|
.. PROTAC-Degradation-Predictor documentation master file, created by |
|
sphinx-quickstart on Mon Aug 23 17:31:15 2021. |
|
You can adapt this file completely to your liking, but it should at least |
|
contain the root `toctree` directive. |
|
|
|
=========================================================== |
|
PROTAC-Degradation-Predictor: Documentation and Overview |
|
=========================================================== |
|
|
|
**PROTAC-Degradation-Predictor** is a Python package designed to predict the activity of PROTAC molecules using advanced machine learning techniques. The tool aims to assist researchers in evaluating the potential effectiveness of PROTACs, a novel class of drugs that target protein degradation. |
|
|
|
The package Github repository can be found `here <https://github.com/ribesstefano/PROTAC-Degradation-Predictor.git>`_. |
|
|
|
.. .. image:: https://yourimageurl.com/logo.png # Add your project's logo or any relevant image |
|
.. :align: center |
|
|
|
Introduction |
|
============ |
|
|
|
PROTACs (Proteolysis Targeting Chimeras) are a class of molecules that induce the degradation of specific proteins. This package allows researchers to predict the activity of PROTACs by leveraging a variety of machine learning models, including XGBoost and PyTorch-based pretrained neural networks. |
|
|
|
The primary functionalities of this package include: |
|
- Predicting PROTAC activity using different machine learning models. |
|
- Accessing curated datasets for training and evaluation. |
|
- Hyperparameter tuning and model training using Optuna. |
|
|
|
Features |
|
======== |
|
|
|
- **Machine Learning Models**: Utilize XGBoost, PyTorch, and scikit-learn models to predict PROTAC activity (refer to the :func:`protac_degradation_predictor.protac_degradation_predictor.get_protac_active_proba` function). |
|
- **Dataset Handling**: Load and manage datasets specific to PROTAC research (refer to the :func:`protac_degradation_predictor.data_utils.load_curated_dataset` function). |
|
- **Customizability**: Tune model hyperparameters and experiment with different model configurations (refer to the :func:`protac_degradation_predictor.optuna_utils.hyperparameter_tuning_and_training` function). |
|
|
|
Quickstart |
|
========== |
|
|
|
To get started with PROTAC-Degradation-Predictor, follow these steps: |
|
|
|
1. **Installation**: |
|
Install the package using pip: |
|
|
|
.. code-block:: bash |
|
pip install git+https://github.com/ribesstefano/PROTAC-Degradation-Predictor.git |
|
|
|
2. **Basic Usage**: |
|
Here's an example of how to predict PROTAC activity: |
|
|
|
.. code-block:: python |
|
|
|
from protac_degradation_predictor import get_protac_active_proba |
|
|
|
smiles = "CC(C)C1=CC=C(C=C1)C2=NC3=CC=CC=C3C(=O)N2" |
|
e3_ligase = "Q9Y6K9" |
|
target_uniprot = "P04637" |
|
cell_line = "HCT116" |
|
|
|
prediction = get_protac_active_proba( |
|
protac_smiles=smiles, |
|
e3_ligase=e3_ligase, |
|
target_uniprot=target_uniprot, |
|
cell_line=cell_line, |
|
device='cpu', |
|
use_models_from_cv=False, |
|
use_xgboost_models=True, |
|
study_type='standard' |
|
) |
|
print(prediction) |
|
|
|
For more detailed usage and customization, refer to the relevant sections below. |
|
|
|
Contents |
|
======== |
|
|
|
.. toctree:: |
|
:maxdepth: 2 |
|
:caption: Documentation Contents: |
|
|
|
source/modules |
|
source/protac_degradation_predictor |
|
source/protac_degradation_predictor.optuna_utils |
|
source/protac_degradation_predictor.protac_dataset |
|
source/protac_degradation_predictor.pytorch_models |
|
|
|
Getting Help |
|
============ |
|
|
|
If you encounter any issues or have questions, please refer to the following resources: |
|
|
|
- **Documentation**: Full API documentation and user guide. |
|
- **GitHub Issues**: Report bugs or request features on the `GitHub Issues <https://github.com/ribesstefano/PROTAC-Degradation-Predictor/issues>`_ page. |
|
- **Contributing**: Learn how to contribute to the project by reading our `Contribution Guidelines <https://github.com/ribesstefano/PROTAC-Degradation-Predictor/blob/main/CONTRIBUTING.md>`_. |
|
|
|
License |
|
======= |
|
|
|
This project is licensed under the MIT License. See the `LICENSE <https://github.com/ribesstefano/PROTAC-Degradation-Predictor/blob/main/LICENSE>`_ file for details. |
|
|
|
About |
|
===== |
|
|
|
**Author**: Stefano Ribes |
|
|
|
**Version**: v1.0.2 |
|
|
|
Built with Sphinx using the `Read the Docs theme <https://sphinx-rtd-theme.readthedocs.io/>`_. |
|
|
|
---------- |
|
|
|
*This documentation was last updated on August 27, 2024.* |
|
|
|
|