)-1)*2. -714sqrt(13) + 184102 Simplify 1*(	{ "pile_set_name": "DM Mathematics" }
1}. Give prob of sequence ioo. 1/15 Two letters picked without replacement from qxqqwwxqwiqi. What is prob of sequence qq? 5/33 What is prob of sequence mq when two letters picked without replacement from {q: 11, m: 2, h: 2}? 11/105 What is prob of sequence xxkk when four letters picked without replacement from {k: 7, e: 1, x: 2, w: 7, c: 1}? 7/6120 Three letters picked without replacement from {c: 3, k: 2, x: 2, o: 5, p: 6}. What is prob of sequence opx? 5/408 What is prob of sequence oi when two letters picked without replacement from mxaoadddaoixda? 1/91 Three letters picked without replacement from jjlajlajzggbj. Give prob of sequence jbj. 5/429 Three letters picked without replacement from {p: 2, k: 5, x: 2, b: 6, o: 1, r: 1}. Give prob of sequence pop. 1/2040 Calculate prob of sequence tt when two letters picked without replacement from wwyywwyalytkywwyayt. 1/171 What is prob of sequence ez when two letters picked without replacement from {e: 14, z: 4}? 28/153 Two letters picked without replacement from {o: 3, s: 7}. Give prob of sequence os. 7/30 What is prob of sequence ifi when three letters picked without replacement from {f: 3, i: 4}? 6/35 Two letters picked without replacement from {w: 5, j: 1, h: 4}. Give prob of sequence wj. 1/18 What is prob of sequence dodd when four letters picked without replacement from {d: 11, o: 1}? 1/12 Four letters picked without replacement from mpppllml. Give prob of sequence pmlp. 3/140 Four letters picked without replacement from {w: 2, f: 4, i: 1, a: 7, n: 2}. What is prob of sequence nwfa? 1/390 Four letters picked without replacement from rtexexrbf. Give prob of sequence xxfr. 1/756 Four letters picked without replacement from {g: 2, l: 6}. Give prob of sequence lglg. 1/28 Calculate prob of sequence hshs when four letters picked without replacement from {h: 1, s: 7}. 0 What is prob of sequence fjjj when four letters picked without replacement from {j: 3, w: 1, f: 5, q: 1}? 1/168 Calculate prob of sequence upuf when four letters picked without replacement from ffuuuupuupppuuuf. 9/455 Two letters picked without replacement from {n: 2, p: 1, h: 1, d: 1, t: 1, i: 1}. What is prob of sequence ph? 1/42 What is prob of sequence zzvv when four letters picked without replacement from myvvavvvivz? 0 What is prob of sequence www when three letters picked without replacement from {o: 3, w: 3}? 1/20 What is prob of sequence dxx when three letters picked without replacement from odolloxodowggdoxxxg? 2/323 Two letters picked without replacement from {v: 1, j: 1, k: 2}. What is prob of sequence vj? 1/12 What is prob of sequence hsy when three letters picked without replacement from hshyhyhyshhhy? 14/429 Three letters picked without replacement from srsdszsr. Give prob of sequence zrr. 1/168 What is prob of sequence zw when two letters picked without replacement from wusszumuuussls? 1/182 Two letters picked without replacement from {x: 1, i: 2, g: 1, u: 1}. Give prob of sequence xg. 1/20 What is prob of sequence vaav when four letters picked without replacement from vvvavvvvavvvavavvvv? 35/1292 Four letters picked without replacement from {h: 1, d: 5, w: 6, g: 6}. What is prob of sequence hdgw? 1/408 Three letters picked without replacement from {y: 2, h: 1, r: 1, a: 1, e: 1, u: 1}. What is prob of sequence ueh? 1/210 Four letters picked without replacement from {b: 1, x: 5, v: 1, w: 2}. Give prob of sequence wxxb. 5/378 What is prob of sequence pdp when three letters picked without replacement from dppdp? 1/5 What is prob of sequence idbi when four letters picked without replacement from {i: 2, b: 1, d: 2}? 1/30 Three letters picked without replacement from {g: 1, s: 2, x: 3, z: 3, y: 1, e: 1}. What is prob of sequence ezx? 1/110 Three letters picked without replacement from oxyfyo. Give prob of sequence fxo. 1/60 Four letters picked without replacement from stttsstttsytstttt. What is prob of sequence tyst? 55/5712 What is prob of sequence igi when three letters picked without replacement from {i: 5, g: 15}? 5/114 Calculate prob of sequence on when two letters picked without replacement from onnoonn. 2/7 What is prob of sequence zv when two letters picked without replacement from ddddddddzddddvdddd? 1/306 Two letters picked without replacement from {r: 1, u: 1, o: 1, i: 1, a: 1, x: 2}. Give prob of sequence ar. 1/42 Calculate prob of sequence mm when two letters picked without replacement from {m: 5, i: 4, w: 7, z: 2}. 10/153 What is prob of sequence xxa when three letters picked without replacement from {x: 13, a: 5}? 65/408 What is prob of sequence vvo when three letters picked without replacement from kpvvdpookddvvdkvvv? 7/408 Calculate prob of sequence xed when three letters picked without replacement from {z: 1, f: 1, x: 1, e: 1, d: 4}. 1/84 What is prob of sequence tz when two letters picked without replacement from {p: 5, t: 2, s: 3, z: 2, v: 7, g: 1}? 1/95 Three letters picked without replacement from {k: 2, n: 6}. What is prob of sequence kkk? 0 What is prob of sequence ex when two letters picked without replacement from {u: 1, x: 4, e: 2, t: 1, f: 1}? 1/9 Two letters picked without replacement from {l: 3, o: 5}. What is prob of sequence oo? 5/14 Calculate prob of sequence wzuk when four letters picked without replacement from akzbbwu. 1/840 Calculate prob of sequence vo when two letters picked without replacement from {o: 1, v: 1, n: 2}. 1/12 Three letters picked without replacement from {c: 6}. Give prob of sequence ccc. 1 Three letters picked without replacement from rzrqvzf. Give prob of sequence zqz. 1/105 Two letters picked without replacement from qqqrrrqq. What is prob of sequence qr? 15/56 Calculate prob of sequence dxx when three letters picked without replacement from dxdyxxd. 3/35 Calculate prob of sequence ll when two letters picked without replacement from pllplppllll. 21/55 Four letters picked without replacement from {o: 2, e: 4, q: 7}. Give prob of sequence qeqq. 7/143 What is prob of sequence fvfl when four letters picked without replacement from lafvufr? 1/420 Calculate prob of sequence izi when three letters picked without replacement from {i: 16, z: 2}. 5/51 Three letters picked without replacement from {e: 3, n: 2, d: 6, y: 1, z: 1}. Give prob of sequence nde. 3/143 Calculate prob of sequence aeay when four letters picked without replacement from aajyjayyjayaeaaaay. 1/204 Three letters picked without replacement from cccccblczlcl. What is prob of sequence cbl? 7/440 Calculate prob of sequence ns when two letters picked without replacement from smvnksv. 1/21 Two letters picked without replacement from {u: 1, s: 2, f: 7}. Give prob of sequence su. 1/45 Two letters picked without replacement from {x: 11, t: 3, i: 1}. What is prob of sequence ti? 1/70 Three letters picked without replacement from fgfjmffgzm. What is prob of sequence zjm? 1/360 Calculate prob of sequence ov when two letters picked without replacement from oooqv. 3/20 What is prob of sequence iiki when four letters picked without replacement from kikkikkikikkikii? 9/208 Calculate prob of sequence xkk when three letters picked without replacement from zxxkk. 1/15 Two letters picked without replacement from ygv. Give prob of sequence vy. 1/6 Calculate prob of sequence ckki when four letters picked without replacement from kkukikkcccsgkiicc. 15/1904 Two letters picked without replacement from kkssskkkskksqkkkk. Give prob of sequence kk. 55/136 Two letters picked without replacement from {t: 4, v: 2, p: 1}. Give prob of sequence pt. 2/21 What is prob of sequence ijd when three letters picked without replacement from {i: 1, d: 3, w: 2, j: 4}? 1/60 Four letters picked without replacement from ouuuuooouuou. What is prob of sequence uouu? 35/396 What is prob of sequence nen when three letters picked without replacement from eenezzwnzyi? 1/165 Calculate prob of sequence um when two letters picked without replacement from cmmzzzzzmuzmczzv. 1/60 Three letters picked without replacement from {a: 1, u: 2, c: 9, m: 1, t: 5}. Give prob of sequence acc. 1/68 Two letters picked without replacement from {r: 3, x: 15}. Give prob of sequence xr. 5/34 Four letters picked without replacement from ikkkkkikik. What is prob of sequence kiii	{ "pile_set_name": "DM Mathematics" }
= 15799 + -15797. What is the nearest to 2/31 in 0.2, -4, n, -2/55? -2/55 Let j be (25/75)/((-2)/48) + 210/27. Which is the nearest to -2? (a) -1/6 (b) j (c) -0.16 (d) 1 b Let u = -986 - -2419. Let a = 1434 - u. Let l(d) = -d - 9. Let z be l(-4). What is the closest to a in -3, 6/5, z? 6/5 Suppose -5c + 35 = 10. Suppose -ci = -0i. Let r = 75.1 - 75.4. What is the closest to i in r, -0.2, 4? -0.2 Let n = 71 + -72. Let k = -9 - -6. Let p = 0.0596 - -3.9404. Which is the closest to -2/7? (a) n (b) k (c) p a Let z = 445 - 236. Let i = -201 + z. Which is the nearest to 1/4? (a) i (b) -0.3 (c) -1/6 c Let i = -308 + 340.8. Let u = i + -33. Let o = 2.86 + -2.86. Which is the closest to u? (a) 0.25 (b) o (c) -0.3 c Let r(u) = -25u + 9. Let l be r(1). Let y be -2 - ((-3 - (-12)/l) + 2). Let t = -2 + 2. What is the nearest to 2 in t, y, -0.1? t Let s = -1049 - -1047. Let v = -9.86 - 0.14. Let z = -10.3 - v. Which is the nearest to s? (a) -13 (b) 1 (c) z c Let b be (-6)/63-1(-16)/(176/(-33)). Let d = 15 - 6. What is the nearest to b in 7, -0.4, d? -0.4 Let l = 225/4 + -3817/68. Let f(h) = -h*2 - 120h + 495. Let u be f(4). What is the nearest to -4/7 in u, 3/4, l, 4? u Let l = -0.73 + 0.59. Let v = -2787 - -2783. Which is the nearest to -0.1? (a) l (b) v (c) -2 a Suppose 0 = -5b - 154 + 244. Let j = b - 5. What is the nearest to -3 in -0.4, j, -0.5? -0.5 Let u(y) = -y3 + 22y*2 - 79y + 130. Let m be u(18). What is the closest to 0.1 in -42/13, m, 3, -0.1? -0.1 Let u = -0.3 + 0.8. Let n = -4.3734 + 1.3734. Which is the nearest to 22? (a) -0.5 (b) u (c) n b Let c = 388/895 + -6/179. Let q = -25 + 25.3. What is the nearest to c in -3/4, 2/5, 5, q? 2/5 Let d = 182.84 + -183. Let k = 155 - 154.6. Which is the nearest to 0.1? (a) d (b) k (c) -0.3 a Let h = -824.617 + -19.283. Let n = 889 + h. Let u = n + -43. What is the nearest to -1/3 in -1, 2/7, u? 2/7 Suppose -3y - 18 = -2w - 14, y = 4w - 8. Let r = 101 - 128. Which is the nearest to y? (a) r (b) 5 (c) 2 c Let s = -7 - -4. Let h = -0.066414 - -0.066414. Let u = 3 - 8. Which is the nearest to h? (a) s (b) u (c) 0 c Let h be (-285702)/(-1275) - (-4)/(-50). Let t be (8/(-70))/(6 + h/(-40)). What is the nearest to 0.1 in -0.01, t, 5, 2? -0.01 Let s = 9.2 + 107.8. Let n = 112 - s. Let v = 0.9 + -1.4. Which is the closest to -3? (a) v (b) n (c) -3 c Let f be (-3(-2)/108)/((-3)/(-6)). What is the nearest to 2 in f, 5/23, -5? 5/23 Let m(d) = -d*3 + 26d*2 - 23d - 83. Let l be m(25). What is the nearest to 0.2 in 6, 1, l? 1 Let w = 0 - 2.05. Let n = w - -2. Let p = -253290.1 + 253290. Which is the closest to p? (a) 4 (b) n (c) 5 b Let z = 1.112 - 52.112. What is the closest to 3 in 2/3, 3/7, z, -0.3? 2/3 Let k be -4(-2 - 0) + (-103 - -96). Suppose 5g = 3g - 40. Let j be (2/g)/(4/10). Which is the closest to k? (a) j (b) 2 (c) 8 b Let h be 75/45 + -5 + (-318)/(-90). What is the closest to 1 in -18, h, 11? h Let r be (0 + (-2)/(-14))/(((-1920)/(-56))/30). Which is the closest to 14? (a) 4 (b) 0.1 (c) -4 (d) r a Let t be 2 - (160/(-12))/(-5). Let r = -2758/15 - -184. Which is the nearest to t? (a) 2 (b) -12 (c) r c Let w = -4973 + 4972.7. What is the closest to 2/11 in 0, -33, w? 0 Let l be ((-7)/35)/(((-2)/(-6))/1). Let v = -22 + 72. Let w = 99/2 - v. What is the closest to -0.1 in l, w, -30? w Let k be 27/(-54)4/(-19). Which is the closest to -1/2? (a) -4/3 (b) 3/8 (c) k (d) -2 c Let u be (-1)/28 - (-2)/(-8). Suppose 1 = -5z - x + 18, 0 = -z - 4x + 11. Let l = 0.06 + -4.06. Which is the nearest to z? (a) -1/5 (b) l (c) u a Let o = 0.3807 - -0.0193. Let h = -8.6 - 43.4. Let d = h + 50. Which is the nearest to d? (a) o (b) -0.3 (c) 0.5 b Let b = -28.37 + 28.42. What is the closest to -1/4 in b, -1, -2/9, 4? -2/9 Let p = -32 - -32. Let f = 584 + -587. Let y = 0.01 + -0.01. Which is the nearest to y? (a) 2/5 (b) f (c) p c Suppose -5h - 2n - 2683 = 0, 3n = -3 + 6. Let y = h - -548. Which is the nearest to 1/2? (a) y (b) 1 (c) -1/2 (d) 2 b Let m = 15.559 - 15.459. Which is the nearest to -149? (a) -11 (b) 0 (c) m a Let l = 21524 - 21523. Which is the closest to l? (a) -3 (b) -4/15 (c) -5 b Let d = -3217 + 3217. What is the nearest to d in -9/2, -2/17, 5? -2/17 Let f be 0(4/18 - (-170)/612). Which is the nearest to f? (a) -2 (b) -0.8 (c) -10/9 (d) -4 b Let n = -20.815 + 0.215. Let s = -21 - n. What is the nearest to 0.3 in s, 2/17, -0.2? 2/17 Let l = -0.04395 - -2.04395. What is the closest to 9/5 in 0.1, 4, l? l Let k be 2 - 7 - ((-62)/(-403) + 389/(-78)). What is the closest to 2/71 in k, -4, 4? k Let d = -857.7 - -868.7. What is the nearest to d in 0, -0.7, -1/9? 0 Let w be (32/288)/((-11)/22). Let r = -1/21 + -2/7. Let a = 294 + -3820/13. What is the nearest to 1/2 in r, a, w? a Let r = -293 + 293.0571. Let f = -4.9429 - r. Which is the nearest to 10? (a) f (b) 2 (c) -0.07 b Let s = 17/35 - 1/5. Let p be ((-2)/8)/((-14)/322). Which is the closest to s? (a) p (b) -1 (c) -3/5 a Let l = 709/4 + -178. Let c = -568/5 + 114. What is the closest to -0.1 in 2, c, l? c Suppose i - 22 = -26, i - 1 = -5r. Let j = -0.26 - 0.24. What is the nearest to 0.18 in 4/3, j, -3, r? j Let m = -1 + 4. Suppose -q = 5r - 19, 4r - 28 = 874q - 878q. Which is the closest to 2/3? (a) m (b) q (c) -0.1 c Let s = 12.5 + -12.4. What is the closest to 28/11 in -2/3, 6, s, 5? s Let p = -656/7 - -3259/35. What is the nearest to -0.2 in -2/29, 1, p? -2/29 Let f = -61 - -61.4. Let g = -2.342 + 2.342. Which is the nearest to g? (a) f (b) 5/3 (c) -16 (d) -0.1 d Let i = -2.29 - -1.29. Let s = 5.05 + -5.23. What is the closest to s in i, 0, 2/9, 0.4? 0 Let a = -6.32 + 9.262. Let p = a + 0.058. Let q = -0.2 + -0.3. What is the nearest to -0.3 in q, -2/7, p? -2/7 Let l be (18 + (15 - 40))((-6)/21)/(-1). Suppose 12 = o + 3m - 7m, 9 = -3m. Which is the nearest to o? (a) l (b) -4/3 (c) -4 (d) 3 b Let g be ((-2)/30)/((-5)/(-15)). Let z = 1702 - 1704. What is the nearest to -1 in g, z, -2/7? -2/7 Suppose -3t = 5v - 7v + 950, -4v + 4t + 1908 = 0. Let w = 481 - v. Let y = -0.2 - 0. Which is the nearest to w? (a) -0.03 (b) -3 (c) y a Let u be (-40)/25((-76)/40 - 24/40). Which is the closest to -2? (a) 3 (b) -1/4 (c) u (d) 2.3 b Let d = 15598 + -15603. What is the nearest to 1 in -1, 0.3, d, -125/4? 0.3 Let t = -6607/84 + 315/4. Let x be (-1)/320(-7)/(-28). Let p = -0.03 - 2.97. Which is the nearest to t? (a) 1 (b) x (c) p a Suppose k + 9v - 4v = 2, -v = -k + 8. Which is the closest to -30? (a) -5 (b) 2 (c) k a Let x = 2787.2 - 2785.2. Let r = -8 + -4. Let s(k) = k*3 + 13k*2 + 13k + 7. Let o be s(r). Which is the nearest to 12/7? (a) o (b) x (c) 0.4 b Let q(t) = -t*3 - 5t*2 - 6t + 4. Suppose 5l - 17 + 2 = 0. Let m(z) = -z. Let w be m(l). Let x be q(w). Which is the closest to -2/5? (a) -2 (b) 8 (c) x a Let u = -0.7882 - -0.6482. Let v = 0.2 + -0.16. Let t = v + u. Which is the closest to t? (a) 2 (b) 2/9 (c) 0.2 c Let h be ((-3)/(18/(-5)))/(30/324-6). Which is the closest to -2/13? (a) h (b) -64 (c) -3 a Let v = 19300 + -19297. What is the nearest to -2/737 in v, -1/2, -1/3, -0.4? -1/3 Suppose 3z - 4v + 9 = 0, 0 = -5z - 2v - 1026 + 1011. Which is the nearest to 2/3? (a) 4 (b) z (c) -33 (d) -1/10 d Let g(x) = 421x - 2951. Let y be g(7). Let h = 1/169 + -175/1014. Which is the closest to -2? (a) h (b) -2 (c) 3/2 (d) y b Let p(g) = 8g - 28. Let i be p(4). Let u be 3/2 - 1/i. Let q = -200 + 204. Which is the nearest to 6? (a) -1 (b) q (c) u b Let r = 7.4 - -31.6. Let g = -20 - r. Let z = g + 58. What is the closest to z in -2, -1, -0.8? -1 Let d = -4.991 + 4.72. Let u = d + -0.729. Which is the closest to u? (a) 2/11 (b) 45 (c) 3 a Let k = 41 - 119/3. Let s = -1355/16 + 6743/80. Which is the closest to s? (a) 0 (b) k (c) 3 a Let l = -14 - -23. Let g = -8.9 + l. Let n = -2/2479 - -4964/7437. What is the nearest to g in 15, -1/2, n? n Let b = 14.15 + -14.25. What is the nearest to -0.1 in -0.5, -5, b, 210? b Let l be (-7)/11(-90)/(-21)416/1040. What is the closest to -1/3 in -21, l, 1? l Suppose 340 = -12*d + 100. Let z be (-3)/(-12) - d/48. Let u = 0.14 - -5.86. What is the	{ "pile_set_name": "DM Mathematics" }
t is the square root of 34586 to the nearest integer? 186 What is 81801 to the power of 1/10, to the nearest integer? 3 What is the tenth root of 2492 to the nearest integer? 2 What is the third root of 24685 to the nearest integer? 29 What is 73431 to the power of 1/2, to the nearest integer? 271 What is the square root of 1056 to the nearest integer? 32 What is 3424 to the power of 1/2, to the nearest integer? 59 What is 4698 to the power of 1/3, to the nearest integer? 17 What is the square root of 6617 to the nearest integer? 81 What is the cube root of 13067 to the nearest integer? 24 What is the cube root of 1143 to the nearest integer? 10 What is the sixth root of 2076 to the nearest integer? 4 What is the cube root of 936 to the nearest integer? 10 What is 15946 to the power of 1/10, to the nearest integer? 3 What is 2442 to the power of 1/2, to the nearest integer? 49 What is 40729 to the power of 1/2, to the nearest integer? 202 What is 73484 to the power of 1/5, to the nearest integer? 9 What is the third root of 20008 to the nearest integer? 27 What is 822 to the power of 1/2, to the nearest integer? 29 What is 947 to the power of 1/2, to the nearest integer? 31 What is the eighth root of 1095 to the nearest integer? 2 What is 25609 to the power of 1/2, to the nearest integer? 160 What is 32180 to the power of 1/2, to the nearest integer? 179 What is the square root of 22236 to the nearest integer? 149 What is the third root of 4302 to the nearest integer? 16 What is 1460 to the power of 1/3, to the nearest integer? 11 What is the cube root of 437 to the nearest integer? 8 What is 5581 to the power of 1/2, to the nearest integer? 75 What is 712 to the power of 1/3, to the nearest integer? 9 What is 53061 to the power of 1/3, to the nearest integer? 38 What is 65428 to the power of 1/2, to the nearest integer? 256 What is 15133 to the power of 1/8, to the nearest integer? 3 What is the cube root of 21545 to the nearest integer? 28 What is the square root of 35960 to the nearest integer? 190 What is the cube root of 281 to the nearest integer? 7 What is the square root of 383 to the nearest integer? 20 What is 13399 to the power of 1/3, to the nearest integer? 24 What is the square root of 5970 to the nearest integer? 77 What is the cube root of 1082 to the nearest integer? 10 What is 5799 to the power of 1/6, to the nearest integer? 4 What is the sixth root of 253 to the nearest integer? 3 What is the third root of 136 to the nearest integer? 5 What is 6273 to the power of 1/4, to the nearest integer? 9 What is 4118 to the power of 1/9, to the nearest integer? 3 What is the third root of 10631 to the nearest integer? 22 What is the fifth root of 284 to the nearest integer? 3 What is the square root of 3242 to the nearest integer? 57 What is 26185 to the power of 1/5, to the nearest integer? 8 What is the third root of 2756 to the nearest integer? 14 What is the third root of 1465 to the nearest integer? 11 What is the square root of 179 to the nearest integer? 13 What is 138145 to the power of 1/2, to the nearest integer? 372 What is the tenth root of 653 to the nearest integer? 2 What is 2005 to the power of 1/2, to the nearest integer? 45 What is the square root of 31603 to the nearest integer? 178 What is the cube root of 1728 to the nearest integer? 12 What is 986 to the power of 1/5, to the nearest integer? 4 What is the fifth root of 40959 to the nearest integer? 8 What is the cube root of 731 to the nearest integer? 9 What is the tenth root of 424 to the nearest integer? 2 What is 108561 to the power of 1/8, to the nearest integer? 4 What is the eighth root of 6236 to the nearest integer? 3 What is the sixth root of 1154 to the nearest integer? 3 What is 2960 to the power of 1/4, to the nearest integer? 7 What is the ninth root of 2696 to the nearest integer? 2 What is 9448 to the power of 1/3, to the nearest integer? 21 What is 2250 to the power of 1/2, to the nearest integer? 47 What is 1311 to the power of 1/2, to the nearest integer? 36 What is 19586 to the power of 1/3, to the nearest integer? 27 What is the third root of 18650 to the nearest integer? 27 What is the ninth root of 16416 to the nearest integer? 3 What is the third root of 102796 to the nearest integer? 47 What is 51442 to the power of 1/3, to the nearest integer? 37 What is 5469 to the power of 1/3, to the nearest integer? 18 What is 7526 to the power of 1/3, to the nearest integer? 20 What is 3999 to the power of 1/5, to the nearest integer? 5 What is the eighth root of 60340 to the nearest integer? 4 What is the square root of 39068 to the nearest integer? 198 What is the third root of 2565 to the nearest integer? 14 What is the eighth root of 10560 to the nearest integer? 3 What is the third root of 444 to the nearest integer? 8 What is 306 to the power of 1/2, to the nearest integer? 17 What is 6267 to the power of 1/2, to the nearest integer? 79 What is the square root of 871 to the nearest integer? 30 What is the fourth root of 716 to the nearest integer? 5 What is 9737 to the power of 1/2, to the nearest integer? 99 What is 3020 to the power of 1/3, to the nearest integer? 14 What is the ninth root of 14739 to the nearest integer? 3 What is the cube root of 14660 to the nearest integer? 24 What is 9183 to the power of 1/4, to the nearest integer? 10 What is 11724 to the power of 1/5, to the nearest integer? 7 What is the third root of 1177 to the nearest integer? 11 What is 10930 to the power of 1/5, to the nearest integer? 6 What is 106349 to the power of 1/4, to the nearest integer? 18 What is 2741 to the power of 1/6, to the nearest integer? 4 What is 257 to the power of 1/3, to the nearest integer? 6 What is the eighth root of 665 to the nearest integer? 2 What is 7172 to the power of 1/2, to the nearest integer? 85 What is the cube root of 27348 to the nearest integer? 30 What is the square root of 88420 to the nearest integer? 297 What is the third root of 5721 to the nearest integer? 18 What is the third root of 1897 to the nearest integer? 12 What is the third root of 2074 to the nearest integer? 13 What is the third root of 3367 to the nearest integer? 15 What is the fifth root of 9460 to the nearest integer? 6 What is the square root of 15401 to the nearest integer? 124 What is 2740 to the power of 1/9, to the nearest integer? 2 What is the fifth root of 50200 to the nearest integer? 9 What is the fifth root of 621 to the nearest integer? 4 What is the cube root of 515 to the nearest integer? 8 What is the square root of 1055 to the nearest integer? 32 What is 28163 to the power of 1/2, to the nearest integer? 168 What is the fifth root of 78 to the nearest integer? 2 What is 5174 to the power of 1/3, to the nearest integer? 17 What is the square root of 12931 to the nearest integer? 114 What is the ninth root of 5645 to the nearest integer? 3 What is the cube root of 1199 to the nearest integer? 11 What is the cube root of 573 to the nearest integer? 8 What is 123172 to the power of 1/9, to the nearest integer? 4 What is 89291 to the power of 1/9, to the nearest integer? 4 What is 23712 to the power of 1/2, to the nearest integer? 154 What is the third root of 143745 to the nearest integer? 52 What is 535 to the power of 1/2, to the nearest integer? 23 What is 362 to the power of 1/9, to the nearest integer? 2 What is 22617 to the power of 1/2, to the nearest integer? 150 What is the third root of 988 to the nearest integer? 10 What is the sixth root of 436 to the nearest integer? 3 What is the tenth root of 2 to the nearest integer? 1 What is the tenth root of 2469 to the nearest integer? 2 What is the square root of 6616 to the nearest integer? 81 What is 7181 to the power of 1/9, to the nearest integer? 3 What is 27475 to the power of 1/2, to the nearest integer? 166 What is the third root of 548 to the nearest integer? 8 What is the ninth root of 65298 to the nearest integer? 3 What is 463 to the power of 1/9, to the nearest integer? 2 What is the square root of 1911 to the nearest integer? 44 What is the square root of 825 to the nearest integer? 29 What is the fourth root of 3799 to the nearest integer? 8 What is the eighth roo	{ "pile_set_name": "DM Mathematics" }
5o3 - 3o2 + o2 + 4o - 5o. Let r(u) = u + u*2 - 4u*3 + 0u*3 + 3u*3. What is -g(f) - 3r(f)? -2f3 - f2 + 2f Let s(o) = o*2 - 4o - 4. Let n = -31 + 18. Let g = -21 - n. Let r(b) = 2b2 - 11b - 11. Determine gs(l) + 3r(l). -2l2 - l - 1 Let s(z) be the second derivative of z3/3 + 7z*2/2 - z. Let h = 4 + 4. Let q = 3 - h. Let a(l) = -l - 3. What is qa(p) - 2s(p)? p + 1 Let d(z) = -5z2 - z + 4. Let u(r) = r3 + r2 - r - 1. Calculate d(o) + u(o). o3 - 4o2 - 2o + 3 Let y(i) = i*3 - i + 1. Let g(b) = 8b*3 + 2b*2 - 4b + 8. Determine g(u) - 6y(u). 2u*3 + 2u*2 + 2u + 2 Let h(d) = -5d + 6d*2 + 2 - 11d*2 + 2d*3 + 5d*3. Let u(b) = 11b*3 - 8b*2 - 8b + 3. Calculate 8h(j) - 5u(j). j*3 + 1 Let s = -22 - -19. Let d(v) = 5v*2 + v + 2. Let t(g) = 9g*2 + g + 3. Determine st(w) + 5d(w). -2w*2 + 2w + 1 Let l(s) = -s*2. Let i(c) = -16c*2 - c - 3. Let g(a) = i(a) - 6l(a). Let v(u) = -3u2 - 1. Calculate 2g(b) - 7v(b). b2 - 2b + 1 Let d(a) = 2a3 + 6a*2 - a. Let m(f) = -2f*3 - 5f*2 + 2f. Give -5d(i) - 6m(i). 2i3 - 7i Let r = 7 - 12. Let b(j) = -8j3 - 2j + 5. Let n(v) = 22v - 47v + 9v3 + 2 + 27v - 8. What is rn(x) - 6b(x)? 3x3 + 2x Let j(r) be the third derivative of -r*4/24 - 5r*3/6 - 6r*2. Let i(o) = -o - 6. Give 5i(u) - 6j(u). u Let x(l) = -l2 - 9l - 6. Let q(s) = s + 1. What is 4q(m) + x(m)? -m2 - 5m - 2 Let l(q) be the third derivative of 7q4/24 + q3/3 + 3q*2. Let w be 1/(((-3)/15)/1). Let j = w + -1. Let r(f) = -4f - 1. What is jl(m) - 10r(m)? -2m - 2 Let g(o) = 4o*3 + 2o*2 + 3o - 1. Let i(s) = -16s3 - 9s*2 - 13s + 4. Calculate -18g(v) - 4i(v). -8v3 - 2v + 2 Let x(o) = -133o - 77. Let y(b) = -18 + 22 + b + 6b. Calculate -4x(g) - 77y(g). -7g Let s(k) = -2k + 4. Let i(q) be the first derivative of -q*2 + 3q + 34. Let v be 22/(-4)-6. Determine vi(u) - 5s(u). -2u - 2 Suppose 0 = -h - 1 + 2. Let x(u) be the third derivative of -u6/120 - u5/60 + u4/24 - 7u*2. Let c(b) = -6b*3 - 7b*2 + 5b. Give hc(l) - 5x(l). -l*3 - 2l*2 Let u(w) = 30w*2 - 3w + 3. Let a(k) = -60k2 + 5k - 5. Give -3a(p) - 5u(p). 30p2 Let n(s) be the second derivative of -s3/3 - 3s*2/2 + 27s. Let h(x) = 6x + 9. Give -4h(l) - 11n(l). -2l - 3 Let y(n) = -4n3 - n2 - 3n + 3. Let c(x) = 3x3 + x2 + 2x - 2. Determine -3c(u) - 2y(u). -u3 - u2 Let l = -41 + 37. Let h(i) be the third derivative of i4/8 - i3/3 + 4i2. Let f(n) = -8n + 5. Calculate lf(q) - 11h(q). -q + 2 Let h(d) = 22d2 - 2. Let l(a) = -a2. Calculate h(y) + 3l(y). 19y2 - 2 Let y(d) = 38d*2 + 2d - 11d2 - 19d*2. Let m(v) = 7v*2 + v. What is 4m(p) - 3y(p)? 4p*2 - 2p Let o(k) = -6k3 + k2 + 2k. Let s be o(-1). Let f(q) = 9q2 - 7q. Let i(a) = 26a2 - 20a. Determine si(h) - 14f(h). 4h2 - 2h Let n(k) = 9k2 - 7k. Let w(x) = 18x2 - 13x. Calculate -11n(d) + 6w(d). 9d2 - d Let g(s) = -s3 + 8s*2 - 13s + 5. Let m be g(6). Let r(k) = -k + 1. Let q(t) be the first derivative of 2t2 - 5t + 1. Calculate mq(b) - 5r(b). b Let j(f) = -2f2 - 2f - 2. Let r(m) be the second derivative of m4/3 + m3/2 + 2m2 - 9m. Give -7j(y) - 4r(y). -2y2 + 2y - 2 Suppose -6f = -12f + 18. Let m(u) = -u3 - u2 - u - 1. Let a(p) = 5p3 + 3p + 3. Calculate fm(s) + a(s). 2s*3 - 3s*2 Let m(f) = 2f*2 - 4f + 6. Let u(x) = -3x2 + 5x - 7. Give -5m(d) - 4u(d). 2d2 - 2 Let p(q) = q3. Let w(h) be the first derivative of -h4/4 + 17. Let n(m) = -m. Let v be n(-2). Give vw(c) + 3p(c). c3 Let n(g) = -6g + 2. Let l(d) = 3d + 0d - 6d - 4. Let r be (6/5)/((-12)/40). Let a(b) = 5b + 7. Let f(p) = ra(p) - 7l(p). Give -4f(k) - n(k). 2k - 2 Let p(n) = 5n2 - 3n + 5 - 8n + 3n. Let j(h) = 11h2 - 17h + 11. Determine -6j(g) + 13p(g). -g*2 - 2g - 1 Suppose 4m = 7 + 5. Let h(z) = z3 + 2z*2 + 2z - 1. Let x(t) = t*3 - 16 + 3t*2 + 3t + 15 + 0t. What is mh(i) - 2x(i)? i3 - 1 Let j be 3/2(3 + -1). Let s(r) = -3 + 0r3 - 3r3 + r3 + 4. Let p(v) = 6 - 11v3 - 3 - 2 + 8v*3. Determine jp(d) - 5s(d). d3 - 2 Let a(y) = -y3 + 3y*2 + 3. Let r = -12 - -15. Let f(w) = 2w*3 - 5w*2 - 5. Calculate rf(d) + 5a(d). d3 Let g(v) = -v - 1. Let p(w) = 12w*2 + 12w + 12. Give -12g(j) - p(j). -12j*2 Let y(w) = -15w*3 - 5w + 5. Let g(m) = 46m3 + 14m - 14. Give 5g(v) + 14y(v). 20v3 Let s(f) be the third derivative of -5f4/24 - f3/6 - 10f2. Let i(y) = -9y - 2. Calculate 6i(t) - 11s(t). t - 1 Let w(a) = a - 1. Let k(n) = -3n + 5n - 3n. Let t be 2 + (-8)/4 - 3. Let h = t - -2. Determine hw(x) + k(x). -2x + 1 Let g(v) = -14v*2 + 2v - 10. Let d(s) = 1. Give 10d(q) + g(q). -14q*2 + 2q Let n(m) be the first derivative of m*4 - 5m*3/3 + 3m*2 - m - 11. Let b(r) = -5r*3 + 6r*2 - 7r + 1. Determine 6b(a) + 7n(a). -2a3 + a2 - 1 Let j(y) = -y + 2. Let f(s) = 3s - 4. What is 2f(n) + 5j(n)? n + 2 Let i(g) = -2g - 2. Let u(o) = -2o - 1. Let l = 13 + 0. Let j = l + -11. Determine ji(y) - 3u(y). 2y - 1 Let k(s) = -s2 - 2s - 2. Let w(q) = -80q2 - 5q + 85q2 + 9 + 14q + 0. Suppose 0 = g - 4f - 25, -3g + 4f = -f - 47. Calculate gk(l) + 2w(l). l2 Let s(l) = -2 - 3l + 2 + 2 + 4. Let j(p) = 2p - 5. Let i(b) be the third derivative of -b5/12 + b4/24 - 2b*2. Let o be i(1). What is os(f) - 5j(f)? 2f + 1 Let s(y) = -5y2 + 3y - 3. Let l(i) = i*2. Calculate 3l(z) + s(z). -2z2 + 3z - 3 Let c(y) = 3y3 + y2 - 6y + 5. Let i(f) = -2f3 - f2 + 5f - 4. What is -4c(k) - 5i(k)? -2k3 + k2 - k Let a(o) = -5o + 11. Let t(y) = 6y - 21. Let v(d) = 10 - 6d + 6d - 3d. Let q(g) = -3t(g) - 7v(g). Determine 5a(l) + 8q(l). -l - 1 Let u(k) = -k*2 - 2k + 3. Let c(o) = -4o2 - 7o + 9. Let h(j) = 2c(j) - 7u(j). Let d(z) = 4 - 5 - 1. What is 3d(i) - 2h(i)? 2i2 Suppose 6g + 105 = 21g. Let o(c) = 10c + 4. Let b(q) = -5q - 2. Give gb(u) + 3o(u). -5u - 2 Let j(d) = -d. Let b(l) = -15l. Determine b(a) - 12j(a). -3a Let w(c) = -c2 - c - 1. Let q(b) = 5b*2 + 2b + 3. Determine -2q(s) - 6w(s). -4s2 + 2s Let x(h) = 2h3 + 3h*2 - 4h - 1. Let z = -2 + 4. Let t(a) = 7a + 2 - 1 + 3 - 5a*z - 2 - 3a*3. Calculate -4t(p) - 7x(p). -2p3 - p2 - 1 Let q(l) = 11l3 - 10l*2 + 13l - 13. Let x(d) = -5d3 + 5d*2 - 6d + 6. Suppose 4g - h = -3h + 22, 2h = -3g + 16. Calculate gq(b) + 13x(b). b*3 + 5b*2 Let d(h) = -4h - 7. Let j(r) = r + 1. Give 3d(o) + 15j(o). 3o - 6 Let a(n) = 2n*3 + 4n - 4. Let t(i) = 15i3 + 27i - 27. Let m be (-3224)/120 + (-6)/45. Give ma(x) + 4t(x). 6x3 Let w(y) = -y2 - y + 1. Let h(t) be the third derivative of -t6/60 - t5/30 - t4/8 + 5t*3/6 + 21t*2 - 2t. Calculate h(c) - 3w(c). -2c3 + c2 + 2 Let m(s) = -2s2 - 2s + 3. Let f(c) = -5c2 - 5c + 6. Calculate -3f(d) + 7m(d). d*2 + d + 3 Let v(h) = -3h*2 - 3h + 2. Let r(b) = -7b2 - 7b + 5. Let k(g) = 2r(g) - 5v(g). Let u(j) = 4j2 + 4j - 1. Determine -5k(d) + u(d). -d2 - d - 1 Let g(c) be the first derivative of c3/3 - c2/2 - 2. Suppose -2v = -5v + 5m - 28, -2v - m - 10 = 0. Let o(u) = -u3 + 6u*2 - 6u. Give vg(a) + o(a). -a3 Let k(i) = 4i*3 - 4i*2 - i + 3. Let w(s) = 3s*3 - 3s*2 - 2s + 2. Calculate 2k(n) - 3w(n). -n3 + n2 + 4n Let z(d) = 2d*3 + 7d. Let n(t) = -t - 2. Let m(x) = -x - 3. Let a(l) = 2m(l) - 3n(l). Suppose 5y = -25, 2r + 0 + 27 = -3y. What is ra(k) + z(k)? 2k3 + k Let u(g) = -85g + 5. Let n(f) = -57f + 3. Determine 8n(y) - 5u(y). -31y - 1 Let j(x) = 3x3 + 5x*2 - 6x + 3. Let c(r) = 7r3 + 11r*2 - 13r + 6. Calculate 6c(b) - 13j(b). 3b3 + b2 - 3 Let l(a) = 4a*2 - 4a. Suppose -3y - 3t + 16 = y, 0 = -y - 3t - 5. Let w(x) = 9x*2 - 9x. Calculate yl(o) - 3w(o). o2 - o Let h(i) be the third derivative of i2 + 0 + 0i + 1/12i*4 - 1/6i*3. Let w(a) = a. Suppose -2r + 15 = -7r. Give rw(n) + h(n). -n - 1 Let j(p) = 8p2. Let d(i) = i3 + i2. Give -3d(q) + j(q). -3q3 + 5q*2 Let n(i) = 21i*	{ "pile_set_name": "DM Mathematics" }
24, 2x - 4s + p = 0. Is x at most g? False Let b be 9406/(-17)74/(-112)-1979. Let q = -723459 - b. Let f = q - 19/7. Is -1 smaller than f? True Suppose -w - 3w + 27 = 3n, 13 = -5n + 3w. Is n < 3318? True Suppose -3l - g + 681 = -5g, -4l = -3g - 908. Let m(a) = a*3 + 227. Let t be m(0). Is t at least as big as l? True Let x be (-432)/(-243) + 4/18. Let a be (392/(-115))/2 + x/5. Is a smaller than -1? True Suppose 4 = -2t + 4w, -70w - 5 = 5t - 75w. Is t at least as big as -0.3024? True Let a be (-15)/6 + 1 - 91/14. Let d be (a/(-56) + (-141)/7)/(-1). Let f be d/6 - (-6)/3. Is f less than 4? False Let n(g) = -g*3 - 5g*2 + 10g + 9. Let q be n(-6). Let r be 73/44. Suppose -4s - 43 = r. Are q and s nonequal? True Let n = 4898 + -4922.87. Let y = 0.87 + n. Let j = 23.9 + y. Are 1/23 and j unequal? True Suppose 34y = 32y + 6, -2p + 5y - 77 = 0. Let t(s) = -s - 35. Let f be t(0). Which is greater: p or f? p Let o be (-1)/7 + (-339)/(-21). Suppose 0 = -2p - 2p, -2p = 4a + o. Which is greater: a or 26? 26 Let g = 17009 - 68087026/4003. Which is smaller: -1 or g? -1 Suppose -5f - 5 = 0, 0 = -y - y + 2f + 48. Suppose yq + 13 = 36q. Which is greater: 2/1229 or q? q Suppose -3g - y = -79, -5 = -3811y + 3806y. Let a = -2675 + 18908/7. Is g < a? True Let z = -487/273 + 38/21. Let i be -4(-9)/(-48) + (-146)/8. Let b = -20 - i. Which is bigger: b or z? z Let j be ((-33)/(-6) - 3)(17 + (-858)/52). Let g(d) = -d*2 - 6d + 1. Let v be g(-6). Let x = 1 - v. Which is bigger: j or x? j Suppose 6j = 86 - 98. Let x be 108/(-810)(8 + (j - 0)). Is x >= 0.29? False Suppose 2n = 3n + 5f, 5n + 3f = 88. Suppose -2z + 4 = -3j + n, 4z + 3j + 14 = 0. Is -29/8 bigger than z? True Let t = -10 + 10. Let i be (-11521)/6068 - 221/(-24). Which is greater: i or t? t Let y = -9634 + 7947. Is y greater than or equal to -1691? True Let a = -707 + 504. Suppose 4205c = 4206c + 202. Is a less than or equal to c? True Let f = 9 + -30. Let z = 0.259 + -18.259. Let s = z - f. Which is smaller: s or -8? -8 Suppose 0 = -3a - 2k - 33, 4k = 6a - 2a + 24. Let v be (-1318)/3990 - 3/a. Which is smaller: 1 or v? v Let p = -94 - -88. Let h be (-8)/(p + -4 - -6). Do h and 31 have different values? True Let g(y) = y3 + 29y*2 - 26y + 253. Let c be g(-32). Which is smaller: -1988 or c? -1988 Let r = -712.7 - -678. Let l = r - -34.8. Do 144 and l have the same value? False Let q be ((-25)/(-2) - 11) + (-3)/2. Is 7119 smaller than q? False Let r be 5310/(-36) + (-6)/4. Let v = 160 + r. Which is smaller: 10 or v? 10 Suppose 0z + 234 = -3z. Let n = -111/380 - -4/95. Which is smaller: n or z? z Let i(o) = 7o - 206. Let j(t) = -17t - 134. Let s be j(-9). Let x be i(s). Which is greater: x or -74? x Suppose -9316p + 2183 = -9279p. Let c = 0.9 + -1. Is c at least as big as p? False Let y = 1764 + -1753. Which is smaller: y or 0.18? 0.18 Let r = -618 + 1116. Let f be (-2)/4(-16 + r). Does -241 = f? True Let j = 546 + -572.1. Let p = -26 - j. Let k = -10.9 - p. Which is greater: 2/5 or k? 2/5 Let g = 121 + -112. Let y = 5/517 - -86761/9823. Is y > g? False Let y(o) = -o3 + 17o*2 + 2o - 27. Let w be y(17). Suppose wh = -3h - 10. Let m be (-518)/(-84) - (2 - h)-1. Which is smaller: m or 9? 9 Let y be ((-4)/(-3))/(13/(-6)). Let g = 457 + -457. Suppose 6 = -2j + 5v + 27, g = v + 5. Which is greater: y or j? y Let s = 486 + -424.2. Let d = s + -62. Which is greater: d or -2/85? -2/85 Suppose -21u = -16u + 680. Let v = u + 135. Is -2 at least v? False Suppose -38j + 43j - 4f - 7 = 0, -4f = -4j + 8. Which is smaller: 4/7511 or j? j Let d be (-3180)/(-660) - 2/(-11). Suppose 3u + 21 = -5n, u - n - 6 = -d. Which is greater: 10 or u? 10 Suppose 0 = -4i - 17 - 3. Let x be (16 - 0)i/10. Let h(u) = u*2 - 72u + 326. Let b be h(5). Is b bigger than x? False Let p(y) = 2y3 + 10y*2 + 4y + 4. Let j be p(-4). Let f be (-192)/40 + (-24)/j. Which is bigger: f or 3? 3 Let c(h) be the second derivative of h*5/20 + 3h*4/4 + 5h*3/3 - 17h*2/2 + 1072h. Suppose 6w + 35 = w. Let f be c(w). Is 11 bigger than f? False Let v be (-8)/(-5) + -1 - 110/(-25). Suppose 12f - v = 11f. Suppose -281 = -fx - 41. Are -0.1 and x unequal? True Let o = -6681/2 - -3341. Which is smaller: 335 or o? o Let j = -0.09164 - 0.00516. Which is smaller: 0.1 or j? j Let p(h) = 6h2 + 2h - 16 + 41 + 2h. Let t(j) = j2 + j + 5. Let u(i) = 2p(i) - 11t(i). Let x be u(4). Is x equal to 2/39? False Suppose -65f + 4497 = -3888. Let j = -0.7 - 3.3. Is f not equal to j? True Let m = -75/14 + 867/154. Suppose -10 = -5c - 5z, -2c + 2z - 1 = 3z. Let v be -1(-2 + c)/(-5). Is v less than m? True Let y(n) = -66n + 408. Let u be y(6). Suppose j + 48 = u. Are -39 and j nonequal? True Let y = -220 - -231. Let x be 15/30 - y/6. Which is greater: -2 or x? x Let q be ((-54)/(-30))/(9/5370). Suppose 38k + q = 276. Is k >= -22? True Let s(k) = 51k + 124. Let u(y) = y3 - 8y*2 + 16y - 7. Let c be u(4). Let a be s(c). Is a not equal to -232? True Let h = -2.3 - 4.7. Let c = h + 6.991. Which is smaller: c or 1? c Let u be (-12)/54 - (-32)/(-18). Let y be u - -7 - (18556/2320 - 3). Is y >= 0? True Let f = 76040 - 76043. Let z(x) = x*3 + 5x*2 - 3. Let u be z(-6). Is u at least f? False Let j be (-5)/(5285/(-1833)) + 4/(-1). Let a = j + -3/151. Is a > -5/3? False Let t(q) = -4q + 20. Let g be t(-28). Suppose -25s = -29s + g. Let j(l) = 6l - 4. Let w be j(6). Which is smaller: s or w? w Let b be 356/(-15) + 4. Let t = 1372 - 1380. Which is smaller: b or t? t Suppose 8m - 2370 = 2310. Let j be (-5)/3299/m. Is j > -2? True Suppose 28n - 36n = 16. Let p be -116 - (n - -9) - -6. Is -119 <= p? True Suppose -4v = 12v - 144. Let l be 15/(-5)v/((-18)/8). Is 12 less than or equal to l? True Let s = -6 + -20. Let v = s - -25.7. Let q = 0 - v. Is -0.2 <= q? True Let m(i) = -8i*3 + 32i*2 + 70i + 8. Let x(k) = 19k3 - 65k*2 - 141k - 16. Let h(d) = 7m(d) + 3x(d). Let p be h(-26). Is 294 at most as big as p? True Let k(l) = -3l3 - 3l*2 + 4. Let d be k(-2). Let j be 4/10 - (-18)/(-45). Suppose j = 7b + 5 + d. Which is smaller: b or -25/6? -25/6 Let n = -121835/1311314 + -1684574432567/64667449910. Let o = n + -1/7045. Are -27 and o unequal? True Let n = 408 - 277. Let l = n - 53. Suppose 18h + 4h = 22. Is l at most as big as h? False Let l be 0 + (-1)/(-5) - (-5106)/(-30). Let a = -2121 + l. Let u = 36671/16 + a. Is 0 != u? True Let z = 3/713969 - -333422620/214904669. Let v = 36/43 - z. Let t(f) = 2f + 3. Let i be t(-2). Which is bigger: i or v? v Let j = -402.27 - -404. Let t = -1.73 + j. Let g = 22/27 + -736/837. Is g greater than or equal to t? False Suppose -85m - 10 = -87m. Let i be -1 + 15/(-3) + m. Is i smaller than -1/388? True Suppose v + 148 + 3 = 0. Let u = 452/3 + v. Let a = 0.65 + -1.15. Is a greater than or equal to u? False Let l = -1864 - -1864.01576. Which is bigger: 0.1 or l? 0.1 Let v(q) = -2q*3 - 27q*2 + 14q - 9. Let z be v(-15). Suppose -46w = -38w + z. Is -58 at most w? True Let r = 15194 - 28197/2. Let b = 785 - r. Which is greater: -312 or b? b Let f(y) = -y*3 - 21y*2 + 3y + 59. Let r be f(-21). Let q be (0 - r) + (-56)/14. Are q and 28/27 equal? False Let d(s) = -s*3 - 10s*2 + 5s - 60. Let v be d(-11). Let u be 14v/(-12) + -4. Which is smaller: u or -9? u Let g = 91200/101 - 903. Let v = g - 89/404. Which is smaller: v or -8/3? -8/3 Let c = 244 - 133. Let w = -110.9 + c. Let s = -42.21 + 42. Which is smaller: w or s? s Let o(v) be the first derivative of 2v*2 + 21v - 12. Let r be o(-4). Suppose -3p + 13 = -8. Which is smaller: p or r? r Let j(t) = -3t + 8. Let y be j(-2). Suppose -l + y = -8l. Is 108 bigger than l? True Suppose -2j - b = -10, 2b + 11 + 9 = 4j. Suppose -ji = 3s - 3i + 31, s - 2i + 5 = 0. Are -11 and s unequal? True Let w be 125/(-10) + 1/2. Suppose -156g - 9 = -306g + 151g. Is w at least g? False Let j be (6/14)/(28/(-49)). Let t = 9.859 + -0.059. Let l = -10 + t. Which is smaller: l or j? j Let r = -0.0434 + 38.0434. Let z = 16 + -46. Let f = z + r. Which is greater: -4 or f? f Let m = -54 - -57. Suppose -5u + 33 = k, mu = -2k + 17 + 7. Let n(g) = -g*2 + 6g + 4. L	{ "pile_set_name": "DM Mathematics" }
7k for k. 4 Let d be 10/(-5) - (3 + -16). Suppose 2y - dy = -27. Solve y + 1 = 4o for o. 1 Let m = -860 - -874. Solve 5k + m = 29 for k. 3 Let o = 90 + -93. Let x be (o - -2 - 0) + (4 - 0). Solve 0 = v - xv for v. 0 Let u(w) = -w*2 - 12w + 2. Let c be u(-16). Let b = -38 - c. Let h be 6/(b/5)4. Solve 0 = -3y - h - 7 for y. -4 Suppose -2r + 5 = -3. Suppose -7 = -rl - s, -4l = -l - s. Solve -7j + 8j = l for j. 1 Suppose 4j + 32 = 4r, 5r + 74j - 19 = 72j. Suppose 2b + 8 = 18. Solve -bu + r = -0 for u. 1 Let d be -12((-1)/(-2))/(5 - 7). Solve -8f = -df - 25 for f. 5 Let h(m) = -3m - 4. Let z be h(-5). Let q(a) = a*3 - 11a*2 + a - 4. Let l be q(z). Let w be (l - 4)(0 + 1). Solve 0u + 3u + w = 0 for u. -1 Let r(l) = -l*3 + 51l*2 + 2l - 100. Let b be r(51). Solve 0 = bf - 7f - 10 for f. -2 Let q(c) = c*2 - 32c + 170. Let u be q(31). Solve -o - u = -142 for o. 3 Let s be (-1)/((-2 - 0)/6). Suppose 9 = sj - z, -z + 3 = 5j - 4. Suppose -2 = -2v + 8. Solve vc - 3 = jc for c. 1 Suppose 3b + 16 - 112 = 0. Suppose -6y + 2y + b = 0. Suppose 0 = d - 2v + v - 19, -2v = -3d + 58. Solve -d = ys - 3s for s. -4 Let b(l) = 3l*2 + 5l + 6. Let q be b(-3). Let d = 19 - q. Solve 5v - d = 4 for v. 1 Suppose -2v - 3t = -0v, v = -3t - 3. Suppose -o - v = -10. Let g = -7 + o. Solve q = -g - 4 for q. -4 Let r = -111 + 121. Solve 0 = 9z - 4z - r for z. 2 Suppose 0 = -q - 2q. Suppose -6s + 16s - 40 = 0. Solve i - 1 - s = q for i. 5 Let x = 23 + -20. Suppose -xq + 21 = 9. Solve -5u - q = 6 for u. -2 Suppose 9j = -0j + j. Solve j = 7w - 6w for w. 0 Suppose 4v + 27 = 3f, 0 = 4f + 2v + 3 - 17. Let i be 0 - (-8 + 3) - (-7 - -10). Solve f = ic - 1 for c. 3 Let m = -1130 - -1146. Solve -4j - m = -12j for j. 2 Let d(g) = g2 - 12g. Let k be d(12). Suppose -8o + 13o - 50 = k. Solve a + a + o = 0 for a. -5 Let u(s) = s*3 - 12s*2 - s + 7. Let j(x) = 3x*2 - 9x. Let b be j(4). Let q be u(b). Let h be (-2)/((15/6)/q). Solve 0 = -ht - 0t for t. 0 Let l(t) = -3t3 + 67t*2 - 22t + 11. Let u be l(22). Solve 8x + 21 + u = 0 for x. -4 Let k = -77 + 77. Suppose 3z - 16 - 8 = k. Solve 0 = -6h + 2h - z for h. -2 Let a(h) = -11h + 37. Let s be a(3). Solve -5v + 11 = -s for v. 3 Let m = -1157 + 1217. Solve 30 - m = -6r for r. 5 Let s = -34 - -37. Suppose 2j + 0j - sk - 16 = 0, k = 5j - 14. Solve -8 = 2d - j for d. -3 Let n = 0 - 0. Suppose -7y + 4 = -5y. Let w be ((3 - y)/((-5)/(-65)))/1. Solve n = 5a + 2 + w for a. -3 Let j(z) = z3 + 5z*2 + 4z + 3. Let w(h) = 3h + 1. Let r(c) = 7c + 2. Let u(y) = -2r(y) + 5w(y). Let d be u(-5). Let n be j(d). Solve b = n - 1 for b. 2 Let q be 1 + 4/3(-38 - -41). Solve qh = 10h - 5 for h. 1 Let q be 1(17 + 0 + -4). Let y be 1 - (-1 - -2)-2. Let r = y + q. Solve -r = -3g - 7 for g. 3 Suppose 2b + 3u + 1 = 6u, -2u + 6 = 0. Suppose 5y - 5 = -r, -4r - 17 = r + by. Let j be 1 + (0 - r - -2). Solve k = -k - j for k. -4 Suppose -5w - u = -4w - 9, 0 = -5u - 5. Solve w = 7h - 5h for h. 5 Let v = 0 + 0. Suppose 5p - 90 = 4w, -w - 35 = 2p - 6. Let n be w/(-7) - (-3)/7. Solve -nh - 20 = -vh for h. -5 Let l = 312 - 308. Solve l = 5o + 29 for o. -5 Let r be 8/28 + (-120)/(-21) + 0. Solve 5 = -ra + 7a for a. 5 Let y(n) = 2n2 + 14n + 29. Let a be y(-3). Solve au = 27 - 2 for u. 5 Let l(g) = -g3 + 4g*2 + 4g + 5. Let a be ((-4)/(-8))/(1/10). Let n be l(a). Suppose n = -4b + 21 - 1. Solve bx - 6 = 2x for x. 2 Let j be (9 - (-3 + 7))/1. Solve -j = -4g + 5g for g. -5 Suppose 0g - 3g - 3 = 0, -3v - 37 = g. Let i = -12 - v. Solve i + 2 = -2c for c. -1 Let k be 56/2(-2)/(-4). Let g = -75 + 69. Let m = k + g. Solve 3l = -l + m for l. 2 Suppose 4u = -r + 11, 5r - 25 = 13u - 18u. Solve -r = -4a + 9 for a. 3 Let w(h) = -76h + 157. Let f be w(2). Let b(g) = g + 9. Let a be b(-5). Let p be (3/(-2))/((-2)/a). Solve f = pq + 2 for q. 1 Let v(u) = u + 4. Let j(s) = s*3 + 3s*2 + 2s - 2. Let i be j(-3). Let c be v(i). Let b(g) = -g*2 - 6g - 5. Let o be b(c). Solve -12 = -or + 3 for r. 5 Suppose 57 - 53 = -2f + x, -5f + 2x - 12 = 0. Let y(s) be the second derivative of s4/12 + s3/2 - 2s2 + s. Let p be y(f). Solve -5v + pv = -5 for v. 1 Suppose -s + 3i - 3 = 0, 2s + i - 6 = 9. Let a be (-4)/s + (-170)/(-30). Solve -a = -3z + 7 for z. 4 Let w(p) = 3p + 6p - 8p - 12. Let d be w(16). Solve -5l + dl = -2 for l. 2 Suppose -n = 3n - 8. Suppose 4 = 2v + nu, 0 = 5v + 2u - 3u - 22. Suppose -m = -v - 0. Solve 2i - 3i = -m for i. 4 Let h(r) be the third derivative of -r4/6 - r3/3 - r2. Let l be h(-3). Let c be (156/(-1456))/((-12)/14) + 2/(-16). Solve cw = 5w - l for w. 2 Suppose -22n - 49 + 137 = 0. Solve 11 = nl + 3 for l. 2 Suppose 0 = -38g + 172 + 56. Solve 114k - g = 112k for k. 3 Let j(r) be the first derivative of r*4/4 + 5r*3/3 - 4r*2 - 4r - 4. Let n be 3 - 1 - 24/3. Let o be j(n). Solve 6l - 4l + o = 0 for l. -4 Suppose 3t - 4t - 3w = 3, -4t + 22 = -5w. Suppose -3i = 24 + t. Let g be (-14)/(-18) + (-2)/i. Solve -z + 4 = g for z. 3 Let g(d) = d + 14. Suppose 3u - v = -30 + 6, -u - 8 = 3v. Let q be g(u). Solve qa + 20 = a for a. -4 Let o(r) = -r2 - 24r + 127. Let x be o(-28). Solve xl = 6l + 27 for l. 3 Suppose -22k = -16k - 12. Solve 8 + k = -5l for l. -2 Let r be 135/12 - 1/4. Suppose 38 = 6u - 4u. Let i = 20 - u. Solve r = -3y - i for y. -4 Suppose 7 = 2i - 3. Suppose 2 + 3 = ik. Let y(q) = -q + 1. Let m be y(k). Solve -l - 5 = -m for l. -5 Suppose -3c + 27 = 3y, c + 2y - 21 = -2y. Suppose -4h = -2n - 42, 3h + h - 3n - 45 = 0. Let l = -6 + h. Solve 4 = -lf - c for f. -3 Let m be (-19 + 19)/(-11). Solve -2x - 17x = m for x. 0 Let v(s) = -s*2 + 25s - 150. Let o be v(10). Solve -q = -oq + 4 for q. -4 Let y = -89 - -91. Solve 0 = 2h + yh + 4 for h. -1 Let a be (-24)/(-18)108/8. Solve aq + 0 = 36 for q. 2 Let g = -2 - -1. Let h = g + 1. Suppose -2q = 5i + 19, -2q - i - 1 = -2. Solve qa - a + 6 = h for a. -3 Let q(y) = 78y + 32 - 81y + 42. Let o be q(24). Solve -ou + 3 - 1 = 0 for u. 1 Suppose 3y + k = 30, 0y + 5k = 3y - 12. Suppose -q + 7 = 4b, -q + 0q = -4b + y. Solve 0 = -6p + bp - 20 for p. -5 Let d be -81 + (8 - 12). Let t(n) = -4n - 44. Let y be t(d). Solve ys = 2s + 2 for s. 1 Suppose 2i - 2 = 4. Suppose 2f - 4w + 28 = 3f, 20 = if - 4w. Suppose f = j + 2j. Solve 2u + 2 = j for u. 1 Let u(h) = 2h + 5. Let t be u(-2). Let n be (3/t)/(-3) - -3. Solve 0 = -nc - 1 + 9 for c. 4 Let p be 0/((-4)/84). Suppose p = -h - 5a + a + 20, -2h - a = -12. Solve 5 = -hw - 3 for w. -2 Let f(x) = -27x - 72. Let u be f(-3). Solve 8i - ui = 3 for i. -3 Let j(i) = -i*3 + 0 + 0 + 11 + 5i - 10i2 - 4i. Let p be j(-10). Let a = 5 - p. Solve -5 = d + ad for d. -1 Let p be 14 - ((6 - 0) + -4). Suppose 4z - 5m + 21 = -18, 4m = p. Let x be 11/33 - 16/z. Solve x - 5 = -2l for l. 1 Let v(u) = 2u*2 + 12u + 4. Let l be v(-6). Suppose 6a - ln = 3a + 31, 48 = 4a - 2n. Let k = -10 + a. Solve -ky + 5y = 6 for y. 3 Let l be 51/153 - -2(-2)/12. Solve -5g + l = -20 for g. 4 Let o = -61 - -117. Suppose o = -n + 59. Solve 14 = nu - 1 for u. 5 Let t = -6 - -9. Let n(m) = -m*3 + 17m*2 - 15m - 16. Let v be n(16). Let l be (5 + -4 + v)7. Solve 4x + t = lx for x. 1 Suppose 7m - 99 = -64. Solve -c - 1 = -m for c. 4 Let h be 289/17 - (-2 - (-9)/(-3)). Solve -p - 26 = -h for p. -4 Let b(m) = m*3 + 7m*2 - 9m. Let w be b(-8). Let d be 120/12w/(-5). Let q be 3/((-12)/d) + 3. Solve -5a - q = 3 for a. -2 Suppose -2k + 18 = 3j, -6j - 4k = -j - 32. Suppose 10c = 11c - 98. Suppose 0 = 9o - 2o - c. Solve -2f = o - j for f. -5 Let r(i) be the first derivative of -2i*3/3 + 3i*2/2 + 2i + 3. Let p be r(2). Solve pv = 5v + 20 for v. -4 Suppose -34w + 118 - 16 = 0. Solve 13 - 25 = wl for l. -4 Let g = -767 - -774. Solve 0 = 5m + gm - 24 for m. 2 Let o = -272 + 297. Solve 8z = 13z + o for z. -5 Let a = -27 + 31. Suppose 1 = an - 7. Solve 5i = ni for i. 0 Suppose 0 = 2k - 4k + 4. Suppose 4g + 4 = kg, 2g = 4j - 24. Solve -jl + l = 0 for l. 0 Let m(v) = -v - 8. Let l(r) = 3. Let a(g) = 7l(g) + 2m	{ "pile_set_name": "DM Mathematics" }
153a2 - 87a + 12. 3(a - 4)(a - 1)*2(5a - 1) Solve 3a*2 + 186a = 0 for a. -62, 0 Factor 4d2 - 208d. 4d(d - 52) Find c such that 7c4/2 - 75c*3/2 + 111c*2/2 - 25c/2 - 9 = 0. -2/7, 1, 9 Suppose 26j2 - 77j - 3 = 0. Calculate j. -1/26, 3 Solve -3o2/4 + 21o/4 + 735 = 0. -28, 35 Solve -2u4/9 + 16u*3/9 - 8u2/3 = 0 for u. 0, 2, 6 Factor s4/7 - s*3 + 6s2/7. s2(s - 6)(s - 1)/7 Factor 5s4 - 65s*3 + 200s*2. 5s*2(s - 8)(s - 5) Find b, given that -2b*4 + 82b*3 + 272b*2 - 352b = 0. -4, 0, 1, 44 Factor 2j4/5 + 8j*3 + 234j*2/5 + 396j/5. 2j(j + 3)(j + 6)(j + 11)/5 Determine v so that 16v2/3 - 45v/2 + 14/3 = 0. 7/32, 4 Find c such that 2c4/15 + 11668c*3/15 + 5668702c*2/5 - 34047224c/15 + 17029448/15 = 0. -2918, 1 Find j, given that -2j3 + 40j*2 - 266j + 588 = 0. 6, 7 Let -2j3 - 24j*2 + 138j + 160 = 0. Calculate j. -16, -1, 5 Factor -3h3/7 + 32h*2/7 - 60h/7 - 144/7. -(h - 6)*2(3h + 4)/7 Find n such that 2n*2/3 - 80n/3 - 150 = 0. -5, 45 Factor 5v5 - 20v*4 - 25v*3. 5v*3(v - 5)(v + 1) Find n such that n5 - 11n*4 + 42n*3 - 70n*2 + 53n - 15 = 0. 1, 3, 5 Let -3g3 - 15g*2 + 3g + 15 = 0. What is g? -5, -1, 1 Suppose -20q3/3 + 15q*2 + 50q - 40/3 = 0. Calculate q. -2, 1/4, 4 Factor -24b3/5 - 15b*2 - 9b/5. -3b(b + 3)(8b + 1)/5 Factor 4z5 - 48z*4 + 108z*3 + 160z*2. 4z*2(z - 8)(z - 5)(z + 1) Find u, given that -3u5 + 3u*4 + 108u*3 - 12u*2 - 672u + 576 = 0. -4, 1, 2, 6 Factor -5f3/4 - 1785f*2/4 - 3510f - 6980. -5(f + 4)2(f + 349)/4 Let -2v3 + 1612v*2 + 3230v + 1616 = 0. What is v? -1, 808 Determine f, given that 3f4 + 9f*3 - 9f*2 - 33f - 18 = 0. -3, -1, 2 Factor 16l5/7 - 4l*4 + 8l*3/7 + 4l*2/7. 4l*2(l - 1)*2(4l + 1)/7 Find k such that 4k*4 - 28k*3 + 8k*2 + 112k - 96 = 0. -2, 1, 2, 6 Find b, given that 2b3/13 - 404b*2/13 + 402b/13 = 0. 0, 1, 201 Factor 4b2/7 - 100b/7. 4b(b - 25)/7 Suppose 4z4 + 384z*3 + 13824z*2 + 221184z + 1327104 = 0. What is z? -24 Determine t, given that -5t2 + 17875t + 17880 = 0. -1, 3576 Let -2m4 - 8m*3 + 96m*2 - 224m + 160 = 0. What is m? -10, 2 Suppose -p*5/4 + 43p*4/4 - 41p3/2 - p2/2 + 83p/4 - 41/4 = 0. Calculate p. -1, 1, 41 Let 3y*4 - 84y*3 - 87y2 = 0. Calculate y. -1, 0, 29 Factor b3/2 + 65b2/2. b2(b + 65)/2 Let 12k3 + 148k*2 + 288k + 80 = 0. What is k? -10, -2, -1/3 Determine x, given that 2x2/7 + 78x/7 - 540/7 = 0. -45, 6 Find a, given that -7a4 - 849a*3 + 612a*2 + 244a = 0. -122, -2/7, 0, 1 Find u such that -14u4/5 - 682u*3/5 - 1708u*2 - 5568u/5 + 2304/5 = 0. -24, -1, 2/7 Factor -108k2 + 2412k - 13467. -3(6k - 67)2 Factor -a4 - 13a3 - 33a*2 - 31a - 10. -(a + 1)*3(a + 10) Let -l*5 + 2l*3 - l = 0. Calculate l. -1, 0, 1 Find f, given that 2f*5 - 21f*4 + 23f*3 + 159f*2 + 155f + 42 = 0. -1, -1/2, 6, 7 Determine a, given that 4a4 + 212a*3 + 988a*2 + 1356a + 576 = 0. -48, -3, -1 Determine a, given that -3a3/7 + 177a*2/7 + 180a/7 = 0. -1, 0, 60 Factor 28m3 - 8m*2 - 28m + 8. 4(m - 1)(m + 1)(7m - 2) Find p such that 6p5/5 - 12p*4/5 - 24p*3/5 + 48p*2/5 = 0. -2, 0, 2 Let -3w*4 - 402w*3 - 13863w*2 - 26532w - 13068 = 0. Calculate w. -66, -1 Factor -a*3/4 + 4155a*2/4 - 5754675a/4 + 2656741625/4. -(a - 1385)*3/4 Find m such that -405m*5 + 7920m*4 + 20995m*3 + 17050m*2 + 4820m + 440 = 0. -1, -2/9, 22 Find z such that -2z4/3 + 24z*3 - 548z*2/3 - 24z + 550/3 = 0. -1, 1, 11, 25 Factor -7n4 - 13n*3 - 6n2. -n2(n + 1)(7n + 6) Solve 2r*2/3 + 2662r/3 - 5332/3 = 0. -1333, 2 Solve -40o2 + 34o + 6 = 0 for o. -3/20, 1 Factor -2i5/5 + 16i*4 - 874i*3/5 + 1444i*2/5. -2i*2(i - 19)*2(i - 2)/5 Solve 9t4 - 444t*3 + 2724t*2 + 2016t = 0 for t. -2/3, 0, 8, 42 Find r, given that 4r5 - 1008r*4 - 3056r*3 - 1032r*2 + 3052r + 2040 = 0. -2, -1, 1, 255 Solve 3l3/2 + 255l*2/2 - 528l + 534 = 0. -89, 2 Suppose 4j2/7 + 1696j/7 + 179776/7 = 0. Calculate j. -212 Solve 2o5/3 - 74o*4/3 + 566o*3/3 + 2162o*2/3 + 2320o/3 + 800/3 = 0 for o. -1, 20 Factor s*3/6 - 2s*2/3 - 2s. s(s - 6)(s + 2)/6 Let 2t4/3 - 4t*3/3 - 2t*2/3 + 4t/3 = 0. Calculate t. -1, 0, 1, 2 Find n, given that -n*2 + 76n - 75 = 0. 1, 75 Factor 2w4 + 496w*3 + 46128w*2 + 1906624w + 29552672. 2(w + 62)4 Determine r so that -2r*3/11 - 8r*2/11 - 10r/11 - 4/11 = 0. -2, -1 Factor -4z4 + 32z*3 - 69z*2 + 47z - 10. -(z - 5)(z - 2)(2z - 1)2 Factor p3 - 670p*2 - 2019p. p(p - 673)(p + 3) Determine m so that m*4/9 - 35m*3/3 + 2701m*2/9 + 1007m/3 - 5618/9 = 0. -2, 1, 53 Let -4l4 - 376l*3 - 8836l*2 = 0. What is l? -47, 0 Factor 15n*3 + 3n*2 - 12n. 3n(n + 1)(5n - 4) Find p such that 4p3 - 32p*2 - 16p + 128 = 0. -2, 2, 8 Find v, given that 2v3 - 110v*2 - 482v + 590 = 0. -5, 1, 59 Factor 49f4/4 + 5565f*3/2 + 638353f*2/4 + 179670f + 51076. (f + 113)*2(7f + 4)2/4 Solve g2/2 - 97g/2 - 202 = 0. -4, 101 Factor -6p3/5 - 173p*2/5 - 1316p/5 - 196. -(p + 14)*2(6p + 5)/5 Find c, given that -2c*3/7 - 36c*2/7 + 146c/7 + 60 = 0. -21, -2, 5 Factor -5q3 + 80q*2 - 205q + 130. -5(q - 13)(q - 2)(q - 1) Factor r5/5 - 21r*4/5 + 104r*3/5 + 128r*2/5 - 384r + 3328/5. (r - 13)(r - 4)3(r + 4)/5 Let -3j5/2 - 5j*4/4 + 19j*3/4 + 3j*2/4 - 13j/4 + 1/2 = 0. Calculate j. -2, -1, 1/6, 1 Determine y, given that 21y2 + 314y/5 - 3/5 = 0. -3, 1/105 Suppose 3c5/4 - 3c*4/4 - 471c*3/4 + 3c*2/4 + 117c = 0. What is c? -12, -1, 0, 1, 13 Factor 8y3/5 + y2/5 - 8y/5 - 1/5. (y - 1)(y + 1)(8y + 1)/5 Factor 4t*4 + 32t*3 + 52t*2 - 120t - 288. 4(t - 2)(t + 3)*2(t + 4) Factor -2w3/9 + 10w*2/9 + 32w/3 - 56. -2(w - 6)2(w + 7)/9 What is j in -3j5 - 12j*4 + 12j*3 + 66j*2 - 9j - 54 = 0? -3, -1, 1, 2 Solve 3v5 - 27v*4 + 42v*3 + 6v*2 - 45v + 21 = 0. -1, 1, 7 Factor 2p5 + 14p*4. 2p*4(p + 7) What is b in -50b3 - 105b*2 + 50b = 0? -5/2, 0, 2/5 Factor -4l3 + 24l*2 + 124l - 144. -4(l - 9)(l - 1)(l + 4) Suppose -2j*3 + 32j*2 - 30j = 0. Calculate j. 0, 1, 15 Solve -2t2 + 934t - 4620 = 0 for t. 5, 462 Suppose -2b3/5 + 38b*2/5 + 8b/5 - 152/5 = 0. What is b? -2, 2, 19 Factor 4g5/3 - 28g*4/3 + 32g*3/3 + 64g*2/3. 4g*2(g - 4)*2(g + 1)/3 Find g such that 5g3 - 20g*2 - 220g + 480 = 0. -6, 2, 8 Factor 2b4/7 + 2516b*3/7 + 150840b*2 + 148173484b/7 + 147120118/7. 2(b + 1)(b + 419)3/7 Factor -t4/3 - 3t3 + 12t*2 + 256t/3 - 256. -(t - 4)(t - 3)(t + 8)*2/3 Factor 3s*2/7 + 17s - 40/7. (s + 40)(3s - 1)/7 Find x, given that 4x4/3 + 20x*3/3 - 24x*2 - 512x/3 - 640/3 = 0. -4, -2, 5 Suppose m*2 + 506m = 0. Calculate m. -506, 0 Find h, given that -10h2 + 865h - 430 = 0. 1/2, 86 Solve -2y3 + 4y*2 + 6y = 0. -1, 0, 3 Suppose -v*2 - 464v - 53824 = 0. What is v? -232 Let 16h5 + 2612h*4 + 121852h*3 + 1200300h*2 + 292500h = 0. What is h? -75, -13, -1/4, 0 Solve 156u2 + 477u + 27 = 0. -3, -3/52 Factor -a*2 - 281a - 558. -(a + 2)(a + 279) Determine v so that v4/2 - v3/2 - 13v*2 + 42v - 36 = 0. -6, 2, 3 Solve -l*2/4 + 1483l/2 - 2199289/4 = 0. 1483 Solve 12r5/7 - 684r*4/7 + 8235r*3/7 + 44652r*2/7 = 0. -4, 0, 61/2 Determine t, given that 27t*4 + 2880t*3 + 115200t*2 + 2048000t + 40960000/3 = 0. -80/3 Suppose -529b2/2 + 138b - 18 = 0. What is b? 6/23 Factor j*4 + 47j*3 - 489j*2 + 865j + 1400. (j - 5)*2(j + 1)(j + 56) Factor b2/3 - 14b/3 + 11. (b - 11)(b - 3)/3 Suppose -125g*4 + 8525g*3 - 1620g*2 - 5420g - 1360 = 0. What is g? -2/5, 1, 68 Suppose -5v4 + 15v*3 + 140v*2 = 0. What is v? -4, 0, 7 Find j such that -2j*4 - 14j*3 + 138j*2 - 234j = 0. -13, 0, 3 Let 3b4 - 33b*3 + 78b*2 - 48b = 0. What is b? 0, 1, 2, 8 Factor 3g3 - 72g*2 + 252g - 240. 3(g - 20)(g - 2)2 What is y in -y4/5 + 11y3/5 - 42y*2/5 + 68y/5 - 8 = 0? 2, 5 Solve a*5 - 26a*4 - 55a*3 - 28a**2 = 0. -1, 0, 2	{ "pile_set_name": "DM Mathematics" }
ich is the closest to f? (a) 9 (b) 3/4 (c) t b Let f = 0.03 - 0.364. Let m = f + 0.434. What is the nearest to -1/64 in 5, 4, m, 0.3? m Let f = -351 + 285.4. Let a = -59 - f. Let q = 6.3 - a. What is the closest to -1 in 2/13, -2/5, q? -2/5 Let h be 8454/14(-59)/177. Let b = h - -201. What is the nearest to b in 0, 1/3, 0.5, -2/73? -2/73 Let g = -4761 + 4766.171. Let k = g - 0.171. Which is the closest to 2/37? (a) 1/8 (b) k (c) 0 (d) 2/3 c Let i = -0.1 - -0.1. Let n = 86.3 - 86. Let d = 117 + -117.5. Which is the closest to i? (a) -10 (b) n (c) d b Let r be -4 - (3 - (-56)/(-12)). Let d = r + 5/6. Let a = 94 + -95. What is the closest to a in 2/7, -5, d? d Let m = -2.05 + 0.05. Let b = -2.1 - m. Let p be (-6)/(-39) + 28/156. What is the closest to 1/2 in b, 2, p? p Let k = 304.4 - 1.4. Let l = -304 + k. What is the closest to 2/3 in -31, l, 0.4? 0.4 Let c(a) = -a3 - 9a*2 + 10a + 5. Let w be c(-10). Let z = 0 - -2. Let j = 21773 - 21769. What is the closest to w in z, -3, j? j Let o = 2144 - 2141. Which is the closest to o? (a) 89 (b) 4 (c) 0.4 b Suppose 8 = 2f - 0f - 2s, 2s + 14 = 4f. Let a be 3/f - 11/6. Let r = -0.2 - -0.1. What is the nearest to r in -0.2, 3, a? -0.2 Let u = -5 + 1. Let o = u + -1. Let t = 0.089366 - 0.089366. What is the closest to -2 in t, o, -3? -3 Let w = 1.222 - 1.222. What is the closest to 5 in w, -14, -0.1, 4? 4 Let q = 1039/780 - 16/195. What is the nearest to 1 in 1/5, q, 1.6? q Let r = -2 - -2. Let h = -1471.4 + 1476.4. Which is the closest to -11? (a) r (b) h (c) -1/3 c Let m = -10893/2 + 5447. Let o = -0.1 - -0.5. Which is the nearest to 5? (a) m (b) o (c) 0 a Suppose 4y + 10 = -2t, 0 = 38t - 35t + 3y + 6. Let x = -7 + 10. Let g = -18 + 9. Which is the nearest to -2/3? (a) g (b) x (c) t c Let i = -32.923 - 0.077. Let r = i - -30. Which is the nearest to 1? (a) r (b) -0.6 (c) -0.2 (d) -1/4 c Suppose 2q + 39 = b - 171, -3q - 4b = 315. Let x = -30.292 + 29.992. What is the closest to 1/2 in q, x, -0.4? x Let t = -12115 + 12120. Which is the closest to -10? (a) 10 (b) t (c) -6 c Let d = -10/167 + -1246/1503. What is the nearest to 5 in -3, d, 4? 4 Let o = -1719 + 1770. Which is the nearest to o? (a) 1/10 (b) 3 (c) 1/2 b Let q be (-3 + 11)12/24. What is the nearest to 106 in -4, 1, q, 2? q Let q = -30151 + 30154. What is the closest to 0.2 in -0.2, -5, -3, q? -0.2 Let i = 10483 + -10491. Which is the closest to 0.1? (a) 5 (b) i (c) 2/5 (d) -4/5 c Let w = 7662 - 7661.801. What is the nearest to 0.2 in 0.1, w, 2, -3/7? w Suppose -64 = 3u - 5x, -44 = 2u - 0x - 4x. Let t be (-10)/u(-2)/20. Which is the closest to -1? (a) -5 (b) t (c) -3/4 c Let m = -67 - -65. Let h = -12.12 - -10.12. Which is the nearest to m? (a) h (b) -13 (c) 2 (d) 5 a Suppose -l + 3i = 2, 5l - i = -5i - 29. Let j = 7 - 2. Which is the nearest to -0.2? (a) l (b) j (c) 2 (d) -2 d Let g = 526 - 1579/3. Which is the closest to g? (a) -1 (b) -16 (c) 0 c Let a be (2/4)/((0 + -7)/(-42)). What is the nearest to -3 in -21, a, 2/5, 2/13? 2/13 Suppose -16v + 11v = 505. Let w = v + 504/5. What is the closest to 0 in 0.5, w, 0.02? 0.02 Let t = 22286 + -22524. What is the closest to -0.2 in t, 0.2, -0.3? -0.3 Suppose -4g + 132 = -3z - 2z, 2z + 3g + 39 = 0. Let f be (3/(-12))/((-36)/z). What is the nearest to 2 in f, 1, 1/9? 1 Let j = -169 - -166.8. Let v = 12.2 + j. Which is the closest to v? (a) -5 (b) -1 (c) 2 c Let z = 692 - 689. Which is the closest to -5/6? (a) z (b) -8 (c) -0.4 c Let v(o) = o*2 + 30o - 779. Let h be v(19). Let t = 152350/7 - 21916. Let q = h + t. Which is the closest to 0.1? (a) q (b) 1/5 (c) -1 b Let k = -23/33 + 59/132. Let u = 4.8 + -5.8. Which is the closest to u? (a) 7.5 (b) 3/4 (c) k c Suppose -2r - 3r = -20. Let j = -5729 + 5728.5. What is the closest to 1 in j, r, 11? j Let z(g) = -g*3 + 4g*2 + 24g + 19. Let y be z(8). Let x be (5 - y/(-10))-8. Which is the closest to -4? (a) x (b) 2/11 (c) -4/9 (d) 1 a Let s be ((-6)/105)/(142/(-1065)). What is the closest to -10 in s, -0.4, 0.031? -0.4 Let u be (-2)/(-4)((-40)/(-30) + (-8)/12). Let s = 0.3 + -0.1. Let y = s + -0.4. What is the nearest to 2 in u, 0, y? u Let c be (-1)/9-3 + 0. Let y = -2364 - -2362. What is the closest to c in -3, -6, y? y Let k = -1689.95 + -23.05. Let x = k - -1713.1. Let n = -1 - -7. Which is the closest to x? (a) n (b) 1/2 (c) 2/17 c Let c be 14/(-8)12/56. Let x(h) = -2h - 2. Let t be x(-2). Let l be (-575)/(-250) + (44/(-8) - -3). What is the closest to l in c, t, -0.3? -0.3 Let c be (2 + -4)/(2 + -8). Let x = -32660.8 + 32661. What is the nearest to 0 in 3, x, c? x Let g = 3 - 3.5. Let d = -182.05 - 1.95. Let i = d + 183. What is the nearest to i in 2, 0, g? g Let f = -3667 - -3672. Which is the closest to -1? (a) -21 (b) -5 (c) -1/3 (d) f c Let f(o) = -o3 - 31o*2 - 153o - 21. Let p be f(-6). Which is the closest to 0? (a) 1/3 (b) p (c) 0.4 (d) -0.2 d Let g be (-8)/(-28)22 + -35 + 29. Let q = 6 - 6.4. Let j = 1.4 + q. What is the closest to g in -0.5, 4, j? j Let p = -9599/3 + 3200. What is the closest to p in 4, 5, 2, -1/5? -1/5 Let n = -7/15 + 4/5. Let f = 159 + -159.1. Which is the closest to f? (a) 5/23 (b) 2/5 (c) n a Let n = 3.19 - 5.89. Let m be 12 + (-28)/12. Let k = 183 + -548/3. Which is the closest to k? (a) m (b) 0 (c) n b Let j = -0.6 - -0.1. Let l = -30622/53613 + -2/7659. What is the closest to l in 0.3, j, -0.04? j Let s = -1.364 + 3.064. What is the closest to 2 in -0.03, -4/7, s, -0.3? s Let p = 1592.4 + -1592. What is the closest to -52 in p, 4, 3, 5? p Let h = 16773 + -16772.5. What is the closest to 0 in h, -9/13, -6/11? h Let l(s) = -s*3 + 2s*2 - s. Let z be l(2). Let k be (-12166)/3792 + 10/3. Let g = 0.3 + -0.2. Which is the nearest to 2/3? (a) g (b) z (c) k c Let l = -579 + 799. Let h = 222 - l. What is the nearest to -0.3 in 2/11, h, 0.11, -4? 0.11 Suppose -5x = 712k - 714k + 31, 3k - x = 14. What is the nearest to 2/3 in k, -47, -1/3, 2/3? 2/3 Let v be ((-64)/720 - (-4)/18) + 14/(-30). What is the nearest to v in -3, -51, 0.4? 0.4 Suppose -3s + 3u - 801 = -5s, 2u - 1582 = -4s. Let w = -3141/8 + s. What is the nearest to 0 in -3, 1/3, w, 4? 1/3 Let p = 15.4 + -15. Suppose 13 = -2h - 77. Let j = h + 179/4. What is the nearest to -0.3 in p, 5, j? j Let s be (-8)/76 + (-112536)/(-26163). Let r = -77/17 + s. Let n = -1 + 1.1. Which is the nearest to r? (a) 2 (b) -4 (c) n c Let y = 0 + 0. Let q(f) = -f3 + 37f*2 + 256f - 18. Let o be q(-6). Which is the nearest to 6? (a) -5 (b) 2 (c) o (d) y b Let b = 764.9 + -706. Let c = -52.9 + b. Suppose 2u - q = 2q + 14, -5u + 1 = q. What is the nearest to -4 in -0.2, u, c? -0.2 Let n = 426 - 424. Suppose -n = -55h - 2. What is the nearest to h in 0, -0.05, 5, -2? 0 Let u be 30/(-4)(-396)/(-1980). Which is the closest to 0.16? (a) 9 (b) u (c) -1 c Let t(a) = -4a*2 - a - 4. Let i be t(-8). Let v = i - -647/3. Let s = v - -37. What is the nearest to -1 in 3/5, s, -1/4? -1/4 Let l = -2.54 - -2.8. Let o = l - -0.04. Let w = 2054 + -2056. Which is the nearest to -1? (a) -1/2 (b) w (c) o a Let i be -13/((-6)/(-4)). Suppose 3m + 3s - 798 = 0, -m = 2s - 195 - 71. Let z = m - 805/3. What is the closest to z in i, -3, 0.2? i Let t be ((-57)/1596)/((-2)/(-16)). Let a = 2103/11 - 191. What is the nearest to 1.9 in t, a, -1/4? a Let u = 20896 - 20895. Which is the nearest to u? (a) -277 (b) -17 (c) -2/3 (d) 1 d Let t = 9.655 + -1.238. Let m = -0.017 + t. Let f = -8.3 + m. What is the closest to -3/4 in f, 3, 2/15? f Let d = 40.3 + -40. Let u = 942.9 + -983. Let i = 40 + u. What is the closest to i in -4/3, d, 0? 0 Let s = -8.1 - -8.78. Let g = s + -1.18. Let d = 43/111 - 2/37. What is the nearest to -0.2 in 1, d, g? g Let x = 4.008 - 18.008. What is the closest to x in 3, -2/23, 5? -2/23 Let u = 0.005 + -22.005. Let m = 41 - u. Let h = m - 65. Which is the nearest to 0.4? (a) h (b) 2/5 (c) -0.3 b Let t = 1.55 - -53.45. Let r = t - 54.9. Which is the closest to 0.1? (a) 0.5 (b) r (c) 2 (d) 0.03 b Let r be (-4)/(-6) + (-2740)/(-12). Let v = r + -1605/7. Suppose 2o = -3q + 7, 3q = 2*o + q + 8. Which is the nearest to	{ "pile_set_name": "DM Mathematics" }
positive. n*(-5480/9) Simplify (gg/(g/g*(1/10))g*(-3)g(g/(g/g(2/27)g))/(gggg/(gg*(-3/11)g)gggg))(-1/2) assuming g is positive. g(24053/5940) Simplify ((r4/r)24/(r(rr*(6/5))/rr)(-36))26 assuming r is positive. r*(24336/5) Simplify (r/(r(r/(rr/(r/(r(9/11)r))))/r))*(-30)r*40rrr/(r/r*(-20))r assuming r is positive. r(-677/11) Simplify k6kk/((k/(k/k*(-12)))/k)k*(-2/9)k/(k((((kk*(4/7))/k)/k)/k)/kk) assuming k is positive. k*(1399/63) Simplify aa/(a*(-4/11)/a)(a/((a/(a/(aa(-44))))/a))/a((a/a*(-16))/aa)43 assuming a is positive. a(8562/11) Simplify ((z(-10))(-5)(z/(z/z(-7)))(-2/75))(-21/5) assuming z is positive. z(-26348/125) Simplify (((o/(o/o33)o16)(27/4))(-15))(-10) assuming o is positive. o*(99225/2) Simplify (((tt(8/3))/t(-2/9))/(t(ttt7)/tt)10)(-47) assuming t is positive. t*(40655/9) Simplify ((((x/(xx*0)x)/x)*(2/33)(x/(x/x*(5/4)))/(x/(xxx(-4/7))))(-1/50))(9/4) assuming x is positive. x(-423/5600) Simplify (v/v(-2/3))(-22)v*5v*3(v*3vv(-3))(-18/13) assuming v is positive. v(-1172/39) Simplify ((l(-1/4))(-2/71))6((ll(-1/3))/l(-1/6))(-35) assuming l is positive. l(-12407/426) Simplify (x/(xx*(1/7))x*(-8)x)*(-2/129)/(((xx/(x(x(-2/5)x)/xxx)x)/x)(-32)x*(2/5)x(-2)) assuming x is positive. x(-78964/4515) Simplify (d1/d2)/(d*(-7)/(dd*(4/5)/ddd))(d*(-7)d)/d*4(d(d/((d2/d)/d)d)/dd)/(dd/(d/(dd0))) assuming d is positive. d(-1/5) Simplify s1/((s6s)/s)((s/s(-1))/s)(2/13)(s(-1))(-13)(s/(s(-1/9)/s))/ss(-3/7) assuming s is positive. s(7237/819) Simplify ((((d/((d/(d*(-30)/d))/d)d)/d)(-26))(2/67))(-36) assuming d is positive. d(-56160/67) Simplify (((ss/s(-9))/sss(-2/25))/(s(sss/((ss(2/3))/s)s)/ssss(1/6)))(3/29) assuming s is positive. s(813/1450) Simplify (((n(n/(n/((n/n*(4/5))/n))nn)/nn)/(n((n/(((nn*(-20))/nn)/n)n)/n)/n))(-2/149))(-11/9) assuming n is positive. n(-2068/6705) Simplify (((ss*(-5/4)s)/s)*(-44)(ss((((s/(s/s*15s))/ss)/s)/s)/ss)/(s0/s))(-11/7) assuming s is positive. s(-286/7) Simplify ((z/(z(-1)z)z)/z(z(-2)z)/z)*(-1/58)(z(2/7))40/(z(1/3))(-1/2) assuming z is positive. z(7072/609) Simplify (b(-2)bbb(b*(-1/39)/b)/bb(1/2)/b(21/2))(1/5) assuming b is positive. b(-86/39) Simplify ((fffff*(-4)f)/((f(-4)/f)/f))(2/59)f(3/2)f*(-7)ff2f*2f assuming f is positive. f*(87/118) Simplify ((ll/(lll/(l/l*(-9))ll))/(ll*(-8))ll(2/9)l(llll/l*4l)/l)11 assuming l is positive. l(1606/9) Simplify (d(2/9))(-40)d/d(-4)dd/(d2d)d(d/((d/((d/(d/(d/(d/d*(1/3))))d)/d))/d))27/((d3/d)/dd3) assuming d is positive. d(253/9) Simplify s(ss/(s/s0ss)ss)/s(ss/(s/s(1/5)))/s(s(-1))36((s(-7)/ss)/s(s/s9)/s)31 assuming s is positive. s(-2809/5) Simplify (((bbbb*(2/29)b)/(b(1/11)/b))(-48))(-7) assuming b is positive. b(533568/319) Simplify ((x*4x)*(-1/15)(x(-1/3)/x)(-33))25 assuming x is positive. x(3275/3) Simplify ((oo(-6/11))(41/5)o((oo*(-1/12))/o)/ooo/o(7/5))(-4/5) assuming o is positive. o(-2801/825) Simplify (ww*(-28/5)www/(ww/(w(-21/2)/w)))/((w/((w/(ww*27ww))/w))/((w(-34)/w)/w)) assuming w is positive. w(-821/10) Simplify ((v14)(-1/19)(v/(v/v(-1/11)))/v(-3/26))23 assuming v is positive. v(-89033/5434) Simplify (((ll(-2/5))/l)/(l/(ll*6ll)l))*(2/29)((lll/l*(-2/7)ll)(2/7))(-2/19) assuming l is positive. l(39986/134995) Simplify (((h(1/6))47/((h/(h/h(-3/8)))/(hh*(-8)h)))(-14))(-3/26) assuming h is positive. h*(371/104) Simplify (ppp(7/4))/p(-5/4)p*(-30)p(-8/3) assuming p is positive. p(-83/3) Simplify ((((n/(nn/(n/n(3/4))))/n)/n(3/10))/(nn*3nn(-3)))/((n(1/5)/(n/(nn/(nn3)n)))/(n*(-2)nn(n/n(-3))/n)) assuming n is positive. n(3/4) Simplify ((f/(f(f(-1/4)f)/ff))(-3/8)(ff(2/3)/f)/(f(3/8)/f))/(ff*(-7/3)ff/(f/f(-3/7))f7/f(-2/3)) assuming f is positive. f(-3583/672) Simplify (k/k9k(kk/(k/((k((k/((kk/((k(-7)/k)/k)k)/k))/kk)/kk)/kk)))/k(k(-2/7))(-16))(-20) assuming k is positive. k(1600/7) Simplify ((z(-2/9)/z)/z(1/7)(zz1)38)/(((zzz/(zz(-1/3)))/z)(7/4)/(z(1/4)/z(1/3))) assuming z is positive. z(18199/252) Simplify o(3/8)/(ooo18o)oo*(2/3)/oo(o29o)/o assuming o is positive. o(241/24) Simplify (p0p(-5))(-7/4)(((p(-1)/p)/p)/p(-6/7))/(p/(ppp(-1/4)/p))0 assuming p is positive. p(185/28) Simplify ((x16)*(-50)x*17x/x15)2 assuming x is positive. x(-1594) Simplify (r8)*(-13)/(((rr*26)/rr)/(r*(-7)r)) assuming r is positive. r(-137) Simplify (((p/p41)/p)/pp((p/(p/(p/p*(-31))))/p)/p(pp(-23/3)p)/p(-3/2))(6/5) assuming p is positive. p(-91/5) Simplify ((m(-2)/m)/(m/(m/((m/(m*(-2/9)/m)mm)/m))))(-5/2)/((m1m)*4(((mm(1/9))/m)/m)/(m/((mm(-1/4))/m))) assuming m is positive. m(349/36) Simplify ((k(2/23))(6/23)k/(k6/k)k12)(-9/10) assuming k is positive. k(-19098/2645) Simplify (l0)(-2/81)/(l(2/5)ll*(-2/7))(l*(-3/2)(l(1/2)/l)/l)/(l2/(l*(5/3)l)) assuming l is positive. l(-362/105) Simplify (t(-1))*(-18/13)(t(-1))(-24)t(-5)t*0(ttt*0/tt)49 assuming t is positive. t(1539/13) Simplify ((((k(-8/7))(-5/3))(-1/5))41)(-50) assuming k is positive. k(16400/21) Simplify ((t(2/3))(23/3)(tt(-1/3)/t)21)/(tt/((tt(tt*4/tt)/t)/tt)t/(t/(ttt*(2/17)t))t(t(1/2))(-1/31)) assuming t is positive. t(-18881/9486) Simplify ((b3)*(2/97)b*(-14)bbb(-2/45))(-2/23) assuming b is positive. b(104608/100395) Simplify ((i5/(i/(ii(1/3)i)i))/(ii*(1/2)iii(-1/4)/i))/((i(-2/3))19/((i6/i)/i6)) assuming i is positive. i(59/4) Simplify (xx/(xx/(xx(2/5)))xx(xx(-4))/x)/(x0)(-1/49)(x/(x*(-1/3)/x)xxx*(-4))/((xx/x(-2/31))/x(-9)) assuming x is positive. x*(-5269/465) Simplify (nn/n*35nn35n*(2/47)n(-2/11))(-39) assuming n is positive. n(-57681/517) Simplify (((i/i(-1/7)i1)/(i(2/9)i(1/8)))(-39))(-18) assuming i is positive. i(35295/28) Simplify (yyy*(-33/7)y)/((((y*8/y)/y)/y)/y)y*(-1/18)yy(-7/5) assuming y is positive. y(-3887/630) Simplify (w/(w/w(-1/4)))(-12/7)/(w(-5/4)/w(-2/7))(w*(2/5)w)(-38)/(w(-1)/ww(2/7)) assuming w is positive. w(-7013/140) Simplify (v(-2/7)/(v/v(-1/8)))49/(((v(-1/5)v)/v)/(vv(-3))v(-6)/v8) assuming v is positive. v(-2277/40) Simplify (u(-15)u/u(-13)uu/u(1/3)uuuu14)(-4) assuming u is positive. u(-212/3) Simplify (nn*(-9)nnnnn)*(-19)n/(n/(n/((nnnn/(n/(nn(nn*6n)/nn)))/n)))nnnnn43 assuming n is positive. n93 Simplify ((ff(ff2)/f(ff(2/21))/f)/((f(4/11)f)/f)(-22))45 assuming f is positive. f(3810/7) Simplify (b(-2/7)b(-5))(-10)/(((b(2/3)/bb)/b)36)(-50) assuming b is positive. b*(-3830/7) Simplify (qq*13/qq*(-6/11)(q/q(-2))(-22/9))(-39) assuming q is positive. q(-2197/11) Simplify (mm/(m(3/4)m)mm*(5/8)(m(-1/6)/m)42)(1/78) assuming m is positive. m(-29/48) Simplify ((x(-2))13)*(-1/22)((x/x6)/(x/(x/x(-6))))/(x1)(2/51) assuming x is positive. x(1202/561) Simplify (s(5/2))25/(s1)28 assuming s is positive. s(69/2) Simplify o*17o*(-2/19)o/((oo(10/9))/o)oo/((o/((oo*(-6/13))/o)o)/o)o assuming o is positive. o(40730/2223) Simplify (((b(bb12)/b)/(b4bbb))/((b/(b/(bb/(b/b(2/3)b))))/b)(-7/9))(4/7) assuming b is positive. b(620/189) Simplify ((d(-1/2))*(-1/23)d*(-3/7)d(2/5))/(((d/d(-7))/(d(-4/5)/d))/(d/d(-2/23)ddd/d(-1))) assuming d is positive. d(-7599/1610) Simplify (y(-10)y/(y/y*(-8)y)yyy(-5)y(-7))(1/25) assuming y is positive. y(-29/25) Simplify (s(2/57)s)(-33)/((s/(s(-13)/s))/(sss19s)) assuming s is positive. s(-516/19) Simplify (a(-2/7)/(a/(a(a/(a2a))/a)))/((a**(-2	{ "pile_set_name": "DM Mathematics" }
- 4s2 - 48s - 82. Let x be u(-2). Let b = -4 + 9. Suppose 53 = v + 3v + bl, -x = 2l. Is v a multiple of 2? False Suppose 5 - 17 = 4q. Let i(u) = -7u3 + u2 - 7u + 1. Let d(l) = 2l3. Let j(k) = 4d(k) + i(k). Does 4 divide j(q)? True Let i(k) = 97k3 - 17k*2 + 11. Does 33 divide i(4)? False Is 3/((-63)/12) + 108628/(-910)-190 a multiple of 21? True Let h(i) = 2i2 - 13i - 3. Let p be h(7). Suppose 14n = 13n + p. Suppose -u - 5m = -4u + 313, 0 = nm + 8. Does 9 divide u? False Let i(z) be the third derivative of -1/6z*4 + 0 + 1/60z*5 + 1/2z*3 + 6z*2 + 0z + 97/120z6. Is i(1) a multiple of 26? False Let p = 317 + -304. Suppose -5c + 1365 = -0j + 5j, -4c = j - 288. Suppose pz - 9z = j. Does 16 divide z? False Suppose 4h + 166 = -2v + 8h, -5v = -2h + 407. Let l = v + 16. Let m = 135 + l. Is 5 a factor of m? True Let c = 26 + -24. Suppose co - 18 = -o. Is o5/(-10) + 75 a multiple of 12? True Let z be 10 + ((-996)/204 - 8/68). Let h = -1 - -4. Suppose 4p = -a + 100, -zp + ha + 116 = 2a. Is 8 a factor of p? True Suppose 3a - 2k = -185, 2a + 115 = 4k - 3. Is (3 + a)84/(-35) a multiple of 39? False Suppose 14038 - 246814 = -26x - 27x. Is 3 a factor of x? True Suppose 15 = -3j, -22 = -5z + 3j - 52. Does 21 divide (-192/(-6))/(z/(-189))? False Let h = 373 + -372. Does 25 divide (-5h)/(-9 + 1568/175)? True Suppose -80g - 20064 = -476784. Does 11 divide g? True Suppose -53a + 55a + 20 = 0. Is 2 a factor of 13/((-13)/a) + -5? False Let z(s) = -2s*3 - 22s*2 + 20s + 18. Let j(h) = 4h3 + 44h*2 - 41h - 34. Let w(i) = -4j(i) - 9z(i). Does 8 divide w(-11)? False Let q be (-1080)/(-4)(-22)/(-4). Let x be (-15)/20 - (q/(-12) - 0). Let c = x - 23. Is c a multiple of 7? False Let i = 2838 - 2179. Does 4 divide i? False Let i(n) = -5n*2 - 70n - 10. Let c(p) = 4p2 + 69p + 12. Let z(a) = 7c(a) + 6i(a). Is z(15) a multiple of 20? False Suppose 2q - 16d = -15d + 11056, -q + 4d + 5514 = 0. Does 14 divide q? True Is 21 a factor of (-4)/4-1193 + 4? True Let u(p) = 184 - 20p - 247 + 5p. Does 12 divide u(-19)? False Suppose -8p + 6643 = -8845. Suppose -p = -4v + 4n, -7v = -4v - 5n - 1462. Is v a multiple of 21? False Suppose 3i = -2u + 22302, 4i - 61u = -58u + 29787. Is i a multiple of 60? True Suppose -4f = 4d, -4d - f - 4f + 3 = 0. Does 4 divide (28/7)/((-6)/144d)? True Suppose 0 = -29i - 37i + 144474. Is 5 a factor of i? False Let u = -9154 - -10148. Is 41 a factor of u? False Suppose -88y = -89y - 719. Let r = -168 - y. Does 10 divide r? False Let i(y) = -3y*2 - 10y + 27. Suppose 0 = -4d - 4u - 20, -4d + 2u - 16 = 7u. Let k be i(d). Is 13 a factor of (k/35 + 4)/((-2)/(-130))? True Let i(o) = 16o + 17. Let v(a) = -16a - 17. Let u(t) = 4i(t) + 5v(t). Let k be u(-12). Suppose 4p = -63 + k. Does 28 divide p? True Let c = 133 + -130. Suppose 0 = -cs - 3, -4t = -4s - 16 - 1088. Is t a multiple of 11? True Suppose -19n + 8n = 2n - 357968. Does 38 divide n? False Suppose 0k - 4k + 4j + 7184 = 0, -5j + 3557 = 2k. Suppose 651 = 22x - k. Is x a multiple of 6? False Let r(z) = 4z3 - 37z*2 - 24z + 43. Let x(l) = l*3 - 9l*2 - 6l + 11. Let h = 5 - 3. Let o(w) = hr(w) - 9x(w). Is 15 a factor of o(7)? False Let f be (24/18)/((-1)/((-30)/4)). Let w be 4/f - 24/10. Is 5 a factor of (16/(-1))/(w/3)? False Let p = -18 - -27. Suppose pm = 3013 + 3314. Is 36 a factor of m? False Suppose -5w + 47 = 157. Let g = w + -27. Let m = 86 - g. Does 17 divide m? False Let f = -539 - -555. Suppose -fa + 18a = 1160. Is a a multiple of 71? False Let v(a) = 12a3 - 21a*2 + 72a + 9. Is v(8) a multiple of 15? True Suppose -1082991 - 608334 = -130g - 125995. Is g a multiple of 13? False Suppose -29d - 28 = -31d. Is 2412/d + (-34)/119 a multiple of 13? False Suppose 17c - 3284 = 18323. Is 2 a factor of c? False Let k be (-4)/(-4) - (-45 - -3). Let g = k - 71. Let m = 168 + g. Does 35 divide m? True Suppose 120120 = 43u + 61u. Does 55 divide u? True Suppose 2l + 4l - 18 = 0. Suppose -lj + 119 = -58. Is j a multiple of 31? False Let l = 74 - 80. Does 61 divide (1 - 11/2)1384/l? False Let w = 5756 - -1157. Does 28 divide w? False Suppose -s = 4d - 53118, -66396 = 7d - 12d - 2s. Is 32 a factor of d? True Let k = 136 - 134. Is 24 a factor of k/7 + (-985)/(-7)? False Let n(j) be the first derivative of -2j3/3 + 15j*2 - 16. Let x be n(15). Suppose x = -6h + 65 + 25. Is 3 a factor of h? True Let w = -626 - -1781. Suppose 30g + w = 4005. Does 10 divide g? False Let f = 619 + 1217. Suppose -1806 = -6b + f. Is 9 a factor of b? False Let d = -19152 + 36858. Is 6 a factor of d? True Suppose 1232 - 2168 = -12q. Does 9 divide q? False Let m(b) = 100b*2 - 27b + 10. Is 6 a factor of m(4)? False Let u = 4756 + -5403. Suppose n - 150 = 6n. Is u/(-5) - (-12)/n a multiple of 43? True Suppose 3w = -2b + 432, w - 91 = -2b + 49. Let v = w + 234. Is v a multiple of 20? True Let f be ((-561)/22)/17(-712)/1. Suppose 284l + f = 290l. Does 9 divide l? False Let o(u) = 85u*2 + 61u*3 + 4 + 2u - 90u2 - 5u. Is o(2) a multiple of 34? False Let n be 0 - (1352/(-20) - 6/(-10)). Let u = n - 64. Does 22 divide (-2)/(-6) - (-329)/u? True Let q = 37485 - 26708. Is 32 a factor of q? False Let t be ((-6)/8)/(-3) + (-223934)/(-8). Let k be (-4)/(-14) - t/(-28). Suppose 6m - k = -4m. Does 20 divide m? True Let n(h) = 3h2 - 5h - 30. Let r be n(-8). Let c = r + -130. Is 4 a factor of c? True Let g(f) = f*2 + f - 5. Let n be g(-3). Let r = 56 - n. Let m = r - 2. Is 23 a factor of m? False Is (-2534885)/(-114) - 3/(-36)(-1 + 3) a multiple of 51? True Let q(p) = -262p + 61. Let l be q(7). Let r = -978 - l. Does 59 divide r? False Suppose -52p - 1855471 - 257969 = -120p. Is 10 a factor of p? True Let s(o) = -8o*3 - 3o*2 + 12. Let g(c) = -7c*3 - 3c*2 + 11. Let i(y) = 5g(y) - 4s(y). Let t be i(-3). Let z = t - 56. Does 5 divide z? True Let p = -19303 - -20661. Is p even? True Let g(z) = -120z - 16. Let a be g(1). Let p be (-43)/(2 - 15/7). Let o = p + a. Does 16 divide o? False Suppose 2s + 2w + 12 = 0, 14 = 3s - 6w + w. Is 7 a factor of 1/s - (-4123)/38? False Let w be 58 - (2 + -3)(-2)/1. Suppose 0 = -4o + 5l - 361, -2o + 5l = 127 + w. Let n = -46 - o. Does 23 divide n? False Let h(g) = -19g - 205 - 61g - 23g. Is h(-11) a multiple of 32? True Let b(s) = 2s2 + 18s + 15. Let f be b(-10). Does 22 divide (-10)/(f/(-7)) - (-1090)/5? True Let n = 13274 - -22450. Is n a multiple of 78? True Suppose 0 = -4r - 5k + 115059, -42k + 57505 = 2r - 43k. Is 32 a factor of r? False Let y = -5302 - -10563. Is y a multiple of 11? False Suppose 5z - y = 3099, -4z - 21y + 2479 = -22y. Suppose -22p - 417 = -2m - 21p, -4p + z = 3m. Does 13 divide m? True Let i = -560 + 584. Is 34 a factor of 423/(152/i - 6)? False Suppose 3q + 3u = 192, 4q - 281 = -4u + 5u. Is 22 a factor of 34201/q - (-8)/6? False Suppose -6p + 16859 = 1859. Suppose -p = 5o - 740. Is 9/(-2)o/33 a multiple of 16? True Let h(u) = -33u + 27. Let z = 284 - 290. Does 14 divide h(z)? False Let c be -4((-2202)/12 + 7). Suppose 11r = -5h + 13r + 714, 5h - c = -2r. Does 9 divide h? False Let y(c) be the third derivative of -c6/120 - c5/12 + 3c4/8 - c3/2 - c*2. Suppose 5d + 10m + 23 = 7m, d = -3m + 5. Does 32 divide y(d)? True Let y(n) = -31n + 3. Let p be 0 + (-4 - -1) - (-1 + -39). Suppose -42x + px = 10. Is y(x) a multiple of 19? False Let z(r) = -21r2 + 3r*3 + 2 - 4r*3 + 28r2 + 6. Is 4 a factor of z(7)? True Is (19 - 61306/(-8)) + (-1)/4 a multiple of 23? True Let m(t) = -t2 + 22t + 54. Suppose -24p - 288 = -36p. Is 3 a factor of m(p)? True Suppose x + 4z + 7480 = 5x, 4z + 1870 = x. Suppose 8w = 18w - x. Is w a multiple of 11? True Suppose -14 = 4o - 46. Suppose y + 5u + 1 = o, 3y + 3u = -15. Let k(r) = r*3 + 11r*2 + 6r - 19. Does 21 divide k(y)? False Suppose -72 = -14f - 16. Suppose 2q - 496 = fy - 6y, 0 = y + 5q - 268. Is y a multiple of 9? True Suppose 4y - 115y + 105274 = -47906. Is 115 a factor of y? True Suppose 0 = -67f + 45f + 47806. Does 4 divide f? False Let m(x) = -18x - 63. Let n b	{ "pile_set_name": "DM Mathematics" }
6l2 Differentiate -1016i*3p*2u + 7i3p + 2ip*2u + 49ip*2 wrt u. -1016i*3p*2 + 2ip2 Find the first derivative of 61hr3z*2 - hr*3z - 33r3 - 2r*2z*2 wrt h. 61r*3z2 - r3z Find the third derivative of -d3j*2k*3 - 2d*3j*2k - 3d2k*2 - 19j*2k*3 - 1752j*2k - 13k3 wrt k. -6d*3j*2 - 114j*2 - 78 Differentiate 88cn2 + 39n*2 wrt c. 88n*2 Find the first derivative of 244w*3 + 6w*2 + 1435. 732w*2 + 12w What is the derivative of 4824c + 3296? 4824 Find the third derivative of 46c*3i3 - c3i2 + 5c*3i - 4c2i*2 - ci*2 + 2i*3 + 69i*2 wrt c. 276i*3 - 6i*2 + 30i Differentiate 2ci*2s + 20cs*3 - cs*2 - 23i*2s3 - s3 with respect to i. 4cis - 46is3 Find the first derivative of -1300r*3x*2 + 2r*3 + 2x*4 + 887 wrt x. -2600r*3x + 8x3 Find the third derivative of 4534z*3 - 9z*2 + 141. 27204 Differentiate -194q*4 - 4q*3 + 6046 with respect to q. -776q*3 - 12q*2 What is the second derivative of 2ap3 - 4ap2 + 21ap + a + p3 - 7p wrt p? 12ap - 8a + 6p Find the second derivative of 2q3 + 12q*2 + 2q + 181 wrt q. 12q + 24 What is the third derivative of 831t*3 - 156t*2 wrt t? 4986 What is the second derivative of 6b*3v*2 + 2b3 - b2v2 + 2b*2v + 604v2 - 6284 wrt v? 12b*3 - 2b*2 + 1208 What is the derivative of 277i*3z + 330i3 wrt z? 277i*3 What is the second derivative of 13565v*2 - 14154v wrt v? 27130 What is the first derivative of 21c2q - 2008c2 - 16cq wrt q? 21c*2 - 16c Differentiate 784u + 974 with respect to u. 784 Find the third derivative of 156l*2r*4 - 162l*2r*2 - lr*4 - 7l - r*4 wrt r. 3744l*2r - 24lr - 24r Differentiate -h3k*2 + 2h*3l - 256h3 - h2kl + 2395hk2l + 2h wrt l. 2h3 - h2k + 2395hk2 What is the second derivative of 9b*2g*3h*3 + 20b*2g*2h*3 - 2bg3h*3 + 530bg2h*3 + 2bgh wrt b? 18g3h*3 + 40g*2h*3 Find the third derivative of 1582x*5 + 2x*4 - 463x*2. 94920x*2 + 48x What is the second derivative of -722c2z*2 - 4cz2 + 20c wrt c? -1444z2 Find the second derivative of -639g*5 + 782g wrt g. -12780g3 What is the third derivative of 3sy3 - sy*2 + 7sy + y6 + 898y*5 - 15y*2 - 2 wrt y? 18s + 120y3 + 53880y*2 What is the third derivative of -ah*3 + 1872ah2 + 552h*4 wrt h? -6a + 13248h What is the derivative of 1209l - 482? 1209 Find the second derivative of -10ry*4 - 9ry2 + 22ry - 2r + 2y4 - 8 wrt y. -120ry2 - 18r + 24y2 What is the third derivative of 403l*4 - 1628l*2 wrt l? 9672l What is the second derivative of -60b3u3 - b3 - 33bu*2 + 4u*3 wrt b? -360bu3 - 6b Differentiate -95x4 + 36x*2 - 7998 wrt x. -380x*3 + 72x Find the third derivative of -6v4 - 38v*3 + 18v*2 - 7v wrt v. -144v - 228 What is the second derivative of -14s*2x*4 - 2s*2x - 2sx*5 + 362x wrt x? -168s2x*2 - 40sx3 What is the first derivative of -23d*2r*3 - 159d*2r*2 - 1166d*2 wrt r? -69d*2r*2 - 318d*2r Find the second derivative of -3859q5 + 3066q wrt q. -77180q3 What is the second derivative of -2i*3u*3 - 33i*3u2 + i3u - 10i*3 - 5i*2u - 22iu*3 - u wrt u? -12i*3u - 66i3 - 132iu What is the derivative of -672n + 19 wrt n? -672 What is the second derivative of -92b2x - bx - 2b - 3x wrt b? -184x What is the first derivative of 55f2m + 797f2 - 2m*3 wrt m? 55f*2 - 6m*2 Find the third derivative of 22754h*6 + 22243h*2 wrt h. 2730480h*3 What is the second derivative of 330s*2 - 38s wrt s? 660 What is the first derivative of 2kt*3w + 2kt - 3t3w + t*3 + tw*2 + tw - 76t wrt w? 2kt3 - 3t*3 + 2tw + t Find the first derivative of -261h*2 - h + 459 wrt h. -522h - 1 Find the third derivative of -3725m3 - 15m*2 - 32m + 2 wrt m. -22350 What is the second derivative of 16c5i*2 + 5c*3i*2 + 91ci2 + i2 wrt c? 320c*3i*2 + 30ci2 Differentiate 173a*3g + 74a3 - a2g + 15 with respect to g. 173a3 - a2 What is the derivative of -3fg2y*2 + 3fg2y + 684fy*2 + 2g*2y - 2y2 wrt g? -6fgy*2 + 6fgy + 4gy Find the second derivative of 42l2 - 2l - 12 wrt l. 84 Find the second derivative of -208x4 + 2x*2 - x - 8 wrt x. -2496x*2 + 4 What is the first derivative of 1767m*3y*2 + 6779m*3 - my*4 wrt y? 3534m*3y - 4my*3 Find the third derivative of -8s*6 - 9s5 - s3 - 6s2 + 2s + 29 wrt s. -960s3 - 540s*2 - 6 Differentiate -2d*3f*2j + 5d3f*2 + 18df + 15dj with respect to j. -2d*3f*2 + 15d What is the second derivative of 156o2 + 262o? 312 What is the second derivative of 816p5 + 2p*2x*2 - 2px2 + 2px + 1206p - x wrt p? 16320p3 + 4x*2 Differentiate -2492kz2 - 1062z*2 with respect to k. -2492z*2 Differentiate -2n*3y2 + n3 + 46n - 4y*2 - 4 with respect to n. -6n*2y*2 + 3n*2 + 46 Find the second derivative of 3534v*4 + 1105v. 42408v2 What is the derivative of -2t*2u*4 + 2t*2 + 750t - 7u4 + u2 wrt u? -8t*2u*3 - 28u*3 + 2u What is the second derivative of -617b2jz - 2b*2z*2 - 2bjz*2 + 2jz2 + 1035z*2 wrt b? -1234jz - 4z*2 Find the second derivative of -7z*4 - 3z*3 + 230z*2 - 6604z wrt z. -84z2 - 18z + 460 Find the second derivative of -bi3k - 2bi*3 + 2bik - 23b + 35i*3k + i wrt i. -6bik - 12bi + 210ik Find the second derivative of 441s*2 + 727s wrt s. 882 Find the third derivative of 3553o4 + 6o*2 + 46o - 1. 85272o Find the first derivative of 4afu*2w - afu*2 + 4afuw - 2au2 + 3a - 2fu*2 - 2fw wrt w. 4afu*2 + 4afu - 2f Find the third derivative of 15k*6 - 2k*3 + 3k*2 + 15 wrt k. 1800k*3 - 12 What is the derivative of -1010x*2 + 5x + 7233 wrt x? -2020x + 5 Find the first derivative of -655q + 564 wrt q. -655 Find the third derivative of -634h4 + 135h*2 - 8. -15216h What is the second derivative of -3gr*3 + 5g + 10r2 + 9r wrt r? -18gr + 20 Differentiate -11ah - 207a - h4 - 2h with respect to h. -11a - 4h*3 - 2 What is the third derivative of 1035g*2q*3 - 2g*2q*2 - 509g*2 + 2g + 3q3 - q2 wrt q? 6210g*2 + 18 Differentiate -22041s*2 + 9703 wrt s. -44082s What is the first derivative of -2a4 - 82a*3b + 29b - 3 wrt a? -8a*3 - 246a*2b Differentiate 512w4 + 3w + 10521 with respect to w. 2048w3 + 3 Find the first derivative of dnv3 + 271dn - 2dv + 31nv3 - 5n wrt d. nv3 + 271n - 2v Find the first derivative of -177ax4 - 8ax2 + 6314a wrt x. -708ax*3 - 16ax What is the second derivative of o2q*3 + 48o*2q - 10oq + 4q3 wrt o? 2q*3 + 96q Find the second derivative of 82c4 - 115c. 984c2 Find the second derivative of -89q*2t*3 + 26q*2 - 743qt3 - t3 + 2 wrt q. -178t*3 + 52 What is the second derivative of 282z*4 + 4z*3 + 14056z? 3384z2 + 24z Find the second derivative of 942q2 - 89q - 9 wrt q. 1884 Find the first derivative of 7mw*2 - 24mw - 121w*2 + 1 wrt m. 7w*2 - 24w Find the third derivative of 9d3p*5 + 5d*3p*2 + 3d*3p - 3p5 + 10p*2 wrt p. 540d*3p*2 - 180p*2 Differentiate 192f*4l - 7f3l2 + l2 - 183l - 5 with respect to f. 768f*3l - 21f2l*2 Differentiate -5479m*2 - 6490 wrt m. -10958m What is the derivative of -38o2tv - 9o*2t - o*2v - 15ov - 2tv - 65t + 2 wrt v? -38o*2t - o*2 - 15o - 2t Differentiate -177b + 209 wrt b. -177 What is the first derivative of 421v4 + v2 - 12622? 1684v*3 + 2v What is the second derivative of -2i2m*2 - 96i*2m + 2im*2 + 31im wrt i? -4m*2 - 192m What is the first derivative of 2g2n + 111g2 + 104gn2 - 3g - n*2 wrt n? 2g*2 + 208gn - 2n Find the first derivative of 2j2t*2u*2 + 4j*2t*2 + 27j*2tu - 7jt2 - 9j wrt u. 4j2t*2u + 27j2t What is the third derivative of -16c3v*2 + 2c*3vx*3	{ "pile_set_name": "DM Mathematics" }
Let q = -23039 + 7705. Let x = q + 8464. What is x rounded to the nearest 1000? -7000 Suppose -9g + 12 = -6g. Suppose 0 = -3x + 3, c + gc + 3x = 208. Suppose -2u + c = -103. Round u to the nearest ten. 70 Let o = -16105738.03000628 + 16105740. Let a = 1.97 - o. Round a to 6 decimal places. 0.000006 Let n = -1.6649574 - -1.6638. What is n rounded to 4 dps? -0.0012 Let g = -1941.995 + 1925. Round g to one decimal place. -17 Let j = -1.012 - -1.1377. Let v = 0.0554 - j. Round v to 2 dps. -0.07 Let o = -20.93 - 46.09. Round o to the nearest 10. -70 Let u = -0.1544 + 2917.1544. Let j = u + -2914.594. What is j rounded to 1 decimal place? 2.4 Let o = -0.33659742 - -0.3366. Round o to six decimal places. 0.000003 Let o be ((-165)/6)/(67/94872). Round o to the nearest one hundred. -38900 Let w = -1241.9 - 277.1. Let s = 1430.1 + w. What is s rounded to the nearest integer? -89 Let q = -3.651 + 3.6507975. Round q to six dps. -0.000203 Let r = -4.4 + -1.6. Let o = -2172958 + 2172952.000021. Let a = r - o. Round a to 6 decimal places. -0.000021 Let h = 18721.00014632 + -18721. What is h rounded to 6 dps? 0.000146 Let f be 3632(9983 + (0 - -17)). Round f to the nearest 1000000. 36000000 Suppose 15z + 252 = 8z. Let n be -24140004 + 9/((-81)/z). Round n to the nearest 1000000. -24000000 Let y = 1661 - 1660.9962685. Round y to 4 decimal places. 0.0037 Let u(f) = -122f + 24. Let t be u(3). Let k = -1185 - t. What is k rounded to the nearest one hundred? -800 Let n = 0.04 - 3.6. Let p = n + 3.978. Round p to two decimal places. 0.42 Let a = -472185 + 474263.752. Let x = -1996.2 + a. Let d = x + -83. Round d to 2 dps. -0.45 Let v = 208513177 + -116823177. What is v rounded to the nearest 1000000? 92000000 Let n(x) = -330263x - 185. Let b be n(5). What is b rounded to the nearest ten thousand? -1650000 Let z = -107.6 + 307. Let o = 214 - z. Round o to zero decimal places. 15 Let z = 0.0436 - 0.136. Let l = z + 0.094535. What is l rounded to 4 decimal places? 0.0021 Let j = -1.04 + -0.4. Let g = -1.439861 - j. Round g to 5 decimal places. 0.00014 Let m = -176.863615032 + -0.136375868. Let g = 177 + m. Round g to six dps. 0.000009 Let p = -869.1988553 + -37.8020307. Let c = p + 907. Round c to four decimal places. -0.0009 Let h(b) = 38b*2 - 66b + 500. Let x be h(37). Round x to the nearest 1000. 50000 Let r = -0.163 - 68.837. Let z = 68.9998064 + r. What is z rounded to 6 dps? -0.000194 Let l = 450552 - 127877. Let d = 213675 - l. Round d to the nearest 100000. -100000 Let x = -11004.162 + 11063. Let s = -1308 - -1249. Let f = s + x. Round f to 1 decimal place. -0.2 Let a = -18948.337 - -18940.7870533. Let h = 7.55 + a. Round h to 6 decimal places. 0.000053 Suppose 2z - 14 = -2v, 5v - 13 = -4z + 17. Suppose 0 = -vb + j + 997, b - 16j + 11j = 485. Round b to the nearest one hundred. 500 Let c = 50.004 + -50. Let h = c + 0.005. Let d = 0.0089938 - h. Round d to six dps. -0.000006 Let c = 137505464563903191.16 - 137505526454540392.15999697. Let y = c - -61890637916. Let b = y - 715. Round b to seven dps. 0.000003 Let u = -110.9141 + 109.31. What is u rounded to 2 dps? -1.6 Let n = 4.819 - 196.879. What is n rounded to zero decimal places? -192 Suppose r - 32 = -7r. Let h be 11/(-22) + (-374909)/r22. What is h rounded to the nearest 100000? -2100000 Suppose 42a + 9886041 + 245559 = 30a. What is a rounded to the nearest 100000? -800000 Let n = 1797.159803006 - 1797.16. Round n to 6 dps. -0.000197 Let l = -14.683 - 62.415. Let n = -77 - l. Let k = n - 0.728. What is k rounded to one decimal place? -0.6 Suppose 0 = 2n + 3q - 16, 5n - 6q = -8q + 29. Let i = 154142 - 842. Suppose 12d - nd = -i. What is d rounded to the nearest 1000? -22000 Let i be (-55169519928)/(-30)26/208 - (-3)/10. What is i rounded to the nearest one million? 230000000 Let x = 164.6 - 67.3. Let k = x + -85. Let s = k + -13.64. Round s to 1 decimal place. -1.3 Let j = 92 - 182. Let o = j + 90.03. Let u = 0.030007 - o. Round u to 6 decimal places. 0.000007 Let h = -205901666 - -205901670.07999783. Let v = 1.762 - -2.318. Let t = v - h. Round t to seven decimal places. 0.0000022 Let n = -0.1744 + -1428.3256. What is n rounded to the nearest 100? -1400 Let o = 19.712 - 2.682. What is o rounded to 0 decimal places? 17 Let i = -63364 + 65569.57. Round i to the nearest one hundred. 2200 Let j = 97320.947999 + -97321. Round j to three dps. -0.052 Let h be 2 - -9 - (-65978 + 19). Round h to the nearest 1000. 66000 Let j = 265292 - 265029.922. Let g = -262 + j. Round g to two decimal places. 0.08 Let q = 47994640930650479 - 47994641216487767.28999817. Let r = q - -285837286. Let a = r + 2.29. What is a rounded to seven decimal places? 0.0000018 Let t = 187463301.24380840553 - 187463293.0502. Let p = t - 0.01360789653. Let m = p - 8.18. What is m rounded to seven decimal places? 0.0000005 Let g = -2052.994591 - -2053. What is g rounded to 3 decimal places? 0.005 Let o = 2172552897 + -2172552863.49999937. Let s = o + -33.5. Round s to seven decimal places. 0.0000006 Let n = 6918.5 + -6821.133. Let z = n + -97. Let g = -0.367347 + z. Round g to 5 dps. -0.00035 Let n = 2.3863 + -3.6544. What is n rounded to 2 decimal places? -1.27 Let r(m) = -501m*2 + 214m - 44. Let d be r(12). What is d rounded to the nearest 10000? -70000 Let m = 11.457449587 + -10.74444927. Let z = m - 0.713. What is z rounded to 7 dps? 0.0000003 Let w = -12934 - -12760.69. Round w to the nearest 10. -170 Let t(f) = 4f3 - 112f*2 - 93f + 198. Let b be t(44). Round b to the nearest one thousand. 120000 Let r = -32833 + 92123. Round r to the nearest 10000. 60000 Let m = 29.2553 - 29.24. Round m to 1 decimal place. 0 Let p = -1461.1 + 1461.099976184. Round p to six decimal places. -0.000024 Let w be 0(-1 - (-6)/9). Suppose w = 4m - 2h + 7584, -2m + 11h - 3800 = 8h. Let b = 1304 + m. Round b to the nearest one hundred. -600 Let g = 427.9 + -447. Let w = 18.859 + g. Let r = -10.459 + w. Round r to the nearest integer. -11 Let k = 1368.6 + -1368.31956. What is k rounded to 2 dps? 0.28 Let h = -5.48 - 1.52. Let s = -7.00000008 - h. What is s rounded to six dps? 0 Let l(j) = 5j2 - 2j + 4. Let v be l(2). Suppose -4q - v = -9q. Suppose 1902 = -qr + 72702. Round r to the nearest one thousand. 18000 Let h = -2411020 - -2410919.0011. Let k = 101 + h. Round k to 2 decimal places. 0 Let d(r) = 11r + 8. Let a be d(-4). Let o(v) = -v*3 + 8v*2 - 4v + 2. Let k be o(9). Let p = k + a. What is p rounded to the nearest ten? -150 Let i = -18073.69035 - -18074. Round i to one dp. 0.3 Let k = 5375 - 5376.5382. What is k rounded to one decimal place? -1.5 Let a = -160800432637.000000061 - -160800432839. Let k = a + -202. What is k rounded to 7 dps? -0.0000001 Suppose b + 1221p - 1218p + 175398 = 0, -3b - 526180 = -5p. Round b to the nearest ten thousand. -180000 Suppose 3y + 4b - 64829 = 0, -86434 = -446y + 442y - 3b. What is y rounded to the nearest 100? 21600 Suppose -1269 = d + 5y, -62d = -59d + 2y + 3742. Let i(g) = g3 + g2 + 1774. Let l be i(0). Let o = d + l. Round o to the nearest 1000. 1000 Let n = -2.363839 - -2.362. What is n rounded to 3 dps? -0.002 Let t(w) = w2 - 25w - 21. Let c be t(26). Suppose cr - 55245344 - 74254656 = 0. What is r rounded to the nearest 1000000? 26000000 Let o = -68.027 + 0.027. Let y = o - -8. Let f = -59.859 - y. Round f to two decimal places. 0.14 Let j = -126 + 125.15. Let q = j - 0.57. Round q to 1 dp. -1.4 Let w(d) = -203d*2 - 473d*2 - 56 + 79d*2 - 385d*2 + 2d. Suppose 59j = 42j - 476. Let y be w(j). Round y to the nearest 100000. -800000 Let r = -32.52659643677 + 32.5266. What is r rounded to seven decimal places? 0.0000036 Let h = -430 - -435. Suppose -hv + 295633837 + 109866163 = 0. What is v rounded to the nearest 1000000? 81000000 Let t = -0.2511 + -4.6639. What is t rounded to the nearest integer? -5 Let c = -2174.000000309 - -2174. Round c to seven dps. -0.0000003 Let w = 2.595 - 2.11. Let u = w - 0.485722. What is u rounded to 4 dps? -0.0007 Let p = -177.4 + 142. Let s = 35.4708 + p. Round s to 3 dps. 0.071 Suppose -3z = -3s - 886482, 3s - 32z + 30z + 886478 = 0. Round s to the nearest one hundred thousand. -300000 Let k =	{ "pile_set_name": "DM Mathematics" }
rt(102) - 2sqrt(102)2)/(sqrt(6) - (sqrt(24)/sqrt(2) - sqrt(12))/sqrt(2)))3)2. -1512sqrt(17) + 269928 Simplify -1 + 2 + (5 + sqrt(128) + sqrt(2) + sqrt(2))2 + (-1 + (sqrt(132)/sqrt(6))/sqrt(11))2. 98sqrt(2) + 229 Simplify (sqrt(1100)1 - (4sqrt(11) + 3))2 + 1 + (sqrt(275) + 1)2 + -3. -26sqrt(11) + 679 Simplify (3 + sqrt(20)/(sqrt(10) + sqrt(70)/(sqrt(7) + sqrt(14)/sqrt(2))) + 1 + -1 + sqrt(20)/(sqrt(1250)/sqrt(5)))*2-1. -2363/225 - 26sqrt(2)/5 Simplify (2sqrt(108))/(sqrt(9) - sqrt(36)/sqrt(16)) + -4 + -5 + 3. -6 + 8sqrt(3) Simplify ((sqrt(190) + 2sqrt(190) - sqrt(190))555)/(-1(-4sqrt(40) - sqrt(10) - -5(sqrt(10) + sqrt(20)/sqrt(2)))). -250sqrt(19) Simplify -3(-5 + (-4 + 3 + -1 + sqrt(7) - (sqrt(5103)/sqrt(9) + -5))). 6 + 24sqrt(7) Simplify 6-2(3 + -5(1 + sqrt(1008))*2 + -6(sqrt(1008) + 4)). 2304sqrt(7) + 60792 Simplify (((3(sqrt(76) - 3sqrt(76)) - sqrt(76))-4 + -1)*2 - ((-1 + sqrt(76))4 + (0 + (sqrt(76) - (sqrt(76) - (sqrt(76)2 - sqrt(76)))))2)5)-3. -177675 + 456sqrt(19) Simplify (-5(sqrt(605)/(-1sqrt(11)) + (-1-1sqrt(55) - sqrt(55))))/((sqrt(220)/(sqrt(5)2))/(sqrt(4) + (4sqrt(36) - sqrt(4)))). 120sqrt(5) Simplify (0 + (-2 + (sqrt(363) - 2sqrt(363)-2 - 4sqrt(363)2))-2 + 3)*2. 924sqrt(3) + 13117 Simplify (sqrt(1000)-5-42)/(sqrt(64)/(4sqrt(8)) + sqrt(8) + (sqrt(72) - -4sqrt(72))/sqrt(9)). 32sqrt(5) Simplify ((-2sqrt(70)-2)/sqrt(2))/(sqrt(500)-5-1). 2sqrt(7)/25 Simplify ((sqrt(360) + -22sqrt(360))/sqrt(6)-4)/((1sqrt(108))/sqrt(9) + sqrt(12) - sqrt(12) - ((sqrt(12)3 + sqrt(12))-5 - sqrt(12))) + -5. -5 + 6sqrt(5)/11 Simplify ((sqrt(216) - 4sqrt(216)-2)/(sqrt(576)1))/(-3sqrt(200)-26)4. sqrt(3)/40 Simplify (-5 + sqrt(700) + 0 - sqrt(700))2 + -1 + sqrt(1372) - (-2 + 2 + sqrt(7) + sqrt(112)1)*2-3. 14sqrt(7) + 549 Simplify (sqrt(12) + -3 + (sqrt(3) + sqrt(6)/sqrt(2))-5 + -5 + (sqrt(300) - (sqrt(300) + 5)) + (sqrt(3) - sqrt(24)/sqrt(200)))*2. 936sqrt(3)/5 + 8113/25 Simplify -2 + (sqrt(256)/(-1sqrt(32)) - -4(-4 + sqrt(32) + -1))*2-2. -1586 + 1120sqrt(2) Simplify 3 + (-2 + sqrt(52))-5 + (sqrt(13) - 6sqrt(208))2 + (sqrt(52)2)/sqrt(4) + 4. -8sqrt(13) + 6894 Simplify (3 + sqrt(1216) + 1 + -4)2 - ((0 + sqrt(95)/sqrt(5))2-6 + 3). 1327 Simplify (3((sqrt(432)-2)*2 - sqrt(432)) + 4)4 - -2(1(sqrt(3) + -1) + -5)-5. -154sqrt(3) + 20812 Simplify (((-5 + sqrt(192) + 2 + 1 + sqrt(192) - -6(4 + (sqrt(192)3 + sqrt(192) - sqrt(192) - sqrt(192)))) + 4 + -3)3)2. 46368sqrt(3) + 343449 Simplify ((sqrt(77) - 5(-2sqrt(77) - sqrt(77))) + 2sqrt(77)1)/(sqrt(35)/((sqrt(60)/sqrt(4))/sqrt(3))). 18sqrt(11) Simplify -5(((5 + sqrt(19))*2 + 5)45 - (sqrt(152)/sqrt(4)1)/((sqrt(66)/sqrt(3) + sqrt(22) + sqrt(22))/sqrt(11))). -4900 - 2995sqrt(19)/3 Simplify -2((-1sqrt(425)2)*2 + ((sqrt(459) - sqrt(51) - sqrt(51))2)/sqrt(3) + -2). -3396 - 4sqrt(17) Simplify -1 + (sqrt(312)/(sqrt(80)/sqrt(640)))/(sqrt(2700)3). -1 + 4sqrt(13)/45 Simplify (-2-2sqrt(95)/sqrt(80))2 + (-5(2sqrt(133) + sqrt(133)) - sqrt(133))/(sqrt(21)/(sqrt(15)/sqrt(5))). -16sqrt(19) + 19 Simplify ((sqrt(110) - sqrt(110)13)/sqrt(11))/(sqrt(224)/(sqrt(21)/sqrt(3))). -sqrt(5)/2 Simplify (-3sqrt(2100)-2 + 5(sqrt(2100) + sqrt(2100) + sqrt(2100)-2 - sqrt(2100)))/(-2(sqrt(63) - sqrt(7))2-6). 5sqrt(3)/24 Simplify ((1sqrt(2673) + sqrt(2673))/(-1sqrt(1584)) + 4 + (-3 + sqrt(300) - (sqrt(12) + -2)))*2. 39sqrt(3) + 543/4 Simplify (-3sqrt(120)2 - (sqrt(120) - -2(sqrt(120) + sqrt(120) + sqrt(120)-1)))/(-6(6sqrt(40)/sqrt(4) - 1sqrt(1000))). -3sqrt(3)/4 Simplify -6(sqrt(396) - ((-2 + sqrt(396))1)*2) + 3sqrt(99) + sqrt(11)-1-3. -168sqrt(11) + 2400 Simplify (-1 + (sqrt(66)/(sqrt(294) + sqrt(294)-2 + sqrt(6)))*2 - (-4 + (sqrt(176) - sqrt(11)16))) + -3. 11/36 + 2sqrt(11) Simplify (-26(sqrt(1900) + -5 + 1sqrt(1900) + sqrt(1900))-1 + 3 + 4)*2. -38160sqrt(19) + 2465209 Simplify (5(sqrt(130) + sqrt(130)2-2 + sqrt(130) + (sqrt(130) - (1sqrt(130) + sqrt(130) - sqrt(130))-3))/(532sqrt(10))-1-6)*2. 52 Simplify (4(1 + ((sqrt(19) + 3)4 - 6-4sqrt(19)))-2)*2-5. -4820800 - 232960sqrt(19) Simplify (-3(-4 + (0 + (-1 + sqrt(272) - sqrt(272)) + sqrt(272) - -2sqrt(272)-2)) + 0)*2. 1080sqrt(17) + 22257 Simplify (2(4-2-4sqrt(119))/(5(sqrt(252) + sqrt(252)3)))*2. 1088/225 Simplify 3(5 + sqrt(171)1 + (sqrt(171)1 + -1)*2 - (5sqrt(209)-1)/((sqrt(66) + 2sqrt(66))/sqrt(6))). -4sqrt(19) + 531 Simplify (((sqrt(2940) - sqrt(60))2)/((-5sqrt(132))/sqrt(11)) + -1)25. 24sqrt(5) + 149 Simplify (2(1 + (2 + sqrt(1872) + -1 + (sqrt(52) + sqrt(13) + -4)1)5))*2. -8400sqrt(13) + 293284 Simplify -1(4 + (((sqrt(306)2 - sqrt(306)) + sqrt(306))/sqrt(6))/(sqrt(21)/(sqrt(42)/sqrt(6)) + sqrt(3)))-4-4. -16sqrt(17) - 64 Simplify (-1(0 + sqrt(720))-16 + 2 + (1(sqrt(720) - (sqrt(720) + -1)) - ((sqrt(720) - ((-1 + sqrt(720))-3 - sqrt(720))) + sqrt(720))) + -3)*2. 9 Simplify (1(-2 + 2(0 + sqrt(450)) + (-1 + sqrt(450) + -5 - sqrt(450)))-2)*2. -1920sqrt(2) + 7456 Simplify 1 + (-43sqrt(70)3)/((sqrt(10) - (-5sqrt(50)/sqrt(5) - sqrt(10))) + (sqrt(60)/(1sqrt(6) + sqrt(6)) - sqrt(10) - sqrt(10)) + sqrt(10)). -72sqrt(7)/13 + 1 Simplify (-6(-2 + sqrt(300))2)2 - ((-5 + (sqrt(48) - sqrt(3)) + sqrt(3))2 - (sqrt(27)/(sqrt(9)-4))2). -5720sqrt(3) + 699251/16 Simplify (-3((sqrt(7) - sqrt(28)) + sqrt(7)))2 + sqrt(49)/(-1sqrt(7)) + -4 - ((sqrt(343) - (-3 + sqrt(343)))-51)*2. -229 - sqrt(7) Simplify (3(-4sqrt(121)/(sqrt(11) - (sqrt(11)-2 + sqrt(11) + sqrt(11)))-3 + 2)6-6)2. 559872sqrt(11) + 18522432 Simplify 5(4sqrt(98)4-1 - (-2sqrt(200)1 - sqrt(200)-23)*2). -16000 - 560sqrt(2) Simplify ((5 + sqrt(17)-1)2 - sqrt(34)/(sqrt(8)/sqrt(4)))-2 - (1sqrt(2448) - (sqrt(17) + 4sqrt(272)))*2. -509 + 22sqrt(17) Simplify -3 + (2sqrt(4212)-2 + sqrt(4212))/(sqrt(16) + 4sqrt(256)). -3 - 27sqrt(13)/34 Simplify -2-6(sqrt(156)/(-1sqrt(432) - sqrt(432)) + (3sqrt(117)1)/sqrt(9))-6. -210sqrt(13) Simplify ((6(sqrt(8) + 5 + 4) + (sqrt(2880)-2 + sqrt(2880))/(-4sqrt(20)/sqrt(2) - sqrt(10)))-1)2. 7776sqrt(2)/5 + 83268/25 Simplify 43(-1(1 + sqrt(99) + -2 + 1))2 + -1. 1187 Simplify 6-6((-3(sqrt(68) + (sqrt(68) - 43sqrt(68)) + sqrt(68)))/(sqrt(484) + sqrt(484)-16 + sqrt(484)))*2. -111537/484 Simplify 2(((0 + sqrt(245))3 + sqrt(245))2 + 0 - (1 + sqrt(245) + -1 + 3)) + 5. -14sqrt(5) + 7839 Simplify 12((sqrt(209) - sqrt(209)-2 - sqrt(209))-3 - (sqrt(209) + sqrt(209)1-3))/(sqrt(539) - sqrt(539)1-3)-3. 6sqrt(19)/7 Simplify (6(-1 + sqrt(1216) + 3 - (-3 + 0 + sqrt(1216) - sqrt(1216))) - (1 + (sqrt(304) + -1 - sqrt(304)) + (sqrt(931) - (3 + 2sqrt(931)))))*2. 3630sqrt(19) + 58564 Simplify (-3((-1sqrt(96) - sqrt(96) - sqrt(96)) + sqrt(96) + sqrt(96))/(-6(sqrt(2) + sqrt(32))) + (sqrt(726)-3)/(sqrt(6)/sqrt(27)))*2. 741027/25 Simplify -3 + (5 + 4 + (4(sqrt(1008) + 3))*2 + -1)-1. -16283 - 1152sqrt(7) Simplify (-11(sqrt(76) - 2sqrt(76) - sqrt(76))-1)/(sqrt(36)/(-5(sqrt(9) - sqrt(36)))-3). 10sqrt(19)/3 Simplify (-3(-1sqrt(104)-6 + -3sqrt(104)-1))/(sqrt(72)-15 - (sqrt(72) + 6(sqrt(72) + 1sqrt(72)) - sqrt(72) - sqrt(72))). 9sqrt(13)/16 Simplify (sqrt(119)31 + sqrt(119)2-4)/(-5(sqrt(28)/sqrt(4)-4 - (sqrt(1008) - (2sqrt(1008) + sqrt(1008))))). sqrt(17)/20 Simplify (2 + sqrt(75) + -1 - sqrt(75) - (sqrt(75) + (-1sqrt(75)2 + sqrt(75) - sqrt(75) - sqrt(75))))2 + ((3sqrt(528))/((2sqrt(99))/sqrt(9)))2. 20sqrt(3) + 409 Simplify (-5-51sqrt(450))/((sqrt(189)/sqrt(7))/sqrt(3) - (sqrt(729) + sqrt(729)-3)). 125sqrt(2)/19 Simplify (6(-4 + -3-2((sqrt(468) - (-2 + sqrt(468))6 - sqrt(468)) + -2 + sqrt(468)1)))*2. -725760sqrt(13) + 15276096 Simplify (-2(sqrt(90) + sqrt(90)1) + sqrt(90))/(sqrt(162) + (sqrt(162) - -1sqrt(162) - sqrt(162) - sqrt(162)) - sqrt(2)) - (4 + -4((-1sqrt(605))2 + -4)). -9sqrt(5)/8 + 2400 Simplify ((sqrt(132)1)/sqrt(4) + (sqrt(4752) + (sqrt(4752)-2 - sqrt(4752) - sqrt(4752) - sqrt(4752)) - sqrt(4752)))/(-6-1sqrt(1100)1). -59sqrt(3)/60 Simplify (-4 + ((-2 + sqrt(108))-3 + 1 + -2(sqrt(108) + 1) + 1 + sqrt(108) + 5)*2)4. -2112*sqrt(3) + 7380 Si	{ "pile_set_name": "DM Mathematics" }
1 - 2))(-q - 4q + 4q) - 3q*2 + 2q*2 + 2q*2 to k + dq + bq2 and give b. -5 Express (170 - 170 + 141s + (-3s + 5s - 3s)(-4 - 1 - 4))(4 + 0 - 2) as rs + z and give r. 300 Express (18d2 - 85d*2 + 6d*2)(-1 + 2d2 + 1) + 49d*3 + 21d*4 - 49d*3 - 2d*2 in the form wd + gd4 + x + zd*3 + yd*2 and give y. -2 Express -2q*3 + 61q + q*4 + 4q*3 - 16942 + 106q + 16944 + 0q4 in the form zq*2 + y + pq + nq4 + uq3 and give n. 1 Rearrange -5879 + u2 - 2u + u2 + 5876 to the form mu + i + zu2 and give m. -2 Express (2 - 3 + 0)(52x + 136x - 176x - 292 - 447) in the form ox + a and give a. 739 Rearrange 1109c + 381c + 1799c to the form d + wc and give w. 3289 Express 182r2 + 16r*3 - 182r*2 + (5r - 3r2 - 5r)(8r + 10r + 2r) as gr3 + or + hr2 + b and give g. -44 Rearrange -l4 - 6l*4 - 2l*2 + 17l*4 - 204l*3 - 4l*4 - 11l*4 to the form vl + a + yl2 + xl*4 + zl*3 and give y. -2 Express -t + 357 + 127 - 107 + 750 as n + yt and give y. -1 Rearrange 50268f2 - 1 + 4f*3 - 50280f*2 - 6f + 16f to zf*2 + uf + lf3 + q and give l. 4 Rearrange -30c - 1839 - 1853 + 9c2 + 3690 to the form fc + t + qc2 and give t. -2 Rearrange (-5f - 63 + 4f + 2f)(3f - 4f - 3f) to the form bf + xf*2 + w and give b. 252 Rearrange 1717o - 104o + 470o - 836o + 646o to the form y + lo and give l. 1893 Rearrange -q - 68 - 388 - 234q*2 + 504 to xq + jq2 + g and give g. 48 Express (5 - 1 - 2)(-4 - 2 + 8)(-152s*4 - 29s*4 + 26s4) + s4 - 2s4 - 2s*4 as ys*2 + hs*4 + ps + t + is3 and give h. -623 Rearrange 47d*2 - 174d*2 + 49d*2 + 48d*2 + 1126 + 35d*2 to the form fd + y + zd2 and give z. 5 Express -127 + 29i + 294 - 102 - 104 in the form ai + q and give q. -39 Rearrange i + 41i*4 - 29i*2 + 62826 - 62824 - 40i*4 to the form pi*3 + vi*4 + hi + yi2 + o and give h. 1 Express (0r*2 - 2r*2 - 3r*2)(-5r + 2r + r)(-62r + 6r - 495 + 53r) in the form jr3 + sr + ir2 + d + cr*4 and give j. -4950 Rearrange 3u - 2u - 3u + (-1 - 4 + 3)(-u - 2u + 6u) - 3u + 0u + 2u - 16u + 22u + 36u + (0u - u + 3u)(-14 - 2 - 17) to v + du and give d. -33 Rearrange 2 + 80s*2 - 460s*2 - 232s*2 to the form ms + is2 + p and give p. 2 Rearrange 177413 - 354824 + 177398 - 63a - 18a to o + za and give o. -13 Rearrange 14 - 7 + 1 - 11 + 8028g + 5 to k + bg and give b. 8028 Rearrange 5y - 2y3 - y2 + 26491 - 26478 + 0y2 to the form oy*2 + iy*3 + z + cy and give c. 5 Rearrange 8u4 + u4 - 230u*3 + 197u*3 + 18 - 22 to ou*2 + vu + lu3 + pu*4 + a and give l. -33 Rearrange -377l4 + l2 - 25l3 - 4l + 6l + 382l*4 to the form jl*2 + yl + xl3 + k + bl*4 and give x. -25 Express 594 - 3315 + i - 251 in the form ri + f and give f. -2972 Rearrange (-2692b - 5635b - 1217b + 983b)(1 - 1 + 5b) to the form db + g + kb*2 and give k. -42805 Express (28 - 28 - 29k)(-4k + k + 2k) + 135 + 261k2 - 135 - 3 + k2 + 3 in the form fk2 + m + sk and give f. 291 Rearrange -65y3 + 4 - 2 - 3 - 15376y - y*2 + 15377y to gy3 + w + ny + ry2 and give w. -1 Express 3 - 96p + 105p - 5 + 136p in the form tp + r and give r. -2 Express (-28 - 11 + 9)(2q3 - 4q*2 + 4q*2)(q - 4 + 4)(6 - 12 - 5) in the form mq*2 + b + wq*3 + tq*4 + fq and give t. 660 Express -28154m4 + 14062m4 - m3 - 43m2 + 2m + 14058m4 in the form om*4 + g + wm + lm2 + jm*3 and give g. 0 Rearrange -144h*4 + 8h*2 + 261h*4 - 2h*3 - 129h*4 + (0h - h - h)(-2h*3 + 0 + 0) to the form qh*3 + a + ch*2 + mh + fh4 and give f. -8 Express (4m - 2m - m)(-223m + 469m + 10m2 - 12 - 245m) in the form jm2 + vm*3 + ym + r and give j. 1 Express ((-1 + 7 - 3)(-5 + 4 + 6) + 0 + 2 - 1)(-3i2 + 9 - 9) + 15i - 2i2 - 7i - 10i in the form ki*2 + ji + f and give j. -2 Rearrange -28f3 - f2 + 30f*3 + 5f*2 - 5f - 1 + 2f2 + 5f*2 to the form x + rf*3 + bf*2 + af and give b. 11 Express (n*2 + 2n*2 + 0n*2)(94452 - 3077n - 94452) in the form rn*3 + an + u + yn2 and give r. -9231 Express 81y + 1261y + 1803y - 7y in the form dy + a and give d. 3138 Express 16s + 754 + 550 - 15s + 3139 in the form x + ls and give l. 1 Express -2 - 2601v*4 + 3v*2 - 32v*4 - 4520v*4 - 2v - 3v2 as wv + bv2 + dv*3 + z + tv*4 and give t. -7153 Express -6914p + 13p2 - 6p*2 + 7062p as rp2 + mp + z and give r. 7 Express (-5 + 5 + u)(-2u + 2u + 2u) - 5u2 - 2321 + 4451 - 2u - 2320 + (4u + 0u - 2u)(-1 + u + 1) in the form hu + l + zu*2 and give l. -190 Express 1003i*2 + 100i - 195i - 1 + 96i as ni2 + y + bi and give y. -1 Express (-2 - p*2 + 2)(-2p - 5p + 5p) + (0p + 5p - p)(206p2 + 133p*2 - 116p*2) in the form a + wp*3 + vp*2 + np and give w. 894 Rearrange 24w2 - 19w*2 + 16w*2 + 92w2 - w2 - 345w2 + (3 - 3 - 2w)(-4w + 5w + w) to the form tw + zw2 + f and give z. -237 Express (j - 1 + 1)(5j2 - 2j*2 - 2j*2)(4549j + 3 + 4547j + 4318j + 277j) in the form vj + mj*3 + fj*4 + l + pj*2 and give f. 13691 Rearrange 42324k*2 - 42323k*2 + 2k3 + k3 + 58k to jk*3 + r + sk*2 + hk and give j. 3 Rearrange -10983 + 9938y + 5488 + 5495 to w + oy and give w. 0 Express (-24 + 66 + 90)(i + 1 - 1)(-67i - 56i + i)(5i - 5i + 2i) as ri2 + ui + a + wi3 and give w. -32208 Rearrange 330t*2 - 186t*2 + 2t - 269t2 + 3t*3 - 4t - t*3 to the form j + mt*3 + lt*2 + rt and give m. 2 Express -26d - 119d*2 + 1 - 1 - 65d*2 + 144d*2 in the form pd + ud2 + n and give p. -26 Express (-2f - f + 0f)(-1325f - 701f + 392f) in the form b + gf + uf2 and give u. 4902 Rearrange -5582486u + 5582484u - 24 - u2 + 2u*2 - 9u*2 to hu + v + ku2 and give k. -8 Express 964u*3 + 968u*3 + 24 - 1855u*3 in the form yu*3 + m + zu*2 + lu and give l. 0 Rearrange (-602 - 798 + 1998)(z - 3 + z - z) to u + qz and give u. -1794 Rearrange (-4 + 4 - 9)(7t + 0 + 0)(27t + 25t - 15t) to u + wt2 + it and give w. -2331 Express 79613b + 4445b*2 - 79613b + 2 in the form nb2 + i + zb and give z. 0 Rearrange -3w - 8 + 0w - w3 - w2 + 1 - 3 + 7w2 to the form uw + iw2 + m + yw*3 and give u. -3 Express -3 + 36z - 258z2 + 185z*2 + 5 - 3 + 148z*2 as iz*2 + t + qz and give i. 75 Express 379y3 + 248y - 478y + 64y*3 + 12y*4 + 231y as p + ly4 + zy*3 + sy*2 + cy and give l. 12 Express 2 + 8b3 + 540b + 546b - 2b4 + b4 - 1083b + 10b*2 - 20b*3 as wb + sb2 + i + xb*3 + jb*4 and give j. -1 Rearrange (-48q - 29q3 + 48q)(-82 + 48 - 16) to the form r + yq*3 + uq*2 + iq and give y. 1450 Rearrange -71w + 20w + 22w + 27w - 900w2 to the form pw + q + gw2 and give p. -2 Express (2 - 2 + 2f)(f2 - 4f2 + f2) - 1086f2 + 161 + 1090f*2 - 39f - 160 + 3f3 as zf*3 + lf*2 + h + mf and give z. -1 Express 0v2 - 4v*2 + 5v*2 + (2v*2 + 0 + 0)(0 - 1 - 2) + 4663v2 - 8340v*2 + 7579v*2 in the form xv + w + mv2 and give m. 3897 Express -18771k*3 + 0k + 30k2 + 18762k*3 + 4k - 24k2 in the form bk*3 + uk + n + pk2 and give b. -9 Express -2m*4 + 187m*2 - 13m + 17 + 12m - 1 - 188m*2 as sm*2 + rm + tm3 + q + om*4 and give s. -1 Express -3y*2 + 176225y - y*3 - 176370y + 6y2 in the form py*2 + vy + x + oy3 and give v. -145 Rearrange -4692l - 66 + 72 - 6 + 556l to x + jl and give j. -4136 Express (-2p + 6p - 2p)(230p2 + 160p*2 - 580p*2) in the form xp*3 + zp + q + fp2 and give x. -380 Rearrange (0l - 3l - 14l)(-870l + 870l + 165l*2) to the form p + rl*2 + yl + il3 and give i. -2805 Express 12j*2 + 868j*3 + 21j*2 - 28j*2 - 67j*3 in the form bj*2 + vj*3 + mj + a and give b. 5 Rearrange (0 - 5 + 4 + i)(6539i - 2111i - 1427i - 1 - 1968i) to the form zi*2 + s + ni and give n. -1034 Express -5418z - 4z*2 + 5418z + (-2z + 0z + z)(1439 - 1439 + 48z) in the form yz + s + qz**2 an	{ "pile_set_name": "DM Mathematics" }
q) be the first derivative of q*2/2 - 1. Let p = 8112 + -8102. Calculate x(p). 10 Let g(p) = 3025 + 51p - 2984 - 99p + 61p. Give g(-6). -37 Suppose 4s = s. Suppose -3 = -q - sq. Let i(h) = -11h + qh - 4h2 + 3h*2 + 4h. What is i(-2)? 4 Let a(w) = 662w + 1998. Let y be a(-3). Let h(b) = -b2 + 8b + 36. Determine h(y). -12 Let d = 9903 - 9900. Let v(i) = i*2 - 80i + 237. Calculate v(d). 6 Let r = 170 - 513. Let l = r - -348. Let p(q) = q*3 - 6q*2 + 3q + 7. Determine p(l). -3 Let v(y) = -17y2 + y3 - 216 - 215 + 24y + 518. What is v(15)? -3 Let l(g) = g*3 + 26g*2 + 3g + 82. Suppose -5c - o + 46 = 183, -3c = 4o + 106. What is l(c)? 4 Let q(r) = 7r*3 - 13r*2 - 3r + 39. Let d(h) = 2h3 - 5h*2 - 2h + 13. Let u(m) = -10d(m) + 3q(m). Calculate u(-10). -23 Let l(m) = 38m3 + m2 + 2m + 2. Suppose 0 = z + 1, 16z - 12z = -2w - 6. Determine l(w). -37 Let x(j) = -8j*3 - 57j*2 + 58j + 17. Let w(b) = -11b3 - 85b*2 + 91b + 25. Let z(k) = 5w(k) - 7x(k). Determine z(24). 30 Let h(s) be the first derivative of -s3/3 - s2/2 + 7s + 2. Suppose -5 = 156d + 14 - 19. What is h(d)? 7 Let z be 110/7 - (-3060)/2380. Let l(g) = 2g - 42. What is l(z)? -8 Suppose -24m = -172 + 155 + 209. Let p(i) = i*2 + 6i + 13. What is p(m)? 29 Let k(b) = -2b2 - b + 2. Suppose -5y + 65 = 4j, -21j + 3y = -19j - 27. Suppose 0 = -v - 3i - 8, -v + 3v = -2i. Let s be (v - 70/j)3. Give k(s). -4 Let s(x) be the second derivative of x*4/12 + 13x*3/3 + 79x*2/2 + 57x + 17. Give s(-21). -26 Suppose 80 = 249v - 169. Let p(i) = 61i + 1. Give p(v). 62 Let x be (-2 + 28/7)/((-2)/(-12)). Let h(m) = -2 - 5m3 + 0m3 - m2 + xm3 - 4m3. What is h(2)? 18 Let d(r) = r3 - 3r2 - 4r - 7. Suppose 41a - 135 = 26a. Let m(b) = 4b3 - 11b*2 - 15b - 28. Let n(s) = ad(s) - 2m(s). Calculate n(6). -7 Suppose 32 = -4j - n, 3n + 48 = -4j - 2n. Let a(p) = p*3 - 7p*2 + 4. Let r be a(7). Let m(u) = -ru + 2u - u - 8. What is m(j)? 13 Let w(u) = -u2 + 3u + 16. Let t(j) = -j*2 - j + 6. Let y(h) = 2t(h) - w(h). Let g = -5 + 8. Suppose g + 12 = -3d. Calculate y(d). -4 Suppose 76i = 78i + 16. Let v(d) be the first derivative of d4/4 + 8d3/3 + d2 - 10d - 16. Calculate v(i). -26 Let t(c) = c3 + 14c*2 - 8c - 4. Let w(x) = -12x - 35 + 52x + 54 - 72x2 - 6x*3. Let h(o) = 11t(o) + 2w(o). Give h(9). 3 Suppose 3n - 168 = -9n. Let s(i) = i3 - 13i*2 - 13i + 10. Let u be s(n). Let o(y) = -20 - 19 - y2 + y + 65 - u. Determine o(3). -4 Let g(a) = -a3 + 10a2 - 14a - 11. Let p be g(7). Let w(s) = -5 - 2s + 3 + s2 + ps*3 - 39s3 + s2. Calculate w(-2). 18 Let o be ((-138)/(-276))/(2/(-140)). Let a(y) = -y*2 - 37y - 58. Determine a(o). 12 Let a(h) = -h*2 + 6h + 6. Let u be -52/15 + 202/(-3). Let y = -53 - u. Let r = 21 - y. Give a(r). 6 Let s(q) be the third derivative of -1/24q*4 - 4/3q*3 - 65q*2 + 0q + 0. Calculate s(-5). -3 Let q(y) = 3y + 56. Suppose -4a + 20 = 0, -14b + a + 50 = -19b. Determine q(b). 23 Let o(k) = 16k3 + 66k*2 + 11k + 76. Let m(h) = -3h3 - 11h*2 - 2h - 15. Let f(x) = -11m(x) - 2o(x). What is f(10)? -87 Let s(z) be the third derivative of -z7/840 - z6/60 + z*5/15 - 63z*3/2 - 2z*2 + 3. Let q(i) be the first derivative of s(i). Determine q(-6). -48 Let k(g) = 3g - g*2 + 0g*2 + 2g + 5g. Suppose -6y - 3r = -2y - 4, -5y - 5r = 0. Suppose -2s - 2s + 30 = -2x, yx + 33 = 5s. Give k(s). 9 Suppose -5i - 3426 + 3441 = 0. Let f(y) be the first derivative of 35 + 3/4y4 - y - y2 - 1/3yi. What is f(-1)? -3 Let s(l) be the second derivative of l5/60 + l4/8 + l3 - 17l2 - 235l. Let m(u) be the first derivative of s(u). Give m(-5). 16 Let c(y) be the first derivative of y*4/12 + 7y*3/6 - 366y + 337. Let n(d) be the first derivative of c(d). Suppose -2x - 21 = x. Determine n(x). 0 Let f be (-25)/6 - -4 - (-2044)/24. Suppose -55 = 6c - f. Let k(m) = m - 11. Let b(h) = h - 12. Let v(y) = -5b(y) + 6k(y). Give v(c). -1 Let n(i) = 97i - 314i + 37 + 108i + 104i. Give n(15). -38 Let d(v) = 1 + 1 - 138v + 212v - 110v. Let h(z) = 13z - 1. Let m(x) = 4d(x) + 11h(x). Calculate m(3). -6 Let b(n) = -n*3 - 18n*2 - 67n - 23. Let z be b(-13). Let j(y) = 5y2 - y - 2. Give j(z). 40 Let d(b) = 2b - 10. Let z(u) = 4u - 21. Let y(w) = -18w - 5. Let a be 32/(-24) + (0 + 2)/6. Let m be y(a). Let l(s) = md(s) - 6z(s). Give l(-5). -14 Let c = -394 - -402. Let x(b) = cb + 7b - 5 + 4b - 16b. Calculate x(-6). -23 Let x(m) be the second derivative of m*5/20 - 3m*4/4 - 5m*3/2 - 2m*2 + 75m - 15. Calculate x(-2). -18 Suppose 4u = 4g + 48 + 20, 3u - 5g = 49. Let j(h) = -11 + h - h*2 - 6 + u - 13. Let i(t) = 3t*3 - 4t*2 - 6t + 4. Let k be i(2). What is j(k)? -12 Let f be 0(5/(-35) - 18/21). Let u(q) = -q2 - 4 + 4 - 3q + 5 + fq. Determine u(-6). -13 Let t(q) be the third derivative of q4/3 - 125q*3/6 + 49q2. Let b be t(15). Let g(d) = -d3 - 5d2 - 8. Calculate g(b). -8 Let d(p) = 3p + 21. Suppose 0 = 5n + 5b + 20, -n + 2n - 2 = b. Determine d(n). 18 Let o(f) = f2 - 10f - 41. Let j be (6/(-9))/((-111)/2331). What is o(j)? 15 Suppose -4i = 4, 0a + 3i - 32 = 5a. Let r(g) be the third derivative of g*4/24 + 5g3/6 + g2 - 23g. Determine r(a). -2 Let s(i) = -i3 - i2 + 5. Let x be s(0). Let w = 985 - 981. Let l(y) = -2y - 3y + 1 - xy*2 + wy2. Calculate l(-5). 1 Let j(n) be the second derivative of -n4/6 + 4n3/3 - 2n*2 - 6n - 156. Suppose m + 32 = 5m. Let r = m - 3. Determine j(r). -14 Let b(w) = -w3 + 3w*2 + 6w - 19. Suppose 1205 + 1423 = 438z. What is b(z)? -91 Suppose -2891 = -17w + 1308. Let f = -243 + w. Let c(j) = -7j - 7. Let l(x) = -4x - 4. Let o(a) = 3c(a) - 5l(a). Determine o(f). -5 Let o(q) = 3q - 17. Let d(n) = -4n + 25. Let r(z) = -5d(z) - 7o(z). Let s(l) = -l - 3. Let t(k) = -6r(k) + 11s(k). Let f = -327 + 329. What is t(f)? -7 Let q = 84 - 21. Let o = q + -54. Let t(k) = -4k + 39. Let n be t(o). Let z(f) = f3 - 2f*2 - f - 4. What is z(n)? 2 Let h(a) = 2a - 7a2 - a3 + 5 + 4a*2 - 2. Let g be 5/((-280)/(-248)) - 6/14. Suppose -3k = -2u, 0 = gk - 0k - 3u - 1. Determine h(k). -5 Suppose -4r - 4u + u = -5, 4r + 5u = 3. Suppose -r = 9k - 20. Let p(b) = 3 + k + 4 + b. Give p(-4). 5 Let q(y) = 5y*3 + 10y*2 + 4. Let o(b) = -4b*3 - 10b*2 - 3. Let n be (2 + (-4)/3)/((-1)/(-9)). Let w(d) = no(d) + 5q(d). Calculate w(10). 2 Let l = 8354 - 8350. Let k(n) = -4n - 1 + 4n - n + 6. Determine k(l). 1 Let f(u) = u3 - 10u*2 - 10u - 3. Suppose -2r = -4g + 60, -r - 3 = -7. Suppose 8o = -g + 105. Calculate f(o). 8 Let u(z) = z3 + 7z*2 + 9z - 7. Let l(g) be the third derivative of -g*5/60 + 11g*4/12 - 39g*3/2 + 115g2. Let c be l(14). Give u(c). -2 Let q(c) be the third derivative of -c4/8 - 2c3/3 - 59c*2. Let m be q(-1). Let v(n) = 33n*2 - 1. Give v(m). 32 Let v(b) = -47b + 89. Let a(m) = 122m - 267. Let s(h) = 3a(h) + 8v(h). Calculate s(-8). -9 Let l be (8 - 244/(-16)) + (-3)/(-4). Let t(n) = -26n*3 - ln*3 - 3 + 77n*3 - 29n*3 + 6n. Calculate t(2). -7 Let q(y) = -y*3 - 9y*2 - 15y + 12. Let b be 18/(-21) - 3168/616. Calculate q(b). -6 Let f(s) = s - 4. Suppose -4 = -t - 1. Let k = -426 + 442. Suppose tb + 7 = k. Calculate f(b). -1 Let v = -9 + 4. Let z(p) = -5p - 17. Let a(s) = -2s - 1. Let d(o) = -a(o) + z(o). Let n be d(v). Let w(y) = -10y*2 + y. Give w(n). -11 Suppose -75f - 328 - 162 = 35. Let h(a) = -a*3 - 6a*2 + 7a - 4. What is h(f)? -4 Let u(b) = b*3 - 4b*2 - 11b + 14. Let d be u(6). Let o be (-12)/16 - (-15)/d. Let r(l) = 6 + 4l - 14 + 8 - 3l. Determine r(o). 0 Let y(o) be the second derivative of -13o3/6 - 20o*2 + 2o - 542. Determine y(-3). -1 Suppose -111 - 243 + 74 = -20d. Let o(v) = 2v - 31. Calculate o(d). -3 Suppose -2x + 3g + 158 = 0, 4x + 3g = -0x + 298. Let w(j) = x - 31 - 19 - 25 + j. Give w(3). 4 Let h(i) = -3i*2 + i. Let k(x) = 53x - 3. Let z be k(3). Let l = -154 + z. What is h(l)? -10 Let s(x) = x*2 - 42x - 53x - 24 - 45x + 127x. Give s(11). -46 Let s(h) = h2 - 6h - 5. Let z be s(9).	{ "pile_set_name": "DM Mathematics" }
-16, 0, 1, 5 Put 36, -190, 0.4, -1 in ascending order. -190, -1, 0.4, 36 Sort -3, -2, -15, 154, -10. -15, -10, -3, -2, 154 Put 2/7, 39.9, 10/113, -1 in descending order. 39.9, 2/7, 10/113, -1 Sort 25, -0.5, -42, 0.5 in descending order. 25, 0.5, -0.5, -42 Put -9, 0, 5, 4, -4, 34 in decreasing order. 34, 5, 4, 0, -4, -9 Sort 22, -2/3, -167. -167, -2/3, 22 Put -4, 3, 20 in ascending order. -4, 3, 20 Sort 1/3, 2/65, 3, -3. -3, 2/65, 1/3, 3 Sort 2/1411, 1.17, 1. 2/1411, 1, 1.17 Sort 1/2, 15, 0, -432/13 in descending order. 15, 1/2, 0, -432/13 Put -338, -5, 16 in increasing order. -338, -5, 16 Put 0, -2, 5, -5243, 2 in decreasing order. 5, 2, 0, -2, -5243 Put -1/4, 5, -32, 1/3, 170, -1/11 in descending order. 170, 5, 1/3, -1/11, -1/4, -32 Sort 1/2, 0.4, -0.2, 1.84 in decreasing order. 1.84, 1/2, 0.4, -0.2 Sort -2/49, -3, 0, 39, -5/2, -5 in descending order. 39, 0, -2/49, -5/2, -3, -5 Sort 3/11, -24, -1, -2/9. -24, -1, -2/9, 3/11 Sort 25, 0, -1, 3, 5 in ascending order. -1, 0, 3, 5, 25 Put -7, -5, 74 in decreasing order. 74, -5, -7 Put 9825, -2, -1 in increasing order. -2, -1, 9825 Put -238, -2/5, -1693 in decreasing order. -2/5, -238, -1693 Sort -4, -0.11, 26, 0, -0.5, 0.7. -4, -0.5, -0.11, 0, 0.7, 26 Sort -2085, 1, -7. -2085, -7, 1 Put -3, 43, 5, -1269 in descending order. 43, 5, -3, -1269 Sort 1, -1726, 51, 2 in ascending order. -1726, 1, 2, 51 Put -0.22, 75, 9/5 in increasing order. -0.22, 9/5, 75 Sort -88, 7, -5, -73, -12 in increasing order. -88, -73, -12, -5, 7 Put 5, 3689, -5, -6 in descending order. 3689, 5, -5, -6 Put -2/77, 2/13, 216.1 in descending order. 216.1, 2/13, -2/77 Put 4, -68, 0.1 in descending order. 4, 0.1, -68 Put 3, 5.9, -506, 2/21 in increasing order. -506, 2/21, 3, 5.9 Sort -14, -2, 141, -4, 0 in decreasing order. 141, 0, -2, -4, -14 Sort -8.1, -4, 5, -1/4 in descending order. 5, -1/4, -4, -8.1 Put -4, -506, 25, 3, 5, -5 in descending order. 25, 5, 3, -4, -5, -506 Sort 681, -631, 1, 0 in ascending order. -631, 0, 1, 681 Sort 0.1, -31/2, -2/5, -4 in increasing order. -31/2, -4, -2/5, 0.1 Put 3, -1/2, 9, 0.0579, -1/12 in ascending order. -1/2, -1/12, 0.0579, 3, 9 Put -11, -4, 5/13, -2, 4 in ascending order. -11, -4, -2, 5/13, 4 Sort -0.15, -0.2, -1/25, 15 in increasing order. -0.2, -0.15, -1/25, 15 Put 3482, 3, 4, 1 in increasing order. 1, 3, 4, 3482 Put -0.08, -87.1, -8 in descending order. -0.08, -8, -87.1 Sort -6/41, -0.1, -7, -1, -3 in increasing order. -7, -3, -1, -6/41, -0.1 Put 6/7, 0, -4, -0.2, -2 in descending order. 6/7, 0, -0.2, -2, -4 Put -2, 60, -1, 8, 5 in increasing order. -2, -1, 5, 8, 60 Sort 1, -511, 0, -5 in increasing order. -511, -5, 0, 1 Put 5, -252, -145, 1 in decreasing order. 5, 1, -145, -252 Sort -0.05, -66/17, -6/11 in descending order. -0.05, -6/11, -66/17 Sort 2, 7, 2661. 2, 7, 2661 Sort 3, 2, -2, -63, 0, 2/7 in ascending order. -63, -2, 0, 2/7, 2, 3 Sort -26, 24, 4 in ascending order. -26, 4, 24 Put -0.4, 0, -4, 2/95, -2, 2/3 in decreasing order. 2/3, 2/95, 0, -0.4, -2, -4 Put -4, -1, 20, -3, -11 in increasing order. -11, -4, -3, -1, 20 Sort 11, 4, -44418. -44418, 4, 11 Put -5, -482, 14 in descending order. 14, -5, -482 Sort -1226, -3, -160, 0 in decreasing order. 0, -3, -160, -1226 Sort 7, -4, -5, 0, 14, 2 in increasing order. -5, -4, 0, 2, 7, 14 Sort -0.2, -5, 0.0798 in increasing order. -5, -0.2, 0.0798 Put -1/44, 334, 0.5 in increasing order. -1/44, 0.5, 334 Sort -20, -4, -35, -5, 4 in increasing order. -35, -20, -5, -4, 4 Sort -12, 4, -3, 0.27 in increasing order. -12, -3, 0.27, 4 Sort 126, -5, -3, 11, 4, 5 in descending order. 126, 11, 5, 4, -3, -5 Put 3164, 4, 3 in descending order. 3164, 4, 3 Sort -1, -0.3, 4, 34, 1/9 in ascending order. -1, -0.3, 1/9, 4, 34 Sort -1/4, -3/4, -5, -17418 in decreasing order. -1/4, -3/4, -5, -17418 Sort -2/7, -22, 0.4, 30 in decreasing order. 30, 0.4, -2/7, -22 Sort 0.2, -473, -13/89. -473, -13/89, 0.2 Sort 1/6, 9, 1/7, -4, -1350. -1350, -4, 1/7, 1/6, 9 Put 27, -4, -2, 0 in decreasing order. 27, 0, -2, -4 Put -3, 4, 3, 784, 19 in increasing order. -3, 3, 4, 19, 784 Put -2/21, 4, -137, 0.3, 0.1 in increasing order. -137, -2/21, 0.1, 0.3, 4 Sort 2, 1, -1, 4, 16, 179 in decreasing order. 179, 16, 4, 2, 1, -1 Put -29875, -2, 4 in ascending order. -29875, -2, 4 Sort -104, -5, -55 in ascending order. -104, -55, -5 Sort -3, -295, 4, 5, 0, 2 in increasing order. -295, -3, 0, 2, 4, 5 Put -0.04, -16/7, -3/7, -1/116 in descending order. -1/116, -0.04, -3/7, -16/7 Sort 16, 2/9, -1.8, -5/4, 0. -1.8, -5/4, 0, 2/9, 16 Sort 69, 3, 1/6, -2/199 in descending order. 69, 3, 1/6, -2/199 Put 2, 20807, -2 in descending order. 20807, 2, -2 Put -522, -2, -130 in descending order. -2, -130, -522 Sort -293.3, -10/21, 5. -293.3, -10/21, 5 Sort -4, 12, -2, -78, 4 in descending order. 12, 4, -2, -4, -78 Sort -4/7, 1, -54/7, -0.258 in descending order. 1, -0.258, -4/7, -54/7 Sort -123858, 5, 3. -123858, 3, 5 Put -5, -3, -3693, -2 in descending order. -2, -3, -5, -3693 Put 30, 3, -4, -1.2 in ascending order. -4, -1.2, 3, 30 Put -3, -0.9, -32.8 in ascending order. -32.8, -3, -0.9 Put -2, 2, 10, 4, 93 in ascending order. -2, 2, 4, 10, 93 Put 4, -399, -5/7, 1 in decreasing order. 4, 1, -5/7, -399 Sort 517, 1, -6, 4. -6, 1, 4, 517 Put -89, -3/25, -3, -0.2 in increasing order. -89, -3, -0.2, -3/25 Sort 6, 3.6, -16/7, 1/12, 0.1 in decreasing order. 6, 3.6, 0.1, 1/12, -16/7 Put 3, -7, 106, -0.1, 13 in ascending order. -7, -0.1, 3, 13, 106 Put -11, 3, 0, -1, -5, 15 in decreasing order. 15, 3, 0, -1, -5, -11 Put -0.1, -4, 191, -1/2 in ascending order. -4, -1/2, -0.1, 191 Put 2, -4, 47189 in descending order. 47189, 2, -4 Sort 290, -1, 4, 2, -3, -4 in ascending order. -4, -3, -1, 2, 4, 290 Put 5, 706, -4 in ascending order. -4, 5, 706 Sort 1, 4, 6/7, 3, -2.812 in descending order. 4, 3, 1, 6/7, -2.812 Sort -110, -4, 3, 36, 1 in ascending order. -110, -4, 1, 3, 36 Sort 2951, 19, 3 in decreasing order. 2951, 19, 3 Put 1, -1, 8.554, -0.5, 0.2 in decreasing order. 8.554, 1, 0.2, -0.5, -1 Put 59, 0, 5, -6, 11 in increasing order. -6, 0, 5, 11, 59 Sort -7, 0, 3, 2, 4. -7, 0, 2, 3, 4 Sort -3, -1.9, 2/11, 789. -3, -1.9, 2/11, 789 Sort 3, 5, -5, -4, -9, 200 in decreasing order. 200, 5, 3, -4, -5, -9 Sort -3240, -85, -3 in descending order. -3, -85, -3240 Sort -12, -101, -4 in decreasing order. -4, -12, -101 Sort -2, 1, -1/461, 4 in increasing order. -2, -1/461, 1, 4 Put -943952, -3, 5 in descending order. 5, -3, -943952 Sort -3, 2, 0, -1, 504 in ascending order. -3, -1, 0, 2, 504 Sort 295, 10, 2, -5. -5, 2, 10, 295 Put -228, -30, -4 in decreasing order. -4, -30, -228 Put -7, -2, -678, 1, -10 in ascending order. -678, -10, -7, -2, 1 Put -170, -4, -82 in increasing order. -170, -82, -4 Sort -4, 11, -3, -24, 0, 4. -24, -4, -3, 0, 4, 11 Put 2, -0.11, 0, 90, -2/3, 2/3 in decreasing order. 90, 2, 2/3, 0, -0.11, -2/3 Sort -4, -41, 100. -41, -4, 100 Put -9437, 2/5, -27 in ascending order. -9437, -27, 2/5 Sort 9, -365, -3, 3 in decreasing order. 9, 3, -3, -365 Put -2/11, 5, 0.1, -408, -168 in decreasing order. 5, 0.1, -2/11, -168, -408 Sort 2, -5001, 12 in decreasing order. 12, 2, -5001 Sort -2, 4, -4, 5, -9 in descending order. 5, 4, -2, -4, -9 Sort -0.2099, 4/7, -2, 2/3 in decreasing order. 2/3, 4/7, -0.2099, -2 Sort -1, -216, 0.3, 2/9, 5 in decreasing order. 5, 0.3, 2/9, -1, -216 Sort -64, 5741, -1 in descending order. 5741, -1, -64 Sort 3, -346, -915 in descending order. 3, -346, -915 Sort 5, 0, -4, -84. -84, -4, 0, 5 Sort -0.1, -10, 0.38, 0.03, -3. -10, -3, -0.1, 0.03, 0.38 Sort -4, -59, -2, 4, 3, 27 in decreasing order. 27, 4, 3, -2, -4, -59 Put -32, 29, 104 in increasing order. -32, 29, 104 Sort -1/3, -4/3, -2975/13 in descending order. -1/3, -4/3, -2975/13 Put -1/9, -5, -2, -9, -1/5, -75.4 in decreasing order. -1/9, -1/5, -2, -5, -9, -75.4 Sort -17, 4409, -3. -17, -3, 4409 Put 16, 650, -1, -2 in descending order. 650, 16, -1, -2 Put -1, -39, 26 in decreasing order. 26, -1, -39 Put 2, 1218425, 3 in decreasing order. 1218425, 3, 2 Sort -226, 99, -16 in decreasing order. 99, -16, -226 Put -4, 37/4, 14/23, 4/5, -0.3 in decreasing order. 37/4, 4/5, 14/23, -0.3, -4 Sort -0.3, -0.6, 4, 0.1, -1/5, 4/3. -0.6, -0.3, -1/5, 0.1, 4/3, 4 Sort 5, 4, 59, 655, 1, -3. -3, 1, 4, 5, 59, 655 Put -0.3, 151, -101 in increasi	{ "pile_set_name": "DM Mathematics" }
z = -6.3917252 + 6.3806. Let h = z - -0.02212684. Let x = h - 0.011. What is x rounded to seven dps? 0.0000016 Let f = 2219 - 2221.9384. Round f to 1 dp. -2.9 Let a = 0.624 - -528.376. Let f = 343 - a. Let z = f + 185.9917. Round z to 3 dps. -0.008 Let u = -74684 + 74626.453. What is u rounded to 0 decimal places? -58 Suppose -o = 36o + 53912700. Round o to the nearest 100000. -1500000 Let m = 9122 - 9122.5829. What is m rounded to one dp? -0.6 Let g = -0.029 + 212.029. Let q = -211.999724 + g. Round q to 4 dps. 0.0003 Suppose -192w = -184w. Suppose -3p + 3x + 2126994 = w, p + 0p = 4x + 708992. Round p to the nearest 10000. 710000 Let b(i) = -7i + 97. Let w be b(-26). Let p be 15/(-2)(-863040)/w. Round p to the nearest 10000. 20000 Let u(y) = 99696y + 596. Let r be u(-1). Round r to the nearest ten thousand. -100000 Let g = 195197 + 13703. Round g to the nearest one hundred thousand. 200000 Let g be 3(4 - (4 + -1)). Let a(r) = -2 - 3 + 252002r - g + 6. Let f be a(1). What is f rounded to the nearest 10000? 250000 Let l = -83.12334 + 44.123304. Let j = 86.4 + -47.4. Let q = l + j. What is q rounded to five decimal places? -0.00004 Let i = 660.811776 + -660.8. Round i to three decimal places. 0.012 Let j = -16.36289 - -202.364438. Let u = -186 + j. Round u to four dps. 0.0015 Let x = -174.307528 - 0.139972. Let h = x - 0.2525. Round h to the nearest ten. -170 Let i = -14847418424 + 14847419414.0000417. Let m = 442.7 - 1432.7. Let f = m + i. What is f rounded to 6 dps? 0.000042 Let p = -51 + 52. Let n be p/4 - (-10)/166. Suppose nq + 180010 = 5h, -5q - 225010 = -8h + 3h. What is q rounded to the nearest 10000? -50000 Suppose 0 = -3u - 2d - 13131588, 5u = -5d + 4d - 21885994. What is u rounded to the nearest 1000000? -4000000 Let r = -35.342956106 - -35.343. Round r to five decimal places. 0.00004 Let u = -0.0817 - 63.1183. Let x = u + 61.586. Round x to zero dps. -2 Let c be (-822)/(18 + 181456/(-10080)). What is c rounded to the nearest ten thousand? 520000 Let u be -82 - -88 - (-2 + 2 - -5). Let t be 150/u(-66749 - 51). What is t rounded to the nearest one million? -10000000 Let b = 20 + -143. Let c = 123.00087 + b. Round c to four decimal places. 0.0009 Let d(s) = -1531s - 66. Let t be d(19). Let b = -50655 - t. Round b to the nearest 10000. -20000 Let d = -48 - -43. Let r be -3 - d - (-9810050 - -1). Suppose 0 = 4i + 4c + 33599996, -i = 4c - 1410055 + r. Round i to the nearest 1000000. -8000000 Suppose 5r + 2203541 = 63r - 9100659. Round r to the nearest 10000. 190000 Let z = -1686 + 1691.955. Let l = 7 - 1. Let q = l - z. What is q rounded to two decimal places? 0.05 Let b = -833663.499464 - -833653. Let y = 46 - 56.5. Let x = b - y. Round x to 4 dps. 0.0005 Let z = 1222.382 - 11.582. Round z to the nearest one hundred. 1200 Let j = 0 - 78. Let k = -1655159957 - -1655159878.99999844. Let z = k - j. What is z rounded to seven dps? -0.0000016 Let d be -29728(46 + -60)(-1)/(-4) + -8. Round d to the nearest 1000. 104000 Let w = 0.04431 - 0.0443054031. Round w to 7 decimal places. 0.0000046 Let o be 17/(-102) - (-332)/(-24). Let y(b) = 10b3 + 20b*2 + 19b + 16. Let p be y(o). What is p rounded to the nearest one thousand? -24000 Let k = 15035 - 15048.619. What is k rounded to the nearest integer? -14 Let p = 1626282458758 + -1626282459041.0000006084. Let f = p + 283. What is f rounded to seven dps? -0.0000006 Suppose 130x = 134x + 11924. Let j be (-1 - -1) + 2 - -2089. Let t = x + j. What is t rounded to the nearest one hundred? -900 Let f = 1 - 2. Let p = f - -0.1. Let y = p + 0.90000095. Round y to 7 decimal places. 0.000001 Let s = -2511.4473893 - -1783.44737988. Let v = -15.15 - -743.15. Let n = v + s. Round n to six dps. -0.000009 Let k = 210.047 + -210. Let y = 0.046998836 - k. Round y to 7 dps. -0.0000012 Let w = -1.2 - -0.1. Let d = 1.100000692 + w. What is d rounded to seven decimal places? 0.0000007 Let g = 1276.140489 - 1276. Let h = g - 0.142. What is h rounded to four dps? -0.0015 Suppose -2b + 2804706 = -3g, 0 = -117b + 114b + 9. Round g to the nearest one hundred thousand. -900000 Let w = 77861.966 + -77777. What is w rounded to 0 dps? 85 Let x be -3 - (-8092600)/(-1 - -3). Suppose -35c - x = 13348703. Round c to the nearest 10000. -500000 Let c = 178 + -428. Let u = 580315040899 - 580315041148.999999813. Let j = c - u. What is j rounded to 7 dps? -0.0000002 Let o = 18685 + -17890.1. What is o rounded to the nearest one hundred? 800 Let v = -243 + 230.9. Let j = -15 - v. Let b = j + 2.8824. Round b to three decimal places. -0.018 Let l be 8/(2 - (-4 + 8)) - -6. Suppose 6 = 3k - lk. Suppose -kp = 6p + 84360. Round p to the nearest 1000. -7000 Let n(k) = 529k + 196. Let t be n(12). Suppose -18z = -t + 119044. What is z rounded to the nearest one thousand? -6000 Let g(t) = -8t - 250. Let q be g(-31). Let v(n) = 644999n3 - n2 + 8n + 12. Let o be v(q). Round o to the nearest 100000. -5200000 Let v(h) = -934h + 6176. Let l be v(-47). What is l rounded to the nearest ten thousand? 50000 Let f = 39291 + -61737. Let m = -22735.18 - f. Let t = 292 + m. What is t rounded to 1 decimal place? 2.8 Let k be (3/(-18)3)/((-1)/(-4)). Let z be 1(-10)/4(0 + k). Let s = z + -5. What is s rounded to six dps? 0 Let z = -7 + 8. Let p(r) = 5599994r2 - r + 1. Let v be p(z). Suppose 0 = -5l + f - 7000002, -3f = 5l - l + v. What is l rounded to the nearest 100000? -1400000 Let a = 348 - -112. Let m = 459.9998754 - a. What is m rounded to five dps? -0.00012 Let d = -7873 - -7872.999038. What is d rounded to 5 decimal places? -0.00096 Suppose -42d + 50d = -2963600. What is d rounded to the nearest ten thousand? -370000 Let d = -7459592140.09999273 + 7459592084. Let r = -57.044 + 0.944. Let t = r - d. Round t to 6 decimal places. -0.000007 Let b = 620.9341 + -621. Let z = b - -0.3529. Round z to 2 decimal places. 0.29 Let y = -83.102 + 83. Let v = -78.898 + y. Let i = v + 78.992. Round i to three decimal places. -0.008 Let o = 10719285 - 6090285. Let i be 24/54-15o. What is i rounded to the nearest one million? -31000000 Suppose -2h - 2f + 10 - 4 = 0, -f - 1 = -3h. Let v be 16387/(-3) + h/3. Let y = v + 3162. What is y rounded to the nearest 1000? -2000 Let q = -25959.9935553 - -25960. What is q rounded to 4 dps? 0.0064 Let s be (-7923930)/140 - (-2)/(-4). Let j be -200-1s/(-2). What is j rounded to the nearest one hundred thousand? 5700000 Let u = 15028.50344 + -15028. What is u rounded to three dps? 0.503 Let p = -351 + 355.13. Let w = p - 4.12999701. Round w to 7 dps. 0.000003 Let t = -0.1489 - 724.8511. Let l = -724.8395 - t. What is l rounded to 2 decimal places? 0.16 Suppose -3q = -4a - 8, q = 3a + 2a - 12. Suppose 0 = 3u + 2z + 8489994, qz - 6z - 2830006 = u. Round u to the nearest one hundred thousand. -2800000 Let q = -2.64 - -0.14. Let k = 0.4887 - -1.9403. Let x = k + q. What is x rounded to 2 decimal places? -0.07 Suppose 0 = 2b - z + 6z - 275856, 3z - 413793 = -3b. Let s = -91533 + b. Round s to the nearest ten thousand. 50000 Let k be 1265/66 - 20/(-24). Let y(q) = 281q*3 - 17q*2 - 11q + 20. Let x be y(k). What is x rounded to the nearest one hundred thousand? 2200000 Let r be ((-3)/6)/((124/(-57240))/(-31)). Let a = r - -11485. Round a to the nearest 100. 4300 Let v = 0.0303 + -0.0201. Let d = -1.2002 + v. Round d to the nearest integer. -1 Let y = 2912.0000007102 - 2912. What is y rounded to 7 dps? 0.0000007 Let h be 4/30 + 522/135. Suppose 4k + 3001 = s, 0k + hk - 3s = -3003. Let l be 9/(81/k)*-564. What is l rounded to the nearest ten thousand? 50000 Let x = 14071.7952 - 25378265.5952. Let m = 25364161.7999854 + x. Let r = m + 32. What is r rounded to six dps? -0.000015 Let w = -53.1445 - -51.73. Let p = -1.36 - w. Let i = p - 0.04767. What is i rounded to 3 dps? 0.007 Let n = 38004.48553 - 38005. What is n rounded to 2 dps? -0.51 Let b = -57.908746 + -0.086554. Let h = -58 - b. What is h rounded to three dps? -0.005 Let r = 2380.86 + -2565.2. What is r rounded to the nearest integer? -184 Let h = 10654.00018716 - 10654. What is h rounded to four dps? 0.0002 Let k = -5.63 + 1.13. Let o = k + 99.5. Let w = -93.17 + o. Round w to 1 dp. 1.8 Let f	{ "pile_set_name": "DM Mathematics" }
is pi(g) + 6n(g)? -23g + 1 Let s(w) = w3 - w2 - 1. Let u(f) be the second derivative of 6f*5/5 - 8f*4/3 - 16f*2 - 365f. Let q = -33 - -1. Calculate qs(p) + u(p). -8p*3 Let g be 0/(-4) - (0 - 1). Let o(d) = -2d*3 + 2d*2. Let z be 6/(-4)24/9. Let u(r) = -3 + 3 - 8359r2 + 8359r2 - r3. Determine go(t) + zu(t). 2t3 + 2t2 Let x(y) = y3 - 11y2. Let t(m) = -129m*3 + 165m*2 + 60m. What is t(l) + 15x(l)? -114l*3 + 60l Let v = 2329 - 2332. Let f(p) = p3 - p2 + p. Let a(z) = z3 - z2 + z. Calculate vf(l) + 2a(l). -l3 + l2 - l Let h(w) = -4w2 + 4w + 6. Let z(f) = 4f2 + 42f + 5. Let j be z(-8). Let d = -69 - j. Let x(y) = 0y - y + y2 - 1 + 0y*2. Determine dx(q) + h(q). 2q2 - 2q Let x(u) = -1. Let y(v) = -2v + 205. Let d(o) = -3o + 273. Let g(p) = -3d(p) + 4y(p). Determine g(n) + 4x(n). n - 3 Let o be (3/(-5) - -1)-15. Let r(y) = -8y + 3. Let t(x) be the third derivative of -23x*2 - 1/2x*3 + 0 + 7/24x*4 + 0x. What is or(h) - 7t(h)? -h + 3 Let l be (-1)/2(-1 - 1). Let a(j) = 1. Let r(v) be the second derivative of 2v*3/3 - 15v + 26. Determine la(w) + r(w). 4w + 1 Let g(c) = -7c - 3. Let v(u) = -30u + 29. Let y(j) = 21j - 21. Let b(o) = 5v(o) + 7y(o). Suppose 4w + 20 = 8w. What is wb(i) - 3g(i)? 6i - 1 Let q(k) = -2k + 5. Let d be q(5). Let y = -13 + 13. Suppose 2g + 1 + 11 = y. Let c(b) = 2b - 6. Let z(j) = -j + 5. Give dc(r) + gz(r). -4r Let n(f) = 2f + 22. Let u(c) = 2c + 21. Let v be (-7)/2888/(-518) + -4. What is vu(r) - 3n(r)? -2r - 24 Let l(i) = -1 + 3 - 1. Let f(y) = -24 + 25y - 4y - 3y - 2y*2 + 8 - 18. Let b be f(6). Let o(t) = -2t + 3. Determine bl(m) - o(m). 2m - 1 Let r(j) = j*3 - 1. Suppose 6v + 30 = -4d, 46d + 8 = -2v + 45d. Let x(f) = 4f3 + 2. Give vx(c) - 3r(c). -7c3 + 1 Let j(y) be the second derivative of y5/20 + y*4/6 - 2y*3/3 - 5y*2/2 + 2y - 65. Let q(v) = -v*3 - 3v*2 + 6v + 7. Give -7j(l) - 5q(l). -2l3 + l2 - 2l Let r(s) be the first derivative of 5s4/2 + s3 + 3s*2/2 + 2s + 6894. Let q(c) = 21c3 + 7c*2 + 6c + 4. Calculate -2q(l) + 5r(l). 8l3 + l2 + 3l + 2 Let w(k) = k - 12. Let u(m) = -72m + 456. Give -u(o) - 36w(o). 36o - 24 Suppose 12n + 10 = 17n. Let b(f) = -10 + 14 + 3f - f - 3 - 3f. Let j(m) = -m2. What is nj(g) - b(g)? -2g2 + g - 1 Let n(y) = 321y*2 + 59y + 9. Let i(o) = 2o2 + 10o + 1. Determine 6i(f) - n(f). -309f2 + f - 3 Let y(g) = 1 - g3 - 1 + 0g3 - 5. Suppose o + w + 6 = 7, -o - 2w = 2. Let n = -6 + 9. Let f(a) = 2a3 + 6. Give nf(u) + oy(u). 2u*3 - 2 Let y(s) = -18s*3 + 415s - 18. Let a(h) = 53h3 - 1245h + 51. Calculate -6a(b) - 17y(b). -12b3 + 415b Let k(x) = -28x3 - 2x*2 - 3x + 2. Let f(w) = -22w3 - w2 - 2w + 1. Let d(y) = 3f(y) - 2k(y). Let n(v) = v*3 + 1. What is -d(j) - n(j)? 9j3 - j2 Let g = 258 - 238. Suppose 12j + 16 = gj. Let z(a) = a - 1. Let r(k) = -4k - 1. Give jz(m) + r(m). -2m - 3 Let f(c) = -11c*2 - 9. Suppose 0 = 24s + 36s - 120. Let n(q) = -5q*2 - 4. Give sf(h) - 5n(h). 3h2 + 2 Let u(a) = a2 - 4a + 1. Let c(h) = -5h*2 - 2h. Let i(t) = 26t2 + 9t + 1. Let g(v) = -5c(v) - i(v). What is 3g(f) + u(f)? -2f2 - f - 2 Let p(b) = 3b*3 - 5b*2 + 11b + 11. Suppose -4c + 3a + 15 = 0, 303 = 4c + 4a + 267. Let f(t) = t3 - t2 + 3t + 3. What is cp(k) - 22f(k)? -4k*3 - 8k*2 Let b(f) = -15f + 3. Let i(p) = 5p - 1. Suppose 106s + 1038 + 128 = 0. What is si(m) - 4b(m)? 5m - 1 Let l(p) = 8. Let s be 4/1 - (-4 - 209/(-19)). Let w(x) = -x + 17. Determine sw(a) + 5l(a). 3a - 11 Let t(m) = 69m3 - m2 + 6m - 6. Let j(v) = 2v3 + v2 - 2v + 2. Give -6j(o) - 2t(o). -150o3 - 4o*2 Let g(x) = -12x + 4. Suppose -230 = 28j - 790. Let f(w) = -18w + 45w - 18w + 4 - jw - 1. Give 3f(u) - 2g(u). -9u + 1 Let z(s) = -12632s. Let g(d) = -2640104d. Determine -5g(p) + 1046z(p). -12552p Let b(m) = 121m*2 - 143m + 143. Let o(l) = 5l2 - 6l + 6. Let r = 1002 - 602. Suppose 6i - r = -1258. What is io(k) + 6b(k)? 11k*2 Suppose -8z = -41 + 1. Suppose 3 = 4b - 17. Let i(d) = -5d + 2d - 3d + b. Let t(w) = -9w + 7. Give zt(r) - 7i(r). -3r Let j(m) = 36m3 + 8. Let s(l) = -4l*3 - 7l*2 + 7l + 3. Let u(y) = -y*3 - 2y*2 + 2y + 1. Let b(v) = 2s(v) - 7u(v). Calculate 8b(t) + j(t). 28t*3 Let h(y) = 3y - 8y2 - 9y*2 + 6 + 18y*2 + 7. Let a(m) = m + 4. What is -7a(q) + 2h(q)? 2q2 - q - 2 Let f(v) be the second derivative of -v3/3 - 10v2 - 3389v. Let l(m) = -m - 10. Give -3f(u) + 7l(u). -u - 10 Suppose -8w + 2 = -2x - 4w, -2x + 4 = -7w. Let j(n) = -9n*2 + n - 1. Let l(b) = 10b*2 - b + 1. What is xj(a) - 6l(a)? -15a*2 + a - 1 Let v(f) = -2f - 1. Let y(k) = 18k + 34. Calculate -3v(p) + y(p). 24p + 37 Let f(d) = 75. Let a(j) = -2611. Let i(m) = -a(m) - 35f(m). Let t(z) = z + 56. Determine 9i(s) + 2t(s). 2s - 14 Let i(x) = x. Let p(f) = -7f*2 + 2f. Let o(a) = a*2 - a - 1. Let d be o(0). Let m be (-70)/(-5) - 20/6036. Determine dp(b) + mi(b). 7b2 Let w(t) = -19t*2 + 6t + 6. Suppose 296 = -251q + 328 + 1474. Let s(z) = 3z*2 - z - 1. Give qw(c) + 39s(c). 3c*2 - 3c - 3 Let v(y) = -7y2 + 45y - 47. Let c(i) = 20i2 - 134i + 130. What is -6c(f) - 17v(f)? -f*2 + 39f + 19 Let w(c) = -947c2 + 4c + 13. Let v(j) = -474j2 + 2j + 6. What is 7v(a) - 3w(a)? -477a2 + 2a + 3 Let a(d) = d*2. Let n(m) = -242m + 7745. Let v be n(32). Let z(x) = x*3 + 6x*2 - 8. Determine vz(s) - 6a(s). s3 - 8 Let n(t) = -2t + 3. Let x(w) = -34. Let g(j) = -2j - 65. Let p(f) = -g(f) + 2x(f). Suppose 5l = -0l + 30. Give lp(y) + 7n(y). -2y + 3 Let x(q) = -12q - 1. Let t(y) = -929y. What is t(i) - 2x(i)? -905i + 2 Let w(b) = 4b*3 - 9b*2 + 12b + 29. Let l(q) = 9q3 - 19q*2 + 26q + 59. Give -6l(p) + 13w(p). -2p3 - 3p*2 + 23 Let c(q) = -14q*2 - 11q - 9. Let b(l) = 7l2 + 5l + 4. Let t be ((-43)/(29 - -57))/(-2 - 13/(-6)). What is tc(g) - 7b(g)? -7g2 - 2g - 1 Let i(n) be the third derivative of 355n5/6 + 71n*4/8 - 71n3/2 + n2 + n - 8. Let t(l) = 67l2 + 4l - 4. Calculate 4i(c) - 213t(c). -71c2 Let y(m) = -m3 - 15m*2 + 33m - 8. Let o be y(-17). Suppose 0 = 13d - 17d - 8. Let f(p) = 3p2. Let j(w) = 13w*2 - w - 1. Give dj(s) + of(s). s2 + 2s + 2 Let l(i) = -39i - 406. Let u(f) = -48f - 410. Give 6l(w) - 5u(w). 6w - 386 Let n(j) = 3j*2 - 300j + 2. Let z(y) = -16y2 + 1499y - 12. What is 11n(f) + 2z(f)? f*2 - 302f - 2 Let w = -14282 - -14284. Let r(j) = 9j2 + 4j - 6. Let t(z) = -5z - 2. Let q be t(1). Let l(o) = 3o*2 + o - 2. Give ql(d) + wr(d). -3d2 + d + 2 Let h(a) = -a3 - a*2 + a - 1. Let s be (3 + -3)/(-3) - (-7 - -6). Let u(r) = -3r*3 - 8r*2 + 5r - 3. Determine su(d) - 5h(d). 2d3 - 3d2 + 2 Let y(o) be the third derivative of -o5/20 - 7o4/24 - 2o*3/3 - 34o*2. Let z(n) = 12n*2 + 29n + 17. What is 9y(w) + 2z(w)? -3w2 - 5w - 2 Let z(n) = -2n + 75. Let s(f) = 12f - 361. Calculate 4s(b) + 22z(b). 4b + 206 Let u(p) = 2p*3 + 10p*2 - 23p - 15. Let t(n) = -6n3 - 21n*2 + 44n + 37. Calculate -2t(f) - 5u(f). 2f3 - 8f*2 + 27f + 1 Let j(n) = -149n - 5. Let q = 21966 - 21504. Let o(y) = 13783y + 462. Determine qj(u) + 5o(u). 77u Let r(d) = -228d - 17. Let x(c) = -127c - 8. Give -3r(g) + 7x(g). -205g - 5 Let v(b) = -25b3 - 3b*2 + 6b - 10. Let u(p) = 8p3 + p2 - 2p + 3. Let d = -8187 + 8194. What is du(y) + 2v(y)? 6y3 + y2 - 2y + 1 Let a(d) = -d - 1. Let q(m) = 723m - 8. Calculate -5a(y) + q(y). 728y - 3 Let l(f) = -11f*3 - 11f*2 + 11f + 34. Let b(w) = w3 + w2 - 3. Give 9b(h) + l(h). -2h*3 - 2h*2 + 11h + 7 Suppose -3 = -l + 3. Suppose -5c - c = -408. Let m = c - 54. Let o(n) = n. Let d(s) = -2s. Give ld(w) + mo(w). 2w Let k(u) = -4u - 3u2 + 0u*3 + 6u2 - u3 + 0 + 5. Let a(m) = -m*2 + m - 1. Let c = -6600 - -6605. Give ca(r) + k(r). -r*3 - 2r*2 + r Let q(s) = -2s*2 - 51s - 5. Let w = -23125 - -23127. Let j(i) = -2i2 - 51i - 4. Give w*	{ "pile_set_name": "DM Mathematics" }
3 - 89 Collect the terms in -11u*3 - 17u*2 + 8u*2 + 9u*2. -11u*3 Collect the terms in 53b*2 - 6 - 12b*2 + 0 + 4. 41b*2 - 2 Collect the terms in 3 - 4 + 1 - 106j*2. -106j2 Collect the terms in 55 - 14 - y3 - 41. -y*3 Collect the terms in -2v + 2v + 658v*2 + 211v*2. 869v*2 Collect the terms in 5x3 - x3 - x*3. 3x*3 Collect the terms in 5q2 - q2 + 129 - 12. 4q2 + 117 Collect the terms in 11799d - 5886d - 5909d. 4d Collect the terms in -5 + k3 + 0k3 + 2 + 11. k3 + 8 Collect the terms in 106c3 + 0c*3 - 20c*3. 86c*3 Collect the terms in -88f - 19 - 84f + 19. -172f Collect the terms in -11u - 6 + 6 + 0. -11u Collect the terms in -2v3 + 4v3 - v3. v*3 Collect the terms in -94h2 - h2 + 65 - 65. -95h2 Collect the terms in -b3 + 659b - 68b + 152b. -b*3 + 743b Collect the terms in -90b - 94b + 179b. -5b Collect the terms in 0w2 - w3 + 2w*2 + 3w*3 - 9w*3. -7w*3 + 2w*2 Collect the terms in -8v + v - 14v - 4v + 16v. -9v Collect the terms in -9c3 + 4c*3 - 37 + 37. -5c*3 Collect the terms in 2j - 4j - 4j + j. -5j Collect the terms in 0d*3 + 3d*3 + 3d*3 + 0d*3 - 8d*3. -2d*3 Collect the terms in 2q*3 + 2q*3 - 10q*3 + 10q*3. 4q*3 Collect the terms in -3662d*2 - 11d*3 + 3662d*2. -11d*3 Collect the terms in -22w*3 + 28w*3 + 82w*3. 88w*3 Collect the terms in v - v + 191v*2 - 188v*2. 3v*2 Collect the terms in 282b - 119b - 170b. -7b Collect the terms in -667t + 1339t - 668t. 4t Collect the terms in 2 + 3d - 41d - 15d. -53d + 2 Collect the terms in p3 + 1705p - 1705p. p3 Collect the terms in 46 + 3z - 46. 3z Collect the terms in 6k + 2k - 11k - 14k - 2. -17k - 2 Collect the terms in -29c2 + 4c*3 + 15c*3 + 29c*2. 19c*3 Collect the terms in 3x + 0 - 4x + 0x + 4. -x + 4 Collect the terms in -3x3 - x3 + 2x*3. -2x*3 Collect the terms in -29o + 83o - 29o - 30o. -5o Collect the terms in -9c + 19c + 6c + 4c. 20c Collect the terms in -10k + 34k - 16k. 8k Collect the terms in -4m + 4 + 2m - 3 + m. -m + 1 Collect the terms in 8 + 4i + 9i2 - 20 + 12. 9i*2 + 4i Collect the terms in 18f + 23f - 47f. -6f Collect the terms in 28m2 - 46m*2 + 25m*2. 7m*2 Collect the terms in 1197 - 1197 + 6u. 6u Collect the terms in -11l*3 + 10l*3 + 3l*3 + 21l*3. 23l*3 Collect the terms in -323 - 99j*3 + 323. -99j*3 Collect the terms in 3m - 4m + 5m. 4m Collect the terms in 6h + 27 - 27. 6h Collect the terms in -97d*3 + 186d*3 - 51d*3. 38d*3 Collect the terms in -1813y + 1813y + y2. y2 Collect the terms in 5 + 2 + 2 - 1 + g. g + 8 Collect the terms in -9k*3 + 2k*3 + 10k*3. 3k3 Collect the terms in -d2 + 0d2 + 218d - 228d. -d2 - 10d Collect the terms in -8 + 21 - 13 + 3c3. 3c*3 Collect the terms in 3s + 13s - 17s. -s Collect the terms in -35t - 27t + 50t. -12t Collect the terms in 1 + 0w2 + 12w*2 - 1. 12w*2 Collect the terms in -25l*2 + 121l*2 + 52l*2 - 8l*2. 140l*2 Collect the terms in -4i + i + 0i + i. -2i Collect the terms in w*2 + 0w*2 + 3w*2 + 0w*2. 4w*2 Collect the terms in -16m*3 - 38m*3 + 117m*3 - 35m*3. 28m*3 Collect the terms in -115 - 107 - l + 222 + 6l. 5l Collect the terms in 13f*2 - 11 + 11. 13f*2 Collect the terms in 4 - 4n - 6n - 5n. -15n + 4 Collect the terms in -383j + 125j + 128j + 128j. -2j Collect the terms in 79i2 - 343i*2 - 97i*2. -361i*2 Collect the terms in 2z + 2z3 - 4z + 0z + 2z. 2z3 Collect the terms in 7 - 6o - 2 - 5. -6o Collect the terms in 3o3 + o3 + 2o3 - 4o*3. 2o3 Collect the terms in -214 + r2 + 4r + 214 - 4r. r*2 Collect the terms in -22u*3 + 36u*3 + 20u*2 - 13u*3 + 0u + 0u. u3 + 20u*2 Collect the terms in 5b*3 - 670b*2 + 670b*2. 5b*3 Collect the terms in 15f*2 + 9f*2 - 9f*2. 15f*2 Collect the terms in 10k*3 - 8k*3 - 3k*3 - 3k*3. -4k*3 Collect the terms in 10u*2 - 22u*2 + 7u*2. -5u*2 Collect the terms in -587w*2 + w - w + 597w*2. 10w*2 Collect the terms in 93a - 39a - 31a. 23a Collect the terms in -62p*2 + 46p*2 - 3p + 39p2 + 7p. 23p2 + 4p Collect the terms in 19d2 + 86d - 87d + 7d*2. 26d*2 - d Collect the terms in -12 - 5x*2 + 3 + 6x2. x2 - 9 Collect the terms in 151q2 - 89q*2 + 615q*2. 677q*2 Collect the terms in -1 - 938p*3 + 1 + 941p*3. 3p*3 Collect the terms in -1 + 0 + 2 + 2b - 2. 2b - 1 Collect the terms in -57q*3 + 76q*3 - 16q*3. 3q*3 Collect the terms in -4p*3 - 10p*3 - 9p*3 + 22p*3 - 5p*3. -6p*3 Collect the terms in -55205 - 2s*3 + 55205. -2s*3 Collect the terms in -6670v - 6680v + 13347v. -3v Collect the terms in -1 + 3 + 3o + 1 + 0. 3o + 3 Collect the terms in 8n*2 + 245 - 245. 8n*2 Collect the terms in 81v*2 + 24 + 30 - 54. 81v*2 Collect the terms in 3h + 87 - 87 - h. 2h Collect the terms in n2 + 8966 - 8966. n2 Collect the terms in -135l*2 - 332l*2 + 333l*2. -134l*2 Collect the terms in 0x - x*2 - 2x + 2x. -x2 Collect the terms in k2 + 52k*3 - 4k*2 + 6k*2. 52k*3 + 3k*2 Collect the terms in 85s*3 - 32s*3 - 52s3. s3 Collect the terms in 21945r2 + 21948r*2 - 43894r2. -r2 Collect the terms in -v + 2v - 1090v*3 + 148v*3. -942v*3 + v Collect the terms in 0l*3 + 16l*3 + 2l*3. 18l*3 Collect the terms in 4f*3 - 12f*3 + 5f - 7f. -8f*3 - 2f Collect the terms in -19d - 20d + 65d - 17d - 17d. -8d Collect the terms in -5m3 - 8m + 8m. -5m*3 Collect the terms in -63h - 64h + 38h. -89h Collect the terms in 2q + 65 - 10 + 14. 2q + 69 Collect the terms in 6g*2 - 71g - 125g2 + 71g. -119g2 Collect the terms in -2d*3 - 27d*3 + 30d3. d3 Collect the terms in 4a2 - 12a*2 + 7a*2 - 4a. -a*2 - 4a Collect the terms in 0h3 + 2h*3 + 2 - 3h3 - 2. -h3 Collect the terms in 133u - 43u - 41u - 48u. u Collect the terms in -z - 40 + 118 - 36 - 42. -z Collect the terms in 225x2 + 0x3 + x3 - 11 - 225x2. x3 - 11 Collect the terms in 29z*3 - 7z*3 - 9z*3. 13z*3 Collect the terms in -102 + 102 + 149i*3. 149i*3 Collect the terms in 9r*3 + 13 + 9 - 22 - 13r*3. -4r*3 Collect the terms in 37 - 100 - 99 + 4n - 6n. -2n - 162 Collect the terms in -15m3 - 9m*3 - 16m*3 + 41m3. m3 Collect the terms in 50s2 + 48s*2 - 98s*2 + 2s*3. 2s*3 Collect the terms in 28a + a*3 + 64a - 92a. a3 Collect the terms in 4y*2 + 47y*3 + 28y*3 - 4y*2 - 73y*3. 2y*3 Collect the terms in -8g - 6g - 15g. -29g Collect the terms in -36d*2 - 38d*3 - 3d*3 + 36d*2. -41d*3 Collect the terms in 15n3 - n3 - 5n3. 9n*3 Collect the terms in 5 - 44u*3 - 5 + 0. -44u*3 Collect the terms in -73358 + 73358 - 3a*3. -3a*3 Collect the terms in -4d*2 + 3d - 7d + 4d + 5d. -4d*2 + 5d Collect the terms in 221v3 - 450v*3 - 5 + 222v*3. -7v*3 - 5 Collect the terms in 35r + 32r - 72r. -5r Collect the terms in 2p + 6p - 29p - 19p. -40p Collect the terms in -7a - 3a + 5a. -5a Collect the terms in 3h + 8 - 11 - 16. 3h - 19 Collect the terms in -5p - 18 + 21 - 3. -5p Collect the terms in 8a + 26a + 4 - 4. 34a Collect the terms in 66w*3 - 193w*3 + 63w*3 + 62w*3. -2w*3 Collect the terms in -6875w + w*3 + 6875w. w*3 Collect the terms in -15c - 12c + 27c - 3c2. -3c*2 Collect the terms in -56j*3 + 3 + 15j*3 - 4. -41j*3 - 1 Collect the terms in 7g*2 + 6g*2 - 12g2. g2 Collect the terms in 13z2 - 13z*2 - 14838z*3 + 14841z*3. 3z*3 Collect the terms in 0 + 116b + 0 - 89b. 27b Collect the terms in 2f3 - 4f - 21f2 + 2f + 2f. 2f*3 - 21f*2 Collect the terms in -3r + 18r + 21r*2 - 6r - 8r. 21r*2 + r Collect the terms in 3r*2 - 13r2 - r2. -11r2 Collect the terms in -5y - 10y2 + 42y - 37y. -10y*2 Collect the terms in 2t2 - t2 + 7t2. 8t*2 Collect the terms in 0 + 0 - 7a*2 - 22a*2. -29a*2 Collect the terms in -4i*2 + 308 - 308. -4i**2 Collect	{ "pile_set_name": "DM Mathematics" }
51. Calculate s(14). 1 Let g(c) = 3318c - 112671. Calculate g(34). 141 Let i(g) = -g3 + 20g*2 - 173g + 1880. Calculate i(16). 136 Let b(r) = -r*3 + 49r*2 + 81r + 1288. What is b(51)? 217 Let w(n) = 350n + 9111. Give w(-27). -339 Let y(k) = -251k - 28466. What is y(-124)? 2658 Let n(s) = -2s2 + 85374s + 256161. Give n(-3). 21 Let j(g) = -g*3 - 66g*2 - 86g + 556. What is j(-63)? -5933 Let v(k) = k*3 + 34k*2 - 3199k + 1. Give v(42). -293 Let g(m) = -2m2 - 768m - 6002. What is g(-8)? 14 Let d(x) = x*2 - 2179x + 55981. What is d(26)? 3 Let t(m) = -2m3 + 34m*2 - 48m - 29. Determine t(2). -5 Let i(k) = -118k + 36977. Determine i(313). 43 Let a(t) = 4t*2 + 69t - 1213. Calculate a(-28). -9 Let f(i) = 566i + 21127. Determine f(-37). 185 Let n(b) = 1341b + 95302. Calculate n(-71). 91 Let t(d) = -328d2 + 68225d - 212. Give t(208). -4 Let g(x) = -x*2 - 1962x + 13787. Give g(7). 4 Let u(i) = 9i3 - 39i*2 - 404i + 1121. What is u(8)? 1 Let j(u) = -9u2 + 221u + 197. Determine j(27). -397 Let m(q) = -q*3 - 57q*2 + 1931q - 9645. Determine m(-82). 113 Let i(d) = 560d2 - 154000d + 36. What is i(275)? 36 Let y(m) = 4939m - 997726. Determine y(202). -48 Let m(f) = -115381f - 230757. Determine m(-2). 5 Let q(r) = 5r2 - 7189r - 1. Give q(0). -1 Let f(c) = 3c2 - 141c + 101. What is f(52)? 881 Let b(k) = 10996k + 670831. Calculate b(-61). 75 Let y(n) = -2n*3 - 158n*2 + 636n + 25269. Calculate y(-81). -3 Let g(y) = 8y3 - 1017y*2 + 129y - 248. Give g(127). 6 Let g(d) = -286364d - 1431817. Give g(-5). 3 Let k(r) = 723r + 9359. Calculate k(-13). -40 Let z(t) = 12t2 + 344t - 2031. Calculate z(5). -11 Let v(l) = 3l2 + 603l - 5951. Give v(9). -281 Let h(m) = -m*3 + 624m*2 + 423939m - 392. Determine h(-410). 18 Let v(d) = d*3 - 154d*2 + 1456d - 2299. What is v(144)? 5 Let o(c) = -52966c + 4872874. Give o(92). 2 Let c(o) = -13633o - 817876. Calculate c(-60). 104 Let y(u) = u*3 - 61u*2 - 551u - 14. Determine y(69). 55 Let f(b) = 4b2 - 1114b - 24992. Determine f(-21). 166 Let i(t) = -9439t - 254798. Determine i(-27). 55 Let n(g) = 1010g + 99050. Determine n(-98). 70 Let j(k) = -k*3 - 68k*2 - 435k - 3888. Determine j(-62). 18 Let n(g) = 9294g + 715665. What is n(-77)? 27 Let w(s) = 98550s + 1281156. Give w(-13). 6 Let z(a) = -2a2 + 10588a + 201904. What is z(-19)? 10 Let h(p) = -308p + 48. What is h(0)? 48 Let n(r) = r3 - 178r*2 + 1527r - 206922. Give n(176). -122 Let b(i) = 3344i + 23658. What is b(-7)? 250 Let j(h) = -109h*3 - 980h*2 - 185h - 1825. Give j(-9). -79 Let h(z) = 1195z - 29898. Give h(25). -23 Let n(h) = -3h*2 + 103h - 1067. Calculate n(12). -263 Let s(z) = 2z3 + 11z*2 + 2096z + 12739. Determine s(-6). 127 Let c(y) = -2y2 + 752y - 27927. Determine c(42). 129 Let h(a) = 11391a - 4419720. Give h(388). -12 Let d(r) = -2246r + 9354. Give d(4). 370 Let n(t) = 4720t + 4568. Calculate n(-1). -152 Let n(z) = -3z*2 - 3630z - 60827. Give n(-17). 16 Let k(g) = -105g2 - 5976g + 6618. Determine k(-58). 6 Let c(j) = 6j3 + 2257j*2 + 341j - 13162. Calculate c(-376). -2 Let y(l) = -l*2 - 37711l - 188540. Calculate y(-5). -10 Let b(r) = -233r2 + 329237r - 11297. Give b(1413). 7 Let u(k) = 87k3 - k2 + 26k + 51. Determine u(-2). -701 Let a(f) = -1534f3 - 142f*2 - 2f - 2. Determine a(-1). 1392 Let i(n) = n*2 + 39n - 20347. Calculate i(-165). 443 Let j(r) = 250r2 + 150513r + 7828. Determine j(-602). 2 Let c(t) = t3 - t2 + 162t - 620. Determine c(4). 76 Let a(k) = -949k + 15969. Determine a(19). -2062 Let n(m) = m*3 + 158m*2 + 207m - 188406. Give n(-148). -2 Let u(o) = -13308o - 66536. Calculate u(-5). 4 Let s(t) = -16338t - 114446. Determine s(-7). -80 Let w(f) = -22063f - 66195. What is w(-3)? -6 Let h(r) = r2 + 151r - 20420. What is h(86)? -38 Let a(n) = -7300n - 356916. What is a(-49)? 784 Let l(j) = 8234j - 642536. Give l(78). -284 Let w(x) = 7x3 + 110x*2 + 209x + 648. Determine w(-14). 74 Let g(y) = y*2 + 741y - 96503. Determine g(113). -1 Let b(g) = -343g2 - 56937g + 163. Determine b(-166). -3 Let f(b) = -1066b2 + 2136b - 13. What is f(2)? -5 Let c(o) = -3562o - 338348. What is c(-95)? 42 Let m(s) = -3s*2 + 605s + 10586. What is m(218)? -96 Let u(c) = -18c2 - 2529c + 1265. What is u(-141)? -4 Let x(s) = -2s3 - 115s*2 - 41s + 913. Determine x(-57). 1 Let t(c) = -45c3 + 2122c*2 - 326c - 151. Calculate t(47). -10 Let t(u) = 4u2 + 1826u + 31065. What is t(-17)? 1179 Let r(t) = 729t + 120298. Calculate r(-165). 13 Let o(m) = 26906m - 44. Give o(0). -44 Let f(g) = -7064g - 52376. Determine f(-8). 4136 Let j(l) = 3l*3 + 5l*2 - 44l + 15. Determine j(3). 9 Let s(f) = 1471f - 66167. What is s(45)? 28 Let q(k) = 419k*2 - 6305k + 296. Give q(15). -4 Let k(h) = -4h3 + 52h*2 + 739h - 9646. Determine k(13). -39 Let x(a) = 2a3 - 57a*2 + 352a - 5797. Determine x(26). -25 Let a(r) = 3r2 + 2370r - 118018. Give a(47). -1 Let y(q) = -q*3 + 18q*2 - 25q - 4. Calculate y(19). -840 Let q(u) = -13u2 + 123u + 101. Determine q(12). -295 Let c(v) = v*3 - 236v*2 + 208v + 6297. Calculate c(235). -48 Let x(j) = -163901j + 655611. Give x(4). 7 Let h(f) = 6f*2 - 636f - 1243. Calculate h(108). 53 Let r(c) = c*2 + 750c - 4550. Give r(6). -14 Let x(f) = -3f2 - 1628f + 19963. Determine x(12). -5 Let r(y) = 2511y + 183275. What is r(-73)? -28 Let g(j) = 5j*2 - 39j - 423. What is g(-6)? -9 Let c(k) = -29331k - 1202687. What is c(-41)? -116 Let q(a) = -3a*3 + 11832a*2 + 11782a - 51. What is q(-1)? 2 Let s(l) = -9l3 - 1043l*2 + 139l + 1779. Give s(-116). -889 Let l(s) = s*2 - 376s + 3245. Calculate l(9). -58 Let x(i) = 571i2 + 75373i + 107. What is x(-132)? -25 Let h(c) = -62663c - 2067886. Calculate h(-33). -7 Let a(f) = -6f*2 - 150f - 580. Calculate a(-4). -76 Let x(n) = -105n + 12404. Calculate x(120). -196 Let n(s) = -28s*2 + 3108s - 4. Calculate n(111). -4 Let x(f) = -7418f + 2388589. Calculate x(322). -7 Let j(b) = b2 - 25b - 9408. What is j(110)? -58 Let j(a) = -9a3 + 22a*2 - 63a + 19. Give j(4). -457 Let i(m) = -18m2 + 539m + 538. Determine i(32). -646 Let y(g) = 80091g + 3123443. Give y(-39). -106 Let n(q) = -2q*3 - 219q*2 + 1087q - 8. Determine n(5). -298 Let p(i) = -i*3 + 15i*2 - 60i - 18. Calculate p(9). -72 Let v(m) = -61m3 + 1403m*2 + 2m - 24. Calculate v(23). 22 Let r(f) = 377299f + 5659479. Calculate r(-15). -6 Let x(b) = -b2 + 1298b - 75448. Determine x(61). 9 Let b(r) = 3666r + 3786982. What is b(-1033)? 4 Let n(v) = 8314v - 257714. Calculate n(31). 20 Let d(r) = 8r3 - 23r*2 - 5r + 6. Determine d(-2). -140 Let y(u) = -u*2 + 185457u + 741843. Calculate y(-4). -1 Let y(u) = 17u - 135. Determine y(2). -101 Let g(u) = -u3 + 41u*2 - 341u + 4641. What is g(36)? -1155 Let s(q) = -q*3 + 85q*2 - 41q - 3684. What is s(84)? -72 Let m(d) = -171d3 - 5d*2 - 73d - 141. Calculate m(-2). 1353 Let o(k) = 92k + 6816. Give o(-74). 8 Let w(c) = c3 + 159c*2 + 2381c + 1357. Give w(-16). -131 Let d(o) = 2361o2 - 118047o - 132. Determine d(50). 18 Let d(z) = -1310600z + 3931799. Determine d(3). -1 Let k(t) = 15t*2 + 3t - 285. Give k(8). 699 Let k(y) = -547y2 + 143y - 95. Calculate k(1). -499 Let r(x) = -267x2 + 216x + 952. What is r(-4)? -4184 Let y(b) = b*3 - 25b*2 + 127b - 570. Calculate y(20). -30 Let s(v) = 4v2 - 2110v - 31432. Calculate s(542). 4 Let j(w) = -3w2 + 44w - 269. What is j(5)? -124 Let h(o) = o*2 - 278o + 15615. Give h(183). -1770 Let f(c) = 934145c - 15880464. Calculate f(17). 1 Let y(u) = -u2 + 23011u + 391476. What is y(-17)? 0 Let w(a) = -21a + 58. Calculate w(7). -89 Let h(c) = -227c*2 - 438c + 757. What is h(-3)? 28 Let i(r) = r*3 - 49r*2 + 409r + 344. What is i(38)? 2 Let l(q) = 630q - 162528. Give l(258). 12 Let k(y) = -525632y + 1576875. What is k(3)? -21 Let p(y) = 4320y - 38940. Determine p(9). -60 Let n(r) = 4r*3 - 239r*2 - 55r - 364. What is n(60)? -64 Let j(v) = v*3 - 55v*2 - 236v + 6951. Calculate j(57). -3 Let i(u) = -3u2 - 96u + 3807. Give i(-58)	{ "pile_set_name": "DM Mathematics" }
to 2 dps. 0.01 Let o = 233967 + -162834. Let l = 71139.0003 - o. Let v = 6 - l. What is v rounded to three dps? 0 Let d = -433 + 422.14. Let o = -0.06 - d. Let z = o + -10.80079. Round z to 4 dps. -0.0008 Let c = -0.078 - -0.001. Round c to two decimal places. -0.08 Suppose -s + 38661 + 14339 = 0. What is s rounded to the nearest ten thousand? 50000 Let w = -36.4015669 - -34.40156661. Let z = w - -2. What is z rounded to 7 dps? -0.0000003 Let d = -14 + 26. Let o = d - 19. Let t = o - -6.94. Round t to 2 decimal places. -0.06 Let q = 875 + 1120. Suppose q - 2501995 = -o. Round o to the nearest one million. 3000000 Let f = -1.8 + 1.800022. Round f to five decimal places. 0.00002 Suppose -3b + 6b = -3o, -4b - 4 = 3o. Let c be -1 + o - (1 - 4199998). Round c to the nearest 1000000. 4000000 Let d be 52/10 - (-3)/(-15). Suppose du + 120010 = -3c, -3c + 2u - 119998 = u. What is c rounded to the nearest 100000? 0 Suppose -s - 17 = 3s - 3p, -3s + 2p - 14 = 0. Let r = s + -1132. What is r rounded to the nearest one hundred? -1100 Let n = -0.04 + 0.1235. Let u = -0.09 + n. Round u to three decimal places. -0.007 Let j = -7.0031 - 0.0269. Let o = -0.72 + j. Let t = o + -0.45. Round t to the nearest integer. -8 Let l = 67 - 67.0000018. Round l to six dps. -0.000002 Let g = 1408947 - 1408835.00051. Let a = g - 112. Round a to four decimal places. -0.0005 Let g(r) be the third derivative of r6/120 - r4/8 + r3/3 - r2. Let c = -5 + 9. Let y be g(c). Round y to the nearest ten. 50 Let i = -0.6 - -0.9. Let r = i + -0.2. Let m = -0.098 + r. What is m rounded to 2 decimal places? 0 Let t = -16 + 15.3. Let r = 0.69999952 + t. What is r rounded to seven decimal places? -0.0000005 Let g = -5 - -7. Suppose -s - g + 0 = 0. Let n be (120/(-9))/s24. What is n rounded to the nearest one hundred? 200 Let v = -13393.77 - -13535. Let p = v - 147.4. Let d = 6.7 + p. Round d to one decimal place. 0.5 Let x = -0.66 - -0.93. What is x rounded to 2 dps? 0.27 Let y = -22911625.0000014 + 22911628. Let z = y - 3. What is z rounded to 6 dps? -0.000001 Let t = -122 - -121.9902. Round t to 3 dps. -0.01 Suppose -228t + 233t = 597000. What is t rounded to the nearest 10000? 120000 Let q = -6 + 5.99999929. What is q rounded to 7 dps? -0.0000007 Let l = 13 - 13.00014. What is l rounded to four decimal places? -0.0001 Let v = -4 - -3. Let r(k) = 37k2 + k + 1. Let i(p) = -112p*2 - 4p - 4. Let n(s) = 2i(s) + 7r(s). Let c be n(v). Round c to the nearest ten. 40 Let b = -12.4 + 11. Let y = -1.4000004 - b. Round y to 6 decimal places. 0 Let c = 0.0250039 + -0.025. Round c to six dps. 0.000004 Let j = 0.6 + -1.1. Let f = j - -0.517. Round f to 2 dps. 0.02 Let p be (1979 + 0 - -5)-3125. Round p to the nearest one million. -6000000 Suppose m - 5g + 26 = 0, 5m = 3m + 4g - 28. Let t = 15 + m. Let y be (-366004)/6 - (-6)/t. What is y rounded to the nearest 10000? -60000 Let o = 45825 + -45825.1600064. Let c = o - -0.16. Round c to 6 decimal places. -0.000006 Let o = -123.01 + 114.1. Let y = 0.71 + o. What is y rounded to the nearest integer? -8 Let v = 737 + -691.1. Let s = v - 48. Let w = s + 2.1009. Round w to four decimal places. 0.0009 Let v = 78.6 + -97. What is v rounded to 0 decimal places? -18 Let t = -0.06 - 0.41. Let i = -7689575 + 7689575.46999934. Let f = i + t. What is f rounded to 7 dps? -0.0000007 Let i = 96628 + -96640.8182. Let b = -12.8 - i. Round b to three dps. 0.018 Let c = -1.15 + 1. Let g = c - 0.03. What is g rounded to one decimal place? -0.2 Let x = 88.4 + -99. What is x rounded to the nearest integer? -11 Let l(t) = -t2 - 11t - 13. Let b be l(-9). Suppose bn + m = 535, -n + 5m + 86 = m. Suppose -3k - n = -376. What is k rounded to the nearest 100? 100 Suppose -4y + y = 617709. Let g = -138903 - y. Round g to the nearest ten thousand. 70000 Let l = -455.2 + 459.541. Let j = 134.069 + l. Let y = -139 + j. Round y to 1 dp. -0.6 Suppose -5d = c - 199975, 4d - 2d + 10 = 0. What is c rounded to the nearest one million? 0 Let p = -197 - -204.65. Let n = p - 6.366. Let x = 1.2 - n. What is x rounded to two dps? -0.08 Let y = -3.03 - -2.16. Let x = -0.869939 - y. What is x rounded to five decimal places? 0.00006 Let z = 70 - 50. Let i = z + -19.99983. Round i to 4 dps. 0.0002 Let p = -17560 - -17558.90045. Let k = -8 + 9.1. Let m = k + p. Round m to four dps. 0.0005 Suppose 5t - 15 + 0 = 0. Let c(d) = -61d3 + 4d*2 - 2d - 3. Let a be c(t). Round a to the nearest one hundred. -1600 Let d = 5 - 5.1. Let t = d + -0.2. Let i = 0.300002 + t. Round i to 5 dps. 0 Let s = 2 + -1.85. Let r = s + -0.7. What is r rounded to 1 dp? -0.6 Let w = 0.03 + -0.03. Let c = -0.033 + w. Round c to two dps. -0.03 Let m = -50 - -132. What is m rounded to the nearest 10? 80 Let i = 749.9 - 821. Round i to the nearest ten. -70 Suppose -r + 374 = 3u, -5r + u + 1960 = -2u. What is r rounded to the nearest ten? 390 Let r(g) = g3 - 8g*2 + 6g + 11. Let d be r(11). Let j be (-1750)/((-1)/d1). What is j rounded to the nearest one hundred thousand? 800000 Suppose 0x + 3g = 2x - 19, 4x + 4g + 12 = 0. Suppose 4w + 20400000 = xz, -2w - 5z = -5w - 15300000. Round w to the nearest one million. -5000000 Let o = -58 + 59. Round o to the nearest 10. 0 Suppose -2u = 3u + 5. Let z = u + 0. Let b be z/4 + (-8002)/(-8). What is b rounded to the nearest 1000? 1000 Let g = 1153.9999391 + -1154. What is g rounded to five dps? -0.00006 Let i = 158 - 92. Let f = 224 - i. Let n = 158.0000069 - f. Round n to 6 decimal places. 0.000007 Let k = 40951.6098 - 40964. Let d = 12.4 + k. Round d to 3 decimal places. 0.01 Let c be 157461(-1 - -5). Suppose -2i + 242984 - c = 0. What is i rounded to the nearest ten thousand? 90000 Let p = -42 + 46.6. Let u = -4.66301 - -0.01401. Let c = u + p. What is c rounded to two dps? -0.05 Let i = 3265 - 6558.264. Let o = -3293.4239983 - i. Let u = -0.16 - o. What is u rounded to 6 dps? -0.000002 Let h = -1504.469 - -1507. Let p = h + -0.071. What is p rounded to 1 decimal place? 2.5 Let c = -54 - -23. Let z = -10.6 - c. What is z rounded to zero dps? 20 Let q(l) = -64573l + 6. Let g be q(-9). Suppose g - 8053 = 5j. Suppose -j - 129378 = 4m. What is m rounded to the nearest 10000? -60000 Let z = -434 - -434.00173. Round z to 4 dps. 0.0017 Let i = 213.6876 - 173.68. Let z = i + -40. What is z rounded to three dps? 0.008 Let w(v) = -2v*3 + 7v*2 + v + 1. Let n be w(-6). Suppose 4d - n = 9461. Suppose -z - 3065 = d. What is z rounded to the nearest 1000? -6000 Suppose r - 2r + 11 = 0. Let c be 1319999980/(-110) + (-2)/r. What is c rounded to the nearest 1000000? -12000000 Let j be (-632)/(-5) + -6(-5)/(-75). What is j rounded to the nearest 100? 100 Suppose -3g + s + 70636 = -152797, 0 = 3g - 2s - 223432. Let x = -187478 + g. What is x rounded to the nearest ten thousand? -110000 Suppose 44219 = 4l - 63781. Let q = 0 - -4. Suppose -qp + p + l = 0. Round p to the nearest one thousand. 9000 Let x = -6199 + -34301. What is x rounded to the nearest 1000? -41000 Let k(i) = 0i*2 + i + 15i*2 - 8i*2 - 6i*2 + 8000. Let q be k(0). Round q to the nearest ten thousand. 10000 Suppose -b = 2p + p + 87, 88 = -b - 2p. Let s be (-1 - (-480009)/9)b. Round s to the nearest 1000000. -5000000 Suppose 3p - 2v + 6 = 5p, -4 = 4v. Suppose pq + 2r + 33510 = -q, -3q + 3r - 20085 = 0. Let z = 2300 - q. Round z to the nearest 10000. 10000 Let u = 61.3 + 13.7. Let k = 25 - u. Let d = k - -49.58. Round d to 1 dp. -0.4 Let s = 15.049 + -15. Let b = 0.0490031 - s. What is b rounded to 6 dps? 0.000003 Let k = 7 + -7.02. Let j = k - 0.017. Let u = -0.0369977 - j. Round u to six dps. 0.000002 Let k = -18.000034 + 18. Round k to five decimal places. -0.00003 Let l = 23.012 + -0.012. Let x = -40366.44666941 + 40389.44667. Let y = l - x. Round y to 7 decimal places. -0.0000006 Suppose 5a - 106000 = 6a. What is a rounded to the nearest 10000? -110000 Let i = 0.31799869 + -0.318. What is i rounded to seven dps? -0.0000013 Let v = 165188833 + -165188806.19845506. Let x = -26.101545 + v. Let p = -0.7 + x. Round p to 7 decimal places. -0.0000001 Let m = -3.121855 - -3888.963855. Let j = 3940.9 - m. Let b = j - 55. Round b to 2 decimal pl	{ "pile_set_name": "DM Mathematics" }
/105. What is the remainder when 44 is divided by (-15)/6(x/10)/c? 5 Suppose 3f + 5r = -f + 36, 0 = -6f - 2r + 54. Calculate the remainder when 1330 is divided by f. 7 Suppose -9i + 3w + 482 = -5i, w + 597 = 5i. What is the remainder when i is divided by 24? 23 Suppose -314 = -5q - 4r + 498, -4r = -32. What is the remainder when 2615 is divided by q? 119 Suppose 52w = 10w - 9w + 3060. What is the remainder when 226 is divided by w? 46 Suppose 0 = -m - 3, -5m - 712 = -4b + 1707. Suppose 52n - b = 23. Calculate the remainder when 65 is divided by n. 5 Let z(w) = -201w + 2738. Calculate the remainder when z(-76) is divided by 21. 17 Let x = -122 + 130. Let c(z) = z2 + 10z + 8. Let j be c(-9). Calculate the remainder when 1/j(1 + -32) is divided by x. 7 Suppose -526 = 7q + 55. Let p = q + 83. Suppose -x + 47 = -px. Calculate the remainder when 185 is divided by x. 44 Let l = -3708 - -3721. Calculate the remainder when 2610 is divided by l. 10 Suppose 44501 = -246m + 157169. What is the remainder when 1856 is divided by m? 24 Suppose -2g = h + h - 20, 0 = -5g + 20. Let f be -4 - (52 - h/3). Let x = f - -62. Calculate the remainder when x is divided by 4. 0 Let a = -271 + 148. Let o = 147 + a. What is the remainder when 82 is divided by o? 10 Suppose 174 = -3i - 9. Let f = i + 64. Suppose -fr + 2x + 50 = -0x, -2r - 5x = -65. What is the remainder when 77 is divided by r? 17 Let b(j) = 3j2 + 4j + 15. Let x be b(6). Let c = x + -111. What is the remainder when 87 is divided by c? 15 Let z be 5(36/(-10))/(-3). Let g be (-2)/(-6) - 80/(-12). Suppose -gv + zv = -99. Calculate the remainder when v is divided by 25. 24 Let b be 7/(-7)(-1 + -21). Suppose -312 = 10f - bf. What is the remainder when 43 is divided by f? 17 Let m = -453 - -506. Let q = 959 + -642. Calculate the remainder when q is divided by m. 52 Let m(h) = -5h + 741h*2 + 9h + 6 - 742h2 - 14 + 12h. Calculate the remainder when 170 is divided by m(7). 5 Let d(u) = 3u2 - 4u + 4. What is the remainder when d(4) is divided by 26/(13/(-78)-26)? 10 Let v(y) = -2y2 + 9y + 42. Let p = 52 + -39. Let w be v(p). Let a = -69 - w. Calculate the remainder when a is divided by 16. 14 Suppose 0 = 368m - 67m - 399395 + 12911. Calculate the remainder when m is divided by 28. 24 Suppose -94w = -7w - 7743. Calculate the remainder when w is divided by 4. 1 Let a be 4/120-5 - 707/6. Let j = 124 + a. What is the remainder when 34 is divided by j? 4 Let w = -5825 - -5959. Calculate the remainder when w is divided by 24. 14 Let g(h) = h3 - 68h*2 - 66h - 178. Calculate the remainder when 200 is divided by g(69). 26 Suppose 0 = -3t - 5p + 41, p + 5 - 16 = -t. Let g(s) = 32s - 123. Calculate the remainder when g(t) is divided by 41. 19 Suppose -2g = -3a + 28 + 27, 3a = 4g + 53. Let u(n) = 2n*3 - 6n*2 + 73n - 397. Calculate the remainder when u(5) is divided by a. 11 Let p be (-1)/((-14)/20)-21. Let c = p - -79. Calculate the remainder when 242 is divided by c. 46 Let g(p) = 2p*2 + 23p + 10. Suppose -20x = -13x + 35. What is the remainder when x/(-1) - 2 - 768/(-6) is divided by g(-12)? 21 Let f(a) = a*3 + 8a*2 + 11a - 2. Let i = -186 + 109. Let v = -82 - i. What is the remainder when f(v) is divided by 5? 3 Suppose 265 = 6q + 55. Suppose -25o + qo = 5140. Calculate the remainder when o is divided by 43. 41 Let v(o) = -5o*3 - 7o*2 - 4o - 3. Let q(p) = -p*2 + 10p. Let s be q(8). Suppose 0 = sk - 12k - 56. What is the remainder when v(-3) is divided by k? 11 Let c(w) = -w + 10. Let g be c(10). Suppose g = d - 15. Let r = -3015 + 3070. What is the remainder when r is divided by d? 10 Let c be -1262044/8. What is the remainder when 68 is divided by (-1 - 2/6) + c/(-219)? 10 Let w = 155 - 148. Suppose y = 1, wa - 3a - 3y = 569. Let c(j) = 4j*2 - 6j - 4. What is the remainder when a is divided by c(4)? 35 Let r = -38 - -78. Calculate the remainder when 2 - -45(0 - -2) is divided by 0 + (r + -4 - 5). 30 Let g(y) = 2y*3 - 2y2 - y - 4. Let z be ((-3)/(-2))/((-35)/(-10) + -3). What is the remainder when g(z) is divided by (0 + 3)/((-30)/(-80))? 5 Let a(u) = -u2 + 13u + 234. Let r be a(36). Let f = r - -602. Calculate the remainder when 14 is divided by f. 6 Suppose -12q = -6q - 24. Calculate the remainder when q is divided by 658/752 - 1/(-8). 0 Suppose -2u = -4b - 57 + 21, 0 = -3u + 5b + 59. Calculate the remainder when 2263 is divided by u. 23 Let h be ((-4)/2)/(4/(-38)). Suppose 5k + h - 120 = -3s, -2k = 10. What is the remainder when s is divided by 17 - 1/1 - 1? 12 Let o(x) = x*2 - 9x + 6. Let w be o(5). Let u be 54/w + (-5)/35. What is the remainder when 66 is divided by 120/u(-2)/5? 6 Let u(z) = -7z + 2. Let d(l) = -l. Let f(q) = -34d(q) + 6u(q). What is the remainder when 214 is divided by f(-3)? 34 Let c be (6/8)/(2/24). Let k be 21/c + (-3)/9. Let z(v) = 17v + 2. What is the remainder when 142 is divided by z(k)? 34 Suppose 5u - 1 = 2x, -5 = -x - 6u + 3u. Suppose 2r - xf = -304 - 42, 2r = 3f - 345. Let w = -111 - r. Calculate the remainder when w is divided by 23. 17 Let t(c) = -5c + 36. Let b be t(6). Suppose 0 = -bn + 187 + 113. Calculate the remainder when n is divided by 9. 5 Suppose -2i - 2b + 510 = 2b, 4b + 1056 = 4i. Suppose 2z + t - 204 = -z, 5t - 96 = -z. What is the remainder when i is divided by z? 63 Suppose 53p - 128 = 49p - 4h, 130 = 4p + 2h. What is the remainder when 97 is divided by p? 31 Let s(t) = -t2 - 30t - 153. Let i = 727 - 745. What is the remainder when 131 is divided by s(i)? 5 Suppose 177 = 5n - 133. Suppose -11v = -9v - 31 - 339. What is the remainder when v is divided by n? 61 Calculate the remainder when 119/17 - (2 + 6) - -897 is divided by 23. 22 Let b = 71491 + -71420. Let d(w) = -3w*3 + 5w*2 + 9w - 6. Calculate the remainder when d(-7) is divided by b. 69 Let y(u) be the third derivative of u*6/120 + 3u*5/20 + 5u*4/24 - 29u*3/6 + 44u*2 - 2. What is the remainder when 66 is divided by y(-7)? 32 Suppose -70a = -60a - 120. What is the remainder when 587 is divided by a? 11 Let q = 1981 - 1761. What is the remainder when q is divided by 172? 48 Let u(t) = 25t - 106. Calculate the remainder when u(61) is divided by 470. 9 Let g = 54 + -10. Let u = -10 - -15. Suppose -us = -2s - 48. What is the remainder when g is divided by s? 12 Let n be (-3 - 2)(-3)/(-5). Let d be (9 + 0)/(13/n). What is the remainder when ((-21)/9)/((-4)/(-16))d is divided by 13? 6 Let j = -2477 - -2518. What is the remainder when 530 is divided by j? 38 Let j = -12 + 18. Let h(g) = -7g + g - g*2 + 21 - 17 + 0g. Calculate the remainder when j is divided by h(-6). 2 Let a(u) = -35u. Let w be a(0). Suppose w = -4k - v + 167, 28 = 5k + 5v - 162. Calculate the remainder when 145 is divided by k. 16 What is the remainder when 1491 is divided by 6 - 16/(112/(-21))? 6 Suppose -3b = -883 - 3812. Calculate the remainder when b is divided by 14. 11 Let u = 32580 - 31955. Calculate the remainder when u is divided by 37. 33 Let v(p) = 5p - 1. Let f(j) = -j*2 - 7j + 7. Let q be f(-6). Let k be v(q). Suppose 9c - 8 = k. What is the remainder when 13 is divided by c? 5 Let m be 21 - (-3 - 366/6). Suppose 4d = -0d. Suppose 0 = -dc + 3c - m. What is the remainder when 42 is divided by c? 20 Suppose -25c - 754 + 2204 = 0. What is the remainder when 2897 is divided by c? 55 Suppose 4h + 4 - 21 = 3q, -h + 8 = 3q. Suppose 4o = -q + 45. What is the remainder when 90 is divided by o? 2 Let f(z) = 9z*2 + 3z + 264. Let k = -4 - -18. What is the remainder when f(0) is divided by k? 12 Let u(b) = -b*3 + 13b*2 + 32b - 107. What is the remainder when u(11) is divided by 48? 7 Let n be -417317/(-84). Let j = n + -571. What is the remainder when 1(-2)/6-51 is divided by j? 5 Suppose 298 = 3c - 4a, 5c - 5a - 635 = -130. Calculate the remainder when 1752 is divided by c. 56 Suppose 4z = 10z - 570. Let y = z - 99. What is the remainder when 1323/(-6)*y/6 is divided by 37? 36 Let r be -3 - (3 + (-52 - 5)). Let i = 53 - r. Suppose 2 + i = q. What is the remainder when 15 is divided by q? 3 Let f = 5478 - 1633. Calculate the remain	{ "pile_set_name": "DM Mathematics" }
st the prime factors of g. 47 Suppose 19 - 24 = 5h. Let r(s) be the third derivative of -49s4/24 + s3/3 + 6s2. What are the prime factors of r(h)? 3, 17 Let z = 768 + -279. List the prime factors of z. 3, 163 Let j(s) = s2 - 6s + 1. Let g be j(7). Suppose gf - 287 = 73. Suppose -2w + 3d = -129, 2d - f = -w - 3d. List the prime factors of w. 2, 3, 5 Let t = 33 + -24. Suppose -t - 35 = -2k. Suppose 8a = 6a + k. List the prime factors of a. 11 Suppose -5m + 100 = -0m. Suppose -33 = 8q - 5q. Let y = q + m. What are the prime factors of y? 3 What are the prime factors of -459(-1)/4 + 1/4? 5, 23 Suppose -3t = 3q + 2t + 52, -5q - 92 = 3t. Let w = q + 43. What are the prime factors of w? 2, 3 Let t = 19 - -5. Let y be (11/(-1) - 0)/(3/(-6)). Let i = t - y. List the prime factors of i. 2 Suppose 69 = -2a + 5a. Suppose 10 = g - a. What are the prime factors of g? 3, 11 Suppose 5b - 370 = -5t, -3b + b + 4t = -154. Suppose b - 63 = j. List the prime factors of j. 2, 3 Suppose -5b + s - 2s = -33, 4b + 2s = 30. Let g(h) be the first derivative of 2h2 + 6h + 4. List the prime factors of g(b). 2, 3, 5 Let z = -3 - -7. Suppose -5k = -4v + 174, -zk + k - 3v = 126. List the prime factors of k/(-6) - (-3)/(-9). 2, 3 Let h(b) = -b*3 - 9b*2 - 3b + 19. Let d be h(-6). Let a = 75 - d. What are the prime factors of a? 2, 73 Suppose 2t = -2i + 2149 + 971, 0 = -4t - 2i + 6244. List the prime factors of t. 2, 11, 71 Suppose 0 = -0m + 6m + 72. Let l be ((-8)/m)/(1/3). Suppose 3g = -lc - c + 108, -c + 70 = 2g. List the prime factors of g. 2, 17 Suppose 5d + 2m = 15, 5d - 31 = -5m - 1. What are the prime factors of 17 - 19 - (-32)/d? 2, 3, 5 Suppose 101j - 2391 = 98j. What are the prime factors of j? 797 Let v = -1731 + 3002. List the prime factors of v. 31, 41 Let m = -16 - -18. Let o(y) = y + 5y - 4y - 3 + 7ym - 1 + y3. List the prime factors of o(-4). 2, 3 What are the prime factors of (26/10 + -3)(15 - 1565)? 2, 5, 31 Let l(z) be the first derivative of z4/4 - 3z*3 + 7z*2/2 - 3z - 17. What are the prime factors of l(9)? 2, 3, 5 Let l(w) = -97w3 + 6w*2 + 4w - 5. Let b(s) = s3 + s2 + s - 1. Let r(n) = 6b(n) - l(n). List the prime factors of r(1). 2, 13 Suppose -3c = -2 + 14. What are the prime factors of (-4044)/(-27) + c/(-18)? 2, 3, 5 Let r = -120 + 597. What are the prime factors of r? 3, 53 Let s(v) = 6499v2 + 2v + 1. Let y be s(-1). What are the prime factors of 24/15 + -2 - y/(-45)? 2, 3 List the prime factors of (-438)/15520/(-16). 13, 73 Let k = 2 - -8. Let u(t) = -t3 - 10t*2 + 6t - 8. Let b(m) = -m*3 + m + 1. Let f(x) = -2b(x) + u(x). List the prime factors of f(k). 2, 3, 5 List the prime factors of (8304/(-9) - -2)/(57/(-171)). 2, 1381 Suppose -5q - 50 = w - 6w, 3q + 2w + 55 = 0. Let a be (1 - 21/q)5. Let r = a - -21. What are the prime factors of r? 3, 11 Let y(l) = l3 - l2. Let f be y(2). Suppose -4o + 4p = -40, -2o = 3o - fp - 52. List the prime factors of o. 2, 3 Let q(s) = -152s + 88. What are the prime factors of q(-10)? 2, 3, 67 Suppose h = -4c - 28, -2h = -2c - h - 8. What are the prime factors of 58(-4)/(c/3)? 2, 29 Let o(m) = -25m*3 + 3m*2 + m + 18. Let t(p) = 13p*3 - 2p*2 - 9. Let s(n) = 3o(n) + 5t(n). What are the prime factors of s(-3)? 3, 29 Suppose -56d = -62d + 1728. List the prime factors of d. 2, 3 Suppose 3g + 2 = 4m, 0 = g - 6g + 4m + 10. Suppose 31 = go - 5o. List the prime factors of o. 31 Let o(u) be the first derivative of 5u*2/2 + 41u + 1. List the prime factors of o(18). 131 Let n be (13 - (-1 - -4)) + 5. What are the prime factors of 6/n + 1866/10? 11, 17 Let c(f) = -f*3 + 3f*2 + f + 2. Let n be c(3). Suppose p + n = 211. List the prime factors of p. 2, 103 List the prime factors of 6/(-57) - (-50328)/152. 331 List the prime factors of 2 + 77/(-44) + (-9561)/(-12). 797 Let p(n) = 135n + 637. What are the prime factors of p(18)? 3067 Let p = -12 - -11. Let y be (0 - p - 0)-1. What are the prime factors of y(-3)/(-3) - -33? 2 Let b(g) = g + 136. Let q be b(0). Suppose d - 6v = -2v + 61, v = 2d - q. List the prime factors of d. 3, 23 Let d(g) = 0g*2 + 5 + 2g*2 + 2g*2 - 11g - 1. Let v be d(4). What are the prime factors of (v/14)/(8/252)? 2, 3 Let m = 523 + -151. What are the prime factors of m? 2, 3, 31 Let v be (-4)/(-3)18/4. Suppose 0 = vp - 2p - 36. What are the prime factors of (6/p)/((-6)/(-63))? 7 Let p = -35 + 40. Suppose 460 - 85 = pd. What are the prime factors of d? 3, 5 Suppose -2l - 4a + 50 = 0, 4a - 112 = -4l - a. Let f = 38 - l. List the prime factors of 332/f - (-3)/5. 67 Suppose -z - 2 = 5. Let q(m) = m*3 + 7m*2 - 15m + 6. What are the prime factors of q(z)? 3, 37 Let b be (48/(-15))/(4/(-10)). Let c = b - 14. What are the prime factors of 8/(-3)1c? 2 Let b(g) = -2g2 + 11g + 1. Let v be b(8). Let h = -34 + -26. Let p = v - h. What are the prime factors of p? 3, 7 Let d(h) be the second derivative of -7h3/2 - 9h*2/2 + 21h. What are the prime factors of d(-3)? 2, 3 What are the prime factors of (-7 - -8 - (-4 + 3))1351? 2, 7, 193 Suppose -7q + 2039 - 492 = 0. Let t = q - 1306. What are the prime factors of (-2)/(t/(-365) - 3)? 73 Let x(h) = 6h - 21. Let i be x(4). Let f(o) = 11o + 13. List the prime factors of f(i). 2, 23 Suppose 5b = 8 - 48. Let q = b - -13. Let x(k) = -k2 + 6k - 1. List the prime factors of x(q). 2 Suppose -4r - r = -4p - 479, 0 = -4r + p + 381. Let k = r + -55. What are the prime factors of k? 2, 5 Suppose 2x - 2z + 199 = -3z, 5z + 490 = -5x. Let q = x + 238. List the prime factors of q. 137 Let k(f) = f - 7. Let b be (3 - 1)(3 + -1). Let s be k(b). List the prime factors of 1 - s - 6/(-3). 2, 3 List the prime factors of 3445 - -1(-104)/13. 7, 491 Let a be 52/(-6)(4 - 7). Suppose 4v - 154 - a = 0. List the prime factors of v. 3, 5 Suppose -h + 134 = -0h. Suppose -834 = -5u - h. What are the prime factors of u? 2, 5, 7 Suppose 0 = j + 2i, -4 = 5i + 6. Suppose 5m - f = 3f + 150, jf - 6 = -m. What are the prime factors of m? 2, 13 Let q(i) = 5i*3 - 4i*2 - 4. Let x be q(3). Suppose 3b = -2b - x. Let y = b - -47. List the prime factors of y. 2, 7 Suppose 5w - 12 - 250 = -2u, -3u = -2w - 431. List the prime factors of u. 3, 47 Suppose -1216 - 998 = -9h. What are the prime factors of h? 2, 3, 41 Let q(z) = 3z + 2z + z*2 - z + z - 2. Let p be q(-6). Suppose -12 = -4c + pl - 0l, 0 = 3c + 5l - 33. What are the prime factors of c? 2, 3 Suppose -19u + 168 = 2u. Suppose 0 = -3f - 2r + 1, 31 = 7f - 2f - 4r. List the prime factors of (-2)/f(-324)/u. 3 Let f be (120/(-21) - 0)7/(-2). Suppose 0 = 76c - 80c + f. What are the prime factors of c? 5 Suppose -5b + 10b = -20. Let m(o) = -2o - 3. Let j be m(b). Suppose jd + c = 169, d - c = 18 + 11. List the prime factors of d. 3, 11 Let l = 104 + -148. Let i = l - -74. What are the prime factors of i? 2, 3, 5 Let t be ((-9)/4)/((-3)/72). Let g = 97 - t. Suppose 0 = -i - 4 + g. What are the prime factors of i? 3, 13 Let f(w) = w3 - 7w*2 + 8w + 1. List the prime factors of f(6). 13 Suppose -1040 = -3l - 200. Suppose 4m = -4d + l, 2d = -2d - 5m + 280. What are the prime factors of d? 2, 5, 7 Suppose 230 = o + g - 245, -2g = 5o - 2378. What are the prime factors of o? 2, 7, 17 Let u(t) = -50 - 9t + 10 + 2t. What are the prime factors of u(-22)? 2, 3, 19 Let j(y) = -4y + 19. Let r be j(0). Let k(a) = a3 - 20a*2 + 20a - 16. Let n be k(r). Suppose -nh + 4 = -2h. List the prime factors of h. 2 Suppose 8a - 3 = 9a. What are the prime factors of a - -2 - (-1 - 22)? 2, 11 Let z = -2210 - -5191. List the prime factors of z. 11, 271 Suppose -f - 5 = -0. Let k = f - -7. Suppose 39 + 1 = kh. What are the prime factors of h? 2, 5 Suppose -150u = -136u - 17668. What are the prime factors of u? 2, 631 Suppose s - 3v - 673 = 0, 767 = 2s - 2v - 567. What are the prime factors of s? 2, 83 Let n = 31 - 79. List the prime factors of (1 - 6/4)n. 2, 3 Let c = -1074 - -2982. What are the prime factors of c? 2, 3, 53 Suppose j - 11 = -s, -2j + 0s - s = -19. Let o(k) = k3 - 9k*2 - 8k - 4. Let g be o(j). What are the pri	{ "pile_set_name": "DM Mathematics" }
- 2f. Let d(y) = 2y*2 - 11y + 13. Let a(k) = -k + 1. What is the least common multiple of d(i) and a(-5)? 114 Suppose -g + 32 = -3k, -20 = -0k + 5k. Suppose -5u = -3x + 35, 0u + 13 = x - 2u. Suppose xq - q = 64. Calculate the least common multiple of g and q. 80 Let a be (-1 + -20)(-11)/33. Suppose -ax + 4x = 108. What is the common denominator of 17/5 and ((-9)/(-12))/(x/776)? 30 Let d(f) = 2f + 25. Let c(h) = -h*2 - 3h + 10. Let b be c(3). Calculate the least common multiple of 10 and d(b). 90 Let d be 9(-2 + 7/3). Suppose 2q + 4a = 66, -dq + 7q - 80 = 5a. Let g = -72019/14 + 5147. Find the common denominator of q and g. 14 What is the smallest common multiple of 196(10/(-15))/(14/(-36)) and 63? 1008 Let x = 623/5 + -7301/60. Let f = -4889/248 - 9/248. Calculate the common denominator of x and f. 12 Let x = -587/210 - -2/21. Let t = -2500 - -823. Let g = t - -8328/5. Find the common denominator of g and x. 10 What is the common denominator of -61/6 and 1890/(-7776) + 1/(-16)? 36 Let s be -3 - (-17 + 8/2). Calculate the lowest common multiple of 3 and (0 - 25)/(-5) + s. 15 What is the common denominator of (-5 - (-32)/6) + -5 and 31/216? 216 Suppose 3t - 1 = 32. Let l = -31 + t. What is the lowest common multiple of (24/l)/(3/(-50)) and 18? 180 Let o(v) = -15v2 + 3v - 2. Let b be o(-3). Let m = b + 986/7. Find the common denominator of m and (-10)/35 - ((-190)/77 - 2). 77 Let q = -11 + 11. What is the least common multiple of 6 and (-1)/(q - 1/11)? 66 Let l = -43/3 - -145/9. Calculate the common denominator of l and -41/186. 558 Suppose 3i + 2i + n = -47, 0 = -i - 4n + 2. Let x = i + 14. Let f(s) = -s2 - 5s + 8. What is the smallest common multiple of x and f(-6)? 4 Let y(d) = 17d + 246. Calculate the smallest common multiple of y(-9) and 93. 93 Suppose 4b - 5n - 239 = 0, 2b = n + 63 + 52. Calculate the smallest common multiple of b and 26. 728 Let l = 81323843/12 - 6758740. Let g = l + -18257. Find the common denominator of g and 71/18. 36 What is the lowest common multiple of 65 and (-30)/168-292 - (-2)/(-14)? 260 Let f = -29486 - -3184433/108. Find the common denominator of f and 80/21. 756 Let h(g) = -11g - 105. Calculate the smallest common multiple of h(-25) and 12. 1020 Let g = -7 + 51. What is the least common multiple of g and 12? 132 Let u be (-10)/(-20) + (-3)/(-2). Suppose -ui + 3 = -1. Let r = 70 + -50. What is the lowest common multiple of i and r? 20 Let y = 38645/12 + -3214. Let o = 8617 - 181012/21. What is the common denominator of y and o? 84 Suppose 223 = o + 235. Calculate the common denominator of -143/246 and o. 246 Suppose -8d + 3v = -6d - 97, 0 = 4d - 3v - 185. Calculate the smallest common multiple of d and 12. 132 Let v = 1081 - 6457/6. Let w = -2143/126 - -142/7. What is the common denominator of v and w? 18 Suppose -15b = 11b - 4b - 44. Suppose -2i + d - 9 = -23, -2 = -d. What is the smallest common multiple of i and b? 8 Suppose -28w + 2108 + 43420 = 0. What is the least common multiple of 2 and w? 1626 Suppose 2g + 3 = 3g. Suppose -x - 2p + 7 = 0, 0x + 17 = 4x - gp. Suppose -xy + 18 = -22. Calculate the least common multiple of 8 and y. 8 Suppose -2s - 8 = -j, 2j + 6s - 2 = 3s. Suppose -3a = -2a - j. What is the least common multiple of 16 and a? 16 Let u(j) = 52j + 4. Let p be u(3). Find the common denominator of ((-26)/65)/(6/p) and 61/2. 6 Let i(b) = b2 + 21b + 10. Let c be i(-21). Calculate the common denominator of (-6)/15150/14 and c5/270 - 3. 189 Suppose 0 = -1667g + 1659g + 880. Calculate the lowest common multiple of 190 and g. 2090 Suppose 4q + w + 305 = 8q, 4w = -4q + 320. Calculate the least common multiple of 49 and q. 539 Let r = -1 + 13. Let t be (-1176)/(-36) + (-2)/(-6). Suppose 8b = t + 79. What is the least common multiple of r and b? 84 Suppose 0 = -5r - 4f + 14, 24r + 20 = 28r + f. What is the least common multiple of 3 and r? 6 Let n(q) = q2 + 27q - 102. Calculate the lowest common multiple of 4 and n(-31). 44 Let p(b) = -b3 + b2 - b. Let z be p(-3). Find the common denominator of z/(-60)36/33 and 1/45. 495 Suppose 21x + 67 = 23x + u, -3u = 4x - 129. What is the smallest common multiple of 282 and x? 1692 Let i = -4/91 - 3541/182. Calculate the common denominator of i and 39/20. 20 Let b = -22 + 54. Let n = 6 - b. Let o = n - -48. Calculate the least common multiple of o and 22. 22 Let r(y) = -y3 - 29y*2 + 31y + 44. Let a be r(-30). Calculate the smallest common multiple of 4 and -251(-2)/a + 5/35. 36 Calculate the least common multiple of -3(-2 + 55/11) + 51 and -62/3-2. 168 Calculate the common denominator of -57/28 and (2952/(-154))/4 - 132/(-33). 308 Let y = -283405919/171294 - 2/85647. Let z = y - -14849/9. Calculate the common denominator of ((-1)/(-12))/((-3)/(-74)) and z. 18 Suppose -3w - t + 14 = 0, 0w + 12 = 2w + 2t. Let b = w + -2. What is the smallest common multiple of (0 - b)8/(-4) and 12? 12 Suppose -18 - 66 = -4k. Let t = 13 - k. Let c = -5 - t. What is the smallest common multiple of 7 and c? 21 Suppose 0 = -2s - 141 + 41. Let l = s + 71. Calculate the common denominator of l/(-6) + 2/(-3) and 51/14. 42 Suppose 3p - 6 = 0, -t - 4p + 6 = -2t. Let c(v) = 2v2 - 5v + 3. Let y be c(1). Let g = t + y. What is the lowest common multiple of 3 and g? 6 Find the common denominator of -149/882 and (8 - (-819)/(-104))(-452)/(-3). 882 Let z = 8699/7964 + -1/724. Let d be (2 - 4)/(-1) + -72. Calculate the common denominator of (1/3)/(d/408) and z. 385 Let u = -236/859 + 107321/206160. What is the common denominator of u and 113/138? 5520 Let f = 20/969 + -58313/149226. What is the common denominator of f and 3/8? 616 Let i = -502 - -507. What is the lowest common multiple of 40 and i? 40 Suppose -3v + 750 = 7x, -3x = 6v - 10v + 963. Calculate the lowest common multiple of v and 33. 2673 Let u = 20469/14 + -1460. Find the common denominator of u and ((-166)/(-6))/((-16)/6). 56 Let i = -3 - 5. Let a = 22 + i. What is the least common multiple of -1 + 1 - 17/((-51)/30) and a? 70 Suppose -8c = -261 + 69. What is the common denominator of 13/14 and 4/14450/c? 14 Suppose 2n + 0n - 20 = -4u, -4n + 3u - 4 = 0. Suppose -3b = nb - 80. What is the common denominator of 0 and b? 1 Let g = -1049627/48 - -21868. What is the common denominator of -37/18 and g? 144 Suppose -5b + 2s + 214 = 0, s - 38 = -5b + 170. Calculate the smallest common multiple of 91 and b. 546 Let x be 18/2 - (11 - 14). Suppose x + 8 = 5z. Let v(a) = a + 2. Calculate the lowest common multiple of v(z) and 1. 6 Calculate the least common multiple of 60 and (8/(-6))/((-114)/855). 60 Calculate the common denominator of 119/18 and (-21)/(-144)26 - -2. 72 Suppose 0 = -2w + 4, 4v + 6w = 8w + 12. What is the smallest common multiple of ((-2 - -6) + -1)2 and v? 12 Calculate the lowest common multiple of 1310 and 9/1 - (-675)/75. 11790 Let m = -183343806607/115644 + 36464738/23. Let k = 2/1257 + m. Let u = -370931/125780 - 6/6289. What is the common denominator of u and k? 20 Let c be -1 + -2 + 2 + 1. Suppose -4k + 108 = -ck. Suppose k = 3l - 3s, l + 0l - 1 = 5s. Calculate the smallest common multiple of 6 and l. 66 Suppose 3j + z = 4, 9 = 5j - 4z - 9. Let f(n) = n*3 + 2n*2 - 5. What is the least common multiple of f(j) and ((-4)/6)/((-3)/27)? 66 Let k = -74 - -13. Let a = k + 91. Calculate the lowest common multiple of 9 and a. 90 Let m = 9200/21 - 437. Find the common denominator of m and -53/27. 189 Let v = 121 - 109. Let u = 1 + -1. What is the smallest common multiple of v - (2 + u/1) and 6? 30 Let h be (2/10)/((-12)/303130). Let b = h - -5065. Calculate the common denominator of 85/158 and b. 474 Let f = -1039639/35 - -29702. Calculate the common denominator of f and -41/7. 35 Let q be -6 + -3 - 23920/(-32). Let u be -716 - 1(0 - 1). Let d = q + u. Calculate the common denominator of 45/11 and d. 22 Suppose -3f - 316 + 286 = -5w, 2w - 5f = -7. Calculate the least common multiple of 48 and w. 144 Let m(j) = j*3 - 11j*2 + 14j - 14. Let t be m(10). What is the lowest common multiple of 11 and (-1 + 0)/(t/(-520))? 220 Calculate the common denominator of 0 - 1*(-102)/16 a	{ "pile_set_name": "DM Mathematics" }
-207a3 + 2a*2 - 6a - 5. Let o(p) = 623p3 - 7p*2 + 16p + 14. Calculate 8h(f) + 3o(f). 213f3 - 5f*2 + 2 Let a(g) = 1190g*2 + 13g - 4 - 2382g2 - 12g*3 + 77g*3 + 1192g*2. Let c(b) = -32b*3 - 6b + 2. What is 6a(o) + 13c(o)? -26o3 + 2 Let p(m) = m3 - 3m*2 - 9. Suppose -8 = -3j + 4b, 3j - 3b - 17 = -2j. Let w be p(j). Let n(r) = -8r + 4. Let i(u) = -9u + 5. Give wn(d) - 6i(d). -2d - 2 Let j(i) = 9i*3 - 177i*2 + 4i - 6. Let m(o) = 8o3 - 158o*2 + 3o - 5. What is -5j(b) + 6m(b)? 3b3 - 63b*2 - 2b Let m(h) be the third derivative of -3h4/8 - h3 + 18h*2. Let x(d) = -47d - 203. Let r(y) = 31y + 128. Let z(a) = 8r(a) + 5x(a). Give 7m(q) + 5z(q). 2q + 3 Let s(i) be the third derivative of -i6/120 + i4/6 - 7i3/6 - 5i*2 + 2i + 39. Let j(p) = 2p3 - 3p + 6. Calculate -5j(x) - 4s(x). -6x3 - x - 2 Let z = 11 - 23. Let j = 16 + z. Let v(l) = 2 - 7l + 5 - 12 + 8. Let y(r) = 6r - 2. What is jy(d) + 3v(d)? 3d + 1 Let a(j) be the second derivative of j5/20 - j4/6 - j*3/2 + 4j + 172. Let p(d) = -2d2 - 4d + 1. Give 4a(n) - 3p(n). 4n3 - 2n*2 - 3 Let s(d) = 3d*2 + 1. Let a(p) be the first derivative of 4p*3/3 + 2p + 5397. What is -5a(i) + 6s(i)? -2i2 - 4 Let b be 658/(-6) + 23/(-69). Let g = 99 + b. Let m(k) = 3k - 6. Let r(j) = j + 1. Let y(l) = m(l) + 5r(l). Let c(t) = -23t + 3. Determine gy(q) - 4c(q). 4q - 1 Let k(n) = -3n - 91. Let g(c) = -23. Let w(l) = 4g(l) - k(l). Let p(i) = -12i + 5. What is 6p(z) + 26w(z)? 6z + 4 Let j(c) = 5c*2 + 2c - 87. Let u(f) = -16f2 - 5f + 175. Determine -7j(a) - 3u(a). 13a2 + a + 84 Let q(x) = -17x*2 + 453x + 49. Let l(w) = 8w2 - 227w - 22. Determine -11l(c) - 5q(c). -3c2 + 232c - 3 Let o(f) = -7f + 8. Let l(p) be the first derivative of 4p*2 - 7p + 219. Let a(y) = -6y + 5. Let d(z) = -7a(z) - 6l(z). Give 6d(t) - 5o(t). -t + 2 Let t(h) = -h + 30. Let m(x) = -37218x + 744360. What is m(s) - 24812t(s)? -12406s Let s(b) = b + 8. Let r be s(-4). Let f(w) = 2w2 + 2w + 4. Let l = 5185 + -5194. Let u(o) = 5o2 + 5o + 9. Calculate lf(j) + ru(j). 2j2 + 2j Let g(x) = -x3 - x2 - 12x. Let s(y) = 652y*3 + 2y*2 + 24y - 15. Determine -2g(b) - s(b). -650b3 + 15 Let x(c) be the first derivative of -c4/4 - 2c2 - 2c - 7. Let q(w) be the third derivative of w*4/24 + 30w*2 - 46w - 2. Determine -3q(j) - x(j). j3 + j + 2 Let d(r) = 3r*3 + 5r2 - r + 3. Let z(k) = -k2 - k - 1. Suppose 817g - 825g = 8. Give gd(f) - 4z(f). -3f3 - f2 + 5f + 1 Let u(z) = -24z2 - 2z - 3. Let b(g) = 24g2 + 2g + 2. Let s = 15657 - 15661. Calculate sb(i) - 3u(i). -24i2 - 2i + 1 Let b(t) = 8t2 - 2. Let y(o) be the second derivative of -o4/12 + o. Let u be ((-341)/(-62))/(-1 - (-87)/84). Let j = -150 + u. Give jy(m) + b(m). 4m2 - 2 Let j(k) = 20k*3 - 57k*3 + 10k*3 + 15k*3 + 11k3. Let h(d) = d3. Determine 3h(v) - j(v). 4v3 Let q(m) be the second derivative of -m4/6 + m*3 + 4m*2 - 2068m - 1. Let t(p) = -2p2 + 5p + 7. What is -5q(d) + 6t(d)? -2d2 + 2 Let c(n) = 3n - 3. Let y(s) = -5s + 82. Let v be y(16). Let u(w) = -15w - 23 + 6w + 33. Determine vu(r) + 7c(r). 3r - 1 Let z(p) = 5p2 - 20p + 28. Let n(w) = -w*3 + 7w*2 - 24w + 28. Give 5n(g) - 6z(g). -5g3 + 5g*2 - 28 Let t(d) = -1074d + 7. Let l(u) = -1076u + 8. What is -5l(a) + 6t(a)? -1064a + 2 Let y be (-1)/(1 - (1 + 5/70)). Suppose 3b + y = -2d, -11 + 9 = b. Let v(j) = -4j2 - 4j - 4. Let n(u) = -2u - u + 4u + 1. Calculate dn(a) - v(a). 4a*2 Let f = 16083 - 16087. Let r(y) = 5y*3 + 5y*2 - 6y + 8. Let s(d) = 4d3 + 4d*2 - 5d + 7. Calculate fs(z) + 3r(z). -z3 - z2 + 2z - 4 Let u(v) = -12v + 2. Let d(h) be the second derivative of -64 - 2h + h3 - 1/2h*2. What is -5d(n) - 2u(n)? -6n + 1 Let v(w) = 2w3 - 21w*2 - 24w + 10. Let b(x) = -3x3 + 14x*2 + 24x - 10. Give 3b(c) + 2v(c). -5c3 + 24c - 10 Let l(n) = 2n - 4. Let s(x) = -5x + 7. Let z(f) = 5l(f) + 3s(f). Let t(r) = -21r + 158588 - 317172 + 158589. Give -2t(v) + 9z(v). -3v - 1 Let u(n) = -165n - 2. Let q(t) = 157t + 3. Calculate -3q(m) - 2u(m). -141m - 5 Let x(w) = 11w - 5. Let o(h) = -65h + 28. Let g(f) = o(f) + 6x(f). Let s(p) = -p + 5. Determine -5g(z) - 3s(z). -2z - 5 Let h(g) = -15g*2 - 10g. Let y(b) be the third derivative of b*5/6 + 7b4/24 + b2 + 128. Give -5h(a) - 7y(a). 5a2 + a Let p(j) = -47j - 24 + 48 - 4. Let n(h) = 16h - 7. Determine -11n(k) - 4p(k). 12k - 3 Let i(y) = -2y2 - 9y - 6. Let u(l) = 6 - 2l2 - 2 + 1 + 3l*2 + 8l + l*2. Suppose -3 = -w - 2w, -12 = -3n + 3w. Calculate ni(t) + 6u(t). 2t2 + 3t Let f(u) = u3 + u2 - 1. Let x be (-20)/(-3)((-1)/(-4) - -2). Let n be 54/(-18) + (x - 1). Let w(q) = -4q*3 - 6q*2 + 5. Determine nf(v) + 2w(v). 3v3 - v2 - 1 Let q(o) = o*2 - 31o + 47. Let a(n) = -n*2 + 33n - 50. Calculate -17a(g) - 18q(g). -g*2 - 3g + 4 Suppose -3p - 16 = -p. Let g(u) = 17u - 3. Let r(d) = 11d - 2. Suppose c - 4q = -11, 7c - 4q = 8c - 21. Give cg(w) + pr(w). -3w + 1 Suppose -17 = -29f + 28 + 13. Let a(z) = 3z*3 - z. Let v(n) = 3n*3 - n. Suppose -b - 7 = -2c + 3c, -c + 5b + 17 = 0. What is ca(u) + fv(u)? -3u3 + u Let n(z) = -z - 3. Let m(v) = -3v - 6. Let y be (-48)/9 - (-115)/(-69). Give yn(i) + 3m(i). -2i + 3 Let x(w) = -5w*2 + 3w + 3. Let z(h) = 60h2 - 66h*2 + 4 + 5h - h. Suppose 4c = -6c + 360. Let i = c - 33. Calculate iz(l) - 4x(l). 2l2 Let y(r) = -19r*2 - 265r + 41. Let z(w) = -5w2 - 66w + 11. Calculate -4y(j) + 15z(j). j*2 + 70j + 1 Let q(y) = 2y + 11. Let x(u) = 3720u + 54. What is 5q(b) - x(b)? -3710b + 1 Let r(f) = 5f3 + 5f*2 - 3f - 4. Let q(c) = -4c3 - 4c*2 + 2c + 3. Let a = 365 - 362. What is aq(x) + 2r(x)? -2x3 - 2x*2 + 1 Let f(x) = 2x*2 + 3x. Let m(h) = 6h2 + 8h. Suppose 8z = 9 + 23. Suppose 3v - 24 = -4r, 3r - zr + 24 = 3v. Give vf(i) - 3m(i). -2i2 Let y(x) = 5413x - 2. Let b(q) = 3q + 1. Determine 2b(v) + y(v). 5419v Let d(r) = 4r*2 + 3597. Let q(z) = 10z*2 + 10792. Determine 8d(w) - 3q(w). 2w*2 - 3600 Let l(d) = -7d*2 + d. Let c(u) = -3u*2 - 55u + 279. Let r be c(4). Let w(g) = -13g2 + 3g. What is rl(x) - 6w(x)? x*2 - 7x Let i = -2 - -6. Let m(h) = -h*2 - 2h - 4. Let k(w) be the third derivative of -w5/60 - w4/24 - w3/6 - w2 - 532w. Give ik(b) - m(b). -3b2 - 2b Let u be ((-15)/45)/((-4)/(-24)). Let w be ((36/(-15))/u)/(39/650). Let v(c) = -4c2 - 3c - 3. Let h(i) = 28i2 + 20i + 20. What is wv(o) + 3h(o)? 4o2 Let i(h) = -1 - 8 + 6 + 3h - 2h. Let j(a) = -a + 4. Let z be 48/(-64) + (-5)/4 + -2. Determine zi(r) - 3j(r). -r Let n(t) = 5278 - t2 + 2t*2 + 5280 - 10556. Let f(s) = -2s*2 - 3. Suppose 8 = -3a - a. Calculate af(x) - 3n(x). x*2 Let u(h) = 3h*3 - 2h*2. Let d(k) = 16k*3 - 100k*2 + 3. What is -d(j) + 5u(j)? -j*3 + 90j2 - 3 Let u(j) = j3 - 3j2 - 62j - 3. Let m = 26686 - 26688. Let v(g) = g*3 - 2g*2 - 61g - 2. What is mu(z) + 3v(z)? z*3 - 59z Let s(p) = -44p - 2. Let a(w) = -173w + 342. What is a(m) - 4s(m)? 3m + 350 Suppose -o = -1, b + 3o = 5o - 3. Let u(i) = 8i - 12. Let p(x) = x - 2. Let d(t) = bu(t) + 5p(t). Let f(l) = -7l + 3. Calculate 5d(k) - 2f(k). -k + 4 Let h(o) = 1. Let x(b) = -b*2 - 10b - 8. Let p be x(-9). Let u(v) = -14. Let a(t) = t - 17. Let q(s) = 3a(s) - 4u(s). Give pq(i) - 4h(i). 3i + 1 Let w(k) = -6k3 - k2 + k - 1. Let i(l) = 414l3 + 15l*2 - 15l + 15. What is 3i(p) + 45w(p)? 972p3 Let g(j) = 187j + 748. Let i(k) = -94k - 409. Give 6g(p) + 11i(p). 88p - 11 Let l(g) = 11g3 - g2 - 9. Let n = -231 + 254. Let q(o) = -5o3 - 63 + 19 + 25 + n + o2. What is 4l(d) + 9q(d)? -d*3 + 5d*2 Let d(j) = -12j*3 + 33j*2 + 7j - 9. Let r(l) = -5l3 + 16l*2 + 3l - 4. Calculate -3d(n) + 7r(n). n*3 + 13n*2 - 1 Suppose -j + 4j = 21. Let u(m) = 5m2 + 5m + 11. Let l(d) = 2d2 + 2d + 5. Let g = 652 - 652. Suppose -26q - 59 - 19 = g. Give j	{ "pile_set_name": "DM Mathematics" }
2. Calculate i(-12). -3 Let j = 8 + -16. Suppose 3s = 8s + 50. Let o = j - s. Let g(n) = -3n*3 + 4n*2 - 4n + 3. What is g(o)? -13 Let o(t) = -116t + 467. Let h be o(4). Let r(k) = -2k - k + 2k2 - 2k + 4. Determine r(h). 7 Let k(v) = 4v3 + 29v*2 + 17v - 11. Let f(x) = x*3 + 7x*2 + 4x - 3. Let d(n) = 9f(n) - 2k(n). Give d(-4). 3 Let m(d) be the first derivative of d*3/3 + 2d*2 + 5d + 319. Determine m(-5). 10 Let b(p) = -p2 + 10. Let o be b(4). Let s(a) be the third derivative of -a4/24 - a*3/2 + 8a*2. Calculate s(o). 3 Let z(x) = x - 7. Let q(a) = 47a2 + a3 + 11a + 5 - a3 - 37a2 - a3. Let m = 35 - 24. Let c be q(m). Calculate z(c). -2 Let h(w) = -5w2 - 9w - 10. Let u(s) = -17s2 - 28s - 32. Let q(b) = 7h(b) - 2u(b). What is q(-4)? 6 Let v(z) be the second derivative of z5/20 - z4/3 - 3z3/2 + 2z*2 - 22z. Give v(6). 22 Let j(s) = -26s. Let a = 52 + -41. Suppose -3f - a = -8. Determine j(f). 26 Let f(o) = o3 + o2 + 2o - 2. Let l be f(1). Let w(b) = 8b*3 + lb*2 - 7b + 2b + 1 + 3b. Determine w(1). 9 Let x be (-54)/(-7) + 4/14. Suppose -5r - 28 = -5b - 93, -x = 2b. Let i(v) = -8 - 3 + 44v - 35v - 8v. Determine i(r). -2 Let w(k) = k*2 + 2k + 6. Let h(l) = -l*3 - 24l*2 - 40l + 93. Let b be h(-22). Determine w(b). 41 Suppose 4m - 2m = -2h, -h + 2m + 6 = 0. Suppose 4 = hp + 2o, 3p + p - 4o = 40. Let y(w) = w - 13. Determine y(p). -7 Suppose 7g = 50 - 1. Let z(h) = -h + 8. Determine z(g). 1 Suppose 2q = 14 - 0. Suppose -2x = -qx + 10. Let l(n) = -2n2 + n + 1. Calculate l(x). -5 Let i(w) = w3 + 4w*2 - w - 4. Suppose -2g + 0k = 4k + 26, g - 12 = 3k. What is i(g)? 8 Let y(q) = 2q - 8. Let t(k) = 56k - 46. Let r be t(1). Determine y(r). 12 Let h(l) = -12l. Let d = -1048 + 1047. Give h(d). 12 Let s(m) be the third derivative of -m6/120 - m5/20 - m4/8 - m3/2 + 2m2. Let r = 344 + -347. What is s(r)? 6 Let u = 1 + 0. Let t be ((-4)/3)/(u/3). Let b(s) = 5 - 10s + 8s - 9. Calculate b(t). 4 Let p(q) = q - 6 + 5q - 2 + 7. Let g(z) = z*3 - 8z*2 - 21z + 11. Let o be g(10). Give p(o). 5 Let s(b) = 15157b - 15154b + 3 + 0. Determine s(-2). -3 Suppose -z + 1 = -0z. Let a be (-2 - z)2/(-2). Let w(o) = -2o3 + 2o*2 - 11o - 3. Let c(l) = l*3 + 6l + 2. Let f(g) = -3c(g) - 2w(g). What is f(a)? 3 Let t(p) be the third derivative of p8/10080 - p7/2520 - p*6/180 + 13p*5/30 + 4p2. Let s(c) be the third derivative of t(c). What is s(3)? 8 Let a(f) = f3 + 5f2 + 2f. Let s = -137 + 155. Let y = s - 23. Determine a(y). -10 Let s(c) be the first derivative of c*4/4 - 7c*3/3 - 4c*2 - 8c + 1. Let m(q) = 5q3 - 27q*2 - 32q - 31. Let f(k) = -2m(k) + 9s(k). Calculate f(-8). -10 Let r be (-13)/(-2 - (-1 - 0)). Let a = 8 - r. Let u(d) = -6d2 + 10d*2 - 9d2 + 3 - d3. Calculate u(a). 3 Let o be -23/2 + -10. Let x be o + (-3)/((-4)/4). Let c(b) = -b - 1. Calculate c(x). 9 Let j(i) = 2i*2 + i + 1. Let f(p) = 4p*2 - 20p - 8. Let h(y) = -f(y) + j(y). Determine h(11). -2 Let l(b) be the third derivative of -b*4/8 - 7b*3/6 + 230b*2. Calculate l(-9). 20 Let q(n) = 5n - 3. Suppose 21y = 23y - 4. Let b be q(y). Let f(s) be the third derivative of s*4/12 - 3s3/2 - s2. Give f(b). 5 Let m(c) = -2c - 3. Let y = -1 - -6. Suppose g = 2 - y. What is m(g)? 3 Let y(d) = -2d2 + 1. Let k(o) = -o2 + 18o - 2. Let r be k(17). Let l be 4 - 8/(40/r). What is y(l)? -1 Let r(z) = -5z - 16z - 4 + 15z. Calculate r(-4). 20 Let x(p) be the first derivative of -1/4p4 + 7p - 13 + 2p2 + 5/3p3. Determine x(6). -5 Let v(y) = y2 + 8y - 1. Let k(x) = x3 - 6x2 + 26. Let g be k(4). Calculate v(g). -13 Let g(n) be the second derivative of -n5/20 - n*4/12 + 11n*2/2 + 3n. Suppose 0 = -4j + 2j - 5j. Give g(j). 11 Let q be (1 - 7 - -8)/(0 - -1). Let l(z) be the first derivative of -5z*2/2 + 8. Give l(q). -10 Let a(t) be the first derivative of 1/2t*2 + 11t + 18. Give a(0). 11 Let o(f) be the third derivative of 11f6/60 + f4/12 - f3/6 - 3f*2 + 8. Give o(1). 23 Suppose 12 = -h - 2h. Let k be (-57)/h - 3/12. Let w = k - 18. Let s(t) = -t*2 - 7t - 3. What is s(w)? 9 Suppose 10 = -5b + 3b. Let a = b + 9. Let f(g) be the third derivative of -g*4/24 - 2g*3/3 + 3g*2. Give f(a). -8 Let b(w) = -2w - 5. Let z(d) = -d*3 - 13d*2 - 43d - 20. Let k be z(-8). Calculate b(k). -13 Suppose -195m = -216m + 147. Let d(o) = 4o3 - 8o*2 + 13o - 9. Let h(l) = 3l3 - 8l*2 + 12l - 9. Let v(k) = -2d(k) + 3h(k). Calculate v(m). 12 Let i(s) be the third derivative of 1/6s4 + 4s*2 + 7/60s5 - s3 + 0s + 1/120s*6 + 0. What is i(-6)? 6 Suppose 29h = 148 + 55. Let x(k) = -k*3 + 8k*2 - 6k - 2. Determine x(h). 5 Let i(v) = -2v2 - 2v + 1 + 0v2 + v2 - v3. Let k be 25/(-10) + (-26)/(-52). What is i(k)? 9 Let a = -299 - -298. Let c(i) = 2i - 2. Give c(a). -4 Let x(c) = 6c2 - 17c + 62. Let h(s) = -5s2 + 19s - 61. Let l(i) = 5h(i) + 4x(i). Determine l(25). -7 Let j(q) = 3 + 0q + 3q - 1 + 0q. What is j(3)? 11 Let h(j) = j2 + 5j + 2. Suppose -8w = -6w - 6. Suppose -2t = 3v + 4, 2v + 2v - t = 13. Suppose 4n + 2 = -wo, -3n + vo - 8 = -n. Determine h(n). -4 Suppose 3z + 1 = n, 3n + 2z - 25 = -0z. Let c(s) = -n + 9s - 4s + s*2 - 9 + 12. Calculate c(-7). 10 Let h = -1918 + 1928. Let t(a) = 2a*2 - 14a - 4. Calculate t(h). 56 Let w(k) be the third derivative of -1/120k6 + 1/12k*4 + 0 - 1/15k*5 + 2/3k*3 + 0k - 29k2. What is w(-4)? -4 Suppose -3g = -0g + 3j - 93, -5g - 4j = -155. Let q = 43 - g. Let n(d) = 2d2 - 3d*2 - 5 + 0d + qd - 5d. What is n(4)? 7 Let j(l) = -18l - 2l*2 - 515 + 8l + 518. Let a be j(-5). Let w(v) = 4v2 + 0 + 2 - v3 - 3v + 0. Determine w(a). 2 Let i(f) = -6f2. Suppose -25l = -24l - 5t - 12, -2l + 2t = -8. Give i(l). -24 Let u(d) = 16d + 2d*2 - 11 + 2d - 19d. Calculate u(0). -11 Let h(n) = -134 + 274 + n - 136. What is h(-11)? -7 Let i = 70 + -68. Let z = -10 + 17. Suppose -6 = -2t + 6f - 3f, 5t = if - z. Let s(k) = -k*3 - 2k*2 + 5k + 3. What is s(t)? -3 Let g = -15 - -14. Let l(w) = -w3 - w2 - 1. Let h(r) = 3r3 + 9r*2 + 4r + 11. Let o(i) = gh(i) - 4l(i). Let j = -8 - -14. What is o(j)? 5 Let z(q) be the second derivative of -q*5/20 + 5q*4/4 + 8q*3/3 + 13q*2/2 - 39q + 5. What is z(16)? 13 Let z = 8 + 6. Let v = z - 18. Let o(u) = -u*3 - 3u*2 + 4u + 1. Give o(v). 1 Let x(a) = 20a2 - 5a*3 - 8a - 15a2 - 2a - 1. Let q(p) = -14p3 + 15p*2 - 29p - 2. Let n(y) = 6q(y) - 17x(y). Calculate n(-6). -7 Let f(u) = u. Let k(h) = 5. Suppose -4g + 0 + 4 = 0. Let i(t) = gf(t) - k(t). Let x be i(5). Let a(c) = -c + 8. Give a(x). 8 Let l be 10/(-4)(-64)/40. Let b = 2 + l. Let w(f) be the first derivative of -f3/3 + 2f*2 + f + 7. Give w(b). -11 Let j(x) = 4x + 1151x2 - 1150x*2 - 11 - 3x. Give j(-5). 9 Let x(c) = -5 - 1 - 8c - 2 - c2. Let o(z) = z - 28. Let y be o(33). Suppose -16n + 18n - 6 = 0, 20 = -5a - yn. Calculate x(a). -1 Let a = -4 - -2. Let r(n) = -119n*2 + 1 + 232n*2 - 116n2. Give r(a). -11 Let j(q) = -q2 - 1. Let f(z) = z*2 - 1. Let h(m) = f(m) + 2j(m). Suppose 19k - 11k = -15k. Calculate h(k). -3 Let h(w) = -w2 - w + 12. Let r(t) = 13 + 11 + 25 + 7t - 7. Let p be r(-6). What is h(p)? 12 Let i be (-6)/112/(-36). Suppose 2m - 3x + ix - 7 = 0, 18 = 3m - 4x. Let w(v) = v - 3. Calculate w(m). -1 Let v = 51 + -39. Let p(f) = 4f - 3f + 14 - 2f. Calculate p(v). 2 Let y(p) = p3 + 9p*2 + p + 13. Let c be 44/(-6) - 6/((-54)/(-15)). What is y(c)? 4 Let p(h) = -h + 2. Let l be p(0). Suppose lz - 6 = v, v + 4z - 14 = z. Let b(g) = -2g + g - 37 - vg + 35. Give b(-4). 10 Let q(l) = 8l + 30. Let x(c) = -3c - 11. Let v(u) = -4q(u) - 11x(u). Determine v(-1). 0 Let l(b) = -b2 + 7b - 7. Let c = 569 + -562. Give l(c). -7 Let h(r) be the first derivative of -7/2r2 + 6r + 1/3r3 + 16. Calculate h(4). -6 Let n(b) = b3 + 13b*2 + 14b + 5. Let r be 10763/(-893) + (-3)/(-57). Calculate n(r). -19 Let d = 2 + 3. Let r(k) be the second derivative of -k*4/12 + 7k3/6 - k2 + 6*k + 8. Dete	{ "pile_set_name": "DM Mathematics" }
1}? 1/28 Calculate prob of picking 2 q and 2 m when four letters picked without replacement from {m: 2, q: 5}. 2/7 What is prob of picking 1 g and 2 c when three letters picked without replacement from {c: 5, g: 11}? 11/56 Three letters picked without replacement from {m: 4, x: 6}. What is prob of picking 2 x and 1 m? 1/2 Three letters picked without replacement from wwewwwewweewww. What is prob of picking 3 e? 1/91 Two letters picked without replacement from sqqtssq. Give prob of picking 1 s and 1 q. 3/7 Four letters picked without replacement from {j: 1, w: 5, c: 3, h: 1, o: 1, q: 1}. What is prob of picking 1 w and 3 c? 1/99 Calculate prob of picking 2 o when two letters picked without replacement from qoctccctolcc. 1/66 Three letters picked without replacement from xxxoooxxoxoxo. Give prob of picking 3 o. 10/143 Calculate prob of picking 2 s and 2 q when four letters picked without replacement from {q: 12, s: 6}. 11/34 Calculate prob of picking 3 y and 1 z when four letters picked without replacement from {y: 3, z: 4, e: 7, f: 2, g: 1}. 1/595 Calculate prob of picking 4 z when four letters picked without replacement from zqzzzqzzzzzzqzzzzz. 91/204 Calculate prob of picking 2 m, 1 y, and 1 t when four letters picked without replacement from {c: 1, t: 3, m: 4, y: 2, o: 7}. 9/595 What is prob of picking 3 o and 1 m when four letters picked without replacement from eejejemvmmvdjoodvjov? 1/1615 Calculate prob of picking 1 d and 1 m when two letters picked without replacement from gddmccddr. 1/9 Calculate prob of picking 4 f when four letters picked without replacement from ffff. 1 Two letters picked without replacement from {r: 3, e: 1, m: 3, p: 3}. Give prob of picking 2 p. 1/15 Four letters picked without replacement from ywtwwwwttty. Give prob of picking 1 w and 3 t. 2/33 Calculate prob of picking 1 g and 1 r when two letters picked without replacement from {r: 8, g: 2}. 16/45 Calculate prob of picking 3 y and 1 q when four letters picked without replacement from yyytqtytytyyjyy. 4/65 What is prob of picking 1 s, 1 t, and 1 h when three letters picked without replacement from ozooozhosrzto? 1/286 What is prob of picking 2 i, 1 n, and 1 p when four letters picked without replacement from nnpinppnpiinninnppip? 112/969 Two letters picked without replacement from {b: 2, h: 2}. What is prob of picking 2 b? 1/6 What is prob of picking 1 t and 1 n when two letters picked without replacement from mnmrt? 1/10 Two letters picked without replacement from iiiiiziwiiizw. Give prob of picking 1 i and 1 z. 3/13 Four letters picked without replacement from {m: 11, u: 1, g: 5}. What is prob of picking 1 u, 1 g, and 2 m? 55/476 Three letters picked without replacement from {d: 2, z: 2, b: 2, h: 4, a: 3}. What is prob of picking 1 z and 2 h? 6/143 What is prob of picking 4 h when four letters picked without replacement from {h: 5, y: 12, o: 1}? 1/612 Three letters picked without replacement from kkpkkkkqkkckkkp. Give prob of picking 3 k. 33/91 Calculate prob of picking 1 b, 2 d, and 1 t when four letters picked without replacement from {d: 4, z: 1, t: 3, b: 3}. 9/55 Three letters picked without replacement from xxxxxexexcoeq. What is prob of picking 1 c, 1 x, and 1 o? 7/286 Four letters picked without replacement from akkkaakkkkkakk. Give prob of picking 4 k. 30/143 Four letters picked without replacement from {e: 1, x: 6, c: 1, l: 6, k: 1, w: 5}. Give prob of picking 1 e, 1 w, and 2 x. 5/323 Two letters picked without replacement from {j: 1, k: 1, i: 1, s: 2}. Give prob of picking 1 s and 1 k. 1/5 Two letters picked without replacement from {p: 14, o: 1, x: 1}. What is prob of picking 1 o and 1 p? 7/60 Three letters picked without replacement from {d: 7, u: 1, h: 2}. Give prob of picking 1 d and 2 h. 7/120 Three letters picked without replacement from {s: 1, m: 2, c: 3, d: 3, w: 1, j: 1}. What is prob of picking 1 j and 2 d? 1/55 Three letters picked without replacement from {i: 11, k: 4, u: 3}. Give prob of picking 1 k and 2 u. 1/68 What is prob of picking 1 p and 1 t when two letters picked without replacement from {n: 1, t: 3, b: 2, a: 1, e: 4, p: 1}? 1/22 What is prob of picking 2 b when two letters picked without replacement from bvbbbv? 2/5 Two letters picked without replacement from {j: 2, q: 1, h: 1}. Give prob of picking 1 h and 1 q. 1/6 Two letters picked without replacement from {e: 4, h: 1, s: 6}. What is prob of picking 1 s and 1 h? 6/55 Four letters picked without replacement from {y: 2, f: 1, k: 7, l: 2}. Give prob of picking 2 y, 1 l, and 1 k. 14/495 Calculate prob of picking 2 v when two letters picked without replacement from vkv. 1/3 Two letters picked without replacement from qqqqqqqqq. Give prob of picking 2 q. 1 Three letters picked without replacement from sxpxk. Give prob of picking 2 x and 1 p. 1/10 Two letters picked without replacement from vvvvvvvvvvvxvvvvvvxv. What is prob of picking 2 x? 1/190 Two letters picked without replacement from {o: 5, w: 4, g: 5, b: 6}. Give prob of picking 1 o and 1 b. 3/19 What is prob of picking 1 x and 1 i when two letters picked without replacement from ixiixxixxixxiz? 6/13 Calculate prob of picking 2 a and 1 w when three letters picked without replacement from {x: 2, a: 4, p: 1, w: 7, c: 3}. 21/340 Calculate prob of picking 1 h and 1 r when two letters picked without replacement from {h: 4, e: 2, x: 1, r: 3, o: 1}. 12/55 Three letters picked without replacement from {q: 1, z: 1, v: 2, f: 1, w: 2}. Give prob of picking 1 v, 1 z, and 1 q. 2/35 What is prob of picking 4 t when four letters picked without replacement from {h: 2, t: 1, z: 6, w: 1, s: 7}? 0 What is prob of picking 1 u, 1 k, and 2 a when four letters picked without replacement from uwukakurwrwkkuuawkw? 25/3876 Three letters picked without replacement from jkjjjjkjkkjjjjkjkj. Give prob of picking 1 k and 2 j. 33/68 Calculate prob of picking 4 v when four letters picked without replacement from {m: 2, a: 1, k: 1, c: 3, v: 1, x: 4}. 0 Three letters picked without replacement from tekoc. What is prob of picking 1 e, 1 o, and 1 k? 1/10 Two letters picked without replacement from {a: 1, b: 2}. Give prob of picking 2 b. 1/3 Two letters picked without replacement from {j: 1, a: 1, e: 2, y: 1, n: 2}. What is prob of picking 2 n? 1/21 What is prob of picking 2 d when two letters picked without replacement from dzdfafzzzd? 1/15 Calculate prob of picking 2 t when two letters picked without replacement from {q: 1, t: 7}. 3/4 Four letters picked without replacement from gdggttggsxgtq. What is prob of picking 2 d, 1 t, and 1 s? 0 Two letters picked without replacement from {b: 1, d: 3, h: 1, a: 4, p: 5, k: 1}. Give prob of picking 1 d and 1 p. 1/7 Two letters picked without replacement from llrlljill. What is prob of picking 1 j and 1 l? 1/6 Two letters picked without replacement from cwwwccccqwcqbcc. Give prob of picking 1 c and 1 b. 8/105 Three letters picked without replacement from {q: 7, j: 2, g: 1}. What is prob of picking 3 q? 7/24 What is prob of picking 2 j when two letters picked without replacement from zxrxrxrjjxjx? 1/22 Four letters picked without replacement from {l: 1, y: 2, j: 3, d: 2, a: 2, g: 2}. Give prob of picking 1 y, 1 d, 1 a, and 1 g. 16/495 What is prob of picking 2 s when two letters picked without replacement from hohhsokoshhksoooso? 2/51 Four letters picked without replacement from qiqtitjqqttei. Give prob of picking 4 t. 1/715 Calculate prob of picking 3 g when three letters picked without replacement from {t: 4, g: 6}. 1/6 Three letters picked without replacement from {m: 3, j: 8}. What is prob of picking 1 m and 2 j? 28/55 Calculate prob of picking 3 g and 1 j when four letters picked without replacement from {g: 3, j: 1, f: 2, d: 6}. 1/495 Two letters picked without replacement from {n: 7, g: 5}. What is prob of picking 1 n and 1 g? 35/66 What is prob of picking 1 r and 1 y when two letters picked without replacement from rcy? 1/3 Calculate prob of picking 2 i and 2 p when four letters picked without replacement from {q: 3, i: 5, p: 2}. 1/21 What is prob of picking 2 a, 1 g, and 1 n when four letters picked without replacement from annnnnnangaanaagaan? 42/323 Calculate prob of picking 1 v and 2 d when three letters p	{ "pile_set_name": "DM Mathematics" }
to j in -2/3, 0.2, d? d Suppose -4a = 4m + 8, -4a - 10 = -2m + a. What is the nearest to -0.08 in m, 2/21, -0.4? m Let k = -4 - -7.6. Let c = -4 + k. What is the closest to -3 in -5, c, -0.2? -5 Let h = 0.7 + -0.6. Let s = -1.1 - -1. Which is the nearest to h? (a) -4 (b) s (c) -3 b Let t = -44 - -351/8. What is the closest to 4 in 0.4, 5, t? 5 Let h = 1.6 + -7.6. Let u = h + 5. Let l(j) = -3j2 - j - 1. Let b be l(-1). What is the closest to 1 in -4, u, b? u Suppose -4 + 10 = 6h. Let r be (h/(-5))/(12/15). What is the nearest to -1 in r, 0.2, -2/3? -2/3 Let z = -2.638 - 0.062. Let v = 3 + z. Let k = -551/35 - -106/7. What is the closest to 0 in v, k, -3? v Let j be ((-1)/(-2))/(21/(-14)). Which is the closest to -1? (a) j (b) -0.4 (c) 3/5 b Let z be 2/5 + (-72)/105. What is the closest to z in -1, -5, 1/4? 1/4 Let s = 13 + -8. Suppose -8o + 3o - 25 = 0, s = 5p - 3o. Let f be (-1)/(p/122). Which is the nearest to f? (a) 0.4 (b) 1 (c) -3/5 b Let o = 1 + 0. Let w be (-8)/6(-18)/(-4). Let v be (w - -5) + 9/7. What is the nearest to -1 in v, 5/4, o? v Let m = 9 - 5. Let h = 14 + -10. Suppose -s - 18 = ht, s + ms = t - 6. What is the nearest to s in 4, 3, 2? 2 Let x(o) = 2o3 + 13o*2 + 5o - 2. Let k be x(-6). Which is the closest to 1/3? (a) k (b) -1 (c) -4 b Let q = -0.2 - -2.2. What is the closest to -0.2 in 0, q, -0.09? -0.09 Let k = 0.9 + -0.6. Let x = -0.02 - -0.42. Let c = -796/7 + 114. What is the nearest to c in k, x, -0.4? k Let l(n) = -n + 1. Let j be l(6). Which is the closest to -0.1? (a) -1/6 (b) j (c) 2/7 a Let x be 1/((-220)/8)-5. Which is the closest to -0.2? (a) -2 (b) -6 (c) x c Let t = -0.05 - -0.25. Let h = 0 - -2. Let f = 0 - h. Which is the nearest to t? (a) -4 (b) f (c) 1/3 c Let s be 1/((-22)/(-4) + 1). Let k = -842/7 - -120. What is the nearest to k in s, 2, 0.1? 0.1 Let k = -6 - -5.9. Which is the closest to k? (a) 12 (b) 0.2 (c) 0.1 c Let m = -4.7 - -5. Let z = -6 - -3. Let q = 1 - 1. What is the nearest to q in m, -0.2, z? -0.2 Let q = -775 - -777. Let o = -1 - 0. Let b = -0.1 - 0. What is the nearest to b in 1/4, o, q? 1/4 Let m be 24/(-35) - (-10)/35. Which is the nearest to 2? (a) 2/17 (b) m (c) -2/19 a Let i be (-4)/(-18) - 11/9. Let z = 1 + 0. Let u be (1/3)/((-5)/(-6)). What is the nearest to i in u, 0.1, z? 0.1 Let p be 2/(-15) + (-914)/(-195). Let i = p + -22/5. What is the nearest to 0.1 in 2/5, 5, i? i Let x = 5.5 - 8. Let i = x - -0.5. Let v = 26 + -26. Which is the nearest to v? (a) i (b) -0.5 (c) 3/7 c Let s = -23/30 - -4/15. Which is the closest to 5? (a) s (b) 0 (c) 2/9 c Let x = 1/151 + 293/1359. Let h = 4.3 - 4. Suppose -v - 3 = 2q - 4q, 10 = 4v + 3q. What is the closest to v in h, x, -2/13? h Let w = 0.3 - 2.3. Which is the nearest to 2/7? (a) w (b) 4 (c) -0.5 c Let j = -9 - -9.6. Let v = j + -0.4. Which is the closest to 2? (a) v (b) -3 (c) -4 a Let o = 0.8 - -2.2. Let u = -2 - o. Let z be ((-1)/(-3))/(16/(-12)). Which is the nearest to 1/3? (a) z (b) u (c) -4 a Let m be (2 - (-114)/(-3)) + 2. Let u be 3 + (1 - (-132)/m). Which is the closest to 0.1? (a) 0 (b) u (c) 4 b Let d = -0.2 - 0.8. Which is the closest to 0.2? (a) -0.3 (b) 2/3 (c) d b Let z = 4 + 1. Let f = 8 - 12. Let i be (3 - -1)(-1)/10. Which is the nearest to 1? (a) z (b) f (c) i c Let o be 6/40 - (-8)/(-20). Let t = 11.72 + -12. Let n = t - 0.02. Which is the nearest to -0.1? (a) 2 (b) o (c) n b Let z = -4 + 6. Let q = 0.0484 - 0.1484. Which is the closest to z? (a) q (b) 0.3 (c) -7/4 b Let x be (-9)/(-14) - 7/14. Let l(r) = -r*2 - 10r. Let z be l(-10). Suppose -2f + zf = 0. What is the closest to 1 in f, 5, x? x Let v(l) be the first derivative of l*4/4 - 2l*3 - 7l*2/2 - l + 2. Suppose 3d = 25 - 4. Let o be v(d). Which is the nearest to o? (a) 4 (b) 0 (c) 0.4 b Let o = 4.9 + -5. Which is the nearest to -0.1? (a) o (b) 4/3 (c) -4/9 a Let l be (-39)/(-63) - (-1)/(-3). Let m = -0.33 - 0.07. What is the nearest to -2/7 in 1/4, l, m? m Let b = 0.04 + -0.03. Let q = -0.51 + b. What is the nearest to 0 in 2, q, 0? 0 Let q be ((-1)/(-2))/(7/(-2)). Let n = 11 + -6. Let h = 29.3 + -29. What is the nearest to 1 in h, n, q? h Let r = 1 + -2. What is the closest to r in -1/2, -5/3, -6? -1/2 Suppose -2w = -4 - 4. Let h be ((-2)/w)/10. Let s(b) = b*3 + 7b*2 + 1. Let j be s(-7). What is the closest to h in -3, 1/4, j? 1/4 Let d = -53/7 - -57/7. Let f = 2 + -2.2. Which is the nearest to 0.2? (a) d (b) -0.5 (c) f a Suppose 0n + 14 = 2n. Suppose 4z = 1 + n. Let d = 2 - -2. What is the closest to -1/6 in z, d, 3? z Let z = 4 - 5. Suppose 1 = -4g - 11, 0 = v + 2g + 3. Which is the nearest to z? (a) 4 (b) v (c) 0.5 c Let p = -97/535 - 2/107. Which is the nearest to -0.1? (a) -4/7 (b) p (c) 5 b Let r = 742/5 + -148. Let n(q) = -q*3 - 2q*2 + 4q + 2. Let y be n(-3). Which is the nearest to r? (a) 2 (b) 5 (c) y c Let n = 1 - 1. Let h be 4/(-63) - -310/105. Let v = 0.2 + 0.2. Which is the closest to n? (a) v (b) 1 (c) h c Suppose 17t - 14t - 15 = 0. Suppose -s - 9 = 5o, 5s = -3o - 0o - 23. What is the closest to o in t, 0.3, 1? 0.3 Let f be (-10)/901(2 + 0). Let g = 6 - 4. Which is the nearest to 1? (a) g (b) -3 (c) f a Let q = -29 + 29. Which is the closest to -0.1? (a) 1 (b) q (c) 1/3 b Let o = -0.5 - -6.5. Let m = o - 7. Which is the nearest to m? (a) -1 (b) 3/5 (c) -0.5 a Let w = 0.3 + 0.7. Let v = w + -0.9. Let o = 4.7 + -5. Which is the nearest to v? (a) -1 (b) o (c) -3 b Let n be 2/(-10) - 0/2. Let g = -67/28 + 15/7. What is the nearest to g in n, 2/7, -1/3? n Let x be (1181/2)/((-7)/(-2)). Let w = 169 - x. Which is the nearest to w? (a) -0.5 (b) 1 (c) -1 b Let y = 0.2 - 1.2. Let f = -8.7 + 6.7. Which is the nearest to y? (a) f (b) -3 (c) 3/8 a Let n = -0.2 + 0. Suppose 0 - 5 = 5f. What is the closest to 0.2 in n, -2/7, f? n Let g = -0.5 - -0.4. Let s = -4.2 - 0.8. Which is the closest to 1/2? (a) g (b) 0.5 (c) s b Let q = -2.1 + 12.1. Let b = 9 - q. What is the closest to -2/3 in b, -5, 0.1? b Let p = -0.1 + 0.1. Let j = 1 + p. Let k = 49 + -46. What is the closest to j in -0.5, 1/5, k? 1/5 Let p = -0.3 + 0.2. Suppose 2 = 2w + x, 3x = 2w - 3w - 9. What is the closest to 2/7 in -2, w, p? p Let y = 8 + -3. Let v = -3.2 - -8.1. Let h = y - v. What is the nearest to 0.1 in 3, -1, h? h Let p = -71.7 + 68. Let v = p + 4. Let x = v - -0.7. What is the closest to x in 1/4, 0, 2/19? 1/4 Let w be ((-2)/(-12) + 0)/1. What is the nearest to -3 in w, -3/5, -2? -2 Suppose -4o = -20, 0 = -0s + s + 2o - 15. Let q = 0.03 + -4.03. Let p be (-150)/(-252) - (-1)/(-2). What is the closest to 0 in p, s, q? p Let u be (2/(-3))/((-4)/6). Let m = -37 + 36.9. What is the nearest to -0.2 in -4/7, u, m? m Let t be 6/(-33)(6 + 18/(-4)). Which is the nearest to t? (a) 3 (b) 3/2 (c) 1 c Let h = 175 - 872/5. Which is the nearest to 0.1? (a) -5 (b) 0 (c) h b Suppose 0 = k - 5m + 4, 2k = -8m + 3m - 8. Let h = k + 4. What is the nearest to -1/2 in 5, h, -1/2? -1/2 Let n = -35/2 + 17. Let z = -0.06 - -0.36. Let b = -0.7 + z. What is the closest to -1 in n, b, -0.1? n Let s = -7.44 - -0.44. What is the closest to 2/7 in 1, -2/9, s? -2/9 Let i = 80 - 76. Let l = -5/7 - -3/14. Which is the closest to -1/4? (a) i (b) l (c) -5 b Let o = 2 + -6. Let x = -6 - -6. Which is the nearest to -1? (a) o (b) x (c) 3/5 b Let u be 0/(8/(-56) - 8/(-7)). Which is the closest to -2/3? (a) 3/5 (b) -1/4 (c) u b Let x = -81 - -83. Let p = -6 + 9. Let u be (-1)/(2/(1-2)). Which is the closest to u? (a) p (b) x (c) 1 c Let x = -380/3 - -128. Let k = -5 - -2. Which is the nearest to -1? (a) x (b) k (c) 2/5 c Let o be (2/11)/(-6 + 7). Which is the nearest to 0? (a) o (b) 2/7 (c) -2/5 a Let o = 38 - 36. Which is the nearest to o? (a) -4 (b) -1 (c) -0.2 c Let m = -2/3 + 1/6. Let w be 3(130/42 - 3). Which is the nearest to 1? (a) 3 (b) w (c) m b Let w = -2 - -2. Let o = 6.5 + -6. Let y = -70 + 492/7. What is the nearest to 2/5 in w, y, o? o Let l(d) = -7d3 + 5d*2 - 2d - 4. Let n be l(4). Let k be (-9)/6n/18. Let w = k + -32. What is the closest to w in -1/10, 3, -1? -1/10 Let w(i) = -3i**3 + i - 1. Let f be w(	{ "pile_set_name": "DM Mathematics" }
28 What is the greatest common factor of 60 and 480? 60 What is the greatest common factor of 74 and 1147? 37 Calculate the highest common factor of 68 and 391. 17 Calculate the highest common factor of 62 and 31. 31 Calculate the highest common factor of 266 and 304. 38 Calculate the greatest common factor of 240 and 3440. 80 Calculate the greatest common factor of 2808 and 728. 104 Calculate the highest common factor of 1557 and 1. 1 What is the greatest common divisor of 26 and 3874? 26 Calculate the greatest common divisor of 96 and 36. 12 What is the greatest common divisor of 12305 and 345? 115 Calculate the highest common divisor of 158 and 1185. 79 What is the greatest common divisor of 4576 and 143? 143 Calculate the greatest common factor of 30336 and 79. 79 What is the highest common divisor of 63 and 511? 7 What is the highest common divisor of 2290 and 10? 10 What is the highest common factor of 7 and 896? 7 What is the highest common divisor of 38 and 9994? 38 What is the greatest common factor of 125 and 2125? 125 What is the greatest common factor of 2 and 4? 2 Calculate the greatest common divisor of 6012 and 108. 36 Calculate the highest common divisor of 812 and 84. 28 What is the greatest common divisor of 34 and 1241? 17 What is the highest common divisor of 22 and 4? 2 Calculate the highest common divisor of 864 and 320. 32 What is the highest common divisor of 10960 and 720? 80 Calculate the greatest common divisor of 324 and 27. 27 What is the highest common factor of 51 and 17? 17 What is the highest common divisor of 285 and 5745? 15 Calculate the greatest common factor of 32500 and 260. 260 What is the highest common factor of 15997 and 51? 17 Calculate the greatest common factor of 504 and 56. 56 Calculate the greatest common factor of 990 and 3168. 198 Calculate the greatest common divisor of 1007 and 53. 53 Calculate the highest common divisor of 4 and 7. 1 What is the highest common factor of 1020 and 60? 60 Calculate the highest common divisor of 10 and 2900. 10 What is the highest common factor of 483 and 6? 3 Calculate the highest common divisor of 34 and 19465. 17 Calculate the greatest common divisor of 6921 and 63. 9 What is the greatest common divisor of 117 and 7800? 39 Calculate the greatest common divisor of 1817 and 46. 23 What is the highest common divisor of 2007 and 2453? 223 What is the highest common factor of 189 and 12096? 189 Calculate the highest common factor of 15 and 50. 5 Calculate the greatest common divisor of 456 and 19. 19 What is the greatest common factor of 10 and 14845? 5 Calculate the highest common divisor of 148 and 36. 4 What is the highest common divisor of 286 and 494? 26 What is the highest common factor of 34 and 24667? 17 Calculate the greatest common divisor of 112 and 16016. 112 Calculate the highest common factor of 4728 and 504. 24 Calculate the greatest common divisor of 207 and 138. 69 What is the greatest common divisor of 17 and 833? 17 Calculate the greatest common factor of 69 and 161. 23 What is the highest common divisor of 582 and 7954? 194 Calculate the greatest common factor of 1030 and 50. 10 What is the highest common divisor of 365 and 4672? 73 What is the highest common divisor of 55 and 583? 11 What is the highest common factor of 2597 and 49? 49 Calculate the highest common divisor of 1055 and 4642. 211 What is the highest common divisor of 28 and 182? 14 What is the highest common divisor of 260 and 2444? 52 What is the highest common factor of 36 and 117? 9 What is the greatest common factor of 29 and 18560? 29 Calculate the greatest common divisor of 708 and 177. 177 Calculate the greatest common divisor of 16 and 29. 1 What is the highest common factor of 825 and 1320? 165 Calculate the greatest common factor of 2560 and 24. 8 What is the highest common divisor of 60 and 390? 30 Calculate the highest common divisor of 496 and 8. 8 Calculate the highest common factor of 45 and 9. 9 Calculate the highest common factor of 206 and 6. 2 What is the greatest common divisor of 52 and 1534? 26 Calculate the highest common divisor of 500 and 25. 25 Calculate the highest common divisor of 6292 and 12. 4 What is the greatest common divisor of 4300 and 60? 20 What is the greatest common divisor of 3061 and 1? 1 What is the highest common divisor of 70 and 875? 35 Calculate the greatest common factor of 77 and 5159. 77 Calculate the greatest common factor of 504 and 801. 9 Calculate the greatest common factor of 390 and 5226. 78 Calculate the highest common divisor of 62 and 6355. 31 What is the highest common divisor of 1220 and 80? 20 What is the greatest common factor of 67 and 29681? 67 What is the highest common factor of 1252 and 4? 4 What is the highest common factor of 279 and 1488? 93 What is the highest common factor of 3872 and 32? 32 What is the highest common divisor of 27 and 15? 3 What is the greatest common divisor of 7500 and 30? 30 Calculate the greatest common factor of 1 and 577. 1 Calculate the highest common divisor of 135 and 378. 27 What is the highest common factor of 9354 and 6? 6 Calculate the highest common factor of 1003 and 34. 17 Calculate the highest common factor of 2 and 16. 2 What is the greatest common factor of 412 and 4? 4 What is the greatest common factor of 22999 and 1266? 211 What is the greatest common factor of 833 and 17? 17 Calculate the highest common divisor of 135 and 2340. 45 Calculate the highest common factor of 1533 and 21. 21 What is the greatest common divisor of 152 and 1007? 19 What is the greatest common factor of 186 and 1426? 62 What is the greatest common divisor of 495 and 396? 99 Calculate the highest common divisor of 144 and 27. 9 Calculate the highest common factor of 13 and 767. 13 What is the greatest common divisor of 3337 and 517? 47 What is the highest common divisor of 224 and 476? 28 What is the greatest common factor of 262 and 4847? 131 What is the highest common divisor of 88 and 1716? 44 What is the greatest common divisor of 37 and 740? 37 Calculate the greatest common divisor of 8 and 2096. 8 What is the highest common factor of 993 and 6? 3 Calculate the greatest common divisor of 475 and 798. 19 What is the greatest common divisor of 17406 and 18? 18 Calculate the highest common divisor of 494 and 234. 26 What is the highest common factor of 5746 and 7514? 442 Calculate the greatest common factor of 154 and 110. 22 What is the highest common factor of 38 and 5833? 19 Calculate the highest common factor of 1868 and 3. 1 Calculate the greatest common divisor of 75 and 10025. 25 What is the highest common factor of 78 and 858? 78 Calculate the highest common factor of 738 and 4674. 246 What is the greatest common factor of 4590 and 210? 30 What is the greatest common factor of 135 and 5? 5 Calculate the greatest common divisor of 6896 and 16. 16 Calculate the greatest common divisor of 19 and 20843. 19 Calculate the greatest common factor of 2262 and 18. 6 Calculate the greatest common divisor of 992 and 62. 62 What is the greatest common divisor of 639 and 497? 71 What is the greatest common divisor of 16287 and 801? 267 What is the greatest common factor of 462 and 154? 154 What is the highest common factor of 9 and 135? 9 What is the highest common factor of 44 and 4? 4 Calculate the highest common factor of 94 and 94. 94 Calculate the highest common divisor of 116 and 4814. 58 Calculate the greatest common divisor of 8041 and 11. 11 Calculate the greatest common factor of 52 and 52. 52 What is the highest common factor of 348 and 58? 58 What is the highest common factor of 7634 and 154? 22 What is the highest common factor of 24 and 48? 24 What is the greatest common factor of 1750 and 525? 175 What is the greatest common factor of 3476 and 22? 22 Calculate the highest common factor of 4 and 3276. 4 What is the highest common factor of 14215 and 5? 5 What is the greatest common factor of 2067 and 583? 53 Calculate the greatest common divisor of 32 and 50. 2 Calculate the highest common divisor of 22 and 341. 11 What is the greatest common factor of 341 and 31? 31 Calculate the greatest common factor of 232 and 174. 58 Calculate the greatest common factor of 56 and 164. 4 What	{ "pile_set_name": "DM Mathematics" }
what is 44162465024 + -1? 44162465023 In base 3, what is 112102122120120 - 10? 112102122120110 In base 4, what is -13302223000302 + 3? -13302223000233 In base 6, what is 14 + -3151533300? -3151533242 In base 8, what is 10 - -456450077? 456450107 In base 16, what is -5 + -127d19f? -127d1a4 In base 15, what is 156134 - -a? 15613e In base 12, what is 41a173 - 16? 41a159 In base 3, what is 110201002112222210 - -12? 110201002112222222 In base 5, what is 202134414 + 304? 202140223 In base 10, what is 1397053 - 49? 1397004 In base 16, what is -4a91 - 20fa? -6b8b In base 14, what is -3a324 + -10? -3a334 In base 3, what is -1120101120 + 10112? -1120021001 In base 10, what is -34 + -679283? -679317 In base 8, what is -123460 + -6032? -131512 In base 14, what is 364 + 3c? 3a2 In base 9, what is 73216 - -287? 73514 In base 8, what is 30443155 - -74? 30443251 In base 8, what is 265 - -17146? 17433 In base 8, what is -435 + 52140? 51503 In base 7, what is -343430 + 14166? -326231 In base 6, what is 1233412 + 345? 1234201 In base 12, what is -1b07 - -1274? -853 In base 4, what is -1031220 + -210020? -1301300 In base 14, what is 131 - -67d5? 6926 In base 16, what is -33b03c + b1? -33af8b In base 7, what is -15236 + -313442? -332011 In base 12, what is -584a04b5 + -2? -584a04b7 In base 5, what is 2004321 - 310131? 1144140 In base 6, what is 13430211545 + -4? 13430211541 In base 8, what is -1 - -555061? 555060 In base 12, what is 1273861 + -3? 127385a In base 16, what is -2eb + 417fc? 41511 In base 6, what is 10 + -503424455? -503424445 In base 14, what is 488b932 - -3? 488b935 In base 8, what is 2377330 - 1563? 2375545 In base 12, what is 2253 - -1321? 3574 In base 9, what is 6 - 580623? -580616 In base 2, what is 1010100101000010010010 + -1101? 1010100101000010000101 In base 5, what is -11031 + -3012133? -3023214 In base 15, what is -59c5d + 5d? -59c00 In base 8, what is 24100161 + 3? 24100164 In base 6, what is 30 + -2023524043? -2023524013 In base 12, what is 4 - -3844080? 3844084 In base 3, what is -22222120020 - 12002211? -100011200001 In base 11, what is -783796a + -17? -7837986 In base 9, what is 4 - 3273748? -3273744 In base 7, what is -12420660615 - 5? -12420660623 In base 11, what is -179 - -771? 5a3 In base 15, what is 266d + 43eb? 6a69 In base 12, what is -278b67a4 + 13? -278b6791 In base 16, what is 19 + c4cd15? c4cd2e In base 14, what is 1 - -bd7906? bd7907 In base 16, what is -17 - -12e727c? 12e7265 In base 12, what is -b411a - 66? -b4184 In base 14, what is -4 - -4602878? 4602874 In base 15, what is -a0296011 - -4? -a029600c In base 14, what is 214 - -6787d? 67a93 In base 16, what is 12f0 + -cc2? 62e In base 2, what is -101010101001111100000110 + -100? -101010101001111100001010 In base 5, what is -104412 - 2100401? -2210313 In base 4, what is 10111232 + -2103? 10103123 In base 10, what is -379150 - 49? -379199 In base 10, what is 897 + 310034? 310931 In base 3, what is -210201001 + -10202222? -221111000 In base 7, what is -316 - 320531? -321150 In base 8, what is -31052164 + -2? -31052166 In base 2, what is 10011001010 - -11100010100010? 11110101101100 In base 15, what is -167 + -90585? -906ec In base 9, what is 1556 + -4517? -2851 In base 3, what is 11112202100 - 0? 11112202100 In base 3, what is -22001 + -102120110? -102212111 In base 5, what is -411 + 1023103042? 1023102131 In base 12, what is 12b6 - -3867? 4b61 In base 12, what is 4116758 - 5? 4116753 In base 15, what is -5 - 21b4581? -21b4586 In base 6, what is -211243532 - 12? -211243544 In base 14, what is -628889 - -18? -628871 In base 11, what is 8690 + -236? 8455 In base 12, what is -15437 + 2a22? -12615 In base 4, what is 30220001130 + -10001? 30213331123 In base 11, what is -127863a8 + 3? -127863a5 In base 8, what is -16723315726 - 5? -16723315733 In base 2, what is 10010101010000110010 + -10110? 10010101010000011100 In base 12, what is 1796173 - 1? 1796172 In base 11, what is 34a78465 + -1? 34a78464 In base 4, what is 2122002320 + -103? 2122002211 In base 7, what is -2435654304 + 4? -2435654300 In base 4, what is -210312010 - 23312? -211001322 In base 11, what is 842976 - -28a? 843155 In base 3, what is 1 - -11000202000102? 11000202000110 In base 14, what is 0 + 19c93? 19c93 In base 15, what is 33a8ea9 - 0? 33a8ea9 In base 9, what is -1 - -77300727? 77300726 In base 5, what is -2 - -423134304234? 423134304232 In base 12, what is -1633 - 2401? -3a34 In base 6, what is -3015 + -11334333? -11341352 In base 5, what is -2 - 32304003343? -32304003400 In base 14, what is 109d - 15d7? -538 In base 3, what is -222122011102211011 - 2? -222122011102211020 In base 8, what is 224206714 + -3? 224206711 In base 4, what is 301001021321310 + -11? 301001021321233 In base 8, what is 4 - 111076053? -111076047 In base 2, what is 1001011010 + 1111111111100010? 10000001000111100 In base 7, what is 1220614150 - 4? 1220614143 In base 14, what is -3 - -4ada4ca? 4ada4c7 In base 4, what is 1 - 122331012233? -122331012232 In base 9, what is -17165032 - 2? -17165034 In base 4, what is 12110013 + -212? 12103201 In base 9, what is 144670 + 6? 144676 In base 14, what is -34c - -d006? ca98 In base 15, what is de6 - 1892? -99b In base 10, what is 269 + -18458? -18189 In base 5, what is -244423431022 - -2? -244423431020 In base 10, what is 416650 - 265? 416385 In base 4, what is 11 - -20033013002? 20033013013 In base 4, what is -10 + -2030001110110? -2030001110120 In base 12, what is -3 + 202b4352? 202b434b In base 4, what is 232 - 323321223? -323320331 In base 5, what is 2333322122 - 123? 2333321444 In base 2, what is 10000010110 - 101010101? 1011000001 In base 10, what is -38683 + -7021? -45704 In base 10, what is -38489 + -10521? -49010 In base 6, what is -3 + 5212222310? 5212222303 In base 5, what is 1000 + 1433343? 1434343 In base 2, what is 10011010110 - -111101001101? 1010000100011 In base 16, what is 6 + 146853? 146859 In base 2, what is 11101111111001111101 + 11111? 11101111111010011100 In base 12, what is 18 - 79861? -79845 In base 11, what is 109 + 3a01? 400a In base 4, what is -1102 - -100131331102? 100131330000 In base 7, what is -26 + -261453042? -261453101 In base 15, what is -107139 - 29? -107163 In base 8, what is -2074622 + -34? -2074656 In base 4, what is -2013313211 + 312? -2013312233 In base 15, what is 6 - -4610bc8? 4610bce In base 15, what is 190 - 3166b? -314cb In base 14, what is b + -1c78768? -1c7875b In base 15, what is 1c - -77dddd? 77de0a In base 12, what is 5 + 968506? 96850b In base 9, what is -1 - 21210801? -21210802 In base 12, what is -1061 - -105a? -3 In base 7, what is 10532031446 - 2? 10532031444 In base 3, what is 111000 - 1101121100? -1101010100 In base 10, what is -4843537 - 21? -4843558 In base 14, what is 65a141 - -5? 65a146 In base 5, what is -332113 + 2040243? 1203130 In base 12, what is 1a93667 + 3? 1a9366a In base 9, what is -230 - -314854? 314624 In base 3, what is -2111001020 - -122? -2111000121 In base 11, what is 0 + -18716a5? -18716a5 In base 14, what is -5 + 15014889? 15014884 In base 14, what is -10c5ac - 40b? -10c9b9 In base 16, what is 76f - 60e3? -5974 In base 8, what is -245703500 + -6? -245703506 In base 10, what is 22606 - -244? 22850 In base 11, what is 178929 + 369? 179197 In base 10, what is 193693 + 50? 193743 In base 5, what is -434301304 + 342? -434300412 In base 5, what is 344 - 223012? -222113 In base 13, what is -184 - 4b183? -4b337 In base 16, what is -185 - 1380? -1505 In base 11, what is -245 - 4475? -470a In base 5, what is -12442334 - -112? -12442222 In base 3, what is 210220112100001 - 101? 210220112022200 In base 6, what is -21 - -122154420? 122154355 In base 12, what is 12328 + -24131? -11a05 In base 5, what is 3 + -401432204? -401432201 In base 3, what is -2 - -111220012110021? 111220012110012 In base 12, what is -4 - -332b0094? 332b0090 In base 16, what is 87c3 + 26a? 8a2d In base 5, what is -1003301 - -120023? -333223 In base 4, what is 12112 + 12313321? 12332033 In base 10, what is -17 + 781528? 781511 In base 3, what is -20020110002220 - 10? -20020110010000 In base 12, what is 43a011b0 + -1? 43a011ab In base 15, what is -c9cab39 + 3? -c9cab36 In base 16, what is -1dfd78 - -2? -1dfd76 In base 3, what is -22 + 10012021111? 1001202101	{ "pile_set_name": "DM Mathematics" }
+ 3m = -m - 10, -aw = -4m + 26. Let t = 12 + w. Calculate the remainder when 15 is divided by t. 3 Let g = 16 - 11. Suppose 4w - ga + 0 + 8 = 0, -4w = -3a. Suppose 0 = k - 5, -151 = -5i + wk + 9. Calculate the remainder when i is divided by 18. 17 Let f(o) = -5o + 2. Calculate the remainder when 94 is divided by f(-6). 30 Suppose -2i + 5i = 0. Let h(f) = f3 + f2 - f + 7. Calculate the remainder when 20 is divided by h(i). 6 Suppose 3c - 38 = -4u, c - 4u = -7 - 7. What is the remainder when 22 is divided by c? 4 Calculate the remainder when (-34 + 7)(-4)/6 is divided by 5. 3 Let k(z) = -2z2 + 16z + 8. Calculate the remainder when 28 is divided by k(8). 4 Let v(m) = m*3 - 2m*2 + 5m - 4. Let n(x) = -2x3 + 5x*2 - 14x + 11. Let a(l) = -4n(l) - 11v(l). Calculate the remainder when 57 is divided by a(-2). 27 Let x = -232 + 419. Suppose -2n + x = 79. What is the remainder when n is divided by 14? 12 Let d(f) = f2 - f + 2. Calculate the remainder when d(-5) is divided by 18. 14 Let z = 92 - 78. Calculate the remainder when 153 is divided by z. 13 Let c = 7 - 4. Calculate the remainder when 6 is divided by c. 0 Suppose 4i + 17 = -7. Let f(a) = a2 + a - 12. Calculate the remainder when 51 is divided by f(i). 15 Let o(q) = -q3 + 6q2 + 5q - 9. Calculate the remainder when o(6) is divided by 11. 10 Suppose 5j = 3x - 59, 2j + 85 = 5x - 3j. Suppose -2l = -l + x. Let s = l + 21. Calculate the remainder when s is divided by 3. 2 Let k = 4 + 1. Suppose 0 = -3t - t + 16. Suppose -p + 44 = th + 3p, -9 = -3p. What is the remainder when h is divided by k? 3 Suppose 3x - 43 - 2 = 0. Calculate the remainder when 58 is divided by x. 13 Suppose -3r + 4 = -4r - 4n, -4n - 16 = -2r. Calculate the remainder when r is divided by 4. 0 What is the remainder when -2(-25)/2 - 3 is divided by 7? 1 Let t be 127/((-3)/(-1)). Let h be (t/6 + -2)-4. Suppose 3d - 4n - 185 = -hd, 0 = -5n. What is the remainder when d is divided by 13? 11 Suppose p + b = 0, -7 = -p + 3b + 9. Suppose pu - 4 = 28. What is the remainder when 22 is divided by u? 6 Suppose -5 = -2k - 1. Let m(n) = -n*2 + n + 11. Let x be m(0). Let w = x + -6. Calculate the remainder when w is divided by k. 1 Let q = 3 + -4. Let a be ((-2)/2 + 4)/q. What is the remainder when (-3)/(a + 0) - -1 is divided by 2? 0 Suppose 2u + 0u = 2p + 32, -5u + 130 = 5p. What is the remainder when 39 is divided by u? 18 What is the remainder when 13 is divided by 2(-4)/2 - -12? 5 Let d be (-1)/(1/(-2))-1. Calculate the remainder when d/6 + 426/9 is divided by 24. 23 Let j(q) = 7q2 - 3q. Let t be j(2). Suppose 14 = 3h - t. Calculate the remainder when 46 is divided by h. 10 Suppose z = 4i - 55, i + 0z = -2z + 16. Calculate the remainder when 39 is divided by i. 11 Let f(b) = 11b + 4. What is the remainder when 76 is divided by f(2)? 24 Suppose -4u = 5i - u - 141, -3i + 75 = -3u. What is the remainder when i is divided by 15? 12 What is the remainder when ((-32)/(-12) + -3)-45 is divided by 8? 7 Calculate the remainder when 6/(((-21)/(-8))/7) is divided by 10. 6 Let b be -3 - -2 - 18/(-6). Calculate the remainder when ((-35)/b)/7-4 is divided by 4. 2 Let u = 91 - 71. Suppose 0 = m - 5v + 13, 0 = 2m + m - 3v - 9. What is the remainder when u is divided by m? 6 Suppose 0 = 3m - 5d - 16 + 4, 0 = -3m - 5d + 12. Calculate the remainder when 8 is divided by m. 0 Suppose 3f - 4 = 11, 5z - 4f - 345 = 0. Calculate the remainder when z is divided by 19. 16 Suppose -3o + 8 = -13. Suppose -p = 5t - 28, -4p + 10 = 4t - t. Suppose -t - 54 = -5n. Calculate the remainder when n is divided by o. 5 Let f = 89 - 63. Suppose 4d + 10 = -3l - 0d, 0 = -3l + d - 20. Let m = l + 20. Calculate the remainder when f is divided by m. 12 Let f(v) = v*2 - v - 2. Let d be f(3). Suppose r = -0r + 32. Calculate the remainder when r is divided by (d/(-6))/((-6)/153). 15 Suppose x + m + 2m = 119, 528 = 4x - m. What is the remainder when x is divided by 33? 32 Let g be (-2)/((-4)/(-2)) - -6. Suppose -4k - g = -5k. What is the remainder when 3/5 + 5 + (-134)/(-10) is divided by k? 4 Suppose 0 = -9o + 4o + 105. What is the remainder when 81 is divided by o? 18 Suppose -t - 4t = -150. Suppose w = 2i - 4w - t, 3w = -3i + 3. Let j = i - 3. Calculate the remainder when j is divided by 1. 0 Let w(o) be the third derivative of -o4/8 - 13o3/6 + o2. Let c be (-3 - -6 - 13)/1. What is the remainder when 49 is divided by w(c)? 15 Suppose 0n + 5n + 20 = 0. Let s(g) = g*2 - 4g - 2. What is the remainder when s(n) is divided by 16? 14 Let c(m) = m*2 + 5m - 2. Let g be c(-6). Suppose gk - k - 9 = -u, -k = 0. Suppose 76 = 3t + 1. Calculate the remainder when t is divided by u. 7 Suppose 0 = 4w - u + 2 + 12, 2u + 16 = -3w. Calculate the remainder when 21 + 1/(w/(-8)) is divided by 13. 10 Let y = -138 + 177. What is the remainder when y is divided by 16? 7 Let b(o) = o2 - o - 3. Let a be b(3). Suppose -ac - 10 = -2d, c = 3d - 1 - 7. Calculate the remainder when 7 is divided by d. 1 Suppose -2t + 3 = t. Let f = t - -4. Suppose 0 = 3r - fg - 145, g - 15 = -r + 44. What is the remainder when r is divided by 19? 17 Let p = 108 - 54. What is the remainder when 2-1 + (p - -1) is divided by 73/4 - 1/4? 17 Suppose 0 = 4c + s - 1524, 2c + 4s + 744 = 4c. What is the remainder when 150 is divided by c/35(-7)/(-2)? 36 Suppose -5l - r = -4r - 87, -5r + 25 = 3l. Let f be 3/(-2)(-64)/6. Let y = f - 7. Calculate the remainder when l is divided by y. 6 Suppose 2o - 2 = 2c, -2o = -5c + 3 + 1. Calculate the remainder when 3 is divided by c. 1 Suppose -5y + 33 = 13. Suppose -3w + yk = 6, -k = -w - 3k - 2. What is the remainder when 14 is divided by (-1 - -3)/1 - w? 2 Let u(b) = -b + 7. Let w(k) = -k*2 + 9k - 15. What is the remainder when w(6) is divided by u(5)? 1 Let w = -10 - 15. Let m = -11 - w. Let n(r) = r*3 - 5r*2 - r - 4. Calculate the remainder when n(6) is divided by m. 12 Let b(p) = -89p*3 - 2p*2 - p - 1. Calculate the remainder when b(-1) is divided by 45. 42 Let u = 58 - 40. Calculate the remainder when 30 is divided by u. 12 Suppose 0p = 2p. Suppose 2d - 3d + 14 = p. Suppose -n + 2 = -6. What is the remainder when d is divided by n? 6 Let b be (8/(-6))/29. Let j = b + 7. What is the remainder when 1 is divided by j? 0 Let a = 138 - 67. Suppose 29 = -3b + a. Calculate the remainder when 4/6(59 + 1) is divided by b. 12 Let j(t) = -t*3 + 9t*2 - 7t + 23. What is the remainder when 60 is divided by j(8)? 29 Let y = -22 - -36. Calculate the remainder when ((-39)/2)/((3/2)/(-3)) is divided by y. 11 Let m be 30/9 - (-4)/6. Suppose mw = 2t - w - 7, -w = t - 7. Calculate the remainder when -2 + 117/6 + (-6)/4 is divided by t. 4 Suppose -60 = -0o - 3o. Let x be o/(-6)(-3 + -3). Suppose -3p + 2p = -x. What is the remainder when 58 is divided by p? 18 Suppose 5 - 10 = -q. What is the remainder when 14 is divided by q? 4 Let q be 1/3 - (-70)/(-3). Let k = 24 - q. What is the remainder when k is divided by 16? 15 Let y(x) = 4x*2. Let b(a) = 29a3 + a2 - a + 1. Calculate the remainder when b(1) is divided by y(-2). 14 Let m(r) = 22r2. Suppose 0 = 2s + s - 18. Calculate the remainder when m(1) is divided by s. 4 Let x(n) = n*3 - 11n*2 - 12n + 14. Calculate the remainder when 53 is divided by x(12). 11 Suppose -k + 9h + 74 = 4h, 0 = -2k - h + 170. Calculate the remainder when k is divided by 29. 26 Let w(b) = -b + 19. What is the remainder when 103 is divided by w(-16)? 33 Suppose 5n = 3n. Suppose -3x + 0v = 4v - 30, n = -5v. What is the remainder when 18 is divided by x? 8 Suppose -2q = 76 - 470. What is the remainder when q is divided by 40? 37 Let x be 31 - ((-4 - -2) + 1). Suppose 0 = -5n + n + x. Calculate the remainder when 22 is divided by n. 6 Suppose 5s = 5f - 45, 0 = 5f - 2s + 3s - 39. Suppose -3p - 400 = -fp. Suppose 5c = 45 + p. What is the remainder when c is divided by 9? 7 Let d = 17 - 9. Suppose 0s - d = -s. Let r = 44 + -29. What is the remainder when r is divided by s? 7 Suppose o + 2o - 39 = 0. Let h(x) = 10x - 7. Calculate the remainder when h(3) is divided by o. 1	{ "pile_set_name": "DM Mathematics" }
Let x = -7 - -6. Let v(q) = 1. Let j(a) = -3a - 6. Give xj(u) - 6v(u). 3u Let s(v) = v - 1. Let j(z) = 15z - 24. Let n(u) = -u - 1. Let l(f) = j(f) - 6n(f). Determine l(b) - 18s(b). 3b Let v(a) = 5a2 - 14a + 11. Let i(x) = -2x2 + 5x - 4. Let k = -9 - -24. Let q be 3/(-5) - (-174)/k. Calculate qi(u) + 4v(u). -2u2 - u Let z(s) = -s2 - 1. Let a(f) = -2f*2 - 2f + 1. Give -a(i) - z(i). 3i2 + 2i Let b(f) = 5f2 - f - 4. Let h = 9 + -14. Let n(l) = 11l*2 - 3l - 9. Give hb(o) + 2n(o). -3o2 - o + 2 Let i(c) = -2c - 3 + 10c + 0 - 5c. Let t(f) = -2f + 1. Give 2i(r) + 5t(r). -4r - 1 Let u(o) = -2o - 6. Let x = 16 + -10. Let l(f) = -2f - 5. Give xl(v) - 5u(v). -2v Let v(s) = -7s*2 - 3s - 3. Let n(y) = -14y2 - 7y - 7. Determine -6n(z) + 14v(z). -14z2 Let j(a) = a + 0a + 0 - 5. Let b(o) = -1. Suppose 2 - 7 = -5u. Give uj(y) - 5b(y). y Let w(k) = 2k. Let n(b) = b + 3. Let c be (-92)/4 - (-1 + -1). Let a = -14 - c. Let u(s) = 2s + 7. Let g(v) = an(v) - 3u(v). Give -11g(z) + 6w(z). z Let f(k) = 2k*3 - 3k. Let q(g) be the third derivative of -g6/20 + g4/3 + 11g2 + 2g. Let l be (0 + 0 - 3)/(-1). Give lq(d) + 8f(d). -2d3 Let q(d) = 9d*2 + 8d. Let s(k) = -26k2 - 24k. Let j(t) = -11q(t) - 4s(t). Let l(p) = -3p - 26 + 11 + 15 - 2p*2. What is -3j(v) - 8l(v)? v2 Let y(q) = 0 + 3 - 1 - 6 - 2q*2 - 4q. Let o(l) be the first derivative of -l*3 - 7l*2/2 - 7l + 2. What is 4o(a) - 7y(a)? 2a2 Let q(b) = 6b - 5. Let v = 239 - 235. Let o(a) = -2a - 3a + 6 - 2a. Calculate vo(d) + 5q(d). 2d - 1 Let x = -3 - -9. Let w(f) = f. Let v(a) = 8a - 9. Let l(j) = j - 1. Let g(u) = -36l(u) + 4v(u). Determine xw(r) + g(r). 2r Let z(t) = 6t*3 + 6t. Let r be 5/((-15)/33) - -2. Let y be -4 - (-1 - (-1)/1). Let o(c) = -13c3 - 13c. What is rz(u) + yo(u)? -2u3 - 2u Let m(y) = -11y3 - 11y + 8. Let u(i) = 2i3 - 11i - 2i3 - 7i*3 + 4i + 5. What is 5m(h) - 8u(h)? h3 + h Let m(n) = n3 - n*2 - 7n + 3. Let u(r) = 3r3 - 2r*2 - 21r + 8. What is -11m(k) + 4u(k)? k*3 + 3k*2 - 7k - 1 Suppose -4y - v = -7, -y - 4v = -7v - 18. Let d(j) = -j2 + j + 1. Let k(r) = 8r*2 - r - 3. Calculate yd(f) + k(f). 5f2 + 2f Let b(d) = -9d3 - 8d - 18. Let m(s) = -6s3 - 5s - 12. Give 5b(x) - 8m(x). 3x3 + 6 Let l(r) = -2r - 1. Let o(i) = 4i + 2. Let q be -5 + 2 + -3 + 1. Let z(m) = -6m - 39. Let x be z(-6). What is ql(u) + xo(u)? -2u - 1 Let n(j) = -7j + 5. Let c(y) = -9y + 14 - 11y + 0y. Let q = -38 + 21. What is qn(h) + 6c(h)? -h - 1 Let c(k) = -2k - 3. Let v(g) = -g + 1. What is -2c(z) + 6v(z)? -2z + 12 Let i(v) = -3v + 1. Let d(m) = 5 + 1 - 9 + 4 - m. Suppose 2y - 5q - 21 = 0, 5 = -2y - q - 4. Calculate yi(l) + 4d(l). 2l + 2 Let f(l) = -l*2 + 8. Suppose -5z = -4z - 6. Let g(h) = -2h*2 + 17. Calculate zg(j) - 13f(j). j2 - 2 Let w be -1(4 + (-8)/4 - -2). Let f = 2 + 1. Let i(c) = -3c2 - 5 - 2c - 2c + 2c*2 - fc*3. Let k(u) = -2u3 - u2 - 3u - 4. Give wk(y) + 3i(y). -y3 + y2 + 1 Let k(n) = -8n*2 + 13n + 9. Let j(s) = s*2 - s + 1. Let t(h) = -2j(h) - k(h). Let c(x) = -x*2 + 2x + 2. Suppose 0 = -7w - w - 16. Give wt(f) - 11c(f). -f2 Let t(g) = g2 + 3. Let n(p) = -2p*2 - 5 + 0 - 3 + 1. Calculate -3n(z) - 7t(z). -z2 Let l(j) = -2j*2 - 4j + 1. Let c(z) = -3z + 4z + z*2 + 2z - 2z. Determine -4c(b) - l(b). -2b2 - 1 Let c(g) = -3g - 1. Let b be c(-1). Let o(x) = 5x3 + 3x*2 + 3x - 2. Let f(d) = 3d2 + 0d + 1 - 5d2 - 4d*3 - 2d. Calculate bo(r) + 3f(r). -2r3 - 1 Let o(v) = v - 1. Let y(a) = -2a*2 + a + 2. Let t be 0/(-1) + 5 + -4. What is ty(j) + o(j)? -2j2 + 2j + 1 Let g(l) = -175l. Let s(i) = -22i. Give 6g(z) - 49s(z). 28z Let j(f) be the third derivative of -f4/12 + f3/2 + 7f*2. Let o = 4 + -2. Let u(a) = 1. Let g = -9 + 8. What is gj(v) + ou(v)? 2v - 1 Let q(h) = -4h3 + 11h*2 + 7h + 7. Let f(r) = -r + 5. Let z be f(9). Let v(s) = 2s3 - 6s*2 - 4s - 4. Give zq(i) - 7v(i). 2i3 - 2i*2 Let i(n) = 2n*3 - 3n*2 + 6n + 8. Suppose -2c - 1 = s, -3s - 12 = 3c - 0c. Let h(u) = 2u3 - 4u*2 + 7u + 9. Determine si(p) + 6h(p). -2p3 - 3p*2 - 2 Let y(w) = -3w + 8. Let d(i) = -1. Let v(l) = 6d(l) + y(l). Let p(a) = 2a - 1. Calculate -7p(u) - 4v(u). -2u - 1 Let f(n) = n + 5. Let h(l) = l + 4. Let i(d) = -2d*3 - 4d*2 - 4d + 1. Let o be i(-3). Suppose t - w + 12 = 0, -o = 4t + w - 8. Determine th(x) + 6f(x). -x + 2 Let b(q) = -4q*2 - 3q - 2. Let f(j) = -17j2 - 13j - 9. Determine -18b(w) + 4f(w). 4w2 + 2w Let f(s) = 14s3 - 5s*2. Let j(r) = 5r*3 - 2r*2. Suppose -8b - 10 = 22. Suppose 3w - 2w - 11 = 0. Determine bf(u) + wj(u). -u*3 - 2u*2 Let w(r) = 4r*3 - 2r + 2. Let j(v) = -21v3 + 11v - 11. Suppose -i - 4 = i. Determine ij(z) - 11w(z). -2z3 Let r(h) = -2h*2 + h + 3. Let u = -11 + 17. Let b = 8 - u. Let c(l) = 2 + 0l*2 - 2l - 7 + 4lb. Calculate 3c(m) + 5r(m). 2m*2 - m Let l(b) = -15b - 2. Let t(w) = 16 - 8w - 17 + 0w. What is 6l(h) - 11t(h)? -2h - 1 Let k be 8/(-6)(-1)/((-4)/(-6)). Let o(p) = -p*3 + 2. Let n(f) = -12f*3 + 27. Determine kn(t) - 27o(t). 3t*3 Let t(i) = 7i*3 + 9i*2 + 13i + 5. Let l(u) = u + u*2 - 3u*3 - 5u*2 - 7u - 2. Give 9l(g) + 4t(g). g*3 - 2g + 2 Let v(z) = -z3 + z2 - z + 1. Let r(s) be the third derivative of -s6/12 + s5/12 - 5s4/24 + 5s*3/6 - 28s*2. Calculate -r(p) + 5v(p). 5p3 Let k(m) = 2m - 21. Let d be k(13). Let f(g) = -4g3 - 2g*2 - g - 1. Let b(v) = 9v*3 + 5v*2 + 2v + 3. Calculate df(x) + 2b(x). -2x3 - x + 1 Let o(h) = h3 - 2 - 3h*3 + 2 - 4. Let v = 0 + 1. Let w(i) = v - 3 - 2i*3 - 1. Give -3o(a) + 4w(a). -2a3 Let m(b) = b3 + 3b + 3. Let d = 1 - -19. Let w be 5/(-2)(-24)/d. Let f be w/6 + (-1)/(-2). Let c(h) = -h*3 - h - 1. Give fm(i) + 3c(i). -2i3 Let g be (-8)/16 - 26/(-4). Let h(d) = -d3 + 1. Let z(s) = -5s3 + 8. Calculate gh(q) - z(q). -q*3 - 2 Let g(q) = q + 3. Let o(m) = -1. Suppose -8 = 2l - 3l. Suppose -5t = 2w + 10, l = -4t - 3w + 6w. Give to(y) - g(y). -y - 1 Let w(q) = -6q*3 - 13q - 13. Let c(s) = 3s3 + 6s + 6. Let n = -20 - -30. Let y = n - 23. Give yc(z) - 6w(z). -3z3 Let j(k) = k. Let z(d) be the first derivative of 3d*2 + d - 3. Let q be (3/2 + -2)-2. What is qz(h) - 5j(h)? h + 1 Let i(b) = 9 + 1 + b*2 - 3 - 9b. Let w = 34 - 16. Suppose -4u = -5c + 28, -3u + 2c = 2u + w. Let t(m) = -4m + 3. Determine ui(d) + 5t(d). -2d2 - 2d + 1 Let q = 5 + -2. Let x(y) = -1 - q + y + 0y - 4y*2 + y. Let r(p) = -2p*2 + p - 2. Give 11r(h) - 6x(h). 2h*2 - h + 2 Let n(k) = -3 + 2k*2 + 4k - 9k + 3 + 3. Let r(t) = 11t*2 - 29t + 17. Calculate -34n(c) + 6r(c). -2c2 - 4c Let r(o) = -o - 7. Let i(s) = 2s + 6. Determine 3i(n) + 4r(n). 2n - 10 Let s(l) = 2l + 7. Let u(j) = -j. Let z(i) = -i + 3. Let x(d) = -2u(d) + z(d). Suppose -3q - 2q = -2f - 33, 0 = 2q + 5f + 10. Give qx(w) - 2s(w). w + 1 Let w(b) be the second derivative of -5b + b*3 + 4b*2 + 3b*2 - 4b*2 - 6b*2. Let k(r) = 4r - 4. Give -7k(o) + 5w(o). 2o - 2 Let a(o) = o - 1. Let y(p) = -6p + 6. Let u(c) = -2a(c) - y(c). Let k(r) = 6r - 6. Let v = 12 - 7. What is vk(b) - 8u(b)? -2b + 2 Suppose 0 = 2h - h - 3. Let r(x) = 5x - 4. Let t(c) = 4c - 4. Give hr(g) - 4t(g). -g + 4 Suppose -16 = -2w - h + 6, -2h + 17 = w. Let r(l) = 4l2 - 9l + 9. Let y(u) = 2u2 - 4u + 4. Suppose -4f - 17 = -1. Calculate fr(m) + wy(m). 2m*2 Let x(v) = 6v + 1. Let r be (-1)/(-2(-1)/(-4)). Let u(k) = -2k. Determine rx(d) + 7u(d). -2d + 2 Let l(q) = 17q - 2. Let x(v) = -17v + 2. Determine -2l(z) - 3x(z). 17z - 2 Let j(z) = -34z + 8. Let h(d) = 35d - 9. Calculate 6h(m) + 7j(m). -28m + 2 Let y(h) = 12h*3 - 2h - 3. Let m(t) = -t - 1. Calculate -2m(b) + y(b). 12b*3 - 1 Let t(d) = -d - 3. Let w(s) = 1. Let c(x) = -3t(x) - 5w(x). Let o(u) be the first derivative of -u2 - 2u - 3. Give -3c(m) - 5o(m). m - 2 Let x(m) = -m*2 + 5m. Let w be x(4). Let y(s) = 10*s - 4. Le	{ "pile_set_name": "DM Mathematics" }
arest to 0 in -17, -2, -1, -36? -1 Which is the nearest to 2/3? (a) -0.08 (b) -2/3 (c) -108 a Which is the nearest to 3/4? (a) 205 (b) -1 (c) -2 (d) 2 d What is the closest to -0.2 in -4/7, -2/9, -4, -26, 1.8? -2/9 Which is the nearest to 0.1? (a) 13 (b) -3/2 (c) -23 (d) -0.1 d What is the closest to 5.9 in -4.8, 4, -3? 4 Which is the closest to -0.5? (a) -1 (b) -48/5 (c) -0.2 c Which is the closest to 1/2? (a) -2/3 (b) 48 (c) -0.1 c Which is the closest to -1? (a) 6 (b) 4.2 (c) 3 (d) -0.3 (e) -2 d What is the closest to -1/4 in 1/33, -2, -1.4, 0.6? 1/33 What is the nearest to 1/7 in 0.4, -0.06, -9.5, -0.2, -0.7? -0.06 What is the nearest to 1/3 in -0.1, -1882, -3/19, -14, -1? -0.1 Which is the closest to -2? (a) -0.019 (b) 32 (c) -1/2 c What is the nearest to 2.9 in -0.001, 0.5, -2, -0.2, 2? 2 Which is the closest to -1425? (a) -1 (b) 13 (c) 0.1 a Which is the closest to 1? (a) -0.24 (b) 3 (c) 2/77 c Which is the closest to -2? (a) -4 (b) 0.4 (c) -3/10 (d) 1089 (e) -5 c What is the closest to 3.7 in -2/11, -5, 3/8? 3/8 What is the nearest to 4 in 1, 0.24, -4, -2/33? 1 What is the nearest to 0.6 in 3/5, -12, -2/33? 3/5 Which is the nearest to 1/4? (a) -14.7 (b) -1/4 (c) 10 (d) -0.04 d Which is the closest to 2? (a) 4 (b) -64 (c) -152 (d) 0.4 d What is the closest to -0.1 in 0, -25, -0.07, -1, 12? -0.07 What is the nearest to 2/21 in -10/13, 2/7, 3/7, 3? 2/7 Which is the nearest to -0.049? (a) -4 (b) -16 (c) -1/2 (d) -2/3 c What is the closest to -16 in 2/5, 82, 9? 2/5 Which is the nearest to 665? (a) -0.1 (b) -2 (c) -5 (d) 1/2 d What is the nearest to 27580.7 in 1/8, -2, 4, 1/4? 4 Which is the closest to -21429? (a) -1/4 (b) 0.1 (c) 2/5 a What is the closest to 1 in -0.01, 3422, 7? -0.01 Which is the closest to -1/2? (a) 33 (b) 5 (c) 0.374 c What is the closest to -148 in 0.2, -0.0761, -2/27? -0.0761 What is the nearest to 408 in 1/5, -0.13, -0.2, 1/3? 1/3 Which is the closest to 0? (a) 12 (b) 0 (c) -2.62 (d) 0.05 (e) -0.1 b What is the closest to 1 in 1/9, 91, 0.985, 3? 0.985 Which is the nearest to 0.1? (a) -8 (b) -27 (c) 1532 a Which is the nearest to -0.9? (a) 1 (b) 58.8 (c) -1 (d) -0.3 c What is the nearest to -3 in -10, -0.5, -22, -0.1, 13? -0.5 Which is the closest to -1/10? (a) 181 (b) 0.1 (c) -2/9 c What is the closest to -1.7 in 0.1, 3, -2, 2077? -2 What is the nearest to -1 in 511, 0.7, 3? 0.7 What is the nearest to 2/39 in 1/15, -4, -0.1? 1/15 What is the closest to -0.1 in -4, 0, 23, -7, -61? 0 What is the closest to -0.079 in -0.5, -113, 5? -0.5 Which is the nearest to 9? (a) -4 (b) 0.03 (c) -15 (d) -3 b What is the closest to 1/6 in -0.5, 1, -0.2, -114, -0.03? -0.03 Which is the closest to -2? (a) -1/3 (b) -3 (c) 0.2 (d) -5 (e) -1/2178 b Which is the closest to 1? (a) -1/3 (b) -0.419 (c) -4 (d) 1 d What is the nearest to 1/6 in 27, -1, 6? -1 What is the closest to 1/19 in 0.5, 0.2, -5, -0.1, 5? 0.2 What is the closest to 0 in 0.1, -29/51, 15, -31, 5? 0.1 What is the nearest to 1/7 in -2, 8, -0.07? -0.07 What is the closest to 75 in -3/4, 49, -0.38? 49 Which is the closest to 20? (a) 0.036 (b) -3 (c) 3 (d) 3/5 c Which is the nearest to 149? (a) -1/3 (b) 1.1 (c) -2 (d) -0.2 (e) 0.2 b What is the nearest to 4 in 0.3, 1.23, 4/3, 0.1? 4/3 Which is the closest to 0.418? (a) 0.14 (b) 0.1 (c) 2 a What is the nearest to -2 in 1, -1/4, 17? -1/4 What is the closest to -0.23 in -1/2, 1, -221? -1/2 What is the nearest to -37 in -1, -0.54, 5? -1 Which is the nearest to 0.1? (a) -0.1 (b) 0 (c) -13 (d) 3/1150 (e) -2 d Which is the closest to 0? (a) 57/23 (b) 1 (c) -0.2 (d) 5 c What is the nearest to 2/7 in 0.05, -0.2, 1/457? 0.05 What is the closest to 2 in -32, 0.1, 0.088? 0.1 Which is the nearest to 0? (a) 0.3 (b) 64.2 (c) 65 (d) -0.2 (e) -2 d Which is the closest to -2/5? (a) 1 (b) -0.1184 (c) -4 b Which is the nearest to -0.1? (a) -2/11 (b) 10 (c) -2 (d) 1/7 (e) -32 a What is the closest to -1/4 in -1, 0.008, 1/5, -2/3, -0.86? 0.008 Which is the nearest to 0.1? (a) -0.0433 (b) 5 (c) 372 a What is the nearest to 1 in -2/15, 13, -18/13? -2/15 Which is the nearest to -22/45? (a) -3/5 (b) -2/3 (c) -0.5 c Which is the closest to -8? (a) 3 (b) 11 (c) -0.1 (d) -4/7 (e) 3/4 d What is the nearest to 2/3 in -3.3, -0.1, 0.057? 0.057 What is the nearest to 2.4578 in 2, -2/5, 0.4? 2 Which is the nearest to -5? (a) -14 (b) -16/97 (c) 0 (d) 1/5 (e) 0.1 b What is the nearest to 2579 in -0.5, -4, -1/3? -1/3 What is the closest to -188 in 2, -1/3, 15? -1/3 What is the closest to 1 in -16, 1436, 4, 5? 4 What is the closest to 0 in -23, 4, -3/7, 32? -3/7 What is the nearest to 19 in 3, -0.06, -1/21? 3 Which is the nearest to -120/7? (a) -0.4 (b) -3 (c) 7 (d) 64 b Which is the nearest to -0.05? (a) -0.02 (b) -260 (c) 0 a What is the closest to 2 in 0.2, -1065, -1, 2? 2 Which is the closest to -15.4? (a) -2/3 (b) 4 (c) -13 (d) 0.2 (e) -0.1 c What is the closest to 5/18 in 4, 1, -1/4? -1/4 What is the nearest to -1 in 10995, 1/2, 5/12? 5/12 Which is the closest to -0.2? (a) -2 (b) 1/3 (c) 0.2055 c What is the nearest to 2/3 in -91, -4/13, 0.4, 1.4? 0.4 Which is the nearest to -1/4? (a) -62 (b) -7/6 (c) 0 (d) -3 (e) -0.2 e What is the nearest to -3 in -0.2, -4, -2/11? -4 What is the nearest to 1 in 3, -0.07, -2/1383? -2/1383 Which is the closest to 15932? (a) 1/2 (b) -0.1 (c) -2/3 a Which is the closest to 0.008? (a) -2/15 (b) -15 (c) 1/2 (d) -3 a Which is the nearest to 0.1? (a) 183 (b) 1/127 (c) -5 (d) 2/7 (e) 5 b What is the nearest to -1/3 in 3/5, 0.4, -5/4, 132/7, -2/3? -2/3 Which is the closest to 0.2? (a) 3/7 (b) -0.1522 (c) 1 (d) 2 a What is the nearest to 3/2 in 7/4, -0.2, 5, 3.8, 15? 7/4 What is the closest to 0.1 in 1/2, -18, -4, -1/5, 5? -1/5 Which is the closest to -1? (a) 0 (b) -4 (c) 6 (d) -1/11 (e) -0.2244 e Which is the closest to -2/7? (a) -2 (b) 0 (c) -2/11 (d) 2/49 (e) 1/18 c Which is the closest to -3? (a) 1 (b) -0.3 (c) 3156 b What is the closest to 1093 in 2, -9, -3? 2 Which is the nearest to 0.1? (a) 0.1 (b) 1 (c) 7912 (d) -6/7 a What is the closest to -5 in -203.5, 2/13, 1? 2/13 Which is the closest to 10/7? (a) 4 (b) -3/19 (c) -1 (d) -0.3 b Which is the closest to -0.1? (a) -0.2 (b) 0.12 (c) 5 (d) -12 a What is the nearest to -1 in 8/19097, 1/3, -2/13? -2/13 What is the nearest to 2/3 in -4, 0, -1/3605? 0 What is the closest to 0 in -5, 2923, -2/7, -2? -2/7 What is the closest to 4231 in -0.1, 0.1, -5? 0.1 Which is the nearest to 2/7? (a) -0.8 (b) -2/3 (c) 0 (d) -3 c Which is the closest to -10? (a) -634 (b) 5/2 (c) 2 (d) 1/6 (e) 12 d Which is the closest to -3? (a) 1/7 (b) 0.2 (c) -1/7 (d) -1527 c Which is the closest to 3/8? (a) -3/47 (b) -2/5 (c) -17 a Which is the closest to 0.6? (a) 4 (b) 3/4 (c) 2 (d) -6/5 b Which is the nearest to 1? (a) -0.4 (b) -0.2 (c) 2524 (d) -4 b What is the nearest to -3 in -26, -45, 5, 0.5? 0.5 What is the closest to -0.1 in -158, -17, 6, 2/5? 2/5 What is the nearest to 4 in -1006, 3/5, -1/9? 3/5 What is the closest to -0.1 in 2/5, 1/11228, -5? 1/11228 Which is the closest to 4? (a) -2/9 (b) -7 (c) 3.53 c Which is the closest to 6/5? (a) -2 (b) 1275 (c) -1 c Which is the closest to -1168? (a) 5 (b) 2 (c) 0.01 (d) -2 d Which is the closest to -2? (a) -8 (b) 5 (c) 0.38 (d) 0 (e) 0.1 d What is the closest to -18 in 1, -972, -5? -5 What is the nearest to 1 in 16, 10, 4, 5, 2? 2 What is the closest to 0.1 in 0.4, 15.7, -5/23? 0.4 What is the nearest to -0.1 in 22/9, -8/11, -4/5? -8/11 Which is the nearest to -2? (a) -9.3 (b) -1/12 (c) -161 (d) 0 (e) -0.2 e Which is the closest to -1? (a) 0.3 (b) -0.4 (c) -6 (d) -109 (e) -2/7 b What is the closest to -974/5 in -2/17, -0.5, 0.12? -0.5 What is the closest to 2/51 in 14, 4, 3, -3? 3 Which is the nearest to 0.3? (a) 3 (b) -0.02 (c) -5 (d) -0.4 (e) 205 b What is the nearest to 2/3 in -1/6, 0, -0.5, -2/81, -2? 0 What is the closest to -30 in -5, 2/139, -4, -0.3, -1? -5 Which is the nearest to 0.3? (a) -0.2 (b) -5/28 (c) -1/3 b What is the closest to -2/7 in 2.1, -5, 372? 2.1 What is the nearest to -0.205 in -1, 2,	{ "pile_set_name": "DM Mathematics" }
How many minutes are there between 11:01 PM and 1:08 AM? 127 How many minutes are there between 7:53 AM and 3:43 PM? 470 How many minutes are there between 11:20 AM and 9:50 PM? 630 How many minutes are there between 6:10 AM and 3:43 PM? 573 What is 443 minutes after 3:12 PM? 10:35 PM How many minutes are there between 2:26 AM and 4:50 AM? 144 What is 237 minutes after 10:17 PM? 2:14 AM How many minutes are there between 8:01 AM and 5:56 PM? 595 How many minutes are there between 1:57 PM and 6:43 PM? 286 What is 313 minutes before 4:03 PM? 10:50 AM What is 76 minutes after 1:58 AM? 3:14 AM What is 578 minutes before 5:08 PM? 7:30 AM How many minutes are there between 9:27 PM and 3:04 AM? 337 How many minutes are there between 3:15 AM and 5:25 AM? 130 What is 298 minutes after 9:58 AM? 2:56 PM How many minutes are there between 8:58 PM and 9:36 PM? 38 What is 556 minutes after 12:31 AM? 9:47 AM How many minutes are there between 2:04 AM and 6:00 AM? 236 How many minutes are there between 3:01 PM and 11:12 PM? 491 What is 643 minutes after 2:02 AM? 12:45 PM What is 641 minutes after 4:06 AM? 2:47 PM What is 175 minutes after 9:14 AM? 12:09 PM What is 453 minutes before 12:09 PM? 4:36 AM How many minutes are there between 5:21 AM and 11:48 AM? 387 How many minutes are there between 1:19 AM and 12:56 PM? 697 How many minutes are there between 7:11 PM and 3:21 AM? 490 How many minutes are there between 6:06 PM and 11:23 PM? 317 How many minutes are there between 5:04 PM and 10:22 PM? 318 How many minutes are there between 5:15 PM and 2:58 AM? 583 How many minutes are there between 8:38 PM and 7:50 AM? 672 What is 616 minutes after 5:04 PM? 3:20 AM How many minutes are there between 2:43 AM and 10:06 AM? 443 How many minutes are there between 7:19 AM and 9:26 AM? 127 How many minutes are there between 9:12 AM and 1:03 PM? 231 What is 2 minutes after 9:34 AM? 9:36 AM How many minutes are there between 1:56 PM and 6:16 PM? 260 What is 318 minutes before 3:40 AM? 10:22 PM How many minutes are there between 1:18 AM and 5:44 AM? 266 What is 581 minutes after 12:21 AM? 10:02 AM How many minutes are there between 3:10 AM and 2:49 PM? 699 What is 570 minutes after 4:50 PM? 2:20 AM What is 401 minutes after 8:49 AM? 3:30 PM How many minutes are there between 9:48 PM and 1:12 AM? 204 How many minutes are there between 4:20 AM and 5:23 AM? 63 What is 646 minutes after 7:22 PM? 6:08 AM What is 576 minutes after 3:22 PM? 12:58 AM What is 504 minutes after 8:42 PM? 5:06 AM How many minutes are there between 1:45 PM and 4:25 PM? 160 What is 502 minutes before 11:11 AM? 2:49 AM How many minutes are there between 9:05 AM and 6:43 PM? 578 How many minutes are there between 10:05 AM and 3:25 PM? 320 What is 35 minutes before 9:10 AM? 8:35 AM How many minutes are there between 5:35 PM and 12:35 AM? 420 What is 71 minutes after 7:47 AM? 8:58 AM How many minutes are there between 11:09 AM and 7:57 PM? 528 What is 260 minutes after 12:10 AM? 4:30 AM What is 322 minutes before 5:43 AM? 12:21 AM How many minutes are there between 12:23 AM and 10:54 AM? 631 What is 4 minutes after 11:15 PM? 11:19 PM What is 195 minutes after 1:24 AM? 4:39 AM What is 52 minutes after 7:44 AM? 8:36 AM How many minutes are there between 11:01 PM and 7:23 AM? 502 What is 231 minutes before 12:57 AM? 9:06 PM What is 710 minutes after 6:16 AM? 6:06 PM What is 646 minutes after 6:22 PM? 5:08 AM How many minutes are there between 9:46 PM and 1:42 AM? 236 How many minutes are there between 9:09 PM and 7:33 AM? 624 What is 572 minutes before 11:55 PM? 2:23 PM How many minutes are there between 6:15 PM and 2:26 AM? 491 How many minutes are there between 10:40 PM and 10:17 AM? 697 How many minutes are there between 8:49 AM and 4:39 PM? 470 What is 103 minutes before 9:36 PM? 7:53 PM How many minutes are there between 4:25 AM and 7:05 AM? 160 What is 360 minutes after 12:56 AM? 6:56 AM What is 289 minutes before 2:27 PM? 9:38 AM What is 298 minutes before 2:29 PM? 9:31 AM What is 38 minutes before 8:32 AM? 7:54 AM How many minutes are there between 5:31 PM and 11:12 PM? 341 How many minutes are there between 6:08 PM and 2:35 AM? 507 What is 560 minutes before 11:03 PM? 1:43 PM What is 255 minutes after 8:49 AM? 1:04 PM How many minutes are there between 1:54 PM and 8:55 PM? 421 How many minutes are there between 9:20 PM and 9:53 PM? 33 What is 595 minutes after 8:54 PM? 6:49 AM How many minutes are there between 12:30 AM and 4:45 AM? 255 What is 53 minutes before 2:47 AM? 1:54 AM How many minutes are there between 3:30 AM and 2:57 PM? 687 What is 318 minutes before 3:14 AM? 9:56 PM How many minutes are there between 5:00 AM and 6:55 AM? 115 How many minutes are there between 6:25 PM and 8:12 PM? 107 How many minutes are there between 6:22 PM and 4:42 AM? 620 What is 69 minutes before 4:39 AM? 3:30 AM What is 387 minutes after 10:49 AM? 5:16 PM How many minutes are there between 1:55 PM and 6:34 PM? 279 How many minutes are there between 1:09 AM and 12:59 PM? 710 How many minutes are there between 4:57 AM and 11:57 AM? 420 How many minutes are there between 4:06 PM and 12:18 AM? 492 How many minutes are there between 5:47 PM and 5:34 AM? 707 How many minutes are there between 1:48 PM and 12:52 AM? 664 What is 103 minutes after 12:28 AM? 2:11 AM How many minutes are there between 11:57 AM and 10:21 PM? 624 How many minutes are there between 1:23 PM and 12:18 AM? 655 What is 240 minutes before 9:28 PM? 5:28 PM What is 2 minutes before 2:51 AM? 2:49 AM What is 136 minutes after 6:52 AM? 9:08 AM How many minutes are there between 1:27 PM and 4:07 PM? 160 What is 672 minutes after 3:31 PM? 2:43 AM How many minutes are there between 3:56 PM and 2:53 AM? 657 What is 152 minutes after 6:44 AM? 9:16 AM How many minutes are there between 9:25 PM and 7:32 AM? 607 How many minutes are there between 8:05 AM and 3:39 PM? 454 How many minutes are there between 9:33 AM and 12:07 PM? 154 How many minutes are there between 2:59 PM and 1:04 AM? 605 How many minutes are there between 10:03 AM and 3:35 PM? 332 What is 283 minutes before 6:02 AM? 1:19 AM How many minutes are there between 5:23 PM and 6:07 PM? 44 What is 67 minutes before 2:19 PM? 1:12 PM What is 236 minutes before 3:53 PM? 11:57 AM What is 675 minutes before 3:43 PM? 4:28 AM How many minutes are there between 10:29 PM and 6:22 AM? 473 How many minutes are there between 7:31 AM and 3:05 PM? 454 How many minutes are there between 2:51 AM and 10:01 AM? 430 What is 277 minutes after 10:04 PM? 2:41 AM What is 386 minutes after 9:36 AM? 4:02 PM What is 644 minutes before 11:24 AM? 12:40 AM What is 320 minutes before 7:02 PM? 1:42 PM How many minutes are there between 2:15 PM and 1:42 AM? 687 What is 344 minutes before 8:17 PM? 2:33 PM How many minutes are there between 10:33 AM and 5:58 PM? 445 What is 385 minutes before 12:53 PM? 6:28 AM What is 202 minutes before 2:27 PM? 11:05 AM What is 583 minutes after 4:19 PM? 2:02 AM What is 40 minutes before 9:09 AM? 8:29 AM How many minutes are there between 9:21 PM and 3:27 AM? 366 How many minutes are there between 1:36 PM and 11:27 PM? 591 How many minutes are there between 10:22 AM and 2:13 PM? 231 What is 607 minutes before 6:08 PM? 8:01 AM How many minutes are there between 9:01 AM and 2:01 PM? 300 What is 376 minutes before 7:36 AM? 1:20 AM What is 503 minutes before 7:08 PM? 10:45 AM How many minutes are there between 6:34 AM and 8:34 AM? 120 What is 300 minutes before 8:53 AM? 3:53 AM What is 549 minutes after 10:01 PM? 7:10 AM What is 63 minutes before 1:58 PM? 12:55 PM How many minutes are there between 3:47 PM and 4:20 PM? 33 What is 142 minutes after 7:05 AM? 9:27 AM How many minutes are there between 12:28 PM and 7:29 PM? 421 What is 586 minutes after 12:44 PM? 10:30 PM How many minutes are there between 4:35 PM and 5:16 PM? 41 How many minutes are there between 1:55 AM and 1:26 PM? 691 How many minutes are there between 6:50 PM and 3:30 AM? 520 How many minutes are there between 1:01 AM and 11:25 AM? 624 How many minutes are there between 8:32 PM and 1:41 AM? 309 What is 670 minutes after 5:06 PM? 4:16 AM What is 644 minutes before 10:27 PM? 11:43 AM What is 444 minutes after 12:01 PM? 7:25 PM How many	{ "pile_set_name": "DM Mathematics" }
3 Suppose 3a - 2a + y - 5 = 0, 10 = 2y. What is the third derivative of af*2 - 5f3 + f3 + 16f2 wrt f? -24 Let c(q) be the third derivative of 89q6/120 + q5/10 + q*4/8 - 5q2 - 3. Find the third derivative of c(j) wrt j. 534 Differentiate h3 + 14h3 - 17h*3 + 253 + 62h*2 wrt h. -6h*2 + 124h Let r(l) = 5l2 - 2l. Let i be (14/21)/(1/48). Let s(b) = i - 32 + 5b2 - 2b. Let w(a) = 4r(a) - 3s(a). What is the second derivative of w(y) wrt y? 10 Let h = 10 - 8. Let c be (-9)/68/(-6). Find the second derivative of 2z*h - z + 2z*2 - cz wrt z. 8 Find the third derivative of -412z3 + 147z*2 - 268z*2 - 24z + 132z2 wrt z. -2472 Let w(v) be the second derivative of 29v*6/3 + 137v*2/2 + 18v + 1. Find the first derivative of w(f) wrt f. 1160f3 Let l(z) = -z - 1. Let u be l(10). Let a = u + 14. Differentiate 5 - 11 + 5sa - s3 with respect to s. 12s2 Let k(z) be the first derivative of 5z6 - z2 + 44. What is the second derivative of k(x) wrt x? 600x3 Let f(g) = 1585g*4 + 9g*2 + 448g + 9. Let r(m) = 794m4 + 4m*2 + 224m + 4. Let k(u) = -4f(u) + 9r(u). Find the second derivative of k(l) wrt l. 9672l2 Let h(n) = n2 - 8n + 3. Let m be h(8). Find the first derivative of 5x3 + 9 + 3x*3 + 3x*m - 6x*3 wrt x. 15x*2 Let q(a) be the third derivative of 11a*6/24 - 65a*3/2 - 265a*2 - 2a. Find the first derivative of q(p) wrt p. 165p2 Let g = -217 + 139. Let v = 149 + g. Find the third derivative of 71k - 12k4 - vk + 4k2 wrt k. -288k Let d = 1086 - 102. Let f(m) = -m*3 - 4m*2 + 3m - 6. Let a be f(-5). What is the first derivative of dt3 + 4 - 972t*3 + a wrt t? 36t*2 Let i(g) = -2g*2 - 1. Let r(q) = 111q*2 - 111q + 4. Let u(d) = -4i(d) - r(d). Find the second derivative of u(f) wrt f. -206 Suppose 2m = 4n - m - 7, -13 = -4n + m. What is the third derivative of 8i5 - 348i*4 + 4i*2 + 348i*n wrt i? 480i*2 Let l be ((-581)/(-105) - 3) + 2/15. Let t(a) be the first derivative of la*3 + 3 + 2a*2 + 0a. What is the second derivative of t(f) wrt f? 16 Let j(x) = 73x2 - 2x - 6. Let k be j(-9). What is the derivative of 5925m2 + 3m*3 - km*2 + 4 wrt m? 9m*2 Suppose -4f = 4c - 40, -5f + 3f + 5c + 20 = 0. Find the second derivative of -fx - 12x + 7x3 - 9x*3 wrt x. -12x Let r(w) be the second derivative of 67w3/3 - 509w*2/2 - 174w. What is the first derivative of r(p) wrt p? 134 What is the derivative of 67t + 682 - 563 - 316 wrt t? 67 Find the third derivative of 2b*2 + 208b*6 + 58b + 61b - 55b wrt b. 24960b3 Let m(w) be the third derivative of -22w*2 + 0w - 17/3w3 + 0w*5 + 0w*4 + 0w*6 + 0 + 1/10w*7. Differentiate m(q) with respect to q. 84q*3 Let n(d) be the third derivative of 4/105d*7 + 0d*4 + 0d*5 + 9d*2 + 0 + 0d + 0d6 + 1/2d*3. What is the first derivative of n(z) wrt z? 32z*3 Let m(h) = -886h*4 - 42h*2 - 18h - 13. Let f(v) = -442v4 - 21v*2 - 8v - 6. Let n(i) = 13f(i) - 6m(i). Find the third derivative of n(z) wrt z. -10320z Let s(x) be the first derivative of 0x*4 - 8x + 0x2 - 42/5x*5 - 20 + 0x*3. Differentiate s(d) wrt d. -168d*3 Let p(q) = -1209q*4 + 42q*2 - 21q - 831. Let s(w) = 121w4 - 4w*2 + 2w + 83. Let r(x) = 2p(x) + 21s(x). What is the first derivative of r(f) wrt f? 492f3 Let v(p) be the third derivative of 43p6/120 - p4/12 + 3p3 - 136p*2. What is the second derivative of v(h) wrt h? 258h Let i(o) = o*2 - 4o - 3. Let d be i(5). Suppose 4q + d = 5q. Find the third derivative of z*4 + 0z*2 - 2z*4 + 6z*q wrt z. -24z Let v(w) = w*3 - 4w + 4. Let d be v(3). Let j = 19 - d. Find the second derivative of -6f3 + 2f + jf2 + 0f*2 + 6f wrt f. -36f Let t(z) = z4 + 2z3 + z2 + z. Let v(q) = 174q4 + 10q*3 - 12q*2 + 9q. Let h(a) = -5t(a) + v(a). What is the third derivative of h(p) wrt p? 4056p Find the third derivative of 23r3 - 239r*2 + 230r*2 - r + 24r*3 + 0r wrt r. 282 Let c(v) = -2v2 - 8v - 3. Let l(k) = 4k2 + 16k + 5. Let f(x) = -9c(x) - 4l(x). What is the second derivative of f(j) wrt j? 4 Suppose 5s + 2a + 22 = 0, 3a = -0s + s + 1. Let f(t) = 27t2 + 24. Let d(m) = -9m*2 - 8. Let q(l) = sf(l) - 11d(l). Differentiate q(n) wrt n. -18n Suppose 9o - 6o - 12 = 0. Find the third derivative of -13a2 + 3a*o + 6a + a*4 - 6a wrt a. 96a Find the second derivative of -5 + 164y + 375y4 - 84y + 275y + 5 wrt y. 4500y*2 Let c(u) be the first derivative of -167u*5/5 + 5u*2/2 + 3u + 106. What is the second derivative of c(s) wrt s? -2004s2 Let t(c) be the second derivative of -10c7/7 - c4/6 + 2c3 + 7c + 9. What is the second derivative of t(o) wrt o? -1200o3 - 4 Let q(p) = 3p + 18. Let x be q(-5). Differentiate x - 1 - 9u - 7 - 2 with respect to u. -9 Let p(d) = -52d - 114. Let c(t) = 103t + 229. Let z(m) = -6c(m) - 11p(m). Differentiate z(x) with respect to x. -46 Let t(v) = -13v - 87. Let g be t(-7). Let s(y) be the first derivative of -2 + 0y3 - 9/4y*g - 7y + 0y2. Differentiate s(w) with respect to w. -27w*2 Suppose 280 = -8z + 1344. What is the derivative of -56k3 - 36 - 48k*3 + zk*3 wrt k? 87k*2 Let v = -49 + 54. Find the third derivative of 4n*4 - 4n*4 - 23n*v - 45n*2 + 26n*2 wrt n. -1380n*2 Suppose -v + 0d + 4d = -25, -3d - 30 = -3v. Let h(s) = s2 - 2s - 4. Let b be h(v). What is the second derivative of 0k + bk*5 - 7k*5 + k wrt k? 80k3 Let y(m) be the third derivative of m8/2 - 63m5/20 + 3m*2 - 14m. What is the third derivative of y(c) wrt c? 10080c2 Let b be ((-1)/((-10)/54))/((-15)/(-50)). Differentiate 34t - bt + 16 + 27t + 0t with respect to t. 43 What is the second derivative of 9h - 101h2 - 18h + 16h - 72h*2 + 5h wrt h? -346 Let d(r) = 19r - 9. Let q(a) = -a. Let g(y) = -d(y) + 3q(y). Let i(v) = -22v + 10. Let z(w) = -3g(w) + 2i(w). Differentiate z(n) with respect to n. 22 Let j(h) be the second derivative of -h5/20 - 4h*4 + 28h3/3 - h2 - 185h. What is the second derivative of j(p) wrt p? -6p - 96 Let q be ((-3)/2)/(18/(-84)). Let y(t) = t*2 - 3t - 5. Let r be y(5). Find the third derivative of 7n4 + 0n*4 + rn*2 + 7n*5 - qn*4 wrt n. 420n2 Let v(c) = c3 + 2c2 + c + 1. Let o(l) = 36l*3 - 5l*2 - 3l - 7. Let b = -47 + 50. Let g(y) = bv(y) + o(y). What is the first derivative of g(k) wrt k? 117k*2 + 2k Let y(u) = -u2 + u - 94. Let w(a) = -a2 - a + 94. Let t(r) = 4w(r) + 3y(r). What is the second derivative of t(q) wrt q? -14 Let r(i) be the first derivative of 2i6/3 + 8i*5/5 + 40i*3/3 + 3i - 76. What is the third derivative of r(w) wrt w? 240w2 + 192w Suppose 0 = 19f - 13f - 30. Let o(h) be the first derivative of -f + h + 0h3 - 5/4h*4 + 0h*2. Find the first derivative of o(n) wrt n. -15n*2 Let a(r) be the first derivative of 17r5 + r3/3 + 31r2 - 111. Find the third derivative of a(c) wrt c. 2040c Let o(t) = -t*2 - t + 4. Let r(k) = 10k*2 + 13k + 368. Let p(w) = -6o(w) - r(w). What is the derivative of p(f) wrt f? -8f - 7 Let k(d) be the third derivative of -7/30d6 + 0d*4 + 35d*2 + 0 - 19/3d*3 + 0d*5 + 0d. Differentiate k(o) with respect to o. -84o2 Let h(t) = -t2 + 6t + 2. Suppose -3y + 22 - 4 = 0. Let n be h(y). Find the first derivative of 1 + nc*2 + 4 - 4 - 9 wrt c. 4c Differentiate 101t4 - 554t*2 + 554t*2 + 81 wrt t. 404t*3 Find the second derivative of -351j + 353j - 73j*2 - 76 - 64j*2 - 78j*2 wrt j. -430 Find the first derivative of 27 + 32 - 21 + 6g*2 + 16g wrt g. 12g + 16 Let x = -32 - -21. Let o be x/22-42. What is the second derivative of 97i*3 - 2i + 5io - 97i*3 wrt i? 60i*2 Let w = 13 + -10. Let g = -1 + w. What is the derivative of 2l - gl + 0l - 4 - l wrt l? -1 Let l(v) = v*3 + 15v*2 + 13v - 7. Let w be l(-13). What is the third derivative of -32f3 + 162 - w + 14f*2 wrt f? -192 Let o(t) be the second derivative of 23/6t*3 + 0t*4 + 0t*6 - 7t + 0 + 22/21t7 + 0t*5 + 0t*2. What is the second derivative of o(b) wrt b? 880b**3 Let s(t	{ "pile_set_name": "DM Mathematics" }
9, -0.03, 0.5, 4, 460 Sort 0, 2, -6836, 3, -3. -6836, -3, 0, 2, 3 Sort -175, -3, 0, 402 in ascending order. -175, -3, 0, 402 Sort -5, 3, 4, -77 in descending order. 4, 3, -5, -77 Sort -3, 3, 4, -424. -424, -3, 3, 4 Put -4, -64, 0.3, -31 in descending order. 0.3, -4, -31, -64 Sort 3, 205, 2, -5. -5, 2, 3, 205 Put 186, 3, -2, 4 in descending order. 186, 4, 3, -2 Sort -183/1712, 4, -5, 0.4 in decreasing order. 4, 0.4, -183/1712, -5 Sort -0.3, -5/11, -3, 5 in decreasing order. 5, -0.3, -5/11, -3 Sort -32, 0.2, 5, 0.3, -2/47 in ascending order. -32, -2/47, 0.2, 0.3, 5 Put 651, 4, -4, 1, -5 in descending order. 651, 4, 1, -4, -5 Put -5, -15, -1, -3, -9 in increasing order. -15, -9, -5, -3, -1 Sort 192, -5, 0, 1, 6 in descending order. 192, 6, 1, 0, -5 Put -174, -10, -44 in increasing order. -174, -44, -10 Put -5, 7, 1, -11, 0, -3 in increasing order. -11, -5, -3, 0, 1, 7 Put 3.6, -2/103, 39 in decreasing order. 39, 3.6, -2/103 Sort -1/38, -1/2, -1/10, 1/11 in decreasing order. 1/11, -1/38, -1/10, -1/2 Sort -11, -5, -2, -1, -10 in decreasing order. -1, -2, -5, -10, -11 Sort 19, -36, 215 in increasing order. -36, 19, 215 Sort 1/6, 2/5, 0.3, 0.12, -10. -10, 0.12, 1/6, 0.3, 2/5 Sort 418, 41, 4, 0, 3 in increasing order. 0, 3, 4, 41, 418 Put 3/4, 3, -42683 in decreasing order. 3, 3/4, -42683 Put -5, 33, 0.21, -12/41 in descending order. 33, 0.21, -12/41, -5 Put 2, 3/5, -0.3, 134/3, 118 in descending order. 118, 134/3, 2, 3/5, -0.3 Sort 1, 0, -5, -35, -3. -35, -5, -3, 0, 1 Sort -705/8, -0.1, 0.68, 3 in decreasing order. 3, 0.68, -0.1, -705/8 Sort 0.4, 0.44312, -2, -0.2 in descending order. 0.44312, 0.4, -0.2, -2 Sort 50, 140, -2 in ascending order. -2, 50, 140 Sort -0.1, -1/4, 58, 5.3, -1/6, 0.4 in ascending order. -1/4, -1/6, -0.1, 0.4, 5.3, 58 Put -11, -5, -7, 98 in decreasing order. 98, -5, -7, -11 Put 170361, -0.2, -0.3 in increasing order. -0.3, -0.2, 170361 Sort -3756, -3, 4, -5 in descending order. 4, -3, -5, -3756 Sort 5, -2, 248/103, -0.5. -2, -0.5, 248/103, 5 Sort -38, -2, 11 in ascending order. -38, -2, 11 Put -144, -265, 1, -4, -2 in increasing order. -265, -144, -4, -2, 1 Put 0.034, 0.1, 2/7, -316 in descending order. 2/7, 0.1, 0.034, -316 Sort -6, -3, 1/7, 0.53, 17 in increasing order. -6, -3, 1/7, 0.53, 17 Sort -24, 3, 4, -41, -2, -4 in ascending order. -41, -24, -4, -2, 3, 4 Sort -30, 3, 2, -4, -169 in ascending order. -169, -30, -4, 2, 3 Sort 4, 59, 1/4, 3/2 in decreasing order. 59, 4, 3/2, 1/4 Put -3, -4, 28, 115, 4 in descending order. 115, 28, 4, -3, -4 Sort 0, 1/28, 0.2, 41. 0, 1/28, 0.2, 41 Sort -5, -187, -1, 18 in increasing order. -187, -5, -1, 18 Put 1, 0.2, 3, -18997 in decreasing order. 3, 1, 0.2, -18997 Sort 1/4, -4, -0.4, -16, -5. -16, -5, -4, -0.4, 1/4 Sort 0.15, 0.5, 0.007, 2/21. 0.007, 2/21, 0.15, 0.5 Sort 73357, -5, 4 in decreasing order. 73357, 4, -5 Put 1, -32, 16 in increasing order. -32, 1, 16 Sort -4, 4, 5, -217, -5, -6. -217, -6, -5, -4, 4, 5 Sort 5225, 5, -5 in ascending order. -5, 5, 5225 Sort -4, 0.2, 76/13, -2/5. -4, -2/5, 0.2, 76/13 Put -0.2, 0.4, -1007, 0.09, 0.2 in descending order. 0.4, 0.2, 0.09, -0.2, -1007 Sort -58, -15, 1, -5, -2 in increasing order. -58, -15, -5, -2, 1 Put 4, 3, 1/4, 0.0047 in decreasing order. 4, 3, 1/4, 0.0047 Sort -2, 981, 141, 2. -2, 2, 141, 981 Sort 16, -2/19, -22, -3/5, -0.1 in decreasing order. 16, -0.1, -2/19, -3/5, -22 Sort 1, 136, 354. 1, 136, 354 Sort -77, -1/14, 0.4, -7 in ascending order. -77, -7, -1/14, 0.4 Sort 2, 0, -1/5, -0.37, -0.3 in descending order. 2, 0, -1/5, -0.3, -0.37 Sort 3, 23/221, -0.4 in decreasing order. 3, 23/221, -0.4 Sort -8, 3, 12, 0, 5. -8, 0, 3, 5, 12 Put 71, 4, -103 in increasing order. -103, 4, 71 Sort -3, 133, 708. -3, 133, 708 Sort 255, -140, 5 in decreasing order. 255, 5, -140 Sort 735, -33, -1, -4 in decreasing order. 735, -1, -4, -33 Sort -4, 96828, 4. -4, 4, 96828 Put -1, -8, -3, -4, 5 in descending order. 5, -1, -3, -4, -8 Sort 3, 4, 0.3, -0.01, -171.6, 0 in increasing order. -171.6, -0.01, 0, 0.3, 3, 4 Sort -1, -4, -36.85, -3/8. -36.85, -4, -1, -3/8 Sort 0.13, 0, -0.07 in descending order. 0.13, 0, -0.07 Sort 49130, -0.5, -2/5, -2 in descending order. 49130, -2/5, -0.5, -2 Put 0, -47, 130, -4 in increasing order. -47, -4, 0, 130 Sort 4, 28428, -1. -1, 4, 28428 Sort 0.6, 119, 3, -4, 2, -4/3. -4, -4/3, 0.6, 2, 3, 119 Sort 1, 7, -5, -11, -1. -11, -5, -1, 1, 7 Sort 22, 6, -10 in decreasing order. 22, 6, -10 Sort 2/7, 7, 28651/3 in descending order. 28651/3, 7, 2/7 Put 5, -5, 10, -860 in descending order. 10, 5, -5, -860 Sort 3, 19, 18.5 in increasing order. 3, 18.5, 19 Put -2461, -4, 0, 5 in decreasing order. 5, 0, -4, -2461 Sort -11, 2, 1, -3, -15 in ascending order. -15, -11, -3, 1, 2 Put -65, 3, 23 in descending order. 23, 3, -65 Put 2726, -22, -1, -2 in descending order. 2726, -1, -2, -22 Sort 199, -0.5, 0, 0.03 in descending order. 199, 0.03, 0, -0.5 Put -2, -0.1, 5, 1, 2/5, 6648 in decreasing order. 6648, 5, 1, 2/5, -0.1, -2 Put 3, 5, 0.4, -0.0348, 4 in decreasing order. 5, 4, 3, 0.4, -0.0348 Sort 1420, 0, 12 in increasing order. 0, 12, 1420 Put 4, -161, -12 in decreasing order. 4, -12, -161 Sort -3, 151, 2, -21. -21, -3, 2, 151 Sort 0, 82630, -1 in decreasing order. 82630, 0, -1 Put -2, 91, -300, 5 in descending order. 91, 5, -2, -300 Sort 21, 79, 22, 4 in decreasing order. 79, 22, 21, 4 Sort 2/3, -2/9, -2/5, 5, -0.2, 4/7 in descending order. 5, 2/3, 4/7, -0.2, -2/9, -2/5 Sort -5, -1, 5, 16112. -5, -1, 5, 16112 Sort 19/709, -4, -3/7, 3/5, 5. -4, -3/7, 19/709, 3/5, 5 Sort 2, -708, -1, 0 in descending order. 2, 0, -1, -708 Put 0.4, -4, 0, -42.5, -5 in increasing order. -42.5, -5, -4, 0, 0.4 Sort -0.3, -0.2, 2, 72, -0.5, 8/77 in descending order. 72, 2, 8/77, -0.2, -0.3, -0.5 Sort -3, -5, 637, -18, 2/17 in ascending order. -18, -5, -3, 2/17, 637 Put -0.1, -446, 3, 6, 2, 0 in decreasing order. 6, 3, 2, 0, -0.1, -446 Put -7, 382.2, 5 in descending order. 382.2, 5, -7 Sort -1/8, -1/3, -2/9, -1/5, 1917 in descending order. 1917, -1/8, -1/5, -2/9, -1/3 Sort -3, 18, 1, -440, 4 in ascending order. -440, -3, 1, 4, 18 Sort -0.1, 769, 12, -6, -1 in increasing order. -6, -1, -0.1, 12, 769 Sort -1, -972, -23 in descending order. -1, -23, -972 Sort 0.05, 442, 0.088 in ascending order. 0.05, 0.088, 442 Put 5, 98923, 4, 2 in decreasing order. 98923, 5, 4, 2 Put -2/3, 5, 0.80451 in increasing order. -2/3, 0.80451, 5 Put -5, 0, -19, 4, -26, 5 in decreasing order. 5, 4, 0, -5, -19, -26 Sort -1/7, -918, -2 in decreasing order. -1/7, -2, -918 Put -4, 2, 3, 1, 46 in decreasing order. 46, 3, 2, 1, -4 Put 4, -2, -5, -1, -472 in decreasing order. 4, -1, -2, -5, -472 Sort 1, 4, -5, -9, -34, -4. -34, -9, -5, -4, 1, 4 Sort -40, -5, 5, 246 in decreasing order. 246, 5, -5, -40 Put 3, 109215, 5, 0 in descending order. 109215, 5, 3, 0 Put 4, 50, -2, 0, -1 in increasing order. -2, -1, 0, 4, 50 Put -89, 5, 16, 0 in increasing order. -89, 0, 5, 16 Put -5, -0.4, -46 in increasing order. -46, -5, -0.4 Sort 7, 1, 805 in descending order. 805, 7, 1 Sort -2/47, -7/192, 2/13, -13. -13, -2/47, -7/192, 2/13 Put -0.5409, -0.5, 0.3 in ascending order. -0.5409, -0.5, 0.3 Sort -9, -4/3, 5, -2/7, 15, 0.1 in ascending order. -9, -4/3, -2/7, 0.1, 5, 15 Put -5, -13, -6, 2, 3 in decreasing order. 3, 2, -5, -6, -13 Put 26, 102, -2 in decreasing order. 102, 26, -2 Put -4, -5, -922, -40 in increasing order. -922, -40, -5, -4 Sort 1.3, 1/6, -0.5, 0.2, 13/12, 5 in decreasing order. 5, 1.3, 13/12, 0.2, 1/6, -0.5 Sort -1, -32, 0, -13, 1, -4 in decreasing order. 1, 0, -1, -4, -13, -32 Put -1, -6, 2, -16, 94, 0 in decreasing order. 94, 2, 0, -1, -6, -16 Sort -2, 197, 7, -12, 1, 0 in ascending order. -12, -2, 0, 1, 7, 197 Sort -1, 8, 0, 2, 732 in decreasing order. 732, 8, 2, 0, -1 Sort -2/5, 1, -1/3, -2/5229, 3. -2/5, -1/3, -2/5229, 1, 3 Sort 5, 0.2, 1, -294, -3/4, -18 in decreasing order. 5, 1, 0.2, -3/4, -18, -294 Sort 1, 7035, -67. -67, 1, 7035 Sort 3/4, -5, -4, 0.00137 in decreasing order. 3/4, 0.00137, -4, -5 Sort -1554, 2, 14. -1554, 2, 14 Put -6, -15, -23/5, -2 in ascending order. -15, -6, -23/5, -2 Sort 528, -8, -1, 1 in decreasing order. 528, 1, -1, -8 Put -7, 0.2, 5, 5490/11 in decreasing order. 5490/11, 5, 0.2, -7 Put 5209, -3, 1 in decreasing order. 5209, 1, -3 Put 0.08, -4, -1/16, 4,	{ "pile_set_name": "DM Mathematics" }
((-837)/(-6))/(3 + -6) and a. 24 Let m = 1095/49 - 75777/2891. Let q = m - 1775/472. Calculate the common denominator of q and 27/22. 88 Let g = -94611/16 + 5917. Let z be ((-58)/(-4))/((-5)/10). What is the common denominator of g and (5/10)/(7/z)? 112 Let f = -1247/3 + 408. Let d = -1987/93 + 94/31. What is the common denominator of d and f? 3 Calculate the common denominator of (-7)/(-9)(-168)/48 and 29/74. 666 Let y = -5757/11 - -521. What is the common denominator of -4/9 and y? 99 Let c(p) = 6p - 1. Let n be c(1). Suppose 8k - 3k - n = 5j, -2j = 2k - 18. Suppose -ka + 5 = -0. Calculate the least common multiple of 6 and a. 6 Let a be (-2 + 2 + -1)/1078. Let h = a - -44207/9702. Let t = 2354/5 + -469. Calculate the common denominator of t and h. 45 Suppose -l - 6 - 10 = 0. Let d = l + 26. What is the least common multiple of d and 18? 90 Suppose -5o + 28 = -2b, -3o - 2b + 12 + 8 = 0. What is the smallest common multiple of o and 48? 48 Suppose -25 = -5y + 4q, -4y + q + 9 = -0q. Let p = y + 5. Suppose -4d + 64 = -0d. Calculate the lowest common multiple of p and d. 48 Let w = 47 + -42. Suppose -2g = -3 + 1. What is the least common multiple of w and g? 5 Suppose 196 = 5t - 3c, t + 4c + 111 = 4t. What is the least common multiple of 8 and t? 328 Suppose 33 = 4p + 5m, 2p - 2m + 7 = 1. Let z(y) = -y3 + 3y*2 + 2y. Calculate the smallest common multiple of z(-2) and (-80)/(-6) + p/3. 112 Suppose 7d - 55 = -4d. What is the lowest common multiple of d and 2? 10 Suppose -4n - 4u + 76 = -36, -127 = -4n - u. Suppose v = 3g - n, g = 5v - 2v + 3. Let d = -15 + 17. What is the lowest common multiple of d and g? 12 Let n = -43/5 - -237/20. Find the common denominator of 87/4 and n. 4 Let m(v) = v*3 + 14v*2 - 16v - 12. Suppose 4j + 8 = 0, w + 3w + 3j = -66. What is the least common multiple of 15 and m(w)? 15 Suppose -4s - 6y = -y + 19, -4s - 49 = -y. Let m(f) = f*3 + 12f*2 + 10f - 5. What is the smallest common multiple of m(s) and 8? 24 Suppose q - 3b - 12 = 0, -3q + 2b + 11 + 4 = 0. Calculate the least common multiple of q and 8. 24 Suppose -5c - j = 3j - 19, -5c + 3j + 12 = 0. Let o = 171 - 168. What is the smallest common multiple of c and o? 3 Let k = 36/31 - 366/155. What is the common denominator of k and -53/8? 40 What is the lowest common multiple of 70/216/927 and 36? 180 Let k = 72 - 56. What is the smallest common multiple of k and 30? 240 Find the common denominator of ((-4)/(-66))/(12/774) and -67/2. 22 What is the common denominator of 1/5 + (9516/40)/13 and ((-11)/3 + 0)4? 6 Let f be (2 + -1)1 - 2. Calculate the common denominator of 89/2 and 15/(-14) - (-1 - f). 14 Let l = -6 - -12. Let q be 2/l - (-10124)/(-30480). Let b = -21623/27940 + q. What is the common denominator of b and 59/4? 44 Let b(a) = -a3 - 7a*2 - 7a - 5. Let v(r) = 2r + 18. What is the lowest common multiple of b(-6) and v(-7)? 4 Let x = -44998 - -6569683/146. Let k = -1384/657 + x. What is the common denominator of k and -11/8? 72 Let j = 2 + -7. Let z = j + 3. Calculate the common denominator of 7/2 and z/(-4) + 190/(-24). 12 Suppose -2c + c + 1 = 0. Suppose -7 = -3l - c. What is the common denominator of (-237)/(-48) + 0/l and 55/14? 112 Suppose -5d = -5a, -d + 9 = 2d. Let h = a + 0. Suppose -hn - 5 + 35 = 0. What is the smallest common multiple of 9 and n? 90 Suppose -10s = -5s - 80. Calculate the least common multiple of s and 12. 48 What is the lowest common multiple of (-4)/(-28) + 97/7 and 14? 14 Let p = 3693/10 + -369. Calculate the common denominator of 49/6 and p. 30 Let q = -107281/9840 + 5/1968. Find the common denominator of -7/22 and q. 110 Let o(k) = -k2 - 24k + 53. Let y(n) = n + 11. What is the lowest common multiple of y(-8) and o(-26)? 3 Let r = 2087/2 - 1077. Find the common denominator of -127/6 and r. 6 Let b be (-1 + -1)(-116)/(-8). Let k = b - -47. What is the smallest common multiple of k and 6? 18 Let v(b) = b - 7. Let q be v(4). Calculate the common denominator of 63/2 and (-1 + q/(-4))-17. 4 Suppose -35 = -5d - 0. Suppose 2w = dw - 190. Find the common denominator of w and 4/14 + (-1398)/(-56). 4 Suppose -40r + 35r + 15 = 0. What is the lowest common multiple of r and 6? 6 Let f(h) = h2 - 7h + 24. What is the least common multiple of f(6) and 6? 18 Suppose m + 0m + 6 = 0. What is the common denominator of ((-2)/m)/((-6)/(-639)) and (16 - 2)(-2)/40? 10 Find the common denominator of 2-4(-81)/(-84) and (-12)/14(-1722)/120. 70 Suppose 5k - 10 = 40. Let v(p) = p*2 + 6p - 61. Calculate the smallest common multiple of k and v(-12). 110 Let i be -2 + 1 - -527. Let s = 779/2 - i. Find the common denominator of s and 41/10. 10 Let x be 334/3 + (-5)/15. Calculate the common denominator of (10/60)/((-3)/73) and (x/72)/((-9)/(-12)). 18 Let p(c) = -c2 - 7c - 6. Let j be p(-4). Let w = j + -4. Suppose -13 = -wa + 15. What is the least common multiple of a and 4? 28 Let d = 2057/4 - 1514/3. Calculate the common denominator of d and -73/12. 12 Suppose 20 = 2f - 2m, -2f + 4m = 3m - 16. Calculate the lowest common multiple of 21 and f. 42 Let a(q) = 4q. Let d = 9 - 6. Let s be a(d). Let b = 19 - s. What is the smallest common multiple of 9 and b? 63 Suppose -r - g = -5r + 35, r = 5g + 23. What is the smallest common multiple of 2 and r? 8 Suppose -2d + 37 + 1 = -5l, -d - 7 = 4l. Calculate the least common multiple of d and 27. 27 Let q = 30 + -18. What is the smallest common multiple of 16 and q? 48 Suppose 5y + 3t + 29 = 0, -y + 1 = -2y + t. Let o(v) = -7v. What is the smallest common multiple of 10 and o(y)? 140 Let b(l) = -4l3 - l2 - 2l - 1. Let t be b(-1). Let m be 6/t2/(-3). What is the common denominator of -26 and m - 9/(2 - -1)? 1 Let m(p) = -p + 0 + 2p*2 + 3 - 4 + 2. Suppose -2u - 2 = -10. Calculate the least common multiple of u and m(1). 4 Let m = -29 - -21. Let w(b) = b*2 + 9b + 12. What is the least common multiple of 3 and w(m)? 12 Let x = 56193/2644 - 2/661. What is the common denominator of x and -47/3? 12 Suppose 0 = 7g - 3g. Suppose -p + 55 = 3v, -3v - v - 3p + 70 = g. Suppose v + 13 = 4f. Calculate the smallest common multiple of 2 and f. 8 Let u(i) = i*3 - 4i*2 - 4i + 2. What is the lowest common multiple of 7 and u(5)? 7 What is the lowest common multiple of 4 and 84/30 - (-2)/10 - -9? 12 Suppose -290 = 2u - 998. Let j = u + -689/2. Find the common denominator of (2/(-5))/(2/8) and j. 10 Let y = 1978 - 11909/6. Find the common denominator of y and (-394)/(-48) - 2/6. 24 Suppose w = -5x - 5, -20 + 0 = 5x - 2w. Let i be (x/(-5))/(2/10). Suppose -iz + 14 + 10 = 0. What is the smallest common multiple of z and 8? 24 Suppose -35 = -5m - 5t, 5m - 5t - 18 = 7. Suppose -y = -m - 42. What is the common denominator of (1/5)/(y/2780) and -7/8? 24 Let c = 30 + -22. Suppose -i = 3i - c. Calculate the lowest common multiple of 3 and i. 6 Suppose -h + 20 = 4h. Suppose -126 + 25 = -l. Calculate the common denominator of 2/4l/h and 37/11. 88 Calculate the common denominator of 4/14 - 730/(-1120) and -1/16. 16 Find the common denominator of (-2)/3((-219)/(-4) + 0) and -8/15. 30 Let w = -367 + 21649/59. Let s = -601/708 + w. Calculate the common denominator of s and 83/(-30) - (-10)/15. 60 Suppose 3k = 2o + 11, -2o + 26 = o + 4k. What is the smallest common multiple of 9o(-3)/(-6) and 6? 18 Suppose 2n = 7 - 1. Suppose -no + 5g - 14 = 0, -6 = 2o + o - 3g. Let i = 6 - -1. Calculate the lowest common multiple of i and o. 14 Calculate the lowest common multiple of 21 and 2 + 3 + (1 - 0). 42 Let c = 11 - -3. Let n(s) = -s*2 + 8s - 6. Calculate the smallest common multiple of n(6) and c. 42 Let i(o) = o*2 - 10. Let y be i(7). Suppose -5g - y = w - 121, -22 = -2g + 5w. Calculate the common denominator of -55/16 and ((-245)/g)/5 - 2. 16 Let d be (1575/6 - 1)-2. Let q = -4191/8 - d. Let m = 314/11 + -3513/88. Calculate the common denominator of m and q. 8 Let t be -2 + (-2 - 194). Find the common denominator of 2/(-5) + (-222)/t and 7/12. 24 Let q(z) be the first derivative of z*3/3 + 7z - 2. Let s be q(0). Suppose -s = -k + 1. Calculate the lowest common multiple of 18 and k. 72 Calcula	{ "pile_set_name": "DM Mathematics" }
e common denominator of w and 115/28. 112 Suppose -3c = -6c + 12. Let d be c/18 + (-100)/45. Find the common denominator of 8/(-44)31/d and -131/6. 66 Suppose -2m + 4 + 0 = 0. Let a be (-1)/((-1)/18m). Let f = a - -1. Calculate the lowest common multiple of f and 3. 30 Let r = 4 + 8. What is the smallest common multiple of 2 and r? 12 Suppose 2w = 3y - 20, 0y - 3w = -3y + 18. Find the common denominator of (2 - 1) + 51/y and -119/6. 24 Let v be 1/((-26)/(-14) - 2). Let g = 10 + v. Suppose k - g = 27. What is the common denominator of 7/10 and k? 10 Let c be (-3)/(2 - -1) + 4. Let p(o) = 5597o. Let f be p(c). Let k = f - 335933/20. Find the common denominator of 91/18 and k. 180 Let r(c) = c2 - 13c + 18. Calculate the lowest common multiple of r(13) and 2. 18 Let i = 2087/14 - 149. Calculate the common denominator of 67/92 and i. 644 Let a = 5 - 8. Let d = a + 1. Calculate the smallest common multiple of ((-20)/((-4)/(-2)))/d and 5. 5 Let a = 10/17 + 871/340. Calculate the common denominator of -47/8 and a. 40 Let g = -1469 - -11709/8. Let m = 507143/18 + -28183. Calculate the common denominator of m and g. 72 Let v(b) = b*2 - 6b + 7. Let z be v(5). What is the common denominator of -77/6 and -36z/(2 + -4)? 6 Let l = -280 - -519/2. Let d = 221303/38262 - -5/2733. Find the common denominator of l and d. 14 Let o(p) = 3p + p*2 - p + 2p. Let k = 22 + -6. Calculate the lowest common multiple of o(-6) and k. 48 What is the smallest common multiple of ((-864)/(-30))/410/3 and 12? 24 Let a(l) = -3l + 14 - 18 + 2l. Calculate the least common multiple of (0 + 14)/(3 - 1) and a(-10). 42 Let d = -319/24 - 7/8. What is the common denominator of 23/72 and d? 72 Let t = -1939 - -11729/6. Find the common denominator of -40 and t. 6 Let t = -599/114 - -46/19. Let r = -4 - 29. What is the common denominator of r and t? 6 Let b(y) = -3y - 20. Calculate the least common multiple of 2 and b(-8). 4 Let h(y) = y*2 + 3y. Let d be (-6 - 0/(-2))/(-2). Let w = 1 + d. What is the smallest common multiple of h(-4) and w? 4 Let c = -7 + 21. Calculate the common denominator of c/(-20)(15 + 3) and 14/3. 15 What is the common denominator of ((-46)/15 - 0)/((-5)/25) and 107/30? 30 Find the common denominator of (-10)/30 - (-2)/24-47 and 64/15. 60 Suppose 4q + 8 = -2f + 3f, 3f = 4q + 8. Find the common denominator of 276/(-8)1/(-27) and 166/32(f - 1). 144 Let n = -75 - -140. Let b = -45 + n. Calculate the smallest common multiple of 6 and b. 60 Let l(u) = 2u*2 + 2u - 14. Suppose 2d - 14 = -4n + 2, -20 = -5d - 5n. Suppose da = 2a - 4. Calculate the least common multiple of l(-4) and a. 10 Let a be 0/(-2)1/(-3). Suppose 0 = -2l - al + 8. Suppose 0 = b - 10 - l. Calculate the smallest common multiple of b and 12. 84 Suppose -5 = -2v - 0v - 3p, 0 = -2v + 2p + 10. What is the smallest common multiple of 25/10(v + -2) and 1? 5 Let j(b) = 3b - 9. Let g be (-10)/(-45) + (-210)/(-27). What is the common denominator of j(g) and 2/9? 9 Let k be -1 - 3/68. Let t = 10 - 2. Calculate the lowest common multiple of (-4)/(-2) + k/(-1) and t. 56 Let r be -5 - -2 - 91. What is the common denominator of (3-15 + 1)/3 and (-291)/30 - r/(-20)? 30 Let c = 0 + 2. What is the least common multiple of 162/10 - (-1)/(-5) and c? 16 Find the common denominator of 17/42 and (-7)/317/2. 42 Suppose -o - 3r + 11 = 0, 2r = -r - 3. Let j = -20 + o. Calculate the common denominator of (-9)/j(-80)/(-33) and 95/6. 66 Suppose 3z + z = -2h + 20, 5h = z + 28. Calculate the least common multiple of h and 8. 24 Let w = -8311491/455 - -18267. Let q = w + -14991/1820. Find the common denominator of -103/6 and q. 12 Let m(w) = w + 1. Suppose -4h + 7 = -1. Suppose 0 = -4g + h + 6. Calculate the lowest common multiple of g and m(2). 6 Let y(q) = -17q + 2. Let g be y(-5). Let r = -1023/40 - -141/5. Calculate the common denominator of (g/(-4))/((-6)/4) and r. 8 Let o be ((-197852)/(-10))/((-108)/(-105)). Let p = o + -19244. What is the common denominator of p and 5/4? 36 Let a be 483/6 - 1/(-2). Calculate the common denominator of (2/(-4))/(12/a) and 113/(-18) + (-29)/(-174). 72 Suppose 4l + 3g + 74 - 254 = 0, 5g - 172 = -4l. What is the least common multiple of 2 and l? 48 Suppose -2l + 5l = 11784. Let y = -23483/6 + l. Calculate the common denominator of y and ((-2)/24)/(1/154). 6 Suppose 4w = -12 + 20. Let q = 4 - -6. Calculate the smallest common multiple of w and q(-1 - (-7)/5). 4 Let o = 4 + -5. Let u(y) = -10y3 - y2 + 1. What is the smallest common multiple of u(o) and 7? 70 Suppose -5p + p = 16. Suppose 6t - 60 = 5t. Find the common denominator of p and (-230)/t + 4/(-2). 6 Let l(m) = -m3 - 10m*2 + 5m + 8. Let r be l(-9). Find the common denominator of ((-5)/(-16))/5r and 103/30. 120 Suppose -2n + n - 6 = 4i, 12 = 3n - 3i. Calculate the common denominator of 31/12 and 1 - n142/48. 12 Let d = -1/6010 - -13703/1202. Suppose -5h = -2h - 201. Let r = -519/7 + h. What is the common denominator of d and r? 35 Let y = -34 - -76. Calculate the smallest common multiple of 6 and y. 42 What is the common denominator of (-6)/18 - (-6)/153 and 43/6? 102 Let b(f) = -5f - 4. Let v(h) = -h2 + 2h + 6. Let x be v(3). Suppose 2m = xm - 6. Calculate the least common multiple of b(-3) and m. 66 What is the smallest common multiple of ((-56)/12)/(2/(-3)) and 18? 126 Let m(r) = r*3 - 15r*2 + r - 9. What is the least common multiple of 12 and m(15)? 12 Suppose 0 = -4h + h - 18. What is the common denominator of 101/6 and (-3)/(-18)423/h? 12 Let i = -1915/2 + 993. What is the common denominator of i and -25/3? 6 Let w = 7 - 11. Find the common denominator of 59/5 and w/(-2) + (-52)/22. 55 Let g = -2 - -5. Let v(k) = k2 - 2k + 2. Let z = 9 + -6. Calculate the smallest common multiple of g and v(z). 15 Let r be ((-6)/(-40))/((-6)/785854). Let v = r + 19651. What is the common denominator of v and -97/10? 20 Let r be 10/5 + (-68098)/20. Let t = -3408 - r. Calculate the common denominator of t and 62/126 - (-8)/28. 90 Let y = 77637/11288 - 4/1411. Find the common denominator of 2/(-12)-1-92 and y. 24 Let v(c) = c2. Let u(s) = s3 + 5s2 + s - 3. Calculate the least common multiple of u(-4) and v(1). 9 Suppose 2s - 8 = 4b, 0 = -3b + 2s + 2s - 6. Let n be 19923/29871 + b/3. Let u = n - 69710/36509. What is the common denominator of u and -14/5? 55 Suppose 18 = -2s + 5s. Let b(m) = 0m - 1 - 3m + 4m. Calculate the lowest common multiple of b(s) and 4. 20 Find the common denominator of 174/442/6 and (-2)/8 + 4/(528/(-273)). 22 Let q(b) = b + 1. Let c(k) = -6k - 3. Let u(t) = -2c(t) - 10q(t). What is the least common multiple of u(7) and 1? 10 Suppose -4a + 28 = 2i, i + 4 = -0a + 4a. What is the smallest common multiple of i and 10? 40 Suppose 0 = 3s - 4h - 1859, 3s - 1236 = s + 2h. Suppose -1615 = -5w + 5t, -3w - 3t + 374 = -s. Find the common denominator of 40/9 and (-2)/8 + w/88. 99 Let s = 1/3544 - -22147/10632. What is the common denominator of 51/2 and s? 12 Suppose 10b - 3b = 98. Let n = 11 + -6. Suppose 2j + nd = 12, -3j - d + 18 = 3d. Calculate the least common multiple of j and b. 42 Calculate the common denominator of 36/7 and 2 + 1 - (-1065)/30. 14 Let u = 440/61 - 4/305. Let s = u - 501/80. Calculate the common denominator of 55/16 and s. 16 Let l = -24 - -40. Let o = l + -6. Calculate the smallest common multiple of 16 and o. 80 Let r(x) = -5x*3 - 2x*3 + 3x*3. Calculate the least common multiple of 16 and r(-1). 16 Let u = -4/143 - -7651/2574. Find the common denominator of -37/30 and u. 90 Suppose -4f = 3z - 10, 0 = 6z - 4z + 4f - 4. Find the common denominator of -29/4 and ((-5)/(-15))/(z/(-10)). 36 Suppose 6j - 6 = -0. What is the least common multiple of j and 7? 7 Let l(i) = -7i + 63 - 61 - 5i2 + 4i*2 + 2i. What is the smallest common multiple of l(-5) and 2? 2 Let y = 6867 - 96213/14. Find the common denominator of 51/22 and y. 154 Let j = -191 + 205. What is the smallest common multiple of 64 and j? 448 What is the smallest common multiple of 26 and 8/4(-7 + 3)/(-2)? 52 Let t be (1/3)/(3/27). What is the common denominator of 1 + 31t/42 and (-178)/(-120) + (-4)/	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.