Datasets:
orafandina
/
wiki_long_600k

Dataset card Data Studio Files Community
1
text
stringlengths
1
383k
input_ids
sequence
token_type_ids
sequence
attention_mask
sequence
The 2021–22 Odisha Women's League is the 9th edition of the Odisha Women's League, the top Odia professional football league, since its establishment in 2011. Rising Students Club are the defending champions. The league is organised by the Football Association of Odisha (FAO), the official football governing body of Odisha, in association with the Department of Sports and Youth Services (DSYS) of the Government of Odisha. On 10 February 2022, the jersey launch ceremony for the 2021–22 season was held in the presence of Principal Secretary of the Department of Sports and Youth Services, Vineel Krishna, and the Honorary Secretary of the Football Association of Odisha (FAO), Avijit Paul, at the Kalinga Stadium. The captains and vice-captains of the six participating teams were also present during the jersey launch ceremony. On 12 February 2022, Sailendra Kumar Jena, Joint Secretary of the Department of Sports and Youth Services and the guest of honour for the Opening Ceremony, declared the season open. Teams Personnel Standings References Sports competitions in Odisha Ind 1
[ 101, 1109, 17881, 1475, 782, 1659, 24314, 2453, 112, 188, 1453, 1110, 1103, 5612, 2596, 1104, 1103, 24314, 2453, 112, 188, 1453, 117, 1103, 1499, 152, 7168, 1848, 1709, 2074, 117, 1290, 1157, 4544, 1107, 1349, 119, 11948, 6510, 1998, 1132, 1103, 6611, 5461, 119, 1109, 2074, 1110, 6967, 1118, 1103, 2289, 1791, 1104, 24314, 113, 6820, 2346, 114, 117, 1103, 2078, 1709, 9042, 1404, 1104, 24314, 117, 1107, 3852, 1114, 1103, 1951, 1104, 3692, 1105, 4866, 4326, 113, 18448, 3663, 1708, 114, 1104, 1103, 2384, 1104, 24314, 119, 1212, 1275, 1428, 17881, 1477, 117, 1103, 14953, 4286, 4502, 1111, 1103, 17881, 1475, 782, 1659, 1265, 1108, 1316, 1107, 1103, 2915, 1104, 8013, 2909, 1104, 1103, 1951, 1104, 3692, 1105, 4866, 4326, 117, 25354, 19032, 10892, 117, 1105, 1103, 9351, 2909, 1104, 1103, 2289, 1791, 1104, 24314, 113, 6820, 2346, 114, 117, 138, 5086, 23324, 1795, 117, 1120, 1103, 22576, 12253, 3339, 119, 1109, 20672, 1105, 4711, 118, 20672, 1104, 1103, 1565, 7828, 1929, 1127, 1145, 1675, 1219, 1103, 14953, 4286, 4502, 119, 1212, 1367, 1428, 17881, 1477, 117, 25185, 7836, 7412, 9392, 16705, 1161, 117, 7885, 2909, 1104, 1103, 1951, 1104, 3692, 1105, 4866, 4326, 1105, 1103, 3648, 1104, 6565, 1111, 1103, 13902, 24664, 16996, 10031, 117, 3332, 1103, 1265, 1501, 119, 11912, 19821, 9996, 1116, 19714, 1116, 3692, 6025, 1107, 24314, 1130, 1181, 122, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Peševići is a village in the City of Zenica, Bosnia and Herzegovina. Demographics According to the 2013 census, its population was 270, all Bosniaks. References Populated places in Zenica
[ 101, 153, 1162, 10222, 16491, 1182, 1110, 170, 1491, 1107, 1103, 1392, 1104, 18933, 4578, 117, 9276, 1105, 11464, 119, 3177, 3702, 11293, 1116, 1792, 1106, 1103, 1381, 2314, 117, 1157, 1416, 1108, 14162, 117, 1155, 9276, 4616, 119, 19714, 1116, 7312, 8360, 2844, 1107, 18933, 4578, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Vladimir Kuspish (born 1942) was a Soviet Union judoka. He was the champion in judo U70kg at the1965 European Judo Championships. References 1942 births Soviet male judoka
[ 101, 8591, 23209, 20080, 2944, 113, 1255, 2889, 114, 1108, 170, 2461, 1913, 179, 18109, 1968, 119, 1124, 1108, 1103, 3628, 1107, 179, 18109, 158, 20829, 1377, 1403, 1120, 1103, 16382, 27677, 1735, 23915, 2572, 2708, 119, 19714, 1116, 2889, 20665, 2461, 2581, 179, 18109, 1968, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
The Nepali Reformed Churches (NRC) form a Continental Reformed denomination in Nepal. It was founded in 2005 by Rev. Arbin Pokharel, a native Nepalese convert to Christianity who returned to the country as a missionary. In 2020, the denomination already consisted of 32 churches. History Arbin Pokharel was born in Nepal, and at the age of 4, he went to live in a Christian orphanage. He later received an offer of study in the United States, where he was baptized and became a member of Christian Reformed Church of North America. In 2004, Rev. Arbin Pokhrel decided to return to Nepal to begin planting Reformed churches in the country. In 2005, the missionary founded a church in Kathmandu. Later, as the number of members grew, other churches were started in other parts of the country. Together these churches organized the Nepali Reformed Churches (NRC). In 2020, the denomination already reached 32 churches. Interchurch Relations The NRC were formerly members of the World Reformed Fellowship. References Reformed denominations in Asia
[ 101, 1109, 26246, 15212, 13701, 113, 151, 10036, 114, 1532, 170, 9211, 15212, 20493, 1107, 7795, 119, 1135, 1108, 1771, 1107, 1478, 1118, 6750, 119, 138, 26281, 1394, 18959, 23553, 1883, 117, 170, 2900, 7795, 6420, 10454, 1106, 7522, 1150, 1608, 1106, 1103, 1583, 1112, 170, 10263, 119, 1130, 12795, 117, 1103, 20493, 1640, 4227, 1104, 2724, 5189, 119, 2892, 138, 26281, 1394, 18959, 23553, 1883, 1108, 1255, 1107, 7795, 117, 1105, 1120, 1103, 1425, 1104, 125, 117, 1119, 1355, 1106, 1686, 1107, 170, 2131, 22899, 119, 1124, 1224, 1460, 1126, 2906, 1104, 2025, 1107, 1103, 1244, 1311, 117, 1187, 1119, 1108, 22162, 1105, 1245, 170, 1420, 1104, 2131, 15212, 1722, 1104, 1456, 1738, 119, 1130, 1516, 117, 6750, 119, 138, 26281, 1394, 18959, 9862, 9261, 1879, 1106, 1862, 1106, 7795, 1106, 3295, 16109, 15212, 5189, 1107, 1103, 1583, 119, 1130, 1478, 117, 1103, 10263, 1771, 170, 1749, 1107, 10785, 16277, 7641, 119, 2611, 117, 1112, 1103, 1295, 1104, 1484, 2580, 117, 1168, 5189, 1127, 1408, 1107, 1168, 2192, 1104, 1103, 1583, 119, 6333, 1292, 5189, 3366, 1103, 26246, 15212, 13701, 113, 151, 10036, 114, 119, 1130, 12795, 117, 1103, 20493, 1640, 1680, 2724, 5189, 119, 11300, 26037, 9269, 1109, 151, 10036, 1127, 3147, 1484, 1104, 1103, 1291, 15212, 9508, 119, 19714, 1116, 15212, 18857, 1107, 3165, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
The Tower of Jewels is a 1919 American silent crime film directed by Tom Terriss and starring Corinne Griffith, Maurice Costello and Estelle Taylor. Cast Corinne Griffith as Emily Cottrell Webster Campbell as Wayne Parrish Henry Stephenson as David Parrish Maurice Costello as Fraser Grimstead Charles Halton as Jimmy the Rat Estelle Taylor as Adele Warren Edward Elkas as Bornheim Charles Craig as Drew References Bibliography Connelly, Robert B. The Silents: Silent Feature Films, 1910-36, Volume 40, Issue 2. December Press, 1998. External links 1919 films 1919 drama films English-language films American films American silent feature films American drama films American black-and-white films Films directed by Tom Terriss Vitagraph Studios films
[ 101, 1109, 5646, 1104, 23624, 1116, 1110, 170, 3688, 1237, 3826, 3755, 1273, 2002, 1118, 2545, 12008, 14791, 3954, 1105, 3937, 3291, 4854, 1673, 14672, 117, 7523, 23093, 1105, 142, 13894, 4838, 3357, 119, 21452, 3291, 4854, 1673, 14672, 1112, 5590, 3291, 3069, 13458, 11674, 5379, 1112, 5489, 19585, 14791, 2737, 1985, 21567, 1112, 1681, 19585, 14791, 2737, 7523, 23093, 1112, 9156, 144, 10205, 21018, 1889, 12193, 1633, 1112, 4479, 1103, 21632, 142, 13894, 4838, 3357, 1112, 20322, 5407, 2594, 2896, 13257, 1112, 3526, 6797, 1889, 6422, 1112, 8633, 19714, 1116, 139, 13292, 27800, 18354, 1183, 117, 1823, 139, 119, 1109, 15013, 1116, 131, 15013, 14533, 9141, 117, 4178, 118, 3164, 117, 6849, 1969, 117, 15653, 123, 119, 1382, 2544, 117, 1772, 119, 22841, 6743, 3688, 2441, 3688, 3362, 2441, 1483, 118, 1846, 2441, 1237, 2441, 1237, 3826, 2672, 2441, 1237, 3362, 2441, 1237, 1602, 118, 1105, 118, 1653, 2441, 9141, 2002, 1118, 2545, 12008, 14791, 3954, 25118, 15241, 5406, 2441, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
N-Acetyldopamine is the organic compound with the formula CH3C(O)NHCH2CH2C6H3(OH)2. It is the N-acetylated derivative of dopamine. This compound is a reactive intermediate in sclerotization, the process by which insect cuticles are formed by hardening molecular precursors. The catechol substituent is susceptible to redox and crosslinking. References Phenethylamines
[ 101, 151, 118, 12860, 2340, 25791, 4163, 9685, 1110, 1103, 7878, 7090, 1114, 1103, 7893, 24890, 1495, 1658, 113, 152, 114, 20576, 23258, 1477, 23258, 1477, 1658, 1545, 3048, 1495, 113, 18719, 114, 123, 119, 1135, 1110, 1103, 151, 118, 20839, 2340, 6951, 14478, 1104, 1202, 4163, 9685, 119, 1188, 7090, 1110, 170, 26844, 9533, 1107, 188, 10536, 10595, 2734, 117, 1103, 1965, 1118, 1134, 15754, 2195, 26407, 1132, 1824, 1118, 1662, 4777, 9546, 15985, 1116, 119, 1109, 5855, 11252, 4063, 4841, 2050, 2875, 23404, 1204, 1110, 19464, 1106, 1894, 10649, 1105, 2771, 13255, 1158, 119, 19714, 1116, 7642, 7582, 15644, 7609, 8515, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Aderinokun is a Yoruba surname. Notable people with the surname include: David Olumide Aderinokun, Nigerian politician Ire Aderinokun, Nigerian software developer Tayo Aderinokun, Nigerian entrepreneur Yoruba-language surnames
[ 101, 24930, 9866, 2728, 4786, 1179, 1110, 170, 14941, 24325, 12239, 119, 11017, 1234, 1114, 1103, 12239, 1511, 131, 1681, 152, 7776, 3269, 24930, 9866, 2728, 4786, 1179, 117, 11960, 2931, 146, 1874, 24930, 9866, 2728, 4786, 1179, 117, 11960, 3594, 9991, 22515, 7490, 24930, 9866, 2728, 4786, 1179, 117, 11960, 12035, 14941, 24325, 118, 1846, 12239, 1116, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
The 1985–86 Notre Dame Fighting Irish men's basketball team represented the University of Notre Dame during the 1985-86 college basketball season. The Irish were led by head coach Digger Phelps, in his 15th season, and played their home games at the Athletic & Convocation Center in Notre Dame, Indiana. The Irish completed a perfect season at home (15–0). Notre Dame earned an at-large bid to the NCAA Tournament where they were upset by Arkansas–Little Rock in the opening round. The team finished with a 23–6 record and a No. 10 ranking in the final AP poll. Roster Schedule and results |- !colspan=9 style=| Regular Season |- !colspan=9 style=| NCAA Tournament Rankings References Notre Dame Fighting Irish men's basketball seasons Notre Dame Notre Dame Notre Dame Fighting Irish Notre Dame Fighting Irish
[ 101, 1109, 2210, 782, 5942, 10360, 8022, 10864, 2600, 1441, 112, 188, 3163, 1264, 2533, 1103, 1239, 1104, 10360, 8022, 1219, 1103, 2210, 118, 5942, 2134, 3163, 1265, 119, 1109, 2600, 1127, 1521, 1118, 1246, 2154, 12120, 9146, 22385, 117, 1107, 1117, 5617, 1265, 117, 1105, 1307, 1147, 1313, 1638, 1120, 1103, 6244, 111, 16752, 17105, 1945, 1107, 10360, 8022, 117, 4456, 119, 1109, 2600, 2063, 170, 3264, 1265, 1120, 1313, 113, 1405, 782, 121, 114, 119, 10360, 8022, 2829, 1126, 1120, 118, 1415, 6875, 1106, 1103, 5089, 5629, 1187, 1152, 1127, 5737, 1118, 6147, 782, 2743, 2977, 1107, 1103, 2280, 1668, 119, 1109, 1264, 1845, 1114, 170, 1695, 782, 127, 1647, 1105, 170, 1302, 119, 1275, 5662, 1107, 1103, 1509, 10997, 9590, 119, 155, 15540, 1200, 23070, 1105, 2686, 197, 118, 106, 1884, 3447, 10224, 134, 130, 1947, 134, 197, 14381, 5623, 197, 118, 106, 1884, 3447, 10224, 134, 130, 1947, 134, 197, 5089, 5629, 22732, 19714, 1116, 10360, 8022, 10864, 2600, 1441, 112, 188, 3163, 2955, 10360, 8022, 10360, 8022, 10360, 8022, 10864, 2600, 10360, 8022, 10864, 2600, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Artem Volodymyrovych Kachanovskyi (ukr. Арте́м Володи́мирович Качано́вський, born 12.12.1992) is a 2-dan professional go player from Ukraine. He was the fifth player to be awarded professional status by the European Go Federation, in 2016. He has won the European Grand Slam tournament twice, in 2017 and 2021, and was runner-up in the European Championship three times, in 2010, 2019 and 2021. Among other high tournament placements, he won the Pandanet European Team Championship in 2016, the Silk Road Tournament in 2019 and the first season of the European Professional Go League in 2020. Biography Kachanovskyi was born on 12 December 1992 and grew up in Rivne, Ukraine. He began playing go at the age of 7 after his father read about the game in a newspaper and began to teach him and his brother, Mykhailo. He attended a local go club until he surpassed his teacher in strength, after reaching the level of 3-kyu. From then on, he continued his studies of the game alone. After completing studies of Computer Science, he decided after the introduction of a professional system in Europe in 2014 to devote himself entirely to the game and attempt to make a living from it. Among the strongest players in Europe, Kachanovskyi is notable for never having visited Asia for an extended period to study, instead achieving his strength mostly through self-study. In 2016, Kachanovskyi became the fifth player to be awarded professional status, after having emerged the overall victor of a six-round, single knockout tournament of sixteen of Europe's strongest players and beating his fellow Ukrainian Andrii Kravets in the final. Kravets and Kachanovskyi both studied as children at the same go school in Rivne, and Kravets would go on to achieve professional status himself the following year. Personal life Now living in Kyiv with his wife and two children, Kachanovskyi launched the "European Go Journal" in February 2021. The Journal is published monthly to an international readership of around 300 people, and features varied content including European and international news, game commentaries, interviews, photography, artwork, tsumego problems and more. Assisted by two proofreaders and content contributors from around Europe, Kachanovskyi celebrated the one-year anniversary of the project in February 2022 with a special article on the project's origins and developments. Tournament and promotional history References External links Kachanovskyi's player card in the European Go Database. Kachanovskyi's player profile on the European Go Federation website. European Go Journal, of which Kachanovskyi is the editor-in-chief. 1992 births Living people Ukrainian Go players
[ 101, 20654, 1306, 5713, 22320, 4527, 12316, 21155, 14812, 18546, 22933, 1182, 113, 26006, 1197, 119, 448, 20442, 28404, 19692, 28310, 28401, 450, 16948, 28400, 16948, 28396, 17424, 28310, 28401, 17424, 20442, 17892, 457, 10286, 28409, 10286, 17127, 16948, 28310, 28394, 28403, 28414, 28399, 21911, 117, 1255, 1367, 119, 1367, 119, 1924, 114, 1110, 170, 123, 118, 5358, 1179, 1848, 1301, 1591, 1121, 5231, 119, 1124, 1108, 1103, 3049, 1591, 1106, 1129, 2152, 1848, 2781, 1118, 1103, 1735, 3414, 4245, 117, 1107, 1446, 119, 1124, 1144, 1281, 1103, 1735, 2224, 14923, 2348, 3059, 117, 1107, 1504, 1105, 17881, 1475, 117, 1105, 1108, 6057, 118, 1146, 1107, 1103, 1735, 1935, 1210, 1551, 117, 1107, 1333, 117, 10351, 1105, 17881, 1475, 119, 3841, 1168, 1344, 2348, 12693, 1116, 117, 1119, 1281, 1103, 6991, 6778, 2105, 1735, 2649, 1935, 1107, 1446, 117, 1103, 14580, 1914, 5629, 1107, 10351, 1105, 1103, 1148, 1265, 1104, 1103, 1735, 6861, 3414, 1453, 1107, 12795, 119, 20599, 14812, 18546, 22933, 1182, 1108, 1255, 1113, 1367, 1382, 1924, 1105, 2580, 1146, 1107, 155, 11083, 1673, 117, 5231, 119, 1124, 1310, 1773, 1301, 1120, 1103, 1425, 1104, 128, 1170, 1117, 1401, 2373, 1164, 1103, 1342, 1107, 170, 3054, 1105, 1310, 1106, 6215, 1140, 1105, 1117, 1711, 117, 1422, 14457, 24755, 119, 1124, 2323, 170, 1469, 1301, 1526, 1235, 1119, 16509, 1117, 3218, 1107, 3220, 117, 1170, 3634, 1103, 1634, 1104, 124, 118, 180, 9379, 119, 1622, 1173, 1113, 117, 1119, 1598, 1117, 2527, 1104, 1103, 1342, 2041, 119, 1258, 7332, 2527, 1104, 6701, 2444, 117, 1119, 1879, 1170, 1103, 4784, 1104, 170, 1848, 1449, 1107, 1980, 1107, 1387, 1106, 26344, 1471, 3665, 1106, 1103, 1342, 1105, 2661, 1106, 1294, 170, 1690, 1121, 1122, 119, 3841, 1103, 11112, 2139, 1107, 1980, 117, 14812, 18546, 22933, 1182, 1110, 3385, 1111, 1309, 1515, 3891, 3165, 1111, 1126, 2925, 1669, 1106, 2025, 117, 1939, 11190, 1117, 3220, 2426, 1194, 2191, 118, 2025, 119, 1130, 1446, 117, 14812, 18546, 22933, 1182, 1245, 1103, 3049, 1591, 1106, 1129, 2152, 1848, 2781, 117, 1170, 1515, 5338, 1103, 2905, 191, 17882, 1766, 1104, 170, 1565, 118, 1668, 117, 1423, 13251, 2348, 1104, 7423, 1104, 1980, 112, 188, 11112, 2139, 1105, 5405, 1117, 3235, 5284, 1262, 2047, 1182, 148, 22116, 2145, 1107, 1103, 1509, 119, 148, 22116, 2145, 1105, 14812, 18546, 22933, 1182, 1241, 2376, 1112, 1482, 1120, 1103, 1269, 1301, 1278, 1107, 155, 11083, 1673, 117, 1105, 148, 22116, 2145, 1156, 1301, 1113, 1106, 5515, 1848, 2781, 1471, 1103, 1378, 1214, 119, 13907, 1297, 1986, 1690, 1107, 148, 10279, 1964, 1114, 1117, 1676, 1105, 1160, 1482, 117, 14812, 18546, 22933, 1182, 2536, 1103, 107, 1735, 3414, 3603, 107, 1107, 1428, 17881, 1475, 119, 1109, 3603, 1110, 1502, 7868, 1106, 1126, 1835, 8460, 3157, 1104, 1213, 3127, 1234, 117, 1105, 1956, 9177, 3438, 1259, 1735, 1105, 1835, 2371, 117, 1342, 26094, 117, 7397, 117, 6427, 117, 8262, 117, 189, 22369, 2758, 2645, 1105, 1167, 119, 1249, 22398, 1174, 1118, 1160, 6777, 11613, 1468, 1105, 3438, 19492, 1121, 1213, 1980, 117, 14812, 18546, 22933, 1182, 5719, 1103, 1141, 118, 1214, 5453, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Dominik Piła (born 6 May 2001) is a Polish professional footballer who plays as a winger for Chrobry Głogów. Club career Piła started his professional career with Polish I liga side Chrobry Głogów in 2019. On 4 January 2022, he signed a four-year contract with Ekstraklasa club Lechia Gdańsk, effective from 1 July 2022. Career statistics Club References External links 2001 births Living people People from Świdnica Polish footballers Association football wingers Chrobry Głogów players I liga players Poland youth international footballers
[ 101, 16727, 4729, 1377, 21902, 26617, 113, 1255, 127, 1318, 1630, 114, 1110, 170, 3129, 1848, 3585, 1150, 2399, 1112, 170, 18962, 1111, 20394, 2180, 1830, 1616, 144, 20671, 8032, 6781, 119, 1998, 1578, 21902, 26617, 1408, 1117, 1848, 1578, 1114, 3129, 146, 181, 13499, 1334, 20394, 2180, 1830, 1616, 144, 20671, 8032, 6781, 1107, 10351, 119, 1212, 125, 1356, 17881, 1477, 117, 1119, 1878, 170, 1300, 118, 1214, 2329, 1114, 142, 4616, 4487, 27752, 3202, 1526, 3180, 27018, 26198, 117, 3903, 1121, 122, 1351, 17881, 1477, 119, 17062, 9161, 1998, 19714, 1116, 22841, 6743, 1630, 20665, 7932, 1234, 2563, 1121, 318, 10073, 22834, 4578, 3129, 3585, 1116, 1791, 1709, 18962, 1116, 20394, 2180, 1830, 1616, 144, 20671, 8032, 6781, 2139, 146, 181, 13499, 2139, 2870, 3298, 1835, 3585, 1116, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Lis Møller (22 December 1918 – 24 September 1983) was a Danish journalist and Conservative People's Party politician who was elected to the Folketing for two non-consecutive periods. She joined the Young Conservatives when she was aged 15 and took part in organisational work for them. Møller joined Danmarks Radio as a programme secretary for radio in 1949 before moving to television seven years later. She focused on women's and social issues and underrepresented minorities while in Parliament and her broadcasting career focused on women's and youth, particularly social issues from those groups she worked with for organisations she was a part of. Møller was appointed Knight of the Order of the Dannebrog in 1976. Early life On 22 December 1918, Møller was born in Copenhagen. She was the daughter of upper-class parents, the clerk Johan Frederik Gotschalk and the housekeeper Kirsten Olesen. Immediately following her birth, Møller was adopted by the wholesaler Hans Marinus Jakobsen and his wife Alma Jakobsen. She grew up with her foster parents and did not make contact with her biological parents until the death of her foster parents during her teenage years. Møller became a member of the Young Conservatives at the age of 15. In 1935, she graduated from N. Zahle's School with her high school diploma, and trained to be a journalist at both Holbæk Amts Avis and Sorø Amts Dagblad from 1936 to 1939. Career Møller had taken part in conservative organizational work from 1934, chairing the Young Conservatives' second district between 1935 and 1936, doing women's work for the Young Conservatives in Slagelse from 1936 to 1938, leading the Copenhagen Young Conservative's women's branch from 1941 to 1943 and was secretary of the national organization's women's committee between 1943 and 1946. She led the Young Conservative's girls' country camps from 1945 to 1947. She worked in the Ministry of Finance between 1940 and 1943. From 1945 to 1949, Møller worked for the daily newspaper Nationaltidende, as well as at . She then became employed as a program secretary at Danmarks Radio. Møller moved to television in 1956 and withdrew a request to join its current affairs department to enable her to cover societial issues in 1969 due to protests from TV Avisen employees. She stood for election to the Folketing in the constituency of in both the 1945 Danish Folketing election and the 1947 Danish Folketing elections on behalf of The Conservative People's Party that nominated her but she failed to get elected on both occasions. At the 1964 Danish general election, Møller did not get election to represent the constituency in the Folketing but she would gain election in the constituency at the 1966 Danish general election on 22 November of that year and remained there until 4 December 1973. She resigned her seat in 1973 and left The Conservative People's Party two years later. Møller was a in the Folketing as a representative of the constituency for The Conservative People's Party from 8 December 1981 to 24 September 1983. In parliament, she focused on women's and social issues and underrepresented minorities; Møller did not seek high office. She established the Housing Fund for Single Mothers in 1966, which she chaired until 1983. She was on the board of several social organisations. In 1966, Møller became a member of both the Weaknesses 'School Association's support committee and the Tørsleff & Co's Housewives' Scholarship. She co-established the Danish Folk High School in Israel the following year and founded Danish Day Care Centers in 1968 that she chaired until 1973. Møller was also a member of the Disability Fund's Board of Representatives and its executive committee, the CISV's presidium and of Sofieskolen's supervisory board, the Board of Censors at the Danish School of Media and Journalism, the Mødrehjælpen's supervisory board, Børneringens main board, the Social Reform Commission, the Children Commission 1976 and the Elderly Commission. She was also chair of the , on the supervisory board of the children's psychotic treatment centre Sofieskolen and the Association for Spastic Paralyzed and worked for the Disability Foundation, the Lonely Old People's Guard and Terres des Hommes. Møller's radio and television broadcasting career saw her focus on women's and youth, particularly social issues from those groups she worked with for organisations she was a part of. She authored Mennesker på skærmen in 1978. Møller was considered by her own party to be "troublesome" because of her focus on finding solutions to issues in society and was a rapporteur of social policy for several years, some of which were revoked. This included her stance on free abortions which she opposed on the grounds of pressure from fathers and instead campaigned for contraception and adoption. Møller believed young women should stay at home as much as possible when their children were young but that single mothers should put their children up for adoption. She was a feverent opponent of crèche and was an supporter of part-time kindergartens and part-time work. In 1979, Møller made the proposal that her housing fund be merged with the foundation established in Countess Danner's House. She contacted the Justice Minister and the foundation's board without notifying the house's occupants, who distanced themselves from her. Personal life On 28 February 1942 in Copenhagen, she married the politician Poul Møller. They had two children, one of whom Per Stig Møller became a politician. Møller had a daughter from a previous short-lived marriage. She died in Ordrup on 24 September 1983 and was buried in Bispebjerg Cemetery. Awards In 1967, Møller received the . She also won the Ejnar Friis-Hansens in 1972, and DR's two years later. In 1976, Møller was appointed Knight of the Order of the Dannebrog. In 1978, she received Birgit Saabye's Memorial Scholarship as well as The Berlin Foundation's Honorary Award. Møller was named an "honorary craftsman" by the Association of Craftsmen in Copenhagen for "her creative work in radio and television and the value her journalism brought to the understanding of social and human conditions. References 1918 births 1983 deaths Politicians from Copenhagen 20th-century Danish women politicians 20th-century Danish women writers 20th-century Danish journalists Women members of the Folketing Members of the Folketing 1968–1971 Members of the Folketing 1971–1973 Members of the Folketing 1981–1984 Conservative People's Party (Denmark) politicians Danish women journalists Radio reporters and correspondents Knights of the Order of the Dannebrog
[ 101, 5255, 1116, 150, 17945, 9860, 113, 1659, 1382, 3428, 782, 1572, 1347, 2278, 114, 1108, 170, 4979, 4391, 1105, 5739, 2563, 112, 188, 1786, 2931, 1150, 1108, 1809, 1106, 1103, 12539, 21299, 1111, 1160, 1664, 118, 4776, 6461, 119, 1153, 1688, 1103, 2701, 15485, 1165, 1131, 1108, 4079, 1405, 1105, 1261, 1226, 1107, 5632, 1348, 1250, 1111, 1172, 119, 150, 17945, 9860, 1688, 4317, 22328, 2664, 1112, 170, 4644, 4848, 1111, 2070, 1107, 3224, 1196, 2232, 1106, 1778, 1978, 1201, 1224, 119, 1153, 3378, 1113, 1535, 112, 188, 1105, 1934, 2492, 1105, 1223, 1874, 1643, 4894, 22666, 16130, 1229, 1107, 2901, 1105, 1123, 6731, 1578, 3378, 1113, 1535, 112, 188, 1105, 3298, 117, 2521, 1934, 2492, 1121, 1343, 2114, 1131, 1589, 1114, 1111, 8485, 1131, 1108, 170, 1226, 1104, 119, 150, 17945, 9860, 1108, 1923, 5122, 1104, 1103, 2864, 1104, 1103, 4317, 1673, 12725, 1403, 1107, 2402, 119, 4503, 1297, 1212, 1659, 1382, 3428, 117, 150, 17945, 9860, 1108, 1255, 1107, 9409, 119, 1153, 1108, 1103, 1797, 1104, 3105, 118, 1705, 2153, 117, 1103, 9477, 13402, 5291, 9866, 1377, 7348, 9022, 23074, 1105, 1103, 26458, 14477, 20628, 19272, 3792, 119, 13301, 1378, 1123, 3485, 117, 150, 17945, 9860, 1108, 3399, 1118, 1103, 20767, 1197, 6458, 20076, 1361, 20791, 3792, 1105, 1117, 1676, 15717, 20791, 3792, 119, 1153, 2580, 1146, 1114, 1123, 12100, 2153, 1105, 1225, 1136, 1294, 3232, 1114, 1123, 7269, 2153, 1235, 1103, 1473, 1104, 1123, 12100, 2153, 1219, 1123, 11009, 1201, 119, 150, 17945, 9860, 1245, 170, 1420, 1104, 1103, 2701, 15485, 1120, 1103, 1425, 1104, 1405, 119, 1130, 3588, 117, 1131, 3024, 1121, 151, 119, 163, 24166, 1162, 112, 188, 1323, 1114, 1123, 1344, 1278, 14985, 117, 1105, 3972, 1106, 1129, 170, 4391, 1120, 1241, 9800, 1233, 1830, 28200, 1377, 7277, 2145, 138, 9356, 1105, 1573, 1197, 17945, 7277, 2145, 10136, 1403, 18075, 1181, 1121, 3419, 1106, 3061, 119, 17062, 150, 17945, 9860, 1125, 1678, 1226, 1107, 6588, 15610, 1250, 1121, 3729, 117, 2643, 1158, 1103, 2701, 15485, 112, 1248, 1629, 1206, 3588, 1105, 3419, 117, 1833, 1535, 112, 188, 1250, 1111, 1103, 2701, 15485, 1107, 156, 19640, 3447, 1162, 1121, 3419, 1106, 3412, 117, 2020, 1103, 9409, 2701, 5739, 112, 188, 1535, 112, 188, 3392, 1121, 3018, 1106, 2976, 1105, 1108, 4848, 1104, 1103, 1569, 2369, 112, 188, 1535, 112, 188, 3914, 1206, 2976, 1105, 3064, 119, 1153, 1521, 1103, 2701, 5739, 112, 188, 2636, 112, 1583, 7869, 1121, 2481, 1106, 3138, 119, 1153, 1589, 1107, 1103, 3424, 1104, 7476, 1206, 3020, 1105, 2976, 119, 1622, 2481, 1106, 3224, 117, 150, 17945, 9860, 1589, 1111, 1103, 3828, 3054, 1305, 23767, 11131, 117, 1112, 1218, 1112, 1120, 119, 1153, 1173, 1245, 4071, 1112, 170, 1788, 4848, 1120, 4317, 22328, 2664, 119, 150, 17945, 9860, 1427, 1106, 1778, 1107, 2990, 1105, 6367, 170, 4566, 1106, 2866, 1157, 1954, 5707, 2853, 1106, 9396, 1123, 1106, 2267, 1177, 25982, 16764, 2492, 1107, 2540, 1496, 1106, 7853, 1121, 1794, 138, 16641, 1179, 4570, 119, 1153, 1866, 1111, 1728, 1106, 1103, 12539, 21299, 1107, 1103, 5269, 1104, 1107, 1241, 1103, 2481, 4979, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
The Battle of Mykolaiv is a military engagement which started on the night of 26 February 2022, as part of the Kherson offensive during the 2022 Russian invasion of Ukraine. Battle During the afternoon hours of 26 February 2022, 12 Russian tanks managed to break through in Kakhovka on the Dnieper and began heading towards Mykolaiv. Vitaly Kim, the governor of Mykolaiv Oblast, stated that the city had 5 hours to prepare. Artillery and other arms had also been prepared. By around 18:52, tanks were in the outskirts of the city and the mayor ordered citizens to stay at home and as far away from windows as possible. Shortly after, troops entered the city and a battle on the Southern Bug erupted around 10 minutes later. According to some reports, tanks "passed through the city". Russian forces had also taken over the Mykolaiv Zoo. After roughly three hours of fighting, Russian forces were driven away by Ukrainian forces, and while some Russian tanks reportedly bypassed the city, fighting continued. Extensive fighting was recorded in , on 6th Slobidska Street, and on Central Avenue. By the early morning of 27 February, Ukrainian officials claimed that Russian forces were fully driven away from the city, with Kim posting on Telegram, "Mykolaiv is ours! Glory to Ukraine!" (Миколаїв наш! Слава Україні[!]). Some Russian soldiers were captured. The city was extensively damaged. On 28 February, Russian troops advanced from Kherson towards Mykolaiv, reaching the city's outskirts and launching an assault at 11:00. References Mykolaiv Mykolaiv
[ 101, 1109, 2651, 1104, 1422, 2718, 20737, 1964, 1110, 170, 1764, 8164, 1134, 1408, 1113, 1103, 1480, 1104, 1744, 1428, 17881, 1477, 117, 1112, 1226, 1104, 1103, 148, 20765, 1320, 5810, 1219, 1103, 17881, 1477, 1938, 4923, 1104, 5231, 119, 2651, 1507, 1103, 4427, 2005, 1104, 1744, 1428, 17881, 1477, 117, 1367, 1938, 6977, 2374, 1106, 2549, 1194, 1107, 14812, 9862, 3292, 1968, 1113, 1103, 141, 5213, 3365, 1105, 1310, 5312, 2019, 1422, 2718, 20737, 1964, 119, 25118, 1193, 4246, 117, 1103, 4066, 1104, 1422, 2718, 20737, 1964, 11705, 117, 2202, 1115, 1103, 1331, 1125, 126, 2005, 1106, 7034, 119, 7211, 1105, 1168, 1739, 1125, 1145, 1151, 4029, 119, 1650, 1213, 1407, 131, 3882, 117, 6977, 1127, 1107, 1103, 13100, 1104, 1103, 1331, 1105, 1103, 4398, 2802, 4037, 1106, 2215, 1120, 1313, 1105, 1112, 1677, 1283, 1121, 3751, 1112, 1936, 119, 6480, 1170, 117, 2830, 2242, 1103, 1331, 1105, 170, 2321, 1113, 1103, 2685, 139, 9610, 12773, 1213, 1275, 1904, 1224, 119, 1792, 1106, 1199, 3756, 117, 6977, 107, 2085, 1194, 1103, 1331, 107, 119, 1938, 2088, 1125, 1145, 1678, 1166, 1103, 1422, 2718, 20737, 1964, 13899, 119, 1258, 4986, 1210, 2005, 1104, 2935, 117, 1938, 2088, 1127, 4940, 1283, 1118, 5284, 2088, 117, 1105, 1229, 1199, 1938, 6977, 7005, 13981, 1174, 1103, 1331, 117, 2935, 1598, 119, 16409, 27291, 2935, 1108, 1802, 1107, 117, 1113, 4584, 156, 2858, 14598, 9289, 1715, 117, 1105, 1113, 1970, 3194, 119, 1650, 1103, 1346, 2106, 1104, 1765, 1428, 117, 5284, 3878, 2694, 1115, 1938, 2088, 1127, 3106, 4940, 1283, 1121, 1103, 1331, 117, 1114, 4246, 15537, 1113, 11341, 12606, 4515, 117, 107, 1422, 2718, 20737, 1964, 1110, 17079, 106, 12519, 1106, 5231, 106, 107, 113, 459, 17424, 28399, 16948, 28400, 10286, 28419, 28394, 488, 10286, 28410, 106, 464, 28400, 10286, 28394, 10286, 466, 28399, 20442, 10286, 28419, 17127, 28418, 164, 106, 166, 114, 119, 1789, 1938, 2803, 1127, 3297, 119, 1109, 1331, 1108, 7620, 4938, 119, 1212, 1743, 1428, 117, 1938, 2830, 3682, 1121, 148, 20765, 1320, 2019, 1422, 2718, 20737, 1964, 117, 3634, 1103, 1331, 112, 188, 13100, 1105, 12611, 1126, 5937, 1120, 1429, 131, 3135, 119, 19714, 1116, 1422, 2718, 20737, 1964, 1422, 2718, 20737, 1964, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Oyenuga is Yoruba surname. Notable people with the surname include: Kudus Oyenuga, English footballer Victor Adenuga Oyenuga, Nigerian Professor Emeritus of Agricultural science and pioneer President of the Nigerian Academy of Science. Yoruba-language surnames
[ 101, 152, 4980, 14787, 2571, 1110, 14941, 24325, 12239, 119, 11017, 1234, 1114, 1103, 12239, 1511, 131, 23209, 15307, 152, 4980, 14787, 2571, 117, 1483, 3585, 4622, 17533, 15650, 152, 4980, 14787, 2571, 117, 11960, 2986, 18212, 1104, 10705, 2598, 1105, 8578, 1697, 1104, 1103, 11960, 2127, 1104, 2444, 119, 14941, 24325, 118, 1846, 12239, 1116, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Shagaya is Yoruba surname. Notable people with the surname include: Bola Shagaya, Nigerian transport mogul John Nanzip Shagaya, Nigerian senator and former senior military officer Sim Shagaya, Nigerian technology entrepreneur and founder of Konga. Yoruba-language surnames
[ 101, 156, 2328, 2571, 2315, 1110, 14941, 24325, 12239, 119, 11017, 1234, 1114, 1103, 12239, 1511, 131, 9326, 1742, 156, 2328, 2571, 2315, 117, 11960, 3936, 182, 8032, 4654, 1287, 20689, 5303, 1643, 156, 2328, 2571, 2315, 117, 11960, 12280, 1105, 1393, 2682, 1764, 2575, 14159, 1306, 156, 2328, 2571, 2315, 117, 11960, 2815, 12035, 1105, 3249, 1104, 3462, 1161, 119, 14941, 24325, 118, 1846, 12239, 1116, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Frederick Baldwin may refer to: Frederick Walker Baldwin, hydrofoil and aviation pioneer and partner of the inventor Alexander Graham Bell Frederick W. Baldwin (Vermont politician), Vermont attorney, businessman, historian, author and politician Frederick C. Baldwin, American photographer
[ 101, 4682, 10944, 1336, 5991, 1106, 131, 4682, 4575, 10944, 117, 177, 19694, 14467, 2723, 1105, 8747, 8578, 1105, 3547, 1104, 1103, 12989, 2792, 5159, 4720, 4682, 160, 119, 10944, 113, 8472, 2931, 114, 117, 8472, 6507, 117, 6414, 117, 4864, 117, 2351, 1105, 2931, 4682, 140, 119, 10944, 117, 1237, 8152, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Brandon Biro (born March 11, 1998) is a Canadian professional ice hockey winger currently playing for the Rochester Americans in the American Hockey League (AHL) as a prospect to the Buffalo Sabres of the National Hockey League (NHL). He played collegiately at Penn State. Playing career Junior Biro played two seasons with the Spruce Grove Saints of the Alberta Junior Hockey League, winning the league's Rookie of the Year award in the 201415 season. College Biro played four seasons for the Penn State Nittany Lions. At the end of his collegiate career, he was eighth all-time for Penn State in goals (41), third all-time in assists (75), and fourth all-time in points (116). Professional On March 18, 2020, Biro was signed by the Buffalo Sabres of the National Hockey League as an undrafted free agent. He made his professional debut with Buffalo's AHL affiliate, the Rochester Americans, on February 12, 2021. Biro made his NHL debut for the Sabres on February 23, 2022, in a game against the Montreal Canadiens. Personal Biro's younger brother, Jordan, plays collegiately for Colorado College. His father, Rob, played collegiate soccer at the University of Alberta. He also played one season with the Winnipeg Fury of the Canadian Soccer League. He now works for Edmonton Catholic Schools as a soccer director. Career statistics Awards and honours References External links 1998 births Canadian ice hockey left wingers Buffalo Sabres players Ice hockey people from Alberta Living people Penn State Nittany Lions men's ice hockey players People from Sherwood Park Rochester Americans players Spruce Grove Saints players Undrafted National Hockey League players
[ 101, 8464, 139, 9992, 113, 1255, 1345, 1429, 117, 1772, 114, 1110, 170, 2122, 1848, 2854, 4700, 18962, 1971, 1773, 1111, 1103, 10425, 4038, 1107, 1103, 1237, 5109, 1453, 113, 22030, 114, 1112, 170, 11870, 1106, 1103, 6911, 17784, 22954, 1104, 1103, 1305, 5109, 1453, 113, 6521, 114, 119, 1124, 1307, 14532, 1193, 1120, 9223, 1426, 119, 15628, 1578, 3800, 139, 9992, 1307, 1160, 2955, 1114, 1103, 156, 21641, 8051, 7099, 1104, 1103, 7153, 3800, 5109, 1453, 117, 2183, 1103, 2074, 112, 188, 14461, 1104, 1103, 2381, 2574, 1107, 1103, 1387, 16337, 1265, 119, 1531, 139, 9992, 1307, 1300, 2955, 1111, 1103, 9223, 1426, 27453, 5100, 3382, 7862, 119, 1335, 1103, 1322, 1104, 1117, 14532, 1578, 117, 1119, 1108, 6075, 1155, 118, 1159, 1111, 9223, 1426, 1107, 2513, 113, 3746, 114, 117, 1503, 1155, 118, 1159, 1107, 8407, 113, 3453, 114, 117, 1105, 2223, 1155, 118, 1159, 1107, 1827, 113, 13096, 114, 119, 6861, 1212, 1345, 1407, 117, 12795, 117, 139, 9992, 1108, 1878, 1118, 1103, 6911, 17784, 22954, 1104, 1103, 1305, 5109, 1453, 1112, 1126, 24467, 1714, 3677, 119, 1124, 1189, 1117, 1848, 1963, 1114, 6911, 112, 188, 22030, 8563, 117, 1103, 10425, 4038, 117, 1113, 1428, 1367, 117, 17881, 1475, 119, 139, 9992, 1189, 1117, 6521, 1963, 1111, 1103, 17784, 22954, 1113, 1428, 1695, 117, 17881, 1477, 117, 1107, 170, 1342, 1222, 1103, 5206, 23454, 119, 13907, 139, 9992, 112, 188, 3247, 1711, 117, 4421, 117, 2399, 14532, 1193, 1111, 4369, 1531, 119, 1230, 1401, 117, 6284, 117, 1307, 14532, 5862, 1120, 1103, 1239, 1104, 7153, 119, 1124, 1145, 1307, 1141, 1265, 1114, 1103, 11070, 14615, 1104, 1103, 2122, 6863, 1453, 119, 1124, 1208, 1759, 1111, 10397, 2336, 5722, 1112, 170, 5862, 1900, 119, 17062, 9161, 2763, 1105, 12652, 19714, 1116, 22841, 6743, 1772, 20665, 2122, 2854, 4700, 1286, 18962, 1116, 6911, 17784, 22954, 2139, 6172, 4700, 1234, 1121, 7153, 7932, 1234, 9223, 1426, 27453, 5100, 3382, 7862, 1441, 112, 188, 2854, 4700, 2139, 2563, 1121, 21164, 1670, 10425, 4038, 2139, 156, 21641, 8051, 7099, 2139, 12118, 7412, 20619, 1305, 5109, 1453, 2139, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
The Sigtuna rib (signum U NOR1998;25) is a 12th-century runic amulet found in the 1990s in Sigtuna, Uppland. Description The amulet is a rib bone. Inscription Scandinavian Runic-text Database The Scandinavian Runic-text Database offers the following "standard" readings: Transliteration: §A iorils × ouriþ × uaksna ur : kroke × bat han × riþu × bar-… §B han : riþu × aok × siþa × sarþ × sararan × uara × hafir × fult ¶ f(e)kit × fly : braot riþa Old West Norse normalization §A Jórils vrið!/óvrið vaksna ur Króki! Bant hann riðu, bar[ði](?) §B hann riðu. Ok síða(?) sarð sára-rann. Vara hefir (hann) fullt fengit. Flý braut riða! Runic Swedish normalization §A Iōrils vrið!/ovrið vaksna uʀ Krōki! Bant hann riðu, bar[ði](?) §B hann riðu. Ok sīða(?) sarð sāra-rann. Vara hafiʀ (hann) fullt fængit. Flȳ braut riða! English translation §A Jórill's woundcauser / Jórill's abnormal stomach-ache disappear from Krókr! He bound the fever, he fought(?) §B the fever. And did away with the abscess. (He) has fully cought the pus. Flee away, fever! Notes References Further reading See also Sigtuna amulet I Canterbury charm Kvinneby amulet 12th-century inscriptions 1990s archaeological discoveries Archaeology of Sweden Runic inscriptions Historical runic magic Norse paganism Sources on Germanic paganism Occult texts Amulets
[ 101, 1109, 14159, 19815, 9291, 23298, 113, 2951, 1818, 158, 24819, 2069, 16382, 1580, 1604, 132, 1512, 114, 1110, 170, 5247, 118, 1432, 1576, 1596, 1821, 20117, 1276, 1107, 1103, 3281, 1107, 14159, 19815, 9291, 117, 3725, 1643, 1931, 119, 14177, 27530, 1109, 1821, 20117, 1110, 170, 23298, 6028, 119, 1130, 19256, 18936, 6728, 1596, 118, 3087, 22929, 1109, 18936, 6728, 1596, 118, 3087, 22929, 3272, 1103, 1378, 107, 2530, 107, 17813, 131, 13809, 21998, 6108, 131, 204, 138, 178, 9012, 3447, 240, 1412, 1182, 28210, 240, 190, 27843, 1605, 190, 1197, 131, 180, 20265, 240, 7693, 5871, 1179, 240, 187, 1182, 28210, 1358, 240, 2927, 118, 795, 204, 139, 5871, 1179, 131, 187, 1182, 28210, 1358, 240, 170, 5926, 240, 27466, 28210, 1161, 240, 21718, 1197, 28210, 240, 21718, 22190, 1389, 240, 190, 4626, 240, 5871, 8702, 1197, 240, 175, 7067, 217, 175, 113, 174, 114, 11622, 240, 4689, 131, 12418, 3329, 187, 1182, 28210, 1161, 2476, 1537, 16152, 2999, 2734, 204, 138, 147, 7774, 13217, 1116, 191, 2047, 28204, 106, 120, 265, 1964, 2047, 28204, 191, 27843, 1605, 190, 1197, 148, 1197, 7774, 2293, 106, 18393, 1204, 5871, 9238, 187, 1182, 28204, 1358, 117, 2927, 164, 262, 1182, 166, 113, 136, 114, 204, 139, 5871, 9238, 187, 1182, 28204, 1358, 119, 23330, 188, 6212, 28204, 1161, 113, 136, 114, 21718, 1197, 28204, 188, 5589, 1611, 118, 1868, 1179, 119, 159, 4626, 1119, 8702, 1197, 113, 5871, 9238, 114, 1554, 1204, 175, 14429, 2875, 119, 143, 1233, 13933, 12418, 3818, 187, 1182, 28204, 1161, 106, 6728, 1596, 3619, 2999, 2734, 204, 138, 146, 4587, 13217, 1116, 191, 2047, 28204, 106, 120, 184, 1964, 2047, 28204, 191, 27843, 1605, 190, 28286, 148, 19651, 2293, 106, 18393, 1204, 5871, 9238, 187, 1182, 28204, 1358, 117, 2927, 164, 262, 1182, 166, 113, 136, 114, 204, 139, 5871, 9238, 187, 1182, 28204, 1358, 119, 23330, 188, 11756, 28204, 1161, 113, 136, 114, 21718, 1197, 28204, 188, 9663, 1611, 118, 1868, 1179, 119, 159, 4626, 5871, 8702, 28286, 113, 5871, 9238, 114, 1554, 1204, 175, 28200, 2118, 2875, 119, 100, 12418, 3818, 187, 1182, 28204, 1161, 106, 1483, 5179, 204, 138, 147, 7774, 11071, 112, 188, 5785, 2599, 19399, 120, 147, 7774, 11071, 112, 188, 22832, 3472, 118, 12953, 10489, 1121, 148, 1197, 7774, 1377, 1197, 106, 1124, 4930, 1103, 10880, 117, 1119, 3214, 113, 136, 114, 204, 139, 1103, 10880, 119, 1262, 1225, 1283, 1114, 1103, 170, 4832, 22371, 119, 113, 1124, 114, 1144, 3106, 21810, 1204, 1103, 23609, 1116, 119, 143, 6894, 1283, 117, 10880, 106, 8797, 19714, 1116, 6940, 3455, 3969, 1145, 14159, 19815, 9291, 1821, 20117, 146, 9763, 11967, 148, 6871, 1673, 2665, 1821, 20117, 5247, 118, 1432, 14212, 3281, 8962, 17707, 20193, 1104, 3865, 6728, 1596, 14212, 6794, 1576, 1596, 3974, 16152, 21253, 1863, 22656, 1113, 15886, 21253, 1863, 152, 19515, 7067, 6685, 7277, 20117, 1116, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Humber College is a below-grade light rail transit (LRT) station under construction on Line 6 Finch West, a new line that is part of the Toronto subway system. The station will be located at the southwest corner of Highway 27 and Humber College Boulevard on the Humber College North Campus in Etobicoke, Toronto. The station will be the western terminus of Line 6, which is scheduled to open in 2023. Description The station will be located below street level in an open trench running parallel to Highway 27. The station will have two street-level entrances, one entrance on the south side of Humber College Boulevard, the second further south facing a new street that will intersect with Highway 27. The entrance structures will be at least in height, and will each face a plaza. The centre platform will have several canopies for weather protection. The lack of a roof over the trench will allow natural lighting on the platform. Wi-Fi will be available at the station. The station will have 3 parallel tracks. Two tracks will flank the island platform. The track on the west side of the station will have no platform, but will be flanked by service walkways. North of the station, the line continues in a trench beside Highway 7 until Finch Avenue West where it enters a short tunnel curving under the intersection to continue on the surface towards Finch West station. Between Humber College station and the portal on Finch Avenue, there are no level crossings. Surface connections Humber College has an existing bus terminal located approximately west of the future rail station. It is served by buses from the TTC, Miway, Brampton Transit, Züm, and York Region Transit. References External links Line 6 Finch West stations Railway stations in Canada at university and college campuses Humber College
[ 101, 20164, 10615, 1531, 1110, 170, 2071, 118, 3654, 1609, 4356, 9575, 113, 149, 10460, 114, 1466, 1223, 2058, 1113, 2800, 127, 19143, 1537, 117, 170, 1207, 1413, 1115, 1110, 1226, 1104, 1103, 3506, 14790, 1449, 119, 1109, 1466, 1209, 1129, 1388, 1120, 1103, 5090, 2655, 1104, 3580, 1765, 1105, 20164, 10615, 1531, 8691, 1113, 1103, 20164, 10615, 1531, 1456, 8838, 1107, 142, 2430, 15421, 9143, 117, 3506, 119, 1109, 1466, 1209, 1129, 1103, 2466, 7132, 1104, 2800, 127, 117, 1134, 1110, 4533, 1106, 1501, 1107, 17881, 1495, 119, 14177, 27530, 1109, 1466, 1209, 1129, 1388, 2071, 2472, 1634, 1107, 1126, 1501, 19374, 1919, 5504, 1106, 3580, 1765, 119, 1109, 1466, 1209, 1138, 1160, 2472, 118, 1634, 19914, 117, 1141, 3448, 1113, 1103, 1588, 1334, 1104, 20164, 10615, 1531, 8691, 117, 1103, 1248, 1748, 1588, 4749, 170, 1207, 2472, 1115, 1209, 9455, 26338, 1114, 3580, 1765, 119, 1109, 3448, 4413, 1209, 1129, 1120, 1655, 1107, 3976, 117, 1105, 1209, 1296, 1339, 170, 19075, 119, 1109, 2642, 3482, 1209, 1138, 1317, 1169, 4184, 1905, 1111, 4250, 3636, 119, 1109, 2960, 1104, 170, 3664, 1166, 1103, 19374, 1209, 2621, 2379, 7570, 1113, 1103, 3482, 119, 160, 1182, 118, 17355, 1209, 1129, 1907, 1120, 1103, 1466, 119, 1109, 1466, 1209, 1138, 124, 5504, 2390, 119, 1960, 2390, 1209, 12509, 1103, 2248, 3482, 119, 1109, 1854, 1113, 1103, 1745, 1334, 1104, 1103, 1466, 1209, 1138, 1185, 3482, 117, 1133, 1209, 1129, 16947, 1118, 1555, 22010, 1116, 119, 1456, 1104, 1103, 1466, 117, 1103, 1413, 3430, 1107, 170, 19374, 3148, 3580, 128, 1235, 19143, 3194, 1537, 1187, 1122, 7603, 170, 1603, 5280, 24016, 1223, 1103, 6326, 1106, 2760, 1113, 1103, 2473, 2019, 19143, 1537, 1466, 119, 3847, 20164, 10615, 1531, 1466, 1105, 1103, 10823, 1113, 19143, 3194, 117, 1175, 1132, 1185, 1634, 24605, 119, 22017, 6984, 20164, 10615, 1531, 1144, 1126, 3685, 3592, 6020, 1388, 2324, 1745, 1104, 1103, 2174, 4356, 1466, 119, 1135, 1110, 1462, 1118, 8049, 1121, 1103, 157, 9481, 117, 12107, 2787, 117, 22924, 11927, 9972, 117, 163, 17176, 1306, 117, 1105, 1365, 4171, 9972, 119, 19714, 1116, 22841, 6743, 2800, 127, 19143, 1537, 2930, 2847, 2930, 1107, 1803, 1120, 2755, 1105, 2134, 14495, 20164, 10615, 1531, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Momodu is given name and surname common in West Africa. Notable people with the surname include: Given name Momodu Bama, second in command of the militant Islamist group Boko Haram Momodu Kargbo, Sierra Leonean politician and economist Momodu Koroma, Sierra Leonean politician Momodu Maligie, Sierra Leonean politician and former Minister of Water Resources for Sierra Leone. Momodu Munu, former diplomat from Sierra Leone. Momodu Mutairu, former Nigerian football player. Surname Dele Momodu, Nigerian journalist
[ 101, 4563, 5412, 1358, 1110, 1549, 1271, 1105, 12239, 1887, 1107, 1537, 2201, 119, 11017, 1234, 1114, 1103, 12239, 1511, 131, 10470, 1271, 4563, 5412, 1358, 18757, 1918, 117, 1248, 1107, 2663, 1104, 1103, 19850, 6489, 1776, 1372, 9326, 2718, 21046, 1306, 4563, 5412, 1358, 14812, 10805, 4043, 117, 7384, 13774, 1389, 2931, 1105, 14893, 4563, 5412, 1358, 19892, 18885, 117, 7384, 13774, 1389, 2931, 4563, 5412, 1358, 17168, 9747, 117, 7384, 13774, 1389, 2931, 1105, 1393, 2110, 1104, 4434, 9868, 1111, 7384, 13774, 119, 4563, 5412, 1358, 19569, 14787, 117, 1393, 11608, 1121, 7384, 13774, 119, 4563, 5412, 1358, 19569, 13564, 5082, 117, 1393, 11960, 1709, 1591, 119, 17078, 16124, 9352, 1162, 4563, 5412, 1358, 117, 11960, 4391, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Elizabeth Fowler is an American lawyer who is Director of the Center for Medicare and Medicaid Innovation. She previously served under President Barack Obama at the National Economic Council. In 2022, she was included by Stat News on their list of leaders in the life sciences. Early life and education Fowler was an undergraduate student in health care management at the University of Pennsylvania. She moved to the Johns Hopkins Bloomberg School of Public Health. Her research considered risk adjustment. After earning her Ph.D. there, she enrolled at the University of Minnesota Law School. She was admitted to the bar in Maryland. Career After earning her Juris Doctor degree, Fowler joined the Park Nicollet Foundation in Minnesota. There, she spent almost five years researching health services. She worked as an attorney at Hogan Lovells, a law firm based in Washington, D.C. Fowler worked at Vice President for Public Policy at Anthem (then WellPoint). During the health reform debate, Fowler served as Chief Health Counsel to Max Baucus and worked on health reform for the United States Senate. Fowler was appointed special assistant to President Barack Obama, working on economic policy at the National Economic Council. She was involved with the design and delivery of the Affordable Care Act. After leaving the Obama administration, Fowler joined Johnson & Johnson as vice president for Global Health. In March 2021, Fowler was appointed by Joe Biden to serve as Director of the Center for Medicare and Medicaid Innovation at the Department of Health and Human Services. She is responsible for developing the Medicare payment models. In 2022, she was included by Stat News on its list of leaders in the life sciences. References American women lawyers Living people Year of birth missing (living people) University of Pennsylvania alumni Johns Hopkins Bloomberg School of Public Health alumni University of Minnesota alumni People associated with Hogan Lovells
[ 101, 3019, 15738, 1110, 1126, 1237, 4545, 1150, 1110, 2524, 1104, 1103, 1945, 1111, 2508, 13328, 8836, 1105, 2508, 13328, 19954, 13886, 119, 1153, 2331, 1462, 1223, 1697, 14319, 7661, 1120, 1103, 1305, 6051, 1761, 119, 1130, 17881, 1477, 117, 1131, 1108, 1529, 1118, 1457, 2980, 3128, 1113, 1147, 2190, 1104, 3478, 1107, 1103, 1297, 8614, 119, 4503, 1297, 1105, 1972, 15738, 1108, 1126, 8448, 2377, 1107, 2332, 1920, 2635, 1120, 1103, 1239, 1104, 2680, 119, 1153, 1427, 1106, 1103, 11673, 10055, 25638, 1323, 1104, 2710, 3225, 119, 1430, 1844, 1737, 3187, 23427, 119, 1258, 6957, 1123, 7642, 119, 141, 119, 1175, 117, 1131, 7945, 1120, 1103, 1239, 1104, 4332, 2601, 1323, 119, 1153, 1108, 4120, 1106, 1103, 2927, 1107, 4624, 119, 17062, 1258, 6957, 1123, 23915, 4889, 4157, 2178, 117, 15738, 1688, 1103, 1670, 21283, 4838, 1204, 2974, 1107, 4332, 119, 1247, 117, 1131, 2097, 1593, 1421, 1201, 22513, 2332, 1826, 119, 1153, 1589, 1112, 1126, 6507, 1120, 15603, 2185, 9872, 117, 170, 1644, 3016, 1359, 1107, 1994, 117, 141, 119, 140, 119, 15738, 1589, 1120, 4070, 1697, 1111, 2710, 7037, 1120, 1760, 25962, 113, 1173, 2119, 2101, 21506, 114, 119, 1507, 1103, 2332, 5851, 5655, 117, 15738, 1462, 1112, 2534, 3225, 18645, 1106, 3405, 18757, 21977, 1361, 1105, 1589, 1113, 2332, 5851, 1111, 1103, 1244, 1311, 3279, 119, 15738, 1108, 1923, 1957, 3109, 1106, 1697, 14319, 7661, 117, 1684, 1113, 2670, 2818, 1120, 1103, 1305, 6051, 1761, 119, 1153, 1108, 2017, 1114, 1103, 1902, 1105, 6779, 1104, 1103, 138, 3101, 6944, 1895, 8396, 2173, 119, 1258, 2128, 1103, 7661, 3469, 117, 15738, 1688, 2921, 111, 2921, 1112, 4711, 2084, 1111, 5357, 3225, 119, 1130, 1345, 17881, 1475, 117, 15738, 1108, 1923, 1118, 2658, 139, 26859, 1106, 2867, 1112, 2524, 1104, 1103, 1945, 1111, 2508, 13328, 8836, 1105, 2508, 13328, 19954, 13886, 1120, 1103, 1951, 1104, 3225, 1105, 4243, 4326, 119, 1153, 1110, 2784, 1111, 4297, 1103, 2508, 13328, 8836, 7727, 3584, 119, 1130, 17881, 1477, 117, 1131, 1108, 1529, 1118, 1457, 2980, 3128, 1113, 1157, 2190, 1104, 3478, 1107, 1103, 1297, 8614, 119, 19714, 1116, 1237, 1535, 10630, 7932, 1234, 2381, 1104, 3485, 3764, 113, 1690, 1234, 114, 1239, 1104, 2680, 12762, 11673, 10055, 25638, 1323, 1104, 2710, 3225, 12762, 1239, 1104, 4332, 12762, 2563, 2628, 1114, 15603, 2185, 9872, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
"School Spirit" is the eleventh episode of the first season of Hulu's horror anthology streaming television series Into the Dark. The feature-length episode was directed by Mike Gan, who co-wrote the episode's teleplay. It was released on Hulu on August 2, 2019. The holiday for this episode is the first day of school. Synopsis The film opens with the brutal murder of two teenagers who have broken into their high school, Helbrook. It then cuts to a video of Erica, a senior hoping to attend Harvard and the student body president, advising her graduating peers to take their final days to take chances while they still can. She is then shown going to school to attend Saturday detention, something that she hides from her former boyfriend, Jason. Erica also hides the reason she received detention from the other attendees, Lizzy, Russ, Vic, and Brett, despite their interest and disbelief. The school's Vice Principal tasks the students with the cleaning of the library before leaving for his office. Once he's gone the teens relax and smoke pot, with the exception of Brett, and they discuss the urban legend that the school is haunted by the ghost of a dead teacher who slaughtered misbehaving students. As the day progresses the students are picked off one by one by the same killer seen earlier in the film. Erica's ex Jason is also killed after he snuck into the school to persuade her to resume their relationship. The group's dwindling numbers is initially attributed to the missing teenagers escaping from detention, but they soon realize that something more sinister is at hand. Eventually only Erica is left alive and she is knocked unconscious by the killer. She awakens to find herself tied up in the school's basement, where she realizes that the killer is Brett. He informs her that he is the son of the dead teacher and that he has been living in the basement since her death. Brett began killing students that misbehaved, as he saw their actions as tarnishing the school's image. He spared Erica because he saw her as a pure, virtuous girl and thought that the detention would be his only way to meet her in person. Brett was dismayed when it was eventually revealed that she was in detention for cheating, something he was reluctant to see as true. Realizing that he has a crush on her, Erica convinces him to untie her so they can dance together. Once freed, Erica attacks Brett and kills him. As he dies, she reveals that she is far from a pure, virtuous girl as she regularly cheated, had sex, and did drugs - she just hid this to protect her public image. Erica then leaves the school, where she is met by police officers. The film ends with her using the tragedy as a way to promote herself in the media and ensure that she is accepted to Harvard. Cast Annie Q. as Erica Corey Fogelmanis as Brett Jessi Case as Lizzy Julian Works as Vic Jordan Austin Smith as Jason Philip Labes as Russ Hugo Armstrong as Mr. Armstrong Graham Taylor as Todd Rickey Alexander Wilson as Chester Production While filming director Mike Gan "wanted to combine the great slasher films of the '90s like Scream and I Know What You Did Last Summer with the iconic character ensembles of the '80s films like Breakfast Club". Gan wanted to avoid the characters coming across as stereotypical, so all of the characters were written "as if each one was the hero of the movie and I think that really helped because they weren’t one-noted and we really got to see different sides." Actors Corey Fogelmanis and Annie Q. were brought on to portray two of the film's central characters, Erica and Brett, based on a script written by Gan, Pat Casey, and Josh Miller. The character of Erica was written specifically as Asian-American. Filming took place in three locations, two high schools and a sound stage, and Gan stated that it was a challenge as one of the schools still had students in class and they had to make the film look like it was taking place in one school. The crew shot at a fast pace, filming about 8-9 pages a day. Release Hulu released "School Spirit" on August 2, 2019. Episodes of Into the Dark are themed around holidays and other landmark days; the holiday for "School Spirit" is the first day of school. Reception As of September 2021 "School Spirit" has a rating of 50% on Rotten Tomatoes, based on 6 reviews. The reviewer for RogerEbert.com noted that the first day of school was a bit of a stretch for the show's holiday theme, also criticizing the episode's dialogue and visuals. Daily Dot and Slash Film both criticized "School Spirit" as formulaic, with Matt Donato of Slash Film summing it up as "not outright bad, nor unwatchable, but "harmless" or "unenthusiastic."" Screen Anarchy was more favorable while also voicing similar criticisms. References External links Into the Dark (TV series) episodes 2019 American television episodes 2010s American horror television series 2010s American mystery television series 2010s American anthology television series English-language television shows Horror drama television series Serial killers in television Television shows set in the United States Television series about teenagers Television shows about death
[ 101, 107, 1323, 7258, 107, 1110, 1103, 14079, 2004, 1104, 1103, 1148, 1265, 1104, 20164, 7535, 112, 188, 5367, 12315, 11403, 1778, 1326, 14000, 1103, 4753, 119, 1109, 2672, 118, 2251, 2004, 1108, 2002, 1118, 2639, 144, 1389, 117, 1150, 1884, 118, 1724, 1103, 2004, 112, 188, 21359, 1513, 11044, 119, 1135, 1108, 1308, 1113, 20164, 7535, 1113, 1360, 123, 117, 10351, 119, 1109, 7946, 1111, 1142, 2004, 1110, 1103, 1148, 1285, 1104, 1278, 119, 156, 5730, 26756, 1109, 1273, 7086, 1114, 1103, 12800, 3513, 1104, 1160, 13663, 1150, 1138, 3088, 1154, 1147, 1344, 1278, 117, 1124, 1233, 8489, 119, 1135, 1173, 7484, 1106, 170, 1888, 1104, 21205, 117, 170, 2682, 4717, 1106, 4739, 5051, 1105, 1103, 2377, 1404, 2084, 117, 28002, 1123, 6282, 14097, 1106, 1321, 1147, 1509, 1552, 1106, 1321, 9820, 1229, 1152, 1253, 1169, 119, 1153, 1110, 1173, 2602, 1280, 1106, 1278, 1106, 4739, 4306, 13826, 117, 1380, 1115, 1131, 18915, 1121, 1123, 1393, 6508, 117, 3627, 119, 21205, 1145, 18915, 1103, 2255, 1131, 1460, 13826, 1121, 1103, 1168, 23150, 117, 8719, 6482, 117, 19809, 117, 11600, 117, 1105, 12161, 117, 2693, 1147, 2199, 1105, 12962, 119, 1109, 1278, 112, 188, 4070, 8013, 8249, 1103, 1651, 1114, 1103, 9374, 1104, 1103, 3340, 1196, 2128, 1111, 1117, 1701, 119, 2857, 1119, 112, 188, 2065, 1103, 15050, 10482, 1105, 5427, 9814, 117, 1114, 1103, 5856, 1104, 12161, 117, 1105, 1152, 6265, 1103, 3953, 7051, 1115, 1103, 1278, 1110, 13526, 1118, 1103, 7483, 1104, 170, 2044, 3218, 1150, 26071, 1940, 1116, 3962, 22300, 1651, 119, 1249, 1103, 1285, 25541, 1103, 1651, 1132, 3015, 1228, 1141, 1118, 1141, 1118, 1103, 1269, 7010, 1562, 2206, 1107, 1103, 1273, 119, 21205, 112, 188, 4252, 3627, 1110, 1145, 1841, 1170, 1119, 27731, 1154, 1103, 1278, 1106, 14528, 1123, 1106, 14926, 1147, 2398, 119, 1109, 1372, 112, 188, 173, 11129, 1979, 2849, 1110, 2786, 6547, 1106, 1103, 3764, 13663, 13755, 1121, 13826, 117, 1133, 1152, 1770, 4663, 1115, 1380, 1167, 20975, 1110, 1120, 1289, 119, 6382, 1178, 21205, 1110, 1286, 3534, 1105, 1131, 1110, 6011, 9719, 1118, 1103, 7010, 119, 1153, 8264, 2316, 1106, 1525, 1941, 4353, 1146, 1107, 1103, 1278, 112, 188, 8078, 117, 1187, 1131, 10875, 1115, 1103, 7010, 1110, 12161, 119, 1124, 16788, 1123, 1115, 1119, 1110, 1103, 1488, 1104, 1103, 2044, 3218, 1105, 1115, 1119, 1144, 1151, 1690, 1107, 1103, 8078, 1290, 1123, 1473, 119, 12161, 1310, 3646, 1651, 1115, 1940, 1116, 3962, 22145, 1181, 117, 1112, 1119, 1486, 1147, 3721, 1112, 27629, 4558, 10506, 1103, 1278, 112, 188, 3077, 119, 1124, 18173, 21205, 1272, 1119, 1486, 1123, 1112, 170, 5805, 117, 191, 25074, 8163, 1873, 1105, 1354, 1115, 1103, 13826, 1156, 1129, 1117, 1178, 1236, 1106, 2283, 1123, 1107, 1825, 119, 12161, 1108, 22035, 1174, 1165, 1122, 1108, 2028, 3090, 1115, 1131, 1108, 1107, 13826, 1111, 18661, 117, 1380, 1119, 1108, 12061, 1106, 1267, 1112, 2276, 119, 5230, 4404, 1115, 1119, 1144, 170, 11321, 1113, 1123, 117, 21205, 21227, 1140, 1106, 8362, 9570, 1123, 1177, 1152, 1169, 2842, 1487, 119, 2857, 11485, 117, 21205, 3690, 12161, 1105, 8567, 1140, 119, 1249, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
A presidential recall referendum will be held in Mexico on 10 April 2022 to decide if the incumbent President Andrés Manuel López Obrador should stay in office and serve his full six-year term. References Mexico Referendums in Mexico 2022 in Mexico
[ 101, 138, 5200, 9148, 9905, 1209, 1129, 1316, 1107, 2470, 1113, 1275, 1364, 17881, 1477, 1106, 4958, 1191, 1103, 8021, 1697, 22023, 7283, 13629, 152, 6766, 8380, 1431, 2215, 1107, 1701, 1105, 2867, 1117, 1554, 1565, 118, 1214, 1858, 119, 19714, 1116, 2470, 11336, 6732, 6696, 17167, 1107, 2470, 17881, 1477, 1107, 2470, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Cyperus dichrostachyus is a species of sedge that is native to parts of Africa. See also List of Cyperus species References dichrostachyus Plants described in 1850 Taxa named by Christian Ferdinand Friedrich Hochstetter Flora of Madagascar Flora of the Democratic Republic of the Congo Flora of Zambia Flora of Zimbabwe Flora of Angola Flora of Burundi Flora of Cameroon Flora of Eritrea Flora of Ethiopia Flora of Kenya Flora of Malawi Flora of Rwanda Flora of Sudan Flora of Tanzania Flora of Uganda Flora of South Africa
[ 101, 27688, 3365, 1361, 4267, 1732, 5864, 1777, 8992, 1361, 1110, 170, 1530, 1104, 14516, 8484, 1115, 1110, 2900, 1106, 2192, 1104, 2201, 119, 3969, 1145, 5619, 1104, 27688, 3365, 1361, 1530, 19714, 1116, 4267, 1732, 5864, 1777, 8992, 1361, 25880, 1758, 1107, 7493, 13429, 1161, 1417, 1118, 2131, 9422, 8523, 9800, 17704, 1566, 8634, 15527, 1104, 12014, 15527, 1104, 1103, 2978, 2250, 1104, 1103, 8695, 15527, 1104, 16512, 15527, 1104, 11395, 15527, 1104, 13833, 15527, 1104, 139, 12328, 12090, 15527, 1104, 14292, 15527, 1104, 142, 7729, 11811, 15527, 1104, 11132, 15527, 1104, 7469, 15527, 1104, 19597, 15527, 1104, 18845, 15527, 1104, 10299, 15527, 1104, 12037, 15527, 1104, 9831, 15527, 1104, 1375, 2201, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Joseph A. Zombek (December 24, 1932 – January 13, 1996) was an American football defensive end and punter who played two seasons in the National Football League (NFL) for the Pittsburgh Steelers. He played college football at Pittsburgh, and was drafted by the Steelers in the 9th round of the 1954 NFL Draft. Early life and education Zombek was born on December 24, 1932, in Carnegie, Pennsylvania. He attended Clark High School in Scott Township, and was an all-state performer in football as a senior in 1949. He enrolled at the University of Pittsburgh in 1950, where he was a three-year letterman in football. He majored in geography. A profile of Zombek in The Pittsburgh Press wrote of him: "A happy-go-lucky lad who likes to tinker with cars in his spare time, he permits no friendships once he takes the field. His charge makes up for lack of heft. He tips the scale at 185 and is a deadly tackler." Professional career After finishing his senior season of college, Zombek was drafted by the Pittsburgh Steelers of the National Football League (NFL), in the 9th round (103rd overall) of the 1954 NFL Draft. Zombek was the final player released in roster cuts. Coach Walt Kiesling said that the final cut had come down to either Zombek or Ernie Cheatham, and kept Cheatham. After receiving film of Zombek the next day, Kielsing "knew he had cut the wrong man." "We had to cut by Tuesday," said coach Kiesling, "and we made a cut in the blind. When we saw the movies we realized we made a mistake." However, due to league rules, he was not eligible to be re-signed until 30 days after the release. After an injury to Bill McPeak, Zombek came back to the team for their game with the Philadelphia Eagles. Zombek finished the season having played in eight games, one as a starter. He returned to Pittsburgh for the 1955 season, and changed his position to punter. He played in one game, at both end and punter, before being released. Later life and death Zombek later was a salesman and manager at Jessop Steel Co. from 1956 to 1967, and was the owner of the Cherry Hills Inn and Resort in McDonald, Pennsylvania, from 1964 to until at least 1987. Zombek was inducted into the Western Chapter of Pennsylvania Sports Hall of Fame in 1987. References Further reading 1932 births 1996 deaths American football defensive ends American football ends American football punters Pittsburgh Panthers football players Players of American football from Pennsylvania Pittsburgh Steelers players
[ 101, 2419, 138, 119, 163, 20972, 4820, 113, 1382, 1572, 117, 3833, 782, 1356, 1492, 117, 1820, 114, 1108, 1126, 1237, 1709, 5341, 1322, 1105, 22498, 1200, 1150, 1307, 1160, 2955, 1107, 1103, 1305, 2289, 1453, 113, 4279, 114, 1111, 1103, 5610, 16060, 119, 1124, 1307, 2134, 1709, 1120, 5610, 117, 1105, 1108, 7071, 1118, 1103, 16060, 1107, 1103, 5612, 1668, 1104, 1103, 3183, 4279, 7060, 119, 4503, 1297, 1105, 1972, 163, 20972, 4820, 1108, 1255, 1113, 1382, 1572, 117, 3833, 117, 1107, 11298, 117, 2680, 119, 1124, 2323, 4425, 1693, 1323, 1107, 2796, 3671, 117, 1105, 1108, 1126, 1155, 118, 1352, 9963, 1107, 1709, 1112, 170, 2682, 1107, 3224, 119, 1124, 7945, 1120, 1103, 1239, 1104, 5610, 1107, 3067, 117, 1187, 1119, 1108, 170, 1210, 118, 1214, 2998, 1399, 1107, 1709, 119, 1124, 1558, 1174, 1107, 14534, 119, 138, 6168, 1104, 163, 20972, 4820, 1107, 1109, 5610, 2544, 1724, 1104, 1140, 131, 107, 138, 2816, 118, 1301, 118, 6918, 19122, 1150, 7407, 1106, 14086, 4188, 1114, 3079, 1107, 1117, 8608, 1159, 117, 1119, 15267, 1185, 7157, 1116, 1517, 1119, 2274, 1103, 1768, 119, 1230, 2965, 2228, 1146, 1111, 2960, 1104, 1119, 4964, 119, 1124, 10538, 1103, 3418, 1120, 16183, 1105, 1110, 170, 10310, 11407, 1197, 119, 107, 6861, 1578, 1258, 4416, 1117, 2682, 1265, 1104, 2134, 117, 163, 20972, 4820, 1108, 7071, 1118, 1103, 5610, 16060, 1104, 1103, 1305, 2289, 1453, 113, 4279, 114, 117, 1107, 1103, 5612, 1668, 113, 9550, 2956, 2905, 114, 1104, 1103, 3183, 4279, 7060, 119, 163, 20972, 4820, 1108, 1103, 1509, 1591, 1308, 1107, 9197, 7484, 119, 6522, 10495, 14477, 1279, 1979, 1163, 1115, 1103, 1509, 2195, 1125, 1435, 1205, 1106, 1719, 163, 20972, 4820, 1137, 15271, 20394, 13448, 2522, 117, 1105, 2023, 20394, 13448, 2522, 119, 1258, 4172, 1273, 1104, 163, 20972, 4820, 1103, 1397, 1285, 117, 23144, 4253, 107, 1450, 1119, 1125, 2195, 1103, 2488, 1299, 119, 107, 107, 1284, 1125, 1106, 2195, 1118, 9667, 117, 107, 1163, 2154, 14477, 1279, 1979, 117, 107, 1105, 1195, 1189, 170, 2195, 1107, 1103, 7198, 119, 1332, 1195, 1486, 1103, 5558, 1195, 2788, 1195, 1189, 170, 6223, 119, 107, 1438, 117, 1496, 1106, 2074, 2995, 117, 1119, 1108, 1136, 7408, 1106, 1129, 1231, 118, 1878, 1235, 1476, 1552, 1170, 1103, 1836, 119, 1258, 1126, 3773, 1106, 2617, 150, 1665, 2101, 23783, 117, 163, 20972, 4820, 1338, 1171, 1106, 1103, 1264, 1111, 1147, 1342, 1114, 1103, 3562, 8507, 119, 163, 20972, 4820, 1845, 1103, 1265, 1515, 1307, 1107, 2022, 1638, 117, 1141, 1112, 170, 12302, 119, 1124, 1608, 1106, 5610, 1111, 1103, 3115, 1265, 117, 1105, 2014, 1117, 1700, 1106, 22498, 1200, 119, 1124, 1307, 1107, 1141, 1342, 117, 1120, 1241, 1322, 1105, 22498, 1200, 117, 1196, 1217, 1308, 119, 2611, 1297, 1105, 1473, 163, 20972, 4820, 1224, 1108, 170, 23259, 1105, 2618, 1120, 12419, 4184, 8180, 3291, 119, 1121, 2990, 1106, 2573, 117, 1105, 1108, 1103, 3172, 1104, 1103, 11328, 5377, 9859, 1105, 15579, 1107, 9092, 117, 2680, 117, 1121, 2668, 1106, 1235, 1120, 1655, 2164, 119, 163, 20972, 4820, 1108, 8016, 1154, 1103, 2102, 2943, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
is a Japanese artistic gymnast. Competitive history Detailed results See also Japan men's national gymnastics team 2021 Top Scorers in Men's Artistic Gymnastics References External links Shohei Kawakami at FIG Official Japanese male artistic gymnasts Sportspeople from Ehime Prefecture Living people 2003 births
[ 101, 1110, 170, 1983, 6037, 10759, 27897, 119, 3291, 8223, 26883, 3946, 1607, 27524, 17239, 2686, 3969, 1145, 1999, 1441, 112, 188, 1569, 20679, 1264, 17881, 1475, 3299, 18417, 1733, 1107, 3401, 112, 188, 19503, 144, 17162, 27897, 4724, 19714, 1116, 22841, 6743, 156, 5114, 4638, 1182, 14812, 3624, 1968, 3080, 1120, 143, 23413, 9018, 1983, 2581, 6037, 10759, 27897, 1116, 3692, 21159, 1121, 142, 14565, 1162, 8197, 7932, 1234, 1581, 20665, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
The Woman He Loved is a 1922 American silent drama film directed by Edward Sloman and starring William V. Mong, Marcia Manon and Mary Wynn. Cast William V. Mong as Nathan Levinsky Marcia Manon as Esther Levinsky A. Edward Sutherland as Jimmy Danvers Mary Wynn as Helen Comstock Charles K. French as John Comstock Fred Malatesta as Max Levy Harvey Clark as John Danvers Bruce Guerin as David Levinsky, as a child Lucille Ward as Rosie Romansky References Bibliography Bell, Geoffrey. The Golden Gate and the Silver Screen. Associated University Presse, 1984 . Connelly, Robert B. The Silents: Silent Feature Films, 1910-36, Volume 40, Issue 2. December Press, 1998. Munden, Kenneth White. The American Film Institute Catalog of Motion Pictures Produced in the United States, Part 1. University of California Press, 1997. External links 1922 films 1922 drama films English-language films American films American silent feature films American drama films American black-and-white films Films directed by Edward Sloman
[ 101, 1109, 5651, 1124, 2185, 1181, 1110, 170, 3988, 1237, 3826, 3362, 1273, 2002, 1118, 2594, 156, 2858, 1399, 1105, 3937, 1613, 159, 119, 22401, 1403, 117, 25663, 2268, 1320, 1105, 2090, 160, 20906, 119, 21452, 1613, 159, 119, 22401, 1403, 1112, 6578, 22104, 4969, 25663, 2268, 1320, 1112, 15261, 22104, 4969, 138, 119, 2594, 14831, 1112, 4479, 4317, 10704, 2090, 160, 20906, 1112, 5673, 3291, 4206, 15960, 1889, 148, 119, 1497, 1112, 1287, 3291, 4206, 15960, 5291, 18880, 5430, 1777, 1112, 3405, 16809, 7206, 4425, 1112, 1287, 4317, 10704, 4767, 144, 10232, 1394, 1112, 1681, 22104, 4969, 117, 1112, 170, 2027, 13174, 8683, 5661, 1112, 16853, 10935, 3781, 19714, 1116, 139, 13292, 27800, 4720, 117, 10985, 119, 1109, 3684, 8375, 1105, 1103, 4826, 15652, 119, 12835, 1239, 2544, 1162, 117, 2219, 119, 18354, 1183, 117, 1823, 139, 119, 1109, 15013, 1116, 131, 15013, 14533, 9141, 117, 4178, 118, 3164, 117, 6849, 1969, 117, 15653, 123, 119, 1382, 2544, 117, 1772, 119, 19569, 28004, 117, 8488, 2061, 119, 1109, 1237, 2352, 2024, 8572, 20151, 1104, 12153, 7392, 13662, 1107, 1103, 1244, 1311, 117, 4539, 122, 119, 1239, 1104, 1756, 2544, 117, 1816, 119, 22841, 6743, 3988, 2441, 3988, 3362, 2441, 1483, 118, 1846, 2441, 1237, 2441, 1237, 3826, 2672, 2441, 1237, 3362, 2441, 1237, 1602, 118, 1105, 118, 1653, 2441, 9141, 2002, 1118, 2594, 156, 2858, 1399, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Pomaderris halmaturina, commonly known as Kangaroo Island pomaderris, is a species of flowering plant in the family Rhamnaceae and is endemic to southern continental Australia. It is a shrub with narrowly elliptic to egg-shaped leaves with toothed or wavy edges, and sparse panicles of hairy, yellowish-green flowers. Description Pomaderris halmaturina is a shrub that typically grows to a height of . The leaves are narrowly elliptic to egg-shaped, long and wide on a petiole long with egg-shaped stipules up to about long at the base, but that fall off as the leaf develops. The upper surface of the leaves is more or less glabrous and the lower surface is densely covered with woolly, star-shaped hairs. The flowers are borne in leaf axils or on the ends of branchlets in panicles or racemes about as long as the leaf at its base, each on a pedicel long. The sepals are long and yellowish-green with woolly, grey, star-shaped hairs on the back, and there are no petals. Flowering occurs in October and November. Taxonomy Pomaderris halmaturina was first formally described in 1925 by John McConnell Black in Transactions and Proceedings of the Royal Society of South Australia from specimens collected on Kangaroo Island. Halmaturus is an old name for a genus of kangaroos. In 1990, Neville Grant Walsh described two subspecies and the names are accepted by the Australian Plant Census: Pomaderris halmaturina subsp. continentis N.G.Walsh has leaves with wavy rather than toothed edges, and smaller flowers than the autonym; Pomaderris halmaturina J.M.Black subsp. halmaturina is listed as "vulnerable" under the Australian Government Environment Protection and Biodiversity Conservation Act 1999. Distribution and habitat Subspecies continentis usually grows in forest or scrub on limestone soils and occurs along the coast of south-eastern South Australia, south-western Victoria and near Torquay and is listed as "rare". Subspecies halmaturina is restricted to Kangaroo Island. References halmaturina Flora of Victoria (Australia) Flora of South Australia Plants described in 1925
[ 101, 18959, 12540, 14791, 1116, 5871, 16882, 20362, 2983, 117, 3337, 1227, 1112, 17614, 25956, 2054, 185, 7903, 2692, 4889, 117, 1110, 170, 1530, 1104, 11853, 2582, 1107, 1103, 1266, 155, 2522, 22636, 19460, 1105, 1110, 6850, 1106, 2359, 10998, 1754, 119, 1135, 1110, 170, 16965, 1114, 11982, 8468, 24021, 1106, 9069, 118, 4283, 2972, 1114, 14051, 1174, 1137, 26985, 7521, 117, 1105, 22726, 7011, 2897, 1104, 18419, 117, 19238, 118, 2448, 4637, 119, 14177, 27530, 18959, 12540, 14791, 1116, 5871, 16882, 20362, 2983, 1110, 170, 16965, 1115, 3417, 7096, 1106, 170, 3976, 1104, 119, 1109, 2972, 1132, 11982, 8468, 24021, 1106, 9069, 118, 4283, 117, 1263, 1105, 2043, 1113, 170, 11109, 19840, 1162, 1263, 1114, 9069, 118, 4283, 188, 27961, 11806, 1146, 1106, 1164, 1263, 1120, 1103, 2259, 117, 1133, 1115, 2303, 1228, 1112, 1103, 7404, 11926, 119, 1109, 3105, 2473, 1104, 1103, 2972, 1110, 1167, 1137, 1750, 176, 1742, 12725, 1361, 1105, 1103, 2211, 2473, 1110, 21265, 2262, 1114, 13103, 1193, 117, 2851, 118, 4283, 14087, 119, 1109, 4637, 1132, 16908, 1107, 7404, 170, 8745, 3447, 1137, 1113, 1103, 3769, 1104, 3392, 9585, 1107, 7011, 2897, 1137, 1886, 6801, 1164, 1112, 1263, 1112, 1103, 7404, 1120, 1157, 2259, 117, 1296, 1113, 170, 185, 24506, 1883, 1263, 119, 1109, 14516, 12320, 1116, 1132, 1263, 1105, 19238, 118, 2448, 1114, 13103, 1193, 117, 5583, 117, 2851, 118, 4283, 14087, 1113, 1103, 1171, 117, 1105, 1175, 1132, 1185, 17270, 119, 14742, 1158, 4365, 1107, 1357, 1105, 1379, 119, 13429, 19608, 18959, 12540, 14791, 1116, 5871, 16882, 20362, 2983, 1108, 1148, 5708, 1758, 1107, 4053, 1118, 1287, 150, 1665, 1658, 26823, 2117, 1107, 13809, 22946, 1105, 20661, 1104, 1103, 1787, 2015, 1104, 1375, 1754, 1121, 9985, 4465, 1113, 17614, 25956, 2054, 119, 12193, 21943, 14022, 1110, 1126, 1385, 1271, 1111, 170, 2804, 1104, 24181, 12253, 24886, 1116, 119, 1130, 1997, 117, 15562, 4468, 10984, 1758, 1160, 11332, 1105, 1103, 2666, 1132, 3134, 1118, 1103, 1925, 9646, 4496, 131, 18959, 12540, 14791, 1116, 5871, 16882, 20362, 2983, 28124, 119, 10995, 1548, 151, 119, 144, 119, 10984, 1144, 2972, 1114, 26985, 1897, 1190, 14051, 1174, 7521, 117, 1105, 2964, 4637, 1190, 1103, 12365, 3382, 1306, 132, 18959, 12540, 14791, 1116, 5871, 16882, 20362, 2983, 147, 119, 150, 119, 2117, 28124, 119, 5871, 16882, 20362, 2983, 1110, 2345, 1112, 107, 8018, 107, 1223, 1103, 1925, 2384, 9247, 8063, 1105, 139, 2660, 3309, 17671, 8749, 2173, 1729, 119, 19806, 1105, 6296, 12859, 20080, 10294, 1905, 10995, 1548, 1932, 7096, 1107, 3304, 1137, 20712, 1113, 10718, 14479, 1105, 4365, 1373, 1103, 3153, 1104, 1588, 118, 2638, 1375, 1754, 117, 1588, 118, 2466, 3006, 1105, 1485, 19928, 13284, 1183, 1105, 1110, 2345, 1112, 107, 4054, 107, 119, 12859, 20080, 10294, 1905, 5871, 16882, 20362, 2983, 1110, 7458, 1106, 17614, 25956, 2054, 119, 19714, 1116, 5871, 16882, 20362, 2983, 15527, 1104, 3006, 113, 1754, 114, 15527, 1104, 1375, 1754, 25880, 1758, 1107, 4053, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
U know is a song by Willow from the 2019 album of the same name. "U Know" may also refer to: "U Know", a song by Prince from the album Art Official Age "U Know", a song by Reks from Rhythmatic Eternal King Supreme Yunho, artist who performs under the stage name U-Know See also "You know", a phrase frequently used as a discourse marker
[ 101, 158, 1221, 1110, 170, 1461, 1118, 15133, 1121, 1103, 10351, 1312, 1104, 1103, 1269, 1271, 119, 107, 158, 9224, 107, 1336, 1145, 5991, 1106, 131, 107, 158, 9224, 107, 117, 170, 1461, 1118, 2558, 1121, 1103, 1312, 2051, 9018, 4936, 107, 158, 9224, 107, 117, 170, 1461, 1118, 11336, 4616, 1121, 15885, 7698, 21342, 1624, 3732, 27413, 5114, 117, 2360, 1150, 10383, 1223, 1103, 2016, 1271, 158, 118, 9224, 3969, 1145, 107, 1192, 1221, 107, 117, 170, 7224, 3933, 1215, 1112, 170, 18644, 13537, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Grafenaschau station () is a railway station in the municipality of Murnau am Staffelsee, in Bavaria, Germany. It is located on the Ammergau Railway of Deutsche Bahn. The station is named for the village of Grafenaschau in the municipality of Schwaigen, located roughly to the southwest. Services the following services stop at Grafenaschau: RB: hourly service between and . References External links Grafenaschau layout Railway stations in Bavaria Buildings and structures in Garmisch-Partenkirchen (district)
[ 101, 25125, 7076, 9022, 3984, 1466, 113, 114, 1110, 170, 2529, 1466, 1107, 1103, 2667, 1104, 19569, 11782, 1358, 1821, 5949, 5999, 3051, 117, 1107, 11632, 117, 1860, 119, 1135, 1110, 1388, 1113, 1103, 7277, 4027, 20130, 2847, 1104, 12054, 18718, 119, 1109, 1466, 1110, 1417, 1111, 1103, 1491, 1104, 25125, 7076, 9022, 3984, 1107, 1103, 2667, 1104, 20452, 24156, 13417, 1179, 117, 1388, 4986, 1106, 1103, 5090, 119, 4326, 1103, 1378, 1826, 1831, 1120, 25125, 7076, 9022, 3984, 131, 24718, 131, 24308, 1555, 1206, 1105, 119, 19714, 1116, 22841, 6743, 25125, 7076, 9022, 3984, 9726, 2847, 2930, 1107, 11632, 19149, 1105, 4413, 1107, 144, 20350, 16253, 118, 4539, 1424, 2293, 26242, 113, 1629, 114, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
In the Sultanate of Morocco, a Khalifa (, "deputy" or "steward"; sometimes translated as "viceroy") was a high-level official who reported directly to the Sultan. Specifically, in the Spanish protectorate in Morocco from 1912 to 1956, the Khalifa () represented the authority of the Sultan and was directly in charge of the affairs of the Muslim and Jewish communities, similarly as the Mendoub in the Tangier International Zone. Etymology The Khalifa's title is the same Arabic word as for the ancient title of Caliph. Residence The Palace of the Khalifa in Tétouan is preserved within what is now the Royal Palace of Tétouan, where it is adjacent to the former residence of the Spanish High Commissioners. It is not open to the public. Another property of the Khalifa, a hilltop villa in Tétouan's northern neighborhood of Touilaa, was in a dilapidated state but still standing as of 2021. List of Khalifas in Tétouan (1913-1923) Hassan Ben el Mehedi Ben Ismael (1924-1956) See also Ismail Ibn Sharif, Khalifa of Fez in 1667-1672 Abu'l Abbas Ahmad of Morocco, Khalifa of Tadla in 1699-1700 Ahmed Belbachir Haskouri List of Spanish high commissioners in Morocco Mendoub References History of Tétouan 20th century in Morocco Gubernatorial titles
[ 101, 1130, 1103, 26607, 1104, 9614, 117, 170, 148, 24486, 8057, 113, 117, 107, 5874, 107, 1137, 107, 26036, 2881, 107, 132, 2121, 4957, 1112, 107, 4711, 9166, 107, 114, 1108, 170, 1344, 118, 1634, 2078, 1150, 2103, 2626, 1106, 1103, 7931, 119, 21325, 117, 1107, 1103, 2124, 23476, 2193, 1107, 9614, 1121, 4080, 1106, 2990, 117, 1103, 148, 24486, 8057, 113, 114, 2533, 1103, 3748, 1104, 1103, 7931, 1105, 1108, 2626, 1107, 2965, 1104, 1103, 5707, 1104, 1103, 4360, 1105, 2778, 3611, 117, 9279, 1112, 1103, 3401, 2572, 10354, 1107, 1103, 10215, 2852, 1570, 6402, 119, 142, 2340, 19969, 1109, 148, 24486, 8057, 112, 188, 1641, 1110, 1103, 1269, 4944, 1937, 1112, 1111, 1103, 2890, 1641, 1104, 11917, 9717, 1324, 119, 18774, 1109, 5130, 1104, 1103, 148, 24486, 8057, 1107, 157, 2744, 2430, 8734, 1110, 6018, 1439, 1184, 1110, 1208, 1103, 1787, 5130, 1104, 157, 2744, 2430, 8734, 117, 1187, 1122, 1110, 4903, 1106, 1103, 1393, 4662, 1104, 1103, 2124, 1693, 19405, 119, 1135, 1110, 1136, 1501, 1106, 1103, 1470, 119, 2543, 2400, 1104, 1103, 148, 24486, 8057, 117, 170, 4665, 9870, 15282, 1107, 157, 2744, 2430, 8734, 112, 188, 2350, 4532, 1104, 1706, 16966, 22118, 117, 1108, 1107, 170, 4267, 16046, 27893, 1352, 1133, 1253, 2288, 1112, 1104, 17881, 1475, 119, 5619, 1104, 148, 24486, 8057, 1116, 1107, 157, 2744, 2430, 8734, 113, 4325, 118, 4123, 114, 13583, 3096, 8468, 2508, 8961, 1182, 3096, 2181, 1918, 1883, 113, 4002, 118, 2990, 114, 3969, 1145, 21851, 14340, 22645, 117, 148, 24486, 8057, 1104, 11907, 1584, 1107, 20104, 1559, 118, 17866, 1477, 8158, 112, 181, 19166, 10870, 1104, 9614, 117, 148, 24486, 8057, 1104, 26741, 1742, 1107, 20065, 1580, 118, 17647, 10045, 26744, 6396, 3161, 10736, 2718, 8212, 5619, 1104, 2124, 1344, 22207, 1107, 9614, 3401, 2572, 10354, 19714, 1116, 2892, 1104, 157, 2744, 2430, 8734, 3116, 1432, 1107, 9614, 144, 15209, 11782, 14155, 1233, 3727, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Cyperus dilatatus is a species of sedge that is native to parts of Africa. See also List of Cyperus species References dilatatus Plants described in 1827 Taxa named by Heinrich Christian Friedrich Schumacher Flora of Benin Flora of Burkina Faso Flora of Chad Flora of the Republic of the Congo Flora of the Central African Republic Flora of Gabon Flora of the Gambia Flora of Ghana Flora of Guinea Flora of Ivory Coast Flora of Mali Flora of Nigeria Flora of Senegal Flora of Sierra Leone Flora of Somalia Flora of Sudan Flora of Tanzania Flora of Uganda Flora of Mali Flora of Nigeria Flora of Senegal Flora of Mali Flora of Nigeria Flora of the Republic of the Congo
[ 101, 27688, 3365, 1361, 4267, 16236, 16582, 1110, 170, 1530, 1104, 14516, 8484, 1115, 1110, 2900, 1106, 2192, 1104, 2201, 119, 3969, 1145, 5619, 1104, 27688, 3365, 1361, 1530, 19714, 1116, 4267, 16236, 16582, 25880, 1758, 1107, 12445, 13429, 1161, 1417, 1118, 10917, 2131, 8523, 24656, 15527, 1104, 23552, 15527, 1104, 25739, 25408, 15527, 1104, 9578, 15527, 1104, 1103, 2250, 1104, 1103, 8695, 15527, 1104, 1103, 1970, 2170, 2250, 15527, 1104, 25806, 15527, 1104, 1103, 144, 2312, 10242, 15527, 1104, 9446, 15527, 1104, 6793, 15527, 1104, 17507, 3331, 15527, 1104, 17168, 15527, 1104, 6860, 15527, 1104, 17419, 15527, 1104, 7384, 13774, 15527, 1104, 15350, 15527, 1104, 10299, 15527, 1104, 12037, 15527, 1104, 9831, 15527, 1104, 17168, 15527, 1104, 6860, 15527, 1104, 17419, 15527, 1104, 17168, 15527, 1104, 6860, 15527, 1104, 1103, 2250, 1104, 1103, 8695, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Dzerzhynske is a village in the Donetsk Oblast of Ukraine. References Populated places in Donetsk Oblast
[ 101, 141, 6198, 1584, 7889, 2316, 2391, 1110, 170, 1491, 1107, 1103, 24243, 23450, 11705, 1104, 5231, 119, 19714, 1116, 7312, 8360, 2844, 1107, 24243, 23450, 11705, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Shevchenko is a crater on Mercury. Its name was adopted by the International Astronomical Union (IAU) in 1976, for Ukrainian poet Taras Hryhorovych Shevchenko. On the west rim of Shevchenko is an unnamed smaller crater that has sharp features and contains hollows. References
[ 101, 1153, 1964, 18599, 1110, 170, 12742, 1113, 10080, 119, 2098, 1271, 1108, 3399, 1118, 1103, 1570, 26545, 1913, 113, 146, 1592, 2591, 114, 1107, 2402, 117, 1111, 5284, 4225, 10235, 1116, 145, 1616, 13252, 3292, 21155, 1153, 1964, 18599, 119, 1212, 1103, 1745, 13840, 1104, 1153, 1964, 18599, 1110, 1126, 14400, 2964, 12742, 1115, 1144, 4295, 1956, 1105, 2515, 11134, 1116, 119, 19714, 1116, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
The 1983–84 Long Island Blackbirds men's basketball team represented Long Island University during the 1983–84 NCAA Division I men's basketball season. The Blackbirds, led by head coach Paul Lizzo, played their home games at the Athletic, Recreation & Wellness Center and were members of the ECAC Metro Conference. They finished the season 20–11, 11–5 in ECAC-M play to capture the regular season championship. They also won the ECAC Metro Tournament to earn an automatic bid in the 1984 NCAA Tournament where they lost in the play-in round to Northeastern, 90–87. Roster Schedule and results |- !colspan=9 style=| Regular season |- !colspan=9 style=| ECAC Metro Tournament |- !colspan=9 style=| NCAA Tournament References Long Island Long Island LIU Brooklyn Blackbirds men's basketball seasons Long Island Blackbirds men's b Long Island Blackbirds men's b
[ 101, 1109, 2278, 782, 5731, 3261, 2054, 2117, 13244, 1441, 112, 188, 3163, 1264, 2533, 3261, 2054, 1239, 1219, 1103, 2278, 782, 5731, 5089, 1784, 146, 1441, 112, 188, 3163, 1265, 119, 1109, 2117, 13244, 117, 1521, 1118, 1246, 2154, 1795, 8719, 6112, 117, 1307, 1147, 1313, 1638, 1120, 1103, 6244, 117, 14094, 111, 2119, 1757, 1945, 1105, 1127, 1484, 1104, 1103, 16028, 8101, 6431, 3047, 119, 1220, 1845, 1103, 1265, 1406, 782, 1429, 117, 1429, 782, 126, 1107, 16028, 8101, 118, 150, 1505, 1106, 4821, 1103, 2366, 1265, 2899, 119, 1220, 1145, 1281, 1103, 16028, 8101, 6431, 5629, 1106, 7379, 1126, 6973, 6875, 1107, 1103, 2219, 5089, 5629, 1187, 1152, 1575, 1107, 1103, 1505, 118, 1107, 1668, 1106, 23362, 117, 3078, 782, 5966, 119, 155, 15540, 1200, 23070, 1105, 2686, 197, 118, 106, 1884, 3447, 10224, 134, 130, 1947, 134, 197, 14381, 1265, 197, 118, 106, 1884, 3447, 10224, 134, 130, 1947, 134, 197, 16028, 8101, 6431, 5629, 197, 118, 106, 1884, 3447, 10224, 134, 130, 1947, 134, 197, 5089, 5629, 19714, 1116, 3261, 2054, 3261, 2054, 149, 2240, 2591, 6010, 2117, 13244, 1441, 112, 188, 3163, 2955, 3261, 2054, 2117, 13244, 1441, 112, 188, 171, 3261, 2054, 2117, 13244, 1441, 112, 188, 171, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
In computer science, code motion, also known as code hoisting, code sinking, loop-invariant code motion, or code factoring, is a blanket term for any process which moves code within a program for performance or size benefits, and is a common optimization performed in most optimizing compilers. It can be difficult to differentiate between different types of code motion, due to the inconsistent meaning of the terms surrounding it. Uses Code motion has a variety of uses and benefits, many of which overlap each other in their implementation. Removing unused/useless operations Code Sinking, also known as lazy code motion, is a term for a technique which reduces wasted instructions by moving instructions to branches in which they are used: If an operation is executed before a branch, and only one of the branch paths use the result of that operation, then code sinking entails moving that operation into the branch where it will be used. This technique is a form of dead code elimination in the sense that it removes code when it’s results are discarded or unused, but in contrast to dead code elimination, it can remove pointless instructions even if there is a possible use of that instruction’s results in an execution code path. Reducing the size of the program Code Factoring is a term for a size-optimization technique which merges common dependencies in branches into the branch above it. Just like factorizing integers decomposes a number into its smallest possible forms (as factors), code factorization transforms the code into the smallest possible form, by merging common "factors" until no duplicates remain. Reducing dependency stalls Global code motion, local code motion, code scheduling, Instruction scheduling and code hoisting/sinking are all terms for a technique where instructions are rearranged (or "scheduled") to improve the efficiency of execution within the CPU. Modern CPUs are able to schedule five or more instructions per clock cycle. However, a CPU cannot schedule an instruction which relies on data from a currently (or not yet executed) instruction. Compilers will interleave dependencies in a manner which maximizes the amount of instructions a CPU can process at any point in time. On the defunct Intel Itanium architecture, the branch predict (BRP) instruction is manually hoisted above branches by the compiler to enable the branch to be immediately taken by the CPU. Itanium relies on additional code scheduling from the CPU to maximize efficiency in the processor. Loop-invariant Code Motion Loop-invariant code motion is the process of moving code which is invariant to the execution of the loop, while inside of the loop, to a position outside of the loop. Compiler examples Instruction scheduling and Loop-invariant code motion are discussed in their respective articles. LLVM LLVM has a sinking pass in it's single scalar assignment form. LLVM 15.0 will not sink an operation if any of it's code paths include a store instruction, or if it may throw an error. Additionally, LLVM will not sink an instruction into a loop. GCC The GNU Compiler Collection implements code motion under the name "code factoring", with the purpose of reducing the size of a compiled program. GCC will move any code upwards or downwards if it "[does not] invalidate any existing dependences nor introduce new ones". LuaJIT LuaJIT uses code sinking under the name "Allocation sinking", to reduce the amount of time compiled code spends allocating and collecting temporary objects within a loop. Allocation sinking moves allocations to execution paths where the allocated object may escape the executing code, and will thus require heap allocation. All removed allocations are filled in with load-to-store forwarding over their fields. See also Loop-invariant code motion Instruction scheduling Dependency graph References Compiler optimizations
[ 101, 1130, 2775, 2598, 117, 3463, 4018, 117, 1145, 1227, 1112, 3463, 16358, 1776, 1158, 117, 3463, 10464, 117, 7812, 118, 27289, 3463, 4018, 117, 1137, 3463, 5318, 1158, 117, 1110, 170, 8560, 1858, 1111, 1251, 1965, 1134, 5279, 3463, 1439, 170, 1788, 1111, 2099, 1137, 2060, 6245, 117, 1105, 1110, 170, 1887, 25161, 1982, 1107, 1211, 11769, 3121, 25596, 26012, 1116, 119, 1135, 1169, 1129, 2846, 1106, 23159, 1206, 1472, 3322, 1104, 3463, 4018, 117, 1496, 1106, 1103, 22410, 2764, 1104, 1103, 2538, 3376, 1122, 119, 11696, 1116, 6741, 4018, 1144, 170, 2783, 1104, 2745, 1105, 6245, 117, 1242, 1104, 1134, 19235, 1296, 1168, 1107, 1147, 7249, 119, 11336, 3702, 3970, 16217, 120, 12277, 2500, 6741, 14009, 4419, 117, 1145, 1227, 1112, 16688, 3463, 4018, 117, 1110, 170, 1858, 1111, 170, 5531, 1134, 13822, 15445, 7953, 1118, 2232, 7953, 1106, 5020, 1107, 1134, 1152, 1132, 1215, 131, 1409, 1126, 2805, 1110, 5858, 1196, 170, 3392, 117, 1105, 1178, 1141, 1104, 1103, 3392, 10843, 1329, 1103, 1871, 1104, 1115, 2805, 117, 1173, 3463, 10464, 4035, 23871, 2232, 1115, 2805, 1154, 1103, 3392, 1187, 1122, 1209, 1129, 1215, 119, 1188, 5531, 1110, 170, 1532, 1104, 2044, 3463, 10466, 1107, 1103, 2305, 1115, 1122, 22391, 3463, 1165, 1122, 787, 188, 2686, 1132, 16041, 1137, 16217, 117, 1133, 1107, 5014, 1106, 2044, 3463, 10466, 117, 1122, 1169, 5782, 27092, 7953, 1256, 1191, 1175, 1110, 170, 1936, 1329, 1104, 1115, 8235, 787, 188, 2686, 1107, 1126, 7581, 3463, 3507, 119, 2156, 21977, 1158, 1103, 2060, 1104, 1103, 1788, 6741, 15926, 1158, 1110, 170, 1858, 1111, 170, 2060, 118, 25161, 5531, 1134, 14713, 1116, 1887, 12864, 15672, 1107, 5020, 1154, 1103, 3392, 1807, 1122, 119, 2066, 1176, 5318, 4404, 27264, 1260, 8178, 14811, 1116, 170, 1295, 1154, 1157, 10471, 1936, 2769, 113, 1112, 5320, 114, 117, 3463, 5318, 2734, 24573, 1103, 3463, 1154, 1103, 10471, 1936, 1532, 117, 1118, 17862, 1887, 107, 5320, 107, 1235, 1185, 3840, 21379, 1116, 3118, 119, 2156, 21977, 1158, 12864, 9517, 21923, 5357, 3463, 4018, 117, 1469, 3463, 4018, 117, 3463, 22784, 117, 1130, 26372, 22784, 1105, 3463, 16358, 1776, 1158, 120, 10464, 1132, 1155, 2538, 1111, 170, 5531, 1187, 7953, 1132, 3876, 19587, 113, 1137, 107, 4533, 107, 114, 1106, 4607, 1103, 8096, 1104, 7581, 1439, 1103, 18701, 119, 4825, 18701, 1116, 1132, 1682, 1106, 6030, 1421, 1137, 1167, 7953, 1679, 4705, 5120, 119, 1438, 117, 170, 18701, 2834, 6030, 1126, 8235, 1134, 17918, 1113, 2233, 1121, 170, 1971, 113, 1137, 1136, 1870, 5858, 114, 8235, 119, 3291, 8223, 25614, 1116, 1209, 9455, 19094, 2707, 12864, 15672, 1107, 170, 4758, 1134, 12477, 8745, 19092, 1116, 1103, 2971, 1104, 7953, 170, 18701, 1169, 1965, 1120, 1251, 1553, 1107, 1159, 119, 1212, 1103, 12273, 15397, 1135, 7192, 1818, 4220, 117, 1103, 3392, 17163, 113, 26660, 2101, 114, 8235, 1110, 23465, 16358, 20330, 1807, 5020, 1118, 1103, 26012, 1106, 9396, 1103, 3392, 1106, 1129, 2411, 1678, 1118, 1103, 18701, 119, 1135, 7192, 1818, 17918, 1113, 2509, 3463, 22784, 1121, 1103, 18701, 1106, 12477, 8745, 19092, 8096, 1107, 1103, 14538, 119, 18086, 118, 27289, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
is the upcoming ninth live video album by Japanese band Wagakki Band, to be released by Universal Music Japan. The video covers the band's annual New Year concert at the Nippon Budokan on January 9, 2022. The concert aired on Wowow Plus on February 27, 2022. Track listing All tracks are arranged by Wagakki Band. Personnel Yuko Suzuhana – vocals Machiya – guitar, vocals ("Episode.0") Beni Ninagawa – tsugaru shamisen Kiyoshi Ibukuro – koto Asa – bass Daisuke Kaminaga – shakuhachi Wasabi – drums Kurona – wadaiko References External links (Universal Music Japan) Wagakki Band video albums Upcoming albums Japanese-language live albums Universal Music Japan video albums
[ 101, 1110, 1103, 8851, 6948, 1686, 1888, 1312, 1118, 1983, 1467, 160, 15446, 1377, 2293, 4230, 117, 1106, 1129, 1308, 1118, 6896, 1953, 1999, 119, 1109, 1888, 3662, 1103, 1467, 112, 188, 2683, 1203, 2381, 3838, 1120, 1103, 21206, 17084, 9865, 1179, 1113, 1356, 130, 117, 17881, 1477, 119, 1109, 3838, 4086, 1113, 11750, 4064, 8696, 1113, 1428, 1765, 117, 17881, 1477, 119, 6563, 10530, 1398, 2390, 1132, 4768, 1118, 160, 15446, 1377, 2293, 4230, 119, 19821, 10684, 2718, 15463, 10337, 17013, 782, 2172, 6603, 3031, 2315, 782, 2092, 117, 2172, 113, 107, 8112, 119, 121, 107, 114, 3096, 1182, 9394, 14612, 782, 189, 6385, 5526, 1358, 188, 2522, 4862, 1179, 14477, 18724, 146, 7925, 4786, 2180, 782, 180, 12355, 1249, 1161, 782, 2753, 23084, 16431, 14812, 14503, 2571, 782, 188, 21893, 23698, 19226, 3982, 23156, 782, 3323, 23209, 15789, 782, 20049, 14117, 2718, 19714, 1116, 22841, 6743, 113, 6896, 1953, 1999, 114, 160, 15446, 1377, 2293, 4230, 1888, 3770, 3725, 9331, 3770, 1983, 118, 1846, 1686, 3770, 6896, 1953, 1999, 1888, 3770, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Admiral William Wolseley (1756 – 1842) was an Anglo-Irish naval officer in the Royal Navy. Life William Wolseley, of the Irish branch of the old Staffordshire family of Wolseley, was born on 15 March 1756 at Annapolis in Nova Scotia, where his father, Captain William Neville Wolseley, of the 47th Regiment of Foot, was then in garrison. His mother was Anne, sister of Admiral Phillips Cosby. In 1764 the family returned to Ireland; and in 1769 William, who had been at school in Kilkenny, was entered on board the Goodwill cutter at Waterford, commanded by his father's brother-in-law, Lieutenant John Buchanan. Two years later, when the Goodwill was paid off, Wolseley was sent by his uncle Cosby to a nautical school in Westminster, from which, after some months, he joined the Portland, going out to Jamaica. He returned to England in the Princess Amelia, and in September 1773 joined the 50-gun ship Salisbury, with Commodore [Sir] Edward Hughes, Commander-in-Chief in the East Indies. The Salisbury came home in the end of 1777, and Wolseley, having passed his examination, was promoted, 11 June 1778, to be junior lieutenant of the Duke, one of the fleet with Keppel in July, though on the 27th she had fallen so far to leeward that she had no part in the action. When the autumn cruise came to an end, Wolseley, at the suggestion of Sir Edward Hughes, going out again as Commander-in-Chief in the East Indies, effected an exchange into the Worcester, one of his squadron. After some service against pirates in the Indian seas, he commanded a company of the naval brigade at the reduction of Negapatam in October 1781, and again at the storming of Fort Ostenburg, Trincomalee, on 11 January 1782, when he was severely wounded in the chest by a charge of slugs from a gingal, and left for dead in the ditch. Happily he was found the next day and carried on board the Worcester. He was shortly afterwards moved into the Superb, Hughes's flagship, and in her was present in the first four of the actions with the Bailli de Suffren. After the last of these, 3 September 1782, he was promoted to be commander of the Combustion fireship, and on 14 September was posted to the Coventry frigate, which on the night of 12 January 1783 ran in among the French fleet in Ganjam Roads, mistaking the ships for Indiamen, and was captured. Wolseley was civilly treated by Suffren, who sent him as a prisoner to Mauritius. He was shortly afterwards transferred to Bourbon, where he was detained till the announcement of peace. He then got a passage to St. Helena in a French transport, and so home in an East Indiaman. In 1786 he was appointed to the Trusty, fitting out at Portsmouth for the broad pennant of his uncle, Phillips Cosby. After a three years' commission in the Mediterranean, the Trusty came home and was paid off. In 1792 Wolseley was appointed to the Lowestoft frigate, in which in the early months of 1793 he was employed in convoy duty in St. George's Channel. He was then sent out to join Lord Hood in the Mediterranean; was present at the occupation of Toulon, and on 30 September, while detached under Commodore Linzee, occupied the celebrated Mortella Tower, which, being handed over to the Corsicans, was retaken by the French some three weeks later, and on 8 February 1794 beat off the 74-gun ship Fortitude, inflicting on her severe loss and damage. The Tower was, however, shortly afterwards captured by a landing party under the command of Wolseley. A few days later he was moved into the Impérieuse, which went home in the end of the year. He had hoped to be again appointed to her; but he was recommended by Hood, and to some extent shared in the ill-feeling of the Admiralty towards the discarded admiral, so that for nearly five years he was left unemployed. Towards the end of 1795 he married Jane, daughter of John Moore of Clough House, County Down, grandson of a Scottish officer, Colonel Muir, who had served in Ireland under William III and obtained a grant of land. He took a little place near Clough House, and lived there in retirement except during the Rebellion of 1798, when he commanded a company of volunteers which took part in the "Battle" of Ballynahinch. Early in 1799 he was appointed to the 74-gun ship Terrible, one of the Channel Fleet under Lord Bridport, and in 1800 under Lord St. Vincent. In December 1800 he was moved into the St. George, but on that ship being selected as the Flagship of Lord Nelson, in February 1801, Wolseley was transferred to the San Josef, which was paid off on the signing of the Peace of Amiens. He afterwards had command of the Sea Fencibles of the Shannon district till his promotion to the rank of rear-admiral on 23 April 1804. He was then appointed to the command of the Sea Fencibles of all Ireland, from which he retired towards the end of 1805. He had no further employment, but was made vice-admiral on 25 October 1809 and admiral on 12 August 1819. In the spring of 1842 the old wound received sixty years before at the storming of Fort Ostenberg opened and would not heal. The surgeons came to the conclusion that something must have remained in the wound, and, as the result of an operation, extracted a jagged piece of lead and a fragment of cloth. The wound, however, would not heal. Gradually losing strength, he died in London on 7 June 1842. He was then the senior admiral of the red. His wife had died several years before, leaving issue two sons and two daughters. His portrait, painted in Paris, in 1840, by Jules Laur, was inherited by his granddaughter. References Bibliography Innes, Mary C. (1895). A Memoir of William Wolseley, Admiral of the Red Squadron. London: Kegan Paul, Trench, Trübner, & Co. Ltd. Laughton, J. K.; Doorne, Christopher (2004). "Wolseley, William (1756–1842)". In Oxford Dictionary of National Biography. Oxford: Oxford University Press. 1756 births 1842 deaths British admirals
[ 101, 6114, 1613, 160, 23681, 23814, 113, 24816, 782, 9790, 114, 1108, 1126, 7342, 118, 2600, 5527, 2575, 1107, 1103, 1787, 2506, 119, 2583, 1613, 160, 23681, 23814, 117, 1104, 1103, 2600, 3392, 1104, 1103, 1385, 18187, 1266, 1104, 160, 23681, 23814, 117, 1108, 1255, 1113, 1405, 1345, 24816, 1120, 28082, 1107, 6584, 9418, 117, 1187, 1117, 1401, 117, 2791, 1613, 15562, 160, 23681, 23814, 117, 1104, 1103, 3862, 1582, 3391, 1104, 13929, 117, 1108, 1173, 1107, 10609, 119, 1230, 1534, 1108, 3967, 117, 2104, 1104, 6114, 7651, 3291, 13341, 119, 1130, 23688, 1103, 1266, 1608, 1106, 2270, 132, 1105, 1107, 22632, 1613, 117, 1150, 1125, 1151, 1120, 1278, 1107, 18277, 117, 1108, 2242, 1113, 2313, 1103, 2750, 17274, 24639, 1120, 19081, 117, 5724, 1118, 1117, 1401, 112, 188, 1711, 118, 1107, 118, 1644, 117, 3897, 1287, 14912, 119, 1960, 1201, 1224, 117, 1165, 1103, 2750, 17274, 1108, 3004, 1228, 117, 160, 23681, 23814, 1108, 1850, 1118, 1117, 4906, 3291, 13341, 1106, 170, 11894, 1278, 1107, 9134, 117, 1121, 1134, 117, 1170, 1199, 1808, 117, 1119, 1688, 1103, 6141, 117, 1280, 1149, 1106, 8822, 119, 1124, 1608, 1106, 1652, 1107, 1103, 4738, 11691, 117, 1105, 1107, 1347, 21676, 1688, 1103, 1851, 118, 2560, 2062, 14268, 117, 1114, 14053, 164, 2203, 166, 2594, 7638, 117, 4350, 118, 1107, 118, 2534, 1107, 1103, 1689, 9195, 119, 1109, 14268, 1338, 1313, 1107, 1103, 1322, 1104, 17128, 117, 1105, 160, 23681, 23814, 117, 1515, 2085, 1117, 8179, 117, 1108, 3082, 117, 1429, 1340, 17343, 117, 1106, 1129, 4635, 6403, 1104, 1103, 3131, 117, 1141, 1104, 1103, 4535, 1114, 26835, 24756, 1107, 1351, 117, 1463, 1113, 1103, 15757, 1131, 1125, 4984, 1177, 1677, 1106, 5837, 5773, 2881, 1115, 1131, 1125, 1185, 1226, 1107, 1103, 2168, 119, 1332, 1103, 8929, 11270, 1338, 1106, 1126, 1322, 117, 160, 23681, 23814, 117, 1120, 1103, 10219, 1104, 2203, 2594, 7638, 117, 1280, 1149, 1254, 1112, 4350, 118, 1107, 118, 2534, 1107, 1103, 1689, 9195, 117, 2629, 1174, 1126, 3670, 1154, 1103, 12710, 117, 1141, 1104, 1117, 5780, 119, 1258, 1199, 1555, 1222, 14978, 1107, 1103, 1890, 17043, 117, 1119, 5724, 170, 1419, 1104, 1103, 5527, 8196, 1120, 1103, 7234, 1104, 151, 12606, 26519, 20284, 1107, 1357, 17870, 117, 1105, 1254, 1120, 1103, 4162, 1158, 1104, 3144, 152, 15874, 3410, 117, 18491, 23573, 7435, 3051, 117, 1113, 1429, 1356, 17995, 117, 1165, 1119, 1108, 8669, 4670, 1107, 1103, 2229, 1118, 170, 2965, 1104, 188, 16693, 1116, 1121, 170, 176, 28050, 1233, 117, 1105, 1286, 1111, 2044, 1107, 1103, 15916, 119, 11679, 8661, 5264, 1119, 1108, 1276, 1103, 1397, 1285, 1105, 2446, 1113, 2313, 1103, 12710, 119, 1124, 1108, 3992, 6091, 1427, 1154, 1103, 3198, 1830, 117, 7638, 112, 188, 10818, 117, 1105, 1107, 1123, 1108, 1675, 1107, 1103, 1148, 1300, 1104, 1103, 3721, 1114, 1103, 27900, 6473, 1260, 15463, 3101, 5123, 119, 1258, 1103, 1314, 1104, 1292, 117, 124, 1347, 17995, 117, 1119, 1108, 3082, 1106, 1129, 3877, 1104, 1103, 3291, 12913, 8954, 1988, 8966, 3157, 117, 1105, 1113, 1489, 1347, 1108, 6310, 1106, 1103, 13985, 17201, 117, 1134, 1113, 1103, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
The 2003 Pontiac Excitement 400 was the 11th stock car race of the 2003 NASCAR Winston Cup Series season and the 49th iteration of the event. The race was held on Saturday, May 3, 2003, before a crowd of 110,000 in Richmond, Virginia, at Richmond International Raceway, a 0.75 miles (1.21 km) D-shaped oval. The race was shortened from its scheduled 400 laps to 393 due to rain cutting the race short. At race's end, Joe Nemechek, driving for Hendrick Motorsports, would rally from the mid-pack and eventually win his third career NASCAR Winston Cup Series win and his first and only win of the season. To fill out the podium, Bobby Labonte of Joe Gibbs Racing and Dale Earnhardt Jr. of Dale Earnhardt, Inc. would finish second and third, respectively. MB2 Motorsports driver Jerry Nadeau would suffer career-ending injuries in the second practice session of the race. Background Entry list (R) denotes rookie driver. *Driver changed to Jason Keller after Nadeau crashed in second practice, leaving Nadeau critically injured and effectively ending Nadeau's racing career. **Withdrew after crashing in first practice. Practice First practice The first practice session was held on Friday, May 2, at 11:20 AM EST, and would last for two hours. Dale Earnhardt Jr. of Dale Earnhardt, Inc. would set the fastest time in the session, with a lap of 21.230 and an average speed of . Second practice The second practice session was held on Friday, May 2, at 4:45 PM EST, and would last for 45 minutes. Jeff Burton of Roush Racing would set the fastest time in the session, with a lap of 21.640 and an average speed of . Third and final practice The third and final practice session, sometimes referred to as Happy Hour, was held on Friday, May 2, at 6:10 PM EST, and would last for 45 minutes. Jeff Burton of Roush Racing would set the fastest time in the session, with a lap of 21.640 and an average speed of . Qualifying Qualifying was held on Friday, May 2, at 3:00 PM EST. Each driver would have two laps to set a fastest time; the fastest of the two would count as their official qualifying lap. Positions 1-36 would be decided on time, while positions 37-43 would be based on provisionals. Six spots are awarded by the use of provisionals based on owner's points. The seventh is awarded to a past champion who has not otherwise qualified for the race. If no past champ needs the provisional, the next team in the owner points will be awarded a provisional. Terry Labonte of Hendrick Motorsports would win the pole, setting a time of 21.342 and an average speed of . Two drivers would fail to qualify: Derrike Cope and Hermie Sadler. Full qualifying results Race results References 2003 NASCAR Winston Cup Series NASCAR races at Richmond Raceway May 2003 sports events in the United States 2003 in sports in Virginia
[ 101, 1109, 1581, 27681, 16409, 14375, 1880, 3434, 1108, 1103, 5573, 4482, 1610, 1886, 1104, 1103, 1581, 11924, 9982, 1635, 2768, 1265, 1105, 1103, 3927, 1582, 1122, 17166, 1104, 1103, 1856, 119, 1109, 1886, 1108, 1316, 1113, 4306, 117, 1318, 124, 117, 1581, 117, 1196, 170, 3515, 1104, 6745, 117, 1288, 1107, 6110, 117, 2550, 117, 1120, 6110, 1570, 26611, 117, 170, 121, 119, 3453, 1829, 113, 122, 119, 1626, 1557, 114, 141, 118, 4283, 13102, 119, 1109, 1886, 1108, 12898, 1121, 1157, 4533, 3434, 11033, 1106, 3614, 1495, 1496, 1106, 4458, 5910, 1103, 1886, 1603, 119, 1335, 1886, 112, 188, 1322, 117, 2658, 151, 5521, 11252, 4820, 117, 3759, 1111, 1124, 3276, 8053, 25683, 117, 1156, 11158, 1121, 1103, 2286, 118, 5246, 1105, 2028, 1782, 1117, 1503, 1578, 11924, 9982, 1635, 2768, 1782, 1105, 1117, 1148, 1105, 1178, 1782, 1104, 1103, 1265, 119, 1706, 5475, 1149, 1103, 15464, 117, 5545, 14470, 22994, 1104, 2658, 16556, 6770, 1105, 8238, 142, 1813, 15624, 25018, 3108, 119, 1104, 8238, 142, 1813, 15624, 25018, 117, 3561, 119, 1156, 3146, 1248, 1105, 1503, 117, 3569, 119, 19443, 1477, 25683, 3445, 5466, 11896, 18747, 1358, 1156, 8813, 1578, 118, 3830, 5917, 1107, 1103, 1248, 2415, 4912, 1104, 1103, 1886, 119, 24570, 15214, 2190, 113, 155, 114, 16699, 11416, 3445, 119, 115, 15787, 2014, 1106, 3627, 17158, 1170, 11896, 18747, 1358, 7573, 1107, 1248, 2415, 117, 2128, 11896, 18747, 1358, 11774, 4475, 1105, 5877, 3830, 11896, 18747, 1358, 112, 188, 3915, 1578, 119, 115, 115, 1556, 11114, 2246, 1170, 13423, 1107, 1148, 2415, 119, 14354, 1752, 2415, 1109, 1148, 2415, 4912, 1108, 1316, 1113, 5286, 117, 1318, 123, 117, 1120, 1429, 131, 1406, 6586, 142, 9272, 117, 1105, 1156, 1314, 1111, 1160, 2005, 119, 8238, 142, 1813, 15624, 25018, 3108, 119, 1104, 8238, 142, 1813, 15624, 25018, 117, 3561, 119, 1156, 1383, 1103, 7901, 1159, 1107, 1103, 4912, 117, 1114, 170, 4443, 1104, 1626, 119, 11866, 1105, 1126, 1903, 2420, 1104, 119, 2307, 2415, 1109, 1248, 2415, 4912, 1108, 1316, 1113, 5286, 117, 1318, 123, 117, 1120, 125, 131, 2532, 14123, 142, 9272, 117, 1105, 1156, 1314, 1111, 2532, 1904, 119, 4274, 9395, 1104, 155, 2285, 1324, 6770, 1156, 1383, 1103, 7901, 1159, 1107, 1103, 4912, 117, 1114, 170, 4443, 1104, 1626, 119, 21451, 1105, 1126, 1903, 2420, 1104, 119, 4180, 1105, 1509, 2415, 1109, 1503, 1105, 1509, 2415, 4912, 117, 2121, 2752, 1106, 1112, 8325, 12197, 117, 1108, 1316, 1113, 5286, 117, 1318, 123, 117, 1120, 127, 131, 1275, 14123, 142, 9272, 117, 1105, 1156, 1314, 1111, 2532, 1904, 119, 4274, 9395, 1104, 155, 2285, 1324, 6770, 1156, 1383, 1103, 7901, 1159, 1107, 1103, 4912, 117, 1114, 170, 4443, 1104, 1626, 119, 21451, 1105, 1126, 1903, 2420, 1104, 119, 19720, 19720, 1108, 1316, 1113, 5286, 117, 1318, 123, 117, 1120, 124, 131, 3135, 14123, 142, 9272, 119, 2994, 3445, 1156, 1138, 1160, 11033, 1106, 1383, 170, 7901, 1159, 132, 1103, 7901, 1104, 1103, 1160, 1156, 5099, 1112, 1147, 2078, 6045, 4443, 119, 18959, 5053, 6126, 122, 118, 3164, 1156, 1129, 1879, 1113, 1159, 117, 1229, 3638, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Piedmont Healthcare is an American non-profit private operator of health care facilities that was founded in 1905. It is based in Atlanta, Georgia, and, as of February 2022, owns and operates 16 hospitals and more than 3,000 sites of care, including urgent care centers and physician clinics in the United States. In 2022, Piedmont Healthcare was ranked #166 on the Forbes rankings of the best large employers in the U.S. The organization takes its name from its original site: Piedmont Hospital, now called Piedmont Atlanta. It also includes the following hospitals: Piedmont Athens Regional, Piedmont Cartersville, Piedmont Columbus Regional, Piedmont Eastside, Piedmont Fayette, Piedmont Henry, Piedmont Macon, Piedmont Macon North, Piedmont Mountainside, Piedmont Newnan, Piedmont Newton, Piedmont Rockdale, Piedmont Walton. Piedmont Healthcare serves the state of Georgia. As of 2021, they claimed to serve 70% of its population. In May 2021, Piedmont Healthcare announced the acquisition of four hospitals from HCA Healthcare for about $950 million, which included Eastside Medical Center in Snellville; Coliseum Medical Centers and Coliseum Northside, both in Macon; and Cartersville Medical Center in Cartersville. A few days later, they announced a $1 billion partnership over ten years with University Hospital in Augusta, Georgia to enhance and expand University facilities. The rapid acquisition of seven hospitals by Piedmont Healthcare in Georgia prompted the National Nurses United, the largest organization of registered nurses in the United States, to file a complaint with the Federal Trade Commission alleging the consolidations would give them close to a monopoly in the area. References External links American companies established in 1905 Companies based in Atlanta Privately held companies Hospital networks in the United States Health care companies based in Georgia (US State)
[ 101, 20970, 22993, 1110, 1126, 1237, 1664, 118, 5022, 2029, 6650, 1104, 2332, 1920, 3380, 1115, 1108, 1771, 1107, 4761, 119, 1135, 1110, 1359, 1107, 5161, 117, 3260, 117, 1105, 117, 1112, 1104, 1428, 17881, 1477, 117, 8300, 1105, 5049, 1479, 8894, 1105, 1167, 1190, 124, 117, 1288, 3911, 1104, 1920, 117, 1259, 14844, 1920, 6425, 1105, 7454, 20562, 1107, 1103, 1244, 1311, 119, 1130, 17881, 1477, 117, 20970, 22993, 1108, 3616, 108, 20104, 1113, 1103, 10754, 13514, 1104, 1103, 1436, 1415, 13673, 1107, 1103, 158, 119, 156, 119, 1109, 2369, 2274, 1157, 1271, 1121, 1157, 1560, 1751, 131, 20970, 3355, 117, 1208, 1270, 20970, 5161, 119, 1135, 1145, 2075, 1103, 1378, 8894, 131, 20970, 7055, 4723, 117, 20970, 5007, 8030, 117, 20970, 8555, 4723, 117, 20970, 1689, 5570, 117, 20970, 20958, 3786, 117, 20970, 1985, 117, 20970, 23153, 117, 20970, 23153, 1456, 117, 20970, 5249, 3269, 117, 20970, 1203, 6509, 117, 20970, 8102, 117, 20970, 2977, 4319, 117, 20970, 14862, 119, 20970, 22993, 3411, 1103, 1352, 1104, 3260, 119, 1249, 1104, 17881, 1475, 117, 1152, 2694, 1106, 2867, 3102, 110, 1104, 1157, 1416, 119, 1130, 1318, 17881, 1475, 117, 20970, 22993, 1717, 1103, 7626, 1104, 1300, 8894, 1121, 18315, 1592, 22993, 1111, 1164, 109, 22173, 1550, 117, 1134, 1529, 1689, 5570, 3875, 1945, 1107, 156, 10376, 2138, 132, 20947, 3875, 22347, 1105, 20947, 1456, 5570, 117, 1241, 1107, 23153, 132, 1105, 5007, 8030, 3875, 1945, 1107, 5007, 8030, 119, 138, 1374, 1552, 1224, 117, 1152, 1717, 170, 109, 122, 3775, 5210, 1166, 1995, 1201, 1114, 1239, 3355, 1107, 14050, 117, 3260, 1106, 11778, 1105, 7380, 1239, 3380, 119, 1109, 6099, 7626, 1104, 1978, 8894, 1118, 20970, 22993, 1107, 3260, 9249, 1103, 1305, 17418, 1116, 1244, 117, 1103, 2026, 2369, 1104, 4410, 13318, 1107, 1103, 1244, 1311, 117, 1106, 4956, 170, 12522, 1114, 1103, 3467, 5820, 2827, 26099, 1103, 20994, 1116, 1156, 1660, 1172, 1601, 1106, 170, 18356, 1107, 1103, 1298, 119, 19714, 1116, 22841, 6743, 1237, 2557, 1628, 1107, 4761, 13134, 1359, 1107, 5161, 7219, 1193, 1316, 2557, 3355, 6379, 1107, 1103, 1244, 1311, 3225, 1920, 2557, 1359, 1107, 3260, 113, 1646, 1426, 114, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
The following is a list of current United States Football League (USFL) team rosters: North Division Michigan Panthers New Jersey Generals Philadelphia Stars Pittsburgh Maulers South Division Birmingham Stallions Houston Gamblers New Orleans Breakers Tampa Bay Bandits United States Football League teams United States Football League
[ 101, 1109, 1378, 1110, 170, 2190, 1104, 1954, 1244, 1311, 2289, 1453, 113, 1646, 12281, 114, 1264, 9197, 1116, 131, 1456, 1784, 3312, 13598, 1203, 3308, 1615, 1116, 3562, 6200, 5610, 7085, 8722, 1733, 1375, 1784, 5836, 1457, 5727, 5266, 4666, 144, 16033, 1733, 1203, 5705, 15835, 1468, 9720, 2410, 4230, 6439, 1244, 1311, 2289, 1453, 1929, 1244, 1311, 2289, 1453, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Psoromic acid is a β-orcinol depsidone with the molecular formula C18H14O8. Psoromic acid inhibits herpes simplex viruses type 1 and type 2. Furthermore it inhibits the RabGGTase. Psoromic acid occurs in antarctic lichens. References Further reading Lichenology Dioxepines Heterocyclic compounds with 3 rings Oxygen heterocycles Carboxylic acids Lactones Ketones Alcohols Methoxy compounds
[ 101, 153, 21484, 18882, 1665, 5190, 1110, 170, 419, 118, 1137, 16430, 4063, 1260, 3491, 12894, 1673, 1114, 1103, 9546, 7893, 140, 15292, 27012, 1527, 2346, 1604, 119, 153, 21484, 18882, 1665, 5190, 1107, 23034, 1116, 1123, 6633, 3014, 1775, 20942, 2076, 122, 1105, 2076, 123, 119, 7282, 1122, 1107, 23034, 1116, 1103, 16890, 1830, 2349, 2349, 1942, 6530, 119, 153, 21484, 18882, 1665, 5190, 4365, 1107, 22904, 1813, 11143, 181, 26312, 2316, 119, 19714, 1116, 6940, 3455, 5255, 10415, 4807, 12120, 10649, 8043, 8515, 1124, 25710, 3457, 1665, 8031, 10071, 1114, 124, 8374, 152, 16844, 4915, 1119, 25710, 19964, 1116, 8185, 8757, 7777, 1596, 13087, 23929, 11488, 26835, 11488, 2586, 2528, 14084, 1116, 19415, 5114, 16844, 10071, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Robert Sibley (born 10 July 1966) is an Australian former professional basketball player. He played in the National Basketball League (NBL) with the Brisbane Bullets and Melbourne Tigers. Sibley won three NBL championships: two with the Bullets in 1985 and 1987, and one with the Tigers in 1993. He was nicknamed "The Baseline Bandit" during his career due to the location where he excelled while on a basketball court. Born in Brisbane, Queensland, Sibley made his debut for the Bullets in February 1984 as a 17-year-old. He retired in 1997 but returned to play five games for the Bullets in 2003 while the team suffered injury problems. It was announced in 2020 that Sibley underwent chemotherapy after he had been diagnosed with cancer of the bladder and kidney. The Brisbane Bullets organised a fundraiser to help pay for Sibley's medical expenses. His number 52 was retired by the Bullets on 15 May 2021. References 1966 births Living people Australian men's basketball players Basketball players from Brisbane Brisbane Bullets players Melbourne Tigers players Power forwards (basketball)
[ 101, 1823, 14159, 26672, 113, 1255, 1275, 1351, 2678, 114, 1110, 1126, 1925, 1393, 1848, 3163, 1591, 119, 1124, 1307, 1107, 1103, 1305, 6035, 1453, 113, 151, 13360, 114, 1114, 1103, 7217, 9255, 6248, 1105, 4141, 7811, 119, 14159, 26672, 1281, 1210, 151, 13360, 6430, 131, 1160, 1114, 1103, 9255, 6248, 1107, 2210, 1105, 2164, 117, 1105, 1141, 1114, 1103, 7811, 1107, 1949, 119, 1124, 1108, 10446, 107, 1109, 14562, 2042, 4230, 2875, 107, 1219, 1117, 1578, 1496, 1106, 1103, 2450, 1187, 1119, 25749, 1229, 1113, 170, 3163, 2175, 119, 3526, 1107, 7217, 117, 4548, 117, 14159, 26672, 1189, 1117, 1963, 1111, 1103, 9255, 6248, 1107, 1428, 2219, 1112, 170, 1542, 118, 1214, 118, 1385, 119, 1124, 2623, 1107, 1816, 1133, 1608, 1106, 1505, 1421, 1638, 1111, 1103, 9255, 6248, 1107, 1581, 1229, 1103, 1264, 3421, 3773, 2645, 119, 1135, 1108, 1717, 1107, 12795, 1115, 14159, 26672, 9315, 22572, 5521, 20939, 1170, 1119, 1125, 1151, 11534, 1114, 4182, 1104, 1103, 28083, 1105, 16042, 119, 1109, 7217, 9255, 6248, 6967, 170, 5841, 27014, 1106, 1494, 2653, 1111, 14159, 26672, 112, 188, 2657, 11928, 119, 1230, 1295, 3882, 1108, 2623, 1118, 1103, 9255, 6248, 1113, 1405, 1318, 17881, 1475, 119, 19714, 1116, 2678, 20665, 7932, 1234, 1925, 1441, 112, 188, 3163, 2139, 6035, 2139, 1121, 7217, 7217, 9255, 6248, 2139, 4141, 7811, 2139, 3794, 22453, 113, 3163, 114, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
The protest against the death of Anish Khan also known as Justice for Anish Khan protest. After the death of student leader Anish Khan; SFI, AISA and some other organisations organised various type of protest like rally, human chain and movements. The protest first began in Jadavpur by Aisa and Park Circus by the students of Aliah University on 18 February 2022. The Protest broke out rapidly across all over the state of West Bengal. Background Anish Khan was one of the prominent leader of Aliah University. On his college life he was a Activist of All India Students Federation. After his college life he left AISF. He was an Activist of various movement like No NRC Movement, No NPR Movement, Citizenship Amendment Act protests and No Vote To BJP. On 18 February midnight Anish Khan was murdered. 3 Policemen was suspended on the case of Anish murder. Protests •On 18 February, Students of Aliah University make a rally in Park Circus. Two Policemen and one student activist were heavily injured in tussle. •On 21 February, In the banner of Students Against Fascism, Sfi and Aisa jointly organised a central rally from Esplanade to MG Road. •On 22 February, Sfi and Aisa jointly call bandh on Jadavpur University for the justice of Anish Khan. Two SFI activist were injured. Another protest of the students of Aliah University were organised a Mahakaran Avijan rally on 22 February. Many students were heavily injured on lathi charge by Kolkata Polices and 49 students were arrested. 2 Aisa activist were arrested. On this day, Howrah district committee of CPIML Liberation also organised a rally on Uluberia. The team of CPIML Liberation visit SDO office. •On 26 February, CPIM organised rally on Panchla, Several activist and leaders including Minakshi Mukherjee was heavily injured on lathi charge by West Bengal Police and civic volunteers. Seventeen SFI - Democratic Youth Federation of India protesters was arrested by Police. Minakshi Mukherjee with 15 other CPIM activists were arrested from the protests of Panchla. Counter Protest On 28 February, after the ten days of Anish Khan death, Trinamool Chaatra Parishad organised a rally from Moulali to Esplanade. The protest held against the left-wing protesters of SFI, AISA and students of Aliah University. Thousands of the students joined on this rally of TMCP. References 2022 protests February 2022 events in India Politics of India Protests in India
[ 101, 1109, 5641, 1222, 1103, 1473, 1104, 1760, 2944, 4340, 1145, 1227, 1112, 3302, 1111, 1760, 2944, 4340, 5641, 119, 1258, 1103, 1473, 1104, 2377, 2301, 1760, 2944, 4340, 132, 18659, 2240, 117, 19016, 8055, 1105, 1199, 1168, 8485, 6967, 1672, 2076, 1104, 5641, 1176, 11158, 117, 1769, 4129, 1105, 5172, 119, 1109, 5641, 1148, 1310, 1107, 147, 7971, 1964, 4093, 1118, 19294, 3202, 1105, 1670, 14537, 1118, 1103, 1651, 1104, 4149, 3354, 1239, 1113, 1407, 1428, 17881, 1477, 119, 1109, 5096, 13053, 2795, 1149, 5223, 1506, 1155, 1166, 1103, 1352, 1104, 1537, 7756, 119, 24570, 1760, 2944, 4340, 1108, 1141, 1104, 1103, 3289, 2301, 1104, 4149, 3354, 1239, 119, 1212, 1117, 2134, 1297, 1119, 1108, 170, 2173, 23936, 1104, 1398, 1726, 6510, 4245, 119, 1258, 1117, 2134, 1297, 1119, 1286, 19016, 19261, 119, 1124, 1108, 1126, 2173, 23936, 1104, 1672, 2230, 1176, 1302, 151, 10036, 6257, 117, 1302, 23706, 6257, 117, 14649, 3157, 10060, 2173, 7853, 1105, 1302, 159, 11860, 1706, 139, 25141, 119, 1212, 1407, 1428, 9191, 1760, 2944, 4340, 1108, 6636, 119, 124, 3284, 2354, 1108, 6232, 1113, 1103, 1692, 1104, 1760, 2944, 3513, 119, 5096, 13053, 1116, 794, 1212, 1407, 1428, 117, 6510, 1104, 4149, 3354, 1239, 1294, 170, 11158, 1107, 1670, 14537, 119, 1960, 3284, 2354, 1105, 1141, 2377, 7041, 1127, 3777, 4475, 1107, 189, 13356, 1513, 119, 794, 1212, 1626, 1428, 117, 1130, 1103, 12438, 1104, 6510, 8801, 143, 26492, 117, 156, 8702, 1105, 19294, 3202, 10824, 6967, 170, 2129, 11158, 1121, 142, 20080, 20592, 2007, 1106, 22459, 1914, 119, 794, 1212, 1659, 1428, 117, 156, 8702, 1105, 19294, 3202, 10824, 1840, 1467, 1324, 1113, 147, 7971, 1964, 4093, 1239, 1111, 1103, 5299, 1104, 1760, 2944, 4340, 119, 1960, 18659, 2240, 7041, 1127, 4475, 119, 2543, 5641, 1104, 1103, 1651, 1104, 4149, 3354, 1239, 1127, 6967, 170, 7085, 21893, 27177, 138, 5086, 8548, 11158, 1113, 1659, 1428, 119, 2408, 1651, 1127, 3777, 4475, 1113, 2495, 14298, 2965, 1118, 13895, 3284, 1116, 1105, 3927, 1651, 1127, 3950, 119, 123, 19294, 3202, 7041, 1127, 3950, 119, 1212, 1142, 1285, 117, 1731, 10659, 1629, 3914, 1104, 20360, 13371, 2162, 10912, 1145, 6967, 170, 11158, 1113, 158, 21794, 16386, 119, 1109, 1264, 1104, 20360, 13371, 2162, 10912, 3143, 19416, 2346, 1701, 119, 794, 1212, 1744, 1428, 117, 20360, 13371, 6967, 11158, 1113, 6991, 1732, 1742, 117, 3728, 7041, 1105, 3478, 1259, 22787, 4616, 3031, 19569, 9862, 21186, 1108, 3777, 4475, 1113, 2495, 14298, 2965, 1118, 1537, 7756, 3284, 1105, 12296, 8118, 119, 5334, 10381, 18659, 2240, 118, 2978, 4866, 4245, 1104, 1726, 14339, 1108, 3950, 1118, 3284, 119, 22787, 4616, 3031, 19569, 9862, 21186, 1114, 1405, 1168, 20360, 13371, 10254, 1127, 3950, 1121, 1103, 7853, 1104, 6991, 1732, 1742, 119, 23064, 5096, 13053, 1212, 1743, 1428, 117, 1170, 1103, 1995, 1552, 1104, 1760, 2944, 4340, 1473, 117, 18491, 12881, 21778, 24705, 2980, 1611, 6648, 3556, 6967, 170, 11158, 1121, 12556, 5886, 2646, 1106, 142, 20080, 20592, 2007, 119, 1109, 5641, 1316, 1222, 1103, 1286, 118, 3092, 14339, 1104, 18659, 2240, 117, 19016, 8055, 1105, 1651, 1104, 4149, 3354, 1239, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Brass Street, locally known as Peetal Gali, is a street located in Golimar, Karachi, a locality which lies between Nazimabad and Guru Mandir. The street is well-known for finest brass work, utensils and decoration pieces, in Pakistan. History The artisans who work in the Brass Street, Karachi have an emigrant background who migrated from the city of Moradabad, a city known as brass city of India, after the partition of India in 1947. Brass work is on the decline in Pakistan and the businesses which are active on the street now only deal with bulk clients who have export and import business. One reason of the decline of brass work is rising cost of coal which is used in their ovens. Their work has been exhibited in numerous countries including China. As of January 2018, the number of shops on the street have decreased to just seven. References Streets in Karachi
[ 101, 20982, 1715, 117, 6889, 1227, 1112, 153, 3051, 6163, 144, 10584, 117, 1110, 170, 2472, 1388, 1107, 3414, 24891, 1813, 117, 16237, 117, 170, 10157, 1134, 2887, 1206, 5755, 1918, 8330, 1105, 14857, 2268, 15232, 119, 1109, 2472, 1110, 1218, 118, 1227, 1111, 10812, 10488, 1250, 117, 190, 23826, 8825, 1105, 12824, 3423, 117, 1107, 3658, 119, 2892, 1109, 1893, 21836, 1150, 1250, 1107, 1103, 20982, 1715, 117, 16237, 1138, 1126, 9712, 6512, 6922, 3582, 1150, 13793, 1121, 1103, 1331, 1104, 12556, 22077, 8330, 117, 170, 1331, 1227, 1112, 10488, 1331, 1104, 1726, 117, 1170, 1103, 16416, 1104, 1726, 1107, 3138, 119, 20982, 1250, 1110, 1113, 1103, 6246, 1107, 3658, 1105, 1103, 5028, 1134, 1132, 2327, 1113, 1103, 2472, 1208, 1178, 2239, 1114, 9634, 7550, 1150, 1138, 10107, 1105, 13757, 1671, 119, 1448, 2255, 1104, 1103, 6246, 1104, 10488, 1250, 1110, 4703, 2616, 1104, 5289, 1134, 1110, 1215, 1107, 1147, 19645, 1116, 119, 2397, 1250, 1144, 1151, 7799, 1107, 2567, 2182, 1259, 1975, 119, 1249, 1104, 1356, 1857, 117, 1103, 1295, 1104, 7116, 1113, 1103, 2472, 1138, 10558, 1106, 1198, 1978, 119, 19714, 1116, 11433, 1107, 16237, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Tenri Dam is a concrete gravity dam located in Nara prefecture in Japan. The dam is used for flood control and water supply. The catchment area of the dam is 10.7 km2. The dam impounds about 18 ha of land when full and can store 2500 thousand cubic meters of water. The construction of the dam was started on 1970 and completed in 1978. References Dams in Nara Prefecture
[ 101, 5157, 2047, 8732, 1110, 170, 5019, 9926, 6961, 1388, 1107, 11896, 1611, 22041, 1107, 1999, 119, 1109, 6961, 1110, 1215, 1111, 7870, 1654, 1105, 1447, 3880, 119, 1109, 27011, 1298, 1104, 1103, 6961, 1110, 1275, 119, 128, 1557, 1477, 119, 1109, 6961, 24034, 6094, 15613, 1164, 1407, 5871, 1104, 1657, 1165, 1554, 1105, 1169, 2984, 4805, 1568, 4032, 12242, 4865, 1104, 1447, 119, 1109, 2058, 1104, 1103, 6961, 1108, 1408, 1113, 2459, 1105, 2063, 1107, 2406, 119, 19714, 1116, 8732, 1116, 1107, 11896, 1611, 8197, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Lappe or Lappé is a German-language surname. Notable people with this surname include: Anna Lappé (born 1973), American author and educator Benay Lappe (1960), American rabbi Frances Moore Lappé (1944), American researcher and author Gemze de Lappe (1922–2017), American dancer Jean-Roger Lappé-Lappé (1981), Cameroonian footballer Joseph DeLappe (1963), UK-based American artist and academic Karl-Heinz Lappe (1987), German footballer Betsy Bobel, American beauty pageant winner Linda Lappe (1980), American college basketball coach Pele de Lappe (1916–2007), American artist See also Lappe, Ontario, unorganized part of Thunder Bay District, Ontario, Canada Lapp References German-language surnames Surnames from nicknames
[ 101, 2001, 20564, 1137, 2001, 8661, 2744, 1110, 170, 1528, 118, 1846, 12239, 119, 11017, 1234, 1114, 1142, 12239, 1511, 131, 3883, 2001, 8661, 2744, 113, 1255, 2478, 114, 117, 1237, 2351, 1105, 12102, 3096, 4164, 2001, 20564, 113, 2761, 114, 117, 1237, 20887, 10327, 4673, 2001, 8661, 2744, 113, 2782, 114, 117, 1237, 11325, 1105, 2351, 144, 5521, 3171, 1260, 2001, 20564, 113, 3988, 782, 1504, 114, 117, 1237, 9227, 2893, 118, 4271, 2001, 8661, 2744, 118, 2001, 8661, 2744, 113, 2358, 114, 117, 14292, 1811, 3585, 2419, 3177, 2162, 11478, 3186, 113, 2826, 114, 117, 1993, 118, 1359, 1237, 2360, 1105, 3397, 5728, 118, 18928, 2001, 20564, 113, 2164, 114, 117, 1528, 3585, 24903, 3162, 1883, 117, 1237, 5295, 14188, 2981, 8138, 2001, 20564, 113, 2253, 114, 117, 1237, 2134, 3163, 2154, 153, 11194, 1260, 2001, 20564, 113, 4145, 782, 1384, 114, 117, 1237, 2360, 3969, 1145, 2001, 20564, 117, 3717, 117, 8362, 1766, 24087, 1226, 1104, 10798, 2410, 1574, 117, 3717, 117, 1803, 2001, 8661, 19714, 1116, 1528, 118, 1846, 12239, 1116, 17078, 16124, 1116, 1121, 8002, 1116, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
The 1982–83 season was Manchester City's 81st season of competitive football and 63rd season in the top division of English football. In addition to the First Division, the club competed in the FA Cup and Football League Cup. First Division League table References External links Manchester City F.C. seasons Manchester City
[ 101, 1109, 2294, 782, 6032, 1265, 1108, 4280, 1392, 112, 188, 5615, 2050, 1265, 1104, 6591, 1709, 1105, 5519, 2956, 1265, 1107, 1103, 1499, 2417, 1104, 1483, 1709, 119, 1130, 1901, 1106, 1103, 1752, 1784, 117, 1103, 1526, 3042, 1107, 1103, 6820, 1635, 1105, 2289, 1453, 1635, 119, 1752, 1784, 1453, 1952, 19714, 1116, 22841, 6743, 4280, 1392, 143, 119, 140, 119, 2955, 4280, 1392, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
The Plaza Theater in Burlington, Kansas, at 404 Neosho St., was built in 1942. It was listed on the National Register of Historic Places in 2005. It replaced a 1941-built Plaza Theater which was destroyed in a flood. It was designed by architect Al Hauetter in Moderne style. In 1990 the facility began to be operated as the Flint Hills Opry, a live performance space. It was later operated as The Music Box Theatre, also a live performance space. References External links Theatres in Kansas National Register of Historic Places in Coffey County, Kansas Buildings and structures completed in 1942
[ 101, 1109, 9761, 5978, 1107, 16402, 117, 4312, 117, 1120, 27993, 14521, 2737, 1186, 1457, 119, 117, 1108, 1434, 1107, 2889, 119, 1135, 1108, 2345, 1113, 1103, 1305, 4273, 1104, 3700, 5068, 1107, 1478, 119, 1135, 2125, 170, 3018, 118, 1434, 9761, 5978, 1134, 1108, 3072, 1107, 170, 7870, 119, 1135, 1108, 2011, 1118, 4460, 2586, 11679, 4175, 8634, 1107, 4825, 1162, 1947, 119, 1130, 1997, 1103, 3695, 1310, 1106, 1129, 2622, 1112, 1103, 17741, 5377, 9126, 1616, 117, 170, 1686, 2099, 2000, 119, 1135, 1108, 1224, 2622, 1112, 1109, 1953, 9167, 2872, 117, 1145, 170, 1686, 2099, 2000, 119, 19714, 1116, 22841, 6743, 2872, 1116, 1107, 4312, 1305, 4273, 1104, 3700, 5068, 1107, 3291, 15475, 1183, 1391, 117, 4312, 19149, 1105, 4413, 2063, 1107, 2889, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Finding Paddy is a 2006 documentary film directed by Steve McCarthy about the life of FDNY Captain Patrick J. Brown (1952-2001), New York's most decorated fireman who died while climbing with his team the North Tower of WTC on 9/11. References External links Official site Tribute page to Patrick J. Brown Documentary films about the September 11 attacks
[ 101, 18036, 21211, 1110, 170, 1386, 4148, 1273, 2002, 1118, 3036, 12780, 1164, 1103, 1297, 1104, 143, 2137, 2249, 3663, 2791, 3938, 147, 119, 2671, 113, 3130, 118, 1630, 114, 117, 1203, 1365, 112, 188, 1211, 7038, 1783, 1399, 1150, 1452, 1229, 8259, 1114, 1117, 1264, 1103, 1456, 5646, 1104, 160, 9481, 1113, 130, 120, 1429, 119, 19714, 1116, 22841, 6743, 9018, 1751, 20140, 3674, 1106, 3938, 147, 119, 2671, 13595, 2441, 1164, 1103, 1347, 1429, 3690, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Mwanahamisi Omary Shurua (born 16 October 1989) is a Tanzanian professional footballer who plays as a forward for and the Tanzania women's national team. International career In 2018, Shurua scored one goal in their run to winning the 2018 CECAFA Women's Championship after scoring Ethiopia 4–1 in their final group match. Honours CECAFA Women's Championship: 2018 References External links 1989 births Living people Tanzanian women's footballers Women's association football forwards Tanzania women's international footballers
[ 101, 150, 22839, 2522, 26868, 13569, 1183, 23274, 5082, 1161, 113, 1255, 1479, 1357, 2056, 114, 1110, 170, 12037, 1179, 1848, 3585, 1150, 2399, 1112, 170, 1977, 1111, 1105, 1103, 12037, 1535, 112, 188, 1569, 1264, 119, 1570, 1578, 1130, 1857, 117, 23274, 5082, 1161, 2297, 1141, 2273, 1107, 1147, 1576, 1106, 2183, 1103, 1857, 9855, 11356, 8842, 2453, 112, 188, 1935, 1170, 3859, 11132, 125, 782, 122, 1107, 1147, 1509, 1372, 1801, 119, 14670, 9855, 11356, 8842, 2453, 112, 188, 1935, 131, 1857, 19714, 1116, 22841, 6743, 2056, 20665, 7932, 1234, 12037, 1179, 1535, 112, 188, 3585, 1116, 2453, 112, 188, 3852, 1709, 22453, 12037, 1535, 112, 188, 1835, 3585, 1116, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Devon Koswal (born 21 August 2003) is a Dutch professional footballer who currently plays as a defender for FC Dordrecht in the Dutch Eerste Divisie. Club career Koswal came through the ranks at VV Alexandria, Spartaan '20, SBV Excelsior and FC Dordrecht, and made his debut for the senior team, coming on as a substitute for Kürşad Sürmeli in a 1–0 victory over NAC Breda. He made his full debut in a 3–0 defeat to Almere City. References External links 2003 births Living people Dutch footballers FC Dordrecht players Eerste Divisie players Association football defenders
[ 101, 7122, 19892, 1116, 11487, 113, 1255, 1626, 1360, 1581, 114, 1110, 170, 2954, 1848, 3585, 1150, 1971, 2399, 1112, 170, 8919, 1111, 3604, 2091, 2956, 20690, 1107, 1103, 2954, 142, 1468, 1566, 12120, 9356, 1663, 119, 1998, 1578, 19892, 1116, 11487, 1338, 1194, 1103, 6496, 1120, 159, 2559, 10142, 117, 23479, 1389, 112, 1406, 117, 156, 2064, 2559, 16409, 18389, 23652, 1197, 1105, 3604, 2091, 2956, 20690, 117, 1105, 1189, 1117, 1963, 1111, 1103, 2682, 1264, 117, 1909, 1113, 1112, 170, 7359, 1111, 148, 17176, 1197, 18272, 3556, 156, 17176, 9019, 21091, 1107, 170, 122, 782, 121, 2681, 1166, 151, 8101, 139, 4359, 1161, 119, 1124, 1189, 1117, 1554, 1963, 1107, 170, 124, 782, 121, 3326, 1106, 2586, 14554, 1392, 119, 19714, 1116, 22841, 6743, 1581, 20665, 7932, 1234, 2954, 3585, 1116, 3604, 2091, 2956, 20690, 2139, 142, 1468, 1566, 12120, 9356, 1663, 2139, 1791, 1709, 15024, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Nicholas Loring (September 1, 1711 – July 31, 1763) was an American Congregational minister who served as the second pastor of the "Old Ledge" meetinghouse in what was then North Yarmouth, Province of Massachusetts Bay (now Yarmouth, Maine). He died while in the 28th year of his tenure. Early life Loring was born on September 11, 1711, the son of John Loring and June Baker. His father died eight years after Nicholas' birth, aged 38. He graduated from Harvard College in 1732. Career In 1736, Loring was ordained the second pastor of the new Meetinghouse under the Ledge, in what was then North Yarmouth, Province of Massachusetts Bay (now Yarmouth, Maine). He succeeded Ammi Ruhamah Cutter, who was relieved of his duties due to his liberal theology. Personal life Loring married Mary Richmond (1713–1803) on February 16, 1737, in Little Compton, Colony of Rhode Island and Providence Plantations. The daughter of colonel Silvester Richmond, Mary received a female house servant as part of her wedding gift. The slave, Belinda, was part of Mary's will. The Lorings had ten children: Richmond, Bezaleel, Levi, Lucretia, Mary, Elizabeth, Rachel, Thomas, Nicholas and Jeremiah. Thomas, Levi and Jeremiah purchased land and built homes in the Walnut Hill area of North Yarmouth, becoming some of the earliest settlers. Death Loring died on July 31, 1763, aged 51. He is interred in the Ledge Cemetery, a few yards from his church. He would have been one of the first burials there after bodies were moved from the nearby Pioneer Cemetery in 1770. His wife survived him by fifty years; she died on September 15, 1803, aged 89. Loring was succeeded at the Old Ledge Meetinghouse by Revd. Edward Brooks. References 1711 births 1763 deaths People of colonial Massachusetts People of colonial Maine American Christian clergy People from Hull, Massachusetts People from North Yarmouth, Maine Harvard College alumni Burials in Maine People of pre-statehood Maine
[ 101, 5460, 20258, 2118, 113, 1347, 122, 117, 19619, 1475, 782, 1351, 1955, 117, 19877, 114, 1108, 1126, 1237, 26544, 3907, 1150, 1462, 1112, 1103, 1248, 11616, 1104, 1103, 107, 2476, 18657, 2176, 107, 2309, 3255, 1107, 1184, 1108, 1173, 1456, 14680, 9019, 16397, 117, 2715, 1104, 3559, 2410, 113, 1208, 14680, 9019, 16397, 117, 6514, 114, 119, 1124, 1452, 1229, 1107, 1103, 16398, 1214, 1104, 1117, 6999, 119, 4503, 1297, 20258, 2118, 1108, 1255, 1113, 1347, 1429, 117, 19619, 1475, 117, 1103, 1488, 1104, 1287, 20258, 2118, 1105, 1340, 5779, 119, 1230, 1401, 1452, 2022, 1201, 1170, 5460, 112, 3485, 117, 4079, 3383, 119, 1124, 3024, 1121, 5051, 1531, 1107, 21121, 1477, 119, 17062, 1130, 21121, 1545, 117, 20258, 2118, 1108, 9492, 1103, 1248, 11616, 1104, 1103, 1207, 12505, 3255, 1223, 1103, 18657, 2176, 117, 1107, 1184, 1108, 1173, 1456, 14680, 9019, 16397, 117, 2715, 1104, 3559, 2410, 113, 1208, 14680, 9019, 16397, 117, 6514, 114, 119, 1124, 3760, 7277, 3080, 155, 23698, 7363, 1324, 15411, 2083, 117, 1150, 1108, 7375, 1104, 1117, 5078, 1496, 1106, 1117, 7691, 10104, 119, 13907, 1297, 20258, 2118, 1597, 2090, 6110, 113, 19619, 1495, 782, 12838, 114, 1113, 1428, 1479, 117, 21121, 1559, 117, 1107, 2743, 20110, 117, 11522, 1104, 9502, 2054, 1105, 11658, 22849, 1116, 119, 1109, 1797, 1104, 9431, 14159, 14455, 2083, 6110, 117, 2090, 1460, 170, 2130, 1402, 8108, 1112, 1226, 1104, 1123, 4655, 5309, 119, 1109, 6748, 117, 27700, 117, 1108, 1226, 1104, 2090, 112, 188, 1209, 119, 1109, 20258, 2118, 1116, 1125, 1995, 1482, 131, 6110, 117, 4108, 25049, 19032, 117, 12388, 117, 13174, 8127, 1465, 117, 2090, 117, 3019, 117, 4858, 117, 1819, 117, 5460, 1105, 18789, 119, 1819, 117, 12388, 1105, 18789, 3310, 1657, 1105, 1434, 4481, 1107, 1103, 160, 1348, 12251, 2404, 1298, 1104, 1456, 14680, 9019, 16397, 117, 2479, 1199, 1104, 1103, 5041, 7056, 119, 4735, 20258, 2118, 1452, 1113, 1351, 1955, 117, 19877, 117, 4079, 4062, 119, 1124, 1110, 14432, 1107, 1103, 18657, 2176, 5501, 117, 170, 1374, 3422, 1121, 1117, 1749, 119, 1124, 1156, 1138, 1151, 1141, 1104, 1103, 1148, 27111, 1175, 1170, 3470, 1127, 1427, 1121, 1103, 2721, 14589, 5501, 1107, 18980, 119, 1230, 1676, 4399, 1140, 1118, 5547, 1201, 132, 1131, 1452, 1113, 1347, 1405, 117, 12838, 117, 4079, 5840, 119, 20258, 2118, 1108, 3760, 1120, 1103, 2476, 18657, 2176, 12505, 3255, 1118, 6750, 1181, 119, 2594, 8084, 119, 19714, 1116, 19619, 1475, 20665, 19877, 6209, 2563, 1104, 5929, 3559, 2563, 1104, 5929, 6514, 1237, 2131, 12538, 2563, 1121, 9632, 117, 3559, 2563, 1121, 1456, 14680, 9019, 16397, 117, 6514, 5051, 1531, 12762, 139, 19700, 3447, 1107, 6514, 2563, 1104, 3073, 118, 1352, 5914, 6514, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
The spillover of the 2022 Russian invasion of Ukraine is a series of military engagements and events during the 2022 Russian invasion of Ukraine that have occurred outside of the territory of Ukraine. Spillovers have occurred in Russia itself, Belarus, and allegedly Transnistria. Spillovers have occurred both militarily in the form of military engagements and non-militarily through protests. Outside of pro-Ukrainian foreign volunteers, the spillover has played an overall small role in the conflict. Military spillovers Belarusian-based attacks On 24 February 2022, Belarusian president Alexander Lukashenko stated that Belarusian forces could be used in the 2022 Russian invasion of Ukraine if they were by Russia. Later that day, the Russian Armed Forces used Belarusian territory to launch attacks into northern Ukraine and begin the Battle of Chernobyl and the Kyiv offensive. Millerovo air base attack On 25 February 2022, Ukraine attacked the Millerovo air base, which was in Russian territory and outside Ukraine's national borders. The attack was inconclusive and both sides claimed victory. Non-military spillovers Protests in Russia With Russia's invasion of Ukraine, the Russian opposition and anti-war movement rose up in protests across the country. Russia responded by arresting protesters, causing the United Nations to support the protesters and condemn Russia's actions. Alleged spillovers Transnistria It has been alleged that the breakaway state of Transnistria has been involved in the conflict by Moldova. Foreign forces involved Pro-Russian forces Russian paramilitary forces Union of Donbas Volunteers Donbas separatist forces Donetsk People's Militia Luhansk People's Militia Armed Forces of Belarus Pro-Ukrainian forces Ukrainian Paramilitary forces Right Sector Georgian Legion Dzhokhar Dudayev Battalion European far-right paramilitary forces References 2022 Russian invasion of Ukraine Russo-Ukrainian War Orders of battle
[ 101, 1109, 16412, 5909, 1104, 1103, 17881, 1477, 1938, 4923, 1104, 5231, 1110, 170, 1326, 1104, 1764, 23048, 1105, 1958, 1219, 1103, 17881, 1477, 1938, 4923, 1104, 5231, 1115, 1138, 3296, 1796, 1104, 1103, 3441, 1104, 5231, 119, 156, 8508, 6643, 10704, 1138, 3296, 1107, 2733, 2111, 117, 12715, 117, 1105, 9273, 13809, 22158, 3464, 119, 156, 8508, 6643, 10704, 1138, 3296, 1241, 1940, 12888, 18206, 1107, 1103, 1532, 1104, 1764, 23048, 1105, 1664, 118, 1940, 12888, 18206, 1194, 7853, 119, 9572, 1104, 5250, 118, 5284, 2880, 8118, 117, 1103, 16412, 5909, 1144, 1307, 1126, 2905, 1353, 1648, 1107, 1103, 4139, 119, 4012, 16412, 24985, 16510, 118, 1359, 3690, 1212, 1572, 1428, 17881, 1477, 117, 16510, 2084, 2792, 14557, 13257, 10436, 2718, 2202, 1115, 16510, 2088, 1180, 1129, 1215, 1107, 1103, 17881, 1477, 1938, 4923, 1104, 5231, 1191, 1152, 1127, 1118, 2733, 119, 2611, 1115, 1285, 117, 1103, 1938, 8776, 4791, 1215, 16510, 3441, 1106, 4286, 3690, 1154, 2350, 5231, 1105, 3295, 1103, 2651, 1104, 20394, 10449, 12809, 7777, 1105, 1103, 148, 10279, 1964, 5810, 119, 3902, 18105, 1586, 2259, 2035, 1212, 1512, 1428, 17881, 1477, 117, 5231, 3623, 1103, 3902, 18105, 1586, 2259, 117, 1134, 1108, 1107, 1938, 3441, 1105, 1796, 5231, 112, 188, 1569, 6641, 119, 1109, 2035, 1108, 1107, 7235, 16891, 1105, 1241, 3091, 2694, 2681, 119, 7922, 118, 1764, 16412, 24985, 5096, 13053, 1116, 1107, 2733, 1556, 2733, 112, 188, 4923, 1104, 5231, 117, 1103, 1938, 4078, 1105, 2848, 118, 1594, 2230, 3152, 1146, 1107, 7853, 1506, 1103, 1583, 119, 2733, 5133, 1118, 6040, 1158, 14339, 117, 3989, 1103, 1244, 3854, 1106, 1619, 1103, 14339, 1105, 14255, 2007, 1306, 1179, 2733, 112, 188, 3721, 119, 1398, 27487, 1181, 16412, 24985, 13809, 22158, 3464, 1135, 1144, 1151, 6351, 1115, 1103, 2549, 7138, 1352, 1104, 13809, 22158, 3464, 1144, 1151, 2017, 1107, 1103, 4139, 1118, 17877, 119, 4201, 2088, 2017, 5096, 118, 1938, 2088, 1938, 25349, 2088, 1913, 1104, 1790, 16531, 19340, 1790, 16531, 14516, 17482, 11745, 2050, 2088, 24243, 23450, 2563, 112, 188, 18549, 14557, 3822, 5276, 2563, 112, 188, 18549, 8776, 4791, 1104, 12715, 5096, 118, 5284, 2088, 5284, 23994, 3080, 12888, 3113, 2088, 4114, 17063, 8832, 8890, 141, 1584, 5114, 23553, 12786, 6194, 6348, 4244, 1735, 1677, 118, 1268, 25349, 2088, 19714, 1116, 17881, 1477, 1938, 4923, 1104, 5231, 18182, 118, 5284, 1414, 23958, 1104, 2321, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
The 2022 Racing Louisville FC season is the club's second season of play. Racing Louisville competes in the National Women's Soccer League, the top flight of professional women's soccer in the United States. Background In its inaugural season, Racing Louisville built a squad from the 2020 NWSL Expansion Draft, the 2021 NWSL Draft, a series of free agent signings, and international transfers after the opening of the season under first head coach Christy Holly. After two losses and two draws to open the campaign in the 2021 NWSL Challenge Cup, Racing Louisville experienced an up-and-down 2021 NWSL season which saw the club finish 9th in the 10-team league and miss the playoffs. The club's greatest success in the first year was as host of the inaugural International Women's Cup, a 4-team mid-season competition won by Racing Louisville with a defeat of FC Bayern Munich on penalties. In the middle of the season, the club parted ways with Holly and installed Mario Sanchez as interim head coach. After the season concluded, Kim Björkegren was installed as the second permanent head coach of Racing Louisville. Lynn Family Stadium, Racing Louisville's home ground, was selected to host the 2021 NWSL Championship, won by Washington Spirit. Current squad Several players departed from Racing Louisville's 2021 squad after the season ended. Aside from free transfers, Savannah McCaskill was traded to Angel City FC, Julia Ashley was sent to Houston Dash, Yuki Nagasato was traded back to Chicago Red Stars, and Kaleigh Riehl was selected by San Diego Wave FC in the 2022 NWSL Expansion Draft. Racing Louisville's rights to Christen Press were traded to Angel City FC for expansion draft protection. Racing Louisville reloaded primarily through the 2022 NWSL Draft, bringing Jaelin Howell, Savannah Demelo, and Jordyn Bloomer into the squad. Jess McDonald was acquired through a trade with North Carolina Courage. 2021 draftee Kirsten Davis and free agent Hillary Beall were signed to pro contracts. Competitions Preseason friendlies All preseason friendlies for this Racing Louisville season were closed to the public with results not published. NWSL Challenge Cup Match results NWSL Regular Season Standings Results summary Match results The 2022 NWSL Season will feature 12 teams with the addition of expansion sides Angel City FC and San Diego Wave FC. All clubs will play a balanced schedule with one home match and one away match against all others. NWSL Playoffs The top six clubs in the regular season standings will qualify for the 2022 NWSL Playoffs. Player statistics Goals Assists Clean sheets Disciplinary References External links Racing Louisville FC Racing Louisville FC Racing Louisville FC 2022 in sports in Kentucky
[ 101, 1109, 17881, 1477, 6770, 11595, 3604, 1265, 1110, 1103, 1526, 112, 188, 1248, 1265, 1104, 1505, 119, 6770, 11595, 14786, 1107, 1103, 1305, 2453, 112, 188, 6863, 1453, 117, 1103, 1499, 3043, 1104, 1848, 1535, 112, 188, 5862, 1107, 1103, 1244, 1311, 119, 24570, 1130, 1157, 7517, 1265, 117, 6770, 11595, 1434, 170, 4322, 1121, 1103, 12795, 24641, 13726, 16409, 10224, 8427, 7060, 117, 1103, 17881, 1475, 24641, 13726, 7060, 117, 170, 1326, 1104, 1714, 3677, 6086, 1116, 117, 1105, 1835, 16845, 1170, 1103, 2280, 1104, 1103, 1265, 1223, 1148, 1246, 2154, 23788, 9030, 119, 1258, 1160, 6053, 1105, 1160, 9804, 1106, 1501, 1103, 2322, 1107, 1103, 17881, 1475, 24641, 13726, 6571, 1635, 117, 6770, 11595, 4531, 1126, 1146, 118, 1105, 118, 1205, 17881, 1475, 24641, 13726, 1265, 1134, 1486, 1103, 1526, 3146, 5612, 1107, 1103, 1275, 118, 1264, 2074, 1105, 5529, 1103, 7736, 119, 1109, 1526, 112, 188, 4459, 2244, 1107, 1103, 1148, 1214, 1108, 1112, 2989, 1104, 1103, 7517, 1570, 2453, 112, 188, 1635, 117, 170, 125, 118, 1264, 2286, 118, 1265, 2208, 1281, 1118, 6770, 11595, 1114, 170, 3326, 1104, 3604, 23517, 6947, 1113, 13095, 119, 1130, 1103, 2243, 1104, 1103, 1265, 117, 1103, 1526, 10155, 3242, 1114, 9030, 1105, 4631, 7734, 17738, 1112, 10572, 1246, 2154, 119, 1258, 1103, 1265, 4803, 117, 4246, 139, 3361, 19593, 4661, 12606, 5123, 1108, 4631, 1112, 1103, 1248, 4088, 1246, 2154, 1104, 6770, 11595, 119, 9086, 3921, 3339, 117, 6770, 11595, 112, 188, 1313, 1747, 117, 1108, 2700, 1106, 2989, 1103, 17881, 1475, 24641, 13726, 1935, 117, 1281, 1118, 1994, 7258, 119, 9493, 4322, 3728, 2139, 7361, 1121, 6770, 11595, 112, 188, 17881, 1475, 4322, 1170, 1103, 1265, 2207, 119, 14727, 1121, 1714, 16845, 117, 11304, 150, 1665, 1658, 25611, 7956, 1108, 6537, 1106, 5876, 1392, 3604, 117, 5829, 9017, 1108, 1850, 1106, 4666, 23460, 117, 10684, 2293, 11896, 11305, 10024, 1108, 6537, 1171, 1106, 2290, 2156, 6200, 117, 1105, 14812, 12185, 155, 1663, 8495, 1108, 2700, 1118, 1727, 4494, 13531, 3604, 1107, 1103, 17881, 1477, 24641, 13726, 16409, 10224, 8427, 7060, 119, 6770, 11595, 112, 188, 2266, 1106, 4028, 1424, 2544, 1127, 6537, 1106, 5876, 1392, 3604, 1111, 4298, 5039, 3636, 119, 6770, 11595, 1231, 18268, 3120, 1194, 1103, 17881, 1477, 24641, 13726, 7060, 117, 4362, 147, 12060, 1394, 19929, 117, 11304, 3177, 10212, 1186, 117, 1105, 8125, 21366, 1179, 19169, 1200, 1154, 1103, 4322, 119, 12419, 9092, 1108, 2888, 1194, 170, 2597, 1114, 1456, 2938, 27796, 119, 17881, 1475, 5039, 3051, 14477, 20628, 3635, 1105, 1714, 3677, 20001, 4108, 5727, 1127, 1878, 1106, 5250, 8216, 119, 8579, 1116, 11689, 19885, 2142, 1910, 7875, 1398, 23592, 1910, 7875, 1111, 1142, 6770, 11595, 1265, 1127, 1804, 1106, 1103, 1470, 1114, 2686, 1136, 1502, 119, 24641, 13726, 6571, 1635, 11492, 2686, 24641, 13726, 14381, 5623, 9996, 1116, 16005, 14940, 11492, 2686, 1109, 17881, 1477, 24641, 13726, 5623, 1209, 2672, 1367, 1929, 1114, 1103, 1901, 1104, 4298, 3091, 5876, 1392, 3604, 1105, 1727, 4494, 13531, 3604, 119, 1398, 3514, 1209, 1505, 170, 12591, 6030, 1114, 1141, 1313, 1801, 1105, 1141, 1283, 1801, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Bessa is a Portuguese surname. Notable people with the surname include: Adriano Bessa (born 1976), Portuguese footballer Agustina Bessa-Luís (1922–2019), Portuguese writer Daniel Bessa (born 1993), Brazilian footballer Diogo Bessa (born 1999), Portuguese footballer Éber Bessa (born 1992), Brazilian footballer João Paulo Bessa (born 1947), Portuguese rugby union footballer and coach Portuguese-language surnames
[ 101, 4108, 11655, 1110, 170, 4269, 12239, 119, 11017, 1234, 1114, 1103, 12239, 1511, 131, 7687, 1186, 4108, 11655, 113, 1255, 2402, 114, 117, 4269, 3585, 138, 12909, 11681, 4108, 11655, 118, 14557, 16928, 113, 3988, 782, 10351, 114, 117, 4269, 2432, 2979, 4108, 11655, 113, 1255, 1949, 114, 117, 5468, 3585, 12120, 26205, 4108, 11655, 113, 1255, 1729, 114, 117, 4269, 3585, 234, 3169, 4108, 11655, 113, 1255, 1924, 114, 117, 5468, 3585, 18139, 8764, 4108, 11655, 113, 1255, 3138, 114, 117, 4269, 4896, 3779, 3585, 1105, 2154, 4269, 118, 1846, 12239, 1116, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
is a Japanese footballer currently playing as a forward for Iwate Grulla Morioka. Career statistics Club . Notes References 1999 births Living people Association football people from Kanagawa Prefecture Rikkyo University alumni Japanese footballers Association football forwards J2 League players Iwate Grulla Morioka players
[ 101, 1110, 170, 1983, 3585, 1971, 1773, 1112, 170, 1977, 1111, 146, 20543, 1162, 144, 5082, 3848, 12556, 8558, 1968, 119, 17062, 9161, 1998, 119, 8797, 19714, 1116, 1729, 20665, 7932, 1234, 1791, 1709, 1234, 1121, 14812, 1605, 14612, 8197, 155, 4847, 3781, 1186, 1239, 12762, 1983, 3585, 1116, 1791, 1709, 22453, 147, 1477, 1453, 2139, 146, 20543, 1162, 144, 5082, 3848, 12556, 8558, 1968, 2139, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Malek Baayou (born 29 April 1999 in Sousse; ) is a Tunisian professional footballer who plays as a midfielder for Étoile Sportive du Sahel and the Tunisia national team. Club career Baayou is trained at the Étoile Sportive du Sahel (ESS), where he goes through all categories of young people. In 2019, Malek Baayou has decided to renew his contract with ES Sahel. He signed a four-year contract. In January 2019, he was voted best player of the month in Tunisian League. He participates with the same club in the CAF Champions League, the CAF Confederation Cup and the CAF Supercup. International career Malek Baayou played his first match for the Tunisian national football team on September 21, 2019, in a friendly against Libya. This match won 1-0 is part of the qualifiers for the 2020 African Nations Championship. Honours and Achievements Étoile sportive du Sahel Tunisian Cup : 2018-19 Arab Club Champions Cup : 2018-19 References External links 1999 births Living people People from Sousse Association football midfielders Tunisian footballers Étoile Sportive du Sahel players Tunisian Ligue Professionnelle 1 players Tunisia international footballers
[ 101, 10882, 1377, 18757, 4164, 6094, 113, 1255, 1853, 1364, 1729, 1107, 1573, 13356, 1162, 132, 114, 1110, 170, 25594, 1848, 3585, 1150, 2399, 1112, 170, 8852, 1111, 234, 2430, 4759, 7331, 2109, 3840, 17784, 18809, 1105, 1103, 13772, 1569, 1264, 119, 1998, 1578, 18757, 4164, 6094, 1110, 3972, 1120, 1103, 234, 2430, 4759, 7331, 2109, 3840, 17784, 18809, 113, 142, 12480, 114, 117, 1187, 1119, 2947, 1194, 1155, 6788, 1104, 1685, 1234, 119, 1130, 10351, 117, 10882, 1377, 18757, 4164, 6094, 1144, 1879, 1106, 23421, 1117, 2329, 1114, 142, 1708, 17784, 18809, 119, 1124, 1878, 170, 1300, 118, 1214, 2329, 119, 1130, 1356, 10351, 117, 1119, 1108, 4751, 1436, 1591, 1104, 1103, 2370, 1107, 25594, 1453, 119, 1124, 18557, 1114, 1103, 1269, 1526, 1107, 1103, 8784, 2271, 4748, 1453, 117, 1103, 8784, 2271, 13052, 1635, 1105, 1103, 8784, 2271, 3198, 18637, 119, 1570, 1578, 10882, 1377, 18757, 4164, 6094, 1307, 1117, 1148, 1801, 1111, 1103, 25594, 1569, 1709, 1264, 1113, 1347, 1626, 117, 10351, 117, 1107, 170, 4931, 1222, 13135, 119, 1188, 1801, 1281, 122, 118, 121, 1110, 1226, 1104, 1103, 23504, 1111, 1103, 12795, 2170, 3854, 1935, 119, 14670, 1105, 10295, 1116, 234, 2430, 4759, 4799, 2109, 3840, 17784, 18809, 25594, 1635, 131, 1857, 118, 1627, 4699, 1998, 4748, 1635, 131, 1857, 118, 1627, 19714, 1116, 22841, 6743, 1729, 20665, 7932, 1234, 2563, 1121, 1573, 13356, 1162, 1791, 1709, 8852, 1116, 25594, 3585, 1116, 234, 2430, 4759, 7331, 2109, 3840, 17784, 18809, 2139, 25594, 19882, 11644, 5800, 1988, 10376, 1162, 122, 2139, 13772, 1835, 3585, 1116, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Hans-Peter Kohler is a German-American demographer and sociologist. He is the Frederick J. Warren Professor of Demography, Professor of Sociology, and co-director of the Population Aging Research Center at the University of Pennsylvania. In 2005, he received the Clifford C. Clogg Award for Early Career Achievement from the Population Association of America, and in 2018, the Association named him an honored member. He previously served as a fellow at the Centre for Advanced Study at the Norwegian Academy of Science and Letters from 2006 to 2007 and as president of the Society for Biodemography and Social Biology from 2007 to 2012. In 2012, he and the three other authors (Jennifer Johnson-Hanks, Christine Bachrach, and Phil Morgan) received the Otis Dudley Duncan Award for Outstanding Scholarship in Social Demography from the American Sociological Association for their 2011 book Understanding Family Change and Variation: Toward a Theory of Conjunctural Action. References External links Faculty page German emigrants to the United States Living people American sociologists American demographers University of Pennsylvania faculty University of California, Berkeley alumni
[ 101, 6458, 118, 1943, 19892, 14460, 1110, 170, 1528, 118, 1237, 11238, 14334, 1105, 20650, 8844, 119, 1124, 1110, 1103, 4682, 147, 119, 5407, 2986, 1104, 3177, 3702, 8944, 117, 2986, 1104, 21181, 117, 1105, 1884, 118, 1900, 1104, 1103, 10858, 138, 3375, 2713, 1945, 1120, 1103, 1239, 1104, 2680, 119, 1130, 1478, 117, 1119, 1460, 1103, 14363, 140, 119, 140, 13791, 1403, 1698, 1111, 4503, 17062, 10295, 1121, 1103, 10858, 1791, 1104, 1738, 117, 1105, 1107, 1857, 117, 1103, 1791, 1417, 1140, 1126, 8817, 1420, 119, 1124, 2331, 1462, 1112, 170, 3235, 1120, 1103, 2961, 1111, 8445, 8690, 1120, 1103, 4236, 2127, 1104, 2444, 1105, 10557, 1121, 1386, 1106, 1384, 1105, 1112, 2084, 1104, 1103, 2015, 1111, 139, 2660, 2007, 3702, 8944, 1105, 3563, 12055, 1121, 1384, 1106, 1368, 119, 1130, 1368, 117, 1119, 1105, 1103, 1210, 1168, 5752, 113, 7184, 2921, 118, 8902, 1116, 117, 10918, 10420, 19366, 1324, 117, 1105, 5676, 4461, 114, 1460, 1103, 20579, 12840, 6809, 1698, 1111, 7196, 16856, 1107, 3563, 3177, 3702, 8944, 1121, 1103, 1237, 1573, 8174, 7810, 1791, 1111, 1147, 1349, 1520, 21300, 3921, 9091, 1105, 159, 11315, 2116, 131, 27674, 170, 9560, 1104, 16752, 20327, 12602, 6605, 119, 19714, 1116, 22841, 6743, 6694, 3674, 1528, 9712, 6512, 18937, 1106, 1103, 1244, 1311, 7932, 1234, 1237, 20650, 17246, 1237, 11238, 26940, 1239, 1104, 2680, 5449, 1239, 1104, 1756, 117, 7823, 12762, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Catherine Donovan (1826, in Ireland – April 16, 1906, in Lakewood Township, New Jersey) was an Irish-American dressmaker, best remembered for her dress shop on Madison Avenue in New York City in the early 20th century. Her designs have been preserved and exhibited by the Metropolitan Museum of Art and the Philadelphia Museum of Art. References 1826 births 1906 deaths Irish designers American designers
[ 101, 6017, 12930, 113, 12000, 117, 1107, 2270, 782, 1364, 1479, 117, 4782, 117, 1107, 2161, 2615, 3671, 117, 1203, 3308, 114, 1108, 1126, 2600, 118, 1237, 3642, 8085, 117, 1436, 3801, 1111, 1123, 3642, 4130, 1113, 6501, 3194, 1107, 1203, 1365, 1392, 1107, 1103, 1346, 3116, 1432, 119, 1430, 5054, 1138, 1151, 6018, 1105, 7799, 1118, 1103, 5458, 2143, 1104, 2051, 1105, 1103, 3562, 2143, 1104, 2051, 119, 19714, 1116, 12000, 20665, 4782, 6209, 2600, 12297, 1237, 12297, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
The 2022 Araucanías wildfires are a series of wildfires in the Chilean region of Araucanía. By February 26 57,000 ha had been burnt by fires. The commune of Traiguén and China Muerta National Reserve were on February 26 the places were most resources being used to fight fires. By February 25 180 haa had been consumed in China Muerta and the fire had not yet reached Conguillío National Park. According to Aída Baldini, manager of the wildfire division of the National Forest Corporation, many fires in Araucanía are intentional given that firefighters are often hindered to approach the fires. This hinderance is in some cases a large tree that have been felled over a road, or by firefighting personell being threatened at gunpoint. References Araucania Araucania Araucania Araucania Araucania Wildfires in Chile History of Araucanía Region
[ 101, 1109, 17881, 1477, 25692, 23315, 1179, 22418, 4098, 20259, 1132, 170, 1326, 1104, 4098, 20259, 1107, 1103, 12208, 1805, 1104, 25692, 23315, 1179, 7171, 119, 1650, 1428, 1744, 4667, 117, 1288, 5871, 1125, 1151, 11946, 1118, 8966, 119, 1109, 5188, 1104, 157, 14089, 13830, 12640, 1105, 1975, 19569, 7340, 1161, 1305, 5081, 1127, 1113, 1428, 1744, 1103, 2844, 1127, 1211, 3979, 1217, 1215, 1106, 2147, 8966, 119, 1650, 1428, 1512, 7967, 5871, 1161, 1125, 1151, 10133, 1107, 1975, 19569, 7340, 1161, 1105, 1103, 1783, 1125, 1136, 1870, 1680, 16752, 13830, 7956, 26804, 1305, 1670, 119, 1792, 1106, 138, 6212, 1810, 18757, 5253, 4729, 117, 2618, 1104, 1103, 4098, 7117, 2417, 1104, 1103, 1305, 4089, 3436, 117, 1242, 8966, 1107, 25692, 23315, 1179, 7171, 1132, 24629, 1549, 1115, 27552, 1132, 1510, 24856, 5686, 1106, 3136, 1103, 8966, 119, 1188, 24856, 19776, 2093, 1110, 1107, 1199, 2740, 170, 1415, 2780, 1115, 1138, 1151, 2204, 1174, 1166, 170, 1812, 117, 1137, 1118, 1783, 24663, 1825, 3991, 1217, 4963, 1120, 2560, 7587, 119, 19714, 1116, 25692, 23315, 5813, 25692, 23315, 5813, 25692, 23315, 5813, 25692, 23315, 5813, 25692, 23315, 5813, 5469, 20259, 1107, 6504, 2892, 1104, 25692, 23315, 1179, 7171, 4171, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Salih Ashmawi (1910–1983) was an Egyptian political figure and a member of the Muslim Brotherhood. He held several posts in the group and edited some of its publications such Al Dawa and Al Nadhir. Early life and education Ashmawi was born in Cairo in 1910. He received a bachelor's degree in commerce in 1932 from Fuad I University. Career and activities Following his meeting with Hasan Al Banna Ashmawi joined the Muslim Brotherhood in 1937. Next year Ashmawi was appointed editor-in-chief of Al Nadhir, a weekly journal started by the Brotherhood the same year. However, he left the Brotherhood after internal disputes stopping the publication of the journal and involved in the establishment of another Islamic group entitled the Society of Mohammad's Youth. Later he restored his relations with Al Banna and became the head of secret group within the Brotherhood. Under his leadership the secret apparatus gained considerable autonomy to the extent that Al Banna had no power over it. Ashmawi was part of the extremist faction and was appointed the deputy secretary of Al Banna in 1947, replacing Ahmad Mohammad Al Sukkari in the post. Abdul Rahman Al Sanadi, on the other hand, succeeded Ashmawi as the head of the Brotherhood's secret network. In 1949 Al Banna was assassinated, and Ashmawi and Hasan Ismail Al Hudaybi became the leaders of the Brotherhood which was banned in 1948. In 1951 Ashmawi launched an Islamic journal, Al Dawa, which was the official organ of the group. In 1953 he and Mohammad Al Ghazali, another senior Brotherhood figure, were dismissed from the group due to their conflict with Hasan Ismail Al Hudaybi. They both also arrested and jailed as part of Gamal Abdel Nasser's crackdown against the Brotherhood. Later years and death Ashmawi collaborated with Umar Al Tilmisani to start Al Dawa in 1976. The journal was published until 1981, and its founder Ashmawi died in 1983. References 20th-century Egyptian politicians 1910 births 1983 births Cairo University alumni Egyptian magazine founders Egyptian Muslim Brotherhood leaders Politicians from Cairo Egyptian prisoners and detainees
[ 101, 18613, 21656, 8603, 1918, 10073, 113, 4178, 782, 2278, 114, 1108, 1126, 6210, 1741, 2482, 1105, 170, 1420, 1104, 1103, 4360, 15831, 119, 1124, 1316, 1317, 8345, 1107, 1103, 1372, 1105, 5045, 1199, 1104, 1157, 5873, 1216, 2586, 10136, 3624, 1105, 2586, 11896, 20832, 1197, 119, 4503, 1297, 1105, 1972, 8603, 1918, 10073, 1108, 1255, 1107, 11086, 1107, 4178, 119, 1124, 1460, 170, 8091, 112, 188, 2178, 1107, 10678, 1107, 3833, 1121, 14763, 3556, 146, 1239, 119, 17062, 1105, 2619, 2485, 1117, 2309, 1114, 18892, 2586, 18393, 1605, 8603, 1918, 10073, 1688, 1103, 4360, 15831, 1107, 3493, 119, 5893, 1214, 8603, 1918, 10073, 1108, 1923, 3045, 118, 1107, 118, 2705, 1104, 2586, 11896, 20832, 1197, 117, 170, 5392, 4897, 1408, 1118, 1103, 15831, 1103, 1269, 1214, 119, 1438, 117, 1119, 1286, 1103, 15831, 1170, 4422, 12530, 7202, 1103, 4128, 1104, 1103, 4897, 1105, 2017, 1107, 1103, 4544, 1104, 1330, 4769, 1372, 3909, 1103, 2015, 1104, 12460, 112, 188, 4866, 119, 2611, 1119, 5219, 1117, 4125, 1114, 2586, 18393, 1605, 1105, 1245, 1103, 1246, 1104, 3318, 1372, 1439, 1103, 15831, 119, 2831, 1117, 3645, 1103, 3318, 16486, 3388, 5602, 13987, 1106, 1103, 6102, 1115, 2586, 18393, 1605, 1125, 1185, 1540, 1166, 1122, 119, 8603, 1918, 10073, 1108, 1226, 1104, 1103, 4252, 7877, 18972, 10673, 1105, 1108, 1923, 1103, 5874, 4848, 1104, 2586, 18393, 1605, 1107, 3138, 117, 5861, 10870, 12460, 2586, 15463, 19610, 2047, 1107, 1103, 2112, 119, 10179, 15106, 2586, 1727, 14230, 117, 1113, 1103, 1168, 1289, 117, 3760, 8603, 1918, 10073, 1112, 1103, 1246, 1104, 1103, 15831, 112, 188, 3318, 2443, 119, 1130, 3224, 2586, 18393, 1605, 1108, 17493, 117, 1105, 8603, 1918, 10073, 1105, 18892, 21851, 2586, 20164, 6194, 5567, 1245, 1103, 3478, 1104, 1103, 15831, 1134, 1108, 7548, 1107, 3027, 119, 1130, 3280, 8603, 1918, 10073, 2536, 1126, 4769, 4897, 117, 2586, 10136, 3624, 117, 1134, 1108, 1103, 2078, 5677, 1104, 1103, 1372, 119, 1130, 3185, 1119, 1105, 12460, 2586, 144, 2328, 25049, 1182, 117, 1330, 2682, 15831, 2482, 117, 1127, 6714, 1121, 1103, 1372, 1496, 1106, 1147, 4139, 1114, 18892, 21851, 2586, 20164, 6194, 5567, 119, 1220, 1241, 1145, 3950, 1105, 23631, 1112, 1226, 1104, 144, 7363, 1233, 22358, 1883, 11896, 14607, 112, 188, 8672, 5455, 1222, 1103, 15831, 119, 2611, 1201, 1105, 1473, 8603, 1918, 10073, 8303, 1114, 12189, 1813, 2586, 157, 2723, 15394, 7192, 1106, 1838, 2586, 10136, 3624, 1107, 2402, 119, 1109, 4897, 1108, 1502, 1235, 2358, 117, 1105, 1157, 3249, 8603, 1918, 10073, 1452, 1107, 2278, 119, 19714, 1116, 3116, 118, 1432, 6210, 8673, 4178, 20665, 2278, 20665, 11086, 1239, 12762, 6210, 2435, 9004, 6210, 4360, 15831, 3478, 17129, 26320, 5895, 1121, 11086, 6210, 5419, 1105, 1260, 11379, 8870, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
The Commerce Department Karachi University operates under the Faculty of Management & Administrative Sciences of University of Karachi It was established in the year 1974. Faculty Programs Graduate (Morning/Evening) BS - 4 year (Morning/Evening) M.COM - 2 year (Business Studies Graduates) References University of Karachi Karachi Sindh Pakistan
[ 101, 1109, 7873, 1951, 16237, 1239, 5049, 1223, 1103, 6694, 1104, 3973, 111, 14275, 4052, 1104, 1239, 1104, 16237, 1135, 1108, 1628, 1107, 1103, 1214, 2424, 119, 6694, 18555, 11045, 113, 7151, 120, 11718, 114, 21948, 118, 125, 1214, 113, 7151, 120, 11718, 114, 150, 119, 18732, 2107, 118, 123, 1214, 113, 3518, 3829, 11045, 1116, 114, 19714, 1116, 1239, 1104, 16237, 16237, 22201, 3658, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
The Old Town Hall is a former events venue in Prince of Wales Road, Cromer, Norfolk, England. The structure, which is currently used for retail purposes, is a grade II listed building. History In the mid-19th century, a group of local businessmen decided to form a company to raise funds for the erection of an events venue in the town. The site they selected was on the west side of Prince of Wales Road and the foundation stone was laid by Mrs Benjamin Bond-Cabbell of Cromer Hall on 3 January 1890. The building was designed by George Skipper in the Queen Anne style, built in red brick with a stucco finish by Chapman and Son of Norwich and was completed later that year. The design involved a symmetrical main frontage with five bays facing onto Prince of Wales Road; the central bay, which slightly projected forward, featured, on the ground floor, a round headed doorway and, on the first floor, a four-part window flanked by fluted pilasters supporting a modillioned pediment with an illustration of a sailing ship in the tympanum. The bays on either side of the central bay were fenestrated by sash windows on the ground floor and by two-part windows on the first floor while the outer bays were fenestrated by pairs of sash windows on the ground floor and by three-part windows on the first floor. Between the two floors there was a panel bearing the coats of arms of the first lord of the manor, Sir Nicholas de Weyland, of the mariner, Robert Bacon, of the locally-born Lord Mayor of London, Sir Bartholomew Reade, and of the later lords of the manor, Lord Suffield and Benjamin Bond-Cabbell, as well as those of other prominent local families. Internally, the principal room was the main assembly hall which was designed to accommodate 900 people. Following significant population growth, largely associated with the tourism industry, the area became an urban district in 1894. However, rather than using the town hall, the new council chose to establish its offices at the corner of West Street and Chapel Street in 1908, before relocating to North Lodge Park in 1928. Following the Second World War, during which time the town hall was requisitioned for military use, it resumed its role as a theatre and performers included the actor, Bernard Archard, who appeared in a production entitled The Regency Players, in 1960. The building was acquired by a firm of wine merchants in 1963, when the company that had developed it was wound up. The town hall was then acquired by a property developer and let to the the Co-op in 1991, before being restored with funding from English Heritage in 1994. In the early 21st century, it was occupied by a firm of solicitors, and, in September 2020, it re-opened as a shop known as "Harbord's Artisan Vintage Emporium". Notes References Government buildings completed in 1890 City and town halls in Norfolk Cromer Grade II listed buildings in Norfolk
[ 101, 1109, 2476, 2779, 1944, 1110, 170, 1393, 1958, 6590, 1107, 2558, 1104, 2717, 1914, 117, 140, 11457, 1197, 117, 7240, 117, 1652, 119, 1109, 2401, 117, 1134, 1110, 1971, 1215, 1111, 6989, 4998, 117, 1110, 170, 3654, 1563, 2345, 1459, 119, 2892, 1130, 1103, 2286, 118, 2835, 1432, 117, 170, 1372, 1104, 1469, 19150, 1879, 1106, 1532, 170, 1419, 1106, 4693, 4381, 1111, 1103, 14398, 1104, 1126, 1958, 6590, 1107, 1103, 1411, 119, 1109, 1751, 1152, 2700, 1108, 1113, 1103, 1745, 1334, 1104, 2558, 1104, 2717, 1914, 1105, 1103, 4686, 2576, 1108, 3390, 1118, 2823, 5816, 8211, 118, 140, 6639, 14545, 1104, 140, 11457, 1197, 1944, 1113, 124, 1356, 5522, 119, 1109, 1459, 1108, 2011, 1118, 1667, 16851, 11292, 1107, 1103, 2454, 3967, 1947, 117, 1434, 1107, 1894, 5003, 1114, 170, 188, 7926, 14566, 3146, 1118, 11554, 1105, 6913, 1104, 12867, 1105, 1108, 2063, 1224, 1115, 1214, 119, 1109, 1902, 2017, 170, 26795, 1514, 1524, 2553, 1114, 1421, 15520, 4749, 2135, 2558, 1104, 2717, 1914, 132, 1103, 2129, 5952, 117, 1134, 2776, 11479, 1977, 117, 2081, 117, 1113, 1103, 1747, 1837, 117, 170, 1668, 2917, 6535, 1105, 117, 1113, 1103, 1148, 1837, 117, 170, 1300, 118, 1226, 2487, 16947, 1118, 10284, 1181, 185, 8009, 12429, 4374, 170, 182, 5412, 7956, 17743, 185, 1174, 27439, 1114, 1126, 17011, 1104, 170, 9145, 2062, 1107, 1103, 189, 17162, 10224, 1818, 119, 1109, 15520, 1113, 1719, 1334, 1104, 1103, 2129, 5952, 1127, 175, 7582, 16468, 1906, 1118, 21718, 2737, 3751, 1113, 1103, 1747, 1837, 1105, 1118, 1160, 118, 1226, 3751, 1113, 1103, 1148, 1837, 1229, 1103, 6144, 15520, 1127, 175, 7582, 16468, 1906, 1118, 7608, 1104, 21718, 2737, 3751, 1113, 1103, 1747, 1837, 1105, 1118, 1210, 118, 1226, 3751, 1113, 1103, 1148, 1837, 119, 3847, 1103, 1160, 7849, 1175, 1108, 170, 5962, 7343, 1103, 19582, 1104, 1739, 1104, 1103, 1148, 7692, 1104, 1103, 9764, 117, 2203, 5460, 1260, 1284, 18403, 117, 1104, 1103, 5243, 1197, 117, 1823, 17887, 117, 1104, 1103, 6889, 118, 1255, 2188, 4643, 1104, 1498, 117, 2203, 21622, 15152, 1162, 117, 1105, 1104, 1103, 1224, 17499, 1104, 1103, 9764, 117, 2188, 15463, 3101, 12350, 1105, 5816, 8211, 118, 140, 6639, 14545, 117, 1112, 1218, 1112, 1343, 1104, 1168, 3289, 1469, 2073, 119, 13545, 1193, 117, 1103, 3981, 1395, 1108, 1103, 1514, 5839, 2885, 1134, 1108, 2011, 1106, 8378, 7208, 1234, 119, 2485, 2418, 1416, 3213, 117, 3494, 2628, 1114, 1103, 8668, 2380, 117, 1103, 1298, 1245, 1126, 3953, 1629, 1107, 5901, 119, 1438, 117, 1897, 1190, 1606, 1103, 1411, 2885, 117, 1103, 1207, 3193, 4102, 1106, 4586, 1157, 4158, 1120, 1103, 2655, 1104, 1537, 1715, 1105, 7557, 1715, 1107, 4536, 117, 1196, 1231, 27970, 1106, 1456, 9262, 1670, 1107, 3825, 119, 2485, 1103, 2307, 1291, 1414, 117, 1219, 1134, 1159, 1103, 1411, 2885, 1108, 1231, 18540, 1174, 1111, 1764, 1329, 117, 1122, 7475, 1157, 1648, 1112, 170, 4041, 1105, 9821, 1529, 1103, 2811, 117, 6190, 19797, 2881, 117, 1150, 1691, 1107, 170, 1707, 3909, 1109, 23069, 6624, 117, 1107, 2761, 119, 1109, 1459, 1108, 2888, 1118, 170, 3016, 1104, 4077, 11278, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Kirsten Jacobsen ( Larsen; 18 February 1942 – 2 December 2010) was an Danish real estate agent and politician who was an elected member of the Folketing for the North Jutland County constituency for two non-consecutive periods from 1973 to 1981 and then between 1988 and 2001. She was first a member of the Progress Party, the Freedom 2000 Group an independent and The Conservative People's Party. Jacobsen was also a member of both the Parliamentary Assembly of the Council of Europe and the Nordic Council. She was leader of the Progress Party from 1995 to 1997. Jacobsen was appointed Knight of the Order of the Dannebrog in 1991 and was upgraded to Knight First Class of the Order of the Dannebrog five years later. Early life On 18 February 1942, Jacobsen was born in Aalborg Hospital in Aalborg; she regularly maintained that she was born in Nørresundby. She was the third of five children of the dairy worker and depot manager Børge Larsen and Helene Bånd-Larsen. Jacobsen was raised in the family home, Nordenfjord at Nørresundby, where her father was custodian. She worked at her father's ice cream family as well as delivering their products and cared for her younger siblings after her mother fell ill. Jacobsen became a member of the Young Conservatives when she was 14 years old and was able to train as an authorised state real estate agent at an educational law firm in 1970. She also attended Aalborg Business School. Career Jacobsen became a member of the newly founded Progress Party in 1972, and was elected to represent the North Jutland County constituency in the Folketing, a seat she held from 4 December 1973 to 7 December 1981. She was one of 28 Progress Party politicians to be elected to the Folketing. During her first term, she became a member of the Nordic Council between 1973 and 1981, and of the Parliamentary Assembly of the Council of Europe from 25 April 1977 to 21 April 1980, variously as a substitute and as a representative. Jacobsen was able to become deputy chair of Parliament's Housing Committee, the Political-Economic Committee as well as the Tax Committee due to her interest in those fields. She was deputy chair of Progress Party's parliamentary group between 1975 and 1976. Jacobsen resigned from the Folketing in 1981 because of ill health. She moved to Oslo in 1982, but returned to Blokhus after four months. Jacobsen was re-elected to the Folketing again for the North Jutland County constituency in the 1988 Danish general election on 10 May. She returned to the Parliamentary Assembly of the Council of Europe for the period from 30 January 1989 to 1 January 1990, and returned to the Nordic Council as a deputy starting in 1990. Jacobsen felt she was ignored by the party leader ; she was group chair for one week, feeling unsuited to a leadership role. She was a political rapporteur for the financial sector and the Faroe Islands, a member of the Business Ministers' Idea Group regarding Real Estate Trading as well as of the and of the parliamentary inquiry committee regarding Spar Nord's purchase of in 1994. From 27 December 1990 to 1 October 1996, she was a member of the and became close friends with Lilli Gyldenkilde of the Socialist People's Party in the process, leading to the television programme Ask Lilli and Kirsten. In 1995, Jacobsen was made leader of the Progress Party following the establishment of the Danish People's Party by Pia Kjærsgaard. She resigned the leadership in 1997 when her husband became quite unwell. At the 1998 Danish general election, her large number of personal votes was enough to allow the Progress Party to remain represented in the Folketing with two seats. The result was enough to make Jacobsen one of Denmark's top three voted on politicians. She notified the party's parliamentary group and her constituency in November 1998 that she would step down the following year to enable her to spend more time with her family and friends. When this was announced, Jacobsen and three other party members formed the Freedom 2000 group in protest of Mogens Glistrup returning to the Progress Party. She became an independent in February 2001 and left the Folketing at the 2001 Danish general election that 20 November. During her career, Jacobsen established an alternative complaints centre that received 6,000 enquries per year from citizens. This enabled her to know what the population were thinking of. In 1998, she authored her biography, Kirsten. In it, Jacobsen says she did not join other parties while in parliament due to their higher levels of discipline. She was named Politician of the Year in 1993. Jacobsen became a member of The Conserative People's Party in 2008. Personal life From 21 May 1960 to their divorce in 1972, she was married to the electric wholesaler Niels Willum Wisbech Jacobsen. They had three children. Jacobsen remarried to the Norwegian real estate agent Erik Stormfelt on 30 June 1979 and remained married until his death on 20 December 1997. She was appointed Knight of the Order of the Dannebrog in 1991 and was upgraded to Knight First Class of the Order of the Dannebrog five years later. Jacobsen died at a Copenhagen hospice on 2 December 2010. References 1942 births 2010 deaths People from Aalborg Aalborg University alumni 20th-century Danish women politicians 21st-century Danish women politicians Progress Party (Denmark) politicians Women members of the Folketing Members of the Folketing 1973–1975 Members of the Folketing 1975–1977 Members of the Folketing 1977–1979 Members of the Folketing 1979–1981 Members of the Folketing 1988–1990 Members of the Folketing 1990–1994 Members of the Folketing 1994–1998 Members of the Folketing 1998–2001 Members of the Parliamentary Assembly of the Council of Europe Substitute Members of the Parliamentary Assembly of the Council of Europe Knights First Class of the Order of the Dannebrog
[ 101, 14477, 20628, 13220, 1424, 113, 22111, 132, 1407, 1428, 2889, 782, 123, 1382, 1333, 114, 1108, 1126, 4979, 1842, 3327, 3677, 1105, 2931, 1150, 1108, 1126, 1809, 1420, 1104, 1103, 12539, 21299, 1111, 1103, 1456, 23915, 11910, 1391, 5269, 1111, 1160, 1664, 118, 4776, 6461, 1121, 2478, 1106, 2358, 1105, 1173, 1206, 2115, 1105, 1630, 119, 1153, 1108, 1148, 170, 1420, 1104, 1103, 12798, 1786, 117, 1103, 6483, 1539, 1990, 1126, 2457, 1105, 1109, 5739, 2563, 112, 188, 1786, 119, 13220, 1424, 1108, 1145, 170, 1420, 1104, 1241, 1103, 10628, 2970, 1104, 1103, 1761, 1104, 1980, 1105, 1103, 14271, 1761, 119, 1153, 1108, 2301, 1104, 1103, 12798, 1786, 1121, 1876, 1106, 1816, 119, 13220, 1424, 1108, 1923, 5122, 1104, 1103, 2864, 1104, 1103, 4317, 1673, 12725, 1403, 1107, 1984, 1105, 1108, 9554, 1106, 5122, 1752, 3699, 1104, 1103, 2864, 1104, 1103, 4317, 1673, 12725, 1403, 1421, 1201, 1224, 119, 4503, 1297, 1212, 1407, 1428, 2889, 117, 13220, 1424, 1108, 1255, 1107, 138, 1348, 9402, 3355, 1107, 138, 1348, 9402, 132, 1131, 4857, 4441, 1115, 1131, 1108, 1255, 1107, 151, 17945, 11604, 23294, 1181, 2665, 119, 1153, 1108, 1103, 1503, 1104, 1421, 1482, 1104, 1103, 14874, 7589, 1105, 11475, 2618, 139, 17945, 12272, 22111, 1105, 5673, 1162, 139, 16835, 3276, 118, 22111, 119, 13220, 1424, 1108, 2120, 1107, 1103, 1266, 1313, 117, 14782, 1424, 2087, 17335, 1120, 151, 17945, 11604, 23294, 1181, 2665, 117, 1187, 1123, 1401, 1108, 16408, 12223, 10359, 119, 1153, 1589, 1120, 1123, 1401, 112, 188, 2854, 7081, 1266, 1112, 1218, 1112, 13232, 1147, 2982, 1105, 8361, 1111, 1123, 3247, 9302, 1170, 1123, 1534, 2204, 5178, 119, 13220, 1424, 1245, 170, 1420, 1104, 1103, 2701, 15485, 1165, 1131, 1108, 1489, 1201, 1385, 1105, 1108, 1682, 1106, 2669, 1112, 1126, 21812, 1352, 1842, 3327, 3677, 1120, 1126, 4339, 1644, 3016, 1107, 2459, 119, 1153, 1145, 2323, 138, 1348, 9402, 3518, 1323, 119, 17062, 13220, 1424, 1245, 170, 1420, 1104, 1103, 3599, 1771, 12798, 1786, 1107, 2388, 117, 1105, 1108, 1809, 1106, 4248, 1103, 1456, 23915, 11910, 1391, 5269, 1107, 1103, 12539, 21299, 117, 170, 1946, 1131, 1316, 1121, 125, 1382, 2478, 1106, 128, 1382, 2358, 119, 1153, 1108, 1141, 1104, 1743, 12798, 1786, 8673, 1106, 1129, 1809, 1106, 1103, 12539, 21299, 119, 1507, 1123, 1148, 1858, 117, 1131, 1245, 170, 1420, 1104, 1103, 14271, 1761, 1206, 2478, 1105, 2358, 117, 1105, 1104, 1103, 10628, 2970, 1104, 1103, 1761, 1104, 1980, 1121, 1512, 1364, 2449, 1106, 1626, 1364, 2253, 117, 18995, 1112, 170, 7359, 1105, 1112, 170, 4702, 119, 13220, 1424, 1108, 1682, 1106, 1561, 5874, 2643, 1104, 2901, 112, 188, 11662, 2341, 117, 1103, 6679, 118, 6051, 2341, 1112, 1218, 1112, 1103, 13429, 2341, 1496, 1106, 1123, 2199, 1107, 1343, 3872, 119, 1153, 1108, 5874, 2643, 1104, 12798, 1786, 112, 188, 6774, 1372, 1206, 2429, 1105, 2402, 119, 13220, 1424, 4603, 1121, 1103, 12539, 21299, 1107, 2358, 1272, 1104, 5178, 2332, 119, 1153, 1427, 1106, 9773, 1107, 2294, 117, 1133, 1608, 1106, 139, 2858, 9862, 1361, 1170, 1300, 1808, 119, 13220, 1424, 1108, 1231, 118, 1809, 1106, 1103, 12539, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Bell's Sports Centre, formerly known as the Gannochy Trust Sports Complex, is located in Perth, Scotland. Built in 1968, it stands at the western edge of the city's North Inch park, adjacent to Balhousie Castle. At the time of its opening, its domed roof, over in diameter, was the largest laminated timber dome in the United Kingdom. It was surpassed by London's Millennium Dome in 1999. Owned by the Gannochy Trust, it is operated by Live Active Leisure on behalf of Perth and Kinross Council. History In the early 1960s, then lord provost of Perth, W. G. Farquharson discussed plans for a sports facility in the city. In 1964, it was announced that the Gannochy Trust, founded in 1937 by Arthur Kinmond Bell and of which Farquharson was chairman, would fund the estimated £150,000 cost of the building's construction. The venue was to be named after Bell, due to his love of sport and of his concern for the health of Perth's citizens. Construction of the facility began on 16 September 1966, and its foundation stone was laid by Farquharson on 20 March 1967. David K. Thomson, who had succeeded Farquharson as lord provost, presided over the ceremony. The planned opening was originally in March 1968, but a fire broke out in the building, severely damaging the dome. Most of the 36 arches had to be replaced. After the extensive repairs, Bell's Sports Centre opened on 15 October 1968, six months behind schedule. The Gannochy Sports Pavilion was built on the dome's southeastern side between 1975 and 1979, designed by Esmé Gordon. The two buildings were linked and modernised between 1989 and 1991, with squash courts added. Bell's Sports Centre was one of the venues used during the 2011–12 UEFA Futsal Cup. Design 36 arches, each long, support the domed roof, which is tall. The facility has of floor space. Facilities Its floor space accommodates courts for tennis, badminton, volleyball, netball and basketball. It also has running track that equates to one mile per eleven laps, a 60-metre sprint track, long-, high- and triple-jumps, pole vault, hammer, discus and javelin. It also has facilities for indoor football, hockey, practice cricket wickets and golf. Former British number-one tennis player Elena Baltacha formerly practiced at Bell's Sports Centre with her father Sergei Baltacha in the early 1990s, when her father played for St Johnstone, the city's professional football club. In 2021, Live Active Leisure announced plans to invest £750,000 to build a new fitness gym and exercise studio at the centre. The plans were of concern to the city's various sport clubs who would be losing the use of the centre's coaching hall. Swimming is not available at the centre; there is instead Perth Leisure Pool, located around to the southeast. Adjacent to the pool is the Dewar's Centre, which offers ice skating and curling. Perthshire RFC use the pavilion's changing rooms, although their home field is officially the North Inch. There is also a restaurant on site. Dome detail References Works cited Duncan 2012 External links Sports venues in Perth, Scotland Sport in Scotland 1968 establishments in Scotland
[ 101, 4720, 112, 188, 3692, 2961, 117, 3147, 1227, 1112, 1103, 144, 11657, 9962, 1183, 4623, 3692, 9974, 117, 1110, 1388, 1107, 8986, 117, 3030, 119, 10521, 1107, 2477, 117, 1122, 4061, 1120, 1103, 2466, 2652, 1104, 1103, 1331, 112, 188, 1456, 3561, 1324, 2493, 117, 4903, 1106, 18757, 1233, 14640, 9819, 3856, 119, 1335, 1103, 1159, 1104, 1157, 2280, 117, 1157, 10945, 1181, 3664, 117, 1166, 1107, 6211, 117, 1108, 1103, 2026, 2495, 23713, 7148, 10945, 1107, 1103, 1244, 2325, 119, 1135, 1108, 16509, 1118, 1498, 112, 188, 14898, 17917, 1107, 1729, 119, 13432, 1174, 1118, 1103, 144, 11657, 9962, 1183, 4623, 117, 1122, 1110, 2622, 1118, 3374, 17244, 26090, 1113, 6261, 1104, 8986, 1105, 14477, 1179, 21721, 1761, 119, 2892, 1130, 1103, 1346, 3266, 117, 1173, 7692, 5250, 22287, 1204, 1104, 8986, 117, 160, 119, 144, 119, 8040, 4426, 23698, 7666, 1320, 6352, 2714, 1111, 170, 2865, 3695, 1107, 1103, 1331, 119, 1130, 2668, 117, 1122, 1108, 1717, 1115, 1103, 144, 11657, 9962, 1183, 4623, 117, 1771, 1107, 3493, 1118, 3456, 14477, 1179, 10151, 4720, 1105, 1104, 1134, 8040, 4426, 23698, 7666, 1320, 1108, 3931, 117, 1156, 5841, 1103, 3555, 15142, 11049, 117, 1288, 2616, 1104, 1103, 1459, 112, 188, 2058, 119, 1109, 6590, 1108, 1106, 1129, 1417, 1170, 4720, 117, 1496, 1106, 1117, 1567, 1104, 4799, 1105, 1104, 1117, 4517, 1111, 1103, 2332, 1104, 8986, 112, 188, 4037, 119, 6568, 1104, 1103, 3695, 1310, 1113, 1479, 1347, 2678, 117, 1105, 1157, 4686, 2576, 1108, 3390, 1118, 8040, 4426, 23698, 7666, 1320, 1113, 1406, 1345, 2573, 119, 1681, 148, 119, 11141, 117, 1150, 1125, 3760, 8040, 4426, 23698, 7666, 1320, 1112, 7692, 5250, 22287, 1204, 117, 16448, 1166, 1103, 4502, 119, 1109, 2919, 2280, 1108, 2034, 1107, 1345, 2477, 117, 1133, 170, 1783, 2795, 1149, 1107, 1103, 1459, 117, 8669, 15812, 1103, 10945, 119, 2082, 1104, 1103, 3164, 14738, 1125, 1106, 1129, 2125, 119, 1258, 1103, 4154, 10528, 117, 4720, 112, 188, 3692, 2961, 1533, 1113, 1405, 1357, 2477, 117, 1565, 1808, 1481, 6030, 119, 1109, 144, 11657, 9962, 1183, 3692, 16790, 1108, 1434, 1113, 1103, 10945, 112, 188, 9785, 1334, 1206, 2429, 1105, 2333, 117, 2011, 1118, 142, 6602, 2744, 4345, 119, 1109, 1160, 2275, 1127, 5128, 1105, 2030, 3673, 1206, 2056, 1105, 1984, 117, 1114, 25714, 5333, 1896, 119, 4720, 112, 188, 3692, 2961, 1108, 1141, 1104, 1103, 9165, 1215, 1219, 1103, 1349, 782, 1367, 6068, 14763, 2145, 1348, 1635, 119, 4800, 3164, 14738, 117, 1296, 1263, 117, 1619, 1103, 10945, 1181, 3664, 117, 1134, 1110, 3543, 119, 1109, 3695, 1144, 1104, 1837, 2000, 119, 143, 7409, 27968, 2098, 1837, 2000, 8378, 1116, 5333, 1111, 5538, 117, 22438, 117, 9576, 117, 5795, 5892, 1105, 3163, 119, 1135, 1145, 1144, 1919, 1854, 1115, 174, 13284, 3052, 1106, 1141, 2837, 1679, 5450, 11033, 117, 170, 2539, 118, 7545, 12766, 1854, 117, 1263, 118, 117, 1344, 118, 1105, 9225, 118, 15457, 117, 7712, 13454, 117, 12582, 117, 6187, 1361, 1105, 179, 25790, 119, 1135, 1145, 1144, 3380, 1111, 9287, 1709, 117, 4700, 117, 2415, 5428, 10267, 1105, 7135, 119, 6963, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Ramany vs Ramany 3.0 (ரமணி விஸ் ரமணி) is an Indian Tamil-language sitcom Comedy web series, produced as an Original for Aha Tamil, directed by Naga. Produced by Kavithalayaa Productions the series stars Vasuki Anand and Ram G in the lead role along with Poovilangu Mohan, Ponni Suresh, Param Guhanesh and Vaidyanathan Padmanabhan. It is a third season of the 1998 Tamil series Ramany vs Ramany. The series is scheduled to premiere on Aha Tamil on 4 March 2022. Cast Vasuki Anand as Mrs. Ramany Ram G as Mr. Ramany Ponni Suresh as Ramanys' daughter Ragini Param Guhanesh as Ramanys' son Ram Poovilangu Mohan Vaidyanathan Padmanabhan K. Sathyamurthy Sriram Krish Sudha Pushpa Suchitra Ravi Elakiya Narmadha Veni Production Casting Vasuki from the first season and Ram G from the second season will be paired as the Ramanys in the third season. Ponni Suresh and Param Ganesh was cast as the daughter and son respectively the comic couple. Devadarshini will not reprise her role from season 2 for the third season. References External links Aha (streaming service) original programming Tamil-language web series 2022 Tamil-language television series debuts Tamil-language comedy television series
[ 101, 15078, 3382, 5016, 15078, 3382, 124, 119, 121, 113, 100, 100, 100, 114, 1110, 1126, 1890, 5344, 118, 1846, 13664, 8909, 5127, 1326, 117, 1666, 1112, 1126, 7267, 1111, 7066, 1161, 5344, 117, 2002, 1118, 11896, 2571, 119, 13662, 1118, 14812, 5086, 17939, 12057, 1161, 7896, 1103, 1326, 2940, 159, 2225, 17041, 20556, 1105, 11447, 144, 1107, 1103, 1730, 1648, 1373, 1114, 18959, 3292, 8009, 2118, 1358, 20165, 117, 18959, 9238, 1182, 6542, 2737, 117, 23994, 1306, 144, 23698, 6354, 2737, 1105, 159, 19954, 23732, 22252, 26922, 1605, 24167, 1179, 119, 1135, 1110, 170, 1503, 1265, 1104, 1103, 1772, 5344, 1326, 15078, 3382, 5016, 15078, 3382, 119, 1109, 1326, 1110, 4533, 1106, 6965, 1113, 7066, 1161, 5344, 1113, 125, 1345, 17881, 1477, 119, 21452, 159, 2225, 17041, 20556, 1112, 2823, 119, 15078, 3382, 11447, 144, 1112, 1828, 119, 15078, 3382, 18959, 9238, 1182, 6542, 2737, 1112, 15078, 3382, 1116, 112, 1797, 16890, 10533, 1182, 23994, 1306, 144, 23698, 6354, 2737, 1112, 15078, 3382, 1116, 112, 1488, 11447, 18959, 3292, 8009, 2118, 1358, 20165, 159, 19954, 23732, 22252, 26922, 1605, 24167, 1179, 148, 119, 17784, 15644, 2312, 12549, 7889, 4471, 4515, 21478, 1324, 15463, 14016, 153, 13148, 4163, 5723, 2875, 1611, 17968, 2896, 8552, 2315, 11896, 10841, 14016, 159, 21462, 6401, 21452, 1158, 159, 2225, 17041, 1121, 1103, 1148, 1265, 1105, 11447, 144, 1121, 1103, 1248, 1265, 1209, 1129, 13185, 1112, 1103, 15078, 3382, 1116, 1107, 1103, 1503, 1265, 119, 18959, 9238, 1182, 6542, 2737, 1105, 23994, 1306, 144, 6354, 2737, 1108, 2641, 1112, 1103, 1797, 1105, 1488, 3569, 1103, 4824, 2337, 119, 18433, 7971, 1733, 8265, 1182, 1209, 1136, 1231, 16874, 1123, 1648, 1121, 1265, 123, 1111, 1103, 1503, 1265, 119, 19714, 1116, 22841, 6743, 7066, 1161, 113, 11403, 1555, 114, 1560, 4159, 5344, 118, 1846, 5127, 1326, 17881, 1477, 5344, 118, 1846, 1778, 1326, 1963, 1116, 5344, 118, 1846, 3789, 1778, 1326, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
The following is a list of teams and cyclists that will take part in the 2022 Tour de France. Teams UCI WorldTeams UCI ProTeams Cyclists By starting number By team By nationality References 2022 Tour de France 2022
[ 101, 1109, 1378, 1110, 170, 2190, 1104, 1929, 1105, 25999, 1115, 1209, 1321, 1226, 1107, 1103, 17881, 1477, 3124, 1260, 1699, 119, 11912, 15166, 1291, 1942, 4490, 4206, 15166, 5096, 1942, 4490, 4206, 27688, 1665, 18286, 1650, 2547, 1295, 1650, 1264, 1650, 11242, 19714, 1116, 17881, 1477, 3124, 1260, 1699, 17881, 1477, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
The following is a list of awards and nominations received by actress Sutton Foster. Foster is an actress known for her extensive work on the Broadway stage. She has received six Tony Award nominations receiving two wins for her performance in Thoroughly Modern Millie in 2003 and Anything Goes in 2011. She is currently starring opposite Hugh Jackman in the Broadway revival of The Music Man. She has also earned a Grammy Award nomination for Best Musical Theater Album for Anything Goes Theater Sources:PlaybillVault Internet Broadway Database BroadwayWorld Note: The year given is the year of the ceremony Grammy Awards Tony Awards Drama Desk Awards Drama League Awards Outer Critics Circle Awards Miscellaneous awards Television awards Critics' Choice Awards Miscellaneous awards References Foster, Sutton
[ 101, 1109, 1378, 1110, 170, 2190, 1104, 3745, 1105, 10394, 1460, 1118, 3647, 11163, 7895, 119, 7895, 1110, 1126, 3647, 1227, 1111, 1123, 4154, 1250, 1113, 1103, 5259, 2016, 119, 1153, 1144, 1460, 1565, 3270, 1698, 10394, 4172, 1160, 4646, 1111, 1123, 2099, 1107, 16261, 18626, 1193, 4825, 21317, 1107, 1581, 1105, 11087, 15150, 1107, 1349, 119, 1153, 1110, 1971, 3937, 3714, 6016, 2132, 1399, 1107, 1103, 5259, 9408, 1104, 1109, 1953, 2268, 119, 1153, 1144, 1145, 2829, 170, 8645, 1698, 6294, 1111, 1798, 8660, 5978, 6429, 1111, 11087, 15150, 5978, 22656, 131, 6060, 26839, 2559, 14045, 4639, 5259, 22929, 5259, 2924, 1766, 5253, 5322, 131, 1109, 1214, 1549, 1110, 1103, 1214, 1104, 1103, 4502, 8645, 2763, 3270, 2763, 8020, 14177, 1377, 2763, 8020, 1453, 2763, 18539, 10320, 7933, 2763, 12107, 1116, 22494, 13064, 3745, 4552, 3745, 10320, 112, 10373, 2763, 12107, 1116, 22494, 13064, 3745, 19714, 1116, 7895, 117, 11163, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Batillipes lusitanus is a species of tardigrade in the genus Batillipes. Description B. lusitanus has middle toes on each four feet which are all equal in length. It exhibits a dorsal cuticular ornamentation which is constituted by large pillars, which makes the cuticle itself appear similar to that of B. adriaticus has. References Tardigrades Batillipes
[ 101, 21928, 7956, 9717, 1279, 181, 1361, 5168, 9299, 1110, 170, 1530, 1104, 27629, 16936, 24633, 1107, 1103, 2804, 21928, 7956, 9717, 1279, 119, 14177, 27530, 139, 119, 181, 1361, 5168, 9299, 1144, 2243, 10497, 1113, 1296, 1300, 1623, 1134, 1132, 1155, 4463, 1107, 2251, 119, 1135, 10877, 170, 13243, 2195, 20899, 1137, 16124, 24832, 1134, 1110, 12810, 1118, 1415, 15592, 117, 1134, 2228, 1103, 2195, 26726, 2111, 2845, 1861, 1106, 1115, 1104, 139, 119, 8050, 3464, 23312, 1144, 119, 19714, 1116, 22515, 16936, 24633, 1116, 21928, 7956, 9717, 1279, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Penny M. Heaton is an American physician who is the Global Therapeutics Lead for Vaccines at Johnson & Johnson. She previously worked at Novavax, Novartis and the Bill & Melinda Gates Foundation. She was included by Stat News on their definitive list of leaders in the life sciences in 2022. Early life and education Heaton has said that she was inspired to work on vaccine development after hearing her father suffered from tuberculosis before she was born. She has credited her high school science teachers with teaching her the importance of blind controlled trials. She was an undergraduate and medical student at the University of Louisville School of Medicine. She remained there as a medical resident in pediatrics. She worked as a services officer for Epidemic Intelligence at the Centers for Disease Control and Prevention, studying food-borne viruses in infants born to HIV positive mothers. She went on to work in Kenya, where she investigated the roll-out of vaccines in impoverished populations in Kisumu. Career On returning to the United States, Heaton joined Merck & Co. Under her leadership the foundation developed the vaccine for rotavirus and delivered the Rotavirus Safety and Efficacy Trials. The vaccine was recommended by the World Health Organization for all infants around the world, and was predicted to save almost two million lives over the course of ten years. Heaton was made Global Head of Vaccine Research Clusters at Novartis where she worked on maternal immunization, with a particular focus on Group B streptococcal infection. She worked on vaccines against Meningococcal meningitis, including Bexsero and Men. After 3 years at Novartis, Heaton joined the Bill & Melinda Gates Foundation as Director of Vaccine Development and focssed on developing vaccines for diseases that impact the world's most vulnerable communities. Heaton was made chief executive officer of the Bill & Melinda Gates Foundation Medical Research Institute in 2017. She was recruited as global lead for vaccines at Johnson & Johnson in 2021. Awards and honors 2018 University of Louisville School of Medicine Alumni of the Year 2020 National Foundation for Infectious Diseases Jimmy and Rosalynn Carter Award Recipient 2020 Pediatric Infectious Diseases Society Distinguished Research Award 2022 Stat News Status List Selected publications References American women physicians American physicians Living people Year of birth missing (living people) Johnson & Johnson people University of Louisville School of Medicine alumni
[ 101, 13651, 150, 119, 9653, 1320, 1110, 1126, 1237, 7454, 1150, 1110, 1103, 5357, 1109, 14543, 14272, 7376, 10440, 1111, 159, 7409, 15459, 1116, 1120, 2921, 111, 2921, 119, 1153, 2331, 1589, 1120, 6584, 2497, 1775, 117, 6584, 3740, 1548, 1105, 1103, 2617, 111, 27042, 12702, 2974, 119, 1153, 1108, 1529, 1118, 1457, 2980, 3128, 1113, 1147, 18379, 2190, 1104, 3478, 1107, 1103, 1297, 8614, 1107, 17881, 1477, 119, 4503, 1297, 1105, 1972, 9653, 1320, 1144, 1163, 1115, 1131, 1108, 3768, 1106, 1250, 1113, 20034, 1718, 1170, 4510, 1123, 1401, 3421, 1121, 18436, 1196, 1131, 1108, 1255, 119, 1153, 1144, 5175, 1123, 1344, 1278, 2598, 4952, 1114, 3679, 1123, 1103, 4495, 1104, 7198, 4013, 7356, 119, 1153, 1108, 1126, 8448, 1105, 2657, 2377, 1120, 1103, 1239, 1104, 11595, 1323, 1104, 5734, 119, 1153, 1915, 1175, 1112, 170, 2657, 6408, 1107, 185, 24795, 1116, 119, 1153, 1589, 1112, 170, 1826, 2575, 1111, 142, 25786, 5521, 1596, 7829, 1120, 1103, 22347, 1111, 20012, 6342, 1105, 18461, 117, 5076, 2094, 118, 16908, 20942, 1107, 20186, 1255, 1106, 9622, 3112, 12694, 119, 1153, 1355, 1113, 1106, 1250, 1107, 7469, 117, 1187, 1131, 10788, 1103, 5155, 118, 1149, 1104, 20034, 1116, 1107, 24034, 5909, 9980, 6623, 1107, 14477, 6385, 13601, 119, 17062, 1212, 3610, 1106, 1103, 1244, 1311, 117, 9653, 1320, 1688, 2508, 19878, 1377, 111, 3291, 119, 2831, 1123, 3645, 1103, 4686, 1872, 1103, 20034, 1111, 24692, 21704, 6208, 1105, 4653, 1103, 155, 16339, 27608, 9218, 1105, 142, 3101, 4578, 3457, 21373, 119, 1109, 20034, 1108, 6315, 1118, 1103, 1291, 3225, 6534, 1111, 1155, 20186, 1213, 1103, 1362, 117, 1105, 1108, 10035, 1106, 3277, 1593, 1160, 1550, 2491, 1166, 1103, 1736, 1104, 1995, 1201, 119, 9653, 1320, 1108, 1189, 5357, 3763, 1104, 159, 7409, 15459, 2713, 140, 23225, 1116, 1120, 6584, 3740, 1548, 1187, 1131, 1589, 1113, 11476, 13280, 13601, 2605, 8569, 117, 1114, 170, 2440, 2817, 1113, 1990, 139, 188, 7877, 6451, 13335, 13335, 7867, 8974, 119, 1153, 1589, 1113, 20034, 1116, 1222, 3401, 1158, 13335, 13335, 7867, 1441, 1158, 10721, 117, 1259, 4108, 1775, 6906, 1186, 1105, 3401, 119, 1258, 124, 1201, 1120, 6584, 3740, 1548, 117, 9653, 1320, 1688, 1103, 2617, 111, 27042, 12702, 2974, 1112, 2524, 1104, 159, 7409, 15459, 3273, 1105, 175, 13335, 17856, 1113, 4297, 20034, 1116, 1111, 8131, 1115, 3772, 1103, 1362, 112, 188, 1211, 8018, 3611, 119, 9653, 1320, 1108, 1189, 2705, 3275, 2575, 1104, 1103, 2617, 111, 27042, 12702, 2974, 3875, 2713, 2024, 1107, 1504, 119, 1153, 1108, 8443, 1112, 4265, 1730, 1111, 20034, 1116, 1120, 2921, 111, 2921, 1107, 17881, 1475, 119, 2763, 1105, 8357, 1857, 1239, 1104, 11595, 1323, 1104, 5734, 17934, 1104, 1103, 2381, 12795, 1305, 2974, 1111, 1130, 11916, 4179, 20012, 1116, 4479, 1105, 9449, 26750, 5007, 1698, 11336, 6617, 15418, 2227, 12795, 153, 24795, 1130, 11916, 4179, 20012, 1116, 2015, 8972, 2713, 1698, 17881, 1477, 1457, 2980, 3128, 22130, 5619, 17018, 5873, 19714, 1116, 1237, 1535, 15230, 1237, 15230, 7932, 1234, 2381, 1104, 3485, 3764, 113, 1690, 1234, 114, 2921, 111, 2921, 1234, 1239, 1104, 11595, 1323, 1104, 5734, 12762, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Leslie Stephanie Ramírez Pérez (born 11 January 1996) is a footballer who plays as a forward for Liga MX Femenil club CD Guadalajara. Born and raised in the United States to a Mexican father and a Guatemalan mother, she has triple nationality and represents the Guatemala women's national team. Early life Ramírez was born in Los Angeles, California, United States and raised in Reseda, California. Her father was born in San Miguel Allende, Guanajuato, Mexico and her late mother in Guatemala City, Guatemala. She has attended the El Camino Real High School. College career Ramírez has attended the California State University, Northridge, the Los Angeles Pierce College and the California State University, Los Angeles in the United States. Club career Ramírez has played for Invictus Club Feminae in the United States and for ŽFK Mašinac Trace in Serbia. On 26 February 2022, Ramírez was officially announced as a new player of Mexican nationalist club Guadalajara. Her signing was questioned by some media since she is cap-tied to Guatemala and therefore no longer eligible to reprensent Mexico, an apparent premise to be able to play for Guadalajara (it was a policy during the administration of the late Jorge Vergara). However, her hiring was defended by current club board which has claimed that, according to the current statutes, there is no restrictions concerning foreign national teams, with the only condition being that "only Mexicans by birth can play", including foreign-born people with a Mexican parent, which it's her case, so she is not going to be asked by them to retire from her international career with Guatemala. International career Ramírez made her senior debut for Guatemala on 16 February 2022, starting in a 9–0 home win over the United States Virgin Islands during the 2022 CONCACAF W Championship qualification. References External links 1999 births Living people People with acquired Guatemalan citizenship Guatemalan women's footballers Women's association football forwards ŽFK Mašinac PZP Niš players Guatemala women's international footballers Guatemalan expatriate footballers Guatemalan expatriates in Serbia Expatriate women's footballers in Serbia Guatemalan people of Mexican descent Citizens of Mexico through descent Mexican women's footballers C.D. Guadalajara (women) footballers Mexican expatriate women's footballers Mexican expatriate sportspeople in Serbia Mexican people of Guatemalan descent Soccer players from Los Angeles People from Reseda, Los Angeles American women's soccer players Cal State Northridge Matadors women's soccer players Los Angeles Pierce College alumni College women's soccer players in the United States Cal State Los Angeles Golden Eagles athletes American expatriate women's soccer players American expatriate sportspeople in Serbia American sportspeople of Mexican descent American people of Guatemalan descent American sportspeople of Latin American descent American sportspeople of North American descent
[ 101, 8521, 11952, 27953, 15489, 113, 1255, 1429, 1356, 1820, 114, 1110, 170, 3585, 1150, 2399, 1112, 170, 1977, 1111, 7837, 150, 3190, 11907, 2354, 2723, 1526, 2891, 25480, 119, 3526, 1105, 2120, 1107, 1103, 1244, 1311, 1106, 170, 4112, 1401, 1105, 170, 11835, 1179, 1534, 117, 1131, 1144, 9225, 11242, 1105, 5149, 1103, 11835, 1535, 112, 188, 1569, 1264, 119, 4503, 1297, 27953, 1108, 1255, 1107, 2238, 2460, 117, 1756, 117, 1244, 1311, 1105, 2120, 1107, 11336, 5591, 1161, 117, 1756, 119, 1430, 1401, 1108, 1255, 1107, 1727, 7975, 4522, 2007, 117, 144, 8734, 12487, 6718, 2430, 117, 2470, 1105, 1123, 1523, 1534, 1107, 11835, 1392, 117, 11835, 119, 1153, 1144, 2323, 1103, 2896, 14805, 4559, 5230, 1693, 1323, 119, 1531, 1578, 27953, 1144, 2323, 1103, 1756, 1426, 1239, 117, 1456, 8044, 117, 1103, 2238, 2460, 9636, 1531, 1105, 1103, 1756, 1426, 1239, 117, 2238, 2460, 1107, 1103, 1244, 1311, 119, 1998, 1578, 27953, 1144, 1307, 1111, 1130, 15901, 4814, 1998, 11907, 14503, 1162, 1107, 1103, 1244, 1311, 1105, 1111, 338, 2271, 2428, 7085, 10222, 2983, 1665, 22681, 1107, 6689, 119, 1212, 1744, 1428, 17881, 1477, 117, 27953, 1108, 3184, 1717, 1112, 170, 1207, 1591, 1104, 4112, 11619, 1526, 25480, 119, 1430, 6086, 1108, 8449, 1118, 1199, 2394, 1290, 1131, 1110, 6707, 118, 4353, 1106, 11835, 1105, 3335, 1185, 2039, 7408, 1106, 1231, 1643, 5123, 27408, 2470, 117, 1126, 6281, 20197, 1106, 1129, 1682, 1106, 1505, 1111, 25480, 113, 1122, 1108, 170, 2818, 1219, 1103, 3469, 1104, 1103, 1523, 10780, 159, 1200, 17582, 114, 119, 1438, 117, 1123, 15768, 1108, 7607, 1118, 1954, 1526, 2313, 1134, 1144, 2694, 1115, 117, 2452, 1106, 1103, 1954, 24026, 117, 1175, 1110, 1185, 9118, 6995, 2880, 1569, 1929, 117, 1114, 1103, 1178, 3879, 1217, 1115, 107, 1178, 4112, 1116, 1118, 3485, 1169, 1505, 107, 117, 1259, 2880, 118, 1255, 1234, 1114, 170, 4112, 6486, 117, 1134, 1122, 112, 188, 1123, 1692, 117, 1177, 1131, 1110, 1136, 1280, 1106, 1129, 1455, 1118, 1172, 1106, 11067, 1121, 1123, 1835, 1578, 1114, 11835, 119, 1570, 1578, 27953, 1189, 1123, 2682, 1963, 1111, 11835, 1113, 1479, 1428, 17881, 1477, 117, 2547, 1107, 170, 130, 782, 121, 1313, 1782, 1166, 1103, 1244, 1311, 6567, 3503, 1219, 1103, 17881, 1477, 24710, 160, 1935, 8969, 119, 19714, 1116, 22841, 6743, 1729, 20665, 7932, 1234, 2563, 1114, 2888, 11835, 1179, 9709, 11835, 1179, 1535, 112, 188, 3585, 1116, 2453, 112, 188, 3852, 1709, 22453, 338, 2271, 2428, 7085, 10222, 2983, 1665, 153, 5301, 2101, 27453, 10222, 2139, 11835, 1535, 112, 188, 1835, 3585, 1116, 11835, 1179, 4252, 4163, 19091, 2193, 3585, 1116, 11835, 1179, 4252, 4163, 19091, 5430, 1107, 6689, 16409, 4163, 19091, 2193, 1535, 112, 188, 3585, 1116, 1107, 6689, 11835, 1179, 1234, 1104, 4112, 6585, 14649, 1104, 2470, 1194, 6585, 4112, 1535, 112, 188, 3585, 1116, 140, 119, 141, 119, 25480, 113, 1535, 114, 3585, 1116, 4112, 4252, 4163, 19091, 2193, 1535, 112, 188, 3585, 1116, 4112, 4252, 4163, 19091, 2193, 2865, 21159, 1107, 6689, 4112, 1234, 1104, 11835, 1179, 6585, 6863, 2139, 1121, 2238, 2460, 2563, 1121, 11336, 5591, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
The Walls Are Way Too Thin is the second extended play (EP) by British singer-songwriter Holly Humberstone. It was released on 5 November 2021, by Interscope Records. Release On 5 August 2021, Holly Humberstone announced the release of her second EP The Walls Are Way Too Thin alongside co-writer Matty Healy (The 1975). Critical reception The Walls Are Way Too Thin was met with "universal acclaim" reviews from critics. At Metacritic, which assigns a weighted average rating out of 100 to reviews from mainstream publications, this release received an average score of 86 based on 4 reviews. In a review for Gigwise, writer Harrison Smith wrote: "Humberstone dives headfirst into first-person narratives, romantic woes and poignant self-discovery on this latest offering. The charming lyrical honesty, infectious groove and playful energy throughout make The Walls Are Way Too Thin a coltish example of Humberstone's dynamic talent and spirit. At Under the Radar, Andy Von Pip said: "The Walls Are Way Too Thin EP provides proof positive that Humberstone is perhaps the brightest Gen Z singer/songwriter to emerge from the U.K. in quite some time. The EP deals with a sense of displacement, of messy relationships, of things falling apart, both physically and emotionally, and attempting to move on whilst trying to find your place in the world." Track listing Charts References External links 2021 EPs Interscope Records albums
[ 101, 1109, 22211, 2372, 4714, 6466, 27626, 1110, 1103, 1248, 2925, 1505, 113, 4493, 114, 1118, 1418, 2483, 118, 5523, 9030, 20164, 10615, 6078, 119, 1135, 1108, 1308, 1113, 126, 1379, 17881, 1475, 117, 1118, 11300, 15300, 2151, 119, 17443, 1212, 126, 1360, 17881, 1475, 117, 9030, 20164, 10615, 6078, 1717, 1103, 1836, 1104, 1123, 1248, 4493, 1109, 22211, 2372, 4714, 6466, 27626, 3338, 1884, 118, 2432, 3895, 1183, 1124, 17449, 113, 1109, 2429, 114, 119, 15247, 7602, 1109, 22211, 2372, 4714, 6466, 27626, 1108, 1899, 1114, 107, 8462, 10989, 107, 3761, 1121, 4217, 119, 1335, 15168, 117, 1134, 27043, 170, 20167, 1903, 5261, 1149, 1104, 1620, 1106, 3761, 1121, 7965, 5873, 117, 1142, 1836, 1460, 1126, 1903, 2794, 1104, 5942, 1359, 1113, 125, 3761, 119, 1130, 170, 3189, 1111, 144, 6512, 15868, 117, 2432, 6067, 2159, 1724, 131, 107, 20164, 10615, 6078, 12706, 1116, 1246, 8702, 9731, 1154, 1148, 118, 1825, 26712, 117, 6376, 192, 19270, 1105, 185, 8136, 15454, 2191, 118, 6004, 1113, 1142, 6270, 4733, 119, 1109, 14186, 18799, 19242, 117, 20342, 22482, 1105, 20303, 2308, 2032, 1294, 1109, 22211, 2372, 4714, 6466, 27626, 170, 23506, 2944, 1859, 1104, 20164, 10615, 6078, 112, 188, 9652, 5939, 1105, 4840, 119, 1335, 2831, 1103, 21858, 117, 4827, 13610, 21902, 1643, 1163, 131, 107, 1109, 22211, 2372, 4714, 6466, 27626, 4493, 2790, 6777, 3112, 1115, 20164, 10615, 6078, 1110, 3229, 1103, 3999, 2556, 9198, 163, 2483, 120, 5523, 1106, 12982, 1121, 1103, 158, 119, 148, 119, 1107, 2385, 1199, 1159, 119, 1109, 4493, 8927, 1114, 170, 2305, 1104, 15167, 117, 1104, 20549, 6085, 117, 1104, 1614, 4058, 3966, 117, 1241, 8027, 1105, 15962, 117, 1105, 6713, 1106, 1815, 1113, 5994, 1774, 1106, 1525, 1240, 1282, 1107, 1103, 1362, 119, 107, 6563, 10530, 25085, 19714, 1116, 22841, 6743, 17881, 1475, 4493, 1116, 11300, 15300, 2151, 3770, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Robert Jordan (1826 - December 21, 1881) was an American sailor and recipient of the Medal of Honor who received the award for his actions in the American Civil War. Biography Jordan was born in New York, New York in 1826. He served in the Union Navy as coxswain aboard the USS Mount Washington during the American Civil War. He earned his medal in action aboard USS Mount Washington on the Nansemond River, Virginia on April 14, 1863. He received his medal on July 10, 1863. He died in Philadelphia, Pennsylvania on December 21, 1881, and is now buried in Mount Moriah Cemetery, Philadelphia, Pennsylvania where his name is spelled as "Jourdan". Medal of Honor Citation For extraordinary heroism in action while attached to the USS Minnesota and temporarily serving on the USS Mount Washington, during action against the enemy in the Nansemond River, Virginia, 14 April 1863. When the Mount Washington drifted against the bank following several successive hits which struck her boilers and stopped her engines, Coxswain Jordan boarded the stricken vessel and, for six hours as fierce artillery and musketry continued to rake her decks, calmly assisted in manning a 12-pound howitzer which had been mounted on the open hurricane deck. External links Photograph of Jordan's gravestone References American Civil War recipients of the Medal of Honor United States Navy Medal of Honor recipients 1826 births 1881 deaths
[ 101, 1823, 4421, 113, 12000, 118, 1382, 1626, 117, 6411, 114, 1108, 1126, 1237, 16389, 1105, 7668, 1104, 1103, 3803, 1104, 7337, 1150, 1460, 1103, 2574, 1111, 1117, 3721, 1107, 1103, 1237, 3145, 1414, 119, 20599, 4421, 1108, 1255, 1107, 1203, 1365, 117, 1203, 1365, 1107, 12000, 119, 1124, 1462, 1107, 1103, 1913, 2506, 1112, 1884, 1775, 1116, 13644, 7161, 1103, 6684, 3572, 1994, 1219, 1103, 1237, 3145, 1414, 119, 1124, 2829, 1117, 3086, 1107, 2168, 7161, 6684, 3572, 1994, 1113, 1103, 20689, 2217, 10151, 1595, 117, 2550, 1113, 1364, 1489, 117, 6293, 119, 1124, 1460, 1117, 3086, 1113, 1351, 1275, 117, 6293, 119, 1124, 1452, 1107, 3562, 117, 2680, 1113, 1382, 1626, 117, 6411, 117, 1105, 1110, 1208, 3126, 1107, 3572, 12556, 3464, 1324, 5501, 117, 3562, 117, 2680, 1187, 1117, 1271, 1110, 11517, 1112, 107, 8125, 2149, 6778, 107, 119, 3803, 1104, 7337, 17028, 1370, 10264, 6485, 1863, 1107, 2168, 1229, 4309, 1106, 1103, 6684, 4332, 1105, 7818, 2688, 1113, 1103, 6684, 3572, 1994, 117, 1219, 2168, 1222, 1103, 3437, 1107, 1103, 20689, 2217, 10151, 1595, 117, 2550, 117, 1489, 1364, 6293, 119, 1332, 1103, 3572, 1994, 9876, 1222, 1103, 3085, 1378, 1317, 11598, 4919, 1134, 4168, 1123, 22800, 1105, 2141, 1123, 4540, 117, 9604, 1116, 13644, 4421, 18666, 1103, 18178, 5832, 1105, 117, 1111, 1565, 2005, 1112, 9250, 6201, 1105, 182, 24493, 2105, 1616, 1598, 1106, 187, 9899, 1123, 22444, 117, 13285, 6842, 1107, 1299, 3381, 170, 1367, 118, 10074, 1293, 23257, 1134, 1125, 1151, 5378, 1113, 1103, 1501, 10610, 5579, 119, 22841, 6743, 21906, 15241, 1104, 4421, 112, 188, 14489, 4793, 19714, 1116, 1237, 3145, 1414, 18509, 1104, 1103, 3803, 1104, 7337, 1244, 1311, 2506, 3803, 1104, 7337, 18509, 12000, 20665, 6411, 6209, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Christos Pagonis (; Lykoudi, 1901 – May 1997) was a Greek Resistance member, teacher and leftist politician. He was elected member of parliament for Larisa with EDA in 1958. Biography He was born in Lykoudi, Elassona and was descended from a farming family. He got involved in syndicalism as member of the Teachers' Federation and resistance activity and politically with EDA and KKE. He was repeatedly arrested and tortured after 1945 and then imprisoned, as well as during the junta of 1967–1974. He was elected member of parliament in the 1958 elections with EDA. He died aged 96 in 1997 and was buried in Elassona on 11 May 1997. References Greek Resistance members MPs of Larissa Greek MPs 1958–1961 1901 births 1997 deaths People from Elassona Greek torture victims Resistance to the Greek junta
[ 101, 4028, 2155, 19585, 7528, 1548, 113, 132, 149, 17252, 13431, 1182, 117, 5064, 782, 1318, 1816, 114, 1108, 170, 2414, 15598, 1420, 117, 3218, 1105, 1286, 1776, 2931, 119, 1124, 1108, 1809, 1420, 1104, 6254, 1111, 2001, 4889, 1161, 1114, 142, 11392, 1107, 2996, 119, 20599, 1124, 1108, 1255, 1107, 149, 17252, 13431, 1182, 117, 2896, 11192, 7637, 1105, 1108, 9026, 1121, 170, 7718, 1266, 119, 1124, 1400, 2017, 1107, 188, 5730, 13328, 14200, 1306, 1112, 1420, 1104, 1103, 14290, 112, 4245, 1105, 4789, 3246, 1105, 10966, 1114, 142, 11392, 1105, 148, 22441, 119, 1124, 1108, 8038, 3950, 1105, 12730, 1170, 2481, 1105, 1173, 8269, 117, 1112, 1218, 1112, 1219, 1103, 179, 19529, 1104, 2573, 782, 2424, 119, 1124, 1108, 1809, 1420, 1104, 6254, 1107, 1103, 2996, 3212, 1114, 142, 11392, 119, 1124, 1452, 4079, 5306, 1107, 1816, 1105, 1108, 3126, 1107, 2896, 11192, 7637, 1113, 1429, 1318, 1816, 119, 19714, 1116, 2414, 15598, 1484, 13904, 1104, 2001, 26509, 2414, 13904, 2996, 782, 2920, 5064, 20665, 1816, 6209, 2563, 1121, 2896, 11192, 7637, 2414, 8831, 5256, 15598, 1106, 1103, 2414, 179, 19529, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Spiranthes perexilis, the languid ladies’-tresses is a species of orchid native to California and Oregon. Description Spiranthes perexilis plants are closely related to Spiranthes romanzoffiana and similar in appearance, but "gracile and open-spiralled, with narrow subpandurate labella". Spiranthes porrifolia plants also look similar. Distribution and habitat Spiranthes perexilis has been found in California and Oregon. Spiranthes perexilis grows in fens and wet meadows, often along the edge of the fen area and the slightly higher area around it. Within the Sierra Nevada and the Cascade Range it grows in similar habitat to Spiranthes porrifolia and Spiranthes romanzoffiana. Taxonomy Spiranthes perexilis plants were first described by Paul Martin Brown in 2008 as Spiranthes stellata but apparently contained a mix of species in the holotype sheet used to describe the new species. C. J. Sheviak first described the plants now accepted as Spiranthes perexilis as a subspecies called Spiranthes stellata subsp. perexilis in 2012 and M. C. Pace elevated them to species status in 2019. References perexilis Orchids of the United States Plants described in 2019
[ 101, 156, 8508, 6922, 16090, 1679, 11708, 22279, 117, 1103, 2495, 2118, 16423, 8564, 787, 118, 189, 26628, 1110, 170, 1530, 1104, 20468, 2900, 1106, 1756, 1105, 4660, 119, 14177, 27530, 156, 8508, 6922, 16090, 1679, 11708, 22279, 3546, 1132, 4099, 2272, 1106, 156, 8508, 6922, 16090, 187, 27085, 6112, 3101, 12268, 1105, 1861, 1107, 2468, 117, 1133, 107, 176, 19366, 4759, 1105, 1501, 118, 14061, 2433, 117, 1114, 4142, 4841, 10224, 7641, 5498, 3107, 1742, 107, 119, 156, 8508, 6922, 16090, 185, 1766, 2047, 26749, 3546, 1145, 1440, 1861, 119, 19806, 1105, 6296, 156, 8508, 6922, 16090, 1679, 11708, 22279, 1144, 1151, 1276, 1107, 1756, 1105, 4660, 119, 156, 8508, 6922, 16090, 1679, 11708, 22279, 7096, 1107, 175, 5026, 1105, 4375, 25958, 117, 1510, 1373, 1103, 2652, 1104, 1103, 175, 1424, 1298, 1105, 1103, 2776, 2299, 1298, 1213, 1122, 119, 5360, 1103, 7384, 7263, 1105, 1103, 27173, 7389, 1122, 7096, 1107, 1861, 6296, 1106, 156, 8508, 6922, 16090, 185, 1766, 2047, 26749, 1105, 156, 8508, 6922, 16090, 187, 27085, 6112, 3101, 12268, 119, 13429, 19608, 156, 8508, 6922, 16090, 1679, 11708, 22279, 3546, 1127, 1148, 1758, 1118, 1795, 2405, 2671, 1107, 1369, 1112, 156, 8508, 6922, 16090, 188, 7854, 16236, 1161, 1133, 4547, 4049, 170, 5495, 1104, 1530, 1107, 1103, 16358, 7841, 16726, 6837, 1215, 1106, 5594, 1103, 1207, 1530, 119, 140, 119, 147, 119, 1153, 7137, 1377, 1148, 1758, 1103, 3546, 1208, 3134, 1112, 156, 8508, 6922, 16090, 1679, 11708, 22279, 1112, 170, 11332, 1270, 156, 8508, 6922, 16090, 188, 7854, 16236, 1161, 28124, 119, 1679, 11708, 22279, 1107, 1368, 1105, 150, 119, 140, 119, 24622, 8208, 1172, 1106, 1530, 2781, 1107, 10351, 119, 19714, 1116, 1679, 11708, 22279, 2926, 4313, 3680, 1104, 1103, 1244, 1311, 25880, 1758, 1107, 10351, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Sceloporus bulleri, Buller's spiny lizard, is a species of lizard in the family Phrynosomatidae. It is endemic to Mexico. References Sceloporus Reptiles of Mexico Endemic fauna of Mexico Reptiles described in 1895 Taxa named by George Albert Boulenger
[ 101, 20452, 19773, 18876, 1361, 12200, 9866, 117, 9255, 1200, 112, 188, 6898, 1183, 20730, 117, 1110, 170, 1530, 1104, 20730, 1107, 1103, 1266, 7642, 15023, 22354, 21943, 5106, 119, 1135, 1110, 6850, 1106, 2470, 119, 19714, 1116, 20452, 19773, 18876, 1361, 20777, 23677, 1116, 1104, 2470, 5135, 5521, 1596, 18335, 1104, 2470, 20777, 23677, 1116, 1758, 1107, 5639, 13429, 1161, 1417, 1118, 1667, 3986, 9326, 8722, 11576, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
The eleventh emergency special session of the United Nations General Assembly centres on the 2022 Russian invasion of Ukraine. The session convened on 28 February 2022, and is being held at United Nations Headquarters in New York City. Background An emergency special session is an unscheduled meeting of the United Nations General Assembly to make urgent, but non-binding decisions or recommendations regarding a particular issue. Emergency special sessions are rare, having previously been convened only ten times in the history of the United Nations. The mechanism of the emergency special session was created in 1950 by the General Assembly's adoption of its "Uniting for Peace" resolution, which made the necessary changes to the Assembly's Rules of Procedure at that time. The resolution likewise declared that: ... if the Security Council, because of lack of unanimity of the permanent members, fails to exercise its primary responsibility for the maintenance of international peace and security in any case where there appears to be a threat to the peace, breach of the peace, or act of aggression, the General Assembly shall consider the matter immediately with a view to making appropriate recommendations to Members for collective measures, including in the case of a breach of the peace or act of aggression the use of armed force when necessary, to maintain or restore international peace and security. If not in session at the time, the General Assembly may meet in emergency special session within twenty-four hours of the request therefor. Such emergency special session shall be called if requested by the Security Council on the vote of any seven members, or by a majority of the Members of the United Nations... These conditions were deemed to have been met following the Russian Federation's use of its veto power within the United Nations Security Council on 25 February to defeat draft resolution S/2022/155 deploring the invasion and calling for the withdrawal of Russian troops. Convocation On 27 February 2022, the United Nations Security Council adopted Resolution 2623 (2022), calling for an emergency special session to convene the following day. Eleven members of the Security Council voted in favor, with Russia voting against and China, India, and the United Arab Emirates abstaining. The resolution was passed despite Russia's negative vote because permanent members of the Security Council do not have veto power over procedural matters, such as a vote to convene an emergency special session. Prior to Resolution 2623, the Uniting for Peace resolution had been invoked to call emergency sessions of the General Assembly on 12 occasions: seven times by the Security Council and five times by the General Assembly. Voting Proceedings At the start of the special session, General Assembly President Abdulla Shahid of the Republic of Maldives called for the delegations to observe a minute's silence. Around a hundred delegations have requested to address the Assembly, which is expected to vote on a non-binding resolution on 2 March. Isolated at the Assembly, Russia defended its “military operation” in Ukraine, and blamed the violence on Kyiv. On the other hand, Ukraine’s representative to the UN, Sergiy Kyslytsya condemned Russia’s acts as “war crimes” and called Putin’s decision to increase the nuclear readiness “madness”. He warned, "If Ukraine does not survive, international peace will not survive. If Ukraine does not survive, the United Nations will not survive. ... If Ukraine does not survive, we cannot be surprised if democracy fails." References External links Video of the first plenary meeting Video of the second plenary meeting Remarks by Abdulla Shahid, president of the 76th General Assembly Summary of first day's debate, United Nations Meetings Coverage and Press Releases 11 Russo-Ukrainian War 2022 Russian invasion of Ukraine 2022 in international relations 2022 in the United Nations February 2022 events
[ 101, 1109, 14079, 5241, 1957, 4912, 1104, 1103, 1244, 3854, 1615, 2970, 9335, 1113, 1103, 17881, 1477, 1938, 4923, 1104, 5231, 119, 1109, 4912, 21419, 1113, 1743, 1428, 17881, 1477, 117, 1105, 1110, 1217, 1316, 1120, 1244, 3854, 9101, 1107, 1203, 1365, 1392, 119, 24570, 1760, 5241, 1957, 4912, 1110, 1126, 8362, 15460, 7641, 2433, 2309, 1104, 1103, 1244, 3854, 1615, 2970, 1106, 1294, 14844, 117, 1133, 1664, 118, 7861, 6134, 1137, 11859, 4423, 170, 2440, 2486, 119, 11177, 1957, 6887, 1132, 4054, 117, 1515, 2331, 1151, 21419, 1178, 1995, 1551, 1107, 1103, 1607, 1104, 1103, 1244, 3854, 119, 1109, 6978, 1104, 1103, 5241, 1957, 4912, 1108, 1687, 1107, 3067, 1118, 1103, 1615, 2970, 112, 188, 10156, 1104, 1157, 107, 6115, 1158, 1111, 5370, 107, 6021, 117, 1134, 1189, 1103, 3238, 2607, 1106, 1103, 2970, 112, 188, 8385, 1104, 5096, 9650, 3313, 1120, 1115, 1159, 119, 1109, 6021, 15869, 3332, 1115, 131, 119, 119, 119, 1191, 1103, 4354, 1761, 117, 1272, 1104, 2960, 1104, 8362, 7192, 15455, 1104, 1103, 4088, 1484, 117, 12169, 1106, 6730, 1157, 2425, 4812, 1111, 1103, 5972, 1104, 1835, 3519, 1105, 2699, 1107, 1251, 1692, 1187, 1175, 2691, 1106, 1129, 170, 4433, 1106, 1103, 3519, 117, 13275, 1104, 1103, 3519, 117, 1137, 2496, 1104, 16843, 117, 1103, 1615, 2970, 4103, 4615, 1103, 2187, 2411, 1114, 170, 2458, 1106, 1543, 5806, 11859, 1106, 7667, 1111, 7764, 5252, 117, 1259, 1107, 1103, 1692, 1104, 170, 13275, 1104, 1103, 3519, 1137, 2496, 1104, 16843, 1103, 1329, 1104, 4223, 2049, 1165, 3238, 117, 1106, 4731, 1137, 9176, 1835, 3519, 1105, 2699, 119, 1409, 1136, 1107, 4912, 1120, 1103, 1159, 117, 1103, 1615, 2970, 1336, 2283, 1107, 5241, 1957, 4912, 1439, 2570, 118, 1300, 2005, 1104, 1103, 4566, 1175, 14467, 1197, 119, 5723, 5241, 1957, 4912, 4103, 1129, 1270, 1191, 6792, 1118, 1103, 4354, 1761, 1113, 1103, 2992, 1104, 1251, 1978, 1484, 117, 1137, 1118, 170, 2656, 1104, 1103, 7667, 1104, 1103, 1244, 3854, 119, 119, 119, 1636, 2975, 1127, 8012, 1106, 1138, 1151, 1899, 1378, 1103, 1938, 4245, 112, 188, 1329, 1104, 1157, 27484, 1540, 1439, 1103, 1244, 3854, 4354, 1761, 1113, 1512, 1428, 1106, 3326, 5039, 6021, 156, 120, 17881, 1477, 120, 14691, 1260, 1643, 10885, 1158, 1103, 4923, 1105, 3516, 1111, 1103, 10602, 1104, 1938, 2830, 119, 16752, 17105, 1212, 1765, 1428, 17881, 1477, 117, 1103, 1244, 3854, 4354, 1761, 3399, 15338, 24280, 1495, 113, 17881, 1477, 114, 117, 3516, 1111, 1126, 5241, 1957, 4912, 1106, 14255, 7912, 1162, 1103, 1378, 1285, 119, 15159, 1484, 1104, 1103, 4354, 1761, 4751, 1107, 5010, 117, 1114, 2733, 6612, 1222, 1105, 1975, 117, 1726, 117, 1105, 1103, 1244, 4699, 14832, 170, 4832, 26174, 119, 1109, 6021, 1108, 2085, 2693, 2733, 112, 188, 4366, 2992, 1272, 4088, 1484, 1104, 1103, 4354, 1761, 1202, 1136, 1138, 27484, 1540, 1166, 5250, 27433, 5218, 117, 1216, 1112, 170, 2992, 1106, 14255, 7912, 1162, 1126, 5241, 1957, 4912, 119, 4602, 1106, 15338, 24280, 1495, 117, 1103, 6115, 1158, 1111, 5370, 6021, 1125, 1151, 1107, 18891, 1106, 1840, 5241, 6887, 1104, 1103, 1615, 2970, 1113, 1367, 6070, 131, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Air Balloon was launched in 1784 at Yarmouth as a coaster. She was captured in 1797. She then disappeared from United Kingdom records until 1824. She was almost rebuilt in 1825, only to suffer a major maritime incident in 1826. She was refloated and resumed sailing, but was wrecked in 1829. Career Air Balloon first appeared in Lloyd's Register (LR) in 1784. On 27 March 1798, Air Balloon was sailing from Blakeney, Norfolk to Salcombe when a French vessel captured her and took her into Boulogne. Air Balloon returned to Lloyd's Register in 1824. She re-entered the Register of Shipping (RS) in 1825, with information that disagreed with that in Lloyd's Register. On 7 September 1826, Air Balloon, James Brown, master was driven ashore at Whitby; her crew were rescued. She was on a voyage from Littlehampton, to her homeport of Sunderland, County Durham. Air Balloon was refloated on 17 September and taken in to Whitby. Fate On 13 August 1829 Air Balloon sprang a leak and foundered in the North Sea off Scarborough. She was on a voyage from Sunderland to Chatham, Kent. She was refloated on 21 August and taken into Scarborough. She was last listed in the 1829 volume of Lloyd's Register. She was last listed in the Register of Shipping in 1833, but with data stale since 1828. Notes, citations, and references Notes Citations References 1784 ships Age of Sail merchant ships of England Captured ships Maritime incidents in September 1826 Maritime incidents in August 1829
[ 101, 1806, 7708, 6931, 1108, 2536, 1107, 17521, 1120, 14680, 9019, 16397, 1112, 170, 20814, 119, 1153, 1108, 3297, 1107, 14643, 119, 1153, 1173, 4712, 1121, 1244, 2325, 3002, 1235, 11638, 119, 1153, 1108, 1593, 6669, 1107, 11377, 117, 1178, 1106, 8813, 170, 1558, 12657, 4497, 1107, 12000, 119, 1153, 1108, 1231, 2087, 23223, 1174, 1105, 7475, 9145, 117, 1133, 1108, 20580, 1107, 11527, 119, 17062, 1806, 7708, 6931, 1148, 1691, 1107, 6151, 112, 188, 4273, 113, 149, 2069, 114, 1107, 17521, 119, 1212, 1765, 1345, 13281, 117, 1806, 7708, 6931, 1108, 9145, 1121, 5887, 4695, 117, 7240, 1106, 18613, 14231, 1165, 170, 1497, 5832, 3297, 1123, 1105, 1261, 1123, 1154, 9326, 22806, 8376, 119, 1806, 7708, 6931, 1608, 1106, 6151, 112, 188, 4273, 1107, 11638, 119, 1153, 1231, 118, 2242, 1103, 4273, 1104, 22198, 113, 25591, 114, 1107, 11377, 117, 1114, 1869, 1115, 19786, 1114, 1115, 1107, 6151, 112, 188, 4273, 119, 1212, 128, 1347, 12000, 117, 1806, 7708, 6931, 117, 1600, 2671, 117, 3283, 1108, 4940, 17487, 1120, 160, 17481, 2665, 132, 1123, 3039, 1127, 10043, 119, 1153, 1108, 1113, 170, 10007, 1121, 2743, 24207, 117, 1106, 1123, 1313, 4342, 1104, 16362, 117, 1391, 8975, 119, 1806, 7708, 6931, 1108, 1231, 2087, 23223, 1174, 1113, 1542, 1347, 1105, 1678, 1107, 1106, 160, 17481, 2665, 119, 17711, 1212, 1492, 1360, 11527, 1806, 7708, 6931, 16636, 170, 19299, 1105, 3249, 1174, 1107, 1103, 1456, 3017, 1228, 20102, 119, 1153, 1108, 1113, 170, 10007, 1121, 16362, 1106, 17815, 117, 5327, 119, 1153, 1108, 1231, 2087, 23223, 1174, 1113, 1626, 1360, 1105, 1678, 1154, 20102, 119, 1153, 1108, 1314, 2345, 1107, 1103, 11527, 3884, 1104, 6151, 112, 188, 4273, 119, 1153, 1108, 1314, 2345, 1107, 1103, 4273, 1104, 22198, 1107, 11004, 117, 1133, 1114, 2233, 188, 15903, 1290, 11521, 119, 8797, 117, 19548, 1116, 117, 1105, 7732, 8797, 17028, 1116, 19714, 1116, 17521, 2968, 4936, 1104, 25185, 1233, 6800, 2968, 1104, 1652, 15914, 10105, 2968, 11081, 10563, 1107, 1347, 12000, 11081, 10563, 1107, 1360, 11527, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Rhipicera femorata is a species of beetle in the genus Rhipicera. Distribution Rhipicera femorata has been collected on sandy swamplands and immediate environs, with sedges, grasses and other swampy land trees, along the eastern coast of Australia from Tasmania to southern Queensland and South Australia. References Beetles of Australia Beetles described in 1819 Polyphaga
[ 101, 155, 3157, 4396, 1611, 175, 5521, 6533, 1777, 1110, 170, 1530, 1104, 7924, 1107, 1103, 2804, 155, 3157, 4396, 1611, 119, 19806, 155, 3157, 4396, 1611, 175, 5521, 6533, 1777, 1144, 1151, 4465, 1113, 13366, 16407, 6754, 1105, 5670, 4035, 25740, 4199, 117, 1114, 14516, 25477, 117, 24567, 1105, 1168, 16407, 1183, 1657, 2863, 117, 1373, 1103, 2638, 3153, 1104, 1754, 1121, 12484, 1106, 2359, 4548, 1105, 1375, 1754, 119, 19714, 1116, 16385, 14629, 1104, 1754, 16385, 14629, 1758, 1107, 12720, 17129, 1183, 20695, 2571, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
The Avoriaz International Fantastic Film Festival () was a film festival held in the French resort of Avoriaz between 1973 and 1993. It was the precursor to the current Gérardmer International Fantastic Film Festival. Unlike many such events, the Avoriaz festival did not have grassroots origins. Organized as a vehicle for the eponymous skiing resort, it intended to promote the genre and its host town to a mainstream audience, with a level of glamour typically associated with more accepted film genres. The New York Times called it as "a great success, the high point of many junketing French journalists' winters" and the Financial Times wrote that its two decades of existence had turned Avoriaz into "a momentary movie mecca". In its time, the festival was hailed as the premier fantasy film event in the world, although recent assessments have ranked Sitges, which outlasted it by a considerable margin, as the genre's foremost gathering. History Origins The festival was the brainchild of leisure entrepreneur Gérard Brémond of Pierre & Vacances and advertiser :fr:Lionel Chouchan. Brémond had established the ski resort of Avoriaz in 1966, in cooperation with Olympic downhill skiing gold medallist Jean Vuarnet. He commissioned Chouchan to create an event that would help publicize his winter sports business. Chouchan suggested a fantastic film festival after witnessing the resort's eerie sightlines, which were influenced by organic architecture. Daniel Goldman, the head of Cinema International Corporation in France, was an early adherent to the project and helped procure screening rights to many American films. Savvy promotion and strong corporate backing elevated the event to a level of relevance unheard of for a speciality film gathering, with ample news and talk show coverage on the home country's most watched channels. France Inter set up a studio at the Hotel des Drômonts during the festival, and many national television talk shows were broadcast from the festival. TF1 was a presenting partner, while Antenne 2 sponsored a special award, the Golden Antenna, sometimes in the same year. A 1990 survey found that the festival was known to 93% of the French public, second only to Cannes. Style In comparison to the more traditional approach of the Paris International Festival of Fantastic and Science-Fiction Film, Avoriaz made a concerted effort to distance itself from the genre's exploitation roots, with Chouchan saying "We couldn't just have the upteenth film with Vincent Price or Christopher Lee [...] There had to be a new fantastique." From the beginning, Brémond had promoted Avoriaz by gifting all-inclusive holidays to popular singers and actors in exchange for publicity shots, and a similar practice was used for the festival itself. Unlike Sitges, Avoriaz actively courted celebrity jurors with art or mainstream cinema credentials, which was as much an effort to legitimize the genre as it was a nudge to mass media. By Chouchan's own retrospective admission, Avoriaz was an image-conscious and exclusive affair, with few members of the public allowed within the festival's perimeter, although it was partly due to the resort's limited capacity. This led to accusations of manufactured elitism from both special and general interest publications, such as the Cahiers du Cinema and L'Express. Lucio Fulci, an Italian director whose career straddled the line between mainstream and exploitation cinema, said: "[In Paris] the public was really sympathetic, with a sweet smell of weed. [...] Whereas in Avoriaz, it was very snobbish, many people didn't care about anything." The inaugural Grand Prix, awarded to Steven Spielberg's Duel in his first award win for a longform feature, did much to establish the festival' credibility when the director rose to international fame in the following years. Spielberg would return in 1977 to serve as jury president, a position he would not accept again until the 2013 Festival de Cannes. While its palmares was generally regarded as being of a high quality, the event's overtures towards cinema auteurs sometimes exposed a gap between the films it showcased and the expectations of the cultural establishment it courted. Hollywood actress and Avoriaz juror Leslie Caron expressed outrage at The Texas Chainsaw Massacre, which made its belatted appearance at the 1976 festival due to censorship issues, calling it "beastly, vile and dehumanizing". The star-studded jury, which also included Sergei Bondarchuk, Eugène Ionesco, Agnès Varda, Jacques Tati, Iannis Xenakis and president Michaelangelo Antonioni, refused to award the Grand Prize that year on the basis on an excessively weak selection. The Texas Chainsaw Massacre took the Critics' Prize. In 1985, popular actor Michel Blanc—who was a festival guest but not a jury member—publicly and repeatedly lambasted The Terminator, calling it "a harrowingly dumb film". The film still won the Grand Prize and the French market ended up contributing a disproportionate amount to its worldwide gross. Segregation of genre and art films By the second half of the 1980s, Brémond and Chouchan were growing uneasy about fantastic cinema's increasingly graphic nature amidst the gore boom of the time, which put the event at odds with Avoriaz's desired family friendly image and ushered in the first rumors of its demise. In response, the 1986 Festival confined slasher and horror films to a minor, separate competition called the Fear Section. However, the distinction between films whose artistic merits were deemed worthy of the main competition and those that would be relegated to the Fear Section was unclear. For instance, the original Hellraiser was consigned to the Fear Section, but when it proved successful, the second installment was accepted into the main bracket. Furthermore, due to its restrictive niche, the Fear Section often had to be padded with the type of low budget horror fare the organizers were keen to avoid in the first place. Today the Fear Section is largely remembered for providing an outlet for some films from the dying days of Italian genre cinema. Most notably, Michele Soavi, one of the country's last internationally recognized genre directors, won his first award in the 1987 Fear Section for Stage Fright. In 1989, the Festival added another award, the Prix de l'Étrange (approximately translating as "Eeriness Prize"), in order to further highlight atmospheric films over graphic ones. In 1990, the Fear Section was closed outright, and extreme cinema was limited to out-of-competition screenings. Demise and relocation to Gérardmer As the 1980s gave rise to bigger, high concept productions, the festival's handpicked juries of prestigious but subversion-prone auteurs clashed with the heightened commercial expectations such films generated, and strained its relationship with major distributors. Fox executives threatened a boycott when their two odds-on favorites, The Fly and RoboCop were passed for top honors in 1986 and 1987 respectively, with Le Monde conceding that RoboCop probably would have won the Grand Prize, had its heavy advertising campaign not antagonized the jury headed by Sidney Lumet. While Columbia Tri-Star provided the 1992 Festival with its showpiece in The Addams Family, the film left empty handed, and the distributor refused to do the same the following year with the highly anticipated Dracula. As the film was scheduled to open in France right after the festival, Chouchan and Brémond interpreted the decision as a deliberate snub. Further highlighting the absence of Coppola's film, that edition featured a Dracula retrospective and Christopher Lee as president in the jury. Festival executives subsequently complained that large distributors were now demanding award guarantees to enter their flagship films in the event, something they did not want to give. Avoriaz's rift with the majors necessited a return to smaller—and gorier—films, although there was an attempt to do so through the prism of dark comedies like The Borrower, Mutant Action, Army of Darkness and Braindead. Brémond cites the appalled reaction of former prime minister Michel Rocard, whom he had invited to a screening of eventual 1993 Grand Prix winner Braindead, and the failure of that film at the box office, as the final hint that the fantastic genre was not an appropriate vehicle for his real estate ventures anymore. The emergence of home video as the primary outlet for much of the independent genre production also meant that such films carried fewer chances of crossing over to the mainstream. Following the 1993 edition, Brémond pulled the plug on the event. As a more wholesome alternative, he launched the Avoriaz French Film Festival the following year. Industry sources suggested that beyond his disenchantment with fantasy films, Brémond may have been looking to attract more public subsidies and ingratiate himself to the French entertainment industry, as he was venturing into filmmaking with his new company Marathon Productions. Ultimately, the French Film Festival underperformed and was shut down after just three years. For his part, Chouchan took the original concept to the Vosges resort of Gérardmer and created a spiritual successor, the Gérardmer International Fantastic Film Festival, which still exists as of 2022. Grand Prix history In popular culture Avoriaz, les fantômes du festival, a crime novel talking place during a fictionalized version of the festival, was written by author Gilbert Picard and published in France in 1990. References Bibliography Fantasy and horror film festivals Film festivals in France 1973 establishments in France Film festivals established in 1973 Science fiction film festivals
[ 101, 1109, 138, 12198, 1465, 1584, 1570, 19420, 2352, 2263, 113, 114, 1108, 170, 1273, 3782, 1316, 1107, 1103, 1497, 8037, 1104, 138, 12198, 1465, 1584, 1206, 2478, 1105, 1949, 119, 1135, 1108, 1103, 15985, 1106, 1103, 1954, 144, 27234, 4027, 1570, 19420, 2352, 2263, 119, 5472, 1242, 1216, 1958, 117, 1103, 138, 12198, 1465, 1584, 3782, 1225, 1136, 1138, 5282, 25142, 7564, 119, 20383, 2200, 1112, 170, 3686, 1111, 1103, 16105, 14106, 8037, 117, 1122, 3005, 1106, 4609, 1103, 6453, 1105, 1157, 2989, 1411, 1106, 170, 7965, 3703, 117, 1114, 170, 1634, 1104, 176, 23823, 3417, 2628, 1114, 1167, 3134, 1273, 11688, 119, 1109, 1203, 1365, 2706, 1270, 1122, 1112, 107, 170, 1632, 2244, 117, 1103, 1344, 1553, 1104, 1242, 22323, 21299, 1497, 9891, 112, 17415, 107, 1105, 1103, 7748, 2706, 1724, 1115, 1157, 1160, 4397, 1104, 3796, 1125, 1454, 138, 12198, 1465, 1584, 1154, 107, 170, 1721, 3113, 2523, 1143, 19495, 107, 119, 1130, 1157, 1159, 117, 1103, 3782, 1108, 17932, 1112, 1103, 11591, 7369, 1273, 1856, 1107, 1103, 1362, 117, 1780, 2793, 25451, 1138, 3616, 20985, 7562, 117, 1134, 1149, 19268, 1174, 1122, 1118, 170, 5602, 7464, 117, 1112, 1103, 6453, 112, 188, 17766, 7410, 119, 2892, 27358, 1109, 3782, 1108, 1103, 3575, 21289, 1104, 17036, 12035, 144, 27234, 139, 13240, 10151, 1104, 4855, 111, 159, 16604, 21949, 1105, 8050, 12986, 12943, 131, 175, 1197, 131, 14957, 22964, 9827, 1389, 119, 139, 13240, 10151, 1125, 1628, 1103, 10458, 8037, 1104, 138, 12198, 1465, 1584, 1107, 2678, 117, 1107, 7395, 1114, 3557, 23895, 14106, 2284, 3086, 7276, 2893, 159, 6718, 12275, 1204, 119, 1124, 4156, 22964, 9827, 1389, 1106, 2561, 1126, 1856, 1115, 1156, 1494, 1470, 3708, 1117, 3701, 2865, 1671, 119, 22964, 9827, 1389, 3228, 170, 14820, 1273, 3782, 1170, 7737, 1158, 1103, 8037, 112, 188, 21914, 3617, 10443, 117, 1134, 1127, 4401, 1118, 7878, 4220, 119, 2979, 19085, 117, 1103, 1246, 1104, 10371, 1570, 3436, 1107, 1699, 117, 1108, 1126, 1346, 8050, 12807, 2227, 1106, 1103, 1933, 1105, 2375, 5250, 22712, 11954, 2266, 1106, 1242, 1237, 2441, 119, 17784, 1964, 7170, 4166, 1105, 2012, 6214, 4581, 8208, 1103, 1856, 1106, 170, 1634, 1104, 25319, 8362, 13836, 2956, 1104, 1111, 170, 1957, 1785, 1273, 7410, 117, 1114, 23336, 2371, 1105, 2037, 1437, 5811, 1113, 1103, 1313, 1583, 112, 188, 1211, 2542, 6412, 119, 1699, 11300, 1383, 1146, 170, 2362, 1120, 1103, 4556, 3532, 1987, 28206, 7578, 1116, 1219, 1103, 3782, 117, 1105, 1242, 1569, 1778, 2037, 2196, 1127, 3012, 1121, 1103, 3782, 119, 157, 2271, 1475, 1108, 170, 11124, 3547, 117, 1229, 1760, 5208, 1673, 123, 5988, 170, 1957, 2574, 117, 1103, 3684, 1760, 5208, 1605, 117, 2121, 1107, 1103, 1269, 1214, 119, 138, 1997, 5980, 1276, 1115, 1103, 3782, 1108, 1227, 1106, 5429, 110, 1104, 1103, 1497, 1470, 117, 1248, 1178, 1106, 15451, 119, 13023, 1130, 7577, 1106, 1103, 1167, 2361, 3136, 1104, 1103, 2123, 1570, 2263, 1104, 19420, 1105, 2444, 118, 9713, 2352, 117, 138, 12198, 1465, 1584, 1189, 170, 3838, 1174, 3098, 1106, 2462, 2111, 1121, 1103, 6453, 112, 188, 15880, 6176, 117, 1114, 22964, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
The 1953 Southwest Texas State Bobcats football team was an American football team that represented Southwest Texas State Teachers College (now known as Texas State University) during the 1953 college football season as a member of the Lone Star Conference (LSC). In their third year under head coach Milton Jowers, the team compiled an overall record of 5–4 with a mark of 3–2 in conference play. Schedule References Southwest Texas State Texas State Bobcats football seasons Southwest Texas State Bobcats football
[ 101, 1109, 3185, 10859, 2245, 1426, 3162, 21393, 1709, 1264, 1108, 1126, 1237, 1709, 1264, 1115, 2533, 10859, 2245, 1426, 14290, 1531, 113, 1208, 1227, 1112, 2245, 1426, 1239, 114, 1219, 1103, 3185, 2134, 1709, 1265, 1112, 170, 1420, 1104, 1103, 19511, 2537, 3047, 113, 149, 10844, 114, 119, 1130, 1147, 1503, 1214, 1223, 1246, 2154, 9398, 8125, 12097, 1116, 117, 1103, 1264, 9064, 1126, 2905, 1647, 1104, 126, 782, 125, 1114, 170, 4551, 1104, 124, 782, 123, 1107, 3511, 1505, 119, 23070, 19714, 1116, 10859, 2245, 1426, 2245, 1426, 3162, 21393, 1709, 2955, 10859, 2245, 1426, 3162, 21393, 1709, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Columbus is a shopping centre in Vuosaari, Helsinki, Finland, right next to the Vuosaari metro station. It is owned by Citycon. The centre was completed in August 1996. The centre has a total surface area of over 20 thousand square metres. To the north of the shopping centre are located the Mosaiikkitori square and the Vuotalo cultural centre as well as the Vuosaari sports hall, and to the south of it are located the service centre Albatrossi and Cirrus, the highest residential building in Finland, which was completed in 2006. History The Paulig era (1996-2006) The family company Paulig known for its coffee and spices owned land at the centre of Vuosaari. During the early 1990s depression in Finland the company started building business spaces in the area by itself as it could not find any suitable investors. The shopping centre Columbus was completed in autumn 1996, almost two years before the Vuosaari branch of the Helsinki metro and its three stations (Puotila, Rastila and Vuosaari) were taken into use. Because of its small size, the centre was slightly overshadowed by larger shopping centres, so it was expanded to the east by about 7 thousand square metres. The expansion was started in June 2005 and was completed at Christmas 2006. With the expansion, the total surface area of the centre grew to over 20 thousand square metres and the number of parking spaces grew from seven hundred to one thousand. Businesses located in the expansion part included K-Supermarket, Posti Group, Tokmanni, Jysk and the self storage rental company Cityvarasto. In 2005 the total revenue of the Columbus shopping centre was over 65 million euro. The Citycon era (2006-) In 2006 the shopping centre had about sixty tenants. Paulig sold the Columbus building, which was not part of its core business, to Citycon for 80 million euro. Paulig spent part of this money to building a new coffee roastery in Vuosaari. An expansion part was completed in autumn 2007, with K-Citymarket as its main tenant. The leasable business area of the centre grew to 20 thousand square metres. In autumn 2016, the K-Citymarket store in the centre was downgraded back to K-Supermarket. In July 2012 a glass window of about five square metres in area fell down from a height of ten metres in the shopping centre. No one was injured. In February 2019 Paulig and Citycon made a preliminary business deal with Bonava about the lots located in Vuosaari. The area is located in Vuosaari, in the northern part of Aurinkolahti, between the metro station, the shopping centre and other activities in Vuosaari. Bonava plans on buying building rights of about 32 thousand square metres of habitable space for owner-occupied and rental apartments. Businesses Numerous businesses related to daily groceries, clothes, beauty, the household and free time, as well as restaurants and services, are located in the Columbus shopping centre. Businesses in the centre include Alko, R-kioski, S-market, K-Supermarket, Lindex, Suomalainen kirjakauppa, Hesburger, Subway, Chico's, a pharmacy and Tokmanni. The newest tenant in the centre is Lidl. Gallery References External links Official site Shopping centres in Helsinki Vuosaari
[ 101, 8555, 1110, 170, 6001, 2642, 1107, 159, 11848, 3202, 7710, 117, 12471, 117, 5776, 117, 1268, 1397, 1106, 1103, 159, 11848, 3202, 7710, 16411, 1466, 119, 1135, 1110, 2205, 1118, 1392, 7235, 119, 1109, 2642, 1108, 2063, 1107, 1360, 1820, 119, 1109, 2642, 1144, 170, 1703, 2473, 1298, 1104, 1166, 1406, 4032, 1961, 2759, 119, 1706, 1103, 1564, 1104, 1103, 6001, 2642, 1132, 1388, 1103, 12556, 19021, 4847, 2293, 2772, 1182, 1961, 1105, 1103, 159, 11848, 6163, 1186, 3057, 2642, 1112, 1218, 1112, 1103, 159, 11848, 3202, 7710, 2865, 2885, 117, 1105, 1106, 1103, 1588, 1104, 1122, 1132, 1388, 1103, 1555, 2642, 24005, 8005, 19828, 1105, 140, 3161, 6208, 117, 1103, 2439, 5198, 1459, 1107, 5776, 117, 1134, 1108, 2063, 1107, 1386, 119, 2892, 1109, 1795, 6512, 3386, 113, 1820, 118, 1386, 114, 1109, 1266, 1419, 1795, 6512, 1227, 1111, 1157, 3538, 1105, 25133, 2205, 1657, 1120, 1103, 2642, 1104, 159, 11848, 3202, 7710, 119, 1507, 1103, 1346, 3281, 7560, 1107, 5776, 1103, 1419, 1408, 1459, 1671, 6966, 1107, 1103, 1298, 1118, 2111, 1112, 1122, 1180, 1136, 1525, 1251, 6736, 9660, 119, 1109, 6001, 2642, 8555, 1108, 2063, 1107, 8929, 1820, 117, 1593, 1160, 1201, 1196, 1103, 159, 11848, 3202, 7710, 3392, 1104, 1103, 12471, 16411, 1105, 1157, 1210, 2930, 113, 153, 11848, 19621, 1161, 117, 16890, 2050, 8009, 1105, 159, 11848, 3202, 7710, 114, 1127, 1678, 1154, 1329, 119, 2279, 1104, 1157, 1353, 2060, 117, 1103, 2642, 1108, 2776, 17074, 9574, 12595, 1118, 2610, 6001, 9335, 117, 1177, 1122, 1108, 3631, 1106, 1103, 1746, 1118, 1164, 128, 4032, 1961, 2759, 119, 1109, 4298, 1108, 1408, 1107, 1340, 1478, 1105, 1108, 2063, 1120, 3394, 1386, 119, 1556, 1103, 4298, 117, 1103, 1703, 2473, 1298, 1104, 1103, 2642, 2580, 1106, 1166, 1406, 4032, 1961, 2759, 1105, 1103, 1295, 1104, 5030, 6966, 2580, 1121, 1978, 2937, 1106, 1141, 4032, 119, 3518, 1279, 1388, 1107, 1103, 4298, 1226, 1529, 148, 118, 3198, 19919, 117, 3799, 1182, 1990, 117, 1706, 27776, 2605, 117, 147, 6834, 1377, 1105, 1103, 2191, 5092, 13519, 1419, 1392, 8997, 12788, 1186, 119, 1130, 1478, 1103, 1703, 7143, 1104, 1103, 8555, 6001, 2642, 1108, 1166, 2625, 1550, 27772, 119, 1109, 1392, 7235, 3386, 113, 1386, 118, 114, 1130, 1386, 1103, 6001, 2642, 1125, 1164, 9229, 16086, 119, 1795, 6512, 1962, 1103, 8555, 1459, 117, 1134, 1108, 1136, 1226, 1104, 1157, 4160, 1671, 117, 1106, 1392, 7235, 1111, 2908, 1550, 27772, 119, 1795, 6512, 2097, 1226, 1104, 1142, 1948, 1106, 1459, 170, 1207, 3538, 187, 20219, 5075, 1107, 159, 11848, 3202, 7710, 119, 1760, 4298, 1226, 1108, 2063, 1107, 8929, 1384, 117, 1114, 148, 118, 1392, 19919, 1112, 1157, 1514, 19197, 119, 1109, 5837, 18384, 2165, 1671, 1298, 1104, 1103, 2642, 2580, 1106, 1406, 4032, 1961, 2759, 119, 1130, 8929, 1446, 117, 1103, 148, 118, 1392, 19919, 2984, 1107, 1103, 2642, 1108, 1205, 18590, 1171, 1106, 148, 118, 3198, 19919, 119, 1130, 1351, 1368, 170, 2525, 2487, 1104, 1164, 1421, 1961, 2759, 1107, 1298, 2204, 1205, 1121, 170, 3976, 1104, 1995, 2759, 1107, 1103, 6001, 2642, 119, 1302, 1141, 1108, 4475, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
The Will to Battle is the third novel in Terra Ignota, a quartet of science fiction novels by the American author Ada Palmer. It was published on December 19, 2017. It was a finalist for the 2018 Locus Award for Best Science Ficiton Novel. It is preceded by Too Like the Lightning (2016) and Seven Surrenders (2017). It is followed by Perhaps the Stars (2021). Set in the year 2454, the Earth of the Terra Ignota quartet has seen several centuries of near-total peace and prosperity, but is preparing to go to war. The Will to Battle presents itself as a chronicle of those global escalations and preparations. It is narrated by self-confessed unreliable narrator Mycroft Canner, a brilliant, infamous, and paroled criminal who often serves the world's most powerful leaders. Setting Advanced technology has led to the advent of a near-utopian golden age. However, the tensions among political groups, such as over distribution of land, population, and income, has escalated into preparations for a global war. Though there were initially seven Hives, they have each shifted into new governance systems or collapsed. The Will to Battle takes place over a much longer timespan than the previous two books combined. The events occur between April 8 and September 6, 2454, and were written between July 6 and September 14, 2454. Gendered language By default, almost all characters use gender-neutral language, with "they/them" the predominant pronoun used. Mycroft, the primary narrator, finds his world's obsession with gender-neutrality oppressive, so often uses gendered pronouns to refer to other characters, assigning genders based on the characters' personalities and roles, as they relate to traditional Western gender roles. For instance, Chagatai is referred to using "she/her" pronouns because of their fierce, lioness-like strength when protecting their nephew from attack. The author has explained that Mycroft frequently "misuses" gendered pronouns, just as people in real life often make mistakes when using gender-neutral pronouns. Also, in its chapter at the start of Seven Surrenders, Sniper advises the reader to not "trust the gendered pronouns Mycroft gives people, they all come from Madame". Mycroft sometimes varies the gendered pronouns he gives characters. For instance, Carlyle is mostly referred to using she/her pronouns starting with Seven Surrenders, whereas in the first book Carlyle is referred to with he/him pronouns. Style The "history" of the first two books were written for contemporaneous public release; this volume has been written for posterity. Thus it is ostensibly less closely edited by the Ninth Anonymous (9A). This is marked by several stylistic changes, including the presentation of more conversations as simple dialogues, as if in a script. The Ninth Anonymous, Mycroft's apprentice, narrates the final chapter. The novels make frequent direct addresses to a "reader", inspired by eighteenth-century literature. However, the reader is not the actual reader of the book, but an imagined in-universe reader whom Mycroft supposes is either his contemporary or someone in his future. Mycroft's sanity is waning and throughout the text he has numerous dialogues with deceased friends, such as several of the Mardi bash', Thomas Hobbes, the reader, and sometimes conversations among these. Plot April Ten days after the events of Seven Surrenders, newly elected Humanist President Vivien Ancelet visits Ockham, now Prospero, Saneer in prison. They discuss the legal details of O.S. and plan for Prospero to plea terra ignota: uncertainty over whether or not the O.S. assassinations were a crime. Achilles, transformed from the toy known as the Major into a human by Bridger's suicide, helps world leaders prepare for war, stockpiling food and increasing medical facilities so that the upcoming war is as humane as it can be. Mycroft and Saladin even recruit black market traders to keep supplies flowing to civilians if mainstream channels fail. At a second emergency session of the Universal Free Alliance Senate, urgent matters are chaotically negotiated: Su-Hyeon Ancelet-Kosala is confirmed as official Censor. The Sensayers' Conclave is ordered to address the global theological crisis caused by J.E.D.D. Mason's resurrection. Lorelai "Cookie" Cook re-proposes the Eighth "Black" Law, banning the development of set-sets and other brainwashing practices like those at Madame's. It is deferred to the next session. The Blacklaws call for Sniper's death, but the motion is deferred to the next session. The Deputy Commissioner General asks whether the Court should accept or reject Ockham Prospero Saneer's petition for a terra ignota trial. During the debate, Humanist hero-Senator Aesop Quarriman pins a bull's eye symbol to her chest as though to say, if killing me would help the planet, do it. Achilles, watching with Mycroft and the Services, notes that the bull's eye symbol marks the moment when sides in the conflict take clear shape. Over a hundred thousand Servicers choose to swear loyalty to Achilles and begin military training as Myrmidons. The next day, Julia Doria-Pamphili and J.E.D.D. Mason go to the Sensayers' Conclave. A sensayer attempts to kill J.E.D.D. Mason but is prevented by Utopians wearing Apollo's Delian sun symbol, signaling their readiness for conflict. Dominic and Madame kidnap Mycroft to lure Sniper. An unknown assailant attempts to kill Mycroft. Sniper and Tully rescue him. The war almost breaks out when all Humanists are indicted on O.S.-related charges. J.E.D.D. Mason and Sniper negotiate to cool things down and give both sides more time to prepare and reduce the danger of the war to come. Cornel MASON and King Isabel of Spain come to conflict over J.E.D.D. Mason's possible succession to Europe's monarchy. The Cousins and Greenpeace faction of the Mitsubishi form an alliance to lessen war's impact. Dominic and Cornel MASON negotiate to end the Mitsubishi strike, kill the set-set ban, and pass the Blacklaw motion to declare Sniper an enemy of the Alliance (though this immediately gets held up in court). May J.E.D.D Mason is invited to Hobbestown to discuss whether he can still serve as a Hiveless Tribune. While there, news breaks that someone has broken into the Masonic Sanctum Sanctorum. The thieves broadcast that J.E.D.D. Mason is the heir to the Empire and also steal the top-secret Masonic Oath of Office. Cornel MASON threatens to go to war right then, but is talked into waiting. J.E.D.D. Mason, Spain, Madame, Mycroft, Felix, Dominic, Carlyle (now a despairing Dominican Blacklaw), and Achilles go to the Vatican Reservation to get permission for Madame to marry the King and to discern J.E.D.D.'s next action. J.E.D.D. Mason goes back to the Rostra in Romanova and declares that as his enemies predicted, he intends to takeover and re-make global system to build a version that does not need the O.S. assassinations to maintain peace. However, he proposes that all sides wait until the end of the forthcoming Olympic Games, as was the tradition in Ancient Greece. A statement attributed to Sniper agrees. J.E.D.D. Mason, Mycroft, and Achilles meet Aesop and Papa during a visit to Antarctica's capital Esperanza City. Throughout the visit, Mycroft receives calls from leaders both alive and dead. The group meets with Lesley, disguised and ghostwriting as Sniper because it has been missing since the it and Tully rescued Mycroft. Lesley gets J.E.D.D. Mason to agree to search for and free Sniper, because if it does not compete in the Olympics it would break the truce. Back at Madame's nunnery in Burgos, J.E.D.D. Mason demands the Cousins' unconditional surrender, refuses Dominic's on behalf of the Mitsubishi, and makes a temporary alliance with Cornel MASON. Achilles makes a permanent alliance with MASON. The Cousins, Europeans, Mitsubishi, and Humanists submit their proposals for government reform (or lackthereof) to the Alliance Senate. June Throughout April, May, and June Martin Guildbreaker endeavors to deduce and trap Mycroft's second attacker, whom he believes may also be Sniper's kidnapper. Mycroft and Achilles separately visit Thisbe in prison. Ockham Prospero Saneer's terra ignota trial begins. Judges recommend that no charges should be brought against Prospero or Humanist Hive leader(s), homicide charges should be brought against Mitsubishi and European Hive leaders, and the Alliance Senate should figure out the limits of lethal force one Hive can use against another. Though Prospero goes free, Papa immediately arrests him for concealing and aiding the murders Thisbe committed against her lovers. August and September The Hive and Hiveless leaders, sans Madame, are called to Romanova by the Utopians. Faust mentions that Cornel and Achilles are having an affair. The Utopians, represented by Huxley Mojave, announce that in order to prevent the destruction of the planet, they have destroyed all facilities capable of creating Harbingers, weapons capable of great destruction, including viral laboratories and nuclear facilities. They have also kidnapped all people with the knowledge of how to create them, except Cato Weeksbooth. As this affects all other Hives, they offer reparations in the form of assets and intellectual property. Furthermore, they give the Hives the means to spy on each other to ensure that no further Harbingers are created. They know this will turn the Hives against them, but judge the risk worth saving all life on Earth. All begin racing to capture Cato at Klamath Marsh Secure Hospital. Martin tries to set another trap with Mycroft as bait, but is double-crossed. The assailant is revealed to be a surviving Merion Kraye/Casimir Perry, assisted by Croucher. Sniper is returned days before the Olympics. It seems traumatized but does not reveal where it had been for four months. During the Olympic Opening Ceremonies, J.E.D.D. Mason completely lowers his defenses but Sniper declines to attack him. A war ceremony is held at the Temple of Janus in Romanova. Immediately, the Utopian undersea city Atlantis is destroyed and thousands killed. During the rescue efforts, Mycroft's tracker indicates his death (though a note in the text reveals otherwise), necessitating the Ninth Anonymous' narration of the final chapter. The novel ends with the world officially at war. Characters These are charactes who figure significantly in this novel. For a full list of the entire quartet's characters, see the main article for Terra Ignota. The ◎ symbol is used to denote Hiveguard. The Ⓥ symbol is used to denote Remakers. Ⓥ Mycroft Canner: a brilliant polymath and infamous convicted criminal. He serves his sentence as a Servicer, works for many of the most powerful world leaders, and secretly protects Bridger. He is thin and stooped, with curly overgrown hair, reconstructed limbs, distinctive scars, and slightly dark skin. Wears a round, shapeless hat. Thirty-one years old. Of Greek descent. Bridger: a 13-year-old boy who can "miracle" toys or representational objects to become real. Fair skin with blondish brown hair, very beautiful. Ⓥ The Major a.k.a. Achilles Mojave: the leader of toy soldiers brought to life by Bridger. Lieutenant Aimer a.k.a. Patroclus: the Major's lieutenant and second in command of the toy soldiers. Croucher: a toy soldier who consistently disagrees and questions those around him. Other toy soldiers: Private Pointer, Looker, Crawler, Medic, Stander Yellow, Stander Green, Nogun, and Nostand. Mommadoll: an animated doll who cooks and cares for Bridger and the soldiers. Cousins Hive Ⓥ Carlyle Foster-Kraye de la Trémouïlle: a sensayer (spiritual counselor). The illegitimate child of Danaë and Casimir Perry/Marion Kraye. Blonde and gaunt, thirty-one years old, of European descent. A male assigned he/him and she/her pronouns in different periods of the narrative. Bryar Kosala: Chair of the Cousins Hive. Looks tall and imperious, but is deeply kind. Spouse of Vivien Ancelet. Of Indian descent. Ⓥ Lorelai "Cookie" Cook: Romanova's Minister of Education. A Nuturist faction leader, opposing the creation of set-sets. Darcy Sok: Cousins' Feedback Bureau Chief. European Hive Isabel Carlos II a.k.a. Spain: King of Spain and former Prime Minister of the European Hive. 59 years old, with nearly black hair. Of Spanish and Chinese descent. Casimir Perry/Marion Kraye: the late "second-choice" Prime Minister of the European Hive. A jilted suitor for Danaë who took his revenge by exposing Madame's system. ◎ Julia Doria-Pamphili: Head of the Sensayers' Conclave a.k.a. Pontifex Maxima (high priestess). A vocateur specializing in intense one-shot sessions and Mycroft's court appointed sensayer. Expresses a distinctly feminine gender. Of Italian descent. Ektor Carlyle 'Papa' Papadelias: Romanovan Commissioner General. Obsessed with the details of Mycroft's case. One hundred and two years old. Of Greek descent. A female assigned 'he' pronouns. Gordian Hive Felix Faust: Headmaster of the Brillist Institute & Gordian Hive. Seventy-eight years old with a voyeuristic, playful, and sarcastic nature. Of European descent. Jin Im-Jin: Speaker of the Universal Free Alliance Senate in Romanova, whom Mycroft calls its Grandpa. Over a hundred years old. Of Korean descent. Hiveless People who, either by choice or by youth, are not part of any Hive. Ⓥ Jehovah Epicurus Donatien D'Arouet "J.E.D.D." Mason: Strange but brilliant. A Graylaw Tribune, Familiaris Candidus, and shadow co-leader of every Hive. Wears all black, unfrilly 18th century clothing. Other names/titles used by various Hives include: Jed, Tai-Kun, Xiao Hei Wang, Jagmohan, T.M., Mike, Porphyrogene, '`Aναξ (Anax). Twenty-one years old. Ⓥ Dominic Seneschal a.k.a. Canis Domini, Hound of the Lord: A polylaw investigator, sensayer, and J.E.D.D. Mason's abrasive personal valet. A Blacklaw with aggressive, anachronistic style: brown hair in a ribboned ponytail, all-black 18th century European clothes, and a rapier. Leader of the Mitsubishi Hive, though not a member. A female assigned 'he' pronouns; intensely masculine in gender expression. Ⓥ "Madame" Joyce Faust D'Arouet: J.E.D.D. Mason's biological mother and madam of the Gendered Sex Club.Blacklaw. Wears a large white wig, elaborate gowns, many gems, and doll-like makeup. Ⓥ Saladin: Mycroft's ba'sib, lover, and secret accomplice. Thought dead since childhood by all but Mycroft. Wears Apollo Mojave's Utopian coat, full of weapons. Of Greek descent. Ⓥ Heloïse D'Arouet: a nun who lives at Madame's, devoted to J.E.D.D. Mason. Ⓥ Castel Natekari: The Rumormonger of Hobbestown and Blacklaw Tribune. Baker, retired leader of the Algheni Group. Has black hair and a scar on her left cheek. Of Indian descent. Ⓥ Outis: A Servicer, Mycroft's protégé, (fictional) editor of the series, and the Ninth Anonymous (9A). Their crime was murdering the murderers of their ba'sib. Formerly Humanist. Of Greek descent. Humanist Hive ◎ Ganymede Jean-Louis de la Trémouïlle: former Duke President of the Humanist Hive. Brother of Danaë Marie-Anne de la Trémouïlle. He wears ostentatious 18th century garb to complement his blue eyes and golden shoulder-length hair. Of French descent. Ⓥ Vivien Ancelet: President of the Humanist Hive. Formerly Censor and Anonymous. Spouse of Bryar Kosala. Wears slim, shoulder-length dreadlocks. His Humanist boot material resembles old parchment with two layers of script and have Olympic medal and French nation-strat stripes around the soles. Of French and African descent. ◎ Aesop Quarriman: The one unelected Humanist Senator chosen annually by heroics. Originator of the bull's eye symbol. Born in Antarctica. Her Humanist boots are fitted polymer for protection and mobility, with many Olympic medal stripes. The Saneer-Weeksbooth bash'house (family) A Humanist bash' which invented the global flying car system and has run it for almost 400 years. Their home and headquarters is in the "Spectacle City" of Cielo de Pájaros, Chile. The current members' parents and predecessors all recently died in a white-water rafting accident. ◎ Ockham Prospero Saneer: former leader of the Saneer-Weeksbooth bash'. Quite muscular and knightly, Ockham possesses the extremely rare right to use lethal force. His Humanist boots are steel and leather. Of Indian and possibly Mestizo descent. Thisbe Ottila Saneer: another of Bridger's secret protectors and a witch. Besides helping her bash' run the cars, Thisbe is an award-winning "smelltrack" creator for movies. Black-haired, dark-skinned, and confident. Her Humanist boots depict a mountainous brush-pen landscape. Of Indian and possibly Mestizo descent. ◎ Ojiro Cardigan Sniper: leader of the Saneer-Weeksbooths, a world-famous athlete, performance artist, model, and professional living doll. Sniper is genderfluid and intersex, assigned 'it' pronouns. Sniper's Humanist boots are leather rimmed with metallic stripes for his Olympic medals. Of Japanese, European, and South American descent. Eureka Weeksbooth: a Cartesian set-set who directly interfaces with the car system data via sight, sound, smell, touch, temperature, and taste. Female and assigned 'they' pronouns. Of Chinese descent. ◎ Lesley Juniper Sniper Saneer: adopted by the Saneer-Weeksbooths after her own bash' was killed in a flying car accident. A compulsive doodler. Ockham's spouse. Energetic, with curly black hair. Her Humanist boots are made of screen cloth, on which doodles change every day. Of Chinese and African ancestry. Masonic Hive Ⓥ Cornel Semaphoros MASON: Emperor. Black-haired and bronze-skinned, he wears a square-breasted suit in an exclusive shade of iron gray. His black right sleeve indicates his sole right to order execution. His left foot is prosthetic, the original having been removed during the Masonic Testing of the Successor. Ⓥ Mycroft 'Martin' Guildbreaker: A polylaw investigator for Romanova and Minister to J.E.D.D. Mason. A Familiaris Regni, member of Ordo Vitae Dialogorum and Nepos, one of the Emperor's inner circle and absolute subject of his will. Thirty-two years old. Of Persian descent. Ⓥ Xiaoliu Guildbreaker: Martin's spouse. Born Mitsubishi, he is the first non-Mason to join the Guildbreaker bash' in generations. The Masonic judge in Ockham Saneer's terra ignota trial. A Familiaris Regni and member of Ordo Vitae Dialogorum. A female assigned 'he' pronouns. Charlemagne Guildbreaker, Sr.: A well-respected Alliance Senator, whom Mycroft calls the Senate's Grandma. A Familiaris Regni. Martin's grandparent. Bearded. Of Persion descent. A male assigned 'she' pronouns. Mitsubishi Hive Hotaka Andō Mitsubishi: former Chief Director of the Mitsubishi Executive Directorate, husband of Danaë Marie-Anne de la Trémouïlle. Of Japanese descent. Danaë Marie-Anne de la Trémouïlle Mitsubishi: A world famous beauty, incredibly adept at social manipulation and gentle interrogation. Named for the Danaë of Greek mythology. Blonde-haired and blue-eyed. Intensely and expressively feminine. Of French descent. Utopian Hive Ⓥ Aldrin Bester: A Utopian investigator, wears a coat depicting a space city. A Familiaris Candidus, in the Emperor's inner circle but not subject to his capital powers. Named for astronaut Buzz Aldrin and science fiction author Alfred Bester. Ⓥ Voltaire Seldon: A Utopian investigator, wears a coat depicting swampy ruins. A Familiaris Candidus, in the Emperor's inner circle but not subject to his capital powers. Named for philosopher Voltaire and economist Arthur Seldon. Mushi Mojave: First entomologist on Mars, wears a coat depicting billions of ants. One of Apollo's ba'pas. Huxley Mojave: Mycroft's Utopian guard. Voted to abandon Earth and lost, but was made ambassador anyway. Wears a coat of storms. ◎ Tully Mardi/Mojave: The last surviving Mardi, hidden by the Utopians in Luna City on the Moon for the thirteen years since the murder spree. Graylaw Hiveless. Tall and dependent on crutches from growing up in low gravity. Nine years younger than Mycroft. Cato Weeksbooth: A brilliant but unstable science teacher and assassin. Volunteer at the Museum of Science and Industry (Chicago), teaching children. Formerly Humanist. Of Chinese descent. Reception Publishers Weekly praised the novel's, "wry humor and the ingenious depth." Paul Di Filippo of Locus said readers will, "enjoy the mental and emotional workout." The Washington Book Review praised the book as "Innovative, mesmerizing and full of fun." Barnes & Noble wrote that it is, "transformative, challenging, and engaging." Kirkus Reviews wrote, "Still intriguing and worth pursuing, but the strain may be beginning to show." Liz Bourke of Tor.com suggested the book is more a philosophical/political exploration couched in novelization, writing, "Ambitious, certainly. Interesting? Yes. Successful? Not, at least, as a novel." 2016 science fiction novels 2016 American novels American science fiction novels Metafictional novels Novels set in the 25th century Philosophical novels Novels about religion Novels by Ada Palmer American LGBT novels Utopian fiction Literature by women Dystopian fiction Science fiction novel series
[ 101, 1109, 3100, 1106, 2651, 1110, 1103, 1503, 2281, 1107, 19810, 146, 25566, 1777, 117, 170, 14818, 1104, 2598, 4211, 5520, 1118, 1103, 1237, 2351, 19222, 8450, 119, 1135, 1108, 1502, 1113, 1382, 1627, 117, 1504, 119, 1135, 1108, 170, 12039, 1111, 1103, 1857, 10605, 6697, 1698, 1111, 1798, 2444, 17355, 6617, 1633, 16912, 119, 1135, 1110, 11983, 1118, 6466, 2409, 1103, 13479, 113, 1446, 114, 1105, 5334, 17078, 5123, 10097, 113, 1504, 114, 119, 1135, 1110, 1723, 1118, 5203, 1103, 6200, 113, 17881, 1475, 114, 119, 9617, 1107, 1103, 1214, 23067, 1527, 117, 1103, 2746, 1104, 1103, 19810, 146, 25566, 1777, 14818, 1144, 1562, 1317, 3944, 1104, 1485, 118, 1703, 3519, 1105, 16286, 117, 1133, 1110, 7963, 1106, 1301, 1106, 1594, 119, 1109, 3100, 1106, 2651, 8218, 2111, 1112, 170, 26539, 1104, 1343, 4265, 13936, 7867, 6006, 1105, 13751, 119, 1135, 1110, 19537, 1118, 2191, 118, 14900, 26641, 12790, 1422, 12012, 2825, 2511, 117, 170, 8431, 117, 15881, 117, 1105, 21122, 1181, 4771, 1150, 1510, 3411, 1103, 1362, 112, 188, 1211, 3110, 3478, 119, 9617, 1916, 8445, 2815, 1144, 1521, 1106, 1103, 16889, 1104, 170, 1485, 118, 190, 24696, 1179, 5404, 1425, 119, 1438, 117, 1103, 14696, 1621, 1741, 2114, 117, 1216, 1112, 1166, 3735, 1104, 1657, 117, 1416, 117, 1105, 2467, 117, 1144, 13936, 27810, 1154, 13751, 1111, 170, 4265, 1594, 119, 3473, 1175, 1127, 2786, 1978, 8790, 5710, 117, 1152, 1138, 1296, 4707, 1154, 1207, 12711, 2344, 1137, 7322, 119, 1109, 3100, 1106, 2651, 2274, 1282, 1166, 170, 1277, 2039, 1551, 10224, 1190, 1103, 2166, 1160, 2146, 3490, 119, 1109, 1958, 4467, 1206, 1364, 129, 1105, 1347, 127, 117, 23067, 1527, 117, 1105, 1127, 1637, 1206, 1351, 127, 1105, 1347, 1489, 117, 23067, 1527, 119, 21108, 1174, 1846, 1650, 12973, 117, 1593, 1155, 2650, 1329, 5772, 118, 8795, 1846, 117, 1114, 107, 1152, 120, 1172, 107, 1103, 23375, 5250, 2728, 3488, 1215, 119, 1422, 12012, 117, 1103, 2425, 12790, 117, 4090, 1117, 1362, 112, 188, 21243, 1114, 5772, 118, 25449, 11769, 16568, 117, 1177, 1510, 2745, 5772, 1174, 5250, 2728, 17096, 1106, 5991, 1106, 1168, 2650, 117, 27430, 1158, 5772, 1116, 1359, 1113, 1103, 2650, 112, 13497, 1105, 3573, 117, 1112, 1152, 15123, 1106, 2361, 2102, 5772, 3573, 119, 1370, 5374, 117, 24705, 18708, 1182, 1110, 2752, 1106, 1606, 107, 1131, 120, 1123, 107, 5250, 2728, 17096, 1272, 1104, 1147, 9250, 117, 11160, 5800, 118, 1176, 3220, 1165, 8547, 1147, 7502, 1121, 2035, 119, 1109, 2351, 1144, 3716, 1115, 1422, 12012, 3933, 107, 1940, 24784, 1116, 107, 5772, 1174, 5250, 2728, 17096, 117, 1198, 1112, 1234, 1107, 1842, 1297, 1510, 1294, 12572, 1165, 1606, 5772, 118, 8795, 5250, 2728, 17096, 119, 2907, 117, 1107, 1157, 6073, 1120, 1103, 1838, 1104, 5334, 17078, 5123, 10097, 117, 156, 2605, 3365, 19961, 1116, 1103, 9728, 1106, 1136, 107, 3496, 1103, 5772, 1174, 5250, 2728, 17096, 1422, 12012, 3114, 1234, 117, 1152, 1155, 1435, 1121, 10889, 107, 119, 1422, 12012, 2121, 9544, 1103, 5772, 1174, 5250, 2728, 17096, 1119, 3114, 2650, 119, 1370, 5374, 117, 19879, 1513, 1110, 2426, 2752, 1106, 1606, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Pau Cunill Clapés (born 4 January 2000) is a field hockey player from Spain, who plays as a Defender. Personal life Pau Cunill has a younger brother, Pepe, who also plays field hockey for Spain. Career Club level In the Spanish División de Honor, Cunill plays for Atlètic Terrassa. Spain Under–21 Cunill made his debut for the Spain U–21 team in 2021, at the FIH Junior World Cup in Bhubaneswar. Los Redsticks In 2022 Cunill made his debut for Los Redsticks in a test match against the Netherlands in Cádiz. He was later named in the national squad for season three of the FIH Pro League. References External links Pau Cunill at the European Hockey Federation 2000 births Living people Male field hockey defenders Spanish male field hockey players
[ 101, 19585, 1358, 140, 19782, 2339, 140, 16046, 10051, 113, 1255, 125, 1356, 1539, 114, 1110, 170, 1768, 4700, 1591, 1121, 2722, 117, 1150, 2399, 1112, 170, 3177, 27896, 119, 13907, 1297, 19585, 1358, 140, 19782, 2339, 1144, 170, 3247, 1711, 117, 153, 8043, 1162, 117, 1150, 1145, 2399, 1768, 4700, 1111, 2722, 119, 17062, 1998, 1634, 1130, 1103, 2124, 12583, 1260, 7337, 117, 140, 19782, 2339, 2399, 1111, 1335, 1233, 27113, 2941, 19810, 11655, 119, 2722, 2831, 782, 1626, 140, 19782, 2339, 1189, 1117, 1963, 1111, 1103, 2722, 158, 782, 1626, 1264, 1107, 17881, 1475, 117, 1120, 1103, 143, 2240, 3048, 3800, 1291, 1635, 1107, 139, 6583, 7167, 1279, 7200, 119, 2238, 13694, 27252, 1116, 1130, 17881, 1477, 140, 19782, 2339, 1189, 1117, 1963, 1111, 2238, 13694, 27252, 1116, 1107, 170, 2774, 1801, 1222, 1103, 3706, 1107, 140, 5589, 3309, 1584, 119, 1124, 1108, 1224, 1417, 1107, 1103, 1569, 4322, 1111, 1265, 1210, 1104, 1103, 143, 2240, 3048, 5096, 1453, 119, 19714, 1116, 22841, 6743, 19585, 1358, 140, 19782, 2339, 1120, 1103, 1735, 5109, 4245, 1539, 20665, 7932, 1234, 10882, 1768, 4700, 15024, 2124, 2581, 1768, 4700, 2139, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Charles Nalden (born John Leslie Simpson; 16 March 1908 – 17 June 2002) was a British and New Zealand musician and professor at the University of Auckland. Born out of wedlock, at the age of 29 days Nalden was accepted into the Thomas Coram Foundation for Children and his birth name was changed. For 25 years, from the age of 14, he was in the British Army rising to bandmaster. Three months before his 40th birthday, he arrived in Auckland, New Zealand, to join the academic staff of the then Auckland University College, later the University of Auckland, where he rose to professor in 1956. He remained there until his retirement in 1974, and was conferred with the title of professor emeritus. Honours In the 1976 Birthday Honours, Nalden was appointed a Commander of the Order of the British Empire, for services to music. References 1908 births 2002 deaths Musicians from London British musicians British emigrants to New Zealand New Zealand musicians University of Auckland faculty New Zealand Commanders of the Order of the British Empire
[ 101, 1889, 11896, 20937, 1179, 113, 1255, 1287, 8521, 8989, 132, 1479, 1345, 4536, 782, 1542, 1340, 1617, 114, 1108, 170, 1418, 1105, 1203, 2512, 4933, 1105, 3083, 1120, 1103, 1239, 1104, 8279, 119, 3526, 1149, 1104, 26055, 6726, 117, 1120, 1103, 1425, 1104, 1853, 1552, 11896, 20937, 1179, 1108, 3134, 1154, 1103, 1819, 18805, 1306, 2974, 1111, 4288, 1105, 1117, 3485, 1271, 1108, 2014, 119, 1370, 1512, 1201, 117, 1121, 1103, 1425, 1104, 1489, 117, 1119, 1108, 1107, 1103, 1418, 1740, 4703, 1106, 1467, 6532, 119, 2677, 1808, 1196, 1117, 17583, 5913, 117, 1119, 2474, 1107, 8279, 117, 1203, 2512, 117, 1106, 2866, 1103, 3397, 2546, 1104, 1103, 1173, 8279, 1239, 1531, 117, 1224, 1103, 1239, 1104, 8279, 117, 1187, 1119, 3152, 1106, 3083, 1107, 2990, 119, 1124, 1915, 1175, 1235, 1117, 4406, 1107, 2424, 117, 1105, 1108, 16104, 1114, 1103, 1641, 1104, 3083, 24055, 119, 14670, 1130, 1103, 2402, 16168, 14670, 117, 11896, 20937, 1179, 1108, 1923, 170, 4350, 1104, 1103, 2864, 1104, 1103, 1418, 2813, 117, 1111, 1826, 1106, 1390, 119, 19714, 1116, 4536, 20665, 1617, 6209, 24108, 1121, 1498, 1418, 4992, 1418, 9712, 6512, 18937, 1106, 1203, 2512, 1203, 2512, 4992, 1239, 1104, 8279, 5449, 1203, 2512, 4350, 1116, 1104, 1103, 2864, 1104, 1103, 1418, 2813, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Roy Sarles Durstine (December 13, 1886 – November 28, 1962) was an American newspaper reporter, author, and advertising executive who founded three eponymous advertising agencies, including Barton, Durstine & Osborn (now BBDO) and Roy S. Durstine Inc. Early life Durstine was born on December 13, 1886, in Jamestown, N.D. He attended Lawrenceville School and graduated from Princeton University in 1908. While at Princeton, Durstine chaired the humor magazine, The Princeton Tiger and was president of the Triangle Club theatre troupe; he was also a member of the Cap and Gown Club. After graduating from Princeton, Durstine worked briefly as a reporter for the New York Sun, before taking a job as public-relations director for Theodore Roosevelt's 1912 presidential campaign on the "Bull Moose" ticket. After the election, he went into the advertising business, first working for firm of Calkins & Holden, then co-founding (with James Berrien) the firm of Berrien & Durstine, which lasted from 1914 to 1918. BBDO years With Bruce Barton and Alex F. Osborn, Durstine founded the firm of Barton, Durstine & Osborn (BD&O) in 1918. Ten years later, in September, 1928, BD&O merged with the George Batten Company to form Batten, Barton, Durstine & Osborn, and Durstine became vice-president and general manager of the combined firm. In 1932, Durstine married Virginia Gardiner, a concert singer from Philadelphia. The Durstines honeymooned in Europe, and upon their return, Roy Durstine published a book, Red Thunder, describing his impressions of Austria, Germany, and Russia. The Durstines had a son, Roy Jr., in 1935. (Roy Durstine had two daughters by a previous marriage, Harriet and Kathrine.) Durstine succeeded William H. Johns as president of BBDO in 1936. In April, 1939, Durstine resigned from BBDO and was replaced as president by Bruce Barton. After BBDO After leaving BBDO, Durstine spent two months consulting for General Motors, The New York Times, and NBC, before announcing that he was forming his own agency, Roy S. Durstine, Inc., in July, 1939. Durstine died on November 28, 1962, at Doctors Hospital in Manhattan, aged 75. Works Durstine was the author of several books: Making Advertisements and Making Them Pay (Scribner, 1920) Translated into German as Reklame, die lohnt by Theodor König and Irene Witte (R. Oldenburg, 1926; reissued by De Gruyter, ) This Advertising Business (Scribner, 1928) Red Thunder (Scribner, 1934) References 1886 births 1962 deaths American advertising executives Lawrenceville School alumni People from Jamestown, North Dakota Princeton University alumni
[ 101, 5396, 17784, 15576, 1116, 12786, 9731, 2042, 113, 1382, 1492, 117, 6332, 782, 1379, 1743, 117, 2832, 114, 1108, 1126, 1237, 3054, 6672, 117, 2351, 117, 1105, 6437, 3275, 1150, 1771, 1210, 16105, 6437, 6421, 117, 1259, 13235, 117, 12786, 9731, 2042, 111, 152, 1116, 7107, 113, 1208, 139, 2064, 2137, 2346, 114, 1105, 5396, 156, 119, 12786, 9731, 2042, 3561, 119, 4503, 1297, 12786, 9731, 2042, 1108, 1255, 1113, 1382, 1492, 117, 6332, 117, 1107, 1600, 3305, 117, 151, 119, 141, 119, 1124, 2323, 4898, 2138, 1323, 1105, 3024, 1121, 8845, 1239, 1107, 4536, 119, 1799, 1120, 8845, 117, 12786, 9731, 2042, 12624, 1103, 8594, 2435, 117, 1109, 8845, 8134, 1105, 1108, 2084, 1104, 1103, 20742, 1998, 4041, 19338, 132, 1119, 1108, 1145, 170, 1420, 1104, 1103, 17212, 1105, 3414, 6540, 1998, 119, 1258, 6282, 1121, 8845, 117, 12786, 9731, 2042, 1589, 4016, 1112, 170, 6672, 1111, 1103, 1203, 1365, 3477, 117, 1196, 1781, 170, 2261, 1112, 1470, 118, 4125, 1900, 1111, 10408, 8189, 112, 188, 4080, 5200, 2322, 1113, 1103, 107, 9255, 25183, 107, 7260, 119, 1258, 1103, 1728, 117, 1119, 1355, 1154, 1103, 6437, 1671, 117, 1148, 1684, 1111, 3016, 1104, 11917, 9615, 111, 9792, 117, 1173, 1884, 118, 4263, 113, 1114, 1600, 4108, 19480, 1179, 114, 1103, 3016, 1104, 4108, 19480, 1179, 111, 12786, 9731, 2042, 117, 1134, 5695, 1121, 3710, 1106, 3428, 119, 139, 2064, 2137, 2346, 1201, 1556, 4767, 13235, 1105, 3230, 143, 119, 152, 1116, 7107, 117, 12786, 9731, 2042, 1771, 1103, 3016, 1104, 13235, 117, 12786, 9731, 2042, 111, 152, 1116, 7107, 113, 139, 2137, 111, 152, 114, 1107, 3428, 119, 5157, 1201, 1224, 117, 1107, 1347, 117, 3825, 117, 139, 2137, 111, 152, 4564, 1114, 1103, 1667, 21928, 5208, 1881, 1106, 1532, 21928, 5208, 117, 13235, 117, 12786, 9731, 2042, 111, 152, 1116, 7107, 117, 1105, 12786, 9731, 2042, 1245, 4711, 118, 2084, 1105, 1704, 2618, 1104, 1103, 3490, 3016, 119, 1130, 3833, 117, 12786, 9731, 2042, 1597, 2550, 23272, 117, 170, 3838, 2483, 1121, 3562, 119, 1109, 12786, 9731, 8515, 25619, 1174, 1107, 1980, 117, 1105, 1852, 1147, 1862, 117, 5396, 12786, 9731, 2042, 1502, 170, 1520, 117, 2156, 10798, 117, 7645, 1117, 25263, 1104, 4318, 117, 1860, 117, 1105, 2733, 119, 1109, 12786, 9731, 8515, 1125, 170, 1488, 117, 5396, 3108, 119, 117, 1107, 3588, 119, 113, 5396, 12786, 9731, 2042, 1125, 1160, 5421, 1118, 170, 2166, 2742, 117, 14766, 1105, 10785, 8167, 2042, 119, 114, 12786, 9731, 2042, 3760, 1613, 145, 119, 11673, 1112, 2084, 1104, 139, 2064, 2137, 2346, 1107, 3419, 119, 1130, 1364, 117, 3061, 117, 12786, 9731, 2042, 4603, 1121, 139, 2064, 2137, 2346, 1105, 1108, 2125, 1112, 2084, 1118, 4767, 13235, 119, 1258, 139, 2064, 2137, 2346, 1258, 2128, 139, 2064, 2137, 2346, 117, 12786, 9731, 2042, 2097, 1160, 1808, 12421, 1111, 1615, 13931, 117, 1109, 1203, 1365, 2706, 117, 1105, 6181, 117, 1196, 14563, 1115, 1119, 1108, 5071, 1117, 1319, 4792, 117, 5396, 156, 119, 12786, 9731, 2042, 117, 3561, 119, 117, 1107, 1351, 117, 3061, 119, 12786, 9731, 2042, 1452, 1113, 1379, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
The 2022 African Women's Youth Handball Championship will be held in Conakry, Guinea from 27 February to 4 March 2022. It will also act as the qualification tournament for the 2022 Women's Youth World Handball Championship to be held in Georgia. Results All times are local (UTC±0). References 2022 in African handball African Women's Youth Handball Championship International handball competitions hosted by Guinea African Youth Youth Sport in Conakry African Women's Youth Handball Championship African Women's Youth Handball Championship African Women's Youth Handball Championship
[ 101, 1109, 17881, 1477, 2170, 2453, 112, 188, 4866, 25283, 1935, 1209, 1129, 1316, 1107, 16752, 3715, 1616, 117, 6793, 1121, 1765, 1428, 1106, 125, 1345, 17881, 1477, 119, 1135, 1209, 1145, 2496, 1112, 1103, 8969, 2348, 1111, 1103, 17881, 1477, 2453, 112, 188, 4866, 1291, 25283, 1935, 1106, 1129, 1316, 1107, 3260, 119, 16005, 1398, 1551, 1132, 1469, 113, 11390, 28168, 1568, 114, 119, 19714, 1116, 17881, 1477, 1107, 2170, 17678, 2170, 2453, 112, 188, 4866, 25283, 1935, 1570, 17678, 6025, 3567, 1118, 6793, 2170, 4866, 4866, 7331, 1107, 16752, 3715, 1616, 2170, 2453, 112, 188, 4866, 25283, 1935, 2170, 2453, 112, 188, 4866, 25283, 1935, 2170, 2453, 112, 188, 4866, 25283, 1935, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Assam Valley Party was founded by Muhammed Saadulah, the first Prime Minister of Assam in 1937. It was the second largest political party after Indian National Congress during 1937–1946 in Assam. It formed government three times in Assam Province, in 1937, 1939 and in 1942. Prime Minister of Assam References Islamic political parties in India Conservative parties in India 1900s in Islam Muslim League
[ 101, 15984, 2634, 1786, 1108, 1771, 1118, 19569, 2522, 4611, 17784, 3556, 5886, 1324, 117, 1103, 1148, 3460, 2110, 1104, 15984, 1107, 3493, 119, 1135, 1108, 1103, 1248, 2026, 1741, 1710, 1170, 1890, 1305, 2757, 1219, 3493, 782, 3064, 1107, 15984, 119, 1135, 1824, 1433, 1210, 1551, 1107, 15984, 2715, 117, 1107, 3493, 117, 3061, 1105, 1107, 2889, 119, 3460, 2110, 1104, 15984, 19714, 1116, 4769, 1741, 3512, 1107, 1726, 5739, 3512, 1107, 1726, 17446, 1107, 6489, 4360, 1453, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Cristian Câmpean (born 22 April 2003) is a Romanian professional footballer who plays as a midfielder for Liga I side Gaz Metan Mediaș. References External links 2003 births Living people People from Mediaș Romanian footballers Association football midfielders Liga I players CS Gaz Metan Mediaș players
[ 101, 140, 12937, 1811, 140, 28198, 8223, 7766, 113, 1255, 1659, 1364, 1581, 114, 1110, 170, 6481, 1848, 3585, 1150, 2399, 1112, 170, 8852, 1111, 7837, 146, 1334, 144, 10961, 19415, 1389, 3957, 24158, 119, 19714, 1116, 22841, 6743, 1581, 20665, 7932, 1234, 2563, 1121, 3957, 24158, 6481, 3585, 1116, 1791, 1709, 8852, 1116, 7837, 146, 2139, 24821, 144, 10961, 19415, 1389, 3957, 24158, 2139, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
The Voice Kids is a Polish reality music talent show for aspiring singers aged 8 to 14, airing on TVP 2. The fifth season premiered on February 26, 2022. Tomson & Baron, Dawid Kwiatkowski and Cleo will return as the coaches. Tomasz Kammel returned as host, alongside Ida Nowakowska-Herndon. Coaches Teams Colour key Blind auditions Color key Episode 1 (February 26, 2022) Episode 2 (February 26, 2022) Episode 3 (March 5, 2022) Episode 4 (March 5, 2022) Episode 5 (March 12, 2022) Episode 6 (March 12, 2022) Episode 7 (March 19, 2022) Episode 8 (March 19, 2022) Episode 9 (March 26, 2022) Episode 10 (March 26, 2022) The Battle Rounds Color key Episode 11: Team Cleo (April 2, 2022) Sing offs Episode 12: Team Dawid (April 9, 2022) Sing offs Episode 13: Team Tomson & Baron (April 16, 2022) Sing offs Episode 14 Finale Color key Round 1 (April 23, 2021) Each contestant performed a duet with their judge. Round 2 (April 23, 2021) Each contestant performed a cover and their original song. Elimination chart Colour key Artist's info Result details Teams Color key Artist's info Results details The Voice of Poland
[ 101, 1109, 7900, 9904, 1110, 170, 3129, 3958, 1390, 5939, 1437, 1111, 25850, 9500, 4079, 129, 1106, 1489, 117, 10477, 1113, 1794, 2101, 123, 119, 1109, 3049, 1265, 5281, 1113, 1428, 1744, 117, 17881, 1477, 119, 2545, 2142, 111, 5483, 117, 10136, 10073, 1181, 148, 10073, 2980, 17445, 1105, 140, 26918, 1209, 1862, 1112, 1103, 8648, 119, 19549, 1584, 14812, 12140, 1233, 1608, 1112, 2989, 117, 3338, 19022, 1986, 3715, 11997, 1968, 118, 1430, 17996, 119, 22322, 11912, 25809, 2501, 13955, 27503, 13066, 2501, 8112, 122, 113, 1428, 1744, 117, 17881, 1477, 114, 8112, 123, 113, 1428, 1744, 117, 17881, 1477, 114, 8112, 124, 113, 1345, 126, 117, 17881, 1477, 114, 8112, 125, 113, 1345, 126, 117, 17881, 1477, 114, 8112, 126, 113, 1345, 1367, 117, 17881, 1477, 114, 8112, 127, 113, 1345, 1367, 117, 17881, 1477, 114, 8112, 128, 113, 1345, 1627, 117, 17881, 1477, 114, 8112, 129, 113, 1345, 1627, 117, 17881, 1477, 114, 8112, 130, 113, 1345, 1744, 117, 17881, 1477, 114, 8112, 1275, 113, 1345, 1744, 117, 17881, 1477, 114, 1109, 2651, 4200, 1116, 13066, 2501, 8112, 1429, 131, 2649, 140, 26918, 113, 1364, 123, 117, 17881, 1477, 114, 13315, 12822, 8112, 1367, 131, 2649, 10136, 10073, 1181, 113, 1364, 130, 117, 17881, 1477, 114, 13315, 12822, 8112, 1492, 131, 2649, 2545, 2142, 111, 5483, 113, 1364, 1479, 117, 17881, 1477, 114, 13315, 12822, 8112, 1489, 3788, 1162, 13066, 2501, 4200, 122, 113, 1364, 1695, 117, 17881, 1475, 114, 2994, 11201, 1982, 170, 13401, 1114, 1147, 3942, 119, 4200, 123, 113, 1364, 1695, 117, 17881, 1475, 114, 2994, 11201, 1982, 170, 2267, 1105, 1147, 1560, 1461, 119, 12224, 9204, 3481, 25809, 2501, 7633, 112, 188, 23992, 11336, 24661, 1204, 4068, 11912, 13066, 2501, 7633, 112, 188, 23992, 16005, 4068, 1109, 7900, 1104, 2870, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Ștefan Vellescu (December 24, 1838–October 2, 1899) was a Romanian stage actor and drama teacher. Born in Craiova, he ran away from school at age 16, joining the local troupe of Costache Mihăileanu. Removed thence by his family and sent to continue his education in Bucharest, he again fled shortly afterward, appearing in minor theatrical roles. He then joined Matei Millo’s troupe at Sala Bossel. Four years later, Vellescu entered Elena Theodorini’s company at Craiova, earning plaudits in roles from Caterina Howard (Errico Petrella), La Dame aux Camélias (Alexandre Dumas fils), Othello (William Shakespeare) and Les Filles de marbre (Théodore Barrière), as well as playing the lead in Alfred de Vigny’s Chatterton. Vellescu then returned to Bucharest, subsequently moving to Iași, where he played in Don César de Bazan (Jules Massenet) and The Barber of Seville (Pierre Beaumarchais). Briefly stopping in Bucharest again, he played the title role in V. A. Urechia’s Vornicul Bucioc. In 1867, sent by Urechia, he left for Paris, studying drama under François-Joseph Regnier. Three years later, he returned to the stage, distinguishing himself in Le Supplice d'une femme (Dumas fils), King John (Shakespeare) and Le gamin de Paris (Jean-François Bayard), the latter in 1877. In 1873, Vellescu was named professor of declamation at the Bucharest Conservatory, where his students included Grigore Manolescu, Constantin I. Nottara and Ion Brezeanu. Among his publications are Istoria artei dra­matice in Revista românească and Curs de declamațiune in Revista literară, as well as criticism. He wrote several dramas and comedies that appeared at the National Theatre Bucharest, where he was assistant director: Lăpușneanul, Banul Craiovei, Prea târziu, Mincinosul (in which Aristizza Romanescu played), Blond sau Brun and Hagi-Bina. He authored several poems and short stories, including “Din Florești”, “Moș Tudor” and “Schițe din viața contimporană”. He served on the Bucharest City Council and, from 1890 to 1895, was employed by the vital records division. Notes 1838 births 1899 deaths Romanian male stage actors 19th-century Romanian male actors Romanian male Shakespearean actors Romanian theatre critics Romanian theatre managers and producers People from Craiova National University of Music Bucharest faculty Romanian civil servants Councillors in Romania 19th-century Romanian dramatists and playwrights ro:Ștefan Vellescu
[ 101, 349, 1566, 16740, 159, 18840, 10182, 113, 1382, 1572, 117, 9702, 782, 1357, 123, 117, 5493, 114, 1108, 170, 6481, 2016, 2811, 1105, 3362, 3218, 119, 3526, 1107, 140, 14089, 8625, 117, 1119, 1868, 1283, 1121, 1278, 1120, 1425, 1479, 117, 4577, 1103, 1469, 19338, 1104, 7176, 4386, 12107, 1324, 15287, 4759, 19762, 119, 11336, 3702, 5790, 26972, 1118, 1117, 1266, 1105, 1850, 1106, 2760, 1117, 1972, 1107, 14806, 117, 1119, 1254, 6192, 3992, 11343, 117, 5452, 1107, 3137, 9033, 3573, 119, 1124, 1173, 1688, 25702, 6851, 7664, 1186, 787, 188, 19338, 1120, 18613, 1161, 15103, 1883, 119, 3396, 1201, 1224, 117, 159, 18840, 10182, 2242, 8712, 23704, 4729, 787, 188, 1419, 1120, 140, 14089, 8625, 117, 6957, 185, 15554, 17903, 1116, 1107, 3573, 1121, 8572, 18866, 4115, 113, 142, 14791, 2528, 25993, 23482, 114, 117, 2001, 8022, 24544, 14805, 2744, 4567, 1116, 113, 18094, 12786, 7941, 20497, 3447, 114, 117, 152, 10681, 6643, 113, 1613, 7647, 114, 1105, 5214, 17355, 12132, 1260, 12477, 26281, 1874, 113, 157, 1324, 2744, 5412, 4474, 21715, 19999, 114, 117, 1112, 1218, 1112, 1773, 1103, 1730, 1107, 5492, 1260, 159, 11368, 1183, 787, 188, 24705, 8634, 1633, 119, 159, 18840, 10182, 1173, 1608, 1106, 14806, 117, 2886, 2232, 1106, 146, 1161, 24158, 1182, 117, 1187, 1119, 1307, 1107, 1790, 21730, 1260, 18757, 14883, 113, 11011, 8718, 7582, 1204, 114, 1105, 1109, 16785, 1104, 20768, 113, 4855, 21477, 7317, 7147, 1548, 114, 119, 139, 24683, 1193, 7202, 1107, 14806, 1254, 117, 1119, 1307, 1103, 1641, 1648, 1107, 159, 119, 138, 119, 158, 1874, 27018, 787, 188, 159, 8456, 1596, 4654, 139, 21977, 2660, 1665, 119, 1130, 6988, 117, 1850, 1118, 158, 1874, 27018, 117, 1119, 1286, 1111, 2123, 117, 5076, 3362, 1223, 8465, 118, 2419, 23287, 12682, 119, 2677, 1201, 1224, 117, 1119, 1608, 1106, 1103, 2016, 117, 23902, 1471, 1107, 3180, 15463, 8661, 11815, 173, 112, 25731, 175, 5521, 3263, 113, 12786, 7941, 20497, 3447, 114, 117, 1624, 1287, 113, 7647, 114, 1105, 3180, 176, 11787, 1179, 1260, 2123, 113, 2893, 118, 8465, 2410, 2881, 114, 117, 1103, 2985, 1107, 7028, 119, 1130, 7110, 117, 159, 18840, 10182, 1108, 1417, 3083, 1104, 1260, 17405, 1120, 1103, 14806, 14074, 117, 1187, 1117, 1651, 1529, 144, 17305, 4474, 2268, 9016, 1116, 10182, 117, 16752, 16566, 1394, 146, 119, 1753, 22875, 1105, 19447, 139, 18550, 7766, 1358, 119, 3841, 1117, 5873, 1132, 2181, 14155, 1893, 6851, 7271, 1162, 1107, 6750, 11663, 187, 4165, 27708, 14517, 1665, 15287, 1105, 140, 7719, 1260, 1260, 1665, 7609, 1161, 28273, 19009, 1673, 1107, 6750, 11663, 27146, 1813, 15287, 117, 1112, 1218, 1112, 5879, 119, 1124, 1724, 1317, 18282, 1105, 25795, 1115, 1691, 1120, 1103, 1305, 2872, 14806, 117, 1187, 1119, 1108, 3109, 1900, 131, 149, 15287, 16091, 24158, 25362, 14787, 1233, 117, 18393, 4654, 140, 14089, 18122, 1182, 117, 11689, 1161, 189, 28198, 11819, 19009, 117, 14321, 16430, 2155, 4654, 113, 1107, 1134, 10789, 2050, 9368, 3293, 2264, 22102, 1307, 114, 117, 139, 4934, 1181, 21718, 1358, 139, 10607, 1105, 11679, 5389, 118, 21700, 1161, 119, 1124, 8466, 1317, 6329, 1105, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Jordon Hall is an Australian professional footballer who plays as a defender for Melbourne City whom he signed with in 2020. He previously played for Green Gully. References Living people Melbourne City FC players
[ 101, 8125, 22528, 1944, 1110, 1126, 1925, 1848, 3585, 1150, 2399, 1112, 170, 8919, 1111, 4141, 1392, 2292, 1119, 1878, 1114, 1107, 12795, 119, 1124, 2331, 1307, 1111, 2565, 144, 16125, 119, 19714, 1116, 7932, 1234, 4141, 1392, 3604, 2139, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Ultsch is a German language surname. It stems from a reduced form of the male given name Ulrich – and may refer to: Bernhard Ultsch (1898), German World War I flying ace Detlef Ultsch (1955), former East German judoka References German-language surnames Surnames from given names
[ 101, 158, 24735, 1732, 1110, 170, 1528, 1846, 12239, 119, 1135, 12878, 1121, 170, 3549, 1532, 1104, 1103, 2581, 1549, 1271, 21351, 782, 1105, 1336, 5991, 1106, 131, 23627, 158, 24735, 1732, 113, 5381, 114, 117, 1528, 1291, 1414, 146, 3754, 20839, 27524, 1513, 2087, 158, 24735, 1732, 113, 3115, 114, 117, 1393, 1689, 1528, 179, 18109, 1968, 19714, 1116, 1528, 118, 1846, 12239, 1116, 17078, 16124, 1116, 1121, 1549, 2666, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
The following outline is provided as an overview of and topical guide to Kohima: Kohima – second-largest city in the Indian state of Nagaland. Originally known as Kewhira, Kohima was founded in 1878 when the British Empire established its headquarters of the then Naga Hills District of Assam Province. It officially became the capital after the state of Nagaland was inaugurated in 1963. Kohima was the site of one of the bloodiest battles of World War II. The battle is often referred to as the ‘Stalingrad of the East’. In 2013, the British National Army Museum voted the Battle of Kohima to be ‘Britain's Greatest Battle’. General reference Pronunciation: Common English name(s): Kohima Official English name(s): City of Kohima Nicknames of Kohima: Adjectival(s): Demonym(s): Geography of Kohima Geography of Kohima Kohima is: a city Population of Kohima: Area of Kohima: Atlas of Kohima Location of Kohima Kohima is situated within the following regions: Northern Hemisphere Eastern Hemisphere Eurasia Asia South Asia India Northeast India Nagaland Kohima District Time zone(s): Indian Standard Time (UTC+5:30) Environment of Kohima Climate of Kohima Landforms of Kohima Pulie Badze Areas of Kohima Wards of Kohima Municipal Wards of Kohima The specific wards are listed below. Neighborhoods in Kohima Neighborhoods in Kohima Locations in Kohima Parks and zoos in Kohima Sakhrie Park Historic locations in Kohima Kohima War Cemetery Other Demographics of Kohima Government and politics of Kohima Kohima Municipal Council Nagaland government within Kohima Kohima is the capital of Nagaland, and its branches of government located there are: Raj Bhavan, Kohima History of Kohima History of Kohima History of Kohima, by period History of Kohima, by subject Battle of Kohima 1986 Killing of Kekuojalie Sachü and Vikhozo Yhoshü 1995 Kohima massacre Culture in Kohima Culture of Kohima Architecture of Kohima Kohima Capital Cultural Center Regional Centre of Excellence for Music & Performing Arts Art in Kohima Cinema of Kohima Music of Kohima Religion in Kohima Christianity in Kohima Churches in Kohima Kohima Ao Baptist Church Kohima Lotha Baptist Church Mary Help of Christians Cathedral, Kohima Sports in Kohima Sport in Kohima Football in Kohima Kohima Komets Sort venues in Kohima Indira Gandhi Stadium Economy and infrastructure of Kohima Banking in Kohima Commerce in Kohima Markets in Kohima Communications in Kohima Media in Kohima Newspapers in Kohima Capi Transportation in Kohima Transport in Kohima Air transport in Kohima Kohima Chiethu Airport Rail transit in Kohima Kohima Zubza Railway Station Education in Kohima Education in Kohima Educational Institutions in Kohima Universities in Kohima Nagaland University, Meriema Campus Health in Kohima Hospitals in Kohima Naga Hospital Authority Nagaland Medical College See also Outline of geography References External links Kohima 1
[ 101, 1109, 1378, 13905, 1110, 2136, 1112, 1126, 24431, 1104, 1105, 8366, 1348, 6388, 1106, 19892, 16340, 131, 19892, 16340, 782, 1248, 118, 2026, 1331, 1107, 1103, 1890, 1352, 1104, 11896, 6997, 5709, 119, 5798, 1227, 1112, 26835, 2246, 14518, 1161, 117, 19892, 16340, 1108, 1771, 1107, 6723, 1165, 1103, 1418, 2813, 1628, 1157, 3834, 1104, 1103, 1173, 11896, 2571, 5377, 1574, 1104, 15984, 2715, 119, 1135, 3184, 1245, 1103, 2364, 1170, 1103, 1352, 1104, 11896, 6997, 5709, 1108, 11327, 1107, 2826, 119, 19892, 16340, 1108, 1103, 1751, 1104, 1141, 1104, 1103, 1892, 9102, 7619, 1104, 1291, 1414, 1563, 119, 1109, 2321, 1110, 1510, 2752, 1106, 1112, 1103, 786, 13406, 20561, 1104, 1103, 1689, 787, 119, 1130, 1381, 117, 1103, 1418, 1305, 1740, 2143, 4751, 1103, 2651, 1104, 19892, 16340, 1106, 1129, 786, 2855, 112, 188, 10971, 2651, 787, 119, 1615, 3835, 5096, 14787, 22313, 2116, 131, 6869, 1483, 1271, 113, 188, 114, 131, 19892, 16340, 9018, 1483, 1271, 113, 188, 114, 131, 1392, 1104, 19892, 16340, 3350, 16124, 1116, 1104, 19892, 16340, 131, 24930, 16811, 15895, 113, 188, 114, 131, 16805, 17162, 113, 188, 114, 131, 20678, 1104, 19892, 16340, 20678, 1104, 19892, 16340, 19892, 16340, 1110, 131, 170, 1331, 10858, 1104, 19892, 16340, 131, 3894, 1104, 19892, 16340, 131, 12974, 1104, 19892, 16340, 26316, 1104, 19892, 16340, 19892, 16340, 1110, 3629, 1439, 1103, 1378, 4001, 131, 2579, 24371, 2882, 24371, 142, 4084, 6370, 3165, 1375, 3165, 1726, 12079, 1726, 11896, 6997, 5709, 19892, 16340, 1574, 2614, 4834, 113, 188, 114, 131, 1890, 6433, 2614, 113, 11390, 116, 126, 131, 1476, 114, 9247, 1104, 19892, 16340, 13540, 1104, 19892, 16340, 4026, 13199, 1116, 1104, 19892, 16340, 153, 15818, 1162, 6304, 3171, 20371, 1104, 19892, 16340, 5661, 1116, 1104, 19892, 16340, 7360, 5661, 1116, 1104, 19892, 16340, 1109, 2747, 12551, 1132, 2345, 2071, 119, 151, 6851, 5084, 12207, 5914, 1116, 1107, 19892, 16340, 151, 6851, 5084, 12207, 5914, 1116, 1107, 19892, 16340, 26316, 1116, 1107, 19892, 16340, 10112, 1105, 15003, 1116, 1107, 19892, 16340, 17784, 9862, 5997, 1670, 3700, 4541, 1107, 19892, 16340, 19892, 16340, 1414, 5501, 2189, 3177, 3702, 11293, 1116, 1104, 19892, 16340, 2384, 1105, 4039, 1104, 19892, 16340, 19892, 16340, 7360, 1761, 11896, 6997, 5709, 1433, 1439, 19892, 16340, 19892, 16340, 1110, 1103, 2364, 1104, 11896, 6997, 5709, 117, 1105, 1157, 5020, 1104, 1433, 1388, 1175, 1132, 131, 12707, 139, 2328, 5242, 117, 19892, 16340, 2892, 1104, 19892, 16340, 2892, 1104, 19892, 16340, 2892, 1104, 19892, 16340, 117, 1118, 1669, 2892, 1104, 19892, 16340, 117, 1118, 2548, 2651, 1104, 19892, 16340, 2177, 19949, 1104, 26835, 4786, 26840, 7174, 17784, 1732, 17176, 1105, 159, 4847, 5114, 6112, 162, 15342, 1324, 17176, 1876, 19892, 16340, 11584, 6076, 1107, 19892, 16340, 6076, 1104, 19892, 16340, 9021, 1104, 19892, 16340, 19892, 16340, 6299, 6651, 1945, 4723, 2961, 1104, 10600, 1111, 1953, 111, 14005, 2334, 2051, 1107, 19892, 16340, 10371, 1104, 19892, 16340, 1953, 1104, 19892, 16340, 11893, 1107, 19892, 16340, 7522, 1107, 19892, 16340, 13701, 1107, 19892, 16340, 19892, 16340, 138, 1186, 7047, 1722, 19892, 16340, 19804, 2328, 7047, 1722, 2090, 12056, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
The Remembrance Arcade located at the Tafawa Balewa Square, Lagos, is a cenotaph site used to commemorate Nigerian soldiers who died in World War I, World War II and the Nigerian Civil War. It is located within the Tafawa Balewa Square in the Lagos Central Business District. The Armed Forces Remembrance celebrations are performed yearly at this site. At the entrance of the site, a statue of an unknown soldier with a gun can be seen facing the entrance. The green space is laid out with grasses, pavements, and the cenotaph. Gallery References Military monuments and memorials Monuments and memorials in Lagos Cenotaphs
[ 101, 1109, 11336, 21207, 22697, 1388, 1120, 1103, 22515, 8057, 3624, 18757, 23513, 1161, 4656, 117, 17883, 117, 1110, 170, 172, 26601, 1777, 7880, 1751, 1215, 1106, 13792, 11960, 2803, 1150, 1452, 1107, 1291, 1414, 146, 117, 1291, 1414, 1563, 1105, 1103, 11960, 3145, 1414, 119, 1135, 1110, 1388, 1439, 1103, 22515, 8057, 3624, 18757, 23513, 1161, 4656, 1107, 1103, 17883, 1970, 3518, 1574, 119, 1109, 8776, 4791, 11336, 21207, 12746, 1132, 1982, 13502, 1120, 1142, 1751, 119, 1335, 1103, 3448, 1104, 1103, 1751, 117, 170, 5921, 1104, 1126, 3655, 5176, 1114, 170, 2560, 1169, 1129, 1562, 4749, 1103, 3448, 119, 1109, 2448, 2000, 1110, 3390, 1149, 1114, 24567, 117, 15823, 1116, 117, 1105, 1103, 172, 26601, 1777, 7880, 119, 3889, 19714, 1116, 4012, 12449, 1105, 6768, 1116, 12267, 1116, 1105, 6768, 1116, 1107, 17883, 24664, 12512, 25890, 1116, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Shalash (Šalaš) was a Syrian goddess best known as the wife of Dagan, the head of the pantheon of the middle Euphrates area. She was already worshiped in Ebla and Tuttul in the third millennium BCE, and later her cult is attested in Mari as well. She was also introduced to the Mesopotamian and Hurrian pantheons. Both in ancient Mesopotamian texts and in modern scholarships a long-standing issue is the differentiation between Shalash and the similarly named Shala, wife of the weather god Ishkur/Adad in Mesopotamia. Name The etymology of the name Shalash is unknown. Based on the attestations in the Ebla texts, theories of Hurrian origin can be rejected. However, as noted by Alfonso Archi, there is no plausible Semitic etymology either, similar as in the case of other Syrian deities like Kubaba or Aštabi. Lluis Feliu proposes that it might have originated in an unknown substrate language. The spellings dsa-a-ša, dsa-a-sa and dša-la-ša are attested in documents from Ebla. In Old Babylonian Mari the name was commonly written logographically as dNIN.HUR.SAG.GA. It is also possible that texts from the same city mentioning Ninlil and Ninkugi refer to Shalash. In Yazılıkaya, the name is written in hieroglyphs as (DEUS)sa-lu-sa. The spelling Shalush is also known from Hurrian texts. In Emar the name of Dagan's wife was written as dNIN.KUR, presumably as an extension of writing his own name logographically as dKUR. It has been proposed that this deity can be identified with Shalash, and that the western scribes treated dNIN.KUR as a synonym of dNIN.HUR.SAG.GA based on similar meanings of the names. A goddess named Ninkur is also known from Mesopotamian god lists, though there she is instead one of the ancestors of Enlil. The god list An-Anum lists the Sumerian names Ninkusi ("lady of gold"), Ninudishara ("mistress who amazes the world") and Ninsuhzagina ("Lady, diadem of lapis lazuli") as synonymous with Shalash. Association with other deities Shalash was the wife of Dagan, and together they stood at the head of the pantheon of the middle Euphrates area in ancient Syria. No known text specifies if she was believed to have any ancestors. It is assumed that Adad was viewed as her son in Mari. Lluis Felieu additionally proposes that Hebat, the goddess of Halab (Aleppo) was a daughter of Shalash and Dagan. In the texts from Ebla, Shalash is also associated with Wada'an(u), a god distinct from Dagan, worshiped in Gar(r)amu rather than Tuttul. Alfonso Archi proposes that they were regarded as consorts. It is assumed that his name had origin in a Semitic language. Unlike Dagan, Wada'an is not attested in any later sources. In Hurrian tradition, Shalash was regarded as the wife of Kumarbi due to the syncretism between him and Dagan. The Mesopotamian god list An-Anum equates Shala with Ninlil, and her husband with Enlil. Shalash and Shala In modern scholarship, Shalash is sometimes confused with Shala, a Mesopotamian goddess regarded as the wife of Adad. According to Daniel Schwemer, while a degree of confusion between the two goddesses is also present in some ancient sources, it is largely limited to scholarly Mesopotamian texts, and no older than the fourteenth century BCE. According to Lluis Feliu, most evidence for it comes from the first millennium BCE. In the god list An-Anum, Shalash is listed as one of the alternate names of Shala. However, it also separately equates Shalash (but not Shala) with Ninlil. In a late explanatory text, Ninkusi/Shalash is addressed as "Shala of the western steppe." In a single copy of a Maqlû ritual from Assur, Shala occurs in place of Shalash, present in other known copies of the same text. Lluis Felieu rejects the possibility that the two were originally the same, and especially that the confusion between them was caused by Dagan being a weather god himself and thus analogous to Adad. He also notes that Shala is well attested in art as a goddess associated with the weather, while the character of Shalash, based on parallels with the wives of heads of other pantheons of ancient Near East (for example Ninlil, wife of Enlil and Athirat, wife of El), would be unlikely to resemble that of the wife of the Mesopotamian weather god. Additionally, the spelling of the name of the goddess paired with Adad in devotional inscriptions is consistent between various time periods and languages, and never ends with a sibilant. There is very little evidence for confusion of the two goddesses in Hurrian and Hittite sources. Daniel Schwemer considers a treaty of king Shattiwaza to be one example. Lluis Felieu proposes that for Hurrians and Hittites the source of confusion might have been the fact the final -š in the name of Shalash name could be interpreted as a case ending in their languages, but he also remarks that the only possible instances might also represent simple scribal mistakes. Worship The earliest attestations of Shalash come from Ebla from the third millennium BCE. There is no indication she was commonly worshiped in that period, however. She was associated with the god Wada'an(u) worshiped in Gar(r)amu, a city in the Eblaite territory. In the documents of the royal vizier Ibrium there is also evidence for an association between dsa-a-ša (Shalash) and DBE du-du-luki, "lord of Tuttul," a title of Dagan. A statue of Shalash was apparently an object of cult in Tuttul. In later periods the cult of Shalash is well attested in Tuttul, and Alfonso Archi goes as far as proposing that the view that she was the wife of Dagan originated in this city. However, there is presently no evidence that she was worshiped in the other cult center of her husband, Terqa. In Halab Shalash was worshiped alongside Dagan and Hebat in the pagrā'um ritual, part of a mourning ceremony. Both the worship of Shalash and her association with Dagan are well attested in Old Babylonian Mari. In earlier periods she already had a temple in this city, at one point rebuilt by Nûr-Mêr. Kings closely linked to the worship of Shalash (dNIN.HUR.SAG.GA) and Dagan include Yaggid-Lim, Yahdun-Lim and Zimri-Lim. Shalash was also worshiped by Hurrians living in the city. She appears in a number of theophoric names both from Mari itself and from the nearby Chagar Bazar, for example Shalash-tappi ("Shalash is my partner") and Shalash-turiya ("Shalash" is my refuge). In Mesopotamia Shalash appears with Dagan on seals from the Isin-Larsa period. In Hurrian sources she is listed in kaluti (offering lists) of the circle of Hebat, in some documents immediately after this goddess herself, in others between Aya and Adamma. She is also known from the kaluti of Shaushka. While in the former she appears with Kumarbi, he is absent from the latter. As early as in the Old Babylonian period Hurrians referred to Shalash as "Pidenhi." This epithet was derived from Piden (also spelled Bitin), a settlement mentioned in the texts from Alalakh, which was a cult center of this goddess. On the reliefs from the Yazılıkaya sanctuary, Shalash is represented between Nabarbi and Damkina (figure number 52). References Bibliography Hurrian deities West Semitic goddesses Mesopotamian goddesses
[ 101, 156, 19456, 2737, 113, 322, 5971, 10222, 114, 1108, 170, 8697, 9659, 1436, 1227, 1112, 1103, 1676, 1104, 10136, 3820, 117, 1103, 1246, 1104, 1103, 13316, 24471, 1104, 1103, 2243, 142, 4455, 20955, 3052, 1298, 119, 1153, 1108, 1640, 7697, 1174, 1107, 142, 18075, 1105, 17037, 3069, 4654, 1107, 1103, 1503, 17928, 10596, 117, 1105, 1224, 1123, 9528, 1110, 20000, 1107, 17978, 1112, 1218, 119, 1153, 1108, 1145, 2234, 1106, 1103, 2508, 7301, 11439, 26817, 1179, 1105, 20164, 14791, 1389, 13316, 24471, 1116, 119, 2695, 1107, 2890, 2508, 7301, 11439, 26817, 1179, 6685, 1105, 1107, 2030, 18085, 170, 1263, 118, 2288, 2486, 1110, 1103, 23510, 1206, 156, 19456, 2737, 1105, 1103, 9279, 1417, 156, 19456, 117, 1676, 1104, 1103, 4250, 5540, 2181, 1324, 4786, 1197, 120, 19222, 1181, 1107, 2508, 7301, 11439, 26817, 119, 10208, 1109, 3084, 17162, 4807, 1104, 1103, 1271, 156, 19456, 2737, 1110, 3655, 119, 7457, 1113, 1103, 1120, 13053, 6006, 1107, 1103, 142, 18075, 6685, 117, 7997, 1104, 20164, 14791, 1389, 4247, 1169, 1129, 5164, 119, 1438, 117, 1112, 2382, 1118, 13961, 19797, 1182, 117, 1175, 1110, 1185, 27918, 24447, 3084, 17162, 4807, 1719, 117, 1861, 1112, 1107, 1103, 1692, 1104, 1168, 8697, 19018, 1176, 23209, 2822, 2822, 1137, 138, 10222, 1777, 5567, 119, 149, 7535, 1548, 11907, 2646, 1358, 18381, 1115, 1122, 1547, 1138, 7506, 1107, 1126, 3655, 17498, 1846, 119, 1109, 12330, 1116, 173, 3202, 118, 170, 118, 323, 1161, 117, 173, 3202, 118, 170, 118, 21718, 1105, 173, 23834, 118, 2495, 118, 323, 1161, 1132, 20000, 1107, 4961, 1121, 142, 18075, 119, 1130, 2476, 19014, 1811, 17978, 1103, 1271, 1108, 3337, 1637, 7998, 25582, 1193, 1112, 173, 27451, 2249, 119, 145, 19556, 119, 13411, 2349, 119, 20173, 119, 1135, 1110, 1145, 1936, 1115, 6685, 1121, 1103, 1269, 1331, 20368, 27453, 1179, 2646, 1233, 1105, 27453, 6773, 9610, 1182, 5991, 1106, 156, 19456, 2737, 119, 1130, 14680, 1584, 12262, 1233, 12262, 23898, 117, 1103, 1271, 1110, 1637, 1107, 20844, 10771, 18901, 19992, 1112, 113, 18581, 13329, 114, 21718, 118, 181, 1358, 118, 21718, 119, 1109, 12330, 156, 7654, 13148, 1110, 1145, 1227, 1121, 20164, 14791, 1389, 6685, 119, 1130, 18653, 1813, 1103, 1271, 1104, 10136, 3820, 112, 188, 1676, 1108, 1637, 1112, 173, 27451, 2249, 119, 148, 19556, 117, 11280, 1112, 1126, 4973, 1104, 2269, 1117, 1319, 1271, 7998, 25582, 1193, 1112, 173, 2428, 19556, 119, 1135, 1144, 1151, 3000, 1115, 1142, 13924, 1169, 1129, 3626, 1114, 156, 19456, 2737, 117, 1105, 1115, 1103, 2466, 188, 17770, 1116, 5165, 173, 27451, 2249, 119, 148, 19556, 1112, 170, 10646, 1104, 173, 27451, 2249, 119, 145, 19556, 119, 13411, 2349, 119, 20173, 1359, 1113, 1861, 17686, 1104, 1103, 2666, 119, 138, 9659, 1417, 27453, 6773, 2149, 1110, 1145, 1227, 1121, 2508, 7301, 11439, 26817, 1179, 5540, 6802, 117, 1463, 1175, 1131, 1110, 1939, 1141, 1104, 1103, 11005, 1104, 13832, 2646, 1233, 119, 1109, 5540, 2190, 1760, 118, 1760, 1818, 6802, 1103, 15463, 4027, 1811, 2666, 27453, 6773, 1361, 1182, 113, 107, 5141, 1104, 2284, 107, 114, 117, 27453, 14787, 10396, 10131, 113, 107, 14198, 1150, 1821, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
No. 28 Squadron, nicknamed the Phoenixes, is a Multi-role, fighter squadron of the Pakistan Air Force (PAF). See also List of Pakistan Air Force squadrons References External links Pakistan Air Force squadrons
[ 101, 1302, 119, 1743, 3837, 117, 10446, 1103, 6343, 1279, 117, 1110, 170, 18447, 118, 1648, 117, 6295, 5780, 1104, 1103, 3658, 1806, 2300, 113, 8544, 2271, 114, 119, 3969, 1145, 5619, 1104, 3658, 1806, 2300, 13352, 19714, 1116, 22841, 6743, 3658, 1806, 2300, 13352, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Nanushi (Japanese: 名主) was a village official in the Edo period. They were village headmen, administering a village (mura) under a district magistrate (gun-dai), the daikan of a district governor (gunji). Their duties included tax collection and serving as the most local administrator of a rural village in direct contact with the villagers. The term nanushi was used in Kantō, while a village head was called shōya (庄屋) in Kansai and kimoiri (肝煎) in Tōhoku and Hokuriku. Overview The duties of nanushi included tax collection, general village administration, management of public natural resources (such as mountain, field, river and ocean) of the village called iriai, as well as negotiating with the territorial lord as the representative of the villagers. The post was typically monopolized by one or more powerful peasant families through hereditary succession, though nominally appointed by the territorial lord who paid salary to the nanushi. The post was sometimes sold to the highest bidder, but was typically only given to a qualified person. In castle towns (jōkamachi), there were town heads called machi-nanushi. In contrast to the nanushi of a village who served under a district magistrate (gun-dai), the machi-nanushi served under a town magistrate (machi-bugyō) or a ward head (machidoshiyori). A machi-nanushi was a townsman (chōnin). History Both the terms nanushi and shōya, meaning a village head, derive from medieval terms. In the Middle Ages, nanushi (名主) was read as myōshu and referred to feudal lords of territorial fields (myōden) who were divided into petty lords (shōmyō) and magnates (daimyō), and shōya (庄屋) referred to the manor building of a manorial estate. In the Edo period, a new system of village administration was established, with three types of village officials appointed in each village: nanushi, kumigashira (組頭), and hyakushōdai (百姓代). For each village there was one nanushi, a number of kumigashira, and one or more hyakushōdai. While the nanushi was the village head, the kumigashira were his advisors or assistants, and the hyakushōdai was the representative of village peasants who surveyed the work of village administrators. These offices were generally established between 1688 and 1704. See also Daimyo Bugyō Gōzoku References Officials of the Tokugawa shogunate Government of feudal Japan
[ 101, 20689, 13148, 1182, 113, 1983, 131, 100, 100, 114, 1108, 170, 1491, 2078, 1107, 1103, 20520, 1669, 119, 1220, 1127, 1491, 1246, 2354, 117, 23972, 1158, 170, 1491, 113, 182, 4084, 114, 1223, 170, 1629, 20261, 113, 2560, 118, 5358, 1182, 114, 117, 1103, 5358, 7223, 1179, 1104, 170, 1629, 4066, 113, 2560, 3454, 114, 119, 2397, 5078, 1529, 3641, 2436, 1105, 2688, 1112, 1103, 1211, 1469, 11065, 1104, 170, 3738, 1491, 1107, 2904, 3232, 1114, 1103, 12453, 119, 1109, 1858, 9468, 9299, 3031, 1108, 1215, 1107, 14812, 2227, 4587, 117, 1229, 170, 1491, 1246, 1108, 1270, 188, 1324, 4587, 2315, 113, 100, 100, 114, 1107, 14812, 2316, 3814, 1105, 180, 12013, 17262, 113, 100, 100, 114, 1107, 157, 4587, 5114, 4786, 1105, 9800, 4786, 10160, 1358, 119, 3278, 7334, 1109, 5078, 1104, 9468, 9299, 3031, 1529, 3641, 2436, 117, 1704, 1491, 3469, 117, 2635, 1104, 1470, 2379, 3979, 113, 1216, 1112, 3231, 117, 1768, 117, 2186, 1105, 5969, 114, 1104, 1103, 1491, 1270, 178, 3464, 1182, 117, 1112, 1218, 1112, 21262, 1114, 1103, 10120, 7692, 1112, 1103, 4702, 1104, 1103, 12453, 119, 1109, 2112, 1108, 3417, 19863, 4184, 11014, 5305, 1118, 1141, 1137, 1167, 3110, 17231, 2073, 1194, 17676, 8705, 117, 1463, 27937, 1923, 1118, 1103, 10120, 7692, 1150, 3004, 10326, 1106, 1103, 9468, 9299, 3031, 119, 1109, 2112, 1108, 2121, 1962, 1106, 1103, 2439, 6875, 2692, 117, 1133, 1108, 3417, 1178, 1549, 1106, 170, 4452, 1825, 119, 1130, 3804, 4281, 113, 179, 4587, 1968, 1918, 4313, 114, 117, 1175, 1127, 1411, 4075, 1270, 23639, 3031, 118, 9468, 9299, 3031, 119, 1130, 5014, 1106, 1103, 9468, 9299, 3031, 1104, 170, 1491, 1150, 1462, 1223, 170, 1629, 20261, 113, 2560, 118, 5358, 1182, 114, 117, 1103, 23639, 3031, 118, 9468, 9299, 3031, 1462, 1223, 170, 1411, 20261, 113, 23639, 3031, 118, 15430, 22561, 114, 1137, 170, 7910, 1246, 113, 23639, 3031, 12847, 3031, 7490, 2047, 114, 119, 138, 23639, 3031, 118, 9468, 9299, 3031, 1108, 170, 4281, 1399, 113, 22572, 4587, 10430, 114, 119, 2892, 2695, 1103, 2538, 9468, 9299, 3031, 1105, 188, 1324, 4587, 2315, 117, 2764, 170, 1491, 1246, 117, 20292, 1121, 5908, 2538, 119, 1130, 1103, 3089, 9325, 117, 9468, 9299, 3031, 113, 100, 100, 114, 1108, 2373, 1112, 1139, 4587, 16138, 1105, 2752, 1106, 18594, 17499, 1104, 10120, 3872, 113, 1139, 4587, 2883, 114, 1150, 1127, 3233, 1154, 19701, 17499, 113, 188, 1324, 4587, 4527, 4587, 114, 1105, 12477, 21772, 1116, 113, 5358, 4060, 22561, 114, 117, 1105, 188, 1324, 4587, 2315, 113, 100, 100, 114, 2752, 1106, 1103, 9764, 1459, 1104, 170, 9764, 2916, 3327, 119, 1130, 1103, 20520, 1669, 117, 170, 1207, 1449, 1104, 1491, 3469, 1108, 1628, 117, 1114, 1210, 3322, 1104, 1491, 3878, 1923, 1107, 1296, 1491, 131, 9468, 9299, 3031, 117, 180, 14088, 11305, 14518, 1161, 113, 100, 100, 114, 117, 1105, 177, 2315, 26688, 1324, 4587, 14117, 113, 100, 100, 100, 114, 119, 1370, 1296, 1491, 1175, 1108, 1141, 9468, 9299, 3031, 117, 170, 1295, 1104, 180, 14088, 11305, 14518, 1161, 117, 1105, 1141, 1137, 1167, 177, 2315, 26688, 1324, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
The 2022 RFL 1895 Cup, known as the 2022 AB Sundecks 1895 Cup for sponsorship reasons, is the third playing of the RFL 1895 Cup, a rugby league football competition for clubs in the United Kingdom. The competition for clubs who play below the top-tier Super League, with amateur clubs joining lower-tier professional clubs in qualification for the first time. The competition will be played from April to May 2022. The final will be played as a curtain raiser to the 2022 Challenge Cup Final at Tottenham Hotspur Stadium, London on 28 May 2022. Format The 2021 competition had run with an altered format due to the disruption caused to that season by the COVID-19 pandemic. Under these changes, the early rounds of the 2021 Challenge Cup served as the opening rounds of the 1895 Cup, with the four teams which progressed from round 2 of the Challenge Cup also becoming semi-finalists of the 1895 Cup. That format was popular among teams, and so the 2022 tournament returned with an adapted version of that, reflecting the re-formatting of the Challenge Cup to facilitate the re-entry of amateur sides to that tournament. This adapted format for 2022 will see five teams progress from round 5 of the 2022 Challenge Cup, and hence qualify for the 1895 Cup. Any Championship, League 1 or Amateur team that subsequently wins in round 6 of the Challenge Cup will qualify automatically for the semi-finals of the 1895 Cup. Two of the remaining qualifiers will be drawn into a play-off match on 9th/10th April, to reduce the five qualifiers to four teams for the semi-finals on the 7th/8th May, with the final held as a curtain-raiser for the 2022 Challenge Cup Final on the 28th May. Qualification The early rounds of the Challenge Cup function as the qualification for the 1895 Cup, with the Fifth Round, played on the 12th/13th March, acting as the final qualifier. All professional RFL member clubs below the Super League are eligible to participate in the 1895 Cup, as well as those amateur teams which entered the Challenge Cup. Newly formed Cornwall R.L.F.C. who play in RFL League 1 decided not to enter the competition. References 2022 in English rugby league 2022 in Welsh rugby league RFL 1895 Cup
[ 101, 1109, 17881, 1477, 24695, 2162, 5639, 1635, 117, 1227, 1112, 1103, 17881, 1477, 16151, 3477, 2007, 8770, 5639, 1635, 1111, 12387, 3672, 117, 1110, 1103, 1503, 1773, 1104, 1103, 24695, 2162, 5639, 1635, 117, 170, 4896, 2074, 1709, 2208, 1111, 3514, 1107, 1103, 1244, 2325, 119, 1109, 2208, 1111, 3514, 1150, 1505, 2071, 1103, 1499, 118, 8081, 3198, 1453, 117, 1114, 6135, 3514, 4577, 2211, 118, 8081, 1848, 3514, 1107, 8969, 1111, 1103, 1148, 1159, 119, 1109, 2208, 1209, 1129, 1307, 1121, 1364, 1106, 1318, 17881, 1477, 119, 1109, 1509, 1209, 1129, 1307, 1112, 170, 12354, 4693, 1197, 1106, 1103, 17881, 1477, 6571, 1635, 3788, 1120, 19494, 4126, 25047, 3339, 117, 1498, 1113, 1743, 1318, 17881, 1477, 119, 15075, 2980, 1109, 17881, 1475, 2208, 1125, 1576, 1114, 1126, 8599, 3536, 1496, 1106, 1103, 23730, 2416, 1106, 1115, 1265, 1118, 1103, 18732, 23314, 2137, 118, 1627, 13316, 2007, 7257, 119, 2831, 1292, 2607, 117, 1103, 1346, 5720, 1104, 1103, 17881, 1475, 6571, 1635, 1462, 1112, 1103, 2280, 5720, 1104, 1103, 5639, 1635, 117, 1114, 1103, 1300, 1929, 1134, 12687, 1121, 1668, 123, 1104, 1103, 6571, 1635, 1145, 2479, 3533, 118, 15333, 1104, 1103, 5639, 1635, 119, 1337, 3536, 1108, 1927, 1621, 1929, 117, 1105, 1177, 1103, 17881, 1477, 2348, 1608, 1114, 1126, 5546, 1683, 1104, 1115, 117, 11636, 1103, 1231, 118, 3536, 1916, 1104, 1103, 6571, 1635, 1106, 11000, 1103, 1231, 118, 3990, 1104, 6135, 3091, 1106, 1115, 2348, 119, 1188, 5546, 3536, 1111, 17881, 1477, 1209, 1267, 1421, 1929, 5070, 1121, 1668, 126, 1104, 1103, 17881, 1477, 6571, 1635, 117, 1105, 7544, 7044, 1111, 1103, 5639, 1635, 119, 6291, 1935, 117, 1453, 122, 1137, 11126, 1264, 1115, 2886, 4646, 1107, 1668, 127, 1104, 1103, 6571, 1635, 1209, 7044, 7743, 1111, 1103, 3533, 118, 4278, 1104, 1103, 5639, 1635, 119, 1960, 1104, 1103, 2735, 23504, 1209, 1129, 3795, 1154, 170, 1505, 118, 1228, 1801, 1113, 5612, 120, 5368, 1364, 117, 1106, 4851, 1103, 1421, 23504, 1106, 1300, 1929, 1111, 1103, 3533, 118, 4278, 1113, 1103, 4766, 120, 5192, 1318, 117, 1114, 1103, 1509, 1316, 1112, 170, 12354, 118, 4693, 1197, 1111, 1103, 17881, 1477, 6571, 1635, 3788, 1113, 1103, 16398, 1318, 119, 26298, 1109, 1346, 5720, 1104, 1103, 6571, 1635, 3053, 1112, 1103, 8969, 1111, 1103, 5639, 1635, 117, 1114, 1103, 9638, 4200, 117, 1307, 1113, 1103, 5247, 120, 5435, 1345, 117, 3176, 1112, 1103, 1509, 21624, 119, 1398, 1848, 24695, 2162, 1420, 3514, 2071, 1103, 3198, 1453, 1132, 7408, 1106, 4868, 1107, 1103, 5639, 1635, 117, 1112, 1218, 1112, 1343, 6135, 1929, 1134, 2242, 1103, 6571, 1635, 119, 1203, 1193, 1824, 10248, 155, 119, 149, 119, 143, 119, 140, 119, 1150, 1505, 1107, 24695, 2162, 1453, 122, 1879, 1136, 1106, 3873, 1103, 2208, 119, 19714, 1116, 17881, 1477, 1107, 1483, 4896, 2074, 17881, 1477, 1107, 5447, 4896, 2074, 24695, 2162, 5639, 1635, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]
Černí baroni is a 1992 Czechoslovak comedy film. Černí baroni may also refer to: Černí baroni (book), a satirical novel written by Miloslav Švandrlík Černí baroni (TV series), a Czech television series that aired in 2004
[ 101, 284, 10449, 6212, 26347, 1182, 1110, 170, 1924, 23409, 3789, 1273, 119, 284, 10449, 6212, 26347, 1182, 1336, 1145, 5991, 1106, 131, 284, 10449, 6212, 26347, 1182, 113, 1520, 114, 117, 170, 18703, 2281, 1637, 1118, 22644, 26142, 322, 5242, 23632, 1233, 18014, 284, 10449, 6212, 26347, 1182, 113, 1794, 1326, 114, 117, 170, 4833, 1778, 1326, 1115, 4086, 1107, 1516, 102 ]
[ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]