Spaces:
Running
Running
{ | |
"env": "LynxKite Graph Analytics", | |
"nodes": [ | |
{ | |
"id": "Import CSV 1", | |
"type": "basic", | |
"data": { | |
"title": "Import CSV", | |
"params": { | |
"filename": "examples/drug_target_data_sample.csv", | |
"separator": "<auto>", | |
"columns": "<from file>" | |
}, | |
"display": null, | |
"error": null, | |
"__execution_delay": 0.0, | |
"collapsed": null, | |
"meta": { | |
"params": { | |
"separator": { | |
"default": "<auto>", | |
"type": { | |
"type": "<class 'str'>" | |
}, | |
"name": "separator" | |
}, | |
"filename": { | |
"default": null, | |
"type": { | |
"type": "<class 'str'>" | |
}, | |
"name": "filename" | |
}, | |
"columns": { | |
"name": "columns", | |
"default": "<from file>", | |
"type": { | |
"type": "<class 'str'>" | |
} | |
} | |
}, | |
"outputs": { | |
"output": { | |
"position": "right", | |
"name": "output", | |
"type": { | |
"type": "None" | |
} | |
} | |
}, | |
"type": "basic", | |
"inputs": {}, | |
"name": "Import CSV" | |
} | |
}, | |
"position": { | |
"x": 300.92214591096035, | |
"y": 1018.8292637889027 | |
}, | |
"width": 200.0, | |
"height": 200.0 | |
}, | |
{ | |
"id": "Parse SMILES 1", | |
"type": "basic", | |
"data": { | |
"title": "Parse SMILES", | |
"params": { | |
"smiles_column": "SMILES", | |
"table": "df", | |
"save_as": "mols" | |
}, | |
"display": null, | |
"error": null, | |
"meta": { | |
"name": "Parse SMILES", | |
"type": "basic", | |
"params": { | |
"table": { | |
"default": "df", | |
"name": "table", | |
"type": { | |
"type": "<class 'str'>" | |
} | |
}, | |
"smiles_column": { | |
"name": "smiles_column", | |
"default": "SMILES", | |
"type": { | |
"type": "<class 'str'>" | |
} | |
}, | |
"save_as": { | |
"name": "save_as", | |
"type": { | |
"type": "<class 'str'>" | |
}, | |
"default": "mols" | |
} | |
}, | |
"inputs": { | |
"bundle": { | |
"name": "bundle", | |
"type": { | |
"type": "<class 'lynxkite_graph_analytics.lynxkite_ops.Bundle'>" | |
}, | |
"position": "left" | |
} | |
}, | |
"outputs": { | |
"output": { | |
"position": "right", | |
"type": { | |
"type": "None" | |
}, | |
"name": "output" | |
} | |
} | |
} | |
}, | |
"position": { | |
"x": 580.5892989328847, | |
"y": 1012.8823965480503 | |
}, | |
"width": 200.0, | |
"height": 200.0 | |
}, | |
{ | |
"id": "Graph from molecule similarity 1", | |
"type": "basic", | |
"data": { | |
"title": "Graph from molecule similarity", | |
"params": { | |
"table": "df", | |
"average_degree": "3", | |
"mols_column": "mols" | |
}, | |
"display": null, | |
"error": null, | |
"meta": { | |
"inputs": { | |
"bundle": { | |
"position": "left", | |
"name": "bundle", | |
"type": { | |
"type": "<class 'lynxkite_graph_analytics.lynxkite_ops.Bundle'>" | |
} | |
} | |
}, | |
"outputs": { | |
"output": { | |
"type": { | |
"type": "None" | |
}, | |
"position": "right", | |
"name": "output" | |
} | |
}, | |
"type": "basic", | |
"name": "Graph from molecule similarity", | |
"params": { | |
"average_degree": { | |
"default": 10.0, | |
"type": { | |
"type": "<class 'int'>" | |
}, | |
"name": "average_degree" | |
}, | |
"table": { | |
"default": "df", | |
"name": "table", | |
"type": { | |
"type": "<class 'str'>" | |
} | |
}, | |
"mols_column": { | |
"default": "mols", | |
"name": "mols_column", | |
"type": { | |
"type": "<class 'str'>" | |
} | |
} | |
} | |
}, | |
"collapsed": null, | |
"__execution_delay": 0.0 | |
}, | |
"position": { | |
"x": 926.4337192214458, | |
"y": 1014.4451876264845 | |
}, | |
"height": 200.0, | |
"width": 200.0 | |
}, | |
{ | |
"id": "Visualize graph 1", | |
"type": "visualization", | |
"data": { | |
"title": "Visualize graph", | |
"params": { | |
"color_nodes_by": "ORGANISM", | |
"label_by": "DRUG_NAME", | |
"color_edges_by": "similarity" | |
}, | |
"display": { | |
"animationDuration": 500, | |
"animationEasingUpdate": "quinticInOut", | |
"tooltip": { | |
"show": true | |
}, | |
"series": [ | |
{ | |
"type": "graph", | |
"lineStyle": { | |
"color": "gray", | |
"curveness": 0.3 | |
}, | |
"emphasis": { | |
"focus": "adjacency", | |
"lineStyle": { | |
"width": 10 | |
} | |
}, | |
"label": { | |
"position": "top", | |
"formatter": "{b}" | |
}, | |
"data": [ | |
{ | |
"id": "0", | |
"x": -0.13734854736037372, | |
"y": 0.0003840689616843064, | |
"symbolSize": 22.360679774997894, | |
"itemStyle": { | |
"color": "#a6cee3" | |
}, | |
"label": { | |
"show": true | |
}, | |
"name": "phencyclidine", | |
"value": "Torpedo californica" | |
}, | |
{ | |
"id": "1", | |
"x": 0.4859426303201164, | |
"y": -0.09785193844993345, | |
"symbolSize": 22.360679774997894, | |
"itemStyle": { | |
"color": "#1f78b4" | |
}, | |
"label": { | |
"show": true | |
}, | |
"name": "triazolam", | |
"value": "Homo sapiens" | |
}, | |
{ | |
"id": "2", | |
"x": -0.36490537596845657, | |
"y": 0.655747709585604, | |
"symbolSize": 22.360679774997894, | |
"itemStyle": { | |
"color": "#1f78b4" | |
}, | |
"label": { | |
"show": true | |
}, | |
"name": "gentian violet", | |
"value": "Homo sapiens" | |
}, | |
{ | |
"id": "3", | |
"x": 0.8039553347691868, | |
"y": 0.44172015990267444, | |
"symbolSize": 22.360679774997894, | |
"itemStyle": { | |
"color": "#1f78b4" | |
}, | |
"label": { | |
"show": true | |
}, | |
"name": "ipratropium", | |
"value": "Homo sapiens" | |
}, | |
{ | |
"id": "4", | |
"x": -0.7876440417604583, | |
"y": -1.0, | |
"symbolSize": 22.360679774997894, | |
"itemStyle": { | |
"color": "#1f78b4" | |
}, | |
"label": { | |
"show": true | |
}, | |
"name": "deoxycholic acid", | |
"value": "Homo sapiens" | |
} | |
], | |
"links": [ | |
{ | |
"source": "3", | |
"target": "4", | |
"lineStyle": { | |
"color": "#440154" | |
}, | |
"value": 0.8481012658227848 | |
}, | |
{ | |
"source": "0", | |
"target": "1", | |
"lineStyle": { | |
"color": "#3a538b" | |
}, | |
"value": 0.8813559322033898 | |
}, | |
{ | |
"source": "0", | |
"target": "4", | |
"lineStyle": { | |
"color": "#3a538b" | |
}, | |
"value": 0.8813559322033898 | |
}, | |
{ | |
"source": "0", | |
"target": "3", | |
"lineStyle": { | |
"color": "#26818e" | |
}, | |
"value": 0.9047619047619048 | |
}, | |
{ | |
"source": "1", | |
"target": "2", | |
"lineStyle": { | |
"color": "#23898d" | |
}, | |
"value": 0.9090909090909091 | |
}, | |
{ | |
"source": "1", | |
"target": "3", | |
"lineStyle": { | |
"color": "#1ea087" | |
}, | |
"value": 0.921875 | |
}, | |
{ | |
"source": "0", | |
"target": "2", | |
"lineStyle": { | |
"color": "#3ebc73" | |
}, | |
"value": 0.9375 | |
}, | |
{ | |
"source": "1", | |
"target": "4", | |
"lineStyle": { | |
"color": "#4fc369" | |
}, | |
"value": 0.9420289855072463 | |
}, | |
{ | |
"source": "2", | |
"target": "4", | |
"lineStyle": { | |
"color": "#9fd938" | |
}, | |
"value": 0.9589041095890412 | |
}, | |
{ | |
"source": "2", | |
"target": "3", | |
"lineStyle": { | |
"color": "#fde724" | |
}, | |
"value": 0.9775280898876404 | |
} | |
] | |
} | |
] | |
}, | |
"error": null, | |
"__execution_delay": 0.0, | |
"collapsed": null, | |
"meta": { | |
"params": { | |
"label_by": { | |
"type": { | |
"format": "node attribute" | |
}, | |
"name": "label_by", | |
"default": null | |
}, | |
"color_nodes_by": { | |
"type": { | |
"format": "node attribute" | |
}, | |
"name": "color_nodes_by", | |
"default": null | |
}, | |
"color_edges_by": { | |
"name": "color_edges_by", | |
"type": { | |
"format": "edge attribute" | |
}, | |
"default": null | |
} | |
}, | |
"inputs": { | |
"graph": { | |
"type": { | |
"type": "<class 'lynxkite_graph_analytics.lynxkite_ops.Bundle'>" | |
}, | |
"name": "graph", | |
"position": "left" | |
} | |
}, | |
"outputs": {}, | |
"position": { | |
"y": 167.0, | |
"x": 883.0 | |
}, | |
"type": "visualization", | |
"name": "Visualize graph" | |
} | |
}, | |
"position": { | |
"x": 1254.2277640235457, | |
"y": 931.9705991370125 | |
}, | |
"height": 314.0, | |
"width": 407.0 | |
}, | |
{ | |
"id": "Cypher 1", | |
"type": "basic", | |
"data": { | |
"title": "Cypher", | |
"params": { | |
"save_as": "result", | |
"query": "MATCH\n (a {ORGANISM: \"Homo sapiens\"})\n -[r]->\n (b {ORGANISM: \"Homo sapiens\"})\nWHERE\n r.similarity > 0.9\nRETURN a.DRUG_NAME, b.DRUG_NAME" | |
}, | |
"display": null, | |
"error": null, | |
"meta": { | |
"outputs": { | |
"output": { | |
"type": { | |
"type": "None" | |
}, | |
"name": "output", | |
"position": "right" | |
} | |
}, | |
"inputs": { | |
"bundle": { | |
"position": "left", | |
"name": "bundle", | |
"type": { | |
"type": "<class 'lynxkite_graph_analytics.lynxkite_ops.Bundle'>" | |
} | |
} | |
}, | |
"name": "Cypher", | |
"params": { | |
"query": { | |
"default": null, | |
"name": "query", | |
"type": { | |
"format": "textarea" | |
} | |
}, | |
"save_as": { | |
"type": { | |
"type": "<class 'str'>" | |
}, | |
"default": "result", | |
"name": "save_as" | |
} | |
}, | |
"type": "basic", | |
"position": { | |
"x": 638.0, | |
"y": 577.0 | |
} | |
}, | |
"collapsed": null, | |
"__execution_delay": 0.0 | |
}, | |
"position": { | |
"x": 1209.2024653849007, | |
"y": 1567.9825632648467 | |
}, | |
"height": 267.0, | |
"width": 434.0 | |
}, | |
{ | |
"id": "View tables 1", | |
"type": "table_view", | |
"data": { | |
"title": "View tables", | |
"params": { | |
"limit": 100.0 | |
}, | |
"display": { | |
"dataframes": { | |
"edges": { | |
"columns": [ | |
"source", | |
"target", | |
"similarity" | |
], | |
"data": [ | |
[ | |
3.0, | |
4.0, | |
0.8481012658227848 | |
], | |
[ | |
0.0, | |
1.0, | |
0.8813559322033898 | |
], | |
[ | |
0.0, | |
4.0, | |
0.8813559322033898 | |
], | |
[ | |
0.0, | |
3.0, | |
0.9047619047619048 | |
], | |
[ | |
1.0, | |
2.0, | |
0.9090909090909091 | |
], | |
[ | |
1.0, | |
3.0, | |
0.921875 | |
], | |
[ | |
0.0, | |
2.0, | |
0.9375 | |
], | |
[ | |
1.0, | |
4.0, | |
0.9420289855072463 | |
], | |
[ | |
2.0, | |
4.0, | |
0.9589041095890412 | |
], | |
[ | |
2.0, | |
3.0, | |
0.9775280898876404 | |
] | |
] | |
}, | |
"nodes": { | |
"columns": [ | |
"Unnamed: 0", | |
"DRUG_NAME", | |
"STRUCT_ID", | |
"TARGET_NAME", | |
"TARGET_CLASS", | |
"ACCESSION", | |
"GENE", | |
"SWISSPROT", | |
"ACT_VALUE", | |
"ACT_UNIT", | |
"ACT_TYPE", | |
"ACT_COMMENT", | |
"ACT_SOURCE", | |
"RELATION", | |
"MOA", | |
"MOA_SOURCE", | |
"ACT_SOURCE_URL", | |
"MOA_SOURCE_URL", | |
"ACTION_TYPE", | |
"TDL", | |
"ORGANISM", | |
"SMILES", | |
"InChI", | |
"InChIKey", | |
"INN", | |
"mols" | |
], | |
"data": [ | |
[ | |
9737, | |
"phencyclidine", | |
2121, | |
"Acetylcholine receptor subunit alpha", | |
"Ion channel", | |
"P02710", | |
"CHRNA1", | |
"ACHA_TORCA", | |
6.66, | |
null, | |
"IC50", | |
"Displacement of [3H]PCP from nAChR in Torpedo nobiliana electric organs membranes in presence of 100 uM carbachol by scintillation counting method", | |
"CHEMBL", | |
"=", | |
null, | |
"nan", | |
null, | |
"nan", | |
"nan", | |
"nan", | |
"Torpedo californica", | |
"C1CCN(CC1)C1(CCCCC1)C1=CC=CC=C1", | |
"InChI=1S/C17H25N/c1-4-10-16(11-5-1)17(12-6-2-7-13-17)18-14-8-3-9-15-18/h1,4-5,10-11H,2-3,6-9,12-15H2", | |
"JTJMJGYZQZDUJJ-UHFFFAOYSA-N", | |
"phencyclidine", | |
"<rdkit.Chem.rdchem.Mol object at 0x74d424169e70>" | |
], | |
[ | |
12934, | |
"triazolam", | |
2729, | |
"GABA A receptor alpha-3/beta-2/gamma-2", | |
"Ion channel", | |
"P18507|P34903|P47870", | |
"GABRG2|GABRA3|GABRB2", | |
"GBRG2_HUMAN|GBRA3_HUMAN|GBRB2_HUMAN", | |
8.876, | |
null, | |
"Ki", | |
"nan", | |
"WOMBAT-PK", | |
"=", | |
1.0, | |
"CHEMBL", | |
null, | |
"https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL646", | |
"POSITIVE ALLOSTERIC MODULATOR", | |
"Tclin|Tclin|Tclin|Tclin|Tclin|Tclin|Tclin|Tclin|Tclin", | |
"Homo sapiens", | |
"CC1=NN=C2CN=C(C3=CC(Cl)=CC=C3N12)C1=C(Cl)C=CC=C1", | |
"InChI=1S/C17H12Cl2N4/c1-10-21-22-16-9-20-17(12-4-2-3-5-14(12)19)13-8-11(18)6-7-15(13)23(10)16/h2-8H,9H2,1H3", | |
"JOFWLTCLBGQGBO-UHFFFAOYSA-N", | |
"triazolam", | |
"<rdkit.Chem.rdchem.Mol object at 0x74d42416ab20>" | |
], | |
[ | |
15266, | |
"gentian violet", | |
4138, | |
"D(2) dopamine receptor", | |
"GPCR", | |
"P14416", | |
"DRD2", | |
"DRD2_HUMAN", | |
5.975, | |
null, | |
"Ki", | |
"DRUGMATRIX: Dopamine D2L radioligand binding (ligand: [3H] Spiperone)", | |
"DRUG MATRIX", | |
"=", | |
null, | |
"nan", | |
null, | |
"nan", | |
"nan", | |
"Tclin", | |
"Homo sapiens", | |
"CN(C)C1=CC=C(C=C1)C(C1=CC=C(C=C1)N(C)C)=C1C=CC(C=C1)=[N+](C)C", | |
"InChI=1S/C25H30N3/c1-26(2)22-13-7-19(8-14-22)25(20-9-15-23(16-10-20)27(3)4)21-11-17-24(18-12-21)28(5)6/h7-18H,1-6H3/q+1", | |
"LGLFFNDHMLKUMI-UHFFFAOYSA-N", | |
"gentian violet", | |
"<rdkit.Chem.rdchem.Mol object at 0x74d424169070>" | |
], | |
[ | |
6488, | |
"ipratropium", | |
1475, | |
"Muscarinic acetylcholine receptor M1", | |
"GPCR", | |
"P11229", | |
"CHRM1", | |
"ACM1_HUMAN", | |
9.31, | |
null, | |
"Ki", | |
"nan", | |
"WOMBAT-PK", | |
"=", | |
null, | |
"nan", | |
null, | |
"nan", | |
"nan", | |
"Tclin", | |
"Homo sapiens", | |
"CC(C)[N+]1(C)[C@H]2CC[C@@H]1C[C@@H](C2)OC(=O)C(CO)C1=CC=CC=C1", | |
"InChI=1S/C20H30NO3/c1-14(2)21(3)16-9-10-17(21)12-18(11-16)24-20(23)19(13-22)15-7-5-4-6-8-15/h4-8,14,16-19,22H,9-13H2,1-3H3/q+1/t16-,17+,18+,19?,21?", | |
"OEXHQOGQTVQTAT-BHIXFJMTSA-N", | |
"ipratropium", | |
"<rdkit.Chem.rdchem.Mol object at 0x74d42416a7a0>" | |
], | |
[ | |
17453, | |
"deoxycholic acid", | |
4988, | |
"G-protein coupled bile acid receptor 1", | |
"GPCR", | |
"Q8TDU6", | |
"GPBAR1", | |
"GPBAR_HUMAN", | |
6.2, | |
null, | |
"EC50", | |
"nan", | |
"IUPHAR", | |
"=", | |
null, | |
"nan", | |
null, | |
"nan", | |
"AGONIST", | |
"Tchem", | |
"Homo sapiens", | |
"C[C@H](CCC(O)=O)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3C[C@H](O)[C@]12C", | |
"InChI=1S/C24H40O4/c1-14(4-9-22(27)28)18-7-8-19-17-6-5-15-12-16(25)10-11-23(15,2)20(17)13-21(26)24(18,19)3/h14-21,25-26H,4-13H2,1-3H3,(H,27,28)/t14-,15-,16-,17+,18-,19+,20+,21+,23+,24-/m1/s1", | |
"KXGVEGMKQFWNSR-LLQZFEROSA-N", | |
"deoxycholic acid", | |
"<rdkit.Chem.rdchem.Mol object at 0x74d424168890>" | |
] | |
] | |
}, | |
"result": { | |
"columns": [ | |
"a.DRUG_NAME", | |
"b.DRUG_NAME" | |
], | |
"data": [ | |
[ | |
"triazolam", | |
"gentian violet" | |
], | |
[ | |
"triazolam", | |
"ipratropium" | |
], | |
[ | |
"triazolam", | |
"deoxycholic acid" | |
], | |
[ | |
"gentian violet", | |
"deoxycholic acid" | |
], | |
[ | |
"gentian violet", | |
"ipratropium" | |
] | |
] | |
} | |
}, | |
"relations": [ | |
{ | |
"df": "edges", | |
"source_column": "source", | |
"target_column": "target", | |
"source_table": "nodes", | |
"target_table": "nodes", | |
"source_key": "id", | |
"target_key": "id" | |
} | |
], | |
"other": null | |
}, | |
"error": null, | |
"meta": { | |
"params": { | |
"limit": { | |
"default": 100.0, | |
"name": "limit", | |
"type": { | |
"type": "<class 'int'>" | |
} | |
} | |
}, | |
"inputs": { | |
"bundle": { | |
"name": "bundle", | |
"position": "left", | |
"type": { | |
"type": "<class 'lynxkite_graph_analytics.lynxkite_ops.Bundle'>" | |
} | |
} | |
}, | |
"position": { | |
"x": 1183.0, | |
"y": 534.0 | |
}, | |
"name": "View tables", | |
"outputs": {}, | |
"type": "table_view" | |
} | |
}, | |
"position": { | |
"x": 1817.1767094971015, | |
"y": 1459.025582190881 | |
}, | |
"width": 322.0, | |
"height": 295.0 | |
} | |
], | |
"edges": [ | |
{ | |
"id": "Import CSV 1 Parse SMILES 1", | |
"source": "Import CSV 1", | |
"target": "Parse SMILES 1", | |
"sourceHandle": "output", | |
"targetHandle": "bundle" | |
}, | |
{ | |
"id": "Parse SMILES 1 Graph from molecule similarity 1", | |
"source": "Parse SMILES 1", | |
"target": "Graph from molecule similarity 1", | |
"sourceHandle": "output", | |
"targetHandle": "bundle" | |
}, | |
{ | |
"id": "Graph from molecule similarity 1 Visualize graph 1", | |
"source": "Graph from molecule similarity 1", | |
"target": "Visualize graph 1", | |
"sourceHandle": "output", | |
"targetHandle": "graph" | |
}, | |
{ | |
"id": "Graph from molecule similarity 1 Cypher 1", | |
"source": "Graph from molecule similarity 1", | |
"target": "Cypher 1", | |
"sourceHandle": "output", | |
"targetHandle": "bundle" | |
}, | |
{ | |
"id": "Cypher 1 View tables 1", | |
"source": "Cypher 1", | |
"target": "View tables 1", | |
"sourceHandle": "output", | |
"targetHandle": "bundle" | |
} | |
] | |
} | |