repo_name
stringlengths 6
91
| path
stringlengths 8
968
| copies
stringclasses 210
values | size
stringlengths 2
7
| content
stringlengths 61
1.01M
| license
stringclasses 15
values | hash
stringlengths 32
32
| line_mean
float64 6
99.8
| line_max
int64 12
1k
| alpha_frac
float64 0.3
0.91
| ratio
float64 2
9.89
| autogenerated
bool 1
class | config_or_test
bool 2
classes | has_no_keywords
bool 2
classes | has_few_assignments
bool 1
class |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
overtake/TelegramSwift | Telegram-Mac/EditImageCanvasColorPicker.swift | 1 | 15701 | //
// EditImageCanvasColorPickerBackground.swift
// Telegram
//
// Created by Mikhail Filimonov on 16/04/2020.
// Copyright © 2020 Telegram. All rights reserved.
//
import Cocoa
import TGUIKit
class EditImageCanvasColorPickerBackground: Control {
override func draw(_ layer: CALayer, in ctx: CGContext) {
super.draw(layer, in: ctx)
let rect = bounds
let radius: CGFloat = rect.size.width > rect.size.height ? rect.size.height / 2.0 : rect.size.width / 2.0
addRoundedRectToPath(ctx, bounds, radius, radius)
ctx.clip()
let colors = EditImageCanvasColorPickerBackground.colors
var locations = EditImageCanvasColorPickerBackground.locations
let colorSpc = CGColorSpaceCreateDeviceRGB()
let gradient: CGGradient = CGGradient(colorsSpace: colorSpc, colors: colors as CFArray, locations: &locations)!
if rect.size.width > rect.size.height {
ctx.drawLinearGradient(gradient, start: CGPoint(x: 0.0, y: rect.size.height / 2.0), end: CGPoint(x: rect.size.width, y: rect.size.height / 2.0), options: .drawsAfterEndLocation)
} else {
ctx.drawLinearGradient(gradient, start: CGPoint(x: rect.size.width / 2.0, y: 0.0), end: CGPoint(x: rect.size.width / 2.0, y: rect.size.height), options: .drawsAfterEndLocation)
}
ctx.setBlendMode(.clear)
ctx.setFillColor(.clear)
}
private func addRoundedRectToPath(_ context: CGContext, _ rect: CGRect, _ ovalWidth: CGFloat, _ ovalHeight: CGFloat) {
var fw: CGFloat
var fh: CGFloat
if ovalWidth == 0 || ovalHeight == 0 {
context.addRect(rect)
return
}
context.saveGState()
context.translateBy(x: rect.minX, y: rect.minY)
context.scaleBy(x: ovalWidth, y: ovalHeight)
fw = rect.width / ovalWidth
fh = rect.height / ovalHeight
context.move(to: CGPoint(x: fw, y: fh / 2))
context.addArc(tangent1End: CGPoint(x: fw, y: fh), tangent2End: CGPoint(x: fw / 2, y: fh), radius: 1)
context.addArc(tangent1End: CGPoint(x: 0, y: fh), tangent2End: CGPoint(x: 0, y: fh / 2), radius: 1)
context.addArc(tangent1End: CGPoint(x: 0, y: 0), tangent2End: CGPoint(x: fw / 2, y: 0), radius: 1)
context.addArc(tangent1End: CGPoint(x: fw, y: 0), tangent2End: CGPoint(x: fw, y: fh / 2), radius: 1)
context.closePath()
context.restoreGState()
}
func color(for location: CGFloat) -> NSColor {
let locations = EditImageCanvasColorPickerBackground.locations
let colors = EditImageCanvasColorPickerBackground.colors
if location < .ulpOfOne {
return NSColor(cgColor: colors[0])!
} else if location > 1 - .ulpOfOne {
return NSColor(cgColor: colors[colors.count - 1])!
}
var leftIndex: Int = -1
var rightIndex: Int = -1
for (index, value) in locations.enumerated() {
if index > 0 {
if value > location {
leftIndex = index - 1
rightIndex = index
break
}
}
}
let leftLocation = locations[leftIndex]
let leftColor = NSColor(cgColor: colors[leftIndex])!
let rightLocation = locations[rightIndex]
let rightColor = NSColor(cgColor: colors[rightIndex])!
let factor = (location - leftLocation) / (rightLocation - leftLocation)
return self.interpolateColor(color1: leftColor, color2: rightColor, factor: factor)
}
private func interpolateColor(color1: NSColor, color2: NSColor, factor: CGFloat) -> NSColor {
let factor = min(max(factor, 0.0), 1.0)
var r1: CGFloat = 0
var r2: CGFloat = 0
var g1: CGFloat = 0
var g2: CGFloat = 0
var b1: CGFloat = 0
var b2: CGFloat = 0
self.colorComponentsFor(color1, red: &r1, green: &g1, blue: &b1)
self.colorComponentsFor(color2, red: &r2, green: &g2, blue: &b2)
let r = r1 + (r2 - r1) * factor;
let g = g1 + (g2 - g1) * factor;
let b = b1 + (b2 - b1) * factor;
return NSColor(red: r, green: g, blue: b, alpha: 1.0)
}
private func colorComponentsFor(_ color: NSColor, red:inout CGFloat, green:inout CGFloat, blue:inout CGFloat) {
let componentsCount = color.cgColor.numberOfComponents
let components = color.cgColor.components
var r: CGFloat = 0.0
var g: CGFloat = 0.0
var b: CGFloat = 0.0
var a: CGFloat = 1.0
if componentsCount == 4 {
r = components?[0] ?? 0.0
g = components?[1] ?? 0.0
b = components?[2] ?? 0.0
a = components?[3] ?? 0.0
} else {
b = components?[0] ?? 0.0
g = b
r = g
}
red = r
green = g
blue = b
}
static var colors: [CGColor] {
return [NSColor(0xea2739).cgColor,
NSColor(0xdb3ad2).cgColor,
NSColor(0x3051e3).cgColor,
NSColor(0x49c5ed).cgColor,
NSColor(0x80c864).cgColor,
NSColor(0xfcde65).cgColor,
NSColor(0xfc964d).cgColor,
NSColor(0x000000).cgColor,
NSColor(0xffffff).cgColor
]
}
static var locations: [CGFloat] {
return [ 0.0, //red
0.14, //pink
0.24, //blue
0.39, //cyan
0.49, //green
0.62, //yellow
0.73, //orange
0.85, //black
1.0
]
}
}
private final class PaintColorPickerKnobCircleView : View {
required init(frame frameRect: NSRect) {
super.init(frame: frameRect)
}
required init?(coder: NSCoder) {
fatalError("init(coder:) has not been implemented")
}
private var strokeIntensity: CGFloat = 0
var strokesLowContrastColors: Bool = false
override var needsLayout: Bool {
didSet {
needsDisplay = true
}
}
var color: NSColor = .black {
didSet {
if strokesLowContrastColors {
var strokeIntensity: CGFloat = 0.0
var hue: CGFloat = 0
var saturation: CGFloat = 0
var brightness: CGFloat = 0
var alpha: CGFloat = 0
color.getHue(&hue, saturation: &saturation, brightness: &brightness, alpha: &alpha)
if hue < CGFloat.ulpOfOne && saturation < CGFloat.ulpOfOne && brightness > 0.92 {
strokeIntensity = (brightness - 0.92) / 0.08
}
self.strokeIntensity = strokeIntensity
}
needsDisplay = true
}
}
override func draw(_ layer: CALayer, in context: CGContext) {
super.draw(layer, in: context)
let rect = bounds
context.setFillColor(color.cgColor)
context.fillEllipse(in: rect)
if strokeIntensity > .ulpOfOne {
context.setLineWidth(1.0)
context.setStrokeColor(NSColor(white: 0.88, alpha: strokeIntensity).cgColor)
context.strokeEllipse(in: rect.insetBy(dx: 1.0, dy: 1.0))
}
}
}
private let paintColorSmallCircle: CGFloat = 4.0
private let paintColorLargeCircle: CGFloat = 20.0
private let paintColorWeightGestureRange: CGFloat = 200
private let paintVerticalThreshold: CGFloat = 5
private let paintPreviewOffset: CGFloat = -60
private let paintPreviewScale: CGFloat = 2.0
private let paintDefaultBrushWeight: CGFloat = 0.22
private let oaintDefaultColorLocation: CGFloat = 1.0
private final class PaintColorPickerKnob: View {
fileprivate var isZoomed: Bool = false
fileprivate var weight: CGFloat = 0.5
fileprivate func updateWeight(_ weight: CGFloat, animated: Bool) {
self.weight = weight
var diameter = circleDiameter(forBrushWeight: weight, zoomed: self.isZoomed)
if Int(diameter) % 2 != 0 {
diameter -= 1
}
colorView.setFrameSize(NSMakeSize(diameter, diameter))
backgroundView.setFrameSize(NSMakeSize(24 * (isZoomed ? paintPreviewScale : 1), 24 * (isZoomed ? paintPreviewScale : 1)))
backgroundView.center()
if animated {
if isZoomed {
colorView.layer?.animateScaleSpring(from: 0.5, to: 1, duration: 0.3)
backgroundView.layer?.animateScaleSpring(from: 0.5, to: 1, duration: 0.3)
} else {
colorView.layer?.animateScaleSpring(from: 2.0, to: 1, duration: 0.3)
backgroundView.layer?.animateScaleSpring(from: 2.0, to: 1, duration: 0.3)
}
}
needsLayout = true
}
fileprivate var color: NSColor = .random {
didSet {
colorView.color = color
}
}
fileprivate var width: CGFloat {
return circleDiameter(forBrushWeight: weight, zoomed: false) - 2
}
private let backgroundView = PaintColorPickerKnobCircleView(frame: .zero)
private let colorView = PaintColorPickerKnobCircleView(frame: .zero)
required init(frame frameRect: NSRect) {
super.init(frame: frameRect)
backgroundView.color = NSColor(0xffffff)
backgroundView.isEventLess = true
colorView.isEventLess = true
colorView.color = NSColor.blue
colorView.strokesLowContrastColors = true
addSubview(backgroundView)
addSubview(colorView)
}
func circleDiameter(forBrushWeight size: CGFloat, zoomed: Bool) -> CGFloat {
var result = CGFloat(paintColorSmallCircle) + CGFloat((paintColorLargeCircle - paintColorSmallCircle)) * size
result = CGFloat(zoomed ? result * paintPreviewScale : floor(result))
return floorToScreenPixels(backingScaleFactor, result)
}
override func layout() {
super.layout()
backgroundView.setFrameSize(NSMakeSize(24 * (isZoomed ? paintPreviewScale : 1), 24 * (isZoomed ? paintPreviewScale : 1)))
backgroundView.center()
colorView.center()
}
required init?(coder: NSCoder) {
fatalError("init(coder:) has not been implemented")
}
}
final class EditImageColorPicker: View {
var arguments: EditImageCanvasArguments? {
didSet {
arguments?.updateColorAndWidth(knobView.color, knobView.width)
}
}
private let knobView = PaintColorPickerKnob(frame: NSMakeRect(0, 0, 24 * paintPreviewScale, 24 * paintPreviewScale))
let backgroundView = EditImageCanvasColorPickerBackground()
required init(frame frameRect: NSRect) {
super.init(frame: frameRect)
addSubview(backgroundView)
addSubview(knobView)
knobView.isEventLess = true
knobView.userInteractionEnabled = false
backgroundView.set(handler: { [weak self] _ in
self?.updateLocation(animated: false)
}, for: .MouseDragging)
backgroundView.set(handler: { [weak self] _ in
self?.knobView.isZoomed = true
self?.updateLocation(animated: true)
}, for: .Down)
backgroundView.set(handler: { [weak self] _ in
self?.knobView.isZoomed = false
self?.updateLocation(animated: true)
}, for: .Up)
let colorValue = UserDefaults.standard.value(forKey: "painterColorLocation") as? CGFloat
let weightValue = UserDefaults.standard.value(forKey: "painterBrushWeight") as? CGFloat
let colorLocation: CGFloat
if let colorValue = colorValue {
colorLocation = colorValue
} else {
colorLocation = CGFloat(arc4random()) / CGFloat(UInt32.max)
UserDefaults.standard.setValue(colorLocation, forKey: "painterColorLocation")
}
self.location = colorLocation
knobView.color = backgroundView.color(for: colorLocation)
let weight = weightValue ?? paintDefaultBrushWeight
knobView.updateWeight(weight, animated: false)
}
private var location: CGFloat = 0
private func updateLocation(animated: Bool) {
guard let window = self.window else {
return
}
let location = backgroundView.convert(window.mouseLocationOutsideOfEventStream, from: nil)
let colorLocation = max(0.0, min(1.0, location.x / backgroundView.frame.width))
self.location = colorLocation
knobView.color = backgroundView.color(for: colorLocation)
let threshold = min(max(frame.height - backgroundView.frame.minY, frame.height - self.convert(window.mouseLocationOutsideOfEventStream, from: nil).y), paintColorWeightGestureRange + paintPreviewOffset)
let weight = threshold / (paintColorWeightGestureRange + paintPreviewOffset);
knobView.updateWeight(weight, animated: animated)
arguments?.updateColorAndWidth(knobView.color, knobView.width)
UserDefaults.standard.set(Double(colorLocation), forKey: "painterColorLocation")
UserDefaults.standard.set(Double(weight), forKey: "painterBrushWeight")
if animated {
knobView.layer?.animatePosition(from: NSMakePoint(knobView.frame.minX - knobPosition.x, knobView.frame.minY - knobPosition.y), to: .zero, duration: 0.3, timingFunction: .spring, removeOnCompletion: true, additive: true)
}
needsLayout = true
}
override var isEventLess: Bool {
get {
guard let window = self.window else {
return false
}
let point = self.convert(window.mouseLocationOutsideOfEventStream, from: nil)
if NSPointInRect(point, backgroundView.frame) || NSPointInRect(point, knobView.frame) {
return false
} else {
return true
}
}
set {
super.isEventLess = newValue
}
}
required init?(coder: NSCoder) {
fatalError("init(coder:) has not been implemented")
}
private var knobPosition: NSPoint {
guard let window = self.window else {
return .zero
}
let threshold: CGFloat
if knobView.isZoomed {
threshold = min(max(0, frame.height - self.convert(window.mouseLocationOutsideOfEventStream, from: nil).y - (frame.height - backgroundView.frame.minY)), paintColorWeightGestureRange)
} else {
threshold = 0
}
let knobY: CGFloat = max(0, (backgroundView.frame.midY - knobView.frame.height / 2) + (knobView.isZoomed ? paintPreviewOffset : 0) + -threshold)
let knobX: CGFloat = max(0, min(backgroundView.frame.width * location, self.frame.width - knobView.frame.width))
return NSMakePoint(knobX, knobY)
}
override func layout() {
super.layout()
backgroundView.frame = NSMakeRect(24, frame.height - 24, frame.width - 48, 20)
knobView.frame = CGRect(x: knobPosition.x, y: knobPosition.y, width: knobView.frame.size.width, height: knobView.frame.size.height)
}
}
| gpl-2.0 | 5247714ccb7ca67cc52e94987f421860 | 34.044643 | 231 | 0.590764 | 4.63948 | false | false | false | false |
remirobert/MyCurrency | MyCurrency/CurrencyModel.swift | 1 | 617 | //
// CurrencyModel.swift
// MyCurrency
//
// Created by Remi Robert on 10/12/2016.
// Copyright © 2016 Remi Robert. All rights reserved.
//
import UIKit
struct CurrencyModel {
var to: Currency
var from: Currency
var rate: Double
init?(json: [String:AnyObject]) {
guard let to = Currency(rawValue: (json["to"] as? String) ?? ""),
let from = Currency(rawValue: (json["from"] as? String) ?? ""),
let rate = json["rate"] as? Double else {
return nil
}
self.to = to
self.from = from
self.rate = rate
}
}
| mit | 4d3f82c50f1cd1db06a7f355825c56df | 21.814815 | 75 | 0.548701 | 3.85 | false | false | false | false |
xebia/xtime-ios | xtime-ios/xtime-ios/XTimeProxyApi.swift | 1 | 1703 | //
// XTimeProxyApi.swift
// xtime-ios
//
// Created by Steven Mulder on 8/22/14.
// Copyright (c) 2014 Xebia Nederland B.V. All rights reserved.
//
import Foundation
class XTimeProxyApi : API {
func getWeekOverview(request: GetWeekOverviewRequest, callback: GetWeekOverviewResponse -> Void, error: NSErrorPointer) {
let url = NSURL(string: "http://localhost:9000/week?date=2014-08-11")
var request = NSMutableURLRequest(URL: url)
request.setValue("username=smulder; JSESSIONID=5678C9CB30F010E03353107E93E1268E; _hp2_id.2790962031=4600497982186508.0.0; s_fid=0001184F49D05B24-3B6EB99660721A7C; __utma=179778477.69251742.1379142638.1391176259.1393790031.13; __utmz=179778477.1379142638.1.1.utmcsr=(direct)|utmccn=(direct)|utmcmd=(none); _ga=GA1.2.69251742.1379142638; hsfirstvisit=http%3A%2F%2Ftraining.xebia.com%2Fsummer-specials%2Fsummer-special-automated-acceptance-testing-with-fitnesse-and-appium||1401696949959; __hstc=232286976.12e4110469efdd95968c50621192e0cc.1401696949961.1401696949961.1401696949961.1; hubspotutk=12e4110469efdd95968c50621192e0cc", forHTTPHeaderField: "Cookie")
let task = NSURLSession.sharedSession().dataTaskWithRequest(request) {(data, response, error) in
println("response")
}
task.resume()
callback( GetWeekOverviewResponse(lastTransferred: 0, monthlyDataApproved: false, projects: [], timesheetRows: [], username: "") )
}
func getWorkTypesForProject(request: GetWorkTypesForProjectRequest, callback: GetWorkTypesForProjectResponse -> Void, error: NSErrorPointer) {
callback( GetWorkTypesForProjectResponse(workTypes: []) )
}
} | apache-2.0 | 33a8aa0cd62ab28807b2f01c2f02b117 | 53.967742 | 664 | 0.736348 | 3.213208 | false | false | false | false |
alokc83/rayW-SwiftSeries | RW_SwiftSeries-classes-chellenge8.playground/Contents.swift | 1 | 2384 | //: Playground - noun: a place where people can play
import UIKit
// Classes part 8 || challenge 8
class Account{
var firstName:String
var lastName:String
var balance: Double
var rate = 0.0
init(firstName:String, lastName:String, balance:Double){
self.firstName = firstName
self.lastName = lastName
self.balance = balance
}
convenience init(){
self.init(firstName:"", lastName:"", balance:0)
}
func interestOverYears(years:Double) -> Double{
return 0
}
func printBreakDown(){
var balance = NSString(format: "%f", self.balance)
println("\(firstName) \(lastName): \(balance)")
}
}
class CheckingAccount:Account{
override init(firstName:String, lastName:String, balance:Double){
super.init(firstName:firstName, lastName:lastName, balance:balance)
self.rate = 4.3
}
override func interestOverYears(years: Double) -> Double {
return (balance * rate * years) / 100
}
}
var account = Account(firstName: "Alok", lastName: "Cewalll", balance: 1.0)
account.printBreakDown()
var account2 = Account()
var checkingAccont = CheckingAccount(firstName: "Alok", lastName: "Cewall", balance: 200_000)
checkingAccont.interestOverYears(5)
class Animal{
var name:String
init(name:String){
self.name = name
}
func speak() -> (String?){
return nil
}
}
class Dog:Animal{
override init(name: String) {
super.init(name: name)
}
convenience init() {
self.init(name:"")
}
override func speak() -> (String?) {
return "Woof Woof"
}
}
class Cat:Animal{
override init(name: String) {
super.init(name: name)
}
convenience init() {
self.init(name:"")
}
override func speak() -> (String?) {
return "Meow Meow"
}
}
class Fox:Animal{
override init(name: String) {
super.init(name: name)
}
convenience init() {
self.init(name:"")
}
override func speak() -> (String?) {
return "ding ding"
}
}
var spoty = Dog(name: "Spoty")
spoty.speak()
var kitty = Cat(name: "Kitty")
kitty.speak()
var foxy = Fox(name: "foxy")
foxy.speak()
let animals = [Dog(), Cat(), Fox()]
for animal in animals{
animal.speak()
}
| mit | 64db5d1f876ac2574af82c9e373e37d1 | 17.625 | 93 | 0.588507 | 3.766193 | false | false | false | false |
jmcalister1/iOS-Calculator | ClassCalculator/ViewController.swift | 1 | 1694 | //
// ViewController.swift
// ClassCalculator
//
// Created by Joshua McAlister on 1/24/17.
// Copyright © 2017 Harding University. All rights reserved.
//
import UIKit
class ViewController: UIViewController {
var userIsTyping = false
var CPU = CalculatorCPU()
@IBOutlet weak var display: UILabel!
private var myFormatter = NumberFormatter()
var displayValue:Double {
get {
return Double(display.text!) ?? 0.0
}
set {
myFormatter.minimumIntegerDigits = 1
myFormatter.maximumFractionDigits = 10
display.text = myFormatter.string(from: NSNumber(value:newValue)) ?? "0"
}
}
@IBAction func digitPressed(_ sender: UIButton) {
if let digit = sender.currentTitle {
if userIsTyping {
display.text! += digit
} else {
display.text = digit
}
userIsTyping = true
}
}
@IBAction func touchDecimalPoint(_ sender: UIButton) {
if let str = display.text {
if userIsTyping {
if !str.contains(".") {
display.text! += "."
}
} else {
display.text = "0."
}
userIsTyping = true
}
}
@IBAction func doOperation(_ sender: UIButton) {
if userIsTyping {
CPU.setOperand(operand: displayValue)
userIsTyping = false
}
if let mathSymbol = sender.currentTitle {
CPU.performOperation(symbol: mathSymbol)
}
displayValue = CPU.result
}
}
| mit | 7342d827065765d4dab90ee221ad5299 | 23.897059 | 84 | 0.523922 | 5.114804 | false | false | false | false |
WEIHOME/SliderExample-Swift | TipCalc.swift | 1 | 1208 | //
// TipCalc.swift
// TipCalc
//
// Created by Weihong Chen on 26/03/2015.
// Copyright (c) 2015 Weihong. All rights reserved.
//
import Foundation
class TipCalc {
var tipAmount: Float = 0
var taxAmount: Float = 0
var amountBeforeTax: Float = 0
var amountAfterTax: Float = 0
var amountTotal: Float = 0
var tipPercentage: Float = 0
var taxPercentage: Float = 0
var howManyPeople: Int = 0
var average: Float = 0
init(amountBeforeTax:Float, tipPercentage:Float, taxPercentage:Float, howManyPeople:Int) {
self.amountBeforeTax = amountBeforeTax
self.tipPercentage = tipPercentage
self.taxPercentage = taxPercentage
self.howManyPeople = howManyPeople
}
func calculateTip() {
tipAmount = amountBeforeTax * tipPercentage
}
func calculateTotalIncludedTaxAndTip(){
amountTotal = amountBeforeTax * taxPercentage + tipAmount + amountBeforeTax
}
func averageForPerPerson(){
average = amountTotal / Float(howManyPeople)
}
func calculateAmountAfterTax(){
amountAfterTax = amountBeforeTax * taxPercentage + amountBeforeTax
}
} | mit | a5df2c3580150a516bfa38d469217df3 | 23.18 | 94 | 0.655629 | 4.793651 | false | false | false | false |
optimizely/objective-c-sdk | Pods/Mixpanel-swift/Mixpanel/BaseNotificationViewController.swift | 2 | 2701 | //
// BaseNotificationViewController.swift
// Mixpanel
//
// Created by Yarden Eitan on 8/11/16.
// Copyright © 2016 Mixpanel. All rights reserved.
//
import UIKit
protocol NotificationViewControllerDelegate {
@discardableResult
func notificationShouldDismiss(controller: BaseNotificationViewController,
callToActionURL: URL?,
shouldTrack: Bool,
additionalTrackingProperties: Properties?) -> Bool
}
class BaseNotificationViewController: UIViewController {
var notification: InAppNotification!
var delegate: NotificationViewControllerDelegate?
var window: UIWindow?
var panStartPoint: CGPoint!
convenience init(notification: InAppNotification, nameOfClass: String) {
// avoiding `type(of: self)` as it doesn't work with Swift 4.0.3 compiler
// perhaps due to `self` not being fully constructed at this point
let bundle = Bundle(for: BaseNotificationViewController.self)
self.init(nibName: nameOfClass, bundle: bundle)
self.notification = notification
}
override var supportedInterfaceOrientations: UIInterfaceOrientationMask {
return .all
}
override var shouldAutorotate: Bool {
return true
}
func show(animated: Bool) {}
func hide(animated: Bool, completion: @escaping () -> Void) {}
}
extension UIColor {
/**
The shorthand four-digit hexadecimal representation of color with alpha.
#RGBA defines to the color #AARRGGBB.
- parameter MPHex: hexadecimal value.
*/
public convenience init(MPHex: UInt) {
let divisor = CGFloat(255)
let alpha = CGFloat((MPHex & 0xFF000000) >> 24) / divisor
let red = CGFloat((MPHex & 0x00FF0000) >> 16) / divisor
let green = CGFloat((MPHex & 0x0000FF00) >> 8) / divisor
let blue = CGFloat( MPHex & 0x000000FF ) / divisor
self.init(red: red, green: green, blue: blue, alpha: alpha)
}
/**
Add two colors together
*/
func add(overlay: UIColor) -> UIColor {
var bgR: CGFloat = 0
var bgG: CGFloat = 0
var bgB: CGFloat = 0
var bgA: CGFloat = 0
var fgR: CGFloat = 0
var fgG: CGFloat = 0
var fgB: CGFloat = 0
var fgA: CGFloat = 0
self.getRed(&bgR, green: &bgG, blue: &bgB, alpha: &bgA)
overlay.getRed(&fgR, green: &fgG, blue: &fgB, alpha: &fgA)
let r = fgA * fgR + (1 - fgA) * bgR
let g = fgA * fgG + (1 - fgA) * bgG
let b = fgA * fgB + (1 - fgA) * bgB
return UIColor(red: r, green: g, blue: b, alpha: 1.0)
}
}
| apache-2.0 | 5e2d9ba1ff3e5f871b0559a8f22b7fc2 | 30.395349 | 85 | 0.611481 | 4.205607 | false | false | false | false |
beforeload/calculate-app | Calculate/ViewController.swift | 1 | 2652 | //
// ViewController.swift
// Calculate
//
// Created by daniel on 9/25/14.
// Copyright (c) 2014 beforeload. All rights reserved.
//
import UIKit
class ViewController: UIViewController {
var lastNumber: String = ""
var endAllCalc: Bool = false
var endOneCalc: Bool = false
@IBOutlet weak var answerField: UILabel!
@IBOutlet weak var operatorLabel: UILabel!
override func viewDidLoad() {
super.viewDidLoad()
// Do any additional setup after loading the view, typically from a nib.
}
override func didReceiveMemoryWarning() {
super.didReceiveMemoryWarning()
// Dispose of any resources that can be recreated.
}
@IBAction func buttonTapped(theButton: UIButton) {
if answerField.text == "0" || endAllCalc || endOneCalc {
endAllCalc = false
endOneCalc = false
answerField.text = theButton.titleLabel?.text
} else {
if let txt = theButton.titleLabel?.text {
answerField.text = answerField.text! + txt
}
}
}
@IBAction func ClearTapped(sender: AnyObject) {
answerField.text = "0"
operatorLabel.text = ""
lastNumber = ""
}
@IBAction func minusTapped(sender: UIButton) {
if operatorLabel.text == "" {
operatorLabel.text = "-"
lastNumber = answerField.text!
answerField.text = "0"
} else {
caculate()
operatorLabel.text = "-"
}
}
@IBAction func plusTapped(sender: UIButton) {
if operatorLabel.text == "" {
operatorLabel.text = "+"
lastNumber = answerField.text!
answerField.text = "0"
} else {
caculate()
operatorLabel.text = "+"
}
}
@IBAction func enterTapped() {
endAllCalc = true
caculate()
}
func caculate() {
var num1 = lastNumber.toInt()
var num2 = answerField.text?.toInt()
var answer = 0
if (num1 == nil || (num2 == nil)) {
showError()
return
}
if operatorLabel.text == "-" {
answer = num1! - num2!
} else if operatorLabel.text == "+" {
answer = num1! + num2!
} else {
showError()
return
}
answerField.text = "\(answer)"
operatorLabel.text = ""
endOneCalc = true
if endAllCalc {
lastNumber = ""
} else {
lastNumber = "\(answer)"
}
}
func showError() {
}
}
| mit | 99c7a1d813e84ec53993eb8c28fa9f0a | 24.5 | 80 | 0.523756 | 4.830601 | false | false | false | false |
xusader/firefox-ios | Sync/State.swift | 2 | 13077 | /* This Source Code Form is subject to the terms of the Mozilla Public
* License, v. 2.0. If a copy of the MPL was not distributed with this
* file, You can obtain one at http://mozilla.org/MPL/2.0/. */
import Foundation
import Shared
import XCGLogger
// TODO: same comment as for SyncAuthState.swift!
private let log = XCGLogger.defaultInstance()
/*
* This file includes types that manage intra-sync and inter-sync metadata
* for the use of synchronizers and the state machine.
*
* See docs/sync.md for details on what exactly we need to persist.
*/
public struct Fetched<T: Equatable>: Equatable {
let value: T
let timestamp: Timestamp
}
public func ==<T: Equatable>(lhs: Fetched<T>, rhs: Fetched<T>) -> Bool {
return lhs.timestamp == rhs.timestamp &&
lhs.value == rhs.value
}
/*
* Persistence pref names.
* Note that syncKeyBundle isn't persisted by us.
*
* Note also that fetched keys aren't kept in prefs: we keep the timestamp ("PrefKeysTS"),
* and we keep a 'label'. This label is used to find the real fetched keys in the Keychain.
*/
private let PrefVersion = "_v"
private let PrefGlobal = "global"
private let PrefGlobalTS = "globalTS"
private let PrefKeyLabel = "keyLabel"
private let PrefKeysTS = "keysTS"
private let PrefLastFetched = "lastFetched"
private let PrefClientName = "clientName"
private let PrefClientGUID = "clientGUID"
/**
* The scratchpad consists of the following:
*
* 1. Cached records. We cache meta/global and crypto/keys until they change.
* 2. Metadata like timestamps, both for cached records and for server fetches.
* 3. User preferences -- engine enablement.
* 4. Client record state.
*
* Note that the scratchpad itself is immutable, but is a class passed by reference.
* Its mutable fields can be mutated, but you can't accidentally e.g., switch out
* meta/global and get confused.
*
* TODO: the Scratchpad needs to be loaded from persistent storage, and written
* back at certain points in the state machine (after a replayable action is taken).
*/
public class Scratchpad {
public class Builder {
var syncKeyBundle: KeyBundle // For the love of god, if you change this, invalidate keys, too!
private var global: Fetched<MetaGlobal>?
private var keys: Fetched<Keys>?
private var keyLabel: String
var collectionLastFetched: [String: Timestamp]
var engineConfiguration: EngineConfiguration?
var clientGUID: String
var clientName: String
var prefs: Prefs
init(p: Scratchpad) {
self.syncKeyBundle = p.syncKeyBundle
self.prefs = p.prefs
self.global = p.global
self.keys = p.keys
self.keyLabel = p.keyLabel
self.collectionLastFetched = p.collectionLastFetched
self.engineConfiguration = p.engineConfiguration
self.clientGUID = p.clientGUID
self.clientName = p.clientName
}
public func setKeys(keys: Fetched<Keys>?) -> Builder {
self.keys = keys
if let keys = keys {
self.collectionLastFetched["crypto"] = keys.timestamp
}
return self
}
public func setGlobal(global: Fetched<MetaGlobal>?) -> Builder {
self.global = global
if let global = global {
self.collectionLastFetched["meta"] = global.timestamp
}
return self
}
public func clearFetchTimestamps() -> Builder {
self.collectionLastFetched = [:]
return self
}
public func build() -> Scratchpad {
return Scratchpad(
b: self.syncKeyBundle,
m: self.global,
k: self.keys,
keyLabel: self.keyLabel,
fetches: self.collectionLastFetched,
engines: self.engineConfiguration,
clientGUID: self.clientGUID,
clientName: self.clientName,
persistingTo: self.prefs
)
}
}
public func evolve() -> Scratchpad.Builder {
return Scratchpad.Builder(p: self)
}
// This is never persisted.
let syncKeyBundle: KeyBundle
// Cached records.
// This cached meta/global is what we use to add or remove enabled engines. See also
// engineConfiguration, below.
// We also use it to detect when meta/global hasn't changed -- compare timestamps.
//
// Note that a Scratchpad held by a Ready state will have the current server meta/global
// here. That means we don't need to track syncIDs separately (which is how desktop and
// Android are implemented).
// If we don't have a meta/global, and thus we don't know syncIDs, it means we haven't
// synced with this server before, and we'll do a fresh sync.
let global: Fetched<MetaGlobal>?
// We don't store these keys (so-called "collection keys" or "bulk keys") in Prefs.
// Instead, we store a label, which is seeded when you first create a Scratchpad.
// This label is used to retrieve the real keys from your Keychain.
//
// Note that we also don't store the syncKeyBundle here. That's always created from kB,
// provided by the Firefox Account.
//
// Why don't we derive the label from your Sync Key? Firstly, we'd like to be able to
// clean up without having your key. Secondly, we don't want to accidentally load keys
// from the Keychain just because the Sync Key is the same -- e.g., after a node
// reassignment. Randomly generating a label offers all of the benefits with none of the
// problems, with only the cost of persisting that label alongside the rest of the state.
let keys: Fetched<Keys>?
let keyLabel: String
// Collection timestamps.
var collectionLastFetched: [String: Timestamp]
// Enablement states.
let engineConfiguration: EngineConfiguration?
// What's our client name?
let clientName: String
let clientGUID: String
// Where do we persist when told?
let prefs: Prefs
init(b: KeyBundle,
m: Fetched<MetaGlobal>?,
k: Fetched<Keys>?,
keyLabel: String,
fetches: [String: Timestamp],
engines: EngineConfiguration?,
clientGUID: String,
clientName: String,
persistingTo prefs: Prefs
) {
self.syncKeyBundle = b
self.prefs = prefs
self.keys = k
self.keyLabel = keyLabel
self.global = m
self.engineConfiguration = engines
self.collectionLastFetched = fetches
self.clientGUID = clientGUID
self.clientName = clientName
}
// This should never be used in the end; we'll unpickle instead.
// This should be a convenience initializer, but... Swift compiler bug?
init(b: KeyBundle, persistingTo prefs: Prefs) {
self.syncKeyBundle = b
self.prefs = prefs
self.keys = nil
self.keyLabel = Bytes.generateGUID()
self.global = nil
self.engineConfiguration = nil
self.collectionLastFetched = [String: Timestamp]()
self.clientGUID = Bytes.generateGUID()
self.clientName = DeviceInfo.defaultClientName()
}
// For convenience.
func withGlobal(m: Fetched<MetaGlobal>?) -> Scratchpad {
return self.evolve().setGlobal(m).build()
}
func freshStartWithGlobal(global: Fetched<MetaGlobal>) -> Scratchpad {
// TODO: I *think* a new keyLabel is unnecessary.
return self.evolve()
.setGlobal(global)
.setKeys(nil)
.clearFetchTimestamps()
.build()
}
func applyEngineChoices(old: MetaGlobal?) -> (Scratchpad, MetaGlobal?) {
log.info("Applying engine choices from inbound meta/global.")
log.info("Old meta/global syncID: \(old?.syncID)")
log.info("New meta/global syncID: \(self.global?.value.syncID)")
log.info("HACK: ignoring engine choices.")
// TODO: detect when the sets of declined or enabled engines have changed, and update
// our preferences and generate a new meta/global if necessary.
return (self, nil)
}
private class func unpickleV1FromPrefs(prefs: Prefs, syncKeyBundle: KeyBundle) -> Scratchpad {
let b = Scratchpad(b: syncKeyBundle, persistingTo: prefs).evolve()
// Do this first so that the meta/global and crypto/keys unpickling can overwrite the timestamps.
if let lastFetched: [String: AnyObject] = prefs.dictionaryForKey(PrefLastFetched) {
b.collectionLastFetched = optFilter(mapValues(lastFetched, { ($0 as? NSNumber)?.unsignedLongLongValue }))
}
if let mg = prefs.stringForKey(PrefGlobal) {
if let mgTS = prefs.unsignedLongForKey(PrefGlobalTS) {
if let global = MetaGlobal.fromPayload(mg) {
b.setGlobal(Fetched(value: global, timestamp: mgTS))
} else {
log.error("Malformed meta/global in prefs. Ignoring.")
}
} else {
// This should never happen.
log.error("Found global in prefs, but not globalTS!")
}
}
if let keyLabel = prefs.stringForKey(PrefKeyLabel) {
b.keyLabel = keyLabel
if let ckTS = prefs.unsignedLongForKey(PrefKeysTS) {
if let keys = KeychainWrapper.stringForKey("keys." + keyLabel) {
// We serialize as JSON.
let keys = Keys(payload: KeysPayload(keys))
if keys.valid {
log.debug("Read keys from Keychain with label \(keyLabel).")
b.setKeys(Fetched(value: keys, timestamp: ckTS))
} else {
log.error("Invalid keys extracted from Keychain. Discarding.")
}
} else {
log.error("Found keysTS in prefs, but didn't find keys in Keychain!")
}
}
}
b.clientGUID = prefs.stringForKey(PrefClientGUID) ?? {
log.error("No value found in prefs for client GUID! Generating one.")
return Bytes.generateGUID()
}()
b.clientName = prefs.stringForKey(PrefClientName) ?? {
log.error("No value found in prefs for client name! Using default.")
return DeviceInfo.defaultClientName()
}()
// TODO: engineConfiguration
return b.build()
}
public class func restoreFromPrefs(prefs: Prefs, syncKeyBundle: KeyBundle) -> Scratchpad? {
if let ver = prefs.intForKey(PrefVersion) {
switch (ver) {
case 1:
return unpickleV1FromPrefs(prefs, syncKeyBundle: syncKeyBundle)
default:
return nil
}
}
log.debug("No scratchpad found in prefs.")
return nil
}
/**
* Persist our current state to our origin prefs.
* Note that calling this from multiple threads with either mutated or evolved
* scratchpads will cause sadness — individual writes are thread-safe, but the
* overall pseudo-transaction is not atomic.
*/
public func checkpoint() -> Scratchpad {
return pickle(self.prefs)
}
func pickle(prefs: Prefs) -> Scratchpad {
prefs.setInt(1, forKey: PrefVersion)
if let global = global {
prefs.setLong(global.timestamp, forKey: PrefGlobalTS)
prefs.setString(global.value.toPayload().toString(), forKey: PrefGlobal)
} else {
prefs.removeObjectForKey(PrefGlobal)
prefs.removeObjectForKey(PrefGlobalTS)
}
// We store the meat of your keys in the Keychain, using a random identifier that we persist in prefs.
prefs.setString(self.keyLabel, forKey: PrefKeyLabel)
if let keys = self.keys {
let payload = keys.value.asPayload().toString(pretty: false)
let label = "keys." + self.keyLabel
log.debug("Storing keys in Keychain with label \(label).")
prefs.setString(self.keyLabel, forKey: PrefKeyLabel)
prefs.setLong(keys.timestamp, forKey: PrefKeysTS)
// TODO: I could have sworn that we could specify kSecAttrAccessibleAfterFirstUnlock here.
KeychainWrapper.setString(payload, forKey: label)
} else {
log.debug("Removing keys from Keychain.")
KeychainWrapper.removeObjectForKey(self.keyLabel)
}
// TODO: engineConfiguration
prefs.setString(clientName, forKey: PrefClientName)
prefs.setString(clientGUID, forKey: PrefClientGUID)
// Thanks, Swift.
let dict = mapValues(collectionLastFetched, { NSNumber(unsignedLongLong: $0) }) as NSDictionary
prefs.setObject(dict, forKey: PrefLastFetched)
return self
}
}
| mpl-2.0 | 7bcfdba4088492798695ef4c51ff4f12 | 36.357143 | 117 | 0.622409 | 4.837218 | false | false | false | false |
kesun421/firefox-ios | Client/Frontend/Browser/TabTrayController.swift | 2 | 43665 | /* This Source Code Form is subject to the terms of the Mozilla Public
* License, v. 2.0. If a copy of the MPL was not distributed with this
* file, You can obtain one at http://mozilla.org/MPL/2.0/. */
import Foundation
import UIKit
import SnapKit
import Storage
import ReadingList
import Shared
struct TabTrayControllerUX {
static let CornerRadius = CGFloat(6.0)
static let BackgroundColor = UIConstants.TabTrayBG
static let CellBackgroundColor = UIConstants.TabTrayBG
static let TextBoxHeight = CGFloat(32.0)
static let FaviconSize = CGFloat(20)
static let Margin = CGFloat(15)
static let ToolbarBarTintColor = UIColor.black
static let ToolbarButtonOffset = CGFloat(10.0)
static let CloseButtonSize = CGFloat(18.0)
static let CloseButtonMargin = CGFloat(6.0)
static let CloseButtonEdgeInset = CGFloat(10)
static let NumberOfColumnsThin = 1
static let NumberOfColumnsWide = 3
static let CompactNumberOfColumnsThin = 2
static let MenuFixedWidth: CGFloat = 320
}
struct LightTabCellUX {
static let TabTitleTextColor = UIColor.black
}
struct DarkTabCellUX {
static let TabTitleTextColor = UIColor.white
}
protocol TabCellDelegate: class {
func tabCellDidClose(_ cell: TabCell)
}
class TabCell: UICollectionViewCell {
enum Style {
case light
case dark
}
static let Identifier = "TabCellIdentifier"
static let BorderWidth: CGFloat = 3
var style: Style = .light {
didSet {
applyStyle(style)
}
}
let backgroundHolder = UIView()
let screenshotView = UIImageViewAligned()
let titleText: UILabel
let favicon: UIImageView = UIImageView()
let closeButton: UIButton
var title: UIVisualEffectView!
var animator: SwipeAnimator!
weak var delegate: TabCellDelegate?
// Changes depending on whether we're full-screen or not.
var margin = CGFloat(0)
override init(frame: CGRect) {
self.backgroundHolder.backgroundColor = UIColor.white
self.backgroundHolder.layer.cornerRadius = TabTrayControllerUX.CornerRadius
self.backgroundHolder.clipsToBounds = true
self.backgroundHolder.backgroundColor = TabTrayControllerUX.CellBackgroundColor
self.screenshotView.contentMode = UIViewContentMode.scaleAspectFill
self.screenshotView.clipsToBounds = true
self.screenshotView.isUserInteractionEnabled = false
self.screenshotView.alignLeft = true
self.screenshotView.alignTop = true
screenshotView.backgroundColor = UIConstants.AppBackgroundColor
self.favicon.backgroundColor = UIColor.clear
self.favicon.layer.cornerRadius = 2.0
self.favicon.layer.masksToBounds = true
self.titleText = UILabel()
self.titleText.textAlignment = NSTextAlignment.left
self.titleText.isUserInteractionEnabled = false
self.titleText.numberOfLines = 1
self.titleText.font = DynamicFontHelper.defaultHelper.DefaultSmallFontBold
self.closeButton = UIButton()
self.closeButton.setImage(UIImage.templateImageNamed("nav-stop"), for: UIControlState())
self.closeButton.tintColor = UIColor.lightGray
self.closeButton.imageEdgeInsets = UIEdgeInsets(equalInset: TabTrayControllerUX.CloseButtonEdgeInset)
super.init(frame: frame)
self.animator = SwipeAnimator(animatingView: self)
self.closeButton.addTarget(self, action: #selector(TabCell.close), for: UIControlEvents.touchUpInside)
contentView.addSubview(backgroundHolder)
backgroundHolder.addSubview(self.screenshotView)
// Default style is light
applyStyle(style)
self.accessibilityCustomActions = [
UIAccessibilityCustomAction(name: NSLocalizedString("Close", comment: "Accessibility label for action denoting closing a tab in tab list (tray)"), target: self.animator, selector: #selector(SwipeAnimator.closeWithoutGesture))
]
}
fileprivate func applyStyle(_ style: Style) {
self.title?.removeFromSuperview()
let title: UIVisualEffectView
switch style {
case .light:
title = UIVisualEffectView(effect: UIBlurEffect(style: .extraLight))
self.titleText.textColor = LightTabCellUX.TabTitleTextColor
case .dark:
title = UIVisualEffectView(effect: UIBlurEffect(style: .dark))
self.titleText.textColor = DarkTabCellUX.TabTitleTextColor
}
titleText.backgroundColor = UIColor.clear
title.contentView.addSubview(self.closeButton)
title.contentView.addSubview(self.titleText)
title.contentView.addSubview(self.favicon)
backgroundHolder.addSubview(title)
self.title = title
}
func setTabSelected(_ isPrivate: Bool) {
// This creates a border around a tabcell. Using the shadow craetes a border _outside_ of the tab frame.
layer.shadowColor = (isPrivate ? UIConstants.PrivateModePurple : UIConstants.SystemBlueColor).cgColor
layer.shadowOpacity = 1
layer.shadowRadius = 0 // A 0 radius creates a solid border instead of a gradient blur
layer.masksToBounds = false
// create a frame that is "BorderWidth" size bigger than the cell
layer.shadowOffset = CGSize(width: -TabCell.BorderWidth, height: -TabCell.BorderWidth)
let shadowPath = CGRect(x: 0, y: 0, width: layer.frame.width + (TabCell.BorderWidth * 2), height: layer.frame.height + (TabCell.BorderWidth * 2))
layer.shadowPath = UIBezierPath(roundedRect: shadowPath, cornerRadius: TabTrayControllerUX.CornerRadius+TabCell.BorderWidth).cgPath
}
required init?(coder aDecoder: NSCoder) {
fatalError("init(coder:) has not been implemented")
}
override func layoutSubviews() {
super.layoutSubviews()
let w = frame.width
let h = frame.height
backgroundHolder.frame = CGRect(x: margin,
y: margin,
width: w,
height: h)
screenshotView.frame = CGRect(origin: CGPoint(x: 0, y: 0), size: backgroundHolder.frame.size)
title.frame = CGRect(x: 0,
y: 0,
width: backgroundHolder.frame.width,
height: TabTrayControllerUX.TextBoxHeight)
favicon.frame = CGRect(x: 6,
y: (TabTrayControllerUX.TextBoxHeight - TabTrayControllerUX.FaviconSize)/2,
width: TabTrayControllerUX.FaviconSize,
height: TabTrayControllerUX.FaviconSize)
let titleTextLeft = favicon.frame.origin.x + favicon.frame.width + 6
titleText.frame = CGRect(x: titleTextLeft,
y: 0,
width: title.frame.width - titleTextLeft - margin - TabTrayControllerUX.CloseButtonSize - TabTrayControllerUX.CloseButtonMargin * 2,
height: title.frame.height)
closeButton.snp.makeConstraints { make in
make.size.equalTo(title.snp.height)
make.trailing.centerY.equalTo(title)
}
let top = (TabTrayControllerUX.TextBoxHeight - titleText.bounds.height) / 2.0
titleText.frame.origin = CGPoint(x: titleText.frame.origin.x, y: max(0, top))
let shadowPath = CGRect(x: 0, y: 0, width: layer.frame.width + (TabCell.BorderWidth * 2), height: layer.frame.height + (TabCell.BorderWidth * 2))
layer.shadowPath = UIBezierPath(roundedRect: shadowPath, cornerRadius: TabTrayControllerUX.CornerRadius+TabCell.BorderWidth).cgPath
}
override func prepareForReuse() {
// Reset any close animations.
backgroundHolder.transform = CGAffineTransform.identity
backgroundHolder.alpha = 1
self.titleText.font = DynamicFontHelper.defaultHelper.DefaultSmallFontBold
layer.shadowOffset = CGSize.zero
layer.shadowPath = nil
layer.shadowOpacity = 0
}
override func accessibilityScroll(_ direction: UIAccessibilityScrollDirection) -> Bool {
var right: Bool
switch direction {
case .left:
right = false
case .right:
right = true
default:
return false
}
animator.close(right: right)
return true
}
@objc
func close() {
self.animator.closeWithoutGesture()
}
}
struct PrivateModeStrings {
static let toggleAccessibilityLabel = NSLocalizedString("Private Mode", tableName: "PrivateBrowsing", comment: "Accessibility label for toggling on/off private mode")
static let toggleAccessibilityHint = NSLocalizedString("Turns private mode on or off", tableName: "PrivateBrowsing", comment: "Accessiblity hint for toggling on/off private mode")
static let toggleAccessibilityValueOn = NSLocalizedString("On", tableName: "PrivateBrowsing", comment: "Toggled ON accessibility value")
static let toggleAccessibilityValueOff = NSLocalizedString("Off", tableName: "PrivateBrowsing", comment: "Toggled OFF accessibility value")
}
protocol TabTrayDelegate: class {
func tabTrayDidDismiss(_ tabTray: TabTrayController)
func tabTrayDidAddBookmark(_ tab: Tab)
func tabTrayDidAddToReadingList(_ tab: Tab) -> ReadingListClientRecord?
func tabTrayRequestsPresentationOf(_ viewController: UIViewController)
}
class TabTrayController: UIViewController {
let tabManager: TabManager
let profile: Profile
weak var delegate: TabTrayDelegate?
var collectionView: UICollectionView!
var draggedCell: TabCell?
var dragOffset: CGPoint = CGPoint.zero
lazy var toolbar: TrayToolbar = {
let toolbar = TrayToolbar()
toolbar.addTabButton.addTarget(self, action: #selector(TabTrayController.didClickAddTab), for: .touchUpInside)
toolbar.maskButton.addTarget(self, action: #selector(TabTrayController.didTogglePrivateMode), for: .touchUpInside)
toolbar.deleteButton.addTarget(self, action: #selector(TabTrayController.didTapDelete(_:)), for: .touchUpInside)
return toolbar
}()
fileprivate(set) internal var privateMode: Bool = false {
didSet {
tabDataSource.tabs = tabsToDisplay
toolbar.styleToolbar(privateMode)
collectionView?.reloadData()
}
}
fileprivate var tabsToDisplay: [Tab] {
return self.privateMode ? tabManager.privateTabs : tabManager.normalTabs
}
fileprivate lazy var emptyPrivateTabsView: EmptyPrivateTabsView = {
let emptyView = EmptyPrivateTabsView()
emptyView.learnMoreButton.addTarget(self, action: #selector(TabTrayController.didTapLearnMore), for: UIControlEvents.touchUpInside)
return emptyView
}()
fileprivate lazy var tabDataSource: TabManagerDataSource = {
return TabManagerDataSource(tabs: self.tabsToDisplay, cellDelegate: self, tabManager: self.tabManager)
}()
fileprivate lazy var tabLayoutDelegate: TabLayoutDelegate = {
let delegate = TabLayoutDelegate(profile: self.profile, traitCollection: self.traitCollection)
delegate.tabSelectionDelegate = self
return delegate
}()
init(tabManager: TabManager, profile: Profile) {
self.tabManager = tabManager
self.profile = profile
super.init(nibName: nil, bundle: nil)
tabManager.addDelegate(self)
}
convenience init(tabManager: TabManager, profile: Profile, tabTrayDelegate: TabTrayDelegate) {
self.init(tabManager: tabManager, profile: profile)
self.delegate = tabTrayDelegate
}
required init?(coder aDecoder: NSCoder) {
fatalError("init(coder:) has not been implemented")
}
deinit {
self.tabManager.removeDelegate(self)
}
func dynamicFontChanged(_ notification: Notification) {
guard notification.name == NotificationDynamicFontChanged else { return }
self.collectionView.reloadData()
}
// MARK: View Controller Callbacks
override func viewDidLoad() {
super.viewDidLoad()
view.accessibilityLabel = NSLocalizedString("Tabs Tray", comment: "Accessibility label for the Tabs Tray view.")
collectionView = UICollectionView(frame: view.frame, collectionViewLayout: UICollectionViewFlowLayout())
collectionView.dataSource = tabDataSource
collectionView.delegate = tabLayoutDelegate
collectionView.contentInset = UIEdgeInsets(top: 0, left: 0, bottom: UIConstants.BottomToolbarHeight, right: 0)
collectionView.register(TabCell.self, forCellWithReuseIdentifier: TabCell.Identifier)
collectionView.backgroundColor = TabTrayControllerUX.BackgroundColor
view.addSubview(collectionView)
view.addSubview(toolbar)
makeConstraints()
view.insertSubview(emptyPrivateTabsView, aboveSubview: collectionView)
emptyPrivateTabsView.snp.makeConstraints { make in
make.top.left.right.equalTo(self.collectionView)
make.bottom.equalTo(self.toolbar.snp.top)
}
if let tab = tabManager.selectedTab, tab.isPrivate {
privateMode = true
}
// register for previewing delegate to enable peek and pop if force touch feature available
if traitCollection.forceTouchCapability == .available {
registerForPreviewing(with: self, sourceView: view)
}
emptyPrivateTabsView.isHidden = !privateTabsAreEmpty()
NotificationCenter.default.addObserver(self, selector: #selector(TabTrayController.appWillResignActiveNotification), name: NSNotification.Name.UIApplicationWillResignActive, object: nil)
NotificationCenter.default.addObserver(self, selector: #selector(TabTrayController.appDidBecomeActiveNotification), name: NSNotification.Name.UIApplicationDidBecomeActive, object: nil)
NotificationCenter.default.addObserver(self, selector: #selector(TabTrayController.dynamicFontChanged(_:)), name: NotificationDynamicFontChanged, object: nil)
}
override func viewWillAppear(_ animated: Bool) {
super.viewWillAppear(animated)
}
override func viewDidDisappear(_ animated: Bool) {
super.viewDidDisappear(animated)
}
override func traitCollectionDidChange(_ previousTraitCollection: UITraitCollection?) {
super.traitCollectionDidChange(previousTraitCollection)
// Update the trait collection we reference in our layout delegate
tabLayoutDelegate.traitCollection = traitCollection
self.collectionView.collectionViewLayout.invalidateLayout()
}
fileprivate func cancelExistingGestures() {
if let visibleCells = self.collectionView.visibleCells as? [TabCell] {
for cell in visibleCells {
cell.animator.cancelExistingGestures()
}
}
}
override func viewWillTransition(to size: CGSize, with coordinator: UIViewControllerTransitionCoordinator) {
super.viewWillTransition(to: size, with: coordinator)
coordinator.animate(alongsideTransition: { _ in
self.collectionView.collectionViewLayout.invalidateLayout()
}, completion: nil)
}
override var preferredStatusBarStyle: UIStatusBarStyle {
return UIStatusBarStyle.lightContent //this will need to be fixed
}
fileprivate func makeConstraints() {
collectionView.snp.makeConstraints { make in
make.left.bottom.right.equalTo(view)
make.top.equalTo(self.topLayoutGuide.snp.bottom)
}
toolbar.snp.makeConstraints { make in
make.left.right.bottom.equalTo(view)
make.height.equalTo(UIConstants.BottomToolbarHeight)
}
}
// MARK: Selectors
func didClickDone() {
presentingViewController!.dismiss(animated: true, completion: nil)
}
func didClickSettingsItem() {
assert(Thread.isMainThread, "Opening settings requires being invoked on the main thread")
let settingsTableViewController = AppSettingsTableViewController()
settingsTableViewController.profile = profile
settingsTableViewController.tabManager = tabManager
settingsTableViewController.settingsDelegate = self
let controller = SettingsNavigationController(rootViewController: settingsTableViewController)
controller.popoverDelegate = self
controller.modalPresentationStyle = UIModalPresentationStyle.formSheet
present(controller, animated: true, completion: nil)
}
func didClickAddTab() {
openNewTab()
LeanplumIntegration.sharedInstance.track(eventName: .openedNewTab, withParameters: ["Source": "Tab Tray" as AnyObject])
}
func didTapLearnMore() {
let appVersion = Bundle.main.object(forInfoDictionaryKey: "CFBundleShortVersionString") as! String
if let langID = Locale.preferredLanguages.first {
let learnMoreRequest = URLRequest(url: "https://support.mozilla.org/1/mobile/\(appVersion)/iOS/\(langID)/private-browsing-ios".asURL!)
openNewTab(learnMoreRequest)
}
}
func didTogglePrivateMode() {
let scaleDownTransform = CGAffineTransform(scaleX: 0.9, y: 0.9)
let fromView: UIView
if !privateTabsAreEmpty(), let snapshot = collectionView.snapshotView(afterScreenUpdates: false) {
snapshot.frame = collectionView.frame
view.insertSubview(snapshot, aboveSubview: collectionView)
fromView = snapshot
} else {
fromView = emptyPrivateTabsView
}
tabManager.willSwitchTabMode()
privateMode = !privateMode
// If we are exiting private mode and we have the close private tabs option selected, make sure
// we clear out all of the private tabs
let exitingPrivateMode = !privateMode && tabManager.shouldClearPrivateTabs()
toolbar.maskButton.setSelected(privateMode, animated: true)
collectionView.layoutSubviews()
let toView: UIView
if !privateTabsAreEmpty(), let newSnapshot = collectionView.snapshotView(afterScreenUpdates: !exitingPrivateMode) {
emptyPrivateTabsView.isHidden = true
//when exiting private mode don't screenshot the collectionview (causes the UI to hang)
newSnapshot.frame = collectionView.frame
view.insertSubview(newSnapshot, aboveSubview: fromView)
collectionView.alpha = 0
toView = newSnapshot
} else {
emptyPrivateTabsView.isHidden = false
toView = emptyPrivateTabsView
}
toView.alpha = 0
toView.transform = scaleDownTransform
UIView.animate(withDuration: 0.2, delay: 0, options: [], animations: { () -> Void in
fromView.transform = scaleDownTransform
fromView.alpha = 0
toView.transform = CGAffineTransform.identity
toView.alpha = 1
}) { finished in
if fromView != self.emptyPrivateTabsView {
fromView.removeFromSuperview()
}
if toView != self.emptyPrivateTabsView {
toView.removeFromSuperview()
}
self.collectionView.alpha = 1
}
}
fileprivate func privateTabsAreEmpty() -> Bool {
return privateMode && tabManager.privateTabs.count == 0
}
func changePrivacyMode(_ isPrivate: Bool) {
if isPrivate != privateMode {
guard let _ = collectionView else {
privateMode = isPrivate
return
}
didTogglePrivateMode()
}
}
fileprivate func openNewTab(_ request: URLRequest? = nil) {
toolbar.isUserInteractionEnabled = false
// We're only doing one update here, but using a batch update lets us delay selecting the tab
// until after its insert animation finishes.
self.collectionView.performBatchUpdates({ _ in
let tab = self.tabManager.addTab(request, isPrivate: self.privateMode)
}, completion: { finished in
// The addTab delegate method will pop to the BVC no need to do anything here.
self.toolbar.isUserInteractionEnabled = true
if finished {
if request == nil && NewTabAccessors.getNewTabPage(self.profile.prefs) == .blankPage {
if let bvc = self.navigationController?.topViewController as? BrowserViewController {
DispatchQueue.main.asyncAfter(deadline: .now() + 0.6) {
bvc.urlBar.tabLocationViewDidTapLocation(bvc.urlBar.locationView)
}
}
}
}
})
}
fileprivate func closeTabsForCurrentTray() {
tabManager.removeTabsWithUndoToast(tabsToDisplay)
self.collectionView.reloadData()
}
}
// MARK: - App Notifications
extension TabTrayController {
func appWillResignActiveNotification() {
if privateMode {
collectionView.alpha = 0
}
}
func appDidBecomeActiveNotification() {
// Re-show any components that might have been hidden because they were being displayed
// as part of a private mode tab
UIView.animate(withDuration: 0.2, delay: 0, options: UIViewAnimationOptions(), animations: {
self.collectionView.alpha = 1
},
completion: nil)
}
}
extension TabTrayController: TabSelectionDelegate {
func didSelectTabAtIndex(_ index: Int) {
let tab = tabsToDisplay[index]
tabManager.selectTab(tab)
_ = self.navigationController?.popViewController(animated: true)
}
}
extension TabTrayController: PresentingModalViewControllerDelegate {
func dismissPresentedModalViewController(_ modalViewController: UIViewController, animated: Bool) {
dismiss(animated: animated, completion: { self.collectionView.reloadData() })
}
}
extension TabTrayController: TabManagerDelegate {
func tabManager(_ tabManager: TabManager, didSelectedTabChange selected: Tab?, previous: Tab?) {
}
func tabManager(_ tabManager: TabManager, willAddTab tab: Tab) {
}
func tabManager(_ tabManager: TabManager, willRemoveTab tab: Tab) {
}
func tabManager(_ tabManager: TabManager, didAddTab tab: Tab) {
// Get the index of the added tab from it's set (private or normal)
guard let index = tabsToDisplay.index(of: tab) else { return }
if !privateTabsAreEmpty() {
emptyPrivateTabsView.isHidden = true
}
tabDataSource.addTab(tab)
self.collectionView?.performBatchUpdates({ _ in
self.collectionView.insertItems(at: [IndexPath(item: index, section: 0)])
}, completion: { finished in
if finished {
tabManager.selectTab(tab)
// don't pop the tab tray view controller if it is not in the foreground
if self.presentedViewController == nil {
_ = self.navigationController?.popViewController(animated: true)
}
}
})
}
func tabManager(_ tabManager: TabManager, didRemoveTab tab: Tab) {
// it is possible that we are removing a tab that we are not currently displaying
// through the Close All Tabs feature (which will close tabs that are not in our current privacy mode)
// check this before removing the item from the collection
let removedIndex = tabDataSource.removeTab(tab)
if removedIndex > -1 {
self.collectionView.performBatchUpdates({
self.collectionView.deleteItems(at: [IndexPath(item: removedIndex, section: 0)])
}, completion: { finished in
guard finished && self.privateTabsAreEmpty() else { return }
self.emptyPrivateTabsView.isHidden = false
})
}
}
func tabManagerDidAddTabs(_ tabManager: TabManager) {
}
func tabManagerDidRestoreTabs(_ tabManager: TabManager) {
}
func tabManagerDidRemoveAllTabs(_ tabManager: TabManager, toast: ButtonToast?) {
guard privateMode else {
return
}
if let toast = toast {
view.addSubview(toast)
toast.snp.makeConstraints { make in
make.left.right.equalTo(view)
make.bottom.equalTo(toolbar.snp.top)
}
toast.showToast()
}
}
}
extension TabTrayController: UIScrollViewAccessibilityDelegate {
func accessibilityScrollStatus(for scrollView: UIScrollView) -> String? {
var visibleCells = collectionView.visibleCells as! [TabCell]
var bounds = collectionView.bounds
bounds = bounds.offsetBy(dx: collectionView.contentInset.left, dy: collectionView.contentInset.top)
bounds.size.width -= collectionView.contentInset.left + collectionView.contentInset.right
bounds.size.height -= collectionView.contentInset.top + collectionView.contentInset.bottom
// visible cells do sometimes return also not visible cells when attempting to go past the last cell with VoiceOver right-flick gesture; so make sure we have only visible cells (yeah...)
visibleCells = visibleCells.filter { !$0.frame.intersection(bounds).isEmpty }
let cells = visibleCells.map { self.collectionView.indexPath(for: $0)! }
let indexPaths = cells.sorted { (a: IndexPath, b: IndexPath) -> Bool in
return a.section < b.section || (a.section == b.section && a.row < b.row)
}
if indexPaths.count == 0 {
return NSLocalizedString("No tabs", comment: "Message spoken by VoiceOver to indicate that there are no tabs in the Tabs Tray")
}
let firstTab = indexPaths.first!.row + 1
let lastTab = indexPaths.last!.row + 1
let tabCount = collectionView.numberOfItems(inSection: 0)
if firstTab == lastTab {
let format = NSLocalizedString("Tab %@ of %@", comment: "Message spoken by VoiceOver saying the position of the single currently visible tab in Tabs Tray, along with the total number of tabs. E.g. \"Tab 2 of 5\" says that tab 2 is visible (and is the only visible tab), out of 5 tabs total.")
return String(format: format, NSNumber(value: firstTab as Int), NSNumber(value: tabCount as Int))
} else {
let format = NSLocalizedString("Tabs %@ to %@ of %@", comment: "Message spoken by VoiceOver saying the range of tabs that are currently visible in Tabs Tray, along with the total number of tabs. E.g. \"Tabs 8 to 10 of 15\" says tabs 8, 9 and 10 are visible, out of 15 tabs total.")
return String(format: format, NSNumber(value: firstTab as Int), NSNumber(value: lastTab as Int), NSNumber(value: tabCount as Int))
}
}
}
extension TabTrayController: SwipeAnimatorDelegate {
func swipeAnimator(_ animator: SwipeAnimator, viewWillExitContainerBounds: UIView) {
let tabCell = animator.animatingView as! TabCell
if let indexPath = collectionView.indexPath(for: tabCell) {
let tab = tabsToDisplay[indexPath.item]
tabManager.removeTab(tab)
UIAccessibilityPostNotification(UIAccessibilityAnnouncementNotification, NSLocalizedString("Closing tab", comment: "Accessibility label (used by assistive technology) notifying the user that the tab is being closed."))
}
}
}
extension TabTrayController: TabCellDelegate {
func tabCellDidClose(_ cell: TabCell) {
let indexPath = collectionView.indexPath(for: cell)!
let tab = tabsToDisplay[indexPath.item]
tabManager.removeTab(tab)
}
}
extension TabTrayController: SettingsDelegate {
func settingsOpenURLInNewTab(_ url: URL) {
let request = URLRequest(url: url)
openNewTab(request)
}
}
extension TabTrayController: PhotonActionSheetProtocol {
func didTapDelete(_ sender: UIButton) {
let controller = UIAlertController(title: nil, message: nil, preferredStyle: .actionSheet)
controller.addAction(UIAlertAction(title: Strings.AppMenuCloseAllTabsTitleString, style: .default, handler: { _ in self.closeTabsForCurrentTray() }))
controller.addAction(UIAlertAction(title: NSLocalizedString("Cancel", comment: "Label for Cancel button"), style: .cancel, handler: nil))
controller.popoverPresentationController?.sourceView = sender
controller.popoverPresentationController?.sourceRect = sender.bounds
present(controller, animated: true, completion: nil)
}
}
fileprivate class TabManagerDataSource: NSObject, UICollectionViewDataSource {
unowned var cellDelegate: TabCellDelegate & SwipeAnimatorDelegate
fileprivate var tabs: [Tab]
fileprivate var tabManager: TabManager
init(tabs: [Tab], cellDelegate: TabCellDelegate & SwipeAnimatorDelegate, tabManager: TabManager) {
self.cellDelegate = cellDelegate
self.tabs = tabs
self.tabManager = tabManager
super.init()
}
/**
Removes the given tab from the data source
- parameter tab: Tab to remove
- returns: The index of the removed tab, -1 if tab did not exist
*/
func removeTab(_ tabToRemove: Tab) -> Int {
var index: Int = -1
for (i, tab) in tabs.enumerated() where tabToRemove === tab {
index = i
tabs.remove(at: index)
break
}
return index
}
/**
Adds the given tab to the data source
- parameter tab: Tab to add
*/
func addTab(_ tab: Tab) {
tabs.append(tab)
}
@objc func collectionView(_ collectionView: UICollectionView, cellForItemAt indexPath: IndexPath) -> UICollectionViewCell {
let tabCell = collectionView.dequeueReusableCell(withReuseIdentifier: TabCell.Identifier, for: indexPath) as! TabCell
tabCell.animator.delegate = cellDelegate
tabCell.delegate = cellDelegate
let tab = tabs[indexPath.item]
tabCell.style = tab.isPrivate ? .dark : .light
tabCell.titleText.text = tab.displayTitle
tabCell.closeButton.tintColor = tab.isPrivate ? UIColor.white : UIColor.gray
if !tab.displayTitle.isEmpty {
tabCell.accessibilityLabel = tab.displayTitle
} else {
tabCell.accessibilityLabel = tab.url?.aboutComponent ?? "" // If there is no title we are most likely on a home panel.
}
tabCell.isAccessibilityElement = true
tabCell.accessibilityHint = NSLocalizedString("Swipe right or left with three fingers to close the tab.", comment: "Accessibility hint for tab tray's displayed tab.")
if let favIcon = tab.displayFavicon {
tabCell.favicon.sd_setImage(with: URL(string: favIcon.url)!)
} else {
let defaultFavicon = UIImage(named: "defaultFavicon")
if tab.isPrivate {
tabCell.favicon.image = defaultFavicon
tabCell.favicon.tintColor = UIColor.white
} else {
tabCell.favicon.image = defaultFavicon
}
}
if tab == tabManager.selectedTab {
tabCell.setTabSelected(tab.isPrivate)
}
tabCell.screenshotView.image = tab.screenshot
return tabCell
}
@objc func collectionView(_ collectionView: UICollectionView, numberOfItemsInSection section: Int) -> Int {
return tabs.count
}
@objc fileprivate func collectionView(_ collectionView: UICollectionView, moveItemAt sourceIndexPath: IndexPath, to destinationIndexPath: IndexPath) {
let fromIndex = sourceIndexPath.item
let toIndex = destinationIndexPath.item
tabs.insert(tabs.remove(at: fromIndex), at: toIndex < fromIndex ? toIndex : toIndex - 1)
tabManager.moveTab(isPrivate: tabs[fromIndex].isPrivate, fromIndex: fromIndex, toIndex: toIndex)
}
}
@objc protocol TabSelectionDelegate: class {
func didSelectTabAtIndex(_ index: Int)
}
fileprivate class TabLayoutDelegate: NSObject, UICollectionViewDelegateFlowLayout {
weak var tabSelectionDelegate: TabSelectionDelegate?
fileprivate var traitCollection: UITraitCollection
fileprivate var profile: Profile
fileprivate var numberOfColumns: Int {
// iPhone 4-6+ portrait
if traitCollection.horizontalSizeClass == .compact && traitCollection.verticalSizeClass == .regular {
return TabTrayControllerUX.CompactNumberOfColumnsThin
} else {
return TabTrayControllerUX.NumberOfColumnsWide
}
}
init(profile: Profile, traitCollection: UITraitCollection) {
self.profile = profile
self.traitCollection = traitCollection
super.init()
}
fileprivate func cellHeightForCurrentDevice() -> CGFloat {
let shortHeight = TabTrayControllerUX.TextBoxHeight * 6
if self.traitCollection.verticalSizeClass == UIUserInterfaceSizeClass.compact {
return shortHeight
} else if self.traitCollection.horizontalSizeClass == UIUserInterfaceSizeClass.compact {
return shortHeight
} else {
return TabTrayControllerUX.TextBoxHeight * 8
}
}
@objc func collectionView(_ collectionView: UICollectionView, layout collectionViewLayout: UICollectionViewLayout, minimumInteritemSpacingForSectionAt section: Int) -> CGFloat {
return TabTrayControllerUX.Margin
}
@objc func collectionView(_ collectionView: UICollectionView, layout collectionViewLayout: UICollectionViewLayout, sizeForItemAt indexPath: IndexPath) -> CGSize {
let cellWidth = floor((collectionView.bounds.width - TabTrayControllerUX.Margin * CGFloat(numberOfColumns + 1)) / CGFloat(numberOfColumns))
return CGSize(width: cellWidth, height: self.cellHeightForCurrentDevice())
}
@objc func collectionView(_ collectionView: UICollectionView, layout collectionViewLayout: UICollectionViewLayout, insetForSectionAt section: Int) -> UIEdgeInsets {
return UIEdgeInsets(equalInset: TabTrayControllerUX.Margin)
}
@objc func collectionView(_ collectionView: UICollectionView, layout collectionViewLayout: UICollectionViewLayout, minimumLineSpacingForSectionAt section: Int) -> CGFloat {
return TabTrayControllerUX.Margin
}
@objc func collectionView(_ collectionView: UICollectionView, didSelectItemAt indexPath: IndexPath) {
tabSelectionDelegate?.didSelectTabAtIndex(indexPath.row)
}
}
struct EmptyPrivateTabsViewUX {
static let TitleColor = UIColor.white
static let TitleFont = UIFont.systemFont(ofSize: 22, weight: UIFontWeightMedium)
static let DescriptionColor = UIColor.white
static let DescriptionFont = UIFont.systemFont(ofSize: 17)
static let LearnMoreFont = UIFont.systemFont(ofSize: 15, weight: UIFontWeightMedium)
static let TextMargin: CGFloat = 18
static let LearnMoreMargin: CGFloat = 30
static let MaxDescriptionWidth: CGFloat = 250
static let MinBottomMargin: CGFloat = 10
}
// View we display when there are no private tabs created
fileprivate class EmptyPrivateTabsView: UIView {
fileprivate lazy var titleLabel: UILabel = {
let label = UILabel()
label.textColor = EmptyPrivateTabsViewUX.TitleColor
label.font = EmptyPrivateTabsViewUX.TitleFont
label.textAlignment = NSTextAlignment.center
return label
}()
fileprivate var descriptionLabel: UILabel = {
let label = UILabel()
label.textColor = EmptyPrivateTabsViewUX.DescriptionColor
label.font = EmptyPrivateTabsViewUX.DescriptionFont
label.textAlignment = NSTextAlignment.center
label.numberOfLines = 0
label.preferredMaxLayoutWidth = EmptyPrivateTabsViewUX.MaxDescriptionWidth
return label
}()
fileprivate var learnMoreButton: UIButton = {
let button = UIButton(type: .system)
button.setTitle(
NSLocalizedString("Learn More", tableName: "PrivateBrowsing", comment: "Text button displayed when there are no tabs open while in private mode"),
for: UIControlState())
button.setTitleColor(UIConstants.PrivateModeTextHighlightColor, for: UIControlState())
button.titleLabel?.font = EmptyPrivateTabsViewUX.LearnMoreFont
return button
}()
fileprivate var iconImageView: UIImageView = {
let imageView = UIImageView(image: UIImage(named: "largePrivateMask"))
return imageView
}()
override init(frame: CGRect) {
super.init(frame: frame)
titleLabel.text = NSLocalizedString("Private Browsing",
tableName: "PrivateBrowsing", comment: "Title displayed for when there are no open tabs while in private mode")
descriptionLabel.text = NSLocalizedString("Firefox won’t remember any of your history or cookies, but new bookmarks will be saved.",
tableName: "PrivateBrowsing", comment: "Description text displayed when there are no open tabs while in private mode")
addSubview(titleLabel)
addSubview(descriptionLabel)
addSubview(iconImageView)
addSubview(learnMoreButton)
titleLabel.snp.makeConstraints { make in
make.center.equalTo(self)
}
iconImageView.snp.makeConstraints { make in
make.bottom.equalTo(titleLabel.snp.top).offset(-EmptyPrivateTabsViewUX.TextMargin)
make.centerX.equalTo(self)
}
descriptionLabel.snp.makeConstraints { make in
make.top.equalTo(titleLabel.snp.bottom).offset(EmptyPrivateTabsViewUX.TextMargin)
make.centerX.equalTo(self)
}
learnMoreButton.snp.makeConstraints { (make) -> Void in
make.top.equalTo(descriptionLabel.snp.bottom).offset(EmptyPrivateTabsViewUX.LearnMoreMargin).priority(10)
make.bottom.lessThanOrEqualTo(self).offset(-EmptyPrivateTabsViewUX.MinBottomMargin).priority(1000)
make.centerX.equalTo(self)
}
}
required init?(coder aDecoder: NSCoder) {
fatalError("init(coder:) has not been implemented")
}
}
extension TabTrayController: TabPeekDelegate {
func tabPeekDidAddBookmark(_ tab: Tab) {
delegate?.tabTrayDidAddBookmark(tab)
}
func tabPeekDidAddToReadingList(_ tab: Tab) -> ReadingListClientRecord? {
return delegate?.tabTrayDidAddToReadingList(tab)
}
func tabPeekDidCloseTab(_ tab: Tab) {
if let index = self.tabDataSource.tabs.index(of: tab),
let cell = self.collectionView?.cellForItem(at: IndexPath(item: index, section: 0)) as? TabCell {
cell.close()
}
}
func tabPeekRequestsPresentationOf(_ viewController: UIViewController) {
delegate?.tabTrayRequestsPresentationOf(viewController)
}
}
extension TabTrayController: UIViewControllerPreviewingDelegate {
func previewingContext(_ previewingContext: UIViewControllerPreviewing, viewControllerForLocation location: CGPoint) -> UIViewController? {
guard let collectionView = collectionView else { return nil }
let convertedLocation = self.view.convert(location, to: collectionView)
guard let indexPath = collectionView.indexPathForItem(at: convertedLocation),
let cell = collectionView.cellForItem(at: indexPath) else { return nil }
let tab = tabDataSource.tabs[indexPath.row]
let tabVC = TabPeekViewController(tab: tab, delegate: self)
if let browserProfile = profile as? BrowserProfile {
tabVC.setState(withProfile: browserProfile, clientPickerDelegate: self)
}
previewingContext.sourceRect = self.view.convert(cell.frame, from: collectionView)
return tabVC
}
func previewingContext(_ previewingContext: UIViewControllerPreviewing, commit viewControllerToCommit: UIViewController) {
guard let tpvc = viewControllerToCommit as? TabPeekViewController else { return }
tabManager.selectTab(tpvc.tab)
navigationController?.popViewController(animated: true)
delegate?.tabTrayDidDismiss(self)
}
}
extension TabTrayController: ClientPickerViewControllerDelegate {
func clientPickerViewController(_ clientPickerViewController: ClientPickerViewController, didPickClients clients: [RemoteClient]) {
if let item = clientPickerViewController.shareItem {
self.profile.sendItems([item], toClients: clients)
}
clientPickerViewController.dismiss(animated: true, completion: nil)
}
func clientPickerViewControllerDidCancel(_ clientPickerViewController: ClientPickerViewController) {
clientPickerViewController.dismiss(animated: true, completion: nil)
}
}
extension TabTrayController: UIAdaptivePresentationControllerDelegate, UIPopoverPresentationControllerDelegate {
// Returning None here makes sure that the Popover is actually presented as a Popover and
// not as a full-screen modal, which is the default on compact device classes.
func adaptivePresentationStyle(for controller: UIPresentationController, traitCollection: UITraitCollection) -> UIModalPresentationStyle {
return UIModalPresentationStyle.none
}
}
// MARK: - Toolbar
class TrayToolbar: UIView {
fileprivate let toolbarButtonSize = CGSize(width: 44, height: 44)
lazy var addTabButton: UIButton = {
let button = UIButton()
button.setImage(UIImage.templateImageNamed("nav-add"), for: .normal)
button.accessibilityLabel = NSLocalizedString("Add Tab", comment: "Accessibility label for the Add Tab button in the Tab Tray.")
button.accessibilityIdentifier = "TabTrayController.addTabButton"
return button
}()
lazy var deleteButton: UIButton = {
let button = UIButton()
button.setImage(UIImage.templateImageNamed("action_delete"), for: .normal)
button.accessibilityLabel = Strings.TabTrayDeleteMenuButtonAccessibilityLabel
button.accessibilityIdentifier = "TabTrayController.removeTabsButton"
return button
}()
lazy var maskButton: PrivateModeButton = PrivateModeButton()
fileprivate let sideOffset: CGFloat = 32
fileprivate override init(frame: CGRect) {
super.init(frame: frame)
backgroundColor = .white
addSubview(addTabButton)
var buttonToCenter: UIButton?
addSubview(deleteButton)
buttonToCenter = deleteButton
maskButton.accessibilityIdentifier = "TabTrayController.maskButton"
buttonToCenter?.snp.makeConstraints { make in
make.centerX.equalTo(self)
make.top.equalTo(self)
make.size.equalTo(toolbarButtonSize)
}
addTabButton.snp.makeConstraints { make in
make.top.equalTo(self)
make.right.equalTo(self).offset(-sideOffset)
make.size.equalTo(toolbarButtonSize)
}
addSubview(maskButton)
maskButton.snp.makeConstraints { make in
make.top.equalTo(self)
make.left.equalTo(self).offset(sideOffset)
make.size.equalTo(toolbarButtonSize)
}
styleToolbar(false)
}
required init?(coder aDecoder: NSCoder) {
fatalError("init(coder:) has not been implemented")
}
fileprivate func styleToolbar(_ isPrivate: Bool) {
addTabButton.tintColor = isPrivate ? UIColor(rgb: 0xf9f9fa) : UIColor(rgb: 0x272727)
deleteButton.tintColor = isPrivate ? UIColor(rgb: 0xf9f9fa) : UIColor(rgb: 0x272727)
backgroundColor = isPrivate ? UIConstants.PrivateModeToolbarTintColor : UIColor(rgb: 0xf9f9fa)
maskButton.styleForMode(privateMode: isPrivate)
}
}
| mpl-2.0 | bab351c60ff4aefcc984edc5a181a7e2 | 40.152686 | 304 | 0.688844 | 5.513005 | false | false | false | false |
VladislavJevremovic/Exchange-Rates-NBS | Exchange Rates NBS/Logic/Constants.swift | 1 | 1711 | //
// Constants.swift
// Exchange Rates NBS
//
// Created by Vladislav Jevremovic on 12/6/14.
// Copyright (c) 2014 Vladislav Jevremovic. All rights reserved.
//
import Foundation
import UIKit
struct Constants {
struct CustomColor {
static let Manatee = UIColor(red: 142.0 / 255.0, green: 142.0 / 255.0, blue: 147.0 / 255.0, alpha: 1.0)
static let RadicalRed = UIColor(red: 255.0 / 255.0, green: 45.0 / 255.0, blue: 85.0 / 255.0, alpha: 1.0)
static let RedOrange = UIColor(red: 255.0 / 255.0, green: 59.0 / 255.0, blue: 48.0 / 255.0, alpha: 1.0)
static let Pizazz = UIColor(red: 255.0 / 255.0, green: 149.0 / 255.0, blue: 0.0 / 255.0, alpha: 1.0)
static let Supernova = UIColor(red: 255.0 / 255.0, green: 204.0 / 255.0, blue: 0.0 / 255.0, alpha: 1.0)
static let Emerald = UIColor(red: 76.0 / 255.0, green: 217.0 / 255.0, blue: 100.0 / 255.0, alpha: 1.0)
static let Malibu = UIColor(red: 90.0 / 255.0, green: 200.0 / 255.0, blue: 250.0 / 255.0, alpha: 1.0)
static let CuriousBlue = UIColor(red: 52.0 / 255.0, green: 170.0 / 255.0, blue: 220.0 / 255.0, alpha: 1.0)
static let AzureRadiance = UIColor(red: 0.0 / 255.0, green: 122.0 / 255.0, blue: 255.0 / 255.0, alpha: 1.0)
static let Indigo = UIColor(red: 88.0 / 255.0, green: 86.0 / 255.0, blue: 214.0 / 255.0, alpha: 1.0)
static let TableBackgroundColor = UIColor(red: 176.0 / 255.0, green: 214.0 / 255.0, blue: 255.0 / 255.0, alpha: 1.0)
static let TableCellColor = UIColor(red: 120.0 / 255.0, green: 185.0 / 255.0, blue: 255.0 / 255.0, alpha: 1.0)
static let TableFooterColor = UIColor(red: 0.43, green: 0.45, blue: 0.45, alpha: 1.0)
}
}
| mit | fd51582cc960af64fbba13989ecbe2c0 | 54.193548 | 124 | 0.610754 | 2.669267 | false | false | false | false |
catloafsoft/AudioKit | AudioKit/iOS/AudioKit/AudioKit.playground/Pages/Band Pass Filter.xcplaygroundpage/Contents.swift | 1 | 1326 | //: [TOC](Table%20Of%20Contents) | [Previous](@previous) | [Next](@next)
//:
//: ---
//:
//: ## Band Pass Filter
//: ### Band-pass filters allow audio above a specified frequency range and bandwidth to pass through to an output. The center frequency is the starting point from where the frequency limit is set. Adjusting the bandwidth sets how far out above and below the center frequency the frequency band should be. Anything above that band should pass through.
import XCPlayground
import AudioKit
let bundle = NSBundle.mainBundle()
let file = bundle.pathForResource("mixloop", ofType: "wav")
var player = AKAudioPlayer(file!)
player.looping = true
var bandPassFilter = AKBandPassFilter(player)
//: Set the parameters of the Band-Pass Filter here
bandPassFilter.centerFrequency = 5000 // Hz
bandPassFilter.bandwidth = 600 // Cents
AudioKit.output = bandPassFilter
AudioKit.start()
player.play()
//: Toggle processing on every loop
AKPlaygroundLoop(every: 3.428) { () -> () in
if bandPassFilter.isBypassed {
bandPassFilter.start()
} else {
bandPassFilter.bypass()
}
bandPassFilter.isBypassed ? "Bypassed" : "Processing" // Open Quicklook for this
}
XCPlaygroundPage.currentPage.needsIndefiniteExecution = true
//: [TOC](Table%20Of%20Contents) | [Previous](@previous) | [Next](@next)
| mit | 88b8759ee37746c12b6506386982050b | 34.837838 | 352 | 0.731523 | 4.22293 | false | false | false | false |
tzef/BmoViewPager | Example/BmoViewPager/CustomView/SegmentedView.swift | 1 | 1670 | //
// SegmentedView.swift
// BmoViewPager
//
// Created by LEE ZHE YU on 2017/6/4.
// Copyright © 2017年 CocoaPods. All rights reserved.
//
import UIKit
@IBDesignable
class SegmentedView: UIView {
@IBInspectable var strokeColor: UIColor = UIColor.black {
didSet {
self.setNeedsDisplay()
}
}
@IBInspectable var lineWidth: CGFloat = 1.0 {
didSet {
self.setNeedsDisplay()
}
}
@IBInspectable var segmentedCount: Int = 0 {
didSet {
self.setNeedsDisplay()
}
}
override init(frame: CGRect) {
super.init(frame: frame)
setup()
}
required init?(coder aDecoder: NSCoder) {
super.init(coder: aDecoder)
setup()
}
func setup() {
self.layer.borderWidth = 1.0
self.layer.cornerRadius = 5.0
self.layer.masksToBounds = true
self.layer.borderColor = strokeColor.cgColor
}
// Only override draw() if you perform custom drawing.
// An empty implementation adversely affects performance during animation.
override func draw(_ rect: CGRect) {
super.draw(rect)
guard let context = UIGraphicsGetCurrentContext() else {
return
}
let marginX = rect.width / CGFloat(segmentedCount)
strokeColor.setStroke()
context.setLineWidth(lineWidth)
for i in 0...segmentedCount {
context.move(to: CGPoint(x: rect.minX + marginX * CGFloat(i + 1), y: rect.minY))
context.addLine(to: CGPoint(x: rect.minX + marginX * CGFloat(i + 1), y: rect.maxY))
}
context.strokePath()
}
}
| mit | 301ccc15095a4e0166bf816bb6b8aac6 | 26.783333 | 95 | 0.592082 | 4.386842 | false | false | false | false |
Schwenger/SwiftUtil | Sources/SwiftUtil/Extensions/Optional.swift | 1 | 1925 | //
// Optional.swift
// SwiftUtil
//
// Created by Maximilian Schwenger on 24.07.17.
//
infix operator +?: AdditionPrecedence
infix operator -?: AdditionPrecedence
infix operator *?: MultiplicationPrecedence
infix operator /?: MultiplicationPrecedence
infix operator ==?: ComparisonPrecedence
public extension Optional {
func getOrElse(_ gen: () -> Wrapped) -> Wrapped {
switch self {
case .some(let content): return content
case .none: return gen()
}
}
public var empty: Bool { get {
switch self {
case .none: return true
case .some: return false
}}
}
}
public extension Optional where Wrapped: Numeric {
// All those functions also work for an unwrapped Numeric as left operand due to implicit conversion of Optionals.
static func +?(_ left: Optional<Wrapped>, right: Optional<Wrapped>) -> Optional<Wrapped> {
if left.empty || right.empty { return nil }
else { return left! + right! }
}
static func -?(_ left: Optional<Wrapped>, right: Optional<Wrapped>) -> Optional<Wrapped> {
if left.empty || right.empty { return nil }
else { return left! - right! }
}
static func *?(_ left: Optional<Wrapped>, right: Optional<Wrapped>) -> Optional<Wrapped> {
if left.empty || right.empty { return nil }
else { return left! * right! }
}
}
// Allows extending datastructures with associated optional type.
// Thanks to https://stackoverflow.com/questions/33138712/function-arrayoptionalt-optionalarrayt
public protocol OptionalType {
associatedtype Wrapped
var optional: Wrapped? { get }
}
extension Optional: OptionalType {
public var optional: Wrapped? { return self }
}
public func ==?<T: Equatable> (lhs: T?, rhs: T?) -> Bool {
if let lhs = lhs, let rhs = rhs {
return lhs == rhs
} else {
return lhs == nil && rhs == nil
}
}
| mit | bfe7a05da5a7b54706a69bf1f545dae7 | 29.555556 | 117 | 0.641039 | 4.268293 | false | false | false | false |
kstaring/swift | validation-test/compiler_crashers_fixed/01373-swift-valuedecl-getinterfacetype.swift | 11 | 699 | // This source file is part of the Swift.org open source project
// Copyright (c) 2014 - 2016 Apple Inc. and the Swift project authors
// Licensed under Apache License v2.0 with Runtime Library Exception
//
// See http://swift.org/LICENSE.txt for license information
// See http://swift.org/CONTRIBUTORS.txt for the list of Swift project authors
// RUN: not %target-swift-frontend %s -parse
import Foundation
extension NSData {
var d = c
let c(n: d {
override init(a(self)] == a")
func i> : a: k.C) -> {
public class A<H : Sequence where T>() {
}
}
protocol A {
}
protocol a {
typealias A : A, T : d where T : (c: e = Swift.f = B
func f<f = .Element>(2, ((x(")() -> T: AnyObject> Any in
func b, le
| apache-2.0 | c0d74753012f58e6c7d04f6820e5ce94 | 29.391304 | 78 | 0.676681 | 3.221198 | false | false | false | false |
calkinssean/TIY-Assignments | Day 18/MoviesApp2/DetailViewController.swift | 1 | 1198 | //
// DetailViewController.swift
// MoviesApp2
//
// Created by Sean Calkins on 2/24/16.
// Copyright © 2016 Sean Calkins. All rights reserved.
//
import UIKit
class DetailViewController: UIViewController {
@IBOutlet weak var movieTitleLabel: UILabel!
@IBOutlet weak var movieImageView: UIImageView!
@IBOutlet weak var movieOverviewLabel: UILabel!
var detailMovie = Movie()
override func viewDidLoad() {
super.viewDidLoad()
self.movieTitleLabel.text = detailMovie.title
self.movieOverviewLabel.text = detailMovie.overview
self.loadImageFromURL("https://image.tmdb.org/t/p/w185\(detailMovie.poster_path)")
}
func loadImageFromURL(urlString: String) {
if urlString.isEmpty == false {
dispatch_async(dispatch_get_main_queue(), {
if let url = NSURL(string: urlString) {
if let data = NSData(contentsOfURL: url) {
self.movieImageView.image = UIImage(data: data)
}
}
})
} else {
debugPrint("Invalid \(urlString)")
}
}
}
| cc0-1.0 | 9c1c3e94351d5d5b477980de15db5057 | 26.204545 | 90 | 0.581454 | 4.768924 | false | false | false | false |
Bashta/ImageDownloader | ImageDownloader/View/ImageTableViewCustoCells/ImageTableViewCell.swift | 1 | 3440 | //
// ImageTableViewCell.swift
// ImageDownloader
//
// Created by Alb on 4/4/16.
// Copyright © 2016 10gic. All rights reserved.
//
import UIKit
import Kingfisher
protocol ImageDownloaderCellDelegate: class {
func cellFinishedDownloadingImage(image: UIImage, cellIndex: Int)
}
final class ImageTableViewCell: UITableViewCell {
static let nib = UINib(nibName: "ImageTableViewCell", bundle: nil)
static let reuseId = "imageTableViewCell"
@IBOutlet private weak var progressView: UIProgressView?
@IBOutlet private weak var imageThumbnailImageView: UIImageView?
@IBOutlet private weak var imageNameLabel: UILabel?
@IBOutlet private weak var progressPercentageLabel: UILabel?
@IBOutlet private weak var downloadButton: UIButton?
private var imageFetcher: RetrieveImageTask?
weak var cellImageDownloaderCellDelegate: ImageDownloaderCellDelegate?
var datasourceCachedImage: UIImage? {
didSet {
imageThumbnailImageView?.image = datasourceCachedImage ?? UIImage(named: "image_placeholder")
setupCell()
}
}
var cellInfo:(imageUrl: NSURL, imageName: String, cellIndex: Int)? {
didSet {
setupCell()
}
}
}
extension ImageTableViewCell {
//MARK:- Action Buttons
@IBAction func downloadButtonPressed(sender: UIButton) {
switch sender.titleLabel!.text! {
case "Download":
downloadButton?.setTitle(downloadButton?.titleLabel?.text == "Download" ? "Stop" : "Download", forState: .Normal)
imageFetcher = imageThumbnailImageView?.kf_setImageWithURL(cellInfo!.imageUrl, placeholderImage: nil, optionsInfo: [.ForceRefresh],progressBlock: { receivedSize, totalSize in
dispatch_async(dispatch_get_main_queue(), {
self.progressPercentageLabel?.text = "\((Float(receivedSize) / Float(totalSize) * 100))%"
self.progressView?.progress = (Float(receivedSize) / Float(totalSize))
})
}, completionHandler: { image, error, cacheType, imageURL in
self.downloadButton?.setTitle("Done", forState: .Normal)
self.progressView?.progress
guard let image = image, index = self.cellInfo?.cellIndex else {
return
}
self.cellImageDownloaderCellDelegate?.cellFinishedDownloadingImage(image, cellIndex: index)
})
case "Cancel":
imageFetcher?.cancel()
default:
return
}
}
override func prepareForReuse() {
super.prepareForReuse()
dispatch_async(dispatch_get_main_queue(), {
})
progressView?.progress = datasourceCachedImage == nil ? 0 : 100
progressPercentageLabel?.text = datasourceCachedImage == nil ? "0%" : "100%"
imageNameLabel?.text = cellInfo?.imageName
downloadButton?.titleLabel?.text = datasourceCachedImage == nil ? "Download" : "Done"
imageFetcher?.cancel()
}
}
private extension ImageTableViewCell {
func setupCell() {
progressView?.progress = datasourceCachedImage == nil ? 0 : 100
progressPercentageLabel?.text = datasourceCachedImage == nil ? "0%" : "100%"
imageNameLabel?.text = cellInfo?.imageName
downloadButton?.titleLabel?.text = datasourceCachedImage == nil ? "Download" : "Done"
}
} | mit | 813b9c509a7ff9974e768b63d5770d5e | 35.989247 | 186 | 0.648444 | 5.323529 | false | false | false | false |
yarshure/Surf | Surf/TitleView.swift | 1 | 1641 | //
// TitleView.swift
// Surf
//
// Created by yarshure on 16/5/25.
// Copyright © 2016年 yarshure. All rights reserved.
//
import UIKit
class TitleView: UIView {
var titleLabel:UILabel
var subLabel:UILabel
override init(frame: CGRect) {
var y0:CGFloat = 10.0
var y1:CGFloat = 32.0
let os = ProcessInfo().operatingSystemVersion
switch (os.majorVersion, os.minorVersion, os.patchVersion) {
case (8, 0, _):
print("iOS >= 8.0.0, < 8.1.0")
case (8, _, _):
print("iOS >= 8.1.0, < 9.0")
case (11, _, _):
y0 = y0 - 6
y1 = y1 - 6
default:
// this code will have already crashed on iOS 7, so >= iOS 10.0
print("iOS >= 9.0.0")
}
titleLabel = UILabel.init(frame: CGRect(x:0,y: y0,width: frame.size.width,height: 20))
titleLabel.font = UIFont.boldSystemFont(ofSize: 16)
//titleLabel?.sizeToFit()
titleLabel.textAlignment = .center
titleLabel.textColor = UIColor.white
subLabel = UILabel.init(frame: CGRect(x:0, y:y1, width:frame.size.width, height:15))
subLabel.font = UIFont.systemFont(ofSize: 12)
//titleLabel?.sizeToFit()
subLabel.textAlignment = .center
subLabel.textColor = UIColor.lightGray
//subLabel.backgroundColor = UIColor.cyanColor()
super.init(frame: frame)
self.addSubview(titleLabel)
self.addSubview(subLabel)
}
required init?(coder aDecoder: NSCoder) {
fatalError("init(coder:) has not been implemented")
}
}
| bsd-3-clause | b2c560cc9419902b78fd70993d582c9b | 30.5 | 94 | 0.575702 | 3.956522 | false | false | false | false |
megavolt605/CNLUIKitTools | CNLUIKitTools/CNLDatePickerView.swift | 1 | 5283 | //
// CNLDatePickerView.swift
// CNLUIKitTools
//
// Created by Igor Smirnov on 25/11/2016.
// Copyright © 2016 Complex Numbers. All rights reserved.
//
import UIKit
import CNLFoundationTools
public typealias CNLDatePickerValueChanged = (_ datePicker: CNLDatePicker, _ date: Date) -> Void
open class CNLDatePicker: UIPickerView {
fileprivate let maxRowCount = 500
fileprivate let dayCount = 31
fileprivate let monthCount = 12
fileprivate let yearCount = 110
fileprivate let calendar = Calendar.current
open var year: Int = 2000
open var month: Int = 1
open var day: Int = 1
open var valueChanged: CNLDatePickerValueChanged?
open var date: Date {
var dc = DateComponents()
dc.calendar = calendar
dc.year = year
dc.month = month
dc.day = day
while !dc.isValidDate(in: calendar) {
day -= 1
}
dc.day = day
let date = dc.date!.addingTimeInterval(TimeInterval(calendar.timeZone.secondsFromGMT()))
return date
}
open func setDate(_ date: Date, animated: Bool) {
let dc = (calendar as Calendar).dateComponents([.day, .month, .year], from: date)
year = dc.year!
month = dc.month!
day = dc.day!
var s = (maxRowCount / 2 / dayCount) * dayCount
selectRow(s + day - 1, inComponent: 0, animated: animated)
s = (maxRowCount / 2 / monthCount) * monthCount
selectRow(s + month - 1, inComponent: 1, animated: animated)
s = (maxRowCount / 2 / yearCount) * yearCount
selectRow(s + year - 1900, inComponent: 2, animated: animated)
valueChanged?(self, date)
}
func initialization() {
dataSource = self
delegate = self
setDate(date, animated: false)
//calendar.timeZone = NSTimeZone.localTimeZone()
}
override public init(frame: CGRect) {
super.init(frame: frame)
initialization()
}
required public init?(coder aDecoder: NSCoder) {
super.init(coder: aDecoder)
initialization()
}
convenience init() {
self.init(frame: CGRect.zero)
}
}
extension CNLDatePicker: UIPickerViewDataSource {
public func numberOfComponents(in pickerView: UIPickerView) -> Int {
return 3
}
public func pickerView(_ pickerView: UIPickerView, numberOfRowsInComponent component: Int) -> Int {
return maxRowCount
}
}
extension CNLDatePicker: UIPickerViewDelegate {
public func pickerView(_ pickerView: UIPickerView, widthForComponent component: Int) -> CGFloat {
switch component {
case 0: return 60
case 1: return 150
case 2: return 70
default: return 30
}
}
public func pickerView(_ pickerView: UIPickerView, rowHeightForComponent component: Int) -> CGFloat {
return 40.0
}
public func pickerView(_ pickerView: UIPickerView, viewForRow row: Int, forComponent component: Int, reusing view: UIView?) -> UIView {
let s = pickerView.rowSize(forComponent: component)
let v = UIView(frame: CGRect(x: 0.0, y: 0.0, width: s.width, height: s.height))
let l = UILabel(frame: v.bounds)
l.backgroundColor = UIColor(white: 0.3, alpha: 1.0)
l.isOpaque = false
l.textColor = UIColor.white
l.font = UIFont.systemFont(ofSize: 24.0)
l.textAlignment = .center
switch component {
case 0: // day
var b = l.frame
b.size.width -= 5.0
l.text = "\(row % dayCount + 1)"
case 1: // month
let df = DateFormatter()
df.dateFormat = "MMMM"
var dc = DateComponents()
dc.year = 2000
dc.month = row % monthCount + 1
dc.day = 1
dc.calendar = calendar
l.text = "\(df.string(from: dc.date!))"
case 2: // year
l.text = "\(1900 + row % yearCount)"
default: break
}
v.addSubview(l)
return l
}
public func pickerView(_ pickerView: UIPickerView, didSelectRow row: Int, inComponent component: Int) {
switch component {
case 0:
let s = (maxRowCount / 2 / dayCount) * dayCount
day = row - s + 1
while day <= 0 { day += dayCount }
while day > dayCount { day -= dayCount }
selectRow(s + day - 1, inComponent: component, animated: false)
case 1:
let s = (maxRowCount / 2 / monthCount) * monthCount
month = row - s + 1
while month <= 0 { month += monthCount }
while month > monthCount { month -= monthCount }
selectRow(s + month - 1, inComponent: component, animated: false)
case 2:
let s = (maxRowCount / 2 / yearCount) * yearCount
year = row - s
while year <= 0 { year += yearCount }
while year > yearCount { year -= yearCount }
selectRow(s + year, inComponent: component, animated: false)
year += 1900
default: break
}
setDate(date, animated: true)
}
}
| mit | 25c67127f07a9cfbc36b2719db18d157 | 30.070588 | 139 | 0.572321 | 4.641476 | false | false | false | false |
hyperoslo/Postman | Pod/Demo/ViewController.swift | 1 | 893 | import UIKit
class ViewController: UIViewController, PostmanDelegate {
var postman: Postman?
override func viewDidAppear(animated: Bool) {
super.viewDidAppear(animated)
self.view.backgroundColor = UIColor.whiteColor()
let button = UIBarButtonItem(
title: "Send mail",
style: .Done,
target: self,
action: "sendMailAction")
navigationItem.leftBarButtonItem = button
}
func sendMailAction() {
postman = Postman()
postman!.sendMailTo(
"[email protected]",
subject: "Hi",
body: "Livy Darling, \n\nI am grateful — grate-fuller than ever before — that you were born, & that your love is mine & our two lives woven & melded together! \n\n- SLC",
attachment: nil,
usingController: self)
postman!.delegate = self
}
func postmanDidFinish(postman: Postman!) {
println("postmanDidFinish!")
}
}
| mit | de3a71700a8294d85b7ea3090fc1fc0f | 24.4 | 176 | 0.670416 | 3.986547 | false | false | false | false |
Coderian/SwiftedKML | SwiftedKML/Elements/LinkName.swift | 1 | 1093 | //
// LinkName.swift
// SwiftedKML
//
// Created by 佐々木 均 on 2016/02/02.
// Copyright © 2016年 S-Parts. All rights reserved.
//
import Foundation
/// KML LinkName
///
/// [KML 2.2 shcema](http://schemas.opengis.net/kml/2.2.0/ogckml22.xsd)
///
/// <element name="linkName" type="string"/>
public class LinkName:SPXMLElement,HasXMLElementValue,HasXMLElementSimpleValue {
public static var elementName: String = "linkName"
public override var parent:SPXMLElement! {
didSet {
// 複数回呼ばれたて同じものがある場合は追加しない
if self.parent.childs.contains(self) == false {
self.parent.childs.insert(self)
switch parent {
case let v as NetworkLinkControl: v.value.linkName = self
default: break
}
}
}
}
public var value: String = ""
public func makeRelation(contents:String, parent:SPXMLElement) -> SPXMLElement{
self.value = contents
self.parent = parent
return parent
}
}
| mit | 27a47b2276962e209752866ee0209b10 | 27.777778 | 83 | 0.605212 | 3.894737 | false | false | false | false |
caiodias/CleanerSkeeker | CleanerSeeker/CleanerSeeker/LoginViewController.swift | 1 | 2511 | //
// LoginScreenUI.swift
// CleanerSeeker
//
// Created by Orest Hazda on 29/03/17.
// Copyright © 2017 Caio Dias. All rights reserved.
//
import UIKit
class LoginViewController: BasicVC {
private enum ShowTabController: String {
case Worker = "workerTabController"
case JobPoster = "jobPosterTabController"
}
@IBOutlet weak var scrollView: UIScrollView!
@IBOutlet weak var userName: UITextField!
@IBOutlet weak var password: UITextField!
override func viewDidLoad() {
super.viewDidLoad()
super.baseScrollView = self.scrollView
}
override func viewWillAppear(_ animated: Bool) {
super.viewWillAppear(true)
if let currentUser = CSUser.current() {
//User is logged in so redirect him based on type and update location
self.redirectLoggedInUser(currentUser)
}
}
@IBAction func login(_ sender: UIButton) {
self.handleTap()
Utilities.showLoading()
Facade.shared.loginUser(login: userName.text!, password: password.text!, onSuccess: onLoginSuccess, onFail: onLoginFail)
}
// MARK: Redirect user to right tab controller
private func displayTabController(tabController: ShowTabController) {
guard let appDelegate = UIApplication.shared.delegate as? AppDelegate else {
print("Not possible to get the appDelegate")
return
}
let initialViewController = self.storyboard!.instantiateViewController(withIdentifier: tabController.rawValue)
// Replace root controller
appDelegate.window?.rootViewController = initialViewController
appDelegate.window?.makeKeyAndVisible()
}
// MARK: login callbacks
private func onLoginSuccess(object: Any) {
print(object)
Utilities.dismissLoading()
guard let user = object as? CSUser else {
print("Not possible convert login object to user")
return
}
self.redirectLoggedInUser(user)
}
private func redirectLoggedInUser(_ user: CSUser) {
if user.userType == CSUserType.Worker.rawValue {
Facade.shared.updateCurrentUserLoccation()
displayTabController(tabController: ShowTabController.Worker)
} else {
displayTabController(tabController: ShowTabController.JobPoster)
}
}
private func onLoginFail(error: Error) {
Utilities.dismissLoading()
Utilities.displayAlert(error)
}
}
| mit | 80a409d47209129795bc9f3c8aa449ff | 29.240964 | 128 | 0.666135 | 5.040161 | false | false | false | false |
crspybits/SMSyncServer | iOS/iOSTests/Pods/SMSyncServer/SMSyncServer/Classes/Public/SMSyncServerUser.swift | 1 | 14600 | //
// SMSyncServerUser.swift
// SMSyncServer
//
// Created by Christopher Prince on 1/18/16.
// Copyright © 2016 Spastic Muffin, LLC. All rights reserved.
//
// Provides user sign-in & authentication for the SyncServer.
import Foundation
import SMCoreLib
// "class" so its delegate var can be weak.
internal protocol SMServerAPIUserDelegate : class {
var userCredentialParams:[String:AnyObject]? {get}
func refreshUserCredentials()
}
public struct SMLinkedAccount {
// This is the userId assigned by the sync server, not by the specific account system.
public var internalUserId:SMInternalUserId
public var userName:String?
public var capabilityMask:SMSharingUserCapabilityMask
}
public enum SMUserType : Equatable {
case OwningUser
// The owningUserId selects the specific shared/linked account being shared. It should only be nil when you are first creating the account, or redeeming a new sharing invitation.
case SharingUser(owningUserId:SMInternalUserId?)
public func toString() -> String {
switch self {
case .OwningUser:
return SMServerConstants.userTypeOwning
case .SharingUser:
return SMServerConstants.userTypeSharing
}
}
}
public func ==(lhs:SMUserType, rhs:SMUserType) -> Bool {
switch lhs {
case .OwningUser:
switch rhs {
case .OwningUser:
return true
case .SharingUser(_):
return false
}
case .SharingUser(_):
switch rhs {
case .OwningUser:
return false
case .SharingUser(_):
return true
}
}
}
// This enum is the interface from the client app to the SMSyncServer framework providing client credential information to the server.
public enum SMUserCredentials {
// In the following,
// userType *must* be OwningUser.
// When using as a parameter to call createNewUser, authCode must not be nil.
case Google(userType:SMUserType, idToken:String!, authCode:String?, userName:String?)
// userType *must* be SharingUser
case Facebook(userType:SMUserType, accessToken:String!, userId:String!, userName:String?)
internal func toServerParameterDictionary() -> [String:AnyObject] {
var userCredentials = [String:AnyObject]()
switch self {
case .Google(userType: let userType, idToken: let idToken, authCode: let authCode, userName: let userName):
Assert.If(userType != .OwningUser, thenPrintThisString: "Yikes: Google accounts with userTypeSharing not yet implemented!")
Log.msg("Sending IdToken: \(idToken)")
userCredentials[SMServerConstants.userType] = userType.toString()
userCredentials[SMServerConstants.accountType] = SMServerConstants.accountTypeGoogle
userCredentials[SMServerConstants.googleUserIdToken] = idToken
userCredentials[SMServerConstants.googleUserAuthCode] = authCode
userCredentials[SMServerConstants.accountUserName] = userName
case .Facebook(userType: let userType, accessToken: let accessToken, userId: let userId, userName: let userName):
switch userType {
case .OwningUser:
Assert.badMojo(alwaysPrintThisString: "Yikes: Not allowed!")
case .SharingUser(owningUserId: let owningUserId):
Log.msg("owningUserId: \(owningUserId)")
userCredentials[SMServerConstants.linkedOwningUserId] = owningUserId
}
userCredentials[SMServerConstants.userType] = userType.toString()
userCredentials[SMServerConstants.accountType] = SMServerConstants.accountTypeFacebook
userCredentials[SMServerConstants.facebookUserId] = userId
userCredentials[SMServerConstants.facebookUserAccessToken] = accessToken
userCredentials[SMServerConstants.accountUserName] = userName
}
return userCredentials
}
}
// This class is *not* intended to be subclassed for particular sign-in systems.
public class SMSyncServerUser {
private var _internalUserId:String?
// A distinct UUID for this user mobile device.
// I'm going to persist this in the keychain not so much because it needs to be secure, but rather because it will survive app deletions/reinstallations.
private static let MobileDeviceUUID = SMPersistItemString(name: "SMSyncServerUser.MobileDeviceUUID", initialStringValue: "", persistType: .KeyChain)
private var _signInCallback = NSObject()
// var signInCompletion:((error:NSError?)->(Void))?
internal weak var delegate: SMLazyWeakRef<SMUserSignInAccount>!
public static var session = SMSyncServerUser()
private init() {
self._signInCallback.resetTargets()
}
// You *must* set this (e.g., shortly after app launch). Currently, this must be a single name, with no subfolders, relative to the root. Don't put any "/" character in the name.
// 1/18/16; I just moved this here, from SMCloudStorageCredentials because it seems like the cloudFolderPath should be at a different level of abstraction, or at least seems independent of the details of cloud storage user creds.
// 1/18/16; I've now made this public because the folder used in cloud storage is fundamentally a client app decision-- i.e., it is a decision made by the user of SMSyncServer, e.g., Petunia.
// TODO: Eventually it would seem like a good idea to give the user a way to change the cloud folder path. BUT: It's a big change. i.e., the user shouldn't change this lightly because it will mean all of their data has to be moved or re-synced. (Plus, the SMSyncServer currently has no means to do such a move or re-sync-- it would have to be handled at a layer above the SMSyncServer).
public var cloudFolderPath:String?
internal func appLaunchSetup(withUserSignInLazyDelegate userSignInLazyDelegate:SMLazyWeakRef<SMUserSignInAccount>!) {
if 0 == SMSyncServerUser.MobileDeviceUUID.stringValue.characters.count {
SMSyncServerUser.MobileDeviceUUID.stringValue = UUID.make()
}
self.delegate = userSignInLazyDelegate
SMServerAPI.session.userDelegate = self
}
// Add target/selector to this to get a callback when the user sign-in process completes.
// An NSError? parameter is passed to each target/selector you give, which will be nil if there was no error in the sign-in process, and non-nil if there was an error in signing in.
public var signInProcessCompleted:TargetsAndSelectors {
get {
return self._signInCallback
}
}
// Is the user signed in? (So we don't have to expose the delegate publicly.)
public var signedIn:Bool {
get {
if let result = self.delegate.lazyRef?.syncServerUserIsSignedIn {
return result
}
else {
return false
}
}
}
// A string giving the identifier used internally on the SMSyncServer server to refer to a users cloud storage account. Has no meaning with respect to any specific cloud storage system (e.g., Google Drive).
// Returns non-nil value iff signedIn is true.
public var internalUserId:String? {
get {
if self.signedIn {
Assert.If(self._internalUserId == nil, thenPrintThisString: "Yikes: Nil internal user id")
return self._internalUserId
}
else {
return nil
}
}
}
public func signOut() {
self.delegate.lazyRef?.syncServerUserIsSignedIn
}
// This method doesn't keep a reference to userCreds; it just allows the caller to create a new user on the server.
public func createNewUser(callbacksAfterSigninSuccess callbacksAfterSignin:Bool=true, userCreds:SMUserCredentials, completion:((error: NSError?)->())?) {
switch (userCreds) {
case .Google(userType: _, idToken: _, authCode: let authCode, userName: _):
Assert.If(nil == authCode, thenPrintThisString: "The authCode must be non-nil when calling createNewUser for a Google user")
case .Facebook:
break
}
SMServerAPI.session.createNewUser(self.serverParameters(userCreds)) { internalUserId, cnuResult in
self._internalUserId = internalUserId
let returnError = self.processSignInResult(forExistingUser: false, apiResult: cnuResult)
self.finish(callbacksAfterSignin:callbacksAfterSignin, withError: returnError, completion: completion)
}
}
// This method doesn't keep a reference to userCreds; it just allows the caller to check for an existing user on the server.
public func checkForExistingUser(userCreds:SMUserCredentials, completion:((error: NSError?)->())?) {
SMServerAPI.session.checkForExistingUser(
self.serverParameters(userCreds)) { internalUserId, cfeuResult in
self._internalUserId = internalUserId
let returnError = self.processSignInResult(forExistingUser: true, apiResult: cfeuResult)
self.finish(withError: returnError, completion: completion)
}
}
// Optionally can have a currently signed in user. i.e., if you give userCreds, they will be used. Otherwise, the currently signed in user creds are used.
public func redeemSharingInvitation(invitationCode invitationCode:String, userCreds:SMUserCredentials?=nil, completion:((linkedOwningUserId:SMInternalUserId?, error: NSError?)->())?) {
var userCredParams:[String:AnyObject]
if userCreds == nil {
userCredParams = self.userCredentialParams!
}
else {
userCredParams = self.serverParameters(userCreds!)
}
SMServerAPI.session.redeemSharingInvitation(
userCredParams, invitationCode: invitationCode, completion: { (linkedOwningUserId, internalUserId, apiResult) in
Log.msg("SMServerAPI linkedOwningUserId: \(linkedOwningUserId)")
let returnError = self.processSignInResult(forExistingUser: true, apiResult: apiResult)
self.finish(withError: returnError) { error in
completion?(linkedOwningUserId:linkedOwningUserId, error: error)
}
})
}
private func finish(callbacksAfterSignin callbacksAfterSignin:Bool=true, withError error:NSError?, completion:((error: NSError?)->())?) {
// The ordering of these two lines of code is important. callSignInCompletion needs to be second because it tests for the sign-in state generated by the completion.
completion?(error: error)
if callbacksAfterSignin {
self.callSignInCompletion(withError: error)
}
}
public func getLinkedAccountsForSharingUser(userCreds:SMUserCredentials?=nil, completion:((linkedAccounts:[SMLinkedAccount]?, error:NSError?)->(Void))?) {
var userCredParams:[String:AnyObject]
if userCreds == nil {
userCredParams = self.userCredentialParams!
}
else {
userCredParams = self.serverParameters(userCreds!)
}
SMServerAPI.session.getLinkedAccountsForSharingUser(userCredParams) { (linkedAccounts, apiResult) -> (Void) in
completion?(linkedAccounts:linkedAccounts, error:apiResult.error)
}
}
private func callSignInCompletion(withError error:NSError?) {
if error == nil {
self._signInCallback.forEachTargetInCallbacksDo() { (obj:AnyObject?, sel:Selector, dict:NSMutableDictionary!) in
if let nsObject = obj as? NSObject {
nsObject.performSelector(sel, withObject: error)
}
else {
Assert.badMojo(alwaysPrintThisString: "Objects should be NSObject's")
}
}
}
else {
Log.error("Could not sign in: \(error)")
}
}
// Parameters in a REST API call to be provided to the server for a user's credentials & other info (e.g., deviceId, cloudFolderPath).
private func serverParameters(userCreds:SMUserCredentials) -> [String:AnyObject] {
Assert.If(0 == SMSyncServerUser.MobileDeviceUUID.stringValue.characters.count, thenPrintThisString: "Whoops: No device UUID!")
var userCredentials = userCreds.toServerParameterDictionary()
userCredentials[SMServerConstants.mobileDeviceUUIDKey] = SMSyncServerUser.MobileDeviceUUID.stringValue
userCredentials[SMServerConstants.cloudFolderPath] = self.cloudFolderPath!
var serverParameters = [String:AnyObject]()
serverParameters[SMServerConstants.userCredentialsDataKey] = userCredentials
return serverParameters
}
private func processSignInResult(forExistingUser existingUser:Bool, apiResult:SMServerAPIResult) -> NSError? {
// Not all non-nil "errors" actually indicate an error in our context. Check the return code first.
var returnError = apiResult.error
if apiResult.returnCode != nil {
switch (apiResult.returnCode!) {
case SMServerConstants.rcOK:
returnError = nil
case SMServerConstants.rcUserOnSystem:
returnError = nil
case SMServerConstants.rcUserNotOnSystem:
if existingUser {
returnError = Error.Create("That user doesn't exist yet-- you need to create the user first!")
}
default:
returnError = Error.Create("An error occurred when trying to sign in (return code: \(apiResult.returnCode))")
}
}
return returnError
}
}
extension SMSyncServerUser : SMServerAPIUserDelegate {
var userCredentialParams:[String:AnyObject]? {
get {
Assert.If(!self.signedIn, thenPrintThisString: "Yikes: There is no signed in user!")
if let creds = self.delegate.lazyRef?.syncServerSignedInUser {
return self.serverParameters(creds)
}
else {
return nil
}
}
}
func refreshUserCredentials() {
self.delegate.lazyRef?.syncServerRefreshUserCredentials()
}
}
| gpl-3.0 | 769242951456302291d0a49916c05720 | 43.239394 | 390 | 0.663059 | 5.266595 | false | false | false | false |
roambotics/swift | test/Interop/SwiftToCxx/properties/getter-in-cxx.swift | 2 | 8589 | // RUN: %empty-directory(%t)
// RUN: %target-swift-frontend %s -typecheck -module-name Properties -clang-header-expose-decls=all-public -emit-clang-header-path %t/properties.h
// RUN: %FileCheck %s < %t/properties.h
// RUN: %check-interop-cxx-header-in-clang(%t/properties.h)
public struct FirstSmallStruct {
public let x: UInt32
}
// CHECK: class FirstSmallStruct final {
// CHECK: public:
// CHECK: inline FirstSmallStruct(FirstSmallStruct &&)
// CHECK-NEXT: inline uint32_t getX() const;
// CHECK-NEXT: private:
public struct LargeStruct {
public let x1, x2, x3, x4, x5, x6: Int
public var anotherLargeStruct: LargeStruct {
return LargeStruct(x1: 11, x2: 42, x3: -0xFFF, x4: 0xbad, x5: 5, x6: 0)
}
public var firstSmallStruct: FirstSmallStruct {
return FirstSmallStruct(x: 65)
}
static public var staticX: Int {
return -402
}
static public var staticSmallStruct: FirstSmallStruct {
return FirstSmallStruct(x: 789)
}
}
// CHECK: class LargeStruct final {
// CHECK: public:
// CHECK: inline LargeStruct(LargeStruct &&)
// CHECK-NEXT: inline swift::Int getX1() const;
// CHECK-NEXT: inline swift::Int getX2() const;
// CHECK-NEXT: inline swift::Int getX3() const;
// CHECK-NEXT: inline swift::Int getX4() const;
// CHECK-NEXT: inline swift::Int getX5() const;
// CHECK-NEXT: inline swift::Int getX6() const;
// CHECK-NEXT: inline LargeStruct getAnotherLargeStruct() const;
// CHECK-NEXT: inline FirstSmallStruct getFirstSmallStruct() const;
// CHECK-NEXT: static inline swift::Int getStaticX();
// CHECK-NEXT: static inline FirstSmallStruct getStaticSmallStruct();
// CHECK-NEXT: private:
public final class PropertiesInClass {
public let storedInt: Int32
init(_ x: Int32) {
storedInt = x
}
public var computedInt: Int {
return Int(storedInt) - 1
}
public var smallStruct: FirstSmallStruct {
return FirstSmallStruct(x: UInt32(-storedInt));
}
}
// CHECK: class PropertiesInClass final : public swift::_impl::RefCountedClass {
// CHECK: using RefCountedClass::operator=;
// CHECK-NEXT: inline int32_t getStoredInt();
// CHECK-NEXT: inline swift::Int getComputedInt();
// CHECK-NEXT: inline FirstSmallStruct getSmallStruct();
public func createPropsInClass(_ x: Int32) -> PropertiesInClass {
return PropertiesInClass(x)
}
public struct SmallStructWithGetters {
public let storedInt: UInt32
public var computedInt: Int {
return Int(storedInt) + 2
}
public var largeStruct: LargeStruct {
return LargeStruct(x1: computedInt * 2, x2: 1, x3: 2, x4: 3, x5: 4, x6: 5)
}
public var smallStruct: SmallStructWithGetters {
return SmallStructWithGetters(storedInt: 0xFAE);
}
}
// CHECK: class SmallStructWithGetters final {
// CHECK: public:
// CHECK: inline SmallStructWithGetters(SmallStructWithGetters &&)
// CHECK-NEXT: inline uint32_t getStoredInt() const;
// CHECK-NEXT: inline swift::Int getComputedInt() const;
// CHECK-NEXT: inline LargeStruct getLargeStruct() const;
// CHECK-NEXT: inline SmallStructWithGetters getSmallStruct() const;
// CHECK-NEXT: private:
public func createSmallStructWithGetter() -> SmallStructWithGetters {
return SmallStructWithGetters(storedInt: 21)
}
private class RefCountedClass {
let x: Int
init(x: Int) {
self.x = x
print("create RefCountedClass \(x)")
}
deinit {
print("destroy RefCountedClass \(x)")
}
}
public struct StructWithRefCountStoredProp {
private let storedRef: RefCountedClass
internal init(x: Int) {
storedRef = RefCountedClass(x: x)
}
public var another: StructWithRefCountStoredProp {
return StructWithRefCountStoredProp(x: 1)
}
}
public func createStructWithRefCountStoredProp() -> StructWithRefCountStoredProp {
return StructWithRefCountStoredProp(x: 0)
}
// CHECK: inline uint32_t FirstSmallStruct::getX() const {
// CHECK-NEXT: return _impl::$s10Properties16FirstSmallStructV1xs6UInt32Vvg(_impl::swift_interop_passDirect_Properties_uint32_t_0_4(_getOpaquePointer()));
// CHECK-NEXT: }
// CHECK: inline swift::Int LargeStruct::getX1() const {
// CHECK-NEXT: return _impl::$s10Properties11LargeStructV2x1Sivg(_getOpaquePointer());
// CHECK-NEXT: }
// CHECK-NEXT: inline swift::Int LargeStruct::getX2() const {
// CHECK-NEXT: return _impl::$s10Properties11LargeStructV2x2Sivg(_getOpaquePointer());
// CHECK-NEXT: }
// CHECK-NEXT: inline swift::Int LargeStruct::getX3() const {
// CHECK-NEXT: return _impl::$s10Properties11LargeStructV2x3Sivg(_getOpaquePointer());
// CHECK-NEXT: }
// CHECK-NEXT: inline swift::Int LargeStruct::getX4() const {
// CHECK-NEXT: return _impl::$s10Properties11LargeStructV2x4Sivg(_getOpaquePointer());
// CHECK-NEXT: }
// CHECK-NEXT: inline swift::Int LargeStruct::getX5() const {
// CHECK-NEXT: return _impl::$s10Properties11LargeStructV2x5Sivg(_getOpaquePointer());
// CHECK-NEXT: }
// CHECK-NEXT: inline swift::Int LargeStruct::getX6() const {
// CHECK-NEXT: return _impl::$s10Properties11LargeStructV2x6Sivg(_getOpaquePointer());
// CHECK-NEXT: }
// CHECK-NEXT: inline LargeStruct LargeStruct::getAnotherLargeStruct() const {
// CHECK-NEXT: return _impl::_impl_LargeStruct::returnNewValue([&](char * _Nonnull result) {
// CHECK-NEXT: _impl::$s10Properties11LargeStructV07anotherbC0ACvg(result, _getOpaquePointer());
// CHECK-NEXT: });
// CHECK-NEXT: }
// CHECK-NEXT: inline FirstSmallStruct LargeStruct::getFirstSmallStruct() const {
// CHECK-NEXT: return _impl::_impl_FirstSmallStruct::returnNewValue([&](char * _Nonnull result) {
// CHECK-NEXT: _impl::swift_interop_returnDirect_Properties_uint32_t_0_4(result, _impl::$s10Properties11LargeStructV010firstSmallC0AA05FirsteC0Vvg(_getOpaquePointer()));
// CHECK-NEXT: });
// CHECK-NEXT: }
// CHECK-NEXT: inline swift::Int LargeStruct::getStaticX() {
// CHECK-NEXT: return _impl::$s10Properties11LargeStructV7staticXSivgZ();
// CHECK-NEXT: }
// CHECK-NEXT: inline FirstSmallStruct LargeStruct::getStaticSmallStruct() {
// CHECK-NEXT: return _impl::_impl_FirstSmallStruct::returnNewValue([&](char * _Nonnull result) {
// CHECK-NEXT: _impl::swift_interop_returnDirect_Properties_uint32_t_0_4(result, _impl::$s10Properties11LargeStructV011staticSmallC0AA05FirsteC0VvgZ());
// CHECK-NEXT: });
// CHECK-NEXT: }
// CHECK: inline int32_t PropertiesInClass::getStoredInt() {
// CHECK-NEXT: return _impl::$s10Properties0A7InClassC9storedInts5Int32Vvg(::swift::_impl::_impl_RefCountedClass::getOpaquePointer(*this));
// CHECK-NEXT: }
// CHECK-NEXT: inline swift::Int PropertiesInClass::getComputedInt() {
// CHECK-NEXT: return _impl::$s10Properties0A7InClassC11computedIntSivg(::swift::_impl::_impl_RefCountedClass::getOpaquePointer(*this));
// CHECK-NEXT: }
// CHECK-NEXT: inline FirstSmallStruct PropertiesInClass::getSmallStruct() {
// CHECK-NEXT: return _impl::_impl_FirstSmallStruct::returnNewValue([&](char * _Nonnull result) {
// CHECK-NEXT: _impl::swift_interop_returnDirect_Properties_uint32_t_0_4(result, _impl::$s10Properties0A7InClassC11smallStructAA010FirstSmallE0Vvg(::swift::_impl::_impl_RefCountedClass::getOpaquePointer(*this)));
// CHECK-NEXT: });
// CHECK-NEXT: }
// CHECK: inline uint32_t SmallStructWithGetters::getStoredInt() const {
// CHECK-NEXT: return _impl::$s10Properties22SmallStructWithGettersV9storedInts6UInt32Vvg(_impl::swift_interop_passDirect_Properties_uint32_t_0_4(_getOpaquePointer()));
// CHECK-NEXT: }
// CHECK-NEXT: inline swift::Int SmallStructWithGetters::getComputedInt() const {
// CHECK-NEXT: return _impl::$s10Properties22SmallStructWithGettersV11computedIntSivg(_impl::swift_interop_passDirect_Properties_uint32_t_0_4(_getOpaquePointer()));
// CHECK-NEXT: }
// CHECK-NEXT: inline LargeStruct SmallStructWithGetters::getLargeStruct() const {
// CHECK-NEXT: return _impl::_impl_LargeStruct::returnNewValue([&](char * _Nonnull result) {
// CHECK-NEXT: _impl::$s10Properties22SmallStructWithGettersV05largeC0AA05LargeC0Vvg(result, _impl::swift_interop_passDirect_Properties_uint32_t_0_4(_getOpaquePointer()));
// CHECK-NEXT: });
// CHECK-NEXT: }
// CHECK-NEXT: inline SmallStructWithGetters SmallStructWithGetters::getSmallStruct() const {
// CHECK-NEXT: return _impl::_impl_SmallStructWithGetters::returnNewValue([&](char * _Nonnull result) {
// CHECK-NEXT: _impl::swift_interop_returnDirect_Properties_uint32_t_0_4(result, _impl::$s10Properties22SmallStructWithGettersV05smallC0ACvg(_impl::swift_interop_passDirect_Properties_uint32_t_0_4(_getOpaquePointer())));
// CHECK-NEXT: });
// CHECK-NEXT: }
| apache-2.0 | b0241bb569c1d4feabab1505c5634f38 | 41.519802 | 222 | 0.726278 | 3.884668 | false | false | false | false |
dokun1/Lumina | Sources/Lumina/Camera/Extensions/FocusHandlerExtension.swift | 1 | 1852 | //
// FocusHandlerExtension.swift
// Lumina
//
// Created by David Okun on 11/20/17.
// Copyright © 2017 David Okun. All rights reserved.
//
import Foundation
import AVFoundation
extension LuminaCamera {
func handleFocus(at focusPoint: CGPoint) {
self.sessionQueue.async {
guard let input = self.videoInput else {
return
}
do {
if input.device.isFocusModeSupported(.autoFocus) && input.device.isFocusPointOfInterestSupported {
try input.device.lockForConfiguration()
input.device.focusMode = .autoFocus
input.device.focusPointOfInterest = CGPoint(x: focusPoint.x, y: focusPoint.y)
if input.device.isExposureModeSupported(.autoExpose) && input.device.isExposurePointOfInterestSupported {
input.device.exposureMode = .autoExpose
input.device.exposurePointOfInterest = CGPoint(x: focusPoint.x, y: focusPoint.y)
}
input.device.unlockForConfiguration()
} else {
self.delegate?.finishedFocus(camera: self)
}
} catch {
self.delegate?.finishedFocus(camera: self)
}
}
}
func resetCameraToContinuousExposureAndFocus() {
do {
guard let input = self.videoInput else {
LuminaLogger.error(message: "Trying to focus, but cannot detect device input!")
return
}
if input.device.isFocusModeSupported(.continuousAutoFocus) {
try input.device.lockForConfiguration()
input.device.focusMode = .continuousAutoFocus
if input.device.isExposureModeSupported(.continuousAutoExposure) {
input.device.exposureMode = .continuousAutoExposure
}
input.device.unlockForConfiguration()
}
} catch {
LuminaLogger.error(message: "could not reset to continuous auto focus and exposure!!")
}
}
}
| mit | 7ad45ced1924589184f682de14c313cd | 32.654545 | 115 | 0.667747 | 4.84555 | false | true | false | false |
crazypoo/PTools | Pods/FluentDarkModeKit/Sources/FluentDarkModeKit/Extensions/UITextField+DarkModeKit.swift | 1 | 1643 | //
// Copyright (c) Microsoft Corporation. All rights reserved.
// Licensed under the MIT License.
//
extension UITextField {
override open func dmTraitCollectionDidChange(_ previousTraitCollection: DMTraitCollection?) {
super.dmTraitCollectionDidChange(previousTraitCollection)
if #available(iOS 13.0, *) {
return
}
else {
dm_updateDynamicColors()
if let dynamicTextColor = textColor?.copy() as? DynamicColor {
textColor = dynamicTextColor
}
keyboardAppearance = {
if DMTraitCollection.override.userInterfaceStyle == .dark {
return .dark
}
else {
return .default
}
}()
}
}
}
extension UITextField {
/// `UITextField` will not call `super.willMove(toWindow:)` in its implementation, so we need to swizzle it separately.
static let swizzleTextFieldWillMoveToWindowOnce: Void = {
let selector = #selector(willMove(toWindow:))
guard let method = class_getInstanceMethod(UITextField.self, selector) else {
assertionFailure(DarkModeManager.messageForSwizzlingFailed(class: UITextField.self, selector: selector))
return
}
let imp = method_getImplementation(method)
class_replaceMethod(UITextField.self, selector, imp_implementationWithBlock({ (self: UITextField, window: UIWindow?) -> Void in
let oldIMP = unsafeBitCast(imp, to: (@convention(c) (UITextField, Selector, UIWindow?) -> Void).self)
oldIMP(self, selector, window)
self.dmTraitCollectionDidChange(nil)
} as @convention(block) (UITextField, UIWindow?) -> Void), method_getTypeEncoding(method))
}()
}
| mit | 62722e4cc087c7630ab185001e084006 | 32.530612 | 131 | 0.690201 | 4.762319 | false | false | false | false |
Fluffcorn/ios-sticker-packs-app | MessagesExtension/WAStickers code files/Limits.swift | 1 | 674 | //
// Copyright (c) WhatsApp Inc. and its affiliates.
// All rights reserved.
//
// This source code is licensed under the BSD-style license found in the
// LICENSE file in the root directory of this source tree.
//
import UIKit
struct Limits {
static let MaxStickerFileSize: Int = 100 * 1024
static let MaxTrayImageFileSize: Int = 50 * 1024
static let TrayImageDimensions: CGSize = CGSize(width: 96, height: 96)
static let ImageDimensions: CGSize = CGSize(width: 512, height: 512)
static let MinStickersPerPack: Int = 3
static let MaxStickersPerPack: Int = 30
static let MaxCharLimit128: Int = 128
static let MaxEmojisCount: Int = 3
}
| mit | b5e6f2299ba067802865c778ef947830 | 27.083333 | 74 | 0.715134 | 3.94152 | false | false | false | false |
caronae/caronae-ios | Caronae/AppDelegate+Notifications.swift | 1 | 6189 | import AudioToolbox
extension AppDelegate {
func handleNotification(_ userInfo: [AnyHashable: Any]) -> Bool {
guard let notificationType = userInfo["msgType"] as? String else {
handleUnknownNotification(userInfo)
return false
}
switch notificationType {
case "chat":
handleChatNotification(userInfo)
case "joinRequest":
handleJoinRequestNotification(userInfo)
case "accepted":
handleJoinRequestAccepted(userInfo)
case "canceled", "cancelled", "finished", "refused":
handleFinishedNotification(userInfo)
case "quitter":
handleQuitterNotification(userInfo)
default:
handleUnknownNotification(userInfo)
return false
}
return true
}
private func handleJoinRequestNotification(_ userInfo: [AnyHashable: Any]) {
guard let (id, senderID, rideID, message) = rideNotificationInfo(userInfo) else {
NSLog("Received ride join request notification but could not parse the notification data")
return
}
let notification = Notification()
notification.id = id
notification.senderID = senderID
notification.rideID = rideID
notification.kind = .rideJoinRequest
NotificationService.instance.createNotification(notification)
showMessageIfActive(message)
}
private func handleJoinRequestAccepted(_ userInfo: [AnyHashable: Any]) {
guard let (id, senderID, rideID, message) = rideNotificationInfo(userInfo) else {
NSLog("Received ride join request accepted notification but could not parse the notification data")
return
}
let notification = Notification()
notification.id = id
notification.senderID = senderID
notification.rideID = rideID
notification.kind = .rideJoinRequestAccepted
NotificationService.instance.createNotification(notification)
updateMyRidesIfActive()
showMessageIfActive(message)
}
private func handleFinishedNotification(_ userInfo: [AnyHashable: Any]) {
guard let (_, _, rideID, message) = rideNotificationInfo(userInfo) else {
NSLog("Received ride finished notification but could not parse the notification data")
return
}
NotificationService.instance.clearNotifications(forRideID: rideID)
updateMyRidesIfActive()
showMessageIfActive(message)
}
private func handleQuitterNotification(_ userInfo: [AnyHashable: Any]) {
guard let (_, _, _, message) = rideNotificationInfo(userInfo) else {
NSLog("Received quitter notification but could not parse the notification data")
return
}
updateMyRidesIfActive()
showMessageIfActive(message)
}
private func handleChatNotification(_ userInfo: [AnyHashable: Any]) {
guard let (id, senderID, rideID, message) = rideNotificationInfo(userInfo),
senderID != UserService.instance.user?.id else {
return
}
ChatService.instance.updateMessagesForRide(withID: rideID) { error in
guard error == nil else {
NSLog("Error updating messages for ride %ld. (%@)", rideID, error!.localizedDescription)
return
}
NSLog("Updated messages for ride %ld", rideID)
}
// Display notification if the chat window is not already open
let notification = Notification()
notification.kind = .chat
notification.id = id
notification.senderID = senderID
notification.rideID = rideID
if UIApplication.shared.applicationState != .active {
NotificationService.instance.createNotification(notification)
return
}
if let topViewController = UIApplication.shared.topViewController(),
let chatViewController = topViewController as? ChatViewController,
chatViewController.ride.id == rideID {
return
}
NotificationService.instance.createNotification(notification)
showMessageIfActive(message)
}
private func handleUnknownNotification(_ userInfo: [AnyHashable: Any]) {
if let message = userInfo["message"] as? String {
showMessageIfActive(message)
} else {
NSLog("Received unknown notification type: (%@)", userInfo)
}
}
func playNotificationSound() {
AudioServicesPlayAlertSoundWithCompletion(beepSound, nil)
}
func showMessageIfActive(_ message: String) {
if UIApplication.shared.applicationState == .active {
playNotificationSound()
CaronaeMessagesNotification.instance.showSuccess(withText: message)
}
}
func updateMyRidesIfActive() {
if UIApplication.shared.applicationState == .active {
RideService.instance.updateMyRides(success: {
NSLog("My rides updated")
}, error: { error in
NSLog("Error updating my rides (\(error.localizedDescription))")
})
}
}
@objc func updateApplicationBadgeNumber() {
guard let notifications = try? NotificationService.instance.getNotifications() else { return }
UIApplication.shared.applicationIconBadgeNumber = notifications.count
}
private func rideNotificationInfo(_ userInfo: [AnyHashable: Any]) -> (String, Int, Int, String)? {
guard let id = userInfo["id"] as? String,
let senderIDString = userInfo["senderId"] as? String,
let senderID = Int(senderIDString),
let rideIDString = userInfo["rideId"] as? String,
let rideID = Int(rideIDString),
let message = userInfo["message"] as? String else {
return nil
}
return (id, senderID, rideID, message)
}
}
| gpl-3.0 | c10a19e5001e7d4b34605aa43a48b285 | 35.839286 | 111 | 0.616901 | 5.877493 | false | false | false | false |
podverse/podverse-ios | Podverse/UITabbarController+PlayerView.swift | 1 | 5800 | //
// UITabbarController+PlayerView.swift
// Podverse
//
// Created by Creon Creonopoulos on 7/16/17.
// Copyright © 2017 Podverse LLC. All rights reserved.
//
import UIKit
protocol PlayerViewProtocol {
func setupPlayerBar()
func hidePlayerView()
func showPlayerView()
func goToNowPlaying(isDataAvailable:Bool)
var playerView:NowPlayingBar {get}
}
private var pvAssociationKey: UInt8 = 0
extension UITabBarController:PlayerViewProtocol {
var playerView:NowPlayingBar {
get {
return objc_getAssociatedObject(self, &pvAssociationKey) as! NowPlayingBar
}
set(newValue) {
objc_setAssociatedObject(self, &pvAssociationKey, newValue, objc_AssociationPolicy.OBJC_ASSOCIATION_RETAIN)
}
}
override open func viewDidLoad() {
super.viewDidLoad()
self.playerView = NowPlayingBar()
setupPlayerBar()
}
func setupPlayerBar() {
var extraIphoneXSpace:CGFloat = 0.0
if (UIScreen.main.nativeBounds.height == 2436.0) {
extraIphoneXSpace = 33.0
}
self.playerView.frame = CGRect(x: self.tabBar.frame.minX,
y: self.tabBar.frame.minY - NowPlayingBar.playerHeight - extraIphoneXSpace,
width: self.tabBar.frame.width,
height: NowPlayingBar.playerHeight)
self.playerView.isHidden = true
self.view.addSubview(self.playerView)
self.playerView.delegate = self
}
func hidePlayerView() {
self.playerView.isHidden = true
PVViewController.delegate?.adjustTableView()
}
func showPlayerView() {
self.playerView.isHidden = false
PVViewController.delegate?.adjustTableView()
}
func goToNowPlaying(isDataAvailable:Bool = true) {
if let currentNavVC = self.selectedViewController?.childViewControllers.first?.navigationController {
var optionalMediaPlayerVC: MediaPlayerViewController?
for controller in currentNavVC.viewControllers {
if controller.isKind(of: MediaPlayerViewController.self) {
optionalMediaPlayerVC = controller as? MediaPlayerViewController
break
}
}
if let mediaPlayerVC = optionalMediaPlayerVC {
currentNavVC.popToViewController(mediaPlayerVC, animated: false)
} else if let mediaPlayerVC = UIStoryboard(name: "Main", bundle: nil).instantiateViewController(withIdentifier: "MediaPlayerVC") as? MediaPlayerViewController {
PVMediaPlayer.shared.isDataAvailable = isDataAvailable
if !isDataAvailable {
PVMediaPlayer.shared.shouldAutoplayOnce = true
}
currentNavVC.pushViewController(mediaPlayerVC, animated: true)
}
}
}
func goToClips(_ clipFilter:ClipFilter? = nil, _ clipSorting:ClipSorting? = nil) {
if let currentNavVC = self.selectedViewController?.childViewControllers.first?.navigationController {
var optionalClipsTVC: ClipsTableViewController?
for controller in currentNavVC.viewControllers {
if controller.isKind(of: ClipsTableViewController.self) {
optionalClipsTVC = controller as? ClipsTableViewController
break
}
}
if let clipFilter = clipFilter {
UserDefaults.standard.set(clipFilter.rawValue, forKey: kClipsTableFilterType)
} else {
UserDefaults.standard.set(ClipFilter.allPodcasts.rawValue, forKey: kClipsTableFilterType)
}
if let clipSorting = clipSorting {
UserDefaults.standard.set(clipSorting.rawValue, forKey: kClipsTableSortingType)
} else {
UserDefaults.standard.set(ClipSorting.topWeek.rawValue, forKey: kClipsTableFilterType)
}
if let clipsTVC = optionalClipsTVC {
clipsTVC.shouldOverrideQuery = true
currentNavVC.popToViewController(clipsTVC, animated: false)
} else if let clipsTVC = UIStoryboard(name: "Main", bundle: nil).instantiateViewController(withIdentifier: "ClipsTVC") as? ClipsTableViewController {
currentNavVC.pushViewController(clipsTVC, animated: false)
}
}
}
func goToPlaylistDetail(id:String) {
if let currentNavVC = self.selectedViewController?.childViewControllers.first?.navigationController {
if let playlistDetailVC = UIStoryboard(name: "Main", bundle: nil).instantiateViewController(withIdentifier: "PlaylistDetailVC") as? PlaylistDetailTableViewController {
playlistDetailVC.playlistId = id
playlistDetailVC.isDataAvailable = false
currentNavVC.pushViewController(playlistDetailVC, animated: true)
}
}
}
func gotoSearchPodcastView(id:String) {
if let currentNavVC = self.selectedViewController?.childViewControllers.first?.navigationController {
if let searchPodcastVC = UIStoryboard(name: "Main", bundle: nil).instantiateViewController(withIdentifier: "SearchPodcastVC") as? SearchPodcastViewController {
searchPodcastVC.podcastId = id
currentNavVC.pushViewController(searchPodcastVC, animated: true)
}
}
}
}
extension UITabBarController:NowPlayingBarDelegate {
func didTapView() {
goToNowPlaying()
}
}
| agpl-3.0 | 1090ee0eab6d5cbf7cf3c8a40c2606b6 | 38.182432 | 179 | 0.62666 | 5.608317 | false | false | false | false |
omaralbeik/SwifterSwift | Sources/Extensions/UIKit/UITableViewExtensions.swift | 1 | 7663 | //
// UITableViewExtensions.swift
// SwifterSwift
//
// Created by Omar Albeik on 8/22/16.
// Copyright © 2016 SwifterSwift
//
#if canImport(UIKit) && !os(watchOS)
import UIKit
// MARK: - Properties
public extension UITableView {
/// SwifterSwift: Index path of last row in tableView.
public var indexPathForLastRow: IndexPath? {
return indexPathForLastRow(inSection: lastSection)
}
/// SwifterSwift: Index of last section in tableView.
public var lastSection: Int {
return numberOfSections > 0 ? numberOfSections - 1 : 0
}
}
// MARK: - Methods
public extension UITableView {
/// SwifterSwift: Number of all rows in all sections of tableView.
///
/// - Returns: The count of all rows in the tableView.
public func numberOfRows() -> Int {
var section = 0
var rowCount = 0
while section < numberOfSections {
rowCount += numberOfRows(inSection: section)
section += 1
}
return rowCount
}
/// SwifterSwift: IndexPath for last row in section.
///
/// - Parameter section: section to get last row in.
/// - Returns: optional last indexPath for last row in section (if applicable).
public func indexPathForLastRow(inSection section: Int) -> IndexPath? {
guard section >= 0 else { return nil }
guard numberOfRows(inSection: section) > 0 else {
return IndexPath(row: 0, section: section)
}
return IndexPath(row: numberOfRows(inSection: section) - 1, section: section)
}
/// Reload data with a completion handler.
///
/// - Parameter completion: completion handler to run after reloadData finishes.
public func reloadData(_ completion: @escaping () -> Void) {
UIView.animate(withDuration: 0, animations: {
self.reloadData()
}, completion: { _ in
completion()
})
}
/// SwifterSwift: Remove TableFooterView.
public func removeTableFooterView() {
tableFooterView = nil
}
/// SwifterSwift: Remove TableHeaderView.
public func removeTableHeaderView() {
tableHeaderView = nil
}
/// SwifterSwift: Scroll to bottom of TableView.
///
/// - Parameter animated: set true to animate scroll (default is true).
public func scrollToBottom(animated: Bool = true) {
let bottomOffset = CGPoint(x: 0, y: contentSize.height - bounds.size.height)
setContentOffset(bottomOffset, animated: animated)
}
/// SwifterSwift: Scroll to top of TableView.
///
/// - Parameter animated: set true to animate scroll (default is true).
public func scrollToTop(animated: Bool = true) {
setContentOffset(CGPoint.zero, animated: animated)
}
/// SwifterSwift: Dequeue reusable UITableViewCell using class name
///
/// - Parameter name: UITableViewCell type
/// - Returns: UITableViewCell object with associated class name.
public func dequeueReusableCell<T: UITableViewCell>(withClass name: T.Type) -> T {
guard let cell = dequeueReusableCell(withIdentifier: String(describing: name)) as? T else {
fatalError("Couldn't find UITableViewCell for \(String(describing: name))")
}
return cell
}
/// SwifterSwift: Dequeue reusable UITableViewCell using class name for indexPath
///
/// - Parameters:
/// - name: UITableViewCell type.
/// - indexPath: location of cell in tableView.
/// - Returns: UITableViewCell object with associated class name.
public func dequeueReusableCell<T: UITableViewCell>(withClass name: T.Type, for indexPath: IndexPath) -> T {
guard let cell = dequeueReusableCell(withIdentifier: String(describing: name), for: indexPath) as? T else {
fatalError("Couldn't find UITableViewCell for \(String(describing: name))")
}
return cell
}
/// SwifterSwift: Dequeue reusable UITableViewHeaderFooterView using class name
///
/// - Parameter name: UITableViewHeaderFooterView type
/// - Returns: UITableViewHeaderFooterView object with associated class name.
public func dequeueReusableHeaderFooterView<T: UITableViewHeaderFooterView>(withClass name: T.Type) -> T {
guard let headerFooterView = dequeueReusableHeaderFooterView(withIdentifier: String(describing: name)) as? T else {
fatalError("Couldn't find UITableViewHeaderFooterView for \(String(describing: name))")
}
return headerFooterView
}
/// SwifterSwift: Register UITableViewHeaderFooterView using class name
///
/// - Parameters:
/// - nib: Nib file used to create the header or footer view.
/// - name: UITableViewHeaderFooterView type.
public func register<T: UITableViewHeaderFooterView>(nib: UINib?, withHeaderFooterViewClass name: T.Type) {
register(nib, forHeaderFooterViewReuseIdentifier: String(describing: name))
}
/// SwifterSwift: Register UITableViewHeaderFooterView using class name
///
/// - Parameter name: UITableViewHeaderFooterView type
public func register<T: UITableViewHeaderFooterView>(headerFooterViewClassWith name: T.Type) {
register(T.self, forHeaderFooterViewReuseIdentifier: String(describing: name))
}
/// SwifterSwift: Register UITableViewCell using class name
///
/// - Parameter name: UITableViewCell type
public func register<T: UITableViewCell>(cellWithClass name: T.Type) {
register(T.self, forCellReuseIdentifier: String(describing: name))
}
/// SwifterSwift: Register UITableViewCell using class name
///
/// - Parameters:
/// - nib: Nib file used to create the tableView cell.
/// - name: UITableViewCell type.
public func register<T: UITableViewCell>(nib: UINib?, withCellClass name: T.Type) {
register(nib, forCellReuseIdentifier: String(describing: name))
}
/// SwifterSwift: Register UITableViewCell with .xib file using only its corresponding class.
/// Assumes that the .xib filename and cell class has the same name.
///
/// - Parameters:
/// - name: UITableViewCell type.
/// - bundleClass: Class in which the Bundle instance will be based on.
public func register<T: UITableViewCell>(nibWithCellClass name: T.Type, at bundleClass: AnyClass? = nil) {
let identifier = String(describing: name)
var bundle: Bundle?
if let bundleName = bundleClass {
bundle = Bundle(for: bundleName)
}
register(UINib(nibName: identifier, bundle: bundle), forCellReuseIdentifier: identifier)
}
/// SwifterSwift: Check whether IndexPath is valid within the tableView
///
/// - Parameter indexPath: An IndexPath to check
/// - Returns: Boolean value for valid or invalid IndexPath
public func isValidIndexPath(_ indexPath: IndexPath) -> Bool {
return indexPath.section < numberOfSections && indexPath.row < numberOfRows(inSection: indexPath.section)
}
/// SwifterSwift: Safely scroll to possibly invalid IndexPath
///
/// - Parameters:
/// - indexPath: Target IndexPath to scroll to
/// - scrollPosition: Scroll position
/// - animated: Whether to animate or not
public func safeScrollToRow(at indexPath: IndexPath, at scrollPosition: UITableView.ScrollPosition, animated: Bool) {
guard indexPath.section < numberOfSections else { return }
guard indexPath.row < numberOfRows(inSection: indexPath.section) else { return }
scrollToRow(at: indexPath, at: scrollPosition, animated: animated)
}
}
#endif
| mit | e9bcffc1aa9f6cef4075c8e41758a5f6 | 38.091837 | 123 | 0.670843 | 5.156124 | false | false | false | false |
akrio714/Wbm | Wbm/Campaign/List/Model/CampaignListItemModel.swift | 1 | 1118 | //
// CampaignListItemModel.swift
// Wbm
//
// Created by akrio on 2017/7/14.
// Copyright © 2017年 akrio. All rights reserved.
//
import Foundation
import SwiftDate
import Moya_SwiftyJSONMapper
import SwiftyJSON
import RxDataSources
struct CampaignListItemModel:ALSwiftyJSONAble {
/// 唯一标示
let id:String
/// publisher名字
let publishers:[String]
/// 价格
let price:Float
/// 持续时间
let durations:Int
/// 创建时间
let createTime:DateInRegion
/// 图片地址
let imageUrl:String
init?(jsonData: JSON) {
self.publishers = jsonData["publishers"].arrayValue.map{ $0.stringValue }
self.price = jsonData["price"].floatValue
self.durations = jsonData["durations"].intValue
self.createTime = jsonData["createTime"].dateFormatValue(.iso8601Auto)
self.id = jsonData["id"].stringValue
self.imageUrl = jsonData["image"].stringValue
}
init() {
publishers = [""]
price = 0
durations = 0
createTime = DateInRegion()
id = ""
imageUrl = ""
}
}
| apache-2.0 | 7d01be72ec609117420523caedf1795b | 23.431818 | 81 | 0.630698 | 4.199219 | false | false | false | false |
hayashi311/iosdcjp2016app | iOSApp/iOSDCJP2016/Entities/Sponsor.swift | 1 | 702 | //
// Sponsor.swift
// iOSDCJP2016
//
// Created by hayashi311 on 7/10/16.
// Copyright © 2016 hayashi311. All rights reserved.
//
import Foundation
import Unbox
struct Sponsor: Unboxable {
let name: String
let description: String?
let image: String?
let url: String?
init(unboxer: Unboxer) {
name = unboxer.unbox("name")
description = unboxer.unbox("description")
image = unboxer.unbox("image")
url = unboxer.unbox("url")
}
}
struct SponsorTier: Unboxable {
let name: String
let sponsors: [Sponsor]
init(unboxer: Unboxer) {
name = unboxer.unbox("name")
sponsors = unboxer.unbox("sponsors")
}
}
| mit | b647bbda44172372d654fd0ad9cde27e | 19.028571 | 53 | 0.616262 | 3.768817 | false | false | false | false |
Muxing1991/Standford_Developing_iOS8_With_Swift | AxesDrawer.swift | 1 | 8479 | //
// AxesDrawer.swift
// Calculator
//
// Created by CS193p Instructor.
// Copyright (c) 2015 Stanford University. All rights reserved.
//
import UIKit
class AxesDrawer
{
private struct Constants {
static let HashmarkSize: CGFloat = 6
}
var color = UIColor.blueColor()
var minimumPointsPerHashmark: CGFloat = 40
var contentScaleFactor: CGFloat = 1 // set this from UIView's contentScaleFactor to position axes with maximum accuracy
convenience init(color: UIColor, contentScaleFactor: CGFloat) {
self.init()
self.color = color
self.contentScaleFactor = contentScaleFactor
}
convenience init(color: UIColor) {
self.init()
self.color = color
}
convenience init(contentScaleFactor: CGFloat) {
self.init()
self.contentScaleFactor = contentScaleFactor
}
// this method is the heart of the AxesDrawer
// it draws in the current graphic context's coordinate system
// therefore origin and bounds must be in the current graphics context's coordinate system
// pointsPerUnit is essentially the "scale" of the axes
// e.g. if you wanted there to be 100 points along an axis between -1 and 1,
// you'd set pointsPerUnit to 50
func drawAxesInRect(bounds: CGRect, origin: CGPoint, pointsPerUnit: CGFloat)
{
CGContextSaveGState(UIGraphicsGetCurrentContext())
color.set()
let path = UIBezierPath()
path.moveToPoint(CGPoint(x: bounds.minX, y: align(origin.y)))
path.addLineToPoint(CGPoint(x: bounds.maxX, y: align(origin.y)))
path.moveToPoint(CGPoint(x: align(origin.x), y: bounds.minY))
path.addLineToPoint(CGPoint(x: align(origin.x), y: bounds.maxY))
path.stroke()
drawHashmarksInRect(bounds, origin: origin, pointsPerUnit: abs(pointsPerUnit))
CGContextRestoreGState(UIGraphicsGetCurrentContext())
}
// the rest of this class is private
private func drawHashmarksInRect(bounds: CGRect, origin: CGPoint, pointsPerUnit: CGFloat)
{
if ((origin.x >= bounds.minX) && (origin.x <= bounds.maxX)) || ((origin.y >= bounds.minY) && (origin.y <= bounds.maxY))
{
// figure out how many units each hashmark must represent
// to respect both pointsPerUnit and minimumPointsPerHashmark
var unitsPerHashmark = minimumPointsPerHashmark / pointsPerUnit
if unitsPerHashmark < 1 {
unitsPerHashmark = pow(10, ceil(log10(unitsPerHashmark)))
} else {
unitsPerHashmark = floor(unitsPerHashmark)
}
let pointsPerHashmark = pointsPerUnit * unitsPerHashmark
// figure out which is the closest set of hashmarks (radiating out from the origin) that are in bounds
var startingHashmarkRadius: CGFloat = 1
if !CGRectContainsPoint(bounds, origin) {
if origin.x > bounds.maxX {
startingHashmarkRadius = (origin.x - bounds.maxX) / pointsPerHashmark + 1
} else if origin.x < bounds.minX {
startingHashmarkRadius = (bounds.minX - origin.x) / pointsPerHashmark + 1
} else if origin.y > bounds.maxY {
startingHashmarkRadius = (origin.y - bounds.maxY) / pointsPerHashmark + 1
} else {
startingHashmarkRadius = (bounds.minY - origin.y) / pointsPerHashmark + 1
}
startingHashmarkRadius = floor(startingHashmarkRadius)
}
// now create a bounding box inside whose edges those four hashmarks lie
let bboxSize = pointsPerHashmark * startingHashmarkRadius * 2
var bbox = CGRect(center: origin, size: CGSize(width: bboxSize, height: bboxSize))
// formatter for the hashmark labels
let formatter = NSNumberFormatter()
formatter.maximumFractionDigits = Int(-log10(Double(unitsPerHashmark)))
formatter.minimumIntegerDigits = 1
// radiate the bbox out until the hashmarks are further out than the bounds
while !CGRectContainsRect(bbox, bounds)
{
let label = formatter.stringFromNumber((origin.x-bbox.minX)/pointsPerUnit)!
if let leftHashmarkPoint = alignedPoint(bbox.minX, y: origin.y, insideBounds:bounds) {
drawHashmarkAtLocation(leftHashmarkPoint, .Top("-\(label)"))
}
if let rightHashmarkPoint = alignedPoint(bbox.maxX, y: origin.y, insideBounds:bounds) {
drawHashmarkAtLocation(rightHashmarkPoint, .Top(label))
}
if let topHashmarkPoint = alignedPoint(origin.x, y: bbox.minY, insideBounds:bounds) {
drawHashmarkAtLocation(topHashmarkPoint, .Left(label))
}
if let bottomHashmarkPoint = alignedPoint(origin.x, y: bbox.maxY, insideBounds:bounds) {
drawHashmarkAtLocation(bottomHashmarkPoint, .Left("-\(label)"))
}
bbox.insetInPlace(dx: -pointsPerHashmark, dy: -pointsPerHashmark)
}
}
}
private func drawHashmarkAtLocation(location: CGPoint, _ text: AnchoredText)
{
var dx: CGFloat = 0, dy: CGFloat = 0
switch text {
case .Left: dx = Constants.HashmarkSize / 2
case .Right: dx = Constants.HashmarkSize / 2
case .Top: dy = Constants.HashmarkSize / 2
case .Bottom: dy = Constants.HashmarkSize / 2
}
let path = UIBezierPath()
path.moveToPoint(CGPoint(x: location.x-dx, y: location.y-dy))
path.addLineToPoint(CGPoint(x: location.x+dx, y: location.y+dy))
path.stroke()
text.drawAnchoredToPoint(location, color: color)
}
private enum AnchoredText
{
case Left(String)
case Right(String)
case Top(String)
case Bottom(String)
static let VerticalOffset: CGFloat = 3
static let HorizontalOffset: CGFloat = 6
func drawAnchoredToPoint(location: CGPoint, color: UIColor) {
let attributes = [
NSFontAttributeName : UIFont.preferredFontForTextStyle(UIFontTextStyleFootnote),
NSForegroundColorAttributeName : color
]
var textRect = CGRect(center: location, size: text.sizeWithAttributes(attributes))
switch self {
case Top: textRect.origin.y += textRect.size.height / 2 + AnchoredText.VerticalOffset
case Left: textRect.origin.x += textRect.size.width / 2 + AnchoredText.HorizontalOffset
case Bottom: textRect.origin.y -= textRect.size.height / 2 + AnchoredText.VerticalOffset
case Right: textRect.origin.x -= textRect.size.width / 2 + AnchoredText.HorizontalOffset
}
text.drawInRect(textRect, withAttributes: attributes)
}
var text: String {
switch self {
case Left(let text): return text
case Right(let text): return text
case Top(let text): return text
case Bottom(let text): return text
}
}
}
// we want the axes and hashmarks to be exactly on pixel boundaries so they look sharp
// setting contentScaleFactor properly will enable us to put things on the closest pixel boundary
// if contentScaleFactor is left to its default (1), then things will be on the nearest "point" boundary instead
// the lines will still be sharp in that case, but might be a pixel (or more theoretically) off of where they should be
private func alignedPoint(x: CGFloat, y: CGFloat, insideBounds: CGRect? = nil) -> CGPoint?
{
let point = CGPoint(x: align(x), y: align(y))
if let permissibleBounds = insideBounds {
if (!CGRectContainsPoint(permissibleBounds, point)) {
return nil
}
}
return point
}
private func align(coordinate: CGFloat) -> CGFloat {
return round(coordinate * contentScaleFactor) / contentScaleFactor
}
}
extension CGRect
{
init(center: CGPoint, size: CGSize) {
self.init(x: center.x-size.width/2, y: center.y-size.height/2, width: size.width, height: size.height)
}
}
| mit | 0620fe70d9e210e346f84fb043fc1ab8 | 41.60804 | 127 | 0.619059 | 4.996464 | false | false | false | false |
JGiola/swift-package-manager | Sources/Workspace/InitPackage.swift | 1 | 13315 | /*
This source file is part of the Swift.org open source project
Copyright (c) 2014 - 2017 Apple Inc. and the Swift project authors
Licensed under Apache License v2.0 with Runtime Library Exception
See http://swift.org/LICENSE.txt for license information
See http://swift.org/CONTRIBUTORS.txt for Swift project authors
*/
import Basic
import PackageModel
/// Create an initial template package.
public final class InitPackage {
/// The tool version to be used for new packages.
public static let newPackageToolsVersion = ToolsVersion(version: "5.0.0")
/// Represents a package type for the purposes of initialization.
public enum PackageType: String, CustomStringConvertible {
case empty = "empty"
case library = "library"
case executable = "executable"
case systemModule = "system-module"
public var description: String {
return rawValue
}
}
/// A block that will be called to report progress during package creation
public var progressReporter: ((String) -> Void)?
/// Where to create the new package
let destinationPath: AbsolutePath
/// The type of package to create.
let packageType: PackageType
/// The name of the package to create.
let pkgname: String
/// The name of the target to create.
var moduleName: String
/// The name of the type to create (within the package).
var typeName: String {
return moduleName
}
/// Create an instance that can create a package with given arguments.
public init(name: String, destinationPath: AbsolutePath, packageType: PackageType) throws {
self.packageType = packageType
self.destinationPath = destinationPath
self.pkgname = name
self.moduleName = name.spm_mangledToC99ExtendedIdentifier()
}
/// Actually creates the new package at the destinationPath
public func writePackageStructure() throws {
progressReporter?("Creating \(packageType) package: \(pkgname)")
// FIXME: We should form everything we want to write, then validate that
// none of it exists, and then act.
try writeManifestFile()
try writeREADMEFile()
try writeGitIgnore()
try writeSources()
try writeModuleMap()
try writeTests()
}
private func writePackageFile(_ path: AbsolutePath, body: (OutputByteStream) -> Void) throws {
progressReporter?("Creating \(path.relative(to: destinationPath).asString)")
try localFileSystem.writeFileContents(path, body: body)
}
private func writeManifestFile() throws {
let manifest = destinationPath.appending(component: Manifest.filename)
guard exists(manifest) == false else {
throw InitError.manifestAlreadyExists
}
try writePackageFile(manifest) { stream in
stream <<< """
// The swift-tools-version declares the minimum version of Swift required to build this package.
import PackageDescription
let package = Package(
"""
var pkgParams = [String]()
pkgParams.append("""
name: "\(pkgname)"
""")
if packageType == .library {
pkgParams.append("""
products: [
// Products define the executables and libraries produced by a package, and make them visible to other packages.
.library(
name: "\(pkgname)",
targets: ["\(pkgname)"]),
]
""")
}
pkgParams.append("""
dependencies: [
// Dependencies declare other packages that this package depends on.
// .package(url: /* package url */, from: "1.0.0"),
]
""")
if packageType == .library || packageType == .executable {
pkgParams.append("""
targets: [
// Targets are the basic building blocks of a package. A target can define a module or a test suite.
// Targets can depend on other targets in this package, and on products in packages which this package depends on.
.target(
name: "\(pkgname)",
dependencies: []),
.testTarget(
name: "\(pkgname)Tests",
dependencies: ["\(pkgname)"]),
]
""")
}
stream <<< pkgParams.joined(separator: ",\n") <<< "\n)\n"
}
// Create a tools version with current version but with patch set to zero.
// We do this to avoid adding unnecessary constraints to patch versions, if
// the package really needs it, they should add it manually.
let version = InitPackage.newPackageToolsVersion.zeroedPatch
// Write the current tools version.
try writeToolsVersion(
at: manifest.parentDirectory, version: version, fs: localFileSystem)
}
private func writeREADMEFile() throws {
let readme = destinationPath.appending(component: "README.md")
guard exists(readme) == false else {
return
}
try writePackageFile(readme) { stream in
stream <<< """
# \(pkgname)
A description of this package.
"""
}
}
private func writeGitIgnore() throws {
let gitignore = destinationPath.appending(component: ".gitignore")
guard exists(gitignore) == false else {
return
}
try writePackageFile(gitignore) { stream in
stream <<< """
.DS_Store
/.build
/Packages
/*.xcodeproj
"""
}
}
private func writeSources() throws {
if packageType == .systemModule {
return
}
let sources = destinationPath.appending(component: "Sources")
guard exists(sources) == false else {
return
}
progressReporter?("Creating \(sources.relative(to: destinationPath).asString)/")
try makeDirectories(sources)
if packageType == .empty {
return
}
let moduleDir = sources.appending(component: "\(pkgname)")
try makeDirectories(moduleDir)
let sourceFileName = (packageType == .executable) ? "main.swift" : "\(typeName).swift"
let sourceFile = moduleDir.appending(RelativePath(sourceFileName))
try writePackageFile(sourceFile) { stream in
switch packageType {
case .library:
stream <<< """
struct \(typeName) {
var text = "Hello, World!"
}
"""
case .executable:
stream <<< """
print("Hello, world!")
"""
case .systemModule, .empty:
fatalError("invalid")
}
}
}
private func writeModuleMap() throws {
if packageType != .systemModule {
return
}
let modulemap = destinationPath.appending(component: "module.modulemap")
guard exists(modulemap) == false else {
return
}
try writePackageFile(modulemap) { stream in
stream <<< """
module \(moduleName) [system] {
header "/usr/include/\(moduleName).h"
link "\(moduleName)"
export *
}
"""
}
}
private func writeTests() throws {
if packageType == .systemModule {
return
}
let tests = destinationPath.appending(component: "Tests")
guard exists(tests) == false else {
return
}
progressReporter?("Creating \(tests.relative(to: destinationPath).asString)/")
try makeDirectories(tests)
switch packageType {
case .systemModule, .empty: break
case .library, .executable:
try writeLinuxMain(testsPath: tests)
try writeTestFileStubs(testsPath: tests)
}
}
private func writeLinuxMain(testsPath: AbsolutePath) throws {
try writePackageFile(testsPath.appending(component: "LinuxMain.swift")) { stream in
stream <<< """
import XCTest
import \(moduleName)Tests
var tests = [XCTestCaseEntry]()
tests += \(moduleName)Tests.allTests()
XCTMain(tests)
"""
}
}
private func writeLibraryTestsFile(_ path: AbsolutePath) throws {
try writePackageFile(path) { stream in
stream <<< """
import XCTest
@testable import \(moduleName)
final class \(moduleName)Tests: XCTestCase {
func testExample() {
// This is an example of a functional test case.
// Use XCTAssert and related functions to verify your tests produce the correct
// results.
XCTAssertEqual(\(typeName)().text, "Hello, World!")
}
static var allTests = [
("testExample", testExample),
]
}
"""
}
}
private func writeExecutableTestsFile(_ path: AbsolutePath) throws {
try writePackageFile(path) { stream in
stream <<< """
import XCTest
import class Foundation.Bundle
final class \(moduleName)Tests: XCTestCase {
func testExample() throws {
// This is an example of a functional test case.
// Use XCTAssert and related functions to verify your tests produce the correct
// results.
// Some of the APIs that we use below are available in macOS 10.13 and above.
guard #available(macOS 10.13, *) else {
return
}
let fooBinary = productsDirectory.appendingPathComponent("\(pkgname)")
let process = Process()
process.executableURL = fooBinary
let pipe = Pipe()
process.standardOutput = pipe
try process.run()
process.waitUntilExit()
let data = pipe.fileHandleForReading.readDataToEndOfFile()
let output = String(data: data, encoding: .utf8)
XCTAssertEqual(output, "Hello, world!\\n")
}
/// Returns path to the built products directory.
var productsDirectory: URL {
#if os(macOS)
for bundle in Bundle.allBundles where bundle.bundlePath.hasSuffix(".xctest") {
return bundle.bundleURL.deletingLastPathComponent()
}
fatalError("couldn't find the products directory")
#else
return Bundle.main.bundleURL
#endif
}
static var allTests = [
("testExample", testExample),
]
}
"""
}
}
private func writeTestFileStubs(testsPath: AbsolutePath) throws {
let testModule = testsPath.appending(RelativePath(pkgname + Target.testModuleNameSuffix))
progressReporter?("Creating \(testModule.relative(to: destinationPath).asString)/")
try makeDirectories(testModule)
let testClassFile = testModule.appending(RelativePath("\(moduleName)Tests.swift"))
switch packageType {
case .systemModule, .empty: break
case .library:
try writeLibraryTestsFile(testClassFile)
case .executable:
try writeExecutableTestsFile(testClassFile)
}
try writePackageFile(testModule.appending(component: "XCTestManifests.swift")) { stream in
stream <<< """
import XCTest
#if !canImport(ObjectiveC)
public func allTests() -> [XCTestCaseEntry] {
return [
testCase(\(moduleName)Tests.allTests),
]
}
#endif
"""
}
}
}
// Private helpers
private enum InitError: Swift.Error {
case manifestAlreadyExists
}
extension InitError: CustomStringConvertible {
var description: String {
switch self {
case .manifestAlreadyExists:
return "a manifest file already exists in this directory"
}
}
}
| apache-2.0 | a35c5e04be47ddcd4657b35da92d6eff | 32.539043 | 138 | 0.531281 | 5.925679 | false | true | false | false |
alessiobrozzi/firefox-ios | UITests/ClearPrivateDataTests.swift | 1 | 12587 | /* This Source Code Form is subject to the terms of the Mozilla Public
* License, v. 2.0. If a copy of the MPL was not distributed with this
* file, You can obtain one at http://mozilla.org/MPL/2.0/. */
import Foundation
import Shared
import WebKit
import UIKit
import EarlGrey
import GCDWebServers
class ClearPrivateDataTests: KIFTestCase, UITextFieldDelegate {
fileprivate var webRoot: String!
override func setUp() {
super.setUp()
webRoot = SimplePageServer.start()
BrowserUtils.dismissFirstRunUI()
}
override func tearDown() {
BrowserUtils.resetToAboutHome(tester())
BrowserUtils.clearPrivateData(tester: tester())
}
func visitSites(noOfSites: Int) -> [(title: String, domain: String, dispDomain: String, url: String)] {
var urls: [(title: String, domain: String, dispDomain: String, url: String)] = []
for pageNo in 1...noOfSites {
let url = "\(webRoot!)/numberedPage.html?page=\(pageNo)"
EarlGrey.select(elementWithMatcher: grey_accessibilityID("url")).perform(grey_tap())
EarlGrey.select(elementWithMatcher: grey_accessibilityID("address"))
.perform(grey_typeText("\(url)\n"))
tester().waitForWebViewElementWithAccessibilityLabel("Page \(pageNo)")
let dom = URL(string: url)!.normalizedHost!
let index = dom.index(dom.startIndex, offsetBy: 7)
let dispDom = dom.substring(to: index) // On IPhone, it only displays first 8 chars
let tuple: (title: String, domain: String, dispDomain: String, url: String)
= ("Page \(pageNo)", dom, dispDom, url)
urls.append(tuple)
}
BrowserUtils.resetToAboutHome(tester())
return urls
}
func anyDomainsExistOnTopSites(_ domains: Set<String>, fulldomains: Set<String>) {
if checkDomains(domains: domains) == true {
return
} else {
if checkDomains(domains: fulldomains) == true {
return
}
}
XCTFail("Couldn't find any domains in top sites.")
}
private func checkDomains(domains: Set<String>) -> Bool {
var errorOrNil: NSError?
for domain in domains {
let withoutDot = domain.replacingOccurrences(of: ".", with: " ")
let matcher = grey_allOfMatchers([grey_accessibilityLabel(withoutDot),
grey_accessibilityID("TopSite"),
grey_sufficientlyVisible()])
EarlGrey.select(elementWithMatcher: matcher!).assert(grey_notNil(), error: &errorOrNil)
if errorOrNil == nil {
return true
}
}
return false
}
func testRemembersToggles() {
BrowserUtils.clearPrivateData([BrowserUtils.Clearable.History], swipe:false, tester: tester())
BrowserUtils.openClearPrivateDataDialog(false, tester: tester())
// Ensure the toggles match our settings.
[
(BrowserUtils.Clearable.Cache, "0"),
(BrowserUtils.Clearable.Cookies, "0"),
(BrowserUtils.Clearable.OfflineData, "0"),
(BrowserUtils.Clearable.History, "1")
].forEach { clearable, switchValue in
XCTAssertNotNil(tester()
.waitForView(withAccessibilityLabel: clearable.rawValue, value: switchValue, traits: UIAccessibilityTraitNone))
}
BrowserUtils.closeClearPrivateDataDialog(tester())
}
func testClearsTopSitesPanel() {
let urls = visitSites(noOfSites: 2)
let dispDomains = Set<String>(urls.map { $0.dispDomain })
let fullDomains = Set<String>(urls.map { $0.domain })
var errorOrNil: NSError?
EarlGrey.select(elementWithMatcher: grey_accessibilityLabel("Top sites")).perform(grey_tap())
// Only one will be found -- we collapse by domain.
anyDomainsExistOnTopSites(dispDomains, fulldomains: fullDomains)
BrowserUtils.clearPrivateData([BrowserUtils.Clearable.History], swipe: false, tester: tester())
EarlGrey.select(elementWithMatcher: grey_accessibilityLabel(urls[0].title))
.assert(grey_notNil(), error: &errorOrNil)
XCTAssertEqual(GREYInteractionErrorCode(rawValue: errorOrNil!.code),
GREYInteractionErrorCode.elementNotFoundErrorCode,
"Expected to have removed top site panel \(urls[0])")
EarlGrey.select(elementWithMatcher: grey_accessibilityLabel(urls[1].title))
.assert(grey_notNil(), error: &errorOrNil)
XCTAssertEqual(GREYInteractionErrorCode(rawValue: errorOrNil!.code),
GREYInteractionErrorCode.elementNotFoundErrorCode,
"We shouldn't find the other URL, either.")
}
func testDisabledHistoryDoesNotClearTopSitesPanel() {
let urls = visitSites(noOfSites: 2)
let dispDomains = Set<String>(urls.map { $0.dispDomain })
let fullDomains = Set<String>(urls.map { $0.domain })
anyDomainsExistOnTopSites(dispDomains, fulldomains: fullDomains)
BrowserUtils.clearPrivateData(BrowserUtils.AllClearables.subtracting([BrowserUtils.Clearable.History]), swipe: false, tester: tester())
anyDomainsExistOnTopSites(dispDomains, fulldomains: fullDomains)
}
func testClearsHistoryPanel() {
let urls = visitSites(noOfSites: 2)
var errorOrNil: NSError?
EarlGrey.select(elementWithMatcher: grey_accessibilityLabel("History")).perform(grey_tap())
let url1 = urls[0].url
let url2 = urls[1].url
EarlGrey.select(elementWithMatcher: grey_accessibilityLabel(url1)).assert(grey_notNil())
EarlGrey.select(elementWithMatcher: grey_accessibilityLabel(url2)).assert(grey_notNil())
BrowserUtils.clearPrivateData([BrowserUtils.Clearable.History], swipe: false, tester: tester())
EarlGrey.select(elementWithMatcher: grey_accessibilityLabel("Bookmarks")).perform(grey_tap())
EarlGrey.select(elementWithMatcher: grey_accessibilityLabel("History")).perform(grey_tap())
EarlGrey.select(elementWithMatcher: grey_accessibilityLabel(url1))
.assert(grey_notNil(), error: &errorOrNil)
XCTAssertEqual(GREYInteractionErrorCode(rawValue: errorOrNil!.code),
GREYInteractionErrorCode.elementNotFoundErrorCode,
"Expected to have removed history row \(url1)")
EarlGrey.select(elementWithMatcher: grey_accessibilityLabel(url2))
.assert(grey_notNil(), error: &errorOrNil)
XCTAssertEqual(GREYInteractionErrorCode(rawValue: errorOrNil!.code),
GREYInteractionErrorCode.elementNotFoundErrorCode,
"Expected to have removed history row \(url2)")
}
func testDisabledHistoryDoesNotClearHistoryPanel() {
let urls = visitSites(noOfSites: 2)
var errorOrNil: NSError?
EarlGrey.select(elementWithMatcher: grey_accessibilityLabel("History")).perform(grey_tap())
let url1 = urls[0].url
let url2 = urls[1].url
EarlGrey.select(elementWithMatcher: grey_accessibilityLabel(url1)).assert(grey_notNil())
EarlGrey.select(elementWithMatcher: grey_accessibilityLabel(url2)).assert(grey_notNil())
BrowserUtils.clearPrivateData(BrowserUtils.AllClearables.subtracting([BrowserUtils.Clearable.History]), swipe: false, tester: tester())
EarlGrey.select(elementWithMatcher: grey_accessibilityLabel(url1))
.assert(grey_notNil(), error: &errorOrNil)
EarlGrey.select(elementWithMatcher: grey_accessibilityLabel(url2))
.assert(grey_notNil(), error: &errorOrNil)
}
func testClearsCookies() {
let url = "\(webRoot!)/numberedPage.html?page=1"
EarlGrey.select(elementWithMatcher: grey_accessibilityID("url")).perform(grey_tap())
EarlGrey.select(elementWithMatcher: grey_accessibilityID("address"))
.perform(grey_typeText("\(url)\n"))
tester().waitForWebViewElementWithAccessibilityLabel("Page 1")
let webView = tester().waitForView(withAccessibilityLabel: "Web content") as! WKWebView
// Set and verify a dummy cookie value.
setCookies(webView, cookie: "foo=bar")
var cookies = getCookies(webView)
XCTAssertEqual(cookies.cookie, "foo=bar")
XCTAssertEqual(cookies.localStorage, "foo=bar")
XCTAssertEqual(cookies.sessionStorage, "foo=bar")
// Verify that cookies are not cleared when Cookies is deselected.
BrowserUtils.clearPrivateData(BrowserUtils.AllClearables.subtracting([BrowserUtils.Clearable.Cookies]), swipe: true, tester: tester())
cookies = getCookies(webView)
XCTAssertEqual(cookies.cookie, "foo=bar")
XCTAssertEqual(cookies.localStorage, "foo=bar")
XCTAssertEqual(cookies.sessionStorage, "foo=bar")
// Verify that cookies are cleared when Cookies is selected.
BrowserUtils.clearPrivateData([BrowserUtils.Clearable.Cookies], swipe: true, tester: tester())
cookies = getCookies(webView)
XCTAssertEqual(cookies.cookie, "")
XCTAssertEqual(cookies.localStorage, "null")
XCTAssertEqual(cookies.sessionStorage, "null")
}
func testClearsCache() {
let cachedServer = CachedPageServer()
let cacheRoot = cachedServer.start()
let url = "\(cacheRoot)/cachedPage.html"
EarlGrey.select(elementWithMatcher: grey_accessibilityID("url")).perform(grey_tap())
EarlGrey.select(elementWithMatcher: grey_accessibilityID("address"))
.perform(grey_typeText("\(url)\n"))
tester().waitForWebViewElementWithAccessibilityLabel("Cache test")
let webView = tester().waitForView(withAccessibilityLabel: "Web content") as! WKWebView
let requests = cachedServer.requests
// Verify that clearing non-cache items will keep the page in the cache.
BrowserUtils.clearPrivateData(BrowserUtils.AllClearables.subtracting([BrowserUtils.Clearable.Cache]), swipe: true, tester: tester())
webView.reload()
XCTAssertEqual(cachedServer.requests, requests)
// Verify that clearing the cache will fire a new request.
BrowserUtils.clearPrivateData([BrowserUtils.Clearable.Cache], swipe: true, tester: tester())
webView.reload()
XCTAssertEqual(cachedServer.requests, requests + 1)
}
fileprivate func setCookies(_ webView: WKWebView, cookie: String) {
let expectation = self.expectation(description: "Set cookie")
webView.evaluateJavaScript("document.cookie = \"\(cookie)\"; localStorage.cookie = \"\(cookie)\"; sessionStorage.cookie = \"\(cookie)\";") { result, _ in
expectation.fulfill()
}
waitForExpectations(timeout: 10, handler: nil)
}
fileprivate func getCookies(_ webView: WKWebView) -> (cookie: String, localStorage: String?, sessionStorage: String?) {
var cookie: (String, String?, String?)!
var value: String!
let expectation = self.expectation(description: "Got cookie")
webView.evaluateJavaScript("JSON.stringify([document.cookie, localStorage.cookie, sessionStorage.cookie])") { result, _ in
value = result as! String
expectation.fulfill()
}
waitForExpectations(timeout: 10, handler: nil)
value = value.replacingOccurrences(of: "[", with: "")
value = value.replacingOccurrences(of: "]", with: "")
value = value.replacingOccurrences(of: "\"", with: "")
let items = value.components(separatedBy: ",")
cookie = (items[0], items[1], items[2])
return cookie
}
}
/// Server that keeps track of requests.
private class CachedPageServer {
var requests = 0
func start() -> String {
let webServer = GCDWebServer()
webServer?.addHandler(forMethod: "GET", path: "/cachedPage.html", request: GCDWebServerRequest.self) { (request) -> GCDWebServerResponse! in
self.requests += 1
return GCDWebServerDataResponse(html: "<html><head><title>Cached page</title></head><body>Cache test</body></html>")
}
webServer?.start(withPort: 0, bonjourName: nil)
// We use 127.0.0.1 explicitly here, rather than localhost, in order to avoid our
// history exclusion code (Bug 1188626).
let port = (webServer?.port)!
let webRoot = "http://127.0.0.1:\(port)"
return webRoot
}
}
| mpl-2.0 | add58a6c44a8d165fbace7a8086d43db | 45.106227 | 161 | 0.658537 | 5.10836 | false | true | false | false |
GocePetrovski/ListCollectionViewKit | Demo/ListCollectionViewKitDemo/ListCollectionViewController.swift | 1 | 5545 | //
// ListCollectionViewController.swift
// ListCollectionViewDemo
//
// Created by Goce Petrovski on 11/02/2015.
// Copyright (c) 2015 Pomarium. All rights reserved.
//
import UIKit
import ListCollectionViewKit
class ListCollectionViewController: UICollectionViewController, ListCollectionViewDataSource {
var items = ["Item 1", "Item 2", "Item 3", "Item 4", "Item 5", "Item 6", "Item 7", "Item 8", "Item 9", "Item 10", "Item 11", "Item 12", "Item 13", "Item 14", "Item 15", "Item 16", "Item 17", "Item 18", "Item 19", "Item 20"]
override func viewDidLoad() {
super.viewDidLoad()
self.navigationItem.rightBarButtonItem = self.editButtonItem
self.collectionView?.register(UINib(nibName: "HeaderView", bundle: nil), forSupplementaryViewOfKind: ListCollectionViewElementKindGlobalHeader, withReuseIdentifier: globalHeaderId)
if let listLayout = collectionView?.collectionViewLayout as? ListCollectionViewFlowLayout {
listLayout.globalHeaderReferenceSize = CGSize(width: 320.0, height: 120.0)
}
}
override func didReceiveMemoryWarning() {
super.didReceiveMemoryWarning()
// Dispose of any resources that can be recreated.
}
override func viewWillAppear(_ animated: Bool) {
super.viewWillAppear(animated)
let contentInset = collectionView!.contentInset
let width:CGFloat = (collectionView!.bounds).width - contentInset.left - contentInset.right
if let layout = collectionViewLayout as? UICollectionViewFlowLayout {
layout.itemSize = CGSize(width: width, height: 46.0)
}
}
override func setEditing(_ editing: Bool, animated: Bool) {
super.setEditing(editing, animated: animated)
if let listLayout = collectionViewLayout as? ListCollectionViewFlowLayout {
listLayout.editing = editing
listLayout.invalidateLayout()
//collectionView?.reloadData()
}
}
/*
// MARK: - Navigation
// In a storyboard-based application, you will often want to do a little preparation before navigation
override func prepareForSegue(segue: UIStoryboardSegue, sender: AnyObject?) {
// Get the new view controller using [segue destinationViewController].
// Pass the selected object to the new view controller.
}
*/
// MARK: UICollectionViewDataSource
override func numberOfSections(in collectionView: UICollectionView) -> Int {
return 1
}
override func collectionView(_ collectionView: UICollectionView, numberOfItemsInSection section: Int) -> Int {
return items.count
}
override func collectionView(_ collectionView: UICollectionView, cellForItemAt indexPath: IndexPath) -> UICollectionViewCell {
let cell = collectionView.dequeueReusableCell(withReuseIdentifier: reuseIdentifier, for: indexPath) as! ListCollectionViewCell
let item = items[(indexPath as NSIndexPath).row]
let label = cell.viewWithTag(5) as! UILabel
label.text = item
cell.accessoryType = ListCollectionViewCellAccessoryType.disclosureIndicator
return cell
}
override func collectionView(_ collectionView: UICollectionView, viewForSupplementaryElementOfKind kind: String, at indexPath: IndexPath) -> UICollectionReusableView {
if kind == ListCollectionViewElementKindGlobalHeader {
return collectionView.dequeueReusableSupplementaryView(ofKind: kind, withReuseIdentifier: globalHeaderId, for: indexPath)
}
return UICollectionReusableView();
}
// MARK: ListCollectionViewDataSource
func collectionView(_ collectionView: UICollectionView, commitEditingStyle:ListCollectionViewCellEditingStyle, forRowAtIndexPath indexPath:IndexPath) {
items.remove(at: (indexPath as NSIndexPath).row)
collectionView.deleteItems(at: [indexPath])
}
// MARK: UICollectionViewDelegate
func collectionView(_ collectionView: UICollectionView, accessoryButtonTappedForRowWithIndexPath indexPath: IndexPath) {
let cell = collectionView.cellForItem(at: indexPath)
print("did select \(String(describing: cell?.contentView.subviews))")
}
/*
// Uncomment this method to specify if the specified item should be highlighted during tracking
override func collectionView(collectionView: UICollectionView, shouldHighlightItemAtIndexPath indexPath: NSIndexPath) -> Bool {
return true
}
*/
/*
// Uncomment this method to specify if the specified item should be selected
override func collectionView(collectionView: UICollectionView, shouldSelectItemAtIndexPath indexPath: NSIndexPath) -> Bool {
return true
}
*/
/*
// Uncomment these methods to specify if an action menu should be displayed for the specified item, and react to actions performed on the item
override func collectionView(collectionView: UICollectionView, shouldShowMenuForItemAtIndexPath indexPath: NSIndexPath) -> Bool {
return false
}
override func collectionView(collectionView: UICollectionView, canPerformAction action: Selector, forItemAtIndexPath indexPath: NSIndexPath, withSender sender: AnyObject?) -> Bool {
return false
}
override func collectionView(collectionView: UICollectionView, performAction action: Selector, forItemAtIndexPath indexPath: NSIndexPath, withSender sender: AnyObject?) {
}
*/
}
| mit | 1aa4035206630f6a7d6849ae7bb97c63 | 40.380597 | 227 | 0.709468 | 5.812369 | false | false | false | false |
ebaker355/IBOutletScanner | src/Options.swift | 1 | 2516 | /*
MIT License
Copyright (c) 2017 DuneParkSoftware, LLC
Permission is hereby granted, free of charge, to any person obtaining a copy
of this software and associated documentation files (the "Software"), to deal
in the Software without restriction, including without limitation the rights
to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
copies of the Software, and to permit persons to whom the Software is
furnished to do so, subject to the following conditions:
The above copyright notice and this permission notice shall be included in all
copies or substantial portions of the Software.
THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
SOFTWARE.
*/
import Foundation
public struct Options {
public let rootPath: String
public let customViewClassNames: [String]
private init(rootPath: String, customViewClassNames: [String]) {
self.rootPath = rootPath
self.customViewClassNames = customViewClassNames
}
private static var defaultRootPath: String? {
let environment = ProcessInfo.processInfo.environment
if let srcRoot = environment["SRCROOT"] {
return srcRoot
}
return nil
}
public static func createFromCommandLineArguments() -> Options {
var rootPath = Options.defaultRootPath ?? ""
var customViewClassNames: [String] = []
var isCustomViewClassNamesArg = false
for (index, arg) in CommandLine.arguments.enumerated() {
guard index > 0 else {
continue
}
guard !isCustomViewClassNamesArg else {
customViewClassNames.append(contentsOf: arg.components(separatedBy: ","))
isCustomViewClassNamesArg = false
continue
}
guard arg != "-customViewClassNames" && arg != "-customViewClassName" else {
isCustomViewClassNamesArg = true
continue
}
rootPath = arg
}
return Options(rootPath: rootPath, customViewClassNames: customViewClassNames)
}
}
| mit | 98e74dac919187c66919794630960005 | 34.942857 | 89 | 0.687599 | 5.399142 | false | false | false | false |
wireapp/wire-ios | Wire-iOS/Sources/UserInterface/Calling/CallInfoViewController/CallInfoViewController.swift | 1 | 8162 | //
// Wire
// Copyright (C) 2018 Wire Swiss GmbH
//
// This program is free software: you can redistribute it and/or modify
// it under the terms of the GNU General Public License as published by
// the Free Software Foundation, either version 3 of the License, or
// (at your option) any later version.
//
// This program is distributed in the hope that it will be useful,
// but WITHOUT ANY WARRANTY; without even the implied warranty of
// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
// GNU General Public License for more details.
//
// You should have received a copy of the GNU General Public License
// along with this program. If not, see http://www.gnu.org/licenses/.
//
import Foundation
import UIKit
import WireSyncEngine
import WireCommonComponents
protocol CallInfoViewControllerDelegate: AnyObject {
func infoViewController(_ viewController: CallInfoViewController, perform action: CallAction)
}
protocol CallInfoViewControllerInput: CallActionsViewInputType, CallStatusViewInputType {
var accessoryType: CallInfoViewControllerAccessoryType { get }
var degradationState: CallDegradationState { get }
var videoPlaceholderState: CallVideoPlaceholderState { get }
var disableIdleTimer: Bool { get }
}
// Workaround to make the protocol equatable, it might be possible to conform CallInfoConfiguration
// to Equatable with Swift 4.1 and conditional conformances. Right now we would have to make
// the `CallInfoRootViewController` generic to work around the `Self` requirement of
// `Equatable` which we want to avoid.
extension CallInfoViewControllerInput {
func isEqual(toConfiguration other: CallInfoViewControllerInput) -> Bool {
return accessoryType == other.accessoryType &&
degradationState == other.degradationState &&
videoPlaceholderState == other.videoPlaceholderState &&
permissions == other.permissions &&
disableIdleTimer == other.disableIdleTimer &&
canToggleMediaType == other.canToggleMediaType &&
isMuted == other.isMuted &&
mediaState == other.mediaState &&
appearance == other.appearance &&
isVideoCall == other.isVideoCall &&
state == other.state &&
isConstantBitRate == other.isConstantBitRate &&
title == other.title &&
cameraType == other.cameraType &&
networkQuality == other.networkQuality &&
userEnabledCBR == other.userEnabledCBR &&
callState.isEqual(toCallState: other.callState) &&
videoGridPresentationMode == other.videoGridPresentationMode &&
allowPresentationModeUpdates == other.allowPresentationModeUpdates &&
isForcedCBR == other.isForcedCBR &&
classification == other.classification
}
}
final class CallInfoViewController: UIViewController, CallActionsViewDelegate, CallAccessoryViewControllerDelegate {
weak var delegate: CallInfoViewControllerDelegate?
private let backgroundViewController: BackgroundViewController
private let stackView = UIStackView(axis: .vertical)
private let statusViewController: CallStatusViewController
private let accessoryViewController: CallAccessoryViewController
private let actionsView = CallActionsView()
var configuration: CallInfoViewControllerInput {
didSet {
updateState()
}
}
init(configuration: CallInfoViewControllerInput,
selfUser: UserType,
userSession: ZMUserSession? = ZMUserSession.shared()) {
self.configuration = configuration
statusViewController = CallStatusViewController(configuration: configuration)
accessoryViewController = CallAccessoryViewController(configuration: configuration, selfUser: selfUser)
backgroundViewController = BackgroundViewController(user: selfUser, userSession: userSession)
super.init(nibName: nil, bundle: nil)
accessoryViewController.delegate = self
actionsView.delegate = self
}
@available(*, unavailable)
required init?(coder aDecoder: NSCoder) {
fatalError("init(coder:) has not been implemented")
}
override func viewDidLoad() {
super.viewDidLoad()
setupViews()
createConstraints()
updateNavigationItem()
}
override func viewWillAppear(_ animated: Bool) {
super.viewWillAppear(animated)
updateState()
}
override func traitCollectionDidChange(_ previousTraitCollection: UITraitCollection?) {
super.traitCollectionDidChange(previousTraitCollection)
guard traitCollection.didSizeClassChange(from: previousTraitCollection) else { return }
updateAccessoryView()
}
private func setupViews() {
addToSelf(backgroundViewController)
stackView.translatesAutoresizingMaskIntoConstraints = false
view.addSubview(stackView)
stackView.alignment = .center
stackView.distribution = .fill
stackView.spacing = 16
addChild(statusViewController)
[statusViewController.view, accessoryViewController.view, actionsView].forEach(stackView.addArrangedSubview)
statusViewController.didMove(toParent: self)
}
private func createConstraints() {
NSLayoutConstraint.activate([
stackView.leadingAnchor.constraint(equalTo: view.leadingAnchor),
stackView.topAnchor.constraint(equalTo: safeTopAnchor),
stackView.trailingAnchor.constraint(equalTo: view.trailingAnchor),
stackView.bottomAnchor.constraint(equalTo: view.safeAreaLayoutGuideOrFallback.bottomAnchor, constant: -25),
statusViewController.view.widthAnchor.constraint(equalTo: view.widthAnchor),
actionsView.leadingAnchor.constraint(equalTo: view.leadingAnchor),
actionsView.trailingAnchor.constraint(equalTo: view.trailingAnchor),
accessoryViewController.view.widthAnchor.constraint(equalTo: view.widthAnchor)
])
backgroundViewController.view.fitIn(view: view)
}
private func updateNavigationItem() {
let minimizeItem = UIBarButtonItem(
icon: .downArrow,
target: self,
action: #selector(minimizeCallOverlay)
)
minimizeItem.accessibilityLabel = "call.actions.label.minimize_call".localized
minimizeItem.accessibilityIdentifier = "CallDismissOverlayButton"
navigationItem.leftBarButtonItem = minimizeItem
}
private func updateAccessoryView() {
let isHidden = traitCollection.verticalSizeClass == .compact && !configuration.callState.isConnected
accessoryViewController.view.isHidden = isHidden
}
private func updateState() {
Log.calling.debug("updating info controller with state: \(configuration)")
actionsView.update(with: configuration)
statusViewController.configuration = configuration
accessoryViewController.configuration = configuration
backgroundViewController.view.isHidden = configuration.videoPlaceholderState == .hidden
updateAccessoryView()
if configuration.networkQuality.isNormal {
navigationItem.titleView = nil
} else {
let label = UILabel()
label.translatesAutoresizingMaskIntoConstraints = false
label.attributedText = configuration.networkQuality.attributedString(color: UIColor.nameColor(for: .brightOrange, variant: .light))
label.font = FontSpec(.small, .semibold).font
navigationItem.titleView = label
}
}
// MARK: - Actions + Delegates
@objc
private func minimizeCallOverlay(_ sender: UIBarButtonItem) {
delegate?.infoViewController(self, perform: .minimizeOverlay)
}
func callActionsView(_ callActionsView: CallActionsView, perform action: CallAction) {
delegate?.infoViewController(self, perform: action)
}
func callAccessoryViewControllerDidSelectShowMore(viewController: CallAccessoryViewController) {
delegate?.infoViewController(self, perform: .showParticipantsList)
}
}
| gpl-3.0 | ba10620d1699105dcb445a63623b62ff | 40.015075 | 143 | 0.714163 | 5.788652 | false | true | false | false |
jiayuquan/ShopCycle | ShopCycle/ShopCycle/Purchase/View/PurchaseCell.swift | 1 | 2176 | //
// PurchaseCell.swift
// shop
//
// Created by mac on 16/5/6.
// Copyright © 2016年 JiaYQ. All rights reserved.
//
import UIKit
protocol PurchaseCellDelegate: NSObjectProtocol {
func shoppingCartCell(cell: PurchaseCell, button: UIButton, countLabel: UILabel)
func reCalculateTotalPrice()
}
class PurchaseCell: UITableViewCell {
@IBOutlet weak var selectButton: UIButton!
@IBOutlet weak var iconView: UIImageView!
@IBOutlet weak var titleLabel: UILabel!
@IBOutlet weak var newPriceLabel: UILabel!
@IBOutlet weak var oldPriceLabel: UILabel!
@IBOutlet weak var goodCountLabel: UILabel!
@IBOutlet weak var addAndsubtraction: UIButton!
@IBOutlet weak var subtractionButton: UIButton!
weak var delegate: PurchaseCellDelegate?
override func awakeFromNib() {
super.awakeFromNib()
iconView.layer.cornerRadius = 30
iconView.layer.masksToBounds = true
self.selectionStyle = UITableViewCellSelectionStyle.None
}
@IBAction func selectButtonClick(button: UIButton) {
// 选中
button.selected = !button.selected
goodModel?.isShopSelected = button.selected
delegate?.reCalculateTotalPrice()
}
@IBAction func addAndsubtractionClick(button: UIButton) {
delegate?.shoppingCartCell(self, button: button, countLabel: goodCountLabel)
}
@IBAction func subtractionButtonClick(button: UIButton) {
delegate?.shoppingCartCell(self, button: button, countLabel: goodCountLabel)
}
override func setSelected(selected: Bool, animated: Bool) {
super.setSelected(selected, animated: animated)
}
var goodModel: DrawerCellModel? {
didSet {
selectButton.selected = goodModel!.isShopSelected
goodCountLabel.text = "\(goodModel!.count)"
iconView.image = UIImage(named: goodModel!.imageName!)
titleLabel.text = goodModel?.title
newPriceLabel.text = "\(goodModel!.newPrice!)"
oldPriceLabel.text = "\(goodModel!.oldPrice!)"
layoutIfNeeded()
}
}
}
| apache-2.0 | a5ca7165161901a8261a9bc73f8aa042 | 29.125 | 84 | 0.662056 | 4.952055 | false | false | false | false |
neeemo/MobileComputingLab | ButterIt/ButterKnife.swift | 1 | 1244 | //
// Butter.swift
// Toast
//
// Created by James Wellence on 04/12/14.
// Copyright (c) 2014 James Wellence. All rights reserved.
//
import UIKit
class ButterKnife {
var butterAmount_: Double = 0
let maxButterAmount: Double = 1000
let minButterAmount: Double = 0
func setButter(butterAmount: Double){
butterAmount_ = butterAmount
}
//when scooping butter, adds the amount to the knife - returns maxButterAmount when knife can't hold more butter
func addButter(addButterAmount: Double) -> Double {
butterAmount_ = butterAmount_ + addButterAmount
if butterAmount_ > maxButterAmount {
butterAmount_ = maxButterAmount
}
return butterAmount_
}
//when spreading butter, removes the amount from the knife / returns minButterAmount (ie 0) when butter used up
func removeButter(removeButterAmount: Double) -> Double {
butterAmount_ = butterAmount_ - removeButterAmount
if butterAmount_ < minButterAmount {
butterAmount_ = minButterAmount
}
return butterAmount_
}
func getButterAmount() -> Double{
return butterAmount_
}
}
| apache-2.0 | 96712495d6e0b0fd7aafeaf88e19cb20 | 24.916667 | 120 | 0.629421 | 4.936508 | false | false | false | false |
Awalz/ark-ios-monitor | ArkMonitor/Account Selection/AccountTransitionDelegate.swift | 1 | 3951 | // Copyright (c) 2016 Ark
//
// Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the
// "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge,
// publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so,
// subject to the following conditions:
//
// The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software.
//
// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE
// FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION
// WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
//
import UIKit
class AccountTransitionDelegate: NSObject, UIViewControllerTransitioningDelegate {
var transitionContext: UIViewControllerContextTransitioning?
func animationController(forPresented presented: UIViewController, presenting: UIViewController, source: UIViewController) -> UIViewControllerAnimatedTransitioning? {
return AccountTransitionAnimator()
}
func animationController(forDismissed dismissed: UIViewController) -> UIViewControllerAnimatedTransitioning? {
return AccountDismissTransitionAnimator()
}
}
class AccountTransitionAnimator: NSObject, UIViewControllerAnimatedTransitioning, CAAnimationDelegate {
var transitionContext: UIViewControllerContextTransitioning?
func transitionDuration(using transitionContext: UIViewControllerContextTransitioning?) -> TimeInterval {
return 0.7
}
func animateTransition(using transitionContext: UIViewControllerContextTransitioning) {
let destinationController = transitionContext.viewController(forKey: UITransitionContextViewControllerKey.to)!
let containerView = transitionContext.containerView as UIView
destinationController.view.alpha = 0.0
containerView.addSubview(destinationController.view)
UIView.animate(withDuration: transitionDuration(using: transitionContext), delay: 0, options: .curveEaseInOut, animations: {
destinationController.view.alpha = 1.0
}) { (finished) in
transitionContext.completeTransition(!transitionContext.transitionWasCancelled)
}
}
func animationDidStop(_ anim: CAAnimation, finished flag: Bool) {
if let transitionContext = self.transitionContext {
transitionContext.completeTransition(!transitionContext.transitionWasCancelled)
}
}
}
class AccountDismissTransitionAnimator: NSObject, UIViewControllerAnimatedTransitioning {
func transitionDuration(using transitionContext: UIViewControllerContextTransitioning?) -> TimeInterval {
return 0.7
}
func animateTransition(using transitionContext: UIViewControllerContextTransitioning) {
let destinationController = transitionContext.viewController(forKey: UITransitionContextViewControllerKey.to)!
let containerView = transitionContext.containerView as UIView
destinationController.view.alpha = 0.0
containerView.addSubview(destinationController.view)
UIView.animate(withDuration: transitionDuration(using: transitionContext), delay: 0, options: .curveEaseInOut, animations: {
destinationController.view.alpha = 1.0
}) { (finished) in
transitionContext.completeTransition(!transitionContext.transitionWasCancelled)
}
}
}
| mit | a4581f96bd04d7f48e1af1931d0ffdd9 | 44.94186 | 170 | 0.748165 | 6.372581 | false | false | false | false |
grandiere/box | box/Model/Help/Energy/MHelpEnergy.swift | 1 | 494 | import Foundation
class MHelpEnergy:MHelp
{
init()
{
let itemIntro:MHelpEnergyIntro = MHelpEnergyIntro()
let itemTime:MHelpEnergyTime = MHelpEnergyTime()
let itemAids:MHelpEnergyAids = MHelpEnergyAids()
let itemPurchase:MHelpEnergyPurchase = MHelpEnergyPurchase()
let items:[MHelpProtocol] = [
itemIntro,
itemTime,
itemAids,
itemPurchase]
super.init(items:items)
}
}
| mit | 79c1c56258e84c1e80289af598099b58 | 23.7 | 68 | 0.601215 | 4.53211 | false | false | false | false |
krzyzanowskim/Natalie | Sources/natalie/Helpers.swift | 1 | 1655 | //
// Helpers.swift
// Natalie
//
// Created by Marcin Krzyzanowski on 07/08/16.
// Copyright © 2016 Marcin Krzyzanowski. All rights reserved.
//
import Foundation
func findStoryboards(rootPath: String, suffix: String) -> [String]? {
var result = [String]()
let fm = FileManager.default
if let paths = fm.subpaths(atPath: rootPath) {
let storyboardPaths = paths.filter({ return $0.hasSuffix(suffix)})
// result = storyboardPaths
for p in storyboardPaths {
result.append((rootPath as NSString).appendingPathComponent(p))
}
}
return result.isEmpty ? nil : result
}
enum FirstLetterFormat {
case none
case capitalize
case lowercase
func format(_ str: String) -> String {
switch self {
case .none:
return str
case .capitalize:
return String(str.uppercased().unicodeScalars.prefix(1) + str.unicodeScalars.suffix(str.unicodeScalars.count - 1))
case .lowercase:
return String(str.lowercased().unicodeScalars.prefix(1) + str.unicodeScalars.suffix(str.unicodeScalars.count - 1))
}
}
}
func swiftRepresentation(for string: String, firstLetter: FirstLetterFormat = .none, doNotShadow: String? = nil) -> String {
var str = string.trimAllWhitespacesAndSpecialCharacters()
str = firstLetter.format(str)
if str == doNotShadow {
str += "_"
}
return str
}
func initIdentifier(for identifierString: String, value: String) -> String {
if identifierString == "String" {
return "\"\(value)\""
} else {
return "\(identifierString)(\"\(value)\")"
}
}
| mit | 62b77e764727bd473de082896cea2806 | 28.535714 | 126 | 0.639057 | 4.318538 | false | false | false | false |
renzifeng/ZFZhiHuDaily | ZFZhiHuDaily/Other/Lib/CyclePictureView/CyclePictureCell.swift | 1 | 3259 | //
// CyclePictureCell.swift
// CyclePictureView
//
// Created by wl on 15/11/7.
// Copyright © 2015年 wl. All rights reserved.
//
import UIKit
import Kingfisher
class CyclePictureCell: UICollectionViewCell {
var imageSource: ImageSource = ImageSource.Local(name: ""){
didSet {
switch imageSource {
case let .Local(name):
self.imageView.image = UIImage(named: name)
case let .Network(urlStr):
self.imageView.kf_setImageWithURL(NSURL(string: urlStr)!, placeholderImage: placeholderImage)
}
}
}
var placeholderImage: UIImage?
var imageDetail: String? {
didSet {
detailLable.hidden = false
detailLable.text = imageDetail
}
}
var detailLableTextFont: UIFont = UIFont(name: "Helvetica-Bold", size: 18)! {
didSet {
detailLable.font = detailLableTextFont
}
}
var detailLableTextColor: UIColor = UIColor.whiteColor() {
didSet {
detailLable.textColor = detailLableTextColor
}
}
var detailLableBackgroundColor: UIColor = UIColor.clearColor() {
didSet {
detailLable.backgroundColor = detailLableBackgroundColor
}
}
var detailLableHeight: CGFloat = 60 {
didSet {
detailLable.frame.size.height = detailLableHeight
}
}
var detailLableAlpha: CGFloat = 1 {
didSet {
detailLable.alpha = detailLableAlpha
}
}
var pictureContentMode: UIViewContentMode = .ScaleAspectFill {
didSet {
imageView.contentMode = pictureContentMode
}
}
private var imageView: UIImageView!
private var detailLable: UILabel!
override init(frame: CGRect) {
super.init(frame: frame)
self.setupImageView()
self.setupDetailLable()
// self.backgroundColor = UIColor.grayColor()
}
private func setupImageView() {
imageView = UIImageView()
imageView.contentMode = pictureContentMode
imageView.clipsToBounds = true
self.addSubview(imageView)
}
private func setupDetailLable() {
detailLable = UILabel()
detailLable.textColor = detailLableTextColor
detailLable.shadowColor = UIColor.grayColor()
detailLable.numberOfLines = 0
detailLable.backgroundColor = detailLableBackgroundColor
detailLable.hidden = true //默认是没有描述的，所以隐藏它
self.addSubview(detailLable!)
}
required init?(coder aDecoder: NSCoder) {
fatalError("init(coder:) has not been implemented")
}
override func layoutSubviews() {
super.layoutSubviews()
imageView.frame = self.bounds
if let _ = self.imageDetail {
let lableX: CGFloat = 20
let lableH: CGFloat = detailLableHeight
let lableW: CGFloat = self.frame.width - lableX
let lableY: CGFloat = self.frame.height - lableH
detailLable.frame = CGRectMake(lableX, lableY, lableW, lableH)
detailLable.font = detailLableTextFont
}
}
}
| apache-2.0 | 4959acfd8cae37fc968c0ede1791c25e | 26.355932 | 109 | 0.60316 | 5.214863 | false | false | false | false |
mmrmmlrr/ModelsTreeKit | JetPack/Subscription.swift | 1 | 1943 | //
// Disposable.swift
// SessionSwift
//
// Created by aleksey on 25.10.15.
// Copyright © 2015 aleksey chernish. All rights reserved.
//
import Foundation
protocol Invocable: class {
func invoke(_ data: Any) -> Void
func invokeState(_ data: Bool) -> Void
}
class Subscription<U> : Invocable, Disposable {
var handler: ((U) -> Void)?
var stateHandler: ((Bool) -> Void)?
private var signal: Signal<U>
private var deliversOnMainThread = false
private var autodisposes = false
init(handler: ((U) -> Void)?, signal: Signal<U>) {
self.handler = handler
self.signal = signal;
}
func invoke(_ data: Any) -> Void {
if deliversOnMainThread {
DispatchQueue.main.async { [weak self] in
self?.handler?(data as! U)
}
} else {
handler?(data as! U)
}
if autodisposes { dispose() }
}
func invokeState(_ data: Bool) -> Void {
if deliversOnMainThread {
DispatchQueue.main.async { [weak self] in
self?.stateHandler?(data)
}
} else {
stateHandler?(data)
}
}
func dispose() {
signal.nextHandlers = signal.nextHandlers.filter { $0 !== self }
signal.completedHandlers = signal.completedHandlers.filter { $0 !== self }
handler = nil
}
@discardableResult
func deliverOnMainThread() -> Disposable {
deliversOnMainThread = true
return self
}
@discardableResult
func autodispose() -> Disposable {
autodisposes = true
return self
}
@discardableResult
func putInto(_ pool: AutodisposePool) -> Disposable {
pool.add(self)
return self
}
@discardableResult
func takeUntil(_ signal: Pipe<Void>) -> Disposable {
signal.subscribeNext { [weak self] in
self?.dispose()
}.putInto(self.signal.pool)
return self
}
func ownedBy(_ object: DeinitObservable) -> Disposable {
return takeUntil(object.deinitSignal)
}
}
| mit | 9dd1ed47863af939fafeb333dd1fd33a | 19.88172 | 78 | 0.625129 | 4.045833 | false | false | false | false |
tripleCC/GanHuoCode | GanHuo/Views/Base/TPCPageScrollView.swift | 1 | 10565 | //
// TPCPageScrollView.swift
// TPCPageScrollView
//
// Created by tripleCC on 15/11/23.
// Copyright © 2015年 tripleCC. All rights reserved.
//
import UIKit
class TPCPageScrollView: UIView {
let padding: CGFloat = 40
var viewDisappearAction: (() -> ())?
var imageMode: UIViewContentMode = UIViewContentMode.ScaleAspectFit {
didSet {
currentImageView.imageMode = imageMode
backupImageView.imageMode = imageMode
}
}
var imageURLStrings: [String]! {
didSet {
guard imageURLStrings.count > 0 else { return }
if imageURLStrings.count > 1 {
backupImageView.imageURLString = imageURLStrings[1]
backupImageView.tag = 1
} else {
scrollView.scrollEnabled = false
// 覆盖全屏手势
let pan = UIPanGestureRecognizer(target: self, action: nil)
currentImageView.addGestureRecognizer(pan)
}
currentImageView.imageURLString = imageURLStrings[0]
currentImageView.tag = 0
countLabel.text = "1 / \(imageURLStrings.count)"
}
}
private var scrollView: UIScrollView!
private var countLabel: UILabel!
var currentImageView: TPCImageView!
var backupImageView: TPCImageView!
var edgeMaskView: UIView!
override init(frame: CGRect) {
super.init(frame: frame)
setupSubviews()
}
func setupSubviews() {
scrollView = UIScrollView()
scrollView.pagingEnabled = true
scrollView.bounces = false
scrollView.delegate = self
scrollView.frame = bounds
scrollView.contentSize = CGSize(width: bounds.width * 3, height: 0)
scrollView.contentOffset = CGPoint(x: bounds.width, y: 0)
scrollView.showsHorizontalScrollIndicator = false
addSubview(scrollView)
currentImageView = TPCImageView(frame: CGRect(x: bounds.width, y: 0, width: bounds.width, height: bounds.height))
currentImageView.oneTapAction = { [unowned self] in
self.removeSelf()
}
currentImageView.longPressAction = { [unowned self] in
self.setupBottomToolView()
}
scrollView.addSubview(currentImageView)
backupImageView = TPCImageView(frame: CGRect(x: bounds.width * 2, y: 0, width: bounds.width, height: bounds.height))
backupImageView.oneTapAction = { [unowned self] in
self.removeSelf()
}
backupImageView.longPressAction = { [unowned self] in
self.setupBottomToolView()
}
scrollView.addSubview(backupImageView)
edgeMaskView = UIView(frame: CGRect(x: -padding, y: 0, width: padding, height: bounds.height))
edgeMaskView.backgroundColor = UIColor.blackColor()
addSubview(edgeMaskView)
setupGradientLayers()
countLabel = UILabel(frame: CGRect(x: 0, y: 0, width: 100, height: 40))
countLabel.center = CGPoint(x: TPCScreenWidth * 0.5, y: 40)
countLabel.textAlignment = NSTextAlignment.Center
countLabel.font = TPCConfiguration.themeBFont
countLabel.textColor = UIColor.whiteColor()
addSubview(countLabel)
// setupBottomToolView()
}
private func setupGradientLayers() {
let gradientLayerH: CGFloat = 60
let topGradientLayer = CAGradientLayer()
topGradientLayer.colors = [UIColor.blackColor().CGColor, UIColor.clearColor().CGColor];
topGradientLayer.opacity = 0.5
topGradientLayer.frame = CGRect(x: 0, y: 0, width: bounds.width, height: gradientLayerH)
layer.addSublayer(topGradientLayer)
let bottomGradientLayer = CAGradientLayer()
bottomGradientLayer.colors = [UIColor.clearColor().CGColor, UIColor.blackColor().CGColor];
bottomGradientLayer.opacity = 0.5
bottomGradientLayer.frame = CGRect(x: 0, y: bounds.height - gradientLayerH, width: bounds.width, height: gradientLayerH)
layer.addSublayer(bottomGradientLayer)
}
private func setupBottomToolView() {
let alertVc = UIAlertController(title: nil, message: nil, preferredStyle: .ActionSheet)
alertVc.addAction(UIAlertAction(title: "保存图片", style: .Default, handler: { (action) in
if let image = self.currentImageView.image {
TPCPhotoUtil.saveImage(image, completion: { (success) -> () in
self.imageDidFinishAuthorize(success: success)
})
}
}))
alertVc.addAction(UIAlertAction(title: "分享图片", style: .Default, handler: { (action) in
TPCShareView.showWithTitle(nil, desc: "干货", image: self.currentImageView.image)
}))
alertVc.addAction(UIAlertAction(title: "取消", style: .Cancel, handler: { (action) in
// self.removeSelf()
}))
viewController?.presentViewController(alertVc, animated: true, completion: nil)
// let buttonWH: CGFloat = 30.0
// let backButtonX = TPCScreenWidth * 0.1
// let backButtonY = TPCScreenHeight - buttonWH * 1.5
// let backButton = TPCSystemButton(frame: CGRect(x: TPCScreenWidth - backButtonX - buttonWH, y: backButtonY, width: buttonWH, height: buttonWH))
// backButton.title = "关闭"
// backButton.animationCompletion = { [unowned self] (inout enable: Bool) in
// self.removeSelf()
// }
// addSubview(backButton)
//
// let saveButton = TPCSystemButton(frame: CGRect(x: TPCScreenWidth * 0.5 - buttonWH * 0.5, y: backButtonY, width: buttonWH, height: buttonWH))
// saveButton.title = "保存"
// saveButton.animationCompletion = { [unowned self] (inout enable: Bool) in
// debugPrint("保存")
// if let image = self.currentImageView.image {
// TPCPhotoUtil.saveImage(image, completion: { (success) -> () in
// self.imageDidFinishAuthorize(success: success)
// })
// }
// }
// addSubview(saveButton)
//
// let shareButton = TPCSystemButton(frame: CGRect(x: backButtonX, y: backButtonY, width: buttonWH, height: buttonWH))
// shareButton.title = "分享"
// shareButton.animationCompletion = { [unowned self] (inout enable: Bool) in
// TPCShareView.showWithTitle(nil, desc: "干货", image: self.currentImageView.image)
// }
// addSubview(shareButton)
}
func imageDidFinishAuthorize(success success: Bool) {
alpha = 0
let vc = UIApplication.sharedApplication().keyWindow!.rootViewController!
var ac: UIAlertController
func recoverActionInSeconds(seconds: NSTimeInterval) {
dispatchSeconds(seconds) {
self.alpha = 1
ac.dismissViewControllerAnimated(false, completion: {
vc.navigationController?.navigationBarHidden = false
ac.navigationController?.navigationBarHidden = false
})
}
}
if success {
ac = UIAlertController(title: "保存成功", message: "恭喜你！又新增一妹子！(｡・`ω´･)", preferredStyle: .Alert)
} else {
ac = UIAlertController(title: "保存失败", message: "是否前往设置访问权限", preferredStyle: .Alert)
ac.addAction(UIAlertAction(title: "确定", style: .Default, handler: { (action) -> Void in
recoverActionInSeconds(0.5)
let url = NSURL(string: UIApplicationOpenSettingsURLString)
if let url = url where UIApplication.sharedApplication().canOpenURL(url) {
UIApplication.sharedApplication().openURL(url)
}
}))
ac.addAction(UIAlertAction(title: "取消", style: .Cancel, handler: { (action) -> Void in
recoverActionInSeconds(0)
}))
}
vc.presentViewController(ac, animated: false, completion: {
vc.navigationController?.navigationBarHidden = true
ac.navigationController?.navigationBarHidden = true
})
if ac.actions.count == 0 {
recoverActionInSeconds(1)
}
}
private func setupBackButton() {
let backButton = TPCSystemButton(frame: CGRect(x: 0, y: 0, width: 30, height: 30))
addSubview(backButton)
}
private func removeSelf() {
UIView.animateWithDuration(0.5, animations: { () -> Void in
self.alpha = 0
self.viewDisappearAction?()
}) { (finished) -> Void in
self.removeFromSuperview()
}
}
required init?(coder aDecoder: NSCoder) {
super.init(coder: aDecoder)
setupSubviews()
}
}
extension TPCPageScrollView: UIScrollViewDelegate {
func scrollViewDidScroll(scrollView: UIScrollView) {
let offsetX = scrollView.contentOffset.x
if offsetX < bounds.width {
edgeMaskView.frame.origin.x = padding / bounds.width * (bounds.width - offsetX) + bounds.width - offsetX - padding
backupImageView.frame = CGRect(x: 0, y: 0, width: bounds.width, height: bounds.height)
backupImageView.tag = (currentImageView.tag - 1 + imageURLStrings.count) % imageURLStrings.count
backupImageView.imageURLString = imageURLStrings[backupImageView.tag]
} else if offsetX > bounds.width {
edgeMaskView.frame.origin.x = padding / bounds.width * (bounds.width - offsetX) + 2 * bounds.width - offsetX
backupImageView.frame = CGRect(x: bounds.width * 2, y: 0, width: bounds.width, height: bounds.height)
backupImageView.tag = (currentImageView.tag + 1) % imageURLStrings.count
backupImageView.imageURLString = imageURLStrings[backupImageView.tag]
}
}
func scrollViewDidEndDecelerating(scrollView: UIScrollView) {
let offsetX = scrollView.contentOffset.x
scrollView.contentOffset.x = bounds.size.width
if offsetX < bounds.width * 1.5 && offsetX > bounds.width * 0.5 {
return
}
currentImageView.imageURLString = backupImageView.imageURLString
currentImageView.tag = backupImageView.tag
countLabel.text = "\(currentImageView.tag + 1) / \(imageURLStrings.count)"
}
} | mit | e93471c7d1e05751e1fada52fcc387c7 | 41.583673 | 152 | 0.616277 | 4.843083 | false | false | false | false |
ahoppen/swift | validation-test/Driver/Dependencies/rdar25405605.swift | 14 | 3185 | // RUN: %empty-directory(%t)
// RUN: cp %s %t/main.swift
// RUN: cp %S/Inputs/rdar25405605/helper-1.swift %t/helper.swift
// RUN: touch -t 201401240005 %t/*.swift
// RUN: cd %t && %target-build-swift -c -incremental -output-file-map %S/Inputs/rdar25405605/output.json -parse-as-library ./main.swift ./helper.swift -parseable-output -j1 -module-name main 2>&1 | %FileCheck -check-prefix=CHECK-1 %s
// CHECK-1-NOT: warning
// CHECK-1: {{^{$}}
// CHECK-1-DAG: "kind"{{ ?}}: "began"
// CHECK-1-DAG: "name"{{ ?}}: "compile"
// CHECK-1-DAG: "{{(\.\\\/)?}}main.swift"
// CHECK-1: {{^}$}}
// CHECK-1: {{^{$}}
// CHECK-1-DAG: "kind"{{ ?}}: "began"
// CHECK-1-DAG: "name"{{ ?}}: "compile"
// CHECK-1-DAG: "{{(\.\\\/)?}}helper.swift"
// CHECK-1: {{^}$}}
// RUN: ls %t/ | %FileCheck -check-prefix=CHECK-LS %s
// CHECK-LS-DAG: main.o
// CHECK-LS-DAG: helper.o
// RUN: cd %t && %target-build-swift -c -incremental -output-file-map %S/Inputs/rdar25405605/output.json -parse-as-library ./main.swift ./helper.swift -parseable-output -j1 -module-name main 2>&1 | %FileCheck -check-prefix=CHECK-1-SKIPPED %s
// CHECK-1-SKIPPED-NOT: warning
// CHECK-1-SKIPPED: {{^{$}}
// CHECK-1-SKIPPED-DAG: "kind"{{ ?}}: "skipped"
// CHECK-1-SKIPPED-DAG: "name"{{ ?}}: "compile"
// CHECK-1-SKIPPED-DAG: "{{(\.\\\/)?}}main.swift"
// CHECK-1-SKIPPED: {{^}$}}
// CHECK-1-SKIPPED: {{^{$}}
// CHECK-1-SKIPPED-DAG: "kind"{{ ?}}: "skipped"
// CHECK-1-SKIPPED-DAG: "name"{{ ?}}: "compile"
// CHECK-1-SKIPPED-DAG: "{{(\.\\\/)?}}helper.swift"
// CHECK-1-SKIPPED: {{^}$}}
// RUN: cp %S/Inputs/rdar25405605/helper-2.swift %t/helper.swift
// RUN: touch -t 201401240006 %t/helper.swift
// RUN: cd %t && not %target-build-swift -c -incremental -output-file-map %S/Inputs/rdar25405605/output.json -parse-as-library ./main.swift ./helper.swift -parseable-output -j1 -module-name main 2>&1 | %FileCheck -check-prefix=CHECK-2 %s
// CHECK-2-NOT: warning
// CHECK-2: {{^{$}}
// CHECK-2-DAG: "kind"{{ ?}}: "began"
// CHECK-2-DAG: "name"{{ ?}}: "compile"
// CHECK-2-DAG: "{{(\.\\\/)?}}helper.swift"
// CHECK-2: {{^}$}}
// CHECK-2: {{^{$}}
// CHECK-2-DAG: "kind"{{ ?}}: "skipped"
// CHECK-2-DAG: "name"{{ ?}}: "compile"
// CHECK-2-DAG: "{{(\.\\\/)?}}main.swift"
// CHECK-2: {{^}$}}
// RUN: cp %S/Inputs/rdar25405605/helper-3.swift %t/helper.swift
// RUN: touch -t 201401240007 %t/helper.swift
// Driver now schedules jobs in the order of the inputs, so since this test wants
// helper first, pass helper.swift before main.swift
// RUN: cd %t && not %target-build-swift -c -incremental -output-file-map %S/Inputs/rdar25405605/output.json -parse-as-library ./helper.swift ./main.swift -parseable-output -j1 -module-name main 2>&1 | %FileCheck -check-prefix=CHECK-3 %s
// CHECK-3-NOT: warning
// CHECK-3: {{^{$}}
// CHECK-3-DAG: "kind"{{ ?}}: "began"
// CHECK-3-DAG: "name"{{ ?}}: "compile"
// CHECK-3-DAG: "{{(\.\\\/)?}}helper.swift"
// CHECK-3: {{^}$}}
// CHECK-3: {{^{$}}
// CHECK-3-DAG: "kind"{{ ?}}: "began"
// CHECK-3-DAG: "name"{{ ?}}: "compile"
// CHECK-3-DAG: "{{(\.\\\/)?}}main.swift"
// CHECK-3: {{^}$}}
func foo(_ value: Foo) -> Bool {
switch value {
case .one: return true
case .two: return false
}
}
| apache-2.0 | f9d60612b3520940b9bd329aac77ce3a | 37.373494 | 241 | 0.595918 | 2.935484 | false | false | false | false |
nathanlea/CS4153MobileAppDev | WIA/WIA11_Lea_Nathan/WIA11_Lea_Nathan/TableViewController.swift | 1 | 5935 | //
// TableViewController.swift
// WIA11_Lea_Nathan
//
// Created by Nathan on 10/30/15.
// Copyright © 2015 Okstate. All rights reserved.
//
import UIKit
class TableViewController: UITableViewController {
var elements: [Dictionary<String, String>] = []
override func viewDidLoad() {
super.viewDidLoad()
// Note that, beginning with iOS 9, we must use "HTTPS"
// rather than "HTTP".
let postEndpoint =
"https://cs.okstate.edu/~user/trains.php/user/password/dbname/fall15_trains"
// Set up the URL instance for the service.
guard let url = NSURL(string: postEndpoint) else {
print("Error: cannot create URL")
return
}
// Use the URL to set up a URL request.
let urlRequest = NSMutableURLRequest(URL: url)
urlRequest.HTTPMethod = "GET"
// We also need a URL session configuration instance.
let config = NSURLSessionConfiguration.defaultSessionConfiguration()
// Now set up the URL session instance needed to make the call.
let session = NSURLSession(configuration: config)
// The method dataTaskWithRequest specifies a completion
// closure; it is invoked asynchronously when the call to
// the service returns.
let task = session.dataTaskWithRequest(urlRequest)
{ (data, response, error) in
// Check to see if any data was returned.
guard let resultData = data else {
print("Error: Did not receive data")
return
}
// Check to see if any error was encountered.
guard error == nil else {
print("Error making call")
print(error)
return
}
// Create a dictionary for the results
let result: NSArray
do {
// Attempt to turn the result into JSON data.
result =
try NSJSONSerialization.JSONObjectWithData(resultData,
options: []) as! NSArray
} catch {
print("Error trying to convert returned data to JSON")
return
}
self.elements = result as! [Dictionary<String, String>]
dispatch_sync(dispatch_get_main_queue(), {
self.tableView.reloadData()
})
}
// Make the call to the service.
task.resume()
// Uncomment the following line to preserve selection between presentations
// self.clearsSelectionOnViewWillAppear = false
// Uncomment the following line to display an Edit button in the navigation bar for this view controller.
// self.navigationItem.rightBarButtonItem = self.editButtonItem()
}
override func didReceiveMemoryWarning() {
super.didReceiveMemoryWarning()
// Dispose of any resources that can be recreated.
}
// MARK: - Table view data source
override func numberOfSectionsInTableView(tableView: UITableView) -> Int {
// #warning Incomplete implementation, return the number of sections
return 1
}
override func tableView(tableView: UITableView, numberOfRowsInSection section: Int) -> Int {
// #warning Incomplete implementation, return the number of rows
return self.elements.count
}
override func tableView(tableView: UITableView, cellForRowAtIndexPath indexPath: NSIndexPath) -> UITableViewCell {
let cell = tableView.dequeueReusableCellWithIdentifier("trains", forIndexPath: indexPath)
//print(self.elements[i]["number"])
cell.textLabel?.text=self.elements[indexPath.item]["roadName"]! + " " + self.elements[indexPath.item]["number"]!
cell.detailTextLabel?.text = self.elements[indexPath.item]["type"]!
// Configure the cell...
return cell
}
/*
// Override to support conditional editing of the table view.
override func tableView(tableView: UITableView, canEditRowAtIndexPath indexPath: NSIndexPath) -> Bool {
// Return false if you do not want the specified item to be editable.
return true
}
*/
/*
// Override to support editing the table view.
override func tableView(tableView: UITableView, commitEditingStyle editingStyle: UITableViewCellEditingStyle, forRowAtIndexPath indexPath: NSIndexPath) {
if editingStyle == .Delete {
// Delete the row from the data source
tableView.deleteRowsAtIndexPaths([indexPath], withRowAnimation: .Fade)
} else if editingStyle == .Insert {
// Create a new instance of the appropriate class, insert it into the array, and add a new row to the table view
}
}
*/
/*
// Override to support rearranging the table view.
override func tableView(tableView: UITableView, moveRowAtIndexPath fromIndexPath: NSIndexPath, toIndexPath: NSIndexPath) {
}
*/
/*
// Override to support conditional rearranging of the table view.
override func tableView(tableView: UITableView, canMoveRowAtIndexPath indexPath: NSIndexPath) -> Bool {
// Return false if you do not want the item to be re-orderable.
return true
}
*/
/*
// MARK: - Navigation
// In a storyboard-based application, you will often want to do a little preparation before navigation
override func prepareForSegue(segue: UIStoryboardSegue, sender: AnyObject?) {
// Get the new view controller using segue.destinationViewController.
// Pass the selected object to the new view controller.
}
*/
}
| mit | 330cb1fe339fd2d34bead92864a7e6f6 | 37.283871 | 157 | 0.608527 | 5.619318 | false | false | false | false |
liufan321/SwiftLearning | 基础语法/Swift基础语法.playground/Pages/002-可选项.xcplaygroundpage/Contents.swift | 1 | 1951 | import Foundation
/*:
## 概念
* `Optional` 是 Swift 的一大特色，也是 Swift 初学者最容易困惑的问题
* 定义变量时，在类型后面添加一个 `?`，表示该变量是可选的
* 定义变量时，如果指定是可选的，表示该变量：
* 可以有一个指定类型的值
* 也可以是 `nil`
## 定义
* 格式1(自动推导)：`var 变量名: Optional = 值`
* 格式2(泛型)：`var 变量名：Optional<类型> = 值`
* 格式3(简化格式)：`var 变量名: 类型? = 值`
*/
// 格式1
let x: Optional = 20
// 格式2
let y: Optional<Int> = 30
// 格式3
let z: Int? = 10
print(x)
print(y)
print(z)
/*:
## 默认值
* 变量可选项的默认值是 `nil`
* 常量可选项没有默认值，需要在定义时，或者构造函数中赋值
*/
var x1: Int?
print(x1)
let x2: Int?
// 常量可选项没有默认值，在赋值之前不能使用
// print(x2)
x2 = 100
print(x2)
/*:
## 计算和强行解包
* 可选值在参与计算前，必须`解包 unwarping`
* 只有`解包(unwrap)`后才能参与计算
* 在可选项后添加一个 `!`，表示强行解包
* 如果有值，会取值，然后参与后续计算
* 如果为 `nil`，强行解包会导致崩溃
> 程序员要对每一个 `!` 负责
*/
print(x! + y! + z!)
/*:
## 可选解包
* 如果只是调用可选项的函数，而不需要参与计算，可以使用**可选解包**
* 在可选项后，使用 `?` 然后再调用函数
* 使用可选解包可以：
* 如果有值，会取值，然后执行后续函数
* 如果为 `nil`，不会执行任何函数
> 与强行解包对比，可选解包更安全，但是只能用于函数调用，而不能用于计算
*/
var optionValue: Int?
print(optionValue?.description)
// 输出 nil
optionValue = 10
print(optionValue?.description)
// 输出 Optional("10")
//: 有关本示例的许可信息，请参阅：[许可协议](License)
| apache-2.0 | 5f47217b51e688afd5b459965ba1a4fa | 13.644737 | 48 | 0.622642 | 2.1 | false | false | false | false |
mominul/swiftup | Sources/swiftup/main.swift | 1 | 1476 | /*
swiftup
The Swift toolchain installer
Copyright (C) 2016-present swiftup Authors
Authors:
Muhammad Mominul Huque
*/
import libNix
import Commander
import Environment
import SwiftupFramework
let ver = "0.0.7"
Group {
$0.command("install",
Argument<String>("version"),
description: "Install specified version of toolchain"
) { version in
installToolchain(argument: version)
}
$0.command("show",
description: "Show the active and installed toolchains"
) {
let toolchains = Toolchains()
if let versions = toolchains.installedVersions() {
versions.forEach {
if $0 == toolchains.globalVersion {
print(" * \($0)", color: .cyan)
} else {
print(" \($0)", color: .cyan)
}
}
print("")
print(" * - Version currently in use")
} else {
print("No installed versions found!", color: .yellow)
}
}
$0.command("global",
Argument<String>("version"),
description: "Set the global toolchain version") { version in
var toolchain = Toolchains()
toolchain.globalVersion = version
}
$0.command("which",
Argument<String>("command"),
description: "Display which binary will be run for a given command") { command in
let toolchain = Toolchains()
print(toolchain.getBinaryPath().addingPath(command))
}
$0.command("version",
description: "Display swiftup version") {
print("swiftup \(ver)")
}
}.run()
| apache-2.0 | ab103505d39145d00e143fc1b09ad199 | 22.428571 | 85 | 0.629404 | 4.111421 | false | false | false | false |
PhillipEnglish/TIY-Assignments | TheGrailDiary/HistoricalSitesTableViewController.swift | 1 | 4704 | //
// HistoricalSitesTableViewController.swift
// TheGrailDiary
//
// Created by Phillip English on 10/19/15.
// Copyright © 2015 The Iron Yard. All rights reserved.
//
import UIKit
class HistoricalSitesTableViewController: UITableViewController {
var temples = Array<Temple>()
override func viewDidLoad() {
super.viewDidLoad()
title = "Temples of Ancient Egypt"
loadTemples()
// Uncomment the following line to preserve selection between presentations
// self.clearsSelectionOnViewWillAppear = false
// Uncomment the following line to display an Edit button in the navigation bar for this view controller.
// self.navigationItem.rightBarButtonItem = self.editButtonItem()
}
override func didReceiveMemoryWarning() {
super.didReceiveMemoryWarning()
// Dispose of any resources that can be recreated.
}
// MARK: - Table view data source
override func numberOfSectionsInTableView(tableView: UITableView) -> Int
{
// #warning Incomplete implementation, return the number of sections
return 1
}
override func tableView(tableView: UITableView, numberOfRowsInSection section: Int) -> Int
{
// #warning Incomplete implementation, return the number of rows
return temples.count
}
override func tableView(tableView: UITableView, cellForRowAtIndexPath indexPath: NSIndexPath) -> UITableViewCell {
let cell = tableView.dequeueReusableCellWithIdentifier("TempleCell", forIndexPath: indexPath)
// Configure the cell...
let aTemple = temples[indexPath.row]
cell.textLabel?.text = aTemple.name
cell.detailTextLabel?.text = aTemple.deity
return cell
}
/*
// Override to support conditional editing of the table view.
override func tableView(tableView: UITableView, canEditRowAtIndexPath indexPath: NSIndexPath) -> Bool {
// Return false if you do not want the specified item to be editable.
return true
}
*/
/*
// Override to support editing the table view.
override func tableView(tableView: UITableView, commitEditingStyle editingStyle: UITableViewCellEditingStyle, forRowAtIndexPath indexPath: NSIndexPath) {
if editingStyle == .Delete {
// Delete the row from the data source
tableView.deleteRowsAtIndexPaths([indexPath], withRowAnimation: .Fade)
} else if editingStyle == .Insert {
// Create a new instance of the appropriate class, insert it into the array, and add a new row to the table view
}
}
*/
/*
// Override to support rearranging the table view.
override func tableView(tableView: UITableView, moveRowAtIndexPath fromIndexPath: NSIndexPath, toIndexPath: NSIndexPath) {
}
*/
/*
// Override to support conditional rearranging of the table view.
override func tableView(tableView: UITableView, canMoveRowAtIndexPath indexPath: NSIndexPath) -> Bool {
// Return false if you do not want the item to be re-orderable.
return true
}
*/
/*
// MARK: - Navigation
// In a storyboard-based application, you will often want to do a little preparation before navigation
override func prepareForSegue(segue: UIStoryboardSegue, sender: AnyObject?) {
// Get the new view controller using segue.destinationViewController.
// Pass the selected object to the new view controller.
}
*/
func loadTemples()
{
do
{
let filePath = NSBundle.mainBundle().pathForResource("temples", ofType: "json")
let dataFromFile = NSData(contentsOfFile: filePath!)
let templeData: NSArray! = try NSJSONSerialization.JSONObjectWithData(dataFromFile!, options: []) as! NSArray
for templeDictionary in templeData
{
let aTemple = Temple(dictionary: templeDictionary as! NSDictionary)
temples.append(aTemple)
}
temples.sortInPlace({ $0.name < $1.name})
}
catch let error as NSError
{
print(error)
}
}
override func tableView(tableView: UITableView, didSelectRowAtIndexPath indexPath: NSIndexPath)
{
let aTemple = temples[indexPath.row]
let NVCfromTemplate = storyboard?.instantiateViewControllerWithIdentifier("TempleDetailViewController") as! TempleDetailViewController
NVCfromTemplate.temple = aTemple
presentViewController(NVCfromTemplate, animated: true, completion: nil)
}
}
| cc0-1.0 | 584c6e20f5dbc17fbcae4621cd37d277 | 33.580882 | 157 | 0.662343 | 5.592152 | false | false | false | false |
memexapp/memex-swift-sdk | Sources/RequestInvoker.swift | 1 | 8066 |
import Foundation
import ObjectMapper
class RequestInvoker {
// MARK: Lifecycle
weak var spaces: Spaces?
var session: URLSession
// MARK: Lifecycle
init(spaces: Spaces) {
self.spaces = spaces
self.session = URLSession(configuration: URLSessionConfiguration.default)
}
// MARK: General
func request(
method: HTTPMethod,
path: String,
queryStringParameters: [String: Any]? = nil,
bodyParameters: AnyObject? = nil,
headers: [String: String]? = nil,
allowDeauthorization: Bool? = nil,
completionHandler: @escaping RequestCompletion) {
do {
let request = try self.buildRequest(
method: method,
path: path,
queryStringParameters: queryStringParameters,
bodyParameters: bodyParameters,
headers: headers,
userToken: self.spaces!.auth.userToken)
self.invokeRequest(request: request,
allowDeauthorization: allowDeauthorization ?? self.spaces?.configuration.allowDeauthorization ?? false,
completionHandler: completionHandler)
} catch {
completionHandler(nil, nil, nil, MemexError.JSONParsingError)
}
}
private func buildRequest(
method: HTTPMethod,
path: String,
queryStringParameters: [String: Any]?,
bodyParameters: AnyObject?,
headers: [String: String]?,
userToken: String?) throws -> URLRequest {
let base = self.spaces!.configuration.serverURL.appendingPathComponent(path)
var path = "\(base.absoluteString)"
if let query = queryStringParameters, !query.isEmpty {
if let queryString = self.spaces!.queryStringTransformer.queryStringFromParameters(parameters: queryStringParameters,
error: nil) {
path = "\(path)?\(queryString)"
}
}
let url = URL(string: path)!
var request = URLRequest(url: url)
request.httpMethod = method.rawValue
if let userToken = userToken {
request.setValue(userToken, forHTTPHeaderField: HTTPHeader.userToken)
}
request.setValue(self.spaces!.configuration.appToken, forHTTPHeaderField: HTTPHeader.appToken)
if let headers = headers {
for (key, value) in headers {
request.setValue(value, forHTTPHeaderField: key)
}
}
request.setValue(userToken, forHTTPHeaderField: HTTPHeader.userToken)
if let body = bodyParameters {
request.setValue(MIMETypes.JSON, forHTTPHeaderField: HTTPHeader.contentType)
let data = try JSONSerialization.data(withJSONObject: body, options: [])
request.httpBody = data
}
return request
}
private func invokeRequest(request: URLRequest,
allowDeauthorization: Bool,
completionHandler: @escaping RequestCompletion) {
var task: URLSessionTask!
task = self.session.dataTask(with: request) { (data, response, error) -> Void in
if error != nil {
self.logRequest(request: task.originalRequest ?? request,
response: response,
resposneData: data)
completionHandler(nil, nil, nil, error)
} else {
self.processResponseWithRequest(request: request,
response: response!,
data: data!,
allowDeauthorization: allowDeauthorization,
completionHandler: completionHandler)
}
}
task.resume()
}
private func processResponseWithRequest(
request: URLRequest,
response: URLResponse,
data: Data,
allowDeauthorization: Bool,
completionHandler: RequestCompletion) {
let httpResponse = response as! HTTPURLResponse
let code = httpResponse.statusCode
var printLog = false
switch code {
case 200..<300:
printLog = printLog || self.spaces!.configuration.logAllRequests
if data.count == 0 {
completionHandler(nil, code, httpResponse.allHeaderFields, nil)
} else {
var content: AnyObject?
do {
content = try JSONSerialization.jsonObject(with: data, options: []) as AnyObject?
} catch {
completionHandler(nil, code, httpResponse.allHeaderFields, MemexError.JSONParsingError)
return
}
completionHandler(content, code, httpResponse.allHeaderFields, nil)
}
default:
printLog = false
self.logRequest(request: request, response: response, resposneData: data)
self.processResponseErrorWithCode(code: code,
data: data,
allowDeauthorization: allowDeauthorization,
request: request,
completionHandler: completionHandler)
}
if printLog {
self.logRequest(request: request, response: response, resposneData: data)
}
}
private func processResponseErrorWithCode(
code: Int,
data: Data?,
allowDeauthorization: Bool,
request: URLRequest,
completionHandler: RequestCompletion) {
let errorPayload = self.errorPayloadFromData(data: data)
switch code {
case 400..<500:
var notAuthorized = false
if let errorPayload = errorPayload, let errorCode = errorPayload.code {
if errorCode == 401 {
notAuthorized = true
}
}
if code == 401 {
notAuthorized = true
}
if notAuthorized {
if allowDeauthorization {
let requestedToken = request.allHTTPHeaderFields?[HTTPHeader.userToken]
let currentToken = self.spaces!.auth.userToken
if requestedToken == currentToken {
self.spaces!.auth.deauthorize(completionHandler: { (error) in
if error != nil {
NSLog("Session invalidation failed")
}
})
}
}
completionHandler(nil, code, nil, MemexError.notAuthorized)
} else {
if code == 404 {
completionHandler(nil, code, nil, MemexError.endpointNotFound)
} else {
completionHandler(nil, code, nil, MemexError.genericClientError)
}
}
default:
if code == 503 {
self.spaces?.healthChecker.observedEnabledMaintanance()
completionHandler(nil, code, nil, MemexError.serverMaintanance)
} else {
completionHandler(nil, code, nil, MemexError.genericServerError)
}
}
}
private func errorPayloadFromData(data: Data?) -> ErrorPayload? {
do {
var errorMessage: ErrorPayload?
if let data = data {
let json: [String: Any]? =
try JSONSerialization.jsonObject(with: data, options: []) as? [String: Any]
if let json = json, let errorDictionary = json["error"] {
errorMessage = Mapper<ErrorPayload>().map(JSONObject: errorDictionary)
}
}
return errorMessage
} catch {
return nil
}
}
func logRequest(request: URLRequest, response: URLResponse?, resposneData: Data?) {
var mutableRequest = request
if mutableRequest.allHTTPHeaderFields?[HTTPHeader.userToken] != nil {
mutableRequest.allHTTPHeaderFields?[HTTPHeader.userToken] = "<USER TOKEN>"
}
if mutableRequest.allHTTPHeaderFields?[HTTPHeader.appToken] != nil {
mutableRequest.allHTTPHeaderFields?[HTTPHeader.appToken] = "<APP TOKEN>"
}
if let httpResponse = response as? HTTPURLResponse, let data = resposneData {
let code = httpResponse.statusCode
var contentString = String(data: data, encoding: String.Encoding.utf8)
if contentString == nil {
contentString = "nil"
}
NSLog("\n\nREQUEST:\n\n\(mutableRequest.toCURL())\nRESPONSE:\n\nResponse Code: \(code)\nResponse Body:\n\(contentString!)\n\n-------------")
} else {
NSLog("\n\nREQUEST:\n\n\(mutableRequest.toCURL())")
}
}
}
| mit | 522e59aeed07d5787ac4fc153aed7c38 | 34.222707 | 146 | 0.617158 | 5.268452 | false | false | false | false |
lucaslt89/simpsonizados | simpsonizados/Pods/Alamofire/Source/Request.swift | 49 | 19439 | // Request.swift
//
// Copyright (c) 2014–2016 Alamofire Software Foundation (http://alamofire.org/)
//
// Permission is hereby granted, free of charge, to any person obtaining a copy
// of this software and associated documentation files (the "Software"), to deal
// in the Software without restriction, including without limitation the rights
// to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
// copies of the Software, and to permit persons to whom the Software is
// furnished to do so, subject to the following conditions:
//
// The above copyright notice and this permission notice shall be included in
// all copies or substantial portions of the Software.
//
// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
// IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
// FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
// AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
// LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
// OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
// THE SOFTWARE.
import Foundation
/**
Responsible for sending a request and receiving the response and associated data from the server, as well as
managing its underlying `NSURLSessionTask`.
*/
public class Request {
// MARK: - Properties
/// The delegate for the underlying task.
public let delegate: TaskDelegate
/// The underlying task.
public var task: NSURLSessionTask { return delegate.task }
/// The session belonging to the underlying task.
public let session: NSURLSession
/// The request sent or to be sent to the server.
public var request: NSURLRequest? { return task.originalRequest }
/// The response received from the server, if any.
public var response: NSHTTPURLResponse? { return task.response as? NSHTTPURLResponse }
/// The progress of the request lifecycle.
public var progress: NSProgress { return delegate.progress }
// MARK: - Lifecycle
init(session: NSURLSession, task: NSURLSessionTask) {
self.session = session
switch task {
case is NSURLSessionUploadTask:
self.delegate = UploadTaskDelegate(task: task)
case is NSURLSessionDataTask:
self.delegate = DataTaskDelegate(task: task)
case is NSURLSessionDownloadTask:
self.delegate = DownloadTaskDelegate(task: task)
default:
self.delegate = TaskDelegate(task: task)
}
}
// MARK: - Authentication
/**
Associates an HTTP Basic credential with the request.
- parameter user: The user.
- parameter password: The password.
- parameter persistence: The URL credential persistence. `.ForSession` by default.
- returns: The request.
*/
public func authenticate(
user user: String,
password: String,
persistence: NSURLCredentialPersistence = .ForSession)
-> Self
{
let credential = NSURLCredential(user: user, password: password, persistence: persistence)
return authenticate(usingCredential: credential)
}
/**
Associates a specified credential with the request.
- parameter credential: The credential.
- returns: The request.
*/
public func authenticate(usingCredential credential: NSURLCredential) -> Self {
delegate.credential = credential
return self
}
// MARK: - Progress
/**
Sets a closure to be called periodically during the lifecycle of the request as data is written to or read
from the server.
- For uploads, the progress closure returns the bytes written, total bytes written, and total bytes expected
to write.
- For downloads and data tasks, the progress closure returns the bytes read, total bytes read, and total bytes
expected to read.
- parameter closure: The code to be executed periodically during the lifecycle of the request.
- returns: The request.
*/
public func progress(closure: ((Int64, Int64, Int64) -> Void)? = nil) -> Self {
if let uploadDelegate = delegate as? UploadTaskDelegate {
uploadDelegate.uploadProgress = closure
} else if let dataDelegate = delegate as? DataTaskDelegate {
dataDelegate.dataProgress = closure
} else if let downloadDelegate = delegate as? DownloadTaskDelegate {
downloadDelegate.downloadProgress = closure
}
return self
}
/**
Sets a closure to be called periodically during the lifecycle of the request as data is read from the server.
This closure returns the bytes most recently received from the server, not including data from previous calls.
If this closure is set, data will only be available within this closure, and will not be saved elsewhere. It is
also important to note that the `response` closure will be called with nil `responseData`.
- parameter closure: The code to be executed periodically during the lifecycle of the request.
- returns: The request.
*/
public func stream(closure: (NSData -> Void)? = nil) -> Self {
if let dataDelegate = delegate as? DataTaskDelegate {
dataDelegate.dataStream = closure
}
return self
}
// MARK: - State
/**
Suspends the request.
*/
public func suspend() {
task.suspend()
}
/**
Resumes the request.
*/
public func resume() {
task.resume()
}
/**
Cancels the request.
*/
public func cancel() {
if let
downloadDelegate = delegate as? DownloadTaskDelegate,
downloadTask = downloadDelegate.downloadTask
{
downloadTask.cancelByProducingResumeData { data in
downloadDelegate.resumeData = data
}
} else {
task.cancel()
}
}
// MARK: - TaskDelegate
/**
The task delegate is responsible for handling all delegate callbacks for the underlying task as well as
executing all operations attached to the serial operation queue upon task completion.
*/
public class TaskDelegate: NSObject {
/// The serial operation queue used to execute all operations after the task completes.
public let queue: NSOperationQueue
let task: NSURLSessionTask
let progress: NSProgress
var data: NSData? { return nil }
var error: NSError?
var credential: NSURLCredential?
init(task: NSURLSessionTask) {
self.task = task
self.progress = NSProgress(totalUnitCount: 0)
self.queue = {
let operationQueue = NSOperationQueue()
operationQueue.maxConcurrentOperationCount = 1
operationQueue.suspended = true
if #available(OSX 10.10, *) {
operationQueue.qualityOfService = NSQualityOfService.Utility
}
return operationQueue
}()
}
deinit {
queue.cancelAllOperations()
queue.suspended = false
}
// MARK: - NSURLSessionTaskDelegate
// MARK: Override Closures
var taskWillPerformHTTPRedirection: ((NSURLSession, NSURLSessionTask, NSHTTPURLResponse, NSURLRequest) -> NSURLRequest?)?
var taskDidReceiveChallenge: ((NSURLSession, NSURLSessionTask, NSURLAuthenticationChallenge) -> (NSURLSessionAuthChallengeDisposition, NSURLCredential?))?
var taskNeedNewBodyStream: ((NSURLSession, NSURLSessionTask) -> NSInputStream?)?
var taskDidCompleteWithError: ((NSURLSession, NSURLSessionTask, NSError?) -> Void)?
// MARK: Delegate Methods
func URLSession(
session: NSURLSession,
task: NSURLSessionTask,
willPerformHTTPRedirection response: NSHTTPURLResponse,
newRequest request: NSURLRequest,
completionHandler: ((NSURLRequest?) -> Void))
{
var redirectRequest: NSURLRequest? = request
if let taskWillPerformHTTPRedirection = taskWillPerformHTTPRedirection {
redirectRequest = taskWillPerformHTTPRedirection(session, task, response, request)
}
completionHandler(redirectRequest)
}
func URLSession(
session: NSURLSession,
task: NSURLSessionTask,
didReceiveChallenge challenge: NSURLAuthenticationChallenge,
completionHandler: ((NSURLSessionAuthChallengeDisposition, NSURLCredential?) -> Void))
{
var disposition: NSURLSessionAuthChallengeDisposition = .PerformDefaultHandling
var credential: NSURLCredential?
if let taskDidReceiveChallenge = taskDidReceiveChallenge {
(disposition, credential) = taskDidReceiveChallenge(session, task, challenge)
} else if challenge.protectionSpace.authenticationMethod == NSURLAuthenticationMethodServerTrust {
let host = challenge.protectionSpace.host
if let
serverTrustPolicy = session.serverTrustPolicyManager?.serverTrustPolicyForHost(host),
serverTrust = challenge.protectionSpace.serverTrust
{
if serverTrustPolicy.evaluateServerTrust(serverTrust, isValidForHost: host) {
disposition = .UseCredential
credential = NSURLCredential(forTrust: serverTrust)
} else {
disposition = .CancelAuthenticationChallenge
}
}
} else {
if challenge.previousFailureCount > 0 {
disposition = .CancelAuthenticationChallenge
} else {
credential = self.credential ?? session.configuration.URLCredentialStorage?.defaultCredentialForProtectionSpace(challenge.protectionSpace)
if credential != nil {
disposition = .UseCredential
}
}
}
completionHandler(disposition, credential)
}
func URLSession(
session: NSURLSession,
task: NSURLSessionTask,
needNewBodyStream completionHandler: ((NSInputStream?) -> Void))
{
var bodyStream: NSInputStream?
if let taskNeedNewBodyStream = taskNeedNewBodyStream {
bodyStream = taskNeedNewBodyStream(session, task)
}
completionHandler(bodyStream)
}
func URLSession(session: NSURLSession, task: NSURLSessionTask, didCompleteWithError error: NSError?) {
if let taskDidCompleteWithError = taskDidCompleteWithError {
taskDidCompleteWithError(session, task, error)
} else {
if let error = error {
self.error = error
if let
downloadDelegate = self as? DownloadTaskDelegate,
userInfo = error.userInfo as? [String: AnyObject],
resumeData = userInfo[NSURLSessionDownloadTaskResumeData] as? NSData
{
downloadDelegate.resumeData = resumeData
}
}
queue.suspended = false
}
}
}
// MARK: - DataTaskDelegate
class DataTaskDelegate: TaskDelegate, NSURLSessionDataDelegate {
var dataTask: NSURLSessionDataTask? { return task as? NSURLSessionDataTask }
private var totalBytesReceived: Int64 = 0
private var mutableData: NSMutableData
override var data: NSData? {
if dataStream != nil {
return nil
} else {
return mutableData
}
}
private var expectedContentLength: Int64?
private var dataProgress: ((bytesReceived: Int64, totalBytesReceived: Int64, totalBytesExpectedToReceive: Int64) -> Void)?
private var dataStream: ((data: NSData) -> Void)?
override init(task: NSURLSessionTask) {
mutableData = NSMutableData()
super.init(task: task)
}
// MARK: - NSURLSessionDataDelegate
// MARK: Override Closures
var dataTaskDidReceiveResponse: ((NSURLSession, NSURLSessionDataTask, NSURLResponse) -> NSURLSessionResponseDisposition)?
var dataTaskDidBecomeDownloadTask: ((NSURLSession, NSURLSessionDataTask, NSURLSessionDownloadTask) -> Void)?
var dataTaskDidReceiveData: ((NSURLSession, NSURLSessionDataTask, NSData) -> Void)?
var dataTaskWillCacheResponse: ((NSURLSession, NSURLSessionDataTask, NSCachedURLResponse) -> NSCachedURLResponse?)?
// MARK: Delegate Methods
func URLSession(
session: NSURLSession,
dataTask: NSURLSessionDataTask,
didReceiveResponse response: NSURLResponse,
completionHandler: (NSURLSessionResponseDisposition -> Void))
{
var disposition: NSURLSessionResponseDisposition = .Allow
expectedContentLength = response.expectedContentLength
if let dataTaskDidReceiveResponse = dataTaskDidReceiveResponse {
disposition = dataTaskDidReceiveResponse(session, dataTask, response)
}
completionHandler(disposition)
}
func URLSession(
session: NSURLSession,
dataTask: NSURLSessionDataTask,
didBecomeDownloadTask downloadTask: NSURLSessionDownloadTask)
{
dataTaskDidBecomeDownloadTask?(session, dataTask, downloadTask)
}
func URLSession(session: NSURLSession, dataTask: NSURLSessionDataTask, didReceiveData data: NSData) {
if let dataTaskDidReceiveData = dataTaskDidReceiveData {
dataTaskDidReceiveData(session, dataTask, data)
} else {
if let dataStream = dataStream {
dataStream(data: data)
} else {
mutableData.appendData(data)
}
totalBytesReceived += data.length
let totalBytesExpected = dataTask.response?.expectedContentLength ?? NSURLSessionTransferSizeUnknown
progress.totalUnitCount = totalBytesExpected
progress.completedUnitCount = totalBytesReceived
dataProgress?(
bytesReceived: Int64(data.length),
totalBytesReceived: totalBytesReceived,
totalBytesExpectedToReceive: totalBytesExpected
)
}
}
func URLSession(
session: NSURLSession,
dataTask: NSURLSessionDataTask,
willCacheResponse proposedResponse: NSCachedURLResponse,
completionHandler: ((NSCachedURLResponse?) -> Void))
{
var cachedResponse: NSCachedURLResponse? = proposedResponse
if let dataTaskWillCacheResponse = dataTaskWillCacheResponse {
cachedResponse = dataTaskWillCacheResponse(session, dataTask, proposedResponse)
}
completionHandler(cachedResponse)
}
}
}
// MARK: - CustomStringConvertible
extension Request: CustomStringConvertible {
/**
The textual representation used when written to an output stream, which includes the HTTP method and URL, as
well as the response status code if a response has been received.
*/
public var description: String {
var components: [String] = []
if let HTTPMethod = request?.HTTPMethod {
components.append(HTTPMethod)
}
if let URLString = request?.URL?.absoluteString {
components.append(URLString)
}
if let response = response {
components.append("(\(response.statusCode))")
}
return components.joinWithSeparator(" ")
}
}
// MARK: - CustomDebugStringConvertible
extension Request: CustomDebugStringConvertible {
func cURLRepresentation() -> String {
var components = ["$ curl -i"]
guard let
request = self.request,
URL = request.URL,
host = URL.host
else {
return "$ curl command could not be created"
}
if let HTTPMethod = request.HTTPMethod where HTTPMethod != "GET" {
components.append("-X \(HTTPMethod)")
}
if let credentialStorage = self.session.configuration.URLCredentialStorage {
let protectionSpace = NSURLProtectionSpace(
host: host,
port: URL.port?.integerValue ?? 0,
`protocol`: URL.scheme,
realm: host,
authenticationMethod: NSURLAuthenticationMethodHTTPBasic
)
if let credentials = credentialStorage.credentialsForProtectionSpace(protectionSpace)?.values {
for credential in credentials {
components.append("-u \(credential.user!):\(credential.password!)")
}
} else {
if let credential = delegate.credential {
components.append("-u \(credential.user!):\(credential.password!)")
}
}
}
if session.configuration.HTTPShouldSetCookies {
if let
cookieStorage = session.configuration.HTTPCookieStorage,
cookies = cookieStorage.cookiesForURL(URL) where !cookies.isEmpty
{
let string = cookies.reduce("") { $0 + "\($1.name)=\($1.value ?? String());" }
components.append("-b \"\(string.substringToIndex(string.endIndex.predecessor()))\"")
}
}
if let headerFields = request.allHTTPHeaderFields {
for (field, value) in headerFields {
switch field {
case "Cookie":
continue
default:
components.append("-H \"\(field): \(value)\"")
}
}
}
if let additionalHeaders = session.configuration.HTTPAdditionalHeaders {
for (field, value) in additionalHeaders {
switch field {
case "Cookie":
continue
default:
components.append("-H \"\(field): \(value)\"")
}
}
}
if let
HTTPBodyData = request.HTTPBody,
HTTPBody = String(data: HTTPBodyData, encoding: NSUTF8StringEncoding)
{
let escapedBody = HTTPBody.stringByReplacingOccurrencesOfString("\"", withString: "\\\"")
components.append("-d \"\(escapedBody)\"")
}
components.append("\"\(URL.absoluteString)\"")
return components.joinWithSeparator(" \\\n\t")
}
/// The textual representation used when written to an output stream, in the form of a cURL command.
public var debugDescription: String {
return cURLRepresentation()
}
}
| mit | e592a59a1d82cac745a06e2de5c41729 | 35.128253 | 162 | 0.615116 | 6.349886 | false | false | false | false |
mmsaddam/TheMovie | TheMovie/ViewController.swift | 1 | 10965 | //
// ViewController.swift
// TheMovie
//
// Created by Md. Muzahidul Islam on 7/16/16.
// Copyright © 2016 iMuzahid. All rights reserved.
//
import UIKit
import Alamofire
import AlamofireImage
private let reuseIdentifier = "FlickrCell"
private let sectionInsets = UIEdgeInsets(top: 5, left: 5, bottom: 5, right: 5)
class ViewController: UIViewController {
// MARK: Outlet Properties
@IBOutlet var collectionView: UICollectionView!
@IBOutlet weak var segmentedControl: UISegmentedControl!
// MARK: Instance properties
let gridHieght = 300 // iamgeview height
let gridWidth = 180 // imageview width
let spacing = 10
var nowPlayingPageNo = 1
var topRatedPageNo = 1
var upcomingPageNo = 1
var refreshing = false
struct List {
static let NowPlaying = "Now"
static let TopRated = "Top"
static let Upcoming = "UP"
}
enum Action: Int {
case NowPlaying
case TopRated
case Upcoming
func getType() -> String {
switch self {
case .NowPlaying: return List.NowPlaying
case .TopRated: return List.TopRated
case .Upcoming: return List.Upcoming
}
}
}
// Movie List Dic: Under every key there will be an array
var movieList = [String:[Movie]]()
var selectedMovie: Movie? // movie tapped for details
var actionType = Action.NowPlaying
var imageDownloadInProgress = [NSIndexPath: IconDownloader]()
var pullUpInProgress = false
override func viewDidLoad() {
super.viewDidLoad()
self.title = "The Movie"
self.collectionView.delegate = self
self.collectionView.dataSource = self
// Initalize shared instance
LibAPI.sharedInstance
self.makeRequestForMovies()
}
// MARK: Helper function
// Get url string for movies
func getPageUrlStr() -> String{
var commonStr = ""
let pageNo = getPageIndex()
switch self.actionType {
case .NowPlaying:
commonStr += kNowPlaying
case .TopRated:
commonStr += kTopRated
case .Upcoming:
commonStr += kUpcoming
}
let finalStr = commonStr + String(pageNo)
return finalStr
}
// make reques for the movies
func makeRequestForMovies() {
let urlStr = getPageUrlStr()
self.beforeMakeRequestCompletion()
Alamofire.request(.GET, urlStr, parameters: nil)
.validate()
.responseData { response in
if let data = response.data{
self.afterRequestCompletionWithData(data)
}
}
}
// set up required before request for new movies
func beforeMakeRequestCompletion(){
UIApplication.sharedApplication().networkActivityIndicatorVisible = true
footerControl(isHidden: false)
self.refreshing = true
}
// Made required change after completing request
func afterRequestCompletionWithData(data: NSData) {
if let movies = LibAPI.sharedInstance.parseJSON(data){
if let _ = self.movieList[self.actionType.getType()]{
self.movieList[self.actionType.getType()]! += movies
}else{
self.movieList[self.actionType.getType()] = movies
}
self.refreshing = false
footerControl(isHidden: true)
UIApplication.sharedApplication().networkActivityIndicatorVisible = false
self.collectionView?.reloadData()
self.incrementPageIndex()
}
}
// Get current page index to make new request
func getPageIndex() -> Int {
switch actionType {
case .NowPlaying: return nowPlayingPageNo
case .TopRated: return topRatedPageNo
default: return upcomingPageNo
}
}
// After downloading increment the index number
func incrementPageIndex() {
switch actionType {
case .NowPlaying: nowPlayingPageNo += 1
case .TopRated: topRatedPageNo += 1
default: upcomingPageNo += 1
}
}
// Download cover image for the movie
func startImageDownload(record: Movie, forIndexPath: NSIndexPath){
var iconDownloader = self.imageDownloadInProgress[forIndexPath]
if iconDownloader == nil{
iconDownloader = IconDownloader()
iconDownloader?.record = record
iconDownloader?.completionHandler = {
if let cell = self.collectionView.cellForItemAtIndexPath(forIndexPath) as? CustomCell{
dispatch_async(dispatch_get_main_queue(), {
cell.imageView.image = record.coverImage
cell.spinner.stopAnimating()
self.imageDownloadInProgress[forIndexPath] = nil
})
}
}
self.imageDownloadInProgress[forIndexPath] = iconDownloader
iconDownloader?.startDownload()
}
}
// MARK: Action
@IBAction func segmentedAction(sender: AnyObject) {
let segmentedControl = sender as! UISegmentedControl
self.actionType = Action(rawValue: segmentedControl.selectedSegmentIndex)!
if let _ = movieList[actionType.getType()]{
collectionView.reloadData()
}else{
self.makeRequestForMovies()
}
}
// Load image for the visible cell
func loadImageForVisibleCells() {
if let movies = self.movieList[actionType.getType()] where movies.count > 0{
let visiblePaths = collectionView.indexPathsForVisibleItems()
for path in visiblePaths{
let movie = movies[path.section + path.row]
if movie.coverImage == nil{
self.startImageDownload(movie, forIndexPath: path)
}
}
}
}
// MARK: - Navigation
// In a storyboard-based application, you will often want to do a little preparation before navigation
override func prepareForSegue(segue: UIStoryboardSegue, sender: AnyObject?) {
if segue.identifier == "ShowDetails"{
let destinationVC = segue.destinationViewController as! DetailViewController
destinationVC.movie = self.selectedMovie
}
}
override func didReceiveMemoryWarning() {
super.didReceiveMemoryWarning()
// Dispose of any resources that can be recreated.
}
}
// MARK: UICollectionView DataSource
extension ViewController: UICollectionViewDataSource{
// MARK: UICollectionViewDataSource
func numberOfSectionsInCollectionView(collectionView: UICollectionView) -> Int {
return 1
}
func collectionView(collectionView: UICollectionView, numberOfItemsInSection section: Int) -> Int {
if let list = self.movieList[self.actionType.getType()] where list.count > 0 {
return list.count
}else{
return 0
}
}
func collectionView(collectionView: UICollectionView, cellForItemAtIndexPath indexPath: NSIndexPath) -> UICollectionViewCell {
let cell = collectionView.dequeueReusableCellWithReuseIdentifier(reuseIdentifier, forIndexPath: indexPath) as! CustomCell
if let movies = movieList[actionType.getType()] where movies.count > 0 {
let movie = movies[indexPath.section + indexPath.row]
// Configure the cell
if let image = movie.coverImage{
cell.imageView.image = image
cell.spinner.stopAnimating()
}else{
if !collectionView.decelerating && !collectionView.dragging{
dispatch_async(dispatch_get_global_queue( DISPATCH_QUEUE_PRIORITY_DEFAULT, 0), {
self.startImageDownload(movie, forIndexPath: indexPath)
})
}
// Set default image until cover image dowload completed
cell.imageView.image = UIImage(named: "emptyCell")
}
}
return cell
}
}
// MARK: UICollectionView Delegate
extension ViewController: UICollectionViewDelegate{
// Tap on the cell
func collectionView(collectionView: UICollectionView, didSelectItemAtIndexPath indexPath: NSIndexPath) {
if !collectionView.decelerating && !collectionView.dragging {
let movie = movieList[actionType.getType()]![indexPath.section + indexPath.row]
self.selectedMovie = movie
dispatch_async(dispatch_get_main_queue(), {
self.performSegueWithIdentifier("ShowDetails", sender: nil)
})
}
}
// Set Footer
func collectionView(collectionView: UICollectionView, viewForSupplementaryElementOfKind kind: String, atIndexPath indexPath: NSIndexPath) -> UICollectionReusableView {
if kind == UICollectionElementKindSectionFooter{
let footer = collectionView.dequeueReusableSupplementaryViewOfKind(UICollectionElementKindSectionFooter, withReuseIdentifier: "Footer", forIndexPath: indexPath) as! FooterCell
footer.hidden = true
if pullUpInProgress {
return footer
}else{
return footer
}
}else{
return UICollectionReusableView()
}
}
// Cell Size cofigure
func collectionView(collectionView: UICollectionView,
layout collectionViewLayout: UICollectionViewLayout,
sizeForItemAtIndexPath indexPath: NSIndexPath) -> CGSize {
let size = self.view.bounds.size
return CGSize(width: CGFloat(size.width / 2) - 10, height: 250)
}
// Set Cell EdgeInset
func collectionView(collectionView: UICollectionView,
layout collectionViewLayout: UICollectionViewLayout,
insetForSectionAtIndex section: Int) -> UIEdgeInsets {
return sectionInsets
}
}
// MARK: ScrollView Delegate
extension ViewController: UIScrollViewDelegate{
// This behavior start when user start dragging...
func scrollViewWillBeginDragging(scrollView: UIScrollView) {
let currentOffsetY = scrollView.contentOffset.y
let contentHeight = scrollView.contentSize.height
let scrollViewHeight = scrollView.frame.size.height
if (currentOffsetY + scrollViewHeight) >= contentHeight {
pullUpInProgress = true
}else{
pullUpInProgress = false
}
if pullUpInProgress{
print("Start pull down process")
}else{
}
}
// Scroll continuing...
func scrollViewDidScroll(scrollView: UIScrollView) {
let currentOffsetY = scrollView.contentOffset.y
let contentHeight = scrollView.contentSize.height
let scrollViewHeight = scrollView.frame.size.height
if pullUpInProgress && ((currentOffsetY + scrollViewHeight) >= contentHeight) {
// check the user scrolling satisfy the condition
if (currentOffsetY + scrollViewHeight) > (contentHeight + 40) {
//print("release to add")
}else{
//print("pull to add")
}
}else{
pullUpInProgress = false
}
}
// When scrollview stop, Download images for visible cell
func scrollViewDidEndDecelerating(scrollView: UIScrollView) {
loadImageForVisibleCells()
}
// User stop dragging
func scrollViewDidEndDragging(scrollView: UIScrollView, willDecelerate decelerate: Bool) {
let currentOffsetY = scrollView.contentOffset.y
let contentHeight = scrollView.contentSize.height
let scrollViewHeight = scrollView.frame.size.height
// check whether the user pull up enough
if (currentOffsetY + scrollViewHeight) > (contentHeight + 40) {
self.makeRequestForMovies()
}else{
}
loadImageForVisibleCells()
}
// make footer visible when start laod new page
func footerControl(isHidden isHide: Bool) {
for view in collectionView.subviews{
if view.isKindOfClass(FooterCell){
view.hidden = isHide
}
}
}
}
| mit | f9ec3e6bcba9728f0c6c85797cba2767 | 21.699793 | 178 | 0.705582 | 4.424536 | false | false | false | false |
1aurabrown/eidolon | Kiosk/Admin/AdminPanelViewController.swift | 1 | 2105 | import UIKit
class AdminPanelViewController: UIViewController {
@IBOutlet weak var auctionIDLabel: UILabel!
@IBAction func backTapped(sender: AnyObject) {
self.presentingViewController?.dismissViewControllerAnimated(true, completion: nil)
}
@IBAction func closeAppTapped(sender: AnyObject) {
exit(1)
}
override func viewDidAppear(animated: Bool) {
super.viewDidAppear(animated)
// TODO: Show help button
}
override func prepareForSegue(segue: UIStoryboardSegue, sender: AnyObject?) {
if segue == .LoadAdminWebViewController {
let webVC = segue.destinationViewController as AuctionWebViewController
let auctionID = AppSetup.sharedState.auctionID
let base = AppSetup.sharedState.useStaging ? "staging.artsy.net" : "artsy.net"
webVC.URL = NSURL(string: "https://\(base)/feature/\(auctionID)")!
// TODO: Hide help button
}
}
override func viewDidLoad() {
super.viewDidLoad()
let state = AppSetup.sharedState
auctionIDLabel.text = state.auctionID
let environment = state.useStaging ? "PRODUCTION" : "STAGING"
environmentChangeButton.setTitle("USE \(environment)", forState: .Normal)
let buttonsTitle = state.showDebugButtons ? "HIDE" : "SHOW"
showAdminButtonsButton.setTitle(buttonsTitle, forState: .Normal)
}
@IBOutlet weak var environmentChangeButton: ActionButton!
@IBAction func switchStagingProductionTapped(sender: AnyObject) {
let defaults = NSUserDefaults.standardUserDefaults()
defaults.setObject(!AppSetup.sharedState.useStaging, forKey: "KioskUseStaging")
defaults.synchronize()
exit(1)
}
@IBOutlet weak var showAdminButtonsButton: ActionButton!
@IBAction func toggleAdminButtons(sender: ActionButton) {
let defaults = NSUserDefaults.standardUserDefaults()
defaults.setObject(!AppSetup.sharedState.showDebugButtons, forKey: "KioskShowDebugButtons")
defaults.synchronize()
exit(1)
}
}
| mit | 77d74b08ca58218531865290ed2e5157 | 33.508197 | 99 | 0.685036 | 5.035885 | false | false | false | false |
fizx/jane | ruby/lib/vendor/grpc-swift/Tests/SwiftGRPCTests/ChannelArgumentTests.swift | 3 | 3570 | /*
* Copyright 2018, gRPC Authors All rights reserved.
*
* Licensed under the Apache License, Version 2.0 (the "License");
* you may not use this file except in compliance with the License.
* You may obtain a copy of the License at
*
* http://www.apache.org/licenses/LICENSE-2.0
*
* Unless required by applicable law or agreed to in writing, software
* distributed under the License is distributed on an "AS IS" BASIS,
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
* See the License for the specific language governing permissions and
* limitations under the License.
*/
#if SWIFT_PACKAGE
import CgRPC
#endif
import Foundation
@testable import SwiftGRPC
import XCTest
fileprivate class ChannelArgumentTestProvider: Echo_EchoProvider {
func get(request: Echo_EchoRequest, session: Echo_EchoGetSession) throws -> Echo_EchoResponse {
// We simply return the user agent we received, which can then be inspected by the test code.
return Echo_EchoResponse(text: (session as! ServerSessionBase).handler.requestMetadata["user-agent"]!)
}
func expand(request: Echo_EchoRequest, session: Echo_EchoExpandSession) throws -> ServerStatus? {
fatalError("not implemented")
}
func collect(session: Echo_EchoCollectSession) throws -> Echo_EchoResponse? {
fatalError("not implemented")
}
func update(session: Echo_EchoUpdateSession) throws -> ServerStatus? {
fatalError("not implemented")
}
}
class ChannelArgumentTests: BasicEchoTestCase {
static var allTests: [(String, (ChannelArgumentTests) -> () throws -> Void)] {
return [
("testArgumentKey", testArgumentKey),
("testStringArgument", testStringArgument),
("testIntegerArgument", testIntegerArgument),
("testBoolArgument", testBoolArgument),
("testTimeIntervalArgument", testTimeIntervalArgument),
]
}
fileprivate func makeClient(_ arguments: [Channel.Argument]) -> Echo_EchoServiceClient {
let client = Echo_EchoServiceClient(address: address, secure: false, arguments: arguments)
client.timeout = defaultTimeout
return client
}
override func makeProvider() -> Echo_EchoProvider { return ChannelArgumentTestProvider() }
}
extension ChannelArgumentTests {
func testArgumentKey() {
let argument = Channel.Argument.defaultAuthority("default")
XCTAssertEqual(String(cString: argument.toCArg().wrapped.key), "grpc.default_authority")
}
func testStringArgument() {
let argument = Channel.Argument.primaryUserAgent("Primary/0.1")
XCTAssertEqual(String(cString: argument.toCArg().wrapped.value.string), "Primary/0.1")
}
func testIntegerArgument() {
let argument = Channel.Argument.http2MaxPingsWithoutData(5)
XCTAssertEqual(argument.toCArg().wrapped.value.integer, 5)
}
func testBoolArgument() {
let argument = Channel.Argument.keepAlivePermitWithoutCalls(true)
XCTAssertEqual(argument.toCArg().wrapped.value.integer, 1)
}
func testTimeIntervalArgument() {
let argument = Channel.Argument.keepAliveTime(2.5)
XCTAssertEqual(argument.toCArg().wrapped.value.integer, 2500) // in ms
}
}
extension ChannelArgumentTests {
func testPracticalUse() {
let client = makeClient([.primaryUserAgent("FOO"), .secondaryUserAgent("BAR")])
let responseText = try! client.get(Echo_EchoRequest(text: "")).text
XCTAssertTrue(responseText.hasPrefix("FOO "), "user agent \(responseText) should begin with 'FOO '")
XCTAssertTrue(responseText.hasSuffix(" BAR"), "user agent \(responseText) should end with ' BAR'")
}
}
| mit | 381d830e848292482c1d0dfdfe23806f | 36.1875 | 106 | 0.735014 | 4.380368 | false | true | false | false |
iAugux/Augus | Settings/TodayViewController+Apps.swift | 1 | 3873 | //
// TodayViewController+Apps.swift
// Augus
//
// Created by Augus on 2/24/16.
// Copyright © 2016 iAugus. All rights reserved.
//
import UIKit
// MARK: - MacID
extension TodayViewController {
internal func configureMacIDPanel() {
macIDClipboardButton.setImageForMacIDButton(UIColor.yellowColor())
macIDWakeButton.setImageForMacIDButton(UIColor.greenColor())
macIDClipboardButton.addGestureRecognizer(UILongPressGestureRecognizer(target: self, action: #selector(TodayViewController.openMacID)))
macIDWakeButton.addGestureRecognizer(UILongPressGestureRecognizer(target: self, action: #selector(TodayViewController.openMacID)))
macIDLockButton.addGestureRecognizer(UILongPressGestureRecognizer(target: self, action: #selector(TodayViewController.openMacID)))
}
@IBAction func macIDSendClipboard(sender: AnyObject) {
openSettingWithURL(AppsURL.MacIDClipboard.scheme)
}
@IBAction func macIDLock(sender: AnyObject) {
openSettingWithURL(AppsURL.MacIDLock.scheme)
}
@IBAction func macIDWake(sender: AnyObject) {
openSettingWithURL(AppsURL.MacIDWake.scheme)
}
internal func openMacID() {
openSettingWithURL(AppsURL.MacID.scheme)
}
private func image(named: String) -> UIImage? {
return UIImage(named: "mac_id")?.imageWithRenderingMode(.AlwaysTemplate)
}
}
// MARK: - Surge
let kSurgeAutoClose = "kSurgeAutoClose"
let kSurgeAutoCloseDefaultBool = true
extension TodayViewController {
internal func configureSurgePanel() {
surgeAutoCloseSwitch.transform = CGAffineTransformMakeScale(0.55, 0.55)
let recognizer = UILongPressGestureRecognizer(target: self, action: #selector(surgeToggleDidLongPress(_:)))
surgeButton?.addGestureRecognizer(recognizer)
}
internal func surgeToggleDidLongPress(sender: UILongPressGestureRecognizer) {
guard sender.state == .Began else { return }
let url = surgeAutoCloseSwitch.on ? AppsURL.SurgeAutoClose.scheme : AppsURL.SurgeToggle.scheme
openSettingWithURL(url)
}
@IBAction func surgeAutoCloseSwitchDidTap(sender: UISwitch) {
NSUserDefaults.standardUserDefaults().setBool(sender.on, forKey: kSurgeAutoClose)
NSUserDefaults.standardUserDefaults().synchronize()
}
@IBAction func surgeToggleDidTap(sender: AnyObject) {
let url = AppsURL.Surge.scheme
openSettingWithURL(url)
}
}
// MARK: -
extension TodayViewController {
@IBAction func open1Password(sender: AnyObject) {
openSettingWithURL(AppsURL.OnePassword.scheme)
}
@IBAction func openOTPAuth(sender: AnyObject) {
openSettingWithURL(AppsURL.OTPAuth.scheme)
}
@IBAction func openDuetDisplay(sender: AnyObject) {
openSettingWithURL(AppsURL.Duet.scheme)
}
@IBAction func openReminders(sender: AnyObject) {
openSettingWithURL(AppsURL.Reminders.scheme)
}
@IBAction func openNotes(sender: AnyObject) {
openSettingWithURL(AppsURL.Notes.scheme)
}
}
extension TodayViewController {
@IBAction func openTumblr(sender: AnyObject) {
openSettingWithURL(AppsURL.Tumblr.scheme)
}
}
extension UIButton {
private func setImageForMacIDButton(tintColor: UIColor) {
setImage("mac_id", tintColor: tintColor)
}
private func setImage(named: String, tintColor: UIColor) {
imageView?.tintColor = tintColor
imageView?.layer.cornerRadius = imageView!.bounds.width / 2
imageView?.layer.borderWidth = 1.5
imageView?.layer.borderColor = UIColor.whiteColor().CGColor
setImage(UIImage(named: named)?.imageWithRenderingMode(.AlwaysTemplate), forState: .Normal)
}
} | mit | 409c8636282de8e666c22d945590aaa2 | 29.023256 | 143 | 0.695764 | 4.938776 | false | false | false | false |
noppoMan/aws-sdk-swift | Sources/Soto/Services/Athena/Athena_Error.swift | 1 | 2951 | //===----------------------------------------------------------------------===//
//
// This source file is part of the Soto for AWS open source project
//
// Copyright (c) 2017-2020 the Soto project authors
// Licensed under Apache License v2.0
//
// See LICENSE.txt for license information
// See CONTRIBUTORS.txt for the list of Soto project authors
//
// SPDX-License-Identifier: Apache-2.0
//
//===----------------------------------------------------------------------===//
// THIS FILE IS AUTOMATICALLY GENERATED by https://github.com/soto-project/soto/tree/main/CodeGenerator. DO NOT EDIT.
import SotoCore
/// Error enum for Athena
public struct AthenaErrorType: AWSErrorType {
enum Code: String {
case internalServerException = "InternalServerException"
case invalidRequestException = "InvalidRequestException"
case metadataException = "MetadataException"
case resourceNotFoundException = "ResourceNotFoundException"
case tooManyRequestsException = "TooManyRequestsException"
}
private let error: Code
public let context: AWSErrorContext?
/// initialize Athena
public init?(errorCode: String, context: AWSErrorContext) {
guard let error = Code(rawValue: errorCode) else { return nil }
self.error = error
self.context = context
}
internal init(_ error: Code) {
self.error = error
self.context = nil
}
/// return error code string
public var errorCode: String { self.error.rawValue }
/// Indicates a platform issue, which may be due to a transient condition or outage.
public static var internalServerException: Self { .init(.internalServerException) }
/// Indicates that something is wrong with the input to the request. For example, a required parameter may be missing or out of range.
public static var invalidRequestException: Self { .init(.invalidRequestException) }
/// An exception that Athena received when it called a custom metastore. Occurs if the error is not caused by user input (InvalidRequestException) or from the Athena platform (InternalServerException). For example, if a user-created Lambda function is missing permissions, the Lambda 4XX exception is returned in a MetadataException.
public static var metadataException: Self { .init(.metadataException) }
/// A resource, such as a workgroup, was not found.
public static var resourceNotFoundException: Self { .init(.resourceNotFoundException) }
/// Indicates that the request was throttled.
public static var tooManyRequestsException: Self { .init(.tooManyRequestsException) }
}
extension AthenaErrorType: Equatable {
public static func == (lhs: AthenaErrorType, rhs: AthenaErrorType) -> Bool {
lhs.error == rhs.error
}
}
extension AthenaErrorType: CustomStringConvertible {
public var description: String {
return "\(self.error.rawValue): \(self.message ?? "")"
}
}
| apache-2.0 | bb27f9232ef10f14d4d33273fe0ab481 | 41.768116 | 337 | 0.684853 | 5.114385 | false | false | false | false |
rokuz/omim | iphone/Maps/Core/Ads/Mopub/MopubBanner.swift | 1 | 5041 | final class MopubBanner: NSObject, Banner {
private enum Limits {
static let minTimeOnScreen: TimeInterval = 3
static let minTimeSinceLastRequest: TimeInterval = 5
}
fileprivate var success: Banner.Success!
fileprivate var failure: Banner.Failure!
fileprivate var click: Banner.Click!
private var requestDate: Date?
private var showDate: Date?
private var remainingTime = Limits.minTimeOnScreen
private let placementID: String
func reload(success: @escaping Banner.Success, failure: @escaping Banner.Failure, click: @escaping Click) {
self.success = success
self.failure = failure
self.click = click
load()
requestDate = Date()
}
func unregister() {
nativeAd?.unregister()
}
var isBannerOnScreen = false {
didSet {
if isBannerOnScreen {
startCountTimeOnScreen()
} else {
stopCountTimeOnScreen()
}
}
}
private(set) var isNeedToRetain = false
var isPossibleToReload: Bool {
if let date = requestDate {
return Date().timeIntervalSince(date) > Limits.minTimeSinceLastRequest
}
return true
}
var type: BannerType { return .mopub(bannerID) }
var mwmType: MWMBannerType { return type.mwmType }
var bannerID: String { return placementID }
var statisticsDescription: [String: String] {
return [kStatBanner: bannerID, kStatProvider: kStatMopub]
}
init(bannerID: String) {
placementID = bannerID
super.init()
let center = NotificationCenter.default
center.addObserver(self,
selector: #selector(enterForeground),
name: UIApplication.willEnterForegroundNotification,
object: nil)
center.addObserver(self,
selector: #selector(enterBackground),
name: UIApplication.didEnterBackgroundNotification,
object: nil)
}
deinit {
NotificationCenter.default.removeObserver(self)
}
@objc private func enterForeground() {
if isBannerOnScreen {
startCountTimeOnScreen()
}
}
@objc private func enterBackground() {
if isBannerOnScreen {
stopCountTimeOnScreen()
}
}
private func startCountTimeOnScreen() {
if showDate == nil {
showDate = Date()
}
if remainingTime > 0 {
perform(#selector(setEnoughTimeOnScreen), with: nil, afterDelay: remainingTime)
}
}
private func stopCountTimeOnScreen() {
guard let date = showDate else {
assert(false)
return
}
let timePassed = Date().timeIntervalSince(date)
if timePassed < Limits.minTimeOnScreen {
remainingTime = Limits.minTimeOnScreen - timePassed
NSObject.cancelPreviousPerformRequests(withTarget: self)
} else {
remainingTime = 0
}
}
@objc private func setEnoughTimeOnScreen() {
isNeedToRetain = false
}
// MARK: - Content
private(set) var nativeAd: MPNativeAd?
var title: String {
return nativeAd?.properties[kAdTitleKey] as? String ?? ""
}
var text: String {
return nativeAd?.properties[kAdTextKey] as? String ?? ""
}
var iconURL: String {
return nativeAd?.properties[kAdIconImageKey] as? String ?? ""
}
var ctaText: String {
return nativeAd?.properties[kAdCTATextKey] as? String ?? ""
}
var privacyInfoURL: URL? {
guard let nativeAd = nativeAd else { return nil }
if nativeAd.adAdapter is FacebookNativeAdAdapter {
return (nativeAd.adAdapter as! FacebookNativeAdAdapter).fbNativeAd.adChoicesLinkURL
}
return URL(string: kDAAIconTapDestinationURL)
}
// MARK: - Helpers
private var request: MPNativeAdRequest!
private func load() {
let settings = MPStaticNativeAdRendererSettings()
let config = MPStaticNativeAdRenderer.rendererConfiguration(with: settings)!
request = MPNativeAdRequest(adUnitIdentifier: placementID, rendererConfigurations: [config])
let targeting = MPNativeAdRequestTargeting()
targeting.keywords = "user_lang:\(AppInfo.shared().twoLetterLanguageId ?? "")"
targeting.desiredAssets = [kAdTitleKey, kAdTextKey, kAdIconImageKey, kAdCTATextKey]
if let location = MWMLocationManager.lastLocation() {
targeting.location = location
}
request.targeting = targeting
request.start { [weak self] _, nativeAd, error in
guard let s = self else { return }
if let error = error as NSError? {
let params: [String: Any] = [
kStatBanner: s.bannerID,
kStatProvider: kStatMopub,
]
let event = kStatPlacePageBannerError
s.failure(s.type, event, params, error)
} else {
nativeAd?.delegate = self
s.nativeAd = nativeAd
s.success(s)
}
}
}
}
extension MopubBanner: MPNativeAdDelegate {
func willPresentModal(for nativeAd: MPNativeAd!) {
guard nativeAd === self.nativeAd else { return }
click(self)
}
func viewControllerForPresentingModalView() -> UIViewController! {
return UIViewController.topViewController()
}
}
| apache-2.0 | 525c42a502b149038363a4cec56c0c10 | 26.102151 | 109 | 0.6707 | 4.951866 | false | false | false | false |
lvogelzang/Blocky | Blocky/Levels/Level43.swift | 1 | 877 | //
// Level43.swift
// Blocky
//
// Created by Lodewijck Vogelzang on 07-12-18
// Copyright (c) 2018 Lodewijck Vogelzang. All rights reserved.
//
import UIKit
final class Level43: Level {
let levelNumber = 43
var tiles = [[0, 1, 0, 1, 0], [1, 1, 1, 1, 1], [0, 1, 0, 1, 0], [0, 1, 0, 1, 0]]
let cameraFollowsBlock = false
let blocky: Blocky
let enemies: [Enemy]
let foods: [Food]
init() {
blocky = Blocky(startLocation: (0, 1), endLocation: (4, 1))
let pattern0 = [("S", 0.5), ("S", 0.5), ("S", 0.5), ("N", 0.5), ("N", 0.5), ("N", 0.5)]
let enemy0 = Enemy(enemyNumber: 0, startLocation: (1, 3), animationPattern: pattern0)
let pattern1 = [("S", 0.5), ("S", 0.5), ("S", 0.5), ("N", 0.5), ("N", 0.5), ("N", 0.5)]
let enemy1 = Enemy(enemyNumber: 1, startLocation: (3, 3), animationPattern: pattern1)
enemies = [enemy0, enemy1]
foods = []
}
}
| mit | 513e457ead6f1df0a3502126bb3e7183 | 24.794118 | 89 | 0.573546 | 2.649547 | false | false | false | false |
Speicher210/wingu-sdk-ios-demoapp | Example/Pods/SKPhotoBrowser/SKPhotoBrowser/SKPagingScrollView.swift | 1 | 7810 | //
// SKPagingScrollView.swift
// SKPhotoBrowser
//
// Created by 鈴木 啓司 on 2016/08/18.
// Copyright © 2016年 suzuki_keishi. All rights reserved.
//
import Foundation
class SKPagingScrollView: UIScrollView {
let pageIndexTagOffset: Int = 1000
let sideMargin: CGFloat = 10
fileprivate var visiblePages = [SKZoomingScrollView]()
fileprivate var recycledPages = [SKZoomingScrollView]()
fileprivate weak var browser: SKPhotoBrowser?
var numberOfPhotos: Int {
return browser?.photos.count ?? 0
}
required init?(coder aDecoder: NSCoder) {
super.init(coder: aDecoder)
}
override init(frame: CGRect) {
super.init(frame: frame)
isPagingEnabled = true
showsHorizontalScrollIndicator = true
showsVerticalScrollIndicator = true
}
convenience init(frame: CGRect, browser: SKPhotoBrowser) {
self.init(frame: frame)
self.browser = browser
updateFrame(bounds, currentPageIndex: browser.currentPageIndex)
}
func reload() {
visiblePages.forEach({$0.removeFromSuperview()})
visiblePages.removeAll()
recycledPages.removeAll()
}
func loadAdjacentPhotosIfNecessary(_ photo: SKPhotoProtocol, currentPageIndex: Int) {
guard let browser = browser, let page = pageDisplayingAtPhoto(photo) else {
return
}
let pageIndex = (page.tag - pageIndexTagOffset)
if currentPageIndex == pageIndex {
// Previous
if pageIndex > 0 {
let previousPhoto = browser.photos[pageIndex - 1]
if previousPhoto.underlyingImage == nil {
previousPhoto.loadUnderlyingImageAndNotify()
}
}
// Next
if pageIndex < numberOfPhotos - 1 {
let nextPhoto = browser.photos[pageIndex + 1]
if nextPhoto.underlyingImage == nil {
nextPhoto.loadUnderlyingImageAndNotify()
}
}
}
}
func deleteImage() {
// index equals 0 because when we slide between photos delete button is hidden and user cannot to touch on delete button. And visible pages number equals 0
if numberOfPhotos > 0 {
visiblePages[0].captionView?.removeFromSuperview()
}
}
func animate(_ frame: CGRect) {
setContentOffset(CGPoint(x: frame.origin.x - sideMargin, y: 0), animated: true)
}
func updateFrame(_ bounds: CGRect, currentPageIndex: Int) {
var frame = bounds
frame.origin.x -= sideMargin
frame.size.width += (2 * sideMargin)
self.frame = frame
if visiblePages.count > 0 {
for page in visiblePages {
let pageIndex = page.tag - pageIndexTagOffset
page.frame = frameForPageAtIndex(pageIndex)
page.setMaxMinZoomScalesForCurrentBounds()
if page.captionView != nil {
page.captionView.frame = frameForCaptionView(page.captionView, index: pageIndex)
}
}
}
updateContentSize()
updateContentOffset(currentPageIndex)
}
func updateContentSize() {
contentSize = CGSize(width: bounds.size.width * CGFloat(numberOfPhotos), height: bounds.size.height)
}
func updateContentOffset(_ index: Int) {
let pageWidth = bounds.size.width
let newOffset = CGFloat(index) * pageWidth
contentOffset = CGPoint(x: newOffset, y: 0)
}
func tilePages() {
guard let browser = browser else { return }
let firstIndex: Int = getFirstIndex()
let lastIndex: Int = getLastIndex()
visiblePages
.filter({ $0.tag - pageIndexTagOffset < firstIndex || $0.tag - pageIndexTagOffset > lastIndex })
.forEach { page in
recycledPages.append(page)
page.prepareForReuse()
page.removeFromSuperview()
}
let visibleSet: Set<SKZoomingScrollView> = Set(visiblePages)
let visibleSetWithoutRecycled: Set<SKZoomingScrollView> = visibleSet.subtracting(recycledPages)
visiblePages = Array(visibleSetWithoutRecycled)
while recycledPages.count > 2 {
recycledPages.removeFirst()
}
for index: Int in firstIndex...lastIndex {
if visiblePages.filter({ $0.tag - pageIndexTagOffset == index }).count > 0 {
continue
}
let page: SKZoomingScrollView = SKZoomingScrollView(frame: frame, browser: browser)
page.frame = frameForPageAtIndex(index)
page.tag = index + pageIndexTagOffset
page.photo = browser.photos[index]
visiblePages.append(page)
addSubview(page)
// if exists caption, insert
if let captionView: SKCaptionView = createCaptionView(index) {
captionView.frame = frameForCaptionView(captionView, index: index)
captionView.alpha = browser.areControlsHidden() ? 0 : 1
addSubview(captionView)
// ref val for control
page.captionView = captionView
}
}
}
func frameForCaptionView(_ captionView: SKCaptionView, index: Int) -> CGRect {
let pageFrame = frameForPageAtIndex(index)
let captionSize = captionView.sizeThatFits(CGSize(width: pageFrame.size.width, height: 0))
let navHeight = browser?.navigationController?.navigationBar.frame.size.height ?? 44
return CGRect(x: pageFrame.origin.x, y: pageFrame.size.height - captionSize.height - navHeight,
width: pageFrame.size.width, height: captionSize.height)
}
func pageDisplayedAtIndex(_ index: Int) -> SKZoomingScrollView? {
for page in visiblePages where page.tag - pageIndexTagOffset == index {
return page
}
return nil
}
func pageDisplayingAtPhoto(_ photo: SKPhotoProtocol) -> SKZoomingScrollView? {
for page in visiblePages where page.photo === photo {
return page
}
return nil
}
func getCaptionViews() -> Set<SKCaptionView> {
var captionViews = Set<SKCaptionView>()
visiblePages
.filter({ $0.captionView != nil })
.forEach {
captionViews.insert($0.captionView)
}
return captionViews
}
}
private extension SKPagingScrollView {
func frameForPageAtIndex(_ index: Int) -> CGRect {
var pageFrame = bounds
pageFrame.size.width -= (2 * sideMargin)
pageFrame.origin.x = (bounds.size.width * CGFloat(index)) + sideMargin
return pageFrame
}
func createCaptionView(_ index: Int) -> SKCaptionView? {
guard let photo = browser?.photoAtIndex(index), photo.caption != nil else {
return nil
}
return SKCaptionView(photo: photo)
}
func getFirstIndex() -> Int {
let firstIndex = Int(floor((bounds.minX + sideMargin * 2) / bounds.width))
if firstIndex < 0 {
return 0
}
if firstIndex > numberOfPhotos - 1 {
return numberOfPhotos - 1
}
return firstIndex
}
func getLastIndex() -> Int {
let lastIndex = Int(floor((bounds.maxX - sideMargin * 2 - 1) / bounds.width))
if lastIndex < 0 {
return 0
}
if lastIndex > numberOfPhotos - 1 {
return numberOfPhotos - 1
}
return lastIndex
}
}
| apache-2.0 | 6a823a2ebdee4e5eb453965c46d69be9 | 33.056769 | 163 | 0.58687 | 5.40097 | false | false | false | false |
saagarjha/iina | iina/MPVPlaylistItem.swift | 3 | 802 | //
// MPVPlaylistItem.swift
// iina
//
// Created by lhc on 23/8/16.
// Copyright © 2016 lhc. All rights reserved.
//
import Cocoa
class MPVPlaylistItem: NSObject {
/** Actually this is the path. Use `filename` to conform mpv API's naming. */
var filename: String
/** Title or the real filename */
var filenameForDisplay: String {
return title ?? (isNetworkResource ? filename : NSString(string: filename).lastPathComponent)
}
var isCurrent: Bool
var isPlaying: Bool
var isNetworkResource: Bool
var title: String?
init(filename: String, isCurrent: Bool, isPlaying: Bool, title: String?) {
self.filename = filename
self.isCurrent = isCurrent
self.isPlaying = isPlaying
self.title = title
self.isNetworkResource = Regex.url.matches(filename)
}
}
| gpl-3.0 | de628d0daee415561acb471403a33c28 | 22.558824 | 97 | 0.695381 | 4.045455 | false | false | false | false |
radvansky-tomas/NutriFacts | nutri-facts/nutri-facts/Libraries/iOSCharts/Classes/Renderers/ChartRendererBase.swift | 6 | 1808 | //
// ChartRendererBase.swift
// Charts
//
// Created by Daniel Cohen Gindi on 3/3/15.
//
// Copyright 2015 Daniel Cohen Gindi & Philipp Jahoda
// A port of MPAndroidChart for iOS
// Licensed under Apache License 2.0
//
// https://github.com/danielgindi/ios-charts
//
import Foundation
import CoreGraphics.CGBase
public class ChartRendererBase: NSObject
{
/// the component that handles the drawing area of the chart and it's offsets
public var viewPortHandler: ChartViewPortHandler!;
/// the minimum value on the x-axis that should be plotted
internal var _minX: Int = 0;
/// the maximum value on the x-axis that should be plotted
internal var _maxX: Int = 0;
public override init()
{
super.init();
}
public init(viewPortHandler: ChartViewPortHandler)
{
super.init();
self.viewPortHandler = viewPortHandler;
}
/// Returns true if the specified value fits in between the provided min and max bounds, false if not.
internal func fitsBounds(val: Float, min: Float, max: Float) -> Bool
{
if (val < min || val > max)
{
return false;
}
else
{
return true;
}
}
/// Calculates the minimum and maximum x-value the chart can currently display (with the given zoom level).
public func calcXBounds(#chart: BarLineChartViewBase, xAxisModulus: Int)
{
let low = chart.lowestVisibleXIndex;
let high = chart.highestVisibleXIndex;
let subLow = (low % xAxisModulus == 0) ? xAxisModulus : 0;
_minX = max((low / xAxisModulus) * (xAxisModulus) - subLow, 0);
_maxX = min((high / xAxisModulus) * (xAxisModulus) + xAxisModulus, Int(chart.chartXMax));
}
}
| gpl-2.0 | 8a5356e97af73ebf9211f65378fddb62 | 27.265625 | 111 | 0.624447 | 4.464198 | false | false | false | false |
lsonlee/Swift_MVVM | Swift_Project/Pods/NVActivityIndicatorView/NVActivityIndicatorView/Animations/NVActivityIndicatorAnimationBallZigZag.swift | 2 | 3537 | //
// NVActivityIndicatorAnimationBallZigZag.swift
// NVActivityIndicatorViewDemo
//
// The MIT License (MIT)
// Copyright (c) 2016 Vinh Nguyen
// Permission is hereby granted, free of charge, to any person obtaining a copy
// of this software and associated documentation files (the "Software"), to deal
// in the Software without restriction, including without limitation the rights
// to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
// copies of the Software, and to permit persons to whom the Software is
// furnished to do so, subject to the following conditions:
// The above copyright notice and this permission notice shall be included in all
// copies or substantial portions of the Software.
// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
// IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
// FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
// AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
// LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
// OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
// SOFTWARE.
//
import UIKit
import QuartzCore
class NVActivityIndicatorAnimationBallZigZag: NVActivityIndicatorAnimationDelegate {
func setUpAnimation(in layer: CALayer, size: CGSize, color: UIColor) {
let circleSize: CGFloat = size.width / 5
let duration: CFTimeInterval = 0.7
let deltaX = size.width / 2 - circleSize / 2
let deltaY = size.height / 2 - circleSize / 2
let frame = CGRect(x: (layer.bounds.size.width - circleSize) / 2, y: (layer.bounds.size.height - circleSize) / 2, width: circleSize, height: circleSize)
// Circle 1 animation
let animation = CAKeyframeAnimation(keyPath: "transform")
animation.keyTimes = [0.0, 0.33, 0.66, 1.0]
animation.timingFunction = CAMediaTimingFunction(name: kCAMediaTimingFunctionLinear)
animation.values = [
NSValue(caTransform3D: CATransform3DMakeTranslation(0, 0, 0)),
NSValue(caTransform3D: CATransform3DMakeTranslation(-deltaX, -deltaY, 0)),
NSValue(caTransform3D: CATransform3DMakeTranslation(deltaX, -deltaY, 0)),
NSValue(caTransform3D: CATransform3DMakeTranslation(0, 0, 0)),
]
animation.duration = duration
animation.repeatCount = HUGE
animation.isRemovedOnCompletion = false
// Draw circle 1
circleAt(frame: frame, layer: layer, size: CGSize(width: circleSize, height: circleSize), color: color, animation: animation)
// Circle 2 animation
animation.values = [
NSValue(caTransform3D: CATransform3DMakeTranslation(0, 0, 0)),
NSValue(caTransform3D: CATransform3DMakeTranslation(deltaX, deltaY, 0)),
NSValue(caTransform3D: CATransform3DMakeTranslation(-deltaX, deltaY, 0)),
NSValue(caTransform3D: CATransform3DMakeTranslation(0, 0, 0)),
]
// Draw circle 2
circleAt(frame: frame, layer: layer, size: CGSize(width: circleSize, height: circleSize), color: color, animation: animation)
}
func circleAt(frame: CGRect, layer: CALayer, size: CGSize, color: UIColor, animation: CAAnimation) {
let circle = NVActivityIndicatorShape.circle.layerWith(size: size, color: color)
circle.frame = frame
circle.add(animation, forKey: "animation")
layer.addSublayer(circle)
}
}
| mit | c0adfd6fba23cc4ec1a8903509091e44 | 44.346154 | 160 | 0.706248 | 4.666227 | false | false | false | false |
cho15255/PaintWithMetal | PaintWithMetal/JHViewController+Renderer.swift | 1 | 3259 | //
// JHViewController+Renderer.swift
// PaintWithMetal
//
// Created by Jae Hee Cho on 2015-11-29.
// Copyright © 2015 Jae Hee Cho. All rights reserved.
//
import Foundation
import UIKit
import Metal
extension JHViewController {
func render() {
if let drawable = self.metalLayer.nextDrawable() {
if self.bufferCleared <= 3 {
self.renderPassDescriptor = MTLRenderPassDescriptor()
self.renderPassDescriptor.colorAttachments[0].loadAction = .Clear
self.renderPassDescriptor.colorAttachments[0].clearColor = MTLClearColorMake(0.9, 0.9, 0.9, 1)
self.renderPassDescriptor.colorAttachments[0].storeAction = .Store
self.bufferCleared += 1
} else {
self.renderPassDescriptor.colorAttachments[0].loadAction = .Load
}
self.renderPassDescriptor.colorAttachments[0].texture = drawable.texture
if self.vertexData.count <= 0 {
let commandBuffer = self.commandQueue.commandBuffer()
let renderEncoderOpt:MTLRenderCommandEncoder? = commandBuffer.renderCommandEncoderWithDescriptor(self.renderPassDescriptor)
if let renderEncoder = renderEncoderOpt {
renderEncoder.setRenderPipelineState(self.pipelineState)
renderEncoder.endEncoding()
}
commandBuffer.presentDrawable(drawable)
commandBuffer.commit()
} else {
let commandBuffer = self.commandQueue.commandBuffer()
let renderEncoderOpt:MTLRenderCommandEncoder? = commandBuffer.renderCommandEncoderWithDescriptor(self.renderPassDescriptor)
if let renderEncoder = renderEncoderOpt {
renderEncoder.setRenderPipelineState(self.pipelineState)
renderEncoder.setVertexBuffer(self.vertexBuffer, offset: 0, atIndex: 0)
renderEncoder.setVertexBuffer(self.colorBuffer, offset: 0, atIndex: 1)
if self.vertexData.count > 0 {
renderEncoder.drawPrimitives(.TriangleStrip, vertexStart: 0, vertexCount: self.vertexData.count/4, instanceCount: 3)
}
renderEncoder.endEncoding()
}
if self.vertexData.count > 800 {
self.vertexData.removeFirst(400)
}
if self.colorData.count > 800 {
self.colorData.removeFirst(400)
}
if self.didTouchEnded < 3 {
self.didTouchEnded += 1
} else {
self.vertexData = []
self.colorData = []
self.prevVertex = nil
}
commandBuffer.presentDrawable(drawable)
commandBuffer.commit()
}
}
}
func gameLoop() {
autoreleasepool {
self.render()
}
}
}
| mit | 0dddc1e34819156260e27a6590009788 | 37.329412 | 140 | 0.537139 | 6.229446 | false | false | false | false |
DigitalRogues/SwiftNotes | SwiftNotes/LeftMenuViewController.swift | 1 | 3781 | //
// LeftMenuViewController.swift
// SSASideMenuExample
//
// Created by Sebastian Andersen on 20/10/14.
// Copyright (c) 2014 Sebastian Andersen. All rights reserved.
//
import Foundation
import UIKit
////I think we'll have to use the app delegate as a central point so the viewcontrollers arent reinited each time they are called. its a bad thing to do but I dont know of a better way
// let view = appDelegate.rootView
class LeftMenuViewController: UIViewController {
var appDelegate = UIApplication.sharedApplication().delegate as! AppDelegate
lazy var tableView: UITableView = {
let tableView = UITableView()
tableView.delegate = self
tableView.dataSource = self
tableView.separatorStyle = .None
tableView.frame = CGRectMake(20, (self.view.frame.size.height - 54 * 5) / 2.0, self.view.frame.size.width, 54 * 5)
tableView.autoresizingMask = .FlexibleTopMargin | .FlexibleBottomMargin | .FlexibleWidth
tableView.registerClass(UITableViewCell.self, forCellReuseIdentifier: "cell")
tableView.opaque = false
tableView.backgroundColor = UIColor.clearColor()
tableView.backgroundView = nil
tableView.bounces = false
return tableView
}()
override func viewDidAppear(animated: Bool) {
super.viewDidAppear(animated)
}
override func viewDidLoad() {
super.viewDidLoad()
view.addSubview(tableView)
}
override func didReceiveMemoryWarning() {
super.didReceiveMemoryWarning()
// Dispose of any resources that can be recreated.
}
}
// MARK : TableViewDataSource & Delegate Methods
extension LeftMenuViewController: UITableViewDelegate, UITableViewDataSource {
func tableView(tableView: UITableView, numberOfRowsInSection section: Int) -> Int {
return 5
}
func tableView(tableView: UITableView, heightForRowAtIndexPath indexPath: NSIndexPath) -> CGFloat {
return 54
}
func tableView(tableView: UITableView, cellForRowAtIndexPath indexPath: NSIndexPath) -> UITableViewCell {
let cell = tableView.dequeueReusableCellWithIdentifier("cell", forIndexPath: indexPath) as! UITableViewCell
let titles: [String] = ["Notes List", "Add Note", "Profile", "Settings", "Log Out"]
let images: [String] = ["IconHome", "IconCalendar", "IconProfile", "IconSettings", "IconEmpty"]
cell.backgroundColor = UIColor.clearColor()
cell.textLabel?.font = UIFont(name: "HelveticaNeue", size: 21)
cell.textLabel?.textColor = UIColor.blackColor()
cell.textLabel?.text = titles[indexPath.row]
cell.selectionStyle = .None
cell.imageView?.image = UIImage(named: images[indexPath.row])
return cell
}
func tableView(tableView: UITableView, didSelectRowAtIndexPath indexPath: NSIndexPath) {
tableView.deselectRowAtIndexPath(indexPath, animated: true)
switch indexPath.row {
case 0:
//Notes
let view = appDelegate.sb.instantiateViewControllerWithIdentifier("noteListView") as! UIViewController
sideMenuViewController?.contentViewController = view
sideMenuViewController?.hideMenuViewController()
break
case 1:
//note input view
let view = appDelegate.noteInputView as UIViewController
sideMenuViewController?.contentViewController = view
sideMenuViewController?.hideMenuViewController()
break
default:
break
}
}
}
| mit | 07d7de10f4830fd3d1686d727bd30a7f | 32.175439 | 184 | 0.647183 | 5.71148 | false | false | false | false |
skedgo/tripkit-ios | Sources/TripKit/vendor/ASPolygonKit/CLLocationCoordinate2D+EncodePolylineString.swift | 1 | 2444 | //
// CLLocationCoordinate2D+EncodePolylineString.swift
//
//
// Created by Adrian Schönig on 5/11/21.
//
import Foundation
extension Polygon {
/// This function encodes an `Polygon` to a `String`
///
/// - parameter precision: The precision used to encode coordinates (default: `1e5`)
///
/// - returns: A `String` representing the encoded Polyline
func encodeCoordinates(precision: Double = 1e5) -> String {
var previousCoordinate = IntegerCoordinates(0, 0)
var encodedPolyline = ""
for coordinate in points {
let intLatitude = Int(round(coordinate.lat * precision))
let intLongitude = Int(round(coordinate.lng * precision))
let coordinatesDifference = (intLatitude - previousCoordinate.latitude, intLongitude - previousCoordinate.longitude)
encodedPolyline += Self.encodeCoordinate(coordinatesDifference)
previousCoordinate = (intLatitude,intLongitude)
}
return encodedPolyline
}
// MARK: - Private -
// MARK: Encode Coordinate
private static func encodeCoordinate(_ locationCoordinate: IntegerCoordinates) -> String {
let latitudeString = encodeSingleComponent(locationCoordinate.latitude)
let longitudeString = encodeSingleComponent(locationCoordinate.longitude)
return latitudeString + longitudeString
}
private static func encodeSingleComponent(_ value: Int) -> String {
var intValue = value
if intValue < 0 {
intValue = intValue << 1
intValue = ~intValue
} else {
intValue = intValue << 1
}
return encodeFiveBitComponents(intValue)
}
// MARK: Encode Levels
private static func encodeLevel(_ level: UInt32) -> String {
return encodeFiveBitComponents(Int(level))
}
private static func encodeFiveBitComponents(_ value: Int) -> String {
var remainingComponents = value
var fiveBitComponent = 0
var returnString = String()
repeat {
fiveBitComponent = remainingComponents & 0x1F
if remainingComponents >= 0x20 {
fiveBitComponent |= 0x20
}
fiveBitComponent += 63
let char = UnicodeScalar(fiveBitComponent)!
returnString.append(String(char))
remainingComponents = remainingComponents >> 5
} while (remainingComponents != 0)
return returnString
}
private typealias IntegerCoordinates = (latitude: Int, longitude: Int)
}
| apache-2.0 | a43d060d2413536641149fb74cd867f3 | 26.761364 | 122 | 0.677855 | 4.945344 | false | false | false | false |
ethanneff/organize | Organize/IntroNavigationController.swift | 1 | 1103 | import UIKit
import Firebase
class IntroNavigationController: UINavigationController {
override func loadView() {
super.loadView()
navigationBar.hidden = true
pushViewController(IntroViewController(), animated: true)
}
override func viewDidAppear(animated: Bool) {
super.viewDidAppear(animated)
determineController()
}
private func determineController() {
Notebook.get { data in
if data == nil {
Remote.Auth.signOut()
}
Util.delay(Constant.App.loadingDelay) {
if let _ = Remote.Auth.user {
self.displayController(navController: MenuNavigationController())
} else {
self.displayController(navController: AccessNavigationController())
}
}
}
}
private func displayController(navController navController: UINavigationController) {
navController.modalTransitionStyle = .CrossDissolve
presentViewController(navController, animated: true, completion: nil)
}
override func preferredStatusBarStyle() -> UIStatusBarStyle {
return UIStatusBarStyle.LightContent
}
}
| mit | bbd8cc40924e4f868b648b597ffb2831 | 27.282051 | 87 | 0.703536 | 5.433498 | false | false | false | false |
RxSwiftCommunity/RxSwiftExt | Playground/RxSwiftExtPlayground.playground/Pages/UIScrollView.reachedBottom.xcplaygroundpage/Contents.swift | 2 | 1781 | /*:
> # IMPORTANT: To use `RxSwiftExtPlayground.playground`, please:
1. Make sure you have [Carthage](https://github.com/Carthage/Carthage) installed
1. Fetch Carthage dependencies from shell: `carthage bootstrap --platform ios`
1. Build scheme `RxSwiftExtPlayground` scheme for a simulator target
1. Choose `View > Show Debug Area`
*/
//: [Previous](@previous)
import RxSwift
import RxCocoa
import RxSwiftExt
import PlaygroundSupport
import UIKit
/*:
## reachedBottom
`reachedBottom` provides a sequence that emits every time the `UIScrollView` is scrolled to the bottom, with an optional offset.
Please open the Assistant Editor (⌘⌥⏎) to see the Interactive Live View example.
*/
final class ReachedBottomViewController: UITableViewController {
private let dataSource = Array(stride(from: 0, to: 28, by: 1))
private let identifier = "identifier"
private let disposeBag = DisposeBag()
override func viewDidLoad() {
super.viewDidLoad()
tableView.register(UITableViewCell.self, forCellReuseIdentifier: identifier)
tableView.rx.reachedBottom(offset: 40)
.subscribe { print("Reached bottom") }
.disposed(by: disposeBag)
}
override func tableView(_ tableView: UITableView, numberOfRowsInSection section: Int) -> Int {
return dataSource.count
}
override func tableView(_ tableView: UITableView, cellForRowAt indexPath: IndexPath) -> UITableViewCell {
let cell = tableView.dequeueReusableCell(withIdentifier: identifier, for: indexPath)
cell.textLabel?.text = "\(dataSource[indexPath.row])"
return cell
}
}
// Present the view controller in the Live View window
PlaygroundPage.current.liveView = ReachedBottomViewController()
//: [Next](@next)
| mit | b32575175d3a0399f79915b42222a7c5 | 33.134615 | 129 | 0.72338 | 4.771505 | false | false | false | false |
HabitRPG/habitrpg-ios | HabitRPG/Utilities/NotificationManager.swift | 1 | 6613 | //
// NotificationManager.swift
// Habitica
//
// Created by Phillip Thelen on 24.06.20.
// Copyright © 2020 HabitRPG Inc. All rights reserved.
//
import Foundation
import Habitica_Models
import FirebaseAnalytics
class NotificationManager {
private static var seenNotifications = Set<String>()
private static let configRepository = ConfigRepository()
private static let userRepository = UserRepository()
static func handle(notifications: [NotificationProtocol]) -> [NotificationProtocol] {
notifications.filter { notification in
return NotificationManager.seenNotifications.contains(notification.id) != true
}.forEach { notification in
var notificationDisplayed: Bool? = false
switch notification.type {
case HabiticaNotificationType.achievementPartyUp, HabiticaNotificationType.achievementPartyOn,
HabiticaNotificationType.achievementBeastMaster,
HabiticaNotificationType.achievementTriadBingo,
HabiticaNotificationType.achievementGuildJoined,
HabiticaNotificationType.achievementMountMaster,
HabiticaNotificationType.achievementInvitedFriend,
HabiticaNotificationType.achievementChallengeJoined,
HabiticaNotificationType.achievementOnboardingComplete:
notificationDisplayed = NotificationManager.displayAchievement(notification: notification, isOnboarding: false, isLastOnboardingAchievement: false)
case HabiticaNotificationType.achievementGeneric:
notificationDisplayed = NotificationManager.displayAchievement(notification: notification, isOnboarding: true, isLastOnboardingAchievement: notifications.contains {
return $0.type == HabiticaNotificationType.achievementOnboardingComplete
})
case HabiticaNotificationType.firstDrop:
notificationDisplayed = NotificationManager.displayFirstDrop(notification: notification)
default:
notificationDisplayed = false
}
if notificationDisplayed == true {
NotificationManager.seenNotifications.insert(notification.id)
}
}
return notifications.filter {
return !seenNotifications.contains($0.id)
}
}
static func displayFirstDrop(notification: NotificationProtocol) -> Bool {
guard let firstDropNotification = notification as? NotificationFirstDropProtocol else {
return true
}
userRepository.retrieveUser().observeCompleted {}
userRepository.readNotification(notification: notification).observeCompleted {}
let alert = HabiticaAlertController(title: L10n.firstDropTitle)
let stackView = UIStackView()
stackView.axis = .vertical
stackView.alignment = .center
stackView.spacing = 12
let iconStackView = UIStackView()
iconStackView.axis = .horizontal
iconStackView.spacing = 16
let eggView = NetworkImageView()
eggView.setImagewith(name: "Pet_Egg_\(firstDropNotification.egg ?? "")")
eggView.backgroundColor = ThemeService.shared.theme.windowBackgroundColor
eggView.cornerRadius = 4
eggView.contentMode = .center
iconStackView.addArrangedSubview(eggView)
eggView.addWidthConstraint(width: 80)
let potionView = NetworkImageView()
potionView.setImagewith(name: "Pet_HatchingPotion_\(firstDropNotification.hatchingPotion ?? "")")
potionView.backgroundColor = ThemeService.shared.theme.windowBackgroundColor
potionView.cornerRadius = 4
potionView.contentMode = .center
iconStackView.addArrangedSubview(potionView)
potionView.addWidthConstraint(width: 80)
stackView.addArrangedSubview(iconStackView)
iconStackView.addHeightConstraint(height: 80)
let firstLabel = UILabel()
firstLabel.text = L10n.firstDropExplanation1
firstLabel.textColor = ThemeService.shared.theme.ternaryTextColor
firstLabel.font = .systemFont(ofSize: 14)
firstLabel.textAlignment = .center
firstLabel.numberOfLines = 0
stackView.addArrangedSubview(firstLabel)
let firstSize = firstLabel.sizeThatFits(CGSize(width: 240, height: 600))
firstLabel.addHeightConstraint(height: firstSize.height)
let secondLabel = UILabel()
secondLabel.text = L10n.firstDropExplanation2
secondLabel.textColor = ThemeService.shared.theme.secondaryTextColor
secondLabel.font = .systemFont(ofSize: 14)
secondLabel.textAlignment = .center
secondLabel.numberOfLines = 0
stackView.addArrangedSubview(secondLabel)
let size = secondLabel.sizeThatFits(CGSize(width: 240, height: 600))
secondLabel.addHeightConstraint(height: size.height)
alert.contentView = stackView
alert.addAction(title: L10n.goToItems, isMainAction: true) { _ in
DispatchQueue.main.asyncAfter(deadline: .now() + 0.2) {
RouterHandler.shared.handle(urlString: "/inventory/items")
}
}
alert.addCloseAction()
alert.enqueue()
return true
}
static func displayAchievement(notification: NotificationProtocol, isOnboarding: Bool, isLastOnboardingAchievement: Bool) -> Bool {
userRepository.retrieveUser().observeCompleted {}
userRepository.readNotification(notification: notification).observeCompleted {}
if !configRepository.bool(variable: .enableAdventureGuide) {
if isOnboarding || notification.type == HabiticaNotificationType.achievementOnboardingComplete {
return true
}
}
if isOnboarding {
Analytics.logEvent(notification.achievementKey ?? "", parameters: nil)
}
if notification.type == HabiticaNotificationType.achievementOnboardingComplete {
Analytics.logEvent(notification.type.rawValue, parameters: nil)
Analytics.setUserProperty("true", forName: "completedOnboarding")
}
let alert = AchievementAlertController()
alert.setNotification(notification: notification, isOnboarding: isOnboarding, isLastOnboardingAchievement: isLastOnboardingAchievement)
DispatchQueue.main.asyncAfter(deadline: .now() + 0.8) {
// add a slight delay to make sure that any running VC transitions are done
alert.enqueue()
}
return true
}
}
| gpl-3.0 | a7b90c42f777499d593c35a31be27878 | 47.977778 | 180 | 0.691621 | 5.98913 | false | false | false | false |
ZeeQL/ZeeQL3 | Sources/ZeeQL/Access/AdaptorChannelPool.swift | 1 | 7414 | //
// AdaptorChannelPool.swift
// ZeeQL3
//
// Copyright © 2018-2020 ZeeZide GmbH. All rights reserved.
//
import Foundation
public protocol AdaptorChannelPool {
func grab() -> AdaptorChannel?
func add(_ channel: AdaptorChannel)
}
// Those are not great, but OKayish.
// The expiration queue probably forks an own thread.
/**
* A naive pool which keeps open just a single connection.
*
* Usage:
*
* private var pool = SingleConnectionPool(maxAge: 10)
*
* open func openChannelFromPool() throws -> AdaptorChannel {
* return pool.grab() ?? (try openChannel())
* }
*
* open func releaseChannel(_ channel: AdaptorChannel) {
* guard let pgChannel = channel as? PostgreSQLAdaptorChannel else {
* assertionFailure("unexpected channel type!")
* return
* }
* guard pgChannel.handle != nil else { return } // closed
*
* pool.add(pgChannel)
* }
*
*/
public final class SingleConnectionPool: AdaptorChannelPool {
struct Entry {
let releaseDate : Date
let connection : AdaptorChannel
var age : TimeInterval { return -(releaseDate.timeIntervalSinceNow) }
}
private let maxAge : TimeInterval
private let lock = NSLock()
private let expirationQueue = DispatchQueue(label: "de.zeezide.zeeql.expire")
private var entry : Entry? // here we just pool one :-)
private var gc : DispatchWorkItem?
public init(maxAge: TimeInterval) {
self.maxAge = maxAge
assert(maxAge > 0)
}
public func grab() -> AdaptorChannel? {
lock.lock(); defer { entry = nil; lock.unlock() }
return entry?.connection
}
public func add(_ channel: AdaptorChannel) {
guard !channel.isTransactionInProgress else {
globalZeeQLLogger.warn("releasing a channel w/ an open TX:", channel)
do {
try channel.rollback()
}
catch {
globalZeeQLLogger.warn("failed to rollback TX in released channel:",
error)
}
return // do not pool such
}
lock.lock()
let doAdd = entry == nil
if doAdd {
entry = Entry(releaseDate: Date(), connection: channel)
}
lock.unlock()
if doAdd {
globalZeeQLLogger.info("adding channel to pool:", channel)
}
else {
globalZeeQLLogger.info("did not add channel to pool:", channel)
}
expirationQueue.async {
if self.gc != nil { return } // already running
self.gc = DispatchWorkItem(block: self.expire)
self.expirationQueue.asyncAfter(deadline: .now() + .seconds(1),
execute: self.gc!)
}
}
private func expire() {
let rerun : Bool
do {
lock.lock(); defer { lock.unlock() }
if let entry = entry {
rerun = entry.age > maxAge
if !rerun { self.entry = nil }
}
else { rerun = false }
}
if rerun {
gc = DispatchWorkItem(block: self.expire)
expirationQueue.asyncAfter(deadline: .now() + .seconds(1),
execute: gc!)
}
else {
gc = nil
}
}
}
/**
* A naive pool which keeps open a number of connections.
*
* Usage:
*
* private var pool = SimpleAdaptorChannelPool(maxAge: 10)
*
* open func openChannelFromPool() throws -> AdaptorChannel {
* return pool.grab() ?? (try openChannel())
* }
*
* open func releaseChannel(_ channel: AdaptorChannel) {
* guard let pgChannel = channel as? PostgreSQLAdaptorChannel else {
* assertionFailure("unexpected channel type!")
* return
* }
* guard pgChannel.handle != nil else { return } // closed
* pool.add(pgChannel)
* }
*
*/
public final class SimpleAdaptorChannelPool: AdaptorChannelPool {
struct Entry {
let releaseDate : Date
let connection : AdaptorChannel
var age : TimeInterval { return -(releaseDate.timeIntervalSinceNow) }
}
private let maxSize : Int
private let maxAge : TimeInterval
private let lock = NSLock()
private let expirationQueue = DispatchQueue(label: "de.zeezide.zeeql.expire")
private var entries = [ Entry ]()
private var gc : DispatchWorkItem?
public init(maxSize: Int, maxAge: TimeInterval) {
assert(maxSize >= 0)
assert(maxSize > 0 && maxSize < 128) // weird size
assert(maxAge > 0)
self.maxSize = max(0, maxSize)
self.maxAge = maxAge
}
public func grab() -> AdaptorChannel? {
lock.lock()
let entry = entries.popLast()
lock.unlock()
return entry?.connection
}
public func add(_ channel: AdaptorChannel) {
guard !channel.isTransactionInProgress else {
globalZeeQLLogger.warn("release a channel w/ an open TX:", channel)
assertionFailure("releasing a channel w/ an open TX")
do {
try channel.rollback()
}
catch {
globalZeeQLLogger.warn("failed to rollback TX in released channel:",
error)
}
return // do not pool such
}
lock.lock()
let doAdd = entries.count < maxSize
if doAdd {
let entry = Entry(releaseDate: Date(), connection: channel)
entries.append(entry)
}
lock.unlock()
if doAdd {
globalZeeQLLogger.info("adding channel to pool:", channel)
}
else {
globalZeeQLLogger.info("did not add channel to pool:", channel)
}
expirationQueue.async {
if self.gc != nil { return } // already running
let now = Date()
self.lock.lock()
let hasContent = !self.entries.isEmpty
let maxAge = self.entries.reduce(0) {
max($0, -($1.releaseDate.timeIntervalSince(now)))
}
self.lock.unlock()
guard hasContent else { return } // no entries
if maxAge > self.maxAge {
return self.expire()
}
let left = self.maxAge - maxAge
self.gc = DispatchWorkItem(block: self.expire)
self.expirationQueue
.asyncAfter(deadline: .now() + .milliseconds(Int(left * 1000)),
execute: self.gc!)
}
}
private func expire() { // Q: expirationQueue
let rerun : Bool
var maxAge : TimeInterval = 0
var stats : ( expired: Int, alive: Int ) = ( 0, 0 )
do {
lock.lock(); defer { lock.unlock() }
let count = entries.count
if count > 0 {
let now = Date()
for ( idx, entry ) in entries.enumerated().reversed() {
let age = -(entry.releaseDate.timeIntervalSince(now))
if age >= self.maxAge {
entries.remove(at: idx)
stats.expired += 1
}
else {
maxAge = max(maxAge, age)
stats.alive += 1
}
}
rerun = !entries.isEmpty
}
else {
rerun = false
}
}
if stats.expired > 0 && stats.alive > 0 {
globalZeeQLLogger
.info("pool expired #\(stats.expired) alive #\(stats.alive)",
rerun ? "rerun" : "done")
}
if rerun {
let left = self.maxAge - maxAge
gc = DispatchWorkItem(block: self.expire)
expirationQueue
.asyncAfter(deadline: .now() + .milliseconds(Int(left * 1000)),
execute: self.gc!)
}
else {
gc = nil
}
}
}
| apache-2.0 | 416029b6dd418b5bb4d9f5e8bc74cdc6 | 25.956364 | 79 | 0.578443 | 4.370873 | false | false | false | false |
Sajjon/ViewComposer | Source/Classes/ViewStyle/UIView+ViewStyle/UIStackView+ViewStyle.swift | 1 | 1214 | //
// UIStackView+ViewStyle.swift
// ViewComposer
//
// Created by Alexander Cyon on 2017-06-15.
//
//
import Foundation
internal extension UIStackView {
func apply(_ style: ViewStyle) {
style.attributes.forEach {
switch $0 {
case .alignment(let alignment):
self.alignment = alignment
case .axis(let axis):
self.axis = axis
case .spacing(let spacing):
self.spacing = spacing
case .distribution(let distribution):
self.distribution = distribution
case .baselineRelative(let isBaselineRelativeArrangement):
self.isBaselineRelativeArrangement = isBaselineRelativeArrangement
case .marginsRelative(let isLayoutMarginsRelativeArrangement):
self.isLayoutMarginsRelativeArrangement = isLayoutMarginsRelativeArrangement
case .margin(let marginExpressible):
let margin = marginExpressible.margin
self.layoutMargins = margin.insets
self.isLayoutMarginsRelativeArrangement = margin.isRelative
default:
break
}
}
}
}
| mit | cc39c7b86ee0b60748b37a02ce3da0ee | 32.722222 | 92 | 0.60626 | 6.009901 | false | false | false | false |
hgani/ganilib-ios | glib/Classes/View/GBarButtonItem.swift | 1 | 735 | import SwiftIconFont
import UIKit
open class GBarButtonItem: UIBarButtonItem {
private var onClick: (() -> Void)?
public func onClick(_ command: @escaping () -> Void) -> Self {
onClick = command
target = self
action = #selector(performClick)
return self
}
@objc private func performClick() {
if let callback = self.onClick {
callback()
}
}
public func icon(_ icon: GIcon) -> Self {
super.icon(from: icon.font, code: icon.code, ofSize: 20)
return self
}
public func title(_ text: String) -> Self {
super.title = text
return self
}
public func end() {
// End chaining initialisation
}
}
| mit | ace6b19675edea965cd1b12d5f0b4bf1 | 21.272727 | 66 | 0.567347 | 4.454545 | false | false | false | false |
IdeasOnCanvas/Ashton | Sources/Ashton/CrossPlatformCompatibility.swift | 1 | 2078 | //
// CrossPlatformCompatibility.swift
// Ashton
//
// Created by Michael Schwarz on 11.12.17.
// Copyright © 2017 Michael Schwarz. All rights reserved.
//
#if os(iOS)
import UIKit
typealias Font = UIFont
typealias FontDescriptor = UIFontDescriptor
typealias FontDescriptorSymbolicTraits = UIFontDescriptor.SymbolicTraits
typealias Color = UIColor
extension UIFont {
class var cpFamilyNames: [String] { return UIFont.familyNames }
var cpFamilyName: String { return self.familyName }
class func cpFontNames(forFamilyName familyName: String) -> [String] {
return UIFont.fontNames(forFamilyName: familyName)
}
}
extension UIFontDescriptor {
var cpPostscriptName: String { return self.postscriptName }
}
extension NSAttributedString.Key {
static let superscript = NSAttributedString.Key(rawValue: "NSSuperScript")
}
extension FontDescriptor.FeatureKey {
static let selectorIdentifier = FontDescriptor.FeatureKey("CTFeatureSelectorIdentifier")
static let cpTypeIdentifier = FontDescriptor.FeatureKey("CTFeatureTypeIdentifier")
}
#elseif os(macOS)
import AppKit
typealias Font = NSFont
typealias FontDescriptor = NSFontDescriptor
typealias FontDescriptorSymbolicTraits = NSFontDescriptor.SymbolicTraits
typealias Color = NSColor
extension NSFont {
class var cpFamilyNames: [String] { return NSFontManager.shared.availableFontFamilies }
var cpFamilyName: String { return self.familyName ?? "" }
class func cpFontNames(forFamilyName familyName: String) -> [String] {
let fontManager = NSFontManager.shared
let availableMembers = fontManager.availableMembers(ofFontFamily: familyName)
return availableMembers?.compactMap { member in
let memberArray = member as Array<Any>
return memberArray.first as? String
} ?? []
}
}
extension NSFontDescriptor {
var cpPostscriptName: String { return self.postscriptName ?? "" }
}
extension FontDescriptor.FeatureKey {
static let cpTypeIdentifier = FontDescriptor.FeatureKey("CTFeatureTypeIdentifier")
}
#endif
| mit | 15f9cc93ed44fea6685e14db94109fc0 | 30.469697 | 92 | 0.755898 | 4.910165 | false | false | false | false |
markedwardmurray/Starlight | Starlight/Starlight/Controllers/LeftMenuTableViewController.swift | 1 | 1744 | //
// LeftMenuTableViewController.swift
// Starlight
//
// Created by Mark Murray on 12/2/16.
// Copyright © 2016 Mark Murray. All rights reserved.
//
import UIKit
class LeftMenuTableViewController: UITableViewController {
var mainRevealController: MainRevealViewController {
return self.revealViewController() as! MainRevealViewController
}
override var preferredStatusBarStyle: UIStatusBarStyle {
return .lightContent
}
override func viewDidLoad() {
super.viewDidLoad()
self.clearsSelectionOnViewWillAppear = false
}
override func viewWillAppear(_ animated: Bool) {
super.viewWillAppear(animated)
let row: Int = self.mainRevealController.revealIndex.rawValue
let indexPath = IndexPath(row: row, section: 0)
self.tableView.selectRow(at: indexPath, animated: false, scrollPosition: .top)
}
override func tableView(_ tableView: UITableView, willDisplay cell: UITableViewCell, forRowAt indexPath: IndexPath) {
let selectionColor = UIView() as UIView
selectionColor.layer.borderWidth = 1
selectionColor.layer.borderColor = UIColor.init(hex: "0000ff").cgColor
selectionColor.backgroundColor = UIColor.init(hex: "0000ff")
cell.selectedBackgroundView = selectionColor
}
override func tableView(_ tableView: UITableView, didSelectRowAt indexPath: IndexPath) {
switch indexPath.row {
case 0:
self.mainRevealController.pushUpcomingBillsTVC()
case 1:
self.mainRevealController.pushLegislatorsTVC()
case 2:
self.mainRevealController.pushAboutTVC()
default:
break
}
}
}
| mit | 5eafccf4281068569ebb1fd93d45768a | 31.277778 | 121 | 0.677567 | 5.1875 | false | false | false | false |
apple/swift-corelibs-foundation | Sources/Foundation/Port.swift | 1 | 45670 | // This source file is part of the Swift.org open source project
//
// Copyright (c) 2014 - 2016 Apple Inc. and the Swift project authors
// Licensed under Apache License v2.0 with Runtime Library Exception
//
// See http://swift.org/LICENSE.txt for license information
// See http://swift.org/CONTRIBUTORS.txt for the list of Swift project authors
//
@_implementationOnly import CoreFoundation
// MARK: Port and related types
public typealias SocketNativeHandle = Int32
extension Port {
public static let didBecomeInvalidNotification = NSNotification.Name(rawValue: "NSPortDidBecomeInvalidNotification")
}
open class Port : NSObject, NSCopying {
@available(*, deprecated, message: "On Darwin, you can invoke Port() directly to produce a MessagePort. Since MessagePort's functionality is not available in swift-corelibs-foundation, you should not invoke this initializer directly. Subclasses of Port can delegate to this initializer safely.")
public override init() {
if type(of: self) == Port.self {
NSRequiresConcreteImplementation()
}
}
open func copy(with zone: NSZone? = nil) -> Any {
return self
}
open func invalidate() {
NSRequiresConcreteImplementation()
}
open var isValid: Bool {
NSRequiresConcreteImplementation()
}
open func setDelegate(_ anObject: PortDelegate?) {
NSRequiresConcreteImplementation()
}
open func delegate() -> PortDelegate? {
NSRequiresConcreteImplementation()
}
// These two methods should be implemented by subclasses
// to setup monitoring of the port when added to a run loop,
// and stop monitoring if needed when removed;
// These methods should not be called directly!
open func schedule(in runLoop: RunLoop, forMode mode: RunLoop.Mode) {
NSRequiresConcreteImplementation()
}
open func remove(from runLoop: RunLoop, forMode mode: RunLoop.Mode) {
NSRequiresConcreteImplementation()
}
open var reservedSpaceLength: Int {
return 0
}
open func send(before limitDate: Date, components: NSMutableArray?, from receivePort: Port?, reserved headerSpaceReserved: Int) -> Bool {
NSRequiresConcreteImplementation()
}
open func send(before limitDate: Date, msgid msgID: Int, components: NSMutableArray?, from receivePort: Port?, reserved headerSpaceReserved: Int) -> Bool {
return send(before: limitDate, components: components, from: receivePort, reserved: headerSpaceReserved)
}
}
@available(*, unavailable, message: "MessagePort is not available in swift-corelibs-foundation.")
open class MessagePort: Port {}
@available(*, unavailable, message: "NSMachPort is not available in swift-corelibs-foundation.")
open class NSMachPort: Port {}
extension PortDelegate {
func handle(_ message: PortMessage) { }
}
public protocol PortDelegate: AnyObject {
func handle(_ message: PortMessage)
}
#if canImport(Glibc) && !os(Android) && !os(OpenBSD)
import Glibc
fileprivate let SOCK_STREAM = Int32(Glibc.SOCK_STREAM.rawValue)
fileprivate let SOCK_DGRAM = Int32(Glibc.SOCK_DGRAM.rawValue)
fileprivate let IPPROTO_TCP = Int32(Glibc.IPPROTO_TCP)
#endif
#if canImport(Glibc) && os(Android) || os(OpenBSD)
import Glibc
fileprivate let SOCK_STREAM = Int32(Glibc.SOCK_STREAM)
fileprivate let SOCK_DGRAM = Int32(Glibc.SOCK_DGRAM)
fileprivate let IPPROTO_TCP = Int32(Glibc.IPPROTO_TCP)
fileprivate let INADDR_ANY: in_addr_t = 0
#if os(OpenBSD)
fileprivate let INADDR_LOOPBACK = 0x7f000001
#endif
#endif
#if canImport(WinSDK)
import WinSDK
/*
// https://docs.microsoft.com/en-us/windows/win32/api/winsock/ns-winsock-sockaddr_in
typedef struct sockaddr_in {
short sin_family;
u_short sin_port;
struct in_addr sin_addr;
char sin_zero[8];
} SOCKADDR_IN, *PSOCKADDR_IN, *LPSOCKADDR_IN;
*/
fileprivate typealias sa_family_t = ADDRESS_FAMILY
fileprivate typealias in_port_t = USHORT
fileprivate typealias in_addr_t = UInt32
fileprivate let IPPROTO_TCP = Int32(WinSDK.IPPROTO_TCP.rawValue)
#endif
// MARK: Darwin representation of socket addresses
/*
===== YOU ARE ABOUT TO ENTER THE SADNESS ZONE =====
SocketPort transmits ports by sending _Darwin_ sockaddr values serialized over the wire. (Yeah.)
This means that whatever the platform, we need to be able to send Darwin sockaddrs and figure them out on the other side of the wire.
Now, the vast majority of the intreresting ports that may be sent is AF_INET and AF_INET6 — other sockets aren't uncommon, but they are generally local to their host (eg. AF_UNIX). So, we make the following tactical choice:
- swift-corelibs-foundation clients across all platforms can interoperate between themselves and with Darwin as long as all the ports that are sent through SocketPort are AF_INET or AF_INET6;
- otherwise, it is the implementor and deployer's responsibility to make sure all the clients are on the same platform. For sockets that do not leave the machine, like AF_UNIX, this is trivial.
This allows us to special-case sockaddr_in and sockaddr_in6; when we transmit them, we will transmit them in a way that's binary-compatible with Darwin's version of those structure, and then we translate them into whatever version your platform uses, with the one exception that we assume that in_addr is always representable as 4 contiguous bytes, and similarly in6_addr as 16 contiguous bytes.
Addresses are internally represented as LocalAddress enum cases; we use DarwinAddress as a type to denote a block of bytes that we type as being a sockaddr produced by Darwin or a Darwin-mimicking source; and the extensions on sockaddr_in and sockaddr_in6 paper over some platform differences and provide translations back and forth into DarwinAddresses for their specific types.
Note that all address parameters and properties that are public are the data representation of a sockaddr generated starting from the current platform's sockaddrs, not a DarwinAddress. No code that's a client of SocketPort should be able to see the Darwin version of the data we generate internally.
*/
fileprivate let darwinAfInet: UInt8 = 2
fileprivate let darwinAfInet6: UInt8 = 30
fileprivate let darwinSockaddrInSize: UInt8 = 16
fileprivate let darwinSockaddrIn6Size: UInt8 = 28
fileprivate typealias DarwinIn6Addr =
(UInt8, UInt8, UInt8, UInt8, UInt8, UInt8, UInt8, UInt8,
UInt8, UInt8, UInt8, UInt8, UInt8, UInt8, UInt8, UInt8) // 16 contiguous bytes
fileprivate let darwinIn6AddrSize = 16
fileprivate extension sockaddr_in {
// Not all platforms have a sin_len field. This is like init(), but also sets that field if it exists.
init(settingLength: ()) {
self.init()
#if canImport(Darwin) || os(FreeBSD)
self.sin_len = UInt8(MemoryLayout<sockaddr_in>.size)
#endif
}
init?(_ address: DarwinAddress) {
let data = address.data
guard data.count == darwinSockaddrInSize,
data[offset: 0] == darwinSockaddrInSize,
data[offset: 1] == darwinAfInet else { return nil }
var port: UInt16 = 0
var inAddr: UInt32 = 0
data.withUnsafeBytes { (buffer) -> Void in
withUnsafeMutableBytes(of: &port) {
$0.copyMemory(from: UnsafeRawBufferPointer(rebasing: buffer[2..<4]))
}
withUnsafeMutableBytes(of: &inAddr) {
$0.copyMemory(from: UnsafeRawBufferPointer(rebasing: buffer[4..<8]))
}
}
self.init(settingLength: ())
self.sin_family = sa_family_t(AF_INET)
self.sin_port = in_port_t(port)
withUnsafeMutableBytes(of: &self.sin_addr) { (buffer) in
withUnsafeBytes(of: inAddr) { buffer.copyMemory(from: $0) }
}
}
var darwinAddress: DarwinAddress {
var data = Data()
withUnsafeBytes(of: darwinSockaddrInSize) { data.append(contentsOf: $0) }
withUnsafeBytes(of: darwinAfInet) { data.append(contentsOf: $0) }
withUnsafeBytes(of: UInt16(sin_port)) { data.append(contentsOf: $0) }
withUnsafeBytes(of: sin_addr) { data.append(contentsOf: $0) }
let padding: (Int8, Int8, Int8, Int8, Int8, Int8, Int8, Int8) =
(0, 0, 0, 0, 0, 0, 0, 0)
withUnsafeBytes(of: padding) { data.append(contentsOf: $0) }
return DarwinAddress(data)
}
}
fileprivate extension sockaddr_in6 {
init(settingLength: ()) {
self.init()
#if canImport(Darwin) || os(FreeBSD)
self.sin6_len = UInt8(MemoryLayout<sockaddr_in6>.size)
#endif
}
init?(_ address: DarwinAddress) {
let data = address.data
guard data.count == darwinSockaddrIn6Size,
data[offset: 0] == darwinSockaddrIn6Size,
data[offset: 1] == darwinAfInet6 else { return nil }
var port: UInt16 = 0
var flowInfo: UInt32 = 0
var in6Addr: DarwinIn6Addr =
(0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0)
var scopeId: UInt32 = 0
data.withUnsafeBytes { (buffer) -> Void in
withUnsafeMutableBytes(of: &port) {
$0.copyMemory(from: UnsafeRawBufferPointer(rebasing: buffer[2..<4]))
}
withUnsafeMutableBytes(of: &flowInfo) {
$0.copyMemory(from: UnsafeRawBufferPointer(rebasing: buffer[4..<8]))
}
withUnsafeMutableBytes(of: &in6Addr) {
$0.copyMemory(from: UnsafeRawBufferPointer(rebasing: buffer[8..<24]))
}
withUnsafeMutableBytes(of: &scopeId) {
$0.copyMemory(from: UnsafeRawBufferPointer(rebasing: buffer[24..<28]))
}
}
self.init(settingLength: ())
self.sin6_family = sa_family_t(AF_INET6)
self.sin6_port = in_port_t(port)
#if os(Windows)
self.sin6_flowinfo = ULONG(flowInfo)
#else
self.sin6_flowinfo = flowInfo
#endif
withUnsafeMutableBytes(of: &self.sin6_addr) { (buffer) in
withUnsafeBytes(of: in6Addr) { buffer.copyMemory(from: $0) }
}
#if !os(Windows)
self.sin6_scope_id = scopeId
#endif
}
var darwinAddress: DarwinAddress {
var data = Data()
withUnsafeBytes(of: darwinSockaddrIn6Size) { data.append(contentsOf: $0) }
withUnsafeBytes(of: darwinAfInet6) { data.append(contentsOf: $0) }
withUnsafeBytes(of: UInt16(sin6_port)) { data.append(contentsOf: $0) }
withUnsafeBytes(of: UInt32(sin6_flowinfo)) { data.append(contentsOf: $0) }
withUnsafeBytes(of: sin6_addr) { data.append(contentsOf: $0) }
#if os(Windows)
withUnsafeBytes(of: UInt32(0)) { data.append(contentsOf: $0) }
#else
withUnsafeBytes(of: UInt32(sin6_scope_id)) { data.append(contentsOf: $0) }
#endif
return DarwinAddress(data)
}
}
enum LocalAddress: Hashable {
case ipv4(sockaddr_in)
case ipv6(sockaddr_in6)
case other(Data)
init(_ data: Data) {
if data.count == MemoryLayout<sockaddr_in>.size {
let sinAddr = data.withUnsafeBytes { $0.baseAddress!.load(as: sockaddr_in.self) }
if sinAddr.sin_family == sa_family_t(AF_INET) {
self = .ipv4(sinAddr)
return
}
}
if data.count == MemoryLayout<sockaddr_in6>.size {
let sinAddr = data.withUnsafeBytes { $0.baseAddress!.load(as: sockaddr_in6.self) }
if sinAddr.sin6_family == sa_family_t(AF_INET6) {
self = .ipv6(sinAddr)
return
}
}
self = .other(data)
}
init(_ darwinAddress: DarwinAddress) {
let data = Data(darwinAddress.data)
if data[offset: 1] == UInt8(AF_INET), let sinAddr = sockaddr_in(darwinAddress) {
self = .ipv4(sinAddr); return
}
if data[offset: 1] == UInt8(AF_INET6), let sinAddr = sockaddr_in6(darwinAddress) {
self = .ipv6(sinAddr); return
}
self = .other(darwinAddress.data)
}
var data: Data {
switch self {
case .ipv4(let sinAddr):
return withUnsafeBytes(of: sinAddr) { Data($0) }
case .ipv6(let sinAddr):
return withUnsafeBytes(of: sinAddr) { Data($0) }
case .other(let data):
return data
}
}
func hash(into hasher: inout Hasher) {
data.hash(into: &hasher)
}
static func ==(_ lhs: LocalAddress, _ rhs: LocalAddress) -> Bool {
return lhs.data == rhs.data
}
}
struct DarwinAddress: Hashable {
var data: Data
init(_ data: Data) {
self.data = data
}
init(_ localAddress: LocalAddress) {
switch localAddress {
case .ipv4(let sinAddr):
self = sinAddr.darwinAddress
case .ipv6(let sinAddr):
self = sinAddr.darwinAddress
case .other(let data):
self.data = data
}
}
}
// MARK: SocketPort
// A subclass of Port which can be used for remote
// message sending on all platforms.
fileprivate func __NSFireSocketAccept(_ socket: CFSocket?, _ type: CFSocketCallBackType, _ address: CFData?, _ data: UnsafeRawPointer?, _ info: UnsafeMutableRawPointer?) {
guard let nonoptionalInfo = info else {
return
}
let me = Unmanaged<SocketPort>.fromOpaque(nonoptionalInfo).takeUnretainedValue()
me.socketDidAccept(socket, type, address, data)
}
fileprivate func __NSFireSocketData(_ socket: CFSocket?, _ type: CFSocketCallBackType, _ address: CFData?, _ data: UnsafeRawPointer?, _ info: UnsafeMutableRawPointer?) {
guard let nonoptionalInfo = info else {
return
}
let me = Unmanaged<SocketPort>.fromOpaque(nonoptionalInfo).takeUnretainedValue()
me.socketDidReceiveData(socket, type, address, data)
}
fileprivate func __NSFireSocketDatagram(_ socket: CFSocket?, _ type: CFSocketCallBackType, _ address: CFData?, _ data: UnsafeRawPointer?, _ info: UnsafeMutableRawPointer?) {
guard let nonoptionalInfo = info else {
return
}
let me = Unmanaged<SocketPort>.fromOpaque(nonoptionalInfo).takeUnretainedValue()
me.socketDidReceiveDatagram(socket, type, address, data)
}
open class SocketPort : Port {
struct SocketKind: Hashable {
var protocolFamily: Int32
var socketType: Int32
var `protocol`: Int32
}
struct Signature: Hashable {
var address: LocalAddress
var protocolFamily: Int32
var socketType: Int32
var `protocol`: Int32
var socketKind: SocketKind {
get {
return SocketKind(protocolFamily: protocolFamily, socketType: socketType, protocol: `protocol`)
}
set {
self.protocolFamily = newValue.protocolFamily
self.socketType = newValue.socketType
self.protocol = newValue.protocol
}
}
var darwinCompatibleDataRepresentation: Data? {
var data = Data()
let address = DarwinAddress(self.address).data
guard let protocolFamilyByte = UInt8(exactly: protocolFamily),
let socketTypeByte = UInt8(exactly: socketType),
let protocolByte = UInt8(exactly: `protocol`),
let addressCountByte = UInt8(exactly: address.count) else {
return nil
}
// TODO: Fixup namelen in Unix socket name.
data.append(protocolFamilyByte)
data.append(socketTypeByte)
data.append(protocolByte)
data.append(addressCountByte)
data.append(contentsOf: address)
return data
}
init(address: LocalAddress, protocolFamily: Int32, socketType: Int32, protocol: Int32) {
self.address = address
self.protocolFamily = protocolFamily
self.socketType = socketType
self.protocol = `protocol`
}
init?(darwinCompatibleDataRepresentation data: Data) {
guard data.count > 3 else { return nil }
let addressCountByte = data[offset: 3]
guard data.count == addressCountByte + 4 else { return nil }
self.protocolFamily = Int32(data[offset: 0])
self.socketType = Int32(data[offset: 1])
self.protocol = Int32(data[offset: 2])
// data[3] is addressCountByte, handled above.
self.address = LocalAddress(DarwinAddress(data[offset: 4...]))
}
}
class Core {
fileprivate let isUniqued: Bool
fileprivate var signature: Signature!
fileprivate let lock = NSLock()
fileprivate var connectors: [Signature: CFSocket] = [:]
fileprivate var loops: [ObjectIdentifier: (runLoop: CFRunLoop, modes: Set<RunLoop.Mode>)] = [:]
fileprivate var receiver: CFSocket?
fileprivate var data: [ObjectIdentifier: Data] = [:]
init(isUniqued: Bool) { self.isUniqued = isUniqued }
}
private var core: Core!
public convenience override init() {
self.init(tcpPort: 0)!
}
public convenience init?(tcpPort port: UInt16) {
var address = sockaddr_in(settingLength: ())
address.sin_family = sa_family_t(AF_INET)
address.sin_port = in_port_t(port).bigEndian
withUnsafeMutableBytes(of: &address.sin_addr) { (buffer) in
withUnsafeBytes(of: in_addr_t(INADDR_ANY).bigEndian) { buffer.copyMemory(from: $0) }
}
let data = withUnsafeBytes(of: address) { Data($0) }
self.init(protocolFamily: PF_INET, socketType: SOCK_STREAM, protocol: IPPROTO_TCP, address: data)
}
private final func createNonuniquedCore(from socket: CFSocket, protocolFamily family: Int32, socketType type: Int32, protocol: Int32) {
self.core = Core(isUniqued: false)
let address = CFSocketCopyAddress(socket)._swiftObject
core.signature = Signature(address: LocalAddress(address), protocolFamily: family, socketType: type, protocol: `protocol`)
core.receiver = socket
}
public init?(protocolFamily family: Int32, socketType type: Int32, protocol: Int32, address: Data) {
super.init()
var context = CFSocketContext()
context.info = Unmanaged.passUnretained(self).toOpaque()
var s: CFSocket
if type == SOCK_STREAM {
s = CFSocketCreate(nil, family, type, `protocol`, CFOptionFlags(kCFSocketAcceptCallBack), __NSFireSocketAccept, &context)
} else {
s = CFSocketCreate(nil, family, type, `protocol`, CFOptionFlags(kCFSocketDataCallBack), __NSFireSocketDatagram, &context)
}
if CFSocketSetAddress(s, address._cfObject) != CFSocketError(0) {
return nil
}
createNonuniquedCore(from: s, protocolFamily: family, socketType: type, protocol: `protocol`)
}
public init?(protocolFamily family: Int32, socketType type: Int32, protocol: Int32, socket sock: SocketNativeHandle) {
super.init()
var context = CFSocketContext()
context.info = Unmanaged.passUnretained(self).toOpaque()
var s: CFSocket
if type == SOCK_STREAM {
s = CFSocketCreateWithNative(nil, CFSocketNativeHandle(sock), CFOptionFlags(kCFSocketAcceptCallBack), __NSFireSocketAccept, &context)
} else {
s = CFSocketCreateWithNative(nil, CFSocketNativeHandle(sock), CFOptionFlags(kCFSocketDataCallBack), __NSFireSocketDatagram, &context)
}
createNonuniquedCore(from: s, protocolFamily: family, socketType: type, protocol: `protocol`)
}
public convenience init?(remoteWithTCPPort port: UInt16, host hostName: String?) {
let host = Host(name: hostName?.isEmpty == true ? nil : hostName)
var addresses: [String] = hostName == nil ? [] : [hostName!]
addresses.append(contentsOf: host.addresses)
// Prefer IPv4 addresses, as Darwin does:
for address in addresses {
var inAddr = in_addr()
if inet_pton(AF_INET, address, &inAddr) == 1 {
var sinAddr = sockaddr_in(settingLength: ())
sinAddr.sin_family = sa_family_t(AF_INET)
sinAddr.sin_port = port.bigEndian
sinAddr.sin_addr = inAddr
let data = withUnsafeBytes(of: sinAddr) { Data($0) }
self.init(remoteWithProtocolFamily: PF_INET, socketType: SOCK_STREAM, protocol: IPPROTO_TCP, address: data)
return
}
}
for address in addresses {
var in6Addr = in6_addr()
if inet_pton(AF_INET6, address, &in6Addr) == 1 {
var sinAddr = sockaddr_in6(settingLength: ())
sinAddr.sin6_family = sa_family_t(AF_INET6)
sinAddr.sin6_port = port.bigEndian
sinAddr.sin6_addr = in6Addr
let data = withUnsafeBytes(of: sinAddr) { Data($0) }
self.init(remoteWithProtocolFamily: PF_INET, socketType: SOCK_STREAM, protocol: IPPROTO_TCP, address: data)
return
}
}
if hostName != nil {
return nil
}
// Lookup on local host.
var sinAddr = sockaddr_in(settingLength: ())
sinAddr.sin_family = sa_family_t(AF_INET)
sinAddr.sin_port = port.bigEndian
withUnsafeMutableBytes(of: &sinAddr.sin_addr) { (buffer) in
withUnsafeBytes(of: in_addr_t(INADDR_LOOPBACK).bigEndian) { buffer.copyMemory(from: $0) }
}
let data = withUnsafeBytes(of: sinAddr) { Data($0) }
self.init(remoteWithProtocolFamily: PF_INET, socketType: SOCK_STREAM, protocol: IPPROTO_TCP, address: data)
}
private static let remoteSocketCoresLock = NSLock()
private static var remoteSocketCores: [Signature: Core] = [:]
static private func retainedCore(for signature: Signature) -> Core {
return SocketPort.remoteSocketCoresLock.synchronized {
if let core = SocketPort.remoteSocketCores[signature] {
return core
} else {
let core = Core(isUniqued: true)
core.signature = signature
SocketPort.remoteSocketCores[signature] = core
return core
}
}
}
public init(remoteWithProtocolFamily family: Int32, socketType type: Int32, protocol: Int32, address: Data) {
let signature = Signature(address: LocalAddress(address), protocolFamily: family, socketType: type, protocol: `protocol`)
self.core = SocketPort.retainedCore(for: signature)
}
private init(remoteWithSignature signature: Signature) {
self.core = SocketPort.retainedCore(for: signature)
}
deinit {
// On Darwin, .invalidate() is invoked on the _last_ release, immediately before deinit; we cannot do that here.
invalidate()
}
open override func invalidate() {
guard var core = core else { return }
self.core = nil
var signatureToRemove: Signature?
if core.isUniqued {
if isKnownUniquelyReferenced(&core) {
signatureToRemove = core.signature // No need to lock here — this is the only reference to the core.
} else {
return // Do not clean up the contents of this core yet.
}
}
if let receiver = core.receiver, CFSocketIsValid(receiver) {
for connector in core.connectors.values {
CFSocketInvalidate(connector)
}
CFSocketInvalidate(receiver)
// Invalidation notifications are only sent for local (receiver != nil) ports.
NotificationCenter.default.post(name: Port.didBecomeInvalidNotification, object: self)
}
if let signatureToRemove = signatureToRemove {
SocketPort.remoteSocketCoresLock.synchronized {
_ = SocketPort.remoteSocketCores.removeValue(forKey: signatureToRemove)
}
}
}
open override var isValid: Bool {
return core != nil
}
weak var _delegate: PortDelegate?
open override func setDelegate(_ anObject: PortDelegate?) {
_delegate = anObject
}
open override func delegate() -> PortDelegate? {
return _delegate
}
open var protocolFamily: Int32 {
return core.signature.protocolFamily
}
open var socketType: Int32 {
return core.signature.socketType
}
open var `protocol`: Int32 {
return core.signature.protocol
}
open var address: Data {
return core.signature.address.data
}
open var socket: SocketNativeHandle {
return SocketNativeHandle(CFSocketGetNative(core.receiver))
}
open override func schedule(in runLoop: RunLoop, forMode mode: RunLoop.Mode) {
let loop = runLoop.currentCFRunLoop
let loopKey = ObjectIdentifier(loop)
core.lock.synchronized {
guard let receiver = core.receiver, CFSocketIsValid(receiver) else { return }
var modes = core.loops[loopKey]?.modes ?? []
guard !modes.contains(mode) else { return }
modes.insert(mode)
core.loops[loopKey] = (loop, modes)
if let source = CFSocketCreateRunLoopSource(nil, receiver, 600) {
CFRunLoopAddSource(loop, source, mode.rawValue._cfObject)
}
for socket in core.connectors.values {
if let source = CFSocketCreateRunLoopSource(nil, socket, 600) {
CFRunLoopAddSource(loop, source, mode.rawValue._cfObject)
}
}
}
}
open override func remove(from runLoop: RunLoop, forMode mode: RunLoop.Mode) {
let loop = runLoop.currentCFRunLoop
let loopKey = ObjectIdentifier(loop)
core.lock.synchronized {
guard let receiver = core.receiver, CFSocketIsValid(receiver) else { return }
let modes = core.loops[loopKey]?.modes ?? []
guard modes.contains(mode) else { return }
if modes.count == 1 {
core.loops.removeValue(forKey: loopKey)
} else {
core.loops[loopKey]?.modes.remove(mode)
}
if let source = CFSocketCreateRunLoopSource(nil, receiver, 600) {
CFRunLoopRemoveSource(loop, source, mode.rawValue._cfObject)
}
for socket in core.connectors.values {
if let source = CFSocketCreateRunLoopSource(nil, socket, 600) {
CFRunLoopRemoveSource(loop, source, mode.rawValue._cfObject)
}
}
}
}
// On Darwin/ObjC Foundation, invoking initRemote… will return an existing SocketPort from a factory initializer if a port with that signature already exists.
// We cannot do that in Swift; we return instead different objects that share a 'core' (their state), so that invoking methods on either will affect the other. To keep maintain a better illusion, unlike Darwin, we redefine equality so that s1 == s2 for objects that have the same core, even though s1 !== s2 (this we cannot fix).
// This allows e.g. collections where SocketPorts are keys or entries to continue working the same way they do on Darwin when remote socket ports are encountered.
open override var hash: Int {
var hasher = Hasher()
ObjectIdentifier(core).hash(into: &hasher)
return hasher.finalize()
}
open override func isEqual(_ object: Any?) -> Bool {
guard let socketPort = object as? SocketPort else { return false }
return core === socketPort.core
}
// Sending and receiving:
fileprivate final func socketDidAccept(_ socket: CFSocket?, _ type: CFSocketCallBackType, _ address: CFData?, _ data: UnsafeRawPointer?) {
guard let handle = data?.assumingMemoryBound(to: SocketNativeHandle.self),
let address = address else {
return
}
var context = CFSocketContext()
context.info = Unmanaged.passUnretained(self).toOpaque()
guard let child = CFSocketCreateWithNative(nil, CFSocketNativeHandle(handle.pointee), CFOptionFlags(kCFSocketDataCallBack), __NSFireSocketData, &context) else {
return
}
var signature = core.signature!
signature.address = LocalAddress(address._swiftObject)
core.lock.synchronized {
core.connectors[signature] = child
addToLoopsAssumingLockHeld(child)
}
}
private final func addToLoopsAssumingLockHeld(_ socket: CFSocket) {
guard let source = CFSocketCreateRunLoopSource(nil, socket, 600) else {
return
}
for loop in core.loops.values {
for mode in loop.modes {
CFRunLoopAddSource(loop.runLoop, source, mode.rawValue._cfObject)
}
}
}
private static let magicNumber: UInt32 = 0xD0CF50C0
private enum ComponentType: UInt32 {
case data = 1
case port = 2
}
fileprivate final func socketDidReceiveData(_ socket: CFSocket?, _ type: CFSocketCallBackType, _ address: CFData?, _ dataPointer: UnsafeRawPointer?) {
guard let socket = socket,
let dataPointer = dataPointer else { return }
let socketKey = ObjectIdentifier(socket)
let peerAddress = CFSocketCopyPeerAddress(socket)._swiftObject
let lock = core.lock
lock.lock() // We may briefly release the lock during the loop below, and it's unlocked at the end ⬇
let data = Unmanaged<CFData>.fromOpaque(dataPointer).takeUnretainedValue()._swiftObject
if data.count == 0 {
core.data.removeValue(forKey: socketKey)
let keysToRemove = core.connectors.keys.filter { core.connectors[$0] === socket }
for key in keysToRemove {
core.connectors.removeValue(forKey: key)
}
} else {
var storedData: Data
if let currentData = core.data[socketKey] {
storedData = currentData
storedData.append(contentsOf: data)
} else {
storedData = data
}
var keepGoing = true
while keepGoing && storedData.count > 8 {
let preamble = storedData.withUnsafeBytes { $0.load(fromByteOffset: 0, as: UInt32.self) }.bigEndian
let messageLength = storedData.withUnsafeBytes { $0.load(fromByteOffset: 4, as: UInt32.self) }.bigEndian
if preamble == SocketPort.magicNumber && messageLength > 8 {
if storedData.count >= messageLength {
let messageEndIndex = storedData.index(storedData.startIndex, offsetBy: Int(messageLength))
let toStore = storedData[offset: messageEndIndex...]
if toStore.isEmpty {
core.data.removeValue(forKey: socketKey)
} else {
core.data[socketKey] = toStore
}
storedData.removeSubrange(messageEndIndex...)
lock.unlock() // Briefly release the lock ⬆
handleMessage(storedData, from: peerAddress, socket: socket)
lock.lock() // Retake for the remainder ⬇
if let newStoredData = core.data[socketKey] {
storedData = newStoredData
} else {
keepGoing = false
}
} else {
keepGoing = false
}
} else {
// Got message without proper header; delete it.
core.data.removeValue(forKey: socketKey)
keepGoing = false
}
}
}
lock.unlock() // Release lock from above ⬆
}
fileprivate final func socketDidReceiveDatagram(_ socket: CFSocket?, _ type: CFSocketCallBackType, _ address: CFData?, _ data: UnsafeRawPointer?) {
guard let address = address?._swiftObject,
let data = data else {
return
}
let actualData = Unmanaged<CFData>.fromOpaque(data).takeUnretainedValue()._swiftObject
self.handleMessage(actualData, from: address, socket: nil)
}
private enum Structure {
static let offsetOfMagicNumber = 0 // a UInt32
static let offsetOfMessageLength = 4 // a UInt32
static let offsetOfMsgId = 8 // a UInt32
static let offsetOfSignature = 12
static let sizeOfSignatureHeader = 4
static let offsetOfSignatureAddressLength = 15
}
private final func handleMessage(_ message: Data, from address: Data, socket: CFSocket?) {
guard message.count > 24, let delegate = delegate() else { return }
let portMessage = message.withUnsafeBytes { (messageBuffer) -> PortMessage? in
guard SocketPort.magicNumber == messageBuffer.load(fromByteOffset: Structure.offsetOfMagicNumber, as: UInt32.self).bigEndian,
message.count == messageBuffer.load(fromByteOffset: Structure.offsetOfMessageLength, as: UInt32.self).bigEndian else {
return nil
}
let msgId = messageBuffer.load(fromByteOffset: Structure.offsetOfMsgId, as: UInt32.self).bigEndian
let signatureLength = Int(messageBuffer[Structure.offsetOfSignatureAddressLength]) + Structure.sizeOfSignatureHeader // corresponds to the sin_len/sin6_len field inside the signature.
var signatureBytes = Data(UnsafeRawBufferPointer(rebasing: messageBuffer[12 ..< min(12 + signatureLength, message.count - 20)]))
if signatureBytes.count >= 12 && signatureBytes[offset: 5] == AF_INET && address.count >= 8 {
if address[offset: 1] == AF_INET {
signatureBytes.withUnsafeMutableBytes { (mutableSignatureBuffer) in
address.withUnsafeBytes { (address) in
mutableSignatureBuffer.baseAddress?.advanced(by: 8).copyMemory(from: address.baseAddress!.advanced(by: 4), byteCount: 4)
}
}
}
} else if signatureBytes.count >= 32 && signatureBytes[offset: 5] == AF_INET6 && address.count >= 28 {
if address[offset: 1] == AF_INET6 {
signatureBytes.withUnsafeMutableBytes { (mutableSignatureBuffer) in
address.withUnsafeBytes { (address) in
mutableSignatureBuffer.baseAddress?.advanced(by: 8).copyMemory(from: address.baseAddress!.advanced(by: 4), byteCount: 24)
}
}
}
}
guard let signature = Signature(darwinCompatibleDataRepresentation: signatureBytes) else {
return nil
}
if let socket = socket {
core.lock.synchronized {
if let existing = core.connectors[signature], CFSocketIsValid(existing) {
core.connectors[signature] = socket
}
}
}
let sender = SocketPort(remoteWithSignature: signature)
var index = messageBuffer.startIndex + signatureBytes.count + 20
var components: [AnyObject] = []
while index < messageBuffer.endIndex {
var word1: UInt32 = 0
var word2: UInt32 = 0
// The amount of data prior to this point may mean that these reads are unaligned; copy instead.
withUnsafeMutableBytes(of: &word1) { (destination) -> Void in
messageBuffer.copyBytes(to: destination, from: Int(index - 8) ..< Int(index - 4))
}
withUnsafeMutableBytes(of: &word2) { (destination) -> Void in
messageBuffer.copyBytes(to: destination, from: Int(index - 4) ..< Int(index))
}
let componentType = word1.bigEndian
let componentLength = word2.bigEndian
let componentEndIndex = min(index + Int(componentLength), messageBuffer.endIndex)
let componentData = Data(messageBuffer[index ..< componentEndIndex])
if let type = ComponentType(rawValue: componentType) {
switch type {
case .data:
components.append(componentData._nsObject)
case .port:
if let signature = Signature(darwinCompatibleDataRepresentation: componentData) {
components.append(SocketPort(remoteWithSignature: signature))
}
}
}
guard messageBuffer.formIndex(&index, offsetBy: componentData.count + 8, limitedBy: messageBuffer.endIndex) else {
break
}
}
let message = PortMessage(sendPort: sender, receivePort: self, components: components)
message.msgid = msgId
return message
}
if let portMessage = portMessage {
delegate.handle(portMessage)
}
}
open override func send(before limitDate: Date, components: NSMutableArray?, from receivePort: Port?, reserved headerSpaceReserved: Int) -> Bool {
send(before: limitDate, msgid: 0, components: components, from: receivePort, reserved: headerSpaceReserved)
}
open override func send(before limitDate: Date, msgid msgID: Int, components: NSMutableArray?, from receivePort: Port?, reserved headerSpaceReserved: Int) -> Bool {
guard let sender = sendingSocket(for: self, before: limitDate.timeIntervalSinceReferenceDate),
let signature = core.signature.darwinCompatibleDataRepresentation else {
return false
}
let magicNumber: UInt32 = SocketPort.magicNumber.bigEndian
var outLength: UInt32 = 0
let messageNumber = UInt32(msgID).bigEndian
var data = Data()
withUnsafeBytes(of: magicNumber) { data.append(contentsOf: $0) }
withUnsafeBytes(of: outLength) { data.append(contentsOf: $0) } // Reserve space for it.
withUnsafeBytes(of: messageNumber) { data.append(contentsOf: $0) }
data.append(contentsOf: signature)
for component in components?.allObjects ?? [] {
var componentData: Data
var componentType: ComponentType
switch component {
case let component as Data:
componentData = component
componentType = .data
case let component as NSData:
componentData = component._swiftObject
componentType = .data
case let component as SocketPort:
guard let signature = component.core.signature.darwinCompatibleDataRepresentation else {
return false
}
componentData = signature
componentType = .port
default:
return false
}
var componentLength = UInt32(componentData.count).bigEndian
var componentTypeRawValue = UInt32(componentType.rawValue).bigEndian
withUnsafeBytes(of: &componentTypeRawValue) { data.append(contentsOf: $0) }
withUnsafeBytes(of: &componentLength) { data.append(contentsOf: $0) }
data.append(contentsOf: componentData)
}
outLength = UInt32(data.count).bigEndian
withUnsafeBytes(of: outLength) { (lengthBytes) -> Void in
data.withUnsafeMutableBytes { (bytes) -> Void in
bytes.baseAddress!.advanced(by: 4).copyMemory(from: lengthBytes.baseAddress!, byteCount: lengthBytes.count)
}
}
let result = CFSocketSendData(sender, self.address._cfObject, data._cfObject, limitDate.timeIntervalSinceNow)
switch result {
case kCFSocketSuccess:
return true
case kCFSocketError: fallthrough
case kCFSocketTimeout:
return false
default:
fatalError("Unknown result of sending through a socket: \(result)")
}
}
private static let maximumTimeout: TimeInterval = 86400
private static let sendingSocketsLock = NSLock()
private static var sendingSockets: [SocketKind: CFSocket] = [:]
private final func sendingSocket(for port: SocketPort, before time: TimeInterval) -> CFSocket? {
let signature = port.core.signature!
let socketKind = signature.socketKind
var context = CFSocketContext()
context.info = Unmanaged.passUnretained(self).toOpaque()
return core.lock.synchronized {
if let connector = core.connectors[signature], CFSocketIsValid(connector) {
return connector
} else {
if signature.socketType == SOCK_STREAM {
if let connector = CFSocketCreate(nil, socketKind.protocolFamily, socketKind.socketType, socketKind.protocol, CFOptionFlags(kCFSocketDataCallBack), __NSFireSocketData, &context), CFSocketIsValid(connector) {
var timeout = time - Date.timeIntervalSinceReferenceDate
if timeout < 0 || timeout >= SocketPort.maximumTimeout {
timeout = 0
}
if CFSocketIsValid(connector) && CFSocketConnectToAddress(connector, address._cfObject, timeout) == CFSocketError(0) {
core.connectors[signature] = connector
self.addToLoopsAssumingLockHeld(connector)
return connector
} else {
CFSocketInvalidate(connector)
}
}
} else {
return SocketPort.sendingSocketsLock.synchronized {
var result: CFSocket?
if signature.socketKind == core.signature.socketKind,
let receiver = core.receiver, CFSocketIsValid(receiver) {
result = receiver
} else if let socket = SocketPort.sendingSockets[socketKind], CFSocketIsValid(socket) {
result = socket
}
if result == nil,
let sender = CFSocketCreate(nil, socketKind.protocolFamily, socketKind.socketType, socketKind.protocol, CFOptionFlags(kCFSocketNoCallBack), nil, &context), CFSocketIsValid(sender) {
SocketPort.sendingSockets[socketKind] = sender
result = sender
}
return result
}
}
}
return nil
}
}
}
fileprivate extension Data {
subscript(offset value: Int) -> Data.Element {
return self[self.index(self.startIndex, offsetBy: value)]
}
subscript(offset range: Range<Int>) -> Data.SubSequence {
return self[self.index(self.startIndex, offsetBy: range.lowerBound) ..< self.index(self.startIndex, offsetBy: range.upperBound)]
}
subscript(offset range: ClosedRange<Int>) -> Data.SubSequence {
return self[self.index(self.startIndex, offsetBy: range.lowerBound) ... self.index(self.startIndex, offsetBy: range.upperBound)]
}
subscript(offset range: PartialRangeFrom<Int>) -> Data.SubSequence {
return self[self.index(self.startIndex, offsetBy: range.lowerBound)...]
}
subscript(offset range: PartialRangeUpTo<Int>) -> Data.SubSequence {
return self[...self.index(self.startIndex, offsetBy: range.upperBound)]
}
}
| apache-2.0 | 791c23b1850564051f8d56ac14945670 | 40.205776 | 396 | 0.599264 | 4.997373 | false | false | false | false |
practicalswift/swift | test/Generics/requirement_inference.swift | 2 | 14502 | // RUN: %target-typecheck-verify-swift -typecheck -verify
// RUN: %target-typecheck-verify-swift -typecheck -debug-generic-signatures > %t.dump 2>&1
// RUN: %FileCheck %s < %t.dump
protocol P1 {
func p1()
}
protocol P2 : P1 { }
struct X1<T : P1> {
func getT() -> T { }
}
class X2<T : P1> {
func getT() -> T { }
}
class X3 { }
struct X4<T : X3> {
func getT() -> T { }
}
struct X5<T : P2> { }
// Infer protocol requirements from the parameter type of a generic function.
func inferFromParameterType<T>(_ x: X1<T>) {
x.getT().p1()
}
// Infer protocol requirements from the return type of a generic function.
func inferFromReturnType<T>(_ x: T) -> X1<T> {
x.p1()
}
// Infer protocol requirements from the superclass of a generic parameter.
func inferFromSuperclass<T, U : X2<T>>(_ t: T, u: U) -> T {
t.p1()
}
// Infer protocol requirements from the parameter type of a constructor.
struct InferFromConstructor {
init<T> (x : X1<T>) {
x.getT().p1()
}
}
// Don't infer requirements for outer generic parameters.
class Fox : P1 {
func p1() {}
}
class Box<T : Fox, U> {
func unpack(_ x: X1<T>) {}
func unpackFail(_ X: X1<U>) { } // expected-error{{type 'U' does not conform to protocol 'P1'}}
}
// ----------------------------------------------------------------------------
// Superclass requirements
// ----------------------------------------------------------------------------
// Compute meet of two superclass requirements correctly.
class Carnivora {}
class Canidae : Carnivora {}
struct U<T : Carnivora> {}
struct V<T : Canidae> {}
// CHECK-LABEL: .inferSuperclassRequirement1@
// CHECK: Canonical generic signature: <τ_0_0 where τ_0_0 : Canidae>
func inferSuperclassRequirement1<T : Carnivora>(
_ v: V<T>) {}
// CHECK-LABEL: .inferSuperclassRequirement2@
// CHECK: Canonical generic signature: <τ_0_0 where τ_0_0 : Canidae>
func inferSuperclassRequirement2<T : Canidae>(_ v: U<T>) {}
// ----------------------------------------------------------------------------
// Same-type requirements
// ----------------------------------------------------------------------------
protocol P3 {
associatedtype P3Assoc : P2 // expected-note{{declared here}}
}
protocol P4 {
associatedtype P4Assoc : P1
}
protocol PCommonAssoc1 {
associatedtype CommonAssoc
}
protocol PCommonAssoc2 {
associatedtype CommonAssoc
}
protocol PAssoc {
associatedtype Assoc
}
struct Model_P3_P4_Eq<T : P3, U : P4> where T.P3Assoc == U.P4Assoc {}
func inferSameType1<T, U>(_ x: Model_P3_P4_Eq<T, U>) {
let u: U.P4Assoc? = nil
let _: T.P3Assoc? = u!
}
func inferSameType2<T : P3, U : P4>(_: T, _: U) where U.P4Assoc : P2, T.P3Assoc == U.P4Assoc {}
// expected-warning@-1{{redundant conformance constraint 'T.P3Assoc': 'P2'}}
// expected-note@-2{{conformance constraint 'T.P3Assoc': 'P2' implied here}}
func inferSameType3<T : PCommonAssoc1>(_: T) where T.CommonAssoc : P1, T : PCommonAssoc2 {
}
protocol P5 {
associatedtype Element
}
protocol P6 {
associatedtype AssocP6 : P5
}
protocol P7 : P6 {
associatedtype AssocP7: P6
}
// CHECK-LABEL: P7@
// CHECK: Canonical generic signature: <τ_0_0 where τ_0_0 : P7, τ_0_0.AssocP6.Element : P6, τ_0_0.AssocP6.Element == τ_0_0.AssocP7.AssocP6.Element>
extension P7 where AssocP6.Element : P6, // expected-note{{conformance constraint 'Self.AssocP6.Element': 'P6' written here}}
AssocP7.AssocP6.Element : P6, // expected-warning{{redundant conformance constraint 'Self.AssocP6.Element': 'P6'}}
AssocP6.Element == AssocP7.AssocP6.Element {
func nestedSameType1() { }
}
protocol P8 {
associatedtype A
associatedtype B
}
protocol P9 : P8 {
associatedtype A
associatedtype B
}
protocol P10 {
associatedtype A
associatedtype C
}
// CHECK-LABEL: sameTypeConcrete1@
// CHECK: Canonical generic signature: <τ_0_0 where τ_0_0 : P10, τ_0_0 : P9, τ_0_0.A == X3, τ_0_0.B == Int, τ_0_0.C == Int>
func sameTypeConcrete1<T : P9 & P10>(_: T) where T.A == X3, T.C == T.B, T.C == Int { }
// CHECK-LABEL: sameTypeConcrete2@
// CHECK: Canonical generic signature: <τ_0_0 where τ_0_0 : P10, τ_0_0 : P9, τ_0_0.B == X3, τ_0_0.C == X3>
func sameTypeConcrete2<T : P9 & P10>(_: T) where T.B : X3, T.C == T.B, T.C == X3 { }
// expected-warning@-1{{redundant superclass constraint 'T.B' : 'X3'}}
// expected-note@-2{{same-type constraint 'T.C' == 'X3' written here}}
// Note: a standard-library-based stress test to make sure we don't inject
// any additional requirements.
// CHECK-LABEL: RangeReplaceableCollection
// CHECK: Canonical generic signature: <τ_0_0 where τ_0_0 : MutableCollection, τ_0_0 : RangeReplaceableCollection, τ_0_0.SubSequence == Slice<τ_0_0>>
extension RangeReplaceableCollection
where Self: MutableCollection, Self.SubSequence == Slice<Self>
{
func f() { }
}
// CHECK-LABEL: X14.recursiveConcreteSameType
// CHECK: Generic signature: <T, V where T == Range<Int>>
// CHECK-NEXT: Canonical generic signature: <τ_0_0, τ_1_0 where τ_0_0 == Range<Int>>
struct X14<T> where T.Iterator == IndexingIterator<T> {
func recursiveConcreteSameType<V>(_: V) where T == Range<Int> { }
}
// rdar://problem/30478915
protocol P11 {
associatedtype A
}
protocol P12 {
associatedtype B: P11
}
struct X6 { }
struct X7 : P11 {
typealias A = X6
}
struct X8 : P12 {
typealias B = X7
}
struct X9<T: P12, U: P12> where T.B == U.B {
// CHECK-LABEL: X9.upperSameTypeConstraint
// CHECK: Generic signature: <T, U, V where T == X8, U : P12, U.B == X8.B>
// CHECK: Canonical generic signature: <τ_0_0, τ_0_1, τ_1_0 where τ_0_0 == X8, τ_0_1 : P12, τ_0_1.B == X7>
func upperSameTypeConstraint<V>(_: V) where T == X8 { }
}
protocol P13 {
associatedtype C: P11
}
struct X10: P11, P12 {
typealias A = X10
typealias B = X10
}
struct X11<T: P12, U: P12> where T.B == U.B.A {
// CHECK-LABEL: X11.upperSameTypeConstraint
// CHECK: Generic signature: <T, U, V where T : P12, U == X10, T.B == X10.A>
// CHECK: Canonical generic signature: <τ_0_0, τ_0_1, τ_1_0 where τ_0_0 : P12, τ_0_1 == X10, τ_0_0.B == X10>
func upperSameTypeConstraint<V>(_: V) where U == X10 { }
}
#if _runtime(_ObjC)
// rdar://problem/30610428
@objc protocol P14 { }
class X12<S: AnyObject> {
func bar<V>(v: V) where S == P14 {
}
}
@objc protocol P15: P14 { }
class X13<S: P14> {
func bar<V>(v: V) where S == P15 {
}
}
#endif
protocol P16 {
associatedtype A
}
struct X15 { }
struct X16<X, Y> : P16 {
typealias A = (X, Y)
}
// CHECK-LABEL: .X17.bar@
// CHECK: Generic signature: <S, T, U, V where S == X16<X3, X15>, T == X3, U == X15>
struct X17<S: P16, T, U> where S.A == (T, U) {
func bar<V>(_: V) where S == X16<X3, X15> { }
}
// Same-type constraints that are self-derived via a parent need to be
// suppressed in the resulting signature.
protocol P17 { }
protocol P18 {
associatedtype A: P17
}
struct X18: P18, P17 {
typealias A = X18
}
// CHECK-LABEL: .X19.foo@
// CHECK: Generic signature: <T, U where T == X18>
struct X19<T: P18> where T == T.A {
func foo<U>(_: U) where T == X18 { }
}
// rdar://problem/31520386
protocol P20 { }
struct X20<T: P20> { }
// CHECK-LABEL: .X21.f@
// CHECK: Generic signature: <T, U, V where T : P20, U == X20<T>>
// CHECK: Canonical generic signature: <τ_0_0, τ_0_1, τ_1_0 where τ_0_0 : P20, τ_0_1 == X20<τ_0_0>>
struct X21<T, U> {
func f<V>(_: V) where U == X20<T> { }
}
struct X22<T, U> {
func g<V>(_: V) where T: P20,
U == X20<T> { }
}
// CHECK: Generic signature: <Self where Self : P22>
// CHECK: Canonical generic signature: <τ_0_0 where τ_0_0 : P22>
// CHECK: Protocol requirement signature:
// CHECK: .P22@
// CHECK-NEXT: Requirement signature: <Self where Self.A == X20<Self.B>, Self.B : P20>
// CHECK-NEXT: Canonical requirement signature: <τ_0_0 where τ_0_0.A == X20<τ_0_0.B>, τ_0_0.B : P20>
protocol P22 {
associatedtype A
associatedtype B: P20 where A == X20<B>
}
// CHECK: Generic signature: <Self where Self : P23>
// CHECK: Canonical generic signature: <τ_0_0 where τ_0_0 : P23>
// CHECK: Protocol requirement signature:
// CHECK: .P23@
// CHECK-NEXT: Requirement signature: <Self where Self.A == X20<Self.B>, Self.B : P20>
// CHECK-NEXT: Canonical requirement signature: <τ_0_0 where τ_0_0.A == X20<τ_0_0.B>, τ_0_0.B : P20>
protocol P23 {
associatedtype A
associatedtype B: P20
where A == X20<B>
}
protocol P24 {
associatedtype C: P20
}
struct X24<T: P20> : P24 {
typealias C = T
}
// CHECK-LABEL: .P25a@
// CHECK-NEXT: Requirement signature: <Self where Self.A == X24<Self.B>, Self.B : P20>
// CHECK-NEXT: Canonical requirement signature: <τ_0_0 where τ_0_0.A == X24<τ_0_0.B>, τ_0_0.B : P20>
protocol P25a {
associatedtype A: P24 // expected-warning{{redundant conformance constraint 'Self.A': 'P24'}}
associatedtype B: P20 where A == X24<B> // expected-note{{conformance constraint 'Self.A': 'P24' implied here}}
}
// CHECK-LABEL: .P25b@
// CHECK-NEXT: Requirement signature: <Self where Self.A == X24<Self.B>, Self.B : P20>
// CHECK-NEXT: Canonical requirement signature: <τ_0_0 where τ_0_0.A == X24<τ_0_0.B>, τ_0_0.B : P20>
protocol P25b {
associatedtype A
associatedtype B: P20 where A == X24<B>
}
protocol P25c {
associatedtype A: P24
associatedtype B where A == X<B> // expected-error{{use of undeclared type 'X'}}
}
protocol P25d {
associatedtype A
associatedtype B where A == X24<B> // expected-error{{type 'Self.B' does not conform to protocol 'P20'}}
}
// Similar to the above, but with superclass constraints.
protocol P26 {
associatedtype C: X3
}
struct X26<T: X3> : P26 {
typealias C = T
}
// CHECK-LABEL: .P27a@
// CHECK-NEXT: Requirement signature: <Self where Self.A == X26<Self.B>, Self.B : X3>
// CHECK-NEXT: Canonical requirement signature: <τ_0_0 where τ_0_0.A == X26<τ_0_0.B>, τ_0_0.B : X3>
protocol P27a {
associatedtype A: P26 // expected-warning{{redundant conformance constraint 'Self.A': 'P26'}}
associatedtype B: X3 where A == X26<B> // expected-note{{conformance constraint 'Self.A': 'P26' implied here}}
}
// CHECK-LABEL: .P27b@
// CHECK-NEXT: Requirement signature: <Self where Self.A == X26<Self.B>, Self.B : X3>
// CHECK-NEXT: Canonical requirement signature: <τ_0_0 where τ_0_0.A == X26<τ_0_0.B>, τ_0_0.B : X3>
protocol P27b {
associatedtype A
associatedtype B: X3 where A == X26<B>
}
// ----------------------------------------------------------------------------
// Inference of associated type relationships within a protocol hierarchy
// ----------------------------------------------------------------------------
struct X28 : P2 {
func p1() { }
}
// CHECK-LABEL: .P28@
// CHECK-NEXT: Requirement signature: <Self where Self : P3, Self.P3Assoc == X28>
// CHECK-NEXT: Canonical requirement signature: <τ_0_0 where τ_0_0 : P3, τ_0_0.P3Assoc == X28>
protocol P28: P3 {
typealias P3Assoc = X28 // expected-warning{{typealias overriding associated type}}
}
// ----------------------------------------------------------------------------
// Inference of associated types by name match
// ----------------------------------------------------------------------------
protocol P29 {
associatedtype X
}
protocol P30 {
associatedtype X
}
protocol P31 { }
// CHECK-LABEL: .sameTypeNameMatch1@
// CHECK: Generic signature: <T where T : P29, T : P30, T.X : P31>
func sameTypeNameMatch1<T: P29 & P30>(_: T) where T.X: P31 { }
// ----------------------------------------------------------------------------
// Infer requirements from conditional conformances
// ----------------------------------------------------------------------------
protocol P32 {}
protocol P33 {
associatedtype A: P32
}
protocol P34 {}
struct Foo<T> {}
extension Foo: P32 where T: P34 {}
// Inference chain: U.A: P32 => Foo<V>: P32 => V: P34
// CHECK-LABEL: conditionalConformance1@
// CHECK: Generic signature: <U, V where U : P33, V : P34, U.A == Foo<V>>
// CHECK: Canonical generic signature: <τ_0_0, τ_0_1 where τ_0_0 : P33, τ_0_1 : P34, τ_0_0.A == Foo<τ_0_1>>
func conditionalConformance1<U: P33, V>(_: U) where U.A == Foo<V> {}
struct Bar<U: P32> {}
// CHECK-LABEL: conditionalConformance2@
// CHECK: Generic signature: <V where V : P34>
// CHECK: Canonical generic signature: <τ_0_0 where τ_0_0 : P34>
func conditionalConformance2<V>(_: Bar<Foo<V>>) {}
// Mentioning a nested type that is conditional should infer that requirement (SR 6850)
protocol P35 {}
protocol P36 {
func foo()
}
struct ConditionalNested<T> {}
extension ConditionalNested where T: P35 {
struct Inner {}
}
// CHECK: Generic signature: <T where T : P35, T : P36>
// CHECK: Canonical generic signature: <τ_0_0 where τ_0_0 : P35, τ_0_0 : P36>
extension ConditionalNested.Inner: P36 where T: P36 {
func foo() {}
struct Inner2 {}
}
// CHECK-LABEL: conditionalNested1@
// CHECK: Generic signature: <U where U : P35>
// CHECK: Canonical generic signature: <τ_0_0 where τ_0_0 : P35>
func conditionalNested1<U>(_: [ConditionalNested<U>.Inner?]) {}
// CHECK-LABEL: conditionalNested2@
// CHECK: Generic signature: <U where U : P35, U : P36>
// CHECK: Canonical generic signature: <τ_0_0 where τ_0_0 : P35, τ_0_0 : P36>
func conditionalNested2<U>(_: [ConditionalNested<U>.Inner.Inner2?]) {}
//
// Generate typalias adds requirements that can be inferred
//
typealias X1WithP2<T: P2> = X1<T>
// Inferred requirement T: P2 from the typealias
func testX1WithP2<T>(_: X1WithP2<T>) {
_ = X5<T>() // requires P2
}
// Overload based on the inferred requirement.
func testX1WithP2Overloading<T>(_: X1<T>) {
_ = X5<T>() // expected-error{{type 'T' does not conform to protocol 'P2'}}
}
func testX1WithP2Overloading<T>(_: X1WithP2<T>) {
_ = X5<T>() // requires P2
}
// Extend using the inferred requirement.
extension X1WithP2 {
func f() {
_ = X5<T>() // okay: inferred T: P2 from generic typealias
}
}
extension X1: P1 {
func p1() { }
}
typealias X1WithP2Changed<T: P2> = X1<X1<T>>
typealias X1WithP2MoreArgs<T: P2, U> = X1<T>
extension X1WithP2Changed {
func bad1() {
_ = X5<T>() // expected-error{{type 'T' does not conform to protocol 'P2'}}
}
}
extension X1WithP2MoreArgs {
func bad2() {
_ = X5<T>() // expected-error{{type 'T' does not conform to protocol 'P2'}}
}
}
// Inference from protocol inheritance clauses.
typealias ExistentialP4WithP2Assoc<T: P4> = P4 where T.P4Assoc : P2
protocol P37 : ExistentialP4WithP2Assoc<Self> { }
extension P37 {
func f() {
_ = X5<P4Assoc>() // requires P2
}
}
| apache-2.0 | 54282969fca6c2fdaaa9fbe7d25c4d14 | 26.870406 | 149 | 0.621348 | 2.956905 | false | false | false | false |
ashfurrow/eidolon | Kiosk/App/Models/GenericError.swift | 2 | 767 | import Foundation
import SwiftyJSON
final class GenericError: NSObject, JSONAbleType {
let detail: [String:AnyObject]
let message: String
let type: String
init(type: String, message: String, detail: [String:AnyObject]) {
self.detail = detail
self.message = message
self.type = type
}
static func fromJSON(_ json:[String: Any]) -> GenericError {
let json = JSON(json)
let type = json["type"].stringValue
let message = json["message"].stringValue
var detailDictionary = json["detail"].object as? [String: AnyObject]
detailDictionary = detailDictionary ?? [:]
return GenericError(type: type, message: message, detail: detailDictionary!)
}
}
| mit | fed7c8c5f7211fc1ea278513632352f4 | 29.68 | 84 | 0.629726 | 4.676829 | false | false | false | false |
JaSpa/swift | test/SourceKit/Indexing/index.swift | 7 | 2590 | // RUN: %sourcekitd-test -req=index %s -- -serialize-diagnostics-path %t.dia %s | %sed_clean > %t.response
// RUN: diff -u %s.response %t.response
var globV: Int
class CC {
init() {}
var instV: CC
func meth() {}
func instanceFunc0(_ a: Int, b: Float) -> Int {
return 0
}
func instanceFunc1(a x: Int, b y: Float) -> Int {
return 0
}
class func smeth() {}
}
func +(a : CC, b: CC) -> CC {
return a
}
struct S {
func meth() {}
static func smeth() {}
}
enum E {
case EElem
}
protocol Prot {
func protMeth(_ a: Prot)
}
func foo(_ a: CC, b: inout E) {
globV = 0
a + a.instV
a.meth()
CC.smeth()
b = E.EElem
var local: CC
class LocalCC {}
var local2: LocalCC
}
typealias CCAlias = CC
extension CC : Prot {
func meth2(_ x: CCAlias) {}
func protMeth(_ a: Prot) {}
var extV : Int { return 0 }
}
class SubCC : CC, Prot {}
var globV2: SubCC
class ComputedProperty {
var value : Int {
get {
var result = 0
return result
}
set(newVal) {
// completely ignore it!
}
}
var readOnly : Int { return 0 }
}
class BC2 {
func protMeth(_ a: Prot) {}
}
class SubC2 : BC2, Prot {
override func protMeth(_ a: Prot) {}
}
class CC2 {
subscript (i : Int) -> Int {
get {
return i
}
set(v) {
v+1
}
}
}
func test1(_ cp: ComputedProperty, sub: CC2) {
var x = cp.value
x = cp.readOnly
cp.value = x
++cp.value
x = sub[0]
sub[0] = x
++sub[0]
}
struct S2 {
func sfoo() {}
}
var globReadOnly : S2 {
get {
return S2();
}
}
func test2() {
globReadOnly.sfoo()
}
class B1 {
func foo() {}
}
class SB1 : B1 {
override func foo() {
foo()
self.foo()
super.foo()
}
}
func test3(_ c: SB1, s: S2) {
test2()
c.foo()
s.sfoo()
}
extension Undeclared {
func meth() {}
}
class CC4 {
convenience init(x: Int) {
self.init(x:0)
}
}
class SubCC4 : CC4 {
init(x: Int) {
super.init(x:0)
}
}
class Observing {
init() {}
var globObserving : Int {
willSet {
test2()
}
didSet {
test2()
}
}
}
// <rdar://problem/18640140> :: Crash in swift::Mangle::Mangler::mangleIdentifier()
class rdar18640140 {
// didSet is not compatible with set/get
var S1: Int {
get {
return 1
}
set {
}
didSet {
}
}
}
protocol rdar18640140Protocol {
var S1: Int {
get
set
get
}
}
@available(*, unavailable)
class AlwaysUnavailableClass {
}
@available(iOS 99.99, *)
class ConditionalUnavailableClass1{
}
@available(OSX 99.99, *)
class ConditionalUnavailableClass2{
}
| apache-2.0 | 175d7f73d835c3a0ebf9ab0814902368 | 12.419689 | 106 | 0.561776 | 2.890625 | false | false | false | false |
peteratseneca/dps923winter2015 | Week_12/ShapesV1/NewShapes/Shape.swift | 1 | 2286 | //
// Shape.swift
// NewShapes
//
// Created by Peter McIntyre on 2015-04-05.
// Copyright (c) 2015 Seneca College. All rights reserved.
//
import UIKit
class Shape: UIView {
// MARK: - Class members
var shapeType: NSString!
var shapeColor: CGColorRef!
// MARK: - Initialization
override init(frame: CGRect) {
super.init(frame: frame)
// This is necessary (leave it out and you'll see why)
self.backgroundColor = UIColor.clearColor()
}
// The Xcode editor and compiler required this method to be added
required init(coder aDecoder: NSCoder) {
super.init(coder: aDecoder)
}
// This method MUST be implemented in a UIView subclass like this
override func drawRect(rect: CGRect) {
// Get the graphics context
let context = UIGraphicsGetCurrentContext()
// Configure the drawing settings with the passed-in color
CGContextSetLineWidth(context, 1.0);
CGContextSetStrokeColorWithColor(context, shapeColor);
CGContextSetFillColorWithColor(context, shapeColor);
// Draw the shape's word/name inside the passed-in rectangle
switch self.shapeType {
case "Square", "Rectangle":
// ...AddRect... can draw both squares and rectangles
CGContextAddRect(context, rect);
CGContextFillRect(context, rect);
case "Circle", "Ellipse":
// ...AddEllipse... can draw both circles and ellipses
CGContextAddEllipseInRect(context, rect);
CGContextFillEllipseInRect(context, rect);
default:
break
}
// Position the shape's word/name a little better
// This is a hacky way to do it, but it keeps the lines of code to a minimum
shapeType = "\n\(shapeType)"
let centerTextStyle = NSMutableParagraphStyle()
centerTextStyle.alignment = NSTextAlignment.Center
// Draw the shape's word/name on the shape
shapeType.drawInRect(rect, withAttributes: [NSFontAttributeName : UIFont.systemFontOfSize(20), NSParagraphStyleAttributeName : centerTextStyle])
}
}
| mit | c2ed0e280f04a8d8af3b4065139c9c3e | 30.75 | 152 | 0.615486 | 5.316279 | false | false | false | false |
czak/triangulator | Triangulator/MainWindowController.swift | 1 | 2376 | //
// MainWindowController.swift
// Triangulator
//
// Created by Łukasz Adamczak on 19.06.2015.
// Copyright (c) 2015 Łukasz Adamczak.
//
// Triangulator is free software: you can redistribute it and/or modify
// it under the terms of the GNU General Public License as published by
// the Free Software Foundation, either version 3 of the License, or
// (at your option) any later version.
//
import Cocoa
class MainWindowController: NSWindowController {
// MARK: - Outlets
@IBOutlet weak var palettePopUpButton: NSPopUpButton!
@IBOutlet weak var backgroundView: NSView!
// MARK: - Properties
var pattern: Pattern = Pattern(width: 640, height: 400, cellSize: 40, variance: 0.5, palette: Palette.defaultPalettes[0])
// MARK: - Window setup
override var windowNibName: String {
return "MainWindowController"
}
override func windowDidLoad() {
super.windowDidLoad()
// White background under the image
backgroundView.layer!.backgroundColor = CGColorCreateGenericGray(1, 1)
populatePalettesPopup()
}
func populatePalettesPopup() {
let menu = palettePopUpButton.menu!
for palette in Palette.defaultPalettes {
let item = NSMenuItem()
item.title = ""
item.representedObject = palette
item.image = palette.swatchImageForSize(NSSize(width: 110, height: 13))
menu.addItem(item)
}
}
// MARK: - Actions
@IBAction func changePalette(sender: NSPopUpButton) {
pattern.palette = sender.selectedItem!.representedObject as! Palette
}
// MARK: - Saving
func saveDocument(sender: AnyObject) {
let panel = NSSavePanel()
panel.allowedFileTypes = ["png"]
panel.beginSheetModalForWindow(window!, completionHandler: { button in
if button == NSFileHandlingPanelCancelButton { return }
if let url = panel.URL, data = self.pattern.dataForPNG {
data.writeToURL(url, atomically: true)
}
else {
let alert = NSAlert()
alert.messageText = "Unable to save image"
alert.beginSheetModalForWindow(self.window!, completionHandler: nil)
}
})
}
}
| gpl-3.0 | a0b92e74bb82c3724ff660f60f0ef7e7 | 29.050633 | 125 | 0.616259 | 4.935551 | false | false | false | false |
JerrySir/YCOA | YCOA/Main/Contacts/Controller/ContactsStructTableViewController.swift | 1 | 16401 | //
// ContactsStructTableViewController.swift
// YCOA
//
// Created by Jerry on 2017/2/5.
// Copyright © 2017年 com.baochunsteel. All rights reserved.
//
import UIKit
import Alamofire
import MJRefresh
class ContactsStructTableViewController: UITableViewController {
var dataSource : [groupNode]? //数据源
var selectedItems: NSSet = NSSet() //已经选择的
var tap: ((_ ids: [String], _ names: [String]) -> Void)?
/// 配置选择列表
///
/// - Parameters:
/// - selectedItems: 已经选择了的数据节点ID
/// - tap: 控制器返回或者确定的监听,返回已经选择的数据
func configure(selectedItems: [String]?, tap: ((_ ids: [String], _ names: [String]) -> Void)?) {
if(selectedItems != nil){
self.selectedItems = NSSet(array: selectedItems!)
}
self.tap = tap
}
override func viewDidLoad() {
super.viewDidLoad()
self.title = "组织结构"
/*
let rightBarButtonItem = UIBarButtonItem(title: "完成", style: .plain, target: nil, action: nil)
rightBarButtonItem.actionBlock = {(sender) -> Void in
var ids : [String] = []
var names: [String] = []
for item in self.dataSource! {
//是否根节点处全选
if(item.isSelectedAll){
ids.append(item.groupID)
names.append(item.groupTitle)
continue
}else{
//从子节点处检查被选中的
guard item.subNode != nil && item.subNode!.count > 0 else {continue}
for subNodeItem in item.subNode! {
if(subNodeItem.isSelected){
ids.append(subNodeItem.subNodeID)
names.append(subNodeItem.uName)
}
}
}
}
NSLog("选中了：\((names as NSArray).componentsJoined(by: ","))")
//检查是pop还是dismiss
if (self.navigationController?.topViewController == self)
{
self.navigationController!.popViewController(animated: true)
if(self.tap != nil){
self.tap!(ids, names)
}
}
else
{
self.dismiss(animated: true, completion: { () -> Void in
if(self.tap != nil){
self.tap!(ids, names)
}
})
}
}
self.navigationItem.rightBarButtonItem = rightBarButtonItem
*/
// self.tableView.allowsMultipleSelection = true
self.tableView.register(ContactsStructItemTableViewCell.self, forCellReuseIdentifier: "cell")
}
deinit {
NSLog("卧槽，竟然释放了")
}
override func viewDidAppear(_ animated: Bool) {
super.viewDidAppear(animated)
self.tableView.mj_header = MJRefreshNormalHeader(refreshingTarget: self, refreshingAction: #selector(reloadData))
self.tableView.mj_header.beginRefreshing()
}
override func didReceiveMemoryWarning() {
super.didReceiveMemoryWarning()
// Dispose of any resources that can be recreated.
}
func reloadData() {
guard UserCenter.shareInstance().isLogin else {
self.view.jrShow(withTitle: "未登录！")
self.tableView.mj_header.endRefreshing()
return
}
let parameters: Parameters = ["adminid": UserCenter.shareInstance().uid!,
"timekey": NSDate.nowTimeToTimeStamp(),
"token": UserCenter.shareInstance().token!,
"cfrom": "appiphone",
"appapikey": UserCenter.shareInstance().apikey!]
guard let url = URL.JRURLEnCoding(string: YCOA_REQUEST_URL.appending("/index.php?d=taskrun&m=user|appapi&a=getdeptadmin&ajaxbool=true")) else {
self.tableView.mj_header.endRefreshing()
return
}
Alamofire.request(url, parameters: parameters).responseJSON(completionHandler: { (response) in
self.tableView.mj_header.endRefreshing()
guard response.result.isSuccess else{
self.view.jrShow(withTitle: "网络错误")
return
}
guard let returnValue : NSDictionary = response.result.value as? NSDictionary else{
self.view.jrShow(withTitle: "服务器错误")
return
}
guard returnValue.value(forKey: "code") as! Int == 200 else{
self.view.jrShow(withTitle: "\(returnValue.value(forKey: "msg")!)")
return
}
guard let data : [NSDictionary] = returnValue.value(forKey: "data") as? [NSDictionary] else{
self.view.jrShow(withTitle: "服务器故障")
return
}
guard let dataArr : [NSDictionary] = data[0]["children"] as? [NSDictionary] else{
self.view.jrShow(withTitle: "暂无数据")
return
}
//同步数据
self.dataSource = []
for dataGroupItem in dataArr {
let groupName = dataGroupItem["name"] as? String
let groupID = dataGroupItem["id"] as? String
guard let dataSubNodeArr : [NSDictionary] = dataGroupItem["children"] as? [NSDictionary] else{continue}
var subNodes : [(icon: String, showName: String, uName: String, subNodeID: String, isSelected: Bool)] = []
for dataSubNodeItem in dataSubNodeArr {
let subNodeID = dataSubNodeItem["id"] as! String
let subNodeName = dataSubNodeItem["name"] as! String
let subNodeDeptname = dataSubNodeItem["deptname"] as! String
let subNodeRanking = dataSubNodeItem["ranking"] as! String
let subNodeIcon = dataSubNodeItem["face"] as! String
let subNode = ("\(YCOA_REQUEST_URL)/\(subNodeIcon)",
"\(subNodeName) (\(subNodeDeptname) \(subNodeRanking))",
"\(subNodeName)",
subNodeID,
self.selectedItems.contains(subNodeID))
subNodes.append(subNode)
}
self.dataSource!.append(groupNode(groupTitle: groupName!, groupID: groupID!, subNode: subNodes))
}
//循环遍历根节点的选择状态
for index in 0..<self.dataSource!.count {
self.dataSource![index].isSelectedAll = self.selectedItems.contains(self.dataSource![index].groupID)
if(self.dataSource![index].isSelectedAll){
//如果是选择了部门，则选中所有子节点
self.setGroupSelectAll(groupIndex: index, isSelectAll: true)
}
}
self.tableView.reloadData()
})
}
// MARK: - Table view data source
override func numberOfSections(in tableView: UITableView) -> Int {
guard self.dataSource != nil else {return 0}
return self.dataSource!.count
}
override func tableView(_ tableView: UITableView, numberOfRowsInSection section: Int) -> Int {
if(self.dataSource![section].isFold){ //是否折叠
return 0
}
guard self.dataSource![section].subNode != nil else {return 0}
return self.dataSource![section].subNode!.count
}
override func tableView(_ tableView: UITableView, cellForRowAt indexPath: IndexPath) -> UITableViewCell {
let cell = tableView.dequeueReusableCell(withIdentifier: "cell", for: indexPath) as! ContactsStructItemTableViewCell
cell.configure(icon: self.dataSource![indexPath.section].subNode![indexPath.row].icon,
title: self.dataSource![indexPath.section].subNode![indexPath.row].showName,
isSelected: self.dataSource![indexPath.section].subNode![indexPath.row].isSelected)
return cell
}
override func tableView(_ tableView: UITableView, heightForRowAt indexPath: IndexPath) -> CGFloat {
return 50.0
}
override func tableView(_ tableView: UITableView, viewForHeaderInSection section: Int) -> UIView? {
return makeSectionHeader(groupTitle: self.dataSource![section].groupTitle,
groupID: self.dataSource![section].groupID,
numberOfSubNode: (self.dataSource![section].subNode?.count)!,
isFold: self.dataSource![section].isFold,
isSelectedAll: self.dataSource![section].isSelectedAll,
didFoldTap: { (groupID) in
NSLog("did fold action \(groupID)")
self.dataSource![section].isFold = !(self.dataSource![section].isFold)
self.tableView.reloadData()
},
selectedAllTap: { (groupID) in
// NSLog("selected all action \(groupID)")
// if(self.dataSource![section].isSelectedAll){
// self.setGroupSelectAll(groupIndex: section, isSelectAll: false)
// self.dataSource![section].isSelectedAll = false
// }else{
// self.setGroupSelectAll(groupIndex: section, isSelectAll: true)
// self.dataSource![section].isSelectedAll = true
// }
// self.tableView.reloadData()
})
}
override func tableView(_ tableView: UITableView, heightForHeaderInSection section: Int) -> CGFloat {
return 50.0
}
/*
override func tableView(_ tableView: UITableView, didSelectRowAt indexPath: IndexPath) {
self.dataSource![indexPath.section].subNode![indexPath.row].isSelected =
!self.dataSource![indexPath.section].subNode![indexPath.row].isSelected
self.dataSource![indexPath.section].isSelectedAll = self.isGroupSelectedAll(group: self.dataSource![indexPath.section])
self.tableView.reloadData()
}
*/
//创建Section View
private func makeSectionHeader(groupTitle: String, groupID: String, numberOfSubNode: Int, isFold: Bool, isSelectedAll: Bool, didFoldTap: @escaping (_ groupID: String) -> Void, selectedAllTap: @escaping (_ groupID: String) -> Void) -> UIView {
let viewHeight : CGFloat = 50.0
let view = UIView(frame: CGRect(x: 0.0, y: 0.0, width: JRSCREEN_WIDTH, height: viewHeight))
view.backgroundColor = UIColor.groupTableViewBackground
let foldIcon = UIImageView(frame: CGRect(x: 16, y: 16, width: viewHeight - 32, height: viewHeight - 32))
view.addSubview(foldIcon)
foldIcon.image = #imageLiteral(resourceName: "cell_fold_right_icon.png")
if(isFold){
//默认可以不处理
}else{
let angle = Double(1) * M_PI_2
foldIcon.transform = CGAffineTransform(rotationAngle: CGFloat(angle))
}
let groupTitleLabel = UILabel(frame: CGRect(x: viewHeight, y: 8, width: JRSCREEN_WIDTH - viewHeight - 16 - viewHeight, height: viewHeight - 16))
view.addSubview(groupTitleLabel)
groupTitleLabel.text = "\(groupTitle) (\(numberOfSubNode))"
// let selectAllButton : UIButton = UIButton(frame: CGRect(x: JRSCREEN_WIDTH - viewHeight, y: 8, width: viewHeight - 16, height: viewHeight - 16))
// if(isSelectedAll){
// selectAllButton.setImage(#imageLiteral(resourceName: "cell_selected_icon.png"), for: .normal)
// }else{
// selectAllButton.setImage(#imageLiteral(resourceName: "cell_unselect_icon.png"), for: .normal)
// }
// view.addSubview(selectAllButton)
//Action
view.isUserInteractionEnabled = true
let tapGestureRecognizer = UITapGestureRecognizer { (sender) in
didFoldTap(groupID)
}
view.addGestureRecognizer(tapGestureRecognizer)
// selectAllButton.addBlock(for: .touchUpInside) { (sender) in
// selectedAllTap(groupID)
// }
return view
}
//全选的相关方法
//组是否已经全选
func isGroupSelectedAll (group: groupNode) -> Bool {
if(group.subNode != nil && group.subNode!.count > 0){
var returnValue = true
for item in group.subNode! {
returnValue = returnValue && item.isSelected
}
return returnValue
}else{
return false
}
}
//设置组全选
func setGroupSelectAll (groupIndex: Int, isSelectAll: Bool) {
if(self.dataSource![groupIndex].subNode != nil && self.dataSource![groupIndex].subNode!.count > 0){
for index in 0..<self.dataSource![groupIndex].subNode!.count {
self.dataSource![groupIndex].subNode![index].isSelected = isSelectAll
}
}
}
}
//联系人选择Cell 高度:50
class ContactsStructItemTableViewCell: UITableViewCell {
private let CellHeight: CGFloat = 50.0
private var iconImageView: UIImageView?
private var titleLabel: UILabel?
private var selectImageView: UIImageView?
override init(style: UITableViewCellStyle, reuseIdentifier: String?) {
super.init(style: style, reuseIdentifier: reuseIdentifier)
self.iconImageView = UIImageView(frame: CGRect(x: 18,
y: 8,
width: CellHeight - 8 - 8,
height: CellHeight - 8 - 8))
self.titleLabel = UILabel(frame: CGRect(x: CellHeight + 10,
y: 8,
width: JRSCREEN_WIDTH - 2 * CellHeight + 5,
height: CellHeight - 8 - 8))
self.selectImageView = UIImageView(frame: CGRect(x: JRSCREEN_WIDTH - CellHeight,
y: 8,
width: CellHeight - 16,
height: CellHeight - 16))
self.contentView.addSubview(self.iconImageView!)
self.contentView.addSubview(self.titleLabel!)
self.contentView.addSubview(self.selectImageView!)
self.selectionStyle = .none
}
required init?(coder aDecoder: NSCoder) {
fatalError("init(coder:) has not been implemented")
}
func configure(icon: String?, title: String?, isSelected: Bool){
if(icon != nil){
self.iconImageView?.sd_setImage(with: URL(string: icon!),
placeholderImage: #imageLiteral(resourceName: "imagePlaceHolder"),
options: .lowPriority)
}
self.titleLabel?.text = title
// if(isSelected){
// self.selectImageView?.image = #imageLiteral(resourceName: "cell_selected_icon.png")
// }else{
// self.selectImageView?.image = #imageLiteral(resourceName: "cell_unselect_icon.png")
// }
}
override func setSelected(_ selected: Bool, animated: Bool) {
super.setSelected(selected, animated: animated)
//逗逼才会在这里图片替换逻辑 -. -!
}
}
| mit | b77e73e33a6e7f787d4459392aab70b9 | 41.242744 | 246 | 0.537976 | 5.266447 | false | false | false | false |
sseitov/v-Chess-Swift | v-Chess/MemberCell.swift | 1 | 1049 | //
// MemberCell.swift
// v-Chess
//
// Created by Сергей Сейтов on 13.03.17.
// Copyright © 2017 V-Channel. All rights reserved.
//
import UIKit
import SDWebImage
class MemberCell: UITableViewCell {
@IBOutlet weak var memberView: UIImageView!
@IBOutlet weak var memberName: UILabel!
override func awakeFromNib() {
super.awakeFromNib()
}
var member:AppUser? {
didSet {
if member!.avatar != nil, let data = member!.avatar as Data?, let image = UIImage(data: data) {
memberView.image = image.withSize(memberView.frame.size).inCircle()
} else if member!.avatarURL != nil, let url = URL(string: member!.avatarURL!) {
memberView.sd_setImage(with: url)
}
if member!.name != nil && !member!.name!.isEmpty {
memberName.text = member!.name
} else {
memberName.text = member!.email
}
memberName.textColor = MainColor
}
}
}
| gpl-3.0 | 529c91dec9856603a50d54f8e90c1168 | 26.263158 | 107 | 0.569498 | 4.280992 | false | false | false | false |
simonbengtsson/realmfire-swift | RealmFire/TypeHandler.swift | 1 | 2506 | import Foundation
import RealmSwift
class TypeHandler {
static var syncTypes = [String: SyncObject.Type]()
static var dataTypes = [String: DataObject.Type]()
static func getSyncType(className: String) -> SyncObject.Type {
if let type = syncTypes[className] {
return type
} else {
fatalError("The type \(className) is not managed by RealmFire")
}
}
static func getType(className: String) -> DataObject.Type? {
return dataTypes[className]
}
static func isSyncType(className: String) -> Bool {
return syncTypes[className] != nil
}
static func isDataType(className: String) -> Bool {
return dataTypes[className] != nil
}
fileprivate static func addSyncType(className: String, type: SyncObject.Type) {
syncTypes[className] = type
}
fileprivate static func addDataType(className: String, type: DataObject.Type) {
dataTypes[className] = type
}
}
extension Object {
/*open override class func initialize() {
super.initialize()
guard self.className() != SyncObject.className() else { return }
// Add all classes that should be observed and synced
//TypeHandler.addSyncType(className: self.className(), type: self)
}*/
}
extension DataObject {
/*open override class func initialize() {
super.initialize()
guard self.className() != DataObject.className() else { return }
guard self.className() != SyncObject.className() else { return }
// Add all classes that should be observed and synced
TypeHandler.addDataType(className: self.className(), type: self)
}*/
}
extension SyncObject {
/*open override class func initialize() {
//super.initialize()
guard self.className() != SyncObject.className() else { return }
// Add all classes that should be observed and synced
TypeHandler.addSyncType(className: self.className(), type: self)
validateClass()
}*/
private class func validateClass() {
if self.primaryKey() == nil {
fatalError("primaryKey() has to be overriden by SyncObject subclasses")
}
if self.collectionName().isEmpty {
fatalError("collectionName cannot be empty")
}
if self.uploadedAtAttribute().isEmpty {
fatalError("uploadedAtAttribute cannot be empty")
}
}
}
| mit | cb6e69eea824f484d58475296b628409 | 30.325 | 83 | 0.621708 | 4.88499 | false | false | false | false |
apple/swift-llbuild | examples/swift-bindings/core/basic.swift | 1 | 2449 | import llbuild
typealias Compute = ([Int]) -> Int
class SimpleTask: Task {
let inputs: [Key]
var values: [Int]
let compute: Compute
init(_ inputs: [Key], compute: @escaping Compute) {
self.inputs = inputs
values = [Int](repeating: 0, count: inputs.count)
self.compute = compute
}
func start(_ engine: TaskBuildEngine) {
for (idx, input) in inputs.enumerated() {
engine.taskNeedsInput(input, inputID: idx)
}
}
func provideValue(_ engine: TaskBuildEngine, inputID: Int, value: Value) {
values[inputID] = Int(value.toString())!
}
func inputsAvailable(_ engine: TaskBuildEngine) {
let result = compute(values)
engine.taskIsComplete(Value("\(result)"), forceChange: false)
}
}
class SimpleBuildEngineDelegate: BuildEngineDelegate {
var builtKeys = [Key]()
func lookupRule(_ key: Key) -> Rule {
switch key.toString() {
case "A":
return SimpleRule([]) { arr in
precondition(self.builtKeys.isEmpty)
self.builtKeys.append(key)
return 2
}
case "B":
return SimpleRule([]) { arr in
precondition(self.builtKeys.count == 1)
self.builtKeys.append(key)
return 3
}
case "C":
return SimpleRule([Key("A"), Key("B")]) { arr in
precondition(self.builtKeys.count == 2)
precondition(self.builtKeys[0].toString() == "A")
precondition(self.builtKeys[1].toString() == "B")
self.builtKeys.append(key)
return arr[0] * arr[1]
}
default: fatalError("Unexpected key \(key) lookup")
}
}
}
class SimpleRule: Rule {
let inputs: [Key]
let compute: Compute
init(_ inputs: [Key], compute: @escaping Compute) {
self.inputs = inputs
self.compute = compute
}
func createTask() -> Task {
return SimpleTask(inputs, compute: compute)
}
}
let delegate = SimpleBuildEngineDelegate()
var engine = BuildEngine(delegate: delegate)
// C depends on A and B
var result = engine.build(key: Key("C"))
print("\(result.toString())")
precondition(result.toString() == "6")
// Make sure building already built keys do not re-compute.
delegate.builtKeys.removeAll()
precondition(delegate.builtKeys.isEmpty)
result = engine.build(key: Key("A"))
precondition(result.toString() == "2")
precondition(delegate.builtKeys.isEmpty)
result = engine.build(key: Key("B"))
precondition(result.toString() == "3")
precondition(delegate.builtKeys.isEmpty)
| apache-2.0 | 48aafc231b4f1ee00007ae322bd2f59c | 25.333333 | 76 | 0.648836 | 3.773498 | false | false | false | false |
ZhiQiang-Yang/pppt | v2exProject 2/Pods/Alamofire/Source/Alamofire.swift | 271 | 12335 | // Alamofire.swift
//
// Copyright (c) 2014–2015 Alamofire Software Foundation (http://alamofire.org/)
//
// Permission is hereby granted, free of charge, to any person obtaining a copy
// of this software and associated documentation files (the "Software"), to deal
// in the Software without restriction, including without limitation the rights
// to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
// copies of the Software, and to permit persons to whom the Software is
// furnished to do so, subject to the following conditions:
//
// The above copyright notice and this permission notice shall be included in
// all copies or substantial portions of the Software.
//
// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
// IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
// FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
// AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
// LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
// OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
// THE SOFTWARE.
import Foundation
// MARK: - URLStringConvertible
/**
Types adopting the `URLStringConvertible` protocol can be used to construct URL strings, which are then used to
construct URL requests.
*/
public protocol URLStringConvertible {
/**
A URL that conforms to RFC 2396.
Methods accepting a `URLStringConvertible` type parameter parse it according to RFCs 1738 and 1808.
See https://tools.ietf.org/html/rfc2396
See https://tools.ietf.org/html/rfc1738
See https://tools.ietf.org/html/rfc1808
*/
var URLString: String { get }
}
extension String: URLStringConvertible {
public var URLString: String {
return self
}
}
extension NSURL: URLStringConvertible {
public var URLString: String {
return absoluteString
}
}
extension NSURLComponents: URLStringConvertible {
public var URLString: String {
return URL!.URLString
}
}
extension NSURLRequest: URLStringConvertible {
public var URLString: String {
return URL!.URLString
}
}
// MARK: - URLRequestConvertible
/**
Types adopting the `URLRequestConvertible` protocol can be used to construct URL requests.
*/
public protocol URLRequestConvertible {
/// The URL request.
var URLRequest: NSMutableURLRequest { get }
}
extension NSURLRequest: URLRequestConvertible {
public var URLRequest: NSMutableURLRequest {
return self.mutableCopy() as! NSMutableURLRequest
}
}
// MARK: - Convenience
func URLRequest(
method: Method,
_ URLString: URLStringConvertible,
headers: [String: String]? = nil)
-> NSMutableURLRequest
{
let mutableURLRequest = NSMutableURLRequest(URL: NSURL(string: URLString.URLString)!)
mutableURLRequest.HTTPMethod = method.rawValue
if let headers = headers {
for (headerField, headerValue) in headers {
mutableURLRequest.setValue(headerValue, forHTTPHeaderField: headerField)
}
}
return mutableURLRequest
}
// MARK: - Request Methods
/**
Creates a request using the shared manager instance for the specified method, URL string, parameters, and
parameter encoding.
- parameter method: The HTTP method.
- parameter URLString: The URL string.
- parameter parameters: The parameters. `nil` by default.
- parameter encoding: The parameter encoding. `.URL` by default.
- parameter headers: The HTTP headers. `nil` by default.
- returns: The created request.
*/
public func request(
method: Method,
_ URLString: URLStringConvertible,
parameters: [String: AnyObject]? = nil,
encoding: ParameterEncoding = .URL,
headers: [String: String]? = nil)
-> Request
{
return Manager.sharedInstance.request(
method,
URLString,
parameters: parameters,
encoding: encoding,
headers: headers
)
}
/**
Creates a request using the shared manager instance for the specified URL request.
If `startRequestsImmediately` is `true`, the request will have `resume()` called before being returned.
- parameter URLRequest: The URL request
- returns: The created request.
*/
public func request(URLRequest: URLRequestConvertible) -> Request {
return Manager.sharedInstance.request(URLRequest.URLRequest)
}
// MARK: - Upload Methods
// MARK: File
/**
Creates an upload request using the shared manager instance for the specified method, URL string, and file.
- parameter method: The HTTP method.
- parameter URLString: The URL string.
- parameter headers: The HTTP headers. `nil` by default.
- parameter file: The file to upload.
- returns: The created upload request.
*/
public func upload(
method: Method,
_ URLString: URLStringConvertible,
headers: [String: String]? = nil,
file: NSURL)
-> Request
{
return Manager.sharedInstance.upload(method, URLString, headers: headers, file: file)
}
/**
Creates an upload request using the shared manager instance for the specified URL request and file.
- parameter URLRequest: The URL request.
- parameter file: The file to upload.
- returns: The created upload request.
*/
public func upload(URLRequest: URLRequestConvertible, file: NSURL) -> Request {
return Manager.sharedInstance.upload(URLRequest, file: file)
}
// MARK: Data
/**
Creates an upload request using the shared manager instance for the specified method, URL string, and data.
- parameter method: The HTTP method.
- parameter URLString: The URL string.
- parameter headers: The HTTP headers. `nil` by default.
- parameter data: The data to upload.
- returns: The created upload request.
*/
public func upload(
method: Method,
_ URLString: URLStringConvertible,
headers: [String: String]? = nil,
data: NSData)
-> Request
{
return Manager.sharedInstance.upload(method, URLString, headers: headers, data: data)
}
/**
Creates an upload request using the shared manager instance for the specified URL request and data.
- parameter URLRequest: The URL request.
- parameter data: The data to upload.
- returns: The created upload request.
*/
public func upload(URLRequest: URLRequestConvertible, data: NSData) -> Request {
return Manager.sharedInstance.upload(URLRequest, data: data)
}
// MARK: Stream
/**
Creates an upload request using the shared manager instance for the specified method, URL string, and stream.
- parameter method: The HTTP method.
- parameter URLString: The URL string.
- parameter headers: The HTTP headers. `nil` by default.
- parameter stream: The stream to upload.
- returns: The created upload request.
*/
public func upload(
method: Method,
_ URLString: URLStringConvertible,
headers: [String: String]? = nil,
stream: NSInputStream)
-> Request
{
return Manager.sharedInstance.upload(method, URLString, headers: headers, stream: stream)
}
/**
Creates an upload request using the shared manager instance for the specified URL request and stream.
- parameter URLRequest: The URL request.
- parameter stream: The stream to upload.
- returns: The created upload request.
*/
public func upload(URLRequest: URLRequestConvertible, stream: NSInputStream) -> Request {
return Manager.sharedInstance.upload(URLRequest, stream: stream)
}
// MARK: MultipartFormData
/**
Creates an upload request using the shared manager instance for the specified method and URL string.
- parameter method: The HTTP method.
- parameter URLString: The URL string.
- parameter headers: The HTTP headers. `nil` by default.
- parameter multipartFormData: The closure used to append body parts to the `MultipartFormData`.
- parameter encodingMemoryThreshold: The encoding memory threshold in bytes.
`MultipartFormDataEncodingMemoryThreshold` by default.
- parameter encodingCompletion: The closure called when the `MultipartFormData` encoding is complete.
*/
public func upload(
method: Method,
_ URLString: URLStringConvertible,
headers: [String: String]? = nil,
multipartFormData: MultipartFormData -> Void,
encodingMemoryThreshold: UInt64 = Manager.MultipartFormDataEncodingMemoryThreshold,
encodingCompletion: (Manager.MultipartFormDataEncodingResult -> Void)?)
{
return Manager.sharedInstance.upload(
method,
URLString,
headers: headers,
multipartFormData: multipartFormData,
encodingMemoryThreshold: encodingMemoryThreshold,
encodingCompletion: encodingCompletion
)
}
/**
Creates an upload request using the shared manager instance for the specified method and URL string.
- parameter URLRequest: The URL request.
- parameter multipartFormData: The closure used to append body parts to the `MultipartFormData`.
- parameter encodingMemoryThreshold: The encoding memory threshold in bytes.
`MultipartFormDataEncodingMemoryThreshold` by default.
- parameter encodingCompletion: The closure called when the `MultipartFormData` encoding is complete.
*/
public func upload(
URLRequest: URLRequestConvertible,
multipartFormData: MultipartFormData -> Void,
encodingMemoryThreshold: UInt64 = Manager.MultipartFormDataEncodingMemoryThreshold,
encodingCompletion: (Manager.MultipartFormDataEncodingResult -> Void)?)
{
return Manager.sharedInstance.upload(
URLRequest,
multipartFormData: multipartFormData,
encodingMemoryThreshold: encodingMemoryThreshold,
encodingCompletion: encodingCompletion
)
}
// MARK: - Download Methods
// MARK: URL Request
/**
Creates a download request using the shared manager instance for the specified method and URL string.
- parameter method: The HTTP method.
- parameter URLString: The URL string.
- parameter parameters: The parameters. `nil` by default.
- parameter encoding: The parameter encoding. `.URL` by default.
- parameter headers: The HTTP headers. `nil` by default.
- parameter destination: The closure used to determine the destination of the downloaded file.
- returns: The created download request.
*/
public func download(
method: Method,
_ URLString: URLStringConvertible,
parameters: [String: AnyObject]? = nil,
encoding: ParameterEncoding = .URL,
headers: [String: String]? = nil,
destination: Request.DownloadFileDestination)
-> Request
{
return Manager.sharedInstance.download(
method,
URLString,
parameters: parameters,
encoding: encoding,
headers: headers,
destination: destination
)
}
/**
Creates a download request using the shared manager instance for the specified URL request.
- parameter URLRequest: The URL request.
- parameter destination: The closure used to determine the destination of the downloaded file.
- returns: The created download request.
*/
public func download(URLRequest: URLRequestConvertible, destination: Request.DownloadFileDestination) -> Request {
return Manager.sharedInstance.download(URLRequest, destination: destination)
}
// MARK: Resume Data
/**
Creates a request using the shared manager instance for downloading from the resume data produced from a
previous request cancellation.
- parameter resumeData: The resume data. This is an opaque data blob produced by `NSURLSessionDownloadTask`
when a task is cancelled. See `NSURLSession -downloadTaskWithResumeData:` for additional
information.
- parameter destination: The closure used to determine the destination of the downloaded file.
- returns: The created download request.
*/
public func download(resumeData data: NSData, destination: Request.DownloadFileDestination) -> Request {
return Manager.sharedInstance.download(data, destination: destination)
}
| apache-2.0 | 2c4b5da01f3392f3a5cb4bde49dac529 | 32.513587 | 118 | 0.707695 | 5.040049 | false | false | false | false |
mathmatrix828/WeatherIcons_swift | WeatherIcons_swift/Classes/WeatherIconsEnum.swift | 1 | 8157 | //
// WeatherIconsEnum.swift
// WeatherIconsEnum
// Pods
//
// Created by Mason Phillips on 4May16.
//
//
public enum WeatherIcons: String {
case day_sunny = "\u{00d}"
case day_cloudy = "\u{002}"
case day_cloudy_gusts = "\u{000}"
case day_cloudy_windy = "\u{001}"
case day_fog = "\u{003}"
case day_hail = "\u{004}"
case day_haze = "\u{0b6}"
case day_lightning = "\u{005}"
case day_rain = "\u{008}"
case day_rain_mix = "\u{006}"
case day_rain_wind = "\u{007}"
case day_showers = "\u{009}"
case day_sleet = "\u{0b2}"
case day_sleet_storm = "\u{068}"
case day_snow = "\u{00a}"
case day_snow_thunderstorm = "\u{06b}"
case day_snow_wind = "\u{065}"
case day_sprinkle = "\u{00b}"
case day_storm_showers = "\u{00e}"
case day_sunny_overcast = "\u{00c}"
case day_thunderstorm = "\u{010}"
case day_windy = "\u{085}"
case solar_eclipse = "\u{06e}"
case hot = "\u{072}"
case day_cloudy_high = "\u{07d}"
case day_light_wind = "\u{0c4}"
case night_clear = "\u{02e}"
case night_alt_cloudy = "\u{086}"
case night_alt_cloudy_gusts = "\u{022}"
case night_alt_cloudy_windy = "\u{023}"
case night_alt_hail = "\u{024}"
case night_alt_lightning = "\u{025}"
case night_alt_rain = "\u{028}"
case night_alt_rain_mix = "\u{026}"
case night_alt_rain_wind = "\u{027}"
case night_alt_showers = "\u{029}"
case night_alt_sleet = "\u{0b4}"
case night_alt_sleet_storm = "\u{06a}"
case night_alt_snow = "\u{02a}"
case night_alt_snow_thunderstorm = "\u{06d}"
case night_alt_snow_wind = "\u{067}"
case night_alt_sprinkle = "\u{02b}"
case night_alt_storm_showers = "\u{02c}"
case night_alt_thunderstorm = "\u{02d}"
case night_cloudy = "\u{031}"
case night_cloudy_gusts = "\u{02f}"
case night_cloudy_windy = "\u{030}"
case night_fog = "\u{04a}"
case night_hail = "\u{032}"
case night_lightning = "\u{033}"
case night_partly_cloudy = "\u{083}"
case night_rain = "\u{036}"
case night_rain_mix = "\u{034}"
case night_rain_wind = "\u{035}"
case night_showers = "\u{037}"
case night_sleet = "\u{0b3}"
case night_sleet_storm = "\u{069}"
case night_snow = "\u{038}"
case night_snow_thunderstorm = "\u{06c}"
case night_snow_wind = "\u{066}"
case night_sprinkle = "\u{039}"
case night_storm_showers = "\u{03a}"
case night_thunderstorm = "\u{03b}"
case lunar_eclipse = "\u{070}"
case stars = "\u{077}"
case storm_showers = "\u{01d}"
case thunderstorm = "\u{01e}"
case night_alt_cloudy_high = "\u{07e}"
case night_cloudy_high = "\u{080}"
case night_alt_partly_cloudy = "\u{081}"
case cloud = "\u{041}"
case cloudy = "\u{013}"
case cloudy_gusts = "\u{011}"
case cloudy_windy = "\u{012}"
case fog = "\u{014}"
case hail = "\u{015}"
case rain = "\u{019}"
case rain_mix = "\u{017}"
case rain_wind = "\u{018}"
case showers = "\u{01a}"
case sleet = "\u{0b5}"
case snow = "\u{01b}"
case sprinkle = "\u{01c}"
case snow_wind = "\u{064}"
case smog = "\u{074}"
case smoke = "\u{062}"
case lightning = "\u{016}"
case raindrops = "\u{04e}"
case raindrop = "\u{078}"
case dust = "\u{063}"
case snowflake_cold = "\u{076}"
case windy = "\u{021}"
case strong_wind = "\u{050}"
case sandstorm = "\u{082}"
case earthquake = "\u{0c6}"
case fire = "\u{0c7}"
case flood = "\u{07c}"
case meteor = "\u{071}"
case tsunami = "\u{0c5}"
case volcano = "\u{0c8}"
case hurricane = "\u{073}"
case tornado = "\u{056}"
case small_craft_advisory = "\u{0cc}"
case gale_warning = "\u{0cd}"
case storm_warning = "\u{0ce}"
case hurricane_warning = "\u{0cf}"
case wind_direction = "\u{0b1}"
case alien = "\u{075}"
case celsius = "\u{03c}"
case fahrenheit = "\u{045}"
case degrees = "\u{042}"
case thermometer = "\u{055}"
case thermometer_exterior = "\u{053}"
case thermometer_internal = "\u{054}"
case cloud_down = "\u{03d}"
case cloud_up = "\u{040}"
case cloud_refresh = "\u{03e}"
case horizon = "\u{047}"
case horizon_alt = "\u{046}"
case sunrise = "\u{051}"
case sunset = "\u{052}"
case moonrise = "\u{0c9}"
case moonset = "\u{0ca}"
case refresh = "\u{04c}"
case refresh_alt = "\u{04b}"
case umbrella = "\u{084}"
case barometer = "\u{079}"
case humidity = "\u{07a}"
case na = "\u{07b}"
case train = "\u{0cb}"
case moon_new = "\u{095}"
case moon_waxing_crescent_1 = "\u{096}"
case moon_waxing_crescent_2 = "\u{097}"
case moon_waxing_crescent_3 = "\u{098}"
case moon_waxing_crescent_4 = "\u{099}"
case moon_waxing_crescent_5 = "\u{09a}"
case moon_waxing_crescent_6 = "\u{09b}"
case moon_first_quarter = "\u{09c}"
case moon_waxing_gibbous_1 = "\u{09d}"
case moon_waxing_gibbous_2 = "\u{09e}"
case moon_waxing_gibbous_3 = "\u{09f}"
case moon_waxing_gibbous_4 = "\u{0a0}"
case moon_waxing_gibbous_5 = "\u{0a1}"
case moon_waxing_gibbous_6 = "\u{0a2}"
case moon_full = "\u{0a3}"
case moon_waning_gibbous_1 = "\u{0a4}"
case moon_waning_gibbous_2 = "\u{0a5}"
case moon_waning_gibbous_3 = "\u{0a6}"
case moon_waning_gibbous_4 = "\u{0a7}"
case moon_waning_gibbous_5 = "\u{0a8}"
case moon_waning_gibbous_6 = "\u{0a9}"
case moon_third_quarter = "\u{0aa}"
case moon_waning_crescent_1 = "\u{0ab}"
case moon_waning_crescent_2 = "\u{0ac}"
case moon_waning_crescent_3 = "\u{0ad}"
case moon_waning_crescent_4 = "\u{0ae}"
case moon_waning_crescent_5 = "\u{0af}"
case moon_waning_crescent_6 = "\u{0b0}"
case moon_alt_new = "\u{0eb}"
case moon_alt_waxing_crescent_1 = "\u{0d0}"
case moon_alt_waxing_crescent_2 = "\u{0d1}"
case moon_alt_waxing_crescent_3 = "\u{0d2}"
case moon_alt_waxing_crescent_4 = "\u{0d3}"
case moon_alt_waxing_crescent_5 = "\u{0d4}"
case moon_alt_waxing_crescent_6 = "\u{0d5}"
case moon_alt_first_quarter = "\u{0d6}"
case moon_alt_waxing_gibbous_1 = "\u{0d7}"
case moon_alt_waxing_gibbous_2 = "\u{0d8}"
case moon_alt_waxing_gibbous_3 = "\u{0d9}"
case moon_alt_waxing_gibbous_4 = "\u{0da}"
case moon_alt_waxing_gibbous_5 = "\u{0db}"
case moon_alt_waxing_gibbous_6 = "\u{0dc}"
case moon_alt_full = "\u{0dd}"
case moon_alt_waning_gibbous_1 = "\u{0de}"
case moon_alt_waning_gibbous_2 = "\u{0df}"
case moon_alt_waning_gibbous_3 = "\u{0e0}"
case moon_alt_waning_gibbous_4 = "\u{0e1}"
case moon_alt_waning_gibbous_5 = "\u{0e2}"
case moon_alt_waning_gibbous_6 = "\u{0e3}"
case moon_alt_third_quarter = "\u{0e4}"
case moon_alt_waning_crescent_1 = "\u{0e5}"
case moon_alt_waning_crescent_2 = "\u{0e6}"
case moon_alt_waning_crescent_3 = "\u{0e7}"
case moon_alt_waning_crescent_4 = "\u{0e8}"
case moon_alt_waning_crescent_5 = "\u{0e9}"
case moon_alt_waning_crescent_6 = "\u{0ea}"
case time_1 = "\u{08a}"
case time_2 = "\u{08b}"
case time_3 = "\u{08c}"
case time_4 = "\u{08d}"
case time_5 = "\u{08e}"
case time_6 = "\u{08f}"
case time_7 = "\u{090}"
case time_8 = "\u{091}"
case time_9 = "\u{092}"
case time_10 = "\u{093}"
case time_11 = "\u{094}"
case time_12 = "\u{089}"
case direction_up = "\u{058}"
case direction_up_right = "\u{057}"
case direction_right = "\u{04d}"
case direction_down_right = "\u{088}"
case direction_down = "\u{044}"
case direction_down_left = "\u{043}"
case direction_left = "\u{048}"
case direction_up_left = "\u{087}"
case wind_beaufort_0 = "\u{0b7}"
case wind_beaufort_1 = "\u{0b8}"
case wind_beaufort_2 = "\u{0b9}"
case wind_beaufort_3 = "\u{0ba}"
case wind_beaufort_4 = "\u{0bb}"
case wind_beaufort_5 = "\u{0bc}"
case wind_beaufort_6 = "\u{0bd}"
case wind_beaufort_7 = "\u{0be}"
case wind_beaufort_8 = "\u{0bf}"
case wind_beaufort_9 = "\u{0c0}"
case wind_beaufort_10 = "\u{0c1}"
case wind_beaufort_11 = "\u{0c2}"
case wind_beaufort_12 = "\u{0c3}"
} | mit | 692ea099a27d20356ea826dd5ef88e32 | 34.469565 | 48 | 0.572882 | 2.765085 | false | false | false | false |
maxim-pervushin/Overlap | Overlap/App/View Controllers/TimezonePicker/TimezonePickerViewController.swift | 1 | 3679 | //
// TimeZonePickerViewController.swift
// Overlap
//
// Created by Maxim Pervushin on 01/05/16.
// Copyright © 2016 Maxim Pervushin. All rights reserved.
//
import UIKit
class TimeZonePickerViewController: UIViewController {
// MARK: @IB
@IBOutlet weak var tableView: UITableView?
@IBOutlet weak var searchBar: UISearchBar?
@IBAction func cancelButtonAction(sender: AnyObject) {
dismissViewControllerAnimated(true, completion: nil)
}
@IBAction func pickButtonAction(sender: AnyObject) {
dismissViewControllerAnimated(true, completion: nil)
finished?()
}
// MARK: public
var timeZone: NSTimeZone {
set {
_timeZoneSet = newValue
reloadData()
}
get {
return _timeZoneSet
}
}
var finished: (Void -> Void)?
// MARK: override
override func viewDidLoad() {
super.viewDidLoad()
for name in NSTimeZone.knownTimeZoneNames() {
if let timeZone = NSTimeZone(name: name) {
_timeZoneList.append(timeZone)
}
}
updateFilter()
}
override func viewWillAppear(animated: Bool) {
super.viewWillAppear(animated)
reloadData()
}
// MARK: private
private var _timeZoneSet = NSTimeZone.localTimeZone()
private var _timeZoneList = [NSTimeZone]()
private var _timeZoneListFiltered = [NSTimeZone]() {
didSet {
reloadData()
}
}
private func updateFilter() {
if let searchBar = searchBar, text = searchBar.text where text.characters.count > 0 {
_timeZoneListFiltered = _timeZoneList.filter({
timezone -> Bool in
let name = timezone.name
if name.rangeOfString(text) != nil {
return true
}
if let localizedName = timezone.localizedName(.Standard, locale: NSLocale.currentLocale()) where localizedName.rangeOfString(text) != nil {
return true
}
return false
})
} else {
_timeZoneListFiltered = _timeZoneList
}
}
private func reloadData() {
tableView?.reloadData()
}
}
extension TimeZonePickerViewController: UITableViewDataSource {
func numberOfSectionsInTableView(tableView: UITableView) -> Int {
return 1
}
func tableView(tableView: UITableView, numberOfRowsInSection section: Int) -> Int {
return _timeZoneListFiltered.count
}
func tableView(tableView: UITableView, cellForRowAtIndexPath indexPath: NSIndexPath) -> UITableViewCell {
let cell = tableView.dequeueReusableCellWithIdentifier(TimeZoneCell.identifier, forIndexPath: indexPath) as! TimeZoneCell
let timezone = _timeZoneListFiltered[indexPath.row]
if timezone == self._timeZoneSet {
cell.accessoryType = .Checkmark
} else {
cell.accessoryType = .None
}
cell.timezone = timezone
return cell
}
}
extension TimeZonePickerViewController: UITableViewDelegate {
func tableView(tableView: UITableView, didSelectRowAtIndexPath indexPath: NSIndexPath) {
if let
cell = tableView.cellForRowAtIndexPath(indexPath) as? TimeZoneCell,
timezone = cell.timezone {
self.timeZone = timezone
}
tableView.deselectRowAtIndexPath(indexPath, animated: true)
}
}
extension TimeZonePickerViewController: UISearchBarDelegate {
func searchBar(searchBar: UISearchBar, textDidChange searchText: String) {
updateFilter()
}
} | mit | ff8c0e1d62037b1e3eb2a7f1ca06f83c | 26.251852 | 155 | 0.624524 | 5.514243 | false | false | false | false |
ainopara/Stage1st-Reader | Stage1st/Manager/Navigation/S1Animator.swift | 1 | 6384 | //
// S1Animator.swift
// Stage1st
//
// Created by Zheng Li on 5/14/16.
// Copyright © 2016 Renaissance. All rights reserved.
//
import UIKit
import CocoaLumberjack
class S1Animator: NSObject, UIViewControllerAnimatedTransitioning {
enum Direction: Int {
case push
case pop
}
let direction: Direction
init(direction: Direction) {
self.direction = direction
super.init()
}
func transitionDuration(using _: UIViewControllerContextTransitioning?) -> TimeInterval {
return 0.3
}
func animateTransition(using transitionContext: UIViewControllerContextTransitioning) {
guard
let toViewController = transitionContext.viewController(forKey: .to),
let fromViewController = transitionContext.viewController(forKey: .from)
else {
assert(false)
transitionContext.completeTransition(!transitionContext.transitionWasCancelled)
return
}
let containerView = transitionContext.containerView
// TODO: remove this workaround once it is no more necessary
toViewController.view.frame = containerView.bounds
// FIXME: will take no effect if toViewController clipsToBounds == true, maybe add the effect to a temp view
toViewController.view.layer.shadowOpacity = 0.5
toViewController.view.layer.shadowRadius = 5.0
toViewController.view.layer.shadowOffset = CGSize(width: 0.0, height: 0.0)
toViewController.view.layer.shadowPath = UIBezierPath(rect: toViewController.view.bounds).cgPath
let containerViewWidth = containerView.frame.width
switch direction {
case .push:
containerView.insertSubview(toViewController.view, aboveSubview: fromViewController.view)
fromViewController.view.transform = .identity
toViewController.view.transform = CGAffineTransform(translationX: containerViewWidth, y: 0.0)
case .pop:
containerView.insertSubview(toViewController.view, belowSubview: fromViewController.view)
fromViewController.view.transform = .identity
toViewController.view.transform = CGAffineTransform(translationX: -containerViewWidth / 2.0, y: 0.0)
}
let options: UIView.AnimationOptions = direction == .pop ? .curveLinear : .curveEaseInOut
UIView.animate(withDuration: transitionDuration(using: transitionContext), delay: 0.0, options: options, animations: { [weak self] in
guard let strongSelf = self else { return }
switch strongSelf.direction {
case .push:
fromViewController.view.transform = CGAffineTransform(translationX: -containerViewWidth / 2.0, y: 0.0)
toViewController.view.transform = .identity
case .pop:
fromViewController.view.transform = CGAffineTransform(translationX: containerViewWidth, y: 0.0)
toViewController.view.transform = .identity
}
}) { finished in
fromViewController.view.transform = .identity
toViewController.view.transform = .identity
transitionContext.completeTransition(!transitionContext.transitionWasCancelled)
}
}
}
// MARK: -
protocol CardWithBlurredBackground {
var backgroundBlurView: UIVisualEffectView { get }
var containerView: UIView { get }
}
class S1ModalAnimator: NSObject, UIViewControllerAnimatedTransitioning {
let presentType: PresentType
enum PresentType {
case present
case dismissal
}
init(presentType: PresentType) {
self.presentType = presentType
}
func transitionDuration(using _: UIViewControllerContextTransitioning?) -> TimeInterval {
return 0.3
}
func animateTransition(using transitionContext: UIViewControllerContextTransitioning) {
switch presentType {
case .present:
guard let toViewController = transitionContext.viewController(forKey: .to) else {
assert(false)
transitionContext.completeTransition(!transitionContext.transitionWasCancelled)
return
}
let containerView = transitionContext.containerView
guard let targetViewController = toViewController as? CardWithBlurredBackground else {
assert(false)
transitionContext.completeTransition(!transitionContext.transitionWasCancelled)
return
}
let blurredBackgroundView = targetViewController.backgroundBlurView
let contentView = targetViewController.containerView
contentView.alpha = 0.0
contentView.transform = CGAffineTransform.init(scaleX: 0.9, y: 0.9)
containerView.addSubview(toViewController.view)
UIView.animate(withDuration: transitionDuration(using: transitionContext), animations: {
blurredBackgroundView.effect = UIBlurEffect(style: .dark)
contentView.alpha = 1.0
contentView.transform = CGAffineTransform.identity
}) { _ in
transitionContext.completeTransition(!transitionContext.transitionWasCancelled)
}
case .dismissal:
guard let fromViewController = transitionContext.viewController(forKey: .from) else {
assert(false)
transitionContext.completeTransition(!transitionContext.transitionWasCancelled)
return
}
guard let targetViewController = fromViewController as? CardWithBlurredBackground else {
assert(false)
transitionContext.completeTransition(!transitionContext.transitionWasCancelled)
return
}
let blurredBackgroundView = targetViewController.backgroundBlurView
let contentView = targetViewController.containerView
UIView.animate(withDuration: transitionDuration(using: transitionContext), animations: {
contentView.alpha = 0.0
contentView.transform = CGAffineTransform(scaleX: 0.9, y: 0.9)
blurredBackgroundView.effect = nil
}) { _ in
transitionContext.completeTransition(!transitionContext.transitionWasCancelled)
}
}
}
}
| bsd-3-clause | 9565403ab87e0d873778d58f842f2362 | 39.916667 | 141 | 0.666144 | 6.004704 | false | false | false | false |
ainopara/Stage1st-Reader | Stage1st/Manager/Parser.swift | 1 | 3641 | //
// Parser.swift
// Stage1st
//
// Created by Zheng Li on 2019/3/9.
// Copyright © 2019 Renaissance. All rights reserved.
//
import Foundation
enum Parser {
static func extractTopic(from urlString: String) -> S1Topic? {
// Current Html Scheme
let result1 = S1Global.regexExtract(from: urlString, withPattern: #"thread-([0-9]+)-([0-9]+)-[0-9]+\.html"#, andColums: [1, 2]) ?? []
if result1.count == 2 {
let topicIDString = result1[0]
let topicPageString = result1[1]
if let topicID = Int(topicIDString), let topicPage = Int(topicPageString) {
let topic = S1Topic(topicID: NSNumber(value: topicID))
topic.lastViewedPage = NSNumber(value: topicPage)
S1LogDebug("Extract Topic \(topic)")
return topic
}
}
// Old Html Scheme
let result2 = S1Global.regexExtract(from: urlString, withPattern: #""read-htm-tid-([0-9]+)\.html""#, andColums: [1]) ?? []
if result2.count == 1 {
let topicIDString = result2[0]
if let topicID = Int(topicIDString) {
let topic = S1Topic(topicID: NSNumber(value: topicID))
topic.lastViewedPage = 1
S1LogDebug("Extract Topic \(topic)")
return topic
}
}
// PHP Scheme
let queryDict = self.extractQuerys(from: urlString)
if
let topicIDString = queryDict["tid"],
let topicPageString = queryDict["page"],
let topicID = Int(topicIDString),
let topicPage = Int(topicPageString)
{
let topic = S1Topic(topicID: NSNumber(value: topicID))
topic.lastViewedPage = NSNumber(value: topicPage)
topic.locateFloorIDTag = URLComponents(string: urlString)?.fragment
S1LogDebug("Extract Topic \(topic)")
return topic
}
S1LogError("Failed to Extract topic from \(urlString)")
return nil
}
static func extractQuerys(from urlString: String) -> [String: String] {
var result = [String: String]()
guard let components = URLComponents(string: urlString) else {
return result
}
for item in components.queryItems ?? [] {
result[item.name] = item.value
}
return result
}
static func replyFloorInfo(from responseString: String?) -> [String: String]? {
guard let responseString = responseString else { return nil }
let pattern = "<input[^>]*name=\"([^>\"]*)\"[^>]*value=\"([^>\"]*)\""
let re = try! NSRegularExpression(pattern: pattern, options: [.anchorsMatchLines])
let results = re.matches(in: responseString, options: [], range: NSRange(responseString.startIndex..., in: responseString))
guard results.count > 0 else {
return nil
}
var info = [String: String]()
for result in results {
if
let keyRange = Range(result.range(at: 1), in: responseString),
let valueRange = Range(result.range(at: 2), in: responseString)
{
let key = responseString[keyRange]
let value = responseString[valueRange]
if key == "noticetrimstr" {
info[String(key)] = String(value).aibo_stringByUnescapingFromHTML()
} else {
info[String(key)] = String(value)
}
} else {
assertionFailure()
}
}
return info
}
}
| bsd-3-clause | 0233714f10a216f3b2a46e1c7e1837ce | 32.703704 | 141 | 0.550824 | 4.54432 | false | false | false | false |
tensorflow/swift-models | Gym/PPO/Categorical.swift | 1 | 4105 | // Copyright 2020 The TensorFlow Authors. All Rights Reserved.
//
// Licensed under the Apache License, Version 2.0 (the "License");
// you may not use this file except in compliance with the License.
// You may obtain a copy of the License at
//
// http://www.apache.org/licenses/LICENSE-2.0
//
// Unless required by applicable law or agreed to in writing, software
// distributed under the License is distributed on an "AS IS" BASIS,
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
// See the License for the specific language governing permissions and
// limitations under the License.
import TensorFlow
// Below code comes from eaplatanios/swift-rl:
// https://github.com/eaplatanios/swift-rl/blob/master/Sources/ReinforcementLearning/Utilities/Protocols.swift
public protocol Batchable {
func flattenedBatch(outerDimCount: Int) -> Self
func unflattenedBatch(outerDims: [Int]) -> Self
}
public protocol DifferentiableBatchable: Batchable, Differentiable {
@differentiable(wrt: self)
func flattenedBatch(outerDimCount: Int) -> Self
@differentiable(wrt: self)
func unflattenedBatch(outerDims: [Int]) -> Self
}
extension Tensor: Batchable {
public func flattenedBatch(outerDimCount: Int) -> Tensor {
if outerDimCount == 1 {
return self
}
var newShape = [-1]
for i in outerDimCount..<rank {
newShape.append(shape[i])
}
return reshaped(to: TensorShape(newShape))
}
public func unflattenedBatch(outerDims: [Int]) -> Tensor {
if rank > 1 {
return reshaped(to: TensorShape(outerDims + shape.dimensions[1...]))
}
return reshaped(to: TensorShape(outerDims))
}
}
extension Tensor: DifferentiableBatchable where Scalar: TensorFlowFloatingPoint {
@differentiable(wrt: self)
public func flattenedBatch(outerDimCount: Int) -> Tensor {
if outerDimCount == 1 {
return self
}
var newShape = [-1]
for i in outerDimCount..<rank {
newShape.append(shape[i])
}
return reshaped(to: TensorShape(newShape))
}
@differentiable(wrt: self)
public func unflattenedBatch(outerDims: [Int]) -> Tensor {
if rank > 1 {
return reshaped(to: TensorShape(outerDims + shape.dimensions[1...]))
}
return reshaped(to: TensorShape(outerDims))
}
}
// Below code comes from eaplatanios/swift-rl:
// https://github.com/eaplatanios/swift-rl/blob/master/Sources/ReinforcementLearning/Distributions/Distribution.swift
public protocol Distribution {
associatedtype Value
func entropy() -> Tensor<Float>
/// Returns a random sample drawn from this distribution.
func sample() -> Value
}
public protocol DifferentiableDistribution: Distribution, Differentiable {
@differentiable(wrt: self)
func entropy() -> Tensor<Float>
}
// Below code comes from eaplatanios/swift-rl:
// https://github.com/eaplatanios/swift-rl/blob/master/Sources/ReinforcementLearning/Distributions/Categorical.swift
public struct Categorical<Scalar: TensorFlowIndex>: DifferentiableDistribution, KeyPathIterable {
/// Log-probabilities of this categorical distribution.
public var logProbabilities: Tensor<Float>
@inlinable
@differentiable(wrt: probabilities)
public init(probabilities: Tensor<Float>) {
self.logProbabilities = log(probabilities)
}
@inlinable
@differentiable(wrt: self)
public func entropy() -> Tensor<Float> {
-(logProbabilities * exp(logProbabilities)).sum(squeezingAxes: -1)
}
@inlinable
public func sample() -> Tensor<Scalar> {
let seed = Context.local.randomSeed
let outerDimCount = self.logProbabilities.rank - 1
let logProbabilities = self.logProbabilities.flattenedBatch(outerDimCount: outerDimCount)
let multinomial: Tensor<Scalar> = _Raw.multinomial(
logits: logProbabilities,
numSamples: Tensor<Int32>(1),
seed: Int64(seed.graph),
seed2: Int64(seed.op))
let flattenedSamples = multinomial.gathering(atIndices: Tensor<Int32>(0), alongAxis: 1)
return flattenedSamples.unflattenedBatch(
outerDims: [Int](self.logProbabilities.shape.dimensions[0..<outerDimCount]))
}
}
| apache-2.0 | 3f277ab82b31f611ce385a2a53df60ee | 32.647541 | 117 | 0.728136 | 4.218911 | false | false | false | false |
pyconjp/pyconjp-ios | PyConJP/View/UITableViewCell/StaffTableViewCell.swift | 1 | 1844 | //
// StaffTableViewCell.swift
// PyConJP
//
// Created by Yutaro Muta on 9/10/16.
// Copyright © 2016 PyCon JP. All rights reserved.
//
import UIKit
class StaffTableViewCell: UITableViewCell {
@IBOutlet weak var nameLabel: UILabel!
@IBOutlet weak var roleLabel: UILabel!
@IBOutlet weak var facebookButton: UIButton!
@IBOutlet weak var twitterButton: UIButton!
static let estimatedRowHeight: CGFloat = 100
private var facebookAction: (() -> Void)?
private var twitterAction: (() -> Void)?
override func prepareForReuse() {
nameLabel.text = nil
roleLabel.text = nil
toggleFacebookButton(enabled: false)
toggleTwitterButton(enabled: false)
}
func fill(staff: Staff, onFacebookButton: @escaping (() -> Void), onTwitterButton: @escaping (() -> Void)) {
nameLabel.text = staff.name
roleLabel.text = staff.role
toggleFacebookButton(enabled: !staff.facebook.isEmpty)
toggleTwitterButton(enabled: !staff.twitter.isEmpty)
facebookAction = onFacebookButton
twitterAction = onTwitterButton
}
private func toggleFacebookButton(enabled: Bool) {
facebookButton.isEnabled = enabled
facebookButton.backgroundColor = enabled ? UIColor.facebook : UIColor.silver
}
private func toggleTwitterButton(enabled: Bool) {
twitterButton.isEnabled = enabled
twitterButton.backgroundColor = enabled ? UIColor.twitter : UIColor.silver
}
@IBAction func onFacebookButton(_ sender: UIButton) {
guard let facebookAction = facebookAction else { return }
facebookAction()
}
@IBAction func onTwitterButton(_ sender: UIButton) {
guard let twitterAction = twitterAction else { return }
twitterAction()
}
}
| mit | 3a44259bca6d6a376c3d008095ea7e59 | 30.237288 | 112 | 0.66522 | 4.99458 | false | false | false | false |
VirrageS/TDL | TDL/DetailTagViewController.swift | 1 | 4121 | import UIKit
class DetailTagViewController: UITableViewController, SlideNavigationControllerDelegate {
var detailTagTasks = [Task]()
var tag: Tag?
func shouldDisplayMenu() -> Bool {
return false
}
init(tag: Tag) {
super.init(nibName: nil, bundle: nil)
title = tag.name
self.tag = tag
}
override func viewWillAppear(animated: Bool) {
super.viewWillAppear(animated)
detailTagTasks.removeAll(keepCapacity: false)
if allTasks.count > 0 {
for i in 0...allTasks.count-1 {
if allTasks[i].tag == nil {
if self.tag!.name.lowercaseString == "none" {
detailTagTasks.append(allTasks[i])
}
} else {
if allTasks[i].tag!.name.lowercaseString == self.tag!.name.lowercaseString {
detailTagTasks.append(allTasks[i])
}
}
}
}
tableView.reloadData()
}
override func viewDidLoad() {
super.viewDidLoad()
if tag?.enabled != false {
let addButtonItem = UIBarButtonItem(barButtonSystemItem: .Edit, target: self, action: "openEditTagViewController:")
navigationItem.rightBarButtonItem = addButtonItem
}
tableView.backgroundColor = UIColor.whiteColor()
tableView.separatorColor = UIColor(red: 0/255, green: 0/255, blue: 0/255, alpha: 0)
tableView.registerClass(TaskCell.self, forCellReuseIdentifier: NSStringFromClass(TaskCell))
tableView.registerClass(NoTaskCell.self, forCellReuseIdentifier: NSStringFromClass(NoTaskCell))
}
override func numberOfSectionsInTableView(tableView: UITableView) -> Int {
return 1
}
override func tableView(tableView: UITableView, numberOfRowsInSection section: Int) -> Int {
return (detailTagTasks.count > 0 ? detailTagTasks.count : 1)
}
override func tableView(tableView: UITableView, cellForRowAtIndexPath indexPath: NSIndexPath) -> UITableViewCell {
if (detailTagTasks.count > 0) {
let cell = tableView.dequeueReusableCellWithIdentifier(NSStringFromClass(TaskCell), forIndexPath: indexPath) as! TaskCell
cell.configureCell(detailTagTasks[indexPath.row])
return cell as TaskCell
}
let cell = tableView.dequeueReusableCellWithIdentifier(NSStringFromClass(NoTaskCell), forIndexPath: indexPath) as! NoTaskCell
tableView.scrollEnabled = false
return cell as NoTaskCell
}
override func tableView(tableView: UITableView, didSelectRowAtIndexPath indexPath: NSIndexPath) {
tableView.deselectRowAtIndexPath(indexPath, animated: true)
}
override func tableView(tableView: UITableView, heightForRowAtIndexPath indexPath: NSIndexPath) -> CGFloat {
// Row height for closed cell
if (detailTagTasks.count > 0) {
return taskCellHeight
}
return noTaskCellHeight
}
override func tableView(tableView: UITableView, shouldHighlightRowAtIndexPath indexPath: NSIndexPath) -> Bool {
let cell: AnyObject? = tableView.cellForRowAtIndexPath(indexPath)
if cell is NoTaskCell {
return false
}
return true
}
required init(coder aDecoder: NSCoder) {
fatalError("init(coder:) has not been implemented")
}
func openEditTagViewController(sender: AnyObject) {
let editTagViewController = EditTagViewController(tag: tag!)
let slideNavigation = SlideNavigationController().sharedInstance()
slideNavigation._delegate = editTagViewController
// Check if navigationController is nil
if navigationController == nil {
println("openAddTaskController - navigationController is nil")
return
}
navigationController!.pushViewController(editTagViewController, animated: true)
}
} | mit | ab818ba3be469a8ac6db83f42e311007 | 35.477876 | 133 | 0.631885 | 5.731572 | false | false | false | false |
cloudinary/cloudinary_ios | Cloudinary/Classes/Core/Features/CacheSystem/StorehouseLibrary/Core/Warehouse.swift | 1 | 5628 | //
// Warehouse.swift
//
// Copyright (c) 2020 Cloudinary (http://cloudinary.com)
//
// Permission is hereby granted, free of charge, to any person obtaining a copy
// of this software and associated documentation files (the "Software"), to deal
// in the Software without restriction, including without limitation the rights
// to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
// copies of the Software, and to permit persons to whom the Software is
// furnished to do so, subject to the following conditions:
//
// The above copyright notice and this permission notice shall be included in all
// copies or substantial portions of the Software.
//
// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
// IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
// FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
// AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
// LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
// OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
// SOFTWARE.
//
import Foundation
import Dispatch
///
/// Manage a storehouse with wares, generic over SoredType.
///
internal final class Warehouse<SoredType>
{
/// MARK: - Typealias
internal typealias Item = SoredType
/// MARK: - Private Properties
private let accessor : StorehouseAccessor<Item>
private let storehouse : StorehouseHybrid <Item>
/// MARK: - Public Computed Properties
internal var memoryCapacity : Int {
return accessor.memoryCapacity
}
internal var diskCapacity : Int {
return accessor.diskCapacity
}
internal var currentMemoryUsage : Int {
return accessor.currentMemoryUsage
}
internal var currentDiskUsage: Int {
return accessor.currentDiskUsage
}
/// MARK: - Initializers
///
/// Initialize a warehouse with configuration options.
///
/// - Parameters:
/// - memoryConfig: In memory storehouse configuration
/// - diskConfig : Disk storehouse configuration
/// - transformer : A transformer to use for conversion of the stored data into the file system
///
/// - Throws: Throw StorehouseError if any.
///
internal convenience init(memoryConfig: StorehouseConfigurationInMemory, diskConfig: StorehouseConfigurationDisk, transformer: StorehouseTransformer<Item>) throws
{
let disk = try StorehouseOnDisk<Item>(configuration: diskConfig, transformer: transformer)
let memory = StorehouseInMemory<Item>(configuration: memoryConfig)
let storage = StorehouseHybrid<Item>(inMemory: memory, onDisk: disk)
self.init(hybrid: storage)
}
///
/// Initialize a warehouse with configuration options.
///
/// - Parameters:
/// - memoryConfig: In memory storehouse configuration
/// - diskConfig : Disk storehouse configuration
/// - transformer : A transformer to use for conversion of the stored data into the file system
///
/// - Throws: Throw StorehouseError if any.
///
internal convenience init(purgingConfig: StorehouseConfigurationAutoPurging, diskConfig: StorehouseConfigurationDisk, transformer: StorehouseTransformer<Item>) throws
{
let disk = try StorehouseOnDisk (configuration: diskConfig, transformer: transformer)
let memory = StorehouseAutoPurging(configuration: purgingConfig, transformer: transformer)
let storage = StorehouseHybrid(inMemory: memory, onDisk: disk)
self.init(hybrid: storage)
}
///
/// Initialise a warehouse with a prepared storehouse.
///
/// - Parameter storage: The storehouse to use
internal init(hybrid storage: StorehouseHybrid<Item>)
{
let queue = DispatchQueue(label: "com.cloudinary.accessQueue", attributes: [.concurrent])
self.storehouse = storage
self.accessor = StorehouseAccessor(storage: storage, queue: queue)
}
internal func updateCacheCapacity(purgingConfig: StorehouseConfigurationAutoPurging, diskConfig: StorehouseConfigurationDisk, transformer: StorehouseTransformer<Item>) throws {
let disk = try StorehouseOnDisk (configuration: diskConfig, transformer: transformer)
let memory = StorehouseAutoPurging(configuration: purgingConfig, transformer: transformer)
let storage = StorehouseHybrid(inMemory: memory, onDisk: disk)
accessor.replaceStorage(storage)
}
}
extension Warehouse : StorehouseProtocol
{
@discardableResult
internal func entry(forKey key: String) throws -> StorehouseEntry<Item>
{
return try accessor.entry(forKey: key)
}
internal func removeObject(forKey key: String) throws
{
try accessor.removeObject(forKey: key)
}
internal func setObject(_ object: Item, forKey key: String, expiry: StorehouseExpiry? = nil) throws
{
try accessor.setObject(object, forKey: key, expiry: expiry)
}
internal func removeAll() throws
{
try accessor.removeAll()
}
internal func removeExpiredObjects() throws
{
try accessor.removeExpiredObjects()
}
internal func removeStoredObjects(since date: Date) throws
{
try accessor.removeStoredObjects(since: date)
}
internal func removeObjectIfExpired(forKey key: String) throws
{
try accessor.removeObjectIfExpired(forKey: key)
}
}
| mit | d36a51ada848a8402fd9e54aadfce4ab | 36.271523 | 180 | 0.693497 | 4.932515 | false | true | false | false |
n-miyo/ViewSizeChecker | ViewSizeChecker/ViewController.swift | 1 | 4407 | // -*- mode:swift -*-
import UIKit
class ViewController: UITableViewController {
@IBOutlet weak var displayScaleLabel: UILabel!
@IBOutlet weak var horizontalSizeLabel: UILabel!
@IBOutlet weak var verticalSizeLabel: UILabel!
@IBOutlet weak var screenScaleLabel: UILabel!
@IBOutlet weak var screenNativeScaleLabel: UILabel!
@IBOutlet weak var screenBoundsLabel: UILabel!
@IBOutlet weak var screenNativeBoundsLabel: UILabel!
@IBOutlet weak var navigationBarSizeLabel: UILabel!
@IBOutlet weak var tabBarSizeLabel: UILabel!
var hwMachine: String!
var displayScale: String!
var horizontalSize: String!
var verticalSize: String!
var screenScale: String!
var screenNativeScale: String!
var screenBounds: String!
var screenNativeBounds: String!
var navigationBarSize: String!
var tabBarSize: String!
override func viewDidLoad() {
super.viewDidLoad()
hwMachine = sysctlByName("hw.machine")
updateViews()
}
override func viewWillTransitionToSize(
size: CGSize,
withTransitionCoordinator coordinator:
UIViewControllerTransitionCoordinator) {
super.viewWillTransitionToSize(
size, withTransitionCoordinator:coordinator)
coordinator.animateAlongsideTransition(
nil,
completion: {
context in
self.updateViews()
})
}
@IBAction func pressedActionButton(sender: UIBarButtonItem) {
updateValues()
let a: [String] = [
"[\(hwMachine)]",
"",
"UITraitCollection:",
" displayScale: \(displayScale)",
" horizontalSize: \(horizontalSize)",
" verticalSize: \(verticalSize)",
"",
"UIScreen:",
" scale: \(screenScale)",
" nativeScale: \(screenNativeScale)",
" screenBounds: \(screenBounds)",
" nativeBounds: \(screenNativeBounds)",
"",
"MISC:",
" NavigationBar size: \(navigationBarSize)",
" TabBar size: \(tabBarSize)"
]
var s = ""
for x in a {
s += "\(x)\n"
}
let avc =
UIActivityViewController(activityItems:[s], applicationActivities:nil)
avc.popoverPresentationController?.barButtonItem = sender
navigationController!.presentViewController(
avc, animated:true, completion:nil)
}
// MARK: Private
private func updateViews() {
updateValues()
navigationItem.title = hwMachine
displayScaleLabel.text = displayScale
horizontalSizeLabel.text = horizontalSize
verticalSizeLabel.text = verticalSize
screenScaleLabel.text = screenScale
screenNativeScaleLabel.text = screenNativeScale
screenBoundsLabel.text = screenBounds
screenNativeBoundsLabel.text = screenNativeBounds
navigationBarSizeLabel.text = navigationBarSize
tabBarSizeLabel.text = tabBarSize
}
private func updateValues() {
let tc = self.view.traitCollection
displayScale = "\(tc.displayScale)"
horizontalSize = "\(tc.horizontalSizeClass)"
verticalSize = "\(tc.verticalSizeClass)"
let ms = UIScreen.mainScreen()
screenScale = "\(ms.scale)"
screenNativeScale = "\(ms.nativeScale)"
screenBounds = NSStringFromCGSize(ms.bounds.size)
screenNativeBounds = NSStringFromCGSize(ms.nativeBounds.size)
let n = navigationController!.navigationBar
navigationBarSize = NSStringFromCGSize(n.frame.size)
let t = tabBarController!.tabBar
tabBarSize = NSStringFromCGSize(t.frame.size)
}
private func sysctlByName(name: String) -> String {
return name.withCString {
cs in
var s: UInt = 0
sysctlbyname(cs, nil, &s, nil, 0)
var v = [CChar](count: Int(s)/sizeof(CChar), repeatedValue: 0)
sysctlbyname(cs, &v, &s, nil, 0)
return String.fromCString(v)!
}
}
}
extension UIUserInterfaceSizeClass: Printable {
public var description: String {
switch self {
case .Compact:
return "Compact"
case .Regular:
return "Regular"
default:
return "Unspecified"
}
}
}
// EOF
| mit | 34b12b8ee58c2db0a404f7d2b1156be2 | 29.604167 | 80 | 0.617881 | 5.3289 | false | false | false | false |
antonio081014/LeetCode-CodeBase | Swift/expression-add-operators.swift | 1 | 1185 | class Solution {
func addOperators(_ num: String, _ target: Int) -> [String] {
var result = [String]()
let num = Array(num)
func dfs(_ path: String, _ currentIndex: Int, _ value: Int, _ lastValue: Int) {
if currentIndex == num.count {
if value == target {
result.append(path)
}
return
}
var sum = 0
for index in currentIndex ..< num.count {
if num[currentIndex] == Character("0"), index != currentIndex {
return
}
sum = sum * 10 + Int(String(num[index]))!
if currentIndex == 0 {
dfs(path + "\(sum)", index + 1, sum, sum)
} else {
dfs(path + "+\(sum)", index + 1, value + sum, sum)
dfs(path + "-\(sum)", index + 1, value - sum, -sum)
dfs(path + "*\(sum)", index + 1, value - lastValue + lastValue * sum, lastValue * sum)
}
}
}
dfs("", 0, 0, 0)
return result
}
}
| mit | 3ae5cf63374aca938cc6160f9c7a9c2d | 33.852941 | 106 | 0.396624 | 4.759036 | false | false | false | false |
away4m/Vendors | Vendors/Extensions/Optional.swift | 1 | 3911 | //
// Optional.swift
// Pods
//
// Created by ALI KIRAN on 3/26/17.
//
//
import Foundation
// https://github.com/RuiAAPeres/OptionalExtensions
public extension Optional {
/// SwifterSwift: Get self of default value (if self is nil).
///
/// let foo: String? = nil
/// print(foo.unwrapped(or: "bar")) -> "bar"
///
/// let bar: String? = "bar"
/// print(bar.unwrapped(or: "foo")) -> "bar"
///
/// - Parameter defaultValue: default value to return if self is nil.
/// - Returns: self if not nil or default value if nil.
public func unwrapped(or defaultValue: Wrapped) -> Wrapped {
// http://www.russbishop.net/improving-optionals
return self ?? defaultValue
}
/// SwifterSwift: Gets the wrapped value of an optional. If the optional is `nil`, throw a custom error.
///
/// let foo: String? = nil
/// try print(foo.unwrapped(or: MyError.notFound)) -> error: MyError.notFound
///
/// let bar: String? = "bar"
/// try print(bar.unwrapped(or: MyError.notFound)) -> "bar"
///
/// - Parameter error: The error to throw if the optional is `nil`.
/// - Returns: The value wrapped by the optional.
/// - Throws: The error passed in.
public func unwrapped(or error: Error) throws -> Wrapped {
guard let wrapped = self else { throw error }
return wrapped
}
/// SwifterSwift: Runs a block to Wrapped if not nil
///
/// let foo: String? = nil
/// foo.run { unwrappedFoo in
/// // block will never run sice foo is nill
/// print(unwrappedFoo)
/// }
///
/// let bar: String? = "bar"
/// bar.run { unwrappedBar in
/// // block will run sice bar is not nill
/// print(unwrappedBar) -> "bar"
/// }
///
/// - Parameter block: a block to run if self is not nil.
public func run(_ block: (Wrapped) -> Void) {
// http://www.russbishop.net/improving-optionals
_ = map(block)
}
/// SwifterSwift: Assign an optional value to a variable only if the value is not nil.
///
/// let someParameter: String? = nil
/// let parameters = [String:Any]() //Some parameters to be attached to a GET request
/// parameters[someKey] ??= someParameter //It won't be added to the parameters dict
///
/// - Parameters:
/// - lhs: Any?
/// - rhs: Any?
public static func ??= (lhs: inout Optional, rhs: Optional) {
guard let rhs = rhs else { return }
lhs = rhs
}
// func filter(_ predicate: (Wrapped) -> Bool) -> Optional {
// return map(predicate) == .some(true) ? self : .none
// }
// func mapNil(_ predicate: () -> Wrapped) -> Optional {
// return self ?? .some(predicate())
// }
//
// func flatMapNil(_ predicate: () -> Optional) -> Optional {
// return self ?? predicate()
// }
// func then(_ f: (Wrapped) -> Void) {
// if let wrapped = self { f(wrapped) }
// }
// func maybe<U>(_ defaultValue: U, f: (Wrapped) -> U) -> U {
// return map(f) ?? defaultValue
// }
// func onSome(_ f: (Wrapped) -> Void) -> Optional {
// then(f)
// return self
// }
// func onNone(_ f: () -> Void) -> Optional {
// if isNone { f() }
// return self
// }
//
// var isSome: Bool {
// return self != nil
// }
//
// var isNone: Bool {
// return !isSome
// }
}
// MARK: - Methods (Collection)
public extension Optional where Wrapped: Collection {
/// Check if optional is nil or empty collection.
public var isNilOrEmpty: Bool {
guard let collection = self else { return true }
return collection.isEmpty
}
}
// MARK: - Operators
infix operator ??=: AssignmentPrecedence
| mit | 6bfd53ba03c3aef5fafcdabbe81f0714 | 29.554688 | 108 | 0.543595 | 3.811891 | false | false | false | false |
JC-Hu/ColorExpert | Pods/FirebaseCoreInternal/FirebaseCore/Internal/Sources/HeartbeatLogging/RingBuffer.swift | 1 | 2808 | // Copyright 2021 Google LLC
//
// Licensed under the Apache License, Version 2.0 (the "License");
// you may not use this file except in compliance with the License.
// You may obtain a copy of the License at
//
// http://www.apache.org/licenses/LICENSE-2.0
//
// Unless required by applicable law or agreed to in writing, software
// distributed under the License is distributed on an "AS IS" BASIS,
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
// See the License for the specific language governing permissions and
// limitations under the License.
import Foundation
/// A generic circular queue structure.
struct RingBuffer<Element>: Sequence {
/// An array of heartbeats treated as a circular queue and intialized with a fixed capacity.
private var circularQueue: [Element?]
/// The current "tail" and insert point for the `circularQueue`.
private var tailIndex: Int = 0
/// Designated initializer.
/// - Parameter capacity: An `Int` representing the capacity.
init(capacity: Int) {
circularQueue = Array(repeating: nil, count: capacity)
}
/// Pushes an element to the back of the buffer, returning the element (`Element?`) that was overwritten.
/// - Parameter element: The element to push to the back of the buffer.
/// - Returns: The element that was overwritten or `nil` if nothing was overwritten.
/// - Complexity: O(1)
@discardableResult
mutating func push(_ element: Element) -> Element? {
guard circularQueue.count > 0 else {
// Do not push if `circularQueue` is a fixed empty array.
return nil
}
defer {
// Increment index, wrapping around to the start if needed.
tailIndex += 1
tailIndex %= circularQueue.count
}
let replaced = circularQueue[tailIndex]
circularQueue[tailIndex] = element
return replaced
}
/// Pops an element from the back of the buffer, returning the element (`Element?`) that was popped.
/// - Returns: The element that was popped or `nil` if there was no element to pop.
/// - Complexity: O(1)
@discardableResult
mutating func pop() -> Element? {
guard circularQueue.count > 0 else {
// Do not pop if `circularQueue` is a fixed empty array.
return nil
}
// Decrement index, wrapping around to the back if needed.
tailIndex -= 1
if tailIndex < 0 {
tailIndex = circularQueue.count - 1
}
guard let popped = circularQueue[tailIndex] else {
return nil // There is no element to pop.
}
circularQueue[tailIndex] = nil
return popped
}
func makeIterator() -> IndexingIterator<[Element]> {
circularQueue
.compactMap { $0 } // Remove `nil` elements.
.makeIterator()
}
}
// MARK: - Codable
extension RingBuffer: Codable where Element: Codable {}
| mit | 4510e23df1a975dde3d46d67d5d10165 | 31.651163 | 107 | 0.686254 | 4.443038 | false | false | false | false |
hooman/swift | stdlib/public/core/ArrayShared.swift | 5 | 13295 | //===--- ArrayShared.swift ------------------------------------*- swift -*-===//
//
// This source file is part of the Swift.org open source project
//
// Copyright (c) 2014 - 2018 Apple Inc. and the Swift project authors
// Licensed under Apache License v2.0 with Runtime Library Exception
//
// See https://swift.org/LICENSE.txt for license information
// See https://swift.org/CONTRIBUTORS.txt for the list of Swift project authors
//
/// This type is used as a result of the `_checkSubscript` call to associate the
/// call with the array access call it guards.
///
/// In order for the optimizer see that a call to `_checkSubscript` is semantically
/// associated with an array access, a value of this type is returned and later passed
/// to the accessing function. For example, a typical call to `_getElement` looks like
/// let token = _checkSubscript(index, ...)
/// return _getElement(index, ... , matchingSubscriptCheck: token)
@frozen
public struct _DependenceToken {
@inlinable
public init() {
}
}
/// Returns an Array of `_count` uninitialized elements using the
/// given `storage`, and a pointer to uninitialized memory for the
/// first element.
///
/// This function is referenced by the compiler to allocate array literals.
///
/// - Precondition: `storage` is `_ContiguousArrayStorage`.
@inlinable // FIXME(inline-always)
@inline(__always)
@_semantics("array.uninitialized_intrinsic")
public // COMPILER_INTRINSIC
func _allocateUninitializedArray<Element>(_ builtinCount: Builtin.Word)
-> (Array<Element>, Builtin.RawPointer) {
let count = Int(builtinCount)
if count > 0 {
// Doing the actual buffer allocation outside of the array.uninitialized
// semantics function enables stack propagation of the buffer.
let bufferObject = Builtin.allocWithTailElems_1(
_ContiguousArrayStorage<Element>.self, builtinCount, Element.self)
let (array, ptr) = Array<Element>._adoptStorage(bufferObject, count: count)
return (array, ptr._rawValue)
}
// For an empty array no buffer allocation is needed.
let (array, ptr) = Array<Element>._allocateUninitialized(count)
return (array, ptr._rawValue)
}
// Referenced by the compiler to deallocate array literals on the
// error path.
@inlinable
@_semantics("array.dealloc_uninitialized")
public // COMPILER_INTRINSIC
func _deallocateUninitializedArray<Element>(
_ array: __owned Array<Element>
) {
var array = array
array._deallocateUninitialized()
}
#if !INTERNAL_CHECKS_ENABLED
@_alwaysEmitIntoClient
@_semantics("array.finalize_intrinsic")
@_effects(readnone)
public // COMPILER_INTRINSIC
func _finalizeUninitializedArray<Element>(
_ array: __owned Array<Element>
) -> Array<Element> {
var mutableArray = array
mutableArray._endMutation()
return mutableArray
}
#else
// When asserts are enabled, _endCOWMutation writes to _native.isImmutable
// So we cannot have @_effects(readnone)
@_alwaysEmitIntoClient
@_semantics("array.finalize_intrinsic")
public // COMPILER_INTRINSIC
func _finalizeUninitializedArray<Element>(
_ array: __owned Array<Element>
) -> Array<Element> {
var mutableArray = array
mutableArray._endMutation()
return mutableArray
}
#endif
extension Collection {
// Utility method for collections that wish to implement
// CustomStringConvertible and CustomDebugStringConvertible using a bracketed
// list of elements, like an array.
internal func _makeCollectionDescription(
withTypeName type: String? = nil
) -> String {
var result = ""
if let type = type {
result += "\(type)(["
} else {
result += "["
}
var first = true
for item in self {
if first {
first = false
} else {
result += ", "
}
debugPrint(item, terminator: "", to: &result)
}
result += type != nil ? "])" : "]"
return result
}
}
extension _ArrayBufferProtocol {
@inlinable // FIXME @useableFromInline https://bugs.swift.org/browse/SR-7588
@inline(never)
internal mutating func _arrayOutOfPlaceReplace<C: Collection>(
_ bounds: Range<Int>,
with newValues: __owned C,
count insertCount: Int
) where C.Element == Element {
let growth = insertCount - bounds.count
let newCount = self.count + growth
var newBuffer = _forceCreateUniqueMutableBuffer(
newCount: newCount, requiredCapacity: newCount)
_arrayOutOfPlaceUpdate(
&newBuffer, bounds.lowerBound - startIndex, insertCount,
{ rawMemory, count in
var p = rawMemory
var q = newValues.startIndex
for _ in 0..<count {
p.initialize(to: newValues[q])
newValues.formIndex(after: &q)
p += 1
}
_expectEnd(of: newValues, is: q)
}
)
}
}
/// A _debugPrecondition check that `i` has exactly reached the end of
/// `s`. This test is never used to ensure memory safety; that is
/// always guaranteed by measuring `s` once and re-using that value.
@inlinable
internal func _expectEnd<C: Collection>(of s: C, is i: C.Index) {
_debugPrecondition(
i == s.endIndex,
"invalid Collection: count differed in successive traversals")
}
@inlinable
internal func _growArrayCapacity(_ capacity: Int) -> Int {
return capacity * 2
}
@_alwaysEmitIntoClient
internal func _growArrayCapacity(
oldCapacity: Int, minimumCapacity: Int, growForAppend: Bool
) -> Int {
if growForAppend {
if oldCapacity < minimumCapacity {
// When appending to an array, grow exponentially.
return Swift.max(minimumCapacity, _growArrayCapacity(oldCapacity))
}
return oldCapacity
}
// If not for append, just use the specified capacity, ignoring oldCapacity.
// This means that we "shrink" the buffer in case minimumCapacity is less
// than oldCapacity.
return minimumCapacity
}
//===--- generic helpers --------------------------------------------------===//
extension _ArrayBufferProtocol {
/// Create a unique mutable buffer that has enough capacity to hold 'newCount'
/// elements and at least 'requiredCapacity' elements. Set the count of the new
/// buffer to 'newCount'. The content of the buffer is uninitialized.
/// The formula used to compute the new buffers capacity is:
/// max(requiredCapacity, source.capacity) if newCount <= source.capacity
/// max(requiredCapacity, _growArrayCapacity(source.capacity)) otherwise
@inline(never)
@inlinable // @specializable
internal func _forceCreateUniqueMutableBuffer(
newCount: Int, requiredCapacity: Int
) -> _ContiguousArrayBuffer<Element> {
return _forceCreateUniqueMutableBufferImpl(
countForBuffer: newCount, minNewCapacity: newCount,
requiredCapacity: requiredCapacity)
}
/// Create a unique mutable buffer that has enough capacity to hold
/// 'minNewCapacity' elements and set the count of the new buffer to
/// 'countForNewBuffer'. The content of the buffer uninitialized.
/// The formula used to compute the new buffers capacity is:
/// max(minNewCapacity, source.capacity) if minNewCapacity <= source.capacity
/// max(minNewCapacity, _growArrayCapacity(source.capacity)) otherwise
@inline(never)
@inlinable // @specializable
internal func _forceCreateUniqueMutableBuffer(
countForNewBuffer: Int, minNewCapacity: Int
) -> _ContiguousArrayBuffer<Element> {
return _forceCreateUniqueMutableBufferImpl(
countForBuffer: countForNewBuffer, minNewCapacity: minNewCapacity,
requiredCapacity: minNewCapacity)
}
/// Create a unique mutable buffer that has enough capacity to hold
/// 'minNewCapacity' elements and at least 'requiredCapacity' elements and set
/// the count of the new buffer to 'countForBuffer'. The content of the buffer
/// uninitialized.
/// The formula used to compute the new capacity is:
/// max(requiredCapacity, source.capacity) if minNewCapacity <= source.capacity
/// max(requiredCapacity, _growArrayCapacity(source.capacity)) otherwise
@inlinable
internal func _forceCreateUniqueMutableBufferImpl(
countForBuffer: Int, minNewCapacity: Int,
requiredCapacity: Int
) -> _ContiguousArrayBuffer<Element> {
_internalInvariant(countForBuffer >= 0)
_internalInvariant(requiredCapacity >= countForBuffer)
_internalInvariant(minNewCapacity >= countForBuffer)
let minimumCapacity = Swift.max(requiredCapacity,
minNewCapacity > capacity
? _growArrayCapacity(capacity) : capacity)
return _ContiguousArrayBuffer(
_uninitializedCount: countForBuffer, minimumCapacity: minimumCapacity)
}
}
extension _ArrayBufferProtocol {
/// Initialize the elements of dest by copying the first headCount
/// items from source, calling initializeNewElements on the next
/// uninitialized element, and finally by copying the last N items
/// from source into the N remaining uninitialized elements of dest.
///
/// As an optimization, may move elements out of source rather than
/// copying when it isUniquelyReferenced.
@inline(never)
@inlinable // @specializable
internal mutating func _arrayOutOfPlaceUpdate(
_ dest: inout _ContiguousArrayBuffer<Element>,
_ headCount: Int, // Count of initial source elements to copy/move
_ newCount: Int, // Number of new elements to insert
_ initializeNewElements:
((UnsafeMutablePointer<Element>, _ count: Int) -> ()) = { ptr, count in
_internalInvariant(count == 0)
}
) {
_internalInvariant(headCount >= 0)
_internalInvariant(newCount >= 0)
// Count of trailing source elements to copy/move
let sourceCount = self.count
let tailCount = dest.count - headCount - newCount
_internalInvariant(headCount + tailCount <= sourceCount)
let oldCount = sourceCount - headCount - tailCount
let destStart = dest.firstElementAddress
let newStart = destStart + headCount
let newEnd = newStart + newCount
// Check to see if we have storage we can move from
if let backing = requestUniqueMutableBackingBuffer(
minimumCapacity: sourceCount) {
let sourceStart = firstElementAddress
let oldStart = sourceStart + headCount
// Destroy any items that may be lurking in a _SliceBuffer before
// its real first element
let backingStart = backing.firstElementAddress
let sourceOffset = sourceStart - backingStart
backingStart.deinitialize(count: sourceOffset)
// Move the head items
destStart.moveInitialize(from: sourceStart, count: headCount)
// Destroy unused source items
oldStart.deinitialize(count: oldCount)
initializeNewElements(newStart, newCount)
// Move the tail items
newEnd.moveInitialize(from: oldStart + oldCount, count: tailCount)
// Destroy any items that may be lurking in a _SliceBuffer after
// its real last element
let backingEnd = backingStart + backing.count
let sourceEnd = sourceStart + sourceCount
sourceEnd.deinitialize(count: backingEnd - sourceEnd)
backing.count = 0
}
else {
let headStart = startIndex
let headEnd = headStart + headCount
let newStart = _copyContents(
subRange: headStart..<headEnd,
initializing: destStart)
initializeNewElements(newStart, newCount)
let tailStart = headEnd + oldCount
let tailEnd = endIndex
_copyContents(subRange: tailStart..<tailEnd, initializing: newEnd)
}
self = Self(_buffer: dest, shiftedToStartIndex: startIndex)
}
}
extension _ArrayBufferProtocol {
@inline(never)
@usableFromInline
internal mutating func _outlinedMakeUniqueBuffer(bufferCount: Int) {
if _fastPath(
requestUniqueMutableBackingBuffer(minimumCapacity: bufferCount) != nil) {
return
}
var newBuffer = _forceCreateUniqueMutableBuffer(
newCount: bufferCount, requiredCapacity: bufferCount)
_arrayOutOfPlaceUpdate(&newBuffer, bufferCount, 0)
}
/// Append items from `newItems` to a buffer.
@inlinable
internal mutating func _arrayAppendSequence<S: Sequence>(
_ newItems: __owned S
) where S.Element == Element {
// this function is only ever called from append(contentsOf:)
// which should always have exhausted its capacity before calling
_internalInvariant(count == capacity)
var newCount = self.count
// there might not be any elements to append remaining,
// so check for nil element first, then increase capacity,
// then inner-loop to fill that capacity with elements
var stream = newItems.makeIterator()
var nextItem = stream.next()
while nextItem != nil {
// grow capacity, first time around and when filled
var newBuffer = _forceCreateUniqueMutableBuffer(
countForNewBuffer: newCount,
// minNewCapacity handles the exponential growth, just
// need to request 1 more than current count/capacity
minNewCapacity: newCount + 1)
_arrayOutOfPlaceUpdate(&newBuffer, newCount, 0)
let currentCapacity = self.capacity
let base = self.firstElementAddress
// fill while there is another item and spare capacity
while let next = nextItem, newCount < currentCapacity {
(base + newCount).initialize(to: next)
newCount += 1
nextItem = stream.next()
}
self.count = newCount
}
}
}
| apache-2.0 | 9caabbe410221c30c0d6c0a6b518bf5f | 34.265252 | 87 | 0.701768 | 4.862838 | false | false | false | false |
pkl728/ZombieInjection | ZombieInjectionTests/ZombieServiceTests.swift | 1 | 2388 | //
// ZombieServiceTests.swift
// ZombieInjection
//
// Created by Patrick Lind on 7/27/16.
// Copyright © 2016 Patrick Lind. All rights reserved.
//
import XCTest
import Bond
@testable import ZombieInjection
class ZombieServiceTests: XCTestCase {
private var zombieRepository: ZombieRepositoryProtocol!
private var zombieService: ZombieServiceProtocol!
override func setUp() {
super.setUp()
// Put setup code here. This method is called before the invocation of each test method in the class.
self.zombieRepository = ZombieRepositoryMock()
self.zombieService = ZombieService(zombieRepository: self.zombieRepository)
}
override func tearDown() {
// Put teardown code here. This method is called after the invocation of each test method in the class.
super.tearDown()
self.zombieRepository.deleteAll()
}
func testFetchZombies() {
// Arrange
// Act
self.zombieService.fetchZombies()
// Assert
XCTAssert(self.zombieRepository.count() > 0)
}
func testGetZombies() {
// Arrange
// Act
let zombies = self.zombieService.getAllZombies()
// Assert
XCTAssert(zombies?.count == 3)
}
func testGetZombiesIfNoZombies() {
// Arrange
self.zombieRepository.deleteAll()
// Act
let zombies = self.zombieService.getAllZombies()
// Assert
XCTAssert(zombies?.count == 0)
}
func testUpdateZombie() {
// Arrange
let zombie = self.zombieRepository.get(0)
zombie?.name.value = "Test"
// Act
self.zombieService.update(zombie!)
// Assert
XCTAssert(self.zombieRepository.get(0)?.name.value == "Test")
}
func testUpdateWithNonExistentZombieDoesNothing() {
// Arrange
let badZombie = Zombie(id: -1, name: "Bad", imageUrlAddress: nil)
// Act
self.zombieService.update(badZombie)
// Assert
XCTAssert(self.zombieRepository.count() == 3)
XCTAssert(self.zombieRepository.get(0)?.name.value == "First")
XCTAssert(self.zombieRepository.get(1)?.name.value == "Second")
XCTAssert(self.zombieRepository.get(2)?.name.value == "Third")
}
}
| mit | 301d6e67bb6bee86a8eaef6ad72dc5d5 | 27.082353 | 111 | 0.607876 | 4.841785 | false | true | false | false |
Subsets and Splits