repo_name
stringlengths 6
91
| ref
stringlengths 12
59
| path
stringlengths 7
936
| license
stringclasses 15
values | copies
stringlengths 1
3
| content
stringlengths 61
714k
| hash
stringlengths 32
32
| line_mean
float64 4.88
60.8
| line_max
int64 12
421
| alpha_frac
float64 0.1
0.92
| autogenerated
bool 1
class | config_or_test
bool 2
classes | has_no_keywords
bool 2
classes | has_few_assignments
bool 1
class |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
theodinspire/FingerBlade | refs/heads/development | FingerBlade/SampleStore.swift | gpl-3.0 | 1 | //
// SampleStore.swift
// FingerBlade
//
// Created by Cormack on 2/10/17.
// Copyright © 2017 the Odin Spire. All rights reserved.
//
import Foundation
import UIKit
/// An object for storing the gesture sample data as well as organize their collection
class SampleStore {
private var trails = [CutLine : [[CGPoint]]]()
var cutsToMake: Int
var current: CutLine?
var cutList: [CutLine]
var iter: IndexingIterator<[CutLine]>
/// First cut of the sequence for the store
var first: CutLine? {
get {
return cutList.first
}
}
/// Consructor
///
/// - Parameters:
/// - numCuts: Number of gestures to collect for each CutLine
/// - cuts: The CutLine guestures collected by the object
init(cutsToMake numCuts: Int, cutList cuts: [CutLine]) {
cutsToMake = numCuts
cutList = cuts
iter = cutList.makeIterator()
}
/// Default constructor, using every CutLine with 10 lines each
convenience init () {
self.init(cutsToMake: 10, cutList: CutLine.all)
//3, cutList: [CutLine.fendManMez, .sotManTut, .punCav])
}
/// Add a sample
///
/// - Parameters:
/// - trail: Sample to be added
/// - cut: CutLine described by the sample
func put(trail: [CGPoint], into cut: CutLine) {
if trails.keys.contains(cut) {
trails[cut]?.append(trail)
} else {
trails[cut] = [trail]
}
}
/// Obtain samples
///
/// - Parameter cut: The CutLine which the samples describe
/// - Returns: Array of gesture trail samples
func get(from cut: CutLine) -> [[CGPoint]]? { return trails[cut] }
/// Get the next cut of the sequence
///
/// - Returns: Next cut whose samples are to be collected
func next() -> CutLine? {
current = iter.next()
return current
}
/// Descriptive string of the sample corpus. Organized and labeled by CutLine, each line is a sample consisting of the cartesian coordinates describing the sample
///
/// - Returns: A verbose string
func getVerboseString() -> String {
var text = ""
for (cut, trailList) in trails {
text += cut.rawValue + "\n"
for trail in trailList {
for (i, point) in trail.enumerated() {
text += (i != 0 ? ", " : "") + String(describing: point)
}
text += "\n"
}
text += "\n"
}
return text
}
}
| 00282b61d3a52538a66d99a854eb6d40 | 27.593407 | 166 | 0.558417 | false | false | false | false |
mengheangrat/Apsara | refs/heads/master | Apsara/Classes/ApsaraButton.swift | mit | 1 | //
// CustomizeButton.swift
// Apasara
//
// Created by Rat Mengheang on 1/27/17.
import Foundation
@IBDesignable class ApsaraButton: UIButton{
@IBInspectable var cornerRadius: CGFloat = 0 {
didSet{
layer.cornerRadius = cornerRadius
}
}
@IBInspectable var borderWidth: CGFloat = 0 {
didSet{
layer.borderWidth = borderWidth
}
}
@IBInspectable var borderColor: UIColor = UIColor.gray {
didSet{
layer.borderColor = borderColor.cgColor
}
}
}
| 0d3f0bf62aeefdb92340ec44cc9efbda | 17.393939 | 60 | 0.546952 | false | false | false | false |
huyphamthanh8290/HPUIViewExtensions | refs/heads/master | Pod/Classes/ViewExtensions/HPLabel.swift | mit | 1 | //
// HPLabel.swift
// Pods
//
// Created by Huy Pham on 11/2/15.
//
//
import UIKit
@IBDesignable
public class HPLabel: UILabel {
var internalProxy: UIInternalProxy?
// MARK: Init
override init(frame: CGRect) {
super.init(frame: frame)
internalProxy = UIInternalProxy(subjectView: self)
}
required public init?(coder aDecoder: NSCoder) {
super.init(coder: aDecoder)
internalProxy = UIInternalProxy(subjectView: self)
}
// MARK: Text
override public var text: String? {
get {
return super.text
}
set(newText) {
super.text = Utils.localizeWithDefinedMode(text: newText)
}
}
// MARK: Border
@IBInspectable public var borderColor: UIColor? {
didSet {
self.internalProxy?.borderColor = self.borderColor
}
}
@IBInspectable public var borderWidth: CGFloat = 0 {
didSet {
self.internalProxy?.borderWidth = self.borderWidth
}
}
// MARK: Corner
@IBInspectable public var cornerRadius: CGFloat = 0 {
didSet {
self.internalProxy?.cornerRadius = self.cornerRadius
}
}
@IBInspectable public var topLeftRounded: Bool = true {
didSet {
self.internalProxy?.topLeftRounded = self.topLeftRounded
}
}
@IBInspectable public var topRightRounded: Bool = true {
didSet {
self.internalProxy?.topRightRounded = self.topRightRounded
}
}
@IBInspectable public var botLeftRounded: Bool = true {
didSet {
self.internalProxy?.botLeftRounded = self.botLeftRounded
}
}
@IBInspectable public var botRightRounded: Bool = true {
didSet {
self.internalProxy?.botRightRounded = self.botRightRounded
}
}
// MARK: Padding
@IBInspectable public var paddingStart: Float = 0
@IBInspectable public var paddingEnd: Float = 0
@IBInspectable public var paddingTop: Float = 0
@IBInspectable public var paddingBottom: Float = 0
override public func drawText(in rect: CGRect) {
super.drawText(in: makeRectInset(bounds: bounds))
}
override public func textRect(forBounds bounds: CGRect, limitedToNumberOfLines numberOfLines: Int) -> CGRect {
return super.textRect(forBounds: makeRectInset(bounds: bounds), limitedToNumberOfLines: numberOfLines)
}
private func makeRectInset(bounds: CGRect) -> CGRect {
return UIEdgeInsetsInsetRect(bounds, UIEdgeInsetsMake(CGFloat(paddingTop), CGFloat(paddingStart), CGFloat(paddingBottom), CGFloat(paddingEnd)))
}
public override func didMoveToWindow() {
for ct: NSLayoutConstraint in self.constraints {
if type(of: ct) !== NSLayoutConstraint.self {
continue
}
if (ct.firstAttribute == NSLayoutAttribute.height && ct.firstItem as? HPLabel == self) || (ct.secondAttribute == NSLayoutAttribute.height && ct.secondItem as? HPLabel == self) {
print(ct.constant)
ct.constant += (CGFloat(paddingTop) + CGFloat(paddingBottom))
break
}
}
}
}
| 7fd79ec1bbcad80f9b26ea00d7da5c1e | 25.92 | 189 | 0.599703 | false | false | false | false |
danielallsopp/Charts | refs/heads/master | Tests/Charts/BarChartTests.swift | apache-2.0 | 1 | import XCTest
import FBSnapshotTestCase
@testable import Charts
class BarChartTests: FBSnapshotTestCase
{
var chart: BarChartView!
var dataSet: BarChartDataSet!
override func setUp()
{
super.setUp()
// Set to `true` to re-capture all snapshots
self.recordMode = false
// Sample data
let values: [Double] = [8, 104, 81, 93, 52, 44, 97, 101, 75, 28,
76, 25, 20, 13, 52, 44, 57, 23, 45, 91,
99, 14, 84, 48, 40, 71, 106, 41, 45, 61]
var entries: [ChartDataEntry] = Array()
var xValues: [String] = Array()
for (i, value) in values.enumerate()
{
entries.append(BarChartDataEntry.init(value: value, xIndex: i))
xValues.append("\(i)")
}
dataSet = BarChartDataSet(yVals: entries, label: "Bar chart unit test data")
chart = BarChartView(frame: CGRectMake(0, 0, 480, 350))
chart.backgroundColor = NSUIColor.clearColor()
chart.leftAxis.axisMinValue = 0.0
chart.rightAxis.axisMinValue = 0.0
chart.data = BarChartData(xVals: xValues, dataSet: dataSet)
}
override func tearDown()
{
// Put teardown code here. This method is called after the invocation of each test method in the class.
super.tearDown()
}
func testDefaultValues()
{
FBSnapshotVerifyView(chart)
}
func testHidesValues()
{
dataSet.drawValuesEnabled = false
FBSnapshotVerifyView(chart)
}
func testHideLeftAxis()
{
chart.leftAxis.enabled = false
FBSnapshotVerifyView(chart)
}
func testHideRightAxis()
{
chart.rightAxis.enabled = false
FBSnapshotVerifyView(chart)
}
func testHideHorizontalGridlines()
{
chart.leftAxis.drawGridLinesEnabled = false
chart.rightAxis.drawGridLinesEnabled = false
FBSnapshotVerifyView(chart)
}
func testHideVerticalGridlines()
{
chart.xAxis.drawGridLinesEnabled = false
FBSnapshotVerifyView(chart)
}
}
| e534d19ea4608ce6f7692f242c18b29f | 25.926829 | 111 | 0.57971 | false | true | false | false |
CaiMiao/CGSSGuide | refs/heads/master | DereGuide/View/CGSSSearchBar.swift | mit | 1 | //
// CGSSSearchBar.swift
// DereGuide
//
// Created by zzk on 2017/1/14.
// Copyright © 2017年 zzk. All rights reserved.
//
import UIKit
import SnapKit
class CGSSSearchBar: UISearchBar {
override init(frame: CGRect) {
super.init(frame: frame)
// 为了避免push/pop时闪烁,searchBar的背景图设置为透明的
for sub in self.subviews.first!.subviews {
if let iv = sub as? UIImageView {
iv.alpha = 0
}
}
autocapitalizationType = .none
autocorrectionType = .no
returnKeyType = .search
enablesReturnKeyAutomatically = false
}
required init?(coder aDecoder: NSCoder) {
fatalError("init(coder:) has not been implemented")
}
override var intrinsicContentSize: CGSize {
// fix a layout issue in iOS 11
if #available(iOS 11.0, *) {
return UILayoutFittingExpandedSize
} else {
return super.intrinsicContentSize
}
}
}
class SearchBarWrapper: UIView {
let searchBar: CGSSSearchBar
init(searchBar: CGSSSearchBar) {
self.searchBar = searchBar
super.init(frame: .zero)
addSubview(searchBar)
searchBar.snp.makeConstraints { (make) in
make.height.equalTo(44)
make.edges.equalToSuperview()
}
}
required init?(coder aDecoder: NSCoder) {
fatalError("init(coder:) has not been implemented")
}
override var intrinsicContentSize: CGSize {
return UILayoutFittingExpandedSize
}
}
| 8cc55abe05b98d5eee30d64e84a239e9 | 23.261538 | 59 | 0.599239 | false | false | false | false |
zhou9734/Warm | refs/heads/master | Warm/Classes/Home/View/CBtnContainerView.swift | mit | 1 | //
// CBtnContainerView.swift
// Warm
//
// Created by zhoucj on 16/9/25.
// Copyright © 2016年 zhoucj. All rights reserved.
//
import UIKit
class CBtnContainerView: UIView {
override init(frame: CGRect) {
super.init(frame: frame)
backgroundColor = UIColor.whiteColor()
setupUI()
}
required init?(coder aDecoder: NSCoder) {
fatalError("init(coder:) has not been implemented")
}
private func setupUI(){
//三个按钮
let btnWidth = (ScreenWidth - 2) / 3
experiDetailBtn.frame = CGRect(x: 0 , y: 0, width: btnWidth, height: 45.0)
addSubview(experiDetailBtn)
experiDetailBtn.selected = true
leftSpliteView.frame = CGRect(x: btnWidth, y: 7, width: 1.0, height: 30.0)
addSubview(leftSpliteView)
userBtn.frame = CGRect(x: btnWidth + 1, y: 0, width: btnWidth, height: 45.0)
addSubview(userBtn)
rightSpliteView.frame = CGRect(x: 2*btnWidth + 1, y: 7, width: 1.0, height: 30.0)
addSubview(rightSpliteView)
contactBtn.frame = CGRect(x: 2*btnWidth + 2, y: 0, width: btnWidth, height: 45.0)
addSubview(contactBtn)
}
private lazy var experiDetailBtn: UIButton = {
let btn = UIButton()
btn.setTitle("体验详情", forState: .Normal)
btn.setTitleColor(UIColor.blackColor(), forState: .Selected)
btn.setTitleColor(UIColor.grayColor(), forState: .Normal)
btn.titleLabel?.textAlignment = .Center
btn.tag = 1
btn.addTarget(self, action: Selector("experiDetailBtnClick:"), forControlEvents: .TouchUpInside)
btn.backgroundColor = Color_GlobalBackground
return btn
}()
private lazy var leftSpliteView : UIView = {
let v = UIView()
v.backgroundColor = SpliteColor
return v
}()
private lazy var userBtn: UIButton = {
let btn = UIButton()
btn.setTitle("手艺人", forState: .Normal)
btn.setTitleColor(UIColor.blackColor(), forState: .Selected)
btn.setTitleColor(UIColor.grayColor(), forState: .Normal)
btn.titleLabel?.textAlignment = .Center
btn.tag = 2
btn.addTarget(self, action: Selector("experiDetailBtnClick:"), forControlEvents: .TouchUpInside)
btn.backgroundColor = Color_GlobalBackground
return btn
}()
private lazy var rightSpliteView : UIView = {
let v = UIView()
v.backgroundColor = SpliteColor
return v
}()
private lazy var contactBtn: UIButton = {
let btn = UIButton()
btn.setTitle("如何体验", forState: .Normal)
btn.setTitleColor(UIColor.blackColor(), forState: .Selected)
btn.setTitleColor(UIColor.grayColor(), forState: .Normal)
btn.titleLabel?.textAlignment = .Center
btn.tag = 3
btn.addTarget(self, action: Selector("experiDetailBtnClick:"), forControlEvents: .TouchUpInside)
btn.backgroundColor = Color_GlobalBackground
return btn
}()
@objc private func experiDetailBtnClick(btn: UIButton){
NSNotificationCenter.defaultCenter().postNotificationName(SectionForSectionIndex, object: btn.tag)
}
}
| ab8e6e7efee9e5ac506167e78b5f26f5 | 36.975904 | 106 | 0.643084 | false | false | false | false |
qasim/CDFLabs | refs/heads/master | CDFLabs/Locations/LocationsViewController.swift | mit | 1 | //
// LocationsViewController.swift
// CDFLabs
//
// Created by Qasim Iqbal on 12/28/15.
// Copyright © 2015 Qasim Iqbal. All rights reserved.
//
import UIKit
class LocationsViewController: UINavigationController, UITableViewDelegate, UITableViewDataSource {
var contentViewController: UIViewController?
var tableView: UITableView?
override func loadView() {
super.loadView()
self.loadContentView()
self.pushViewController(contentViewController!, animated: false)
/*
let infoButton = UIButton(type: .InfoLight)
infoButton.tintColor = UIColor.whiteColor()
infoButton.addTarget(self, action: #selector(self.info), forControlEvents: .TouchUpInside)
let infoBarButton = UIBarButtonItem(customView: infoButton)
self.contentViewController!.navigationItem.leftBarButtonItem = infoBarButton
*/
}
func loadContentView() {
self.contentViewController = UIViewController()
self.contentViewController!.title = "Locations"
let contentView = self.contentViewController!.view
self.loadTableView()
contentView.addSubview(self.tableView!)
let viewsDict: [String: AnyObject] = [
"tableView": self.tableView!
]
let options = NSLayoutFormatOptions(rawValue: 0)
contentView.addConstraints(NSLayoutConstraint.constraintsWithVisualFormat(
"|[tableView]|", options: options, metrics: nil, views: viewsDict))
contentView.addConstraints(NSLayoutConstraint.constraintsWithVisualFormat(
"V:|[tableView]|", options: options, metrics: nil, views: viewsDict))
}
func loadTableView() {
self.tableView = CLTableView()
self.tableView?.estimatedRowHeight = CLTable.printerCellHeight
self.tableView?.rowHeight = UITableViewAutomaticDimension
self.tableView?.delegate = self
self.tableView?.dataSource = self
self.tableView?.reloadData()
}
func tableView(tableView: UITableView, numberOfRowsInSection section: Int) -> Int {
return 2
}
func tableView(tableView: UITableView, cellForRowAtIndexPath indexPath: NSIndexPath) -> UITableViewCell {
if indexPath.row == 0 {
return BahenLocationViewCell()
} else {
return NXLocationViewCell()
}
}
}
| 668b1c13a7d2a6d8c35a44341213b715 | 31.68 | 109 | 0.656875 | false | false | false | false |
CogMachines/arnold | refs/heads/master | FastText/FastTextPlayground.playground/Contents.swift | mit | 1 | //: Playground - noun: a place where people can play
// MacOS
import Cocoa
// Local
import FastText
#if true
let fastText = FastText()
var trainingData = [TrainingData]()
trainingData.append(TrainingData(label: "query_person",
data: "Do you know Melanie?"))
trainingData.append(TrainingData(label: "query_person",
data: "Do you know Reggie?"))
print("Begin training...")
let modelPath = fastText.trainSupervised(trainingData)
print("Training complete: " + modelPath)
fastText.predict(modelPath, text: "Do you know Poppy?")
#endif
#if false
//: ## NSLinguisticTagger
let text: NSString = "Do you know about Reggie Bird?"
// Create a tagger with "nameType" scheme to find named entities
let tagger = NSLinguisticTagger(tagSchemes: [.nameType], options: 0)
tagger.string = String(text)
// Whole range of text.
let range: NSRange = NSMakeRange(0, text.length)
// Consider compound names, like Apple Inc. as one word.
let options: NSLinguisticTagger.Options = [.omitPunctuation, .omitWhitespace, .joinNames]
// Interested in all names.
//let tags: [NSLinguisticTag] = [.personalName, .placeName, .organizationName]
var personals: [String] = []
var places: [String] = []
var organizations: [String] = []
// Enumerate through recognized tokens.
tagger.enumerateTags(in: range,
unit: .word,
scheme: .nameType,
options: options) { (tag, tokenRange, stop) in
guard let tag = tag else { return }
let token = text.substring(with: tokenRange)
let word = (text as NSString).substring(with: tokenRange)
print("\(word): \(tag)")
switch tag {
case .personalName: personals.append(token)
case .placeName: places.append(token)
case .organizationName: organizations.append(token)
default: break
}
}
print("""
Persons:\n\(personals)\n\n
Places:\n\(places)\n\n
Organizations:\n\(organizations)\n\n
""")
#endif
| 91394d6af2a9fd452b6a6b6eaa6d29dc | 25.355263 | 89 | 0.659511 | false | false | false | false |
peteratseneca/dps923winter2015 | refs/heads/master | Week_10/Places/Classes/PlaceList.swift | mit | 1 | //
// PlaceList.swift
// Scroll
//
// Created by Peter McIntyre on 2015-04-11.
// Copyright (c) 2015 School of ICT, Seneca College. All rights reserved.
//
import UIKit
import CoreData
// Notice the protocol conformance
class PlaceList: UITableViewController, NSFetchedResultsControllerDelegate {
// MARK: - Private properties
var frc: NSFetchedResultsController!
// MARK: - Properties
// Passed in by the app delegate during app initialization
var model: Model!
// MARK: - View lifecycle
override func viewDidLoad() {
super.viewDidLoad()
self.title = "Places List"
// Configure and load the fetched results controller (frc)
frc = model.frc_place
// This controller will be the frc delegate
frc.delegate = self;
// No predicate (which means the results will NOT be filtered)
frc.fetchRequest.predicate = nil;
// Create an error object
var error: NSError? = nil
// Perform fetch, and if there's an error, log it
if !frc.performFetch(&error) { println(error?.description) }
}
// MARK: - Table view methods
override func numberOfSectionsInTableView(tableView: UITableView) -> Int {
return self.frc.sections?.count ?? 0
}
override func tableView(tableView: UITableView, numberOfRowsInSection section: Int) -> Int {
let sectionInfo = self.frc.sections![section] as! NSFetchedResultsSectionInfo
return sectionInfo.numberOfObjects
}
override func tableView(tableView: UITableView, cellForRowAtIndexPath indexPath: NSIndexPath) -> UITableViewCell {
let cell = tableView.dequeueReusableCellWithIdentifier("cell", forIndexPath: indexPath) as! UITableViewCell
self.configureCell(cell, atIndexPath: indexPath)
return cell
}
func configureCell(cell: UITableViewCell, atIndexPath indexPath: NSIndexPath) {
let item: AnyObject = frc.objectAtIndexPath(indexPath)
cell.textLabel!.text = item.valueForKey("address")! as? String
}
// MARK: - Navigation
override func prepareForSegue(segue: UIStoryboardSegue, sender: AnyObject?) {
if segue.identifier == "toPlaceDetail" {
// Get a reference to the destination view controller
let vc = segue.destinationViewController as! PlaceDetail
// From the data source (the fetched results controller)...
// Get a reference to the object for the tapped/selected table view row
let item = frc.objectAtIndexPath(self.tableView.indexPathForSelectedRow()!) as! Place
// Pass on the object
vc.item = item
// Configure the view if you wish
vc.title = item.address
}
}
}
| eff928bcf8041e4417ea5fdaad0cacb6 | 30.4 | 118 | 0.620181 | false | false | false | false |
HassanEskandari/Eureka | refs/heads/master | Source/Rows/SuggestionRow/SuggestionCell.swift | mit | 1 | //
// SuggestionCell.swift
//
// Adapted from Mathias Claassen 4/14/16 by Hélène Martin 8/11/16
//
//
import Foundation
import UIKit
/// General suggestion cell. Create a subclass or use SuggestionCollectionCell or SuggestionTableCell.
open class SuggestionCell<T: SuggestionValue>: _FieldCell<T>, CellType {
let cellReuseIdentifier = "Eureka.SuggestionCellIdentifier"
var suggestions: [T]?
required public init(style: UITableViewCellStyle, reuseIdentifier: String?) {
super.init(style: style, reuseIdentifier: reuseIdentifier)
}
required public init?(coder aDecoder: NSCoder) {
super.init(coder: aDecoder)
}
override open func setup() {
super.setup()
textField.autocorrectionType = .no
textField.autocapitalizationType = .sentences
}
//MARK: UITextFieldDelegate
open override func textFieldDidBeginEditing(_ textField: UITextField) {
formViewController()?.beginEditing(of: self)
formViewController()?.textInputDidBeginEditing(textField, cell: self)
textField.selectAll(nil)
if let text = textField.text {
setSuggestions(text)
}
}
open override func textFieldDidChange(_ textField: UITextField) {
super.textFieldDidChange(textField)
if let text = textField.text {
setSuggestions(text)
}
}
open override func textFieldDidEndEditing(_ textField: UITextField) {
formViewController()?.endEditing(of: self)
formViewController()?.textInputDidEndEditing(textField, cell: self)
textField.text = row.displayValueFor?(row.value)
}
func setSuggestions(_ string: String) {}
func reload() {}
}
| 82b7def179dd5d1d1956dfbf1193cd0a | 29.12069 | 102 | 0.670864 | false | false | false | false |
appzzman/JMCBeaconManager | refs/heads/master | Example/Pods/JMCiBeaconManager/JMCiBeaconManager/Classes/BeaconShape.swift | bsd-2-clause | 5 | //
// BeaconShape.swift
// iBeaconManager
//
// Created by Felipe on 6/23/16.
// Copyright © 2016 Janusz Chudzynski. All rights reserved.
//
import UIKit
import CoreLocation
class BeaconShape {
var shapeLayer : CAShapeLayer!
var id = ""
var beacon:iBeacon!
var speed = 0.0
/// t is a parametric variable in the range 0 to 2π, interpreted geometrically as the angle that the ray from (a, b) to (x, y) makes with the positive x-axis.
var t : CGFloat = 0
var blink = false
var distance: CLProximity!
var point: CGPoint!
var radius: CGFloat
{
get{
if UIScreen.mainScreen().scale > 2{
return 15
}
return 10
}
set{
}
}
var color = UIColor(red: 0.392, green: 1.000, blue: 0.050, alpha: 1.000)
/// Increments the t value according to the speed
func nextT() -> CGFloat{
var s = speed
if distance == CLProximity.Unknown{
s += speed * 0.35
}
if distance == CLProximity.Far{
s += speed * 0.25
}
if distance == CLProximity.Near{
s += speed * 0.12
}
t += CGFloat(s)
if t > CGFloat(2 * M_PI){
t = 0
}
return t
}
} | 18b757fdf17abd5237db28d71dc1e9ba | 20.818182 | 162 | 0.47811 | false | false | false | false |
Flinesoft/HandyUIKit | refs/heads/main | Frameworks/HandyUIKit/Extensions/StringExt.swift | mit | 1 | // Copyright © 2017 Flinesoft. All rights reserved.
import UIKit
extension String {
/// Calculates and returns the height needed to fit the text into a width-constrained rect.
///
/// - Parameters:
/// - fixedWidth: The fixed width of the rect.
/// - font: The font of the text to calculate for.
/// - Returns: The height needed to fit the text into a width-constrained rect.
public func height(forFixedWidth fixedWidth: CGFloat, font: UIFont) -> CGFloat {
let constraintSize = CGSize(width: fixedWidth, height: .greatestFiniteMagnitude)
return ceil(rect(for: constraintSize, font: font).height)
}
/// Calculates and returns the width needed to fit the text into a height-constrained rect.
///
/// - Parameters:
/// - fixedHeight: The fixed height of the rect.
/// - font: The font of the text to calculate for.
/// - Returns: The width needed to fit the text into a height-constrained rect.
public func width(forFixedHeight fixedHeight: CGFloat, font: UIFont) -> CGFloat {
let constraintSize = CGSize(width: .greatestFiniteMagnitude, height: fixedHeight)
return ceil(rect(for: constraintSize, font: font).width)
}
private func rect(for constraintSize: CGSize, font: UIFont) -> CGRect {
let attributes = [NSAttributedString.Key.font: font]
return (self as NSString).boundingRect(with: constraintSize, options: .usesLineFragmentOrigin, attributes: attributes, context: nil)
}
/// - Returns: A hyphenated NSAttributedString with justified alignment and word wrapping line break mode.
public func hyphenated() -> NSAttributedString {
let paragraphStyle = NSMutableParagraphStyle()
paragraphStyle.hyphenationFactor = 1.0
paragraphStyle.alignment = .justified
paragraphStyle.lineBreakMode = .byWordWrapping
return NSAttributedString(string: self, attributes: [NSAttributedString.Key.paragraphStyle: paragraphStyle])
}
/// Superscripts substrings of structure ^{substring} and subscripts substrings of structure _{substring}.
///
/// - Parameters:
/// - font: The base font size for the resulting attributed string.
///
/// - Returns: The resulting attributed string with superscripted and subscripted substrings.
public func superAndSubscripted(font: UIFont) -> NSAttributedString {
NSAttributedString(string: self).superAndSubscripted(font: font)
}
/// Superscripts substrings of structure ^{substring}.
///
/// - Parameters:
/// - font: The base font size for the resulting attributed string.
///
/// - Returns: The resulting attributed string with superscripted substrings.
public func superscripted(font: UIFont) -> NSAttributedString {
NSAttributedString(string: self).superscripted(font: font)
}
/// Subscripts substrings of structure _{substring}.
///
/// - Parameters:
/// - font: The base font size for the resulting attributed string.
///
/// - Returns: The resulting attributed string with subscripted substrings.
public func subscripted(font: UIFont) -> NSAttributedString {
NSAttributedString(string: self).subscripted(font: font)
}
}
| 4dfba660bca86891fa9f6dfbe89488c0 | 44.25 | 140 | 0.691529 | false | false | false | false |
box/box-ios-sdk | refs/heads/main | Sources/Responses/DevicePin.swift | apache-2.0 | 1 | //
// DevicePin.swift
// BoxSDK-iOS
//
// Created by Cary Cheng on 8/27/19.
// Copyright © 2019 box. All rights reserved.
//
import Foundation
/// Defines a device pin which allows the enterprise to control devices connecting to it.
public class DevicePin: BoxModel {
// MARK: - BoxModel
private static var resourceType: String = "device_pinner"
/// Box item type
public var type: String
public private(set) var rawData: [String: Any]
// MARK: - Properties
/// The ID of the device pinner object.
public let id: String
/// The user that the device pin belongs to.
public let ownedBy: User?
/// The type of device being pinned.
public let productName: String?
/// The time the device pin was created.
public let createdAt: Date?
/// The time the device pin was modified.
public let modifiedAt: Date?
/// Initializer.
///
/// - Parameter json: JSON dictionary.
/// - Throws: Decoding error.
public required init(json: [String: Any]) throws {
guard let itemType = json["type"] as? String else {
throw BoxCodingError(message: .typeMismatch(key: "type"))
}
guard itemType == DevicePin.resourceType else {
throw BoxCodingError(message: .valueMismatch(key: "type", value: itemType, acceptedValues: [DevicePin.resourceType]))
}
rawData = json
type = itemType
id = try BoxJSONDecoder.decode(json: json, forKey: "id")
ownedBy = try BoxJSONDecoder.optionalDecode(json: json, forKey: "owned_by")
productName = try BoxJSONDecoder.optionalDecode(json: json, forKey: "product_name")
createdAt = try BoxJSONDecoder.optionalDecodeDate(json: json, forKey: "created_at")
modifiedAt = try BoxJSONDecoder.optionalDecodeDate(json: json, forKey: "modified_at")
}
}
| 2d89d9b7a56839e87b76db2805c8943c | 31.578947 | 129 | 0.656435 | false | false | false | false |
xBrux/BXIcon | refs/heads/master | BXIconDemo/ViewController.swift | mit | 1 | //
// ViewController.swift
// BXIconDemo
//
// Created by BRUX on 10/15/15.
// Copyright © 2015 Brux. All rights reserved.
//
import UIKit
class ViewController: UIViewController {
@IBOutlet weak var iconView: BXIconView!
@IBOutlet weak var imageView: UIImageView!
@IBOutlet weak var textField: UITextField!
override func viewDidLoad() {
super.viewDidLoad()
// Do any additional setup after loading the view, typically from a nib.
let image = BXIcon().iconImage(iconName:"bowl", imageSize: CGSize(width: 100, height: 100), fillColor: UIColor.redColor())
imageView.image = image
}
override func didReceiveMemoryWarning() {
super.didReceiveMemoryWarning()
// Dispose of any resources that can be recreated.
}
@IBAction func showButtonTouched(sender: AnyObject) {
guard let iconName = textField.text else { return }
let image = BXIcon().iconImage(iconName:iconName, imageSize: CGSize(width: 100, height: 100), fillColor: UIColor.redColor())
imageView.image = image
iconView.iconName = iconName
}
}
| 6bde0b0de43f6fd5d77062a0851a44db | 28.973684 | 132 | 0.66813 | false | false | false | false |
Glucosio/glucosio-ios | refs/heads/develop | Pods/Charts/Source/Charts/Data/Implementations/Standard/LineChartDataSet.swift | apache-2.0 | 4 | //
// LineChartDataSet.swift
// Charts
//
// Copyright 2015 Daniel Cohen Gindi & Philipp Jahoda
// A port of MPAndroidChart for iOS
// Licensed under Apache License 2.0
//
// https://github.com/danielgindi/Charts
//
import Foundation
import CoreGraphics
open class LineChartDataSet: LineRadarChartDataSet, ILineChartDataSet
{
@objc(LineChartMode)
public enum Mode: Int
{
case linear
case stepped
case cubicBezier
case horizontalBezier
}
private func initialize()
{
// default color
circleColors.append(NSUIColor(red: 140.0/255.0, green: 234.0/255.0, blue: 255.0/255.0, alpha: 1.0))
}
public required init()
{
super.init()
initialize()
}
public override init(values: [ChartDataEntry]?, label: String?)
{
super.init(values: values, label: label)
initialize()
}
// MARK: - Data functions and accessors
// MARK: - Styling functions and accessors
/// The drawing mode for this line dataset
///
/// **default**: Linear
open var mode: Mode = Mode.linear
private var _cubicIntensity = CGFloat(0.2)
/// Intensity for cubic lines (min = 0.05, max = 1)
///
/// **default**: 0.2
open var cubicIntensity: CGFloat
{
get
{
return _cubicIntensity
}
set
{
_cubicIntensity = newValue
if _cubicIntensity > 1.0
{
_cubicIntensity = 1.0
}
if _cubicIntensity < 0.05
{
_cubicIntensity = 0.05
}
}
}
/// The radius of the drawn circles.
open var circleRadius = CGFloat(8.0)
/// The hole radius of the drawn circles
open var circleHoleRadius = CGFloat(4.0)
open var circleColors = [NSUIColor]()
/// - returns: The color at the given index of the DataSet's circle-color array.
/// Performs a IndexOutOfBounds check by modulus.
open func getCircleColor(atIndex index: Int) -> NSUIColor?
{
let size = circleColors.count
let index = index % size
if index >= size
{
return nil
}
return circleColors[index]
}
/// Sets the one and ONLY color that should be used for this DataSet.
/// Internally, this recreates the colors array and adds the specified color.
open func setCircleColor(_ color: NSUIColor)
{
circleColors.removeAll(keepingCapacity: false)
circleColors.append(color)
}
open func setCircleColors(_ colors: NSUIColor...)
{
circleColors.removeAll(keepingCapacity: false)
circleColors.append(contentsOf: colors)
}
/// Resets the circle-colors array and creates a new one
open func resetCircleColors(_ index: Int)
{
circleColors.removeAll(keepingCapacity: false)
}
/// If true, drawing circles is enabled
open var drawCirclesEnabled = true
/// - returns: `true` if drawing circles for this DataSet is enabled, `false` ifnot
open var isDrawCirclesEnabled: Bool { return drawCirclesEnabled }
/// The color of the inner circle (the circle-hole).
open var circleHoleColor: NSUIColor? = NSUIColor.white
/// `true` if drawing circles for this DataSet is enabled, `false` ifnot
open var drawCircleHoleEnabled = true
/// - returns: `true` if drawing the circle-holes is enabled, `false` ifnot.
open var isDrawCircleHoleEnabled: Bool { return drawCircleHoleEnabled }
/// This is how much (in pixels) into the dash pattern are we starting from.
open var lineDashPhase = CGFloat(0.0)
/// This is the actual dash pattern.
/// I.e. [2, 3] will paint [-- -- ]
/// [1, 3, 4, 2] will paint [- ---- - ---- ]
open var lineDashLengths: [CGFloat]?
/// Line cap type, default is CGLineCap.Butt
open var lineCapType = CGLineCap.butt
/// formatter for customizing the position of the fill-line
private var _fillFormatter: IFillFormatter = DefaultFillFormatter()
/// Sets a custom IFillFormatter to the chart that handles the position of the filled-line for each DataSet. Set this to null to use the default logic.
open var fillFormatter: IFillFormatter?
{
get
{
return _fillFormatter
}
set
{
_fillFormatter = newValue ?? DefaultFillFormatter()
}
}
// MARK: NSCopying
open override func copyWithZone(_ zone: NSZone?) -> AnyObject
{
let copy = super.copyWithZone(zone) as! LineChartDataSet
copy.circleColors = circleColors
copy.circleRadius = circleRadius
copy.cubicIntensity = cubicIntensity
copy.lineDashPhase = lineDashPhase
copy.lineDashLengths = lineDashLengths
copy.lineCapType = lineCapType
copy.drawCirclesEnabled = drawCirclesEnabled
copy.drawCircleHoleEnabled = drawCircleHoleEnabled
copy.mode = mode
return copy
}
}
| a4b86255cc54cd74522c9925acf1c5c6 | 27.949438 | 155 | 0.608772 | false | false | false | false |
kesun421/firefox-ios | refs/heads/master | Client/Frontend/AuthenticationManager/PasscodeEntryViewController.swift | mpl-2.0 | 1 | /* This Source Code Form is subject to the terms of the Mozilla Public
* License, v. 2.0. If a copy of the MPL was not distributed with this
* file, You can obtain one at http://mozilla.org/MPL/2.0/. */
import Foundation
import SnapKit
import Shared
import SwiftKeychainWrapper
/// Delegate available for PasscodeEntryViewController consumers to be notified of the validation of a passcode.
@objc protocol PasscodeEntryDelegate: class {
func passcodeValidationDidSucceed()
@objc optional func userDidCancelValidation()
}
/// Presented to the to user when asking for their passcode to validate entry into a part of the app.
class PasscodeEntryViewController: BasePasscodeViewController {
weak var delegate: PasscodeEntryDelegate?
fileprivate var passcodePane: PasscodePane
override init() {
let authInfo = KeychainWrapper.sharedAppContainerKeychain.authenticationInfo()
passcodePane = PasscodePane(title:nil, passcodeSize:authInfo?.passcode?.count ?? 6)
super.init()
}
required init?(coder aDecoder: NSCoder) {
fatalError("init(coder:) has not been implemented")
}
override func viewDidLoad() {
super.viewDidLoad()
title = AuthenticationStrings.enterPasscodeTitle
view.addSubview(passcodePane)
passcodePane.snp.makeConstraints { make in
make.bottom.left.right.equalTo(self.view)
make.top.equalTo(self.topLayoutGuide.snp.bottom)
}
}
override func viewWillAppear(_ animated: Bool) {
super.viewWillAppear(animated)
passcodePane.codeInputView.delegate = self
// Don't show the keyboard or allow typing if we're locked out. Also display the error.
if authenticationInfo?.isLocked() ?? false {
displayLockoutError()
passcodePane.codeInputView.isUserInteractionEnabled = false
} else {
passcodePane.codeInputView.becomeFirstResponder()
}
}
override func viewDidLayoutSubviews() {
super.viewDidLayoutSubviews()
if authenticationInfo?.isLocked() ?? false {
passcodePane.codeInputView.isUserInteractionEnabled = false
passcodePane.codeInputView.resignFirstResponder()
} else {
passcodePane.codeInputView.becomeFirstResponder()
}
}
override func viewWillDisappear(_ animated: Bool) {
super.viewWillDisappear(animated)
self.view.endEditing(true)
}
override func dismissAnimated() {
delegate?.userDidCancelValidation?()
super.dismissAnimated()
}
}
extension PasscodeEntryViewController: PasscodeInputViewDelegate {
func passcodeInputView(_ inputView: PasscodeInputView, didFinishEnteringCode code: String) {
if let passcode = authenticationInfo?.passcode, passcode == code {
authenticationInfo?.recordValidation()
KeychainWrapper.sharedAppContainerKeychain.setAuthenticationInfo(authenticationInfo)
delegate?.passcodeValidationDidSucceed()
} else {
passcodePane.shakePasscode()
failIncorrectPasscode(inputView)
passcodePane.codeInputView.resetCode()
// Store mutations on authentication info object
KeychainWrapper.sharedAppContainerKeychain.setAuthenticationInfo(authenticationInfo)
}
}
}
| c421348bbc1ee938a3aeb61533787aae | 35.978261 | 112 | 0.694004 | false | false | false | false |
google/swift-benchmark | refs/heads/main | Sources/Benchmark/BenchmarkState.swift | apache-2.0 | 1 | // Copyright 2020 Google LLC
//
// Licensed under the Apache License, Version 2.0 (the "License");
// you may not use this file except in compliance with the License.
// You may obtain a copy of the License at
//
// http://www.apache.org/licenses/LICENSE-2.0
//
// Unless required by applicable law or agreed to in writing, software
// distributed under the License is distributed on an "AS IS" BASIS,
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
// See the License for the specific language governing permissions and
// limitations under the License.
/// Benchmark state is used to collect the
/// benchmark measurements and view the settings it
/// was configured with.
///
/// Apart from the standard benchmark loop, you can also use
/// it with customized benchmark measurement sections via either
/// `start`/`end` or `measure` functions.
public struct BenchmarkState {
var startTime: UInt64
var endTime: UInt64
var measurements: [Double]
/// A mapping from counters to their corresponding values.
public var counters: [String: Double]
/// Number of iterations to be run.
public let iterations: Int
/// Aggregated settings for the current benchmark run.
public let settings: BenchmarkSettings
@inline(__always)
init() {
self.init(iterations: 0, settings: BenchmarkSettings())
}
@inline(__always)
init(iterations: Int, settings: BenchmarkSettings) {
self.startTime = 0
self.endTime = 0
self.measurements = []
self.measurements.reserveCapacity(iterations)
self.counters = [:]
self.iterations = iterations
self.settings = settings
}
/// Explicitly marks the start of the measurement section.
@inline(__always)
public mutating func start() {
self.endTime = 0
self.startTime = now()
}
/// Explicitly marks the end of the measurement section
/// and records the time since start of the benchmark.
@inline(__always)
public mutating func end() throws {
let value = now()
if self.endTime == 0 {
self.endTime = value
try record()
}
}
@inline(__always)
mutating func record() throws {
if measurements.count < iterations {
measurements.append(self.duration)
} else {
throw BenchmarkTermination()
}
}
@inline(__always)
var duration: Double {
return Double(self.endTime - self.startTime)
}
@inline(__always)
mutating func loop(_ benchmark: AnyBenchmark) throws {
while measurements.count < iterations {
benchmark.setUp()
start()
try benchmark.run(&self)
try end()
benchmark.tearDown()
}
}
/// Run the closure within within benchmark measurement section.
/// It may throw errors to propagate early termination to
/// the outer benchmark loop.
@inline(__always)
public mutating func measure(f: () -> Void) throws {
start()
f()
try end()
}
/// Increment a counter by a given value (with a default of 1).
/// If counter has never been set before, it starts with zero as the
/// initial value.
@inline(__always)
public mutating func increment(counter name: String, by value: Double = 1) {
if let oldValue = counters[name] {
counters[name] = oldValue + value
} else {
counters[name] = value
}
}
}
| 4e7497e4ff32698739d0d733452e0540 | 29.594828 | 80 | 0.629191 | false | false | false | false |
neonichu/SPMediaKeyTap | refs/heads/master | SPMediaKeys.swift | bsd-3-clause | 1 | import AppKit
public enum SPMediaKey {
case PlayPause
case Rewind
case Forward
}
public typealias SPMediaKeyObserver = ((mediaKey: SPMediaKey) -> Void)
public class SPMediaKeys: NSObject {
public override class func initialize() {
NSUserDefaults.standardUserDefaults().registerDefaults([kMediaKeyUsingBundleIdentifiersDefaultsKey: SPMediaKeyTap.defaultMediaKeyUserBundleIdentifiers()])
}
private var keyTap: SPMediaKeyTap!
private var observer: SPMediaKeyObserver?
public func watch(newObserver: SPMediaKeyObserver) {
keyTap = SPMediaKeyTap(delegate: self)
if SPMediaKeyTap.usesGlobalMediaKeyTap() {
keyTap.startWatchingMediaKeys()
}
observer = newObserver
}
public override func mediaKeyTap(keyTap: SPMediaKeyTap!, receivedMediaKeyEvent event: NSEvent!) {
let keyCode = ((event.data1 & 0xFFFF0000) >> 16)
let keyFlags = (event.data1 & 0x0000FFFF)
let keyIsPressed = (((keyFlags & 0xFF00) >> 8)) == 0xA
let keyRepeat = (keyFlags & 0x1)
if keyIsPressed {
switch Int32(keyCode) {
case NX_KEYTYPE_PLAY:
observer?(mediaKey:.PlayPause)
break
case NX_KEYTYPE_FAST:
observer?(mediaKey:.Forward)
break
case NX_KEYTYPE_REWIND:
observer?(mediaKey:.Rewind)
break
default:
break
// More cases defined in hidsystem/ev_keymap.h
}
}
}
}
| a2296080287583813a1e18cff0facba6 | 27 | 162 | 0.605263 | false | false | false | false |
vector-im/riot-ios | refs/heads/develop | Riot/Modules/Common/Buttons/Close/CloseButton.swift | apache-2.0 | 1 | /*
Copyright 2020 New Vector Ltd
Licensed under the Apache License, Version 2.0 (the "License");
you may not use this file except in compliance with the License.
You may obtain a copy of the License at
http://www.apache.org/licenses/LICENSE-2.0
Unless required by applicable law or agreed to in writing, software
distributed under the License is distributed on an "AS IS" BASIS,
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
See the License for the specific language governing permissions and
limitations under the License.
*/
import Foundation
final class CloseButton: UIButton, Themable {
// MARK: - Constants
private enum CircleBackgroundConstants {
static let height: CGFloat = 30.0
static let highlightedAlha: CGFloat = 0.5
static let normalAlha: CGFloat = 1.0
}
// MARK: - Properties
// MARK: Private
private var theme: Theme?
private var circleBackgroundView: UIView!
// MARK: Public
override var isHighlighted: Bool {
didSet {
self.circleBackgroundView.alpha = self.isHighlighted ? CircleBackgroundConstants.highlightedAlha : CircleBackgroundConstants.normalAlha
}
}
// MARK: - Life cycle
override func awakeFromNib() {
super.awakeFromNib()
self.backgroundColor = UIColor.clear
self.setImage(Asset.Images.closeButton.image, for: .normal)
self.setupCircleView()
self.update(theme: ThemeService.shared().theme)
}
override func layoutSubviews() {
super.layoutSubviews()
self.sendSubviewToBack(self.circleBackgroundView)
self.circleBackgroundView.layer.cornerRadius = self.circleBackgroundView.bounds.height/2
}
// MARK: - Private
private func setupCircleView() {
let rect = CGRect(x: 0, y: 0, width: CircleBackgroundConstants.height, height: CircleBackgroundConstants.height)
let view = UIView(frame: rect)
view.translatesAutoresizingMaskIntoConstraints = false
view.isUserInteractionEnabled = false
view.layer.masksToBounds = true
self.addSubview(view)
NSLayoutConstraint.activate([
view.heightAnchor.constraint(equalToConstant: CircleBackgroundConstants.height),
view.widthAnchor.constraint(equalTo: view.heightAnchor, multiplier: 1.0),
view.centerXAnchor.constraint(equalTo: self.centerXAnchor),
view.centerYAnchor.constraint(equalTo: self.centerYAnchor)
])
self.sendSubviewToBack(view)
self.circleBackgroundView = view
}
// MARK: - Themable
func update(theme: Theme) {
self.theme = theme
self.circleBackgroundView.backgroundColor = theme.headerTextSecondaryColor
}
}
| c94e69f0c553684825ea7af31cf73cd9 | 29.8 | 147 | 0.661654 | false | false | false | false |
e-sites/Bluetonium | refs/heads/master | Source/Models/Device.swift | mit | 1 | //
// Device.swift
// Bluetonium
//
// Created by Dominggus Salampessy on 23/12/15.
// Copyright © 2015 E-sites. All rights reserved.
//
import Foundation
import CoreBluetooth
/**
A `Device` will represent a CBPeripheral.
When registering ServiceModels on this device it will automaticly map the characteristics to the correct value.
*/
public class Device: Equatable {
// An array of all registered `ServiceModel` subclasses
open var registedServiceModels: [ServiceModel] {
return serviceModelManager.registeredServiceModels
}
// The peripheral it represents.
private(set) public var peripheral: CBPeripheral
// The ServiceModelManager that will manage all registered `ServiceModels`
private(set) var serviceModelManager: ServiceModelManager
// MARK: Initializers
/**
Initalize the `Device` with a Peripheral.
- parameter peripheral: The peripheral it will represent
*/
public init(peripheral: CBPeripheral) {
self.peripheral = peripheral
self.serviceModelManager = ServiceModelManager(peripheral: peripheral)
}
// MARK: Public functions
/**
Register a `ServiceModel` subclass.
Register before connecting to the device.
- parameter serviceModel: The ServiceModel subclass to register.
*/
public func register(serviceModel: ServiceModel) {
serviceModelManager.register(serviceModel: serviceModel)
}
// MARK: functions
/**
Register serviceManager as delegate of the peripheral.
This should be done just before connecting/
If done at initalizing it will override the existing peripheral delegate.
*/
func registerServiceManager() {
peripheral.delegate = serviceModelManager
}
/**
Equatable support.
*/
public static func == (lhs: Device, rhs: Device) -> Bool {
return lhs.peripheral.identifier == rhs.peripheral.identifier
}
}
| d5ed345e0063cdb24eca2171d89586c0 | 27.471429 | 112 | 0.684395 | false | false | false | false |
GregoryMaks/RingLabsTestTask | refs/heads/master | RingTask/Classes/Networking/NetworkService.swift | mit | 1 | //
// NetworkService.swift
// RingTask
//
// Created by Hryhorii Maksiuk on 8/5/17.
// Copyright © 2017 Gregory M. All rights reserved.
//
import Foundation
enum NetworkError: Error, Descriptable {
case unknown
case timeOut
case networkConnectionLost
case cancelled
case other(urlError: Error)
init(urlError: Error?) {
if let urlError = urlError as NSError?,
urlError.domain == NSURLErrorDomain
{
switch urlError.code {
case NSURLErrorNotConnectedToInternet,
NSURLErrorCannotConnectToHost,
NSURLErrorNetworkConnectionLost:
self = .networkConnectionLost
case NSURLErrorTimedOut:
self = .timeOut
case NSURLErrorCancelled:
self = .cancelled
default:
self = .other(urlError: urlError)
}
} else {
self = .unknown
}
}
var stringDescription: String {
switch self {
case .unknown:
return "Unknown"
case .timeOut:
return "Timeout"
case .networkConnectionLost:
return "Network connection lost"
case .cancelled:
return "Cancelled"
case .other(let urlError):
return urlError.localizedDescription
}
}
}
protocol NetworkServiceProtocol {
@discardableResult func perform(request: URLRequest,
completion: @escaping (Result<(Data?, HTTPURLResponse), NetworkError>) -> Void)
-> URLSessionDataTask
}
class NetworkService: NetworkServiceProtocol {
private let session: URLSession
init() {
let configuration = URLSessionConfiguration.default
session = URLSession(configuration: configuration)
}
@discardableResult func perform(request: URLRequest,
completion: @escaping (Result<(Data?, HTTPURLResponse), NetworkError>) -> Void)
-> URLSessionDataTask
{
let dataTask = session.dataTask(with: request) { data, response, error in
guard let response = response as? HTTPURLResponse else {
completion(.failure(NetworkError(urlError: error)))
return
}
completion(.success((data, response)))
}
dataTask.resume()
return dataTask
}
}
| ae0f19c27832256b8cf637c6f9c867b7 | 25.967391 | 115 | 0.571141 | false | false | false | false |
bud-ci/ios | refs/heads/develop | Owncloud iOs Client/Utils/SystemConstants-swift.swift | gpl-3.0 | 7 | //
// SystemConstants-swift.swift
// Owncloud iOs Client
//
// Created by Gonzalo Gonzalez on 6/8/15.
//
/*
Copyright (C) 2014, ownCloud, Inc.
This code is covered by the GNU Public License Version 3.
For distribution utilizing Apple mechanisms please see https://owncloud.org/contribute/iOS-license-exception/
You should have received a copy of this license
along with this program. If not, see <http://www.gnu.org/licenses/gpl-3.0.en.html>.
*/
import Foundation
import UIKit
let IS_IPHONE = UI_USER_INTERFACE_IDIOM() == UIUserInterfaceIdiom.Phone
let IS_PORTRAIT = UIInterfaceOrientationIsPortrait(UIApplication.sharedApplication().statusBarOrientation)
let appDelegate = UIApplication.sharedApplication().delegate as! AppDelegate
| aedeb8286172e2eb92c98af46593876a | 22.4375 | 109 | 0.770667 | false | false | false | false |
djwbrown/swift | refs/heads/master | test/IRGen/big_types_corner_cases.swift | apache-2.0 | 1 | // RUN: %target-swift-frontend -assume-parsing-unqualified-ownership-sil -enable-large-loadable-types %s -emit-ir | %FileCheck %s --check-prefix=CHECK --check-prefix=CHECK-%target-ptrsize
public struct BigStruct {
var i0 : Int32 = 0
var i1 : Int32 = 1
var i2 : Int32 = 2
var i3 : Int32 = 3
var i4 : Int32 = 4
var i5 : Int32 = 5
var i6 : Int32 = 6
var i7 : Int32 = 7
var i8 : Int32 = 8
}
func takeClosure(execute block: () -> Void) {
}
class OptionalInoutFuncType {
private var lp : BigStruct?
private var _handler : ((BigStruct?, Error?) -> ())?
func execute(_ error: Error?) {
var p : BigStruct?
var handler: ((BigStruct?, Error?) -> ())?
takeClosure {
p = self.lp
handler = self._handler
self._handler = nil
}
handler?(p, error)
}
}
// CHECK-LABEL: define{{( protected)?}} internal swiftcc void @_T022big_types_corner_cases21OptionalInoutFuncTypeC7executeys5Error_pSgFyycfU_(%T22big_types_corner_cases9BigStructVSg* nocapture dereferenceable({{.*}}), %T22big_types_corner_cases21OptionalInoutFuncTypeC*, %T22big_types_corner_cases9BigStructVSgs5Error_pSgIxcx_Sg* nocapture dereferenceable({{.*}})
// CHECK: call void @_T0SqWy
// CHECK: call void @_T0SqWe
// CHECK: ret void
public func f1_returns_BigType(_ x: BigStruct) -> BigStruct {
return x
}
public func f2_returns_f1() -> (_ x: BigStruct) -> BigStruct {
return f1_returns_BigType
}
public func f3_uses_f2() {
let x = BigStruct()
let useOfF2 = f2_returns_f1()
let _ = useOfF2(x)
}
// CHECK-LABEL: define{{( protected)?}} swiftcc void @_T022big_types_corner_cases10f3_uses_f2yyF()
// CHECK:call swiftcc void @_T022big_types_corner_cases9BigStructVACycfC(%T22big_types_corner_cases9BigStructV* nocapture dereferenceable
// CHECK: call swiftcc { i8*, %swift.refcounted* } @_T022big_types_corner_cases13f2_returns_f1AA9BigStructVADcyF()
// CHECK: call swiftcc void {{.*}}(%T22big_types_corner_cases9BigStructV* nocapture dereferenceable({{.*}}) {{.*}}, %T22big_types_corner_cases9BigStructV* noalias nocapture dereferenceable({{.*}}) {{.*}}, %swift.refcounted* swiftself {{.*}})
// CHECK: ret void
public func f4_tuple_use_of_f2() {
let x = BigStruct()
let tupleWithFunc = (f2_returns_f1(), x)
let useOfF2 = tupleWithFunc.0
let _ = useOfF2(x)
}
// CHECK-LABEL: define{{( protected)?}} swiftcc void @_T022big_types_corner_cases18f4_tuple_use_of_f2yyF()
// CHECK: [[TUPLE:%.*]] = call swiftcc { i8*, %swift.refcounted* } @_T022big_types_corner_cases13f2_returns_f1AA9BigStructVADcyF()
// CHECK: [[TUPLE_EXTRACT:%.*]] = extractvalue { i8*, %swift.refcounted* } [[TUPLE]], 0
// CHECK: [[CAST_EXTRACT:%.*]] = bitcast i8* [[TUPLE_EXTRACT]] to void (%T22big_types_corner_cases9BigStructV*, %T22big_types_corner_cases9BigStructV*, %swift.refcounted*)*
// CHECK: call swiftcc void [[CAST_EXTRACT]](%T22big_types_corner_cases9BigStructV* nocapture dereferenceable({{.*}}) {{.*}}, %T22big_types_corner_cases9BigStructV* noalias nocapture dereferenceable({{.*}}) {{.*}}, %swift.refcounted* swiftself %{{.*}})
// CHECK: ret void
public class BigClass {
public init() {
}
public var optVar: ((BigStruct)-> Void)? = nil
func useBigStruct(bigStruct: BigStruct) {
optVar!(bigStruct)
}
}
// CHECK-LABEL: define{{( protected)?}} hidden swiftcc void @_T022big_types_corner_cases8BigClassC03useE6StructyAA0eH0V0aH0_tF(%T22big_types_corner_cases9BigStructV* noalias nocapture dereferenceable({{.*}}), %T22big_types_corner_cases8BigClassC* swiftself) #0 {
// CHECK: getelementptr inbounds %T22big_types_corner_cases8BigClassC, %T22big_types_corner_cases8BigClassC*
// CHECK: call void @_T0SqWy
// CHECK: [[BITCAST:%.*]] = bitcast i8* {{.*}} to void (%T22big_types_corner_cases9BigStructV*, %swift.refcounted*)*
// CHECK: call swiftcc void [[BITCAST]](%T22big_types_corner_cases9BigStructV* noalias nocapture dereferenceable({{.*}}) %0, %swift.refcounted* swiftself
// CHECK: ret void
public struct MyStruct {
public let a: Int
public let b: String?
}
typealias UploadFunction = ((MyStruct, Int?) -> Void) -> Void
func takesUploader(_ u: UploadFunction) { }
class Foo {
func blam() {
takesUploader(self.myMethod) // crash compiling this
}
func myMethod(_ callback: (MyStruct, Int) -> Void) -> Void { }
}
// CHECK-LABEL: define{{( protected)?}} linkonce_odr hidden swiftcc { i8*, %swift.refcounted* } @_T022big_types_corner_cases3FooC8myMethodyyAA8MyStructV_SitcFTc(%T22big_types_corner_cases3FooC*)
// CHECK: getelementptr inbounds %T22big_types_corner_cases3FooC, %T22big_types_corner_cases3FooC*
// CHECK: getelementptr inbounds void (i8*, %swift.refcounted*, %T22big_types_corner_cases3FooC*)*, void (i8*, %swift.refcounted*, %T22big_types_corner_cases3FooC*)**
// CHECK: call noalias %swift.refcounted* @swift_rt_swift_allocObject(%swift.type* getelementptr inbounds (%swift.full_boxmetadata, %swift.full_boxmetadata*
// CHECK: ret { i8*, %swift.refcounted* }
public enum LargeEnum {
public enum InnerEnum {
case simple(Int64)
case hard(Int64, String?)
}
case Empty1
case Empty2
case Full(InnerEnum)
}
public func enumCallee(_ x: LargeEnum) {
switch x {
case .Full(let inner): print(inner)
case .Empty1: break
case .Empty2: break
}
}
// CHECK-LABEL-64: define{{( protected)?}} swiftcc void @_T022big_types_corner_cases10enumCalleeyAA9LargeEnumOF(%T22big_types_corner_cases9LargeEnumO* noalias nocapture dereferenceable(34)) #0 {
// CHECK-64: alloca %T22big_types_corner_cases9LargeEnumO05InnerF0O
// CHECK-64: alloca %T22big_types_corner_cases9LargeEnumO
// CHECK-64: call void @llvm.memcpy.p0i8.p0i8.i64
// CHECK-64: call void @llvm.memcpy.p0i8.p0i8.i64
// CHECK-64: call %swift.type* @_T0ypMa()
// CHECK-64: ret void
| b286d4984747cde69333cbb142d0173f | 40.536232 | 363 | 0.702547 | false | false | false | false |
DAloG/BlueCap | refs/heads/master | BlueCap/Peripheral/PeripheralManagersViewController.swift | mit | 2 | //
// PeripheralManagersViewController.swift
// BlueCap
//
// Created by Troy Stribling on 8/10/14.
// Copyright (c) 2014 Troy Stribling. The MIT License (MIT).
//
import UIKit
import BlueCapKit
class PeripheralManagersViewController : UITableViewController {
struct MainStoryboard {
static let peripheralManagerCell = "PeripheralManagerCell"
static let peripheralManagerViewSegue = "PeripheralManagerView"
static let peripheralManagerAddSegue = "PeripheralManagerAdd"
}
required init?(coder aDecoder: NSCoder) {
super.init(coder:aDecoder)
}
override func viewDidLoad() {
super.viewDidLoad()
self.styleNavigationBar()
self.navigationItem.leftBarButtonItem = self.editButtonItem()
self.navigationItem.leftBarButtonItem?.tintColor = UIColor.blackColor()
}
override func viewWillAppear(animated:Bool) {
super.viewWillAppear(animated)
self.tableView.reloadData()
self.navigationItem.title = "Peripherals"
}
override func viewWillDisappear(animated:Bool) {
super.viewWillDisappear(animated)
self.navigationItem.title = ""
}
override func prepareForSegue(segue:UIStoryboardSegue, sender:AnyObject!) {
if segue.identifier == MainStoryboard.peripheralManagerViewSegue {
if let selectedIndex = self.tableView.indexPathForCell(sender as! UITableViewCell) {
let viewController = segue.destinationViewController as! PeripheralManagerViewController
let peripherals = PeripheralStore.getPeripheralNames()
viewController.peripheral = peripherals[selectedIndex.row]
}
} else if segue.identifier == MainStoryboard.peripheralManagerAddSegue {
let viewController = segue.destinationViewController as! PeripheralManagerViewController
viewController.peripheral = nil
}
}
// UITableViewDataSource
override func numberOfSectionsInTableView(tableView:UITableView) -> Int {
return 1
}
override func tableView(_:UITableView, numberOfRowsInSection section:Int) -> Int {
return PeripheralStore.getPeripheralNames().count
}
override func tableView(tableView:UITableView, editingStyleForRowAtIndexPath indexPath:NSIndexPath) -> UITableViewCellEditingStyle {
return UITableViewCellEditingStyle.Delete
}
override func tableView(tableView:UITableView, commitEditingStyle editingStyle:UITableViewCellEditingStyle, forRowAtIndexPath indexPath:NSIndexPath) {
if editingStyle == UITableViewCellEditingStyle.Delete {
let peripherals = PeripheralStore.getPeripheralNames()
PeripheralStore.removePeripheral(peripherals[indexPath.row])
self.tableView.deleteRowsAtIndexPaths([indexPath], withRowAnimation:UITableViewRowAnimation.Fade)
}
}
override func tableView(tableView:UITableView, cellForRowAtIndexPath indexPath:NSIndexPath) -> UITableViewCell {
let cell = tableView.dequeueReusableCellWithIdentifier(MainStoryboard.peripheralManagerCell, forIndexPath: indexPath) as! SimpleCell
let peripherals = PeripheralStore.getPeripheralNames()
cell.nameLabel.text = peripherals[indexPath.row]
return cell
}
// UITableViewDelegate
}
| c3851323afefec079d5960cb1c6fd240 | 38.905882 | 154 | 0.713149 | false | false | false | false |
objecthub/swift-lispkit | refs/heads/master | Sources/LispKit/Runtime/SymbolTable.swift | apache-2.0 | 1 | //
// SymbolTable.swift
// LispKit
//
// Created by Matthias Zenger on 23/01/2016.
// Copyright © 2016-2022 ObjectHub. All rights reserved.
//
// Licensed under the Apache License, Version 2.0 (the "License");
// you may not use this file except in compliance with the License.
// You may obtain a copy of the License at
//
// http://www.apache.org/licenses/LICENSE-2.0
//
// Unless required by applicable law or agreed to in writing, software
// distributed under the License is distributed on an "AS IS" BASIS,
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
// See the License for the specific language governing permissions and
// limitations under the License.
//
///
/// Class `SymbolTable` implements the symbol table for LispKit. It is used for managing
/// symbols and their textual representations. Instances of `SymbolTable` provide functionality
/// for creating interned symbols for a given identifier and for looking up the identifier
/// of a given symbol.
///
public final class SymbolTable: Sequence {
private let lock = EmbeddedUnfairLock()
private var symTable = [String : Symbol]()
private let gensymLock = EmbeddedUnfairLock()
private var gensymCounter: UInt64 = 0
public let undef = Symbol("<undef>")
public let dotdotdot = Symbol("…")
public let ellipsis = Symbol("...")
public let wildcard = Symbol("_")
public let append = Symbol("append")
public let cons = Symbol("cons")
public let list = Symbol("list")
public let quote = Symbol("quote")
public let quasiquote = Symbol("quasiquote")
public let unquote = Symbol("unquote")
public let unquoteSplicing = Symbol("unquote-splicing")
public let doubleArrow = Symbol("=>")
public let `else` = Symbol("else")
public let `if` = Symbol("if")
public let lambda = Symbol("lambda")
public let `let` = Symbol("let")
public let letStar = Symbol("let*")
public let letrec = Symbol("letrec")
public let define = Symbol("define")
public let defineValues = Symbol("define-values")
public let makePromise = Symbol("make-promise")
public let makeStream = Symbol("make-stream")
public let begin = Symbol("begin")
public let `import` = Symbol("import")
public let export = Symbol("export")
public let exportOpen = Symbol("export-open")
public let extern = Symbol("extern")
public let rename = Symbol("rename")
public let only = Symbol("only")
public let except = Symbol("except")
public let prefix = Symbol("prefix")
public let library = Symbol("library")
public let and = Symbol("and")
public let or = Symbol("or")
public let not = Symbol("not")
public let condExpand = Symbol("cond-expand")
public let include = Symbol("include")
public let includeCi = Symbol("include-ci")
public let includeLibDecls = Symbol("include-library-declarations")
public let scheme = Symbol("scheme")
public let r5rs = Symbol("r5rs")
public let r5rsSyntax = Symbol("r5rs-syntax")
public let starOne = Symbol("*1")
public let starTwo = Symbol("*2")
public let starThree = Symbol("*3")
public init() {
self.registerNativeSymbols()
}
deinit {
self.lock.release()
self.gensymLock.release()
}
/// Register internally used symbols.
public func registerNativeSymbols() {
func register(_ sym: Symbol) {
self.symTable[sym.identifier] = sym
}
register(self.undef)
register(self.ellipsis)
register(self.wildcard)
register(self.append)
register(self.cons)
register(self.list)
register(self.quote)
register(self.quasiquote)
register(self.unquote)
register(self.unquoteSplicing)
register(self.doubleArrow)
register(self.else)
register(self.if)
register(self.lambda)
register(self.let)
register(self.letStar)
register(self.letrec)
register(self.define)
register(self.defineValues)
register(self.makePromise)
register(self.makeStream)
register(self.begin)
register(self.`import`)
register(self.export)
register(self.exportOpen)
register(self.extern)
register(self.rename)
register(self.only)
register(self.except)
register(self.prefix)
register(self.library)
register(self.and)
register(self.or)
register(self.not)
register(self.condExpand)
register(self.include)
register(self.includeCi)
register(self.includeLibDecls)
register(self.scheme)
register(self.r5rs)
register(self.r5rsSyntax)
register(self.starOne)
register(self.starTwo)
register(self.starThree)
}
/// Returns true if there is already an interned symbol for identifier `ident`.
public func exists(_ ident: String) -> Bool {
self.lock.lock()
defer {
self.lock.unlock()
}
return self.symTable[ident] != nil
}
/// Return a new interned symbol for the given identifier `ident`.
public func intern(_ ident: String) -> Symbol {
self.lock.lock()
defer {
self.lock.unlock()
}
if let sym = self.symTable[ident] {
return sym
} else {
let sym = Symbol(ident)
self.symTable[ident] = sym
return sym
}
}
/// Generates a new interned symbol.
public func gensym(_ basename: String) -> Symbol {
self.gensymLock.lock()
defer {
self.gensymLock.unlock()
}
var ident: String
repeat {
ident = basename + String(self.gensymCounter)
self.gensymCounter &+= 1
} while self.exists(ident)
return self.intern(ident)
}
/// Generates an interned symbol by concatenating `prefix` and `sym`.
public func prefix(_ sym: Symbol, with prefix: Symbol) -> Symbol {
return self.intern(prefix.identifier + sym.identifier)
}
/// Returns a generator for iterating over all symbols of this symbol table.
public func makeIterator() -> AnyIterator<Symbol> {
var generator = self.symTable.values.makeIterator()
return AnyIterator { return generator.next() }
}
/// Reset symbol table.
public func release() {
self.symTable = [:]
self.gensymCounter = 0
self.registerNativeSymbols()
}
}
| 7cf45b8c5ea52a78cda163f64e136dfb | 32.221649 | 95 | 0.645772 | false | false | false | false |
magnetsystems/max-ios | refs/heads/master | Tests/Tests/MMModuleSpec.swift | apache-2.0 | 1 | /*
* Copyright (c) 2015 Magnet Systems, Inc.
* All rights reserved.
*
* Licensed under the Apache License, Version 2.0 (the "License"); you
* may not use this file except in compliance with the License. You
* may obtain a copy of the License at
*
* http://www.apache.org/licenses/LICENSE-2.0
*
* Unless required by applicable law or agreed to in writing, software
* distributed under the License is distributed on an "AS IS" BASIS,
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or
* implied. See the License for the specific language governing
* permissions and limitations under the License.
*/
import Foundation
import Quick
import Nimble
import MagnetMax
class MMModuleSpec : QuickSpec {
override func spec() {
describe("MMModuleSpec") {
it("allows you to retrieve configuration") {
let module = MMX.sharedInstance
expect(module.name).to(equal("MMX"))
var isSuccess = false
let success = { () -> Void in
isSuccess = true
}
let failure = { (error: NSError) -> Void in
isSuccess = false
}
module.shouldInitializeWithConfiguration([:], success: success, failure: failure)
expect(isSuccess).to(beTruthy())
// expect(module.appTokenHandler!?(appID: "appID", deviceID: "deviceID", appToken: "appToken")).to(beNil())
// expect(module.userTokenHandler!?(userID: "userID", deviceID: "deviceID", userToken: "userToken")).to(beNil())
}
}
}
}
| d817f667db217e7a3ef9c24cb7b17189 | 36.906977 | 127 | 0.614724 | false | false | false | false |
philipbannon/iOS | refs/heads/master | ColourPlate/ColourPlate/ColorViewController.swift | gpl-2.0 | 1 | //
// ColorViewController.swift
// ColourPlate
//
// Created by Philip Bannon on 07/01/2016.
// Copyright © 2016 Philip Bannon. All rights reserved.
//
import UIKit
class ColorViewController: UIViewController {
@IBOutlet weak var colorLabel: UILabel!
override func viewDidLoad() {
super.viewDidLoad()
// Do any additional setup after loading the view.
}
override func viewWillAppear(animated: Bool) {
if (self.view.backgroundColor == UIColor.redColor() )
{
self.colorLabel.text = "Red!"
} else if (self.view.backgroundColor == UIColor.blueColor()) {
self.colorLabel.text = " Blue!!"
} else if (self.view.backgroundColor == UIColor.greenColor()) {
self.colorLabel.text = "Green!"
} else if (self.view.backgroundColor == UIColor.purpleColor()) {
self.colorLabel.text = "Purple!"
} else if (self.view.backgroundColor == UIColor(red: 255, green: 0, blue: 128, alpha: 1.0)) {
self.colorLabel.text = "Pink!"
} else if (self.view.backgroundColor == UIColor.yellowColor()) {
self.colorLabel.text = "Yellow!"
}
}
override func didReceiveMemoryWarning() {
super.didReceiveMemoryWarning()
// Dispose of any resources that can be recreated.
}
}
| 5275c96985e84ebde10664a5d7c1a377 | 31.119048 | 101 | 0.616753 | false | false | false | false |
tensorflow/swift-models | refs/heads/main | PersonLab/Pose.swift | apache-2.0 | 1 | // Copyright 2020 The TensorFlow Authors. All Rights Reserved.
//
// Licensed under the Apache License, Version 2.0 (the "License");
// you may not use this file except in compliance with the License.
// You may obtain a copy of the License at
//
// http://www.apache.org/licenses/LICENSE-2.0
//
// Unless required by applicable law or agreed to in writing, software
// distributed under the License is distributed on an "AS IS" BASIS,
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
// See the License for the specific language governing permissions and
// limitations under the License.
import TensorFlow
struct Keypoint {
var y: Float
var x: Float
let index: KeypointIndex
let score: Float
init(
heatmapY: Int, heatmapX: Int, index: Int, score: Float, offsets: CPUTensor<Float>,
outputStride: Int
) {
self.y = Float(heatmapY) * Float(outputStride) + offsets[heatmapY, heatmapX, index]
self.x =
Float(heatmapX) * Float(outputStride)
+ offsets[heatmapY, heatmapX, index + KeypointIndex.allCases.count]
self.index = KeypointIndex(rawValue: index)!
self.score = score
}
init(y: Float, x: Float, index: KeypointIndex, score: Float) {
self.y = y
self.x = x
self.index = index
self.score = score
}
func isWithinRadiusOfCorrespondingKeypoints(in poses: [Pose], radius: Float) -> Bool {
return poses.contains { pose in
let correspondingKeypoint = pose.getKeypoint(self.index)!
let dy = correspondingKeypoint.y - self.y
let dx = correspondingKeypoint.x - self.x
let squaredDistance = dy * dy + dx * dx
return squaredDistance <= radius * radius
}
}
}
enum KeypointIndex: Int, CaseIterable {
case nose = 0
case leftEye
case rightEye
case leftEar
case rightEar
case leftShoulder
case rightShoulder
case leftElbow
case rightElbow
case leftWrist
case rightWrist
case leftHip
case rightHip
case leftKnee
case rightKnee
case leftAnkle
case rightAnkle
}
enum Direction { case fwd, bwd }
func getNextKeypointIndexAndDirection(_ keypointId: KeypointIndex) -> [(KeypointIndex, Direction)] {
switch keypointId {
case .nose:
return [(.leftEye, .fwd), (.rightEye, .fwd), (.leftShoulder, .fwd), (.rightShoulder, .fwd)]
case .leftEye: return [(.nose, .bwd), (.leftEar, .fwd)]
case .rightEye: return [(.nose, .bwd), (.rightEar, .fwd)]
case .leftEar: return [(.leftEye, .bwd)]
case .rightEar: return [(.rightEye, .bwd)]
case .leftShoulder: return [(.leftHip, .fwd), (.leftElbow, .fwd), (.nose, .bwd)]
case .rightShoulder: return [(.rightHip, .fwd), (.rightElbow, .fwd), (.nose, .bwd)]
case .leftElbow: return [(.leftWrist, .fwd), (.leftShoulder, .bwd)]
case .rightElbow: return [(.rightWrist, .fwd), (.rightShoulder, .bwd)]
case .leftWrist: return [(.leftElbow, .bwd)]
case .rightWrist: return [(.rightElbow, .bwd)]
case .leftHip: return [(.leftKnee, .fwd), (.leftShoulder, .bwd)]
case .rightHip: return [(.rightKnee, .fwd), (.rightShoulder, .bwd)]
case .leftKnee: return [(.leftAnkle, .fwd), (.leftHip, .bwd)]
case .rightKnee: return [(.rightAnkle, .fwd), (.rightHip, .bwd)]
case .leftAnkle: return [(.leftKnee, .bwd)]
case .rightAnkle: return [(.rightKnee, .bwd)]
}
}
/// Maps a pair of keypoint indexes to the appropiate index to be used
/// in the displacement forward and backward tensors.
let keypointPairToDisplacementIndexMap: [Set<KeypointIndex>: Int] = [
Set([.nose, .leftEye]): 0,
Set([.leftEye, .leftEar]): 1,
Set([.nose, .rightEye]): 2,
Set([.rightEye, .rightEar]): 3,
Set([.nose, .leftShoulder]): 4,
Set([.leftShoulder, .leftElbow]): 5,
Set([.leftElbow, .leftWrist]): 6,
Set([.leftShoulder, .leftHip]): 7,
Set([.leftHip, .leftKnee]): 8,
Set([.leftKnee, .leftAnkle]): 9,
Set([.nose, .rightShoulder]): 10,
Set([.rightShoulder, .rightElbow]): 11,
Set([.rightElbow, .rightWrist]): 12,
Set([.rightShoulder, .rightHip]): 13,
Set([.rightHip, .rightKnee]): 14,
Set([.rightKnee, .rightAnkle]): 15,
]
public struct Pose {
var keypoints: [Keypoint?] = Array(repeating: nil, count: KeypointIndex.allCases.count)
var resolution: (height: Int, width: Int)
mutating func add(_ keypoint: Keypoint) {
keypoints[keypoint.index.rawValue] = keypoint
}
func getKeypoint(_ index: KeypointIndex) -> Keypoint? {
return keypoints[index.rawValue]
}
mutating func rescale(to newResolution: (height: Int, width: Int)) {
for i in 0..<keypoints.count {
if var k = keypoints[i] {
k.y *= Float(newResolution.height) / Float(resolution.height)
k.x *= Float(newResolution.width) / Float(resolution.width)
self.keypoints[i] = k
}
}
self.resolution = newResolution
}
}
extension Pose: CustomStringConvertible {
public var description: String {
var description = ""
for keypoint in keypoints {
description.append(
"\(keypoint!.index) - \(keypoint!.score) | \(keypoint!.y) - \(keypoint!.x)\n")
}
return description
}
}
| 3dc7d4508b113243e707cdb18b77611c | 32.171053 | 100 | 0.671361 | false | false | false | false |
DSanzh/GuideMe-iOS | refs/heads/master | GuideMe/View/Profile/History/HistoryCell.swift | mit | 1 | //
// HistoryCell.swift
// GuideMe
//
// Created by Sanzhar on 9/18/17.
// Copyright © 2017 Sanzhar Dauylov. All rights reserved.
//
import UIKit
import EasyPeasy
class HistoryCell: UITableViewCell {
lazy var mainView: UIView = {
let _view = UIView()
_view.backgroundColor = .white
_view.layer.cornerRadius = 3.0
_view.layer.shadowOffset = .zero
_view.layer.shadowRadius = 3.0
_view.layer.shadowOpacity = 0.1
return _view
}()
lazy var mainImage: UIImageView = {
let _image = UIImageView()
_image.contentMode = .scaleAspectFill
_image.layer.cornerRadius = 48.widthProportion()/2
_image.layer.masksToBounds = true
return _image
}()
lazy var mainName: UILabel = {
let _label = UILabel()
_label.font = FontContant.fontWith(20, type: .bold)
return _label
}()
lazy var mainDate: UILabel = {
let _label = UILabel()
_label.font = FontContant.fontWith(12, type: .regular)
return _label
}()
lazy var mainSeparator: UIView = {
let _view = UIView()
_view.backgroundColor = ColorConstants.lightGrey
return _view
}()
lazy var mainStatus: UILabel = {
let _label = UILabel()
_label.font = FontContant.fontWith(15, type: .regular)
return _label
}()
required init?(coder aDecoder: NSCoder) {
super.init(coder: aDecoder)
}
override init(style: UITableViewCellStyle, reuseIdentifier: String?) {
super.init(style: style, reuseIdentifier: reuseIdentifier)
setupViews()
setupConstraints()
}
private func setupViews(){
addSubview(mainView)
selectionStyle = .none
backgroundColor = .clear
[mainImage, mainName, mainDate, mainSeparator, mainStatus].forEach{
mainView.addSubview($0)
}
}
private func setupConstraints(){
mainView.easy.layout([
Top().to(self),
Left().to(self),
Right().to(self),
Height(111.heightProportion()),
Bottom(14.heightProportion()).to(self)
])
mainImage.easy.layout([
Top(14.heightProportion()).to(mainView),
Left(14.widthProportion()).to(mainView),
Width(48.widthProportion()),
Height(48.widthProportion())
])
mainName.easy.layout([
Top().to(mainImage, .top),
Left(15.widthProportion()).to(mainImage)
])
mainDate.easy.layout([
Top(4.heightProportion()).to(mainName),
Left().to(mainName, .left)
])
mainSeparator.easy.layout([
Top(10.heightProportion()).to(mainDate),
Left().to(mainName, .left),
Right().to(mainView),
Height(3)
])
mainStatus.easy.layout([
Top(8.heightProportion()).to(mainSeparator),
Left().to(mainName, .left),
Bottom(10.heightProportion()).to(mainView)
])
}
func configureCell() {
mainImage.image = UIImage(named: "Background.jpg")
mainName.text = "Del Papa"
mainDate.text = "6 марта, 15:00 на 4 человека"
mainStatus.text = "Ожидает подтверждения"
}
}
| 735817986eaa7ed327193788ae58c311 | 28.280702 | 75 | 0.566806 | false | false | false | false |
AlexIzh/Griddle | refs/heads/master | Griddle/Classes/Source/ArraySource.swift | mit | 1 | //
// ArraySource.swift
// CollectionPresenter
//
// Created by Alex on 20/02/16.
// Copyright © 2016 Moqod. All rights reserved.
//
import Foundation
public enum ArrayAction<Model> {
case insert(index: Int, model: Model)
case delete(index: Int)
case replace(index: Int, newModel: Model)
case move(oldIndex: Int, newIndex: Int)
}
public struct ArraySection<Element>: DataSection {
public var header: Any? { return nil }
public var footer: Any? { return nil }
public var items: [Element] = []
public init(items: [Element] = []) {
self.items = items
}
}
open class ArraySource<Element>: DataSource, ExpressibleByArrayLiteral {
public var delegate = DataSourceDelegate()
private var section = ArraySection<Element>()
public var sectionsCount: Int { return 1 }
public var count: Int {
return section.items.count
}
public var items: [Element] {
get { return section.items }
set {
section.items = newValue
delegate.didRefreshAll()
}
}
public subscript(index: Int) -> Element {
get { return section.items[index] }
set {
delegate.willBeginEditing()
section.items[index] = newValue
delegate.didUpdate(.row(.update(.item(section: 0, item: index))))
delegate.didEndEditing()
}
}
// MARK: - Life cycle
public required convenience init(arrayLiteral elements: Element...) {
self.init(array: elements)
}
public init(array: [Element]) {
section.items = array
}
// MARK: - Public methods
public func append(_ item: Element) {
delegate.willBeginEditing()
insert(item, at: items.count)
delegate.didEndEditing()
}
public func sections() -> [ArraySection<Element>] {
return [section]
}
public func itemsCount(for section: Int) -> Int {
return self.section.items.count
}
public func item(at section: Int, index: Int) -> Element? {
guard section == 0 && index >= 0 && index < self.section.items.count
else { return nil }
return self.section.items[index]
}
public func header(at section: Int) -> Any? {
return nil
}
public func footer(at section: Int) -> Any? {
return nil
}
public func perform(actions: [ArrayAction<Element>]) {
delegate.willBeginEditing()
for action in actions {
switch action {
case .insert(let index, let model): insert(model, at: index)
case .delete(let index): deleteItem(at: index)
case .move(let oldIndex, let newIndex): moveItem(from: oldIndex, to: newIndex)
case .replace(let index, let newModel): replaceItem(at: index, with: newModel)
}
}
delegate.didEndEditing()
}
// MARK: - Private methods
func replaceItem(at index: Int, with model: Element) {
section.items[index] = model
delegate.didUpdate(.row(.update(.item(section: 0, item: index))))
}
func moveItem(from index: Int, to newIndex: Int) {
let item = section.items[index]
section.items.remove(at: index)
section.items.insert(item, at: newIndex)
delegate.didUpdate(.row(.move(from: .item(section: 0, item: index), to: .item(section: 0, item: newIndex))))
}
func deleteItem(at index: Int) {
section.items.remove(at: index)
delegate.didUpdate(.row(.delete(.item(section: 0, item: index))))
}
func insert(_ item: Element, at index: Int) {
let insertIndex = index > section.items.count ? section.items.count : index
section.items.insert(item, at: insertIndex)
delegate.didUpdate(.row(.insert(.item(section: 0, item: index))))
}
}
| 18f24e91155425fc325d5104346502b3 | 25.65942 | 114 | 0.631693 | false | false | false | false |
goRestart/restart-backend-app | refs/heads/develop | Tests/StorageTests/Utils/Validator/EmailValidatorSpec.swift | gpl-3.0 | 1 | import XCTest
import Shared
@testable import FluentStorage
class EmailValidatorSpec: XCTestCase {
static let allTests = [
("testShould_return_false_when_email_is_invalid", testShould_return_false_when_email_is_invalid),
("testShould_return_true_when_email_is_valid", testShould_return_true_when_email_is_valid),
("testShould_return_false_when_email_lenght_is_incorrect", testShould_return_false_when_email_lenght_is_incorrect)
]
private let sut = EmailValidator()
override func setUp() {
super.setUp()
}
override func tearDown() {
super.tearDown()
}
func testShould_return_false_when_email_is_invalid() {
let invalidEmail1 = "despacito@"
let invalidEmail2 = "favoritos@com"
let invalidEmail3 = "fonsihot.com"
XCTAssertFalse(sut.validate(invalidEmail1))
XCTAssertFalse(sut.validate(invalidEmail2))
XCTAssertFalse(sut.validate(invalidEmail3))
}
func testShould_return_true_when_email_is_valid() {
let validEmail = "[email protected]"
XCTAssertTrue(sut.validate(validEmail))
}
func testShould_return_false_when_email_lenght_is_incorrect() {
let invalidEmail = "[email protected]"
XCTAssertFalse(sut.validate(invalidEmail))
}
}
| ee7267d27512b78a40d9e7c4fc3a9f46 | 28.613636 | 122 | 0.669992 | false | true | false | false |
jonatascb/Smashtag | refs/heads/master | Smashtag/Twitter/MediaItem.swift | mit | 1 | //
// MediaItem.swift
// Twitter
//
// Created by CS193p Instructor.
// Copyright (c) 2015 Stanford University. All rights reserved.
//
import Foundation
// holds the network url and aspectRatio of an image attached to a Tweet
// created automatically when a Tweet object is created
public struct MediaItem
{
public var url: NSURL!
public var aspectRatio: Double = 0
public var description: String { return (url.absoluteString ?? "no url") + " (aspect ratio = \(aspectRatio))" }
// MARK: - Private Implementation
init?(data: NSDictionary?) {
var valid = false
if let urlString = data?.valueForKeyPath(TwitterKey.MediaURL) as? NSString {
if let url = NSURL(string: urlString as String) {
self.url = url
let h = data?.valueForKeyPath(TwitterKey.Height) as? NSNumber
let w = data?.valueForKeyPath(TwitterKey.Width) as? NSNumber
if h != nil && w != nil && h?.doubleValue != 0 {
aspectRatio = w!.doubleValue / h!.doubleValue
valid = true
}
}
}
if !valid {
return nil
}
}
struct TwitterKey {
static let MediaURL = "media_url_https"
static let Width = "sizes.small.w"
static let Height = "sizes.small.h"
}
}
| c36fbc6d3473d9f27cada4a329b3faac | 28.913043 | 115 | 0.578488 | false | false | false | false |
haskelash/molad | refs/heads/master | Molad/Views/WeekdayLayer.swift | mit | 1 | //
// WeekdayLayer.swift
// Molad
//
// Created by Haskel Ash on 5/29/17.
// Copyright © 2017 HaskelAsh. All rights reserved.
//
import UIKit
class WeekdayLayer: CALayer {
private var current = 0
private let textWheel: TextWheel!
private let outlineLayer = CAShapeLayer()
let startRatio: CGFloat = 0.2
let endRatio: CGFloat = 0.5
override init() {
textWheel = TextWheel()
textWheel.startRatio = startRatio
textWheel.endRatio = endRatio
super.init()
addSublayer(textWheel)
}
required init?(coder aDecoder: NSCoder) {
fatalError("init(coder:) has not been implemented")
}
override func draw(in ctx: CGContext) {
textWheel.frame = bounds
textWheel.setNeedsDisplay()
func wedgePath(wedgeAngle: CGFloat = -.pi/6) -> CGPath {
let path = CGMutablePath()
let wedgeStart: CGFloat = startRatio * bounds.width/2
let wedgeEnd: CGFloat = endRatio * bounds.width/2
//start at r = wedgeStart, ø = wedgeAngle
path.move(to: CGPoint(x: bounds.midX + wedgeStart*cos(wedgeAngle),
y: bounds.midY + wedgeStart*sin(wedgeAngle)))
//add line to r = wedgeEnd, ø = wedgeAngle
path.addLine(to: CGPoint(x: bounds.midX + wedgeEnd*cos(wedgeAngle),
y: bounds.midY + wedgeEnd*sin(wedgeAngle)))
//add arc to r = wedgeEnd, ø = -wedgeAngle
path.addArc(center: CGPoint(x: bounds.midX, y: bounds.midY), radius: wedgeEnd,
startAngle: wedgeAngle, endAngle: -wedgeAngle, clockwise: false)
//add line to r = wedgeStart, ø = -wedgeAngle
path.addLine(to: CGPoint(x: bounds.midX + wedgeStart*cos(-wedgeAngle),
y: bounds.midY + wedgeStart*sin(-wedgeAngle)))
//add arc to r = wedgeStart, ø = wedgeAngle
path.addArc(center: CGPoint(x: bounds.midX, y: bounds.midY), radius: wedgeStart,
startAngle: -wedgeAngle, endAngle: wedgeAngle, clockwise: true)
return path
}
//draw mask wedge
let maskLayer = CAShapeLayer()
maskLayer.path = wedgePath()
maskLayer.fillColor = UIColor.black.cgColor
mask = maskLayer
//draw black outline around mask
outlineLayer.path = wedgePath()
outlineLayer.lineWidth = 4
outlineLayer.fillColor = UIColor.clear.cgColor
outlineLayer.strokeColor = UIColor.black.cgColor
addSublayer(outlineLayer)
}
func rotate() {
let desired = (self.current + 1) % 7
UIView.animate(withDuration: 1.5) {
self.textWheel.transform = CATransform3DMakeRotation(
CGFloat.pi*2.0*CGFloat(desired)/7, 0, 0, -1)
}
self.current = (self.current + 1) % 7
}
private class TextWheel: CALayer {
var startRatio: CGFloat = 0
var endRatio: CGFloat = 1
override func draw(in ctx: CGContext) {
//flip context for text
ctx.translateBy(x: 0, y: bounds.height)
ctx.scaleBy(x: 1.0, y: -1.0)
let days = ["Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat"]
let dayFont = UIFont(name: "Helvetica Light", size: 11)
let dayAttrs = [NSFontAttributeName: dayFont,
NSForegroundColorAttributeName: UIColor.black] as CFDictionary
//draw weekday text rotated at 1/7 of a cirlce intervals
let midWedge = bounds.midX + ((startRatio + endRatio)/2 * bounds.width/2)
for day in days {
let dayStr = day as CFString
let text = CFAttributedStringCreate(nil, dayStr, dayAttrs)!
let line = CTLineCreateWithAttributedString(text)
let lineBounds = CTLineGetBoundsWithOptions(line, .useOpticalBounds)
ctx.setTextDrawingMode(.stroke)
let textX = (midWedge - lineBounds.midX)
let textY = (bounds.midY - lineBounds.midY)
ctx.textPosition = CGPoint(x: textX, y: textY)
CTLineDraw(line, ctx)
ctx.translateBy(x: bounds.midX, y: bounds.midY)
ctx.rotate(by: -.pi*2/7)
ctx.translateBy(x: -bounds.midX, y: -bounds.midY)
}
//done with text, flip context back
ctx.translateBy(x: 0, y: bounds.height)
ctx.scaleBy(x: 1.0, y: -1.0)
}
}
}
| 136beb43ea1b53b5db97b5922a53e775 | 36.178862 | 92 | 0.57424 | false | false | false | false |
jopamer/swift | refs/heads/master | test/Interpreter/algorithms.swift | apache-2.0 | 2 | // RUN: %target-run-simple-swift-swift3 | %FileCheck %s
// REQUIRES: executable_test
func fib() {
var (a, b) = (0, 1)
while b < 10 {
print(b)
(a, b) = (b, a+b)
}
}
fib()
// CHECK: 1
// CHECK: 1
// CHECK: 2
// CHECK: 3
// CHECK: 5
// CHECK: 8
// From: <rdar://problem/17796401>
// FIXME: <rdar://problem/21993692> type checker too slow
let two_oneA = [1, 2, 3, 4].lazy.reversed()
let two_one = Array(two_oneA.filter { $0 % 2 == 0 }.map { $0 / 2 })
print(two_one)
// CHECK: [2, 1]
// rdar://problem/18208283
func flatten<Element, Seq: Sequence, InnerSequence: Sequence
where Seq.Iterator.Element == InnerSequence, InnerSequence.Iterator.Element == Element> (_ outerSequence: Seq) -> [Element] {
var result = [Element]()
for innerSequence in outerSequence {
result.append(contentsOf: innerSequence)
}
return result
}
// CHECK: [1, 2, 3, 4, 5, 6]
let flat = flatten([[1,2,3], [4,5,6]])
print(flat)
// rdar://problem/19416848
func observe<T:Sequence, V where V == T.Iterator.Element>(_ g:T) { }
observe(["a":1])
| bb054f62034a108a46ab12d7e9e5f95d | 22.288889 | 132 | 0.617366 | false | false | false | false |
mcxiaoke/learning-ios | refs/heads/master | ios_programming_4th/Homepwner-ch10/Homepwner/Item.swift | apache-2.0 | 1 | //
// Item.swift
// Homepwner
//
// Created by Xiaoke Zhang on 2017/8/16.
// Copyright © 2017年 Xiaoke Zhang. All rights reserved.
//
import Foundation
struct Item : Equatable{
var itemName:String
var serialNumber:String
var valueInDollars:Int
let dateCreated:Date = Date()
var description:String {
return "\(itemName) (\(serialNumber)) Worth \(valueInDollars), recorded on \(dateCreated)"
}
public static func ==(lhs: Item, rhs: Item) -> Bool {
return lhs.dateCreated == rhs.dateCreated
}
static func randomItem() -> Item {
let adjectives = ["Fluffy", "Rusty", "Shiny"]
let nouns = ["Bear", "Spork", "Mac"]
let ai = Int(arc4random()) % adjectives.count
let ni = Int(arc4random()) % nouns.count
let randomName = "\(adjectives[ai]) \(nouns[ni])"
let randomValue = Int(arc4random_uniform(100))
let s0 = "0\(arc4random_uniform(10))"
let s1 = "A\(arc4random_uniform(26))"
let s2 = "0\(arc4random_uniform(10))"
let randomSerialNumber = "\(s0)-\(s1)-\(s2)"
return Item(itemName:randomName,
serialNumber:randomSerialNumber,
valueInDollars: randomValue)
}
}
| 9ca7c56f3ab3adc1907c82fabd0b3469 | 29.707317 | 98 | 0.592534 | false | false | false | false |
damoyan/BYRClient | refs/heads/master | FromScratch/ImageDecoder.swift | mit | 1 | //
// ImageDecoder.swift
// FromScratch
//
// Created by Yu Pengyang on 1/13/16.
// Copyright © 2016 Yu Pengyang. All rights reserved.
//
import UIKit
import ImageIO
protocol ImageDecoder {
var firstFrame: UIImage? { get }
var frameCount: Int { get }
var totalTime: NSTimeInterval { get }
func imageAtIndex(index: Int) -> UIImage?
func imageDurationAtIndex(index: Int) -> NSTimeInterval
}
class BYRImageDecoder: ImageDecoder {
private let scale: CGFloat
private let data: NSData
private var source: CGImageSource?
private var durations = [NSTimeInterval]()
var firstFrame: UIImage? = nil
var frameCount: Int = 0
var totalTime: NSTimeInterval = 0
init(data: NSData, scale: CGFloat = UIScreen.mainScreen().scale) {
self.data = data
self.scale = scale
source = CGImageSourceCreateWithData(data, nil)
generateImageInfo()
}
// MARK: - ImageDecoder
func imageAtIndex(index: Int) -> UIImage? {
guard let source = self.source else { return nil }
if let cgimage = CGImageSourceCreateImageAtIndex(source, index, nil) {
return decodeCGImage(cgimage, withScale: scale)
}
return nil
}
func imageDurationAtIndex(index: Int) -> NSTimeInterval {
guard index < durations.count else { return 0 }
/*
http://opensource.apple.com/source/WebCore/WebCore-7600.1.25/platform/graphics/cg/ImageSourceCG.cpp
Many annoying ads specify a 0 duration to make an image flash as quickly as
possible. We follow Safari and Firefox's behavior and use a duration of 100 ms
for any frames that specify a duration of <= 10 ms.
See <rdar://problem/7689300> and <http://webkit.org/b/36082> for more information.
See also: http://nullsleep.tumblr.com/post/16524517190/animated-gif-minimum-frame-delay-browser.
*/
let duration = durations[index]
return duration < 0.011 ? 0.1 : duration
}
// MARK: - Private
private func generateImageInfo() {
guard let source = self.source else { return }
frameCount = CGImageSourceGetCount(source)
durations = [NSTimeInterval](count: frameCount, repeatedValue: 0)
for index in 0..<frameCount {
guard let properties = CGImageSourceCopyPropertiesAtIndex(source, index, nil) else {
continue
}
if index == 0, let cgimage = CGImageSourceCreateImageAtIndex(source, index, nil) {
firstFrame = decodeCGImage(cgimage, withScale: scale)
}
if let gifDict = getValue(properties, key: kCGImagePropertyGIFDictionary, type: CFDictionary.self) {
if let unclampedDelay = getValue(gifDict, key: kCGImagePropertyGIFUnclampedDelayTime, type: NSNumber.self) {
durations[index] = unclampedDelay.doubleValue
} else if let delay = getValue(gifDict, key: kCGImagePropertyGIFDelayTime, type: NSNumber.self) {
durations[index] = delay.doubleValue
}
}
}
}
// swift version of SDWebImage decoder (just copy code)
private func decodeCGImage(image: CGImage, withScale scale: CGFloat) -> UIImage? {
let imageSize = CGSize(width: CGImageGetWidth(image), height: CGImageGetHeight(image))
let imageRect = CGRect(origin: CGPointZero, size: imageSize)
let colorSpace = CGColorSpaceCreateDeviceRGB()
var bitmapInfo = CGImageGetBitmapInfo(image).rawValue
let infoMask = bitmapInfo & CGBitmapInfo.AlphaInfoMask.rawValue
let anyNonAlpha = (infoMask == CGImageAlphaInfo.None.rawValue ||
infoMask == CGImageAlphaInfo.NoneSkipFirst.rawValue ||
infoMask == CGImageAlphaInfo.NoneSkipLast.rawValue)
if infoMask == CGImageAlphaInfo.None.rawValue && CGColorSpaceGetNumberOfComponents(colorSpace) > 1 {
bitmapInfo &= ~CGBitmapInfo.AlphaInfoMask.rawValue
bitmapInfo |= CGImageAlphaInfo.NoneSkipFirst.rawValue
} else if !anyNonAlpha && CGColorSpaceGetNumberOfComponents(colorSpace) == 3 {
bitmapInfo &= ~CGBitmapInfo.AlphaInfoMask.rawValue
bitmapInfo |= CGImageAlphaInfo.PremultipliedFirst.rawValue
}
guard let context = CGBitmapContextCreate(nil, Int(imageSize.width), Int(imageSize.height), CGImageGetBitsPerComponent(image), 0, colorSpace, bitmapInfo) else { return nil }
CGContextDrawImage(context, imageRect, image)
guard let newImage = CGBitmapContextCreateImage(context) else { return nil }
return UIImage(CGImage: newImage, scale: scale, orientation: .Up)
}
private func getValue<T>(dict: CFDictionary, key: CFString, type: T.Type) -> T? {
let nkey = unsafeBitCast(key, UnsafePointer<Void>.self)
let v = CFDictionaryGetValue(dict, nkey)
if v == nil {
return nil
}
return unsafeBitCast(v, type)
}
} | b383c7de85fe877fee113f46ad1d5dd4 | 41.358333 | 181 | 0.651318 | false | false | false | false |
ScoutHarris/WordPress-iOS | refs/heads/develop | WordPress/WordPressShareExtension/UIImageView+Extensions.swift | gpl-2.0 | 2 | import Foundation
extension UIImageView {
/// Downloads an image and updates the UIImageView Instance
///
/// - Parameter url: The URL of the target image
///
public func downloadImage(_ url: URL) {
// Hit the cache
if let cachedImage = Downloader.cache.object(forKey: url as AnyObject) as? UIImage {
self.image = cachedImage
return
}
// Cancel any previous OP's
if let task = downloadTask {
task.cancel()
downloadTask = nil
}
// Helpers
let scale = mainScreenScale
let size = CGSize(width: blavatarSizeInPoints, height: blavatarSizeInPoints)
// Hit the Backend
var request = URLRequest(url: url)
request.httpShouldHandleCookies = false
request.addValue("image/*", forHTTPHeaderField: "Accept")
let session = URLSession.shared
let task = session.dataTask(with: request, completionHandler: { [weak self] data, response, error in
guard let data = data, let image = UIImage(data: data, scale: scale) else {
return
}
DispatchQueue.main.async {
// Resize if needed!
var resizedImage = image
if image.size.height > size.height || image.size.width > size.width {
resizedImage = image.resizedImage(with: .scaleAspectFit,
bounds: size,
interpolationQuality: .high)
}
// Update the Cache
Downloader.cache.setObject(resizedImage, forKey: url as AnyObject)
self?.image = resizedImage
}
})
downloadTask = task
task.resume()
}
/// Downloads a resized Blavatar, meant to perfectly fit the UIImageView's Dimensions
///
/// - Parameter url: The URL of the target blavatar
///
public func downloadBlavatar(_ url: URL) {
var components = URLComponents(url: url, resolvingAgainstBaseURL: true)
components?.query = String(format: Downloader.blavatarResizeFormat, blavatarSize)
if let updatedURL = components?.url {
downloadImage(updatedURL)
}
}
/// Returns the desired Blavatar Side-Size, in pixels
///
fileprivate var blavatarSize: Int {
return blavatarSizeInPoints * Int(mainScreenScale)
}
/// Returns the desired Blavatar Side-Size, in points
///
fileprivate var blavatarSizeInPoints: Int {
var size = Downloader.defaultImageSize
if !bounds.size.equalTo(CGSize.zero) {
size = max(bounds.width, bounds.height)
}
return Int(size)
}
/// Returns the Main Screen Scale
///
fileprivate var mainScreenScale: CGFloat {
return UIScreen.main.scale
}
/// Stores the current DataTask, in charge of downloading the remote Image
///
fileprivate var downloadTask: URLSessionDataTask? {
get {
return objc_getAssociatedObject(self, Downloader.taskKey) as? URLSessionDataTask
}
set {
let policy = objc_AssociationPolicy.OBJC_ASSOCIATION_RETAIN_NONATOMIC
objc_setAssociatedObject(self, Downloader.taskKey, newValue, policy)
}
}
/// Private helper structure
///
fileprivate struct Downloader {
/// Default Blavatar Image Size
///
static let defaultImageSize = CGFloat(40)
/// Blavatar Resize Query FormatString
///
static let blavatarResizeFormat = "d=404&s=%d"
/// Stores all of the previously downloaded images
///
static let cache = NSCache<AnyObject, AnyObject>()
/// Key used to associate a Download task to the current instance
///
static let taskKey = "downloadTaskKey"
}
}
| c3f18d0a850f56923252df3e5e672826 | 29.937984 | 108 | 0.58206 | false | false | false | false |
Eonil/Editor | refs/heads/develop | Editor4/WorkspaceWindowState.swift | mit | 1 | //
// WorkspaceWindowState.swift
// Editor4
//
// Created by Hoon H. on 2016/05/14.
// Copyright © 2016 Eonil. All rights reserved.
//
/// We do not keep selection/editing informaiton in navigational state
/// except it's really required because it affects performance too much.
struct WorkspaceWindowState {
var navigatorPane = NavigatorPaneState()
var editorPane = EditorPaneState()
var utilityPane = UtilityPaneState()
var commandPane = CommandPaneState()
}
////////////////////////////////////////////////////////////////
struct NavigatorPaneState {
/// Set `nil` to hide pane.
var current: NavigatorPaneID?
var file = FileNavigatorPaneState()
var issue = IssueNavigatorPaneState()
}
enum NavigatorPaneID {
case files
case issues
case breakpoints
case debug
}
struct FileNavigatorPaneState {
/// Path to a file-node that is currently in editing.
var editing: Bool = false
var filterExpression: String?
var selection = FileNavigatorPaneSelectionState()
}
struct FileNavigatorPaneSelectionState {
/// Currently focused file node.
/// This is clicked file while context-menu is running.
private(set) var highlighting: FileID2?
/// User's most recent focused selection.
/// This is rarely required.
/// - Parameter current:
/// This must be included in `all`.
private(set) var current: FileID2?
/// This work only in specific time-span. Which means
/// accessible only if `version == accessibleVerison`.
private(set) var items: TemporalLazyCollection<FileID2> = []
private init() {
}
mutating func reset() {
highlighting = nil
current = nil
items = []
}
mutating func reset(newCurrent: FileID2?) {
reset()
if let newCurrent = newCurrent {
reset(newCurrent)
}
}
mutating func reset(newCurrent: FileID2) {
reset(newCurrent, [newCurrent])
}
/// You must have a "current" file when you set to a new files.
mutating func reset(newCurrent: FileID2, _ newItems: TemporalLazyCollection<FileID2>) {
assert(newItems.contains(newCurrent))
highlighting = nil
current = newCurrent
items = newItems
}
mutating func highlight(newHighlight: FileID2) {
highlighting = newHighlight
current = nil
// Keeps current selection.
}
}
extension FileNavigatorPaneSelectionState {
func getHighlightOrCurrent() -> FileID2? {
return highlighting ?? current
}
/// - Returns:
/// A highlighted file ID if highlighted file ID is not a part of selected file IDs.
/// All selected file IDs if the highlighted file ID is a part of selected file IDs
/// or there's no highlighted file ID.
func getHighlightOrItems() -> AnyRandomAccessCollection<FileID2> {
if let highlighting = highlighting {
if items.contains(highlighting) {
return AnyRandomAccessCollection(items)
}
else {
return AnyRandomAccessCollection(CollectionOfOne(highlighting).flatMap({$0}))
}
}
else {
return AnyRandomAccessCollection(items)
}
}
}
struct IssueNavigatorPaneState {
var hideWarnings = false
}
////////////////////////////////////////////////////////////////
struct EditorPaneState {
var current: EditorPaneID?
var text = TextEditorPaneState()
}
enum EditorPaneID {
case Text
}
struct TextEditorPaneState {
private(set) var lines = [String]()
}
struct AutocompletionState {
private(set) var candidates = [AutocompletionCandidateState]()
}
struct AutocompletionCandidateState {
private(set) var code: String
}
////////////////////////////////////////////////////////////////
enum CommandPaneID {
case Console
case Variables
}
struct CommandPaneState {
/// Set `nil` to hide pane.
var current: CommandPaneID?
var variable = VariableNavigatorPaneState()
var console = ConsoleCommandPaneState()
}
struct VariableNavigatorPaneState {
}
struct ConsoleCommandPaneState {
}
////////////////////////////////////////////////////////////////
struct UtilityPaneState {
/// Set `nil` to hide pane.
var current: UtilityPaneID?
}
enum UtilityPaneID {
case Inspector
case Help
}
struct InspectorUtilityPaneState {
var current: InspectableID?
}
enum InspectableID {
case File(FileNodePath)
}
| 650da0701637e1361b8cec135ca0b86b | 22.581152 | 93 | 0.625888 | false | false | false | false |
AngryLi/Onmyouji | refs/heads/master | Carthage/Checkouts/realm-cocoa/Realm/Tests/Swift/SwiftTestObjects.swift | mit | 2 | ////////////////////////////////////////////////////////////////////////////
//
// Copyright 2014 Realm Inc.
//
// Licensed under the Apache License, Version 2.0 (the "License");
// you may not use this file except in compliance with the License.
// You may obtain a copy of the License at
//
// http://www.apache.org/licenses/LICENSE-2.0
//
// Unless required by applicable law or agreed to in writing, software
// distributed under the License is distributed on an "AS IS" BASIS,
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
// See the License for the specific language governing permissions and
// limitations under the License.
//
////////////////////////////////////////////////////////////////////////////
import Realm
class SwiftStringObject: RLMObject {
@objc dynamic var stringCol = ""
}
class SwiftBoolObject: RLMObject {
@objc dynamic var boolCol = false
}
class SwiftIntObject: RLMObject {
@objc dynamic var intCol = 0
}
class SwiftLongObject: RLMObject {
@objc dynamic var longCol: Int64 = 0
}
class SwiftObject: RLMObject {
@objc dynamic var boolCol = false
@objc dynamic var intCol = 123
@objc dynamic var floatCol = 1.23 as Float
@objc dynamic var doubleCol = 12.3
@objc dynamic var stringCol = "a"
@objc dynamic var binaryCol = "a".data(using: String.Encoding.utf8)
@objc dynamic var dateCol = Date(timeIntervalSince1970: 1)
@objc dynamic var objectCol = SwiftBoolObject()
@objc dynamic var arrayCol = RLMArray<SwiftBoolObject>(objectClassName: SwiftBoolObject.className())
}
class SwiftOptionalObject: RLMObject {
@objc dynamic var optStringCol: String?
@objc dynamic var optNSStringCol: NSString?
@objc dynamic var optBinaryCol: Data?
@objc dynamic var optDateCol: Date?
@objc dynamic var optObjectCol: SwiftBoolObject?
}
class SwiftDogObject: RLMObject {
@objc dynamic var dogName = ""
}
class SwiftOwnerObject: RLMObject {
@objc dynamic var name = ""
@objc dynamic var dog: SwiftDogObject? = SwiftDogObject()
}
class SwiftAggregateObject: RLMObject {
@objc dynamic var intCol = 0
@objc dynamic var floatCol = 0 as Float
@objc dynamic var doubleCol = 0.0
@objc dynamic var boolCol = false
@objc dynamic var dateCol = Date()
}
class SwiftAllIntSizesObject: RLMObject {
@objc dynamic var int8 : Int8 = 0
@objc dynamic var int16 : Int16 = 0
@objc dynamic var int32 : Int32 = 0
@objc dynamic var int64 : Int64 = 0
}
class SwiftEmployeeObject: RLMObject {
@objc dynamic var name = ""
@objc dynamic var age = 0
@objc dynamic var hired = false
}
class SwiftCompanyObject: RLMObject {
@objc dynamic var employees = RLMArray<SwiftEmployeeObject>(objectClassName: SwiftEmployeeObject.className())
}
class SwiftArrayPropertyObject: RLMObject {
@objc dynamic var name = ""
@objc dynamic var array = RLMArray<SwiftStringObject>(objectClassName: SwiftStringObject.className())
@objc dynamic var intArray = RLMArray<SwiftIntObject>(objectClassName: SwiftIntObject.className())
}
class SwiftDynamicObject: RLMObject {
@objc dynamic var stringCol = "a"
@objc dynamic var intCol = 0
}
class SwiftUTF8Object: RLMObject {
@objc dynamic var 柱колоéнǢкƱаم👍 = "值значен™👍☞⎠‱௹♣︎☐▼❒∑⨌⧭иеمرحبا"
}
class SwiftIgnoredPropertiesObject: RLMObject {
@objc dynamic var name = ""
@objc dynamic var age = 0
@objc dynamic var runtimeProperty: AnyObject?
@objc dynamic var readOnlyProperty: Int { return 0 }
override class func ignoredProperties() -> [String]? {
return ["runtimeProperty"]
}
}
class SwiftPrimaryStringObject: RLMObject {
@objc dynamic var stringCol = ""
@objc dynamic var intCol = 0
override class func primaryKey() -> String {
return "stringCol"
}
}
class SwiftLinkSourceObject: RLMObject {
@objc dynamic var id = 0
@objc dynamic var link: SwiftLinkTargetObject?
}
class SwiftLinkTargetObject: RLMObject {
@objc dynamic var id = 0
@objc dynamic var backlinks: RLMLinkingObjects<SwiftLinkSourceObject>?
override class func linkingObjectsProperties() -> [String : RLMPropertyDescriptor] {
return ["backlinks": RLMPropertyDescriptor(with: SwiftLinkSourceObject.self, propertyName: "link")]
}
}
class SwiftLazyVarObject : RLMObject {
@objc dynamic lazy var lazyProperty : String = "hello world"
}
class SwiftIgnoredLazyVarObject : RLMObject {
@objc dynamic var id = 0
@objc dynamic lazy var ignoredVar : String = "hello world"
override class func ignoredProperties() -> [String] { return ["ignoredVar"] }
}
class SwiftObjectiveCTypesObject: RLMObject {
@objc dynamic var stringCol: NSString?
@objc dynamic var dateCol: NSDate?
@objc dynamic var dataCol: NSData?
@objc dynamic var numCol: NSNumber? = 0
}
| 2fb5ef7b7d258ad838f1dfd0ffb37008 | 30.219355 | 113 | 0.692292 | false | false | false | false |
Conaaando/swift-hacker-rank | refs/heads/master | 00.Warmup/02-large-sum.swift | mit | 1 | #!/usr/bin/swift
/*
https://github.com/singledev/swift-hacker-rank
02-large-sum.swift
https://www.hackerrank.com/challenges/a-very-big-sum
Created by Fernando Fernandes on 07/04/16.
Copyright © 2016 SINGLEDEV. All rights reserved.
http://stackoverflow.com/users/584548/singledev
Instructions:
$ chmod a+x 02-large-sum.swift
$ ./02-large-sum.swift
*/
import Foundation
print("Type a NUMBER, then press ENTER")
var n = Int(readLine()!)!
print("Type \(n) numbers separated by spaces, then press ENTER")
var arr = readLine()!.characters.split(" ").map(String.init)
var sum: Double = 0.0
for (var i = 0; i < n; i++) {
sum += Double(arr[i])!
}
print("The sum is: " + String(format: "%.0f", sum))
| daf33517516176446d14873e1a36c464 | 18.702703 | 64 | 0.668038 | false | false | false | false |
DarrenKong/firefox-ios | refs/heads/master | Client/Frontend/Browser/SearchEngines.swift | mpl-2.0 | 1 | /* This Source Code Form is subject to the terms of the Mozilla Public
* License, v. 2.0. If a copy of the MPL was not distributed with this
* file, You can obtain one at http://mozilla.org/MPL/2.0/. */
import Foundation
import Shared
import Storage
import XCGLogger
private let log = Logger.browserLogger
private let OrderedEngineNames = "search.orderedEngineNames"
private let DisabledEngineNames = "search.disabledEngineNames"
private let ShowSearchSuggestionsOptIn = "search.suggestions.showOptIn"
private let ShowSearchSuggestions = "search.suggestions.show"
private let customSearchEnginesFileName = "customEngines.plist"
/**
* Manage a set of Open Search engines.
*
* The search engines are ordered. Individual search engines can be enabled and disabled. The
* first search engine is distinguished and labeled the "default" search engine; it can never be
* disabled. Search suggestions should always be sourced from the default search engine.
*
* Two additional bits of information are maintained: whether the user should be shown "opt-in to
* search suggestions" UI, and whether search suggestions are enabled.
*
* Consumers will almost always use `defaultEngine` if they want a single search engine, and
* `quickSearchEngines()` if they want a list of enabled quick search engines (possibly empty,
* since the default engine is never included in the list of enabled quick search engines, and
* it is possible to disable every non-default quick search engine).
*
* The search engines are backed by a write-through cache into a ProfilePrefs instance. This class
* is not thread-safe -- you should only access it on a single thread (usually, the main thread)!
*/
class SearchEngines {
fileprivate let prefs: Prefs
fileprivate let fileAccessor: FileAccessor
init(prefs: Prefs, files: FileAccessor) {
self.prefs = prefs
// By default, show search suggestions
self.shouldShowSearchSuggestions = prefs.boolForKey(ShowSearchSuggestions) ?? true
self.fileAccessor = files
self.disabledEngineNames = getDisabledEngineNames()
self.orderedEngines = getOrderedEngines()
}
var defaultEngine: OpenSearchEngine {
get {
return self.orderedEngines[0]
}
set(defaultEngine) {
// The default engine is always enabled.
self.enableEngine(defaultEngine)
// The default engine is always first in the list.
var orderedEngines = self.orderedEngines.filter { engine in engine.shortName != defaultEngine.shortName }
orderedEngines.insert(defaultEngine, at: 0)
self.orderedEngines = orderedEngines
}
}
func isEngineDefault(_ engine: OpenSearchEngine) -> Bool {
return defaultEngine.shortName == engine.shortName
}
// The keys of this dictionary are used as a set.
fileprivate var disabledEngineNames: [String: Bool]! {
didSet {
self.prefs.setObject(Array(self.disabledEngineNames.keys), forKey: DisabledEngineNames)
}
}
var orderedEngines: [OpenSearchEngine]! {
didSet {
self.prefs.setObject(self.orderedEngines.map { $0.shortName }, forKey: OrderedEngineNames)
}
}
var quickSearchEngines: [OpenSearchEngine]! {
get {
return self.orderedEngines.filter({ (engine) in !self.isEngineDefault(engine) && self.isEngineEnabled(engine) })
}
}
var shouldShowSearchSuggestions: Bool {
didSet {
self.prefs.setObject(shouldShowSearchSuggestions, forKey: ShowSearchSuggestions)
}
}
func isEngineEnabled(_ engine: OpenSearchEngine) -> Bool {
return disabledEngineNames.index(forKey: engine.shortName) == nil
}
func enableEngine(_ engine: OpenSearchEngine) {
disabledEngineNames.removeValue(forKey: engine.shortName)
}
func disableEngine(_ engine: OpenSearchEngine) {
if isEngineDefault(engine) {
// Can't disable default engine.
return
}
disabledEngineNames[engine.shortName] = true
}
func deleteCustomEngine(_ engine: OpenSearchEngine) {
// We can't delete a preinstalled engine or an engine that is currently the default.
if !engine.isCustomEngine || isEngineDefault(engine) {
return
}
customEngines.remove(at: customEngines.index(of: engine)!)
saveCustomEngines()
orderedEngines = getOrderedEngines()
}
/// Adds an engine to the front of the search engines list.
func addSearchEngine(_ engine: OpenSearchEngine) {
customEngines.append(engine)
orderedEngines.insert(engine, at: 1)
saveCustomEngines()
}
func queryForSearchURL(_ url: URL?) -> String? {
for engine in orderedEngines {
guard let searchTerm = engine.queryForSearchURL(url) else { continue }
return searchTerm
}
return nil
}
fileprivate func getDisabledEngineNames() -> [String: Bool] {
if let disabledEngineNames = self.prefs.stringArrayForKey(DisabledEngineNames) {
var disabledEngineDict = [String: Bool]()
for engineName in disabledEngineNames {
disabledEngineDict[engineName] = true
}
return disabledEngineDict
} else {
return [String: Bool]()
}
}
fileprivate func customEngineFilePath() -> String {
let profilePath = try! self.fileAccessor.getAndEnsureDirectory() as NSString
return profilePath.appendingPathComponent(customSearchEnginesFileName)
}
fileprivate lazy var customEngines: [OpenSearchEngine] = {
return NSKeyedUnarchiver.unarchiveObject(withFile: self.customEngineFilePath()) as? [OpenSearchEngine] ?? []
}()
fileprivate func saveCustomEngines() {
NSKeyedArchiver.archiveRootObject(customEngines, toFile: self.customEngineFilePath())
}
/// Return all possible language identifiers in the order of most specific to least specific.
/// For example, zh-Hans-CN will return [zh-Hans-CN, zh-CN, zh].
class func possibilitiesForLanguageIdentifier(_ languageIdentifier: String) -> [String] {
var possibilities: [String] = []
let components = languageIdentifier.components(separatedBy: "-")
possibilities.append(languageIdentifier)
if components.count == 3, let first = components.first, let last = components.last {
possibilities.append("\(first)-\(last)")
}
if components.count >= 2, let first = components.first {
possibilities.append("\(first)")
}
return possibilities
}
/// Get all bundled (not custom) search engines, with the default search engine first,
/// but the others in no particular order.
class func getUnorderedBundledEnginesFor(locale: Locale) -> [OpenSearchEngine] {
let languageIdentifier = locale.identifier
let region = locale.regionCode ?? "US"
let parser = OpenSearchParser(pluginMode: true)
guard let pluginDirectory = Bundle.main.resourceURL?.appendingPathComponent("SearchPlugins") else {
assertionFailure("Search plugins not found. Check bundle")
return []
}
guard let defaultSearchPrefs = DefaultSearchPrefs(with: pluginDirectory.appendingPathComponent("list.json")) else {
assertionFailure("Failed to parse List.json")
return []
}
let possibilities = possibilitiesForLanguageIdentifier(languageIdentifier)
let engineNames = defaultSearchPrefs.visibleDefaultEngines(for: possibilities, and: region)
let defaultEngineName = defaultSearchPrefs.searchDefault(for: possibilities, and: region)
assert(engineNames.count > 0, "No search engines")
return engineNames.map({ (name: $0, path: pluginDirectory.appendingPathComponent("\($0).xml").path) })
.filter({ FileManager.default.fileExists(atPath: $0.path) })
.flatMap({ parser.parse($0.path, engineID: $0.name) })
.sorted { e, _ in e.shortName == defaultEngineName }
}
/// Get all known search engines, possibly as ordered by the user.
fileprivate func getOrderedEngines() -> [OpenSearchEngine] {
let unorderedEngines = customEngines + SearchEngines.getUnorderedBundledEnginesFor(locale: Locale.current)
// might not work to change the default.
guard let orderedEngineNames = prefs.stringArrayForKey(OrderedEngineNames) else {
// We haven't persisted the engine order, so return whatever order we got from disk.
return unorderedEngines
}
// We have a persisted order of engines, so try to use that order.
// We may have found engines that weren't persisted in the ordered list
// (if the user changed locales or added a new engine); these engines
// will be appended to the end of the list.
return unorderedEngines.sorted { engine1, engine2 in
let index1 = orderedEngineNames.index(of: engine1.shortName)
let index2 = orderedEngineNames.index(of: engine2.shortName)
if index1 == nil && index2 == nil {
return engine1.shortName < engine2.shortName
}
// nil < N for all non-nil values of N.
if index1 == nil || index2 == nil {
return index1 ?? -1 > index2 ?? -1
}
return index1! < index2!
}
}
}
| ead015e286b097bbe31f1815ee56d89e | 40.081545 | 124 | 0.671646 | false | false | false | false |
CMP-Studio/TheWarholOutLoud | refs/heads/master | ios/CMSAccessibilityManager.swift | mit | 1 | //
// CMSAccessibilityManager.swift
// AndyWarholAccessibilityProject
//
// Created by Ruben Niculcea on 6/22/16.
// Copyright © 2016 Carnegie Museums of Pittsburgh Innovation Studio.
// All rights reserved.
//
import Foundation
import UIKit
enum CMSAccessibilityManagerEvents:String {
case screenReaderStatusChanged
}
@objc(CMSAccessibilityManager)
class CMSAccessibilityManager: RCTEventEmitter {
override func constantsToExport() -> [String: Any] {
let screenReaderStatusChanged = CMSAccessibilityManagerEvents.screenReaderStatusChanged.rawValue
return [
"Events": [
screenReaderStatusChanged: screenReaderStatusChanged,
]
]
}
override func supportedEvents() -> [String] {
let screenReaderStatusChanged = CMSAccessibilityManagerEvents.screenReaderStatusChanged.rawValue
return [
screenReaderStatusChanged,
]
}
@objc func screenReaderSpeak(_ text:String) {
mainThread() {
UIAccessibilityPostNotification(UIAccessibilityAnnouncementNotification, text);
}
}
@objc func screenReaderScreenChanged(_ text:String) {
mainThread() {
UIAccessibilityPostNotification(UIAccessibilityScreenChangedNotification, text)
}
}
@objc func screenReaderForceFocus(_ reactTag:Int) {
mainThread() {
// How to find the reactTag in JS:
// const reactTag = ReactNative.findNodeHandle(this.refs.testView);
// !! Note: This is true for react 0.28 but bound to change in the future !!
let view = self.bridge.uiManager.view(forReactTag: reactTag as NSNumber!)
UIAccessibilityPostNotification(UIAccessibilityScreenChangedNotification, view)
}
}
@objc func screenReaderReloadLayout() {
mainThread() {
UIAccessibilityPostNotification(UIAccessibilityLayoutChangedNotification, nil);
}
}
@objc func screenReaderStatus(_ resolve:RCTPromiseResolveBlock, reject:RCTPromiseRejectBlock) {
let screenReaderStatus = UIAccessibilityIsVoiceOverRunning()
// This function will never reject but I want to be able
// to use promises to make for cleaner JS code
resolve([screenReaderStatus])
}
override func startObserving() {
NotificationCenter.default.addObserver(self, selector:#selector(CMSAccessibilityManager.screenReaderStatusChanged), name: NSNotification.Name(rawValue: UIAccessibilityVoiceOverStatusChanged), object: nil)
}
func screenReaderStatusChanged() {
let screenReaderStatus = UIAccessibilityIsVoiceOverRunning()
let eventName = CMSAccessibilityManagerEvents.screenReaderStatusChanged.rawValue
let eventData = [
"screenReaderStatus": screenReaderStatus,
]
self.sendEvent(withName: eventName, body: eventData)
}
func mainThread(_ closure:@escaping () -> ()) {
DispatchQueue.main.async {
closure()
}
}
}
| 9132f8f74599d1dcc81785fb629fafb2 | 29.252632 | 208 | 0.729993 | false | false | false | false |
net-a-porter-mobile/XCTest-Gherkin | refs/heads/master | Pod/Core/PageObject.swift | apache-2.0 | 1 | import XCTest
/// Base class for PageObject pattern.
open class PageObject: NSObject {
required public override init() {
super.init()
let presented = isPresented()
XCTAssertTrue(presented, "\(type(of: self).name) is not presented")
}
/// Name of the screen (or its part) that this page object represent.
/// Default is name of this type without "PageObject" suffix, if any.
open class var name: String {
let name = String(describing: self)
if name.lowercased().hasSuffix("pageobject") {
return String(name.dropLast(10)).humanReadableString
}
return name.humanReadableString
}
/// This method should be overriden by subclasses
/// and should return `true` if this PageObject's screen is presented
open func isPresented() -> Bool { fatalError("not implemented") }
}
/// This type defines common steps for all page objects.
public class CommonPageObjectsStepDefiner: StepDefiner {
/// Format for step expression that validates that PageObject is presented
/// Default value matches "I see %@", "I should see %@" or "it is %@" with optional "the" before page object name
public static var isPresentedStepFormat = "^(?:I (?:should )?see|it is) (?:the )?%@$"
override public func defineSteps() {
allSubclassesOf(PageObject.self).forEach { (subclass) in
guard subclass != PageObject.self else { return }
let name = subclass.name
let expression = String(format: CommonPageObjectsStepDefiner.isPresentedStepFormat, name)
step(expression) {
_ = subclass.init()
}
}
}
}
| 839292edb11c960dc1b1b263c2e9ec62 | 37.227273 | 117 | 0.648633 | false | false | false | false |
debugsquad/nubecero | refs/heads/master | nubecero/Controller/Home/CHome.swift | mit | 1 | import UIKit
class CHome:CController
{
private weak var viewHome:VHome!
let model:MHome
let askAuth:Bool
var diskUsed:Int?
init(askAuth:Bool)
{
model = MHome()
self.askAuth = askAuth
super.init()
}
deinit
{
NotificationCenter.default.removeObserver(self)
}
required init?(coder:NSCoder)
{
fatalError()
}
override func loadView()
{
let viewHome:VHome = VHome(controller:self)
self.viewHome = viewHome
view = viewHome
}
override func viewDidLoad()
{
super.viewDidLoad()
if askAuth
{
guard
let shouldAuth:Bool = MSession.sharedInstance.settings.current?.security
else
{
return
}
if shouldAuth
{
parentController.presentAuth()
parentController.controllerAuth?.askAuth()
}
}
}
override func viewDidAppear(_ animated:Bool)
{
super.viewDidAppear(animated)
DispatchQueue.global(qos:DispatchQoS.QoSClass.background).async
{ [weak self] in
guard
let welf:CHome = self
else
{
return
}
NotificationCenter.default.removeObserver(welf)
NotificationCenter.default.addObserver(
welf,
selector:#selector(welf.notifiedSessionLoaded(sender:)),
name:Notification.sessionLoaded,
object:nil)
MSession.sharedInstance.user.sendUpdate()
}
MPhotos.sharedInstance.loadPhotos()
}
//MARK: notified
func notifiedSessionLoaded(sender notification:Notification)
{
NotificationCenter.default.removeObserver(self)
loadUsedDisk()
}
//MARK: private
private func loadUsedDisk()
{
DispatchQueue.global(qos:DispatchQoS.QoSClass.background).async
{
guard
let userId:MSession.UserId = MSession.sharedInstance.user.userId
else
{
return
}
let parentUser:String = FDatabase.Parent.user.rawValue
let propertyDiskUsed:String = FDatabaseModelUser.Property.diskUsed.rawValue
let pathDiskUsed:String = "\(parentUser)/\(userId)/\(propertyDiskUsed)"
FMain.sharedInstance.database.listenOnce(
path:pathDiskUsed,
modelType:FDatabaseModelUserDiskUsed.self)
{ [weak self] (diskUsed:FDatabaseModelUserDiskUsed?) in
guard
let firebaseDiskUsed:FDatabaseModelUserDiskUsed = diskUsed
else
{
return
}
self?.diskUsed = firebaseDiskUsed.diskUsed
DispatchQueue.main.async
{ [weak self] in
self?.usedDiskLoaded()
}
}
}
}
private func usedDiskLoaded()
{
viewHome.sessionLoaded()
DispatchQueue.global(qos:DispatchQoS.QoSClass.background).async
{ [weak self] in
self?.checkFullDisk()
}
}
private func checkFullDisk()
{
guard
let fullWarning:Bool = MSession.sharedInstance.settings.current?.fullWarning,
let plus:Bool = MSession.sharedInstance.settings.current?.nubeceroPlus
else
{
return
}
if !plus
{
if fullWarning
{
MSession.sharedInstance.settings.current?.fullWarning = false
DManager.sharedInstance.save()
DispatchQueue.main.async
{ [weak self] in
self?.storeAd()
}
}
}
}
private func storeAd()
{
let modelAd:MStoreAdPlus = MStoreAdPlus()
let adController:CStoreAd = CStoreAd(model:modelAd)
parentController.over(
controller:adController,
pop:false,
animate:true)
}
//MARK: public
func uploadPictures()
{
let controllerUpload:CHomeUpload = CHomeUpload()
parentController.push(
controller:controllerUpload,
underBar:true)
}
}
| 1302148126c09808110a2d023b39c09b | 23.545455 | 89 | 0.488477 | false | false | false | false |
AaronMT/firefox-ios | refs/heads/master | Shared/DeviceInfo.swift | mpl-2.0 | 6 | /* This Source Code Form is subject to the terms of the Mozilla Public
* License, v. 2.0. If a copy of the MPL was not distributed with this
* file, You can obtain one at http://mozilla.org/MPL/2.0/. */
import UIKit
open class DeviceInfo {
// List of device names that don't support advanced visual settings
static let lowGraphicsQualityModels = ["iPad", "iPad1,1", "iPhone1,1", "iPhone1,2", "iPhone2,1", "iPhone3,1", "iPhone3,2", "iPhone3,3", "iPod1,1", "iPod2,1", "iPod2,2", "iPod3,1", "iPod4,1", "iPad2,1", "iPad2,2", "iPad2,3", "iPad2,4", "iPad3,1", "iPad3,2", "iPad3,3"]
public static var specificModelName: String {
var systemInfo = utsname()
uname(&systemInfo)
let machine = systemInfo.machine
let mirror = Mirror(reflecting: machine)
var identifier = ""
// Parses the string for the model name via NSUTF8StringEncoding, refer to
// http://stackoverflow.com/questions/26028918/ios-how-to-determine-iphone-model-in-swift
for child in mirror.children.enumerated() {
if let value = child.1.value as? Int8, value != 0 {
identifier.append(String(UnicodeScalar(UInt8(value))))
}
}
return identifier
}
/// Return the client name, which can be either "Fennec on Stefan's iPod" or simply "Stefan's iPod" if the application display name cannot be obtained.
open class func defaultClientName() -> String {
let format = NSLocalizedString("%@ on %@", tableName: "Shared", comment: "A brief descriptive name for this app on this device, used for Send Tab and Synced Tabs. The first argument is the app name. The second argument is the device name.")
if ProcessInfo.processInfo.arguments.contains(LaunchArguments.DeviceName) {
return String(format: format, AppInfo.displayName, "iOS")
}
return String(format: format, AppInfo.displayName, UIDevice.current.name)
}
open class func clientIdentifier(_ prefs: Prefs) -> String {
if let id = prefs.stringForKey("clientIdentifier") {
return id
}
let id = UUID().uuidString
prefs.setString(id, forKey: "clientIdentifier")
return id
}
open class func deviceModel() -> String {
return UIDevice.current.model
}
open class func isSimulator() -> Bool {
return ProcessInfo.processInfo.environment["SIMULATOR_ROOT"] != nil
}
open class func isBlurSupported() -> Bool {
// We've tried multiple ways to make this change visible on simulators, but we
// haven't found a solution that worked:
// 1. http://stackoverflow.com/questions/21603475/how-can-i-detect-if-the-iphone-my-app-is-on-is-going-to-use-a-simple-transparen
// 2. https://gist.github.com/conradev/8655650
// Thus, testing has to take place on actual devices.
return !lowGraphicsQualityModels.contains(specificModelName)
}
open class func hasConnectivity() -> Bool {
let status = Reach().connectionStatus()
switch status {
case .online(.wwan), .online(.wiFi):
return true
default:
return false
}
}
// Reports portrait screen size regardless of the current orientation.
open class func screenSizeOrientationIndependent() -> CGSize {
let screenSize = UIScreen.main.bounds.size
return CGSize(width: min(screenSize.width, screenSize.height), height: max(screenSize.width, screenSize.height))
}
}
| a3de2f562504e6b3e0a34f2486e7b94f | 42.641975 | 271 | 0.653748 | false | false | false | false |
drinkapoint/DrinkPoint-iOS | refs/heads/master | DrinkPoint/DrinkPoint/Bartender/BartenderAddItemTableViewCell.swift | mit | 1 | //
// BartenderAddItemTableViewCell.swift
// DrinkPoint
//
// Created by Paul Kirk Adams on 7/5/16.
// Copyright © 2016 Paul Kirk Adams. All rights reserved.
//
import UIKit
class AddItemTableViewCell: UITableViewCell {
@IBOutlet weak var iconImage: UIImageView!
@IBOutlet weak var nameLabel: UILabel!
@IBOutlet weak var checkLabel: UILabel!
func prefersStatusBarHidden() -> Bool {
return true
}
override func awakeFromNib() {
super.awakeFromNib()
}
override func setSelected(selected: Bool, animated: Bool) {
super.setSelected(selected, animated: animated)
self.selectionStyle = .None
}
func setCell(item: Item) {
self.nameLabel.text = item.name
self.nameLabel.textColor = .whiteColor()
switch item.category {
case "mixer":
self.iconImage.image = UIImage(named: "BartenderMixer")
self.iconImage.image = iconImage.image!.imageWithRenderingMode(UIImageRenderingMode.AlwaysTemplate)
self.iconImage.tintColor = .whiteColor()
case "hardDrink":
self.iconImage.image = UIImage(named: "BartenderHardDrink")
self.iconImage.image = iconImage.image!.imageWithRenderingMode(UIImageRenderingMode.AlwaysTemplate)
self.iconImage.tintColor = .whiteColor()
case "softDrink":
self.iconImage.image = UIImage(named: "BartenderSoftDrink")
self.iconImage.image = iconImage.image!.imageWithRenderingMode(UIImageRenderingMode.AlwaysTemplate)
self.iconImage.tintColor = .whiteColor()
case "produce":
self.iconImage.image = UIImage(named: "BartenderProduce")
self.iconImage.image = iconImage.image!.imageWithRenderingMode(UIImageRenderingMode.AlwaysTemplate)
self.iconImage.tintColor = .whiteColor()
case "beer":
self.iconImage.image = UIImage(named: "BartenderBeer")
self.iconImage.image = iconImage.image!.imageWithRenderingMode(UIImageRenderingMode.AlwaysTemplate)
self.iconImage.tintColor = .whiteColor()
case "spice":
self.iconImage.image = UIImage(named: "BartenderSpice")
self.iconImage.image = iconImage.image!.imageWithRenderingMode(UIImageRenderingMode.AlwaysTemplate)
self.iconImage.tintColor = .whiteColor()
case "ice":
self.iconImage.image = UIImage(named: "BartenderIce")
self.iconImage.image = iconImage.image!.imageWithRenderingMode(UIImageRenderingMode.AlwaysTemplate)
self.iconImage.tintColor = .whiteColor()
case "wine":
self.iconImage.image = UIImage(named: "BartenderWine")
self.iconImage.image = iconImage.image!.imageWithRenderingMode(UIImageRenderingMode.AlwaysTemplate)
self.iconImage.tintColor = .whiteColor()
default:
self.iconImage.image = UIImage(named: "BartenderMixer")
self.iconImage.image = iconImage.image!.imageWithRenderingMode(UIImageRenderingMode.AlwaysTemplate)
self.iconImage.tintColor = .whiteColor()
}
}
} | 90af3d9f440b524a84926c282e84670e | 39.04878 | 111 | 0.644228 | false | false | false | false |
loveMyAp/ZYNetworkTools | refs/heads/master | NetWorkingTools.swift | mit | 1 | //
// NetWorkingTools.swift
// sniaWeiBo
//
// Created by mac on 15/11/19.
// Copyright © 2015年 cn.1069560719@qq. All rights reserved.
//
import UIKit
import AFNetworking
private let Domain = "com.baidu.data.error"
enum HTTPMothod: String {
case POST = "POST"
case GET = "GET"
}
class NetWorkingTools: AFHTTPSessionManager {
//定义单例对象
/*
我添加的一个text解析方式,可以根据自己的项目需求自己手动的添加解析方式
tools.responseSerializer.acceptableContentTypes?.insert("text/plain")
*/
static var sharedTools: NetWorkingTools = {
let tools = NetWorkingTools()
tools.responseSerializer.acceptableContentTypes?.insert("text/plain")
return tools
}()
//定义网络访问方法 以后所有的网络访问都经过该方法调用 AFN
//加载字典数据
/*
requestMethod: 发送网络请求的方法类型(枚举)
urlString: 网络请求地址
parameters: 拼接网络地址参数
finished: 返回结果回调(result: 字典类型的数据回调,error: 返回错误信息)
*/
func request(requestMethod: HTTPMothod ,urlString: String,parameters: [String:AnyObject]?,finished:(result: [String:AnyObject]?,error: NSError?) -> ()){
//调用AFN具体的 GET,POST方法
if requestMethod == HTTPMothod.GET{
NetWorkingTools.sharedTools.GET(urlString, parameters: parameters, success: { (_, result) -> Void in
if let dict = result as? [String:AnyObject] {
finished(result: dict, error: nil)
}
let dateError = NSError(domain: Domain, code: -10000, userInfo: [NSLocalizedDescriptionKey:"数据加载错误"])
finished(result: nil, error: dateError)
}) { (_, error) -> Void in
finished(result: nil, error: error)
print(error)
}
}else if requestMethod == HTTPMothod.POST {
NetWorkingTools.sharedTools.POST(urlString, parameters: parameters, success: { (_, result) -> Void in
if let dict = result as? [String:AnyObject] {
finished(result: dict, error: nil)
}
let dateError = NSError(domain: Domain, code: -10000, userInfo: [NSLocalizedDescriptionKey:"数据加载错误"])
finished(result: nil, error: dateError)
}) { (_, error) -> Void in
finished(result: nil, error: error)
print(error)
}
}
}
//加载数组数据
func requestArray(requestMethod: HTTPMothod ,urlString: String,parameters: [String:AnyObject]?,finished:(result: [AnyObject]?,error: NSError?) -> ()){
//调用AFN具体的 GET,POST方法
if requestMethod == HTTPMothod.GET{
NetWorkingTools.sharedTools.GET(urlString, parameters: parameters, success: { (_, result) -> Void in
if let dict = result as? [AnyObject] {
finished(result: dict, error: nil)
}
let dateError = NSError(domain: Domain, code: -11000, userInfo: [NSLocalizedDescriptionKey:"数据加载错误"])
finished(result: nil, error: dateError)
}) { (_, error) -> Void in
finished(result: nil, error: error)
print(error)
}
}else if requestMethod == HTTPMothod.POST {
NetWorkingTools.sharedTools.POST(urlString, parameters: parameters, success: { (_, result) -> Void in
if let dict = result as? [AnyObject] {
finished(result: dict, error: nil)
}
let dateError = NSError(domain: Domain, code: -11000, userInfo: [NSLocalizedDescriptionKey:"数据加载错误"])
finished(result: nil, error: dateError)
}) { (_, error) -> Void in
finished(result: nil, error: error)
print(error)
}
}
}
//添加上传图片的方法
func uploadImage(urlString: String,parmaters: [String : AnyObject]?,imageData: NSData,finished: (result: [String : AnyObject]?, error: NSError?) -> ()) {
POST(urlString, parameters: parmaters, constructingBodyWithBlock: { (multipartFormData) -> Void in
//1.data 要上传的文件的二进制数据
//2.name 表示上传的文件服务器对应的字段
//3.filename 表示服务器接受后 存储的名字 名字可以随便取
//4.上传文件的格式 image/jpeg
multipartFormData.appendPartWithFileData(imageData, name: "pic", fileName: "OMG", mimeType: "image/jpeg")
}, success: { (_, result) -> Void in
if let dict = result as? [String : AnyObject] {
finished(result: dict, error: nil)
}
}) { (_, error) -> Void in
finished(result: nil, error: error)
print(error)
}
}
}
| 9e6b21e27832ea601e506677d2baf641 | 38.798319 | 157 | 0.558488 | false | false | false | false |
khoren93/SwiftHub | refs/heads/master | SwiftHub/Modules/Events/EventCellViewModel.swift | mit | 1 | //
// EventCellViewModel.swift
// SwiftHub
//
// Created by Sygnoos9 on 9/6/18.
// Copyright © 2018 Khoren Markosyan. All rights reserved.
//
import Foundation
import RxSwift
import RxCocoa
class EventCellViewModel: DefaultTableViewCellViewModel {
let event: Event
let userSelected = PublishSubject<User>()
init(with event: Event) {
self.event = event
super.init()
let actorName = event.actor?.login ?? ""
var badgeImage: UIImage?
var actionText = ""
var body = ""
switch event.type {
case .fork:
actionText = "forked"
badgeImage = R.image.icon_cell_badge_fork()
case .create:
let payload = event.payload as? CreatePayload
actionText = ["created", (payload?.refType.rawValue ?? ""), (payload?.ref ?? ""), "in"].joined(separator: " ")
badgeImage = payload?.refType.image()
case .delete:
let payload = event.payload as? DeletePayload
actionText = ["deleted", (payload?.refType.rawValue ?? ""), (payload?.ref ?? ""), "in"].joined(separator: " ")
badgeImage = payload?.refType.image()
case .issueComment:
let payload = event.payload as? IssueCommentPayload
actionText = ["commented on issue", "#\(payload?.issue?.number ?? 0)", "at"].joined(separator: " ")
body = payload?.comment?.body ?? ""
badgeImage = R.image.icon_cell_badge_comment()
case .issues:
let payload = event.payload as? IssuesPayload
actionText = [(payload?.action ?? ""), "issue", "in"].joined(separator: " ")
body = payload?.issue?.title ?? ""
badgeImage = R.image.icon_cell_badge_issue()
case .member:
let payload = event.payload as? MemberPayload
actionText = [(payload?.action ?? ""), "\(payload?.member?.login ?? "")", "as a collaborator to"].joined(separator: " ")
badgeImage = R.image.icon_cell_badge_collaborator()
case .pullRequest:
let payload = event.payload as? PullRequestPayload
actionText = [(payload?.action ?? ""), "pull request", "#\(payload?.number ?? 0)", "in"].joined(separator: " ")
body = payload?.pullRequest?.title ?? ""
badgeImage = R.image.icon_cell_badge_pull_request()
case .pullRequestReviewComment:
let payload = event.payload as? PullRequestReviewCommentPayload
actionText = ["commented on pull request", "#\(payload?.pullRequest?.number ?? 0)", "in"].joined(separator: " ")
body = payload?.comment?.body ?? ""
badgeImage = R.image.icon_cell_badge_comment()
case .push:
let payload = event.payload as? PushPayload
actionText = ["pushed to", payload?.ref ?? "", "at"].joined(separator: " ")
badgeImage = R.image.icon_cell_badge_push()
case .release:
let payload = event.payload as? ReleasePayload
actionText = [payload?.action ?? "", "release", payload?.release?.name ?? "", "in"].joined(separator: " ")
body = payload?.release?.body ?? ""
badgeImage = R.image.icon_cell_badge_tag()
case .star:
actionText = "starred"
badgeImage = R.image.icon_cell_badge_star()
default: break
}
let repoName = event.repository?.fullname ?? ""
title.accept([actorName, actionText, repoName].joined(separator: " "))
detail.accept(event.createdAt?.toRelative())
secondDetail.accept(body)
imageUrl.accept(event.actor?.avatarUrl)
badge.accept(badgeImage?.template)
badgeColor.accept(UIColor.Material.green)
}
}
extension EventCellViewModel {
static func == (lhs: EventCellViewModel, rhs: EventCellViewModel) -> Bool {
return lhs.event == rhs.event
}
}
extension CreateEventType {
func image() -> UIImage? {
switch self {
case .repository: return R.image.icon_cell_badge_repository()
case .branch: return R.image.icon_cell_badge_branch()
case .tag: return R.image.icon_cell_badge_tag()
}
}
}
extension DeleteEventType {
func image() -> UIImage? {
switch self {
case .repository: return R.image.icon_cell_badge_repository()
case .branch: return R.image.icon_cell_badge_branch()
case .tag: return R.image.icon_cell_badge_tag()
}
}
}
| e6422397ab23b85c2ac72de3b5ce39ca | 38.429825 | 132 | 0.589766 | false | false | false | false |
ArthurKK/XCGLogger | refs/heads/master | XCGLogger/DemoApps/iOS/iOSDemo/iOSDemo/AppDelegate.swift | mit | 4 | //
// AppDelegate.swift
// XCGLogger: https://github.com/DaveWoodCom/XCGLogger
//
// Created by Dave Wood on 2014-06-06.
// Copyright (c) 2014 Dave Wood, Cerebral Gardens.
// Some rights reserved: https://github.com/DaveWoodCom/XCGLogger/blob/master/LICENSE.txt
//
import UIKit
import XCGLogger
let appDelegate = UIApplication.sharedApplication().delegate as! AppDelegate
let log: XCGLogger = {
// Setup XCGLogger
let log = XCGLogger.defaultInstance()
log.xcodeColorsEnabled = true // Or set the XcodeColors environment variable in your scheme to YES
log.xcodeColors = [
.Verbose: .lightGrey,
.Debug: .darkGrey,
.Info: .darkGreen,
.Warning: .orange,
.Error: XCGLogger.XcodeColor(fg: UIColor.redColor(), bg: UIColor.whiteColor()), // Optionally use a UIColor
.Severe: XCGLogger.XcodeColor(fg: (255, 255, 255), bg: (255, 0, 0)) // Optionally use RGB values directly
]
#if USE_NSLOG // Set via Build Settings, under Other Swift Flags
log.removeLogDestination(XCGLogger.constants.baseConsoleLogDestinationIdentifier)
log.addLogDestination(XCGNSLogDestination(owner: log, identifier: XCGLogger.constants.nslogDestinationIdentifier))
log.logAppDetails()
#else
let logPath: NSURL = appDelegate.cacheDirectory.URLByAppendingPathComponent("XCGLogger_Log.txt")
log.setup(logLevel: .Debug, showThreadName: true, showLogLevel: true, showFileNames: true, showLineNumbers: true, writeToFile: logPath)
#endif
return log
}()
@UIApplicationMain
class AppDelegate: UIResponder, UIApplicationDelegate {
// MARK: - Properties
var window: UIWindow?
let documentsDirectory: NSURL = {
let urls = NSFileManager.defaultManager().URLsForDirectory(.DocumentDirectory, inDomains: .UserDomainMask)
return urls[urls.endIndex-1] as! NSURL
}()
let cacheDirectory: NSURL = {
let urls = NSFileManager.defaultManager().URLsForDirectory(.CachesDirectory, inDomains: .UserDomainMask)
return urls[urls.endIndex-1] as! NSURL
}()
// MARK: - Life cycle methods
func application(application: UIApplication, didFinishLaunchingWithOptions launchOptions: [NSObject: AnyObject]?) -> Bool {
// Override point for customization after application launch.
return true
}
func applicationWillResignActive(application: UIApplication) {
// Sent when the application is about to move from active to inactive state. This can occur for certain types of temporary interruptions (such as an incoming phone call or SMS message) or when the user quits the application and it begins the transition to the background state.
// Use this method to pause ongoing tasks, disable timers, and throttle down OpenGL ES frame rates. Games should use this method to pause the game.
}
func applicationDidEnterBackground(application: UIApplication) {
// Use this method to release shared resources, save user data, invalidate timers, and store enough application state information to restore your application to its current state in case it is terminated later.
// If your application supports background execution, this method is called instead of applicationWillTerminate: when the user quits.
}
func applicationWillEnterForeground(application: UIApplication) {
// Called as part of the transition from the background to the inactive state; here you can undo many of the changes made on entering the background.
}
func applicationDidBecomeActive(application: UIApplication) {
// Restart any tasks that were paused (or not yet started) while the application was inactive. If the application was previously in the background, optionally refresh the user interface.
}
func applicationWillTerminate(application: UIApplication) {
// Called when the application is about to terminate. Save data if appropriate. See also applicationDidEnterBackground:.
}
}
func noop() {
// Global no operation function, useful for doing nothing in a switch option, and examples
}
| 68b2e69bbba140ac3c2f6a546057dce4 | 46.44186 | 285 | 0.738235 | false | false | false | false |
muukii/LightRoom | refs/heads/master | LightRoom/Classes/Operators.swift | mit | 2 | //
// Operators.swift
// LightRoom
//
// Created by Hiroshi Kimura on 2/27/16.
// Copyright © 2016 muukii. All rights reserved.
//
import Foundation
import CoreImage
/**
Connect FilterComponentType to FilterComponentType
*/
infix operator >>> : MultiplicationPrecedence
/**
Set inputBackgroundImage on CompositionComponentType
*/
infix operator --* : MultiplicationPrecedence
@discardableResult
public func >>> (chain1: FilterChain, chain2: FilterChain) -> FilterChain {
chain2.inputImage = chain1.outputImage
_ = chain1.connect(chain2)
return chain2
}
@discardableResult
public func >>> (image: CIImage?, chain: FilterChain) -> FilterChain {
chain.inputImage = image
return chain
}
@discardableResult
public func >>> (image: CIImage?, component: FilterComponentType) -> FilterComponentType {
component.inputImage = image
return component
}
@discardableResult
public func >>> (chain1: FilterComponentType, component: FilterComponentType) -> FilterComponentType {
component.inputImage = chain1.outputImage
return component
}
@discardableResult
public func >>> (gen: GeneratorComponent, component: FilterComponentType) -> FilterComponentType {
component.inputImage = gen.outputImage
return component
}
@discardableResult
public func --* (chain1: FilterComponentType, component: CompositionFilterComponent) -> FilterComponentType {
component.inputBackgroundImage = chain1.outputImage
return component
}
@discardableResult
public func --* (image: CIImage?, component: CompositionFilterComponent) -> FilterComponentType {
component.inputBackgroundImage = image
return component
}
@discardableResult
public func --* (gen: GeneratorComponent, component: CompositionFilterComponent) -> FilterComponentType {
component.inputBackgroundImage = gen.outputImage
return component
}
| 7868d6b24d3094e87bd15292286e9d21 | 26.205882 | 109 | 0.761622 | false | false | false | false |
yulingtianxia/pbxprojHelper | refs/heads/master | pbxprojHelper/ViewController.swift | gpl-3.0 | 1 | //
// ViewController.swift
// pbxprojHelper
//
// Created by 杨萧玉 on 2016/9/24.
// Copyright © 2016年 杨萧玉. All rights reserved.
//
import Cocoa
class ViewController: NSViewController {
@IBOutlet weak var filePathTF: NSTextField!
@IBOutlet weak var resultTable: NSOutlineView!
@IBOutlet weak var chooseJSONFileBtn: NSButton!
@IBOutlet weak var filePathListView: NSView!
@IBOutlet weak var filePathListHeightConstraint: NSLayoutConstraint!
var propertyListURL: URL?
var jsonFileURL: URL?
var filterKeyWord = ""
var originalPropertyList: [String: Any] = [:]
var currentPropertyList: [String: Any] = [:]
override func viewDidLoad() {
filePathListView.isHidden = true
let clickFilePathGesture = NSClickGestureRecognizer(target: self, action: #selector(ViewController.handleClickFilePath(_:)))
filePathTF.addGestureRecognizer(clickFilePathGesture)
let chooseFilePathGesture = NSClickGestureRecognizer(target: self, action: #selector(ViewController.chooseFilePathGesture(_:)))
filePathListView.addGestureRecognizer(chooseFilePathGesture)
}
func refreshFilePathListView() {
if !filePathListView.isHidden {
for view in filePathListView.subviews {
view.removeFromSuperview()
}
let textFieldHeight = filePathTF.bounds.size.height
filePathListHeightConstraint.constant = CGFloat(recentUsePaths.count) * textFieldHeight
var nextOriginY: CGFloat = CGFloat(recentUsePaths.count - 1) * textFieldHeight
for key in recentUsePaths {
let path = recentUsePaths[key]
let textField = NSTextField(string: path!)
textField.toolTip = key
textField.isBordered = false
textField.frame = NSRect(x: CGFloat(0), y: nextOriginY, width: filePathListView.bounds.size.width, height: textFieldHeight)
filePathListView.addSubview(textField)
nextOriginY -= textFieldHeight
}
}
}
func handleSelectProjectFileURL(_ url: URL) {
filePathTF.stringValue = url.path
propertyListURL = url
originalPropertyList = [:]
currentPropertyList = [:]
if let data = PropertyListHandler.parseProject(fileURL: url) {
let shortURL: URL
if url.lastPathComponent == "project.pbxproj" {
shortURL = url.deletingLastPathComponent()
}
else {
shortURL = url
}
recentUsePaths[url.path] = shortURL.path
originalPropertyList = data
currentPropertyList = data
resultTable.reloadData()
refreshFilePathListView()
}
}
func handleSelectJSONFileURL(_ url: URL) {
if let data = PropertyListHandler.parseJSON(fileURL: url) as? [String: Any] {
self.jsonFileURL = url
self.currentPropertyList = PropertyListHandler.apply(json: data, onProjectData: self.originalPropertyList)
self.chooseJSONFileBtn.title = url.lastPathComponent
if let projectPath = self.propertyListURL?.path {
projectConfigurationPathPairs[projectPath] = url
}
self.resultTable.reloadData()
}
}
}
//MARK: - User Action
extension ViewController {
@IBAction func selectProjectFile(_ sender: NSButton) {
let openPanel = NSOpenPanel()
openPanel.prompt = "Select"
openPanel.canChooseFiles = true
openPanel.canChooseDirectories = false
openPanel.allowsMultipleSelection = false
openPanel.allowedFileTypes = ["pbxproj", "xcodeproj"]
openPanel.begin { (result) in
if NSApplication.ModalResponse.OK == result, let url = openPanel.url {
storeBookmark(url: url)
self.handleSelectProjectFileURL(url)
}
}
}
@objc func handleClickFilePath(_ gesture: NSClickGestureRecognizer) {
filePathListView.isHidden = !filePathListView.isHidden
refreshFilePathListView()
}
@objc func chooseFilePathGesture(_ gesture: NSClickGestureRecognizer) {
let clickPoint = gesture.location(in: gesture.view)
for (index, subview) in filePathListView.subviews.enumerated() {
let pointInSubview = subview.convert(clickPoint, from: filePathListView)
if subview.bounds.contains(pointInSubview) {
let path = recentUsePaths[index]
handleSelectProjectFileURL(URL(fileURLWithPath: path))
}
}
filePathListView.isHidden = true
}
@IBAction func chooseJSONFile(_ sender: NSButton) {
let openPanel = NSOpenPanel()
openPanel.prompt = "Select"
openPanel.allowsMultipleSelection = false
openPanel.canChooseFiles = true
openPanel.canChooseDirectories = false
openPanel.begin { (result) in
if NSApplication.ModalResponse.OK == result, let url = openPanel.url {
storeBookmark(url: url)
self.handleSelectJSONFileURL(url)
}
}
}
func handleApplyJson(forward isForward: Bool) {
if let propertyURL = propertyListURL, let jsonURL = jsonFileURL {
if let propertyListData = PropertyListHandler.parseProject(fileURL: propertyURL),
let jsonFileData = PropertyListHandler.parseJSON(fileURL: jsonURL) as? [String: Any]{
originalPropertyList = propertyListData
currentPropertyList = PropertyListHandler.apply(json: jsonFileData, onProjectData: originalPropertyList, forward: isForward)
resultTable.reloadData()
}
DispatchQueue.global().async {
PropertyListHandler.generateProject(fileURL: propertyURL, withPropertyList: self.currentPropertyList)
}
}
}
@IBAction func applyJSONConfiguration(_ sender: NSButton) {
handleApplyJson(forward: true)
}
@IBAction func revertJSONConfiguration(_ sender: NSButton) {
handleApplyJson(forward: false)
}
@IBAction func click(_ sender: NSOutlineView) {
if sender.clickedRow >= 0 && sender.clickedColumn >= 0 {
let item = sender.item(atRow: sender.clickedRow)
let column = sender.tableColumns[sender.clickedColumn]
if let selectedString = self.outlineView(sender, objectValueFor: column, byItem: item) as? String {
writePasteboard(selectedString)
}
}
}
@IBAction func doubleClick(_ sender: NSOutlineView) {
if sender.selectedRow >= 0 {
let item = sender.item(atRow: sender.clickedRow)
let path = keyPath(forItem: item)
writePasteboard(path)
}
}
}
//MARK: - NSOutlineViewDataSource
extension ViewController: NSOutlineViewDataSource {
func outlineView(_ outlineView: NSOutlineView, numberOfChildrenOfItem item: Any?) -> Int {
if item == nil {
if filterKeyWord != "" {
return elementsOfDictionary(currentPropertyList, containsKeyWord: filterKeyWord).count
}
return currentPropertyList.count
}
let itemValue = (item as? Item)?.value
if let dictionary = itemValue as? [String: Any] {
if filterKeyWord != "" && !((item as? Item)?.key.lowercased().contains(filterKeyWord.lowercased()) ?? false) {
return elementsOfDictionary(dictionary, containsKeyWord: filterKeyWord).count
}
return dictionary.count
}
if let array = itemValue as? [Any] {
if filterKeyWord != "" && !((item as? Item)?.key.lowercased().contains(filterKeyWord.lowercased()) ?? false) {
return elementsOfArray(array, containsKeyWord: filterKeyWord).count
}
return array.count
}
return 0
}
func outlineView(_ outlineView: NSOutlineView, isItemExpandable item: Any) -> Bool {
return self.outlineView(outlineView, numberOfChildrenOfItem: item) > 0
}
func outlineView(_ outlineView: NSOutlineView, child index: Int, ofItem item: Any?) -> Any {
let itemValue = (item as? Item)?.value
if var dictionary = item == nil ? currentPropertyList : (itemValue as? [String: Any]) {
if filterKeyWord != "" && !((item as? Item)?.key.lowercased().contains(filterKeyWord.lowercased()) ?? false) {
dictionary = elementsOfDictionary(dictionary, containsKeyWord: filterKeyWord)
}
let keys = Array(dictionary.keys)
let key = keys[index]
let value = dictionary[key] ?? ""
let childItem = Item(key: key, value: value, parent: item)
return childItem
}
if var array = (itemValue as? [String]) {
if filterKeyWord != "" && !((item as? Item)?.key.lowercased().contains(filterKeyWord.lowercased()) ?? false) {
array = elementsOfArray(array, containsKeyWord: filterKeyWord) as! [String]
}
return Item(key: array[index], value: "", parent: item)
}
return Item(key: "", value: "", parent: item)
}
func outlineView(_ outlineView: NSOutlineView, objectValueFor tableColumn: NSTableColumn?, byItem item: Any?) -> Any? {
if let pair = item as? Item {
if tableColumn?.identifier.rawValue == "Key" {
return pair.key
}
if tableColumn?.identifier.rawValue == "Value" {
if let value = pair.value as? [String: Any] {
return "Dictionary (\(value.count) elements)"
}
if let value = pair.value as? [Any] {
return "Array (\(value.count) elements)"
}
return pair.value
}
}
return nil
}
}
//MARK: - NSOutlineViewDelegate
extension ViewController: NSOutlineViewDelegate {
func outlineView(_ outlineView: NSOutlineView, shouldEdit tableColumn: NSTableColumn?, item: Any) -> Bool {
return false
}
}
//MARK: - NSTextFieldDelegate
extension ViewController: NSTextFieldDelegate {
func control(_ control: NSControl, textShouldEndEditing fieldEditor: NSText) -> Bool {
filterKeyWord = fieldEditor.string
resultTable.reloadData()
resultTable.expandItem(nil, expandChildren: true)
return true
}
}
| e251c0c2aaa2e43017409d3c127c2b12 | 38.518519 | 140 | 0.617807 | false | false | false | false |
KrishMunot/swift | refs/heads/master | test/decl/func/default-values.swift | apache-2.0 | 3 | // RUN: %target-parse-verify-swift
var func5 : (fn : (Int,Int) -> ()) -> ()
// Default arguments for functions.
func foo3(a: Int = 2, b: Int = 3) {}
func functionCall() {
foo3(a: 4)
foo3()
foo3(a : 4)
foo3(b : 4)
foo3(a : 2, b : 4)
}
func g() {}
func h(_ x: () -> () = g) { x() }
// Tuple types cannot have default values, but recover well here.
func tupleTypes() {
typealias ta1 = (a : Int = ()) // expected-error{{default argument not permitted in a tuple type}}{{28-32=}}
// expected-error @-1{{cannot create a single-element tuple with an element label}}{{20-24=}}
var c1 : (a : Int, b : Int, c : Int = 3, // expected-error{{default argument not permitted in a tuple type}}{{39-42=}}
d = 4) = (1, 2, 3, 4) // expected-error{{default argument not permitted in a tuple type}}{{15-18=}} expected-error{{use of undeclared type 'd'}}
}
func returnWithDefault() -> (a: Int, b: Int = 42) { // expected-error{{default argument not permitted in a tuple type}} {{45-49=}}
return 5 // expected-error{{cannot convert return expression of type 'Int' to return type '(a: Int, b: Int)'}}
}
func selectorStyle(_ i: Int = 1, withFloat f: Float = 2) { }
// Default arguments of constructors.
struct Ctor {
init (i : Int = 17, f : Float = 1.5) { }
}
Ctor() // expected-warning{{unused}}
Ctor(i: 12) // expected-warning{{unused}}
Ctor(f:12.5) // expected-warning{{unused}}
// Default arguments for nested constructors/functions.
struct Outer<T> {
struct Inner { // expected-error{{type 'Inner' nested in generic type}}
struct VeryInner {// expected-error{{type 'VeryInner' nested in generic type}}
init (i : Int = 17, f : Float = 1.5) { }
static func f(i: Int = 17, f: Float = 1.5) { }
func g(i: Int = 17, f: Float = 1.5) { }
}
}
}
Outer<Int>.Inner.VeryInner() // expected-warning{{unused}}
Outer<Int>.Inner.VeryInner(i: 12) // expected-warning{{unused}}
Outer<Int>.Inner.VeryInner(f:12.5) // expected-warning{{unused}}
Outer<Int>.Inner.VeryInner.f()
Outer<Int>.Inner.VeryInner.f(i: 12)
Outer<Int>.Inner.VeryInner.f(f:12.5)
var vi : Outer<Int>.Inner.VeryInner
vi.g()
vi.g(i: 12)
vi.g(f:12.5)
// <rdar://problem/14564964> crash on invalid
func foo(_ x: WonkaWibble = 17) { } // expected-error{{use of undeclared type 'WonkaWibble'}}
// Default arguments for initializers.
class SomeClass2 {
init(x: Int = 5) {}
}
class SomeDerivedClass2 : SomeClass2 {
init() {
super.init()
}
}
func shouldNotCrash(_ a : UndefinedType, bar b : Bool = true) { // expected-error {{use of undeclared type 'UndefinedType'}}
}
// <rdar://problem/20749423> Compiler crashed while building simple subclass
// code
class SomeClass3 {
init(x: Int = 5, y: Int = 5) {}
}
class SomeDerivedClass3 : SomeClass3 {}
_ = SomeDerivedClass3()
// Tuple types with default arguments are not materializable
func identity<T>(_ t: T) -> T { return t }
func defaultArgTuplesNotMaterializable(_ x: Int, y: Int = 0) {}
defaultArgTuplesNotMaterializable(identity(5))
// <rdar://problem/22333090> QoI: Propagate contextual information in a call to operands
defaultArgTuplesNotMaterializable(identity((5, y: 10)))
// expected-error@-1 {{cannot convert value of type '(Int, y: Int)' to expected argument type 'Int'}}
// rdar://problem/21799331
func foo<T>(_ x: T, y: Bool = true) {}
foo(true ? "foo" : "bar")
func foo2<T>(_ x: T, y: Bool = true) {}
extension Array {
func bar(_ x: Element -> Bool) -> Int? { return 0 }
}
foo2([].bar { $0 == "c" }!)
// rdar://problem/21643052
let a = ["1", "2"].map { Int($0) }
| d71f8512609f25097747e8721f691cc9 | 30.40708 | 156 | 0.641871 | false | false | false | false |
darren90/Gankoo_Swift | refs/heads/master | Gankoo/Gankoo/Classes/Me/MeViewController.swift | apache-2.0 | 1 | //
// MeViewController.swift
// Gankoo
//
// Created by Fengtf on 2017/2/7.
// Copyright © 2017年 ftf. All rights reserved.
//
import UIKit
class MeViewController: BaseViewController {
lazy var tableView:UITableView = UITableView(frame: self.view.bounds, style: .plain)
var dataArray:[DataModel] = [DataModel](){
didSet{
tableView.reloadData()
}
}
override func viewDidLoad() {
super.viewDidLoad()
automaticallyAdjustsScrollViewInsets = false
initTableView()
//最底部的空间，设置距离底部的间距（autolayout），然后再设置这两个属性，就可以自动计算高度
tableView.rowHeight = UITableViewAutomaticDimension
tableView.estimatedRowHeight = 100
tableView.separatorStyle = .none
}
override func viewDidAppear(_ animated: Bool) {
super.viewDidAppear(animated)
dataArray = RMDBTools.shareInstance.getAllDatas()
}
func initTableView(){
view.addSubview(tableView)
tableView.frame = CGRect(x: 0, y: 64, width: view.frame.size.width, height: view.frame.height - 64 - 49)
tableView.delegate = self
tableView.dataSource = self
tableView.backgroundColor = UIColor.white
let header = MJRefreshNormalHeader(refreshingTarget: self, refreshingAction: #selector(self.loadNew))
tableView.mj_header = header
tableView.mj_header.beginRefreshing()
// tableView.mj_footer = MJRefreshAutoFooter(refreshingTarget: self, refreshingAction: #selector(self.loadMore))
// tableView.isEditing
//多行编辑
// tableView.allowsMultipleSelectionDuringEditing = true
}
func loadNew() {
endReresh()
dataArray = RMDBTools.shareInstance.getAllDatas()
}
func endReresh(){
self.tableView.mj_header.endRefreshing()
// self.tableView.mj_footer.endRefreshing()
}
}
extension MeViewController : UITableViewDataSource,UITableViewDelegate{
func numberOfSections(in tableView: UITableView) -> Int {
return 1;
}
func tableView(_ tableView: UITableView, numberOfRowsInSection section: Int) -> Int {
noDataView.isHidden = !(dataArray.count == 0)
return dataArray.count
}
func tableView(_ tableView: UITableView, cellForRowAt indexPath: IndexPath) -> UITableViewCell {
let cell = DataListCell.cellWithTableView(tableView: tableView)
let model = dataArray[indexPath.row]
cell.model = model
return cell
}
func tableView(_ tableView: UITableView, didSelectRowAt indexPath: IndexPath) {
let model = dataArray[indexPath.row]
guard let urlStr = model.url else {
return
}
if urlStr.characters.count == 0 {
return
}
let url = URL(string: urlStr)
let vc = DataDetailController(url: url!, entersReaderIfAvailable: true)
present(vc, animated: true, completion: nil)
tableView.deselectRow(at: indexPath, animated: true)
}
func tableView(_ tableView: UITableView, commit editingStyle: UITableViewCellEditingStyle, forRowAt indexPath: IndexPath) {
if editingStyle == .delete {//删除操作
}
}
func tableView(_ tableView: UITableView, editActionsForRowAt indexPath: IndexPath) -> [UITableViewRowAction]? {
let deleAction = UITableViewRowAction(style: .destructive, title: "取消收藏", handler: { (action, indexPath) in
let model = self.dataArray[indexPath.row]
RMDBTools.shareInstance.deleData(model)
self.dataArray.remove(at: indexPath.row)
// tableView.deleteRows(at: [indexPath], with: .left)
// self.noDataView.isHidden = !(self.dataArray.count == 0)
})
return [deleAction]
}
}
| c817eb7a7d410101c16876d532c23dec | 25.626761 | 127 | 0.653531 | false | false | false | false |
IvanVorobei/TwitterLaunchAnimation | refs/heads/master | TwitterLaunchAnimation - project/TwitterLaucnhAnimation/sparrow/ui/views/views/SPShadowWithMaskView.swift | mit | 1 | // The MIT License (MIT)
// Copyright © 2017 Ivan Vorobei ([email protected])
//
// Permission is hereby granted, free of charge, to any person obtaining a copy
// of this software and associated documentation files (the "Software"), to deal
// in the Software without restriction, including without limitation the rights
// to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
// copies of the Software, and to permit persons to whom the Software is
// furnished to do so, subject to the following conditions:
//
// The above copyright notice and this permission notice shall be included in all
// copies or substantial portions of the Software.
//
// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
// IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
// FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
// AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
// LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
// OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
// SOFTWARE.
import UIKit
public class SPShadowWithMaskView: UIView {
public let contentView: UIView = UIView()
public init() {
super.init(frame: CGRect.zero)
commonInit()
}
override public init(frame: CGRect) {
super.init(frame: frame)
commonInit()
}
required public init?(coder aDecoder: NSCoder) {
super.init(coder: aDecoder)
commonInit()
}
private func commonInit() {
self.contentView.layer.masksToBounds = true
self.layer.masksToBounds = false
self.backgroundColor = UIColor.clear
self.addSubview(contentView)
self.updateShadow()
}
public override func layoutSubviews() {
super.layoutSubviews()
self.contentView.frame = self.bounds
self.layer.cornerRadius = self.contentView.layer.cornerRadius
}
public override func layoutSublayers(of layer: CALayer) {
super.layoutSublayers(of: layer)
self.updateShadow()
}
private var xTranslationFactor: CGFloat = 0
private var yTranslationFactor: CGFloat = 0
private var widthRelativeFactor: CGFloat = 0
private var heightRelativeFactor: CGFloat = 0
private var blurRadiusFactor: CGFloat = 0
private var shadowOpacity: CGFloat = 0
public override func setShadow(xTranslationFactor: CGFloat, yTranslationFactor: CGFloat, widthRelativeFactor: CGFloat, heightRelativeFactor: CGFloat, blurRadiusFactor: CGFloat, shadowOpacity: CGFloat, cornerRadiusFactor: CGFloat = 0) {
super.setShadow(xTranslationFactor: xTranslationFactor, yTranslationFactor: yTranslationFactor, widthRelativeFactor: widthRelativeFactor, heightRelativeFactor: heightRelativeFactor, blurRadiusFactor: blurRadiusFactor, shadowOpacity: shadowOpacity, cornerRadiusFactor: cornerRadiusFactor)
self.xTranslationFactor = xTranslationFactor
self.yTranslationFactor = yTranslationFactor
self.widthRelativeFactor = widthRelativeFactor
self.heightRelativeFactor = heightRelativeFactor
self.blurRadiusFactor = blurRadiusFactor
self.shadowOpacity = shadowOpacity
}
private func updateShadow() {
self.setShadow(
xTranslationFactor: self.xTranslationFactor,
yTranslationFactor: self.yTranslationFactor,
widthRelativeFactor: self.widthRelativeFactor,
heightRelativeFactor: self.heightRelativeFactor,
blurRadiusFactor: self.blurRadiusFactor,
shadowOpacity: self.shadowOpacity
)
}
}
public class SPShadowWithMaskControl: UIControl {
public let contentView: UIView = UIView()
public init() {
super.init(frame: CGRect.zero)
commonInit()
}
override public init(frame: CGRect) {
super.init(frame: frame)
commonInit()
}
required public init?(coder aDecoder: NSCoder) {
super.init(coder: aDecoder)
commonInit()
}
private func commonInit() {
self.contentView.layer.masksToBounds = true
self.layer.masksToBounds = false
self.backgroundColor = UIColor.clear
self.addSubview(contentView)
self.updateShadow()
}
public override func layoutSubviews() {
super.layoutSubviews()
self.contentView.frame = self.bounds
self.layer.cornerRadius = self.contentView.layer.cornerRadius
}
public override func layoutSublayers(of layer: CALayer) {
super.layoutSublayers(of: layer)
self.updateShadow()
}
private var xTranslationFactor: CGFloat = 0
private var yTranslationFactor: CGFloat = 0
private var widthRelativeFactor: CGFloat = 0
private var heightRelativeFactor: CGFloat = 0
private var blurRadiusFactor: CGFloat = 0
private var shadowOpacity: CGFloat = 0
public override func setShadow(xTranslationFactor: CGFloat, yTranslationFactor: CGFloat, widthRelativeFactor: CGFloat, heightRelativeFactor: CGFloat, blurRadiusFactor: CGFloat, shadowOpacity: CGFloat, cornerRadiusFactor: CGFloat = 0) {
super.setShadow(xTranslationFactor: xTranslationFactor, yTranslationFactor: yTranslationFactor, widthRelativeFactor: widthRelativeFactor, heightRelativeFactor: heightRelativeFactor, blurRadiusFactor: blurRadiusFactor, shadowOpacity: shadowOpacity, cornerRadiusFactor: cornerRadiusFactor)
self.xTranslationFactor = xTranslationFactor
self.yTranslationFactor = yTranslationFactor
self.widthRelativeFactor = widthRelativeFactor
self.heightRelativeFactor = heightRelativeFactor
self.blurRadiusFactor = blurRadiusFactor
self.shadowOpacity = shadowOpacity
}
private func updateShadow() {
self.setShadow(
xTranslationFactor: self.xTranslationFactor,
yTranslationFactor: self.yTranslationFactor,
widthRelativeFactor: self.widthRelativeFactor,
heightRelativeFactor: self.heightRelativeFactor,
blurRadiusFactor: self.blurRadiusFactor,
shadowOpacity: self.shadowOpacity
)
}
}
| 51f1ad6625880f769f3f0243a74bfbb6 | 39.410256 | 295 | 0.711136 | false | false | false | false |
shadanan/mado | refs/heads/master | Antlr4Runtime/Sources/Antlr4/misc/MurmurHash.swift | mit | 1 | /* Copyright (c) 2012-2017 The ANTLR Project. All rights reserved.
* Use of this file is governed by the BSD 3-clause license that
* can be found in the LICENSE.txt file in the project root.
*/
/**
*
* @author Sam Harwell
*/
public final class MurmurHash {
private static let DEFAULT_SEED: Int = 0
/**
* Initialize the hash using the default seed value.
*
* @return the intermediate hash value
*/
public static func initialize() -> Int {
return initialize(DEFAULT_SEED)
}
/**
* Initialize the hash using the specified {@code seed}.
*
* @param seed the seed
* @return the intermediate hash value
*/
public static func initialize(_ seed: Int) -> Int {
return seed
}
/**
* Update the intermediate hash value for the next input {@code value}.
*
* @param hash the intermediate hash value
* @param value the value to add to the current hash
* @return the updated intermediate hash value
*/
public static func update2(_ hashIn: Int, _ value: Int) -> Int {
let c1: Int32 = -862048943//0xCC9E2D51;
let c2: Int32 = 0x1B873593
let r1: Int32 = 15
let r2: Int32 = 13
let m: Int32 = 5
let n: Int32 = -430675100//0xE6546B64;
var k: Int32 = Int32(truncatingBitPattern: value)
k = Int32.multiplyWithOverflow(k, c1).0
// (k,_) = UInt32.multiplyWithOverflow(k, c1) ;//( k * c1);
//TODO: CHECKE >>>
k = (k << r1) | (k >>> (Int32(32) - r1)) //k = (k << r1) | (k >>> (32 - r1));
//k = UInt32 (truncatingBitPattern:Int64(Int64(k) * Int64(c2)));//( k * c2);
//(k,_) = UInt32.multiplyWithOverflow(k, c2)
k = Int32.multiplyWithOverflow(k, c2).0
var hash = Int32(hashIn)
hash = hash ^ k
hash = (hash << r2) | (hash >>> (Int32(32) - r2))//hash = (hash << r2) | (hash >>> (32 - r2));
(hash, _) = Int32.multiplyWithOverflow(hash, m)
(hash, _) = Int32.addWithOverflow(hash, n)
//hash = hash * m + n;
// print("murmur update2 : \(hash)")
return Int(hash)
}
/**
* Update the intermediate hash value for the next input {@code value}.
*
* @param hash the intermediate hash value
* @param value the value to add to the current hash
* @return the updated intermediate hash value
*/
public static func update<T:Hashable>(_ hash: Int, _ value: T?) -> Int {
return update2(hash, value != nil ? value!.hashValue : 0)
// return update2(hash, value);
}
/**
* Apply the final computation steps to the intermediate value {@code hash}
* to form the final result of the MurmurHash 3 hash function.
*
* @param hash the intermediate hash value
* @param numberOfWords the number of integer values added to the hash
* @return the final hash result
*/
public static func finish(_ hashin: Int, _ numberOfWordsIn: Int) -> Int {
var hash = Int32(hashin)
let numberOfWords = Int32(numberOfWordsIn)
hash = hash ^ Int32.multiplyWithOverflow(numberOfWords, Int32(4)).0 //(numberOfWords * UInt32(4));
hash = hash ^ (hash >>> Int32(16)) //hash = hash ^ (hash >>> 16);
(hash, _) = Int32.multiplyWithOverflow(hash, Int32(-2048144789))//hash * UInt32(0x85EBCA6B);
hash = hash ^ (hash >>> Int32(13))//hash = hash ^ (hash >>> 13);
//hash = UInt32(truncatingBitPattern: UInt64(hash) * UInt64(0xC2B2AE35)) ;
(hash, _) = Int32.multiplyWithOverflow(hash, Int32(-1028477387))
hash = hash ^ (hash >>> Int32(16))// hash = hash ^ (hash >>> 16);
//print("murmur finish : \(hash)")
return Int(hash)
}
/**
* Utility function to compute the hash code of an array using the
* MurmurHash algorithm.
*
* @param <T> the array element type
* @param data the array data
* @param seed the seed for the MurmurHash algorithm
* @return the hash code of the data
*/
public static func hashCode<T:Hashable>(_ data: [T], _ seed: Int) -> Int {
var hash: Int = initialize(seed)
for value: T in data {
//var hashValue = value != nil ? value.hashValue : 0
hash = update(hash, value.hashValue)
}
hash = finish(hash, data.count)
return hash
}
private init() {
}
}
| bc6e4658719c983fb0abb7d843cfa71b | 34.095238 | 107 | 0.580733 | false | false | false | false |
Draveness/DKChainableAnimationKit | refs/heads/master | Carthage/Checkouts/DKChainableAnimationKit/DKChainableAnimationKit/Classes/DKChainableAnimationKit+Extra.swift | apache-2.0 | 3 | //
// DKChainableAnimationKit+Extra.swift
// DKChainableAnimationKit
//
// Created by Draveness on 15/6/14.
// Copyright (c) 2015年 Draveness. All rights reserved.
//
import Foundation
public extension DKChainableAnimationKit {
public func makeOpacity(_ opacity: CGFloat) -> DKChainableAnimationKit {
self.addAnimationCalculationAction { (view: UIView) -> Void in
let opacityAnimation = self.basicAnimationForKeyPath("opacity")
opacityAnimation.fromValue = view.alpha as AnyObject!
opacityAnimation.toValue = opacity as AnyObject!
self.addAnimationFromCalculationBlock(opacityAnimation)
}
self.addAnimationCompletionAction { (view: UIView) -> Void in
view.alpha = opacity
}
return self
}
public func makeAlpha(_ alpha: CGFloat) -> DKChainableAnimationKit {
return makeOpacity(alpha)
}
public func makeBackground(_ color: UIColor) -> DKChainableAnimationKit {
self.addAnimationCalculationAction { (view: UIView) -> Void in
let backgroundColorAnimation = self.basicAnimationForKeyPath("backgroundColor")
backgroundColorAnimation.fromValue = view.backgroundColor
backgroundColorAnimation.toValue = color
self.addAnimationFromCalculationBlock(backgroundColorAnimation)
}
self.addAnimationCompletionAction { (view: UIView) -> Void in
view.backgroundColor = color
}
return self
}
public func makeBorderColor(_ color: UIColor) -> DKChainableAnimationKit {
self.addAnimationCalculationAction { (view: UIView) -> Void in
let borderColorAnimation = self.basicAnimationForKeyPath("borderColor")
borderColorAnimation.fromValue = UIColor(cgColor: view.layer.borderColor!)
borderColorAnimation.toValue = color
self.addAnimationFromCalculationBlock(borderColorAnimation)
}
self.addAnimationCompletionAction { (view: UIView) -> Void in
view.layer.borderColor = color.cgColor
}
return self
}
public func makeBorderWidth(_ width: CGFloat) -> DKChainableAnimationKit {
let width = max(0, width)
self.addAnimationCalculationAction { (view: UIView) -> Void in
let borderColorAnimation = self.basicAnimationForKeyPath("borderWidth")
borderColorAnimation.fromValue = view.layer.borderWidth as AnyObject!
borderColorAnimation.toValue = width as AnyObject!
self.addAnimationFromCalculationBlock(borderColorAnimation)
}
self.addAnimationCompletionAction { (view: UIView) -> Void in
view.layer.borderWidth = width
}
return self
}
public func makeCornerRadius(_ cornerRadius: CGFloat) -> DKChainableAnimationKit {
let cornerRadius = max(0, cornerRadius)
self.addAnimationCalculationAction { (view: UIView) -> Void in
let cornerRadiusAnimation = self.basicAnimationForKeyPath("cornerRadius")
cornerRadiusAnimation.fromValue = view.layer.cornerRadius as AnyObject!
cornerRadiusAnimation.toValue = cornerRadius as AnyObject!
self.addAnimationFromCalculationBlock(cornerRadiusAnimation)
}
self.addAnimationCompletionAction { (view: UIView) -> Void in
view.layer.cornerRadius = cornerRadius
}
return self
}
}
| f270c56f2348dce5d95659754077234c | 37.932584 | 91 | 0.677633 | false | false | false | false |
SASAbus/SASAbus-ios | refs/heads/master | SASAbus/Data/Model/LineCourse.swift | gpl-3.0 | 1 | import Foundation
class LineCourse {
let id: Int
let busStop: BBusStop
let time: String
let active: Bool
let pin: Bool
let bus: Bool
var lineText: NSAttributedString? = nil
init(id: Int, busStop: BBusStop, time: String, active: Bool, pin: Bool, bus: Bool) {
self.id = id
self.busStop = busStop
self.time = time
self.active = active
self.pin = pin
self.bus = bus
}
}
| 94d3b773c8ca0c4d2582f26d22b8c64b | 18 | 88 | 0.585526 | false | false | false | false |
Ben21hao/edx-app-ios-enterprise-new | refs/heads/master | Source/BorderStyle.swift | apache-2.0 | 4 | //
// BorderStyle.swift
// edX
//
// Created by Akiva Leffert on 6/4/15.
// Copyright (c) 2015 edX. All rights reserved.
//
import Foundation
public class BorderStyle {
enum Width {
case Hairline
case Size(CGFloat)
var value : CGFloat {
switch self {
case Hairline: return OEXStyles.dividerSize()
case let Size(s): return s
}
}
}
enum Radius {
case Circle
case Size(CGFloat)
func value(view: UIView) -> CGFloat {
switch self {
case Circle: return view.frame.size.height / 2.0
case let Size(s): return s
}
}
}
static let defaultCornerRadius = OEXStyles.sharedStyles().boxCornerRadius()
let cornerRadius : Radius
let width : Width
let color : UIColor?
init(cornerRadius : Radius = .Size(BorderStyle.defaultCornerRadius), width : Width = .Size(0), color : UIColor? = nil) {
self.cornerRadius = cornerRadius
self.width = width
self.color = color
}
private func applyToView(view : UIView) {
let radius = cornerRadius.value(view)
view.layer.cornerRadius = radius
view.layer.borderWidth = width.value
view.layer.borderColor = color?.CGColor
if radius != 0 {
view.clipsToBounds = true
}
}
class func clearStyle() -> BorderStyle {
return BorderStyle()
}
}
extension UIView {
func applyBorderStyle(style : BorderStyle) {
style.applyToView(self)
}
}
| 9bc05d8b6c588eb1ee5a863bbf2a5a8b | 23.149254 | 124 | 0.566749 | false | false | false | false |
JerrySir/YCOA | refs/heads/master | YCOA/Expand/Category/UIDatePicker.swift | mit | 1 | //
// UIDatePicker.swift
// YCOA
//
// Created by Jerry on 2016/12/19.
// Copyright © 2016年 com.baochunsteel. All rights reserved.
//
import Foundation
extension UIDatePicker {
/// 弹出选择日期的View
///
/// - Parameters:
/// - minDate: 最小可选日期
/// - maxDate: 最大可选日期
/// - onView: 承载的View
/// - datePickerMode: datePickerMode
/// - tap: 选择后的回调(Date)
class func showDidSelectView(minDate: Date?, maxDate: Date?, onView: UIView, datePickerMode: UIDatePickerMode, tap:@escaping (Date)-> Void) {
var date = Date()
let superView_ = UIView(frame: CGRect(x: 0, y: 0, width: onView.bounds.width, height: onView.bounds.height / 3 * 2))
superView_.alpha = 0.0
onView.addSubview(superView_)
superView_.backgroundColor = UIColor.black
let datePicker = UIDatePicker(frame: CGRect(x: 0, y: onView.bounds.height / 3 * 2, width: onView.bounds.width, height: onView.bounds.height / 3))
datePicker.minimumDate = minDate
datePicker.maximumDate = maxDate
datePicker.datePickerMode = .dateAndTime
datePicker.date = Date()
datePicker.alpha = 0.0
datePicker.backgroundColor = UIColor.white
onView.addSubview(datePicker)
UIView.animate(withDuration: 0.5) {
superView_.alpha = 0.5
datePicker.alpha = 1.0
}
datePicker.rac_signal(for: .valueChanged).subscribeNext { (sender) in
date = (sender as! UIDatePicker).date
}
superView_.isUserInteractionEnabled = true
let tapGestureRecognizer = UITapGestureRecognizer { (sender) in
tap(date)
UIView.animate(withDuration: 0.5, animations: {
superView_.alpha = 0.0
datePicker.alpha = 0.0
}, completion: { (isCompletion) in
superView_.removeFromSuperview()
datePicker.removeFromSuperview()
})
}
superView_.addGestureRecognizer(tapGestureRecognizer)
}
}
| 3fdd58efe1c0fa22a49b9ff4050d0358 | 34.169492 | 153 | 0.598554 | false | false | false | false |
Virpik/T | refs/heads/master | src/UI/TableView/TableViewModel/TableViewModel.swift | mit | 1 | //
// TImage.swift
// TDemo
//
// Created by Virpik on 26/10/2017.
// Copyright © 2017 Virpik. All rights reserved.
//
import Foundation
import UIKit
open class TableViewModel: NSObject, UITableViewDelegate, UITableViewDataSource {
public let tableView: UITableView
public var sections: [[AnyRowModel]] = []
// public var moveHandlers: MoveHandlers? {
// set(handlers) {
// self._managerMoveCells.handlers = handlers
// }
//
// get {
// return self._managerMoveCells.handlers
// }
// }
//
public var handlers: Handlers = Handlers()
public var cellMoviesPressDuration: TimeInterval {
get {
return self.managerMoveCells.cellMoviesPressDuration
}
set(value) {
self.managerMoveCells.cellMoviesPressDuration = value
}
}
public lazy var managerMoveCells: ManagerMoveCells = {
let ds = TableViewModel.ManagerMoveCells.DataSourse { (indexPath) -> AnyRowModel? in
return self.sections[indexPath.section][indexPath.row]
}
return ManagerMoveCells(tableView: self.tableView, dataSourse: ds)
}()
private var _cashHeightRows: [IndexPath: CGSize] = [:]
public init (tableView: UITableView, handlers: Handlers? = nil) {
self.tableView = tableView
if let handlers = handlers {
self.handlers = handlers
}
super.init()
self.tableView.delegate = self
self.tableView.dataSource = self
var mHandlers = MoveHandlers()
mHandlers.handlerBeginMove = { context in
//
self.handlers.moveHandlers?.handlerBeginMove?(context)
}
mHandlers.handlerMove = { atContext, toContext in
//
self.handlers.moveHandlers?.handlerMove?(atContext, toContext)
}
mHandlers.handlerDidMove = { atContex, toContext in
let atIndexPath = atContex.indexPath
let toIndexPath = toContext.indexPath
let item = self.sections[atIndexPath.section][atIndexPath.row]
self.sections[atIndexPath.section].remove(at: atIndexPath.row)
self.sections[toIndexPath.section].insert(item, at: toIndexPath.row)
self.handlers.moveHandlers?.handlerDidMove?(atContex, toContext)
}
mHandlers.handlerEndMove = { atContext, toContext in
//
self.handlers.moveHandlers?.handlerEndMove?(atContext, toContext)
}
self.managerMoveCells.handlers = mHandlers
}
public func set(sections: [[AnyRowModel]]){
self.sections = sections
sections.forEach {
$0.forEach({ (rowModel) in
if rowModel.rowType.self == UITableViewCell.self {
return
}
self.tableView.register(type: rowModel.rowType.self, isNib: rowModel.isNib)
})
}
self.tableView.reloadData()
}
public func reload(rows: [Row]) {
rows.forEach { (row) in
self.sections[row.indexPath.section][row.indexPath.row] = row.rowModel
if let cell = self.tableView.cellForRow(at: row.indexPath) {
row.rowModel.build(cell: cell, indexPath: row.indexPath)
}
}
}
public func remove(sections: [[AnyRowModel]], indexPaths: [IndexPath], animation: UITableView.RowAnimation = .bottom) {
self.tableView.beginUpdates()
self.sections = sections
self.tableView.deleteRows(at: indexPaths, with: animation)
self.tableView.endUpdates()
}
public func update(sections: [[AnyRowModel]], indexPaths: [IndexPath], animation: UITableView.RowAnimation = .automatic) {
self.tableView.beginUpdates()
self.sections = sections
self.tableView.reloadRows(at: indexPaths, with: animation)
self.tableView.endUpdates()
}
public func insert(sections: [[AnyRowModel]], indexPaths: [IndexPath], animation: UITableView.RowAnimation = .bottom) {
self.tableView.beginUpdates()
self.sections = sections
self.tableView.insertRows(at: indexPaths, with: animation)
self.tableView.endUpdates()
}
public func insert(rows: [Row]) {
self.tableView.beginUpdates()
rows.forEach { row in
self.sections[row.indexPath.section].insert(row.rowModel, at: row.indexPath.row)
self.tableView.insertRows(at: [row.indexPath], with: row.animation)
}
self.tableView.endUpdates()
}
public func replace(rows: [Row]) {
self.tableView.beginUpdates()
rows.forEach { row in
self.sections[row.indexPath.section][row.indexPath.row] = row.rowModel
self.tableView.reloadRows(at: [row.indexPath], with: row.animation)
}
self.tableView.endUpdates()
}
public func remove(rows: [(IndexPath, UITableView.RowAnimation)]) {
self.tableView.beginUpdates()
rows.forEach { row in
self.sections[row.0.section].remove(at: row.0.row)
self.tableView.deleteRows(at: [row.0], with: row.1)
}
self.tableView.endUpdates()
}
// MARK: - scroll view
open func scrollViewDidScroll(_ scrollView: UIScrollView) {
// tLog(scrollView.contentOffset)
self.handlers.handlerDidScroll?(scrollView)
}
open func scrollViewDidEndScrollingAnimation(_ scrollView: UIScrollView) {
// tLog(scrollView.contentOffset)
}
// MARK: - Table view delegate && data sourse
open func numberOfSections(in tableView: UITableView) -> Int {
return self.sections.count
}
open func tableView(_ tableView: UITableView, heightForRowAt indexPath: IndexPath) -> CGFloat {
return self.sections[indexPath.section][indexPath.row].rowHeight ?? tableView.rowHeight
}
open func tableView(_ tableView: UITableView, estimatedHeightForRowAt indexPath: IndexPath) -> CGFloat {
return self._cashHeightRows[indexPath]?.height ?? tableView.estimatedRowHeight
}
open func tableView(_ tableView: UITableView, willDisplay cell: UITableViewCell, forRowAt indexPath: IndexPath) {
self._cashHeightRows[indexPath] = cell.bounds.size
}
open func tableView(_ tableView: UITableView, numberOfRowsInSection section: Int) -> Int {
return self.sections[section].count
}
open func tableView(_ tableView: UITableView, cellForRowAt indexPath: IndexPath) -> UITableViewCell {
let model = self.sections[indexPath.section][indexPath.row]
guard let cell = self.tableView.cell(type: model.rowType) else {
return UITableViewCell()
}
model.build(cell: cell, indexPath: indexPath)
return cell
}
open func tableView(_ tableView: UITableView, didSelectRowAt indexPath: IndexPath) {
let model = self.sections[indexPath.section][indexPath.row]
guard let cell = self.tableView.cellForRow(at: indexPath) else {
return
}
model.didSelect(cell: cell, indexPath: indexPath)
}
}
| 5fabe4965c6814f1a020da954ce5dfbf | 30.021008 | 126 | 0.616687 | false | false | false | false |
kakajika/Brief | refs/heads/master | Brief-OSX/Brief-OSX.swift | apache-2.0 | 2 | //
// Brief-OSX.swift
//
// Created by kakajika on 2015/08/20.
// Copyright (c) 2015 INFOCITY, Inc. All rights reserved.
//
import Cocoa
extension NSView {
// Frame Origin
public var x: CGFloat {
get { return self.frame.origin.x }
set(x) { self.frame.origin.x = x }
}
public var y: CGFloat {
get { return self.frame.origin.y }
set(y) { self.frame.origin.y = y }
}
// Frame Size
public var width: CGFloat {
get { return self.frame.width }
set(width) { self.frame.size.width = width }
}
public var height: CGFloat {
get { return self.frame.height }
set(height) { self.frame.size.height = height }
}
// Frame Borders
public var left: CGFloat {
get { return self.frame.minX }
set(left) { self.frame.origin.x = left - min(width, 0.0) }
}
public var top: CGFloat {
get { return self.frame.minY }
set(top) { self.frame.origin.y = top - min(height, 0.0) }
}
public var right: CGFloat {
get { return self.frame.maxX }
set(right) { self.frame.origin.x = right - max(width, 0.0) }
}
public var bottom: CGFloat {
get { return self.frame.maxY }
set(bottom) { self.frame.origin.y = bottom - max(height, 0.0) }
}
// Bounds
public var boundsWidth: CGFloat {
get { return self.bounds.width }
set(boundsWidth) { self.bounds.size.width = boundsWidth }
}
public var boundsHeight: CGFloat {
get { return self.bounds.height }
set(boundsHeight) { self.bounds.size.height = boundsHeight }
}
// Bounds Borders
public var boundsLeft: CGFloat {
get { return self.bounds.minX }
set(boundsLeft) { self.bounds.origin.x = boundsLeft - min(boundsWidth, 0.0) }
}
public var boundsTop: CGFloat {
get { return self.bounds.minY }
set(boundsTop) { self.bounds.origin.y = boundsTop - min(boundsHeight, 0.0) }
}
public var boundsRight: CGFloat {
get { return self.bounds.maxX }
set(boundsRight) { self.bounds.origin.x = boundsRight - max(boundsWidth, 0.0) }
}
public var boundsBottom: CGFloat {
get { return self.bounds.maxY }
set(boundsBottom) { self.bounds.origin.y = boundsBottom - max(boundsHeight, 0.0) }
}
}
extension CALayer {
// Frame Origin
public var x: CGFloat {
get { return self.frame.origin.x }
set(x) { self.frame.origin.x = x }
}
public var y: CGFloat {
get { return self.frame.origin.y }
set(y) { self.frame.origin.y = y }
}
// Frame Size
public var width: CGFloat {
get { return self.frame.width }
set(width) { self.frame.size.width = width }
}
public var height: CGFloat {
get { return self.frame.height }
set(height) { self.frame.size.height = height }
}
// Frame Borders
public var left: CGFloat {
get { return self.frame.minX }
set(left) { self.frame.origin.x = left - min(width, 0.0) }
}
public var top: CGFloat {
get { return self.frame.minY }
set(top) { self.frame.origin.y = top - min(height, 0.0) }
}
public var right: CGFloat {
get { return self.frame.maxX }
set(right) { self.frame.origin.x = right - max(width, 0.0) }
}
public var bottom: CGFloat {
get { return self.frame.maxY }
set(bottom) { self.frame.origin.y = bottom - max(height, 0.0) }
}
// Bounds
public var boundsWidth: CGFloat {
get { return self.bounds.width }
set(boundsWidth) { self.bounds.size.width = boundsWidth }
}
public var boundsHeight: CGFloat {
get { return self.bounds.height }
set(boundsHeight) { self.bounds.size.height = boundsHeight }
}
// Bounds Borders
public var boundsLeft: CGFloat {
get { return self.bounds.minX }
set(boundsLeft) { self.bounds.origin.x = boundsLeft - min(boundsWidth, 0.0) }
}
public var boundsTop: CGFloat {
get { return self.bounds.minY }
set(boundsTop) { self.bounds.origin.y = boundsTop - min(boundsHeight, 0.0) }
}
public var boundsRight: CGFloat {
get { return self.bounds.maxX }
set(boundsRight) { self.bounds.origin.x = boundsRight - max(boundsWidth, 0.0) }
}
public var boundsBottom: CGFloat {
get { return self.bounds.maxY }
set(boundsBottom) { self.bounds.origin.y = boundsBottom - max(boundsHeight, 0.0) }
}
} | c665261e913a30f2898f6656a945945f | 30.027027 | 90 | 0.584186 | false | false | false | false |
iOSDevLog/iOSDevLog | refs/heads/master | 133. 16-functional-apis/FunctionalCoreImage/CoreImage.swift | mit | 1 | //
// CoreImage.swift
// FunctionalCoreImage
//
// Created by Florian on 10/09/14.
// Copyright (c) 2014 objc.io. All rights reserved.
//
import UIKit
typealias Filter = CIImage -> CIImage
typealias Parameters = Dictionary<String, AnyObject>
func blur(radius: Double) -> Filter {
return { image in
let parameters : Parameters = [kCIInputRadiusKey: radius, kCIInputImageKey: image]
let filter = CIFilter(name:"CIGaussianBlur", withInputParameters:parameters)
return filter!.outputImage!
}
}
func colorGenerator(color: UIColor) -> Filter {
return { _ in
let filter = CIFilter(name:"CIConstantColorGenerator", withInputParameters: [kCIInputColorKey: CIColor(color: color)])
return filter!.outputImage!
}
}
func compositeSourceOver(overlay: CIImage) -> Filter {
return { image in
let parameters : Parameters = [
kCIInputBackgroundImageKey: image,
kCIInputImageKey: overlay
]
let filter = CIFilter(name:"CISourceOverCompositing", withInputParameters: parameters)
return filter!.outputImage!.imageByCroppingToRect(image.extent)
}
}
func colorOverlay(color: UIColor) -> Filter {
return { image in
let overlay = colorGenerator(color)(image)
return compositeSourceOver(overlay)(image)
}
}
infix operator >|> { associativity left }
func >|> (filter1: Filter, filter2: Filter) -> Filter {
return { img in filter2(filter1(img)) }
}
| b50e5be5ac815915db4d95c2380e6431 | 26.962264 | 126 | 0.680162 | false | false | false | false |
IngmarStein/swift | refs/heads/master | test/IDE/complete_from_reexport.swift | apache-2.0 | 17 | // RUN: rm -rf %t
// RUN: mkdir -p %t
//
// RUN: %target-swift-frontend -emit-module -module-name FooSwiftModule %S/Inputs/foo_swift_module.swift -o %t
// RUN: %target-swift-frontend -emit-module -module-name FooSwiftModuleOverlay %S/Inputs/foo_swift_module_overlay.swift -I %t -o %t
//
// RUN: %target-swift-ide-test -code-completion -source-filename %s -code-completion-token=TOP_LEVEL_1 -I %t > %t.txt
// RUN: %FileCheck %s -check-prefix=TOP_LEVEL_1 < %t.txt
// RUN: %FileCheck %s -check-prefix=NO_DUPLICATES < %t.txt
// TOP_LEVEL_1: Begin completions
// TOP_LEVEL_1-DAG: Decl[FreeFunction]/OtherModule[FooSwiftModuleOverlay]: overlayedFoo()[#Void#]{{; name=.+$}}
// TOP_LEVEL_1-DAG: Decl[FreeFunction]/OtherModule[FooSwiftModuleOverlay]: onlyInFooOverlay()[#Void#]{{; name=.+$}}
// TOP_LEVEL_1: End completions
// FIXME: there should be only one instance of this completion result.
// NO_DUPLICATES: overlayedFoo()[#Void#]{{; name=.+$}}
// NO_DUPLICATES: overlayedFoo()[#Void#]{{; name=.+$}}
// NO_DUPLICATES-NOT: overlayedFoo()[#Void#]{{; name=.+$}}
import FooSwiftModuleOverlay
#^TOP_LEVEL_1^#
| 2159de1250ddb9ffdf50c3aa9fdac14d | 47.347826 | 131 | 0.68795 | false | false | false | false |
v2panda/DaysofSwift | refs/heads/master | swift2.3/My-ImagePickerSheetController/My-ImagePickerSheetController/ImagePickerSheet/AnimationController.swift | mit | 1 | //
// AnimationController.swift
// ImagePickerSheet
//
// Created by Laurin Brandner on 25/05/15.
// Copyright (c) 2015 Laurin Brandner. All rights reserved.
//
import UIKit
class AnimationController: NSObject, UIViewControllerAnimatedTransitioning {
let imagePickerSheetController: ImagePickerSheetController
let presenting: Bool
// MARK: - Initialization
init(imagePickerSheetController: ImagePickerSheetController, presenting: Bool) {
self.imagePickerSheetController = imagePickerSheetController
self.presenting = presenting
}
// MARK: - UIViewControllerAnimatedTransitioning
func transitionDuration(transitionContext: UIViewControllerContextTransitioning?) -> NSTimeInterval {
return 0.3
}
func animateTransition(transitionContext: UIViewControllerContextTransitioning) {
if presenting {
animatePresentation(transitionContext)
}
else {
animateDismissal(transitionContext)
}
}
// MARK: - Animation
private func animatePresentation(context: UIViewControllerContextTransitioning) {
let containerView = context.containerView()!
containerView.addSubview(imagePickerSheetController.view)
let tableViewOriginY = imagePickerSheetController.tableView.frame.origin.y
imagePickerSheetController.tableView.frame.origin.y = containerView.bounds.maxY
imagePickerSheetController.backgroundView.alpha = 0
UIView.animateWithDuration(transitionDuration(context), animations: {
self.imagePickerSheetController.tableView.frame.origin.y = tableViewOriginY
self.imagePickerSheetController.backgroundView.alpha = 1
}, completion: { _ in
context.completeTransition(true)
})
}
private func animateDismissal(context: UIViewControllerContextTransitioning) {
let containerView = context.containerView()!
UIView.animateWithDuration(transitionDuration(context), animations: {
self.imagePickerSheetController.tableView.frame.origin.y = containerView.bounds.maxY
self.imagePickerSheetController.backgroundView.alpha = 0
}, completion: { _ in
self.imagePickerSheetController.view.removeFromSuperview()
context.completeTransition(true)
})
}
}
| 34887a38c893cab6bbea34b5b408193d | 34.529412 | 105 | 0.700331 | false | false | false | false |
iOSTestApps/firefox-ios | refs/heads/master | Client/Frontend/Home/ReaderPanel.swift | mpl-2.0 | 1 | /* This Source Code Form is subject to the terms of the Mozilla Public
* License, v. 2.0. If a copy of the MPL was not distributed with this
* file, You can obtain one at http://mozilla.org/MPL/2.0/. */
import UIKit
import SnapKit
import Storage
import ReadingList
import Shared
private struct ReadingListTableViewCellUX {
static let RowHeight: CGFloat = 86
static let ActiveTextColor = UIColor(red: 0.2, green: 0.2, blue: 0.2, alpha: 1.0)
static let DimmedTextColor = UIColor(red: 0.2, green: 0.2, blue: 0.2, alpha: 0.44)
static let ReadIndicatorWidth: CGFloat = 12 // image width
static let ReadIndicatorHeight: CGFloat = 12 // image height
static let ReadIndicatorTopOffset: CGFloat = 36.75 // half of the cell - half of the height of the asset
static let ReadIndicatorLeftOffset: CGFloat = 18
static let ReadAccessibilitySpeechPitch: Float = 0.7 // 1.0 default, 0.0 lowest, 2.0 highest
static let TitleLabelFont = UIFont.systemFontOfSize(15, weight: UIFontWeightMedium)
static let TitleLabelTopOffset: CGFloat = 14 - 4
static let TitleLabelLeftOffset: CGFloat = 16 + 16 + 16
static let TitleLabelRightOffset: CGFloat = -40
static let HostnameLabelFont = UIFont.systemFontOfSize(14, weight: UIFontWeightLight)
static let HostnameLabelBottomOffset: CGFloat = 11
static let DeleteButtonBackgroundColor = UIColor(rgb: 0xef4035)
static let DeleteButtonTitleFont = UIFont.systemFontOfSize(15, weight: UIFontWeightLight)
static let DeleteButtonTitleColor = UIColor.whiteColor()
static let DeleteButtonTitleEdgeInsets = UIEdgeInsets(top: 4, left: 4, bottom: 4, right: 4)
static let MarkAsReadButtonBackgroundColor = UIColor(rgb: 0x2193d1)
static let MarkAsReadButtonTitleFont = UIFont.systemFontOfSize(15, weight: UIFontWeightLight)
static let MarkAsReadButtonTitleColor = UIColor.whiteColor()
static let MarkAsReadButtonTitleEdgeInsets = UIEdgeInsets(top: 4, left: 4, bottom: 4, right: 4)
// Localizable strings
static let DeleteButtonTitleText = NSLocalizedString("Remove", comment: "Title for the button that removes a reading list item")
static let MarkAsReadButtonTitleText = NSLocalizedString("Mark as Read", comment: "Title for the button that marks a reading list item as read")
static let MarkAsUnreadButtonTitleText = NSLocalizedString("Mark as Unread", comment: "Title for the button that marks a reading list item as unread")
}
private struct ReadingListPanelUX {
// Welcome Screen
static let WelcomeScreenTopPadding: CGFloat = 16
static let WelcomeScreenPadding: CGFloat = 10
static let WelcomeScreenHeaderFont = UIFont.boldSystemFontOfSize(14)
static let WelcomeScreenHeaderTextColor = UIColor.darkGrayColor()
static let WelcomeScreenItemFont = UIFont.systemFontOfSize(14, weight: UIFontWeightLight)
static let WelcomeScreenItemTextColor = UIColor.lightGrayColor()
static let WelcomeScreenItemWidth = 220
static let WelcomeScreenItemOffset = -20
static let WelcomeScreenCircleWidth = 40
static let WelcomeScreenCircleOffset = 20
static let WelcomeScreenCircleSpacer = 10
}
class ReadingListTableViewCell: SWTableViewCell {
var title: String = "Example" {
didSet {
titleLabel.text = title
updateAccessibilityLabel()
}
}
var url: NSURL = NSURL(string: "http://www.example.com")! {
didSet {
hostnameLabel.text = simplifiedHostnameFromURL(url)
updateAccessibilityLabel()
}
}
var unread: Bool = true {
didSet {
readStatusImageView.image = UIImage(named: unread ? "MarkAsRead" : "MarkAsUnread")
titleLabel.textColor = unread ? ReadingListTableViewCellUX.ActiveTextColor : ReadingListTableViewCellUX.DimmedTextColor
hostnameLabel.textColor = unread ? ReadingListTableViewCellUX.ActiveTextColor : ReadingListTableViewCellUX.DimmedTextColor
markAsReadButton.setTitle(unread ? ReadingListTableViewCellUX.MarkAsReadButtonTitleText : ReadingListTableViewCellUX.MarkAsUnreadButtonTitleText, forState: UIControlState.Normal)
markAsReadAction.name = markAsReadButton.titleLabel!.text
updateAccessibilityLabel()
}
}
private let deleteAction: UIAccessibilityCustomAction
private let markAsReadAction: UIAccessibilityCustomAction
let readStatusImageView: UIImageView!
let titleLabel: UILabel!
let hostnameLabel: UILabel!
let deleteButton: UIButton!
let markAsReadButton: UIButton!
override init(style: UITableViewCellStyle, reuseIdentifier: String?) {
readStatusImageView = UIImageView()
titleLabel = UILabel()
hostnameLabel = UILabel()
deleteButton = UIButton()
markAsReadButton = UIButton()
deleteAction = UIAccessibilityCustomAction()
markAsReadAction = UIAccessibilityCustomAction()
super.init(style: style, reuseIdentifier: reuseIdentifier)
backgroundColor = UIColor.clearColor()
separatorInset = UIEdgeInsets(top: 0, left: 48, bottom: 0, right: 0)
layoutMargins = UIEdgeInsetsZero
preservesSuperviewLayoutMargins = false
contentView.addSubview(readStatusImageView)
readStatusImageView.contentMode = UIViewContentMode.ScaleAspectFit
readStatusImageView.snp_makeConstraints { (make) -> () in
make.width.equalTo(ReadingListTableViewCellUX.ReadIndicatorWidth)
make.height.equalTo(ReadingListTableViewCellUX.ReadIndicatorHeight)
make.top.equalTo(self.contentView).offset(ReadingListTableViewCellUX.ReadIndicatorTopOffset)
make.left.equalTo(self.contentView).offset(ReadingListTableViewCellUX.ReadIndicatorLeftOffset)
}
contentView.addSubview(titleLabel)
titleLabel.textColor = ReadingListTableViewCellUX.ActiveTextColor
titleLabel.numberOfLines = 2
titleLabel.font = ReadingListTableViewCellUX.TitleLabelFont
titleLabel.snp_makeConstraints { (make) -> () in
make.top.equalTo(self.contentView).offset(ReadingListTableViewCellUX.TitleLabelTopOffset)
make.left.equalTo(self.contentView).offset(ReadingListTableViewCellUX.TitleLabelLeftOffset)
make.right.equalTo(self.contentView).offset(ReadingListTableViewCellUX.TitleLabelRightOffset) // TODO Not clear from ux spec
}
contentView.addSubview(hostnameLabel)
hostnameLabel.textColor = ReadingListTableViewCellUX.ActiveTextColor
hostnameLabel.numberOfLines = 1
hostnameLabel.font = ReadingListTableViewCellUX.HostnameLabelFont
hostnameLabel.snp_makeConstraints { (make) -> () in
make.bottom.equalTo(self.contentView).offset(-ReadingListTableViewCellUX.HostnameLabelBottomOffset)
make.left.right.equalTo(self.titleLabel)
}
deleteButton.backgroundColor = ReadingListTableViewCellUX.DeleteButtonBackgroundColor
deleteButton.titleLabel?.font = ReadingListTableViewCellUX.DeleteButtonTitleFont
deleteButton.titleLabel?.textColor = ReadingListTableViewCellUX.DeleteButtonTitleColor
deleteButton.titleLabel?.lineBreakMode = NSLineBreakMode.ByWordWrapping
deleteButton.titleLabel?.textAlignment = NSTextAlignment.Center
deleteButton.setTitle(ReadingListTableViewCellUX.DeleteButtonTitleText, forState: UIControlState.Normal)
deleteButton.setTitleColor(UIColor.whiteColor(), forState: UIControlState.Normal)
deleteButton.titleEdgeInsets = ReadingListTableViewCellUX.DeleteButtonTitleEdgeInsets
deleteAction.name = deleteButton.titleLabel!.text
deleteAction.target = self
deleteAction.selector = "deleteActionActivated"
rightUtilityButtons = [deleteButton]
markAsReadButton.backgroundColor = ReadingListTableViewCellUX.MarkAsReadButtonBackgroundColor
markAsReadButton.titleLabel?.font = ReadingListTableViewCellUX.MarkAsReadButtonTitleFont
markAsReadButton.titleLabel?.textColor = ReadingListTableViewCellUX.MarkAsReadButtonTitleColor
markAsReadButton.titleLabel?.lineBreakMode = NSLineBreakMode.ByWordWrapping
markAsReadButton.titleLabel?.textAlignment = NSTextAlignment.Center
markAsReadButton.setTitle(ReadingListTableViewCellUX.MarkAsReadButtonTitleText, forState: UIControlState.Normal)
markAsReadButton.setTitleColor(UIColor.whiteColor(), forState: UIControlState.Normal)
markAsReadButton.titleEdgeInsets = ReadingListTableViewCellUX.MarkAsReadButtonTitleEdgeInsets
markAsReadAction.name = markAsReadButton.titleLabel!.text
markAsReadAction.target = self
markAsReadAction.selector = "markAsReadActionActivated"
leftUtilityButtons = [markAsReadButton]
accessibilityCustomActions = [deleteAction, markAsReadAction]
}
required init(coder aDecoder: NSCoder) {
fatalError("init(coder:) has not been implemented")
}
let prefixesToSimplify = ["www.", "mobile.", "m.", "blog."]
private func simplifiedHostnameFromURL(url: NSURL) -> String {
let hostname = url.host ?? ""
for prefix in prefixesToSimplify {
if hostname.hasPrefix(prefix) {
return hostname.substringFromIndex(advance(hostname.startIndex, count(prefix)))
}
}
return hostname
}
@objc private func markAsReadActionActivated() -> Bool {
self.delegate?.swipeableTableViewCell?(self, didTriggerLeftUtilityButtonWithIndex: 0)
return true
}
@objc private func deleteActionActivated() -> Bool {
self.delegate?.swipeableTableViewCell?(self, didTriggerRightUtilityButtonWithIndex: 0)
return true
}
private func updateAccessibilityLabel() {
if let hostname = hostnameLabel.text,
title = titleLabel.text {
let unreadStatus = unread ? NSLocalizedString("unread", comment: "Accessibility label for unread article in reading list. It's a past participle - functions as an adjective.") : NSLocalizedString("read", comment: "Accessibility label for read article in reading list. It's a past participle - functions as an adjective.")
let string = "\(title), \(unreadStatus), \(hostname)"
var label: AnyObject
if !unread {
// mimic light gray visual dimming by "dimming" the speech by reducing pitch
let lowerPitchString = NSMutableAttributedString(string: string as String)
lowerPitchString.addAttribute(UIAccessibilitySpeechAttributePitch, value: NSNumber(float: ReadingListTableViewCellUX.ReadAccessibilitySpeechPitch), range: NSMakeRange(0, lowerPitchString.length))
label = NSAttributedString(attributedString: lowerPitchString)
} else {
label = string
}
// need to use KVC as accessibilityLabel is of type String! and cannot be set to NSAttributedString other way than this
// see bottom of page 121 of the PDF slides of WWDC 2012 "Accessibility for iOS" session for indication that this is OK by Apple
// also this combined with Swift's strictness is why we cannot simply override accessibilityLabel and return the label directly...
setValue(label, forKey: "accessibilityLabel")
}
}
}
class ReadingListEmptyStateView: UIView {
convenience init() {
self.init(frame: CGRectZero)
}
}
class ReadingListPanel: UITableViewController, HomePanel, SWTableViewCellDelegate {
weak var homePanelDelegate: HomePanelDelegate? = nil
var profile: Profile!
private lazy var emptyStateOverlayView: UIView = self.createEmptyStateOverview()
private var records: [ReadingListClientRecord]?
init() {
super.init(nibName: nil, bundle: nil)
NSNotificationCenter.defaultCenter().addObserver(self, selector: "firefoxAccountChanged:", name: NotificationFirefoxAccountChanged, object: nil)
}
required init!(coder aDecoder: NSCoder!) {
fatalError("init(coder:) has not been implemented")
}
override func viewDidLoad() {
super.viewDidLoad()
tableView.rowHeight = ReadingListTableViewCellUX.RowHeight
tableView.separatorInset = UIEdgeInsetsZero
tableView.layoutMargins = UIEdgeInsetsZero
tableView.separatorColor = UIConstants.SeparatorColor
tableView.registerClass(ReadingListTableViewCell.self, forCellReuseIdentifier: "ReadingListTableViewCell")
// Set an empty footer to prevent empty cells from appearing in the list.
tableView.tableFooterView = UIView()
view.backgroundColor = UIConstants.PanelBackgroundColor
if let result = profile.readingList?.getAvailableRecords() where result.isSuccess {
records = result.successValue
// If no records have been added yet, we display the empty state
if records?.count == 0 {
tableView.scrollEnabled = false
view.addSubview(emptyStateOverlayView)
}
}
}
deinit {
NSNotificationCenter.defaultCenter().removeObserver(self, name: NotificationFirefoxAccountChanged, object: nil)
}
func firefoxAccountChanged(notification: NSNotification) {
if notification.name == NotificationFirefoxAccountChanged {
let prevNumberOfRecords = records?.count
if let result = profile.readingList?.getAvailableRecords() where result.isSuccess {
records = result.successValue
if records?.count == 0 {
tableView.scrollEnabled = false
if emptyStateOverlayView.superview == nil {
view.addSubview(emptyStateOverlayView)
}
} else {
if prevNumberOfRecords == 0 {
tableView.scrollEnabled = true
emptyStateOverlayView.removeFromSuperview()
}
}
self.tableView.reloadData()
}
}
}
private func createEmptyStateOverview() -> UIView {
let overlayView = UIView(frame: tableView.bounds)
overlayView.backgroundColor = UIColor.whiteColor()
// Unknown why this does not work with autolayout
overlayView.autoresizingMask = UIViewAutoresizing.FlexibleHeight | UIViewAutoresizing.FlexibleWidth
let containerView = UIView()
overlayView.addSubview(containerView)
let logoImageView = UIImageView(image: UIImage(named: "ReadingListEmptyPanel"))
containerView.addSubview(logoImageView)
logoImageView.snp_makeConstraints({ (make) -> Void in
make.centerX.equalTo(containerView)
make.top.equalTo(containerView)
})
let welcomeLabel = UILabel()
containerView.addSubview(welcomeLabel)
welcomeLabel.text = NSLocalizedString("Welcome to your Reading List", comment: "See http://mzl.la/1LXbDOL")
welcomeLabel.textAlignment = NSTextAlignment.Center
welcomeLabel.font = ReadingListPanelUX.WelcomeScreenHeaderFont
welcomeLabel.textColor = ReadingListPanelUX.WelcomeScreenHeaderTextColor
welcomeLabel.adjustsFontSizeToFitWidth = true
welcomeLabel.snp_makeConstraints({ (make) -> Void in
make.centerX.equalTo(containerView)
make.width.equalTo(ReadingListPanelUX.WelcomeScreenItemWidth + ReadingListPanelUX.WelcomeScreenCircleSpacer + ReadingListPanelUX.WelcomeScreenCircleWidth)
make.top.equalTo(logoImageView.snp_bottom).offset(ReadingListPanelUX.WelcomeScreenPadding)
})
let readerModeLabel = UILabel()
containerView.addSubview(readerModeLabel)
readerModeLabel.text = NSLocalizedString("Open articles in Reader View by tapping the book icon when it appears in the title bar.", comment: "See http://mzl.la/1LXbDOL")
readerModeLabel.font = ReadingListPanelUX.WelcomeScreenItemFont
readerModeLabel.textColor = ReadingListPanelUX.WelcomeScreenItemTextColor
readerModeLabel.numberOfLines = 0
readerModeLabel.snp_makeConstraints({ (make) -> Void in
make.top.equalTo(welcomeLabel.snp_bottom).offset(ReadingListPanelUX.WelcomeScreenPadding)
make.left.equalTo(welcomeLabel.snp_left)
make.width.equalTo(ReadingListPanelUX.WelcomeScreenItemWidth)
})
let readerModeImageView = UIImageView(image: UIImage(named: "ReaderModeCircle"))
containerView.addSubview(readerModeImageView)
readerModeImageView.snp_makeConstraints({ (make) -> Void in
make.centerY.equalTo(readerModeLabel)
make.right.equalTo(welcomeLabel.snp_right)
})
let readingListLabel = UILabel()
containerView.addSubview(readingListLabel)
readingListLabel.text = NSLocalizedString("Save pages to your Reading List by tapping the book plus icon in the Reader View controls.", comment: "See http://mzl.la/1LXbDOL")
readingListLabel.font = ReadingListPanelUX.WelcomeScreenItemFont
readingListLabel.textColor = ReadingListPanelUX.WelcomeScreenItemTextColor
readingListLabel.numberOfLines = 0
readingListLabel.snp_makeConstraints({ (make) -> Void in
make.top.equalTo(readerModeLabel.snp_bottom).offset(ReadingListPanelUX.WelcomeScreenPadding)
make.left.equalTo(welcomeLabel.snp_left)
make.width.equalTo(ReadingListPanelUX.WelcomeScreenItemWidth)
})
let readingListImageView = UIImageView(image: UIImage(named: "AddToReadingListCircle"))
containerView.addSubview(readingListImageView)
readingListImageView.snp_makeConstraints({ (make) -> Void in
make.centerY.equalTo(readingListLabel)
make.right.equalTo(welcomeLabel.snp_right)
})
containerView.snp_makeConstraints({ (make) -> Void in
// Let the container wrap around the content
make.top.equalTo(overlayView.snp_top).offset(20)
make.bottom.equalTo(readingListLabel.snp_bottom)
make.left.equalTo(welcomeLabel).offset(ReadingListPanelUX.WelcomeScreenItemOffset)
make.right.equalTo(welcomeLabel).offset(ReadingListPanelUX.WelcomeScreenCircleOffset)
// And then center it in the overlay view that sits on top of the UITableView
make.centerX.equalTo(overlayView)
})
return overlayView
}
override func numberOfSectionsInTableView(tableView: UITableView) -> Int {
return 1
}
override func tableView(tableView: UITableView, numberOfRowsInSection section: Int) -> Int {
return records?.count ?? 0
}
override func tableView(tableView: UITableView, cellForRowAtIndexPath indexPath: NSIndexPath) -> UITableViewCell {
let cell = tableView.dequeueReusableCellWithIdentifier("ReadingListTableViewCell", forIndexPath: indexPath) as! ReadingListTableViewCell
cell.delegate = self
if let record = records?[indexPath.row] {
cell.title = record.title
cell.url = NSURL(string: record.url)!
cell.unread = record.unread
}
return cell
}
func swipeableTableViewCell(cell: SWTableViewCell!, didTriggerLeftUtilityButtonWithIndex index: Int) {
if let cell = cell as? ReadingListTableViewCell {
cell.hideUtilityButtonsAnimated(true)
if let indexPath = tableView.indexPathForCell(cell), record = records?[indexPath.row] {
if let result = profile.readingList?.updateRecord(record, unread: !record.unread) where result.isSuccess {
// TODO This is a bit odd because the success value of the update is an optional optional Record
if let successValue = result.successValue, updatedRecord = successValue {
records?[indexPath.row] = updatedRecord
tableView.reloadRowsAtIndexPaths([indexPath], withRowAnimation: UITableViewRowAnimation.Automatic)
}
}
}
}
}
func swipeableTableViewCell(cell: SWTableViewCell!, didTriggerRightUtilityButtonWithIndex index: Int) {
if let cell = cell as? ReadingListTableViewCell, indexPath = tableView.indexPathForCell(cell), record = records?[indexPath.row] {
if let result = profile.readingList?.deleteRecord(record) where result.isSuccess {
records?.removeAtIndex(indexPath.row)
tableView.deleteRowsAtIndexPaths([indexPath], withRowAnimation: UITableViewRowAnimation.Automatic)
// reshow empty state if no records left
if records?.count == 0 {
view.addSubview(emptyStateOverlayView)
}
}
}
}
override func tableView(tableView: UITableView, didSelectRowAtIndexPath indexPath: NSIndexPath) {
tableView.deselectRowAtIndexPath(indexPath, animated: false)
if let record = records?[indexPath.row], encodedURL = ReaderModeUtils.encodeURL(NSURL(string: record.url)!) {
// Reading list items are closest in concept to bookmarks.
let visitType = VisitType.Bookmark
homePanelDelegate?.homePanel(self, didSelectURL: encodedURL, visitType: visitType)
}
}
}
| b1595e6a3b610de19a1ebcb8a61aae54 | 48.710648 | 333 | 0.707427 | false | false | false | false |
visenze/visearch-sdk-swift | refs/heads/master | ViSearchSDK/ViSearchSDK/Classes/Request/ViColorSearchParams.swift | mit | 1 | //
// ViColorSearchParams.swift
// ViSearchSDK
//
// Created by Hung on 3/10/16.
// Copyright © 2016 Hung. All rights reserved.
//
import UIKit
/// Construct color search parameter request
public class ViColorSearchParams: ViBaseSearchParams {
public var color: String
public init? (color: String ) {
self.color = color
//verify that color is exactly 6 digits
if self.color.count != 6 {
print("\(type(of: self)).\(#function)[line:\(#line)] - error: color length must be 6")
return nil
}
// verify color is of valid format i.e. only a-fA-F0-9
let regex = try! NSRegularExpression(pattern: "[^a-fA-F|0-9]", options: [])
let numOfMatches = regex.numberOfMatches(in: self.color, options: [.reportCompletion], range: NSMakeRange(0, self.color.count ))
if numOfMatches != 0 {
print("\(type(of: self)).\(#function)[line:\(#line)] - error: invalid color format")
return nil
}
}
public convenience init (color: UIColor){
self.init(color: color.hexString())!
}
public override func toDict() -> [String: Any] {
var dict = super.toDict()
dict["color"] = color
return dict;
}
}
| 451e4b36e397c77c019b1145fa50ac7c | 27.608696 | 136 | 0.570669 | false | false | false | false |
zadr/conservatory | refs/heads/main | Conservatory.playground/Contents.swift | bsd-2-clause | 1 | import Conservatory
import UIKit
let length = 2000.0
let canvas = Canvas<CGRenderer>(size: Size(width: length, height: length))
var color = Color.random()
canvas.appearance.background = .solid(color)
canvas.appearance.border = .solid(color.complement)
canvas.appearance.borderWidth = Double.random(in: 50.0 ... 150.0)
let add: (Shape) -> Void = { (shape) -> Void in
var colors = Color.random().compound()
let shapeColor = colors.removeFirst()
var shapeDrawer = ShapeDrawer(shape: shape)
shapeDrawer.appearance.border = .solid(shapeColor.complement)
shapeDrawer.appearance.background = Bool.random() ? .gradient(colors, GradientOptions()) : .solid(shapeColor)
shapeDrawer.appearance.borderWidth = Double.random(in: 5.0 ... 30.0)
shapeDrawer.appearance.transform = Transform.move(Double.random(in: 0 ... length), y: Double.random(in: 0 ... length))
shapeDrawer.appearance.aura = Aura(color: shapeColor.withAlpha(float: 0.4), offset: Size(width: 0.0, height: -5.0), blur: 25.0)
canvas.add(shapeDrawer)
}
Int.random(in: 5 ... 15).times { (x, _) in
let side = Double.random(in: 35.0 ... 350.0)
let circle = Shape(circle: side)
add(circle)
let oval = Shape(oval: Size(width: side / 1.5, height: side * 1.5))
add(oval)
let polygon = Shape(sideCount: Int.random(in: 3 ... 8), length: side)
add(polygon)
}
//canvas.currentRepresentation!
UIImage(cgImage: canvas.currentRepresentation!) // changes every run!
let view = UIView(frame: CGRect(x: 0, y: 0, width: canvas.size.width, height: canvas.size.height))
| 49e200b36eb2d0416bb269d92a690e4e | 37.1 | 128 | 0.716535 | false | false | false | false |
MLSDev/TRON | refs/heads/main | Source/TRON/UploadAPIRequest.swift | mit | 1 | //
// UploadAPIRequest.swift
// TRON
//
// Created by Denys Telezhkin on 11.09.16.
// Copyright © 2015 - present MLSDev. All rights reserved.
//
// Permission is hereby granted, free of charge, to any person obtaining a copy
// of this software and associated documentation files (the "Software"), to deal
// in the Software without restriction, including without limitation the rights
// to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
// copies of the Software, and to permit persons to whom the Software is
// furnished to do so, subject to the following conditions:
//
// The above copyright notice and this permission notice shall be included in
// all copies or substantial portions of the Software.
//
// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
// IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
// FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
// AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
// LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
// OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
// THE SOFTWARE.
import Foundation
import Alamofire
/// Types of `UploadAPIRequest`
public enum UploadRequestType {
/// Will create `NSURLSessionUploadTask` using `uploadTaskWithRequest(_:fromFile:)` method
case uploadFromFile(URL)
/// Will create `NSURLSessionUploadTask` using `uploadTaskWithRequest(_:fromData:)` method
case uploadData(Data)
/// Will create `NSURLSessionUploadTask` using `uploadTaskWithStreamedRequest(_)` method
case uploadStream(InputStream)
// Depending on resulting size of the payload will either stream from disk or from memory
case multipartFormData(formData: (MultipartFormData) -> Void,
memoryThreshold: UInt64,
fileManager: FileManager)
}
/**
`UploadAPIRequest` encapsulates upload request creation logic, stubbing options, and response/error parsing.
*/
open class UploadAPIRequest<Model, ErrorModel: ErrorSerializable>: BaseRequest<Model, ErrorModel> {
/// UploadAPIRequest type
let type: UploadRequestType
/// Serializes received response into Result<Model>
open var responseParser: ResponseParser
/// Serializes received error into APIError<ErrorModel>
open var errorParser: ErrorParser
/// Closure that is applied to request before it is sent.
open var validationClosure: (UploadRequest) -> UploadRequest = { $0.validate() }
/// Sets `validationClosure` to `validation` parameter and returns configured request
///
/// - Parameter validation: validation to perform.
/// - Returns: configured request.
open func validation(_ validation: @escaping (UploadRequest) -> UploadRequest) -> Self {
validationClosure = validation
return self
}
/// Creates `UploadAPIRequest` with specified `type`, `path` and configures it with to be used with `tron`.
public init<Serializer: DataResponseSerializerProtocol>(type: UploadRequestType, path: String, tron: TRON, responseSerializer: Serializer)
where Serializer.SerializedObject == Model {
self.type = type
self.responseParser = { request, response, data, error in
try responseSerializer.serialize(request: request, response: response, data: data, error: error)
}
self.errorParser = { request, response, data, error in
ErrorModel(request: request, response: response, data: data, error: error)
}
super.init(path: path, tron: tron)
}
override func alamofireRequest(from session: Session) -> Request {
switch type {
case .uploadFromFile(let url):
return session.upload(url, to: urlBuilder.url(forPath: path), method: method,
headers: headers, interceptor: interceptor, requestModifier: requestModifier)
case .uploadData(let data):
return session.upload(data, to: urlBuilder.url(forPath: path), method: method,
headers: headers, interceptor: interceptor, requestModifier: requestModifier)
case .uploadStream(let stream):
return session.upload(stream, to: urlBuilder.url(forPath: path), method: method,
headers: headers, interceptor: interceptor, requestModifier: requestModifier)
case .multipartFormData(let constructionBlock, let memoryThreshold, let fileManager):
return session.upload(multipartFormData: appendParametersToMultipartFormDataBlock(constructionBlock),
to: urlBuilder.url(forPath: path),
usingThreshold: memoryThreshold,
method: method,
headers: headers,
interceptor: interceptor,
fileManager: fileManager,
requestModifier: requestModifier)
}
}
private func appendParametersToMultipartFormDataBlock(_ block: @escaping (MultipartFormData) -> Void) -> (MultipartFormData) -> Void {
return { formData in
self.parameters.forEach { key, value in
formData.append(String(describing: value).data(using: .utf8) ?? Data(), withName: key)
}
block(formData)
}
}
@discardableResult
/**
Send current request.
- parameter successBlock: Success block to be executed when request finished
- parameter failureBlock: Failure block to be executed if request fails. Nil by default.
- returns: Alamofire.Request or nil if request was stubbed.
*/
open func perform(withSuccess successBlock: ((Model) -> Void)? = nil, failure failureBlock: ((ErrorModel) -> Void)? = nil) -> UploadRequest {
return performAlamofireRequest {
self.callSuccessFailureBlocks(successBlock, failure: failureBlock, response: $0)
}
}
@discardableResult
/**
Perform current request with completion block, that contains Alamofire.Response.
- parameter completion: Alamofire.Response completion block.
- returns: Alamofire.Request or nil if request was stubbed.
*/
open func performCollectingTimeline(withCompletion completion: @escaping ((Alamofire.DataResponse<Model, AFError>) -> Void)) -> UploadRequest {
return performAlamofireRequest(completion)
}
private func performAlamofireRequest(_ completion : @escaping (DataResponse<Model, AFError>) -> Void) -> UploadRequest {
guard let session = tronDelegate?.session else {
fatalError("Manager cannot be nil while performing APIRequest")
}
willSendRequest()
guard let request = alamofireRequest(from: session) as? UploadRequest else {
fatalError("Failed to receive UploadRequest")
}
if let stub = apiStub, stub.isEnabled {
request.tron_apiStub = stub
}
willSendAlamofireRequest(request)
let uploadRequest = validationClosure(request)
.performResponseSerialization(queue: resultDeliveryQueue,
responseSerializer: dataResponseSerializer(with: request),
completionHandler: { dataResponse in
self.didReceiveDataResponse(dataResponse, forRequest: request)
completion(dataResponse)
})
if !session.startRequestsImmediately {
request.resume()
}
didSendAlamofireRequest(request)
return uploadRequest
}
internal func dataResponseSerializer(with request: Request) -> TRONDataResponseSerializer<Model> {
return TRONDataResponseSerializer { urlRequest, response, data, error in
self.willProcessResponse((urlRequest, response, data, error), for: request)
let parsedModel: Model
do {
parsedModel = try self.responseParser(urlRequest, response, data, error)
} catch let catchedError {
let parsedError = self.errorParser(urlRequest, response, data, catchedError)
self.didReceiveError(parsedError, for: (urlRequest, response, data, error), request: request)
throw parsedError
}
self.didSuccessfullyParseResponse((urlRequest, response, data, error), creating: parsedModel, forRequest: request)
return parsedModel
}
}
internal func didReceiveError(_ error: ErrorModel, for response: (URLRequest?, HTTPURLResponse?, Data?, Error?), request: Alamofire.Request) {
allPlugins.forEach { plugin in
plugin.didReceiveError(error, forResponse: response, request: request, formedFrom: self)
}
}
}
| b8469b0639ed56cee3155923a732733a | 45.19898 | 147 | 0.658973 | false | false | false | false |
zeroc-ice/ice | refs/heads/3.7 | swift/test/Ice/optional/TestI.swift | gpl-2.0 | 3 | //
// Copyright (c) ZeroC, Inc. All rights reserved.
//
import Foundation
import Ice
import TestCommon
class InitialI: Initial {
func shutdown(current: Ice.Current) throws {
current.adapter!.getCommunicator().shutdown()
}
func pingPong(o: Ice.Value?, current _: Ice.Current) throws -> Ice.Value? {
return o
}
func opOptionalException(a: Int32?,
b: String?,
o: OneOptional?,
current _: Ice.Current) throws {
throw OptionalException(req: false, a: a, b: b, o: o)
}
func opDerivedException(a: Int32?,
b: String?,
o: OneOptional?,
current _: Ice.Current) throws {
throw DerivedException(req: false, a: a, b: b, o: o, d1: "d1", ss: b, o2: o, d2: "d2")
}
func opRequiredException(a: Int32?,
b: String?,
o: OneOptional?,
current _: Ice.Current) throws {
let e = RequiredException()
e.a = a
e.b = b
e.o = o
if let b = b {
e.ss = b
}
e.o2 = o
throw e
}
func opByte(p1: UInt8?,
current _: Ice.Current) throws -> (returnValue: UInt8?, p3: UInt8?) {
return (p1, p1)
}
func opBool(p1: Bool?, current _: Ice.Current) throws -> (returnValue: Bool?, p3: Bool?) {
return (p1, p1)
}
func opShort(p1: Int16?, current _: Ice.Current) throws -> (returnValue: Int16?, p3: Int16?) {
return (p1, p1)
}
func opInt(p1: Int32?, current _: Ice.Current) throws -> (returnValue: Int32?, p3: Int32?) {
return (p1, p1)
}
func opLong(p1: Int64?, current _: Ice.Current) throws -> (returnValue: Int64?, p3: Int64?) {
return (p1, p1)
}
func opFloat(p1: Float?, current _: Ice.Current) throws -> (returnValue: Float?, p3: Float?) {
return (p1, p1)
}
func opDouble(p1: Double?, current _: Ice.Current) throws -> (returnValue: Double?, p3: Double?) {
return (p1, p1)
}
func opString(p1: String?, current _: Ice.Current) throws -> (returnValue: String?, p3: String?) {
return (p1, p1)
}
func opCustomString(p1: String?, current _: Current) throws -> (returnValue: String?, p3: String?) {
return (p1, p1)
}
func opMyEnum(p1: MyEnum?, current _: Ice.Current) throws -> (returnValue: MyEnum?, p3: MyEnum?) {
return (p1, p1)
}
func opSmallStruct(p1: SmallStruct?, current _: Ice.Current) throws -> (returnValue: SmallStruct?,
p3: SmallStruct?) {
return (p1, p1)
}
func opFixedStruct(p1: FixedStruct?, current _: Ice.Current) throws -> (returnValue: FixedStruct?,
p3: FixedStruct?) {
return (p1, p1)
}
func opVarStruct(p1: VarStruct?, current _: Ice.Current) throws -> (returnValue: VarStruct?, p3: VarStruct?) {
return (p1, p1)
}
func opOneOptional(p1: OneOptional?, current _: Ice.Current) throws -> (returnValue: OneOptional?,
p3: OneOptional?) {
return (p1, p1)
}
func opOneOptionalProxy(p1: Ice.ObjectPrx?, current _: Ice.Current) throws -> (returnValue: Ice.ObjectPrx?,
p3: Ice.ObjectPrx?) {
return (p1, p1)
}
func opByteSeq(p1: ByteSeq?, current _: Ice.Current) throws -> (returnValue: ByteSeq?, p3: ByteSeq?) {
return (p1, p1)
}
func opBoolSeq(p1: BoolSeq?, current _: Ice.Current) throws -> (returnValue: BoolSeq?, p3: BoolSeq?) {
return (p1, p1)
}
func opShortSeq(p1: ShortSeq?, current _: Ice.Current) throws -> (returnValue: ShortSeq?, p3: ShortSeq?) {
return (p1, p1)
}
func opIntSeq(p1: IntSeq?, current _: Ice.Current) throws -> (returnValue: IntSeq?, p3: IntSeq?) {
return (p1, p1)
}
func opLongSeq(p1: LongSeq?, current _: Ice.Current) throws -> (returnValue: LongSeq?, p3: LongSeq?) {
return (p1, p1)
}
func opFloatSeq(p1: FloatSeq?, current _: Ice.Current) throws -> (returnValue: FloatSeq?, p3: FloatSeq?) {
return (p1, p1)
}
func opDoubleSeq(p1: DoubleSeq?, current _: Ice.Current) throws -> (returnValue: DoubleSeq?, p3: DoubleSeq?) {
return (p1, p1)
}
func opStringSeq(p1: StringSeq?, current _: Ice.Current) throws -> (returnValue: StringSeq?,
p3: StringSeq?) {
return (p1, p1)
}
func opSmallStructSeq(p1: SmallStructSeq?, current _: Ice.Current) throws -> (returnValue: SmallStructSeq?,
p3: SmallStructSeq?) {
return (p1, p1)
}
func opSmallStructList(p1: SmallStructList?, current _: Ice.Current) throws -> (returnValue: SmallStructList?,
p3: SmallStructList?) {
return (p1, p1)
}
func opFixedStructSeq(p1: FixedStructSeq?, current _: Ice.Current) throws -> (returnValue: FixedStructSeq?,
p3: FixedStructSeq?) {
return (p1, p1)
}
func opFixedStructList(p1: FixedStructList?, current _: Ice.Current) throws -> (returnValue: FixedStructList?,
p3: FixedStructList?) {
return (p1, p1)
}
func opVarStructSeq(p1: VarStructSeq?, current _: Ice.Current) throws -> (returnValue: VarStructSeq?,
p3: VarStructSeq?) {
return (p1, p1)
}
func opSerializable(p1: Serializable?, current _: Current) throws -> (returnValue: Serializable?,
p3: Serializable?) {
return (p1, p1)
}
func opIntIntDict(p1: [Int32: Int32]?, current _: Ice.Current) throws -> (returnValue: [Int32: Int32]?,
p3: [Int32: Int32]?) {
return (p1, p1)
}
func opStringIntDict(p1: [String: Int32]?, current _: Ice.Current) throws -> (returnValue: [String: Int32]?,
p3: [String: Int32]?) {
return (p1, p1)
}
func opCustomIntStringDict(p1: IntStringDict?,
current _: Current) throws -> (returnValue: IntStringDict?, p3: IntStringDict?) {
return (p1, p1)
}
func opIntOneOptionalDict(p1: [Int32: OneOptional?]?,
current _: Ice.Current) throws -> (returnValue: [Int32: OneOptional?]?,
p3: [Int32: OneOptional?]?) {
return (p1, p1)
}
func opClassAndUnknownOptional(p _: A?, current _: Ice.Current) throws {}
func sendOptionalClass(req _: Bool, o _: OneOptional?, current _: Ice.Current) throws {}
func returnOptionalClass(req _: Bool, current _: Ice.Current) throws -> OneOptional? {
return OneOptional(a: 53)
}
func opG(g: G?, current _: Ice.Current) throws -> G? {
return g
}
func opVoid(current _: Ice.Current) throws {}
func supportsRequiredParams(current _: Ice.Current) throws -> Bool {
return false
}
func supportsJavaSerializable(current _: Ice.Current) throws -> Bool {
return false
}
func supportsCsharpSerializable(current _: Ice.Current) throws -> Bool {
return false
}
func supportsCppStringView(current _: Ice.Current) throws -> Bool {
return false
}
func supportsNullOptional(current _: Ice.Current) throws -> Bool {
return false
}
func opMStruct1(current _: Current) throws -> SmallStruct? {
return SmallStruct()
}
func opMStruct2(p1: SmallStruct?, current _: Current) throws -> (returnValue: SmallStruct?, p2: SmallStruct?) {
return (p1, p1)
}
func opMSeq1(current _: Current) throws -> StringSeq? {
return []
}
func opMSeq2(p1: StringSeq?, current _: Current) throws -> (returnValue: StringSeq?, p2: StringSeq?) {
return (p1, p1)
}
func opMDict1(current _: Current) throws -> StringIntDict? {
return [:]
}
func opMDict2(p1: StringIntDict?, current _: Current) throws -> (returnValue: StringIntDict?, p2: StringIntDict?) {
return (p1, p1)
}
func opMG1(current _: Current) throws -> G? {
return G()
}
func opMG2(p1: G?, current _: Current) throws -> (returnValue: G?, p2: G?) {
return (p1, p1)
}
}
| 9208d477044b8824e95993991a5d1adb | 34.061303 | 119 | 0.511966 | false | false | false | false |
sstanic/Shopfred | refs/heads/master | Shopfred/Shopfred/View Controller/GenericSelectionViewController.swift | mit | 1 | //
// GenericSelectionViewController.swift
// Shopfred
//
// Created by Sascha Stanic on 7/1/17.
// Copyright © 2017 Sascha Stanic. All rights reserved.
//
import UIKit
import CoreData
/**
Shows a list of core data entities.
These entities are managed by the view controller:
- *Unit*
- *Category*
- *Context*
The entity type is defined by the generic type
parameter of the class.
*/
class GenericSelectionViewController<T: NSManagedObject>: UIViewController, UITableViewDataSource, UITableViewDelegate {
// MARK: - Private Attributes
private var setSelection: ((_ o: T) -> Void)!
private var myTableView: UITableView!
private var myLabel: UILabel!
private var myStackView: UIStackView!
private var myToolBar: UIToolbar!
private var list = [ManagedObjectName]()
private var info: String!
private var selectedName: String?
// MARK: - Initializer
convenience init(setSelection: @escaping (_ o: T) -> Void) {
self.init(nibName: nil, bundle: nil)
self.setSelection = setSelection
self.info = ""
self.selectedName = ""
}
convenience init(info: String, setSelection: @escaping (_ o: T) -> Void) {
self.init(setSelection: setSelection)
self.info = info
self.selectedName = ""
}
convenience init(info: String, selectedName: String?, setSelection: @escaping (_ o: T) -> Void) {
self.init(info: info, setSelection: setSelection)
self.selectedName = selectedName
}
// MARK: - Lifecycle
override func viewDidLoad() {
super.viewDidLoad()
self.createElementList()
self.initializeView()
self.setStyle()
}
override func viewWillAppear(_ animated: Bool) {
self.myTableView.reloadData()
if let navController = self.navigationController {
navController.isToolbarHidden = false
}
}
override func viewWillDisappear(_ animated: Bool) {
if let navController = self.navigationController {
navController.isToolbarHidden = true
}
}
// MARK: - Styling
private func setStyle() {
self.myTableView.style(style: ViewStyle.TableListView.standard)
self.myTableView.separatorColor = UIColor.clear
self.myTableView.contentInset = UIEdgeInsets(top: 8, left: 0, bottom: 0, right: 0)
self.myLabel.style(style: TextStyle.title)
self.view.style(style: ViewStyle.TableListView.standard)
}
// MARK: - Initialize View
private func createElementList() {
let shoppingSpace = DataStore.sharedInstance().shoppingStore.shoppingSpace
let request: NSFetchRequest = T.fetchRequest()
let predicate = NSPredicate(format: "shoppingSpace.id == %@", shoppingSpace?.id ?? "")
request.predicate = predicate
do {
self.list = try DataStore.sharedInstance().stack.context.fetch(request) as! [ManagedObjectName]
}
catch {
print("fetch request for \(T.self) failed.")
}
}
private func initializeView() {
self.myStackView = UIStackView()
self.myStackView.translatesAutoresizingMaskIntoConstraints=false
self.view.addSubview(myStackView)
self.view.addConstraints(NSLayoutConstraint.constraints(withVisualFormat: "V:|-64-[stackView]-0-|", options: NSLayoutFormatOptions.alignAllLeading, metrics: nil, views: ["stackView":self.myStackView]))
self.view.addConstraints(NSLayoutConstraint.constraints(withVisualFormat: "H:|-0-[stackView]-0-|", options: NSLayoutFormatOptions.alignAllLeading, metrics: nil, views: ["stackView":self.myStackView]))
self.myStackView.axis = .vertical
self.myStackView.alignment = .fill
self.myStackView.distribution = .fill
self.myStackView.spacing = 5
self.myLabel = UILabel()
self.myLabel.text = info
self.myLabel.textAlignment = .center
self.myLabel.backgroundColor = UIColor.groupTableViewBackground
let height : CGFloat = 40.0
let heightConstraint = NSLayoutConstraint(item: self.myLabel, attribute: NSLayoutAttribute.height, relatedBy: NSLayoutRelation.equal, toItem: nil, attribute: NSLayoutAttribute.notAnAttribute, multiplier: 1, constant: height)
self.myStackView.addArrangedSubview(self.myLabel)
NSLayoutConstraint.activate([heightConstraint])
// tableView
self.myTableView = UITableView()
self.myTableView.register(GenericSelectionTableViewCell.self, forCellReuseIdentifier: "genericSelectionTableViewCell")
self.myTableView.dataSource = self
self.myTableView.delegate = self
self.myStackView.addArrangedSubview(self.myTableView)
var items = [UIBarButtonItem]()
items.append(UIBarButtonItem(title: "Manage entries", style: .plain, target: self, action: #selector(navigateToSettings)))
self.toolbarItems = items
}
// MARK: - Navigation
@objc private func navigateToSettings() {
let vc = UIStoryboard(name:"Main", bundle:nil).instantiateViewController(withIdentifier: "SettingsListViewController") as! SettingsListViewController
vc.type = T.self
vc.titleText = "Manage entries"
if let navController = self.navigationController {
navController.pushViewController(vc, animated: true)
}
}
private func navigateBack() {
if let navController = self.navigationController {
navController.popViewController(animated: true)
}
else {
Utils.showAlert(self, alertMessage: "Sorry, something went wrong. Please restart the app.", completion: nil)
}
}
// MARK: - UITableViewDataSource, UITableViewDelegate
func tableView(_ tableView: UITableView, numberOfRowsInSection section: Int) -> Int {
return self.list.count
}
func tableView(_ tableView: UITableView, cellForRowAt indexPath: IndexPath) -> UITableViewCell {
let cell = tableView.dequeueReusableCell(withIdentifier: "genericSelectionTableViewCell", for: indexPath) as! GenericSelectionTableViewCell
let selectionItem = self.list[indexPath.row]
if let txtLbl = cell.textLabel {
txtLbl.text = selectionItem.name
}
if (selectionItem.name == self.selectedName) {
cell.accessoryType = .checkmark
}
cell.setStyle()
return cell
}
func tableView(_ tableView: UITableView, didSelectRowAt indexPath: IndexPath) {
self.setSelection(list[indexPath.row] as! T)
DataStore.sharedInstance().saveContext() { success, error in
// completion parameters not used
self.navigateBack()
}
}
}
| 89bc96226a35eecb90e1c1bc9b9940ff | 31.976959 | 232 | 0.635551 | false | false | false | false |
zyhndesign/SDX_DG | refs/heads/master | sdxdg/sdxdg/ClientDetailViewController.swift | apache-2.0 | 1 | //
// ClientDetailViewController.swift
// sdxdg
//
// Created by lotusprize on 16/12/26.
// Copyright © 2016年 geekTeam. All rights reserved.
//
import UIKit
class ClientDetailViewController: UIViewController {
@IBOutlet var baseInfoBtn: UIButton!
@IBOutlet var consumeBtn: UIButton!
@IBOutlet var feedbackBtn: UIButton!
let screenWidth = UIScreen.main.bounds.width
let screenHeight = UIScreen.main.bounds.height
var baseInfoPanel:UIView?
var consumePanel:UIView?
var feedbackPanel:UIView?
var vipUser:VipUser?
override func viewDidLoad() {
super.viewDidLoad()
self.initBaseInfoPanel()
self.initPushHistoryPanel()
self.initFeedbackPanel()
consumePanel?.isHidden = true
feedbackPanel?.isHidden = true
}
func initBaseInfoPanel(){
baseInfoPanel = UIView.init(frame: CGRect.init(x: 0, y: 113, width: screenWidth, height: screenHeight - 113))
let icon:UIImageView = UIImageView.init(frame: CGRect.init(x: 20, y: 20, width: 130, height: 130))
icon.image = UIImage.init(named: "customerIcon5")
icon.contentMode = UIViewContentMode.scaleAspectFit
baseInfoPanel!.addSubview(icon)
let nameLabel:UILabel = UILabel.init(frame: CGRect.init(x: 160, y: 20, width: 100, height: 25))
nameLabel.text = "VIP会员姓名:"
nameLabel.font = UIFont.systemFont(ofSize: 12)
baseInfoPanel!.addSubview(nameLabel)
let nameLabelValue:UILabel = UILabel.init(frame: CGRect.init(x: 240, y: 20, width: 100, height: 25))
nameLabelValue.text = vipUser?.vipname
nameLabelValue.font = UIFont.systemFont(ofSize: 12)
baseInfoPanel!.addSubview(nameLabelValue)
let birthdayLabel:UILabel = UILabel.init(frame: CGRect.init(x: 160, y: 60, width: 100, height: 25))
birthdayLabel.text = "生日:"
birthdayLabel.font = UIFont.systemFont(ofSize: 12)
baseInfoPanel!.addSubview(birthdayLabel)
let valueBirthdayLabel:UILabel = UILabel.init(frame: CGRect.init(x: 240, y: 60, width: 100, height: 25))
valueBirthdayLabel.text = vipUser?.birthday
valueBirthdayLabel.font = UIFont.systemFont(ofSize: 12)
baseInfoPanel!.addSubview(valueBirthdayLabel)
let levelLabel:UILabel = UILabel.init(frame: CGRect.init(x: 160, y: 90, width: 100, height: 25))
levelLabel.text = "级别:"
levelLabel.font = UIFont.systemFont(ofSize: 12)
baseInfoPanel!.addSubview(levelLabel)
let valueLevelLabel:UILabel = UILabel.init(frame: CGRect.init(x: 240, y: 90, width: 100, height: 25))
valueLevelLabel.text = vipUser?.rank
valueLevelLabel.font = UIFont.systemFont(ofSize: 12)
baseInfoPanel!.addSubview(valueLevelLabel)
let mobileLabel:UILabel = UILabel.init(frame: CGRect.init(x: 160, y: 125, width: 100, height: 25))
mobileLabel.text = "手机号码:"
mobileLabel.font = UIFont.systemFont(ofSize: 12)
baseInfoPanel!.addSubview(mobileLabel)
let valueMobileLabel:UILabel = UILabel.init(frame: CGRect.init(x: 240, y: 125, width: 100, height: 25))
valueMobileLabel.text = vipUser?.phonenumber
valueMobileLabel.font = UIFont.systemFont(ofSize: 12)
baseInfoPanel!.addSubview(valueMobileLabel)
let line1:UIView = UIView.init(frame: CGRect.init(x: 15, y: 170, width: screenWidth - 30, height: 1))
line1.backgroundColor = UIColor.lightGray
baseInfoPanel!.addSubview(line1)
let consumeLabel:UILabel = UILabel.init(frame: CGRect.init(x: 20, y: 180, width: 110, height: 30))
consumeLabel.text = "目前消费额度:"
consumeLabel.font = UIFont.systemFont(ofSize: 12)
baseInfoPanel!.addSubview(consumeLabel)
let valueConsumeLabel:UILabel = UILabel.init(frame: CGRect.init(x: 120, y: 180, width: 110, height: 30))
valueConsumeLabel.text = String.init(format: "%i", (vipUser?.consumesum!)!)
valueConsumeLabel.font = UIFont.systemFont(ofSize: 12)
baseInfoPanel!.addSubview(valueConsumeLabel)
let line2:UIView = UIView.init(frame: CGRect.init(x: 15, y: 210, width: screenWidth - 30, height: 1))
line2.backgroundColor = UIColor.lightGray
baseInfoPanel!.addSubview(line2)
let consumeValueLabel:UILabel = UILabel.init(frame: CGRect.init(x: 20, y: 220, width: 110, height: 30))
consumeValueLabel.text = "累计消费次数:"
consumeValueLabel.font = UIFont.systemFont(ofSize: 12)
baseInfoPanel!.addSubview(consumeValueLabel)
let valueConsumeValueLabel:UILabel = UILabel.init(frame: CGRect.init(x: 120, y: 220, width: 110, height: 30))
valueConsumeValueLabel.text = String.init(format: "%i", (vipUser?.consumenumber!)!)
valueConsumeValueLabel.font = UIFont.systemFont(ofSize: 12)
baseInfoPanel!.addSubview(valueConsumeValueLabel)
let line3:UIView = UIView.init(frame: CGRect.init(x: 15, y: 250, width: screenWidth - 30, height: 1))
line3.backgroundColor = UIColor.lightGray
baseInfoPanel!.addSubview(line3)
self.view.addSubview(baseInfoPanel!)
}
func initPushHistoryPanel(){
let consumerController:ConsumeListViewController = ConsumeListViewController.init(storyBoard: self.storyboard!, naviController: self.navigationController!, vipName:(vipUser?.vipname)!)
consumerController.view.frame = CGRect.init(x: 0, y: 113, width: screenWidth, height: screenHeight - 113)
consumePanel = consumerController.view
self.view.addSubview(consumePanel!)
self.addChildViewController(consumerController)
}
func initFeedbackPanel(){
let feedbackController:FeedbackListViewController = FeedbackListViewController.init(sBoard: self.storyboard!, naviController: self.navigationController!, vipName:(vipUser?.vipname)!, vipId:(vipUser?.id)!)
feedbackController.view.frame = CGRect.init(x: 0, y: 113, width: screenWidth, height: screenHeight - 113)
feedbackPanel = feedbackController.view
self.view.addSubview(feedbackPanel!)
self.addChildViewController(feedbackController)
}
@IBAction func baseInfoBtnClick(_ sender: Any) {
baseInfoBtn.setBackgroundImage(UIImage.init(named: "selectedBtn"), for: UIControlState.normal)
consumeBtn.setBackgroundImage(UIImage.init(named: "normalBtn"), for: UIControlState.normal)
feedbackBtn.setBackgroundImage(UIImage.init(named: "normalBtn"), for: UIControlState.normal)
baseInfoPanel?.isHidden = false
consumePanel?.isHidden = true
feedbackPanel?.isHidden = true
}
@IBAction func consumeBtnClick(_ sender: Any) {
consumeBtn.setBackgroundImage(UIImage.init(named: "selectedBtn"), for: UIControlState.normal)
baseInfoBtn.setBackgroundImage(UIImage.init(named: "normalBtn"), for: UIControlState.normal)
feedbackBtn.setBackgroundImage(UIImage.init(named: "normalBtn"), for: UIControlState.normal)
baseInfoPanel?.isHidden = true
consumePanel?.isHidden = false
feedbackPanel?.isHidden = true
}
@IBAction func feedbackBtnClick(_ sender: Any) {
feedbackBtn.setBackgroundImage(UIImage.init(named: "selectedBtn"), for: UIControlState.normal)
consumeBtn.setBackgroundImage(UIImage.init(named: "normalBtn"), for: UIControlState.normal)
baseInfoBtn.setBackgroundImage(UIImage.init(named: "normalBtn"), for: UIControlState.normal)
baseInfoPanel?.isHidden = true
consumePanel?.isHidden = true
feedbackPanel?.isHidden = false
}
override func didReceiveMemoryWarning() {
super.didReceiveMemoryWarning()
// Dispose of any resources that can be recreated.
}
}
| a37c1b90b499e2fe04d5aac86180ae90 | 46.04142 | 212 | 0.677862 | false | false | false | false |
boylee1111/BLCircularProgress-Swift | refs/heads/master | BLCircularProgress-Swift/ViewController.swift | mit | 1 | //
// ViewController.swift
// BLCircularProgress-Swift
//
// Created by Boyi on 4/3/15.
// Copyright (c) 2015 boyi. All rights reserved.
//
import UIKit
class ViewController: UIViewController, BLCircularProgressViewProtocol {
@IBOutlet weak var circularProgress: BLCircularProgressView!
override func viewDidLoad() {
super.viewDidLoad()
// Do any additional setup after loading the view, typically from a nib.
self.circularProgress.progress = 30
self.circularProgress.maximaProgress = 90
self.circularProgress.minimaProgress = 20
self.circularProgress.delegate = self;
NSTimer.scheduledTimerWithTimeInterval(2, target: self, selector: "updateProgress", userInfo: nil, repeats: true)
}
override func didReceiveMemoryWarning() {
super.didReceiveMemoryWarning()
// Dispose of any resources that can be recreated.
}
func updateProgress() {
var randomValue = self.randomDoubleBetween(0, bigValue: 100)
println("random value = \(randomValue)")
self.circularProgress.animateProgress(randomValue, completion: nil)
}
func randomDoubleBetween(smallValue: Double, bigValue: Double) -> Double {
var diff = bigValue - smallValue
return Double(arc4random_uniform(UInt32(diff))) + smallValue
}
func circularAnimationBegan(circularProgressView: BLCircularProgressView, progress: Double) {
println("Animation Began")
}
func circularAnimationDuring(circularProgressView: BLCircularProgressView, progress: Double) {
println("Animation During, Current Progress = \(progress)")
}
func circularAnimationEnded(circularProgressView: BLCircularProgressView, progress: Double) {
println("Animation Ended")
}
}
| cbdd765f54a0a545eb6b6e91532dbf3b | 32.327273 | 121 | 0.692853 | false | false | false | false |
tsolomko/SWCompression | refs/heads/develop | Sources/Common/Container/DosAttributes.swift | mit | 1 | // Copyright (c) 2022 Timofey Solomko
// Licensed under MIT License
//
// See LICENSE for license information
import Foundation
/// Represents file attributes in DOS format.
public struct DosAttributes: OptionSet {
/// Raw bit flags value.
public let rawValue: UInt32
/// Initializes attributes with bit flags.
public init(rawValue: UInt32) {
self.rawValue = rawValue
}
/// File is archive or archived.
public static let archive = DosAttributes(rawValue: 0b00100000)
/// File is a directory.
public static let directory = DosAttributes(rawValue: 0b00010000)
/// File is a volume.
public static let volume = DosAttributes(rawValue: 0b00001000)
/// File is a system file.
public static let system = DosAttributes(rawValue: 0b00000100)
/// File is hidden.
public static let hidden = DosAttributes(rawValue: 0b00000010)
/// File is read-only.
public static let readOnly = DosAttributes(rawValue: 0b00000001)
}
| cb4d9ce1ca070102c457c9638b69d560 | 25.837838 | 69 | 0.700906 | false | false | false | false |
kuhippo/swift-vuejs-starter | refs/heads/master | Sources/swift-vue-start/configuration/Config.swift | mit | 1 | //
// Config.swift
// swiftStartKit
//
// Created by mubin on 2017/8/17.
//
//
import Foundation
import PostgreSQL
import PerfectLib
let postgresTestConnInfo = "host=localhost dbname=postgres"
func config(){
let p = PGConnection()
let status = p.connectdb(postgresTestConnInfo)
guard status != .bad else{
//连接失败
fatalError("\(p.errorMessage())")
}
//添加测试数据
let userres = p.exec(statement: "CREATE TABLE users ( id serial PRIMARY KEY, username varchar(20) NOT NULL, age integer)")
let topicres = p.exec(statement: "CREATE TABLE topics ( id serial PRIMARY KEY, user_id integer ,title varchar(20) NULL, content varchar(20))")
guard userres.status() == .commandOK && topicres.status() == .commandOK else {
Log.error(message: "\(userres.errorMessage())\(topicres.errorMessage())")
userres.clear()
topicres.clear()
return
}
let _ = p.exec(statement: "INSERT INTO users(username,age) values('john',10)")
let _ = p.exec(statement: "INSERT INTO topics(user_id,title,content) values(10,'文章1','fffffccckkk')")
let _ = p.exec(statement: "INSERT INTO topics(user_id,title,content) values(10,'文章2','seven color')")
let _ = p.exec(statement: "INSERT INTO topics(user_id,title,content) values(10,'文章3',':-D :-D :-D')")
userres.clear()
topicres.clear()
p.finish()
}
| 604b7c2fe9dfc6072896f0fb4c7cfa2c | 27.54 | 146 | 0.627891 | false | false | false | false |
thankmelater23/relliK | refs/heads/master | Pods/SwiftyBeaver/Sources/Filter.swift | unlicense | 1 | //
// Filter.swift
// SwiftyBeaver
//
// Created by Jeff Roberts on 5/31/16.
// Copyright © 2015 Sebastian Kreutzberger
// Some rights reserved: http://opensource.org/licenses/MIT
//
import Foundation
/// FilterType is a protocol that describes something that determines
/// whether or not a message gets logged. A filter answers a Bool when it
/// is applied to a value. If the filter passes, it shall return true,
/// false otherwise.
///
/// A filter must contain a target, which identifies what it filters against
/// A filter can be required meaning that all required filters against a specific
/// target must pass in order for the message to be logged. At least one non-required
/// filter must pass in order for the message to be logged
public protocol FilterType: class {
func apply(_ value: Any) -> Bool
func getTarget() -> Filter.TargetType
func isRequired() -> Bool
func isExcluded() -> Bool
func reachedMinLevel(_ level: SwiftyBeaver.Level) -> Bool
}
/// Filters is syntactic sugar used to easily construct filters
public class Filters {
public static let Path = PathFilterFactory.self
public static let Function = FunctionFilterFactory.self
public static let Message = MessageFilterFactory.self
}
/// Filter is an abstract base class for other filters
public class Filter {
public enum TargetType {
case Path(Filter.ComparisonType)
case Function(Filter.ComparisonType)
case Message(Filter.ComparisonType)
}
public enum ComparisonType {
case StartsWith([String], Bool)
case Contains([String], Bool)
case Excludes([String], Bool)
case EndsWith([String], Bool)
case Equals([String], Bool)
}
let targetType: Filter.TargetType
let required: Bool
let minLevel: SwiftyBeaver.Level
public init(_ target: Filter.TargetType, required: Bool, minLevel: SwiftyBeaver.Level) {
self.targetType = target
self.required = required
self.minLevel = minLevel
}
public func getTarget() -> Filter.TargetType {
return self.targetType
}
public func isRequired() -> Bool {
return self.required
}
public func isExcluded() -> Bool {
return false
}
/// returns true of set minLevel is >= as given level
public func reachedMinLevel(_ level: SwiftyBeaver.Level) -> Bool {
//print("checking if given level \(level) >= \(minLevel)")
return level.rawValue >= minLevel.rawValue
}
}
/// CompareFilter is a FilterType that can filter based upon whether a target
/// starts with, contains or ends with a specific string. CompareFilters can be
/// case sensitive.
public class CompareFilter: Filter, FilterType {
private var filterComparisonType: Filter.ComparisonType?
override public init(_ target: Filter.TargetType, required: Bool, minLevel: SwiftyBeaver.Level) {
super.init(target, required: required, minLevel: minLevel)
let comparisonType: Filter.ComparisonType?
switch self.getTarget() {
case let .Function(comparison):
comparisonType = comparison
case let .Path(comparison):
comparisonType = comparison
case let .Message(comparison):
comparisonType = comparison
/*default:
comparisonType = nil*/
}
self.filterComparisonType = comparisonType
}
public func apply(_ value: Any) -> Bool {
guard let value = value as? String else {
return false
}
guard let filterComparisonType = self.filterComparisonType else {
return false
}
let matches: Bool
switch filterComparisonType {
case let .Contains(strings, caseSensitive):
matches = !strings.filter { string in
return caseSensitive ? value.contains(string) :
value.lowercased().contains(string.lowercased())
}.isEmpty
case let .Excludes(strings, caseSensitive):
matches = !strings.filter { string in
return caseSensitive ? !value.contains(string) :
!value.lowercased().contains(string.lowercased())
}.isEmpty
case let .StartsWith(strings, caseSensitive):
matches = !strings.filter { string in
return caseSensitive ? value.hasPrefix(string) :
value.lowercased().hasPrefix(string.lowercased())
}.isEmpty
case let .EndsWith(strings, caseSensitive):
matches = !strings.filter { string in
return caseSensitive ? value.hasSuffix(string) :
value.lowercased().hasSuffix(string.lowercased())
}.isEmpty
case let .Equals(strings, caseSensitive):
matches = !strings.filter { string in
return caseSensitive ? value == string :
value.lowercased() == string.lowercased()
}.isEmpty
}
return matches
}
override public func isExcluded() -> Bool {
guard let filterComparisonType = self.filterComparisonType else { return false }
switch filterComparisonType {
case .Excludes(_, _):
return true
default:
return false
}
}
}
// Syntactic sugar for creating a function comparison filter
public class FunctionFilterFactory {
public static func startsWith(_ prefixes: String..., caseSensitive: Bool = false,
required: Bool = false, minLevel: SwiftyBeaver.Level = .verbose) -> FilterType {
return CompareFilter(.Function(.StartsWith(prefixes, caseSensitive)), required: required, minLevel: minLevel)
}
public static func contains(_ strings: String..., caseSensitive: Bool = false,
required: Bool = false, minLevel: SwiftyBeaver.Level = .verbose) -> FilterType {
return CompareFilter(.Function(.Contains(strings, caseSensitive)), required: required, minLevel: minLevel)
}
public static func excludes(_ strings: String..., caseSensitive: Bool = false,
required: Bool = false, minLevel: SwiftyBeaver.Level = .verbose) -> FilterType {
return CompareFilter(.Function(.Excludes(strings, caseSensitive)), required: required, minLevel: minLevel)
}
public static func endsWith(_ suffixes: String..., caseSensitive: Bool = false,
required: Bool = false, minLevel: SwiftyBeaver.Level = .verbose) -> FilterType {
return CompareFilter(.Function(.EndsWith(suffixes, caseSensitive)), required: required, minLevel: minLevel)
}
public static func equals(_ strings: String..., caseSensitive: Bool = false,
required: Bool = false, minLevel: SwiftyBeaver.Level = .verbose) -> FilterType {
return CompareFilter(.Function(.Equals(strings, caseSensitive)), required: required, minLevel: minLevel)
}
}
// Syntactic sugar for creating a message comparison filter
public class MessageFilterFactory {
public static func startsWith(_ prefixes: String..., caseSensitive: Bool = false,
required: Bool = false, minLevel: SwiftyBeaver.Level = .verbose) -> FilterType {
return CompareFilter(.Message(.StartsWith(prefixes, caseSensitive)), required: required, minLevel: minLevel)
}
public static func contains(_ strings: String..., caseSensitive: Bool = false,
required: Bool = false, minLevel: SwiftyBeaver.Level = .verbose) -> FilterType {
return CompareFilter(.Message(.Contains(strings, caseSensitive)), required: required, minLevel: minLevel)
}
public static func excludes(_ strings: String..., caseSensitive: Bool = false,
required: Bool = false, minLevel: SwiftyBeaver.Level = .verbose) -> FilterType {
return CompareFilter(.Message(.Excludes(strings, caseSensitive)), required: required, minLevel: minLevel)
}
public static func endsWith(_ suffixes: String..., caseSensitive: Bool = false,
required: Bool = false, minLevel: SwiftyBeaver.Level = .verbose) -> FilterType {
return CompareFilter(.Message(.EndsWith(suffixes, caseSensitive)), required: required, minLevel: minLevel)
}
public static func equals(_ strings: String..., caseSensitive: Bool = false,
required: Bool = false, minLevel: SwiftyBeaver.Level = .verbose) -> FilterType {
return CompareFilter(.Message(.Equals(strings, caseSensitive)), required: required, minLevel: minLevel)
}
}
// Syntactic sugar for creating a path comparison filter
public class PathFilterFactory {
public static func startsWith(_ prefixes: String..., caseSensitive: Bool = false,
required: Bool = false, minLevel: SwiftyBeaver.Level = .verbose) -> FilterType {
return CompareFilter(.Path(.StartsWith(prefixes, caseSensitive)), required: required, minLevel: minLevel)
}
public static func contains(_ strings: String..., caseSensitive: Bool = false,
required: Bool = false, minLevel: SwiftyBeaver.Level = .verbose) -> FilterType {
return CompareFilter(.Path(.Contains(strings, caseSensitive)), required: required, minLevel: minLevel)
}
public static func excludes(_ strings: String..., caseSensitive: Bool = false,
required: Bool = false, minLevel: SwiftyBeaver.Level = .verbose) -> FilterType {
return CompareFilter(.Path(.Excludes(strings, caseSensitive)), required: required, minLevel: minLevel)
}
public static func endsWith(_ suffixes: String..., caseSensitive: Bool = false,
required: Bool = false, minLevel: SwiftyBeaver.Level = .verbose) -> FilterType {
return CompareFilter(.Path(.EndsWith(suffixes, caseSensitive)), required: required, minLevel: minLevel)
}
public static func equals(_ strings: String..., caseSensitive: Bool = false,
required: Bool = false, minLevel: SwiftyBeaver.Level = .verbose) -> FilterType {
return CompareFilter(.Path(.Equals(strings, caseSensitive)), required: required, minLevel: minLevel)
}
}
extension Filter.TargetType: Equatable {
}
// The == does not compare associated values for each enum. Instead == evaluates to true
// if both enums are the same "types", ignoring the associated values of each enum
public func == (lhs: Filter.TargetType, rhs: Filter.TargetType) -> Bool {
switch (lhs, rhs) {
case (.Path(_), .Path(_)):
return true
case (.Function(_), .Function(_)):
return true
case (.Message(_), .Message(_)):
return true
default:
return false
}
}
| 6cd1b3f17734f2cb58497f535a4fa3a5 | 39.643123 | 117 | 0.642916 | false | false | false | false |
clark-new/Animated | refs/heads/master | swiftSnows/swiftSnows/ViewController.swift | mit | 1 | //
// ViewController.swift
// swiftSnows
//
// Created by Clark on 2017/2/23.
// Copyright © 2017年 Clark. All rights reserved.
//
import UIKit
class ViewController: UIViewController {
override func viewDidLoad() {
super.viewDidLoad()
let snowEmitter = CAEmitterLayer()
snowEmitter.emitterPosition = CGPoint(x: self.view.bounds.size.width/2.0, y: -30)
snowEmitter.emitterSize = CGSize(width: self.view.bounds.size.width * 2.0, height: 0.0)
snowEmitter.emitterShape = kCAEmitterLayerLine
snowEmitter.emitterMode = kCAEmitterLayerOutline
let snowflake = CAEmitterCell()
snowflake.birthRate = 1.0
snowflake.lifetime = 120.0
snowflake.velocity = -10
snowflake.velocityRange = 10
snowflake.yAcceleration = 2
snowflake.emissionRange = CGFloat(0.5 * M_PI)
snowflake.spinRange = CGFloat(0.25 * M_PI)
snowflake.contents = UIImage(named: "snow")?.cgImage
snowflake.color = UIColor(red: 0.600, green: 0.658, blue: 0.743, alpha: 1.000).cgColor
snowEmitter.shadowOpacity = 1.0
snowEmitter.shadowRadius = 0.0
snowEmitter.shadowOffset = CGSize(width: 0.0, height: 1.0)
snowEmitter.shadowColor = UIColor.white.cgColor
snowEmitter.emitterCells = Array(arrayLiteral: snowflake)
view.layer.insertSublayer(snowEmitter, at: 0)
}
override func didReceiveMemoryWarning() {
super.didReceiveMemoryWarning()
// Dispose of any resources that can be recreated.
}
}
| a9b5208469405cc025bd298e39a8c47c | 30.86 | 95 | 0.650973 | false | false | false | false |
mogstad/liechtensteinklamm | refs/heads/master | example/view_controller.swift | mit | 1 | import UIKit
class ViewController: UIViewController {
let label = UILabel(frame: .zero)
let index: Int
init(index: Int) {
self.index = index
super.init(nibName: nil, bundle: nil)
}
required init?(coder: NSCoder) {
fatalError("init(coder:) has not been implemented")
}
override func viewDidLoad() {
super.viewDidLoad()
self.title = "View \(index)"
self.label.text = "\(index)"
self.label.font = UIFont.systemFontOfSize(70, weight: UIFontWeightThin)
self.label.textColor = UIColor.lightGrayColor()
self.label.sizeToFit()
self.view.addSubview(self.label)
self.view.addConstraintsForCenteredSubview(self.label)
self.view.backgroundColor = UIColor.greenColor()
if let button = self.splitViewController?.displayModeButtonItem() {
self.navigationItem.leftBarButtonItem = button
self.navigationItem.leftItemsSupplementBackButton = true
}
}
}
| b374bf4e99c58de7223537eb2d26c510 | 24.861111 | 75 | 0.701396 | false | false | false | false |
ludagoo/Perfect | refs/heads/master | Examples/Authenticator/Authenticator Client/LoginViewController.swift | agpl-3.0 | 2 | //
// LoginViewController.swift
// Authenticator
//
// Created by Kyle Jessup on 2015-11-12.
// Copyright © 2015 PerfectlySoft. All rights reserved.
//
// This program is free software: you can redistribute it and/or modify
// it under the terms of the GNU Affero General Public License as
// published by the Free Software Foundation, either version 3 of the
// License, or (at your option) any later version, as supplemented by the
// Perfect Additional Terms.
//
// This program is distributed in the hope that it will be useful,
// but WITHOUT ANY WARRANTY; without even the implied warranty of
// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
// GNU Affero General Public License, as supplemented by the
// Perfect Additional Terms, for more details.
//
// You should have received a copy of the GNU Affero General Public License
// and the Perfect Additional Terms that immediately follow the terms and
// conditions of the GNU Affero General Public License along with this
// program. If not, see <http://www.perfect.org/AGPL_3_0_With_Perfect_Additional_Terms.txt>.
//
import UIKit
let LOGIN_SEGUE_ID = "loginSegue"
class LoginViewController: UIViewController, NSURLSessionDelegate, UITextFieldDelegate {
@IBOutlet var emailAddressText: UITextField?
@IBOutlet var passwordText: UITextField?
var message = ""
override func viewDidLoad() {
super.viewDidLoad()
// Do any additional setup after loading the view.
self.emailAddressText?.delegate = self
self.passwordText?.delegate = self
}
override func didReceiveMemoryWarning() {
super.didReceiveMemoryWarning()
// Dispose of any resources that can be recreated.
}
override func shouldPerformSegueWithIdentifier(identifier: String, sender: AnyObject?) -> Bool {
if identifier == LOGIN_SEGUE_ID {
// start login process
tryLogin()
return false
}
return true
}
// In a storyboard-based application, you will often want to do a little preparation before navigation
override func prepareForSegue(segue: UIStoryboardSegue, sender: AnyObject?) {
if let dest = segue.destinationViewController as? ResultViewController {
dest.message = self.message
}
}
func tryLogin() {
let urlSessionDelegate = URLSessionDelegate(username: self.emailAddressText!.text!, password: self.passwordText!.text!) {
(d:NSData?, res:NSURLResponse?, e:NSError?) -> Void in
if let _ = e {
self.message = "Failed with error \(e!)"
} else if let httpRes = res as? NSHTTPURLResponse where httpRes.statusCode != 200 {
self.message = "Failed with HTTP code \(httpRes.statusCode)"
} else {
let deserialized = try! NSJSONSerialization.JSONObjectWithData(d!, options: NSJSONReadingOptions.AllowFragments)
self.message = "Logged in \(deserialized["firstName"]!!) \(deserialized["lastName"]!!)"
}
dispatch_async(dispatch_get_main_queue()) {
self.performSegueWithIdentifier(LOGIN_SEGUE_ID, sender: nil)
}
}
let sessionConfig = NSURLSession.sharedSession().configuration
let session = NSURLSession(configuration: sessionConfig, delegate: urlSessionDelegate, delegateQueue: nil)
let req = NSMutableURLRequest(URL: NSURL(string: END_POINT + "login")!)
req.addValue("application/json", forHTTPHeaderField: "Accept")
let task = session.dataTaskWithRequest(req)
task.resume()
}
func textFieldShouldReturn(textField: UITextField) -> Bool {
textField.resignFirstResponder()
return true
}
}
| fde8652ca6b6227726d955d54e9ba0ca | 33.495146 | 123 | 0.720799 | false | false | false | false |
qingtianbuyu/Mono | refs/heads/master | Moon/Classes/Main/Model/MNCollection.swift | mit | 1 | //
// MNCollection.swift
// Moon
//
// Created by YKing on 16/6/4.
// Copyright © 2016年 YKing. All rights reserved.
//
import UIKit
class MNCollection: NSObject {
var thumb: MNThumb?
var banner_img_url: String?
var title: String?
var id: Int = 0
var is_program: Bool = false
var content_num: Int = 0
var logo_url: String?
var type: String?
var fav_num: Int = 0
var banner_img_url_thumb: MNThumb?
var logo_url_thumb: MNThumb?
init(dict: [String: AnyObject]) {
super.init()
setValuesForKeys(dict)
}
override func setValue(_ value: Any?, forKey key: String) {
if key == "thumb" {
thumb = MNThumb(dict: value as! [String: AnyObject])
return
}
if key == "logo_url_thumb" {
logo_url_thumb = MNThumb(dict: value as! [String: AnyObject])
return
}
if key == "banner_img_url_thumb" {
banner_img_url_thumb = MNThumb(dict: value as! [String: AnyObject])
return
}
super.setValue(value, forKey: key)
}
}
| b86bf6e18773b970472f977448e324ac | 19.918367 | 73 | 0.607805 | false | false | false | false |
insidegui/WWDC | refs/heads/master | WWDC/FeaturedCommunityCollectionViewItem.swift | bsd-2-clause | 1 | //
// FeaturedCommunityCollectionViewItem.swift
// WWDC
//
// Created by Guilherme Rambo on 01/06/20.
// Copyright © 2020 Guilherme Rambo. All rights reserved.
//
import Cocoa
final class FeaturedCommunityCollectionViewItem: NSCollectionViewItem {
var clickHandler: () -> Void = { }
var newsItem: CommunityNewsItemViewModel? {
didSet {
guard newsItem != oldValue else { return }
updateUI()
}
}
private lazy var titleLabel: NSTextField = {
let v = NSTextField(labelWithString: "")
v.font = NSFont.wwdcRoundedSystemFont(ofSize: 24, weight: .semibold)
v.textColor = .primaryText
v.setContentCompressionResistancePriority(.required, for: .vertical)
v.translatesAutoresizingMaskIntoConstraints = false
v.allowsDefaultTighteningForTruncation = true
v.maximumNumberOfLines = 1
v.lineBreakMode = .byTruncatingTail
v.isSelectable = false
return v
}()
private static let placeholderImage: NSImage? = {
NSImage(named: .init("featured-placeholder"))
}()
private lazy var imageContainerView: NSView = {
let v = NSView()
v.translatesAutoresizingMaskIntoConstraints = false
return v
}()
private lazy var imageLayer: CALayer = {
let l = CALayer()
l.contentsGravity = .resizeAspectFill
l.contents = Self.placeholderImage
return l
}()
private var imageDownloadOperation: Operation?
override func loadView() {
view = NSView()
view.wantsLayer = true
view.layer?.backgroundColor = NSColor.contentBackground.cgColor
view.addSubview(titleLabel)
view.addSubview(imageContainerView)
imageLayer.frame = imageContainerView.bounds
imageContainerView.wantsLayer = true
imageContainerView.layer?.cornerRadius = 8
imageContainerView.layer?.masksToBounds = true
imageContainerView.layer?.cornerCurve = .continuous
imageContainerView.layer?.addSublayer(imageLayer)
NSLayoutConstraint.activate([
titleLabel.leadingAnchor.constraint(equalTo: view.leadingAnchor),
titleLabel.trailingAnchor.constraint(equalTo: view.trailingAnchor),
titleLabel.topAnchor.constraint(equalTo: view.topAnchor),
imageContainerView.leadingAnchor.constraint(equalTo: view.leadingAnchor),
imageContainerView.trailingAnchor.constraint(equalTo: view.trailingAnchor),
imageContainerView.topAnchor.constraint(equalTo: titleLabel.bottomAnchor, constant: 12),
imageContainerView.heightAnchor.constraint(equalToConstant: 166)
])
let click = NSClickGestureRecognizer(target: self, action: #selector(clicked))
view.addGestureRecognizer(click)
}
@objc private func clicked() {
clickHandler()
}
override func viewDidLayout() {
super.viewDidLayout()
imageLayer.frame = imageContainerView.bounds
}
private func updateUI() {
guard let item = newsItem, let imageUrl = item.image else { return }
imageLayer.contents = Self.placeholderImage
imageDownloadOperation?.cancel()
imageDownloadOperation = ImageDownloadCenter.shared.downloadImage(from: imageUrl, thumbnailHeight: Constants.thumbnailHeight) { [weak self] url, result in
guard let self = self else { return }
guard url == imageUrl, result.original != nil else { return }
self.imageLayer.contents = result.original
}
titleLabel.stringValue = item.title
titleLabel.toolTip = item.title
}
}
| 93010c62cfed486e2fce37c6dd4fd2ea | 29.991597 | 162 | 0.670282 | false | false | false | false |
xiaowinner/YXWShineButton | refs/heads/master | YXWShineButton.swift | mit | 1 | import UIKit
@objc public class YXWShineButton: UIControl {
/// 更多的配置参数
public var params: YXWShineParams {
didSet {
clickLayer.animDuration = params.animDuration/3
shineLayer.params = params
}
}
/// 未点击的颜色
public var color: UIColor = UIColor.lightGray {
willSet {
clickLayer.color = newValue
}
}
/// 点击后的颜色
public var fillColor: UIColor = UIColor(rgb: (255, 102, 102)) {
willSet {
clickLayer.fillColor = newValue
shineLayer.fillColor = newValue
}
}
/// button的图片
public var image: YXWShineImage = .heart {
willSet {
clickLayer.image = newValue
}
}
/// 是否点击的状态
public override var isSelected:Bool {
didSet {
clickLayer.clicked = isSelected
}
}
public var currentSelected:Bool = false {
willSet {
clickLayer.clicked = currentSelected
}
}
private var clickLayer = YXWShineClickLayer()
private var shineLayer = YXWShineLayer()
//MARK: Initial Methods
public init(frame: CGRect, params: YXWShineParams) {
self.params = params
super.init(frame: frame)
initLayers()
}
public override init(frame: CGRect) {
params = YXWShineParams()
super.init(frame: frame)
initLayers()
}
required public init?(coder aDecoder: NSCoder) {
params = YXWShineParams()
super.init(coder: aDecoder)
layoutIfNeeded()
initLayers()
}
public override func sendActions(for controlEvents: UIControlEvents) {
super.sendActions(for: controlEvents)
weak var weakSelf = self
if clickLayer.clicked == false {
shineLayer.endAnim = { Void in
weakSelf?.clickLayer.clicked = !(weakSelf?.clickLayer.clicked ?? false)
weakSelf?.clickLayer.startAnim()
weakSelf?.currentSelected = weakSelf?.clickLayer.clicked ?? false
}
shineLayer.startAnim()
}else {
clickLayer.clicked = !clickLayer.clicked
currentSelected = clickLayer.clicked
}
}
//MARK: Override
override public func touchesEnded(_ touches: Set<UITouch>, with event: UIEvent?) {
super.touchesEnded(touches, with: event)
weak var weakSelf = self
if clickLayer.clicked == false {
shineLayer.endAnim = { Void in
weakSelf?.clickLayer.clicked = !(weakSelf?.clickLayer.clicked ?? false)
weakSelf?.clickLayer.startAnim()
weakSelf?.currentSelected = weakSelf?.clickLayer.clicked ?? false
}
shineLayer.startAnim()
}else {
clickLayer.clicked = !clickLayer.clicked
currentSelected = clickLayer.clicked
}
}
//MARK: Privater Methods
private func initLayers() {
clickLayer.animDuration = params.animDuration/3
shineLayer.params = params
clickLayer.frame = bounds
shineLayer.frame = bounds
layer.addSublayer(clickLayer)
layer.addSublayer(shineLayer)
}
}
| 83b07eb901e724830c32b06e6d29d281 | 25.230769 | 87 | 0.553079 | false | false | false | false |
alblue/swift | refs/heads/master | test/stmt/yield.swift | apache-2.0 | 9 | // RUN: %target-typecheck-verify-swift
struct YieldRValue {
var property: String {
_read {
yield "hello"
}
}
}
struct YieldVariables {
var property: String {
_read {
yield ""
}
_modify {
var x = ""
yield &x
}
}
var wrongTypes: String {
_read {
yield 0 // expected-error {{cannot convert value of type 'Int' to expected yield type 'String'}}
}
_modify {
var x = 0
yield &x // expected-error {{cannot yield immutable value of type 'Int' as an inout yield of type 'String'}}
}
}
var rvalue: String {
get {}
_modify {
yield &"" // expected-error {{cannot yield immutable value of type 'String' as an inout yield}}
}
}
var missingAmp: String {
get {}
_modify {
var x = ""
yield x // expected-error {{yielding mutable value of type 'String' requires explicit '&'}}
}
}
}
protocol HasProperty {
associatedtype Value
var property: Value { get set }
}
struct GenericTypeWithYields<T> : HasProperty {
var storedProperty: T?
var property: T {
_read {
yield storedProperty!
}
_modify {
yield &storedProperty!
}
}
subscript<U>(u: U) -> (T,U) {
_read {
yield ((storedProperty!, u))
}
_modify {
var temp = (storedProperty!, u)
yield &temp
}
}
}
// 'yield' is a context-sensitive keyword.
func yield(_: Int) {}
func call_yield() {
yield(0)
}
struct YieldInDefer {
var property: String {
_read {
defer { // expected-warning {{'defer' statement before end of scope always executes immediately}}{{7-12=do}}
// FIXME: this recovery is terrible
yield ""
// expected-error@-1 {{expression resolves to an unused function}}
// expected-error@-2 {{consecutive statements on a line must be separated by ';'}}
// expected-warning@-3 {{string literal is unused}}
}
}
}
}
| 75d2c36798376979c3da74884cc25bd9 | 19.638298 | 114 | 0.580412 | false | false | false | false |
hjanuschka/fastlane | refs/heads/master | fastlane/swift/main.swift | mit | 1 | //
// main.swift
// FastlaneSwiftRunner
//
// Created by Joshua Liebowitz on 8/26/17.
// Copyright © 2017 Joshua Liebowitz. All rights reserved.
//
import Foundation
let argumentProcessor = ArgumentProcessor(args: CommandLine.arguments)
let timeout = argumentProcessor.commandTimeout
class MainProcess {
var doneRunningLane = false
var thread: Thread!
@objc func connectToFastlaneAndRunLane() {
runner.startSocketThread()
let completedRun = Fastfile.runLane(named: argumentProcessor.currentLane, parameters: argumentProcessor.laneParameters())
if completedRun {
runner.disconnectFromFastlaneProcess()
}
doneRunningLane = true
}
func startFastlaneThread() {
thread = Thread(target: self, selector: #selector(connectToFastlaneAndRunLane), object: nil)
thread.name = "worker thread"
thread.start()
}
}
let process: MainProcess = MainProcess()
process.startFastlaneThread()
while (!process.doneRunningLane && (RunLoop.current.run(mode: RunLoopMode.defaultRunLoopMode, before: Date(timeIntervalSinceNow: 2)))) {
// no op
}
// Please don't remove the lines below
// They are used to detect outdated files
// FastlaneRunnerAPIVersion [0.9.2]
| c5f8ca4ea3b5e52ec669c41f25f3833a | 27.377778 | 136 | 0.700078 | false | false | false | false |
ap4y/JsonSerialize | refs/heads/master | JSONSerialize/JSONDecoder.swift | mit | 1 | public class JSONDecoder {
var stack: [JSON]
public init(json: JSON) {
stack = [json]
}
public convenience init(jsonString: String) {
self.init(json: JSON.jsonWithJSONString(jsonString))
}
public func readObject<T>(block: () -> T?) -> T? {
let value = block()
pop()
return value
}
public func readValueForKey<T: JSONDecodable>(key: String) -> T? {
let json = stack[stack.endIndex - 1]
if let value = json.object?[key] {
stack.append(value)
return T.decode(self)
}
return nil
}
public func readArrayForKey<T: JSONDecodable>(key: String) -> [T]? {
let json = stack[stack.endIndex - 1]
if let value = json.object?[key] {
switch value {
case let .Array(array):
var result = [T]()
for item in array {
stack.append(item)
if let item = T.decode(self) { result.append(item) }
}
return result
default:
return nil
}
}
return nil
}
public func readDictionaryForKey<V: JSONDecodable>(key: String) -> [String: V]? {
let json = stack[stack.endIndex - 1]
if let value = json.object?[key] {
switch value {
case let .Object(object):
var result = Dictionary<String, V>()
for (key, item) in object {
stack.append(item)
if let value = V.decode(self) {
result[key as String] = value
}
}
return result
default:
return nil
}
}
return nil
}
func pop() -> JSON {
return stack.removeLast()
}
}
| 3aed97e8c02c5fdb97d39777bd285916 | 25.56338 | 85 | 0.469247 | false | false | false | false |
Panl/Gank.lu | refs/heads/master | Gank.lu/UIKit/PageViewUI.swift | gpl-3.0 | 1 | //
// PageViewUI.swift
// Gank.lu
//
// Created by Lei Pan on 2020/3/24.
// Copyright © 2020 smartalker. All rights reserved.
//
import SwiftUI
import UIKit
import struct Kingfisher.KFImage
import struct Kingfisher.DownsamplingImageProcessor
struct PageViewUI: UIViewControllerRepresentable {
var controllers: [UIViewController]
@Binding var currentPage: Int
func makeCoordinator() -> PageViewUI.Coordinator {
Coordinator(self)
}
func makeUIViewController(context: Context) -> UIPageViewController {
let pageViewController = UIPageViewController(
transitionStyle: .scroll,
navigationOrientation: .horizontal)
pageViewController.dataSource = context.coordinator
pageViewController.delegate = context.coordinator
return pageViewController
}
func updateUIViewController(_ pageViewController: UIPageViewController, context: Context) {
pageViewController.setViewControllers(
[controllers[currentPage]], direction: .forward, animated: true)
}
class Coordinator: NSObject, UIPageViewControllerDataSource, UIPageViewControllerDelegate {
var parent: PageViewUI
init(_ pageViewUI: PageViewUI) {
self.parent = pageViewUI
}
func pageViewController(
_ pageViewController: UIPageViewController,
viewControllerBefore viewController: UIViewController) -> UIViewController?
{
guard let index = parent.controllers.firstIndex(of: viewController) else {
return nil
}
if index == 0 {
return parent.controllers.last
}
return parent.controllers[index - 1]
}
func pageViewController(
_ pageViewController: UIPageViewController,
viewControllerAfter viewController: UIViewController) -> UIViewController?
{
guard let index = parent.controllers.firstIndex(of: viewController) else {
return nil
}
if index + 1 == parent.controllers.count {
return parent.controllers.first
}
return parent.controllers[index + 1]
}
func pageViewController(_ pageViewController: UIPageViewController, didFinishAnimating finished: Bool, previousViewControllers: [UIViewController], transitionCompleted completed: Bool) {
if completed,
let visibleViewController = pageViewController.viewControllers?.first,
let index = parent.controllers.firstIndex(of: visibleViewController)
{
parent.currentPage = index
}
}
}
}
struct BannerCard: View {
var url: String
var title: String
init(url: String, title: String) {
self.url = url
self.title = title
}
var body: some View {
HStack {
ZStack(alignment: .bottomLeading) {
KFImage(URL(string: url), options: [
.transition(.fade(0.2)),
.processor(
DownsamplingImageProcessor(size: CGSize(width: 375 * 1.5, height: 180 * 1.5))
),
.cacheOriginalImage
])
.resizable()
.aspectRatio(contentMode: .fill)
.frame(height: 180)
LinearGradient(gradient: Gradient(colors: [.clear, Color.black.opacity(0.6)]), startPoint: .top, endPoint: .bottom)
.cornerRadius(8)
Text(title).font(.headline)
.fontWeight(.semibold)
.padding(EdgeInsets.init(top: 0, leading: 16, bottom: 32, trailing: 16)).foregroundColor(.white)
}
.cornerRadius(8)
.shadow(radius: 4)
}.padding(16)
}
}
struct PageView<Page: View>: View {
var viewControllers: [UIHostingController<Page>]
@State var currentPage = 0
init(_ views: [Page]) {
self.viewControllers = views.map { UIHostingController(rootView: $0) }
}
var body: some View {
ZStack(alignment: .bottom) {
PageViewUI(controllers: viewControllers, currentPage: $currentPage)
.frame(maxWidth: .infinity, minHeight: 196, alignment: .center)
PageControl(numberOfPages: viewControllers.count, currentPage: $currentPage)
.padding(.trailing)
}
}
}
var features = [1, 2, 3]
struct PageView_Previews: PreviewProvider {
static var previews: some View {
PageView(features.map { _ in BannerCard(url: "", title: "-念念不忘，必有回响, -念念不忘，必有回响") })
}
}
| 7bd0640efd5ade12e6bf5b21f5a254f7 | 29.333333 | 190 | 0.678691 | false | false | false | false |
fernandomarins/food-drivr-pt | refs/heads/master | hackathon-for-hunger/Modules/Driver/Dashboards/Views/DonationHistoryViewController.swift | mit | 1 | //
// DonationHistoryViewController.swift
// hackathon-for-hunger
//
// Created by Ian Gristock on 20/05/2016.
// Copyright © 2016 Hacksmiths. All rights reserved.
//
import UIKit
import RealmSwift
class DonationHistoryViewController: UIViewController {
@IBOutlet weak var noDonationsView: UIView!
@IBOutlet weak var imageView: UIImageView!
@IBOutlet weak var tableView: UITableView!
private var refreshControl: UIRefreshControl!
var activityIndicator : ActivityIndicatorView!
private let dashboardPresenter = DashboardPresenter(donationService: DonationService())
var pendingDonations: Results<Donation>?
@IBOutlet weak var refreshTriggered: UIButton!
@IBAction func refreshDonations(sender: AnyObject) {
self.refresh(self)
}
override func viewDidLoad() {
self.refreshTriggered.layer.cornerRadius = 0.5 * self.refreshTriggered.bounds.width
self.refreshTriggered.layer.shadowColor = UIColor.blackColor().CGColor
self.refreshTriggered.layer.shadowOffset = CGSizeMake(2, 2)
self.refreshTriggered.layer.shadowRadius = 2
self.refreshTriggered.layer.shadowOpacity = 0.5
super.viewDidLoad()
noDonationsView.hidden = true
dashboardPresenter.attachView(self)
activityIndicator = ActivityIndicatorView(inview: self.view, messsage: "Syncing")
refreshControl = UIRefreshControl()
refreshControl.addTarget(self, action: #selector(PendingDonationsDashboard.refresh(_:)), forControlEvents: UIControlEvents.ValueChanged)
tableView.addSubview(refreshControl)
}
override func viewWillAppear(animated: Bool) {
super.viewWillAppear(animated)
dashboardPresenter.fetch([DonationStatus.DroppedOff.rawValue, DonationStatus.Suspended.rawValue ])
}
func refresh(sender: AnyObject) {
self.startLoading()
dashboardPresenter.fetchRemotely([DonationStatus.DroppedOff.rawValue, DonationStatus.Suspended.rawValue])
refreshControl?.endRefreshing()
}
override func prepareForSegue(segue: UIStoryboardSegue, sender: AnyObject?) {
if (segue.identifier == "toDriverMapDetailPendingFromDashboard") {
if let donation = sender as? Donation {
let donationVC = segue.destinationViewController as! DriverMapDetailPendingVC
donationVC.mapViewPresenter = MapViewPresenter(donationService: DonationService(), donation: donation)
}
}
if (segue.identifier == "acceptedDonation") {
if let donation = sender as? Donation {
let donationVC = segue.destinationViewController as! DriverMapPickupVC
donationVC.donation = donation
}
}
}
deinit {
print("DEINITIALIZING")
}
}
extension DonationHistoryViewController: UITableViewDelegate, UITableViewDataSource {
func tableView(tableView: UITableView, numberOfRowsInSection section: Int) -> Int {
return pendingDonations?.count ?? 0
}
func tableView(tableView: UITableView, cellForRowAtIndexPath indexPath: NSIndexPath) -> UITableViewCell {
let identifier = "pendingDonation"
let cell = tableView.dequeueReusableCellWithIdentifier(identifier, forIndexPath: indexPath) as! PendingDonationsDashboardTableViewCell
cell.indexPath = indexPath
cell.information = pendingDonations![indexPath.row]
cell.selectionStyle = .None;
return cell
}
func tableView(tableView: UITableView, willDisplayCell cell: UITableViewCell, forRowAtIndexPath indexPath: NSIndexPath) {
cell.layer.transform = CATransform3DMakeScale(0.1,0.1,1)
UIView.animateWithDuration(0.25, animations: {
cell.layer.transform = CATransform3DMakeScale(1,1,1)
})
}
func tableView(tableView: UITableView, didSelectRowAtIndexPath indexPath: NSIndexPath) {
}
}
extension DonationHistoryViewController: DashboardView {
func startLoading() {
self.activityIndicator.startAnimating()
}
func finishLoading() {
self.activityIndicator.stopAnimating()
self.activityIndicator.title = "Syncing"
}
func donations(sender: DashboardPresenter, didSucceed donations: Results<Donation>) {
self.finishLoading()
self.pendingDonations = donations
if(donations.isEmpty) {
self.tableView.hidden = true
self.noDonationsView.hidden = false
} else {
self.tableView.hidden = false
self.noDonationsView.hidden = true
self.tableView.reloadData()
}
}
func donations(sender: DashboardPresenter, didFail error: NSError) {
self.finishLoading()
if error.code == 401 {
let refreshAlert = UIAlertController(title: "Unable To Sync.", message: "Your session has expired. Please log back in", preferredStyle: UIAlertControllerStyle.Alert)
refreshAlert.addAction(UIAlertAction(title: "Ok", style: .Default, handler: { (action: UIAlertAction!) in
self.logout()
}))
presentViewController(refreshAlert, animated: true, completion: nil)
}
}
func donationStatusUpdate(sender: DashboardPresenter, didSucceed donation: Donation) {
self.finishLoading()
let index = pendingDonations!.indexOf(donation)
self.performSegueWithIdentifier("acceptedDonation", sender: donation)
let indexPath = NSIndexPath(forRow: index!, inSection: 0)
self.tableView.deleteRowsAtIndexPaths([indexPath], withRowAnimation: UITableViewRowAnimation.Automatic)
}
func donationStatusUpdate(sender: DashboardPresenter, didFail error: NSError) {
self.finishLoading()
if error.code == 401 {
let refreshAlert = UIAlertController(title: "Unable To Sync.", message: "Your session has expired. Please log back in", preferredStyle: UIAlertControllerStyle.Alert)
refreshAlert.addAction(UIAlertAction(title: "Ok", style: .Default, handler: { (action: UIAlertAction!) in
self.logout()
}))
presentViewController(refreshAlert, animated: true, completion: nil)
} else {
let refreshAlert = UIAlertController(title: "Unable To Accept.", message: "Donation might have already been accepted. Resync your donations?.", preferredStyle: UIAlertControllerStyle.Alert)
refreshAlert.addAction(UIAlertAction(title: "Ok", style: .Default, handler: { (action: UIAlertAction!) in
self.startLoading()
self.dashboardPresenter.fetchRemotely([DonationStatus.Pending.rawValue])
}))
refreshAlert.addAction(UIAlertAction(title: "Cancel", style: .Default, handler: { (action: UIAlertAction!) in
}))
presentViewController(refreshAlert, animated: true, completion: nil)
}
}
}
| e263fe7908dbd91c9a9d1ec96345858c | 39.890805 | 201 | 0.673085 | false | false | false | false |
jhwayne/Minimo | refs/heads/master | SwifferApp/SwifferApp/ComposeViewController.swift | mit | 1 | //
// ComposeViewController.swift
// SwifferApp
//
// Created by Training on 29/06/14.
// Copyright (c) 2014 Training. All rights reserved.
//
import UIKit
class ComposeViewController: UIViewController, UITextViewDelegate {
@IBOutlet var sweetTextView: UITextView! = UITextView()
@IBOutlet var charRemainingLabel: UILabel! = UILabel()
override init(nibName nibNameOrNil: String?, bundle nibBundleOrNil: NSBundle?) {
super.init(nibName: nibNameOrNil, bundle: nibBundleOrNil)
// Custom initialization
}
required init(coder aDecoder: NSCoder) {
super.init(coder: aDecoder)
}
override func viewDidLoad() {
super.viewDidLoad()
sweetTextView.layer.borderColor = UIColor.blackColor().CGColor
sweetTextView.layer.borderWidth = 0.5
sweetTextView.layer.cornerRadius = 5
sweetTextView.delegate = self
sweetTextView.becomeFirstResponder()
// Do any additional setup after loading the view.
}
override func didReceiveMemoryWarning() {
super.didReceiveMemoryWarning()
// Dispose of any resources that can be recreated.
}
@IBAction func sendSweet(sender: AnyObject) {
var query = PFQuery(className:"Posts")
query.whereKey("DisplayToday", equalTo:"Yes")
query.getFirstObjectInBackgroundWithBlock {
(object: PFObject!, error: NSError!) -> Void in
if (error != nil || object == nil) {
}
else {
// The find succeeded.
let ID = object["PostID"] as Int
var sweet:PFObject = PFObject(className: "Sweets")
sweet["content"] = self.sweetTextView.text
sweet["sweeter"] = PFUser.currentUser()
sweet["PostID"] = ID
sweet.saveInBackground()
self.navigationController?.popToRootViewControllerAnimated(true)
}
}
}
func textView(textView: UITextView!,
shouldChangeTextInRange range: NSRange,
replacementText text: String!) -> Bool{
var newLength:Int = (textView.text as NSString).length + (text as NSString).length - range.length
var remainingChar:Int = 140 - newLength
charRemainingLabel.text = "\(remainingChar)"
return (newLength > 140) ? false : true
}
/*
// #pragma mark - Navigation
// In a storyboard-based application, you will often want to do a little preparation before navigation
override func prepareForSegue(segue: UIStoryboardSegue?, sender: AnyObject?) {
// Get the new view controller using [segue destinationViewController].
// Pass the selected object to the new view controller.
}
*/
}
| e3c1582f52a1a0ec4b3d9dcb83b4d284 | 29.5 | 109 | 0.599044 | false | false | false | false |
MaartenBrijker/project | refs/heads/back | project/External/AudioKit-master/AudioKit/Common/Nodes/Playback/Phase-Locked Vocoder/AKPhaseLockedVocoder.swift | apache-2.0 | 1 | //
// AKPhaseLockedVocoder.swift
// AudioKit
//
// Created by Aurelius Prochazka, revision history on Github.
// Copyright (c) 2016 Aurelius Prochazka. All rights reserved.
//
import AVFoundation
/// This is a phase locked vocoder. It has the ability to play back an audio
/// file loaded into an ftable like a sampler would. Unlike a typical sampler,
/// mincer allows time and pitch to be controlled separately.
///
/// - parameter audioFileURL: Location of the audio file to use.
/// - parameter position: Position in time. When non-changing it will do a spectral freeze of a the current point in time.
/// - parameter amplitude: Amplitude.
/// - parameter pitchRatio: Pitch ratio. A value of. 1 normal, 2 is double speed, 0.5 is halfspeed, etc.
///
public class AKPhaseLockedVocoder: AKNode {
// MARK: - Properties
internal var internalAU: AKPhaseLockedVocoderAudioUnit?
internal var token: AUParameterObserverToken?
private var positionParameter: AUParameter?
private var amplitudeParameter: AUParameter?
private var pitchRatioParameter: AUParameter?
/// Ramp Time represents the speed at which parameters are allowed to change
public var rampTime: Double = AKSettings.rampTime {
willSet(newValue) {
if rampTime != newValue {
internalAU?.rampTime = newValue
internalAU?.setUpParameterRamp()
}
}
}
/// Position in time. When non-changing it will do a spectral freeze of a the current point in time.
public var position: Double = 0 {
willSet(newValue) {
if position != newValue {
if internalAU!.isSetUp() {
positionParameter?.setValue(Float(newValue), originator: token!)
} else {
internalAU?.position = Float(newValue)
}
}
}
}
/// Amplitude.
public var amplitude: Double = 1 {
willSet(newValue) {
if amplitude != newValue {
if internalAU!.isSetUp() {
amplitudeParameter?.setValue(Float(newValue), originator: token!)
} else {
internalAU?.amplitude = Float(newValue)
}
}
}
}
/// Pitch ratio. A value of. 1 normal, 2 is double speed, 0.5 is halfspeed, etc.
public var pitchRatio: Double = 1 {
willSet(newValue) {
if pitchRatio != newValue {
if internalAU!.isSetUp() {
pitchRatioParameter?.setValue(Float(newValue), originator: token!)
} else {
internalAU?.pitchRatio = Float(newValue)
}
}
}
}
/// Tells whether the node is processing (ie. started, playing, or active)
public var isStarted: Bool {
return internalAU!.isPlaying()
}
private var audioFileURL: CFURL
// MARK: - Initialization
/// Initialize this Phase-Locked Vocoder node
///
/// - parameter audioFileURL: Location of the audio file to use.
/// - parameter position: Position in time. When non-changing it will do a spectral freeze of a the current point in time.
/// - parameter amplitude: Amplitude.
/// - parameter pitchRatio: Pitch ratio. A value of. 1 normal, 2 is double speed, 0.5 is halfspeed, etc.
///
public init(
audioFileURL: NSURL,
position: Double = 0,
amplitude: Double = 1,
pitchRatio: Double = 1) {
self.position = position
self.amplitude = amplitude
self.pitchRatio = pitchRatio
self.audioFileURL = audioFileURL
var description = AudioComponentDescription()
description.componentType = kAudioUnitType_Generator
description.componentSubType = 0x6d696e63 /*'minc'*/
description.componentManufacturer = 0x41754b74 /*'AuKt'*/
description.componentFlags = 0
description.componentFlagsMask = 0
AUAudioUnit.registerSubclass(
AKPhaseLockedVocoderAudioUnit.self,
asComponentDescription: description,
name: "Local AKPhaseLockedVocoder",
version: UInt32.max)
super.init()
AVAudioUnit.instantiateWithComponentDescription(description, options: []) {
avAudioUnit, error in
guard let avAudioUnitGenerator = avAudioUnit else { return }
self.avAudioNode = avAudioUnitGenerator
self.internalAU = avAudioUnitGenerator.AUAudioUnit as? AKPhaseLockedVocoderAudioUnit
AudioKit.engine.attachNode(self.avAudioNode)
}
guard let tree = internalAU?.parameterTree else { return }
positionParameter = tree.valueForKey("position") as? AUParameter
amplitudeParameter = tree.valueForKey("amplitude") as? AUParameter
pitchRatioParameter = tree.valueForKey("pitchRatio") as? AUParameter
token = tree.tokenByAddingParameterObserver {
address, value in
dispatch_async(dispatch_get_main_queue()) {
if address == self.positionParameter!.address {
self.position = Double(value)
} else if address == self.amplitudeParameter!.address {
self.amplitude = Double(value)
} else if address == self.pitchRatioParameter!.address {
self.pitchRatio = Double(value)
}
}
}
internalAU?.position = Float(position)
internalAU?.amplitude = Float(amplitude)
internalAU?.pitchRatio = Float(pitchRatio)
}
// MARK: - Control
/// Function to start, play, or activate the node, all do the same thing
public func start() {
Exit: do {
var err: OSStatus = noErr
var theFileLengthInFrames: Int64 = 0
var theFileFormat: AudioStreamBasicDescription = AudioStreamBasicDescription()
var thePropertySize: UInt32 = UInt32(strideofValue(theFileFormat))
var extRef: ExtAudioFileRef = nil
var theData: UnsafeMutablePointer<CChar> = nil
var theOutputFormat: AudioStreamBasicDescription = AudioStreamBasicDescription()
err = ExtAudioFileOpenURL(self.audioFileURL, &extRef)
if err != 0 { print("ExtAudioFileOpenURL FAILED, Error = \(err)"); break Exit }
// Get the audio data format
err = ExtAudioFileGetProperty(extRef, kExtAudioFileProperty_FileDataFormat, &thePropertySize, &theFileFormat)
if err != 0 { print("ExtAudioFileGetProperty(kExtAudioFileProperty_FileDataFormat) FAILED, Error = \(err)"); break Exit }
if theFileFormat.mChannelsPerFrame > 2 { print("Unsupported Format, channel count is greater than stereo"); break Exit }
theOutputFormat.mSampleRate = AKSettings.sampleRate
theOutputFormat.mFormatID = kAudioFormatLinearPCM
theOutputFormat.mFormatFlags = kLinearPCMFormatFlagIsFloat
theOutputFormat.mBitsPerChannel = UInt32(strideof(Float)) * 8
theOutputFormat.mChannelsPerFrame = 1; // Mono
theOutputFormat.mBytesPerFrame = theOutputFormat.mChannelsPerFrame * UInt32(strideof(Float))
theOutputFormat.mFramesPerPacket = 1
theOutputFormat.mBytesPerPacket = theOutputFormat.mFramesPerPacket * theOutputFormat.mBytesPerFrame
// Set the desired client (output) data format
err = ExtAudioFileSetProperty(extRef, kExtAudioFileProperty_ClientDataFormat, UInt32(strideofValue(theOutputFormat)), &theOutputFormat)
if err != 0 { print("ExtAudioFileSetProperty(kExtAudioFileProperty_ClientDataFormat) FAILED, Error = \(err)"); break Exit }
// Get the total frame count
thePropertySize = UInt32(strideofValue(theFileLengthInFrames))
err = ExtAudioFileGetProperty(extRef, kExtAudioFileProperty_FileLengthFrames, &thePropertySize, &theFileLengthInFrames)
if err != 0 { print("ExtAudioFileGetProperty(kExtAudioFileProperty_FileLengthFrames) FAILED, Error = \(err)"); break Exit }
// Read all the data into memory
let dataSize = UInt32(theFileLengthInFrames) * theOutputFormat.mBytesPerFrame
theData = UnsafeMutablePointer.alloc(Int(dataSize))
if theData != nil {
var theDataBuffer: AudioBufferList = AudioBufferList()
theDataBuffer.mNumberBuffers = 1
theDataBuffer.mBuffers.mDataByteSize = dataSize
theDataBuffer.mBuffers.mNumberChannels = theOutputFormat.mChannelsPerFrame
theDataBuffer.mBuffers.mData = UnsafeMutablePointer(theData)
// Read the data into an AudioBufferList
var ioNumberFrames: UInt32 = UInt32(theFileLengthInFrames)
err = ExtAudioFileRead(extRef, &ioNumberFrames, &theDataBuffer)
if err == noErr {
// success
let data=UnsafeMutablePointer<Float>(theDataBuffer.mBuffers.mData)
internalAU?.setupAudioFileTable(data, size: ioNumberFrames)
internalAU!.start()
} else {
// failure
theData.dealloc(Int(dataSize))
theData = nil // make sure to return NULL
print("Error = \(err)"); break Exit;
}
}
}
}
/// Function to stop or bypass the node, both are equivalent
public func stop() {
internalAU!.stop()
}
}
| d97733be2424bdcfb718acadb7d51958 | 42.039648 | 147 | 0.620164 | false | false | false | false |
gvsucis/mobile-app-dev-book | refs/heads/master | iOS/ch04/TraxyApp/TraxyApp/UIViewController+Validation.swift | gpl-3.0 | 4 | //
// UIViewController+Validation.swift
// TraxyApp
//
// Created by Jonathan Engelsma on 2/7/17.
// Copyright © 2017 Jonathan Engelsma. All rights reserved.
//
import UIKit
extension UIViewController {
func isValidPassword(password: String?) -> Bool
{
guard let s = password, s.lowercased().range(of: "traxy") != nil else {
return false
}
return true
}
func isEmptyOrNil(password: String?) -> Bool
{
guard let s = password, s != "" else {
return false
}
return true
}
func isValidEmail(emailStr : String? ) -> Bool
{
var emailOk = false
if let email = emailStr {
let regex = "[A-Z0-9a-z._%+-]+@[A-Za-z0-9.-]+\\.[A-Za-z]{2,}"
let emailPredicate = NSPredicate(format:"SELF MATCHES %@", regex)
emailOk = emailPredicate.evaluate(with: email)
}
return emailOk
}
}
| 0ce1a70b787a6eedacc6033b2acae652 | 23.846154 | 79 | 0.54386 | false | false | false | false |
mdznr/Keyboard | refs/heads/master | KeyboardExtension/Spacebar.swift | mit | 2 | //
// Spacebar.swift
// Keyboard
//
// Created by Matt Zanchelli on 6/16/14.
// Copyright (c) 2014 Matt Zanchelli. All rights reserved.
//
import UIKit
class Spacebar: MetaKey {
override func refreshAppearance() {
UIView.animateWithDuration(0.18, delay: 0.0, usingSpringWithDamping: 1.0, initialSpringVelocity: 0.0, options: .BeginFromCurrentState | .AllowUserInteraction, animations: {
if self.highlighted {
self.horizontalLine.backgroundColor = self.enabledTintColor
self.horizontalLine.frame.size.height = 3
} else {
self.horizontalLine.backgroundColor = self.disabledTintColor
self.horizontalLine.frame.size.height = 1
}
// Center the line vertically
self.horizontalLine.frame.origin.y = CGRectGetMidY(self.bounds) - (self.horizontalLine.frame.size.height/2)
}, completion: nil)
}
let horizontalLine: UIView = {
let view = UIView()
view.autoresizingMask = .FlexibleWidth | .FlexibleTopMargin | .FlexibleBottomMargin
return view
}()
override init(frame: CGRect) {
super.init(frame: frame)
// Initialization code
horizontalLine.frame = CGRect(x: 0, y: CGRectGetMidY(self.bounds) - 0.5, width: self.bounds.size.width, height: 1)
self.addSubview(horizontalLine)
}
required init(coder aDecoder: NSCoder) {
super.init(coder: aDecoder)
}
}
| 72767aadf2ad48e0c071608980c8db7c | 28.733333 | 174 | 0.713752 | false | false | false | false |
lemonkey/iOS | refs/heads/master | ContactsPro/CheckBoxLayer.swift | mit | 3 | /*
Copyright (C) 2015 Apple Inc. All Rights Reserved.
See LICENSE.txt for this sample’s licensing information
Abstract:
A `CALayer` subclass that draws a check box within its layer. This is shared between ListerKit on iOS and OS X to to draw their respective `CheckBox` controls.
*/
import QuartzCore
class CheckBoxLayer: CALayer {
// MARK: Types
struct SharedColors {
static let defaultTintColor = CGColorCreate(CGColorSpaceCreateDeviceRGB(), [0.5, 0.5, 0.5])
}
// MARK: Properties
var tintColor: CGColor = SharedColors.defaultTintColor {
didSet {
setNeedsDisplay()
}
}
var isChecked: Bool = false {
didSet {
setNeedsDisplay()
}
}
var strokeFactor: CGFloat = 0.07 {
didSet {
setNeedsDisplay()
}
}
var insetFactor: CGFloat = 0.17 {
didSet {
setNeedsDisplay()
}
}
var markInsetFactor: CGFloat = 0.34 {
didSet {
setNeedsDisplay()
}
}
// The method that does the heavy lifting of check box drawing code.
override func drawInContext(context: CGContext) {
super.drawInContext(context)
let size = min(bounds.width, bounds.height)
var transform = affineTransform()
var xTranslate: CGFloat = 0
var yTranslate: CGFloat = 0
if bounds.size.width < bounds.size.height {
yTranslate = (bounds.height - size) / 2.0
}
else {
xTranslate = (bounds.width - size) / 2.0
}
transform = CGAffineTransformTranslate(transform, xTranslate, yTranslate)
let strokeWidth: CGFloat = strokeFactor * size
let checkBoxInset: CGFloat = insetFactor * size
// Create the outer border for the check box.
let outerDimension: CGFloat = size - 2.0 * checkBoxInset
var checkBoxRect = CGRect(x: checkBoxInset, y: checkBoxInset, width: outerDimension, height: outerDimension)
checkBoxRect = CGRectApplyAffineTransform(checkBoxRect, transform)
// Make the desired width of the outer box.
CGContextSetLineWidth(context, strokeWidth)
// Set the tint color of the outer box.
CGContextSetStrokeColorWithColor(context, tintColor)
// Draw the outer box.
CGContextStrokeRect(context, checkBoxRect)
// Draw the inner box if it's checked.
if isChecked {
let markInset: CGFloat = markInsetFactor * size
let markDimension: CGFloat = size - 2.0 * markInset
var markRect = CGRect(x: markInset, y: markInset, width: markDimension, height: markDimension)
markRect = CGRectApplyAffineTransform(markRect, transform)
CGContextSetFillColorWithColor(context, tintColor)
CGContextFillRect(context, markRect)
}
}
}
| cc271f985cd2cbdc22b80d02ce98b54e | 29.663265 | 164 | 0.604326 | false | false | false | false |
SwifterSwift/SwifterSwift | refs/heads/master | Tests/UIKitTests/UIBarButtonExtensionsTests.swift | mit | 1 | // UIBarButtonExtensionsTests.swift - Copyright 2020 SwifterSwift
@testable import SwifterSwift
import XCTest
#if canImport(UIKit) && !os(watchOS)
import UIKit
final class UIBarButtonExtensionsTests: XCTestCase {
func testFlexibleSpace() {
let space1 = UIBarButtonItem.flexibleSpace
let space2 = UIBarButtonItem.flexibleSpace
// Make sure two different instances are created
XCTAssert(space1 !== space2)
}
func testSelector() {}
func testAddTargetForAction() {
let barButton = UIBarButtonItem()
let selector = #selector(testSelector)
barButton.addTargetForAction(self, action: selector)
let target = barButton.target as? UIBarButtonExtensionsTests
XCTAssertEqual(target, self)
XCTAssertEqual(barButton.action, selector)
}
func testFixedSpace() {
let width: CGFloat = 120
let barButtonItem = UIBarButtonItem.fixedSpace(width: width)
XCTAssertEqual(barButtonItem.width, width)
}
}
#endif
| 9641a430aab762c9ff370f1e09aa7d24 | 26.052632 | 68 | 0.698444 | false | true | false | false |
Esri/arcgis-runtime-samples-ios | refs/heads/main | arcgis-ios-sdk-samples/Display information/Graphics overlay (dictionary renderer) 3D/GraphicsOverlayDictionaryRenderer3DViewController.swift | apache-2.0 | 1 | //
// Copyright © 2019 Esri.
//
// Licensed under the Apache License, Version 2.0 (the "License");
// you may not use this file except in compliance with the License.
// You may obtain a copy of the License at
//
// http://www.apache.org/licenses/LICENSE-2.0
//
// Unless required by applicable law or agreed to in writing, software
// distributed under the License is distributed on an "AS IS" BASIS,
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
// See the License for the specific language governing permissions and
// limitations under the License.
//
import UIKit
import ArcGIS
/// A view controller that manages the interface of the Graphics Overlay
/// (Dictionary Renderer) 3D sample.
class GraphicsOverlayDictionaryRenderer3DViewController: UIViewController {
/// The scene view managed by the view controller.
@IBOutlet weak var sceneView: AGSSceneView! {
didSet {
sceneView.scene = AGSScene(basemapStyle: .arcGISTopographic)
sceneView.graphicsOverlays.add(makeGraphicsOverlay())
}
}
/// Creates a graphics overlay configured to display MIL-STD-2525D
/// symbology.
/// - Returns: A new `AGSGraphicsOverlay` object.
func makeGraphicsOverlay() -> AGSGraphicsOverlay {
let graphicsOverlay = AGSGraphicsOverlay()
// Create the style from Joint Military Symbology MIL-STD-2525D
// portal item.
let dictionarySymbolStyle = AGSDictionarySymbolStyle(
portalItem: AGSPortalItem(
portal: .arcGISOnline(withLoginRequired: false),
itemID: "d815f3bdf6e6452bb8fd153b654c94ca"
)
)
dictionarySymbolStyle.load { [weak self, weak graphicsOverlay] error in
guard let self = self, let graphicsOverlay = graphicsOverlay else {
return
}
if let error = error {
self.presentAlert(error: error)
} else {
let camera = AGSCamera(lookAt: graphicsOverlay.extent.center, distance: 15_000, heading: 0, pitch: 70, roll: 0)
self.sceneView.setViewpointCamera(camera)
// Use Ordered Anchor Points for the symbol style draw rule.
if let drawRuleConfiguration = dictionarySymbolStyle.configurations.first(where: { $0.name == "model" }) {
drawRuleConfiguration.value = "ORDERED ANCHOR POINTS"
}
graphicsOverlay.renderer = AGSDictionaryRenderer(dictionarySymbolStyle: dictionarySymbolStyle)
}
}
// Read the messages and add a graphic to the overlay for each messages.
if let messagesURL = Bundle.main.url(forResource: "Mil2525DMessages", withExtension: "xml") {
do {
let messagesData = try Data(contentsOf: messagesURL)
let messages = try MessageParser().parseMessages(from: messagesData)
let graphics = messages.map { AGSGraphic(geometry: AGSMultipoint(points: $0.points), symbol: nil, attributes: $0.attributes) }
graphicsOverlay.graphics.addObjects(from: graphics)
} catch {
print("Error reading or decoding messages: \(error)")
}
} else {
preconditionFailure("Missing Mil2525DMessages.xml")
}
return graphicsOverlay
}
// MARK: UIViewController
override func viewDidLoad() {
super.viewDidLoad()
// Add the source code button item to the right of navigation bar.
(navigationItem.rightBarButtonItem as? SourceCodeBarButtonItem)?.filenames = ["GraphicsOverlayDictionaryRenderer3DViewController"]
}
}
struct Message {
var points: [AGSPoint]
var attributes: [String: Any]
}
class MessageParser: NSObject {
struct ControlPoint {
var x: Double
var y: Double
}
private var controlPoints = [ControlPoint]()
private var wkid: Int?
private var attributes = [String: Any]()
private var contentsOfCurrentElement = ""
private var parsedMessages = [Message]()
func didFinishParsingMessage() {
let spatialReference = AGSSpatialReference(wkid: wkid!)
let points = controlPoints.map { AGSPoint(x: $0.x, y: $0.y, spatialReference: spatialReference) }
let message = Message(points: points, attributes: attributes)
parsedMessages.append(message)
wkid = nil
controlPoints.removeAll()
attributes.removeAll()
}
func parseMessages(from data: Data) throws -> [Message] {
defer { parsedMessages.removeAll() }
let parser = XMLParser(data: data)
parser.delegate = self
let parsingSucceeded = parser.parse()
if parsingSucceeded {
return parsedMessages
} else if let error = parser.parserError {
throw error
} else {
return []
}
}
}
extension MessageParser: XMLParserDelegate {
func parser(_ parser: XMLParser, didStartElement elementName: String, namespaceURI: String?, qualifiedName qName: String?, attributes attributeDict: [String: String] = [:]) {
contentsOfCurrentElement.removeAll()
}
func parser(_ parser: XMLParser, foundCharacters string: String) {
contentsOfCurrentElement.append(contentsOf: string)
}
enum Element: String {
case controlPoints = "_control_points"
case message
case messages
case wkid = "_wkid"
}
func parser(_ parser: XMLParser, didEndElement elementName: String, namespaceURI: String?, qualifiedName qName: String?) {
if let element = Element(rawValue: elementName) {
switch element {
case .controlPoints:
controlPoints = contentsOfCurrentElement.split(separator: ";").map { (pair) in
let coordinates = pair.split(separator: ",")
return ControlPoint(x: Double(coordinates.first!)!, y: Double(coordinates.last!)!)
}
case .message:
didFinishParsingMessage()
case .messages:
break
case .wkid:
wkid = Int(contentsOfCurrentElement)
}
} else {
attributes[elementName] = contentsOfCurrentElement
}
contentsOfCurrentElement.removeAll()
}
}
| 2efdef3244196b7fe29ae87834ce6f68 | 37.301775 | 178 | 0.628148 | false | false | false | false |
huonw/swift | refs/heads/master | test/SILGen/synthesized_conformance_enum.swift | apache-2.0 | 1 | // RUN: %target-swift-frontend -assume-parsing-unqualified-ownership-sil -emit-silgen %s -swift-version 4 | %FileCheck %s
enum Enum<T> {
case a(T), b(T)
}
// CHECK-LABEL: enum Enum<T> {
// CHECK: case a(T), b(T)
// CHECK: }
enum NoValues {
case a, b
}
// CHECK-LABEL: enum NoValues {
// CHECK: case a, b
// CHECK: @_implements(Equatable, ==(_:_:)) static func __derived_enum_equals(_ a: NoValues, _ b: NoValues) -> Bool
// CHECK: var hashValue: Int { get }
// CHECK: func hash(into hasher: inout Hasher)
// CHECK: }
// CHECK-LABEL: extension Enum : Equatable where T : Equatable {
// CHECK: @_implements(Equatable, ==(_:_:)) static func __derived_enum_equals(_ a: Enum<T>, _ b: Enum<T>) -> Bool
// CHECK: }
// CHECK-LABEL: extension Enum : Hashable where T : Hashable {
// CHECK: var hashValue: Int { get }
// CHECK: func hash(into hasher: inout Hasher)
// CHECK: }
// CHECK-LABEL: extension NoValues : CaseIterable {
// CHECK: typealias AllCases = [NoValues]
// CHECK: static var allCases: [NoValues] { get }
// CHECK: }
extension Enum: Equatable where T: Equatable {}
// CHECK-LABEL: // static Enum<A>.__derived_enum_equals(_:_:)
// CHECK-NEXT: sil hidden @$S28synthesized_conformance_enum4EnumOAAs9EquatableRzlE010__derived_C7_equalsySbACyxG_AFtFZ : $@convention(method) <T where T : Equatable> (@in_guaranteed Enum<T>, @in_guaranteed Enum<T>, @thin Enum<T>.Type) -> Bool {
extension Enum: Hashable where T: Hashable {}
// CHECK-LABEL: // Enum<A>.hashValue.getter
// CHECK-NEXT: sil hidden @$S28synthesized_conformance_enum4EnumOAAs8HashableRzlE9hashValueSivg : $@convention(method) <T where T : Hashable> (@in_guaranteed Enum<T>) -> Int {
// CHECK-LABEL: // Enum<A>.hash(into:)
// CHECK-NEXT: sil hidden @$S28synthesized_conformance_enum4EnumOAAs8HashableRzlE4hash4intoys6HasherVz_tF : $@convention(method) <T where T : Hashable> (@inout Hasher, @in_guaranteed Enum<T>) -> () {
extension NoValues: CaseIterable {}
// CHECK-LABEL: // static NoValues.allCases.getter
// CHECK-NEXT: sil hidden @$S28synthesized_conformance_enum8NoValuesO8allCasesSayACGvgZ : $@convention(method) (@thin NoValues.Type) -> @owned Array<NoValues> {
// Witness tables for Enum
// CHECK-LABEL: sil_witness_table hidden <T where T : Equatable> Enum<T>: Equatable module synthesized_conformance_enum {
// CHECK-NEXT: method #Equatable."=="!1: <Self where Self : Equatable> (Self.Type) -> (Self, Self) -> Bool : @$S28synthesized_conformance_enum4EnumOyxGs9EquatableAAsAERzlsAEP2eeoiySbx_xtFZTW // protocol witness for static Equatable.== infix(_:_:) in conformance <A> Enum<A>
// CHECK-NEXT: conditional_conformance (T: Equatable): dependent
// CHECK-NEXT: }
// CHECK-LABEL: sil_witness_table hidden <T where T : Hashable> Enum<T>: Hashable module synthesized_conformance_enum {
// CHECK-NEXT: base_protocol Equatable: <T where T : Equatable> Enum<T>: Equatable module synthesized_conformance_enum
// CHECK-NEXT: method #Hashable.hashValue!getter.1: <Self where Self : Hashable> (Self) -> () -> Int : @$S28synthesized_conformance_enum4EnumOyxGs8HashableAAsAERzlsAEP9hashValueSivgTW // protocol witness for Hashable.hashValue.getter in conformance <A> Enum<A>
// CHECK-NEXT: method #Hashable.hash!1: <Self where Self : Hashable> (Self) -> (inout Hasher) -> () : @$S28synthesized_conformance_enum4EnumOyxGs8HashableAAsAERzlsAEP4hash4intoys6HasherVz_tFTW // protocol witness for Hashable.hash(into:) in conformance <A> Enum<A>
// CHECK-NEXT: method #Hashable._rawHashValue!1: <Self where Self : Hashable> (Self) -> ((UInt64, UInt64)) -> Int : @$S28synthesized_conformance_enum4EnumOyxGs8HashableAAsAERzlsAEP13_rawHashValue4seedSis6UInt64V_AJt_tFTW // protocol witness for Hashable._rawHashValue(seed:) in conformance <A> Enum<A>
// CHECK-NEXT: conditional_conformance (T: Hashable): dependent
// CHECK-NEXT: }
// Witness tables for NoValues
// CHECK-LABEL: sil_witness_table hidden NoValues: CaseIterable module synthesized_conformance_enum {
// CHECK-NEXT: associated_type AllCases: Array<NoValues>
// CHECK-NEXT: associated_type_protocol (AllCases: Collection): [NoValues]: specialize <NoValues> (<Element> Array<Element>: Collection module Swift)
// CHECK-NEXT: method #CaseIterable.allCases!getter.1: <Self where Self : CaseIterable> (Self.Type) -> () -> Self.AllCases : @$S28synthesized_conformance_enum8NoValuesOs12CaseIterableAAsADP8allCases03AllI0QzvgZTW // protocol witness for static CaseIterable.allCases.getter in conformance NoValues
// CHECK-NEXT: }
| 61c44490224b93843ddd3a442f7048fc | 60.671233 | 303 | 0.723456 | false | false | false | false |
AlesTsurko/DNMKit | refs/heads/master | DNMModel/Frequency.swift | gpl-2.0 | 1 | //
// Frequency.swift
// denm_model
//
// Created by James Bean on 8/12/15.
// Copyright © 2015 James Bean. All rights reserved.
//
import Foundation
// TODO: convert to FloatLiteralConvertible
/**
Frequency of Pitch
*/
public struct Frequency: CustomStringConvertible {
// MARK: String Representation
/// Printed description of Frequency
public var description: String { get { return "Freq: \(value)" } }
// MARK: Attribute
/// Value of Frequency as Float (middle-c = 261.6)
public var value: Float
// MARK: Create a Frequency
/**
Create a Frequency with value
- parameter value: Value of Frequency as Float (middle-c = 261.6)
- returns: Initialized Frequency object
*/
public init(_ value: Float) {
self.value = value
}
/*
/**
Create a Frequency with a value and resolultion
- parameter value: Value of Frequency
- parameter resolution: Resolution
- returns: (0.25 = 1/8th tone, 0.5 = 1/4-tone, 1 = chromatic)
*/
public init(value: Float, resolution: Float? = nil) {
if let resolution = resolution {
self.value = round(value / resolution) * resolution
} else {
self.value = value
}
}
*/
/**
Create a Frequency with MIDI
- parameter midi: MIDI representation of Pitch (middle-c = 60.0)
- returns: Initialized Frequency object
*/
public init(midi: MIDI) {
self.value = 440 * pow(2.0, (midi.value - 69.0) / 12.0)
}
/**
Quantizes Frequency to the desired resolution
(chromatic = 1.0, 1/4-tone = 0.5, 1/8th-tone = 0.25)
- parameter resolution: MIDI object
*/
public mutating func quantizeToResolution(resolution: Float) {
var midi = MIDI(frequency: self)
midi.quantizeToResolution(resolution)
self = Frequency(midi: midi)
}
}
func ==(lhs: Frequency, rhs: Frequency) -> Bool {
return lhs.value == rhs.value
}
func !=(lhs: Frequency, rhs: Frequency) -> Bool {
return lhs.value != rhs.value
}
func <(lhs: Frequency, rhs: Frequency) -> Bool {
return lhs.value < rhs.value
}
func >(lhs: Frequency, rhs: Frequency) -> Bool {
return lhs.value > rhs.value
}
func <=(lhs: Frequency, rhs: Frequency) -> Bool {
return lhs.value <= rhs.value
}
func >=(lhs: Frequency, rhs: Frequency) -> Bool {
return lhs.value >= rhs.value
}
// MARK: Modify Frequency
func +(lhs: Frequency, rhs: Frequency) -> Frequency {
return Frequency(lhs.value + rhs.value)
}
func -(lhs: Frequency, rhs: Frequency) -> Frequency {
return Frequency(lhs.value - rhs.value)
}
func *(lhs: Frequency, rhs: Float) -> Frequency {
return Frequency(lhs.value * rhs)
}
/*
func %(lhs: Frequency, rhs: Float) -> Frequency {
return Frequency(lhs.value % rhs)
}
*/ | 56c08c0336193860f3b00fca698729e5 | 22 | 70 | 0.607525 | false | false | false | false |
JaySonGD/SwiftDayToDay | refs/heads/master | 获取通信录3/获取通信录3/ViewController.swift | mit | 1 | //
// ViewController.swift
// 获取通信录3
//
// Created by czljcb on 16/3/18.
// Copyright © 2016年 lQ. All rights reserved.
//
import UIKit
import ContactsUI
class ViewController: UIViewController {
override func viewDidLoad() {
super.viewDidLoad()
// Do any additional setup after loading the view, typically from a nib.
}
override func touchesBegan(touches: Set<UITouch>, withEvent event: UIEvent?) {
if #available(iOS 9.0, *) {
let vc = CNContactPickerViewController()
vc.delegate = self
presentViewController(vc, animated: true, completion: nil)
}
}
}
@available(iOS 9.0, *)
extension ViewController: CNContactPickerDelegate{
func contactPicker(picker: CNContactPickerViewController, didSelectContact contact: CNContact) {
let name = contact.familyName + contact.middleName + contact.givenName
print(name)
let phones = contact.phoneNumbers
for phone in phones{
print(phone.label)
let value: CNPhoneNumber = phone.value as! CNPhoneNumber
print(value.stringValue)
}
}
} | 14ea57a559739ea1750a0509daaff86f | 23.6 | 100 | 0.607811 | false | false | false | false |
colemancda/Pedido | refs/heads/master | Pedido Admin/Pedido Admin/NewMenuItemViewController.swift | mit | 1 | //
// NewMenuItemViewController.swift
// Pedido Admin
//
// Created by Alsey Coleman Miller on 12/27/14.
// Copyright (c) 2014 ColemanCDA. All rights reserved.
//
import Foundation
import UIKit
class NewMenuItemViewController: NewManagedObjectViewController {
// MARK: - IB Outlets
@IBOutlet weak var nameTextField: UITextField!
@IBOutlet weak var priceTextfield: UITextField!
@IBOutlet weak var currencySymbolLabel: UILabel!
// MARK: - Properties
override var entityName: String {
return "MenuItem"
}
var currencyLocale: NSLocale = NSLocale.currentLocale() {
didSet {
// update UI
self.currencySymbolLabel.text = currencyLocale.objectForKey(NSLocaleCurrencySymbol) as? String
// set locale on number formatter
self.numberFormatter.locale = self.currencyLocale
}
}
// MARK: - Private Properties
lazy var numberFormatter: NSNumberFormatter = {
let numberFormatter = NSNumberFormatter()
numberFormatter.numberStyle = NSNumberFormatterStyle.CurrencyStyle
numberFormatter.locale = self.currencyLocale
numberFormatter.currencySymbol = ""
return numberFormatter
}()
// MARK: - Methods
override func getNewValues() -> [String : AnyObject]? {
// attributes
let name = self.nameTextField.text
let price = self.numberFormatter.numberFromString(self.priceTextfield.text)
// invalid price text
if price == nil {
self.showErrorAlert(NSLocalizedString("Invalid value for price.", comment: "Invalid value for price."))
return nil
}
return ["name": name, "price": price!, "currencyLocaleIdentifier": self.currencyLocale.localeIdentifier]
}
// MARK: - Segues
override func prepareForSegue(segue: UIStoryboardSegue, sender: AnyObject?) {
switch MainStoryboardSegueIdentifier(rawValue: segue.identifier!)! {
case .NewMenuItemPickCurrencyLocale:
let currencyLocalePickerVC = segue.destinationViewController as CurrencyLocalePickerViewController
currencyLocalePickerVC.selectedCurrencyLocale = self.currencyLocale
// set handler
currencyLocalePickerVC.selectionHandler = {
self.currencyLocale = currencyLocalePickerVC.selectedCurrencyLocale!
}
default:
return
}
}
} | 6c1adf7f4a8086515ee0f99fdc654390 | 26.6 | 115 | 0.595143 | false | false | false | false |
WebAPIKit/WebAPIKit | refs/heads/master | Sources/WebAPIKit/Response/ResponseHeaderKey.swift | mit | 1 | /**
* WebAPIKit
*
* Copyright (c) 2017 Evan Liu. Licensed under the MIT license, as follows:
*
* Permission is hereby granted, free of charge, to any person obtaining a copy
* of this software and associated documentation files (the "Software"), to deal
* in the Software without restriction, including without limitation the rights
* to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
* copies of the Software, and to permit persons to whom the Software is
* furnished to do so, subject to the following conditions:
*
* The above copyright notice and this permission notice shall be included in all
* copies or substantial portions of the Software.
*
* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
* IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
* FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
* AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
* LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
* OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
* SOFTWARE.
*/
import Foundation
/// Wrapper for http response header keys.
public struct ResponseHeaderKey: RawValueWrapper {
public let rawValue: String
public init(_ rawValue: String) {
self.rawValue = rawValue
}
}
extension HTTPURLResponse {
/// Get header response header value by key as `ResponseHeaderKey`.
public func value(forHeaderKey key: ResponseHeaderKey) -> String? {
return allHeaderFields[key.rawValue] as? String
}
}
extension WebAPIResponse {
/// Get header response header value by key as `ResponseHeaderKey`.
public func value(forHeaderKey key: ResponseHeaderKey) -> String? {
return headers[key.rawValue] as? String
}
}
// MARK: Common used keys
extension ResponseHeaderKey {
/// Valid actions for a specified resource. To be used for a 405 Method not allowed.
/// - `Allow: GET, HEAD`
public static let allow = ResponseHeaderKey("Allow")
/// Where in a full body message this partial message belongs.
/// - `Content-Range: bytes 21010-47021/47022`
public static let contentRange = ResponseHeaderKey("Content-Range")
/// An identifier for a specific version of a resource, often a message digest.
/// - `ETag: "737060cd8c284d8af7ad3082f209582d"`
public static let eTag = ResponseHeaderKey("ETag")
/// An HTTP cookie.
/// - `Set-Cookie: UserID=JohnDoe; Max-Age=3600; Version=`
public static let setCookie = ResponseHeaderKey("Set-Cookie")
}
| 6616053d45daf061c65b584929c6d2bc | 34.972973 | 88 | 0.719384 | false | false | false | false |
walokra/Haikara | refs/heads/master | Haikara/Models/Paywall.swift | mit | 1 | //
// PaywallType.swift
// highkara
//
// The MIT License (MIT)
//
// Copyright (c) 2018 Marko Wallin <[email protected]>
//
// Permission is hereby granted, free of charge, to any person obtaining a copy
// of this software and associated documentation files (the "Software"), to deal
// in the Software without restriction, including without limitation the rights
// to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
// copies of the Software, and to permit persons to whom the Software is
// furnished to do so, subject to the following conditions:
//
// The above copyright notice and this permission notice shall be included in
// all copies or substantial portions of the Software.
//
// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
// IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
// FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
// AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
// LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
// OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
// THE SOFTWARE.
//
import UIKit
var paywallTextAll: String = NSLocalizedString("PAYWALL_TEXT_ALL", comment: "News source paywall type")
var paywallTextFree: String = NSLocalizedString("PAYWALL_TEXT_FREE", comment: "News source paywall type")
var paywallTextPartial: String = NSLocalizedString("PAYWALL_TEXT_PARTIAL", comment: "News source paywall type")
var paywallTextMonthly: String = NSLocalizedString("PAYWALL_TEXT_MONTHLY", comment: "News source paywall type")
var paywallTextStrict: String = NSLocalizedString("PAYWALL_TEXT_STRICT", comment: "News source paywall type")
enum Paywall: String {
case All = "all"
case Free = "free"
case Partial = "partial"
case Monthly = "monthly-limit"
case Strict = "strict-paywall"
// func type() -> String {
// return self.rawValue
// }
var type: String {
switch self {
case .All: return "all"
case .Free: return "free"
case .Partial: return "partial"
case .Monthly: return "monthly-limit"
case .Strict: return "strict-paywall"
}
}
var description: String {
switch self {
case .All: return paywallTextAll
case .Free: return paywallTextFree
case .Partial: return paywallTextPartial
case .Monthly: return paywallTextMonthly
case .Strict: return paywallTextStrict
}
}
}
| c4a2e3fff67adf7edaf267d7839352d6 | 38.030303 | 111 | 0.701475 | false | false | false | false |
4faramita/TweeBox | refs/heads/master | TweeBox/ImageContainerViewController.swift | mit | 1 | //
// ImageContainerViewController.swift
// TweeBox
//
// Created by 4faramita on 2017/8/21.
// Copyright © 2017年 4faramita. All rights reserved.
//
import UIKit
import SnapKit
import Kingfisher
class ImageContainerViewController: UIViewController {
public var tweet: Tweet? {
didSet {
setLayout()
}
}
private var media: [TweetMedia]? {
return tweet?.entities?.realMedia
}
private var clickedIndex = 0
private var images = [UIImage]()
private var imageViews = [UIImageView]()
private let placeholder = R.image.picPlaceholder() // UIImage(named: "picPlaceholder")!
private let cutPoint = CGPoint(x: 0.5, y: 0.5)
override func viewDidLayoutSubviews() {
super.viewDidLayoutSubviews()
for (index, imageView) in imageViews.enumerated() {
if imageView.bounds.height > 0 && imageView.bounds.width > 0 {
addGesture(index, imageView)
}
}
}
private func setLayout() {
if let media = media {
switch media.count {
case 1:
let firstImageView = addImageView(at: 0)
firstImageView.snp.makeConstraints({ (make) in
make.size.equalTo(view)
make.center.equalTo(view)
})
case 2:
let firstImageView = addImageView(at: 0)
firstImageView.snp.makeConstraints({ (make) in
make.width.equalTo(view).multipliedBy(0.5)
make.height.equalTo(view)
make.top.equalTo(view)
make.leading.equalTo(view)
})
let secondImageView = addImageView(at: 1)
secondImageView.snp.makeConstraints({ (make) in
make.size.equalTo(firstImageView)
make.top.equalTo(firstImageView)
make.trailing.equalTo(view)
})
case 3:
let firstImageView = addImageView(at: 0)
firstImageView.snp.makeConstraints({ (make) in
make.width.equalTo(view).multipliedBy(0.5)
make.height.equalTo(view)
make.top.equalTo(view)
make.leading.equalTo(view)
})
let secondImageView = addImageView(at: 1)
secondImageView.snp.makeConstraints({ (make) in
make.width.equalTo(firstImageView)
make.height.equalTo(firstImageView).multipliedBy(0.5)
make.top.equalTo(firstImageView)
make.trailing.equalTo(view)
})
let thirdImageView = addImageView(at: 2)
thirdImageView.snp.makeConstraints({ (make) in
make.size.equalTo(secondImageView)
make.bottom.equalTo(firstImageView)
make.trailing.equalTo(view)
})
case 4:
let firstImageView = addImageView(at: 0)
firstImageView.snp.makeConstraints({ (make) in
make.width.equalTo(view).multipliedBy(0.5)
make.height.equalTo(view).multipliedBy(0.5)
make.top.equalTo(view)
make.leading.equalTo(view)
})
let secondImageView = addImageView(at: 1)
secondImageView.snp.makeConstraints({ (make) in
make.size.equalTo(firstImageView)
make.top.equalTo(firstImageView)
make.trailing.equalTo(view)
})
let thirdImageView = addImageView(at: 2)
thirdImageView.snp.makeConstraints({ (make) in
make.size.equalTo(firstImageView)
make.bottom.equalTo(view)
make.leading.equalTo(view)
})
let fourthImageView = addImageView(at: 3)
fourthImageView.snp.makeConstraints({ (make) in
make.size.equalTo(firstImageView)
make.bottom.equalTo(view)
make.trailing.equalTo(view)
})
default:
break
}
}
}
private func addImageView(at index: Int) -> UIImageView {
let imageView = UIImageView()
view.addSubview(imageView)
imageView.contentMode = .scaleAspectFit
var ratio: CGFloat {
let total = media!.count
if (total == 2) || (total == 3 && index == 0) {
return Constants.thinAspectRatio
} else {
return Constants.normalAspectRatio
}
}
let cutSize = media![index].getCutSize(with: ratio, at: Constants.picQuality)
// let processor = CroppingImageProcessor(size: cutSize, anchor: cutPoint)
KingfisherManager.shared.retrieveImage(with: media![index].mediaURL!, options: nil, progressBlock: nil) { [weak self] (image, error, cacheType, url) in
if let image = image, let cutPoint = self?.cutPoint {
self?.images.append(image)
let cuttedImage = image.kf.crop(to: cutSize, anchorOn: cutPoint)
imageView.image = cuttedImage
}
}
// imageView.kf.setImage(
// with: media![index].mediaURL,
// placeholder: placeholder,
// options: [
// .transition(.fade(Constants.picFadeInDuration)),
// .processor(processor)
// ]
// )
// { [weak self] (image, error, cacheType, url) in
// if let image = image {
// self?.images.append(image)
// }
// }
imageViews.append(imageView)
return imageView
}
private func addGesture(_ index: Int, _ imageView: ImageView) {
imageView.isUserInteractionEnabled = true
// add tap gesture
let gestures = [#selector(tapOnFirstImage(_:)), #selector(tapOnSecondImage(_:)), #selector(tapOnThirdImage(_:)), #selector(tapOnFourthImage(_:))]
let tapGesture = UITapGestureRecognizer(target: self, action: gestures[index])
tapGesture.numberOfTapsRequired = 1
tapGesture.numberOfTouchesRequired = 1
imageView.addGestureRecognizer(tapGesture)
}
@IBAction private func tapOnFirstImage(_ sender: UIGestureRecognizer) {
clickedIndex = 0
if media?.count == 1, media?[0].type != "photo" {
performSegue(withIdentifier: "Video Tapped", sender: nil)
}
performSegue(withIdentifier: "Image Tapped", sender: imageViews[0])
}
@IBAction private func tapOnSecondImage(_ sender: UIGestureRecognizer) {
clickedIndex = 1
performSegue(withIdentifier: "Image Tapped", sender: imageViews[1])
}
@IBAction private func tapOnThirdImage(_ sender: UIGestureRecognizer) {
clickedIndex = 2
performSegue(withIdentifier: "Image Tapped", sender: imageViews[2])
}
@IBAction private func tapOnFourthImage(_ sender: UIGestureRecognizer) {
clickedIndex = 3
performSegue(withIdentifier: "Image Tapped", sender: imageViews[3])
}
override func prepare(for segue: UIStoryboardSegue, sender: Any?) {
if let identifier = segue.identifier {
switch identifier {
case "Video Tapped":
if let videoViewer = segue.destination.content as? VideoViewerViewController {
videoViewer.tweetMedia = media![0]
}
case "Image Tapped":
if let imageViewer = segue.destination as? ImageViewerViewController {
imageViewer.image = images[clickedIndex]
imageViewer.imageURL = tweet?.entities?.mediaToShare?[clickedIndex].mediaURL
}
default:
return
}
}
}
}
| 9bcc86ebd9aebac1b861a95b3aa6a7bd | 32.963855 | 159 | 0.527374 | false | false | false | false |
Subsets and Splits