Datasets:

parameterlab
/

scaling_mia_the_pile_00_DM_Mathematics

Dataset card Data Studio Files Files and versions Community

Split (3)

train · 63.5k rows

text stringlengths 518 8.19k	meta dict
+ sqrt(91)) - sqrt(91) - sqrt(91))/sqrt(7). sqrt(13) Simplify (1(sqrt(16)/sqrt(8) + -2))2. -4sqrt(2) + 6 Simplify 3 + ((-1 + sqrt(108))-2)2. -48sqrt(3) + 439 Simplify 1 + ((sqrt(7) - (sqrt(7) - sqrt(252)))*2 + -3 - sqrt(28)/(sqrt(12)/sqrt(3))). -sqrt(7) + 250 Simplify 3sqrt(175) - (sqrt(7) - (-1 + sqrt(700) - sqrt(7))). -1 + 23sqrt(7) Simplify 5((-2sqrt(56))/sqrt(2))2. 560 Simplify (2sqrt(132)/sqrt(3))/(sqrt(32)/(sqrt(8) - sqrt(32))). -2sqrt(11) Simplify 1(sqrt(539) + 0 + sqrt(539) + sqrt(539) + -4). -4 + 21sqrt(11) Simplify (sqrt(13) - (sqrt(1300) + sqrt(1300) + 4)) + sqrt(65)/sqrt(45). -56sqrt(13)/3 - 4 Simplify (sqrt(5) - (sqrt(5) + sqrt(30)/sqrt(6))3) + (-5sqrt(500) - sqrt(5)). -56sqrt(5) Simplify (sqrt(128)/sqrt(2))/(sqrt(648)-2). -sqrt(2)/9 Simplify -2((2 + sqrt(147))2 + -5)6. -1752 - 336sqrt(3) Simplify ((sqrt(192) + (sqrt(192) - (2sqrt(192)-2 + sqrt(192))))/(42sqrt(4)))2. 75/4 Simplify (sqrt(1344)1 + sqrt(1344))/((sqrt(21)/sqrt(3) + sqrt(7))1). 8sqrt(3) Simplify -4sqrt(19)-13. 12sqrt(19) Simplify (6sqrt(170)-2)/sqrt(10). -12sqrt(17) Simplify sqrt(99)/(-2sqrt(9))4. -2sqrt(11) Simplify sqrt(637) + (-5sqrt(637)-1)*2. 7sqrt(13) + 15925 Simplify ((sqrt(7) - 3(1 + sqrt(7))) + (-4sqrt(252) + sqrt(252) - sqrt(7)))*2. 126sqrt(7) + 3096 Simplify sqrt(13)-6 + 4 + -3sqrt(832). -30sqrt(13) + 4 Simplify (sqrt(2299) + sqrt(2299) + sqrt(2299) + (sqrt(2299) - -3((0 + sqrt(2299) - sqrt(2299)) + sqrt(2299)) - sqrt(2299)))*2. 82764 Simplify sqrt(9)/(sqrt(15)/(sqrt(25)/sqrt(5))). sqrt(3) Simplify (1sqrt(1377) + 0 - sqrt(1377))*2. 0 Simplify -5(-5 + sqrt(52)/sqrt(4))-3. -75 + 15sqrt(13) Simplify 64((sqrt(2) + 0)*2 + -4). -48 Simplify (sqrt(242)-1)*2 - sqrt(14)/sqrt(112). -sqrt(2)/4 + 242 Simplify ((-1sqrt(2) + sqrt(2) + 5 - sqrt(2)) + sqrt(18)4)2. 110sqrt(2) + 267 Simplify -1 + (sqrt(13) - (-5 + sqrt(208) - sqrt(13))). -2sqrt(13) + 4 Simplify 0 + sqrt(16)/(3sqrt(8)). sqrt(2)/3 Simplify sqrt(612)3 - ((-1sqrt(34))/sqrt(2))*2. -17 + 18sqrt(17) Simplify ((sqrt(209)-2)/sqrt(11) + sqrt(171)/(sqrt(9)2 - sqrt(9)))*2. 19 Simplify (1(sqrt(1088) + -4sqrt(1088)))2. 9792 Simplify -4 + (sqrt(11) + 1)5. 1 + 5sqrt(11) Simplify -1((sqrt(320) - (sqrt(320) + sqrt(320) + -1)) + 1). -2 + 8sqrt(5) Simplify 3sqrt(17)-2-1. 6sqrt(17) Simplify 4(sqrt(847) + -1). -4 + 44sqrt(7) Simplify (sqrt(833) + (5(sqrt(833) + 0))*2)5. 35sqrt(17) + 104125 Simplify 6sqrt(63) + -4. -4 + 18sqrt(7) Simplify 2-61sqrt(112)3. -144sqrt(7) Simplify 6(1 + (sqrt(1539) - (sqrt(1539) + -2 + sqrt(1539)))) + -5. -54sqrt(19) + 13 Simplify (2 + (sqrt(1539) - (sqrt(1539) + 0)))*2. 4 Simplify ((sqrt(190) + sqrt(190)-33)/(sqrt(40)/sqrt(4)1))*2. 1216 Simplify 3 + (sqrt(81)/(sqrt(18)/sqrt(2)))/sqrt(3). sqrt(3) + 3 Simplify 3(-3(-2 + 2sqrt(68)))*2. -432sqrt(17) + 7452 Simplify -41((sqrt(3) + (sqrt(108) + 0 - sqrt(108) - sqrt(108) - sqrt(108)))*2 + sqrt(9)/sqrt(3) + 5). -1472 - 4sqrt(3) Simplify sqrt(13) + -5 + -2sqrt(13) - (-2sqrt(91))/sqrt(7). -5 + sqrt(13) Simplify -1(-5 + (sqrt(171) - sqrt(19)) + -2)1. -2sqrt(19) + 7 Simplify (3 + (sqrt(2448) - (2sqrt(2448) + 1)))*2 + -2. -48sqrt(17) + 2450 Simplify -15(sqrt(11) + 1)-5. 25 + 25sqrt(11) Simplify (-1sqrt(170)5)/sqrt(10). -5sqrt(17) Simplify ((sqrt(242) - (sqrt(242) + -3))-5)*2. 225 Simplify 3 + (1 + sqrt(95)/sqrt(5) - sqrt(19) - sqrt(1900)-1). 4 + 10sqrt(19) Simplify 2sqrt(77)/((sqrt(11) - sqrt(66)/sqrt(54)) + sqrt(11)). 6sqrt(7)/5 Simplify (sqrt(605) + -3 - sqrt(605))2 + 2 + sqrt(180). 11 + 6sqrt(5) Simplify (2sqrt(72)1)*2 - (-4 + sqrt(72)2 + sqrt(72)). -18sqrt(2) + 292 Simplify (-5 + -2sqrt(300))*2. 200sqrt(3) + 1225 Simplify ((sqrt(80) - (0 + (1sqrt(80) - sqrt(80)) + sqrt(80) + sqrt(80)) - sqrt(80)) + -3 + (sqrt(80) - (sqrt(80) + 1 - sqrt(80)) - sqrt(80)))2. 64sqrt(5) + 336 Simplify sqrt(33)/(4sqrt(363)). sqrt(11)/44 Simplify (sqrt(54) + sqrt(54) + 2sqrt(162)/sqrt(3))/(((sqrt(4) - (sqrt(4) + sqrt(4)-1)) + sqrt(4) + sqrt(4))/sqrt(2)). 4sqrt(3) Simplify (2 + (sqrt(4212) + 1 - (2sqrt(572) + sqrt(572))/sqrt(11)))2. 72sqrt(13) + 1881 Simplify (sqrt(272) + (sqrt(272) - (1 + sqrt(272))*2-6))1. 56sqrt(17) + 1638 Simplify (((sqrt(1573) + 0)-2 - sqrt(1573)) + sqrt(1573) + 4 + 0)2. -176sqrt(13) + 6308 Simplify (-2 + sqrt(18)/sqrt(6) + -3)*2. -10sqrt(3) + 28 Simplify (-3 + sqrt(5)-1 + sqrt(5) + sqrt(5))22. -12sqrt(5) + 28 Simplify ((sqrt(76)2 + sqrt(76))/sqrt(4))*2 - (-4 + sqrt(38)/sqrt(2)). -sqrt(19) + 175 Simplify ((5 + sqrt(7)2 + sqrt(42)/(sqrt(18)/sqrt(3)))2)2. 120sqrt(7) + 352 Simplify ((sqrt(110) + (sqrt(110) - (sqrt(110)2 + sqrt(110))) + sqrt(110))-1)/sqrt(10)1. 0 Simplify sqrt(16)/(sqrt(96)/sqrt(3)). sqrt(2)/2 Simplify (2sqrt(190)2)/(sqrt(1210) + sqrt(1210)-1 + sqrt(1210)). 4sqrt(19)/11 Simplify (sqrt(1216) + -2 + 4 - -3-2sqrt(1216))2. -160sqrt(19) + 30404 Simplify (sqrt(190)/(sqrt(60)/sqrt(6)))*2 + (sqrt(19) - (sqrt(95)1)/sqrt(5)). 19 Simplify (sqrt(684) - -3sqrt(684))-5. -120sqrt(19) Simplify -3((sqrt(2) - ((sqrt(2)-4 - sqrt(2))2 - sqrt(2))2) + -5). -9sqrt(2) + 315 Simplify ((sqrt(320) + 2sqrt(320) - sqrt(320))/sqrt(8))/(sqrt(8) - sqrt(800)1). -2sqrt(5)/9 Simplify ((sqrt(208) + -1 - sqrt(13)) + 4)*23. 54sqrt(13) + 378 Simplify sqrt(153)/(sqrt(567)/sqrt(7))-3. -sqrt(17) Simplify ((sqrt(539) - sqrt(539)-3)/sqrt(11))/(sqrt(252)2). sqrt(7)/3 Simplify (-4(sqrt(78) + (sqrt(78) - (sqrt(78) + sqrt(78)2 - sqrt(78)))) - sqrt(78) - sqrt(78))/sqrt(6). -2sqrt(13) Simplify (sqrt(1539) + -4 + sqrt(1539) + -3)2. -252sqrt(19) + 6205 Simplify 1 + 5 + 1sqrt(11)-2. -2sqrt(11) + 6 Simplify sqrt(6)/((sqrt(135)/sqrt(5))/sqrt(9)). sqrt(2) Simplify (sqrt(1100) + (sqrt(1100) + 1)1)*2 - ((sqrt(66) + sqrt(66)-2)/sqrt(6)-5)2. 40sqrt(11) + 4126 Simplify -5 + 1 + sqrt(2448)2. -4 + 24sqrt(17) Simplify sqrt(11) + -5 + -1 - (sqrt(55)/sqrt(5) + -2)*2. -21 + 5sqrt(11) Simplify (sqrt(272)2 - (-1sqrt(17) + 5))-5. -45sqrt(17) + 25 Simplify sqrt(68)/(sqrt(20)/sqrt(5)) - sqrt(34)/sqrt(2)6. -5sqrt(17) Simplify 0 + (sqrt(17) - 2sqrt(17)6). -11sqrt(17) Simplify 0 + sqrt(425) + sqrt(17) - (sqrt(34)/sqrt(2) + 2 - sqrt(17))2. -4 + 6sqrt(17) Simplify 5(4 + 3 + sqrt(1900) + 1). 40 + 50sqrt(19) Simplify -3sqrt(50)/(sqrt(10)2). -3sqrt(5)/2 Simplify -3 + (4 + -2sqrt(5))*2. -16sqrt(5) + 33 Simplify (((sqrt(189) - (sqrt(189) + sqrt(189)1 + sqrt(189)))/sqrt(7) + sqrt(27) + sqrt(27))/sqrt(9))2. 0 Simplify ((5 + -2sqrt(343))1)2. -140sqrt(7) + 1397 Simplify ((sqrt(143) - ((sqrt(143) - 1sqrt(143)6) + sqrt(143)) - sqrt(143)) + sqrt(143))/(sqrt(11) + (sqrt(88)/sqrt(4))/sqrt(2)). 5sqrt(13)/2 Simplify (sqrt(170) + (sqrt(170) - (sqrt(170) - (-1sqrt(170) + sqrt(170) + sqrt(170))-2)) + sqrt(170))/(-6sqrt(40)/sqrt(4)). 0 Simplify -6(sqrt(3) - (sqrt(3)1 + 0))-4. 0 Simplify (sqrt(1053) - (sqrt(1053) + 1 - sqrt(1053)))25 - (2sqrt(1053) + -3). -108sqrt(13) + 5273 Simplify -6(sqrt(1900) - -1sqrt(1900)) - (-1sqrt(684) + (sqrt(228)-2)/sqrt(12))*2. -1216 - 120sqrt(19) Simplify (-6(sqrt(117) + sqrt(117) + 11sqrt(117) + sqrt(117))/sqrt(9))2. 7488 Simplify -2(3 + (sqrt(108) - 1sqrt(108))). -6 Simplify -4 + -4(sqrt(2) - (-2 + sqrt(2) - sqrt(2)))6. -52 - 24sqrt(2) Simplify (3(sqrt(704) + 0))2. 6336 Simplify ((sqrt(128) - (2sqrt(128) + 0)) + 1 + -5)*2. 64sqrt(2) + 144 Simplify ((sqrt(1452) - (sqrt(1452) - -3sqrt(1452))) + ((-1sqrt(108))/sqrt(9) - sqrt(12)))*2. 14700 Simplify (sqrt(40) + (sqrt(160) + sqrt(160)1)/sqrt(4))/(-2sqrt(968) - sqrt(968)). -sqrt(5)/11 Simplify 1(0 + sqrt(17))5. 5sqrt(17) Simplify -1 + sqrt(51)/sqrt(3) + (2sqrt(17) + sqrt(17) + -1)2. -5sqrt(17) + 153 Simplify (2 + sqrt(102)/sqrt(6) + 2)-6. -6sqrt(17) - 24 Simplify sqrt(6)/sqrt(8) + sqrt(363) + 0 + sqrt(3). 25sqrt(3)/2 Simplify (1 + sqrt(468) + sqrt(130)/(1sqrt(10)) + -5)*22. -112sqrt(13) + 1306 Simplify (sqrt(228) + (sqrt(228) - (sqrt(228) + (sqrt(228) - (sqrt(228) + (sqrt(228) - 2sqrt(228)2))))))/(3sqrt(300)). -2sqrt(19)/15 Simplify (-34-1sqrt(3)-4)2. 6912 Simplify (sqrt(637) - ((-1 + sqrt(637))6 - sqrt(637)))*2. -336sqrt(13) + 10228	{ "pile_set_name": "DM Mathematics" }
e in 1/8, j, z? 1/8 Let g = -11 + 8. Let s be g/5 - (-48)/280. Let d = 5.11 + -0.11. Which is the third biggest value? (a) d (b) s (c) 4 b Let t be (-1)/((-2)/((-4)/5)). Let x = 9 - 15. Let i = 6.5 + x. Which is the third smallest value? (a) 2 (b) i (c) t a Let r be (4/3 + -1)18. Let b be -9 + r + (-1)/(-1). What is the second smallest value in -5, -1/5, b? b Let u = -3 - -10. Let s = -12 + u. Let w = -0.164 + 0.364. Which is the second smallest value? (a) s (b) w (c) 5 b Let h = 0.9 + -1. Let m = -0.4 - h. Which is the third smallest value? (a) -0.5 (b) -2/5 (c) m c Let q = -4.8 + 0.8. Suppose l - 3l - 16 = 2p, -5l - 26 = -2p. Let t = l - -23/4. Which is the second biggest value? (a) 2/9 (b) t (c) q b Suppose -20 = 5u, 2u + 24 = 3q + q. Let o = 87 + -87. Let t = 1.1 + -1. What is the third biggest value in q, o, t? o Let u = 1 + 1. Let n = 10 - 9. Let i = n - u. What is the third biggest value in i, -2, 2? -2 Let m = 47 + -25. Let v = m + -26. Which is the third biggest value? (a) v (b) 1/6 (c) -1/6 a Suppose -13 + 10 = i. Let y = -7.3 - -7. Let w = y + 1.3. Which is the second biggest value? (a) i (b) w (c) 0.1 c Let m = 0.014 - -8.986. Which is the second biggest value? (a) -3 (b) 3/7 (c) m (d) -0.2 b Let q = -0.8 - -0.2. Let z = q - -7.6. Let h = z - 5. Which is the biggest value? (a) h (b) -1/3 (c) -0.6 a Let v = 4 + -5. Let p = 6 + -10. What is the smallest value in p, v, -0.1? p Let s = -1.1 + 1.6. Which is the third biggest value? (a) s (b) -4 (c) -2 b Let c = 5.06 + -5. Let r = c - 0.56. What is the biggest value in -0.4, 2/7, r? 2/7 Let v(z) = z*3 - 7z*2 + 6z - 4. Let i be v(6). Let p = 4 + -1. Which is the second smallest value? (a) 1/2 (b) p (c) i a Suppose u + 37 = -5o + 8o, -5o + u + 63 = 0. Let i be (-8)/18o/26. Let l be (8/14 - 0)-1. What is the third biggest value in i, -0.2, l? l Let c = -4.8 - 0.2. Let x be 2/(-6)6/(-1). What is the third smallest value in x, 3, c? 3 Let r = 7 + -6.9. Let v = -13/100 + -3/25. Which is the third biggest value? (a) r (b) v (c) 1 b Let i be (-9(-14)/(-105))/(6/(-4)). What is the second biggest value in i, 0.4, 6? i Let x = 7 + -2. Which is the biggest value? (a) -3 (b) 0.05 (c) x (d) 0.4 c Let m = 0.46 + 0.09. Let f = 0.05 - m. Which is the third biggest value? (a) -2 (b) -0.2 (c) f a Let o = 7.1 + 0.9. Let b = -5 + o. What is the smallest value in b, -3, -1/3? -3 Let t = -1.1 + -12.9. Let v = -13 - t. Let b = 0.8 - 1. What is the third biggest value in -4, v, b? -4 Let i = -5 - -4. Let b be 29/(-7) + 4/28. Let f = 1419/56 + -180/7. What is the second biggest value in b, i, f? i Let x = 1/48 + -11/16. Which is the smallest value? (a) 0 (b) 0.5 (c) x c Suppose -4a + 4c - 32 = 0, -4a + 4c - c - 29 = 0. What is the third biggest value in 1/2, 5, a? a Let p = -0.024 - -0.024. Which is the biggest value? (a) -4 (b) p (c) -0.5 b Let l = -6.5 - -18.5. Which is the second smallest value? (a) 2/15 (b) -0.2 (c) l a Let i = 2 - 1.8. Let r = -0.3 - -3.3. Let o = -7 + 3. Which is the second smallest value? (a) r (b) i (c) o b Let a = 11.3 + -12.3. Let h = 11 - 10.3. Let k = h + -0.3. What is the second biggest value in 0, k, a? 0 Let n(t) = t3 - 7t*2 + 8t - 9. Let r be n(6). Let s = 280 + -4202/15. Which is the third smallest value? (a) s (b) 3/7 (c) r c Let s = 0.65 + -1.65. Which is the second smallest value? (a) 0 (b) s (c) -3 (d) -0.3 b Let p(x) = -x*3 + 4x*2 - 2x + 4. Let i be p(5). Let f be i/((-4)/2 - -5). Let t = 10 + f. What is the third biggest value in 0.4, -2/9, t? t Let g = 5.1 - 4.7. What is the smallest value in -4, g, -5? -5 Suppose 0 = 2w + w + 123759. Let g = 1856633/45 + w. Let q = g - 27/5. What is the second biggest value in -5, q, 4? q Let a be (-10)/(-12)(-6)/(-15). Let b = 2/103 - -196/515. What is the second smallest value in b, -2/11, a? a Let p = 1/7 - -5/14. What is the third smallest value in 1/6, p, 2? 2 Let s = -5 - -16. Suppose 0 = 3v + 5m + s, v - m - 1 = 2m. Let n = 0 - 0.1. What is the second smallest value in -4/5, v, n? -4/5 Let w(j) = -2j*2 + 5j - 2. Let k be w(3). Let i = 7 + k. Which is the smallest value? (a) i (b) 2/13 (c) -0.5 c Let h be 40/24 - (2 - 1). Let r = -6.08 + 6. Let k = -4.92 + r. Which is the smallest value? (a) 0.1 (b) k (c) h b Let m = 2/63 + -79/504. Suppose 0z = 2t + 5z - 8, 12 = 3t + 5z. Suppose -3l + 1 = -tl. Which is the second biggest value? (a) m (b) 5 (c) l a Let o = 101 - 61. Let x be 4/6(-15)/o. What is the third smallest value in -5, x, -0.3? x Let y(g) = g - 4. Let p be y(6). Let z be 59435/(-165) + 4/6. Let s = -359 - z. Which is the biggest value? (a) s (b) p (c) 0.5 b Let k = 2.1 + -1.8. Let j be 2/10 + (-22)/35. Which is the third biggest value? (a) k (b) -1 (c) j b Let m be (((-135)/(-6))/(-5))/6. Which is the second smallest value? (a) -0.3 (b) m (c) 2 a Let v = -4 + 3.7. Let o = -524141/7 + 74725. Let w = o + 152. What is the second biggest value in v, 5, w? w Let b = 4.95 + 0.05. Let u = -2 + b. Let x = u - 2.5. What is the second smallest value in 0.2, x, -0.3? 0.2 Let m be 2/(-8)(-4)/(-6). Let z = -6 - 3. Let y be (-6)/z9/24. What is the second smallest value in y, 3/4, m? y Let n = -30 + 18. Let w = n - -8. Which is the second smallest value? (a) 0.5 (b) 1 (c) w a Let g = 0 + -1. Let z = -126 - -126.4. Which is the smallest value? (a) g (b) z (c) -3 c Let g be (-3)/(-20) - (-16)/64. Which is the biggest value? (a) g (b) -1 (c) 3 c Let i(x) = -x*2 + 6x + 6. Let m be i(6). Let a = 2 - m. Let y = -0.4 - -2.4. What is the second biggest value in a, 3, y? y Let m = 629/10 - 63. What is the fourth biggest value in 0.2, m, -5, -2/5? -5 Let o(g) = -g*2 - 3g + 10. Let k be o(8). Let p = k - -467/6. Let i(l) = -l*2 - 6l - 4. Let w be i(-6). What is the biggest value in -0.2, w, p? p Let v = -10.04 - -10. What is the second smallest value in v, 0.1, -5? v Let q = -1/7 - 16/35. Let n = 0.9 - 4.9. Which is the second smallest value? (a) n (b) q (c) 0.2 b Suppose 3t = 4y + 10, 4t + 2 = -y + 9. Suppose 32 = -3b - 4m, 15 + 11 = -4b - 2m. What is the third biggest value in 5, b, t? b Let h = 16.2 - 16. Let w = -1 + -2. Which is the smallest value? (a) -1/4 (b) h (c) w c Let z = -25 + 25.4. Suppose -4c + 5d - 13 = -0c, d = 4c - 7. What is the biggest value in -1, c, z? c Suppose 11 = -4p + 5f + 1, 0 = p + 3f + 11. Let q = -8 + 4. Let v be 3/q + -5 + 5. What is the third biggest value in p, v, -2? p Let k = -10 - -4.8. Let c = k + 0.2. What is the smallest value in 3/4, c, -6? -6 Let o = -4.81 - 0.19. Let f = -0.7 - -0.2. What is the third smallest value in o, f, -0.3? -0.3 Let d = 95 + -1993/21. Let y(j) = -j*2 - 3j - 2. Let u be y(-3). What is the second biggest value in u, d, -4? u Let i(v) = 2v - 3. Let j = 3 + 1. Let u be i(j). Suppose -3d - us - 21 = -d, -s - 6 = d. What is the second biggest value in 0.3, d, 1/7? 1/7 Let n = 34/45 + -8/15. What is the third smallest value in n, 0.4, -3? 0.4 Let f be 10/4 - (-4)/(-2). Let y = 25 + -24. Which is the third smallest value? (a) y (b) f (c) 3 c Let l = -23.6 + 24. What is the second smallest value in 2/15, 3, l, 3/4? l Let z be 18/6 - (-2)/1. Let l = -0.2 + 0.2. What is the second biggest value in -3, l, z? l Let q = -12.3 + 12. Suppose 2 = -f + 4h - 7, -3f + 4h = 11. Which is the biggest value? (a) -3 (b) f (c) q c Let x = 1/185 - 381/2035. What is the smallest value in -1, x, -0.3? -1 Let h = -3 - -10. Let v = 46.5 - 54. Let y = v + h. Which is the second smallest value? (a) -4/5 (b) -2/13 (c) y c Let o = -7784/17 + 458. Let w = 21/34 - o. Which is the smallest value? (a) 3/5 (b) 3 (c) w c Let m(s) be the third derivative of -s5/60 + s4/6 + 7s3/6 - s2. Let o be m(5). Which is the second biggest value? (a) o (b) -5 (c) 0.4 c Let w be ((-4)/(-18) - (-34)/9)4. What is the third smallest value in 5, w, -0.4? w Let z = 37 - 44. Let o = 3 - 3.5. Which is the biggest value? (a) o (b) 3 (c) z b Let g = 0.86 - 5.86. What is the biggest value in 0.1, g, 4, 3/5? 4 Let s be ((-2)/3)/((-10)/(-12)). Which is the smallest value? (a) s (b) 8 (c) 0.5 (d) 0.2 a Let p = -169/270 - -7/10. Let o = 0.7 - 2.7.	{ "pile_set_name": "DM Mathematics" }
r letters picked without replacement from gtgggtggtttg. Give prob of sequence gggt. 35/396 Four letters picked without replacement from qnncwffffqwnkn. Give prob of sequence nfnw. 4/1001 Calculate prob of sequence vsv when three letters picked without replacement from {w: 7, v: 3, s: 2}. 1/110 What is prob of sequence ee when two letters picked without replacement from {e: 3}? 1 Two letters picked without replacement from ioabiiiibiboaii. Give prob of sequence oo. 1/105 Three letters picked without replacement from {o: 5, a: 6, m: 4}. What is prob of sequence moo? 8/273 Two letters picked without replacement from ulwexnn. Give prob of sequence lx. 1/42 What is prob of sequence tp when two letters picked without replacement from {w: 1, e: 1, k: 1, v: 2, p: 1, t: 1}? 1/42 Four letters picked without replacement from {i: 4, s: 2, v: 4}. Give prob of sequence ssvi. 2/315 What is prob of sequence aoh when three letters picked without replacement from {w: 1, h: 1, o: 2, x: 1, t: 1, a: 2}? 1/84 What is prob of sequence bi when two letters picked without replacement from biiibibbbiibiibi? 21/80 What is prob of sequence zzk when three letters picked without replacement from {k: 5, z: 2}? 1/21 Calculate prob of sequence bbsz when four letters picked without replacement from {s: 4, b: 3, l: 1, z: 10}. 1/306 What is prob of sequence eo when two letters picked without replacement from {m: 1, o: 1, e: 1}? 1/6 Two letters picked without replacement from {m: 1, l: 1, r: 1, y: 1, q: 1}. What is prob of sequence lm? 1/20 Calculate prob of sequence iii when three letters picked without replacement from iiiiiiiiigiigig. 44/91 Calculate prob of sequence qm when two letters picked without replacement from qddwvvddm. 1/72 Four letters picked without replacement from mbmbbmbmbb. Give prob of sequence bmbm. 1/14 What is prob of sequence iiii when four letters picked without replacement from {b: 11, i: 9}? 42/1615 Calculate prob of sequence sg when two letters picked without replacement from {v: 2, g: 2, w: 4, s: 2}. 2/45 What is prob of sequence dd when two letters picked without replacement from ddddddddd? 1 Calculate prob of sequence ey when two letters picked without replacement from {e: 3, n: 1, h: 1, c: 2, y: 8, m: 1}. 1/10 Four letters picked without replacement from dndnnnnndnnddn. What is prob of sequence dddn? 45/2002 Three letters picked without replacement from {t: 4, m: 1, z: 1, k: 4, y: 1, x: 3}. What is prob of sequence myz? 1/2184 Two letters picked without replacement from {z: 1, y: 2, q: 1, w: 1, k: 4, i: 6}. What is prob of sequence wq? 1/210 Calculate prob of sequence nn when two letters picked without replacement from ninnnninnninnnninnin. 21/38 What is prob of sequence fee when three letters picked without replacement from rettfeeeeeekrebebtb? 4/323 Four letters picked without replacement from vwddvvvvdpvvvvvwdwb. What is prob of sequence wpdw? 1/3876 Two letters picked without replacement from jnijfyd. What is prob of sequence fy? 1/42 What is prob of sequence ueex when four letters picked without replacement from xxxexjuxuuuxxexuxxej? 5/1938 Four letters picked without replacement from {e: 9, d: 3, l: 2, w: 2, s: 1}. What is prob of sequence lwld? 1/4760 Calculate prob of sequence kbzb when four letters picked without replacement from {b: 2, z: 1, r: 1, n: 2, d: 1, k: 2}. 1/756 What is prob of sequence ddmm when four letters picked without replacement from mmmdmmimmddidi? 3/143 Four letters picked without replacement from cdtihghtitcc. Give prob of sequence dtcc. 1/660 What is prob of sequence zrzr when four letters picked without replacement from {z: 2, r: 2, t: 1}? 1/30 What is prob of sequence ld when two letters picked without replacement from {c: 2, l: 1, m: 1, d: 3, r: 3}? 1/30 Calculate prob of sequence oddk when four letters picked without replacement from kvokkovvvkdkgvddkv. 1/1020 Calculate prob of sequence ajg when three letters picked without replacement from {j: 1, v: 3, g: 2, w: 1, a: 4, z: 1}. 1/165 Two letters picked without replacement from {e: 6, o: 1, w: 5, l: 6}. What is prob of sequence ew? 5/51 What is prob of sequence fy when two letters picked without replacement from {y: 2, f: 4}? 4/15 Two letters picked without replacement from fxbfbfhfbfnfhfhxwh. What is prob of sequence xh? 4/153 Three letters picked without replacement from {e: 1, h: 7, y: 5}. What is prob of sequence eyh? 35/1716 Four letters picked without replacement from ppppttptptttttttttt. What is prob of sequence pppt? 65/3876 Four letters picked without replacement from {n: 7, w: 5, l: 7}. Give prob of sequence llln. 245/15504 What is prob of sequence fggf when four letters picked without replacement from {g: 2, f: 7}? 1/36 Calculate prob of sequence kqio when four letters picked without replacement from okioqqqiqoiqqq. 3/1144 What is prob of sequence nn when two letters picked without replacement from entnnetnnntntntn? 3/10 Calculate prob of sequence vycc when four letters picked without replacement from vyvvyvyvyvvvvyycc. 9/4760 Three letters picked without replacement from sbjmmmgsshb. Give prob of sequence hmj. 1/330 Two letters picked without replacement from nokoxnkkkxcokoxckcko. What is prob of sequence xn? 3/190 What is prob of sequence iei when three letters picked without replacement from efqii? 1/30 Two letters picked without replacement from {v: 2, l: 3, b: 3, n: 1, q: 5, y: 1}. What is prob of sequence qv? 1/21 What is prob of sequence bzz when three letters picked without replacement from {z: 2, b: 6}? 1/28 Four letters picked without replacement from {f: 10, p: 4}. Give prob of sequence fffp. 120/1001 Calculate prob of sequence nbbb when four letters picked without replacement from bbbbbbbbbbbbbnbbbbb. 1/19 Four letters picked without replacement from lllldllllddl. What is prob of sequence ddll? 2/55 Two letters picked without replacement from {v: 1, i: 3, p: 1, x: 1, z: 3, d: 2}. Give prob of sequence iz. 9/110 What is prob of sequence tkh when three letters picked without replacement from hkhhhfptfkhhhhhhhr? 11/2448 What is prob of sequence kkvk when four letters picked without replacement from {k: 3, b: 13, v: 2}? 1/6120 Three letters picked without replacement from oamtmmamtoam. Give prob of sequence ata. 1/110 What is prob of sequence fo when two letters picked without replacement from {f: 4, o: 3}? 2/7 What is prob of sequence ru when two letters picked without replacement from rbzuburbulrbbruubtb? 10/171 Calculate prob of sequence ot when two letters picked without replacement from dodtt. 1/10 Two letters picked without replacement from {r: 2, z: 1, e: 9, x: 7}. Give prob of sequence rz. 1/171 What is prob of sequence goo when three letters picked without replacement from {g: 1, o: 5, j: 4}? 1/36 Four letters picked without replacement from {r: 2, c: 10}. Give prob of sequence rccc. 4/33 Four letters picked without replacement from {q: 7, w: 1}. What is prob of sequence qqqw? 1/8 Two letters picked without replacement from {y: 4, e: 2, z: 1, n: 6, f: 3}. Give prob of sequence ff. 1/40 Calculate prob of sequence sl when two letters picked without replacement from {s: 3, o: 1, p: 2, l: 3, i: 2, x: 1}. 3/44 Four letters picked without replacement from {z: 1, d: 1, o: 3, w: 3, e: 3}. What is prob of sequence zooe? 1/440 Three letters picked without replacement from zzzlzlzzzzzzz. Give prob of sequence lzz. 5/39 Three letters picked without replacement from lllxxzxbzlzxlxzbxx. What is prob of sequence zzz? 1/204 Two letters picked without replacement from {d: 5, w: 11}. What is prob of sequence wd? 11/48 Two letters picked without replacement from {v: 1, y: 2, i: 8, w: 1, u: 2}. What is prob of sequence vi? 4/91 Three letters picked without replacement from cvbcydib. Give prob of sequence dbb. 1/168 What is prob of sequence odc when three letters picked without replacement from qeddoqdqqdeqdcqdqeqe? 1/1140 Three letters picked without replacement from qkqktqdqktrtkj. Give prob of sequence tdr. 1/728 What is prob of sequence jqv when three letters picked without replacement from {v: 1, q: 1, j: 5, i: 1, e: 4}? 1/264 Three letters picked without replacement from boobiioobb. Give prob of sequence bbo. 1/15 Calculate prob of sequence xk when	{ "pile_set_name": "DM Mathematics" }
k = 3b + 4u, -2u + 10 = -3b. Suppose b = -0h + 7h - 28. Solve -hj + j - 15 = 0 for j. -5 Let k = 25 - 22. Let p = -44 + k. Let c = -39 - p. Solve -3f - c = -2f for f. -2 Suppose -3h - 216 = -3g, 0 = 3g + 12h - 7h - 200. Let n be 38/5 - (-28)/g. Solve 0 = nd - 4d + 8 for d. -2 Let p = 568 + -564. Suppose 3o - 41 - 19 = 0. Solve pb + 0 = o for b. 5 Suppose -4l + 2d = -10, 3l - 124d + 126d = -3. Suppose -4b - 20 = 5s, 0 = 2s - b + l - 6. Let x = 8 + -5. Solve xt + 1 + 11 = s for t. -4 Let b(q) = 4q*2 - 51q + 2. Let t(p) = 8p2 - 102p + 5. Let k(w) = 13b(w) - 6t(w). Let m be k(13). Solve 0 = -5n + m - 14 for n. -1 Let m(o) = -3o - 41. Let g be m(-18). Suppose -2c + 21 = 5r, -2c - g = 2r - 25. Solve -3 + r = f for f. 0 Let x(c) be the second derivative of -7/12c4 + 1/2c*3 + 1/20c*5 + 20c + 0 - 8c2. Let t be x(7). Solve t = -3b + 20 for b. 5 Suppose l + 7 = 5h - 16, l + 5h - 27 = 0. Solve -17 = -5x - l for x. 3 Let l(q) = 1 - 2q + 47q2 - 22 - 46q*2. Let d be l(-4). Solve -5v + d = -12 for v. 3 Let z(a) = -a*2 - 13a - 12. Let x be z(-12). Suppose 12w = 8w + 12. Suppose -b - 4h + 5 = 0, -5b = wh - 25 - 0. Solve -2r + br = x for r. 0 Let m = 2673 + -2667. Solve -mv + 2 = 26 for v. -4 Let c = -574 - -580. Let w be 8/10 + (-44)/(-20). Suppose -r + 0 = -w. Solve -5m = -rm + c for m. -3 Let g(k) = 4k2 + 80k + 162. Let p be g(-2). Solve 64b - 58b = -p for b. -3 Let x be (-3)/154 + (-132)/(-165). Let f be 2 - -6 - 0/4. Let g be (10/f)/(2/8). Solve -gp + x = -20 for p. 4 Let s = -513 - -1158. Let i = 653 - s. Solve 22 = iq - 18 for q. 5 Let r be ((-12)/(-10))/(3/15). Let g be (-43)/((-5160)/18) + (-819)/(-140). Solve g = -rp - 0 for p. -1 Let h(f) = 29f2 - 51f - 4. Let a be h(2). Solve 19b - a = 14b for b. 2 Let v be -5 - (-7 - (-750)/40)-4. Solve 25q - v = 11q for q. 3 Suppose 5z - 11r + 7r - 32 = 0, 9 = -3r. Let t(j) = -2j*2 + 10j - 8. Let v be t(z). Solve v = -c + 2c - 2 for c. 2 Let q = 201 + -194. Let y(i) be the first derivative of i3/3 - 4i*2 + 10i + 2. Let j be y(q). Solve -3 = 3f + j for f. -2 Let b(k) = k3 - 10k*2 - 9k - 19. Let u be b(11). Let g be 7/u - (-19)/(-57). Solve -2 = gj + 4 for j. -3 Let m(q) = 5q + 12. Let y be m(-2). Let v(x) = 2x2 + 2x. Let k be v(-3). Suppose 55 = 18b + 19. Solve -k = -bg - y for g. 5 Let u = -29 + 81. Let t be 0/(-3 + 4 + 1). Suppose 6p + 40 - u = t. Solve ps - 3s = -2 for s. 2 Suppose 0 = 101h - 145h. Solve -18w + 8w - 20 = h for w. -2 Let l be 14118/65 - (-99)/(-45). Solve 3o + 239 = l for o. -8 Let d be 1-61/(-2). Let u(v) = -v*3 + 9v*2 + 40v + 12. Let a be u(-3). Solve a = -c - d - 2 for c. -5 Let x = -34 - -42. Suppose 2737 + 2859 = -18a + 5722. Solve 5k = x + a for k. 3 Suppose -139 = 6m - 193. Solve md = 4d - 12d for d. 0 Let y(l) = l*2 + 3l - 3. Let r be y(2). Suppose -5z + 2n + 71 = 0, z + 0n = 4n + 7. Solve rx - z = 12x for x. -3 Suppose 3j - 10 = t, 0 = -j + 71t - 75t + 12. Suppose u = 3 + 3. Solve -jb + 2 + u = 0 for b. 2 Suppose -242z + 29z + 19176 = -2550. Solve 3y - 123 = -z for y. 7 Suppose q + 15 = 5y, 3y - 4 - 5 = -q. Suppose 14d - 144 = 2d. Solve yi + i = d for i. 3 Suppose 4h - 179 = -5s, -3s = -3h + 97 + 71. Solve -hb + 125 = -28 for b. 3 Let r = 15 + -38. Let j = r - -40. Solve 0 = 5z + j - 2 for z. -3 Suppose -65u + 1980 = -1985. Solve u - 21 = -8i for i. -5 Let w(a) = a + 4a2 - 7a + a - 2a2 - 8 - a2. Let o be w(7). Solve oh = -11 - 7 for h. -3 Let l be (-10)/(-4) + (-2)/4. Suppose 0 = -2c + 2b - 2, 0 = -lc + 4b - 4. Suppose c = -x - 3u + u + 3, 3x - 20 = 5u. Solve -t + xt = 0 for t. 0 Suppose -3h + 5x + 8 = -16, -27 = -5h + 4x. Let c be ((-4)/(-4) - 3/1)/(-1). Solve 4f - c = hf for f. 2 Let p = -406 - -412. Suppose -p = -2v - 4i, 5i = -v - 2v + 9. Solve vf = -3 - 9 for f. -4 Let l = 5902 - 5881. Solve ls - 18 = 15s for s. 3 Let x = -1009 + 1009. Solve 5w + 57 - 62 = x for w. 1 Let x(n) = n2 + n + 1. Let z be x(3). Let b = z + -8. Let g(f) = f3 + 42f2 - 351f + 379. Let k be g(6). Solve b = 2v + k for v. 2 Suppose -54y + 51y + 27 = 0. Suppose -3t + 3v + 27 = 0, 5t + 2v + 40 = yt. Solve 2s - t + 3 = 0 for s. 4 Let i(h) = -2h*2 + 6h. Let o be i(6). Suppose -5s + 4s + q - 40 = 0, 3s + 124 = 5q. Let v = o - s. Solve j = -vj + 15 for j. 5 Let j(k) = k2 + 114k + 1139. Let n be j(-103). Solve 3f = nf for f. 0 Suppose -3c + 31 = 5o, -2c = 3c - o - 5. Let k(y) = -y*2 + 65y - 590. Let t be k(11). Solve 6 = tv - c for v. 2 Let o = -131 - -130. Let h be (-8 + 3)(32/(-20) + o). Solve -10 = -15s + hs for s. 5 Suppose 4488 = 259t - 72t. Solve ts - 60 = -12 for s. 2 Suppose -131k + 101k + 4104 = 141k. Solve 0 = -14r - kr - 228 for r. -6 Suppose 752 = 49b - 81. Solve -b = 13q + 48 for q. -5 Let h = 5718 - 5718. Solve 9o + 7 + 47 = h for o. -6 Let d be -13 + (5 - (4 - 2)). Let x be (d + 100/8)14/5. Solve xi + 24 - 3 = 0 for i. -3 Suppose 0a - 2 = -2a. Let n be 2/(-8) - 174/(-24). Suppose -n = -2x + 1. Solve a = -5u - x for u. -1 Let o = 4584 - 4584. Solve -20g - 12g + 32 = o for g. 1 Suppose -11069g + 11068g = -2. Let f be 3/(-2)-12. Suppose 6 = -s - fs + gr, 3r - 9 = -5s. Solve 2d + 0 - 2 = s for d. 1 Suppose -25r - 112 = -32r. Suppose 0 = 29x - rx. Solve -3j + xj = -6 for j. 2 Let n = -3712 - -4180. Solve 477s - ns + 45 = 0 for s. -5 Suppose 20 = 2k + 5m, 30 = -0k + 3k - 3m. Suppose -ka + 12a = 0. Let g(c) = -c3 - c2 - c + 6. Let w be g(a). Solve -4x - w = -x for x. -2 Let j = -11763 + 11817. Solve -20t + j = 14 for t. 2 Suppose -5u - 10d + 5d + 110 = 0, 0 = 3u - 2d - 56. Solve -55y = -59y - u for y. -5 Suppose 2g = 5n + 3g - 100, 5n - 100 = 5g. Let q(k) = 3k*2 + 26k - 8. Let a be q(-9). Suppose y = a, -4y + 1 = 4x - 3. Solve x = 5h + n for h. -4 Suppose s - 24 = -4s + j, 0 = 4s - 5j - 36. Suppose -3u = -6, -10 + 35 = 3t + 5u. Suppose 0 = -tx + 22 + 18. Solve 8 = sf - x for f. 4 Let o(x) be the third derivative of 55x*4/24 + 95x*3/3 + 3x*2 + 4x. Let f be o(-3). Solve -f = 5j - 15 for j. -2 Suppose 2t - 6b = -2b + 82, -3b - 34 = -t. Solve tu = 42u - 65 for u. -5 Let o be 5772/96 - (2 - 15/8). Let t = 65 - o. Suppose -4 = 4s, 2j + 7s - 5 = 4s. Solve 0 = -ja + 3a - t for a. -5 Let t(n) = n3 - 2n*2 + n + 2. Suppose 2h - 5 = x, -3x - 4 = 5h - 0h. Let m be (h - 17)/(-4) + 4/(-2). Let b be t(m). Solve -b = -2j - 0j for j. 2 Suppose -4t - 3n = -109, 2t + 0n - 52 = -4n. Suppose tw = 23w. Solve -3b + 8 - 14 = w for b. -2 Let x be ((-16)/28)/((-36)/126). Suppose -5v + 11 = -9, 0 = -2t + 4v + 18. Suppose -2c = -27 + t. Solve -x = 4u - cu for u. 2 Suppose 124 = 8o + 92. Let w be 10(-5)/(-175)7. Solve -wy + 4 + o = 0 for y. 4 Suppose 0 = -30v + 5883 + 1527. Suppose -v = -26n - 65. Solve -nk + 6k + 1 = 0 for k. 1 Let i be (-42)/98(-21)/180. Suppose 0q - 5q = -50. Let y = -6 + q. Solve 4 = -ij - yj for j. -1 Suppose 41k - 43k + 12 = 0. Suppose 7v + 15 = kv. Let z be (-1)/5 - (-4 + (-57)/v). Solve z = -t - 3t + 12 for t. 3 Let v(r) = -81r - 797. Let t be v(-10). Solve 37 = -10z - t for z. -5 Let t = 398 - 394. Let z(l) = l*3 + 4l*2 - 6l + 4. Suppose 3n + 25 = -2n. Let o be z(n). Solve -5k = -ok + t for k. 1 Let f be 50/(-5)(-1)/2. Suppose -h = 3h + 148. Let v be (1 + 3/2)/(h/(-74)). Solve 0t = vt + f for t. -1 Let d be 0(7 - 8)/(-1). Suppose 1 = -s + q, 15 = 3s - ds + 3q. Solve -6 = -2u - s for u. 2 Let l = 22681 + -22563. Solve -14 = lo - 104o for o. -1 Let x = -23616 - -23652. Solve 0 = -106a + 115a - x for a. 4 Suppose -21r + 8r = -637. Let n = 54 - r. Solve ns = -0s - 5 for s. -1 Let i(g) = 14g*2 + 4g - 4. Let k be i(2). Suppose 8x - k = -20. Suppose -p - x = -2p + u, -u = 2p - 7. Solve -c = -pc for c. 0 Let n(a) = a*2 - 4a - 3. Let c be n(5). Suppose -5j = c - 7, 8 = 2v - 2j. Suppose vw = 2x + 55, 3x = -0x - 15. Solve -5u = w + 6 for u. -3 Suppose -6 = 2a - f, -2a + 5f - 3 = 11. Let k be ((-6)/a)/(99/132). Solve -3g + 5 = -kg for g. -5 Let r(i) = 3i*2 + 35i - 33. Let q be r(-13). Solve -2*j - 5	{ "pile_set_name": "DM Mathematics" }
- 12, -2k = 3f + 8 + 1 for f. -5 Solve 2h - 2 = v, 32v = -2h + 35v + 6 for h. 0 Solve 8a - 3a + g - 25 = 0, 3g = a + 11 for a. 4 Solve -2y + 4 = -3z, -5y - 24 = -z + 2z for z. -4 Solve -5i - 157 = 2u - 128, u = -3i - 17 for i. -5 Solve 4x = 274l - 269l + 37, 3l + 4x = -3 for l. -5 Solve h = d - 3, 1 + 3 = 2d for h. -1 Solve 3l - 4a - 2 = -19, 0 = 2l + 2a + 2 for l. -3 Solve -n + 15 = 4n + 5g, -2n = -5g + 15 for n. 0 Solve f = -4c + 13, 0 = -2c - 3f - 28 + 27 for c. 4 Solve o - j - 2j = -11, 0 = -4j + 12 for o. -2 Solve 2j = 2s, 3s + 5j = 3s for s. 0 Solve 0 = -j + 5, 0j + 6 = -d + j for d. -1 Solve -u - 23 = 5x, -57x + 59x + 4 = -3u for u. 2 Solve 3w + 2n + 20 = 6w, -w + 2n + 12 = 0 for w. 4 Solve 2x + k = 0, 3k = -3x + k - 1 for x. 1 Solve 12y = -3o + 11y + 7, 0 = 4y - 16 for o. 1 Solve 3c - s + 5 = 0, -2c + 5s - 2s = 1 for c. -2 Solve -4n - 17 = 3g, 2g + 4n + 12 = -6 for g. 1 Solve 4z - 3p = 5z + 9, -6 = 4z + 2p for z. 0 Solve m - 8 = -m, g = -2m + 12 for g. 4 Solve -3k + 7c - 12c + 7 = 0, -2c = 5k + 1 for k. -1 Solve 4o - 19v + 16v = 3, -3o + 4v - 3 = 0 for o. 3 Solve 5t - 8t + q = 8, 5q = 25 for t. -1 Solve 43i + 5s = 42i - 24, -3s - 10 = 5i for i. 1 Solve 4q = p + 4, -p - 2p - 12 = -5q for q. 0 Solve -3l + 6g - 8 = 4g, 2l = g - 3 for l. 2 Solve 3r = 3a + 12 - 21, 3r - 6 = -2a for a. 3 Solve -l = 5p + 4, 3l + 3p + 9 + 3 = 0 for l. -4 Solve 13 = 3s + 4i, -2s - 2i = -8 + 2 for s. -1 Solve 5o + 4v + 5 = 0, 5o + 11 = v + 31 for o. 3 Solve -15 = 5a, -84 = -5g - 4a - 96 for g. 0 Solve -d - 6 = -4a, -5a - 2 = -3d - 6 for d. 2 Solve 22g - 20 = t + 27g, -4g - 5 = 3t for t. 5 Solve 0 = -4b - y - y, 3b + 2 = -y for b. -2 Solve -5o = -15, -7o - 10 = w - 10o for w. -1 Solve -2i = 5d + 4, -4d - 2i - i = -1 for d. -2 Solve 0 = -2a + 4o, 4a - 3o + 20 = 15 for a. -2 Solve t - 8l + 3 = -13l, 2t = -3l - 6 for t. -3 Solve 0 = 5v + 4h - 4 - 3, -2v + 10 = 4h for v. -1 Solve 12 = -2t + 4t - 4n, -n = -3t + 3 for t. 0 Solve -3l = g + 22 - 13, -2g = -4l - 12 for l. -3 Solve 2u + 20 = -2w, -3w + 0u = 4u + 35 for w. -5 Solve 4i = v + 20, -3v = -i - 2v + 8 for i. 4 Solve -3d = -8a + 5a - 27, -5a - 2d = 10 for a. -4 Solve 0 = 2v + 3p + 10, -4v + 9v - 21 = 4p for v. 1 Solve 7p - 4d = 3p, 0 = -p - 3d - 8 for p. -2 Solve -4j - 5x + 16 = -x, j = -5x + 24 for j. -1 Solve 56i - 51i + 23 = -h, -3h + 21 = -3i for h. 2 Solve 2x = -4h + 7h - 9, 0 = 2h - 3x - 11 for h. 1 Solve 0 = -4s + 3x + 39, -s + 119x - 118x + 11 = 0 for s. 6 Solve -3g + 5 = 5d, 5g - 3g = 4d + 18 for g. 5 Solve -1 = 4k + 84w - 79w, -12 = -4w for k. -4 Solve 4q + 2 = -3m - 1, 0 = q for m. -1 Solve -7k - 80 = -5o, -51 = 4k - k - 4o for k. -5 Solve -3m - 13 = -2v - 2v, -m + v = 4 for m. -3 Solve 0 = k - 3, -5k + 9 = 4w + 6 for w. -3 Solve -v = -4j - 14, -j = -v + 2 - 0 for v. -2 Solve -3h + 4d + 3 = 3d, -4d - 12 = 2h for h. 0 Solve -x - 8f + 4f - 5 = 0, x + f = -2 for x. -1 Solve 0 = -5c + 4z - 8, 13z = -3c + 10z - 21 for c. -4 Solve -5c - 29 = -4u, -5c + 19 = 6u - 2u for c. -1 Solve -26 = -4v + 2x, v - 2 = -3x + 2x for v. 5 Solve 0 = 3n - 3w + 3, 0 = 2n + 3n + 4w - 13 for n. 1 Solve t + 6 = -3o - 10, 5t + 16 = o for t. -4 Solve -3r + j - 6 = 0, -4r - j + 2 = 10 for r. -2 Solve 5p - 3 + 9 = 4o, -2p = 8o + 12 for p. -2 Solve -4d + 16 = 0, -15o = -19o - d for o. -1 Solve -71i = 3p - 72i + 14, 12 = -4p - 2i for p. -4 Solve 3u = -5o + 2o + 12, 3u - 4o = 5 for u. 3 Solve 0l + l - 4s = -20, -20 = 5l - 4s for l. 0 Solve -3f - 7u = -10u - 18, f - 2u = 10 for f. 2 Solve -3k = 4t + 2, 0k = 2k - 4 for t. -2 Solve 3k - 14 = a, 5a - 4a = -4k + 14 for k. 4 Solve 0 = 3n - 4t + 4, n - 3n - 2 = -2t for n. 0 Solve -4p = 5s - 13, 4p - 3p - 1 = s for p. 2 Solve -9z + 13z = -3y - 8, 3z - 2y + 23 = 0 for z. -5 Solve -4a - 20 = -5h, -5h - 10 = 2a - 0a for a. -5 Solve -4v + d = 6d - 9, -2v - 4d = -6 for v. 1 Solve 5q + 6 = -5f - 24, -3q + 2f - 8 = 0 for q. -4 Solve 2x = -3b + 14, -10 = x - 2b - 3 for x. 1 Solve -9 = -3d + 3, 4b = -2d + 8 for b. 0 Solve -31y = w - 26y + 8, -3w = 2y + 11 for w. -3 Solve 0 = 2k + 3b - 8, -3b - 2b + 20 = 0 for k. -2 Solve 5x = a - 23 + 3, 4 = -x + 2a for x. -4 Solve 5a - f - 3f + 9 = 0, 0 = 5a - 2f + 7 for a. -1 Solve 3f - 3l = 27, f - 2f + 17 = -3l for f. 5 Solve -6y - 24 = -3l - 2y, -5y = 5l - 5 for l. 4 Solve 2m = -5h + 6, -3h - 4 = 5m - 0h for m. -2 Solve d + 6 = 2n, n = -5d + 6d + 4 for n. 2 Solve 4f + 2 + 2 = -b, -2b + 14 = -3f for b. 4 Solve -m = 4c + 10, c - 19 = 6c - 2m for c. -3 Solve -f + 9 = 3g, -4f = -5f - g - 1 for f. -6 Solve 0 = -f - 3s - 8, -4f - 4s = s + 4 for f. 4 Solve -11 = 3w + r, -w - 6r = -5r + 7 for w. -2 Solve -3 = 3u - 3g, -2u + g = 14 - 17 for u. 4 Solve 5x = 3v - 41, x = 4x + 2v + 17 for x. -7 Solve 25m - 22m = -4s - 29, 2s = 3m - 1 for m. -3 Solve -4d + 9 = -c - 7, -9 = -c - d for c. 4 Solve 5i = 2j + 4i - 7, j - 3i = 6 for j. 3 Solve -25 = -0g - 5g - 2l, 2l = 10 for g. 3 Solve 3k + 0k - z = -7, -6 = 3z for k. -3 Solve 0 = 3o + 3x - 6, -7 + 2 = 2o - x for o. -1 Solve 5q - n = 25, 2q + 3n + 12 - 39 = 0 for q. 6 Solve -13 = j - 3f, 0 = 3j - f + 5f for j. -4 Solve 2a - 22 = 3d - 26, a = -2 for d. 0 Solve -s + 3a - 16 = -8, -a + 1 = 0 for s. -5 Solve -2l + 20 = n + 29, -5n - 21 = 4l for l. -4 Solve 3a + 25 = 5m, -22 = -3a - 37 for m. 2 Solve -2p - 2a + 6 = 0, -p - 21 = -5p + 5a for p. 4 Solve -59v + 54v - 40 = 4z, 3v + 7 = z for v. -4 Solve -11 = 5l - 5r - 46, 5l - 23 = 2r for l. 3 Solve 5y = h + 6y - 7, 3h + 4y - 23 = 0 for h. 5 Solve 2o + 6 = -n, -7n = 4o - 10n + 2 for o. -2 Solve 5n + 4o = o - 10, 2n - 4o + 30 = 0 for n. -5 Solve 6t - l = 5t, -t - 4l = -25 for t. 5 Solve -4h = 5s + 36, 0 = -2s - 0s - 8 for h. -4 Solve v + 20 = -5w - 3v, -4v = -2w - 36 for w. -8 Solve -24 = 3x - 3s, 4s - 33 = 2x - 11 for x. -5 Solve 4c = -8, -14l + 10 = -13l - 3c for l. 4 Solve -3v = -5f + 4, 0f - 3v - 11 = 2f for f. -1 Solve 2c - 182 = r - 188, -5r + 3c = -2 for r. -2 Solve 0 = -5m + 11w + 64, w = m + 48 - 56 for m. 4 Solve 3n - 4b - 13 = 0, -4n + 2b = 5b - 9 for n. 3 Solve -2b - 7 = -5d, -6b - 2d = -b + 3 for b. -1 Solve 14m - 4z - 16 = 17m, -3z - 37 = -4m for m. 4 Solve -39a = -34a - 5i - 35, -5i - 7 = 2a for a. 4 Solve 15 = 10f - 12f - y, 4f - 5y - 5 = 0 for f. -5 Solve 436x - 5j = 438x + 8, 2j = -4x for x. 1 Solve -4b - r + 2 = 0, -2b + 5b = -3r - 3 for b. 1 Solve 3g = 4k - 18, -4k - 5g - 3 = -5 for k. 3 Solve d - 3c + 11 = 0, -1 = -6d + 9d - c for d. 1 Solve 23 = -2y - 72j + 77j, 33 = -4y - 3j for y. -9 Solve 10 = c - 5v, 109c = 106c - v - 18 for c. -5 Solve -5o + 2p = -4, -92o + 21 = -89o + 5p for o. 2 Solve -3m + 6 - 28 = -2b, -5m = 2b + 10 for b. 5 Solve 5n = 25, t + 4n - 20 = -2t for t. 0 Solve -4y = 8, 0q - 14 = -2q + 5y for q. 2 Solve 23 - 48 = -w + 5g, -4w - 2g = -12 for w. 5 Solve 4h = -w + 7h - 11, 4h = 16 for w. 1 Solve -3p = -2n + 13, -11 = 29n - 33n + p for n. 2 Solve 0 = -j - 5, -26q + j - 5 = -31q for q. 2 Solve -40 = i - 3o - 57, 4i = -5o for i. 5 Solve -3w + 3o - 8 = 2w, 4w = 4o for w. -4 Solve -a = 4o - 8, -3a - 13 = -o - 11 for a. 0 Solve y + 4y - 5c = -25, 2c - 14 = 4y for y. -2 Solve 1923l = 1919l - 3r - 7, 3l + 9 = -r for l. -4 Solve -2n = i - 15 + 7, 2n + 2i = 6 for n. 5 Solve 30 = -2g + 4t, -149t + 145t = -20 for g. -5 Solve -7k + 3k - 14 = 3r, -3r + 2k + 16 = 0 for r. 2 Solve 0 = -4n + 3m - 15, -10m = 3n - 12m + 12 for n. -6 Solve -5l - 5 = 0, -d + 54 - 56 = 2l for d. 0 Solve -i - 5a + 12 = -3, -20 = -5a for i. -5 Solve 2 = n + 2o, -60 + 58 = -o for n. -2 Solve 2i + 3 = m, -2m - 5i - 9 = -6 for m. 1 Solve 5z + 0c = 5c + 5, 0 = 3z + 4c - 17 for z. 3 Solve 2u + 2 - 4 = 2n, 4n = 0 for u. 1 Solve -3p = 6c - 33, c + 2 = 7 for p. 1 Solve 5n + 7 = r - 3, -r + 4n = -7 for r. -5 Solve 2w + 2 = -2r + 8, -2*	{ "pile_set_name": "DM Mathematics" }
, -1/2? -0.31 What is the closest to 0.2 in 9295, -9, 1/4, 19? 1/4 Which is the nearest to -0.6? (a) -2 (b) -920/9 (c) 0.07 (d) 12 c What is the closest to -0.3 in 0.3, 24.5, -10/47, 4/5? -10/47 What is the nearest to -2.93 in -0.6, 5, -525? -0.6 Which is the closest to 608/59? (a) 5 (b) -3/5 (c) -3 a What is the nearest to 5738.4 in -3, 0.09, -0.3, -4? 0.09 What is the nearest to 1/45 in -21, 19, -106? 19 Which is the nearest to 6/61? (a) 37 (b) 0.224 (c) -0.1 b Which is the closest to 24/5? (a) -1/3 (b) 2/459 (c) 5 (d) -2 (e) -49 c What is the nearest to 696535 in 4, -3, 0.5, -4? 4 What is the nearest to -59 in -9, -2, 3/4, -0.38, -0.02, 5? -9 What is the nearest to -56 in 22029, -4, 2? -4 Which is the nearest to 1/10? (a) 1/32 (b) 1/40 (c) 8 (d) 74 (e) -3/4 a What is the nearest to -1/3 in -5/6, 0.5, 1, 36? -5/6 Which is the closest to -10362? (a) -1 (b) -4/3 (c) 2/823 (d) 1/4 b What is the nearest to -40421 in -3/2, -1/5, -1/3? -3/2 What is the nearest to -176 in 2/7, 0.03, -26, 1? -26 What is the closest to -300556 in 2/7, 0, -2/37? -2/37 Which is the closest to -1040? (a) -17 (b) 1/2 (c) 1/5 (d) -1/7 a Which is the closest to 1? (a) 5 (b) -9 (c) -0.15 (d) -3/124 d What is the nearest to 1/3 in -136344/7, -0.4, -64? -0.4 What is the nearest to -19 in 338, 5, -1499? 5 Which is the nearest to 2? (a) 0.1 (b) 2449 (c) -2 (d) -9 (e) 1.4 e Which is the closest to -1? (a) -5 (b) -0.9 (c) 1/2 (d) 5822/3 b Which is the closest to 1393? (a) 0.06 (b) 46 (c) 3 (d) -1/3 b What is the closest to 14 in 13/2, -6698, -5, 4, -0.2? 13/2 What is the nearest to -0.1 in 1.714, -1/5, -1038.5? -1/5 What is the closest to 1/4 in 2, -27/4, -3, -6, 145? 2 Which is the closest to 1? (a) -311 (b) 3 (c) 5 (d) -0.1 (e) -73 (f) 9/10 f Which is the nearest to -3.909? (a) -4/3 (b) -4 (c) -0.5 (d) 1742 (e) -0.1 b What is the nearest to -0.2 in 0.054, -71038, 0.3, -3, 5? 0.054 Which is the closest to 50928? (a) -3/7 (b) -0.3 (c) 2/9 c Which is the nearest to -3? (a) -60 (b) -147 (c) 2 (d) 8 c Which is the nearest to -0.1? (a) 2/7 (b) -0.56 (c) 1926/11 (d) 4/13 a What is the nearest to -7 in -3, -30, -7, -39, -5/3, 4? -7 What is the closest to 4/3 in -4328, 1/4, -15? 1/4 Which is the nearest to 1/9? (a) -26 (b) 1/10 (c) -5 (d) 51/2 b What is the nearest to -4 in 12, -761.7, 6/7, -16? 6/7 Which is the nearest to 0.050497? (a) 123/4 (b) -4/3 (c) 4 (d) -0.5 d What is the closest to -2 in 6316/19, 2/5, 1, 5, 0.2? 0.2 Which is the nearest to 1? (a) -9.17 (b) -1/14 (c) 0.1 (d) 2.8 c What is the closest to 0.9 in -6, 3, -0.5, -5, -92, -50? -0.5 Which is the closest to -4484? (a) -0.4 (b) 0.4 (c) -2618 c Which is the closest to -1? (a) 1.5 (b) 9.394 (c) -0.01 (d) 19 c Which is the nearest to -1? (a) 631 (b) 2/7 (c) -11/6 c What is the closest to -230/601 in 0.3, -5, 2/209? 2/209 Which is the nearest to -2969? (a) -0.042 (b) -7 (c) 2/5 (d) 1/6 b What is the closest to -1 in 179, 10, -1/5, 0.553, -3? -1/5 What is the nearest to 20/7 in 76, -0.5, 1/7, -4, 0.4? 0.4 Which is the nearest to -1? (a) -4 (b) 2/21 (c) 308/3 (d) 4.7 (e) -23 (f) -2/15 f What is the closest to -16 in -4, 2, 116, 11, -0.7, -3? -4 What is the nearest to 1 in 1/5, -0.2, -0.1, -0.4, 2/114845? 1/5 What is the nearest to -1 in 4, -0.5, 0.4, 62, 1/39? -0.5 What is the nearest to 3952/5 in 220, -1, -4/3? 220 What is the closest to 135 in -1/2, 4, 504/197, -2/9, 2/11? 4 What is the nearest to 28.35 in -10, 3/5, -34? 3/5 Which is the closest to 201? (a) -4 (b) 0.3 (c) 829.22 b What is the nearest to 1 in 183, 5, 41, -2.3? -2.3 Which is the nearest to -0.1? (a) 21 (b) -1/3 (c) -2.061 b Which is the closest to 3/25? (a) 2 (b) 1/391041 (c) -1/3 b What is the closest to -1 in -0.219, -26, 6, 2, -3? -0.219 Which is the nearest to -0.1? (a) -282 (b) -34.67 (c) 3 (d) 5 c What is the closest to 0.1 in -0.3, -37.1, -0.48, 0.11, 0.3, -1/2? 0.11 What is the nearest to -230 in -2/7, 1067, 2/9, 0, 0.05, -1/24? -2/7 What is the nearest to 0 in -0.4, 134, 21, 0.412? -0.4 What is the closest to 24/5 in -1, 43, 6009, 9, -5? 9 Which is the closest to -3/41? (a) 0.11 (b) -546 (c) 0 c What is the nearest to -61/29 in 3, -2/5, 1/3, -11/5, -1/5, -8? -11/5 What is the closest to -125 in 997, 0.3, 2/5, 2? 0.3 What is the nearest to -13/3 in 4, -239, 2/1889? 2/1889 Which is the nearest to -57? (a) -3 (b) 145.3 (c) 1/3 (d) 2 a Which is the nearest to -2? (a) -3 (b) -38 (c) 25/11 (d) -0.2 (e) 215 a What is the closest to 0.1 in 0.5, 1.2, -4/17, 7, -2/7, -1/70? -1/70 What is the closest to 0.9 in 5, 3, -0.09, 1, -1/21, 221/4? 1 What is the closest to 22035 in 63/13, 2, 2/5? 63/13 Which is the closest to -0.0152? (a) -6 (b) 1/2 (c) 5 (d) -2/21 (e) -0.2 d Which is the nearest to -3/8? (a) 0.18 (b) 0.32 (c) -0.1 (d) -1/22 (e) -2 (f) 1 c Which is the closest to -0.2? (a) -71 (b) 0.2 (c) 2.4 (d) -19 b Which is the nearest to 1/110? (a) -66 (b) 0.02 (c) 0.09 (d) -4 b Which is the nearest to 3/22? (a) 3/8 (b) 6 (c) 0.2 (d) 2/137 (e) -1/6 c Which is the closest to 4? (a) 3 (b) -8/1477 (c) 2.1 a What is the nearest to 2 in 1655, -0.09, -14, 0.2, -1/4? 0.2 Which is the nearest to 1? (a) 0.3 (b) -1/2 (c) -1/4 (d) -5 (e) -3.7 (f) -322 a Which is the closest to -2/85? (a) -44 (b) -1/2 (c) 38 (d) -6 b What is the closest to 11.147 in 8, 9, 2/3? 9 Which is the nearest to -5? (a) 1/9 (b) -0.1 (c) 0.05 (d) 1486 (e) 33 (f) 0.2 b Which is the closest to 1/4? (a) -0.16 (b) 1/3 (c) -5.69 (d) 1.1 b Which is the closest to 2? (a) 1/7 (b) 0.1 (c) 5 (d) 1136 (e) 13/9 e Which is the closest to -2/3? (a) -11/3 (b) -4235 (c) 23 a Which is the nearest to 0.1? (a) 3.9 (b) -4 (c) 6.86 (d) -1 d What is the closest to -2/13 in 0.2, -454/33, -5/16, -4? -5/16 Which is the nearest to -1? (a) 0 (b) -0.22 (c) 3 (d) 10 (e) -0.03 (f) -4/35 b Which is the nearest to -0.009? (a) 0 (b) -5 (c) -371760 a What is the closest to 0.1 in -6, 132, 30, -149? -6 What is the closest to 0.14 in -2, -0.3, -0.006, -3/4, 17? -0.006 Which is the closest to 0.05? (a) 11 (b) -1.47 (c) -1 (d) -2/3 (e) 2/19 (f) -1.7 e Which is the nearest to 3/3446? (a) 0.3 (b) 3 (c) 0.08 (d) -2/7 (e) 5 c What is the closest to 0 in 0.3, -0.5, -28547, 3, -51? 0.3 Which is the nearest to 1.37? (a) -0.4 (b) 979 (c) -1.5 a Which is the nearest to -13? (a) 1 (b) 1/2 (c) -0.3 (d) -26/9 (e) 94 d What is the nearest to 0.1 in -1, 4, -3.724? -1 What is the nearest to 2/5 in -3/4, -77.943, -1, -28? -3/4 What is the closest to -1/3 in -1/6, 194, 5, -0.6, 29/6? -1/6 Which is the nearest to 0.5? (a) -39/40 (b) -5 (c) 0.3 (d) -1/2 (e) -1/7 (f) 126 c Which is the nearest to 0.088? (a) 0.7 (b) -17 (c) 3/2 (d) 0.1 (e) 4 (f) -3/2 d Which is the nearest to 38? (a) -0.3 (b) -0.4 (c) 543.1 (d) 0 (e) -0.16 d What is the closest to -0.4 in -1/6, 1229/3, 0.03, 19, 0.4? -1/6 What is the closest to -18 in -1/4, 0.4, 1/323, -2/21, 0.02? -1/4 What is the closest to 2/7 in 2/145, -29, -0.1, -3? 2/145 What is the nearest to 0.06 in -1/12, 0.09, -0.9, -1/2, -5? 0.09 What is the closest to 0.07 in -2/7, 0.099, 2100, -1/5? 0.099 Which is the closest to -22? (a) -0.3 (b) 0.8 (c) -33/7 (d) -2/21 (e) -48.7 c What is the nearest to 1 in -0.08, -6/11, -1/85, 56? -1/85 Which is the closest to 1.6? (a) 5 (b) -5270 (c) -71 a What is the closest to 3180 in -0.5, -22, 16, 1/6, -3? 16 Which is the closest to -1? (a) -62 (b) 0.3 (c) 263/69 (d) 1/11 (e) 0 e Which is the closest to -412? (a) -1/2 (b) 7 (c) -4 (d) -1/3 (e) -1/8 (f) 0.03 c What is the closest to -0.1 in -2, -239/3, -5/4, 5, -125? -5/4 Which is the closest to 0.2? (a) -3 (b) 31 (c) 6840 (d) 3 (e) -2/3 e Which is the closest to 4? (a) -4 (b) 0.60796 (c) 0.4 (d) -1.5 b Which is the nearest to 23? (a) 0.07 (b) 5301 (c) -3 (d) -2/5 (e) 3 e What is the nearest to 3170 in 12, 10, 1/5, 0.25, 4? 12 Which is the closest to -15? (a) 1/13 (b) 3 (c) 11.7 (d) 1 a Which is the closest to -1? (a) -7.099 (b) 0.1 (c) 2/65 c What is the closest to 12/5 in 5, -1, 3/1399, 0.5? 0.5 What is the closest to 0.012526 in 0, 8, -3/5, -4? 0 Which is the nearest to 2?	{ "pile_set_name": "DM Mathematics" }
e prob of sequence vn. 1/8 What is prob of sequence nob when three letters picked without replacement from bnrnrlnbnbonrlln? 3/560 Three letters picked without replacement from {v: 6, g: 6, s: 2, q: 2, f: 1}. Give prob of sequence vfg. 3/340 What is prob of sequence ts when two letters picked without replacement from {t: 2, s: 1, v: 1}? 1/6 What is prob of sequence ezu when three letters picked without replacement from {d: 1, e: 5, u: 1, r: 5, z: 1, l: 1}? 5/2184 Four letters picked without replacement from jdhxz. What is prob of sequence hxjd? 1/120 What is prob of sequence sd when two letters picked without replacement from msmvsdmmmdsdmsdmvo? 8/153 What is prob of sequence jcat when four letters picked without replacement from {a: 2, k: 1, t: 2, c: 1, j: 2}? 1/210 Calculate prob of sequence qwq when three letters picked without replacement from {q: 4, w: 7}. 14/165 Calculate prob of sequence av when two letters picked without replacement from vavvavaaaaa. 14/55 Two letters picked without replacement from dpvvp. What is prob of sequence pp? 1/10 Three letters picked without replacement from {w: 1, p: 2, c: 1, k: 2, t: 1, n: 1}. Give prob of sequence pnk. 1/84 Two letters picked without replacement from {y: 3, k: 6, e: 1, h: 2, m: 3}. Give prob of sequence kk. 1/7 Two letters picked without replacement from {y: 6, d: 2, z: 1, j: 3, q: 4}. Give prob of sequence dq. 1/30 What is prob of sequence add when three letters picked without replacement from {a: 4, x: 3, d: 13}? 26/285 Two letters picked without replacement from {n: 6, w: 4, k: 5, o: 1}. Give prob of sequence ow. 1/60 Two letters picked without replacement from {c: 1, d: 2, s: 2, e: 1, a: 1}. Give prob of sequence sa. 1/21 Calculate prob of sequence npn when three letters picked without replacement from {l: 1, p: 4, d: 2, n: 1}. 0 Calculate prob of sequence lu when two letters picked without replacement from yzulyuy. 1/21 Calculate prob of sequence alm when three letters picked without replacement from {l: 2, m: 4, a: 1, h: 6, k: 3}. 1/420 What is prob of sequence xc when two letters picked without replacement from ccccccccxcxccccxccxc? 16/95 Four letters picked without replacement from {n: 2, v: 5, r: 4}. What is prob of sequence vrrn? 1/66 Calculate prob of sequence jj when two letters picked without replacement from cvvvvvlvvvlljvvj. 1/120 What is prob of sequence szz when three letters picked without replacement from {g: 8, s: 8, z: 4}? 4/285 What is prob of sequence kini when four letters picked without replacement from {n: 5, i: 3, k: 2}? 1/84 What is prob of sequence nvv when three letters picked without replacement from {v: 2, a: 1, n: 5, z: 1}? 5/252 Four letters picked without replacement from {r: 5, u: 5, o: 5, m: 5}. What is prob of sequence rmuu? 25/5814 Calculate prob of sequence wqu when three letters picked without replacement from qwfqqqhhuwuhhqqhh. 1/170 Three letters picked without replacement from {a: 5, q: 2}. What is prob of sequence aqq? 1/21 Three letters picked without replacement from bininbiibniii. Give prob of sequence nbn. 3/286 Three letters picked without replacement from {q: 4, f: 2, h: 4, y: 2}. What is prob of sequence yfq? 2/165 Four letters picked without replacement from iiiiiiiiii. Give prob of sequence iiii. 1 Three letters picked without replacement from hhpphpwhhhwwhwipwp. What is prob of sequence www? 5/408 Three letters picked without replacement from yzyr. What is prob of sequence yry? 1/12 What is prob of sequence rr when two letters picked without replacement from {c: 5, r: 5}? 2/9 Three letters picked without replacement from obaoboabb. What is prob of sequence boo? 1/21 What is prob of sequence qu when two letters picked without replacement from ufusqff? 1/21 What is prob of sequence ch when two letters picked without replacement from dhhdppddddcdpppvo? 1/136 Three letters picked without replacement from {b: 3, n: 1, r: 2, f: 4}. Give prob of sequence bnb. 1/120 Calculate prob of sequence pw when two letters picked without replacement from mmmmvvvmmpmvmmpwpw. 1/51 Four letters picked without replacement from {e: 5, h: 13}. What is prob of sequence hehh? 143/1224 Calculate prob of sequence dv when two letters picked without replacement from dzaadzdazv. 1/30 Two letters picked without replacement from oxfkllgk. Give prob of sequence og. 1/56 What is prob of sequence llc when three letters picked without replacement from {l: 2, c: 4}? 1/15 Three letters picked without replacement from fuauufuuuuufaauauuf. What is prob of sequence afa? 8/969 Calculate prob of sequence ttcy when four letters picked without replacement from {c: 5, y: 2, t: 4}. 1/66 Calculate prob of sequence hjh when three letters picked without replacement from jhhhhhhhjhhhhjhhhhhh. 34/285 Calculate prob of sequence gtl when three letters picked without replacement from wrltg. 1/60 Three letters picked without replacement from {n: 2, s: 2, q: 2}. What is prob of sequence qns? 1/15 Three letters picked without replacement from kaf. Give prob of sequence kfa. 1/6 Calculate prob of sequence pqp when three letters picked without replacement from {q: 6, s: 3, p: 3, z: 2, y: 3}. 3/340 Two letters picked without replacement from msstlmsys. Give prob of sequence mt. 1/36 What is prob of sequence dds when three letters picked without replacement from {q: 2, w: 2, s: 12, p: 1, d: 3}? 1/95 Four letters picked without replacement from {m: 5, b: 1, o: 1, e: 3, n: 4}. Give prob of sequence menm. 10/1001 Three letters picked without replacement from {y: 2, c: 9}. Give prob of sequence yyc. 1/55 Two letters picked without replacement from imftoipppfi. What is prob of sequence po? 3/110 Calculate prob of sequence iw when two letters picked without replacement from {w: 1, b: 2, i: 1}. 1/12 What is prob of sequence cih when three letters picked without replacement from iihiciciiiiicciicic? 4/323 Three letters picked without replacement from oxeelouuloeuxxeuxux. Give prob of sequence elo. 4/969 Two letters picked without replacement from {h: 1, u: 1, p: 1}. Give prob of sequence pp. 0 Two letters picked without replacement from avgaaffgavgcgavfaag. Give prob of sequence fv. 1/38 Calculate prob of sequence uu when two letters picked without replacement from {g: 1, u: 2, h: 1, s: 2, y: 1, e: 2}. 1/36 What is prob of sequence zo when two letters picked without replacement from {z: 2, o: 4, t: 2, f: 2, d: 4}? 4/91 Calculate prob of sequence rw when two letters picked without replacement from trmmrmtrwtrbrtmt. 1/48 Four letters picked without replacement from {o: 5, k: 5}. Give prob of sequence kkkk. 1/42 Calculate prob of sequence jjuu when four letters picked without replacement from {u: 2, j: 9, a: 5}. 3/910 Calculate prob of sequence nbbn when four letters picked without replacement from nnbnnnnbnnn. 1/55 Three letters picked without replacement from {s: 5, o: 7, b: 1}. What is prob of sequence osb? 35/1716 What is prob of sequence xa when two letters picked without replacement from {x: 1, e: 1, d: 1, w: 1, h: 2, a: 1}? 1/42 Three letters picked without replacement from bwirbxwrwbwjrwxbrbxr. What is prob of sequence iww? 1/342 Calculate prob of sequence wyyt when four letters picked without replacement from {t: 5, y: 2, w: 12}. 5/3876 Three letters picked without replacement from {m: 3, u: 5, w: 1, l: 1, k: 5}. What is prob of sequence uwk? 5/546 Three letters picked without replacement from qdlqqllddql. Give prob of sequence lql. 8/165 Four letters picked without replacement from ilblllbli. Give prob of sequence liil. 5/378 Four letters picked without replacement from yfiiwibuiifbiuuifi. What is prob of sequence fiuy? 1/1020 Four letters picked without replacement from nfffffnffn. Give prob of sequence nffn. 1/20 Two letters picked without replacement from {w: 2, n: 1}. Give prob of sequence wn. 1/3 Three letters picked without replacement from eeaeala. What is prob of sequence laa? 1/35 What is prob of sequence ndo when three letters picked without replacement from {o: 1, z: 5, s: 1, d: 7, n: 1}? 1/390 What is prob of sequence cwc when three letters picked without replacement from mwccwmmwww? 1/72 Two letters picked without replacement from {y: 9}. Give prob of sequence yy. 1 What is prob of	{ "pile_set_name": "DM Mathematics" }
8. Determine o(-760). 12 Let m(g) = 2g3 - 36g*2 + 106g - 653. Calculate m(16). 19 Let h(s) = 17s3 - 13s*2 - 1528s + 4633. Calculate h(3). 391 Let v(t) = -t*3 + 23t*2 + 10t - 251. Calculate v(19). 1383 Let q(g) = 281992g - 2255947. Calculate q(8). -11 Let y(r) = -58r*3 + 25r*2 + 572r - 595. Determine y(1). -56 Let t(f) = -f*3 + 38f*2 + 16281f + 131. What is t(-110)? 21 Let d(s) = -87s - 9392. Calculate d(-110). 178 Let b(t) = -23t*2 - 1270t + 2338. Calculate b(-57). 1 Let k(u) = 1141u - 710794. What is k(623)? 49 Let p(o) = o3 + 23o*2 + 89o + 187. Determine p(-6). 265 Let d(n) = n*2 + 6539n + 149822. Give d(-23). -46 Let i(s) = -711376s + 2134114. Determine i(3). -14 Let w(b) = 51676b + 878403. Give w(-17). -89 Let i(v) = 5085v + 193236. Give i(-38). 6 Let o(s) = -4s*2 - 1923s + 102005. What is o(-529)? -92 Let v(h) = 2h2 + 145h - 560. Determine v(-76). -28 Let f(b) = -5b2 + 481b + 3654. What is f(-7)? 42 Let i(w) = -2w2 + 4339w - 482225. Give i(2052). -5 Let y(z) = 3z3 - 88z*2 + 205z - 437. Calculate y(27). -5 Let s(w) = -1196w - 89453. Calculate s(-75). 247 Let a(x) = -4x*3 + 532x*2 - 3527x - 34. Give a(126). 92 Let f(s) = -12s3 + 7s*2 + 42s - 124. Determine f(3). -259 Let d(n) = n*2 + 351n + 25804. What is d(-105)? -26 Let m(w) = w*2 + 458w - 52027. Give m(95). 508 Let x(w) = 656w - 207865. What is x(317)? 87 Let x(a) = -71a*2 - 263a + 486. What is x(-5)? 26 Let b(y) = -2y2 + 73y + 98. What is b(33)? 329 Let y(s) = -6029s - 204694. What is y(-34)? 292 Let w(h) = 25h*2 + 378h + 78. What is w(-17)? 877 Let c(w) = w*3 - 36w*2 + 215w + 564. What is c(-2)? -18 Let w(b) = -164b2 + 37708b + 2755. What is w(230)? -5 Let r(t) = t*2 - 155t + 1478. What is r(10)? 28 Let a(c) = 877c2 - 143827c - 159. Calculate a(164). 5 Let r(j) = -63j2 - 866j + 242. Determine r(-11). 2145 Let u(a) = 3a3 - 57a*2 + 60a - 82. Give u(18). 26 Let m(g) = 252g - 2952. Determine m(12). 72 Let i(y) = -1573y + 8438. Give i(6). -1000 Let h(c) = -3c2 - 57c + 177. What is h(3)? -21 Let h(u) = -5u2 + 4u + 391. What is h(19)? -1338 Let q(s) = -23s2 + 30103s - 298732. Determine q(10). -2 Let c(w) = -w*3 - 43w*2 - 302w + 327. Give c(-32). -1273 Let o(u) = -27u3 + 272u*2 + 3u - 254. Calculate o(10). -24 Let t(h) = 232h2 + 706h - 34. Give t(-3). -64 Let f(d) = d*3 + 9d*2 + 7d - 24. Calculate f(-6). 42 Let q(n) = -60021n + 59872. Calculate q(1). -149 Let o(m) = -16748m + 1909328. Calculate o(114). 56 Let v(w) = 83012w - 83010. Give v(1). 2 Let c(k) = 2989k + 95667. Determine c(-32). 19 Let k(c) = 129c2 + 860c + 54. Determine k(-7). 355 Let y(b) = b*3 + 111b*2 + 360b + 66220. What is y(-113)? 2 Let v(o) = 4o2 - 5529o - 3334626. Give v(-454). 4 Let l(k) = k3 - k2 + 51k + 990. Determine l(-8). 6 Let u(y) = -3y*2 + 4322y - 8. What is u(0)? -8 Let r(q) = -q*3 + 4q*2 - 293q + 901. Determine r(3). 31 Let w(k) = k*2 + 884k - 6256. Give w(7). -19 Let b(r) = -44r + 87. Calculate b(-24). 1143 Let x(r) = 11282r - 191600. What is x(17)? 194 Let x(p) = p*2 + 29p - 625. Calculate x(19). 287 Let q(t) = 14t2 + 276t + 518. Determine q(-20). 598 Let r(t) = 7t3 - 408t*2 + 119t - 206. Determine r(58). -32 Let n(a) = -37a3 - 182a*2 - 66a - 296. Determine n(-5). 109 Let u(g) = -1279g - 750728. Calculate u(-587). 45 Let f(j) = -j3 - j2 - 15j + 287. Give f(0). 287 Let q(z) = -4610z - 442565. What is q(-96)? -5 Let y(c) = c3 - 832c*2 + 162031c - 53. Give y(311). -53 Let v(y) = -y*2 + 11212y + 676316. Determine v(-60). -4 Let g(s) = 2s2 - 673s + 24233. What is g(41)? 2 Let d(t) = -15127t + 831823. Calculate d(55). -162 Let d(r) = -70r - 4958. Calculate d(-64). -478 Let b(r) = 3595440r - 10786323. Calculate b(3). -3 Let z(u) = -416u + 19845. Give z(56). -3451 Let v(u) = u*3 - 196u*2 + 9353u - 97. Calculate v(82). 313 Let n(v) = -309v + 7452. What is n(22)? 654 Let r(u) = 468443u - 2810657. What is r(6)? 1 Let o(r) = 197436r + 7502538. Give o(-38). -30 Let i(a) = -55283a + 1326814. Give i(24). 22 Let p(y) = 460y - 9230. What is p(17)? -1410 Let i(y) = 3y*3 + 421y*2 - 266y + 2235. Calculate i(-141). -21 Let s(l) = -223l2 + 23186l - 32. What is s(104)? -656 Let t(k) = k*2 + 25107k - 1145. Determine t(0). -1145 Let k(o) = o*2 - 69o - 11997. Give k(149). -77 Let z(r) = -1436r + 4328. Give z(3). 20 Let d(i) = -20252i - 202693. What is d(-10)? -173 Let h(o) = -12o2 + 61o - 120. What is h(2)? -46 Let a(g) = 8g2 - 588g - 1163. Give a(-2). 45 Let i(p) = -634p2 - 21311p + 8332. Determine i(-34). 2 Let s(f) = -7f3 - 16f*2 - 82f - 109. Give s(-2). 47 Let b(x) = -x*3 + 2x*2 + 4095x - 28648. Calculate b(7). -228 Let g(y) = 8y3 - 442y*2 - 882y + 30. What is g(-2)? -38 Let t(w) = -60w + 7289. Determine t(123). -91 Let j(w) = w2 - 134w + 4350. Calculate j(51). 117 Let d(c) = -22c2 + 12c - 535. Determine d(0). -535 Let k(o) = -8o2 + 41o + 892. Calculate k(-14). -1250 Let o(m) = m*3 + 1052m*2 + 6224m - 54391. What is o(-1046)? 1 Let o(t) = 4t3 + 56t2 - 1085. Determine o(-12). 67 Let a(d) = d2 + 762903d - 4577471. Calculate a(6). -17 Let c(t) = -6t*2 + 164t - 154. Calculate c(29). -444 Let n(r) = 16477r - 164763. What is n(10)? 7 Let w(f) = f3 - 10f*2 - 1528f + 1645. Calculate w(-35). 0 Let c(d) = -2196d - 647810. Calculate c(-295). 10 Let p(d) = -3d*2 + 609d - 8502. What is p(15)? -42 Let q(l) = -13l3 + 24l*2 + 112l + 328. Determine q(-3). 559 Let i(q) = -q*3 + 144q*2 + 1537q + 106647. What is i(158)? -3 Let i(j) = 482j2 + 31904j + 6077. Give i(-66). 5 Let j(q) = q*3 - 10q*2 - 39q + 177. Determine j(12). -3 Let z(f) = -3f3 + 15f*2 - 287f + 1687. Give z(6). -143 Let d(u) = -10374u + 32673. Give d(3). 1551 Let j(z) = 12z*3 - 168z*2 - 13937z + 195129. Give j(14). 11 Let o(k) = 38792k + 814666. Calculate o(-21). 34 Let l(u) = u3 - 65u*2 + 1095u + 49. Give l(29). 1528 Let c(r) = -632r2 - 2975r + 27. What is c(-5)? -898 Let q(m) = 36m2 + 319m + 894. Calculate q(-5). 199 Let x(t) = -869t + 52251. Give x(60). 111 Let b(u) = u2 + 370364u - 1111098. Calculate b(3). 3 Let k(j) = 3631j - 3733. Determine k(1). -102 Let i(w) = 32w*2 + 56236w + 413004. Give i(-1750). 4 Let a(d) = -d*2 - 125d - 3331. Calculate a(-59). 563 Let n(r) = 4278r - 55841. What is n(13)? -227 Let m(o) = -10709o - 149918. What is m(-14)? 8 Let n(u) = -2u2 - 245u + 78. Calculate n(-121). 441 Let q(f) = -981f + 12882. Give q(13). 129 Let o(w) = 524w + 123677. Calculate o(-236). 13 Let x(g) = 1931g + 13467. What is x(-7)? -50 Let g(r) = 2r*2 + 1371r + 21587. Determine g(-16). 163 Let j(d) = -d*3 + 174d*2 - 1269d + 16695. Calculate j(167). -5 Let z(u) = -492u2 - 19687u - 281. Calculate z(-40). -1 Let z(o) = -11o2 - 4155o - 3054. What is z(-377)? -38 Let g(u) = -u*3 - 150u*2 - 209u - 8572. Determine g(-149). 368 Let z(k) = k*2 + 383k + 22616. Calculate z(-73). -14 Let r(k) = -174k - 15547. Determine r(-88). -235 Let n(v) = -147147v - 1618613. Determine n(-11). 4 Let j(m) = 19m2 - 12621m - 9153. What is j(665)? 157 Let m(l) = -4l2 - 58l - 216. Give m(-13). -138 Let n(b) = 2409b - 585395. What is n(243)? -8 Let l(w) = -63457w - 634571. What is l(-10)? -1 Let m(d) = 481d + 5908. Give m(-15). -1307 Let z(a) = 44460a*2 + 222260a + 6. Give z(-5). 206 Let p(l) = 8l2 - 74l + 85. Calculate p(10). 145 Let y(i) = -167i2 + 17860i + 963. Determine y(107). 0 Let p(i) = 26i2 + 287i + 1112. Determine p(-5). 327 Let p(o) = -3553o - 64939. What is p(-19)? 2568 Let p(r) = -r3 + r2 + 7481r - 29903. Give p(4). -27 Let s(d) = -2721d + 21566. Determine s(8). -202 Let q(y) = 7114y - 320136. Give q(45). -6 Let i(w) = -2w3 + 23w*2 + 450w + 291. What is i(22)? 27 Let h(f) = 8816f + 141648. What is h(-16)? 592 Let f(h) = h3 + 24h*2 - 643h - 16185. Give f(-28). -1317 Let x(s) = 3s2 - 267s - 1120. Determine x(-4). -4 Let w(i) = -i*3 - 20i*2 + 2398i + 47976. Calculate w(-20). 16 Let u(z) = 25z3 - 114z*2 + 95z. Determine u(3). -66 Let i(b) = 3b3 - 15b*2 - 12	{ "pile_set_name": "DM Mathematics" }
+ b. Calculate the common denominator of -9/4 and j. 12 Suppose 0 = 33o - 42o + 54. Calculate the smallest common multiple of o and 6. 6 Let v = -14126 + 29071/2. Let y = v - 2393/6. Find the common denominator of y and -1 - (3 + (-60)/16). 12 Let c be (-13 - -10)(2 - (-13)/(-3)). What is the common denominator of 203/(-6) + (-2)/3 and ((-19)/c)/((-10)/7)? 10 Let t = -39 - -30. Let z(q) = -q + 14. Let i be z(-6). Let m = i + t. Calculate the least common multiple of 7 and m. 77 Suppose 0 = -3u - 12. What is the common denominator of 71/36/u and (-1 - -2) + (-33)/(-36)? 12 Let m = -2444/3 - -829. Let x = -87183/20 - -4358. Find the common denominator of m and x. 60 Let b be (-36)/(-42)(-28)/(-3). Let n = -21597/8890 - -1/1270. What is the common denominator of b/8 + 178/12 and n? 42 Let x = 4145/7 + -598. Let o be -33/(-9) + 1830873/(-294630). Let u = o - 1/7015. Calculate the common denominator of x and u. 14 Suppose -11z + 8z - 5v = -29, -4 = -4z + 2v. What is the least common multiple of 3 and z? 3 Suppose 7n - 434 = -0n. Let v = n - 46. Calculate the smallest common multiple of v and 16. 16 Suppose 2 = 5m - 3. Calculate the lowest common multiple of -4m88/(-16) and 10. 110 Let n be 2(1 + 4/((-32)/(-220))). Calculate the common denominator of 3 - 1 - n(-4)/42 and -85/8. 56 Let c = 109793/41832 - -2/5229. Let a = 6942 + -458059/66. Find the common denominator of a and c. 264 Let i = -737/11680 + -107/365. Find the common denominator of 143/96 and i. 480 Let d = 9235/4404 - 5/367. What is the common denominator of d and 738/27(0 - (-15)/(-50))? 60 Let d = 434 + -422. What is the lowest common multiple of 42 and d? 84 Let p(k) = 20k - 115. Let x be p(28). What is the common denominator of ((-198)/(-4) - 1) + 1 and 12/(-8) + -4 + x/40? 8 Suppose 0 = 2m + 3 + 3. What is the common denominator of 2/m + 4965/630 and 119/18? 126 Suppose -3y + 4d - 1 = 0, -2y = -4y + d - 9. Let v = 18787/1761 + -1/587. Find the common denominator of (-6)/21 - (-48)/y and v. 21 Suppose -30t + 26t = 3u - 57, 4t - 5u - 33 = 0. Calculate the smallest common multiple of 16 and t. 48 Let c(u) = 13u*2 + 2u + 6. Let f be c(3). What is the common denominator of ((f/(-4))/3)/(5/4) and 32? 5 Let d(p) = -p*3 - 8p*2 + 18p - 14. Suppose -4a = 29 + 11. What is the lowest common multiple of d(a) and (7 + 0)20/14? 30 Let w be -1142(-1 + 44/48). Let u = 53/24 - w. Find the common denominator of u and -62/5. 40 Let z = -43 + 1. Let a = z + 391/8. Find the common denominator of a and -51/11. 88 Let v(m) = m. Let n be ((-1)/(-2) + -1)/((-2)/24). What is the smallest common multiple of v(5) and 0/(3 + -5) + (n - 3)? 15 Let b(i) = 5i2 - 2i + 5. Let s be b(2). Let w(c) = 9c. Calculate the lowest common multiple of 3/s - 42/(-49) and w(1). 9 Let h be (3/6)/(3/48). Suppose -3i + 1 = -h. Suppose ik = 2 + 10. What is the least common multiple of 40 and k? 40 Let m = -3 + 12. Let s = -4 + m. Suppose -u + 17 = p - s, 5u - 4p - 92 = 0. What is the smallest common multiple of u and 16? 80 Let j = -457/5 - -25617/280. What is the common denominator of j and ((-2236)/16)/13 - (-5)/(-1)? 56 Suppose -3m - 23323 = 13313. Let u = -2967 + m. Let n = 303473/20 + u. What is the common denominator of n and 109/22? 220 Let i be (-4)/18 + (-625731)/(-54216). Let r = -14/251 - i. Let a = -7379/8740 - 5/874. What is the common denominator of r and a? 40 Let u = -5038/9 + 561. What is the common denominator of -58/45 and u? 45 Suppose 4b - 25 = 5d, 3b + 10 = 4d + 28. Let n(i) = i*3 - 5i*2 + 3i + 7. What is the lowest common multiple of n(5) and b? 110 Let h = 173 - 370. Let j = h - -1963/10. What is the common denominator of j and ((-3)/15)/(2/495)? 10 Find the common denominator of -113(-7 + 836/840 - -6) and -97/14. 210 Suppose 3h = 6h - 4b - 160, 3b = 5h - 285. Calculate the smallest common multiple of h and 80. 240 Suppose -6a + 16 = -2a. What is the common denominator of (-66)/12 - -5 - 42/10 and (7/84)/(a/(-486))? 40 Let r = 681 + -329. Calculate the common denominator of (-1 - -1) + 0 - 448/r and -30/7. 77 Let k(w) = w*2 + 9w + 5. Let h be k(0). Find the common denominator of 17/24 and (h/40)/((-15)/650). 24 Suppose 2g - 3n = -0g + 135, 0 = -g + 5n + 57. Calculate the smallest common multiple of g and 48. 144 Let b be 292/(-8)-12. Let m = b - 51. Suppose 3f - 1 = 5. What is the lowest common multiple of m and f? 22 Let v(s) = -s3 + 8s*2 - 4s - 8. Let n be v(7). Let c be (n/(-5) + 3)9910. Let k = 55471/14 - c. What is the common denominator of k and -59/4? 28 Let r = -88 + 98. Suppose m - 73 = -3x + x, -2x - 341 = -5m. Calculate the smallest common multiple of r and m. 690 Let w(b) = -b*3 - 13b*2 - 13b + 10. Let t be w(-12). Let d = t + -18. Let g = d - 1. Calculate the smallest common multiple of g and 5. 15 Let k = -18 + 20. Suppose 0 = -r + kr - 12. Calculate the smallest common multiple of r and 20. 60 What is the common denominator of -53/95 and -18(18 + -10)/800? 950 Suppose 6o - 79 - 41 = 0. Calculate the common denominator of -85/6 and (-10)/21(-255)/o. 42 Let r = 11 + -8. Suppose -30 = -8i + ri. Let d(l) = -l + 7. What is the least common multiple of d(i) and 4? 4 Let i = 5268 - 263291/50. Find the common denominator of -47/25 and i. 50 What is the smallest common multiple of 10 and (-15)/(-15) - (-226 + 1)? 1130 Let k(b) = b*2 + 4b - 2. Let c be k(-4). Let p = 10 + c. Let l = p - 6. What is the lowest common multiple of 8 and l? 8 Suppose 0 = -5n + 115 + 20. Suppose -3g = 2m - 13 - 0, 3m + 5 = -g. Calculate the least common multiple of g and n. 189 Let u(l) = -l*3 - 2l*2 - 5l - 2. Let j = 30 - 25. Suppose 3w - 41 = 2k - 3k, -jw - k = -65. What is the smallest common multiple of u(-3) and w? 132 Let s be 4/6 - (6 + (-208)/12). Calculate the common denominator of (-60)/56 - s/28 and -13/6. 6 Let s = -4858 + 97239/20. Find the common denominator of -109/10 and s. 20 Let q = -467/8 + 59. Suppose -4 = -2f + f - 4k, -k = -3f - 14. What is the common denominator of q and (-152)/(-384)6/f? 32 Suppose 1637 = 11o + 1571. Calculate the lowest common multiple of 302 and o. 906 Suppose 0 = 4q - 8, 41 + 43 = c + 2q. Suppose -z - c = -6z. Let d = 25 - z. Calculate the least common multiple of 8 and d. 72 Suppose -2j = 4n + 3j - 42, 0 = -4n - 4j + 40. Let k be 1-12(-4)/n. Calculate the least common multiple of 9 and k/(-8)(-12)/1. 9 Find the common denominator of (62/(-40))/(9/(-36)-12) and -9/40. 120 Let q = -6703/40 + 866/5. Calculate the common denominator of 43/55 and q. 440 Suppose 919 = 27x - 4994. What is the lowest common multiple of x and 15? 1095 Suppose -208 = -v + 4m, -2v - 3m + 120 + 252 = 0. What is the least common multiple of v and 15? 960 Suppose -x + 7 + 11 = 0. Calculate the common denominator of x/30 - 754/(-60) and 19/10. 30 Let m = 19 + -10. Let d = 21 - -6. Suppose -2 = 5h - d. What is the least common multiple of h and m? 45 Calculate the common denominator of -19/12 and (-3)/696/54. 36 Let k be 416/7118439018/(-16). Let w = -2/1483 - k. Calculate the common denominator of w and 7/4. 4 Calculate the least common multiple of 252 and (360/(-56))/(21/(-98)). 1260 Let a = -9 + 12. Suppose g - 20 = -5i + 4, -ai = g - 16. Suppose -3t = -iy + 35, y - 7 - 5 = 4t. Calculate the smallest common multiple of 4 and y. 8 Suppose 0 = -415i + 412i + 54. What is the lowest common multiple of 9 and i? 18 Calculate the smallest common multiple of 2/(-9) - ((-25740)/(-162))/(-13) and 15/2 - 3/(-6). 24 Calculate the common denominator of 522/(-33) - 2 and (147/(-30) - -1) + 3. 30 Find the common denominator of -113/28 and (7/((-196)/(-228)))/(1 + 0). 28 Let m(w) = -6w + 17. Let u be (0 - 8)/((-3)/(-3)). Let p be m(u). Calculate the smallest common multiple of 4 and 18/5 + 26/p. 4 Let j(h) = h2 - 1. Let b be -41/2-40. Let d = b - 64. What is the smallest common multiple of j(-3) and d? 16 Let m = 76 - 64. What is the lowest common multiple of 4 and m? 12 Let y = 29 - 7. Suppose -5n = -10n + 10. Calculate the lowest common multiple of 2108/y - 10/(-55) and n. 96 Suppose -30 = 5l - 10l. Suppose w - w = 3w. Let y = w + l. What is the lowest common multiple of	{ "pile_set_name": "DM Mathematics" }
eplacement from {z: 1, w: 2, c: 8, t: 5, u: 2}. What is prob of sequence zcwc? 7/4590 What is prob of sequence oqku when four letters picked without replacement from okguqhu? 1/420 Calculate prob of sequence bpy when three letters picked without replacement from {r: 1, p: 5, h: 1, b: 1, y: 2}. 1/72 Calculate prob of sequence vv when two letters picked without replacement from {w: 3, v: 12}. 22/35 Four letters picked without replacement from zppfiffifffppffz. What is prob of sequence ifpi? 2/1365 Two letters picked without replacement from uugug. What is prob of sequence ug? 3/10 Calculate prob of sequence bbba when four letters picked without replacement from {a: 2, x: 3, b: 5, o: 4, t: 5}. 5/3876 What is prob of sequence lv when two letters picked without replacement from {l: 9, v: 3}? 9/44 Calculate prob of sequence ty when two letters picked without replacement from ytttytyyyyytyyyyty. 4/17 Three letters picked without replacement from yyywycccyw. Give prob of sequence ycc. 1/24 What is prob of sequence fssg when four letters picked without replacement from {m: 1, s: 2, f: 1, g: 1}? 1/60 Calculate prob of sequence omo when three letters picked without replacement from {o: 6, m: 4, i: 3}. 10/143 Calculate prob of sequence mvmk when four letters picked without replacement from {m: 3, v: 1, k: 4, d: 6}. 1/1001 Three letters picked without replacement from {j: 7, c: 7, d: 2}. What is prob of sequence dcj? 7/240 What is prob of sequence at when two letters picked without replacement from mxxaxxtxi? 1/72 Calculate prob of sequence rjc when three letters picked without replacement from {c: 3, r: 2, j: 1, p: 1}. 1/35 Four letters picked without replacement from {n: 2, h: 1, c: 1, o: 1}. What is prob of sequence nhcn? 1/60 Calculate prob of sequence ddv when three letters picked without replacement from vddvddddvdddddvddvv. 52/323 Calculate prob of sequence tt when two letters picked without replacement from ttttt. 1 Two letters picked without replacement from uvhcmhh. Give prob of sequence mu. 1/42 Two letters picked without replacement from {d: 2, i: 2, l: 2, n: 4, y: 8, w: 1}. Give prob of sequence nl. 4/171 Three letters picked without replacement from {z: 1, a: 1, w: 2, l: 5}. What is prob of sequence lll? 5/42 Calculate prob of sequence yhry when four letters picked without replacement from {d: 4, y: 2, h: 8, r: 5}. 5/5814 Calculate prob of sequence hll when three letters picked without replacement from {z: 9, l: 4, h: 4}. 1/85 Calculate prob of sequence daa when three letters picked without replacement from aoonaooozdoooznzao. 1/816 Calculate prob of sequence uu when two letters picked without replacement from iuhiilihhxu. 1/55 Two letters picked without replacement from {v: 3, e: 1}. Give prob of sequence ev. 1/4 Calculate prob of sequence ga when two letters picked without replacement from {z: 2, a: 1, r: 4, o: 1, g: 2}. 1/45 Calculate prob of sequence bz when two letters picked without replacement from {n: 1, e: 4, b: 3, l: 2, c: 2, z: 2}. 3/91 Four letters picked without replacement from ooounuouhons. Give prob of sequence onon. 1/297 What is prob of sequence pqg when three letters picked without replacement from {q: 1, p: 5, s: 4, g: 4, v: 6}? 1/342 Calculate prob of sequence vpc when three letters picked without replacement from {p: 1, f: 5, v: 11, c: 2}. 11/2907 Calculate prob of sequence ssu when three letters picked without replacement from sussssssususuusuuss. 154/969 Two letters picked without replacement from {v: 1, e: 1, c: 1, d: 1, k: 1}. What is prob of sequence de? 1/20 Calculate prob of sequence lteo when four letters picked without replacement from {l: 1, f: 1, t: 1, e: 2, o: 2}. 1/210 Calculate prob of sequence kbk when three letters picked without replacement from {h: 4, b: 2, w: 1, n: 2, k: 2, s: 6}. 1/1020 What is prob of sequence hs when two letters picked without replacement from {k: 1, h: 3, s: 4}? 3/14 Four letters picked without replacement from {w: 3, t: 5}. What is prob of sequence wwwt? 1/56 Calculate prob of sequence vg when two letters picked without replacement from vvvvlwvvglvvfelvlvl. 5/171 Calculate prob of sequence wpaz when four letters picked without replacement from fpzwa. 1/120 What is prob of sequence uu when two letters picked without replacement from urmmuumrmummrmrmurrr? 1/19 Two letters picked without replacement from {i: 1, h: 1, r: 8, s: 5, z: 2, o: 3}. Give prob of sequence os. 3/76 Calculate prob of sequence grrg when four letters picked without replacement from {r: 4, g: 3}. 3/35 What is prob of sequence xx when two letters picked without replacement from {x: 5, e: 2}? 10/21 What is prob of sequence zz when two letters picked without replacement from zvvz? 1/6 Calculate prob of sequence ggg when three letters picked without replacement from ghssrgghchhghhg. 2/91 Three letters picked without replacement from {z: 2, k: 4, e: 6, o: 6}. What is prob of sequence eee? 5/204 What is prob of sequence yz when two letters picked without replacement from bydzb? 1/20 What is prob of sequence ii when two letters picked without replacement from {i: 8, n: 3}? 28/55 Calculate prob of sequence cll when three letters picked without replacement from {l: 4, c: 3}. 6/35 Calculate prob of sequence jwwi when four letters picked without replacement from {j: 1, k: 2, r: 2, i: 5, m: 1, w: 2}. 1/1716 Calculate prob of sequence uu when two letters picked without replacement from uqu. 1/3 What is prob of sequence gggg when four letters picked without replacement from gppppggpppg? 1/330 Calculate prob of sequence ijxj when four letters picked without replacement from jjjixjjjjjjxjjijjjji. 7/646 Calculate prob of sequence qqs when three letters picked without replacement from {i: 2, q: 3, s: 2, t: 3, h: 1, x: 3}. 1/182 Two letters picked without replacement from {o: 5, b: 1, w: 6, m: 2, j: 2}. Give prob of sequence ob. 1/48 Two letters picked without replacement from lljjjljjljjjlllj. Give prob of sequence jj. 3/10 Calculate prob of sequence ksrf when four letters picked without replacement from memskemmskrmfse. 1/5460 Four letters picked without replacement from {j: 1, o: 5, f: 4, x: 2, s: 2}. What is prob of sequence xosj? 5/6006 Calculate prob of sequence qky when three letters picked without replacement from {r: 5, y: 3, q: 1, j: 2, i: 8, k: 1}. 1/2280 Four letters picked without replacement from nnolllolnn. What is prob of sequence llln? 2/105 Calculate prob of sequence mp when two letters picked without replacement from pmpmmpp. 2/7 Two letters picked without replacement from {r: 3, w: 2, b: 1, y: 10, f: 1, i: 1}. What is prob of sequence br? 1/102 Calculate prob of sequence oy when two letters picked without replacement from oyyoyayaya. 1/9 Two letters picked without replacement from gfxgffrfrgfrggffx. Give prob of sequence xg. 5/136 Calculate prob of sequence inl when three letters picked without replacement from qqiiinqlqii. 1/198 Calculate prob of sequence mf when two letters picked without replacement from ppppggffffffmxbg. 1/40 Four letters picked without replacement from {s: 1, v: 2, d: 1, x: 2, w: 1, l: 2}. Give prob of sequence dsll. 1/1512 What is prob of sequence rl when two letters picked without replacement from {n: 1, o: 1, l: 6, r: 3, c: 2}? 3/26 Calculate prob of sequence it when two letters picked without replacement from {w: 2, i: 1, t: 2, s: 5, d: 6}. 1/120 Calculate prob of sequence gvmb when four letters picked without replacement from xdbmgxmxbbxxv. 1/2860 Three letters picked without replacement from bbbbbb. Give prob of sequence bbb. 1 Calculate prob of sequence tnve when four letters picked without replacement from {v: 3, e: 1, n: 1, t: 1, k: 1}. 1/280 Calculate prob of sequence tb when two letters picked without replacement from {b: 1, s: 1, t: 1, f: 1, q: 4}. 1/56 Four letters picked without replacement from {j: 4, z: 3, g: 4, d: 7}. What is prob of sequence jjjg? 1/765 Calculate prob of sequence ymy when three letters picked without replacement from {m: 4, y: 7}. 28/165 Three letters picked without replacement from vrcavvcpcchhc. Give prob of sequence cpp. 0 Three letters picked without replacement from {x: 2, h: 6, i: 3, m: 1, b: 3}. What is prob of sequence bbi? 3/455 Calculate prob	{ "pile_set_name": "DM Mathematics" }
9 Work out -58425024611 + 4. -58425024607 What is the difference between 3951294064 and 303? 3951293761 What is the difference between -165.504 and 135077? 135242.504 What is -0.90554 minus 2762960.59? -2762961.49554 Put together 28143152512628 and -0.03. 28143152512627.97 Work out 6500688408912 + -0.2. 6500688408911.8 Calculate -0.06 + 210920933043. 210920933042.94 Total of -9847132352 and 0.1082. -9847132351.8918 Add together -0.11 and -296.9612629224. -297.0712629224 Calculate -858130379158.88 + 5. -858130379153.88 Work out -86863600 + -160404. -87024004 -5036918261 - 10.8 -5036918271.8 What is -856189226 take away 0.0512? -856189226.0512 Add -37955.52 and -65199. -103154.52 Put together 4570656925 and -34. 4570656891 Work out -3413.48418 + -20.393. -3433.87718 What is 4 minus 1605.50333912814? -1601.50333912814 What is 408011789919815 + -0.3? 408011789919814.7 Put together -2273996027704 and 0.044. -2273996027703.956 Subtract 142129.288 from 88381. -53748.288 -1427961375 - 54849 -1428016224 What is -161.320696237 minus 2.439? -163.759696237 Sum 0.01 and 14741438970340. 14741438970340.01 Work out 5.23 + -90506788. -90506782.77 What is -81657705786096 minus -2? -81657705786094 Total of -765066921592 and 57. -765066921535 Sum -173323 and 9132182. 8958859 Calculate 4 - -5274341.07035. 5274345.07035 Subtract -13276.91979 from 0.0295. 13276.94929 3.019629556 - 2.57 0.449629556 What is -129247936537 minus 0.0322? -129247936537.0322 -643.1 + -3.040341324 -646.140341324 Subtract 38788 from 22.55479. -38765.44521 Subtract -8283 from 0.50514433808. 8283.50514433808 38084.3+53351 91435.3 What is the distance between 0.1391588126 and -65.3? 65.4391588126 Sum 1182698626 and 396209. 1183094835 Work out -0.2 + -54595992018. -54595992018.2 Calculate -5252.09 + 68474.2. 63222.11 Calculate -0.0629 - 19973548. -19973548.0629 What is 0.3 plus 948713731877? 948713731877.3 Sum -0.025022 and 490943. 490942.974978 Sum 0.69093167 and 0.0940791. 0.78501077 Sum -2627.1437327 and -9. -2636.1437327 What is -0.014708 less than -62.91816644? -62.90345844 Put together -11 and -11882975415. -11882975426 39167+11525810.57 11564977.57 Calculate 10956.85 - 14000515. -13989558.15 What is 2.7 - 1046253157781? -1046253157778.3 What is 6.6 minus 1567675580.003? -1567675573.403 What is the distance between 22 and 1530084328646? 1530084328624 Work out 371.56845768983 + -0.2. 371.36845768983 What is the distance between 79651492761 and 2? 79651492759 Add together 0.2 and -38221915414. -38221915413.8 Add 520 and -0.313188815. 519.686811185 What is -0.034 less than -0.347528768? -0.313528768 Total of 6224.6807714898 and -0.4. 6224.2807714898 What is 625714570.4 + 0.046494? 625714570.446494 Total of 4 and -1957584316. -1957584312 Add together 0.19446363893 and -0.05. 0.14446363893 What is -0.38 minus 552727124164? -552727124164.38 Work out -29766 + -9511277. -9541043 Work out 2423022867 - -122. 2423022989 What is 4 minus 25960.6868042623? -25956.6868042623 22.255 + 9968.7273 9990.9823 Work out -14424707 + -6.848. -14424713.848 Work out -49286877 - 0.570949. -49286877.570949 What is 45.3 plus 3.35419? 48.65419 Add -0.0705654605 and 4465. 4464.9294345395 Total of 1.113 and -54096.1343. -54095.0213 213791699490 + 7 213791699497 Add -4545206 and -227.97. -4545433.97 Calculate -17.05 + 623036163. 623036145.95 What is -213 minus 115306607? -115306820 Calculate 0.358 + 1418273196. 1418273196.358 Add together 13.796938 and 4937092. 4937105.796938 746660841827+-128 746660841699 What is 179913534861 less than -71? -179913534932 Add 4201121 and -0.824074. 4201120.175926 What is the difference between 56 and -622081101088? 622081101144 Add together 46 and 4472794591280. 4472794591326 Put together -17063861189267 and 0.2. -17063861189266.8 What is the distance between -47602.177277 and -2602? 45000.177277 286840.1 - 149154 137686.1 Calculate -0.10905 + 1930500502. 1930500501.89095 -350602 + 360617 10015 What is -48558294 plus 2229? -48556065 What is 2394 + 345556.351753? 347950.351753 Calculate -10920109991 - 293.7. -10920110284.7 What is 13042.86 less than -412349? -425391.86 What is -1.8957159157 - -24? 22.1042840843 -11245334744 + 143 -11245334601 What is 17 less than -24190656.0891? -24190673.0891 Total of -264880 and -357.1. -265237.1 Work out -0.006 + -338966954.677. -338966954.683 Put together -33274.7460211731 and -5. -33279.7460211731 Add -7617 and -152289079. -152296696 Add -0.11 and -46.6673151886. -46.7773151886 Work out -45449806417 + 3. -45449806414 Sum -31 and 370484975.7844. 370484944.7844 Calculate -26646529343 - -4. -26646529339 Put together 1996 and 51118126. 51120122 What is -3174 + 0.159342332? -3173.840657668 What is the distance between 4161 and 0.6829342? 4160.3170658 -372+-337.8672143 -709.8672143 Sum 0.286144206 and 248130. 248130.286144206 Calculate -2.57 - -106552248. 106552245.43 Add -0.09 and 64588660602214. 64588660602213.91 What is -1.5482 minus 219670972? -219670973.5482 What is 16606.1348 - 0.0245? 16606.1103 What is 0 minus 452957940.64841? -452957940.64841 What is 0.2 plus 0.289156420609? 0.489156420609 What is 0.00058370389 - -0.0246? 0.02518370389 What is the distance between 3.438033804 and -3.104? 6.542033804 What is 0.63365 take away 17453722? -17453721.36635 Put together -347686632257 and 1693. -347686630564 Total of 4 and -51874494836592. -51874494836588 Subtract 0.3 from 117959.6057379. 117959.3057379 What is -6427.63277116 - 0.11? -6427.74277116 Work out -0.586 - -115076457. 115076456.414 Total of 5908970572 and 1116. 5908971688 What is -18.6723021 plus -472.14? -490.8123021 Total of 245149373543 and 0.3. 245149373543.3 -153312+1436131.61 1282819.61 What is -757129338.07 take away 267? -757129605.07 Work out -0.0747 + -702382386. -702382386.0747 What is 864206.4 take away 0.5108127? 864205.8891873 What is -62.0411587321 minus 3.4? -65.4411587321 Subtract -63709889236 from 0.46. 63709889236.46 What is -1409272943 less than -759? 1409272184 Put together -536755 and -26.1453. -536781.1453 Add together -26.329069227 and 25. -1.329069227 Calculate -429759039267164 + -5. -429759039267169 What is the difference between -16387009378 and 3? 16387009381 What is -10970 less than -1513.03147? 9456.96853 What is the difference between -71391894 and 10.23? 71391904.23 Work out 4 + -28111353760379. -28111353760375 -11812+2515911484 2515899672 Work out 3572321709 - -65. 3572321774 Put together -2.11183 and 140.147. 138.03517 Work out -72258261.3 - 967. -72259228.3 Add 0.026196654 and 4.11. 4.136196654 Work out -99677.5 - 42.8559. -99720.3559 What is -0.19 minus 138584025044? -138584025044.19 Work out -2.361678776 - 9.45. -11.811678776 Work out -242.783475 - -0.04073. -242.742745 Put together -11541040218159 and -0.3. -11541040218159.3 Work out 0.14 + 440902646989. 440902646989.14 What is 267566.7 less than -130462? -398028.7 What is the difference between -16052.1 and 180710? 196762.1 Put together -623714191437 and -3. -623714191440 What is -2.6 less than 9246600194? 9246600196.6 593032525+1630 593034155 What is -7476 + -1198025242? -1198032718 2+-51896348471 -51896348469 What is 40020601634490 + -2? 40020601634488 Add -14405493777 and -203. -14405493980 -0.024020594515739 + -0.08 -0.104020594515739 What is 4.68 less than 193168.8867? 193164.2067 What is 2759738939 - -1.75? 2759738940.75 What is the difference between -37.1 and 2.027668905638? 39.127668905638 What is -0.2 minus -3643883121140? 3643883121139.8 0.6 - 340321428739 -340321428738.4 What is 24 take away -2256138882489? 2256138882513 62 + 794739716.071 794739778.071 Work out -4444 + -68592161921. -68592166365 Sum 807015484258 and -131. 807015484127 Put together -14737 and -2071249349. -2071264086 Sum 10461.6 and -5157690. -5147228.4 -1216978487.2301 - -108 -1216978379.2301 Add 196789883896764 and -5. 196789883896759 Total of -0.3 and -38900290482762. -38900290482762.3 Total of 127123661008 and -0.963. 127123661007.037 0 - 1969186557.88 -1969186557.88 Work out 121089398.6 - -141706. 121231104.6 Calculate -106126232 + -60315. -106186547 0.07 - -37649742935 37649742935.07 Calculate 30426663944549 + -0.4. 30426663944548.6 What is 3963561 minus 283047? 3680514 Subtract 261125359001 from -170. -261125359171 Wha	{ "pile_set_name": "DM Mathematics" }
a + 9 = -3j, j + 2 = -3a - 1. Let d be (j/(-9))/((-3)/(-54)). Is u(d) a composite number? False Let t = 770 + -513. Is t a composite number? False Let v be (-6)/430-1. Let k be (-1)/(-1 - (-50)/52). Let n = v - k. Is n prime? True Suppose 4w - 20 = 2s, 5s = -2w + 2 - 16. Let k = -4 - s. Suppose -2a + 25 + 73 = k. Is a a prime number? False Let w = -1 - -6. Let z = w + 14. Is z a prime number? True Suppose -4q = -3q - 2. Suppose -q = -z + 2. Suppose 4i - j - 79 = 2i, 191 = 5i + zj. Is i composite? True Let k(l) = -l3 - 3l*2 + l - 20. Is k(-13) a composite number? False Let m = -11 - 7. Is 296/6(-27)/m composite? True Let a be (-12)/5 + 6/(-10). Is a - (-2 + 42/(-3)) composite? False Let h = 61 - -47. Let d = h + 185. Is d a composite number? False Suppose 9f = -0f + 19377. Is f a composite number? False Let f(g) = -g*3 + 11g*2 - 8g - 2. Let t be f(10). Let c = 5 - 2. Is 1c570/t a composite number? True Suppose 2v + v + 12 = 0, 3377 = 5l + 2v. Is l composite? False Suppose t + 16 = 3q, 2t - 3t + q - 10 = 0. Let l be (-23)/t + (-4)/14. Suppose 0 = -2i + li - 149. Is i prime? True Suppose 5x = 4p - 89, -2x = -p - 3x + 20. Is p a prime number? False Let h(o) = 10o2 + 3o + 2. Suppose 5x - 3d = 0, 3x + 2d - 1 = 6x. Let u be h(x). Suppose -4r + 255 + u = 0. Is r prime? True Suppose 2f = -0f + 10. Let v(q) = q*3 + 2q*2 - 5q - 5. Is v(f) composite? True Let d(i) = -16i - 1. Let l be d(1). Let g = l + 86. Is g composite? True Suppose -u + 15 = -4. Suppose -u = -5q - 2d, -2q + d + 0d = -13. Suppose 53 = 2p + qb, 15 = -2b - 3b. Is p composite? True Let h(c) = -170c*3 - 2c*2 + 1. Let o be h(-1). Let f = o + -72. Is f a prime number? True Let h be 1 - 1/1 - -1. Let y(t) = 1 + 1 - h - t. Is y(-6) prime? True Let s = -3 - -8. Is 1/s - 1268/(-10) a composite number? False Suppose -4t = 3v - 2346, 1012 = v + t + 229. Is v/24 - 1/(-4) a composite number? True Let j(i) = 2i + 13i + 1 - 3i. Is j(2) a prime number? False Let q(u) = u*3 - 2u*2 + 4u - 3. Let d be q(2). Let g = 54 + d. Is g composite? False Let u(m) = 17m3 + 4m2 + m - 7. Is u(3) prime? True Let k(t) be the first derivative of t4/8 - t*3/3 - 3t*2/2 - 3. Let u(x) be the second derivative of k(x). Is u(7) a prime number? True Suppose -5k + 4k = -257. Is k a prime number? True Suppose 9z = 5z. Suppose 0 = -5t + 5b + 715, z = -3t + b + 255 + 178. Is t a prime number? False Suppose -4z = -4d + 760, -174 = 3d + 4z - 709. Suppose 66 = 3l - 2s - 47, -5l + 5s + d = 0. Is l prime? False Let u(s) = 32s2 + 3s - 3. Is u(2) a composite number? False Let o = 136 + 4. Suppose 7n = 2n + o. Let k = n - 9. Is k composite? False Let y(i) = i*2 + 9i + 4. Let v = 12 - 18. Let m be y(v). Is -2 + ((-3)/(-3) - m) composite? False Let j(t) = 40t + 3. Suppose -6m = -4m - 6. Is j(m) a prime number? False Let o be (-4)/6 - (-215)/(-15). Let a be -42/((-8)/(-82)). Let j = o - a. Is j prime? True Let b = -17 - -5. Let z = -6 - b. Suppose -c + 4c - z = 0. Is c composite? False Suppose -5b = -535 - 2005. Suppose 4t = 3q - 1534, -q + 2t + b = 4t. Is (6/(-9))/((-4)/q) a prime number? False Suppose 3w + 520 - 1450 = 0. Suppose -5l - b + w = 0, 3l - 8b - 186 = -4b. Is (-4)/((-4)/l + 0) composite? True Let c = 195 - -98. Is c composite? False Let n be -2 - (-2 - -1)4. Let u(b) = -b3 + b2. Let k(o) = 20o3 + 6o*2 + o + 1. Let c(z) = k(z) - 4u(z). Is c(n) a composite number? True Let i(f) = 62f + 4. Let z be i(3). Is z/1 - (-7 + 10) composite? True Let c(h) = 9h - 1. Let f be c(-1). Is (-2)/f - 136/(-20) a composite number? False Suppose 4g - 175 = -43. Is g a composite number? True Let v be (78/(-3))/(3 + -5). Is 4 - (1 - (v + -3)) a prime number? True Let o = 156 - -985. Is o composite? True Suppose -2s + 7s - 1913 = 3l, 4s - 1529 = l. Suppose s = 3o - o. Is o a prime number? True Let u = 10 - 5. Let s = -43 + 51. Suppose -3h + 30 = -ua - 155, -4a = -s. Is h a prime number? False Suppose 3v - 5t + 3 = 0, 5v - 2t + 2 = -3. Is 2v + 36 + -1 prime? False Suppose -414 = a + 426. Is a/(-16) + (-1)/(-2) prime? True Let g = 115 - 68. Is g composite? False Suppose k = -5y + 20, -4y + 3k = -2y - 8. Suppose n - yr - 5 = 0, 7n + 71 = 2n - 4r. Let i = 18 + n. Is i composite? False Suppose -5t = 9 - 34, 0 = -4z + 3t - 51. Let g be ((-2)/(-3))/(3/z). Is g + 0 + 19 + -2 a prime number? False Let j = 327 - 178. Is j a prime number? True Let y = -9 + 2. Let v(g) = -g + 6. Is v(y) prime? True Is 2/(-4)(-1592 - (-2)/(-1)) a composite number? False Let o = -298 + 599. Is o a composite number? True Let k(u) = 120u2. Let g be k(1). Suppose 0 = 4s + q - 60, 32 = -5s + 2q + g. Let p = 22 - s. Is p composite? True Let h = -2 + 6. Suppose 0l = -3l - 2m + 32, -hm = -3l + 8. Let i(o) = 4o - 7. Is i(l) a prime number? False Let q(r) = r*3 + 6r*2 - r + 4. Let z be q(-6). Suppose i = 111 + z. Is i composite? True Is 40139/77 + (-2)/7 composite? False Let v(s) = 2s*2 - 17s + 10. Let i = -32 + 45. Is v(i) a prime number? True Is 331 - ((-2 - 2) + 6) a prime number? False Let b be -1 + 65 - (3 - 3). Suppose -5l = 5z - 220, 4l = 4z - b - 72. Is z prime? False Let i(w) = w*2 - w - 4. Let g be i(-7). Let c be 23 - 02/6. Suppose 3z - g - c = 0. Is z prime? False Let w(l) = l3 - 4l*2 - 6l + 8. Let s be w(5). Suppose 5b = 2b - 2u, 0 = 3b + 5u + 9. Suppose 0 = bi - 3 - s. Is i a prime number? True Let b(u) = u*3 + 5u*2 - 6u + 7. Let w be b(-5). Let p(s) = -3s + w + 7s - 5s. Is p(0) prime? True Suppose -i + 2 = 2q, 2q - 2i = -i + 6. Suppose -g = -qg + 3. Suppose -5 = -go + 40. Is o a prime number? False Suppose a = 3g + 202, 6a - 2a - 859 = -5g. Is a composite? False Suppose -4o + 5r + 1201 = 177, -2r = 4o - 996. Is o a prime number? True Let k = 34 + -21. Let q = k + 308. Is q a composite number? True Suppose -4u + 3m + 324 = -m, -5m = 2u - 190. Is u prime? False Let u be 328/(-1)(-1 + 2). Suppose -11o + 15o = 24. Is 1/3 - u/o composite? True Let q be 957/(-12) + (-2)/8. Let k be (4 - 2)/(7 + -5). Is (q + 2 - k)-1 a prime number? True Let s(a) = 7a + 6. Let n be s(8). Suppose -4z + 228 = -z. Suppose 4d - n = -2p, 4p - 2d = 2d + z. Is p a prime number? True Suppose -5g = -36 + 156. Let o = -4 + 147. Let q = g + o. Is q a prime number? False Let k be (2/(-3))/((-8)/36). Let r be (-12)/(-7) + 2/7. Suppose 0 = -rf - 2f + ko + 868, 2f - 434 = -5o. Is f composite? True Let h = 2142 + -1115. Is h composite? True Is -1((0 - (0 + -4)) + -4131) a composite number? False Let n(j) = -30j + 5. Let k be n(-4). Suppose -4q + 591 = -k. Is q a composite number? False Let v(a) be the first derivative of -a*4/4 + 8a*3/3 - 2a*2 + 2a - 1. Let r be v(7). Suppose 4i + f = 26, 9 + r = 4i + 4f. Is i a prime number? False Suppose -2y - 3s + 457 + 875 = 0, 4y = -5s + 2666. Is y a prime number? False Let p = 18 - 10. Let l be p/1(-8)/(-16). Suppose -x + 528 = 5z, 189 = -4z - lx + 605. Is z prime? False Let l = -10 + 19. Let b(t) = -t2 + 12t - 2. Let m be b(l). Suppose -v + 10 = -m. Is v prime? False Suppose -g - 2g = 456. Let t = 235 + g. Is t prime? True Let m(o) = -10o. Is m(-1) prime? False Let b be 2/5(-45)/(-3). Let n(w) = -w3 + 8w*2 - 5w - 5. Is n(b) composite? False Let i(c) = -c - 3. Let j be i(-6). Suppose q + 198 = jq. Suppose 0 = -4k + 5p + q, -5k - 2p + 99 = -0k. Is k composite? True Is (3 - 160/12)-3 prime? True Let n = -2 + 6. Suppose 1381 = 4p + 5o, -np = -3p + o - 344. Is p a composite number? True Let i(g) = -g3 + 9g*2 + 14g - 11. Is i(6) prime? True Let j(v) = -v*3 - 14v*2 + 5v - 19. Suppose -3u + 4u + 2z + 23 = 0, -4u = -5z + 40. Is j(u) prime? True Let g be (8/(-6))/((-4)/6). Suppose -gi = -0i - 166. Suppose -5b + i = 13. Is b composite? True Let f be (1/2)/((-2)/(-16)). Suppose -fu = -5 - 15. Suppose -um - 89 = -3d + d, -d = -5m - 52. Is d a prime number? True Suppose k + 35 = 146. Is k composite? True Suppose -2n + 492 = -1090. Is n composite? True Suppose z + 796 + 102 = 0. Let x = -399 - z. Is x a composite number? False Let r = 3 - 2. Let j be 0r/2 + 3. Suppose -js + 1 = 13, 5	{ "pile_set_name": "DM Mathematics" }
3a2 + 9a - 6. Let y(m) = -25m3 + 7m*2 + 19m - 13. Let j(u) = 13i(u) - 6y(u). Determine b so that j(b) = 0. -1, 0, 1/2 Suppose 3a = -2g + 26, -2g - 17 = -2a - 3g. Suppose 20 = ak - 3k. Let 1/3v*k + 0 + 0v*3 - 1/3v*2 + 0v = 0. Calculate v. -1, 0, 1 Suppose -4h = h - 30. Let d = -3 + h. Let -10/9p + 14/9p2 - 2/3p*d + 2/9 = 0. Calculate p. 1/3, 1 Let o(g) = -g - 7. Let a be o(-12). Let p = 7 - a. Determine r, given that 0 + 2r*4 + 3/2r*5 - 2rp - r3 - 1/2r = 0. -1, -1/3, 0, 1 Let v be ((-1)/3)/(2/(-18)). Suppose vu*3 - 2u3 - u2 - 2u3 = 0. What is u? -1, 0 Let c(o) = o - 8. Let h be c(7). Let i(l) = 2l*2 - 7l - 5. Let k(m) = 4m - m + 2m - 4m + 1. Let d(v) = hi(v) - 5k(v). Suppose d(u) = 0. What is u? 0, 1 Let z(h) be the third derivative of 0 + 1/60h*4 - 1/300h*6 + 0h + 6h2 + 0h*3 + 0h*5. Factor z(c). -2c(c - 1)(c + 1)/5 Let a be 27/108(1 + 7). Factor 0 + 3/2y*a - 3/2y. 3y(y - 1)/2 Factor 27/2y + 0 + 21/2y*3 + 45/2y*2 + 3/2y*4. 3y(y + 1)(y + 3)*2/2 Let -2i*2 + 10i*4 + 2i*3 - 18i*4 + 10i*4 - 2i*5 = 0. Calculate i. -1, 0, 1 Suppose 5v + 25 = -0n + 5n, 0 = 4v - 3n + 15. Suppose -4 = -4b - 2s, vb + 3s = b - 15. Factor 0 - 2/9hb + 0h + 0h2 + 2/9h*4. 2h*3(h - 1)/9 Suppose -4/5p4 + 0 + 16/5p + 16/5p2 - 4/5p3 = 0. Calculate p. -2, -1, 0, 2 Let g(c) be the third derivative of -c5/30 + c4/24 + c3/6 - 10c2. Factor g(n). -(n - 1)(2n + 1) Let n(p) be the third derivative of -1/4p*4 - 1/6p*3 + 0p - 1/120p6 + 0 - p2 + 3/40p*5. Let q(m) be the first derivative of n(m). Factor q(z). -3(z - 2)(z - 1) Let w = -3 - -1. Let j be w/(-7) + 84/49. Determine d so that 3d*2 + 3d*4 + 6d*3 + 2d*5 + 3d*4 - 3d*2 + 2d*j = 0. -1, 0 Let x = -222 + 224. Factor 0 - 2/9t*x + 4/9t*3 + 0t - 2/9t4. -2t*2(t - 1)*2/9 Suppose 59 = 3d + 5t, 4d - 6d + 48 = -t. Suppose -25 = 5b, 5m - m = 3b + d. Factor -1/2 - c - 1/2cm. -(c + 1)2/2 Let b(n) = -n2 + 6n. Let h(a) = -a. Let u(v) = -3b(v) - 15h(v). Factor u(g). 3g(g - 1) Let h(t) be the first derivative of -t5/30 - t4/12 - 3t2/2 - 1. Let x(c) be the second derivative of h(c). Factor x(s). -2s(s + 1) Suppose -5u = -26 + 1. Let m(h) be the first derivative of -uh + h + h2 + 1 + 1 + 0h + 2h3. Factor m(k). 2(k + 1)(3k - 2) Let m(y) be the first derivative of y4/36 - y3/3 + 3y2/2 + 7y + 6. Let z(f) be the first derivative of m(f). Factor z(v). (v - 3)*2/3 Let a = 243929/240 + -3049/3. Let t(g) be the second derivative of 0 - ag*5 - 3/8g*4 - 3g*2 + 2g - 3/2g3. Factor t(r). -3(r + 2)*3/4 Let v(y) = -3y*3 + 5y*2 - 2y + 4. Let s be v(4). Let k be -3 + 0 + s/(-20). Find n, given that 0 - 14/5n4 + 4/5n + kn2 + 6/5n*3 - 2n*5 = 0. -1, -2/5, 0, 1 What is r in 4/7 - 10/7r - 2/7r3 + 8/7r*2 = 0? 1, 2 Let v(m) = 23m*2 + 14m2 + m3 - 38m2 + 2. Let d(t) = 2t3 - t2 + 3. Suppose -2 = 3b - 2b. Let f(i) = bd(i) + 3v(i). Factor f(j). -j*2(j + 1) Let o(j) be the first derivative of -j - 1/6j4 - 3 + 1/2j*3 - 1/2j*2. Let u(q) be the first derivative of o(q). Factor u(k). -(k - 1)(2k - 1) Factor -12n*2 + 0n*4 + 268 - 4n*4 - 4n - 12n3 - 268. -4n(n + 1)3 Let g(p) be the second derivative of -p5/2 + p4/2 + 4p*3 + 4p*2 - 32p. Suppose g(j) = 0. What is j? -1, -2/5, 2 Let i(b) be the third derivative of -b7/3780 - b6/1080 + b*4/24 - 2b*2. Let o(w) be the second derivative of i(w). Factor o(r). -2r(r + 1)/3 Let f(h) be the third derivative of -3h7/490 + h6/70 - h*5/140 + 19h*2. Suppose f(d) = 0. What is d? 0, 1/3, 1 Let 16/3 - 202/3c*3 + 104/3c - 140/3c4 + 98/3c*5 + 124/3c*2 = 0. What is c? -1, -2/7, 1, 2 Let n be (-2)/6 + (-260)/(-6). Let v = -257/6 + n. Factor 0 + 1/6c*2 - vc. c(c - 1)/6 Let k = -1 + 3. Factor -3g*2 + g - 5g - kg. -3g(g + 2) Let p(i) be the third derivative of i8/2352 - 3i7/490 + i6/35 - 4i5/105 + 4i*2. Suppose p(r) = 0. What is r? 0, 1, 4 Let w(z) = 76z*3 + 32z*2 - 100z - 120. Let p(a) = 7a3 + 3a*2 - 9a - 11. Let j(m) = -32p(m) + 3w(m). Factor j(u). 4(u - 2)(u + 1)2 Let n(v) be the first derivative of -v6/720 - v5/240 + v4/24 - 5v3/3 + 3. Let z(o) be the third derivative of n(o). Determine b, given that z(b) = 0. -2, 1 Let g(h) = h - 3. Let q be g(5). Factor 0c*4 - 2c*3 + 4c*3 - 5c5 - c4 + qc5. -c3(c + 1)(3c - 2) Let o(g) be the second derivative of -g*7/42 + 4g. Find u, given that o(u) = 0. 0 Factor -3/2 + 1/2a2 + a. (a - 1)(a + 3)/2 Solve -3/2i3 + 3/4i*5 + 3/4i + 1/2i2 - 1/4 - 1/4i*4 = 0 for i. -1, 1/3, 1 Let v = 23/21 + 4/7. Factor -vd*3 + 0d + 0 - 1/3d5 - 4/3d*4 - 2/3d2. -d2(d + 1)2(d + 2)/3 Suppose r - 8 = 4. Let c = r + -9. Suppose 120p2 - 9p + 30p4 - 39p + 8 - 112p3 - 18p*2 + 20p*c = 0. Calculate p. 2/5, 2/3, 1 Solve -2x - 8x + 100x*3 - 3x + 16x2 - 100x*4 - 3x = 0 for x. -2/5, 0, 2/5, 1 Let n(a) be the first derivative of -2a3/9 - 2a*2/3 - 2a/3 - 4. Determine z so that n(z) = 0. -1 Find r such that -2r4 + 2r*4 - 9r*4 + 15r*3 + 12r*2 - 12r + 0r2 = 0. -1, 0, 2/3, 2 Let o be 0 + ((-4)/(-60) - 3/(-9)). Factor -4/5h*3 + 0 - oh*2 + 2/5h*4 + 4/5h. 2h(h - 2)(h - 1)(h + 1)/5 Let u(a) = 7a2 + 2a. Let x(r) be the second derivative of r4/2 + r3/3 - 2r. Let q(y) = 5u(y) - 6x(y). Find w, given that q(w) = 0. -2, 0 Let n be 16/(-24) - (-12)/9. Let 4/3a - n - 2/3a2 = 0. Calculate a. 1 Find y, given that 108 + 2y - 4y3 - 112 - 4y*4 + 8y*2 + 0y*3 + 2y5 = 0. -1, 1, 2 Let x(z) be the third derivative of -z7/13860 - z6/990 - z5/165 - z*4/8 + 3z*2. Let u(i) be the second derivative of x(i). Factor u(d). -2(d + 2)*2/11 Let z be (-1)/5 - 0 - 56/(-80). Factor 0s + 0 + zs2. s2/2 Let n(u) = -u2 + 11u + 44. Let d be n(14). Factor -2/15fd - 16/15f - 32/15. -2(f + 4)2/15 Let v be (12/120)/(6/10). Suppose -1/6x*4 + 0 - vx*2 - 1/3x*3 + 0x = 0. What is x? -1, 0 Factor 0k + 1/5k*2 - 1/5k3 + 0. -k2(k - 1)/5 Let a(i) be the third derivative of i6/360 - i5/180 - 7i2. Factor a(b). b2(b - 1)/3 Suppose -2v = 3p - 7v + 7, 0 = -5p + 2v + 1. Suppose 4s = -j - 4 - p, -3s = j + 5. Solve 2/5z2 + 2/5z*3 + s + 0z = 0. -1, 0 Let d(t) be the first derivative of -3t4/8 - 45t*3/2 - 2025t*2/4 - 10125t/2 + 43. Let d(c) = 0. What is c? -15 Let i(f) be the first derivative of -f7/315 - f6/180 + 2f2 + 5. Let y(r) be the second derivative of i(r). Factor y(q). -2q*3(q + 1)/3 Let z be 0/((-9)/3 + 1). Let q(v) be the third derivative of -1/32v4 + 0v*5 + 1/12v*3 + z + 1/480v*6 - 2v*2 + 0v. Let q(k) = 0. What is k? -2, 1 Let x be 0 + (-2)/4-1. Let f(s) = -s3 + 3s*2 + s - 1. Let h be f(-1). Suppose -3/4v + x - 5/4vh = 0. Calculate v. -1, 2/5 Let f(r) be the first derivative of -2/3r*3 - 1/2r*4 + 0r*2 - 2 + 0r. Factor f(q). -2q2(q + 1) Let i(y) be the third derivative of -y*2 + 0 - 1/30y*6 - 4/105y*7 + 1/6y*4 + 0y + 1/12y3 + 1/8y*5. Determine t so that i(t) = 0. -1, -1/4, 1 Let p be 2/3(12/16 + 0). Factor t*3 + 0t*2 + 0t*4 - pt*5 + 0 - 1/2t. -t(t - 1)2(t + 1)*2/2 Suppose 4u - 4 = 3a, -a - 4u = -7 + 3. Let h(v) be the second derivative of 1/6v3 + 0 - 5v + av2 + 1/12v*4. Solve h(k) = 0. -1, 0 Let w(h) be the first derivative of -3h*5/25 + 9h4/20 - h3/5 - 9h2/10 + 6h/5 + 9. Determine r, given that w(r) = 0. -1, 1, 2 Let u(v) be the second derivative of 2v + 0 + 0v*3 + 1/36v*4 - 1/6v2. Suppose u(f) = 0. What is f? -1, 1 Let c(j) be the second derivative of -j7/28 + j*6/20 + 3j*5/20 - 6j. Solve c(b) = 0. -1, 0, 2 Let o(g) be the first derivative of -g*4/3 + 2g*2/3 - 39. What is d in o(d) = 0? -1, 0, 1 Factor -14/9w + 2/9 + 14/9w3 - 2/9w*2. 2(w - 1)(w + 1)(7w - 1)/9 Let s = -10 + 14. What is x in -sx - 18x2 - 4 + 1 + 3 = 0? -2/9, 0 Let c(f) be the first derivative of f5/5 + 11f4/48 + f3/18 - 8. Suppose c(a) = 0. Calculate a. -2/3, -1/4, 0 Let p = -3 + 7. Let 4a4 - a2 - ap - 2a**2 = 0. Ca	{ "pile_set_name": "DM Mathematics" }
d to 5 dps? 0 Round -0.000278066 to seven decimal places. -0.0002781 Round -1.7539049 to one decimal place. -1.8 Round -29419.78 to the nearest 10000. -30000 Round 6.895 to the nearest 10. 10 What is 0.00002361139 rounded to 6 decimal places? 0.000024 What is -0.294586 rounded to two decimal places? -0.29 What is -0.00590288 rounded to 5 dps? -0.0059 Round -5549790 to the nearest one million. -6000000 Round -8.831433 to two decimal places. -8.83 Round 3740.15 to the nearest 1000. 4000 What is -0.964193 rounded to two dps? -0.96 Round 165579.3 to the nearest one thousand. 166000 What is -0.000001817597 rounded to 7 decimal places? -0.0000018 What is 6589740 rounded to the nearest ten thousand? 6590000 Round -0.0009056213 to four decimal places. -0.0009 Round -0.275018 to two dps. -0.28 Round -283460600 to the nearest one hundred thousand. -283500000 What is 0.00099773 rounded to 5 decimal places? 0.001 What is 478.9 rounded to zero decimal places? 479 What is 0.0018200999 rounded to 4 dps? 0.0018 Round -7369.007 to the nearest ten thousand. -10000 What is 325585500 rounded to the nearest one million? 326000000 What is -0.00192034 rounded to five decimal places? -0.00192 What is -2.61845 rounded to the nearest integer? -3 What is 0.5591701 rounded to 1 dp? 0.6 What is -1346489 rounded to the nearest one thousand? -1346000 What is 4.2953 rounded to one dp? 4.3 What is -0.0007954187 rounded to five decimal places? -0.0008 Round -0.02329061 to 3 decimal places. -0.023 What is -0.093531 rounded to one dp? -0.1 Round 0.389344 to 3 dps. 0.389 Round -3364700 to the nearest one million. -3000000 Round -1054624.7 to the nearest 100000. -1100000 What is 0.0055550566 rounded to four decimal places? 0.0056 What is 0.000037556 rounded to 6 dps? 0.000038 What is 0.046138199 rounded to 4 decimal places? 0.0461 Round 0.011928928 to 3 dps. 0.012 What is 0.0080027 rounded to three decimal places? 0.008 Round -0.063949512 to five dps. -0.06395 Round -0.0003556122 to five dps. -0.00036 What is -0.6701 rounded to the nearest integer? -1 What is 36.449833 rounded to one dp? 36.4 What is 25.3362 rounded to 1 dp? 25.3 What is 0.000735067 rounded to six dps? 0.000735 What is -20289120 rounded to the nearest 1000000? -20000000 What is 36744630 rounded to the nearest 100000? 36700000 Round 10985570 to the nearest 100000. 11000000 Round 0.3534 to 2 decimal places. 0.35 Round 891430 to the nearest 100000. 900000 Round 37.2454 to zero dps. 37 Round -0.01213536 to three dps. -0.012 What is 0.49033 rounded to 1 decimal place? 0.5 Round 97393.6 to the nearest one hundred. 97400 What is -0.000297902 rounded to 4 dps? -0.0003 Round -0.024312998 to five decimal places. -0.02431 What is -12.05106 rounded to two decimal places? -12.05 What is -2.9822 rounded to one dp? -3 What is 0.521545 rounded to three decimal places? 0.522 Round 0.0000668313 to six dps. 0.000067 What is -0.00042349131 rounded to seven dps? -0.0004235 Round -52.76964 to one decimal place. -52.8 Round -0.0000024338 to 6 decimal places. -0.000002 What is -0.003840871 rounded to five dps? -0.00384 What is -0.0000914856 rounded to 7 dps? -0.0000915 What is -4391.5276 rounded to the nearest ten? -4390 Round -0.000018297514 to 5 dps. -0.00002 What is -0.00000359513 rounded to six decimal places? -0.000004 Round 70.60283 to the nearest integer. 71 What is -1.64358 rounded to one dp? -1.6 What is 17.548262 rounded to 1 dp? 17.5 Round -30.70153 to one decimal place. -30.7 Round -37781100 to the nearest 1000000. -38000000 What is -15878.5 rounded to the nearest one thousand? -16000 What is 0.0000008615089 rounded to seven dps? 0.0000009 What is 49.63529 rounded to the nearest 10? 50 What is 0.72310869 rounded to 3 dps? 0.723 What is -0.000029375 rounded to 6 decimal places? -0.000029 Round 37359 to the nearest one thousand. 37000 What is -142565923 rounded to the nearest 1000000? -143000000 Round 15849671 to the nearest one million. 16000000 Round 0.0361451 to 3 decimal places. 0.036 What is 0.0053304498 rounded to 6 dps? 0.00533 Round 79579.6 to the nearest 10000. 80000 Round 0.0068844093 to six decimal places. 0.006884 What is 2744355 rounded to the nearest ten thousand? 2740000 Round 865.936 to the nearest 10. 870 Round 0.006096189 to three dps. 0.006 Round 0.048603 to 2 decimal places. 0.05 What is 0.00011293019 rounded to 5 dps? 0.00011 What is -2.5988998 rounded to 1 dp? -2.6 What is 2319715000 rounded to the nearest one million? 2320000000 What is 0.000577155 rounded to seven dps? 0.0005772 What is -0.0460606 rounded to four decimal places? -0.0461 What is -0.0140059 rounded to 3 dps? -0.014 Round 30612.6 to the nearest one hundred. 30600 Round 0.00003587697 to 6 decimal places. 0.000036 Round -4374110 to the nearest 1000000. -4000000 What is 0.000765899 rounded to 4 decimal places? 0.0008 What is 1820424700 rounded to the nearest one million? 1820000000 Round -0.64134724 to 1 dp. -0.6 Round 13.63698 to zero dps. 14 What is 0.000366433 rounded to 6 decimal places? 0.000366 Round 0.0234431 to 4 decimal places. 0.0234 Round -0.0004310176 to 6 dps. -0.000431 What is 0.0066456 rounded to 1 decimal place? 0 What is -62.50709 rounded to the nearest ten? -60 Round -2180.724 to the nearest 10. -2180 What is -0.00001971172 rounded to six dps? -0.00002 What is 0.2530321 rounded to 2 dps? 0.25 What is 0.79199 rounded to one decimal place? 0.8 What is -171.24851 rounded to 1 decimal place? -171.2 Round 2586223.8 to the nearest 10000. 2590000 What is -2619612.4 rounded to the nearest 100000? -2600000 What is 4585300 rounded to the nearest one hundred thousand? 4600000 Round -0.00005130205 to seven dps. -0.0000513 What is -5.32973 rounded to the nearest integer? -5 Round 7594970 to the nearest 100000. 7600000 What is -25814300 rounded to the nearest one hundred thousand? -25800000 Round 1.0093461 to one dp. 1 Round 8786.104 to the nearest 100. 8800 What is -170591000 rounded to the nearest one hundred thousand? -170600000 Round 0.827648 to three dps. 0.828 Round -1341143600 to the nearest one hundred thousand. -1341100000 Round 0.0616059 to three decimal places. 0.062 Round 2606.366 to the nearest ten. 2610 What is -0.0000505276 rounded to seven decimal places? -0.0000505 What is 0.00321382 rounded to 6 dps? 0.003214 What is -10103.143 rounded to the nearest ten? -10100 Round 12591244 to the nearest one hundred thousand. 12600000 Round -799109000 to the nearest one million. -799000000 Round 0.00031809238 to four dps. 0.0003 Round 1472.757 to the nearest 100. 1500 Round 0.38823 to 2 dps. 0.39 Round -6.50616 to 1 decimal place. -6.5 What is -0.030329 rounded to one dp? 0 Round 0.01512345 to four decimal places. 0.0151 Round -4792879300 to the nearest one million. -4793000000 Round -0.1370916 to 3 decimal places. -0.137 Round -2691744 to the nearest 1000000. -3000000 Round -0.0633578 to 4 dps. -0.0634 What is -0.2033433 rounded to 2 dps? -0.2 Round -98862 to the nearest 10000. -100000 What is -6057911000 rounded to the nearest one million? -6058000000 What is -0.4737093 rounded to 2 decimal places? -0.47 What is -40192.07 rounded to the nearest 10? -40190 Round 960857 to the nearest 10000. 960000 Round 979497.2 to the nearest one thousand. 979000 What is -115.7234 rounded to 0 dps? -116 Round -0.0001076 to 5 decimal places. -0.00011 Round -0.00000075084 to seven dps. -0.0000008 Round 0.001135741 to 6 dps. 0.001136 What is -0.00217627 rounded to three dps? -0.002 Round -0.000535058 to 4 decimal places. -0.0005 Round 0.00936281 to 3 dps. 0.009 What is -0.0000482309 rounded to seven dps? -0.0000482 Round 0.035136 to four dps. 0.0351 Round 0.004997366 to 5 decimal places. 0.005 Round -0.0062881 to four dps. -0.0063 What is 0.0003421694 rounded to 6 decimal places? 0.000342 Round -0.01914204 to three decimal places. -0.019 Round 20420.21 to the nearest 10. 20420 What is -0.0429869 rounded to four decimal places? -0.043 Round -121564960 to the nearest 100000. -121600000 Round 12.40675 to two decimal places. 12.41 What is -0.000000039895 rounded to seven dps? 0 What is 876.0981 rounded to the nearest 100? 900 Round 0.0008589228 to 6 dps. 0.000859 Round -0.000180228 to 5 dps. -0.00018 Round -0.0013601974 to 7 dps. -0.0013602 Round -524	{ "pile_set_name": "DM Mathematics" }
-0.029830971 + 0.029858. What is n rounded to 6 dps? 0.000027 Suppose -14595 = -13m - 172181. Let y = 18957 + m. What is y rounded to the nearest 100? 6800 Suppose 16c - 18c + 14454180 = -31c. Round c to the nearest one thousand. -498000 Let m = 207.83 - 176.2. Let r = 32 - m. Let j = r - -0.59. Round j to one dp. 1 Let z be ((96544/49)/((-18)/(-21)))/(1/(-6)). What is z rounded to the nearest one hundred? -13800 Let u = -267.54 + 264. Let z = u + -1.28. What is z rounded to the nearest integer? -5 Suppose -2r - 1957563 = -11r. Suppose -5q - r = 487493. Round q to the nearest 100000. -100000 Let r(u) = 0 + 5u + 498u3 - 3 + 18u*2 - 13u + 113u3. Let d be r(14). Suppose -a = -5a - 3p + d, a = 4p + 420004. Round a to the nearest 100000. 400000 Suppose 16 = q - 4q + 5c, q - c + 2 = 0. Suppose qf + i + 43 = -3i, i + 13 = -f. Let x be 216/330/f. Round x to the nearest 100. -200 Let b = -1356606428 + 1356606895.9999895. Let j = b - 468. What is j rounded to 6 dps? -0.000011 Let h be (450-100)/(48/520480). What is h rounded to the nearest one million? -488000000 Let u = -313.2 - 39.8. Let m = 353.343 + u. Round m to two decimal places. 0.34 Let k = -429 + 428.997511. Round k to 4 dps. -0.0025 Let m = 11747 + -6497. Round m to the nearest one thousand. 5000 Let r = 5059809518.111 - 5055822142. Let f = r + -3987731.1110326. Let j = -355 - f. Round j to five dps. 0.00003 Let i = 386.866 - 15.556. Let x = i - 371. What is x rounded to one decimal place? 0.3 Let q = -10446785.11899997 + 10446736.119. Let x = -63.54 - -14.54. Let m = x - q. What is m rounded to seven decimal places? 0 Let b = 7.1 + -1.1. Let i = 16441.64 + -16447.639844. Let l = i + b. Round l to 5 decimal places. 0.00016 Let m = -6017941202.40000329 + 6017941283. Let d = m - 80.6. What is d rounded to six dps? -0.000003 Let h = -0.6606 - -1.31544. Round h to one decimal place. 0.7 Let y(d) = 797d3 - 7d*2 - 46d + 11. Let g be y(19). Suppose 5v = -g + 15163233. What is v rounded to the nearest one hundred thousand? 1900000 Suppose -16i + 15 - 255 = 0. Let n be 36809998 - (-20)/i(-18)/12. What is n rounded to the nearest one million? 37000000 Let i = -10.67331 + -14.43857. Let t = 25.1 + i. Round t to 3 decimal places. -0.012 Let r be (-717)/(-1912) + 2431/(-8). Let n be 200/(-15)6/2. Let t = n + r. What is t rounded to the nearest one hundred? -100 Let c = -3043 + 4506. Let y = 1463.0000889 - c. What is y rounded to 5 dps? 0.00009 Let k be ((-16)/12)/(2/6). Let b be 7 + k/2 + 4. Let v(o) = -286665o - 15. Let r be v(b). What is r rounded to the nearest 100000? -2600000 Suppose -2l + 2m + 17404 = 0, 0 = 5m - 10 - 15. Let u be (l + -7)/(-3)17. Round u to the nearest one thousand. -49000 Let h be (-260)/78(-6)/4. Let c be (-6 - 44699997/3) + h. What is c rounded to the nearest one million? -15000000 Let c = -29826136902.00002194 + 29826136589. Let t = c - -313. Round t to five decimal places. -0.00002 Let r = -0.099 + 44.299. Let o = 0.313 + 55.687. Let m = r - o. What is m rounded to the nearest integer? -12 Let j = 0.53851 - 0.5362031. What is j rounded to five decimal places? 0.00231 Let d = 0.0165 + 0.3265. Let b = 0.34936 - d. What is b rounded to four dps? 0.0064 Let j = -143.15916 - -146.188. Let u = 3.03 - j. Round u to 4 decimal places. 0.0012 Let j = 152 + -172. Let w = j - -19.98848. Round w to three dps. -0.012 Let a = -1.845924 - -1.8958. What is a rounded to 4 decimal places? 0.0499 Let c = -26.965 + 27. Let w = c - -0.034. Let y = w - -0.071. Round y to 2 decimal places. 0.14 Let i = 641 - 968. Let k = 1228692.9719 + -1229020. Let q = k - i. What is q rounded to 3 dps? -0.028 Let l = -3882.05 - -3513. Let t = l - -366. What is t rounded to the nearest integer? -3 Let q = 67 - 37.4. Let r = 39.3 - 92.5. Let i = q + r. Round i to the nearest integer. -24 Let n = 822.188 + -819. Let z = -3.187996623 + n. Round z to seven decimal places. 0.0000034 Let c(z) = -9407z - 15. Let n be c(-9). Suppose 3x + 14948 = -u + n, 5u + 5x = 348500. What is u rounded to the nearest 10000? 70000 Let s(f) = 13364f*2 + 36f - 280. Let t be s(21). Round t to the nearest one million. 6000000 Let f = 8504929.0754 - 8505690. Let t = f + 761. What is t rounded to 2 dps? 0.08 Let y = 11 + -11.125. Let s = y - -229.125. Let b = s - 229.0426. Round b to two dps. -0.04 Let q = -19.623427 + 0.217787. Let t = q + 19.4. Round t to three decimal places. -0.006 Let w = -8834907 - -8774009.0504. Let h = 60861 + w. Let c = h - -37. Round c to two dps. 0.05 Let s(p) = -5p2 - 4p + 3. Let n be s(1). Let c be -111n4200/(-54)250. Round c to the nearest one million. -13000000 Suppose 0 = 3317z - 3340z + 44413. Round z to the nearest 100. 1900 Suppose 10m - 46 = 24. Let i be 1 + m/(-6) + 675009/54. Let y be 9/((-18)/208)i. What is y rounded to the nearest 100000? -1300000 Let i = 5.076160464 - 3716.074661464. Let q = i + 3711. Round q to four decimal places. 0.0015 Let m = -98 + 111. Suppose 5u + 94480 = mu. Round u to the nearest 1000. 12000 Let h = -17409127505797477.73999637 + 17409127576418685. Let j = -70621208 + h. Let b = j - -0.74. What is b rounded to 6 decimal places? 0.000004 Let y = 4.258 + -1887.258. Let j = y - -2003.22. Let k = j + -119. Round k to one dp. 1.2 Let o = -5.04088 - -4.9838738. Let s = -0.138 + 0.195. Let n = s + o. Round n to 6 dps. -0.000006 Let u = -0.032507 + 0.0325044759. Round u to seven decimal places. -0.0000025 Let t = -4.58 - -4.57964355. Round t to 5 decimal places. -0.00036 Let o = -1399010058.9625643427 + -0.0374356573. Let y = o + 1399010272.0000442. Let r = 213 - y. Round r to six dps. -0.000044 Let b = 15031.6 + -15031.68300264. Let d = b - -0.083. What is d rounded to seven decimal places? -0.0000026 Let t = 214 - 214.000711. Round t to 4 decimal places. -0.0007 Let b = -9441 - -9448.306. Let g = 459.426 - 459. Let z = g - b. What is z rounded to the nearest integer? -7 Let u = -24864 + 24864.0000018203. Round u to 7 decimal places. 0.0000018 Suppose 0 = j - 2j + 4. Suppose 4s = -3b - 0 + 1, -5b = -js + 41. Let a be ((-390)/(-4))/(b/(-20)). What is a rounded to the nearest 100? 400 Let j(q) = -8q2 + 2 - 3 + 0 + 13q*3 + 15q - 4. Let i be j(5). Let c = i + -2105. Round c to the nearest 100. -600 Let q = -1839980 + -1323720. Round q to the nearest 100000. -3200000 Let q = -15101 - 12295. Let d = -52796 - q. Round d to the nearest 10000. -30000 Suppose h - 3 = -d, 17 = -4h + 1. Let n be (d + (-59)/2)2104/(-3). What is n rounded to the nearest one thousand? 16000 Let c = 0.38758 + -0.38790662. Round c to 6 decimal places. -0.000327 Let v = -323.2 + 53.2. Let y = v + 256.9. What is y rounded to 0 dps? -13 Let q = 0.9038633 - 0.0037313. Let u = -41 - -41.9. Let i = u - q. Round i to 5 decimal places. -0.00013 Let o = 0.036835 + 2.282465. Round o to 2 decimal places. 2.32 Let t = -4679 - -6562.2. What is t rounded to the nearest 10? 1880 Suppose 38h - 38514800 = 20h - 55h. What is h rounded to the nearest 1000000? 1000000 Let a = -2643 + 2643.1277. Let f = a + -0.128914. Round f to four decimal places. -0.0012 Let r = -681628 - -69801628. Suppose 89t - r = 105t. What is t rounded to the nearest one million? -4000000 Let p = 0.12138 - 457.92138. What is p rounded to the nearest ten? -460 Let g = -0.0513 + -669.9487. Let y = g - -669.998605. Round y to 5 decimal places. -0.0014 Let i = -3.8539 + -0.8731. What is i rounded to zero decimal places? -5 Let m = 32940.56 - 33921. Let r = 914 + m. Let v = r + 65. What is v rounded to 1 decimal place? -1.4 Let i be -3 - (5 + (1 - -1764)). Let x be 2/(-13) - i/117. Let h be 640/x9350/4. What is h rounded to the nearest 1000? 50000 Let y = 5 + -2. Suppose 2b + 53041050 = yb. Let s = -30041050 + b. What is s rounded to the nearest 1000000? 23000000 Let o = -279 + 278.99990046. Round o to 6 decimal places. -0.0001 Let u = 1812.97605 - 1814. What is u rounded to 1 dp? -1 Suppose 4q = -2d + 8, -2q + d + 4 = -3*d. Let c be q + (-7924)/10 + 6/15. Let a = c + 390. Round a to the nearest one hundred. -400 Let d = -29 - -30.31. Let a = -2613.760345 + 2612.450345053. Let j = d + a. What is j rounded to 7 decimal places? 0.0000001 Let k = 1696 - 1695.999992232. Round k to	{ "pile_set_name": "DM Mathematics" }
0 = 2f, -4l = 5f - 7. Sort -1/3, 1/8, -0.3, l in descending order. 1/8, -0.3, -1/3, l Let f be ((0 + -4)/4)/(-1). Let i = -23 - -38. Let w = 13 - i. Sort f, -5, w in decreasing order. f, w, -5 Let a be (-6)/(-9) + -1 + (-3484)/42. Let y = a + 83. Sort -5, 14, -3, y in descending order. 14, y, -3, -5 Suppose 0 = -8m + 7m + 2. Let l(s) = -14 + m - 47s + 48s. Let i be l(10). Put 4, i, -1 in ascending order. i, -1, 4 Let o = 11/30 + 2/15. Let m be (-201)/(-7) + (2/1 - 1). Let j = -30 + m. Sort -2/15, j, o in increasing order. j, -2/15, o Let m(j) = -3j*3 - 3j*2 - j - 2. Let i(q) = 16q*3 + 14q*2 + 4q + 11. Let g(k) = 2i(k) + 11m(k). Let l be g(-4). Put 4, -1, l, -2 in decreasing order. 4, -1, -2, l Let m(b) = b*2 + 4b - 7. Let s be m(2). Suppose -8o + 37o = 0. Sort o, 3, s, 2 in decreasing order. s, 3, 2, o Let t = -274 + 275. Sort t, -1, -4 in descending order. t, -1, -4 Let k = 1.842 - 1.892. Put 5.2, k, 0.3 in descending order. 5.2, 0.3, k Let h = -48 - -47.7. Let a = -13.2 + 13. Sort h, 1, a, 5 in decreasing order. 5, 1, a, h Let w be (31/124)/(1/(-4)). Sort -6, 1, w, 16. -6, w, 1, 16 Let q be (-20 + (-2431)/(-119))(-14)/(-6). Let v be (8/3)/((-2)/54). Put v, q, -4 in decreasing order. q, -4, v Let t = 324 + -327. Let i(c) = 0c*2 + 0c2 - 1 - c2. Let l be i(2). Put t, -2, l in decreasing order. -2, t, l Let t = 9.2 + -9.239. Let k = t - 0.061. Put 0.4, k, -2, 0 in ascending order. -2, k, 0, 0.4 Let o = -44 + 51.8. Let j = o - 3.8. Sort -1/2, 0.1, -5, j in increasing order. -5, -1/2, 0.1, j Let q be 5 + 85/(-15) - 68/(-3). Put -3, -2, q, 0 in decreasing order. q, 0, -2, -3 Let c = 6.97 - 5.97. Put 3, 15, c in decreasing order. 15, 3, c Let j = -8 + 3. Suppose -4c + 12 = -3d + 5, 5d - 31 = -4c. Sort j, 2, c in ascending order. j, 2, c Let w be ((-248)/20 + 12)/(13/5). Sort w, 2, 5/3 in descending order. 2, 5/3, w Suppose 0 = 5y - 0 + 20. Let u = y + -22. Put -5, 3, u in ascending order. u, -5, 3 Let x be (3/9 - 1)/(80/(-48)). Sort -6, x, 0.2, -2/5 in decreasing order. x, 0.2, -2/5, -6 Suppose n + l + 2 = -2n, l = n + 6. Let c be 3 + 10/n - 3. Let k(x) = -x*3 + 6x*2 - 2x + 4. Let m be k(6). Put 1, c, m in increasing order. m, c, 1 Suppose 0i - 1 = -4i + j, 3i = -5j - 5. Suppose o - 2h + 5 - 2 = i, -o = -h + 2. Suppose -3c + 4c = -2. Put o, c, 4 in descending order. 4, o, c Let d = 6.67 + -9.67. Put -1, 0.17, d in decreasing order. 0.17, -1, d Let h = 18.23 + -18.18. Put 2, -0.1, -2/5, h in increasing order. -2/5, -0.1, h, 2 Let k(s) = -s3 + 5s*2 + 5s + 5. Let r be k(6). Let j = 60.99 - 59. Let n = 0.01 + j. Put 4/3, r, n in descending order. n, 4/3, r Let n = 1 + -1. Let q be (-1)/(-9)2 - 22032/5760. Sort -2, q, 5, n in descending order. 5, n, q, -2 Let v(n) = -n*3 + 4n*2 - 4n. Let b be v(3). Let a be (13 + 1 + -2)/2. Let j be (-4)/a + 56/12. Put b, j, -5 in increasing order. -5, b, j Let k = 4357.139 - 4362. Let p = -0.139 + k. Put -1/9, 3, p, -0.3 in decreasing order. 3, -1/9, -0.3, p Let c = -0.076 - -7.076. Sort -4, -1, 0.5, c in descending order. c, 0.5, -1, -4 Let k = 0.88 - 0.59. Let n = -0.49 + k. Let o = 9 - 5. Put -0.4, n, o in decreasing order. o, n, -0.4 Let s = 1149 - 1149.5. Put s, 9, -14 in descending order. 9, s, -14 Suppose 3z + 5 = 4z. Suppose -35 + 0 = -5n - 5g, -2n + 20 = zg. Put -4, 0.3, 2/9, n in ascending order. -4, 2/9, 0.3, n Let a(w) = w*2 - 2w + 10. Let u be a(5). Put 4, 0, u in increasing order. 0, 4, u Let o be (1 - -3)/(-2) - -22. Let l = -15 + o. Let t = 14 - l. Sort 4, -5, t in decreasing order. t, 4, -5 Let p be ((-2)/(-12))/(10/15). Suppose 3f = -2v - 12, -29v + 4f = -33v - 16. Sort 1, p, v in descending order. 1, p, v Let j = -11 - -31. Suppose 5i - i = j. Suppose -p + 3 = -g, -5g + 8 = p + 29. Sort -3, i, g. g, -3, i Let b = -36 + 35.7. Let y be (3/(-9))/((-2)/24). Suppose r + u = -0r + y, -2u = 2. Put b, r, -1 in ascending order. -1, b, r Let a = -0.94 - -1.74. Let m = -4 - -4.6. Let h = m - a. Sort 0.4, -2, h in increasing order. -2, h, 0.4 Suppose -180 = 49z - 4z. Let j be 1 + 0 + (-5)/3. Sort j, z, -0.3, 3. z, j, -0.3, 3 Let o = 2556 + -2560. Let m = 6 - 11. Sort o, -0.3, -0.5, m. m, o, -0.5, -0.3 Let c be (-8)/1015/6. Sort -1, 5, -11, c. -11, c, -1, 5 Let w = -191 + 188. Let p be (1/2)/((-2)/(-12)). Let q(o) = o*2 - 2o - 1. Let g be q(p). Put w, 3, g in decreasing order. 3, g, w Suppose v + 2h + h = -16, 3v - 8 = 5h. Let t = -9 + 7. Sort t, 3, 2, v in increasing order. v, t, 2, 3 Let u = -3.5 + 10.2. Let g = u - 7. Sort g, 1, -0.1 in descending order. 1, -0.1, g Let j = -46.6 - -47. Sort 0, j, -1.6 in descending order. j, 0, -1.6 Suppose -3z - 64 = 4t, -16 = -t + 2t + 2z. Sort t, 4, 5 in ascending order. t, 4, 5 Let d = 147 - 144. Let c = 0.9 - 0.4. Sort d, -0.3, -1/4, c. -0.3, -1/4, c, d Let f be -3 - (-1)/2-21. Suppose 2v + 9 = -2h + 25, -2h + 4 = -2v. Sort h, 1, f, 0. f, 0, 1, h Let j = -65 - -64. Let n be (j/3)/((-3)/9). Suppose 15 = 4o + 5x, 3o = o - 3x + 7. Sort 2, n, o in decreasing order. o, 2, n Let b be (-2)/(-5) - (-3 + (-56)/(-20)). Sort -0.02, -10, b, 0.5 in ascending order. -10, -0.02, 0.5, b Suppose -39z + 20 = -34z. Suppose 4w = w - 3l - 3, 0 = 5w + zl + 2. Suppose b - s + 5s - 13 = 0, -3s = -3b - 6. Sort w, b, -2 in increasing order. -2, b, w Let x be -2 + (1 - (0 + 0)). Let n(m) be the first derivative of -m*2/2 - 7m - 33. Let k be n(-12). Sort -3, x, k in descending order. k, x, -3 Let j be (-266)/126 - (-2)/6. Sort j, -3, -0.5, 1. -3, j, -0.5, 1 Let p = 0.1053 - -53.8947. Put p, 0.3, 0.4, 0 in ascending order. 0, 0.3, 0.4, p Let b = -54 + 148. Let s = b + -91. Let x = 121 - 368/3. Sort -1, x, s. x, -1, s Let x = 159/118 + -50/59. Sort x, 2/5, -4, 23. -4, 2/5, x, 23 Let y be (-206)/17 + (-6)/(-51). Let p be (3 - 2) + -3 + (-28)/y. Sort p, -2, -5/2. -5/2, -2, p Let g = 0 - -0.1. Let a = 2.1 - g. Let h be (-10)/12(-5)/((-20)/(-6)). Sort -4/3, h, a in descending order. a, h, -4/3 Let w = 24.94 + 0.06. Let d = w + -35. Put d, 0, 4 in ascending order. d, 0, 4 Let v(p) = 2p*2 + 4p + 3. Let m be v(-5). Let r = -36 + m. Sort 3, r, 4 in decreasing order. 4, 3, r Let w = 0.99 - 1.121. Let v = w - -0.031. Let m = -41 - -202/5. Put v, -4, m in decreasing order. v, m, -4 Let m be ((-6)/(-10))/(5 - (-52)/(-10)). Sort m, -4, 0.69 in descending order. 0.69, m, -4 Let q be -24 + 24 + (3 - (-1 + -1)). Put 33, 3, q in ascending order. 3, q, 33 Let o = -845 - -844. Put -4, 2, 3, o in ascending order. -4, o, 2, 3 Let t(z) = -z*3 - 3z*2 + 3. Let j be t(-3). Let b be (-5 - 1) + 5 + -3. Sort 2, -3, j, b in ascending order. b, -3, 2, j Suppose 4t + 14 = n, 5t + 3n - 73 = -99. Sort 0.5, -0.14, 0.03, t. t, -0.14, 0.03, 0.5 Let k(y) = -2y - 44. Let m be k(-22). Put 18, m, 4 in ascending order. m, 4, 18 Let n = -125.14 + 137. Let m = -0.14 - n. Let f = 9 + m. Sort f, -4, -2. -4, f, -2 Let j(k) = -5k - 5 - k*3 + 4 - 6k*2 - 3. Let m be j(-5). Suppose -4s - 3 = 3w, 2s - 4 = 3w - 1. Sort m, w, 5. m, w, 5 Let w = -0.044 - -2.044. Let m(q) = -q3 + 3q*2 + 2. Let u be m(3). Let b be (-11)/10 - (-2)/u. Put b, w, -4 in ascending order. -4, b, w Let d(a) = 13a - 21. Let q be d(11). Let s = 364/3 - q. Sort s, 1/11, 5, 2 in decreasing order. 5, 2, 1/11, s Let j be (-5 + 9)(-2)/20. Let d(o) = -o + 17. Let t be d(9). Put j, t, -0.3 in decreasing order. t, -0.3, j Let l = -92.6 - -93. Let i = -10.1 - 4.7. Let p = i - -15. Put 0, p, l in decreasing order. l, p, 0 Let y = -0.078 - 73.922. Let g = y + 105. Let i = g - 30.98. Put -1, 0.5, i in descending order. 0.5, i, -1 Let j = -6 + 6. Let p be j + 1 + -1 + 0. Let x = -1 - p. Put 4, x, -3 in descending order. 4, x, -3 Let z = -33 + 28. Let a = 19 - 24. Let n(v) = -v - 2. Let u be n(a). Put 4, u, z in decreasing order. 4, u, z Let c = -47646 - -71760. Let b = -193865/8 + c. Let n = 119 + b. Sort n, -2/13, 0. -2/13, n, 0 Suppose -2z + 2 + 0 = -5w, -10 = w + 2z. Sort 0.4, 4/7, w, -0.259 in decreasing order. 4/7, 0.4, -0.259, w Suppose 25 = -5n + 4l + l, 14 = -2n + 4l. Put -1, -4, n, -7 in increasing order. -7, -4, n, -1 Let t be 5 + (-57)/11 - (-40)/(-22). Sort 8, t, 4 in increasing order. t, 4, 8 Let x = 8 - 10. Let o be 5-16/10. Sort o, x, -0	{ "pile_set_name": "DM Mathematics" }
0. What is the tens digit of j? 1 Let z = 23 + -47. Let f be (z/10)/(22/110). Let l = -7 - f. What is the units digit of l? 5 Let r(m) = 5m2 - 20m - 4. What is the units digit of r(9)? 1 What is the hundreds digit of 82/5(-18 + 68 - 15)? 5 Let g be ((-3)/(-4))/((20/(-304))/5). Let o = 100 + g. What is the tens digit of o? 4 Let r(s) = -s2 - 13s - 8. What is the units digit of r(-6)? 4 Let g be 2(2 + 2)14. Let s = 178 - g. What is the tens digit of s? 6 Suppose -2f - 5r + 1672 = 182, 0 = 5f - 4r - 3791. What is the tens digit of f? 5 Suppose 3b + o = -3o - 825, -o + 1398 = -5b. Let d = b - -483. What is the tens digit of d? 0 Let x = -36 + 41. Suppose -2c + 2y + 134 = 0, 18 = 3c - xy - 185. What is the tens digit of c? 6 Let r(l) = 3l*2 + 27l - 247. What is the hundreds digit of r(14)? 7 Let v(r) = 9r + 3. Let l be v(-6). Let t = l - -101. What is the units digit of t? 0 Let v = -12 + 13. Let u(o) = 3o*2 + 1. Let c be u(v). Suppose 0f + 132 = cf + 2z, 3z - 23 = -f. What is the units digit of f? 5 Suppose 0 = 2h + 2i - 17 + 73, -3h = -4i + 91. Let t = -25 - h. Suppose -tz + 7z = -d - 1, -2d + 48 = -4z. What is the units digit of d? 4 What is the units digit of ((-9)/3 - 10/(-3))24? 8 Let p be 3(-4)/(-121). Let f = -13 - -8. What is the tens digit of (-264)/(-5) - p/f? 5 Let w = -15 - -11. Let t(d) = d*3 + 4d*2 - 6d - 3. Let o be t(w). Suppose 11 = 4r - o. What is the units digit of r? 8 Let r(i) = 3i*2 - 5i + 4. Let y be r(1). Let q(k) = 5k3 - 4k*2 - k + 2. What is the units digit of q(y)? 4 Suppose -5j = 5u - 290, -1 = j + 1. Suppose -4s - 52 = 2z, z = -5s - u + 1. Let k = s - -38. What is the tens digit of k? 2 Let q be 1/1(4 - 0). Let t(h) = 28h*2 - 4h - 4. Let b be t(q). What is the units digit of b/7 - (-1)/(-7)? 1 Let i(q) = -2q2 - 9q - 13. Let c(d) = -d*2 + d. Let n(r) = 3c(r) - i(r). Let h be n(9). What is the units digit of 432/h + 1/5? 1 Suppose 2q + n = 1695, -q = 2q - 4n - 2548. What is the units digit of q? 8 Let i be (1 - 1)/(5 + -7). Suppose -5x + 23 + 12 = i. Suppose x - 3 = f. What is the units digit of f? 4 Suppose -j = -5w - 259, 4w - 2w - 578 = -2j. What is the tens digit of j? 8 Let l(z) = -11z - 3. Let m = 7 - 22. Let n = m + 12. What is the tens digit of l(n)? 3 Suppose 68b - 63b - 6710 = 0. What is the hundreds digit of b? 3 Suppose -5v + 5 = -10. Suppose y - 2j = -0j + 8, vj = 5y - 75. Suppose -4i - 2t + y = -3i, -3i - 3t = -45. What is the units digit of i? 2 Suppose -4b = -q - 3546, 0 = 4b - 2q + 7q - 3558. What is the units digit of b? 7 What is the tens digit of 4 + -1 - (-25)/((-100)/(-1992))? 0 Let m = -3 - 1. Let s = 6 + m. What is the units digit of s? 2 Let l be 1(4 - 0) + 271. Suppose 75 = -5i + l. What is the units digit of i? 0 Let c(m) be the third derivative of -m5/60 + m4/6 + m3/6 + 8m*2. Let y be c(5). What is the tens digit of y/12-3 + 12? 1 Let i be 4 - (1 - -4(-14)/4). Let t = i - -82. What is the tens digit of t? 9 Suppose -4p - 4y - 64 = 0, y - 29 = -0p + 2p. Let d(f) = -f3 - 15f*2 - 4f - 22. What is the units digit of d(p)? 8 Suppose 5c = -4v + 134, 0 = 4c + v - 119 + 3. Let y = -30 + c. Suppose y = 4g + 1 - 5, -2g + 307 = 5u. What is the units digit of u? 1 Let t(i) be the second derivative of -193i5/20 + i4/12 + i3/2 + i2/2 - 39i. What is the tens digit of t(-1)? 9 Suppose 0a - 3a - 108 = 0. Let j be 8/(-3)a/24. Suppose -2x - 23 = -2p - 85, 0 = -2x + jp + 58. What is the units digit of x? 3 Suppose 0 = -v - 2m + 615, 4v - 8v - 2m = -2436. What is the units digit of v? 7 Let r(f) = 398f*2 - 4. What is the hundreds digit of r(-2)? 5 Let u be (526/4)/(3/6). Suppose 5j - 353 = -4p, 4j + 3p - 20 = u. What is the units digit of j? 3 Let f(a) = -a2 - 18a - 76. Let t be f(-12). Let r(g) = -3g3 - g + 1. Let m be r(1). What is the units digit of (-5)/(m + (-11)/t)? 0 Let r = 753 - 405. What is the tens digit of r? 4 Suppose -2x + 0x = 2r - 120, -2x - 3r + 122 = 0. Let q = 118 - x. What is the units digit of q? 0 Suppose -33p + 6358 = -22p. What is the tens digit of p? 7 Let c = 539 - 176. What is the tens digit of c? 6 Suppose -3n + 4n - 9 = 0. Suppose 0 = 2f - 5f + n. Suppose -fx = -x - 6. What is the units digit of x? 3 Suppose 353 = -10f + 3653. What is the tens digit of f? 3 Let h = -17 + 23. Suppose -6x + 48 = -2x. What is the units digit of hx/8 + 3? 2 Let v(j) = 38j*2 - 32j - 41. What is the units digit of v(-7)? 5 Suppose 5n + 1464 = 8n. Let s = -266 + n. What is the tens digit of s? 2 Let l = 19 + -9. Suppose ln = 3n + 273. What is the tens digit of n? 3 Suppose -2 = 2t - 112. Suppose -3a = 13 - t. What is the units digit of a? 4 Suppose 517 = 4f + 5m, 0m + m = 3f - 364. What is the tens digit of (50/2)/(7 + f/(-18))? 5 Suppose -x = 19z - 18z - 103, -x + 2 = 0. What is the hundreds digit of z? 1 Let k(l) = 136l2 + 2l. Let z be k(1). Suppose -1 = q - 4a, -4a + 45 = 3q - 0q. Suppose -8u - z = -qu. What is the units digit of u? 6 Let g(l) = 6l2 + 39l + 10. What is the units digit of g(-12)? 6 Suppose 2 = 4u - 10. Let f be (-66)/18 - 1/u. Let v(b) = -15b + 9. What is the units digit of v(f)? 9 Let f be 10/(-35) + 1539/21. Let o = f + -53. What is the tens digit of o? 2 Let f(d) = 27d - 12. Let l be f(6). Let z = -99 + l. What is the tens digit of z? 5 Suppose -14i - 5161 = -27i. What is the hundreds digit of i? 3 Let s be 20/(-25)(-10)/4. Suppose -sh + 4 = 10. What is the units digit of h/(-4)32/12? 2 What is the units digit of ((-351)/36)/((-28)/(-16) + -2)? 9 Suppose 4r - 2 = 6, r = -2n + 60. Let z = -12 + n. What is the tens digit of z? 1 What is the units digit of 5/30 + (-3922)/(-12)? 7 What is the units digit of (-1 + -56)/(9/(-57) + 0)? 1 Suppose -5z + 128 = o, 5o = 3z - 0z + 752. Let a = -86 + o. What is the tens digit of a? 6 Let a = -69 - -62. What is the units digit of (-391)/a - (-39)/273? 6 Let m = -46 - -1. Let p = 10 - m. What is the tens digit of p? 5 Let g = -64 - -34. Let j = g - -92. What is the tens digit of j? 6 Let m be (4 + 56/(-20))-15. Let v = m - -24. What is the tens digit of v/3 - (-21 + 0)? 2 Suppose -2b + 7b - n = 7469, -2b + 5n = -3006. What is the units digit of b? 3 Let u(d) = d3 + 6d*2 - 2d - 11. Let y be u(-6). Let c(x) = 2x + 0 + 8x*2 + y - 8x*2 - 19x*3. What is the units digit of c(-1)? 8 Suppose 2r - 11 - 7 = 0. Suppose -2q + r = q. Suppose 2k - qs - 69 = 2s, 3k = -3s + 114. What is the units digit of k? 7 Let n(v) be the second derivative of 12v + 0 + 5/2v*3 - 1/2v*2. What is the tens digit of n(1)? 1 Let x be 3(1 - 1 - -3). What is the units digit of 489/9 - 3/x? 4 What is the hundreds digit of 746 + 5(-12 - -10)? 7 Suppose 0 = 6y - 0y - 30. Let d be 8/(-5)y/(-2). Suppose 2l + 9 = dp + p, 0 = 5p - 4l - 13. What is the units digit of p? 1 Suppose 0 = -3b - 9, 3x - x - 775 = -3b. What is the hundreds digit of x? 3 Suppose -4a + 105 = -5z + 2z, 3a - z - 80 = 0. Suppose 2k - 69 = -5v, -a = -2k + k - v. What is the tens digit of k? 2 Suppose -4j = i - 7j - 18, 0 = -5i - 5j - 10. Let s(k) = k*3 + 2k*2 - k - 5. What is the tens digit of s(i)? 3 Let y(t) = 2t*2 + 4t + 44. Suppose 2w - 4a = 2, 4w + 2a + 16 = 5a. What is the tens digit of y(w)? 1 Let u(d) = 107d*3 - 3d*2 - 4d + 37. What is the tens digit of u(3)? 8 Let v be 9/(-6) - (-1)/2. Let y(f) = -9f3 - f2 - f - 1. Let q be y(v). Let z = 14 + q. What is the tens digit of z? 2 Suppose 0 = -5d - r + 21, 3r = 5d - 8d + 3. Suppose -5z + 50 = -dw, -w - 1 = -0w. What is the units digit of z? 9 Let x(b) = 4b - 18. Let l be x(12). Suppose 0 = -s - 4s + l. What is the units digit of 5 + 5s/15? 7 Let h(f) be the first derivative of -5f*2/2 + 7f - 3. Let b be h(3). Let i = -2 - b. What is the units digit of i? 6 Let j = 530 - 306. Suppose 0 = 3w - j - 124. What is the hundreds digit of w? 1 Suppose 0 = 3m - 1 + 4. Let c be (-7)/((m - -3)/50). What is the units digit of c/(-14) - (-6)/4? 4 Suppose 3l = -4n - 38 - 2, -2n = -5l - 84. Let h be (l/(-6))/(2/3). Suppose 3t - 3p - 16 = 47, 0 = ht + 5p - 102. What is the tens d	{ "pile_set_name": "DM Mathematics" }
5)/sqrt(7))/sqrt(5)). 160sqrt(17) Simplify 1 + (sqrt(130)/(sqrt(10)-2) + (sqrt(156)-2)/sqrt(12))2 + 3. 341/4 Simplify -3(3(sqrt(132) + (sqrt(132) - sqrt(132)-23) + sqrt(132)))/(sqrt(1200) - (sqrt(1200) - sqrt(1200)21)). -81sqrt(11)/20 Simplify ((-3 + (sqrt(1573) - (sqrt(1573) - sqrt(1573)3)))2 + sqrt(1573) + -2 + -4)2. -374sqrt(13) + 28320 Simplify -2 + (4(sqrt(15)/(-1sqrt(3)) + (sqrt(5) - 6(0 + sqrt(5)))))*2. 2878 Simplify (((sqrt(63)/sqrt(3)-2)/(sqrt(3) + (sqrt(84)/sqrt(4))/sqrt(7)))*2 + -5)4. 8 Simplify (-2(-2sqrt(35) + sqrt(35) + sqrt(35)))/sqrt(7) - (2 + sqrt(40)/(sqrt(8)-2 + sqrt(8))). -2 + sqrt(5) Simplify ((sqrt(513)/sqrt(3) - (-2 + sqrt(304))) + 1(sqrt(931) - (sqrt(931) + 1)))*2. -2sqrt(19) + 20 Simplify -4 + (sqrt(19) + -1 + -1)*2 - (-1 + 0 + sqrt(304)). -8sqrt(19) + 20 Simplify 6(-5(sqrt(7) - ((sqrt(7) - sqrt(35)/sqrt(5)) + sqrt(7) + -5))-4 + -2) + 0. 588 Simplify (3 + -5 + sqrt(1088)-1 + sqrt(1088) + -2 + -4)*2. 64 Simplify (sqrt(24) + 5(sqrt(96)/sqrt(4) - sqrt(24)) + sqrt(24))/sqrt(8) + -3 + sqrt(36)/(sqrt(1200) - sqrt(12)). -3 + 19sqrt(3)/9 Simplify -1((-1(sqrt(190) + sqrt(190)2 + sqrt(190)) - sqrt(190)) + sqrt(190))/(sqrt(450)/sqrt(5)). 4sqrt(19)/3 Simplify 2(sqrt(1700) - ((sqrt(1700)1)2-2 + sqrt(1700))) + (6(sqrt(1700) - (1 + -1sqrt(1700))))*2. -1440sqrt(17) + 251636 Simplify (6(-4 + (-2 + sqrt(425) - sqrt(425))-64))2. 69696 Simplify 0 + (-4 + sqrt(75)13)26. -720sqrt(3) + 4146 Simplify (((sqrt(198)-3 - sqrt(198))/sqrt(6)1)/(-2(sqrt(2156) - sqrt(11))))*2. 12/169 Simplify (((sqrt(260) + sqrt(260)1)3 - sqrt(260))/sqrt(10))/(sqrt(882)3). 5sqrt(13)/63 Simplify (-51(sqrt(190) - 1sqrt(190)))/((sqrt(10) + sqrt(30)/sqrt(3))22). 0 Simplify (sqrt(39)/sqrt(3) + 0 + (sqrt(26)/sqrt(2) + sqrt(13))-6 + -3)-6. 18 + 66sqrt(13) Simplify (sqrt(88)-2 + 2sqrt(22)-2)/(sqrt(450) + sqrt(4)/(sqrt(10)/sqrt(5))). -sqrt(11)/2 Simplify ((sqrt(102)1 + sqrt(102))-6)/((-1sqrt(66))/sqrt(11)). 12sqrt(17) Simplify ((sqrt(13) - (sqrt(13) + sqrt(13) + -2sqrt(13) + -4)) + -2sqrt(325) + sqrt(117) + -1 + -4)*2-4-3. 144sqrt(13) + 5628 Simplify (2sqrt(153) + (2sqrt(119) - sqrt(119))/sqrt(7) - (sqrt(1377) + (sqrt(1377) + -3 + sqrt(1377))-5))2. -2640sqrt(17) + 131873 Simplify (((sqrt(560) - 1sqrt(560)) + sqrt(560))-1)/(((sqrt(55)2 + sqrt(55))/sqrt(11) - sqrt(5))6) + -1. -1 - sqrt(7)/3 Simplify (-3 + ((-5sqrt(210) - sqrt(210) - sqrt(210) - sqrt(210))/sqrt(7))/(sqrt(90)/sqrt(9)1))*2. 48sqrt(3) + 201 Simplify sqrt(50) + -1 + (sqrt(242) - (0 + sqrt(242)))*2 - ((sqrt(2)1 + -1)*2 - (sqrt(2)2 + -2 - sqrt(2))). -6 + 8sqrt(2) Simplify (2(sqrt(91) - sqrt(91)-1 - sqrt(91)) - ((sqrt(91) + (12sqrt(91) - sqrt(91)) - sqrt(91)) + sqrt(91)))/(4sqrt(7)-2-4). 0 Simplify (sqrt(160)/sqrt(4) + sqrt(90)/(sqrt(27)/sqrt(3)))/(sqrt(98)-1-1). 3sqrt(5)/7 Simplify ((-2sqrt(1900)-2)2 + -2(sqrt(1900)-1 - sqrt(1900)))-4. -121600 - 160sqrt(19) Simplify 2 + ((sqrt(343) + sqrt(343) + sqrt(343) + 2 + -4)2 - (sqrt(343) + sqrt(343)-3 + 3)). -70sqrt(7) + 3090 Simplify (-1-1sqrt(136))/(2sqrt(648)) - (sqrt(119)/sqrt(7) + -3 + (sqrt(170)1)/sqrt(10))2. -77 + 217sqrt(17)/18 Simplify ((4sqrt(117)-6 - (sqrt(156)/sqrt(3) - 4-2sqrt(13))) + 3)*2. -492sqrt(13) + 87421 Simplify (-5(sqrt(204)/(sqrt(432) + -1sqrt(432) + sqrt(432)) + sqrt(170)/(sqrt(10) - (sqrt(360)2 + sqrt(10)))))2. 425/144 Simplify ((sqrt(112)25)/sqrt(8))/((2sqrt(128))/sqrt(4)). 5sqrt(7)/4 Simplify (sqrt(1377)-31)2 - (5 + sqrt(153))2-6. 180sqrt(17) + 13461 Simplify (5(-5sqrt(51) - sqrt(51)) + sqrt(51))/(sqrt(192) + sqrt(192) + (sqrt(192) - (sqrt(192)-1 + sqrt(192)))). -29sqrt(17)/24 Simplify 1 + (sqrt(1008) + 1 + 2 - (sqrt(175) + -1 + -2)). 7 + 7sqrt(7) Simplify (sqrt(7) + (sqrt(28)/sqrt(4)2)2 - (sqrt(35)/sqrt(5) + -5))6 + 1. 199 Simplify (sqrt(60)/(sqrt(120)/(sqrt(40)/sqrt(4))) - (3(-2 + sqrt(5)) - sqrt(50)/(sqrt(50)/sqrt(5) + sqrt(10) + sqrt(10))))2. -20sqrt(5) + 449/9 Simplify 4 + 6sqrt(175)3 + (-2(-3 + sqrt(175)) - sqrt(175)). 10 + 75sqrt(7) Simplify (-3 + sqrt(1300)-1-3 + (sqrt(1300) + sqrt(1300)-2-3)2)2. -1020sqrt(13) + 375709 Simplify -3 + (3 + sqrt(3)2 + sqrt(12) + sqrt(3) + 1 + 5sqrt(75)1)2. 240sqrt(3) + 2713 Simplify (4-2sqrt(275) - (sqrt(275)1 + -3))2. -270sqrt(11) + 22284 Simplify (-3 + -2sqrt(396) + -4)2 + 3. 168sqrt(11) + 1636 Simplify 2 + (sqrt(216)/sqrt(128) + -1 + sqrt(432))*2 + 0. -51sqrt(3)/2 + 7851/16 Simplify (0 + (sqrt(847) - 1sqrt(847))-4 + sqrt(847) - (sqrt(28)/sqrt(4) + 4 + -2sqrt(7) + sqrt(7) + 0))2. -88sqrt(7) + 863 Simplify 0 + (1 + sqrt(336)/sqrt(7))*2 + 5. 8sqrt(3) + 54 Simplify (((sqrt(1088) + -1sqrt(1088))3 - sqrt(1088)) + sqrt(1088) + (sqrt(1088) + 0)5)2 + 2 + (sqrt(1088)2)*26. 53314 Simplify (-6-4sqrt(153) + (sqrt(153) - -4sqrt(153))26)-1. -22950 - 72sqrt(17) Simplify (1 + sqrt(252))*2-4 - (3 + sqrt(1008) + 5). -1020 - 60sqrt(7) Simplify -1 + 2 + (sqrt(325))2 + ((sqrt(13) - (-2sqrt(13) + 4 + sqrt(13)))*2 - (0 + sqrt(13))1). -17sqrt(13) + 394 Simplify (-1((-2sqrt(200) + 4 - -5(sqrt(200) + 1)) + -3))*2. 360sqrt(2) + 1836 Simplify 1 + ((2sqrt(112) + 1)2 + (sqrt(112) - 6(sqrt(112) + -2sqrt(112)))2 - -4-2(sqrt(112) + 0)). -16sqrt(7) + 5938 Simplify -5(-5 + (sqrt(882) - sqrt(2))1). -100sqrt(2) + 25 Simplify (sqrt(96)/(sqrt(36)/sqrt(9)))/sqrt(2592). sqrt(3)/18 Simplify ((4sqrt(190)-5)/(sqrt(60)/(sqrt(6) - sqrt(864)))-5)*2. 22990000 Simplify (sqrt(270)/sqrt(5)1)/(3(3sqrt(363) + sqrt(363))). sqrt(2)/44 Simplify ((3 + (sqrt(637) - (sqrt(637) - (sqrt(637) - (-1 + sqrt(637)))) - sqrt(637) - sqrt(637))*2 - sqrt(637) - sqrt(637) - 22sqrt(637)) + 5)6. -420sqrt(13) + 15342 Simplify -2(((3sqrt(343))/sqrt(7) - sqrt(49)) + sqrt(49))/(sqrt(343)-3). 2sqrt(7)/7 Simplify (-1sqrt(65)-1 + (sqrt(65) - (sqrt(65) - -6(sqrt(65) + sqrt(65) + 2sqrt(65)))))/(1sqrt(500)-6). 23sqrt(13)/60 Simplify -1 + sqrt(26)/sqrt(50) + (sqrt(13) - (1 + sqrt(13) + 1 + sqrt(13))) + sqrt(13) + (sqrt(39)/(sqrt(363)-2))2. -1439/484 + sqrt(13)/5 Simplify (0 + sqrt(972) + 1 + sqrt(972) + sqrt(972) + sqrt(972) + 2)21. 432sqrt(3) + 15561 Simplify (2(-1(sqrt(637)-2 + 1) - ((3(-1 + sqrt(637)) - sqrt(637)) + sqrt(637) - (3 + sqrt(637) + -1sqrt(637)))))*2. -280sqrt(13) + 2648 Simplify (5-1sqrt(152)/(sqrt(288)-4))2. 475/576 Simplify (sqrt(99)/(sqrt(44)/sqrt(4)) + (sqrt(9) - (sqrt(9) + sqrt(9) + 3sqrt(144) + sqrt(9))))/(sqrt(15)/(sqrt(20)6)). -156sqrt(3) Simplify (sqrt(2100) + -2sqrt(2100) + sqrt(2100))/sqrt(3) - (-3 + sqrt(112) + sqrt(7)). -5sqrt(7) + 3 Simplify ((4sqrt(420) - sqrt(420))/sqrt(12))/(sqrt(5) - (2sqrt(10))/sqrt(2)). -3sqrt(7) Simplify (-3 + (sqrt(847) - sqrt(847)2))*2 + 3 + ((-2sqrt(847))*2 + 3)-4. -12705 + 66sqrt(7) Simplify sqrt(63) + 5sqrt(63)3 - sqrt(1008)-1-1. 36sqrt(7) Simplify ((-6(sqrt(95) - (sqrt(95) + (sqrt(95) - (sqrt(95) + 12sqrt(95))) + sqrt(95))))/(sqrt(60)/(sqrt(192) + -1sqrt(192) - sqrt(12))))*2. 684 Simplify (3(sqrt(153) + sqrt(153) + (-1 + sqrt(153))1 - 4(sqrt(153) - (1 + sqrt(153) + sqrt(153)))))*22. 2268sqrt(17) + 135108 Simplify (sqrt(49) - 3sqrt(5929))/((sqrt(77)-2)/sqrt(11)). 16sqrt(7) Simplify (sqrt(11) + sqrt(11)-2 + 2 - (0 + sqrt(11) + -2))5. -10sqrt(11) + 20 Simplify (-5 + -2 + 3sqrt(1088)5 + 0)2. -1680sqrt(17) + 244849 Simplify -5(5 + 0 + (-1 + sqrt(1100) + 4)2)2. -11140 - 600sqrt(11) Simplify (-4 + -1 + sqrt(200) + 4)2 - (-4 + 3-2sqrt(200)). 40sqrt(2) + 205 Simplify -2 + sqrt(13) + 2 + -2 - (1sqrt(208)4)*2. -3330 + sqrt(13) Simplify ((sqrt(81)/(-2sqrt(12)))/(sqrt(63)/(sqrt(28)/sqrt(4)) + sqrt(9) + ((sqrt(27)/sqrt(3) - sqrt(9))5 - sqrt(9))))2-6. -9/8 Simplify sqrt(77)/((sqrt(112) + sqrt(7))5) - 4sqrt(33)/sqrt(3)-2. 201sqrt(11)/25 Simplify (sqrt(104)2)/sqrt(8) + sqrt(104)/((sqrt(16)/sqrt(2) - sqrt(8)) + sqrt(8)) - ((sqrt(637) - (sqrt(637) + -5)) + 2). -7 + 3sqrt(13) Simplify 1 + ((1sqrt(1872))2 + 0 - (0 + (sqrt(1872)2)*2)) + -2. -5617 Simplify ((6(1 + sqrt(7)) + -4)-1 + sqrt(14)/sqrt(32) + sqrt(7) + sqrt(7) + -1 + 3)2. 1575/16 Simplify 3(sqrt(1250) - (sqrt(1250) - 3*sqrt(	{ "pile_set_name": "DM Mathematics" }
Let x = 2.5 - -0.5. Let m = x - 2.6. Which is the third smallest value? (a) 0.3 (b) m (c) q c Let o = -62 + 433/7. Which is the third smallest value? (a) o (b) 1/2 (c) -0.3 b Let g = 0.28 + 0.12. Which is the third smallest value? (a) 1 (b) 0.9 (c) g a Let j = -3 - -3.3. Let k = 79/5 + -583/35. What is the third smallest value in j, -1/2, k? j Let r(j) = -j. Let c be r(-6). What is the biggest value in 1/4, -4, c? c Suppose 3t + 2k = -6, -5t - 9 = k + 2k. Let q be 1/(t + (-15)/(-9)). Let y = 12 + -8. Which is the third biggest value? (a) q (b) -3 (c) y b Let g = 0.03 + -10.03. Let l = 6.9 + 0.1. Let w = g + l. Which is the third smallest value? (a) w (b) 0.2 (c) 2/9 c Let z = 37/6 + -35/6. Suppose -1 - 2 = 3w. Let v = w - -1. What is the second smallest value in z, -2/9, v? v Let y = -1.4 - -1.5. Let f be (-2 - 20/(-8))-6. What is the biggest value in y, -4, f? y Let k = 0.8 + -0.4. Let b be (-1)/(-2) + 15/(-6). Let c be (39/(-12) - -3)-1. What is the smallest value in c, b, k? b Let u be (2 - (-14)/(-6))/(-1). Suppose 3d - d = 10. What is the second biggest value in u, d, 4? 4 Let o = 1/5 - 2/5. Which is the biggest value? (a) o (b) -2 (c) 3 c Suppose -k = 3l - 24, 5k - 6l + 2l = 25. Suppose -3c = -2c, -5c - k = 3z. What is the second smallest value in -0.2, 5, z? -0.2 Let z be (-1)/575/(-20). What is the smallest value in -0.5, -3/4, z? -3/4 Suppose 7 = 2x - 0z + 3z, 0 = -4x + 2z + 22. Which is the third smallest value? (a) -1 (b) x (c) -2/13 b Suppose 9r - 6r - 15 = 0. Which is the biggest value? (a) r (b) -3/5 (c) -6/5 (d) -1 a Let j = -5 - -23. Let g = -14.5 + j. Let d = -4 + g. Which is the biggest value? (a) d (b) -3 (c) -1/4 c Let j = 4 - 5. Let z = -0.5 - j. Which is the biggest value? (a) -4 (b) z (c) 4 c Let z = -1.5 - -1.41. Which is the smallest value? (a) 5 (b) 0 (c) z (d) 0.5 c Let c = -15.5 + 16. What is the smallest value in c, -2/7, -1? -1 Let l be 3/6-3(4 - 2). What is the second biggest value in 4, 4/5, 0.3, l? 4/5 Let m = 3 + -4. What is the second biggest value in m, -0.4, -5? m Let m = 11 - 6. Let h = m + -5.2. Let u = 4 + -4.4. Which is the second biggest value? (a) -5 (b) h (c) u c Let h = 36 + -33. Which is the second biggest value? (a) 1 (b) h (c) -11 a Let p = -46.4 - -46. Which is the second biggest value? (a) 0 (b) p (c) -4 b Let i = 41.2 + -41. Let l(k) = k*2 - 3k. Let f be l(4). Suppose 0 = n + fn - 4s + 13, -5n = 3s - 1. What is the second biggest value in n, -2, i? n Let n = -47 - -39. What is the fourth biggest value in -0.4, -3/8, n, 0.3? n Let h be 54 + -1 - (2 + -4). Let t be h/10 + 1/(-2). Suppose 2l + 8 = 3j, 2 = tj + 5l - 3. Which is the biggest value? (a) j (b) 4 (c) -4 b Let g = -24.6 - -25. What is the second biggest value in g, -2/7, -3, 0? 0 Suppose 7j - j = 30. Suppose -2 - 7 = 3n. Let g = n + j. Which is the second biggest value? (a) g (b) -1/5 (c) -1/2 b Let q = -1.1 + 0. Let i = q - -0.9. Which is the biggest value? (a) 2/15 (b) 0 (c) i a Suppose 23t - 24t - 2 = 0. Which is the smallest value? (a) 5 (b) -2/5 (c) 0 (d) t d Suppose 5l = 2k - 1, -2l + 7l + 15 = 0. Let s = 4 + k. Let x be (-20)/36(-4 - 1) + -3. Which is the third biggest value? (a) s (b) x (c) 1 a Let h = 8.23 - 8.2. What is the third biggest value in h, -3/4, -1/7? -3/4 Let h(q) = 2q + 6. Suppose 5s = 70 - 5. Suppose 4n - f = -s, -n - 5f - 27 = 2n. Let i be h(n). What is the second smallest value in 0, -6/7, i? -6/7 Let f = 46.5 + -47. What is the fourth biggest value in -0.2, f, 13, -1? -1 Let d = 1 + -0.9. Let w = -19 + 22.1. Let h = d - w. Which is the smallest value? (a) -5/3 (b) -2 (c) h c Let h = -163/4 - -41. Let o be 69/(-21) - (0 - 3). Which is the third biggest value? (a) -7/3 (b) o (c) h a Let b = 14 - 8. Let j = -7 + b. What is the third smallest value in j, 3, 2? 3 Let j = -34 + 39. What is the second smallest value in 4, 2, j, 0? 2 Let w = 0.44 - 0.04. Let f = 2 - 1.3. Let d = 0.3 - f. What is the second smallest value in w, d, -0.3? -0.3 Let u be 2 + 23/(-5) - -2. Let t(i) = i*2 - 2i - 1. Let b be t(5). Let z be (-8)/b + 2/7. What is the smallest value in z, -1, u? -1 Suppose 3 = -x - 3s, -2x + 4s + 14 = -0s. Suppose 3 = -xf + 2f. Let j be (6/26)/(f/(-2)). Which is the biggest value? (a) -2/11 (b) j (c) 2/5 c Let s = 1/4 + 1/4. Which is the second biggest value? (a) 0.2 (b) s (c) 3 b Let j = 18 - 27. Which is the third smallest value? (a) j (b) 3 (c) -0.4 b Let r = 67871/2958 - 660/29. Let m = r + -6/17. What is the second biggest value in m, -0.5, 0.2? m Let o be 2(-2)/(14/9). Let u = -20/7 - o. Which is the second biggest value? (a) 2/11 (b) -2/15 (c) u b Suppose -60 = -0g + 2g. Let d be (-6)/5g/24. Which is the third biggest value? (a) d (b) -1 (c) 5/2 b Let v(y) = -3y. Let a be v(5). Let t be (14/49)/(a/(-7)). Let h = -9 - -11. What is the second smallest value in 2/3, h, t? 2/3 Let r(v) = 15v - 62. Let s be r(4). What is the biggest value in 3, -0.06, 2/3, s? 3 Let y = -1.21 + 0.21. Which is the third biggest value? (a) 3 (b) 1 (c) y c Let i = -0.1 + -0.02. Let h = i - -1.12. Let d = 6.4 - 6. What is the second biggest value in 0.1, d, h? d Let d = 18.3 + -18. What is the fourth biggest value in 6, -1, -5, d? -5 Let r = 0.343 - 0.043. What is the third smallest value in -2, -0.5, r? r Let i = -0.06 - -0.09. Let r = 0.27 + i. Let t = -6 - -1. Which is the biggest value? (a) 3 (b) r (c) t a Let j be -16(36/16 - 3). Suppose -3z = -1 - 5. Suppose -j = -2x - z. What is the second biggest value in -2/3, x, -0.4? -0.4 Let w = 5 + -10. Let h = 21/32 - -3/32. Let o = -1075/6 - -180. What is the third biggest value in h, w, o? w Suppose 6d - 5d = 1. Suppose -h = -3 + d. Let j = -2 - -7. What is the third smallest value in j, 0.5, h? j Let n = 0.17 + -0.57. Which is the smallest value? (a) 9 (b) n (c) 0 b Let p = -117 - -317/4. Let b = p + 38. What is the third biggest value in 3, b, 0.5? b Suppose -5c = -11 - 9. Let b be -2(2 - 14/c). Let r be ((-2)/8)/(b/6). What is the third smallest value in r, -0.4, 0.1? 0.1 Let l = -5.6 - -4.6. Which is the biggest value? (a) l (b) 5 (c) -3 b Suppose 7x = 11x + 12. What is the second biggest value in x, 5, -2/5? -2/5 Let a = -2.5 + 3. Let b = 3 + 8. Let m = 8 - b. What is the third smallest value in -0.4, a, m? a Suppose -5j = -3b + 16, -3b + 3j + 1 + 11 = 0. Let r = 23 + -6. Let t = -12 + r. What is the third biggest value in 2/19, b, t? 2/19 Let k = 17 - 12. Which is the smallest value? (a) k (b) -5 (c) -0.3 b Let i = -2.2 - -1.2. What is the third smallest value in 0.5, i, -1/3? 0.5 Let z be (0 + 4)(1 + 0). Suppose -zx + 7 = -1. Let o = 3.97 + 0.03. Which is the second smallest value? (a) o (b) x (c) -2/11 b Let g = 0.08 + -4.08. Let n = -10.8 - -11. Which is the second smallest value? (a) n (b) g (c) -0.1 c Let v = 1 - -1. Let o be (-12)/(-21) - 1/1. Let i = 15.2 - 15. What is the biggest value in o, v, i? v Suppose s + 28 = j, s + 0s = 0. Let w be j/8 - 1/(-2). Suppose wu = 5u. What is the biggest value in u, -3, 2/5? 2/5 Let s be (-75)/(-99) + (-6)/9. Let y = 8 + -13. What is the third biggest value in s, -1, y? y Let n = -0.0042 + 0.0042. Suppose 5d + 2r = -11, -2d - 2d = 3r + 6. What is the second smallest value in d, n, 2? n Let d = 6 - 5.7. Let r = 5 - 4.98. Let x = r - 0.32. What is the third biggest value in 4, x, d? x Let q = -3 + 2. Let g = 56/75 + -2/25. Let i be (1/(-1))/1-3. Which is the third smallest value? (a) i (b) q (c) g a Let i = -0.7 - 0.3. Let d = 3 - 2.5. Let f = 0.3 - d. Which is the third biggest value? (a) f (b) i (c) -1/8 b Let q = 13.8 + -17. Let d = q + 1.2. Let x be 1 + 0 - (5 + -1). What is the second biggest value in 4, d, x? d Let m = 0.95 - -0.05. Let q = -0.2 - 0.8. Let g = q - m. What is the smallest value in 4, -0.1, g? g Let r = -2.4 - -3.4. What is the third biggest value in 0.1, r, -1/2, -2? -1/2 Let q = 175 - 4023/23. Which is the biggest value? (a) -3/2 (b) -2/7 (c) q c Let d = 5 - 4.77. Which is the third smallest value? (a) -1/4 (b) -1/2 (c) d c Let g = -0.8 + -2.2. Let t = 15 + -14. Let f = 0 + 0. Which is the third biggest value?	{ "pile_set_name": "DM Mathematics" }
th respect to h. 16h3 Let s be 15/(-12)(-8)/2. Let i(w) = -7w + 11 - 3w - sw. Let b(v) = -8v + 6. Let j(d) = -7b(d) + 4i(d). What is the first derivative of j(p) wrt p? -4 Let z(a) be the second derivative of -31a8/56 - a6/10 - 55a4/4 + a3/6 + 16a + 18. What is the third derivative of z(h) wrt h? -3720h*3 - 72h Let t(r) be the third derivative of r*7/70 + 9r*4/8 - 25r*3/6 + 4r*2. Let u(a) be the first derivative of t(a). Differentiate u(l) with respect to l. 36l*2 Let d = 14 + -16. Let b = d - -9. Find the third derivative of 2o*6 + 2o*2 + 2o*2 - bo*6 wrt o. -600o*3 Let y(m) be the third derivative of 2m*7/35 - 17m*5/10 + 16m*2. Find the third derivative of y(i) wrt i. 288i What is the first derivative of -109 - 10y4 + 11y*3 + 357 + 38 + 328 wrt y? -40y*3 + 33y*2 Let h = 413/24 - 135/8. Let n(b) be the second derivative of 0 + 1/6b*3 + 0b*2 - 6b - hb4. Find the second derivative of n(t) wrt t. -8 Let h(t) = -46t*2 + 6t - 35. Let w(l) = 45l2 - 5l + 35. Let o(u) = -5h(u) - 6w(u). Find the first derivative of o(m) wrt m. -80m Let q be 32/(-288) + 2/18. Let s(b) be the first derivative of 2b*3 + 0b - 5 + qb5 + 2/3b*6 + 0b*2 + 0b*4. Find the third derivative of s(c) wrt c. 240c*2 Let i be (-2)/15 + 1/(75/160). What is the third derivative of -11h*3 - 32h*3 - 172h*2 + 175h*i wrt h? -258 Let p(x) = 5x*2 - 5x + 7. Let y(n) = n3 - n2 + n + 2. Let o(f) = -p(f) - 5y(f). Find the first derivative of o(c) wrt c. -15c2 Let w(p) = p2 + 4p. Let c be w(-4). Suppose c + 3 = f. Find the third derivative of fd*2 + 2d*3 - 4d*2 + 5d*2 wrt d. 12 Let g be -3(-3)/9 + 2. Suppose v + 2a = -8, -5a = -gv + 14 + 17. What is the second derivative of x4 + vx*5 + 3x + 0x - x4 wrt x? 40x*3 Let t(y) be the first derivative of 5/6y*3 - 5y + 6 + 1/2y2. Let h(v) be the first derivative of t(v). Differentiate h(u) wrt u. 5 Let t be 3(-5)/102. Let n(u) = 22u - 16. Let a(h) = 44h - 31. Let y(x) = ta(x) + 7n(x). Find the first derivative of y(p) wrt p. 22 Let d(c) be the first derivative of 0c*3 + 0c + 12 - 23/2c2 - 31/4c*4. Find the second derivative of d(h) wrt h. -186h Let f(r) be the third derivative of -227r7/210 - 17r4/2 + r3/3 + 49r2 - 5. What is the second derivative of f(k) wrt k? -2724k*2 Suppose 5q = -5z, 0 = -3z - 2z - 10. Let s be 1 - q/4-2. Find the second derivative of -5u3 - 107u*s + 107u*2 - 5u wrt u. -30u Let n(c) = 44c + 71. Let q(i) = -47i - 71. Let l(z) = -5n(z) - 6q(z). Find the first derivative of l(b) wrt b. 62 Let i(p) = -6p2 - 1. Let m(v) be the third derivative of v3/6 - 6v2. Let r(h) = i(h) + 3m(h). Differentiate r(x) with respect to x. -12x Let m(s) = 109s*3 - 5s*2 + 14s + 5. Let z(r) = 53r3 - 3r*2 + 7r + 3. Let n(t) = 3m(t) - 5z(t). What is the second derivative of n(l) wrt l? 372l Let f(q) = 3q - 2. Let t(n) = -413n + 360. Let k(z) = 2f(z) + t(z). What is the derivative of k(y) wrt y? -407 Let t(v) be the first derivative of v5/2 - v2 - 3v + 7. Let y(w) be the first derivative of t(w). Differentiate y(a) with respect to a. 30a*2 Suppose 0 = 2y + 4y - 48. What is the second derivative of 9z - z*2 + 4z - yz wrt z? -2 Suppose -12 = -5v + 2v. Suppose 0z = 2z - v. Find the third derivative of -14b*6 - 4b*2 + 9b*z - 3b*2 - 4b*2 wrt b. -1680b*3 Let r(k) be the third derivative of -9k*6/10 + 3k5/10 + k3/2 + 3k2 - 2. What is the third derivative of r(y) wrt y? -648 Let t(z) = -937z*2 + 166z - 4. Let y(c) = -624c2 + 110c - 3. Let h(n) = -5t(n) + 7y(n). Find the second derivative of h(f) wrt f. 634 Let n(r) = -r*3 - 7r*2 + 8r. Let f be n(-8). Suppose 0 = 4g - 20 - f. What is the second derivative of 3sg - s5 + s*5 - 7s wrt s? 60s3 Let a(s) be the second derivative of s7/6 - s5/5 + 39s*4 + 285s. Find the third derivative of a(o) wrt o. 420o2 - 24 Differentiate -16 + 120f*2 - 55f*2 - 63f*2 + 4f*3 wrt f. 12f*2 + 4f What is the first derivative of 101d4 + 1079d*2 + 36d*4 + 576 - 1079d*2 wrt d? 548d*3 Let t(z) be the second derivative of 275z*3/6 - 67z*2 + 60z + 1. What is the derivative of t(c) wrt c? 275 Let p(s) = 31s4 + 3s*3 - 19. Suppose 0 = 5q - 4q - 4. Let z(y) = 31y*4 + 4y*3 - 19. Let w(v) = qp(v) - 3z(v). What is the derivative of w(x) wrt x? 124x*3 Let g(n) = -598n*2 + 8n - 58. Let l(q) = 595q2 - 9q + 59. Let a(d) = -5g(d) - 4l(d). What is the second derivative of a(w) wrt w? 1220 Suppose -3 = d - 7. Suppose -dx = 3f - 11, 0 = -6x + x - f + 11. What is the first derivative of 1 + xr*4 - 2 - 1 wrt r? 8r*3 What is the third derivative of -12917 + 334p*2 + 12917 + 407p*3 wrt p? 2442 Let i(w) = 8w - 1. Let u be i(1). Find the second derivative of 4l3 - 11l*3 + ul + 2l3 + 3l*3 wrt l. -12l Let x be (19 + -9)/(-2 + 4). Let n(p) be the first derivative of 0p - 2p*3 + x + 5/2p*2. What is the second derivative of n(m) wrt m? -12 Find the first derivative of 498f*4 - 240f*4 - 214f*4 + 9 wrt f. 176f*3 Let d(g) be the second derivative of 7g6/15 + g3/6 - 51g2/2 + 2g + 24. What is the second derivative of d(p) wrt p? 168p2 Suppose 0 = -5c + 20, 3u - 2c + 7 = 2c. What is the first derivative of -6 - 13q*3 + 32q*3 - 15q*u wrt q? 12q*2 What is the third derivative of 75u*2 + 121u*2 - 129772u*3 + 112u*4 + 129772u*3 wrt u? 2688u Let t(y) be the second derivative of 30y3 + 159y*2 + 18y - 2. What is the derivative of t(b) wrt b? 180 Suppose 3u = 2u + 6. Suppose 0 = w - uw + 95. What is the second derivative of 11s - ws + 10s - 5s4 wrt s? -60s*2 Suppose 0 = -2l + 7l - 60. Find the third derivative of lr*6 - 6r*3 - 11r*2 + 5r3 + r3 wrt r. 1440r3 Let z(h) be the first derivative of 37h*4/4 - 10h3/3 + h2/2 - 110. Find the third derivative of z(q) wrt q. 222 Let s(d) = 10d2 + 2d - 47. Let f(y) = -20y2 - 5y + 93. Let m(u) = -2f(u) - 5s(u). Differentiate m(g) wrt g. -20g What is the second derivative of -37o*3 + 23o*3 + 36o - 131o wrt o? -84o Suppose -2b = -2d - 5b - 5, 3b - 5 = -4d. Let j = d + -2. What is the derivative of 0 + 0 + 1 + jy wrt y? 3 Let q(j) be the second derivative of 0j2 - 11/42j*7 + 23/12j*4 + 0 + 0j*5 + 0j*6 - 10j + 0j3. What is the third derivative of q(g) wrt g? -660g2 Let q(g) be the first derivative of g4/12 - 13g3/6 + 4g*2 - 5. Let l(n) be the second derivative of q(n). Find the first derivative of l(a) wrt a. 2 Let v be (3/3 + -2)-2. What is the first derivative of -13 + vo - 6o*2 - 2o wrt o? -12o Suppose 5o = 7r - 5r + 13, -4r - 11 = -5o. Differentiate -123 + 140 - 22i4 + oi*4 with respect to i. -76i3 Let t(w) = -w2 + 6w. Let s be t(3). Suppose -3l - 18 = -2v + 1, -v + 2l = -11. What is the second derivative of -4h - sh*4 + vh*4 + 2h wrt h? -48h2 Let q(n) = n + 9. Let t be q(20). What is the third derivative of -57y*4 + 28y*4 - 7y*2 + 32y*6 + ty*4 wrt y? 3840y*3 Let t(o) = -14o*4 - 12o*2 - 3. Let l(i) = -7i*4 + 4i*4 - 1 + 4i*4. Let w(n) = 3l(n) - t(n). Find the third derivative of w(m) wrt m. 408m Let i be (1 - (-65)/39) + -1 + -1. Let h(v) be the third derivative of 0v + 0 - 4v2 - 1/20v*5 + iv*3 + 0v*4. Differentiate h(l) wrt l. -6l Suppose 4w + 7 - 22 = -3n, 0 = 5n + 5w - 20. Let y = 4 - n. Find the third derivative of -2g4 + yg - 8g2 - 2g - g wrt g. -48g Let v(s) be the first derivative of -299s*4/4 + 617s - 388. Differentiate v(k) wrt k. -897k2 Let d(p) be the second derivative of -73p*3/6 - 17p*2 - 31p. What is the first derivative of d(n) wrt n? -73 What is the derivative of -63 + 396p2 - 284p*2 + 26 wrt p? 224p Let f(n) be the second derivative of -59n6/30 - n5/10 + 7n*4/12 - 9n*2/2 - 33n. What is the third derivative of f(b) wrt b? -1416b - 12 What is the derivative of -28g - 22 + 170 - 26g - 16 wrt g? -54 Let q(g) = 13g*2 - 16. Let u be (6/18)/((-1)/18). Let x(l) = 28l*2 - 33. Let j(h) = ux(h) + 13*q(h). What is the first derivative of j(p) wr	{ "pile_set_name": "DM Mathematics" }
2680470497 prime? False Is 3538013753 a prime number? True Is 41748483937 a composite number? True Is 118668793 prime? False Is 103833007651 a prime number? False Is 13694105119 a composite number? True Is 99598611221 prime? True Is 9755344657 a prime number? False Is 29922501673 composite? False Is 212448127 a prime number? False Is 79957123 prime? True Is 903021709 a composite number? True Is 1298813683 a composite number? False Is 88261963 prime? True Is 357349139 a composite number? True Is 25183573871 prime? False Is 3135896191 a composite number? True Is 65548169 a composite number? False Is 17452879451 prime? False Is 50258698921 a prime number? False Is 1040971709 a prime number? True Is 38622889 a prime number? True Is 74248394183 prime? False Is 496275541 a composite number? True Is 6865054499 a prime number? False Is 1015014943 composite? False Is 43503548161 composite? True Is 3209724263 a prime number? False Is 323545279 a prime number? False Is 3736943447 composite? True Is 2833405829 a prime number? True Is 26096673035 a composite number? True Is 1000808579 prime? True Is 135986495591 a prime number? False Is 35327319178 prime? False Is 18140829737 a composite number? True Is 3436937279 a prime number? True Is 1414787341 a prime number? False Is 6829227397 composite? False Is 5986344751 prime? True Is 16196539363 composite? False Is 18958729 a prime number? True Is 8621745191 a composite number? True Is 1205863693 prime? False Is 70222034153 a composite number? False Is 5446723411 a composite number? False Is 1601195329 a composite number? False Is 5893778897 a prime number? False Is 180143334049 a prime number? False Is 43871857 a composite number? False Is 1106865559 a composite number? False Is 70705748963 a composite number? True Is 484598671 a composite number? True Is 716953141 a composite number? False Is 64499599 prime? True Is 1052118646 a composite number? True Is 13546119047 prime? True Is 27188140979 prime? True Is 25754560679 prime? True Is 5968698949 prime? False Is 18503596721 composite? True Is 4222808419 composite? False Is 1018238269 prime? True Is 1056708493 a prime number? False Is 57464579461 prime? True Is 6712745597 prime? True Is 2272846639 a composite number? True Is 2926100839 prime? True Is 97774840697 a composite number? False Is 3396728693 a prime number? True Is 1755236515 a composite number? True Is 16274569 a prime number? True Is 6184435099 a prime number? False Is 12014159359 a prime number? True Is 10827540791 composite? True Is 1137225223 a prime number? False Is 1172296942 prime? False Is 321190381 composite? True Is 11152169279 a composite number? False Is 144764456513 composite? False Is 92013195671 a composite number? False Is 746369353 a prime number? False Is 70262549801 a prime number? True Is 1822588801 a composite number? True Is 3422705383 a prime number? False Is 13951842661 prime? True Is 1405793999 a prime number? True Is 18576127519 a prime number? False Is 641422857 a composite number? True Is 6607221829 a composite number? True Is 365378411 composite? False Is 87207439367 a prime number? True Is 870747307 prime? False Is 17633068361 composite? True Is 437102683 composite? True Is 29969656291 a composite number? False Is 1808560597 prime? True Is 12515123419 a composite number? False Is 254092051 composite? False Is 1237019789 a prime number? True Is 591448843 a composite number? False Is 31411932947 a prime number? True Is 3865310751 a prime number? False Is 307141729 prime? True Is 2031654019 composite? False Is 6569132797 prime? False Is 3429389053 prime? False Is 21172120573 a prime number? False Is 11732423799 a composite number? True Is 37223520131 a composite number? True Is 19251625849 a composite number? False Is 48554843 prime? False Is 1450619441 a composite number? False Is 10576080701 a composite number? False Is 3582075193 a prime number? True Is 27319694867 a prime number? True Is 21552484865 prime? False Is 833095547 a composite number? False Is 2329247083 a prime number? False Is 30049788359 a prime number? True Is 4226213729 a prime number? False Is 21994907945 prime? False Is 413131853 a composite number? True Is 7628308541 a prime number? False Is 2671053163 a composite number? False Is 2861591093 composite? False Is 3398544623 a prime number? True Is 261608323 prime? True Is 3208506211 composite? False Is 1601996251 a prime number? True Is 2907280067 prime? True Is 15891515993 a composite number? False Is 37304574629 composite? True Is 739567523 prime? True Is 38703195151 prime? False Is 10454058269 prime? False Is 859595431 composite? False Is 669372623611 prime? True Is 1325027801 a composite number? False Is 2108330449 composite? False Is 1703110793 a prime number? False Is 1109709469 a prime number? False Is 8081586727 a composite number? False Is 217673191 a prime number? True Is 3105931747 a prime number? False Is 187619749 prime? True Is 1140594617 a composite number? True Is 402342121 a composite number? True Is 20332424341 a composite number? False Is 30270781291 composite? False Is 23453422151 prime? True Is 12614903867 a composite number? True Is 120350987 a composite number? True Is 429351121 composite? False Is 17335047887 a composite number? False Is 6430702783 prime? True Is 7271542171 prime? True Is 99357569 a composite number? False Is 560409767 composite? False Is 1841202217 a prime number? False Is 77123243189 a composite number? False Is 2315053213 prime? False Is 105839177839 prime? False Is 834350537 composite? True Is 4331652685 prime? False Is 414409467 prime? False Is 43251519965 prime? False Is 103249983869 composite? False Is 17289094457 a prime number? False Is 634221053 composite? False Is 152305211 composite? False Is 3631929881 composite? False Is 11197011113 prime? False Is 86879362991 a composite number? True Is 1547300251 a prime number? False Is 193157243 composite? True Is 22682630207 a prime number? True Is 8624641609 prime? True Is 129572921 composite? True Is 2740053221 a composite number? False Is 7584701303 composite? False Is 671323319 a prime number? False Is 21213295639 prime? False Is 198299939 a composite number? False Is 28451061481 prime? True Is 21938515889 a composite number? True Is 14727712487 prime? False Is 11844520607 prime? True Is 5855060909 composite? False Is 5100144629 composite? True Is 137598816703 prime? True Is 7047535129 prime? False Is 124792736701 a prime number? False Is 679833659 a prime number? False Is 80888654995 composite? True Is 512690459 composite? False Is 3072435767 a composite number? False Is 4386120373 a prime number? True Is 1048438231 a prime number? True Is 202741937 composite? True Is 97279899677 composite? True Is 154885994 a prime number? False Is 4661508953 a composite number? True Is 2176208407 prime? True Is 2214407449 composite? False Is 778638169 a composite number? True Is 933202201 a prime number? True Is 7868816639 composite? True Is 52099039 prime? True Is 19894166521 a prime number? True Is 47272196609 prime? False Is 57757465063 prime? False Is 74170265927 a composite number? False Is 1117699411 a composite number? True Is 5486962699 a prime number? False Is 550281133 a prime number? False Is 115805527 composite? False Is 673414363 prime? False Is 47859777409 composite? True Is 10696688857 a composite number? False Is 938595127 a composite number? False Is 15048499121 a prime number? False Is 21888750067 a prime number? True Is 188173115303 a prime number? True Is 107041586681 prime? True Is 79243497371 prime? True Is 255882413 a composite number? False Is 4970278273 a composite number? True Is 4650032861 composite? False Is 16381169491 a composite number? True Is 3674439761 composite? False Is 339529931 composite? True Is 1475790949 composite? False Is 12725837909 a composite number? False Is 1939762189 a prime number? True Is 534837211 prime? False Is 22897229359 composite? True Is 4781460349 prime? False Is 929764859 a prime number? True Is 144152479 composite? False Is 575187031 a composite number? False Is 76026610637 a prime number? False Is 7143492229 composite? True Is 18767575427 composite? True Is 1713360583 composite? True Is 54566144419 prime? T	{ "pile_set_name": "DM Mathematics" }
(-1))? True Let u(o) = 12o. Let g(n) = 35n. Let k(y) = -5g(y) + 14u(y). Let j(m) = -m + 1. Let b be j(5). Is 13 a factor of k(b)? False Suppose -3l = 4 - 16. Suppose -ly + 190 = 5r, 15 = 4y - 7y. Is 21 a factor of r? True Suppose -3g + 53 = 3s - 10, 0 = 5g + 3s - 101. Let p = 30 + g. Let t = p + -21. Is t a multiple of 18? False Suppose 0i = 2t - 2i - 70, -2t - i + 70 = 0. Does 13 divide t? False Let u(l) = l3 + 5l*2 + 2. Let t be u(-4). Let j = -7 + t. Is 3 a factor of j? False Suppose 3i = -2u + 235, -4u + i + 596 = u. Does 10 divide u? False Let w(q) = q*2 - q + 1. Let v(n) = -3n*2 + 12n + 1. Let i(f) = -v(f) - 2w(f). Is 8 a factor of i(11)? True Suppose 0 = -3q, -5n + 3q - 7q = -820. Does 37 divide n? False Suppose -41 = -7l + 211. Is l a multiple of 6? True Let u = -177 - -313. Let k = u - -139. Suppose -2a - k = -7a. Is a a multiple of 25? False Let m be -2 - (2 + 1-3). Let t be 136/20 + m/(-5). Suppose -5p + 27 = t. Does 2 divide p? True Let m be (-2)/(-8) + (-7)/(-4). Let v = m - 11. Is 4 a factor of (-3)/v + (-46)/(-6)? True Let m = 10 + -2. Let l be (m - 2)/(21). Suppose -lw = -82 + 7. Does 14 divide w? False Let x(j) = 2j2 - 11j + 4. Suppose 0 = 2g - 4r - 28, 0g - 5r - 47 = -4g. Is 11 a factor of x(g)? True Suppose 1968 = -2f + 10f. Is 22 a factor of f? False Let t = 63 + 25. Does 7 divide t? False Let l(c) = 8c + 3. Let s(u) = 12u + 4. Let y(o) = 7l(o) - 5s(o). Let b be y(-1). Suppose -x + 50 = bi, -2x - 4 = 5i - 49. Is 4 a factor of i? False Let x(s) = s + 5. Let b be x(-5). Suppose b = -5r + 4g + 25, -8 = -r + g - 3. Let d = 3 + r. Is d a multiple of 8? True Suppose -2s = 2s - 88. Is 11 a factor of s? True Suppose -2l + 8 = 6. Let d(g) = 38g + 1. Is 26 a factor of d(l)? False Let m = -4 - -6. Suppose 2i + z - 179 = 0, -i - 5z + 69 = m. Suppose 2c - 5l = 53, 8c - 3c = -l + i. Is 9 a factor of c? False Suppose 0z + z + 1 = 0. Let u(i) = -51i3 + i2 + i. Let s be u(z). Suppose -2o + s = -15. Is o a multiple of 11? True Suppose -2f + 3f = 0. Suppose 2o - 5t = -fo + 7, o = 3t + 1. Is o a multiple of 16? True Let q(m) = -m2 + 2m + 1. Let u be q(-3). Let a = 46 + u. Suppose -4d + 2d = 4v - a, 0 = 5v + 3d - 41. Does 7 divide v? True Let u be 4 + (-3)/62. Is 3/((-3)/(-14)) + u a multiple of 17? True Let g be (-1 + 0)01. Let l be (-2 + 3)/(2/24). Suppose 3d = -gd + l. Does 4 divide d? True Suppose -3z - 5w = -221, -2w = -5z - 94 + 452. Is 12 a factor of z? True Is (-3)/18 + 481/6 a multiple of 10? True Suppose 3q - 209 = 349. Suppose 3k - q = 9. Is k a multiple of 27? False Let q(o) = -3 + 0o + 0o - o*3 - 2o - 3 - 5o2. Let r be q(-5). Suppose -r = -k - 1. Is k a multiple of 3? True Suppose 212 = 3p - 430. Is p/9 - (-10)/45 a multiple of 12? True Let n(q) = -q*2 - 6q + 7. Let a be n(-5). Let s = 39 - a. Is s a multiple of 7? False Let x(v) = 5v - 3. Suppose k = -1 + 8. Is x(k) a multiple of 16? True Suppose 2z + 9 = 3h + 2h, 5z = 3h + 6. Suppose -2i + zj = -57, -i + 4i - 3j = 87. Suppose 0 = c - i + 9. Does 9 divide c? False Let w(g) = -2g - 7. Does 9 divide w(-11)? False Is (-2 - -3)/((-3)/(-42)) a multiple of 9? False Let s = 59 - 41. Does 3 divide s? True Let v be (-2)/2 + (-6 - 8). Is v/(-25) + 127/5 a multiple of 13? True Suppose 2i + 4b - 468 = 0, -b = -5b + 8. Suppose -14h + 9h + i = 0. Does 12 divide h? False Suppose -i - 3i + 2u = 38, 2i - 3u + 13 = 0. Let n = 15 + i. Is ((-27)/6)/((-2)/n) a multiple of 4? False Let r(j) = j + 4. Let h be r(0). Suppose 0b - i = hb - 40, 0 = b - 2i - 10. Does 4 divide b? False Let n(w) = -5w - 16. Let t be n(-11). Let i = -11 + t. Is i a multiple of 21? False Suppose -5x = 2i, 5i + x = 4i + 3. Suppose 64 = 4s - 52. Suppose iu = s + 21. Is 5 a factor of u? True Is (1 - -13)/((-2)/(-4)) a multiple of 7? True Suppose -2z - 560 = -9z. Is 10 a factor of z? True Let l(r) = 2r2 - 5. Let u be l(-4). Is 16 a factor of 438/u - 2/9? True Let n = -5 + 5. Suppose nj = 3x + 2j - 12, -5x + 16 = 2j. Suppose -u - 34 = -xu. Does 13 divide u? False Let h(y) = -y + 5. Let b(x) = -2x + 5. Let m(o) = 5b(o) - 6h(o). Is 4 a factor of m(-4)? False Let b(k) = -4k - 9. Is b(-6) a multiple of 8? False Suppose 5m - 374 = -5f + 3m, 365 = 5f + 5m. Is 19 a factor of f? True Let k = 97 + -18. Does 16 divide k? False Suppose -6h + 380 = -h. Does 19 divide h? True Let y(w) = w2 - 9w + 2. Let s be y(12). Suppose -94 = -3q + s. Does 9 divide q? False Is 9 a factor of (-45)/(-2) - 1/(-2)? False Let q(y) = y2 + 8y - 11. Let f be q(-9). Is 8 a factor of (1 - -19)f/(-5)? True Let a = 2 + -2. Suppose d - 2z - 8 + 1 = 0, a = -4d - z + 19. Does 3 divide d? False Let k be -121/(-6)-8. Let d = -13 - k. Is 15 a factor of d? True Suppose -7z + 4w + 23 = -2z, 3z - 4w = 9. Is z/(-4)(-4 + -4) a multiple of 14? True Let g be 2(0 - (-1 + 0)). Suppose 0 = -gj + 9 + 19. Does 7 divide j? True Suppose -2m = -m - 5. Suppose -o - 2o + 4d = -84, -4o + md = -112. Is 14 a factor of o? True Is 9/(46/104) a multiple of 11? False Suppose 0 = -v + 4q - 7, -3q + 7 = v. Is (-6)/(-3) + v - -3 even? True Suppose -4i = i. Suppose 1 = y - i. Is 21 + -1 + 2/y a multiple of 18? False Let v(f) = -f*3 - 5f*2 + 2. Let h be v(-5). Suppose 4u + c = 157, -2c + 119 = hu + u. Is 15 a factor of u? False Let k(p) = -5p3 - p2 - p. Let m be k(-1). Suppose 6 = mz - 4. Suppose n - 4x = -3x + 5, 0 = n - 2x - z. Is 4 a factor of n? True Let u(r) = 12r + 8. Is u(8) a multiple of 20? False Suppose 0a - a = -8. Is 2 a factor of a? True Let k(h) = -2h*3 + 2h*2. Let n be k(2). Let g = n + 11. Suppose 4m - 4q - 60 = 0, 5m + 5q = 62 + g. Is m a multiple of 13? False Let a(l) = -l2 + 9l + 7. Let b be a(8). Suppose i - 4i + b = 0. Is i a multiple of 3? False Suppose 0b + 2b = -r + 55, -53 = -2b + r. Is 9 a factor of b? True Let u = 28 - 17. Let m = 32 - u. Does 7 divide m? True Is (-2)/14-471 - (-52)/(-182) a multiple of 8? False Suppose -4f = 399 - 1023. Is 12 a factor of f? True Let b = -14 - -9. Let v = b - -8. Is 3 a factor of v? True Let z = -3 - -8. Suppose zt - 57 = 13. Is t a multiple of 7? True Let w = 34 + -59. Let l = -12 - w. Is 13 a factor of l? True Suppose 0 = -4j + 20, -q = -j - 99 - 232. Suppose 2w - 4 - 178 = 0. Suppose -5n - w + q = 0. Does 18 divide n? False Let x(r) = r*2 - 8r - 7. Let h be x(9). Suppose -hm = -0m - 84. Is m a multiple of 21? True Suppose -2d - 3d + 20 = 0. Let v(o) = -2o + 2. Let j be v(-7). Suppose 0z = -z - 3, -dz = 4y - j. Is 7 a factor of y? True Suppose -j = -1 - 14. Is j a multiple of 5? True Let s = -39 - -87. Does 24 divide s? True Let a(c) = -5c + 7. Let j(p) = 2p - 3. Let x(d) = -4a(d) - 9j(d). Let z be x(-2). Let w(u) = -2u - 4. Is w(z) a multiple of 4? False Suppose 2c + 2c = 2v + 18, 0 = -3c + 4v + 21. Suppose h = -ch + 80. Is h a multiple of 10? True Let b(a) = 4 + 5a + 2a2 + 0a*2 - 3a*2. Let s be b(4). Does 9 divide (4/5)/(s/180)? True Suppose 0 = y - 4y + 21. Is y a multiple of 2? False Let m = 41 - 25. Is m a multiple of 4? True Is 9/(-32/(-6)) a multiple of 8? False Let m = 38 + -3. Suppose -5t - 3g = -33 - m, t = -g + 12. Let o = -7 + t. Is 9 a factor of o? True Let q(u) = u + 3. Let p be q(0). Suppose 0 = -pk + 4z + 29, -k + 0z + 2z + 13 = 0. Suppose -2b + 30 = -kv, -3b + 67 = 2v - v. Does 19 divide b? False Let f(z) be the third derivative of -13z4/8 - z3/6 - 2z2. Let x be f(-1). Suppose 5m = 5w - x + 233, w = -3m + 113. Is m a multiple of 14? False Let y = -602 + 892. Is 25 a factor of y? False Suppose 2m + 4 = 24. Is 5 a factor of m? True Suppose -3f = 5k - 47, 4f - 2k = 2k + 52. Let m = f - -3. Does 12 divide m? False Let x be 4/((-4)/(-7)) + -1. Let a(y) = -2y2 + 2y + 5. Let v be a(x). Let i = v + 83. Does 14 divide i? True Suppose 5t - 67 = -22. Suppose -2u = -t + 3. Does 4 divide (7/3)/(u/18)? False Let g(d) = d*2 - 23. Does 13 divide g(-7)? True Suppose -2h + 46 = l, -2h + 250 = 5l + 3h. Does 18 divide l? True Let i(v) = -3v*2 - 2v - 2. Let p be i(-2). Let s be (-1078)/33 - (2 - -1)/9. Let y = p - s. Is y a multiple of 23? True Su	{ "pile_set_name": "DM Mathematics" }
243 rounded to four dps? -0.0001 What is -104027 rounded to the nearest 10000? -100000 What is 0.010075 rounded to 3 decimal places? 0.01 What is 1.1986 rounded to 2 decimal places? 1.2 Round 0.6017 to one dp. 0.6 What is 0.0001823 rounded to five dps? 0.00018 Round 0.0325 to two decimal places. 0.03 Round 10580000 to the nearest one million. 11000000 What is 29579 rounded to the nearest one hundred? 29600 Round -1152 to the nearest one hundred. -1200 Round 0.00006 to 3 dps. 0 What is -0.0005649 rounded to 5 decimal places? -0.00056 What is 33610000 rounded to the nearest one million? 34000000 Round 0.2011 to two decimal places. 0.2 What is 29.2401 rounded to the nearest integer? 29 What is -725900 rounded to the nearest 100000? -700000 What is -0.0006759 rounded to four decimal places? -0.0007 Round -0.407 to 1 dp. -0.4 What is -3033 rounded to the nearest 1000? -3000 Round 0.0375 to three decimal places. 0.038 Round -0.006168 to three dps. -0.006 Round 0.000134908 to five decimal places. 0.00013 Round 0.000002957 to seven dps. 0.000003 What is 7168 rounded to the nearest one hundred? 7200 What is -331360 rounded to the nearest 1000? -331000 What is -28.143 rounded to 0 dps? -28 Round -0.0034448 to four decimal places. -0.0034 What is -29554.6 rounded to the nearest one hundred? -29600 Round 0.00014115 to five dps. 0.00014 Round 0.22952 to the nearest integer. 0 What is -56570 rounded to the nearest 1000? -57000 What is -2.326 rounded to 1 dp? -2.3 Round -0.120076 to two decimal places. -0.12 Round 0.0009653 to four dps. 0.001 What is -0.0000005351 rounded to 7 decimal places? -0.0000005 Round -204849 to the nearest 10000. -200000 What is 67750 rounded to the nearest one hundred thousand? 100000 Round -0.08588 to three decimal places. -0.086 Round -127575 to the nearest 10000. -130000 What is 0.00100261 rounded to 4 decimal places? 0.001 Round 36.713 to 0 dps. 37 Round -0.00037304 to five decimal places. -0.00037 Round -205.343 to the nearest 10. -210 Round 53.567 to the nearest 10. 50 What is -0.0000432 rounded to 6 dps? -0.000043 Round 0.0000022982 to seven decimal places. 0.0000023 Round 0.00311 to three decimal places. 0.003 What is -0.0008058 rounded to 4 dps? -0.0008 What is -2084200 rounded to the nearest 1000000? -2000000 Round -0.00001408 to six decimal places. -0.000014 What is 47170000 rounded to the nearest 1000000? 47000000 What is -15232 rounded to the nearest one thousand? -15000 What is 0.000034049 rounded to seven dps? 0.000034 What is 0.006361 rounded to three dps? 0.006 Round -2.964 to one dp. -3 Round -0.00002949 to six decimal places. -0.000029 What is 18.13 rounded to the nearest 10? 20 What is 351020000 rounded to the nearest one million? 351000000 Round -9.909 to zero decimal places. -10 Round 234.263 to the nearest 10. 230 Round 28480 to the nearest one thousand. 28000 Round 2093000 to the nearest one hundred thousand. 2100000 What is 10730 rounded to the nearest one thousand? 11000 What is 5238.7 rounded to the nearest 1000? 5000 What is 0.00010988 rounded to 6 decimal places? 0.00011 Round -2.079 to one dp. -2.1 Round -0.000020615 to six decimal places. -0.000021 Round -0.004296 to three dps. -0.004 Round 132330 to the nearest 10000. 130000 What is 0.00005574 rounded to 5 dps? 0.00006 What is 159258 rounded to the nearest one hundred thousand? 200000 What is -17400000 rounded to the nearest one hundred thousand? -17400000 What is -0.27211 rounded to 3 dps? -0.272 What is -0.05982 rounded to one decimal place? -0.1 Round 0.000045694 to five dps. 0.00005 Round 0.00001764 to six dps. 0.000018 What is 0.000684 rounded to 4 dps? 0.0007 What is 22.73 rounded to zero decimal places? 23 Round 0.00000407 to seven decimal places. 0.0000041 Round -6.029 to 1 decimal place. -6 What is 9442100 rounded to the nearest 1000000? 9000000 What is 24300 rounded to the nearest one thousand? 24000 Round 17998000 to the nearest 1000000. 18000000 What is 120140 rounded to the nearest 10000? 120000 Round 2996600 to the nearest one million. 3000000 Round -2660560 to the nearest one million. -3000000 Round -113.36 to the nearest 10. -110 What is 0.112042 rounded to 3 dps? 0.112 Round 92902 to the nearest 10000. 90000 What is 374100 rounded to the nearest 10000? 370000 Round 0.004674 to 3 decimal places. 0.005 Round 0.019625 to three decimal places. 0.02 Round 0.5728 to 2 decimal places. 0.57 Round -0.02009 to three dps. -0.02 What is -0.0085675 rounded to four dps? -0.0086 What is 0.004678 rounded to three decimal places? 0.005 What is -110240000 rounded to the nearest 1000000? -110000000 What is -33.7807 rounded to one dp? -33.8 Round -0.000008153 to six decimal places. -0.000008 Round 4400 to the nearest one hundred thousand. 0 Round 40200 to the nearest ten thousand. 40000 What is 192300 rounded to the nearest one hundred thousand? 200000 What is 0.00000753 rounded to 6 decimal places? 0.000008 Round 0.00000062745 to seven dps. 0.0000006 What is -0.0000002204 rounded to 7 decimal places? -0.0000002 What is 0.0000361 rounded to five decimal places? 0.00004 Round 3.9866 to two dps. 3.99 What is -119.13 rounded to 0 dps? -119 Round -0.018 to three dps. -0.018 Round -0.04165 to 2 dps. -0.04 What is 2949600 rounded to the nearest one million? 3000000 What is -11516000 rounded to the nearest 100000? -11500000 Round -0.0012526 to four dps. -0.0013 What is -223.41 rounded to the nearest ten? -220 Round -0.000072297 to six dps. -0.000072 What is -0.0078039 rounded to 4 decimal places? -0.0078 Round -0.000001777 to seven decimal places. -0.0000018 Round 234160 to the nearest one thousand. 234000 Round -1382770 to the nearest one hundred thousand. -1400000 Round 4.3097 to the nearest integer. 4 What is -3952100 rounded to the nearest ten thousand? -3950000 Round 0.048 to three dps. 0.048 What is -0.00000104 rounded to 6 dps? -0.000001 Round 566.43 to 0 dps. 566 What is 92614 rounded to the nearest one hundred? 92600 Round -1236700 to the nearest 10000. -1240000 What is 0.0031057 rounded to four decimal places? 0.0031 What is 2428.7 rounded to the nearest 100? 2400 What is 5790 rounded to the nearest 1000? 6000 What is 3210 rounded to the nearest one hundred? 3200 Round -0.04625 to 3 decimal places. -0.046 What is 0.000000991 rounded to 7 decimal places? 0.000001 Round 113523 to the nearest 1000. 114000 Round 40000 to the nearest 1000. 40000 What is -1.2615 rounded to one dp? -1.3 What is 0.0000217 rounded to six decimal places? 0.000022 Round -158550 to the nearest 100000. -200000 Round -0.00000077208 to seven dps. -0.0000008 Round 0.0001477 to five dps. 0.00015 What is 0.438 rounded to 1 dp? 0.4 Round 1.0425 to 0 decimal places. 1 What is 0.00253 rounded to four decimal places? 0.0025 What is 1.595 rounded to 2 decimal places? 1.6 What is 0.0000005412 rounded to seven decimal places? 0.0000005 Round 0.5614 to two dps. 0.56 What is 122210 rounded to the nearest 1000? 122000 Round 0.60864 to three dps. 0.609 Round -11.482 to the nearest integer. -11 Round -0.000074274 to seven decimal places. -0.0000743 Round 0.00006146 to six decimal places. 0.000061 What is -6.6855 rounded to one decimal place? -6.7 What is -0.056043 rounded to 3 dps? -0.056 What is 0.0000033797 rounded to 7 dps? 0.0000034 What is 226607 rounded to the nearest 1000? 227000 What is 0.000008207 rounded to 6 decimal places? 0.000008 What is -101180 rounded to the nearest one thousand? -101000 What is -0.000007605 rounded to 6 decimal places? -0.000008 What is 722900 rounded to the nearest ten thousand? 720000 What is 36.0201 rounded to one dp? 36 Round 15.64 to 1 decimal place. 15.6 What is -0.00084057 rounded to five dps? -0.00084 What is -0.016105 rounded to four dps? -0.0161 Round 30.32 to 0 dps. 30 What is -7.69 rounded to zero dps? -8 Round 24300000 to the nearest 1000000. 24000000 What is -618730 rounded to the nearest 100000? -600000 Round -0.000502 to four decimal places. -0.0005 What is -0.0000006402 rounded to seven dps? -0.0000006 What is -0.00000029912 rounded to seven dps? -0.0000003 Round -177890000 to the nearest one million. -178000000 Round 518620 to the nearest ten thousand. 520000 Round -0.0138806 to 4 decimal places. -0.0139 What is -0.00000397 rounded to six d	{ "pile_set_name": "DM Mathematics" }
= -0.1 + -12.9. Let s = -13.3 - t. Is s greater than -0.5? True Suppose -2 = 3m + 2i, 2i + 9 - 7 = 2m. Is 1/51 equal to m? False Let m = 0.083 - -2.917. Which is greater: 17 or m? 17 Let m(y) = 2y + 11. Let a be m(-6). Is a greater than or equal to -1? True Let l = 49/1185 - -2/79. Are -1 and l unequal? True Let f = 110111/91 + -1210. Let u = f + -100/819. Which is smaller: 0 or u? u Let v = -3 - -4. Let f = v - 0. Let t be (-4)/(-6)(-1)/2. Which is smaller: f or t? t Suppose 0 = -5l + l - 4. Which is greater: l or -2? l Suppose -t = -4t + 18. Let f be ((-42)/(-224))/(t/(-4)). Which is smaller: 0 or f? f Let c(x) = -x + 3. Let k be c(6). Let q(u) = -u - 9. Let r be q(-8). Is r smaller than k? False Suppose 7c - 2c = -g + 19, 16 = 4c + g. Suppose -ck + 32 = k. Suppose 2u + 2u + k = 0. Which is bigger: -1/2 or u? -1/2 Let r = -22.04 - -4.34. Let j = 17 + r. Which is smaller: 1/4 or j? j Let u be -4(0 - -2)/(-4). Suppose 6 + 3 = -uk - 3i, k + 3i + 9 = 0. Let b(d) = d - 6. Let f be b(5). Which is smaller: f or k? f Let m(p) = 2 - p + p*3 - 3p2 + 4 + p2 - 3p2. Let t be m(5). Let i be -1-6(-8)/(-132). Which is smaller: i or t? i Suppose 5v = 33 - 3. Suppose vr = 2r. Let j be 1(-1)/(3 - 2). Which is smaller: j or r? j Let n = 3 + -1. Suppose 5a - 20 = -4f, nf - 15 = a - f. Let w = -1 - a. Is 1 != w? True Let h(p) = -p*2 - 5p - 4. Let l be h(-4). Does 13/9 = l? False Let o(i) = i*2 - 4i - 2. Suppose -6z + z + 20 = 0. Let h be o(z). Which is smaller: -1 or h? h Let a = -6 - -5.9. Let k = 4 + -6. Which is smaller: k or a? k Let y be 0 - -1 - (-36)/(-28). Which is smaller: y or 9? y Let n = 4 - 7. Let v(o) = -2o - 7. Let d be v(n). Are -7 and d equal? False Suppose 0v + v - 6 = 0. Let r be v/(-8) - (-6)/8. Suppose -3x + 15 + r = 0. Are x and 6 unequal? True Let p be 3 + (3 - 82/12). Let x = 4/3 + p. Is x smaller than 0? False Let d(i) = -i*2 - 13i + 5. Let c be d(-13). Suppose y + c = -0y. Which is bigger: -4 or y? -4 Suppose 0 = -5f + 16 + 29. Is f at least as big as 9? True Let g = 73 + -217/3. Let z(w) = -3w2 + w. Let k be z(-1). Let r = 5 + k. Which is smaller: g or r? g Let g be 9 + (18/(-4) - (-2)/4). Which is smaller: 35/6 or g? g Let y(x) = x - 4. Let r be y(-8). Suppose 20 = 4p, 5k - 5p + 17 + 18 = 0. Let a be ((-3)/k)/(r/(-32)). Is 4 < a? False Suppose 0 = d + 10 - 4. Let o be (290/d)/(12/(-28)). Let l = -113 + o. Which is smaller: 1 or l? l Let b = 2 + -2. Let o = 25 - 373/15. Which is greater: o or b? o Let d(n) = 3n - 2. Let p be d(4). Suppose -3y + 18 + 13 = -5r, -p = 2r. Suppose u = -k - 3, yk = 4u + 4k + 12. Is -3 != u? False Suppose x + 3x + 369 = 3y, -x - 91 = -y. Let g be ((-1)/2)/((-6)/x). Is -2 smaller than g? False Suppose -2x = -5c + 7, -7c - 3x + 2 = -2c. Is 2/13 equal to c? False Suppose k = -c, 7 + 3 = c - 4k. Suppose -3 = cb + b. Which is smaller: b or -2? -2 Let l be 0/(-2) - (27 + -25). Is -4 > l? False Let b = -28/9 + -2/9. Is 0 at least as big as b? True Let u be -2 + 4 - (40/4 - 4). Let g = -8 + 4. Does g = u? True Suppose 4g - 50 = -g. Suppose -2r - g = -2w - 3r, r + 8 = 4w. Suppose -5k - 4 = 4n, -2n = -wn - 5k - 1. Which is smaller: n or -2? -2 Let v = 11 + -17. Let h = v + 8. Is h not equal to 2? False Let c = -16291/6 - -2691. Let k = c - -25. Suppose 0x - 3n - 17 = -5x, -4x + n + 8 = 0. Is k at most x? True Let q be 62/12/(-4). Let d = -91/3 - q. Which is bigger: 1 or d? 1 Let w = 41/114 - 10/19. Let v be 2/(-5) + (-8)/5. Let h be -1 + 0(-2)/v. Are h and w unequal? True Let b = -15 - -33. Let n = b + -11. Let r = n + -5. Is r less than 2? False Let m = 4 - 4. Let n = m - -1. Suppose -2g = -4c - 2, 3g + 8 = 4c - 9c. Which is smaller: n or g? g Let w = -1255 + 8803/7. Is w greater than or equal to 4? False Let a be (9/6)/(2/8). Suppose -y + 0y + a = 0. Suppose -20 = -4z, -5d - z + 6z = -5. Is y at most d? True Let r = 6 + 8. Is 14 less than or equal to r? True Let o = -5263/15 - -351. Let c be -3 + (0 - (1 + -5)). Suppose 3d - c = 2. Are o and d equal? False Suppose -v - 1 = -2h + 4, h - 4v = 13. Suppose 0 = m - 6 + h. Suppose 0 = -mo + 10 - 0. Which is bigger: 1 or o? o Let t be 4/55/7. Suppose 12u = 3 + 21. Are u and t equal? False Let s(h) = 0 - h + 1 - 4. Let r be s(-5). Let j = -4/19 + -3/76. Which is smaller: j or r? j Let o = -35 + 18. Let d = o - -16. Is d bigger than -13? True Suppose -8 = 2v, -3 = 4p + v + 1. Suppose 0 = -t - pt - 5. Which is greater: -0.1 or t? -0.1 Suppose 0 = a + 5, -5a + a = -t + 22. Let o = -7 + 4. Which is greater: t or o? t Suppose -5l + 3l - 20 = 0. Are -9 and l nonequal? True Let h(d) = -d. Let z be h(-1). Suppose 10 = 6i - i. Which is greater: i or z? i Let r = -28 + 17. Let q = 10 + r. Does q = 0.1? False Suppose 1 = 5s - 9. Suppose m - w = 4, -m + 6 - s = -2w. Is m != -2/11? True Let l be (1/(-11))/(2/(-6)). Which is greater: l or 0? l Let h = -4 + 3.9. Let l = -27 + 49. Let t = l - 68/3. Is h >= t? True Let i = -244 + 246. Let g(m) = 2m2 - m. Let q be g(1). Is q less than or equal to i? True Let z = -12.931 - 0.069. Which is greater: z or -8? -8 Let h = 32 - 23. Let c be (-25)/h + (-4)/18. Which is smaller: c or -2? c Let k = -6/5 + 1. Suppose -a + 4g + 20 = a, -3a - 25 = 5g. Let b = -1 + a. Which is bigger: b or k? k Let d(n) = -3 - 6n - 2 + 2. Let t be (-1)/(-2) + 10/(-4). Let h be d(t). Which is smaller: 8 or h? 8 Let u = -3 - -2.7. Let m = u - 0.7. Let k = 1 - 1. Which is smaller: k or m? m Let m be -4(3 + 4/(-2)). Let z = 5 + m. Is z greater than or equal to 1? True Suppose 0 = -136n + 145n + 90. Let v be (-1)/3-2-15. Is n bigger than v? False Let r be -4((-21)/4 - -2). Is 13 < r? False Let z be 5(4 + (3 - 3)). Let s be ((-5)/z)/((-1)/8). Let a be -22/(-4) + 0. Is a greater than s? False Let q(p) = -p2 + 10p + 14. Let k(x) = 4x2 + 4x + 3. Let r be k(-2). Let w be q(r). Let f(t) = t + 2. Let d be f(w). Which is bigger: d or 6? 6 Suppose 0 = -g + 2g - 10. Let n be (-2)/(-4) - (-15)/g. Suppose -2v = -5b + 13, 4v = 2b + nb - 20. Is 0.3 equal to b? False Suppose -3k + k + 4o - 206 = 0, 0 = -3o - 12. Let n be ((-10)/(-25))/(k/15). Is n less than or equal to 0? True Let p be (-3 - -1) + 5 + 26/(-10). Let f = -0.3 - -0.6. Let s = f - 0.2. Is s at most p? True Let l(g) = -g - 4. Let u = -1 + -3. Let f be l(u). Suppose f = x - 0n + 2n + 3, 4n = -x - 5. Which is greater: x or -1/8? -1/8 Let k be ((-4)/24)/((-1)/40). Are k and 7 equal? False Let j = -10.7 + 24.3. Let t = -15 + j. Let q = 0.6 - t. Which is smaller: 1 or q? 1 Suppose -5w - 5b + 20 = 0, 2b - 3 = 3. Is w bigger than 4/17? True Let b = 0.2 - 0.3. Suppose 6 = -5l + 10l - 3k, -5k = -4l + 10. Is l > b? True Let v(u) = -u*3 - 14u*2 - 11u + 32. Let g be v(-13). Which is smaller: 1 or g? 1 Let m(i) = -i - 11. Let d be m(-10). Let h = -23 + 23. Is d smaller than h? True Let w = -21.1 - -4.1. Let i = 16.6 + w. Let r = 2 + -2. Is r less than or equal to i? False Let f = -0.216 - -0.116. Is -1.4 > f? False Suppose -22h = -21h + 1. Is h at least -4/39? False Let o = -0.04 - -0.07. Let x = 0.42 - 0.25. Let q = x + o. Is 1/4 bigger than q? True Let n(o) = -18o2 - 6o - 7. Let z be n(-1). Is z at most as big as -21? False Let t(l) = -l*3 - l - 1. Let m be t(-1). Let j = -7 - -9. Let a = j - 3. Which is smaller: m or a? a Let q = -149 - -148. Which is smaller: 3/11 or q? q Suppose -15 = -7s + 2s. Suppose -r = -sn + 26, -n + 0n + 5r = -4. Suppose -5m - n = -2m. Are m and -2 unequal? True Let f(g) = 5g2 + 1. Let r be f(1). Suppose a - ra = -3z + 27, a + 19 = 4z. Suppose 28 = -s - 4s + 4j, -4j - z = 3s. Is -4 at most as big as s? True Let f be (1 - 6) + 7 + (8 - 1). Is 6 < f? True Suppose -3s - 326 = 73. Let w = 667/5 + s. Let v = 0.4 + -0.5. Which is smaller: w or v? v Let o = 2.18 + -0.18. Let b = o - 1.9. Let x be (-21)/(-27) - (-1 - -2). Which is smaller: x or b? x Let c be -5 + 27/6 + (-2)/4. Is c at most -1/114? True Let c = 1.1 + -1.12. Which is smaller: c or 2? c Let y be (-16)/88(-6850)/4. Let j = 311 - y. Is j less than 0? True Let c = 1 - -7. Let q be 2/2 - (5 - -2). Let j be q/(-4)c/42. Which is smaller: 0 or j? 0 Let x = -1 - -4. Suppose 4 = xg	{ "pile_set_name": "DM Mathematics" }
108/99) Simplify (((((u/u(1/4))/u)/u)/u)(-2/53))*(-50)((u*4u)/u(1/9))23 assuming u is positive. u(51611/477) Simplify ((m(-14)m(-4/7)(m/m(-8))/m6)(-3))50 assuming m is positive. m(12150/7) Simplify (((x(-1))*24x/x*(-6)(x(-3/5)/x)/x)(-2/101))(4/29) assuming x is positive. x(784/14645) Simplify (n*(-6/11)n/(n/(n/(n(n(nnnn(-8/7))/n)/n)))(n/(n(4/17)/n))(-11))(-47) assuming n is positive. n(1280562/1309) Simplify (((l/(((l/l*(-20/11))/l)/ll)l)/l)/l)/l41(ll(l(l(-33/5)ll)/l)/l)(-16/5) assuming l is positive. l(-8607/275) Simplify (x(-1/3)/(x2/x))/(((xx(-4))/x)/x(2/3))((xxxx/x*(-1/5))/(xx(-11/4)))(-5) assuming x is positive. x(-317/12) Simplify (o(-12)o/((oo/(o/o*(2/9)))/o)(ooo*6ooo)/o(-6))(-5) assuming o is positive. o*(-260/9) Simplify (vv*(-2/3)v)*19(vv(-4/9)vv)/vvvv*5/v(v*1vv)/(v(2/5)/v)(v/(v/(v*(2/3)v)))/(vv/(v(v/v*(-2))/vv)) assuming v is positive. v*(1807/45) Simplify (iii/(i(-2/7)/i))(-1/14)i*(-2/3)i*(-7)(i*0/ii)*(8/11)i/(i*(-6/7)/i)i/(i/i*(-4)i) assuming i is positive. i(-1487/147) Simplify (((y(-3/4)y/y(4/7))/(y/(yy/(y/y*(2/5)))yy)(-5/7))(2/45))(-50) assuming y is positive. y(-115/63) Simplify (f(-2/9)/((f(-8)ff)/f))(-44)/((f(-2))(2/47)/(f/f(1/2))(-1/43)) assuming f is positive. f(-10846055/36378) Simplify ((b/(((b/b(-8/3))/b)/b))/b)(-8/5)/(((bb*18)/bbb)/((b(b*(5/7)/bbb)/bb)/b)) assuming b is positive. b(-328/21) Simplify (((o0(oo/(o*(-4)o))/o)/(o*(-2/7)/oo(-2/3)))(2/59))(-1/20) assuming o is positive. o(-25/2478) Simplify ((u*(-3/2)u/u(-6))/((u(1/2)u)/u)12)/(((u4/u)/(u(-2)/u))/(u1uu)(-3)) assuming u is positive. u(-31/2) Simplify (z/z(-3/4)(z/((z/(z/((z/(zz(4/3))z)/z)))/z))/z)41/(z(-4/3)z(2/21)/z)(-18) assuming z is positive. z(10679/84) Simplify (f4f(-7))44((f/f(-2/5))/ff)*(-6/19)f/f*(-8)f(-2/3) assuming f is positive. f(-35371/285) Simplify (v*(-2/11)v*(-2)(v(-1))(-3/32))(-2/11) assuming v is positive. v(735/1936) Simplify (f*(-1/11)f(f(-39)f)/ff(-27)/(f/f5))(-2/73) assuming f is positive. f(1344/803) Simplify ((n(1/12))8/(n/(nn/n*(-9/2))nnn18))(11/6) assuming n is positive. n*(-913/36) Simplify ((s/(s(s(-5)/s)/s))(-50)s(-23/2)ss/(s(1/2)/ss))32 assuming s is positive. s(-11520) Simplify (g(2/5))19(gg/(gg/(((g/(gg*(-1)g)g)/ggg)/g)))20(g/(gg/g(-1/3)g)g/g(1/2))(-5/2) assuming g is positive. g(1931/60) Simplify (((w(2/7)w(-4/5))/((w/(w/w(2/7)))/w)(-44))29)(1/28) assuming w is positive. w(-16211/490) Simplify vv/((v/v(-4/7)v)/v)vv*(-2/23)((v(vv/v*(1/2)v)/v)/v)*(2/47)((v/v(-7))/v(-2/15))(-7) assuming v is positive. v(-6302693/113505) Simplify ((k/k(1/3))41(kk(-1))(-4))/((k/(k(k(-2)k)/k))*(2/59)((kkk/(kk/k2)k)/kk)(3/4)) assuming k is positive. k(4295/177) Simplify (v(-9)/(v(3/2)/v))(-31)/((vv(1/4))(2/57)/(v*(-1/6)vv(5/2))) assuming v is positive. v(5658/19) Simplify ((d/(dd*0)d)/(d/(dd/(d(-6)/d)dd))(d(1/4))(-14))/((d1)(-3/31)(d/(d/d(1/4)))8) assuming d is positive. d(347/62) Simplify (j(19/4)/(j22j)(j/j10)/(j/(j/(j/(j/j(-7))))))(-16) assuming j is positive. j324 Simplify (l(29/2)/((ll*(1/25))/ll)l/l(-3/10)l(-1/6)/l)(1/5) assuming l is positive. l(2039/750) Simplify ((c/(c/(((c/(c(-15)c)c)/c)/c)))*(-19)cc(-4/7)/cc(-10))(-27) assuming c is positive. c(52272/7) Simplify (((n(2/7))*(-7)((nnn*1)/n)/(nn/(nn7)n))20)(7/8) assuming n is positive. n*(175/2) Simplify dddd/((d*(-4)d)/d)dd*(-1/10)(d/d(-2))/((d(-3/4)d)/d)((d/(dd(-1)/ddd))(1/3))(-2/27) assuming d is positive. d(253/20) Simplify ((((l(-1/4)l)41)(8/7))(-12/7))23 assuming l is positive. l(-67896/49) Simplify (j(1/14)jj/(jj/(j(jj7)/j)))(-31)/((j/(j/(j(-9)/j)j))/jjjj1/j)(-7/8) assuming j is positive. j(-7251/28) Simplify ((a(-1/6))(-13))22((a(-1/2)/a)/a)(-1/30)a1/a(1/2) assuming a is positive. a(193/4) Simplify ((p/((p/(p(p*(-4/5)p)/p))/p))*36(p/(p/p*(-3/2)p))39)(-26) assuming p is positive. p*(7059/5) Simplify ((xx/x0)(-15)/(x(-2/7))(-29))/(x*(1/4)x(-3))(1/58) assuming x is positive. x(-62099/1624) Simplify (((p/(p(-1/3)/pp))/p)(1/2)/((p/(p/p(-8)))/p6))/((p(1/2)p)(4/7)/(p(-1))(1/9)) assuming p is positive. p(1663/126) Simplify ((r(-1/2))29/(r/r(-1))(-10/9))/(((r(-2/3)/r)/((r/(((r(-2/9)/r)/r)/r))/r))/(r(-1))(-36)) assuming r is positive. r*(515/18) Simplify (((pppp/p*(2/3)p)/p)(2/11))(2/31)/(p*(1/5)(pp/(p(-1/4)/ppp)ppp)/p(p/p1)18) assuming p is positive. p(-69787/20460) Simplify (((aa*7a)/(a*18a))/(a(-12)/a)(8/13))(-35) assuming a is positive. a70 Simplify (((f*(-7)f*(1/29)f)(-2/57))(-6/11))43 assuming f is positive. f(-29756/6061) Simplify (((xx/((x/((x/(x/(xx(x(-10)/x)/x)))/xx))/x)x)/x(-12))/(x34/(x(30/13)/x)))32 assuming x is positive. x(-11520/13) Simplify (q(-25))(-8)(qq20q)/(q3/q) assuming q is positive. q220 Simplify ((k/(k/(k*(-26/7)k))k(18/7)k)/(k(2/11))(-16/7))(7/2) assuming k is positive. k(49/11) Simplify (((z/(zzz*(-3/7)z)z)/zz)/z*3(zz/(z/z(-2/3))z)*(-3/25))/((zz0)(-6/17)z(-4/3)/z(2/5)) assuming z is positive. z(-14683/8925) Simplify ((b/((bb*(-2/21))/b)b*0)/(b(bb/b6b)/b)(-2/89))(-29) assuming b is positive. b*(-55709/1869) Simplify (((o/(o/(oo/(oo19))))/o22)(15/4))(-35) assuming o is positive. o5250 Simplify ((y/(y/(y(2/7)y)))(-38)/((y/(y(-4/9)/y))/y9))(-26) assuming y is positive. y*(69290/63) Simplify (((cc*(-1)c)(-2/15)/(c/(c/(c/c1)))(-3))45)29 assuming c is positive. c(-174) Simplify ((s/s*(-1/3)s)/(ss(3/2)))9((s/(s*6s))/s)/(ss/s6)(sss/(s(-1/2)/s))/s0 assuming s is positive. 1 Simplify u*(-2)u*(-1/4)uu(uu(-2))/uu/u*(-2/15)(u*(-7)uu(uu/(u/(u/(u/(u/((uu*10)/u)))))u)/uu)(3/25) assuming u is positive. u(-767/300) Simplify (o/(o9o)o/((oo(o/((o(-3/5)/oo)/o))/o)/o)(o2)(-18))(-35) assuming o is positive. o1631 Simplify (((y(-1)/y)/y)(-5))(-1/44)/(yy/(y*(-4)y)yyyy(-2/11))(-50) assuming y is positive. y(17185/44) Simplify (c(-3/11)/(c/(c/(c/(c(cc*(1/4))/ccc)))))/(c7c/c*7)(c/c*(-4/3)c11)(-17) assuming c is positive. c(-29791/132) Simplify (b6/bbb/(b/(((b(3/10)/b)/b)/b)))13(b/b(-3))/(bb*(-5))bb(-3/5)/bbb(-3) assuming b is positive. b(483/10) Simplify ((t1/t)(-7)(t(-1/2))(2/77))/(t*(4/5)/(t(t/t*(1/2))/t)t/(t(t/t(1/7)t)/ttt)tt/(tt0/t)t) assuming t is positive. t*(-351/770) Simplify (((xx/x(-10))/x(-1/13))/(x/x6)(-2/29))(3/4) assuming x is positive. x(13269/1508) Simplify (z(3/2)/z(2/27))*(-18/5)((z/z*(-1))/z)/z(z/((z/(zz3))/z))/zz(z(-2/3))(2/91) assuming z is positive. z(-202/1365) Simplify (((r/((rrr(-12))/r))/(r/(r/r15)))/(rrrr*21rr)40)13 assuming r is positive. r(-13559) Simplify ((zz*1/zz)28/((z0z)/z)(-2/79))/((zz/z*(-2/9)z)(-36))16 assuming z is positive. z1912 Simplify (((((k2/k)/k)(-37))11)(3/16))(-38) assuming k is positive. 1 Simplify (r(-1/2))12/((r*(-4/5)r)/r*5)(r*9r/r(-8))(4/3) assuming r is positive. r(114/5) Simplify ((s(-6))35/(s(-2/3)((ss*(-1)/s)/ss)/s))(-3) assuming s is positive. s622 Simplify ((a/a(-2/3))(-2/17))*(-11/4)/((aa*0aaa)(26/3)/((a(2/15)a)/(a/a2))) assuming a is positive. a(-5439/170) Simplify ((((k/(kk/(k*9k))k)/kk)/k(-1/8))/(k(1/3))(8/5))/((k/k(-1)k)(-43)/(k(2/9)/(kk(-2)))) assuming k is positive. k(50333/360) Simplify ((yyyy2yy)(-39))(4/11)(y*(-6)y)/yyy/(y/(y*(2/15)/y)y)yy*(-7)/yy*(-4/7)y assuming y is positive. y*(-130181/1155) Simplify ((((jj(-3))/j4)/((j/(j/(j(2/9)/j)))/j(1/7)))**	{ "pile_set_name": "DM Mathematics" }
- 3v - 32 = 3s. Let i = -67 - -72. Calculate the least common multiple of i and s. 20 Let z(d) = -d*2 + 9d - 5. Let a be z(7). Let p(t) = t*2 - 8t - 7. Let i be p(a). What is the common denominator of 13/6 and ((-576)/14)/4 + i? 42 Let n(j) = 341j - 28. Let h be n(7). Let k = h + -9527/4. Find the common denominator of 21/4 and k. 4 Find the common denominator of (-7)/(-21) + (-860)/168 and (2741/(-8))/3. 84 Let k = 18 - 8. What is the smallest common multiple of (-5)/10k-4 and 30? 60 Let d(r) = -167r3 - r2 + 2r + 1. Calculate the smallest common multiple of d(-1) and 8. 1320 Let r be (-1144)/897(-1 + 106/(-8)). Let w = 10001/506 - r. What is the common denominator of -111/22 and w? 22 Suppose -21s + 142 + 5 = 0. What is the smallest common multiple of 20 and s? 140 Suppose 2z + 88 = -72. What is the common denominator of -43/6 and 30/(-50) + (-373)/z? 48 Suppose 3 = -4u + 5u. Suppose v + 3v = ur - 99, 0 = r + 2v - 23. Let f = -527 + 3739/7. Calculate the common denominator of f and r. 7 Let a = -5257411 + 315426547/60. Let p = a - -1799/6. Calculate the common denominator of -69/2 and p. 20 Let o(u) = 8u3 - u. Let w be o(1). Let p = -251 + 259. Calculate the common denominator of -21/5 and p - w - (-73)/(-6). 30 Let a = -12/9373 + -546743/4892706. Calculate the common denominator of -65/18 and a. 522 What is the least common multiple of (-2)/11 - 2000/(-110) and (6/5)/((-1)/(40/(-12)))? 36 Calculate the common denominator of 3/29 and 3/2872/(-5). 290 Let t = -29 - -329. What is the lowest common multiple of 36 and t? 900 Let b = 98 + -86. Calculate the lowest common multiple of 24 and b. 24 Let r = -60 - -85. Let o be (-40)/630/r. Calculate the lowest common multiple of 12 and 31/2 - 4/o. 48 Suppose 4y - 70 = 2w, 2w - 2y = 3w + 43. Let a = -27 - w. Suppose 0u - 24 = -4u. Calculate the smallest common multiple of a and u. 12 Let y be (62356/(-18) - 0) + -4. Let o = y - -3460. Find the common denominator of 1/5 and o. 45 Let j be (-421620)/(-42) + 3/7. Let z = j - 60101/6. Find the common denominator of z and (-1 - 53)/(65/(-5)). 78 Let p be 3 + 458/(-6) + (-8)/(-24). Find the common denominator of 47/3 and (-6 - p)(-2)/6. 3 What is the common denominator of -74/3 and ((-22)/(-268))/((-183)/122)? 201 Let q(x) = x2 - x + x2 + 3x + 2x*3 - 4x. Suppose b = m + 4, 0 = 4b + m + m - 4. Calculate the smallest common multiple of 3 and q(b). 60 Suppose 0 = -2y + 2t - 14, 4y - 2t + 6t + 52 = 0. Find the common denominator of (-4)/y - ((-283)/(-70) - 0) and -39/20. 140 Calculate the common denominator of -43/3 and (-46)/11 + 4 - 918/(-88). 12 Suppose 105 = 5y + 5. Suppose -4q + 60 = -f, -5q + 3q + 16 = -4f. Calculate the least common multiple of y and q. 80 Let v = 1888 + -1834. Calculate the smallest common multiple of v and 126. 378 Suppose 10 = 5x - 4k, 3x - 4k - 8 = -x. What is the lowest common multiple of 287/91 - x/13 and 21? 21 Let s(n) = -n3 - 2n*2 + 3n + 4. Let r be s(-5). Suppose 2h = -3c + r, -h - 37 - 12 = -3c. What is the lowest common multiple of c and 22? 198 Suppose -3a - 29 = -3b + 28, -74 = -5b - 2a. Let o(c) = -c - 7. Let i be o(-6). Let x(w) = -15w - 1. What is the lowest common multiple of x(i) and b? 112 Let g(n) = -3n - 21. Let k be g(-20). Suppose -w + k = 31. What is the lowest common multiple of 0 - (-2 + 0/1) and w? 8 Let w(q) = -4q - 3. Let a be (-14)/216/4. Let r be w(a). Suppose -r = 5l - 26. Calculate the least common multiple of 10 and l. 10 Suppose -2 = 3s + 4. Let d(w) = -5w - 6. Calculate the lowest common multiple of (-1 - -2)/((-2)/(-18)) and d(s). 36 Calculate the smallest common multiple of 124/14 + (-67)/(-469) and 11. 99 Let i = 727 + -718. Calculate the least common multiple of 208 and i. 1872 Let g be 40 - (-4 + 1 + 1). Find the common denominator of 95/24 and (2(3 - 145/g))/1. 168 Let g(f) = f2 - 4. Suppose 0 = i - 5c + 29, 5i + 4c - 5c = -25. Let l be g(i). Calculate the common denominator of (-628)/(-42) + l/(-42) and 29/5. 15 Let t = -46588079/294 - -158463. Calculate the common denominator of t and -109/70. 1470 Suppose 3t - 2 - 193 = 3a, -5t - 2a = -318. What is the lowest common multiple of t and 16? 64 Let s = 146 - 332. Let v = 509/3 + s. What is the common denominator of v and 107/6? 6 Suppose 43 - 303 = -10j. What is the least common multiple of j and ((-1)/(-2))/((-2)/(-80))? 260 Let k(g) = 3g - 36. Let d be k(11). Let h = -461 - -963/2. What is the common denominator of h and (0 - 5/70)(-1 + d)? 14 Find the common denominator of -29/66 and 2792/(-5280) + (-2)/(-5). 132 What is the least common multiple of (0 - -1) + 10 + 2 + -10 and 12? 12 Suppose -j = -0j - 5. Suppose -v + jv + 16 = 0. What is the common denominator of 56/9 and ((-100)/(-16))/(11/v)? 99 Suppose -39 = -2l + 3i, -5l + 4i - 54 = -134. Suppose 5c - 1 - 19 = 0. What is the smallest common multiple of l and 2/(-4)4/c-28? 84 Let b = -1 - 5. Let g be b/4(-6)/(-3). Calculate the common denominator of -3/22 and (-570)/(-36)g/(-20). 88 Let q be ((-62)/(-4))/(70/756). Let m = q - 803/5. Find the common denominator of -23/10 and m. 10 Let x be (-43)/(-6) - 2/12. Let z = -1 + x. Suppose -2s - 12s + 196 = 0. Calculate the lowest common multiple of s and z. 42 Suppose d + 2d - 33 = 0. Let f = 12474 - 12429. Calculate the smallest common multiple of d and f. 495 Let x be 4 - (0 - 0) - -3. Let z(j) = j*3 - 6j*2 - 6j - 4. Calculate the smallest common multiple of (-3)/5 - 128/(-5) and z(x). 75 Let p = -7 + 0. Let o = 10 + p. Suppose 7m - 88 = om. What is the least common multiple of m and 18? 198 Suppose 5o - 72 = -w + 18, 3w = 2o + 202. Find the common denominator of (-10)/(-35) + (-279)/w and -27/20. 20 Let g be (-84)/(-4) + 8/(-2). Suppose -21l + gl = -88. What is the smallest common multiple of 8 and l? 88 Let h(f) = f3 + f2 - 2. Let t be h(1). Suppose -3k - 4w = -41, -5w + w - 4 = t. What is the smallest common multiple of k and 1? 15 Find the common denominator of -1/64 and 2198/864 + (-4)/(-6). 576 Suppose -129n = -128n, 0 = 2q - 5n - 96. Calculate the lowest common multiple of q and 96. 96 Let u be 01(2 - 1). Suppose uk = 3k - 12. Let m(l) = l + 3. Calculate the least common multiple of m(13) and k. 16 What is the lowest common multiple of 27(-18)/1560/(-54) and 18? 36 Let j(f) = 18f*2 - 3f*3 + 0f*2 + 10f + 4f3 - 3f*2. Let u be j(-12). Calculate the common denominator of -101/12 and (-4)/(-26) + (-5924)/u. 12 Let p = 5 + 0. Suppose -3w + 1 = -p. Let b = -1 + w. What is the least common multiple of b and 1? 1 Suppose -861 = -3y + 63. Calculate the lowest common multiple of 88 and y. 616 Let q = -6422/153 + 774/17. Let k = 81903/10 + -8181. Calculate the common denominator of q and k. 90 Let k be 219/(-2)(-40)/(-96). Let q = -33/8 - k. Calculate the common denominator of q and -22/13. 26 Let n = -58 + 40. What is the common denominator of (((-4)/5)/1)/(3/n) and 61/8? 40 What is the common denominator of (495/4)/314/(-42) and (0 - -1)31/(-9)? 36 Let r be ((-2)/(-10))/((-7)/(-35)) + 6. Suppose -5w = 3q - 43, -5q - r = -2w + 4. Find the common denominator of w and -39/4. 4 Let i be (-2 - -15) + 2/(-2). Suppose 0s + i = -4s. What is the common denominator of s/15710/(-4) and -34/11? 22 Suppose 3r - 5r + 20 = 0. What is the common denominator of (18/r)/((-2)/35) and (-671)/33(-15)/(-100)? 20 Let g be 2 - (-4 + 3 - -283). Let s be 3 + ((-55756)/g - 2). Let l = s + -991/5. What is the common denominator of -89/18 and l? 126 Suppose 2o + i = -768, -3o - o - 3i = 1540. Let c be (30435/50)/((-8)/(-5)). Let q = o + c. Calculate the common denominator of 61/22 and q. 176 Let t = -104105/2 + 51053. Let k = 47971/48 + t. What is the common denominator of k and 113/6? 48 Suppose 118 = 5p - w - 3w, -w + 20 = p. Suppose -p = -z - 5k, 4k = 2k + 4. Calculate the least common multiple of z and 33. 132 Let v(z) = 6z2 + z + 6. Let f be v(-4). Suppose 3i = 4i + 27. Calculate the common denominator of f/i9/6 and 6/11. 99 Calculate the common denominator of 131/6 and (12/(-18))/(32/(-856)). 6 Let i = 171 - 167. What is the lowest common multiple of i and 2? 4 Suppose -4i - 3h + 1 = -9*i,	{ "pile_set_name": "DM Mathematics" }
(-1716)/308. -3/7 What is (9 + -4)1134/(-4050)(-4)/(-14)? -2/5 What is the value of (-33)/(29733/34) - (-1356)/2226? 4/7 Evaluate 32/(-2) + 84/13423225619. 3/94 Evaluate 34386/3946846 - 1/13. 40 Calculate (-64)/8 + ((-90)/(-19) - (-308 - -305)). -5/19 What is ((-6)/(-5))/((-150)/(-13125)) + 6? 111 What is the value of ((-9)/6)/((-3585)/14346/710)? 71 Calculate 1017/(-25) + 32/400 + (-78)/(-30) + -3. -41 What is 886/152 + (-7160)/(-17005)? 25/4 What is (0 + (-12)/(-60) - (-1 + 1)) + (-5056)/29230? 1/37 Evaluate 1305/174(-21484)/1965. -82 What is 8160/432 - ((-261)/(-81))/(-29)? 19 Evaluate (3350/225)/(-5 + (2 - (-400)/144)). -67 ((-17)/2)/(4/(-36) - (414/(-324))/(-23)) 51 Calculate 765/2295(-36)/(2 + 0) + -64. -70 Evaluate 4/10 + (-84)/10 + (57038/608 - 86). -3/16 Calculate 11656593/(-187362) + -1(-3)/14. -62 Evaluate (-23783)/4197324/(-102). 18 What is the value of 24/120(-1)/(-4)? 1/20 (-39)/(-7) + (-678)/(-1582) - (1 - 49) 54 Calculate (-9)/(297/6) - ((-58)/232)/(44/186). 7/8 What is 786/21615 + 40415/275 + 1? 148 Evaluate 5844/(-195) - 240/(-8). 2/65 What is (-1 - (-138)/135)/((-161)/(-690) + 6/9)? 2/81 Evaluate (14/(-72))/((-50575)/72250). 5/18 -22 + (-1148)/(-231978)82(-222)/(-4) 12/23 What is the value of (-2)/(-4)2027/(-756)14 + -25? -30 What is (-24)/(-195)((5 - 2)/(-18))/(1460/2190)? -2/65 What is the value of 3439/1729 - ((-5)/10 - (-1 - (-9)/(-6)))? -1/91 What is the value of 6402/(-97097) + 2/(-26)? -1/7 What is ((3 + -2)/(10/60018))/((-2)/(-21))? 35 Evaluate (18/(-11) + 210/55 + -4)/((-176)/968). 10 What is the value of (22/(-3300)36-15)/(44/(-10))? -9/11 What is (-32)/(-5)(-9521)/(-533176)? 4/35 Evaluate (-44)/(-7)(713 + -706). 44 Calculate (-5 - -99) + 766 + -779. 81 Calculate (39/468)/(1/45) - (-1 - -6). -5/4 Evaluate (50400/8820)/(9 - (-50)/70). 10/17 ((624/(-60) - -6) + 5)-2(-5)/46 3/23 Evaluate 1612/78(12 - (7 + 2)). 62 What is (29 - 161813/5562)/((-35)/2583)? 41/6 What is 2(5/(-5) - (-12 - (756/(-8))/(-21)))? 31 -43/66 + (105/475 - 82/3895) 1/55 What is 34 - (-64 + (-2479)/(-37))? 31 Evaluate (6/(-5)(-65)/117)/(13/((-2262)/(-4))). 29 What is the value of 11/(-154)98(1 + -2)/(7/119)? 119 1392/(-34) + 2115/(-35955) -41 Calculate (-3791)/5753420/(-85). 2/129 What is the value of 19 - 10 - (-210)/357-15? 3/17 What is (-11164)/180 - (-21576)/348? -1/45 What is the value of 2786/25074 + 453/(-2)64/216? -67 What is the value of (6/16)/(99/66) - 407/1276? -2/29 Calculate 870/(-78) + 700/4550. -11 Evaluate -142 - 12887/(-70) - (-36)/40. 43 (17364/(-22))/6 - ((-14306)/253 - -56) -131 (8/(-48))/((-16)/(-1260)) + 8/(-384)-6 -13 What is the value of (((-16362)/(-8383))/(-81))/(-1)? 2/83 What is the value of 46580/32606(-7)/2? -5 Evaluate (55/3)/(-11 + ((-8)/80 - (-3553)/330)). -55 What is the value of 8/100 + (-622/45)/((-170)/(-5916))? -102 2(-4 + -1 - 132/110)/2 -31/5 What is ((-4)/(-242))/(3523/348777)? 18/11 4/(-9)4305/(-140) + (-64 - -50) -1/3 Evaluate ((-12)/(-16))/((-22)/((-2992)/3)). 34 What is the value of (30328/25422)/(6/(-57))? -34/3 What is the value of 1382/154 - (-8398)/323323 - (-52)/(-10)? 19/5 -1((-378)/168)/((-9)/36) -9 Evaluate ((-1026)/(-14364) + 10/(-42))(0 - (-12)/(-22)). 1/11 ((-2)/(-620))/((-31)/(5425/70)) -1/24 Evaluate (4698/45)/(-9) - (1/(-5))/((-63)/756). -14 Evaluate ((-74953)/(-11084) - (92/16 - (6 - 1))) + -6. 2/163 Calculate -27 - ((-5)/(-2) - (-115)/46). -32 Evaluate ((-7452)/1104)/((-63)/(-28)) + (-514)/(-128) + -1. 1/64 What is ((-621)/483)/(24/520) + (-1)/7? -28 What is -70((-18984)/(-560) - 34)? 7 (-9)/6 - (8/(3696/(-783)) - (-18)/63) -1/11 Calculate (-13626)/2064 + (-159)/424 - (-7)/1. 1/43 What is (-2)/360(-13)/416-4? -5 What is (-4473)/(-639) - (((-3114)/44)/(-9) - 1)? 3/22 What is the value of (-8)/(-14) + (-760 + 795 - (-19008)/(-532))? -3/19 What is the value of 16(36 - 9548/264) + 167/3? 53 What is 64/2 - 92(-154)/(-1771)? 24 What is (104052/(-58))/46 + 12? -27 Evaluate 1/(92/(-30))(7052/410 - 18). 6/23 What is (1164459/(-833514) + -1 + (-11)/(-6))/3? -1/173 (-61)/((-1708)/(-1120)) + -85(-2)/10 -23 (-50 + (-2 + 3 - -1))/(16838/16838) -48 What is ((-540)/(-5940))/((-1 - 0)2/2)? -1/11 (4518/154365)/((-6)/10) -2/41 What is the value of (-1 - 0) + (20816/(-4644))/(-4) - (-20)/(-270)? 2/43 Evaluate (-1582564)/25162/(-74). 17 Calculate (0 - 1 - (-186)/171)45726/38105. 2/19 What is 413400/(-22260)14/(-10)? 26 (296/(-6))/((204140/10710)/((-2)/1)) 37 What is the value of ((11/(1925/20))/(22/15))/((-512)/(-1792))? 3/11 Evaluate 16 - 10(-975)/(-500). -7/2 18 - (277500/(-325))/(-50) 12/13 What is the value of (9/(-15) - 0)/(66/(-2750))? 25 Calculate (-100)/(-64)(-18512)/(-5785). 5 Calculate 659/(-3954) + 4 + (-14)/12. 8/3 Evaluate (945000/1035)/40 + -23. -4/23 Calculate ((-84)/(-92)23)/3. 7 Calculate (1/11)/(144(-191)/(-16942464)). 56 What is the value of ((-15)/21)/(381/(-762))? 10/7 Evaluate (-2050)/(-205) - 5/(-15)-35. -5/3 Evaluate (873/1261)/((-14)/(-182)). 9 What is ((-14040)/(-4896))/(-195)(0 + 16/(-14))? 2/119 (-71 + (10 - -53))2/1 -16 (337/674)/(-8 + (-7740)/(-968)) -121 What is the value of 1775/1125 + ((-260)/(-36) - 7)? 9/5 What is 132/16 - (12 + (-918)/72)? 9 What is 86436/(-10290)(6 - 1)? -42 Evaluate (-273)/(-240) + (-83)/(-1328) + 86/20. 11/2 What is the value of (-2)/95 - (-99)/(300960/27424)? 9 What is 72/40 + 1265(-22)/(-275)? 103 Evaluate 7636/897((-3)/4)/(-1) + -6. 5/13 What is the value of 10/4((-18)/143 + 12/(-66))? -10/13 What is the value of (8/15 - 1) + ((-21)/72)/((-2499)/2856)? -2/15 What is the value of 2880/10800 - 3808/(-120)? 32 (15 - -1) + -1 + (822330/(-9450) - (-2)/105) -72 Evaluate (-2 - 42) + 64935/1480. -1/8 Calculate 15 + (600 - 546)/((-2 + 3)-2). -22 Evaluate 80/56 + 336648/(-4648). -71 (-1755)/99 + 14/770-15 -18 (-120)/(-3) - 31(-3654)/1798 103 Evaluate 118904/(-209684) + 4/(-62). -12/19 Calculate ((-90)/(-4))/((-561429)/45368). -20/11 What is the value of 1448/1086 + ((-24)/270)/((-4)/(-102))? -14/15 Calculate (231/2156)/(27/(-96))29/(-6). 8/7 30 - (-90)/60(-288)/(-27) 46 Calculate 3333/14443 + (-349)/1625. 2/125 1/(-5) - 264/30 - (14 - (-1207)/(-51)) 2/3 -100(-17908)/78650 + -23 + 0 -3/13 What is the value of ((-48)/(-3087))/((-17344)/(-15176))? 2/147 What is the value of 6069/1734(3 + 3)/(((-105)/(-4))/(-5))? -4 21516/(-825) + 19 + 1/1 - -6 -2/25 Calculate (-38 - 183739/(-4902)) + 16/32. -1/57 What is (2 - 11 - (107 + -125)) + 668/(-74)? -1/37 Evaluate 370/(-444)(-15)/25((-35)/(-40) - 1). -1/16 What is the value of (-22 + 2)(34 + 9855/(-292))? -5 What is the value of (127 - 119025/900)/(14/(-16))? 6 What is the value of 0/((-114)/(-133) + 6/18 + (-67)/21)? 0 7781 + -7694 + 1-60 27 What is (954/30 - 1)/(100/75-6 - -6)? -77/5 Calculate -8 + (-3)/360-1130 + -1. 5/12 ((-6013)/5154(-8)/(-14))/((-8)/6)26 13 Calculate -114509/(-27027) - (-297)/(-429). 8/7 Calculate (22 - 8)/((-22386)/(-492)). 4/13 Calculate 23 + (-476)/(-17)(-18)/(-21). 47 What is 23/(2392/2808) + 0 + -9? 18 Calculate ((-3)/6 + 3)/((-5634)/23788) + 9. -14/9 What is (-156)/240 - 10/(-25) - ((-98)/56 + 4)? -5/2 Evaluate (88/((-7920)/(-675)))/((-9)/42) - -3. -32 What is the value of 7 + ((-1491)/(-9))/(-7) + (131 - 130)? -47/3 What is the value of (16/(-150))/((-60196)/(-447) - 134)? -4/25 Evaluate (1380/(-90))/((-104)/(-156)). -23 (23 - (-700)/(-28))(-8)/(-48)3-25 25 What is (-60)/35(-40)/(-60) + 888/42? 20 ((-2)/(-4)((-2975)/70 - -39))/(1 + -2) 7/4 Calculate (-5)/174(-680)/(-238) + 500/(-84) + 6. -1/29 What is the value of ((-2752)/9632)/((-2)/(-56))? -8 (-3906)/105(25/(-20) - 0)20/15 62 What is the value of (348/(-819) - (-458)/4809)/(5/(-42))? 36/13 What is (-26)/(-1482) - (-657)/21033? 2/41 Evaluate (-90)/2(-147536)/(-92210). -72 (-3450)/(-9108)(-72)/(-120) 5/22 Evaluate 27 + 52/2496 + 65859/(-2448). 2/17 Evaluate (-46)/(-161) - (-25)/(69300/(-708)). 1/33 What is the value of ((-2)/8)/((-999)/228) - 57/(-12825)-25? -2/37 What is the value of 96/(-1008)(-13 - 8)(-2)/32? -1/8 29/(261/6) + 34/(-114) 7/19 Evaluate (-1358)/1386 - (20 + (-1128)/54). -1/11 Evaluate (-1038)/(-10) - (-1244754)/49395. 129 What is the value of 52620/(-1160) - ((-10704)/1200 + 4/(-50))? -2/29 What is 13/(5070/(-1079)) - (-31)	{ "pile_set_name": "DM Mathematics" }
806? 2, 3806903 List the prime factors of 2071772. 2, 157, 3299 List the prime factors of 2315308. 2, 578827 List the prime factors of 1316270. 2, 5, 131627 What are the prime factors of 1140636? 2, 3, 7, 37, 367 List the prime factors of 3818915. 5, 53, 14411 List the prime factors of 695900. 2, 5, 6959 What are the prime factors of 1281712? 2, 80107 List the prime factors of 2130255. 3, 5, 47339 What are the prime factors of 1708793? 61, 109, 257 What are the prime factors of 13242871? 23, 575777 List the prime factors of 155121. 3, 29, 1783 What are the prime factors of 2327869? 2327869 List the prime factors of 1427268. 2, 3, 83, 1433 What are the prime factors of 257430? 2, 3, 5, 8581 What are the prime factors of 667170? 2, 3, 5, 7, 353 What are the prime factors of 2392493? 149, 16057 List the prime factors of 5428960. 2, 5, 33931 List the prime factors of 16681286. 2, 31, 113, 2381 List the prime factors of 39717. 3, 1471 List the prime factors of 65726. 2, 59, 557 What are the prime factors of 192554? 2, 43, 2239 What are the prime factors of 224203? 7, 32029 What are the prime factors of 759537? 3, 9377 What are the prime factors of 41147356? 2, 10286839 What are the prime factors of 166690? 2, 5, 79, 211 List the prime factors of 596122. 2, 17, 89, 197 List the prime factors of 14309514. 2, 3, 264991 What are the prime factors of 259645? 5, 51929 List the prime factors of 3440787. 3, 7, 163847 List the prime factors of 13709094. 2, 3, 7, 103, 3169 What are the prime factors of 380827? 229, 1663 What are the prime factors of 500339? 7, 10211 List the prime factors of 2632844. 2, 658211 What are the prime factors of 2694693? 3, 898231 What are the prime factors of 1571495? 5, 314299 List the prime factors of 3107778. 2, 3, 37, 13999 What are the prime factors of 6577880? 2, 5, 164447 List the prime factors of 1663003. 1031, 1613 List the prime factors of 19355. 5, 7, 79 List the prime factors of 7502523. 3, 7, 357263 What are the prime factors of 2982020? 2, 5, 149101 List the prime factors of 21404. 2, 5351 List the prime factors of 568095. 3, 5, 11, 313 List the prime factors of 515915. 5, 103183 List the prime factors of 1638478. 2, 819239 List the prime factors of 256616. 2, 32077 What are the prime factors of 6953054? 2, 1669, 2083 What are the prime factors of 12181085? 5, 7, 348031 What are the prime factors of 406951? 406951 What are the prime factors of 8175687? 3, 13, 41, 5113 List the prime factors of 691826. 2, 37, 9349 List the prime factors of 18121052. 2, 4530263 What are the prime factors of 511058? 2, 59, 61, 71 List the prime factors of 432085. 5, 103, 839 List the prime factors of 961936. 2, 59, 1019 What are the prime factors of 5897189? 71, 83059 What are the prime factors of 18366534? 2, 3, 340121 What are the prime factors of 198658? 2, 71, 1399 List the prime factors of 684638. 2, 342319 What are the prime factors of 1522601? 1522601 What are the prime factors of 227406? 2, 3, 151, 251 List the prime factors of 1723126. 2, 861563 What are the prime factors of 2365396? 2, 11, 53759 What are the prime factors of 857562? 2, 3, 47, 3041 What are the prime factors of 126355? 5, 37, 683 List the prime factors of 10602639. 3, 43, 27397 List the prime factors of 1090668. 2, 3, 97, 937 What are the prime factors of 7841734? 2, 3920867 List the prime factors of 285480. 2, 3, 5, 13, 61 What are the prime factors of 548104? 2, 131, 523 What are the prime factors of 890971? 31, 41, 701 List the prime factors of 123568. 2, 7723 List the prime factors of 941734. 2, 470867 What are the prime factors of 10600292? 2, 2650073 List the prime factors of 14689306. 2, 7344653 List the prime factors of 1320429. 3, 11, 40013 What are the prime factors of 56403? 3, 2089 List the prime factors of 1558336. 2, 13, 1873 List the prime factors of 2463015. 3, 5, 164201 What are the prime factors of 3595678? 2, 1797839 What are the prime factors of 15289? 15289 List the prime factors of 1887037. 37, 51001 What are the prime factors of 177221? 11, 16111 List the prime factors of 2885830. 2, 5, 288583 What are the prime factors of 30692558? 2, 13, 73, 103, 157 List the prime factors of 555108. 2, 3, 167, 277 List the prime factors of 214684. 2, 191, 281 What are the prime factors of 103213? 11, 853 List the prime factors of 306320. 2, 5, 7, 547 What are the prime factors of 794812? 2, 43, 4621 List the prime factors of 428694. 2, 3, 7, 59, 173 What are the prime factors of 1156574? 2, 463, 1249 List the prime factors of 4250011. 67, 229, 277 List the prime factors of 113544. 2, 3, 19, 83 What are the prime factors of 2966131? 7, 491, 863 List the prime factors of 1125110. 2, 5, 7, 16073 List the prime factors of 546654. 2, 3, 31, 2939 List the prime factors of 512483. 67, 7649 List the prime factors of 6659068. 2, 13, 79, 1621 List the prime factors of 7753279. 83, 109, 857 List the prime factors of 6833905. 5, 13, 105137 List the prime factors of 9011072. 2, 7, 89, 113 List the prime factors of 298294. 2, 29, 37, 139 List the prime factors of 76568. 2, 17, 563 What are the prime factors of 3047484? 2, 3, 11, 23087 What are the prime factors of 5496838? 2, 47, 58477 What are the prime factors of 488019? 3, 7, 17, 1367 List the prime factors of 1378566. 2, 3, 7, 521 List the prime factors of 13264514. 2, 23, 288359 What are the prime factors of 5160934? 2, 2580467 List the prime factors of 14281164. 2, 3, 132233 List the prime factors of 1594407. 3, 107, 4967 List the prime factors of 39214125. 3, 5, 1291 What are the prime factors of 6512307? 3, 19, 43, 2657 What are the prime factors of 819208? 2, 13, 7877 What are the prime factors of 59661? 3, 7, 947 What are the prime factors of 8294808? 2, 3, 37, 9341 What are the prime factors of 755737? 755737 What are the prime factors of 1073617? 23, 46679 List the prime factors of 204972. 2, 3, 19, 29, 31 List the prime factors of 178885. 5, 7, 19, 269 What are the prime factors of 277032? 2, 3, 7, 17, 97 List the prime factors of 606177. 3, 11, 13, 157 List the prime factors of 521360. 2, 5, 7, 19 What are the prime factors of 6487714? 2, 509, 6373 List the prime factors of 5813671. 461, 12611 What are the prime factors of 12736147? 2801, 4547 What are the prime factors of 135815? 5, 23, 1181 List the prime factors of 8231420. 2, 5, 97, 4243 List the prime factors of 759053. 759053 List the prime factors of 45823. 45823 What are the prime factors of 4824412? 2, 139, 8677 What are the prime factors of 2085? 3, 5, 139 List the prime factors of 10385356. 2, 2596339 What are the prime factors of 47080? 2, 5, 11, 107 List the prime factors of 1559125. 5, 12473 What are the prime factors of 461390? 2, 5, 29, 37, 43 What are the prime factors of 26093125? 5, 83, 503 List the prime factors of 5151169. 5151169 List the prime factors of 2532716. 2, 401, 1579 List the prime factors of 39181. 39181 List the prime factors of 1178015. 5, 17, 13859 List the prime factors of 1582005. 3, 5, 105467 What are the prime factors of 34646? 2, 17, 1019 What are the prime factors of 197766? 2, 3, 10987 What are the prime factors of 10483079? 19, 71, 409 What are the prime factors of 6109318? 2, 239, 12781 What are the prime factors of 1856423? 241, 7703 List the prime factors of 415380. 2, 3, 5, 7, 23, 43 List the prime factors of 48498. 2, 3, 59, 137 What are the prime factors of 167678? 2, 7, 29, 59 List the prime factors of 12468759. 3, 113, 36781 What are the prime factors of 738076? 2, 37, 4987 What are the prime factors of 2587685? 5, 673, 769 What are the prime factors of 241187? 43, 71, 79 What are the prime factors of 615885? 3, 5, 19, 2161 What are the prime factors of 734610? 2, 3, 5, 47, 521 List the prime factors of 12707982. 2, 3, 7, 33619 What are the prime factors of 1323077? 7, 189011 List the prime factors of 65608. 2, 59, 139 What are the prime factors of 2299180? 2, 5, 13, 37, 239 What are the prime factors of 1096853? 1096853 What are the prime factors of 7477760? 2, 5, 23, 127 List the prime factors of 69218. 2, 53, 653 List the prime factors of 306857. 306857 What are the prime factors of 6720996? 2, 3, 560083 What are the prime factors of 6541259? 223, 29333 List the prime factors of 1933495. 5, 1	{ "pile_set_name": "DM Mathematics" }
-3/4n + tn*2 + 1/2. (n - 2)(n - 1)/4 Let u(z) = -8z3 - 23z*2 + 52z - 36. Let m(i) = 15i3 + 45i*2 - 105i + 70. Let o be 2/(-13) + (-296)/104. Let l(k) = om(k) - 5u(k). Factor l(t). -5(t - 1)2(t + 6) Let 2i3 + 5504/3 + 12392/3i*2 + 49544/9i = 0. Calculate i. -2064, -2/3 Let b be (-11)/(-2) - (-793)/122. Let w(j) = 20j - 237. Let o be w(b). Find f, given that 0 - f2 + 0f - 7/2fo = 0. -2/7, 0 Let t(l) be the second derivative of 2l*7/105 + 8l*6/75 - 3l*5/25 - 6l*4/5 - 2l - 16. Find c, given that t(c) = 0. -3, 0, 2 Let f be (357/(-6545))/(14/(-770)). What is k in 10/19k + 0 + 2/19k*f + 12/19k*2 = 0? -5, -1, 0 Let r(i) be the second derivative of -441i*6/10 - 1017i*5/20 + 475i*4/2 - 146i*3 - 60i2 + i - 682. Solve r(z) = 0. -2, -5/49, 2/3 Let m(i) be the first derivative of -i5/40 - 17i4 - 9248i3/3 - 8316. Factor m(s). -s2(s + 272)2/8 Suppose 44a = 56a - 36. Let q be (-205)/123a/(-15). Solve -2/3 - qk + 1/3k*3 + 2/3k2 = 0. -2, -1, 1 Let k(g) be the first derivative of g7/525 - 2g6/75 - 17g*2 - 2g - 187. Let u(z) be the second derivative of k(z). Let u(l) = 0. Calculate l. 0, 8 Let h = 398 + -393. Suppose 224c + 12 = 228c - 4t, -7 = -c + ht. Determine d so that -5/8dc + d + 1/8d*3 - 1/2 = 0. 1, 2 Solve 6016h*2 - 476 - 1649 + 2120h - 12016h2 + 6005h2 = 0. -425, 1 Let n(m) be the third derivative of m6/420 + 113m5/70 - 3m*2 - 106. Let n(s) = 0. What is s? -339, 0 Let n(q) be the first derivative of -5q*3/3 + 335q*2/2 - 1830q - 6209. Factor n(r). -5(r - 61)(r - 6) Let h(i) = 5i2 - 5. Let b(x) = -23 - 28 + x - 23 + 53 + 22x*2. Let q(p) = -4b(p) + 18h(p). Suppose q(c) = 0. What is c? -1, 3 Let g(l) = 23l + 1679. Let m be g(-73). Let x(i) be the second derivative of 1/48i4 + 0i*3 + 0i*2 + m - 11i + 1/120i6 - 1/40i5. Factor x(f). f2(f - 1)2/4 Let s be ((-65)/(-26))/(11/4466). Let d = 1018 - s. Let 0f + 0 + 2/3f5 - 2/3f*d + 2/3f*2 - 2/3f*4 = 0. What is f? -1, 0, 1 Find p, given that 1248p*2 + 206043p + 958p3 - 59858 + 10812p*2 - 783p*3 = 0. -173/5, 2/7 Solve 34h - 119h - 139h - 44h2 + 160h*2 - 4h*3 - 32h*2 + 144 = 0 for h. 1, 2, 18 Let k = -53 - -80. Let a be (-6)/3 - (4 - 3)-6. Suppose 4s2 - ks + 11s3 + 25s - 36sa + 23s*5 - 5s*5 + 5s*3 = 0. Calculate s. -1/3, 0, 1/3, 1 Suppose 0 = 5q - 10 - 0. Suppose -z - 4 = -2w, qz = -3w - 2z + 6. Factor -wb - 6b + 31b2 - 35b*2. -4b(b + 2) Let g(k) be the third derivative of -2k*2 + 0k + 0k3 + 1/315k*7 + 0k*4 + 0k*5 + 3 + 1/45k6. Let g(n) = 0. What is n? -4, 0 Let a(p) be the second derivative of -p4/21 - 340p3/7 - 130050p2/7 + p - 299. Let a(b) = 0. Calculate b. -255 Let m(c) be the third derivative of -c6/24 - c*5/3 + 55c*4/24 + 25c*3 + 6738c2. Suppose m(o) = 0. What is o? -5, -2, 3 Let a(g) be the third derivative of g5/30 - 83g4/12 + 322g*3 - 2368g*2 - 2. Let a(o) = 0. Calculate o. 14, 69 Let f be 924/126 + 7(-2 - -1). Let l be (1/(-6))/(-1) + 0. Find c, given that -fc + 0 + lc*2 = 0. 0, 2 Let z(j) = -156j*2 - 142j + 5. Let u(d) = 310d2 + 285d - 10. Let v(k) = 3u(k) + 5z(k). Determine a so that v(a) = 0. -1, 1/30 Suppose 0 = i, -3d = -2d + 5i. Suppose d = -l + 17 - 11. Determine n so that -20n*2 + ln - 22n + 13n*3 - 17n*3 = 0. -4, -1, 0 Suppose -154o*4 + 4974o*2 + 84o*4 - 373o*4 + 4512o - 76o4 + 412o*5 - 1440 - 496o*5 + 207o*3 = 0. Calculate o. -4, -10/7, 1/4, 3 Solve -1/2k*4 + 0 + 1/2k*2 - 1/4k*5 - 6k + 25/4k3 = 0 for k. -6, -1, 0, 1, 4 Let r(s) = 6s - 21 + 7s + 22s - 11s. Let n(o) = -o2 + 25o - 20. Let k(w) = -3n(w) + 4r(w). Solve k(h) = 0. -8, 1 Solve -17/5g2 + 1/5g*3 + 0 - 168/5g = 0 for g. -7, 0, 24 Let n be (-234 - -216) + (-289)/(-16). Let k(b) be the first derivative of 42 - 9/4b - 3/8b*2 + 5/12b*3 - nb4. Factor k(y). -(y - 3)2(y + 1)/4 Suppose 5k + 2n = 2, 3k + 0 = -n + 2. Suppose 3c - 60 = -3h, -5h = 2c - 17 - 74. Factor -h - 5l2 + 5 - 2l + 7lk. 2(l - 3)(l + 2) Let g(n) be the third derivative of n6/360 + 5n*5/18 + 47n*4/18 + 92n*3/9 - 5n*2 - 53n. Factor g(w). (w + 2)*2(w + 46)/3 Let t = -2207 - -15506/7. Let f = t - 54/7. Factor 0 - 3/7n2 + fn. -3n(n - 1)/7 Let c(h) be the first derivative of -h4/66 + h3/3 - 10h2/11 + 122h - 20. Let b(l) be the first derivative of c(l). Factor b(j). -2(j - 10)(j - 1)/11 Let 568/5t + 0 + 1708/5t*2 + 12/5t*3 = 0. Calculate t. -142, -1/3, 0 Factor 598w - 3w2 + 0w*2 - 8w*2 + 441 + 9w*2 + 159. -2(w - 300)(w + 1) Suppose 0 = 216b - 215b - 2. Let c(j) = -j3. Let v(y) = -27y*3 + 200y*2 + 103y + 13. Let u(r) = bv(r) - 22c(r). Factor u(a). -2(a - 13)(4a + 1)2 Let j = 43 + -28. Factor -25t*5 + 2t*3 + 10t4 + t3 - jt3 + 23t*5. -2t*3(t - 3)(t - 2) Let q(h) = -h3 - 10h*2 - 2h - 2. Let l be q(-10). Let d(a) = 5a2 + 41a + 9. Let x(f) = f*2 + 10f + 2. Let j(k) = lx(k) - 4d(k). Factor j(s). -2s(s - 8) Let m(f) be the first derivative of 3f4/16 + 51f*3/4 - 60f*2 + 81f - 1165. Factor m(y). 3(y - 2)(y - 1)(y + 54)/4 Let b(o) be the second derivative of 0o*3 + 0 + 0o*2 + 47o - 1/6o5 + 7/9o*4. Solve b(r) = 0 for r. 0, 14/5 Let j = 5456 + -2946239/540. Let l(b) be the third derivative of 1/54b*4 + 1/90b*5 + 0 + 0b*3 + 0b - 10b2 + jb*6. Factor l(u). 2u(u + 1)(u + 2)/9 Factor 2u + 10/3u*3 - 28/3u*2 + 15 - 1/3u*4. -(u - 5)(u - 3)*2(u + 1)/3 Let p(u) = -2u + 28. Let i be 4 + 8 - (1 - (-6)/(-3)). Let h be p(i). Determine r so that -5r + 2r - 5r - r*2 + 5rh = 0. 0, 2 Let q(o) be the third derivative of -o7/315 + 43o6/5 - 49923o*5/5 + 6440067o*4 - 2492305929o*3 - 997o*2. Factor q(r). -2(r - 387)*4/3 Let w(z) = -3z - 34. Let o be w(-12). Suppose -h = 5q - 13, 0q + oh = 3q. Factor -u*q - 7u + 6u2 - 2u + 4u. 5u(u - 1) Let a(y) be the second derivative of -y5/100 + 19y*4/15 + 31y*3/6 + 39y*2/5 + 2283y. Factor a(u). -(u - 78)(u + 1)2/5 Suppose 5 - 33 = -14u. Suppose -8 - 4k + 0k + 0k + 2k*u - 2k = 0. What is k? -1, 4 Let r = -62 - -67. Let d be 5 - 0/(-2 + r). Let da - 15a*5 - 27a - 6a4 + 6a*2 + 24a*3 + 13a = 0. Calculate a. -1, 0, 3/5, 1 Let m(i) be the first derivative of -5i6/6 - 43i*5 - 370i*4 - 2800i*3/3 + 3898. Let m(d) = 0. Calculate d. -35, -4, 0 Let j(o) = 4o*4 + 46o*3 + 258o*2 + 70o - 336. Let c(m) = m3 - m2 + m - 4. Let s(k) = -14c(k) - j(k). Determine u so that s(u) = 0. -7, -2, 1 Let i(m) be the second derivative of m7/210 + 7m*6/150 - 3m*5/50 - 17m*4/30 + 53m*3/30 - 21m*2/10 + 895m + 2. Factor i(x). (x - 1)*3(x + 3)(x + 7)/5 Let i(j) be the third derivative of 1/1680j*8 - 1/60j*4 + 0 + 1/100j*5 + 1/600j*6 + 0j + 0j3 + 162j*2 - 1/350j7. Let i(q) = 0. What is q? -1, 0, 1, 2 Let a(v) be the second derivative of -v6/660 - 2v5/165 - v4/33 + 75v*2/2 - 11v - 1. Let l(z) be the first derivative of a(z). Factor l(p). -2p(p + 2)*2/11 Suppose 41m = 62m - 11298. Let x = m - 1067/2. Determine v, given that -3 - xv - 3/2v2 = 0. -2, -1 Let y be ((-17 - 3) + -3)(-3 + 0). Let 0 - 8a + 4 - ya*2 + 73a*2 = 0. Calculate a. 1 Let f be (4 - -6)/5 + 8. Suppose -5p - 4k + 18 = 0, -p = 5k - f - 2. Factor t*2 + 0t*2 - 16t*4 + 7t*p + 4t*3 - 6t*5 - 6t*5. -4t*2(t + 1)*2(3t - 2) Find u such that 125u - 45u3 + 303u + 22u + 10u*4 + 280 + 2346u*2 - 2591u2 = 0. -4, -1/2, 2, 7 Let q(p) be the second derivative of -p4/4 + 49p3/2 + 588p*2 + 3461p. Suppose q(x) = 0. What is x? -7, 56 Let f be 126/(-27)12/(-14). Suppose fp + 2 = -3v, -3v + 5 = -3p - 7. Factor 16b + 4b2 + 46 - 14 - 2b*v. 2(b + 4)2 Let m(d) be the second derivative of d8/448 - d*6/160 - 123d*2/2 - 5d - 4. Let u(o) be the first derivative of m(o). Factor u(r). 3r3(r - 1)(r + 1)/4 Let v(l) = 8055l + 32220. Let j be v(-4). Let -4/9m4 + 0m + 2/9m5 + jm*3 + 0 + 0m2 = 0. What is m? 0, 2 Let y(f) be the first derivative of -f4/14 - 54f3/7 + f2/7 + 162f/7 - 623.	{ "pile_set_name": "DM Mathematics" }
g3/9 + 20g*2/3. -4g*2(g - 15)/9 Determine k so that -k*5/6 - 10k*4/3 - 47k*3/2 - 203k*2/3 - 196k/3 = 0. -7, -4, -2, 0 Factor -l*2/2 + 161l/2. -l(l - 161)/2 Factor -2g*4 - 84g*3 - 576g*2 - 1088g. -2g(g + 4)*2(g + 34) Solve -2d4/3 - 106d*3/3 + 276d*2 - 240d = 0. -60, 0, 1, 6 Factor 392u4 - 616u*3 - 1158u*2 + 1100u + 1250. 2(u + 1)2(14u - 25)2 Factor 3l*4 + 765l*3 + 759l*2 - 765l - 762. 3(l - 1)(l + 1)*2(l + 254) Solve 3l4 + 21l*3 - 2361l*2 + 6891l - 4554 = 0. -33, 1, 2, 23 Suppose 3l4/4 + 9l*3/2 - 6l*2 - 9l/2 + 21/4 = 0. Calculate l. -7, -1, 1 Factor -2b2 - 104b - 102. -2(b + 1)(b + 51) Let -f*3 + 8f*2 - 16f = 0. What is f? 0, 4 Let -2n2/3 - 22n + 68/3 = 0. Calculate n. -34, 1 Factor 4b4 - 8b*3 - 76b*2 + 80b. 4b(b - 5)(b - 1)(b + 4) Determine d so that -2d3 + 482d*2 = 0. 0, 241 What is b in 4b*3/5 - 8b*2/5 - 76b/5 + 16 = 0? -4, 1, 5 Suppose -x*5/3 + 52x*4/3 + 36x*3 + 2x*2/3 - 107x/3 - 18 = 0. What is x? -1, 1, 54 Factor 2v5 - 6v*4 + 2v*3 + 6v*2 - 4v. 2v(v - 2)(v - 1)2(v + 1) Factor -12h4 - 80h*3 - 192h*2 - 192h - 64. -4(h + 2)3(3h + 2) Factor -2s*4/9 + 62s*3/3 - 480s*2. -2s*2(s - 48)(s - 45)/9 Factor -s3/2 + 5s*2/2 + 7s. -s(s - 7)(s + 2)/2 Find t such that -28t5 + 316t*4 - 60t*3 - 316t*2 + 88t = 0. -1, 0, 2/7, 1, 11 Suppose -15q2/2 + 51q + 21/2 = 0. Calculate q. -1/5, 7 Solve 4z4 + 32z*3 + 96z*2 + 128z + 64 = 0 for z. -2 Let -138m4 - 694m*3 - 20m*2 = 0. What is m? -5, -2/69, 0 Let -10x*4/13 - 64x*3/13 - 14x*2/13 + 64x/13 + 24/13 = 0. What is x? -6, -1, -2/5, 1 Factor -3u3/5 + 78u*2/5 + 3u/5 - 78/5. -3(u - 26)(u - 1)(u + 1)/5 Let -2n*3/3 + 8n*2 - 70n/3 = 0. Calculate n. 0, 5, 7 Let 2p3/9 + 238p*2/9 + 2320p/3 - 800 = 0. What is p? -60, 1 Factor 2w3/3 + 14w*2/3 + 32w/3 + 8. 2(w + 2)2(w + 3)/3 Let f*5 + 2f*4 - 5f*3 - 6f*2 = 0. What is f? -3, -1, 0, 2 Find k such that -3k*5 - 3k*4 + 9k*3 + 15k*2 + 6k = 0. -1, 0, 2 What is b in -b*2 - 2370b = 0? -2370, 0 Factor -5f3 + 775f*2 + 2360f + 1580. -5(f - 158)(f + 1)(f + 2) Factor 4f*3 - 3457f*2/2 + 186840f - 23328. (f - 216)*2(8f - 1)/2 Factor 3x*2 - 237x. 3x(x - 79) Factor -2t3 - 106t*2 - 468t + 576. -2(t - 1)(t + 6)(t + 48) Find j such that -j3/12 - 143j*2/12 - 35j = 0. -140, -3, 0 Suppose z*5/6 - 11z*4/3 - 58z*3 - 87z*2 + 297z/2 = 0. What is z? -9, -3, 0, 1, 33 Solve d*3/7 + 11d*2 - 489d/7 + 747/7 = 0 for d. -83, 3 Determine d so that 3d2/2 + 379d - 253/2 = 0. -253, 1/3 Let -3m2 - 1620m = 0. What is m? -540, 0 Factor 2r3/19 + 2r*2/19 - 4r/19. 2r(r - 1)(r + 2)/19 Factor 3k*3 - 81k*2 - 5844k - 5760. 3(k - 60)(k + 1)(k + 32) Factor t3/3 - t2/3 - 16t/3 + 16/3. (t - 4)(t - 1)(t + 4)/3 Solve 2z4/13 - 180z*3/13 - 366z*2/13 - 184z/13 = 0 for z. -1, 0, 92 What is q in 4q2/5 + 4q/5 - 8/5 = 0? -2, 1 Factor 5n2 - 670n + 1320. 5(n - 132)(n - 2) Find i such that 51i3/4 + 15i*2/2 - 783i/4 + 351/2 = 0. -78/17, 1, 3 Factor 2g3/7 - 24g/7 + 32/7. 2(g - 2)2(g + 4)/7 Find g such that -175g5 + 1345g*4 - 3485g*3 + 3515g*2 - 1380g + 180 = 0. 2/7, 2/5, 1, 3 Find d, given that -d*4/2 + 15d3/2 + d2/2 - 15d/2 = 0. -1, 0, 1, 15 Determine l, given that -l2/5 + 5538l/5 - 7667361/5 = 0. 2769 Factor 3g5 - 15g*4 + 6g*3 + 24g*2. 3g*2(g - 4)(g - 2)(g + 1) Suppose -h*5/4 + 49h*4/4 - 12h*3 = 0. What is h? 0, 1, 48 Solve 2p*2/7 + 4p/7 + 2/7 = 0. -1 What is v in v*2 + 46v + 529 = 0? -23 Find n such that n*5/3 - 12n4 - n3/3 + 12n2 = 0. -1, 0, 1, 36 Find k such that -4k*2/3 - 28k - 440/3 = 0. -11, -10 What is i in i*2 - 305i/2 - 153/2 = 0? -1/2, 153 Solve -2u5/3 + 170u*4/3 - 1534u*3 + 40390u*2/3 - 63700u/3 = 0. 0, 2, 13, 35 Let -3p5 + 51p*4 - 126p*3 - 780p*2 - 600p = 0. Calculate p. -2, -1, 0, 10 Factor m*5/2 - 8m*4 + 39m*3 - 56m*2 + 49m/2. m(m - 7)2(m - 1)*2/2 Solve -97w*2/9 + 2w/9 = 0. 0, 2/97 Determine c, given that -24c5/5 + 30c*4 - 177c*3/5 - 378c*2/5 + 567c/5 + 162/5 = 0. -3/2, -1/4, 2, 3 Factor -5g3 - 525g*2 - 15840g - 103680. -5(g + 9)(g + 48)2 What is x in x4/4 - 3x3 - 3x*2/4 + 19x/2 - 6 = 0? -2, 1, 12 Solve 2p2/3 + 34p/3 - 12 = 0. -18, 1 Suppose -25u4 - 115u*3 + 75u*2 + 115u - 50 = 0. Calculate u. -5, -1, 2/5, 1 Solve 28d5 + 60d*4 - 188d*3 - 252d*2 + 304d + 48 = 0. -3, -2, -1/7, 1, 2 Factor -3t2 + 27t + 660. -3(t - 20)(t + 11) Factor 2f3 - 66f*2 + 510f + 578. 2(f - 17)2(f + 1) Let -2l4/3 - 14l*3/3 + 20l*2/3 + 32l/3 = 0. What is l? -8, -1, 0, 2 What is i in 2i2 - 108i - 110 = 0? -1, 55 Determine s, given that 2s5/9 - 4s*3/3 - 16s*2/9 - 2s/3 = 0. -1, 0, 3 Find i such that 4i4 - 20i*3/3 - 44i*2/3 - 4i = 0. -1, -1/3, 0, 3 Solve 40a3/9 + 4a*2 - 28a/3 + 8/9 = 0. -2, 1/10, 1 Factor 2c2/7 - 564c/7 + 39762/7. 2(c - 141)2/7 Factor 5m*2 - 12050m + 7260125. 5(m - 1205)2 Factor -4q*3 + 12q*2 + 4q - 12. -4(q - 3)(q - 1)(q + 1) Factor -h4/3 + 25h*3/3 + 224h2/3. -h2(h - 32)(h + 7)/3 Factor 4h5 - 20h*4 - 7320h*3 + 186200h*2 - 1205740h - 1399236. 4(h - 19)3(h + 1)(h + 51) Determine o, given that 6o*2 - 9o/4 = 0. 0, 3/8 Determine x, given that -3x5/10 + 7x*4/5 - 17x*3/10 - 3x*2/5 + 2x - 4/5 = 0. -1, 2/3, 1, 2 Solve h*3/5 - 214h*2/5 + 2332h - 22472/5 = 0 for h. 2, 106 Solve -28f2 + 7716f - 4400 = 0. 4/7, 275 Factor 5o2 + 200o + 720. 5(o + 4)(o + 36) Factor y*2 + 46y - 432. (y - 8)(y + 54) Solve 8y*2 + 324y - 504 = 0. -42, 3/2 Suppose -64y5 - 2144y*4 - 5092y*3 - 4132y*2 - 1244y - 124 = 0. What is y? -31, -1, -1/4 Factor -2b3 + 36b*2 - 142b + 156. -2(b - 13)(b - 3)(b - 2) Factor r4/3 + 18r*3 + 100r*2 + 584r/3 + 128. (r + 2)*3(r + 48)/3 Find g such that -3g3 + 102g*2 - 267g - 372 = 0. -1, 4, 31 Let 205j2 - 1228j - 12 = 0. What is j? -2/205, 6 Factor -4o2/5 + 348o/5 - 1944/5. -4(o - 81)(o - 6)/5 Factor 4x3 + 4x*2 - 132x + 252. 4(x - 3)2(x + 7) Solve 6a4/5 - 76a*3/5 - 1606a*2/15 + 19448a/15 + 6936/5 = 0. -9, -1, 34/3 Suppose t*3/2 - 6t*2 - 43t/2 - 15 = 0. Calculate t. -2, -1, 15 Factor 2p5 - 2p*4 - 58p*3 + 90p*2 + 432p - 864. 2(p - 3)3(p + 4)*2 Let 6g*5 - 2870g*4/11 + 42024g*3/11 - 213408g*2/11 + 89152g/11 + 23520/11 = 0. Calculate g. -2/11, 2/3, 14, 15 Determine w so that 9w3/7 + 114w*2/7 - 39w/7 = 0. -13, 0, 1/3 Determine g, given that -3g2 - 2028g + 2031 = 0. -677, 1 Factor -s*2 - 3493s. -s(s + 3493) Factor y4/4 - 23y*3/2 + 481y*2/4 + 276y + 144. (y - 24)*2(y + 1)*2/4 Let -2b*2/7 + 2514b/7 = 0. What is b? 0, 1257 Factor -2a4 - 10a*3 + 26a*2 - 14a. -2a(a - 1)*2(a + 7) Factor -o*2 - 167o - 330. -(o + 2)(o + 165) Factor y5/7 + 46y*4/7 - 21y3. y3(y - 3)(y + 49)/7 Find t, given that 2t2 - 22t - 160 = 0. -5, 16 Find k, given that -9k3 - 606k*2 + 3000k - 1728 = 0. -72, 2/3, 4 Determine n so that n*3/6 + 11n*2/6 - 28n/3 + 10 = 0. -15, 2 Let -2f3 - 106f*2 = 0. What is f? -53, 0 Let 21z*4 + 180z*3 + 276z*2 = 0. What is z? -46/7, -2, 0 Factor -9p*3/7 - 155p*2/7 + 128p/7 + 36/7. -(p - 1)(p + 18)(9p + 2)/7 Suppose -4x*3 - 424x*2 - 13056x - 92160 = 0. What is x? -48, -10 Factor 20q2/7 - 36q - 104/7. 4(q - 13)(5q + 2)/7 Factor -m4 + 3m*3 + 9m*2 - 27m. -m(m - 3)2(m + 3) Determine h, given that -45h2 - 200h = 0. -40/9, 0 Let -2w3/19 - 6w*2/19 = 0. What is w? -3, 0 Find m, given that -10m*5/23 + 152m*4/23 - 6m*3 - 476m*2/23 + 808m/23 - 336/23 = 0. -2, 1, 6/5, 14 Solve 3d3/7 - 30d*2/7 + 69d/7 - 6 = 0. 1, 2, 7 Factor 3i2/8 + 15i/2 - 33/2. 3(i - 2)(i + 22)/8 Factor 4h2 - 124h - 264. 4(h - 33)(h + 2) Find r such that -r*5/7 + 36r*4/7 - 232r*3/7 - 306r*2/7 + 233r/7 + 270/7 = 0. -1, 1, 10, 27 Let -10s3/3 + 194s*2/3 + 344s/3 - 56 = 0. What is s? -2, 2/5, 21 Factor 1055l3/3 - 355l*2 + 10l/3. 5l(l - 1	{ "pile_set_name": "DM Mathematics" }
94f2. Let w(b) = b2. Give x(w(t)). 694t*4 Let k(o) = 4o - 7. Let w(r) = 3r - 6. Let m(n) = -6k(n) + 7w(n). Let h = 15 + -9. Let i(d) = -3d - 2d + hd. Give m(i(q)). -3q Let p(j) = -4j. Let x be (4/10)/((-1)/(-40)). Let h(o) = -16 + x + o*2. What is p(h(l))? -4l*2 Let w(d) = 3d. Let o(b) = 175b2 - 63b + 63. Let k(p) = 11p2 - 4p + 4. Let n(q) = -63k(q) + 4o(q). Determine n(w(s)). 63s2 Let d(i) = -7i. Let w(j) = 2 + j - 9 + j*2 + j + 5j. Let c(z) = -z*2 - 6z + 6. Let n(m) = 7c(m) + 6w(m). What is n(d(k))? -49k2 Let x(l) = 6l*2 + 0 + 0 - 5l2. Let t(n) = -n2. Give t(x(b)). -b4 Let w(p) = -p2. Let r(j) = -477j. Determine r(w(y)). 477y*2 Let t(w) = 2w - 4. Let a(m) = -m + 1. Let s(r) = -4a(r) - t(r). Let z(f) be the third derivative of -2f*2 + 1/24f*4 + 0f*3 + 0 + 0f. Determine z(s(p)). 2p Let s(l) = -5l. Let c(u) be the second derivative of 0u2 + 0 - u - 1/12u*4 - 2/3u*3. Let r(p) = -5c(p) + 4s(p). Let x(j) = j. What is r(x(n))? 5n*2 Let y(j) = 2j. Let u(t) = 4t2 - 587t + 2. Determine y(u(a)). 8a2 - 1174a + 4 Let x(n) be the first derivative of n*2/2 - 1. Let s(a) = 5a - 2a - 3a + 5a. Determine x(s(o)). 5o Let g(c) = 7c. Let v(f) = 3f. Let h(u) = -3g(u) + 6v(u). Let n(i) = -10 + 10 - 5i. Determine h(n(b)). 15b Let x(d) = -4d2. Let h(q) = -2q - 158. Determine h(x(m)). 8m2 - 158 Suppose 0o + o = 4s + 9, -3o - 1 = 2s. Let g be s - (-6)/(3 + 0). Let a(h) = g - 6h + 0h + 0. Let t(i) = -i2. Give t(a(r)). -36r*2 Let o(j) = -13j*2 - 4j. Let d(q) = -391q2 - 119q. Let b(l) = 4d(l) - 119o(l). Let c(h) = -2h2. What is b(c(u))? -68u*4 Let c(o) = -4o - 607. Let b(q) = q. Give b(c(f)). -4f - 607 Let y(t) = -3t - 3. Let j(c) = -21c2 - 11c. Determine j(y(v)). -189v2 - 345v - 156 Let v = -1 + 3. Let z(s) = 3s2 - 6s*2 + 2sv. Let d(t) be the third derivative of t5/15 + 6t2. Calculate d(z(n)). 4n*4 Let p(z) = 304z. Let m(g) = -6g2. Give m(p(d)). -554496d*2 Let c(k) = 11k. Let v(g) = 5g2 - 4g + 4. Let a(w) = 9w2 - 7w + 7. Let n(y) = 4a(y) - 7v(y). Calculate n(c(o)). 121o2 Suppose -15 = 4g - 75. Let k be 35/g - (-1)/(-3). Let f(u) = -5u2 + ku*2 + 4u2. Let p(w) = w2. Calculate f(p(t)). t4 Let r be 1/((-8)/12) - (-5)/10. Let x(u) = -u2 + 1. Let n(d) = 2d2 - 3d + 3d - 1. Let z(o) = rn(o) - x(o). Let c(h) = 8h. Calculate z(c(l)). -64l*2 Let i(d) = 0d2 - d2 + 0 + 0. Let a(u) be the second derivative of 1/6u4 - 2u + 0u3 + 0 + 0u*2. Determine a(i(k)). 2k*4 Let r(i) = -44i - 1. Let g(y) = 4y. Determine r(g(q)). -176q - 1 Let h(p) = -5p2 - 4. Let l(i) = 6i*2 + 5. Let y(n) = 5h(n) + 4l(n). Let t be 0 + 5/((-10)/(-4)). Let w(r) = -tr + r - r. Determine w(y(z)). 2z2 Let g(x) = -3x*2 + 3x*2 + 0x2 + x2. Let a(t) be the second derivative of 0t2 - 5/12t*4 + 0t*3 + 2t + 0. Determine a(g(i)). -5i4 Let s(v) = 22v*2. Let h(b) = -62b*2. What is s(h(t))? 84568t*4 Let f(t) = -5t*2. Let c(a) = -811a*2. Give c(f(m)). -20275m*4 Let m(y) = 10y. Let w(q) be the first derivative of -2q3/3 + 5. Give m(w(t)). -20t*2 Let i(b) = 2b*2. Let z(p) = -44p - 5 + 3 + 21p. Give z(i(d)). -46d*2 - 2 Let a(o) = -2o. Let h(i) be the second derivative of -31i3/6 + 18i. Calculate a(h(u)). 62u Let t be 1 + (5 - 3) + 0. Let x(j) = -2j*2 + 2j*2 - tj*2 + 0j*2. Let g(s) = -2s. What is x(g(z))? -12z2 Let r(m) = -4m + 4m - 4m + 5m. Let i(y) = 10y. Let g(t) = 11t. Let p(c) = 5g(c) - 6i(c). Give r(p(q)). -5q Let y(s) = 2s. Let c(d) = 141d + 27. Let m(p) = -20p - 4. Let w(l) = -4c(l) - 27m(l). Give w(y(r)). -48r Let a(z) = -3z. Let q(f) = 2 - 3f + 7f - 2f - 8f2 + 0f. Let l(v) = 9v2 - 3v - 3. Let i(g) = 2l(g) + 3q(g). Give i(a(c)). -54c2 Let p(a) be the second derivative of -2a + 1/3a3 + 0 + 0a*2. Let c(n) = -n - 2n*2 - 5n + 6n. Determine c(p(k)). -8k*2 Let j(o) = 4o + 989o2 - 988o*2 - 4o. Let f(z) = 39z. Give j(f(m)). 1521m*2 Let b(w) = -5w*2 - 3. Let i(y) = -1. Let u(l) = -b(l) + 3i(l). Let x(s) = -4s2. Determine x(u(v)). -100v*4 Let y(f) = -3f*2 + 5f. Let n(o) = -9o2. Calculate y(n(b)). -243b*4 - 45b*2 Let k(f) = -5f. Suppose -3b = 4m - b - 6, 0 = -5b - 5. Let y(h) = h2 + 3h2 - hm. Calculate k(y(a)). -15a2 Let i(m) = 7m*2. Let v(o) = 2o + 2. Let q(u) = -6u - 7. Let p(r) = 2q(r) + 7v(r). Determine i(p(n)). 28n2 Let q(c) = -c2 + 3c + 5. Let n be q(-2). Let b(z) = -2z. Let o(m) = -3m. Let h(p) = nb(p) + 4o(p). Let l(d) = -8d. Calculate l(h(f)). 16f Let w(i) = -17i. Let n(j) = 2j. Give n(w(y)). -34y Let i(y) be the third derivative of -y6/360 - y3/6 - 3y2. Let t(u) be the first derivative of i(u). Let w(r) = -2r + r - r. Give t(w(h)). -4h2 Let g(a) be the second derivative of a4/6 - a2/2 - 2a. Let l(o) be the first derivative of g(o). Let y(k) = -58k + 20k + 16k + 20k. Calculate l(y(h)). -8h Let g(n) = n. Suppose -27 = -3x - 3j, 3x - 4x = -3j + 7. Let h = -3 + x. Let y(c) = hc - 4c + 4c. Determine y(g(w)). 2w Let k(p) = 2p - 81. Let f(h) = 3h*2. Give f(k(t)). 12t*2 - 972t + 19683 Let i(k) = 284k2. Let t(s) = -3s. Give t(i(u)). -852u2 Suppose -2h - 1 = -3. Let i(g) = -h + 1 + 4g. Let f(c) = 15c*2 - 11c*2 - 2c*2. Calculate i(f(q)). 8q*2 Let a(x) = 3x - x - 18x. Let b(c) = 2c*2. Give a(b(y)). -32y2 Let j(n) be the third derivative of -n5/20 - 25n2. Let o(p) = 9p*2. What is o(j(m))? 81m4 Let r(q) = -q3 - 5q2 + 2q - 8. Let h be r(-6). Let f(v) = -11v2 - 11v*2 + hv*2. Let k(l) = l. Give k(f(i)). -6i*2 Let y(h) = -2h. Let c(t) = -29t2 - 5 - 27t*2 + 57t*2. Calculate y(c(a)). -2a2 + 10 Let s(b) = b2. Let p(i) = 112 - 112 + 4i. What is p(s(t))? 4t2 Let a(z) = -z2. Let x(n) = 3n2. Let d = -2 - -4. Let p(o) = 7o*2 + 2 - 2. Let q(w) = dp(w) - 5x(w). Calculate a(q(i)). -i4 Let k(h) = -h2. Let z(c) = -364c. Determine z(k(q)). 364q2 Let a(v) = -2v*2. Let n(x) = -3x*2 + 4x - 8. Let w(g) = -4g2 + 5g - 10. Let o(j) = -5n(j) + 4w(j). Determine a(o(r)). -2r4 Let t(c) = -53c*2. Let d(k) = -20k - 16k + 36k + k*2. Calculate t(d(a)). -53a4 Let s(j) = -j2. Let n(h) = 3h + 2h - 3h + 0h. What is s(n(l))? -4l2 Let a(q) = 17q - 10q + 8q. Let o(g) = 2g. Give a(o(c)). 30c Let h(u) = 4u. Let x(k) = -5k + 20. Calculate x(h(d)). -20d + 20 Let c(x) = 70x*2 - 1. Let m(f) = 8f*2. What is c(m(w))? 4480w*4 - 1 Let c(i) = 0 + 0 - 14i + 78i. Let f(n) = -5n. Let k(q) = -3c(q) - 40f(q). Let p(z) = 2z2. Determine p(k(u)). 128u*2 Let l(o) = o. Let t = 5 + -3. Let f be 9 + -2 + 0 + 2. Let q(k) = 9k + k*t - fk. What is l(q(w))? w*2 Let r(p) = -3p + 6p + 0p. Let f be (8/10)/(2/5). Let t(d) = -d*2 - 2df + d2. Calculate r(t(a)). -6a2 Let c(b) = 7b. Let f(g) = 4g. Let l(y) = -7y. Let q(m) = -10f(m) - 6l(m). Give c(q(w)). 14w Let s(b) = -2b*2. Let g(o) = -2o*2. Let k(l) = -6g(l) + 5s(l). Let h(z) = -3z + 7z + 0z. Determine h(k(n)). 8n2 Let k(n) = -8n + 8n + 0n*2 + 7n*2. Let w(y) = -y - y - 5y + 5y. Calculate k(w(t)). 28t*2 Suppose -4o = -6o. Let p(r) = -2r*2 + or - r*2 + 0r. Let j(d) = d. Calculate j(p(w)). -3w2 Let s(x) = 2x*2 - 135. Let p(c) = -6c. Calculate s(p(u)). 72u2 - 135 Let g(y) = -2y*2. Let o(i) = 495i*2. Give o(g(f)). 1980f4 Let n(h) = h2 + h - 1. Let d(k) = k - 1. Let u(a) = -2d(a) + 2n(a). Let j(w) = -3w. What is j(u(i))? -6i2 Let i(l) = -l2 + 3l - 3. Let k(z) = -z + 1. Let x(u) = -i(u) - 3k(u). Let q(j) be the second derivative of j*4/6 - j. Give q(x(n)). 2n*4 Let u(m) = -4m + m + 3m + 5m*2. Let s(w) = 11w*2. Let v(y) = -4s(y) + 9u(y). Let l(g) = 3g*2. Give v(l(o)). 9o4 Let s(g) = g2. Let d(i) = -35i - 2. What is d(s(t))? -35t*2 - 2 Let v(c) = -4c*2. Let a(f) = -5f*2 - 7. What is v(a(z))? -100z*4 - 280z*2 - 196 Let d(k) = -13k*2 + 9k. Let i(o) = -3o2 + 2o. Let u = -7 + 9. Let x(t) = ud(t) - 9i(t). Let p(v) = -2v2. Give x(p(r)). 4r*4 Let h(q) = 6q. Let t(o) be the second derivati	{ "pile_set_name": "DM Mathematics" }
at is prob of sequence eaaa? 1/4 Two letters picked without replacement from {o: 3, k: 4, f: 1, u: 4, j: 1}. What is prob of sequence uf? 1/39 Calculate prob of sequence rrim when four letters picked without replacement from imddmirri. 1/252 Calculate prob of sequence qix when three letters picked without replacement from {g: 1, j: 1, x: 1, i: 1, q: 1}. 1/60 Four letters picked without replacement from {m: 3, u: 3, x: 7}. Give prob of sequence ummx. 21/2860 Three letters picked without replacement from {q: 1, p: 1, u: 2}. What is prob of sequence quu? 1/12 What is prob of sequence iz when two letters picked without replacement from uupzuzfizfffpupppu? 1/102 What is prob of sequence qqn when three letters picked without replacement from qhqn? 1/12 Calculate prob of sequence vaz when three letters picked without replacement from {m: 1, a: 1, z: 1, d: 1, v: 1}. 1/60 What is prob of sequence ytth when four letters picked without replacement from {h: 4, t: 3, e: 2, y: 1, f: 1}? 1/330 What is prob of sequence kc when two letters picked without replacement from ckc? 1/3 Calculate prob of sequence bn when two letters picked without replacement from bbnbnjnbb. 5/24 Calculate prob of sequence eqts when four letters picked without replacement from {q: 1, t: 5, e: 5, s: 7, w: 1}. 175/93024 Calculate prob of sequence uuaa when four letters picked without replacement from {u: 10, a: 2}. 1/66 Three letters picked without replacement from wuwuwuuwwwwwwuuwuww. Give prob of sequence uww. 154/969 Four letters picked without replacement from {l: 10}. Give prob of sequence llll. 1 Four letters picked without replacement from mmvuvvvhvvhmmuu. Give prob of sequence hvhu. 1/910 Three letters picked without replacement from annaan. Give prob of sequence nan. 3/20 What is prob of sequence ana when three letters picked without replacement from {t: 4, a: 2, n: 2}? 1/84 What is prob of sequence ae when two letters picked without replacement from qeeqqeeeqa? 1/18 Four letters picked without replacement from {a: 1, x: 1, o: 5, h: 5}. Give prob of sequence aoxh. 5/2376 What is prob of sequence xel when three letters picked without replacement from llxllxeleellxlex? 4/105 Two letters picked without replacement from {b: 1, i: 2, s: 1, g: 2, v: 1}. Give prob of sequence sv. 1/42 What is prob of sequence li when two letters picked without replacement from {p: 1, i: 1, l: 1, f: 4, a: 1}? 1/56 Calculate prob of sequence yyy when three letters picked without replacement from uuauauuuuuauaayuaaau. 0 Calculate prob of sequence dbd when three letters picked without replacement from bbddddddddddddbd. 39/280 What is prob of sequence bsm when three letters picked without replacement from {x: 1, b: 2, s: 2, m: 1, i: 4}? 1/180 Three letters picked without replacement from {k: 1, h: 3, l: 1}. Give prob of sequence klh. 1/20 What is prob of sequence fc when two letters picked without replacement from fssfffffscffffcs? 1/12 Calculate prob of sequence wuu when three letters picked without replacement from {u: 11, w: 1}. 1/12 Calculate prob of sequence onn when three letters picked without replacement from {p: 3, n: 2, k: 2, o: 2}. 1/126 What is prob of sequence ok when two letters picked without replacement from {o: 3, w: 2, l: 3, x: 1, k: 3, c: 2}? 9/182 Calculate prob of sequence nwnn when four letters picked without replacement from wnwwwwwnwn. 1/120 Three letters picked without replacement from gaggagggaggagg. Give prob of sequence aaa. 1/91 What is prob of sequence bmwb when four letters picked without replacement from bbdwdmbwbrdwbd? 5/2002 Calculate prob of sequence oc when two letters picked without replacement from {l: 1, z: 4, o: 3, c: 2, p: 4}. 3/91 Three letters picked without replacement from {l: 1, g: 2, c: 2, o: 6, n: 4, v: 2}. What is prob of sequence lcg? 1/1020 What is prob of sequence ooo when three letters picked without replacement from {o: 5}? 1 Two letters picked without replacement from {q: 1, u: 4, k: 1, j: 2, w: 4, o: 2}. Give prob of sequence kw. 2/91 Three letters picked without replacement from {o: 3, b: 2, h: 1, q: 1, l: 1, e: 3}. Give prob of sequence eel. 1/165 Calculate prob of sequence dm when two letters picked without replacement from ddqumwmy. 1/14 Three letters picked without replacement from {m: 6, k: 1, n: 4, c: 5}. What is prob of sequence cmk? 1/112 Four letters picked without replacement from {d: 7, p: 1}. Give prob of sequence pddd. 1/8 Calculate prob of sequence sc when two letters picked without replacement from nqcesqeqqocqqqq. 1/105 Two letters picked without replacement from agtgaaaoa. What is prob of sequence to? 1/72 Calculate prob of sequence zxzx when four letters picked without replacement from {x: 4, z: 7}. 7/110 What is prob of sequence rfy when three letters picked without replacement from ffyfrfffnfff? 3/440 What is prob of sequence xxdd when four letters picked without replacement from {x: 7, d: 5}? 7/99 Calculate prob of sequence pf when two letters picked without replacement from mngnpgnmagfg. 1/132 What is prob of sequence ll when two letters picked without replacement from {m: 5, l: 2}? 1/21 Four letters picked without replacement from uwuuwuuuuuwuuu. Give prob of sequence wwuw. 1/364 Three letters picked without replacement from rakyr. What is prob of sequence arr? 1/30 What is prob of sequence ilcm when four letters picked without replacement from lcmiiil? 1/140 Three letters picked without replacement from {j: 2, p: 7}. What is prob of sequence pjp? 1/6 Calculate prob of sequence yy when two letters picked without replacement from jfwfyfffynwfwwf. 1/105 Four letters picked without replacement from qcqqccqcqqcqq. What is prob of sequence qcqq? 14/143 Calculate prob of sequence hh when two letters picked without replacement from {w: 7, h: 3}. 1/15 Calculate prob of sequence qrx when three letters picked without replacement from {q: 1, f: 1, x: 1, r: 1, s: 5}. 1/504 Two letters picked without replacement from {j: 3, l: 6, v: 1, m: 4, p: 2}. What is prob of sequence pl? 1/20 Four letters picked without replacement from {g: 2, h: 2, j: 1, v: 1}. Give prob of sequence ghgv. 1/90 Calculate prob of sequence cjj when three letters picked without replacement from {c: 9, j: 9}. 9/68 Calculate prob of sequence qo when two letters picked without replacement from oooooooooooooqoooooq. 9/95 Calculate prob of sequence dgd when three letters picked without replacement from {l: 7, d: 6, g: 6}. 10/323 What is prob of sequence lo when two letters picked without replacement from {m: 1, p: 4, l: 4, o: 7, y: 2}? 14/153 Four letters picked without replacement from {v: 2, w: 4, f: 1, k: 1}. Give prob of sequence vwkv. 1/210 Two letters picked without replacement from {w: 1, y: 5, e: 4}. What is prob of sequence ew? 2/45 Calculate prob of sequence jbd when three letters picked without replacement from {b: 4, d: 3, x: 2, w: 2, j: 2}. 2/143 Four letters picked without replacement from mmmmmmmmmmnmmmmnnm. What is prob of sequence nmmn? 7/408 Three letters picked without replacement from nmnnvnvvkvnx. What is prob of sequence nvn? 2/33 Two letters picked without replacement from umajtjmyu. What is prob of sequence my? 1/36 Two letters picked without replacement from denqy. What is prob of sequence yq? 1/20 What is prob of sequence oqm when three letters picked without replacement from {q: 2, m: 1, o: 1}? 1/12 Two letters picked without replacement from ddcdcddddlld. Give prob of sequence ld. 4/33 Two letters picked without replacement from {r: 3, i: 11}. Give prob of sequence ri. 33/182 Two letters picked without replacement from ziizziii. What is prob of sequence zz? 3/28 What is prob of sequence ypy when three letters picked without replacement from ypyapyypyyyypyyypp? 55/408 Two letters picked without replacement from {f: 10, w: 9, m: 1}. What is prob of sequence fw? 9/38 Calculate prob of sequence rr when two letters picked without replacement from {r: 4, v: 5, z: 1}. 2/15 Four letters picked without replacement from {k: 11, r: 9}. What is prob of sequence rkrk? 22/323 Two letters picked without replacement from {e: 1, x: 2, y: 4, g: 2, v: 10}. What is prob of sequence ey? 2/171 Two letters picked without replacement from llolllolggogllllllol. Give	{ "pile_set_name": "DM Mathematics" }
770 to the nearest integer? 108 What is the third root of 3318460 to the nearest integer? 149 What is 269464 to the power of 1/8, to the nearest integer? 5 What is 521124 to the power of 1/6, to the nearest integer? 9 What is the ninth root of 934218 to the nearest integer? 5 What is the third root of 13084884 to the nearest integer? 236 What is 8007495 to the power of 1/2, to the nearest integer? 2830 What is the eighth root of 4743436 to the nearest integer? 7 What is 548227 to the power of 1/3, to the nearest integer? 82 What is 10910733 to the power of 1/3, to the nearest integer? 222 What is the cube root of 14278366 to the nearest integer? 243 What is 6805154 to the power of 1/7, to the nearest integer? 9 What is the square root of 12180257 to the nearest integer? 3490 What is 21860710 to the power of 1/2, to the nearest integer? 4676 What is 485251 to the power of 1/8, to the nearest integer? 5 What is the third root of 3034257 to the nearest integer? 145 What is 3504374 to the power of 1/3, to the nearest integer? 152 What is 3977902 to the power of 1/7, to the nearest integer? 9 What is 7420339 to the power of 1/2, to the nearest integer? 2724 What is the sixth root of 3343641 to the nearest integer? 12 What is 396160 to the power of 1/8, to the nearest integer? 5 What is 335649 to the power of 1/9, to the nearest integer? 4 What is the third root of 102427 to the nearest integer? 47 What is 24942 to the power of 1/9, to the nearest integer? 3 What is the square root of 2422551 to the nearest integer? 1556 What is the third root of 332771 to the nearest integer? 69 What is the third root of 620173 to the nearest integer? 85 What is the ninth root of 24950933 to the nearest integer? 7 What is the tenth root of 198875 to the nearest integer? 3 What is the third root of 593830 to the nearest integer? 84 What is 219676 to the power of 1/5, to the nearest integer? 12 What is 260798 to the power of 1/2, to the nearest integer? 511 What is 281539 to the power of 1/2, to the nearest integer? 531 What is 1075213 to the power of 1/2, to the nearest integer? 1037 What is 237220 to the power of 1/2, to the nearest integer? 487 What is 75182 to the power of 1/3, to the nearest integer? 42 What is the sixth root of 128024 to the nearest integer? 7 What is the third root of 955325 to the nearest integer? 98 What is the third root of 583368 to the nearest integer? 84 What is 18113280 to the power of 1/2, to the nearest integer? 4256 What is the tenth root of 220655 to the nearest integer? 3 What is the third root of 379835 to the nearest integer? 72 What is the square root of 245185 to the nearest integer? 495 What is the third root of 213982 to the nearest integer? 60 What is the fifth root of 8118 to the nearest integer? 6 What is the square root of 16476189 to the nearest integer? 4059 What is 2639046 to the power of 1/9, to the nearest integer? 5 What is 573135 to the power of 1/3, to the nearest integer? 83 What is 86787 to the power of 1/2, to the nearest integer? 295 What is the square root of 2610862 to the nearest integer? 1616 What is 3923577 to the power of 1/10, to the nearest integer? 5 What is the sixth root of 1253740 to the nearest integer? 10 What is the third root of 1458123 to the nearest integer? 113 What is 19519680 to the power of 1/2, to the nearest integer? 4418 What is 260909 to the power of 1/5, to the nearest integer? 12 What is the tenth root of 819847 to the nearest integer? 4 What is the cube root of 2802461 to the nearest integer? 141 What is the seventh root of 676021 to the nearest integer? 7 What is the cube root of 27369304 to the nearest integer? 301 What is 19787029 to the power of 1/4, to the nearest integer? 67 What is the cube root of 20174373 to the nearest integer? 272 What is 995309 to the power of 1/2, to the nearest integer? 998 What is the third root of 7406006 to the nearest integer? 195 What is the third root of 6050073 to the nearest integer? 182 What is the third root of 8751295 to the nearest integer? 206 What is 7620315 to the power of 1/3, to the nearest integer? 197 What is the square root of 5035908 to the nearest integer? 2244 What is the ninth root of 349382 to the nearest integer? 4 What is 269278 to the power of 1/6, to the nearest integer? 8 What is 18550157 to the power of 1/8, to the nearest integer? 8 What is 695202 to the power of 1/2, to the nearest integer? 834 What is 177530 to the power of 1/2, to the nearest integer? 421 What is the cube root of 2040377 to the nearest integer? 127 What is 808910 to the power of 1/7, to the nearest integer? 7 What is the square root of 43979255 to the nearest integer? 6632 What is 2644956 to the power of 1/2, to the nearest integer? 1626 What is the seventh root of 3169067 to the nearest integer? 8 What is 559258 to the power of 1/3, to the nearest integer? 82 What is 663830 to the power of 1/2, to the nearest integer? 815 What is 405244 to the power of 1/2, to the nearest integer? 637 What is 400719 to the power of 1/3, to the nearest integer? 74 What is the cube root of 11642384 to the nearest integer? 227 What is the third root of 1471393 to the nearest integer? 114 What is 1310886 to the power of 1/2, to the nearest integer? 1145 What is 86004 to the power of 1/3, to the nearest integer? 44 What is the square root of 746567 to the nearest integer? 864 What is the third root of 1004243 to the nearest integer? 100 What is the tenth root of 773526 to the nearest integer? 4 What is the tenth root of 20485246 to the nearest integer? 5 What is the cube root of 1027613 to the nearest integer? 101 What is 2766682 to the power of 1/2, to the nearest integer? 1663 What is the cube root of 498739 to the nearest integer? 79 What is 137105 to the power of 1/3, to the nearest integer? 52 What is 1980162 to the power of 1/3, to the nearest integer? 126 What is the fourth root of 3864612 to the nearest integer? 44 What is the square root of 545720 to the nearest integer? 739 What is 35759827 to the power of 1/2, to the nearest integer? 5980 What is the square root of 12569493 to the nearest integer? 3545 What is the fifth root of 2236741 to the nearest integer? 19 What is 343126 to the power of 1/2, to the nearest integer? 586 What is the square root of 260816 to the nearest integer? 511 What is the sixth root of 5879354 to the nearest integer? 13 What is 2790009 to the power of 1/3, to the nearest integer? 141 What is the seventh root of 1998141 to the nearest integer? 8 What is the eighth root of 570632 to the nearest integer? 5 What is 251883 to the power of 1/2, to the nearest integer? 502 What is 127629 to the power of 1/7, to the nearest integer? 5 What is the square root of 118509 to the nearest integer? 344 What is 2910628 to the power of 1/6, to the nearest integer? 12 What is 290635 to the power of 1/4, to the nearest integer? 23 What is 8626197 to the power of 1/3, to the nearest integer? 205 What is 949903 to the power of 1/2, to the nearest integer? 975 What is the fifth root of 26831766 to the nearest integer? 31 What is the tenth root of 1509730 to the nearest integer? 4 What is the cube root of 1831086 to the nearest integer? 122 What is the third root of 7826063 to the nearest integer? 199 What is the square root of 14952015 to the nearest integer? 3867 What is 678629 to the power of 1/3, to the nearest integer? 88 What is the third root of 1604879 to the nearest integer? 117 What is the ninth root of 7370884 to the nearest integer? 6 What is the third root of 175413 to the nearest integer? 56 What is 48733 to the power of 1/2, to the nearest integer? 221 What is the cube root of 456437 to the nearest integer? 77 What is the cube root of 4786142 to the nearest integer? 169 What is the third root of 667677 to the nearest integer? 87 What is the square root of 1615936 to the nearest integer? 1271 What is the ninth root of 407329 to the nearest integer? 4 What is the fifth root of 109602 to the nearest integer? 10 What is the sixth root of 3811643 to the nearest integer? 12 What is the square root of 3130376 to the nearest integer? 1769 What is 487983 to the power of 1/4, to the nearest integer? 26 What is the third root of 981830 to the neare	{ "pile_set_name": "DM Mathematics" }
t k = -8.9 - h. Sort k, 0.8, -3. -3, k, 0.8 Let y = -4 - -3. Let r = 2 + y. Let s = 7 + -12. Put 4, s, r in increasing order. s, r, 4 Let t = -13 + 12.8. Let m = t + -10.8. Sort m, 5, -3. m, -3, 5 Let i be 3/((-27)/(-24))-3. Let u(p) = -p3 - 8p*2 + 2p + 12. Let t be u(i). Let x = 6 + t. Put -2, x, -0.1 in increasing order. -2, -0.1, x Let l = -556/55 - -51/5. Sort 0.3, l, -1/5. -1/5, l, 0.3 Let v = -103 + 119. Put 3, 3/5, v in increasing order. 3/5, 3, v Let u be (-3)/(-1) - (-6)/(-2 + 0). Sort 1, u, -4, -2 in descending order. 1, u, -2, -4 Let k = -0.8 - 20.2. Let n = k + 24. Sort 0, -2/7, n. -2/7, 0, n Let u(j) = j*2 + 7j - 5. Let k be u(-8). Let p(f) = f - 1. Let v be p(-3). Let l(n) = 2n2 + 2n - 2. Let z be l(-2). Sort v, z, k in ascending order. v, z, k Let b = 1 - -1. Let q = -2.5 + b. Sort q, -2/11, 5 in descending order. 5, -2/11, q Let z = -2.47 - -0.27. Let d = z - -2. Let f = d - 1.8. Sort -4, -0.5, f in ascending order. -4, f, -0.5 Let w be (-69)/(-6) + 1/(-2). Let t = w + -11. Let n(u) = -u*3 - 5u*2 + 6u - 4. Let m be n(-6). Sort -2, m, t in decreasing order. t, -2, m Suppose -2g - g = 0. Suppose -10 = c - 4j, -4c - 2 = -5j + 5. Suppose -c - 8 = 3r - 2z, 5z = -2r - 13. Sort r, g, -1. r, -1, g Let q(w) = -w*3 - 11w*2 - 30w + 3. Let f be q(-6). Sort -2/9, -4/3, f, -3/11 in decreasing order. f, -2/9, -3/11, -4/3 Let x = 3 - 2. Let b be (-6)/28 - 1/(-2). Let u = 299.7 + -300. Put u, x, b in descending order. x, b, u Let y = 4.93 + 0.07. Let a = y - 4.5. Sort -2, -2/7, a. -2, -2/7, a Let l(w) = -2w3 - w2 - w. Let o be l(-1). Let z(q) = q2 - 25q + 155. Let n be z(11). Put n, o, 11 in ascending order. n, o, 11 Let p be 2 - ((-2)/(-12) - -2). Suppose 0 = 2r - 3f - 14, -5r + 10 + 2 = 4f. Suppose -20 = -ro - 5j, -5j = -5o - 9 - 11. Sort -1/2, o, p. -1/2, p, o Suppose -4z + 2 = 3y - 14, 2z - 14 = -3y. Let h be 3 - 2/y6. Put h, 3, 7 in decreasing order. 7, 3, h Let t = -21.5 - -21. Let a = 1 + -1. Sort t, a, 2 in increasing order. t, a, 2 Let t = -4 + 3.4. Sort 0.2, -3/7, t. t, -3/7, 0.2 Let n = 12.6 - 13. Sort n, 3, -4 in descending order. 3, n, -4 Suppose 8 = -2n + 2. Sort 1, 4, n in ascending order. n, 1, 4 Let l = 1.4 - 1. Sort -1, -0.4, l, 4. -1, -0.4, l, 4 Suppose 5l = -4s - 8 + 21, -5 = -5l. Suppose 4 = x + sm, -x + 4 = -0x - 5m. Suppose 1 + 1 = t + a, xt = -3a + 10. Sort t, -1, 3 in increasing order. -1, 3, t Let z be (4/3)/(3/(-9)). Let o = -15 + 18. Sort o, -1, z in descending order. o, -1, z Let m(g) = -1 - 5g2 - 3 + 3 + 2g. Let k(o) = -o*3 + 10o*2 - 8o - 8. Let p be k(9). Let j be m(p). Sort 2, j, -5 in increasing order. -5, j, 2 Let f = 0.03 + -0.13. Sort -3, f, -5 in descending order. f, -3, -5 Let f = -4.1 - -6.1. Sort 4, -1, f, -1/3 in decreasing order. 4, f, -1/3, -1 Let r(z) = -2z2 - 6z + 3. Let l be r(-3). Sort l, 5, -9 in decreasing order. 5, l, -9 Let i = 62 - 57. Put i, -1, 1/3, -0.4 in increasing order. -1, -0.4, 1/3, i Let f = -3 + 12. Suppose -2b = u - f, -5u + 25 = -0b + 5b. Put 5, u, -5 in descending order. 5, u, -5 Let c = -8 + 20. Let m = c + -9. Sort m, -2, 1 in decreasing order. m, 1, -2 Suppose 21 = 2d + 5y, -2y + 13 = 3d - 2. Suppose 11 = 4z + 5t, 0 = dz + 2t - 10. Sort z, -2, -1 in decreasing order. z, -1, -2 Suppose -3c - c = -24. Sort 1, c, -3. -3, 1, c Let m = -10 - -26. Let u be (m/(-4))/2 - -6. Sort -3, 2, u in ascending order. -3, 2, u Let w = -15 - -13. Sort 4, w, 8. w, 4, 8 Let i = -3 + 2. Let t be -1 - -4 - 2 - -2. Suppose -tl + 3r - 27 = 0, 4 = -5l - r - 17. Sort 0, l, i. l, i, 0 Let y = 355 - 359. Let a = 7 + -12. Put -0.2, a, y in ascending order. a, y, -0.2 Suppose -2q + 4 = 2. Let z = -4 + q. Put z, -0.2, 2/3 in decreasing order. 2/3, -0.2, z Let n = -128 - -123. Sort n, 37, -1/3 in increasing order. n, -1/3, 37 Let v = -77/68 + -2/17. Let l = 0.06 - -0.19. Let u = 0.05 + l. Put v, -5, u in ascending order. -5, v, u Let g be (-8)/(-1)1/(-6). Let t be (-4)/(-10) + (-7)/(-20). Sort g, t, 2 in decreasing order. 2, t, g Let x = -5 - -12.4. Let j = x - 7. Suppose -l = 3 - 2. Sort j, -3, l in ascending order. -3, l, j Suppose 0 = -0j + 3j + 15. Suppose 35 = -7u + 14u. Sort 1, u, j in decreasing order. u, 1, j Let v = -2.01 - -0.01. Let u = 120 + -593/5. Let a = 452 - 451.8. Put u, a, v in decreasing order. u, a, v Let v(u) = 2u3 + u - 1. Let c be v(1). Let d be 2/(-12)(-12)/9. Sort 4, d, c in ascending order. d, c, 4 Let f(m) = m*2 + 3m + 3. Let k(j) = j*2 + 3j + 2. Let z(g) = 6f(g) - 7k(g). Let r be z(-4). Suppose -2v - 3 + 13 = r. Put -5, -1, v in descending order. v, -1, -5 Let n be 12/10(-10)/(-3). Let t be (23)/(6/n). Put t, -5, 6 in increasing order. -5, t, 6 Suppose 0 = 5v - 25, v + 2v = -2h + 15. Suppose 0p = 2p - 16. Let l be (-30)/(-8) - p/(-32). Put 5, l, h in increasing order. h, l, 5 Let p = 0.08 + -0.1. Let x = 1.72 + -1.7. Let w = p + x. Put 3, -0.5, w in descending order. 3, w, -0.5 Let c be -4 - -3 - (1 - 6). Let q = -0.9 + -1.1. Sort c, 1, q. q, 1, c Let t = 75 - 73. Let r(a) = a*3 + 3a*2 - 4a - 4. Let i be r(-4). Put -5, t, i in decreasing order. t, i, -5 Let l = -9.54 + -0.46. Sort l, 3, 2/5 in descending order. 3, 2/5, l Let m(v) = v*3 - 7v*2 + 9v + 10. Let w be m(5). Let d(i) = -2 - 2 + 5 - 3i. Let a be d(2). Put a, w, 1 in decreasing order. w, 1, a Suppose -k + 4 - 5 = 0. Sort k, -2, -3, -4 in increasing order. -4, -3, -2, k Let z = -80 + 79.9. Suppose 0 = w - 0w + 4. Sort w, -5, z in decreasing order. z, w, -5 Suppose 0 = 2p - 5 - 5. Let l be 18/(-6) - (-20)/12. Put l, 2/5, p in increasing order. l, 2/5, p Let o be 516(-1)/(-5). Let q = -11 + o. Sort q, 3, 0 in increasing order. 0, 3, q Let n = 16 - 81/5. Sort -4, 0, n in decreasing order. 0, n, -4 Let d be 9/(1 + 2)-2. Let j be (d/(-15))/(2/(-10)). Sort 2, 1, j in decreasing order. 2, 1, j Let a = -9 - -15. Let c = 4 - a. Sort c, 0, 0.2 in increasing order. c, 0, 0.2 Let x(r) = r*2 - 7r - 2. Let m be x(7). Let k(j) = j*2 - 21j + 85. Let f be k(14). Put f, -1, m in ascending order. f, m, -1 Let s be 51 - (-14 - -12). Suppose -4b - 13 = s. Sort b, 4, -1 in descending order. 4, -1, b Let h(l) = -l + 2. Let w be h(5). Let m(y) be the third derivative of y4/12 + y3/6 - 2y2. Let q be m(w). Put q, -3, 1 in decreasing order. 1, -3, q Let v = 8.1 - 8. Let p = -378 - -6428/17. Put p, v, 1/6 in increasing order. v, p, 1/6 Let c = -8 - -3. Suppose -b = 2b - 12. Sort b, c, -1. c, -1, b Let n = -1.7 - -0.7. Let k = 2 + n. Let z = -5 + k. Sort z, 5, -1/2 in descending order. 5, -1/2, z Let i = -101 - -104.96. Let g = -4 + i. Let q = 0.16 - g. Sort 5, 2/3, q in increasing order. q, 2/3, 5 Let l(z) = -4z. Let i be l(1). Let m = -1.3 + 1.1. Put -1, i, m in ascending order. i, -1, m Let c = -0.0355 - -0.5355. Let w = -4.02 - -0.02. Sort c, w, -0.4. w, -0.4, c Let z = -1.2 - -0.2. Sort -0.3, -3, z in increasing order. -3, z, -0.3 Let f(y) = 7y - 7. Let w(r) = -4r + 3. Let b(d) = 3f(d) + 5w(d). Let t be b(10). Put 0, -1, t in decreasing order. t, 0, -1 Let f = -0.058 + 1.058. Sort -3, -1/2, 12, f in decreasing order. 12, f, -1/2, -3 Let w(t) = t3 + t2 + t + 5. Let k be w(0). Suppose -y - 7 = kj - 1, 2j + 2 = 0. Suppose 0u - 9 = 3u. Put -4, u, y in increasing order. -4, u, y Suppose s + 2s = -15. Let t be -1(-3)/55. Sort -3, t, s in increasing order. s, -3, t Let o = -3 + 5. Suppose -3q - 7 = -u, -9 = 4q - q. Sort u, 3, o. u, o, 3 Let g = 20/9 + -71/36. Let y = 25 - 74/3. Put y, 0.5, g in descending order. 0.5, y, g Suppose 11 = 4z + 31. Suppose 0 = -5s + 7s + 12. Put -3, s, z in decreasing order. -3, z, s Let t be ((-1)/2)/((-1)/12). Let s be 2 - (-4 + (-2 - -4)). Put s, 5, t in decreasing order. t, 5, s Let q = 0 - -1. Let w = 4 - -1. Put w, 0.4, q in ascending order. 0.4, q, w Let v = 22 + -19. Suppose -l - 3l = -4c - 24, c = -3l + 6. Sort v, c, -4 in ascending order. -4, c, v Let p = 2.9 - 3. Let q = -0.9 + p. Sort 2, q, 2/7 in ascending order. q, 2/7, 2 Let o = 0.2 + -0.4. Let b = o + 3.2. Let n = 0.07 + 3.93. Put b, 1, n in descending order. n, b, 1 Let o = -27 + 24. Sort 2, o, -14 in descending order. 2, o, -14 Suppose -16 - 5 = 7*x. Put 2, x, -1/3 in decreasing order. 2, -1/3,	{ "pile_set_name": "DM Mathematics" }
What is 0.0002084 rounded to 5 decimal places? 0.00021 What is 0.000034361 rounded to seven dps? 0.0000344 What is -0.00010972 rounded to four decimal places? -0.0001 Round -10.474 to 1 decimal place. -10.5 Round 0.0000703 to 4 decimal places. 0.0001 What is 3069000 rounded to the nearest 100000? 3100000 Round -51431 to the nearest 100. -51400 What is -1257900 rounded to the nearest 10000? -1260000 What is 11847000 rounded to the nearest 100000? 11800000 What is 18900000 rounded to the nearest 1000000? 19000000 What is 0.000010891 rounded to seven decimal places? 0.0000109 What is 0.00000036573 rounded to seven dps? 0.0000004 Round -0.00001167 to six dps. -0.000012 Round 0.002397 to four decimal places. 0.0024 What is 0.00011192 rounded to 6 decimal places? 0.000112 Round -0.02063 to 3 decimal places. -0.021 Round -48629 to the nearest one thousand. -49000 What is -43750 rounded to the nearest 1000? -44000 Round 121140 to the nearest 1000. 121000 What is 0.0000017132 rounded to 7 decimal places? 0.0000017 Round -3281.1 to the nearest 1000. -3000 What is -894500 rounded to the nearest 100000? -900000 Round 52381 to the nearest one thousand. 52000 Round -43785000 to the nearest one million. -44000000 What is -3758.9 rounded to the nearest ten? -3760 What is 376300 rounded to the nearest one thousand? 376000 What is 0.31652 rounded to two dps? 0.32 Round 213340 to the nearest ten thousand. 210000 Round 0.1444 to 2 decimal places. 0.14 Round -27120 to the nearest 100000. 0 Round -4.155 to one decimal place. -4.2 Round -22304000 to the nearest one million. -22000000 Round -1.0901 to one dp. -1.1 What is -4445400 rounded to the nearest ten thousand? -4450000 What is 0.0038295 rounded to five dps? 0.00383 Round 426800 to the nearest 10000. 430000 What is 30292.4 rounded to the nearest ten thousand? 30000 What is 0.0003387 rounded to four dps? 0.0003 What is -63010 rounded to the nearest 1000? -63000 Round -629.7 to the nearest 100. -600 Round 0.01809 to two decimal places. 0.02 What is -1.653 rounded to zero dps? -2 What is 0.05998 rounded to two decimal places? 0.06 What is -136.8 rounded to the nearest integer? -137 What is -33304000 rounded to the nearest 1000000? -33000000 What is 5933000 rounded to the nearest one hundred thousand? 5900000 What is -13020700 rounded to the nearest one million? -13000000 What is -0.0002934 rounded to five dps? -0.00029 Round -0.0050012 to 3 dps. -0.005 Round -0.000135816 to 5 dps. -0.00014 What is -1245 rounded to the nearest ten? -1250 What is 24.16 rounded to the nearest 10? 20 Round 0.6994 to 2 dps. 0.7 Round -0.0732 to 2 decimal places. -0.07 Round -2980000 to the nearest 100000. -3000000 What is 0.005563 rounded to 3 decimal places? 0.006 What is -0.014195 rounded to 4 decimal places? -0.0142 Round -29.72 to the nearest 10. -30 Round -2.3428 to two dps. -2.34 What is 35140 rounded to the nearest one thousand? 35000 Round -0.000359 to 5 dps. -0.00036 What is -2057700 rounded to the nearest 10000? -2060000 Round 0.0018 to three dps. 0.002 Round 0.000151 to 5 decimal places. 0.00015 Round -2784200 to the nearest ten thousand. -2780000 Round -8700000 to the nearest one hundred thousand. -8700000 What is -0.0007383 rounded to four decimal places? -0.0007 What is 3195000 rounded to the nearest one hundred thousand? 3200000 What is 0.03377 rounded to two decimal places? 0.03 What is -0.00003866 rounded to 6 dps? -0.000039 Round 65.4 to the nearest ten. 70 Round 0.4395 to 1 dp. 0.4 What is -251.03 rounded to the nearest integer? -251 Round -0.29054 to 3 decimal places. -0.291 Round 3.006 to the nearest integer. 3 What is 0.00001146 rounded to 6 decimal places? 0.000011 What is 63300 rounded to the nearest 10000? 60000 What is 16.048 rounded to the nearest integer? 16 What is 0.3292 rounded to 1 dp? 0.3 What is -4249400 rounded to the nearest one hundred thousand? -4200000 Round -125000 to the nearest ten thousand. -130000 What is 452.08 rounded to the nearest one hundred? 500 Round -947270 to the nearest ten thousand. -950000 Round 0.0008088 to three dps. 0.001 Round -9.191 to 1 decimal place. -9.2 Round -300.7 to the nearest 100. -300 Round 164660 to the nearest 1000. 165000 What is -1.6682 rounded to one decimal place? -1.7 What is -0.86402 rounded to 2 decimal places? -0.86 What is -0.00715 rounded to three decimal places? -0.007 Round 3956900 to the nearest 10000. 3960000 Round 25.59 to the nearest 10. 30 Round -18562000 to the nearest 1000000. -19000000 What is -0.0000857 rounded to six decimal places? -0.000086 What is 61.78 rounded to the nearest 10? 60 What is 2.49 rounded to one decimal place? 2.5 Round 1117500 to the nearest 100000. 1100000 Round -0.2283 to 2 decimal places. -0.23 Round 43890000 to the nearest 1000000. 44000000 What is -0.0046008 rounded to 4 dps? -0.0046 Round 3.188 to 0 dps. 3 Round 304.7 to the nearest 100. 300 Round -0.02867 to three decimal places. -0.029 What is -6137.4 rounded to the nearest 100? -6100 Round -1853 to the nearest ten. -1850 What is -12.228 rounded to 1 dp? -12.2 Round -0.51224 to two decimal places. -0.51 What is 841000 rounded to the nearest ten thousand? 840000 Round -9121 to the nearest one thousand. -9000 Round -5.00313 to 1 dp. -5 What is -1.32359 rounded to 1 dp? -1.3 Round 10546 to the nearest 100. 10500 What is -481.2 rounded to the nearest ten? -480 What is 0.0235 rounded to two dps? 0.02 Round -0.000011484 to 7 decimal places. -0.0000115 What is -12.479 rounded to the nearest integer? -12 Round -0.009 to 1 dp. 0 Round -39110000 to the nearest 1000000. -39000000 What is 0.09419 rounded to three dps? 0.094 What is 0.0058927 rounded to three decimal places? 0.006 Round -0.17877 to 2 decimal places. -0.18 What is 0.4854 rounded to the nearest integer? 0 What is 7806000 rounded to the nearest 100000? 7800000 What is 0.000012 rounded to four decimal places? 0 Round 3300 to the nearest 100. 3300 Round 1.8814 to two dps. 1.88 What is -0.044197 rounded to three decimal places? -0.044 What is -0.002632 rounded to five decimal places? -0.00263 What is -0.01107 rounded to three dps? -0.011 Round -0.000101944 to 5 dps. -0.0001 What is 0.1619 rounded to two decimal places? 0.16 What is 141.4 rounded to the nearest one hundred? 100 Round -0.000624 to four decimal places. -0.0006 Round 696640 to the nearest 100000. 700000 What is 207610 rounded to the nearest ten thousand? 210000 Round -82700000 to the nearest 1000000. -83000000 Round 132.27 to the nearest ten. 130 Round -186800 to the nearest 10000. -190000 What is 3.32 rounded to the nearest integer? 3 Round 0.20126 to 3 dps. 0.201 Round 51315 to the nearest ten thousand. 50000 Round 2547 to the nearest one hundred. 2500 What is 0.00041409 rounded to five dps? 0.00041 What is 50.974 rounded to the nearest integer? 51 What is 817910 rounded to the nearest 100000? 800000 What is 0.7598 rounded to 1 dp? 0.8 Round -1881000 to the nearest 10000. -1880000 What is -0.0633 rounded to three decimal places? -0.063 Round -17.296 to the nearest integer. -17 What is 0.0000005817 rounded to 7 dps? 0.0000006 Round 769200 to the nearest 100000. 800000 Round -57.666 to the nearest 10. -60 Round 4230 to the nearest one thousand. 4000 Round 0.000314 to 4 decimal places. 0.0003 What is -4282 rounded to the nearest 100? -4300 Round -2.928 to 1 dp. -2.9 Round 240640000 to the nearest one million. 241000000 What is -2.0098 rounded to one dp? -2 Round 0.00001837 to six decimal places. 0.000018 What is -0.1258 rounded to 1 dp? -0.1 Round -551000 to the nearest 10000. -550000 What is 1396.18 rounded to the nearest ten? 1400 Round 13195000 to the nearest one hundred thousand. 13200000 Round 58850 to the nearest one thousand. 59000 What is -0.000016887 rounded to six decimal places? -0.000017 What is 0.000111815 rounded to six decimal places? 0.000112 Round -3294 to the nearest 1000. -3000 Round -42540 to the nearest one thousand. -43000 Round 10 to zero dps. 10 Round -7883600 to the nearest 1000000. -8000000 What is 0.0000339 rounded to five dps? 0.00003 What is 0.00010078 rounded to 5 dps? 0.0001 What is 0.000059083 rounded to six decimal places? 0.000059 What is -3807 rounded to the nearest 1000? -4000 What is 0.63208 rounded to one decimal	{ "pile_set_name": "DM Mathematics" }
common divisor of 13 and 3445? 13 What is the highest common factor of 8 and 454? 2 What is the highest common divisor of 21 and 567? 21 Calculate the greatest common factor of 2838 and 66. 66 Calculate the highest common factor of 2776 and 64. 8 Calculate the highest common factor of 135 and 1440. 45 Calculate the greatest common divisor of 52 and 13. 13 Calculate the greatest common divisor of 152 and 3496. 152 What is the highest common divisor of 18145 and 95? 95 What is the highest common divisor of 28149 and 33? 33 Calculate the highest common factor of 8652 and 5356. 412 What is the greatest common factor of 1106 and 14? 14 What is the greatest common factor of 38513 and 19? 19 Calculate the highest common divisor of 4 and 326. 2 Calculate the highest common divisor of 817 and 95. 19 Calculate the highest common factor of 30 and 50. 10 What is the greatest common divisor of 7 and 1883? 7 What is the highest common divisor of 4 and 260? 4 Calculate the greatest common factor of 56 and 35. 7 Calculate the highest common divisor of 387 and 129. 129 Calculate the greatest common divisor of 46 and 69. 23 Calculate the greatest common divisor of 1332 and 261. 9 Calculate the greatest common divisor of 225 and 55. 5 What is the highest common divisor of 7 and 6741? 7 What is the highest common divisor of 3 and 393? 3 What is the greatest common divisor of 3006 and 18? 18 What is the highest common factor of 100 and 80? 20 Calculate the greatest common divisor of 650 and 78. 26 What is the greatest common factor of 984 and 48? 24 What is the highest common factor of 4773 and 129? 129 What is the greatest common divisor of 12 and 6? 6 Calculate the greatest common factor of 135 and 19485. 45 What is the greatest common factor of 84 and 6608? 28 What is the greatest common factor of 95 and 38? 19 Calculate the greatest common divisor of 123 and 5289. 123 Calculate the greatest common factor of 42 and 238. 14 What is the highest common factor of 188 and 5734? 94 What is the highest common factor of 66 and 110? 22 What is the greatest common factor of 10027 and 37? 37 What is the highest common factor of 1855 and 106? 53 What is the highest common divisor of 16 and 424? 8 Calculate the greatest common divisor of 24 and 3104. 8 What is the greatest common divisor of 198 and 66? 66 Calculate the greatest common factor of 119 and 73423. 119 Calculate the highest common factor of 297 and 44. 11 What is the greatest common divisor of 225 and 180? 45 What is the highest common factor of 928 and 58? 58 What is the highest common factor of 12 and 1212? 12 What is the greatest common factor of 319 and 145? 29 What is the highest common divisor of 29747 and 197? 197 What is the highest common divisor of 4074 and 42? 42 Calculate the greatest common factor of 10 and 640. 10 What is the greatest common factor of 140 and 360? 20 Calculate the highest common divisor of 84 and 48. 12 Calculate the greatest common divisor of 8425 and 50. 25 What is the highest common divisor of 90 and 120? 30 What is the greatest common factor of 2970 and 110? 110 Calculate the highest common factor of 66 and 231. 33 Calculate the highest common factor of 4838 and 164. 82 What is the greatest common divisor of 43 and 2? 1 Calculate the greatest common divisor of 5760 and 32. 32 What is the highest common factor of 2439 and 6? 3 Calculate the highest common factor of 552 and 216. 24 What is the highest common divisor of 35 and 805? 35 What is the highest common factor of 493 and 464? 29 Calculate the greatest common factor of 427 and 183. 61 Calculate the greatest common divisor of 2223 and 234. 117 Calculate the highest common divisor of 23 and 184. 23 Calculate the highest common divisor of 9 and 2367. 9 Calculate the greatest common factor of 16 and 26. 2 Calculate the greatest common divisor of 104 and 1378. 26 Calculate the greatest common factor of 84 and 20552. 28 Calculate the highest common divisor of 20 and 32. 4 Calculate the highest common divisor of 567 and 1575. 63 What is the highest common factor of 981 and 109? 109 What is the greatest common divisor of 1220 and 60? 20 What is the greatest common divisor of 276 and 12? 12 Calculate the highest common factor of 14 and 4382. 14 Calculate the highest common divisor of 725 and 100. 25 What is the highest common divisor of 588 and 6? 6 Calculate the highest common divisor of 221 and 391. 17 What is the highest common divisor of 23803 and 26? 13 Calculate the highest common divisor of 4203 and 18. 9 Calculate the highest common divisor of 303 and 1919. 101 Calculate the greatest common divisor of 14 and 126. 14 Calculate the greatest common divisor of 48 and 60. 12 Calculate the highest common factor of 80 and 40. 40 What is the greatest common factor of 27 and 1971? 27 Calculate the greatest common divisor of 1881 and 99. 99 Calculate the highest common divisor of 848 and 28. 4 Calculate the greatest common factor of 7 and 301. 7 What is the greatest common divisor of 925 and 37? 37 Calculate the greatest common divisor of 7990 and 340. 170 Calculate the highest common factor of 137 and 42881. 137 What is the highest common factor of 93 and 1147? 31 What is the greatest common divisor of 16 and 24? 8 What is the greatest common factor of 1131 and 87? 87 What is the highest common factor of 7 and 448? 7 What is the highest common factor of 11 and 3? 1 Calculate the greatest common factor of 440 and 55. 55 What is the greatest common factor of 112 and 70? 14 Calculate the greatest common factor of 468 and 144. 36 Calculate the highest common divisor of 37 and 1110. 37 Calculate the highest common factor of 944 and 413. 59 Calculate the greatest common factor of 1872 and 720. 144 What is the highest common divisor of 62 and 24118? 62 Calculate the greatest common divisor of 6713 and 137. 137 Calculate the greatest common divisor of 42 and 28. 14 Calculate the highest common divisor of 572 and 1300. 52 Calculate the greatest common divisor of 92 and 161. 23 What is the greatest common factor of 153 and 36? 9 What is the highest common factor of 13 and 2197? 13 What is the greatest common factor of 2047 and 1104? 23 What is the highest common factor of 158 and 2291? 79 Calculate the highest common factor of 364 and 156. 52 Calculate the greatest common divisor of 14 and 8. 2 What is the greatest common divisor of 200 and 75? 25 Calculate the greatest common divisor of 13 and 871. 13 What is the greatest common factor of 286 and 624? 26 Calculate the greatest common factor of 17374 and 7. 7 Calculate the greatest common factor of 19428 and 12. 12 Calculate the greatest common divisor of 78 and 222. 6 What is the greatest common factor of 15 and 3585? 15 What is the highest common factor of 2132 and 884? 52 What is the greatest common divisor of 648 and 600? 24 Calculate the greatest common factor of 1269 and 27. 27 Calculate the greatest common divisor of 1288 and 184. 184 What is the highest common divisor of 46793 and 73? 73 What is the greatest common divisor of 72 and 240? 24 Calculate the greatest common divisor of 36 and 414. 18 What is the highest common divisor of 580 and 40? 20 What is the greatest common divisor of 1426 and 558? 62 Calculate the greatest common factor of 1472 and 192. 64 What is the greatest common divisor of 450 and 22650? 150 Calculate the highest common divisor of 1419 and 903. 129 What is the highest common divisor of 138566 and 158? 158 What is the greatest common factor of 112 and 7? 7 What is the greatest common divisor of 47424 and 152? 152 What is the greatest common divisor of 5161 and 39? 13 What is the greatest common factor of 299 and 104? 13 Calculate the greatest common divisor of 95 and 15. 5 What is the greatest common divisor of 21 and 3801? 21 What is the greatest common divisor of 110 and 100? 10 What is the greatest common divisor of 129 and 27047? 43 What is the highest common factor of 441 and 49? 49 What is the highest common divisor of 198 and 576? 18 Calculate the highest common divisor of 1274 and 117. 13 Calculate the highest common factor of 1785 and 340. 85 What is the greatest common factor of 27 and 1422? 9 Calculate the highest common factor of 29 and 4553. 29 W	{ "pile_set_name": "DM Mathematics" }
o the nearest integer? 22 What is 36193826 to the power of 1/2, to the nearest integer? 6016 What is the square root of 340040612 to the nearest integer? 18440 What is 113434369 to the power of 1/3, to the nearest integer? 484 What is 20588221 to the power of 1/4, to the nearest integer? 67 What is the square root of 59051047 to the nearest integer? 7684 What is 83129506 to the power of 1/3, to the nearest integer? 436 What is 2562856821 to the power of 1/5, to the nearest integer? 76 What is the third root of 71359246 to the nearest integer? 415 What is the sixth root of 352469586 to the nearest integer? 27 What is the fourth root of 149718422 to the nearest integer? 111 What is 3609913414 to the power of 1/2, to the nearest integer? 60083 What is the seventh root of 1140987567 to the nearest integer? 20 What is 445857888 to the power of 1/3, to the nearest integer? 764 What is the third root of 30326290 to the nearest integer? 312 What is 262998667 to the power of 1/2, to the nearest integer? 16217 What is the tenth root of 289024098 to the nearest integer? 7 What is the cube root of 5443962 to the nearest integer? 176 What is 1646039787 to the power of 1/2, to the nearest integer? 40571 What is the tenth root of 12100276 to the nearest integer? 5 What is 315303242 to the power of 1/5, to the nearest integer? 50 What is the fourth root of 239983083 to the nearest integer? 124 What is the third root of 553841640 to the nearest integer? 821 What is 22063722 to the power of 1/4, to the nearest integer? 69 What is 4713369 to the power of 1/3, to the nearest integer? 168 What is 65594940 to the power of 1/7, to the nearest integer? 13 What is the cube root of 13568306 to the nearest integer? 239 What is 139666524 to the power of 1/5, to the nearest integer? 43 What is 12955227 to the power of 1/2, to the nearest integer? 3599 What is 752181151 to the power of 1/4, to the nearest integer? 166 What is the fourth root of 68131786 to the nearest integer? 91 What is the square root of 7496607664 to the nearest integer? 86583 What is the fourth root of 239116065 to the nearest integer? 124 What is 103429546 to the power of 1/6, to the nearest integer? 22 What is the cube root of 484804897 to the nearest integer? 786 What is 373692372 to the power of 1/2, to the nearest integer? 19331 What is 30500595 to the power of 1/3, to the nearest integer? 312 What is 276590948 to the power of 1/9, to the nearest integer? 9 What is the cube root of 54775618 to the nearest integer? 380 What is the square root of 37515922 to the nearest integer? 6125 What is the fourth root of 30873362 to the nearest integer? 75 What is the cube root of 18666930 to the nearest integer? 265 What is the square root of 528195540 to the nearest integer? 22983 What is the seventh root of 1012207288 to the nearest integer? 19 What is 2051353257 to the power of 1/5, to the nearest integer? 73 What is the seventh root of 730479484 to the nearest integer? 18 What is the square root of 58230854 to the nearest integer? 7631 What is 850123347 to the power of 1/8, to the nearest integer? 13 What is the cube root of 190597444 to the nearest integer? 575 What is the third root of 274112744 to the nearest integer? 650 What is the square root of 973536598 to the nearest integer? 31202 What is the fifth root of 57233478 to the nearest integer? 36 What is the square root of 19751592 to the nearest integer? 4444 What is the square root of 1026875081 to the nearest integer? 32045 What is the third root of 9618002 to the nearest integer? 213 What is 374740586 to the power of 1/7, to the nearest integer? 17 What is 24919139 to the power of 1/2, to the nearest integer? 4992 What is the square root of 2345238301 to the nearest integer? 48428 What is the square root of 84674873 to the nearest integer? 9202 What is the square root of 1291367383 to the nearest integer? 35936 What is the third root of 455261098 to the nearest integer? 769 What is the third root of 4054740920 to the nearest integer? 1595 What is 1000062512 to the power of 1/3, to the nearest integer? 1000 What is the square root of 4808129235 to the nearest integer? 69341 What is 50661993 to the power of 1/2, to the nearest integer? 7118 What is 1798256738 to the power of 1/9, to the nearest integer? 11 What is the cube root of 5268207 to the nearest integer? 174 What is 49576551 to the power of 1/2, to the nearest integer? 7041 What is 1811710735 to the power of 1/9, to the nearest integer? 11 What is the square root of 825160199 to the nearest integer? 28726 What is 688007591 to the power of 1/10, to the nearest integer? 8 What is the sixth root of 1055838686 to the nearest integer? 32 What is 19923522 to the power of 1/6, to the nearest integer? 16 What is the square root of 36232592 to the nearest integer? 6019 What is 32645568 to the power of 1/3, to the nearest integer? 320 What is 8112718635 to the power of 1/2, to the nearest integer? 90071 What is the cube root of 93376092 to the nearest integer? 454 What is 288239686 to the power of 1/2, to the nearest integer? 16978 What is 266228236 to the power of 1/9, to the nearest integer? 9 What is 3979643858 to the power of 1/8, to the nearest integer? 16 What is 390330833 to the power of 1/2, to the nearest integer? 19757 What is the third root of 3152212266 to the nearest integer? 1466 What is 269951183 to the power of 1/3, to the nearest integer? 646 What is 2670956732 to the power of 1/3, to the nearest integer? 1387 What is 5802298545 to the power of 1/3, to the nearest integer? 1797 What is 36483814 to the power of 1/3, to the nearest integer? 332 What is the tenth root of 1030536234 to the nearest integer? 8 What is 81630348 to the power of 1/7, to the nearest integer? 13 What is the tenth root of 1918573052 to the nearest integer? 8 What is 1432851931 to the power of 1/6, to the nearest integer? 34 What is the ninth root of 31191939 to the nearest integer? 7 What is the third root of 977502029 to the nearest integer? 992 What is the tenth root of 20479880 to the nearest integer? 5 What is 276023818 to the power of 1/10, to the nearest integer? 7 What is 125299682 to the power of 1/2, to the nearest integer? 11194 What is 1049996435 to the power of 1/3, to the nearest integer? 1016 What is 6355706770 to the power of 1/2, to the nearest integer? 79723 What is the square root of 5937400319 to the nearest integer? 77055 What is the square root of 3006692485 to the nearest integer? 54833 What is the square root of 132485808 to the nearest integer? 11510 What is the fourth root of 922346333 to the nearest integer? 174 What is the third root of 3363450821 to the nearest integer? 1498 What is 233435318 to the power of 1/7, to the nearest integer? 16 What is the third root of 60870461 to the nearest integer? 393 What is 430275678 to the power of 1/5, to the nearest integer? 53 What is the square root of 1014107382 to the nearest integer? 31845 What is the cube root of 1700404996 to the nearest integer? 1194 What is 869077437 to the power of 1/7, to the nearest integer? 19 What is 793374796 to the power of 1/3, to the nearest integer? 926 What is the eighth root of 44471719 to the nearest integer? 9 What is 59826816 to the power of 1/7, to the nearest integer? 13 What is 113624598 to the power of 1/8, to the nearest integer? 10 What is the eighth root of 3247606430 to the nearest integer? 15 What is the cube root of 9550561 to the nearest integer? 212 What is the eighth root of 67980721 to the nearest integer? 10 What is the ninth root of 54862740 to the nearest integer? 7 What is 536606947 to the power of 1/9, to the nearest integer? 9 What is the square root of 68203159 to the nearest integer? 8259 What is the eighth root of 23658750 to the nearest integer? 8 What is the tenth root of 29503840 to the nearest integer? 6 What is 2103522306 to the power of 1/2, to the nearest integer? 45864 What is the fifth root of 8234655 to the nearest integer? 24 What is 19274187 to the power of 1/10, to the nearest integer? 5 What is the tenth root of 250244719 to the nearest integer? 7 What is 244420117 to the power of 1/9, to the nearest integer? 9 What is the cube root of 738932854 to the nearest inte	{ "pile_set_name": "DM Mathematics" }
v(i) = 3i - 1232. Let f(b) = 7b - 2774. Let z(o) = -4f(o) + 9v(o). Let t(k) = -k*3 + 7k*2 - 4k - 1. Let w be t(6). Give z(w). -3 Suppose 16 = 2w + 2k, k + 14 - 4 = 5w. Suppose -13t + 21 = -18. Let b(x) = -t + 3x - 18x*2 + 7 + 17x*2. Give b(w). 4 Let l(g) = -9g*2 - 2g. Let w(t) be the first derivative of -t*4/4 + 49t*3/3 - 47t*2/2 - 46t + 64. Let o be w(48). What is l(o)? -40 Let n(w) = w*2 - 18w + 40. Let r(y) = -2y3 + 11y*2 + 16y - 44. Let o be r(6). Determine n(o). 8 Let r(z) = 27 + 2z2 - 8 - 22 + 1 + z2. Let s be (-3)/2(-16)/6. Let d = 6 - s. What is r(d)? 10 Let t(f) be the first derivative of 5f2 - 4f + 1555. What is t(-1)? -14 Let b(p) = 8p3 - p2 - 3p + 3. Let t(c) = 17c + 869. Let d be t(-51). Calculate b(d). 57 Let p be (15/12)/(1/4). Let g(t) = 5t*3 + 15t*2 + 23t - 17. Let x(s) = -2s3 - 7s*2 - 11s + 8. Let a(w) = 3g(w) + 7x(w). Give a(p). -10 Let s(z) be the first derivative of 2z2 + 31z - 2634. Calculate s(-7). 3 Let p = 1 + 15. Suppose -pc = -20c - 4. Let j be (-28)/8c/((-3)/6). Let o(a) = a2 + 2a - 8. Give o(j). 27 Let y = -3 + -7. Let n = -5 - y. Let p(f) = -8f3 - 45f*2 + 88f + 2. Let u(x) = -3x3 - 16x*2 + 32x + 1. Let v(j) = 4p(j) - 11u(j). Determine v(n). 22 Let k(h) = -13h3 + h2 + 6h + 6. Let w be k(-1). Let x(b) = -10 - w + 9b - 4b - 6b + 6. Give x(-9). -9 Let h(p) = -616p + 651. Let t(z) = -20z + 21. Let l(x) = -2h(x) + 63t(x). Let b be l(1). Let o(q) = q2 + 6q - 4. What is o(b)? 3 Suppose 3l + l - 4g = -164, l - 3g + 49 = 0. Let m = -35 - l. Let d(n) = -mn + 2 - 2n + 3n + 9. Calculate d(9). 2 Let j(l) = -91l. Let n(k) = -32k. Let z(v) = 6j(v) - 17n(v). Let d be 0 - 0/2 - 1. What is z(d)? 2 Let j(o) = 4o - 37. Let s(b) = -2b + 19. Let q(y) = 6j(y) + 13s(y). Calculate q(11). 3 Let d = 28325 - 28328. Let h(o) = 16o + 38. Give h(d). -10 Let p(o) = -12o*2 + 2o + 92. Let a be p(-2). Let r(n) = 2n3 - 78n*2 - 83n + 124. What is r(a)? 4 Let n(c) be the third derivative of -c6/30 + c5/12 + c*4/8 + 5c*3/6 - 74c2. Let s(z) = -z3 + z*2 + z + 1. Let u(i) = n(i) - 3s(i). Give u(3). -7 Let x(l) = 5l2 + 3l + 22. Suppose 5j + 30 = -4a, -5a + 1042j - 1045j - 31 = 0. What is x(a)? 132 Let x(w) = w2 + 6w - 3. Let h(d) = d*2 + 14d + 42. Let g be h(-10). Let n be g/(-4)(0 - 52). Suppose -33 = c - n. Calculate x(c). 4 Let n(u) = -u2 - 14u + 95. Suppose 22s - 988 + 1406 = 0. Give n(s). 0 Let g(s) be the second derivative of -s5/20 + 3s*4/4 - 5s*3/6 - 9s*2/2 - 1042s - 1. Calculate g(7). 54 Let s(c) = c*3 - 6c*2 + 8c - 6. Let y = -12 + 24. Let h be 15(4/y - 0). Let d = 0 + h. Calculate s(d). 9 Let c(y) = -15y*2 - 2y + 1. Suppose 17 = 5s - 4w, 384w - 3 = 385w. Calculate c(s). -16 Let f(h) be the second derivative of -h5/20 - h4 + h*3/3 + 25h*2/2 - 146h - 4. Give f(-12). 1 Suppose -7q = -11q + 16. Let l be q/(-14) - 5/7. Let k(n) be the second derivative of 4n5/5 - n3/3 - n2/2 + n - 139. Calculate k(l). -15 Let r(a) be the first derivative of 3a*2/2 + 3a - 2584. What is r(1)? 6 Let g(y) = y*3 + 5y*2 + 6y + 5. Let x(s) = s*3 + 7s*2 - s - 4. Let r be x(-7). Let f be 17/4 + r/(-12). Suppose 0 = 10j - 9j + f. Give g(j). -3 Suppose s - 4s = -9. Let m(c) = -3c - c2 + cs + 3c. Let u(v) = 244v - 1464. Let b be u(6). Determine m(b). 0 Let p(u) = u3 + 12u*2 - 13u + 1. Let b be (-17550)/1365 + (-1)/7. Determine p(b). 1 Let j(b) = b*2 + 4b - 11. Let u = 111 - 112. Let d be (u/3)/((-27)/(-405)). Determine j(d). -6 Let c(t) = 9t + 0 + 2 + 2 + t2 + 2 + 3. Let f(l) = l2 + 4l - 8. Let a be f(-4). Give c(a). 1 Let v(t) = -16 - 11t - 24 - 14 + 75. Give v(7). -56 Let z be (0 - (-6)/(-7))-7. Let q(v) be the second derivative of -v4/12 + v3 - v*2 - 10295v. What is q(z)? -2 Let u(h) = -7h2 - 7h - 8. Suppose 0 = 5p - 2w + 12, 3p - 3w - 24 + 33 = 0. Calculate u(p). -22 Let p(u) be the third derivative of -u*5/60 - 5u4/24 + u3/6 + 8u2. Suppose -10j = -11j + 21. Let b = 17 - j. Calculate p(b). 5 Let z(j) be the first derivative of j4/4 + 3j3 + j2 + 15j + 12252. Determine z(-9). -3 Let c(x) = x3 + 8x*2 + 7x - 25. Let l(h) = 2h3 + 16h*2 + 15h - 50. Let b(g) = -5c(g) + 3l(g). Give b(-5). 0 Let j = -46 + 42. Let d be -4 + (-4 - j) - 2. Let b(c) be the second derivative of c*3/6 + 2c*2 + 12c. What is b(d)? -2 Suppose -8 - 4 = -p. Let c(w) = w + p - 7 - 6. Determine c(-7). -8 Let n(c) = 40c + 74. Let r(b) = 21b + 39. Let i(v) = 2n(v) - 5r(v). Determine i(-2). 3 Let w(b) = b - 4. Let p = -52 + 61. Let r(i) = -3i + 19. Let u be r(p). Let c = 15 + u. What is w(c)? 3 Let k(p) = -65p + 142. Let s(u) = 14u - 35. Let v(r) = -2k(r) - 9s(r). Give v(-6). 7 Let u(b) = 2b*3 + 9b*2 + 3b + 1. Let a be u(-4). Let l(y) = 2y + 3. Let i be l(a). Let g(w) = 3 + 5 + w - i + 6. Give g(2). 3 Let f = -30 - -35. Suppose 0 = -fc + 9 + 6. Let x(m) = -7mc + 2m2 - m3 - m + 2m3. Determine x(1). -5 Let t(v) = v3 + 11v*2 - 11v + 14. Let b be t(-12). Suppose 67 = by + 59. Let u(p) = 2p + 5. Determine u(y). 13 Let b(v) = -v*2 - 4v + 1. Let u be (-4 + ((-66)/(-15))/1)20. Let x(q) = -15q + 63. Let n be x(u). Let i be ((-10)/3)/((-38)/n). What is b(i)? -4 Suppose -28c + 32c - 4y = 32, 5c - 48 = -3y. Let z(x) = 82 + x + cx*2 - 83 + x. Determine z(1). 10 Let w(m) = -6 + 1 - m - 4. Suppose -446a + 851 = 120a - 4809. Give w(a). -19 Let q(x) be the second derivative of x8/6720 - x7/504 - x6/720 + x5/30 + 5x*4/12 + 2x + 11. Let b(a) be the third derivative of q(a). What is b(5)? -1 Let f be ((-720)/(-64) + -12)4. Let m(u) = -7u - 13. Calculate m(f). 8 Let p(i) = 56i + 41. Let s(t) = -21t - 14. Let a(w) = 4p(w) + 11s(w). What is a(3)? -11 Let t(a) = -a + 11. Let g(z) be the second derivative of -z*2 + 49z - 4. Let r(l) = 6g(l) + t(l). Let n(v) = -v + 5. Let w be n(3). Calculate r(w). -3 Let s(q) = 358q + 2166. Let y be s(-6). Let p(n) = 3n - 72. Calculate p(y). -18 Let a(g) = g2 + 6g + 5. Suppose 0 = r + 8 - 51. Let j = r + -26. Let x = j + -23. Determine a(x). 5 Suppose s - 46 = -4h, -h + 0s + 22 = -5s. Let g(q) = q + hq*2 + 2q*2 - 1 - 5q*2 + 2q - 6q2. Determine g(2). 17 Let x(g) be the first derivative of -g3/3 + 7g*2/2 + 11g + 202. What is x(10)? -19 Suppose r - 6 = 4y, 5r + 7y - 2y + 20 = 0. Let m be r/(-7) - (-600)/105. Let x(z) = -2z + 3. Calculate x(m). -9 Suppose -260a = -246a - 126. Let q(y) = -y3 + 22y*2 + 0 + 0 - 10y - 12y2. Give q(a). -9 Let o(j) = -j3 - 8j*2 - 10j - 13. Let g be ((-9)/(-81)-15)/((-15)/(-54)). What is o(g)? -25 Let o(a) = 4a*2 + 2a - 1. Let f = -32 - -28. Let r be f/(-18) + -10(-6)/(-27). Let q be 4/r2 + 15. Give o(q). 5 Let g(q) = q3 - 18q*2 - 41q + 28. Suppose 130 = 8r - 21r + 390. What is g(r)? 8 Let y(z) = -21z2 - 5z + 31z2 - 8 - 9z. Let b(h) = h*2 - h - 1. Let q(s) = -8b(s) + y(s). Calculate q(3). 0 Let u(w) = w*2 - 8w + 3. Let r(d) = d + 1. Let b(n) = 6r(n) - u(n). Let q be b(14). Let x(t) = -3t - 8 + 9 - t*3 + 3 + 6t*2. Determine x(q). 22 Suppose 1 = 5b - 29. Let x(p) = -25p - 23. Let z be x(-1). Let y(c) = -39c + 2cz + bc*2 + 38c. Calculate y(-1). 9 Suppose 4 = -10v + 4. Suppose v = -9k + 2k + 7. Let l(z) = 22z3 + z2 - z + 1. Give l(k). 23 Let o = 1 - 1. Let z(r) = -86683 - 86682 - 86686 - 86680 + 346731 + r. Give z(o). 0 Let w(b) = b + 8. Let s be w(-4). Suppose -7m = -11 + s. Let k(c) = 17c3 - c2 + c - 1. Give k(m). 16 Let r(h) = 2h2 + h. Let w(m) = -3m*2 - 2m - 2. Let j(o) = -3r(o) - w(o). Suppose -17k = k + 54. Determine j(k). -22 Suppose -3q + 4t + 3 = 0, 4q - 5t + 3 = 8. Suppose qc + 240 = -35c. Let n(b) be the second derivative of b3/3 - b2 - b. Give n(c). -14 Let v(s) be the second derivative of s7/315 - s6/180 - s5/60 - s4/12 + 63s2/2 + 30s. Let j(x) be the third derivative of v(x). Calculate j(-1). 10 Let b(q) = -4q + 27. Let i = -536 + 543. Let a be b(i). Let v(f) = -18f*2 - 1. Give v(a). -19 Let w(f) be the third derivative of -3f*4/8 + 2f*3/3 + 334f**2. Let a be (0 + 1)/(7/28). What is w(a)? -32	{ "pile_set_name": "DM Mathematics" }
000? 6000000 Let t(r) = -1795r - 55. Let v be t(-9). What is v rounded to the nearest one thousand? 16000 Let y = 5.05 - 5. Let f = -0.05000001 + y. Round f to seven decimal places. 0 Let z = 38.1 + -5.1. Let b = -33.29 + z. Let t = b + 0.01. Round t to 1 decimal place. -0.3 Let c = -0.13 - 0.11. Let n = c - -0.06. What is n rounded to one decimal place? -0.2 Suppose x = -4c + 11332096 + 627686, 4x = c - 2989937. Let o = 1719945 - c. What is o rounded to the nearest 100000? -1300000 Let l be 9/(-6) + (-79)/(-2). Let n be l/8 + (-6)/(-24). Suppose -q = ni - 36001, 14403 = 2i - 0q + 3q. What is i rounded to the nearest 1000? 7000 Let t = -3.1 - 47.9. Let g = 50.41 + t. Round g to 1 decimal place. -0.6 Let c = 7.38 + -7. Let h = -18.38 + c. Let q = 17.99974 + h. What is q rounded to 4 dps? -0.0003 Let d be 4 - (2 - (0 - -2)). Suppose 2k - 3k = -62224. Suppose 5c + f - 427781 - k = 0, -3f - 391985 = -dc. What is c rounded to the nearest 10000? 100000 Let t = 0.23 + -0.556. Let l = 141.326 + t. Let i = l + -141.00122. What is i rounded to four dps? -0.0012 Suppose 3h + 2h - 3w = 14100979, -4h + 2w = -11280784. Suppose 5l = h + 3979803. What is l rounded to the nearest 100000? 1400000 Let v be 1250/(-4) + 3. Let u = v - -1727. Round u to the nearest 100. 1600 Let b(a) = 2218749a*2 + 5a - 4. Let u be b(4). What is u rounded to the nearest 1000000? 36000000 Let g = 0.1 + 0.4. Let j = 0.2 - g. Let m = j - -0.299975. What is m rounded to five decimal places? -0.00003 Let z = 24.9976 - 25. Round z to 3 decimal places. -0.002 Let x = 77.873 + 0.127. Let d = -566650 + 566727.9842. Let l = d - x. Round l to 3 decimal places. -0.016 Let g be ((-360)/54)/((-2)/1980). What is g rounded to the nearest 1000? 7000 Let f = 0.35153 - 0.353. What is f rounded to four dps? -0.0015 Let z = 0.15 - 0.2. Let p = 0.12657 - 0.176552. Let f = z - p. What is f rounded to 5 decimal places? -0.00002 Let l = 302.7648 + -303.4647955. Let a = -0.03 + 0.73. Let u = l + a. What is u rounded to six dps? 0.000005 Let k = -0.074 + 0.073729. Round k to 5 decimal places. -0.00027 Let m = 423.3 + -444. Let c = -17.1 + -4.9. Let i = c - m. What is i rounded to the nearest integer? -1 Let l = 1421.82 - 1401. Let t = -31 - -11. Let y = t + l. What is y rounded to 1 decimal place? 0.8 Let g be 3(-4 + -2 + 5). Round g to the nearest integer. -3 Let y = 0.06 - 3.36. What is y rounded to the nearest integer? -3 Let h = -66.84 - -68. Let k = -1.15999951 + h. What is k rounded to seven dps? 0.0000005 Let g = 2.88 - 1.2. Let p = 334.62 - 329. Let h = g + p. What is h rounded to the nearest integer? 7 Let i = -1455130.999993 - -1455141. Let k = i - 10. What is k rounded to 6 dps? 0.000007 Let b = 0.01 + -4.01. Let k = 5 - b. Let d = -8.84 + k. Round d to 1 dp. 0.2 Let j = -82.6 - -73. Round j to the nearest integer. -10 Let w be (1 - 0)-25-1. Round w to the nearest ten. 30 Let h = 71 + -149. Let m = h - -78.00000039. Round m to 7 dps. 0.0000004 Let x = -12.8 + 12.785. Round x to 3 dps. -0.015 Let m = 0.163 + -0.325. Let b = 0.18 + m. Let x = 0.0179934 - b. What is x rounded to six decimal places? -0.000007 Let b = 2867459 - -9132541. What is b rounded to the nearest one million? 12000000 Let n = 36.16 - 37. Let a = -7.46 + n. What is a rounded to the nearest integer? -8 Let x = -0.65 + 0.586. What is x rounded to two decimal places? -0.06 Let v = 73.9967 + -74. Round v to three dps. -0.003 Let s = 0.71 + 0.083. Let v = s + -0.8. Round v to two dps. -0.01 Let p = -0.12548 + 0.125. Round p to 3 decimal places. 0 Let n(x) = -x3 + x2 + x - 3. Let k be n(0). Let w be (k/9)/((-2)/12). Suppose t + 207 = wc - 428, 2t = -5c + 1610. What is c rounded to the nearest 100? 300 Let o = -2835.494054 + 2829.394. Let b = 18.9 - 25. Let y = o - b. What is y rounded to 5 dps? -0.00005 Let m = 4.2 - 4.19. Round m to 3 decimal places. 0.01 Let f = -0.00600628 + 0.006. What is f rounded to seven decimal places? -0.0000063 Let x = 141 - -42. Let i = -316 + x. Round i to the nearest 10. -130 Let p(w) = 5626w3 - w2 - w - 2. Let i be p(2). Suppose -6q = -5q - i. What is q rounded to the nearest ten thousand? 50000 Let d = -15.18 - -5.09. Let c = d - 0.41. Round c to zero decimal places. -11 Let p be (-2)/(1/5-2). Suppose 3s - 6 = 0, ps = d + 8 - 3. Suppose 2u + 0u + 5z = 1019975, du + 4z - 2549980 = 0. Round u to the nearest 100000. 500000 Let b = 0.7 - 1.103. Let n = b - 0.107. Round n to one decimal place. -0.5 Let j = -1277636404924096 + 1277636543657071.19999914. Let i = 138732977 - j. Let u = i + -1.8. What is u rounded to seven decimal places? 0.0000009 Let o = -1.2 + 1. Let m = o + -2.8. Let v = m + 2.999956. What is v rounded to five decimal places? -0.00004 Let z = -122.4 - 111.5. Let j = z - 0.1. Let r = j - -223.3. What is r rounded to 0 decimal places? -11 Let a = -276.45548 + 276.61547971. Let b = 0.16 - a. Round b to seven dps. 0.0000003 Let p = 0.887 - 0.85. Let m = p - 0.04. Round m to 2 dps. 0 Let g(w) = 6502w + 4. Let l be g(-2). What is l rounded to the nearest one thousand? -13000 Let n = -12.37774 - -14.0196. Let r = -1.64 + n. Round r to four decimal places. 0.0019 Let d be (-28)/8(-100)/(-6)360. What is d rounded to the nearest 1000? -21000 Let m(x) = 3x2 + 2x - 8. Let a be m(6). Let o = -88 - a. What is o rounded to the nearest 1000? 0 Let i = -4.298527 - -4.51265. Let t = -0.214 + i. Round t to 5 decimal places. 0.00012 Let z(m) = 4m2 - 1. Suppose -4l - 3x = -8, 2l - l - 4x = 2. Suppose -5j = -3j + l. Let v be z(j). What is v rounded to the nearest 10? 0 Let a = 218 - 401. What is a rounded to the nearest 10? -180 Let s = -3 + 1. Let p be s/(23/(-189)). What is p rounded to the nearest 10? 60 Let f(z) = -64286z - 2. Let k be f(-7). What is k rounded to the nearest 100000? 500000 Let t = -23 + 23.013. Let b = -22.987 - t. Let r = -25.8 - b. What is r rounded to the nearest integer? -3 Suppose -y + k = 605, -4y + 3k = 2037 + 378. Round y to the nearest one thousand. -1000 Let d = -83181 + 83231.061. Let l = -40 - -90. Let b = l - d. Round b to 2 dps. -0.06 Suppose -6r - 32 = -2r. Let p = r - -12. Suppose pv = -v - 1000000. What is v rounded to the nearest one million? 0 Let o = -11 + 55. Let m = -44.086 + o. Round m to two dps. -0.09 Let b = -5 - -4.8. Let l = -0.18 + b. What is l rounded to one decimal place? -0.4 Let h(x) = 28890x - 10. Let j = -22 - -31. Let w be h(j). What is w rounded to the nearest 100000? 300000 Let v = 4.11 - 0.11. Let a = 3.7683059 + 0.2315681. Let i = a - v. What is i rounded to 5 decimal places? -0.00013 Suppose 2r = 3x - 0r - 44, 4x = 3r + 59. Let a be (-6 - -3)/(1/x). What is a rounded to the nearest 10? -40 Let r be 1 + 7 - (4 - 1). Suppose -2z = -6, -4b + 5z - 21 = -rb. Round b to the nearest 10. 10 Let d = -2.13 - -2.0332. Let z = d - -0.197. Let x = z - 0.1. Round x to four decimal places. 0.0002 Let q(o) be the third derivative of -1833333o4/8 + o3/6 - 4o*2. Let a be q(-1). What is a rounded to the nearest 1000000? 6000000 Suppose -7 = 3h + 8. Let v = -7 - h. Let r be (1 + v)(-5 + 2). What is r rounded to the nearest ten? 0 Let b = 3 + -2.999974. What is b rounded to 5 dps? 0.00003 Let p = -0.7 + -23.3. Let n = p - -23.932. What is n rounded to 2 dps? -0.07 Suppose 3d = -z + 5, 4d = 3z + 21 + 29. Let o be (-555009)/(-15) - (-6)/z. Round o to the nearest ten thousand. 40000 Let p = 8.08 + -8. Let c = 0.080047 - p. What is c rounded to five decimal places? 0.00005 Let c = -54861.37082 + 54964.37. Let q = -103 + c. What is q rounded to four decimal places? -0.0008 Let v = -0.2 - -0.1919. Round v to three decimal places. -0.008 Suppose -3z + 111997 = -4a + 2a, 3a + 167999 = z. What is a rounded to the nearest 10000? -60000 Let c be (-17)/(-34)(1 + -1). Suppose -4t + 0z = 4z + 10840008, t + 2z + 2710004 = c. Round t to the nearest one hundred thousand. -2700000 Let n(l) = 25138l*3 + 4l*2 + 7l + 3. Let m be n(6). Let y = m + -11829997. Round y to the nearest one million. -6000000 Let u(s) = s. Let i be u(6). Suppose 5d = -i - 9, 3d = 3c - 8100009. Round c to the nearest one million. 3000000 Let i(u) = 1625002u + 8. Let r be i(-4). Round r to the nearest one mi	{ "pile_set_name": "DM Mathematics" }
sqrt(176))*2 + -2 + -2)) + 0). -16sqrt(11) + 6348 Simplify (sqrt(108)/sqrt(225)-4)/(32sqrt(256)) + -2. -2 - sqrt(3)/60 Simplify ((sqrt(136) - ((-1sqrt(136) - sqrt(136)) + sqrt(136)))3-4)/(sqrt(88)/(1sqrt(539))). -168sqrt(17) Simplify (-2sqrt(76)-1 - 5(sqrt(76) - -2sqrt(76)))/(sqrt(144)-24 + sqrt(144) - -12sqrt(144)). 13sqrt(19)/30 Simplify -6(((sqrt(50) + sqrt(50) + 0 + -2)*2 - 4(sqrt(8)/sqrt(4) - sqrt(2))*2-6) + -5). -1194 + 240sqrt(2) Simplify 1 + (-4 + (sqrt(720) + -1)2)-5 + (sqrt(720)2-2 - sqrt(720)1-1) + 4. -3580 + 84sqrt(5) Simplify 5 + (3(-2 + 2sqrt(1216) - (-3sqrt(1216) + -4)))*2 + 4. 1440sqrt(19) + 273645 Simplify (-1(sqrt(121)15 - sqrt(121) - (sqrt(121) - (sqrt(121)1 + sqrt(121) - sqrt(121))6)))/((-1(-1sqrt(22) - sqrt(22)))/(sqrt(8)-6)). 54sqrt(11) Simplify (-4(-6(sqrt(4032) + 5 + (sqrt(4032) - (sqrt(4032)-1 + sqrt(4032)))) + 4 + 5 + -1sqrt(4032)))2. 209664sqrt(7) + 10909584 Simplify (1((-6sqrt(468) + 5)5 + (sqrt(468) - (sqrt(468)-6 + sqrt(468))-2) + -2 + 5))2. -13104sqrt(13) + 712612 Simplify ((-4 + -2sqrt(448)32 + 1)4 + 4)*2. 6144sqrt(7) + 1032256 Simplify ((sqrt(84)/sqrt(3))*2 - (sqrt(7) + 0)4) + -3 + -1(sqrt(343) + -3). -11sqrt(7) + 28 Simplify (-4(sqrt(88)2 + sqrt(88)) - (sqrt(88) - -2sqrt(88)-3))/(3(sqrt(80)/(sqrt(30)/sqrt(3)) + (-1sqrt(392) - sqrt(8)))). sqrt(11)/3 Simplify (-6(-2sqrt(117) + sqrt(117))-61)/((sqrt(18) + -2sqrt(882))/(sqrt(4)/sqrt(2)4)). 144sqrt(13)/13 Simplify -4 + 1 + 1 + (-4(sqrt(55) - -6sqrt(165)/sqrt(3) - sqrt(55))/sqrt(5))2. 6334 Simplify (6(1 + (2sqrt(432) + -1 - (-5 + (sqrt(432)-5 + sqrt(432) - sqrt(432))))4))2. 411264sqrt(3) + 12203172 Simplify 3((1 + (-4sqrt(85)2)/sqrt(5) + -1sqrt(272)-12)-2)2. 12 Simplify (sqrt(833)2)*2 + 2 + 5 + 2 - (-4sqrt(833)2 + sqrt(833) - sqrt(833) - sqrt(833) - sqrt(833) - sqrt(833)-34)2. 9 Simplify 3 + (((sqrt(150)/sqrt(5) + sqrt(30))-2)/((1sqrt(70))/sqrt(7)) + (sqrt(147)/sqrt(7))/sqrt(7) + 0 + sqrt(6)/sqrt(2) + sqrt(3))2. 6 Simplify ((sqrt(1470) + sqrt(1470) + -1sqrt(1470)1 + -1sqrt(1470)-6 + sqrt(1470))/(sqrt(490)1 + sqrt(10) - sqrt(60)/sqrt(24)))*2-5. -12544/15 Simplify ((-1(51sqrt(77) + sqrt(77))-4)/((sqrt(175) + sqrt(175) + -6-2sqrt(175) - sqrt(175))-3))2. 704/4225 Simplify (((sqrt(84) - (sqrt(84) + -1sqrt(84))) + (sqrt(336)3 - sqrt(21)))/(((sqrt(270) + sqrt(270) + sqrt(270)3)-2)/sqrt(10)))2. 1183/900 Simplify ((-2(sqrt(448) - (sqrt(448) - -5(sqrt(448) + 4))) - (4 + sqrt(448) + -2 + 5))1)*2. 4752sqrt(7) + 37377 Simplify ((2sqrt(378))/((sqrt(6) + sqrt(54))2 - sqrt(6)))2 + sqrt(7) + (1 + sqrt(7) + sqrt(28)/sqrt(4))2 + -5(sqrt(7)2)*2 + 1 + 4. -706/7 + 5sqrt(7) Simplify 5 + sqrt(2057) + -1 + sqrt(2057) + (sqrt(17) - (sqrt(17) + 0 + 5))-6 - (-4 + sqrt(68) + 0)23-3. -122sqrt(17) + 790 Simplify (-3-1sqrt(336) + sqrt(336) + 4(sqrt(336) - (sqrt(336) - -1sqrt(336))))/(sqrt(70)/(sqrt(10) - (1sqrt(1210) + sqrt(1210)))-2) + 3. 3 Simplify (((sqrt(1377) + sqrt(1377) + -1 - sqrt(1377))-1 + 2sqrt(1377)5 - (2sqrt(85)1)/(sqrt(10)/sqrt(2)-1)) + 2)*2. 498sqrt(17) + 117122 Simplify 0 + (-1 + -2sqrt(13)2 + 4 + -5 + sqrt(39)/sqrt(3) + sqrt(13) + -3 + 2)*2. 12sqrt(13) + 61 Simplify 2(-4 + (sqrt(312)/sqrt(6) + 5 - (4 + sqrt(1053) + 5)))2. 224sqrt(13) + 1402 Simplify (-3 + sqrt(972) + 2 + sqrt(972) + 6-2sqrt(972) + 2sqrt(972)21)2. 216sqrt(3) + 34993 Simplify (6-5(1sqrt(66) + sqrt(66))-1)/(4sqrt(54)/sqrt(9) - 5sqrt(486)). -60sqrt(11)/41 Simplify 3(-1 + (sqrt(99) - (-1sqrt(99)1 + sqrt(99))) + -5 + sqrt(99)24)*2. -972sqrt(11) + 24165 Simplify 2 + (6sqrt(90)3)/(sqrt(5) + 1sqrt(500) - (sqrt(5) + sqrt(20)/sqrt(4))6). -54sqrt(2) + 2 Simplify ((sqrt(567)2 + (3sqrt(77) + sqrt(77))/sqrt(11))2 - (sqrt(147)/sqrt(3)-5)/(sqrt(63)3)) + 0. 5sqrt(7)/9 + 3388 Simplify -5(3(sqrt(98) + 1 + sqrt(98)) + sqrt(98))*2 + -5 - (-3-3sqrt(14))/(4sqrt(28)). -24060 - 11769sqrt(2)/8 Simplify (-6((4sqrt(190))/sqrt(10) - -1sqrt(19)-6) + -3 + -1 + 5(sqrt(19)1 + sqrt(19) + -2))2. -616sqrt(19) + 9392 Simplify ((sqrt(136) + -6(sqrt(136)-1 + sqrt(136)))6)/(sqrt(200) + sqrt(200)21 - sqrt(200))-4 + -2. -12sqrt(17)/5 - 2 Simplify ((3(sqrt(252) - (0 + sqrt(252) - sqrt(252))) - -11sqrt(252))*2 - (sqrt(336)/sqrt(108))/(sqrt(4) + sqrt(16)/sqrt(4)-5))-2. -8064 - sqrt(7)/6 Simplify (-3(-5 + 4 + 2 + sqrt(1008) + -1 + sqrt(1008) + 5sqrt(1008)1))*23. 1333584 Simplify (-5 + 2(-4 + sqrt(2299)))2 + ((sqrt(19) + 4sqrt(19))*2 + -1 - (-3(-2 + sqrt(19)) - sqrt(19))). -568sqrt(19) + 9833 Simplify (-6(sqrt(119) + 5sqrt(119)2)-4)/(-5(sqrt(70)/sqrt(2)-2 - sqrt(35))/sqrt(5)). 88sqrt(17)/5 Simplify -5(6(3sqrt(1900))2 + -1 + ((sqrt(1900) - (2 + sqrt(1900))) + sqrt(1900))2 + (-3 + sqrt(1900) + 1 - -2sqrt(1900)-3)). -522505 + 450sqrt(19) Simplify 5(-6-5(1 + sqrt(125) - sqrt(125)) + -1 + sqrt(125) + -3 + -2 + 0)2. 1200sqrt(5) + 3505 Simplify (5(sqrt(12) + sqrt(12) + -5) - (5 + -1 + sqrt(12)) - ((sqrt(48)/(sqrt(4) + sqrt(16)) - -2sqrt(1728)) + 3))*2. 5888sqrt(3)/3 + 11536/3 Simplify ((sqrt(187) - 5sqrt(187)-4) + (sqrt(187) - ((sqrt(187) - sqrt(187)-1)3 + sqrt(187))))/((sqrt(88)-1-1)/sqrt(2)). 15sqrt(17)/2 Simplify (sqrt(84)/(1sqrt(24)/sqrt(8)))/(6(sqrt(4) + sqrt(4) + sqrt(24)/sqrt(6))-5). -sqrt(7)/90 Simplify (-6(sqrt(99) + -3(sqrt(99) + 1)) - (-4 + 2((sqrt(99) - sqrt(99)5) + sqrt(99))))*26 + 3. 14256sqrt(11) + 195363 Simplify (44sqrt(2673))/(sqrt(12)/(sqrt(28)/sqrt(343) + sqrt(4) - sqrt(4))). 144sqrt(11)/7 Simplify 1 + (-3(sqrt(54) - sqrt(54)1)6)/((sqrt(18)/(sqrt(27)/sqrt(3)) - 5(sqrt(2) - sqrt(2)-2))6). 1 Simplify (1(-5 + (3sqrt(13) - sqrt(13)))*2 + -2 + (-3sqrt(1573))*2)-5-5. -500sqrt(13) + 355800 Simplify ((sqrt(24) - sqrt(24)-2-5)/(-5sqrt(6)/sqrt(2)))/(-611sqrt(576)). -sqrt(2)/40 Simplify -6sqrt(72)45 - 4(-2 + -4sqrt(200)). -560sqrt(2) + 8 Simplify (-1sqrt(88)-1 + (sqrt(88) + sqrt(88)-2-2 - sqrt(88)))/(((sqrt(64) + -1sqrt(64) + sqrt(64))-6 + sqrt(64))/(sqrt(32)/sqrt(4)4)). -4sqrt(11) Simplify (1 + (sqrt(88) - (sqrt(88) - (sqrt(88) - (sqrt(88) + -53sqrt(88) + sqrt(88) + sqrt(88)))))/(sqrt(33)/(sqrt(12)/sqrt(4))) + -5)*2. -208sqrt(2) + 1368 Simplify (2sqrt(15)-2 - (sqrt(120)/(sqrt(8)2) - sqrt(15)))/((3(-4sqrt(147) - sqrt(147)) - sqrt(147))-1). -sqrt(5)/32 Simplify (-3 + sqrt(448)-3 + 5 + sqrt(448) + (sqrt(448) - sqrt(448)-1) + 2 + 3(-1sqrt(448)-6 + -4))2. -2304sqrt(7) + 145216 Simplify (3 + ((-1 + sqrt(500))4 - (-5 + sqrt(500)-2)) - (sqrt(180)2 + sqrt(20) - sqrt(2880)-4))*2. -400sqrt(5) + 12516 Simplify (sqrt(12)/sqrt(4)1 - sqrt(3) - sqrt(12)/sqrt(36))-2 + -5 + sqrt(9)/(sqrt(432)1). -5 + 3sqrt(3)/4 Simplify 1(3(5 + 11(sqrt(112) + 1)-5))2. 25200 Simplify sqrt(77)/(-1sqrt(28)/sqrt(4)) + (-1 + sqrt(1331) + 1)2 - (sqrt(1100) + 1 + -1 + sqrt(132)/(sqrt(84)/((sqrt(7) - sqrt(14)/sqrt(2)) + sqrt(7))))2. -sqrt(11) Simplify ((sqrt(162)/sqrt(3)-6)/(sqrt(363)2 - sqrt(363)))/(-61(sqrt(225) - sqrt(225)-1)). sqrt(2)/110 Simplify (4sqrt(170)-5)/(-4sqrt(10)-4) - (6(sqrt(1088)-1 + -4)-5)*2. -993600 - 230405sqrt(17)/4 Simplify (sqrt(110) - -5(sqrt(110)-2 + sqrt(110)) - (sqrt(110) + sqrt(110)23 + sqrt(110)))/(sqrt(250) - sqrt(250)2-2 - 3sqrt(250)2). 12sqrt(11)/5 Simplify (4(sqrt(288) + -2)4 + 3-1sqrt(288) + -1sqrt(288) + 1)*2 + 3. -8928sqrt(2) + 42436 Simplify (sqrt(25) + sqrt(100))/sqrt(5) + ((sqrt(5) - (sqrt(5) + 1))-6)2 + sqrt(55)/(2-2sqrt(11) + sqrt(11)) + -1-5(6(sqrt(5) + 0) - (-1sqrt(5) + -4)). 56 + 113sqrt(5)/3 Simplify (-4sqrt(833)-5 - -2sqrt(833)-3)*2 + 0 + -3. 163265 Simplify (-5 + (sqrt(75)-2 - sqrt(75)) + sqrt(75) + -4 + 5 + -5 + sqrt(75) + -1 + 2)*2-2. -278 - 160sqrt(3) Simplify (sqrt(1008) - (sqrt(1008) - (sqrt(1008) - (sqrt(1008) - 2sqrt(1008)))) - sqrt(875)/sqrt(5)) + (sqrt(189)2 + sqrt(189) + sqrt(189))/(3sqrt(3)1). 23sqrt(7) Simplify ((sqrt(50)/sqrt(2)4-4)/((sqrt(320) - 2sqrt(320)) + (sqrt(10)/sqrt(2)-5 - sqrt(5))) + -5)-1. -8sqrt(5)/7 + 5 Simplify (-4sqrt(243)2 + 0)-1 - (sqrt(1200)1 + sqrt(12))/((sqrt(280)/sqrt(7))/sqrt(10) +	{ "pile_set_name": "DM Mathematics" }
(2)/2 Simplify (((-2sqrt(198) + sqrt(198))2)/(2sqrt(900) + sqrt(900)))/(sqrt(1584)/sqrt(4) - sqrt(22)/(sqrt(16)/sqrt(8))). -sqrt(2)/75 Simplify 4(sqrt(2448) - (sqrt(2448) + 0)*2 - sqrt(2448)) + 3 - (sqrt(170)/sqrt(5)-6)/((sqrt(2) + 2sqrt(2))-6). -9789 - sqrt(17)/3 Simplify (-2(-1sqrt(66) - sqrt(66)) + -2(-4sqrt(66) + sqrt(66) + sqrt(66) + sqrt(66)))/((sqrt(486) - (sqrt(486)-1-5 - sqrt(486)))3). -2sqrt(11)/27 Simplify 4 + -62sqrt(112) + -5 + ((-2 + sqrt(3087))*2 - sqrt(63)). -135sqrt(7) + 3090 Simplify (0 + 3 + sqrt(1300) + 0)*2 + ((sqrt(78) + sqrt(78)1)1 - sqrt(78))/(sqrt(6) - (sqrt(6) - sqrt(24)/(sqrt(4)2))). 62sqrt(13) + 1309 Simplify (-2(2 + 1 + sqrt(4)/(1sqrt(2)) + -2))2 + -3. 9 + 8sqrt(2) Simplify -1 + ((-4sqrt(19))2-5 - 1(sqrt(19) + -3)) + -1((1(sqrt(304) + sqrt(19)))2 + (sqrt(608)/sqrt(2))2). -2297 - sqrt(19) Simplify (-4(sqrt(896) - (sqrt(896) - (sqrt(896) + sqrt(896)-2 + sqrt(896))))-1)/((sqrt(242) - -3sqrt(242))-3-3). 0 Simplify (0 + (-2 + 1sqrt(972) + sqrt(27) - (0 + sqrt(27) + sqrt(27) + 1 + (1sqrt(162))/sqrt(6))))2. -72sqrt(3) + 441 Simplify (-1(sqrt(209)1-3 - (4sqrt(209)-2 - sqrt(209))))/((-4(sqrt(55) + sqrt(275)/sqrt(5)))/(sqrt(5) - sqrt(80)-3)). 39sqrt(19)/4 Simplify (-5(sqrt(1377) + (sqrt(1377) + 0)-6 + (sqrt(1377) + 0 + sqrt(1377))-4 - -3(5 + 2sqrt(1377))) + 0)2-4. -6769800 + 189000sqrt(17) Simplify ((sqrt(17)-11 - (sqrt(85) + (sqrt(85) - 3sqrt(85)))/sqrt(5)) + 1sqrt(153) + sqrt(17) + sqrt(68) + -5)2. -60sqrt(17) + 637 Simplify -4(2(sqrt(1900) + 1) + -3 + (-1(4 + sqrt(1900) + sqrt(1900) + 0))2). -30460 - 720sqrt(19) Simplify 2(-4 + (sqrt(7) - (-2sqrt(343) + sqrt(343))))-3 - (-4sqrt(28)-2)/(sqrt(256)4). -193sqrt(7)/4 + 24 Simplify (-1sqrt(68) + 1 + -4 + (-4 + -1(sqrt(68) + -2))2)1. 6sqrt(17) + 69 Simplify -3 + -32(-2sqrt(76))*2 + 3(sqrt(76)-1 - sqrt(76)) + (sqrt(76) + 5 + -1 + sqrt(76) + sqrt(76))2. -1127 + 36sqrt(19) Simplify ((sqrt(156) + -3sqrt(156))1 + sqrt(156) + (sqrt(156)-3 + sqrt(156))4)/((-6sqrt(432))/(sqrt(12)/sqrt(3)2)). sqrt(13) Simplify (5-3((-2sqrt(416) - sqrt(416)) + sqrt(416))2)/((sqrt(64) + sqrt(64) + (sqrt(64) - 1sqrt(64))-2)/(sqrt(200) - (sqrt(200) + 1sqrt(200)))). -300sqrt(13) Simplify (sqrt(102)113)/(2(sqrt(6) + (sqrt(96) - (-3sqrt(96) + sqrt(96) - sqrt(96))))). 3sqrt(17)/34 Simplify ((sqrt(363) + sqrt(363) + 0 + 5 + 2 - (sqrt(3) - (sqrt(3) + sqrt(18)/sqrt(6) + 4) - (-5 + (sqrt(3) - (sqrt(3) - (sqrt(3) + -2))) + sqrt(3)))) + 0)*2. 200sqrt(3) + 1891 Simplify 1(-4 + sqrt(1900)-1 + -4)*2 - (-3 + -51sqrt(1900) + -4)2. -45585 - 540sqrt(19) Simplify -1 + ((-5 + 1sqrt(192))21 - ((-1 + sqrt(192) - sqrt(192))2 + -5)2). -80sqrt(3) + 167 Simplify -5 + 1((3 + -2 + -4 + (sqrt(448) - (sqrt(448) - (sqrt(448) + -1 - sqrt(448)))))5)*2 + -3. 392 Simplify (6(1 + 1sqrt(605) - (4 + sqrt(605) + 1sqrt(605)))6)232. 513216sqrt(5) + 4774464 Simplify (-5 + (sqrt(300) - (sqrt(300) + (sqrt(300) + 1)*2 - sqrt(300)))3)-2 + 1 + (sqrt(192))2 + (sqrt(36)/sqrt(48) - sqrt(3)). 119sqrt(3)/2 + 2009 Simplify (-1 + 1((sqrt(5324) - (sqrt(5324) + (1 + sqrt(5324) - sqrt(5324)) + sqrt(5324) + 2)) + -5)1)*2. 396sqrt(11) + 5405 Simplify (sqrt(12)/(sqrt(20)/sqrt(5)) - (sqrt(63)/sqrt(3))/sqrt(7))*2 + 3 - (-42sqrt(27) + sqrt(27)-2 + -1)*2. -2698 - 60sqrt(3) Simplify (4(1 + sqrt(275)) + -5 + -2 + sqrt(275))2 - 5(sqrt(275) + (sqrt(275) - (1sqrt(275) + sqrt(275)))2 + -3)3. -225sqrt(11) + 2804 Simplify (-5sqrt(1782) - sqrt(22) - (5sqrt(22)-3 - sqrt(22)))/(sqrt(88)/(sqrt(32)/sqrt(4)-5)-5). -30sqrt(2) Simplify ((sqrt(252) + sqrt(252) + sqrt(252) + -1)4 + -5 - (1 + (sqrt(252) - (sqrt(252) - (sqrt(252) + -1 + sqrt(252)))))-5)2-6. -732294 + 14256sqrt(7) Simplify (5 + 3sqrt(833) + sqrt(833) + 1 + sqrt(833) + -3 + ((4 + sqrt(833) + 0 - sqrt(833)) + sqrt(833) + sqrt(833))-3-4 + 3)*2. 21924sqrt(17) + 703469 Simplify -5((-2sqrt(11)3 + sqrt(55)/sqrt(125))-1 - (((1 + sqrt(11) - sqrt(11))6)2 - ((-3 + sqrt(11))2 + -4))). sqrt(11) + 100 Simplify ((((sqrt(384) - (1sqrt(384) - sqrt(384)) - sqrt(384)) + sqrt(384))-65)/((-2sqrt(2541) - sqrt(2541))/(-2sqrt(175))))*2. 1280000/121 Simplify 5(-5 + ((((sqrt(75) + sqrt(75)-1)-3)*2 - (sqrt(75) - (1 + sqrt(75)-1)*2)) + ((-4 + sqrt(75) + 1)2)*2)4). -2700sqrt(3) + 8215 Simplify -5-1((sqrt(66)/(sqrt(3) + sqrt(12)))/(sqrt(16)/(-2sqrt(8))) - (sqrt(22)/sqrt(288) + 0)). -15sqrt(11)/4 Simplify -2 + (((sqrt(297) + sqrt(297)2 - sqrt(297))1 + sqrt(297))-4)/(2sqrt(1100)3 + 1sqrt(1100)-5). -18sqrt(3)/5 - 2 Simplify ((-4sqrt(1008)6)2 - (-5 + sqrt(7) + 1 + sqrt(7) + -2)2) + -3. 24sqrt(7) + 580541 Simplify -2sqrt(1216)-3-2 - (-1sqrt(171)-2)/((-2sqrt(81))/sqrt(9)). -95sqrt(19) Simplify (5 + sqrt(80) - sqrt(15)/sqrt(192)) + ((-2 + sqrt(320))4 + -2sqrt(320) + -5)2. -3297sqrt(5)/8 + 1454 Simplify -4((sqrt(20)-3)*2 + -3) + ((3 + sqrt(605))-4)*2 + -3. 1056sqrt(5) + 9113 Simplify ((-1 + (-1 + 5 + -1sqrt(300))44)-2-5)2. -2016000sqrt(3) + 8076900 Simplify (-61sqrt(12))*2 + sqrt(12) + -5 + (sqrt(972) + 1 - sqrt(972))-1 + 3(sqrt(108) + 5 + (1-2sqrt(12) + sqrt(12))2)4. 74sqrt(3) + 630 Simplify 3(sqrt(1872) + 0)*2 + 1-3sqrt(1872) + sqrt(1872) - (sqrt(1872) + (sqrt(1872) + -4 + sqrt(1872) + -2)2 + 1(-2 + sqrt(1872))). -1906 + 240sqrt(13) Simplify (-5sqrt(288) + 1sqrt(2178) + sqrt(18))/(1sqrt(81)/(sqrt(27)/sqrt(3))). -8sqrt(2) Simplify -5(((sqrt(216) + sqrt(216) + 1sqrt(216) + sqrt(216))2 - sqrt(216)) + sqrt(216))/(sqrt(4)/(sqrt(242)2 + sqrt(242))). -7920sqrt(3) Simplify (-3 + ((sqrt(117)2-2 - sqrt(117))3)/((sqrt(9) - sqrt(180)/sqrt(5)) + -41sqrt(9)))2. -18sqrt(13) + 126 Simplify (sqrt(125) + -4(sqrt(125) + 2sqrt(125)) + (sqrt(125) - (sqrt(125) + 0)-2) + (4 + sqrt(125) + 1 + sqrt(125) + -2)6)*2. 720sqrt(5) + 2324 Simplify (-4-6(sqrt(847)2 + -1)2 - (-3 + -3(sqrt(847)2 + 5 - sqrt(847)))) + 4. -1023sqrt(7) + 81358 Simplify 6(5 + (0 + sqrt(208) + -4 - (-3(sqrt(208) + sqrt(208) + 0))*2) + -3sqrt(208)25). -44922 - 696sqrt(13) Simplify (sqrt(266)/sqrt(448)3)/((sqrt(600)-1)/sqrt(12)). -3sqrt(19)/40 Simplify -1 + (-2sqrt(336)/sqrt(108)-2 + -2)3. -7 + 8sqrt(7) Simplify ((sqrt(272) - (-2 + sqrt(272))) + -1 + (5sqrt(272)-1 - sqrt(272)) - (-3 + 1sqrt(272)-6 + 1))*2. 9 Simplify (-5sqrt(70)-1-61)/(sqrt(1440)1-5 + sqrt(1440) + 42sqrt(1440) + sqrt(1440) + sqrt(1440) + sqrt(1440)). -5sqrt(7)/14 Simplify ((-4(sqrt(120) + (sqrt(120)-2 - sqrt(120)) + sqrt(120))/(sqrt(6)/sqrt(2)6))/((sqrt(2420)-3 + sqrt(20))/(-4sqrt(30)/sqrt(3))))2. 5/36 Simplify ((sqrt(72) + -5-2sqrt(72))/(-2sqrt(8)/sqrt(4)))/(26(sqrt(1452) - sqrt(1452)2)). sqrt(3)/24 Simplify (-62sqrt(196)-5)/(-5sqrt(343)21). -12sqrt(7)/7 Simplify -6(2 + (sqrt(68) + 3 + sqrt(68) + 1 - (sqrt(68) + (2(sqrt(68) + 0) - sqrt(68)))) + 4)*2. -600 Simplify -2(2sqrt(19) + 2)2 + -1 + (sqrt(684) + (sqrt(684) - (-1 + sqrt(684))) - sqrt(684)) - (4 + ((1sqrt(19) + sqrt(19))6 + sqrt(171)/sqrt(144))2). -48243/16 - 16sqrt(19) Simplify ((-1 + sqrt(117)-2 - (sqrt(117) + (sqrt(117) + sqrt(117) + -1)2) - (2sqrt(117)1 - (-5 + (sqrt(117) + 1 - sqrt(117)))))51)*2. 4050sqrt(13) + 237150 Simplify ((-2sqrt(10)2 - sqrt(1000)1)/(sqrt(5445) + (sqrt(5445) + (sqrt(5445) - -2sqrt(5445)) + sqrt(5445))5 + sqrt(5445)))2. 392/793881 Simplify ((-6(sqrt(45) + sqrt(405) - sqrt(45) - sqrt(45)))/(-4sqrt(12)/sqrt(4)))/((sqrt(60)/sqrt(2))/sqrt(6) - sqrt(250)/sqrt(2))-5. 15sqrt(3)/4 Simplify 1(4 + 1 + 3 + sqrt(11)) - -2(2sqrt(1100))*21. sqrt(11) + 8808 Simplify -4(-4((sqrt(792) - (sqrt(792) + (sqrt(792) - sqrt(792)-2)) - sqrt(792))6)/((sqrt(11) - sqrt(66)/(1sqrt(6))) + sqrt(44)/sqrt(4)-5))*2. -2654208/25 Simplify ((sqrt(288) + 2 + -2 + sqrt(288)3 + 0 + sqrt(288) - (5(-4 + 1 + sqrt(288)) + 4))-2)*2. 484 Simplify 3(1 + 5(-3sqrt(75)-3)2 + (6(sqrt(75) + 2) - ((1sqrt(75) - sqrt(75)) + -2))2). 2520sqrt(3) + 99816 Simplify (3 + (sqrt(190)-2)/sqrt(10) - ((sqrt(19) - (sqrt(19)-1 + sqrt(19)) - sqrt(19)) + -5 + sqrt(2299) + 0))*2 + (1(sqrt(475)1-6 + -5))*2. 92sqr	{ "pile_set_name": "DM Mathematics" }
-1655, -1771, -1887, -2003? -2119 What comes next: -3466, -6881, -10296? -13711 What is next in 83, 43, -21, -109? -221 What is the next term in -1465, -1460, -1455, -1450, -1445? -1440 What is the next term in 6632, 6625, 6618? 6611 What is the next term in 65857, 65796, 65637, 65332, 64833, 64092? 63061 What is the next term in -815987, -815990, -815995, -816002? -816011 What comes next: 19606, 19538, 19426, 19270, 19070? 18826 What comes next: -4117, -8225, -12329, -16429, -20525, -24617? -28705 What comes next: 3954, 3968, 3992, 4026, 4070, 4124? 4188 What is next in 248977, 248976, 248975? 248974 What is next in -638, -1283, -1938, -2609, -3302, -4023, -4778, -5573? -6414 What is next in -18464, -73852, -166166, -295406, -461572, -664664? -904682 What comes next: 68806, 275222, 619248, 1100884, 1720130, 2476986? 3371452 What comes next: 342, 347, 340, 315, 266? 187 What is next in -14976, -29954, -44932, -59910, -74888, -89866? -104844 What comes next: 84252, 168539, 252826, 337113, 421400, 505687? 589974 What comes next: 755, 1341, 1927, 2513, 3099, 3685? 4271 What comes next: 564309, 564311, 564313, 564315, 564317, 564319? 564321 What is the next term in -161, -376, -743, -1268, -1957, -2816, -3851? -5068 What is the next term in -1065, -2118, -3121, -4050, -4881, -5590? -6153 What is the next term in 160099, 160100, 160101, 160102, 160103? 160104 What is next in 15455, 15402, 15347, 15290, 15231? 15170 What is next in 128892, 128934, 128978, 129024, 129072? 129122 What is next in -713, -863, -1281, -2105, -3473, -5523, -8393, -12221? -17145 What is next in 207, 874, 1997, 3576, 5611, 8102? 11049 What comes next: 499, 978, 1457, 1936, 2415? 2894 What is the next term in 42, 236, 560, 1014, 1598? 2312 What is the next term in -25162, -201325, -679472, -1610593, -3145678, -5435717, -8631700? -12884617 What comes next: -59137, -118271, -177381, -236455, -295481, -354447, -413341, -472151? -530865 What is next in 40492, 80978, 121462, 161944, 202424? 242902 What is the next term in -118048, -118055, -118066, -118081, -118100, -118123, -118150? -118181 What is next in -2, -8, -24, -56, -110, -192, -308, -464? -666 What is next in 1485, 5949, 13389, 23805, 37197? 53565 What is next in -3085, -6000, -8903, -11788, -14649, -17480, -20275, -23028? -25733 What comes next: 1712, 2828, 3944, 5060? 6176 What comes next: -2122, -2422, -2722, -3022, -3322? -3622 What comes next: -1015, -1058, -1089, -1114, -1139, -1170, -1213? -1274 What is the next term in 7188, 14347, 21492, 28617, 35716, 42783, 49812, 56797? 63732 What is the next term in -11178, -22391, -33626, -44895, -56210, -67583, -79026, -90551? -102170 What is the next term in -171399, -171407, -171417, -171429, -171443, -171459, -171477? -171497 What comes next: -220356, -220355, -220354, -220353? -220352 What comes next: 59, 72, 101, 152, 231, 344, 497? 696 What is next in 58, 55, 72, 121, 214, 363? 580 What is next in -86615, -86491, -86279, -85973, -85567, -85055? -84431 What comes next: -55138, -110275, -165412, -220549? -275686 What is next in 2428, 9795, 22080, 39289, 61428? 88503 What comes next: 4075, 8202, 12329, 16456? 20583 What comes next: -10, -214, -702, -1594, -3010, -5070? -7894 What is next in -113, -322, -649, -1076, -1585? -2158 What is the next term in 2068, 2150, 2286, 2476, 2720, 3018, 3370? 3776 What is the next term in -35847, -35848, -35849? -35850 What is next in -4659, -4773, -4891, -5013? -5139 What is the next term in -57101, -114197, -171293, -228389? -285485 What is next in -154650, -154620, -154590? -154560 What is the next term in -4334, -4318, -4292, -4256, -4210, -4154? -4088 What is next in -154, -965, -3174, -7483, -14594, -25209, -40030? -59759 What is the next term in -7510, -15161, -22812? -30463 What comes next: -6164, -12438, -18712, -24986, -31260, -37534? -43808 What comes next: 2364, 4711, 7032, 9327, 11596, 13839, 16056? 18247 What is the next term in -13649, -54593, -122831, -218363, -341189, -491309, -668723? -873431 What is the next term in -87, -377, -881, -1611, -2579, -3797? -5277 What is next in 3352, 3395, 3398, 3349, 3236, 3047, 2770, 2393? 1904 What is the next term in -40433, -40419, -40397, -40367, -40329, -40283? -40229 What is next in -1001, -4013, -9035, -16061, -25085? -36101 What is next in 8846, 8818, 8770, 8702? 8614 What comes next: 8567, 17176, 25785, 34394, 43003, 51612? 60221 What comes next: 12519960, 12519961, 12519962, 12519963, 12519964, 12519965? 12519966 What is the next term in -4492, -17897, -40232, -71491, -111668? -160757 What comes next: 19489, 38981, 58475, 77971? 97469 What is next in 402, 851, 1308, 1767, 2222, 2667, 3096? 3503 What comes next: 7083, 28335, 63759, 113355, 177123? 255063 What comes next: 72081, 72079, 72077, 72075? 72073 What is next in -682, -1356, -2018, -2662, -3282, -3872? -4426 What comes next: -58, -174, -362, -616, -930, -1298, -1714? -2172 What comes next: -5964, -11926, -17888, -23850, -29812? -35774 What comes next: -717, -809, -963, -1179? -1457 What is the next term in 357, 2897, 9805, 23265, 45461? 78577 What is the next term in -10018, -9923, -9670, -9181, -8378, -7183, -5518, -3305? -466 What comes next: -11, -39, -81, -143, -231? -351 What is next in 30, 100, 170, 240? 310 What is the next term in -156, -280, -492, -798, -1204? -1716 What comes next: 618001, 1236003, 1854003, 2472001, 3089997? 3707991 What comes next: -4886, -39118, -132038, -312992, -611326, -1056386? -1677518 What is next in 8597843, 8597841, 8597837, 8597831, 8597823, 8597813? 8597801 What is next in 452117, 452115, 452113, 452111? 452109 What comes next: 1102, 1309, 1516, 1723, 1930? 2137 What comes next: 1427, 2863, 4307, 5765, 7243? 8747 What is next in 163, 359, 591, 871, 1211, 1623, 2119, 2711? 3411 What comes next: -2008, -4044, -6080? -8116 What comes next: 1661, 3397, 5133? 6869 What comes next: 280114, 280113, 280112, 280111, 280110, 280109? 280108 What comes next: 125083, 125079, 125073, 125065? 125055 What is next in 12073, 24153, 36241, 48343, 60465, 72613? 84793 What comes next: -442731, -885465, -1328199, -1770933, -2213667, -2656401? -3099135 What is next in 2687, 2686, 2685, 2684, 2683? 2682 What is next in 2006, 3594, 6240, 9944, 14706, 20526? 27404 What comes next: 205, 143, -27, -359, -907? -1725 What is next in -2641, -2680, -2789, -3004, -3361, -3896? -4645 What is next in -206655, -206653, -206651, -206649? -206647 What is the next term in -2792871, -2792870, -2792869? -2792868 What is next in 1100, 1251, 1416, 1601, 1812? 2055 What is next in -350, 3, 356, 709, 1062, 1415? 1768 What comes next: 6856, 13769, 20682, 27595, 34508? 41421 What is the next term in 2293, 2421, 2559, 2707, 2865, 3033? 3211 What is the next term in 420884, 841775, 1262666, 1683557, 2104448? 2525339 What is the next term in -25251, -24810, -24359, -23892, -23403? -22886 What is the next term in 1339, 2670, 4007, 5350, 6699, 8054? 9415 What is next in -783, -3277, -7431, -13245, -20719? -29853 What is the next term in 98234, 98235, 98234, 98231, 98226, 98219, 98210? 98199 What is next in 3692, 3664, 3606, 3512, 3376, 3192, 2954? 2656 What comes next: -1016, -2033, -3050, -4067? -5084 What comes next: -84, -182, -296, -426? -572 What is next in -6780, -6843, -7022, -7377, -7968, -8855, -10098, -11757? -13892 What is the next term in -1084147, -2168292, -3252437? -4336582 What comes next: -518, -4020, -13522, -32024, -62526, -108028? -171530 What is the next term in -32, -57, -108, -179, -264? -357 What is next in -314, -648, -984, -1316, -1638, -1944, -2228, -2484? -2706 What is the next term in 324, 439, 576, 729, 892, 1059, 1224? 1381 What is next in 4052, 4571, 5436, 6647, 8204, 10107? 12356 What comes next: -528, -1266, -1998, -2718, -3420? -4098 What comes next: -90514, -362014, -814514, -1448014, -2262514? -3258014 What comes next: 7480, 14978, 22474, 29968, 37460, 44950? 52438 What comes next: 3397, 13581, 30549, 54301, 84837? 122157 What comes next: 2282, 4731, 7178, 9623? 12066 What is next in -3032, -3585, -4138? -4691 What is the next term in 1863, 1860, 1857? 1854 What is the next term in -81384, -81386, -81388, -81390, -81392, -81394? -81396 What is next in -7376, -14760, -22144? -29528 What is n	{ "pile_set_name": "DM Mathematics" }
m(f) = 4s(f) - 11u(f). What is the first derivative of m(d) wrt d? -32d Let y(d) = -7d*3 + 5d*2 + 7d - 6. Let t(h) = -4h3 + 3h*2 + 3h - 3. Let l(p) = -7t(p) + 3y(p). What is the third derivative of l(s) wrt s? 42 Suppose 0 = 2o + b - 17, 0 = 4o + 5b - 0 - 25. Find the second derivative of os*2 - 10s*2 - 8s2 - s wrt s. -16 Let y(m) = m2 + m + 1. Let h(i) = 7i2 + 6i + 21. Let z(x) = -h(x) + 6y(x). What is the derivative of z(r) wrt r? -2r Let c(g) be the second derivative of g*3/6 - 4g*2 - 6g. Find the first derivative of c(k) wrt k. 1 Let t(d) = d2 - d - 4. Let a be t(3). Find the second derivative of l3 + 1 + 2l - 1 - al*3 wrt l. -6l Suppose 0n - 15 = -5n. Find the first derivative of -2t4 + 0t*4 - 5t*3 + 3 + 5t*n wrt t. -8t*3 Let f be (-88)/(-14) - 12/42. Suppose z + 5 = fz. What is the derivative of -3 - a*4 - z + 5 wrt a? -4a*3 Find the third derivative of -23s*6 - 6s2 + s2 + 7s2 - 19s*2 wrt s. -2760s*3 Let x(s) be the second derivative of 0s*2 + 5s + 0s6 + 0s*5 + 0 + 0s*4 + 5/6s*3 + 1/42s*7. What is the second derivative of x(c) wrt c? 20c*3 Let d(o) be the third derivative of 0o*6 - 1/70o*7 - 7/60o*5 + 0o*3 + 0o*4 + 3o*2 + 0 + 0o. Find the third derivative of d(g) wrt g. -72g Let z(d) be the second derivative of -23d*6/30 - 19d*4/12 - 22d. Find the third derivative of z(h) wrt h. -552h Let z(j) be the first derivative of -j10/2520 - j6/180 + j3/3 + 3. Let x(g) be the third derivative of z(g). What is the third derivative of x(c) wrt c? -240c*3 Let t(b) = -4 + 4b - 3 - 2b. Let y be t(6). Find the third derivative of 2r*3 + yr2 - r3 - 3r2 wrt r. 6 Let t(l) be the third derivative of 0l*3 - 3l*2 + 1/210l*7 + 1/12l*4 + 0 + 0l + 0l6 + 0l*5. What is the second derivative of t(r) wrt r? 12r2 Let f(k) be the third derivative of -k6/180 + k5/30 + k4/24 - 2k2. Let r(n) be the second derivative of f(n). Find the first derivative of r(c) wrt c. -4 Suppose i + x - 12 = -2x, -5i + 3 = -4x. Differentiate 3 + 1 - 2c3 - ic*3 + 2c*3 wrt c. -9c2 Let q(x) be the third derivative of x6/60 - x*5/20 - 5x*3/6 - 7x*2. Let k(j) be the first derivative of q(j). Find the second derivative of k(c) wrt c. 12 Let c(x) = 5x*4 - 7x*3 - 24x*2 + 7. Let g(p) = -2p*4 + 4p*3 + 12p*2 - 4. Let d(w) = 4c(w) + 7g(w). Find the third derivative of d(u) wrt u. 144u Suppose 3l = j + 14, -3j = 3l + j - 4. What is the second derivative of 2x*5 + x + x - lx*2 + 4x*2 wrt x? 40x*3 Let m(r) = -5r*2 - 7r*3 + 2r*2 + 15r*3. Let c(x) = 7x*3 - 2x*2. Let w(d) = -6c(d) + 5m(d). Find the third derivative of w(t) wrt t. -12 What is the third derivative of 48l*5 - 2l3 + l6 + 2l3 - 2l*2 - 2l - 55l5 wrt l? 120l*3 - 420l*2 Let d(y) be the second derivative of -4y*5/5 + 7y*3/2 + 32y. Find the second derivative of d(c) wrt c. -96c Let w(g) be the first derivative of g4/8 + 7g3/6 + g2/2 + 1. Let t(l) be the second derivative of w(l). What is the first derivative of t(d) wrt d? 3 Let o(q) = -q4 + q3 - q2 - 1. Let j(k) = k4 + 4k3 - k2 - 4. Let h(y) = j(y) - 4o(y). What is the third derivative of h(b) wrt b? 120b Let w(v) be the third derivative of -4v*2 - 1/42v*7 + 0v*5 + 0v*3 + 0v + 0 - 1/8v4 + 0v*6. What is the second derivative of w(s) wrt s? -60s*2 What is the second derivative of 6i*2 - 7i*2 - 6i*2 - 8i wrt i? -14 Let t(a) be the first derivative of 3a3 + 3a2/2 - 9. What is the second derivative of t(q) wrt q? 18 Let i(n) be the third derivative of -n7/35 + n*3/6 + 5n*2. Find the first derivative of i(p) wrt p. -24p*3 Let j = 10 + 1. Suppose j = -a + 5c, 5a + 2c - 14 = 4c. Differentiate -ak*4 + 3 + 2k*4 - 6 wrt k. -8k*3 Let s(o) be the second derivative of -17o*6/30 + 19o*4/12 + 22o. Find the third derivative of s(y) wrt y. -408y Let a(z) be the second derivative of -2z*7/7 + 3z*5/20 - 3z*4/2 - 2z. Find the third derivative of a(x) wrt x. -720x2 + 18 What is the second derivative of -29j*2 + 4j + 4j2 - 16j wrt j? -50 Let k(v) be the first derivative of 0v4 + 5 + v2 + 0v - 7/5v5 + 0v*3. What is the second derivative of k(n) wrt n? -84n2 Let s(r) = r2 + 2r. Let h be s(-2). Suppose k + g - 4 = h, 0 = -3k - 4g - 6 + 17. What is the third derivative of 3f*5 - 2f*5 + 0f*k - 2f*2 wrt f? 60f*2 Let h(q) = -q + 11. Let o(y) = -y + 23. Let b(k) = 13h(k) - 6o(k). Let c(z) = -1. Let n(s) = -b(s) + 3c(s). Find the first derivative of n(x) wrt x. 7 Let b(x) be the first derivative of -x6/120 - x4/6 + x*2 - 5. Let l(r) be the second derivative of b(r). What is the second derivative of l(n) wrt n? -6n Let r = 65 + -61. Let x(p) be the first derivative of -p*2 - 1/2p*r + 0p + 0p3 + 3. What is the second derivative of x(v) wrt v? -12v Let n(b) be the first derivative of 18b5/5 - 36b + 1. What is the derivative of n(c) wrt c? 72c3 What is the derivative of 163j + 13 - 4 - 192j wrt j? -29 What is the second derivative of 3236 - 17w*2 - 23w - 3236 wrt w? -34 Let l(b) = 30b4 - 22b. Let n(o) = -12o4 + 9o. Let h(g) = -5l(g) - 12n(g). What is the second derivative of h(u) wrt u? -72u2 Let c(v) be the second derivative of -3v*8/7 - 3v*4 - 23v. Find the third derivative of c(f) wrt f. -2880f3 Let c(s) = -112s*3 + 152s - 17. Let n(q) = -37q3 + 51q - 6. Let r(k) = -6c(k) + 17n(k). Find the second derivative of r(u) wrt u. 258u What is the first derivative of 2v*2 - 96 + 10v*2 + 82 wrt v? 24v Let o(d) = -d*2 - 2d + 2. Let r be o(0). Suppose 0 = 3c + b + b, 25 = 5c - 5b. Find the second derivative of -rz - cz2 + 5z + 0z + 0z wrt z. -4 Let z be (-2)/10 - (-48)/15. Find the second derivative of -c*3 + 9c*2 - zc - 9c2 wrt c. -6c Find the second derivative of -80 + 3f3 - 81 - 26f*3 - 17f + 163 wrt f. -138f Let c(a) = 2a*4 - 2a*3 + 2a*2 - 2a + 1. Let k(o) = 9o4 - 11o*3 + 11o*2 - 11o + 5. Let b(v) = 11c(v) - 2k(v). Differentiate b(y) wrt y. 16y3 Let n = 9 - 4. What is the third derivative of -2m*2 + nm*2 + 0m*2 - 2m*2 + 4m*4 wrt m? 96m Let z(x) = -1. Let o = 1 + -2. Let n(d) be the third derivative of -d*4/24 + 9d*2. Let p(q) = on(q) - 2z(q). What is the first derivative of p(l) wrt l? 1 Let x(n) = n3 - 2n*2 + 2. Let m be x(0). Find the third derivative of -4r3 - r3 + 4r2 + mr*3 wrt r. -18 Let u(v) be the second derivative of -22v*7/21 + 13v*3/3 + 2v - 3. Find the second derivative of u(c) wrt c. -880c3 Let b(u) = 25u*2 - 6. Let z = -2 + -11. Let g(c) = -12c*2 + 3. Let h(x) = zg(x) - 6b(x). Find the first derivative of h(l) wrt l. 12l Suppose 6x - 10 = 4x. Differentiate 6k - 4 - 5 + 2 + x with respect to k. 6 Let b(c) = c2 - 10c + 5. Let m be b(10). Suppose -q + m = 3. What is the third derivative of 2y4 + 5y*2 - 4y*q + 0y*4 + 0y*4 wrt y? 48y Let v(c) = 9c3 - 11. Let m(z) = 2z*2 - 3z*2 - 8z3 + z2 + 10. Let u(t) = 6m(t) + 5v(t). What is the derivative of u(n) wrt n? -9n2 Suppose 3r = 15, 0d + 4d = -2r + 30. Find the third derivative of -70j*4 + 70j*4 + 2j*d - 7j*2 wrt j. 120j2 Let p(w) be the first derivative of -w4/4 + 5w2/2 - 3w - 2. Let m(i) be the first derivative of p(i). What is the derivative of m(r) wrt r? -6r Let y(m) be the third derivative of 9m*5/20 - 15m*4/8 + 5m2 + m. What is the second derivative of y(z) wrt z? 54 Let l(p) be the first derivative of -p7/42 - p*4/12 - 4p - 3. Let m(w) be the first derivative of l(w). Find the third derivative of m(q) wrt q. -60q2 Let c be 0(-2 + (-5)/(-2)). Suppose c = -5g + 4u + 15 + 12, 3 = 3g + 2u. What is the second derivative of 0w - 3 - 2w - 2w4 + g wrt w? -24w*2 Let g(p) be the third derivative of 11p*6/60 + 5p*3/3 + 22p*2. Find the first derivative of g(j) wrt j. 66j*2 Suppose -5c - 2j + 18 = -4j, -j = 4c - 4. What is the derivative of -3 + 3l*c - 3l*2 - 4 + 3l*3 wrt l? 9l*2 Suppose 5f - 28 - 107 = 0. Suppose 4p + 3 - f = 0. What is the derivative of -5r**3 + 2 +	{ "pile_set_name": "DM Mathematics" }
is 1339454909 to the power of 1/3, to the nearest integer? 1102 What is 158170301 to the power of 1/3, to the nearest integer? 541 What is the seventh root of 684321202 to the nearest integer? 18 What is 974451600 to the power of 1/2, to the nearest integer? 31216 What is 51379851 to the power of 1/3, to the nearest integer? 372 What is the third root of 96900385 to the nearest integer? 459 What is 945936848 to the power of 1/10, to the nearest integer? 8 What is the ninth root of 941216398 to the nearest integer? 10 What is the sixth root of 71012931 to the nearest integer? 20 What is the square root of 28477915 to the nearest integer? 5336 What is the third root of 697814775 to the nearest integer? 887 What is the square root of 118210655 to the nearest integer? 10872 What is 150711175 to the power of 1/6, to the nearest integer? 23 What is 1346101889 to the power of 1/3, to the nearest integer? 1104 What is the third root of 1374942553 to the nearest integer? 1112 What is 30136201 to the power of 1/2, to the nearest integer? 5490 What is the third root of 141616375 to the nearest integer? 521 What is 226568191 to the power of 1/3, to the nearest integer? 610 What is the cube root of 180368984 to the nearest integer? 565 What is 267862826 to the power of 1/3, to the nearest integer? 645 What is the square root of 4356582253 to the nearest integer? 66004 What is the ninth root of 6924939466 to the nearest integer? 12 What is the cube root of 756322757 to the nearest integer? 911 What is the square root of 433618544 to the nearest integer? 20824 What is 372516671 to the power of 1/3, to the nearest integer? 720 What is the cube root of 39211316 to the nearest integer? 340 What is the third root of 157284494 to the nearest integer? 540 What is the cube root of 5525181 to the nearest integer? 177 What is 1650485143 to the power of 1/3, to the nearest integer? 1182 What is the square root of 416770358 to the nearest integer? 20415 What is 11977029 to the power of 1/2, to the nearest integer? 3461 What is 12816090 to the power of 1/2, to the nearest integer? 3580 What is the cube root of 369950000 to the nearest integer? 718 What is the sixth root of 359129597 to the nearest integer? 27 What is 343737710 to the power of 1/2, to the nearest integer? 18540 What is the tenth root of 12720979 to the nearest integer? 5 What is 11187056 to the power of 1/2, to the nearest integer? 3345 What is 668810492 to the power of 1/2, to the nearest integer? 25861 What is 110228654 to the power of 1/6, to the nearest integer? 22 What is the cube root of 192268059 to the nearest integer? 577 What is the square root of 51964299 to the nearest integer? 7209 What is 407602023 to the power of 1/2, to the nearest integer? 20189 What is 1026059959 to the power of 1/4, to the nearest integer? 179 What is the seventh root of 82393301 to the nearest integer? 14 What is the fourth root of 1372218493 to the nearest integer? 192 What is the square root of 1510672650 to the nearest integer? 38867 What is the ninth root of 4373485507 to the nearest integer? 12 What is the square root of 615665511 to the nearest integer? 24813 What is the seventh root of 70566570 to the nearest integer? 13 What is 755870757 to the power of 1/2, to the nearest integer? 27493 What is 113774055 to the power of 1/3, to the nearest integer? 485 What is the square root of 177915865 to the nearest integer? 13339 What is 50145406 to the power of 1/2, to the nearest integer? 7081 What is 47830151 to the power of 1/2, to the nearest integer? 6916 What is the third root of 206370352 to the nearest integer? 591 What is the third root of 1697522661 to the nearest integer? 1193 What is 2022971612 to the power of 1/2, to the nearest integer? 44977 What is 241081930 to the power of 1/9, to the nearest integer? 9 What is 662283634 to the power of 1/3, to the nearest integer? 872 What is the ninth root of 42247840 to the nearest integer? 7 What is the square root of 188024063 to the nearest integer? 13712 What is the square root of 187178003 to the nearest integer? 13681 What is the tenth root of 220681448 to the nearest integer? 7 What is 247896206 to the power of 1/2, to the nearest integer? 15745 What is the fourth root of 54763425 to the nearest integer? 86 What is the square root of 908015169 to the nearest integer? 30133 What is the third root of 8762527981 to the nearest integer? 2062 What is the square root of 459351154 to the nearest integer? 21432 What is 1114811701 to the power of 1/2, to the nearest integer? 33389 What is the third root of 105011977 to the nearest integer? 472 What is the cube root of 3364265652 to the nearest integer? 1498 What is 186546739 to the power of 1/2, to the nearest integer? 13658 What is 736682884 to the power of 1/8, to the nearest integer? 13 What is the square root of 4820262866 to the nearest integer? 69428 What is 9081472020 to the power of 1/6, to the nearest integer? 46 What is 18095837 to the power of 1/5, to the nearest integer? 28 What is the seventh root of 13478801 to the nearest integer? 10 What is the fourth root of 2741266100 to the nearest integer? 229 What is 551347532 to the power of 1/2, to the nearest integer? 23481 What is 265764274 to the power of 1/3, to the nearest integer? 643 What is 2921794 to the power of 1/8, to the nearest integer? 6 What is 311410963 to the power of 1/2, to the nearest integer? 17647 What is 70213582 to the power of 1/4, to the nearest integer? 92 What is 40397171 to the power of 1/4, to the nearest integer? 80 What is the seventh root of 422863258 to the nearest integer? 17 What is the square root of 53184258 to the nearest integer? 7293 What is the eighth root of 150899842 to the nearest integer? 11 What is the square root of 28015897 to the nearest integer? 5293 What is 3018319470 to the power of 1/2, to the nearest integer? 54939 What is 19958185 to the power of 1/2, to the nearest integer? 4467 What is 5749302119 to the power of 1/7, to the nearest integer? 25 What is the eighth root of 220310521 to the nearest integer? 11 What is 2440137248 to the power of 1/6, to the nearest integer? 37 What is the square root of 78177295 to the nearest integer? 8842 What is the cube root of 612381045 to the nearest integer? 849 What is the fifth root of 1152292124 to the nearest integer? 65 What is the fifth root of 1516183725 to the nearest integer? 69 What is the cube root of 224503373 to the nearest integer? 608 What is the fifth root of 496780192 to the nearest integer? 55 What is 40464368 to the power of 1/7, to the nearest integer? 12 What is 152247669 to the power of 1/4, to the nearest integer? 111 What is 566008440 to the power of 1/2, to the nearest integer? 23791 What is 217581984 to the power of 1/2, to the nearest integer? 14751 What is 55408268 to the power of 1/2, to the nearest integer? 7444 What is 474941064 to the power of 1/2, to the nearest integer? 21793 What is the fourth root of 1443341770 to the nearest integer? 195 What is 4554601351 to the power of 1/2, to the nearest integer? 67488 What is 18180269 to the power of 1/4, to the nearest integer? 65 What is 2742804603 to the power of 1/2, to the nearest integer? 52372 What is 91735365 to the power of 1/9, to the nearest integer? 8 What is the square root of 1888839514 to the nearest integer? 43461 What is the third root of 609970220 to the nearest integer? 848 What is 421301785 to the power of 1/10, to the nearest integer? 7 What is 109323707 to the power of 1/5, to the nearest integer? 41 What is 158923629 to the power of 1/2, to the nearest integer? 12606 What is the fourth root of 27835115 to the nearest integer? 73 What is the sixth root of 132484653 to the nearest integer? 23 What is 4123549952 to the power of 1/5, to the nearest integer? 84 What is 3737683691 to the power of 1/8, to the nearest integer? 16 What is 139429610 to the power of 1/3, to the nearest integer? 519 What is 7795222990 to the power of 1/8, to the nearest integer? 17 What is the cube root of 114724342 to the nearest integer? 486 What is the cube root of 33859858 to the nearest integer? 324 What is 4242950667 to the power of 1/2, to the nearest integer? 65138 What is 158452009 to t	{ "pile_set_name": "DM Mathematics" }
69 Calculate -206904576 divided by 1544064. -134 Calculate -137263752 divided by 42248. -3249 Divide -23162 by -5385. 23162/5385 Divide 9128130 by -2. -4564065 Calculate 651631992 divided by -162907998. -4 Divide -44512015 by -5. 8902403 Divide -5 by 2657828. -5/2657828 -11 divided by -16334980 11/16334980 Calculate 361004826 divided by -1326. -272251 Divide -10286856 by 2. -5143428 What is -6679624 divided by -1318? 5068 Calculate 283095 divided by 58. 283095/58 Divide -2656588 by 346. -7678 Calculate -35628 divided by -11336. 8907/2834 251935540 divided by 6 125967770/3 What is 24942900 divided by -831430? -30 -374546 divided by -8 187273/4 Calculate 349432426 divided by 3565637. 98 1415634770 divided by -5830 -242819 8654608 divided by -316 -27388 Divide 222752542 by -38. -5861909 What is -18852080 divided by 5? -3770416 Calculate -99008612 divided by -17. 5824036 Divide 499557879 by 3. 166519293 4 divided by -34525744 -1/8631436 25010073 divided by -9 -2778897 Calculate 2765854 divided by 2765854. 1 -73944 divided by -80 9243/10 Divide -711040390 by -142208078. 5 Divide -997 by -64585. 997/64585 Divide -19211967 by -19211967. 1 -162954488 divided by -47956 3398 What is 263812032 divided by 9? 29312448 What is -5701159 divided by 2? -5701159/2 Calculate 1 divided by 21252464. 1/21252464 Calculate -33113453 divided by -6. 33113453/6 What is -37879424 divided by -2367464? 16 Calculate 375446 divided by -2. -187723 What is -90133722 divided by -1112762? 81 26055206 divided by 13027603 2 -23 divided by 521825 -23/521825 Calculate -973733760 divided by 6. -162288960 What is -5945 divided by -2353? 5945/2353 Calculate -179266178 divided by 25609454. -7 Divide -1059 by 127079. -1059/127079 232121377 divided by 232121377 1 Divide -312091230 by -6. 52015205 Calculate 52 divided by -185875. -52/185875 Divide -88619368 by -41. 2161448 Divide -17638855 by -1356835. 13 -1272 divided by -13787 1272/13787 Calculate 140039 divided by -131. -1069 -69160 divided by -13832 5 Divide 505550 by 252775. 2 Calculate 44 divided by -461420. -11/115355 What is -71228304 divided by -7914256? 9 -7565172 divided by 130434 -58 Divide 370 by 1686018. 185/843009 What is 658 divided by 3615? 658/3615 37788513 divided by 21 1799453 -2 divided by -164332893 2/164332893 -37394184 divided by 8 -4674273 85651788 divided by 3254 26322 What is -244 divided by -11342? 122/5671 Calculate -16866416 divided by 3673. -4592 Divide -281248712 by -35156089. 8 Divide -70 by -29517. 70/29517 -545559315 divided by 3409 -160035 What is 17 divided by 2008817? 17/2008817 7054510 divided by 2033 3470 What is -280016604 divided by -1052694? 266 What is -1872484 divided by 7? -1872484/7 What is 145359 divided by 716? 145359/716 What is 4471488 divided by 39924? 112 What is -101398257 divided by 2358099? -43 Divide 791104 by -49444. -16 Calculate 5 divided by 2303172. 5/2303172 Calculate 1068562079 divided by -183067. -5837 Calculate 508158503 divided by 2. 508158503/2 What is 44212 divided by -6270? -22106/3135 Divide -1973808 by 1523. -1296 320449 divided by -6 -320449/6 31869 divided by 174 10623/58 Calculate -3215064 divided by -872. 3687 Calculate -2698485 divided by -1. 2698485 -3608437 divided by -212261 17 -233 divided by 7650 -233/7650 -2416149 divided by -9 268461 What is 307692 divided by 180? 8547/5 Calculate -9383034 divided by -3127678. 3 Divide -7548 by -1709. 7548/1709 What is 31230983 divided by 2303? 13561 Divide -3 by -3246395. 3/3246395 Divide 0 by -99535602. 0 Calculate -7954970 divided by -16402. 485 Divide -8817 by -607. 8817/607 Calculate 4052324 divided by -2. -2026162 10466472 divided by 566 18492 -365116305 divided by 121705435 -3 What is -60241476 divided by 12? -5020123 -10 divided by -2913799 10/2913799 -397 divided by -4487 397/4487 1502 divided by 2665 1502/2665 What is 8668980 divided by 1733796? 5 -1976972 divided by -988486 2 -11 divided by 26860616 -11/26860616 What is -7405180 divided by -185? 40028 Calculate 482559 divided by 57. 160853/19 What is 10 divided by 6392118? 5/3196059 Divide 176598312 by -47652. -3706 What is 309461950 divided by 5? 61892390 Calculate 46559 divided by -5742. -46559/5742 Calculate 252929281 divided by -11. -22993571 What is 547350670 divided by 5? 109470134 -5 divided by 24695968 -5/24695968 What is -68873 divided by 148? -68873/148 What is 863274 divided by -1? -863274 Calculate -8861568 divided by 31424. -282 Calculate 8257 divided by -14737. -8257/14737 -54531320 divided by -234040 233 What is 1324308 divided by -220718? -6 What is 113305635 divided by 279767? 405 Calculate -491394408 divided by -61424301. 8 What is -59 divided by 816811? -59/816811 What is -27610657 divided by -27610657? 1 What is 1060019 divided by -177? -1060019/177 What is -49468653 divided by 716937? -69 7295649 divided by -479 -15231 Divide -119461284 by 5. -119461284/5 Calculate 30 divided by -452148. -5/75358 What is -9 divided by -10848301? 9/10848301 -14146836 divided by -33 428692 Calculate -77636153 divided by 4151. -18703 5 divided by -43734293 -5/43734293 Divide 3581516 by -8693. -412 Calculate -483516884 divided by 4. -120879221 -4508 divided by -112107 4508/112107 Calculate 949 divided by -13065. -73/1005 What is -1399 divided by 174235? -1399/174235 Divide 19838266 by -7. -2834038 What is -5 divided by -252758739? 5/252758739 Divide 2721705 by 118335. 23 What is 79970712 divided by 6? 13328452 Divide -179 by 27376. -179/27376 -129775 divided by -78 129775/78 What is -11112225 divided by -16? 11112225/16 What is -701487138 divided by -6? 116914523 Divide -468424 by -464. 58553/58 What is 39851052 divided by -2? -19925526 -63413152 divided by 376 -168652 What is 7791340 divided by -6? -3895670/3 Divide -22382218 by -22382218. 1 Divide 5 by -3900996. -5/3900996 What is -11578336 divided by 263144? -44 What is -22 divided by 15492484? -11/7746242 Divide -2377 by -4827. 2377/4827 Divide 6620320 by -5. -1324064 Calculate 13932 divided by 617. 13932/617 What is 146544739 divided by -1? -146544739 -28670190 divided by -115 249306 Calculate -10062834 divided by -6. 1677139 -46336752 divided by 8756 -5292 Divide 488660800 by 97732160. 5 Divide -174134996 by 166. -1049006 What is -284129424 divided by -54? 5261656 What is -308122 divided by -34? 154061/17 -229700496 divided by 57425124 -4 What is -37642681 divided by -6? 37642681/6 What is -1494805 divided by -21? 1494805/21 What is 572260857 divided by 155379? 3683 What is -1753794 divided by 250542? -7 376 divided by 12589 376/12589 What is 27 divided by 119370? 9/39790 Divide -162580 by 36. -40645/9 Divide 147174121 by 5. 147174121/5 Divide -106613425 by -1535. 69455 What is -1726836 divided by 1812? -953 Calculate 13046040 divided by -362390. -36 Calculate 5 divided by -12528460. -1/2505692 Calculate 43858580 divided by -1. -43858580 Divide -1 by -141948917. 1/141948917 What is 2540891 divided by -11? -2540891/11 5714285 divided by -5743 -995 Calculate 277305 divided by 598. 277305/598 Divide 25963539 by 119. 218181 857 divided by 469130 857/469130 600511743 divided by 2683 223821 Divide -595 by -18475. 119/3695 What is 43480307 divided by -1? -43480307 What is -28068490 divided by -5? 5613698 -259570 divided by 8 -129785/4 -10957192 divided by -229 47848 Calculate -14133117 divided by 31. -455907 -1588404 divided by -529468 3 -75904850 divided by -3036194 25 What is -66929912 divided by -329704? 203 What is 29971458 divided by 3993? 7506 0 divided by -2111222 0 Calculate 1269637400 divided by -3656. -347275 What is 27910 divided by -65? -5582/13 What is 37423141 divided by -133? -281377 What is 186393092 divided by 29? 6427348 What is -1 divided by 1743152? -1/1743152 Calculate 42419038 divided by 7291. 5818 -11036 divided by -9141 11036/9141 What is -80538 divided by 116? -40269/58 Calculate -5 divided by 57094661. -5/57094661 What is 987223 divided by 227? 4349 32 divided by 413579 32/413579 Calculate 84441630 divided by -2412618. -35 What is -1750061 divided by -6? 1750061/6 Divide 9259250 by 22750. 407 Calculate 12631752 divided by -1278. -9884 What is -649386 divided by -387? 1678 What is -3954462 divided by 3? -1318154 Calculate -22215420 divided by -2221542. 10 What is -192649556 divided by	{ "pile_set_name": "DM Mathematics" }
3w = q - 3, q - 7 = vw for q. 3 Suppose -42 + 56 = -2f + 3t, 5f - 34 = -4t. Solve l + 11 = fy, 0 = -5l - 5y - 7 + 12 for l. -3 Let r be 214/2033 - (-148)/38. Solve rx - 5z = 33, -3x - 28z + 1 = -27z for x. 2 Let u = -1475 + 1500. Solve -j = -d, -22j + 25j = -2d - u for d. -5 Suppose -20f - 465 = -51f. Solve -4z = a - 0a + f, 0 = 5a + z - 20 for a. 5 Let s = 2540 + -2534. Solve -4p + 6 = 3n, -27 + s = -5p + 3n for p. 3 Suppose n + 38 - 37 = 0. Let z be -3 + 6 + (n - 2) + 1. Let r be (-3)/(-9) - (4/(-6) + z). Solve -t - 4j - 6 = -r, -4t - 5j - 13 = 0 for t. -2 Let l = -42180 + 42185. Suppose 3p = -0p + 6. Solve -b + 3 = pu, -3b + u - 3 = -l for b. 1 Let i be (-32)/(-20) - (-7)/5. Solve -4f = -2j + 6, 2f - 3j + 9 = if for f. 0 Let j(z) = 18z2 - z + 1. Let s be j(1). Suppose s = 21c - 171. Solve 5y - 4q = 5, cy + q = 4y + 30 for y. 5 Let t(w) be the second derivative of -w5/20 + w4/3 + 5w3/6 + 5w*2/2 - 13w + 1. Let i be t(5). Solve -2l + 1 + 20 = 5s, l = is - 27 for l. -2 Let x(q) = 52q*2 - 2q. Let i be x(1). Suppose -66c + 480 = -ic. Solve -3t = j - 5j - 35, 4j + c = 2t for j. -5 Let p be 4/(((-20)/(-6) - 1)156/182). Solve 3y - po - 3 = 0, 2y - 9o + 4o + 9 = 0 for y. 3 Let u be ((-3)/2)/((-2)/(-4)). Let w be ((-1)/u)/((-7)/(-42)). Let y = 775 - 775. Solve -3b + wb - 5j = 11, y = 4j + 8 for b. -1 Let s be ((-294)/35)/(2/10). Let w be (27/1)/(s/(-28)). Solve -a + 4 + 10 = -3q, -5a + w = -2q for q. -4 Suppose 31s + 57s - 78 = 98. Solve -142 = 5v + k - 157, 4k - 24 = -sv for v. 2 Let s = 75 - 80. Let a be s + ((-228)/95)/(3/(-10)). Solve 3v + 5q = -0v + 31, aq = -5v + 25 for v. 2 Suppose 3g - 6 = 6. Let d(z) = 0z - 62 + 4z*2 + 57 - 14z. Let x be d(g). Solve 17 = -q + 4a, q + 0q + xa = 11 for q. -1 Let m be (-3)/(42/((-196)/14)). Let y(x) = 6x*2 - 1. Suppose -4d + 2d - 2 = 0. Let h be y(d). Solve -5q = -4c - 7, hq - 10 = 3c - m for c. 2 Suppose 3b = -2b + 35. Let t(f) = 2f3 - f2 - 10f - 7. Let g be t(-2). Let v be (-17)/g - 28/(-49). Solve -4 = -i, 2o = -vi + bi - 20 for o. -2 Let l = 424 - 399. Suppose -3c - 6 = 0, -4w - 5 = -2c - l. Solve g + 2v = w, 4v - 4 = -5g + 10 for g. 2 Suppose -o + w = 48 - 46, -1 = 3o - 2w. Suppose -3r + 0p - 8 = 5p, -4 = 3r + 4p. Solve -ra + a + 15 = f, o = 3a - 3f for a. 4 Let m = 245 + -186. Let z = m - 56. Solve -r + 21 = 2r - 2d, 5d = -zr for r. 5 Suppose f + 0 + 1 = 4d, -2d = 4f + 4. Suppose d = j - 79 + 9. Let p = j + -67. Solve -4m - 3i + 19 = 0, -pm + 1 + 17 = 3i for m. 1 Let w be -2 + 4 - (78 + 2). Let g(q) = 6q*2 - 78q - 76. Let r be g(13). Let z = r - w. Solve 13 - 4 = -5a - 3l, -zl = 3a + 6 for a. 0 Let m be (70/(-15))/((-3)/(-27)). Let t = m + 42. Suppose -7p + 11p - 20 = t. Solve 0 = -2y - 2b - 6, py - 3b + 9 = -6 for y. -3 Suppose 0 = -10w - 457 - 283. Let l = 77 + w. Solve -2k = -0b + lb - 17, 0 = -4k + 16 for b. 3 Let c(o) = 5o - 39. Let t be c(7). Let b be (-10)/t + 0 + 6/4. Suppose -bi - 18 = -26. Solve 3a = -a + iu + 28, -4a - 2u + 12 = 0 for a. 5 Suppose 0 = -4q - 5d + 58, 2d - 327 = -4q - 275. Solve 0 = -3p + 3v - 15, -3p - v + q = 19 for p. -3 Suppose -11 = -4t + 9. Let n = 708 - 712. Let o be (n + (-1 - -3))/2 + 3. Solve -th = z + 4, -oz - z - 12 = h for h. 0 Let h(v) = v2 + 10v + 24. Let n be 13(-2 - -1) + 5 + -1. Let c be h(n). Suppose -27w + 24w + c = 0. Solve -x + 2 + 3 = 4j, x - j = -w for x. -3 Let i = 9549 - 9547. Solve j = 30k - 25k + 26, ij = -5k - 8 for k. -4 Suppose 4f + f - 10 = 0. Suppose 2m + 2m = -m. Let r(a) = -a3 - 2a*2 - 3a. Let s be r(m). Solve 0 = -5u - fd - 3, s = -4u + d - 2 + 10 for u. 1 Let h(u) = -4u*2 + 8u - 23. Let n be h(5). Let j = n + 88. Solve -q + j = -3q + x, -3x = 5q - 15 for q. 0 Suppose -3o + 2p + 13 + 34 = 0, p + 49 = 3o. Solve -2m + 188v = 186v + 2, 5v = -m + o for m. 2 Suppose 0 = 8v - 13v + 2b + 34, -4v + 38 = 2b. Solve 4l = 5z - 0l + 10, 4z + 5l + v = 0 for z. -2 Suppose -10y = -630 - 160. Suppose 0 = 5u - y + 59. Solve 0 = -f + 5d + 20, 0 = f - ud - 17 + 2 for f. -5 Let d(g) = 17g3 + 19g*2 + 13g*3 - 47g*3 + 24 + 18g + 18g3. Let t be d(-18). Suppose -14 + t = 2h. Solve 3v = -4a + 5a, 0 = 5a - hv for a. 0 Let l(x) = x2 + 6x + 12. Let d be l(-5). Suppose -dc + 4 = -10. Let y = -18 - -21. Solve -5s + 5 = -yu, 5s - cu = 4 + 1 for s. 1 Let v = 36086 + -36083. Solve -2g = -z + 2g + v, 31 = -5z - 3g for z. -5 Suppose -32n + 36n = 5g - 42, -33 = -4g + 3n. Solve 2i - 5s + g = 10, 2s + 16 = -4i for i. -3 Suppose -487i = -478i - 36. Let y be (-28)/i8/(-28). Solve 2x - 3t = 1 - 6, -yt = -6 for x. 2 Let i(f) = 2f2 + 8f + 10. Let x be i(-2). Suppose 18 = -12y + 42. Solve -3t + 5z = 3, -x = t + yz - 12 for t. 4 Let a be (19 - 17)/((-2)/(-14)). Suppose a = 2d - 2f, -24 = -2d - 2d + 2f. Solve -x = 2t + 5, -4t = -dx - 0t - 11 for x. -3 Suppose 5m = -3x + 13, 3x + 6m - 41 = 8m. Suppose -j + 5n + x = 0, 0 = 2j + 3n - 2n. Solve u - 2r - 7 + j = 0, 0 = 5u - r - 3 for u. 0 Let y(s) = s*2 + 11s + 13. Let w be y(-10). Let c = w - -4. Let q = -678 - -686. Solve u = -2d + c - 1, 4d + u - q = 0 for d. 1 Suppose 17 = -7b - 25. Let i(g) = -8g - 40. Let f be i(b). Solve f = 2t, 0 = 3l + 3t - 13 - 8 for l. 3 Let g = -982 + 991. Solve 4a = 16, -t + 13a - ga = 19 for t. -3 Let f = -17073 + 17077. Solve fn + 16 = -2w, -7w + 8w = -5n - 20 for w. 0 Let z = -1434 + 598. Let h = -817 - z. Solve l - h = 5d - l, l = 4d + 14 for d. -3 Let y = 9345 + -9345. Solve -6 = -a - a - 2g, -2a - 3g + 6 = y for a. 3 Let c(v) = v + 1. Let m be c(6). Suppose m = 2o - 41. Suppose oy = 22y. Solve -l = -4j + 12, -2j = -5l - yj + 12 for l. 4 Let n(w) = w + 6. Let s be n(5). Suppose k - x = 4, -2k - 4x = 3 + 13. Suppose 14p + 16 - 58 = k. Solve -6 = pr + 2l, -r - s = 4r + 3l for r. -4 Let x be (-1)/(1 - (-3)/(-2)). Suppose n + 3 = -f, n - 4f = -7 + 19. Let p be 6/15 + n - 1104/(-115). Solve i + 6 = -3r, -xi = -4i - 4r - p for i. -3 Let o = 12 + -9. Let d(j) = j2 + 1. Let c be d(-1). Suppose 0 = oq + cq - 15. Solve -qp = -l + 20, 3p + 2p - l + 30 = 0 for p. -5 Suppose -10k + 8k = 0, 0 = -3c - 2k - 21. Let q be 4 - ((-4)/18 + c/9). Solve -6 = 3w + 4y, 2w - 13 = 3w + qy for w. 2 Suppose x = -4y + 26, 29 = 2y + 4x + 9. Solve i + 4f = 14, -3i + 10f = yf + 6 for i. 2 Let d(g) = 2g2 - 7g - 2. Let q be d(4). Let f be (-2 + 2 - -3) + q. Suppose 35 = -52s + 57s. Solve 12 = 4b, s = -fr - 3b + 1 for r. -3 Let n be 22/11 - 6/2. Let m be 10 - (n(1 + 0) - -4). Suppose -mb + 5 + 23 = 0. Solve -g = -bq + 10, -5g + 2g = 2q - 12 for q. 3 Let r be (96 - 96)/(5/(15/(-6)) + 5). Solve -2d = -1 - 5, 5j + 3d - 14 = r for j. 1 Let i be (-3)/12 - 2172/(-48). Suppose 0 = 17w - i + 11. Solve 0a + 24 = -5a - wl, 0 = 3a - 2l + 8 for a. -4 Suppose 3b = -2j + 45, 5b + 7j = 10j + 37. Solve -2p - 4o = 0, -5p + 15o - bo = 28 for p. -4 Let j = 8913 - 8908. Solve jq - 5w + 1 = -49, 3q = -5w + 2 for q. -6 Let z be 32/1 + -7(-4)/14. Suppose -33q = -zq. Solve q = -3o - 5t + 25, 0 = -o - 0o + 4t - 20 for o. 0 Let c(u) = -u + 19. Let a be c(-9). Suppose -5v = -3 + a. Let t = 4 - v. Solve -3j - 2g - 11 = 0, 2j + t = -j - 3g for j. -5 Let n = 957 - 952. Solve k - 17 = -15, -nt + 4k = 8 for t. 0 Suppose 5i - 48 = 262. Let t = i - -48. Suppose 0 = 5n - t + 95. Solve 2f = np + 4f + 9, -p - 5f = 16 for p. -1 Let n = -25 + 27. Suppose -nf + 21 = 3v + f, f - 27 = -3v. Let i be ((-312)/(-20) - 4) + 4/v. Solve -4w + 4j - 8 = 0, -w - w = -4j + i for w. 2 Let n(m) = m*3 + 5m*2 - 6m + 2. Let i be n(-6). Let j = -18 - -20. Suppose 56 = -11o + 19o. Solve -oc - 34 = -ic - 3r, -26 = 4c - jr for c. -5 Suppose -p - 3x = 9, -123x - 16 = -119x. Solve -15y = 4a - 18y + 20, 14 = -pa + 2y for a. -2 Let m = 59 - 75. Suppose -3p + 6 + 51 = 0. Let x = m + p. Solve r - 2j + 5 = 0, 0r - xr = -2j + 3 for r. 1 Let v(y) = y*3 + 22y*2 - 77y - 37. Let a be v(-25). Solve -z + 4k = 2 + a, 3z = 5k - 24 for z. -3 Suppose 4f + 0d = -2d -	{ "pile_set_name": "DM Mathematics" }
n + 20 = pn. Solve -nw + 11 = -9 for w. 5 Suppose -33h = -32h + 38. Let g be -1(h - (-15)/(-5)). Suppose w - g + 25 = 0. Solve 4 = -4t + w for t. 3 Suppose m - 5m = -20. Let p(n) = 1218n*2 + 10n - 1. Let c be p(1). Suppose 1226q = cq. Solve q = -mh + 8h - 6 for h. 2 Let i(o) = 18o + 742. Let u be i(-41). Solve -22g = -62 - u for g. 3 Let f = -44 + 46. Suppose 8 = fm - 8. Suppose -m = -w - w. Solve -w = 3r - r for r. -2 Let g = 5585 - 5562. Solve 17s - g = 28 for s. 3 Let v(f) = -f3 - 8f*2 - 3f - 97. Let w be v(-9). Solve 0 = -wi + 39 + 5 for i. 4 Let z = -42 + 36. Let b be 494/z + 110/(-66). Let w be (48/b)/(4/(-14)). Solve -r + w = 3 for r. -1 Let x be (-1)/(-2)(9 + -9). Let f be -2 - (40/(-7) - (-12)/(-42) - 9). Solve x = -5c - f + 28 for c. 3 Let v be (0 - (3 + 93/(-6)))2. Suppose v = -l - 4n - 18, -4n = -5l - 215. Let i = -41 - l. Solve f - i = -f for f. 1 Suppose -6 = -k - 2. Suppose 3g = -j + 3, kg + 0g - 4 = -3j. Let w(i) = i3 + 16i*2 - 19i - 33. Let r be w(-17). Solve -r + j = t for t. -1 Let c(p) be the first derivative of -2p2 + 208p + 80. Let o be c(51). Solve 0 = 7r - or + 9 for r. -3 Let h be 1/(8/241). Suppose 0 = -hy + 38 - 26. Solve -4t = -0 - y for t. 1 Let f(w) = 5w + 33. Let p be f(-7). Let q be 174/29 + p + 0. Solve qg - 5g + 1 = 0 for g. 1 Let a(f) = 1034f + 1088. Let y be a(-1). Solve -497t - y = -515t for t. 3 Suppose 4 = 3m - 2m, 2m - 164 = 3k. Let c be 698/8 - (-13)/k. Suppose -cp + 88p - 8 = 0. Solve -b = -3b - p for b. -4 Let y(r) = r*3 + 4r*2 - r - 12. Let p be y(-3). Suppose p = -s - s - z + 12, 3s - z - 8 = 0. Solve -sq = -q - 9 for q. 3 Suppose -2j + 54 = v, 5j = -7v + 13v - 409. Solve -51m + vm + 65 = 0 for m. -5 Suppose 0 = 9x - 12x. Let u be ((-162)/(-12))/(17/((-340)/(-30))). Solve q - u + 7 = x for q. 2 Let l = 88 - 88. Suppose l = w + 5w - 54. Suppose -6r - wr = -r. Solve 9 = -rv + 3v for v. 3 Let b(a) = 17a - 970. Let p be b(64). Solve 21v + 50 = -p for v. -8 Suppose 0z = n - 3z - 13, -4n - 4z = -36. Suppose -nb + 106 = -44. Solve -b = -4r - 7 for r. 2 Let a(y) = -97y2 + 807y - 191. Let z be a(8). Suppose -m + 3m = 8. Solve 73 = -mf + z for f. -4 Let k(o) = 3o3 + o. Let i be k(-1). Let l be i - ((13 - 22) + 3 + 0). Suppose -5f + 1 = -d - 12, -ld - 4f + 16 = 0. Solve 1 = c + d for c. -1 Suppose 0 = 1484x - 1493x. Solve x = -33d - 37d + 490 for d. 7 Let j(x) = 24x + 58. Let q be j(-6). Let w = q - -87. Solve -w = o - 2o for o. 1 Suppose 892r - 1177 = 53r + 501. Let q = 0 - -2. Let p = 3 - q. Solve -p - r = y for y. -3 Let i(v) be the second derivative of 5v3/3 - 20v*2 + 94v. Let y be i(4). Solve -4k + 7 - 3 = y for k. 1 Let m(j) = -11j - 578. Let n be m(-54). Solve -198 = -nu - 17u for u. 6 Let g be (-52)/(-20) + 4/10. Suppose 3z = -2d + 3d - 70, 0 = -d - z + 70. Let x = d + -50. Solve gp + x = -p for p. -5 Suppose 28m = -23m + 204. Suppose 0 = mp - 2w + 6, -68p = -69p + 4w - 12. Solve pz = -7z + 28 for z. 4 Suppose -5u = n - 429, n - 315 = -4u + 113. Let b = 425 - n. Let v(o) = -o - 2. Let l be v(-6). Solve -b + l = 3a for a. 1 Let w be (16/24)/((-2)/(-3))-5. Let h be 2/1 - 10/w. Solve -y + 3y = h for y. 2 Let k = 279 + -269. Suppose -2c - 3d = -81, -5c - 240 = -kc + 5d. Solve c = 4f - 13f for f. -5 Suppose -3p - 11 = -10h + 6h, 3 = -3p. Let q = 18 - 17. Suppose -j + q + 2 = 0. Solve -jf = hf + 5 for f. -1 Suppose c + h = -14 - 82, -5c - h - 460 = 0. Let a be (c - -1) + -2 + -1. Let k = a + 98. Solve k + 0 = -y for y. -5 Let b(a) = -13a3 - 13a*2 - 2a + 4. Let q(m) = -2m3 - m2 - m + 1. Let t(o) = -b(o) + 7q(o). Let n be t(5). Solve -85y + n = -88y for y. -1 Let s(k) = k*3 + 19k*2 - 42k + 15. Let g be s(-21). Suppose 0l + l = 0. Suppose -5t - 15 = -0d + 5d, l = -2d - 10. Solve -g = -tu + 5u for u. -5 Let d be (0 + 3/(-6))(-144)/(-9). Let q be (-2)/d - (35/(-4) + 3). Solve 0 = -qh - 30 - 0 for h. -5 Suppose 3s - d - 9 = 0, 5s - 7d - 23 = -8d. Suppose -6j + 9j - 24 = 0. Let q = j - s. Solve 2v - v = q for v. 4 Let s be (13(-30)/(-65))/(0 + 1). Let k(p) = p2 - 6p + 2. Let y be k(s). Solve -8r + y = -10r for r. -1 Suppose -10s = -8s - 4. Let i be (-3 - -7) + s/(-1). Suppose -2c + 47 = 3p - 12, -2c = -i. Solve -5v - 4 + p = 0 for v. 3 Let o = 1200 + -1137. Solve 17d + o + 5 = 0 for d. -4 Let f be ((-10)/12 + 21/14)3. Let y(h) be the third derivative of h6/120 - h5/60 - h*4/12 + 2h*2. Let d be y(-1). Solve d = -4c + fc for c. 0 Let s be 72/30(-12)/432-30. Solve -4c + c = -sc for c. 0 Let p(v) = 2v*2 - 24v - 537. Let x be p(-13). Solve 0 = xh - 119h for h. 0 Let z be 10/(-14)(-30 + 23). Suppose 3l + 52 = 2h, 8l = zh + 6l - 141. Solve 5m = h - 9 for m. 4 Let w(i) = -5i*2 - 75i - 99. Let o be w(-12). Solve -11d + 26 - o = 0 for d. -5 Suppose -2u - 31 = -u. Let k = 35 + u. Suppose -4a = -3w - 1, 5a = a + k. Solve -i = -2 - w for i. 3 Let i be (-55 + 55)1/6. Solve i = -10z - 4 + 24 for z. 2 Suppose 0 = -3n + 3z + 24, -2n - 18z + 16z + 4 = 0. Solve -nx = -94 + 79 for x. 3 Let u be 7 - (13 + -20 - -5). Solve -uc = -18 + 27 for c. -1 Let z be -3 - ((10 + -9)(-15 + -4) - 2). Solve zx + 0x = 0 for x. 0 Let d be -6 + 8/(-2) + 16 + -9. Let s be -14d/31. Solve -9y = -5 + s for y. -1 Let p(d) = -749d + 3026. Let z be p(4). Solve -22w = -zw - 72 for w. -9 Suppose 2 = -6l - 88. Let a be 5(-3)/(-6)(-12)/l. Suppose 4m - 15 = -3j - 0m, 0 = aj + 5m - 17. Solve 0 = -u - 4 - j for u. -5 Let s(i) = -i2 - 22i - 102. Let y be s(-7). Suppose -3m - 4x = -22, -4m + 4x = yx - 4. Solve -18 = -mr - 10 for r. 4 Suppose 2g + 3r = 29, -4g + 3g = 3r - 13. Solve ga = -549 + 629 for a. 5 Let l = 12738 - 12486. Solve 0 = 186n - 228n - l for n. -6 Let i(z) = -7z - 198. Let h be i(-18). Let u be (h/54)/((-2)/6). Solve -uv = 41 - 21 for v. -5 Let b = 117 + -87. Suppose -n - 4n = -b. Suppose 5j - 16 + n = 0. Solve j = -5k - 3 for k. -1 Let r(c) = -15c - 138. Let n be r(-10). Solve nx = 20x - 10x for x. 0 Suppose -3y + 8 + 9 = -j, y - j = 9. Suppose -l + 12 = 2d, -5l + y = -4d - 0. Let u be 2/5 + ((-64)/40)/l. Solve ub - 2b - 6 = 0 for b. -3 Let y(r) = -7 + 25r - 7r - 3r - 12r. Let x be y(-9). Let n = -31 - x. Solve nw = -w for w. 0 Suppose 3i - 118 + 6 = -a, 272 = 2a - 2i. Solve ab + 24 = 122b for b. -3 Suppose 2b - 34 = -0p - 4p, -2b = 2p - 18. Suppose -pu + 1 + 39 = 0. Solve -2 = uh - 7 for h. 1 Let m be (-3)/21 - 33/42-4. Suppose -19b - n - 28 = -21b, -mb + 44 = -n. Suppose -2p + 2 = 5z - b, -5p = 3z - 26. Solve 6t - zt + 16 = 0 for t. -4 Let l(w) = -185w3 - 8w*2 - 51 - 20w*2 + 94w*3 - 2w + 90w3. Let p be l(-28). Solve -pb - 15 = -0b for b. -3 Suppose -1455r = -1441r - 644. Solve 90 = -11y + r for y. -4 Suppose -3h - 74 - 6 = -19h. Let j be (-1)/3 - (-16)/(-6). Let z be (-2)/(-4)(1 - j). Solve hf = 12 - z for f. 2 Suppose -2 = 11m - 24. Suppose 0g = 3g - 2z - 2, -mz = 2. Solve -4u - u + 15 = g for u. 3 Let j(i) = i*2 - 55i + 653. Let a be j(39). Solve -3s = as for s. 0 Let s be (2/(-8))/(-1) - 1156/16. Let o = s + 38. Let k = -28 - o. Solve p = -p + k for p. 3 Let l = -4 + 30. Let g(u) = -3u3 - 2u*2 - 2u + 6. Let c be g(-2). Let m = c - l. Solve 0 = -3q - mq - 9 for q. -3 Let t be (-1953)/558-63. Solve 42l = 105 + t for l. 4 Suppose -200r + 195r + 30 = 0, u - 4r - 374 = 0. Solve 28v = -650 + u for v. -9 Suppose 2n - 22 = 2d, n + d - 16 = -n. Let x(j) = -485j + 122220. Let a be x(252). Solve -nb - 2b - 33 = a for b. -3 Suppose 4 - 52 = -4s. Suppose s = 5v - v. Suppose 0 = -d + 2j + 14, 2j + 8 = -vd - 2j. Solve t - d + 8 = 0 for t. -4 Suppose -8v = -5v - 4h - 1066, -1786 = -5v + 2h. Solve vc - 363c = 35 for c. -7 Let h(n) = n3 + 10n*2 + 10n + 6. Let t be h(-9). Let u be t - -34(3/(-6) + 1). Suppose 20 = -ua + 19a. Solve ar = r + 12 for r. 4 Suppose 0 = y - 68 + 44. Solve 0 = yu - 27u - 15 for u. -5 Let x = 39 - 39. Let r = 675 + -659. Suppose -4p - 2h = h - 32, 4h - 21 = -p. Solve x = c - pc + r for c. 4 Let f be -3 - ((-3)/(-1) + -9). Suppose 0 = -f*r - x + 14,	{ "pile_set_name": "DM Mathematics" }
33u2). 3u*5 Expand (3l*3 + 0l3 - l3)(-l + 6 - 6)(2 - 2 - 3). 6l4 Expand k4 - 17k*3 - 19k*3 - 90k3 + (-k4 - 4k4 + 4k*4)(4 - 4 + 2). -k*4 - 126k*3 Expand (-2g - 3 + 3)(0 + 3 - 5)(0 - 3 + 1). -8g Expand (1 - 1 + i)(4 + 57 - 6). 55i Expand (-4p*3 + 6p*3 + 2p*3 + (4 - 4 - 2p*2)(-2p - 2p + 5p) + 5p*3 - 12 + 12)(2p - 2p*2 - 2p) + p*5 - 2p*5 + 2p*5. -13p*5 Expand (3 - 2 + 0x - 2x)((5 - 2 - 5)(-x + x + 4x) + 3x + 2x - 4x). 14x*2 - 7x Expand p*4 + 4p*4 - 3p*4 - 2p*4 - 1 + 1 + (2p - 2p - p3)(4 - 4 + 2p) + (-24p + 24p + 10p*2)(p*2 + 0p*2 - 2p*2). -12p*4 Expand -11 - 11d - 2 - d*2 + 10d + 2d2 + d2 + d2 + (-5d + 3d + 0d)(2d + 2 - 2) - d*2 - 1 + 1. -2d*2 - d - 13 Expand (3r - 2r + 0r)(3r*2 - 2r*2 - 6r*2). -5r3 Expand -h3 - 3h - h + 3h + (-2h2 + 4h*2 + 7h*2)(h + h - h). 8h3 - h Expand -23p*2 + 9p*2 + 13p*2 + (2p - 5p + p)(-5p + 6p - 5p). 7p*2 Expand (-6l + 2l + 0l + (l - 2l + 0l)(3 + 4 - 5))(-1 + 1 + 2)(0l - l + 3l). -24l*2 Expand (8 + 7i*2 - 4i*2 - 1)(-4i2 + 2i*2 + 4i*2). 6i*4 + 14i*2 Expand (-3 + 5 - 1 + (-4 + 1 + 1)(2 + 2 - 2) - 3 + 3 - 12)(2l + 2l - l). -45l Expand (3s - 4s - s)(-2 - 12 + 2) + s + 1 - 1. 25s Expand -4b2 + 0b2 - b2 + (-2 + 0 + 0)(4b*2 + 0b*2 - 3b*2 - b). -7b*2 + 2b Expand -a + a*4 + a + 2a*4 + 4a*4 - 5a*4 + (2a*3 - 2a*3 - 3a*3)(a + 0 + 0) - a*2 + 2a4 + a2. a*4 Expand (4 - 2 - 4)(2q4 - 2q*3 + 2q3) + q2 - 2q2 - 17q*4 + 9q*4. -12q4 - q2 Expand -4q + 0q + 3q + (-2 + 5 - 1)(2 + 2q - 2) + 106 - 12q - 106. -9q Expand (2y*2 - 3y*2 + 2y*2)(y + y - 4y) + 0y + 5y3 + y - 6y*3. -3y*3 + y Expand (40 - 21 + 22)(-2 + 2 + 2j + 1) + 3j + j - 3j. 83j + 41 Expand (3p3 - 3p3 + p4)((-2p + 2p + p)(-1 + 2 - 2) + (5 + 1 - 4)(-2p + 6p - 2p)). 3p5 Expand (2 + 1 - 2)(-3 + 0 + 1)(-j + 4 - j - 3). 4j - 2 Expand 2t - 3 + 2 + 2 + t + 0t - 2t + (-2 + 2 - 1)(-t - 2t + t) + 2t - 1 + 1 + 0 - t + 0. 4t + 1 Expand (-2q + q - q)(-1 - 3 + 5). -2q Expand (s + 0s - 3s)(-22 + 0 + 2). 40s Expand (2b5 - 2b + 2b)(4 - 3 - 2 + (-3 - 4 + 5)(0 - 1 + 2) + 0 + 0 - 1 - 1 - 4 + 3 + (3 - 5 + 1)(-3 + 1 + 3) + 2 - 2 - 3 + 2 + 1 - 2 + 4 + 0 + 1). -8b5 Expand (-3 + 4 + 1)(-6 + 7 + 12)(h + 0h + h). 52h Expand (0y + 0y + y2 + 3 - 3 + 2y*2 + (2y + 2 - 2)(-3y + 2y + 2y) + 0y + 2y*2 + 0y + 4y2 - y2 - y2)(2y2 - y2 - 6y*2). -45y*4 Expand (-6t*2 + 3t*2 + 5t*2)(-2t - 3t - 3t) + 4t*3 - 3t*3 - 2t*3. -17t*3 Expand (-2s - 7s - 16s)(1 - 3 + 0). 50s Expand -g*3 - 3g*3 + 2g3 + (-g2 + g2 - g2)(3g - g + 0g) - 2 - g3 + 2 + (-6g + 3g + 4g)(2g - 2g - g2) + 4g*3 + 0g*3 - 6g*3. -8g*3 Expand (1 - 1 + 2k*2)(-k + 6k + 0k) + k2 + k2 - 11k3 + 8k*3. 7k*3 + 2k*2 Expand (3o*2 - 7o*2 + 2o*2)(5 - 4 + 4). -10o2 Expand (0 - f + 0 + (-4f - f + 3f)(5 + 0 - 3) - 2f + 2 - 2 - 3f + 2f + 3f)(-7 + 11 + 22). -130f Expand (2z - 1 + 1)(-3z + z2 + 3z) - 8z + 8z - 4z3 + (2z - 3z + 2z)((-2z + 1 - 1)(-z + z - 2z) - 22 + 22 + 2z2). 4z*3 Expand (8b*2 - 1 + 1 + (0b + 2b - 4b)(3 - 3 - 2b))(2 - 2 + 7b). 84b3 Expand g4 - g4 + 2g*4 + (-2 + 7 - 1)(2g4 - g4 - 4g*4). -10g*4 Expand (0 + 1 - 2)(0n + n - 5n)(-2 + 2 + n3). 4n4 Expand (-p3 + 7p3 + 0p*3)(-p2 - p2 + 0p2) - p5 - p5 + p5 - p5 - p5 - 3p*5. -18p*5 Expand -3z*4 + 25z*4 + 8z*4 + (-5z3 - z3 + 3z3)(-2 + 2 + 2z). 24z*4 Expand (4f - 2f2 - 4f)(-f2 + 2f*2 + 0f*2) + 2f*4 - 3f*4 + 2f*3 - 4f*3. -3f*4 - 2f*3 Expand (-2r - 144 + 144)(3 + 1 - 2 + (-2 + 0 + 1)(6 - 4 - 4) + 2 - 6 + 2). -4r Expand (2g4 - g3 + g*3)(g + 5 - 5) + (2g5 - 2g5 + g5)(-2 + 3 + 1) + g - g - g5 + 3g*2 - 3g2 + g5. 4g5 Expand (2p - 4p + 0p)(-4p - 2p3 + 4p) + 5p4 + 0p*4 - 14p*4. -5p*4 Expand (-3 - 2 + 3)(-c*2 + 1 - 1 + (2c - c - 2c)(0c - 2c + c) - c*2 + 3c2 + c2). -6c2 Expand (1 - 2 - 1)(2t - 3t + 3t) + 3t + 3t - 5t - t - 1 + 1. -4t Expand 2m5 - m5 + m*5 + (2m*3 + 0m*2 + 0m*2)(0m2 + 2m2 - m2) + 5m5 - 6m*5 + 5m*5. 8m*5 Expand (-3l*2 + 2l*2 + 0l*2)(4 + 2 - 3) + (-l + 0l + 4l)(3l - 3l + 2l). 3l2 Expand (3 + 3 - 5)(-z + 1 - 1)(-2 - 1 + 2) + (2z + 3z - 4z)(-3 - 2 + 7). 3z Expand (3 + 2 - 4)(-l + l - l). -l Expand (2 - 3 - 1)(-394m2 + 396m*2 + 9m + 26m). -4m*2 - 70m Expand (2g2 - 3g*2 - 2g*2 + (1 + 2 - 4)(3g2 - 2g*2 + 0g*2))(g*3 + 3g3 - g3). -12g5 Expand ((2 - 1 + 1)(-3t + 0t + t) + t - t - t + 3t - 2t + t - 2t + 2t + 2t)(0t - t - 3t). 4t2 Expand (-d + 2d + 3d)(2d + d - 4d). -4d2 Expand 1 - l - 1 + 2 + (2 - 1 - 3)(-2l + 0 + 0) + 2l - 2l - l. 2l + 2 Expand -2g4 + 3g*4 + 0g*4 - 14g*4 + 70g - 70g - 4g4 + g4 + g*4 + (-1 + 1 - 2g*3)(4g - g - g) - g4 + 3g*2 - 3g*2. -20g*4 Expand (-4 + 2l + 4 - 2)(-4l*3 - 2l*3 + 5l*3). -2l*4 + 2l*3 Expand (4 - 5 + 2)(-2g + 0g + 0g). -2g Expand 5s3 - s + s - 2s*3 + 0s*3 + 0s*3 + (4s*2 - 5s*2 - 2s*2)(-5s - s + 4s) + 0s3 + 4s*3 - 2s*3. 11s*3 Expand (1 + 2 - 2)(-4n4 - n5 + 4n*4) + (4 - 2n*3 - 4)(4n - n2 - 4n) + (-2n4 - 1 + 1)(0n + 2n + 0n) + 1 - 1 + 2n5. -n5 Expand (4p - 4p + p*2)(4 - 3 - 3) + 2p2 + 1 + 0p*2 - 8p*2 + (1 + 2 - 1)(4p2 - 2p2 - p2) + 3p2 - 5p*2 + 3p*2. -5p2 + 1 Expand (-g3 - 1 + 1)(g2 + 2g*2 - 2g*2) + 2g*5 + 0g*2 + 0g*2 + 3g*2 - 6g*5 - 3g*2. -5g*5 Expand (-1 + 1 - 2)(n + 0n + 0n)(-2n*3 + 3n*3 - 2n*3). 2n*4 Expand (7i - 4i + 2i)(3 - 1 + 1) + (1 - 1 + i)(-4 + 5 - 4). 12i Expand (b - 2b - 4b)(-2 - 1 + 4) + 3b + b + 2b + 3b - b - 4b. -b Expand (-g*4 - 2g*2 + 2g*2)(2 + 1 - 5) + (0g + 6g + 2g)(3g3 - 5g*3 + 3g*3). 10g*4 Expand (5s2 + s2 - 5s2)(1 - 8 + 3). -4s2 Expand (27 - 10r - 27)(2 - 1 + 1) - 3r + r + 3r + (1 - 4 + 1)(-2r - 3r + 3r) + 3r + 0r - 2r. -14r Expand l - l5 - l + (3l + l - 6l)(2l3 - 2l*3 + 2l*4) + 2l*5 + 0l*4 + 0l*4 + (53 + 11l - 53)(l2 - 3l4 - l2). -36l5 Expand (0q*2 + 2q*2 - 3q*2)(-4q3 - 6q*3 - 3q*3). 13q5 Expand -q4 + 47q3 - 47q*3 - 5q2 + (q3 + 0q3 + q3)(q - 4q + 5q). 3q4 - 5q*2 Expand (0 + 1 + 2)(-30 + 30 + 2f + 4f*3). 12f*3 + 6f Expand (-3j3 - 2j*3 + 3j*3)(3 + 2j2 - 3) - 4j*5 + 4j*5 + 2j*5 + 4j*5 + 2j*5 - 3j5. j5 Expand -2p - 1 - 1 - p + (-6p + 3p + 2p)(-1 + 4 - 2). -4p - 2 Expand (-2x3 - x3 + x3)(2x + 15x + 3x). -40x*4 Expand (-j + 0 + 0)(-3j3 + j3 + j3) - 148j*3 + 148j*3 - 43j*4. -42j*4 Expand (0x*2 + 3x*2 - 4x*2 - 4x*2 + 5x*2 + 0x*2 + (6x*2 + 0x*2 - 4x*2)(4 - 6 + 7))(-5x + x*2 + 5x). 10x4 Expand (-6x*2 + 49x - 51x - 2 + 1)(-2x + 3x - 3x). 12x*3 + 4x*2 + 2x Expand -k + 2 - 2 + (2 - 4 + 4)(3k + 4 - 4). 5k Expand 4 - 7 - a - 7 - a + 0a - a + (a + 2a - a)(1 + 5 - 4). a - 10 Expand (-58 + 23 - 13)(s - s + 2s*2). -96s*2 Expand (2p - 2p + 2p*4)(-3p - p + 3p) - 24p - 2p*5 - 5887 + 5887. -4p*5 - 24p Expand (2h2 - 2h*2 - 2h*3)(-1 - 2 + 1) + 14h2 - 7h*3 - 14h2 - h3 - 4h3 + 4h*3. -4h*3 Expand (-2z*2 + 2z*2 + 2z*3 + 2z*2)(5z - 3z + z)(0 + 5 - 3). 12z*4 + 12z*3 Expand (2k + 0k - k)(2k3 - 2k3 + k3) + (-4 + 3 + 3)((-5k*3 + 0k*3 + 3k*3)(-k + 4 - 4) + 3k4 - 7k*4 - 26k*4). -55k*4 Expand (2i - 2i - 2i*2)(-2 + 0 + 4)(7i - i + 14i). -80i*3 Expand (-h + 0h - h - 2)(-14 + 6h*2 + 14). -12h*3 - 12h*2 Expand (-2a + 2a2 + 2a)(a3 - 4a*3 + 4a*3) + 6a*5 + 73a*4 - 73a*4. 8a*5 Expand (-3 + 5 - 3)(-2z + 4z - 5z)(0z + 4z + z)(-2z*2 + 0z2 + z2). -15z4 Expand -11m - 3 + 9m + 2 + (2m - 3m + 3m)(-2 - 1 + 5). 2m - 1	{ "pile_set_name": "DM Mathematics" }
+ 232w3/15 + 8w*2/5 - 2752w/15 - 3712/15 = 0? -2, 4, 116 Let 5z4 - 205z*3 - 1290z*2 + 6280z + 7360 = 0. What is z? -8, -1, 4, 46 Factor -3i2/4 + 2067i/2 + 54249/4. -3(i - 1391)(i + 13)/4 Factor -4q2 + 308224q - 5937627136. -4(q - 38528)2 Suppose 4y*4 - 6292y*3 + 130944y*2 - 895232y + 1986560 = 0. What is y? 5, 8, 1552 Determine b so that 50b5 + 3485b*4 + 5800b*3 + 1345b*2 - 1020b = 0. -68, -1, 0, 3/10 Suppose 1642n3/5 + 658n*2 + 1654n/5 + 6/5 = 0. What is n? -1, -3/821 Let -2s4/3 + 5218s*3/9 - 1414340s*2/9 + 113032192s/9 - 24909248/3 = 0. Calculate s. 2/3, 141, 364 Suppose 5z2 - 23655z - 23660 = 0. Calculate z. -1, 4732 Suppose a*2/8 - 121799a/4 - 243599/8 = 0. Calculate a. -1, 243599 Factor -36n2 - 1612n - 7160. -4(n + 5)(9n + 358) Factor -961n*3/2 - 46190n*2 - 184576n - 188416. -(n + 92)(31n + 64)*2/2 Solve 4r*5 - 28r*4 - 1156r*3 - 6932r*2 - 8448r + 16560 = 0. -6, -5, 1, 23 Find d such that 14d5/13 - 8908d*4/13 - 15474d*3/13 + 103232d*2/13 + 79160d/13 - 30624/13 = 0. -4, -1, 2/7, 3, 638 Factor -3a2 + 3498a - 51795. -3(a - 1151)(a - 15) Solve -8n5/5 - 284n*4/5 + 232n*3 + 2624n*2/5 - 1152n/5 - 468 = 0. -39, -3/2, -1, 1, 5 Determine r, given that -r*3/7 + 11394r*2 - 227190663r = 0. 0, 39879 Determine c, given that -c*4/3 + 44c*3 - 975c*2 - 6386c/3 = 0. -2, 0, 31, 103 Find b such that 6b2/5 - 2188b/5 - 2928/5 = 0. -4/3, 366 Factor -x*4/3 + 608138x*3 - 369831827044x*2 + 224908787634884072x/3. -x(x - 608138)3/3 Suppose -4u*3/3 - 532u*2/3 - 7600u/3 - 4368 = 0. What is u? -117, -14, -2 Let -4t4/3 - 3440t*3/3 + 20740t*2/3 - 38080t/3 + 6928 = 0. What is t? -866, 1, 2, 3 Solve -4p3/3 + 240p*2 - 1844p + 4816/3 = 0 for p. 1, 7, 172 Suppose 2a3 - 757180a2 = 0. What is a? 0, 378590 Factor g3/3 - 49g2/3 + 494g/3 + 544/3. (g - 34)(g - 16)(g + 1)/3 Suppose x*4 - 756x*3 - 1516x2 = 0. Calculate x. -2, 0, 758 Find l such that -l2/3 - 33388l - 100163/3 = 0. -100163, -1 What is q in q3/4 - 5251q*2 - 63039q - 189144 = 0? -6, 21016 Factor 2a3/7 + 1014a*2/7 + 129030a/7 + 128018/7. 2(a + 1)(a + 253)*2/7 Find p such that 3p*4 + 567p*3 + 26880p*2 + 26316p = 0. -102, -86, -1, 0 Find j such that -4j3 + 2740j*2 + 244484j + 241740 = 0. -79, -1, 765 Solve 2f2/7 + 3246f - 22724/7 = 0. -11362, 1 Factor -69239041b2/3 + 49926b - 27. -(8321b - 9)2/3 Determine o, given that -5o*3 + 60575o*2 - 605375o + 1513125 = 0. 5, 12105 Find v such that 5v5 + 265v*4 - 2760v*3 + 1940v*2 + 4960v = 0. -62, -1, 0, 2, 8 Let 18225h3 - 55620h*2 + 43381h - 10082 = 0. Calculate h. 71/135, 2 Solve -2704m2 - 2702m + 2 = 0 for m. -1, 1/1352 Factor g*3/9 - 101g*2/3 + 1267g - 12789. (g - 261)(g - 21)2/9 Factor -4j*2/5 + 219776j/5 - 3018843136/5. -4(j - 27472)2/5 Find a such that a2 + 8266a - 16536 = 0. -8268, 2 What is a in -3a2/7 + 900a + 31575/7 = 0? -5, 2105 Determine p, given that -1166p3/9 + 1126p*2/9 - 20p/3 = 0. 0, 3/53, 10/11 Find k such that 250k4/9 + 170k*3/9 - 88k*2/9 - 8k/9 = 0. -1, -2/25, 0, 2/5 Find y, given that 4y4/7 + 208y*3/7 + 1044y*2/7 - 2728y/7 + 1472/7 = 0. -46, -8, 1 Solve -2w3 - 1146w*2 - 162432w + 497664 = 0. -288, 3 Solve -2v2/7 + 66656v/7 - 555377792/7 = 0 for v. 16664 Factor 2f2 + 648952f + 52642337288. 2(f + 162238)2 Find t, given that -3t*2 + 198t - 1944 = 0. 12, 54 What is u in 2u3/11 + 32u*2/11 - 238u/11 - 588/11 = 0? -21, -2, 7 What is v in 2v5 - 666v*4 + 40014v*3 + 2758834v*2 - 5635056v + 2836872 = 0? -41, 1, 186 Factor 2b4 + 18120b*3. 2b*3(b + 9060) Factor -n*3/2 - 153n*2 - 19565n/2. -n(n + 91)(n + 215)/2 Factor 2m2/3 - 3526m - 116600/3. 2(m - 5300)(m + 11)/3 Factor 2c2/7 + 900c/7 - 1808/7. 2(c - 2)(c + 452)/7 Let -2s2 - 5462s - 5460 = 0. What is s? -2730, -1 Find q such that -6q5/11 + 28q*4 + 13678q*3/11 + 58924q*2/11 + 81896q/11 + 32400/11 = 0. -25, -2, -2/3, 81 Solve 2m5/11 - 9990m*4/11 + 12470016m*3/11 + 12480008m*2/11 = 0 for m. -1, 0, 2498 Let -3d*2 - 306420d - 612828 = 0. Calculate d. -102138, -2 Suppose -4q3 - 220q*2 + 232q + 448 = 0. Calculate q. -56, -1, 2 Determine y, given that -143y2/5 - 617y/5 - 474/5 = 0. -474/143, -1 Factor t*4/2 + 21925t*3 + 479827825t*2/2 - 9622882500t + 96316605000. (t - 20)*2(t + 21945)*2/2 Factor -14w*2/13 - 5610w/13 + 5624/13. -2(w - 1)(7w + 2812)/13 Factor -x2 - 931x + 148730. -(x - 139)(x + 1070) Suppose 4l*3/5 - 1016l*2/5 - 66124l + 331632/5 = 0. Calculate l. -188, 1, 441 Factor 20p2 - 387p + 981. (p - 3)(20p - 327) Determine q so that 2q3/11 - 164q*2/11 - 9728q/11 + 808640/11 = 0. -70, 76 Factor -3k2 + 7926k + 7929. -3(k - 2643)(k + 1) Suppose -5n4 + 330n*3 + 4745n*2 - 5070n = 0. What is n? -13, 0, 1, 78 Find l such that 3l2/5 - 118938l/5 + 1178853987/5 = 0. 19823 Find i, given that -2i4/9 + 18976i*3/9 - 5001230i*2 - 18976i/9 + 45011072/9 = 0. -1, 1, 4744 Factor -2r2 + 5668r + 5670. -2(r - 2835)(r + 1) Find d, given that -d*3/6 + 1387d*2/6 - 2768d/3 + 922 = 0. 2, 1383 Suppose -2p5/7 + 2230p*4 + 140674p*3/7 - 171890p*2/7 - 20096p + 156280/7 = 0. Calculate p. -10, -1, 1, 7814 Let -2l2/5 + 2254748l/5 - 635486067938/5 = 0. Calculate l. 563687 Let -114m3/5 - 61892m*2 - 173688m/5 + 21712/5 = 0. What is m? -2714, -2/3, 2/19 Factor 3n2/5 - 1818n/5 - 104781/5. 3(n - 659)(n + 53)/5 What is b in -5b2 - 2005b - 13790 = 0? -394, -7 Factor 4o4 + 160o*3 + 2048o*2 + 9728o + 15360. 4(o + 4)2(o + 12)(o + 20) Factor 135d*3 + 9625d*2 + 177625d + 214375. 5(d + 35)2(27d + 35) Factor m2 + 4525m + 9046. (m + 2)(m + 4523) Let -3l*4/2 + 4503l*3/4 + 2259l*2/4 - 4503l/4 - 2253/4 = 0. What is l? -1, -1/2, 1, 751 Let -4n5 + 124n*4 + 2084n*3 + 8724n*2 + 11088n = 0. What is n? -7, -3, 0, 44 Factor d*2/2 + 1493d/2 + 746. (d + 1)(d + 1492)/2 Factor -o4 - 12263o*3 - 50086113o*2 - 67966037141o + 684681255710. -(o - 10)(o + 4091)3 Let 4p*2/7 - 277920p/7 + 4827470400/7 = 0. Calculate p. 34740 Suppose -2m2/9 - 18442m/9 + 259364/3 = 0. Calculate m. -9263, 42 Determine r, given that r*2/4 - 1607r - 32165/4 = 0. -5, 6433 Determine v, given that 6v3 - 843v*2 + 21939v + 22788 = 0. -1, 36, 211/2 Suppose -w*3/7 - 3w*2/7 + 22w/7 + 24/7 = 0. What is w? -6, -1, 4 Factor 3249n2/4 - 22173n + 151321. (57n - 778)2/4 Factor 5s*5 + 390s*4 - 9080s*3 - 1469600s*2 - 37403520s - 211256320. 5(s - 62)(s + 8)(s + 44)3 Factor 3u*3/2 - 306u*2 + 41607u/2 - 471339. 3(u - 69)2(u - 66)/2 Factor -u*3/7 - 967u*2/7 - 44488u - 33397872/7. -(u + 303)(u + 332)2/7 Find g such that 2g*4 + 1870g*3 + 62924g*2 - 68544g - 129600 = 0. -900, -36, -1, 2 Let -k*4 - 59k*3 + 5244k*2 - 5184k = 0. What is k? -108, 0, 1, 48 Factor -5y2/6 - 63y + 4763/6. -(y - 11)(5y + 433)/6 What is i in i*2 - 5598i + 83745 = 0? 15, 5583 Solve 8j5/11 + 122j*4/11 - 1336j*3/11 + 2034j*2/11 - 828j/11 = 0. -23, 0, 3/4, 1, 6 Suppose -5y2 + 85020y = 0. Calculate y. 0, 17004 Determine g so that g*3 - 6g*2 - 432g = 0. -18, 0, 24 Determine g, given that -239g2/3 - 299g - 180 = 0. -3, -180/239 Suppose -2s5/9 + 32s*4/9 + 50s*3/3 - 76s*2 = 0. Calculate s. -6, 0, 3, 19 Suppose 134z*4/11 + 276z*3/11 + 16z2/11 = 0. Calculate z. -2, -4/67, 0 Factor l2 + 171290l + 7335066025. (l + 85645)2 What is b in b4/5 + 15472b*3/5 + 59737294b*2/5 - 838597872b/5 + 2937748401/5 = 0? -7743, 7 Factor -h*2 + 49510h - 612810025. -(h - 24755)*2 Solve 8b*4 - 114b*3 - 508b*2 + 4614b - 1120 = 0. -7, 1/4, 5, 16 Find n, given that -2n2 + 1386n + 2780 = 0. -2, 695 Factor -3q3 - 40770q*2 - 244536q - 326016. -3(q + 2)(q + 4)(q + 13584) Find n, given that n2/5 + 1328502n/5 + 441229391001/5 = 0. -664251 Suppose -2t4 + 119t*3 - 1654t*2 - 2693t - 918 = 0. What is t? -1, -1/2, 27, 34 Factor 2m3/19 - 710m*2/19 + 704m/19 + 1416/19. 2(m - 354)(m - 2)(m + 1)/19 Suppose -d3/3 + 4609	{ "pile_set_name": "DM Mathematics" }
prob of sequence zg. 1/14 Calculate prob of sequence rm when two letters picked without replacement from dxrrxrmrrn. 1/18 Two letters picked without replacement from {r: 2, h: 1, p: 2, q: 1, e: 1, s: 1}. Give prob of sequence rs. 1/28 What is prob of sequence jhdh when four letters picked without replacement from {v: 2, h: 2, d: 2, p: 4, j: 2}? 1/1485 Two letters picked without replacement from {w: 11, k: 9}. What is prob of sequence kk? 18/95 Two letters picked without replacement from {x: 3, s: 11}. What is prob of sequence sx? 33/182 Calculate prob of sequence lu when two letters picked without replacement from {u: 2, d: 2, a: 1, l: 4}. 1/9 Three letters picked without replacement from xxyyxxx. What is prob of sequence yyx? 1/21 Four letters picked without replacement from {c: 7, v: 1, b: 2}. Give prob of sequence vccc. 1/24 Two letters picked without replacement from {d: 1, n: 3, h: 3, y: 3, q: 2, k: 3}. What is prob of sequence kd? 1/70 Two letters picked without replacement from effce. Give prob of sequence ec. 1/10 What is prob of sequence uc when two letters picked without replacement from {u: 1, i: 3, c: 6, y: 5, o: 3, s: 2}? 3/190 Calculate prob of sequence nmm when three letters picked without replacement from omnmononwxnxwoomo. 1/170 What is prob of sequence ff when two letters picked without replacement from ffcdcfcdcffcccffcf? 28/153 Two letters picked without replacement from {r: 14, h: 1, u: 2, d: 2}. What is prob of sequence hd? 1/171 What is prob of sequence ukkk when four letters picked without replacement from {k: 4, u: 10}? 10/1001 Four letters picked without replacement from {x: 1, j: 1, v: 2, y: 1, a: 1, u: 2}. Give prob of sequence jvvu. 1/420 Calculate prob of sequence trnv when four letters picked without replacement from vvrnvrnvttvvnnbnctvv. 2/969 Calculate prob of sequence qg when two letters picked without replacement from qqqqqqgqggg. 14/55 Two letters picked without replacement from vwwatbwtwbtwawaaab. Give prob of sequence av. 5/306 Two letters picked without replacement from dwddwddw. What is prob of sequence dd? 5/14 What is prob of sequence aaaa when four letters picked without replacement from {a: 7}? 1 Calculate prob of sequence chhc when four letters picked without replacement from {e: 7, c: 4, h: 3}. 3/1001 Three letters picked without replacement from vxhgvhxwvavhvvvwaa. What is prob of sequence vwv? 7/408 Calculate prob of sequence bl when two letters picked without replacement from oloiilogoobogii. 1/105 Calculate prob of sequence tt when two letters picked without replacement from gptpthgtgptppp. 6/91 Four letters picked without replacement from {f: 2, m: 2, n: 5}. Give prob of sequence mfmn. 5/756 Three letters picked without replacement from zgqggzgzzgzzzg. Give prob of sequence zqz. 1/52 Calculate prob of sequence qzzi when four letters picked without replacement from {q: 3, i: 2, z: 3}. 3/140 Three letters picked without replacement from bqqbdpqdqqqprrqpdpqe. Give prob of sequence ped. 1/570 Two letters picked without replacement from {y: 8, o: 4, z: 1}. What is prob of sequence yz? 2/39 Three letters picked without replacement from {u: 2, s: 3, v: 5}. Give prob of sequence suu. 1/120 Calculate prob of sequence qg when two letters picked without replacement from {q: 4, g: 7}. 14/55 Three letters picked without replacement from {v: 7, j: 3}. Give prob of sequence jvj. 7/120 Three letters picked without replacement from {j: 8, v: 2}. What is prob of sequence jjj? 7/15 Calculate prob of sequence nnnz when four letters picked without replacement from {z: 3, n: 4}. 3/35 Two letters picked without replacement from {q: 1, o: 3, c: 2, a: 3, j: 1}. What is prob of sequence qa? 1/30 Three letters picked without replacement from mmgmgm. Give prob of sequence gmm. 1/5 What is prob of sequence hj when two letters picked without replacement from {z: 2, h: 3, j: 4, o: 2}? 6/55 What is prob of sequence txx when three letters picked without replacement from {t: 5, x: 5, f: 3}? 25/429 Calculate prob of sequence rr when two letters picked without replacement from rkrkff. 1/15 Two letters picked without replacement from {i: 1, h: 3}. What is prob of sequence ih? 1/4 Calculate prob of sequence pllu when four letters picked without replacement from {p: 1, u: 3, l: 11, g: 5}. 11/3876 Four letters picked without replacement from {y: 2, f: 7}. Give prob of sequence yfyf. 1/36 What is prob of sequence cxc when three letters picked without replacement from {l: 5, x: 1, c: 3, n: 1, i: 1, s: 2}? 1/286 Two letters picked without replacement from kmmmkmmmkmm. Give prob of sequence km. 12/55 Two letters picked without replacement from ylclcclyjiy. What is prob of sequence jy? 3/110 Four letters picked without replacement from kujuuhukjuuukhuuukku. What is prob of sequence khjh? 1/5814 Calculate prob of sequence why when three letters picked without replacement from {i: 1, w: 3, h: 1, y: 6, x: 1, j: 1}. 3/286 Calculate prob of sequence mfgw when four letters picked without replacement from nfmggnwnn. 1/1512 Three letters picked without replacement from {q: 9}. Give prob of sequence qqq. 1 Three letters picked without replacement from ejssees. What is prob of sequence ejs? 3/70 Three letters picked without replacement from {g: 2, y: 2, m: 5}. What is prob of sequence myy? 5/252 Calculate prob of sequence ynw when three letters picked without replacement from {d: 3, s: 2, n: 2, w: 1, l: 2, y: 2}. 1/330 Two letters picked without replacement from {y: 7, l: 1, a: 2}. Give prob of sequence ya. 7/45 Calculate prob of sequence lkl when three letters picked without replacement from {l: 4, k: 3}. 6/35 Four letters picked without replacement from lllglglllglgggllll. Give prob of sequence lglg. 11/204 Four letters picked without replacement from ddzddddznznnd. What is prob of sequence dznn? 21/2860 Calculate prob of sequence oali when four letters picked without replacement from {f: 1, a: 1, l: 1, o: 2, i: 2}. 1/210 Two letters picked without replacement from {e: 3, d: 13, r: 2, a: 2}. Give prob of sequence dr. 13/190 What is prob of sequence kk when two letters picked without replacement from {k: 3, p: 13}? 1/40 Two letters picked without replacement from ssssosppuzpupzsos. What is prob of sequence zs? 7/136 What is prob of sequence dhd when three letters picked without replacement from xdxxdxxsddxshx? 1/182 Two letters picked without replacement from btinvniivvnvnibv. Give prob of sequence vi. 1/12 Two letters picked without replacement from cwcwcwcwcc. What is prob of sequence cc? 1/3 What is prob of sequence ee when two letters picked without replacement from egegegee? 5/14 Calculate prob of sequence hkkk when four letters picked without replacement from hhhhhhkkhhhhhkhkkhh. 35/3876 Two letters picked without replacement from {w: 2, u: 2, e: 2}. Give prob of sequence ee. 1/15 Two letters picked without replacement from xmpvxpxqpxmv. Give prob of sequence mx. 2/33 What is prob of sequence bb when two letters picked without replacement from bbb? 1 Three letters picked without replacement from aaaiaaaaaacza. Give prob of sequence cia. 5/858 What is prob of sequence jnnp when four letters picked without replacement from nnpppnjpp? 5/504 What is prob of sequence bz when two letters picked without replacement from fxpwxzbzzwpppz? 2/91 Four letters picked without replacement from {a: 5, m: 10, x: 4}. What is prob of sequence mxam? 25/1292 Two letters picked without replacement from {z: 1, i: 2, c: 1, o: 2, t: 1, a: 1}. What is prob of sequence oc? 1/28 Three letters picked without replacement from bhhvbyyaavyamh. Give prob of sequence hmh. 1/364 Two letters picked without replacement from eyczepqzqzzc. What is prob of sequence zq? 2/33 Two letters picked without replacement from nnlbelek. Give prob of sequence be. 1/28 Four letters picked without replacement from {e: 5, r: 8}. What is prob of sequence rree? 28/429 Calculate prob of sequence fq when two letters picked without replacement from {f: 3, q: 1}. 1/4 Calculate prob of sequence xxjw when four letters picked without replacement from {w: 13, x: 5, j: 2}. 13/2907 Two letters picked without replacement from hadxhhhdx. What is prob of sequence dh? 1/9 Two letters picked without repla	{ "pile_set_name": "DM Mathematics" }
to the nearest integer? 655 What is the third root of 1350408003 to the nearest integer? 1105 What is the eighth root of 45550704 to the nearest integer? 9 What is the seventh root of 88201527 to the nearest integer? 14 What is 270857446 to the power of 1/3, to the nearest integer? 647 What is the eighth root of 5596764 to the nearest integer? 7 What is the third root of 1034968125 to the nearest integer? 1012 What is 7180774481 to the power of 1/2, to the nearest integer? 84739 What is the cube root of 354564499 to the nearest integer? 708 What is the cube root of 941300027 to the nearest integer? 980 What is the square root of 2031639115 to the nearest integer? 45074 What is 487182302 to the power of 1/2, to the nearest integer? 22072 What is the third root of 361054657 to the nearest integer? 712 What is 4990813691 to the power of 1/10, to the nearest integer? 9 What is the seventh root of 119947178 to the nearest integer? 14 What is the fourth root of 501875128 to the nearest integer? 150 What is the third root of 2077648337 to the nearest integer? 1276 What is 1525353194 to the power of 1/10, to the nearest integer? 8 What is 1202885763 to the power of 1/2, to the nearest integer? 34683 What is 5834682945 to the power of 1/6, to the nearest integer? 42 What is the square root of 50009422 to the nearest integer? 7072 What is the third root of 324000809 to the nearest integer? 687 What is the square root of 38292082 to the nearest integer? 6188 What is the cube root of 298377044 to the nearest integer? 668 What is the third root of 73184529 to the nearest integer? 418 What is the cube root of 1726070893 to the nearest integer? 1200 What is 1089096870 to the power of 1/2, to the nearest integer? 33001 What is 17610422 to the power of 1/7, to the nearest integer? 11 What is the square root of 3598864681 to the nearest integer? 59991 What is 4008048675 to the power of 1/5, to the nearest integer? 83 What is the square root of 31586518 to the nearest integer? 5620 What is 603824283 to the power of 1/2, to the nearest integer? 24573 What is 670149870 to the power of 1/3, to the nearest integer? 875 What is 4810977515 to the power of 1/6, to the nearest integer? 41 What is the fifth root of 433318438 to the nearest integer? 53 What is the square root of 817352888 to the nearest integer? 28589 What is the cube root of 898809192 to the nearest integer? 965 What is the third root of 376563648 to the nearest integer? 722 What is 19068705 to the power of 1/5, to the nearest integer? 29 What is the sixth root of 71784946 to the nearest integer? 20 What is 43399815 to the power of 1/3, to the nearest integer? 351 What is the fourth root of 4821127896 to the nearest integer? 264 What is the cube root of 42016491 to the nearest integer? 348 What is the square root of 319991582 to the nearest integer? 17888 What is the cube root of 52264389 to the nearest integer? 374 What is the square root of 5397781395 to the nearest integer? 73470 What is the fifth root of 308050226 to the nearest integer? 50 What is 70459954 to the power of 1/7, to the nearest integer? 13 What is 3102558171 to the power of 1/10, to the nearest integer? 9 What is the tenth root of 58809869 to the nearest integer? 6 What is the ninth root of 1302387280 to the nearest integer? 10 What is 147962133 to the power of 1/4, to the nearest integer? 110 What is 773498527 to the power of 1/3, to the nearest integer? 918 What is the eighth root of 58122727 to the nearest integer? 9 What is the cube root of 191682466 to the nearest integer? 577 What is the third root of 1157474531 to the nearest integer? 1050 What is the square root of 2462403190 to the nearest integer? 49623 What is the square root of 4538945297 to the nearest integer? 67372 What is the third root of 125488637 to the nearest integer? 501 What is the square root of 44360029 to the nearest integer? 6660 What is the third root of 19898759 to the nearest integer? 271 What is the ninth root of 35849395 to the nearest integer? 7 What is the fifth root of 4203326039 to the nearest integer? 84 What is the cube root of 84482388 to the nearest integer? 439 What is 2691941341 to the power of 1/2, to the nearest integer? 51884 What is 349351925 to the power of 1/2, to the nearest integer? 18691 What is 43295380 to the power of 1/3, to the nearest integer? 351 What is 82580238 to the power of 1/3, to the nearest integer? 435 What is the eighth root of 15315268 to the nearest integer? 8 What is the sixth root of 1334832353 to the nearest integer? 33 What is 2270811 to the power of 1/5, to the nearest integer? 19 What is 70758569 to the power of 1/2, to the nearest integer? 8412 What is the fifth root of 1834607309 to the nearest integer? 71 What is 4951923053 to the power of 1/2, to the nearest integer? 70370 What is 1234472503 to the power of 1/3, to the nearest integer? 1073 What is 51524182 to the power of 1/8, to the nearest integer? 9 What is 1717657659 to the power of 1/2, to the nearest integer? 41445 What is 4255098 to the power of 1/2, to the nearest integer? 2063 What is 337989479 to the power of 1/3, to the nearest integer? 697 What is the cube root of 675295546 to the nearest integer? 877 What is the square root of 2043337097 to the nearest integer? 45203 What is the cube root of 286113203 to the nearest integer? 659 What is the ninth root of 617152083 to the nearest integer? 9 What is the ninth root of 375039576 to the nearest integer? 9 What is 45010770 to the power of 1/10, to the nearest integer? 6 What is the eighth root of 16316673 to the nearest integer? 8 What is the third root of 348854639 to the nearest integer? 704 What is 161491105 to the power of 1/3, to the nearest integer? 545 What is the fourth root of 35154654 to the nearest integer? 77 What is the third root of 993177907 to the nearest integer? 998 What is the seventh root of 22759385 to the nearest integer? 11 What is the cube root of 345903404 to the nearest integer? 702 What is the square root of 390955135 to the nearest integer? 19773 What is the cube root of 42044887 to the nearest integer? 348 What is the seventh root of 402279479 to the nearest integer? 17 What is the square root of 115412828 to the nearest integer? 10743 What is 854839092 to the power of 1/3, to the nearest integer? 949 What is the ninth root of 477502124 to the nearest integer? 9 What is the cube root of 3427897638 to the nearest integer? 1508 What is the square root of 27567109 to the nearest integer? 5250 What is the cube root of 56646325 to the nearest integer? 384 What is the square root of 262259551 to the nearest integer? 16194 What is 2726536893 to the power of 1/2, to the nearest integer? 52216 What is 972347753 to the power of 1/5, to the nearest integer? 63 What is 855984621 to the power of 1/2, to the nearest integer? 29257 What is 531876654 to the power of 1/2, to the nearest integer? 23062 What is the cube root of 3380780305 to the nearest integer? 1501 What is the seventh root of 2932717432 to the nearest integer? 23 What is the third root of 571862439 to the nearest integer? 830 What is 4397581 to the power of 1/4, to the nearest integer? 46 What is the seventh root of 3220797519 to the nearest integer? 23 What is the third root of 550146469 to the nearest integer? 819 What is the seventh root of 5238836797 to the nearest integer? 24 What is the fifth root of 295502219 to the nearest integer? 49 What is the third root of 473712651 to the nearest integer? 780 What is the square root of 2318759790 to the nearest integer? 48154 What is the third root of 34752191 to the nearest integer? 326 What is 6400966 to the power of 1/10, to the nearest integer? 5 What is the square root of 1215399353 to the nearest integer? 34863 What is the square root of 132117554 to the nearest integer? 11494 What is the third root of 578403549 to the nearest integer? 833 What is 1697386844 to the power of 1/2, to the nearest integer? 41199 What is the square root of 139057501 to the nearest integer? 11792 What is 164715989 to the power of 1/2, to the nearest integer? 12834 What is 5886019286 to the power of 1/2, to the nearest integer? 76720 What is the square root of 515286970 to the nearest in	{ "pile_set_name": "DM Mathematics" }
8)/(-60) - (-2)/10. Give i(s). 5 Let c = 1360 + -1354. Let u(m) = m*2 - 11m + 5. Let s(p) = -2p2 + 21p - 10. Let t(h) = 4s(h) + 7u(h). Calculate t(c). 1 Let f(r) be the first derivative of 2r2 - 1/3r*3 - 1 + 4r. Determine f(3). 7 Let u(m) = 5m - 4 + 0m*3 + 3m*3 - 5m*2 - 2m*3 - 2. Give u(4). -2 Suppose v - 4v = -3n - 33, 5v - 55 = -4n. Suppose 0 = 2o - 5b + 8, -4b + 33 - v = o. Let l(f) = f*3 - 5f*2 - 5f - 4. What is l(o)? 2 Suppose -68 = -4u - 2o, 2o - 20 - 29 = -3u. Suppose -4g - u = 5. Let w(x) be the third derivative of x4/24 + 7x*3/6 - 3x2. What is w(g)? 1 Let g(k) = -k2 - 6k + 1. Suppose 7t - 2t + 30 = 0. Give g(t). 1 Suppose 0 = 3a - 5 - 10. Suppose -au = 0, 5 - 3 = -2f + u. Let n(l) be the second derivative of l5/5 + l4/6 + l3/3 + l2/2 + 2l. Determine n(f). -3 Let g(m) = m3 + 4m*2 + 4m. Let n = 4 - -8. Let w be (n/8)/(1/(-2)). Determine g(w). -3 Let k(p) = -p*2 - p + 4. Let v(w) = 1. Let t(o) = -o - 1. Let z(u) = 4t(u) + 5v(u). Let l be z(1). Give k(l). -2 Let g(t) be the second derivative of t4/6 - 2t*3/3 - 5t*2/2 + 7t. Calculate g(4). 11 Suppose 10p + 9p = -57. Let l(w) be the third derivative of w5/60 + w4/8 - w3/6 + w2. Determine l(p). -1 Let z(v) = -7 + 0v - 3v2 - v + 6 - v3. Let s be 4(1/(-3) - (-1)/(-6)). Give z(s). -3 Let a be (4 - 2 - 0)4. Suppose 5m - m + a = 0, 0 = 5h - 5m + 15. Let o(j) = -4 + 2j - 3 + 9. Calculate o(h). -8 Let r(q) = -q*2 + 8q - 1. Let g = -10 - -15. Suppose 4k + v - 15 = g, 2v = -5k + 22. What is r(k)? 11 Suppose 0 = 3l - 0l. Let n(a) = l + 14a - 1 + 0 - 7a. Determine n(1). 6 Let i(j) be the second derivative of -23j4/12 - j2/2 - 2j - 5. Determine i(-1). -24 Let b(j) = j3 - 7j*2 + 8j - 8. Let s be b(6). Let i(h) be the second derivative of 0h2 + 0h*3 + 1/12hs + h + 0. What is i(-1)? 1 Let h(s) = -s3 + 9s2 + 8s + 13. Let v be h(10). Let p(r) = r*2 + 8r - 3. Determine p(v). -10 Let k(w) be the second derivative of -w*5/20 + 5w4/12 - w3/6 - 7w2/2 - 8w. Calculate k(5). -12 Let i(w) = w*3 - 5w*2 + 4w + 1. Suppose 2d + 2d = 2k + 12, 5d = -k + 29. Let t be i(k). Let u(l) = 4l3 - 2l*2 + 2l - 1. Calculate u(t). 3 Let l(d) = 22d - 18d + 5d2 + 14 + d3 - 14. Let k = -3 + 0. Determine l(k). 6 Let t(j) be the third derivative of j5/60 - j4/4 - j3/6 - j2. Let p be 76/10 - (-21)/(-35). Suppose -4c + p = -17. Determine t(c). -1 Let z(n) = -3n + 3. Let l(c) = -c - 1. Let a(r) = 4l(r) + z(r). Give a(-1). 6 Let m(d) = d + 7. Let y(f) = f*2 + 5f - 1. Let u be y(-6). Suppose -ug - 34 = 41. Let k be 4/10 - (-6)/g. Give m(k). 7 Suppose -3y + 0y - 6 = 0, -3x + 5 = -4y. Let z(t) = -t2 - t. What is z(x)? 0 Let x(r) be the second derivative of 0 + 2r + 1/6r3 + r2 - 1/24r*4 - 1/60r*5. Let y(h) be the first derivative of x(h). Determine y(1). -1 Let v(r) = -3 + 2r - 2 - 5r + 6r. Determine v(4). 7 Suppose -4 = -3o - p, 12 = 3p - 0. Let v be 1(-3 - o) - 2. Let k(u) = -6 - 7u + 4u - 1. Determine k(v). 8 Let k(w) = -24w - 20. Let x(c) = 8c + 7. Let l(y) = 6k(y) + 17x(y). Let j = -40 + 39. Give l(j). 7 Suppose l - 6l + 20 = 0. Let n(g) = -g*3 + 5g*2 - 2g - 2. What is n(l)? 6 Suppose -8c + 4c = -20. Suppose -4v + 7v = 2w + 15, cw + 27 = -3v. Let q(p) = p2 + 4p. Determine q(w). 12 Let x be (-48)/(-36)(-6)/(-4). Let u(l) = 4l*2 - 2l*2 + xl*3 - 3l3. Give u(2). 0 Let m(f) = f3 - 7f2 + 5f + 8. Let a be m(6). Suppose r = -ar. Let z(w) = -w3 + w2 - 10. Determine z(r). -10 Let u(f) = f3 - 6f*2 + 6f + 7. Let q(d) = -d*3 + 6d*2 - 5d - 7. Let t(g) = -7q(g) - 6u(g). Let o be t(6). Let j(m) = 11m - 1. What is j(o)? 10 Let t(h) be the second derivative of 13/12h*4 + 0h*3 + 0 - 4h + 0h2. Calculate t(-1). 13 Let i(v) be the first derivative of 0v*4 + 2 + 1/6v*3 - 1/30v*5 + 3/2v*2 + 0v. Let d(o) be the second derivative of i(o). What is d(-2)? -7 Let f(h) be the third derivative of h4/24 + h3/3 - 7h2. Give f(5). 7 Let g(k) be the third derivative of k5/60 - 4k*2. What is g(-2)? 4 Let q(j) = -3j - 7. Let u(l) = l - 11. Let h be (8/(-6))/((-14)/63). Let g be u(h). What is q(g)? 8 Let t(k) = -k*3 + 7k*2 - 2k + 3. Let i(b) = -7b2 - 1 - 3 + 2b + b*3 + b + 0. Let w(d) = 6i(d) + 5t(d). What is w(6)? 3 Let m be (0/(-3))/(-1 - 1). Suppose s + 0 - 2 = m. Let j(b) = -2b*2 + 3 + s + 2b + b2 - 3. What is j(3)? -1 Let l(f) be the first derivative of f3/3 - f*2/2 - 3f + 9. Determine l(4). 9 Suppose -2s + s + 2 = 0, -p + 2s = 11. Let z = -7 + 0. Let w = z - p. Let k(a) = a2 + a - 6. Determine k(w). -6 Let a(q) = -q3 - 7q2 - 6q + 3. Let g be a(-6). Suppose -k - 13 = -4t - 2k, -4t - gk = -15. Let w(j) = j2 - j - 3. Determine w(t). 3 Let n = -8 + 13. Let l(h) = h3 - 5h2 - 3. Determine l(n). -3 Suppose p = 3j - 13, 0 = -2j - 2p + 8 + 6. Let n(g) = 1. Let z(r) = r + 13. Let o(x) = jn(x) - z(x). Give o(0). -8 Let k be ((-90)/54)/(5/(-6)). Suppose 3y + 15 = 3v, ky + 2v + 0v + 10 = 0. Let i(b) = -b*3 - 5b2 - 7. Calculate i(y). -7 Let b(x) = -x2 - 7x - 4. Let w = -23 - -28. Suppose 2j + 41 = -5o, j + 18 + 20 = -wo. Give b(o). -4 Let s(a) be the second derivative of -a*3/3 - 3a*2/2 + 7a. Suppose 17 = 4w + p, w - 18 = -3p - 0. What is s(w)? -9 Let t be -4((-6)/4)/(-1). Let l(b) = -b - 13. Calculate l(t). -7 Let z(r) = -r + 10. Let w = 6 + -6. Suppose -5s + m + 23 = 0, -4 = -2m - w. What is z(s)? 5 Suppose -7 + 2 = 5k. Let x(b) = 58b2 + 3 - 60b2 - 4. Give x(k). -3 Let z(h) = h3. Let i(g) = 7g3 + 5g*2 - 7. Let c(x) = i(x) - 6z(x). What is c(-5)? -7 Let s be (2 - 1)/(1/(-1)). Let g be (-1 + 3 + s)5. Let t(q) be the second derivative of -q3/6 + 4q*2 - q. Calculate t(g). 3 Let t be 20/8 + 2/123. Let n(r) = -r*3 + 3r*2 + r - 2. Calculate n(t). 1 Let i(g) = -26g*2 - 3g + 42g2 + 3g*3 - 20g*2 - 2g3 - 4. Calculate i(5). 6 Let s be -5 - (-1 + (2 - 0)). Let r(i) be the third derivative of -i6/120 - i*5/10 + 2i*3/3 + 60i*2. Give r(s). 4 Let u(h) = -7h*3 + 7h*2 - 5h + 15. Let y(l) = 3l3 - 3l*2 + 2l - 7. Let m = -1 + 7. Suppose -2s = 4 + m. Let r(z) = sy(z) - 2u(z). What is r(0)? 5 Suppose -26 = -4h - 6. Let c be (-2 - h)/(-1 - -2). Let y(s) = -s*3 - 8s*2 - 5s + 4. What is y(c)? -10 Let f(k) be the third derivative of -k4/24 - k3/2 - k*2. Suppose 18 = q - 5d, 4d = -2q - 0d - 6. Let g = 1 - q. Give f(g). -1 Let x(g) = -2g + 1. Let f be (0 - -1)/(4/40). Suppose -4 = -3k - f. Determine x(k). 5 Let s(a) be the third derivative of -a6/24 + a3/6 - 2a2. Let z be s(1). Let y(v) be the first derivative of v3/3 + 3v2/2 + 2v - 3. What is y(z)? 6 Let y(w) be the first derivative of -w6/360 - w5/120 - 13w4/24 + 2w*3 - 3. Let g(k) be the third derivative of y(k). Give g(0). -13 Let x(w) = 3. Let z(c) = c. Let s(h) = -3h. Let q(y) = 4s(y) + 11z(y). Let n(i) = 4q(i) + x(i). Determine n(2). -5 Let h(t) = t2 + 18t + 11. Let d be h(-17). Let u(l) be the second derivative of -l*4/12 - 4l3/3 + l2/2 + 2l. Calculate u(d). 13 Let z(x) = 9x - 3. Let g be (1/4)/(6/481). Determine z(g). 15 Let j(d) = d2 - d + 3. Let v(x) = -x - 3. Let r be v(-3). Suppose -3i + 8i = r. Give j(i). 3 Let h(i) be the first derivative of i4/4 + 7i*3/3 + 5i*2/2 + 7i + 2. Calculate h(-6). 13 Let s(o) = -o*2 + 4o + 1. Suppose -56 = -5n - 16. Let c be (20/n)/(1/2). Suppose -3b + 4j + c = 0, -3j - 4 = -7j. Determine s(b). 4 Let j(a) = -10a + 4a - 5a*2 + 6a*2 - 5. Suppose -4l - 2 = 70. Let r be ((-5)/((-15)/l))/(-1). Calculate j(r). -5 Suppose 3p - 11 = -2. Let i(m) be the second derivative of m4/12 - m2 + 22m. Give i(p). 7 Let m(r) = 0r + 2r*2 - 1 + 3r + 0r2 + r3 - 2r3. Calculate m(3). -1 Let s(r) = r3 - r*2 - 1. Let k be (27/12)/34. Let n(y) = -4y3 - 2y*2 + 5y - 4. Let c(a) = ks(a) + n(a). Give c(-6). -1 Let s(l) be the second derivative of 1/12l*4 + 5/2l*2 - 3l + 7/6l3 + 0. Calculate s(-5). -5 Let p(v) = v3 + 7v*2 + 10v + 2. Let g be p(-5). Suppose -4l = -7l. Let a(x) = x3 + xg + 0x + lx*2 + 2 + 2x. Give a(-2).	{ "pile_set_name": "DM Mathematics" }
ilogram? 3250 How many millilitres are there in 7/4 of a litre? 1750 Convert 40.38649us to seconds. 0.00004038649 What is seventeen quarters of a microgram in nanograms? 4250 What is thirty-seven fifths of a gram in milligrams? 7400 How many months are there in one quarter of a millennium? 3000 How many micrometers are there in 2731.837 millimeters? 2731837 What is 824.3407ug in grams? 0.0008243407 Convert 4864.378 nanometers to micrometers. 4.864378 What is 406701.9kg in tonnes? 406.7019 Convert 125.9631 millimeters to centimeters. 12.59631 How many seconds are there in one fifth of a minute? 12 How many nanometers are there in twenty-one fifths of a micrometer? 4200 How many kilograms are there in 715.2275g? 0.7152275 How many nanometers are there in 8.090606m? 8090606000 Convert 85.3671cm to meters. 0.853671 Convert 903286.7g to micrograms. 903286700000 What is 8.671586 decades in months? 1040.59032 What is 8035.275 meters in kilometers? 8.035275 What is five sixths of a year in months? 10 How many kilograms are there in 4310.08mg? 0.00431008 What is nine tenths of a litre in millilitres? 900 How many centimeters are there in 6/25 of a kilometer? 24000 How many seconds are there in 45.66378ns? 0.00000004566378 How many micrometers are there in one fifth of a millimeter? 200 What is 3/10 of a kilometer in meters? 300 How many microseconds are there in 2539.277s? 2539277000 What is 7/2 of a microgram in nanograms? 3500 What is 3/8 of a litre in millilitres? 375 How many years are there in 29/5 of a millennium? 5800 How many millimeters are there in 1/5 of a meter? 200 What is four thirds of a decade in months? 160 What is 52.29636 days in milliseconds? 4518405504 What is one quarter of a microsecond in nanoseconds? 250 Convert 17740195.83ns to weeks. 0.000000029332334375 How many seconds are there in three tenths of a day? 25920 How many millilitres are there in 453.3141l? 453314.1 How many micrometers are there in 86.54679mm? 86546.79 Convert 87.19186mg to nanograms. 87191860 How many seconds are there in fifty-five thirds of a minute? 1100 How many millilitres are there in seventy-two fifths of a litre? 14400 What is 5/8 of a minute in milliseconds? 37500 How many millilitres are there in 1/4 of a litre? 250 How many kilograms are there in thirteen eighths of a tonne? 1625 How many grams are there in 91.74257 nanograms? 0.00000009174257 What is 57.58039t in grams? 57580390 What is 88511.61kg in tonnes? 88.51161 How many micrograms are there in 3/40 of a milligram? 75 How many micrograms are there in fourty-nine fifths of a milligram? 9800 What is 57/2 of a litre in millilitres? 28500 How many centimeters are there in 64391.3um? 6.43913 How many micrometers are there in fifty-one quarters of a millimeter? 12750 What is eleven halves of a millimeter in micrometers? 5500 What is nine tenths of a day in seconds? 77760 How many litres are there in 169.5752ml? 0.1695752 What is 1264.8639 nanoseconds in minutes? 0.000000021081065 What is 384389.5 years in millennia? 384.3895 What is twenty-seven halves of a litre in millilitres? 13500 How many nanograms are there in 0.9513784 grams? 951378400 What is five eighths of a century in months? 750 What is 727042.7 years in months? 8724512.4 What is 21/5 of a microgram in nanograms? 4200 How many micrograms are there in 930.6888mg? 930688.8 Convert 131.0743728 nanoseconds to weeks. 0.0000000000002167235 What is 0.3775502 centuries in decades? 3.775502 How many nanometers are there in 0.8466376m? 846637600 What is 55353.14 decades in years? 553531.4 How many milliseconds are there in 0.6086076 microseconds? 0.0006086076 Convert 0.8428601mm to kilometers. 0.0000008428601 How many tonnes are there in 8.18741 kilograms? 0.00818741 Convert 11966.69 nanograms to milligrams. 0.01196669 How many litres are there in 0.3536834 millilitres? 0.0003536834 How many millilitres are there in 9.48151l? 9481.51 What is twenty-one quarters of a milligram in micrograms? 5250 What is seven eighths of a kilometer in centimeters? 87500 What is three fifths of a micrometer in nanometers? 600 How many minutes are there in 0.9820083 days? 1414.091952 Convert 33514.7ng to milligrams. 0.0335147 How many seconds are there in one sixteenth of a hour? 225 Convert 9177.447ml to litres. 9.177447 How many millilitres are there in 17/4 of a litre? 4250 What is 5/4 of a second in milliseconds? 1250 How many centimeters are there in twenty-one halves of a meter? 1050 What is 6/25 of a litre in millilitres? 240 How many months are there in 28/3 of a year? 112 What is 830662.4 tonnes in grams? 830662400000 What is 6/25 of a litre in millilitres? 240 How many months are there in 1/5 of a decade? 24 How many decades are there in 33.19019 centuries? 331.9019 What is 3/8 of a kilogram in grams? 375 How many centuries are there in 454275.3 decades? 45427.53 How many seconds are there in 19/4 of a minute? 285 What is 25/2 of a litre in millilitres? 12500 What is 3410.074 centuries in years? 341007.4 Convert 52325.96 centuries to years. 5232596 Convert 4019.338 centuries to decades. 40193.38 How many nanograms are there in 12/25 of a microgram? 480 What is 0.7692381 nanometers in micrometers? 0.0007692381 What is 0.9312544 decades in millennia? 0.009312544 What is one tenth of a microgram in nanograms? 100 What is twenty-one fifths of a century in months? 5040 Convert 813743.4 nanometers to micrometers. 813.7434 How many centuries are there in 9.384764 decades? 0.9384764 Convert 6.715137 milliseconds to seconds. 0.006715137 What is 6/25 of a meter in centimeters? 24 How many micrograms are there in 13/5 of a milligram? 2600 Convert 7165.748ml to litres. 7.165748 What is 541.2742 nanograms in tonnes? 0.0000000000005412742 How many millennia are there in 29738.058 months? 2.4781715 How many millilitres are there in 77/2 of a litre? 38500 What is 8.443641ns in milliseconds? 0.000008443641 Convert 610.05069us to days. 0.000000007060771875 What is 5/4 of a litre in millilitres? 1250 How many months are there in 0.6467273 years? 7.7607276 How many years are there in 524.7817 decades? 5247.817 Convert 7.688149 nanometers to centimeters. 0.0000007688149 Convert 944945.8 decades to months. 113393496 What is 2.729753 centimeters in kilometers? 0.00002729753 How many micrograms are there in 121.6031 milligrams? 121603.1 How many micrometers are there in 0.5674796cm? 5674.796 What is 771.1822 centimeters in micrometers? 7711822 How many decades are there in 59/5 of a millennium? 1180 What is 21/2 of a litre in millilitres? 10500 What is 293936.31 months in decades? 2449.46925 What is twenty-nine thirds of a week in hours? 1624 How many months are there in 899215.5 decades? 107905860 What is 7/4 of a millisecond in microseconds? 1750 How many months are there in 747.8152 centuries? 897378.24 How many micrograms are there in 99230.29 kilograms? 99230290000000 How many weeks are there in 126579.138 hours? 753.44725 What is 13/4 of a litre in millilitres? 3250 How many micrometers are there in 8/25 of a centimeter? 3200 How many centimeters are there in 31.54673 millimeters? 3.154673 What is fourty-eight fifths of a gram in milligrams? 9600 How many months are there in 5/6 of a year? 10 What is 184.1347 millilitres in litres? 0.1841347 What is 27/2 of a decade in years? 135 How many kilograms are there in 17/2 of a tonne? 8500 How many meters are there in 25/4 of a kilometer? 6250 What is twenty-one quarters of a tonne in kilograms? 5250 What is three eighths of a litre in millilitres? 375 How many grams are there in three fifths of a kilogram? 600 What is 1/5 of a meter in centimeters? 20 What is 6738.265 years in decades? 673.8265 What is 8681.002 weeks in hours? 1458408.336 How many litres are there in 4.227059 millilitres? 0.004227059 What is 3/40 of a millennium in months? 900 What is 538.4296 weeks in nanoseconds? 325642222080000000 How many millilitres are there in 1/20 of a litre? 50 How many milligrams are there in 485.6948ug? 0.4856948 What is 1/10 of a litre in millilitres? 100 What is 1267.742g in milligrams? 1267742 How many milliseconds are there in 1/5 of a minute? 12000 How many millennia are there in 2698579.8 months? 224.88165 How many nanogra	{ "pile_set_name": "DM Mathematics" }
13324 rounded to 5 decimal places? -0.59231 Round -2001994.222 to the nearest 10000. -2000000 Round 0.0000008975857 to six dps. 0.000001 Round -0.000679255146 to 5 decimal places. -0.00068 Round 5220632910 to the nearest 1000000. 5221000000 What is 4.816598 rounded to zero dps? 5 Round 6577851.357 to the nearest 10000. 6580000 What is 1.124366 rounded to 1 dp? 1.1 What is 0.001535270261 rounded to six dps? 0.001535 What is 25165552 rounded to the nearest ten thousand? 25170000 Round 4363.1203 to the nearest one hundred. 4400 What is 66.119314 rounded to 0 dps? 66 Round -0.0003914338 to six decimal places. -0.000391 Round 2063579.16 to the nearest 100. 2063600 What is -174543435.1 rounded to the nearest one hundred thousand? -174500000 Round -560435.92 to the nearest one thousand. -560000 Round 1.43721394 to three decimal places. 1.437 Round -0.02234172008 to 5 dps. -0.02234 Round -0.000001094849819 to six decimal places. -0.000001 What is -595297.701 rounded to the nearest one hundred? -595300 What is -3568394.349 rounded to the nearest 1000? -3568000 Round -0.0004546623821 to 7 decimal places. -0.0004547 What is -0.000045747135 rounded to 7 decimal places? -0.0000457 Round 0.81565799 to four dps. 0.8157 Round 0.0000014032468 to six dps. 0.000001 Round 22756980700 to the nearest one million. 22757000000 Round -2.9038353 to two dps. -2.9 Round -1875163.46 to the nearest 1000. -1875000 Round -0.94700344 to 2 decimal places. -0.95 Round -0.002010495929 to five decimal places. -0.00201 What is -1158622.6 rounded to the nearest one hundred thousand? -1200000 Round 10540814.011 to the nearest one thousand. 10541000 Round 300.26598 to the nearest integer. 300 What is 5523110.997 rounded to the nearest 10000? 5520000 Round -0.0534758767 to 3 dps. -0.053 What is -0.00012505661 rounded to 6 decimal places? -0.000125 Round -17965480.4 to the nearest 1000000. -18000000 What is -23799460.3 rounded to the nearest one thousand? -23799000 What is 99055.5818 rounded to the nearest 1000? 99000 Round -1886.866494 to the nearest 10. -1890 Round 4125656.2 to the nearest 1000000. 4000000 Round 13.641341308 to 2 dps. 13.64 What is -0.00041728213 rounded to 5 decimal places? -0.00042 What is -138679509400 rounded to the nearest 1000000? -138680000000 Round -41.32448749 to the nearest integer. -41 Round -0.00006725710767 to 7 dps. -0.0000673 What is -0.678185651 rounded to three dps? -0.678 Round -128908465 to the nearest 10000. -128910000 Round -9.3946431 to the nearest integer. -9 What is 0.617174426 rounded to 1 decimal place? 0.6 Round 59371.3542 to the nearest 100. 59400 What is 0.0000035556571 rounded to five dps? 0 What is -531.505774 rounded to the nearest integer? -532 Round -27.165371 to the nearest integer. -27 What is -0.0000015459897 rounded to 7 dps? -0.0000015 What is -46479.76884 rounded to the nearest one hundred? -46500 What is 660.3388073 rounded to the nearest ten? 660 What is 4383614.4 rounded to the nearest 1000000? 4000000 Round 10125848.3 to the nearest 100000. 10100000 Round 11.1518362 to 3 decimal places. 11.152 Round -17195.6638 to the nearest 10. -17200 Round 0.00000604069543 to seven dps. 0.000006 What is -653.519004 rounded to 1 dp? -653.5 Round -0.00004341054393 to five dps. -0.00004 What is 2471.599133 rounded to 0 decimal places? 2472 What is 4255639.9 rounded to the nearest 10000? 4260000 What is 17.104689 rounded to one decimal place? 17.1 What is -5.2301921 rounded to one dp? -5.2 What is 211.133014 rounded to two decimal places? 211.13 Round -0.01078685977 to four dps. -0.0108 What is 0.17133415954 rounded to 6 decimal places? 0.171334 What is 0.15259587 rounded to 2 dps? 0.15 Round 3678.7751 to 1 dp. 3678.8 What is -8663838.1 rounded to the nearest one thousand? -8664000 What is -0.00007848689786 rounded to 5 dps? -0.00008 What is 11.23688933 rounded to two dps? 11.24 What is 7.43542 rounded to 2 dps? 7.44 Round -182413.6352 to the nearest ten. -182410 Round 27235.954 to the nearest one thousand. 27000 Round 4.99818807 to four decimal places. 4.9982 What is -788098920 rounded to the nearest 1000000? -788000000 What is -28234339170 rounded to the nearest one million? -28234000000 Round 0.01269637986 to four dps. 0.0127 What is -4772.5082 rounded to the nearest integer? -4773 Round -0.0000145096039 to seven decimal places. -0.0000145 Round -24.32816866 to 1 decimal place. -24.3 Round 0.00083239747 to 6 decimal places. 0.000832 What is -0.144165142 rounded to 4 decimal places? -0.1442 What is -84886.3601 rounded to the nearest ten thousand? -80000 Round 9450630.37 to the nearest 10000. 9450000 What is -129.8259731 rounded to the nearest integer? -130 Round 0.0650324031 to 2 dps. 0.07 Round -10390300.63 to the nearest 1000000. -10000000 What is -0.01471559572 rounded to 7 decimal places? -0.0147156 What is -0.013199019 rounded to four dps? -0.0132 What is 115891863 rounded to the nearest 100000? 115900000 What is -202.709555 rounded to one dp? -202.7 What is 81921899.25 rounded to the nearest 10000? 81920000 What is 887.48495 rounded to the nearest 10? 890 Round 11778023.5 to the nearest one million. 12000000 What is 0.001857502 rounded to 5 dps? 0.00186 What is -57532270.5 rounded to the nearest 10000? -57530000 Round 32321480.72 to the nearest 10000. 32320000 Round -0.0183336432 to 5 dps. -0.01833 What is -0.03071471791 rounded to 6 decimal places? -0.030715 What is 0.0000005633362 rounded to five decimal places? 0 Round -0.00098763017 to 6 decimal places. -0.000988 Round -0.0037858425 to 7 dps. -0.0037858 What is -0.025180384 rounded to four decimal places? -0.0252 Round -0.000281802039 to six dps. -0.000282 Round -0.0001117149954 to 6 dps. -0.000112 Round 5974687.25 to the nearest 1000. 5975000 Round -0.024151368 to 3 decimal places. -0.024 Round -393.90696 to the nearest integer. -394 What is -0.040709697 rounded to five dps? -0.04071 What is 0.0001334054231 rounded to 6 dps? 0.000133 What is 0.00101487264 rounded to five dps? 0.00101 Round -0.782985 to the nearest integer. -1 Round 1670814.24 to the nearest ten thousand. 1670000 What is 594903.9127 rounded to the nearest 100000? 600000 Round -0.000601982884 to seven decimal places. -0.000602 What is -0.005462292369 rounded to seven dps? -0.0054623 What is -0.02649097093 rounded to 4 decimal places? -0.0265 What is 18.2972461 rounded to three decimal places? 18.297 What is 569.6404829 rounded to 1 decimal place? 569.6 Round 7820603.26 to the nearest 1000000. 8000000 Round 1342114707.6 to the nearest 10000. 1342110000 Round 168.06240652 to the nearest ten. 170 What is 0.650321537 rounded to 4 decimal places? 0.6503 What is -33087.1703 rounded to the nearest ten thousand? -30000 Round 129344.602 to the nearest one hundred. 129300 What is -27.65172966 rounded to 1 decimal place? -27.7 Round 875095.312 to the nearest ten thousand. 880000 What is -931095.484 rounded to the nearest 1000? -931000 What is -126039588.9 rounded to the nearest one million? -126000000 What is 38466086.4 rounded to the nearest ten thousand? 38470000 Round -706378050 to the nearest one hundred thousand. -706400000 Round 0.0000550348764 to 7 decimal places. 0.000055 What is -1.678082347 rounded to two decimal places? -1.68 What is 229450.038 rounded to the nearest one hundred thousand? 200000 Round 0.000007465240919 to 6 dps. 0.000007 What is 3903.8473 rounded to the nearest ten? 3900 Round -3357.91191 to the nearest 100. -3400 What is -0.0152322605 rounded to four dps? -0.0152 What is -115898492 rounded to the nearest 10000? -115900000 What is -1.7556528 rounded to three dps? -1.756 Round -13033685.98 to the nearest 1000000. -13000000 Round 555.242653 to the nearest integer. 555 Round -349547.72 to the nearest 100. -349500 What is -6209.029 rounded to the nearest one thousand? -6000 What is 0.0155433186 rounded to four dps? 0.0155 Round 1070.29172 to the nearest 100. 1100 Round 0.0063255859 to 6 dps. 0.006326 Round -6008574.3 to the nearest ten thousand. -6010000 What is 0.0843211798 rounded to four decimal places? 0.0843 Round 218.255749 to the nearest 10. 220 What is 13.53071435 rounded to the nearest 10? 10 Round -532798.968 to the nearest ten thousand. -530000 Round -190.258872 to 2 dps. -190.26 Round	{ "pile_set_name": "DM Mathematics" }
+ 2) Solve 4d4 - 68d*3 - 228d*2 - 236d - 80 = 0. -1, 20 Factor 2c2 + 5160c - 5162. 2(c - 1)(c + 2581) Solve -2k2 + 2900k - 1051250 = 0. 725 Suppose -2d5 - 12d*4 - 4d*3 + 40d*2 + 54d + 20 = 0. What is d? -5, -1, 2 Factor 784j3 + 9296j*2 - 1340j + 48. 4(j + 12)(14j - 1)2 Factor -4n*3/3 - 356n*2/3 + 740n/3 + 364. -4(n - 3)(n + 1)(n + 91)/3 Let 52i*2/9 + 148i/3 - 24 = 0. Calculate i. -9, 6/13 What is h in 4h4 - 956h*3 + 54632h*2 + 303536h - 357216 = 0? -6, 1, 122 Let -w*2/3 - 2w/3 + 143/3 = 0. What is w? -13, 11 Solve 8n4 + 212n*3 - 108n2 = 0. -27, 0, 1/2 Find x, given that -x5/7 + 54x4/7 - 130x*3 + 4836x*2/7 - 7153x/7 + 3174/7 = 0. 1, 6, 23 Suppose -14n5/3 + 1636n*4/9 - 1514n*3/9 - 232n*2/9 + 152n/9 = 0. What is n? -1/3, 0, 2/7, 1, 38 What is z in 4z5/3 - 157z*4/3 + 479z*3/3 - 398z*2/3 + 24z = 0? 0, 1/4, 1, 2, 36 Factor -2z2 - 50z. -2z(z + 25) Suppose g*5/7 - 2g*4 + 68g*3/7 - 130g*2/7 + 75g/7 = 0. What is g? 0, 1, 3, 5 Solve 5s5 - 75s*4 + 255s*3 + 55s*2 - 1140s + 900 = 0 for s. -2, 1, 3, 10 What is d in -d*5 + 5768d*4 - 8328985d*3 + 33252518d*2 - 41541148d + 16611848 = 0? 1, 2, 2882 Factor -10l3/19 - 176l*2/19 - 738l/19 + 324/19. -2(l + 9)2(5l - 2)/19 Let w4 + 13w*3 - 35w*2 - 69w + 90 = 0. Calculate w. -15, -2, 1, 3 Factor -k*3/4 + 240k2. -k2(k - 960)/4 Suppose -p5 + 495p*4 + 3506p*3 + 4032p*2 - 8032p = 0. What is p? -4, 0, 1, 502 What is n in -4n2 - 40n - 100 = 0? -5 Factor -d*5 + 23d*4 + 230d*3 + 542d*2 + 491d + 155. -(d - 31)(d + 1)3(d + 5) Let 4a3 + 1108a*2 - 4a - 1108 = 0. Calculate a. -277, -1, 1 Let 2c3/17 + 166c*2/17 - 2c/17 - 166/17 = 0. Calculate c. -83, -1, 1 Let -20w3 + 55w*2 + 80w - 220 = 0. Calculate w. -2, 2, 11/4 Factor -5y4 + 300y*3 + 1280y*2. -5y*2(y - 64)(y + 4) Factor -3u*3 + 39u*2 - 96u + 60. -3(u - 10)(u - 2)(u - 1) Find k, given that 40k*4/3 + 176k*3/3 + 274k*2/3 + 58k + 12 = 0. -3/2, -1, -2/5 Factor -3n3 - 624n*2 - 31815n + 66150. -3(n - 2)(n + 105)*2 Factor 2q*2/11 + 24q/11 + 40/11. 2(q + 2)(q + 10)/11 Factor c*3/7 - 2c*2/7 - 13c - 88/7. (c - 11)(c + 1)(c + 8)/7 Factor 15i3 - 24i*2 - 33i + 42. 3(i - 2)(i - 1)(5i + 7) Factor 2c2 + 32c. 2c(c + 16) Factor -p*2 - 199p. -p(p + 199) Find k, given that -2k*5/5 + 2k*3/5 = 0. -1, 0, 1 What is t in 10t*4/3 + 12t*3 - 2t*2 - 64t/3 + 8 = 0? -3, -2, 2/5, 1 Let 3n2 + 102n + 867 = 0. Calculate n. -17 Factor -2c3 - 146c*2 - 2590c + 2738. -2(c - 1)(c + 37)*2 Factor -243c*5 + 34830c*4 - 1236420c*3 - 2503880c*2/3 - 186240c - 13824. -(c - 72)*2(9c + 2)3/3 Factor 5u*4 - 20u*2. 5u*2(u - 2)(u + 2) Suppose 27v*2/2 - 190v + 14 = 0. What is v? 2/27, 14 Factor -2h3/7 - 2h*2/7. -2h*2(h + 1)/7 Factor -g*3 - 4g*2 + 5g. -g(g - 1)(g + 5) Find z such that 2z4/5 - 22z*3/5 + 54z*2/5 - 10z + 16/5 = 0. 1, 8 Factor 5c2 + 3540c + 626580. 5(c + 354)2 Let 2o*3/9 + 8o*2/9 + 2o/3 = 0. What is o? -3, -1, 0 Suppose -k*3/7 - 5k*2/7 - k - 3/7 = 0. Calculate k. -3, -1 Determine t so that 2t*5/7 + 2t*4 + 34t*3/7 + 34t*2/7 + 12t/7 = 0. -3, -2, -1, 0 Suppose o*5 - 21o*4 - 25o*3 + 61o*2 + 108o + 44 = 0. Calculate o. -1, 2, 22 Suppose -3g2 + 24g - 21 = 0. Calculate g. 1, 7 Solve -2f2 + 811f + 406 = 0. -1/2, 406 Factor -2y2 + 22y - 56. -2(y - 7)(y - 4) Factor -45u3 + 525u*2 - 1160u + 720. -5(u - 9)(3u - 4)2 Let -2f*3 + 36f*2 + 50f - 228 = 0. Calculate f. -3, 2, 19 Solve 2q4 + 44q*3 + 194q*2 - 528q + 288 = 0. -12, 1 Find h such that -3h5 + 9h*4 + 51h*3 - 45h*2 - 264h - 180 = 0. -2, -1, 3, 5 Solve 9n5/4 + 91n*4/2 + 13n*3/4 - 132n*2 + 61n + 20 = 0 for n. -20, -2, -2/9, 1 Let 5u5 - 85u*4 - 415u*3 + 1925u*2 + 7250u + 5000 = 0. What is u? -5, -2, -1, 5, 20 Let -5l2/8 - 21l/8 - 2 = 0. What is l? -16/5, -1 Solve 5d4 + 4d*3 - 19d*2 - 18d = 0. -9/5, -1, 0, 2 Factor -b4 - b3 + b*2 + b. -b(b - 1)(b + 1)2 Find j such that -4j*3 - 60j*2 - 56j = 0. -14, -1, 0 Determine s, given that 2s3 + 6672s*2 + 7419264s + 2750073856 = 0. -1112 Factor 2x4 - 38x*3 - 2x*2 + 38x. 2x(x - 19)(x - 1)(x + 1) Suppose 2p3 - 510p*2/11 - 436p/11 + 96/11 = 0. Calculate p. -1, 2/11, 24 Factor -2d3/11 + 12d*2/11 - 16d/11. -2d(d - 4)(d - 2)/11 Suppose -a3/3 + 3a*2 - 8a + 16/3 = 0. What is a? 1, 4 Factor 5k3/3 + 20k*2/3 - 35k. 5k(k - 3)(k + 7)/3 Factor -6m*4 - 23m3/4 + m2/4. -m*2(m + 1)(24m - 1)/4 Find q, given that 2q5 + 4q*4 - 24q*3 + 28q*2 - 10q = 0. -5, 0, 1 Find c, given that c*4/5 - 172c*3/5 + 327c*2/5 + 440c + 340 = 0. -2, -1, 5, 170 Solve -20s5 + 568s*4 - 1712s*3 + 264s*2 + 900s = 0. -3/5, 0, 1, 3, 25 Find x such that -4x5 - 8x*4 + 8x*2 + 4x = 0. -1, 0, 1 Find w such that 4w5 - 52w*4 - 284w*3 + 164w*2 + 712w - 544 = 0. -4, -2, 1, 17 Factor -u4/5 - u3. -u*3(u + 5)/5 Factor m*4 + 4m*3 - 2m*2 - 12m + 9. (m - 1)*2(m + 3)2 What is s in -s4/2 - 69s3 - 2380s*2 + 69s + 4761/2 = 0? -69, -1, 1 Factor -8y4 - 50y*3 - 108y*2 - 88y - 16. -2(y + 2)3(4y + 1) Let j3/2 + 105j*2/2 = 0. What is j? -105, 0 Find x, given that -5x*4 - 140x*3 - 1065x*2 - 650x + 6760 = 0. -13, -4, 2 Factor -12d2 + 2110d + 352. -2(d - 176)(6d + 1) What is d in 4d*5 - 2d*4 - 23d*3/4 + 3d*2/2 + 9d/4 = 0? -3/4, 0, 1 Factor n*2 - n - 156. (n - 13)(n + 12) Let 22k5 - 112k*4 + 10k*3 = 0. What is k? 0, 1/11, 5 Factor 2z*2 - 14z - 60. 2(z - 10)(z + 3) Suppose -n*2/3 + 1675n/3 - 558 = 0. Calculate n. 1, 1674 What is m in 2m5 - 4m*4 - 22m*3 + 24m2 = 0? -3, 0, 1, 4 Let -t2 + 474t - 56169 = 0. What is t? 237 Determine t so that -t3/3 - 8t*2 = 0. -24, 0 Factor 3t*2 - 1506t + 189003. 3(t - 251)2 Factor -w5 - 5w*4 - 8w*3 - 4w2. -w2(w + 1)(w + 2)*2 Suppose -2u*5/7 - 94u*4/7 - 118u*3 - 1202u*2/7 + 828u/7 + 1296/7 = 0. What is u? -36, -9, -2, -1, 1 Suppose -3f5 + 9f*4 + 63f*3 - 129f*2 - 288f + 540 = 0. Calculate f. -3, 2, 5 Determine y, given that y4 - y3 = 0. 0, 1 Factor 2q4/21 + 56q*3/3 + 18812q*2/21 - 1848q + 6534/7. 2(q - 1)2(q + 99)2/21 Determine l so that l2/4 + 5l = 0. -20, 0 Factor 2p*3 + 4p*2. 2p*2(p + 2) Factor -580w2 - 612w - 32. -4(w + 1)(145w + 8) Factor 9w*3/7 - 24w*2/7 + 12w/7. 3w(w - 2)(3w - 2)/7 Factor 3d3/7 - 159d*2/7 - 3d/7 + 159/7. 3(d - 53)(d - 1)(d + 1)/7 Factor -q3/3 + 37q*2/3 - 280q/3 - 400. -(q - 20)*2(q + 3)/3 Factor -p*4 + 3p*3 + 382p*2 - 3552p + 3168. -(p - 12)*2(p - 1)(p + 22) What is t in -3t*4/5 + 2t*3/5 + 9t*2/5 - 12t/5 + 4/5 = 0? -2, 2/3, 1 Factor 2w2 - 796w + 79202. 2(w - 199)2 Factor 4r*2 - 136r - 2688. 4(r - 48)(r + 14) Factor -3f4 - 27f*3 + 141f*2 - 189f + 78. -3(f - 2)(f - 1)*2(f + 13) What is d in -4d5 + 46d*4 + 150d*3 - 2954d*2 + 4214d + 20580 = 0? -15/2, -2, 7 Find n such that n*3/7 - 53n*2/7 + 328n/7 - 276/7 = 0. 1, 6, 46 Factor 5b2 + 79120b + 312998720. 5(b + 7912)2 Factor -2c*4 - 34c*3 + 82c*2 + 114c. -2c(c - 3)(c + 1)(c + 19) What is y in -y5/6 + y4/3 + 11y3/6 - 2y*2 = 0? -3, 0, 1, 4 Solve 2v*2/5 - 12v/5 + 2 = 0. 1, 5 What is n in n*3/6 - 15n*2 - 679n/6 = 0? -7, 0, 97 Find q such that -q*2/10 + 731q/5 - 534361/10 = 0. 731 Factor -z*5 + 32z*4 + 178z*3 + 256z*2 + 111z. -z(z - 37)(z + 1)*2(z + 3) Factor -5f2 + 175f - 870. -5(f - 29)(f - 6) Factor 2i2/9 + 10i/3 + 52/9. 2(i + 2)(i + 13)/9 What is k in k*4 + 18k*3 + 101k*2 + 132k - 252 = 0? -7, -6, 1 What is i in i*3/4 + 11i*2/4 + 39i/4 + 45/4 = 0? -5, -3 Let 3u2/2 + 933u + 290163/2 = 0. What is u? -311 Factor 2x3 + 158x*2 + 2358x + 9882. 2(x + 9)2(x + 61) What is i in -3i5 + 15i*4 - 9i*3 - 15i*2 + 12i = 0? -1, 0, 1, 4 Suppose 45a5 + 330a*4 + 515a*3 - 150a*2 - 540a - 200 = 0. Calculate a. -5, -2, -2/3, 1 Solve -2v3 - 8v**2 + 6	{ "pile_set_name": "DM Mathematics" }
AM What is 39 minutes after 1:23 PM? 2:02 PM What is 609 minutes before 3:48 PM? 5:39 AM How many minutes are there between 3:53 PM and 3:02 AM? 669 What is 677 minutes after 1:39 AM? 12:56 PM What is 136 minutes before 8:33 AM? 6:17 AM What is 595 minutes after 4:56 PM? 2:51 AM What is 310 minutes after 11:41 AM? 4:51 PM What is 250 minutes after 1:55 PM? 6:05 PM What is 49 minutes before 5:26 PM? 4:37 PM What is 496 minutes before 3:55 PM? 7:39 AM What is 120 minutes after 1:08 AM? 3:08 AM What is 700 minutes before 11:57 AM? 12:17 AM What is 244 minutes before 8:23 AM? 4:19 AM How many minutes are there between 5:04 PM and 10:59 PM? 355 What is 62 minutes after 11:48 AM? 12:50 PM How many minutes are there between 9:32 PM and 1:45 AM? 253 How many minutes are there between 7:12 PM and 1:46 AM? 394 What is 406 minutes after 3:41 AM? 10:27 AM How many minutes are there between 1:18 PM and 8:30 PM? 432 What is 525 minutes before 8:05 PM? 11:20 AM How many minutes are there between 1:02 PM and 10:19 PM? 557 What is 48 minutes before 11:26 PM? 10:38 PM What is 296 minutes after 6:46 AM? 11:42 AM What is 302 minutes after 7:47 PM? 12:49 AM How many minutes are there between 5:03 AM and 6:45 AM? 102 How many minutes are there between 9:40 AM and 4:48 PM? 428 How many minutes are there between 12:38 PM and 9:45 PM? 547 How many minutes are there between 4:54 PM and 5:48 PM? 54 How many minutes are there between 4:06 PM and 5:34 PM? 88 How many minutes are there between 10:14 PM and 6:19 AM? 485 What is 136 minutes after 1:06 AM? 3:22 AM What is 209 minutes before 6:21 PM? 2:52 PM How many minutes are there between 5:07 PM and 2:26 AM? 559 What is 406 minutes before 6:38 PM? 11:52 AM What is 324 minutes before 9:15 PM? 3:51 PM How many minutes are there between 8:56 AM and 4:34 PM? 458 What is 641 minutes after 10:14 AM? 8:55 PM How many minutes are there between 3:43 PM and 4:31 PM? 48 How many minutes are there between 10:05 PM and 9:06 AM? 661 How many minutes are there between 5:44 AM and 11:26 AM? 342 How many minutes are there between 4:38 PM and 6:54 PM? 136 What is 48 minutes after 4:16 AM? 5:04 AM What is 304 minutes after 4:58 PM? 10:02 PM What is 592 minutes before 3:47 PM? 5:55 AM How many minutes are there between 1:55 PM and 9:38 PM? 463 What is 406 minutes after 6:02 AM? 12:48 PM What is 588 minutes after 4:21 AM? 2:09 PM How many minutes are there between 3:54 PM and 1:11 AM? 557 How many minutes are there between 10:44 PM and 7:12 AM? 508 What is 419 minutes after 9:35 PM? 4:34 AM What is 291 minutes before 5:12 AM? 12:21 AM How many minutes are there between 9:10 PM and 8:49 AM? 699 How many minutes are there between 2:46 PM and 1:55 AM? 669 How many minutes are there between 12:07 PM and 9:48 PM? 581 How many minutes are there between 7:04 AM and 3:15 PM? 491 How many minutes are there between 5:37 PM and 6:54 PM? 77 What is 576 minutes after 3:21 PM? 12:57 AM How many minutes are there between 11:11 PM and 6:01 AM? 410 What is 507 minutes after 5:27 AM? 1:54 PM How many minutes are there between 3:26 PM and 12:33 AM? 547 How many minutes are there between 2:40 AM and 10:13 AM? 453 What is 101 minutes before 10:19 PM? 8:38 PM What is 416 minutes before 7:34 PM? 12:38 PM What is 235 minutes before 4:56 PM? 1:01 PM How many minutes are there between 5:08 AM and 7:54 AM? 166 What is 223 minutes before 7:10 PM? 3:27 PM How many minutes are there between 5:36 AM and 10:40 AM? 304 How many minutes are there between 9:55 AM and 8:31 PM? 636 What is 270 minutes after 8:58 PM? 1:28 AM What is 502 minutes after 3:48 AM? 12:10 PM How many minutes are there between 7:11 PM and 3:19 AM? 488 How many minutes are there between 4:22 AM and 1:02 PM? 520 How many minutes are there between 4:54 AM and 2:11 PM? 557 How many minutes are there between 4:20 AM and 2:09 PM? 589 How many minutes are there between 5:46 PM and 11:40 PM? 354 What is 423 minutes after 6:52 PM? 1:55 AM How many minutes are there between 7:56 PM and 4:18 AM? 502 How many minutes are there between 2:41 AM and 2:18 PM? 697 How many minutes are there between 6:10 AM and 8:35 AM? 145 What is 620 minutes before 5:00 PM? 6:40 AM What is 302 minutes after 3:18 AM? 8:20 AM How many minutes are there between 10:43 AM and 7:52 PM? 549 How many minutes are there between 7:07 AM and 10:11 AM? 184 How many minutes are there between 3:18 AM and 8:27 AM? 309 What is 331 minutes after 11:50 AM? 5:21 PM What is 526 minutes after 9:36 PM? 6:22 AM How many minutes are there between 11:11 PM and 1:08 AM? 117 How many minutes are there between 4:09 PM and 4:59 PM? 50 How many minutes are there between 9:29 AM and 11:37 AM? 128 What is 121 minutes before 2:10 AM? 12:09 AM What is 639 minutes before 1:25 PM? 2:46 AM How many minutes are there between 6:26 AM and 4:31 PM? 605 How many minutes are there between 10:20 AM and 11:02 AM? 42 What is 313 minutes before 4:35 AM? 11:22 PM How many minutes are there between 8:23 AM and 11:38 AM? 195 How many minutes are there between 11:41 AM and 12:01 PM? 20 What is 289 minutes after 5:51 AM? 10:40 AM What is 39 minutes before 4:24 AM? 3:45 AM How many minutes are there between 3:09 PM and 6:24 PM? 195 What is 446 minutes before 1:54 AM? 6:28 PM What is 191 minutes after 5:16 AM? 8:27 AM What is 401 minutes before 6:34 PM? 11:53 AM How many minutes are there between 1:47 AM and 4:38 AM? 171 How many minutes are there between 4:52 PM and 5:02 PM? 10 How many minutes are there between 4:41 PM and 11:42 PM? 421 How many minutes are there between 4:22 PM and 7:49 PM? 207 What is 719 minutes before 6:53 AM? 6:54 PM What is 302 minutes before 4:35 AM? 11:33 PM What is 110 minutes before 5:21 PM? 3:31 PM How many minutes are there between 9:09 AM and 5:02 PM? 473 What is 279 minutes before 10:02 PM? 5:23 PM How many minutes are there between 3:49 AM and 7:52 AM? 243 How many minutes are there between 6:08 AM and 11:25 AM? 317 What is 610 minutes before 7:04 AM? 8:54 PM What is 459 minutes before 8:56 AM? 1:17 AM How many minutes are there between 2:08 PM and 11:32 PM? 564 What is 688 minutes after 1:22 PM? 12:50 AM How many minutes are there between 5:34 PM and 8:21 PM? 167 What is 251 minutes before 2:09 AM? 9:58 PM What is 708 minutes before 5:31 AM? 5:43 PM How many minutes are there between 2:33 AM and 2:52 AM? 19 How many minutes are there between 8:35 AM and 12:39 PM? 244 How many minutes are there between 9:26 AM and 12:48 PM? 202 How many minutes are there between 12:22 PM and 1:22 PM? 60 How many minutes are there between 2:45 PM and 8:16 PM? 331 What is 680 minutes after 1:24 AM? 12:44 PM What is 69 minutes before 2:56 AM? 1:47 AM How many minutes are there between 6:22 AM and 12:36 PM? 374 What is 217 minutes after 8:38 AM? 12:15 PM How many minutes are there between 12:05 PM and 9:18 PM? 553 What is 591 minutes before 11:26 AM? 1:35 AM How many minutes are there between 8:47 PM and 12:50 AM? 243 How many minutes are there between 6:30 AM and 5:48 PM? 678 How many minutes are there between 5:22 AM and 6:39 AM? 77 How many minutes are there between 3:37 PM and 9:36 PM? 359 What is 175 minutes after 10:36 PM? 1:31 AM What is 652 minutes after 1:02 PM? 11:54 PM What is 586 minutes after 5:15 PM? 3:01 AM What is 6 minutes after 7:13 PM? 7:19 PM What is 144 minutes after 11:36 AM? 2:00 PM What is 279 minutes before 12:28 PM? 7:49 AM What is 252 minutes after 4:47 AM? 8:59 AM What is 40 minutes before 10:16 PM? 9:36 PM How many minutes are there between 10:45 AM and 6:31 PM? 466 How many minutes are there between 11:10 PM and 5:55 AM? 405 What is 647 minutes before 7:35 AM? 8:48 PM How many minutes are there between 2:39 PM and 9:40 PM? 421 What is 678 minutes after 4:41 PM? 3:59 AM What is 331 minutes before 1:37 PM? 8:06 AM What is 672 minutes before 8:25 PM? 9:13 AM How many minutes are there between 5:42 AM and 5:22 PM? 700 How many minutes are there between 5:46 AM and 12:36 PM? 410 What is 286 minutes before 10:42 AM? 5:56 AM How many minutes are there between 5:16 AM and 12:58 PM? 462 How many minutes are there between 2:00 PM and 8:27 PM? 387 How many minutes are there between 9:52 PM and 8:44 AM? 652 How many minutes are there between 3:25 PM and	{ "pile_set_name": "DM Mathematics" }
Suppose 3l = 4s - o - 18, 3s - 4 = -4l. Which is smaller: -3 or l? -3 Let p = -45 - -35.4. Let w = 81.6 + p. Let l = w - 74.1. Is -2/5 > l? True Let v(i) = 1037i2 - 12i - 10. Let b be v(-1). Which is bigger: 1038 or b? b Let j = -245 - -1. Let k = -401 - j. Which is bigger: -156 or k? -156 Let o = 152.75 + -1.75. Let n = -151.2 + o. Which is bigger: 18 or n? 18 Suppose 3y = 11q + 8, -4y = -2q + 6 - 4. Which is bigger: y or 2/5573? 2/5573 Suppose 2a = 7r - 4r - 3, 2a + 5r + 11 = 0. Let g(k) = 42k + 196. Let b be g(a). Is b at least as big as 70? True Suppose 22 - 49 = -14v - 41. Which is smaller: 9/653 or v? v Let v be -164 - (7 - (-10)/(-5)). Let a = 1525/9 + v. Are 0 and a equal? False Let r = -257408/83 + 3101. Let v = -5251/18260 - r. Which is smaller: 1 or v? v Suppose 9s + 1094 = -328. Let d = s + 139. Is -17 greater than d? True Let h = -0.043 + 0.263. Let t = 1.42 - h. Let x = 0.8 - t. Do x and -7 have different values? True Let c = 138/5 - 27. Let g = -71 - -145/2. Which is greater: g or c? g Let i be (9/(-36))/(2/664). Let x = i - -77. Which is smaller: -90/13 or x? -90/13 Let j = 38.81 + -39. Let d(f) = f*3 + 8f*2 - f + 38. Let l be d(-9). Let p be (-2)/4 + (-17)/l. Which is greater: p or j? p Let b(q) = -2q + 1 + 10q + 2 - q. Let y be b(-2). Let x = -10 - y. Is x bigger than -2/45? True Suppose -p = -4 + 3. Let k(q) = 5q + 1. Let g be k(p). Let d = 0.0602 - -0.9398. Is g at least as big as d? True Let v be ((-75)/(-210))/((-30)/24) - 368/(-1582). Is 9 < v? False Suppose 3d = i - d + 13, -2i + 4 = 2d. Let v be (2 - -2 - i)(-24)/20. Let r be (-7 - v)2/(4 + -2). Which is greater: -11/9 or r? r Suppose 2a = 4t + 16, 7t - 5t = 2a - 14. Suppose -a = 2v, n + v - 2v = 37. Are n and 31 non-equal? True Let g = 4.299 - 5.299. Which is bigger: -262.6 or g? g Suppose 2c - 13 = 3m, -5c + m + 23 = -2c. Let h be ((-96)/(-12))/c2/(-6). Which is greater: h or -1/4? -1/4 Suppose -19q - 17q = -5760. Suppose qp - 163p + 198 = 0. Which is smaller: p or 63? 63 Suppose 2n + 10 - 16 = 3m, 4m = 5n - 15. Suppose 8o = 3o - nt - 228, -2o - 3t - 84 = 0. Let p be 3404/(-10). Does o = p? True Let z = 1.12 - 61.32. Let b = z - -60. Which is smaller: b or -116? -116 Let n = -9647.89 - -9648. Let i be 5/(-2) - 3/(-6). Let w = i - -1. Which is greater: w or n? n Suppose 0 = -17g - 84 + 228 + 519. Are g and 39 unequal? False Let n = 52 + -56. Let w be (((-240)/(-39))/n)/14. Which is bigger: 1 or w? 1 Suppose 0 = 2i - 8, 23 + 20 = -3o + i. Which is smaller: 6 or o? o Let l = -20 + 36. Suppose -2s + 6s - 300 = 0. Suppose -s = -5x - 5d, 2d + 35 - 11 = x. Is l <= x? True Let h = 241/9042 + 1/274. Suppose a - 300 = 2l, a - l = -101 + 405. Let f = -308 + a. Which is bigger: f or h? h Let l be -4 - 554(-72)/(-44). Let i = l + 907. Is -3 smaller than i? False Let v(t) = -4t + 4. Suppose -8k + 8 = -0k. Let s be v(k). Suppose s = 6d - 3d. Which is greater: d or 3/10? 3/10 Suppose -36686q = 5x - 36690q - 315, -5 = -x - 5q. Let y = 1948/3 + -1784/3. Which is smaller: y or x? y Let b(c) = -14c - 126. Let t be b(-9). Let k = 107 - 274. Which is greater: t or k? t Let w(p) = 25p2 + p + 1. Let v be w(-1). Let n(a) = 11a + 78. Let z be n(-3). Suppose -50r - v = -zr. Do -0.03 and r have the same value? False Let o be 20/(-168)-6 + 289255/(-405055). Which is smaller: -1 or o? -1 Let t = 30263/65 + -2321/5. Let u = t - 368/247. Is -8/3 bigger than u? False Suppose -7h - 640 = 121h. Which is smaller: h or -55/14? h Let m = 135 + -681/5. Let o = -4093/742 + 6/371. Which is bigger: o or m? m Let m = 5204 + -5244. Is -26 less than m? False Let v = 57 - 57.051. Let x = 0.06 + v. Let j = x - 1.009. Is 0 bigger than j? True Let y be -3(-66)/(-9)(-4 + 2). Let p = 59 - y. Let o be (-10)/p - 5/(-3). Is o > 30? False Let p = -1.2 - -1. Let u = 309 + -308.527. Let h = u + 1.927. Which is smaller: h or p? p Suppose 3z - 2020 = -4x, -4z - 586 = 5x - 3110. Suppose -18s = x + 1598. Do s and -117 have the same value? True Let y = -901 - -501. Let b = -697 - y. Are b and 1 non-equal? True Let u = 3539 - 1564. Which is bigger: 1973 or u? u Let w(p) = p*3 - p. Let a be w(0). Let n = -1.0299 - 171.9801. Let z = 173 + n. Is a less than or equal to z? False Let r be 1(-5)/(-10)94. Suppose -4u + 29 + r = 0. Suppose -u = 3c + 35. Is -16 >= c? True Let k = 3615 + -3647. Is -49 less than k? True Suppose -5n + 2n = -6. Let h = 107 - 99. Let q be (0 - 2) + (4 + h)/4. Is q >= n? False Suppose 24t = -574 + 790. Suppose 3 + 57 = 4o - 4s, -3o = 4s - 10. Suppose -2q + o + 6 = 0. Which is smaller: q or t? q Let z(j) = 0j + 9j - 31j - 47 - j*2. Let u be z(-19). Is 11 at least u? True Let b be 1/12((-389 - 7)/(-18) - 12). Which is smaller: -1597 or b? -1597 Let m(c) = 2694c - 16. Let t be m(1). Suppose 0 = -20v + t + 302. Is v smaller than 150? True Let x be (-2)/11 - (-342)/661. Let o be -2(x/(-2) + 2). Which is smaller: -4/41 or o? -4/41 Let r = -70 - -11. Let s = 87 + r. Let n = 30 - s. Is n < 0.22? False Let t = -1035 + 727. Let g = t - 113. Is -421 at most g? True Let m(i) = 193i - 6976. Let p be m(36). Is p greater than 37? False Suppose -3k = 204 + 147. Let j = 81 + k. Suppose 54 - 5 = -2v + 5i, v + 2i = -47. Is j greater than or equal to v? True Let z = -16085/4 - -4021. Is z at most as big as -19? False Let t be -3 - (1 + 191/(-142))/(831/7202). Which is greater: t or -1.5? t Let x be -4 - (-207)/45 - (-27762)/(-70). Which is smaller: -5/4 or x? x Let m = -9006/13 - -6925640/9997. Is m not equal to 0? True Let g be (36/8)/(9/30). Let n be (g/140)/(45/24). Which is greater: -1 or n? n Suppose 4s + 17 = 1. Let a be (-108)/s(-1)/((-1)/(-1)). Let p be (-4a/2)/(-3 + 2). Is p less than -55? False Let x be (-279)/(-155)(-23)/11. Let g = -70/11 - x. Let i = -2.8 + 3. Is i at least g? True Let l = 42.781 + -43. Let u = -0.079 - l. Are -1 and u non-equal? True Let p be (165/(-132))/((-5)/8). Suppose q - p = o - 0, q - 5o = 6. Is -5.2 > q? False Let y = 133357/6 + -22226. Let z = 2 + -3. Which is bigger: z or y? y Suppose k = k + 20k + 53700. Is k < -2681? True Suppose 11t = -0t. Suppose -8f - f - 4f = t. Which is greater: -4/57 or f? f Let h(g) = 2g*2 + 107g - 461. Let v be h(4). Let p = 21 - 15.8. Let w = p - 5. Which is smaller: w or v? v Suppose -48n = -51n + 47n + 20240. Is n equal to -443? False Suppose -y - 4z = -13, 15 = 5y - 3z - 2z. Suppose yp - 14 = -19. Let v be ((-4)/32)/((-3)/4). Which is smaller: v or p? p Suppose 18355 - 18307 = -48y. Which is smaller: -13/246 or y? y Let o be 2/(-4) - 43/(-2). Let a = 354 + -352. Suppose -8j = -aj - 126. Is j greater than o? False Suppose 991 - 948 = -43a. Is -20/869 >= a? True Suppose 4i + 1344 = 2s, 0 = -3s + 5i + 619 + 1402. Let v = 681 - s. Is v equal to 103/8? False Let n(v) = -v*3 + 6v*2 + 15v - 8. Let x be n(10). Let c = x + 259. Which is smaller: 0 or c? 0 Let o be (-392)/73511030/40. Are 0.1 and o nonequal? True Suppose 4y - 10q = -14q + 156, 0 = -2y - 4q + 68. Let u = -26.1 + -5.9. Let w = 31.9 + u. Which is smaller: y or w? w Let s = -85 - -98. Suppose 0 = 15o - 25o + 160. Which is smaller: o or s? s Let j be (-1 - -1)/(-8 - -9). Let k be (j - 3) + (-77)/(-42). Suppose 713m = 722m. Is m less than k? False Let h be 8/(-12)(370 - 22). Which is smaller: -224 or h? h Let z(m) = 53m*3 + 15m*2 - 52m - 257. Let a be z(-6). Is a at least -10852? False Suppose -97u + 187 = -172u + 92u. Is u greater than 8/3? True Let v be 5 - 138/(-8) - (-10 - -5 - -8). Is v at least as big as 19? True Let v = -167 - -167. Suppose -d - 1 - 1 = 0. Let w be (d - -1)/((-200)/(-24)). Which is smaller: v or w? w Let o(h) = 2h*2 - 10h + 8. Let f be o(5). Suppose 342 = 5u - 3y, 3u + fy - 212 = 3y. Are 68 and u nonequal? True Let n be (-18785)/(-11) - 33/(-66)2/(-1). Which is smaller: n or 1707? n Suppose 3o - o - 9 = b, -b + 21 = 4o. Suppose or + 4u = -167, -4r = r - 3u + 146. Let a = -327 - -298. Is a smaller than r? False Let t = 5315017 + -15960995803/3003. Let o = 2/91 - t. Which is smaller: o or 1/13? o Let d be 3/2*(-2486)/(-2712). Which is bigger: d or -128? d Let u = -469 - -471.2. Let f be -3 + -1 +	{ "pile_set_name": "DM Mathematics" }
(c) 0.5 b Let w = -1183.3 - -1184. What is the closest to 1 in -2, -1, -2/7, w? w Let r = 9.2 + -6.3. Let k = -0.1 - r. Suppose 6d - 9d - 3 = 0. What is the closest to d in 5, k, -0.1? -0.1 Let h = 1 - 1.4. Let k = -61 + 59. Which is the closest to k? (a) 0.3 (b) 2/21 (c) h c Let j = -5 - -5. Let k(c) = c*2 + 14c - 3. Let l be k(-11). Let b = 145/4 + l. What is the closest to j in b, -2/9, -0.5? -2/9 Let h be 2/(-6) + (5382/27 - 5). Let d = h + -1360/7. Which is the closest to -1? (a) -1/14 (b) d (c) -0.5 c Let g = 1 + -0.9. Let v = -3092 - -3091.8. Which is the closest to 1/2? (a) -2/5 (b) g (c) v b Let w = -436 - -436.5. Which is the closest to 0.09? (a) w (b) 2 (c) 0.1 c Let d be (2/(-40))/(7/((-168)/(-9))). Let g(w) = 2w - 1. Let i be g(1). Which is the closest to -2? (a) d (b) 4 (c) i a Let f = 0.002 + -0.212. Let n = 0.61 + f. What is the nearest to -1/2 in n, -4, -0.1? -0.1 Suppose 5s + 5u - 3 = 7, 2s + 5u = 4. Suppose 3d = -2q + 17, -3q = 3d + sd - 25. Suppose -5z = -qz. What is the nearest to z in -1/4, -1, 0.5? -1/4 Suppose 5h = h + 5h. What is the nearest to 5 in 3, h, 6? 6 Let x be 3 + -6 + (-35)/(-15). Let v = -2.99 - 0.01. What is the nearest to x in -3/2, 1/3, v? -3/2 Let l = -33.15 + 33. Let r = l - 1.85. What is the closest to -0.1 in 3, r, 0.5? 0.5 Let u = -4 - -7. Let m be (-2)/4 - 0/u. Suppose 0 = 45t + 8t. Which is the closest to t? (a) -0.2 (b) m (c) -3/2 a Let p = 0.6 + -0.3. Suppose 9 = 3x + u - 34, -4u = -5x + 83. Let v be 20/x(-39)/(-18) - 3. Which is the closest to -0.1? (a) 3 (b) v (c) p b Let h = 6 - 4. Let z = -944 - -10380/11. Which is the nearest to -0.1? (a) 3 (b) h (c) z c Let y = 163 + -133. Suppose -28 = o - y. Which is the nearest to -0.2? (a) 0.3 (b) 1/3 (c) o a Let v = 68 + -72. Which is the closest to -0.2? (a) v (b) -1.8 (c) 1 c Let p = 6 + -3. Let f be (-11 + -4)/((-3)/2). Let w = f + -31/3. Which is the closest to -0.1? (a) w (b) p (c) -0.3 c Let k(j) = 61j - 368. Let z be k(6). Let h = 0 - 1. Which is the closest to -1? (a) z (b) h (c) -3/2 b Let r = 9 + -4. Let i = r - 6. Let h = -13 + 16. What is the nearest to h in i, -1/2, -1/5? -1/5 Let p = -314 - -179. Which is the nearest to 0? (a) -0.4 (b) p (c) -1 a Let f = 17.28 + -17.38. What is the nearest to 2 in -3/7, -2/13, f, -0.4? f Let z = -5/26 + -4/13. Let g = 0.38 - -0.02. Which is the nearest to z? (a) 0 (b) g (c) 2 a Let j = 0.0054 + -5.0054. Let m = -0.5 - -0.3. Let n = -0.1 - m. Which is the closest to n? (a) j (b) 2 (c) 3 b Let z be (0 + -3)-2 + 233 + -242. Which is the closest to -2/19? (a) -1/4 (b) 4 (c) z (d) -2 a Let f be (-8 + 2)(-2)/(-4). Let u be (f/(-21) - (-64)/(-7)) + -2. Which is the closest to 1/4? (a) 3/7 (b) 0.4 (c) u b Let r be (874/(-57) - -18)/((-1)/(-6)). Which is the nearest to 1/2? (a) r (b) -0.03 (c) 1 c Let a = 13.6 - 13.8. What is the closest to a in 2/15, 55, -1/5? -1/5 Let i = 92 + -646/7. Let l = -1.8 + 1. Let w = 0.4 + l. Which is the closest to i? (a) 4 (b) w (c) -3/2 b Suppose -h + 12h = 3465. Let d = -4097/13 + h. Let f = -0.38 - -0.08. Which is the nearest to 0.1? (a) d (b) -1/4 (c) f a Let a = 136/207 + -10/23. What is the nearest to a in 4/7, -1, 1/5, -2/7? 1/5 Let i = -0.03 - 4.97. Let f be (72/273)/2 + (-2)/(-13). What is the closest to f in i, 2, 0.3? 0.3 Let j = 0.5 + -0.3. Let a = -1907 + 1908. What is the closest to a in j, 33, 3? j Let x = -1.291 - -1.26. Let w = x - -5.031. Let i = -1/35 - -73/105. What is the nearest to i in w, -1, 1/3? 1/3 Let s be (-12928)/(-18382) + (-4)/(-26). Let m = 3.06 + -0.06. Which is the closest to 2? (a) s (b) m (c) -1/34 b Suppose -5u + 2k - 3 = 0, 0 = 2u - 5k + 23 - 5. Which is the closest to -1? (a) -10/11 (b) 0.2 (c) u a Let i = -18 - -19. Let n = -139/99 + 13/11. Which is the closest to 2? (a) n (b) i (c) 0.5 b Let u = 257 - 256. Let v be (4/(-30))/((-4)/20). What is the closest to u in -2, 0, v? v Suppose 4k = -5r + 38, -6 = -5r + k + 47. Let d = -7.188 - -6.788. Which is the nearest to -1? (a) r (b) -1 (c) d b Let q be -2 + -5 + (-57)/(-9). Let d = 1 - 0.9. What is the closest to q in 0.3, -1, d? -1 Let h be 1 - 2 - 0/5. Suppose -13 + 49 = -g. Which is the closest to h? (a) 2 (b) g (c) -3/7 c Let l = 22.16 + -19.16. Which is the nearest to -2/7? (a) -1/4 (b) l (c) -4 (d) -0.13 a Let c = -4 + 3.6. Suppose -w - 3w + 24 = 0. Suppose 0 = wy - 10y. What is the nearest to -1 in y, 1/4, c? c Let x = 6 + 2. Let w = x + -13. Let v = 4 - 4. Which is the closest to v? (a) 0.5 (b) -4 (c) w a Let b = 69 + -343/5. Let h = -3.481 - -3.081. What is the closest to b in -3, h, -2? h Let k(n) = n*2 + 2n - 21. Let s be k(-6). Let w = 48 + -50. What is the closest to 0.1 in s, 0.1, w? 0.1 Let l = -11 + 6. Let n = -0.1 - 0. Let z = -1.46 + 1.46. What is the closest to z in n, l, 0.14? n Let h = -836.8 - -834. Which is the closest to -2? (a) h (b) -5 (c) 0.2 a Let g = -2215 + 2235. Which is the nearest to -2/5? (a) -4 (b) -4/7 (c) g (d) 1 b Let x = 0 + 0. Let z = -68/3 + 23. Let m(o) = -o - 2. Let b be m(-1). What is the nearest to b in x, 0.4, z? x Let d = 102 - 815/8. Which is the closest to 0? (a) -1/5 (b) -2/9 (c) d c Let a be (4 + 1 + -2)/(48/(-16)). Let v = -408/5 - -82. What is the nearest to a in v, -0.1, -0.5? -0.5 Let i = 28 - 24. Suppose ig + g = 0. Which is the closest to g? (a) 1/4 (b) 8 (c) -2 a Let h(t) be the second derivative of t4/12 + 2t*3/3 + 2t*2 - 2t. Let c be h(-4). Let s = 0.031 - 4.031. What is the closest to -1/3 in 0.5, c, s? 0.5 Let u = -0.4656 + -0.0344. Which is the closest to 1/11? (a) 2 (b) u (c) -3 (d) 1/4 d Let q be (48/(-160))/((-4)/10). Let m = 0.16 + 0.84. Which is the closest to m? (a) -0.4 (b) -3/7 (c) q c Suppose -15 = -3g, 220y - 221y = -g + 6. Which is the nearest to -8? (a) -8 (b) 2 (c) y (d) 1/2 a Let a = -6.42 - -8.42. Let g be 1228/930 - 0 - 2. Let q = g + 2/155. What is the nearest to -0.1 in a, 0.5, q? q Let z be (9/(-36))/((-9)/12). Let n = -0.04 + -4.96. What is the closest to -3/4 in z, n, 0.4? z Let i = -59.8 - -59.6. What is the nearest to -0.1 in i, 0.4, -0.5, -0.3? i Let z be 3 + -2 + (-3)/6. Let d be -2 - (2577/(-234))/(-1). Let g = -79/6 - d. Which is the nearest to 1/2? (a) -6/11 (b) z (c) g b Let j = -88 + 179/2. Let y = -163 + 162.8. What is the closest to j in y, -2, -1/3? y Let k(f) = -2f + 7. Let n be k(6). Let j = -2.8 + -1.2. Let x(l) = l*3 - 2l*2 - 3l. Let z be x(3). Which is the nearest to n? (a) j (b) 0.2 (c) z a Let i = 1735 + -1738. What is the nearest to 43 in 1, 0.4, i? 1 Suppose 5p = -4o - 71, p + 22 = -o + 4p. Let y = 135/7 + o. Let u = 48 - 48. What is the closest to y in 4, u, -0.4? u Let f = -1.12 + 0.22. Let v = -0.28 + -0.62. Let s = f - v. Which is the nearest to s? (a) -3/4 (b) -0.4 (c) 3 b Let o = 0.0479 + -1.0479. What is the nearest to o in -7, 1, 2/9, 2? 2/9 Let u = 23.11 + -23. Let y = u + -0.61. Which is the nearest to -0.1? (a) y (b) 5 (c) 1/3 a Let n = -0.0133 - 0.4867. Which is the nearest to -1/3? (a) -5 (b) -0.1 (c) n (d) 10 c Let x(q) = 36q*3 + q + 1. Let f be x(-1). Let p = 37 + f. Let u be p/(-2)(1 + -1). What is the closest to 1/2 in -3/5, -1, u? u Let w = 953/4 - 238. Let u = -9 + 6. Which is the closest to -6? (a) w (b) u (c) -4 c Let t = -0.04 - 2.96. Let x = 13019/7815 + 2/2605. What is the closest to x in t, -4, 0.1? 0.1 Let q = 1 + -3. Let z be (-4)/70(212 + -205). Suppose -3t - 7 = 5d, -4d + 4t + 11 = -9d. Which is the closest to z? (a) -0.5 (b) d (c) q a Suppose -2x + 24 = 5g + 4, 15 = 5g + 3x. Suppose -16 = -5d - g. Which is the nearest to d? (a) -2 (b) -1/2 (c) -0.3 c Let s = -4.59 + 3.3. Let l = 0.29 + s. Which is the nearest to l? (a) -1/4 (b) 0.4 (c) 0 a Suppose 0 = 23b + 14b - 111. What is the closest to 4 in 2, -0.5, 0.01, b? b Let a = -385 - -384. What is the closest to 0 in 3, a, -0.2? -0.2 Let y = -1.3 + 6.3. Let s = -39 + 39.1. What is the closest to -3 in s, -2, y? -2 Let m(q) = -q2 + 9q - 9. Let g be m(8). Let v = -2 + 4. What is the nearest to 2 in -5, v, g? v Let c = 59/5 - 35/3. Let y = 32 + -63/2. What is the closest to -2/3 in -14, c, y? c Let p = 2/2733	{ "pile_set_name": "DM Mathematics" }
059037s3/4 - 1787s*2. Determine a so that z(a) = 0. -477 Let i = -61 + 64. Factor 10y*i - 30y*3 + 13y*3 + 2y*3 + 20y. -5y(y - 2)(y + 2) Let o(w) = w3 - 33w*2 + 5w - 74. Let r be o(33). Suppose 95b3 + 188b*3 + 2187b - rb3 - 1296b2 = 0. What is b? 0, 27/8 Let b(l) be the third derivative of -l7/42 - 5l6/24 + 5l*5/3 + 25l*4/2 - 120l*3 + 4324l*2 - 2l. Suppose b(y) = 0. Calculate y. -6, -4, 2, 3 Find g, given that -24 - 2/11g2 - 136/11g = 0. -66, -2 Let m = -29847 + 89545/3. Find a, given that 2/3a4 + ma*3 - 16/3a - 8/3a2 + 0 = 0. -2, 0, 2 Let y(a) = a2 + 6a + 2. Let s be y(-6). Let v = 42983/57300 - 2/14325. Find o such that 9/4os + 3/2o - vo4 + 0 + 0o*3 = 0. -1, 0, 2 Let y = 26/3355 - -2658/3355. Factor 0 - yr + 4/5r2. 4r(r - 1)/5 Let q(r) = 5r*2 + 951r + 1918. Let y(g) = 32g2 + 6656g + 13424. Let u(a) = 20q(a) - 3y(a). Suppose u(p) = 0. Calculate p. -2, 239 Let l(f) = -4f2 - 28f + 7. Let h be l(-5). Suppose 0 = -28c + h + 9. Solve 5/4i + 1/4ic + 1 = 0 for i. -4, -1 Factor 1/10t*2 + 4/5t*3 + 0 - 1/5t + 1/2t4. t(t + 1)*2(5t - 2)/10 Let l(z) = 166z*2 - 25060z + 15700078. Let q(v) = -97v2 + 15036v - 9420047. Let j(n) = -7l(n) - 12q(n). Solve j(h) = 0. 1253 Suppose -65 = -2z + 2d - 43, z - 4d = 29. Let s(x) be the first derivative of -3/2x*4 + 9x*2 + 27/2x + 3/10xz - x3 + 5. Factor s(y). 3(y - 3)*2(y + 1)2/2 Let j(f) be the first derivative of f5/20 - 153f4/8 + 203f*3/4 - 38f*2 - 4692. Factor j(q). q(q - 304)(q - 1)2/4 Let y(j) be the second derivative of -j4/6 - 15j*3 + 826j*2 - 5944j. Let y(l) = 0. What is l? -59, 14 Let x(y) be the second derivative of 5y4/12 + 665y*3/6 + 975y*2 + 3298y. Let x(t) = 0. What is t? -130, -3 Suppose 4 = -b - q, 0 = 12b - 13b + 4q + 11. Let l(z) = -4z*4 + 17z*2 - 17z. Let v(j) = j5 - j2 + j. Let r(s) = bl(s) - v(s). Factor r(c). -c(c - 2)*3(c + 2) Let 30 - 10f3 + 11f*2 + 580f - 2f2 - 531f + f3 + f4 = 0. What is f? -1, 5, 6 Suppose 23s - 27 - 19 = 46. Let d(y) be the second derivative of -4/5y*5 + 0 + 1/6y*s + 8/3y*3 + 0y*2 - 1/15y*6 + 13y. Find g such that d(g) = 0. -8, -1, 0, 1 Suppose 38t = 2x + 37t - 12, 2x - 36 = 4t. What is d in -7/2d*x - 3/2d - 1/2d4 + 0 - 5/2d*3 = 0? -3, -1, 0 Let v = 56581 - 282873/5. What is s in 2/5s*2 - 34/5 + vs = 0? -17, 1 Let o(w) = 36w2 + 1837w + 51. Let m be o(-51). Let 2/7h5 + mh + 0 + 2/7h4 - 2/7h*3 - 2/7h*2 = 0. What is h? -1, 0, 1 Let b be 180/(-255)(-1802)/371. Solve bv4 - 8v*3 + 8/7 + 64/7v*2 - 4/7v*5 - 36/7v = 0. 1, 2 Suppose -2t - 2w = 0, -2t + 7t + 3w - 4 = 0. Factor -14z - 5171zt - 40 + 5167z*2 - 30z. -4(z + 1)(z + 10) Let d(v) be the third derivative of -166v2 + 0v + 0 - 4/3v4 + 6v*3 - 1/15v*5. Factor d(r). -4(r - 1)(r + 9) Let b(v) be the third derivative of v8/504 - 557v*7/315 - 559v*6/60 - 1679v*5/90 - 140v*4/9 - 2122v*2 + 2v. Find t such that b(t) = 0. -1, 0, 560 Let d = 1293299/3832 + 1/3832. Determine h, given that 45h3 + 3/2h*5 + dh - 45/2h4 + 285h2 + 243/2 = 0. -1, 9 Let m(v) be the third derivative of v5/100 - 4v4/5 + 128v*3/5 - 2v*2 - 6. Solve m(u) = 0 for u. 16 Let p(j) be the second derivative of -4j*6/15 + 34j5/5 + j4/2 - 2714j3/3 - 2645j*2 - j + 13. What is i in p(i) = 0? -5, -1, 23/2 Factor -34/7h*2 + 72/7 - 2/7h*3 + 40/7h. -2(h - 2)(h + 1)(h + 18)/7 Suppose -21i = -26i - 5h + 520, 2i = -5h + 220. Factor -i - 4s2 + 28s + 4s + 8s. -4(s - 5)2 Suppose 884 = -3d - 4f - 2661, 3d + 5f + 3550 = 0. Let i = d + 1178. Suppose 24/7t - 4/7t2 - 6/7t*i - 16/7 + 2/7t*4 = 0. What is t? -2, 1, 2 Let f be -93(8/32 - (-7)/(-12)). Suppose -542 + 521 - 44j + 4j*5 - 29j + 81j3 + 40j*4 - fj*2 = 0. Calculate j. -7, -3, -1/2, 1 Let o(a) = 2a*2 - 31a - 15. Let q(y) = -2y2 + 32y + 15. Let i(n) = -4o(n) - 3q(n). Let j be i(12). Suppose 12v + 92 - j - 2v*2 - 45 = 0. What is v? 2, 4 Suppose -4a = 20b - 21b - 113, 5b = 15. Suppose 0 = 12w - 77 + a. What is d in -4/7d2 - 8/7d + 8/7d3 + 6/7 - 2/7d*w = 0? -1, 1, 3 Let g(v) be the first derivative of 3v*5/5 - 15v*4/2 - 97v*3 + 15v*2 + 288v - 113. Determine o, given that g(o) = 0. -6, -1, 1, 16 Let u(c) = -3c2 + 876c - 17337. Let r(w) = w*2 - 220w + 4334. Let b(k) = 9r(k) + 2u(k). Factor b(v). 3(v - 38)2 Let g(s) be the first derivative of s4/24 + 14s*3/9 + 25s*2/12 - 9s + 1497. Factor g(r). (r - 1)(r + 2)(r + 27)/6 Let a(l) = -8l3 - 232l*2 + 476l - 240. Let b(v) = 15v3 + 463v*2 - 950v + 479. Let j(g) = 7a(g) + 4b(g). Factor j(w). 4(w - 1)2(w + 59) Let k = -2065 + 2067. Let x(g) be the second derivative of -2/3g3 - 1/12g*4 + 2g - kg2 + 0. Factor x(q). -(q + 2)2 Let x = 1/258697 - -2328268/1293485. What is r in 1/5r*2 - 2 - xr = 0? -1, 10 Let p(y) be the first derivative of -20 + 0y2 + 5/33y*3 + 1/110y*5 + 1/11y*4 - 22y. Let w(n) be the first derivative of p(n). Solve w(d) = 0 for d. -5, -1, 0 Let c(f) be the first derivative of -f*5/10 + 7f*4/2 - 143f*3/3 + 315f*2 - 2025f/2 - 309. Let c(h) = 0. Calculate h. 5, 9 Let j = -81 + 72. Let s be (j/(-18))/((-2)/(-8)). Factor -1 - 3 + 518o - 524o - 2os. -2(o + 1)(o + 2) Suppose -39o*3 + 30o*2 - 6o + 7o2 - 4o*2 - 412o*4 + 212o*4 + 212o*4 = 0. Calculate o. 0, 1/4, 1, 2 Suppose -19k + 16k = -102. Suppose 2l - 42 = -4j + 80, -4l + k = j. Find c, given that -7c2 + 35c - jc + 2c*2 + 10 = 0. -1, 2 Suppose 3 = -3h + 3o, 0 = 2h + 11o - 10o - 7. Let x(v) be the first derivative of -3v3 + 0v + 3/4v4 - 6v*h - 19. Factor x(f). 3f(f - 4)(f + 1) Let a(s) be the second derivative of -3s - 289/20s*5 - 4s*2 - 70/3s*3 + 23 - 323/6s*4. Let a(d) = 0. What is d? -2, -2/17 Let d(o) be the third derivative of 1/60o*6 + 1/4o*4 - 1/105o*7 + 1/6o*5 + 0o + 0o3 + 12 - 2o*2. Factor d(b). -2b(b - 3)(b + 1)*2 Let z(k) be the second derivative of -2k*6/15 + 9k*5/5 + 11k*4 + 70k*3/3 + 24k*2 - 337k + 1. Solve z(b) = 0. -1, 12 Factor 1/4o3 - 603/4o - 5o2 - 1539/2. (o - 38)(o + 9)*2/4 Find j, given that 60j*4 + 524j - 145j3 - 98j*2 + 38j*2 - 384j + 5j5 = 0. -14, -1, 0, 1, 2 Suppose -774g + 777g - 42 = -4a, 0 = -2a + 4g - 34. Factor -36u - 3/2u*a + 33/2u*2 + 0. -3u(u - 8)(u - 3)/2 Let h(w) = 5w2 + 640w + 637. Let d(r) = -21r2 - 2559r - 2547. Let v(u) = -2d(u) - 9h(u). Factor v(b). -3(b + 1)(b + 213) Suppose -2/15g2 + 36 + 2/5g = 0. Calculate g. -15, 18 Let x be (7 + (-152)/56)/(-4860/(-4480)). Factor -50/3 - xf - 2/3f2. -2(f + 5)2/3 Let n(k) be the second derivative of k7/560 - 9k6/160 + 47k*5/160 - 15k*4/32 - 38k*2 - k + 4. Let b(f) be the first derivative of n(f). Factor b(h). 3h(h - 15)(h - 2)(h - 1)/8 Let j(l) be the second derivative of 3l*5/100 + 11l*4/10 - 101l*3/10 + 117l*2/5 + 2151l. Suppose j(f) = 0. What is f? -26, 1, 3 Let b(v) = -v*3 - 1. Let k(a) = -5a*3 - 3a*2 + a - 1. Suppose -15t + 2 = -17t. Let o(u) = tk(u) + 4b(u). Find q such that o(q) = 0. -3, -1, 1 What is f in -1880/11f - 224 + 14f3 + 2/11f*4 - 24/11f*2 = 0? -77, -2, 4 Suppose 3v + v + 4m = -4, v - 2m - 11 = 0. Factor 3lv + 2l - 6l + l3. 4l(l - 1)(l + 1) Let r = -1260905 + 1260908. Factor 3/5v - 1/5 - 3/5v*2 + 1/5vr. (v - 1)3/5 Suppose -2m + 857 + 455 = 0. Let n = m - 4589/7. Suppose -3/7r + nr2 - 6/7 = 0. What is r? -1, 2 Let -1/2k*3 + 117k + 324 + 3/2k2 = 0. What is k? -12, -3, 18 Solve 192/11 - 18/11l*5 + 512/11l + 94/11l3 + 444/11l*2 - 48/11l*4 = 0 for l. -2, -4/3, -1, 3 Let s(t) be the third derivative of -5t8/336 + t7/14 + t6/3 - t5 - 10t4/3 + t2 + 104t - 5. Solve s(v) = 0. -2, -1, 0, 2, 4 Let h = -323 - -325. Find x, given that 6 + 4x3 + 4x - 13 + 7 + 54x3 + 62x*h = 0. -1, -2/29, 0 Suppose 33815 = -16c + 33847. Let -2/11mc + 24/11 - 8/11m = 0. What is m? -6, 2 What is h in 3h2 - 33/4h + 3/4h*3 - 45/2 = 0? -5, -2, 3 Determine d, giv	{ "pile_set_name": "DM Mathematics" }
52au + 18a - 72u - 18 What is the derivative of 191350u2 - 74036 wrt u? 382700u Find the second derivative of 3133g2m*2 - 159g*2mo2 - 12g*2mo + 8g*2 + 5m*2o*2 wrt m. 6266g*2 + 10o*2 Find the third derivative of -5d*3o*2 - 558d*3 + 1643d*2 + 4do2 wrt d. -30o*2 - 3348 What is the second derivative of -665086k*2o*2 + 4k*2 + 9092ko2 + 3ko + 9o*2 - o wrt k? -1330172o*2 + 8 Find the third derivative of -5b*5 + 4b*4 + 1858b*3 + 45b*2 + 1961b wrt b. -300b2 + 96b + 11148 What is the third derivative of -3351st*3 + 8953st2 - 5st - 2s - 9t3 + t2 + 1 wrt t? -20106s - 54 Find the third derivative of 8f6 - 10488f*5 + 2f*3 + 12f*2 + 11669. 960f*3 - 629280f*2 + 12 What is the second derivative of 734366r*2u*3 - 772ru3 - ru + 16u - 1 wrt r? 1468732u*3 Differentiate 263521s + 316082 wrt s. 263521 Find the third derivative of -36375b3 + b2 + 5b - 69. -218250 What is the second derivative of 144099j4 - 981869j wrt j? 1729188j2 What is the derivative of 113b*4 - 4648b*2 + 830711? 452b*3 - 9296b Find the second derivative of 1807t3 - 41t*2 + 47902t - 3. 10842t - 82 What is the second derivative of -7j*2w*2 + 9464j*2wz - 2j*2 - 1713w*2z*2 + wz*2 wrt w? -14j*2 - 3426z*2 Find the third derivative of 26g*5 + 613g4 + g2 + 18431. 1560g2 + 14712g What is the second derivative of -14u2vz + 14u*2v + 2u2z*2 - 4u*2 + 4uvz*2 - 4vz2 + 108vz wrt u? -28vz + 28v + 4z2 - 8 Find the third derivative of -276530f*4 + 30230f*2 + 3. -6636720f What is the second derivative of 188221g4 + 3g*2 - 5526925g wrt g? 2258652g2 + 6 Find the third derivative of -17542h*3 + 44491h*2 wrt h. -105252 What is the second derivative of -592f*2gp - f2np3 - 10f*2p*3 - 5fnp*3 + 1460fnp*2 + 2gnp wrt f? -1184gp - 2np*3 - 20p3 Find the first derivative of o2v - 722o*2 + 59ov + 1749v + 6 wrt o. 2ov - 1444o + 59v What is the derivative of -8jkw3 - 40jw3 + 172jw2 - 126kw3 - 2kw + 2k - 90w wrt j? -8kw3 - 40w*3 + 172w*2 Find the second derivative of 1842347f*3 + 285563f - 3. 11054082f Differentiate 922343r + 639706 with respect to r. 922343 Find the second derivative of 14272ns*2 + ns - 7n + 24s - 8 wrt s. 28544n Find the first derivative of 25c*2u + 3c2v - 753c2 + 101767uv wrt v. 3c*2 + 101767u Find the third derivative of -7777y4 + y3 - 1772y*2 - 2 wrt y. -186648y + 6 Find the third derivative of -127600t5 - 141442t*2. -7656000t*2 What is the second derivative of 8t*5 + 3313t*3 + 911t - 19 wrt t? 160t3 + 19878t What is the second derivative of -5222uv*3z*2 - 10uv3 + uvz2 - uvz - 4970uz wrt z? -10444uv3 + 2uv What is the third derivative of 57337nr3 + 145nr2 - 59n + 1 wrt r? 344022n Differentiate -40f*2kt - 28fjkt2 - ft*2 + 3341jkt*2 - 3jk + kt*2 with respect to f. -80fkt - 28jkt2 - t2 What is the third derivative of 214951t4 + t3 + 3t2 - 1524t + 32? 5158824t + 6 What is the second derivative of 84792p4 + p2 + 2p - 20374? 1017504p*2 + 2 What is the third derivative of -14c*3o*2r - 72c3orx + 137c3x - c*2o*2rx - c2o*2r + 29956c2orx - o*2r wrt c? -84o2r - 432orx + 822x Differentiate -2m2 + 5147m - 11443 wrt m. -4m + 5147 What is the derivative of -3bo2 + 23bq + b - o4q + 6382o + 979q - 2 wrt o? -6bo - 4o3q + 6382 What is the derivative of -1493662i - 3099906 wrt i? -1493662 What is the third derivative of 204799b*3 + 4b*2 + 10230? 1228794 Find the second derivative of -3l*5 - 2l*4 - 60847l*2 + 91557l + 1 wrt l. -60l3 - 24l*2 - 121694 What is the third derivative of -60206b*6 - 2b*3 + 65401b*2? -7224720b3 - 12 Differentiate -f3r + 8289f*2r*2 + 12798r*2 wrt f. -3f*2r + 16578fr*2 Differentiate -3n*3 + 20292n*2 - n - 790049 with respect to n. -9n*2 + 40584n - 1 What is the second derivative of 1645k3v*3 - 52k*3v - 3000k3 - 635kv4 wrt v? 9870k*3v - 7620kv*2 Differentiate -14u*3x - 422u2x*2 - ux + 119454x2 wrt u. -42u*2x - 844ux*2 - x What is the second derivative of -97449r*4 + 6r*2 + 2030421r wrt r? -1169388r2 + 12 Differentiate 53432w3 + w2 + 17216. 160296w2 + 2w Find the second derivative of -264930y5 - 129234y. -5298600y3 Differentiate 2d*3o - 1060670d3 - 222d*2o + do + 88o wrt o. 2d3 - 222d*2 + d + 88 Find the third derivative of -315x6 + x4 + 11x3 - 2x*2 - 39732 wrt x. -37800x*3 + 24x + 66 Differentiate 712167f3lu + 16f*3l + 2f3 - 36fl - 17f + 2l wrt u. 712167f*3l Find the second derivative of -38723d2l*2 + 2d*2l + 2020dl - 4 wrt l. -77446d2 Find the second derivative of 108598fz3 + 3fz2 + 124821f + z*3 - 3z wrt z. 651588fz + 6f + 6z What is the derivative of 33985j + 25802 wrt j? 33985 Differentiate -32486a*2 - 11579. -64972a Find the second derivative of -181179qy*2 + 141qy + 3964q + y wrt y. -362358q What is the first derivative of 1135639q + 811189? 1135639 Find the third derivative of -105327y4 + 2y*3 - 23y*2 - 129y. -2527848y + 12 What is the first derivative of -3v*2x*2 + 167v*2 - 52585vx2 - 55v wrt x? -6v2x - 105170vx What is the second derivative of -2971910i2u*3 - 2iu3 + 8iu - 2u*3 + 15u*2 + u wrt i? -5943820u*3 Differentiate -333893h*2 - 2h + 644414. -667786h - 2 Find the first derivative of -493621ry - 13379r wrt y. -493621r Find the second derivative of -531av3 - 4av2 + 50av - 2v*3 - 9v*2 + 739v + 2 wrt v. -3186av - 8a - 12v - 18 Find the second derivative of -57121g2k + gk + 12g + 8897k - 1 wrt g. -114242k What is the first derivative of 2i4m - 765i4 + 14im - 104m wrt i? 8i3m - 3060i3 + 14m What is the third derivative of 2111727a5 - 5955960a*2? 126703620a*2 What is the derivative of -380855d + 20193 wrt d? -380855 Find the third derivative of -99o5 - 1032o*4 + 55o*2 - 588o wrt o. -5940o2 - 24768o What is the third derivative of 47469g3 + 2g*2 + 59g - 42 wrt g? 284814 Differentiate 187m4 + 391m*2 + 63300 wrt m. 748m*3 + 782m What is the second derivative of 10568p3w*2 - 318p*3w - p*3 + 3p*2 - 20pw2 wrt w? 21136p*3 - 40p What is the third derivative of t*6 + 19t*5 + 1742t*3 - 556157t*2 wrt t? 120t*3 + 1140t*2 + 10452 Find the first derivative of -4ms4 - 12ms - m - 170s*4 + 23003 wrt s. -16ms3 - 12m - 680s3 Differentiate 62235jw2 + 235430w*2 wrt j. 62235w*2 Find the second derivative of -543195w*2 + 28w - 792. -1086390 What is the derivative of 8783x3 - 43161? 26349x*2 Differentiate 109905l - 168615. 109905 Find the third derivative of 23kmp6 + 4kmp*2 + 787km - 7kp2 + 195mp3 wrt p. 2760kmp*3 + 1170m What is the second derivative of 854194b3c*2u*2 + 257b*3cu2 - 30b*3 + 2bcu*2 - 2bc - u2 wrt c? 1708388b*3u*2 What is the second derivative of 21lu4 - 4lu - 3l + 16u3 + 126u*2 + 664u + 4 wrt u? 252lu*2 + 96u + 252 Find the first derivative of 3r4 - 7778r*3 - 1792 wrt r. 12r*3 - 23334r*2 What is the first derivative of 10f*3w + 2f3 - 2fw - 18410f - 7w2 + 5 wrt w? 10f*3 - 2f - 14w Find the second derivative of -2b*3o*2 + 211b*3o + 27142bo*2 + 63bo wrt o. -4b*3 + 54284b Differentiate 20s3 - 5s*2t*3 + 250s + t*3 - 10t*2 + 12105t wrt s. 60s2 - 10st3 + 250 Differentiate -153i*2k*3 + 47i*2kv + 7k*3v + 2k + 5v*4 wrt v. 47i*2k + 7k3 + 20v*3 Find the first derivative of -2708260o - 656914. -2708260 What is the second derivative of -2362m2w*2 + 940m*2w + 2m2 - 8w*3 + 6w wrt w? -4724m2 - 48w What is the second derivative of -bp4 - 89bp3 + 2bp2 + 54b + 42p wrt p? -12bp2 - 534bp + 4b Find the first derivative of -170i2 - 11i - 139153 wrt i. -340*i - 11 Find the th	{ "pile_set_name": "DM Mathematics" }
2 - 50699493a*2 What is the third derivative of 581258644c*6 + 4c*2 - 38239454? 69751037280c*3 Find the third derivative of 12l*5 - 4055182l*3 + 1399013l*2 + 2. 720l*2 - 24331092 Differentiate 597037gh2 - 15gh + 362696433g + 11h with respect to h. 1194074gh - 15g + 11 Differentiate 9bwy - 1361474bw + 3wy + 3w - 3817y + 3 with respect to b. 9wy - 1361474w Find the second derivative of 274241564p2 - 1288337173p. 548483128 What is the third derivative of -13240o6 + 210o*3w + 3o2w + o*2 + 8ow - 8o - 74w wrt o? -1588800o*3 + 1260w Find the third derivative of 147i5p*2 - 14138i*3p*2 + 5i*2p - i*2 + 15ip2 - 7088 wrt i. 8820i*2p*2 - 84828p*2 What is the derivative of -3356002l*3 + 2l*2 + 2l - 6313443? -10068006l2 + 4l + 2 Find the second derivative of -4u2z*2 + 28u*2z - 2u2 + 2uz2 + 2uz - 422893z*2 + 3625z + 10 wrt z. -8u2 + 4u - 845786 What is the second derivative of 188169623b4 + 15b + 2270709? 2258035476b2 Find the third derivative of -89891324q*4 - 26q*2 - 86q - 2967 wrt q. -2157391776q Find the first derivative of -25611972a*2f + 483039461f wrt a. -51223944af Differentiate 5m*2 - 2296889m + 39792009 wrt m. 10m - 2296889 What is the first derivative of 145079166a + 24344557? 145079166 What is the second derivative of -57398762c2 - 8594620c - 1? -114797524 What is the second derivative of 6i4 - 1265578i*3 - 86i - 18170 wrt i? 72i2 - 7593468i What is the derivative of 14vy*2 - 511vy + 278v - 23y2 + 311655 wrt v? 14y*2 - 511y + 278 What is the second derivative of 152j4 - 32j*3 + 71j*2 - 19149535j? 1824j2 - 192j + 142 Find the second derivative of -440341670bg*2 + bg + 3b - 192g + 120588 wrt g. -880683340b Differentiate -15044972x + 10172926 wrt x. -15044972 What is the derivative of -797k3 + 17511k*2 - k + 56383153 wrt k? -2391k*2 + 35022k - 1 What is the third derivative of -380582156f3 + 1044579856f*2? -2283492936 Differentiate -12591961uy - 1174662u with respect to y. -12591961u Find the first derivative of -1068130b*4 + 2b - 12177950. -4272520b3 + 2 What is the derivative of 4d*3gq - 48716d*3g + d*3 - 268d*2gq + 21d*2g - dg - 1187dq + 2g - 35 wrt q? 4d3g - 268d2g - 1187d What is the second derivative of -254306973c*3p*2 + 2c*3p + 18c3 - 3c*2 - 10cp + 8120c + 1 wrt p? -508613946c3 What is the second derivative of 22331563t*2 - 2006636t wrt t? 44663126 Differentiate 192334263g3 - 46883140 with respect to g. 577002789g*2 Find the second derivative of -189in4 - 606in3 - 2in + 67i - 4450n - 1 wrt n. -2268in2 - 3636in Find the second derivative of 49fl3 - 59fl2 - 10fl - 2l*3 + 246l*2 + 8015322l wrt l. 294fl - 118f - 12l + 492 Find the second derivative of -484103a3n*2 + 135a*3n - 16an*2 + 9an - 512n*2 + 66 wrt a. -2904618an2 + 810an Differentiate 63757519kv - 13v - 1598236 wrt k. 63757519v What is the third derivative of 9367553kv3 - kv - 5k + 108v*2 + 350 wrt v? 56205318k What is the third derivative of 487406736g3 - 69300042g*2 + 2g - 1 wrt g? 2924440416 Find the third derivative of -2d4 - 17486431d*3 + 212d*2 + 24839d wrt d. -48d - 104918586 What is the third derivative of 30747t*6 + 379t*4 + 9743t*2 + 964 wrt t? 3689640t*3 + 9096t Find the third derivative of -24324133s6 + 1929237s*2 + 6. -2918895960s*3 Find the second derivative of 138738171n*2 - 47745926n. 277476342 What is the third derivative of 13486dg*4 - 28391dg2 - 2dg + 65d + g*5 + 1706g*3 - 2g*2 - 1 wrt g? 323664dg + 60g*2 + 10236 What is the third derivative of 83226614t*4 + 148661t*2 + 44t + 2? 1997438736t What is the derivative of 488832809t - 24810453? 488832809 Find the second derivative of 2252j2w*4 + 19j*2w - 20j2 - 19339jw + 16986w*5 wrt w. 27024j*2w*2 + 339720w*3 What is the third derivative of 11178j*4 + 4j*3 - 1134j*2 + 6j - 214? 268272j + 24 Find the second derivative of 1130792l*3 - 8702l + 38 wrt l. 6784752l Find the first derivative of 14ku4 + 391ku2 - 27831k - 34u wrt u. 56ku3 + 782ku - 34 Differentiate uy*2 + 12886504u - 107246y4 - 3y*2 with respect to y. 2uy - 428984y*3 - 6y Differentiate -v*3 - 2v*2 - 6804331v + 72196517 wrt v. -3v2 - 4v - 6804331 Find the third derivative of -144692c2o*5 - 28c*2o*3 + 1339c*2o*2 - 1270o*2 wrt o. -8681520c*2o*2 - 168c*2 What is the second derivative of -492443745g*3h*2 + 4g*3h - g*3 - 614g*2 - 230gh + h wrt h? -984887490g*3 Find the second derivative of 3g*4 - 195694g*3 - 12g*2 + 59788550g wrt g. 36g2 - 1174164g - 24 What is the first derivative of -1865140j - 6655319 wrt j? -1865140 Differentiate 656008a*2j*2 - 328aj3 - 2j*3 + 22857j*2 + 294j + 6 wrt a. 1312016aj*2 - 328j*3 Differentiate -38183t*4 + 13469t + 772524213. -152732t3 + 13469 Differentiate -4570k*2 - 1341k - 263296614 with respect to k. -9140k - 1341 Differentiate -816881ry3 - ry - 488622287r + 2y wrt y. -2450643ry*2 - r + 2 What is the second derivative of 3ms2 - 5ms - 307m + 3101980s2 - s - 2 wrt s? 6m + 6203960 What is the second derivative of -364786397o4 + 15634250o? -4377436764o2 What is the third derivative of 135895d*3o2 + d3o + 25d*3 + 2d*2 + 3do2 + 52d + 171 wrt d? 815370o2 + 6o + 150 Differentiate 6961937c3 - 7364408. 20885811c*2 Find the second derivative of 832669407l*5v - 53568l - v - 238 wrt l. 16653388140l*3v What is the derivative of 280c4 + 4c*3 - 3307c*2 + 16375759? 1120c*3 + 12c*2 - 6614c What is the second derivative of 129091497d2 + 3340d + 746 wrt d? 258182994 What is the derivative of -508885542a2 - 631306869 wrt a? -1017771084a Find the second derivative of 11429874k2q + 2k2 - 491kq + 8961k wrt k. 22859748q + 4 What is the second derivative of 163b*5 - 5697b*3x*2 - 1384107bx2 + 1 wrt b? 3260b*3 - 34182bx2 What is the third derivative of -5422735p*3u - p*2u - 3992pu - 156p wrt p? -32536410u What is the first derivative of 11791743ox - 3o - 238089973x wrt o? 11791743x - 3 Find the second derivative of 646l*5 - 288l*4 + 5l*3 + 43463l + 113. 12920l3 - 3456l*2 + 30l Find the second derivative of 1958254w4 - 2w*2 - 3774w - 164. 23499048w2 - 4 Find the first derivative of 189644d*2 - 2d - 21234767. 379288d - 2 What is the second derivative of -173608824q*3 + 96q - 470732 wrt q? -1041652944q What is the second derivative of 4408754ao2 - 2a + 46o - 2612 wrt o? 8817508a What is the third derivative of -251k6 - 85211k*4 + 54021739k*2? -30120k*3 - 2045064k What is the third derivative of -4gq*3 - 3905gq2 - 38982gq - 7831280q*3 wrt q? -24g - 46987680 What is the first derivative of 10k3 + 9k*2 + 926k - 37582780? 30k2 + 18k + 926 Find the third derivative of 267155620h5 + 72990188h*2. 16029337200h*2 Find the third derivative of -18444622d*3 + 108366d*2 - 3d. -110667732 Find the second derivative of 324s4 + 2s*3 - 14870s*2 + 201966429s. 3888s2 + 12s - 29740 Find the first derivative of 7263539k4 - 4305794. 29054156k*3 What is the derivative of -2q*4 + 28866489q + 3854133? -8q3 + 28866489 Find the third derivative of 37882598n*5o*3 + 224462n*2o*2 + 4n*2 + 2no3 - 5o*3 wrt n. 2272955880n*2o*3 Find the third derivative of -9628547mz3 - 156010mz2 + 18z*2 - 5 wrt z. -57771282m Differentiate -21522938c3 - 34166375 with respect to c. -64568814c*2 Find the third derivative of -1232329052c*2v*3 - 229c*2v2 - c2v + 5c*2 + 497cv - 6 wrt v. -7393974312c*2 What is the third derivative of 1070219474g*6 - 4g*2 - g + 45056275 wrt g? 128426336880g*3 What is the first derivative of -4591575bv + 5v + 639946 wrt b? -4591575v What is the second derivative of -199170c*4v + c*3v + 394c2 + 896cv - 9c - 4v - 1111 wrt c? -2390040c*2v + 6cv + 788 Find the s	{ "pile_set_name": "DM Mathematics" }
late the lowest common multiple of 77 and q. 1617 Suppose 6f = -3w + 10f - 380, 4w + 2f + 536 = 0. What is the common denominator of -99/28 and (w/(-30))/(21/5)? 84 Let k(c) be the first derivative of 7c*4/2 - 4c*3/3 - 4c*2 - 3c - 37. Let d be k(-3). What is the common denominator of (-8)/12 + d/(-198) and 97/124? 1364 Let h = 15/121 - 2449/1210. Let u = 3073287761093 + -1203597832453491703/391632. Let o = u + 3/8159. Find the common denominator of o and h. 240 Let t be -13 + 10 + (-1009686)/56. Let x = 40165 - 58202. Let b = t - x. What is the common denominator of 109/10 and b? 140 Let a(d) = -d*3 + 10d*2 - 6d - 3. Suppose -9g = -7g - 16. Suppose gz - 10z = -18. Calculate the lowest common multiple of a(z) and 5. 120 Let x(b) = b*3 + 43b*2 + 45b + 131. Let n be x(-42). Calculate the smallest common multiple of 526 and 12/20n(-66)/(-9). 5786 Suppose -r + 2 = 0, 13930 = -469b + 474b - 5r. What is the least common multiple of 4 and b? 2788 What is the smallest common multiple of 45/12(13 + 3) and -5(-12)/90150? 300 Let v = 46 + -50. Let l be v/2 + -165 + -1 + 0. Find the common denominator of -69/2 and (-9)/6 + (-623)/l. 24 Let m(k) = -k*3 + 25k*2 - 143k - 48. What is the smallest common multiple of 2898/5 - (-6)/15 and m(10)? 6380 Let i be (-28)/2162(-3)/4. Suppose 4l - 242 = -i. Suppose 27 = 9q - l. What is the smallest common multiple of 6 and q? 24 Let y = -16363 + 8112. Let f = 412433/50 + y. Calculate the common denominator of f and 117/20. 100 Let b = 2504651/64280325 + 1/450300. What is the common denominator of b and 67/5710? 11420 Let i = -524 - 90. Let c = -602 - i. What is the smallest common multiple of 20 and c? 60 Let f = 890486/27 + -32981. Calculate the common denominator of f and (137/(-9))/((-4)/(-3)). 108 Suppose 14888m + 525 = 14913m. Calculate the smallest common multiple of 129 and m. 903 Suppose 16 = 9d - d. Suppose -da + 69 = -9. Suppose a = 8o - 41. What is the lowest common multiple of 8 and o? 40 Let c = 25/44 - 273/374. What is the common denominator of c and (-1438)/(-152) + 4744/(-22534)? 68 Let c = -255745/32 + 7991. Let t be 1284/(-129) - 16/344. What is the common denominator of c and 18/t(-1475)/118? 32 Find the common denominator of (257/(-36))/1 + 399/21 + -13 and 73/4. 36 Suppose -4u + 2u = -8. Find the common denominator of 41/24 and (u - 522/30)/(24/10). 24 Let h = -26 - -59. Suppose -4u - 118 = 190. Let i = 86 + u. What is the smallest common multiple of i and h? 99 Find the common denominator of (9/((-450)/172))/((-6)/(-10)) and 9/11. 165 Calculate the lowest common multiple of 15 and 3150/(-135)(-2 - 4). 420 Let q be ((-3 - 0/6) + 4)-1. Calculate the common denominator of 32 and 1q/(-2(-20)/(-296)). 5 Let r(i) = 172i*2 + 10i - 14. What is the least common multiple of r(-1) and 37? 148 Let o be (-15780)/2960 + 5 + 0. Let g = 1/444 - o. Find the common denominator of g and -44/21. 21 Let f be 1/2-6 - (-24)/3. Suppose -64 = -fx - 44. Let z = 157 - 152. Calculate the least common multiple of z and x. 20 Let w = 201 + -269. Find the common denominator of (51/w)/((45/(-176))/5) and -79/21. 21 Let q(k) = -k*2 - 26k - 128. Let f be q(-17). What is the common denominator of f/5056/10 and 2/(-6) + 181/(-96)? 160 Let d(r) = 3r + 123. Let w be d(-39). What is the least common multiple of (-32)/(-24) - 2 - (-10)/w and 14? 14 Let b = 65/8146 + 94447/1690295. What is the common denominator of b and 79/10? 830 Let k = -54 + 103. Suppose -216 = -4w + 4i, 9w - 10w = -4i - 69. What is the least common multiple of k and w? 49 Suppose -6p - 7p + 65 = 0. Suppose n + 3n - p = y, -y = -n - 4. Suppose -2o - 3c = -2 - 12, 0 = 3o + c - y. What is the least common multiple of 23 and o? 23 Let x = 333 + -308. Calculate the common denominator of -75/56 and x/(-575)37/(-7). 1288 Let u(f) = 3f2 - 41f - 53. Calculate the least common multiple of 2248 and u(15). 15736 Suppose 2m = -4m + 360. Let x be (21/m)/(-2(-2)/16570). Let s = -1446 + x. What is the common denominator of s and -83/12? 24 Suppose 0 = 4559r - 4562r + 9096. What is the smallest common multiple of r and 24? 9096 Let h = 2086663/135 + -15457. What is the common denominator of 13/99 and h? 1485 Let g = -1501/1239 + 108/59. Let c be (1 + 0)/(4/(-8)). Calculate the common denominator of g and (1 - 26/3)c. 21 Let a be (1/(-4))/(-1) - 559/172. Calculate the common denominator of 7/8 and a/61(-287)/(-98). 56 Let u = -20 - -24. Let b = -196 - -216. Suppose 52m = 47m + b. What is the least common multiple of m and u? 4 Find the common denominator of -6 + 9 + 10 + (-29084)/2280 and 55/159. 30210 Suppose 19b = 16b + 174. Let t = b - 55. What is the common denominator of (t/14)/((-3)/(378/(-8))) and 1/12? 24 Let f = 54869/50160 + -4/627. Find the common denominator of f and -1/14. 560 Let n be (3/4)/(13/52). Find the common denominator of (-1)/n-9 + 70/(-66) and 55/36. 396 Let u be ((-2 - 2) + 5)/(2/8). Suppose 6 = ug - g. Suppose -gn = 3 - 33. Calculate the lowest common multiple of 24 and n. 120 Suppose 146 = -2m - f, 3f + 4 = f. What is the common denominator of (17/2)/((-30)/16) and (-3140)/m - (-3)/(-27)? 30 Let s = 11925861234 + -9063651343989/760. Let h = s - -6288/95. Let k = h - 4280. What is the common denominator of k and -49/10? 40 Calculate the common denominator of 133/1404 and (-4)/32 - (12 + (-48102)/3888). 4212 Suppose -5d - s + 16 = -4d, -2d - 3s + 33 = 0. Let f = d + 2. Suppose c = 7 + f. What is the smallest common multiple of 15 and c? 120 Let u = -9 + -33. Find the common denominator of ((-704)/u)/(-8)1/(-4) and 139/192. 1344 Let b = 136 - 134. Suppose -3o + 2c = 4c - 34, 4c + 86 = 5o. What is the lowest common multiple of o and 7 + (b - 5) + 4? 56 Let n be -1 + (-1 - 2) + 6. Let a(d) = -2d*3 + 5d - nd - 3d. What is the lowest common multiple of a(-1) and 2? 2 Let l = 488033/88067727 - 52/19017. What is the common denominator of l and 1/88? 37048 Suppose -16h + 19h + 2c + 509 = 0, 0 = -3c + 6. Let a = h - -225. What is the least common multiple of 21 and a? 378 Let c = -115 - -115. Suppose 3x = 5b - 2x - 75, c = 4b + 4x - 60. What is the smallest common multiple of 30 and b? 30 Suppose 112i + 22 = 123i. What is the smallest common multiple of (52 - (3 + 1)) + (i - 1) and 28? 196 Let u(f) be the second derivative of -f3/6 + 31f*2/2 + 13f. Let q be u(7). What is the common denominator of 22/9 and 393/(-36) + q/6? 36 Let a = 1224740/51 - 24035. Let v be 4 + -4 + 144/(-51). Let q = a - v. Find the common denominator of -48/7 and q. 21 Let f = 95 + -51. Suppose 3g + 2o - f = -2g, -30 = -5g + 5o. Let q = 9596 + -9592. What is the least common multiple of g and q? 8 Let x(l) = -562l - 2238. What is the smallest common multiple of 186 and x(-4)? 930 Let m = 660409721/1925 - 343070. Find the common denominator of -2/385 and m. 1925 Let v be 30 + -7 + 16/4 + 3. Suppose -5c + 2 = -m, 7m = 3m - 2c - v. Let j(d) = -d*2 - 7d - 16. Find the common denominator of 121/6 and j(m). 6 Let c = 62/11 - 755/132. Let x = 105992/7 + -15196. Let o = -12125/224 - x. Find the common denominator of o and c. 96 Suppose 0 = -7d + 82 - 54. Suppose dq + 15 = -5t, 5t - 4q + 15 = -3q. Calculate the common denominator of -37/30 and t + 3 + 2/((-18)/73). 90 Suppose -4q = 5x - 27, 0 = -0q - 2q - 4. Suppose 0 = -2i - x + 17. Calculate the lowest common multiple of i and 72. 360 Suppose -3q - q = -10212. Let l = q + -28033/11. Calculate the common denominator of l and 7/2(-638)/88 + 13. 88 Let d(h) = -h + 13. Let x(n) = -4n + 10. Let w be x(0). Let l be d(w). Suppose 0 = 5t - 57 - l. What is the smallest common multiple of t and 3? 12 Suppose 10v - 87v + 7550 = 74v. What is the smallest common multiple of v and 4/(-14) - (-16)/7? 50 Suppose 5q + 3x + 858 = 8q, -3q = -4x - 856. What is the smallest common multiple of 128 and q? 1152 Suppose 3o - 6 = 0, 4q - 7q + 3o = -18. Suppose 0 = z + 24 - q. Find the common denominator of (-185)/30z/(-36) and -91/18. 54 Let m be (0 - 122)2/(-4). Let u = 16 - 11. Suppose 0 = uy - 3p - m, 4y = 3*y + p + 13. Calculate the least common multiple of y and 2. 22 Find the common denominator of (-72	{ "pile_set_name": "DM Mathematics" }
33. Let y(h) = -5h3 - 502h*2 - 3h + 944. Let z(s) = -3j(s) + 8y(s). Find the first derivative of z(l) wrt l. 6l2 + 1010l Let s(d) = -d*3 - 10d*2 + 14d + 24. Let a be s(-11). Let v(b) = -b - 5. Let n be v(a). Find the second derivative of 45in - 10i - 46i4 - 10i wrt i. -12i2 Let t(f) be the first derivative of 175f*6/6 - 2f*3/3 + 576f*2 - f - 378. What is the second derivative of t(c) wrt c? 3500c*3 - 4 Find the first derivative of -10514 - 760r*4 + 392 - 302r*4 wrt r. -4248r*3 Suppose 7m = 44m - 296. Let o(y) be the first derivative of my*3 + 0y + 11/2y2 - 2. What is the second derivative of o(i) wrt i? 48 Suppose -r - r + 3a + 16 = 0, -4a = -2r + 18. Find the first derivative of 21q4 + rq*4 + 39 - 82 + 112 wrt q. 104q*3 Suppose -56 = -i - 3a, i + a - 58 - 4 = 0. Differentiate b*4 - b + i + 2b - 35 wrt b. 4b3 + 1 Find the third derivative of -2f*4 + 15f*3 - 199f*2 + 13f + 132f3 - f4 - 9f*4 + 222f*2 wrt f. -288f + 882 Differentiate -942d - 1121d + 149 - 42 + 124 + 303d with respect to d. -1760 Let a(s) be the first derivative of 51s*8/56 + 41s*4/12 - 37s + 17. Let n(c) be the first derivative of a(c). What is the third derivative of n(g) wrt g? 6120g3 Let z be (5 - (-3 + 0)) + 6 + -10. What is the third derivative of nz + 15n*5 + 17n*5 + 119n*2 - 31n*5 + 17n*2 wrt n? 60n*2 + 24n Let n(p) = p*2 + p. Let x(m) = 3042m*2 + 8m + 1644. Let o(k) = -10n(k) + x(k). Find the second derivative of o(f) wrt f. 6064 What is the second derivative of 948g*2 + 69g - 45g3 + 47g*3 - 2396g - 1173g2 wrt g? 12g - 450 Let f(r) = 169r3 + 27r*2 - 3r - 4. Let t(i) = i + 31 - i*3 - 9 - 10 - 11. Let u(p) = f(p) + 4t(p). What is the third derivative of u(d) wrt d? 990 Let s(c) = -225c3 + 10c*2 + 4c - 7. Let r(o) = 670o3 - 29o*2 - 13o + 24. Let f(v) = -3r(v) - 10s(v). Find the third derivative of f(q) wrt q. 1440 Suppose -3v - 210 = -5v. Let f be 1/(-7) + v/49. What is the third derivative of -4h2 - 14h*4 - fh*4 + 0h*2 wrt h? -384h What is the derivative of -2z2 + 11z*2 - 25479 + 6643z*3 + 19282 - 9z*2 wrt z? 19929z2 Let j(o) be the third derivative of -o7/70 + 19o5/60 + 5o*4/24 - 1976o*3/3 + 8o*2 - 137. Find the first derivative of j(x) wrt x. -12x*3 + 38x + 5 Let p(q) be the first derivative of 73q7/42 + 187q*4/12 - 114q + 71. Let s(g) be the first derivative of p(g). What is the third derivative of s(z) wrt z? 4380z2 Suppose -11i + 81 = 16i. What is the second derivative of 24l + 13l + 1731l*i + 3 - 1634l*3 wrt l? 582l Let d(t) be the first derivative of -t*5 - 1/6t*6 + 0t*3 + 0t*4 - 33t*2 + 0t + 55. Find the second derivative of d(x) wrt x. -20x3 - 60x*2 What is the second derivative of 164v*3 - 60v + 265v3 + 2 - 545v*3 - 870v*3 - 138v wrt v? -5916v Find the second derivative of -424l + 2978l + 7806l + 271l + 3754l*2 + 961l wrt l. 7508 Suppose 3w + 34 + 83 = 3n, 2w = 4n - 148. Find the first derivative of 6g4 - 532g*2 - 4g*4 + 534g*2 + n - 4 wrt g. 8g*3 + 4g Suppose 0 = 4t - 5z - 8 - 28, -4z = 16. Differentiate 57d*t - 12d*3 + 12d*3 - 3 - 46 wrt d. 228d*3 What is the first derivative of -354 - 241b + 95b + 146b - 269b2 wrt b? -538b Let g(y) = 132y3 + 679y*2 - 4y - 8. Let m(n) = 3n3 + n + 2. Let q(d) = -g(d) - 4m(d). What is the third derivative of q(a) wrt a? -864 Let s(d) = -40d2 + 142d*2 + 40d2 - 25. Let w(n) = n2 - 2. Let u(r) = s(r) + 4w(r). Differentiate u(h) with respect to h. 292h What is the second derivative of -3019j3 - 2397j + 204j + 2836j*5 + 3019j*3 wrt j? 56720j*3 Let b(g) be the first derivative of 5/3g*3 - 242g + 0g2 + 3/4g*4 - 176. What is the first derivative of b(s) wrt s? 9s*2 + 10s Let d(s) be the third derivative of 7s6/40 + 3080s*3/3 + 2s*2 - 1431s. Differentiate d(f) with respect to f. 63f2 Find the third derivative of -32l*4 - 48l*4 - 85l*4 + 91l*4 + 614l*2 wrt l. -1776l What is the second derivative of 17003l + 246l*4 + 82l*4 - 21602l + 80l4 - 4l*3 wrt l? 4896l*2 - 24l Let o be 7 + 1 - (3 - (-15)/(-3)). Let j be 6o/(-15) + 6. Differentiate 14 - 7f + j - 30 - 3 with respect to f. -7 Let l = 835 + -691. Find the third derivative of 36p4 - 60p*6 + 35p*4 + lp*2 + 39p*4 - 140p*4 + 32p*4 wrt p. -7200p*3 + 48p What is the third derivative of 23j2 + 63j*2 - 479j*2 + 580j*4 - 172j*2 wrt j? 13920j Let i = -52 + 58. Let n(q) be the first derivative of 9q3 - 25 + 1 - iq*4 - 7. What is the third derivative of n(r) wrt r? -144 Suppose 14d + 6d = 7d. Let u(l) be the first derivative of 0l2 - 10 + 0l - 14/3l3 + dl*4 - 13/5l*5. Find the third derivative of u(n) wrt n. -312n Let b(o) be the first derivative of 88o5/5 + 3o4/4 - o3 + 196o2 + 1675. What is the third derivative of b(d) wrt d? 2112d + 18 Let t(h) = -19h4 - 5h*3 - 117h - 7967. Let z(u) = -10u4 - 3u*3 - 59u - 3985. Let a(n) = -3t(n) + 5z(n). Find the first derivative of a(c) wrt c. 28c3 + 56 Find the third derivative of -1935w*2 + 4348w*2 - 1960w*2 - 18w*3 - 2w*4 wrt w. -48w - 108 Let t = 483 - 442. Differentiate -208u2 + 209u*2 - 3u - 6u + t wrt u. 2u - 9 What is the third derivative of -13t3 + 789t*3 - 15 + 8 + 7 + 1821t*2 wrt t? 4656 Let a(b) be the first derivative of 60 + 30b + 1/3b3 + 3/2b*2. Differentiate a(r) wrt r. 2r + 3 Let t(y) = -y*2 + 7y + 3. Let l be t(7). What is the second derivative of -184c - 569c*l + 588c*3 + 3c*5 + 2c*5 wrt c? 100c*3 + 114c Let i(y) be the second derivative of -236y6/5 + 100y*4/3 - y - 25. What is the third derivative of i(s) wrt s? -33984s Let n(k) be the first derivative of 5454k5/5 + 7k3/3 - k2/2 + 3k - 603. Find the third derivative of n(g) wrt g. 130896g What is the second derivative of -140b2 - 3117b*2 + 6415625b - 6414517b + 1 wrt b? -6514 Suppose 15 = -3v + 198. Let p = 63 - v. Find the third derivative of -3j2 + 4j6 + j6 - 4jp wrt j. 600j*3 Find the third derivative of -943h*4 - 3h*3 - 962h*2 + 6263h - 6265h + 0h*3 - 1 wrt h. -22632h - 18 Suppose 0 = -7p - 3 + 10. Let x be (-10 + 5 - -5)p/2. What is the third derivative of -7g2 - 20g*5 - 2g*5 - 12g*5 + xg*5 wrt g? -2040g*2 Let u(y) = -1902y - 333. Let l(x) = 1889x + 335. Let z(q) = -6l(q) - 5u(q). Differentiate z(m) with respect to m. -1824 Let m(c) be the third derivative of -8093c*4/24 - 6589c*3/6 + 12c*2 + 177c. Differentiate m(q) with respect to q. -8093 Find the second derivative of 30 - 323j5 - 159 - 762j*5 - 4 - 4j wrt j. -21700j3 Let p(j) = -37j*2 + 3j + 47. Let d(g) = -72g2 + 7g + 93. Let n be (-138)/322 - 52/(-7). Let s(f) = np(f) - 3d(f). Differentiate s(k) with respect to k. -86k Let n(o) be the second derivative of 7o*5/20 - 35o*4/8 - 31o*3/6 + o + 4. Let d(g) be the second derivative of n(g). What is the derivative of d(s) wrt s? 42 Let f(a) be the third derivative of 49a*5/4 - 85a*4/4 + 2260a*2. Find the second derivative of f(o) wrt o. 1470 Let u(a) = 2a*3 - 11a*2 + 5a - 64. Let d be u(6). What is the second derivative of 12157i2 - 270i*3 - 20i - 12157id wrt i? -1620i Differentiate -962d - 1703d + 2255 - 10 - 1450 + 2641 with respect to d. -2665 Let v(b) be the third derivative of -217b4/24 - 12b*3 - 1122b*2. What is the derivative of v(x) wrt x? -217 Let o(p) be the first derivative of 49p*5/30 + 8p*3/3 - 106p*2 + 42. Let a(k) be the second derivative of o(k). Find the first derivative of a(v) wrt v. 196v Find the first derivative of 28s - 38s*2 + 1517 - 2s*3 + 18s*2 + 20s*2 wrt s. -6s*2 + 28 Let q(d) be the second derivative of 0d*6 + 1/4d*4 - 13/2d*3 - 32d + 0d2 + 0 - 23/21d*7 + 0d*5. What is the third derivative of q(x) wrt x? -2760x*2 Let u = -656 - -658. What is the first derivative of 274 - 50s*u + 6 - 71s*2 wrt s? -242s Let f = 358 + -353. Find the second derivative of 20b - 38b*f + 6b - 36b5 + 49b*5 wrt b. -500b**3 Let w be (12/(-7	{ "pile_set_name": "DM Mathematics" }
nded to the nearest 1000? 11000 Suppose 2y + 605340 + 1610370 = 0. Let g = y + 2407859. Let b be (g - 3) + 2 + -3. Round b to the nearest 100000. 1300000 Let q = -2975.807 - -2992.8. Let g = 17 - q. Round g to three dps. 0.007 Suppose -2k = -1 + 25. Let s be (3200/6)/(k/1350). What is s rounded to the nearest ten thousand? -60000 Let t = -40.0007024 + 0.0088024. Let k = -31.5 - 8.5. Let j = t - k. What is j rounded to 3 decimal places? 0.008 Let l = -9539 - -9570.927. Let h = l - 32. Round h to 2 dps. -0.07 Let d = 0.6 + -0.1. Let c = -1.5 + d. Let h = c + 1.002. Round h to three dps. 0.002 Let u = 18 + -11. Let l = 0.5 - u. Round l to 0 dps. -7 Let z(i) = 608i3 - i2 + i - 2. Let f be z(2). What is f rounded to the nearest 1000? 5000 Let g = 112 + -112.0000036. Round g to six decimal places. -0.000004 Suppose 10 + 6 = -4v. Let s = -1 - v. Let l be (-330)/(3/(-6000)s). What is l rounded to the nearest one hundred thousand? 200000 Let v = 0.0319936 - 0.032. Round v to 5 decimal places. -0.00001 Let x = -1 + 0. Let j be x + (-2)/(0 + -2). Suppose jr - 2r = -780. What is r rounded to the nearest 100? 400 Let u = -38 + 38.174. What is u rounded to 2 dps? 0.17 Let b = 0.8 + -0.79999928. What is b rounded to 7 decimal places? 0.0000007 Let a be 110/10 - 6/2. Let o be a/(-12) - 120002/(-3). What is o rounded to the nearest ten thousand? 40000 Let h = 43 - 42.46. What is h rounded to one decimal place? 0.5 Let j(y) = y3 - 5y*2 + 2. Let m be j(5). Suppose mn + 5 = -89. Round n to the nearest ten. -50 Let j = -10.12 - -0.12. Let s = j + 10.00288. What is s rounded to 4 dps? 0.0029 Let s = -0.1627 + 0.202. What is s rounded to three decimal places? 0.039 Let t = -0.2 + 3.2. Let d = -2.997 + t. What is d rounded to three dps? 0.003 Let w = 2 - 1.99999995. Round w to 7 dps. 0.0000001 Let x(c) = -199 - 522 - 835 - 344 - c. Let h be x(0). Round h to the nearest 1000. -2000 Let t = -7917.45530088 + 7914.8553. Let k = t + 2.6. Round k to seven dps. -0.0000009 Let f = 4.6 - 5.57. Round f to one decimal place. -1 Let t(g) = -509g3 - 9g*2 + 4g. Let q be t(-8). What is q rounded to the nearest 100000? 300000 Let w = -0.115 - -0.12. Round w to 2 decimal places. 0.01 Let i be 706/((-2)/(-136)2). Suppose 3 = l + 4, 2y + 4l + i = 0. Round y to the nearest ten thousand. -10000 Let y = -6034.12836 - 1.80164. Let j = -5948 - y. Let i = -87 + j. Round i to 1 dp. 0.9 Let n = -3.8 - 3.7. Let r = n + 7.5000098. What is r rounded to six dps? 0.00001 Let t = -855 + 585. Let z = t - -270.0121. Round z to three decimal places. 0.012 Let n = -4428 + 4419.9904. Let k = -8 - n. Round k to 3 dps. 0.01 Let v = 0.10953 + -0.01904. Let w = 20 + -19.91. Let h = w - v. What is h rounded to four dps? -0.0005 Let u = 0.092 - 0.882. What is u rounded to 1 dp? -0.8 Let p = -0.094 - -0.025. Let o = 0.0689917 + p. Round o to six decimal places. -0.000008 Let a = 77 - 105. What is a rounded to the nearest 10? -30 Let c be (-12)/((-1)/758). Suppose 5i + c + 84 = 0. Round i to the nearest 100. -300 Let w = 20.88 + 11.44. Let c = -33.026 - -0.026. Let n = c + w. Round n to one decimal place. -0.7 Let l = 17 + -6. Round l to zero decimal places. 11 Let l = -529 + 526.11. Let s = -3.07 + 0.07. Let y = l - s. Round y to one decimal place. 0.1 Let x be -6((-2)/10 - (-65991)/(-45)). Round x to the nearest 1000. 9000 Let b = -39.799 + 40. Round b to 2 decimal places. 0.2 Let y = 348.6 + -387. Round y to zero decimal places. -38 Suppose -2v - 297000 = v. Round v to the nearest ten thousand. -100000 Let g = 24.74 + 0.26. Let b = g - 22.72. What is b rounded to one dp? 2.3 Let x = 0.37 - 17.37. Let q = 16.999975 + x. What is q rounded to five dps? -0.00003 Let o = 2957002 - 11057002. Round o to the nearest 1000000. -8000000 Suppose v - 19036 = 59672. Suppose v = -n - 301292. Round n to the nearest 100000. -400000 Let u = -1423511111.9999927 - -1423511203. Let h = 91 - u. What is h rounded to six decimal places? -0.000007 Let t = 1.8 + 12.2. Let a = t - 14.00003. What is a rounded to five decimal places? -0.00003 Let f = 208 - 197.1. Let d = 59.1 + f. Let y = d - 69.99953. Round y to 4 decimal places. 0.0005 Let k = 16 - 15.955. Round k to two decimal places. 0.05 Let w(z) = 5z*3 + 5z*2 + 2z - 1. Let b be w(-3). Let m = b + 257. What is m rounded to the nearest 100? 200 Suppose 3u - 3 = -0. Let n be -1 + (u - -239997) + 3. What is n rounded to the nearest 100000? 200000 Suppose -105 = -31l + 26l. Round l to the nearest ten. 20 Let f = -12.7 + -1.3. Let p = -12.247 - 0.153. Let n = f - p. What is n rounded to zero decimal places? -2 Let w = 8.86946 + -5.86995. Let c = w + -3. Round c to 4 decimal places. -0.0005 Let p = -438.93 - -441. Round p to 1 decimal place. 2.1 Suppose 2p - p = -6667. Let z = p + 3167. What is z rounded to the nearest 1000? -4000 Let z be (2/(-5))/(1/(-110)). Let q be (-128)/(-22) - (-8)/z. Let c be (-4)/(-6) + 40796/q. Round c to the nearest one thousand. 7000 Suppose 0a = 4a + 3526304. Let j = a - -251572. Let c be (-8)/(-12) + j/6. Round c to the nearest ten thousand. -110000 Let i = 246274665.000113 + -246274402. Let f = -263 + i. What is f rounded to 5 decimal places? 0.00011 Suppose -3f - 90 = 2f. Let i be ((-6)/f)/((-1)/3). Round i to 1 dp. -1 Let q = 0.7737 + -0.742. What is q rounded to three dps? 0.032 Let b = 83.6 + -83.600000701. Round b to 7 decimal places. -0.0000007 Let s = 96.41 - 115.3932. Let g = -22 + 3. Let k = s - g. Round k to three decimal places. 0.017 Let c = -0.0459892 + 0.046. Round c to 6 dps. 0.000011 Let h(s) = 28288s - 16. Let z be h(7). What is z rounded to the nearest 100000? 200000 Let d = -0.025 - -0.265. What is d rounded to 1 dp? 0.2 Let i = -175.97 - -178. Let x = i - 0.03. Let u = -1.99995 + x. Round u to 4 dps. 0.0001 Let s = 0.4 + 2.2. Let x = s - -43.4. Let w = 45.99977 - x. What is w rounded to 4 dps? -0.0002 Let l(f) = -f3 + f2. Let h be l(1). Suppose -3q - 13 = -u, 2u - 2q = -hu + 6. Let r be (-6)/u - 10299997-1. Round r to the nearest 1000000. 10000000 Let g = 171 + -170.99838. Round g to four decimal places. 0.0016 Suppose -i + 5 = 3. Let x(s) = 318s2 - s - 2. Let j be x(i). Let g = 132 + j. What is g rounded to the nearest 1000? 1000 Let u = -23 - -23.00026. Round u to 4 dps. 0.0003 Let x(q) = q3 + q. Let p be x(1). Let i be p/((-4)/(-6)) + 1. Suppose -16655126 = -io - 4255126. Round o to the nearest 1000000. 3000000 Let i = -3300 + 1930. What is i rounded to the nearest 100? -1400 Let w = 0 - 1.6. Let s = 10 - 9.2. Let h = w - s. What is h rounded to zero decimal places? -2 Let b = 43.42 + -43. Let d = -0.4200029 + b. Round d to 6 dps. -0.000003 Let k = 11 + -12.4. Let x = k - -1.415. Round x to two decimal places. 0.02 Let d(p) = 624982p + 13810p - 10 + 275494p + 8. Let g be d(7). Round g to the nearest 1000000. 6000000 Suppose 5m = -0m. Suppose -16 = -3l + 2k, mk + k = -2. Suppose -2j = -5y - 2999992, -1087118 - 1312878 = ly - j. Round y to the nearest one million. -1000000 Let o = 2.091 - 1.88. What is o rounded to two dps? 0.21 Let g(p) = -95p*2 + 3p - 7. Let k be g(2). Round k to the nearest 100. -400 Suppose 0 = -c + 2c. Suppose z = l - 5803 + 20439, 3z = c. Let v = l - -8436. What is v rounded to the nearest 1000? -6000 Let u = 3125 - 3125.3087. Let z = u + 0.31. What is z rounded to 3 dps? 0.001 Let m(t) = 18t - 4. Let z be 34/4 - (-24)/16. Let l = 23 - z. Let h be m(l). What is h rounded to the nearest 100? 200 Let f = -281.1 + 266. Let k = f - -17. Round k to zero decimal places. 2 Let m(j) be the first derivative of 595/4j*4 - 3 - 4j - 2j3 + 5/2j*2. Let b be m(4). What is b rounded to the nearest ten thousand? 40000 Let t = -62 + -149. Let b = 43584539.00089 - 43584328. Let d = t + b. What is d rounded to 4 decimal places? 0.0009 Let a = 954035.98999977 - 954036. Let k = 0.19 - 0.2. Let r = k - a. Round r to 7 decimal places. 0.0000002 Let y = 0.111 + 0.734. Round y to 1 decimal place. 0.8 Suppose n = -1 + 5. Suppose 0c + n = c, -46000012 = 5h - 3c. What is h rounded to the nearest 1000000? -9000000 Let f = -6721350 + 6714547.054. Let n = 6783 + f. Let j = n + 20. What is j rounded to two decimal places? 0.05 Suppose 0 = 4*y - 0 - 20. Let	{ "pile_set_name": "DM Mathematics" }
8 = a. Suppose -4r = -2o + 6o, 3o = -r + f. Solve -3w + ow = 3 for w. -3 Suppose -5f = -3f + 3z - 45, 5z - 105 = -5f. Suppose 9m = fm. Solve -u + 2u - 3 = m for u. 3 Suppose -5o - 4t - 8 - 12 = 0, -2t - 10 = -5o. Solve 9u - 21 + 75 = o for u. -6 Let c(m) = -92m*3 - 280m - 560. Let k be c(-2). Solve 4n = -k + 708 for n. -7 Suppose 2j = 73 - 65. Suppose -3n = -jn - 4b, 2n - 3b - 22 = 0. Solve -7a + n = -3a for a. 2 Suppose 36o + 159 - 1776 = 3o. Solve -157 = -18v - o for v. 6 Let t = -417 - -421. Let c be ((-2)/t)/((-251)/(-42) - 6). Solve 3r - 15 + c = 0 for r. -2 Let b(a) = -9a - 741. Let i be b(-84). Solve -i = 38w - 281 for w. 7 Let x = -7415 + 7472. Solve 155l - 174l = -x for l. 3 Suppose 2t - 12 = -8. Let x be 0 + 196/22 - 40/(-440). Solve -x = -tk - 5 for k. 2 Suppose 0s = 2s - 8. Let f be ((-6)/s)/((-1)/2). Solve 2c + 10 = -fc for c. -2 Suppose 0 = -p + 2u + 148 + 229, 3u - 1846 = -5p. Let f = 373 - p. Solve 4b = 3b - f for b. -2 Let f(a) = 2a2 - 15a - 22. Let p be f(9). Let o be -5 + (22/p - (-102)/170). Solve o = 15z - 6z + 27 for z. -3 Suppose -3g + w = -4w - 41, -4g - w + 47 = 0. Suppose 0 = -3z - g, -p - 3z - 3 = 6. Solve 18 - 3 = -ph for h. -5 Let u = 3713 - 3679. Solve -139k - u = -122k for k. -2 Let w(h) = -18h + 21. Let d = 282 - 281. Let o be w(d). Solve 3a = -6 + o for a. -1 Suppose -2z = -j - 492, 0 = -4z - 2j + 382 + 594. Solve -2a = 33a + z for a. -7 Suppose -j - 11 = -15. Let k(s) = 8s - js3 + s3 + 2 + 10s*2 - 3s*2 + 2s*3. Let d be k(8). Solve dg = 7 + 3 for g. 5 Let y = 80 + -85. Let h be 4 - ((-20)/y)/(-4). Solve hp - 3p = 0 for p. 0 Let w = -48 - -51. Suppose -23 = -5g - wb, 0 = -5g + 2g - 5b + 17. Suppose 0 = -3v + g + 11. Solve -12c + 11c = v for c. -5 Suppose -439k + 444k = -4y + 37, -3y + 4 = -k. Solve kv + 9 = -1 for v. -2 Let c be 1050/(-45) + -34/18. Let q be (-1 + (-28)/8)/(c/32). Solve 7 = qj - 11 for j. 3 Suppose 3c = -15, -5z + 6c = 8c - 910. Solve -190x + zx = 30 for x. -5 Let z be 48 + 1 - ((-12)/(-11))/((-2)/(-11)). Solve 7y - z = -22 for y. 3 Let i = 145 - 187. Let a = -30 - i. Solve 7m - am = 0 for m. 0 Suppose -3i = -4c - 14, -2i - 11 = -3i - 5c. Suppose -2t + 11 = iw - 7w, -3t = 4w. Let g be -2 + 22/t - 11/(-22). Solve -j - g = j for j. -2 Let s = 615 + -592. Suppose 18m - 49 = s. Solve -md - 14 = -18 for d. 1 Let i(k) = k*3 + 2k2 + 6. Let t(h) = -h3 - 2h2 - 5. Let p(d) = 5i(d) + 6t(d). Suppose -9y + 19 = 37. Let n be p(y). Solve -2u = -n + 4 for u. -2 Suppose -769v = -768v - 14. Suppose 0 = -vu - 15u + 232. Solve ui = 3i for i. 0 Let r(x) = x - 3. Let f(g) = -g - 4. Let z(k) = f(k) - 2r(k). Let q be z(-1). Solve 0 = qm - 10 + 5 for m. 1 Suppose -254h = -250h + 252. Let x be (-4)/(12/h)9/27. Solve xk + 7 = -0 for k. -1 Let h(f) be the first derivative of 5f*2/2 - 44f + 59. Let c be h(9). Suppose 0z + z = 3. Solve -c = zg - 13 for g. 4 Let r = -8713 + 8744. Solve -rm = -48 - 76 for m. 4 Suppose 5k - 359 = -4b, -5b + 193k - 196k + 426 = 0. Solve 280 = 41a - ba for a. -7 Let f be (56/10)/(34/85). Suppose -6 = -3p, -4y + 2p = p - f. Let r(t) = -2t - 19. Let o be r(-11). Solve -11 - y = -oz for z. 5 Suppose -186 = 306s - 309s. Let a = -60 + s. Solve a = 5l + 12 for l. -2 Let z(a) = 13a3 - 19a*2 - 3a + 12. Let p be z(4). Let l = p - 524. Let v(w) = -w*2 - 7w - 2. Let g be v(-6). Solve lq - 16 = g for q. 5 Let l = -12 + 13. Let s be ((-2)/(-6) + l)36/8. Suppose s = 2t + 6. Solve -z + 3z = t for z. 0 Suppose 0 = -45r - 43r + 11r + 27720. Solve rg - 353g - 28 = 0 for g. 4 Let v be 132/(-99)(-87)/4. Suppose -vq + 227 + 324 = 0. Solve 2o = q - 13 for o. 3 Suppose 85 = 18l - 23. Suppose 4v = -3r + 17, -2r - 2 + l = -v. Solve c = -r + 1 for c. -2 Suppose 15958 = 131w + 71w. Solve 7u = -wu + 172 for u. 2 Suppose -2h = -c + 2h - 21, -3c - 28 = -5h. Let q be 238/221 - c/(-13). Let r be ((-72)/20)/((-2)/5). Solve r + q = 5x for x. 2 Suppose -14c = -25 - 31. Suppose 3w + cb = -b + 43, 2w + 3b = 29. Solve -w = 2u - 8 for u. -4 Let v = 438 - 422. Suppose 700 = vi + 60. Solve 17y + i = 7y for y. -4 Let b(k) = -7k3 - 17k + 3k2 + 1 + 54 + 6k*3. Let h be b(3). Solve -h = -g - 0g for g. 4 Let x be (55/(-33))/(1 + (-11)/6). Suppose 4m + m = -5h + 20, -xh = 0. Solve -4u - m = -0 for u. -1 Let z = -20181 - -20307. Solve 0 = -176q + 155q - z for q. -6 Let i be (-1)/(4/((-708)/(-3))). Let d = i + -11. Let c = 72 + d. Solve -c = -x - 0 for x. 2 Let p = 9355 - 9317. Solve -16g = p - 150 for g. 7 Let y(p) = -p2 + 2p + 77. Let w be y(9). Suppose -2n = -w + 8. Solve -nq = -7q - 4 for q. -1 Suppose -2i - 8 = 0, -5j = 3i + 4 + 8. Suppose 4a + ja = -4c + 4, 3a + 1 = -4c. Suppose -2z = -2k - 16, -k + ak = 16. Solve 3w + z = 7w for w. 3 Suppose 5r - 4a + 27 = 10, -3a - 6 = 0. Let n be (-2 - r) + (-21 - -27). Solve -16s - n = -13s for s. -3 Let c(s) = 31s - 4. Let y(f) = -32f + 5. Let h(p) = 3c(p) + 2y(p). Let g be h(-1). Let o = g - -32. Solve -o = -5n + 4 for n. 1 Let j(t) = t*2 - t - 1. Let f be j(-9). Let w = f - 87. Let z be ((w/(-3))/(-2))/((-4)/(-24)). Solve -zq - 2q = 4 for q. -1 Let l = -162 - -82. Let p = 85 + l. Suppose -m = 2a - 8, -2a + 4a = pm - 4. Solve 0 = -mg - 3g + 5 for g. 1 Let u = -279 + 256. Let x(d) = -6d - 133. Let a be x(u). Solve 3r - ar = -10 for r. 5 Let d = 11418 - 11412. Solve -do - 370 = -358 for o. -2 Suppose -94j = -6786 + 2556. Solve -j = 4i - 49i for i. 1 Let s be (-1 + 34)2/2. Let w = -792 + 764. Let a = s + w. Solve 0 = al + 12 + 8 for l. -4 Suppose -15v + 87 = -138. Let a(h) = h3 - 17h*2 + 32h - 20. Let t be a(v). Solve 5j - 15 = t for j. 5 Let x(i) = 24i + 11. Let m(j) = 24j + 11. Let y(n) = 4m(n) - 3x(n). Let w be y(0). Solve -w = 4t + 7t for t. -1 Suppose -3q = -i - i, 4q + 7 = 5i. Let o be (q + -1 + -2)(12 - 14). Solve -10 = og - 4g for g. 5 Let y = -18549 + 18585. Solve 228d - 222d = -y for d. -6 Let c = -14731 - -14773. Solve -8j - 102 = -cj for j. 3 Suppose 2m = -0m - 3f + 13, 0 = -2m + 2f - 2. Suppose 1 + m = x. Suppose 3c = -5l - 6, 2l - 10 = 3l + 5c. Solve s - x - 1 = l for s. 4 Suppose -5x + 5h + 84 = -101, -37 = -x - 4h. Solve 0 = xg - 186 - 36 for g. 6 Let x(q) = 6q + 327. Let k be x(-54). Solve 17w = kw for w. 0 Let f be (-8)/(-24)18(3 - -3). Solve 3d - 18 = -f for d. -6 Let j = 660 - 561. Solve 108v - jv - 45 = 0 for v. 5 Let u be 8/10 - (-40018)/(-110). Let o = u - -366. Solve -g - o - 1 = 0 for g. -4 Suppose -889t = -1040t + 24462. Solve 73v + t = 100v for v. 6 Let k be -1 + 12924/455. Let c be k/451 - (-2)/(-11). Solve 8o = co + 5 for o. 1 Suppose 11 - 37 = -a. Suppose -5j = 1 - a. Suppose s = -3s + t + 19, -jt = -s + 19. Solve sm = 3m - 3 for m. -3 Suppose -2h - 5a = -252, 58h - 4a = 59h - 138. Solve -63 = -127x + hx for x. 3 Suppose -48 = 2c + 40. Let f = c + 54. Suppose 3t = 2l + 18, t = l + l + f. Solve -t = -2k - 2k for k. 1 Suppose 0 = -32b + 331 - 14827. Let k = -445 - b. Solve kt + 9 - 1 = 0 for t. -1 Suppose -p = 4y - 39, 3y + 41p - 29 = 40p. Solve 9g = -28 + y for g. -2 Let x be (-165)/(-30) + -5 - 1129/(-6). Solve 0 = -xc - 13c + 35 for c. 1 Let p = 58 + -59. Let i be (-2 - p) + (-1)/((-5)/(-10)). Let n = 0 - i. Solve -nh = -2h + 2 for h. -2 Let a(k) = -k + 2. Let n = -116 + 156. Let q = -49 + n. Let h be a(q). Solve -h = 5z + 4 for z. -3 Let r(n) = 3n3 - 31n*2 + 20n - 363. Let m be r(11). Solve m = 19z - 34 for z. 7 Let l = 2307 + -2288. Solve -lf + 37 = 37 for f. 0 Let a(h) = h*3 - 30h*2 + 32h - 75. Let n be a(29). Solve -7o = -5o - n for o. 6 Suppose -5y = -5, 4w - 202 - 216 = 2y. Solve -57 + w = 12g for g. 4 Let q = -257 + 389. Let h = -127 + q. Solve -7z = -hz + 6 for z. -3 Let a(l) = -9l3 - l2 + l + 1. Let o be a(-1). Let b = -135 + 132. Let u be (-91)/(-21) + (-2)/b. Solve -9g = -ug - o for g. 2 Let y be -10 - (-10)/((-100)/(-11510)). Solve yw = 1128w - 52 for w. -4 Let q = -6959 - -7258. Solve 65g - 221 = q for g. 8 Suppose -z = 3z. Suppose 2n = -f - n - 15, 4n = -3f - 20. Suppose	{ "pile_set_name": "DM Mathematics" }
s? 2 Suppose -4j - 3x + 381 = 0, 0 = -j - x - 0x + 94. What is the tens digit of j? 9 Let z(s) = -12s + 3. Let o be z(2). Let b = 35 + o. What is the units digit of b? 4 Let w(d) = -d*3 + 4d*2 + 4d + 3. Let s be w(5). Let b = s + 4. What is the tens digit of (-5)/4(-10 + b)? 1 Let k be (1 + 1)/(7/21). Let u be (3/(-2))/((-3)/k). Suppose -2h - uh + 70 = 0. What is the tens digit of h? 1 Let g be 2/(-9) + (-2)/(-9). Suppose 0 = 5k + v, -k - 3k + 3v = g. Suppose -4a = -ka - 28. What is the units digit of a? 7 Let d be 5/(3/((-3)/(-1))). What is the units digit of 1 + 6/(-3) + d? 4 Suppose a - 17 - 5 = t, 4t = -a + 27. What is the units digit of a? 3 Suppose 0 = -w + 3b + 68, 2b = -3w + 98 + 128. Let z = w - 49. What is the units digit of z? 5 Suppose -a - 3z = -15, 3a - 32 + 3 = -5z. Suppose a = 3r - 6. Suppose -rp = -2 - 4. What is the units digit of p? 2 Let m = -27 + 18. What is the units digit of (-81)/(-12) + m/12? 6 Let u = -2 + 6. Let k = 3 - u. Let v = k - -11. What is the tens digit of v? 1 Let l(b) be the second derivative of b3/6 + 9b*2/2 - 4b. What is the units digit of l(7)? 6 Let x be 3/2(-12)/18. Let u(w) = -21w - 1. What is the units digit of u(x)? 0 Let j(a) = -a*2 + 4a + 5. Let k(t) = 2t - 8. Let z be k(6). Suppose -zh + 16 = x + x, 0 = 5x + 5h - 30. What is the units digit of j(x)? 5 Suppose 64 = 2i - 3t - 61, -2t = -i + 65. Suppose 0 = -2j + i + 31. What is the units digit of j? 3 Let l(v) = v*3 - 3v*2 - 18v - 3. What is the hundreds digit of l(8)? 1 Let j = 155 - 24. What is the hundreds digit of j? 1 Suppose -5q + 5j + 750 - 290 = 0, -2q = -3j - 187. What is the tens digit of q? 8 Suppose 369 = 19r - 16r. What is the units digit of r? 3 Let x be (-5)/((-2)/(-2) + -2). What is the tens digit of (x - 1 - 7) + 27? 2 Let f(k) = k*3 - 4k*2 - 6k - 3. Suppose 13 = 4t - 11. Let p be f(t). Let y = p - 20. What is the tens digit of y? 1 Let k(f) = -f2 + 8f + 7. Let z(c) = -c - 1. Let w(g) = -k(g) - 6z(g). Let r(j) = j2 - 1. Let b be r(2). What is the units digit of w(b)? 2 Suppose 0 = -g + 5 - 11. What is the units digit of (2/(-3))/(2/g)? 2 Let q = -50 + 198. What is the units digit of q? 8 What is the units digit of 10/60 + -47(-1)/6? 8 Let f(w) = -w + 65. Let m be f(0). Suppose 5g - 40 = m. What is the units digit of g? 1 Let q(g) be the first derivative of -g2 + g + 3. Let o be q(-1). What is the units digit of (o + 1 + -2)2? 4 Suppose -2g = -4g. Suppose gq + 4q = 44. What is the units digit of q? 1 Suppose 5x + 3 = 43. Suppose x = p - 0. Let j = 12 - p. What is the units digit of j? 4 Let q be (12/9)/((-2)/12). Let f(z) = -z2 - 10z - 3. Let g be f(-7). Let a = g + q. What is the units digit of a? 0 Let c = -21 + 25. What is the units digit of c? 4 Let u(d) = 126d3 - d2 + 3d - 2. What is the tens digit of u(1)? 2 Suppose -d + 12 = -4d, 72 = 4n + 2d. What is the units digit of n? 0 Let w(s) = 40s*2 - 1. What is the units digit of w(-1)? 9 Let f(p) = -20p*3 + 2p*2 + 2p + 1. What is the tens digit of f(-1)? 2 Let l = 14 - 11. Suppose w + 24 = lw. What is the tens digit of w? 1 Suppose -m = -3u - 7, -2m + 2u + 3 = -m. Let p be (12)/(3 + m). Let a = 4 + p. What is the units digit of a? 3 Let l(j) = j2 + 8j + 11. Let d be l(-5). What is the units digit of (2 + -4 - d) + 42? 4 Let c be 2(-2)/4 - -1. Let l be c + 3/1 + -1. Suppose lv + v = 33. What is the units digit of v? 1 Suppose b = -j + 3b, 0 = 2b - 2. What is the units digit of j? 2 Let g = 15 + -13. What is the units digit of (g/3)/((-10)/(-105))? 7 Suppose 2v + 3c = 3, -3c + 3 = -0. Suppose 8 = 4p - 2m, v = 3p + m + 2m + 3. Suppose -3 = -2j - p. What is the units digit of j? 1 Let n = -2 + 18. Suppose -5x + x = -n. What is the units digit of ((-6)/4)/((-3)/x)? 2 Let v be 16 - 3/(-2)-2. Suppose -vf + 15 = -8f. What is the units digit of f? 3 Let j = -122 + 183. What is the units digit of j? 1 Let n(h) = -h + 10. Let c(w) = 8w. Let p be c(1). Let t be n(p). What is the units digit of -5t(-2)/4? 5 Let n be (4/(-2 + 1))/(-1). Suppose -44 = no - 6o. What is the units digit of o? 2 Suppose -7 + 34 = -4p + z, 3z = 4p + 17. Let n be p/(-2)(-18)/8. What is the units digit of (-1)/((n/(-24))/(-3))? 8 Suppose -4i = -4u - 156, -2u = 3i - 0u - 92. What is the units digit of i? 4 Let r(q) = -3q - 12. Let b be r(10). Let w = b - -69. What is the units digit of w? 7 Let z be -12 - (3 + 1). Let h = z + 6. Suppose -4u + 26 = 2o - 0u, h = 5o - 4u - 51. What is the tens digit of o? 1 What is the hundreds digit of 1/(-3 + (-2 - 1222/(-244)))? 1 Let i(s) be the first derivative of -s4/4 - 5s*3/3 + 7s*2/2 - 7s - 7. What is the units digit of i(-7)? 2 Let k = 84 + 41. Suppose 0 = -3h + 8h - k. What is the tens digit of h? 2 Suppose -q - 13q + 1554 = 0. What is the units digit of q? 1 Suppose 5p + 36 = q, -7q + 2q + 2p + 65 = 0. What is the units digit of q? 1 Suppose 2c + 2a - 95 = 5a, -3a = -4c + 175. What is the units digit of c? 0 Let j = 833 - 509. What is the hundreds digit of j? 3 Let i(s) be the third derivative of 2s5/15 - s4/24 - s2. Let u be 9/(-45) + 12/10. What is the units digit of i(u)? 7 Let m(h) = -h2 + 9h - 3. Let r be m(7). Suppose -2g - r = -31. What is the units digit of g? 0 Let z = -106 - -159. What is the units digit of z? 3 Let w be 4/22 - (-101)/(-11). What is the units digit of 2/3 + (-30)/w? 4 Suppose -28w + 23w = -190. What is the units digit of w? 8 Let c(q) = -q3 + q2 + 104. What is the hundreds digit of c(0)? 1 Suppose -4j + 4f = -200, 0f + 121 = 2j + 5f. What is the tens digit of j? 5 Suppose -3h + 39 + 18 = 0. What is the tens digit of h? 1 Let i(k) = -4k - 5. Let a be i(-2). Suppose ac - 10c = -63. What is the units digit of c? 9 Suppose 2v + 2v - 4n - 8 = 0, n = -v - 8. Let t = v - -6. Suppose -t = -g + 4. What is the units digit of g? 7 Suppose 114 - 20 = 2m. What is the units digit of m? 7 Suppose -4j = -k + 33, -3j + 6j + 80 = 4k. What is the tens digit of k? 1 Let k(g) = 5g2 - 6g + 1. Let h(l) = -6l2 + 7l - 1. Let j(b) = 4h(b) + 5k(b). Let w = -5 - -7. What is the units digit of j(w)? 1 Let a(p) = p*2 + 6p + 15. What is the units digit of a(-6)? 5 What is the hundreds digit of 2891 - (6 + -9)? 2 Suppose 6a - a = 0. Suppose ap + 1 = p. What is the units digit of p? 1 Suppose -2s = 1 + 1. Let z be 0 - 46s. Let c = -15 + z. What is the units digit of c? 9 Let a(o) = o + 18. What is the units digit of a(-13)? 5 Let q = 7 - 3. Suppose 2z = 4t - 8, -qz = -t + z - 16. What is the units digit of t? 4 Let h(j) = 72j*2. What is the tens digit of h(1)? 7 Let j = -159 - -303. What is the units digit of j? 4 Suppose 5l = -0c - 4c + 99, -3l = 3c - 60. Suppose 0 = -4s - 5d + l + 12, 23 = 5s + d. Suppose sy - 42 = -6. What is the units digit of y? 9 Suppose 2t + 4y - 24 = 0, 0 = 2t - 2y - 2y + 16. Suppose 0 = ta - 4a + 3q + 29, 3a - 35 = -4q. What is the units digit of a? 3 Suppose 5x - 4l - 817 = 0, -5x + 0l + 827 = l. Suppose 121 = 2b - 5i, 3b - i - x = i. What is the tens digit of b? 5 Let v(f) = 6 - f2 + 0f*2 - 9f + 2f2. Let t be v(8). What is the units digit of 78/10 + t/(-10)? 8 Suppose 13 = -4f + 1, -12 = 3q - 4f. Let w = q + 13. What is the units digit of w? 5 Let h = 139 - 58. What is the tens digit of h? 8 Suppose 9 = 3s - 72. What is the tens digit of s? 2 Let h(k) = 7k - 35. What is the units digit of h(16)? 7 Suppose 230 = -9q + 4q. Let l = 65 + q. What is the units digit of l? 9 Let b be (-18)/(-15)(-10)/(-4). Let g = b - 1. What is the units digit of 3g/6 - 0? 1 Let d = 66 + -12. What is the tens digit of d? 5 Let q = 11 - 8. Suppose 2j - 8 + 4 = 0. Suppose -qs = 4x - 19, 5x - 2s - j = -7. What is the units digit of x? 1 Let s = -2 - -7. Suppose 2a - 10 = -2x + 4, sa - 5x = 45. What is the units digit of a? 8 Suppose 54g - 50g = 1544. What is the tens digit of g? 8 Let h = 8 - 2. Let d be h(3 + -5)/6. Let r(q) = -6q - 2. What is the units digit of r(d)? 0 Let q = 1 + -4. Let t = q - -5. What is the units digit of t? 2 Let z be (-2)/(-4) - (-3)/2. Suppose zr - 34 = -3n + 4r, 0 = 2n + 3r - 1. W	{ "pile_set_name": "DM Mathematics" }
104? (a) -0.3 (b) 9 (c) 0 (d) -1/7 (e) -3 (f) 243 b What is the closest to -4/21 in 2, -555, -0.2, -4? -0.2 Which is the closest to 0.0696? (a) 1 (b) -10/7 (c) 0.068 c What is the closest to -1 in 0.092, 920, -8/7? -8/7 What is the nearest to 0 in -40, 50, -26.5, -0.1? -0.1 What is the closest to -279 in -3/8, -3, 0.16, 0.05, 0? -3 What is the closest to 1/5 in -2/5, -3/2, 1/62, 1388? 1/62 Which is the nearest to 0.7? (a) -2.8 (b) 0.2 (c) 4648 (d) -5/2 b Which is the nearest to 1/10? (a) -0.11 (b) -0.3 (c) -2 (d) 3306 (e) -0.4 a Which is the nearest to 1/15? (a) 3 (b) 19 (c) -4 (d) -1/2 (e) -0.16 (f) -1437 e Which is the nearest to 68? (a) 5 (b) 2/69 (c) 4 (d) 1/398 a What is the closest to 22 in -2.78, -3/10, -4? -3/10 What is the nearest to 1/52 in 2, 0.4, 5, 0.1, 9843? 0.1 What is the nearest to 4351 in -3, 330, 6? 330 Which is the closest to -0.4? (a) -2/9 (b) -2 (c) 0.89976 a Which is the closest to -12? (a) -5/16 (b) 1/20 (c) -5/54 a Which is the nearest to -64? (a) 0.3 (b) -323 (c) 5 (d) -4/9 (e) -3/4 (f) 0.07 e What is the nearest to 0 in -5/2, 0.063, 4/5, 2320? 0.063 What is the closest to -0.1 in -10, 430/233, -1/51, -3, 4? -1/51 What is the closest to 4361 in -0.2, 0.05, -11, 2/7? 2/7 What is the closest to 0.1 in 4, 9/2, 3000, -2, -4? -2 What is the nearest to -1/51 in 2105, -5, 5? -5 Which is the nearest to 3? (a) 3 (b) -4.348 (c) -20 (d) 2/17 (e) -4/5 a Which is the closest to -1/6? (a) 0 (b) 0.88 (c) 3.8 (d) 95/6 (e) 3 a What is the closest to -148 in 0.02, -2/7, 2, 9/28? -2/7 What is the closest to -4.51 in -0.4, 2, -0.19, 3, 0.27, 4? -0.4 What is the nearest to -5 in -139.772, 1, 1/5? 1/5 What is the nearest to -3 in 5, -1/3, -62, 6, -33? -1/3 What is the closest to -0.3 in -4, 9/4, 5/22, 12, 1/5? 1/5 What is the nearest to -0.13 in 1/62, 2, -346/11? 1/62 What is the nearest to -18 in 5969, 2, -10? -10 What is the closest to 0.1 in 1, -1162/19, -366? 1 Which is the closest to -51? (a) 16 (b) -5 (c) 3 (d) -4/25 (e) 5 (f) -12 f Which is the nearest to -4? (a) 3 (b) 0 (c) -0.3 (d) -2.5 d Which is the nearest to 1/3? (a) 48.9 (b) 59 (c) -3/8 (d) 2 (e) 0 (f) -3/7 e What is the nearest to 0.59 in -0.3, 1, -0.033, 192? 1 Which is the nearest to 15? (a) -809 (b) -0.5 (c) -0.1 c Which is the closest to 0.107404? (a) 4 (b) -0.27 (c) 2 b Which is the closest to -9? (a) 2 (b) -5/3 (c) 4 (d) -3.094 (e) -5 (f) -1/2 e Which is the nearest to -373? (a) 0.1 (b) 1 (c) -3 (d) -1 (e) 56 c Which is the closest to -0.3? (a) 0.09 (b) 41697 (c) 2/7 a Which is the nearest to -5/486? (a) -0.1 (b) 81/2 (c) 4 a What is the closest to 5 in -1/25, 4, -19, 0, -4, 60/13? 60/13 What is the nearest to 17.6 in -2, -0.3, -2471, -0.5? -0.3 What is the nearest to 250.5 in 8/7, -28, 0.5, -5, -1/8, -0.1? 8/7 What is the nearest to -0.188 in -14, -101, -4, 1? 1 Which is the nearest to -2/21? (a) 2/7 (b) 0 (c) -0.02 (d) -4/5 (e) 3/7 c What is the nearest to -0.1 in -3, 0.13, 1771895? 0.13 What is the nearest to 0.4 in -0.07, -2/3, -18.886? -0.07 Which is the closest to -11? (a) -268475 (b) 5 (c) -0.3 (d) -1 (e) 1 d What is the nearest to 1 in 7.9, 40, 2/5, -32, -0.3? 2/5 What is the nearest to -2/5 in -1/4, 8, 3430? -1/4 Which is the closest to -0.1? (a) -92 (b) 1/13 (c) 5 (d) 1/5 (e) 2 b What is the closest to 2.6 in 112, -2649, -2/5, -2/3? -2/5 What is the nearest to -182 in 3, -1, 21, -3? -3 What is the nearest to 1 in 1/4, -2, 33374/3? 1/4 Which is the nearest to 1? (a) 3 (b) -4 (c) 452146 a Which is the closest to -1.2? (a) -2 (b) -1.4478 (c) 5/6 (d) 3 (e) 4 b Which is the nearest to -0.2? (a) -9 (b) 163/7 (c) 0 (d) 5 (e) 0.1 c Which is the closest to -4? (a) -350 (b) 0.46 (c) 30 b Which is the closest to -5/3? (a) 3/5 (b) 1/4 (c) 3/7 (d) -0.06 (e) -14 d What is the nearest to 1 in 1081, 11, -176? 11 Which is the nearest to -1/4? (a) 3 (b) -7 (c) -23 (d) -74 a Which is the closest to 1? (a) 0.24 (b) 9731 (c) 0.5 (d) -0.2 (e) 2/13 c Which is the closest to -124? (a) 1/4 (b) 0 (c) 229.9 (d) 4 (e) -5 e Which is the closest to -2/5? (a) 40 (b) 14 (c) -5 (d) 57 (e) 2/3 e What is the nearest to -0.485 in 0.5, 1/9, 3/1802, -4? 3/1802 What is the closest to 18/5 in 2/25, -1/22, 0.03, -2/19? 2/25 What is the closest to 100 in 3, -19179, -7? 3 What is the nearest to 197 in -4, -15, -2.2, -3, 1/6? 1/6 What is the nearest to -1 in 7, 0.5, -5, 2/15737, -4/3, 0.202? -4/3 Which is the nearest to -0.9? (a) -18.735 (b) 0.3 (c) 0.5 (d) -0.1 (e) 2.7 d What is the closest to -3 in 0.5, 43, 4767? 0.5 What is the nearest to 10112 in -1, 1, 2/13, -1/4, -3/2? 1 What is the closest to 364 in 2/1435, 0.3, -0.3? 0.3 Which is the closest to -32/35? (a) 2/5 (b) 1/6 (c) 4 (d) 4121 (e) 0.2 b Which is the nearest to -1.1? (a) 3 (b) -5/11 (c) -6 (d) 1775 b Which is the nearest to -7? (a) -0.8 (b) -0.028 (c) -2/349 a Which is the closest to 3/2? (a) -1/4 (b) 1 (c) 512.36 (d) -4 b Which is the nearest to 752? (a) 26 (b) -3 (c) -4/79 (d) -5 a Which is the nearest to 1/4? (a) -5 (b) -30 (c) -4 (d) -3 (e) 0.263 e Which is the closest to -24/71? (a) 0.5 (b) 9 (c) -17 a Which is the closest to 0.2? (a) 231 (b) 1.3 (c) -3 (d) -16/13 b Which is the nearest to 0.7107? (a) -56 (b) 0.6 (c) 1/4 (d) 0.3 b What is the closest to 0.1 in 2/27, -4, 3, -3/409, -0.2, -14/9? 2/27 Which is the nearest to 0.2? (a) 5/4 (b) 2/19 (c) 3.61 (d) 13 (e) -0.083 b Which is the closest to -2/929? (a) -0.04 (b) -4 (c) -10.46 a What is the nearest to 708/13 in -1/4, 2/3, -105, -2, 1/3? 2/3 Which is the nearest to 4? (a) 0.8 (b) 4 (c) 3 (d) 14/33 (e) 0.13 b Which is the nearest to 2/259? (a) -3/4 (b) 23782 (c) -0.4 (d) -2 c What is the nearest to 0 in 249, -39, 2/233? 2/233 What is the nearest to 3/4 in -6/287, 0.5, -14, -7? 0.5 Which is the nearest to -4.8? (a) -1 (b) 2/13 (c) -0.298 (d) 556 (e) -4 e Which is the nearest to -1? (a) -5 (b) 35 (c) -1.5 (d) 0.5 (e) 1 (f) 21/22 c Which is the closest to 0.1? (a) -1.4 (b) 1.35 (c) 1/3 (d) -0.46 c What is the closest to 2/27 in -2/9, -29.40033, -3? -2/9 What is the nearest to -1/37 in 3.9, 65, 7? 3.9 Which is the closest to 2/13? (a) 5 (b) 0.5 (c) -0.2 (d) -2482 (e) 2 b What is the nearest to 4/5 in -4, 4658, 0, -2.5, 0.1? 0.1 What is the nearest to -45/2 in 0.18, 2/25, 2/5, -1/3? -1/3 Which is the closest to 0.02? (a) 0.07 (b) 3/7 (c) -5 (d) -2.669 a Which is the closest to 1.2? (a) 2 (b) -0.24 (c) 794.1 a What is the nearest to -1222 in -0.024, 2/15, -189? -189 Which is the nearest to 0.5? (a) 546 (b) -4/7 (c) 124 b Which is the nearest to 0? (a) 58155 (b) 26 (c) 4 c Which is the closest to -1? (a) 0.5 (b) -4676.59 (c) -9 (d) 3 a What is the closest to 1 in -2/21, 5257, -3, -2/5, 3/8, -2? 3/8 What is the closest to -5.08 in -1/4, 10/21, 5, 2/7? -1/4 What is the nearest to 87 in -4, -0.4, -6956? -0.4 What is the nearest to -7 in -10, 212, -0.209? -10 What is the nearest to -86 in -5/3, -8478, 5, 3, 1/6? -5/3 Which is the closest to 0? (a) -1 (b) 0.1 (c) -2/3 (d) 0.4 (e) 42 (f) -7 b Which is the closest to -0.07? (a) 17 (b) -34 (c) -389 a Which is the closest to 0.1? (a) 30374 (b) 0.3 (c) -5 (d) -0.2 (e) -48 b Which is the nearest to -1/654? (a) -14 (b) -0.13 (c) 0.08 c Which is the closest to -725/18? (a) 1/2 (b) 0.6 (c) -0.5 c What is the closest to -3/11 in 124/33, -0.5, 2/11, -5.4, 2, -3? -0.5 Which is the nearest to -0.05? (a) 5/46 (b) -4 (c) 0 (d) 0.19 (e) 3/4 c What is the closest to -1966.9 in -0.4, -2/3, 104? -2/3 Which is the nearest to -0.028? (a) 0.4 (b) -5/11 (c) -615 b What is the nearest to -1/5 in -5, 2/3, 0.1, 910? 0.1 What is the nearest to 1/3 in 0.08, -1/4, 0.03, 20/11, -0.8? 0.08 Which is the nearest to -34? (a) -16/39 (b) -3/5 (c) -1/3 (d) 1 b What is the nearest to -0.06 in 3/22, -2.5, -8, 10? 3/22 What is the nearest to 88 in -21.8, -0.5, -1/4, -5? -1/4 Which is the closest to 1/57? (a) 4 (b) -13795 (c) 14 (d) 2 d Which is the nearest to 12? (a) -37 (b) -3 (c) 4 (d) -2/11 (e) 1.8 (f) 3 c Which is the closest to 8? (a) 0 (b) -21.97 (c) 702 a What is the closest to 0.65 in 0.3, 0.	{ "pile_set_name": "DM Mathematics" }
mplify (o/(o*(-2/21)o))/(o*(-5)o) assuming o is positive. o*(86/21) Simplify dd*(-9)/ddd(-5/9)/d assuming d is positive. d(-86/9) Simplify kk/k*(5/13)kkk/(kkk/(k*(2/27)k)) assuming k is positive. k*(944/351) Simplify gg*(-3)(gg(-2/7))/g(ggg(-1))/g(-1/6) assuming g is positive. g(-47/42) Simplify (o3o)/(o/(o4o))(o(-1))44 assuming o is positive. o(-36) Simplify f(-6)/(ff/(f*(-5/6)f))f/(ff/(f/f*3))f/(f/(f*2f)) assuming f is positive. f(-47/6) Simplify i/((i/i(-1/3))/ii)iii*(1/3)i((i/((ii(5/4))/i))/i)/(i/i(-8)) assuming i is positive. i(-29/4) Simplify (f/f(1/6))(1/14) assuming f is positive. f(5/84) Simplify (uuu(uu/((uu(-8))/u))/u)(1/21) assuming u is positive. u(4/7) Simplify (aa(-13))(-46) assuming a is positive. a*552 Simplify xx/x*(6/11)xxx(-28) assuming x is positive. x(-270/11) Simplify ((u/u(11/4))/(u(-2/9)u))(-29) assuming u is positive. u(2639/36) Simplify (h/h(-2/15)h/(hh5))/((h/(hh(3/4)))/(h(-1)/h)) assuming h is positive. h(-307/60) Simplify l8/l16 assuming l is positive. l(-8) Simplify (x*1/(xx*4x))/(x*(-3/5)xx(-3/8)) assuming x is positive. x(-201/40) Simplify (m(-1/7)m(-1/5)/m)(15/7) assuming m is positive. m(-141/49) Simplify (x(7/2))(-37) assuming x is positive. x(-259/2) Simplify ((m37/m)/m)/m(4/15) assuming m is positive. m*(521/15) Simplify (f/(ff*(-6))f(-1/3))(-25) assuming f is positive. f(-425/3) Simplify (v(-2))*(-2/3)/((vv2)/v)(-42) assuming v is positive. v*(256/3) Simplify (dd(ddd3d)/d)(-19) assuming d is positive. d(-133) Simplify r*(2/5)r*3(r/(r/(rr0r)))(5/4) assuming r is positive. r(59/10) Simplify (y*(-2/11)((((y(y/y(-1/4))/y)/yy)/y)/y)/y)25 assuming y is positive. y(-2125/44) Simplify (d/(d*(-4)d)ddd/(dd(-1/4)))(25/2) assuming d is positive. d(625/8) Simplify (u(-6/7))(-1/33) assuming u is positive. u(2/77) Simplify ((b3)(2/97))0 assuming b is positive. 1 Simplify (b(-2/13))*25(b(1/6))(-2/17) assuming b is positive. b*(-2563/663) Simplify ww*13w11 assuming w is positive. w25 Simplify (qq/q(-3)qqq*(-3/5)qq)/(q(-6)/qq/((q(-3/5)/q)/q)) assuming q is positive. q(59/5) Simplify (ddd(d14/d)/d)/ddd(d*15d)/d assuming d is positive. d31 Simplify (c/c(-5/6)c)/(((cc(cc*(-5))/c)/c)/c)c*(-4)/cc(-4/3) assuming c is positive. c(3/2) Simplify (z*(-14)z)/(z/(zz/(z/(zzz(-17)))z)) assuming z is positive. z*(-27) Simplify ((rr*(4/7)r)/r)/(rr(-2/5)r)(r1rrr)(-26) assuming r is positive. r(-3641/35) Simplify c*6cc(-7) assuming c is positive. 1 Simplify (g0)(-1/41)/((g(3/5)/gg)/(gg(-2/11))) assuming g is positive. g(12/55) Simplify (m/m(-27))45 assuming m is positive. m1260 Simplify ((c9cc)/cc(-3))(-14) assuming c is positive. c(-98) Simplify ((s/(s/s(-7)))/(s/(ss10/s)))/((s/((s/s(-4/5)ss)/s))/((ss*(6/11)s)/s)) assuming s is positive. s(294/55) Simplify (z/(z7/z))/((z*(-1/4)z)/z)(z/(z/z8))/((zz(-1/6))/z) assuming z is positive. z(41/12) Simplify (r(-1/25))(-2/27) assuming r is positive. r(2/675) Simplify (o/(o/o7)o(-2/11))(-13/5) assuming o is positive. o(-195/11) Simplify ((h/h5)/(h/h(-1/2)h))/(((((h/(h*(1/4)/h))/hh)/h)/h)/(h/(h/(hh(-5/4)h)))) assuming h is positive. h(-11/2) Simplify (j9j)/j(-1/15) assuming j is positive. j(151/15) Simplify (l0/ll/(ll(-3/5)l))13 assuming l is positive. l(-91/5) Simplify (d*(6/7)(dd0/dddd)/d)/(d*(-2)dd(-7)d) assuming d is positive. d*(69/7) Simplify (vv/v*(-1/3)vvv)*8/(vv(1/2))(-1/8) assuming v is positive. v(2057/48) Simplify ((p(2/27)/p)/(p(p(2/5)pp)/p))39 assuming p is positive. p(-5837/45) Simplify (m(-7/3))(-1/20) assuming m is positive. m(7/60) Simplify u(1/4)u/u(5/4) assuming u is positive. 1 Simplify (v(2/17)v)(-2/11) assuming v is positive. v(-38/187) Simplify (r/((rr/r*(-2/43)rr)/rrr))/(((r/r(-1/5))/r)/r) assuming r is positive. r(-698/215) Simplify m10mm/(m4m)(m3)(2/19) assuming m is positive. m(139/19) Simplify n/n2nn(-16)/nn assuming n is positive. n*(-16) Simplify (sss/(s/((ss*29)/s)s)s)/(s/s(1/43)) assuming s is positive. s(1291/43) Simplify p(-5)p(p/(pp/(p*(-6/7)p)p))/pp(p(2/7)p)/p0 assuming p is positive. p(-32/7) Simplify (kk(-8/11))/kk(-5/6) assuming k is positive. k(-103/66) Simplify ((g/(gg1/g))(-11))(19/5) assuming g is positive. 1 Simplify s34s/((s/s*(2/13))/ss) assuming s is positive. s*(444/13) Simplify (a(a/(a(a(-8)a)/a))/a)/a(-6/7) assuming a is positive. a(62/7) Simplify (y(2/7)/y(-1/2))/(y*(-5)/(yy*(-5/3)yy)) assuming y is positive. y(299/42) Simplify ((u/u(-2/3))/(((u(u(1/4)/u)/u)/u)/u))(-7) assuming u is positive. u*(-371/12) Simplify ((ww*(-2/15)www)/(w/(w/(w*6w))w))/((w/(w8w))/w(-5)) assuming w is positive. w(-17/15) Simplify ((mm(-3))/(m/(m/m(2/9))))/(m(-4)/(mm/(mm/m5)m)) assuming m is positive. m*(70/9) Simplify ((b/(bb/(bb/(b(b*(-4)/b)/b)bbb)))/(((b/b(-5))/b)/b))/(b(-5/6)(b/(b/(bb/((bb(-1/4)b)/bbb)bb)))/b) assuming b is positive. b*(67/12) Simplify (((m(m*(-1/4)/m)/mm)/mm)/mm)0/((m3/m)/(m*(1/3)m)) assuming m is positive. m(-2/3) Simplify (y/(y/y(-2/13)y))/(y(-2/91)y) assuming y is positive. y(-194/91) Simplify (i(-4)/((i/i*3)/ii))/(ii/(ii*(1/12))iii/i6) assuming i is positive. i(1/12) Simplify g(-6)/g(1/7) assuming g is positive. g*(-43/7) Simplify (b/(bbb3/b)b/(bb(-7)))/((b(2/23)/b)/bbbbb(bbb*4bb)/bbb) assuming b is positive. b(-163/23) Simplify j/j(1/6)j(-1) assuming j is positive. j(-1/6) Simplify j*(-21/4)j/(j/((jj26)/j)j) assuming j is positive. j(79/4) Simplify (h(-4)h(-1/2))/(h/(h9h)h/(h(-11)h)) assuming h is positive. h*(-13/2) Simplify ((f/(ff*(-2/5)))/ff)/ff(2/15)/ff*(-1/4)f(-4) assuming f is positive. f(-343/60) Simplify (ss(2/5))/(s(s*(-3/5)s)/s) assuming s is positive. s Simplify (k*(1/4)k)*(-28)((kk4k)/k)/((k*(2/15)k)/k) assuming k is positive. k(-452/15) Simplify (p(-2/13)pp)(-38) assuming p is positive. p(-912/13) Simplify (j(-7/3)/j)17 assuming j is positive. j*(-170/3) Simplify (uu*(-3/4)/u)/((u/(uu(-7/3)/u))/u) assuming u is positive. u(-37/12) Simplify (pp32)(2/5) assuming p is positive. p(66/5) Simplify y5/y5 assuming y is positive. 1 Simplify (bb(-2))(2/21)((bb(2/9))/b)(-40) assuming b is positive. b(-566/63) Simplify s(2/29)/s(s(24/7)/s)/s assuming s is positive. s(101/203) Simplify (v(-3/4))(-3/52) assuming v is positive. v(9/208) Simplify (v(-6))(-15/8) assuming v is positive. v(45/4) Simplify (v1vv)(-2/67)v(-1/13)/v(3/7) assuming v is positive. v(-3628/6097) Simplify ((y/(y(-2/11)y))/y(y/(yyy(-1/5)))/y)/((y(-1/2)y)/y(-2/13)) assuming y is positive. y(-4679/1430) Simplify (g/(g(1/7)/g))/(g((g(g/((ggg1)/ggg))/g)/g)/g) assuming g is positive. g(41/7) Simplify ((y(-1/3)yy)(-23))37 assuming y is positive. y(-4255/3) Simplify (k(-2)/kkk)(2/17) assuming k is positive. k(-2/17) Simplify ((r(1/3)/r)/(r/r(2/17)))(-5) assuming r is positive. r(395/51) Simplify (q8qqq/q*(-8))/(q/(qq(1/4)))(-32) assuming q is positive. q*11 Simplify ii*7i(-22)/i assuming i is positive. i(-15) Simplify (n(-2/5))(-1/3) assuming n is positive. n(2/15) Simplify (q/q1qqqq)*(-2/75)(qqq*(1/3)qq)41 assuming q is positive. q(4439/25) Simplify (h/(h/h(-2))hh(-2/11)hh)/((h(-1)hh)/hh)(-1/5) assuming h is positive. h(56/55) Simplify uu(u(u/(uu*(-1/4)))/u)/uuu(3/16) assuming u is positive. u(39/16) Simplify (k/(k/(k(1/30)/k)))/(k(4/3)/k) assuming k is positive. k(-13/10) Simplify ((n(-3))40)(-2/37) assuming n is positive. n(240/37) Simplify ((k/(k/k(-6/5))k)/k)/k*(1/4)kk1(kk/(kk**(6/7)/k))/k assuming	{ "pile_set_name": "DM Mathematics" }
from {d: 4, q: 7, j: 2, f: 1, x: 1, r: 2}? 1/170 What is prob of picking 2 u when two letters picked without replacement from zkkkzkkuukkzzzku? 1/40 Calculate prob of picking 4 j when four letters picked without replacement from {m: 1, j: 14, o: 2}. 143/340 Calculate prob of picking 4 x when four letters picked without replacement from {x: 7, s: 5}. 7/99 Two letters picked without replacement from pypygyp. What is prob of picking 2 y? 1/7 Two letters picked without replacement from {p: 2, h: 1, c: 4}. What is prob of picking 1 c and 1 p? 8/21 Calculate prob of picking 2 v and 2 i when four letters picked without replacement from iviceamv. 1/70 What is prob of picking 2 n when two letters picked without replacement from {m: 1, n: 4, q: 2, a: 4}? 6/55 What is prob of picking 1 x and 1 e when two letters picked without replacement from {e: 11, x: 2, o: 1}? 22/91 Three letters picked without replacement from {k: 6, o: 1, j: 3, i: 5, r: 2, a: 3}. Give prob of picking 3 i. 1/114 What is prob of picking 2 p when two letters picked without replacement from cgccpgccgkyk? 0 Three letters picked without replacement from qftzvff. What is prob of picking 1 z and 2 f? 3/35 Four letters picked without replacement from {q: 5, h: 13}. What is prob of picking 1 q and 3 h? 143/306 Three letters picked without replacement from cqqcq. Give prob of picking 2 c and 1 q. 3/10 What is prob of picking 1 e, 1 a, and 2 c when four letters picked without replacement from cawcahecccwsaca? 4/91 Calculate prob of picking 1 c and 3 d when four letters picked without replacement from mddmdmmdccmdcdfd. 3/52 Calculate prob of picking 1 e, 1 l, 1 h, and 1 u when four letters picked without replacement from {u: 8, r: 3, l: 2, s: 1, h: 4, e: 2}. 128/4845 Calculate prob of picking 3 u when three letters picked without replacement from {a: 4, u: 7}. 7/33 Calculate prob of picking 1 x and 1 u when two letters picked without replacement from uxuuuuuuuxuu. 10/33 What is prob of picking 3 g when three letters picked without replacement from glgg? 1/4 What is prob of picking 1 r and 1 i when two letters picked without replacement from {r: 1, j: 1, i: 1}? 1/3 Three letters picked without replacement from mbplbpbnb. What is prob of picking 1 m, 1 b, and 1 p? 2/21 Two letters picked without replacement from feefegeeellflgefee. Give prob of picking 1 l and 1 f. 4/51 Four letters picked without replacement from {c: 11, e: 9}. What is prob of picking 4 e? 42/1615 Calculate prob of picking 2 a when two letters picked without replacement from {v: 1, i: 1, z: 1, l: 1, a: 3}. 1/7 What is prob of picking 2 l when two letters picked without replacement from {l: 9, c: 4, k: 1}? 36/91 Three letters picked without replacement from zpqdkqzzzkzqzkk. Give prob of picking 3 q. 1/455 Four letters picked without replacement from accilliciaaaccicaal. Give prob of picking 1 i, 2 l, and 1 c. 6/323 Calculate prob of picking 1 b and 2 r when three letters picked without replacement from ibrr. 1/4 Two letters picked without replacement from {r: 1, v: 2, u: 2, f: 1, g: 2}. What is prob of picking 1 f and 1 r? 1/28 Calculate prob of picking 2 x and 2 p when four letters picked without replacement from xxwpwpxp. 9/70 What is prob of picking 1 s and 1 p when two letters picked without replacement from sdsssdddddpdddddssds? 7/190 Two letters picked without replacement from {g: 1, j: 2}. What is prob of picking 1 j and 1 g? 2/3 Calculate prob of picking 1 s and 1 j when two letters picked without replacement from xcmsjck. 1/21 What is prob of picking 3 v when three letters picked without replacement from svpvpsvsvsvs? 1/22 What is prob of picking 3 o and 1 k when four letters picked without replacement from rrrookrro? 1/126 Four letters picked without replacement from yokoyokoyyoooyox. Give prob of picking 1 x, 1 y, and 2 o. 1/13 Calculate prob of picking 1 o and 1 z when two letters picked without replacement from zozozottooztozptpo. 35/153 What is prob of picking 2 h and 1 k when three letters picked without replacement from {h: 8, k: 2}? 7/15 Calculate prob of picking 2 w and 1 t when three letters picked without replacement from {w: 4, t: 3, n: 1, j: 12}. 3/190 Calculate prob of picking 1 k and 1 o when two letters picked without replacement from syopeskoe. 1/18 What is prob of picking 1 d, 1 v, and 1 k when three letters picked without replacement from {v: 2, d: 3, k: 1, t: 1, z: 4}? 2/55 Two letters picked without replacement from rellmwsw. What is prob of picking 1 l and 1 m? 1/14 Calculate prob of picking 1 q and 2 u when three letters picked without replacement from uxuxq. 1/10 Three letters picked without replacement from {f: 1, n: 1, p: 3}. Give prob of picking 2 n and 1 p. 0 Two letters picked without replacement from {a: 18, o: 1}. Give prob of picking 2 a. 17/19 What is prob of picking 1 m, 1 x, and 1 p when three letters picked without replacement from {x: 7, p: 4, a: 1, m: 1, n: 4}? 7/170 Three letters picked without replacement from qmx. Give prob of picking 3 q. 0 Calculate prob of picking 1 q and 1 o when two letters picked without replacement from {h: 2, z: 1, q: 1, o: 3}. 1/7 Two letters picked without replacement from oaoddddadododoo. What is prob of picking 2 a? 1/105 Three letters picked without replacement from hahahqmaamabbmbhabz. Give prob of picking 1 m, 1 z, and 1 a. 6/323 What is prob of picking 1 j and 1 h when two letters picked without replacement from {c: 1, j: 1, h: 2, f: 1, k: 1, l: 1}? 2/21 Four letters picked without replacement from zvzzvhvv. What is prob of picking 4 v? 1/70 What is prob of picking 2 j and 2 m when four letters picked without replacement from {p: 2, s: 1, m: 2, b: 7, g: 1, j: 1}? 0 Three letters picked without replacement from {y: 5, t: 8}. What is prob of picking 1 t and 2 y? 40/143 Calculate prob of picking 1 l and 1 d when two letters picked without replacement from {r: 1, m: 3, d: 4, l: 1, f: 6}. 4/105 Two letters picked without replacement from {p: 1, m: 1, n: 9}. Give prob of picking 1 m and 1 p. 1/55 What is prob of picking 2 d and 2 f when four letters picked without replacement from rfkfrurffddfdd? 60/1001 What is prob of picking 1 a, 1 k, and 1 b when three letters picked without replacement from {a: 1, b: 3, u: 2, k: 10, j: 3}? 10/323 Three letters picked without replacement from {d: 8, e: 4, b: 1}. What is prob of picking 3 d? 28/143 Two letters picked without replacement from ccaciacb. Give prob of picking 1 i and 1 c. 1/7 Calculate prob of picking 2 u when two letters picked without replacement from {u: 10, v: 10}. 9/38 Two letters picked without replacement from ttbbttltbb. What is prob of picking 1 b and 1 l? 4/45 Two letters picked without replacement from {o: 1, i: 4, p: 6, t: 5, b: 3, m: 1}. Give prob of picking 2 i. 3/95 Calculate prob of picking 2 d when two letters picked without replacement from {w: 2, d: 10}. 15/22 Three letters picked without replacement from {b: 2, d: 10, o: 6}. Give prob of picking 2 o and 1 b. 5/136 What is prob of picking 2 a when two letters picked without replacement from {c: 1, d: 1, j: 2, r: 2, a: 2}? 1/28 Calculate prob of picking 1 o and 3 z when four letters picked without replacement from {o: 3, z: 5, b: 8}. 3/182 Calculate prob of picking 2 i and 1 r when three letters picked without replacement from {r: 1, i: 3, p: 1}. 3/10 Three letters picked without replacement from xiinxxzxxm. What is prob of picking 1 i, 1 z, and 1 x? 1/12 What is prob of picking 4 z when four letters picked without replacement from zzdzzdzz? 3/14 What is prob of picking 2 c when two letters picked without replacement from {c: 3, a: 4, w: 2, g: 2}? 3/55 What is prob of picking 1 j and 1 x when two letters picked without replacement from {j: 3, x: 8}? 24/55 Two letters picked without replacement from {z: 1, s: 2, q: 2}. Give prob of picking 1 s and 1 q. 2/5 Two letters picked without replacement from {p: 12, v: 7}. What is prob of picking 2 p? 22/57 Three letters picked without replacement from {k: 5, x: 10, h: 4}. What is prob of picking 3 h? 4/969 Two letters picked without replacement from {u: 4, w: 4, a: 5, k: 3, s: 1, i: 1}. Give prob of picking 1 u and 1 a. 20/153 Calculate prob of picking 1 o and 1 n when two letters picked wit	{ "pile_set_name": "DM Mathematics" }
+ 3w + 12 = 5b. Is p(b) a prime number? False Let i(u) = -132u2 + 2. Let q be i(-2). Let z = -349 - q. Is z composite? True Let p(n) = n3 - 2n*2 - 3n + 4. Let m be p(5). Suppose 2v - 4v + 4 = 0. Suppose vx + 159 = 3t, 2x = -t - x + m. Is t a composite number? True Let o = 2371 + -1322. Is o prime? True Let d(g) = 4g*3 + 6g*2 - 5g - 2. Let j be ((-2)/4)/((-1)/10). Is d(j) prime? False Let z(o) = 1 - 2o + 0 - 6 + o2. Is z(-4) composite? False Let p(d) = -7 - 3d3 - d3 - 2d3 + 5d*3 + 2d + 6d2. Let i be p(6). Suppose ig - 30 = 85. Is g prime? True Let g(t) be the first derivative of t*2/2 - t - 2. Let p be g(1). Suppose 4d + d - 235 = p. Is d prime? True Let g = 183 + 134. Is g a prime number? True Let m(j) = -j*2 + j + 3. Let g = 4 + -6. Let z = 2 + g. Is m(z) composite? False Is -121(-2)/(0 + 2) a composite number? True Suppose y - q = -11, -2y + q = -3 + 20. Let d be -10(-3)/y. Suppose d = -3b + 35 + 70. Is b prime? False Let s(l) = 3l2 - 6l - 2. Is s(7) prime? True Let l(z) = z. Let j be l(5). Suppose -u + 1 = -j. Suppose -un - 2t + 78 = -2n, 2n - 3t - 51 = 0. Is n a composite number? True Suppose 0 = -2q - q + 99. Suppose s + q + 81 = -5f, -f - s - 26 = 0. Let p = 1 - f. Is p composite? False Suppose -2u - 2l + 2394 = 0, 2u - 5u = -5l - 3575. Is u prime? False Let t be -6(21/6 + -2). Is (12/t)/((-4)/222) a prime number? False Let j(h) be the second derivative of h5/20 + h4/12 + 143h*2/2 + 8h. Is j(0) a prime number? False Suppose 4w - 2 = 10, 2o - 5w = -9. Suppose 0 = on - y - 4y - 179, -4n = 3y - 200. Is n composite? False Suppose 5q - 3u - 5752 = -0u, -u = -3q + 3452. Is q prime? True Suppose -10o = -12o - 516. Let z = -179 - o. Is z a composite number? False Let a be (2/6)/(5/6555). Suppose -q - 2o = -9, -4q + 3o + 21 = 6o. Suppose qr - a = -t, 588 = 5r - r + 4t. Is r a prime number? False Suppose 1101 = -3s + 6s. Is s composite? False Let q(w) = 11w2 - w - 13. Is q(14) composite? False Let q = -6 + 11. Suppose 2x - 2y = 6, -4x + 1 + 7 = -qy. Suppose v = 8 + x. Is v a prime number? False Let p(x) = 8x + 7. Let w(c) = 4c + 3. Let h(u) = -6p(u) + 13w(u). Let v be h(4). Suppose -4y = v - 89. Is y a composite number? False Let t be 162 - (-3 + 5 - -1). Let n = t + 92. Is n a composite number? False Suppose -l + 124 = 3l. Is l a prime number? True Let f(q) = -299q - 21. Let x be f(-6). Suppose -3j - 2i + 1753 = 0, -6j + 3i + x = -3j. Is j a composite number? False Let y(l) = 3l + 18. Let f(c) = -c - 6. Let n(b) = -17f(b) - 6y(b). Let p be n(-4). Is 4/p111/(-6) a prime number? True Let q(h) = -9h - 19. Let w be q(-8). Let u = 66 + w. Is u prime? False Let f(q) = 59q - 4. Let r be f(4). Let w = -106 - -255. Let l = r - w. Is l a composite number? False Let p(w) = 52w*2 + 2w - 1. Is p(4) prime? True Let j be (-2 - 3/(-3)) + -2024. Let d be 3/2 + j/(-10). Suppose -3p - 12 = 0, 3p + d = 4f + 7p. Is f composite? True Let u(j) = -4j3 - 3j*2 - j - 5. Is u(-3) composite? False Let q = 747 + -524. Is q prime? True Let w(s) = s + 11. Let q be w(-9). Suppose 5k = 37 - q. Is k a prime number? True Is 5 + -6 + -1 + -1 + 1216 a prime number? True Let n(h) = -3 + 1 + 3 + h + 5h2. Is n(2) a prime number? True Let r(h) = h3 - 3h*2 + 2h - 4. Let v be r(3). Let a(u) = 36u3 + u2 + 1. Is a(v) a composite number? False Suppose 113 = -3f - 4m - 3, 3m + 117 = -3f. Let w = f - -197. Is w prime? True Suppose 22 = -2b + 5x + 3, 3 = x. Let o = b + 6. Suppose 2p = -5h + 50 + 191, op + 155 = 3h. Is h prime? False Let m = 79 + -145. Let k = m - -119. Is k a prime number? True Let d(w) = -4 + 11w + 8w + 5. Is d(2) a composite number? True Let x be (-1 - -2)/((-2)/58). Let k = -12 - x. Suppose t - 20 = k. Is t prime? True Is (41 - (1 - 0)) + -3 prime? True Let n be 5(18/5 - 3). Suppose -nb - 4435 = -8b. Is b prime? True Let v(h) = -9 + 7h2 + 2h - 4h - h. Is v(-7) composite? True Let f(j) = -7j + 3j3 - j3 - j3 - 4 + 5j*2. Let o be f(-6). Suppose oq = 70 - 26. Is q a prime number? False Let l be 294 - (2 + -3 + 4). Let u(j) = -74j. Let m be u(1). Let a = l + m. Is a a prime number? False Let l(c) = 117c + 2. Let a be l(2). Suppose -5p + a = -p. Is p a prime number? True Let l(c) be the third derivative of c6/120 - c5/20 + c4/6 - c3/6 + 3c*2. Is l(7) a composite number? False Suppose 0 = -o + 3o - 4. Suppose 0 = -g + 80 - o. Suppose -r - r = -g. Is r prime? False Let c = 970 + -664. Let j(w) = -3w - 5. Let i be j(-3). Suppose -c = -iq + 50. Is q composite? False Let c = -3 - -3. Is -3 - c - (3 + -16) a composite number? True Let r = 243 - 167. Let u = r + -54. Is u a prime number? False Suppose -741 = -3l - 0l. Is l composite? True Let x = -486 + 877. Is x a composite number? True Let h(y) = -7y + 2. Let z be (3 - 8) + 3 - 3. Let k be h(z). Let v = k - 18. Is v prime? True Suppose 5i + 2q - 10 = 5q, 0 = i - q - 2. Suppose -if - 5 = 3f. Is f/(-2) - (-101)/2 a prime number? False Let c be 6/4 + (-18)/12. Suppose -k - k + 3j + 239 = 0, -k + 5j + 130 = c. Is k a prime number? False Suppose -3i + i - 127 = -5h, 39 = h + 3i. Let q be -12(h/12 + -1). Is 10/(-5)q/2 composite? True Let k(a) = -a - 4a + 0a + 2a*2 - 7. Let q be k(5). Let g = 31 - q. Is g a composite number? False Let s be 5/(5/2)-2. Let t be 2/s(-2 - -2). Suppose t = 5r - 166 - 79. Is r prime? False Suppose -13623 = -7u + 1798. Is u a composite number? False Suppose -3r + 5r + 244 = 0. Suppose 25 = -5h - 5f + 2f, 0 = 4h + 4f + 12. Is r/h - (-2)/(-8) a composite number? True Let q be (-2)/5 + 1568/20. Let m = q + 148. Suppose b = -b + m. Is b a prime number? True Suppose -2l + 4f + 278 = 0, 5l = 2f + 3f + 710. Is l prime? False Let f = 21 - 3. Suppose 0 = u - 182 + f. Suppose -3z + k = -u, -z = z - 3k - 121. Is z prime? True Suppose 2z - 5w + 94 = -0z, -3w + 94 = -2z. Suppose -314 = f - 5f - a, 0 = 5f + a - 392. Let p = z + f. Is p composite? False Suppose -3u + 2u = -4. Suppose uv + r = 2r + 73, v - 4r = 7. Is v composite? False Let o = -22 - -16. Let s be 4-6(-62)/o. Let r = s - -439. Is r a prime number? True Let b be (-42)/(-18) - 2/(-3). Let y be (b - 0)/3 + 1. Suppose -30 = -yd - d. Is d a composite number? True Let d(g) = 1164g2 + g + 2. Is d(-1) composite? True Suppose 2c - 31 = 157. Is -3 + c/(2 - 1) a prime number? False Let c = -550 - -3317. Is c a prime number? True Let t be (-369)/45 - (-1)/5. Let b(g) be the second derivative of -g*5/20 - 2g4/3 - g3/2 - 5g2/2 - g. Is b(t) composite? False Let h(v) be the third derivative of v8/20160 - v7/720 + v6/90 + v5/60 + v2. Let n(o) be the third derivative of h(o). Is n(6) a composite number? False Suppose -79 = 3r - 439. Suppose -2y + 50 = -4w, 0 = -4y + 4w - w + r. Is y prime? False Let f = -2 - -2. Suppose f = -4i + 10 - 6. Is 2 + 162 + (0 - i) composite? False Let i(s) = s2 + 12s + 10. Let f be i(-10). Suppose -5 - 8 = v. Is (1 + f)v/3 prime? False Suppose 0 = -5i + 3i + 3314. Is i a prime number? True Let g be (-6)/(-8)(9 - 1). Let s(l) be the third derivative of -l6/120 + l5/10 + l*4/24 + 2l3/3 - l2. Is s(g) a prime number? False Let r = 18 + -11. Suppose r - 4 = t. Suppose 51 = -2i + ti. Is i a prime number? False Is (-3 - -4)/((-1)/(-529)) a prime number? False Suppose 6b - b = 0. Suppose -4w = -2t - 38, 2w + 2t + 17 - 39 = b. Is w composite? True Let j be 4(-1 + -3 + 3). Is ((-2)/j)/(8/784) composite? True Is 1/(-5) + (-2496)/(-30) a composite number? False Let m(u) = 13u2 - 18u + 21. Is m(6) prime? False Suppose 0 = -u + 4u - 777. Let k = u + -96. Is k prime? True Is 1432/6 + 11/33 composite? False Suppose 6g = g + 5. Let k be g(1 - 2) - -1. Suppose j + kj - 22 = 0. Is j a composite number? True Is 2/(-4) + 1054/4 a prime number? True Suppose -5c - 3785 = -5g, -5g + 3817 = c + 2c. Is g composite? False Let u(n) = -2n2 + 33n - 35. Is u(14) a prime number? False Let t(m) = -2m3 - 12m*2 + 3m + 10. Is t(-7) a composite number? True Let j(r) = -r*3 - 6r*2 - 2r - 8. Let k be j(-6). Suppose 0 = k*d - 432 + 92. Is d a prime number? False Suppose 0 = f	{ "pile_set_name": "DM Mathematics" }
first derivative of -4/5t + 1/10t*4 - 3 - 1/5t*2 + 4/15t*3. Factor y(p). 2(p - 1)(p + 1)(p + 2)/5 Let i be 30/6 - (0 + 0). Factor -3ti + 4t4 + t3 + 4t5 - 2t4. t3(t + 1)2 Let q be (3/(-6))/((-3)/18). Factor d - d + 3d*q + 0d. 3d3 Let o = 118/213 - -8/71. Find r, given that -or*2 + 4/3r + 0 = 0. 0, 2 Let r = 40 - 40. Let k(l) be the third derivative of 0l + r + 0l*3 - 3l*2 + 0l*4 - 1/120l5. Factor k(d). -d2/2 Let q be 2/3(-9)/(-3). Suppose 5y - 4a - 27 = -0y, 4a = -5y + 3. Factor 10f + 6f*2 + 1 + y + 2f*3 + 2f*q. 2(f + 1)*2(f + 2) Let s(q) be the third derivative of q7/4200 - q6/600 + q5/200 - q4/24 + q*2. Let f(i) be the second derivative of s(i). Factor f(d). 3(d - 1)2/5 Let b(v) be the second derivative of v5/20 - 7v4/24 + 7v3/12 - v2/2 + 13v. Factor b(w). (w - 2)(w - 1)(2w - 1)/2 Factor 2/9n4 + 2/9n*3 + 0n - 4/9n2 + 0. 2n*2(n - 1)(n + 2)/9 Let x(z) = 2z*4 - 2z*3 + 5z*2 + 9z. Let u(w) = -2w4 + 2w*3 - 4w*2 - 8w. Let r(k) = -7u(k) - 6x(k). Determine m, given that r(m) = 0. -1, 0, 1 Let r(g) be the third derivative of -g5/20 - g4/4 - g*3/2 + 8g*2. Factor r(x). -3(x + 1)2 Let o(k) be the second derivative of -k5/20 - k4/4 - k3/3 + 39k. Determine f, given that o(f) = 0. -2, -1, 0 Suppose -27s = -20s - 35. Solve 3/2n*2 + 0n - 3/2n4 - 3/2n*3 + 0 + 3/2ns = 0 for n. -1, 0, 1 Let g(t) = -t4 + t*3 + 1. Let q be -4(1 - 10/8). Let y(u) = 2u5 - 3u4 - u3 + 4u2 - 2u - 1. Let z(m) = qy(m) + g(m). Solve z(w) = 0 for w. -1, 0, 1 Let d = -6 - -3. Let j = -2 - d. Let w(i) = 8i*3 - 6i*2 + 12i - 2. Let z(p) = p*3 + p. Let x(a) = jw(a) - 6z(a). Factor x(t). 2(t - 1)3 Let d(l) be the first derivative of -l4/18 - 4l3/9 - 4l*2/3 + 2l + 1. Let a(k) be the first derivative of d(k). Determine q, given that a(q) = 0. -2 Find m, given that 6m - 738m3 + m5 + 723m3 + 3m*2 - 3m*4 + 8m*5 = 0. -1, -2/3, 0, 1 Let p(x) be the first derivative of -7x*4/20 + 2x*3 - 18x*2/5 + 8x/5 - 6. Suppose p(f) = 0. Calculate f. 2/7, 2 Let o(n) be the third derivative of -n10/50400 + n8/11200 + 5n4/24 - 4n*2. Let k(j) be the second derivative of o(j). Factor k(h). -3h*3(h - 1)(h + 1)/5 Let h(z) = -2 + 4 + 7z*3 - 4z3 + z2 + 2z. Let n(w) = -10w*3 - 4w - 3w - 7 - 2w*2 - 2w*2. Let u(c) = 7h(c) + 2n(c). Factor u(i). i2(i - 1) Let r(c) = 4c3 + 14c*2 + 23c + 11. Let p(h) = h3 - h2 - h - 1. Let d(q) = p(q) - r(q). Factor d(b). -3(b + 1)(b + 2)*2 Let d be (-13)/(-104) + 30/16. Let s = 3/20 + 1/10. Factor sr*d - 1/2r + 1/4. (r - 1)*2/4 Solve -4/3m*5 + 8/3m*3 + 8/3m*2 - 4/3m - 4/3 - 4/3m4 = 0. -1, 1 Suppose -10 = -3g - 2g. Let w(t) be the second derivative of 1/40t*5 - 2t + 1/12t3 - 1/12t*4 + 0 + 0t*g. Factor w(r). r(r - 1)2/2 Let o(k) be the third derivative of -k6/360 - k5/45 - k4/24 + k*2 - 5k. Factor o(d). -d(d + 1)(d + 3)/3 Suppose -5j = s + 2, 2s = -j - 3s - 10. Factor -4/9x*4 - 4/9x*3 + 0x + 0x2 + 35/9x5 + j. x3(5x - 2)(7x + 2)/9 Let j(f) be the third derivative of -f7/4200 - f6/1200 + f*4/24 + 2f*2. Let x(h) be the second derivative of j(h). Factor x(y). -3y(y + 1)/5 Suppose 8 = 2n - 2. Suppose 2a + n = -5w - 1, 15 = -4w - 5a. What is d in 0d + 2/5d*3 + w - 2/5d2 = 0? 0, 1 Let y(s) = s2 - 4s + s + 2s + 2s. Let i be y(1). Factor 4/3j + 0ji - 4/3j*3 - 2/3 + 2/3j*4. 2(j - 1)*3(j + 1)/3 Suppose 4t + 4p = 1 - 9, -3t - 5p = 10. Let l(g) be the third derivative of -1/9g3 - 1/60g*5 + t + 5/72g*4 + 0g - g*2. Factor l(w). -(w - 1)(3w - 2)/3 Let n(p) be the third derivative of 0 + 0p*6 - 1/105p*7 + 0p*5 - 1/336p*8 - 3p*2 + 0p*3 + 0p*4 + 0p. Factor n(b). -b*4(b + 2) Find i such that -3i2 - 14i + 7i2 - 2i - 7 + 19 = 0. 1, 3 Find c, given that 51c4 + 2c*3 - 24c*4 - 25c*4 = 0. -1, 0 Suppose -3q + 0q + 33 = 0. Find p, given that -2p - 16p3 + 6p*4 + qp*2 + 5p*4 - 4p4 = 0. 0, 2/7, 1 Let w(z) be the second derivative of z6/90 + 4z5/45 + z4/6 - 9z*2/2 - 8z. Let m(h) be the first derivative of w(h). Factor m(y). 4y(y + 1)(y + 3)/3 Let i(x) = -4x*2 + 2x - 6. Let d(y) = y*3 + 9y*2 - 3y + 11. Let j be (-44)/6(-15)/10. Let w(b) = ji(b) + 6d(b). Let w(m) = 0. What is m? -1, -2/3, 0 Let n(x) = -x + 13. Let t be n(10). Solve -2q*2 - 6q + 6qt - 2q*4 + 0q*4 - 4 + 8 = 0. -1, 1, 2 Let z be 12/5 - (-12)/20. Factor -3c*5 + 5 - 5 + 2c5 + cz. -c*3(c - 1)(c + 1) Let n(b) be the second derivative of b4/6 + 8b*3/3 + 16b*2 + 7b. Factor n(r). 2(r + 4)2 Determine g, given that 5g*4 - 10 + 9g - 5g3 + 132g*2 + 5g - 147g2 + 11g = 0. -2, 1 Let -465 + i4 + i2 + 2i3 + 465 = 0. What is i? -1, 0 Let c(f) be the first derivative of -f8/3360 + f7/840 + f6/720 - f5/120 + 2f*3 - 2. Let a(g) be the third derivative of c(g). Factor a(d). -d(d - 2)(d - 1)(d + 1)/2 Let o(j) = -7j4 - j3 - j2 + j. Let u(b) = -6b*4. Let k(h) = -3o(h) + 4u(h). Determine i, given that k(i) = 0. -1, 0, 1 Let u(s) be the first derivative of -s4/20 - 2s*3/5 - 6s*2/5 - s - 5. Let j(l) be the first derivative of u(l). Find x such that j(x) = 0. -2 Let x(r) = -2r*3 - 2r*2 + 2r + 2. Let n be x(-2). Suppose 2k - n = 3k + 2w, -4k - 6 = 2w. Suppose ki*2 - 2i*2 - 3i + i = 0. Calculate i. -1, 0 Let v(w) be the first derivative of -w6/135 + w4/54 - 4w - 3. Let r(y) be the first derivative of v(y). Factor r(u). -2u*2(u - 1)(u + 1)/9 Let y(k) be the third derivative of k9/1008 + 3k*8/560 + 3k7/280 + k6/120 - 2k3/3 + k2. Let c(t) be the first derivative of y(t). Factor c(g). 3g*2(g + 1)3 Let l(n) = -n3 + 2n2 - 1. Let a be l(-1). Let 0f - f - 2f3 - 4f*a - f = 0. What is f? -1, 0 Let s be (-1 - 2)/((-9)/21). Let j be 0/s1/2. Factor 2/3g4 - 2/3g*3 + 0g*2 + 0g + j. 2g3(g - 1)/3 Let p be 8/(-28) - 46/(-14). Factor c + 2c2 + 2 - 2c3 - p - c4 + 0 + c5. (c - 1)3(c + 1)2 Let x be 9/(-21) - (155/56)/(-5). Let z(u) be the third derivative of 3u*2 + 0u*3 + 1/20u*5 - xu*4 + 0u + 0. Let z(p) = 0. Calculate p. 0, 1 Solve -12d2 + 12d*3 + 8 - 8 + 4d + 20d4 - 16d*5 - 8d*2 = 0. -1, 0, 1/4, 1 Factor -10y - 23y2 + 45y*2 - 27y*2. -5y(y + 2) Let p(t) be the third derivative of 0 + 0t - 1/20t5 - 2t*2 + 1/2t*3 + 0t*4. Determine v, given that p(v) = 0. -1, 1 Factor -3/5v*2 + 21/5v - 21/5v3 + 3/5. -3(v - 1)(v + 1)(7v + 1)/5 Factor 4/9u*3 + 0u*2 - 4/9u + 2/9 - 2/9u4. -2(u - 1)*3(u + 1)/9 Factor -1/4v2 + 1/4 - 1/4v + 1/4v3. (v - 1)2(v + 1)/4 Let z(k) = k. Let q(r) = 4r2 + 29r + 36. Let c(i) = -q(i) + 5z(i). Let c(u) = 0. Calculate u. -3 Let o(x) be the second derivative of -3x + 0 + 0x2 + 0x*3 + 1/60x*5 + 0x*6 + 0x*4 - 1/126x*7. What is w in o(w) = 0? -1, 0, 1 Suppose 2g - 3 = 5. Let y be 20/6 - (-4)/(-12). Determine h so that -5hy - 2 + gh*3 + 3h*2 + 2h*3 - 2 = 0. -2, 1 Let r(u) be the first derivative of 1 - 3/10u5 + u2 - 1/2u4 - 1/3u*3 + 0u. Let i(m) be the second derivative of r(m). Suppose i(v) = 0. Calculate v. -1/3 Let j(t) be the second derivative of 0t2 + 3t + 0t3 + 0t*4 + 1/35t*5 + 0. Factor j(l). 4l*3/7 Suppose -o + 8 = -2. Suppose 17x = 12x + o. Find z such that 0 + 0z - 1/3zx = 0. 0 Let c be ((-4)/10)/((-1)/5). Suppose 5 + s2 + 0s*c + 2s - 1 - 3 = 0. Calculate s. -1 What is i in -26i3 + 169 + 12i*4 - 8i - 169 - 2i5 + 24i*2 = 0? 0, 1, 2 Let y = -13/4 - -15/4. Factor 1/2 - b + yb2. (b - 1)2/2 Let i(g) = 6g. Let a be i(1). Factor -ad + 7d2 - d2 - 3d - 3d2. 3d(d - 3) Let l(w) be the second derivative of w9/15120 + w8/3360 - w6/360 - w5/120 - w4/4 - 2w. Let p(v) be the third derivative of l(v). Factor p(m). (m - 1)(m + 1)3 Let y = -21 - -24. Let p(f) be the second derivative of 0 + 1/21f*7 - 2f*2 - f - 2/15f*6 - 1/5f*5 + 1/3f*y + 2/3f*4. Find i, given that p(i) = 0. -1, 1, 2 Suppose 7 + 3 = 5o. Factor 3to + t3 - 5t**2 + t +	{ "pile_set_name": "DM Mathematics" }
a + 2 - 2. Let d(l) = 3l. Determine d(y(m)). -6m Let f(r) be the first derivative of -304r*3/3 + 219. Let g(o) = -2o. What is f(g(n))? -1216n2 Let z(o) be the second derivative of 0 + 7o + 0o2 + 0o*3 + 5/4o*4. Let b(v) = 4v. What is z(b(a))? 240a2 Let a(z) = -48z*2 + 33. Let i(n) = 6n*2 - 4. Let s(v) = 4a(v) + 33i(v). Let b(d) = -d2. Calculate s(b(t)). 6t*4 Let t = 6 - 4. Let p(j) = -2j + tj - j2. Let l(g) = 4g*2 - 3g. Let d(h) = 9h2 - 7h. Let u(w) = -3d(w) + 7l(w). Determine u(p(r)). r*4 Let v(o) = 406568o*2 - 6o. Let d(b) = 3b. Determine v(d(g)). 3659112g*2 - 18g Let u(q) = 21q2. Let c(a) = 26a - 4. Let d(t) = 497t - 77. Let n(m) = 77c(m) - 4d(m). What is n(u(s))? 294s2 Let q(n) be the third derivative of -n5/60 - 2n2. Let c(w) be the first derivative of 1 + 1 - 4 + 2w*3 - 2. Determine c(q(j)). 6j*4 Let y(t) = t + 12. Let k be y(-5). Let z(o) = 3o + 6o + 0o - ko. Let j(l) = 18l*2. Calculate j(z(r)). 72r*2 Let i(r) = 148r. Let h(z) be the first derivative of -z*2/2 + 136. Calculate h(i(p)). -148p Let r(g) = 15975 - 15975 - 4g2 - 18g. Let x(a) = -2a2. Give x(r(h)). -32h*4 - 288h*3 - 648h*2 Let l(q) = -70q*2. Let b(u) = -225u*2. What is l(b(x))? -3543750x*4 Let a(v) = 4v*2. Let m(c) = 5 - 5 + 1369023c - 1369482c. Calculate a(m(n)). 842724n*2 Let u(c) = 10c*2 - 2c. Let i(v) = 6v2 - 33. Let o(t) = t2 - 6. Let j(y) = 2i(y) - 11o(y). What is j(u(a))? 100a*4 - 40a*3 + 4a*2 Let h(j) = 3j*2. Let s(z) = 176z. Let i(p) be the first derivative of -25p2/2 + 5. Let y(o) = 22i(o) + 3s(o). Calculate y(h(u)). -66u*2 Let b(j) be the first derivative of 13j*3 + 222. Let y(x) = 10x. Calculate b(y(l)). 3900l2 Let a(b) be the first derivative of 2b*3/3 - 19. Let y(h) = -27h*2 - 13h*2 + 17h*2. What is y(a(f))? -92f*4 Let k(y) be the second derivative of 0 + 14y + 0y2 - 1/6y*4 + 0y*3. Let d(i) = i. Determine k(d(q)). -2q*2 Let n(w) = w - 10. Let k(m) = -5073m*2. Determine n(k(a)). -5073a*2 - 10 Let i(k) = 20k*2. Let x(s) = -162s. Calculate x(i(u)). -3240u2 Let u(h) = -11h + 2. Let s be (13 - 4 - 6) + 3/1. Let f(v) = -8v + 4v + sv. Calculate f(u(y)). -22y + 4 Let n(y) = 4y2. Let h(j) = -3. Let q(m) = 7m + 9. Let c(l) = -4l - 4. Let i(v) = 5c(v) + 3q(v). Let b(g) = -7h(g) - 3i(g). What is b(n(d))? -12d2 Let o(i) = i2 - 2i - 4. Let c be o(4). Let v(w) = -3w - 2w + 7w + cw. Let g(s) = 5s2 - s2 - s*2. What is g(v(d))? 108d*2 Let h(l) = -3492595l. Let x(w) = -w*2. Give x(h(a)). -12198219834025a*2 Let x(k) = -k + 2. Let a(n) = 4n - 6. Let c(t) = -a(t) - 3x(t). Let h(u) be the third derivative of -u4/4 + 5u*2. Determine c(h(v)). 6v Let p(l) = 10l2. Let o = 1747 - 1117. Let z(f) = 2f*2 + 630f - of. What is p(z(q))? 40q*4 Let c(i) = -2i2. Let z(l) = l2 + 25l - 51. Let g be z(-27). Let a be (-56)/(-10) - 2/(-5). Let q(v) = a + gv - 3 - 3. Give q(c(n)). -6n2 Let g(o) = -1325o + 2649o + 0 + 0 - 1323o. Let y(j) = -73j + 1. What is y(g(c))? -73c + 1 Let u(v) = 2v. Let s = 104 - 104. Let x(c) be the third derivative of 3c*2 - 1/15c*5 + 0 + sc*3 + 0c*4 + 0c. Determine x(u(a)). -16a2 Let k(v) be the third derivative of v4/24 + 2v*2 - 62v. Let a(c) = 10c2 + 7. Determine k(a(t)). 10t*2 + 7 Let r(n) = 188n*2 - 274n. Let c(v) = -v. What is c(r(g))? -188g2 + 274g Let z(o) = 52 + 47 - 99 + 57o. Let l(t) = -t. Determine l(z(u)). -57u Let z(m) = 2m2 - 5m*2 + 4m*2. Let i(f) be the third derivative of 2f5/15 - f2 + 6. What is z(i(q))? 64q4 Let m(i) be the first derivative of 5i*2 + 149. Let s(o) = -8o. Determine m(s(r)). -80r Let f(p) = 112p + 108p - 222p. Let h(b) = b*2 - 37. Determine h(f(o)). 4o*2 - 37 Let u(b) = 3b*2 + 136b + 1. Let v(k) = -41k. What is u(v(y))? 5043y*2 - 5576y + 1 Let w(g) = 81g2 - 2824 + 2824. Let u(b) = -3b. Determine u(w(v)). -243v2 Let t(w) = -2w - 3w + 9w. Let m(g) be the first derivative of 0g + 0g*2 - 3 + 4/3g*3. Determine t(m(k)). 16k*2 Let w(n) = 7n. Let g be (2 - 0/8) + 0/2. Let p(b) be the third derivative of 0b + 8b*g + 1/12b*4 + 0b*3 + 0. Calculate p(w(x)). 14x Let t(y) = y*2. Let p = 67 + 0. Let i(c) = 28c*2 - pc + 67c - 10c*2. What is t(i(v))? 324v*4 Let s(c) = -1. Let n(d) = -d - 1. Let u(y) = -y + 1. Let f be u(-1). Suppose -6 = fj - 4. Let r(v) = js(v) + n(v). Let o(h) = 10h. Calculate o(r(i)). -10i Let m = 10 + -3. Let o(k) be the first derivative of -9k*2/2 + 7k - 200. Let t(p) = -4p + 3. Let i(j) = mt(j) - 3o(j). Let f(g) = -9g. What is f(i(x))? 9x Let k(d) = 2d2. Let g(s) be the first derivative of -s2 + 104s - 61. Determine g(k(r)). -4r*2 + 104 Let v(a) = 37a + 8. Let l(o) = 3. Let f(r) = 2l(r) - v(r). Let x(c) = c. Determine f(x(w)). -37w - 2 Let a(m) be the second derivative of 8m3/3 + 22m. Suppose -6i + 3i + 1584 = 0. Let b(n) = -528 - 2n2 + i. Calculate a(b(o)). -32o*2 Let p(y) = -3y*2. Suppose 9 = -5a + 24. Suppose -au - 18 = -5u. Let v(j) = 7j2 - j - uj*2 + j. Calculate p(v(m)). -12m*4 Let z(g) = -g. Let i(h) = 828h + 31. What is i(z(r))? -828r + 31 Let p(i) be the third derivative of -i4/12 + 4i*2. Let w(j) = 35j - 45j + 58j. Give w(p(h)). -96h Let h(k) = -2k. Let w(b) = -b - 3459. Give h(w(t)). 2t + 6918 Let o(b) = -2b. Let x(m) be the second derivative of -193m3/3 + 17m - 2. Give x(o(n)). 772n Let o(t) = t3 - 4t*2 + 5t - 6. Let j be o(4). Let u(y) = 35y - 7y - jy - 16y. Let z(g) be the first derivative of 3g2/2 - 1. Determine u(z(k)). -6k Let v(c) = -15c2. Let s = 14 + -9. Let k(d) = -d + 7. Let m be k(s). Let j(y) = 5y*2 - 15y*m + 12y*2. What is j(v(r))? 450r*4 Let t(r) = -9r*2 + 91r. Let o(h) = 20h - 2. What is t(o(z))? -3600z*2 + 2540z - 218 Let h(y) be the second derivative of 0y3 + 0 + 0y*2 - y + 11/12y*4. Let f(s) = -2s. What is f(h(j))? -22j2 Let t(f) = -f2 + 0f*2 + 2f*2. Let v(i) = 9i - 5i + 5i + 23i2 + 9. Let m(k) = 6k*2 + 2k + 2. Let n(w) = 9m(w) - 2v(w). Give t(n(s)). 64s4 Let i(t) = -t. Let y(c) = 9c - 29c + 17c + 20 - 8. Calculate i(y(s)). 3s - 12 Let u(d) = 2d2. Let c(l) be the third derivative of -l4/8 + 4l3 - 122l*2. What is c(u(r))? -6r2 + 24 Let b(y) = y2. Let x(s) = 7 - s*2 + 5922s - 5922s. What is b(x(d))? d4 - 14d*2 + 49 Let m(j) = 2j. Let a(f) be the first derivative of -4f2 + 3f - 1. Let x = -57 + 54. Let o(n) = 7n - 2. Let l(g) = xo(g) - 2a(g). Give m(l(v)). -10v Let z(l) = -5l - 8. Let w(f) = 14f*2 - 6. Determine w(z(i)). 350i*2 + 1120i + 890 Let a(s) be the third derivative of -s*4/24 + 418s*2. Let f(n) be the first derivative of 25n*2/2 - 3. Calculate f(a(g)). -25g Let x(z) = -29z + 51. Let m(d) = 768d. Give m(x(p)). -22272p + 39168 Let g(o) = o2 - 5o - 5. Let r(n) = n*2 - 4n - 4. Let i(q) = -4g(q) + 5r(q). Let w(t) be the first derivative of 7t3/3 + 3. Determine i(w(x)). 49x*4 Let f(h) = -4193h*2. Let n(x) = -3x. What is f(n(m))? -37737m2 Let n(k) = -103924k. Let v(q) = -q. Determine n(v(d)). 103924d Let z(d) be the third derivative of -d8/6720 + 11d*5/60 - 3d*2. Let r(n) be the third derivative of z(n). Let m(x) = -5x. Calculate m(r(p)). 15p2 Let o(m) be the second derivative of -m3 + 23m. Let j(d) be the second derivative of d*4/4 - 2d. Calculate j(o(s)). 108s2 Let g(o) = -168 - 3o + 0o + 168. Let h(q) = 215q*2. Give h(g(j)). 1935j2 Let l be (1 + -1)/(0 + 1). Let n(d) = -d + l + 0. Let h(y) = y2 - 6y + 2. Let f(x) = -6x*2 + 27x - 9. Let r(p) = -4f(p) - 18h(p). Determine r(n(a)). 6a2 Let t(i) = -22i + 0 + 0 + 49i - 29i. Let m(d) = 5d - 16. Determine m(t(v)). -10v - 16 Let c(s) be the second derivative of 3s4/2 + 2s. Let i(a) = -3a + 4 + 6 - 10 + 7. Let x(d) = 2d - 5. Let m(q) = 5i(q) + 7x(q). What is m(c(k))? -18k2 Let b(h) = 4h. Let u(p) be the second derivative of -p*3 + 56p. What is b(u(s))? -24s Let i(m) = 1 + 189m - 191m - 1. Let p(n) = 168n*2. Determine i(p(y)). -336y*2 Let p(a) = -10a - 24. Let f(z) = 4*z + 9. Let b(j	{ "pile_set_name": "DM Mathematics" }
(-6)). Let x = -7 - -6.8. Which is the third biggest value? (a) u (b) -4/9 (c) x b Let y = 36 - 40. Let d = 0.6 - 0.2. Which is the third smallest value? (a) y (b) d (c) -5 b Let b = 1.5 - 7.5. What is the third smallest value in 0.02, b, 3/2? 3/2 Let p = -0.85 - -0.7. Let j = p + 0.05. Which is the third biggest value? (a) -2/15 (b) j (c) 1/2 a Let l = -0.6 + 0.5. Let u = l - -0.1. Let f = u + 0. Which is the third biggest value? (a) 2 (b) -4 (c) f b Let v = 7.8 + -7.8. Let w = 0.04 + -0.44. Which is the biggest value? (a) v (b) w (c) 4 c Let j = -10 + 9. Let k = j - -0.7. Which is the third biggest value? (a) k (b) 1 (c) -4 c Suppose 0c - 36 = -4c + 4x, 15 = c - 3x. Let i = c - 9. Let b be ((-1)/i)/(1/(-3)). What is the third biggest value in -2, b, 2/9? -2 Let j = -56 + 56. Let b = -2090/9 - -232. What is the biggest value in b, 3, j? 3 Let r be (72/(-21))/(3/4). Let n = r + 107/28. Let p = 2.9 - 2.6. Which is the smallest value? (a) p (b) 0 (c) n c Let m = 0.4 + -0.6. What is the smallest value in m, 5, -2/7? -2/7 Let w = 7 - 10. Let l be 0/1 - (-4)/(-8). Which is the third biggest value? (a) l (b) -1/5 (c) w c Suppose -5m = -z + 3z + 46, -z + 3m - 23 = 0. Let n = z - -24. What is the third biggest value in n, -3/2, 4? -3/2 Suppose -5 = 5r + 20. Let d = -137/105 + 7/5. Which is the smallest value? (a) d (b) 2/11 (c) r c Let z be 26/168 - 5/20. Let m = -6 - -5. Let g be (-1)/(-1 + (-1 - m)). Which is the second biggest value? (a) g (b) z (c) -3 b Let j(l) = 2l + 2. Let f be j(-1). What is the smallest value in 2/5, -3, f? -3 Let u = -6.2 - -1.2. Let i = -0.43 - 0.07. What is the biggest value in i, -1, u? i Let u = 0.43 + -4.63. Let o = u - 0.8. What is the third smallest value in -3, 2, o? 2 Let r = 0.2 - 0.1. Let q = r + -3.1. Let d(w) = 2w + 20. Let l be d(-9). What is the smallest value in l, q, 4? q Suppose -2i = -i - 3. Suppose 4a - iy = 60, a - 2a = -4y - 15. Suppose -4t + a = -t. What is the second smallest value in -4, t, 0.1? 0.1 Let g = 1.1 + -0.1. What is the second biggest value in 4, g, 2? 2 Let q = -0.03 + 1.03. Let x = 0.03 + -0.63. Let i = x - -0.2. Which is the biggest value? (a) q (b) i (c) 0 a Let i = 0.1 - -1.5. Let r = i - 2.6. What is the third biggest value in 1, r, 2/9? r Suppose -4q - 14 = -6q. Let h = q - 4. Let w be (-2)/(-8)(-16)/12-1. Which is the smallest value? (a) w (b) 1 (c) h a Let n = 0.5 + -0.6. Let m = 89.08 - 89. What is the second smallest value in m, n, -5? n Suppose 3d + 13 = q - d, 11 = -q - 4d. Which is the second smallest value? (a) q (b) 0.4 (c) -5 b Let l = -0.023 - 0.377. Which is the smallest value? (a) 4 (b) -5 (c) -0.5 (d) l b Let g = -0.9 + 5.9. Let s = -9 + g. Which is the second biggest value? (a) -0.1 (b) 4 (c) s a Let f = -3 + 3.1. Let p(j) = j*3 + 6j*2 - 6j + 10. Let d be p(-7). Let i = 1.1 - -2.9. What is the second biggest value in f, i, d? d Let o be (-2)/(-8)(9 + -9). What is the third smallest value in 0.1, 1, o? 1 Let u be -1 - (2 - 105/(-6)). Let v = 21 + u. Which is the biggest value? (a) -2 (b) 3 (c) v b Let q = -133 - -137. Let o = -8.3 - -8. Let b = -0.7 - o. What is the second smallest value in 0.5, q, b? 0.5 Let m = -0.118 - 0.182. Let n be 6/7(-14)/(-9). Which is the third biggest value? (a) 3 (b) n (c) m c Let y = -0.077 + -0.423. Let l(q) = -2q3. Let d be l(-1). Which is the third smallest value? (a) d (b) -3 (c) y a Let x = 5.97 - 6. Let o = x - -0.33. Which is the second biggest value? (a) -5 (b) -3/5 (c) o b Let s be (3/(-12))/(8/32). Which is the second smallest value? (a) s (b) 0 (c) 0.2 b Let i be (3/18)/(12/(-27)). Which is the smallest value? (a) -5 (b) i (c) 3 a Let y = -2.1 + 0.1. Let s = -2.3 - -2. Which is the third biggest value? (a) -2/11 (b) s (c) y c Suppose -4u + 3u - 20 = 2a, -3u + a - 39 = 0. Let k(x) = x2 + 15x + 18. Let m be k(u). What is the second smallest value in m, -1, -0.4? -0.4 Let v = 12 + -14. What is the second smallest value in v, 2, 5? 2 Let h = -0.05 + -0.95. What is the biggest value in 4, -0.5, h? 4 Let z = -17.8 + 18.3. Let g be (-55)/(-12) - 4/6. Let x = g - 13/4. What is the second biggest value in z, x, 3? x Let q = 1.7 - -0.3. Let y = 1 + q. Let h be (-6)/(-3)(-2)/26. Which is the smallest value? (a) h (b) 5 (c) y a Suppose -14 = 54i - 56i. What is the smallest value in -1, i, 2/9? -1 Let c = -0.2 - 0. Let k = c + 0.1. Let j be (-144)/40 + 6/10. What is the biggest value in k, j, -4? k Suppose -4v - 3 = 5. Let f be (-6 + 2)/(1v). Which is the second smallest value? (a) f (b) -4 (c) 5 a Let r = -9 + 15. Let g be 9/(-4)1/r. Which is the biggest value? (a) -0.3 (b) 0 (c) g b Let m = 5 + -4. Which is the third biggest value? (a) m (b) 0.5 (c) -5/4 c Let g = -0.06 - -2.06. Let z = 3 - g. Let x = z - 1.2. Which is the third smallest value? (a) x (b) 0.3 (c) 0 b Let j(r) = -r*3 + 5r*2. Let g be j(5). Let m = -531.5 + 532. Which is the second smallest value? (a) g (b) 1/8 (c) m b Let n = -124 + 127. Let l = -0.2 - -0.7. What is the third smallest value in n, l, 0? n Let y = -0.51 - -0.01. What is the biggest value in y, 0, 5? 5 Let s = 3.99 + 0.01. Let q = -3.08 - -0.08. Which is the second smallest value? (a) -1/4 (b) s (c) q a Let d = 10 - 6. Let p = d + -1. Let w = 9 + -5. Which is the second smallest value? (a) p (b) w (c) -5 a Suppose -z = -6z + 50. Which is the third smallest value? (a) -5 (b) 0 (c) z (d) -1 b Let o = -254 + 1274/5. Let i = 0.02 - 8.02. Let s = i + 8.1. Which is the biggest value? (a) s (b) 1/5 (c) o c Let f = 0.5 + -0.8. Suppose -4s = -3s + 4. Which is the smallest value? (a) f (b) 5 (c) s c Let u be 10/(-75) - (-1)/3. Let w = -3.2 - -3. Which is the second smallest value? (a) u (b) -5 (c) w c Let y = -1297/7 - -185. Let h = -0.15 + 0.2. Let d = 0.25 + h. Which is the biggest value? (a) 0.4 (b) d (c) y a Let z = 21 - 20. Which is the second smallest value? (a) -0.4 (b) -0.36 (c) z b Let c = 0 - 5. What is the smallest value in 4, c, -3? c Let s = 5.5 - 5. Suppose 0 = -g - 3g. What is the second smallest value in s, g, 4/3? s Let n = 1.2 - -0.6. Let l = n + 1.2. Let y = -0.27 + -0.03. What is the third biggest value in l, y, -0.4? -0.4 Let m(n) = 163n3 - n2 + n + 1. Let y be m(-1). Let o = -653/4 - y. Which is the second smallest value? (a) -2/5 (b) -3 (c) o a Let l = -0.1 - -4.1. Let n = 3.8 - l. Let m = 0.4 - -0.1. Which is the third smallest value? (a) n (b) m (c) -1 b Suppose 29q = 15q + 11q. Let b be (22/(-2))/(2/(-4)). Suppose 4i + 3j - b = 0, 5j = -5i - 10 + 40. What is the third biggest value in q, -3/2, i? -3/2 Suppose 5j = -5f + 15, -3j + 2j - 2f + 5 = 0. What is the second biggest value in j, -2/7, 4? j Let r be (-2 - (-1 - 5))(-6)/(-8). Let q = -11 - -6. Let u = q + 2. What is the smallest value in 1/4, r, u? u Let u = 10 + -3. Let i = -18 + u. Let r = i + 11.5. What is the biggest value in -0.5, r, -3? r Let w = -1 + 0.5. Let p(a) = 5a - 19. Let m be p(4). What is the second smallest value in w, -5, m? w Let r = 0.48 - 0.08. What is the biggest value in 4, -3/5, r? 4 Let c be 2-1 - (5/(-20) + -4). What is the third biggest value in c, 5, 3/4? 3/4 Let u be (-2)/14(1 + -2). Which is the smallest value? (a) 0.3 (b) 2 (c) u c Let s = 10328/17 + -102464122/168657. Let w = s + 1696495/19842. Let z = 1201/14 - w. Which is the biggest value? (a) -1/5 (b) z (c) 2 c Let p = 0 + 2. Suppose 0 = 2y - 4t - 11 - 7, y + 6 = -t. What is the second biggest value in y, p, 0.5? 0.5 Let t = 57.5 + -57. Which is the third biggest value? (a) 0.2 (b) -1 (c) t b Let x = 1503196 - 3945889229/2625. Let f be (-127)/(-250) + (-2)/4. Let i = f - x. Which is the biggest value? (a) i (b) 2/5 (c) -1/3 b Let n be 0/((-4 - 0)/(-4)). Which is the third smallest value? (a) -2 (b) -0.1 (c) n c Let l = 4 - 5.2. Let t = 0.2 + l. Let u(f) = f*3 - 2f*2 - 7f - 1. Let p be u(4). Which is the third biggest value? (a) t (b) p (c) -0.2 a Let i = -0.28 - -0.48. What is the third smallest value in 0.3, 1, i? 1 Let n = -1.7 + 2. Let y = -20/33 - 239/11. Let j = -22 - y. Which is the third smallest value? (a) j (b) 2 (c) n b Let s = 0.	{ "pile_set_name": "DM Mathematics" }
ue Is 67741 a prime number? True Is 91079 composite? False Is 59611 prime? True Is 35069 a composite number? False Is 18485 composite? True Is 36265 a prime number? False Is 65551 prime? True Is 13229 composite? False Is 5197 a composite number? False Is 59921 a composite number? False Is 108739 a prime number? True Is 365047 composite? True Is 36833 a composite number? False Is 1441 a prime number? False Is 1973 composite? False Is 176977 a composite number? False Is 459139 a composite number? True Is 5647 prime? True Is 17653 prime? False Is 7313 prime? False Is 33241 prime? False Is 449 prime? True Is 190601 prime? False Is 69457 a prime number? True Is 103195 prime? False Is 66739 prime? True Is 27397 prime? True Is 257947 prime? True Is 1824827 prime? True Is 29695 composite? True Is 7555 a prime number? False Is 595501 a composite number? True Is 34841 a prime number? True Is 18041 composite? False Is 133141 prime? False Is 55753 a prime number? False Is 409163 composite? False Is 1873337 composite? False Is 15877 composite? False Is 1016111 a prime number? True Is 457951 prime? False Is 20005 prime? False Is 133241 a composite number? False Is 66835 a composite number? True Is 175307 composite? True Is 334021 composite? False Is 1497235 prime? False Is 30902 a prime number? False Is 1931 prime? True Is 6947 prime? True Is 1658179 composite? True Is 23173 composite? False Is 15133 a prime number? False Is 47577 a composite number? True Is 4903 a composite number? False Is 50429 composite? True Is 282197 a composite number? True Is 1843255 prime? False Is 268123 a composite number? False Is 38261 composite? False Is 267821 a prime number? False Is 262001 a composite number? True Is 3805 a prime number? False Is 3646 prime? False Is 991261 composite? False Is 1150837 prime? True Is 150387 a composite number? True Is 966971 prime? True Is 55277 a composite number? True Is 524039 composite? True Is 31067 prime? False Is 198313 prime? True Is 897517 prime? True Is 76079 prime? True Is 810091 a composite number? False Is 7534 a composite number? True Is 4369 a prime number? False Is 169123 a prime number? False Is 304493 a composite number? True Is 27397 composite? False Is 27509 composite? False Is 953 prime? True Is 441751 composite? False Is 4759 a prime number? True Is 32183 composite? False Is 266333 a composite number? False Is 4413 a composite number? True Is 8889 a prime number? False Is 14347 a prime number? True Is 7151 a prime number? True Is 109097 composite? False Is 11246 composite? True Is 322387 composite? True Is 39359 a prime number? True Is 84887 prime? False Is 17519 composite? False Is 145931 a composite number? False Is 472559 a composite number? False Is 6691 a prime number? True Is 343127 prime? True Is 2893133 a composite number? True Is 25841 a composite number? False Is 211457 prime? True Is 14698 a composite number? True Is 747977 composite? False Is 80713 a prime number? True Is 26141 a composite number? False Is 6143 prime? True Is 9253 a prime number? False Is 22733 composite? True Is 6679 a prime number? True Is 1012219 composite? True Is 22917 a composite number? True Is 60397 a prime number? True Is 592121 prime? True Is 44953 a prime number? True Is 7321 a composite number? False Is 91961 prime? True Is 783169 a composite number? True Is 8053 prime? True Is 5167 composite? False Is 6127 a composite number? True Is 1121 composite? True Is 731495 a composite number? True Is 3366503 a composite number? True Is 189239 a prime number? True Is 45519 prime? False Is 127271 a composite number? False Is 398413 a composite number? True Is 2390819 a prime number? True Is 6389 a prime number? True Is 2721847 a prime number? False Is 1948207 a prime number? False Is 313879 a prime number? True Is 98269 a composite number? False Is 17846 a prime number? False Is 187943 composite? True Is 2581829 a composite number? False Is 361313 composite? False Is 518677 composite? True Is 2371 composite? False Is 398787 composite? True Is 9719 a composite number? False Is 258691 a prime number? True Is 363719 a prime number? True Is 8489 composite? True Is 1361 a prime number? True Is 18883 a prime number? False Is 41671 prime? False Is 570329 prime? True Is 72817 prime? True Is 907 a prime number? True Is 15253 composite? True Is 40343 a prime number? True Is 99949 composite? True Is 4203359 a prime number? False Is 297793 a prime number? True Is 6122 a composite number? True Is 39467 a prime number? False Is 67793 composite? True Is 257891 a composite number? True Is 4987 prime? True Is 17461 prime? False Is 2291 prime? False Is 55849 a prime number? True Is 205589 prime? True Is 209407 a prime number? False Is 2147 a composite number? True Is 104449 a composite number? True Is 1454 composite? True Is 4621 a prime number? True Is 13217 composite? False Is 110419 a prime number? True Is 407686 a prime number? False Is 20707 a prime number? True Is 14567 prime? False Is 2519257 prime? False Is 12381 prime? False Is 137699 composite? False Is 107533 composite? True Is 4666 a prime number? False Is 277195 a prime number? False Is 48353 composite? False Is 45007 composite? False Is 1087 a composite number? False Is 91177 a composite number? True Is 3770963 a composite number? True Is 333959 a prime number? True Is 47798 a prime number? False Is 87211 a composite number? False Is 333923 composite? False Is 1639 a prime number? False Is 202661 a prime number? True Is 3637 prime? True Is 20279 a prime number? False Is 9745 a composite number? True Is 39199 a composite number? False Is 430649 a composite number? False Is 996277 composite? True Is 8801 a prime number? False Is 3415 composite? True Is 40577 a composite number? False Is 42593 a prime number? False Is 2063129 prime? True Is 28211 a composite number? False Is 5485589 composite? False Is 39454 composite? True Is 20283 prime? False Is 28321 prime? False Is 142927 a composite number? True Is 15727 a composite number? False Is 56365 composite? True Is 153019 composite? True Is 100313 a prime number? True Is 6983 a composite number? False Is 62273 a composite number? False Is 348805 composite? True Is 5611 composite? True Is 18293 prime? False Is 3833 prime? True Is 618023 a composite number? True Is 895 a composite number? True Is 216023 prime? True Is 119173 a composite number? False Is 97919 composite? False Is 67478 a prime number? False Is 74123 a prime number? False Is 19165 a composite number? True Is 61823 composite? True Is 122443 composite? False Is 4499449 prime? False Is 4699 prime? False Is 40009 composite? False Is 88211 composite? False Is 3761 composite? False Is 12842 a composite number? True Is 422987 composite? False Is 139 a composite number? False Is 11179 a composite number? True Is 4681 a composite number? True Is 5141 a prime number? False Is 1788729 a composite number? True Is 1997651 prime? False Is 7495 prime? False Is 37793 composite? True Is 3733 a composite number? False Is 2797241 a prime number? True Is 207227 composite? False Is 31883 a prime number? True Is 5227 a prime number? True Is 422431 composite? False Is 18947 a prime number? True Is 86677 composite? False Is 9743 prime? True Is 34381 composite? False Is 86971 a prime number? False Is 102607 a composite number? False Is 5299 a composite number? True Is 14621 a prime number? True Is 109913 prime? True Is 4967 a prime number? True Is 21001 a prime number? True Is 26787 composite? True Is 2099 prime? True Is 856601 composite? True Is 51218 composite? True Is 621721 prime? True Is 20887 composite? False Is 846779 composite? False Is 13238 a composite number? True Is 286973 composite? False Is 243877 composite? True Is 28889 prime? False Is 177649 a composite number? True Is 23929 prime? True Is 597637 prime? True Is 12143 composite? False Is 35941 prime? False Is 174851 composite? False Is 828557 composite? False Is 105914 a prime number? False Is 3202837 prime? False Is 222289 composite? False Is 2106773 a prime number? True Is 130231 a prime number? False Is 237487 prime? True Is 27733 a composite number? False Is 32063 a prime number? True Is 16837 a composite number? True Is 114531 prime?	{ "pile_set_name": "DM Mathematics" }
- 35u5 - 46u*5 + 3u*5 + 0u5 - u5 + (u*3 - 3u*3 + 4u*3)(2u2 + 0u*2 + 0u*2). -55u*5 Expand (-266d - 323d + 72d)((-d + 2 - 2)(13 - 13 - 2d) + d2 + d2 + d2). -2585d*3 Expand (-139 + 197 + 56 + 36)(-2l - 4 + 4). -300l Expand (-v*2 - 7v*2 - 2v*2)(-368 + 67v + 368 + v - 3v - 4v + 3v + 2v - 3v - 3v + 2v - v + 0v + 0v - 2v + (-5 + 2 + 4)(-2v + 0v + 0v)). -570v*3 Expand (-11 + 5 + 8 + 5p)(-1 + p + 1 + (3p - 5p + 0p)(3 - 2 + 0) + 2 - 2 + 2p - 3p + 1 - 1)(-3 + 3 - p) + 0p3 - 6p3 - p3. 3p3 + 4p*2 Expand (6j*3 - 3j3 - j3)(2 + 1 - 1)(1 - 1 + 5j) - 5j*2 + 5j*2 - 4j*4 + 0j*4 + 9 - 2j*4 - 13. 14j*4 - 4 Expand -2n - 3502 - 1401 - 85n3 - n2 + 83n*3 + (2n2 + n2 - 4n2)(-4n + 4n + n). -3n3 - n2 - 2n - 4903 Expand -5w3 - 6w*3 + 0w*3 + (9 - 9 + 7w*2)(7 - 3w - 7) + 2 - 4w*3 - 2. -36w*3 Expand (20f*2 + 3f*3 - 20f*2)((-4 - 3 - 9)(f - f - 2f) + 1 - f - 1). 93f4 Expand (-40q*2 - 751q + 751q)(-5q2 + 15q*2 + 6q*2)(2 + 1 - 1). -1280q4 Expand (1727s - 36057 + 36057)(-2s + 4s - 4s). -3454s2 Expand (1 + 3 - 2)((2r + 2 - 2 + 4r + 13r - 5r + (-2r + 2r - 2r)(2 + 4 - 4))(1 + 2 - 4) + (-2r - r + 2r)(-6 + 2 + 2)). -16r Expand (1 + 3 - 8)(55 + 39 + 88 - 49)(0 + 0 + 2q). -1064q Expand -5x - x*2 + 4 + 5x + 30x2 - 50x*2 + 29x*2 + (2 - 2 - 3)(0x2 + 4x*2 - 3x*2) - 3x*2 + 3x2 + x2 - 3x2 + 2x2 - x2. 4x2 + 4 Expand (-210c + 392c - 45c)(0 + 5 + 12 + (-5 + 2 + 1)(2 + 0 - 1) + 2 - 1 + 1). 2329c Expand (-3914d*3 - 3539d - 3921d3 - 3917d*3 + 11751d*3)(-3 + 4 + 1). -2d3 - 7078d Expand (-362a3 + 1406355 - 1406355)(a + a - 4a). 724a*4 Expand (-4 + 2 + 1)(-2p2 - 1 + 1) + (p + p2 - p)(-1 + 1 + 2) + (-33299p + 239p*2 + 33299p)(3 + 2 - 2). 721p*2 Expand 2392v*4 + 4582494v - 4582494v + (0v3 - v3 - v*3)(-3v + 4v - 2v) - 3v + 3v - v4 - 4v*4 + 0v*4 + 2v*4. 2391v*4 Expand (1 - 3 + 1)(-c - 1 + 1)(-1 + 2 + 1)(92c4 + 75c*4 - 2c + 3c) + 2c2 + c5 + 2c2 - 6c*2. 335c*5 Expand 91g*2 - 224g*2 + 130g*2 - 2g - 55 - 4g3 - g + g3 + g + (-1 + 3 - 3)(g*3 + 2g3 - g3) + 3g3 - g3 + g3. -2g*3 - 3g*2 - 2g - 55 Expand (q - 5q + 2q)(179 + 1501 + 621 + 848). -6298q Expand 9y + 0y*3 + 3y*3 - 8y + 2 - 6y3 + 34y*3 + 9y*3 + 0y*3 + 0y3 - y3 + (-3 + y + 3)(2y*2 - 3y + 3y). 41y*3 + y + 2 Expand -3 - 337k + 3 + (-2 - 1 + 2)(2k - 2k - 5k) - 3 + 3 + k. -331k Expand (4 + 4 - 3f - 3)(5f*3 - 6f*3 - 2f*3) + (4f*3 + 5 - 5)(3f - 3f + 2f). 17f*4 - 15f*3 Expand -z + 342 - 4z - 124700z3 - 110 + 124696z3 + (-z2 + 0z2 - 2z*2)(-3 + 3 + z). -7z3 - 5z + 232 Expand ((2 - 3 - 1)(2o - 5o + 2o) - 5o + 5o + 4o)(18 + 359 + 834). 7266o Expand ((-27 + 11 + 9)(3 + 0 - 5) - 5 + 2 + 4)(140 - 140 + 32i) + (-2 - 1 + 1)(-1 + 1 - 2i). 484i Expand (83953k - 169101k + 81426k)(2k*2 - 3k2 - k2). 7444k3 Expand (2o*4 + 2o*4 - 5o*4)((-2 + 1 - 1)(0o + 8o - o) + 2o + 0o - 4o - o + 14 - 14 + o - 3o + 4o). 15o5 Expand (33r - 11r - 13r)(-157r*3 + 157r*3 + 200r*4). 1800r*5 Expand (3k*3 + 0 + 0)(-3 + 2 - 5)(-6k - 15k - k)(-3 - 3 + 4)(-5k + k + k). 2376k5 Expand (27y - 17y - 118y)(-37y + 110 - 110). 3996y2 Expand (6o + 65o - o)(o + 1 - 1 + 0o + 3o - 2o + (-2 - 3 + 7)(-2o - 1 + 1) + 3o - o - o). -70o2 Expand (327p - 167p - 148p)(2p + 4p - 10p*2 - 9p). -120p3 - 36p*2 Expand (-6 + 13 + 19)(-1 - 2 + 1)(-5q + 3q - 4q). 312q Expand (-54m*3 + 16m*4 + 54m3 + m4 + m3 - m3 + (4 - m*2 - 4)(0m - 2m*2 + 0m))(-6 + 79 + 97). 3230m*4 Expand 0w*2 + 3w*2 - 5w*2 + (w - 2 + 2)(-w + 0 + 0) - 2 - w*2 + 2 + 2w - 20452594 + 20452594 + 2195w2. 2191w*2 + 2w Expand -22z2 + 16z*2 - 21795z4 + z3 - 22z2 + 21788z4 - z4 + 0z + 0z + (-z*3 + 0z3 - z3)(-3z - 2z + 4z) - 12 - 11z4 + 12. -17z4 + z3 - 28z2 Expand (1 + 0 - 2)(83c3 + 20c*3 + 296c*3)(3 + 3 - 5)(c + 4c - 3c) + (1 - 3 + 1)(-2c4 + 2c*4 - 2c4) - c4 + 4c4 - 2c*4. -795c*4 Expand 0i*3 + 0i3 + i3 + (7 + 4i2 - 7)(-2931 + 2931 + 135i). 541i*3 Expand 49g*5 + 97g*2 - 97g*2 + (-2g - g + 5g)(-11g4 + 9g*4 - 13g*4). 19g*5 Expand (42q + 39q + 58q)(-11 + 8 - 7). -1390q Expand (1065f3 + 0f*2 + 1689127 - 1689127 + 0f*2)(18 + 11f2 - 18). 11715f*5 Expand (2 + 2 - 2)(8w + 7w - 7w) - 69w + 230w - 98w + 2. 79w + 2 Expand (7t + 528 - 36t3 - 528)(-2t + 4t - 4t). 72t*4 - 14t*2 Expand (-3 - 25b + 15b + 12b)(-43 + 88 - 44)(-1 + 5 - 3 + (-1 - 2 + 1)(0 + 0 - 1)). 6b - 9 Expand (-3v2 + v2 + 5v*2)(207v - 222v - 209v + (-3 + 5 - 1)(-2 + 0v + 4 - v)). -675v*3 + 6v*2 Expand (11602o + 23108o + 14156o - 77697o)(-o + 0o - o + 0o - o - o + (-1 + 2 - 2)(2 - 2 - o) - 2o - 5o + 6o). 115324o2 Expand ((2 - b - 2)(0 + 5 - 4) - 3 + 3 + 2b)(-675 - 476 - 233). -1384b Expand (-3n - 2n + 4n)(102443 - 9n - 102404 - 8n). 17n*2 - 39n Expand (4 - 1 - 1)(-154x*2 - 70x*2 - 93x*2 + (-4 + 3 - 1)(-3x2 + 2x*2 + 3x*2))(34 - 12x3 - 34). 7704x*5 Expand 2917 - 2595s*2 - 2917 + (0 + 1 + 1)(-2s2 - 2 + 2). -2599s*2 Expand 0 + 5f*3 + 0 + (-42f + 17f - 38f - 8f)(14f2 - 2f*2 + 9f*2). -1486f*3 Expand (-594m*2 + 594m*2 + 93m*3)(-79m2 - 4 + 32m*2 + 4). -4371m*5 Expand (8 - 8 + 2 + 6q)(1 - 3 - 1)(0q - 4q + 5q) + 27q*2 + 87q*2 + 30q*2. 126q*2 - 6q Expand (226 - 12 + 89)(-5k - k + 3k)(2 - 5 + 1). 1818k Expand (322g - 413g - 342g - 435g)(6g2 - g3 - 347 + 347). 868g*4 - 5208g*3 Expand (535 + 1271 - 221 + 364)(1 + 2 - 4)(2s - s + 2s). -5847s Expand (4v - 5v + 2v)(-2v3 + v3 + 3v3) - v4 - 2v + 2v - 489v4 - 36751 + 36751 + 4v + 2v4 - 4v. -486v4 Expand (19p*2 + 26p*2 + 16p*2)(-41p - 17p - 8p). -4026p*3 Expand (-3j + j + 0j)(65 + 26 - 6) - 21 + 21 + 4j. -166j Expand (2u - 2u + u*4)(0 - 5 - 3) + (0u + 0u - 3u2)(0 + u*2 + 0) + (-3u*3 + 4u*3 - 3u*3)(u - u + 2u). -15u*4 Expand (-44c + 1831 - 1831)(-352 - 98c + 352). 4312c2 Expand (3b - b - 4b)(-2b - 2b + b) + 1535b2 + 2 - 5 + 5944b*2 + 10639b*2 + 3. 18124b*2 Expand (-20 - 9w*2 + 20)((w + w - 3w)(-2 - 1 + 5) - 14w + 0w + 4w - 8 + 8 + w + w + w - 3w + (-1 + 4 - 5)(4 - 2w - 4)). 72w3 Expand 1706m + 415m4 - 1706m + (1 - 1 - m*2)(0m2 - 2m*2 + 3m2) - m4 + 3m4 + 0m*4 - 5m*4 + 0m*4 + 3m*4. 414m*4 Expand (1 - 2 + 2)(0 + 2 - 1)(-14 - 7b + 14)(-3 - 2 - 2)(4 + 3 + 1). 392b Expand (-789n*4 + 1763n*4 - 872n4 + (-n3 + 4n3 - n3)(3n + 2n - 4n) - 2n4 - n4 + 5n4)(n + 5n - 8n). -212n5 Expand (h3 + 9h*3 + 2h*3)(2h2 - 2h*2 + 2h*2 + (1 - 7 + 3)(3h2 - 5h*2 + 5h2) + h2 + 8 - 8). -72h5 Expand 203u*2 + 31u*5 - 203u*2 + (-1 + 2u*3 + 1)(610u2 + 619u*2 - 1315u*2). -141u*5 Expand (2h + h - h)(5 + 0 + 1)(2h - h + 0h) + (-69 + 69 + 12h)(2 + 2 - 5)(4h - 6h + h). 24h*2 Expand (-4z*2 - 6 + 6 + (z + z - 3z)(3z - z - z) + 2 + z*2 - 2)(-40 - 13 - 21)(0 - 1 - 5). -1776z*2 Expand 11f + 2f2 - 11 - 11f + (-9f + 16f - 6f)(-4 + 4f + 4). 6f*2 - 11 Expand (3 - 2 - 3)(30i - 12 + 19 - 7)(87i + 2i - 9i). -4800i*2 Expand (-1 - 3p + 3 - 7p)((1 + 1 - 4)(0 - 5 + 3) + 26 + 31 + 28). -890p + 178 Expand (23 - 23 + 12r2)(4 - 4 - 3r) + (-2r*3 - 3r + 3r)(19 - 185 + 13). 270r3 Expand ((-3 - 26 - 6)(-2 + 0 + 0) + 3 - 3 + 1)(-1 - 73a*3 - 2a*5 + 71a*3 + 20). -142a*5 - 142a*3 + 1349 Expand 2i2 + i2 - 4i2 + (1 - 1 - i)(4i + 4i - 6i) - 1218i*2 + 1157i*2 + 86i - 30i. -64i*2 + 56i Expand -2d5 + 4d - 4d + (2d*3 - 2 + 2)(-4d2 + 2d*2 + 0d*2) + (-14d*2 - 19 + 19)(-12d3 + 6d*3 + 8d*3). -34d*5 Expand -43 - f + 43 + (0 - 4 - 4)(-35 + 35 - 35f). 279f Expand a*2 - 5a*2 + 3a**2 +	{ "pile_set_name": "DM Mathematics" }
1))(c(8/7)c*(2/3)c)37 assuming c is positive. c(25042/231) Simplify (o/(((oo/(oo*0))/o)/o)o)*(-3/13)(oo/(oo*(-1/9))o)/(o/(o/o*6))(o*(-2/11)o(-4))/(o(-1))(-5/11) assuming o is positive. o(-11863/1287) Simplify ((((hh/h1)/hh(h/h(-2))/h)/(h(-1/4)/h)(-12/11))14)4 assuming h is positive. h(1008/11) Simplify (r(-4)/r(-5))(11/6)(r*5r1)(-11) assuming r is positive. r(-385/6) Simplify (g(-3/4)g(ggg(-6))/g)(-2/29)((gg4/g)/g(1/4))/(g*(-4)g*(1/8)/gg) assuming g is positive. g(1845/232) Simplify (((n(-2/7)n)/(n(n(n/(nn*4n))/nn)/nn))/(n*(-5)/nn(-3/5)))/(n(-1)n(4/7))(-2/31) assuming n is positive. n(11161/1085) Simplify (w3w*(-3/5)w)*(-2/7)((ww0)/(w/(w/((w(-4)/w)/w))))/(w(1/2)/w(5/4)) assuming w is positive. w(949/140) Simplify (b(4/3)b*(-4/9)b(-5)/b(-6/7))/((bb(1/4))(-34)/(b4/(bbb7))) assuming b is positive. b(4315/126) Simplify (((b/b(-1)b)/b(-10))/(b(1/3)/(bb(2/5))))(-8) assuming b is positive. b(-1688/15) Simplify p(-5)p*(2/7)p(1/5)/p5(p/(pp(p0/p)/p))26/(p/(p/(p/((p/(p(-2/7)p))/p))))(-8) assuming p is positive. p(151/5) Simplify (((p(1/5)/((p(6/11)/p)/p))/(p(-9)/(p/p(-3/7))))(-2/107))(-4/5) assuming p is positive. p(37216/205975) Simplify (o(1/12)o/(o(-2)/o)oo)(-41)(o*5/(o/(oo(-1))))/(o(-1/2))0 assuming o is positive. o(-2945/12) Simplify n(2/15)/n(-2/3)n4/(n/(nnn3/n))((n/n(1/7))/(n(2/9)n))/(n1)(-1/20) assuming n is positive. n(9431/1260) Simplify ((b/(b/(bb(-1/6))))(-48)/(((bb6b)/bb)/(b/(b/b(-2/3)))))28 assuming b is positive. b(-4088/3) Simplify d(dd/d(2/5))/dd*0d(d(-7)/d)(-10/7) assuming d is positive. d(491/35) Simplify (p1p)/(p*(-7)/p)((pp(1/8))/pp)/((p*(6/5)/p)/pp)(((p/p(-1))/p)/p5)(-37) assuming p is positive. p(6357/40) Simplify (s(-1/4)/s)(-2/131)/((s/s(-2/7)s)/(s/(s/s*(1/2))))(s*(-1/3)/ss(-1/6))/(s/s1)(-40) assuming s is positive. s(-5991/1834) Simplify (b*(3/5)/((bb*2b)/b)b(1/3)/(b/(b1/b)))/((bb*(-1))/((bb/b*1b)/b)b/(b/(b(2/7)b))b(-3)) assuming b is positive. b(-37/105) Simplify ((ii*(7/4)/ii)/i(9/5))(-25/4)(i(2/3))(-19)(i*2i)/(i/i2) assuming i is positive. i(-701/48) Simplify (x*(1/9)xx4)/(x(2/7)/(x/(xx/((x/(((x/x*5)/x)/x))/x)x)))((x/x(-1))(-48))49 assuming x is positive. x(-295796/63) Simplify ((((q(-1/17)/qq)(2/13))18)27)27 assuming q is positive. q(-26244/221) Simplify (q(-2/7))*(-4)q*(1/7)/q(q*(-3)/qq)/q((q(-2/3))(2/21))(10/11) assuming q is positive. q(-2614/693) Simplify (j2/(j/((jj/(j(j(((j/j*5)/jj)/j)/j)/j))/jj)))/(((j(-3)/jjjj)/j)/(j/(j/j*(2/11))j))(jjjj*(-2/11)j2)21 assuming j is positive. j(1236/11) Simplify ((m8m(-1/7))/(m(2/27)/(m/(m/(m/(mm*(-6))m)))))(-33/4) assuming m is positive. m(-15367/126) Simplify (k/(k*(-6)k)k(-4/3))(-3/11)/((k(-1/4))(-11)/((k/((kkk(3/8))/k))/kkk/k(-1))) assuming k is positive. k(-211/88) Simplify ((((u4/u)/u)/u)/u(1/3)(uu3)(1/27))(-4/11) assuming u is positive. u(-8/27) Simplify (((s/s3s)/ss)/(sss/(sss(1/2)/sss)s))*(1/5)(sss0/s)(-1/8)s(1/15)s/s(3/5) assuming s is positive. s(1/24) Simplify (m*(2/13)m/m(-6))/(m6mm*(-3/2))(m/m(2/7))(-10/9)m(-1/3)(m(-2/11)/m)/m assuming m is positive. m(-29819/18018) Simplify (z(-2))(4/7)z(3/5)(zz(1/3)zz)/z((z/(zz(-2/9)))/zzz4)(2/17) assuming z is positive. z(12248/5355) Simplify ((ii*(-9)ii)(-49)/(i/i(-7/2))(40/7))(-45) assuming i is positive. i(-84510/7) Simplify ((g10g)*(2/25)(g(g/g24)/g)/g8)(-1/19) assuming g is positive. g(753/475) Simplify ((q/(q(-4)qq)qq(2/17))/(q0/q5))/((q/q(-1)q)*(-2/63)q(-2)/q5) assuming q is positive. q(5788/357) Simplify ((w/(w8/w)w(2/39))/(w(1/5)((w*(-2/11)/w)/ww)/w))8 assuming w is positive. w(-68072/2145) Simplify (v*(2/3)/(v/(vvv4)))(-20/3)/(((v(2/9)v)/v)/((v(-9)/v)/v))(7/5) assuming v is positive. v*(-2407/45) Simplify ((g/(gg0))(-4)/(gg(-1)g)*(-10))/((((g/(gg*(3/2)/gg))/g)/gg/(g/(gg/((g*(2/15)/g)/g))))/((gg(1/2))/g(-1/4))) assuming g is positive. g(683/60) Simplify ((h(21/4)h/h(-12))/(h2/hhhhh(-21)))(-8) assuming h is positive. h(-282) Simplify ((r/r1)/(r1r))(1/21)/((r(-2/3))(5/7)/(r0)(-3/7)) assuming r is positive. r(8/21) Simplify (((q/(qq/q1))/q)(-36)((q/(qq/q1)q)/q)(-2/21))/((q(-2/7)/q)*(1/5)(q/((qq1)/q))(-34)) assuming q is positive. q(1269/35) Simplify (u/((uu*(-2/11))/uu))/uuu*(2/7)u*(-2/3)u/(u(u4/u)/u)((u/(uu1uu)u)/u)*(-22/7)((uuuuu(-1/2))/u)(-39) assuming u is positive. u(-41705/462) Simplify ((w(-4/23)/w)/w)/((w/(w*(-3/7)/w))/w)(w/w(-35))(-31) assuming w is positive. w*(-180256/161) Simplify ((l/(ll*8l))*(-4)l*(-4)ll/(lll(-9/2)l))(-24) assuming l is positive. l(-852) Simplify ((t*4t*(-2/3)/t)/((tt(-1/10))/(t(-3)t)))/((t(-2/15)t)/(tt(-1/5))(t*0/tt)43) assuming t is positive. t(-19/30) Simplify l*(-25/4)/(l/(ll/(l/(ll(-3/14))l)))l(-10/3)l*23l assuming l is positive. l(1193/84) Simplify (j(-10)jjjjj(1/16)j)*(-8/9)(j/(jj7))/(j(-8)/j)j*5(j/(j/(j(-7)/j)))/j assuming j is positive. j(43/18) Simplify (((kk(-4/3))/((kk(-2/7))/k))/((k(-1/10)k)/(kk(k(-3/5)k)/k)))/((k/k(1/4))(5/4))(-3/7) assuming k is positive. k(41/48) Simplify ((dd(5/4))/dd*(3/2)((d1/d)/d)(3/31))/(d*(2/21)/ddd0)(-7/8) assuming d is positive. d(509/186) Simplify ((j(-24)/j)(2/73)(j(j/((jj*(-1/2))/j))/j)/(j(jj(-10)/j)/jj))(7/4) assuming j is positive. j(10031/584) Simplify ((c(-10))(-3)/(c(-8))(1/33))(1/37) assuming c is positive. c(998/1221) Simplify j(2/7)/j(-1)(j0j)/(j*(-1)j)(j/(j/j(-6)j)j/(jj/(j/(j/(j/j*(1/7))j))jj))/(j*1(jj(-1/9))/j) assuming j is positive. j(-551/63) Simplify m/(m/(m/(m(-33)/m)))m*(-25)/mmmmm43m(3/19) assuming m is positive. m(1048/19) Simplify (l(3/4)/(l(-11)/l))*(-20/7)((l/l*(-2)ll)/((l(2/37)/l)/lll))/(l5/l(-1/4)) assuming l is positive. l(-38055/1036) Simplify (((o/o(2/7))/(oo*(-3/5)o))/(o/(o*(-8/9)/oo)oo(o(-4/5)o)/o))(-40) assuming o is positive. o(9512/63) Simplify ((u/u(-1/2))(15/2)/((u(2/5)/u)/u(-2/11)))/((u5/u)/u(2/9))26 assuming u is positive. u(-171377/1980) Simplify ((c(2/3))50)*(1/27)cc4c*3((c/(c/(cc/c(-1/4)c)))/c)(-20) assuming c is positive. c(-2897/81) Simplify ((((tt/t(-2/7))/t)/t)27)20t*(1/6)t*3t*(-3/2)ttt/(t*(-3/5)t) assuming t is positive. t(16648/105) Simplify (v(-1/2))*33/(vvv/(v(-2/7)/v)v)*(13/8)((v/(v/(vv(3/2)v)))/v(-5/4))(-2) assuming v is positive. v*(-1937/56) Simplify ((p/(pp(3/7)))/p(2/13))*4pp1p/p*(2/5)p/(p/(p*(4/7)p))pp*(1/3)p assuming p is positive. p(5699/1365) Simplify (l(2/3)/l(-1/3))13((ll/(l(-4)/l))/l)/l6(l/(l(1/3)l))(-1/3) assuming l is positive. l(118/9) Simplify (mm18)/m(1/10)(m/m(1/15))(-47) assuming m is positive. m(-749/30) Simplify (y/(y(1/2)y)yyy/(yy(-1/5))yy)/(y0/y(-1))((yy2)/y(4/7))/(y(-5)(((yy(-2/9))/y)/y)/yy) assuming y is positive. y(7151/630) Simplify (p(-5)(pp/(p/(p*(-1/8)/p))p)/p(pp*(-1))/((pp(2/7)/p)/p))/((p(-1/3))*(-20/9)p*(2/11)pp(-5)p) assuming p is positive. p(-38807/16632) Simplify ((n(-2/5)n(-5))/(n/(((n/(n7/n)nn)/n)/nn))(-9))(3/5) assuming n is positive. n(594/25) Simplify (o(1/8)(((o((o/o*(2/5))/o)/o)/o)/o)/o)/((oo*(-6))/ooo/o(-7)o)(o(1/11)/(oo(-4)))/(o1o/(o/(o/o(-2)))) assuming o is positive. o(-3601/440) Simplify ((((h/(h(-24)h)h)/h)/h)/(h1h))/(h*(-11/8)h)(2/45) assuming h is positive. h(1261/60) Simplify ((w/(w*(1/3)w))/wwwww*(-2/11)w/(ww5)w(w/w(5/4))/w)/(((w/w0)/w)8)*(2/	{ "pile_set_name": "DM Mathematics" }
92 Let o(b) be the first derivative of -5b7/21 - 13b*4/12 + 18b + 10. Let v(a) be the first derivative of o(a). What is the third derivative of v(d) wrt d? -600d2 Let n be -484/(-4) - -4. Find the second derivative of 9g3 + 9g - 23g3 + 52 - n wrt g. -84g Let u(g) be the first derivative of g*7/30 - 7g*4/24 - 5g*2/2 + 14. Let q(c) be the second derivative of u(c). What is the second derivative of q(z) wrt z? 84z*2 Differentiate 182 - 68m3 - m2 - 276 - 11m + 11m wrt m. -204m2 - 2m Let n(h) be the second derivative of -13/2h2 + 0h*5 + 6h + 0h3 + 0 + 1/6h*6 + 0h*4. Differentiate n(j) with respect to j. 20j*3 Let i be (-80)/30 - (0 + (-6)/2). Let l(b) be the first derivative of 0b*2 - 5b - 5 + ib3. What is the first derivative of l(w) wrt w? 2w What is the second derivative of 11f3 + 51 - 6f2 - f3 - 51 + 86f wrt f? 60f - 12 Let n(y) = -228y3 - 10y*2 + 5y + 451. Let h(w) = 342w3 + 14w*2 - 7w - 676. Let g(t) = -5h(t) - 7n(t). Differentiate g(c) with respect to c. -342c2 Let w(b) = -b3 - 4b*2 + 3b - 705. Let g(a) = 3a3 + 14a*2 - 8a + 2115. Let d(l) = -2g(l) - 7w(l). Find the first derivative of d(j) wrt j. 3j2 - 5 Let v(r) be the first derivative of 0r*3 - 1 + 3/2r*6 + 0r*4 + 0r + 0r5 + 9/2r*2. Find the second derivative of v(w) wrt w. 180w*3 Let o(u) = 407u*3 - 24u*2 - 118u - 5. Let v(h) = -408h3 + 19h*2 + 118h + 4. Let n(p) = -4o(p) - 5v(p). Find the third derivative of n(t) wrt t. 2472 Let x(f) be the first derivative of 24 + 0f - 8f*2 + 0f*3 + 0f*5 + 0f*4 + 13/6f*6. Find the second derivative of x(a) wrt a. 260a3 Let s(f) be the second derivative of -f5/20 - f*4/12 + 7f*2/2 + 4f. Let p(a) be the first derivative of s(a). Find the second derivative of p(z) wrt z. -6 Let x(p) be the second derivative of 0p3 + 0p*4 - 1/10p*6 - 9/2p*2 - 18p + 0p5 + 0. Differentiate x(r) wrt r. -12r*3 What is the third derivative of 35v*6 - 5v*2 - 17 + 1 + 28v*6 wrt v? 7560v*3 Let r = 30 + -28. What is the second derivative of -10x + 3x2 + rx + x2 + x2 wrt x? 10 Let x(n) = -46n2 - 4n - 154. Let g(h) = 23h2 + h + 77. Let w(q) = -5g(q) - 2x(q). Differentiate w(z) wrt z. -46z + 3 Let o(x) be the third derivative of 0x - 1/35x7 + 0 - x2 + 0x4 + 0x*3 + 0x*6 + 1/12x*5. What is the third derivative of o(m) wrt m? -144m Suppose -5i = 9 - 19. What is the third derivative of -8g*i + 12g*6 + 218g - 218g wrt g? 1440g*3 Let o(c) be the third derivative of 799c*6/120 - 943c3/6 - c2 - 13c. Differentiate o(i) with respect to i. 2397i*2 Let j(y) be the first derivative of -3y*5/5 + 5y*3/3 + 13y + 133. Find the first derivative of j(g) wrt g. -12g3 + 10g Suppose l + 12 - 45 = 0. Let x(m) = 43921m + 2 - 3 - 43925m. Let q(c) = -21c - 6. Let b(k) = lx(k) - 6q(k). Find the first derivative of b(d) wrt d. -6 Differentiate -87p*3 - 116 + 517p - 517p wrt p. -261p*2 Let h(t) be the first derivative of -151t*2/2 - 210t - 145. Differentiate h(r) with respect to r. -151 Let a(o) = -4o + 3o - 1 + 2o - 2. Let s be a(7). What is the first derivative of 0b*4 + 0b4 + 5 - bs wrt b? -4b3 Let m(x) be the second derivative of -7x*3/2 + 275x*2 - 305x. What is the derivative of m(z) wrt z? -21 Suppose -3d - 30 = -5p + 8, -3p + 25 = -4d. Suppose 8f = pf + 2. What is the derivative of -3 - f + 4 + 7n4 wrt n? 28n*3 Let s = 3 - -20. Suppose -3a = -2y + 17, 2y - 4a = a + s. Find the first derivative of -4 + 22r*4 - 26r*y + 1 wrt r. -16r*3 Let n = 18 + -16. What is the second derivative of -nz*4 + 2z*4 + 5z*4 - 3z*4 - 8z wrt z? 24z2 Let a(k) = -k + 22. Let y be a(13). Find the second derivative of -5f - f + yf4 + 19f*4 + 8f wrt f. 336f2 Let z(b) = -1004b*3 - 38b + 592. Let j(g) = 335g3 + 12g - 197. Let h(u) = 16j(u) + 5z(u). What is the second derivative of h(q) wrt q? 2040q Let x(k) be the third derivative of -7k*2 + 1/120k*6 - 1/5k*5 + 0k + 0k4 + 0k3 + 0. What is the third derivative of x(c) wrt c? 6 Let y = 19 + -17. Differentiate -y - 7 - x3 - 4x3 - 2 wrt x. -15x*2 Suppose 14x - 1065 + 995 = 0. Let l(h) be the second derivative of 4h + 0 - 7/20h*x + 0h*3 + 0h*4 - 3h*2. Differentiate l(y) wrt y. -21y*2 What is the first derivative of 182 - 897 + 186o - 782o wrt o? -596 Let n(f) be the third derivative of -f6/45 - f5/60 + f3/6 - 5f*2. Let m(r) be the first derivative of n(r). What is the second derivative of m(i) wrt i? -16 Differentiate 95l + 13 - 2l + 23l with respect to l. 116 Let q(r) = -r*3 + 12r*2 - 10r - 9. Let u be q(11). What is the third derivative of -15lu - 10l + 55l3 + 10l wrt l? 330 Let h(t) be the third derivative of -t7/105 - t5/5 + 11t4/6 - 42t*2. Find the second derivative of h(i) wrt i. -24i*2 - 24 Let g(a) be the third derivative of 0a - 19/24a4 - 1/60a*5 + 0 + 2a*2 + 0a*3. What is the second derivative of g(x) wrt x? -2 Let u be 115/10 - 1/2. Let g = u + -9. Find the third derivative of -m + 8m2 - m6 - 15mg + m wrt m. -120m*3 Let u(o) = -255o*2 - 75o + 8. Let b(k) = -85k2 - 25k + 3. Let n(j) = 8b(j) - 3u(j). Find the second derivative of n(w) wrt w. 170 Suppose 37 = 8r + 13. What is the second derivative of -2w*3 - 39w - rw3 - 14w*3 wrt w? -114w Let i(a) be the first derivative of -11a7/210 + a3/3 - 2a*2 - 16. Let q(h) be the second derivative of i(h). Differentiate q(k) with respect to k. -44k*3 Suppose -4x + 24 = 5o, -6o + 3o + 12 = 2x. Suppose 0 = -l + x - 4. Differentiate 1 - 4d - 2d + ld with respect to d. -4 Let t(g) be the third derivative of -g7/42 - g5/30 - 7g*4 - 3g*2 + 82. What is the second derivative of t(q) wrt q? -60q*2 - 4 Let a(p) be the third derivative of 0 + 0p - 7/3p3 - 15p*2 - 1/4p*4. Find the first derivative of a(d) wrt d. -6 Let a(f) be the second derivative of 59f8/56 - f4/12 - 7f3/3 + 48f + 1. Find the third derivative of a(v) wrt v. 7080v3 Let d(q) = -3q - 3. Let g be d(-2). Suppose 2k + 1 = g. What is the second derivative of -2v + k - 1 - 2v - 8v*4 wrt v? -96v*2 Suppose 6k - 261 = 1299. Differentiate -120z - 127z + kz - 9 with respect to z. 13 Let u(t) = -511t*4 + 10t*3 + 5t*2 + 146t. Let z(j) = 2j3 + j2 + j. Let k(i) = u(i) - 5z(i). What is the second derivative of k(h) wrt h? -6132h2 What is the derivative of 6 + 56 - 241b*3 - 99b + 293 + 99b wrt b? -723b*2 Find the second derivative of -3712q - 704q4 + 1852q - 89 + 1857q wrt q. -8448q*2 Let i = 63 - 57. Differentiate -12u - 9u - 7u + iu + 2 wrt u. -22 Let b(z) be the first derivative of -z6/3 + 5z*2 + 14z + 2. Let a(i) be the first derivative of b(i). What is the first derivative of a(g) wrt g? -40g3 Let a = 59 + -35. What is the second derivative of 9g*2 - ag*2 - 5g - 2g wrt g? -30 Let g(s) = -7s*3 + 27s + 7. Let i(c) = c*3 - c + 2. Let z(m) = g(m) + 5i(m). Differentiate z(t) wrt t. -6t2 + 22 Let o(t) be the third derivative of 116t*5/15 - 109t*4/24 + 3t*2 - 37. What is the second derivative of o(n) wrt n? 928 Let u(s) be the second derivative of 137s*6/30 + 167s*3/6 - 11s - 3. What is the second derivative of u(l) wrt l? 1644l2 What is the derivative of 3d - 24 - 2d - 13d - 4d3 + 6 wrt d? -12d*2 - 12 Let u = 90/7 + -325/28. Let y(p) be the first derivative of up*4 - 3p*2 + 0p + 3 + 0p3. Find the second derivative of y(q) wrt q. 30q Let b be 0 + 1 - (-2 - -8). Let g be (-8 - b)/((-6)/10). Find the third derivative of 5xg - 6x*5 - 7x2 - x5 wrt x. -120x2 Suppose 20 = -5m, 3u - 16 = 5u + 3m. Let x = u + 8. Find the third derivative of 3f*2 + 8f*x + 0f*5 + 0f*5 - 9f*6 wrt f. -120f*3 What is the first derivative of 254 - 1 - 12 + 37 + 209m*2 + 37 wrt m? 418m Let v(f) be the third derivative of -22f7/105 - 3f*5/20 - 347f*3/6 - 805f*2. Differentiate v(z) with respect to z. -176z*3 - 18z Let u(k) = k*2 - k. Let z(b) = -3b*2 - 6b - 9. Let a(i) = 2u(i) - z(i). Differentiate a(c) with respect to c. 10c +	{ "pile_set_name": "DM Mathematics" }
sqrt(114)))/(-2sqrt(24)))2. 247/16 Simplify ((sqrt(2299) - sqrt(2299)-2-5 - ((sqrt(2299) - (-1 + sqrt(2299))) + 0) - (2 + -1sqrt(2299) + sqrt(2299) + -1(-1 + sqrt(2299)))) + -2)2. 1056sqrt(19) + 147172 Simplify (-5-2sqrt(528)2-6)/(6(sqrt(55)/sqrt(45) + sqrt(11)) - -2(2sqrt(66))/sqrt(6)). -40sqrt(3) Simplify -1(-14(sqrt(1188) + sqrt(1188)1))/(1sqrt(75) + (sqrt(36)3)/sqrt(12)). 6sqrt(11) Simplify ((sqrt(343) - (1 + 3sqrt(343)) - sqrt(343))*2 - (1 + (sqrt(1764) + sqrt(49))/sqrt(7)))-5. -15435 - 175sqrt(7) Simplify -1sqrt(2299)2 - sqrt(114)/(sqrt(18)/sqrt(3))-3 - (-2sqrt(152) + sqrt(152))/(sqrt(2) + 4(sqrt(2) + sqrt(8)/sqrt(4)))-5. -181sqrt(19)/9 Simplify (((-2sqrt(45) - sqrt(45))-2)/(2sqrt(576)) + (sqrt(5) + (sqrt(10)/sqrt(2) - sqrt(5)) + -5)4-1)2. -145sqrt(5) + 29805/64 Simplify 1 + (-5(-2 + sqrt(243)) + -3sqrt(243)1 - (3 + sqrt(243) + sqrt(243) + (sqrt(243) - sqrt(243)5) + -2))*2. -972sqrt(3) + 8830 Simplify -1 + (-2sqrt(2904)6 + 3-2sqrt(2904))/(-2(sqrt(24) + (sqrt(600) - (1sqrt(600) + sqrt(600))))/sqrt(2)). -99sqrt(2)/4 - 1 Simplify (sqrt(104) + sqrt(104) + sqrt(104) + (sqrt(104) + sqrt(104)3)1 + sqrt(104))/(-1sqrt(512)) + (-2 + sqrt(26)/(2sqrt(18)) + -5)2. -10sqrt(13)/3 + 1777/36 Simplify 1 + 1sqrt(1573)4 + -4 + (-4 + (sqrt(3159) - (sqrt(3159) - (sqrt(3159) - -2sqrt(3159))))/sqrt(3))-6. -118sqrt(13) + 21 Simplify ((-12sqrt(297) + 2sqrt(297)2)/(sqrt(1331) - 4((sqrt(1331) - -3sqrt(1331)) + sqrt(1331))))2. 108/43681 Simplify (sqrt(65)4-5 - sqrt(65)23)/((sqrt(720) + (sqrt(720) - sqrt(720)-1-2) - sqrt(720))-2). -13sqrt(13)/12 Simplify -265((sqrt(70) + sqrt(70)1)/sqrt(10) + 2)21 + 5. -1915 - 480sqrt(7) Simplify (-1((sqrt(91)22)/(sqrt(784)/sqrt(7)))*2 + -2)-1-1. -15 Simplify 4(0 + sqrt(405) + -3) + (sqrt(405) + -2)*2-4 + 2 + 0 + sqrt(405). -1646 + 189sqrt(5) Simplify ((-3((sqrt(550) - sqrt(550)2-6) + sqrt(550)))/((sqrt(1331) - -1sqrt(1331))1) + 0)*2. 22050/121 Simplify (sqrt(7)-2 + 4)*2 + sqrt(49)/(sqrt(7)-1) + (1sqrt(343) + -1)3 + 1. 4sqrt(7) + 42 Simplify (-3(sqrt(68) + -1(2sqrt(68) + sqrt(68)) - sqrt(68) - sqrt(68))5)/((1sqrt(28)2)/(sqrt(252)/sqrt(4))). 90sqrt(17) Simplify (((6sqrt(135)-2)/sqrt(3))/(-2sqrt(729)-3)-3)2. 20/9 Simplify ((sqrt(130)-1)/sqrt(10) - (-1 + sqrt(13) + 1)) + -5 + ((sqrt(78) + -3sqrt(78) + sqrt(78))3)/(-3sqrt(864) - sqrt(6)). -71sqrt(13)/37 - 5 Simplify (2(sqrt(1568) + -5 + sqrt(1568) + 1 + sqrt(1568) + ((1sqrt(128))/sqrt(8))/(-1sqrt(288))))2. -8048sqrt(2)/3 + 506594/9 Simplify (-14sqrt(2560)4)/(sqrt(72)-3 + sqrt(8)-42). 128sqrt(5)/17 Simplify ((-3-2sqrt(350))/(-1sqrt(810)))/(3sqrt(63)/sqrt(9) - (sqrt(7) - sqrt(77)/(sqrt(44)/sqrt(4)))). -2sqrt(5)/9 Simplify -3 + (sqrt(162) + sqrt(162)-2 + 4)-1 + (4(sqrt(162) - -2sqrt(162)4)4)*2. 9sqrt(2) + 3359225 Simplify ((((sqrt(567) - (sqrt(567) - -1(-5 + sqrt(567)))) + sqrt(567) + sqrt(567) + -1sqrt(567) + 2 + -3)-6 + 2)-2)*2. 1936 Simplify (1sqrt(700)1)2 + 5 + ((2(sqrt(112) + -1) + sqrt(112))*2 - (-5 + (sqrt(112)-1)*2)). -48sqrt(7) + 1610 Simplify (3 + ((sqrt(180) + sqrt(20))2)/(6sqrt(64)) - (sqrt(5) + 1 + 1 + (sqrt(10) + sqrt(20)/sqrt(2) - sqrt(10))/sqrt(2) + 0))*2. -10sqrt(5)/3 + 134/9 Simplify 0 + (((sqrt(180) + (sqrt(180) - (sqrt(180)-1 - sqrt(180))) + sqrt(180))6 + sqrt(180))/sqrt(3))/(-1sqrt(588)3). -31sqrt(5)/21 Simplify ((2 + sqrt(192) + 0)4)*2 - 5(4 + (sqrt(147)1)2 + 3). 512sqrt(3) + 2366 Simplify 3((sqrt(972) - (sqrt(972) + 1sqrt(972)3))/((sqrt(4) - sqrt(12)/sqrt(48)) + sqrt(64)6 + sqrt(4) + sqrt(4)))*2. 104976/11449 Simplify (3sqrt(18)-6 - 1(sqrt(18) - sqrt(18)-1))/(sqrt(6) + sqrt(486)2 - 2sqrt(726)). 20sqrt(3)/3 Simplify -3 + (1sqrt(1088)-2 + -5 + ((sqrt(1088) - (-2 + (sqrt(1088) - sqrt(1088)-1) + sqrt(1088))) + sqrt(1088))1 + -1)*2. 192sqrt(17) + 9805 Simplify 2 + (4(sqrt(77) + sqrt(77)2 + sqrt(77)))/((sqrt(44)/sqrt(2))/sqrt(2)) + -1 + (sqrt(112) + 1)*2 + 1 + 3. 24sqrt(7) + 118 Simplify (2(2(462sqrt(3) + (sqrt(363) + (sqrt(363) - (sqrt(363) + -2)) - sqrt(363)) + -1) + 3))2. 3840sqrt(3) + 110692 Simplify -5 + (-4sqrt(156)2)/(sqrt(300)2 - sqrt(12) - sqrt(12)) - (6(sqrt(325) - (sqrt(325) + (sqrt(325) - (0 + sqrt(325))-3)2)) + -4). -sqrt(13) + 31199 Simplify (-41(sqrt(550)/sqrt(11) - (sqrt(14) + (sqrt(56) - sqrt(14)))/sqrt(7) - ((sqrt(2) - sqrt(12)/(4sqrt(6))) + 1)))*2. -72sqrt(2) + 178 Simplify (sqrt(250)/(((3sqrt(110) + sqrt(110) + sqrt(110) - sqrt(110)) + sqrt(110))/sqrt(11)))/(65sqrt(320)). sqrt(5)/1200 Simplify (-2(sqrt(1584) + -4)*2 - sqrt(1584)) + sqrt(1584) - (sqrt(1584) + -3sqrt(1584)-1) - (-3-21sqrt(1584) + 0). -3200 + 72sqrt(11) Simplify 3((-1sqrt(2057) + -5 - sqrt(2057))-4 + ((sqrt(204)1 + sqrt(204))6)/(sqrt(12) - sqrt(192)/sqrt(4))). 60 + 228sqrt(17) Simplify (-3 + -4 + 0 + (sqrt(832) + (sqrt(832) - (sqrt(832) - (sqrt(832) - (-5 + sqrt(832)1)))) + -2sqrt(832)6 + -3)3)2. 528sqrt(13) + 906049 Simplify (-5(4 + sqrt(1584)-2 + 1))*2 - (sqrt(110) - (3sqrt(110)-2 - sqrt(110)))/(-1sqrt(160))4. -5992sqrt(11) + 159025 Simplify 2 + (4 + sqrt(27)-1 - (sqrt(27) + (sqrt(216)1 - sqrt(216))/sqrt(8)))*2 + (sqrt(108) + 2 - sqrt(135)/sqrt(45)). -43sqrt(3) + 128 Simplify -5(sqrt(931) + (sqrt(931)2 + sqrt(931))3 + 0 + (63sqrt(19))2 + 2). -30790 - 350sqrt(19) Simplify -1 + -3(1 + -5(-2 + -1sqrt(847)-11))2. -63889 + 3630sqrt(7) Simplify (0 + 3 + 5 + (-5 + sqrt(162)1 + -4)-3)*2 + 1. -1890sqrt(2) + 2684 Simplify (0 + -3(sqrt(80)-2 + 3 + -5 - (-1 + 1 + sqrt(80) - (sqrt(80) + -1 + -2 - sqrt(80)))))*2. 1080sqrt(5) + 6705 Simplify ((sqrt(110)1-6 - ((sqrt(110)3 + sqrt(110))-6 - sqrt(110)))/(-6(1sqrt(250) + sqrt(40)/(sqrt(4) + sqrt(16) + sqrt(4)))))*2. 15884/3969 Simplify (-5(sqrt(68)5 + sqrt(68)) - 6(sqrt(68) + (sqrt(68) + sqrt(68)1 - sqrt(68)) + sqrt(68)))/(-1sqrt(576) + sqrt(144)3). -8sqrt(17) Simplify (2(sqrt(66) + sqrt(66)-1 - sqrt(66)) + sqrt(66) + (sqrt(66) - -1sqrt(66))-3)/((sqrt(1200) - sqrt(1200)-2)/(sqrt(14)/sqrt(28))). -7sqrt(11)/60 Simplify (sqrt(539)/(sqrt(22)/sqrt(2)))/(sqrt(7)-1-3) - (sqrt(448) + 1 + 2((sqrt(7) + (sqrt(7) - sqrt(63)))2 + sqrt(7)))-6. 90 + 181sqrt(7)/3 Simplify -3(2 + (sqrt(1584) - (sqrt(1584) - ((-1 + sqrt(1584))*2 + 1)) - sqrt(1584)4-5)). -4764 - 648sqrt(11) Simplify ((-2 + sqrt(252) - (sqrt(7)2 + 2)2)-1 - 3(sqrt(175) - (sqrt(175) + 0 + 1 + sqrt(175))2))2. 94sqrt(7) + 4274 Simplify 3(3 + 6(5 + sqrt(300)) + 0 + (5 + sqrt(300))-3)*2. 3240sqrt(3) + 9072 Simplify 2((sqrt(272) + sqrt(272)-1 + 4 + -4(-3 + sqrt(272)))2 + sqrt(272) + (sqrt(272) - (-2sqrt(272) + -1 - sqrt(272))) + -2sqrt(272)6). -1080sqrt(17) + 9218 Simplify (4((2((sqrt(171) - sqrt(171)1) + sqrt(171)) - -1sqrt(171)1)-3)/(-6(sqrt(576) - sqrt(576)-2 - sqrt(576))-1))*2. 171/64 Simplify 1 + (sqrt(121)1-2 - -2sqrt(121)6)/((-3sqrt(110)/sqrt(2) - sqrt(55))/(sqrt(315)/sqrt(7) + sqrt(5))). -10sqrt(11) + 1 Simplify ((4 + 0 + sqrt(980) + (sqrt(980) + sqrt(980)1 - sqrt(980))-6 + sqrt(980) + 5)2)*2. -4032sqrt(5) + 63044 Simplify (sqrt(171) - -2sqrt(171)1 - (24sqrt(171) - sqrt(171)))/(-3-2sqrt(900)-6) + -2. -2 + sqrt(19)/90 Simplify 3 + (-6sqrt(77)-1 - (sqrt(77) - sqrt(77)1-2))/((sqrt(70) - ((sqrt(70) - (1sqrt(70) + sqrt(70)))-4 + sqrt(70)))/sqrt(10)) + -5. -3sqrt(11)/4 - 2 Simplify (-3((sqrt(120) + sqrt(120)1 + sqrt(120) - sqrt(120))-6)/sqrt(4))/((sqrt(36) - sqrt(144)/sqrt(4) - sqrt(36))/sqrt(6) + sqrt(600)3). 36sqrt(5)/29 Simplify -2 + ((sqrt(480) - (sqrt(480) + (1sqrt(480) - sqrt(480))))1)/(((sqrt(40) + sqrt(360) + sqrt(40))-5)/sqrt(4)) + 3. 1 Simplify (0 + -4 + sqrt(304) + (sqrt(304) - -1(sqrt(304) + 2)) + -3)25-64. -331320 + 14400sqrt(19) Simplify ((-2((sqrt(68) - (-2 + sqrt(68))4) + sqrt(68)) + 0 + sqrt(68) + 1 + (2(-1 + sqrt(68)) - sqrt(68)) + 5)-3)2. -2592sqrt(17) + 23328 Simplify -5 + (0 + ((-5 + sqrt(612) + sqrt(612)-1)2 - sqrt(612))-1 - (1 + -5(sqrt(612) - (-2sqrt(612) + -4))*2)). 726sqrt(17) + 27589 Simplify ((1 + sqrt(300) + 5 - (sqrt(300) - (sqrt(300) - 5*(sqrt(300) - (sqrt(300) + -2))) - sqrt(	{ "pile_set_name": "DM Mathematics" }
he nearest to 0.1 in n, -0.05, 5? -0.05 Let h = -87/2852 + -7/124. Which is the closest to 2? (a) h (b) 0 (c) -3 (d) -177 b Let k(g) = 4 - 8 - 3g3 - 5g*2 - 4g + 3g2 - 4g*2. Let x be k(-2). What is the nearest to 0.1 in 0.1, x, 2/3? 0.1 Let t = 0.64 - 5.64. Let x = 70.07 + 0.33. Let g = -70 + x. Which is the nearest to -2/7? (a) 0 (b) t (c) g a Let n = 32755/268 - 489/4. Let k = -63/134 + n. Which is the nearest to 2? (a) 2 (b) -0.3 (c) k a Let a = -38.39 + 38.69. What is the closest to 5/7 in a, 2/7, 4, -44? a Suppose -7q = 200 - 214. Let y = 0.48 + 1.72. Let f = y - 2. What is the nearest to q in f, -4, -0.4? f Let p = -4828.5 + 4828. Which is the closest to p? (a) 4/5 (b) -0.6 (c) -2/7 b Let c = 9/38 - 14/19. What is the nearest to -7/6 in 2/11, c, 2/79? c Let t = 35667 - 35667.4. What is the closest to 1 in 33, t, 2/31? 2/31 Let y = -1.96 + 2. Let s = -23687 + 23686.5. What is the nearest to y in -1, -0.2, s? -0.2 Let k = 0 - 0.1. Let y = 183.2 - 541.2. Let d = y + 361. What is the nearest to 2 in d, k, 1/5? d Let j be 15924/(-30) - 0 - (1 - 5). Let q = j + 527. Let n = -1 - -0.8. What is the closest to n in q, -1, 2/3? q Suppose 2q - 1 - 1 = 0. Suppose 4g + h - q = 0, 0g + 4h + 16 = 4g. Let m = 4166 - 4167. Which is the closest to m? (a) g (b) -0.3 (c) -0.1 b Suppose 5t - 115 + 20 = -2r, 74 = 4t + 2r. Let q be (-16)/t - (-22)/231. Let i = -3.5 + 2.8. What is the closest to 1/4 in i, 5, q? q Let y = -173.14 - -173.34. Let k = -137 - -137.61. What is the closest to k in -0.2, y, -5? y Let i = -35908 - -106604/3. Let t = -373 - i. What is the closest to -0.2 in -0.3, t, 0? -0.3 Let g = -3.66 + 4.66. Which is the closest to -1? (a) 22/21 (b) g (c) 4/7 c Let h = 18.3 - 18.5. Let f = 4141/2 - 2070. What is the nearest to f in h, -5, -0.8? h Let r = 0.00771 + 0.20229. What is the closest to 0.2 in 4, r, 0, -1/2? r Let z be (-2)/(-4) + (-1)/(-2). Let f = -0.01 - 0. Let x = -773.75 + 768.75. What is the closest to z in f, x, 4? f Suppose h - 243 = 5x, 4h = -x - 2x + 1087. Let m = -268 + h. What is the closest to 1 in m, -4, -3? m Let l be 22/255-3 + (-50)/(-850). Let k be (-8 - -2)/(3 - 2). Let i be 3 - 1 - k/(-4). What is the nearest to -4 in 4/3, i, l? l Suppose -50q = 26q + q + 231. Let m(j) be the second derivative of j4/12 + 5j*3/6 + 3j*2/2 - j. Let s be m(q). What is the nearest to 1 in s, -2, 3/4? 3/4 Let q = -4 - -4.1. Let i = 29 - 201/7. Let l be (-4)/(-4) + (-676)/468. Which is the nearest to i? (a) 3/5 (b) l (c) q c Suppose 2l - 16 = -2i, 20 = 9i - 5i. Let t be 88/220 - (1 + -1). Let y = -0.1 - 1.9. What is the closest to y in l, t, -2? -2 Let w = 27515/3 + -9172. Which is the nearest to w? (a) 0.4 (b) 2/491 (c) -0.5 (d) -4 c Let c = 16.4 + 25.3. Let j = -5.8 + c. Let i = -36 + j. What is the closest to i in 0.1, 4, 10? 0.1 Let y = 1.8408 + 0.1592. Which is the closest to 1/3? (a) 274 (b) y (c) -1 c Let v = 14013 + -14089. What is the nearest to -0.1 in -4, -27, v? -4 Let v = 0.1 + 0.4. Let h be ((-2)/4)/((-5)/10). Let d be 11 + (16 - 3) + -21 - (-13)/(-4). What is the closest to 0.1 in v, h, d? d Let f be 5 + (-17)/(-5) + 2/(-5). Suppose 5i = -fi + 14i. Let j = 54 - 36. What is the nearest to i in 0, 1, j? 0 Let y = 16 + -21. Let k = -147 - -41. Let n = k - -105. Which is the closest to n? (a) y (b) 1/6 (c) 1 b Suppose -13y - 40 = 64. Let c be (4/y)/(6/(-8)). What is the nearest to -5 in 3/5, 0.2, c? 0.2 Let z = -1490 - -1490.5. Let y = -36 + 61. Let i = -101/4 + y. What is the nearest to i in z, -3, 4? z Let a = 31811 - 349922/11. What is the nearest to a in -11, 5, 0.1? 0.1 Let w = -1.35 - -91.35. Let d = w + -90.4. Which is the closest to -2? (a) 4 (b) 1 (c) d c Let g be 2/(-6) - 4/(-6). Let i = -164.64 + 165.14. Which is the closest to 3/4? (a) i (b) g (c) -2/11 a Let n = -232/13 - -1843/104. Let v = -1051/5 + 211. What is the nearest to v in n, -3, -0.3? n Let l = -17221 + 17218. What is the closest to 71 in 3, l, -2/25? 3 Let l be 5(267/10 + 5/10). Let y = 141 - l. Which is the nearest to -6? (a) y (b) -2 (c) -3 c Let c = -689 - -690. Let k = -31 + 31.3. What is the closest to c in 3/8, -1, k? 3/8 Let r = -0.0045 - -0.0645. Which is the closest to 0.85? (a) r (b) 1/4 (c) 0.4 (d) -1 c Let h = -22213/19 - -1169. Let t(n) = -n*2 + 7n + 15. Let c be t(9). What is the nearest to -0.2 in 3, h, c? h Let k = 1248 - 1363. Let r = 135 - 251. Let a = r - k. What is the nearest to a in 0.35, 1/7, 2? 1/7 Let h = -69.28 + 71.28. Let j = 3.6 - 4. What is the nearest to j in 7, 2/9, -3, h? 2/9 Let n be 58/(-18) - 8/(-36). Let s be 5/(-7 - n - -3). Which is the nearest to -0.2? (a) 0.5 (b) -0.2 (c) s b Let s = 66 - 64.6. Let c = -1.4 + s. Let f be -2 + (-1 + (-3)/6)-2. What is the closest to f in 0.1, 0.5, c? 0.5 Let r = 71.346 + -70.346. Let a = 1.1 - -3.9. What is the nearest to r in -2, -50, a? -2 Let t = -0.28677 + 0.37677. What is the closest to -2/5 in t, -0.2, -2/13? -0.2 Let v be (-2)/(-85)10/2. Let f = 36.3264 - 0.0264. Let c = f - 35.3. What is the closest to 6 in v, 0.5, c? c Let r = 2564/7 - 366. Let a be (-4)/((-3)/(9/6)). Suppose 0 = -3d + ad - 1. What is the nearest to r in d, -5, -3/4? -3/4 Let q = -9417 - -9418. What is the closest to q in 12, -0.3, -2/9? -2/9 Let r(u) = 30u - 3390. Let h be r(113). Let o(m) = -m3 - 2m*2 + 2m. Let t be o(-3). Let x = 0.1 + 0.1. Which is the nearest to h? (a) t (b) 2.9 (c) x c Let k = -5.84 + 5.34. Let v(l) = 3l + 6. Let h(t) = -2t - 7. Let b(i) = -4h(i) - 3v(i). Let s be b(11). What is the nearest to -2/5 in 2, k, s? k Suppose 26 = i - 5w, 2i + 3w + 14 - 1 = 0. What is the closest to 1/2 in 3/4, -8.22, -3, i? 3/4 Let i = 1074 - 1072. Which is the closest to i? (a) -1 (b) 45 (c) 1/5 c Let h = 0.25 - -5.75. Let f = -9 + h. Suppose -2l + 3q = -19, -3l + 3q + 23 = -1. Which is the closest to -1? (a) l (b) 0.1 (c) f b Let r = 2.85 + -3.973. Let d = r + 0.623. What is the closest to -1 in d, 0.5, 4? d Let v = 2/367 - 752/3303. What is the closest to 53 in 3/2, -2/5, v, 0.02? 3/2 Let b be (-1 - (-2 + 2))255/(-340). What is the closest to -0.4 in 44, b, -4/9? -4/9 Suppose 285t = 289t - 52. Suppose -3z + 0z - t = o, -1 = -z - 3o. Which is the closest to 0.3? (a) 3 (b) z (c) 3/2 c Let n = -4566 + 4561. Let k = 9.11 + -0.11. Let o = k + -9. Which is the nearest to o? (a) n (b) 2/25 (c) 0.1 b Let s = -0.02 - -0.12. Let p = -0.4191 + 0.2191. What is the closest to s in -0.4, -3, p? p Let u = -5 + 5.1. Let j be (-6)/4 - 8/(-112)-7. Let f be (-1)/((-2)/j) - 99/(-66). What is the closest to u in f, 0.38, 1? 0.38 Let t be ((-1)/(25/10))/((-2)/60). Suppose -3k = -0k - t. Let z be 0(-3)/9 + k/18. Which is the nearest to z? (a) -2/15 (b) 9 (c) 3 a Let p be (-60)/8 + 6 + (-85)/(-30). What is the closest to 2/9 in p, 2, -1/16, 5? -1/16 Let a = 65.13 + -65.13. What is the closest to a in -5.4, -1, 0.9? 0.9 Let l = -3509 - -3513. Which is the nearest to 2/7? (a) l (b) 5 (c) 2 (d) 15 c Let o = -420 + 427.3. Let k = o - 10.3. Which is the closest to -0.5? (a) -3/4 (b) -5 (c) 1 (d) k a Let q = 161/171 - 20/19. Let m be (2/(-5))/(456/950). Let d = 3.1 + -3. Which is the nearest to d? (a) 3/5 (b) q (c) m b Let s = 31 - 30.6. Let r = -7.6 + -3.4. Let n = r - -11. Which is the nearest to n? (a) s (b) -1 (c) 5 a Let z = -83055504/17 - -4887404. Let d = z - 1787. Let h = -21/34 + d. What is the nearest to -1/3 in 4, -0.5, h? -0.5 Let g = 1627.1 - 1627. Let o = 1 + 38. Let p = 39 - o. Which is the closest to p? (a) -0.6 (b) -3/2 (c) g c Let x = -1.913 + 0.013. Let q = -1.32 - x. Let j = q - -0.42. What is the nearest to 0.1 in j, -4, -0.2? -0.2 Let p = -798 - -802.53. Let z = p + -0.53. Let n = 23 - 22. Which is the closest to n? (a) -3 (b) z (c) -5 b Let q = 0.0368 - -202.9632. Let g = q - 202. What is the nearest to g in 0, 0.8, -3? 0.8 Let l = -3 + 2.9. Let q(j) = 29j + 417. Let i be q(-10). Suppose -75 = 52*b - i. What is the nearest to 1 in b, l, 0.09? b Let p = 7702 - 7704. Which is the closest to p? (a) -2/5 (b) 18 (c) 2/5 (d) 3 a Let l = 217 - 215.59. Let t = 2.59 + l. Which is the nearest to -1? (a) 0 (b) t (c) 0.4 a Let q be (45/(-450))/((-16)/(-60))	{ "pile_set_name": "DM Mathematics" }
u for u. -2 Let j be (-10)/(-35) + (-6)/21. Solve -o - 1 = -jo for o. -1 Let k = -18 - -22. Suppose -v = k, -43 = -4o - 2v - 3. Solve -o = -4y + y for y. 4 Let v be 26/(-4) - -8. Suppose 0 = -k + vk. Let u(o) = o + 4. Let a be u(k). Solve -at + 1 = -19 for t. 5 Suppose 0b - b - 3 = 2a, 2a = 4b - 18. Let c = b + -3. Let s be 0 - (c - -2)/(-1). Solve sh = -0h for h. 0 Suppose 3b - 2c - 64 = 0, 0c = -b + 2c + 16. Suppose -b = -3v + q - 6q, 27 = 5v + 4q. Suppose -5h = v - 13. Solve -1 = -n + h for n. 3 Suppose 3u = r - 13, 4r - 4u + 2 = 30. Let d be 5 - (-2 + 0 + r). Solve d = n - 2 for n. 5 Let z(r) = r*2 - 4. Let o be z(3). Solve -o + 0 = v for v. -5 Let j(y) be the second derivative of -2y*2 + 0 - 1/12y*4 - 5/6y*3 + 3y. Let m be j(-3). Solve -mk + 4k = -6 for k. -3 Let g be 8(6/(-4))/(-3). Solve 8y = gy - 12 for y. -3 Let t = -2 - -4. Let n be t3/((-6)/(-4)). Solve no = -o - 10 for o. -2 Let q(a) = 6a*2 + 2a. Let r be q(-3). Suppose 4x - 3n - n - r = 0, -n = -3x + 42. Solve 9d - x = 4d for d. 3 Let z = -29 + 32. Solve -zn + 8 = -1 for n. 3 Let s(z) = 2. Let d(v) = -v + 2. Let l(p) = -2d(p) - 6s(p). Let j be l(11). Let a = j - 4. Solve r + a = -0 for r. -2 Let o = 2 - 0. Suppose f = of - 4. Solve fc = 4 - 20 for c. -4 Let y be 4 - 1 - (0 + 0). Let r(o) = 5o2 + 2. Let m be r(2). Let u = m + -10. Solve n + u = -yn for n. -3 Suppose -5m = 5t - 2t - 37, 5m + t - 29 = 0. Suppose 0 = c + 3d - 1, 2 = -c - md - 3. Solve z = 3z - c for z. 5 Suppose 0 = 3w - 0w - y - 11, -4w + 21 = 5y. Solve wc = 10 - 2 for c. 2 Suppose -15 = -4k - k. Let v be (-48)/(-18) - 2/k. Let m be (-1 - -3) + 2v. Solve s - m = -3 for s. 3 Let m(v) = 3v2 + v. Let z be m(1). Let g be z((-9)/(-6) + -2). Let s be 7 + -10 + (-8)/g. Solve 3h = -s - 14 for h. -5 Let s = -140 - -143. Solve 15 = -0w + sw for w. 5 Let i = -3 + 8. Suppose -3y = -9, -ik + 20 = -k + 4y. Let s be ((-3)/15)/(k/(-10)). Solve -b - 2 + s = 0 for b. -1 Suppose b - c - 1 = 0, -c = 4b - 3b - 7. Solve 11 - 3 = -bq for q. -2 Let h(w) = -w - 1. Let t be h(-5). Solve -tz + 0z = 4 for z. -1 Suppose -3w + 32 = -1. Solve -w = -3l + 4 for l. 5 Let r be 0/((0/3 - -2) + 0). Solve r = 2s - 8 for s. 4 Suppose -5v + 135 = -45. Let h be ((-2)/(-6))/(3/v). Solve -4 = -0m + hm for m. -1 Let h = 21 - 16. Solve hz = 3z + 6 for z. 3 Let s = 23 + -23. Solve v + s = 3 for v. 3 Suppose -3b = -4g - 21, 2g = b + 4 - 13. Let n = -3 + b. Solve -3 + n = -3j for j. 1 Suppose 3q - 4 = 8. Solve 1 = -qy - 3 for y. -1 Suppose g + 25 = 5h + 3, 4h - 23 = -g. Solve 2y = gy for y. 0 Suppose -u = -4z - z - 25, 0 = -3u - 3z - 15. Solve 3r = -u - 6 for r. -2 Let t = 3 + -6. Suppose -6o - 21 = 3n - 2o, -4o - 15 = n. Let p = t - n. Solve pc = c + 3 for c. -3 Let c(s) = -s*2 - 30s - 62. Let p be c(-27). Solve 4y + p = 7 for y. -3 Let u be (-3)/6 + 31/2. Let y be 0/(3/1 + -2). Let v = 2 + y. Solve vc - u = -c for c. 5 Suppose -5p - 5v + 105 = 0, -90 = -5p - 4v + 2v. Suppose 0 = -4r - p, -2s - 2r + 4r = -14. Solve sw + 2 = 14 for w. 4 Let m = -2 + 15. Solve 3j - m = -1 for j. 4 Let b be (-5)/(-2) - 13/(-26). Solve -4r = b + 9 for r. -3 Let m(d) = d3 + d2 + d + 22. Let z be m(0). Let s be z + 0 + -21. Suppose s = -0g + 4g. Solve gk - 11 = -1 for k. 2 Let a(c) = c*3 - 13c*2 + 12c. Suppose -13 = 2u - 1. Let t(m) = m3 + 6m*2 - 2m. Let v be t(u). Let z be a(v). Solve 0 = -3y + 15 - z for y. 5 Let s be (2/5)/(2/10). Let o = -39 - -42. Solve on = sn - 4 for n. -4 Let i be -1-141. Suppose ix = -x. Solve -j = -xj for j. 0 Let c be (0 + -16)3/(-4). Let q be 206/14 - c/(-42). Let n be 18/5 - 9/q. Solve o = no for o. 0 Suppose -4j = -f - f + 2, -2f + 2 = 3j. Solve j + 12 = 3t for t. 4 Suppose 0o = -2o - 64. Let c be -4 - o/((-16)/(-4)). Solve cr = 8r + 16 for r. -4 Let h(w) be the second derivative of -w4/12 - w3/3 - w*2/2 + w. Let j be h(-2). Let i be (3/6)/(j/(-6)). Solve iu + 12 = -0 for u. -4 Let k(i) = i*3 + 19i*2 - 21i - 9. Let p be k(-20). Solve 12j - pj = -4 for j. -4 Let u be (3/(-2))/((-21)/224). Let t = u + -14. Solve -t = -5l + 3l for l. 1 Let y(b) = 4b - 23. Let k be y(6). Solve -3o = k - 4 for o. 1 Let z be 0/((-1 + -1)/(-2)). Suppose -3t + 16 = -2. Solve -t = -zv + 2v for v. -3 Let k be -4-34/12. Suppose -kv + 1 = -5a, -5v - 8 + 22 = -2a. Solve -4 + 24 = -vx for x. -5 Let s(z) = -3z. Let q be s(-1). Let y(j) be the first derivative of 7j*2/2 - 5j - 2. Let x be y(4). Solve x = -5f + q for f. -4 Suppose 3m - 44 = 3b - 2b, 0 = 5m + 2b - 77. Suppose -5v = -0v - m. Let d(p) = p*2 + 2p - 3. Let r be d(-3). Solve -vs = -rs + 3 for s. -1 Suppose 4m - 19 = -3a, 2a = -0a - 2m + 12. Let c = 10 - 6. Suppose -8 = -4h - 4y, 4y = 5h - y. Solve cn + h = a for n. 1 Let k be 16 - 3/((-6)/4). Suppose k = 5d - 3o, -4d + 3o + 2o = -17. Let y(t) = t2 + t + 4. Let j be y(-3). Solve dl = l - j for l. -5 Suppose 4a = 2t - 40, -a - 6 + 41 = 2t. Let i = t + -18. Solve -2z + i - 2 = 0 for z. -1 Let k(j) be the first derivative of j*3/3 - j - 1. Let y be k(1). Solve 3p - p + 4 = y for p. -2 Let x(u) = 4u2 + u. Let g be x(-1). Let h(p) = -2p*2 + p. Let s be h(0). Solve s = -b - gb + 16 for b. 4 Suppose 3s = 74 + 7. Suppose 2i + o - 5 = 0, 7 = 4o + s. Suppose 0 = -23x + 21x + 28. Solve -ij - 11 - x = 0 for j. -5 Suppose 0 = -3b + 6, 0 = 4x - 2b - b + 22. Suppose -2d + 4 = -4. Let o = x + d. Solve -v = -ov + 2 for v. -2 Let f(g) = g2 + 3g - 4. Let r be f(-4). Let k(o) = -o*3 + 4o*2 + 3o + 4. Let a be k(4). Let q = 17 - a. Solve -s + r = q for s. -1 Suppose -8 = -7c + 3c. Solve 3l + 4 = cl for l. -4 Let h = 50 + -27. Suppose -h = -2q - 5. Let g be ((-6)/5)/(q/(-30)). Solve 5c - c + g = 0 for c. -1 Let c = 9 - 6. Let q be (-205)/(-15) - 2/c. Solve -q = -5l - 3 for l. 2 Let c be (18/(-21))/((-1)/7). Solve 3d - 12 = cd for d. -4 Let t(k) = -k - 2. Let u be t(-6). Solve -4 = -5f + uf for f. 4 Let x = 125 + -116. Solve xi = 8i - 2 for i. -2 Let r = -1 - 0. Let t(p) = p + 5. Let m be t(-6). Let b be (2 + (m - r))1. Solve 10 = -0g + bg for g. 5 Let l(v) be the third derivative of v5/30 + v4/8 + 3v2. Let g be l(-2). Solve gd + 5 + 3 = 0 for d. -4 Let u be (-14)/(-91) - 111/(-39). Solve 4 = 2a - ua for a. -4 Let s(z) = z*2 - z + 7. Let d be s(0). Let v(g) = g - 2 + 2 - 5. Let j be v(d). Solve -ju = u - 9 for u. 3 Let h(m) = -m*2 + 5m - 2. Let x be h(3). Solve -x = 3f + f for f. -1 Let p(y) = -y - 3. Let h be p(-6). Suppose 0o = 4i + 2o, 0 = 4i + o. Solve hk + 8 - 2 = i for k. -2 Let t = 105 - -10. Suppose 6v = -4z + 4v + 62, 5z - 5v = t. Solve -5y + z = -2 for y. 4 Let m be (-12)/3(-3)/6. Solve mz = -2z + 12 for z. 3 Suppose 2j - 8 = p, 2j - 3j + 7 = p. Let o be (3 - 1) + 2/2. Solve -oi + p = -i for i. 1 Let w(v) = 2v*3 - 3v*2 - v - 4. Let n = 6 + -3. Let m be w(n). Suppose 0 = -5c - m + 60. Solve -4k - c = -0 for k. -2 Let c be ((-1 - -1) + -1)-2. Let r be (4/c)/(0 - -1). Solve -2v + 10 - r = 0 for v. 4 Suppose 0 = -4i + v - 2v + 12, 4i = -5v + 28. Solve -2p + i = -0p for p. 1 Suppose -23 - 27 = -5m. Let r = -10 + m. Solve r = 4l - 0 + 16 for l. -4 Suppose 3f - 17 = -5t + 12, 0 = 2t - 4f + 4. Let w(k) = -4k*3 - 3k*2 + 3k. Let y be w(2). Let h be y/(-4) + (-3)/6. Solve 0 = -c + tc - h for c. 3 Let m = -9 + 13. Suppose 0 = 2t - r - 3 - 5, -mt - r = -16. Solve -ta - 8 = -0 for a. -2 Suppose -1 = -2r - r + 2a, 2a + 4 = 4r. Solve ri - 7 - 5 = 0 for i. 4 Let k be 4/3 + 12/18. Solve j + kj = -15 for j. -5 Let z = 19 + -16. Solve 0 = zc + c for c. 0 Let x(k) = -k2 + 12k - 8. Let j be x(11). Suppose 2p - 25 = -jp. Solve -b - p = -0 for b. -5 Suppose -x - 2x - 2y = 19, 17 = -5x + 4y. Let l = x - -9. Solve 0o - 20 = -lo for o. 5 Let u(d) = d*3 - 9d*2 - 10d + 2. Let n be u(10). Suppose -57 = -4b - 17. Let a = b - 7. Solve nc - ac = -3 for c. 3 Suppose 0 = -4o - 5i + 25 - 2, 5i - 7 = 4o. Let v be (-3)/(o + -5) + 1. Let u = 14 + -8. Solve uw = 5w - v for w. -2 Let g(i) = -6i*3 + 2i*2 + 2i + 1. Let r be g(-1). Solve -2b = -rb + 20 for b. 4 Supp	{ "pile_set_name": "DM Mathematics" }
a*2 + 1/5a*5 + 0a - 8/3av - 1/12a*6. Factor h(m). 2(m - 2)*3(m + 1) Let z be 15/(-2)8/10-1. Suppose -u = z - 17. Suppose 52 - u + 4f2 - 5 - 24f = 0. Calculate f. 3 Let v(d) be the second derivative of d6/285 - d5/38 - 17d4/114 + 43d*3/19 - 180d*2/19 - 184d. Find r, given that v(r) = 0. -5, 3, 4 Let q(l) = 2l4 + 71l*3 - 128l*2 + 64l + 9. Let j(y) = 18y3 - 32y*2 + 16y + 2. Let r(w) = 9j(w) - 2q(w). Determine n, given that r(n) = 0. 0, 1, 2 Solve 22400 + 61610n2 + 3418n*3 - 418n*3 + 6154n*3 + 60n*5 - 494n*3 - 122240n + 100846n2 - 2024n*4 = 0. -7, 1/3, 2/5, 20 Let n be 2265 + -2294 + 311. Find u such that -2 + 12/7u + 2/7u*n = 0. -7, 1 Let y(d) be the first derivative of -2/15d*3 - 1/15d*4 - 14d + 20 + 0d2. Let o(p) be the first derivative of y(p). Factor o(z). -4z(z + 1)/5 Let r(h) be the first derivative of 2h*5/35 + 204h*4/7 + 36992h*3/7 + 2515456h*2/7 - 2103. Factor r(v). 2v(v + 136)3/7 Let k(i) be the first derivative of 1/11i*2 + 1/22i*4 - 4/33i*3 - 56 + 0i. Let k(b) = 0. Calculate b. 0, 1 Let m(z) be the third derivative of 1/4z4 + 0 + 1/30z*5 + 4z - z*2 + 2/3z*3. What is a in m(a) = 0? -2, -1 Let p(x) be the second derivative of 0x*3 + 4x + 0x2 - 1/12x*4 + 0. Let z(k) = -8k*2 - 28k - 8. Let y(f) = -12p(f) - z(f). Factor y(a). 4(a + 1)(5a + 2) Let l(r) be the second derivative of -r6/1440 + r5/24 + 7r4/32 - 2r*3/3 + 7r*2 + 4r - 10. Let w(m) be the second derivative of l(m). Factor w(p). -(p - 21)(p + 1)/4 Let c(a) be the second derivative of -a5/20 + 239a*4/12 - 6832a*3/3 - 37210a*2 + 841a. Solve c(u) = 0 for u. -5, 122 Let c = 75 + 15. Let o be 4/18 + 1420/c. Factor 17q - 16q + 0q2 - q2 - 9q - o. -(q + 4)*2 Let r(g) be the second derivative of -7g*5/75 - 29g*4/60 - 2g*3/15 - 179g*2/2 - 21g - 4. Let l(m) be the first derivative of r(m). Factor l(j). -2(j + 2)(14j + 1)/5 Factor 115b - 232 + 1/2b2. (b - 2)(b + 232)/2 Let -68h4 - 34h*3 + 2700 - 101h*3 + 31h*4 - 1545h + 34h4 - 1017h*2 = 0. What is h? -36, -5, 1 Let q = 652 + -650. Factor -21 + 10z*2 - 20z - 8zq - 6 + 0z - 21. 2(z - 12)(z + 2) Let g(j) = j*3 - 13j*2 - 15j + 18. Let p be g(14). Let s be 2 + 5 + (-9)/3. Factor l*4 - 2l*s - pl*3 - 8l*2 - 3l*2 + 7l2. -l2(l + 2)2 Let j(t) be the first derivative of -t6/3 + 18t*5/5 + 24t*4 + 104t*3/3 + 294. Factor j(b). -2b*2(b - 13)(b + 2)2 Let b be (-243/(-2))/((-5)/(-10)). Factor 46 - 4z3 - b + 12z + 48. -4(z - 2)(z + 1)*2 Let r(c) be the first derivative of -49 - 1/2c + 3/8c2 - 1/12c*3. Factor r(n). -(n - 2)(n - 1)/4 Let r = -255 + 257. Let i(d) = d*2 + 2. Let m be i(-3). Suppose -mv - 19v - 85 - 3vr + 10 = 0. What is v? -5 Let d(a) be the second derivative of -a5/80 - 1885a4/16 - 3553225a*3/8 - 6697829125a*2/8 - 7829a. Let d(b) = 0. Calculate b. -1885 Let j be 2640/910035. Determine k so that 31/9k2 - 5/9k - 17/3k3 + kj + 0 = 0. 0, 1/3, 5 Let r(b) = -5 - b2 - 4 + 12 - 3. Let z(m) = -50m*3 - 256m*2 - 220m - 16. Let f(j) = -4r(j) + 2z(j). Factor f(s). -4(s + 1)(s + 4)(25s + 2) Find i such that -8i2 - 171i - 121 + 14i2 + 61i*3 - 60i*3 - 90i*2 + 35 = 0. -1, 86 Let t = 437 + -432. Suppose 3r - tf = 15 - 10, r - 4f = 4. Factor 0a - 1/2a*2 + 2/3a*3 + r - 1/6a4. -a2(a - 3)(a - 1)/6 Let g(x) be the third derivative of x*8/1008 + 79x*7/630 + 209x*6/45 + 361x5/15 + x2 - 2068x. Factor g(r). r2(r + 3)(r + 38)2/3 Let r(u) = u3 - 49u*2 - 867u - 4911. Let d(i) = -41i2 - 5 + 3 + 3 + 351i*3 + 42i*2 - 350i*3. Let w(c) = 6d(c) - 3r(c). Factor w(f). 3(f + 17)*3 Determine b, given that -128018 - 5/3b*5 + 707135/3b + 762536/3b2 - 108702b*3 + 2542/3b*4 = 0. -1, 2/5, 3, 253 Let y = -83183 - -83185. Let -32/9d*y + 2/9 - 10/3d = 0. What is d? -1, 1/16 Suppose 2754 - 30f3 - 54f*4 - 409f - 2752f - 1132f + 1620f2 + 3f*5 = 0. Calculate f. -6, 1, 3, 17 Let n(c) be the second derivative of -11/60c*5 + 0c*2 - 2/9c*3 - 1/30c*6 - 1/3c*4 + 59c + 0. Factor n(a). -a(a + 1)(a + 2)(3a + 2)/3 Let q be 72/28 - ((-520)/48 - -11)0. Suppose 0 - qx*2 - 2/7x*3 - 16/7x = 0. Calculate x. -8, -1, 0 Let f = -505910102/459 + 1102202. Let g = f + -4/459. Factor -gx + 4/3x*2 - 4/3 + 4/3x*3. 4(x - 1)(x + 1)2/3 Let q be 10/8 + (-156)/(-16) + -9. Find t such that 5t - 324t2 - 77 + 329t*q + 17 = 0. -4, 3 Let r be 12/((23 - (20 - 3)) + (0 - 5)). Let t(g) be the second derivative of -2/3g*3 + 0 - rg + 0g2 + 1/6g*4. Let t(j) = 0. What is j? 0, 2 Let f(h) = -4h*4 - 62h*3 - 40h*2 + 18h. Let s(t) = -t*4 - 6t*3 - 5t*2. Let r(i) = -2f(i) - 12s(i). Suppose r(m) = 0. Calculate m. -9, -1, 0, 1/5 Let n(j) be the third derivative of 2j*7/15 + 2j*6/15 - 59j*5/15 - 10j*4 + 24j*3 - 2j*2 + 34. Factor n(q). 4(q - 3)(q + 2)2(7q - 3) Let u(d) be the third derivative of 2d*7/105 + 7d6/30 + d5/3 - 7d4/6 - 4d*3 + 1878d*2. Factor u(z). 4(z - 1)(z + 1)2(z + 6) Let k(s) be the second derivative of s*4/78 - 66s*3/13 + 9801s*2/13 + s + 151. Let k(j) = 0. What is j? 99 Let f(q) be the first derivative of -2q*5/25 + 13q*4/10 + 58q*3/15 + 3q2 + 1001. Determine g, given that f(g) = 0. -1, 0, 15 Let a(i) = -12 - 3 + i2 + 203i - 184i - 5. Let f be a(15). Determine v so that 33 - fv2 + 63v + 225v3 - 37 + 44 - 3v = 0. -2/9, 2/5, 2 Solve 2/5o2 + 792/5 - 144/5o = 0 for o. 6, 66 Let o(y) = 2y3 - 7y*2 + 310y - 302. Let n(i) = 5i3 - 14i*2 + 618i - 602. Let f(p) = -6n(p) + 14o(p). Factor f(j). -2(j - 14)(j - 1)(j + 22) Factor 88/3 + 118/3p*2 + 2p*3 - 304/3p. 2(p - 2)(p + 22)(3p - 1)/3 Let g(j) be the first derivative of j*4/44 + 104j*3/11 + 927j*2/22 - 2073. Factor g(y). y(y + 3)(y + 309)/11 Let n be 4/(-80)95/(-38) - 52/(-32). Factor -23/4q2 + 2 + nq*3 - 11/2q. (q - 4)(q + 1)(7q - 2)/4 Factor 348s - 202 + 18 + 4s2 - 128 - 40. 4(s - 1)(s + 88) Let v(n) be the third derivative of 0n*4 + 0n + 170n2 + 0n*3 + 0 - 1/195n*5 + 1/780n*6. Let v(d) = 0. Calculate d. 0, 2 Let l(t) = 12t - 34. Let u be l(8). Let g = -47 + u. Factor -g - 9h - 29h - 17h + 20h*2. 5(h - 3)(4h + 1) Let u(a) be the second derivative of -a*6/30 + 109a*5/5 - 11881a*4/2 + 2590058a*3/3 - 141158161a*2/2 - 1721a. Suppose u(q) = 0. Calculate q. 109 Determine l, given that -3/2l3 - 225l + 648 - 93/2l2 = 0. -24, -9, 2 Let y = 603 + -602. Suppose -l + 5 = 2j, -l = -5j + l + 17. Solve jx*3 + x + 6x*2 + 0x*3 - 4x*3 - y - 5 = 0 for x. -1, 1, 6 Let w(m) be the first derivative of -95/2m*2 + 25/2m + 19m4 + 288 + 8/5m*5 + 107/2m3. Suppose w(c) = 0. What is c? -5, 1/4 Let o(b) be the third derivative of -b5/120 - 229b4/48 + 77b*3/2 - 38b*2 + 12b. Solve o(t) = 0 for t. -231, 2 Let l be (2 + 0)/((-9)/(-198)11). Suppose -95p*2 - 169p*5 - 45p*l + 24p + 105p3 + 6p - 169p5 + 343p*5 = 0. What is p? 0, 1, 6 Let n be 1/(-6) + -43 + 19348/504 - (-5)/1. Solve 0d + 32/3d3 - 128d*2 - nd*4 + 0 = 0. 0, 24 Let x(i) = -3i*2 - i - 18. Let r(g) = -57g*2 + g - 36 + 56g*2 + 35. Let y(a) = -20r(a) + 5x(a). Factor y(v). 5(v - 7)(v + 2) Let p be ((-336)/(-18))/83 + -2. Suppose -13 = -2y - 5, 4y = -pw + 26. Let 8/5c*w - 2c + 4/5 - 2/5c3 = 0. Calculate c. 1, 2 Solve 290j*3 + 140j - 132j2 + 4j*4 + 278j*3 + 287j*3 - 867j*3 = 0. -5, 0, 1, 7 Let w = -239/50 - -249/50. Let z(y) be the first derivative of 2/25y*5 + 28 + 6/5y - wy4 - 8/15y*3 + 2/5y*2. Find f such that z(f) = 0. -1, 1, 3 Let x be 12/32 + (7474/592 - 10). Let -2/13k + 0 + 0kx - 4/13k*4 + 2/13k*5 + 4/13k*2 = 0. What is k? -1, 0, 1 Let y = -567 - -567. Let z(m) be the third derivative of 3/50m*6 + y + 0m + 1/20m4 + 0m*3 + 1/70m*7 + 17m*2 + 9/100m*5. Factor z(g). 3g(g + 1)2(5g + 2)/5 Let b(m) be the second derivative of 1/42m*7 + 0m*2 - 1/30m*6 - 1 + 0m*3 + 1/3m*4 + 8m - 1/5m5. Factor b(o). o2(o - 2)(o - 1)(o + 2) Let d = -2031064 + 18279589/	{ "pile_set_name": "DM Mathematics" }
3/15 - 21y*2/5 - 8y - 611. Factor p(z). -2(z + 1)(z + 20)/5 Let y(d) = d*2 + 1. Let r(p) be the third derivative of 1/3p*4 - 8p*2 + 5/6p*3 + 0 + 0p + 3/20p5. Let n(a) = r(a) - 5y(a). Factor n(w). 4w(w + 2) What is c in 0 - 3168c + 526/11c*3 + 4/11c*4 - 2/11c*5 - 48c*2 = 0? -11, 0, 12 Solve -8155l - 1248l - l2 - 7107556 + 4071l = 0 for l. -2666 Let -38t2 - 29 + t - 13 + 36t2 + t3 - 2t + 44t*2 = 0. Calculate t. -42, -1, 1 Let t = 709 + -697. Let d be (40/(-60))/(1/(t/(-10))). What is b in -1/5b*2 + db - 3/5 = 0? 1, 3 Let a(y) = -y*3 - 11y*2 - 20y - 22. Let t be a(-13). Let i = 4044/7 - t. Factor i - 36/7p2 - 6/7p. -6(2p - 1)(3p + 2)/7 Let h = 430 - 428. Solve 5jh + 90j - 25443 + 25443 = 0. -18, 0 Suppose 6l - h - 41 = 3l, 0 = -2l + 5h + 10. Suppose -p + 5b = -4p, 0 = -5b - l. What is s in -20s + 12 + ps3 - 5s2 - s3 + 2s2 + 7s*2 = 0? -3, 1 Suppose 0 = -5g - 107g + 172g - 46 - 74. Factor -15/8j + 0 - 1/8j*g. -j(j + 15)/8 Let d be -3 + (-331)/(-75) - 182/2275. Find p such that 2p2 + 0p*3 - 2/3p*4 - dp + 0 = 0. -2, 0, 1 Suppose 4m - l - 2 = 28, -16 = -m - 4l. Determine a so that -12a3 - 37a*4 - 4a*3 - ma*2 - 8a*5 - 22a3 + a5 = 0. -4, -1, -2/7, 0 Let t(h) be the first derivative of -h6/840 - h5/210 + h4/168 + h3/21 + 69h2 + 8. Let z(w) be the second derivative of t(w). Factor z(u). -(u - 1)(u + 1)(u + 2)/7 Let b(c) = 2c*2 + 8c + 3. Let p be b(-4). Suppose 4j - pj = 5. Let -5l3 - 18 + 3l - jl4 + 9l*2 + 6l*2 + 8 + 2l = 0. What is l? -2, -1, 1 Let h(q) = -3q2 + 3172q + 518412. Let b(o) = 4o2 - 3166o - 518411. Let p(t) = 8b(t) + 9h(t). Factor p(g). 5(g + 322)2 Let p(i) be the second derivative of 21/10i*5 + 0 + 1/4i*4 - 7i*3 + 0i*2 - 158i - 1/10i6. Factor p(v). -3v(v - 14)(v - 1)(v + 1) Let u(q) = -5q*3 + 2574q*2 + 5163q + 2602. Let p(r) = 70r3 - 36035r*2 - 72280r - 36430. Let l(h) = -6p(h) - 85u(h). Factor l(a). 5(a - 518)(a + 1)*2 Solve -11/3z*2 + 4/3 + 7/3z = 0 for z. -4/11, 1 Let l(k) = 4k3 - 456k*2 + 3168k - 6208. Let c(x) = -2x3 + 230x*2 - 1584x + 3104. Let p(i) = -9c(i) - 5l(i). Determine u so that p(u) = 0. 4, 97 Let h(s) be the second derivative of 21s5/20 - 121s*4/4 - 46s*3 + 54s*2 + 4s + 77. Solve h(v) = 0. -1, 2/7, 18 Suppose -13b = -25b + 7680. Let l = b + -640. Factor 0n + 0 + 2/7n*2 + ln*3 - 2/7n*4. -2n*2(n - 1)(n + 1)/7 Factor -2i - 9i2 + 8 - 5/4i*4 + 13/2i3. -(i - 2)3(5i + 4)/4 Factor 22w4 + 28w*4 + 26692w - 26692w + 2w*5 + 312w*3. 2w*3(w + 12)(w + 13) Let r = 4399/24090 - 38/219. Let f(g) be the second derivative of 0 + 1/33g*3 - 1/11g*2 - 13g + 1/66g4 - rg*5. Find k such that f(k) = 0. -1, 1 Let b(m) be the second derivative of 253m - 35/3m3 + 60m*2 + 5/12m4 + 0. Let b(s) = 0. What is s? 2, 12 Let c(b) be the second derivative of b5/80 - 47b4/16 - 6b*3 + 71b*2/2 - b + 2056. Solve c(k) = 0. -2, 1, 142 Let z be (38 - (-18592)/(-504) - (-1)/((-18)/65))/(-5). Suppose 10/3 - 27/2j - zj3 + 32/3j*2 = 0. What is j? 1/3, 1, 20 Find y such that -36y + 129y3 + 4y*2 - 312y*3 + 35y*2 + 180y*3 = 0. 0, 1, 12 Let b(s) be the third derivative of -1/105s*6 + 0s*5 + 0s + 0s3 + 2/735s*7 + 62 + 0s*4 - 2s*2. Suppose b(m) = 0. What is m? 0, 2 Let f(c) = -13c*2 + 27c + 54. Let o(s) = -s*2. Let k(q) = -3q*2 - 4q + 6. Let h be k(1). Let v(y) = hf(y) - 2o(y). Factor v(r). 3(r - 3)(5r + 6) Find r such that -943r - 25r + 207368 - 320r + 2r2 = 0. 322 Let i(k) be the second derivative of -16/15k*6 + 0 + 2/3k*7 + 0k*3 - 6/7k*4 + 0k*2 + 187k - 15/7k5. Solve i(t) = 0 for t. -3/7, 0, 2 Let d(u) be the second derivative of -u4/6 + 6556u*3/3 - 10745284u*2 - 700u - 2. Suppose d(j) = 0. What is j? 3278 Suppose -108/7a + 1458/7 + 2/7a2 = 0. Calculate a. 27 Let x(i) be the second derivative of i6/30 + 17i5/10 + 131i*4/4 + 884i*3/3 + 1352i*2 - 16i - 6. Find s, given that x(s) = 0. -13, -4 Let n be (4/48)/((-3235)/(-7764)). Suppose 28/5 - nr2 - 27/5r = 0. Calculate r. -28, 1 Factor 2/7k3 + 46/7k*2 + 320/7k + 600/7. 2(k + 3)(k + 10)2/7 Let p(h) = -h2 - 15h + 113. Let c be p(-19). Let -27 - 32s*2 - 24s - 11s3 + cs*3 - 2s5 - 22 + 81 = 0. Calculate s. -4, -1, 1, 2 Let x(m) be the first derivative of m4/2 - 82m3/3 - 485m*2 - 2550m - 11106. Find v such that x(v) = 0. -5, 51 Let q(f) = -7f3 - 207f*2 - 611f - 414. Let c(t) = 5t3 + 208t*2 + 615t + 414. Let m(n) = -3c(n) - 2q(n). Factor m(i). -(i + 1)(i + 2)(i + 207) Factor 24714y2 - 816y + 3656 - 7236y - 8408y + 50y4 - 12393y*3 - 23y*4. (y - 457)(3y - 2)3 Suppose -1077n = -1074n + 45. Let p be (-51)/(-6) + n/3 + -1. Factor pc*3 + 5 - 5c*2 - 5/2c. 5(c - 2)(c - 1)(c + 1)/2 Let b(s) be the first derivative of 88s*2 + 24 + 4/3s*3 + 1936s. Factor b(n). 4(n + 22)2 Let w(p) be the second derivative of -7/8p*3 + 30p + 0 + 1/40p6 - 5/24p*4 - 1/168p*7 - 9/8p*2 + 3/40p5. Factor w(d). -(d - 3)2(d + 1)3/4 What is f in 195/8f - 639/4 + 3/8f2 = 0? -71, 6 Let n(g) = -27g*2 - 2513g - 184. Let a be n(-93). Let p(j) be the first derivative of -4/3j6 + 0j + 4/5j5 + 14 + j4 + 0j*3 + 0j*a. Factor p(h). -4h*3(h - 1)(2h + 1) Let b(h) = 524h + 308114. Let m be b(-588). What is s in 15/4s*4 - 15s*m + 5/4s*5 - 10s + 0 - 5/2s3 = 0? -2, -1, 0, 2 Let q(t) be the first derivative of t6/18 - 32t*5/15 - 17t*4/3 - 2t*3/9 + 67t*2/6 + 34t/3 + 307. Let q(l) = 0. Calculate l. -1, 1, 34 Let q be -28 + (191352/96)/67. Factor 0 - 1/4c2 + qc. -c(c - 7)/4 Let w(x) be the first derivative of 9x*4/4 - 220x*3 - 443x*2/2 - 74x + 1365. Let w(u) = 0. What is u? -1/3, 74 Find j, given that 25/2j2 + 65/4j*3 - 30j + 5/4j4 + 0 = 0. -12, -2, 0, 1 Let q(r) = r2 - 47r + 177. Let f be q(43). Let k be (1 + f)(-41)/(-82). Factor -8/9w*k + 8/9w + 2/9w4 - 2/3 + 4/9w*2. 2(w - 3)(w - 1)2(w + 1)/9 Let m(s) be the third derivative of 0 + 5/336s8 + 35/8s*4 + 5/6s*5 + 0s - 37s2 - 1/14s*7 - 1/4s*6 + 15/2s*3. Factor m(r). 5(r - 3)*2(r + 1)*3 What is s in 16s*3 - 97s*4 - 40 + 36s*2 - 2s + 99s4 - 6s - 7s2 + s2 = 0? -5, -2, 1 Suppose 42/17y*3 + 18/17y*4 + 0 + 12/17y + 2/17y5 + 38/17y2 = 0. Calculate y. -6, -1, 0 Let c(y) be the first derivative of -y4/18 + 526y3/27 - 5720y*2/3 - 3872y + 6316. Find b, given that c(b) = 0. -1, 132 Suppose -700 = -45a + 52a. Let p = a + 302/3. What is r in pr3 + 2r - 2r2 - 2/3 = 0? 1 Suppose -5061/5f - 339f3 - 1686/5 - 3/5f*4 - 5067/5f*2 = 0. Calculate f. -562, -1 Let h(a) be the first derivative of -2a*5/5 - 58a*4/3 - 374a*3/9 - 74a*2/3 - 3206. Determine m so that h(m) = 0. -37, -1, -2/3, 0 Let u = 19 - 14. Let c(a) = -6a + 4 - ua2 + 3 - 4 - a2. Let l(g) = -g2 - g - 1. Let q(h) = c(h) - 3l(h). Suppose q(i) = 0. Calculate i. -2, 1 Let v(x) = -357x + 42. Let m be v(0). Let u(k) be the second derivative of 1/3k*4 - k - 21/10k*5 + 0k*3 + 0k*2 + m. Find o such that u(o) = 0. 0, 2/21 Let c(o) be the first derivative of -4/3o*3 - 46 - 8o - 6o2. Factor c(x). -4(x + 1)(x + 2) Suppose -6k - 23 = 61. Let p be (k/(-21))/((-2)/(-6)). Factor -1 - 20c2 + 30c*p + 13 + 2c - 22c2 - 2c*3. -2(c - 1)(c + 1)(c + 6) Suppose 8 = 4g + 5o - 6o, 3g - 3o = 6. Find y such that -y2 + 2y*2 - 4y*g + 18y - 28 + 3y2 - 2y*2 = 0. 2, 7 Let a(f) = 74f*2 + 5179f + 3348872. Let d(h) = 790h2 + 56968h + 36837592. Let u(z) = 32a(z) - 3d(z). Factor u(s). -2(s + 1294)2 Let v = 3407 + -23805/7. Suppose -6 - vz - 2/7z2 = 0. What is z? -21, -1 Let u(y) be the second derivative of y6/10 - 333y*5/20 + 4107y*4/4 - 50653y*3/2 - 630y. Determine g, given that u(g) = 0. 0, 37 Let l = 405 - 289. Let x be -1 + l/18 - 10/2. Factor -xn4 - 2/3n*3 + 0n*2 + 2/9n + 0. -2n(n + 1)*2(2n - 1)/9 Let m(o) be the first derivative of -o5 + 55o*4/2 - 455o*3/3 + 255o*2 + 3464. Factor m(v). -5v(v - 17)	{ "pile_set_name": "DM Mathematics" }
7304 Calculate -0.07 - 18. -18.07 What is 4 minus -307206? 307210 Add 329125.5 and -0.4. 329125.1 What is 127631 - -0.4? 127631.4 What is -0.1 minus -0.001886? -0.098114 Work out 0.3 + 364. 364.3 Add together -33 and 48580. 48547 What is 6 take away 0.845? 5.155 What is the difference between -0.24 and -42? 41.76 Total of 2 and -9243. -9241 What is 9 less than 0.637? -8.363 Subtract 0.1779757 from 0.1. -0.0779757 Total of 19.839 and 0.16. 19.999 What is -0.6942 - -0.02? -0.6742 What is 98487 minus -14? 98501 Add together 1295013 and -0.2. 1295012.8 Put together -1 and -0.436815. -1.436815 Work out -678.93 - -0.01. -678.92 What is -0.0946 - 0.3? -0.3946 3+177.5087 180.5087 Add -13170 and 4. -13166 -101524 - -4 -101520 What is 0.4 take away 126678? -126677.6 What is 2.78 minus 7.9? -5.12 Work out 2 - 6234.14. -6232.14 Calculate 1.4 - 0.021963. 1.378037 What is the distance between 0.696 and 0.15? 0.546 What is 1.8 plus -183465? -183463.2 What is -0.06 minus 0.571? -0.631 Work out -109.9 + 0.05609. -109.84391 9.923+0.13 10.053 Work out 18938 + 18. 18956 What is -1926680 minus -0.2? -1926679.8 What is the distance between -28.45 and -2? 26.45 Work out 344 + -1256. -912 -2 + -23935.19 -23937.19 Calculate -1 - -3.568. 2.568 What is 0.08 plus -5? -4.92 What is -39.79 less than 0.071? 39.861 Put together -0.366 and -0.35. -0.716 Add together -0.07 and -0.0013. -0.0713 Calculate -1799 + -0.17. -1799.17 Add together 0.286666 and -0.2. 0.086666 What is 144 less than -10.6? -154.6 Work out 0.179 - 3936. -3935.821 Total of 65.7 and 1.1. 66.8 What is 463 minus 304.6? 158.4 Calculate 0.011 + -2.6496. -2.6386 What is 5.84 + -30.3? -24.46 Calculate -844 - 15. -859 What is -16 minus -4473? 4457 Subtract -0.2 from -0.4177. -0.2177 Work out -89 - -12. -77 Calculate -2244.1 - 0.09. -2244.19 What is the difference between -0.02 and 1322? 1322.02 Calculate 100 - 63693. -63593 Add 20688 and 0.031. 20688.031 Total of 1.259 and -4.2. -2.941 What is -1310 plus 1.2? -1308.8 Calculate -4 - -1.121917. -2.878083 What is 0.147277 less than -1? -1.147277 Work out -19160306 - 0.2. -19160306.2 Subtract 1.285 from -4. -5.285 Total of 20812.1 and 0.1. 20812.2 Sum 0.2 and -6789. -6788.8 0.501 - -2 2.501 What is -0.4 plus -0.185983? -0.585983 Calculate -5.44 + 0.0185. -5.4215 What is 0.1 take away 1270? -1269.9 What is 61 plus -215? -154 Add together 1181 and -0.613. 1180.387 What is 23.41 plus -0.26? 23.15 What is -864838 take away -4? -864834 What is 12.245 less than 0.22? -12.025 -3816.6 + -0.143 -3816.743 What is -90859 minus 0.1? -90859.1 What is -0.08 + -1776? -1776.08 What is the difference between -3105.9 and -0.3? 3105.6 What is 2816 minus -9? 2825 8400 - 49 8351 Put together -0.1 and 4890. 4889.9 Work out -17418 - 0.3. -17418.3 What is 4 less than -28538? -28542 What is -8171 take away 1.64? -8172.64 What is -0.4 minus 14078? -14078.4 Subtract 0.5 from -215. -215.5 What is 0.4 plus 706? 706.4 What is -1 plus 926.4? 925.4 Subtract 181 from 0.9. -180.1 What is 1.43458 - 0.4? 1.03458 Subtract 707 from -81. -788 What is 1 plus -0.363? 0.637 Add together -38 and -3284. -3322 Calculate 26993 + -0.5. 26992.5 Calculate 8 - 132152. -132144 What is -2 + 57403? 57401 Work out -73.2 - 1. -74.2 What is the distance between -3579 and 0.2? 3579.2 What is 0.163 take away -1.8274? 1.9904 What is 1.244 + -0.32? 0.924 What is -15 plus 732210? 732195 Calculate 0.04 + -175224. -175223.96 What is -2 take away 255271? -255273 Calculate 406 - 0.03. 405.97 What is 16 less than -0.10874? -16.10874 What is 2096 plus 0.01? 2096.01 Total of -46.34 and -0.1. -46.44 Subtract -0.3 from 46131. 46131.3 Put together 1348 and 2345. 3693 What is -4781 - 0.1604? -4781.1604 What is -0.1 take away -266048? 266047.9 What is 9.26 plus -69? -59.74 What is -813 less than 2? 815 What is -636 - 952? -1588 17 - -312.908 329.908 Add together 143 and -37. 106 Sum 16.92 and -13. 3.92 -9+-474064 -474073 Total of -0.12 and -2433. -2433.12 Put together 0.079 and -19. -18.921 What is 4 + 0.2424? 4.2424 Add 786067 and 1. 786068 0.5868+-0.4 0.1868 What is 3.4 plus 2.7? 6.1 0.1 + 1459.9 1460 -309+260.72 -48.28 What is 3 + 7.37? 10.37 Calculate -18 - 0.019374. -18.019374 Put together -11 and -212. -223 What is 113 + 26? 139 Add together 311841 and 8. 311849 What is the difference between 1419 and -1.62? 1420.62 -574 + 4 -570 Calculate 16170 + -0.4. 16169.6 What is -149 take away 0.18? -149.18 What is -19.9 minus 1136? -1155.9 Add 4 and -404. -400 578730 + 0.1 578730.1 -0.32 + 6897 6896.68 5 - 0.1434038 4.8565962 What is -33.88 take away 2284? -2317.88 Calculate 0.5 + -9041. -9040.5 What is the distance between -4 and -6.9186? 2.9186 Add -13.2 and -2. -15.2 Subtract 350 from -3. -353 What is 932 - -102? 1034 Calculate -1.91 - -1.13. -0.78 Add -0.03 and -63. -63.03 Sum -5 and 0.433. -4.567 Calculate -0.4 - 2200. -2200.4 -0.1 - -0.13327 0.03327 27556 + 4 27560 What is -0.4 - 21374? -21374.4 Total of -4 and -120762. -120766 Work out 0.1 + 65.67. 65.77 Calculate 3.6231 - 0.31. 3.3131 What is -1088 + 0? -1088 What is -7 + -1220? -1227 Add together -124 and -26. -150 What is -30 minus 60? -90 -19 + 448578 448559 What is -3091 minus -4? -3087 Add 12 and -39.1. -27.1 What is -0.7088 - -0.077? -0.6318 Subtract 3861.7 from -1. -3862.7 -8278 - -0.2 -8277.8 -0.254+-1672 -1672.254 Subtract -1857 from 0.409. 1857.409 Add 5 and 0.84. 5.84 What is 0.09 minus 118? -117.91 What is 12 + -295479? -295467 Put together -36 and -7.8. -43.8 2.3+-270 -267.7 What is 5 less than 2.37829? -2.62171 Calculate 0 + 0.421. 0.421 What is -42.67 take away 0? -42.67 What is 0.68 plus -1.8? -1.12 What is the difference between -0.4 and 4337? 4337.4 21425 - 0.5 21424.5 What is 12.292 less than -9.9? -22.192 -5.3 + -2280 -2285.3 What is 0 - 1874718? -1874718 Sum -803.1 and -0.084. -803.184 Put together 0.04 and -207. -206.96 What is the distance between -2.4 and -4.493? 2.093 4.0423+-0.1 3.9423 What is the difference between 5.3 and -12? 17.3 What is 0.4 take away -3.433? 3.833 29636+4 29640 -66 - 0.17222 -66.17222 What is -717 less than -7? 710 Add together 0.08 and -0.02081. 0.05919 Put together -8334.8 and -0.6. -8335.4 Calculate 0.092 + -1.987. -1.895 0.436+2989 2989.436 Add together -4 and 0.0735. -3.9265 -2729 - 3 -2732 Put together 843 and -62. 781 What is -52 take away 1.138? -53.138 What is 681 - 0.36? 680.64 Put together -37 and -2641. -2678 366.5 + -0.1 366.4 What is the distance between -694 and -1? 693 What is 0.5 take away -195? 195.5 What is the distance between -44.2 and 1? 45.2 Add 2.228 and 1.8. 4.028 What is -0.058 minus 302? -302.058 What is -1085 take away 130.4? -1215.4 Subtract -0.2 from -517. -516.8 26 + 26321 26347 Add -73159 and 0.9. -73158.1 What is 107 minus -393? 500 Work out -47 - 1542. -1589 What is the distance between -221 and 0.14? 221.14 Add together -0.02 and -28253. -28253.02 What is -143352 take away -0.1? -143351.9 Subtract 7182 from -5. -7187 What is 13 less than -0.076? -13.076 Calculate 0.01224706 - -2. 2.01224706 What is 606 less than 6? -600 2622+2.71 2624.71 What is -0.0589 + 574? 573.9411 What is the difference between 5081.95 and 0.1? 5081.85 -23437+0.3 -23436.7 What is 4 minus -225.4? 229.4 Add 4 and -0.13161. 3.86839 What is 1.07 - 0.105? 0.965 What is -0.1 less than 131367.22? 131367.32 What is -2 minus 0.28? -2.28 What is -240.847 minus 0.1? -240.947 Add -2.6168 and 6.7. 4.0832 Work out 0.14 + -45025. -45024.86 Calculate 0.4124 + -7. -6.5876 Calculate -0.1061 + 27. 26.8939 Put together -7 and 1.225. -5.775 -1589 - -4855 3266 Calculate -28 - 1056. -1084 Total of 0.2 and -70521. -70520.8 Calculate 2207 + 0.22. 2207.22 Sum -1 and -12.076. -13.076 What is -1 - -4.8? 3.8 -0.3 - -88025 88024.7 What is the difference between 124950 and 8? 124942 What is 0 plus -277? -277 Calculate -0.0479 - 0.5. -0.5479 Put together 9858 and 0.01. 9858.01 -89+-7028 -7117 Subtract 2 from -225283.5. -225285.5 74689+11 74700 Calculate 9 + -163170. -163161 706 + 0 706 Calculate -4 + 839776. 839772 16.3 - -110 126.3 What is 1.1448 plus -151? -149.8552 What is 2.18 + 0.2? 2.38 Work out 0.38 + 0.34. 0.72 Add together 6182 and 0.4. 6182.4 What is 0.2 + -0.0376? 0.1624 Work out -5866 - -1.3. -5864.7 What is -0.3 take away 11796? -11796.3 Sum 933	{ "pile_set_name": "DM Mathematics" }
543204y2 - 473616y = 0. Calculate y. -69, 0, 1, 13/2, 132 What is p in -p*4/6 + 359p*3/2 - 27809p*2/6 - 188899p/2 - 236775 = 0? -11, -3, 41, 1050 Factor 5j2 - 59955j - 8062460. 5(j - 12124)(j + 133) Let 1723653t3/7 - 11938379t*2/7 - 890380t/7 + 36 = 0. Calculate t. -2/27, 18/63839, 7 Factor -4015947w2 + 36063690w - 80964075. -3(1157w - 5195)*2 What is v in 2v*4/11 + 790v*3/11 - 1536v*2/11 - 590336v/11 + 6471680/11 = 0? -395, -32, 16 Suppose -d*5/4 + 2059d*4/4 - 474595d*3/4 + 29104609d*2/4 + 474599d - 29112845 = 0. Calculate d. -2, 2, 127, 1805 Suppose 7u5/4 + 1087u*4/4 + 10974u*3 + 31984u*2 - 48032u - 69312 = 0. Calculate u. -76, -4, -1, 12/7 Suppose 3q4 - 1566q*3 - 255789q*2 + 5573580q - 28620900 = 0. Calculate q. -147, 10, 649 Let -2j4/9 - 4124j*3/9 + 12398j*2/9 + 16496j/9 - 16520/3 = 0. What is j? -2065, -2, 2, 3 Suppose 4p2/9 - 12583032p = 0. What is p? 0, 28311822 Suppose -5y4 - 11785y*3 - 6939055y*2 - 74910275y = 0. What is y? -1291, -1055, -11, 0 Let j*2 - 100232j - 19885140 = 0. Calculate j. -198, 100430 Factor 3k3 - 4286604k*2 + 120023148k - 840157920. 3(k - 1428840)(k - 14)2 Suppose -f2/4 - 661757f - 437922327049 = 0. Calculate f. -1323514 Factor -2g*3 - 118695682g*2 - 1761083175028480g - 1761083056332800. -2(g + 1)(g + 29673920)*2 Factor 2a*4 + 1312784a*3 - 2625574a*2 + 1312788a. 2a(a - 1)*2(a + 656394) Factor i*3 + 1477i*2 + 219591i + 8627715. (i + 81)*2(i + 1315) Factor 2v2/3 + 45164v/3 + 6596230. 2(v + 447)(v + 22135)/3 Suppose -35n3 + 365444655n*2 - 953927087240160n - 136275305635220 = 0. Calculate n. -1/7, 5220638 Find c such that -2c2/3 + 5684c/3 - 752070 = 0. 477, 2365 Factor -5r3 + 21598r*2 - 442755r - 180558. -(r - 4299)(r - 21)(5r + 2) Find q such that -6q*5 - 152037q*4 - 1443618q*3 + 4863495q*2 + 3419442q - 2735640 = 0. -25330, -12, -1, 1/2, 3 Let -7241965388100w2 + 43057440w - 64 = 0. Calculate w. 4/1345545 Suppose 25630s2 - 65s = 0. What is s? 0, 13/5126 Factor 3r2 - 19127478r + 30488367886707. 3(r - 3187913)2 Factor 2d*2/7 + 13574d/7 - 1015428/7. 2(d - 74)(d + 6861)/7 Let -2j5 - 1042916j*4 - 6257450j*3 - 13557776j*2 - 12514856j - 4171616 = 0. Calculate j. -521452, -2, -1 Solve 6a2 - 9728829a + 4864413 = 0. 1/2, 1621471 Determine l so that -l*3 + 16231l*2 - 18160388l - 18176620 = 0. -1, 1210, 15022 Factor 5n2 - 113594600n + 113594595. 5(n - 22718919)(n - 1) Factor -r*3/5 - 281869r2/5. -r2(r + 281869)/5 Find o, given that -3o*5/7 - 498o*4/7 + 2460o*3 - 82680o*2/7 - 68832o/7 + 48384 = 0. -196, -2, 2, 6, 24 Find v, given that 4v5/3 - 5872v*4/3 + 23036v*3/3 + 568048v*2/3 - 7680v - 187392 = 0. -8, -1, 1, 12, 1464 Find i such that i*4 - 558224i*3/3 - 992449i*2 + 12467336i/3 + 1488640 = 0. -8, -1/3, 3, 186080 Factor -3k2 + 745248k - 4471380. -3(k - 248410)(k - 6) Factor -2h2/11 + 2342128h/11 - 2342126/11. -2(h - 1171063)(h - 1)/11 Factor -i*2/3 - 3754i/3 - 288743. -(i + 247)(i + 3507)/3 Determine n so that -9n*5/2 - 155n*4/2 + 561n*3 + 1850n*2 - 2172n - 6160 = 0. -22, -20/9, -2, 2, 7 Find b such that 4b2/5 - 4843688b/5 + 1466332090084/5 = 0. 605461 Let 2x5/5 - 1689588x*4/5 + 475774463754x*3/5 - 8930857554544536x*2 - 803909928101066784x/5 - 401965669660263552 = 0. What is x? -15, -3, 281604 Factor 2a2/3 - 14195884a + 75571170953046. 2(a - 10646913)2/3 Factor i3 - 82580i*2 + 8745053i - 231669466. (i - 82474)(i - 53)2 Determine j so that 3j*4/5 - 510126j*3 + 722857894308j*2/5 - 68287180510419162j/5 + 68286457655075481/5 = 0. 1, 283403 Let 2l3/9 + 17792l*2/3 + 88922l + 320076 = 0. Calculate l. -26673, -9, -6 Let 2q5 + 1127214q*4 + 20289270q*3 + 37196906q*2 + 18034848q = 0. Calculate q. -563589, -16, -1, 0 What is a in a*3 + 4166a*2 - 134336a = 0? -4198, 0, 32 Let -3g5 + 813g*4 - 45261g*3 - 746553g*2 + 878304g + 1578780 = 0. What is g? -14, -1, 2, 105, 179 Solve h*5/5 + 5041h*4 - 25209h*3 + 25211h*2 + 126044h/5 - 30252 = 0 for h. -25210, -1, 1, 2, 3 Let -3g4/4 - 411859g*3/4 - 4804181g*2/2 + 1647156g = 0. What is g? -137263, -24, 0, 2/3 Suppose -12d5 - 124d*4 + 2940d*3 + 27900d*2 - 54000d = 0. Calculate d. -15, -12, 0, 5/3, 15 Find s, given that -6s3/13 - 20614s*2/13 + 359184s/13 + 248616/13 = 0. -3453, -2/3, 18 Suppose d*3/4 + 419991d*2/4 + 11022794838d - 363866581188 = 0. What is d? -210012, 33 Find s, given that -14964s3 - 1047471s*2 - 18330270s + 11025 = 0. -35, 3/4988 Solve 169b4 - 168747b*3/4 - 748101b*2/4 - 188897b - 36195 = 0. -3, -190/169, -1/4, 254 Suppose -2p4/5 - 114p*3/5 + 11436p*2/5 + 175568p/5 + 304512/5 = 0. What is p? -104, -12, -2, 61 Determine w so that -2w5 - 89804w*4 - 1009530700w*3 - 32238647200w*2 - 286938041250w - 452996302500 = 0. -22435, -15, -2 Suppose -8372m5/11 + 519062m*4/11 - 636148m*3/11 - 6447976m*2 - 279708720m/11 - 66816/11 = 0. Calculate m. -6, -1/4186, 16, 58 Find n, given that -5n4 + 22030n*3 - 635380n*2 + 3130130n - 2516775 = 0. 1, 5, 23, 4377 Let 64082g4/3 + 77730034g*3/3 - 104562728g*2 + 6980680g/3 - 38944/3 = 0. Calculate g. -1217, 2/179, 4 Suppose -9604t4/5 - 30061304t*3/5 - 72359440t*2 - 29384224t/5 - 598656/5 = 0. What is t? -3118, -12, -2/49 Solve 2n3 - 8130962n*2 + 8264063815198n + 8264071946162 = 0 for n. -1, 2032741 Determine w, given that 8w2 + 38324w - 19164 = 0. -4791, 1/2 Solve 5u4 - 82765u*3 + 246043515u*2 - 267947626255u + 99877409790500 = 0 for u. 1151, 13100 What is i in -358i4 + 4642i*3 - 11300i*2 + 6776i + 240 = 0? -6/179, 1, 2, 10 Factor 5r3/4 + 1480205r*2/4 + 68081495r/4 + 782906775/4. 5(r + 23)2(r + 295995)/4 Factor r*2/7 + 1999r/7 - 4007406/7. (r - 1238)(r + 3237)/7 Determine x so that 4x*2/7 + 39104x/7 + 1208380/7 = 0. -9745, -31 Suppose -a*2 + 54444a - 163323 = 0. Calculate a. 3, 54441 What is y in 4y5 - 43777020y*4 + 119776739393532y*3 - 119776695616516y*2 = 0? 0, 1, 5472127 Factor 2y*2/5 - 3616y/5 - 655368/5. 2(y - 1974)(y + 166)/5 Let 14u3 - 1748u*2 - 557438u - 555676 = 0. What is u? -146, -1, 1903/7 Determine x so that 8265x5 - 396710x*4 + 1032645x*3 + 17804060x*2 + 32750940x + 39600 = 0. -3, -2/1653, 10, 44 What is f in -f*3/8 + 70292497f*2/8 - 154407352346250f + 154407343559688 = 0? 1, 35146248 Determine u, given that -u*5 + 3456u*4 + 69455u*3 + 225930u*2 + 34856u - 333696 = 0. -16, -3, -2, 1, 3476 Solve r*4/5 - 5599r*3/5 + 1429863r*2 + 393947675r - 2005345100 = 0. -236, 5, 2915 Let -q*2/5 - 107146q + 1607199/5 = 0. Calculate q. -535733, 3 Solve 4q5 + 1416q*4 + 39796q*3 - 99984q*2 - 5552048q + 11162880 = 0. -323, -27, -16, 2, 10 Let d*2/6 - 2825d/2 - 1872608/3 = 0. What is d? -421, 8896 Factor -5h3 - 2120920h*2 - 224912961385h + 449834406490. -5(h - 2)(h + 212093)*2 Let 2s*2/17 - 332346s/17 - 4653236/17 = 0. What is s? -14, 166187 Factor z*2 - 11515513z - 11515514. (z - 11515514)(z + 1) Solve -3g*5 - 5052g*4 + 3213774g*3 + 9556609980g*2 + 4256222010141g - 34663023780840 = 0. -1019, 8, 1365 Find l, given that 14l5 + 96368l*4 + 24445254l*3/7 + 10022288l*2/7 - 11776552l/7 + 1971936/7 = 0. -6847, -36, -1, 2/7 Factor m*3/4 - 6741m*2/4 + 1747356m - 495728545. (m - 5545)(m - 598)2/4 Let 3w*2 - 11308698w - 33926121 = 0. What is w? -3, 3769569 Factor 2809k2/3 + 88244152k/3 + 693042930064/3. (53k + 832492)2/3 Factor -5r*2 + 3920711r + 3136572. -(r - 784143)(5r + 4) Factor 4a3 + 118016a*2 + 695441300a - 2701312310312. 4(a - 2618)(a + 16061)*2 Factor 5r*2/6 + 3979055r/3 + 3166575738605/6. 5(r + 795811)2/6 Suppose -a2/3 - 130655952a - 12803233344769728 = 0. Calculate a. -195983928 Factor 2w2/9 - 78376424w/9 + 767857979878472/9. 2(w - 19594106)2/9 What is j in -j2 - 98608j - 1873191 = 0? -98589, -19 Solve 2g2/3 + 414394g/3 - 49341208/3 = 0 for g. -207316, 119 What is t in t*3 + 176129t*2 - 1585252t - 1761380 = 0? -176138, -1, 10 Find p, given that 2p4 + 9140	{ "pile_set_name": "DM Mathematics" }
, 31283? 39324 What is the next term in 71, -41, -363, -1009, -2093, -3729, -6031, -9113? -13089 What comes next: 80291, 160586, 240979, 321518, 402251? 483226 What is the next term in -2984, -11955, -26902, -47825, -74724? -107599 What comes next: 21346, 85819, 193404, 344083, 537838, 774651, 1054504, 1377379? 1743258 What is next in 129475, 517828, 1165085, 2071246, 3236311, 4660280, 6343153? 8284930 What is next in -526110, -1052264, -1578420, -2104578, -2630738, -3156900? -3683064 What comes next: 25539, 51216, 76881, 102528, 128151? 153744 What is next in -9960786, -19921571, -29882356, -39843141? -49803926 What comes next: 335344, 335349, 335354? 335359 What is next in -223758, -447383, -671010, -894633, -1118246, -1341843? -1565418 What is next in -5038473, -10076941, -15115409, -20153877? -25192345 What is the next term in -12755757, -12755764, -12755785, -12755826, -12755893, -12755992? -12756129 What is the next term in 102268, 102084, 101900? 101716 What is next in -179587, -359122, -538621, -718084, -897511? -1076902 What is next in 3131, 2801, 2179, 1271, 83, -1379, -3109, -5101? -7349 What comes next: -858, -1986, -3386, -5058, -7002, -9218? -11706 What is next in -6235, -10417, -14599? -18781 What comes next: -1345, -4736, -13945, -31882, -61457, -105580, -167161, -249110? -354337 What is the next term in -150045209, -150045210, -150045211? -150045212 What is next in 88164, 176103, 264042, 351981, 439920? 527859 What is the next term in 1349, 10465, 35325, 83801, 163765? 283089 What is next in 646019, 1292036, 1938051, 2584064? 3230075 What is next in 42495668, 42495666, 42495664, 42495662, 42495660, 42495658? 42495656 What comes next: -149175, -148934, -148687, -148434, -148175, -147910, -147639? -147362 What is the next term in 302200, 302189, 302178, 302167, 302156, 302145? 302134 What comes next: 32706954, 32706956, 32706958, 32706960, 32706962, 32706964? 32706966 What is the next term in 153, 741, 1503, 2439, 3549, 4833, 6291? 7923 What comes next: 19619, 38903, 58187, 77471, 96755, 116039? 135323 What comes next: 2988844, 2988877, 2988910, 2988943, 2988976, 2989009? 2989042 What is the next term in -61751895, -123503787, -185255679, -247007571? -308759463 What is next in 376, 2710, 8970, 21094, 41020? 70686 What comes next: 4299295, 4299294, 4299293, 4299292? 4299291 What comes next: -1522924, -3045828, -4568732, -6091636, -7614540, -9137444? -10660348 What is the next term in -12716, -24981, -37246, -49511, -61776, -74041? -86306 What is next in 1919, 2005, 2235, 2681, 3415? 4509 What comes next: -42192, -42280, -42418, -42600, -42820, -43072? -43350 What is next in -120165, -240365, -360567, -480771, -600977, -721185, -841395? -961607 What comes next: -409, -322, 757, 3320, 7859, 14866, 24833, 38252? 55615 What is the next term in -5457046, -5457029, -5457012? -5456995 What is the next term in -6900, -12870, -18936, -25146, -31548, -38190, -45120? -52386 What comes next: 33551063, 33551062, 33551061, 33551060? 33551059 What is the next term in -25014, -48601, -72186, -95769, -119350, -142929, -166506? -190081 What is the next term in -296242, -296205, -296196, -296221, -296286, -296397, -296560, -296781? -297066 What is next in 151703582, 151703579, 151703574, 151703567, 151703558, 151703547, 151703534? 151703519 What is next in -8897, -18692, -29385, -40976, -53465? -66852 What is next in -387242, -387273, -387304, -387335? -387366 What is next in 970978, 1941713, 2912448, 3883183, 4853918? 5824653 What is next in -94529, -95397, -96265, -97133? -98001 What is the next term in -1431, -3779, -7445, -12423, -18707? -26291 What is the next term in -14793404, -29586847, -44380290, -59173733, -73967176, -88760619? -103554062 What is the next term in 444143, 444212, 444281, 444350? 444419 What is the next term in 138621, 277402, 416183, 554964, 693745, 832526? 971307 What comes next: 134426, 268996, 403566, 538136, 672706, 807276? 941846 What is next in -13223, -28324, -43425, -58526? -73627 What comes next: -3857576, -15430180, -34717816, -61720484? -96438184 What comes next: 1236721, 1236795, 1236903, 1237033, 1237173, 1237311, 1237435? 1237533 What is next in -134825, -134861, -134915, -134987? -135077 What comes next: 15497, 10300, 5103, -94, -5291, -10488? -15685 What is next in 5324, 11280, 17226, 23162, 29088, 35004? 40910 What is next in 4690, 5661, 6628, 7591, 8550, 9505? 10456 What is the next term in -34639, -34563, -34433, -34243, -33987? -33659 What comes next: 913627, 913617, 913607, 913597? 913587 What is next in -47910, -95827, -143760, -191721, -239722, -287775, -335892? -384085 What comes next: -5545371, -11090727, -16636077, -22181421, -27726759? -33272091 What comes next: 12286579, 24573160, 36859741, 49146322, 61432903? 73719484 What is the next term in 2882043, 2882029, 2881993, 2881923, 2881807, 2881633, 2881389? 2881063 What is next in 12973, 52397, 118105, 210097, 328373, 472933? 643777 What is next in -42465572, -84931139, -127396706, -169862273? -212327840 What comes next: 9629, 19390, 29147, 38900, 48649, 58394? 68135 What is next in -1027, -1029, -1019, -991, -939, -857, -739, -579? -371 What is the next term in 4145094, 8290187, 12435280? 16580373 What is the next term in -411127, -1644701, -3700669, -6579031, -10279787, -14802937? -20148481 What is next in -2171, -2834, -3873, -5288, -7079, -9246? -11789 What comes next: 14173216, 14173213, 14173212, 14173213, 14173216, 14173221, 14173228? 14173237 What is next in -911124, -3644528, -8200266, -14578392, -22778960, -32802024? -44647638 What is next in 1741619, 1741761, 1741903, 1742045, 1742187? 1742329 What is next in -69709, -66730, -63751, -60772, -57793, -54814? -51835 What is the next term in -3257389, -3257384, -3257375, -3257362? -3257345 What is the next term in 366997703, 733995406, 1100993109, 1467990812, 1834988515? 2201986218 What is the next term in -45249, -45126, -44999, -44868, -44733, -44594, -44451? -44304 What is next in 627149, 1253908, 1880669, 2507432? 3134197 What is next in 15601, 31225, 46845, 62455, 78049? 93621 What is the next term in 1428, 11611, 39408, 93675, 183268, 317043, 503856, 752563? 1072020 What is next in 38470, 154139, 347004, 617071, 964346, 1388835, 1890544, 2469479? 3125646 What comes next: -1398, -5561, -12464, -22095, -34442, -49493, -67236? -87659 What is next in 6826292, 6826300, 6826308, 6826316, 6826324? 6826332 What is the next term in 1662, 3387, 5104, 6813? 8514 What is the next term in 120751332, 120751333, 120751334, 120751335? 120751336 What is next in 113416, 226744, 340074, 453406, 566740, 680076, 793414? 906754 What is the next term in 34393, 69006, 103619, 138232, 172845? 207458 What is the next term in -21, -193, -695, -1695, -3361, -5861? -9363 What comes next: 416234, 416235, 416236, 416237, 416238? 416239 What is the next term in 7586, 15224, 22912, 30650? 38438 What comes next: -11795, -30715, -49637, -68561, -87487? -106415 What is the next term in 15499, 63271, 142891, 254359, 397675, 572839? 779851 What comes next: -6509, -204, 6103, 12412, 18723? 25036 What comes next: -371253, -742544, -1113839, -1485138, -1856441, -2227748, -2599059? -2970374 What is next in 81749, 328124, 738749, 1313624, 2052749? 2956124 What comes next: 5643754, 5643749, 5643744, 5643739, 5643734? 5643729 What is the next term in 81336640, 81336639, 81336638, 81336637? 81336636 What comes next: 174408, 174398, 174388? 174378 What comes next: -250, -746, -1492, -2488, -3734, -5230, -6976? -8972 What is the next term in 163878, 163877, 163876, 163875, 163874, 163873? 163872 What comes next: -7236, -8179, -9122? -10065 What is the next term in 107362139, 214724277, 322086415, 429448553, 536810691, 644172829? 751534967 What is the next term in 22352, 22256, 22104, 21902, 21656, 21372? 21056 What is the next term in -111669, -111706, -111743, -111780? -111817 What is next in -82978, -165868, -248672, -331390, -414022, -496568, -579028? -661402 What is the next term in -28005, -224095, -756327, -1792761, -3501457, -6050475? -9607875 What is the next term in -10193756, -10193755, -10193754, -10193753? -10193752 What comes next: -24177, -48316, -72265, -96018, -119569, -142912? -166041 What comes next: -3185970	{ "pile_set_name": "DM Mathematics" }
e of 5 - 6iy + 7i*2 + 1 - 3i*2 wrt i? -4i Let h(q) = q. Let c be h(4). Suppose -3 = -4t + 5. Find the second derivative of b + tb*4 - cb + b wrt b. 24b2 Differentiate -16i + 20 + 41i - 63i wrt i. -38 Let o(r) be the third derivative of -r*6/60 - 19r*5/60 + 25r*2. What is the third derivative of o(h) wrt h? -12 Find the second derivative of -10d*3 - 13d*3 - 33d*3 + 56d wrt d. -336d What is the second derivative of 5x - x*2 - 3x*2 + 3x2 wrt x? -2 What is the first derivative of b2 - 7b2 - 9 + 15b*2 - 4b*2 wrt b? 10b Let p(g) be the first derivative of -17g7/7 - g6/6 + 5g*3/3 + 3g - 12. What is the third derivative of p(h) wrt h? -2040h3 - 60h*2 Find the third derivative of -2g*6 + 26g*2 - 76g*2 + 38g*2 wrt g. -240g*3 Let m(l) be the third derivative of 7l*5/60 + 5l*3/6 - 8l*2. Differentiate m(x) with respect to x. 14x Differentiate 8b + 12 + 11b - 6b + 14 wrt b. 13 Let m(h) be the first derivative of h2 + 2. Let x be m(1). What is the third derivative of u5 + ux - 5u*5 + 2u*5 wrt u? -120u*2 Let p = 116 + -76. Let u be (-48)/p(-10)/4. What is the derivative of i + 6 - u - 2i wrt i? -1 Let t = -6 + 6. Suppose 0d - d + 5 = t. Find the third derivative of 14 - sd - 14 - s2 wrt s. -60s2 Let i be 1/((-14)/(-6) + -2). Let x(d) be the first derivative of -2 + 6d*3 + 3d - 3di - 4d*3. Differentiate x(m) with respect to m. -6m Let i(l) = -l. Let g(b) = 39b3 - 3b - 3b4 - 39b*3. Let h(q) = g(q) - 5i(q). What is the second derivative of h(a) wrt a? -36a2 Let p(u) be the first derivative of u + 5 + 0u - u - 4u - 2u*3. What is the first derivative of p(t) wrt t? -12t Let g(z) be the first derivative of -z7/210 - z4/24 + 2z2 - 7. Let r(s) be the second derivative of g(s). Find the second derivative of r(d) wrt d. -12d*2 Suppose 7 = -0q - q + 3p, 4 = -4q + 4p. Let u(v) be the first derivative of 5v*2 - qv*2 - 2v*2 - 1 + v. Differentiate u(r) wrt r. 2 Let t(s) be the first derivative of 18s*5/5 - 18s + 12. Differentiate t(n) wrt n. 72n3 Let t(v) be the second derivative of 2v*7/7 - 8v3/3 + v2 + 15v. What is the second derivative of t(g) wrt g? 240g*3 What is the first derivative of 8 + 2b*2 + 16b*2 - 7b*2 - 1 wrt b? 22b Let c(n) be the second derivative of -n4/12 + n3 + 3n. What is the second derivative of c(u) wrt u? -2 Let z(f) be the third derivative of -f9/252 + f5/15 + 3f*2. Find the third derivative of z(i) wrt i. -240i*3 Let o(p) be the first derivative of 0p*3 - 7/4p*4 - 6 + 0p*2 - 4p. Differentiate o(b) wrt b. -21b2 Find the third derivative of 298 + 301 - 50v*2 - 599 + 29v*4 wrt v. 696v Let b(w) be the first derivative of -w*6/3 + 3w*2 - 3. Find the second derivative of b(n) wrt n. -40n3 Let m(h) be the second derivative of h8/336 + h*5/30 - 2h*2 - 3h. Let x(g) be the first derivative of m(g). What is the third derivative of x(l) wrt l? 60l2 Let z be (3/6)/(2/12). Suppose 6 = -3k + 5k. What is the second derivative of -tk + 4t + 0t3 - zt wrt t? -6t Let v(r) be the second derivative of 1/6r*4 + 0 - 6r + 0r2 + r3. Find the second derivative of v(l) wrt l. 4 Let z(v) = 2v - 1 + 3v2 - v2 + 2. Let t be z(-2). Find the first derivative of 1 + 2y*3 - ty + 5y wrt y. 6y*2 Let o(c) be the first derivative of -1/2c*2 + 0c + 1/3c3 - 1 + 1/12c*4. Let h(n) be the second derivative of o(n). Differentiate h(z) with respect to z. 2 Find the second derivative of 13u*5 + 8u - 10u - 10u wrt u. 260u3 Let f(i) be the second derivative of 9i*5/20 - 13i*4/3 - 36i. Find the third derivative of f(p) wrt p. 54 Suppose 4d - 3p - 32 = 0, 3d - 2d + 5p = -15. Find the third derivative of -27f*3 + 0f*d + 27f3 + f5 + 5f2 wrt f. 60f*2 Find the second derivative of -2 - 2j - 3j - 7j*4 + 2 wrt j. -84j*2 Suppose 5z - 32 = -k, 5z + 4k = 2k + 29. Find the second derivative of -zw + 27w3 + 5w*5 - 27w*3 wrt w. 100w3 Find the third derivative of -m2 + 3m3 + 7m*2 - 10m3 wrt m. -42 Let i(o) = -o3 + 17o2 + 7. Let h(z) = -9z*2 - 4. Suppose 0 = 2r - 7r - 35. Let l(n) = rh(n) - 4i(n). Find the third derivative of l(g) wrt g. 24 Let m(q) be the first derivative of 0q*3 + 0q*2 + 2/5q*5 + 1 + 0q*4 + q. What is the derivative of m(u) wrt u? 8u*3 Let h(g) = 9g*3 - 5g*2 - 5g - 3. Let f(p) = 14p3 - 8p*2 - 8p - 4. Let o(x) = 5f(x) - 8h(x). Find the first derivative of o(k) wrt k. -6k2 What is the first derivative of -8 - 13u + 9u + 7u wrt u? 3 Find the third derivative of -19v5 + 2v*5 - 3v*2 - 2v*2 wrt v. -1020v2 Let w(d) be the second derivative of -d5/40 + d4/12 + d3/6 + 2d. Let t(b) be the second derivative of w(b). Differentiate t(v) with respect to v. -3 Let u(q) be the first derivative of 0q - 8 + 5/3q3 - 5/4q*4 + 0q*2. What is the third derivative of u(x) wrt x? -30 Find the second derivative of 49h*2 - 31h*2 - 56h*2 + 3h wrt h. -76 Let b(c) be the second derivative of 19c6/30 + 19c*4/12 + 25c. What is the third derivative of b(j) wrt j? 456j Let o(p) be the second derivative of p2 + 0 + p - 1/12p*4 + 0p*3. Find the first derivative of o(w) wrt w. -2w Find the third derivative of -4448 + 4t2 + 4448 - 16t*4 wrt t. -384t What is the third derivative of 57 + 36g2 + 23g5 + g2 - 57 wrt g? 1380g2 Let u(z) = -2z - 5. Let k(t) = t + 2. Let d be 1 - (3/1 - -6). Let y(x) = dk(x) - 3u(x). Differentiate y(a) with respect to a. -2 Let g(i) be the first derivative of i6/40 + i4/12 + i*2/2 - 3. Let d(s) be the second derivative of g(s). What is the second derivative of d(w) wrt w? 18w Find the third derivative of 3o2 + 6o - 7o6 + 4o - 10o wrt o. -840o*3 Let q(d) be the third derivative of -2d*7/15 - 7d*5/15 + 17d*2. What is the third derivative of q(v) wrt v? -672v Find the third derivative of -3d2 - 8d6 - d2 + 2d6 wrt d. -720d*3 Let j = 14 + -11. What is the second derivative of 0w3 - wj - 3w3 + w + 3w*3 wrt w? -6w Let p be (-20)/(-8)(-12)/(-10). Suppose 5u - 3u - 2m = 6, u - p = -5m. Differentiate ui*3 - 2 - 6i*3 + 2i*3 with respect to i. -3i*2 Let a(s) = 17s*3 - 9s*2 - 5s. Let i(z) = -9z3 + 4z*2 + 3z. Let x(m) = 3a(m) + 5i(m). Find the third derivative of x(f) wrt f. 36 Let x(t) be the first derivative of -56t3/3 + 44t - 24. What is the derivative of x(s) wrt s? -112s Suppose d + 2d + 2r - 25 = 0, 2r = 4. Find the third derivative of 3b6 - db*6 + 0b*2 - 3b*2 wrt b. -480b*3 Let n(j) be the first derivative of 20j*3/3 - 4j + 4. Differentiate n(z) with respect to z. 40z Let l = -4 + 4. Suppose 2y - 10 = -ly. What is the third derivative of 4t*6 - 4t*2 + 2t*2 - yt*6 wrt t? -120t3 Let f(z) = z2 - 11z + 12. Let g be f(10). Let b = g - 0. Find the third derivative of -r5 - 3r*2 - br5 - r5 wrt r. -240r2 Let q(m) = 19m*3 - 8m*2 - 6m - 6. Let h(w) = w3 - w2 - w - 1. Let r(t) = 6h(t) - q(t). What is the third derivative of r(y) wrt y? -78 Let s(o) be the third derivative of -o6/120 + 13o*3/6 + 2o*2. What is the derivative of s(j) wrt j? -3j2 Let n(b) be the third derivative of b8/48 - 7b4/24 - 13b*2. Find the second derivative of n(h) wrt h. 140h*3 Let m(t) = 86t*3 + 11t*2 - 299t + 11. Let c(b) = -17b3 - 2b*2 + 60b - 2. Let r(k) = -11c(k) - 2m(k). Find the second derivative of r(j) wrt j. 90j Let k(y) = -29y*3 + 32y*2 - 3y + 3. Let l(a) = 28a3 - 33a*2 + 4a - 4. Let g(u) = 4k(u) + 3l(u). What is the third derivative of g(o) wrt o? -192 Let l = -25/66 - -6/11. Let j(b) be the second derivative of 0b2 + 0 + lb*3 - 1/10b*5 + 2b + 0b4. What is the second derivative of j(o) wrt o? -12o Let w(n) be the second derivative of 3n7/14 + 13n*4/12 - 9n. Find the third derivative of w(m) wrt m. 540m2 What is the second derivative of -3y - 3y3 - y + y wrt y? -18y Let s(r) be the third derivative of r*2 + 0r - 1/35r7 + 0 + 1/12r*4 + 0r*6 + 0r*5 + 0r*3. Find the second derivative of s(a) wrt a. -72a**2 Sup	{ "pile_set_name": "DM Mathematics" }
76 and 1144. 572 What is the greatest common factor of 18387 and 9? 9 Calculate the greatest common divisor of 1056 and 47344. 176 Calculate the greatest common factor of 25 and 227875. 25 Calculate the highest common factor of 11798 and 4879. 17 What is the greatest common divisor of 396 and 31548? 132 What is the highest common factor of 29220 and 2040? 60 What is the greatest common divisor of 42265 and 1343? 79 Calculate the greatest common factor of 1200615 and 975. 195 What is the greatest common divisor of 57600 and 5850? 450 What is the greatest common divisor of 11264 and 9328? 176 What is the highest common factor of 1428 and 156723? 357 Calculate the highest common factor of 18285 and 345. 345 What is the greatest common factor of 19161 and 45? 9 Calculate the highest common divisor of 3240 and 17595. 45 What is the highest common factor of 2040468 and 552? 276 Calculate the highest common factor of 1312 and 304. 16 Calculate the highest common factor of 152140 and 40. 20 Calculate the greatest common divisor of 323 and 472447. 17 Calculate the greatest common divisor of 183240 and 5580. 180 Calculate the greatest common divisor of 63 and 647991. 9 Calculate the highest common factor of 2035 and 151415. 55 What is the greatest common factor of 127023 and 351? 39 What is the greatest common divisor of 36 and 104868? 36 What is the greatest common factor of 339 and 175037? 113 What is the highest common divisor of 20820 and 144? 12 Calculate the greatest common factor of 124646 and 4. 2 Calculate the greatest common divisor of 822957 and 279. 93 Calculate the greatest common divisor of 104 and 10699. 13 What is the greatest common factor of 352 and 341728? 32 Calculate the highest common factor of 244326 and 516. 258 Calculate the highest common factor of 264 and 9384. 24 What is the highest common factor of 11764 and 39444? 692 Calculate the highest common divisor of 113927 and 143. 11 Calculate the highest common divisor of 44 and 19868. 4 Calculate the highest common factor of 4409043 and 249. 249 What is the highest common factor of 682 and 1525634? 682 Calculate the greatest common factor of 23259 and 3. 3 Calculate the highest common factor of 32 and 19678. 2 What is the greatest common factor of 148 and 204? 4 What is the greatest common divisor of 76 and 571425? 19 What is the greatest common factor of 612 and 8258124? 204 Calculate the highest common divisor of 16310 and 250. 10 Calculate the highest common divisor of 230988 and 84. 12 Calculate the greatest common factor of 68 and 988618. 34 What is the greatest common divisor of 6094 and 616? 22 Calculate the highest common divisor of 40070 and 10. 10 What is the greatest common divisor of 684 and 134634? 114 What is the highest common factor of 36 and 214299? 9 What is the highest common divisor of 35857 and 69? 23 Calculate the highest common factor of 25935 and 6783. 399 What is the greatest common factor of 1056 and 2706? 66 Calculate the greatest common divisor of 684424 and 156. 52 What is the greatest common divisor of 2295 and 26435? 85 What is the greatest common factor of 638 and 746141? 319 What is the highest common divisor of 18 and 982206? 18 Calculate the highest common factor of 1115 and 44377. 223 What is the greatest common divisor of 540804 and 8364? 204 Calculate the greatest common factor of 59085 and 315. 45 Calculate the greatest common factor of 77 and 2457. 7 Calculate the highest common divisor of 8122 and 29344. 262 Calculate the greatest common factor of 2556 and 249423. 213 Calculate the highest common factor of 32872 and 208. 8 What is the highest common factor of 10381 and 497? 7 Calculate the greatest common divisor of 897 and 4173. 39 Calculate the greatest common divisor of 97020 and 880. 220 What is the highest common factor of 24871 and 87703? 1309 Calculate the highest common divisor of 12846 and 6. 6 Calculate the greatest common divisor of 3405 and 99. 3 Calculate the highest common divisor of 21 and 6245393. 7 What is the highest common divisor of 3189132 and 162? 162 What is the highest common factor of 3014 and 22044? 22 Calculate the highest common factor of 510 and 4794. 102 Calculate the greatest common divisor of 2052 and 48. 12 Calculate the greatest common divisor of 78 and 44044. 26 What is the highest common factor of 560 and 16180? 20 Calculate the highest common factor of 14 and 872522. 14 Calculate the greatest common divisor of 1179 and 927. 9 What is the greatest common factor of 6 and 113667? 3 Calculate the greatest common factor of 496 and 13552. 16 What is the highest common factor of 774 and 2202? 6 Calculate the highest common divisor of 30 and 2356215. 15 Calculate the greatest common factor of 76401 and 36. 9 Calculate the greatest common divisor of 332311 and 5075. 203 What is the highest common factor of 133068 and 429? 39 What is the greatest common factor of 5293 and 30? 1 What is the greatest common factor of 31439 and 1688? 211 Calculate the greatest common factor of 140235 and 15. 15 Calculate the greatest common factor of 1462 and 1784371. 731 Calculate the highest common factor of 2246 and 2. 2 Calculate the greatest common factor of 165 and 503943. 33 Calculate the greatest common factor of 532 and 11837. 133 What is the highest common divisor of 432 and 3857328? 432 What is the greatest common factor of 8370 and 124? 62 What is the highest common divisor of 20 and 49684? 4 What is the greatest common factor of 19680 and 10? 10 What is the highest common factor of 357 and 12243? 21 What is the highest common divisor of 3892 and 13344? 556 What is the highest common factor of 5626170 and 220? 110 What is the greatest common factor of 9000 and 4680? 360 Calculate the greatest common factor of 6045 and 561990. 195 What is the highest common factor of 663 and 3849378? 663 What is the greatest common divisor of 8136 and 342? 18 What is the greatest common divisor of 593865 and 1325? 265 Calculate the highest common divisor of 288 and 150480. 144 Calculate the highest common factor of 311140 and 4465. 235 Calculate the highest common factor of 56119 and 21. 7 What is the greatest common factor of 10 and 24826? 2 Calculate the highest common factor of 360339 and 21. 21 Calculate the highest common divisor of 587 and 9873927. 587 Calculate the highest common factor of 50 and 319010. 10 Calculate the greatest common divisor of 35240 and 80. 40 Calculate the greatest common divisor of 22 and 3713710. 22 What is the greatest common factor of 1241 and 442? 17 What is the highest common divisor of 10569 and 4953? 39 What is the highest common factor of 1833 and 7527? 39 Calculate the greatest common divisor of 2376 and 1524. 12 What is the highest common divisor of 16216 and 96? 8 Calculate the greatest common divisor of 12109606 and 694. 694 Calculate the highest common divisor of 725 and 638775. 25 Calculate the greatest common factor of 102 and 3712222. 34 What is the greatest common divisor of 255528 and 63? 63 What is the greatest common divisor of 12 and 23116? 4 Calculate the greatest common divisor of 285 and 162355. 95 What is the greatest common factor of 3 and 3750? 3 Calculate the greatest common divisor of 828 and 2628. 36 What is the highest common factor of 2893 and 1375? 11 What is the greatest common factor of 4293 and 1802? 53 What is the highest common factor of 9204 and 156? 156 Calculate the greatest common factor of 5313085 and 535. 535 What is the greatest common divisor of 405780 and 60? 60 Calculate the greatest common divisor of 15933 and 423. 141 Calculate the greatest common divisor of 72888 and 24. 24 Calculate the highest common divisor of 2778 and 1434837. 1389 What is the greatest common factor of 413 and 504? 7 Calculate the greatest common factor of 441 and 21. 21 What is the highest common factor of 511959 and 42? 21 What is the greatest common factor of 4686 and 33654? 426 What is the greatest common divisor of 1845 and 137145? 615 What is the greatest common factor of 3542 and 77000? 154 What is the highest common divisor of 1 and 22546? 1 Calculate the highest common factor of 17854 and 1808. 226 What is the greatest common divisor of 3501 and 130315? 389 Calculate the gre	{ "pile_set_name": "DM Mathematics" }
the remainder when 12 is divided by u. 5 Suppose -s - 4s = -60. Suppose -3r + 70 = -r. What is the remainder when r is divided by s? 11 Suppose -2t + t + 341 = 5a, 0 = -a + 2t + 77. Calculate the remainder when a is divided by 20. 9 Suppose -4h + 58 = -5i, 4h - h - 3i = 42. Suppose 46 = 3x - 95. Calculate the remainder when x is divided by h. 11 Let c(m) = 3m2 - 3. Calculate the remainder when c(6) is divided by 27. 24 Let h be 70/(-9) + (-4)/18. Let k = h - -18. Calculate the remainder when 38 is divided by k. 8 Let l(k) = -k2 + 7k + 6. What is the remainder when 47 is divided by l(6)? 11 Let w(k) = 7k + 8. Let b(d) = -d3 + 7d*2 + 2d + 8. Suppose 0 = -4q + 12 + 16. Calculate the remainder when w(8) is divided by b(q). 20 Let j = -2 + 5. Suppose -jv - 3i = -72, -8i - 88 = -4v - 4i. What is the remainder when v is divided by 5? 3 Let l(h) be the second derivative of h*3/6 + 3h*2/2 - h. Calculate the remainder when ((-26)/(-5))/(4/20) is divided by l(6). 8 What is the remainder when 20 is divided by 8 + (12-1)/3? 0 Let u = -56 + 221. What is the remainder when u is divided by 24? 21 Suppose -i + 3i - 64 = 0. Suppose 5w - 2w = -6, -x + 4w = -19. Calculate the remainder when i is divided by x. 10 Let r be (10/(-6))/((-2)/(-12)). Let p be 12/20 + 76/r. Let s(a) = a*3 + 8a*2 + 8a + 9. Calculate the remainder when 4 is divided by s(p). 0 Suppose j = -r + 5, -4r + 3j + 3 = -3. Let l = 185 - 127. What is the remainder when l is divided by 30r(-4)/(-18)? 18 Let t be 0 + 2 + -52 - -2. Let f = t - -67. What is the remainder when (-1296)/(-12)(-2)/(-4) + 1 is divided by f? 17 Suppose 4z - 7t - 35 = -4t, -5t = 4z - 27. What is the remainder when 19 is divided by z? 3 Suppose -1 = -4h + 7. Let v = 12 + h. Suppose -s - 4s = -d + v, 3d = 4s + 42. Calculate the remainder when 27 is divided by d. 13 Let b be (-16 + 4)(-1)/(-2). What is the remainder when (4/b)/(2/(-6)) is divided by 1 + (0 - -1)/1? 0 Let c be (-31)/((-1)/2). Suppose 1 + 5 = cp. Calculate the remainder when p is divided by 1. 0 Suppose 6g - 8g = -24. What is the remainder when 21 is divided by g? 9 Let z(y) = -y2 - 17y - 7. Let t be z(-16). Suppose -3i + 23 = m, -i - 5m + t = -6m. What is the remainder when 28 is divided by i? 4 Calculate the remainder when 251 is divided by 8/(40/3) + 87/5. 17 Calculate the remainder when 75 is divided by (-108)/252 + (-188)/(-14). 10 Suppose 0 = -5x + 3x + 24. Suppose -u - 3q - q + 6 = 0, -4u - 4q = -72. Calculate the remainder when u is divided by x. 10 Let d(c) = -3c + 0 - 4c - 4 - 3. Calculate the remainder when d(-10) is divided by 16. 15 Suppose -12d + 13d - 25 = 0. What is the remainder when d is divided by 16? 9 Let r(z) = z*3 - 13z*2 - z + 17. Let c be r(13). Suppose i = -cf - 0f + 132, 3f + i = 98. What is the remainder when f is divided by 18? 16 Let c = 38 + -26. Suppose 2 + 1 = -f - 2n, -4 = -4n. Let p(z) = -9z. What is the remainder when p(f) is divided by c? 9 Let i(n) = -2n - 30. Calculate the remainder when 7 is divided by i(-17). 3 Let d(k) = -2k - 20. What is the remainder when 23 is divided by d(-14)? 7 Let v = 0 + 8. Let o = 6 - 8. What is the remainder when v is divided by o/(-2) - 16/(-4)? 3 Let r = -9 + 18. Calculate the remainder when 35 is divided by r. 8 Suppose 2y - y = 7. Calculate the remainder when y is divided by (-10)/35(-9 + 2). 1 Let x(t) = -t3 - 11t*2 - 13t - 12. Calculate the remainder when 70 is divided by x(-10). 16 Suppose 16 = 3m - 86. What is the remainder when m is divided by 18? 16 Suppose -255 = -3p - 2p. Calculate the remainder when p is divided by 9. 6 Let c(n) = n3 - 4n*2 + 9n - 15. Suppose 4a - 21 = 55. What is the remainder when c(5) is divided by a? 17 Let j = -46 - -73. Suppose m + 2m = j. What is the remainder when 25 is divided by m? 7 Suppose 3s + 3p = 45, -2p + 48 = 4s - p. Let g = -5 + s. Let l(m) = -m*2 + 8m - 4. Calculate the remainder when l(g) is divided by 5. 3 Suppose -4m + a - 9 = 0, 0 = m - 2a - 4 + 1. Let t(v) = 6v3 + v - 1. Calculate the remainder when (m/(-2))/(9/60) is divided by t(1). 4 Suppose -2r - 10 = -30. Let g = 2 + r. Calculate the remainder when 23 is divided by g. 11 Let d = 64 + -43. Suppose -4 = w - d. What is the remainder when 65 is divided by w? 14 Let k(u) be the first derivative of u4/4 + u3/3 + 20u - 8. What is the remainder when 39 is divided by k(0)? 19 Calculate the remainder when 23 is divided by 4 + 0(-2)/10. 3 Suppose -3g + 85 - 22 = 0. Let i = g - 5. Calculate the remainder when 29 is divided by i. 13 Suppose 8s - 3s - 65 = 0. What is the remainder when 62 is divided by s? 10 Suppose s - 12 = 20. Suppose -2x + 6 = -6. What is the remainder when s is divided by 17 - -3 - x/2? 15 Let l be -31/(6/(-4)). Suppose -j = j - 20. Suppose 0 = -3c + j + l. Calculate the remainder when 11 is divided by c. 3 Calculate the remainder when 198 is divided by 4/(4 - (-57)/(-15)). 18 Suppose 0 = -0t - 2t + 2s + 18, -21 = -t + 4s. Suppose -2n = -tx - 11, -x + 24 - 8 = n. What is the remainder when 23 is divided by n? 10 Let q(v) = -4v + 3. Calculate the remainder when 20 is divided by q(-2). 9 Let j = -13 - -57. What is the remainder when j is divided by 12? 8 Suppose q + 31 = 85. What is the remainder when 104 is divided by q? 50 Let p be 24/(-30)245/1. Let t = -5 - -10. Calculate the remainder when (t + -2)p/(-12) is divided by 17. 15 Calculate the remainder when 46 is divided by 9/(7/(-6)(-9)/14). 10 Suppose v - 5v = -12. Suppose -2d = -2q - 38, vd = -5q - 8 + 105. What is the remainder when d is divided by 13? 11 Suppose -4q = -3g - 14, 5g + 6 = 5q - 14. Let a(r) = 18r*2 + q - 2 - 4r2. What is the remainder when a(-1) is divided by 8? 6 Let t = 11 - 5. Let m = 12 - t. Calculate the remainder when 11 is divided by m. 5 Let p(g) be the second derivative of -g3/2 - 3g2 + 2g. What is the remainder when 45 is divided by p(-10)? 21 Suppose 2r - 2 = -2s, -6s + 2s + 4r = -20. What is the remainder when 13 is divided by s? 1 Suppose -89 = -5x - 2g, -4x + 13g = 11g - 82. Suppose 0 = -5r + 25, -2p + 4r - 6 = -0p. Calculate the remainder when x is divided by p. 5 Let x be (9/9)/((-2)/(-8)). What is the remainder when 20 is divided by 12/16 - (-25)/x? 6 Let l(v) = -12v3 + v. What is the remainder when 16 is divided by l(-1)? 5 Suppose 4h - 304 = n + 3n, -3 = -n. Suppose 0t + h = t + 3k, -t - 4k = -74. What is the remainder when t is divided by 24? 22 Let b be (7 + (-6)/3)-1. Let y = 0 - b. Suppose -32 = -4j + 4h + 44, 0 = yj - 4h - 92. What is the remainder when j is divided by 9? 7 Let w(f) = f3 + 7f*2 + 9. What is the remainder when 15 is divided by w(-7)? 6 Suppose -3f = -3m + 1 + 2, m - 2f = 0. Let j(l) = l + 55. What is the remainder when j(0) is divided by (-2(-19)/m)/1? 17 Suppose j + 3c = 6c - 1, -3j = -5c - 5. Suppose 92 = js + 4z, 2z = s - 0s - 10. Calculate the remainder when 31 is divided by s. 15 Let t = -157 + 195. What is the remainder when t is divided by 14? 10 Let z(f) = -3f*2 - f. Let h be z(-1). Let v be (-22)/(-2) + (h - -1). Suppose 2w = w + v. What is the remainder when 18 is divided by w? 8 Suppose -5v + 3s = 15, 4v - 2s - 2s = -4. Let w be (4/3)/(2/v). Let u(j) = -j3 - 2j*2 + 3j + 6. Calculate the remainder when u(w) is divided by 9. 8 Suppose 3n = -8 + 53. What is the remainder when 9/(-12) + (-115)/(-4) is divided by n? 13 Suppose 3a + 10 = 28. What is the remainder when (a/9 - 1)-99 is divided by 9? 6 Let t = -30 + 46. What is the remainder when 31 is divided by t? 15 Let h(s) = s3 - 4s*2 - 11s + 8. Suppose -2y = -4g - 18 - 16, -2y - 2g = -64. What is the remainder when h(7) is divided by y? 24 Let c = -16 + 16. Let h be (-1)/(-4) + (-118)/(-8). Suppose c = 2f - h - 21. Calculate the remainder when f is divided by 7. 4 What is the remainder when 143 is divided by ((-3)/4)/(((-5)/(-32))/(-5))? 23 Let f(a) = a3 - 3a + 1. Let z(v) = -v*2 - 4v - 6. Let x be z(-4). Let m = 2 - x. Calculate the remainder when m is divided by f(2). 2 Let c be 1/2 - (-234)/4. Let u = -34 + c. Let b = -49 + 58. What is the remainder when u is divided by b? 7 Let k	{ "pile_set_name": "DM Mathematics" }
- 2v + 0v). -4v2 Expand 29q + 90q - 51q + (-2q + 1 - 1)(-3 + 2 - 1) - q + 0 + 0. 71q Expand -2a - a + a + (-1 - 2 + 0)(4 - 4 - 2a)(-1 + 7 - 1). 28a Expand (3b2 - 3b2 - b3)(-9b - 3b + 2b)(-5b + 2b + b). -20b*5 Expand 0c2 - c2 - 4c2 + (-c - 3 + 3)(0c - c + 0c). -4c2 Expand (42 - 42 + 50v)(0v*2 + 6v*2 - 4v*2) + 3v*3 + 0v3 - v3. 102v3 Expand (-2o + 9o + 11o)(0o*2 - 4o*2 + 3o*2) - 3o*3 + 2o*3 + 2o*3 + (-1 + 1 + 2o*2)(2o + 2o - 5o) - 4 + 4 - o3. -20o*3 Expand (-2 - 2 - 7)(-2v + 2v - 3v3). 33v*3 Expand (3 - 1 + 0)(4 + q - 4)(2 + 5 - 3). 8q Expand (0 - 4o2 + 0)(4o2 - 3o*2 + 0o*2) + (2o3 - o3 - 2o3)(0o + o - 3o) - 3 + 3 + o4. -o4 Expand (-4j3 + 4j3 - j4)(2 - j - 2) + 0 - j5 + 0 + (j3 + 0j*2 + 0j*2)(-2j2 + 6j*2 - 5j2). -j5 Expand (9 + 2 - 7)(8 - 8f - 8) + 5 + f - 5. -31f Expand (-4a + a + a)(6a + 4a3 - 6a). -8a4 Expand (0m*2 + 5m*2 - 4m*2)(11m3 + 50 - 50) + (-2m*3 + 0m + 0m)(m - m + 2m2). 7m*5 Expand (-2n + 1 - 1)(0 - 1 - 1) + (2 - 2 + 3)(2n - 3 + 3) - 1 - 3n + 1. 7n Expand -s + s + s + (3 - 4 - 1)(-3s + s + 0s) - s + 4s - 2s - 3s - 3 + 3. 3s Expand q5 - q5 - 2q5 + (-1 + 1 + 3q)(0q*4 + 2q4 - q4) + 0q3 + 3q*5 + 0q*3. 4q*5 Expand (-1 - 3 + 3)(-2i + i + 2i) - 3 + 3 + 2i - 2i + 2i + i + 0i + i + i - 3 + 4i + 3. 8i Expand (-2 - 1 + 1)((-2 + 3n + 2)(-1 - 1 + 5) - 6n - n + 3n). -10n Expand (3f2 - 3f2 - f5)(1 + 1 + 0) + (-7f*3 - 2 + 2)(-2f + f2 + 2f) + 2f5 + 3f*5 - 4f*5. -8f*5 Expand (-5 - 3 - 4 + (-2 - 1 + 1)(1 + 5 - 4))(0m - 2m + m). 16m Expand (2 - 3 - 1)(32 - 112o - 12o - 32). 248o Expand (-d + 0d + 3d)(-6 + 3 - 7)(-d - 3 + 3). 20d2 Expand (i3 + 0i*2 + 0i*2)(198i - 1071 + 1071). 198i*4 Expand (-3r - r + 2r)(-2r + 0 + 0) + r2 + 1 - 1 - r2 - r2 + r2 - 2r*2 + 3r*2 + 0r*2 - 2r2 - r2 + 6r2. 8r*2 Expand (21x - 11x - 12x + 12)(0 - 1 + 3). -4x + 24 Expand 2 + 2s - 2 + (6s - 3s - s)(0 - 4 + 2) + 4s + 2s - 2s. 2s Expand (-1 + 3 + 1)(-x + 0x + 0x)((x - x - 2x2)(-3x + 4x - 3x) - 2x*3 + 6x - 6x). -6x4 Expand d5 - 14d5 + 2d*5 + (-3d*2 + 3d2 + d3)(-5d2 + d2 + 2d2) + 4d5 + d3 - d*3. -9d5 Expand (-m2 + 6m2 - 3m*2)(-45 - 14m + 45) - 3m2 - m3 + 3m2. -29m*3 Expand (-5m*2 + 5m*2 - 2m*5)(3 - 17 + 1). 26m5 Expand m4 - m4 + m5 + m5 + m5 + 0m*5 + (-3m*3 + 9m*3 + 7m*3)(4 - 4 + m*2) - 2m*5 + 5m5 - m5. 18m5 Expand (-10s - 6s + 5s)(2s*4 - 3s*4 + 3s*4). -22s*5 Expand (-v + 6v - 3v)(12 - 12 + 16v + (5v - 5v + 2v)(5 - 2 - 5) + 1 - v - 1). 22v*2 Expand (0x + 3x - 2x)(5x + 5 - 5). 5x2 Expand 5n*2 - n + n + 2n*2 - 4n*2 - 7n*2 + (-5n + 4n + 2n)(-4n + n + 2n). -5n*2 Expand 4i*5 + 2 - 8i + 8i + (-1 + 1 + 3i*3)(3 - 2i2 - 3). -2i5 + 2 Expand (0 + 0 - l3)(2 - 2l + 9 - 1). 2l4 - 10l*3 Expand (16q*3 - 24q*3 - 62q*3)(2q - 2q*2 - 2q). 140q5 Expand (-7h + 3h + 3h)(-2h*2 + 2h2 + h3) - 3h4 + 6h*4 - 4h*4 + (-2h2 + h2 + 3h2)(2h2 + 1 - 1) - 3h*4 + 0h*4 + 4h*4. 3h*4 Expand (3 - 1 + 0)(-p*3 - 3p*3 - 6p + 3p3). -2p*3 - 12p Expand (-3 - 2 + 3)(-19o + 19o + 46o). -92o Expand (3l - 2l + 0l)(-2l - 2l + 2l)(-2l + l*2 + 2l). -2l4 Expand (0 - 2 + 4)(-5c + 5c + 3c3) + 3c*3 - 7c*3 + 3c*3. 5c*3 Expand -14x + 14x - x3 + 10 + (-2x + 4x - x)(2x2 + 2x - 2x). x3 + 10 Expand (-1 - 3 + 2 + (4 - 3 - 2)(1 + 2 - 6))(3 - r - 3). -r Expand ((-5 + 5 - 2i)(6i - 2i - 2i) - 6 + 6 - 2i2)(-3i + 0i + 2i). 6i*3 Expand (0r*3 + 2r3 - r3 + (2r2 + 0r*2 + 0r*2)(3 - 2r - 3))(3 + 3 - 3 - 2 + 2 - 3 + (2 - 1 + 0)(-1 + 0 + 0)). 3r*3 Expand (2c*2 + 3 - 3)(c*2 + 2c3 - c2) + 2c2 + c3 - c3 - 2c*5 + 4c*5 - 6c*5 + 4c*5. 4c*5 + 2c*2 Expand -3k*3 - 2k*5 + 3k3 + (-k3 + k5 + k3)(0 + 0 + 2) + (-3k*2 - 4k*2 + 5k*2)(-5k3 + 2k3 + k3) - 8k4 + 8k*4 - 3k5. k5 Expand (0 - t2 + 0 + t2 - 2 + 2 + (-3t2 + 3t*2 + 2t*2)(-2 - 2 + 2) - 4t2 + 8 - 8)(2t - 2t - 2t). 16t*3 Expand 0w + 4w - 6w - 4w + 4w + w + (-w - w + 0w)(4 - 2 - 1) - w - 3 + w - w + (-1 + 3 + 0)(2w + 2 - 2) + 3w + 2w - 3w. 2w - 3 Expand (4g + g - 4g)(0g3 + g3 - 3g3) - 3g*2 + 0g2 + g2 - 5g4. -7g*4 - 2g2 Expand (-2 - m2 + 2)(1 + 2m*3 - 1) - 4m*5 + 59m*3 - 59m*3. -6m*5 Expand (3v2 - v2 + 0v2)(0v + 2v + 0v + (-3v - 8v + 4v)(2 + 0 + 0) + 0 + 0 + 2v). -20v3 Expand (-t2 + 5t*2 - 3t*2)(-t*3 - 3 + 3) + 3t*5 + 0t*5 - 4t*5 + 4t*5 - 4t*5 + 3t5. t5 Expand (0m2 + 0m*2 - 2m*3)(2 - 6 + 2)(-2m*2 + 2m2 + m2). 4m5 Expand (-8f + 2f - f)(f - 3 + 3). -7f2 Expand (-3v + v + 3v)(3 - 2 - 2 + (5 - 3 - 4)(-4 + 4 - 2) + 2 + 1 + 2). 8v Expand (0r2 + r2 - 2r*2)(7 - 8 + 50). -49r2 Expand (-s - 2s + 5s)(-7s3 - 3s*4 + 7s*3)(3 - 4 + 2) + (-s*2 + 4s*2 - 4s*2)(-2s3 - 2s*3 + 3s*3). -5s*5 Expand (0 - 1 + 8)((6l + 6l - 6l)(0l + 0l - 2l) - 3l2 + l2 + l*2). -91l*2 Expand -2d + 2d3 + 0d - 5d3 + (0 - 4 + 2)(2d3 + d3 + d3). -11d*3 - 2d Expand (-3 + 2v + 3)(-11v - 37 + 38 - 3v). -28v2 + 2v Expand (22l - 13l + 8l)(l - 5 + 5 + (3l - l - 4l)(-2 + 3 - 3) - 2l - 4l + 5l + 0l + 4l - 2l + 0l + 4l - 2l)(2l + 2l - 2l). 272l3 Expand (0b + 2b3 + 0b)(-2b*2 - b + b + (b + b - b)(-3b + 2 - 2)). -10b5 Expand 0 + 0 + o3 + 3o3 + 0o + 0o + 0o*3 + 3o*3 - 2o*3 + (2o - o + o)(-2o*2 + 2o - 2o) - o2 + o2 + o3. 2o*3 Expand (2k*2 + 2k*3 - 2k*2)(2k + 2k - k) - 4k4 - 3k*4 - 2k*4. -3k*4 Expand (0k + 0k + 2k)(5 + 2 - 4) - 5k + 4k + 0k + (k - 5 + 5)(2 + 3 - 6). 4k Expand (3v + v2 - 2v - 1 - 3v2)(-4 + 3 - 2). 6v2 - 3v + 3 Expand (1 + 2o2 - 1)(0o + 0o - 2o) - o3 - 2o + 2o + 3o*3 - 6o + 6o - 3o*3 + 5o*3 - 13o*3. -13o*3 Expand (2o*3 - 2o*2 + 2o*2)(o*2 + 6o*2 - 3o*2) + (13o*3 - 11o*2 + 11o*2)(0o2 + o2 + 0o*2). 21o*5 Expand (0j - 2j2 + 0j - 1 + 1 + j*2 + (4 + 0 - 2)(-2 + 2 + 2j2) - j2 - 4j*2 + 4j*2 + 2j*2 - 5j*2 + 2j*2 + 4j*2 - 2j + 2j)(0 + 3 + 0). 15j2 Expand 0k - 2k + 4k + (2k - 2k + 4k)(-5 + 5 + 2). 10k Expand g3 + 4g*3 - 3g + 6g + 1 + 2g*3 - 1 + 3g - g*3 - 3g + (-4g2 + 5g*2 - 3g*2)(-1 + 1 - g) + 3 - 3 + 2g3 - 3g*2 + 2g*3 + 3g*2. 12g*3 + 3g Expand -h*4 - 3h*4 + 2h*4 + (-3h2 + h2 + 0h2)(-h*2 + 3h*2 + 0h*2) + (-2h + 6h - 2h)(-h2 - h3 + h2). -8h*4 Expand 0w*3 + 4w*2 - 10w*2 - 2w*3 + (0w + 0w - 2w*3)(-1 + 3 + 0). -6w3 - 6w*2 Expand (5m - m - 2m)(-6 + 2 - 2) - 6m - 3m - m. -22m Expand (13 + 15 - 12)(1 - 1 + k). 16k Expand (-4 + 0 + 3 + 0 - 4 + 3 + (1 - 2 + 0)(-1 - 1 + 3) + 1 - 1 - 2 + 2 - 4 + 4)(o3 - 9o*3 + 2o*3). 18o*3 Expand (0u + 2u2 + 0u)(-2u - 2u + 6u) + 4u3 - 2u3 - u3 + u - 2u3 + 7u*2 - 7u*2. 3u*3 + u Expand 2l - 12l - l3 + 0l + (9 - 9 - 2l2)(-2l + l - l). 3l*3 - 10l Expand (-1 - 2 - 1)(4x - x - 2x)(-2x2 - x2 + 2x*2)(-3 + 3 + 2x). 8x*4 Expand (-3v*2 + 3v2 + v2)(13 + 7v - 26 + 14). 7v3 + v2 Expand -3u4 + u4 + 0u4 + (u2 + 2u2 - u2)(4 - 4 + 3u*2). 4u*4 Expand 0w3 - w3 - w*3 + (-79w + 62w + 33w)(w2 - 4w2 + w2). -34w3 Expand (t + 4t - 3t)(4 + 12t - 3 - 3)(0t + t + t). 48t*3 - 8t*2 Expand -2g + 2g3 + 2g + (3g2 + g2 - 6g*2)(5g + 0g - 3g) - 1 + 4g*3 + 1 + 2g3 - g3 + g*3. 4g*3 Expand 4l*5 - 4l*5 - 3l*5 + (2l - 2l + l)(-12l4 - 14l*4 + 8l*4). -21l*5 Expand (2c + 3c - 4c)(0c - c - c) - c*2 + 0c*2 + 4c2. c2 Expand (-1 + 1 + 2 + (-1 + 1 + 2)(-3 + 2 - 1))(c + 0c - 3c) + 22c - 12c - 11c. 3c Expand (7*b	{ "pile_set_name": "DM Mathematics" }
r be 4713/2357 - (2 - 0). Let m = r - 25875/122564. Let w = m - 1/26. Is w > 0? False Let l = -8 + 7. Is -4 < l? True Let s be (-3)/((-9)/6) + -2. Suppose s = -5k + 3b - 4b + 4, -5b = 5. Let h = k - 0. Which is smaller: -1 or h? -1 Let x be (-2 - 147/(-69))/((-21)/28). Which is greater: x or -1? x Let l = -8 + 9. Suppose 3z = -5g - 25, z - 2g - l = g. Which is smaller: -7 or z? -7 Let h = 9 - 12.5. Let r = -5 - h. Let z = -1 - r. Which is greater: 2/3 or z? 2/3 Let d(b) = 2b*2 + 23b + 24. Let w(q) = 3q2 + 35q + 36. Let x(h) = 8d(h) - 5w(h). Let l be x(-8). Is l > 4? False Let j = -3/65 - 23/65. Let b = -103/3 + 34. Is j < b? True Let q(b) = -b*2 - 5b + 1. Suppose 0m + 5o + 25 = -5m, 2o = 4m + 14. Let z be q(m). Suppose -zn + 4 = 19. Which is smaller: n or 1? n Let f = -321 + 320. Let y = -19 + 12. Let w be y/4 + 2 + -1. Which is greater: w or f? w Let n be 42/24-1. Which is smaller: n or 1? n Suppose -3t - 5g - 21 = t, t - 2g = 11. Let d(j) = j3 - 3j*2 + 2j + 1. Let p be 35/(-14)(-4)/5. Let n be d(p). Is n <= t? True Let k = 460/7511 + 2/259. Suppose 0 = -d - 2d + 4a + 11, -5d - 5a = 5. Are d and k nonequal? True Suppose 2z = 6 + 4. Suppose 2g - 1 = -3p + z, g = p + 13. Is 9 at least g? True Let j(a) = a*2 + 9a + 3. Let l be j(-9). Suppose -lc - 2 = 4i, -i + 4c - 3 = 7. Is -2 < i? False Let y = 54 + -61. Which is smaller: y or -4? y Let u be 5/((-4)/(-8)-2). Is u greater than or equal to -6? True Let f = 509 - 346. Let s = -485/3 + f. Which is greater: s or 2? 2 Suppose 5x - 3 = -0x + 4n, 1 = x - n. Let y = -1/12 - 65/84. Are x and y unequal? True Let p be (0/(1/(-1)))/2. Suppose p = -n - n. Let w = -0.3 + 0.2. Which is greater: n or w? n Suppose y - 1 + 11 = 2g, -y + 14 = 4g. Let o be 2/6 - (1 - -1). Which is bigger: o or y? o Suppose -m - m + 16 = 0. Let b = m - 7. Which is smaller: 2/15 or b? 2/15 Suppose -29u + 25u = -72. Is 18 equal to u? True Let b = -1 + 1. Suppose b = 2v + 1 + 7. Let h be 2 + (v/(-1))/(-2). Which is smaller: h or 2/9? h Suppose -t - 2t = -57. Suppose 20x + 1 = tx. Which is greater: -5/3 or x? x Let j = 5 + -4. Let u be (j - 4)/(5 + -4). Is -2 <= u? False Let r(j) = 2j2 + 1. Let x be r(1). Let w(y) = y3 - 5y2 + 2y - 7. Let z be w(5). Is x equal to z? True Let x(h) = 4h3 + h2 + 2h. Let a be x(2). Is a <= 40? True Suppose 0h = 4h - 28. Suppose -6p = -2p - 12. Suppose -4o - 16 = -g, -pg = -2g + o - 6. Which is smaller: h or g? h Let s be 5-34/30. Let p = 1 + -1. Which is bigger: s or p? p Let w(j) = -j2 - j - 1. Let z be w(-1). Suppose -7v + 2v + 1315 = 0. Let h = -3421/13 + v. Is h at least z? True Let q be 128/799 - 8/68. Is q < 0? False Let i = 0.2 + -0.4. Let y be (-25)/180(-6)/20. Let u = y - 53/120. Is i != u? True Suppose 0 = -0r - 4r + 8. Let c be r/(-12)(-15)/25. Which is bigger: -1 or c? c Let c(h) be the third derivative of 65h4/24 - h3/3 - 2h2. Let z be c(-4). Let q = -1831/7 - z. Which is smaller: 1 or q? q Let k = 17/90 - -1/30. Which is bigger: k or -1? k Suppose 5t + 472 = 2u, -u - 3u + 464 = -5t. Which is smaller: t or -0.1? t Let j = -27026/1315 - -40/263. Which is smaller: -19 or j? j Suppose w - 24 = -2w. Which is smaller: 6 or w? 6 Let u = -1.41 - -1.49. Is u less than or equal to -2? False Let m(h) = h*3 - 2h*2 + h. Let v be m(2). Let i be ((-1)/(-3))/(v/6). Suppose -2f - 5 = -3o, -3f - 16 = -0o + 4o. Is o less than or equal to i? True Let t = 13.07 + -13. Let n = -6.07 + t. Which is greater: 0.1 or n? 0.1 Let z = -24 + 37. Let l(p) = -p + 18. Let y be l(z). Which is smaller: y or 3? 3 Let c be 0 + 0 + 0 - 2. Suppose -4 + 6 = u. Suppose -6 = -up + 5p. Are c and p nonequal? False Let d(a) = -a*2 - 4a - 3. Let f be d(-3). Is f at least 1/8? False Let r = -932 - -21442/23. Is -1 less than r? True Let j = 1 + -1. Let m(p) = -5p3 + p. Let s be m(-1). Suppose -2 = -2x - s. Is j equal to x? False Let a = -2 + 2. Let z = -0.2 + a. Is 1 at least z? True Let i be -247 - (-9)/(-1 + -2). Let x be (1/(-2))/((-3)/i). Let l = x - -41. Which is greater: l or 2/7? 2/7 Let t(k) = k + 4. Let l be t(-3). Which is greater: l or -2/65? l Let b = -259 - -127. Let g be -3 + (-5)/(260/b). Which is smaller: 1 or g? g Let d(x) = -2x - 13. Let l be d(-15). Do l and 18 have different values? True Suppose 0 = 5r + 2h - 11, 2 - 8 = 3h. Suppose -17 - 4 = -rn. Let s(k) = 3k + 70. Let g be s(-21). Is n at least as big as g? True Let v = 9 + -8.93. Let a = 3.6 + -4.6. Which is greater: a or v? v Let n = 1 - 0. Let u be (-5 + 5)(-2)/(-6). Is n at least u? True Let n = 50.9 - 3.9. Which is greater: 0 or n? n Let n be -2 - (-1 + 9/(-7)). Let u = 3 - 5. Let y = u - -2.2. Is n > y? True Let k = 27 + -16. Suppose 0g - k = -g. Which is greater: 1 or g? g Let s(p) = -p + 12. Let w be s(8). Is 6 at most as big as w? False Let z = -43676/9 + 4848. Which is bigger: -6 or z? z Let q = 3.7 + -4. Let g = 0.24 + -0.44. Which is smaller: g or q? q Let p = -8 + 7.7. Let t = 7.9 - 0.9. Let f = -6 + t. Which is smaller: f or p? p Let w = -29.88 + 30. Which is smaller: w or -2/9? -2/9 Let i = 2 + 3. Let x be 2/(i/(10/8)). Let k = 0.1 + 0. Is k at least as big as x? False Suppose r + 2z = 8, -2r + z = -4r + 10. Let h = r - 2. Suppose -1 = hg - 3. Which is smaller: -1 or g? -1 Let q = -17 - -18. Which is smaller: -2/21 or q? -2/21 Let j = 0.04 + 0.06. Let l = -0.1 + j. Is l greater than or equal to -1? True Let s = -17 + 29. Let u = 6 + -5. Let l be u/(-2) + 22/s. Are l and 2 nonequal? True Suppose 0 = -4g + g + 12. Suppose 2d = gd. Which is smaller: d or 0.1? d Let u = -10.1 + 10.7. Which is bigger: u or 0? u Suppose -7n = -3n + 28. Let f(w) = 0 + w2 - 1 - w3 - 8 - 8w - 9w2. Let g be f(n). Is -1 greater than g? True Suppose -35q + 25q + 50 = 0. Which is bigger: -5 or q? q Let i = -25 - -24.2. Let u = -1 - i. Is u not equal to 5/2? True Suppose 2l - 2 = 2a + 10, 0 = 2a + l. Which is smaller: a or -9/7? a Suppose 10f = 7f - 30. Is f > -11? True Let h(b) = -b*2 + 8b - 5. Let z be ((-14)/6)/((-1)/3). Let s be h(z). Is 4/7 at least as big as s? False Let g be (-285)/(-1161) - 10/45. Do 1 and g have the same value? False Let p = 1 + 2. Let t = p - 1. Which is bigger: 2/3 or t? t Let u = 262 - 6554/25. Are u and 1 nonequal? True Let c be 14/21(-3)/13. Is c at most as big as 2/11? True Suppose -15q + 48 = -19q. Let s be q/84/3. Is s <= -5/8? True Let f = 5 + 0. Let y = -5.07 + f. Let z = y + 0.17. Is 2/7 greater than or equal to z? True Let y be ((-16)/(-9))/(-1) + (0 - -2). Are 0 and y nonequal? True Let x = 5 + -2. Let y = 10 + 3. Suppose 2c - 2 = 3j, y = j + 2c + 3. Which is smaller: j or x? j Let q = -33/2 + 16. Let v be (2/3)/((-44)/12). Which is greater: q or v? v Suppose -i = 4i - 10. Suppose -ij - j = 0. Suppose jm = -2m. Is m >= 0? True Let x = -3/14 - -101/406. Are 0 and x unequal? True Let i = 9 + -12. Let v be -2 + (-1 + -2)/i. Is 1/6 less than or equal to v? False Suppose -5j + 50 = -5x, 12 = 2x + 2j + 36. Let o be 2/(-28)(-1 - x). Is o less than 0? True Let r = 0.4 - -0.2. Let g = r - -0.4. Let k = -3.04 + 0.04. Is g greater than or equal to k? True Let v(h) = -h*2 + 6h + 9. Let x be 0/(0 + -3) + 7. Let u be v(x). Let t be u(1 + (-9)/6). Which is bigger: t or -2/5? -2/5 Let b = -5 - 2. Let d be (-1)/((-3)/(-2))3. Let y be b/d + 2/4. Which is smaller: y or 1? 1 Let k = 35 - 42. Let b = -7.0058 - -0.0258. Let s = b - k. Which is greater: s or -1? s Suppose 0d + 4d = 0. Are d and 5/8 equal? False Let f be 3 + (4 - 2)-1. Does 2/39 = f? False Let f = -38/3 + 40/3. Let l be (-2)/7 - 12/7. Let n = l - -2. Is f smaller than n? False Let a = 1996109/114 - 106775/6. Let f = 286 + a. Which is smaller: 1 or f? f Let k = -121 - -85. Is -36 >= k? True Suppose 3v + 9 = 6. Is v less than -1/6? True Let h = 357 + -255. Let j = h - 508/5. Which is greater: -1 or j? j Let w = 152575/26 + -5869. Let g = -3/13 - w. Which is greater: g or 1? 1 Let p = 29 + -24. Let g = -9 - -3. Let o = p + g. Which is smaller: -2/11 or o? o Let v be (3 - 1)/((-1)/2). Let s be (75/10)/((-3)/v). Is s greater than or equal to 10? True Let y be (-364)/(-18) - 2/9. Suppose 0 = -3s + 7s + y. Which is smaller: s	{ "pile_set_name": "DM Mathematics" }
is o(i)? -8 Let w(l) be the first derivative of l*3/3 + 3l*2/2 + l + 32. Give w(-5). 11 Let j be (-570)/14 - (-14)/(-49). Let b = j - -43. Let v(g) = -g + 4g*3 - 3g*2 - 3g*3 + 0g. Give v(b). -6 Suppose -4r + 21 = -i, -4i - 14 - 15 = -5r. Let k(g) = -g2 + 9g - 11. Give k(r). 9 Let i(r) be the second derivative of -r*4/12 + 5r*3/6 - 2r*2 - 2r. Let y be -14 - -10 - 1/((-4)/32). Give i(y). 0 Let f(c) = 1 - c + 2c + 5c. Let a(w) = -2w3 + 2w*2 - 11w - 2. Let s be a(0). Determine f(s). -11 Suppose 0 = -6z + 4z + 4. Let f(n) = -5n3 - 2n*2 + 0n - 2n - 1 + z + 4n*3. What is f(-3)? 16 Let m(z) = 2z*2 - z - 1. Let x(s) = 4s*2 - 3s - 2. Let f be (20/(-16))/(3/(-12)). Let c(r) = fm(r) - 2x(r). Give c(-2). 5 Let b be 2 + 2 + (0 - -1). Let z = 12 + 97. Let f(q) = -109q - zq + 7 + 223q + 4q2 - q3. Determine f(b). 7 Let b(z) = 12z2 + 3z2 - 7 + z3 - z*2 + 2z*2 - 6z2. Give b(-10). -7 Let s(t) be the second derivative of t3/6 + 3t2/2 + 16t. Let n(z) = z*3 + 6z*2 - 5. Let g be n(-6). What is s(g)? -2 Let t(p) = p + 8. Let w(y) = -3y - 21. Let b(s) = 8t(s) + 3w(s). What is b(-6)? 7 Suppose 0 = 2h - 5b + 7, 0 = b + 4b - 25. Let z(f) = f3 - 9f*2 - 2f + 7. Give z(h). -11 Let c(n) = n*3 - 4n*2 + 3n + 2. Let f = -40 - 37. Let z be (-2)/4 + f/(-22). Let r = 0 + z. What is c(r)? 2 Let h(b) = -b*3 - 5b*2 - 4b + 3. Let o = -32 + 25. Let f be o + 6/(-18/(-4)). Give h(f). 3 Suppose -2g = -7g + 55. Suppose -3x - 4l - 25 = 0, 6x - 4l = 2x - 80. Let q = x + g. Let p(n) = n + 2. Give p(q). -2 Let q(d) be the second derivative of 0 + 1/2d3 + 25d - 1/2d2. Give q(2). 5 Let m(o) = 7o + 4975 - 4975. What is m(1)? 7 Let g(q) = 15q - 4q*3 + 2q*2 + 6q*3 - 35q + 18q - 2. What is g(-2)? -6 Let a be (-7)/((8/(-60))/(12/(-10))). Let x = 60 + a. Let w(o) = -4o - 5. Let f(b) = b + 1. Let j(u) = -9f(u) - 2w(u). Give j(x). 4 Let i(f) be the second derivative of -f4/12 - f3/3 - f - 44. Calculate i(6). -48 Let l(a) = -2 + 0 + a*2 - 5 + 5a2 + a + a3. Calculate l(-6). -13 Let s(z) = z*3 - 2z*2 - 1. Let q(y) = 5y*3 - 14y*2 + 5y - 6. Let p(j) = q(j) - 6s(j). What is p(-4)? 12 Let x(d) = -d3 + d2 + 4d + 1. Let w be (-4)/(-12) - (-28)/6. Let c(u) = -wu + 19 + u + 6u. Let f be c(-8). Calculate x(f). -5 Let z = -16 + 18. Let i(j) = -j*2 + 6j + 6. Let x be i(5). Let v(h) = -7 - zh + x - 5 + h2 + 2h3. Determine v(-2). -9 Let l = 110 + -110. Let s(z) be the second derivative of -z3/2 + 29z2/2 + 3z. Let f(d) = -d + 10. Let m(w) = -17f(w) + 6s(w). Give m(l). 4 Let i(s) = 14s3 - 18s*2 - 11s - 11. Let n(v) = 5v3 - 6v*2 - 4v - 4. Let b(p) = -4i(p) + 11n(p). Give b(6). 0 Let p(t) be the third derivative of -8t2 + 1/60t*5 + 0t + 5/12t4 + 0 + 7/6t*3. Give p(-6). -17 Let i be (-240)/456/(-8). Let c = i + 5. Let p(w) = -41 - cw + 16 + 24. Give p(1). -10 Let p(s) be the third derivative of s6/120 + 7s*5/30 - 5s*4/8 + 10s*3/3 + 7s2 + 14. Determine p(-15). 20 Let t(g) = g + 3. Let l(q) = q3 - 5q2 + 8q - 12. Let u be l(3). Calculate t(u). -3 Suppose 0z - 12 = -3z. Let p(f) = 35f2 - 4f + 21. Let i(k) = -6k2 + k - 4. Let q(c) = 6i(c) + p(c). Give q(z). -11 Let x(h) = 8h3 + 2h*2 - 4h + 10. Let n(z) = 3z3 + 2z*2 - 2z + 5. Let k(v) = -5n(v) + 2x(v). Determine k(6). 7 Suppose -364 = -18r + 68. Let c(y) = r + y - 12y + 10y. Give c(0). 24 Let r be ((-2)/(-4))/(2/4). Let c(x) = 3 - 2 + 0 + 0 - x. Let s(p) = 4p - 7. Let g(o) = 6c(o) + s(o). Give g(r). -3 Suppose -5q - 3o + 95 = 0, -o = o - 10. Let z be (-13)/4 - 12/q. Let k(m) be the third derivative of -m5/60 - m4/4 - 5m*3/6 + 2m*2. Calculate k(z). 3 Let q(s) = -46s - 832. Let p be q(-18). Let c(o) = -o*2 - 8o + 2. Determine c(p). 18 Let o = -290 - -285. Let w(a) = a*2 + 3a - 2. Give w(o). 8 Suppose -5s + 0s - 93 = 4u, -s = 3u + 56. Let f = -13 - u. Let j be f - 4 - (-9 + 2). Let p(i) = i*3 - 8i*2 + 7i - 3. What is p(j)? -3 Let b(j) be the first derivative of j*3/3 + 7j*2/2 + 2j + 9. Let z = 7 + -4. Suppose -2q + zq + 6 = 0. What is b(q)? -4 Let u(q) = -5q - 3. Let c(d) = -2d - 2. Let z(y) = y + 1. Let l(i) = 3c(i) + 4z(i). Let g be 33/(-5) + (-2)/5. Let r(w) = gl(w) + 3u(w). What is r(5)? 0 Let k(d) = -18d3 - 2d*2 - d + 35. Let x(w) = 13w*3 + 2w*2 + w - 24. Let f(c) = -5k(c) - 7x(c). Give f(-3). -10 Let q(d) be the first derivative of -d4/24 + d2 + 5. Let s(l) be the second derivative of q(l). Determine s(-4). 4 Let z(p) = -p3 - 5p*2 + 6p + 2. Let r(q) be the third derivative of q*4/24 - 5q*2. Let y be r(5). Suppose 23 - y = -3d. Give z(d). 2 Let m be 546/(-117)(-12)/(-14). Let k = 7 - 5. Let t(o) = 6 + 3o*k - 2o*2 + 0o*2 + 5o. Give t(m). 2 Suppose 4i = 26 - 6. Suppose -l - 2 = -a, 5l = -ia + 2 + 8. Let q be l - -3 - (-7 + 4). Let x(s) = -s2 + 5s + 7. What is x(q)? 1 Let q(f) = 0f2 + 11 + f2 + 8 - 9 - 10f. Determine q(9). 1 Let z be ((-28)/8 - -5)/(6/8). Let a(c) = 96c3 - 97c*3 - 1 - 7c*2 - 5c + 2 - zc. Calculate a(-6). 7 Suppose 147q = 20q. Let n(a) = a + 46. Determine n(q). 46 Let i(r) = -r3 - 3r + 19 + 3r2 + r - r3 - 16. What is i(2)? -5 Let s(m) = 2m*2 + 7m2 - m3 - 9 + 10m2 - 4m*2 + 17m. What is s(16)? 7 Let d be 8/36 + 32/18. Let w(y) = -y + 2y + y3 - 5 + 5y*d - 4y2. Let l = 6 + -6. Determine w(l). -5 Let t(g) be the first derivative of -g4/4 + 2g3 - 7g + 195. Suppose -3y + 6 = 3f, -4y + f - 2 = y. Suppose y = 5r - 19 - 11. Determine t(r). -7 Let o(a) = -a - 1. Let u = 295 + -302. Calculate o(u). 6 Suppose -302n + 295n - 35 = 0. Let y(p) = -5p - 24. Calculate y(n). 1 Let q = 1 - -4. Suppose 7f - qf = -14. Let m(k) = 2k*2 + 11k + 6. Give m(f). 27 Let c(m) be the first derivative of 1 + 0m - 4/3m*3 - 1/60m*5 + 1/6m*4 + 0m*2. Let r(w) be the third derivative of c(w). What is r(4)? -4 Suppose -4a - 19 = -p, 5p + 4a + 29 = 172. Let q be (4/(-12))/((-3)/p). Let r(w) = -qw + 4w + w + 7 - 3w. Give r(0). 7 Let z(t) be the second derivative of t3/3 + 11t*2 + 148t. Calculate z(-5). 12 Let r(i) = -i + 1. Let o(l) = -9. Let a(h) = -h. Let t(p) = 5a(p) - o(p). Let q(g) = 6r(g) - t(g). Calculate q(-8). 5 Let v(b) = 14b2 - 21b + 140. Let j(h) = -h*2 + 2h - 14. Let s(t) = -10j(t) - v(t). Suppose 0 = -5q - r + 12, -r = -3r + 4. Calculate s(q). -14 Let c be -2 - (-1 + 0 - 1). Let r(s) = -s2 - 1 + 67142s*3 - 67143s3 - 6. Determine r(c). -7 Let x(q) be the first derivative of q3 - q*2 - 3q + 13. Let y = 1 - 3. Determine x(y). 13 Let s(b) = 6b. Let c be 2/(-1) + (-608)/(-19). Let g be -7(c/(-35))/6. Give s(g). 6 Let p(r) = r. Let m be (3/4)/(6/72). Calculate p(m). 9 Let y(u) be the first derivative of -3u2/2 + 13u + 12. Let z be y(4). Suppose z = -2t + 3. Let q(h) = -10h + 1. Calculate q(t). -9 Let w(q) = 2q2 - q - 1. Suppose 0z = -7z - 28. Let r be (-1)/3 - 37/(-3). Let t be 6/r - (-10)/z. Determine w(t). 9 Suppose -191 = 22r - 15. Let t(n) = 2n + 5. Calculate t(r). -11 Let c(y) = 21y*2 - 23y - 111. Let j(g) = 7g2 - 8g - 39. Let k(b) = 6c(b) - 17j(b). What is k(-1)? 6 Suppose 0 = 5d, 0 = w + 5d - 0d + 10. Let p(a) = a3 + 9a*2 - 9a + 1. Determine p(w). -9 Let b(x) be the second derivative of x*3/2 - 7x*2/2 - 22x + 4. What is b(-11)? -40 Let o(w) = w*2 + 3w - 4. Let d be 3/7 - 80/7. Let a = d - -6. Give o(a). 6 Let w(d) = -4d2 + 10d - 7. Let y(f) = -f*2 + f - 1. Let h(s) = w(s) - 3y(s). Calculate h(6). 2 Let j(t) = -5t2 - 3t + 4. Suppose 8m - 40 = -64. Determine j(m). -32 Let d(b) = -b + 14. Let z(v) = 13. Let f be ((-12)/(-8))/(1/(-2)). Let s(h) = fd(h) + 4z(h). Give s(-7). -11 Let c(g) = 3g*2 + 17g - 6. Suppose 25 = 5s, -5s = 3z - 2s + 3. Calculate c(z). 0 Let q = -221 - -224. Let v(u) be the third derivative of 5/3uq + 0u - 1/60u5 - 5u*2 + 0 + 5/24u*4. What is v(7)? -4 Let u = -4 - -6. Let i(c) = 4c - 4 - c*2 - uc - 2c. Determine i(0). -4 Suppose 4b + 169 = 209. Let u(t) = b + 3t - 11 - 6t + 10t. Calculate u(-1). -8 Let i(s) be the second derivative of 7s*5/20 - 2s. Let q = 272 - 271. Calculate i(q).	{ "pile_set_name": "DM Mathematics" }
144 Calculate the highest common factor of 11 and 352. 11 Calculate the greatest common divisor of 16 and 3728. 16 What is the highest common factor of 714 and 2278? 34 Calculate the greatest common divisor of 52 and 793. 13 Calculate the greatest common factor of 6336 and 550. 22 Calculate the greatest common factor of 33 and 111. 3 Calculate the highest common factor of 13 and 299. 13 What is the highest common divisor of 4200 and 28? 28 Calculate the greatest common divisor of 192 and 8952. 24 Calculate the greatest common divisor of 46 and 851. 23 Calculate the highest common divisor of 21 and 161. 7 Calculate the highest common divisor of 1560 and 26. 26 What is the greatest common factor of 84 and 651? 21 What is the greatest common factor of 6 and 596? 2 What is the highest common divisor of 185 and 333? 37 What is the greatest common factor of 1195 and 85? 5 What is the greatest common factor of 288 and 15192? 72 What is the greatest common divisor of 13 and 195? 13 What is the highest common divisor of 64 and 208? 16 What is the greatest common factor of 784 and 49? 49 Calculate the greatest common factor of 976 and 427. 61 Calculate the greatest common divisor of 2475 and 33. 33 What is the highest common factor of 158 and 79? 79 Calculate the highest common divisor of 225 and 195. 15 What is the highest common factor of 159 and 583? 53 What is the highest common factor of 122 and 5002? 122 What is the greatest common factor of 12566 and 206? 206 Calculate the greatest common divisor of 1024 and 8. 8 Calculate the highest common divisor of 20300 and 25. 25 Calculate the highest common factor of 315 and 280. 35 Calculate the highest common divisor of 456 and 399. 57 Calculate the highest common divisor of 60 and 12. 12 Calculate the highest common factor of 39 and 143. 13 What is the highest common divisor of 12 and 12948? 12 What is the highest common factor of 99 and 144? 9 Calculate the greatest common divisor of 816 and 3024. 48 Calculate the greatest common divisor of 1325 and 25. 25 Calculate the greatest common divisor of 318 and 2703. 159 What is the highest common divisor of 1456 and 224? 112 What is the highest common factor of 3652 and 176? 44 What is the highest common factor of 48 and 24? 24 What is the highest common factor of 473 and 86? 43 Calculate the highest common divisor of 38 and 741. 19 What is the highest common factor of 5340 and 240? 60 Calculate the highest common factor of 143 and 3302. 13 What is the highest common divisor of 107 and 85279? 107 Calculate the greatest common divisor of 900 and 120. 60 What is the greatest common factor of 3875 and 31? 31 What is the highest common factor of 81 and 126? 9 What is the greatest common factor of 22 and 55? 11 Calculate the highest common factor of 6 and 74. 2 Calculate the highest common divisor of 32 and 20. 4 Calculate the highest common factor of 45269 and 203. 203 Calculate the greatest common factor of 2085 and 15. 15 What is the greatest common factor of 66 and 110? 22 What is the highest common factor of 55 and 176? 11 Calculate the greatest common divisor of 945 and 783. 27 What is the greatest common factor of 243 and 657? 9 What is the greatest common divisor of 75 and 5925? 75 Calculate the greatest common divisor of 108 and 2538. 54 Calculate the greatest common factor of 1128 and 36. 12 What is the greatest common divisor of 141 and 11515? 47 Calculate the greatest common factor of 581 and 664. 83 Calculate the greatest common factor of 40 and 88. 8 Calculate the highest common divisor of 210 and 1610. 70 Calculate the greatest common factor of 448 and 4144. 112 What is the greatest common factor of 49 and 637? 49 Calculate the highest common divisor of 49 and 973. 7 Calculate the greatest common factor of 19465 and 255. 85 Calculate the greatest common divisor of 340 and 1275. 85 What is the highest common divisor of 9917 and 844? 211 What is the highest common factor of 1106 and 70? 14 Calculate the highest common factor of 148 and 68. 4 Calculate the greatest common divisor of 45 and 405. 45 What is the greatest common divisor of 19 and 608? 19 What is the greatest common divisor of 596 and 1639? 149 What is the greatest common divisor of 485 and 679? 97 What is the highest common factor of 18 and 720? 18 What is the greatest common factor of 96 and 3504? 48 Calculate the greatest common factor of 60 and 9732. 12 What is the highest common factor of 106 and 159? 53 What is the highest common factor of 1764 and 216? 36 Calculate the highest common factor of 21 and 1. 1 What is the greatest common factor of 108 and 243? 27 What is the highest common divisor of 92 and 1472? 92 Calculate the highest common divisor of 4797 and 82. 41 Calculate the highest common divisor of 9 and 453. 3 Calculate the highest common factor of 15105 and 570. 285 What is the highest common factor of 1781 and 13? 13 What is the greatest common divisor of 234 and 54? 18 What is the highest common divisor of 7272 and 216? 72 Calculate the highest common divisor of 32 and 288. 32 Calculate the highest common divisor of 78 and 7566. 78 What is the highest common divisor of 26 and 32734? 26 What is the greatest common divisor of 150 and 60? 30 Calculate the greatest common factor of 102 and 238. 34 Calculate the highest common divisor of 5 and 320. 5 Calculate the greatest common divisor of 65 and 5. 5 Calculate the greatest common divisor of 4419 and 3. 3 What is the greatest common factor of 440 and 132? 44 Calculate the greatest common factor of 384 and 3184. 16 What is the greatest common factor of 1364 and 88? 44 What is the highest common factor of 640 and 1760? 160 What is the greatest common factor of 240 and 110? 10 Calculate the highest common divisor of 861 and 105. 21 What is the greatest common factor of 885 and 15? 15 What is the greatest common divisor of 1805 and 95? 95 Calculate the greatest common divisor of 315 and 1505. 35 Calculate the greatest common divisor of 90 and 4. 2 What is the highest common divisor of 39174 and 6? 6 What is the highest common divisor of 100 and 30? 10 What is the highest common divisor of 103 and 15244? 103 What is the greatest common factor of 292 and 219? 73 What is the greatest common divisor of 8 and 136? 8 What is the highest common divisor of 5988 and 24? 12 What is the greatest common divisor of 78 and 130? 26 What is the highest common divisor of 198 and 2475? 99 Calculate the greatest common divisor of 27 and 30321. 27 What is the highest common divisor of 885 and 8673? 177 What is the greatest common factor of 5509 and 7? 7 Calculate the greatest common divisor of 22 and 32. 2 Calculate the greatest common factor of 12285 and 252. 63 Calculate the greatest common divisor of 32 and 8608. 32 What is the highest common divisor of 49 and 2989? 49 What is the greatest common factor of 56 and 1512? 56 What is the greatest common factor of 69654 and 94? 94 Calculate the highest common factor of 149 and 298. 149 What is the greatest common factor of 993 and 33? 3 Calculate the highest common factor of 1200 and 720. 240 What is the greatest common factor of 178 and 2? 2 What is the greatest common divisor of 362 and 7783? 181 What is the greatest common factor of 43 and 5? 1 Calculate the highest common factor of 632 and 8. 8 Calculate the greatest common factor of 294 and 147. 147 What is the highest common factor of 120 and 45? 15 Calculate the greatest common factor of 1200 and 448. 16 What is the greatest common divisor of 945 and 84? 21 Calculate the highest common divisor of 334 and 43921. 167 Calculate the greatest common factor of 14 and 2086. 14 What is the highest common divisor of 12 and 65892? 12 What is the highest common factor of 126 and 1098? 18 What is the highest common divisor of 1313 and 505? 101 What is the highest common factor of 46 and 10? 2 What is the greatest common divisor of 14 and 994? 14 What is the greatest common divisor of 324 and 12? 12 What is the highest common divisor of 655 and 10? 5 Calculate the greatest common factor of 90 and 720. 90 What is the greatest common factor of 16 and 200? 8 Calculate the greatest common divisor of 2596 and 44. 44 What is the highest common factor of 42 a	{ "pile_set_name": "DM Mathematics" }
3z, -z + 5z = -2f - 10. Let h be ((-6)/z)/(1/(-2)). Sort n, h, 2 in increasing order. h, n, 2 Let i = 3 - 3.2. Let k = 3.2 - 0.2. Put k, i, -0.5 in decreasing order. k, i, -0.5 Let h = 0.57 - 0.07. Put 1/9, 2/3, h in increasing order. 1/9, h, 2/3 Suppose -l + 2g = 1, 0 = l + 4l - g - 22. Let h(s) = -4 + 4 + 4s. Let c be h(1). Sort l, 3/4, c. 3/4, c, l Let p = 0.2 + -0.5. Let h = p - 0.7. Suppose 12 + 3 = 3n, 3b = -n + 11. Put b, h, -0.4 in descending order. b, -0.4, h Suppose 0 = -5f + j + 20, j = -0j - 5. Sort f, 3/4, 5. 3/4, f, 5 Let i(k) = -k*2 - 15k - 17. Let j be i(-14). Put 1, -4, 5, j in decreasing order. 5, 1, j, -4 Let l = 6 + -9. Sort l, 3, -2. l, -2, 3 Suppose -4k + 33 = -5m, 3m + 10 = m. Suppose 4v + k = -6. Sort -1, v, 5 in ascending order. v, -1, 5 Let y be -2 - -26/2. Suppose -13 + 1 = -yg. Sort 1, -5, g in decreasing order. g, 1, -5 Let s(o) = o*2 + 4o + 1. Let v be s(-4). Put -1, v, 6 in descending order. 6, v, -1 Let b be (-4)/(-6) + 168/18. Suppose 0 + b = -2q. Let r = -5 + 4.6. Put 0, q, r in descending order. 0, r, q Let z = -6 - -8. Suppose v = -zm - 12, -2v + v = -2m - 4. Put m, 5, 2 in descending order. 5, 2, m Let w = -0.49 + 0.09. Suppose 0 = 3u + 2u - 60. Let l be 2/(-24) + (-3)/u. Put l, -0.3, w in increasing order. w, l, -0.3 Let h = -17/7 + 109/42. Put h, -1/4, 4, 0.1 in descending order. 4, h, 0.1, -1/4 Let m = -47 - -47. Put -0.3, 5, m in descending order. 5, m, -0.3 Suppose -60g - 6 = -58g. Suppose -2b + 4n = 2n - 16, n + 36 = 5b. Sort g, b, 0. g, 0, b Let t(b) = b*2 - 2b - 14. Let z be t(5). Let j be 0/((-3)/3-1). Sort z, -3, j in decreasing order. z, j, -3 Let r be 9/3 + 52/(-16). Let l = -8/7 + 23/14. Put 0.4, r, l in descending order. l, 0.4, r Let b = 1.26 + -0.26. Let u = 1 + -6. Put u, b, 5 in increasing order. u, b, 5 Let s(m) = -m2 - 15m + 3. Let u be s(-15). Suppose 0 = -2h + 2 - 4. Let b = 1.03 + -0.03. Sort u, b, h. h, b, u Let o(a) = -a - 11. Let f be o(-6). Sort f, -0.4, 4 in decreasing order. 4, -0.4, f Let h = -1 + -2. Put -0.2, h, 2 in increasing order. h, -0.2, 2 Let k be 23/(-7) + 10 + -7. Sort k, 0.1, 0.4 in descending order. 0.4, 0.1, k Let u be (2/(-6))/((-3)/(-9)). Suppose -4t + 8 = -5t. Let v(d) = d2 + 8d + 1. Let f be v(t). Sort -5, f, u. -5, u, f Let w be (2/(-5))/(2/(-10)). Suppose -3 = 2o + 5. Sort 5, w, o. o, w, 5 Let q(d) = -d2 - 9d - 1. Let z be q(-9). Put -3, 5, z, -6 in descending order. 5, z, -3, -6 Suppose 0 = d + 3d - 8. Let c(r) = 2r - 3. Let v be c(2). Let m = v + 3. Put 5, m, d in decreasing order. 5, m, d Let f = -4 - 3. Let t = -4 - f. Sort t, -0.4, 0.4 in decreasing order. t, 0.4, -0.4 Suppose 5m - 3w - 17 = 0, 0 = -2m - 6w + 2w - 14. Suppose 0 = -3u + 5i - 15, 5i = -u + 9 + 6. Sort 9, m, u in decreasing order. 9, m, u Let z be 4/((0 + 1)/1). Suppose -zo = -3o. Sort 1, 5, o in increasing order. o, 1, 5 Let x be 31 + -10 + 2. Sort x, 8, 0, -2. x, -2, 0, 8 Let i(d) = -d - 5. Let s be i(-6). Suppose -17 + 5 = 5q + k, 6 = -3q - k. Let y = 1 - 1. Sort q, y, s. q, y, s Let c = -134 - -135. Put c, -6, 2 in decreasing order. 2, c, -6 Let j = 6 + -7. Let z = -11 + 10.5. Sort z, -3, j in decreasing order. z, j, -3 Let j = -22 + 18. Sort -5, 0, j in increasing order. -5, j, 0 Let i = -22 - -1. Let f = 18 + i. Sort f, -4, -2 in increasing order. -4, f, -2 Let k = -7 + 7. Suppose 2 = -2a - 2y, k = -a - 2y - 0y - 1. Suppose 4m - 7m - 12 = 0. Sort a, m, -3 in decreasing order. a, -3, m Let d = -0.056 - -2.056. Let p = 1.1 - 1. Put p, d, 1/5 in decreasing order. d, 1/5, p Let q = 2 - 1. Suppose 5m = -25, 3m + 20 = 3k + 2m. Suppose 2r = 3c - 17, -r - 31 = -5c + 3r. Put c, k, q in descending order. k, c, q Let v = -11 + 10. Let h be ((-6)/(-4))/(2/8). Put h, v, 1 in ascending order. v, 1, h Let d = 242/3 - 80. Put 0.1, d, -3, 0 in descending order. d, 0.1, 0, -3 Let k = 101 + -99. Put -2, k, 1 in ascending order. -2, 1, k Let o be (-3)/((21/4)/(-7)). Suppose -ob - 4u = 20, -3b - 2u - 14 = -0b. Sort b, 3, -1 in descending order. 3, -1, b Suppose -2w - 3 = w. Suppose 8n + 3 = -37. Suppose -2d + 2 + 0 = 0, -3d + 6 = v. Sort n, v, w in decreasing order. v, w, n Suppose 0 = -q + 4j + 7, j - 3 = 2j. Sort -4, q, -13 in decreasing order. -4, q, -13 Let c = -10 - -6. Suppose 4 = -6u - 8. Put 3, c, u in increasing order. c, u, 3 Let u be (13/(-78))/(6/(-4)). Sort -2, 0.22, u in decreasing order. 0.22, u, -2 Let t be 35/14(-12)/(-15). Let k be -1(0 + 1) - -5. Sort t, k, -3 in increasing order. -3, t, k Let w = 3 + -8. Let s = w - -13. Sort -2, -1, s in decreasing order. s, -1, -2 Suppose -5d + 39 = -2b, 4b - d = -2d - 23. Put b, -4, 2 in decreasing order. 2, -4, b Suppose 0 = -r - r + 4. Sort -2, 1, r in descending order. r, 1, -2 Let p = 0.55 + -0.05. Let x = p - 0.7. Put -1, x, 0.5 in decreasing order. 0.5, x, -1 Let p = -3 - -1. Let d = -4 - p. Let r be 6/21 + (-6)/(-252)-19. Sort d, r, -2/7. d, -2/7, r Let x be 17 + (-1)/(2 + -1). Let k be x/6(-60)/(-16). Suppose 4t = -k - 10. Sort 2, -2, t. t, -2, 2 Let p = -9 + 8.3. Let t = -3.327 + 0.027. Let i = p + t. Sort 1, -3, i in ascending order. i, -3, 1 Let v = 0.24 + 0.06. Let f be (13/(-1) + 0)-1. Let a = f + -17. Sort -1/3, a, v in descending order. v, -1/3, a Suppose 0 = 4d - 9d - 15. Let i(p) = p2 - 6p - 3. Let w = -15 - -22. Let m be i(w). Put d, m, 2 in increasing order. d, 2, m Let f = -0.2 - -0.4. Let n be (-3 + (-106)/(-38))/(-2). Sort n, 0.1, f in ascending order. 0.1, n, f Let r = 35 + -36.7. Let n = 2 + r. Put n, 2, -3/7 in decreasing order. 2, n, -3/7 Let h(r) = -2r2 + r + 1. Let m = 0 - -10. Let z be 15/(-6)(-8)/m. Let f be h(z). Put 4, -3, f in decreasing order. 4, -3, f Let g(b) = -b - 4. Let a be g(-4). Let h = 2 - a. Suppose 3d + 5v - h = 4d, -13 = -3d - 4v. Put d, 4, 1 in decreasing order. 4, d, 1 Let y = 28/79 - 1455/316. Let b = -55/12 - y. Put 0.4, -2/7, b in descending order. 0.4, -2/7, b Let y = -2 - -1. Sort -2, 3, -6, y in decreasing order. 3, y, -2, -6 Let g = 5 + -5. Let y = 0.4 - -0.1. Put g, 2, y in decreasing order. 2, y, g Let h = 129 - 1417/11. Put 11, 3, h in increasing order. h, 3, 11 Let o = 3 + -5. Let b = 2 + o. Let l = -0.2 - b. Put 1/2, l, 0.2 in decreasing order. 1/2, 0.2, l Suppose 4l = 5l + 4. Sort 2, -1, l in descending order. 2, -1, l Let u = -48.2 + 48. Sort u, 1/2, 2/7 in increasing order. u, 2/7, 1/2 Let m = 1/12 - -7/60. Let a = 1 + -0.5. Let v = 2.5 + -3. Put m, a, v in decreasing order. a, m, v Let k = -2 + 6. Let i = -2 + 2.1. Let q = -0.07 + -0.33. Put k, q, i in ascending order. q, i, k Let i = -17 + 17. Suppose v - 7 + 2 = i. Put v, -2, -3 in ascending order. -3, -2, v Suppose 0r = 4r. Let h = 0.08 - -0.92. Put h, 2/7, r in ascending order. r, 2/7, h Let b(x) = -2x - 17. Let w be b(-10). Put -4, -3, w, 2/7 in descending order. w, 2/7, -3, -4 Let d = -3.99 - -4. Let h = d - 0.31. Put h, -3, -2 in descending order. h, -2, -3 Let w = 272 + -2990/11. Let a = -11 + 16. Put a, w, -5/6 in increasing order. -5/6, w, a Let u = -21 - -21.3. Sort 1, u, -1 in decreasing order. 1, u, -1 Let h = 6 + -3. Let m = h + -3. Let p be 2 + -2 + -3 + 0. Put p, 5, m in descending order. 5, m, p Let c = 4.7 - 5. Let h be ((-14)/(-6) + -2)(-12)/(-16). Sort 1/2, c, h in increasing order. c, h, 1/2 Let i be (-1)/(((-4)/1)/8). Let a be ((1 + -2)1)/1. Suppose 2n + 3n - 5 = 0. Put n, a, i in decreasing order. i, n, a Suppose 4i + 36 = -5k, k + k + 16 = -2i. Sort k, 7, 2. k, 2, 7 Let s = 0.19 + -0.09. Let p = 0.1 - s. Put -0.5, p, 2/7 in descending order. 2/7, p, -0.5 Let f(d) = d - 1. Let g be f(1). Suppose g = 5w + 5k, 5w + k = 2w + 6. Sort 4, w, 0 in decreasing order. 4, w, 0 Suppose 8 = -0h + 4h. Suppose o + 11 = -3w, 3 = ho + 4w + 21. Sort 5, -4, o in increasing order. o, -4, 5 Let v = -2 - 1. Sort -2/7, 0.03, v in increasing order. v, -2/7, 0.03 Suppose -v = -0v. Let a = -27 + 49. Let u = -18 + a. Sort 2, v, u in ascending order. v, 2, u Let z(u) = u2 - u + 2. Let t be z(0). Let n(p) = 9p*3 + p - 2. Let w be n(1). Let o = -9 + w. Sort -3, o, t in ascending order. -3, o, t Let s = -0.06 - 0.44. Put s, -3, -0.1, -4 in increasing order. -4, -3, s, -0.1 Suppose 5o + 3p = 117, 2p	{ "pile_set_name": "DM Mathematics" }
3, -7709, -17769, -31853, -49961? -2012o2 + 339 What is the l'th term of 92, 236, 582, 1232, 2288, 3852? 17l3 - l2 + 28l + 48 What is the q'th term of 2068, 2085, 2108, 2131, 2148, 2153, 2140, 2103? -q3 + 9q*2 - 3q + 2063 What is the h'th term of 33, 60, 101, 162, 249? h3 + h2 + 17h + 14 What is the u'th term of 9526, 19057, 28588? 9531u - 5 What is the o'th term of -5015, -5014, -5013? o - 5016 What is the u'th term of 16807, 33613, 50419, 67225, 84031, 100837? 16806u + 1 What is the j'th term of 431, 792, 1161, 1538, 1923, 2316, 2717? 4j*2 + 349j + 78 What is the g'th term of -2390892, -2390893, -2390894, -2390895, -2390896, -2390897? -g - 2390891 What is the j'th term of -67795, -135589, -203383, -271177? -67794j - 1 What is the o'th term of 2000, 16383, 55424, 131453, 256800, 443795, 704768, 1052049? 2055o3 - o2 + o - 55 What is the z'th term of -7703952, -7703950, -7703948, -7703946, -7703944? 2z - 7703954 What is the j'th term of -8, 266, 696, 1276, 2000, 2862, 3856? -j3 + 84j*2 + 29j - 120 What is the l'th term of 15266, 15250, 15220, 15170, 15094, 14986? -l3 - l2 - 6l + 15274 What is the v'th term of 37590, 37592, 37594, 37596? 2v + 37588 What is the v'th term of -259, -1281, -3001, -5425, -8559, -12409, -16981? -v*3 - 343v*2 + 14v + 71 What is the y'th term of -2940, -2930, -2942, -2988, -3080, -3230, -3450, -3752? -2y3 + y2 + 21y - 2960 What is the a'th term of 30, -58, -352, -954, -1966, -3490, -5628? -17a3 - a2 + 34a + 14 What is the n'th term of -3925, -7377, -10831, -14287, -17745? -n*2 - 3449n - 475 What is the b'th term of 218055, 218061, 218067? 6b + 218049 What is the i'th term of 42093, 84183, 126265, 168339, 210405, 252463, 294513? -4i*2 + 42102i - 5 What is the k'th term of 7811, 7838, 7859, 7874? -3k2 + 36k + 7778 What is the l'th term of 2067, 2139, 2211, 2283? 72l + 1995 What is the o'th term of -2811, -5631, -8457, -11289, -14127, -16971, -19821? -3o*2 - 2811o + 3 What is the t'th term of -6530, -6601, -6668, -6731, -6790, -6845, -6896? 2t2 - 77t - 6455 What is the y'th term of 331, 303, 203, -5, -357, -889, -1637, -2637? -6y3 + 14y + 323 What is the w'th term of 108, 130, 188, 300, 484? 3w3 + w + 104 What is the v'th term of 3422, 6749, 10076, 13403, 16730? 3327v + 95 What is the j'th term of -7558, -30254, -68080, -121036, -189122? -7565j2 - j + 8 What is the z'th term of -697, -2775, -6239, -11089, -17325? -693z*2 + z - 5 What is the f'th term of 39683, 79357, 119025, 158687? -3f*2 + 39683f + 3 What is the y'th term of -37717, -75441, -113165, -150889, -188613, -226337? -37724y + 7 What is the z'th term of 915, 1799, 2683, 3567? 884z + 31 What is the w'th term of 147579, 147973, 148377, 148797, 149239? w3 - w2 + 390w + 147189 What is the p'th term of -47, -330, -1091, -2570, -5007, -8642, -13715? -40p3 + p2 - 6p - 2 What is the c'th term of 421, 434, 487, 604, 809, 1126, 1579, 2192? 4c*3 - 4c*2 - 3c + 424 What is the d'th term of -26706, -53410, -80112, -106812? d*2 - 26707d What is the v'th term of 1147, 1101, 1041, 961, 855, 717, 541, 321? -v3 - v2 - 36v + 1185 What is the f'th term of -184, -607, -1294, -2239, -3436, -4879, -6562, -8479? f3 - 138f*2 - 16f - 31 What is the i'th term of 1185, 1193, 1199, 1203, 1205, 1205, 1203? -i*2 + 11i + 1175 What is the c'th term of -232, -464, -694, -928, -1172, -1432, -1714, -2024? -c*3 + 7c*2 - 246c + 8 What is the a'th term of 151, 671, 1201, 1747, 2315, 2911, 3541, 4211? a3 - a2 + 516a - 365 What is the a'th term of 218235, 218238, 218243, 218250, 218259, 218270? a2 + 218234 What is the g'th term of -950, -951, -946, -929, -894? g3 - 3g*2 + g - 949 What is the v'th term of 228, 489, 750? 261v - 33 What is the f'th term of 29770, 29782, 29800, 29824? 3f2 + 3f + 29764 What is the a'th term of -4146, -4542, -4938, -5334? -396a - 3750 What is the a'th term of 24715, 24617, 24533, 24469, 24431, 24425, 24457? a3 + a2 - 108a + 24821 What is the b'th term of 45844, 183422, 412720, 733738? 45860b2 - 2b - 14 What is the z'th term of 132, 144, 150, 150, 144? -3z2 + 21z + 114 What is the v'th term of 26, 94, 198, 338, 514, 726, 974? 18v2 + 14v - 6 What is the o'th term of 9508, 19024, 28540? 9516o - 8 What is the s'th term of -39134, -78232, -117330? -39098s - 36 What is the x'th term of 27, -86, -337, -726? -69x2 + 94x + 2 What is the b'th term of -3553, -3533, -3485, -3397, -3257, -3053, -2773? 2b3 + 2b*2 - 3557 What is the b'th term of 3, -232, -467, -702, -937, -1172? -235b + 238 What is the s'th term of -34218, -68444, -102670, -136896? -34226s + 8 What is the i'th term of 2801041, 2801040, 2801037, 2801032, 2801025, 2801016? -i2 + 2i + 2801040 What is the d'th term of 3973, 3820, 3667, 3514, 3361? -153d + 4126 What is the o'th term of 172, 720, 1632, 2902, 4524? -o3 + 188o*2 - 9o - 6 What is the x'th term of -310, -538, -686, -748, -718, -590, -358, -16? x*3 + 34x*2 - 337x - 8 What is the c'th term of 436, 460, 516, 616, 772, 996, 1300? 2c3 + 4c*2 - 2c + 432 What is the q'th term of -86, -124, -76, 88, 398, 884? 5q3 + 13q*2 - 112q + 8 What is the u'th term of -6112, -5721, -5330, -4939, -4548? 391u - 6503 What is the b'th term of 3280, 6340, 8966, 10942, 12052, 12080, 10810? -36b3 - b2 + 3315b + 2 What is the c'th term of -42, -64, -100, -144, -190, -232, -264? c3 - 13c*2 + 10c - 40 What is the r'th term of -191279, -191275, -191271, -191267, -191263, -191259? 4r - 191283 What is the c'th term of -7583, -15156, -22729, -30302, -37875, -45448? -7573c - 10 What is the j'th term of 1745, 1689, 1607, 1487, 1317, 1085, 779, 387? -2j3 - j2 - 39j + 1787 What is the l'th term of -254, -277, -288, -281, -250, -189? l*3 - 30l - 225 What is the b'th term of -129597, -259178, -388759, -518340, -647921, -777502? -129581b - 16 What is the l'th term of 581, 640, 699, 758? 59l + 522 What is the p'th term of -293, -1626, -3847, -6956, -10953? -444p2 - p + 152 What is the y'th term of -108, -167, -274, -429? -24y*2 + 13y - 97 What is the o'th term of -12518, -12528, -12542, -12560, -12582? -2o2 - 4o - 12512 What is the p'th term of 35327, 35378, 35427, 35474? -p*2 + 54p + 35274 What is the v'th term of 108, 156, 144, 72, -60, -252? -30v2 + 138v What is the z'th term of 22486, 44965, 67440, 89911, 112378, 134841? -2z2 + 22485z + 3 What is the q'th term of -300, -610, -886, -1122, -1312, -1450, -1530, -1546? q*3 + 11q*2 - 350q + 38 What is the b'th term of 12514, 25053, 37592, 50131, 62670? 12539b - 25 What is the g'th term of 4472, 8960, 13438, 17900, 22340, 26752? -g3 + g2 + 4492g - 20 What is the z'th term of -6526, -6706, -6884, -7060, -7234? z*2 - 183z - 6344 What is the x'th term of 6705, 13383, 20063, 26745? x*2 + 6675x + 29 What is the c'th term of 8506, 34017, 76536, 136063, 212598, 306141? 8504c2 - c + 3 What is the f'th term of 150, 351, 554, 759, 966, 1175, 1386? f2 + 198f - 49 What is the g'th term of 79, 76, -23, -266, -701, -1376? -8g3 + 53g + 34 What is the z'th term of -30, -337, -646, -957, -1270, -1585, -1902? -z*2 - 304z + 275 What is the g'th term of -59, -226, -519, -944, -1507, -2214, -3071? -g*3 - 57g*2 + 11g - 12 What is the d'th term of 240445, 240439, 240421, 240385, 240325, 240235, 240109, 239941? -d3 + d + 240445 What is the l'th term of 7227719, 7227714, 7227697, 7227662, 7227603, 7227514, 7227389, 7227222? -l3 + 2l + 7227718 What is the i'th term of 206557, 206546, 206521, 206476, 206405? -i3 - i2 - i + 206560 What is the q'th term of 651, 553, 383, 135, -197, -619, -1137? -q3 - 30q*2 - q + 683 What is the m'th term of -14698, -14667, -14616, -14545, -14454, -14343? 10m*2 + m - 14709 What is the y'th term of -6293, -12817, -19341, -25865? -6524y + 231 What is the y'th term of 20123, 40202, 60281, 80360, 100439? 20079y + 44 What is the n'th term of -118, -431, -940, -1645, -2546, -3643, -4936? -98n*2 - 19n - 1 What is the r'th term of 1052, 1093, 1134, 1175, 1216, 1257? 41r + 1011 What is the q'th term of 13700, 13700, 13708, 13730, 13772, 13840, 13940, 14078? q3 - 2q**2	{ "pile_set_name": "DM Mathematics" }
y 7? 6 Suppose 5q - 3v = -0v + 278, 0 = 2q - 3v - 104. What is the remainder when q is divided by 15? 13 Let r = -185 + 223. Let h(s) = s2 - s. Calculate the remainder when r is divided by h(-4). 18 Calculate the remainder when 54 is divided by -1(-2)/612 - -4. 6 Let n = 1 - 1. Let t be ((-26)/(-3))/(28/(-42)). Let u = n - t. Calculate the remainder when u is divided by 7. 6 Calculate the remainder when 7 is divided by (-32)/(-24)3/2. 1 Let n be (-4)/(-6) - 12/(-9). Suppose f + 9 = n. Let i(t) = -2t + 2. What is the remainder when 31 is divided by i(f)? 15 Suppose -q - 4u + 98 = 0, 2u - 32 = -q + 70. What is the remainder when q is divided by 29? 19 Let a = -3 + 2. Let w(t) = -27t. Let p be w(a). Suppose 0 = -4f + 2f + 4z + 2, 2f + z - p = 0. Calculate the remainder when 32 is divided by f. 10 Let m = -27 - -334. Calculate the remainder when m is divided by 44. 43 Let m(b) = -8b - 5. Calculate the remainder when 56 is divided by m(-3). 18 Let u = -37 - -66. What is the remainder when u is divided by 5? 4 What is the remainder when 65 is divided by (-360)/(-16) - 1/2? 21 Let c = -49 - -81. Calculate the remainder when 56 is divided by c. 24 Let n be ((-30)/45)/((-2)/6). Suppose 41 = 4m - m + 2u, m = -nu + 7. Calculate the remainder when m is divided by 5. 2 Suppose -r + 35 + 0 = 0. Calculate the remainder when r is divided by 3. 2 Let v(z) = z*3 - 9z*2 + 14z - 30. Calculate the remainder when 87 is divided by v(8). 15 Suppose -5t + 5w - 260 = -10t, 4t = 5w + 199. Calculate the remainder when t is divided by 6/(-3)(4 - 11). 9 Let o(l) be the first derivative of 7l2/2 - 3l + 2. Let r = -11 + 28. What is the remainder when o(5) is divided by r? 15 Let m(p) = -2p3 - 2p + 6p - 2 + 3p3 + p2. Calculate the remainder when m(3) is divided by 12. 10 What is the remainder when 14 is divided by 27 + -32 + (-15)/(-1)? 4 Let a = -12 - -29. Suppose 17h - 4h = 130. Calculate the remainder when a is divided by h. 7 Let u(b) = b*3 + 4b*2 + 4b + 2. Let t(l) = -5l3 - 16l*2 - 17l - 8. Let n(w) = 2t(w) + 9u(w). What is the remainder when 29 is divided by n(4)? 9 Let o(b) = 19b - 4. What is the remainder when o(1) is divided by 8? 7 Let p be 2/(-8) - 26/(-8). Suppose pu - 25 = -2u. Calculate the remainder when 18 is divided by u. 3 Suppose 44 - 159 = 5t. Let b = -10 - t. Suppose 0 = 4q - 5a - 163, -3q - 1 = -5a - 127. What is the remainder when q is divided by b? 11 Let p(y) = 2y3 - 5y*2 + 7y + 2. What is the remainder when p(5) is divided by 15? 12 Suppose -36 = -2o - o. Let h(t) = t3 + 3t*2 - 2t - 4. Let j be h(-3). Suppose -3f + 175 = jf. Calculate the remainder when f is divided by o. 11 Suppose v = -2v + 27. Let o = -52 + 77. What is the remainder when o is divided by v? 7 Suppose 3y = 2y + 4. Suppose 4l - 28 = -yf, -3l + 41 = -3f - 4. Let n(p) = 4p*2 - 2p. What is the remainder when n(-3) is divided by l? 9 Suppose -3f - 3u = -63, -4u - 42 = -2f - 0u. What is the remainder when 82 is divided by f? 19 Suppose 5d + 42 = -4p + 191, 0 = 4p - d - 119. What is the remainder when p is divided by 2 + (-32)/14 - (-228)/14? 15 Let f = 37 - 33. What is the remainder when 5 is divided by f? 1 Let y = 52 + -37. Let n = 8 + 51. What is the remainder when n is divided by y? 14 Calculate the remainder when 31 is divided by (-147)/(-18) + 1/(-6). 7 Let l be (2 + -3)/(2/12). Let a be ((-10)/l)/((-4)/(-12)). Suppose -9 = -4h + au + 34, 0 = 5h - 3u - 44. Calculate the remainder when h is divided by 3. 1 Suppose -4p = -16, -6y + p + 88 = -2y. Calculate the remainder when y is divided by 16/(-9) - -2 - (-460)/36. 10 Let c = -5 - -21. What is the remainder when 61 is divided by c? 13 Suppose 87k = 85k + 46. Suppose v = 4 + 4. Calculate the remainder when k is divided by v. 7 Suppose -16 - 4 = -l. Suppose d + 4d + l = 0. Calculate the remainder when 9/(2 + 2/d) is divided by 4. 2 Let g = -3 - -8. Suppose 3t + 2d - 4 - 10 = 0, -gt = 3d - 22. Calculate the remainder when 6 is divided by t. 0 Let w be (-29)/2 + (-1)/2. Let x = -2 - w. Calculate the remainder when x is divided by (28/8)/((-3)/(-6)). 6 Calculate the remainder when 4 is divided by 135/608/6. 1 Let i be 1/3 - (-6)/(-18). Let c(j) = j3 - 8j*2 + 8j - 3. Let y be c(7). Suppose i = 2a - ya + 18. What is the remainder when a is divided by 6? 3 Let m = 67 + -56. What is the remainder when 43 is divided by m? 10 Let d(o) = 2o2 + 3o*2 - 2o - 2o2 + 1 + 4o*3 - 4o2. Let r = -16 + 29. Calculate the remainder when d(2) is divided by r. 12 Let b = 118 - 115. What is the remainder when 25 is divided by b? 1 Let g = 6 - -8. Calculate the remainder when 68 is divided by g. 12 Let z(o) = o3 - 4o2 - 4o. Let h be z(4). Let k = h + 31. Calculate the remainder when 29 is divided by k. 14 Suppose 20 = 4c - 9c. Let z(t) = -5t - 5. Let s be z(c). Let i = 25 - s. What is the remainder when 18 is divided by i? 8 Let m(g) = -g2 + 6g + 5. What is the remainder when m(4) is divided by 4? 1 Suppose -5u = -5m, 4u + m - 4 = 3u. Suppose up - 4 = 2. Calculate the remainder when 10 is divided by p. 1 Let t be 4/(-16) - (-25)/4. Calculate the remainder when (-2)/t + 576/27 is divided by 8. 5 Let z(t) = t3 - 12t*2 - t + 16. Suppose -5d = -19 - 1. Suppose 2l - dl + 12 = 0. What is the remainder when l is divided by z(12)? 2 Suppose 5i - h = -0h + 140, 4h = 5i - 140. Let n = -81 - -135. Calculate the remainder when n is divided by i. 26 Let p(s) = s*2 + 3s - 7. Let f be p(-9). Suppose f = 3m + 5. Let o(d) = d3 + 5d*2 - 6d - 4. What is the remainder when o(-5) is divided by m? 12 Let x(n) = -n*3 + 5n*2 - 4n + 4. What is the remainder when 6/4 + -2 + (-111)/(-6) is divided by x(3)? 8 Let v = 23 + -9. Let u = 5 + v. What is the remainder when (-1)/(-2)255 is divided by u? 17 Let p = 2 + 11. Let y(o) = 6o - 35. What is the remainder when y(14) is divided by p? 10 Let w(s) = s2 + s + 27. Let a be (-1 + 1)4/8. What is the remainder when w(a) is divided by 10? 7 Let n(t) = 8t. Calculate the remainder when 46 is divided by n(3). 22 Suppose -5c - 27 = q - 4q, -c + 17 = q. What is the remainder when 17 is divided by q? 3 What is the remainder when 1245/10 is divided by 3? 0 Suppose -3s - 27 = -4h, 4h - 29 = 4s + h. Let w = 0 - s. What is the remainder when 13 is divided by w? 3 Let w = 20 + -1. Let h = w - 12. Calculate the remainder when 25 is divided by h. 4 Let c = -18 - -19. What is the remainder when 89 is divided by 5 + -6 + 24c? 20 Let l = 122 - 26. What is the remainder when l is divided by 49? 47 Suppose 3t = -0t + 390. What is the remainder when t is divided by 33? 31 Let u(q) = 4q - 1. Suppose 2g - 2 = -0g. Let w(p) = 31p*3 + p - 1. Calculate the remainder when w(g) is divided by u(3). 9 Let l = 24 + 18. Suppose 2m = -j + 15, 3j - m = -j + 33. Calculate the remainder when j is divided by l/9 - 1/(-3). 4 Suppose 0 = -b - 0b. Let s be (b/(3 - 2))/1. Suppose x + 4j - 35 = s, -4x - 4j - 53 + 169 = 0. Calculate the remainder when x is divided by 14. 13 Suppose -3 = -g + 30. What is the remainder when 98 is divided by g? 32 What is the remainder when 2 - (-27 + 4 - -3) is divided by 5? 2 Suppose -3s + 2s + 35 = 0. Calculate the remainder when s is divided by 19. 16 Suppose 5m = -0m. Let j = 6 - -1. What is the remainder when j is divided by 1(m - -5 - 2)? 1 Suppose 77 = 2d + 3h, 0 = -8d + 3d - h + 160. Let c(s) = -2s. Let v be c(-2). Let n = v + 12. What is the remainder when d is divided by n? 15 Let n = 30 - 6. Calculate the remainder when n is divided by -18(3/(-6))/1. 6 Calculate the remainder when 4 + (69 + -2 - -1) is divided by 25. 22 Suppose -j = 5o - 17, 5j - 52 = 3j - o. What is the remainder when 79 is divided by j? 25 Let u = -2 - -2. Suppose 96 = 2z - uz. What is the remainder when z is divided by 17? 14 Let r(g) = -3g*2 + 18g + 12. Calculate the remainder when 77 is divided by r(6). 5 Calculate the remainder when 471/1 + 1 is divided by 17. 14 Let j = -65 - -43. Let v = j + 1. Calculate the remainder when (2 - 2 - v) + 3 is divided by 13. 11 Let f be (-2 + -7)(-6)/9. Let s = f - 4. Let x = s + 10. Calculate the remainder when 22	{ "pile_set_name": "DM Mathematics" }
ors of ((-6)/(-4) + -1)m? 37 Let d = -13 + 25. Let c(k) = 26k - 87. What are the prime factors of c(d)? 3, 5 Let o(m) be the first derivative of 2m3/3 + 3m*2 - 8m - 14. What are the prime factors of o(-8)? 2, 3 Suppose -10r + 8750 = -7r - 5q, -2q = -10. What are the prime factors of r? 3, 5, 13 Suppose 4g + 6k - 1787 = 3k, 0 = -2g - 3k + 901. List the prime factors of g. 443 Let t(f) = f2 - 20f - 4. Let g(u) = u*2 - 20u - 5. Let a(b) = 4g(b) - 5t(b). What are the prime factors of a(8)? 2, 3 Let h = -456 - -542. List the prime factors of h. 2, 43 Let m be 3 + 8/(-6)6. Let b(n) = n3 + 9n*2 + 9n. List the prime factors of b(m). 5, 11 Let h(c) = -c - 25. Let b(w) = -3w - 49. Let r(o) = 2b(o) - 5h(o). What are the prime factors of r(13)? 2, 7 Let u(p) = p2 + 14p + 82. What are the prime factors of u(-32)? 2, 7, 47 Let y = 17 - 11. Suppose yn + 564 = 10n. Suppose n = 6r - 51. What are the prime factors of r? 2 Suppose 0 = 8a - 5500 - 11516. List the prime factors of a. 3, 709 Let i(r) = -53r + 318. Let u be i(6). Let x(z) = -2z + 5z2 + 6 - 3z*2 - 3z2. List the prime factors of x(u). 2, 3 Let o = 4003 + -656. What are the prime factors of o? 3347 Let h(q) = q3 + 10q2 - 7. Let i be h(-10). Let x = i - -17. What are the prime factors of x? 2, 5 Suppose 0 = -g - g + 52. Suppose -5i = g + 49. List the prime factors of -3 + (0 - i) - -2. 2, 7 Suppose 0 = 9v - 6889 - 1103. List the prime factors of v. 2, 3, 37 Suppose -2n - 6n = 0. Let s = 5 + -2. Suppose n = -2t + 4, 2c + st - 6t - 2 = 0. List the prime factors of c. 2 Let h(j) = 3j*2 - 35j + 230. What are the prime factors of h(-31)? 2, 2099 Let n = 25 + -17. Suppose 0 = -ni + 3i + 840. What are the prime factors of i? 2, 3, 7 Let k(w) = w*3 + 17w*2 + 11w - 11. Let l be k(-16). Let d = 80 - l. What are the prime factors of d? 11 Suppose -3b + 4256 = 13b. List the prime factors of b. 2, 7, 19 Let y(v) = 81v3 - 2v*2 - 5v. List the prime factors of y(3). 2, 3, 359 Suppose -4p + 2x + 34 = 0, 4x = -3p - 2 - 0. Suppose pr - 10r = -312. What are the prime factors of r? 2, 3, 13 Suppose 254 = -3g - 52. Let o = g + 134. What are the prime factors of o? 2 Let h be (-5)/5 + 4 + -13. Let q(b) = b3 + 10b*2 - 5b + 5. What are the prime factors of q(h)? 5, 11 List the prime factors of (4/(-14))/((-1)/(-6524)-4). 2, 233 Let p(k) be the third derivative of 13k5/30 + k3/3 + 8k2. What are the prime factors of p(2)? 2, 53 Let f(u) be the third derivative of -u6/30 + u5/30 - u3/6 + u2. Let l be f(1). Let x(j) = -6j + 2. List the prime factors of x(l). 2, 5 Suppose 0 = -3f + 2r + 1684, r + r = f - 556. What are the prime factors of f? 2, 3, 47 Suppose 6g = g + 6450. List the prime factors of (-6)/108/((-48)/g). 3, 43 Let b(y) = -33y3 - 3y*2 + 4y + 19. What are the prime factors of b(-3)? 13, 67 Suppose 0 = 2g + g - 219. Let v = 12 + g. List the prime factors of v. 5, 17 Let g(w) = 6w*3 - 9w*2 + 11w + 1. List the prime factors of g(5). 7, 83 List the prime factors of (-45)/(-225) - 839/(-5). 2, 3, 7 Let d = -565 - -883. List the prime factors of d. 2, 3, 53 Let k(g) = 2g3 - 2g + 2. Let r be k(-2). Let c be 6/r - 65/(-25). Let s = c + 14. What are the prime factors of s? 2 Suppose -8128 = -5i + 3v, 61i - 59i - 3249 = -v. What are the prime factors of i? 5, 13 Let d(y) = 77y + 26. List the prime factors of d(4). 2, 167 Suppose 0a + 2a - 72 = 0. Let p = -6 + 6. Suppose p = 5v - v - a. What are the prime factors of v? 3 Let k be 1/1-15(-6)/18. List the prime factors of (-5)/(1/34(k - 7)). 5, 17 List the prime factors of (-680)/(-2) + 8/(-2). 2, 3, 7 Let o = -31 - -23. Let z(s) = s3 + 11s*2 + 8s + 3. Let u be z(o). Suppose 5v = -3q + u, -2v - 145 = -7q + 4q. What are the prime factors of q? 47 Suppose 0 = -2s + 7s + 255. Suppose -b + 4 = 4c, 2b + 3c - 37 = -3b. List the prime factors of (s + -1)/(b + -9). 2, 13 Suppose 0 = -8u + 2433 + 1359. List the prime factors of u. 2, 3, 79 Suppose 4j = 8j + 16. Let l be (-204)/(-54) - j/18. Suppose -280 = -lg - g. List the prime factors of g. 2, 7 Suppose 0 = 6n - 9n + 138. Suppose 2x + 6g = g + 93, -x = 2g - n. What are the prime factors of x? 2, 11 Suppose -d + 140 = -3k - 33, 3d - 4k = 524. Suppose -4i - d = 4m, 5m + 66 = -3i - 62. Let s = -26 - i. What are the prime factors of s? 2, 5 Let x(u) = -u3 - 7u*2 + 12u - 9. What are the prime factors of x(-12)? 3, 7 Suppose -7f - 3 = -31. Suppose fn + 3n = 616. List the prime factors of n. 2, 11 Suppose 0 = -20o + 24o + 24. List the prime factors of (104 - 18/o)2. 2, 107 Let u = -8 - 0. Let m(c) = -4c - 7. Let g be m(u). Suppose -5 = -3v + g. What are the prime factors of v? 2, 5 Let i = 9 - 7. Suppose ij - 3l + 4 = 4j, 5l - 2 = -j. Suppose 3u = ju + 23. List the prime factors of u. 23 Let z(r) = r - 22. Let y be z(18). List the prime factors of (-1 - y) + 186 + 8. 197 Let r be (6/12)/(1/4). Suppose -rt + 127 = 3z, -2t - 23 = -2z - 135. What are the prime factors of t? 59 Let d = 992 - 427. List the prime factors of d. 5, 113 Suppose 3i - 4i - 11 = -5s, -15 = -5s. Suppose 0 = 2t - 3x - 2x - 19, -4t - i = 4x. List the prime factors of (1 + -22)/(t - 3). 3, 7 Let c(t) = 32t*2 - 6t - 20. What are the prime factors of c(5)? 2, 3, 5 Let u(s) = 3s3 - 3s*2 - 2s - 7. List the prime factors of u(4). 3, 43 Let y be (4 + 4/(-1))/(-2). Let r be 2/(-1) - (-2 + 25). Let u = y - r. What are the prime factors of u? 5 Suppose -1446 - 1161 = -2d + t, -4d + 5t = -5211. List the prime factors of d. 2, 163 Let b(f) = 4f - 24. Let l be b(7). What are the prime factors of -3 + l + 2 - 1/(-1)? 2 Suppose 5x = 3t + 5876, 0 = 54x - 56x - 5t + 2369. What are the prime factors of x? 11, 107 Let o(l) = -l2 + 25. Let k be 0 - -128/12. Let f be ((-2)/k0)/2. List the prime factors of o(f). 5 Let b be (16/10)/(4/(-60)). Let o be (-17)/(-4) + b/(-32). Suppose ot - 380 = 4y - 0y, 149 = 2t - y. What are the prime factors of t? 2, 3 Suppose -2h + 4 = 8, z - 2079 = -4h. What are the prime factors of z? 2087 Let m(g) = g3 + 1. Let z(o) = 5o*3 + 3o*2 - 3o + 8. Let k(c) = -4m(c) + z(c). Let j be k(-4). Suppose -6u + 2u + 8 = j. List the prime factors of u. 2 Suppose x + 3z + 510 = 2x, -2z - 1028 = -2x. What are the prime factors of x? 2, 3, 43 Let h be (-8)/41 + 78. Suppose v - h = -v. What are the prime factors of v? 2, 19 Let s = 7 - 6. Let b = 9 - s. Suppose -3v + bv - 150 = 0. List the prime factors of v. 2, 3, 5 Let b be -6(9 + -6 + -2). Let x = -47 + 11. List the prime factors of b/(-4) - x/8. 2, 3 Let b be -35 + -3(-10)/(-15). Let g = 90 + b. What are the prime factors of g? 53 Let a(v) = -143v - 126. List the prime factors of a(-16). 2, 23, 47 Let x = 108 - 8. Suppose 265 = 3p + x. What are the prime factors of p? 5, 11 Suppose p - 3p = -2. Let r be (-2 - 6/3) + p. What are the prime factors of (4 - 1)(-28)/r? 2, 7 Let z = -454 - -230. Let c = -35 - z. List the prime factors of c. 3, 7 Let l(s) = 98s - 133. What are the prime factors of l(26)? 3, 5, 7, 23 List the prime factors of (-16)/(-120) + (0 - (-67196)/30). 2, 5, 7 Let x = 32 - 27. Suppose a - 3 = 2a. Let o = x + a. What are the prime factors of o? 2 Let z be 3 + 115/(1/1). Let a = z + 19. List the prime factors of a. 137 Let f(c) = -584c + 19. List the prime factors of f(-1). 3, 67 Let m be (-36)/30(-15)/(-2). What are the prime factors of (-2441)/m - 14/63? 271 Let f(i) = i3 - i2 - 2i - 22. What are the prime factors of f(7)? 2, 3, 43 Suppose -78 + 1125 = i. List the prime factors of i. 3, 349 Let f(m) = -m2 - 6m - 3. Let o be f(-6). List the prime factors of (-447)/(-9) + 2/o. 7 Let c be 18/(-4) + (-12)/8. Let i = c + 12. List the prime factors of i. 2, 3 Let r = -4 + 4. Suppose r = k - 4y - 26 - 29, -2y + 73 = k. What are the prime factors of k? 67 Let w(z) = -8z2 - 18z - 15. Let m(f) = -f*2 - f - 1. Let s(u) = -18m(u) + 2w(u). Let a be s(15). Suppose -4o = -7o + a. List the prime factors of o. 2, 7 Let f(i) = 33i. Let y be f(1). Let n = -107 - -111. Suppose -85 + y = -nh. What are the prime factors of h? 13 Let z = -5 + 7. Suppose -5q	{ "pile_set_name": "DM Mathematics" }
u = -a + 16. Suppose -3k - u = 5. Calculate t(k). 7 Let x(r) = r2 + 7r + 7. Let m = 81 + -87. Give x(m). 1 Let a(v) = 3v + 2v + 0v + 4v. Determine a(-1). -9 Let z(c) = c*3 + 3c*2 + 2c + 3. Let l(q) = -4q2 - q. Suppose 0 = 4m - 3t - 8, 2m = -2m - 2t - 12. Let h be l(m). Give z(h). -3 Let n be -543/(-30). Let l(x) = -x - x*3 - 4x*2 + 0x*n - 3 - 3x. Calculate l(-3). 0 Let g(h) = h*2 + h + 4. Let k be g(0). Let i(x) = -2x*3 + 5x*2 + 3x - 3. Let p(m) = 3m3 - 4m*2 - 2m + 2. Let s(r) = kp(r) + 3i(r). What is s(1)? 5 Let r(s) = 5 - 5 - 2s - 6 + 4. Let u = -2 + 0. Give r(u). 2 Suppose w = -2t + 3 - 9, 3t + 18 = -3w. Let k(l) = -l*3 - 7l*2 - 5l + 8. Calculate k(w). 2 Let u(o) = -o*3 + 2o*2 - o + 1. Let a be u(2). Let t(z) = -4z3 - z2 - z. Determine t(a). 4 Let l(r) = r*2 - 15r + 12. Let q be l(14). Let f(j) = j3 - 1. What is f(q)? -9 Let a(b) = b2 - 6b + 7. Let m(k) be the third derivative of k6/120 - k5/15 - k4/6 - k2. Let h be m(5). Calculate a(h). 2 Let l be 38/(-6) + 1/3. Let r(h) be the third derivative of h5/60 + h4/4 + h3 + 58h*2. Give r(l). 6 Let d(t) be the second derivative of -1/6t*3 - 2t - t*2 + 0. Let h = -4 - -2. Calculate d(h). 0 Let h be (-4)/(-18) + (-32)/(-18). Suppose 2v - 4 = hp + p, -4p + 8 = 0. Let d = v - 0. Let k(q) = q + 7. Determine k(d). 12 Let t(i) be the second derivative of -1/6i4 + 6i + 0 - 1/2i2 + 2/3i*3. Determine t(3). -7 Let q = -16 - -26. Let g be 6/5(-50)/3. Let l be 88/g + 4/q. Let x(s) = -2s - 6. Determine x(l). 2 Let f(u) be the first derivative of u4/4 - 2u*3 + 2u2 - 3. Calculate f(5). -5 Let h(t) = -t2 - t - 1. Let v(j) = 3j2 + 2j + 2. Let g(l) = 5h(l) + 3v(l). Determine g(-1). 4 Let o(h) = h - 3. Let l(m) = m - 3. Let u(k) = 6l(k) - 5o(k). Let v = 3 - 1. Suppose 0g = g - v. Give u(g). -1 Suppose -3t + 2t = 0. Let q(a) = a2 - a - 4. What is q(t)? -4 Let r be (-6)/(3 + 0) - -2. Let w(a) = r - 5 - 2a + 2a + a. Let s be w(6). Let v(b) = 2b. Determine v(s). 2 Let b(d) = d*3 + 9d*2 + 7d - 4. Let h be b(-8). Let s = h + -2. Suppose sc - 7c = 5. Let a(t) = 4t + 1. Give a(c). -3 Let y(w) be the second derivative of w8/6720 - w7/420 + w6/180 - w5/30 - w4/4 + 2w. Let b(d) be the third derivative of y(d). Determine b(5). -9 Let x(i) be the first derivative of 6i - 2i*2 - 3 - 1/4i*4 - 2i*3. Suppose 0 = h - 0h + 5. Calculate x(h). 1 Let t(n) = -4n. Let g(r) = r3 - 7r*2 + 8r - 11. Let f be g(6). Calculate t(f). -4 Let k(n) = n*3 - 4n*2 - 7n + 5. Let x(s) = 2s2 + s - 1. Suppose -z + i - 2 = -i, -4 = 2z + 5i. Let m be x(z). Calculate k(m). -5 Let j be ((-8)/10)/((-10)/25). Let s(a) = a + 0 - 4 + j. What is s(5)? 3 Let v(l) = -l + 7. Let p(i) = 3i - 15. Let b(h) = 6p(h) + 13v(h). What is b(1)? 6 Let u be (-3)/7 + (-20)/35. Let y(j) = 14j + 1. Calculate y(u). -13 Let v be -4 + 12 + 16/(-4). Let z(n) = -10 + 5n*2 - 2n + n*3 - 2n - vn + 6. Give z(-6). 8 Let c(i) be the first derivative of -8i3/3 - i2/2 - i - 2. Suppose 2q - 3z = -3q - 20, -q + 2z - 11 = 0. Give c(q). -8 Let q(w) = -7w - 1. Let l(z) = 11z + 2. Let n(g) = -5l(g) - 8q(g). Give n(1). -1 Suppose 3b + 5c - 1 = 0, 0c + c = 5b - 11. Let k(f) = f - 1. Calculate k(b). 1 Let r(s) = -s*3 - 6s*2 + 9s + 3. Suppose 5f + t = 2t - 33, 4f - 5t = -18. What is r(f)? -11 Let p(l) = l*3 + 4l*2 - 2l + 3. Let b be p(-4). Suppose 3y - b = -4t, 3y - 5t = 4y. Let j(f) = yf + f*2 + 1 - f - 3. Determine j(-5). 3 Suppose -11o + 70 = 3o. Let b(w) = -w - 2. Calculate b(o). -7 Let i(x) be the second derivative of 4x + 1/12x4 + 1/2x2 - x3 + 0. Give i(6). 1 Let t(v) = 38v - 39v + 5 - 1. Determine t(7). -3 Suppose -3 = -3c - 0. Let n(q) = 5q + 1. What is n(c)? 6 Let g = -10 - -6. Let r(y) = -7y3 - 10y*2 + 9y - 2. Let w(d) = 2d + 8d - 3 - 19d2 - 13d*3 + 7d. Let z(i) = -11r(i) + 6w(i). Give z(g). -8 Let j(a) = a*3 + 9a*2 - 10a + 3. Let q be j(-10). Let s(w) = 1 + w - 1 - 3w. Give s(q). -6 Let m(n) = n3 - 10n*2 + 7n + 12. Let c be m(9). Let y(t) = t - 1. Determine y(c). -7 Let v(s) = -3s + 3. Let w(u) = 2 - 2 - 2 + 3u. Let z(q) = 4v(q) + 5w(q). Let m be (-9)/(-36) + (-18)/8 - 0. Determine z(m). -4 Let z(x) = 10x + 10x + 6x - 22x + x*2 + 2. What is z(-6)? 14 Let t be -1 + 0 + (-1 - -6). Suppose 0 = 4q - 4 - t. Let r(f) = -4 + q + 6f - 3f - f. What is r(2)? 2 Suppose 3c + 6 = 0, 2c = -4d - 37 + 9. Let h(a) = -a2 - 8a + 4. Calculate h(d). 16 Let r(o) = -2o2 - 17o - 17. Let x(n) = n*2 + 9n + 9. Let b(y) = 3r(y) + 5x(y). Suppose -5w - 36 = 3g, 4w - 4g - 3 = -19. Determine b(w). -6 Let c(k) = k*3 - 3k*2 - 5k + 4. Let z be c(4). Let l(i) = i + 1 - 3i + i2 + 3i*3 + zi. Give l(1). 3 Let s(t) = 61t + 8t2 - 2 + t3 - 55t - 6. Calculate s(-7). -1 Let q(t) = t - 3. Suppose -3m - 28 = 2. Let o be (0 - 0)(-5)/m. Suppose -4a + a = o. Determine q(a). -3 Let l(b) = 90b + 1 + 5b*3 - 88b + 3b3 + b2. Determine l(-1). -8 Let w(q) be the second derivative of -q5/60 - q4/3 - 3q*3/2 - 2q*2 + q. Let g(a) be the first derivative of w(a). Give g(-6). 3 Let j = 44 - 41. Let i(m) = 2m*2 - 2m - 2. Determine i(j). 10 Suppose -3u - 14 = z + 7, z + 2u = -16. Let l(b) = -3b - 9. Calculate l(z). 9 Suppose -4s - 4y + 28 = 0, 0 = -0y - 2y + 10. Let d(k) be the third derivative of -k6/120 + k5/20 - k4/24 - k3/6 + 8k2. Calculate d(s). 1 Let z(l) = -l2 - l + 1. Suppose 3n - 2n = -2. Let w(q) = q*2 + 8q - 2. Let a(c) = nz(c) - w(c). Determine a(5). -5 Let h(a) = a3 - 6a*2 + 3a + 5. Let u be 64/(-8) - 11. Let i(l) = l2 + 13l - 9. Let k be i(u). Give h(k). -5 Let s(y) = -5. Let f(h) = h. Let u(p) = -2f(p) + s(p). Suppose -26z = -71z - 180. Determine u(z). 3 Let z(a) be the first derivative of a4/12 - a3/6 + a2 - a - 4. Let u(d) be the first derivative of z(d). What is u(2)? 4 Let b(u) be the third derivative of u5/60 - 5u*4/24 - 4u*3/3 - 3u2. Give b(7). 6 Let q(j) be the third derivative of j5/60 - j*4/4 + 5j*3/6 - 65j2. What is q(4)? -3 Let f(k) be the first derivative of -k4/4 + 5k3/3 - k2/2 + 3k - 1. Let g = 1 - -4. Calculate f(g). -2 Let z(x) = 2x - 7. Suppose -3v = -10 - 5. What is z(v)? 3 Suppose 0 = 5d - 15, -w + 6 = -5w - 2d. Let i(t) = 3t*2 - t - 6t*2 - 1 + 4t*2. What is i(w)? 11 Suppose 14 = 3k + 4c, 3k = -c - 0c + 17. Suppose -4d = -k - 2. Let t(y) = 3y2 - 3y. What is t(d)? 6 Let w(a) = -a - 9. Suppose -o + 2o - v = -1, -5o - 2v + 2 = 0. Determine w(o). -9 Let a be (0/(-3))/(0 - 2). Let q be (0/(-1))/(a - 3). Let t(v) = v2 + v + 4. Determine t(q). 4 Suppose 0 = -5b + 5m + 2 + 13, -2m + 6 = 0. Let r(x) = -x*3 + 5x*2 + 5x + 4. Let g be r(b). Let s be (g/4)/((-2)/4). Let n(p) = p. Give n(s). 1 Let r(n) = n - 1. Let x(p) = 3. Let c(y) = -r(y) - x(y). Determine c(-6). 4 Let j(w) = 98w - 3w*2 - 100w - 1 - 2 + 0. Calculate j(-2). -11 Let s = 1 + -10. Let m(p) = -19p + 2. Let l(c) = 9c - 1. Let a(x) = sl(x) - 4m(x). What is a(-2)? 11 Let h = 0 - 6. Let g(c) be the second derivative of -c*4/12 - 2c*3/3 + 5c*2/2 + 108c. What is g(h)? -7 Let q(b) be the third derivative of -b*4/24 + 5b*3/3 + 2b*2. Let d be q(7). Let n(m) = 2m - 2. What is n(d)? 4 Suppose -w - 4 = w. Let d(p) = p - 2. Give d(w). -4 Let d(t) = t - 2. Suppose 12 = 5o - 8. Let j = o + -3. Determine d(j). -1 Let u(n) = -n2 - 6n - 4. Suppose d + 0d = -1, 4s + 4d = 0. Let b be (4 - s - 2) + 1. Suppose -bj = 1 + 9. Calculate u(j). 1 Let x = -50 - -44. Let r(k) = -k + 3. What is r(x)? 9 Let i(l) = 6l3 + l2 - 4l + 2. Let p(w) = w3 + w2 - w. Let r(d) = i(d) - 5p(d). Let n = 12 - 7. Let y = 9 - n. What is r(y)? 6 Let t(z) be the first derivative of z2/2 - z + 1. Let k be t(7). Let f(y) = -y - 4. Let a(p) = 2p + 9. Let j(h) = ka(h) + 13f(h). Give j(2). 0 Let x = 58 + -61. Let h(r) = r*2 + 3r - 2. Calculate h(x). -2 Let h(c) = -c*3 - 7c2 + 6. Let f(j) = -j3 - 5j2 - j - 12. Let l be f(-5). Calculate h(l). 6 Let c(b) = -b3 - b + 1. Let f(n) = 7n*3 + 2n*2 + 6n - 5. Let g(u) = 6*c(u) + f(u). Calculate g(-3). -8 Let v(c	{ "pile_set_name": "DM Mathematics" }
Let n be c(3). Solve 5z - n = 4 for z. 1 Suppose 17 = z + 24. Let r(w) = w + 7. Let q be r(z). Solve -3k - k + 16 = q for k. 4 Let n = 89 - 89. Suppose nb = -b + 2. Solve bv = 3v - 2 for v. 2 Let n be (1/2)/(2/(-156) - 0). Let h = n + 48. Solve -hv + 13v = 0 for v. 0 Let k = 12 + -6. Let z = 5 + -9. Let d = z + k. Solve 2y = -dy for y. 0 Suppose -5q = -25, 4i - i - q = -5. Solve -5x + 5 = -ix for x. 1 Suppose -4l - 5 = -5l. Let w(i) = -5i*2 - 59i*3 + 31i*3 - 2i + 29i3 + 10. Let z be w(l). Solve z = 4d + 2 - 14 for d. 3 Let b = -175 + 326. Let n = b + -145. Suppose 0 = -5s + 2i + 9, -2s + 3i + 9 = 1. Solve n = -5f + s for f. -1 Suppose -89g = -471 - 419. Let b(s) = -10s3 - 2s*2 - s. Let o be b(-1). Let f = o - 6. Solve g = -fh + 4 for h. -2 Let v be (-1)/(-3(-4)/12). Let u(r) = -5r*3 + 2r*2 + r. Let s be u(v). Suppose -sb = -5b + 4x - 28, -b = -x - 3. Solve 4l + b = -0l for l. -2 Let q(s) = -3s3 + 6s*2 - 3s + 6. Let t(y) = 2y3 - 6y*2 + 4y - 5. Let c(w) = -3q(w) - 4t(w). Let m be c(-7). Solve a - m = -3 for a. -1 Let v be 4/10 - (17/5 + -4). Let q be (-5)/3 + (-2)/6. Let p be ((-8)/(q - 2))/v. Solve -pd + 1 = -d for d. 1 Suppose -2d = 3h + 61, 0 = -4h + 2h + 2d - 54. Let n = h - -33. Suppose 6a + n = 11a. Solve -10 = -3z - az for z. 2 Let q(u) = -u*3 + 4u*2 - 2u + 11. Let m be q(4). Suppose w - 2w = -mv + 4, -2v + 4 = 0. Solve 3 = wj + 1 for j. 1 Let r = 826 + -821. Let o be (-1)/(2(-3)/12). Solve -os - 9 = -rs for s. 3 Suppose -7r - 10r = -11r. Solve r = -10m + 5m - 20 for m. -4 Suppose 5g + 10 = 0, -h - 4h = 5g - 40. Suppose 11r - h = 6r. Solve -rt - 3t = 10 for t. -2 Suppose 4c = 5c + 3. Let f = 0 - 2. Let x be (c - -3) + f + 2. Solve x = -5u - 0u - 10 for u. -2 Suppose s - 1 = -0s. Suppose -2g + 3c + 4 = c, -4c = -g - s. Solve i + 4 = gi for i. 2 Let l = 2152 - 2116. Solve -33i + l = -24i for i. 4 Let y be (8/(-6))/((-2)/6). Suppose -s = -5s + 32. Let w = s - y. Solve 4i - w + 20 = 0 for i. -4 Let l(i) = -11i + 102. Let k be l(8). Solve d + 13 = kd for d. 1 Let n be -104((-165)/(-22))/(-15). Solve 23w - 10w - n = 0 for w. 4 Let n(r) = -5r*2 + 12r*2 - 2r*2 - 2 - 2r*2 - 4r. Let b be n(2). Solve bp - 4 + 0 = 0 for p. 2 Let i be 277 - (4 - 1)/(-1). Let k be (-3)/2i/(-42). Solve 6g = g + k for g. 2 Let c be ((-120)/330)/(3/(-33)). Solve -ci - 20 = i for i. -4 Suppose 0 = -4c - 2i + 18, -c + 3i + 0i - 13 = 0. Let g be (2 + 1)5/5. Suppose 37 - 7 = gr. Solve -r = cb - 0b for b. -5 Let x be (2 - 4)/((-2)/(-3)). Let g be 1/(((-1)/4)/(x + 2)). Solve -10 = s + gs for s. -2 Suppose 0 = -2u - 0u. Let l(q) = -4q*2 - 9q + 15. Let f(c) = -3c2 - 10c + 17. Let g(a) = 5f(a) - 4l(a). Let z be g(13). Solve -3b - z = -ub for b. -4 Let w be 0/1 + -1 + 4. Suppose -160 = -4z - 144. Solve f - w = -z for f. -1 Let x(f) = f3 - 7f*2 - 7f - 2. Let l be 5/3(-156)/(-130). Suppose 4d - t - 28 = 0, -lt - 16 = d - 4d. Let b be x(d). Solve 6 = 3s - b for s. 4 Let p(o) = -4o - 4 + 6o - 7o + o2. Let b be p(6). Solve -y = b + 2 for y. -4 Let j(d) = d2 - 17d + 4. Let w be j(0). Solve 0i = -wi for i. 0 Let a(t) = -t3 - 14t*2 + 6. Let c be a(-14). Solve -2m - cm + 24 = 0 for m. 3 Let o(d) = 48d - 133. Let k be o(3). Solve -45 = 17t - k for t. -2 Let l = 9 + -7. Solve 0 = -lo - 0 + 6 for o. 3 Suppose 7b = -3u + 2b - 12, 5u + 20 = b. Let s(o) = 4o2 + 14o - 5. Let q be s(u). Solve 2t + q = -5 for t. -4 Suppose 1 = 2o - 0i + 3i, -4o + 3 = 5i. Suppose 1506c = 1509c. Let u be (-4)/(-2) - (0 - -1). Solve c = -oj - u - 1 for j. -1 Let q(k) = -7k + 1. Let z be q(-11). Let i = -71 + z. Solve -20 = -iy + 3y for y. 5 Suppose 0 = 5p + 3d, p + 0d = 2d. Let a = p - 2. Let v be (-1)/a4 - 1. Solve v = l - 2 for l. 3 Suppose -5c + 64 = -2y, 5y + 114 = -3c - 108. Let w = y - -47. Solve -19 = wj - 4 for j. -3 Let q be (-36)/(-90) - (1 + 96/(-10)). Solve qf - 14 = 2f for f. 2 Suppose -3y - 2y = 5p + 100, 0 = -3y + 4p - 88. Let i be -40(-4)/y-3. Let m = i + -9. Solve 0 = -4j - m - 9 for j. -5 Let r = -1296 + 1317. Solve 6x - 3 = -r for x. -3 Suppose -7r + 4r + 141 = 0. Let q be 5/((-45)/2) + r/9. Solve 0 = 7v - 8v - q for v. -5 Suppose 4d + 6l - l - 13 = 0, -3d + 3l = -30. Suppose dy = 2 + 12. Suppose yh - 3 = 1. Solve -k = -hk for k. 0 Let o be (6/4)/(6/52). Solve -oq = q for q. 0 Let t be (-3 - (-2 - 1)) + 4/2. Let h be (3 - 0)/((-6)/(-4)) + t. Solve 10 = -ha + 6 for a. -1 Let l = 133 - 133. Solve l = -v + 1 - 2 for v. -1 Let j(l) be the first derivative of l*3/3 + 4l*2 - 16l + 15. Let d be j(-10). Solve -2 = -2v + d for v. 3 Let c be (-10 - -9)(-1 - 2). Solve -2b + c = b for b. 1 Let d be (35/(-14))/((-1)/2). Suppose df - f = 8. Solve 1 = -fu - 3 for u. -2 Let r(t) = t3 + 2t + 3. Let k be r(0). Suppose 3l + 0x = 4x + 5, -3l + 5x + 4 = 0. Suppose 5g = 4q - 0 + k, 4g - 3q = l. Solve i + 2 + g = 0 for i. -5 Suppose z + 65 = 2z. Suppose -20 + z = -5a. Let l(y) = -y2 - 11y - 11. Let o be l(a). Solve 5 = -og + 2g for g. -1 Let n = 0 - -3. Let o = -176 + 177. Suppose -o = -np + 23. Solve 8 = pb - 4b for b. 2 Suppose -3h + 1 = 2o, 2o - 8h + 3h = 9. Solve 3z - o = 1 for z. 1 Let o = -694 - -697. Solve 3g = -og for g. 0 Let i(d) = d2 - 15d + 18. Let o be i(10). Let u be 1 + 15/(-12) + (-104)/o. Solve -4v - u = -v for v. -1 Let i = -7 - -20. Suppose -2t = 2p + 1 + 1, 6 = -4p - 3t. Let j be 21/9p/(-1). Solve -i = -4u + j for u. 5 Let r be (-1 + -51)(-2464)/264. Solve -47 = -3i - r for i. -3 Let x(o) = o*3 - 7o*2 - 31o + 198. Let i be x(8). Solve -8a - 54 = -i for a. -5 Suppose -4o = 16, 5n - o + 6o = 120. Let c = n - 19. Solve -s = 2s + c for s. -3 Let r = 21 - 11. Let u = 86 - 54. Suppose 5a - 5 = 2t - 0t, u = 4t + 4a. Solve 0f = tf - r for f. 2 Let l(r) = -r*2 + 4r + 4. Let x be l(4). Let n = 140 - 137. Solve -xt - n - 17 = 0 for t. -5 Suppose -5d - 2d = 42. Let p be (6/9)/2 - (-2)/d. Solve 0 = -py - 2y + 10 for y. 5 Let j(r) = 2r*2 - 3r. Let c(s) = s*3 + 7s*2 + 3s - 8. Let m be c(-6). Suppose 3p - 10 = a, 4p - m = 2a + a. Let u be j(p). Solve -4h - h = u for h. -4 Let j be -2 + (-16)/(-2 - 2). Suppose -jk = k - 30. Suppose n - 2 = -i - 3i, 5n = -5i + k. Solve l = -il + 4 for l. 4 Let f be (-1)/(-4) - (-7)/4. Suppose -8h + 518 = -122. Let c = h - 74. Solve -12 = fb - cb for b. 3 Suppose -130l + 124l = -180. Solve -4u + l = -10u for u. -5 Let d be (30/(-8))/(26/(-104)). Let g = 34 - 26. Solve 0 = gu - 3u + d for u. -3 Suppose -4c + 3 = 2t + 5, -2t + 5c = 11. Let d be (-6)/(-3) - 5 - t. Solve k + 0 - 3 = d for k. 3 Suppose -4a + 2z + 12 = 0, 7z = -3a + 5z + 16. Let n be (3/a)/(3/12). Let k(c) = -2c - 1. Let y be k(-1). Solve -4 = nh - y for h. -1 Suppose 4n - 7n = 0. Suppose n = -9t + 8 + 1. Solve 4 = -b + t for b. -3 Let m(p) = -p*2 + 6p + 9. Let i be m(7). Let j = 118 + -115. Suppose jg = -4g + 14. Solve 0 = gl + il for l. 0 Let j = 17 - 15. Let a(k) = -k*2 - 6k - 2 + 18k - 4. Let g be a(11). Solve -g = -jw - 15 for w. -5 Let n = -4 - -7. Suppose 43 = -4t + l, 32 = -3t - 0l + l. Let d be t/(-7) - (36/28)/(-3). Solve -d = -nh + h for h. 1 Suppose -12l = -15l + 207. Suppose 3i = -3p + 39, 5i = -5p + i + l. Solve -5f + 3 = -p for f. 4 Let t be (-8)/480/(-2). Solve t = r + 3 - 0 for r. -3 Let f = 3233 - 3176. Solve f - 30 = 9b for b. 3 Suppose 40q - 31 = 39q + 5b, -3q = -2b - 28. Solve qz - 9 = 9z for z. -3 Suppose 0 = -22v + 24v - 14. Let q be (0 - -3)1/3. Solve -vc - q = -6c for c. -1 Let u be 6/(-10) - (-247)/95. Solve -uj = -3 + 1 for j. 1 Let r(d) = -d*2 - 4d - 2. Let x be r(-6). Let z(p) = p*3 + 14p*2 + p + 15. Let o be z(x). Let v be (1 + -1)/(1 + o). Solve v = -m + 3m for m. 0 Let p = -2682 + 2693. Solve p = 2m + 1 for m. 5 Let o = -447 - -448. Solve -9w + 46 = o for w. 5 Let s(g) = -9g2 - 9g - 14. Let o(t) = -5t2 - 4t + 0 - 5 - 2. Let f(i) = -11o(i) + 6s(i). Let n be f(11). Solve -4c = -6c + n for c. 2 Suppose -j + 273 = 4v, v - 4j = -7j + 82. Solve -68d = -vd for d. 0 Suppose -j = 3j - 12. Suppose -n	{ "pile_set_name": "DM Mathematics" }
/11) Simplify (p*3p/p(-2))(-3/4) assuming p is positive. p*(-9/2) Simplify (((m/(mmm(-1/7)))/m)/mm)/(m/((m/(mmm*4/m))/m)m)(m1)(-2/45) assuming m is positive. m(-2804/315) Simplify (w/w(-6/7))/(w4/w) assuming w is positive. w(-8/7) Simplify q(-11)/(qq/q(-13)) assuming q is positive. q(-26) Simplify (r/((rr/((r/r(-2))/r)r)/r))/r*2(r/(rr/(rr*(-1))r))/(r(-5)/r) assuming r is positive. r3 Simplify ((r(-2)/r)/r)(-11/7)rr*4r(-3) assuming r is positive. r(58/7) Simplify (hh(4/11))/h11 assuming h is positive. h(-106/11) Simplify m(2/35)/m(3/4) assuming m is positive. m(-97/140) Simplify ((gg*(6/11)g)/g)/(gg/(g(2/19)/g)) assuming g is positive. g(-282/209) Simplify (ii/(iii(-3)))(-27) assuming i is positive. i(-81) Simplify (r7/(((rr6r)/r)/r))13 assuming r is positive. r13 Simplify (((tt/(t/t(-28)))/t)/t)34 assuming t is positive. t(-986) Simplify (n/(n(nn(-1/4)n)/n))*(-1/30)/(n/(nnn/(nn*(-1)/nn)))(-1/20) assuming n is positive. n(-3/40) Simplify (k2)(-2/51)/(k*6k(-6)) assuming k is positive. k(-4/51) Simplify ((y/y*(-1/4))/y)/(yy/(yy1))y(y/(y((yy(-2/5))/y)/y))/yy/(y/y*4)y assuming y is positive. y(133/20) Simplify x(7/2)/(xx1x) assuming x is positive. sqrt(x) Simplify ((q/(q*(-2)q))26)(7/5) assuming q is positive. q(364/5) Simplify y(-10)yy*(1/15)yy assuming y is positive. y(-104/15) Simplify ((x(-2/9))(-2/61))(3/43) assuming x is positive. x(4/7869) Simplify (c(-2/9)c*(-1/11)c)/((c/(cc5))/(c(-1/3)ccccc)) assuming c is positive. c(1025/99) Simplify d6dd(dd*(7/9))/dd assuming d is positive. d(88/9) Simplify s(-6/11)s(-19)/s assuming s is positive. s(-226/11) Simplify (t/(t(ttt*(-2/11)t)/t)t6)(-1) assuming t is positive. t(-46/11) Simplify (((aaa/a(4/7)a)/a)/a)(-2/53) assuming a is positive. a(-20/371) Simplify (hh8)(-12/7) assuming h is positive. h(-108/7) Simplify z2/z(zz0zz)/z(z(-1))(-3/16) assuming z is positive. z*(51/16) Simplify gg*(-1)gggg(-8) assuming g is positive. g(-5) Simplify ((ll/((l/(ll/((l(3/4)/l)/l)))/l)l)/(l/(l/(((l/l*(-1/8))/l)/ll))))(-14/5) assuming l is positive. l(-343/20) Simplify i(-10)/(i5/i) assuming i is positive. i(-14) Simplify (u(2/7)u)(-36)(u(u/(u(1/3)/u))/uu)(4/3) assuming u is positive. u(-2692/63) Simplify (yy(-14))/(y(yy(-1/3))/yy) assuming y is positive. y*(-44/3) Simplify ((k/(kk*(5/4)))/kk)/(kk(-6)/kk) assuming k is positive. k(15/4) Simplify (c/(c/((c(1/5)/c)/c)))30 assuming c is positive. c(-54) Simplify (p(3/11)/p)/p(-11) assuming p is positive. p*(113/11) Simplify ((ii(i/(ii*0/i)i)/ii)/i)(11/2)(i(2/3))(-37) assuming i is positive. i(-49/6) Simplify (g(-4)/(g/g(1/5)))(-2) assuming g is positive. g(48/5) Simplify (u(-2/3))(-23)/(u(-1)/u(-1)) assuming u is positive. u(46/3) Simplify ((vv(2/11)v)/(vv(1/2)))/(v1v(-11/3)) assuming v is positive. v(221/66) Simplify (z*(-1)zz)(-2/19)z*(2/7)/(zz(-3/4)) assuming z is positive. z(-37/532) Simplify p(-2/75)/p(5/6) assuming p is positive. p*(-43/50) Simplify (dd*5)/(ddd/d(-1))(d(-1))41 assuming d is positive. d*(-39) Simplify (aa/a*0a)*26(a/(((a(1/2)/a)/a)/a))/a(4/7) assuming a is positive. a(1133/14) Simplify (((h1/h)/h)(-9/7))(6/13) assuming h is positive. h(54/91) Simplify y(-5/9)/(y/(y*(-15)/y)y) assuming y is positive. y(-167/9) Simplify m6/(m*(2/107)m) assuming m is positive. m(533/107) Simplify (n2)(2/53) assuming n is positive. n(4/53) Simplify (j*(1/14)j)/j(-14) assuming j is positive. j(211/14) Simplify ii(-34)ii/i(-1/5) assuming i is positive. i(-154/5) Simplify (n5nnnnn/(nn(-16)/n)n)(-50) assuming n is positive. n(-1350) Simplify (z*8/((z/(zz/(z/(z*(-1/3)z)z)))/z))31 assuming z is positive. z(806/3) Simplify ((l(-1)/l)(-5))(-5/9) assuming l is positive. l(-50/9) Simplify z(-3/10)z*(-2/19)(z(2/7))(1/3) assuming z is positive. z*(-1237/3990) Simplify j/((jj*(-25))/j)j/j5 assuming j is positive. j22 Simplify ((yy/(y/(y/(y3y))))/y*(-6))/((y/(yy/y*(-3/2)))/yy(-4)) assuming y is positive. y(23/2) Simplify g/(ggg*18)g(-29) assuming g is positive. g(-48) Simplify l22/l(4/17) assuming l is positive. l(370/17) Simplify ((v(-13)/v)/v)29 assuming v is positive. v(-435) Simplify (h(-1/21)/h)/(h(-2/7)/h) assuming h is positive. h(5/21) Simplify (u(16/5))(-31) assuming u is positive. u(-496/5) Simplify u*(-1)u*(-5/6)(uu(-2)u)(4/3) assuming u is positive. u(-11/6) Simplify (zz(-1)zz)(-25) assuming z is positive. z(-50) Simplify (j/(j/(j/(j/j(-25))jj))j)/jj(jj(-4/3))/j assuming j is positive. j(-70/3) Simplify ((((s(-2/5)s)/s)/s)/s)/ss(1/4)(s*(-4)s)/((((s/(s/(ss/((s(sss*(2/7))/ss)/s)))s)/s)/ss)/s) assuming s is positive. s(-681/140) Simplify u13/(u/(u(-11/3)/u)) assuming u is positive. u(22/3) Simplify (vv(-33))(11/9) assuming v is positive. v(-352/9) Simplify (p(-1/2))(1/58) assuming p is positive. p(-1/116) Simplify (c(cccccc(1/21)cc)/c)/(c/(c(-2/7)c)) assuming c is positive. c(142/21) Simplify (f(2/109)/f)/f(15/2) assuming f is positive. f(-1849/218) Simplify ((i/(ii(2/3)/i))/i)(-40)((i(-2)/i)/i)(1/3) assuming i is positive. i(76/3) Simplify i/i7i/i(-1/2)i((i1/i)/i)(-29) assuming i is positive. i(51/2) Simplify ((s(2/11))(-29/3))24 assuming s is positive. s(-464/11) Simplify m/(((m/m(-2/19)m)/m)/mmm)m/m(-15) assuming m is positive. m(283/19) Simplify (((ff/(ffff/f1f)f)/f)/f)(-8/3)ff(-5)(f*4f)/f assuming f is positive. f8 Simplify (f(-3))*(-23)f*(-6/7)/(f(ff(-1/11)f)/f) assuming f is positive. f*(5100/77) Simplify ((pp(3/4)/p)/p(-4))(-3/4) assuming p is positive. p(-57/16) Simplify (p/p*(1/2)pp(-2/7))/((pp/(ppp*5pp))/(p(-6)/p)) assuming p is positive. p(17/14) Simplify (c0/(c/((c/((c/c(-4/5))/c))/cc)))/(((c/c(1/4))/c)/c)36 assuming c is positive. c(221/5) Simplify c(2/27)c/((c/(c6/c))/c)((ccc*7/c)/c)/(c/(c/((cc*0/cc)/cc))) assuming c is positive. c(326/27) Simplify (t/(ttt(-1/3)/t)t)/ttttt21 assuming t is positive. t(73/3) Simplify (m*(5/3)(m*5m)/mm)/((m/m(-1))/(mm/(mm(-4)/m)m)) assuming m is positive. m(38/3) Simplify (t(1/4))(-18/7)/(t5t(3/4)/t) assuming t is positive. t(-151/28) Simplify ((ff(4/3))/f(1/12))(-1/2) assuming f is positive. f(-9/8) Simplify (((ff(1/5)f)/f)/f(-8))(-2/11) assuming f is positive. f(-92/55) Simplify (t(-3)t(-7))/(t(t*8t)/ttt(-3)) assuming t is positive. t(-17) Simplify (a*(-1/4)aa(-4))/(aaa(-2/7)/a)(-2/13) assuming a is positive. a(-1143/364) Simplify (s(6/7))(-7) assuming s is positive. s(-6) Simplify (uuuu(u13u)/uuu(-9))(-2/31) assuming u is positive. u(-18/31) Simplify m(-23)/mm(-3/4) assuming m is positive. m(-99/4) Simplify f(4/3)/f(-1/9)(f/(f(f/f2)/f)f)(2/3) assuming f is positive. f(31/9) Simplify g6/(g(-39)g) assuming g is positive. g44 Simplify (h1)16/((h(-1)h)/hhh*(1/8)hh) assuming h is positive. h(111/8) Simplify g20ggg*1g assuming g is positive. g24 Simplify (y6)(-2) assuming y is positive. y(-12) Simplify (m*13m)/(m/m(10/7)) assuming m is positive. m(101/7) Simplify (i9)(2/3) assuming i is positive. i*6 Simplify ((h/(hh/h*(-2/29)h))/(hh11h))(2/121) assuming h is positive. h(-874/3509) Simplify (f/f8)(-34) assuming f is positive. f*238 Simplify (b/(bb(1/4)))(1/6)b3/(bb(-2/21)) assuming b is positive. b(115/56) Simplify (x(-3/4))22 assuming x is positive. x*(-33/2) Simplify ((m/(mm(-1/6)/m))/(m(-12)/m))(-8/7) assuming m is positive. m(-340/21) Simplify (tt(-1))30(t/(t(-1/3)/t))(-18/13) assuming t is positive. t*(-42/13) Simplify ((ll(ll(2/3))/l)50)**(-2/19)	{ "pile_set_name": "DM Mathematics" }
127, 62, 2, -2/9, -8 Put -21, 0, 1, -3, 4, 7672, -2 in descending order. 7672, 4, 1, 0, -2, -3, -21 Put -3, 24.6, -0.2, 0.8, 3 in ascending order. -3, -0.2, 0.8, 3, 24.6 Sort -5, 2218/639, 0.5, 0.3, 4 in increasing order. -5, 0.3, 0.5, 2218/639, 4 Sort 45675237, -1, 1 in descending order. 45675237, 1, -1 Sort -5715.172, 0.1, -0.5 in descending order. 0.1, -0.5, -5715.172 Sort -4, 3, -3, 4, -8447, 54, 2. -8447, -4, -3, 2, 3, 4, 54 Sort 2, -5, 774710, 1. -5, 1, 2, 774710 Put -4/33, 4/3, -53.5, -4 in decreasing order. 4/3, -4/33, -4, -53.5 Put 1/171, -1647/4, -19 in decreasing order. 1/171, -19, -1647/4 Sort 470572, -4, 3, -3 in decreasing order. 470572, 3, -3, -4 Sort 0.034, -71064, -13 in decreasing order. 0.034, -13, -71064 Put 65, -4, -117, 260, -7 in increasing order. -117, -7, -4, 65, 260 Put -18, -1, 1, 294, 30, 4, 2 in ascending order. -18, -1, 1, 2, 4, 30, 294 Sort -4/5, -40, 0.7, -0.25, 160, 0 in increasing order. -40, -4/5, -0.25, 0, 0.7, 160 Sort 18, 46, 3, 97, 8, 2 in ascending order. 2, 3, 8, 18, 46, 97 Put -238, -1, 499, -7, 3, 2 in increasing order. -238, -7, -1, 2, 3, 499 Sort 5, 84, -4, 4, 14, -26 in increasing order. -26, -4, 4, 5, 14, 84 Sort -4, 4, -817699 in ascending order. -817699, -4, 4 Sort -2, 2, -10, 757, -5, -180 in decreasing order. 757, 2, -2, -5, -10, -180 Sort -18, 2, 4, 125, 581 in descending order. 581, 125, 4, 2, -18 Sort -21, -2, -3, 47, 5, -8, -49. -49, -21, -8, -3, -2, 5, 47 Sort 137, -14, 5, 2, -90, 1. -90, -14, 1, 2, 5, 137 Sort 4/3, 4, -554, 0.1, -196 in descending order. 4, 4/3, 0.1, -196, -554 Put 3, -41, -4, -3, -475 in ascending order. -475, -41, -4, -3, 3 Sort 0, 11, 85, 72, -2, -3 in increasing order. -3, -2, 0, 11, 72, 85 Sort 1200, -65, 5, 0 in descending order. 1200, 5, 0, -65 Sort -5, -1, 1033, 252, 5 in decreasing order. 1033, 252, 5, -1, -5 Put -0.005, -5, -3, 22, 415 in descending order. 415, 22, -0.005, -3, -5 Put 5, 3, -4, -180766, 4 in ascending order. -180766, -4, 3, 4, 5 Sort 0, 11, 859, 24 in decreasing order. 859, 24, 11, 0 Sort -15, 0, 43, 5, -5, 1 in descending order. 43, 5, 1, 0, -5, -15 Sort 5, 55, -2, 6, 99, 0, -6 in decreasing order. 99, 55, 6, 5, 0, -2, -6 Sort 24, 2, 5, 310, 4, -3. -3, 2, 4, 5, 24, 310 Sort -2, 4, 297, 231. -2, 4, 231, 297 Sort -26, 3/5, 2, -2/9, -1753/14 in increasing order. -1753/14, -26, -2/9, 3/5, 2 Put -5, 1, -2/8104921 in increasing order. -5, -2/8104921, 1 Sort -483, -1/3, 0.5, 1, -1074 in decreasing order. 1, 0.5, -1/3, -483, -1074 Put -4, -625, 157543 in ascending order. -625, -4, 157543 Sort 4, -9, -5, -1, 389, 22. -9, -5, -1, 4, 22, 389 Sort 1, -1, -50, 2079, 1/2, 1/12 in descending order. 2079, 1, 1/2, 1/12, -1, -50 Sort -0.5, 3, -5, 0.03, -7, 5/2 in descending order. 3, 5/2, 0.03, -0.5, -5, -7 Put -7, 0, 19, -12, -1, -5, 17 in increasing order. -12, -7, -5, -1, 0, 17, 19 Sort 2, -0.3, 5, 48, 13970, -1 in descending order. 13970, 48, 5, 2, -0.3, -1 Sort 242, -3, -5260, -5 in increasing order. -5260, -5, -3, 242 Put 4/5, 5, 0.22, 17755 in ascending order. 0.22, 4/5, 5, 17755 Sort 21775, -547, 1, -3, 3 in decreasing order. 21775, 3, 1, -3, -547 Sort 4, -1, -11967, 14, 1 in descending order. 14, 4, 1, -1, -11967 Put -15, 5, -2, -3, 71, 17 in decreasing order. 71, 17, 5, -2, -3, -15 Put 3, -266, 355993 in decreasing order. 355993, 3, -266 Sort 5, -1, -166197, 4. -166197, -1, 4, 5 Sort -303164, 4, -3 in descending order. 4, -3, -303164 Sort 37, 0, 1, 9, 715 in ascending order. 0, 1, 9, 37, 715 Sort 1/4218995, -2/9, -3, -4 in increasing order. -4, -3, -2/9, 1/4218995 Sort 1/17, -2, 276.644 in ascending order. -2, 1/17, 276.644 Put 0.1, -5, -21991, -0.3, 2, -0.2 in increasing order. -21991, -5, -0.3, -0.2, 0.1, 2 Put -15831548, 12, 2 in increasing order. -15831548, 2, 12 Sort 195, -1, 0, 0.1, 25. -1, 0, 0.1, 25, 195 Put 3, 7, 0.0114, 0.07, -1 in ascending order. -1, 0.0114, 0.07, 3, 7 Put 3, -129, -4/5, 1.1, 4, -3/7 in decreasing order. 4, 3, 1.1, -3/7, -4/5, -129 Sort -5, 1, -6, 493781. -6, -5, 1, 493781 Sort -1519, 0.2, 211 in ascending order. -1519, 0.2, 211 Sort 28, 71, 642, 1, 4, 3. 1, 3, 4, 28, 71, 642 Sort 5, 4, 0, 2/73, -5, -2/9. -5, -2/9, 0, 2/73, 4, 5 Sort -4770, 67, 3, 5, 6, 1, -5. -4770, -5, 1, 3, 5, 6, 67 Put 0, -2, -11494, 2, 49, 1 in decreasing order. 49, 2, 1, 0, -2, -11494 Sort 102/25, 1, 96, 76 in ascending order. 1, 102/25, 76, 96 Put 183, 4, -0.3, -4, 1.3 in ascending order. -4, -0.3, 1.3, 4, 183 Sort 8, 4, 6, -97, 695. -97, 4, 6, 8, 695 Sort -200, 0.0615, 0.5, 4, 0.04 in decreasing order. 4, 0.5, 0.0615, 0.04, -200 Sort 5, -1, 1, -9, -3, -91 in ascending order. -91, -9, -3, -1, 1, 5 Put 3, -0.2, -11670.343, 1/2 in increasing order. -11670.343, -0.2, 1/2, 3 Put 2, 5/4, -321, -0.07, 2/21 in ascending order. -321, -0.07, 2/21, 5/4, 2 Put 0, 2/11, -13, 0.4, -3, -29, 5 in descending order. 5, 0.4, 2/11, 0, -3, -13, -29 Put -1, -13, -17, 8, 20 in decreasing order. 20, 8, -1, -13, -17 Put -1, 635, 0.9, 2.1 in decreasing order. 635, 2.1, 0.9, -1 Sort -947269, -7, 5 in increasing order. -947269, -7, 5 Sort 114, -317, -0.5, 1.1 in increasing order. -317, -0.5, 1.1, 114 Sort -2/5, 702.7, 0 in descending order. 702.7, 0, -2/5 Put 1, -4, -286, -2, -790 in decreasing order. 1, -2, -4, -286, -790 Put 4, 175, -4, 12, 0, 2, -9 in descending order. 175, 12, 4, 2, 0, -4, -9 Sort 4, 36, 111, 5, 3, -10 in increasing order. -10, 3, 4, 5, 36, 111 Sort -1, -5, 18, -1342 in ascending order. -1342, -5, -1, 18 Sort 49555, -1/46, 0.4, 2. -1/46, 0.4, 2, 49555 Sort 4.82, 36, -14/9, 8, -0.1, 0. -14/9, -0.1, 0, 4.82, 8, 36 Put -1, -7, 2562, -5, -22, -4 in ascending order. -22, -7, -5, -4, -1, 2562 Put 55517, 2, -0.03, 0.3, 0.4 in decreasing order. 55517, 2, 0.4, 0.3, -0.03 Put -367, 1, -0.06, -1/4, -11, 0.1 in descending order. 1, 0.1, -0.06, -1/4, -11, -367 Sort -138, 922, 402. -138, 402, 922 Put 10, 0.2, -16, -2, -0.1, 3, 0 in increasing order. -16, -2, -0.1, 0, 0.2, 3, 10 Sort -4, -47, -32917 in increasing order. -32917, -47, -4 Sort 31/11, -5, 0.2199, 0.17 in decreasing order. 31/11, 0.2199, 0.17, -5 Put -2/7, 0.1, 338, -50, -5, 158 in increasing order. -50, -5, -2/7, 0.1, 158, 338 Put -234, 2, 129556 in decreasing order. 129556, 2, -234 Sort 1, -2, -7, -1, -180, -5, 191 in decreasing order. 191, 1, -1, -2, -5, -7, -180 Sort 1/19, -70, 0, 2/7, -4 in decreasing order. 2/7, 1/19, 0, -4, -70 Put -0.5, 0.42, 0, 3/5, -4, 54 in descending order. 54, 3/5, 0.42, 0, -0.5, -4 Put 5, 2264, 21, -3, 3 in ascending order. -3, 3, 5, 21, 2264 Sort 25436, 7, 0.0239 in descending order. 25436, 7, 0.0239 Sort -961, 3, -1, -212. -961, -212, -1, 3 Sort -112, 4, -12, -1, 10, 0, 42 in descending order. 42, 10, 4, 0, -1, -12, -112 Sort -17, 10238, -4. -17, -4, 10238 Put 3, 7, -5, 18, -4, -156 in descending order. 18, 7, 3, -4, -5, -156 Put 17687, -5, 0, 1 in decreasing order. 17687, 1, 0, -5 Sort -5, 17, -20, -1, -71. -71, -20, -5, -1, 17 Put -31.79, 5, 0.1, 130, -2, -0.1 in ascending order. -31.79, -2, -0.1, 0.1, 5, 130 Sort 1, -0.265, -4244, 0.3. -4244, -0.265, 0.3, 1 Sort -2, 426, -16, -3, 43, 20 in decreasing order. 426, 43, 20, -2, -3, -16 Put -3, 144, 53, -85, -4 in decreasing order. 144, 53, -3, -4, -85 Sort 8, -168, -2, -1, -3, 11, 2 in descending order. 11, 8, 2, -1, -2, -3, -168 Sort -3190, -28, -2, 2, 7 in descending order. 7, 2, -2, -28, -3190 Sort 24.9, 1.961, 3. 1.961, 3, 24.9 Put -0.02, -1, -415, -155, 1 in ascending order. -415, -155, -1, -0.02, 1 Sort -49.73, -3, 2, 1, 3, -1.6 in decreasing order. 3, 2, 1, -1.6, -3, -49.73 Sort -1679, 2, -4, -17, -6, -3, 3. -1679, -17, -6, -4, -3, 2, 3 Put 93033, 4, -1, -5, 0 in decreasing order. 93033, 4, 0, -1, -5 Sort -3, 3, 129, -5, -144, -4 in descending order. 129, 3, -3, -4, -5, -144 Sort 2417.8, -432, -0.4, -2. -432, -2, -0.4, 2417.8 Put -71/87, -23, -3/8, 4 in descending order. 4, -3/8, -71/87, -23 Sort 5, 543, -6, 1, 4, 41 in descending order. 543, 41, 5, 4, 1, -6 Put -4, 52, 2, 1, 68, -1, 7 in increasing order. -4, -1, 1, 2, 7, 52, 68 Sort -153, 529, 0. -153, 0, 529 Sort 841, 0, -2, 4, -26, -3, -5. -26, -5, -3, -2, 0, 4, 841 Sort -14, -431, -15, -87 in decreasing order. -14, -15, -87, -431 Put 0.1, -0.1, 72, -5, -31.3, 3 in descending order. 72, 3, 0.1, -0.1, -5, -31.3 Put -1, 0, -1034, -5, -2, 7, 6 in decreasing order.	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.