diff --git a/.gitattributes b/.gitattributes index 0c922537e61680a94b7d340281730343606d79e2..ab94b09fed5b51ab3e9c23534ec7feb3df3e3256 100644 --- a/.gitattributes +++ b/.gitattributes @@ -521,3 +521,17 @@ A-表番角色/GATE[[:space:]]奇幻自卫队/chara_GATEJietai_RoryMercury_v1.pr A-表番角色/GATE[[:space:]]奇幻自卫队/GATE_girlpack_v1.preview.png filter=lfs diff=lfs merge=lfs -text A-表番角色/GATE[[:space:]]奇幻自卫队/roryMercury2Outfits_v11.preview.png filter=lfs diff=lfs merge=lfs -text A-表番角色/HUNDRED百武装战记/claireHarvey_v1.preview.png filter=lfs diff=lfs merge=lfs -text +A-表番角色/安达与岛村/Adachi_v1.2.preview.png filter=lfs diff=lfs merge=lfs -text +A-表番角色/暗杀教室/irinaJelavi_v10.preview.png filter=lfs diff=lfs merge=lfs -text +A-表番角色/百变小樱/sakuraKinomoto_sakuraV2Epoch6.preview.png filter=lfs diff=lfs merge=lfs -text +A-表番角色/百合是我的工作！/yano.preview.png filter=lfs diff=lfs merge=lfs -text +A-表番角色/百无禁忌！女高中生私房话/galkoChanOshieteGalko_v10.preview.png filter=lfs diff=lfs merge=lfs -text +A-表番角色/被解雇的暗黑士兵（30多岁）开始了慢生活的第二人生/chillinInMy30sAfterGetting_01.preview.png filter=lfs diff=lfs merge=lfs -text +A-表番角色/被勇者队伍开除的驭兽使，邂逅了最强种的猫耳少女/beastTamerGirlpack_01.preview.png filter=lfs diff=lfs merge=lfs -text +A-表番角色/Re：从零开始的异世界生活/ramReZero_v1.preview.png filter=lfs diff=lfs merge=lfs -text +A-表番角色/Re：从零开始的异世界生活/ramREZero_v11.preview.png filter=lfs diff=lfs merge=lfs -text +A-表番角色/Re：从零开始的异世界生活/Rem_v2_FB.preview.png filter=lfs diff=lfs merge=lfs -text +A-表番角色/Re：从零开始的异世界生活/ReZeroRem_v10.preview.png filter=lfs diff=lfs merge=lfs -text +A-表番角色/RWBY/weissSchneeRWBY_weissSchneeV10.preview.png filter=lfs diff=lfs merge=lfs -text +A-表番角色/SPY×FAMILY间谍家家酒/yorBriarSpyFamily_lykonV1.preview.png filter=lfs diff=lfs merge=lfs -text +A-表番角色/TRINITY[[:space:]]SEVEN[[:space:]]魔道书7使者/asamiLilithTrinity_v10.preview.png filter=lfs diff=lfs merge=lfs -text diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/CHAR-NakaharaMizuki.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/CHAR-NakaharaMizuki.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..00ded9845c418eb57db469bd6a6dee7f0806b987 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/CHAR-NakaharaMizuki.civitai.info" @@ -0,0 +1,496 @@ +{ + "id": 108154, + "modelId": 101035, + "name": "v1.0", + "createdAt": "2023-07-01T19:26:40.344Z", + "updatedAt": "2023-07-01T19:29:17.957Z", + "trainedWords": [ + "Nakahara Mizuki", + "long hair", + "red-framed eyewear" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 252, + "ratingCount": 1, + "rating": 5 + }, + "model": { + "name": "Mizuki Nakahara | Lycoris Recoil", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "CHAR-NakaharaMizuki.safetensors", + "id": 76207, + "sizeKB": 18549.556640625, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-07-01T19:30:46.547Z", + "hashes": { + "AutoV1": "DE2F2560", + "AutoV2": "9C86FFE732", + "SHA256": "9C86FFE7323391919C6F51556754E0C64BB079C82D8D70AC0521706357F4AEDD", + "CRC32": "A56789D0", + "BLAKE3": "9F82BD04F85DB6D78AD1381F9629FB92F6143617DF56A520E3DEEA6C81293F79" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/108154" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/85877bff-1b04-4fb9-9807-3439d633033f/width=450/1361923.jpeg", + "nsfw": "None", + "width": 768, + "height": 1152, + "hash": "UXIEhK00oyxaWUayW=WB~VM{NGt7%MIVt6Rj", + "meta": { + "Size": "512x768", + "seed": 680115942, + "Model": "heavenorangemix_v23", + "steps": 25, + "hashes": { + "model": "a7c433adda" + }, + "prompt": "masterpiece, best quality, absurdres, perfect anatomy, 1girl, solo, Nakahara Mizuki, long hair, red-framed eyewear, high-waist skirt, long skirt, white skirt, black shirt, long sleeves, smile, standing, indoors, shopping mall", + "Version": "v1.4.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "a7c433adda", + "name": "heavenorangemix_v23", + "type": "model" + }, + { + "hash": "9caa11ab7a52", + "name": "06", + "type": "lora", + "weight": null + } + ], + "Model hash": "a7c433adda", + "Hires upscale": "1.5", + "AddNet Enabled": "True", + "AddNet Model 1": "NakaharaMizuki-06(9caa11ab7a52)", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "(worst quality, low quality:1.4), negative_hand-neg", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.6" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/85805dfd-6238-47b5-b1b7-96bcac853346/width=450/1361933.jpeg", + "nsfw": "Soft", + "width": 768, + "height": 1152, + "hash": "UdHetc^j*0R*OsS5E4V@rXxtROt7xZaK%1jY", + "meta": { + "Size": "512x768", + "seed": 3507975630, + "Model": "heavenorangemix_v23", + "steps": 25, + "hashes": { + "model": "a7c433adda" + }, + "prompt": "masterpiece, best quality, absurdres, perfect anatomy, 1girl, solo, Nakahara Mizuki, long hair, red-framed eyewear, ocean, smile, wet, water, sexy swimsuit, clothing cutout, one-piece, large breasts", + "Version": "v1.4.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "a7c433adda", + "name": "heavenorangemix_v23", + "type": "model" + }, + { + "hash": "9caa11ab7a52", + "name": "06", + "type": "lora", + "weight": null + } + ], + "Model hash": "a7c433adda", + "Hires upscale": "1.5", + "AddNet Enabled": "True", + "AddNet Model 1": "NakaharaMizuki-06(9caa11ab7a52)", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "(worst quality, low quality:1.4), negative_hand-neg", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.6" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/64c7004b-2971-4447-94fb-0ca31fa744f2/width=450/1361925.jpeg", + "nsfw": "None", + "width": 768, + "height": 1152, + "hash": "UAF#p%059Y0206~U029t-4$%Rk%MEj4;^iD,", + "meta": { + "Size": "512x768", + "seed": 3816726856, + "Model": "heavenorangemix_v23", + "steps": 25, + "hashes": { + "model": "a7c433adda" + }, + "prompt": "masterpiece, best quality, absurdres, perfect anatomy, 1girl, solo, Nakahara Mizuki, long hair, red-framed eyewear, indoors, kimono, hair flower, floral print, wariza, sitting, hands on own knees", + "Version": "v1.4.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "a7c433adda", + "name": "heavenorangemix_v23", + "type": "model" + }, + { + "hash": "9caa11ab7a52", + "name": "06", + "type": "lora", + "weight": null + } + ], + "Model hash": "a7c433adda", + "Hires upscale": "1.5", + "AddNet Enabled": "True", + "AddNet Model 1": "NakaharaMizuki-06(9caa11ab7a52)", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "(worst quality, low quality:1.4), negative_hand-neg", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.6" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d79ecbfe-d5c5-4b67-b89e-a769ffa2029f/width=450/1361932.jpeg", + "nsfw": "None", + "width": 768, + "height": 1152, + "hash": "UNH-x$=WDix]FgIpW=NfM{=]?GNy_NM{n~?a", + "meta": { + "Size": "512x768", + "seed": 1838093197, + "Model": "heavenorangemix_v23", + "steps": 25, + "hashes": { + "model": "a7c433adda" + }, + "prompt": "masterpiece, best quality, absurdres, perfect anatomy, 1girl, solo, Nakahara Mizuki, long hair, red-framed eyewear, astronaut suit, dutch angle, wide shot, smile, laughing, window, space station, planet, earth, galaxy, space, universe, star, milky way, nebula", + "Version": "v1.4.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "a7c433adda", + "name": "heavenorangemix_v23", + "type": "model" + }, + { + "hash": "9caa11ab7a52", + "name": "06", + "type": "lora", + "weight": null + } + ], + "Model hash": "a7c433adda", + "Hires upscale": "1.5", + "AddNet Enabled": "True", + "AddNet Model 1": "NakaharaMizuki-06(9caa11ab7a52)", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "(worst quality, low quality:1.4), negative_hand-neg", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.6" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/aaaf00fc-2922-4f62-b194-2aedf6c3a989/width=450/1361927.jpeg", + "nsfw": "None", + "width": 768, + "height": 1152, + "hash": "UOIhKO_20$S$k]-q^*k=tmtloM%3%Zo#Ro-o", + "meta": { + "Size": "512x768", + "seed": 639777804, + "Model": "heavenorangemix_v23", + "steps": 25, + "hashes": { + "model": "a7c433adda" + }, + "prompt": "masterpiece, best quality, absurdres, perfect anatomy, 1girl, solo, Nakahara Mizuki, long hair, red-framed eyewear, from behind, sundress, yellow sundress, garden, day, sunshine, smile, looking back", + "Version": "v1.4.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "a7c433adda", + "name": "heavenorangemix_v23", + "type": "model" + }, + { + "hash": "9caa11ab7a52", + "name": "06", + "type": "lora", + "weight": null + } + ], + "Model hash": "a7c433adda", + "Hires upscale": "1.5", + "AddNet Enabled": "True", + "AddNet Model 1": "NakaharaMizuki-06(9caa11ab7a52)", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "(worst quality, low quality:1.4), negative_hand-neg", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.6" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c17f71c5-67d0-4d77-8ee5-2536992fc848/width=450/1361930.jpeg", + "nsfw": "None", + "width": 768, + "height": 1152, + "hash": "UEGRxR00Y500_39E%gR+_N4.IVVsN^D%?HxZ", + "meta": { + "Size": "512x768", + "seed": 898597024, + "Model": "heavenorangemix_v23", + "steps": 25, + "hashes": { + "model": "a7c433adda" + }, + "prompt": "masterpiece, best quality, absurdres, perfect anatomy, 1girl, solo, Nakahara Mizuki, long hair, red-framed eyewear, graphic tee, denim shorts, standing, outdoors, city, hands in pockets", + "Version": "v1.4.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "a7c433adda", + "name": "heavenorangemix_v23", + "type": "model" + }, + { + "hash": "9caa11ab7a52", + "name": "06", + "type": "lora", + "weight": null + } + ], + "Model hash": "a7c433adda", + "Hires upscale": "1.5", + "AddNet Enabled": "True", + "AddNet Model 1": "NakaharaMizuki-06(9caa11ab7a52)", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "(worst quality, low quality:1.4), negative_hand-neg", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.6" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/41ec5498-8d4c-45d7-8e5e-f4e8bb5954cb/width=450/1361928.jpeg", + "nsfw": "Soft", + "width": 768, + "height": 1152, + "hash": "UDHA|X^k~89Z~V?b0L%19_aLEkM|Io^*t7Nb", + "meta": { + "Size": "512x768", + "seed": 2652947887, + "Model": "heavenorangemix_v23", + "steps": 25, + "hashes": { + "model": "a7c433adda" + }, + "prompt": "masterpiece, best quality, absurdres, perfect anatomy, 1girl, solo, Nakahara Mizuki, long hair, red-framed eyewear, elegant, long dress, black dress, halterneck, smile, indoors, reflective floor, ball room", + "Version": "v1.4.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "a7c433adda", + "name": "heavenorangemix_v23", + "type": "model" + }, + { + "hash": "9caa11ab7a52", + "name": "06", + "type": "lora", + "weight": null + } + ], + "Model hash": "a7c433adda", + "Hires upscale": "1.5", + "AddNet Enabled": "True", + "AddNet Model 1": "NakaharaMizuki-06(9caa11ab7a52)", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "(worst quality, low quality:1.4), negative_hand-neg", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.6" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2ffdb275-5dc3-430e-a52c-617d2f744017/width=450/1361931.jpeg", + "nsfw": "Soft", + "width": 768, + "height": 1152, + "hash": "UPHBi0~W.8o#M_RjD%WVJ8NGxuofIpofs.R*", + "meta": { + "Size": "512x768", + "seed": 2227004080, + "Model": "heavenorangemix_v23", + "steps": 25, + "hashes": { + "model": "a7c433adda" + }, + "prompt": "masterpiece, best quality, absurdres, perfect anatomy, 1girl, solo, Nakahara Mizuki, long hair, red-framed eyewear, wrist cuffs, playboy bunny, leotard, pantyhose, fake bunny ears, from side, contrapposto, smile, dynamic pose, cowboy shot, indoors, bedroom", + "Version": "v1.4.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "a7c433adda", + "name": "heavenorangemix_v23", + "type": "model" + }, + { + "hash": "9caa11ab7a52", + "name": "06", + "type": "lora", + "weight": null + } + ], + "Model hash": "a7c433adda", + "Hires upscale": "1.5", + "AddNet Enabled": "True", + "AddNet Model 1": "NakaharaMizuki-06(9caa11ab7a52)", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "(worst quality, low quality:1.4), negative_hand-neg", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.6" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b6915e91-9bb7-4181-8335-1b42c18ad085/width=450/1361929.jpeg", + "nsfw": "Soft", + "width": 768, + "height": 1152, + "hash": "U8JQ$X00001%4n_2?c8_8w_N4oV@KQwI4o~q", + "meta": { + "Size": "512x768", + "seed": 2254941120, + "Model": "heavenorangemix_v23", + "steps": 25, + "hashes": { + "model": "a7c433adda" + }, + "prompt": "masterpiece, best quality, absurdres, perfect anatomy, 1girl, solo, Nakahara Mizuki, long hair, red-framed eyewear, naked apron, cowboy shot, contrapposto, dynamic pose", + "Version": "v1.4.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "a7c433adda", + "name": "heavenorangemix_v23", + "type": "model" + }, + { + "hash": "9caa11ab7a52", + "name": "06", + "type": "lora", + "weight": null + } + ], + "Model hash": "a7c433adda", + "Hires upscale": "1.5", + "AddNet Enabled": "True", + "AddNet Model 1": "NakaharaMizuki-06(9caa11ab7a52)", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "(worst quality, low quality:1.4), negative_hand-neg", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.6" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/586f923a-275d-42d3-a038-9779b7e4e162/width=450/1361935.jpeg", + "nsfw": "X", + "width": 768, + "height": 1152, + "hash": "UQJtbq~p_NW=Ost8t7WX0KIUa0t7xZM{NGj?", + "meta": { + "Size": "512x768", + "seed": 3349565131, + "Model": "ChameleonAIRPGMix_v1.0prunedBakedVae", + "steps": 25, + "hashes": { + "model": "ca0e3359f7" + }, + "prompt": "masterpiece, best quality, absurdres, perfect anatomy, 1girl, solo, Nakahara Mizuki, long hair, red-framed eyewear, ponytail, (upper body), topless, from behind, back, nape, shoulder blades", + "Version": "v1.4.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "ca0e3359f7", + "name": "ChameleonAIRPGMix_v1.0prunedBakedVae", + "type": "model" + }, + { + "hash": "9caa11ab7a52", + "name": "06", + "type": "lora", + "weight": null + } + ], + "Model hash": "ca0e3359f7", + "Hires steps": "10", + "Hires upscale": "1.5", + "AddNet Enabled": "True", + "AddNet Model 1": "NakaharaMizuki-06(9caa11ab7a52)", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "(worst quality, low quality:1.4), negative_hand-neg", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.4" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/108154" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/CHAR-NakaharaMizuki.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/CHAR-NakaharaMizuki.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..001f63f1d42cd112f26e14260f756cd18c04d158 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/CHAR-NakaharaMizuki.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/CHAR-NakaharaMizuki.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/CHAR-NakaharaMizuki.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..878248cf8cc1d12ada20059c116ed59538251bc2 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/CHAR-NakaharaMizuki.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9c86ffe7323391919c6f51556754e0c64bb079c82d8d70ac0521706357f4aedd +size 18994746 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/chisatonishikigitest.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/chisatonishikigitest.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..c4a5b4c9ab5ed3a6fc1f2b2d9dfb9c7fb2fbf34b --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/chisatonishikigitest.civitai.info" @@ -0,0 +1,419 @@ +{ + "id": 105084, + "modelId": 98270, + "name": "v1.0", + "createdAt": "2023-06-27T09:20:20.293Z", + "updatedAt": "2023-06-27T09:22:31.813Z", + "trainedWords": [ + "nishikigi chisato, short hair, bangs, blonde hair, (red eyes:1.5), hair ribbon, one side up, bob cut,", + "shirt, long sleeves, dress, ribbon, white shirt, collared shirt, belt, neck ribbon, red dress, blue ribbon, pleated dress, grey dress, two-tone dress, red belt, lycoris uniform,", + "navel, bare shoulders, thighs, stomach, crop top, buruma, sportswear, zipper pull tab, red buruma, sports bikini,", + "japanese clothes, kimono, apron, red ribbon, waitress, red kimono,", + "shirt, bare shoulders, twintails, collarbone, hair ribbon, white shirt, frills, off shoulder, red ribbon, short twintails, off-shoulder shirt, frilled shirt," + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 93, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Chisato Nishikigi - Lycoris Recoil", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "chisatonishikigitest.safetensors", + "id": 73822, + "sizeKB": 37029.4619140625, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Pending", + "pickleScanMessage": null, + "virusScanResult": "Pending", + "scannedAt": null, + "hashes": {}, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/105084" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/701eece8-0b6a-47fd-9dad-0d203b873d01/width=450/1306780.jpeg", + "nsfw": "None", + "width": 600, + "height": 896, + "hash": "UeI}6W.8EgNI~WxuNbjFkVoejbt7Rke.oLoz", + "meta": { + "Size": "200x300", + "seed": 3251983037, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "chisatonishikigi, , nishikigi chisato, short hair, bangs, blonde hair, (red eyes:1.5), hair ribbon, one side up, bob cut,\nBREAK shirt, long sleeves, dress, ribbon, white shirt, collared shirt, belt, neck ribbon, red dress, blue ribbon, pleated dress, grey dress, two-tone dress, red belt, lycoris uniform,,\nBREAK outdoors, city,\nBREAK looking at viewer, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "chisatonishikigitest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"", + "\"chisatonishikigitest": "dd43c79687d0" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7b5ce36c-6f2a-4879-9011-43bf2f5d6ecc/width=450/1306776.jpeg", + "nsfw": "None", + "width": 600, + "height": 896, + "hash": "UGH-49Nt00?GO:E1I;^k?^aL8{xa-VNGMyR+", + "meta": { + "Size": "200x300", + "seed": 713428397, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "chisatonishikigi, , nishikigi chisato, short hair, bangs, blonde hair, (red eyes:1.5), hair ribbon, one side up, bob cut,\nBREAK japanese clothes, kimono, apron, red ribbon, waitress, red kimono,\nBREAK outdoors, track and field,\nBREAK looking at viewer, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "chisatonishikigitest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"", + "\"chisatonishikigitest": "dd43c79687d0" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9d5f554b-6024-439d-b481-9bf5eaed92e4/width=450/1306775.jpeg", + "nsfw": "Soft", + "width": 600, + "height": 896, + "hash": "UAJt9-_400^k^b0y02bF0e01Mdni?woMMx-o", + "meta": { + "Size": "200x300", + "seed": 1117962998, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "chisatonishikigi, , nishikigi chisato, short hair, bangs, blonde hair, (red eyes:1.5), hair ribbon, one side up, bob cut,\nBREAK shirt, bare shoulders, twintails, collarbone, hair ribbon, white shirt, frills, off shoulder, red ribbon, short twintails, off-shoulder shirt, frilled shirt,\nBREAK outdoors, city,\nBREAK looking at viewer, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "chisatonishikigitest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"", + "\"chisatonishikigitest": "dd43c79687d0" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/deebcf61-b463-4b76-8bf9-b6f36ffff1c1/width=450/1306774.jpeg", + "nsfw": "Soft", + "width": 600, + "height": 896, + "hash": "UHJjrO000K?an2E2xvj?56WBxtxZ~pE1M{ax", + "meta": { + "Size": "200x300", + "seed": 1117962997, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "chisatonishikigi, , nishikigi chisato, short hair, bangs, blonde hair, (red eyes:1.5), hair ribbon, one side up, bob cut,\nBREAK shirt, bare shoulders, twintails, collarbone, hair ribbon, white shirt, frills, off shoulder, red ribbon, short twintails, off-shoulder shirt, frilled shirt,\nBREAK outdoors, city,\nBREAK looking at viewer, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "chisatonishikigitest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"", + "\"chisatonishikigitest": "dd43c79687d0" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5116e266-536b-4450-8f4c-03a7bd5dac4f/width=450/1306778.jpeg", + "nsfw": "None", + "width": 600, + "height": 896, + "hash": "UHGkOZ0g00?G~p9tE2-p4.nOo#%Mv}WBaxWA", + "meta": { + "Size": "200x300", + "seed": 74475635, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "chisatonishikigi, , nishikigi chisato, short hair, bangs, blonde hair, (red eyes:1.5), hair ribbon, one side up, bob cut,\nBREAK shirt, bare shoulders, twintails, collarbone, hair ribbon, white shirt, frills, off shoulder, red ribbon, short twintails, off-shoulder shirt, frilled shirt,\nBREAK outdoors, city,\nBREAK looking at viewer, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "chisatonishikigitest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"", + "\"chisatonishikigitest": "dd43c79687d0" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f5780fbf-ea37-40c2-8f3a-684958392e95/width=450/1306777.jpeg", + "nsfw": "Mature", + "width": 600, + "height": 896, + "hash": "UMJ@5$010fIV~o9tr^NG%f$*8{kCRiR*kWsV", + "meta": { + "Size": "200x300", + "seed": 2512055641, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "chisatonishikigi, , nishikigi chisato, short hair, bangs, blonde hair, (red eyes:1.5), hair ribbon, one side up, bob cut,\nBREAK navel, bare shoulders, thighs, stomach, crop top, buruma, sportswear, zipper pull tab, red buruma, sports bikini,\nBREAK outdoors, track and field,\nBREAK looking at viewer, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "chisatonishikigitest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"", + "\"chisatonishikigitest": "dd43c79687d0" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6de0763c-5ff6-4dc3-b67f-f1fe2195649f/width=450/1306781.jpeg", + "nsfw": "Mature", + "width": 600, + "height": 896, + "hash": "UgMGI]~qKPNd.7OYt8ozf+jFRQRjRjR*R*WB", + "meta": { + "Size": "200x300", + "seed": 2512055640, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "chisatonishikigi, , nishikigi chisato, short hair, bangs, blonde hair, (red eyes:1.5), hair ribbon, one side up, bob cut,\nBREAK navel, bare shoulders, thighs, stomach, crop top, buruma, sportswear, zipper pull tab, red buruma, sports bikini,\nBREAK outdoors, track and field,\nBREAK looking at viewer, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "chisatonishikigitest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"", + "\"chisatonishikigitest": "dd43c79687d0" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d191bba4-9b5e-4039-aa37-2a22643905b0/width=450/1306779.jpeg", + "nsfw": "Soft", + "width": 600, + "height": 896, + "hash": "U$Kmwz~px]-p-pt8NbR+fkkCWBRjW=ofs:j[", + "meta": { + "Size": "200x300", + "seed": 25296626, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "chisatonishikigi, , nishikigi chisato, short hair, bangs, blonde hair, (red eyes:1.5), hair ribbon, one side up, bob cut,\nBREAK navel, bare shoulders, thighs, stomach, crop top, buruma, sportswear, zipper pull tab, red buruma, sports bikini,\nBREAK outdoors, track and field,\nBREAK looking at viewer, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "chisatonishikigitest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"", + "\"chisatonishikigitest": "dd43c79687d0" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/105084" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/chisatonishikigitest.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/chisatonishikigitest.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..578a9f39d5499dbb53fdec2f63bad6b899cf21aa Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/chisatonishikigitest.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/chisatonishikigitest.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/chisatonishikigitest.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..c380baa946c9b01695926ac6248dcef9ef986863 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/chisatonishikigitest.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:e3886e713a289d8b6651455ec572b1dc883e8baa336c4e691f2d1eda6f96dd10 +size 37918169 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/lycorisRecoilTakina_takinaInoueBeta01.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/lycorisRecoilTakina_takinaInoueBeta01.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..b263a10b3bd68ca942160e8157199b8ad691d153 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/lycorisRecoilTakina_takinaInoueBeta01.civitai.info" @@ -0,0 +1,172 @@ +{ + "id": 10072, + "modelId": 8543, + "name": "Takina Inoue beta-0.1", + "createdAt": "2023-02-13T16:23:40.304Z", + "updatedAt": "2023-02-13T16:23:40.304Z", + "trainedWords": [ + "long_hair,black_hair,ribbon,school_uniform,long_sleeves,jacket" + ], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": null, + "model": { + "name": "Lycoris Recoil-\u4e95\u4e0a\u6cf7\u5948/Takina Inoue", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "lycorisRecoilTakina_takinaInoueBeta01.safetensors", + "id": 9654, + "sizeKB": 36975.080078125, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-02-13T16:26:41.105Z", + "hashes": {}, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/10072" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0fa2e887-2684-408a-b466-3f242ff28400/width=450/98154.jpeg", + "nsfw": false, + "width": 800, + "height": 1000, + "hash": "URK-FB-p_49G%NIo~pa#^j-pIoa~tQxaogNH", + "meta": { + "ENSD": "31337", + "Size": "800x1000", + "seed": 1958903613, + "steps": 50, + "prompt": "white background,", + "sampler": "Euler a", + "cfgScale": 14, + "Clip skip": "2", + "Mask blur": "0", + "resources": [ + { + "hash": "a78cf5a3a6ce", + "name": "Inoue", + "type": "lora", + "weight": null + } + ], + "Model hash": "fbcf965a62", + "AddNet Enabled": "True", + "AddNet Model 1": "Takina Inoue(a78cf5a3a6ce)", + "negativePrompt": "malformed mutated,morbid,error,mutated,more than 2 thighs,malformed limbs,poorly drawn,poorly drawn hands,mutilated,missing fngers,fused fingers,more than 2 nipples,extra legs,disfigured,multiple breasts,bad face,fused anus,three arms,missing arms,missing limb,Missing limbs,missing fingers,malformed,mutated hands and fingers ,limb,mutated hands and fingers,cloned face,worstquality,low quality,long body,long neck,missing fingers,missing arms,bad hands,long neck,lowres,extra digit,jpeg artifacts,bad anatomy,signature,fewer digits,Humpbacked,cropped,watermark,text,worst quality,username,error,blurry,low quality,normal quality,bad anatomy disfigured malformed mutated,extra limbs,too many fingers,bad hands,mutated hands,bad anatomy,bad proportions,large breasts,too long legs,wrong colors,(Depth of field),big breasts,logo,Mosaic,braid,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.6", + "AddNet Weight B 1": "0.6", + "Denoising strength": "0.7" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e1156537-a5c2-4fdc-5046-aa689939a000/width=450/98157.jpeg", + "nsfw": false, + "width": 800, + "height": 1000, + "hash": "UyKwnS-p~Wxaxur?ofRP%1jZjZV@t7RQt7NG", + "meta": { + "ENSD": "31337", + "Size": "800x1000", + "seed": 3114934729, + "steps": 50, + "prompt": "best quality,highly detailed,masterpiece,ultra-detailed,solo,1girl,white background,delicate eyes,long_hair, black_hair, trembling, ribbon, school_uniform, long_sleeves, jacket,sitting, looking at viewer,", + "sampler": "Euler a", + "cfgScale": 14, + "Clip skip": "2", + "resources": [ + { + "hash": "a78cf5a3a6ce", + "name": "Inoue", + "type": "lora", + "weight": null + } + ], + "Model hash": "fbcf965a62", + "AddNet Enabled": "True", + "AddNet Model 1": "Takina Inoue(a78cf5a3a6ce)", + "negativePrompt": "malformed mutated,morbid,error,mutated,more than 2 thighs,malformed limbs,poorly drawn,poorly drawn hands,mutilated,missing fngers,fused fingers,more than 2 nipples,extra legs,disfigured,multiple breasts,bad face,fused anus,three arms,missing arms,missing limb,Missing limbs,missing fingers,malformed,mutated hands and fingers ,limb,mutated hands and fingers,cloned face,worstquality,low quality,long body,long neck,missing fingers,missing arms,bad hands,long neck,lowres,extra digit,jpeg artifacts,bad anatomy,signature,fewer digits,Humpbacked,cropped,watermark,text,worst quality,username,error,blurry,low quality,normal quality,bad anatomy disfigured malformed mutated,extra limbs,too many fingers,bad hands,mutated hands,bad anatomy,bad proportions,large breasts,too long legs,wrong colors,(Depth of field),big breasts,logo,Mosaic,(clothes)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.5", + "AddNet Weight B 1": "0.5" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2540aaa6-7a63-4a1f-a382-d187ef57be00/width=450/98156.jpeg", + "nsfw": false, + "width": 800, + "height": 1000, + "hash": "UvLzgT^+~WIV-;X8t7RjxaWBRkWB%LofofWB", + "meta": { + "ENSD": "31337", + "Size": "800x1000", + "seed": 3991847417, + "steps": 50, + "prompt": "best quality,highly detailed,masterpiece,ultra-detailed,solo,1girl,white background,delicate eyes,long_hair, black_hair, trembling, ribbon, school_uniform, long_sleeves, jacket,sitting, looking at viewer,", + "sampler": "Euler a", + "cfgScale": 14, + "Clip skip": "2", + "resources": [ + { + "hash": "a78cf5a3a6ce", + "name": "Inoue", + "type": "lora", + "weight": null + } + ], + "Model hash": "fbcf965a62", + "AddNet Enabled": "True", + "AddNet Model 1": "Takina Inoue(a78cf5a3a6ce)", + "negativePrompt": "malformed mutated,morbid,error,mutated,more than 2 thighs,malformed limbs,poorly drawn,poorly drawn hands,mutilated,missing fngers,fused fingers,more than 2 nipples,extra legs,disfigured,multiple breasts,bad face,fused anus,three arms,missing arms,missing limb,Missing limbs,missing fingers,malformed,mutated hands and fingers ,limb,mutated hands and fingers,cloned face,worstquality,low quality,long body,long neck,missing fingers,missing arms,bad hands,long neck,lowres,extra digit,jpeg artifacts,bad anatomy,signature,fewer digits,Humpbacked,cropped,watermark,text,worst quality,username,error,blurry,low quality,normal quality,bad anatomy disfigured malformed mutated,extra limbs,too many fingers,bad hands,mutated hands,bad anatomy,bad proportions,large breasts,too long legs,wrong colors,(Depth of field),big breasts,logo,Mosaic,(clothes)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.45", + "AddNet Weight B 1": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7d267c67-a65c-4810-9c0a-bc944b9e2d00/width=450/98155.jpeg", + "nsfw": false, + "width": 800, + "height": 1000, + "hash": "UqL|=fIU~qt8t7ofxvt7t7xu%2ofkWR*oLWU", + "meta": { + "ENSD": "31337", + "Size": "800x1000", + "seed": 2683808970, + "steps": 50, + "prompt": "best quality,highly detailed,masterpiece,ultra-detailed,solo,1girl,white background,delicate eyes,long_hair, black_hair, trembling, ribbon, school_uniform, long_sleeves, jacket,wariza,looking at viewer, expressionless, backlighting,", + "sampler": "Euler a", + "cfgScale": 14, + "Clip skip": "2", + "resources": [ + { + "hash": "a78cf5a3a6ce", + "name": "Inoue", + "type": "lora", + "weight": null + } + ], + "Model hash": "fbcf965a62", + "AddNet Enabled": "True", + "AddNet Model 1": "Takina Inoue(a78cf5a3a6ce)", + "negativePrompt": "malformed mutated,morbid,error,mutated,more than 2 thighs,malformed limbs,poorly drawn,poorly drawn hands,mutilated,missing fngers,fused fingers,more than 2 nipples,extra legs,disfigured,multiple breasts,bad face,fused anus,three arms,missing arms,missing limb,Missing limbs,missing fingers,malformed,mutated hands and fingers ,limb,mutated hands and fingers,cloned face,worstquality,low quality,long body,long neck,missing fingers,missing arms,bad hands,long neck,lowres,extra digit,jpeg artifacts,bad anatomy,signature,fewer digits,Humpbacked,cropped,watermark,text,worst quality,username,error,blurry,low quality,normal quality,bad anatomy disfigured malformed mutated,extra limbs,too many fingers,bad hands,mutated hands,bad anatomy,bad proportions,large breasts,too long legs,wrong colors,(Depth of field),big breasts,logo,Mosaic,(clothes)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.45", + "AddNet Weight B 1": "0.45" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/10072" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/lycorisRecoilTakina_takinaInoueBeta01.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/lycorisRecoilTakina_takinaInoueBeta01.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..d77df2b769abad447771a07d4d057706298c7614 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/lycorisRecoilTakina_takinaInoueBeta01.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/lycorisRecoilTakina_takinaInoueBeta01.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/lycorisRecoilTakina_takinaInoueBeta01.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..94e4c6c43856dc48ff0e21577ccea68d06c05eaa --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/lycorisRecoilTakina_takinaInoueBeta01.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:28a52ff63caedec8d4816b34110baa8e96783da0a30612c784f3ab4f909eaabb +size 37862482 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/lycorisRecoil_chisatoV10.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/lycorisRecoil_chisatoV10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..68876194ec24af48294dc7eb800dc70aea339937 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/lycorisRecoil_chisatoV10.civitai.info" @@ -0,0 +1,282 @@ +{ + "id": 9989, + "modelId": 8473, + "name": "Chisato v1.0", + "createdAt": "2023-02-13T11:28:44.815Z", + "updatedAt": "2023-02-13T17:04:30.451Z", + "trainedWords": [ + "red_jacket, ribbon,red_eyes,blond hair,short hair,hair_ribbon,smile," + ], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": null, + "model": { + "name": "Lycoris Recoil-\u9526\u6728\u5343\u675f/Nishikigi Chisato", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "lycorisRecoil_chisatoV10.safetensors", + "id": 9608, + "sizeKB": 36975.0908203125, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-02-13T11:31:18.425Z", + "hashes": { + "AutoV1": "24560B67", + "AutoV2": "48ED45A707", + "SHA256": "48ED45A7079B9D6F63F285D1B630338D9FCE81B17DE2B374368B9B4261B8A200", + "CRC32": "B75FDE52", + "BLAKE3": "973E8AF9BEE0398D11916253C5E6D39E35C62EF633FA07A66EE2F99037294648" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/9989" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/540fe64c-193c-4083-d651-3e88effa9400/width=450/98222.jpeg", + "nsfw": true, + "width": 800, + "height": 1000, + "hash": "URK-FB-p_49G%NIo~pa#^j-pIoa~tQxaogNH", + "meta": { + "ENSD": "31337", + "Size": "800x1000", + "seed": 1958903613, + "steps": 50, + "prompt": "white background,", + "sampler": "Euler a", + "cfgScale": 14, + "Clip skip": "2", + "Mask blur": "0", + "resources": [ + { + "hash": "a78cf5a3a6ce", + "name": "Inoue", + "type": "lora", + "weight": null + } + ], + "Model hash": "fbcf965a62", + "AddNet Enabled": "True", + "AddNet Model 1": "Takina Inoue(a78cf5a3a6ce)", + "negativePrompt": "malformed mutated,morbid,error,mutated,more than 2 thighs,malformed limbs,poorly drawn,poorly drawn hands,mutilated,missing fngers,fused fingers,more than 2 nipples,extra legs,disfigured,multiple breasts,bad face,fused anus,three arms,missing arms,missing limb,Missing limbs,missing fingers,malformed,mutated hands and fingers ,limb,mutated hands and fingers,cloned face,worstquality,low quality,long body,long neck,missing fingers,missing arms,bad hands,long neck,lowres,extra digit,jpeg artifacts,bad anatomy,signature,fewer digits,Humpbacked,cropped,watermark,text,worst quality,username,error,blurry,low quality,normal quality,bad anatomy disfigured malformed mutated,extra limbs,too many fingers,bad hands,mutated hands,bad anatomy,bad proportions,large breasts,too long legs,wrong colors,(Depth of field),big breasts,logo,Mosaic,braid,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.6", + "AddNet Weight B 1": "0.6", + "Denoising strength": "0.7" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/713a46f5-aac0-4230-5d41-6093c71c3600/width=450/97340.jpeg", + "nsfw": false, + "width": 800, + "height": 1000, + "hash": "ULJ7m[4:*0#+.74:n+Io56IVIAozM{RjxuWB", + "meta": { + "ENSD": "31337", + "Size": "800x1000", + "seed": 270235727, + "steps": 50, + "prompt": "(+++++waving:1.2),", + "sampler": "Euler a", + "cfgScale": 14, + "Clip skip": "2", + "Mask blur": "4", + "resources": [ + { + "hash": "6580eaf6cc41", + "name": "Chisato", + "type": "lora", + "weight": null + } + ], + "Model hash": "fbcf965a62", + "AddNet Enabled": "True", + "AddNet Model 1": "Nishikigi Chisato(6580eaf6cc41)", + "negativePrompt": "malformed mutated,morbid,error,mutated,more than 2 thighs,malformed limbs,poorly drawn,poorly drawn hands,mutilated,missing fngers,fused fingers,more than 2 nipples,extra legs,disfigured,multiple breasts,bad face,fused anus,three arms,missing arms,missing limb,Missing limbs,missing fingers,malformed,mutated hands and fingers ,limb,mutated hands and fingers,cloned face,worstquality,low quality,long body,long neck,missing fingers,missing arms,bad hands,long neck,lowres,extra digit,jpeg artifacts,bad anatomy,signature,fewer digits,Humpbacked,cropped,watermark,text,worst quality,username,error,blurry,low quality,normal quality,bad anatomy disfigured malformed mutated,extra limbs,too many fingers,bad hands,mutated hands,bad anatomy,bad proportions,large breasts,too long legs,wrong colors,(Depth of field),big breasts,logo,Mosaic,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.5", + "AddNet Weight B 1": "0.5", + "Denoising strength": "0.75" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e74f3cca-de6d-494a-7ae4-574d52d59f00/width=450/97343.jpeg", + "nsfw": false, + "width": 800, + "height": 1000, + "hash": "UML3x|00JWg3Z#M|MxjF_ME1RkRjI.X8S$tR", + "meta": { + "ENSD": "31337", + "Size": "800x1000", + "seed": 3782898868, + "steps": 50, + "prompt": "floor", + "sampler": "Euler a", + "cfgScale": 14, + "Clip skip": "2", + "Mask blur": "4", + "resources": [ + { + "hash": "6580eaf6cc41", + "name": "Chisato", + "type": "lora", + "weight": null + } + ], + "Model hash": "fbcf965a62", + "AddNet Enabled": "True", + "AddNet Model 1": "Nishikigi Chisato(6580eaf6cc41)", + "negativePrompt": "malformed mutated,morbid,error,mutated,more than 2 thighs,malformed limbs,poorly drawn,poorly drawn hands,mutilated,missing fngers,fused fingers,more than 2 nipples,extra legs,disfigured,multiple breasts,bad face,fused anus,three arms,missing arms,missing limb,Missing limbs,missing fingers,malformed,mutated hands and fingers ,limb,mutated hands and fingers,cloned face,worstquality,low quality,long body,long neck,missing fingers,missing arms,bad hands,long neck,lowres,extra digit,jpeg artifacts,bad anatomy,signature,fewer digits,Humpbacked,cropped,watermark,text,worst quality,username,error,blurry,low quality,normal quality,bad anatomy disfigured malformed mutated,extra limbs,too many fingers,bad hands,mutated hands,bad anatomy,bad proportions,large breasts,too long legs,wrong colors,(Depth of field),big breasts,logo,Mosaic,shoes,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.5", + "AddNet Weight B 1": "0.5", + "Denoising strength": "0.75" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/44d25b4e-cff3-4671-14aa-aa9022e21e00/width=450/97342.jpeg", + "nsfw": false, + "width": 800, + "height": 1000, + "hash": "UYL|ZO4..TaJ_2xuW=t6?uofV[g3x]%Mxuay", + "meta": { + "ENSD": "31337", + "Size": "800x1000", + "seed": 1453778639, + "steps": 50, + "prompt": "arms behind back,", + "sampler": "Euler a", + "cfgScale": 14, + "Clip skip": "2", + "Mask blur": "4", + "resources": [ + { + "hash": "6580eaf6cc41", + "name": "Chisato", + "type": "lora", + "weight": null + } + ], + "Model hash": "fbcf965a62", + "AddNet Enabled": "True", + "AddNet Model 1": "Nishikigi Chisato(6580eaf6cc41)", + "negativePrompt": "malformed mutated,morbid,error,mutated,more than 2 thighs,malformed limbs,poorly drawn,poorly drawn hands,mutilated,missing fngers,fused fingers,more than 2 nipples,extra legs,disfigured,multiple breasts,bad face,fused anus,three arms,missing arms,missing limb,Missing limbs,missing fingers,malformed,mutated hands and fingers ,limb,mutated hands and fingers,cloned face,worstquality,low quality,long body,long neck,missing fingers,missing arms,bad hands,long neck,lowres,extra digit,jpeg artifacts,bad anatomy,signature,fewer digits,Humpbacked,cropped,watermark,text,worst quality,username,error,blurry,low quality,normal quality,bad anatomy disfigured malformed mutated,extra limbs,too many fingers,bad hands,mutated hands,bad anatomy,bad proportions,large breasts,too long legs,wrong colors,(Depth of field),big breasts,logo,Mosaic,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.5", + "AddNet Weight B 1": "0.5", + "Denoising strength": "0.75" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4228fde2-d783-4013-503b-72ac40729a00/width=450/97341.jpeg", + "nsfw": true, + "width": 800, + "height": 1000, + "hash": "UlL|o*xao~jb~ptRogf6%1WCIpozR*oe%2of", + "meta": { + "ENSD": "31337", + "Size": "800x1000", + "seed": 4284122407, + "steps": 50, + "prompt": "best quality,highly detailed,masterpiece,ultra-detailed,1girl,(white background),Delicate eyes,ribbon,red_eyes,blond hair,short hair,hair_ribbon,smile,(++standing:1.3),(+++++looking back:1.2),upper body, nsfw,nude,string_panties", + "sampler": "Euler a", + "cfgScale": 14, + "Clip skip": "2", + "resources": [ + { + "hash": "6580eaf6cc41", + "name": "Chisato", + "type": "lora", + "weight": null + } + ], + "Model hash": "fbcf965a62", + "AddNet Enabled": "True", + "AddNet Model 1": "Nishikigi Chisato(6580eaf6cc41)", + "negativePrompt": "malformed mutated,morbid,error,mutated,more than 2 thighs,malformed limbs,poorly drawn,poorly drawn hands,mutilated,missing fngers,fused fingers,more than 2 nipples,extra legs,disfigured,multiple breasts,bad face,fused anus,three arms,missing arms,missing limb,Missing limbs,missing fingers,malformed,mutated hands and fingers ,limb,mutated hands and fingers,cloned face,worstquality,low quality,long body,long neck,missing fingers,missing arms,bad hands,long neck,lowres,extra digit,jpeg artifacts,bad anatomy,signature,fewer digits,Humpbacked,cropped,watermark,text,worst quality,username,error,blurry,low quality,normal quality,bad anatomy disfigured malformed mutated,extra limbs,too many fingers,bad hands,mutated hands,bad anatomy,bad proportions,large breasts,too long legs,wrong colors,(Depth of field),big breasts,logo,Mosaic,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.5", + "AddNet Weight B 1": "0.5" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/932769fb-162d-40c8-72f5-09fc8934e900/width=450/97339.jpeg", + "nsfw": false, + "width": 800, + "height": 1000, + "hash": "ULK^jP?v5?~C~Wxu?us._3niM}oz_2jZD*X8", + "meta": { + "ENSD": "31337", + "Size": "800x1000", + "seed": 2030881719, + "steps": 50, + "prompt": "expressionless,", + "sampler": "Euler a", + "cfgScale": 14, + "Clip skip": "2", + "Mask blur": "4", + "resources": [ + { + "hash": "6580eaf6cc41", + "name": "Chisato", + "type": "lora", + "weight": null + } + ], + "Model hash": "fbcf965a62", + "AddNet Enabled": "True", + "AddNet Model 1": "Nishikigi Chisato(6580eaf6cc41)", + "negativePrompt": "malformed mutated,morbid,error,mutated,more than 2 thighs,malformed limbs,poorly drawn,poorly drawn hands,mutilated,missing fngers,fused fingers,more than 2 nipples,extra legs,disfigured,multiple breasts,bad face,fused anus,three arms,missing arms,missing limb,Missing limbs,missing fingers,malformed,mutated hands and fingers ,limb,mutated hands and fingers,cloned face,worstquality,low quality,long body,long neck,missing fingers,missing arms,bad hands,long neck,lowres,extra digit,jpeg artifacts,bad anatomy,signature,fewer digits,Humpbacked,cropped,watermark,text,worst quality,username,error,blurry,low quality,normal quality,bad anatomy disfigured malformed mutated,extra limbs,too many fingers,bad hands,mutated hands,bad anatomy,bad proportions,large breasts,too long legs,wrong colors,(Depth of field),big breasts,logo,Mosaic,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.5", + "AddNet Weight B 1": "0.5", + "Denoising strength": "0.75" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7ffc6544-2672-40f5-db9d-7f7b98f0a700/width=450/97338.jpeg", + "nsfw": false, + "width": 800, + "height": 1000, + "hash": "UdLzmr^+?wbb_2n$IpWB%gx]WCV[%gx]tRof", + "meta": { + "ENSD": "31337", + "Size": "800x1000", + "seed": 2688019458, + "steps": 50, + "prompt": "best quality,highly detailed,masterpiece,ultra-detailed,1girl,(white background),Delicate eyes,red_jacket, ribbon, red_eyes,blond hair,short hair,hair_ribbon,smile", + "sampler": "Euler a", + "cfgScale": 14, + "Clip skip": "2", + "resources": [ + { + "hash": "6580eaf6cc41", + "name": "Chisato", + "type": "lora", + "weight": null + } + ], + "Model hash": "fbcf965a62", + "AddNet Enabled": "True", + "AddNet Model 1": "Nishikigi Chisato(6580eaf6cc41)", + "negativePrompt": "malformed mutated,morbid,error,mutated,more than 2 thighs,malformed limbs,poorly drawn,poorly drawn hands,mutilated,missing fngers,fused fingers,more than 2 nipples,extra legs,disfigured,multiple breasts,bad face,fused anus,three arms,missing arms,missing limb,Missing limbs,missing fingers,malformed,mutated hands and fingers ,limb,mutated hands and fingers,cloned face,worstquality,low quality,long body,long neck,missing fingers,missing arms,bad hands,long neck,lowres,extra digit,jpeg artifacts,bad anatomy,signature,fewer digits,Humpbacked,cropped,watermark,text,worst quality,username,error,blurry,low quality,normal quality,bad anatomy disfigured malformed mutated,extra limbs,too many fingers,bad hands,mutated hands,bad anatomy,bad proportions,large breasts,too long legs,wrong colors,(Depth of field),big breasts,logo,Mosaic,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.5", + "AddNet Weight B 1": "0.5" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/9989" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/lycorisRecoil_chisatoV10.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/lycorisRecoil_chisatoV10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..d77df2b769abad447771a07d4d057706298c7614 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/lycorisRecoil_chisatoV10.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/lycorisRecoil_chisatoV10.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/lycorisRecoil_chisatoV10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..f8746093555672f59823c24fad33fce39118fd75 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/lycorisRecoil_chisatoV10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:48ed45a7079b9d6f63f285d1b630338d9fce81b17de2b374368b9b4261b8a200 +size 37862493 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/takinainoue.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/takinainoue.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..433049bd41ad7f1c2656fa8037c73897d6ea26ce --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/takinainoue.civitai.info" @@ -0,0 +1,381 @@ +{ + "id": 104210, + "modelId": 97491, + "name": "v1.0", + "createdAt": "2023-06-26T03:02:37.041Z", + "updatedAt": "2023-06-26T03:04:25.668Z", + "trainedWords": [ + "inoue takina, long hair, bangs, black hair, (purple eyes:1.2),", + "inoue takina, long hair, bangs, ponytail, black hair, (purple eyes:1.2),", + "inoue takina, long hair, bangs, twintails, black hair, (purple eyes:1.2),", + "shirt, long sleeves, dress, ribbon, school uniform, white shirt, collared shirt, belt, neck ribbon, blue dress, green ribbon, pleated dress, grey dress, two-tone dress, blue belt, lycoris uniform,", + "crop top, white socks, buruma, sports bra, sportswear, wristwatch, sports bikini,", + "gloves, long sleeves, jacket, necktie, black gloves, collared shirt, belt, pants, vest, black jacket, black pants, formal, suit, red necktie, headset, black suit, earpiece,", + "japanese clothes, kimono, apron, waist apron, blue kimono, waitress," + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "", + "stats": { + "downloadCount": 180, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Takina Inoue - Lycoris Recoil", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "takinainoue.safetensors", + "id": 73177, + "sizeKB": 37013.3876953125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-26T03:05:47.214Z", + "hashes": { + "AutoV1": "806B0CAF", + "AutoV2": "809249FE4E", + "SHA256": "809249FE4E83C9C144C6C3A429BB01023C997C6BBE34530292B708AF1D45B438", + "CRC32": "A62B07D5", + "BLAKE3": "4AFBA714E8A0FBE2D5E78DE50B3A549E31061D72F195654EC8D36B39D21903C5" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/104210" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/73c62cda-d5d8-4dbf-8797-4619bcfe7029/width=450/1291780.jpeg", + "nsfw": "None", + "width": 600, + "height": 896, + "hash": "UgJHdi^+~p%Mxts:%LNG-oNGt7fkS2ayxZog", + "meta": { + "Size": "200x300", + "seed": 45205232, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "takinainoue, , inoue takina, long hair, bangs, black hair, (purple eyes:1.2), BREAK shirt, long sleeves, dress, ribbon, school uniform, white shirt, collared shirt, belt, neck ribbon, blue dress, green ribbon, pleated dress, grey dress, two-tone dress, blue belt, lycoris uniform, BREAK outdoors, city, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "takinainoue", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "\"takinainoue": "fd319071d9ab", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2837d125-e656-4009-a2ad-49fb60fad7b7/width=450/1291779.jpeg", + "nsfw": "None", + "width": 600, + "height": 896, + "hash": "UHF#,l00xV?a~UD*%2tP~VM{R,%2^+IUt7%M", + "meta": { + "Size": "200x300", + "seed": 305759261, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "takinainoue, , inoue takina, long hair, bangs, black hair, (purple eyes:1.2), BREAK shirt, long sleeves, dress, ribbon, school uniform, white shirt, collared shirt, belt, neck ribbon, blue dress, green ribbon, pleated dress, grey dress, two-tone dress, blue belt, lycoris uniform, BREAK outdoors, city, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "takinainoue", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "\"takinainoue": "fd319071d9ab", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/fd013ddd-7541-4811-81ef-1ac0c63883a8/width=450/1291777.jpeg", + "nsfw": "None", + "width": 600, + "height": 896, + "hash": "UhKAsa%0~Vxb^+NHxuofjDM|Rnj?R:V@$%s:", + "meta": { + "Size": "200x300", + "seed": 1477243544, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "takinainoue, , inoue takina, long hair, bangs, black hair, twintails, (purple eyes:1.2), (small breast:1.2), BREAK japanese clothes, kimono, apron, waist apron, blue kimono, waitress, BREAK indoors, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "takinainoue", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "\"takinainoue": "fd319071d9ab", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c93c5b2e-dcc5-4150-8f65-6529e8106750/width=450/1291775.jpeg", + "nsfw": "None", + "width": 600, + "height": 896, + "hash": "UDD+[9?c*0S6_3o#E1i^x^Io-p-U-pxt%MIV", + "meta": { + "Size": "200x300", + "seed": 521260647, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "takinainoue, , inoue takina, long hair, bangs, black hair, (purple eyes:1.2), (small breast:1.2), BREAK gloves, long sleeves, jacket, ponytail, necktie, black gloves, collared shirt, belt, pants, vest, black jacket, black pants, formal, suit, red necktie, headset, black suit, earpiece,, BREAK outdoors, city, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "takinainoue", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "\"takinainoue": "fd319071d9ab", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6ffef169-407c-448f-adb6-f18217864c8a/width=450/1291776.jpeg", + "nsfw": "Soft", + "width": 600, + "height": 896, + "hash": "URL4BDpJ_N%gE0TJ~WW=xu$*tRofo~t7smWA", + "meta": { + "Size": "200x300", + "seed": 56935925, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "takinainoue, , inoue takina, long hair, bangs, black hair, (purple eyes:1.2), (small breast:1.2), BREAK socks, crop top, white socks, buruma, sports bra, sportswear, wristwatch, sports bikini, BREAK outdoors, city, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "takinainoue", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "\"takinainoue": "fd319071d9ab", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4ff60da4-5319-4e14-84cc-a44ac5fd8b7a/width=450/1291774.jpeg", + "nsfw": "None", + "width": 600, + "height": 896, + "hash": "USEofF^+tRIo~W%2t7WCNGWCxtt7IofRxtWV", + "meta": { + "Size": "200x300", + "seed": 1023596256, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "takinainoue, , inoue takina, long hair, bangs, black hair, (purple eyes:1.2), (small breast:1.2), BREAK gloves, long sleeves, jacket, ponytail, necktie, black gloves, collared shirt, belt, pants, vest, black jacket, black pants, formal, suit, red necktie, headset, black suit, earpiece,, BREAK outdoors, city, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "takinainoue", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "\"takinainoue": "fd319071d9ab", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2c474f5b-f4ae-4cfc-b785-971afd9de4cc/width=450/1291778.jpeg", + "nsfw": "Soft", + "width": 600, + "height": 896, + "hash": "UPKAmL?^yCbwkXOZ~WozM}%3o#R*tmxuV@fQ", + "meta": { + "Size": "200x300", + "seed": 56935926, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "takinainoue, , inoue takina, long hair, bangs, black hair, (purple eyes:1.2), (small breast:1.2), BREAK socks, crop top, white socks, buruma, sports bra, sportswear, wristwatch, sports bikini, BREAK outdoors, city, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "takinainoue", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "\"takinainoue": "fd319071d9ab", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/104210" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/takinainoue.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/takinainoue.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..31b8169b9a55173a0e72e1353d00373c62c6fb53 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/takinainoue.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/takinainoue.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/takinainoue.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..72fe4541f5c064ebeffd5374ea3245aadd9d1dfe --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Lycoris Recoil/takinainoue.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:809249fe4e83c9c144c6c3a429bb01023c997c6bbe34530292b708af1d45b438 +size 37901709 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/aoba-10.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/aoba-10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..a1c5ddc60c641117ddd5f01aa33ab3bcb0915294 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/aoba-10.civitai.info" @@ -0,0 +1,89 @@ +{ + "id": 111627, + "modelId": 104168, + "name": "v2.0", + "createdAt": "2023-07-06T15:52:41.618Z", + "updatedAt": "2023-07-06T15:53:52.871Z", + "trainedWords": [ + "suzukaze aoba" + ], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 294, + "ratingCount": 2, + "rating": 5 + }, + "model": { + "name": "Suzukaze Aoba - New Game!", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "aoba-10.safetensors", + "id": 79036, + "sizeKB": 18555.4208984375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-07-06T15:55:42.257Z", + "hashes": { + "AutoV1": "DE2F2560", + "AutoV2": "7F51926A51", + "SHA256": "7F51926A51B864A04B712101D1945565F5FA93B822DFFE9DF987C63982F8F165", + "CRC32": "F492E16D", + "BLAKE3": "97A69618B3D9E050EFEACA8C37D771A7C3A1BC4D128BB946D3C8D3F243F4FAC2" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/111627" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/67e7c781-beef-4401-99dd-813d5943df9a/width=450/1435219.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "UVF=m?~px[?a?IR+E1xuRkRjRjWCNGaeoJR*", + "meta": { + "Size": "512x768", + "seed": 637321843, + "\"aoba": "7b23a56e7445\"", + "Model": "sweetMix_v21", + "steps": 35, + "hashes": { + "model": "9e4f6f7a28" + }, + "prompt": "(extremely detailed CG unity 8k wallpaper), (masterpiece), (best quality), (ultra-detailed), (best illustration), (best shadow), (absurdres), 1girl, solo, , suzukaze aoba, formal, suit, skirt, looking at viewer, smile, own hands together", + "Version": "## 1.4.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "clipSkip": 2, + "resources": [ + { + "name": "aoba", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "9e4f6f7a28", + "name": "sweetMix_v21", + "type": "model" + } + ], + "Model hash": "9e4f6f7a28", + "negativePrompt": "extra fingers, fewer fingers, bad-hands-5, by bad-artist, (bad eyes:1.2), (misfigured pupils:1.2), (bad clothing:1.3), (undetailed clothing:1.3), ng_deepnegative_v1_75t, verybadimagenegative_v1.3, (nonsensical backrounds:1.2), (bad backrounds:1.2), (bad shadows:1.2), (bad anatomy:1.1)," + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/111627" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/aoba-10.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/aoba-10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..2d579449bc57d57827cffab1e0a6aed317247cb8 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/aoba-10.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/aoba-10.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/aoba-10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..41d14c6adb64611d6632d282e238353b68832675 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/aoba-10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:7f51926a51b864a04b712101d1945565f5fa93b822dffe9df987c63982f8f165 +size 19000751 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/aobatest.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/aobatest.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..cad05500aae0a514bdfb2973560948167f1cc835 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/aobatest.civitai.info" @@ -0,0 +1,330 @@ +{ + "id": 111894, + "modelId": 104385, + "name": "v1.0", + "createdAt": "2023-07-07T01:02:19.243Z", + "updatedAt": "2023-07-07T01:09:17.610Z", + "trainedWords": [ + "aoba suzukaze, eyebrows, hair ornament, long hair, (purple eyes:1.1), purple hair, twintails,", + "blue skirt, bow, bowtie, business suit, dress shirt, formal, neck ribbon, pink bow, pink bowtie, pink ribbon, ribbon, shirt, skirt, skirt suit, suit, white shirt" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 38, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Aoba Suzukaze - New Game!", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "aobatest.safetensors", + "id": 79238, + "sizeKB": 37039.341796875, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-07-07T01:05:49.146Z", + "hashes": { + "AutoV1": "4678FF15", + "AutoV2": "E0961D269C", + "SHA256": "E0961D269C87F52712F371FEED0DD4B0FBA27FCA14ACDB7417E50896E15A08EC", + "CRC32": "7223299B", + "BLAKE3": "FAEFE20B19945502B1A8F6EACC9504BCD3864DA6B59D98EC9BD0EEA8B404E588" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/111894" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0b7eb209-3176-4d8c-b91f-4660c0f51008/width=450/1440575.jpeg", + "nsfw": "None", + "width": 600, + "height": 896, + "hash": "UcIhHv%M%g-;~XE1InR*RjE1Ioj]NHt7%2t7", + "meta": { + "Size": "200x300", + "seed": 3444170215, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "aobasuzukaze, , \naoba suzukaze, eyebrows, hair ornament, long hair, (purple eyes:1.1), purple hair, twintails,\nBREAK blue skirt, bow, bowtie, business suit, dress shirt, formal, neck ribbon, pink bow, pink bowtie, pink ribbon, ribbon, shirt, skirt, skirt suit, suit, white shirt,\nBREAK looking at viewer,\nBREAK indoors, office,\nBREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "\"aobatest": "6c3803c9e4c0", + "resources": [ + { + "name": "aobatest", + "type": "lora", + "weight": 0.75 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3, (hair between eyes:2)", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7a19b0b6-0b3a-4784-ac70-2ca1bd2e2034/width=450/1440576.jpeg", + "nsfw": "None", + "width": 600, + "height": 896, + "hash": "UfF5daE1NEM|~WM{NFWBxaf8WBfPj]azt6WB", + "meta": { + "Size": "200x300", + "seed": 3463041105, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "aobasuzukaze, , \naoba suzukaze, eyebrows, hair ornament, long hair, (purple eyes:1.1), purple hair, twintails, (flat chest:1.2),\nBREAK blue skirt, bow, bowtie, business suit, dress shirt, formal, neck ribbon, pink bow, pink bowtie, pink ribbon, ribbon, shirt, skirt, skirt suit, suit, white shirt,\nBREAK looking at viewer,\nBREAK indoors, office,\nBREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "\"aobatest": "6c3803c9e4c0", + "resources": [ + { + "name": "aobatest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3, (hair between eyes:2)", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9b107a8d-42bb-43d0-8bbe-cb5fbe54e6c3/width=450/1440593.jpeg", + "nsfw": "Mature", + "width": 600, + "height": 896, + "hash": "UPMsf]PCKh~qtA9u?GNGV|$*a^M|yDoyW9of", + "meta": { + "Size": "200x300", + "seed": 1583964543, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "aobasuzukaze, , \naoba suzukaze, eyebrows, hair ornament, long hair, (purple eyes:1.1), purple hair, twintails, (flat chest:1.2),\nBREAK bikini,\nBREAK looking at viewer,\nBREAK outdoors, beach,\nBREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "\"aobatest": "6c3803c9e4c0", + "resources": [ + { + "name": "aobatest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3, (hair between eyes:2)", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8d33d644-2d8d-4dca-8686-61035386191d/width=450/1440591.jpeg", + "nsfw": "Mature", + "width": 600, + "height": 896, + "hash": "UNN0MQA^*I%#^,yD^j-pE2wcxsj]xuRjR%n+", + "meta": { + "Size": "200x300", + "seed": 1583964542, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "aobasuzukaze, , \naoba suzukaze, eyebrows, hair ornament, long hair, (purple eyes:1.1), purple hair, twintails, (flat chest:1.2),\nBREAK bikini,\nBREAK looking at viewer,\nBREAK outdoors, beach,\nBREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "\"aobatest": "6c3803c9e4c0", + "resources": [ + { + "name": "aobatest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3, (hair between eyes:2)", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7491a34c-c7e7-4180-b74d-bd82205ca0f3/width=450/1440592.jpeg", + "nsfw": "Mature", + "width": 600, + "height": 896, + "hash": "U4KmeK000{cFLM03tH?b_4IB~Usp00t0~W=r", + "meta": { + "Size": "200x300", + "seed": 519954735, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "aobasuzukaze, , \naoba suzukaze, eyebrows, hair ornament, long hair, (purple eyes:1.1), purple hair, twintails, (flat chest:1.2),\nBREAK lingerie,\nBREAK looking at viewer,\nBREAK indoors, bed,\nBREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "\"aobatest": "6c3803c9e4c0", + "resources": [ + { + "name": "aobatest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3, (hair between eyes:2)", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3686a224-e5c5-4b7e-a900-9bed43d6e5b8/width=450/1440590.jpeg", + "nsfw": "Mature", + "width": 600, + "height": 896, + "hash": "UALWVE00C0s+p{4n%E9Z~qIBt6xt4:tQxZ%2", + "meta": { + "Size": "200x300", + "seed": 519954734, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "aobasuzukaze, , \naoba suzukaze, eyebrows, hair ornament, long hair, (purple eyes:1.1), purple hair, twintails, (flat chest:1.2),\nBREAK lingerie,\nBREAK looking at viewer,\nBREAK indoors, bed,\nBREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "\"aobatest": "6c3803c9e4c0", + "resources": [ + { + "name": "aobatest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3, (hair between eyes:2)", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/111894" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/aobatest.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/aobatest.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..2f5c5a066f3e284daa639d65fb3a73a21222e7bc Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/aobatest.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/aobatest.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/aobatest.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..72f28bdeae63100c7b4e9d7d2d34c543c3518acf --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/aobatest.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:e0961d269c87f52712f371feed0dd4b0fba27fca14acdb7417e50896e15a08ec +size 37928286 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/hajime-10.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/hajime-10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..0f8f77925304df28396c29cc0e961927533ac1bf --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/hajime-10.civitai.info" @@ -0,0 +1,89 @@ +{ + "id": 111633, + "modelId": 104173, + "name": "v2.0", + "createdAt": "2023-07-06T15:58:27.085Z", + "updatedAt": "2023-07-06T15:58:56.264Z", + "trainedWords": [ + "shinoda hajime" + ], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 233, + "ratingCount": 1, + "rating": 5 + }, + "model": { + "name": "Shinoda Hajime - New Game!", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "hajime-10.safetensors", + "id": 79042, + "sizeKB": 18548, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-07-06T16:00:57.924Z", + "hashes": { + "AutoV1": "DE2F2560", + "AutoV2": "CDD74E146F", + "SHA256": "CDD74E146F349E4F30EC3F558CB74CD361E3A133DC6DB4857673A4982E4C86F3", + "CRC32": "05BB2110", + "BLAKE3": "7C699B1E1787A4FD2A5F65C20FA30A6D644588A64325E704494DBED41B592C08" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/111633" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5abefe48-afcb-4a2e-9069-83a0adce474f/width=450/1435294.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "U9Kdbw575t0v-WIHwON400ImNo_NEm0L~Bn3", + "meta": { + "Size": "512x768", + "seed": 2361167203, + "Model": "sweetMix_v21", + "steps": 35, + "hashes": { + "model": "9e4f6f7a28" + }, + "prompt": "(extremely detailed CG unity 8k wallpaper), (masterpiece), (best quality), (ultra-detailed), (best illustration), (best shadow), (absurdres), 1girl, solo, , shinoda hajime, collarbone, shirt, hoodie, looking at viewer, leaning forward, :d, open mouth, shorts", + "\"hajime": "000fd6edaf0b\"", + "Version": "## 1.4.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "clipSkip": 2, + "resources": [ + { + "name": "hajime", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "9e4f6f7a28", + "name": "sweetMix_v21", + "type": "model" + } + ], + "Model hash": "9e4f6f7a28", + "negativePrompt": "extra fingers, fewer fingers, bad-hands-5, by bad-artist, (bad eyes:1.2), (misfigured pupils:1.2), (bad clothing:1.3), (undetailed clothing:1.3), ng_deepnegative_v1_75t, verybadimagenegative_v1.3, (nonsensical backrounds:1.2), (bad backrounds:1.2), (bad shadows:1.2), (bad anatomy:1.1)," + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/111633" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/hajime-10.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/hajime-10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..3bcbe05c788f87207709f26496280a96bb2024ef Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/hajime-10.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/hajime-10.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/hajime-10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..8a5e4dd81f69870f3d3375381940968aa5f9aee2 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/hajime-10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:cdd74e146f349e4f30ec3f558cb74cd361e3a133dc6db4857673a4982e4c86f3 +size 18993152 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/hazuki-10.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/hazuki-10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..dbd6fb1abf37ed4f3c10a4d9bb3a3fb89ee70069 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/hazuki-10.civitai.info" @@ -0,0 +1,89 @@ +{ + "id": 111641, + "modelId": 104182, + "name": "v2.0", + "createdAt": "2023-07-06T16:04:43.753Z", + "updatedAt": "2023-07-06T16:05:16.961Z", + "trainedWords": [ + "hazuki shizuku" + ], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 164, + "ratingCount": 1, + "rating": 5 + }, + "model": { + "name": "Hazuki Shizuku - New Game!", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "hazuki-10.safetensors", + "id": 79049, + "sizeKB": 18547.53515625, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-07-06T16:06:22.294Z", + "hashes": { + "AutoV1": "DE2F2560", + "AutoV2": "0B476DACEE", + "SHA256": "0B476DACEE8E8CB182DD651C83F1F4C2D2B3C4064DD5DB87026631AB6CF76ADF", + "CRC32": "2807C461", + "BLAKE3": "E5791578D34596E6B36AE408DF75E4725BB6C20AF0BA4FC174BA8D74FDBBA3FA" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/111641" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c93794b1-1e9e-484c-baf0-a24eb2aec124/width=450/1435395.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "UOI}kh~p?Iax9G_3oyNG~VM_WXM|0eNH-o%L", + "meta": { + "Size": "512x768", + "seed": 1376340275, + "Model": "sweetMix_v21", + "steps": 35, + "hashes": { + "model": "9e4f6f7a28" + }, + "prompt": "(extremely detailed CG unity 8k wallpaper), (masterpiece), (best quality), (ultra-detailed), (best illustration), (best shadow), (absurdres), 1girl, solo, , hazuki shizuku, smile, green turtleneck sweater, jewelry, looking at viewer, smile, closed mouth", + "\"hazuki": "641b5b9729f2\"", + "Version": "## 1.4.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "clipSkip": 2, + "resources": [ + { + "name": "hazuki", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "9e4f6f7a28", + "name": "sweetMix_v21", + "type": "model" + } + ], + "Model hash": "9e4f6f7a28", + "negativePrompt": "extra fingers, fewer fingers, bad-hands-5, by bad-artist, (bad eyes:1.2), (misfigured pupils:1.2), (bad clothing:1.3), (undetailed clothing:1.3), ng_deepnegative_v1_75t, verybadimagenegative_v1.3, (nonsensical backrounds:1.2), (bad backrounds:1.2), (bad shadows:1.2), (bad anatomy:1.1)," + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/111641" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/hazuki-10.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/hazuki-10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..39f4f9a5a40816e0d8b8867ee66c050bdb548445 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/hazuki-10.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/hazuki-10.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/hazuki-10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..48f4bf6da5976fa52ccc3af356139a8195f8834e --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/hazuki-10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:0b476dacee8e8cb182dd651c83f1f4c2d2b3c4064dd5db87026631ab6cf76adf +size 18992676 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/hifumi-12.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/hifumi-12.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..0962eac16f7f92765d64363165b94feb6ba08b1f --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/hifumi-12.civitai.info" @@ -0,0 +1,89 @@ +{ + "id": 111630, + "modelId": 104171, + "name": "v2.0", + "createdAt": "2023-07-06T15:54:56.225Z", + "updatedAt": "2023-07-06T15:55:38.886Z", + "trainedWords": [ + "takimoto hifumi" + ], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 295, + "ratingCount": 3, + "rating": 5 + }, + "model": { + "name": "Takimoto Hifumi - New Game!", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "hifumi-12.safetensors", + "id": 79038, + "sizeKB": 18549.029296875, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-07-06T16:01:25.090Z", + "hashes": { + "AutoV1": "DE2F2560", + "AutoV2": "EA571FA5E5", + "SHA256": "EA571FA5E538CCFCEE1313B46F6812D3D7F1AC53214D03EF0F1D601FED13AB47", + "CRC32": "1B512F4F", + "BLAKE3": "83D629814A0DCAF606E69267B466B7690E3EBA2296E4B7231C887DD594A19A0D" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/111630" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/53a7c420-814a-4898-b9fe-bbe2fab9b411/width=450/1435248.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "UDGb9t000000~qD%IU%MI99Z?I~qV@kC%2Mx", + "meta": { + "Size": "512x768", + "seed": 3144249233, + "Model": "sweetMix_v21", + "steps": 35, + "hashes": { + "model": "9e4f6f7a28" + }, + "prompt": "(extremely detailed CG unity 8k wallpaper), (masterpiece), (best quality), (ultra-detailed), (best illustration), (best shadow), (absurdres), 1girl, solo, , takimoto hifumi, white shirt, red cardigan, ribbon, skirt, black thighhighs, looking at viewer, v arms, blush, embarrassed, wavy mouth", + "\"hifumi": "0c86a2014577\"", + "Version": "## 1.4.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "clipSkip": 2, + "resources": [ + { + "name": "hifumi", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "9e4f6f7a28", + "name": "sweetMix_v21", + "type": "model" + } + ], + "Model hash": "9e4f6f7a28", + "negativePrompt": "extra fingers, fewer fingers, bad-hands-5, by bad-artist, (bad eyes:1.2), (misfigured pupils:1.2), (bad clothing:1.3), (undetailed clothing:1.3), ng_deepnegative_v1_75t, verybadimagenegative_v1.3, (nonsensical backrounds:1.2), (bad backrounds:1.2), (bad shadows:1.2), (bad anatomy:1.1)," + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/111630" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/hifumi-12.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/hifumi-12.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..5e9e0cc383511ee0729e3143dcfecbd6bdf12eef Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/hifumi-12.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/hifumi-12.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/hifumi-12.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..06b335e1d91a22b27f07bde940bda8c511f90c04 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/hifumi-12.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:ea571fa5e538ccfcee1313b46f6812d3d7f1ac53214d03ef0f1d601fed13ab47 +size 18994206 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/hifumitakimoto.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/hifumitakimoto.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..3bd58a4bf956c69d873bba243bb7aafd43b0cde0 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/hifumitakimoto.civitai.info" @@ -0,0 +1,378 @@ +{ + "id": 104186, + "modelId": 97466, + "name": "v1.0", + "createdAt": "2023-06-26T02:13:14.643Z", + "updatedAt": "2023-06-26T02:15:40.623Z", + "trainedWords": [ + "takimoto hifumi, long hair, blush, bangs, blue eyes, ponytail, purple hair, hair bow, bow,", + "skirt, shirt, thighhighs, long sleeves, bow, ribbon, white shirt, pleated skirt, black thighhighs, miniskirt, zettai ryouiki, dress shirt, red skirt,", + "gloves, hat, dress, bow, bare shoulders, sleeveless, elbow gloves, white gloves, white dress, witch hat, white headwear, pelvic curtain, side slit, low-tied long hair, large hat,", + "shirt, long sleeves, cleavage, collarbone, white shirt, collared shirt, mole, dress shirt, mole on breast, naked shirt," + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "", + "stats": { + "downloadCount": 176, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Hifumi Takimoto - New Game!", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "hifumitakimoto.safetensors", + "id": 73160, + "sizeKB": 37015.919921875, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-26T02:15:44.297Z", + "hashes": { + "AutoV1": "97EC6428", + "AutoV2": "82D2E8865B", + "SHA256": "82D2E8865B957EF472615194E56ADECC86E20BC16D59780F917ED65FE9811A2B", + "CRC32": "92089E63", + "BLAKE3": "7BA0382C7D4948843B666D400DFE591C52CF2A9C7ADF9E49B4A73F5B61271B2C" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/104186" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0bbd23e2-eda2-4978-9428-111e57856e09/width=450/1291294.jpeg", + "nsfw": "None", + "width": 600, + "height": 896, + "hash": "UcJ*3d~V?Zt7%Kbv-;R*%MIpM{WBE1Rj%2of", + "meta": { + "Size": "200x300", + "seed": 652479553, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "hifumitakimoto, , takimoto hifumi, long hair, blush, bangs, blue eyes, ponytail, purple hair, hair bow, bow, BREAK skirt, shirt, thighhighs, long sleeves, bow, ribbon, white shirt, pleated skirt, black thighhighs, miniskirt, zettai ryouiki, dress shirt, red skirt, BREAK looking at viewer, BREAK outdoors, city, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "hifumitakimoto", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "\"hifumitakimoto": "982cc67d3c23", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/38cf68eb-3e03-4bbd-875e-a12872d9d1a1/width=450/1291292.jpeg", + "nsfw": "Soft", + "width": 600, + "height": 896, + "hash": "UVKm;L?G~W?a~Waxxu-;K3t7x^ozf+ofxuWC", + "meta": { + "Size": "200x300", + "seed": 3019723736, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "hifumitakimoto, , takimoto hifumi, long hair, blush, bangs, blue eyes, ponytail, purple hair, hair bow, bow, BREAK shirt, long sleeves, cleavage, collarbone, white shirt, collared shirt, mole, dress shirt, mole on breast, naked shirt, BREAK indoors, bed, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "hifumitakimoto", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "\"hifumitakimoto": "982cc67d3c23", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/22a8b2e4-c4c0-435d-bcec-a06d1bdcec28/width=450/1291291.jpeg", + "nsfw": "Soft", + "width": 600, + "height": 896, + "hash": "UeLWt]~Wbtt7NFxu%MofIpxb%MkDa~WDo2t7", + "meta": { + "Size": "200x300", + "seed": 2398620255, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "hifumitakimoto, , takimoto hifumi, long hair, blush, bangs, blue eyes, ponytail, purple hair, hair bow, bow, BREAK shirt, long sleeves, cleavage, collarbone, white shirt, collared shirt, mole, dress shirt, mole on breast, naked shirt, BREAK indoors, bed, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "hifumitakimoto", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "\"hifumitakimoto": "982cc67d3c23", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b9e21c7b-6692-4974-a78b-1bd5baa03a64/width=450/1291293.jpeg", + "nsfw": "None", + "width": 600, + "height": 896, + "hash": "U6IN]w0000^*00%M.S%N0LV?_2M{_4%ND$9F", + "meta": { + "Size": "200x300", + "seed": 1916733692, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "hifumitakimoto, , takimoto hifumi, long hair, blush, bangs, blue eyes, ponytail, purple hair, hair bow, bow, BREAK gloves, hat, dress, bow, bare shoulders, sleeveless, elbow gloves, white gloves, white dress, witch hat, white headwear, pelvic curtain, side slit, low-tied long hair, large hat, BREAK outdoors, city, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "hifumitakimoto", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "\"hifumitakimoto": "982cc67d3c23", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/aa66332e-344b-42cc-990d-0993a31db8af/width=450/1291297.jpeg", + "nsfw": "Soft", + "width": 600, + "height": 896, + "hash": "UFI}Fz02%e9a~V4o_2a%TL-;-;D%EM$*s:%3", + "meta": { + "Size": "200x300", + "seed": 1916733690, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "hifumitakimoto, , takimoto hifumi, long hair, blush, bangs, blue eyes, ponytail, purple hair, hair bow, bow, BREAK gloves, hat, dress, bow, bare shoulders, sleeveless, elbow gloves, white gloves, white dress, witch hat, white headwear, pelvic curtain, side slit, low-tied long hair, large hat, BREAK outdoors, city, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "hifumitakimoto", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "\"hifumitakimoto": "982cc67d3c23", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8537df85-21e9-4a5d-b104-12860e52f587/width=450/1291299.jpeg", + "nsfw": "None", + "width": 600, + "height": 896, + "hash": "UUHeRoS$yDDj_4bcx]Mx?bW=tRRP9toMxuof", + "meta": { + "Size": "200x300", + "seed": 1391930197, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "hifumitakimoto, , takimoto hifumi, long hair, blush, bangs, blue eyes, ponytail, purple hair, hair bow, bow, BREAK looking at viewer, BREAK outdoors, city, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "hifumitakimoto", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "\"hifumitakimoto": "982cc67d3c23", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2b773e41-c5ba-465f-8807-ac46ea538fce/width=450/1291322.jpeg", + "nsfw": "None", + "width": 600, + "height": 896, + "hash": "UDJQ.+^Kl-4.YQR4^+%100-o.Sx[%$%KITs,", + "meta": { + "Size": "200x300", + "seed": 652479552, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "hifumitakimoto, , takimoto hifumi, long hair, blush, bangs, blue eyes, ponytail, purple hair, hair bow, bow, BREAK skirt, shirt, thighhighs, long sleeves, bow, ribbon, white shirt, pleated skirt, black thighhighs, miniskirt, zettai ryouiki, dress shirt, red skirt, BREAK looking at viewer, BREAK outdoors, city, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "hifumitakimoto", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "\"hifumitakimoto": "982cc67d3c23", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/104186" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/hifumitakimoto.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/hifumitakimoto.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..576967c8be4507c06eac9c092f587ac8a2da3175 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/hifumitakimoto.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/hifumitakimoto.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/hifumitakimoto.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..6664a65b82e7713cf70daed16ab6d37750e8b826 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/hifumitakimoto.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:82d2e8865b957ef472615194e56adecc86e20bc16d59780f917ed65fe9811a2b +size 37904302 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/highlegp_v1.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/highlegp_v1.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..62ded9bf74762e5e33a9c5f9683cdeb626422b4f --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/highlegp_v1.civitai.info" @@ -0,0 +1,204 @@ +{ + "id": 111499, + "modelId": 104058, + "name": "highlegp_v1.0", + "createdAt": "2023-07-06T12:21:11.274Z", + "updatedAt": "2023-07-06T12:51:30.846Z", + "trainedWords": [ + "highlegp" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 1056, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Highleg Panties Thong", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "highlegp_v1.safetensors", + "id": 78929, + "sizeKB": 37021.1220703125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-07-06T12:25:43.488Z", + "hashes": { + "AutoV1": "5B9ED37F", + "AutoV2": "4E57EFC0B5", + "SHA256": "4E57EFC0B51DFC8FAA856C21654CDEF938D391130FDF687AA472C2F4DA97CAB1", + "CRC32": "7CC6EA67", + "BLAKE3": "4A73B2100D446273A32D154A52D638F1EF8510178A412B18395E623878F6A535" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/111499" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/605e3a51-6ad6-4699-9af0-2289190773c8/width=450/1432375.jpeg", + "nsfw": "X", + "width": 738, + "height": 1200, + "hash": "UBIDwC?H00xu00D*9aM{%f%fkDM{~pIU9G-;", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a66f3201-7819-4421-a0f5-6f6802f7e1c9/width=450/1432376.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1664, + "hash": "UEJGpE9Y5+?G9@?G0LxZEKxZIVfi~VV@M|%M", + "meta": { + "ENSD": "31337", + "Size": "512x832", + "seed": 88714247, + "steps": 30, + "prompt": "power (chainsaw man), 1girl, ass visible through thighs, blonde hair, cross-shaped pupils, crotch, demon horns, frontal wedgie, hair between eyes, (highlegp:1.1), highleg panties, horns, large breasts, long hair, long sleeves, looking at viewer, looking down, navel, open mouth, partially visible vulva, pink shirt, red horns, sharp teeth, shirt, smile, solo, stomach, teeth, thighs, wedgie, yellow eyes \n ", + "Version": "v1.3.0", + "sampler": "Euler a", + "cfgScale": 9.5, + "clipSkip": 2, + "highlegP": "bb16210d6753", + "resources": [ + { + "name": "add_detail", + "type": "lora", + "weight": 0.5 + }, + { + "name": "highlegP", + "type": "lora", + "weight": 0.5 + } + ], + "Model hash": "1bab7a0895", + "Hires steps": "15", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality, normal quality:1.341), 3D, 3D face, sketch, (multiple views:1.158), (2koma, 3koma, 4koma, manga:1.158), cut-in, letterbox, title, text, (mutanted breasts, mutanted nipple, mutated breasts, mutated nipple:1.103), (missing limb, floating limbs, disconnected limbs, out of frame, mutated hands and fingers, poorly drawn hands, malformed hands, poorly drawn face, poorly drawn asymmetrical eyes:1.103), signature, watermark, username, artist name, greyscale, monochrome, lineart, (lowres:1.103), (bad anatomy:1.103), (bad hands:1.277), error, extra digit, fewer digits, cropped, long body, (blurry:1.158), pointy ears, (multiple girls:1.05), (margin, blank space:1.277), deformityv6, negative_hand-neg,", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/fc7ed694-6165-42a0-8026-f54d00a39b24/width=450/1434464.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1664, + "hash": "UYG8WT~WOYof%M%Mt7tREMt7-poz%LtQt7WV", + "meta": { + "ENSD": "31337", + "Size": "512x832", + "seed": 1423246061, + "steps": 30, + "prompt": "1girl, arm belt, bikini, black thighhighs, boots, bound, bound legs, bound wrists, breasts, brown hair, cleavage, detached sleeves, glaring, hair between eyes, hair spread out, highlegp, large breasts, long hair, looking at viewer, lying, micro bikini, nail polish, navel, on back, on floor, parted lips, pink eyes, restrained, solo, thigh boots, thigh strap, thighhighs, v-shaped eyebrows, thong,\nlora:highlegP:1> ", + "Version": "v1.3.0", + "sampler": "Euler a", + "cfgScale": 9.5, + "clipSkip": 2, + "resources": [ + { + "name": "more_details", + "type": "lora", + "weight": 0.2 + } + ], + "Model hash": "1bab7a0895", + "Hires steps": "15", + "more_details": "3b8aa1d351ef", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality, normal quality:1.341), 3D, 3D face, sketch, (multiple views:1.158), (2koma, 3koma, 4koma, manga:1.158), cut-in, letterbox, title, text, (mutanted breasts, mutanted nipple, mutated breasts, mutated nipple:1.103), (missing limb, floating limbs, disconnected limbs, out of frame, mutated hands and fingers, poorly drawn hands, malformed hands, poorly drawn face, poorly drawn asymmetrical eyes:1.103), signature, watermark, username, artist name, greyscale, monochrome, lineart, (lowres:1.103), (bad anatomy:1.103), (bad hands:1.277), error, extra digit, fewer digits, cropped, long body, (blurry:1.158), pointy ears, (multiple girls:1.05), (margin, blank space:1.277), deformityv6, negative_hand-neg,", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3f17f3f1-3a94-4d48-8073-fe80870f4100/width=450/1432382.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1664, + "hash": "UWJai?9aO@-pPEkDS*nh0ixtN0sl-pV@aet7", + "meta": { + "ENSD": "31337", + "Size": "512x832", + "seed": 2244675641, + "steps": 30, + "prompt": "matsumoto rangiku, 1girl, balcony, black thighhighs, blue eyes, blue sky, blurry, cleavage, collarbone, crop top overhang, fence, half-closed eyes, hands up, (highlegp:1.1), highleg panties, large breasts, long hair, looking at viewer, mountainous horizon, navel, orange hair, parted bangs, parted lips, sky, smile, solo, stomach, thighhighs, wooden fence, underboob, \n ", + "Version": "v1.3.0", + "sampler": "Euler a", + "cfgScale": 9.5, + "clipSkip": 2, + "highlegP": "bb16210d6753", + "resources": [ + { + "name": "add_detail", + "type": "lora", + "weight": 0.5 + }, + { + "name": "highlegP", + "type": "lora", + "weight": 0.7 + } + ], + "Model hash": "1bab7a0895", + "Hires steps": "15", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality, normal quality:1.341), 3D, 3D face, sketch, (multiple views:1.158), (2koma, 3koma, 4koma, manga:1.158), cut-in, letterbox, title, text, (mutanted breasts, mutanted nipple, mutated breasts, mutated nipple:1.103), (missing limb, floating limbs, disconnected limbs, out of frame, mutated hands and fingers, poorly drawn hands, malformed hands, poorly drawn face, poorly drawn asymmetrical eyes:1.103), signature, watermark, username, artist name, greyscale, monochrome, lineart, (lowres:1.103), (bad anatomy:1.103), (bad hands:1.277), error, extra digit, fewer digits, cropped, long body, (blurry:1.158), pointy ears, (multiple girls:1.05), (margin, blank space:1.277), deformityv6, negative_hand-neg,", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b5f8851e-3e51-4b6f-ac3e-47430c30c839/width=450/1432385.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1664, + "hash": "UWK^y%^+?^?v?^t7-p%g9aM{xDxu^+axR+s:", + "meta": { + "ENSD": "31337", + "Size": "512x832", + "seed": 392053413, + "steps": 30, + "prompt": "nico robin, 1girl, ass, ass focus, back, bent over, black hair, black panties, breasts, eyewear on head, highlegp, highleg panties, long hair, sarong, solo, sunglasses, thighs, thong\n ", + "Version": "v1.3.0", + "sampler": "Euler a", + "cfgScale": 9.5, + "clipSkip": 2, + "highlegP": "bb16210d6753", + "resources": [ + { + "name": "add_detail", + "type": "lora", + "weight": 0.5 + }, + { + "name": "highlegP", + "type": "lora", + "weight": 0.5 + } + ], + "Model hash": "1bab7a0895", + "Hires steps": "15", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality, normal quality:1.341), 3D, 3D face, sketch, (multiple views:1.158), (2koma, 3koma, 4koma, manga:1.158), cut-in, letterbox, title, text, (mutanted breasts, mutanted nipple, mutated breasts, mutated nipple:1.103), (missing limb, floating limbs, disconnected limbs, out of frame, mutated hands and fingers, poorly drawn hands, malformed hands, poorly drawn face, poorly drawn asymmetrical eyes:1.103), signature, watermark, username, artist name, greyscale, monochrome, lineart, (lowres:1.103), (bad anatomy:1.103), (bad hands:1.277), error, extra digit, fewer digits, cropped, long body, (blurry:1.158), pointy ears, (multiple girls:1.05), (margin, blank space:1.277), deformityv6, negative_hand-neg,", + "Denoising strength": "0.5" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/111499" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/kou-12.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/kou-12.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..ce9fde2e0c965808f631ee9528cec4a1a0b92c4d --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/kou-12.civitai.info" @@ -0,0 +1,89 @@ +{ + "id": 111634, + "modelId": 104174, + "name": "v2.0", + "createdAt": "2023-07-06T15:59:52.627Z", + "updatedAt": "2023-07-06T16:00:16.742Z", + "trainedWords": [ + "yagami kou" + ], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 219, + "ratingCount": 2, + "rating": 5 + }, + "model": { + "name": "Yagami Kou - New Game!", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "kou-12.safetensors", + "id": 79043, + "sizeKB": 18550.9677734375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-07-06T16:01:22.857Z", + "hashes": { + "AutoV1": "DE2F2560", + "AutoV2": "EDFB6FB614", + "SHA256": "EDFB6FB61476453ED76D2AAB32895ABF3D1AE2353D09C4DFF5221A5182DCFDC4", + "CRC32": "FF066986", + "BLAKE3": "A0AFE695EA29DC84E81750F6E1CCCA118641741601A013DE95E1A0CF1A6C1CEC" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/111634" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0ba86d46-6c21-4a74-a168-a3c1ad2941f8/width=450/1435314.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "UaIN{t01t7NH~UI;D%W;-Uo#MxxuaxWVn%oM", + "meta": { + "\"kou": "33d818a185c1\"", + "Size": "512x768", + "seed": 4018254987, + "Model": "sweetMix_v21", + "steps": 35, + "hashes": { + "model": "9e4f6f7a28" + }, + "prompt": "(extremely detailed CG unity 8k wallpaper), (masterpiece), (best quality), (ultra-detailed), (best illustration), (best shadow), (absurdres), 1girl, solo, , yagami kou, black shirt, jeans, collarbone, smile, smirk, grin, hand on hip, looking at viewer", + "Version": "## 1.4.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "clipSkip": 2, + "resources": [ + { + "name": "kou", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "9e4f6f7a28", + "name": "sweetMix_v21", + "type": "model" + } + ], + "Model hash": "9e4f6f7a28", + "negativePrompt": "extra fingers, fewer fingers, bad-hands-5, by bad-artist, (bad eyes:1.2), (misfigured pupils:1.2), (bad clothing:1.3), (undetailed clothing:1.3), ng_deepnegative_v1_75t, verybadimagenegative_v1.3, (nonsensical backrounds:1.2), (bad backrounds:1.2), (bad shadows:1.2), (bad anatomy:1.1)," + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/111634" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/kou-12.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/kou-12.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..c58cf5306f1ef7ee47c7a791da02863b61c49811 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/kou-12.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/kou-12.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/kou-12.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..be9d4250a365e23c1462125e26a71a9991c06de2 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/kou-12.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:edfb6fb61476453ed76d2aab32895abf3d1ae2353d09c4dff5221a5182dcfdc4 +size 18996191 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/momiji-10.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/momiji-10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..f58851ecffaacb436e2f81f8631ffbbc416fa624 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/momiji-10.civitai.info" @@ -0,0 +1,89 @@ +{ + "id": 111646, + "modelId": 104188, + "name": "v2.0", + "createdAt": "2023-07-06T16:07:55.978Z", + "updatedAt": "2023-07-06T16:08:16.047Z", + "trainedWords": [ + "mochizuki momiji" + ], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 197, + "ratingCount": 1, + "rating": 5 + }, + "model": { + "name": "Mochizuki Momiji - New Game!!", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "momiji-10.safetensors", + "id": 79052, + "sizeKB": 18548.3935546875, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-07-06T16:11:30.897Z", + "hashes": { + "AutoV1": "DE2F2560", + "AutoV2": "32DC88D4DE", + "SHA256": "32DC88D4DE12E0F4EA7D707D2904D7C2F78C631221060298AA9C1AE4FEEF6C5C", + "CRC32": "1758C818", + "BLAKE3": "7CDE3D3576469FACA31D86FD39ADF1818F5CE924B532C6C0A1F4B149DFF0C5CD" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/111646" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/cff28963-5229-415d-8be4-b21c07f59f38/width=450/1435452.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "UVK1B+~WInxu-p?b.8t7^kt7EKs:s;M|E1WB", + "meta": { + "Size": "512x768", + "seed": 4217920095, + "Model": "sweetMix_v21", + "steps": 35, + "hashes": { + "model": "9e4f6f7a28" + }, + "prompt": "(extremely detailed CG unity 8k wallpaper), (masterpiece), (best quality), (ultra-detailed), (best illustration), (best shadow), (absurdres), 1girl, solo, , mochizuki momiji, looking at viewer, black turtleneck, necklace, short sleeves, closed mouth, grey striped skirt,", + "\"momiji": "09db57ea7255\"", + "Version": "## 1.4.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "clipSkip": 2, + "resources": [ + { + "name": "momiji", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "9e4f6f7a28", + "name": "sweetMix_v21", + "type": "model" + } + ], + "Model hash": "9e4f6f7a28", + "negativePrompt": "extra fingers, fewer fingers, bad-hands-5, by bad-artist, (bad eyes:1.2), (misfigured pupils:1.2), (bad clothing:1.3), (undetailed clothing:1.3), ng_deepnegative_v1_75t, verybadimagenegative_v1.3, (nonsensical backrounds:1.2), (bad backrounds:1.2), (bad shadows:1.2), (bad anatomy:1.1)," + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/111646" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/momiji-10.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/momiji-10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..d3c1724d0154bfe1ba95196f32fb16f8185df927 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/momiji-10.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/momiji-10.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/momiji-10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..3844f0b8c2d6c3c02b07df34719f698d4f33c980 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/momiji-10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:32dc88d4de12e0f4ea7d707d2904d7c2f78c631221060298aa9c1ae4feef6c5c +size 18993555 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/nene-12.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/nene-12.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..7da9b452234d9c73ac363135594a074acc95eb06 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/nene-12.civitai.info" @@ -0,0 +1,89 @@ +{ + "id": 111644, + "modelId": 104187, + "name": "v2.0", + "createdAt": "2023-07-06T16:06:05.841Z", + "updatedAt": "2023-07-06T16:06:32.638Z", + "trainedWords": [ + "sakura nene" + ], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 231, + "ratingCount": 1, + "rating": 5 + }, + "model": { + "name": "Sakura Nene - New Game!", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "nene-12.safetensors", + "id": 79050, + "sizeKB": 18552.6611328125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-07-06T16:11:08.208Z", + "hashes": { + "AutoV1": "DE2F2560", + "AutoV2": "35C7AC6EA7", + "SHA256": "35C7AC6EA71606FBE6AF1F15616F4E766514B4392ED882864EF0CD9E32EC1D3B", + "CRC32": "2926F3B6", + "BLAKE3": "0D85538608E763E5C71DC74F4D860C5A742CF567A641D6BC0D66954D288430F6" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/111644" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/93e91a6a-d28a-424e-85ea-bdf2dfe7bb0c/width=450/1435411.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "UQM7P;4n4ns;~BITE+RiRiWCxGRju4n$IBRk", + "meta": { + "Size": "512x768", + "seed": 812700765, + "\"nene": "87c344073e6a\"", + "Model": "sweetMix_v21", + "steps": 35, + "hashes": { + "model": "9e4f6f7a28" + }, + "prompt": "(extremely detailed CG unity 8k wallpaper), (masterpiece), (best quality), (ultra-detailed), (best illustration), (best shadow), (absurdres), 1girl, solo, , sakura nene, shirt, short sleeves, off shoulder, smile, looking at viewer, brastraps", + "Version": "## 1.4.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "clipSkip": 2, + "resources": [ + { + "name": "nene", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "9e4f6f7a28", + "name": "sweetMix_v21", + "type": "model" + } + ], + "Model hash": "9e4f6f7a28", + "negativePrompt": "extra fingers, fewer fingers, bad-hands-5, by bad-artist, (bad eyes:1.2), (misfigured pupils:1.2), (bad clothing:1.3), (undetailed clothing:1.3), ng_deepnegative_v1_75t, verybadimagenegative_v1.3, (nonsensical backrounds:1.2), (bad backrounds:1.2), (bad shadows:1.2), (bad anatomy:1.1)," + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/111644" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/nene-12.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/nene-12.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..aa31cf23a75e6b7df7ee4c34516f5bfed4df4ad5 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/nene-12.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/nene-12.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/nene-12.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..0a54fd65d44e5eed1c017b89c97403dc73df0fcb --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/nene-12.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:35c7ac6ea71606fbe6af1f15616f4e766514b4392ed882864ef0cd9e32ec1d3b +size 18997925 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/rin-10.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/rin-10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..06209d74e1e8695f6ac38ca2f2f57cc02f1800a5 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/rin-10.civitai.info" @@ -0,0 +1,89 @@ +{ + "id": 111635, + "modelId": 104176, + "name": "v2.0", + "createdAt": "2023-07-06T16:01:00.746Z", + "updatedAt": "2023-07-06T16:01:31.246Z", + "trainedWords": [ + "toyama rin" + ], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 176, + "ratingCount": 1, + "rating": 5 + }, + "model": { + "name": "Toyama Rin - New Game!", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "rin-10.safetensors", + "id": 79044, + "sizeKB": 18546.943359375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-07-06T16:05:54.960Z", + "hashes": { + "AutoV1": "DE2F2560", + "AutoV2": "EAA51F299F", + "SHA256": "EAA51F299FBF911768A33923F54872B4D6EE170F2AAE18A60A6E2CAC438E5254", + "CRC32": "B9AD14A1", + "BLAKE3": "59C2454129B36187B0565DB96845E7E4A18983699B376A2682B06A4E46F6CD2D" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/111635" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/38acb672-246b-4d51-91a6-8ec33b6ecb26/width=450/1435330.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "U8J@IML$00}]00XS^,9F00OY?u9t^RDiIU?G", + "meta": { + "\"rin": "75ec9b964a36\"", + "Size": "512x768", + "seed": 2306129352, + "Model": "sweetMix_v21", + "steps": 35, + "hashes": { + "model": "9e4f6f7a28" + }, + "prompt": "(extremely detailed CG unity 8k wallpaper), (masterpiece), (best quality), (ultra-detailed), (best illustration), (best shadow), (absurdres), 1girl, solo, , toyama rin, turtleneck sweater, smile, :d, open mouth, own hands together, looking at viewer", + "Version": "## 1.4.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "clipSkip": 2, + "resources": [ + { + "name": "rin", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "9e4f6f7a28", + "name": "sweetMix_v21", + "type": "model" + } + ], + "Model hash": "9e4f6f7a28", + "negativePrompt": "extra fingers, fewer fingers, bad-hands-5, by bad-artist, (bad eyes:1.2), (misfigured pupils:1.2), (bad clothing:1.3), (undetailed clothing:1.3), ng_deepnegative_v1_75t, verybadimagenegative_v1.3, (nonsensical backrounds:1.2), (bad backrounds:1.2), (bad shadows:1.2), (bad anatomy:1.1)," + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/111635" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/rin-10.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/rin-10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..94944684fa63af0eb9dc0372b9876e4a36552457 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/rin-10.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/rin-10.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/rin-10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..660fc7741c2bebf9d67685aa13aa0f63fe14280c --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/rin-10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:eaa51f299fbf911768a33923f54872b4d6ee170f2aae18a60a6e2cac438e5254 +size 18992070 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/suzukaze_aoba-000015.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/suzukaze_aoba-000015.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..a96abdcf51065a394dade69f232edba15e5ad068 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/suzukaze_aoba-000015.civitai.info" @@ -0,0 +1,455 @@ +{ + "id": 109376, + "modelId": 102178, + "name": "v1.0", + "createdAt": "2023-07-03T11:13:28.028Z", + "updatedAt": "2023-07-03T11:17:37.717Z", + "trainedWords": [ + "suzukaze aoba, 1girl, hair ornament, suit, twintails, bow, purple hair, purple bow", + "suzukaze aoba, 1girl, hair ornament, school uniform, cardigan, twintails, purple hair, black bowtie", + "suzukaze aoba, 1girl, gym shirt, buruma, hair ornament, twintails, purple hair" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 233, + "ratingCount": 1, + "rating": 5 + }, + "model": { + "name": "Aoba Suzukaze | New Game!!", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "suzukaze_aoba-000015.safetensors", + "id": 77228, + "sizeKB": 18555.1328125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-07-03T11:15:44.834Z", + "hashes": { + "AutoV1": "DE2F2560", + "AutoV2": "1A5B686566", + "SHA256": "1A5B686566FD3205E0FC673E46B65B964251E57132D622E53CB2B90075AC4A60", + "CRC32": "7B3704A8", + "BLAKE3": "5ED300DBABC1194EBA8E00565EED6014EA83277BF0E285F57FC259D1FAEFD1FF" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/109376" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/dbbd339f-b2ed-4baf-9877-77597a380813/width=450/1388554.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UPIOa}8{$wD*_ND%oyxGrDIUOsM|I[Mxsnt6", + "meta": { + "Size": "1024x1536", + "seed": 1577236718, + "Model": "yabalMix_v5", + "steps": 20, + "hashes": { + "vae": "df3c506e51", + "model": "75888f2829", + "embed:bad-artist": "2d35613490", + "embed:EasyNegative": "66a7279a88", + "embed:bad_prompt_version2": "6f35e7dd81", + "lora:suzukaze_aoba-000015": "1a5b686566", + "embed:ng_deepnegative_v1_75t": "54e7e4826d" + }, + "prompt": "(Masterpiece:1.4), (best quality:1.2), , suzukaze aoba, 1girl, hair ornament, school uniform, cardigan, twintails, purple hair, black bowtie", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "75888f2829", + "name": "yabalMix_v5", + "type": "model" + } + ], + "Model hash": "75888f2829", + "negativePrompt": "cartoon, sketches, (worst quality:1.5), (low quality:1.5), lowres, ((monochrome)), ((grayscale)), drawn by bad-artist, bad_prompt_version2, negative_hand, ng_deepnegative_v1_75t, EasyNegative, (nsfw:1.1), bad anatomy, text, watermark, simple background, white background, noise, blurry background, blurry, signature, black background, patreon username", + "Denoising strength": "0.35", + "\"suzukaze_aoba-000015": "d5a0caf0b321\"", + "Tiled Diffusion upscaler": "4x_fatal_Anime_500000_G", + "Tiled Diffusion scale factor": "2" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/73585cbe-7a03-4b98-af1c-b2ba3bd6ca06/width=450/1388562.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UiJHdeDk%Exb~WD*IUWAbcWARkawWUj[t6ay", + "meta": { + "Size": "1024x1536", + "seed": 2617467643, + "Model": "CheckpointYesmix_v20", + "steps": 20, + "hashes": { + "vae": "df3c506e51", + "model": "b776728f83", + "embed:bad-artist": "2d35613490", + "embed:EasyNegative": "66a7279a88", + "embed:bad_prompt_version2": "6f35e7dd81", + "lora:suzukaze_aoba-000015": "1a5b686566", + "embed:ng_deepnegative_v1_75t": "54e7e4826d" + }, + "prompt": "(Masterpiece:1.4), (best quality:1.2), , suzukaze aoba, 1girl, hair ornament, suit, skirt suit, twintails, purple hair, purple bow", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "b776728f83", + "name": "CheckpointYesmix_v20", + "type": "model" + } + ], + "Model hash": "b776728f83", + "negativePrompt": "cartoon, sketches, (worst quality:1.5), (low quality:1.5), lowres, ((monochrome)), ((grayscale)), drawn by bad-artist, bad_prompt_version2, negative_hand, ng_deepnegative_v1_75t, EasyNegative, (nsfw:1.1), bad anatomy, text, watermark, simple background, white background, noise, blurry background, blurry, signature, black background, patreon username", + "Denoising strength": "0.35", + "\"suzukaze_aoba-000015": "d5a0caf0b321\"", + "Tiled Diffusion upscaler": "4x_fatal_Anime_500000_G", + "Tiled Diffusion scale factor": "2" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/18b6c695-ddba-4e79-8948-17f89d7e4d04/width=450/1388563.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UAKn3$0000D?4.9G?tRN03jCMw-;_N%hMINF", + "meta": { + "Size": "1024x1536", + "seed": 3345681498, + "Model": "cetusMix_v4", + "steps": 20, + "hashes": { + "vae": "df3c506e51", + "model": "b42b09ff12", + "embed:bad-artist": "2d35613490", + "embed:EasyNegative": "66a7279a88", + "embed:bad_prompt_version2": "6f35e7dd81", + "lora:suzukaze_aoba-000015": "1a5b686566", + "embed:ng_deepnegative_v1_75t": "54e7e4826d" + }, + "prompt": "(Masterpiece:1.4), (best quality:1.2), , suzukaze aoba, 1girl, gym shirt, buruma, hair ornament, twintails, purple hair", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "b42b09ff12", + "name": "cetusMix_v4", + "type": "model" + } + ], + "Model hash": "b42b09ff12", + "negativePrompt": "cartoon, sketches, (worst quality:1.5), (low quality:1.5), lowres, ((monochrome)), ((grayscale)), drawn by bad-artist, bad_prompt_version2, negative_hand, ng_deepnegative_v1_75t, EasyNegative, (nsfw:1.1), bad anatomy, text, watermark, simple background, white background, noise, blurry background, blurry, signature, black background, patreon username", + "Denoising strength": "0.35", + "\"suzukaze_aoba-000015": "d5a0caf0b321\"", + "Tiled Diffusion upscaler": "4x_fatal_Anime_500000_G", + "Tiled Diffusion scale factor": "2" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c289d276-19b3-4cdf-af8f-ddba352cdc91/width=450/1388557.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UTHCAr_2oYo#~BxaTGWYM|%Mxtspb_xurrtR", + "meta": { + "Size": "1024x1536", + "seed": 54662357, + "Model": "yabalMix_v5", + "steps": 20, + "hashes": { + "vae": "df3c506e51", + "model": "75888f2829", + "embed:bad-artist": "2d35613490", + "embed:EasyNegative": "66a7279a88", + "embed:bad_prompt_version2": "6f35e7dd81", + "lora:suzukaze_aoba-000015": "1a5b686566", + "embed:ng_deepnegative_v1_75t": "54e7e4826d" + }, + "prompt": "(Masterpiece:1.4), (best quality:1.2), , suzukaze aoba, 1girl, hair ornament, school uniform, cardigan, twintails, purple hair, black bowtie", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "75888f2829", + "name": "yabalMix_v5", + "type": "model" + } + ], + "Model hash": "75888f2829", + "negativePrompt": "cartoon, sketches, (worst quality:1.5), (low quality:1.5), lowres, ((monochrome)), ((grayscale)), drawn by bad-artist, bad_prompt_version2, negative_hand, ng_deepnegative_v1_75t, EasyNegative, (nsfw:1.1), bad anatomy, text, watermark, simple background, white background, noise, blurry background, blurry, signature, black background, patreon username", + "Denoising strength": "0.35", + "\"suzukaze_aoba-000015": "d5a0caf0b321\"", + "Tiled Diffusion upscaler": "4x_fatal_Anime_500000_G", + "Tiled Diffusion scale factor": "2" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/34c71d95-5792-477a-9ce7-afd0679bdafb/width=450/1388552.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UUH.m9tk#iNG~B-:OTfleV-;RjxDXot8r?Rj", + "meta": { + "Size": "1024x1536", + "seed": 3922518813, + "Model": "yabalMix_v5", + "steps": 20, + "hashes": { + "vae": "df3c506e51", + "model": "75888f2829", + "embed:bad-artist": "2d35613490", + "embed:EasyNegative": "66a7279a88", + "embed:bad_prompt_version2": "6f35e7dd81", + "lora:suzukaze_aoba-000015": "1a5b686566", + "embed:ng_deepnegative_v1_75t": "54e7e4826d" + }, + "prompt": "(Masterpiece:1.4), (best quality:1.2), , suzukaze aoba, 1girl, hair ornament, school uniform, cardigan, twintails, purple hair, black bowtie", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "75888f2829", + "name": "yabalMix_v5", + "type": "model" + } + ], + "Model hash": "75888f2829", + "negativePrompt": "cartoon, sketches, (worst quality:1.5), (low quality:1.5), lowres, ((monochrome)), ((grayscale)), drawn by bad-artist, bad_prompt_version2, negative_hand, ng_deepnegative_v1_75t, EasyNegative, (nsfw:1.1), bad anatomy, text, watermark, simple background, white background, noise, blurry background, blurry, signature, black background, patreon username", + "Denoising strength": "0.35", + "\"suzukaze_aoba-000015": "d5a0caf0b321\"", + "Tiled Diffusion upscaler": "4x_fatal_Anime_500000_G", + "Tiled Diffusion scale factor": "2" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e5b14e96-3447-4ffb-9d53-744962dee163/width=450/1388558.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UBHeFB~p009F_4?GIn-;?aoz%gD*KkRjI9^+", + "meta": { + "Size": "1024x1536", + "seed": 2581745512, + "Model": "sweetMix_v21", + "steps": 20, + "hashes": { + "vae": "df3c506e51", + "model": "9e4f6f7a28", + "embed:bad-artist": "2d35613490", + "embed:EasyNegative": "66a7279a88", + "embed:bad_prompt_version2": "6f35e7dd81", + "lora:suzukaze_aoba-000015": "1a5b686566", + "embed:ng_deepnegative_v1_75t": "54e7e4826d" + }, + "prompt": "(Masterpiece:1.4), (best quality:1.2), , suzukaze aoba, 1girl, gym shirt, buruma, hair ornament, twintails, purple hair", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "9e4f6f7a28", + "name": "sweetMix_v21", + "type": "model" + } + ], + "Model hash": "9e4f6f7a28", + "negativePrompt": "cartoon, sketches, (worst quality:1.5), (low quality:1.5), lowres, ((monochrome)), ((grayscale)), drawn by bad-artist, bad_prompt_version2, negative_hand, ng_deepnegative_v1_75t, EasyNegative, (nsfw:1.1), bad anatomy, text, watermark, simple background, white background, noise, blurry background, blurry, signature, black background, patreon username", + "Denoising strength": "0.35", + "\"suzukaze_aoba-000015": "d5a0caf0b321\"", + "Tiled Diffusion upscaler": "4x_fatal_Anime_500000_G", + "Tiled Diffusion scale factor": "2" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4b6f35cf-c2de-46dc-b3ca-d3e0533bbf14/width=450/1388553.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UjNJ,$-p_MWC-qoeIoa#~qj@Rjfkaxjsoeof", + "meta": { + "Size": "1024x1536", + "seed": 1292236791, + "Model": "cottoncandyPastel_v10", + "steps": 20, + "hashes": { + "vae": "df3c506e51", + "model": "54c721edf1", + "embed:bad-artist": "2d35613490", + "embed:EasyNegative": "66a7279a88", + "embed:bad_prompt_version2": "6f35e7dd81", + "lora:suzukaze_aoba-000015": "1a5b686566", + "embed:ng_deepnegative_v1_75t": "54e7e4826d" + }, + "prompt": "(Masterpiece:1.4), (best quality:1.2), , suzukaze aoba, 1girl, hair ornament, suit, skirt suit, twintails, purple hair, purple bow", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "54c721edf1", + "name": "cottoncandyPastel_v10", + "type": "model" + } + ], + "Model hash": "54c721edf1", + "negativePrompt": "cartoon, sketches, (worst quality:1.5), (low quality:1.5), lowres, ((monochrome)), ((grayscale)), drawn by bad-artist, bad_prompt_version2, negative_hand, ng_deepnegative_v1_75t, EasyNegative, (nsfw:1.1), bad anatomy, text, watermark, simple background, white background, noise, blurry background, blurry, signature, black background, patreon username", + "Denoising strength": "0.35", + "\"suzukaze_aoba-000015": "d5a0caf0b321\"", + "Tiled Diffusion upscaler": "4x_fatal_Anime_500000_G", + "Tiled Diffusion scale factor": "2" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1d305676-9aad-4781-ba05-4bc465b98b6a/width=450/1388555.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UhJtuH_2%K-:~pxtNFbHxufiM{oMX7WCs:t7", + "meta": { + "Size": "1024x1536", + "seed": 3497886023, + "Model": "cottoncandyPastel_v10", + "steps": 20, + "hashes": { + "vae": "df3c506e51", + "model": "54c721edf1", + "embed:bad-artist": "2d35613490", + "embed:EasyNegative": "66a7279a88", + "embed:bad_prompt_version2": "6f35e7dd81", + "lora:suzukaze_aoba-000015": "1a5b686566", + "embed:ng_deepnegative_v1_75t": "54e7e4826d" + }, + "prompt": "(Masterpiece:1.4), (best quality:1.2), , suzukaze aoba, 1girl, hair ornament, suit, twintails, bow, purple hair, purple bow", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "54c721edf1", + "name": "cottoncandyPastel_v10", + "type": "model" + } + ], + "Model hash": "54c721edf1", + "negativePrompt": "cartoon, sketches, (worst quality:1.7), (low quality:1.7), lowres, ((monochrome)), ((grayscale)), drawn by bad-artist, bad_prompt_version2, negative_hand, ng_deepnegative_v1_75t, EasyNegative, (nsfw:1.1), bad anatomy, text, watermark, simple background, white background, noise, blurry background, blurry, signature, black background, patreon username", + "Denoising strength": "0.35", + "\"suzukaze_aoba-000015": "d5a0caf0b321\"", + "Tiled Diffusion upscaler": "R-ESRGAN 4x+ Anime6B", + "Tiled Diffusion scale factor": "2" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c125ecb1-a71d-42fe-b8bf-a4c9f14886e9/width=450/1388556.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UlIN:WIUs*bI~WWBt3of-:xaRjt6baWCxat6", + "meta": { + "Size": "1024x1536", + "seed": 2347124104, + "Model": "cottoncandyPastel_v10", + "steps": 20, + "hashes": { + "vae": "df3c506e51", + "model": "54c721edf1", + "embed:bad-artist": "2d35613490", + "embed:EasyNegative": "66a7279a88", + "embed:bad_prompt_version2": "6f35e7dd81", + "lora:suzukaze_aoba-000015": "1a5b686566", + "embed:ng_deepnegative_v1_75t": "54e7e4826d" + }, + "prompt": "(Masterpiece:1.4), (best quality:1.2), , suzukaze aoba, 1girl, hair ornament, suit, skirt suit, twintails, purple hair, purple bow", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "54c721edf1", + "name": "cottoncandyPastel_v10", + "type": "model" + } + ], + "Model hash": "54c721edf1", + "negativePrompt": "cartoon, sketches, (worst quality:1.5), (low quality:1.5), lowres, ((monochrome)), ((grayscale)), drawn by bad-artist, bad_prompt_version2, negative_hand, ng_deepnegative_v1_75t, EasyNegative, (nsfw:1.1), bad anatomy, text, watermark, simple background, white background, noise, blurry background, blurry, signature, black background, patreon username", + "Denoising strength": "0.35", + "\"suzukaze_aoba-000015": "d5a0caf0b321\"", + "Tiled Diffusion upscaler": "4x_fatal_Anime_500000_G", + "Tiled Diffusion scale factor": "2" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/457ee1d6-0224-47b6-9fa9-8c5292ad94ce/width=450/1388559.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UgLNla-:_3kC_NozbXRj?as.RiRktRbIs;ay", + "meta": { + "Size": "1024x1536", + "seed": 4138342921, + "Model": "cottoncandyPastel_v10", + "steps": 20, + "hashes": { + "vae": "df3c506e51", + "model": "54c721edf1", + "embed:bad-artist": "2d35613490", + "embed:EasyNegative": "66a7279a88", + "embed:bad_prompt_version2": "6f35e7dd81", + "lora:suzukaze_aoba-000015": "1a5b686566", + "embed:ng_deepnegative_v1_75t": "54e7e4826d" + }, + "prompt": "(Masterpiece:1.4), (best quality:1.2), , suzukaze aoba, 1girl, hair ornament, suit, skirt suit, twintails, purple hair, purple bow", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "54c721edf1", + "name": "cottoncandyPastel_v10", + "type": "model" + } + ], + "Model hash": "54c721edf1", + "negativePrompt": "cartoon, sketches, (worst quality:1.5), (low quality:1.5), lowres, ((monochrome)), ((grayscale)), drawn by bad-artist, bad_prompt_version2, negative_hand, ng_deepnegative_v1_75t, EasyNegative, (nsfw:1.1), bad anatomy, text, watermark, simple background, white background, noise, blurry background, blurry, signature, black background, patreon username", + "Denoising strength": "0.35", + "\"suzukaze_aoba-000015": "d5a0caf0b321\"", + "Tiled Diffusion upscaler": "4x_fatal_Anime_500000_G", + "Tiled Diffusion scale factor": "2" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/109376" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/suzukaze_aoba-000015.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/suzukaze_aoba-000015.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..1c9bacade168c48c96faccad9544fe3dca762907 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/suzukaze_aoba-000015.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/suzukaze_aoba-000015.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/suzukaze_aoba-000015.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..26112bb7544f9d154b4d09e0f2fdac194a062663 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/suzukaze_aoba-000015.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:1a5b686566fd3205e0fc673e46b65b964251e57132d622e53cb2b90075ac4a60 +size 19000456 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/takimotoHifumi_takimotoHifumi.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/takimotoHifumi_takimotoHifumi.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..a6dd5b1e39e1feb439bebd04b6f7c3854d88a990 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/takimotoHifumi_takimotoHifumi.civitai.info" @@ -0,0 +1,338 @@ +{ + "id": 21241, + "modelId": 17972, + "name": "Takimoto Hifumi \u6cf7\u672c\u65e5\u5bcc\u7f8e", + "createdAt": "2023-03-10T17:29:03.275Z", + "updatedAt": "2023-03-13T17:30:23.456Z", + "trainedWords": [ + "takimoto hifumi " + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "model": { + "name": "Takimoto Hifumi \u6cf7\u672c\u65e5\u5bcc\u7f8e", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "takimotoHifumi_takimotoHifumi.safetensors", + "id": 17695, + "sizeKB": 73845.0322265625, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-03-10T17:30:52.329Z", + "hashes": { + "AutoV1": "67A72EAB", + "AutoV2": "A7728205BE", + "SHA256": "A7728205BE9EE2E4011BE447C45E6B5E84BC4674447EFB1CD44E621989820008", + "CRC32": "29B82114", + "BLAKE3": "CDB090ABC4E147D3A6B3BCAA6D2A60E62FED90676BAC0A6F16485A0D3C79DA52" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/21241" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4f858d0c-8822-4c36-e4b3-eff7e20e7700/width=450/244754.jpeg", + "nsfw": false, + "width": 688, + "height": 1032, + "hash": "UJJaWXEMw[x@~VE3-=N?s7IV-:-:4oM|M}IU", + "meta": { + "Eta": "0.68", + "ENSD": "31337", + "Size": "512x768", + "seed": 3535322064, + "steps": 20, + "prompt": ",((masterpiece,best quality, detailed)), ultra-detailed, detailed hair,cowboy shot, (1girl:1.2), solo,( long hair:1.3), (floating hair:1.2), (smile:1.1),medium breasts, standing,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "pastelMixStylizedAnime_pastelMixLoraVersion", + "type": "lora", + "weight": 0.8 + } + ], + "Model hash": "8fd5b18bbe", + "Hires steps": "10", + "Hires upscale": "1.35", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "lowres, bad anatomy, bad hands,bad_prompt_version2, error, missing fingers, (easynegative:1.2),extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, artist name,\n(adult:1.1576), (bad anatomy:1.2155), (bad feet:1.05), bad hands, (bad proportions:1.1576), (blurry:1.05), cloned face, cropped, (deformed:1.1576), (disfigured:1.1576), error, (extra arms:1.1576), (extra digit:1.05), (extra legs:1.1576), extra limbs, (extra limbs:1.1025), (fewer digits:1.05), (fused fingers:1.05), gross proportions, ink eyes, ink hair, jpeg artifacts, (long neck:1.2155), low quality, (malformed limbs:1.05), (missing arms:1.1025), (missing fingers:1.05), (missing legs:1.1025), (more than 2 nipples:1.1576), mutated hands, (mutation:1.1576), normal quality, out of frame, owres, (poorly drawn face:1.1025), (poorly drawn hands:1.1025), reen eyes, signature, text, (too many fingers:1.1025), (ugly:1.1576), username, uta, watermark, worst quality\nmultiple_breasts, (mutated_hands_and_fingers:1.5), (long_body:1.3), (mutation, poorly_drawn:1.2), black-white, bad_anatomy, liquid_body, liquid_tongue, disfigured, malformed, mutated, anatomical_nonsense, text_font_ui, malformed_hands, long_neck, blurred, lowers, lowres, bad_anatomy, bad_proportions, uncoordinated_body, black-white, unnatural_body, fused_breasts, bad_breasts, huge_breasts, poorly_drawn_breasts, extra_breasts, liquid_breasts, heavy_breasts, missing_breasts, huge_haunch, huge_thighs, huge_calf, bad_hands, fused_hand, missing_hand, disappearing_arms, disappearing_thigh, disappearing_calf, disappearing_legs, fused_ears, bad_ears, poorly_drawn_ears, extra_ears, liquid_ears, heavy_ears, missing_ears, fused_animal_ears, bad_animal_ears, poorly_drawn_animal_ears, extra_animal_ears, liquid_animal_ears, heavy_animal_ears, missing_animal_ears, text, ui, error, missing_fingers, missing_limb, fused_fingers, one_hand_with_more_than_5_fingers, one_hand_with_less_than_5_fingers, one_hand_with_more_than_5_digit, one_hand_with_less_than_5_digit, extra_digit, fewer_digits, fused_digit, missing_digit, bad_digit, liquid_digit, colorful_tongue, black_tongue, cropped, jpeg_artifacts, signature,, malformed_feet, extra_feet, bad_feet, poorly_drawn_feet, fused_feet, missing_feet, extra_shoes, bad_shoes, fused_shoes, more_than_two_shoes, poorly_drawn_shoes, bad_gloves, poorly_drawn_gloves, fused_gloves, bad_cum, poorly_drawn_cum, fused_cum, bad_hairs, poorly_drawn_hairs, fused_hairs, big_muscles, ugly, bad_face, fused_face, poorly_drawn_face, cloned_face, big_face, long_face, bad_eyes, fused_eyes_poorly_drawn_eyes, extra_eyes, malformed_limbs, more_than_2_nipples, missing_nipples, different_nipples, fused_nipples, bad_nipples, poorly_drawn_nipples, black_nipples, colorful_nipples, gross_proportions._short_arm, (missing_arms), missing_thighs, missing_calf, missing_legs, mutation, duplicate,mutilated, poorly_drawn_hands, more_than_1_left_hand, more_than_1_right_hand, deformed, (blurry), disfigured, missing_legs, extra_arms, extra_thighs, more_than_2_thighs, extra_calf, fused_calf, extra_legs, bad_knee, extra_knee, more_than_2_legs, bad_tails, bad_mouth, fused_mouth, poorly_drawn_mouth, bad_tongue, long_tongue, black_tongue, big_mouth, cracked_mouth, bad_mouth,dirty_teeth, fused_pantie, poorly_drawn_pantie, fused_cloth, poorly_drawn_cloth, bad_pantie, yellow_teeth, thick_lips, bad_cameltoe, colorful_camelote, bad_asshole, poorly_drawn_asshole, fused_asshole, missing_asshole, bad_anus, bad_pussy, bad_crotch, bad_crotch_seam, fused_anus, poorly_drawn_pussy, fused_pussy, poorly_drawn_anus, fused_anus, fused_crotch, poorly_drawn_crotch, fused_seam, poorly_drawn_anus, poorly_drawn_crotch, poorly_drawn_crotch_seam, bad_thigh_gap, missing_thigh_gap, fused_thigh_gap, liquid_thigh_gap, poorly_drawn_thigh_gap, poorly_drawn_anus, bad_collarbone, fused_collarbone, missing_collarbone, liquid_collarbone, strong_girl, obesity, worst_quality, low_quality, normal_quality, cbad_tentacles, poorly_drawn_tentacles, split_tentacles, fused_tentacles, missing_clit, bad_clit, fused_clit, colorful_clit, black_clit, liquid_clit, QR_code, bar_code, censored, safety_panties, safety_knickers, beard, furry, pony, pubic_hair, bar_censor,heart_censor, mosaic,mosaic censoring, excrement, futa, testis, (too_long_body:1.5), (too_long_upper_body:1.5), (ugly_body:1.2), (big_head:1.1), crooked_nipples, cignature, username, blurry,", + "Denoising strength": "0.6" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/aec66648-a95b-40c2-4adf-97f99d06a300/width=450/244692.jpeg", + "nsfw": false, + "width": 688, + "height": 1032, + "hash": "UJKm;Dx]D#9F^+Ne-;M|~qIq9Zt6I;n+Rjxt", + "meta": { + "Eta": "0.68", + "ENSD": "31337", + "Size": "512x768", + "seed": 3113878166, + "steps": 20, + "prompt": ",((masterpiece,best quality, detailed)), ultra-detailed, detailed hair,cowboy shot, (1girl:1.2), solo,( long hair:1.3), (floating hair:1.2), (smile:1.1),medium breasts, standing,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "pastelMixStylizedAnime_pastelMixLoraVersion", + "type": "lora", + "weight": 0.8 + } + ], + "Model hash": "8fd5b18bbe", + "Hires steps": "10", + "Hires upscale": "1.35", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "lowres, bad anatomy, bad hands,bad_prompt_version2, error, missing fingers, (easynegative:1.2),extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, artist name,\n(adult:1.1576), (bad anatomy:1.2155), (bad feet:1.05), bad hands, (bad proportions:1.1576), (blurry:1.05), cloned face, cropped, (deformed:1.1576), (disfigured:1.1576), error, (extra arms:1.1576), (extra digit:1.05), (extra legs:1.1576), extra limbs, (extra limbs:1.1025), (fewer digits:1.05), (fused fingers:1.05), gross proportions, ink eyes, ink hair, jpeg artifacts, (long neck:1.2155), low quality, (malformed limbs:1.05), (missing arms:1.1025), (missing fingers:1.05), (missing legs:1.1025), (more than 2 nipples:1.1576), mutated hands, (mutation:1.1576), normal quality, out of frame, owres, (poorly drawn face:1.1025), (poorly drawn hands:1.1025), reen eyes, signature, text, (too many fingers:1.1025), (ugly:1.1576), username, uta, watermark, worst quality\nmultiple_breasts, (mutated_hands_and_fingers:1.5), (long_body:1.3), (mutation, poorly_drawn:1.2), black-white, bad_anatomy, liquid_body, liquid_tongue, disfigured, malformed, mutated, anatomical_nonsense, text_font_ui, malformed_hands, long_neck, blurred, lowers, lowres, bad_anatomy, bad_proportions, uncoordinated_body, black-white, unnatural_body, fused_breasts, bad_breasts, huge_breasts, poorly_drawn_breasts, extra_breasts, liquid_breasts, heavy_breasts, missing_breasts, huge_haunch, huge_thighs, huge_calf, bad_hands, fused_hand, missing_hand, disappearing_arms, disappearing_thigh, disappearing_calf, disappearing_legs, fused_ears, bad_ears, poorly_drawn_ears, extra_ears, liquid_ears, heavy_ears, missing_ears, fused_animal_ears, bad_animal_ears, poorly_drawn_animal_ears, extra_animal_ears, liquid_animal_ears, heavy_animal_ears, missing_animal_ears, text, ui, error, missing_fingers, missing_limb, fused_fingers, one_hand_with_more_than_5_fingers, one_hand_with_less_than_5_fingers, one_hand_with_more_than_5_digit, one_hand_with_less_than_5_digit, extra_digit, fewer_digits, fused_digit, missing_digit, bad_digit, liquid_digit, colorful_tongue, black_tongue, cropped, jpeg_artifacts, signature,, malformed_feet, extra_feet, bad_feet, poorly_drawn_feet, fused_feet, missing_feet, extra_shoes, bad_shoes, fused_shoes, more_than_two_shoes, poorly_drawn_shoes, bad_gloves, poorly_drawn_gloves, fused_gloves, bad_cum, poorly_drawn_cum, fused_cum, bad_hairs, poorly_drawn_hairs, fused_hairs, big_muscles, ugly, bad_face, fused_face, poorly_drawn_face, cloned_face, big_face, long_face, bad_eyes, fused_eyes_poorly_drawn_eyes, extra_eyes, malformed_limbs, more_than_2_nipples, missing_nipples, different_nipples, fused_nipples, bad_nipples, poorly_drawn_nipples, black_nipples, colorful_nipples, gross_proportions._short_arm, (missing_arms), missing_thighs, missing_calf, missing_legs, mutation, duplicate,mutilated, poorly_drawn_hands, more_than_1_left_hand, more_than_1_right_hand, deformed, (blurry), disfigured, missing_legs, extra_arms, extra_thighs, more_than_2_thighs, extra_calf, fused_calf, extra_legs, bad_knee, extra_knee, more_than_2_legs, bad_tails, bad_mouth, fused_mouth, poorly_drawn_mouth, bad_tongue, long_tongue, black_tongue, big_mouth, cracked_mouth, bad_mouth,dirty_teeth, fused_pantie, poorly_drawn_pantie, fused_cloth, poorly_drawn_cloth, bad_pantie, yellow_teeth, thick_lips, bad_cameltoe, colorful_camelote, bad_asshole, poorly_drawn_asshole, fused_asshole, missing_asshole, bad_anus, bad_pussy, bad_crotch, bad_crotch_seam, fused_anus, poorly_drawn_pussy, fused_pussy, poorly_drawn_anus, fused_anus, fused_crotch, poorly_drawn_crotch, fused_seam, poorly_drawn_anus, poorly_drawn_crotch, poorly_drawn_crotch_seam, bad_thigh_gap, missing_thigh_gap, fused_thigh_gap, liquid_thigh_gap, poorly_drawn_thigh_gap, poorly_drawn_anus, bad_collarbone, fused_collarbone, missing_collarbone, liquid_collarbone, strong_girl, obesity, worst_quality, low_quality, normal_quality, cbad_tentacles, poorly_drawn_tentacles, split_tentacles, fused_tentacles, missing_clit, bad_clit, fused_clit, colorful_clit, black_clit, liquid_clit, QR_code, bar_code, censored, safety_panties, safety_knickers, beard, furry, pony, pubic_hair, bar_censor,heart_censor, mosaic,mosaic censoring, excrement, futa, testis, (too_long_body:1.5), (too_long_upper_body:1.5), (ugly_body:1.2), (big_head:1.1), crooked_nipples, cignature, username, blurry,", + "Denoising strength": "0.6" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3a147514-e010-4cd3-41d5-76636ea4f900/width=450/244691.jpeg", + "nsfw": false, + "width": 688, + "height": 1032, + "hash": "UHK1a%-;JBIUPES2.T-;D,%Mt7M_01V?V[S4", + "meta": { + "Eta": "0.68", + "ENSD": "31337", + "Size": "512x768", + "seed": 3113878167, + "steps": 20, + "prompt": ",((masterpiece,best quality, detailed)), ultra-detailed, detailed hair,cowboy shot, (1girl:1.2), solo,( long hair:1.3), (floating hair:1.2), (smile:1.1),medium breasts, standing,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "pastelMixStylizedAnime_pastelMixLoraVersion", + "type": "lora", + "weight": 0.8 + } + ], + "Model hash": "8fd5b18bbe", + "Hires steps": "10", + "Hires upscale": "1.35", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "lowres, bad anatomy, bad hands,bad_prompt_version2, error, missing fingers, (easynegative:1.2),extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, artist name,\n(adult:1.1576), (bad anatomy:1.2155), (bad feet:1.05), bad hands, (bad proportions:1.1576), (blurry:1.05), cloned face, cropped, (deformed:1.1576), (disfigured:1.1576), error, (extra arms:1.1576), (extra digit:1.05), (extra legs:1.1576), extra limbs, (extra limbs:1.1025), (fewer digits:1.05), (fused fingers:1.05), gross proportions, ink eyes, ink hair, jpeg artifacts, (long neck:1.2155), low quality, (malformed limbs:1.05), (missing arms:1.1025), (missing fingers:1.05), (missing legs:1.1025), (more than 2 nipples:1.1576), mutated hands, (mutation:1.1576), normal quality, out of frame, owres, (poorly drawn face:1.1025), (poorly drawn hands:1.1025), reen eyes, signature, text, (too many fingers:1.1025), (ugly:1.1576), username, uta, watermark, worst quality\nmultiple_breasts, (mutated_hands_and_fingers:1.5), (long_body:1.3), (mutation, poorly_drawn:1.2), black-white, bad_anatomy, liquid_body, liquid_tongue, disfigured, malformed, mutated, anatomical_nonsense, text_font_ui, malformed_hands, long_neck, blurred, lowers, lowres, bad_anatomy, bad_proportions, uncoordinated_body, black-white, unnatural_body, fused_breasts, bad_breasts, huge_breasts, poorly_drawn_breasts, extra_breasts, liquid_breasts, heavy_breasts, missing_breasts, huge_haunch, huge_thighs, huge_calf, bad_hands, fused_hand, missing_hand, disappearing_arms, disappearing_thigh, disappearing_calf, disappearing_legs, fused_ears, bad_ears, poorly_drawn_ears, extra_ears, liquid_ears, heavy_ears, missing_ears, fused_animal_ears, bad_animal_ears, poorly_drawn_animal_ears, extra_animal_ears, liquid_animal_ears, heavy_animal_ears, missing_animal_ears, text, ui, error, missing_fingers, missing_limb, fused_fingers, one_hand_with_more_than_5_fingers, one_hand_with_less_than_5_fingers, one_hand_with_more_than_5_digit, one_hand_with_less_than_5_digit, extra_digit, fewer_digits, fused_digit, missing_digit, bad_digit, liquid_digit, colorful_tongue, black_tongue, cropped, jpeg_artifacts, signature,, malformed_feet, extra_feet, bad_feet, poorly_drawn_feet, fused_feet, missing_feet, extra_shoes, bad_shoes, fused_shoes, more_than_two_shoes, poorly_drawn_shoes, bad_gloves, poorly_drawn_gloves, fused_gloves, bad_cum, poorly_drawn_cum, fused_cum, bad_hairs, poorly_drawn_hairs, fused_hairs, big_muscles, ugly, bad_face, fused_face, poorly_drawn_face, cloned_face, big_face, long_face, bad_eyes, fused_eyes_poorly_drawn_eyes, extra_eyes, malformed_limbs, more_than_2_nipples, missing_nipples, different_nipples, fused_nipples, bad_nipples, poorly_drawn_nipples, black_nipples, colorful_nipples, gross_proportions._short_arm, (missing_arms), missing_thighs, missing_calf, missing_legs, mutation, duplicate,mutilated, poorly_drawn_hands, more_than_1_left_hand, more_than_1_right_hand, deformed, (blurry), disfigured, missing_legs, extra_arms, extra_thighs, more_than_2_thighs, extra_calf, fused_calf, extra_legs, bad_knee, extra_knee, more_than_2_legs, bad_tails, bad_mouth, fused_mouth, poorly_drawn_mouth, bad_tongue, long_tongue, black_tongue, big_mouth, cracked_mouth, bad_mouth,dirty_teeth, fused_pantie, poorly_drawn_pantie, fused_cloth, poorly_drawn_cloth, bad_pantie, yellow_teeth, thick_lips, bad_cameltoe, colorful_camelote, bad_asshole, poorly_drawn_asshole, fused_asshole, missing_asshole, bad_anus, bad_pussy, bad_crotch, bad_crotch_seam, fused_anus, poorly_drawn_pussy, fused_pussy, poorly_drawn_anus, fused_anus, fused_crotch, poorly_drawn_crotch, fused_seam, poorly_drawn_anus, poorly_drawn_crotch, poorly_drawn_crotch_seam, bad_thigh_gap, missing_thigh_gap, fused_thigh_gap, liquid_thigh_gap, poorly_drawn_thigh_gap, poorly_drawn_anus, bad_collarbone, fused_collarbone, missing_collarbone, liquid_collarbone, strong_girl, obesity, worst_quality, low_quality, normal_quality, cbad_tentacles, poorly_drawn_tentacles, split_tentacles, fused_tentacles, missing_clit, bad_clit, fused_clit, colorful_clit, black_clit, liquid_clit, QR_code, bar_code, censored, safety_panties, safety_knickers, beard, furry, pony, pubic_hair, bar_censor,heart_censor, mosaic,mosaic censoring, excrement, futa, testis, (too_long_body:1.5), (too_long_upper_body:1.5), (ugly_body:1.2), (big_head:1.1), crooked_nipples, cignature, username, blurry,", + "Denoising strength": "0.6" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/bb288987-7ffd-4bfc-4969-4125cb4afc00/width=450/225173.jpeg", + "nsfw": false, + "width": 512, + "height": 768, + "hash": "UII#S{~V0eR-={%L-;%M%1%L-:%2xu-;IoM{", + "meta": { + "Eta": "0.68", + "ENSD": "31338", + "Size": "512x768", + "seed": -2, + "steps": 20, + "prompt": ",((masterpiece,best quality, detailed)), cowboy shot, (1girl:1.2), solo, (seductive smile:1.3), breasts, standing, looking at viewer, (sea:1.3),(starry sky:1.3) , ", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "pastelMixStylizedAnime_pastelMixLoraVersion", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "0873291ac5", + "negativePrompt": "(worst quality, low quality:1.4), (malformed hands:1.4),(poorly drawn hands:1.4),(mutated fingers:1.4),(extra limbs:1.35),(poorly drawn face:1.4), ((logo,text)), ((easynegative)), (depth of field, bokeh, blurry:1.4), realistic, teeth, pubic hair, bad_prompt_version2" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/161473e0-1853-4eb1-49fc-83ca7f48df00/width=450/244753.jpeg", + "nsfw": false, + "width": 688, + "height": 1032, + "hash": "UbKd9|NH=^-p~VM|V?ofrpt6adV@W.%Mt7jY", + "meta": { + "Eta": "0.68", + "ENSD": "31337", + "Size": "512x768", + "seed": 3535322062, + "steps": 20, + "prompt": ",((masterpiece,best quality, detailed)), ultra-detailed, detailed hair,cowboy shot, (1girl:1.2), solo,( long hair:1.3), (floating hair:1.2), (smile:1.1),medium breasts, standing,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "pastelMixStylizedAnime_pastelMixLoraVersion", + "type": "lora", + "weight": 0.8 + } + ], + "Model hash": "8fd5b18bbe", + "Hires steps": "10", + "Hires upscale": "1.35", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "lowres, bad anatomy, bad hands,bad_prompt_version2, error, missing fingers, (easynegative:1.2),extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, artist name,\n(adult:1.1576), (bad anatomy:1.2155), (bad feet:1.05), bad hands, (bad proportions:1.1576), (blurry:1.05), cloned face, cropped, (deformed:1.1576), (disfigured:1.1576), error, (extra arms:1.1576), (extra digit:1.05), (extra legs:1.1576), extra limbs, (extra limbs:1.1025), (fewer digits:1.05), (fused fingers:1.05), gross proportions, ink eyes, ink hair, jpeg artifacts, (long neck:1.2155), low quality, (malformed limbs:1.05), (missing arms:1.1025), (missing fingers:1.05), (missing legs:1.1025), (more than 2 nipples:1.1576), mutated hands, (mutation:1.1576), normal quality, out of frame, owres, (poorly drawn face:1.1025), (poorly drawn hands:1.1025), reen eyes, signature, text, (too many fingers:1.1025), (ugly:1.1576), username, uta, watermark, worst quality\nmultiple_breasts, (mutated_hands_and_fingers:1.5), (long_body:1.3), (mutation, poorly_drawn:1.2), black-white, bad_anatomy, liquid_body, liquid_tongue, disfigured, malformed, mutated, anatomical_nonsense, text_font_ui, malformed_hands, long_neck, blurred, lowers, lowres, bad_anatomy, bad_proportions, uncoordinated_body, black-white, unnatural_body, fused_breasts, bad_breasts, huge_breasts, poorly_drawn_breasts, extra_breasts, liquid_breasts, heavy_breasts, missing_breasts, huge_haunch, huge_thighs, huge_calf, bad_hands, fused_hand, missing_hand, disappearing_arms, disappearing_thigh, disappearing_calf, disappearing_legs, fused_ears, bad_ears, poorly_drawn_ears, extra_ears, liquid_ears, heavy_ears, missing_ears, fused_animal_ears, bad_animal_ears, poorly_drawn_animal_ears, extra_animal_ears, liquid_animal_ears, heavy_animal_ears, missing_animal_ears, text, ui, error, missing_fingers, missing_limb, fused_fingers, one_hand_with_more_than_5_fingers, one_hand_with_less_than_5_fingers, one_hand_with_more_than_5_digit, one_hand_with_less_than_5_digit, extra_digit, fewer_digits, fused_digit, missing_digit, bad_digit, liquid_digit, colorful_tongue, black_tongue, cropped, jpeg_artifacts, signature,, malformed_feet, extra_feet, bad_feet, poorly_drawn_feet, fused_feet, missing_feet, extra_shoes, bad_shoes, fused_shoes, more_than_two_shoes, poorly_drawn_shoes, bad_gloves, poorly_drawn_gloves, fused_gloves, bad_cum, poorly_drawn_cum, fused_cum, bad_hairs, poorly_drawn_hairs, fused_hairs, big_muscles, ugly, bad_face, fused_face, poorly_drawn_face, cloned_face, big_face, long_face, bad_eyes, fused_eyes_poorly_drawn_eyes, extra_eyes, malformed_limbs, more_than_2_nipples, missing_nipples, different_nipples, fused_nipples, bad_nipples, poorly_drawn_nipples, black_nipples, colorful_nipples, gross_proportions._short_arm, (missing_arms), missing_thighs, missing_calf, missing_legs, mutation, duplicate,mutilated, poorly_drawn_hands, more_than_1_left_hand, more_than_1_right_hand, deformed, (blurry), disfigured, missing_legs, extra_arms, extra_thighs, more_than_2_thighs, extra_calf, fused_calf, extra_legs, bad_knee, extra_knee, more_than_2_legs, bad_tails, bad_mouth, fused_mouth, poorly_drawn_mouth, bad_tongue, long_tongue, black_tongue, big_mouth, cracked_mouth, bad_mouth,dirty_teeth, fused_pantie, poorly_drawn_pantie, fused_cloth, poorly_drawn_cloth, bad_pantie, yellow_teeth, thick_lips, bad_cameltoe, colorful_camelote, bad_asshole, poorly_drawn_asshole, fused_asshole, missing_asshole, bad_anus, bad_pussy, bad_crotch, bad_crotch_seam, fused_anus, poorly_drawn_pussy, fused_pussy, poorly_drawn_anus, fused_anus, fused_crotch, poorly_drawn_crotch, fused_seam, poorly_drawn_anus, poorly_drawn_crotch, poorly_drawn_crotch_seam, bad_thigh_gap, missing_thigh_gap, fused_thigh_gap, liquid_thigh_gap, poorly_drawn_thigh_gap, poorly_drawn_anus, bad_collarbone, fused_collarbone, missing_collarbone, liquid_collarbone, strong_girl, obesity, worst_quality, low_quality, normal_quality, cbad_tentacles, poorly_drawn_tentacles, split_tentacles, fused_tentacles, missing_clit, bad_clit, fused_clit, colorful_clit, black_clit, liquid_clit, QR_code, bar_code, censored, safety_panties, safety_knickers, beard, furry, pony, pubic_hair, bar_censor,heart_censor, mosaic,mosaic censoring, excrement, futa, testis, (too_long_body:1.5), (too_long_upper_body:1.5), (ugly_body:1.2), (big_head:1.1), crooked_nipples, cignature, username, blurry,", + "Denoising strength": "0.6" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/152c5723-e2d7-40bf-a562-94d916fc9e00/width=450/225188.jpeg", + "nsfw": false, + "width": 512, + "height": 768, + "hash": "UMGuXeI@O?b^~p9ZRk?Gg4RQM{xt={R,RiE1", + "meta": { + "Eta": "0.68", + "ENSD": "31338", + "Size": "512x768", + "seed": -1, + "steps": 20, + "prompt": ",((masterpiece,best quality, detailed)), cowboy shot, (1girl:1.2), solo, (seductive smile:1.3), breasts, standing, looking at viewer, (sea:1.3),(starry sky:1.3) , ", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "pastelMixStylizedAnime_pastelMixLoraVersion", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "0873291ac5", + "negativePrompt": "(worst quality, low quality:1.4), (malformed hands:1.4),(poorly drawn hands:1.4),(mutated fingers:1.4),(extra limbs:1.35),(poorly drawn face:1.4), ((logo,text)), ((easynegative)), (depth of field, bokeh, blurry:1.4), realistic, teeth, pubic hair, bad_prompt_version2" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/79310916-094e-49a5-e5d7-e2a41abe9d00/width=450/225187.jpeg", + "nsfw": false, + "width": 512, + "height": 768, + "hash": "USJas5Ipx]9G~VM|S4R.oexWWYR*-o%KD%IU", + "meta": { + "Eta": "0.68", + "ENSD": "31338", + "Size": "512x768", + "seed": 0, + "steps": 20, + "prompt": ",((masterpiece,best quality, detailed)), cowboy shot, (1girl:1.2), solo, (seductive smile:1.3), breasts, standing, looking at viewer, (sea:1.3),(starry sky:1.3) , ", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "pastelMixStylizedAnime_pastelMixLoraVersion", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "0873291ac5", + "negativePrompt": "(worst quality, low quality:1.4), (malformed hands:1.4),(poorly drawn hands:1.4),(mutated fingers:1.4),(extra limbs:1.35),(poorly drawn face:1.4), ((logo,text)), ((easynegative)), (depth of field, bokeh, blurry:1.4), realistic, teeth, pubic hair, bad_prompt_version2" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6eb73fc3-2933-487d-c36c-ffef3934c500/width=450/244752.jpeg", + "nsfw": false, + "width": 688, + "height": 1032, + "hash": "UbKT#*%M%MM{~qkBWAM{s:NGR*xu%MWWRjxt", + "meta": { + "Eta": "0.68", + "ENSD": "31337", + "Size": "512x768", + "seed": 3535322065, + "steps": 20, + "prompt": ",((masterpiece,best quality, detailed)), ultra-detailed, detailed hair,cowboy shot, (1girl:1.2), solo,( long hair:1.3), (floating hair:1.2), (smile:1.1),medium breasts, standing,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "pastelMixStylizedAnime_pastelMixLoraVersion", + "type": "lora", + "weight": 0.8 + } + ], + "Model hash": "8fd5b18bbe", + "Hires steps": "10", + "Hires upscale": "1.35", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "lowres, bad anatomy, bad hands,bad_prompt_version2, error, missing fingers, (easynegative:1.2),extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, artist name,\n(adult:1.1576), (bad anatomy:1.2155), (bad feet:1.05), bad hands, (bad proportions:1.1576), (blurry:1.05), cloned face, cropped, (deformed:1.1576), (disfigured:1.1576), error, (extra arms:1.1576), (extra digit:1.05), (extra legs:1.1576), extra limbs, (extra limbs:1.1025), (fewer digits:1.05), (fused fingers:1.05), gross proportions, ink eyes, ink hair, jpeg artifacts, (long neck:1.2155), low quality, (malformed limbs:1.05), (missing arms:1.1025), (missing fingers:1.05), (missing legs:1.1025), (more than 2 nipples:1.1576), mutated hands, (mutation:1.1576), normal quality, out of frame, owres, (poorly drawn face:1.1025), (poorly drawn hands:1.1025), reen eyes, signature, text, (too many fingers:1.1025), (ugly:1.1576), username, uta, watermark, worst quality\nmultiple_breasts, (mutated_hands_and_fingers:1.5), (long_body:1.3), (mutation, poorly_drawn:1.2), black-white, bad_anatomy, liquid_body, liquid_tongue, disfigured, malformed, mutated, anatomical_nonsense, text_font_ui, malformed_hands, long_neck, blurred, lowers, lowres, bad_anatomy, bad_proportions, uncoordinated_body, black-white, unnatural_body, fused_breasts, bad_breasts, huge_breasts, poorly_drawn_breasts, extra_breasts, liquid_breasts, heavy_breasts, missing_breasts, huge_haunch, huge_thighs, huge_calf, bad_hands, fused_hand, missing_hand, disappearing_arms, disappearing_thigh, disappearing_calf, disappearing_legs, fused_ears, bad_ears, poorly_drawn_ears, extra_ears, liquid_ears, heavy_ears, missing_ears, fused_animal_ears, bad_animal_ears, poorly_drawn_animal_ears, extra_animal_ears, liquid_animal_ears, heavy_animal_ears, missing_animal_ears, text, ui, error, missing_fingers, missing_limb, fused_fingers, one_hand_with_more_than_5_fingers, one_hand_with_less_than_5_fingers, one_hand_with_more_than_5_digit, one_hand_with_less_than_5_digit, extra_digit, fewer_digits, fused_digit, missing_digit, bad_digit, liquid_digit, colorful_tongue, black_tongue, cropped, jpeg_artifacts, signature,, malformed_feet, extra_feet, bad_feet, poorly_drawn_feet, fused_feet, missing_feet, extra_shoes, bad_shoes, fused_shoes, more_than_two_shoes, poorly_drawn_shoes, bad_gloves, poorly_drawn_gloves, fused_gloves, bad_cum, poorly_drawn_cum, fused_cum, bad_hairs, poorly_drawn_hairs, fused_hairs, big_muscles, ugly, bad_face, fused_face, poorly_drawn_face, cloned_face, big_face, long_face, bad_eyes, fused_eyes_poorly_drawn_eyes, extra_eyes, malformed_limbs, more_than_2_nipples, missing_nipples, different_nipples, fused_nipples, bad_nipples, poorly_drawn_nipples, black_nipples, colorful_nipples, gross_proportions._short_arm, (missing_arms), missing_thighs, missing_calf, missing_legs, mutation, duplicate,mutilated, poorly_drawn_hands, more_than_1_left_hand, more_than_1_right_hand, deformed, (blurry), disfigured, missing_legs, extra_arms, extra_thighs, more_than_2_thighs, extra_calf, fused_calf, extra_legs, bad_knee, extra_knee, more_than_2_legs, bad_tails, bad_mouth, fused_mouth, poorly_drawn_mouth, bad_tongue, long_tongue, black_tongue, big_mouth, cracked_mouth, bad_mouth,dirty_teeth, fused_pantie, poorly_drawn_pantie, fused_cloth, poorly_drawn_cloth, bad_pantie, yellow_teeth, thick_lips, bad_cameltoe, colorful_camelote, bad_asshole, poorly_drawn_asshole, fused_asshole, missing_asshole, bad_anus, bad_pussy, bad_crotch, bad_crotch_seam, fused_anus, poorly_drawn_pussy, fused_pussy, poorly_drawn_anus, fused_anus, fused_crotch, poorly_drawn_crotch, fused_seam, poorly_drawn_anus, poorly_drawn_crotch, poorly_drawn_crotch_seam, bad_thigh_gap, missing_thigh_gap, fused_thigh_gap, liquid_thigh_gap, poorly_drawn_thigh_gap, poorly_drawn_anus, bad_collarbone, fused_collarbone, missing_collarbone, liquid_collarbone, strong_girl, obesity, worst_quality, low_quality, normal_quality, cbad_tentacles, poorly_drawn_tentacles, split_tentacles, fused_tentacles, missing_clit, bad_clit, fused_clit, colorful_clit, black_clit, liquid_clit, QR_code, bar_code, censored, safety_panties, safety_knickers, beard, furry, pony, pubic_hair, bar_censor,heart_censor, mosaic,mosaic censoring, excrement, futa, testis, (too_long_body:1.5), (too_long_upper_body:1.5), (ugly_body:1.2), (big_head:1.1), crooked_nipples, cignature, username, blurry,", + "Denoising strength": "0.6" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6c3d0f93-aa5e-4ac6-0de9-072790362300/width=450/225186.jpeg", + "nsfw": false, + "width": 512, + "height": 768, + "hash": "UAF$06E3%#~WA2^,0Lxt4TX9X7D*^$IU-mt7", + "meta": { + "Eta": "0.68", + "ENSD": "31338", + "Size": "512x768", + "seed": 1, + "steps": 20, + "prompt": ",((masterpiece,best quality, detailed)), cowboy shot, (1girl:1.2), solo, (seductive smile:1.3), breasts, standing, looking at viewer, (sea:1.3),(starry sky:1.3) , ", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "pastelMixStylizedAnime_pastelMixLoraVersion", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "0873291ac5", + "negativePrompt": "(worst quality, low quality:1.4), (malformed hands:1.4),(poorly drawn hands:1.4),(mutated fingers:1.4),(extra limbs:1.35),(poorly drawn face:1.4), ((logo,text)), ((easynegative)), (depth of field, bokeh, blurry:1.4), realistic, teeth, pubic hair, bad_prompt_version2" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/70c5ff77-4950-460f-e7d4-e99d97027f00/width=450/225185.jpeg", + "nsfw": false, + "width": 512, + "height": 768, + "hash": "UGHUkKM|L2D*_N4.MdMyW;xuD%SgMx-VI:%L", + "meta": { + "Eta": "0.68", + "ENSD": "31338", + "Size": "512x768", + "seed": 2, + "steps": 20, + "prompt": ",((masterpiece,best quality, detailed)), cowboy shot, (1girl:1.2), solo, (seductive smile:1.3), breasts, standing, looking at viewer, (sea:1.3),(starry sky:1.3) , ", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "pastelMixStylizedAnime_pastelMixLoraVersion", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "0873291ac5", + "negativePrompt": "(worst quality, low quality:1.4), (malformed hands:1.4),(poorly drawn hands:1.4),(mutated fingers:1.4),(extra limbs:1.35),(poorly drawn face:1.4), ((logo,text)), ((easynegative)), (depth of field, bokeh, blurry:1.4), realistic, teeth, pubic hair, bad_prompt_version2" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/21241" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/takimotoHifumi_takimotoHifumi.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/takimotoHifumi_takimotoHifumi.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..24ceccf4cf8e7ba05d5deae38eb5d1da01b8605a Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/takimotoHifumi_takimotoHifumi.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/takimotoHifumi_takimotoHifumi.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/takimotoHifumi_takimotoHifumi.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..b3e9ced1e9b4180f851bf2fe56ceb8399886c6dc --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/takimotoHifumi_takimotoHifumi.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:a7728205be9ee2e4011be447c45e6b5e84bc4674447efb1cd44e621989820008 +size 75617313 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/umiko-11.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/umiko-11.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..212ec142f07c0ab9a49ca5b7515031e398f2a630 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/umiko-11.civitai.info" @@ -0,0 +1,89 @@ +{ + "id": 111639, + "modelId": 104179, + "name": "v2.0", + "createdAt": "2023-07-06T16:03:30.669Z", + "updatedAt": "2023-07-06T16:03:49.981Z", + "trainedWords": [ + "ahagon umiko" + ], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 210, + "ratingCount": 1, + "rating": 5 + }, + "model": { + "name": "Ahagon Umiko - New Game!", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "umiko-11.safetensors", + "id": 79047, + "sizeKB": 18547.59765625, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-07-06T16:06:00.136Z", + "hashes": { + "AutoV1": "DE2F2560", + "AutoV2": "01C2986BFD", + "SHA256": "01C2986BFDEE552FA6CCBFC8DB15B7A555CD2E6268842A386E94FA004B9CDE9E", + "CRC32": "295217C1", + "BLAKE3": "DA6F4772B8A95C85B4FBEC3997BAE136B61E40AB2239BF480C8BE6381ADF0BF3" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/111639" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c48200dc-5bd3-4c8d-a4ab-3d24ee4ffa77/width=450/1435362.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "UUI;;kxc?v%2~pxuX9oMxvxuafoy?HW-afbF", + "meta": { + "Size": "512x768", + "seed": 1463950825, + "Model": "sweetMix_v21", + "steps": 35, + "\"umiko": "613b96e00087\"", + "hashes": { + "model": "9e4f6f7a28" + }, + "prompt": "(extremely detailed CG unity 8k wallpaper), (masterpiece), (best quality), (ultra-detailed), (best illustration), (best shadow), (absurdres), 1girl, solo, , ahagon umiko, closed mouth, crossed arms, t-shirt, looking at viewer", + "Version": "## 1.4.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "clipSkip": 2, + "resources": [ + { + "name": "umiko", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "9e4f6f7a28", + "name": "sweetMix_v21", + "type": "model" + } + ], + "Model hash": "9e4f6f7a28", + "negativePrompt": "extra fingers, fewer fingers, bad-hands-5, by bad-artist, (bad eyes:1.2), (misfigured pupils:1.2), (bad clothing:1.3), (undetailed clothing:1.3), ng_deepnegative_v1_75t, verybadimagenegative_v1.3, (nonsensical backrounds:1.2), (bad backrounds:1.2), (bad shadows:1.2), (bad anatomy:1.1)," + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/111639" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/umiko-11.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/umiko-11.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..31f75b5c7a0ffdec44437f484bcc13184aea4896 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/umiko-11.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/umiko-11.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/umiko-11.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..58f365fe3e0bd219dccbb7aba8089522828c3b99 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/umiko-11.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:01c2986bfdee552fa6ccbfc8db15b7a555cd2e6268842a386e94fa004b9cde9e +size 18992740 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/yun-10.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/yun-10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..48de10accd9935b4ef82f0bb0f9b4ad5ea5af945 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/yun-10.civitai.info" @@ -0,0 +1,89 @@ +{ + "id": 111632, + "modelId": 104172, + "name": "v2.0", + "createdAt": "2023-07-06T15:56:30.303Z", + "updatedAt": "2023-07-06T15:56:55.653Z", + "trainedWords": [ + "iijima yun" + ], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 205, + "ratingCount": 1, + "rating": 5 + }, + "model": { + "name": "Iijima Yun - New Game!", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "yun-10.safetensors", + "id": 79041, + "sizeKB": 18548.822265625, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-07-06T16:00:57.139Z", + "hashes": { + "AutoV1": "DE2F2560", + "AutoV2": "461B8C9988", + "SHA256": "461B8C99880068AC28884C90C144DA173F4A4EA6BE6D39705CC471D41F749AF2", + "CRC32": "3F181AFB", + "BLAKE3": "624E14098B53BC5E2F5A765A8E3395CE05C8B1659D0F35F2411DFDC38A0FA37D" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/111632" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3cfb260d-cd27-4a9f-84fb-dca6fffeec39/width=450/1435346.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "UeK-5#VsD%Rj~WofIpa}V?oet7oexuRjt7ae", + "meta": { + "\"yun": "eb1e6e041b23\"", + "Size": "512x768", + "seed": 1614741831, + "Model": "sweetMix_v21", + "steps": 35, + "hashes": { + "model": "9e4f6f7a28" + }, + "prompt": "(extremely detailed CG unity 8k wallpaper), (masterpiece), (best quality), (ultra-detailed), (best illustration), (best shadow), (absurdres), 1girl, solo, , iijima yun, collarbone, shirt, long sleeves, choker, green ribbon, looking at viewer, smile", + "Version": "## 1.4.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "clipSkip": 2, + "resources": [ + { + "name": "yun", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "9e4f6f7a28", + "name": "sweetMix_v21", + "type": "model" + } + ], + "Model hash": "9e4f6f7a28", + "negativePrompt": "extra fingers, fewer fingers, bad-hands-5, by bad-artist, (bad eyes:1.2), (misfigured pupils:1.2), (bad clothing:1.3), (undetailed clothing:1.3), ng_deepnegative_v1_75t, verybadimagenegative_v1.3, (nonsensical backrounds:1.2), (bad backrounds:1.2), (bad shadows:1.2), (bad anatomy:1.1)," + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/111632" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/yun-10.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/yun-10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..7cfd27e336e016f813d780be03948b5a316638c9 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/yun-10.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/yun-10.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/yun-10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..4ad64812f2ea35b569a3cc46ec3d3385f871335c --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NEW GAME!/yun-10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:461b8c99880068ac28884c90c144da173f4a4ea6be6d39705cc471d41f749af2 +size 18993994 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NO GAME NO LIFE \346\270\270\346\210\217\344\272\272\347\224\237/Steph_V1.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NO GAME NO LIFE \346\270\270\346\210\217\344\272\272\347\224\237/Steph_V1.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..31db9b0902d0f0b28ebc80ae45955ed554f030c4 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NO GAME NO LIFE \346\270\270\346\210\217\344\272\272\347\224\237/Steph_V1.civitai.info" @@ -0,0 +1,183 @@ +{ + "id": 89540, + "modelId": 84238, + "name": "v1.0", + "createdAt": "2023-06-05T04:13:14.050Z", + "updatedAt": "2023-06-05T04:33:51.348Z", + "trainedWords": [ + "Steph(NGNL)" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 104, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Stephanie Dola (No Game No Life)", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "Steph_V1.safetensors", + "id": 61540, + "sizeKB": 9326.7626953125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-05T04:25:33.788Z", + "hashes": { + "AutoV1": "5190AEEE", + "AutoV2": "6198C3DCC7", + "SHA256": "6198C3DCC7932A189F8277CFE7EB9DCB508C3C3955AB117A14006A7923927FC0", + "CRC32": "C7727796", + "BLAKE3": "19E3DE874F15B4D58E97A617165ED39268D1FD6E9EF35D106B174DF76EF26F92" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/89540" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/155b39dc-cf40-4006-8f8c-35b4b81b7743/width=450/1035784.jpeg", + "nsfw": "None", + "width": 512, + "height": 512, + "hash": "UQM5z^~B9vOXM0;{^+b]%fO;%gE#Oqk9Myt8", + "meta": { + "Size": "512x512", + "seed": 2766649606, + "Model": "mightycorneoNewMerges_bloodsplashsMix", + "steps": 80, + "hashes": { + "vae": "f921fb3f29", + "model": "517d63f73e" + }, + "prompt": "1girl, solo, blue eyes, Steph(NGNL), masterpierce, detailed eyes, serious, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 19, + "Clip skip": "2", + "resources": [ + { + "hash": "517d63f73e", + "name": "mightycorneoNewMerges_bloodsplashsMix", + "type": "model" + } + ], + "Model hash": "517d63f73e", + "negativePrompt": "EasyNegative, poor drawn, blurry, blurry smile, water mark" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1c5f779e-0b2d-4a90-9ccb-49192988e3dd/width=450/1035821.jpeg", + "nsfw": "None", + "width": 512, + "height": 512, + "hash": "UTK0aC=h9H~DH}IDxJ-W^l^kt8t6M~xH%KIo", + "meta": { + "Size": "512x512", + "seed": 1732456355, + "Model": "mightycorneoNewMerges_bloodsplashsMix", + "steps": 80, + "hashes": { + "vae": "f921fb3f29", + "model": "517d63f73e" + }, + "prompt": "1girl, solo, blue eyes, Steph(NGNL), masterpierce, confident, determined, elegant, mysterious ,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 19, + "Clip skip": "2", + "resources": [ + { + "name": "Steph_V1", + "type": "lora", + "weight": 1 + }, + { + "hash": "517d63f73e", + "name": "mightycorneoNewMerges_bloodsplashsMix", + "type": "model" + } + ], + "Model hash": "517d63f73e", + "negativePrompt": "EasyNegative, poor drawn, blurry, blurry smile, water mark" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7ba1aaee-b16d-415d-b5b6-abba7481c751/width=450/1035838.jpeg", + "nsfw": "None", + "width": 512, + "height": 512, + "hash": "UGLyWo0155zp*e69_2kF5jaR_M^5paIUNfNa", + "meta": { + "Size": "512x512", + "seed": 3983934665, + "Model": "mightycorneoNewMerges_bloodsplashsMix", + "steps": 80, + "hashes": { + "vae": "f921fb3f29", + "model": "517d63f73e" + }, + "prompt": "1girl, solo, blue eyes, Steph(NGNL), masterpierce, crying, elegant, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 19, + "Clip skip": "2", + "resources": [ + { + "name": "Steph_V1", + "type": "lora", + "weight": 1 + }, + { + "hash": "517d63f73e", + "name": "mightycorneoNewMerges_bloodsplashsMix", + "type": "model" + } + ], + "Model hash": "517d63f73e", + "negativePrompt": "EasyNegative, poor drawn, blurry, blurry smile, water mark" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b94f6f6a-c31f-4b60-95ce-b01b294640f9/width=450/1035778.jpeg", + "nsfw": "None", + "width": 512, + "height": 512, + "hash": "UBKTDV00K6I900KzE0~n30^$R5=g=^+itS9c", + "meta": { + "Size": "512x512", + "seed": 3716145735, + "Model": "mightycorneoNewMerges_bloodsplashsMix", + "steps": 80, + "hashes": { + "vae": "f921fb3f29", + "model": "517d63f73e" + }, + "prompt": "Steph(NGNL), masterpierce, 1girl, solo, detailed eyes, , cinematic lighting, full body", + "sampler": "DPM++ 2M Karras", + "cfgScale": 19, + "Clip skip": "2", + "resources": [ + { + "hash": "517d63f73e", + "name": "mightycorneoNewMerges_bloodsplashsMix", + "type": "model" + } + ], + "Model hash": "517d63f73e", + "negativePrompt": "EasyNegative, poor drawn, blurry, blurry smile, water mark, text" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/89540" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NO GAME NO LIFE \346\270\270\346\210\217\344\272\272\347\224\237/Steph_V1.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NO GAME NO LIFE \346\270\270\346\210\217\344\272\272\347\224\237/Steph_V1.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..1c5f7f81311376bff555e2f53d009ab6470b92fd Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NO GAME NO LIFE \346\270\270\346\210\217\344\272\272\347\224\237/Steph_V1.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NO GAME NO LIFE \346\270\270\346\210\217\344\272\272\347\224\237/Steph_V1.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NO GAME NO LIFE \346\270\270\346\210\217\344\272\272\347\224\237/Steph_V1.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..3120ca95fdfb4c6a6e4cc1baea66645c41030db2 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NO GAME NO LIFE \346\270\270\346\210\217\344\272\272\347\224\237/Steph_V1.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:6198c3dcc7932a189f8277cfe7eb9dcb508c3c3955ab117a14006a7923927fc0 +size 9550605 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NO GAME NO LIFE \346\270\270\346\210\217\344\272\272\347\224\237/jibriltest.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NO GAME NO LIFE \346\270\270\346\210\217\344\272\272\347\224\237/jibriltest.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..06ae638dc0ec7677d5468178d095ebfd29ff828c --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NO GAME NO LIFE \346\270\270\346\210\217\344\272\272\347\224\237/jibriltest.civitai.info" @@ -0,0 +1,330 @@ +{ + "id": 111918, + "modelId": 104407, + "name": "v1.0", + "createdAt": "2023-07-07T01:53:48.239Z", + "updatedAt": "2023-07-07T01:57:01.775Z", + "trainedWords": [ + "jibril, angel, angel wings, animal ears, bird ears, compass rose halo, feathered wings, feathers, gradient hair, halo, long hair, low wings, multicolored hair, navel, pink hair, symbol-shaped pupils, tattoo, white wings, wing ears, wings, (yellow eyes:1.5)", + "asymmetrical legwear, crop top, cross, gloves, mismatched legwear, sideboob," + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 35, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Jibril - No Game No Life", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "jibriltest.safetensors", + "id": 79260, + "sizeKB": 37018.0556640625, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-07-07T01:55:47.775Z", + "hashes": { + "AutoV1": "4D1697A4", + "AutoV2": "A44E960DB7", + "SHA256": "A44E960DB77ABDCD0825B0A1232F6DBE662AC4C8BCCCBFBB083ED48699F8D5FB", + "CRC32": "CB201442", + "BLAKE3": "03792C764253588849FF4342917EC3FC3B7C5E69C6C7528E8AC60B67B3D11EAF" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/111918" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d63a401e-a480-4864-a5de-2f607ac575ba/width=450/1441001.jpeg", + "nsfw": "Soft", + "width": 600, + "height": 896, + "hash": "UQLz8Z9wK%tl_Naftlt7M_MyI:Sgr^RkIUS#", + "meta": { + "Size": "200x300", + "seed": 1194572894, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "jibril, , \njibril, angel, angel wings, animal ears, bird ears, compass rose halo, feathered wings, feathers, gradient hair, halo, long hair, low wings, multicolored hair, navel, pink hair, symbol-shaped pupils, tattoo, white wings, wing ears, wings, (yellow eyes:1.5),\nBREAK asymmetrical legwear, crop top, cross, gloves, mismatched legwear, sideboob,,\nBREAK looking at viewer,\nBREAK outdoors, city,\nBREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "jibriltest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "\"jibriltest": "014dd3c04a98", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3, (hair between eyes:2)", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/21717575-61f8-4c0b-b0b2-940972f01491/width=450/1441002.jpeg", + "nsfw": "Soft", + "width": 600, + "height": 896, + "hash": "UHM6o5t3T|tl~Cn6o{%1NfepS]tNtj%J0#S%", + "meta": { + "Size": "200x300", + "seed": 1194572895, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "jibril, , \njibril, angel, angel wings, animal ears, bird ears, compass rose halo, feathered wings, feathers, gradient hair, halo, long hair, low wings, multicolored hair, navel, pink hair, symbol-shaped pupils, tattoo, white wings, wing ears, wings, (yellow eyes:1.5),\nBREAK asymmetrical legwear, crop top, cross, gloves, mismatched legwear, sideboob,,\nBREAK looking at viewer,\nBREAK outdoors, city,\nBREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "jibriltest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "\"jibriltest": "014dd3c04a98", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3, (hair between eyes:2)", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7a7582e4-885a-4a9a-9ef2-5a78f486a6e6/width=450/1441006.jpeg", + "nsfw": "Soft", + "width": 600, + "height": 896, + "hash": "UJM?GA_N.RJA^,-:%gj^n$r^tQ%L.8xuofbH", + "meta": { + "Size": "200x300", + "seed": 3330656329, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "jibril, , \njibril, angel, angel wings, animal ears, bird ears, compass rose halo, feathered wings, feathers, gradient hair, halo, long hair, low wings, multicolored hair, navel, pink hair, symbol-shaped pupils, tattoo, white wings, wing ears, wings, (yellow eyes:1.5),\nBREAK bikini,\nBREAK looking at viewer,\nBREAK outdoors, beach,\nBREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "jibriltest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "\"jibriltest": "014dd3c04a98", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3, (hair between eyes:2)", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/46ce52b4-cb7d-4b09-b3a0-de56b4a030e7/width=450/1441005.jpeg", + "nsfw": "Soft", + "width": 600, + "height": 896, + "hash": "ULLM-d*Jp_J:?Io}g4NH$fV@tMkDT0NbNHR%", + "meta": { + "Size": "200x300", + "seed": 3330656328, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "jibril, , \njibril, angel, angel wings, animal ears, bird ears, compass rose halo, feathered wings, feathers, gradient hair, halo, long hair, low wings, multicolored hair, navel, pink hair, symbol-shaped pupils, tattoo, white wings, wing ears, wings, (yellow eyes:1.5),\nBREAK bikini,\nBREAK looking at viewer,\nBREAK outdoors, beach,\nBREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "jibriltest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "\"jibriltest": "014dd3c04a98", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3, (hair between eyes:2)", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/34d1010d-ba88-4d2f-84ea-5f2cd5c42d59/width=450/1441012.jpeg", + "nsfw": "Soft", + "width": 600, + "height": 896, + "hash": "U6Kvjr4U3A~p03~C0J0y0z-D0|1G$eo}=_TJ", + "meta": { + "Size": "200x300", + "seed": 1254073241, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "jibril, , \njibril, angel, angel wings, animal ears, bird ears, compass rose halo, feathered wings, feathers, gradient hair, halo, long hair, low wings, multicolored hair, navel, pink hair, symbol-shaped pupils, tattoo, white wings, wing ears, wings, (yellow eyes:1.5),\nBREAK lingerie,\nBREAK looking at viewer,\nBREAK indoors, bed,\nBREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "jibriltest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "\"jibriltest": "014dd3c04a98", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3, (hair between eyes:2)", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/bdfbabb5-472d-4302-9cd0-1b87b2bef949/width=450/1441013.jpeg", + "nsfw": "Soft", + "width": 600, + "height": 896, + "hash": "U8JQNGMg00yU02~p0e9[-;-pbuFs~VtR_3ov", + "meta": { + "Size": "200x300", + "seed": 1254073240, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "jibril, , \njibril, angel, angel wings, animal ears, bird ears, compass rose halo, feathered wings, feathers, gradient hair, halo, long hair, low wings, multicolored hair, navel, pink hair, symbol-shaped pupils, tattoo, white wings, wing ears, wings, (yellow eyes:1.5),\nBREAK lingerie,\nBREAK looking at viewer,\nBREAK indoors, bed,\nBREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "jibriltest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "\"jibriltest": "014dd3c04a98", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3, (hair between eyes:2)", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/111918" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NO GAME NO LIFE \346\270\270\346\210\217\344\272\272\347\224\237/jibriltest.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NO GAME NO LIFE \346\270\270\346\210\217\344\272\272\347\224\237/jibriltest.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..f65d05a4f5a0fb09d6fadd270d7b746e8b351d40 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NO GAME NO LIFE \346\270\270\346\210\217\344\272\272\347\224\237/jibriltest.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NO GAME NO LIFE \346\270\270\346\210\217\344\272\272\347\224\237/jibriltest.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NO GAME NO LIFE \346\270\270\346\210\217\344\272\272\347\224\237/jibriltest.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..6923adf617235a3ebfb5b237235254924879c921 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NO GAME NO LIFE \346\270\270\346\210\217\344\272\272\347\224\237/jibriltest.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:a44e960db77abdcd0825b0a1232f6dbe662ac4c8bcccbfbb083ed48699f8d5fb +size 37906489 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NO GAME NO LIFE \346\270\270\346\210\217\344\272\272\347\224\237/stephanieDoraNoGameNoLife_v10.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NO GAME NO LIFE \346\270\270\346\210\217\344\272\272\347\224\237/stephanieDoraNoGameNoLife_v10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..0e70b8aea4dd4cef85d3fbda0e82741e5d01e059 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NO GAME NO LIFE \346\270\270\346\210\217\344\272\272\347\224\237/stephanieDoraNoGameNoLife_v10.civitai.info" @@ -0,0 +1,194 @@ +{ + "id": 53699, + "modelId": 49103, + "name": "v1.0", + "createdAt": "2023-04-24T02:01:39.586Z", + "updatedAt": "2023-04-24T02:25:12.486Z", + "trainedWords": [ + "1girl,frilled dress,yellow dress, pink cape" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 9, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "stephanie dora (no game no life) \u53f2\u8482\u82ac\u59ae\u00b7\u591a\u62c9 (\u6e38\u620f\u4eba\u751f)", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "stephanieDoraNoGameNoLife_v10.safetensors", + "id": 38973, + "sizeKB": 147568.4892578125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-24T02:11:40.905Z", + "hashes": { + "AutoV1": "203C1FB2", + "AutoV2": "C90B8582A4", + "SHA256": "C90B8582A4FBC3DF9C228382E2FDE0A1578836EFF4DFDFAA409949DD5A353369", + "CRC32": "4352EDDC", + "BLAKE3": "38F32D7D1805F636A642F587BA94EF8E4526A56A6CBFB2C381AF970572B689B0" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/53699" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7e4aa1cd-a01b-42a6-fe40-436795f84f00/width=450/581361.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "URL|1F0L9]a0~pi_?aoMrr%2x[R%?GV[Ipn*", + "meta": { + "ENSD": "31337", + "Size": "576x832", + "seed": 1147731574, + "Model": "a7b3", + "steps": 20, + "hashes": { + "model": "f915efad12" + }, + "prompt": "masterpiece, best quality,1girl,frilled dress,yellow dress, pink cape,grey background, (kbxll:0.6)", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "f915efad12", + "name": "a7b3", + "type": "model" + }, + { + "hash": "6f36f288e2fc", + "name": "stephanie", + "type": "lora", + "weight": null + } + ], + "Model hash": "f915efad12", + "AddNet Enabled": "True", + "AddNet Model 1": "stephanie(6f36f288e2fc)", + "negativePrompt": "text,username,logo,(low quality, worst quality:1.4), (bad anatomy), (inaccurate limb:1.2), bad composition, inaccurate eyes, extra digit, fewer digits, (extra arms:1.2)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.4", + "Ultimate SD upscale padding": "32", + "Ultimate SD upscale upscaler": "R-ESRGAN 4x+ Anime6B", + "Ultimate SD upscale mask_blur": "16", + "Ultimate SD upscale tile_width": "576", + "Ultimate SD upscale tile_height": "832" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/bcf23968-53ab-4c00-c06a-0197baee8d00/width=450/581360.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UWJ@2i~BT19vtnt7%Lt6$es.NHbcj]Rkoft7", + "meta": { + "ENSD": "31337", + "Size": "1024x1536", + "seed": 1853780405, + "Model": "a7b3", + "steps": 20, + "hashes": { + "model": "f915efad12" + }, + "prompt": "masterpiece, best quality,1girl,frilled dress,yellow dress,back, ,grey background, (kbxll:0.6)", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "f915efad12", + "name": "a7b3", + "type": "model" + }, + { + "hash": "6f36f288e2fc", + "name": "stephanie", + "type": "lora", + "weight": null + } + ], + "Model hash": "f915efad12", + "AddNet Enabled": "True", + "AddNet Model 1": "stephanie(6f36f288e2fc)", + "negativePrompt": "text,username,logo,(low quality, worst quality:1.4), (bad anatomy), (inaccurate limb:1.2), bad composition, inaccurate eyes, extra digit, fewer digits, (extra arms:1.2)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.4", + "Ultimate SD upscale padding": "32", + "Ultimate SD upscale upscaler": "R-ESRGAN 4x+ Anime6B", + "Ultimate SD upscale mask_blur": "16", + "Ultimate SD upscale tile_width": "576", + "Ultimate SD upscale tile_height": "832" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b23e9535-eb76-4784-4db2-7fc1b2da9a00/width=450/581379.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UcK^87~pk;oztS-;bws:IBWCozfk%KRjV@RQ", + "meta": { + "ENSD": "31337", + "Size": "576x832", + "seed": 3701612054, + "Model": "anything-v4.5-pruned", + "steps": 20, + "hashes": { + "model": "6e430eb514" + }, + "prompt": "masterpiece, best quality,1girl,dog ears, dog tail,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "6e430eb514", + "name": "anything-v4.5-pruned", + "type": "model" + }, + { + "hash": "6f36f288e2fc", + "name": "stephanie", + "type": "lora", + "weight": null + } + ], + "Model hash": "6e430eb514", + "AddNet Enabled": "True", + "AddNet Model 1": "stephanie(6f36f288e2fc)", + "negativePrompt": "text,username,logo,(low quality, worst quality:1.4), (bad anatomy), (inaccurate limb:1.2), bad composition, inaccurate eyes, extra digit, fewer digits, (extra arms:1.2)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.4", + "Ultimate SD upscale padding": "32", + "Ultimate SD upscale upscaler": "R-ESRGAN 4x+ Anime6B", + "Ultimate SD upscale mask_blur": "16", + "Ultimate SD upscale tile_width": "576", + "Ultimate SD upscale tile_height": "832" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/53699" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NO GAME NO LIFE \346\270\270\346\210\217\344\272\272\347\224\237/stephanieDoraNoGameNoLife_v10.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NO GAME NO LIFE \346\270\270\346\210\217\344\272\272\347\224\237/stephanieDoraNoGameNoLife_v10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..8f42fd581f2ccbd8bb034b595e43f06e44856042 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NO GAME NO LIFE \346\270\270\346\210\217\344\272\272\347\224\237/stephanieDoraNoGameNoLife_v10.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/NO GAME NO LIFE \346\270\270\346\210\217\344\272\272\347\224\237/stephanieDoraNoGameNoLife_v10.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NO GAME NO LIFE \346\270\270\346\210\217\344\272\272\347\224\237/stephanieDoraNoGameNoLife_v10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..189cb884b0fcc29b2688c31591dc99c1c4615f51 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/NO GAME NO LIFE \346\270\270\346\210\217\344\272\272\347\224\237/stephanieDoraNoGameNoLife_v10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:c90b8582a4fbc3df9c228382e2fde0a1578836eff4dfdfaa409949dd5a353369 +size 151110133 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/ONE PIECE/boaHancockONEPIECE_v10.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/ONE PIECE/boaHancockONEPIECE_v10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..3dcc7e125fd007316f63cba616d133251135849e --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/ONE PIECE/boaHancockONEPIECE_v10.civitai.info" @@ -0,0 +1,443 @@ +{ + "id": 51479, + "modelId": 46895, + "name": "v1.0", + "createdAt": "2023-04-21T11:57:36.797Z", + "updatedAt": "2023-04-21T11:59:04.412Z", + "trainedWords": [ + "hancock1, boa hancock" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 45, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Boa Hancock \u30dc\u30a2\u30fb\u30cf\u30f3\u30b3\u30c3\u30af / ONE PIECE", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "boaHancockONEPIECE_v10.safetensors", + "id": 37588, + "sizeKB": 18546.9453125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-21T12:01:40.216Z", + "hashes": { + "AutoV1": "DE2F2560", + "AutoV2": "A5B2BC5E51", + "SHA256": "A5B2BC5E51C1C3AE43816F9305AC7070255204CEB8BA587BCECC4CA80AF5B053", + "CRC32": "F61955B9", + "BLAKE3": "9B73548FA735DB22F92E0B566230D2A9DD1511469407167316DC5ADDB056445D" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/51479" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a5132b2e-5019-4a79-f99a-2f9f87749d00/width=450/554499.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "U4HnQt5S00_M00-700rY4T9]U^%2?a}?.800", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1347687930, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, hancock1, boa hancock, large breasts, epaulettes, cape, crop top, side slit, , cowboy shot, sitting,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "boa_hancock_v1", + "type": "lora", + "weight": 0.9 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1),", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/cfd388d2-2f47-46ef-57ad-9b2e3fc76600/width=450/554501.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UDGuUXD~1F~pCT$ii^58O@t2R4_2I9Xg$vV?", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 4267493179, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, hancock1, boa hancock, large breasts, epaulettes, cape, crop top, side slit, , cowboy shot, stading, outdoors,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "boa_hancock_v1", + "type": "lora", + "weight": 0.9 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1),", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/12d5e33f-5f01-42f9-5c42-716ceec3fc00/width=450/554503.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UXH_fE_3t,XR.m%NozRjXnT1RkxZEQW?jGbb", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3729249999, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, hancock1, 1girl, boa hancock, large breasts, long hair, epaulettes, cape, crop top, side slit, , cowboy shot, stading, outdoors, smile,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "boa_hancock_v1", + "type": "lora", + "weight": 0.9 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1), (holding),", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ca2eade0-3bc5-4e92-781c-201b42428500/width=450/554502.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UIHUX:M{1Gw]Y*tRabxs.mWBxBIoyYxvwuRj", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2533616332, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, hancock1, 1girl, boa hancock, large breasts, long hair, epaulettes, cape, crop top, side slit, , cowboy shot, standing, pointing at viewer,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "boa_hancock_v1", + "type": "lora", + "weight": 0.9 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1), (holding),", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f0eaac95-68ff-49e8-a879-9d93e3ba4e00/width=450/554509.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UJF=gl_N6*D%yr?c$*I..8x^RQw]%go#aLaK", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1699862408, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, hancock1, 1girl, boa hancock, large breasts, long hair, epaulettes, cape, crop top, side slit, , cowboy shot, standing, pointing at viewer,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "boa_hancock_v1", + "type": "lora", + "weight": 0.9 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1), (holding),", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f204e59f-9fba-43b6-e7e4-e7b47307a500/width=450/554500.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UVHUtP?HE1In_Lf+RPj??a%1M{t6kWkCRjt6", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 950110392, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, hancock1, 1girl, boa hancock, large breasts, long hair, crop top, side slit, , cowboy shot, forest, sitting,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "boa_hancock_v1", + "type": "lora", + "weight": 0.9 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1), (holding),", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2e30eef1-6355-4304-33fe-791d8e66de00/width=450/554507.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UNFr9URjEfx[~WRjn$tQt6R*RjxtR*ozWBxZ", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1226428577, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, hancock1, 1girl, boa hancock, large breasts, long hair, crop top, side slit, , cowboy shot, pantyshot,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "boa_hancock_v1", + "type": "lora", + "weight": 0.9 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1), (holding),", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6ae6b65e-2564-41b8-7cee-93ebb690a800/width=450/554510.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UGH^-T~BK4_2EL~WkD-;0LE2~BNH^*oLaga1", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2337796888, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, hancock1, 1girl, boa hancock, large breasts, long hair, crop top, side slit, long sleeves, , indoors, sitting, spread legs, thong, embarrassed, blush,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "boa_hancock_v1", + "type": "lora", + "weight": 0.9 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1), (holding),", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/fdced12f-b002-49c1-455f-d0b2e8716c00/width=450/554506.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "URI|?z-oF_57~VXS%2Rj%MWBaexZ$*j[Rjt7", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 556467050, + "Model": "zMix_v10", + "steps": 20, + "hashes": { + "model": "e8fcda5e2c" + }, + "prompt": "masterpiece, best quality, highres, hancock1, 1girl, boa hancock, large breasts, long hair, crop top, side slit, long sleeves, , cowboy shot, standing,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "boa_hancock_v1", + "type": "lora", + "weight": 0.9 + }, + { + "hash": "e8fcda5e2c", + "name": "zMix_v10", + "type": "model" + } + ], + "Model hash": "e8fcda5e2c", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1), (holding),", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2b56c17f-258c-4967-7955-a358a927e600/width=450/554508.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UYGRez~pOYNG?b?a%MWBbbkCWBaeaya{j?WB", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1722303141, + "Model": "lainmix_v22", + "steps": 20, + "hashes": { + "model": "cd96ea5a76" + }, + "prompt": "masterpiece, best quality, highres, hancock1, 1girl, boa hancock, large breasts, long hair, crop top, side slit, long sleeves, , cowboy shot, standing,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "boa_hancock_v1", + "type": "lora", + "weight": 0.9 + }, + { + "hash": "cd96ea5a76", + "name": "lainmix_v22", + "type": "model" + } + ], + "Model hash": "cd96ea5a76", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1), (holding),", + "Denoising strength": "0.45" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/51479" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/ONE PIECE/boaHancockONEPIECE_v10.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/ONE PIECE/boaHancockONEPIECE_v10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..e9f28a5ae281c93be4098ad0002ec2f17ad42b33 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/ONE PIECE/boaHancockONEPIECE_v10.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/ONE PIECE/boaHancockONEPIECE_v10.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/ONE PIECE/boaHancockONEPIECE_v10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..a398a484753ea5c6853e652a1d0f600322080250 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/ONE PIECE/boaHancockONEPIECE_v10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:a5b2bc5e51c1c3ae43816f9305ac7070255204ceb8ba587bcecc4ca80af5b053 +size 18992072 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/ONE PIECE/nami-10.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/ONE PIECE/nami-10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..1f7231fbfc62adec442d243d47ffbd79c8a76142 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/ONE PIECE/nami-10.civitai.info" @@ -0,0 +1,266 @@ +{ + "id": 109088, + "modelId": 101905, + "name": "v1.0", + "createdAt": "2023-07-03T00:32:59.352Z", + "updatedAt": "2023-07-03T00:35:26.659Z", + "trainedWords": [ + "nami", + "long hair", + "tattoo" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 112, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Nami", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "nami-10.safetensors", + "id": 77006, + "sizeKB": 18598.89453125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-07-03T00:35:42.422Z", + "hashes": { + "AutoV1": "E76F34E3", + "AutoV2": "2297F6B1C5", + "SHA256": "2297F6B1C59EE820EAB37D61C49F1F28F29B112C434277A842A21E7643A8A671", + "CRC32": "161A258C", + "BLAKE3": "126D0F841ABF9CBACC0A22FD9CBD55B2429ED25245053EE0E26CA364E203C50B" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/109088" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/284de47a-c59b-423e-a6fe-b8dabc50eae7/width=450/1382759.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1536, + "hash": "UIKwCD0L1M%M?wD*kXtRM|s*-nRP589FM{s.", + "meta": { + "Size": "512x768", + "seed": 1466968731, + "\"nami": "629acdc8e043\"", + "steps": 100, + "prompt": "(anime style),masterpiece, best quality, ultra-detailed, glistening shiny, glowing light, ray tracing, HDR, deph of field, (perfect face, detailed face, detailed eyes),(big boobs:1.2,clevage),8k,HD,ultra realistic face,ray tracing,perfect lighting,best quality, ultra-detailed, shiny eyes, (looking at viewer,sensual smile:1.1), ((1girl)), (gyaru, mature female:1.4),cowboy shot,((view from below)):1.2,((nsfw,nude)),\nnami,long hair,((gradient hair)),multicolored eyes, gradient eyes, (glowing eyes:1.1), mascara, (fashion make up), parted lips,pussy,nipples,tattoo,sitting on a bench,\n((tropical beach, sunset, palm trees, log cabin)),complex background,((super detailed background)), dynamic poses, ((8k wallpaper)) , ", + "Version": "v1.3.2", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "nami", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "5e6b1cc26c", + "Hires steps": "20", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "bad_prompt,(worst quality:2.0), (low quality:2.0),inaccurate limb,lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name:2,realistic.ugly face,ugly eyes,3D,white bars,", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/fe5dd3e6-c280-49b3-8982-01f225c9d5ef/width=450/1382765.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1536, + "hash": "UNJQvQ~WAH$$59S6I@IV4.IqRj%MRPs:tPIp", + "meta": { + "Size": "512x768", + "seed": 1466968732, + "\"nami": "629acdc8e043\"", + "steps": 100, + "prompt": "(anime style),masterpiece, best quality, ultra-detailed, glistening shiny, glowing light, ray tracing, HDR, deph of field, (perfect face, detailed face, detailed eyes),(big boobs:1.2,clevage),8k,HD,ultra realistic face,ray tracing,perfect lighting,best quality, ultra-detailed, shiny eyes, (looking at viewer,sensual smile:1.1), ((1girl)), (gyaru, mature female:1.4),cowboy shot,((view from below)):1.2,((nsfw,nude)),\nnami,long hair,((gradient hair)),multicolored eyes, gradient eyes, (glowing eyes:1.1), mascara, (fashion make up), parted lips,pussy,nipples,tattoo,sitting on a bench,\n((tropical beach, sunset, palm trees, log cabin)),complex background,((super detailed background)), dynamic poses, ((8k wallpaper)) , ", + "Version": "v1.3.2", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "nami", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "5e6b1cc26c", + "Hires steps": "20", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "bad_prompt,(worst quality:2.0), (low quality:2.0),inaccurate limb,lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name:2,realistic.ugly face,ugly eyes,3D,white bars,", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/951f2b00-6417-435b-bd39-8257533b332e/width=450/1382761.jpeg", + "nsfw": "Mature", + "width": 1536, + "height": 1024, + "hash": "UWJ@zi~Vx]x]k?R5RPELkX%MsTxukX-;xZ-p", + "meta": { + "Size": "768x512", + "seed": 335164156, + "\"nami": "629acdc8e043\"", + "steps": 100, + "prompt": "(anime style),masterpiece, best quality, ultra-detailed, glistening shiny, glowing light, ray tracing, HDR, deph of field, (perfect face, detailed face, detailed eyes),(big boobs:1.2,clevage),8k,HD,ultra realistic face,ray tracing,perfect lighting,best quality, ultra-detailed, shiny eyes, (looking at viewer,sensual smile:1.1), ((1girl)), (gyaru, mature female:1.4),cowboy shot,((view from below)):1.2\nnami,long hair,((gradient hair)),multicolored eyes, gradient eyes, (glowing eyes:1.1), mascara, (fashion make up), parted lips,((microbikini)),cameltoe,tattoo,sitting on a bench,\n((tropical beach, sunset, palm trees, log cabin)),complex background,((super detailed background)), dynamic poses, ((8k wallpaper)) , ", + "Version": "v1.3.2", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "nami", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "5e6b1cc26c", + "Hires steps": "20", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "bad_prompt,(worst quality:2.0), (low quality:2.0),inaccurate limb,lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name:2,realistic.ugly face,ugly eyes,3D,white bars,", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/63b9be26-d2c2-414f-920d-6c74737da94b/width=450/1382762.jpeg", + "nsfw": "X", + "width": 1536, + "height": 1024, + "hash": "UKI#P.~B9sEOuP~C^*xuM}-;%1-oVYXUs,Rk", + "meta": { + "Size": "768x512", + "seed": 2507846452, + "\"nami": "629acdc8e043\"", + "steps": 100, + "prompt": "(anime style),masterpiece, best quality, ultra-detailed, glistening shiny, glowing light, ray tracing, HDR, deph of field, (perfect face, detailed face, detailed eyes),(big boobs:1.2,clevage),8k,HD,ultra realistic face,ray tracing,perfect lighting,best quality, ultra-detailed, shiny eyes, (looking at viewer,sensual smile:1.1), ((1girl)), (gyaru, mature female:1.4),cowboy shot,((view from below)):1.2\nnami,long hair,((gradient hair)),multicolored eyes, gradient eyes, (glowing eyes:1.1), mascara, (fashion make up), parted lips,((microbikini)),cameltoe,tattoo,sitting on a bench,\n((tropical beach, sunset, palm trees, log cabin)),complex background,((super detailed background)), dynamic poses, ((8k wallpaper)) , ", + "Version": "v1.3.2", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "nami", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "5e6b1cc26c", + "Hires steps": "20", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "bad_prompt,(worst quality:2.0), (low quality:2.0),inaccurate limb,lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name:2,realistic.ugly face,ugly eyes,3D,white bars,", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/706786f8-adc1-45b7-9981-bf1456d08c86/width=450/1382760.jpeg", + "nsfw": "X", + "width": 1536, + "height": 1024, + "hash": "UEHxd6^Pu59]16~C]#x[00%gv|,-?HI@TexD", + "meta": { + "Size": "768x512", + "seed": 2507846453, + "\"nami": "629acdc8e043\"", + "steps": 100, + "prompt": "(anime style),masterpiece, best quality, ultra-detailed, glistening shiny, glowing light, ray tracing, HDR, deph of field, (perfect face, detailed face, detailed eyes),(big boobs:1.2,clevage),8k,HD,ultra realistic face,ray tracing,perfect lighting,best quality, ultra-detailed, shiny eyes, (looking at viewer,sensual smile:1.1), ((1girl)), (gyaru, mature female:1.4),cowboy shot,((view from below)):1.2\nnami,long hair,((gradient hair)),multicolored eyes, gradient eyes, (glowing eyes:1.1), mascara, (fashion make up), parted lips,((microbikini)),cameltoe,tattoo,sitting on a bench,\n((tropical beach, sunset, palm trees, log cabin)),complex background,((super detailed background)), dynamic poses, ((8k wallpaper)) , ", + "Version": "v1.3.2", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "nami", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "5e6b1cc26c", + "Hires steps": "20", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "bad_prompt,(worst quality:2.0), (low quality:2.0),inaccurate limb,lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name:2,realistic.ugly face,ugly eyes,3D,white bars,", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1b593061-55d0-407b-9206-b3df0d16e78d/width=450/1382763.jpeg", + "nsfw": "X", + "width": 1536, + "height": 1024, + "hash": "UIJ@g]M}E0vfETIq-o}@0LxuNIt7D%IoNHo#", + "meta": { + "Size": "768x512", + "seed": 2507846454, + "steps": 100, + "prompt": "(anime style),masterpiece, best quality, ultra-detailed, glistening shiny, glowing light, ray tracing, HDR, deph of field, (perfect face, detailed face, detailed eyes),(big boobs:1.2,clevage),8k,HD,ultra realistic face,ray tracing,perfect lighting,best quality, ultra-detailed, shiny eyes, (looking at viewer,sensual smile:1.1), ((1girl)), (gyaru, mature female:1.4),cowboy shot,((view from below)):1.2\nnami,long hair,((gradient hair)),multicolored eyes, gradient eyes, (glowing eyes:1.1), mascara, (fashion make up), parted lips,((microbikini)),cameltoe,tattoo,sitting on a bench,\n((tropical beach, sunset, palm trees, log cabin)),complex background,((super detailed background)), dynamic poses, ((8k wallpaper)) , ", + "Version": "v1.3.2", + "sampler": "DPM++ 2M Karras", + "\"nami-10": "629acdc8e043\"", + "cfgScale": 7, + "clipSkip": 2, + "resources": [], + "Model hash": "5e6b1cc26c", + "Hires steps": "20", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "bad_prompt,(worst quality:2.0), (low quality:2.0),inaccurate limb,lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name:2,realistic.ugly face,ugly eyes,3D,white bars,", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1497c234-a531-4f97-a087-bb26f9cf4e29/width=450/1382764.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1536, + "hash": "URJ@F0~WKOxbOFbHJBR-4:njxuR-RkShbHR+", + "meta": { + "Size": "512x768", + "seed": 2290950474, + "\"nami": "629acdc8e043\"", + "steps": 100, + "prompt": "(anime style),masterpiece, best quality, ultra-detailed, glistening shiny, glowing light, ray tracing, HDR, deph of field, (perfect face, detailed face, detailed eyes),(big boobs:1.2,clevage),8k,HD,ultra realistic face,ray tracing,perfect lighting,best quality, ultra-detailed, shiny eyes, (looking at viewer,sensual smile:1.1), ((1girl)), (gyaru, mature female:1.4),cowboy shot,((bottom view)):1.5\nnami,long hair,((gradient hair)),multicolored eyes, gradient eyes, (glowing eyes:1.1), mascara, (fashion make up), parted lips,((microbikini)),cameltoe,tattoo,sitting on a bench,\n((tropical beach, sunset, palm trees, log cabin)),complex background,((super detailed background)), dynamic poses, ((8k wallpaper)) , ", + "Version": "v1.3.2", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "nami", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "5e6b1cc26c", + "Hires steps": "20", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "bad_prompt,(worst quality:2.0), (low quality:2.0),inaccurate limb,lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name:2,realistic.ugly face,ugly eyes,3D,white bars,", + "Denoising strength": "0.45" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/109088" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/ONE PIECE/nami-10.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/ONE PIECE/nami-10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..8633b609b34dbc641b8215198fdb1c414382bee2 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/ONE PIECE/nami-10.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/ONE PIECE/nami-10.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/ONE PIECE/nami-10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..a222432803a07034f6655501224ed0a3c870f06b --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/ONE PIECE/nami-10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:2297f6b1c59ee820eab37d61c49f1f28f29b112c434277a842a21e7643a8a671 +size 19045268 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/WillowSchneeV1-10.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/WillowSchneeV1-10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..c6c49e9b4ec94744c2ec095784ff75ebd2137870 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/WillowSchneeV1-10.civitai.info" @@ -0,0 +1,167 @@ +{ + "id": 92430, + "modelId": 86886, + "name": "v1.0", + "createdAt": "2023-06-09T13:36:53.774Z", + "updatedAt": "2023-06-09T13:58:48.906Z", + "trainedWords": [ + "WillowSchnee" + ], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 134, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Willow Schnee | RWBY", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "WillowSchneeV1-10.safetensors", + "id": 63740, + "sizeKB": 18551.4150390625, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-09T13:41:05.708Z", + "hashes": { + "AutoV1": "DE2F2560", + "AutoV2": "A01839190D", + "SHA256": "A01839190D011DD164F029EFD2D157A40E8D721C5195A81E4D7A663B51DE9DB0", + "CRC32": "466AF772", + "BLAKE3": "FFAFDDA9473A18FB243584AA636294905299C22516C46DD8AD0CE3EFF358F56A" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/92430" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/bfe2ee0c-5e19-44c3-8f64-9391b0fba263/width=450/1084555.jpeg", + "nsfw": "None", + "width": 768, + "height": 768, + "hash": "UDGlCsM_00~qNaa#9EM|00oy%3n~%2aft7R*", + "meta": { + "Size": "768x768", + "seed": 2813209817, + "steps": 45, + "prompt": "masterpiece,best quality, masterpiece, high detail,detailed face,detailed eyes,rendered eyes,perfect eyes,hip lines,ambient occlusion,crisp image,detailed,amazing,8k,8k wallpaper,8k background,high detailed skin,high res,\n(((cowboy shot))), solo, 1girl,looking at viewer,WillowSchnee,white robe, .\nHer attire consists of a white cravat secured by a silver brooch set with a red stone, as well as a light purple jacket with light sleeves, a wide belt around her waist, a matching pencil skirt with black tights and slippers.", + "sampler": "Euler a", + "cfgScale": 7.5, + "Clip skip": "2", + "resources": [], + "Model hash": "5493a0ec49", + "negativePrompt": "(worst quality:1.4), (low quality:1.4), (monochrome:1.1), easynegative, bad-artist-anime, bad-image-v2-39000, bad_prompt_version2, bad_quality, ng_deepnegative_v1_75t, verybadimagenegative_v1.1-6400, vile_prompt3, bad-hands-5,watermark, font, text, negative_hand-neg,(((close-up)))" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d9451ea9-eea1-4100-9d46-0b5c799c3f8f/width=450/1084550.jpeg", + "nsfw": "None", + "width": 768, + "height": 768, + "hash": "UQIXs%E1E0xu~WIoIUt7_MWBV[WBIoWVjIaf", + "meta": { + "Size": "768x768", + "seed": 2503070203, + "steps": 30, + "prompt": "masterpiece,best quality, masterpiece, high detail,detailed face,detailed eyes,rendered eyes,perfect eyes,hip lines,ambient occlusion,crisp image,detailed,amazing,8k,8k wallpaper,8k background,high detailed skin,high res,\n(((cowboy shot))), solo, 1girl,looking at viewer,WillowSchnee, .\nHer attire consists of a white cravat secured by a silver brooch set with a red stone, as well as a light purple jacket with light sleeves, a wide belt around her waist, a matching pencil skirt with black tights and slippers.", + "sampler": "Euler a", + "cfgScale": 7.5, + "Clip skip": "2", + "resources": [], + "Model hash": "5493a0ec49", + "negativePrompt": "(worst quality:1.4), (low quality:1.4), (monochrome:1.1), easynegative, bad-artist-anime, bad-image-v2-39000, bad_prompt_version2, bad_quality, ng_deepnegative_v1_75t, verybadimagenegative_v1.1-6400, vile_prompt3, bad-hands-5,watermark, font, text, negative_hand-neg,(((close-up)))" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e91e128f-c449-40cb-8964-6718ddc1cfb4/width=450/1084559.jpeg", + "nsfw": "None", + "width": 768, + "height": 768, + "hash": "U5FYZITJ00}Zxus:00IU7{nNQTPB_NEKQ-?c", + "meta": { + "Size": "768x768", + "seed": 3429644828, + "steps": 30, + "prompt": "masterpiece,best quality, masterpiece, high detail,detailed face,detailed eyes,rendered eyes,perfect eyes,hip lines,ambient occlusion,crisp image,detailed,amazing,8k,8k wallpaper,8k background,high detailed skin,high res,\n(((cowboy shot))), solo, 1girl,looking at viewer,WillowSchnee, .\nHer attire consists of a white cravat secured by a silver brooch set with a red stone, as well as a light purple jacket with light sleeves, a wide belt around her waist, a matching pencil skirt with black tights and slippers.", + "sampler": "Euler a", + "cfgScale": 7.5, + "Clip skip": "2", + "resources": [], + "Model hash": "5493a0ec49", + "negativePrompt": "(worst quality:1.4), (low quality:1.4), (monochrome:1.1), easynegative, bad-artist-anime, bad-image-v2-39000, bad_prompt_version2, bad_quality, ng_deepnegative_v1_75t, verybadimagenegative_v1.1-6400, vile_prompt3, bad-hands-5,watermark, font, text, negative_hand-neg,(((close-up)))" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ec1de93b-284f-4f8e-b446-eaa543d8b0b0/width=450/1084558.jpeg", + "nsfw": "None", + "width": 768, + "height": 768, + "hash": "UPH.HI~qkltP.8-;oIWCVrxaIpbIE2NG-poI", + "meta": { + "Size": "768x768", + "seed": 3166964673, + "steps": 30, + "prompt": "masterpiece,best quality, masterpiece, high detail,detailed face,detailed eyes,rendered eyes,perfect eyes,hip lines,ambient occlusion,crisp image,detailed,amazing,8k,8k wallpaper,8k background,high detailed skin,high res,\n(((cowboy shot))), solo, 1girl,looking at viewer,WillowSchnee, ,nervous,blush,school uniform,", + "sampler": "Euler a", + "cfgScale": 7.5, + "Clip skip": "2", + "resources": [], + "Model hash": "5493a0ec49", + "negativePrompt": "(worst quality:1.4), (low quality:1.4), (monochrome:1.1), easynegative, bad-artist-anime, bad-image-v2-39000, bad_prompt_version2, bad_quality, ng_deepnegative_v1_75t, verybadimagenegative_v1.1-6400, vile_prompt3, bad-hands-5,watermark, font, text, negative_hand-neg,(((close-up)))" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5f329fc2-9775-42d6-bd1d-db7d9cc5ca25/width=450/1084556.jpeg", + "nsfw": "None", + "width": 768, + "height": 768, + "hash": "UAE{Ll0d00~C-;s.IU9FTdiwMxS}?vMxMx?b", + "meta": { + "Size": "768x768", + "seed": 1607237367, + "steps": 30, + "prompt": "masterpiece,best quality, masterpiece, high detail,detailed face,detailed eyes,rendered eyes,perfect eyes,hip lines,ambient occlusion,crisp image,detailed,amazing,8k,8k wallpaper,8k background,high detailed skin,high res,\n(((cowboy shot))), solo, 1girl,looking at viewer,WillowSchnee, .\nHer attire consists of a white cravat secured by a silver brooch set with a red stone, as well as a light purple jacket with light sleeves, a wide belt around her waist, a matching pencil skirt with black tights and slippers.", + "sampler": "Euler a", + "cfgScale": 7.5, + "Clip skip": "2", + "resources": [], + "Model hash": "5493a0ec49", + "negativePrompt": "(worst quality:1.4), (low quality:1.4), (monochrome:1.1), easynegative, bad-artist-anime, bad-image-v2-39000, bad_prompt_version2, bad_quality, ng_deepnegative_v1_75t, verybadimagenegative_v1.1-6400, vile_prompt3, bad-hands-5,watermark, font, text, negative_hand-neg,(((close-up)))" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6ec07f32-7f6f-429d-b65b-52c04360a91b/width=450/1084554.jpeg", + "nsfw": "None", + "width": 768, + "height": 768, + "hash": "U5FYif~q00NGcZoy00kD1GIo+v-p-p%2obE0", + "meta": { + "Size": "768x768", + "seed": 2091028072, + "steps": 30, + "prompt": "masterpiece,best quality, masterpiece, high detail,detailed face,detailed eyes,rendered eyes,perfect eyes,hip lines,ambient occlusion,crisp image,detailed,amazing,8k,8k wallpaper,8k background,high detailed skin,high res,\n(((cowboy shot))), solo, 1girl,looking at viewer,WillowSchnee, .\nHer attire consists of a white cravat secured by a silver brooch set with a red stone, as well as a light purple jacket with light sleeves, a wide belt around her waist, a matching pencil skirt with black tights and slippers.", + "sampler": "Euler a", + "cfgScale": 7.5, + "Clip skip": "2", + "resources": [], + "Model hash": "5493a0ec49", + "negativePrompt": "(worst quality:1.4), (low quality:1.4), (monochrome:1.1), easynegative, bad-artist-anime, bad-image-v2-39000, bad_prompt_version2, bad_quality, ng_deepnegative_v1_75t, verybadimagenegative_v1.1-6400, vile_prompt3, bad-hands-5,watermark, font, text, negative_hand-neg,(((close-up)))" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/92430" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/WillowSchneeV1-10.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/WillowSchneeV1-10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..f24f98e446cbbf32866efef94ed0ad9ef3f7174f Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/WillowSchneeV1-10.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/WillowSchneeV1-10.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/WillowSchneeV1-10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..eb270765eb2fcad5ce9eced801a6963044c9c85e --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/WillowSchneeV1-10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:a01839190d011dd164f029efd2d157a40e8d721c5195a81e4d7a663b51de9db0 +size 18996649 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/cinderFallRWBY_v10.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/cinderFallRWBY_v10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..66899902d85b70b625648b04b5fb075facdfba8e --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/cinderFallRWBY_v10.civitai.info" @@ -0,0 +1,286 @@ +{ + "id": 52551, + "modelId": 47955, + "name": "v1.0", + "createdAt": "2023-04-22T16:18:39.471Z", + "updatedAt": "2023-04-22T16:20:47.747Z", + "trainedWords": [ + "cinder fall" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

Initial release.

", + "stats": { + "downloadCount": 210, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Cinder Fall | RWBY", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "cinderFallRWBY_v10.safetensors", + "id": 38256, + "sizeKB": 36987.4306640625, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-22T16:21:41.856Z", + "hashes": { + "AutoV1": "1B17A52E", + "AutoV2": "6B1BD35C27", + "SHA256": "6B1BD35C2729D8C61652C9B3BAF96E2E938117F7A875F5A4B1D38B238FE66C06", + "CRC32": "1F1D44B0", + "BLAKE3": "7580AD5F97865391C21AD5CDD4A56285C104A0E84F2E79048C7C256803170358" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/52551" + }, + { + "name": "cinderFallRWBY_v10_trainingData.zip", + "id": 38257, + "sizeKB": 59660.0478515625, + "type": "Training Data", + "metadata": { + "fp": null, + "size": null, + "format": "Other" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-22T16:22:14.171Z", + "hashes": { + "AutoV1": "B0328537", + "AutoV2": "8C5253FB5A", + "SHA256": "8C5253FB5AF933A5D894D5E0822F3354E636BF9AB4B77639E70AF951602BF403", + "CRC32": "E13BED4E", + "BLAKE3": "EB2DBB30D47237D0C903A80C138E60FC0179B11A0449A23256D55F7396DCF868" + }, + "primary": false, + "downloadUrl": "https://civitai.com/api/download/models/52551?type=Training%20Data" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/946d80d3-3a2d-40ff-a0fe-20cb95596300/width=450/566468.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UOE_gc-:IoIox[Rje.fj~VxaV@s.xaNGxaxa", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3106339666, + "Model": "Anime_citrinedreammix_v11BakedVAE", + "steps": 30, + "hashes": { + "model": "724566c0cc" + }, + "prompt": "(masterpiece, best quality:1.2), , cowboy shot, solo, 1girl, cinder fall, evil smile, looking at viewer, long hair, red dress, elbow gloves", + "sampler": "DPM++ 2M Karras MOD", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "724566c0cc", + "name": "Anime_citrinedreammix_v11BakedVAE", + "type": "model" + } + ], + "Model hash": "724566c0cc", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, badhandv4, (worst quality, low quality:1.4), greyscale, border, artist name, out of frame, holding, zombie", + "Denoising strength": "0.5" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a217a5a2-f606-4fc5-1136-c4cd14752100/width=450/566471.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "U7GatU0hPU_3004o9F00~qxu-pxu00?G^js,", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 555639018, + "Model": "Anime_citrinedreammix_v11BakedVAE", + "steps": 30, + "hashes": { + "model": "724566c0cc" + }, + "prompt": "(masterpiece, best quality:1.2), , , cowboy shot, solo, 1girl, cinder fall, evil grin, looking at viewer, arms behind head, long hair, red dress, elbow gloves, surrounded by flames", + "sampler": "DPM++ 2M Karras MOD", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "FirevfxCreateMore_v2", + "type": "lora", + "weight": 0.4 + }, + { + "hash": "724566c0cc", + "name": "Anime_citrinedreammix_v11BakedVAE", + "type": "model" + } + ], + "Model hash": "724566c0cc", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, badhandv4, (worst quality, low quality:1.4), greyscale, border, artist name, out of frame, zombie", + "Denoising strength": "0.5" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ec13aca9-8b11-4738-7271-faaeddd4f400/width=450/566473.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UNFFd7xuBQWB?]t7V@NGtRIpMx%2NGs:snay", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1340477992, + "Model": "Anime_citrinedreammix_v11BakedVAE", + "steps": 30, + "hashes": { + "model": "724566c0cc" + }, + "prompt": "(masterpiece, best quality:1.2), , cowboy shot, solo, 1girl, cinder fall, expressionless, hand on hip, short black hair, hair over one eye, red china dress, cleavage cutout", + "sampler": "DPM++ 2M Karras MOD", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "724566c0cc", + "name": "Anime_citrinedreammix_v11BakedVAE", + "type": "model" + } + ], + "Model hash": "724566c0cc", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, badhandv4, (worst quality, low quality:1.4), greyscale, border, artist name, out of frame, holding, zombie", + "Denoising strength": "0.5" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ca6e0fea-0877-476d-9fc2-52b962d4ed00/width=450/566469.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UHGHo6~VKfIo^*-o?G%M-:-oVtj]Ioxt$*Rj", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1340477991, + "Model": "Anime_citrinedreammix_v11BakedVAE", + "steps": 30, + "hashes": { + "model": "724566c0cc" + }, + "prompt": "(masterpiece, best quality:1.2), , cowboy shot, solo, 1girl, cinder fall, expressionless, hand on hip, short black hair, hair over one eye, red china dress, cleavage cutout", + "sampler": "DPM++ 2M Karras MOD", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "724566c0cc", + "name": "Anime_citrinedreammix_v11BakedVAE", + "type": "model" + } + ], + "Model hash": "724566c0cc", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, badhandv4, (worst quality, low quality:1.4), greyscale, border, artist name, out of frame, holding, zombie", + "Denoising strength": "0.5" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/84626906-cffe-495c-462d-38586f555400/width=450/566472.jpeg", + "nsfw": false, + "width": 1024, + "height": 1536, + "hash": "UUHBxfVtE1D%?bxus.IU~qWUMxRjxbfQIoj[", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 533584341, + "Model": "Anime_citrinedreammix_v11BakedVAE", + "steps": 30, + "hashes": { + "model": "724566c0cc" + }, + "prompt": "(masterpiece, best quality:1.2), , solo, 1girl, cinder fall, expressionless, hand on hip, short black hair, hair over one eye, hood up, yellow eyes, cloak, red dress, gloves", + "sampler": "DPM++ 2M Karras MOD", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "724566c0cc", + "name": "Anime_citrinedreammix_v11BakedVAE", + "type": "model" + } + ], + "Model hash": "724566c0cc", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, badhandv4, (worst quality, low quality:1.4), greyscale, border, artist name, out of frame, holding, zombie", + "Denoising strength": "0.5" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2c6e5200-b230-47c2-3ec0-d7e65c53ba00/width=450/566470.jpeg", + "nsfw": false, + "width": 1024, + "height": 1536, + "hash": "UcIhNs?a_NIU?bj[oLRjtQbHM{WBaxj[RjoL", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 533584340, + "Model": "Anime_citrinedreammix_v11BakedVAE", + "steps": 30, + "hashes": { + "model": "724566c0cc" + }, + "prompt": "(masterpiece, best quality:1.2), , solo, 1girl, cinder fall, expressionless, hand on hip, short black hair, hair over one eye, hood up, yellow eyes, cloak, red dress, gloves", + "sampler": "DPM++ 2M Karras MOD", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "724566c0cc", + "name": "Anime_citrinedreammix_v11BakedVAE", + "type": "model" + } + ], + "Model hash": "724566c0cc", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, badhandv4, (worst quality, low quality:1.4), greyscale, border, artist name, out of frame, holding, zombie", + "Denoising strength": "0.5" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/52551" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/cinderFallRWBY_v10.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/cinderFallRWBY_v10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..09a099eb974f7a8964a32c57edc719ca9dc452b1 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/cinderFallRWBY_v10.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/cinderFallRWBY_v10.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/cinderFallRWBY_v10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..5e45af301558f6c5f7ce67d3bc2c5460751df977 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/cinderFallRWBY_v10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:6b1bd35c2729d8c61652c9b3baf96e2e938117f7a875f5a4b1d38b238fe66c06 +size 37875129 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/rwby_belladonna-10.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/rwby_belladonna-10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..0e72afc783baf0f5f32ecfa3c7d3a2780ecf1ba7 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/rwby_belladonna-10.civitai.info" @@ -0,0 +1,393 @@ +{ + "id": 54494, + "modelId": 49967, + "name": "v1.0", + "createdAt": "2023-04-24T21:40:42.270Z", + "updatedAt": "2023-04-24T21:43:08.258Z", + "trainedWords": [ + "blake belladonna" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

Initial release.

", + "stats": { + "downloadCount": 741, + "ratingCount": 2, + "rating": 4.5 + }, + "model": { + "name": "Blake Belladonna (Season 1) | RWBY", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "rwby_belladonna-10.safetensors", + "id": 39378, + "sizeKB": 37010.4990234375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-24T21:45:51.343Z", + "hashes": { + "AutoV1": "BA86A35F", + "AutoV2": "645ED694A4", + "SHA256": "645ED694A47F8579C9CFAFB297E0F7CF5A69E7CE9EACEAA7A192CD17C2BA613E", + "CRC32": "28195F1A", + "BLAKE3": "F62A31860307B6FEBF582588258C10C0D0362F163BE90F19239C7D958AE158B9" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/54494" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/eee357a2-9b84-4f7f-5607-bed977a39900/width=450/589498.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "UMJal;_3~q-;-:t7_2Io-;WBM{ay%MD%?bt7", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2235058435, + "Model": "Anime_citrinedreammix_v11BakedVAE", + "steps": 30, + "hashes": { + "model": "724566c0cc" + }, + "prompt": "(masterpiece, best quality:1.2), , cowboy shot, solo, 1girl, blake belladonna, expressionless, closed mouth, looking at viewer, black hair bow, white shirt, detached sleeve, pantyhose, legwear under white shorts", + "sampler": "DPM++ 2M Karras MOD", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "724566c0cc", + "name": "Anime_citrinedreammix_v11BakedVAE", + "type": "model" + } + ], + "Model hash": "724566c0cc", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, badhandv4, (worst quality, low quality:1.4), greyscale, border, artist name, out of frame, zombie", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/922c3d72-7ba8-4fef-e258-e8a1f10abb00/width=450/589499.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "USJaiyRj^*R*~qRjx]xt-;WAWBt7%MoLxaa}", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1424185457, + "Model": "Anime_citrinedreammix_v11BakedVAE", + "steps": 30, + "hashes": { + "model": "724566c0cc" + }, + "prompt": "(masterpiece, best quality:1.2), , cowboy shot, solo, 1girl, blake belladonna, expressionless, closed mouth, looking at viewer, black hair bow, white shirt, detached sleeve, pantyhose, legwear under shorts", + "sampler": "DPM++ 2M Karras MOD", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "724566c0cc", + "name": "Anime_citrinedreammix_v11BakedVAE", + "type": "model" + } + ], + "Model hash": "724566c0cc", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, badhandv4, (worst quality, low quality:1.4), greyscale, border, artist name, out of frame, zombie", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a725217a-3916-4aa3-37d6-c80b45377c00/width=450/589503.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "UGG[f=D*9F?b~qM{W;%M?bE1M|-;_3M{M{oz", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2235058434, + "Model": "Anime_citrinedreammix_v11BakedVAE", + "steps": 30, + "hashes": { + "model": "724566c0cc" + }, + "prompt": "(masterpiece, best quality:1.2), , cowboy shot, solo, 1girl, blake belladonna, expressionless, closed mouth, looking at viewer, black hair bow, white shirt, detached sleeve, pantyhose, legwear under white shorts", + "sampler": "DPM++ 2M Karras MOD", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "724566c0cc", + "name": "Anime_citrinedreammix_v11BakedVAE", + "type": "model" + } + ], + "Model hash": "724566c0cc", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, badhandv4, (worst quality, low quality:1.4), greyscale, border, artist name, out of frame, zombie", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2c224d94-ab48-4742-7441-786b26a28100/width=450/589497.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "U9HUd{#+^hxs?FRQ~q?a?G9a4o_2%fkW4o?G", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2235058433, + "Model": "Anime_citrinedreammix_v11BakedVAE", + "steps": 30, + "hashes": { + "model": "724566c0cc" + }, + "prompt": "(masterpiece, best quality:1.2), , cowboy shot, solo, 1girl, blake belladonna, expressionless, closed mouth, looking at viewer, black hair bow, white shirt, detached sleeve, pantyhose, legwear under white shorts", + "sampler": "DPM++ 2M Karras MOD", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "724566c0cc", + "name": "Anime_citrinedreammix_v11BakedVAE", + "type": "model" + } + ], + "Model hash": "724566c0cc", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, badhandv4, (worst quality, low quality:1.4), greyscale, border, artist name, out of frame, zombie", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b03cbb53-3c46-4901-4c96-914748a33700/width=450/589500.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UVHn?A-;~q%N-;xaxut8xCIUM{xaodM{oday", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3138992501, + "Model": "Anime_citrinedreammix_v11BakedVAE", + "steps": 30, + "hashes": { + "model": "724566c0cc" + }, + "prompt": "(masterpiece, best quality:1.2), , solo, 1girl, blake belladonna, slight smile, closed mouth, looking at viewer, cat ears, school uniform, black blazer, neck ribbon, plaid skirt, pantyhose", + "sampler": "DPM++ 2M Karras MOD", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "724566c0cc", + "name": "Anime_citrinedreammix_v11BakedVAE", + "type": "model" + } + ], + "Model hash": "724566c0cc", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, badhandv4, (worst quality, low quality:1.4), greyscale, border, artist name, out of frame, bare shoulders, zombie", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f55723e7-b370-4151-da12-012c02d89f00/width=450/589501.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UTHeIG?b%MS4~qx]%Mt7RjM{Rjt7xuoLIUf6", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3138992500, + "Model": "Anime_citrinedreammix_v11BakedVAE", + "steps": 30, + "hashes": { + "model": "724566c0cc" + }, + "prompt": "(masterpiece, best quality:1.2), , solo, 1girl, blake belladonna, slight smile, closed mouth, looking at viewer, cat ears, school uniform, black blazer, neck ribbon, plaid skirt, pantyhose", + "sampler": "DPM++ 2M Karras MOD", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "724566c0cc", + "name": "Anime_citrinedreammix_v11BakedVAE", + "type": "model" + } + ], + "Model hash": "724566c0cc", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, badhandv4, (worst quality, low quality:1.4), greyscale, border, artist name, out of frame, bare shoulders, zombie", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/dd59f38c-c2df-4cd7-670f-e9acbbfb3400/width=450/589496.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UFHnmR~UMv^*Dix].8%f-:-p%2i^NGIo4o%2", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2039170813, + "Model": "Anime_citrinedreammix_v11BakedVAE", + "steps": 30, + "hashes": { + "model": "724566c0cc" + }, + "prompt": "(masterpiece, best quality:1.2), , upper body, solo, 1girl, blake belladonna, slight smile, closed mouth, looking at viewer, elbows on table, cat ears, sleeveless shirt, detached sleeve, indoors, food on plate, drinking glass, book on table", + "sampler": "DPM++ 2M Karras MOD", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "724566c0cc", + "name": "Anime_citrinedreammix_v11BakedVAE", + "type": "model" + } + ], + "Model hash": "724566c0cc", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, badhandv4, (worst quality, low quality:1.4), greyscale, border, artist name, out of frame, zombie", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/27a27729-0af1-4af9-7774-779398515400/width=450/589743.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "UPFYP+~pRjof_3-;kCV@x[%Mt7Rj%MxajZRj", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1324370507, + "Model": "Anime_meinamix_meinaV9", + "steps": 30, + "hashes": { + "model": "eac6c08a19" + }, + "prompt": "(masterpiece, best quality:1.2), , solo, 1girl, blake belladonna, expressionless, closed mouth, looking afar, sitting, black hair bow, sleeveless shirt, detached sleeve, pantyhose, legwear under white shorts", + "sampler": "DPM++ 2M Karras MOD", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "eac6c08a19", + "name": "Anime_meinamix_meinaV9", + "type": "model" + } + ], + "Model hash": "eac6c08a19", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, badhandv4, (worst quality, low quality:1.4), greyscale, border, artist name, out of frame, zombie", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f880320f-b03c-48f5-04eb-514c34d31900/width=450/589742.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UHFrO?4nRiE1~qD%X8IU-;D%%Lae%g%0oJxt", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1324370506, + "Model": "Anime_meinamix_meinaV9", + "steps": 30, + "hashes": { + "model": "eac6c08a19" + }, + "prompt": "(masterpiece, best quality:1.2), , solo, 1girl, blake belladonna, expressionless, closed mouth, looking afar, sitting, black hair bow, sleeveless shirt, detached sleeve, pantyhose, legwear under white shorts", + "sampler": "DPM++ 2M Karras MOD", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "eac6c08a19", + "name": "Anime_meinamix_meinaV9", + "type": "model" + } + ], + "Model hash": "eac6c08a19", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, badhandv4, (worst quality, low quality:1.4), greyscale, border, artist name, out of frame, zombie", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c3acd69a-11c6-45da-2647-b7d3275f7800/width=450/589745.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UAG[f;0000t7?G4T?btR4.4m~q_3%h?a0KI:", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3229872378, + "Model": "Anime_meinamix_meinaV9", + "steps": 30, + "hashes": { + "model": "eac6c08a19" + }, + "prompt": "(masterpiece, best quality:1.2), , solo, 1girl, blake belladonna, expressionless, closed mouth, looking at viewer, sitting, crossed legs, cat ears, formal, white suit, red necktie, white pants, pointy footwear", + "sampler": "DPM++ 2M Karras MOD", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "eac6c08a19", + "name": "Anime_meinamix_meinaV9", + "type": "model" + } + ], + "Model hash": "eac6c08a19", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, badhandv4, (worst quality, low quality:1.4), greyscale, border, artist name, out of frame, sleeveless, shorts, pantyhose, bare shoulders, zombie", + "Denoising strength": "0.5" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/54494" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/rwby_belladonna-10.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/rwby_belladonna-10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..67e825da4f4eefa835144a2d41f992d75e8074f0 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/rwby_belladonna-10.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/rwby_belladonna-10.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/rwby_belladonna-10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..8ab4d913efe17f4e8628298f32aaa64b243ec0a5 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/rwby_belladonna-10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:645ed694a47f8579c9cfafb297e0f7cf5a69e7ce9eaceaa7a192cd17c2ba613e +size 37898751 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/rwby_rose-10.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/rwby_rose-10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..34ccefc3da43f7a76de5d9e13433d39498c0b054 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/rwby_rose-10.civitai.info" @@ -0,0 +1,227 @@ +{ + "id": 53790, + "modelId": 49195, + "name": "v1.0", + "createdAt": "2023-04-24T04:27:15.722Z", + "updatedAt": "2023-04-24T04:28:33.034Z", + "trainedWords": [ + "ruby rose", + "black dress", + "long sleeves", + "red cape", + "pantyhose" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

Initial release.

", + "stats": { + "downloadCount": 1053, + "ratingCount": 4, + "rating": 5 + }, + "model": { + "name": "Ruby Rose (Season 1) | RWBY", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "rwby_rose-10.safetensors", + "id": 39016, + "sizeKB": 37004.626953125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-24T04:31:38.263Z", + "hashes": { + "AutoV1": "6F02C87A", + "AutoV2": "AAB59F4B9E", + "SHA256": "AAB59F4B9EDC9EAB33C1011806B476F374AB25A16FDEF26378BC6ADC5D112651", + "CRC32": "B85ED59C", + "BLAKE3": "9406164138B426150AC32970CAB240058789EFF21119F2C70E0703D7B6110DC7" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/53790" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/20cd7ed0-a399-4187-ba01-944e9cb00900/width=450/582126.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UAEBv*0}~V^Q9$$L0fxZt-w]xHS}0Mt7nRNa", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3227176769, + "Model": "Anime_citrinedreammix_v11BakedVAE", + "steps": 30, + "hashes": { + "model": "724566c0cc" + }, + "prompt": "(masterpiece, best quality:1.2), , cowboy shot, solo, 1girl, ruby rose, grin, looking at viewer, arms behind back, black dress, long sleeves, red cape, pantyhose, night, cityscape, street", + "sampler": "DPM++ 2M Karras MOD", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "724566c0cc", + "name": "Anime_citrinedreammix_v11BakedVAE", + "type": "model" + } + ], + "Model hash": "724566c0cc", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, badhandv4, (worst quality, low quality:1.4), greyscale, border, artist name, out of frame, holding, zombie", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a54a50a5-bd44-48ed-f55e-82ad7faf8100/width=450/582125.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UPHnsk%M_3%2?bD%Nbso~qxut7x]NGV@xZNG", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2429528931, + "Model": "Anime_citrinedreammix_v11BakedVAE", + "steps": 30, + "hashes": { + "model": "724566c0cc" + }, + "prompt": "(masterpiece, best quality:1.2), , cowboy shot, solo, 1girl, ruby rose, expressionless, looking at viewer, holding phone, headphones, hood up, black dress, long sleeves, red cape, pantyhose, indoors, grocery store", + "sampler": "DPM++ 2M Karras MOD", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "724566c0cc", + "name": "Anime_citrinedreammix_v11BakedVAE", + "type": "model" + } + ], + "Model hash": "724566c0cc", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, badhandv4, (worst quality, low quality:1.4), greyscale, border, artist name, out of frame, holding, zombie", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3178421c-58a5-407f-c305-b0c9858ba500/width=450/582127.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UVHeX$Ip?v%M%%X8XTkW?wS5t7WCENM{i_WB", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 142123079, + "Model": "Anime_citrinedreammix_v11BakedVAE", + "steps": 30, + "hashes": { + "model": "724566c0cc" + }, + "prompt": "(masterpiece, best quality:1.2), , cowboy shot, solo, 1girl, ruby rose, smile, looking at viewer, peace sign, black dress, long sleeves, red cape, pantyhose, outdoors", + "sampler": "DPM++ 2M Karras MOD", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "724566c0cc", + "name": "Anime_citrinedreammix_v11BakedVAE", + "type": "model" + } + ], + "Model hash": "724566c0cc", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, badhandv4, (worst quality, low quality:1.4), greyscale, border, artist name, out of frame, holding, zombie", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ea50637c-d0b5-49e8-4cb2-e8fd4a111e00/width=450/582124.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "USH_Y|JB%fxu~pV?E1%L%#D%Myxu-;bcaKWC", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3608135812, + "Model": "Anime_brainime_v10", + "steps": 30, + "hashes": { + "model": "5d95dbb8eb" + }, + "prompt": "(masterpiece, best quality:1.2), , solo, 1girl, ruby rose, smile, looking at viewer, sitting, pajamas, red t-shirt, unbuttoned, pants, bedroom", + "sampler": "DPM++ 2M Karras MOD", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "5d95dbb8eb", + "name": "Anime_brainime_v10", + "type": "model" + } + ], + "Model hash": "5d95dbb8eb", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, badhandv4, (worst quality, low quality:1.4), greyscale, border, artist name, out of frame, holding, zombie", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d3157c5e-7716-4bfe-7c1a-c57c43c84a00/width=450/582128.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UcH2QKWVOEsl*0oftRe.pKxt%2M{OGs:R*R*", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1628351463, + "Model": "Anime_ambientmixAnAnime_v10", + "steps": 30, + "hashes": { + "model": "fdffd3c312" + }, + "prompt": "(masterpiece, best quality:1.2), , cowboy shot, solo, 1girl, ruby rose, smile, looking at viewer, headphones, tank top, black track pants, cityscape scenery", + "sampler": "DPM++ 2M Karras MOD", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "fdffd3c312", + "name": "Anime_ambientmixAnAnime_v10", + "type": "model" + } + ], + "Model hash": "fdffd3c312", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, badhandv4, (worst quality, low quality:1.4), greyscale, border, artist name, out of frame, holding, zombie", + "Denoising strength": "0.5" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/53790" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/rwby_rose-10.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/rwby_rose-10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..d3b8148090d2e0741c4eb724732ee6f52898b970 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/rwby_rose-10.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/rwby_rose-10.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/rwby_rose-10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..2d6138b40c4f131e54ad3ae2f8601fb6c97eb581 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/rwby_rose-10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:aab59f4b9edc9eab33c1011806b476f374ab25a16fdef26378bc6adc5d112651 +size 37892738 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/rwby_weissschnee-12.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/rwby_weissschnee-12.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..596e7f112848250a1b8bc93c3a58e3c026f349fc --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/rwby_weissschnee-12.civitai.info" @@ -0,0 +1,255 @@ +{ + "id": 107543, + "modelId": 50934, + "name": "v2.0", + "createdAt": "2023-06-30T20:48:19.360Z", + "updatedAt": "2023-06-30T23:46:05.515Z", + "trainedWords": [ + "weissvale, ponytail, white dress, jewelry, necklace, earrings", + "weissmistral, side ponytail, blue dress, long sleeves, jewelry, earrings", + "weissneg, peaked cap, military uniform, white coat, belt, pantyhose" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

The Vale and Mistral outfits have been separated. I have also added an additional outfit from RWBY: Ice Queendom. Thanks to the requester for providing some training images for that outfit.

", + "stats": { + "downloadCount": 208, + "ratingCount": 3, + "rating": 5 + }, + "model": { + "name": "Weiss Schnee | RWBY", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "rwby_weissschnee-12.safetensors", + "id": 75776, + "sizeKB": 36990.361328125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-30T23:45:48.453Z", + "hashes": { + "AutoV1": "C324682C", + "AutoV2": "703F243167", + "SHA256": "703F2431673CF54DD3C0AB57C71B878AC1FE8BEB046D1A5B80CDFA8B832E8406", + "CRC32": "419B4437", + "BLAKE3": "64CF92FC57541EB41A0A3FE063055F483661575DC9E6471300966D7676C3DD16" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/107543" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1326da9d-9b7d-4689-a99a-97878461326a/width=450/1351042.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UBGlVI0000~C_L8{NHfB--ozIT%MO?ozDhWY", + "meta": { + "VAE": "vae-ft-mse-840000-ema-pruned", + "Size": "512x768", + "seed": 2799130118, + "Model": "Anime-NoVAE_wrenchmix_v10", + "steps": 20, + "Parser": "Full parser", + "hashes": { + "vae": "c6a580b13a", + "model": "21444571eb", + "embed:fcNeg-neg": "f257fca133" + }, + "prompt": "(masterpiece, best quality:1.2), , cowboy shot, solo, 1girl, weissvale, expressionless, closed mouth, looking at viewer, crossed arms, ponytail, scar on eye, white dress, jewelry, necklace, earrings", + "Version": "4867daf", + "sampler": "DPM++ 2M Karras MOD", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "21444571eb", + "name": "Anime-NoVAE_wrenchmix_v10", + "type": "model" + } + ], + "Model hash": "21444571eb", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "fcNeg-neg, (worst quality, low quality:1.4), out of frame", + "Denoising strength": "0.3", + "Token merging ratio": "0.5", + "Token merging ratio hr": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/389a6953-ce2c-4df0-b9e1-5d6f7d5f3d54/width=450/1351043.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "UAHnv#0700~WD44-t79Z0M~VIv%L02?Gn+kV", + "meta": { + "VAE": "vae-ft-mse-840000-ema-pruned", + "Size": "512x768", + "seed": 1489334978, + "Model": "Anime-NoVAE_citrinedreammix_v2NoVAE", + "steps": 20, + "Parser": "Full parser", + "hashes": { + "vae": "c6a580b13a", + "model": "493776f555", + "embed:fcNeg-neg": "f257fca133" + }, + "prompt": "(masterpiece, best quality:1.2), , cowboy shot, solo, 1girl, weissvale, expressionless, closed mouth, looking at viewer, crossed arms, ponytail, white dress, jewelry, necklace, earrings", + "Version": "4867daf", + "sampler": "DPM++ 2M Karras MOD", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "493776f555", + "name": "Anime-NoVAE_citrinedreammix_v2NoVAE", + "type": "model" + } + ], + "Model hash": "493776f555", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "fcNeg-neg, (worst quality, low quality:1.4), out of frame", + "Denoising strength": "0.3", + "Token merging ratio": "0.5", + "Token merging ratio hr": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/60614bb5-f7bb-4c8f-b8c2-eb1f6f541e4b/width=450/1351692.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "U9F$O.XD00R5~04n9cRP~q4:00xu9wWGnOxu", + "meta": { + "VAE": "vae-ft-mse-840000-ema-pruned", + "Size": "512x768", + "seed": 107300823, + "Model": "Anime-NoVAE_citrinedreammix_v2NoVAE", + "steps": 20, + "Parser": "Full parser", + "hashes": { + "vae": "c6a580b13a", + "model": "493776f555", + "embed:fcNeg-neg": "f257fca133" + }, + "prompt": "(masterpiece, best quality:1.2), , cowboy shot, solo, 1girl, weissmistral, expressionless, closed mouth, looking at viewer, side ponytail, blue dress, long sleeves, jewelry, earrings", + "Version": "4867daf", + "sampler": "DPM++ 2M Karras MOD", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "493776f555", + "name": "Anime-NoVAE_citrinedreammix_v2NoVAE", + "type": "model" + } + ], + "Model hash": "493776f555", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "fcNeg-neg, (worst quality, low quality:1.4), out of frame", + "Denoising strength": "0.3", + "Token merging ratio": "0.5", + "Token merging ratio hr": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/737e907f-6a4a-46e8-a1e2-897365ff23ed/width=450/1351699.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "U7F=]$_400o$00M{00IT00RPtSD%_4t8^,of", + "meta": { + "VAE": "vae-ft-mse-840000-ema-pruned", + "Size": "512x768", + "seed": 2910142961, + "Model": "Anime-NoVAE_citrinedreammix_v2NoVAE", + "steps": 20, + "Parser": "Full parser", + "hashes": { + "vae": "c6a580b13a", + "model": "493776f555", + "embed:fcNeg-neg": "f257fca133" + }, + "prompt": "(masterpiece, best quality:1.2), , cowboy shot, solo, 1girl, weissneg, expressionless, closed mouth, looking at viewer, hand on hip, long hair, peaked cap, military uniform, white coat, belt, pantyhose", + "Version": "4867daf", + "sampler": "DPM++ 2M Karras MOD", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "493776f555", + "name": "Anime-NoVAE_citrinedreammix_v2NoVAE", + "type": "model" + } + ], + "Model hash": "493776f555", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "fcNeg-neg, (worst quality, low quality:1.4), out of frame", + "Denoising strength": "0.3", + "Token merging ratio": "0.5", + "Token merging ratio hr": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0b210ce1-48a5-473c-a9a7-a9ed4d2f1f6c/width=450/1351700.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UNFr*L~q4.NHD%R*RiM_9FM{t7ofbHWAs:ay", + "meta": { + "VAE": "vae-ft-mse-840000-ema-pruned", + "Size": "512x768", + "seed": 1911968491, + "Model": "Anime-NoVAE_wrenchmix_v10", + "steps": 20, + "Parser": "Full parser", + "hashes": { + "vae": "c6a580b13a", + "model": "21444571eb", + "embed:fcNeg-neg": "f257fca133" + }, + "prompt": "(masterpiece, best quality:1.2), , cowboy shot, solo, 1girl, weissneg, expressionless, closed mouth, peaked cap, sunglasses, military uniform, white coat, belt, pantyhose", + "Version": "4867daf", + "sampler": "DPM++ 2M Karras MOD", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "21444571eb", + "name": "Anime-NoVAE_wrenchmix_v10", + "type": "model" + } + ], + "Model hash": "21444571eb", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "fcNeg-neg, (worst quality, low quality:1.4), out of frame", + "Denoising strength": "0.3", + "Token merging ratio": "0.5", + "Token merging ratio hr": "0.5" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/107543" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/rwby_weissschnee-12.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/rwby_weissschnee-12.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..aa90488c2dc8ae3f4a611b1d5ef5a05d65023019 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/rwby_weissschnee-12.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/rwby_weissschnee-12.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/rwby_weissschnee-12.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..e85c3106a3febe2e04c034e0b758f510b1ca5668 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/rwby_weissschnee-12.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:703f2431673cf54dd3c0ab57c71b878ac1fe8beb046d1a5b80cdfa8b832e8406 +size 37878130 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/rwby_xiaolong-10.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/rwby_xiaolong-10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..c2f1c0f88f37ad3de88a9e40be9d2244881e644c --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/rwby_xiaolong-10.civitai.info" @@ -0,0 +1,259 @@ +{ + "id": 55460, + "modelId": 50938, + "name": "v1.0", + "createdAt": "2023-04-25T23:43:29.147Z", + "updatedAt": "2023-04-25T23:45:54.974Z", + "trainedWords": [ + "yang xiao long", + "ahoge", + "purple eyes" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

Initial release.

", + "stats": { + "downloadCount": 678, + "ratingCount": 2, + "rating": 5 + }, + "model": { + "name": "Yang Xiao Long (Season 1) | RWBY", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "rwby_xiaolong-10.safetensors", + "id": 39884, + "sizeKB": 37028.2255859375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-25T23:46:38.267Z", + "hashes": { + "AutoV1": "3801AD76", + "AutoV2": "203BB13EF8", + "SHA256": "203BB13EF837AAE11688DA466850089B113BD9DE89404EFFE149201E8ECC77EF", + "CRC32": "FDF5AE86", + "BLAKE3": "F7AC8123268890FC0D7223D86FBBFB66A5028037FD9F472E35F2C3A489CB47A7" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/55460" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b58fd1d5-ebda-4f04-0031-3d38aab1e600/width=450/600753.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "U3H^;P}s00?H4Tt500.87LEN0M004-M{^6?F", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2828685438, + "Model": "Anime_citrinedreammix_v11BakedVAE", + "steps": 30, + "hashes": { + "model": "724566c0cc" + }, + "prompt": "(masterpiece, best quality:1.2), , cowboy shot, solo, 1girl, yang xiao long, grin, hand on hip, ahoge, purple eyes, brown jacket, yellow tube top, black shorts, black fingerless gloves, orange scarf, waist cape, midriff, cleavage, large breasts", + "sampler": "DPM++ 2M Karras MOD", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "724566c0cc", + "name": "Anime_citrinedreammix_v11BakedVAE", + "type": "model" + } + ], + "Model hash": "724566c0cc", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, badhandv4, (worst quality, low quality:1.4), greyscale, border, artist name, out of frame, zombie", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/69353389-60d7-4873-cabb-b85c1dfd3700/width=450/600751.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "UWIg=b9GI=WB~VNGS4j[-;e-Rjj[tQoKxaR*", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2828685437, + "Model": "Anime_citrinedreammix_v11BakedVAE", + "steps": 30, + "hashes": { + "model": "724566c0cc" + }, + "prompt": "(masterpiece, best quality:1.2), , cowboy shot, solo, 1girl, yang xiao long, grin, hand on hip, ahoge, purple eyes, brown jacket, yellow tube top, black shorts, black fingerless gloves, orange scarf, waist cape, midriff, cleavage, large breasts", + "sampler": "DPM++ 2M Karras MOD", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "724566c0cc", + "name": "Anime_citrinedreammix_v11BakedVAE", + "type": "model" + } + ], + "Model hash": "724566c0cc", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, badhandv4, (worst quality, low quality:1.4), greyscale, border, artist name, out of frame, zombie", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/74fcb675-d854-4e2c-61b5-24de98fea800/width=450/600750.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "UNI}6K^*?vxD~VxuNIRi~Wx]S5jY?b-;%MkC", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2828685439, + "Model": "Anime_citrinedreammix_v11BakedVAE", + "steps": 30, + "hashes": { + "model": "724566c0cc" + }, + "prompt": "(masterpiece, best quality:1.2), , cowboy shot, solo, 1girl, yang xiao long, grin, hand on hip, ahoge, purple eyes, brown jacket, yellow tube top, black shorts, black fingerless gloves, orange scarf, waist cape, midriff, cleavage, large breasts", + "sampler": "DPM++ 2M Karras MOD", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "724566c0cc", + "name": "Anime_citrinedreammix_v11BakedVAE", + "type": "model" + } + ], + "Model hash": "724566c0cc", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, badhandv4, (worst quality, low quality:1.4), greyscale, border, artist name, out of frame, zombie", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4586937f-8228-4d63-667d-e909b0b47100/width=450/600790.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "UMG*vb~VOZMxD%M{4.j[%MbcNeRkIoRQadae", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2828685436, + "Model": "Anime_citrinedreammix_v11BakedVAE", + "steps": 30, + "hashes": { + "model": "724566c0cc" + }, + "prompt": "(masterpiece, best quality:1.2), , cowboy shot, solo, 1girl, yang xiao long, grin, hand on hip, ahoge, purple eyes, brown jacket, yellow tube top, black shorts, black fingerless gloves, orange scarf, waist cape, midriff, cleavage, large breasts", + "sampler": "DPM++ 2M Karras MOD", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "724566c0cc", + "name": "Anime_citrinedreammix_v11BakedVAE", + "type": "model" + } + ], + "Model hash": "724566c0cc", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, badhandv4, (worst quality, low quality:1.4), greyscale, border, artist name, out of frame, zombie", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/89e82a6c-69e1-4368-8876-0decd89d9100/width=450/600752.jpeg", + "nsfw": "Soft", + "width": 1536, + "height": 1024, + "hash": "UNHd~i_NIq$%%L%Mt7xD4T9ENF%LD%IAV@bH", + "meta": { + "ENSD": "31337", + "Size": "768x512", + "seed": 3476965561, + "Model": "Anime_citrinedreammix_v11BakedVAE", + "steps": 30, + "hashes": { + "model": "724566c0cc" + }, + "prompt": "(masterpiece, best quality:1.2), , solo, 1girl, yang xiao long, smile, looking at viewer, ahoge, purple eyes, brown jacket, yellow tube top, black shorts, orange scarf, waist cape, midriff, large breasts, ground vehicle, motorcycle", + "sampler": "DPM++ 2M Karras MOD", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "724566c0cc", + "name": "Anime_citrinedreammix_v11BakedVAE", + "type": "model" + } + ], + "Model hash": "724566c0cc", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, badhandv4, (worst quality, low quality:1.4), greyscale, border, artist name, out of frame, zombie", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/07f101fa-7541-42a7-474c-34cfc95d1a00/width=450/600754.jpeg", + "nsfw": "Soft", + "width": 1536, + "height": 1024, + "hash": "UFIzba~AIp01R$?GRkIrjDozIUIW0gM{s.aL", + "meta": { + "ENSD": "31337", + "Size": "768x512", + "seed": 3521608607, + "Model": "Anime_citrinedreammix_v11BakedVAE", + "steps": 30, + "hashes": { + "model": "724566c0cc" + }, + "prompt": "(masterpiece, best quality:1.2), , upper body, solo, 1girl, yang xiao long, smile, looking at viewer, lying, on stomach, ahoge, purple eyes, orange t-shirt, cleavage, large breasts, indoors", + "sampler": "DPM++ 2M Karras MOD", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "724566c0cc", + "name": "Anime_citrinedreammix_v11BakedVAE", + "type": "model" + } + ], + "Model hash": "724566c0cc", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, badhandv4, (worst quality, low quality:1.4), greyscale, border, artist name, out of frame, zombie", + "Denoising strength": "0.5" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/55460" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/rwby_xiaolong-10.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/rwby_xiaolong-10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..ffddef43535da10cc40df258be97a247f3d2d590 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/rwby_xiaolong-10.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/rwby_xiaolong-10.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/rwby_xiaolong-10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..f403bc582b1ab0798e5cc3ccbb0354bab08a6002 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/rwby_xiaolong-10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:203bb13ef837aae11688da466850089b113bd9de89404effe149201e8ecc77ef +size 37916903 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/weissSchneeRWBY_weissSchneeV10.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/weissSchneeRWBY_weissSchneeV10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..a4574ab1511f18c25462d3dc683d9b65725d64de --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/weissSchneeRWBY_weissSchneeV10.civitai.info" @@ -0,0 +1,225 @@ +{ + "id": 22617, + "modelId": 19060, + "name": "weiss schnee_v1.0", + "createdAt": "2023-03-13T14:44:16.236Z", + "updatedAt": "2023-03-14T08:36:49.137Z", + "trainedWords": [ + "weiss schnee", + "ponytail", + "red stand collar" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "model": { + "name": "weiss schnee[RWBY]", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "weissSchneeRWBY_weissSchneeV10.safetensors", + "id": 18811, + "sizeKB": 75681.12890625, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-03-13T14:56:49.730Z", + "hashes": { + "AutoV1": "1C8B5AFE", + "AutoV2": "953A29B64F", + "SHA256": "953A29B64FFD3EEB7D5A6F53139310DE32DDB47191F699591F07D412C23AA1B7", + "CRC32": "52CCFAA3", + "BLAKE3": "3AA5AABBB70BF3EDC550F401E721B60AA363FA568D1690761869C43C58680FDE" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/22617" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7083de4f-0538-4e37-3f06-0d4a5d53e700/width=450/243562.jpeg", + "nsfw": false, + "width": 1024, + "height": 1280, + "hash": "UEQ0BmEQcE#l?^n$oMyDt,oLVsSh?HbvIps9", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 22896607, + "steps": 20, + "prompt": "<(masterpiece), (extremely intricate:1.2)>, weiss schnee, 1girl,solo, portrait of a girl, wavy hair, dynamic, flutter, wind, snowflake,ponytail", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8.5, + "Clip skip": "2", + "resources": [ + { + "hash": "a9d93fd12a6d", + "name": "schnee", + "type": "lora", + "weight": null + } + ], + "Model hash": "30953ab0de", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "weiss schnee(a9d93fd12a6d)", + "Hires upscaler": "Latent", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.5", + "AddNet Weight B 1": "0.5", + "Denoising strength": "0.6" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0d4bcb7b-a255-45aa-09a0-4b23fa0e5400/width=450/243561.jpeg", + "nsfw": true, + "width": 1280, + "height": 1408, + "hash": "ULP~{7~qpxjIY6jbw]X7o~RQi_n$rroyo}n*", + "meta": { + "ENSD": "31337", + "Size": "640x704", + "seed": 4057847821, + "steps": 20, + "prompt": "<(masterpiece), (extremely intricate:1.2)>, weiss_schnee, 1girl,solo, upper body, wavy hair, dynamic, flutter, wind, snowflake, looking at viewer, ponytail, portrait of a girl,red stand-up collar, from front", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8.5, + "Clip skip": "2", + "resources": [ + { + "hash": "a9d93fd12a6d", + "name": "schnee", + "type": "lora", + "weight": null + } + ], + "Model hash": "30953ab0de", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "weiss schnee(a9d93fd12a6d)", + "Hires upscaler": "Latent", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative,3hands,extra fingernails, 2hands,3arms,extra arms", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.5", + "AddNet Weight B 1": "0.5", + "Denoising strength": "0.6" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1d6dd87a-3ccb-4498-a020-f7ac72a97900/width=450/243530.jpeg", + "nsfw": false, + "width": 1280, + "height": 1408, + "hash": "U8MtH%Iq0K~V00%N9Zxv00xZwu.800xuxut7", + "meta": { + "ENSD": "31337", + "Size": "640x704", + "seed": 4057847821, + "steps": 20, + "prompt": "<(masterpiece), (extremely intricate:1.2)>, weiss schnee, 1girl,solo, upper body, wavy hair, dynamic, flutter, wind, snowflake,(Wedding dress:1.3),(bridal veil:1.3)", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8.5, + "Clip skip": "2", + "resources": [ + { + "hash": "a9d93fd12a6d", + "name": "schnee", + "type": "lora", + "weight": null + } + ], + "Model hash": "30953ab0de", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "weiss schnee(a9d93fd12a6d)", + "Hires upscaler": "Latent", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.5", + "AddNet Weight B 1": "0.5", + "Denoising strength": "0.6" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ada74c04-e802-4e02-4bad-f7cacedf0b00/width=450/243560.jpeg", + "nsfw": true, + "width": 1280, + "height": 1408, + "hash": "U1OWjL0000cutI~X000000~n00x]0000UuI8", + "meta": { + "ENSD": "31337", + "Size": "640x704", + "seed": 4057847818, + "steps": 20, + "prompt": "<(masterpiece), (extremely intricate:1.2)>, weiss schnee, 1girl,solo, upper body, wavy hair, dynamic, flutter, wind, snowflake,(Wedding dress:1.3),(bridal veil:1.3)", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8.5, + "Clip skip": "2", + "resources": [ + { + "hash": "a9d93fd12a6d", + "name": "schnee", + "type": "lora", + "weight": null + } + ], + "Model hash": "30953ab0de", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "weiss schnee(a9d93fd12a6d)", + "Hires upscaler": "Latent", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative,3hands,extra fingernails, 2hands", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.5", + "AddNet Weight B 1": "0.5", + "Denoising strength": "0.55" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/81710ec2-04f2-4e6b-c3e5-0c168aca9400/width=450/243559.jpeg", + "nsfw": false, + "width": 1280, + "height": 1408, + "hash": "UEN^6-9Z0eMx.m00?HNF0}IUDhoyR5RjNxMx", + "meta": { + "ENSD": "31337", + "Size": "640x704", + "seed": 4057847819, + "steps": 20, + "prompt": "<(masterpiece), (extremely intricate:1.2)>, weiss_schnee, 1girl,solo, upper body, wavy hair, dynamic, flutter, wind, snowflake, looking at viewer, ponytail, portrait of a girl,red stand-up collar", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8.5, + "Clip skip": "2", + "resources": [ + { + "hash": "a9d93fd12a6d", + "name": "schnee", + "type": "lora", + "weight": null + } + ], + "Model hash": "30953ab0de", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "weiss schnee(a9d93fd12a6d)", + "Hires upscaler": "Latent", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative,3hands,extra fingernails, 2hands,3arms,extra arms", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.5", + "AddNet Weight B 1": "0.5", + "Denoising strength": "0.6" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/22617" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/weissSchneeRWBY_weissSchneeV10.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/weissSchneeRWBY_weissSchneeV10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..13ac20e525def21fdb781c463c58e228541fee00 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/weissSchneeRWBY_weissSchneeV10.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:b12e3354fcc3f6a4d00d8084ecfd5180b811ccaaec3f18c85def17bd8cb88705 +size 1413179 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/weissSchneeRWBY_weissSchneeV10.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/weissSchneeRWBY_weissSchneeV10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..a9450cc46a3a2c2c43dae780595dd58aea8c5ab8 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/RWBY/weissSchneeRWBY_weissSchneeV10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:953a29b64ffd3eeb7d5a6f53139310de32ddb47191f699591f07d412c23aa1b7 +size 77497476 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232Creators/HoshikawaHikayu.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232Creators/HoshikawaHikayu.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..e5026ac54d7dff955e7b74e2a89b869b105e3788 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232Creators/HoshikawaHikayu.civitai.info" @@ -0,0 +1,109 @@ +{ + "id": 90063, + "modelId": 84719, + "name": "v1.0", + "createdAt": "2023-06-06T00:30:24.049Z", + "updatedAt": "2023-06-06T00:33:34.333Z", + "trainedWords": [ + "hoshikawahikayu" + ], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 13, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Hoshikawa Hikayu (from Re:CREATORS)", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "HoshikawaHikayu.safetensors", + "id": 61925, + "sizeKB": 18549.7744140625, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-06T00:36:21.994Z", + "hashes": { + "AutoV1": "DE2F2560", + "AutoV2": "E07FFDD153", + "SHA256": "E07FFDD153CDFCFA65CFB43D2AA1C90EF15FE0A1077ABAA228841F4348B82477", + "CRC32": "A30072AE", + "BLAKE3": "CBACB328AD60D120A90B37F70F487437C44907B99AB4E799D51C9FA4174057DF" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/90063" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7688283e-fddd-412d-96b0-16d65a7b5b83/width=450/1044187.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "UOJQcr~V?b-:-D$koz9Z:+r=5QRi9Y-:rrni", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d8d67e43-2ab0-4d68-92ea-5d2ff669d5d7/width=450/1044188.jpeg", + "nsfw": "Soft", + "width": 512, + "height": 768, + "hash": "UJJZGJsE0yWY?H~Ca00LkrI:MxR6$joJtRg2", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b7647dc4-fd8f-4419-acf7-7cf54fe3fee3/width=450/1044192.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "UCKToUJD00JB~Wx]PUxuHX^+O?%M9a%MMx%2", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5b1c4eab-dc68-40f1-b6f8-ab20140ea00f/width=450/1044190.jpeg", + "nsfw": "Mature", + "width": 512, + "height": 768, + "hash": "UHK-hCZj1S?v4V1OyD}qDOIVVXrWrYNFtRMz", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/cc7542c0-67a6-405f-900e-77858b0c3960/width=450/1044189.jpeg", + "nsfw": "Soft", + "width": 512, + "height": 768, + "hash": "USM$iA^*B.IU~qx]x]t7x]x]ozazR6x[ozjF", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5687648d-9501-4cce-9734-c67262cd79a5/width=450/1044191.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "UDL3ZB^k00~p}@4oJ,4o~o01a1xt8|Rj?[oy", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9316b14f-ccb0-4640-bf57-dca5eaa12298/width=450/1044193.jpeg", + "nsfw": "Soft", + "width": 512, + "height": 768, + "hash": "UOJaD?00.TMdry9|EM?GM_?HxYIB0LIo%2V@", + "meta": null + } + ], + "downloadUrl": "https://civitai.com/api/download/models/90063" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232Creators/HoshikawaHikayu.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232Creators/HoshikawaHikayu.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..4bb2f8ee94334ac04d927b3e06ef0fef7f1f691b Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232Creators/HoshikawaHikayu.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232Creators/HoshikawaHikayu.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232Creators/HoshikawaHikayu.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..2622d578d1c8cb61d467d6af25fe8f2b40ddbbf8 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232Creators/HoshikawaHikayu.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:e07ffdd153cdfcfa65cfb43d2aa1c90ef15fe0a1077abaa228841f4348b82477 +size 18994969 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232Creators/Marine-10.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232Creators/Marine-10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..213bf9cdc562cbe19e11f08a11b10631cc5a372e --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232Creators/Marine-10.civitai.info" @@ -0,0 +1,174 @@ +{ + "id": 105481, + "modelId": 98616, + "name": "v1.0", + "createdAt": "2023-06-27T21:40:40.492Z", + "updatedAt": "2023-06-28T02:34:21.771Z", + "trainedWords": [ + "marine", + "glasses" + ], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 38, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Ayano Koura | Marine (from Re:CREATORS)", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "Marine-10.safetensors", + "id": 74140, + "sizeKB": 18548.0673828125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-27T21:45:52.864Z", + "hashes": { + "AutoV1": "DE2F2560", + "AutoV2": "4EE492F168", + "SHA256": "4EE492F1684D6C915637C30AD28F7B3CFBC24896C81156E53556AFD34F58149E", + "CRC32": "9E22D557", + "BLAKE3": "6AC868885E2D950BAEE11BB74B1D28427F58C7EDC02718D8815D43B27D10DDED" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/105481" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1b7bb170-234e-4b2c-9c23-afe6d95f5b63/width=450/1315627.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "UTL4EBo{S^~W-:t7%MRj00oM-;RP-pD*tQs;", + "meta": { + "seed": 3700204170, + "steps": 23, + "prompt": "marine, glasses, 1girl, solo", + "sampler": "Euler a", + "cfgScale": 5, + "negativePrompt": "(worst quality, low quality, large head, extra digits:1.4), easynegative," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/62cc81f1-479e-4d00-8f3e-c938d321fe4d/width=450/1315628.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "UIJRN,00K4oe?wMwxbxu.8%M4.S4IoIVWnWB", + "meta": { + "seed": 1609299079, + "steps": 23, + "prompt": "marine, glasses, 1girl, solo, school uniform", + "sampler": "Euler a", + "cfgScale": 5, + "negativePrompt": "(worst quality, low quality, large head, extra digits:1.4), easynegative," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/dbaac062-05dd-4d36-a985-3268407d17cb/width=450/1315625.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "UNIN{wI-0e~C9s~p?IIU-qt7ayM|%gIUxaxu", + "meta": { + "seed": 1093092517, + "steps": 23, + "prompt": "marine, glasses, 1girl, solo, serafuku", + "sampler": "Euler a", + "cfgScale": 5, + "negativePrompt": "(worst quality, low quality, large head, extra digits:1.4), easynegative," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7e061365-f445-47de-b261-6365497ac045/width=450/1315621.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "UPHUOj~C?aO=Q7x]ELXS.StSnhoK%htl%0%1", + "meta": { + "seed": 1689142830, + "steps": 23, + "prompt": "marine, glasses, 1girl, solo, track suit, trackjacket", + "sampler": "Euler a", + "cfgScale": 5, + "negativePrompt": "(worst quality, low quality, large head, extra digits:1.4), easynegative," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9107df23-dd2a-4d9e-b581-e448561e6a3b/width=450/1315624.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "UYI}R]_MI.-pI;g3xujFkV?a%MIU_4%Noft7", + "meta": { + "seed": 3693296128, + "steps": 23, + "prompt": "marine, glasses, 1girl, solo, drawing", + "sampler": "Euler a", + "cfgScale": 5, + "negativePrompt": "(worst quality, low quality, large head, extra digits:1.4), easynegative," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7c6f84e7-895d-4102-b9be-1c5495b3c11a/width=450/1315622.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "UZLNA6IUInbuM_n%E2t70LD%%2oL~WM|tQxt", + "meta": { + "seed": 2071357199, + "steps": 23, + "prompt": "marine, glasses, 1girl, solo, casual, sitting, living room", + "sampler": "Euler a", + "cfgScale": 5, + "negativePrompt": "(worst quality, low quality, large head, extra digits:1.4), easynegative," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3644cc84-7b46-4573-a49f-0e5708e39a65/width=450/1315626.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "ULLM^pVs5jE2^+0LtlNH00oI~pxu~CRQX5of", + "meta": { + "seed": 3774914534, + "steps": 23, + "prompt": "marine, glasses, 1girl, solo, pov, blush, :3, cat smile", + "sampler": "Euler a", + "cfgScale": 5, + "negativePrompt": "(worst quality, low quality, large head, extra digits:1.4), easynegative," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/26ca33b0-c2f7-4bad-ac36-a0aa03dbb6ad/width=450/1315623.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "UGI}06-;?ZM{vzD%tR%M^%~W0LM{0101R*M{", + "meta": { + "seed": 2352506913, + "steps": 23, + "prompt": "marine, 1girl, solo, sleeping, lying, on back", + "sampler": "Euler a", + "cfgScale": 5, + "negativePrompt": "(worst quality, low quality, large head, extra digits:1.4), easynegative," + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/105481" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232Creators/Marine-10.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232Creators/Marine-10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..d20a64a719992d154dcfb5f0323c7e7af25e45d4 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232Creators/Marine-10.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232Creators/Marine-10.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232Creators/Marine-10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..ac579e5c06f1be21acad2038dcda365c34ea8a6f --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232Creators/Marine-10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:4ee492f1684d6c915637c30ad28f7b3cfbc24896c81156e53556afd34f58149e +size 18993221 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232Creators/ShimazakiSetsunaV2.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232Creators/ShimazakiSetsunaV2.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..e290e186c5991135a3b2ae01960ddcade9094b44 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232Creators/ShimazakiSetsunaV2.civitai.info" @@ -0,0 +1,176 @@ +{ + "id": 102486, + "modelId": 85277, + "name": "v2.0", + "createdAt": "2023-06-23T21:07:58.919Z", + "updatedAt": "2023-06-23T22:54:52.152Z", + "trainedWords": [ + "shimazakisetsuna", + "glasses", + "blunt bangs", + "twin braids" + ], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": "

Added tons more images

", + "stats": { + "downloadCount": 55, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Shimazaki Setsuna (from Re:Creators)", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "ShimazakiSetsunaV2.safetensors", + "id": 71840, + "sizeKB": 18548.03515625, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-23T21:10:44.816Z", + "hashes": { + "AutoV1": "DE2F2560", + "AutoV2": "62CA5964D5", + "SHA256": "62CA5964D542767559D1054E5CA124281121FCDB1A1EEED96C9C549506288EEB", + "CRC32": "19E7FCE0", + "BLAKE3": "527B0EA8E08767BAB8A779D809145BDB6EDB4D86ABD02F55F8DA984569CC29CD" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/102486" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/73c23dbc-1a17-408b-9b70-eccb116744dc/width=450/1262146.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "URHL3j~pRjt7tS%2R*M{IUxt-:xZs.t7%Mxt", + "meta": { + "seed": 3808141254, + "steps": 23, + "prompt": "shimazakisetsuna, glasses, blunt bangs, 1girl, solo", + "sampler": "Euler a", + "cfgScale": 5, + "negativePrompt": "(worst quality, low quality, large head, extra digits:1.4), easynegative," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7fd4fb10-0f60-4fba-aff9-e407f0139f6d/width=450/1262155.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "UPI}V9~q9YxZxt%M?HtQ00n$-:RjRjIUITRj", + "meta": { + "seed": 2209223606, + "steps": 23, + "prompt": "shimazakisetsuna, glasses, blunt bangs, twin braids, 1girl, solo, gym uniform, buruma", + "sampler": "Euler a", + "cfgScale": 5, + "negativePrompt": "(worst quality, low quality, large head, extra digits:1.4), easynegative," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d3720e8a-9cc2-48f8-b2ed-66e270ddb621/width=450/1262145.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "UbK1OC~q?a%M-ojtNGNGIUIAs:jFf,ayV@WB", + "meta": { + "seed": 2399842033, + "steps": 23, + "prompt": "shimazakisetsuna, blunt bangs, glasses, twin braids, 1girl, solo, tracksuit, jacket,", + "sampler": "Euler a", + "cfgScale": 5, + "negativePrompt": "(worst quality, low quality, large head, extra digits:1.4), easynegative," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a9c57ea6-cd54-4eb3-b9e1-3cad6433dd9f/width=450/1262149.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "UPJ[9l-3yrI]wF5??Fib.T%2x^IoOaxs-p9G", + "meta": { + "seed": 347961172, + "steps": 23, + "prompt": "shimazakisetsuna, glasses, blunt bangs, twin braids, 1girl, solo, school swimsuit, pool", + "sampler": "Euler a", + "cfgScale": 5, + "negativePrompt": "(worst quality, low quality, large head, extra digits:1.4), easynegative," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/01df2c45-52b8-47e6-8ad9-393858e58b0c/width=450/1262148.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "UKJQ{1ng0e9F15-5xuWU?^a0?aW=9csSNet7", + "meta": { + "seed": 560649281, + "steps": 23, + "prompt": "shimazakisetsuna, glasses, blunt bangs, twin braids, 1girl, solo, bikini", + "sampler": "Euler a", + "cfgScale": 5, + "negativePrompt": "(worst quality, low quality, large head, extra digits:1.4), easynegative," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/14dd8e66-2ea8-4c34-9139-59a3ba0e33b8/width=450/1262151.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "UEJHglMxDN9u00E2_2IVNG01%Nw]0-~VnN-:", + "meta": { + "seed": 8370757, + "steps": 23, + "prompt": "shimazakisetsuna, glasses, blunt bangs, twin braids, 1girl, solo, drawing, holding pencil", + "sampler": "Euler a", + "cfgScale": 5, + "negativePrompt": "(worst quality, low quality, large head, extra digits:1.4), easynegative," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c54eee61-d5d5-4be6-bca7-16dc42b3be58/width=450/1262150.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "UDI;kzXhENV|Jn?c%2D%%~-p9b02~q?GoMRj", + "meta": { + "seed": 1155544537, + "steps": 23, + "prompt": "shimazakisetsuna, glasses, blunt bangs, twin braids, 1girl, solo, train station, (empty eyes:1.4), sad", + "sampler": "Euler a", + "cfgScale": 5, + "negativePrompt": "(worst quality, low quality, large head, extra digits:1.4), easynegative," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/47343927-12e6-4e82-bb0a-90dbda49d633/width=450/1262152.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "UCG+j?004n.900~Us-E20OEl?Hr;$0?G9G%0", + "meta": { + "seed": 773591451, + "steps": 23, + "prompt": "shimazakisetsuna, glasses, blunt bangs, twin braids, 1girl, solo, sleeping, nightgown, lying, on water, night", + "sampler": "Euler a", + "cfgScale": 5, + "negativePrompt": "(worst quality, low quality, large head, extra digits:1.4), easynegative," + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/102486" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232Creators/ShimazakiSetsunaV2.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232Creators/ShimazakiSetsunaV2.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..458b386287c588d2c5857a1a06d98ca05863a3bc Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232Creators/ShimazakiSetsunaV2.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232Creators/ShimazakiSetsunaV2.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232Creators/ShimazakiSetsunaV2.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..779bf2016a39f592bc2ab76d30da33f8ae40c64b --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232Creators/ShimazakiSetsunaV2.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:62ca5964d542767559d1054e5ca124281121fcdb1a1eeed96c9c549506288eeb +size 18993188 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232Creators/meteora osterreich,.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232Creators/meteora osterreich,.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..981db62bf25f1b311e88c882666e093dc2acc592 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232Creators/meteora osterreich,.civitai.info" @@ -0,0 +1,85 @@ +{ + "id": 91653, + "modelId": 86217, + "name": "meteora osterreichv1.0", + "createdAt": "2023-06-08T10:36:34.667Z", + "updatedAt": "2023-06-08T10:44:46.873Z", + "trainedWords": [ + "meteora osterreich,1girl, blue eyes, short hair, fur trim, hood, jewelry,capelet,white hair" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 133, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "\u7c73\u7279\u5965\u62c9/\u30e1\u30c6\u30aa\u30e9\u30fb \u30a8\u30b9\u30bf\u30fc\u30e9\u30a4\u30d2\uff08re:creators\uff09", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "meteora osterreich,.safetensors", + "id": 63151, + "sizeKB": 36975.8134765625, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-08T10:40:58.488Z", + "hashes": { + "AutoV1": "E1E94ADB", + "AutoV2": "78AF72BB54", + "SHA256": "78AF72BB54FD9BA27D0748560CB402F5E44012512E41779A9A4ACB7E7207CE05", + "CRC32": "B2143661", + "BLAKE3": "E1E0E7E588398201AB8313BBAE5B9321AEBAE66BD2C4D71343EAA2A8A649DAB9" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/91653" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7a79abf8-c35a-4daf-8d75-8005769b0d03/width=450/1071328.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UIGRh,0LDiWY~WkC00%M_29Za_t7X8kCM{oz", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2adeca26-a7e2-461d-95dd-cb200115de5e/width=450/1071279.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UKGuRM^*4T$%~W%14nxtSiM|D%R*XSIpofR*", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/105c950f-c959-4cbe-95b5-0aa2458a9105/width=450/1071278.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UbH1=1slV?Rj~Vt6RPM{-oozRiV@-pt6t6s:", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/93616aa7-1d77-4995-8f4e-c402c73c6402/width=450/1071280.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UeI4|q-p9Fo0~pR*9Fof%MR+RjR*k9j[s:WB", + "meta": null + } + ], + "downloadUrl": "https://civitai.com/api/download/models/91653" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232Creators/meteora osterreich,.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232Creators/meteora osterreich,.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..d2d6dcd6fb75a7742a733fa134f2c6a4bdad79b8 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232Creators/meteora osterreich,.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232Creators/meteora osterreich,.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232Creators/meteora osterreich,.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..762961153f71e63b18a38d9a9666a1085e081415 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232Creators/meteora osterreich,.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:78af72bb54fd9ba27d0748560cb402f5e44012512e41779a9a4acb7e7207ce05 +size 37863233 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Emilia_V2-000004.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Emilia_V2-000004.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..47d87ee7dc5da65cfcfd20232097f24fec082ed3 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Emilia_V2-000004.civitai.info" @@ -0,0 +1,166 @@ +{ + "id": 78579, + "modelId": 41459, + "name": "v2.0", + "createdAt": "2023-05-23T07:21:52.471Z", + "updatedAt": "2023-05-23T07:25:29.088Z", + "trainedWords": [ + "Emilia" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 225, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Emilia/\u611b\u871c\u8389\u96c5/\u30a8\u30df\u30ea\u30a2/Re:Zero/Re:\u5f9e\u96f6\u958b\u59cb\u7684\u7570\u4e16\u754c\u751f\u6d3b/Re:\u30bc\u30ed\u304b\u3089\u59cb\u3081\u308b\u7570\u4e16\u754c\u751f\u6d3b", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "Emilia_V2-000004.safetensors", + "id": 54018, + "sizeKB": 73843.4375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-23T07:26:32.530Z", + "hashes": { + "AutoV1": "6DDBBD68", + "AutoV2": "2DDB7399C5", + "SHA256": "2DDB7399C5B3C214BF4CC2859CC8106DB22C3A7DFEEACB0D18DB222E2F549623", + "CRC32": "65700989", + "BLAKE3": "2395D9A8866FD1A0E508514B114D1DEDE83476E8C71BA26FB9387A4A557F0FF4" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/78579" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5907a8fc-8269-4a27-ac78-040c50161668/width=450/881017.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UHHBxo~q004nE0Mx9Z%Nx@xuIV9Y.7%K-ot7", + "meta": { + "seed": 1135524067, + "steps": 20, + "prompt": "1girl, solo, , , Emilia, emilia_\\(re:zero\\), long hair, silver hair, blunt bangs, braid, hair ornament, hair flower, hair ribbon, purple ribbon, purple eyes, blush, low-tied long hair, elf, dress, bare shoulders, detached sleeves, wide sleeves, cleavage, pleated skirt, thighhights, white legwear, white shoes, open mouth, smile,(\u5922\u5e7b\u68ee\u6797|Dreamy forest:1.3), (masterpiece:1.2), highres, best quality, 8k, very clear,", + "sampler": "Euler a", + "cfgScale": 7, + "negativePrompt": "(worst quality:2), (low quality:2), (normal quality:2), EasyNegative, badhandv4, verybadimagenegative_v1.3, NSFW," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/63d4c5e8-051c-41ee-9334-81a0038515c1/width=450/880993.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "UGFr*So~00ozR-xuR-o#E1%MIVIo?wR+-:t8", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3505f4c6-daf2-45ee-b887-19f788298ec4/width=450/881330.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UfJ*Cy~pI-WUs-xv%Mxus,t7IpjZo#oes:WA", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ef4902f2-ea4a-4bba-a36f-3be4035ad783/width=450/880977.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "UWHe;3D*D$yDu6xao#NxTeIUt8M|OHtRWBRj", + "meta": { + "Size": "512x768", + "seed": 2992357239, + "Model": "QuinceMixV2", + "steps": 20, + "hashes": { + "model": "678a9cc6f6" + }, + "prompt": "1girl, solo, , Emilia, emilia_\\(re:zero\\), long hair, silver hair, blunt bangs, braid, hair ornament, hair flower, hair ribbon, purple ribbon, purple eyes, blush, low-tied long hair, elf, dress, bare shoulders, detached sleeves, wide sleeves, cleavage, pleated skirt, thighhights, white legwear, white shoes, outdoors, (masterpiece:1.2), highres, best quality, 8k, very clear,", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "678a9cc6f6", + "name": "QuinceMixV2", + "type": "model" + } + ], + "Model hash": "678a9cc6f6", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality:2), (low quality:2), (normal quality:2), EasyNegative, badhandv4, verybadimagenegative_v1.3, NSFW,", + "Denoising strength": "0.5", + "SAG Guidance Scale": "0.75", + "SAG Mask Threshold": "1" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/920931d9-1ef8-41bf-aea0-21fc26fb0661/width=450/880978.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "UOIEkh^+9Yt7~V?bocj]~pV?ohj[.8%Mxut7", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7cefa8f7-475d-4878-afb4-93c045836047/width=450/881002.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1536, + "hash": "UaK^?N?vOSR*.TbcR*ogtlt7xatRNLxZIBxa", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/71725c93-2143-4c44-bbff-992274e73e86/width=450/881004.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1536, + "hash": "UIJ*r3~qPlD*1lEL01xHSjogjvX9Vws:$MSO", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4e51a649-faa0-4623-8108-36387b600c86/width=450/880980.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "U5H-uy00$Y-r-?9E5SIU00^*tTIT00_N00Ne", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a2a930f7-dc53-4f23-bb42-68da55bfa371/width=450/880981.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "ULFiMZ~pf^tP4=%gxwR:-pIuN4t8Inxu-;xu", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/85c6b200-7848-4b3f-accc-82f6dd8dc2d0/width=450/880983.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UMG8{4^+D#NayZNbi^o#tn%M%2WC58M|-otQ", + "meta": null + } + ], + "downloadUrl": "https://civitai.com/api/download/models/78579" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Emilia_V2-000004.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Emilia_V2-000004.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..75c6dd146572480766c531b07de5a47f03f9e109 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Emilia_V2-000004.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Emilia_V2-000004.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Emilia_V2-000004.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..3141ead288d9e7d056000228269a349c7b3cbfd4 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Emilia_V2-000004.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:2ddb7399c5b3c214bf4cc2859cc8106db22c3a7dfeeacb0d18db222e2f549623 +size 75615680 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Ram_ReZero_v1_2.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Ram_ReZero_v1_2.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..d0d2be8cc470d505537e2606459eecc7b6e48291 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Ram_ReZero_v1_2.civitai.info" @@ -0,0 +1,305 @@ +{ + "id": 74098, + "modelId": 10631, + "name": "v1.2", + "createdAt": "2023-05-18T14:01:32.421Z", + "updatedAt": "2023-05-18T14:27:59.427Z", + "trainedWords": [ + "ram_rezero" + ], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": "

Retrained the model with larger dataset on NovelAI model following this guide: https://civitai.com/models/22530/guide-make-your-own-loras-easy-and-free

", + "stats": { + "downloadCount": 52, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Ram (RE:Zero)", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "Ram_ReZero_v1_2.safetensors", + "id": 51251, + "sizeKB": 18544.212890625, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-18T14:06:56.648Z", + "hashes": { + "AutoV1": "93DD1204", + "AutoV2": "EDD560A5DE", + "SHA256": "EDD560A5DE1F35EDD02FDB36C518AE12ED41E1B1B0B3A8377AB84BEC3EA8E8F3", + "CRC32": "0ECE7ECF", + "BLAKE3": "B165C4BADAA2A8FB5345CF60738B33EC8E02A1FCB50C2BFD45FA5DEDCC1084FB" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/74098" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f8b0ad2c-02aa-4dc3-8023-463f2bb9807e/width=450/828193.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "UVM6*d~qKi%MwzNGS~R+RQRkt7t7.8ozRjjF", + "meta": { + "Size": "512x768", + "seed": 3311477688, + "Model": "Anime_ghostmix_v12", + "steps": 20, + "hashes": { + "model": "d7465e52e1" + }, + "prompt": "(best quality:1.2), (ultra-detailed:1.2), masterpiece, 8k wallpapers, extremely detailed, 1girl, Ram_ReZero, , pink hair, short hair, (upper body:1.2), angry", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 7, + "resources": [ + { + "name": "Ram_ReZero_v1_2", + "type": "lora", + "weight": 0.65 + }, + { + "hash": "d7465e52e1", + "name": "Anime_ghostmix_v12", + "type": "model" + } + ], + "Model hash": "d7465e52e1", + "Hires upscale": "2", + "Hires upscaler": "Latent (nearest)", + "negativePrompt": "duplicated, disfugured, deformed, poorly drawn, low quality eyes, border, comic, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, artist name, pixels, censored,", + "Denoising strength": "0.65" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6878f904-4f51-455d-89fc-6bf4c61158f7/width=450/828195.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "UaL3}u~qEKM{-:x[x]ogX9t8R*M|NGjboLay", + "meta": { + "Size": "512x768", + "seed": 4238046726, + "Model": "Anime_ghostmix_v12", + "steps": 20, + "hashes": { + "model": "d7465e52e1" + }, + "prompt": "(best quality:1.2), (ultra-detailed:1.2), masterpiece, 8k wallpapers, extremely detailed, 1girl, Ram_ReZero, , pink hair, short hair, full body, maid outfit,", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 7, + "resources": [ + { + "name": "Ram_ReZero_v1_2", + "type": "lora", + "weight": 0.65 + }, + { + "hash": "d7465e52e1", + "name": "Anime_ghostmix_v12", + "type": "model" + } + ], + "Model hash": "d7465e52e1", + "Hires upscale": "2", + "Hires upscaler": "Latent (nearest)", + "negativePrompt": "duplicated, disfugured, deformed, poorly drawn, low quality eyes, border, comic, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, artist name, pixels, censored,", + "Denoising strength": "0.65" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/414f518f-57a4-4117-8dad-e324606faded/width=450/828194.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UgMGP6xu8_xa~qofMxaeozofM{RjNaofWBjY", + "meta": { + "Size": "512x768", + "seed": 371471417, + "Model": "Anime_ghostmix_v12", + "steps": 20, + "hashes": { + "model": "d7465e52e1" + }, + "prompt": "(best quality:1.2), (ultra-detailed:1.2), masterpiece, 8k wallpapers, extremely detailed, 1girl, Ram_ReZero, , pink hair, short hair, (full body:1.2), maid outfit,", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 7, + "resources": [ + { + "name": "Ram_ReZero_v1_2", + "type": "lora", + "weight": 0.65 + }, + { + "hash": "d7465e52e1", + "name": "Anime_ghostmix_v12", + "type": "model" + } + ], + "Model hash": "d7465e52e1", + "Hires upscale": "2", + "Hires upscaler": "Latent (nearest)", + "negativePrompt": "duplicated, disfugured, deformed, poorly drawn, low quality eyes, border, comic, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, artist name, pixels, censored,", + "Denoising strength": "0.65" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8c739268-14ef-46ba-8534-4eeed0fddd06/width=450/828198.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UWIN%H-pI.%L~V%2I:WBjGR+W=RjtRWBjFoM", + "meta": { + "Size": "512x768", + "seed": 2357678720, + "Model": "Anime_ghostmix_v12", + "steps": 20, + "hashes": { + "model": "d7465e52e1" + }, + "prompt": "(best quality:1.2), (ultra-detailed:1.2), masterpiece, 8k wallpapers, extremely detailed, 1girl, Ram_ReZero, , pink hair, upper body, black leather jacket, white shirt, blue jeans, standing", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 7, + "resources": [ + { + "name": "Ram_ReZero_v1_2", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "d7465e52e1", + "name": "Anime_ghostmix_v12", + "type": "model" + } + ], + "Model hash": "d7465e52e1", + "Hires upscale": "2", + "Hires upscaler": "Latent (nearest)", + "negativePrompt": "duplicated, disfugured, deformed, poorly drawn, low quality eyes, border, comic, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, artist name, pixels, censored,", + "Denoising strength": "0.65" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/402b003c-d25c-4ee4-988e-4a1be5f2f08e/width=450/828197.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "UBH_ACD+00-;4oXTJ%%1Ey9GM{s:56n*~CkW", + "meta": { + "Size": "512x768", + "seed": 296196928, + "Model": "Anime_ghostmix_v12", + "steps": 20, + "hashes": { + "model": "d7465e52e1" + }, + "prompt": "(best quality:1.2), (ultra-detailed:1.2), masterpiece, 8k wallpapers, extremely detailed, 1girl, Ram_ReZero, , pink hair, upper body, black swimsuit, sitting in water", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 7, + "resources": [ + { + "name": "Ram_ReZero_v1_2", + "type": "lora", + "weight": 0.65 + }, + { + "hash": "d7465e52e1", + "name": "Anime_ghostmix_v12", + "type": "model" + } + ], + "Model hash": "d7465e52e1", + "Hires upscale": "2", + "Hires upscaler": "Latent (nearest)", + "negativePrompt": "duplicated, disfugured, deformed, poorly drawn, low quality eyes, border, comic, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, artist name, pixels, censored,", + "Denoising strength": "0.65" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/cb651050-cdba-4b9c-bcfa-86884a94a0e8/width=450/828196.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "UfLzHqIoNbW.~qfkayofRkofM{ayxaWBjFWB", + "meta": { + "Size": "512x768", + "seed": 2091521554, + "Model": "Anime_ghostmix_v12", + "steps": 20, + "hashes": { + "model": "d7465e52e1" + }, + "prompt": "(best quality:1.2), (ultra-detailed:1.2), masterpiece, 8k wallpapers, extremely detailed, 1girl, Ram_ReZero, , pink hair, upper body, black swimsuit", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 7, + "resources": [ + { + "name": "Ram_ReZero_v1_2", + "type": "lora", + "weight": 0.65 + }, + { + "hash": "d7465e52e1", + "name": "Anime_ghostmix_v12", + "type": "model" + } + ], + "Model hash": "d7465e52e1", + "Hires upscale": "2", + "Hires upscaler": "Latent (nearest)", + "negativePrompt": "duplicated, disfugured, deformed, poorly drawn, low quality eyes, border, comic, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, artist name, pixels, censored,", + "Denoising strength": "0.65" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d07cdbe5-0f94-4f37-ae2e-85c7e49b27cf/width=450/828192.jpeg", + "nsfw": "Soft", + "width": 800, + "height": 1200, + "hash": "UZMjUL%M.T%M~WRjXmV@M{t7bHoz.7WBRjWB", + "meta": { + "Size": "400x600", + "seed": 2050923071, + "Model": "Anime_meinahentai_v21", + "steps": 20, + "hashes": { + "model": "deb40a068a" + }, + "prompt": "highres, sharp focus, pixiv masterpiece, ((intricate details)), highly detailed, 1girl, maid outfit, Ram_ReZero, , , Bags under eyes, depressed, expressionless,", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 7, + "resources": [ + { + "name": "Ram_ReZero_v1_2", + "type": "lora", + "weight": 1 + }, + { + "hash": "deb40a068a", + "name": "Anime_meinahentai_v21", + "type": "model" + } + ], + "Model hash": "deb40a068a", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "negativePrompt": "duplicated, disfugured, deformed, poorly drawn, low quality eyes, border, comic, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, artist name, pixels, censored,", + "Denoising strength": "0.65" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/74098" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Ram_ReZero_v1_2.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Ram_ReZero_v1_2.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..7c788a8d6fb18237952914190b5320f12168f033 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Ram_ReZero_v1_2.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Ram_ReZero_v1_2.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Ram_ReZero_v1_2.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..89e338bc9f2756c2fd71665ea8d9fb53bfc393d4 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Ram_ReZero_v1_2.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:edd560a5de1f35edd02fdb36c518ae12ed41e1b1b0b3a8377ab84bec3ea8e8f3 +size 18989274 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Ram_V2-000005.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Ram_V2-000005.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..5beff90f8e280b2ec0d0253fb7700af8a310680f --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Ram_V2-000005.civitai.info" @@ -0,0 +1,140 @@ +{ + "id": 78883, + "modelId": 38535, + "name": "v2.0", + "createdAt": "2023-05-23T14:02:30.310Z", + "updatedAt": "2023-05-23T14:07:53.485Z", + "trainedWords": [ + "Ram" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 280, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Ram/\u62c9\u59c6/\u30e9\u30e0/Re:Zero/Re:\u5f9e\u96f6\u958b\u59cb\u7684\u7570\u4e16\u754c\u751f\u6d3b/Re:\u30bc\u30ed\u304b\u3089\u59cb\u3081\u308b\u7570\u4e16\u754c\u751f\u6d3b", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "Ram_V2-000005.safetensors", + "id": 54210, + "sizeKB": 73845.78125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-23T14:06:29.430Z", + "hashes": { + "AutoV1": "16CF3F56", + "AutoV2": "618D8ABF00", + "SHA256": "618D8ABF0073A62BDA87D8E6D8465A71B6031D0B03C03A8F2AEAD22F40637F5B", + "CRC32": "43DF1E90", + "BLAKE3": "151EED8FED5E0D04A83FD7753EF73365E1EA4A0C057551030B55D97075DB3222" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/78883" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/024b2112-e602-45f0-8fc6-952e9b65b3e7/width=450/884177.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UOH-fQV@In%frX?I9Z9Y-Uxax]oI~Baz-o-:", + "meta": { + "seed": 2590033820, + "steps": 20, + "prompt": " 1girl, solo, , Ram, ram_\\(re:zero\\), red eyes, hair over one eye, short hair, pink hair, hair ornament, bangs, blush, hair ribbon, ribbon trim, purple ribbon, hairclip, roswaal mansion maid uniform, maid headdress, detached sleeves, white legwear, white apron, white thighhighs, cleavage, ribbon-trimmed sleeves, black shoes, shy, looking at viewer|\u2605\\[\u6b63\u5728\u770b\u7684\u89c0\u773e\\],, (masterpiece:1.2), highres, best quality, 8k, very clear,", + "sampler": "Euler a", + "cfgScale": 7, + "negativePrompt": "(worst quality:2), (low quality:2), (normal quality:2), EasyNegative, badhandv4, verybadimagenegative_v1.3, ng_deepnegative_v1_75t, NSFW," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6283ae86-f0e2-49d2-b822-daeba2af1188/width=450/884215.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "ULI}u1SiFpX-%%%NX8yD?wM|x]NxE4D*M{WE", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ddaa5504-d765-4a31-a675-13660abdb77c/width=450/884365.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1482, + "hash": "UFKT=L002YyYp3?bPVNKmQlTxs%L^$S+VDIA", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1711f962-2ebf-49f1-ab7d-4cfa868e60e9/width=450/884348.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1482, + "hash": "UFKT=L002YyYp3?bPVNKmQlTxs%L^$S+VDIA", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4f383722-68f6-4063-9163-8df17df01db3/width=450/884178.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "UYGa@7~Wk6ac$*s,g1xuoMxatRxtxt%1t6R%", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6288b7cb-e227-4107-8d0e-89ca43dba03f/width=450/884180.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "UHF}+zTJc5~B?F_2Xl~V$l-;%gxFS1o#?IM{", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/74fbec26-39ac-4931-9fdc-0d06be39de07/width=450/884186.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "USEVBG~VXLxs^QxYI.obnPR*NakBn,ozx]xv", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a5b454c1-eb8a-4899-8a3f-38ab3b33a196/width=450/884187.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "ULFYP{~U00E1ivNFEyM{MwV?%g?H-V%2kWM{", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7488f87f-a0d8-4f51-87d6-6fcee2438fa6/width=450/884192.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UZG[c:_NXM9Z?ao~xuR*.7?H-qoga$xuR*jr", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/03630d2c-9108-4902-9db2-5048897fbcdb/width=450/884193.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UCF5mu00A64:IAxuEKk90c~VtAt5xAIVXAov", + "meta": null + } + ], + "downloadUrl": "https://civitai.com/api/download/models/78883" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Ram_V2-000005.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Ram_V2-000005.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..77b9bc2c2538190f9f0bc363f1b177cb88b35f5d Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Ram_V2-000005.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Ram_V2-000005.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Ram_V2-000005.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..e97c8d0131f05065730c888406f94e25dced9359 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Ram_V2-000005.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:618d8abf0073a62bda87d8e6d8465a71b6031d0b03c03a8f2aead22f40637f5b +size 75618080 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/ReZeroRem_v10.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/ReZeroRem_v10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..e2c4070937dfeec1f1c6ff088e3ff94012208a4a --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/ReZeroRem_v10.civitai.info" @@ -0,0 +1,249 @@ +{ + "id": 19707, + "modelId": 16688, + "name": "V10", + "createdAt": "2023-03-07T06:01:28.699Z", + "updatedAt": "2023-03-08T09:52:11.924Z", + "trainedWords": [ + "nayutaren", + "blue hair", + "roswaal mansion maid uniform" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

a test version

", + "model": { + "name": "\u857e\u59c6|Re:Zero-Rem", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "ReZeroRem_v10.safetensors", + "id": 16453, + "sizeKB": 147570.572265625, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-03-07T06:05:45.113Z", + "hashes": { + "AutoV1": "265DEE49", + "AutoV2": "494C9F7D0F", + "SHA256": "494C9F7D0FC989B75551ED8DC9956B0C373F4AD79422D84A9317A80CA9306FAE", + "CRC32": "7AA514B6", + "BLAKE3": "4DF4B0CFB8BCE1389B340FE8DDAA2643271737612F3A6884E3EAB3BEC271D994" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/19707" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d1ae54d5-4168-4aa5-7f9a-eceb77006e00/width=450/207429.jpeg", + "nsfw": false, + "width": 3840, + "height": 2160, + "hash": "ULLOE4V[y5~VPD^O=[={0h.7I=x[WFIpMyRk", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/548f6456-5cae-4add-4987-d3d4334fa400/width=450/207440.jpeg", + "nsfw": true, + "width": 3840, + "height": 2160, + "hash": "UKKUi|ys0#9GE89I%1D*d;=_V?9uogRlI]M|", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9065c0e9-bf22-4ac9-3dd6-0875838a9f00/width=450/207439.jpeg", + "nsfw": true, + "width": 3840, + "height": 2160, + "hash": "UGH{sYqF0}E4L4jZ^js+02Md%1e=o5x[IVR-", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f1fd44c9-cece-432d-004e-4c9018411400/width=450/207438.jpeg", + "nsfw": true, + "width": 3840, + "height": 2160, + "hash": "UHHLe*0000-@%MMc%LElNgD*bI%0NKIU%M%L", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/793b1995-8a5a-47e3-cac5-94f49ab47200/width=450/207437.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UgM%p8~qxtt8XUa#%0xtW?oeWBadofRk%2WW", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/53169913-7106-4e13-df38-b0566750b700/width=450/213371.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UCK^]X000z9c018wRN-=0:?G~BI]J=^cIpE1", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2211268140, + "steps": 20, + "prompt": "best quality,highly,detailed,masterpiece,ultra-detailed,illustration,85mm lens,\nlooking at viewer, ((1girl,solo)),blush,full body,\n(Delicate eyes),(smile),one eye covered, (cover right eye),hair over one eye,hair ornament,\nmedium breasts,cleavage,\n(topless,nipples,pussy),(complete nude:1.5),\n(short hair,:1.2),(wet hair:1.3),expressive detail hair,blue hair,\nbeach,beautiful sky,detail sky,morning,\n,nayutaren,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "Model hash": "0f3f7f92a7", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative,((bad anatomy)), ((bad hands)),((mutated hands andfingers)), missing fingers, missing limb, fused fingers, one hand with more than 5 fingers", + "Denoising strength": "0.35" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c3bf5424-1390-49ea-68c2-13f46e365f00/width=450/213370.jpeg", + "nsfw": true, + "width": 1536, + "height": 1024, + "hash": "UmI#ov~qW;bdtSkWRlbcM{ogj]Rj-ot7R*V?", + "meta": { + "ENSD": "31337", + "Size": "1536x1024", + "seed": 581131911, + "steps": 20, + "prompt": "best quality,highly,detailed,masterpiece,ultra-detailed,illustration,85mm lens,\nlooking at viewer, ((1girl,solo)),blush,full body,\n(Delicate eyes),(smile),one eye covered, (cover right eye),hair over one eye,hair ornament,\nmedium breasts,cleavage,\nbikini,\n(short hair,:1.2),(wet hair:1.3),expressive detail hair,blue hair,\nbeach,beautiful sky,detail sky,morning,\n,nayutaren, ,mix4", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "Mask blur": "0", + "resources": [ + { + "name": "cuteGirlMix4_v10", + "type": "lora", + "weight": 0.4 + } + ], + "Model hash": "0f3f7f92a7", + "negativePrompt": "(ribbon,collar,choker,bowtie:1.5),(worst quality, low quality:1.4), EasyNegative,((bad anatomy)), ((bad hands)),((mutated hands andfingers)), missing fingers, missing limb, fused fingers, one hand with more than 5 fingers", + "Denoising strength": "0" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8c82b776-8b68-4bb3-eb43-950dcf801800/width=450/213369.jpeg", + "nsfw": true, + "width": 1536, + "height": 1024, + "hash": "UKJRp:^h.7?Ht:~UQ,IU0Mo}-T%L%Nt7xu%L", + "meta": { + "ENSD": "31337", + "Size": "1536x1024", + "seed": 581131909, + "steps": 20, + "prompt": "best quality,highly,detailed,masterpiece,ultra-detailed,illustration,85mm lens,\nlooking at viewer, ((1girl,solo)),blush,full body,\n(Delicate eyes),(smile),one eye covered, (cover right eye),hair over one eye,hair ornament,\nmedium breasts,cleavage,\nbikini,\n(short hair,:1.2),(wet hair:1.3),expressive detail hair,blue hair,\nbeach,beautiful sky,detail sky,morning,\n,nayutaren, ,mix4", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "Mask blur": "0", + "resources": [ + { + "name": "cuteGirlMix4_v10", + "type": "lora", + "weight": 0.4 + } + ], + "Model hash": "0f3f7f92a7", + "negativePrompt": "(ribbon,collar,choker,bowtie:1.5),(worst quality, low quality:1.4), EasyNegative,((bad anatomy)), ((bad hands)),((mutated hands andfingers)), missing fingers, missing limb, fused fingers, one hand with more than 5 fingers", + "Denoising strength": "0" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/00cf5837-ed94-42a1-90ff-cbc979f13800/width=450/207436.jpeg", + "nsfw": false, + "width": 1024, + "height": 1024, + "hash": "UYJRzFIp?^t7JER*bJWBWBayxZWVNeWBE1fk", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 2986763741, + "steps": 20, + "prompt": "1girl, beach, sky,upper body,,nayutaren,looking at viewer, maid, best quality, nude,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "Rem1", + "type": "lora", + "weight": 0.4 + }, + { + "hash": "bfcd285d2ecd", + "name": "Rem1", + "type": "lora", + "weight": null + } + ], + "Model hash": "aad629159b", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "Rem1(bfcd285d2ecd)", + "Hires upscaler": "Latent", + "negativePrompt": "(worst quality, low quality:1.4), signature,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.5", + "AddNet Weight B 1": "0.5", + "Denoising strength": "0.5" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/77d4a45a-c01a-4ae2-7f51-51f98cc42200/width=450/207435.jpeg", + "nsfw": true, + "width": 1024, + "height": 1024, + "hash": "UAKKD]000K_300%L=so$SPah~W4.%2n$4:oy", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 2986763741, + "steps": 20, + "prompt": "1girl, nayutaren,looking at viewer, maid, best quality, (((nude))), , best quality,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "Rem1", + "type": "lora", + "weight": 0.4 + }, + { + "hash": "bfcd285d2ecd", + "name": "Rem1", + "type": "lora", + "weight": null + } + ], + "Model hash": "5efb10a9e1", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "Rem1(bfcd285d2ecd)", + "Hires upscaler": "Latent", + "negativePrompt": "(worst quality, low quality:1.4), signature,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.5", + "AddNet Weight B 1": "0.5", + "Denoising strength": "0.5" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/19707" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/ReZeroRem_v10.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/ReZeroRem_v10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..e0614d8e85c702b023ac39cfb584d353f3d5e4cc --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/ReZeroRem_v10.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:01d704e509d6302a9373f42e56799d13b6a59c95420a8c6aaf20ee6b3ae401f3 +size 1570238 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/ReZeroRem_v10.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/ReZeroRem_v10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..b352d57b3db0ebd1c2a383c73ea2ad2a01bda664 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/ReZeroRem_v10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:494c9f7d0fc989b75551ed8dc9956b0c373f4ad79422d84a9317a80ca9306fae +size 151112266 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Rem_ReZero_v1_1.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Rem_ReZero_v1_1.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..4fde610c1c98e78bb49a7d191dbb1f334e45319b --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Rem_ReZero_v1_1.civitai.info" @@ -0,0 +1,233 @@ +{ + "id": 82179, + "modelId": 9951, + "name": "v1.1", + "createdAt": "2023-05-26T21:25:55.368Z", + "updatedAt": "2023-05-26T21:28:32.095Z", + "trainedWords": [ + "rem_re_zero" + ], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": "

Retrained the model on NovelAI model following this guide: https://civitai.com/models/22530/guide-make-your-own-loras-easy-and-free

", + "stats": { + "downloadCount": 179, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Rem (Re:Zero)", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "Rem_ReZero_v1_1.safetensors", + "id": 56276, + "sizeKB": 18544.6005859375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-26T21:31:22.565Z", + "hashes": { + "AutoV1": "44C445C0", + "AutoV2": "6FF28776FF", + "SHA256": "6FF28776FF71A3B616E17B2B23AEF8BB3881E3675BCF7ADC4A4CA0104DAA7769", + "CRC32": "1F587202", + "BLAKE3": "CE4E468DBB936A54E796096255900A54D55BC1FAA1E1D3F9990EE68B7074F4ED" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/82179" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7b8e84e1-0366-4596-94c8-4e65bd4536da/width=450/923991.jpeg", + "nsfw": "Soft", + "width": 800, + "height": 1200, + "hash": "UDF~Bj0000_302V=%0-p01t8^+IW~VM{RPkB", + "meta": { + "Size": "400x600", + "seed": 2524696140, + "Model": "Anime_ghostmix_v20Novae", + "steps": 20, + "hashes": { + "model": "e3edb8a26f" + }, + "prompt": "highres, sharp focus, pixiv masterpiece, ((intricate details)), highly detailed, upper body, 1girl, rem_re_zero, blue hair, short hair, maid uniform, hair ornament, cleavage, maid headdress, detached sleeves, ribbon,, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "name": "Rem_ReZero_v1_1", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "e3edb8a26f", + "name": "Anime_ghostmix_v20Novae", + "type": "model" + } + ], + "Model hash": "e3edb8a26f", + "Hires upscale": "2", + "Hires upscaler": "Latent (nearest-exact)", + "negativePrompt": "duplicated, disfugured, deformed, poorly drawn, low quality eyes, border, comic, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality, low quality:1.4), interlocked fingers, normal quality, jpeg artifacts, signature, watermark, username, blurry, artist name, pixels, censored,", + "Denoising strength": "0.7" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5fc6b31a-aa63-4070-bfc7-44c9349ade7d/width=450/923993.jpeg", + "nsfw": "Soft", + "width": 800, + "height": 1200, + "hash": "UAG*{I004mXUNgD%$woh00Rj^ikC~pM|D*xu", + "meta": { + "Size": "400x600", + "seed": 2356881330, + "Model": "Anime_ghostmix_v20Novae", + "steps": 20, + "hashes": { + "model": "e3edb8a26f" + }, + "prompt": "highres, sharp focus, pixiv masterpiece, ((intricate details)), highly detailed, upper body, 1girl, rem_re_zero, blue hair, short hair, maid uniform, hair ornament, cleavage, maid headdress, detached sleeves, ribbon,, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "resources": [ + { + "name": "Rem_ReZero_v1_1", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "e3edb8a26f", + "name": "Anime_ghostmix_v20Novae", + "type": "model" + } + ], + "Model hash": "e3edb8a26f", + "Hires upscale": "2", + "Hires upscaler": "Latent (nearest-exact)", + "negativePrompt": "duplicated, disfugured, deformed, poorly drawn, low quality eyes, border, comic, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality, low quality:1.4), interlocked fingers, normal quality, jpeg artifacts, signature, watermark, username, blurry, artist name, pixels, censored,", + "Denoising strength": "0.7" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/152df12f-9f85-4c69-bf7d-f8a2ee48398f/width=450/923997.jpeg", + "nsfw": "Soft", + "width": 800, + "height": 1200, + "hash": "UMJRHuMe4m-:_ND%-.ad%h9YxvM|~Wk7E4of", + "meta": { + "Size": "400x600", + "seed": 2524696138, + "Model": "Anime_ghostmix_v20Novae", + "steps": 20, + "hashes": { + "model": "e3edb8a26f" + }, + "prompt": "highres, sharp focus, pixiv masterpiece, ((intricate details)), highly detailed, upper body, 1girl, rem_re_zero, blue hair, short hair, maid uniform, hair ornament, cleavage, maid headdress, detached sleeves, ribbon,, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "name": "Rem_ReZero_v1_1", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "e3edb8a26f", + "name": "Anime_ghostmix_v20Novae", + "type": "model" + } + ], + "Model hash": "e3edb8a26f", + "Hires upscale": "2", + "Hires upscaler": "Latent (nearest-exact)", + "negativePrompt": "duplicated, disfugured, deformed, poorly drawn, low quality eyes, border, comic, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality, low quality:1.4), interlocked fingers, normal quality, jpeg artifacts, signature, watermark, username, blurry, artist name, pixels, censored,", + "Denoising strength": "0.7" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/afe8256c-406a-4186-a162-c4040e095664/width=450/923999.jpeg", + "nsfw": "Soft", + "width": 800, + "height": 1200, + "hash": "UHIEqu00J$v}cGVr-p9ZE1M{$*W;~UM|IpjY", + "meta": { + "Size": "400x600", + "seed": 2524696139, + "Model": "Anime_ghostmix_v20Novae", + "steps": 20, + "hashes": { + "model": "e3edb8a26f" + }, + "prompt": "highres, sharp focus, pixiv masterpiece, ((intricate details)), highly detailed, upper body, 1girl, rem_re_zero, blue hair, short hair, maid uniform, hair ornament, cleavage, maid headdress, detached sleeves, ribbon,, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "name": "Rem_ReZero_v1_1", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "e3edb8a26f", + "name": "Anime_ghostmix_v20Novae", + "type": "model" + } + ], + "Model hash": "e3edb8a26f", + "Hires upscale": "2", + "Hires upscaler": "Latent (nearest-exact)", + "negativePrompt": "duplicated, disfugured, deformed, poorly drawn, low quality eyes, border, comic, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality, low quality:1.4), interlocked fingers, normal quality, jpeg artifacts, signature, watermark, username, blurry, artist name, pixels, censored,", + "Denoising strength": "0.7" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/408cadfd-74d4-4f7c-9f6a-5f008c022974/width=450/923995.jpeg", + "nsfw": "Soft", + "width": 800, + "height": 1200, + "hash": "USJHHx00-:$k_3D%n~X9EQbYRPbb~VV@Ioxa", + "meta": { + "Size": "400x600", + "seed": 511165603, + "Model": "Anime_ghostmix_v20Novae", + "steps": 20, + "hashes": { + "model": "e3edb8a26f" + }, + "prompt": "highres, sharp focus, pixiv masterpiece, ((intricate details)), highly detailed, upper body, 1girl, rem_re_zero, blue hair, short hair, maid uniform, hair ornament, cleavage, maid headdress, detached sleeves, ribbon, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "name": "sam_yang_offset_right_filesize", + "type": "lora", + "weight": 1 + }, + { + "hash": "e3edb8a26f", + "name": "Anime_ghostmix_v20Novae", + "type": "model" + } + ], + "Model hash": "e3edb8a26f", + "Hires upscale": "2", + "Hires upscaler": "Latent (nearest-exact)", + "negativePrompt": "duplicated, disfugured, deformed, poorly drawn, low quality eyes, border, comic, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality, low quality:1.4), interlocked fingers, normal quality, jpeg artifacts, signature, watermark, username, blurry, artist name, pixels, censored,", + "Denoising strength": "0.7" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/82179" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Rem_ReZero_v1_1.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Rem_ReZero_v1_1.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..e7979c832cc3c818cb3307470592fb9ce9edffdc Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Rem_ReZero_v1_1.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Rem_ReZero_v1_1.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Rem_ReZero_v1_1.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..917979cd697e46e36a6a5c6ceb1977e506bd742b --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Rem_ReZero_v1_1.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:6ff28776ff71a3b616e17b2b23aef8bb3881e3675bcf7adc4a4ca0104daa7769 +size 18989671 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Rem_v2_FB.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Rem_v2_FB.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..54d7644f406bf4e65563e911e528ad6339fb1c5f --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Rem_v2_FB.civitai.info" @@ -0,0 +1,335 @@ +{ + "id": 117662, + "modelId": 50290, + "name": "v2.0", + "createdAt": "2023-07-14T17:54:16.389Z", + "updatedAt": "2023-07-14T18:00:40.968Z", + "trainedWords": [ + "phRem" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 192, + "ratingCount": 2, + "rating": 5 + }, + "model": { + "name": "Rem/Re:0_maid, oni\uff06chibi / B.E.S.T \u857e\u59c6", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "Rem_v2_FB.safetensors", + "id": 84127, + "sizeKB": 73858.1162109375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-07-14T18:01:07.761Z", + "hashes": { + "AutoV1": "3A5DA5AB", + "AutoV2": "92938F5AE5", + "SHA256": "92938F5AE582EE4DD5A30DAEEBB057C4C4A247B82135D6A0ACF7F77FE6FD7FE9", + "CRC32": "E6D353BD", + "BLAKE3": "FB3BFCE829D9A7C02B832D54E21C7AB216E173E35C08CE27843828B2AC3EBA1C" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/117662" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/79ac69d2-28ce-4f2d-a1d4-21a0e1707e2c/width=450/1558011.jpeg", + "nsfw": "None", + "width": 640, + "height": 832, + "hash": "UiKUvdIU.Tx].8NMs,WYtRR.n$WB%gs+V@WV", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1a791982-ca94-4390-ab22-cb4f16605e53/width=450/1556014.jpeg", + "nsfw": "None", + "width": 640, + "height": 832, + "hash": "UiKUvdIU.Tx].8NMs,WYtQR.n$WB%gs+V@WV", + "meta": { + "ENSD": "31337", + "Size": "640x832", + "seed": 1785014732, + "Model": "meinaalter_v3", + "steps": 35, + "hashes": { + "model": "ecc87bab9c" + }, + "prompt": "best quality, masterpiece, , phRem, 1girl, blue hair, solo, maid, roswaal mansion maid uniform, looking at viewer, outdoors, open mouth, anime coloring, maid headdress, upper body, light particles, light rays, wallpaper, high contrast, colorful, blue background, blue sky, sky", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "ecc87bab9c", + "name": "meinaalter_v3", + "type": "model" + } + ], + "Model hash": "ecc87bab9c", + "Variation seed": "1785014733", + "negativePrompt": "low quality, worst quality, zombie, monochrome, star \\(sky\\), sparkle,", + "Variation seed strength": "0.1" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f41bfee0-d6f6-43ce-9009-4a7e3232ebf8/width=450/1557596.jpeg", + "nsfw": "None", + "width": 640, + "height": 832, + "hash": "URLgbJ.AwXs8ESIX=^t5V=xDnOxuv{VrS7o~", + "meta": { + "ENSD": "31337", + "Size": "640x832", + "seed": 2194414103, + "Model": "meinamix_meinaV10", + "steps": 35, + "hashes": { + "model": "77b7dc4ef0" + }, + "prompt": "best quality, masterpiece, , phRem, 1girl, solo, maid, looking at viewer, smile, roswaal mansion maid uniform, blush, anime coloring, open mouth, black ribbon, maid headdress, parody, portrait, parted lips, indoors, blue hair, blue eyes, short hair, maid, hair ornament, hair over one eye, x hair ornament, hair ribbon, pink ribbon", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "77b7dc4ef0", + "name": "meinamix_meinaV10", + "type": "model" + } + ], + "Model hash": "77b7dc4ef0", + "negativePrompt": "low quality, worst quality, zombie, monochrome, teeth," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7327e6b3-afe2-438f-9efe-105a78fa4f3c/width=450/1557806.jpeg", + "nsfw": "None", + "width": 640, + "height": 832, + "hash": "UCJaftyZMa?F00EQ?An#%#xZ-Uxu-3${NgNe", + "meta": { + "ENSD": "31337", + "Size": "640x832", + "seed": 2194414103, + "Model": "majicmixRealistic_v6", + "steps": 35, + "hashes": { + "model": "e4a30e4607" + }, + "prompt": "best quality, masterpiece, , phRem, 1girl, solo, maid, looking at viewer, smile, roswaal mansion maid uniform, blush, anime coloring, open mouth, black ribbon, maid headdress, parody, portrait, parted lips, indoors, blue hair, blue eyes, short hair, maid, hair ornament, hair over one eye, x hair ornament, hair ribbon, pink ribbon", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "e4a30e4607", + "name": "majicmixRealistic_v6", + "type": "model" + } + ], + "Model hash": "e4a30e4607", + "negativePrompt": "low quality, worst quality, zombie, monochrome, teeth," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/adfc9dab-b528-4ff3-82b3-12a0489981d1/width=450/1556015.jpeg", + "nsfw": "None", + "width": 640, + "height": 832, + "hash": "U7HxQk0KO6005u00~qxH0z^*-pNF009F-WV@", + "meta": { + "ENSD": "31337", + "Size": "640x832", + "seed": 1200853734, + "Model": "meinaalter_v3", + "steps": 35, + "hashes": { + "model": "ecc87bab9c" + }, + "prompt": "best quality, masterpiece, , phRem, 1girl, solo, roswaal mansion maid uniform, maid, maid headdress, closed mouth, indoors, parody, black ribbon, anime coloring, neck ribbon, frills, upper body, curtains, looking down, sad, full body, sitting,", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "ecc87bab9c", + "name": "meinaalter_v3", + "type": "model" + } + ], + "Model hash": "ecc87bab9c", + "negativePrompt": "low quality, worst quality, zombie, monochrome" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c45601a0-3ad9-49eb-93dc-5fd4911399f1/width=450/1556019.jpeg", + "nsfw": "None", + "width": 640, + "height": 832, + "hash": "UFGSG*WD54?a19R,9EWApeIU~VogSjxEDjoz", + "meta": { + "ENSD": "31337", + "Size": "640x832", + "seed": 1290088366, + "Model": "meinaalter_v3", + "steps": 35, + "hashes": { + "model": "ecc87bab9c" + }, + "prompt": "best quality, masterpiece, , phRem, 1girl, blue hair, solo, maid, roswaal mansion maid uniform, looking at viewer, outdoors, open mouth, anime coloring, maid headdress, upper body, cloud, sky, parody, day, black ribbon, detached sleeves, blush, highres, highest quallity, illustration, cinematic light, ultra detailed, detailed face, (detailed eyes), best quality, hyper detailed, masterpiece, (detailed face), highest details, luminous eyes, medium breats, sitting in bed, sitting, bed, window, night sky, lake outside, moon, full moon, backlighting, light rays, (high contrast), (colorful),", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "ecc87bab9c", + "name": "meinaalter_v3", + "type": "model" + } + ], + "Model hash": "ecc87bab9c", + "negativePrompt": "low quality, worst quality, zombie, monochrome" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/db1e97ee-6bb4-4d80-af73-6d1b82c043f4/width=450/1556024.jpeg", + "nsfw": "None", + "width": 640, + "height": 832, + "hash": "UHF}.q~V4TI9A{EmD%RN9a%M?GROnMs-xuRn", + "meta": { + "ENSD": "31337", + "Size": "640x832", + "seed": 3373054748, + "Model": "meinaalter_v3", + "steps": 35, + "hashes": { + "model": "ecc87bab9c" + }, + "prompt": "best quality, masterpiece, , phRem, 1girl, blue hair, solo, maid, roswaal mansion maid uniform, looking at viewer, outdoors, open mouth, anime coloring, maid headdress, ((cinematic light)), colorful, hyper detail, dramatic light, intricate details, best quality, (wallpaper, masterpiece, best quality, ultra-detailed, best shadow), (detailed background:1.4), (beautiful detailed face, beautiful detailed eyes), high contrast, (best illumination, an extremely delicate and beautiful), solo, blue eyes, electric guitar, guitar, headphones, holding, holding plectrum, instrument, music, one side up, playing guiter, indoors ((caustic)), dynamic angle,beautiful detailed glow,full body, cowboy shot,", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "ecc87bab9c", + "name": "meinaalter_v3", + "type": "model" + } + ], + "Model hash": "ecc87bab9c", + "Variation seed": "3373054750", + "negativePrompt": "low quality, worst quality, zombie, monochrome", + "Variation seed strength": "0.2" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3673b2e5-9202-4fbd-b1c1-1ed71b8ad900/width=450/1556025.jpeg", + "nsfw": "None", + "width": 640, + "height": 832, + "hash": "UJF}[,~pD#D$OuNfV?sk4:RPs.WBIT$y%Mxu", + "meta": { + "ENSD": "31337", + "Size": "640x832", + "seed": 3373054749, + "Model": "meinaalter_v3", + "steps": 35, + "hashes": { + "model": "ecc87bab9c" + }, + "prompt": "best quality, masterpiece, , phRem, 1girl, blue hair, solo, maid, roswaal mansion maid uniform, looking at viewer, outdoors, open mouth, anime coloring, maid headdress, ((cinematic light)), colorful, hyper detail, dramatic light, intricate details, best quality, (wallpaper, masterpiece, best quality, ultra-detailed, best shadow), (detailed background:1.4), (beautiful detailed face, beautiful detailed eyes), high contrast, (best illumination, an extremely delicate and beautiful), solo, blue eyes, electric guitar, guitar, headphones, holding, holding plectrum, instrument, music, one side up, playing guiter, indoors ((caustic)), dynamic angle,beautiful detailed glow,full body, cowboy shot,", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "ecc87bab9c", + "name": "meinaalter_v3", + "type": "model" + } + ], + "Model hash": "ecc87bab9c", + "negativePrompt": "low quality, worst quality, zombie, monochrome" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/490f5bc0-a671-4bfe-a1db-fc7b6c69af04/width=450/1556041.jpeg", + "nsfw": "None", + "width": 640, + "height": 832, + "hash": "UZKBzhDi.T%hcHS6aJWBo}NLs8V@-;kBV?WB", + "meta": { + "ENSD": "31337", + "Size": "640x832", + "seed": 1785014734, + "Model": "meinaalter_v3", + "steps": 35, + "hashes": { + "model": "ecc87bab9c" + }, + "prompt": "best quality, masterpiece, , phRem, 1girl, blue hair, solo, maid, roswaal mansion maid uniform, looking at viewer, outdoors, open mouth, anime coloring, maid headdress, upper body, light particles, light rays, wallpaper, high contrast, colorful, blue background, blue sky, sky", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "ecc87bab9c", + "name": "meinaalter_v3", + "type": "model" + } + ], + "Model hash": "ecc87bab9c", + "negativePrompt": "low quality, worst quality, zombie, monochrome" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/815126c7-8c36-415e-9b2f-ed28326ee712/width=450/1556028.jpeg", + "nsfw": "None", + "width": 640, + "height": 832, + "hash": "UWJa7j~pn3%Lx]bv%L-;o#afk8jG9uWCozt7", + "meta": { + "ENSD": "31337", + "Size": "640x832", + "seed": 2176660560, + "Model": "meinaalter_v3", + "steps": 35, + "hashes": { + "model": "ecc87bab9c" + }, + "prompt": "best quality, masterpiece, , phRem, 1girl, solo, breasts, roswaal mansion maid uniform, maid, blush, detached sleeves, lying, looking at viewer, on side, pantyhose, frills, dress, cleavage, maid headdress, white pantyhose, medium breasts, bare shoulders, smile, closed mouth, black dress, indoors, long sleeves, frilled sleeves, frilled dress, large breasts, dutch angle, juliet sleeves, apron, hairband, black ribbon, window", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "ecc87bab9c", + "name": "meinaalter_v3", + "type": "model" + } + ], + "Model hash": "ecc87bab9c", + "negativePrompt": "low quality, worst quality, zombie, monochrome" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/117662" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Rem_v2_FB.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Rem_v2_FB.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..75eb0d62074249108eb888439fc8322f74486267 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Rem_v2_FB.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:a15254cf656e78278a06280526fa3aa9cb5fa40a383a85745220ebd524ab995f +size 2377829 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Rem_v2_FB.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Rem_v2_FB.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..ca37bdb596cb6cd860b6c8feb5cd89171e24f8a0 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/Rem_v2_FB.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:92938f5ae582ee4dd5a30daeebb057c4c4a247b82135d6a0acf7f77fe6fd7fe9 +size 75630711 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/aimiliya-10.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/aimiliya-10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..4b0be3d1612e3cefe5daf31d45b5f71cea923846 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/aimiliya-10.civitai.info" @@ -0,0 +1,333 @@ +{ + "id": 70154, + "modelId": 65509, + "name": "v1.0", + "createdAt": "2023-05-14T03:32:36.094Z", + "updatedAt": "2023-05-14T03:35:04.233Z", + "trainedWords": [ + "aimiliya" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 59, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Emiria-Re:zero-Re\uff1a\u4ece\u96f6\u5f00\u59cb\u7684\u5f02\u4e16\u754c\u751f\u6d3b-\u7231\u871c\u8389\u96c5-\u6027\u611f\u7f8e\u5973-\u30a8\u30df\u30ea\u30a2-Re\uff1a\u30bc\u30ed\u304b\u3089\u59cb\u3081\u308b\u7570\u4e16\u754c\u751f\u6d3b-\u827e\u7c73\u8389\u5a05-Emilia", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "aimiliya-10.safetensors", + "id": 48938, + "sizeKB": 18547.525390625, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-14T03:36:03.070Z", + "hashes": { + "AutoV1": "DE2F2560", + "AutoV2": "360A3E5761", + "SHA256": "360A3E5761B2251271BE0D7B58E0C012CA04AF07F9D7A95C9877CD181A02265D", + "CRC32": "69E20056", + "BLAKE3": "3837A697CBB856A7F811C44DF0488EFE1C3C9D12C83F0C7D80B098FF8E8F1DEC" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/70154" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3a935de0-5309-405f-bb82-72a9d44877b3/width=450/783497.jpeg", + "nsfw": "Soft", + "width": 512, + "height": 768, + "hash": "UZMGu8~pSwt6D%%2obIVoHoza#n~S%kCt6t7", + "meta": { + "Size": "512x768", + "seed": 881745129, + "Model": "perfectWorld_v2Baked", + "steps": 25, + "hashes": { + "model": "79e42fb744" + }, + "prompt": ",aimiliya, white dress, white skirt,cleavage, medium breasts,light smile,best quality", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6, + "resources": [ + { + "hash": "79e42fb744", + "name": "perfectWorld_v2Baked", + "type": "model" + } + ], + "Model hash": "79e42fb744", + "negativePrompt": "Easy Negative:1.4, Painting, sketches, (worst quality:2), (low quality:2), (normal quality:2), ((monochrome:)), ((grayscales)), skin spots, acne, skin blemishes, age spots, (deformity), multiple breasts, (mutated hands and fingers:1.5 ), (long body:1.3), (mutation, poorly drawn:1.2) , bad anatomy, malformed, mutated, anatomical nonsense, QR code, bar code, censored, beard, furry, mosaic, excrement, faeces, shit, extra limbs, low contrast, draft, tiling, fat, big hip, short legs:1.25, fused fingers, twisted legs, tie, belt" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/70543d84-1de3-4566-a844-e1c21e95c9ce/width=450/783495.jpeg", + "nsfw": "Soft", + "width": 512, + "height": 768, + "hash": "U6Jtl3IG00.Q0J%M00otB=%Mo~9Guh%MHqM{", + "meta": { + "Size": "512x768", + "seed": 317165562, + "Model": "perfectWorld_v2Baked", + "steps": 25, + "hashes": { + "model": "79e42fb744" + }, + "prompt": ",aimiliya, cleavage, large breasts,light smile,best quality", + "sampler": "DPM++ 2M Karras", + "cfgScale": 10, + "resources": [ + { + "hash": "79e42fb744", + "name": "perfectWorld_v2Baked", + "type": "model" + } + ], + "Model hash": "79e42fb744", + "negativePrompt": "Easy Negative:1.4, Painting, sketches, (worst quality:2), (low quality:2), (normal quality:2), ((monochrome:)), ((grayscales)), skin spots, acne, skin blemishes, age spots, (deformity), multiple breasts, (mutated hands and fingers:1.5 ), (long body:1.3), (mutation, poorly drawn:1.2) , bad anatomy, malformed, mutated, anatomical nonsense, QR code, bar code, censored, beard, furry, mosaic, excrement, faeces, shit, extra limbs, low contrast, draft, tiling, fat, big hip, short legs:1.25, fused fingers, twisted legs, tie, belt" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/28d6aeea-497d-45b6-9f1a-9dd85ad7d808/width=450/783496.jpeg", + "nsfw": "Soft", + "width": 512, + "height": 768, + "hash": "UlLWbO~VS{t7pH%LoekBxut7ogofR-R*xtWq", + "meta": { + "Size": "512x768", + "seed": 2598540582, + "Model": "perfectWorld_v2Baked", + "steps": 25, + "hashes": { + "model": "79e42fb744" + }, + "prompt": ",aimiliya, cleavage, medium breasts,light smile,best quality", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6, + "resources": [ + { + "hash": "79e42fb744", + "name": "perfectWorld_v2Baked", + "type": "model" + } + ], + "Model hash": "79e42fb744", + "negativePrompt": "Easy Negative:1.4, Painting, sketches, (worst quality:2), (low quality:2), (normal quality:2), ((monochrome:)), ((grayscales)), skin spots, acne, skin blemishes, age spots, (deformity), multiple breasts, (mutated hands and fingers:1.5 ), (long body:1.3), (mutation, poorly drawn:1.2) , bad anatomy, malformed, mutated, anatomical nonsense, QR code, bar code, censored, beard, furry, mosaic, excrement, faeces, shit, extra limbs, low contrast, draft, tiling, fat, big hip, short legs:1.25, fused fingers, twisted legs, tie, belt" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/63f3b8ef-faf0-421a-ad71-450994d7258e/width=450/783501.jpeg", + "nsfw": "Soft", + "width": 512, + "height": 768, + "hash": "UULg9K~VNY?H~p%LWAbI9uNGWBozt7WBn$t7", + "meta": { + "Size": "512x768", + "seed": 3416229862, + "Model": "perfectWorld_v2Baked", + "steps": 25, + "hashes": { + "model": "79e42fb744" + }, + "prompt": ",aimiliya, nightgown,cleavage, medium breasts,light smile,best quality", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6, + "resources": [ + { + "hash": "79e42fb744", + "name": "perfectWorld_v2Baked", + "type": "model" + } + ], + "Model hash": "79e42fb744", + "negativePrompt": "Easy Negative:1.4, Painting, sketches, (worst quality:2), (low quality:2), (normal quality:2), ((monochrome:)), ((grayscales)), skin spots, acne, skin blemishes, age spots, (deformity), multiple breasts, (mutated hands and fingers:1.5 ), (long body:1.3), (mutation, poorly drawn:1.2) , bad anatomy, malformed, mutated, anatomical nonsense, QR code, bar code, censored, beard, furry, mosaic, excrement, faeces, shit, extra limbs, low contrast, draft, tiling, fat, big hip, short legs:1.25, fused fingers, twisted legs, tie, belt" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/eb1d5446-56e5-4ec5-ba2a-09d0a4bfbe24/width=450/783506.jpeg", + "nsfw": "Soft", + "width": 512, + "height": 768, + "hash": "UPLf{.-pXe~p?v%1bHS#NLM|IURPohIVMxs:", + "meta": { + "Size": "512x768", + "seed": 3416229863, + "Model": "perfectWorld_v2Baked", + "steps": 25, + "hashes": { + "model": "79e42fb744" + }, + "prompt": ",aimiliya, looking back, from behind, bra, window, underwear only,cleavage, medium breasts,light smile,best quality", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6, + "resources": [ + { + "hash": "79e42fb744", + "name": "perfectWorld_v2Baked", + "type": "model" + } + ], + "Model hash": "79e42fb744", + "negativePrompt": "Easy Negative:1.4, Painting, sketches, (worst quality:2), (low quality:2), (normal quality:2), ((monochrome:)), ((grayscales)), skin spots, acne, skin blemishes, age spots, (deformity), multiple breasts, (mutated hands and fingers:1.5 ), (long body:1.3), (mutation, poorly drawn:1.2) , bad anatomy, malformed, mutated, anatomical nonsense, QR code, bar code, censored, beard, furry, mosaic, excrement, faeces, shit, extra limbs, low contrast, draft, tiling, fat, big hip, short legs:1.25, fused fingers, twisted legs, tie, belt" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a833697a-e79d-493f-b361-32e1ff704a71/width=450/783508.jpeg", + "nsfw": "Soft", + "width": 512, + "height": 768, + "hash": "U9Iqcg0000^m9=00?H~W9Zf7r^M|0gM_-..7", + "meta": { + "Size": "512x768", + "seed": 3416229864, + "Model": "perfectWorld_v2Baked", + "steps": 25, + "hashes": { + "model": "79e42fb744" + }, + "prompt": "purple dress,,aimiliya,cleavage, medium breasts,light smile,best quality", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6, + "resources": [ + { + "hash": "79e42fb744", + "name": "perfectWorld_v2Baked", + "type": "model" + } + ], + "Model hash": "79e42fb744", + "negativePrompt": "Easy Negative:1.4, Painting, sketches, (worst quality:2), (low quality:2), (normal quality:2), ((monochrome:)), ((grayscales)), skin spots, acne, skin blemishes, age spots, (deformity), multiple breasts, (mutated hands and fingers:1.5 ), (long body:1.3), (mutation, poorly drawn:1.2) , bad anatomy, malformed, mutated, anatomical nonsense, QR code, bar code, censored, beard, furry, mosaic, excrement, faeces, shit, extra limbs, low contrast, draft, tiling, fat, big hip, short legs:1.25, fused fingers, twisted legs, tie, belt" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/15d08904-25e7-4713-aa58-c648826268f3/width=450/783510.jpeg", + "nsfw": "Soft", + "width": 512, + "height": 768, + "hash": "UPJao}00B.xs?^9E?bIToNShxHt7V=N2ROWZ", + "meta": { + "Size": "512x768", + "seed": 3416229864, + "Model": "perfectWorld_v2Baked", + "steps": 25, + "hashes": { + "model": "79e42fb744" + }, + "prompt": "(wet_micro bikini:1.2),,aimiliya,cleavage, medium breasts,light smile,best quality", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6, + "resources": [ + { + "hash": "79e42fb744", + "name": "perfectWorld_v2Baked", + "type": "model" + } + ], + "Model hash": "79e42fb744", + "negativePrompt": "Easy Negative:1.4, Painting, sketches, (worst quality:2), (low quality:2), (normal quality:2), ((monochrome:)), ((grayscales)), skin spots, acne, skin blemishes, age spots, (deformity), multiple breasts, (mutated hands and fingers:1.5 ), (long body:1.3), (mutation, poorly drawn:1.2) , bad anatomy, malformed, mutated, anatomical nonsense, QR code, bar code, censored, beard, furry, mosaic, excrement, faeces, shit, extra limbs, low contrast, draft, tiling, fat, big hip, short legs:1.25, fused fingers, twisted legs, tie, belt" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/cce99c0a-4d18-41c1-a79e-f973ceb95754/width=450/783512.jpeg", + "nsfw": "Soft", + "width": 512, + "height": 768, + "hash": "U6GI4Y9i00~ptm~V0000-oIT00NF00?b~qDj", + "meta": { + "Size": "512x768", + "seed": 1077724857, + "Model": "perfectWorld_v2Baked", + "steps": 25, + "hashes": { + "model": "79e42fb744" + }, + "prompt": "(transparent_gothic:1.2),,aimiliya,cleavage, medium breasts,light smile,best quality", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6, + "resources": [ + { + "hash": "79e42fb744", + "name": "perfectWorld_v2Baked", + "type": "model" + } + ], + "Model hash": "79e42fb744", + "negativePrompt": "Easy Negative:1.4, Painting, sketches, (worst quality:2), (low quality:2), (normal quality:2), ((monochrome:)), ((grayscales)), skin spots, acne, skin blemishes, age spots, (deformity), multiple breasts, (mutated hands and fingers:1.5 ), (long body:1.3), (mutation, poorly drawn:1.2) , bad anatomy, malformed, mutated, anatomical nonsense, QR code, bar code, censored, beard, furry, mosaic, excrement, faeces, shit, extra limbs, low contrast, draft, tiling, fat, big hip, short legs:1.25, fused fingers, twisted legs, tie, belt" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5fa072c5-9bb7-4e8c-a37d-aeeaa191b3c3/width=450/783511.jpeg", + "nsfw": "Soft", + "width": 512, + "height": 768, + "hash": "UIJaTK-o4,~W?tRj%g?HS0E39uD*I;s9Z~bb", + "meta": { + "Size": "512x768", + "seed": 1964132690, + "Model": "perfectWorld_v2Baked", + "steps": 25, + "hashes": { + "model": "79e42fb744" + }, + "prompt": "(transparent_kindergarten uniform:1.2),,aimiliya,cleavage, medium breasts,light smile,best quality", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6, + "resources": [ + { + "hash": "79e42fb744", + "name": "perfectWorld_v2Baked", + "type": "model" + } + ], + "Model hash": "79e42fb744", + "negativePrompt": "Easy Negative:1.4, Painting, sketches, (worst quality:2), (low quality:2), (normal quality:2), ((monochrome:)), ((grayscales)), skin spots, acne, skin blemishes, age spots, (deformity), multiple breasts, (mutated hands and fingers:1.5 ), (long body:1.3), (mutation, poorly drawn:1.2) , bad anatomy, malformed, mutated, anatomical nonsense, QR code, bar code, censored, beard, furry, mosaic, excrement, faeces, shit, extra limbs, low contrast, draft, tiling, fat, big hip, short legs:1.25, fused fingers, twisted legs, tie, belt" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/26dbb752-d735-4812-b55b-e28f3a8afdfd/width=450/783498.jpeg", + "nsfw": "Soft", + "width": 512, + "height": 768, + "hash": "UWJ*I~~V0KD*IAo0WAWAM_t7afRjtlxaxZt7", + "meta": { + "Size": "512x768", + "seed": 1331591900, + "Model": "perfectWorld_v2Baked", + "steps": 25, + "hashes": { + "model": "79e42fb744" + }, + "prompt": ",aimiliya, white skirt,cleavage, medium breasts,light smile,best quality", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6, + "resources": [ + { + "hash": "79e42fb744", + "name": "perfectWorld_v2Baked", + "type": "model" + } + ], + "Model hash": "79e42fb744", + "negativePrompt": "Easy Negative:1.4, Painting, sketches, (worst quality:2), (low quality:2), (normal quality:2), ((monochrome:)), ((grayscales)), skin spots, acne, skin blemishes, age spots, (deformity), multiple breasts, (mutated hands and fingers:1.5 ), (long body:1.3), (mutation, poorly drawn:1.2) , bad anatomy, malformed, mutated, anatomical nonsense, QR code, bar code, censored, beard, furry, mosaic, excrement, faeces, shit, extra limbs, low contrast, draft, tiling, fat, big hip, short legs:1.25, fused fingers, twisted legs, tie, belt" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/70154" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/aimiliya-10.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/aimiliya-10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..87f3a66149876b5e50883237bc5688b0867e414e Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/aimiliya-10.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/aimiliya-10.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/aimiliya-10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..9ca32846af17ed6b15444e8c007b35de7390ef49 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/aimiliya-10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:360a3e5761b2251271be0d7b58e0c012ca04af07f9d7a95c9877cd181a02265d +size 18992666 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/elsaGranhiertReZero_v10.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/elsaGranhiertReZero_v10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..1c6aa7940a69cfff2248e06dd2b115f4443a1e1a --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/elsaGranhiertReZero_v10.civitai.info" @@ -0,0 +1,371 @@ +{ + "id": 16345, + "modelId": 13889, + "name": "V1.0", + "createdAt": "2023-02-27T19:23:44.120Z", + "updatedAt": "2023-02-28T07:52:14.240Z", + "trainedWords": [ + "elsagranhiert" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "model": { + "name": "Elsa Granhiert (Re:Zero)", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "elsaGranhiertReZero_v10.safetensors", + "id": 13844, + "sizeKB": 73843.0244140625, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-02-27T19:26:05.141Z", + "hashes": { + "AutoV1": "22617B5D", + "AutoV2": "45F79DF6EC", + "SHA256": "45F79DF6ECB3A474F13C77C795774A8765A901EC57726D350840F473E3D50CB0", + "CRC32": "8719C2BA", + "BLAKE3": "A3889C21273A20A35FFE6D9AE895474E72C08A75F7424D100154232FFD9E8AC2" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/16345" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d5e800e0-b1d3-4f50-c46d-767244c5bf00/width=450/164763.jpeg", + "nsfw": true, + "width": 768, + "height": 768, + "hash": "UQFh@w-p.8yD~qaK%M%N?b9Ft6xt?I9FRjs:", + "meta": { + "ENSD": "31337", + "Size": "768x768", + "seed": 4042713196, + "Model": "mightycorneoGoodModel_bloodsplashsMix", + "steps": 28, + "prompt": ", ElsaGranhiert, 1girl, black hair, solo, black cloak, fur-trim, navel, two-sided fabric, black dress, purple_eyes, long_hair, brown_pantyhose, bridal_gauntlets, blood_on_face, licking_lips, tongue", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 11.5, + "Clip skip": "2", + "resources": [ + { + "name": "ElsaGranhiert", + "type": "lora", + "weight": 1 + }, + { + "hash": "517d63f73e", + "name": "mightycorneoGoodModel_bloodsplashsMix", + "type": "model" + } + ], + "Model hash": "517d63f73e", + "negativePrompt": "(sketch by bad-artist-anime:0.9), (painting by bad-artist:0.9), (bad-hands:0.9), (bad_prompt:0.5), watermark, text, error, blurry, jpeg artifacts, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, artist name, (worst quality, low quality:1.4), bad anatomy, greyscale, monochrome, lowres, bad proportions, bad hands, multiple arms, multiple legs, deformed, text, error, missing fingers, extra fingers, extra digit, extra limb, extra nipple, extra breast, missing limb, floating limbs, disconnected limbs, severed, dismembered, corpse, malformed hands, long neck, long body, fewer digits, deformed, disfigured, amputee, mutated, mutation, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, artist name, (((censored))), fat, long body, poorly drawn face, ((futa))," + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7e25e305-32bb-4f84-2cb2-19b7682cfc00/width=450/164779.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UpHfS9xu.mS4TwayELR*S#ays:t6NaWBs:t7", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 4042713196, + "Model": "mightycorneoGoodModel_bloodsplashsMix", + "steps": 28, + "prompt": ", ElsaGranhiert, 1girl, black hair, solo, cloak, breasts, pantyhose, flower, hair ornament, purple eyes, navel, two-sided fabric, black cloak, hair flower, mole, smile, dress, bridal gauntlets, large breasts, looking at viewer, full body, mole under eye, long hair, cleavage, center opening, high heels, black footwear, braid, standing, hand on hip, cape, gloves, brown pantyhose, watson cross, elbow gloves, fur trim, bangs, pelvic curtain", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 11.5, + "Clip skip": "2", + "resources": [ + { + "name": "ElsaGranhiert", + "type": "lora", + "weight": 1 + }, + { + "hash": "517d63f73e", + "name": "mightycorneoGoodModel_bloodsplashsMix", + "type": "model" + } + ], + "Model hash": "517d63f73e", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(sketch by bad-artist-anime:0.9), (painting by bad-artist:0.9), (bad-hands:0.9), (bad_prompt:0.5), watermark, text, error, blurry, jpeg artifacts, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, artist name, (worst quality, low quality:1.4), bad anatomy, greyscale, monochrome, lowres, bad proportions, bad hands, multiple arms, multiple legs, deformed, text, error, missing fingers, extra fingers, extra digit, extra limb, extra nipple, extra breast, missing limb, floating limbs, disconnected limbs, severed, dismembered, corpse, malformed hands, long neck, long body, fewer digits, deformed, disfigured, amputee, mutated, mutation, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, artist name, (((censored))), fat, long body, poorly drawn face, ((futa)), jacket, track_jacket, open_jacket, open_shirt, zipper, skirt,", + "Denoising strength": "0.6" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8d606c42-87ba-4fe6-ae4d-e6293fa22600/width=450/164778.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UEDuxl~B9sxst7M{V=NF0LE2%M%MS0xa-p-o", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 4042713196, + "Model": "mightycorneoGoodModel_bloodsplashsMix", + "steps": 28, + "prompt": ", ElsaGranhiert, 1girl, black hair, solo, cloak, fur-trim, navel, two-sided fabric, black dress, purple_eyes, brown_pantyhose, long_hair, from_behind, back", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 11.5, + "Clip skip": "2", + "resources": [ + { + "name": "ElsaGranhiert", + "type": "lora", + "weight": 1 + }, + { + "hash": "517d63f73e", + "name": "mightycorneoGoodModel_bloodsplashsMix", + "type": "model" + } + ], + "Model hash": "517d63f73e", + "negativePrompt": "(sketch by bad-artist-anime:0.9), (painting by bad-artist:0.9), (bad-hands:0.9), (bad_prompt:0.5), watermark, text, error, blurry, jpeg artifacts, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, artist name, (worst quality, low quality:1.4), bad anatomy, greyscale, monochrome, lowres, bad proportions, bad hands, multiple arms, multiple legs, deformed, text, error, missing fingers, extra fingers, extra digit, extra limb, extra nipple, extra breast, missing limb, floating limbs, disconnected limbs, severed, dismembered, corpse, malformed hands, long neck, long body, fewer digits, deformed, disfigured, amputee, mutated, mutation, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, artist name, (((censored))), fat, long body, poorly drawn face, ((futa)), jacket, track_jacket, open_jacket, open_shirt, zipper, skirt," + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/868afdea-5f53-46c0-2a37-83f133c04800/width=450/164777.jpeg", + "nsfw": true, + "width": 768, + "height": 768, + "hash": "U58zP.~VI.D$^k^lxVE2WU-o%1R+xBInxu?G", + "meta": { + "ENSD": "31337", + "Size": "768x768", + "seed": 4042713196, + "Model": "mightycorneoGoodModel_bloodsplashsMix", + "steps": 28, + "prompt": ", ElsaGranhiert, 1girl, black hair, solo, black cloak, fur-trim, navel, two-sided fabric, black dress, purple_eyes, long_hair, brown_pantyhose, bridal_gauntlets, holding, knife, weapon", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 11.5, + "Clip skip": "2", + "resources": [ + { + "name": "ElsaGranhiert", + "type": "lora", + "weight": 1 + }, + { + "hash": "517d63f73e", + "name": "mightycorneoGoodModel_bloodsplashsMix", + "type": "model" + } + ], + "Model hash": "517d63f73e", + "negativePrompt": "(sketch by bad-artist-anime:0.9), (painting by bad-artist:0.9), (bad-hands:0.9), (bad_prompt:0.5), watermark, text, error, blurry, jpeg artifacts, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, artist name, (worst quality, low quality:1.4), bad anatomy, greyscale, monochrome, lowres, bad proportions, bad hands, multiple arms, multiple legs, deformed, text, error, missing fingers, extra fingers, extra digit, extra limb, extra nipple, extra breast, missing limb, floating limbs, disconnected limbs, severed, dismembered, corpse, malformed hands, long neck, long body, fewer digits, deformed, disfigured, amputee, mutated, mutation, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, artist name, (((censored))), fat, long body, poorly drawn face, ((futa))," + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/59307169-2047-4761-cc26-cabae52eb400/width=450/164776.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UUFrhjxa%gR+~qoekCRkIoazaexaRkWBxuxa", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 4042713196, + "Model": "mightycorneoGoodModel_bloodsplashsMix", + "steps": 28, + "prompt": ", ElsaGranhiert, 1girl, black hair, solo, cloak, fur-trim, navel, two-sided fabric, dress, purple_eyes", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 11.5, + "Clip skip": "2", + "resources": [ + { + "name": "ElsaGranhiert", + "type": "lora", + "weight": 1 + }, + { + "hash": "517d63f73e", + "name": "mightycorneoGoodModel_bloodsplashsMix", + "type": "model" + } + ], + "Model hash": "517d63f73e", + "negativePrompt": "(sketch by bad-artist-anime:0.9), (painting by bad-artist:0.9), (bad-hands:0.9), (bad_prompt:0.5), watermark, text, error, blurry, jpeg artifacts, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, artist name, (worst quality, low quality:1.4), bad anatomy, greyscale, monochrome, lowres, bad proportions, bad hands, multiple arms, multiple legs, deformed, text, error, missing fingers, extra fingers, extra digit, extra limb, extra nipple, extra breast, missing limb, floating limbs, disconnected limbs, severed, dismembered, corpse, malformed hands, long neck, long body, fewer digits, deformed, disfigured, amputee, mutated, mutation, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, artist name, (((censored))), fat, long body, poorly drawn face, ((futa)), jacket, track_jacket, open_jacket, open_shirt, zipper, skirt," + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6247cc67-d36e-4452-ec15-01155864f200/width=450/164775.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UxJavJ%M?bxu~qax%MR*kCM{s:oLWUozoexu", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 4042713196, + "Model": "mightycorneoGoodModel_bloodsplashsMix", + "steps": 28, + "prompt": ", ElsaGranhiert, 1girl, black hair, solo, black cloak, fur-trim, navel, two-sided fabric, black dress, purple_eyes, long_hair, brown_pantyhose, bridal_gauntlets", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 11.5, + "Clip skip": "2", + "resources": [ + { + "name": "ElsaGranhiert", + "type": "lora", + "weight": 1 + }, + { + "hash": "517d63f73e", + "name": "mightycorneoGoodModel_bloodsplashsMix", + "type": "model" + } + ], + "Model hash": "517d63f73e", + "negativePrompt": "(sketch by bad-artist-anime:0.9), (painting by bad-artist:0.9), (bad-hands:0.9), (bad_prompt:0.5), watermark, text, error, blurry, jpeg artifacts, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, artist name, (worst quality, low quality:1.4), bad anatomy, greyscale, monochrome, lowres, bad proportions, bad hands, multiple arms, multiple legs, deformed, text, error, missing fingers, extra fingers, extra digit, extra limb, extra nipple, extra breast, missing limb, floating limbs, disconnected limbs, severed, dismembered, corpse, malformed hands, long neck, long body, fewer digits, deformed, disfigured, amputee, mutated, mutation, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, artist name, (((censored))), fat, long body, poorly drawn face, ((futa))," + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a8ebbc96-bdb6-4fd2-8d4f-d2009d421f00/width=450/164774.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "U8BygX-q00IW~VxU4-570fRk?H^k00M|-;?G", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 4042713196, + "Model": "mightycorneoGoodModel_bloodsplashsMix", + "steps": 28, + "prompt": ", ElsaGranhiert, 1girl, black hair, solo, black cloak, fur-trim, navel, two-sided fabric, black dress, purple_eyes, long_hair, brown_pantyhose, bridal_gauntlets, blood, holding, knife, weapon", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 11.5, + "Clip skip": "2", + "resources": [ + { + "name": "ElsaGranhiert", + "type": "lora", + "weight": 1 + }, + { + "hash": "517d63f73e", + "name": "mightycorneoGoodModel_bloodsplashsMix", + "type": "model" + } + ], + "Model hash": "517d63f73e", + "negativePrompt": "(sketch by bad-artist-anime:0.9), (painting by bad-artist:0.9), (bad-hands:0.9), (bad_prompt:0.5), watermark, text, error, blurry, jpeg artifacts, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, artist name, (worst quality, low quality:1.4), bad anatomy, greyscale, monochrome, lowres, bad proportions, bad hands, multiple arms, multiple legs, deformed, text, error, missing fingers, extra fingers, extra digit, extra limb, extra nipple, extra breast, missing limb, floating limbs, disconnected limbs, severed, dismembered, corpse, malformed hands, long neck, long body, fewer digits, deformed, disfigured, amputee, mutated, mutation, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, artist name, (((censored))), fat, long body, poorly drawn face, ((futa))," + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/49d2b714-3d63-432a-7a32-871d55401d00/width=450/164773.jpeg", + "nsfw": false, + "width": 768, + "height": 768, + "hash": "UVF5,J?b%g%g~qt7oy%N?bIoWBxa%ME1Rjxt", + "meta": { + "ENSD": "31337", + "Size": "768x768", + "seed": 4042713196, + "Model": "mightycorneoGoodModel_bloodsplashsMix", + "steps": 28, + "prompt": ", ElsaGranhiert, 1girl, black hair, solo, black cloak, fur-trim, navel, two-sided fabric, black dress, purple_eyes, long_hair, brown_pantyhose, bridal_gauntlets, blood, holding, knife, weapon", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 11.5, + "Clip skip": "2", + "resources": [ + { + "name": "ElsaGranhiert", + "type": "lora", + "weight": 1 + }, + { + "hash": "517d63f73e", + "name": "mightycorneoGoodModel_bloodsplashsMix", + "type": "model" + } + ], + "Model hash": "517d63f73e", + "negativePrompt": "(sketch by bad-artist-anime:0.9), (painting by bad-artist:0.9), (bad-hands:0.9), (bad_prompt:0.5), watermark, text, error, blurry, jpeg artifacts, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, artist name, (worst quality, low quality:1.4), bad anatomy, greyscale, monochrome, lowres, bad proportions, bad hands, multiple arms, multiple legs, deformed, text, error, missing fingers, extra fingers, extra digit, extra limb, extra nipple, extra breast, missing limb, floating limbs, disconnected limbs, severed, dismembered, corpse, malformed hands, long neck, long body, fewer digits, deformed, disfigured, amputee, mutated, mutation, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, artist name, (((censored))), fat, long body, poorly drawn face, ((futa))," + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d893415d-fffe-4bd7-ee54-1f0506055100/width=450/164772.jpeg", + "nsfw": false, + "width": 768, + "height": 768, + "hash": "UCAm0c~V9t0L^jxtR*M|IoNHt6%19aE2s;={", + "meta": { + "ENSD": "31337", + "Size": "768x768", + "seed": 4042713196, + "Model": "mightycorneoGoodModel_bloodsplashsMix", + "steps": 28, + "prompt": ", ElsaGranhiert, 1girl, black hair, solo, licking_lips, close-up, eyes_focus, detailed eyes, detailed mouth, purple_eyes, long_hair, bridal_gauntlets, touching_face, blood_on_face,", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 10, + "Clip skip": "2", + "resources": [ + { + "name": "ElsaGranhiert", + "type": "lora", + "weight": 1 + }, + { + "hash": "517d63f73e", + "name": "mightycorneoGoodModel_bloodsplashsMix", + "type": "model" + } + ], + "Model hash": "517d63f73e", + "negativePrompt": "(sketch by bad-artist-anime:0.9), (painting by bad-artist:0.9), (bad-hands:0.9), (bad_prompt:0.5), watermark, text, error, blurry, jpeg artifacts, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, artist name, (worst quality, low quality:1.4), bad anatomy, greyscale, monochrome, lowres, bad proportions, bad hands, multiple arms, multiple legs, deformed, text, error, missing fingers, extra fingers, extra digit, extra limb, extra nipple, extra breast, missing limb, floating limbs, disconnected limbs, severed, dismembered, corpse, malformed hands, long neck, long body, fewer digits, deformed, disfigured, amputee, mutated, mutation, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, artist name, (((censored))), fat, long body, poorly drawn face, ((futa))," + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/993ae2e7-ec42-45b0-15db-ecb1d94d4b00/width=450/164771.jpeg", + "nsfw": true, + "width": 768, + "height": 768, + "hash": "UGC$TK~V4.0LE1NGxtxtj?xt%2R*xuR-NGxY", + "meta": { + "ENSD": "31337", + "Size": "768x768", + "seed": 4042713196, + "Model": "mightycorneoGoodModel_bloodsplashsMix", + "steps": 28, + "prompt": ", ElsaGranhiert, 1girl, black hair, solo, licking_lips, tongue, close-up, detailed eyes, detailed mouth, sexy tongue, purple_eyes, long_hair, bridal_gauntlets, touching_face, blood_on_face,", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 11.5, + "Clip skip": "2", + "resources": [ + { + "name": "ElsaGranhiert", + "type": "lora", + "weight": 1 + }, + { + "hash": "517d63f73e", + "name": "mightycorneoGoodModel_bloodsplashsMix", + "type": "model" + } + ], + "Model hash": "517d63f73e", + "negativePrompt": "(sketch by bad-artist-anime:0.9), (painting by bad-artist:0.9), (bad-hands:0.9), (bad_prompt:0.5), watermark, text, error, blurry, jpeg artifacts, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, artist name, (worst quality, low quality:1.4), bad anatomy, greyscale, monochrome, lowres, bad proportions, bad hands, multiple arms, multiple legs, deformed, text, error, missing fingers, extra fingers, extra digit, extra limb, extra nipple, extra breast, missing limb, floating limbs, disconnected limbs, severed, dismembered, corpse, malformed hands, long neck, long body, fewer digits, deformed, disfigured, amputee, mutated, mutation, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, artist name, (((censored))), fat, long body, poorly drawn face, ((futa))," + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/16345" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/elsaGranhiertReZero_v10.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/elsaGranhiertReZero_v10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..f2ba053ba8f6f393f8ef68e85024f334e0757409 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/elsaGranhiertReZero_v10.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/elsaGranhiertReZero_v10.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/elsaGranhiertReZero_v10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..2940e741579ae88d6729630e15c35cd5592b8d80 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/elsaGranhiertReZero_v10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:45f79df6ecb3a474f13c77c795774a8765a901ec57726d350840f473e3d50cb0 +size 75615257 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/elsaGranhilteReZero_v10.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/elsaGranhilteReZero_v10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..82b1e7e83567468eb1cb58c7711fc5df23f6bfc4 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/elsaGranhilteReZero_v10.civitai.info" @@ -0,0 +1,216 @@ +{ + "id": 25682, + "modelId": 21531, + "name": "v1.0", + "createdAt": "2023-03-19T14:27:47.104Z", + "updatedAt": "2023-03-20T03:23:37.127Z", + "trainedWords": [ + "elsa granhilte" + ], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": "

black cloak removed by default, you can revoke the cloak by tags like \"black cloak\", \"black cape\"

other tags you may find useful:

black cloak, red cloak, two-sided cloak

strapless dress, backless outfit

single braid, purple rose

purple eyes

pantyhose,

black elbow gloves

", + "model": { + "name": "Elsa Granhilte - Re:zero", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "elsaGranhilteReZero_v10.safetensors", + "id": 21323, + "sizeKB": 9330.4697265625, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-03-19T14:31:16.746Z", + "hashes": { + "AutoV1": "2091C748", + "AutoV2": "8B41436A0F", + "SHA256": "8B41436A0F6F5531EF4E64C4B466059FF6576B9CCB41944FB104AA2A1B90252A", + "CRC32": "967BDB3F", + "BLAKE3": "DB7E5900909D57FA3731ECDC5AF0A6FF76B7F7FB5E72BDADABA36C319FE35FC0" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/25682" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/78257a6d-d2e5-40a1-d12d-ccd8c5250900/width=450/282317.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "USHBVyxH9vxv.TWBxtxupKM{tRt7pJj[W?NH", + "meta": { + "Size": "512x768", + "seed": 2291965158, + "steps": 20, + "prompt": "1girl, solo focus, dress, breasts, cleavage, elsa granhilte, buildings, street", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "resources": [ + { + "name": "ReZeroElsa", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1)" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/58bca398-942b-4b9f-53d8-ddfd897b6700/width=450/282323.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UcIhEZH=V@%M_NVrnhkWT0s:s:aeS$R*WBof", + "meta": { + "Size": "512x768", + "seed": 3943854380, + "steps": 20, + "prompt": "1girl, solo focus, dress, breasts, cleavage, elsa granhilte, buildings, street", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "resources": [ + { + "name": "ReZeroElsa", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1)" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3f085d66-18c1-4941-b5f0-c3b1a39b0b00/width=450/282322.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UgI#fZS6yD%M~qOFozxuxuRjxaozXTWXn~V@", + "meta": { + "Size": "512x768", + "seed": 105699256, + "steps": 20, + "prompt": "1girl, solo focus, dress, breasts, elsa granhilte, buildings, street", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "resources": [ + { + "name": "ReZeroElsa", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1)" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8f7c089a-d476-4b03-684d-6e6534fe0900/width=450/282321.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UGHeIO4T0,~CyrU^S}EM5pR5?HIVOWEMoaWA", + "meta": { + "Size": "512x768", + "seed": 1030632144, + "steps": 20, + "prompt": "1girl, solo focus, dress, breasts, cleavage, elsa granhilte", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "resources": [ + { + "name": "ReZeroElsa", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1)" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e41f8710-0f82-486d-ce3f-73a60199d400/width=450/282320.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "ULJ@LK~AOYnh%L?Gn$NG9aaJ?G$%x]xF%2R*", + "meta": { + "Size": "512x768", + "seed": 1873959451, + "steps": 20, + "prompt": "1girl, solo focus, dress, breasts, cleavage, single braid, elsa granhilte", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "resources": [ + { + "name": "ReZeroElsa", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1)" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/72e9e818-ba66-42fe-ea95-14ccdf31bf00/width=450/282319.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UIH-x_00KQ~V00?b4noI9ts:?HogM{ofRPRj", + "meta": { + "Size": "512x768", + "seed": 3066615348, + "steps": 20, + "prompt": "1girl, solo focus, black cloak, dress, breasts, cleavage, single braid, elsa granhilte", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "resources": [ + { + "name": "ReZeroElsa", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1)" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b18f20ad-bace-4af7-29ca-9f4a161b3700/width=450/282318.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UbJ@LD0Ltk$$~VM{xtjEIUxa%2WBIoW=t6oM", + "meta": { + "Size": "512x768", + "seed": 4109007926, + "steps": 20, + "prompt": "1girl, solo focus, dress, breasts, cleavage, nipples, navel, elsa granhilte", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "resources": [ + { + "name": "ReZeroElsa", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1)" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/25682" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/elsaGranhilteReZero_v10.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/elsaGranhilteReZero_v10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..9a8a2d3c7976259256e797c11532305877bf8426 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/elsaGranhilteReZero_v10.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/elsaGranhilteReZero_v10.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/elsaGranhilteReZero_v10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..7942075ac7a474e1c76fea05c37d851525d2e621 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/elsaGranhilteReZero_v10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:8b41436a0f6f5531ef4e64c4b466059ff6576b9ccb41944fb104aa2a1b90252a +size 9554401 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/emiliatest.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/emiliatest.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..a1d7ee31b240529edbe1d2e62751f294b62b0683 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/emiliatest.civitai.info" @@ -0,0 +1,377 @@ +{ + "id": 106373, + "modelId": 99400, + "name": "v1.0", + "createdAt": "2023-06-29T05:24:53.324Z", + "updatedAt": "2023-06-29T05:26:08.674Z", + "trainedWords": [ + "emilia, braid, crown braid, flower, hair flower, hair ornament, hair ribbon, long hair, pointy ears, (purple eyes:1.2), white hair, x hair ornament,", + "detached collar, detached sleeves, frilled sleeves, frills, long sleeves, miniskirt, pleated skirt, ribbon, skirt, thighhighs, white skirt, white sleeves, white thighhighs, wide sleeves, zettai ryouiki", + "alternate costume, cardigan, open cardigan, open clothes, sailor collar, school uniform, scrunchie, serafuku, sleeves past elbows, wrist scrunchie," + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 46, + "ratingCount": 1, + "rating": 5 + }, + "model": { + "name": "Emilia - Re:Zero", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "emiliatest.safetensors", + "id": 74893, + "sizeKB": 37060.2197265625, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-29T05:30:44.033Z", + "hashes": { + "AutoV1": "0F5EAA44", + "AutoV2": "343D8FB86F", + "SHA256": "343D8FB86F8D06BBF2B52D43A64507147B1D1746386C1FE3BDDEE739846AE776", + "CRC32": "41DE7150", + "BLAKE3": "1C4BB661B714DB23708C7AA4275038EF17076C22334A4F7CB41479B9F3B5FD6C" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/106373" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/22888115-d82d-4bc4-97c1-d27def15f9d1/width=450/1330410.jpeg", + "nsfw": "Soft", + "width": 600, + "height": 896, + "hash": "U6G*ma0000%e_G-X00~Vx^^lE255.8-;00E0", + "meta": { + "Size": "200x300", + "seed": 1676989015, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "rezeroemilia, , emilia, braid, crown braid, flower, hair flower, hair ornament, hair ribbon, long hair, low-tied long hair, (purple eyes:1.2), pointy ears, white flower, x hair ornament,\nBREAK bare shoulders, detached collar, dress, long sleeves, low-tied long hair, navel, pink dress, shoulder cutout, thigh gap, wide sleeves,\nBREAK outdoors, city,\nBREAK looking at viewer, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "emiliatest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "\"emiliatest": "02e9e6d5ad1e", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e2563534-4214-4a28-9856-b2689cc76859/width=450/1330412.jpeg", + "nsfw": "Soft", + "width": 600, + "height": 896, + "hash": "UHJ@Ro009D%J~AV[xYtRocM|IoxtI@IqM{R%", + "meta": { + "Size": "200x300", + "seed": 649911778, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "rezeroemilia, , emilia, braid, crown braid, flower, hair flower, hair ornament, hair ribbon, long hair, pointy ears, (purple eyes:1.2), white hair, x hair ornament,\nBREAK detached collar, detached sleeves, frilled sleeves, frills, long sleeves, miniskirt, pleated skirt, ribbon, skirt, thighhighs, white skirt, white sleeves, white thighhighs, wide sleeves, zettai ryouiki,\nBREAK outdoors, city,\nBREAK looking at viewer, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "emiliatest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "\"emiliatest": "02e9e6d5ad1e", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/30385884-55fc-4a30-a736-4483197b1e08/width=450/1330404.jpeg", + "nsfw": "None", + "width": 600, + "height": 896, + "hash": "UYJ@Ro4.t0%2~UsqxsxaxsjJxta{%MWBWAt6", + "meta": { + "Size": "200x300", + "seed": 883073862, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "rezeroemilia, , emilia, braid, crown braid, flower, hair flower, hair ornament, hair ribbon, long hair, low-tied long hair, (purple eyes:1.2), pointy ears, white flower, x hair ornament,\nBREAK alternate costume, cardigan, open cardigan, open clothes, sailor collar, school uniform, scrunchie, serafuku, sleeves past elbows, wrist scrunchie,\nBREAK outdoors, classroom,\nBREAK looking at viewer, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "emiliatest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "\"emiliatest": "02e9e6d5ad1e", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6fb08c2b-f796-44a5-9dc1-90c5e4125184/width=450/1330403.jpeg", + "nsfw": "Soft", + "width": 600, + "height": 896, + "hash": "U9Hx220000~op9%301x]%2V[e@NZtmxuI9M_", + "meta": { + "Size": "200x300", + "seed": 1676989016, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "rezeroemilia, , emilia, braid, crown braid, flower, hair flower, hair ornament, hair ribbon, long hair, low-tied long hair, (purple eyes:1.2), pointy ears, white flower, x hair ornament,\nBREAK bare shoulders, detached collar, dress, long sleeves, low-tied long hair, navel, pink dress, shoulder cutout, thigh gap, wide sleeves,\nBREAK outdoors, city,\nBREAK looking at viewer, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "emiliatest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "\"emiliatest": "02e9e6d5ad1e", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a8a4d188-6e62-4211-9795-d88af6d73915/width=450/1330407.jpeg", + "nsfw": "Soft", + "width": 600, + "height": 896, + "hash": "UbKw30~oxokC%1R*xaR*M|wfxFo2xuofRjay", + "meta": { + "Size": "200x300", + "seed": 2006071609, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "rezeroemilia, , emilia, braid, crown braid, flower, hair flower, hair ornament, hair ribbon, long hair, low-tied long hair, (purple eyes:1.2), pointy ears, white flower, x hair ornament,\nBREAK bikini,\nBREAK outdoors, beach,\nBREAK looking at viewer, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "emiliatest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "\"emiliatest": "02e9e6d5ad1e", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4b4edb5b-27ea-4adb-a43c-f696a9fa69d5/width=450/1330405.jpeg", + "nsfw": "Soft", + "width": 600, + "height": 896, + "hash": "USL3.Y~V.6tQ_2NKt6xt%MxuofxuS7oyV@o0", + "meta": { + "Size": "200x300", + "seed": 818410066, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "rezeroemilia, , emilia, braid, crown braid, flower, hair flower, hair ornament, hair ribbon, (purple eyes:1.2), pointy ears, white flower, x hair ornament,\nBREAK lingerie,\nBREAK indoors, bed,\nBREAK looking at viewer, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "emiliatest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "\"emiliatest": "02e9e6d5ad1e", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2a5fbe57-4c62-47e8-a423-fc92b4489e54/width=450/1330406.jpeg", + "nsfw": "Soft", + "width": 600, + "height": 896, + "hash": "UbH_7G~W%KoxE1WCIUNFIoofo1f5tSkC-pt7", + "meta": { + "Size": "200x300", + "seed": 818410065, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "rezeroemilia, , emilia, braid, crown braid, flower, hair flower, hair ornament, hair ribbon, (purple eyes:1.2), pointy ears, white flower, x hair ornament,\nBREAK lingerie,\nBREAK indoors, bed,\nBREAK looking at viewer, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "emiliatest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "\"emiliatest": "02e9e6d5ad1e", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/106373" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/emiliatest.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/emiliatest.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..b0fd8fa9aad6018288506d5573f55003c9629dab Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/emiliatest.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/emiliatest.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/emiliatest.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..49c2b7315f90eadbb1d33dc815d99562b5c6af85 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/emiliatest.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:343d8fb86f8d06bbf2b52d43a64507147b1d1746386c1fe3bddee739846ae776 +size 37949665 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/ramREZero_v11.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/ramREZero_v11.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..4841131d35e33edebeb2ba4cb28c34e1c53b636c --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/ramREZero_v11.civitai.info" @@ -0,0 +1,317 @@ +{ + "id": 13098, + "modelId": 10631, + "name": "v1.1", + "createdAt": "2023-02-20T13:05:48.076Z", + "updatedAt": "2023-02-20T13:05:48.076Z", + "trainedWords": [ + "Ram_ReZero" + ], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": "

The traning set was expanded with both sfw and nswf images

", + "stats": { + "downloadCount": 1072, + "ratingCount": 2, + "rating": 4.5 + }, + "model": { + "name": "Ram (RE:Zero)", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "ramREZero_v11.safetensors", + "id": 11681, + "sizeKB": 147572.203125, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-02-20T13:11:21.487Z", + "hashes": { + "AutoV1": "499A74FC", + "AutoV2": "EBB642E80D", + "SHA256": "EBB642E80D43327FBEC69F859604FA499057670CAFA26A26C490FDD243D9EF33", + "CRC32": "40659241", + "BLAKE3": "1A87BB552A95F9011E34620ACFE14B5F25BB3CF8D211622F451E5A1D3ACD9A84" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/13098" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6a1285df-5969-470a-85bb-7007f54f9200/width=450/126311.jpeg", + "nsfw": true, + "width": 800, + "height": 1408, + "hash": "UOJREo00TDM{~V9FK3oe~VM{XlWB8{t8ELxu", + "meta": { + "Size": "400x704", + "seed": 1886923628, + "Model": "Anime_AbyssOrangeMix2_hard", + "steps": 25, + "prompt": "fullbody, 1girl,Ram_ReZero, ", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "Ram_ReZero", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "0fc198c490", + "name": "Anime_AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "negativePrompt": "disfugured, deformed, poorly drawn, low quality eyes, border, comic, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, artist name, NG_DeepNegative_V1_75T,", + "Denoising strength": "0.65" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ba7bb555-ffe6-4566-2df4-20ad4295c900/width=450/126310.jpeg", + "nsfw": true, + "width": 800, + "height": 1408, + "hash": "UTLDx{xaDi%1~Bt7t7t6w|ofIpfi-;WBIpt6", + "meta": { + "Size": "400x704", + "seed": 2184673497, + "Model": "Anime_Midnight Melt", + "steps": 25, + "prompt": "fullbody, 1girl,Ram_ReZero, , highres, sharp focus, pixiv masterpiece, ((intricate details)), highly detailed,", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "Ram_ReZero", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "d01b3a0365", + "name": "Anime_Midnight Melt", + "type": "model" + } + ], + "Model hash": "d01b3a0365", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "negativePrompt": "disfugured, deformed, poorly drawn, low quality eyes, border, comic, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, artist name, NG_DeepNegative_V1_75T,", + "Denoising strength": "0.65" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/06e1f508-5861-4386-9ab3-96919bff8500/width=450/126309.jpeg", + "nsfw": true, + "width": 800, + "height": 1200, + "hash": "UBJI04yZ0CrxQB^QS*0hxHE3IoWBMgE2JBn#", + "meta": { + "Size": "400x600", + "seed": 1820956743, + "Model": "Anime_AbyssOrangeMix2_hard", + "steps": 25, + "prompt": "fullbody, 1girl,Ram_ReZero, , (bikini:1.2)", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "Ram_ReZero", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "0fc198c490", + "name": "Anime_AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "negativePrompt": "disfugured, deformed, poorly drawn, low quality eyes, border, comic, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, artist name, NG_DeepNegative_V1_75T,", + "Denoising strength": "0.65" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/15848508-614c-4c6b-e983-eb07dc583800/width=450/126308.jpeg", + "nsfw": false, + "width": 800, + "height": 1408, + "hash": "UaHC$cT1Gaxa?^X9K4n%x^V@tlVsmmRiM_og", + "meta": { + "Size": "400x704", + "seed": 2973981777, + "Model": "Anime_Anything-V3.0", + "steps": 25, + "prompt": "fullbody, 1girl,Ram_ReZero, ", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "Ram_ReZero", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "8712e20a5d", + "name": "Anime_Anything-V3.0", + "type": "model" + } + ], + "Model hash": "8712e20a5d", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "negativePrompt": "disfugured, deformed, poorly drawn, low quality eyes, border, comic, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, artist name, NG_DeepNegative_V1_75T,", + "Denoising strength": "0.65" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/52162f73-be0d-4b51-156d-c0420c214e00/width=450/126307.jpeg", + "nsfw": false, + "width": 800, + "height": 1408, + "hash": "U8IhdTIT3U5RRoD+00k?qw?b00D%:Rf5cY~W", + "meta": { + "Size": "400x704", + "seed": 164290209, + "Model": "Anime_AbyssOrangeMix2_hard", + "steps": 25, + "prompt": "fullbody, 1girl,Ram_ReZero, ", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "Ram_ReZero", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "0fc198c490", + "name": "Anime_AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "negativePrompt": "disfugured, deformed, poorly drawn, low quality eyes, border, comic, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, artist name, NG_DeepNegative_V1_75T,", + "Denoising strength": "0.65" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/cb719253-6241-4546-7cfc-f31d2c3c8d00/width=450/126306.jpeg", + "nsfw": false, + "width": 800, + "height": 1408, + "hash": "UdK-qb?HEe?c~W-;yCxuiwozInNFxaRPNZxu", + "meta": { + "Size": "400x704", + "seed": 105820087, + "Model": "Anime_Anything-V3.0", + "steps": 25, + "prompt": "fullbody, 1girl,Ram_ReZero, , highres, sharp focus, pixiv masterpiece, ((intricate details)), highly detailed,", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "Ram_ReZero", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "8712e20a5d", + "name": "Anime_Anything-V3.0", + "type": "model" + } + ], + "Model hash": "8712e20a5d", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "negativePrompt": "disfugured, deformed, poorly drawn, low quality eyes, border, comic, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, artist name, NG_DeepNegative_V1_75T,", + "Denoising strength": "0.65" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ae808b22-0a9f-4319-0805-1a127a29c700/width=450/126305.jpeg", + "nsfw": true, + "width": 800, + "height": 1200, + "hash": "UMJ*3g9v00^k00R%E0%2H?bX?asp~WNGShni", + "meta": { + "Size": "400x600", + "seed": 3347720032, + "Model": "Anime_AbyssOrangeMix2_hard", + "steps": 25, + "prompt": "fullbody, 1girl,Ram_ReZero, , nsfw, naked", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "Ram_ReZero", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "0fc198c490", + "name": "Anime_AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "negativePrompt": "disfugured, deformed, poorly drawn, low quality eyes, border, comic, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, artist name, NG_DeepNegative_V1_75T,", + "Denoising strength": "0.65" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8233775b-9ba1-4d2b-59e7-d1a26c664300/width=450/126304.jpeg", + "nsfw": true, + "width": 800, + "height": 1200, + "hash": "UyLNV|~pTJ%2-p%LkWWBnORjNGWBjGoft7s:", + "meta": { + "Size": "400x600", + "seed": 3406704429, + "Model": "Anime_AbyssOrangeMix2_hard", + "steps": 25, + "prompt": "fullbody, 1girl,Ram_ReZero, , nsfw, no pants, lifted skirt", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "Ram_ReZero", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "0fc198c490", + "name": "Anime_AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "negativePrompt": "disfugured, deformed, poorly drawn, low quality eyes, border, comic, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, artist name, NG_DeepNegative_V1_75T,", + "Denoising strength": "0.65" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/13098" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/ramREZero_v11.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/ramREZero_v11.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..2029bcedc46a1be910908b961eab1e15f77b1574 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/ramREZero_v11.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:c0df21ba3eb573801f042d3aa5cbe1b8dbb57e40e6ff6cf9a13dac158fd26353 +size 1335216 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/ramREZero_v11.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/ramREZero_v11.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..c9d16faf2637984cbbf9aaca141172f06870f7c0 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/ramREZero_v11.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:ebb642e80d43327fbec69f859604fa499057670cafa26a26c490fdd243d9ef33 +size 151113936 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/ramReZero_v1.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/ramReZero_v1.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..36aaf8d203737372ae715d41369d318a31f335ac --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/ramReZero_v1.civitai.info" @@ -0,0 +1,443 @@ +{ + "id": 34532, + "modelId": 28782, + "name": "v1", + "createdAt": "2023-04-03T16:44:02.131Z", + "updatedAt": "2023-04-03T16:44:02.131Z", + "trainedWords": [ + "ram1, ram_(re:zero)" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 1375, + "ratingCount": 1, + "rating": 5 + }, + "model": { + "name": "Ram \u30e9\u30e0 / Re:Zero", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "ramReZero_v1.safetensors", + "id": 28359, + "sizeKB": 73847.6904296875, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-03T16:46:32.349Z", + "hashes": { + "AutoV1": "E2A4BCA6", + "AutoV2": "8ABB53936B", + "SHA256": "8ABB53936BE8566665C4356D1FF4858423450299B57BA739F16094EE8F71C3E6", + "CRC32": "A1339B82", + "BLAKE3": "0FE9A01F21354FA57FACD34D3A6E43C6D71B649C45D717CF6BE33BC1615F8453" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/34532" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/cd79623d-4c67-4436-5131-4469cd023f00/width=450/394413.jpeg", + "nsfw": false, + "width": 1024, + "height": 1536, + "hash": "UeKKQW9GInRj~BMyozWB%2ayNGt7RifkofWB", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 668815766, + "Model": "yabalMix_yabalMix", + "steps": 20, + "hashes": { + "model": "b4372530d4" + }, + "prompt": "masterpiece, best quality, highres, ram1, 1girl, solo, ram \\(re:zero\\), pink hair, white thighhighs, short hair, red eyes, hair over one eye, ribbon trim, hair ribbon, x hair ornament, frills, maid headdress, waist apron, garter straps, black ribbon, small breasts, long sleeves, white apron, neck ribbon, purple ribbon, wide sleeves, hair flower, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "ram_rezero_v1", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "b4372530d4", + "name": "yabalMix_yabalMix", + "type": "model" + } + ], + "Model hash": "b4372530d4", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1),", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/95f02d85-0de3-4953-9412-2e985181d600/width=450/394412.jpeg", + "nsfw": false, + "width": 1024, + "height": 1536, + "hash": "UJHxpLIn9W-:-;kB%gWX~XIWRoWEx{IVo}WC", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 234949112, + "Model": "yabalMix_yabalMix", + "steps": 20, + "hashes": { + "model": "b4372530d4" + }, + "prompt": "masterpiece, best quality, highres, ram1, 1girl, solo, ram \\(re:zero\\), pink hair, white thighhighs, short hair, red eyes, hair over one eye, ribbon trim, hair ribbon, x hair ornament, frills, maid headdress, waist apron, garter straps, black ribbon, small breasts, long sleeves, white apron, neck ribbon, purple ribbon, wide sleeves, hair flower, , wariza, field, grass,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "name": "ram_rezero_v1", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "b4372530d4", + "name": "yabalMix_yabalMix", + "type": "model" + } + ], + "Model hash": "b4372530d4", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1),", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/59eb4e6b-c53c-4d34-0ce7-27e912466400/width=450/394411.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UTKKTc~Vf|Rj~Bxax[oz-Vs:I:oen~t7t6WA", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 668815767, + "Model": "yabalMix_yabalMix", + "steps": 20, + "hashes": { + "model": "b4372530d4" + }, + "prompt": "masterpiece, best quality, highres, ram1, 1girl, solo, ram \\(re:zero\\), pink hair, white thighhighs, short hair, red eyes, hair over one eye, ribbon trim, hair ribbon, x hair ornament, frills, maid headdress, waist apron, garter straps, black ribbon, small breasts, long sleeves, white apron, neck ribbon, purple ribbon, wide sleeves, hair flower, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "ram_rezero_v1", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "b4372530d4", + "name": "yabalMix_yabalMix", + "type": "model" + } + ], + "Model hash": "b4372530d4", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1),", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/dc31d254-648d-4c2c-b70c-3183e5e07d00/width=450/394410.jpeg", + "nsfw": false, + "width": 1024, + "height": 1536, + "hash": "UNHBrXRp0J%L~VMxNe.8xDRjNcxZW=M_M{t8", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 510600815, + "Model": "yabalMix_yabalMix", + "steps": 20, + "hashes": { + "model": "b4372530d4" + }, + "prompt": "masterpiece, best quality, highres, ram1, 1girl, solo, ram \\(re:zero\\), pink hair, white thighhighs, short hair, red eyes, hair over one eye, ribbon trim, hair ribbon, x hair ornament, frills, maid headdress, waist apron, garter straps, black ribbon, small breasts, long sleeves, white apron, neck ribbon, purple ribbon, wide sleeves, hair flower, , indoors, sitting, crossed legs,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 10, + "Clip skip": "2", + "resources": [ + { + "name": "ram_rezero_v1", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "b4372530d4", + "name": "yabalMix_yabalMix", + "type": "model" + } + ], + "Model hash": "b4372530d4", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1),", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b42fbac7-2459-4ce8-55ac-9ca1ed3dbb00/width=450/394409.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UQHxjEM{9D-B~qM{xusqtmNHRjM{%hM{nht3", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3635509782, + "Model": "yabalMix_yabalMix", + "steps": 20, + "hashes": { + "model": "b4372530d4" + }, + "prompt": "masterpiece, best quality, highres, ram1, 1girl, solo, ram \\(re:zero\\), pink hair, white thighhighs, short hair, red eyes, hair over one eye, ribbon trim, hair ribbon, x hair ornament, frills, maid headdress, waist apron, garter straps, black ribbon, small breasts, long sleeves, white apron, neck ribbon, purple ribbon, wide sleeves, hair flower, , outdoors, market stall, leaning forward, arms behind back,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "name": "ram_rezero_v1", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "b4372530d4", + "name": "yabalMix_yabalMix", + "type": "model" + } + ], + "Model hash": "b4372530d4", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1),", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a9640d2d-d929-48f9-c244-485659629f00/width=450/394408.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UGGuRW~qE0^+-SjCXR^lv~%h.9$*t8^+oHM{", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 897966911, + "Model": "yabalMix_yabalMix", + "steps": 20, + "hashes": { + "model": "b4372530d4" + }, + "prompt": "masterpiece, best quality, highres, ram1, 1girl, solo, ram \\(re:zero\\), pink hair, white thighhighs, short hair, red eyes, hair over one eye, ribbon trim, hair ribbon, x hair ornament, frills, maid headdress, waist apron, garter straps, black ribbon, small breasts, long sleeves, white apron, neck ribbon, purple ribbon, wide sleeves, hair flower, , indoors, sitting, crossed legs,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 10, + "Clip skip": "2", + "resources": [ + { + "name": "ram_rezero_v1", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "b4372530d4", + "name": "yabalMix_yabalMix", + "type": "model" + } + ], + "Model hash": "b4372530d4", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1),", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7236614a-56ac-4dda-d019-6e301da63b00/width=450/394407.jpeg", + "nsfw": false, + "width": 1024, + "height": 1536, + "hash": "UDGkUu~B9pR4:~NGFdNJ0Lxax^t60gNbSiNZ", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 767286015, + "Model": "yabalMix_yabalMix", + "steps": 20, + "hashes": { + "model": "b4372530d4" + }, + "prompt": "masterpiece, best quality, highres, ram1, 1girl, solo, ram \\(re:zero\\), pink hair, short hair, red eyes, hair over one eye, hair ribbon, x hair ornament, small breasts, purple ribbon, hair flower, , yukata, night, summer festival, smile,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "name": "ram_rezero_v1", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "b4372530d4", + "name": "yabalMix_yabalMix", + "type": "model" + } + ], + "Model hash": "b4372530d4", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1),", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/be541b42-3638-4c68-5f80-64c54f330500/width=450/394406.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UKJHdfIUO8%M?GIU9Z%N%24nIVNI~qRP?boz", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3287763828, + "Model": "yabalMix_yabalMix", + "steps": 20, + "hashes": { + "model": "b4372530d4" + }, + "prompt": "masterpiece, best quality, highres, ram1, 1girl, solo, ram \\(re:zero\\), pink hair, white thighhighs, short hair, red eyes, hair over one eye, ribbon trim, hair ribbon, x hair ornament, frills, maid headdress, waist apron, garter straps, black ribbon, small breasts, long sleeves, white apron, neck ribbon, purple ribbon, wide sleeves, hair flower, , smile, bed, hands on own knees, standing, own hands together,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "name": "ram_rezero_v1", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "b4372530d4", + "name": "yabalMix_yabalMix", + "type": "model" + } + ], + "Model hash": "b4372530d4", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1),", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/32b86a6c-554e-4bb9-9b51-a14f63d88e00/width=450/394405.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UGFrz~~o0vIn?D%eT0xurtxtNMWFy5%2-:Rj", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3079613221, + "Model": "yabalMix_yabalMix", + "steps": 20, + "hashes": { + "model": "b4372530d4" + }, + "prompt": "masterpiece, best quality, highres, ram1, 1girl, solo, ram \\(re:zero\\), pink hair, white thighhighs, short hair, red eyes, hair over one eye, ribbon trim, hair ribbon, x hair ornament, frills, maid headdress, waist apron, garter straps, black ribbon, small breasts, long sleeves, white apron, neck ribbon, purple ribbon, wide sleeves, hair flower, , holding weapon, outdoors, night, forest, torn clothes, blood on clothes, injury,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "name": "ram_rezero_v1", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "b4372530d4", + "name": "yabalMix_yabalMix", + "type": "model" + } + ], + "Model hash": "b4372530d4", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1),", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/fffc4381-0993-4b14-6128-41da9b19a000/width=450/394404.jpeg", + "nsfw": false, + "width": 1024, + "height": 1536, + "hash": "UHJ*9y0000~WVDIUXQnP%N9G.8snn3nhozR-", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2182478065, + "Model": "yabalMix_yabalMix", + "steps": 20, + "hashes": { + "model": "b4372530d4" + }, + "prompt": "masterpiece, best quality, highres, ram1, 1girl, solo, ram \\(re:zero\\), pink hair, short hair, red eyes, hair over one eye, hair ribbon, x hair ornament, small breasts, purple ribbon, hair flower, , wedding dress, bridal veil, bouquet, chuch,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "name": "ram_rezero_v1", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "b4372530d4", + "name": "yabalMix_yabalMix", + "type": "model" + } + ], + "Model hash": "b4372530d4", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1),", + "Denoising strength": "0.45" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/34532" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/ramReZero_v1.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/ramReZero_v1.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..c932048ee1d3350c19cce9a80530a47b9bd8b611 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/ramReZero_v1.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:c67214c5060394db74096ac4f55f190d684893b7fc78c3263d7530a3bd95b15e +size 1832589 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/ramReZero_v1.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/ramReZero_v1.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..755ec61030a590a27b66b15b6725781760497c00 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/ramReZero_v1.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:8abb53936be8566665c4356d1ff4858423450299b57ba739f16094ee8f71c3e6 +size 75620035 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/ramtest.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/ramtest.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..8882a3f6ab01fd168fd252bd6888a008647fc4be --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/ramtest.civitai.info" @@ -0,0 +1,330 @@ +{ + "id": 106375, + "modelId": 99402, + "name": "v1.0", + "createdAt": "2023-06-29T05:27:23.752Z", + "updatedAt": "2023-06-29T05:28:27.312Z", + "trainedWords": [ + "ram, hair flower, hair ornament, hair over one eye, pink hair, (red eyes:1.5), short hair, x hair ornament,", + "apron, black bow, black dress, black ribbon, bow, detached sleeves, dress, frilled apron, frilled sleeves, frills, juliet sleeves, long sleeves, maid, neck ribbon, puffy sleeves, ribbon, roswaal mansion maid uniform, thighhighs, two-tone dress, waist apron, white bow, white dress, white thighhighs," + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 42, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Ram - Re:Zero", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "ramtest.safetensors", + "id": 74895, + "sizeKB": 37050.7158203125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-29T05:30:44.434Z", + "hashes": { + "AutoV1": "A45BE09D", + "AutoV2": "2548D0BE8F", + "SHA256": "2548D0BE8F2E65AE5952872BE1517BBC8DA60A76216FD703966A255BFD1C702D", + "CRC32": "A147C024", + "BLAKE3": "99ABEFA20F0A4196260135FF0FAC914FB313EA1FBE57779DE038A3B778FB33E3" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/106375" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c7608f28-b3b5-44b9-8e23-db9bc2c37524/width=450/1330440.jpeg", + "nsfw": "Soft", + "width": 600, + "height": 896, + "hash": "UBG8NGEM00-;|xIT0y%MQo?HTJNaVYIotltR", + "meta": { + "Size": "200x300", + "seed": 1465321359, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "rezeroram, , ram, hair flower, hair ornament, hair over one eye, pink hair, (red eyes:1.5), short hair, x hair ornament,\nBREAK apron, black bow, black dress, black ribbon, bow, detached sleeves, dress, frilled apron, frilled sleeves, frills, juliet sleeves, long sleeves, maid, neck ribbon, puffy sleeves, ribbon, roswaal mansion maid uniform, thighhighs, two-tone dress, waist apron, white bow, white dress, white thighhighs,,\nBREAK outdoors, city,\nBREAK looking at viewer, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "\"ramtest": "cddfd1799e87", + "cfgScale": 7, + "resources": [ + { + "name": "ramtest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6258a3de-4624-426b-9455-dc811d196281/width=450/1330437.jpeg", + "nsfw": "Soft", + "width": 600, + "height": 896, + "hash": "UEGa@DD*00o_}ZMx0y-;H@?HXlIn%1Ioozbb", + "meta": { + "Size": "200x300", + "seed": 1465321360, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "rezeroram, , ram, hair flower, hair ornament, hair over one eye, pink hair, (red eyes:1.5), short hair, x hair ornament,\nBREAK apron, black bow, black dress, black ribbon, bow, detached sleeves, dress, frilled apron, frilled sleeves, frills, juliet sleeves, long sleeves, maid, neck ribbon, puffy sleeves, ribbon, roswaal mansion maid uniform, thighhighs, two-tone dress, waist apron, white bow, white dress, white thighhighs,,\nBREAK outdoors, city,\nBREAK looking at viewer, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "\"ramtest": "cddfd1799e87", + "cfgScale": 7, + "resources": [ + { + "name": "ramtest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/070fcef9-a16c-4173-a59c-b8a1b166ad12/width=450/1330434.jpeg", + "nsfw": "Soft", + "width": 600, + "height": 896, + "hash": "UfJj[5_NFwSgnnI;kqS3w0RQW=Rkxut7s:oL", + "meta": { + "Size": "200x300", + "seed": 1004228586, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "rezeroram, , ram, hair flower, hair ornament, hair over one eye, pink hair, (red eyes:1.5), short hair, x hair ornament, (small chest:1.2)\nBREAK bikini,\nBREAK outdoors, beach,\nBREAK looking at viewer, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "\"ramtest": "cddfd1799e87", + "cfgScale": 7, + "resources": [ + { + "name": "ramtest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5ae5113c-859a-4897-8905-af0aed8af174/width=450/1330438.jpeg", + "nsfw": "Mature", + "width": 600, + "height": 896, + "hash": "UhI}9l_NAWNxsXI=bwbc#URPa#R*xuoys:WB", + "meta": { + "Size": "200x300", + "seed": 1004228585, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "rezeroram, , ram, hair flower, hair ornament, hair over one eye, pink hair, (red eyes:1.5), short hair, x hair ornament, (small chest:1.2)\nBREAK bikini,\nBREAK outdoors, beach,\nBREAK looking at viewer, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "\"ramtest": "cddfd1799e87", + "cfgScale": 7, + "resources": [ + { + "name": "ramtest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a710d00f-7da7-42e1-89b0-91d320710b66/width=450/1330436.jpeg", + "nsfw": "Soft", + "width": 600, + "height": 896, + "hash": "UcIEFe~W%gkV%2?HJ6R*xbxu%MW;s;WCxuxu", + "meta": { + "Size": "200x300", + "seed": 539468622, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "rezeroram, , ram, hair flower, hair ornament, hair over one eye, pink hair, (red eyes:1.5), short hair, x hair ornament, (small chest:1.2)\nBREAK lingerie,\nBREAK indoors, bed,\nBREAK looking at viewer, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "\"ramtest": "cddfd1799e87", + "cfgScale": 7, + "resources": [ + { + "name": "ramtest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b5ee314f-b41b-4f05-bae1-88dc105ab8d9/width=450/1330435.jpeg", + "nsfw": "Mature", + "width": 600, + "height": 896, + "hash": "UXLg6G9Fx[.7~WIAI.kW$+o0X8X8M{j]xu%M", + "meta": { + "Size": "200x300", + "seed": 539468621, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "rezeroram, , ram, hair flower, hair ornament, hair over one eye, pink hair, (red eyes:1.5), short hair, x hair ornament, (small chest:1.2)\nBREAK lingerie,\nBREAK indoors, bed,\nBREAK looking at viewer, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "\"ramtest": "cddfd1799e87", + "cfgScale": 7, + "resources": [ + { + "name": "ramtest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/106375" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/ramtest.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/ramtest.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..52254bf2f4bb84662a8962ac5e25cfa45fcb3e09 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/ramtest.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/ramtest.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/ramtest.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..a2e37dffc10d40f39914859beb00cc3207462991 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/ramtest.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:2548d0be8f2e65ae5952872be1517bbc8da60a76216fd703966a255bfd1c702d +size 37939933 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/remReZero_v1.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/remReZero_v1.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..47d58e2d14e54147035efa06b2cf744e97997dbb --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/remReZero_v1.civitai.info" @@ -0,0 +1,121 @@ +{ + "id": 47451, + "modelId": 42774, + "name": "v1", + "createdAt": "2023-04-16T20:36:40.589Z", + "updatedAt": "2023-04-16T20:40:32.891Z", + "trainedWords": [ + "rem", + "rem (re:zero)" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "model": { + "name": "Rem | Re:Zero", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "remReZero_v1.safetensors", + "id": 35255, + "sizeKB": 36163.8515625, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-16T20:40:53.992Z", + "hashes": { + "AutoV1": "041ED57B", + "AutoV2": "771A1E9977", + "SHA256": "771A1E99776A05BE81BE360705B9B960D3AF1AB54EC387E66ED055DCB4A428E4", + "CRC32": "92D04718", + "BLAKE3": "608E7460DA1DA9A1785D57EB6763BF4CB526516C88E36CA7A4A7A74A7C235429" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/47451" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1d2b88f7-cb6c-47f1-0edd-43bc19f79500/width=450/511284.jpeg", + "nsfw": true, + "width": 864, + "height": 1295, + "hash": "UQI5c1~pD$xvI:xts+x]-??b-pM{4ot8spIo", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f2608b8b-7952-471f-2f0d-6cc7eb23fb00/width=450/511298.jpeg", + "nsfw": false, + "width": 864, + "height": 1295, + "hash": "UOHn?Y%MKkRkGKozIcRQ00WVH=V[^Jn%$way", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/df01331d-6e07-4749-b836-0dfb83634800/width=450/511278.jpeg", + "nsfw": true, + "width": 864, + "height": 1295, + "hash": "U8Iq}=00008_02cX*|-6+DDO~Ut,Q8+}HCF3", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8230c557-e7c8-4f32-d776-3818bc7d6500/width=450/511280.jpeg", + "nsfw": false, + "width": 864, + "height": 1295, + "hash": "UWKU7y$+D$t6%#%LR4NGx?I:t7ng~9X8EK%1", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1447a80c-4b52-4e92-ed9d-cf4c42813f00/width=450/511282.jpeg", + "nsfw": false, + "width": 864, + "height": 1295, + "hash": "UIJa+h01G5^gIcs;%jR606E0oiVrL#-TIqXU", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8320ad6f-4e48-43a8-57f9-f5d11dd73e00/width=450/511285.jpeg", + "nsfw": true, + "width": 864, + "height": 1295, + "hash": "UDK1Uk?F2]v1IDHs$m-4OuQn}@cF?J9G0gR6", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e94138a3-a239-4b70-d23d-ad91c89c7800/width=450/511277.jpeg", + "nsfw": false, + "width": 864, + "height": 1295, + "hash": "UKIhgRIT8^-P_49#xYWE01t7xGWE4o-nI9oI", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/bcfc11c0-beeb-4a58-b1a8-0cf0a2be7800/width=450/511291.jpeg", + "nsfw": true, + "width": 864, + "height": 1295, + "hash": "UJJaG]-.#gD+D%Mx0eD+GG$%~BSi_1%1,UM{", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/715a3af3-c0fd-4074-4a32-f3d7c645e700/width=450/511294.jpeg", + "nsfw": false, + "width": 864, + "height": 1295, + "hash": "UJHBJN0;00^F~R5ARj$_4m9Z-;x]-pR,$z$*", + "meta": null + } + ], + "downloadUrl": "https://civitai.com/api/download/models/47451" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/remReZero_v1.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/remReZero_v1.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..18926cfb9ac0d1367c0cb256145b5c29c00e1698 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/remReZero_v1.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/remReZero_v1.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/remReZero_v1.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..386ddc3457653f2af47f6374fc77c5e97bbce160 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/remReZero_v1.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:771a1e99776a05be81be360705b9b960d3af1ab54ec387e66ed055dcb4a428e4 +size 37031784 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/remtest.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/remtest.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..0516b0da08218904621cf8ed192c9ba2d5e37c43 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/remtest.civitai.info" @@ -0,0 +1,330 @@ +{ + "id": 107011, + "modelId": 99979, + "name": "v1.0", + "createdAt": "2023-06-30T02:55:27.465Z", + "updatedAt": "2023-06-30T03:17:32.754Z", + "trainedWords": [ + "rem, blue eyes, blue hair, hair ornament, hair over one eye, hair ribbon, short hair, x hair ornament", + "apron, black ribbon, black skirt, black sleeves, detached collar, detached sleeves, flower, frilled apron, frilled skirt, frills, head wreath, long sleeves, maid, miniskirt, neck ribbon, purple ribbon, ribbon, ribbon trim, ribbon-trimmed sleeves, roswaal mansion maid uniform, short hair, skirt, thighhighs, waist apron, white apron, white thighhighs," + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 662, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Rem - Re:Zero", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "remtest.safetensors", + "id": 75360, + "sizeKB": 37068.6611328125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-30T03:01:00.852Z", + "hashes": { + "AutoV1": "729DEA3E", + "AutoV2": "B320FC036E", + "SHA256": "B320FC036E9DFDD8B9B14B909CD18C4CA988D7396C2A25093C7F10B7B342C927", + "CRC32": "ED380584", + "BLAKE3": "FA2EA3A5DD4F6BEA3DF74D24705EBAFB980CDE88029DE341031FC79EF009E954" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/107011" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0d21f4a8-cc29-4a77-8bf4-4651b6b25db8/width=450/1341747.jpeg", + "nsfw": "Soft", + "width": 600, + "height": 896, + "hash": "UbJ@:@4.-.M{~qIUxsxuE3a$t7s:R.Rkt6oJ", + "meta": { + "Size": "200x300", + "seed": 2329261805, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "rezerorem, , rem, blue eyes, blue hair, hair ornament, hair over one eye, hair ribbon, short hair, x hair ornament,\nBREAK apron, black ribbon, black skirt, black sleeves, detached collar, detached sleeves, flower, frilled apron, frilled skirt, frills, head wreath, long sleeves, maid, miniskirt, neck ribbon, purple ribbon, ribbon, ribbon trim, ribbon-trimmed sleeves, roswaal mansion maid uniform, short hair, skirt, thighhighs, waist apron, white apron, white thighhighs,\nBREAK outdoors, city,\nBREAK looking at viewer, \nBREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "\"remtest": "04e7d3ab0a44", + "cfgScale": 7, + "resources": [ + { + "name": "remtest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c6a31247-c68c-40aa-bb76-a51d5e960379/width=450/1341746.jpeg", + "nsfw": "Soft", + "width": 600, + "height": 896, + "hash": "UaL4d6Sj_Mx[~qM{-:%29aM{nhofogbHxaof", + "meta": { + "Size": "200x300", + "seed": 2329261804, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "rezerorem, , rem, blue eyes, blue hair, hair ornament, hair over one eye, hair ribbon, short hair, x hair ornament,\nBREAK apron, black ribbon, black skirt, black sleeves, detached collar, detached sleeves, flower, frilled apron, frilled skirt, frills, head wreath, long sleeves, maid, miniskirt, neck ribbon, purple ribbon, ribbon, ribbon trim, ribbon-trimmed sleeves, roswaal mansion maid uniform, short hair, skirt, thighhighs, waist apron, white apron, white thighhighs,\nBREAK outdoors, city,\nBREAK looking at viewer, \nBREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "\"remtest": "04e7d3ab0a44", + "cfgScale": 7, + "resources": [ + { + "name": "remtest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ac0dbe1b-cd59-4cbe-af2f-a47c197049b1/width=450/1341743.jpeg", + "nsfw": "Soft", + "width": 600, + "height": 896, + "hash": "UaJk4g?^tlShXoI=n%M|E2r?xat7ozt6smR+", + "meta": { + "Size": "200x300", + "seed": 2980650900, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "rezerorem, , rem, blue eyes, blue hair, hair ornament, hair over one eye, hair ribbon, short hair, x hair ornament,\nBREAK bikini,\nBREAK outdoors, beach,\nBREAK looking at viewer, \nBREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "\"remtest": "04e7d3ab0a44", + "cfgScale": 7, + "resources": [ + { + "name": "remtest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5b0d7f23-dd51-46ff-8864-0b9992097a14/width=450/1341744.jpeg", + "nsfw": "Mature", + "width": 600, + "height": 896, + "hash": "UdJtl6?^tlS3OaJAs:RkIVr?%1t7%Mxun%R*", + "meta": { + "Size": "200x300", + "seed": 2980650899, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "rezerorem, , rem, blue eyes, blue hair, hair ornament, hair over one eye, hair ribbon, short hair, x hair ornament,\nBREAK bikini,\nBREAK outdoors, beach,\nBREAK looking at viewer, \nBREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "\"remtest": "04e7d3ab0a44", + "cfgScale": 7, + "resources": [ + { + "name": "remtest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/60a31e0d-363b-47ea-bfc1-2a430a9cffec/width=450/1341742.jpeg", + "nsfw": "Mature", + "width": 600, + "height": 896, + "hash": "UBKKHF00YQ%gYR0LxYRi00-;iui^00%g=_%2", + "meta": { + "Size": "200x300", + "seed": 2950268354, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "rezerorem, , rem, blue eyes, blue hair, hair ornament, hair over one eye, hair ribbon, short hair, x hair ornament,\nBREAK lingerie,\nBREAK indoors, bed,\nBREAK looking at viewer, \nBREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "\"remtest": "04e7d3ab0a44", + "cfgScale": 7, + "resources": [ + { + "name": "remtest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ab61b1ca-20ca-4062-8e0e-95bc168d6a04/width=450/1341745.jpeg", + "nsfw": "Mature", + "width": 600, + "height": 896, + "hash": "UHK18%00TGtk.m01IT%1tnM_s:xYpJM{-p-p", + "meta": { + "Size": "200x300", + "seed": 2950268353, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "rezerorem, , rem, blue eyes, blue hair, hair ornament, hair over one eye, hair ribbon, short hair, x hair ornament,\nBREAK lingerie,\nBREAK indoors, bed,\nBREAK looking at viewer, \nBREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "\"remtest": "04e7d3ab0a44", + "cfgScale": 7, + "resources": [ + { + "name": "remtest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/107011" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/remtest.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/remtest.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..bc97070b99104f586c724c6fd269090577209a51 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/remtest.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/remtest.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/remtest.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..9d70ebcb8cb32d537c87140818a07fd1847a785a --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/remtest.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:b320fc036e9dfdd8b9b14b909cd18c4ca988d7396c2a25093c7f10b7b342c927 +size 37958309 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/rezerowitches-25.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/rezerowitches-25.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..df071efc4e93bedfeba9e140b4ad00ad84e3a81b --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/rezerowitches-25.civitai.info" @@ -0,0 +1,365 @@ +{ + "id": 115770, + "modelId": 107626, + "name": "v1", + "createdAt": "2023-07-12T03:47:02.874Z", + "updatedAt": "2023-07-12T04:12:23.654Z", + "trainedWords": [ + "echidna_rezero", + "satella_rezero", + "minerva_rezero", + "daphne_rezero", + "typhon_rezero", + "carmilla_rezero", + "sekhmet_rezero" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

Trained with 50 images of Echidna, 33 images of Satella, 25 images of Minerva, 20 images of Daphne, 20 images of Typhon, 20 images of Carmilla, and 20 images of Sekhmet. The repeats were balanced so that the result was 100.

", + "stats": { + "downloadCount": 49, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Re:Zero Witches Pack 7 in 1 - Echidna Satella Minerva Daphne Typhon Carmilla Sekhmet", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "rezerowitches-25.safetensors", + "id": 82546, + "sizeKB": 37011.748046875, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-07-12T03:52:12.278Z", + "hashes": { + "AutoV1": "BF50D886", + "AutoV2": "73FAFFAE29", + "SHA256": "73FAFFAE2984D18592D15D9F496FAA5D2D1F858FD8795A3D086A44B69EBCF24F", + "CRC32": "FE355475", + "BLAKE3": "5EB89D2558B252472CECF61C2689C9AA4CB60083FC8AFE56BE9205166846B6F3" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/115770" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/432d3dcf-c914-4d9f-92bd-30a8a0b66595/width=450/1518626.jpeg", + "nsfw": "Soft", + "width": 2688, + "height": 1536, + "hash": "UJHea[yCHr9F~Vx]xvbJ%Lx[-pR-X7NZWAWV", + "meta": { + "Size": "384x768", + "seed": 2, + "Model": "HeavenOrangeMix", + "steps": 20, + "hashes": { + "model": "a7c433adda" + }, + "prompt": "masterpiece, best quality, anime, 2d, 1girl, solo, (name_rezero), cowboy shot, standing, smile, fantasy world", + "Version": "v1.3.2", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "a7c433adda", + "name": "HeavenOrangeMix", + "type": "model" + } + ], + "Model hash": "a7c433adda", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "AnimeSharp 4x", + "negativePrompt": "EasyNegative, 3d, render", + "Denoising strength": "0.4" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/616e1074-6463-4fd3-a5fc-a558324a342e/width=450/1518625.jpeg", + "nsfw": "None", + "width": 768, + "height": 1536, + "hash": "UHF~K@aJ00Io~q-q4-R*~U-;01M{XmNF%Nn~", + "meta": { + "Size": "384x768", + "seed": 2, + "Model": "HeavenOrangeMix", + "steps": 20, + "hashes": { + "model": "a7c433adda" + }, + "prompt": "masterpiece, best quality, anime, 2d, 1girl, solo, echidna_rezero, school uniform, pleated skirt, collared shirt, red bowtie, blazer, blue jacket, cowboy shot, smile, school", + "Version": "v1.3.2", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "a7c433adda", + "name": "HeavenOrangeMix", + "type": "model" + } + ], + "Model hash": "a7c433adda", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "AnimeSharp 4x", + "negativePrompt": "EasyNegative, 3d, render", + "Denoising strength": "0.4" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/73c3bcf1-cc32-4f85-915a-13242f47eef7/width=450/1518386.jpeg", + "nsfw": "Soft", + "width": 768, + "height": 1536, + "hash": "UFDl+xNZ0Joz-Vr?00M{_No}9Z%MX8MxrsM_", + "meta": { + "Size": "384x768", + "seed": 2, + "Model": "HeavenOrangeMix", + "steps": 20, + "hashes": { + "model": "a7c433adda" + }, + "prompt": "masterpiece, best quality, anime, 2d, 1girl, solo, (echidna_rezero), (colored eyelashes), cowboy shot, standing, smile, fantasy world", + "Version": "v1.3.2", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "a7c433adda", + "name": "HeavenOrangeMix", + "type": "model" + } + ], + "Model hash": "a7c433adda", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "AnimeSharp 4x", + "negativePrompt": "EasyNegative, 3d, render", + "Denoising strength": "0.4" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/eeb068bf-be0a-4082-9f50-583556839f1c/width=450/1518385.jpeg", + "nsfw": "Soft", + "width": 768, + "height": 1536, + "hash": "UHEo.I-pT1Ne~pkDND-=?wt8E1xvE1ITs;t6", + "meta": { + "Size": "384x768", + "seed": 2, + "Model": "HeavenOrangeMix", + "steps": 20, + "hashes": { + "model": "a7c433adda" + }, + "prompt": "masterpiece, best quality, anime, 2d, 1girl, solo, (satella_rezero), veil, cowboy shot, standing, smile, fantasy world", + "Version": "v1.3.2", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "a7c433adda", + "name": "HeavenOrangeMix", + "type": "model" + } + ], + "Model hash": "a7c433adda", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "AnimeSharp 4x", + "negativePrompt": "EasyNegative, 3d, render", + "Denoising strength": "0.4" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/31a0300b-6444-4b1d-8fe4-c220a8682186/width=450/1518383.jpeg", + "nsfw": "Soft", + "width": 768, + "height": 1536, + "hash": "UZL4]L^%pI9a_NVqf,x^R$-oRoxvt6tRaJWY", + "meta": { + "Size": "384x768", + "seed": 4, + "Model": "HeavenOrangeMix", + "steps": 20, + "hashes": { + "model": "a7c433adda" + }, + "prompt": "masterpiece, best quality, anime, 2d, 1girl, solo, (minerva_rezero), cowboy shot, standing, smile, pink heart, fantasy world", + "Version": "v1.3.2", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "a7c433adda", + "name": "HeavenOrangeMix", + "type": "model" + } + ], + "Model hash": "a7c433adda", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "AnimeSharp 4x", + "negativePrompt": "EasyNegative, 3d, render", + "Denoising strength": "0.4" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3da6eca6-e763-42f6-9d2f-535511b28ac0/width=450/1518381.jpeg", + "nsfw": "None", + "width": 768, + "height": 1536, + "hash": "UcHyB=_4o}R%rVtQX9xaIq9FRQM|IUMxNFNG", + "meta": { + "Size": "384x768", + "seed": 3, + "Model": "HeavenOrangeMix", + "steps": 20, + "hashes": { + "model": "a7c433adda" + }, + "prompt": "masterpiece, best quality, anime, 2d, 1girl, solo, (daphne_rezero), covered eyes, cowboy shot, standing, smile, fantasy world", + "Version": "v1.3.2", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "a7c433adda", + "name": "HeavenOrangeMix", + "type": "model" + } + ], + "Model hash": "a7c433adda", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "AnimeSharp 4x", + "negativePrompt": "EasyNegative, 3d, render", + "Denoising strength": "0.4" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/cf19f019-0d68-4ca5-af67-ab69c0573300/width=450/1518384.jpeg", + "nsfw": "None", + "width": 768, + "height": 1536, + "hash": "ULF?bGD%Y7%2.AM_%NM|00ROROS%D%e.ITo#", + "meta": { + "Size": "384x768", + "seed": 4, + "Model": "HeavenOrangeMix", + "steps": 20, + "hashes": { + "model": "a7c433adda" + }, + "prompt": "masterpiece, best quality, anime, 2d, 1girl, solo, (typhon_rezero), cowboy shot, standing, smile, fantasy world", + "Version": "v1.3.2", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "a7c433adda", + "name": "HeavenOrangeMix", + "type": "model" + } + ], + "Model hash": "a7c433adda", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "AnimeSharp 4x", + "negativePrompt": "EasyNegative, 3d, render, see-through", + "Denoising strength": "0.4" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/34210225-243f-48be-8220-c87bb38f9ff2/width=450/1518382.jpeg", + "nsfw": "None", + "width": 768, + "height": 1536, + "hash": "U9GlFuB427~p*fH@00w}00R*0fWA?btkEe^+", + "meta": { + "Size": "384x768", + "seed": 1, + "Model": "HeavenOrangeMix", + "steps": 20, + "hashes": { + "model": "a7c433adda" + }, + "prompt": "masterpiece, best quality, anime, 2d, 1girl, solo, (carmilla_rezero), cowboy shot, standing, smile, fantasy world", + "Version": "v1.3.2", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "a7c433adda", + "name": "HeavenOrangeMix", + "type": "model" + } + ], + "Model hash": "a7c433adda", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "AnimeSharp 4x", + "negativePrompt": "EasyNegative, 3d, render", + "Denoising strength": "0.4" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ebb57c31-e7ab-4540-8a30-632d5cd5ffe4/width=450/1518380.jpeg", + "nsfw": "Soft", + "width": 768, + "height": 1536, + "hash": "UCEoiZ0e7L~XmRMv0JDh-DWF9Y-qNZ.SXl_4", + "meta": { + "Size": "384x768", + "seed": 1, + "Model": "HeavenOrangeMix", + "steps": 20, + "hashes": { + "model": "a7c433adda" + }, + "prompt": "masterpiece, best quality, anime, 2d, 1girl, solo, (sekhmet_rezero), cowboy shot, standing, smile, fantasy world", + "Version": "v1.3.2", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "a7c433adda", + "name": "HeavenOrangeMix", + "type": "model" + } + ], + "Model hash": "a7c433adda", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "AnimeSharp 4x", + "negativePrompt": "EasyNegative, 3d, render", + "Denoising strength": "0.4" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/115770" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/rezerowitches-25.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/rezerowitches-25.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..dbd5e7e20610a240f9e8f8f4a527a0b758f0182b Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/rezerowitches-25.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/rezerowitches-25.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/rezerowitches-25.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..a5698ae01d7f88ebab1c2702e856899506585d0d --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Re\357\274\232\344\273\216\351\233\266\345\274\200\345\247\213\347\232\204\345\274\202\344\270\226\347\225\214\347\224\237\346\264\273/rezerowitches-25.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:73faffae2984d18592d15d9f496faa5d2d1f858fd8795a3d086a44b69ebcf24f +size 37900030 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yor-01.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yor-01.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..ad9bcdaad8ce9499aacbbc8f90c0cd17299fccf2 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yor-01.civitai.info" @@ -0,0 +1,279 @@ +{ + "id": 115862, + "modelId": 107711, + "name": "v1.0", + "createdAt": "2023-07-12T07:43:10.606Z", + "updatedAt": "2023-07-12T07:50:30.816Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 128, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Yor Forger \u30e8\u30eb\u30fb\u30d5\u30a9\u30fc\u30b8\u30e3\u30fc / Spy x Family", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "yor-01.safetensors", + "id": 82618, + "sizeKB": 18548.8623046875, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-07-12T07:46:19.233Z", + "hashes": { + "AutoV1": "DE2F2560", + "AutoV2": "6D8FEF47B0", + "SHA256": "6D8FEF47B0C492ACC83039D9CE9B1D4475BA452DBAB4023DC59A77E701E49B39", + "CRC32": "DF6D53BF", + "BLAKE3": "25B5CCE8856F288E6B82A33EA36E8FBAAF6FC6954FB7082B06EF85F3117E5111" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/115862" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/80dd3e33-1104-4732-a927-07bc413394c8/width=450/1520265.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UNHn$:o#Fq~WI9_3?bxu%$jYw0kWELV@i_oz", + "meta": { + "\"yor": "5d97ce22aa35\"", + "Size": "512x768", + "seed": 2101559311, + "Model": "meinapastel_v6Pastel", + "steps": 40, + "hashes": { + "model": "6292dd40d6" + }, + "prompt": "masterpiece, yor, 1girl, solo, looking at viewer, open mouth, black hair, red eyes, dress, bare shoulders, jewelry, collarbone, sidelocks, hairband, earrings, indoors, off shoulder, :o, sweater, arms behind back, plant, short hair with long locks, white hairband, off-shoulder dress, sweater dress, off-shoulder sweater, red sweater, big side hair, very long side hair, ", + "Version": "v1.4.1", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "resources": [ + { + "name": "yor", + "type": "lora", + "weight": 1 + }, + { + "hash": "6292dd40d6", + "name": "meinapastel_v6Pastel", + "type": "model" + } + ], + "Model hash": "6292dd40d6", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "lolicon, easynegative, FastNegativeV2, badhandv4, sketches, (worst quality, low quality:2), FastNegativeV2, extra fingers, extra hands, loli, obese, disfigured hands, nudity, naked, lengthy fingers, big thumb finger, missing thumb finger, 6 fingers", + "Denoising strength": "0.7" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/020c43de-7110-48d8-bf84-d4ee44e8b77f/width=450/1520305.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "UIH1-~~W^k9a00NG0K%M4nIAs:V@pcOsxuIV", + "meta": { + "\"yor": "5d97ce22aa35\"", + "Size": "512x768", + "seed": 3794888062, + "Model": "meinapastel_v6Pastel", + "steps": 40, + "hashes": { + "model": "6292dd40d6" + }, + "prompt": "masterpiece, yor, 1girl, solo, long hair, looking at viewer, large breasts, black hair, hair ornament, red eyes, gloves, dress, holding, bare shoulders, jewelry, weapon, flower, sidelocks, hairband, earrings, black gloves, hair flower, fingerless gloves, holding weapon, black dress, blood, knife, short hair with long locks, holding knife, dagger, blood on weapon, holding dagger, gold hairband, ", + "Version": "v1.4.1", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "resources": [ + { + "name": "yor", + "type": "lora", + "weight": 1 + }, + { + "hash": "6292dd40d6", + "name": "meinapastel_v6Pastel", + "type": "model" + } + ], + "Model hash": "6292dd40d6", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "lolicon, teen, easynegative, FastNegativeV2, badhandv4, sketches, (worst quality, low quality:2), FastNegativeV2, extra fingers, extra hands, loli, obese, disfigured hands, nudity, naked, lengthy fingers, big thumb finger, missing thumb finger, 6 fingers, watermarks", + "Denoising strength": "0.7" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6a0c5706-284c-454f-b89c-2911e83dcad6/width=450/1520268.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "UPKdPc01O?w|_Nrqi_x]yXIU?HoyM|t7tRRj", + "meta": { + "\"yor": "5d97ce22aa35\"", + "Size": "512x768", + "seed": 1441839416, + "Model": "meinapastel_v6Pastel", + "steps": 40, + "hashes": { + "model": "6292dd40d6" + }, + "prompt": "masterpiece, yor, 1girl, solo, looking at viewer, open mouth, black hair, red eyes, dress, bare shoulders, jewelry, collarbone, sidelocks, hairband, earrings, indoors, off shoulder, :o, sweater, arms behind back, plant, short hair with long locks, white hairband, off-shoulder dress, sweater dress, off-shoulder sweater, red sweater, big side hair, very long side hair, ", + "Version": "v1.4.1", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "resources": [ + { + "name": "yor", + "type": "lora", + "weight": 1 + }, + { + "hash": "6292dd40d6", + "name": "meinapastel_v6Pastel", + "type": "model" + } + ], + "Model hash": "6292dd40d6", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "lolicon, easynegative, FastNegativeV2, badhandv4, sketches, (worst quality, low quality:2), FastNegativeV2, extra fingers, extra hands, loli, obese, disfigured hands, nudity, naked, lengthy fingers, big thumb finger, missing thumb finger, 6 fingers", + "Denoising strength": "0.7" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0657683e-7c9d-4615-8ef6-ce956a29a931/width=450/1520264.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "U8DlKD$i}S#kCT^j4:^iI_9aNwDiE2I:=ySd", + "meta": { + "\"yor": "5d97ce22aa35\"", + "Size": "512x768", + "seed": 1114197008, + "Model": "meinapastel_v6Pastel", + "steps": 40, + "hashes": { + "model": "6292dd40d6" + }, + "prompt": "masterpiece, royal background, yor, 1girl, solo, long hair, looking at viewer, large breasts, black hair, hair ornament, red eyes, thighhighs, gloves, dress, holding, bare shoulders, jewelry, standing, weapon, flower, sidelocks, hairband, earrings, boots, black gloves, black thighhighs, hair flower, fingerless gloves, holding weapon, black dress, zettai ryouiki, thigh boots, knife, dual wielding, holding knife, dagger, lamppost, two-sided fabric, holding dagger, gold hairband, two-sided dress, ", + "Version": "v1.4.1", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "resources": [ + { + "name": "yor", + "type": "lora", + "weight": 1 + }, + { + "hash": "6292dd40d6", + "name": "meinapastel_v6Pastel", + "type": "model" + } + ], + "Model hash": "6292dd40d6", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "lolicon, easynegative, FastNegativeV2, badhandv4, sketches, (worst quality, low quality:2), FastNegativeV2, extra fingers, extra hands, loli, obese, disfigured hands, nudity, naked, lengthy fingers, big thumb finger, missing thumb finger, 6 fingers", + "Denoising strength": "0.7" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/69b983a7-2184-4025-b657-10afb67f2b6a/width=450/1520266.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UWIz*a4nKh%M_NR5RjtlS~In%2ofMyM{kDae", + "meta": { + "\"yor": "5d97ce22aa35\"", + "Size": "512x768", + "seed": 2616899729, + "Model": "meinapastel_v6Pastel", + "steps": 40, + "hashes": { + "model": "6292dd40d6" + }, + "prompt": "masterpiece, yor, 1girl, solo, looking at viewer, open mouth, black hair, red eyes, dress, bare shoulders, jewelry, collarbone, sidelocks, hairband, earrings, indoors, off shoulder, :o, sweater, arms behind back, plant, short hair with long locks, white hairband, off-shoulder dress, sweater dress, off-shoulder sweater, red sweater, big side hair, very long side hair, ", + "Version": "v1.4.1", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "resources": [ + { + "name": "yor", + "type": "lora", + "weight": 1 + }, + { + "hash": "6292dd40d6", + "name": "meinapastel_v6Pastel", + "type": "model" + } + ], + "Model hash": "6292dd40d6", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "lolicon, easynegative, FastNegativeV2, badhandv4, sketches, (worst quality, low quality:2), FastNegativeV2, extra fingers, extra hands, loli, obese, disfigured hands, nudity, naked, lengthy fingers, big thumb finger, missing thumb finger, 6 fingers", + "Denoising strength": "0.7" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b4428873-ff5e-4349-9997-666eb6917c54/width=450/1520267.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "UGH1#q4o~UNG01_2D%o}?GIo-oWBkVxZ?HRj", + "meta": { + "\"yor": "5d97ce22aa35\"", + "Size": "512x768", + "seed": 3851942054, + "Model": "meinapastel_v6Pastel", + "steps": 40, + "hashes": { + "model": "6292dd40d6" + }, + "prompt": "masterpiece, royal background, yor, 1girl, solo, long hair, looking at viewer, large breasts, black hair, hair ornament, red eyes, thighhighs, gloves, dress, holding, bare shoulders, jewelry, standing, weapon, flower, sidelocks, hairband, earrings, boots, black gloves, black thighhighs, hair flower, fingerless gloves, holding weapon, black dress, zettai ryouiki, thigh boots, knife, dual wielding, holding knife, dagger, lamppost, two-sided fabric, holding dagger, gold hairband, two-sided dress, ", + "Version": "v1.4.1", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "resources": [ + { + "name": "yor", + "type": "lora", + "weight": 1 + }, + { + "hash": "6292dd40d6", + "name": "meinapastel_v6Pastel", + "type": "model" + } + ], + "Model hash": "6292dd40d6", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "lolicon, easynegative, FastNegativeV2, badhandv4, sketches, (worst quality, low quality:2), FastNegativeV2, extra fingers, extra hands, loli, obese, disfigured hands, nudity, naked, lengthy fingers, big thumb finger, missing thumb finger, 6 fingers", + "Denoising strength": "0.7" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/115862" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yor-01.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yor-01.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..61c171dcd615c7bbd08c5db3c4905b7c5bf18135 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yor-01.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yor-01.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yor-01.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..d235e7b27d579b17e475bf5141b6c0dd2098f0ab --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yor-01.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:6d8fef47b0c492acc83039d9ce9b1d4475ba452dbab4023dc59a77e701e49b39 +size 18994035 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yor4-06.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yor4-06.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..1bf108e18fdc80c1f0aa6c39372f1e911871a0be --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yor4-06.civitai.info" @@ -0,0 +1,300 @@ +{ + "id": 73571, + "modelId": 29306, + "name": "v2.0", + "createdAt": "2023-05-17T22:04:09.901Z", + "updatedAt": "2023-05-17T23:27:57.820Z", + "trainedWords": [ + "yor" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

Fully remake

", + "stats": { + "downloadCount": 50, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Yor Forger - Spy x Family", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "yor4-06.safetensors", + "id": 50964, + "sizeKB": 36984.5419921875, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-17T22:41:39.040Z", + "hashes": { + "AutoV1": "73918FCE", + "AutoV2": "4872AD89CD", + "SHA256": "4872AD89CD5D89C87481A978FFE04E8388070DD02F510C248037CC72B2DA94E0", + "CRC32": "C06422CE", + "BLAKE3": "EA1F7D1430618F405A5A24DBA4E4999A5B05E4317FAAED87C3E8BA66927AC082" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/73571" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/97d4cf3b-7a80-424e-b5cf-3f496cb2af26/width=450/821802.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UDMGbf~VD%s9yYM{IoNGEfRjIAMxQ6%gxux]", + "meta": { + "Size": "512x768", + "seed": 277082765, + "Model": "anyhentai_19", + "steps": 20, + "hashes": { + "model": "011cdb0b18" + }, + "prompt": "upper body, yor, 1girl, solo, off-shoulder sweater, red sweater, collarbone, black hair, red eyes, black hair, short hair, short hair with long locks, bangs, sidelocks, white hairband, looking at viewer, :o, , simple background, arms behind back", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "011cdb0b18", + "name": "anyhentai_19", + "type": "model" + } + ], + "Model hash": "011cdb0b18", + "negativePrompt": "(worst quality, lowres:1.3), 3D, own hands together" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3227dbf8-d2e6-40f8-ac2e-63cd383194a9/width=450/821804.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "U2MP]}00~CRO0000tl0eTd00t,K%0MzV~W-;", + "meta": { + "Size": "512x768", + "seed": 2038459452, + "Model": "anyhentai_19", + "steps": 20, + "hashes": { + "model": "011cdb0b18" + }, + "prompt": "cowboy shot, yor, 1girl, solo, off-shoulder sweater, red sweater, collarbone, bottomless, black hair, red eyes, black hair, short hair, short hair with long locks, bangs, sidelocks, white hairband, looking at viewer, :o, , simple background, squatting, spread legs, arms behind head", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "011cdb0b18", + "name": "anyhentai_19", + "type": "model" + } + ], + "Model hash": "011cdb0b18", + "negativePrompt": "(worst quality, lowres:1.3), 3D, own hands together" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7d4226c7-82be-4104-9587-f6512c06d729/width=450/821841.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UEKm;E~qbHs:~q?bNGR%azxaM{M{?vs9n%IU", + "meta": { + "Size": "512x768", + "seed": 45435480, + "Model": "anyhentai_19", + "steps": 20, + "hashes": { + "model": "011cdb0b18" + }, + "prompt": "cowboy shot, yor, 1girl, solo, red sweater, off-shoulder sweater, collarbone, black pantyhose, black hair, short hair, short hair with long locks, bangs, sidelocks, white hairband, red eyes, looking at viewer, arms behind back, closed mouth, blush, smile, closed mouth, bent over, hands on hips, , simple background", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "011cdb0b18", + "name": "anyhentai_19", + "type": "model" + } + ], + "Model hash": "011cdb0b18", + "negativePrompt": "(worst quality, lowres:1.3), 3D, own hands together" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d48436ea-2127-4f60-a5f7-f3c8cb4bfc8f/width=450/821805.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UHI=GY_NRk%2$%_3-pxuS#-pM{tR~qi_xuNG", + "meta": { + "Size": "512x768", + "seed": 2444183737, + "Model": "anyhentai_19", + "steps": 20, + "hashes": { + "model": "011cdb0b18" + }, + "prompt": "cowboy shot, yor, 1girl, solo, green vest, pants, black hair, short hair, short hair with long locks, bangs, sidelocks, white hairband, red eyes, looking at viewer, arms behind back, closed mouth, blush, smile, closed mouth, leaning forward, , simple background", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "011cdb0b18", + "name": "anyhentai_19", + "type": "model" + } + ], + "Model hash": "011cdb0b18", + "negativePrompt": "(worst quality, lowres:1.3), 3D, own hands together" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4939b9b6-c768-412a-80dc-f11c61e4449d/width=450/821803.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UHIp}B~Wof-V-p?bozt7%gRjazWX9ERjoLof", + "meta": { + "Size": "512x768", + "seed": 4107230456, + "Model": "anyhentai_19", + "steps": 20, + "hashes": { + "model": "011cdb0b18" + }, + "prompt": "cowboy shot, yor, 1girl, solo, red sweater, off-shoulder sweater, collarbone, black hair, short hair, short hair with long locks, bangs, sidelocks, white hairband, red eyes, looking at viewer, black pantyhose, arms behind head, closed mouth, blush, smile, closed mouth, (spread legs), sitting, , , simple background", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "multipleCuteStyle_cute2", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "011cdb0b18", + "name": "anyhentai_19", + "type": "model" + } + ], + "Model hash": "011cdb0b18", + "negativePrompt": "(worst quality, lowres:1.3), 3D, own hands together" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f0cae708-3346-41b3-8e8f-bf26b0b80e5a/width=450/821861.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1536, + "hash": "U6JHUEwI0K~p00IVIVW:%Loz?Hwv009ZWBIo", + "meta": { + "Size": "512x768", + "seed": 2570336859, + "Model": "anyhentai_19", + "steps": 20, + "hashes": { + "model": "011cdb0b18" + }, + "prompt": "upper body, yor, 1girl, solo, nude, collarbone, black hair, short hair, short hair with long locks, bangs, sidelocks, white hairband, red eyes, looking at viewer, blush, :o, , simple background, arms behind back", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "011cdb0b18", + "name": "anyhentai_19", + "type": "model" + } + ], + "Model hash": "011cdb0b18", + "negativePrompt": "(worst quality, lowres:1.3), 3D, own hands together" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/31c2de9a-158d-4430-bdd9-021cf2727de8/width=450/821936.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "ULLXA3^+t6%L~qIUWBj[xuM{V@Rj_N%Mt7t7", + "meta": { + "Size": "512x768", + "seed": 2625820630, + "Model": "anyhentai_19", + "steps": 20, + "hashes": { + "model": "011cdb0b18" + }, + "prompt": "yor, 1girl, solo, (black) dress, sleeveless dress, black thighhighs, black hair, short hair, short hair with long locks, bangs, sidelocks, white hairband, red eyes, looking at viewer, blush, :o, , simple background, squatting, (spread legs), arms behind back, , large breasts", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "multipleCuteStyle_cute1", + "type": "lora", + "weight": 0.4 + }, + { + "hash": "011cdb0b18", + "name": "anyhentai_19", + "type": "model" + } + ], + "Model hash": "011cdb0b18", + "negativePrompt": "(worst quality, lowres:1.3), 3D, own hands together" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f801627c-4fe5-4dc3-9bb6-4b1803b38227/width=450/821958.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "UGM7Ju~V-p~W4:NHofNHxuMxM{IU00t7t7%g", + "meta": { + "Size": "512x768", + "seed": 1182691346, + "Model": "anyhentai_19", + "steps": 20, + "hashes": { + "model": "011cdb0b18" + }, + "prompt": "yor, 1girl, solo, naked t-shirt, bottomless, black hair, short hair, short hair with long locks, bangs, sidelocks, white hairband, red eyes, looking at viewer, blush, :o, , simple background, all fours, , large breasts", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "multipleCuteStyle_cute1", + "type": "lora", + "weight": 0.4 + }, + { + "hash": "011cdb0b18", + "name": "anyhentai_19", + "type": "model" + } + ], + "Model hash": "011cdb0b18", + "negativePrompt": "(worst quality, lowres:1.3), 3D, own hands together" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/73571" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yor4-06.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yor4-06.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..ce1e6f202e50902cac28dcf54bb8174675926a55 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yor4-06.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yor4-06.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yor4-06.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..2dfcea9368b475946bd93ff2590ea281d825f741 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yor4-06.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:4872ad89cd5d89c87481a978ffe04e8388070dd02f510c248037cc72b2da94e0 +size 37872171 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yorBriarSpyFamily_lykonV1.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yorBriarSpyFamily_lykonV1.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..888cc356ed7a5f8a92174fdbcd559b4284001d56 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yorBriarSpyFamily_lykonV1.civitai.info" @@ -0,0 +1,328 @@ +{ + "id": 8531, + "modelId": 7256, + "name": "lykon_v1", + "createdAt": "2023-02-07T20:27:48.030Z", + "updatedAt": "2023-03-23T22:10:34.366Z", + "trainedWords": [ + "yor briar" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "model": { + "name": "Yor Briar (Spy \u00d7 Family) LoRA", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "yorBriarSpyFamily_lykonV1.safetensors", + "id": 8412, + "sizeKB": 147569.1181640625, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-02-07T20:30:59.821Z", + "hashes": { + "AutoV1": "CD752E3E", + "AutoV2": "117AEFF5CD", + "SHA256": "117AEFF5CD953D35F15CE0963E9BCBA36F8965F4E02FE03FF602582BF5FCFE7D", + "CRC32": "E6722874", + "BLAKE3": "6FE8262F59984CC828AB8B0E10964AA919C9BCA439E8E47EE474F06642528932" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/8531" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/071744a9-e992-4c75-7c27-15bdba2baf00/width=450/81097.jpeg", + "nsfw": false, + "width": 920, + "height": 1376, + "hash": "UGFrCm?b4.9ZEL$*NaW=%2oz9ZM{0KRP~Wxa", + "meta": { + "ENSD": "31337", + "Size": "920x1376", + "seed": 3187489593, + "steps": 20, + "prompt": "yor briar,\n\n1girl, backlighting, bare shoulders, black background, black dress, black gloves, black hair, blood, blood on face, blood on weapon, breasts, closed mouth, cowboy shot, dress, earrings, expressionless, fingerless gloves, floating hair, floral print, flower, gloves, gold earrings, gold hairband, hair flower, hair ornament, hairband, holding, holding weapon, jewelry, large breasts, light particles, long hair, looking at viewer, off-shoulder dress, off shoulder, petals, red eyes, rose, rose petals, rose print, short hair with long locks, sidelocks, solo, spikes, thighs, two-sided dress, two-sided fabric, weapon\n\n, ((masterpiece))\n\n", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "Clip skip": "2", + "Mask blur": "4", + "resources": [ + { + "name": "yor", + "type": "lora", + "weight": 0.6 + } + ], + "Model hash": "e4b17ce185", + "negativePrompt": "(painting by bad-artist-anime:0.9), (painting by bad-artist:0.9), watermark, text, error, blurry, jpeg artifacts, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, artist name, (worst quality, low quality:1.4), bad anatomy", + "Denoising strength": "0.34" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ef5f0ee7-912b-4b5b-3370-5928922bd200/width=450/81105.jpeg", + "nsfw": false, + "width": 896, + "height": 1344, + "hash": "UcI4|t9EpHxu~WM|NGn%o~NGs:jcNcIVofWB", + "meta": { + "ENSD": "31337", + "Size": "896x1344", + "seed": 3187489595, + "steps": 20, + "prompt": "yor briar,\n\n1girl, bangs, black pantyhose, book, bookshelf, breasts, cleavage, coffee, coffee mug, cup, earrings, gold earrings, gold hairband, hairband, jewelry, long hair, long sleeves, looking at viewer, medium breasts, mug, off-shoulder sweater, off shoulder, out of frame, pantyhose, plant, red eyes, red sweater, smile, solo, sweater, white hairband, window\n\n, ((masterpiece))\n\n", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "Clip skip": "2", + "Mask blur": "4", + "resources": [ + { + "name": "yor", + "type": "lora", + "weight": 0.7 + } + ], + "Model hash": "ae3f6911a1", + "negativePrompt": "(painting by bad-artist-anime:0.9), (painting by bad-artist:0.9), watermark, text, error, blurry, jpeg artifacts, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, artist name, (worst quality, low quality:1.4), bad anatomy", + "Denoising strength": "0.4" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/06096dc9-d670-4999-4ebe-0f2236216e00/width=450/81104.jpeg", + "nsfw": false, + "width": 920, + "height": 1376, + "hash": "UeP6?b-;~qjFxuxvxuD%?bxuD%RPM{RjR*xu", + "meta": { + "ENSD": "31337", + "Size": "920x1376", + "seed": 1608367123, + "steps": 20, + "prompt": "yor briar,\n\n1girl, bangs, bare legs, black footwear, black hair, dress shirt, earrings, flats, full body, green skirt, green vest, hairband, jewelry, kneeling, long hair, long sleeves, looking at viewer, miniskirt, office lady, open mouth, pencil skirt, red eyes, seiza, shadow, shirt, sidelocks, simple background, sitting, skirt, solo, vest, white background, white hairband, white shirt\n\n, ((masterpiece))\n\n", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "Clip skip": "2", + "Mask blur": "4", + "resources": [ + { + "name": "yor", + "type": "lora", + "weight": 0.7 + } + ], + "Model hash": "ae3f6911a1", + "negativePrompt": "(painting by bad-artist-anime:0.9), (painting by bad-artist:0.9), watermark, text, error, blurry, jpeg artifacts, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, artist name, (worst quality, low quality:1.4), bad anatomy", + "Denoising strength": "0.31" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d293a04f-3213-4515-3e2a-a3fe528cae00/width=450/81103.jpeg", + "nsfw": false, + "width": 920, + "height": 1376, + "hash": "UnKT=3?Ht*x[_Nt8%2ogS5kCt7ae-VxaM{R*", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3187489594, + "steps": 20, + "prompt": "yor briar,\n\n1girl, bangs, black hair, collarbone, earrings, hairband, jewelry, leaf, long hair, long sleeves, off-shoulder shirt, off shoulder, red eyes, red shirt, shirt, solo, upper body, white hairband\n\n, ((masterpiece))\n\n", + "sampler": "DPM++ SDE Karras", + "cfgScale": 9, + "Clip skip": "2", + "resources": [], + "Model hash": "ae3f6911a1", + "Hires steps": "10", + "Hires upscale": "1.8", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(painting by bad-artist-anime:0.9), (painting by bad-artist:0.9), watermark, text, error, blurry, jpeg artifacts, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, artist name, (worst quality, low quality:1.4), bad anatomy", + "Denoising strength": "0.38" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/149e635a-3675-4b7b-9a83-d22f51890d00/width=450/81102.jpeg", + "nsfw": false, + "width": 920, + "height": 1376, + "hash": "UJExw;~Va_Io?G^jNG%LM{xZ-pR*NFs:?Gxt", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1527693373, + "steps": 20, + "prompt": "yor briar, (photorealistic), beautiful girl, \n\nbacklighting, bare shoulders, black background, black dress, black gloves, black hair, breasts, closed mouth, cowboy shot, dress, earrings, expressionless, fingerless gloves, floating hair, gloves, gold earrings, gold hairband, hair flower, hair ornament, hairband, jewelry, large breasts, light particles, long hair, looking at viewer, off-shoulder dress, off shoulder, petals, red eyes, short hair with long locks, sidelocks, solo, spikes, thighs, two-sided dress, two-sided fabric\n\n, ((masterpiece))\n\n", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "yor", + "type": "lora", + "weight": 0.6 + } + ], + "Model hash": "1dceefec07", + "Hires steps": "20", + "Hires upscale": "1.8", + "Hires upscaler": "Latent", + "negativePrompt": "((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), (out of frame), extra fingers, mutated hands, ((poorly drawn hands)), ((poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs)), cloned face, (((disfigured))). (((more than 2 nipples))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), ((long neck)))", + "Denoising strength": "0.48" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4a4f3fd0-c749-442e-574c-bda776f60e00/width=450/81101.jpeg", + "nsfw": false, + "width": 920, + "height": 1376, + "hash": "USJtYd_2tlsm~Wogt8oJ?G-T-oR*0LD*Ip%2", + "meta": { + "ENSD": "31337", + "Size": "920x1376", + "seed": 246422378, + "steps": 25, + "prompt": "yor briar, (photorealistic), beautiful girl,\n\nbacklighting, bare shoulders, black background, black dress, black gloves, black hair, breasts, closed mouth, cowboy shot, dress, earrings, expressionless, fingerless gloves, floating hair, gloves, gold earrings, gold hairband, hair flower, hair ornament, ((hairband)), jewelry, large breasts, light particles, long hair, looking at viewer, off-shoulder dress, off shoulder, petals, red eyes, short hair with long locks, sidelocks, solo, spikes, thighs, two-sided dress, two-sided fabric\n\n, ((masterpiece))\n\n", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "Clip skip": "2", + "Mask blur": "4", + "resources": [ + { + "name": "yor", + "type": "lora", + "weight": 0.6 + } + ], + "Model hash": "c35782bad8", + "negativePrompt": "((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), (out of frame), extra fingers, mutated hands, ((poorly drawn hands)), ((poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs)), cloned face, (((disfigured))). (((more than 2 nipples))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), ((long neck)))", + "Denoising strength": "0.31" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1d914e94-5048-45bf-0b30-6d44975aa100/width=450/81100.jpeg", + "nsfw": false, + "width": 920, + "height": 1376, + "hash": "UcJHO1Dio}%2~WM{IUt7NaELRPM{oMW;kWjF", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3187489595, + "steps": 20, + "prompt": "yor briar,\n\n1girl, ass, bedroom, black bra, black hair, black panties, black pantyhose, bra, clothes pull, earrings, from behind, gold earrings, hairband, jewelry, lips, long hair, looking at viewer, looking back, no pants, off-shoulder sweater, off shoulder, on floor, pantyhose, red eyes, red sweater, sitting, solo, sweater, underwear, white hairband\n\n, ((masterpiece))\n\n", + "sampler": "DPM++ SDE Karras", + "cfgScale": 9, + "Clip skip": "2", + "resources": [], + "Model hash": "ae3f6911a1", + "Hires steps": "10", + "Hires upscale": "1.8", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(painting by bad-artist-anime:0.9), (painting by bad-artist:0.9), watermark, text, error, blurry, jpeg artifacts, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, artist name, (worst quality, low quality:1.4), bad anatomy", + "Denoising strength": "0.38" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/925136d8-8e3e-4370-b64d-b164d03a5700/width=450/81099.jpeg", + "nsfw": true, + "width": 920, + "height": 1376, + "hash": "UGJQ+q?aIT}[?b-q4nM{00tRoMIn9[Sextxa", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1608367124, + "steps": 20, + "prompt": "yor briar,\n\n1girl, portrait, animal ears, bangs, black hair, black leotard, black pantyhose, black thighhighs, earrings, flower, gold earrings, gold hairband, hairband, highleg, highleg leotard, jewelry, medium breasts, leotard, looking at viewer, pantyhose, playboy bunny, rabbit ears, red eyes, red flower, red lips, red rose, rose, short hair with long locks, single leg pantyhose, single thighhigh, solo, thighhighs, wrist cuffs, asimmetrical legwear, \n\n, ((masterpiece))\n\n", + "sampler": "DPM++ SDE Karras", + "cfgScale": 9, + "Clip skip": "2", + "resources": [ + { + "name": "yor", + "type": "lora", + "weight": 0.7 + } + ], + "Model hash": "0873291ac5", + "Hires steps": "10", + "Hires upscale": "1.8", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(painting by bad-artist-anime:0.9), (painting by bad-artist:0.9), watermark, text, error, blurry, jpeg artifacts, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, artist name, (worst quality, low quality:1.4), bad anatomy", + "Denoising strength": "0.38" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3c565476-5cba-4c9e-fcab-04f7bda34c00/width=450/81098.jpeg", + "nsfw": false, + "width": 920, + "height": 1376, + "hash": "UGF#{=~WI@4:?b%LI@_2MxRQ-;E20Kxt-oRj", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1527693373, + "steps": 20, + "prompt": "yor briar, (photorealistic), beautiful girl, girl, full body portrait of a stunningly beautiful ( young girl : 1.5 ),(detailed face), (view from_front ) , sakura, by artist christophe young and by artist ilya kuvshinov, hdr, \nbacklighting, bare shoulders, black background, black dress, black gloves, black hair, breasts, closed mouth, cowboy shot, dress, earrings, expressionless, fingerless gloves, floating hair, gloves, gold earrings, gold hairband, hair flower, hair ornament, hairband, jewelry, large breasts, light particles, long hair, looking at viewer, off-shoulder dress, off shoulder, petals, red eyes, short hair with long locks, sidelocks, solo, spikes, thighs, two-sided dress, two-sided fabric\n\n, ((masterpiece))\n\n", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "yor", + "type": "lora", + "weight": 0.6 + } + ], + "Model hash": "1dceefec07", + "Hires steps": "20", + "Hires upscale": "1.8", + "Hires upscaler": "Latent", + "negativePrompt": "((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), (out of frame), extra fingers, mutated hands, ((poorly drawn hands)), ((poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs)), cloned face, (((disfigured))). (((more than 2 nipples))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), ((long neck)))", + "Denoising strength": "0.48" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ec06c87f-cc4a-4eea-5493-a5411d8b4b00/width=450/81202.jpeg", + "nsfw": true, + "width": 920, + "height": 1376, + "hash": "UKIq[l~qIo9Z?bs:9Z%M9Foz%LM{E0n%xaIU", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 246422378, + "steps": 25, + "prompt": "yor briar, 1girl, bare shoulders, black dress, black hair, breasts, closed mouth, dress, earrings, flower, hair flower, hair ornament, hairband, jewelry, medium breasts, long hair, looking at viewer, red eyes, sidelocks, sleeveless, solo, upper body, black background\n, ((masterpiece))\n\n", + "sampler": "DPM++ SDE Karras", + "cfgScale": 9, + "Clip skip": "2", + "resources": [ + { + "name": "yor", + "type": "lora", + "weight": 0.6 + } + ], + "Model hash": "ae3f6911a1", + "Hires steps": "20", + "Hires upscale": "1.8", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), (out of frame), extra fingers, mutated hands, ((poorly drawn hands)), ((poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs)), cloned face, (((disfigured))). (((more than 2 nipples))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), ((long neck)))", + "Denoising strength": "0.48" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/8531" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yorBriarSpyFamily_lykonV1.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yorBriarSpyFamily_lykonV1.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..bf7afe5dc3f5fc68d7e84916795c08a3a77cb225 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yorBriarSpyFamily_lykonV1.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:ad0f4c8e8616967c7a1102d8b07f395e4266114960d57650b0796420f5f8d721 +size 1403483 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yorBriarSpyFamily_lykonV1.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yorBriarSpyFamily_lykonV1.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..99857a0f2963cb13aae90bc4c5811a0c9c88e8b9 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yorBriarSpyFamily_lykonV1.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:117aeff5cd953d35f15ce0963e9bcba36f8965f4e02fe03ff602582bf5fcfe7d +size 151110777 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yorForger_v1.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yorForger_v1.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..3fb94c7267bb48a87bb15679eee89b7ca6266483 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yorForger_v1.civitai.info" @@ -0,0 +1,423 @@ +{ + "id": 7362, + "modelId": 6281, + "name": "v1", + "createdAt": "2023-02-02T06:27:36.541Z", + "updatedAt": "2023-02-18T13:48:59.343Z", + "trainedWords": [ + "yorforger" + ], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": "

v1

", + "stats": { + "downloadCount": 1438, + "ratingCount": 2, + "rating": 4.5 + }, + "model": { + "name": "Yor Forger", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "yorForger_v1.safetensors", + "id": 7440, + "sizeKB": 73804.7890625, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-02-02T06:31:27.413Z", + "hashes": { + "AutoV1": "0FA10092", + "AutoV2": "24C347988A", + "SHA256": "24C347988AEDB11E287D1917EAC3376061870D88152BF982ADEC72BB7527BD82", + "CRC32": "C8E9EE42", + "BLAKE3": "7D0D227153D8281EB0AD6FD009FB4708801DFE37E18C4F0AA7918FFBB3D6CDEC" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/7362" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4be6aa5e-ba8b-4d8c-5ab1-a2f9cbda4d00/width=450/68471.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UdIrHARh.5S6xzVtWGtRx]s+xubcShj[xts=", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2305547331, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 22, + "prompt": "masterpiece, best quality, (YorForger), 1girl, solo, pants, sky, breasts, smile, gloves, outdoors,tight, bow, flower, sidelocks, grass, day, standing, cloud, dandelion, belt, thighs, shirt, white pants, looking at viewer, hair bow, blue eyes, blue sky, tight pants, long hair, black gloves, hair between eyes, medium breasts, closed mouth, long sleeves, black bow, (red eyes), black_hair", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7.5, + "Clip skip": "2", + "resources": [ + { + "hash": "a87fd7da", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + }, + { + "hash": "07afbbd3", + "name": "000012", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "a87fd7da", + "AddNet Enabled": "True", + "AddNet Model 1": "Yor-000012(07afbbd3)", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name, (worst quality, low quality, extra digits, loli, loli face:1.3), bad-hands-5, negprompt5,bad-image-v2-39000, art by bad-artist", + "AddNet Module 1": "LoRA", + "AddNet Weight 1": "1" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/934a527e-a9d1-4176-5291-54c99a672a00/width=450/68485.jpeg", + "nsfw": false, + "width": 512, + "height": 768, + "hash": "UXIYF48^.P%LS.n2IvItITXRobX8IAX7s8M}", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1303173380, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 22, + "prompt": "masterpiece, best quality, (YorForger:1.3), 1girl, solo, pants, sky, breasts, smile, gloves, outdoors,tight, bow, flower, sidelocks, grass, day, standing, cloud, dandelion, belt, thighs, shirt, white pants, looking at viewer, hair bow, blue eyes, blue sky, tight pants, black gloves, hair between eyes, medium breasts, closed mouth, long sleeves, black bow, (red eyes), black hair", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7.5, + "Clip skip": "2", + "resources": [ + { + "hash": "a87fd7da", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + }, + { + "hash": "07afbbd3", + "name": "000012", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "a87fd7da", + "AddNet Enabled": "True", + "AddNet Model 1": "Yor-000012(07afbbd3)", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name, (worst quality, low quality, extra digits, loli, loli face:1.3), bad-hands-5, negprompt5,bad-image-v2-39000, art by bad-artist", + "AddNet Module 1": "LoRA", + "AddNet Weight 1": "1" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e17bfd4c-fda4-48b7-632a-3144be4e6000/width=450/68484.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UgKKKCIWW.%L~pRjbHxuIVadxbtRNHS1jbxt", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 935765706, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 22, + "prompt": "masterpiece, best quality, (YorForger), 1girl, breasts, skirt, shirt, pantyhose, solo, sitting, cigarette, contemporary, holding, smoke, chair, cleavage, earrings, jewelry, paper, smoking, desk, indoors, office, braid, bangs, miniskirt, bra, underwear, office lady, hair over one eye, crossed legs, large breasts, black footwear, holding cigarette, white shirt, button gap, collared shirt, high heels, office chair, black skirt, alternate costume, looking at viewer, (red eyes), bra peek, long sleeves, pencil skirt, very long hair, hair ornament, braided ponytail, tassel earrings, brown pantyhose, shirt tucked in, dress shirt, black pantyhose, black bra, black hair, closed mouth, partially unbuttoned, one eye covered", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7.5, + "Clip skip": "2", + "resources": [ + { + "hash": "a87fd7da", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + }, + { + "hash": "07afbbd3", + "name": "000012", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "a87fd7da", + "AddNet Enabled": "True", + "AddNet Model 1": "Yor-000012(07afbbd3)", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name, (worst quality, low quality, extra digits, loli, loli face:1.3), bad-hands-5, negprompt5,bad-image-v2-39000, art by bad-artist", + "AddNet Module 1": "LoRA", + "AddNet Weight 1": "1" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c73c07ad-0bca-4540-243b-5d6427cd5600/width=450/68483.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UgJQ+mMzRPxu~qIobFozNGRPofbvIoR*fPs:", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2406422326, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 22, + "prompt": "masterpiece, best quality, (YorForger), 1girl, breasts, skirt, shirt, pantyhose, solo, sitting, cigarette, contemporary, holding, smoke, chair, cleavage, earrings, jewelry, paper, smoking, desk, indoors, office, miniskirt, bra, underwear, office lady, hair over one eye, crossed legs, large breasts, black footwear, holding cigarette, white shirt, button gap, collared shirt, high heels, office chair, black skirt, alternate costume, looking at viewer, (red eyes), bra peek, long sleeves, pencil skirt, hair ornament, braided ponytail, tassel earrings, brown pantyhose, shirt tucked in, dress shirt, black pantyhose, black bra, black hair, closed mouth, partially unbuttoned, one eye covered", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7.5, + "Clip skip": "2", + "resources": [ + { + "hash": "a87fd7da", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + }, + { + "hash": "07afbbd3", + "name": "000012", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "a87fd7da", + "AddNet Enabled": "True", + "AddNet Model 1": "Yor-000012(07afbbd3)", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name, (worst quality, low quality, extra digits, loli, loli face:1.3), bad-hands-5, negprompt5,bad-image-v2-39000, art by bad-artist", + "AddNet Module 1": "LoRA", + "AddNet Weight 1": "1" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/bf3bbd9c-8d25-49a7-df3d-a7e2e5137c00/width=450/68482.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UZJ*uH-nuPXnI^tQNeWUE2tRs;SORQtRRPV@", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3232981881, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 22, + "prompt": "masterpiece, best quality, (YorForger), 1girl, breasts, solo, bangs, armpits, smile, sky, cleavage, jewelry, gloves, jacket, dice, mole, cloud, grin, black dress, blush, earrings, thighs, tassel, sleeveless, day, outdoors, large breasts, looking at viewer, (red eyes), arms up, short hair,black hair, fur trim, white jacket, blue sky, mole on breast, arms behind head, bob cut, (black hair), fur-trimmed jacket, elbow gloves, bare shoulders, parted lips, clothing cutout, pelvic curtain, asymmetrical gloves Negative", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7.5, + "Clip skip": "2", + "resources": [ + { + "hash": "a87fd7da", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + }, + { + "hash": "cd84aafd", + "name": "000020", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "a87fd7da", + "AddNet Enabled": "True", + "AddNet Model 1": "Yor-000020(cd84aafd)", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name, (worst quality, low quality, extra digits, loli, loli face:1.3), bad-hands-5, negprompt5,bad-image-v2-39000, art by bad-artist", + "AddNet Module 1": "LoRA", + "AddNet Weight 1": "1" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b6a49058-a549-4463-f0bc-103be3026f00/width=450/68481.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UnI=Z9RP*0t7x]WCS4oKIURPV?RjIoR*t7Rk", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1257115106, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 22, + "prompt": "masterpiece, best quality, (YorForger), 1girl, breasts, solo, armpits, smile, sky, cleavage, jewelry, gloves, cloud, grin, black dress, blush, earrings, thighs, tassel, sleeveless, day, outdoors, large breasts, looking at viewer, (red eyes), arms up, short hair,black hair, fur trim, white jacket, blue sky, mole on breast, arms behind head, bob cut, (black hair), fur-trimmed jacket, elbow gloves, bare shoulders, parted lips, clothing cutout, pelvic curtain, asymmetrical gloves", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7.5, + "Clip skip": "2", + "resources": [ + { + "hash": "a87fd7da", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + }, + { + "hash": "cd84aafd", + "name": "000020", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "a87fd7da", + "AddNet Enabled": "True", + "AddNet Model 1": "Yor-000020(cd84aafd)", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name, (worst quality, low quality, extra digits, loli, loli face:1.3), bad-hands-5, negprompt5,bad-image-v2-39000, art by bad-artist", + "AddNet Module 1": "LoRA", + "AddNet Weight 1": "1" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/89ffb2cd-fec7-4518-d9a7-b9aebb0ea900/width=450/68480.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UYJRp=rDlo%McG%1bxt7IARPRQW=ITaes.sm", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2896254328, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 22, + "prompt": "masterpiece, best quality, (YorForger), 1girl, breasts, solo, armpits, smile, cleavage, jewelry, gloves, cloud, grin, black dress, blush, earrings, thighs, tassel, sleeveless, day, outdoors, large breasts, looking at viewer, (red eyes), arms up, short hair,black hair, fur trim, white jacket, blue sky, arms behind head, bob cut, (black hair),elbow gloves, bare shoulders, parted lips, clothing cutout, pelvic curtain, asymmetrical gloves", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7.5, + "Clip skip": "2", + "resources": [ + { + "hash": "a87fd7da", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + }, + { + "hash": "cd84aafd", + "name": "000020", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "a87fd7da", + "AddNet Enabled": "True", + "AddNet Model 1": "Yor-000020(cd84aafd)", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name, (worst quality, low quality, extra digits, loli, loli face:1.3), bad-hands-5, negprompt5,bad-image-v2-39000, art by bad-artist", + "AddNet Module 1": "LoRA", + "AddNet Weight 1": "1" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/10f9c71c-d4b9-4bf4-3b37-579f8b880500/width=450/68479.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UWKU4jRj_N?b^+RjWB-;9ZjuM_RjRkbvoeoL", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3070391645, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 22, + "prompt": "(YorForger), 1girl, breasts, solo, armpits, smile, cleavage, jewelry, gloves, black dress, blush, earrings, thighs, tassel, sleeveless, large breasts, looking at viewer, (red eyes), arms up, black hair, arms behind head, (black hair), elbow gloves, bare shoulders, parted lips, clothing cutout, pelvic curtain, asymmetrical gloves, head band", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7.5, + "Clip skip": "2", + "resources": [ + { + "hash": "a87fd7da", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + }, + { + "hash": "07afbbd3", + "name": "000012", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "a87fd7da", + "AddNet Enabled": "True", + "AddNet Model 1": "Yor-000012(07afbbd3)", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name, (worst quality, low quality, extra digits, loli, loli face:1.3)", + "AddNet Module 1": "LoRA", + "AddNet Weight 1": "1" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/519e4285-448e-46d3-59cf-c68eb53ac000/width=450/68478.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UCHxBA9aTe?b~WS$xu?H01^+%1D*%#E2RO%2", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1985477496, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 22, + "prompt": "(YorForger), 1girl, breasts, solo, armpits, smile, jewelry, gloves, black dress, blush, earrings, thighs, tassel, sleeveless, large breasts, looking at viewer, (red eyes), arms up, black hair, arms behind head, (black hair), elbow gloves, bare shoulders, parted lips, pelvic curtain, asymmetrical gloves, head band, black shirt", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7.5, + "Clip skip": "2", + "resources": [ + { + "hash": "a87fd7da", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + }, + { + "hash": "07afbbd3", + "name": "000012", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "a87fd7da", + "AddNet Enabled": "True", + "AddNet Model 1": "Yor-000012(07afbbd3)", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name, (worst quality, low quality, extra digits, loli, loli face:1.3)", + "AddNet Module 1": "LoRA", + "AddNet Weight 1": "1" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/152f2f6c-2a03-4343-4be3-713962203b00/width=450/68477.jpeg", + "nsfw": false, + "width": 512, + "height": 768, + "hash": "UOIOhB4.AAt7X1%Mk6Io$vIUtPsANESN~WWX", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2383661581, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 20, + "prompt": "(YorForger), (red eyes), (black hair), head band, reflective eyes, looking at the viewer, water, white shirt, gothic, adult", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 7.5, + "Clip skip": "2", + "resources": [ + { + "hash": "a87fd7da", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + }, + { + "hash": "68f2ed4c", + "name": "000016", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "a87fd7da", + "AddNet Enabled": "True", + "AddNet Model 1": "Yor-000016(68f2ed4c)", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name, (worst quality, low quality, extra digits, loli, loli face:1.3)", + "AddNet Module 1": "LoRA", + "AddNet Weight 1": "1" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/7362" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yorForger_v1.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yorForger_v1.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..6f462a0c70fd4c9b00edfb8f9ff4b938fd4d75e3 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yorForger_v1.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yorForger_v1.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yorForger_v1.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..105879ec7c0b44ec0c82aa11e3b0542fdae0c976 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yorForger_v1.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:24c347988aedb11e287d1917eac3376061870d88152bf982adec72bb7527bd82 +size 75576104 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yorbriar.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yorbriar.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..f55fd45024420eed1c36e7b387e1f28abe0bd8c7 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yorbriar.civitai.info" @@ -0,0 +1,515 @@ +{ + "id": 107007, + "modelId": 99975, + "name": "v1.0", + "createdAt": "2023-06-30T02:45:23.511Z", + "updatedAt": "2023-06-30T02:48:28.443Z", + "trainedWords": [ + "yor briar, black hair, (red eyes:1.5), earrings, gold hairband, hairband, long hair, sidelocks,", + "black dress, black gloves, black thighhighs, cleavage, covered navel, dress, fingerless gloves, gloves, thighhighs, thighs, waist cape,", + "bare shoulders, collarbone, covered navel, dress, long sleeves, off shoulder, off-shoulder dress, off-shoulder sweater, pantyhose, red sweater, sweater, sweater dress, thighs," + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 812, + "ratingCount": 4, + "rating": 5 + }, + "model": { + "name": "Yor Briar - Spy x Family", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "yorbriar.safetensors", + "id": 75359, + "sizeKB": 37069.0634765625, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-30T02:50:39.525Z", + "hashes": { + "AutoV1": "9221AE74", + "AutoV2": "026EFD4214", + "SHA256": "026EFD421458D85A59C1C891EAF9E9B3B7B27FC402E0FA3A02B53DC0FED3026B", + "CRC32": "21EE2295", + "BLAKE3": "2F5B0FCE84A8F7D5501DFF387F696751A9ADDE19D05A4C56F52367263804C71A" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/107007" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f02ca94f-a3ae-4a6f-8d94-479ff394baa8/width=450/1341624.jpeg", + "nsfw": "None", + "width": 600, + "height": 896, + "hash": "UaI|zg9Z%gWB_NRO%2bHkqWB%2oLM{jFozj[", + "meta": { + "Size": "200x300", + "seed": 3440641015, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "yorbriar, , yor briar, black hair, (red eyes:1.5), earrings, gold hairband, hairband, long hair, sidelocks,\nBREAK bare shoulders, collarbone, dress, long sleeves, off shoulder, off-shoulder dress, off-shoulder sweater, pantyhose, red sweater, sweater, sweater dress, thighs,\nBREAK outdoors, city,\nBREAK looking at viewer, \nBREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "\"yorbriar": "d62c1cbdef9f", + "resources": [ + { + "name": "yorbriar", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/187abdc2-bbab-40a0-aa9d-3922e959ccbc/width=450/1341622.jpeg", + "nsfw": "None", + "width": 600, + "height": 896, + "hash": "UNJQcz4:.SIo_MIU?G%1NtxaV@f5MdR*%Mof", + "meta": { + "Size": "200x300", + "seed": 211556728, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "yorbriar, , yor briar, black hair, (red eyes:1.5), earrings, gold hairband, hairband, long hair, sidelocks,\nBREAK bare shoulders, collarbone, covered navel, dress, long sleeves, off shoulder, off-shoulder dress, off-shoulder sweater, pantyhose, red sweater, sweater, sweater dress, thighs,\nBREAK outdoors, city,\nBREAK looking at viewer, \nBREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "\"yorbriar": "d62c1cbdef9f", + "resources": [ + { + "name": "yorbriar", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d9a7fdb9-3ed8-4a16-8c8f-f739537fe274/width=450/1341626.jpeg", + "nsfw": "Soft", + "width": 600, + "height": 896, + "hash": "UWH_Moxu-;NH~WRk-;j]bIWAt7xuE2ocbIt7", + "meta": { + "Size": "200x300", + "seed": 1216682264, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "yorbriar, , yor briar, black hair, (red eyes:1.5), earrings, gold hairband, hairband, long hair, sidelocks,\nBREAK black dress, black gloves, black thighhighs, cleavage, covered navel, dress, fingerless gloves, gloves, thighhighs, thighs, waist cape,\nBREAK outdoors, city,\nBREAK looking at viewer, \nBREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "\"yorbriar": "d62c1cbdef9f", + "resources": [ + { + "name": "yorbriar", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1a4236c8-f153-46dc-936a-7117c5201b5e/width=450/1341618.jpeg", + "nsfw": "Soft", + "width": 600, + "height": 896, + "hash": "ULGH;:tREexuyD~VxvxuxWxv%LxtIrt6s;t6", + "meta": { + "Size": "200x300", + "seed": 1087223124, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "yorbriar, , yor briar, black hair, (red eyes:1.5), earrings, gold hairband, hairband, long hair, sidelocks,\nBREAK bikini,\nBREAK outdoors, beach,\nBREAK looking at viewer, \nBREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "\"yorbriar": "d62c1cbdef9f", + "resources": [ + { + "name": "yorbriar", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f899d314-1f03-4898-90f2-d174c1357fdd/width=450/1341623.jpeg", + "nsfw": "None", + "width": 600, + "height": 896, + "hash": "U9FEft0y00-:0zMxS2RjB6~CMeRjD4JTx]RP", + "meta": { + "Size": "200x300", + "seed": 211556729, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "yorbriar, , yor briar, black hair, (red eyes:1.5), earrings, gold hairband, hairband, long hair, sidelocks,\nBREAK bare shoulders, collarbone, covered navel, dress, long sleeves, off shoulder, off-shoulder dress, off-shoulder sweater, pantyhose, red sweater, sweater, sweater dress, thighs,\nBREAK outdoors, city,\nBREAK looking at viewer, \nBREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "\"yorbriar": "d62c1cbdef9f", + "resources": [ + { + "name": "yorbriar", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0895917d-605e-4d6d-9be1-c4a423211214/width=450/1341617.jpeg", + "nsfw": "Soft", + "width": 600, + "height": 896, + "hash": "UXIE34~UtQj??G%2-poJM~D*xbj@IqM|n,NG", + "meta": { + "Size": "200x300", + "seed": 50332926, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "yorbriar, , yor briar, black hair, (red eyes:1.5), earrings, gold hairband, hairband, long hair, sidelocks,\nBREAK bikini,\nBREAK outdoors, beach,\nBREAK looking at viewer, \nBREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "\"yorbriar": "d62c1cbdef9f", + "resources": [ + { + "name": "yorbriar", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c71f48c1-1267-4f91-89b7-f026c190d515/width=450/1341621.jpeg", + "nsfw": "Soft", + "width": 600, + "height": 896, + "hash": "U9HBA20f0K?H]$.S~C-B^ktRt8WAI.Io-pw|", + "meta": { + "Size": "200x300", + "seed": 1087223123, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "yorbriar, , yor briar, black hair, (red eyes:1.5), earrings, gold hairband, hairband, long hair, sidelocks,\nBREAK bikini,\nBREAK outdoors, beach,\nBREAK looking at viewer, \nBREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "\"yorbriar": "d62c1cbdef9f", + "resources": [ + { + "name": "yorbriar", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ad9055f1-f639-41f4-a06a-1a11f668443a/width=450/1341627.jpeg", + "nsfw": "Soft", + "width": 600, + "height": 896, + "hash": "U4EoGW0000?G00_2KO00?Hs:0K%g}@D%~Cv$", + "meta": { + "Size": "200x300", + "seed": 1274915151, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "yorbriar, , yor briar, black hair, (red eyes:1.5), earrings, gold hairband, hairband, long hair, sidelocks,\nBREAK black dress, black gloves, black thighhighs, cleavage, covered navel, dress, fingerless gloves, gloves, thighhighs, thighs, waist cape,\nBREAK outdoors, city,\nBREAK looking at viewer, \nBREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "\"yorbriar": "d62c1cbdef9f", + "resources": [ + { + "name": "yorbriar", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9d06b3e8-5346-4bae-ae1c-94e2944ad6a2/width=450/1341620.jpeg", + "nsfw": "Soft", + "width": 600, + "height": 896, + "hash": "UDG[D|00-;?H0K%M9ZD%IT9as.D*~pD*~Wxa", + "meta": { + "Size": "200x300", + "seed": 2082047874, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "yorbriar, , yor briar, black hair, (red eyes:1.5), earrings, gold hairband, hairband, long hair, sidelocks,\nBREAK lingerie,\nBREAK indoors, bed,\nBREAK looking at viewer, \nBREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "\"yorbriar": "d62c1cbdef9f", + "resources": [ + { + "name": "yorbriar", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7ae7298d-dd4d-4fa8-88f8-e4bb2c3e98af/width=450/1341619.jpeg", + "nsfw": "Mature", + "width": 600, + "height": 896, + "hash": "URJ*3Z01_2-p~pMxNFtRIoIojGR+-;M{%M%2", + "meta": { + "Size": "200x300", + "seed": 2082047873, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "yorbriar, , yor briar, black hair, (red eyes:1.5), earrings, gold hairband, hairband, long hair, sidelocks,\nBREAK lingerie,\nBREAK indoors, bed,\nBREAK looking at viewer, \nBREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "\"yorbriar": "d62c1cbdef9f", + "resources": [ + { + "name": "yorbriar", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/107007" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yorbriar.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yorbriar.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..204645b1392d68e477520e9c2e8a2a624928c9e9 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yorbriar.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yorbriar.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yorbriar.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..196fd1b6345c74d3729434ac2f2c984827e87e32 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yorbriar.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:026efd421458d85a59c1c891eaf9e9b3b7b27fc402e0fa3a02b53dc0fed3026b +size 37958721 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yorquebuenaestas.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yorquebuenaestas.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..67b609b973c94f5e202239b8f0822f67217b0dd5 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yorquebuenaestas.civitai.info" @@ -0,0 +1,217 @@ +{ + "id": 114070, + "modelId": 106215, + "name": "v1.0", + "createdAt": "2023-07-09T21:57:59.046Z", + "updatedAt": "2023-07-09T22:40:22.708Z", + "trainedWords": [ + "yor" + ], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": "

This is the first version, it works using AnyLoRA

", + "stats": { + "downloadCount": 37, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Yor from Spy X Family LoRA", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "yorquebuenaestas.safetensors", + "id": 81078, + "sizeKB": 36986.5703125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-07-09T22:01:31.406Z", + "hashes": { + "AutoV1": "E4709094", + "AutoV2": "94C7A40089", + "SHA256": "94C7A4008923746CF07CD0B1C33BB6EF98EAD30FF62D304B548295052A87543A", + "CRC32": "4C360FED", + "BLAKE3": "CCCDB6DB857EF090AE13582A35463C5D28EFE55E18A1FE1EF87C03873DCC81A2" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/114070" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3ae39bb9-bb79-41c7-b6da-e760dd2d5416/width=450/1484873.jpeg", + "nsfw": "Soft", + "width": 2048, + "height": 3072, + "hash": "UaLNfBI:.mXm5nNGt7WVI=R-xGogtln%M{WC", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1, + "Model": "anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "steps": 28, + "hashes": { + "model": "8a952cafe9" + }, + "prompt": "masterpiece,best quality,1girl,bangs,breasts,bare_shoulders,black_hair,blush,collarbone,crescent_earrings,earrings,hairband,hoop_earrings,jewelry,large_breasts,long_hair,looking_at_viewer,red_eyes,black bikini,beach,smile,closed mouth,posing,", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "8a952cafe9", + "name": "anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "type": "model" + }, + { + "hash": "f82c4eb1b8cd", + "name": "yorquebuenaestas", + "type": "lora", + "weight": null + } + ], + "Model hash": "8a952cafe9", + "AddNet Enabled": "True", + "AddNet Model 1": "yorquebuenaestas(f82c4eb1b8cd)", + "negativePrompt": "lowres,bad anatomy,bad hands,text,error,missing fingers,extra digit,fewer digits,cropped,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,username,blurry,\nheight:768,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/48d90081-92ba-42a4-b66e-ec57517ca91b/width=450/1484874.jpeg", + "nsfw": "Mature", + "width": 2048, + "height": 3072, + "hash": "UEK18v9F0LD%0zM{Q-D%01%M~qtRjFxuV@WB", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1, + "Model": "anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "steps": 28, + "hashes": { + "model": "8a952cafe9" + }, + "prompt": "masterpiece,best quality,1girl,bangs,breasts,bare_shoulders,black_hair,blush,collarbone,crescent_earrings,earrings,hairband,hoop_earrings,jewelry,large_breasts,red_eyes,white underwear,smile,closed mouth,standing,", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "8a952cafe9", + "name": "anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "type": "model" + }, + { + "hash": "f82c4eb1b8cd", + "name": "yorquebuenaestas", + "type": "lora", + "weight": null + } + ], + "Model hash": "8a952cafe9", + "AddNet Enabled": "True", + "AddNet Model 1": "yorquebuenaestas(f82c4eb1b8cd)", + "negativePrompt": "lowres,bad anatomy,bad hands,text,error,missing fingers,extra digit,fewer digits,cropped,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,username,blurry,\nheight:768,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7c0f44d7-9a3a-4fff-94b8-9b68a965934b/width=450/1484871.jpeg", + "nsfw": "None", + "width": 2048, + "height": 3072, + "hash": "UEHLC_kYoZ00ELE1H?Io4mV?~q^+Djoz4.ae", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1, + "Model": "anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "steps": 28, + "hashes": { + "model": "8a952cafe9" + }, + "prompt": "masterpiece,best quality,1girl,yor,bangs,black_hair,blush,crescent_earrings,earrings,ponytail,hoop_earrings,hairband,jewelry,large_breasts,red_eyes,oversized white t shirt,yoga pants,from behind,", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "8a952cafe9", + "name": "anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "type": "model" + }, + { + "hash": "f82c4eb1b8cd", + "name": "yorquebuenaestas", + "type": "lora", + "weight": null + } + ], + "Model hash": "8a952cafe9", + "AddNet Enabled": "True", + "AddNet Model 1": "yorquebuenaestas(f82c4eb1b8cd)", + "negativePrompt": "lowres,bad anatomy,bad hands,text,error,missing fingers,extra digit,fewer digits,cropped,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,username,blurry,\nheight:768,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/cdfed56b-9687-4859-8edb-05d3ce2ce8bb/width=450/1484872.jpeg", + "nsfw": "X", + "width": 2048, + "height": 3072, + "hash": "UEJtSU4o5mRk00kCH=xa9ut7%Mxt~q%Li_xu", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1, + "Model": "anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "steps": 28, + "hashes": { + "model": "8a952cafe9" + }, + "prompt": "masterpiece,best quality,1girl,yor,bangs,bare shoulders,collarbone,breasts,black_hair,blush,crescent_earrings,earrings,hairband,hoop_earrings,jewelry,large_breasts,red_eyes,bed,completly naked,lewd smile,nsfw,", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "8a952cafe9", + "name": "anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "type": "model" + }, + { + "hash": "f82c4eb1b8cd", + "name": "yorquebuenaestas", + "type": "lora", + "weight": null + } + ], + "Model hash": "8a952cafe9", + "AddNet Enabled": "True", + "AddNet Model 1": "yorquebuenaestas(f82c4eb1b8cd)", + "negativePrompt": "lowres,bad anatomy,bad hands,text,error,missing fingers,extra digit,fewer digits,cropped,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,username,blurry,\nheight:768,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/114070" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yorquebuenaestas.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yorquebuenaestas.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..1fffbac5e033fac7e2cc10bd4f327117e913cfec Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yorquebuenaestas.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yorquebuenaestas.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yorquebuenaestas.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..e41db1f95e7515c82734bb20d183b1fffa2d5519 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SPY\303\227FAMILY\351\227\264\350\260\215\345\256\266\345\256\266\351\205\222/yorquebuenaestas.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:94c7a4008923746cf07cd0b1c33bb6ef98ead30ff62d304b548295052a87543a +size 37874248 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/SSSS.GRIDMAN/akaneshinjou.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SSSS.GRIDMAN/akaneshinjou.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..6c7013cb0472391ad3f6faec187f04de57d79d9d --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SSSS.GRIDMAN/akaneshinjou.civitai.info" @@ -0,0 +1,376 @@ +{ + "id": 105755, + "modelId": 98864, + "name": "v1.0", + "createdAt": "2023-06-28T09:06:05.852Z", + "updatedAt": "2023-06-28T09:08:33.472Z", + "trainedWords": [ + "shinjou akane, light purple hair, (pink eyes:1.2), short hair,", + "black pantyhose, bow, collared shirt, hood, hooded jacket, jacket, open clothes, open jacket, open shirt, pantyhose, purple bow, purple jacket, school uniform, shirt, sleeves past wrists, unbuttoned shirt, white shirt," + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 340, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Akane Shinjou - SSSS.Gridman", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "akaneshinjou.safetensors", + "id": 74371, + "sizeKB": 37044.1533203125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-28T09:10:44.943Z", + "hashes": { + "AutoV1": "64438EB3", + "AutoV2": "0DAEDB06E6", + "SHA256": "0DAEDB06E67B3B691FEBDE180B952C6C4BD41FF5FC90338117136AF0F2D2CFDD", + "CRC32": "C346E279", + "BLAKE3": "66733EA9A1BB79DA94F76C3A2EAEBF114DE3100DB68C9FAD7C4D98DFFF1AA876" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/105755" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f9ce61fe-e678-4e2f-a9ae-86086059c0c8/width=450/1319216.jpeg", + "nsfw": "None", + "width": 600, + "height": 896, + "hash": "UaJ*C[xtS]9Z~XIUozWBM{Rjxuoys;t7Rjax", + "meta": { + "Size": "200x300", + "seed": 1653295300, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "akaneshinjou, , shinjou akane, light purple hair, (pink eyes:1.2), short hair,\nBREAK black pantyhose, bow, collared shirt, hood, hooded jacket, jacket, open clothes, open jacket, open shirt, pantyhose, purple bow, purple jacket, school uniform, shirt, sleeves past wrists, unbuttoned shirt, white shirt,,\nBREAK indoors, city,\nBREAK looking at viewer, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "akaneshinjou", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"akaneshinjou": "f9d3f5effea4", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4bf6c1ca-6e4a-455a-a39f-ac5d0f0968e2/width=450/1319212.jpeg", + "nsfw": "None", + "width": 600, + "height": 896, + "hash": "UIEx^$?b0Jxv~DxuI.xuVts:tRWV?ItQIUM{", + "meta": { + "Size": "200x300", + "seed": 289382236, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "akaneshinjou, , shinjou akane, light purple hair, (pink eyes:1.2), short hair,\nBREAK black pantyhose, bow, collared shirt, hood, hooded jacket, jacket, open clothes, open jacket, open shirt, pantyhose, purple bow, purple jacket, school uniform, shirt, sleeves past wrists, unbuttoned shirt, white shirt,\nBREAK indoors, city,\nBREAK looking at viewer, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "akaneshinjou", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"akaneshinjou": "f9d3f5effea4", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9ef779b2-e8d5-463c-88bf-d9d3ff3f985e/width=450/1319214.jpeg", + "nsfw": "None", + "width": 600, + "height": 896, + "hash": "UfI#J.IUEdxt~WM{kWxuMxaekCofxaozM{WB", + "meta": { + "Size": "200x300", + "seed": 289382237, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "akaneshinjou, , shinjou akane, light purple hair, (pink eyes:1.2), short hair,\nBREAK black pantyhose, bow, collared shirt, hood, hooded jacket, jacket, open clothes, open jacket, open shirt, pantyhose, purple bow, purple jacket, school uniform, shirt, sleeves past wrists, unbuttoned shirt, white shirt,\nBREAK indoors, city,\nBREAK looking at viewer, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "akaneshinjou", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"akaneshinjou": "f9d3f5effea4", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0ace754a-3109-4272-9d18-a4a78a38cca7/width=450/1319215.jpeg", + "nsfw": "Soft", + "width": 600, + "height": 896, + "hash": "UjI;#X~qK0tRR.SiShR*RRV@xZof%2ofRjWX", + "meta": { + "Size": "200x300", + "seed": 2524818378, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "akaneshinjou, , shinjou akane, light purple hair, (pink eyes:1.2), short hair,\nBREAK bikini,\nBREAK outdoors, beach,\nBREAK looking at viewer, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "akaneshinjou", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"akaneshinjou": "f9d3f5effea4", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/76f5eb72-d0e3-41f9-a7d1-11cf8ccdf710/width=450/1319210.jpeg", + "nsfw": "Soft", + "width": 600, + "height": 896, + "hash": "USKv?r~qSwbJ-XR-%1WB9boMxtoykXNdE2Ip", + "meta": { + "Size": "200x300", + "seed": 2524818377, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "akaneshinjou, , shinjou akane, light purple hair, (pink eyes:1.2), short hair,\nBREAK bikini,\nBREAK outdoors, beach,\nBREAK looking at viewer, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "akaneshinjou", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"akaneshinjou": "f9d3f5effea4", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1c4bfd9f-4ce4-42d5-aa5b-d9cb750ef896/width=450/1319213.jpeg", + "nsfw": "Soft", + "width": 600, + "height": 896, + "hash": "UIK0:A00AUb]_39FIn%L~X8{t7tRI[s+%1t7", + "meta": { + "Size": "200x300", + "seed": 3578292839, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "akaneshinjou, , shinjou akane, light purple hair, (pink eyes:1.2), short hair,\nBREAK lingerie,\nBREAK indoors, bed,\nBREAK looking at viewer, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "akaneshinjou", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"akaneshinjou": "f9d3f5effea4", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/93af6b58-2ae1-4791-b9af-4015957ad84f/width=450/1319211.jpeg", + "nsfw": "Mature", + "width": 600, + "height": 896, + "hash": "UUK^EWoh%f_2~p-pX4-:-pWBNFt6Nba{n%of", + "meta": { + "Size": "200x300", + "seed": 3578292840, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "akaneshinjou, , shinjou akane, light purple hair, (pink eyes:1.2), short hair,\nBREAK lingerie,\nBREAK indoors, bed,\nBREAK looking at viewer, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "akaneshinjou", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"akaneshinjou": "f9d3f5effea4", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/105755" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/SSSS.GRIDMAN/akaneshinjou.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SSSS.GRIDMAN/akaneshinjou.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..d02e38a615c1f2e8a5e225026eb0d648754fc2d2 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SSSS.GRIDMAN/akaneshinjou.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/SSSS.GRIDMAN/akaneshinjou.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SSSS.GRIDMAN/akaneshinjou.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..b303480ebfdb281fb30307e24c1c6069a991ed54 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SSSS.GRIDMAN/akaneshinjou.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:0daedb06e67b3b691febde180b952c6c4bd41ff5fc90338117136af0f2d2cfdd +size 37933213 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/SSSS.GRIDMAN/rikkatakaradatest.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SSSS.GRIDMAN/rikkatakaradatest.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..3c25ba2a2787ea99457785d81e9054dcc3e132ec --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SSSS.GRIDMAN/rikkatakaradatest.civitai.info" @@ -0,0 +1,515 @@ +{ + "id": 105740, + "modelId": 98850, + "name": "v1.0", + "createdAt": "2023-06-28T08:50:11.670Z", + "updatedAt": "2023-06-28T08:52:47.380Z", + "trainedWords": [ + "rikka takarada, black hair, blue eyes, long hair, orange scrunchie, scrunchie, wrist scrunchie", + "black footwear, black skirt, bow, bowtie, buttons, cardigan, collared shirt, long sleeves, microskirt, pleated skirt, red bow, red bowtie, red socks, school uniform, shirt, shoes, skirt, socks, thighs, white cardigan, white shirt,", + "bikini, cleavage, collarbone, layered bikini, navel, ponytail, side-tie bikini bottom, stomach, sweatdrop, swimsuit" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 356, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Rikka Takarada - SSSS.Gridman", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "rikkatakaradatest.safetensors", + "id": 74358, + "sizeKB": 37057.1708984375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-28T08:55:43.398Z", + "hashes": { + "AutoV1": "26B4A82D", + "AutoV2": "B5697F811A", + "SHA256": "B5697F811AF6F7F0FE7093D05C5AFEF6170DBBCA3F5282A13A01DAF15B841ED1", + "CRC32": "D33BB074", + "BLAKE3": "3A7DFB4AA71C3AD08CFD8F63973CD9ED0DD24CF3C702E5975CD86EF3833BE9A3" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/105740" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b8670ac0-dca9-4bc2-bee5-309959f6fd17/width=450/1319046.jpeg", + "nsfw": "None", + "width": 600, + "height": 896, + "hash": "UDHL3w570d^+56~V-;%M4o%M%MRP~qR-Rk%M", + "meta": { + "Size": "200x300", + "seed": 4184413650, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "rikkatakarada, , rikka takarada, black hair, blue eyes, long hair, orange scrunchie, scrunchie, wrist scrunchie\nBREAK black footwear, black skirt, bow, bowtie, buttons, cardigan, collared shirt, long sleeves, microskirt, pleated skirt, red bow, red bowtie, red socks, school uniform, shirt, shoes, skirt, socks, thighs, white cardigan, white shirt,,\nBREAK outdoors, city,\nBREAK looking at viewer, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "rikkatakaradatest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "\"rikkatakaradatest": "9b8864e6de58", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/90cc0ea2-8e6a-4f27-8071-17a60df04384/width=450/1319047.jpeg", + "nsfw": "None", + "width": 600, + "height": 896, + "hash": "UGLCuIQTy@^P00%f^jV@D%tlsoRQ~VV@Vte.", + "meta": { + "Size": "200x300", + "seed": 4184413649, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "rikkatakarada, , rikka takarada, black hair, blue eyes, long hair, orange scrunchie, scrunchie, wrist scrunchie\nBREAK black footwear, black skirt, bow, bowtie, buttons, cardigan, collared shirt, long sleeves, microskirt, pleated skirt, red bow, red bowtie, red socks, school uniform, shirt, shoes, skirt, socks, thighs, white cardigan, white shirt,,\nBREAK outdoors, city,\nBREAK looking at viewer, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "rikkatakaradatest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "\"rikkatakaradatest": "9b8864e6de58", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c5df60d0-9489-41c0-a2ba-b6a79143a78f/width=450/1319044.jpeg", + "nsfw": "Mature", + "width": 600, + "height": 896, + "hash": "ULJtbt?bTb~p66OYShbw0LS1x]E1IWf6xEni", + "meta": { + "Size": "200x300", + "seed": 779748083, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "rikkatakarada, , rikka takarada, black hair, blue eyes, long hair, orange scrunchie, scrunchie, wrist scrunchie\nBREAK bikini, cleavage, collarbone, layered bikini, navel, ponytail, side-tie bikini bottom, stomach, sweatdrop, swimsuit\nBREAK outdoors, beach,\nBREAK looking at viewer, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "rikkatakaradatest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "\"rikkatakaradatest": "9b8864e6de58", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/79b8c55d-85c1-48e3-b08e-3d5ae4f667e6/width=450/1319043.jpeg", + "nsfw": "Mature", + "width": 600, + "height": 896, + "hash": "UTJQyb~qTI%M5mXTtSR+4:WVxuWobIR+xat7", + "meta": { + "Size": "200x300", + "seed": 779748084, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "rikkatakarada, , rikka takarada, black hair, blue eyes, long hair, orange scrunchie, scrunchie, wrist scrunchie\nBREAK bikini, cleavage, collarbone, layered bikini, navel, ponytail, side-tie bikini bottom, stomach, sweatdrop, swimsuit\nBREAK outdoors, beach,\nBREAK looking at viewer, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "rikkatakaradatest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "\"rikkatakaradatest": "9b8864e6de58", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9648bc8a-4fcc-463c-8985-0718c7a92d96/width=450/1319041.jpeg", + "nsfw": "Soft", + "width": 600, + "height": 896, + "hash": "UfK^Q%_M-;x]x]tR?HoyIVw|xaRktQt7oLWU", + "meta": { + "Size": "200x300", + "seed": 3892553188, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "rikkatakarada, , rikka takarada, black hair, blue eyes, long hair, orange scrunchie, scrunchie, wrist scrunchie\nBREAK bikini, cleavage, collarbone, layered bikini, navel, ponytail, side-tie bikini bottom, stomach, sweatdrop, swimsuit\nBREAK outdoors, beach,\nBREAK looking at viewer, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "rikkatakaradatest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "\"rikkatakaradatest": "9b8864e6de58", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2c96f234-46f5-4efd-83e4-443898385521/width=450/1319045.jpeg", + "nsfw": "Mature", + "width": 600, + "height": 896, + "hash": "URKAvnYQ?^~q9^TK%NRkD%RQ$*Rj%gxu%2of", + "meta": { + "Size": "200x300", + "seed": 3892553189, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "rikkatakarada, , rikka takarada, black hair, blue eyes, long hair, orange scrunchie, scrunchie, wrist scrunchie\nBREAK bikini, cleavage, collarbone, layered bikini, navel, ponytail, side-tie bikini bottom, stomach, sweatdrop, swimsuit\nBREAK outdoors, beach,\nBREAK looking at viewer, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "rikkatakaradatest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "\"rikkatakaradatest": "9b8864e6de58", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8dba6bdf-cf91-415b-854a-03cabaac04f2/width=450/1319042.jpeg", + "nsfw": "None", + "width": 600, + "height": 896, + "hash": "UEK,:L00~p?H01Io-pt700?Z9a9G0Mx[nm%M", + "meta": { + "Size": "200x300", + "seed": 1104925218, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "rikkatakarada, , rikka takarada, black hair, blue eyes, long hair, orange scrunchie, scrunchie, wrist scrunchie\nBREAK black footwear, black skirt, bow, bowtie, buttons, cardigan, collared shirt, long sleeves, microskirt, pleated skirt, red bow, red bowtie, red socks, school uniform, shirt, shoes, skirt, socks, thighs, white cardigan, white shirt,\nBREAK indoors, bed,\nBREAK looking at viewer, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "rikkatakaradatest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "\"rikkatakaradatest": "9b8864e6de58", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9752aa9a-f907-46e3-bb8a-f494e24a9131/width=450/1319038.jpeg", + "nsfw": "None", + "width": 600, + "height": 896, + "hash": "UAKApR00%zp0AB01~VxarCROx^Mx0fx]w{xG", + "meta": { + "Size": "200x300", + "seed": 1104925219, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "rikkatakarada, , rikka takarada, black hair, blue eyes, long hair, orange scrunchie, scrunchie, wrist scrunchie\nBREAK black footwear, black skirt, bow, bowtie, buttons, cardigan, collared shirt, long sleeves, microskirt, pleated skirt, red bow, red bowtie, red socks, school uniform, shirt, shoes, skirt, socks, thighs, white cardigan, white shirt,\nBREAK indoors, bed,\nBREAK looking at viewer, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "rikkatakaradatest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "\"rikkatakaradatest": "9b8864e6de58", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5ff5326e-5ac0-4035-b44e-a91ae93428ce/width=450/1319039.jpeg", + "nsfw": "Mature", + "width": 600, + "height": 896, + "hash": "UaJ7j:~W_3-;EMo#t7t7IUafRje.R+M{xas:", + "meta": { + "Size": "200x300", + "seed": 824578389, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "rikkatakarada, , rikka takarada, black hair, blue eyes, long hair, orange scrunchie, scrunchie, wrist scrunchie\nBREAK lingerie,\nBREAK indoors, bed,\nBREAK looking at viewer, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "rikkatakaradatest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "\"rikkatakaradatest": "9b8864e6de58", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/59264a7b-b94e-4be0-8a45-7bc979fc6b90/width=450/1319040.jpeg", + "nsfw": "Mature", + "width": 600, + "height": 896, + "hash": "UKKdA300_N-p0ekCWUR*00tR9FkDI@t6oMoe", + "meta": { + "Size": "200x300", + "seed": 824578388, + "Model": "cleanlinearmix_nsfw", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "1ac01c7a0f" + }, + "prompt": "rikkatakarada, , rikka takarada, black hair, blue eyes, long hair, orange scrunchie, scrunchie, wrist scrunchie\nBREAK lingerie,\nBREAK indoors, bed,\nBREAK looking at viewer, BREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "rikkatakaradatest", + "type": "lora", + "weight": 1 + }, + { + "hash": "1ac01c7a0f", + "name": "cleanlinearmix_nsfw", + "type": "model" + } + ], + "Model hash": "1ac01c7a0f", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "\"rikkatakaradatest": "9b8864e6de58", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/105740" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/SSSS.GRIDMAN/rikkatakaradatest.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SSSS.GRIDMAN/rikkatakaradatest.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..9383701301c33024b07f9a37cca38ca8c7e9fbb2 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SSSS.GRIDMAN/rikkatakaradatest.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/SSSS.GRIDMAN/rikkatakaradatest.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SSSS.GRIDMAN/rikkatakaradatest.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..99cb97348a4aec24841350729e11bdaa229e9060 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SSSS.GRIDMAN/rikkatakaradatest.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:b5697f811af6f7f0fe7093d05c5afef6170dbbca3f5282a13a01daf15b841ed1 +size 37946543 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/SSSS.GRIDMAN/shinjou_akane_v2.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SSSS.GRIDMAN/shinjou_akane_v2.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..2f5ff3b0e3e9b0fedaca81191c670d6afd6999bf --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SSSS.GRIDMAN/shinjou_akane_v2.civitai.info" @@ -0,0 +1,443 @@ +{ + "id": 108238, + "modelId": 19431, + "name": "v2.0", + "createdAt": "2023-07-01T21:46:48.386Z", + "updatedAt": "2023-07-01T22:07:02.539Z", + "trainedWords": [ + "aaakane, short hair, red eyes, large breasts, purple bowtie, collared shirt, white shirt, off shoulder, purple jacket, partially unzipped, long sleeves, sleeves past wrists, pleated skirt, black skirt, pantyhose" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

144MB \u2192 36MB

Added 2 outfits.

", + "stats": { + "downloadCount": 812, + "ratingCount": 2, + "rating": 5 + }, + "model": { + "name": "Shinjo Akane \u65b0\u6761 \u30a2\u30ab\u30cd / SSSS.GRIDMAN & GRIDMAN UNIVERSE", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "shinjou_akane_v2.safetensors", + "id": 76277, + "sizeKB": 36974.01171875, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-07-01T21:50:48.774Z", + "hashes": { + "AutoV1": "519D55E5", + "AutoV2": "945D555241", + "SHA256": "945D5552410A877C094E9977B021D7AD376FE1AC0223F4E5E2BC3BFC8B0C60BD", + "CRC32": "655C7144", + "BLAKE3": "A6965C233464259FCBC6AF83A02D6FF7C45AFED3AA449FD65485E952575185A6" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/108238" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a435a5cb-acc4-4650-b2e8-ff46ba9a238e/width=450/1363331.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UmG+dz?wk;%M-?S6InaKRkR+ogs:M|R-t7oz", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1086144483, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, aaakane, short hair, red eyes, large breasts, purple bowtie, collared shirt, white shirt, off shoulder, purple jacket, partially unzipped, long sleeves, sleeves past wrists, pleated skirt, black skirt, pantyhose, , cowboy shot, standing, sky,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "shinjou_akane_v2", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1), (holding:1.5)", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5f94a9d2-a101-4e58-83a0-72157ab5392e/width=450/1363340.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1536, + "hash": "UFKBUTMe0M14*00h.6^Q8{TJ$KrtT0n4rWxt", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1648959847, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, aaakane, short hair, red eyes, large breasts, swimsuit, frilled bikini, white bikini, front-tie top, , wet, water, lying, from above,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "shinjou_akane_v2", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1), (holding:1.5)", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/399ef59f-49be-4f3d-99ef-543e3156ec43/width=450/1363344.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "UTIqy8-UNE%2~WxZ9Foe?Hslxtoe%Nae%1xt", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1724729723, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, aaakane, short hair, halo, red eyes, large breasts, cleavage, epaulettes, white gloves, elbow gloves, purple skirt, thighhighs, , cowboy shot, standing, arms at sides, straight-on, street", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "shinjou_akane_v2", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1), (holding:1.5)", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/645f172d-e96c-4fab-94be-c85e1c7be50e/width=450/1363333.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "ULFr^=^kct9ytWX90eE3R4S6j=My8_a$t6oc", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1086144479, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, aaakane, short hair, red eyes, large breasts, purple bowtie, collared shirt, white shirt, off shoulder, purple jacket, partially unzipped, long sleeves, sleeves past wrists, pleated skirt, black skirt, pantyhose, , cowboy shot, standing, sky,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "shinjou_akane_v2", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1), (holding:1.5)", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/531b4fde-5fe9-4ce1-9c8e-0aacb6b2d2ab/width=450/1363335.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1536, + "hash": "UUHoRgu5pxI?PXV@NyWBRUn%xGs:WaS2s:Wq", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 450894029, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, aaakane, short hair, red eyes, large breasts, swimsuit, frilled bikini, white bikini, front-tie top, , standing, cowboy shot, beach", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "shinjou_akane_v2", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1), (holding:1.5)", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f9bc4686-a320-4cde-8320-40832d46f0ba/width=450/1363347.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "UaKKjB={b_WB?divRkNGVus.t6kXRPoInMkW", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3284339757, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, aaakane, short hair, halo, red eyes, large breasts, cleavage, epaulettes, white gloves, elbow gloves, purple skirt, thighhighs, , cherry blossoms, bench, sitting, crossed legs,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "shinjou_akane_v2", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1), (holding:1.5)", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f5464866-3f47-4ca8-84b8-7df803b6f6a6/width=450/1363332.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UEG*+^4n0001~BtP4.xI00xs?bxu-q%2wcIo", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 501891880, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, aaakane, short hair, red eyes, large breasts, purple bowtie, collared shirt, white shirt, off shoulder, purple jacket, partially unzipped, long sleeves, sleeves past wrists, pleated skirt, black skirt, pantyhose, , cowboy shot, hands in pockets, walking, glasses,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "shinjou_akane_v2", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1), (holding:1.5)", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0f2a48e9-601d-48b9-9175-01856d13463f/width=450/1363337.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1536, + "hash": "UZK^:H?aTxxZYRs+TJR%5ANHaf%2%3ozs9t7", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 367908872, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, aaakane, short hair, red eyes, large breasts, swimsuit, frilled bikini, white bikini, front-tie top, , beach, wariza, :o", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "shinjou_akane_v2", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1), (holding:1.5)", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/32f141d1-4357-4197-a2ce-1596a93ff50d/width=450/1363342.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "ULGug@~WJ6RiogNH4.9G%2oyobadD+%M%LoI", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1207063307, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, aaakane, short hair, halo, red eyes, large breasts, cleavage, epaulettes, white gloves, elbow gloves, purple skirt, thighhighs, , cowboy shot, standing, street", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "shinjou_akane_v2", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1), (holding:1.5)", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3fa90c9a-d0cf-49bc-946b-d0479e35b71e/width=450/1363330.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "ULHL6q4;9Dxt_LM|55t8r-E3%fa#ngR*%2M|", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 319965796, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, aaakane, short hair, red eyes, large breasts, purple bowtie, collared shirt, white shirt, off shoulder, purple jacket, partially unzipped, long sleeves, sleeves past wrists, pleated skirt, black skirt, pantyhose, , sitting, bench, outdoors, smile,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "shinjou_akane_v2", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1), (holding:1.5)", + "Denoising strength": "0.45" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/108238" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/SSSS.GRIDMAN/shinjou_akane_v2.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SSSS.GRIDMAN/shinjou_akane_v2.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..70796d291a1f769b9c4c5d5f6ce47014f1ae9762 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SSSS.GRIDMAN/shinjou_akane_v2.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/SSSS.GRIDMAN/shinjou_akane_v2.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SSSS.GRIDMAN/shinjou_akane_v2.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..74dc39ae238e1f0ca91e761199032c03540eaec4 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/SSSS.GRIDMAN/shinjou_akane_v2.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:945d5552410a877c094e9977b021d7ad376fe1ac0223f4e5e2bc3bfc8b0c60bd +size 37861388 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/TRINITY SEVEN \351\255\224\351\201\223\344\271\2467\344\275\277\350\200\205/LieselotteSherlock.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/TRINITY SEVEN \351\255\224\351\201\223\344\271\2467\344\275\277\350\200\205/LieselotteSherlock.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..be77cd6ac121d13729e26bc20acd51aed631840b --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/TRINITY SEVEN \351\255\224\351\201\223\344\271\2467\344\275\277\350\200\205/LieselotteSherlock.civitai.info" @@ -0,0 +1,174 @@ +{ + "id": 88577, + "modelId": 83347, + "name": "v1.0", + "createdAt": "2023-06-03T18:13:05.105Z", + "updatedAt": "2023-06-04T06:57:10.795Z", + "trainedWords": [ + "lieselottesherlock, purple eyes, twintails", + "collarbone, cleavage, choker, midriff, underwear, elbow gloves, black gloves, belt, highleg panties, black shorts, short shorts, thighhighs, black footwear, boots, thigh boots" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 93, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Lieselotte Sherlock | Trinity Seven", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "LieselotteSherlock.safetensors", + "id": 60771, + "sizeKB": 36981.001953125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-03T18:15:49.939Z", + "hashes": { + "AutoV1": "CB1CDCF2", + "AutoV2": "32E3FFDDA1", + "SHA256": "32E3FFDDA1B9E5B9D25330C1643696C4FAE1B7A88980A5C6D850EF9A1D6C9BBA", + "CRC32": "A107C61D", + "BLAKE3": "E5FABAF6E99B9CEE2F2ABF92D16D3F4A97832D6CCE190F15868C1F87A2826D99" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/88577" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9ef5cb62-a580-45bb-8f6d-0a4ea0df3501/width=450/1024442.jpeg", + "nsfw": "Soft", + "width": 768, + "height": 1088, + "hash": "UFHxpQD*AqI[~pskE2E24TIUR7IUDgS6IA-o", + "meta": { + "Size": "512x728", + "seed": 2996562680, + "Model": "Anime Cartoon_2.5D_abyssorangemix2_Hard", + "steps": 20, + "hashes": { + "model": "e714ee20aa" + }, + "prompt": "masterpiece, best quality, ultra-detailed, beautiful detailed eyes, extremely detailed eyes and face, 1girl, lieselottesherlock, purple eyes, twintails, collarbone, cleavage, choker, midriff, underwear, elbow gloves, black gloves, belt, highleg panties, black shorts, short shorts, thighhighs, black footwear, boots, thigh boots, ((large breasts)), standing, looking at viewer, smiling, seductive smile, forest, day, sky, cloud, cowboy shot, upper body, ", + "Version": "v1.3.0", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "Lieselotte_Sherlock_v1", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "e714ee20aa", + "name": "Anime Cartoon_2.5D_abyssorangemix2_Hard", + "type": "model" + } + ], + "Model hash": "e714ee20aa", + "Hires steps": "10", + "Hires upscale": "1.5", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "lowres, text, error, cropped, worst quality, low quality, jpeg artifacts, ugly, duplicate, morbid, mutilated, out of frame, extra fingers, mutated hands, poorly drawn hands, poorly drawn face, mutation, deformed, blurry, dehydrated, bad anatomy, bad proportions, extra limbs, cloned face, disfigured, gross proportions, malformed limbs, missing arms, missing legs, extra arms, extra legs, fused fingers, too many fingers, long neck, username, watermark, signature,(((deformed))), [blurry], (poorly drawn hands), 2girl, easynegative, By bad artist -neg, text, speech bubble, censored, blurry, (((watermark))), ((text)), (wings:2), (black wings:2)", + "Denoising strength": "0.3", + "Lieselotte_Sherlock_v1": "b91ca4d414d9" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6e34a0ec-b322-4e79-974e-da2c7f38dda4/width=450/1024443.jpeg", + "nsfw": "Soft", + "width": 768, + "height": 1088, + "hash": "UUKUG+H?4:xH*0n3rrNyVvofEKI;4oxvWB%1", + "meta": { + "Size": "512x728", + "seed": 1143253251, + "Model": "Anime Cartoon_2D_anyhentai_20", + "steps": 20, + "hashes": { + "model": "61bc7001e8" + }, + "prompt": "masterpiece, best quality, ultra-detailed, beautiful detailed eyes, extremely detailed eyes and face, 1girl, lieselottesherlock, purple eyes, twintails, collarbone, (green t-shirt), (orange skirt), sneakers, ((large breasts)), standing, looking at viewer, smiling, seductive smile, forest, day, sky, cloud, cowboy shot, full body, ", + "Version": "v1.3.0", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "Lieselotte_Sherlock_v1", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "61bc7001e8", + "name": "Anime Cartoon_2D_anyhentai_20", + "type": "model" + } + ], + "Model hash": "61bc7001e8", + "Hires steps": "10", + "Hires upscale": "1.5", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "lowres, text, error, cropped, worst quality, low quality, jpeg artifacts, ugly, duplicate, morbid, mutilated, out of frame, extra fingers, mutated hands, poorly drawn hands, poorly drawn face, mutation, deformed, blurry, dehydrated, bad anatomy, bad proportions, extra limbs, cloned face, disfigured, gross proportions, malformed limbs, missing arms, missing legs, extra arms, extra legs, fused fingers, too many fingers, long neck, username, watermark, signature,(((deformed))), [blurry], (poorly drawn hands), 2girl, easynegative, By bad artist -neg, text, speech bubble, censored, blurry, (((watermark))), ((text)), (wings:2), (black wings:2)", + "Denoising strength": "0.3", + "Lieselotte_Sherlock_v1": "b91ca4d414d9" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d9e13204-b80f-4773-84d0-d1fb0d1de304/width=450/1024444.jpeg", + "nsfw": "Soft", + "width": 768, + "height": 1088, + "hash": "UGA^B.WE00of~Voe9GWCxsj@NKWWITj@tRWC", + "meta": { + "Size": "512x728", + "seed": 3266443982, + "Model": "Anime Cartoon_2D_meinahentai_v3", + "steps": 20, + "hashes": { + "model": "7c01e48033" + }, + "prompt": "masterpiece, best quality, ultra-detailed, beautiful detailed eyes, extremely detailed eyes and face, 1girl, lieselottesherlock, purple eyes, collarbone, cleavage, (shirt), skirt, sneakers, ((large breasts)), standing, looking at viewer, smiling, seductive smile, forest, cowboy shot, full body, ", + "Version": "v1.3.0", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "Lieselotte_Sherlock_v1", + "type": "lora", + "weight": 0.75 + }, + { + "hash": "7c01e48033", + "name": "Anime Cartoon_2D_meinahentai_v3", + "type": "model" + } + ], + "Model hash": "7c01e48033", + "Hires steps": "10", + "Hires upscale": "1.5", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "lowres, text, error, cropped, worst quality, low quality, jpeg artifacts, ugly, duplicate, morbid, mutilated, out of frame, extra fingers, mutated hands, poorly drawn hands, poorly drawn face, mutation, deformed, blurry, dehydrated, bad anatomy, bad proportions, extra limbs, cloned face, disfigured, gross proportions, malformed limbs, missing arms, missing legs, extra arms, extra legs, fused fingers, too many fingers, long neck, username, watermark, signature,(((deformed))), [blurry], (poorly drawn hands), 2girl, easynegative, By bad artist -neg, text, speech bubble, censored, blurry, (((watermark))), ((text)), (wings:2), (black wings:2)", + "Denoising strength": "0.3", + "Lieselotte_Sherlock_v1": "b91ca4d414d9" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/88577" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/TRINITY SEVEN \351\255\224\351\201\223\344\271\2467\344\275\277\350\200\205/LieselotteSherlock.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/TRINITY SEVEN \351\255\224\351\201\223\344\271\2467\344\275\277\350\200\205/LieselotteSherlock.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..b0bceced2bf4cd6fb5fbb562a3ea7c2efde276da Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/TRINITY SEVEN \351\255\224\351\201\223\344\271\2467\344\275\277\350\200\205/LieselotteSherlock.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/TRINITY SEVEN \351\255\224\351\201\223\344\271\2467\344\275\277\350\200\205/LieselotteSherlock.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/TRINITY SEVEN \351\255\224\351\201\223\344\271\2467\344\275\277\350\200\205/LieselotteSherlock.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..fec0a80c4df5852455a573fcd6fdf8eea894b122 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/TRINITY SEVEN \351\255\224\351\201\223\344\271\2467\344\275\277\350\200\205/LieselotteSherlock.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:32e3ffdda1b9e5b9d25330c1643696c4fae1b7a88980a5c6d850ef9a1d6c9bba +size 37868546 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/TRINITY SEVEN \351\255\224\351\201\223\344\271\2467\344\275\277\350\200\205/asamiLilithTrinity_v10.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/TRINITY SEVEN \351\255\224\351\201\223\344\271\2467\344\275\277\350\200\205/asamiLilithTrinity_v10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..c9ca16e7083c71d747a3f2297b3e72be4df08c6f --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/TRINITY SEVEN \351\255\224\351\201\223\344\271\2467\344\275\277\350\200\205/asamiLilithTrinity_v10.civitai.info" @@ -0,0 +1,443 @@ +{ + "id": 48410, + "modelId": 43771, + "name": "v1.0", + "createdAt": "2023-04-17T20:03:28.947Z", + "updatedAt": "2023-04-17T20:24:19.946Z", + "trainedWords": [ + "lilith1, 1girl, solo, braid, hat, beret" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 0, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Asami Lilith \u6d45\u898b\u30ea\u30ea\u30b9 / Trinity Seven", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "asamiLilithTrinity_v10.safetensors", + "id": 35774, + "sizeKB": 36980.740234375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-17T20:05:59.226Z", + "hashes": { + "AutoV1": "FCAE2583", + "AutoV2": "F9AB773CBA", + "SHA256": "F9AB773CBAAA7D70E8B0E0F4D984EAAE4A2C082CFF4F0A4A47A2A3E77CF9C13C", + "CRC32": "BDBD2608", + "BLAKE3": "0EBD5CE7D7F49EF02B5657C084A665D625B5FF83C89AAB22F68E759DF930401C" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/48410" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d45f1378-23f1-4648-3513-3306c4c45600/width=450/519823.jpeg", + "nsfw": false, + "width": 1024, + "height": 1536, + "hash": "U6G8WW0L00OE,0My0ztk00?GG^I:00^+$+9F", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2283074200, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres,lilith1, 1girl, solo, braid, hat, beret, elbow gloves, black thighhighs, sleeveless, black gloves, black necktie, sleeveless shirt, large breasts, bare shoulders, pleated skirt, black skirt, white shirt, miniskirt, , cowboy shot, standing, outdoors, night, holding gun, rifle,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 5, + "Clip skip": "2", + "resources": [ + { + "name": "asami_lilith_v1", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1),", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a90f5143-f267-4fb7-22fc-01171a484e00/width=450/519829.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "ULHxmMxu9sNH.To#E2t7?wbc.8t759ogMxRj", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1600996825, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres,lilith1, 1girl, solo, braid, hat, beret, elbow gloves, black thighhighs, sleeveless, black gloves, black necktie, sleeveless shirt, large breasts, bare shoulders, pleated skirt, black skirt, white shirt, miniskirt, , cowboy shot, standing, outdoors,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 5, + "Clip skip": "2", + "resources": [ + { + "name": "asami_lilith_v1", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1),", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2d15dbf1-9cb8-478c-be37-daccfa2ef600/width=450/519826.jpeg", + "nsfw": false, + "width": 1024, + "height": 1536, + "hash": "UNIX?U8^boI=KlI99t.8_Ne+%gIp9{IU%Lt7", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1600996826, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres,lilith1, 1girl, solo, braid, hat, beret, elbow gloves, black thighhighs, sleeveless, black gloves, black necktie, sleeveless shirt, large breasts, bare shoulders, pleated skirt, black skirt, white shirt, miniskirt, , cowboy shot, standing, outdoors,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 5, + "Clip skip": "2", + "resources": [ + { + "name": "asami_lilith_v1", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1),", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8bb80250-144c-49ca-a854-facaab7b6900/width=450/519824.jpeg", + "nsfw": false, + "width": 1024, + "height": 1536, + "hash": "UMIq=T?]I,xB57Xl0eIA~p-;x[nNR*x[o}Rj", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1600996822, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres,lilith1, 1girl, solo, braid, hat, beret, elbow gloves, black thighhighs, sleeveless, black gloves, black necktie, sleeveless shirt, large breasts, bare shoulders, pleated skirt, black skirt, white shirt, miniskirt, , cowboy shot, standing, outdoors,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 5, + "Clip skip": "2", + "resources": [ + { + "name": "asami_lilith_v1", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1),", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9548a4cd-485d-46c1-2e6c-5753c758e100/width=450/519821.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UEJ%:]Na~o~V4TRk56n*MJM{TJjF8_-;Z%M{", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1868297564, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres,lilith1, 1girl, solo, braid, hat, beret, elbow gloves, black thighhighs, sleeveless, black gloves, black necktie, sleeveless shirt, large breasts, bare shoulders, pleated skirt, black skirt, white shirt, miniskirt, , panties, from below,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 5, + "Clip skip": "2", + "resources": [ + { + "name": "asami_lilith_v1", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1),", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4ed6022e-bc90-475c-b675-db7486a2b000/width=450/519828.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UYHxB1D%E1Rj~WIUN[t6V[M{x]R+RkX7jbRj", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3450134538, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres,lilith1, 1girl, solo, braid, hat, beret, elbow gloves, black thighhighs, sleeveless, black gloves, black necktie, sleeveless shirt, large breasts, bare shoulders, pleated skirt, black skirt, white shirt, miniskirt, , cowboy shot, smile, cafe, coffee, table, sitting, crossed legs,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 5, + "Clip skip": "2", + "resources": [ + { + "name": "asami_lilith_v1", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1),", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/61e33d84-7c0a-49d7-f2f7-48ea15979000/width=450/519827.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UZG*_;WBo@oM~VWTkVsp%LWV%MWU$+jZ%2V@", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 327473278, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres,lilith1, 1girl, solo, braid, hat, beret, elbow gloves, black thighhighs, sleeveless, black gloves, black necktie, sleeveless shirt, large breasts, bare shoulders, pleated skirt, black skirt, white shirt, miniskirt, , from side, field, grass,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 5, + "Clip skip": "2", + "resources": [ + { + "name": "asami_lilith_v1", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1),", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/de519202-c87d-4ecb-e819-1914ba1f4200/width=450/519822.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UVGu5n~VS}bExae.SNW;E1bHtR%MNaozn%s:", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2004940557, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres,lilith1, 1girl, solo, braid, elbow gloves, black thighhighs, sleeveless, black gloves, black necktie, sleeveless shirt, large breasts, bare shoulders, pleated skirt, black skirt, white shirt, miniskirt, , ruins, sitting, hand on own face, crossed legs, hand on own knee,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 5, + "Clip skip": "2", + "resources": [ + { + "name": "asami_lilith_v1", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1),", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/dc6100cd-84cf-4b64-9a14-f634549bf700/width=450/519825.jpeg", + "nsfw": false, + "width": 1024, + "height": 1536, + "hash": "UQJ[6Z_3LgIo5@WXJCt7Ros.-pbI%NRjt7WV", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1020163562, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, lilith1, long hair, 1girl, solo, braid, large breasts, , beach, ocean, red micro bikini, leaning forward, smirk,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "asami_lilith_v1", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1),", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a4b6035b-29df-433b-bf2a-98d0dd746e00/width=450/519820.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UII#u@00C,?v1Ar=KRMexIW?=xnigPS%-;of", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 896921916, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, lilith1, long hair, 1girl, solo, braid, large breasts, , beach, ocean, red micro bikini, walking, arms behind back, looking at another,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "asami_lilith_v1", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1),", + "Denoising strength": "0.45" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/48410" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/TRINITY SEVEN \351\255\224\351\201\223\344\271\2467\344\275\277\350\200\205/asamiLilithTrinity_v10.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/TRINITY SEVEN \351\255\224\351\201\223\344\271\2467\344\275\277\350\200\205/asamiLilithTrinity_v10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..36bbd757cb8f93a41c84919ab97cc217961da203 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/TRINITY SEVEN \351\255\224\351\201\223\344\271\2467\344\275\277\350\200\205/asamiLilithTrinity_v10.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:7913e0cf1e307d901dfa14dc43ba8eebe6befd821fa192799686da3bdb526c2b +size 2144778 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/TRINITY SEVEN \351\255\224\351\201\223\344\271\2467\344\275\277\350\200\205/asamiLilithTrinity_v10.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/TRINITY SEVEN \351\255\224\351\201\223\344\271\2467\344\275\277\350\200\205/asamiLilithTrinity_v10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..b8c4804ab73c8c198c05b2513b0d6bf73b5c4a16 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/TRINITY SEVEN \351\255\224\351\201\223\344\271\2467\344\275\277\350\200\205/asamiLilithTrinity_v10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:f9ab773cbaaa7d70e8b0e0f4d984eaae4a2c082cff4f0a4a47a2a3e77cf9c13c +size 37868278 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/TRINITY SEVEN \351\255\224\351\201\223\344\271\2467\344\275\277\350\200\205/lilith_asami_DG.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/TRINITY SEVEN \351\255\224\351\201\223\344\271\2467\344\275\277\350\200\205/lilith_asami_DG.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..bf49fd6c38f8c6f9bcfec42d9df974feb61701ae --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/TRINITY SEVEN \351\255\224\351\201\223\344\271\2467\344\275\277\350\200\205/lilith_asami_DG.civitai.info" @@ -0,0 +1,438 @@ +{ + "id": 99046, + "modelId": 92915, + "name": "v1.0", + "createdAt": "2023-06-18T21:52:07.633Z", + "updatedAt": "2023-06-18T21:54:26.424Z", + "trainedWords": [ + "lilith_asami", + "long hair", + "red hair", + "blue eyes", + "side braid", + "braid", + "large breasts", + "blush", + "school uniform", + "shirt", + "skirt" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 39, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Lilith Asami (Trinity Seven)", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "lilith_asami_DG.safetensors", + "id": 69034, + "sizeKB": 36991.033203125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-18T21:56:20.191Z", + "hashes": { + "AutoV1": "097F99B7", + "AutoV2": "FA10F6BC93", + "SHA256": "FA10F6BC935CF83737008D9220D1C78E978176B7333E3F621B23CA8BDFFEFB5D", + "CRC32": "C52BA143", + "BLAKE3": "FD2A134668A0957FB15868D9EBF17BABA643869C98CED3B66A8F24F7F3BAFE77" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/99046" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2f6b8bbf-3f51-48fb-809a-fa8078b70acb/width=450/1199456.jpeg", + "nsfw": "None", + "width": 1280, + "height": 1920, + "hash": "UaGutR-;?^yE%%o0gOOYRnnOM|RjIVofRjxa", + "meta": { + "Size": "512x768", + "seed": 2833885727, + "Model": "anything-v4.5", + "steps": 20, + "hashes": { + "model": "1d1e459f9f" + }, + "prompt": "masterpiece, (best quality), 1woman,1girl ,lilith_asami, long hair, red hair, blue eyes , braid, side braid, school uniform, shirt, skirt, jacket, necktie, large breasts,,sexy woman, adult, smile, blush, vibrant colors ,,natural lighting ,RTX, beautiful, (detailed face:1.2), showcase, (perfect eyes:1.1) ,(photorealistic:1.1), 8k uhd, looking at viewer, outdoors, simple backround", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "1d1e459f9f", + "name": "anything-v4.5", + "type": "model" + } + ], + "Model hash": "1d1e459f9f", + "Hires steps": "20", + "Hires upscale": "1.25", + "AddNet Enabled": "True", + "AddNet Model 3": "testing_lilith_asami-07(9f934a1d6330)", + "Hires upscaler": "Latent", + "negativePrompt": "(worst quality, low quality:1.4), easynegative, bad hands, noob artist, (bad anatomy:1.2), ugly, distortions, child, loli, deformityv6, (watermark:1.5),(chalkboard)", + "AddNet Module 3": "LoRA", + "AddNet Weight A 3": "0.7", + "AddNet Weight B 3": "0.7", + "Denoising strength": "0.7" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/44f1dc54-e6b0-412d-ae5b-e00a4f528d27/width=450/1199466.jpeg", + "nsfw": "None", + "width": 1280, + "height": 1920, + "hash": "UKIqiI~Tc3t8~gNE9@WGx,xV-qxb?D%K-.bw", + "meta": { + "Size": "512x768", + "seed": 1005161011, + "Model": "anything-v4.5", + "steps": 20, + "hashes": { + "model": "1d1e459f9f" + }, + "prompt": "masterpiece, (best quality), 1woman,1girl ,lilith_asami, long hair, red hair, blue eyes , braid, side braid, white sweater, shirt, pants, large breasts,,sexy woman, adult, smile, blush, vibrant colors ,,natural lighting ,RTX, beautiful, (detailed face:1.2), showcase, (perfect eyes:1.1) ,(photorealistic:1.1), 8k uhd, looking at viewer, outdoors, simple backround", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "1d1e459f9f", + "name": "anything-v4.5", + "type": "model" + } + ], + "Model hash": "1d1e459f9f", + "Hires steps": "20", + "Hires upscale": "1.25", + "AddNet Enabled": "True", + "AddNet Model 3": "testing_lilith_asami-07(9f934a1d6330)", + "Hires upscaler": "Latent", + "negativePrompt": "(worst quality, low quality:1.4), easynegative, bad hands, noob artist, (bad anatomy:1.2), ugly, distortions, child, loli, deformityv6, (watermark:1.5),(chalkboard)", + "AddNet Module 3": "LoRA", + "AddNet Weight A 3": "0.7", + "AddNet Weight B 3": "0.7", + "Denoising strength": "0.7" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/42404b2b-54c0-4635-b3e6-e0c9fa2846b7/width=450/1199457.jpeg", + "nsfw": "None", + "width": 1280, + "height": 1920, + "hash": "UWG[f_cu.7v#%%OabbMxxwozJA-UM}RQoMXS", + "meta": { + "Size": "512x768", + "seed": 2833885726, + "Model": "anything-v4.5", + "steps": 20, + "hashes": { + "model": "1d1e459f9f" + }, + "prompt": "masterpiece, (best quality), 1woman,1girl ,lilith_asami, long hair, red hair, blue eyes , braid, side braid, school uniform, shirt, skirt, jacket, necktie, large breasts,,sexy woman, adult, smile, blush, vibrant colors ,,natural lighting ,RTX, beautiful, (detailed face:1.2), showcase, (perfect eyes:1.1) ,(photorealistic:1.1), 8k uhd, looking at viewer, outdoors, simple backround", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "1d1e459f9f", + "name": "anything-v4.5", + "type": "model" + } + ], + "Model hash": "1d1e459f9f", + "Hires steps": "20", + "Hires upscale": "1.25", + "AddNet Enabled": "True", + "AddNet Model 3": "testing_lilith_asami-07(9f934a1d6330)", + "Hires upscaler": "Latent", + "negativePrompt": "(worst quality, low quality:1.4), easynegative, bad hands, noob artist, (bad anatomy:1.2), ugly, distortions, child, loli, deformityv6, (watermark:1.5),(chalkboard)", + "AddNet Module 3": "LoRA", + "AddNet Weight A 3": "0.7", + "AddNet Weight B 3": "0.7", + "Denoising strength": "0.7" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5ce814f1-91f5-4149-b9bd-1f3673d163e2/width=450/1199462.jpeg", + "nsfw": "None", + "width": 1280, + "height": 1920, + "hash": "UGIN%FD+00=|-PD*P9xbR5IA_MNHxcE2S2xZ", + "meta": { + "Size": "512x768", + "seed": 1005161005, + "Model": "anything-v4.5", + "steps": 20, + "hashes": { + "model": "1d1e459f9f" + }, + "prompt": "masterpiece, (best quality), 1woman,1girl ,lilith_asami, long hair, red hair, blue eyes , braid, side braid, white sweater, shirt, pants, large breasts,,sexy woman, adult, smile, blush, vibrant colors ,,natural lighting ,RTX, beautiful, (detailed face:1.2), showcase, (perfect eyes:1.1) ,(photorealistic:1.1), 8k uhd, looking at viewer, outdoors, simple backround", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "1d1e459f9f", + "name": "anything-v4.5", + "type": "model" + } + ], + "Model hash": "1d1e459f9f", + "Hires steps": "20", + "Hires upscale": "1.25", + "AddNet Enabled": "True", + "AddNet Model 3": "testing_lilith_asami-07(9f934a1d6330)", + "Hires upscaler": "Latent", + "negativePrompt": "(worst quality, low quality:1.4), easynegative, bad hands, noob artist, (bad anatomy:1.2), ugly, distortions, child, loli, deformityv6, (watermark:1.5),(chalkboard)", + "AddNet Module 3": "LoRA", + "AddNet Weight A 3": "0.7", + "AddNet Weight B 3": "0.7", + "Denoising strength": "0.7" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/862332a4-3df2-4fb1-b70c-1aaa00838157/width=450/1199460.jpeg", + "nsfw": "None", + "width": 1280, + "height": 1920, + "hash": "UOGkg[~W.R?b~CR.NuNH^*xux]-pS5t6%Mxa", + "meta": { + "Size": "512x768", + "seed": 2833885728, + "Model": "anything-v4.5", + "steps": 20, + "hashes": { + "model": "1d1e459f9f" + }, + "prompt": "masterpiece, (best quality), 1woman,1girl ,lilith_asami, long hair, red hair, blue eyes , braid, side braid, school uniform, shirt, skirt, jacket, necktie, large breasts,,sexy woman, adult, smile, blush, vibrant colors ,,natural lighting ,RTX, beautiful, (detailed face:1.2), showcase, (perfect eyes:1.1) ,(photorealistic:1.1), 8k uhd, looking at viewer, outdoors, simple backround", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "1d1e459f9f", + "name": "anything-v4.5", + "type": "model" + } + ], + "Model hash": "1d1e459f9f", + "Hires steps": "20", + "Hires upscale": "1.25", + "AddNet Enabled": "True", + "AddNet Model 3": "testing_lilith_asami-07(9f934a1d6330)", + "Hires upscaler": "Latent", + "negativePrompt": "(worst quality, low quality:1.4), easynegative, bad hands, noob artist, (bad anatomy:1.2), ugly, distortions, child, loli, deformityv6, (watermark:1.5),(chalkboard)", + "AddNet Module 3": "LoRA", + "AddNet Weight A 3": "0.7", + "AddNet Weight B 3": "0.7", + "Denoising strength": "0.7" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c0799537-9212-4cf1-bc40-ed86fef844d6/width=450/1199465.jpeg", + "nsfw": "None", + "width": 1280, + "height": 1920, + "hash": "UEE.U,D.0JE1?DIWE%Io9E9G~pof-69Z%ft7", + "meta": { + "Size": "512x768", + "seed": 1005161009, + "Model": "anything-v4.5", + "steps": 20, + "hashes": { + "model": "1d1e459f9f" + }, + "prompt": "masterpiece, (best quality), 1woman,1girl ,lilith_asami, long hair, red hair, blue eyes , braid, side braid, white sweater, shirt, pants, large breasts,,sexy woman, adult, smile, blush, vibrant colors ,,natural lighting ,RTX, beautiful, (detailed face:1.2), showcase, (perfect eyes:1.1) ,(photorealistic:1.1), 8k uhd, looking at viewer, outdoors, simple backround", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "1d1e459f9f", + "name": "anything-v4.5", + "type": "model" + } + ], + "Model hash": "1d1e459f9f", + "Hires steps": "20", + "Hires upscale": "1.25", + "AddNet Enabled": "True", + "AddNet Model 3": "testing_lilith_asami-07(9f934a1d6330)", + "Hires upscaler": "Latent", + "negativePrompt": "(worst quality, low quality:1.4), easynegative, bad hands, noob artist, (bad anatomy:1.2), ugly, distortions, child, loli, deformityv6, (watermark:1.5),(chalkboard)", + "AddNet Module 3": "LoRA", + "AddNet Weight A 3": "0.7", + "AddNet Weight B 3": "0.7", + "Denoising strength": "0.7" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8c6c446e-55e6-42d4-93ee-bfea4d2c7316/width=450/1199476.jpeg", + "nsfw": "Mature", + "width": 1280, + "height": 1920, + "hash": "UdH^kp~BE1M|D%M|oykCIpNGNdWCIpayodR*", + "meta": { + "Size": "512x768", + "seed": 2481107513, + "Model": "alabasterBlend_v10", + "steps": 20, + "hashes": { + "model": "43381b29f9" + }, + "prompt": "masterpiece, (best quality), 1woman,1girl ,lilith_asami, long hair, red hair, blue eyes , braid, side braid, formal dress, white dress, jewelry, earrings, necklace, formal event, large breasts,,sexy woman, adult, smile, blush, vibrant colors ,,natural lighting ,RTX, beautiful, (detailed face:1.2), showcase, (perfect eyes:1.1) ,(photorealistic:1.1), 8k uhd, looking at viewer, indoors, simple backround", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "43381b29f9", + "name": "alabasterBlend_v10", + "type": "model" + } + ], + "Model hash": "43381b29f9", + "Hires steps": "20", + "Hires upscale": "1.25", + "AddNet Enabled": "True", + "AddNet Model 3": "testing_lilith_asami-07(9f934a1d6330)", + "Hires upscaler": "Latent", + "negativePrompt": "(worst quality, low quality:1.4), easynegative, bad hands, noob artist, (bad anatomy:1.2), ugly, distortions, child, loli, deformityv6, (watermark:1.5),(chalkboard)", + "AddNet Module 3": "LoRA", + "AddNet Weight A 3": "0.7", + "AddNet Weight B 3": "0.7", + "Denoising strength": "0.7" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7af8f268-ad91-471c-aa0b-491ef56a8d89/width=450/1199461.jpeg", + "nsfw": "None", + "width": 1280, + "height": 1920, + "hash": "UQE.U^?b.8yD~WSitRxu^*xbx]o}ozNGogWC", + "meta": { + "Size": "512x768", + "seed": 2833885729, + "Model": "anything-v4.5", + "steps": 20, + "hashes": { + "model": "1d1e459f9f" + }, + "prompt": "masterpiece, (best quality), 1woman,1girl ,lilith_asami, long hair, red hair, blue eyes , braid, side braid, school uniform, shirt, skirt, jacket, necktie, large breasts,,sexy woman, adult, smile, blush, vibrant colors ,,natural lighting ,RTX, beautiful, (detailed face:1.2), showcase, (perfect eyes:1.1) ,(photorealistic:1.1), 8k uhd, looking at viewer, outdoors, simple backround", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "1d1e459f9f", + "name": "anything-v4.5", + "type": "model" + } + ], + "Model hash": "1d1e459f9f", + "Hires steps": "20", + "Hires upscale": "1.25", + "AddNet Enabled": "True", + "AddNet Model 3": "testing_lilith_asami-07(9f934a1d6330)", + "Hires upscaler": "Latent", + "negativePrompt": "(worst quality, low quality:1.4), easynegative, bad hands, noob artist, (bad anatomy:1.2), ugly, distortions, child, loli, deformityv6, (watermark:1.5),(chalkboard)", + "AddNet Module 3": "LoRA", + "AddNet Weight A 3": "0.7", + "AddNet Weight B 3": "0.7", + "Denoising strength": "0.7" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3945f680-8046-4414-af0d-3eaf097501e7/width=450/1199467.jpeg", + "nsfw": "None", + "width": 1280, + "height": 1920, + "hash": "UCH21Z?IEHEe?tx]0KM^J$kr?H-ntl~q-;M^", + "meta": { + "Size": "512x768", + "seed": 1005161013, + "Model": "anything-v4.5", + "steps": 20, + "hashes": { + "model": "1d1e459f9f" + }, + "prompt": "masterpiece, (best quality), 1woman,1girl ,lilith_asami, long hair, red hair, blue eyes , braid, side braid, white sweater, shirt, pants, large breasts,,sexy woman, adult, smile, blush, vibrant colors ,,natural lighting ,RTX, beautiful, (detailed face:1.2), showcase, (perfect eyes:1.1) ,(photorealistic:1.1), 8k uhd, looking at viewer, outdoors, simple backround", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "1d1e459f9f", + "name": "anything-v4.5", + "type": "model" + } + ], + "Model hash": "1d1e459f9f", + "Hires steps": "20", + "Hires upscale": "1.25", + "AddNet Enabled": "True", + "AddNet Model 3": "testing_lilith_asami-07(9f934a1d6330)", + "Hires upscaler": "Latent", + "negativePrompt": "(worst quality, low quality:1.4), easynegative, bad hands, noob artist, (bad anatomy:1.2), ugly, distortions, child, loli, deformityv6, (watermark:1.5),(chalkboard)", + "AddNet Module 3": "LoRA", + "AddNet Weight A 3": "0.7", + "AddNet Weight B 3": "0.7", + "Denoising strength": "0.7" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/49c494fd-91a5-40fa-ae68-a2462efbbc3e/width=450/1199458.jpeg", + "nsfw": "None", + "width": 1280, + "height": 1920, + "hash": "UIHe2rQ,_14;.84.4:xv~qD%S1bv.8MxRQE2", + "meta": { + "Size": "512x768", + "seed": 2833885730, + "Model": "anything-v4.5", + "steps": 20, + "hashes": { + "model": "1d1e459f9f" + }, + "prompt": "masterpiece, (best quality), 1woman,1girl ,lilith_asami, long hair, red hair, blue eyes , braid, side braid, school uniform, shirt, skirt, jacket, necktie, large breasts,,sexy woman, adult, smile, blush, vibrant colors ,,natural lighting ,RTX, beautiful, (detailed face:1.2), showcase, (perfect eyes:1.1) ,(photorealistic:1.1), 8k uhd, looking at viewer, outdoors, simple backround", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "1d1e459f9f", + "name": "anything-v4.5", + "type": "model" + } + ], + "Model hash": "1d1e459f9f", + "Hires steps": "20", + "Hires upscale": "1.25", + "AddNet Enabled": "True", + "AddNet Model 3": "testing_lilith_asami-07(9f934a1d6330)", + "Hires upscaler": "Latent", + "negativePrompt": "(worst quality, low quality:1.4), easynegative, bad hands, noob artist, (bad anatomy:1.2), ugly, distortions, child, loli, deformityv6, (watermark:1.5),(chalkboard)", + "AddNet Module 3": "LoRA", + "AddNet Weight A 3": "0.7", + "AddNet Weight B 3": "0.7", + "Denoising strength": "0.7" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/99046" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/TRINITY SEVEN \351\255\224\351\201\223\344\271\2467\344\275\277\350\200\205/lilith_asami_DG.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/TRINITY SEVEN \351\255\224\351\201\223\344\271\2467\344\275\277\350\200\205/lilith_asami_DG.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..01c231b353cf7ee258dca677103ceca8052dea06 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/TRINITY SEVEN \351\255\224\351\201\223\344\271\2467\344\275\277\350\200\205/lilith_asami_DG.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/TRINITY SEVEN \351\255\224\351\201\223\344\271\2467\344\275\277\350\200\205/lilith_asami_DG.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/TRINITY SEVEN \351\255\224\351\201\223\344\271\2467\344\275\277\350\200\205/lilith_asami_DG.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..267165c693b98aa3530ec7a6612bd05d65b06393 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/TRINITY SEVEN \351\255\224\351\201\223\344\271\2467\344\275\277\350\200\205/lilith_asami_DG.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:fa10f6bc935cf83737008d9220d1c78e978176b7333e3f621b23ca8bdffefb5d +size 37878818 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/URARA\350\277\267\350\267\257\345\270\226/chiya.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/URARA\350\277\267\350\267\257\345\270\226/chiya.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..34c8aef2b128fd606041594c9cffd364aabe1661 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/URARA\350\277\267\350\267\257\345\270\226/chiya.civitai.info" @@ -0,0 +1,88 @@ +{ + "id": 75710, + "modelId": 71017, + "name": "v1.0", + "createdAt": "2023-05-20T08:08:12.132Z", + "updatedAt": "2023-05-20T09:31:15.879Z", + "trainedWords": [ + "chiya" + ], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 198, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "chiya(urara meirochou)", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "chiya.safetensors", + "id": 52272, + "sizeKB": 36976.0009765625, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-20T08:11:21.421Z", + "hashes": { + "AutoV1": "EC76F83A", + "AutoV2": "7BF2B7F99D", + "SHA256": "7BF2B7F99DFCF95DE8FF0E6BA9E8D8124452D61EF4F8AD39BCFF3BD90ED27081", + "CRC32": "4B988A2E", + "BLAKE3": "539CCC54A20955E84394D86B44A80B79D79F713C08B9362E65F082D41122183E" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/75710" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/91d591f4-7e72-4f42-8efb-e72ed3f86463/width=450/847835.jpeg", + "nsfw": "None", + "width": 816, + "height": 1024, + "hash": "UPLf%U^%9tQ-_N?GIAxtEMjEogS1IBoIShRO", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 2044072890, + "steps": 30, + "prompt": ",masterpiece,best quality,highly detailed,\nchiya,small breasts,white hair,very long hair,upper body,\nkimono,Japanese house,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "hash": "4159e3ae1214", + "name": "chiya2", + "type": "lora", + "weight": null + } + ], + "Hires steps": "10", + "Hires upscale": "1.6", + "AddNet Enabled": "True", + "AddNet Model 1": "chiya2(4159e3ae1214)", + "Hires upscaler": "Latent", + "negativePrompt": "EasyNegative,(bad_prompt_version2:0.75),(badhandv4:0.7),lowres,text, error, cropped, worst quality, low quality, jpeg artifacts, ugly, duplicate, morbid, mutilated, extra fingers, mutated hands, poorly drawn hands, poorly drawn face, mutation, deformed, blurry, dehydrated, bad anatomy, bad proportions, extra limbs, cloned face, disfigured, gross proportions, malformed limbs, missing arms, missing legs, extra arms, extra legs, fused fingers, too many fingers, long neck, username, watermark, signature,monster,, easynegative,lowres,text, error, cropped, worst quality, low quality, jpeg artifacts, ugly, duplicate, morbid, mutilated, extra fingers, mutated hands, poorly drawn hands, poorly drawn face, mutation, deformed, blurry, dehydrated, bad anatomy, bad proportions, extra limbs, cloned face, disfigured, gross proportions, malformed limbs, missing arms, missing legs, extra arms, extra legs, fused fingers, too many fingers, long neck, username, watermark, signature,monster,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.75", + "AddNet Weight B 1": "0.75", + "Denoising strength": "0.55" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/75710" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/URARA\350\277\267\350\267\257\345\270\226/chiya.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/URARA\350\277\267\350\267\257\345\270\226/chiya.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..de515acff74a54801df65d0638a4e073a34f40d5 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/URARA\350\277\267\350\267\257\345\270\226/chiya.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/URARA\350\277\267\350\267\257\345\270\226/chiya.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/URARA\350\277\267\350\267\257\345\270\226/chiya.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..dc7aeb0f8f8bb360af285fcdea01297a83b0e1e1 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/URARA\350\277\267\350\267\257\345\270\226/chiya.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:7bf2b7f99dfcf95de8ff0e6ba9e8d8124452d61ef4f8ad39bcff3bd90ed27081 +size 37863425 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Valkyrie Drive/Mamori_Tokonome-10.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Valkyrie Drive/Mamori_Tokonome-10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..dbc68c75761f662b488f2b5f905377e5f008435d --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Valkyrie Drive/Mamori_Tokonome-10.civitai.info" @@ -0,0 +1,237 @@ +{ + "id": 116410, + "modelId": 108182, + "name": "v1.0", + "createdAt": "2023-07-13T02:58:54.722Z", + "updatedAt": "2023-07-13T03:29:31.485Z", + "trainedWords": [ + "1girl, MamoriTokonome, red hair, thin braid twintails, white smiling cat hair pin, pink lips, gold eyes" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

  • Trained on 28 images that were mostly portraits only

  • Cannot be upscaled but inpainting for the hair and face will fix it

  • Images that aren't portraits will only look Mamori-adjacent until you inpaint but when you inpaint it will fix it immediately

  • Hair pin lacks a lot to be desired

  • I will need to tag the backgrounds next time so that the backgrounds don't default to the same nature background

  • If you think about the hands, you will have a curse on your household. Please use controlnet to correct them for now.

", + "stats": { + "downloadCount": 3, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Valkyrie Drive Mermaid - Mamori Tokonome", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "Mamori_Tokonome-10.safetensors", + "id": 83111, + "sizeKB": 36979.96875, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-07-13T03:25:20.369Z", + "hashes": { + "AutoV1": "FA4FE64C", + "AutoV2": "47576E3398", + "SHA256": "47576E339810C11BD0B36841535FA08CCF194976F1F25CB2B3ECC72A3BCADD09", + "CRC32": "95E90776", + "BLAKE3": "1C33835AF694036C56AC701ED563604F6CDE6AB4B00D22907714036ED63CC5FE" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/116410" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ec13ac69-d106-42e7-ae58-17deac99ba4f/width=450/1532389.jpeg", + "nsfw": "None", + "width": 512, + "height": 512, + "hash": "UNMsj1~q%y-;8|x_-:x[-=Ri_2Io^*-;I:xa", + "meta": { + "Size": "512x512", + "seed": 3599962258, + "Model": "AnythingV5_v5PrtRE", + "steps": 20, + "hashes": { + "model": "7f96a1a9ca" + }, + "prompt": " 1girl, MamoriTokonome, thin braid twintails, white smiling cat hair pin, flushed face, smiling, happy, gold eyes", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Mamori_Tokonome", + "type": "lora", + "weight": 1 + }, + { + "hash": "7f96a1a9ca", + "name": "AnythingV5_v5PrtRE", + "type": "model" + } + ], + "Model hash": "7f96a1a9ca", + "negativePrompt": "easynegative", + "\"Mamori_Tokonome": "a9ec402b033a\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8d6d96ac-8a45-411e-8609-8d04fb4bfb36/width=450/1532388.jpeg", + "nsfw": "None", + "width": 512, + "height": 512, + "hash": "UQLpL1xwEx-;IWWC?GIU_N%N?bof?aR%9ZWA", + "meta": { + "Size": "512x512", + "seed": 835402482, + "Model": "AnythingV5_v5PrtRE", + "steps": 20, + "hashes": { + "model": "7f96a1a9ca" + }, + "prompt": " 1girl, MamoriTokonome, thin braid twintails, white smiling cat hair pin, flushed face, missionary sex, penis in vagina sex, cream pie, closed eyes, orgasm face", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Mamori_Tokonome", + "type": "lora", + "weight": 1 + }, + { + "hash": "7f96a1a9ca", + "name": "AnythingV5_v5PrtRE", + "type": "model" + } + ], + "Model hash": "7f96a1a9ca", + "negativePrompt": "easynegative, portrait", + "\"Mamori_Tokonome": "a9ec402b033a\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6404cea6-d65d-45bb-8229-ab4e1a81db59/width=450/1532387.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UHK]_[-PJ~-:01D~?HIU^,nP~paf^+xtNZoM", + "meta": { + "Size": "512x512", + "seed": 2309545202, + "Model": "AnythingV5_v5PrtRE", + "steps": 20, + "hashes": { + "model": "7f96a1a9ca" + }, + "prompt": " 1girl, MamoriTokonome, thin braid twintails, white smiling cat hair pin, flushed face, missionary sex, penis in vagina sex, cream pie, closed eyes, orgasm face, frowning", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Mamori_Tokonome", + "type": "lora", + "weight": 1 + }, + { + "hash": "7f96a1a9ca", + "name": "AnythingV5_v5PrtRE", + "type": "model" + } + ], + "Model hash": "7f96a1a9ca", + "negativePrompt": "easynegative, portrait", + "\"Mamori_Tokonome": "a9ec402b033a\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a16cfacc-60fb-4683-ae96-a7be212b185f/width=450/1532404.jpeg", + "nsfw": "None", + "width": 512, + "height": 512, + "hash": "UII$W;Q+0v%L0rVrIAtR+aso~mNGA2xsO9My", + "meta": { + "Size": "768x768", + "seed": 1049558510, + "Model": "AnythingV5_v5PrtRE", + "steps": 20, + "hashes": { + "model": "7f96a1a9ca" + }, + "prompt": " 1girl, MamoriTokonome, red hair, thin braid twintails, white smiling cat hair pin, gold eyes, happy, smiling, wedding dress, outdoors, beautiful nature background, white rose on dress, flower petals falling from the sky", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "Mask blur": "4", + "resources": [ + { + "name": "Mamori_Tokonome", + "type": "lora", + "weight": 1 + }, + { + "hash": "7f96a1a9ca", + "name": "AnythingV5_v5PrtRE", + "type": "model" + } + ], + "Model hash": "7f96a1a9ca", + "negativePrompt": "easynegative, portrait", + "\"Mamori_Tokonome": "a9ec402b033a\"", + "Denoising strength": "0.75" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/27d6fb24-331a-4578-bef9-208c89b9d752/width=450/1532403.jpeg", + "nsfw": "None", + "width": 512, + "height": 512, + "hash": "UlLXY:-oAptQpyxs%hbbD+aekXWC,:oJ$#j[", + "meta": { + "Size": "550x550", + "seed": 2462598302, + "Model": "AnythingV5_v5PrtRE", + "steps": 20, + "hashes": { + "model": "7f96a1a9ca" + }, + "prompt": " 1girl, MamoriTokonome, thin braid twintails, red hair, back view, swimsuit", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "Mask blur": "4", + "resources": [ + { + "name": "Mamori_Tokonome", + "type": "lora", + "weight": 1 + }, + { + "hash": "7f96a1a9ca", + "name": "AnythingV5_v5PrtRE", + "type": "model" + } + ], + "Model hash": "7f96a1a9ca", + "negativePrompt": "easynegative, portrait, ugly breasts, morbid, badhandv4, NegfeetV2", + "\"Mamori_Tokonome": "a9ec402b033a\"", + "Denoising strength": "0.75" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/116410" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Valkyrie Drive/Mamori_Tokonome-10.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Valkyrie Drive/Mamori_Tokonome-10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..980cdc40d14f5c09c9782d936aed423603756685 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Valkyrie Drive/Mamori_Tokonome-10.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/Valkyrie Drive/Mamori_Tokonome-10.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Valkyrie Drive/Mamori_Tokonome-10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..13d290ea8f827dd35745752df10d3263080336de --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/Valkyrie Drive/Mamori_Tokonome-10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:47576e339810c11bd0b36841535fa08ccf194976f1f25cb2b3ecc72a3bcadd09 +size 37867488 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\345\256\211\350\276\276\344\270\216\345\262\233\346\235\221/Adachi_v1.2.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\345\256\211\350\276\276\344\270\216\345\262\233\346\235\221/Adachi_v1.2.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..844372d637ee20cd60f9bf9208a4a6b665067f07 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\345\256\211\350\276\276\344\270\216\345\262\233\346\235\221/Adachi_v1.2.civitai.info" @@ -0,0 +1,221 @@ +{ + "id": 103326, + "modelId": 96716, + "name": "v1.0", + "createdAt": "2023-06-24T23:25:03.228Z", + "updatedAt": "2023-06-24T23:29:37.454Z", + "trainedWords": [ + "adachi" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 287, + "ratingCount": 2, + "rating": 3 + }, + "model": { + "name": "Adachi Sakura - Adachi to Shimamura ", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "Adachi_v1.2.safetensors", + "id": 72509, + "sizeKB": 147571.7158203125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-24T23:30:51.811Z", + "hashes": { + "AutoV1": "6E1E1B2C", + "AutoV2": "A8C63E8E91", + "SHA256": "A8C63E8E913BAC520CFA5DC7D41925F8885B2B221673C33A012A0AE95C59AE56", + "CRC32": "62C66121", + "BLAKE3": "45B4CA8B3FD0B3F4839E32F5B1CE79B6CC764CC484A35C12C172A5E442E816AE" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/103326" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/300be05a-e37e-4990-b779-7f90b6392553/width=450/1277421.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UGFsG2D%ts%N_NIUIVkFOFIU4Ut8?rRi~8bJ", + "meta": { + "Size": "1024x1536", + "seed": 212792559, + "Model": "AnyLoRA_Default", + "steps": 35, + "prompt": "(masterpiece, best quality, ultra-detailed), (illustration), (beautiful detailed eyes), 1girl, solo, adachi, green eyes, short hair, ,\nskirt,shirt, long sleeves, bow, school uniform, white shirt, pleated skirt, collared shirt, bowtie, red bow, plaid skirt, blazer, cardigan, pink bow,\noutdoors, cowboy shot, greenary, looking away, blush,", + "Version": "v1.3.2", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "Adachi_v1.2", + "type": "lora", + "weight": 0.6 + } + ], + "\"Adachi_v1.2": "ed1569200a6b\"", + "negativePrompt": "EasyNegative, extra fingers,(bad feet:2.0),fewer fingers,low quality, worst quality, watermark,sketch, duplicate, ugly, huge eyes, text, logo, monochrome, worst face, (bad and mutated hands:1.3), (worst quality:2.0), (low quality:2.0), (blurry:2.0), (bad hands), (missing fingers), (multiple limbs:1.2), bad anatomy, (interlocked fingers:1.2), Ugly Fingers, (extra digit and hands and fingers and legs and arms:1.4), (deformed fingers:1.2), (long fingers:1.2),(bad-artist-anime), ((((fake animal ears, cat ears:2, animal ears)))), ((multiple views)), ((((fish, fishs)))), signature, watermark, nude, completely nude, bodysuit:2, pink bodysuit, green bodysuit, white bodysuit,", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b539f322-74e0-4517-a38e-453ea3970d70/width=450/1277420.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UKEpJ;aSNpXdM_%JNKO9_Lt6V[f5IVX4xZxa", + "meta": { + "Size": "1024x1536", + "seed": 550165534, + "Model": "AnyLoRA_Default", + "steps": 35, + "prompt": "(masterpiece, best quality, ultra-detailed), (illustration), (beautiful detailed eyes), 1girl, solo, adachi, green eyes, short hair, ,\nskirt,shirt, long sleeves, bow, school uniform, white shirt, pleated skirt, collared shirt, bowtie, red bow, plaid skirt, pink bow,\noutdoors, cowboy shot, greenary, looking away, blush,", + "Version": "v1.3.2", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "Adachi_v1.2", + "type": "lora", + "weight": 0.8 + } + ], + "\"Adachi_v1.2": "ed1569200a6b\"", + "negativePrompt": "EasyNegative, extra fingers,(bad feet:2.0),fewer fingers,low quality, worst quality, watermark,sketch, duplicate, ugly, huge eyes, text, logo, monochrome, worst face, (bad and mutated hands:1.3), (worst quality:2.0), (low quality:2.0), (blurry:2.0), (bad hands), (missing fingers), (multiple limbs:1.2), bad anatomy, (interlocked fingers:1.2), Ugly Fingers, (extra digit and hands and fingers and legs and arms:1.4), (deformed fingers:1.2), (long fingers:1.2),(bad-artist-anime), ((((fake animal ears, cat ears:2, animal ears)))), ((multiple views)), ((((fish, fishs)))), signature, watermark, nude, completely nude, bodysuit:2, pink bodysuit, green bodysuit, white bodysuit,", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0e18ded7-3683-4c7e-9017-1c2b3a934c70/width=450/1277424.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UEEC,e02FSNLRQ%DNMog_KRiIW%1k,D*~VV[", + "meta": { + "Size": "1024x1536", + "seed": 550358478, + "Model": "AnyLoRA_Default", + "steps": 35, + "prompt": "(masterpiece, best quality, ultra-detailed), (illustration), (beautiful detailed eyes), 1girl, solo, adachi, green eyes, short hair, ,\nskirt,shirt, long sleeves, bow, school uniform, white shirt, pleated skirt, collared shirt, bowtie, red bow, plaid skirt, blazer, cardigan, pink bow,\noutdoors, cowboy shot, greenary, looking away, blush,", + "Version": "v1.3.2", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "Adachi_v1.2", + "type": "lora", + "weight": 0.6 + } + ], + "\"Adachi_v1.2": "ed1569200a6b\"", + "negativePrompt": "EasyNegative, extra fingers,(bad feet:2.0),fewer fingers,low quality, worst quality, watermark,sketch, duplicate, ugly, huge eyes, text, logo, monochrome, worst face, (bad and mutated hands:1.3), (worst quality:2.0), (low quality:2.0), (blurry:2.0), (bad hands), (missing fingers), (multiple limbs:1.2), bad anatomy, (interlocked fingers:1.2), Ugly Fingers, (extra digit and hands and fingers and legs and arms:1.4), (deformed fingers:1.2), (long fingers:1.2),(bad-artist-anime), ((((fake animal ears, cat ears:2, animal ears)))), ((multiple views)), ((((fish, fishs)))), signature, watermark, nude, completely nude, bodysuit:2, pink bodysuit, green bodysuit, white bodysuit,", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/085a3113-f57f-4a22-b4dc-5b9912d53ec7/width=450/1277423.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "URHx.[_NExx^?v.9tmo#00R.%NRkOSRjxWV@", + "meta": { + "Size": "1024x1536", + "seed": 2911979623, + "Model": "AnyLoRA_Default", + "steps": 35, + "prompt": "(masterpiece, best quality, ultra-detailed), (illustration), (beautiful detailed eyes), 1girl, solo, adachi, green eyes, short hair, ,\nskirt,shirt, long sleeves, bow, school uniform, white shirt, pleated skirt, collared shirt, bowtie, red bow, plaid skirt, pink bow,\noutdoors, cowboy shot, greenary, looking away, blush,", + "Version": "v1.3.2", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "Adachi_v1.2", + "type": "lora", + "weight": 0.6 + } + ], + "\"Adachi_v1.2": "ed1569200a6b\"", + "negativePrompt": "EasyNegative, extra fingers,(bad feet:2.0),fewer fingers,low quality, worst quality, watermark,sketch, duplicate, ugly, huge eyes, text, logo, monochrome, worst face, (bad and mutated hands:1.3), (worst quality:2.0), (low quality:2.0), (blurry:2.0), (bad hands), (missing fingers), (multiple limbs:1.2), bad anatomy, (interlocked fingers:1.2), Ugly Fingers, (extra digit and hands and fingers and legs and arms:1.4), (deformed fingers:1.2), (long fingers:1.2),(bad-artist-anime), ((((fake animal ears, cat ears:2, animal ears)))), ((multiple views)), ((((fish, fishs)))), signature, watermark, nude, completely nude, bodysuit:2, pink bodysuit, green bodysuit, white bodysuit,", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e67b0403-fd20-4c26-8290-e674e7691690/width=450/1277425.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "ULG9Z_Wm_IW??ts*9vt69YIVnPM|M[%L=[s:", + "meta": { + "Size": "1024x1536", + "seed": 64033413, + "Model": "AnyLoRA_Default", + "steps": 35, + "prompt": "(masterpiece, best quality, ultra-detailed), (illustration), (beautiful detailed eyes), 1girl, solo, adachi, green eyes, short hair, ,\nblue dress, jewelry, tiara, earrings, \noutdoors, cowboy shot, greenary, blush, looking at viewer, smile,", + "Version": "v1.3.2", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "Adachi_v1.2", + "type": "lora", + "weight": 0.7 + } + ], + "\"Adachi_v1.2": "ed1569200a6b\"", + "negativePrompt": "EasyNegative, extra fingers,(bad feet:2.0),fewer fingers,low quality, worst quality, watermark,sketch, duplicate, ugly, huge eyes, text, logo, monochrome, worst face, (bad and mutated hands:1.3), (worst quality:2.0), (low quality:2.0), (blurry:2.0), (bad hands), (missing fingers), (multiple limbs:1.2), bad anatomy, (interlocked fingers:1.2), Ugly Fingers, (extra digit and hands and fingers and legs and arms:1.4), (deformed fingers:1.2), (long fingers:1.2),(bad-artist-anime), ((((fake animal ears, cat ears:2, animal ears)))), ((multiple views)), ((((fish, fishs)))), signature, watermark, nude, completely nude, bodysuit:2, pink bodysuit, green bodysuit, white bodysuit,", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/de65c263-b613-4c46-9661-bf364af623cb/width=450/1277422.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UAD,cL-:yHot~px]01M{.8t8-UWAl8xu~Ts+", + "meta": { + "Size": "1024x1536", + "seed": 3579422123, + "Model": "AnyLoRA_Default", + "steps": 35, + "prompt": "(masterpiece, best quality, ultra-detailed), (illustration), (beautiful detailed eyes), 1girl, solo, adachi, green eyes, short hair, ,\nblue dress, jewelry, tiara, earrings, \noutdoors, cowboy shot, greenary, blush, looking at viewer, smile,", + "Version": "v1.3.2", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "Adachi_v1.2", + "type": "lora", + "weight": 0.7 + } + ], + "\"Adachi_v1.2": "ed1569200a6b\"", + "negativePrompt": "EasyNegative, extra fingers,(bad feet:2.0),fewer fingers,low quality, worst quality, watermark,sketch, duplicate, ugly, huge eyes, text, logo, monochrome, worst face, (bad and mutated hands:1.3), (worst quality:2.0), (low quality:2.0), (blurry:2.0), (bad hands), (missing fingers), (multiple limbs:1.2), bad anatomy, (interlocked fingers:1.2), Ugly Fingers, (extra digit and hands and fingers and legs and arms:1.4), (deformed fingers:1.2), (long fingers:1.2),(bad-artist-anime), ((((fake animal ears, cat ears:2, animal ears)))), ((multiple views)), ((((fish, fishs)))), signature, watermark, nude, completely nude, bodysuit:2, pink bodysuit, green bodysuit, white bodysuit,", + "Denoising strength": "0.5" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/103326" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\345\256\211\350\276\276\344\270\216\345\262\233\346\235\221/Adachi_v1.2.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\345\256\211\350\276\276\344\270\216\345\262\233\346\235\221/Adachi_v1.2.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..bba4ddacc5de9efee5fdaa90ca0f9aeb60d8f90f --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\345\256\211\350\276\276\344\270\216\345\262\233\346\235\221/Adachi_v1.2.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:c31b8a77e0617d9a5ed5ec8d65a45393443b82b1088e961142522b33b2fef50b +size 2019232 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\345\256\211\350\276\276\344\270\216\345\262\233\346\235\221/Adachi_v1.2.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\345\256\211\350\276\276\344\270\216\345\262\233\346\235\221/Adachi_v1.2.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..06349a84b7af8cf33dee413fecd001d3c80976d1 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\345\256\211\350\276\276\344\270\216\345\262\233\346\235\221/Adachi_v1.2.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:a8c63e8e913bac520cfa5dc7d41925f8885b2b221673c33a012a0ae95c59ae56 +size 151113437 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\345\256\211\350\276\276\344\270\216\345\262\233\346\235\221/ShimamuraHougetsu.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\345\256\211\350\276\276\344\270\216\345\262\233\346\235\221/ShimamuraHougetsu.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..bec42faecdf611a55bb5c62207fe446a14f1e6ad --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\345\256\211\350\276\276\344\270\216\345\262\233\346\235\221/ShimamuraHougetsu.civitai.info" @@ -0,0 +1,95 @@ +{ + "id": 87385, + "modelId": 82292, + "name": "v1.0", + "createdAt": "2023-06-02T02:37:07.896Z", + "updatedAt": "2023-06-02T02:39:10.527Z", + "trainedWords": [ + "shimamura hougetsu" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 136, + "ratingCount": 1, + "rating": 5 + }, + "model": { + "name": "\u5cf6\u6751 \u62b1\u6708 Shimamura Hougetsu / \u5b89\u9054\u3068\u3057\u307e\u3080\u3089 Adachi and Shimamura", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "ShimamuraHougetsu.safetensors", + "id": 59851, + "sizeKB": 18544.1123046875, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-02T02:41:33.922Z", + "hashes": { + "AutoV1": "DE2F2560", + "AutoV2": "9F4EC91F3C", + "SHA256": "9F4EC91F3C0ACB88D89D8C5CF4AF14F94FAEE87A3EE2E284754209B3045D423D", + "CRC32": "EA9E23E1", + "BLAKE3": "79DC625CB1152F8F44AB02CC78FEF92CE67D8987CB92ED921E289A6D19F9E29C" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/87385" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/107ab952-d69f-43f9-a8a8-7843befa65c3/width=450/999948.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "UbJ8Y8-UKNRQ*0snx]xZT2WCRUs.t8W.NIR+", + "meta": { + "steps": 20, + "prompt": "masterpiece, best quality,1girl,solo,shimamura hougetsu,grey hair,long hair,hair between eyes,purple eyes,scarf,hairclip,school uniform,blue jacket,orange cardigan,dress shirt,red bowtie,grey plaid skirt,miniskirt,black socks,,cleavage, outdoors,", + "sampler": "Euler a", + "cfgScale": 7, + "negativePrompt": "worst quality, low quality, signature, EasyNegative,censor,bar censor,mosaic censorship,bad anatomy,lowres,text, normal quality,badhandv4," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/42da195e-25d4-4db6-937e-c106ded26f47/width=450/999947.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "URKT[0~oAAtQJ#t6X4oekpxaMxjY$zoe%2WC", + "meta": { + "steps": 20, + "prompt": "masterpiece, best quality,1girl,solo,shimamura hougetsu,grey hair,long hair,hair between eyes,purple eyes,hairclip,school uniform,blue jacket,orange cardigan,dress shirt,red bowtie,grey plaid skirt,miniskirt,black socks,,classroom, ", + "sampler": "Euler a", + "cfgScale": 7, + "negativePrompt": "worst quality, low quality, signature, EasyNegative,censor,bar censor,mosaic censorship,bad anatomy,lowres,text, normal quality,badhandv4," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2adaff55-c09b-4336-b11a-f45ba7dc2d65/width=450/999949.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "UHI}b8$~0JjG_IR$pAxu%{Io-:t6_2V[E1M|", + "meta": { + "steps": 20, + "prompt": "masterpiece, best quality,1girl,solo,shimamura hougetsu,grey hair,long hair,hair between eyes,purple eyes,hairclip,school uniform,blue jacket,orange cardigan,dress shirt,red bowtie,grey plaid skirt,miniskirt,black socks,,school,outdoors, light smile, ", + "sampler": "Euler a", + "cfgScale": 7, + "negativePrompt": "worst quality, low quality, signature, EasyNegative,censor,bar censor,mosaic censorship,bad anatomy,lowres,text, normal quality,badhandv4," + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/87385" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\345\256\211\350\276\276\344\270\216\345\262\233\346\235\221/ShimamuraHougetsu.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\345\256\211\350\276\276\344\270\216\345\262\233\346\235\221/ShimamuraHougetsu.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..faaa220adac13843ee9bfb0f7a3262b0224e4b84 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\345\256\211\350\276\276\344\270\216\345\262\233\346\235\221/ShimamuraHougetsu.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\345\256\211\350\276\276\344\270\216\345\262\233\346\235\221/ShimamuraHougetsu.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\345\256\211\350\276\276\344\270\216\345\262\233\346\235\221/ShimamuraHougetsu.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..47ef9fa6310cdffc6d07892ab8dd0e7479535350 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\345\256\211\350\276\276\344\270\216\345\262\233\346\235\221/ShimamuraHougetsu.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9f4ec91f3c0acb88d89d8c5cf4af14f94faee87a3ee2e284754209b3045d423d +size 18989171 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\345\256\211\350\276\276\344\270\216\345\262\233\346\235\221/adachisakura.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\345\256\211\350\276\276\344\270\216\345\262\233\346\235\221/adachisakura.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..d645c934d6c9246eb2a6a64931272a81e45fc39f --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\345\256\211\350\276\276\344\270\216\345\262\233\346\235\221/adachisakura.civitai.info" @@ -0,0 +1,109 @@ +{ + "id": 87382, + "modelId": 82290, + "name": "v1.0", + "createdAt": "2023-06-02T02:33:07.896Z", + "updatedAt": "2023-06-02T02:35:51.987Z", + "trainedWords": [ + "adachi sakura" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 138, + "ratingCount": 1, + "rating": 5 + }, + "model": { + "name": "\u5b89\u9054 \u685c Adachi Sakura / \u5b89\u9054\u3068\u3057\u307e\u3080\u3089 Adachi and Shimamura", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "adachisakura.safetensors", + "id": 59847, + "sizeKB": 27760.34375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-02T02:36:40.732Z", + "hashes": { + "AutoV1": "75B96F58", + "AutoV2": "4A2D0DBB33", + "SHA256": "4A2D0DBB330FD92DFF04E06074D52E6BB2DC7CA551723A07F6D4011EDF9C7D97", + "CRC32": "28148BF8", + "BLAKE3": "E39309194370FE398A643EFAC7D2E64A7602D958AE6B36AB9D766531FAB53ECB" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/87382" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/605812d0-c566-4604-8bed-ec5188eab540/width=450/999904.jpeg", + "nsfw": "X", + "width": 512, + "height": 768, + "hash": "URHxZ@%1Mw?H~q%2?Fof-:tR-;R*~WNHJBxu", + "meta": { + "steps": 20, + "prompt": "masterpiece, best quality,1girl,solo,adachi sakura,blue hair,short hair,hair between eyes,aqua eyes,blue scarf,school uniform,blue jacket,blue cardigan,dress shirt,red bowtie,grey plaid skirt,miniskirt,black socks,,winter,street,night sky, building, ", + "sampler": "Euler a", + "cfgScale": 7, + "negativePrompt": "worst quality, low quality, signature, EasyNegative,censor,bar censor,mosaic censorship,bad anatomy,lowres,text, normal quality,badhandv4," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a12578fa-720c-4b7d-9003-71063e710a26/width=450/999902.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "UII#ZF00KinNTL-:-:aK4n~pnPIp_2NIE1nl", + "meta": { + "steps": 20, + "prompt": "masterpiece, best quality,1girl,solo,adachi sakura,blue hair,short hair,hair between eyes,aqua eyes,school uniform,blue jacket,blue cardigan,dress shirt,red bowtie,grey plaid skirt,miniskirt,black socks,,", + "sampler": "Euler a", + "cfgScale": 7, + "negativePrompt": "worst quality, low quality, signature, EasyNegative,censor,bar censor,mosaic censorship,bad anatomy,lowres,text, normal quality,badhandv4," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1e24b362-8298-4610-9518-fdb2ff1b20ee/width=450/999903.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "U8Fr;f%20x0200%J8_~V=o02WBE1WE_2%Mrq", + "meta": { + "steps": 20, + "prompt": "masterpiece, best quality,1girl,solo,adachi sakura,blue hair,short hair,hair between eyes,aqua eyes,blue scarf,school uniform,blue jacket,blue cardigan,dress shirt,red bowtie,grey plaid skirt,miniskirt,black socks,,winter,street,night sky, building, \n", + "sampler": "Euler a", + "cfgScale": 7, + "negativePrompt": "worst quality, low quality, signature, EasyNegative,censor,bar censor,mosaic censorship,bad anatomy,lowres,text, normal quality,badhandv4," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b3f5c8b6-4b5c-4c87-a5d2-211269f2645b/width=450/999901.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "UVI}*N~q.6D%?Hxas:M|nORjIVxuNeR*xZWA", + "meta": { + "steps": 20, + "prompt": "masterpiece, best quality,1girl,solo,adachi sakura,blue hair,short hair,hair between eyes,aqua eyes,school uniform,blue jacket,blue cardigan,dress shirt,red bowtie,grey plaid skirt,miniskirt,black socks,,", + "sampler": "Euler a", + "cfgScale": 7, + "negativePrompt": "worst quality, low quality, signature, EasyNegative,censor,bar censor,mosaic censorship,bad anatomy,lowres,text, normal quality,badhandv4," + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/87382" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\345\256\211\350\276\276\344\270\216\345\262\233\346\235\221/adachisakura.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\345\256\211\350\276\276\344\270\216\345\262\233\346\235\221/adachisakura.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..42f401fcc3fe48a044a5a8e945cde61faf872363 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\345\256\211\350\276\276\344\270\216\345\262\233\346\235\221/adachisakura.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\345\256\211\350\276\276\344\270\216\345\262\233\346\235\221/adachisakura.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\345\256\211\350\276\276\344\270\216\345\262\233\346\235\221/adachisakura.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..355b027f84bcb8cfba7d84154a4dbe24f73482b9 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\345\256\211\350\276\276\344\270\216\345\262\233\346\235\221/adachisakura.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:4a2d0dbb330fd92dff04e06074d52e6bb2dc7ca551723a07f6d4011edf9c7d97 +size 28426592 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\346\213\234\346\211\230\344\272\206\342\230\206\350\200\201\345\270\210/kazami_mizuho_v1.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\346\213\234\346\211\230\344\272\206\342\230\206\350\200\201\345\270\210/kazami_mizuho_v1.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..d6ec6c6bd9046899ee0aabbad3ffa2fda8f580e2 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\346\213\234\346\211\230\344\272\206\342\230\206\350\200\201\345\270\210/kazami_mizuho_v1.civitai.info" @@ -0,0 +1,443 @@ +{ + "id": 62954, + "modelId": 58511, + "name": "v1.0", + "createdAt": "2023-05-05T09:53:40.908Z", + "updatedAt": "2023-05-05T09:55:32.026Z", + "trainedWords": [ + "km1, 1girl, red hair, sidelocks, glasses" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 41, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Kazami Mizuho \u98a8\u898b\u307f\u305a\u307b / Onegai Teacher", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "kazami_mizuho_v1.safetensors", + "id": 44377, + "sizeKB": 36984.6767578125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-05T09:55:45.520Z", + "hashes": { + "AutoV1": "733B5BB1", + "AutoV2": "807DE3B6E4", + "SHA256": "807DE3B6E4531F28E70126217A15BF2B661F3545690B151EA88E83C0BE6262CB", + "CRC32": "B185AAD0", + "BLAKE3": "1A699B4E194510AF16294B1EEF39A1246EBFE300B5114B5EE4083CBE2B19B095" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/62954" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a82aec1f-aac3-44c5-9e6a-4ef1241b1548/width=450/693281.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UIHUzmx[Y#~VXxNF0Jj??uD*rrS4%g-;xaxu", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2350589053, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, km1, 1girl, red hair, sidelocks, brooch, jewelry, ascot, red vest, miniskirt, black_skirt, long sleeves, glasses, , outdoors, graden, arms behind back, smile, open mouth,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "kazami_mizuho_v1", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1), (holding:1.5)", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2ae71391-29cc-4e0a-b2be-f21f73a47f81/width=450/693283.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UMHV6$4:PptlBa-ob{n,%4nNI.kVIA9Z=sIo", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1464902172, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, km1, 1girl, red hair, long hair, brooch, jewelry, ascot, red vest, miniskirt, black_skirt, long sleeves, , standing, from below, pantyshot, white panties, frown, crossed arms,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "kazami_mizuho_v1", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1), (holding:1.5)", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d85507cb-93fc-4127-83b4-9e6409d4973b/width=450/693280.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "UAJQZi000J~Bxb9a-:My00OZ9^%200-;^kxt", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3773155263, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, km1, 1girl, red hair, sidelocks, playboy bunny, rabbit ears, ,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "kazami_mizuho_v1", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1), (holding:1.5)", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e02be4f2-6a1d-4ef0-a82f-25c5ee4da47b/width=450/693286.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UKJjh]01IU00yD9ZbJw2~pNL9GIot,Vrofs8", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 732901954, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, km1, 1girl, red hair, long hair, brooch, jewelry, ascot, red vest, miniskirt, black_skirt, long sleeves, glasses, , sitting, bench,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "kazami_mizuho_v1", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1), (holding:1.5)", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a1de946e-af03-4423-995d-c5eb14818b0d/width=450/693278.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "ULHBY#~WB:TJ9aj]XSOr-:S4D*r?.8xu_2%M", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1553740391, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, km1, 1girl, red hair, sidelocks, brooch, jewelry, ascot, red vest, miniskirt, black_skirt, long sleeves, glasses, , classroom, sitting, crossed legs,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "kazami_mizuho_v1", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1), (holding:1.5)", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/68d1e7dd-77f8-4773-a6e6-ac0bcdc67175/width=450/693289.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UFG*yr_4T_PBDjtS?btmbv%M9a-oAH%0?c%1", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 781569714, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, km1, 1girl, red hair, long hair, brooch, jewelry, ascot, red vest, miniskirt, black_skirt, long sleeves, , upper body,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "kazami_mizuho_v1", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1), (holding:1.5)", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6921751f-5a66-4fef-890c-f711e6964445/width=450/693282.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UCIXN+00Le-;A0NbKiDj=^.88{s+yESz~Wxa", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1563869138, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, km1, 1girl, red hair, sidelocks, brooch, jewelry, ascot, red vest, miniskirt, black_skirt, long sleeves, glasses, , classroom, standing, cowboy shot,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "kazami_mizuho_v1", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1), (holding:1.5)", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/75a93815-c2d5-4c0a-9d46-85d617bf80a8/width=450/693287.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1536, + "hash": "UIGl3V00_N%NI^R400bw?vr=V?%M%#RP%2g3", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 4261342330, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, km1, 1girl, red hair, long hair, bodysuit, cleavage, , street, cowboy shot,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "kazami_mizuho_v1", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1), (holding:1.5)", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e94436a0-da82-4c2a-bff9-ea9780551b54/width=450/693288.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UMHU;24TO-.8F|-5NFkW?wD#kBE2A1f2%3jw", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2205213369, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, km1, 1girl, red hair, sidelocks, brooch, jewelry, ascot, red vest, miniskirt, black_skirt, long sleeves, , outdoors, hand on hip,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "kazami_mizuho_v1", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1), (holding:1.5)", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/03985fe2-52d3-49b4-9f23-1808f94e64d3/width=450/693279.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "UQIX{p.m9sIA-=.9%#%go#-=x^ozxtt6s.Mx", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2462036506, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, km1, 1girl, red hair, long hair, dress, ,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "kazami_mizuho_v1", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1), (holding:1.5)", + "Denoising strength": "0.45" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/62954" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\346\213\234\346\211\230\344\272\206\342\230\206\350\200\201\345\270\210/kazami_mizuho_v1.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\346\213\234\346\211\230\344\272\206\342\230\206\350\200\201\345\270\210/kazami_mizuho_v1.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..da33ce8d14e842f7a2b556c6778d66075c9168d2 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\346\213\234\346\211\230\344\272\206\342\230\206\350\200\201\345\270\210/kazami_mizuho_v1.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\346\213\234\346\211\230\344\272\206\342\230\206\350\200\201\345\270\210/kazami_mizuho_v1.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\346\213\234\346\211\230\344\272\206\342\230\206\350\200\201\345\270\210/kazami_mizuho_v1.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..5f1be5893b535c76cf239d558a7bcc72d9cd0359 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\346\213\234\346\211\230\344\272\206\342\230\206\350\200\201\345\270\210/kazami_mizuho_v1.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:807de3b6e4531f28e70126217a15bf2b661f3545690b151ea88e83c0be6262cb +size 37872309 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\346\232\227\346\235\200\346\225\231\345\256\244/irinaJelavi_v10.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\346\232\227\346\235\200\346\225\231\345\256\244/irinaJelavi_v10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..4a6736f66060434371a7592af0b748ca3428ac7c --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\346\232\227\346\235\200\346\225\231\345\256\244/irinaJelavi_v10.civitai.info" @@ -0,0 +1,298 @@ +{ + "id": 33448, + "modelId": 27911, + "name": "v1.0", + "createdAt": "2023-04-02T00:31:06.557Z", + "updatedAt": "2023-04-02T00:31:06.557Z", + "trainedWords": [ + "irina jelavic" + ], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 674, + "ratingCount": 6, + "rating": 4.83 + }, + "model": { + "name": "Irina Jelavi\u0107 (Assassination Classroom)", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "irinaJelavi_v10.safetensors", + "id": 27543, + "sizeKB": 9333.3876953125, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-02T00:36:15.542Z", + "hashes": { + "AutoV1": "E8C9F031", + "AutoV2": "CE5E14E61E", + "SHA256": "CE5E14E61E352B2331197B6E0C41306D35710AE792810C11EB917E8443B919DD", + "CRC32": "E818ED7A", + "BLAKE3": "F5E704E97B7C5D5246A0D8EA32ACB3D87672BFFFC4E1CF3C3AF2DB5F26D3CFBA" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/33448" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0b771576-3938-4d39-d014-3288d6326400/width=450/381362.jpeg", + "nsfw": false, + "width": 1152, + "height": 1728, + "hash": "UAKd*#xa00-;_1%M%$X8~U_25SR.K*f,Mwjs", + "meta": { + "ENSD": "31337", + "Size": "384x576", + "seed": 1334752038, + "steps": 24, + "prompt": "(masterpiece), (best quality), extremely detailed,\nirina jelavic, black choker, white jacket, black sleeveless shirt, white skirt, black belt, classroom, cowboy shot, confident, smile, (smirk:0.8),\nhand on hip, arm at side", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "f2db738ced82", + "name": "irinaJelavic", + "type": "lora", + "weight": null + } + ], + "Model hash": "c590550ea5", + "Hires upscale": "3", + "AddNet Enabled": "True", + "AddNet Model 1": "irinaJelavic(f2db738ced82)", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(EasyNegative:0.8), (depth of field, bokeh, blurry:1.4), bra, holding, book, desk, chalkboard, anime screencap", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.3" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/bd24da0a-560b-4146-8aab-6ce8c319d300/width=450/381368.jpeg", + "nsfw": false, + "width": 768, + "height": 1024, + "hash": "UFM@WK%24-x^t:-o0#o~24Rj^jIpThM{rrM{", + "meta": { + "ENSD": "31337", + "Size": "384x512", + "seed": 45355, + "steps": 20, + "prompt": "(masterpiece), (best quality),\nirina jelavic, black choker, white jacket, black sleeveless shirt, upper body, outdoors, head tilt, smile", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "f2db738ced82", + "name": "irinaJelavic", + "type": "lora", + "weight": null + } + ], + "Model hash": "1d10a19f06", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "irinaJelavic(f2db738ced82)", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(EasyNegative:0.8), (depth of field, bokeh, blurry:1.4), bra, flower", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.3" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/52af2055-8848-456f-471d-d980a9185500/width=450/381367.jpeg", + "nsfw": true, + "width": 1152, + "height": 1536, + "hash": "UIL41ysm00xt_N?bIA9F-o%MR+9F0MS4xtIU", + "meta": { + "ENSD": "31337", + "Size": "384x512", + "seed": 45357, + "steps": 20, + "prompt": "(masterpiece), (best quality),\nirina jelavic, black choker, white jacket, black sleeveless shirt, white skirt, black belt, angry, leaning forward, cleavage, arm support, desk, looking at viewer, leaning on desk, hands on desk, pov", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "f2db738ced82", + "name": "irinaJelavic", + "type": "lora", + "weight": null + } + ], + "Model hash": "d124fc18f0", + "Hires upscale": "3", + "AddNet Enabled": "True", + "AddNet Model 1": "irinaJelavic(f2db738ced82)", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(EasyNegative:0.8), (depth of field, bokeh, blurry:1.4), bra, holding, book, desk, chalkboard, anime screencap", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.3" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a4e3f8e4-6023-4430-5c6e-ec237ca08200/width=450/381366.jpeg", + "nsfw": true, + "width": 768, + "height": 1024, + "hash": "UPOe@h~UHqxY9Gs:IVMwtQs.9bM|Ott6s:R-", + "meta": { + "ENSD": "31337", + "Size": "384x512", + "seed": 45355, + "steps": 20, + "prompt": "(extremely detailed CG unity 8k wallpaper), (masterpiece), (best quality), finely detailed,\nirina jelavic, black choker, black sleeveless shirt, spaghetti strap, white skirt, black belt, barefoot, cowboy shot, wariza, sitting, wooden floor, simple background, looking at viewer", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "f2db738ced82", + "name": "irinaJelavic", + "type": "lora", + "weight": null + } + ], + "Model hash": "c590550ea5", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "irinaJelavic(f2db738ced82)", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(EasyNegative:0.8), (depth of field, bokeh, blurry:1.4), (anime screencap:1.3), bra", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.3" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1dc06cc4-28ed-443e-27ea-5253965a9700/width=450/381365.jpeg", + "nsfw": true, + "width": 768, + "height": 1152, + "hash": "UQMss9^%4:%1ixxB4ooe~BxB-9kCxu$zxZkC", + "meta": { + "ENSD": "31337", + "Size": "384x576", + "seed": 45355, + "steps": 20, + "prompt": "(masterpiece), (best quality),\nirina jelavic, black choker, irinabikini, cowboy shot, sunset, beach", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "f2db738ced82", + "name": "irinaJelavic", + "type": "lora", + "weight": null + } + ], + "Model hash": "1d10a19f06", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "irinaJelavic(f2db738ced82)", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(EasyNegative:0.8), (depth of field, bokeh, blurry:1.4), bra, flower", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.3" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1cda7221-275b-4d44-6cf1-4af6673b4600/width=450/381364.jpeg", + "nsfw": true, + "width": 768, + "height": 1152, + "hash": "UKKK4o~V000L.Qx@r=E29tOBxZIVE2X8R*IV", + "meta": { + "ENSD": "31337", + "Size": "384x576", + "seed": 45359, + "steps": 20, + "prompt": "nsfw, (extremely detailed CG unity 8k wallpaper), (masterpiece), (best quality), finely detailed,\nirina jelavic, completely nude, nude, sexy pose, night, dim lighting, mood lighting, looking at viewer, cleft of venus", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "f2db738ced82", + "name": "irinaJelavic", + "type": "lora", + "weight": null + } + ], + "Model hash": "c590550ea5", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "irinaJelavic(f2db738ced82)", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(EasyNegative:0.8), (depth of field, bokeh, blurry:1.4), choker, black choker, (spread legs:1.3), spread pussy, cum, sex, head out of frame, cropped body, censored, (anime screencap:1.3)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.3" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ea20e440-0a08-43b8-fd73-cb84f4629400/width=450/381363.jpeg", + "nsfw": true, + "width": 768, + "height": 1152, + "hash": "UNNc.:020yIB}?V@D*tQ5QM{#m%M+vRjxuV[", + "meta": { + "ENSD": "31337", + "Size": "384x576", + "seed": 45355, + "steps": 20, + "prompt": "nsfw, (extremely detailed CG unity 8k wallpaper), (masterpiece), (best quality), (ultra-detailed), (best illustration),(best shadow), (an extremely delicate and beautiful), finely detail,\nirina jelavic, completely nude, on back, on bed, heavy breath, breath, steaming body, feet, bed sheet, light rays, bedroom, detailed background, from above, bed, looking at viewer, light blush, light smile, uncensored", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "f2db738ced82", + "name": "irinaJelavic", + "type": "lora", + "weight": null + } + ], + "Model hash": "c590550ea5", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "irinaJelavic(f2db738ced82)", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(EasyNegative:0.8), (depth of field, bokeh, blurry:1.4), choker, black choker, (spread legs:1.3), spread pussy, cum, sex, head out of frame, cropped body, censored", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.3" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/33448" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\346\232\227\346\235\200\346\225\231\345\256\244/irinaJelavi_v10.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\346\232\227\346\235\200\346\225\231\345\256\244/irinaJelavi_v10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..ad15560d4c5fea66cc8e220f82319147fcc2eaaf --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\346\232\227\346\235\200\346\225\231\345\256\244/irinaJelavi_v10.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:b2edc75d808a5b115d354906c67162afa77a8613b28748231c6719307bed577a +size 1680461 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\346\232\227\346\235\200\346\225\231\345\256\244/irinaJelavi_v10.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\346\232\227\346\235\200\346\225\231\345\256\244/irinaJelavi_v10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..a7f2c2c94593c7e7c6cca39d92299e16be1de4d9 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\346\232\227\346\235\200\346\225\231\345\256\244/irinaJelavi_v10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:ce5e14e61e352b2331197b6e0c41306d35710ae792810c11eb917e8443b919dd +size 9557389 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\210\261\344\270\275\344\270\235\346\242\246\346\270\270\344\273\231\345\242\203/alice_liddell_v2.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\210\261\344\270\275\344\270\235\346\242\246\346\270\270\344\273\231\345\242\203/alice_liddell_v2.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..5038465bd7008c0fc2784f7bd5f3e989256594cc --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\210\261\344\270\275\344\270\235\346\242\246\346\270\270\344\273\231\345\242\203/alice_liddell_v2.civitai.info" @@ -0,0 +1,253 @@ +{ + "id": 85086, + "modelId": 80264, + "name": "v2.0", + "createdAt": "2023-05-29T22:48:09.829Z", + "updatedAt": "2023-05-29T22:55:36.169Z", + "trainedWords": [ + "alice liddell" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

I deleted V1 training data and already trained model by accident so I had to do the whole thing again ;_;

How to use the LoRa

Basic prompt:

alice liddell, blue dress, white apron, black hairband, white legwear, black shoes <lora:alice_liddell_v20:1>

", + "stats": { + "downloadCount": 126, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Alice Liddell (Disney)", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "alice_liddell_v2.safetensors", + "id": 58084, + "sizeKB": 147570.0693359375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-29T22:51:28.525Z", + "hashes": { + "AutoV1": "CC6B8A3A", + "AutoV2": "045B3F825E", + "SHA256": "045B3F825EE9B0F802F1C6DF4ABF48611161A814E07FB05D32369A47C0ED3DCF", + "CRC32": "712A02C7", + "BLAKE3": "94B89F6B778AA8F72DA41A79E7198C160FD2F34F3A04EBD65AF7F53227A423CF" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/85086" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/18d95f9d-2644-47ad-b5bc-11ccfb2bfab3/width=450/962335.jpeg", + "nsfw": "None", + "width": 768, + "height": 1152, + "hash": "U8HBYx~A000N00-o%#Nd00%MTNn%pe0LIA%1", + "meta": { + "Size": "512x768", + "seed": 1763455940, + "Model": "art_meina_meinaPastel_v5", + "steps": 20, + "hashes": { + "model": "ff1bb68db1" + }, + "prompt": "(masterpiece:1.4), (best qualit:1.4), (high resolution:1.4), alice liddell, blue dress, white apron, black hairband, smile, looking at viewer, ", + "Version": "v1.3.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "name": "alice_liddell_v2", + "type": "lora", + "weight": 1 + }, + { + "hash": "ff1bb68db1", + "name": "art_meina_meinaPastel_v5", + "type": "model" + } + ], + "Model hash": "ff1bb68db1", + "Hires steps": "14", + "Hires upscale": "1.5", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "nsfw, EasyNegative, badhandv4, (bad anatomy, worst quality, low quality:1.4), watermark, signature, username, patreon, monochrome, zombie, squinting,", + "alice_liddell_v2": "2b8e62e89f9e", + "Denoising strength": "0.4" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b9da870f-592d-4df2-841a-be6de16b3c64/width=450/962397.jpeg", + "nsfw": "None", + "width": 768, + "height": 1152, + "hash": "UPH^*D~V9tM{EKofNeRk57RkxZs.f,od-otQ", + "meta": { + "Size": "512x768", + "seed": 697296707, + "Model": "art_meina_meinaPastel_v5", + "steps": 20, + "hashes": { + "model": "ff1bb68db1" + }, + "prompt": "(masterpiece:1.4), (best qualit:1.4), (high resolution:1.4), alice liddell, black hairband, (red school uniform, serafuku:1.1) looking at viewer, smile, ", + "Version": "v1.3.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "name": "alice_liddell_v2", + "type": "lora", + "weight": 1 + }, + { + "hash": "ff1bb68db1", + "name": "art_meina_meinaPastel_v5", + "type": "model" + } + ], + "Model hash": "ff1bb68db1", + "Hires steps": "14", + "Hires upscale": "1.5", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "nsfw, EasyNegative, badhandv4, (bad anatomy, worst quality, low quality:1.4), watermark, signature, username, patreon, monochrome, zombie, squinting, (blue dress, apron,:1.2)", + "alice_liddell_v2": "2b8e62e89f9e", + "Denoising strength": "0.4" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/748a7f1a-a814-4950-84fc-91ed68578286/width=450/962338.jpeg", + "nsfw": "None", + "width": 768, + "height": 1152, + "hash": "U9IO950000M|Mw9ayEt8:g4p_4V@Ae0LtQ4.", + "meta": { + "Size": "512x768", + "seed": 2133829034, + "Model": "art_meina_meinaPastel_v5", + "steps": 20, + "hashes": { + "model": "ff1bb68db1" + }, + "prompt": "(masterpiece:1.4), (best qualit:1.4), (high resolution:1.4), alice liddell, blue dress, white apron, black hairband, smile, looking at viewer, ", + "Version": "v1.3.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "name": "alice_liddell_v2", + "type": "lora", + "weight": 1 + }, + { + "hash": "ff1bb68db1", + "name": "art_meina_meinaPastel_v5", + "type": "model" + } + ], + "Model hash": "ff1bb68db1", + "Hires steps": "14", + "Hires upscale": "1.5", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "nsfw, EasyNegative, badhandv4, (bad anatomy, worst quality, low quality:1.4), watermark, signature, username, patreon, monochrome, zombie, squinting,", + "alice_liddell_v2": "2b8e62e89f9e", + "Denoising strength": "0.4" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/315d52f4-c702-4483-881c-5da80562c94c/width=450/962336.jpeg", + "nsfw": "None", + "width": 768, + "height": 1152, + "hash": "U5FX^-}t00NE@Xxo6.aN0eAtF#E31MR4;{u5", + "meta": { + "Size": "512x768", + "seed": 1099633726, + "Model": "art_ee*you_toonyou_beta3", + "steps": 20, + "hashes": { + "model": "52768d2bc4" + }, + "prompt": "(masterpiece:1.4), (best qualit:1.4), (high resolution:1.4), alice liddell, blue dress, white apron, black hairband, smile, looking at viewer, ", + "Version": "v1.3.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "name": "alice_liddell_v2", + "type": "lora", + "weight": 1 + }, + { + "hash": "52768d2bc4", + "name": "art_ee*you_toonyou_beta3", + "type": "model" + } + ], + "Model hash": "52768d2bc4", + "Hires steps": "14", + "Hires upscale": "1.5", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "nsfw, EasyNegative, badhandv4, (bad anatomy, worst quality, low quality:1.4), watermark, signature, username, patreon, monochrome, zombie, squinting,", + "alice_liddell_v2": "2b8e62e89f9e", + "Denoising strength": "0.4" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/05ec0144-a380-4d67-a992-6c5c84886de3/width=450/962337.jpeg", + "nsfw": "None", + "width": 768, + "height": 1152, + "hash": "U9G[KF#;0v0L8w^O.9Ne?^0L%PoH1i9^};-o", + "meta": { + "Size": "512x768", + "seed": 1901595343, + "Model": "art_ee*you_toonyou_beta3", + "steps": 20, + "hashes": { + "model": "52768d2bc4" + }, + "prompt": "(masterpiece:1.4), (best qualit:1.4), (high resolution:1.4), alice liddell, blue dress, white apron, black hairband, smile, looking at viewer, ", + "Version": "v1.3.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "name": "alice_liddell_v2", + "type": "lora", + "weight": 1 + }, + { + "hash": "52768d2bc4", + "name": "art_ee*you_toonyou_beta3", + "type": "model" + } + ], + "Model hash": "52768d2bc4", + "Hires steps": "14", + "Hires upscale": "1.5", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "nsfw, EasyNegative, badhandv4, (bad anatomy, worst quality, low quality:1.4), watermark, signature, username, patreon, monochrome, zombie, squinting,", + "alice_liddell_v2": "2b8e62e89f9e", + "Denoising strength": "0.4" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/85086" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\210\261\344\270\275\344\270\235\346\242\246\346\270\270\344\273\231\345\242\203/alice_liddell_v2.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\210\261\344\270\275\344\270\235\346\242\246\346\270\270\344\273\231\345\242\203/alice_liddell_v2.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..b1cd29fbd9a99f7604c61cbe952698c670d8862c Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\210\261\344\270\275\344\270\235\346\242\246\346\270\270\344\273\231\345\242\203/alice_liddell_v2.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\210\261\344\270\275\344\270\235\346\242\246\346\270\270\344\273\231\345\242\203/alice_liddell_v2.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\210\261\344\270\275\344\270\235\346\242\246\346\270\270\344\273\231\345\242\203/alice_liddell_v2.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..c49ebe20551d84e35836acbf83827433efd774c9 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\210\261\344\270\275\344\270\235\346\242\246\346\270\270\344\273\231\345\242\203/alice_liddell_v2.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:045b3f825ee9b0f802f1c6df4abf48611161a814e07fb05d32369a47c0ed3dcf +size 151111751 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\275\346\262\231\347\232\204\346\260\264\346\227\217\351\246\206/\345\256\256\346\262\242\351\242\250\350\212\261_loar.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\275\346\262\231\347\232\204\346\260\264\346\227\217\351\246\206/\345\256\256\346\262\242\351\242\250\350\212\261_loar.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..357642ae7e3737cd973e9823e2b6953054260edc --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\275\346\262\231\347\232\204\346\260\264\346\227\217\351\246\206/\345\256\256\346\262\242\351\242\250\350\212\261_loar.civitai.info" @@ -0,0 +1,99 @@ +{ + "id": 84311, + "modelId": 79497, + "name": "\u5bae\u6ca2\u98a8\u82b1v1.0", + "createdAt": "2023-05-29T05:07:34.454Z", + "updatedAt": "2023-05-29T05:09:16.082Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 102, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "\u5bae\u6ca2\u98a8\u82b1,miyazawa fuuka", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "\u5bae\u6ca2\u98a8\u82b1_loar.safetensors", + "id": 57622, + "sizeKB": 73844.203125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-29T05:10:49.662Z", + "hashes": { + "AutoV1": "71FA103E", + "AutoV2": "2232DF5FFC", + "SHA256": "2232DF5FFC57652E4A91C067347ACF17835DF07CF94D092DFEF1E6B576DDC06A", + "CRC32": "870AB697", + "BLAKE3": "A4B49E3017E782D7A96844F1980CF6F0FD10CF1120BC673E6FFDE4E1A80A9157" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/84311" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ab945f4b-13cb-4742-9449-eeac06f5df38/width=450/952276.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "UFHU^F000{=|?^Di-;9a00xt-poisk?I55xb", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9a169537-aed6-4d36-87e4-ca5be54b2eaa/width=450/952277.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "UYIXml~pNZx[4.jFkAR*WAj?-ptR-pxuWqxa", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/98256317-cd51-4b6b-b645-977a29369ac2/width=450/952278.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "UIG+K__40Jxt.T?c-:Nt9uo~?bt8_3t8NHxu", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8147322e-7e46-47ff-8f96-d05e63d64ba3/width=450/952274.jpeg", + "nsfw": "None", + "width": 512, + "height": 832, + "hash": "UFHUzzD%J$xF0eVt9FNav{%29w?H-.D%~WI:", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/89d4311e-b21b-4413-a69c-1e7d6aa88ffe/width=450/952275.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UMHetY000KI:~V0L%2xa9FIo?bxu%MaKM{X9", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/27b52fe8-b3e6-4e17-a9cb-a6867a91a9b0/width=450/952281.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "UJHLYu4.56-;~pofELxuS0NH?cV@9[ax-pR*", + "meta": null + } + ], + "downloadUrl": "https://civitai.com/api/download/models/84311" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\275\346\262\231\347\232\204\346\260\264\346\227\217\351\246\206/\345\256\256\346\262\242\351\242\250\350\212\261_loar.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\275\346\262\231\347\232\204\346\260\264\346\227\217\351\246\206/\345\256\256\346\262\242\351\242\250\350\212\261_loar.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..7922a1c8bfc3013f5e06b64ea2d93a864191fdc5 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\275\346\262\231\347\232\204\346\260\264\346\227\217\351\246\206/\345\256\256\346\262\242\351\242\250\350\212\261_loar.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\275\346\262\231\347\232\204\346\260\264\346\227\217\351\246\206/\345\256\256\346\262\242\351\242\250\350\212\261_loar.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\275\346\262\231\347\232\204\346\260\264\346\227\217\351\246\206/\345\256\256\346\262\242\351\242\250\350\212\261_loar.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..929c527775a9bc08b07717efd0173426c8801932 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\275\346\262\231\347\232\204\346\260\264\346\227\217\351\246\206/\345\256\256\346\262\242\351\242\250\350\212\261_loar.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:2232df5ffc57652e4a91c067347acf17835df07cf94d092dfef1e6b576ddc06a +size 75616464 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\275\351\233\252\345\205\254\344\270\273/SnowWhite_v1.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\275\351\233\252\345\205\254\344\270\273/SnowWhite_v1.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..a777454b21415480ca273c921fe73dd05e13df17 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\275\351\233\252\345\205\254\344\270\273/SnowWhite_v1.civitai.info" @@ -0,0 +1,323 @@ +{ + "id": 50026, + "modelId": 45401, + "name": "v1.0", + "createdAt": "2023-04-19T17:06:56.667Z", + "updatedAt": "2023-04-19T18:54:54.864Z", + "trainedWords": [ + "snow white" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 1011, + "ratingCount": 7, + "rating": 4.29 + }, + "model": { + "name": "Snow White", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "SnowWhite_v1.safetensors", + "id": 36748, + "sizeKB": 147569.5205078125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-19T17:11:16.354Z", + "hashes": { + "AutoV1": "61AD5A41", + "AutoV2": "86FFE0B085", + "SHA256": "86FFE0B085A667C736CA22704716AE28BA7821E2A81E204EF65E3B9F3BCB8861", + "CRC32": "63F839D0", + "BLAKE3": "A528C819DD860A49B3BCCF965EE7857FB26732DC72AA716A50C6339E98F0F631" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/50026" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2f310f67-d245-42aa-b233-642754d9e4bc/width=450/1222112.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UCECI4rW01~UAcRP-mt8l7EM%MNH%er=9INH", + "meta": { + "Size": "512x768", + "seed": 3821209285, + "Model": "art_meina_meinaPastel_v5", + "steps": 30, + "hashes": { + "model": "ff1bb68db1" + }, + "prompt": "(masterpiece:1.4), (best quality:1.4), (high resolution:1.4), snow white, 1girl, woman, light smile, looking at viewer, (medieval dress, yellow skirt, long skirt, red hairband), pose, medieval house, grass, forest, ", + "Version": "v1.3.2", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "SnowWhite_v1", + "type": "lora", + "weight": 1 + }, + { + "name": "tools_more_details", + "type": "lora", + "weight": 0.5 + }, + { + "hash": "ff1bb68db1", + "name": "art_meina_meinaPastel_v5", + "type": "model" + } + ], + "Model hash": "ff1bb68db1", + "Hires steps": "10", + "\"SnowWhite_v1": "2251b9f43e14", + "Hires upscale": "2", + "Hires upscaler": "Latent (nearest-exact)", + "Variation seed": "2279817746", + "negativePrompt": "ng_deepnegative_v1_75t, badhandv4, (bad anatomy, worst quality, low quality:1.4), watermark, signature, username, patreon, monochrome, zombie, squinting, snow,", + "Denoising strength": "0.7", + "tools_more_details": "3b8aa1d351ef\"", + "Variation seed strength": "0.15" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3afdccbd-28dd-4343-bf63-e555e5410d00/width=450/539380.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "U9E-?k02On=s}=0M%L5Q0e9v^%n$~AIoxbsq", + "meta": { + "Size": "512x768", + "seed": 2998367873, + "Model": "anime_cartoon_Mistoon_mistoonAmethyst_v1", + "steps": 35, + "hashes": { + "model": "8dd56a2872" + }, + "prompt": "(masterpiece, best quality, high resolution:1.4), portrait,\nsnow white, \n1girl, woman, smile, looking at viewer,\n(medieval dress, yellow skirt, long skirt, red hairband),\nsitting on bed,\nindoor,\n", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "SnowWhite_v1", + "type": "lora", + "weight": 1 + }, + { + "hash": "8dd56a2872", + "name": "anime_cartoon_Mistoon_mistoonAmethyst_v1", + "type": "model" + } + ], + "Model hash": "8dd56a2872", + "Hires upscale": "2", + "Hires upscaler": "Latent (nearest-exact)", + "negativePrompt": "nsfw, EasyNegative, badhandv4, (bad anatomy, worst quality, low quality:2), watermark, signature, username, patreon, monochrome, zombie, large breasts, cleavage, logo, earrings, long hair,", + "Denoising strength": "0.55" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5236610d-828f-4c93-a5d5-d469b8b9bd00/width=450/539658.jpeg", + "nsfw": "None", + "width": 768, + "height": 1152, + "hash": "UTHBe%~VE%ELtm%3%L%K?at7t7oeo|%LM~M|", + "meta": { + "Size": "512x768", + "seed": 132746211, + "Model": "anime_cartoon_Anything_anything_v4.5pruned", + "steps": 20, + "hashes": { + "model": "6e430eb514" + }, + "prompt": "(masterpiece, best quality, high resolution:1.4), portrait, analog, RAW format,\nsnow white,\n1girl, woman, smile, looking at viewer,\n(medieval dress, yellow skirt, long skirt, red hairband),\nstanding, hands on hips, \noutdoors, nature, forest,\nperfect light,\n", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "SnowWhite_v1", + "type": "lora", + "weight": 1 + }, + { + "hash": "6e430eb514", + "name": "anime_cartoon_Anything_anything_v4.5pruned", + "type": "model" + } + ], + "Model hash": "6e430eb514", + "Hires upscale": "1.5", + "Hires upscaler": "Latent (nearest-exact)", + "negativePrompt": "nsfw, EasyNegative, badhandv4, (bad anatomy, worst quality, low quality:2), watermark, signature, username, patreon, monochrome, zombie, large breasts, logo, earrings, long hair,", + "Denoising strength": "0.55" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/70d9980f-483e-43a6-16ab-e8a45abdeb00/width=450/538259.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UFGk][XU0exD0#?cxtV@~qx^%fn$tmIqE3t7", + "meta": { + "Size": "512x768", + "seed": 1537499957, + "Model": "anime_cartoon_DreamShaper_dreamshaper_v5", + "steps": 30, + "hashes": { + "model": "5415fd85c7" + }, + "prompt": "(masterpiece, best quality, high resolution:1.4),\nsnow white,\n1girl, woman, smile, looking at viewer, \nlong skirt, \nnature, outdoors, summer, beach,\ncolorful, high contrast,\n", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "SnowWhite_v1", + "type": "lora", + "weight": 1 + }, + { + "hash": "5415fd85c7", + "name": "anime_cartoon_DreamShaper_dreamshaper_v5", + "type": "model" + } + ], + "Model hash": "5415fd85c7", + "Hires upscale": "2", + "Hires upscaler": "Latent (nearest-exact)", + "negativePrompt": "EasyNegative, badhandv4, (bad anatomy, worst quality, low quality:1.4), watermark, signature, username, patreon, monochrome, zombie,", + "Denoising strength": "0.55" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/29521d2c-ed75-4d31-90df-d97537d4b400/width=450/539477.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UXFE}%~VIoE1M{M{WBt7NGs:%2kCxZoeWCV[", + "meta": { + "Size": "512x768", + "seed": 2998367873, + "Model": "anime_cartoon_DucHaiten_DucHaitenAIart_v3.1", + "steps": 35, + "hashes": { + "model": "ca90dfc8b1" + }, + "prompt": "(masterpiece, best quality, high resolution:1.4), portrait,\nsnow white, \n1girl, woman, smile, looking at viewer,\n(medieval dress, yellow skirt, long skirt, red hairband),\nsitting on bed,\nindoor,\n", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "SnowWhite_v1", + "type": "lora", + "weight": 1 + }, + { + "hash": "ca90dfc8b1", + "name": "anime_cartoon_DucHaiten_DucHaitenAIart_v3.1", + "type": "model" + } + ], + "Model hash": "ca90dfc8b1", + "Hires upscale": "2", + "Hires upscaler": "Latent (nearest-exact)", + "negativePrompt": "nsfw, EasyNegative, badhandv4, (bad anatomy, worst quality, low quality:2), watermark, signature, username, patreon, monochrome, zombie, large breasts, cleavage, logo, earrings, long hair,", + "Denoising strength": "0.55" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/745a4bf3-3348-4994-0a83-4c907f63dc00/width=450/538820.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UGGuL5IBJ6EgE3~V9aI:xAR*s=^iyDNa?a%2", + "meta": { + "Size": "512x768", + "seed": 1748167713, + "Model": "anime_cartoon_Mistoon_mistoonSapphire_v1", + "steps": 30, + "hashes": { + "model": "b3ef8af57b" + }, + "prompt": "(masterpiece, best quality, high resolution:1.4), portrait,\nsnow white, short black hair, (red hair ribbon:1.2),\n1girl, woman, smile, looking at viewer, leaning forward, \nshirt, long yellow skirt,\nindoor,\ncolorful, high contrast,\n", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "SnowWhite_v1", + "type": "lora", + "weight": 1 + }, + { + "hash": "b3ef8af57b", + "name": "anime_cartoon_Mistoon_mistoonSapphire_v1", + "type": "model" + } + ], + "Model hash": "b3ef8af57b", + "Hires upscale": "2", + "Hires upscaler": "Latent (nearest-exact)", + "negativePrompt": "EasyNegative, badhandv4, (bad anatomy, worst quality, low quality:2), watermark, signature, username, patreon, monochrome, zombie, large breasts,", + "Denoising strength": "0.6" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b6bb81ee-7d81-46c5-cf3d-ad4142d92600/width=450/539612.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UAG8.l~W1}RP18S*~W-pV@%MIxbw9F%Nv%RQ", + "meta": { + "Size": "512x768", + "seed": 2623774487, + "Model": "anime_cartoon_Mistoon_mistoonAnime_v1", + "steps": 35, + "hashes": { + "model": "a49140c6c5" + }, + "prompt": "(masterpiece, best quality, high resolution:1.4), portrait,\nsnow white,\n1girl, woman, smile, looking at viewer,\n(medieval dress, yellow skirt, long skirt, red hairband),\nsitting on park bench,\noutdoors, nature,\n", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "SnowWhite_v1", + "type": "lora", + "weight": 1 + }, + { + "hash": "a49140c6c5", + "name": "anime_cartoon_Mistoon_mistoonAnime_v1", + "type": "model" + } + ], + "Model hash": "a49140c6c5", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "negativePrompt": "nsfw, EasyNegative, badhandv4, (bad anatomy, worst quality, low quality:2), watermark, signature, username, patreon, monochrome, zombie, large breasts, logo, earrings, long hair,", + "Denoising strength": "0.7" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/50026" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\275\351\233\252\345\205\254\344\270\273/SnowWhite_v1.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\275\351\233\252\345\205\254\344\270\273/SnowWhite_v1.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..b42ce084ad874cc73f449ba807f87861aa178303 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\275\351\233\252\345\205\254\344\270\273/SnowWhite_v1.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\275\351\233\252\345\205\254\344\270\273/SnowWhite_v1.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\275\351\233\252\345\205\254\344\270\273/SnowWhite_v1.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..810b90c9e5dce37da9edf8af8fbbc73a8826624c --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\275\351\233\252\345\205\254\344\270\273/SnowWhite_v1.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:86ffe0b085a667c736ca22704716ae28ba7821e2a81e204ef65e3b9f3bcb8861 +size 151111189 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\345\217\230\345\260\217\346\250\261/kinomotoSakuraSchool_20230311.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\345\217\230\345\260\217\346\250\261/kinomotoSakuraSchool_20230311.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..6cf2f2b245bc1ef24c9d69e9c21aa44317764fad --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\345\217\230\345\260\217\346\250\261/kinomotoSakuraSchool_20230311.civitai.info" @@ -0,0 +1,134 @@ +{ + "id": 21202, + "modelId": 17939, + "name": "20230311", + "createdAt": "2023-03-10T15:30:21.392Z", + "updatedAt": "2023-03-10T16:39:28.744Z", + "trainedWords": [ + "kinomoto_sakura_school_uniforms" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "model": { + "name": "kinomoto_sakura_school_uniforms", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "kinomotoSakuraSchool_20230311_trainingData.zip", + "id": 17661, + "sizeKB": 9159.98828125, + "type": "Training Data", + "metadata": { + "format": "Other" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-03-10T15:35:55.882Z", + "hashes": { + "AutoV1": "D91A00E5", + "AutoV2": "63C3F12E94", + "SHA256": "63C3F12E94F1310FEB2331E8F144354C19D371A8DAA253285055768370D63FD0", + "CRC32": "70A0EEDF", + "BLAKE3": "838AA0119119828CDE37139306804DE5C907D9F62C3EA7B6DAA751390A12B292" + }, + "primary": false, + "downloadUrl": "https://civitai.com/api/download/models/21202?type=Training%20Data" + }, + { + "name": "kinomotoSakuraSchool_20230311.safetensors", + "id": 17660, + "sizeKB": 147569.4638671875, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-03-10T15:36:28.631Z", + "hashes": { + "AutoV1": "28151CB4", + "AutoV2": "F679E8C4B5", + "SHA256": "F679E8C4B5730680D0C0E470D327E33593B0BEE677A092DBBD6F3D56073B4E8B", + "CRC32": "518C9C5F", + "BLAKE3": "1016A8562B7D052A4A9045574C4D227C6AC2AEC2207D5E75866683A5655247B1" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/21202" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7254789e-f3ae-431f-5f3c-07eb8f9de900/width=450/224604.jpeg", + "nsfw": false, + "width": 512, + "height": 768, + "hash": "UEJHad~C.9RP~pbwb_s9Rix]IoE19Zs;^+Rj", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7fa1e9de-64a3-4e62-80b0-ba7f8eacf900/width=450/224599.jpeg", + "nsfw": false, + "width": 512, + "height": 768, + "hash": "UHJ7,l9GIo~W-oNG%Mn%xGofIoIU56NG-pog", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c761b432-9a69-4662-ca64-c18bd7140f00/width=450/224606.jpeg", + "nsfw": false, + "width": 512, + "height": 768, + "hash": "UEH_V@4:Io~W9FNFbcxa$*%256W;SiR*xZax", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5c016135-f81e-4976-b127-ed3295d70a00/width=450/224605.jpeg", + "nsfw": false, + "width": 512, + "height": 768, + "hash": "UDI;xJ_4J:o~o~I]x^%gs-oz4:4.00xa^koL", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/26451cde-9aff-460f-338b-63cb6f74cb00/width=450/224603.jpeg", + "nsfw": false, + "width": 512, + "height": 768, + "hash": "UEIN~;9Z4.~W-US2?bV[?HofE1R%9aR*?Gxa", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b8c60cc2-6086-45c0-037c-70830ba0b700/width=450/224602.jpeg", + "nsfw": false, + "width": 512, + "height": 768, + "hash": "U7JHdk01t,-o~WE0?w-;IUWE009Z0fE1~C-p", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f9dfdcf9-3b7d-497e-c9db-73de8d1b3300/width=450/224601.jpeg", + "nsfw": false, + "width": 512, + "height": 768, + "hash": "UGI}VGIqkr~W^+bv?vjF?bt7E1M{9ZWV-pV@", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d1d5aba5-10e9-481c-062b-3c0004927b00/width=450/224600.jpeg", + "nsfw": false, + "width": 512, + "height": 768, + "hash": "UGJ@zl~qtlo~?bSix^o#xZxaNGWC4:oL-pbb", + "meta": null + } + ], + "downloadUrl": "https://civitai.com/api/download/models/21202" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\345\217\230\345\260\217\346\250\261/kinomotoSakuraSchool_20230311.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\345\217\230\345\260\217\346\250\261/kinomotoSakuraSchool_20230311.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..f0a4182ec09fae12ab5fff764502701f45533d89 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\345\217\230\345\260\217\346\250\261/kinomotoSakuraSchool_20230311.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\345\217\230\345\260\217\346\250\261/kinomotoSakuraSchool_20230311.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\345\217\230\345\260\217\346\250\261/kinomotoSakuraSchool_20230311.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..0e9f8d9b4720da7806292e91cc79169152b03abe --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\345\217\230\345\260\217\346\250\261/kinomotoSakuraSchool_20230311.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:f679e8c4b5730680d0c0e470d327e33593b0bee677a092dbbd6f3d56073b4e8b +size 151111131 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\345\217\230\345\260\217\346\250\261/kinomoto_sakura_v1.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\345\217\230\345\260\217\346\250\261/kinomoto_sakura_v1.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..253aaf86e8d25d6b0e12511500a2b1ed4f3cca33 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\345\217\230\345\260\217\346\250\261/kinomoto_sakura_v1.civitai.info" @@ -0,0 +1,456 @@ +{ + "id": 112839, + "modelId": 105213, + "name": "v1.0", + "createdAt": "2023-07-08T10:30:09.046Z", + "updatedAt": "2023-07-08T10:32:34.585Z", + "trainedWords": [ + "kinomoto sakura, 1girl, brown hair, short hair, antenna hair, two side up, hair bobbles, green eyes, school uniform, white sailor collar, black shirt, long sleeves, white skirt, pleated skirt", + "kinomoto sakura, 1girl, brown hair, short hair, antenna hair, red headwear, green eyes, frills, red dress, puffy short sleeves, white gloves, red bow, white thighhighs, white wings", + "kinomoto sakura, 1girl, brown hair, short hair, antenna hair, pink headwear, green eyes, capelet, pink dress, striped ribbon, long sleeves, white gloves", + "kinomoto sakura, 1girl, brown hair, short hair, antenna hair, ahoge, crown, green eyes, white dress, sleeveless, white gloves" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 64, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Kinomoto Sakura \u6728\u4e4b\u672c\u685c / Cardcaptor Sakura", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "kinomoto_sakura_v1.safetensors", + "id": 80060, + "sizeKB": 36974.01171875, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-07-08T10:33:44.598Z", + "hashes": { + "AutoV1": "571EA62F", + "AutoV2": "6AB67F6395", + "SHA256": "6AB67F63955426884A7557F99663FD0007621576355782D5F5F7D60ABFB31BC1", + "CRC32": "C4D04B71", + "BLAKE3": "BD22166FFB33EE7C19954100CBDBE81E9ED070118CFD238D2D8294699D12784E" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/112839" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/05e22dcd-776e-423b-a479-7493fe2fab6d/width=450/1460018.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "USKA:8#SuPB=JXE2xvMzE+NHjIM}u*$fxtae", + "meta": { + "Size": "512x768", + "seed": 2023452475, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, kinomoto sakura, 1girl, brown hair, short hair, antenna hair, red headwear, green eyes, frills, red dress, puffy short sleeves, white gloves, red bow, white thighhighs, wings, , fly, sky, holding staff, wand, fuuin no tsue, open mouth, bound, petals, cowboy shot", + "Version": "v1.4.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "kinomoto_sakura_v1", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1),", + "Denoising strength": "0.45", + "\"kinomoto_sakura_v1": "4560664f9566\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9b045ce3-1d47-4b11-a7e3-a562b00a8968/width=450/1460015.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UFJ@wrE.?KM}0V0NY7kqWHM~5Q9tVs?H#Ra0", + "meta": { + "Size": "512x768", + "seed": 764342828, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, kinomoto sakura, 1girl, brown hair, short hair, antenna hair, two side up, hair bobbles, green eyes, school uniform, white sailor collar, black shirt, long sleeves, white skirt, pleated skirt, , cowboy shot, standing, cherry blossoms, outdoors, smile", + "Version": "v1.4.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "kinomoto_sakura_v1", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1), (holding:1.5), (wand:1.2), (staff:1.2)", + "Denoising strength": "0.45", + "\"kinomoto_sakura_v1": "4560664f9566\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3d9230a0-146e-4386-a2f6-bd927f77e898/width=450/1460022.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UXJGg6~AKiNG%#xt$*oftAadxbt7ElWqW=RQ", + "meta": { + "Size": "512x768", + "seed": 2688994241, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, kinomoto sakura, 1girl, brown hair, short hair, antenna hair, pink headwear, green eyes, capelet, pink dress, striped ribbon, long sleeves, white gloves, , reaching out, smile, open mouth, garden, flower, sunset", + "Version": "v1.4.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "kinomoto_sakura_v1", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1), (holding:1.5),", + "Denoising strength": "0.5", + "\"kinomoto_sakura_v1": "4560664f9566\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a906ce48-a2d7-4380-be41-89fe3b85539b/width=450/1460027.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UEJIU}0110tS3sI@%~X901=^?HS5^lIVVs$%", + "meta": { + "Size": "512x768", + "seed": 803147678, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, kinomoto sakura, 1girl, brown hair, short hair, antenna hair, ahoge, crown, green eyes, white dress, sleeveless, white gloves,, water, wet, wariza, kero,", + "Version": "v1.4.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "kinomoto_sakura_v1", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1), (holding:1.5)", + "Denoising strength": "0.5", + "\"kinomoto_sakura_v1": "4560664f9566\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/83fcc7b2-4842-4042-9d35-c6515df5b89f/width=450/1460016.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "USKAys%LwGNJ^kRj-qxu~Xoei{s;-;bH?Gt7", + "meta": { + "Size": "512x768", + "seed": 282209669, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, kinomoto sakura, 1girl, brown hair, short hair, antenna hair, white headwear, green eyes, school uniform, white sailor collar, black shirt, long sleeves, white skirt, pleated skirt, , waving, smile, open mouth, standing, cowboy shot, outdoors,", + "Version": "v1.4.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "kinomoto_sakura_v1", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1), (holding:1.5), (wand:1.2), (staff:1.2)", + "Denoising strength": "0.5", + "\"kinomoto_sakura_v1": "4560664f9566\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/821d6492-dde1-4be2-beda-e2c7448b0011/width=450/1460017.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UEIz-g_H1XD%0JMxT0D%9cTMDl-UL}OtoyOF", + "meta": { + "Size": "512x768", + "seed": 3884157926, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, kinomoto sakura, 1girl, brown hair, short hair, antenna hair, red headwear, green eyes, frills, red dress, puffy short sleeves, white gloves, red bow, white thighhighs, wings, , field, :o, wariza, grass, kero", + "Version": "v1.4.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "kinomoto_sakura_v1", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1),", + "Denoising strength": "0.45", + "\"kinomoto_sakura_v1": "4560664f9566\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c7c5d6f4-4dbf-4a05-a506-10e40216b2c9/width=450/1460021.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UQI}V0HrD%K~_NDjnQIpY6NXV?sr-rM_M{oh", + "meta": { + "Size": "512x768", + "seed": 3532557514, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, kinomoto sakura, 1girl, brown hair, short hair, antenna hair, pink headwear, green eyes, capelet, pink dress, striped ribbon, long sleeves, white gloves, , outdoors, garden, sitting, table, smile", + "Version": "v1.4.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "kinomoto_sakura_v1", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1), (holding:1.5),", + "Denoising strength": "0.5", + "\"kinomoto_sakura_v1": "4560664f9566\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/cfba828a-1e2f-42a9-b39c-ef47c2222ea5/width=450/1460026.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "U8KB2lyX02Ff0000R5RPu%Su^$xZ?w0g?GO@", + "meta": { + "Size": "512x768", + "seed": 2439315842, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, kinomoto sakura, 1girl, brown hair, short hair, antenna hair, ahoge, crown, green eyes, white dress, sleeveless, white gloves,, holding staff, smile, open mouth, cowboy shot, blue sky,", + "Version": "v1.4.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "kinomoto_sakura_v1", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1),", + "Denoising strength": "0.45", + "\"kinomoto_sakura_v1": "4560664f9566\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a19bcc46-db77-4079-b7c5-a34906ed1307/width=450/1460012.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UHHxTfaN0J$_Eu~VtkIn_2?ZWBV@_MOU$enh", + "meta": { + "Size": "512x768", + "seed": 4269295690, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, kinomoto sakura, 1girl, brown hair, short hair, antenna hair, two side up, hair bobbles, green eyes, school uniform, white sailor collar, black shirt, long sleeves, white skirt, pleated skirt, , sitting, eating, outdoors, bench, food, leaf,", + "Version": "v1.4.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "kinomoto_sakura_v1", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1), (holding:1.5), (wand:1.2), (staff:1.2)", + "Denoising strength": "0.5", + "\"kinomoto_sakura_v1": "4560664f9566\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/042996d3-e322-46c0-992e-6465e72ab733/width=450/1460159.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UTLWYI?u~W%f.8pIt8niOFI@WVjFRObvX8oy", + "meta": { + "Size": "512x768", + "seed": 3711328784, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, kinomoto sakura, 1girl, brown hair, short hair, antenna hair, red headwear, green eyes, frills, red dress, puffy short sleeves, white gloves, red bow, white thighhighs, wings, , standing, holding card", + "Version": "v1.4.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6, + "clipSkip": 2, + "resources": [ + { + "name": "kinomoto_sakura_v1", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1)", + "Denoising strength": "0.5", + "\"kinomoto_sakura_v1": "4560664f9566\"" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/112839" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\345\217\230\345\260\217\346\250\261/kinomoto_sakura_v1.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\345\217\230\345\260\217\346\250\261/kinomoto_sakura_v1.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..99c85e3be9fc7c37a16a3932710de39b0f0ab9f5 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\345\217\230\345\260\217\346\250\261/kinomoto_sakura_v1.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\345\217\230\345\260\217\346\250\261/kinomoto_sakura_v1.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\345\217\230\345\260\217\346\250\261/kinomoto_sakura_v1.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..5080e0317542a48f5d7e6392b988474b49f87f74 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\345\217\230\345\260\217\346\250\261/kinomoto_sakura_v1.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:6ab67f63955426884a7557f99663fd0007621576355782d5f5f7d60abfb31bc1 +size 37861388 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\345\217\230\345\260\217\346\250\261/sakuraKinomoto_sakuraV2Epoch6.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\345\217\230\345\260\217\346\250\261/sakuraKinomoto_sakuraV2Epoch6.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..379a231324566d149eefbf1328786f9afad06928 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\345\217\230\345\260\217\346\250\261/sakuraKinomoto_sakuraV2Epoch6.civitai.info" @@ -0,0 +1,421 @@ +{ + "id": 25156, + "modelId": 20451, + "name": "Sakura V2 Epoch 6", + "createdAt": "2023-03-18T16:00:32.132Z", + "updatedAt": "2023-03-20T23:35:59.389Z", + "trainedWords": [ + "kinomoto_sakura", + "tomoeda_elementary_school_uniform", + "one-piece swimsuit" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

Trained on +190 screencap of the anime, no more Kero or Tomoyo.

Please use highres fix for better result. All pic was done on EndlessMix.

", + "model": { + "name": "Sakura Kinomoto", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "sakuraKinomoto_sakuraV2Epoch6.safetensors", + "id": 20874, + "sizeKB": 147572.37890625, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-03-18T16:01:37.508Z", + "hashes": { + "AutoV1": "8B62F840", + "AutoV2": "A9C41C7BC7", + "SHA256": "A9C41C7BC7E57B74F96946EA6931321FC561B24C4C5AEA86C6ED344113D932E3", + "CRC32": "274BF674", + "BLAKE3": "8DC5A1B468A8F3B3972544F10C911C8E6529BA7EB1CBBA6D380FA7F1DD089034" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/25156" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/cbfd34ec-d2b6-43f5-d31f-0796fbb18700/width=450/275383.jpeg", + "nsfw": false, + "width": 1024, + "height": 1024, + "hash": "USKA4b0NJ+V@},D*%Ls*bc#k%3%1^%$eIqWB", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 906019155, + "Model": "endlessmix_v10", + "steps": 30, + "prompt": "masterpiece, 1girl, highres, kinomoto_sakura with green eyes, wearing (casual clothes), shy, blush, smiling, looking at viewer, happy, (lot of food)\nBREAK\n(midnight:1), starry sky, darkness, moody lighting, (cooking outside)\nBREAK\nrealistic lighting, very detailed, full of detail", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "hash": "9da9c17d65", + "name": "endlessmix_v10", + "type": "model" + }, + { + "hash": "8cb765319688", + "name": "000006", + "type": "lora", + "weight": null + } + ], + "Model hash": "9da9c17d65", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "sincoslora-000006(8cb765319688)", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "deformed, extra limbs, extra fingers, mutated hands, bad anatomy, bad proportions, blind, bad eyes, ugly eyes, dead eyes, blur, vignette, out of shot, monochrome, censorship, ugly, old, deformed, drawing, odd, fat, tall, cell shading, bad anatomy, bad hands, missing fingers, cropped, jpeg artifacts, ((signature)), ((watermark)), username, blurry, out of focus, poorly drawn hands, (((multiple views:1.4))), simple background, (EasyNegative)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.6" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c75f9646-c451-4539-47ed-18669ed60a00/width=450/275382.jpeg", + "nsfw": false, + "width": 1024, + "height": 1024, + "hash": "UNGRCw~90LM|Rh-o-;M|$%%1rrR+ozofM|Ip", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 201477733, + "Model": "endlessmix_v10", + "steps": 30, + "prompt": "masterpiece, 1girl, highres, kinomoto_sakura, green eyes, face focus, wearing (simple white silk dress:1), smiling, looking at viewer, petite\nBREAK\n(midnight:1), starry sky, darkness, moody lighting, in the living room\nBREAK\nrealistic lighting, very detailed, full of detail", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "hash": "9da9c17d65", + "name": "endlessmix_v10", + "type": "model" + }, + { + "hash": "8cb765319688", + "name": "000006", + "type": "lora", + "weight": null + } + ], + "Model hash": "9da9c17d65", + "Cutoff strong": "False", + "Cutoff weight": "0.5", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "sincoslora-000006(8cb765319688)", + "Cutoff enabled": "True", + "Cutoff padding": "_", + "Cutoff targets": "\"['white', 'green']\"", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "deformed, extra limbs, extra fingers, mutated hands, bad anatomy, bad proportions, blind, bad eyes, ugly eyes, dead eyes, blur, vignette, out of shot, monochrome, censorship, ugly, old, deformed, drawing, odd, fat, tall, cell shading, bad anatomy, bad hands, missing fingers, cropped, jpeg artifacts, ((signature)), ((watermark)), username, blurry, out of focus, poorly drawn hands, (((multiple views:1.4))), simple background, (EasyNegative)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.8", + "AddNet Weight B 1": "0.8", + "Denoising strength": "0.6", + "Cutoff interpolation": "lerp", + "Cutoff disable_for_neg": "True" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/98dc0598-559b-4869-40f7-bd33fd624a00/width=450/275380.jpeg", + "nsfw": false, + "width": 768, + "height": 1280, + "hash": "UMH.7:.T0|~CJL?a?cIW.S%M-VWFE1M|M|n+", + "meta": { + "ENSD": "31337", + "Size": "384x640", + "seed": 2553721282, + "Model": "endlessmix_v10", + "steps": 30, + "prompt": "masterpiece, 1girl, highres, kinomoto_sakura, green eyes, face focus, wearing (wedding dress), blush, shy, good mood, looking at viewer, petite, side view, a bunch of roses in hand\nBREAK\nrealistic lighting, very detailed, full of detail", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "hash": "9da9c17d65", + "name": "endlessmix_v10", + "type": "model" + }, + { + "hash": "8cb765319688", + "name": "000006", + "type": "lora", + "weight": null + } + ], + "Model hash": "9da9c17d65", + "Cutoff strong": "False", + "Cutoff weight": "0.5", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "sincoslora-000006(8cb765319688)", + "Cutoff enabled": "True", + "Cutoff padding": "_", + "Cutoff targets": "\"['white', 'green', 'black']\"", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "deformed, extra limbs, extra fingers, mutated hands, bad anatomy, bad proportions, blind, bad eyes, ugly eyes, dead eyes, blur, vignette, out of shot, monochrome, censorship, ugly, old, deformed, drawing, odd, fat, tall, cell shading, bad anatomy, bad hands, missing fingers, cropped, jpeg artifacts, ((signature)), ((watermark)), username, blurry, out of focus, poorly drawn hands, (((multiple views:1.4))), simple background, (EasyNegative)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.8", + "AddNet Weight B 1": "0.8", + "Denoising strength": "0.6", + "Cutoff interpolation": "lerp", + "Cutoff disable_for_neg": "True" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e61852b1-1741-4d69-d5c3-d0b30f010400/width=450/275379.jpeg", + "nsfw": false, + "width": 768, + "height": 1280, + "hash": "UKGuqMXA3sOZ0PR+r_W=MJ-:rqt7Ort6-ooe", + "meta": { + "ENSD": "31337", + "Size": "384x640", + "seed": 2937467190, + "Model": "endlessmix_v10", + "steps": 30, + "prompt": "masterpiece, 1girl, highres, kinomoto_sakura, green eyes, face focus, wearing (magical girl dress), back view , blush, shy, good mood, looking at viewer, petite, side view\nBREAK\nvery detailed, full of detail, blue sky, sun, cinematic lighting", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "hash": "9da9c17d65", + "name": "endlessmix_v10", + "type": "model" + }, + { + "hash": "8cb765319688", + "name": "000006", + "type": "lora", + "weight": null + } + ], + "Model hash": "9da9c17d65", + "Cutoff strong": "False", + "Cutoff weight": "0.5", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "sincoslora-000006(8cb765319688)", + "Cutoff enabled": "True", + "Cutoff padding": "_", + "Cutoff targets": "\"['white', 'green', 'black']\"", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "deformed, extra limbs, extra fingers, mutated hands, bad anatomy, bad proportions, blind, bad eyes, ugly eyes, dead eyes, blur, vignette, out of shot, monochrome, censorship, ugly, old, deformed, drawing, odd, fat, tall, cell shading, bad anatomy, bad hands, missing fingers, cropped, jpeg artifacts, ((signature)), ((watermark)), username, blurry, out of focus, poorly drawn hands, (((multiple views:1.4))), simple background, (EasyNegative)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.8", + "AddNet Weight B 1": "0.8", + "Denoising strength": "0.6", + "Cutoff interpolation": "lerp", + "Cutoff disable_for_neg": "True" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/cf7b8e9b-a58e-4977-8c63-b501a6917100/width=450/275378.jpeg", + "nsfw": false, + "width": 1280, + "height": 768, + "hash": "UaMP?e5A~nIrKREQSit59}R*soWBoyV@niWB", + "meta": { + "ENSD": "31337", + "Size": "640x384", + "seed": 191405880, + "Model": "endlessmix_v10", + "steps": 30, + "prompt": "masterpiece, 1girl, highres, kinomoto_sakura, green eyes, wearing (one-piece swimsuit), good mood, on the beach\nBREAK\n(upper body), very detailed, full of detail, blue sky, sun, cinematic lighting, sand, sea, nibble, (sunset), view from above", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "hash": "9da9c17d65", + "name": "endlessmix_v10", + "type": "model" + }, + { + "hash": "8cb765319688", + "name": "000006", + "type": "lora", + "weight": null + } + ], + "Model hash": "9da9c17d65", + "Cutoff strong": "False", + "Cutoff weight": "0.5", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "sincoslora-000006(8cb765319688)", + "Cutoff enabled": "True", + "Cutoff padding": "_", + "Cutoff targets": "\"['white', 'green', 'black']\"", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "deformed, extra limbs, extra fingers, mutated hands, bad anatomy, bad proportions, blind, bad eyes, ugly eyes, dead eyes, blur, vignette, out of shot, monochrome, censorship, ugly, old, deformed, drawing, odd, fat, tall, cell shading, bad anatomy, bad hands, missing fingers, cropped, jpeg artifacts, ((signature)), ((watermark)), username, blurry, out of focus, poorly drawn hands, (((multiple views:1.4))), simple background, (EasyNegative)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.8", + "AddNet Weight B 1": "0.8", + "Denoising strength": "0.6", + "Cutoff interpolation": "lerp", + "Cutoff disable_for_neg": "True" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/57fb93fd-5df9-469f-3c76-7d389db61c00/width=450/275384.jpeg", + "nsfw": false, + "width": 1280, + "height": 768, + "hash": "UOGuq5tQM{-;?^xusoozOsR*$LxG9xkCaJM{", + "meta": { + "ENSD": "31337", + "Size": "640x384", + "seed": 1158800453, + "Model": "endlessmix_v10", + "steps": 30, + "prompt": "masterpiece, 1girl, highres, kinomoto_sakura, green eyes, wearing (tomoeda_elementary_school_uniform), good mood, at school\nBREAK\n(upper body), very detailed, full of detail, blue sky, sun, cinematic lighting, desk, chair, window, students", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "hash": "9da9c17d65", + "name": "endlessmix_v10", + "type": "model" + }, + { + "hash": "8cb765319688", + "name": "000006", + "type": "lora", + "weight": null + } + ], + "Model hash": "9da9c17d65", + "Cutoff strong": "False", + "Cutoff weight": "0.5", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "sincoslora-000006(8cb765319688)", + "Cutoff enabled": "True", + "Cutoff padding": "_", + "Cutoff targets": "\"['white', 'green', 'black']\"", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "deformed, extra limbs, extra fingers, mutated hands, bad anatomy, bad proportions, blind, bad eyes, ugly eyes, dead eyes, blur, vignette, out of shot, monochrome, censorship, ugly, old, deformed, drawing, odd, fat, tall, cell shading, bad anatomy, bad hands, missing fingers, cropped, jpeg artifacts, ((signature)), ((watermark)), username, blurry, out of focus, poorly drawn hands, (((multiple views:1.4))), simple background, (EasyNegative)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.8", + "AddNet Weight B 1": "0.8", + "Denoising strength": "0.6", + "Cutoff interpolation": "lerp", + "Cutoff disable_for_neg": "True" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/61271c31-a695-42fc-cebd-c2ae84f34600/width=450/275377.jpeg", + "nsfw": false, + "width": 512, + "height": 512, + "hash": "UHHx__[E_2sC:kNNa_r]}]W?w5t5[y^ONHNZ", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 2831997847, + "Model": "endlessmix_v10", + "steps": 30, + "prompt": "masterpiece, 1girl, highres, kinomoto_sakura, green eyes, wearing (tomoeda_elementary_school_uniform), crying, at the parc\nBREAK\n(full body), very detailed, full of detail, blue sky, sun, cinematic lighting, tree, sakura flower, sakura petal floating around", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "hash": "9da9c17d65", + "name": "endlessmix_v10", + "type": "model" + }, + { + "hash": "8cb765319688", + "name": "000006", + "type": "lora", + "weight": null + } + ], + "Model hash": "9da9c17d65", + "Cutoff strong": "False", + "Cutoff weight": "0.5", + "AddNet Enabled": "True", + "AddNet Model 1": "sincoslora-000006(8cb765319688)", + "Cutoff enabled": "True", + "Cutoff padding": "_", + "Cutoff targets": "\"['white', 'green', 'black']\"", + "negativePrompt": "deformed, extra limbs, extra fingers, mutated hands, bad anatomy, bad proportions, blind, bad eyes, ugly eyes, dead eyes, blur, vignette, out of shot, monochrome, censorship, ugly, old, deformed, drawing, odd, fat, tall, cell shading, bad anatomy, bad hands, missing fingers, cropped, jpeg artifacts, ((signature)), ((watermark)), username, blurry, out of focus, poorly drawn hands, (((multiple views:1.4))), simple background, (EasyNegative)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.8", + "AddNet Weight B 1": "0.8", + "Cutoff interpolation": "lerp", + "Cutoff disable_for_neg": "True" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/70bb2a5b-704c-4fdd-5a32-42a312b6ae00/width=450/275376.jpeg", + "nsfw": false, + "width": 512, + "height": 512, + "hash": "UJE{w%$zp{K+00pdM~i{M]R*$w-POSM_-ObY", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 2287109290, + "Model": "endlessmix_v10", + "steps": 30, + "prompt": "masterpiece, 1girl, highres, kinomoto_sakura, green eyes, wearing (tomoeda_elementary_school_uniform), happy, at the parc\nBREAK\n(full body), very detailed, full of detail, blue sky, sun, cinematic lighting, tree, sakura flower, sakura petal floating around", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "hash": "9da9c17d65", + "name": "endlessmix_v10", + "type": "model" + }, + { + "hash": "8cb765319688", + "name": "000006", + "type": "lora", + "weight": null + } + ], + "Model hash": "9da9c17d65", + "Cutoff strong": "False", + "Cutoff weight": "0.5", + "AddNet Enabled": "True", + "AddNet Model 1": "sincoslora-000006(8cb765319688)", + "Cutoff enabled": "True", + "Cutoff padding": "_", + "Cutoff targets": "\"['white', 'green', 'black']\"", + "negativePrompt": "deformed, extra limbs, extra fingers, mutated hands, bad anatomy, bad proportions, blind, bad eyes, ugly eyes, dead eyes, blur, vignette, out of shot, monochrome, censorship, ugly, old, deformed, drawing, odd, fat, tall, cell shading, bad anatomy, bad hands, missing fingers, cropped, jpeg artifacts, ((signature)), ((watermark)), username, blurry, out of focus, poorly drawn hands, (((multiple views:1.4))), simple background, (EasyNegative)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.8", + "AddNet Weight B 1": "0.8", + "Cutoff interpolation": "lerp", + "Cutoff disable_for_neg": "True" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/25156" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\345\217\230\345\260\217\346\250\261/sakuraKinomoto_sakuraV2Epoch6.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\345\217\230\345\260\217\346\250\261/sakuraKinomoto_sakuraV2Epoch6.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..ae3fd0df82d7960268c07fbb459dc0b1b68b8499 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\345\217\230\345\260\217\346\250\261/sakuraKinomoto_sakuraV2Epoch6.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:be36ca343bab593a0afa88d26bccef6bb28d3be5157fefc99c860a580950541b +size 1284500 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\345\217\230\345\260\217\346\250\261/sakuraKinomoto_sakuraV2Epoch6.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\345\217\230\345\260\217\346\250\261/sakuraKinomoto_sakuraV2Epoch6.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..5eea2fe3cb8eaa45c099a5a6a77b9c76e0176630 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\345\217\230\345\260\217\346\250\261/sakuraKinomoto_sakuraV2Epoch6.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:a9c41c7bc7e57b74f96946ea6931321fc561b24c4c5aea86c6ed344113d932e3 +size 151114116 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\345\220\210\346\230\257\346\210\221\347\232\204\345\267\245\344\275\234\357\274\201/yano.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\345\220\210\346\230\257\346\210\221\347\232\204\345\267\245\344\275\234\357\274\201/yano.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..ccf254a8508eca2302bae98e818b76933c9f2aaa --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\345\220\210\346\230\257\346\210\221\347\232\204\345\267\245\344\275\234\357\274\201/yano.civitai.info" @@ -0,0 +1,243 @@ +{ + "id": 70881, + "modelId": 66226, + "name": "v1.0", + "createdAt": "2023-05-14T22:00:37.641Z", + "updatedAt": "2023-05-14T22:16:36.470Z", + "trainedWords": [ + "yano" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 0, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Mitsuki Yano | Yuri is My Job | Watashi no Yuri wa Oshigoto Desu! ", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "yano.safetensors", + "id": 49390, + "sizeKB": 36979.751953125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-14T22:15:54.966Z", + "hashes": { + "AutoV1": "033C9BE2", + "AutoV2": "91A0E354E1", + "SHA256": "91A0E354E10D8BF8D725D6C48758BA9A33BED369AD4076D4F51BF57F68C04671", + "CRC32": "7DC3D9EF", + "BLAKE3": "0ACCAEB598661323E59174D543BDD9BB97850B5154913A18E07A52B1F54D4774" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/70881" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ce8141fe-301a-4d96-b422-62185e59cc3c/width=450/791857.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UGFhFn9a^MxZ}@niI:jZ4oS$EMsTNGI;xao0", + "meta": { + "Size": "512x768", + "seed": 622345342, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "3e9211917c" + }, + "prompt": "masterpiece, high quality, highres, 1girl, solo, yano, , school uniform, long skirt, long sleeves, puffy sleeves, red neckerchief, indoors, coffee shop, cowboy shot", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "yano", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "3e9211917c", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "3e9211917c", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, bad-image-v2-39000, bad_prompt_version2, extra fingers, fewer fingers,lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry,wrong legs, ,wrong Human body structure,Extra breasts,(((extra legs))),(((wrong legs))) ,Finger connection,pointy ears,", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/89703074-668e-48aa-a496-43e6fa9c6785/width=450/791856.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UGEooQ9HMdD*~VR+D$rr?uafRiE2KPR.idR%", + "meta": { + "Size": "512x768", + "seed": 2263127470, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "3e9211917c" + }, + "prompt": "masterpiece, high quality, highres, 1girl, solo, yano, , school uniform, (long skirt), long sleeves, puffy sleeves, red neckerchief, outdoors, green shirt, brown eyes, profile, street, breast, upper body", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "yano", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "3e9211917c", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "3e9211917c", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, bad-image-v2-39000, bad_prompt_version2, extra fingers, fewer fingers,lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry,wrong legs, ,wrong Human body structure,Extra breasts,(((extra legs))),(((wrong legs))) ,Finger connection,pointy ears,", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4ca76255-493f-4eaf-bde7-6f13b4397d00/width=450/791858.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UFGSMP00?=I.l,v}5ROYiUImM-rsXT$w#?s:", + "meta": { + "Size": "512x768", + "seed": 3759112146, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "3e9211917c" + }, + "prompt": "masterpiece, high quality, highres, 1girl, solo, yano, , school uniform, (long skirt), long sleeves, puffy sleeves, red neckerchief, outdoors, sitting, green shirt, brown eyes, bench, black skirt, upper body", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "yano", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "3e9211917c", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "3e9211917c", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, bad-image-v2-39000, bad_prompt_version2, extra fingers, fewer fingers,lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry,wrong legs, ,wrong Human body structure,Extra breasts,(((extra legs))),(((wrong legs))) ,Finger connection,pointy ears,", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a189cb1c-8ed9-438c-9b37-b881dec18167/width=450/791859.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UJGR;p0M.7%fX3~C0Lt5-Sxcafn#~V9bxuxZ", + "meta": { + "Size": "512x768", + "seed": 3400226247, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "3e9211917c" + }, + "prompt": "masterpiece, high quality, highres, 1girl, solo, yano, , school uniform, long skirt, long sleeves, puffy sleeves, red neckerchief, outdoors, street, cowboy shot,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "yano", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "3e9211917c", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "3e9211917c", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, bad-image-v2-39000, bad_prompt_version2, extra fingers, fewer fingers,lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry,wrong legs, ,wrong Human body structure,Extra breasts,(((extra legs))),(((wrong legs))) ,Finger connection,pointy ears,", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f74202c7-6067-4df4-a520-df3f8250f53a/width=450/791860.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UEHBMG01~AE2~VEMK4Rj00S~baniRPxFxFxa", + "meta": { + "Size": "512x768", + "seed": 923641531, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "3e9211917c" + }, + "prompt": "masterpiece, high quality, highres, 1girl, solo, yano, , school uniform, long skirt, long sleeves, puffy sleeves, red neckerchief, indoors, coffee shop, cowboy shot, tray, tray in one hand", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "yano", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "3e9211917c", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "3e9211917c", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, bad-image-v2-39000, bad_prompt_version2, extra fingers, fewer fingers,lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry,wrong legs, ,wrong Human body structure,Extra breasts,(((extra legs))),(((wrong legs))) ,Finger connection,pointy ears,", + "Denoising strength": "0.45" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/70881" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\345\220\210\346\230\257\346\210\221\347\232\204\345\267\245\344\275\234\357\274\201/yano.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\345\220\210\346\230\257\346\210\221\347\232\204\345\267\245\344\275\234\357\274\201/yano.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..1b46f4c5797a70e8547bbf9bbee6428a2ebb09b9 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\345\220\210\346\230\257\346\210\221\347\232\204\345\267\245\344\275\234\357\274\201/yano.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:cc280aa0a0304c5b9ac8b4aa5a4859bee88408df7b33f4cecad555c1358a63ee +size 2338787 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\345\220\210\346\230\257\346\210\221\347\232\204\345\267\245\344\275\234\357\274\201/yano.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\345\220\210\346\230\257\346\210\221\347\232\204\345\267\245\344\275\234\357\274\201/yano.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..fc5fff06325b179aa8a8516884a60d1d1d0a4574 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\345\220\210\346\230\257\346\210\221\347\232\204\345\267\245\344\275\234\357\274\201/yano.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:91a0e354e10d8bf8d725d6c48758ba9a33bed369ad4076d4f51bf57f68c04671 +size 37867266 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\346\227\240\347\246\201\345\277\214\357\274\201\345\245\263\351\253\230\344\270\255\347\224\237\347\247\201\346\210\277\350\257\235/galkoChanOshieteGalko_v10.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\346\227\240\347\246\201\345\277\214\357\274\201\345\245\263\351\253\230\344\270\255\347\224\237\347\247\201\346\210\277\350\257\235/galkoChanOshieteGalko_v10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..a0a0ea3f79277e5df50e1c3c9c6991ca36502f1e --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\346\227\240\347\246\201\345\277\214\357\274\201\345\245\263\351\253\230\344\270\255\347\224\237\347\247\201\346\210\277\350\257\235/galkoChanOshieteGalko_v10.civitai.info" @@ -0,0 +1,397 @@ +{ + "id": 32548, + "modelId": 27193, + "name": "v1.0", + "createdAt": "2023-03-31T15:32:11.217Z", + "updatedAt": "2023-03-31T15:34:29.196Z", + "trainedWords": [ + "galko", + "galkoschool", + "plaid skirt" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 939, + "ratingCount": 2, + "rating": 5 + }, + "model": { + "name": "Galko-chan | oshiete! galko-chan", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "galkoChanOshieteGalko_v10.safetensors", + "id": 26810, + "sizeKB": 147580.2880859375, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-03-31T15:35:58.120Z", + "hashes": { + "AutoV1": "F1E41487", + "AutoV2": "6053DD594F", + "SHA256": "6053DD594FF42EF644C391A7BB3BA151324CB0AEE2C7DA88087776301F5AA9DA", + "CRC32": "101901C2", + "BLAKE3": "E95CA608E3F7C7C31E768824906A0991B846B3BB47706ECE3BA8BEB5432592BA" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/32548" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a5fdb467-5de6-4a0b-7b4b-1f29c3d75d00/width=450/370986.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UbKJ[K9GEgxt~pIoNyxaElRjxZogs+jFNIt6", + "meta": { + "Size": "512x768", + "seed": 1289688243, + "Model": "Kotosmix", + "steps": 25, + "hashes": { + "model": "49ef66fc4c" + }, + "prompt": "masterpiece, best quality,,gigantic breasts,smile,school classroom, galkoschool ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7.5, + "Clip skip": "2", + "resources": [ + { + "name": "galko4", + "type": "lora", + "weight": 1 + }, + { + "hash": "49ef66fc4c", + "name": "Kotosmix", + "type": "model" + } + ], + "Model hash": "49ef66fc4c", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "ESRGAN_4x", + "negativePrompt": "(worst quality, low quality:1.4),EasyNegative , (monochrome:1.1),bad-hands-5, (greyscale),((((blurry background)))),multiple views,comic,(signature:1.3),(2girls,panels:1.4),", + "Denoising strength": "0.4" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/50aa44e2-ce9d-4e9a-e66f-82d583912200/width=450/370994.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UHKAQVQ-02wc_MrpOaM{%%IU%LNGY7IVxX-n", + "meta": { + "Size": "512x768", + "seed": 1106364419, + "Model": "Kotosmix", + "steps": 25, + "hashes": { + "model": "49ef66fc4c" + }, + "prompt": "masterpiece, best quality,,gigantic breasts,smile,school classroom, sitting,on desk,plaid skirt,galkoschool ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7.5, + "Clip skip": "2", + "resources": [ + { + "name": "galko4", + "type": "lora", + "weight": 1 + }, + { + "hash": "49ef66fc4c", + "name": "Kotosmix", + "type": "model" + } + ], + "Model hash": "49ef66fc4c", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "(worst quality, low quality:1.4),EasyNegative , (monochrome:1.1),bad-hands-5, (greyscale),((((blurry background)))),multiple views,comic,(signature:1.3),(2girls,panels:1.4),", + "Denoising strength": "0.55" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5259bec9-99a0-4ee8-6260-9a306c12fc00/width=450/370993.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UEIE^g9z3Gx]Q+H?01%frA-o?ZZ~10IpNaof", + "meta": { + "Size": "512x768", + "seed": 3676575719, + "Model": "Kotosmix", + "steps": 25, + "hashes": { + "model": "49ef66fc4c" + }, + "prompt": "masterpiece, best quality,,gigantic breasts,smile,swimming pool,dynamic pose, blue bikini,bikini skirt,galko ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7.5, + "Clip skip": "2", + "resources": [ + { + "name": "galko4", + "type": "lora", + "weight": 1 + }, + { + "hash": "49ef66fc4c", + "name": "Kotosmix", + "type": "model" + } + ], + "Model hash": "49ef66fc4c", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "(worst quality, low quality:1.4),EasyNegative , (monochrome:1.1),bad-hands-5, (greyscale),((((blurry background)))),multiple views,comic,(signature:1.3),(2girls,panels:1.4),", + "Denoising strength": "0.55" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c16a052b-817a-4799-a573-c59389393000/width=450/370992.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UTJa=,VECT?GtoT0xvfO0-RPo#V@VEIoIAs,", + "meta": { + "Size": "512x768", + "seed": 1888201717, + "Model": "Kotosmix", + "steps": 25, + "hashes": { + "model": "49ef66fc4c" + }, + "prompt": "masterpiece, best quality,,gigantic breasts,smile,swimming pool,huge ass,from behind,dynamic pose, blue bikini,bikini skirt,galko ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7.5, + "Clip skip": "2", + "resources": [ + { + "name": "galko4", + "type": "lora", + "weight": 1 + }, + { + "hash": "49ef66fc4c", + "name": "Kotosmix", + "type": "model" + } + ], + "Model hash": "49ef66fc4c", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "(worst quality, low quality:1.4),EasyNegative , (monochrome:1.1),bad-hands-5, (greyscale),((((blurry background)))),multiple views,comic,(signature:1.3),(2girls,panels:1.4),", + "Denoising strength": "0.55" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b12593f9-11de-4d77-57e2-af72c5fffd00/width=450/370991.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UFK0vh00PB~V?vw[tS-:MxNeM{IV00%NMxM|", + "meta": { + "Size": "512x768", + "seed": 3214272238, + "Model": "Kotosmix", + "steps": 25, + "hashes": { + "model": "49ef66fc4c" + }, + "prompt": "masterpiece, best quality,,gigantic breasts,smile,pink lace lingerie,dynamic pose,sitting,looking at viewer,choker,(arms behind back:1.3), indoors,bedroom,galko ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7.5, + "Clip skip": "2", + "resources": [ + { + "name": "galko4", + "type": "lora", + "weight": 1 + }, + { + "hash": "49ef66fc4c", + "name": "Kotosmix", + "type": "model" + } + ], + "Model hash": "49ef66fc4c", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "(worst quality, low quality:1.4),EasyNegative , (monochrome:1.1),bad-hands-5, (greyscale),((((blurry background)))),multiple views,comic,(signature:1.3),(2girls,panels:1.4),", + "Denoising strength": "0.55" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/879f5628-d543-4ea9-1d2a-277ffe954e00/width=450/370990.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UGM6SD4.01={~UxC-;%1_Lnh%Mt6RQNH%fM|", + "meta": { + "Size": "512x768", + "seed": 3048482989, + "Model": "Kotosmix", + "steps": 25, + "hashes": { + "model": "49ef66fc4c" + }, + "prompt": "masterpiece, best quality,,gigantic breasts,smile,pink lace lingerie,dynamic pose,sitting,looking at viewer,choker,(arms behind back:1.3), indoors,bedroom,on bed,galko ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7.5, + "Clip skip": "2", + "resources": [ + { + "name": "galko4", + "type": "lora", + "weight": 1 + }, + { + "hash": "49ef66fc4c", + "name": "Kotosmix", + "type": "model" + } + ], + "Model hash": "49ef66fc4c", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "(worst quality, low quality:1.4),EasyNegative , (monochrome:1.1),bad-hands-5, (greyscale),((((blurry background)))),multiple views,comic,(signature:1.3),(2girls,panels:1.4),", + "Denoising strength": "0.55" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9ca8ecec-566b-47c5-1569-c7b8c7707b00/width=450/370989.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UMJt@r%NNO~WyExvE2sk#eM|gdj[GIe.xuM|", + "meta": { + "Size": "512x768", + "seed": 2787340560, + "Model": "Kotosmix", + "steps": 25, + "hashes": { + "model": "49ef66fc4c" + }, + "prompt": "masterpiece, best quality,,gigantic breasts,smile,(green long sleeve shirt:1.1),bare shoulders,denim short shorts,midriff,off shoulder,dynamic pose,looking at viewer,choker,(arms behind back:1.3),outdoors,street,city,galko ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7.5, + "Clip skip": "2", + "resources": [ + { + "name": "galko4", + "type": "lora", + "weight": 1 + }, + { + "hash": "49ef66fc4c", + "name": "Kotosmix", + "type": "model" + } + ], + "Model hash": "49ef66fc4c", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "(worst quality, low quality:1.4),EasyNegative , (monochrome:1.1),bad-hands-5, (greyscale),((((blurry background)))),multiple views,comic,(signature:1.3),(2girls,panels:1.4),", + "Denoising strength": "0.55" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/cb1ce024-b62e-4782-8d60-22dd058e2200/width=450/370988.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UHJ*O;9tA2?Z%5NG0fRON9-V%eRo%|W?rdM{", + "meta": { + "Size": "512x768", + "seed": 3724587581, + "Model": "Kotosmix", + "steps": 25, + "hashes": { + "model": "49ef66fc4c" + }, + "prompt": "masterpiece, best quality,,gigantic breasts,smile,(green long sleeve shirt:1.1),bare shoulders,denim short shorts,midriff,off shoulder,dynamic pose,looking at viewer,choker,(arms behind back:1.3),outdoors,street,city,galko ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7.5, + "Clip skip": "2", + "resources": [ + { + "name": "galko4", + "type": "lora", + "weight": 1 + }, + { + "hash": "49ef66fc4c", + "name": "Kotosmix", + "type": "model" + } + ], + "Model hash": "49ef66fc4c", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "(worst quality, low quality:1.4),EasyNegative , (monochrome:1.1),bad-hands-5, (greyscale),((((blurry background)))),multiple views,comic,(signature:1.3),(2girls,panels:1.4),", + "Denoising strength": "0.55" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/580ae9ec-f8ac-4e3b-4b43-fa7e34ab8400/width=450/370987.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UKKmqO%N0O~o-??bT0t70W-;%Nxb~RR:NKIV", + "meta": { + "Size": "512x768", + "seed": 906003090, + "Model": "Kotosmix", + "steps": 25, + "hashes": { + "model": "49ef66fc4c" + }, + "prompt": "(realistic:1.5),masterpiece, best quality,,gigantic breasts,smile,(green long sleeve shirt:1.1),bare shoulders,denim short shorts,midriff,off shoulder,dynamic pose,looking at viewer,choker,(arms behind back:1.3),outdoors,street,city,galko ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7.5, + "Clip skip": "2", + "resources": [ + { + "name": "galko4", + "type": "lora", + "weight": 1 + }, + { + "hash": "49ef66fc4c", + "name": "Kotosmix", + "type": "model" + } + ], + "Model hash": "49ef66fc4c", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "(worst quality, low quality:1.4),EasyNegative , (monochrome:1.1),bad-hands-5, (greyscale),((((blurry background)))),multiple views,comic,(signature:1.3),(2girls,panels:1.4),", + "Denoising strength": "0.55" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/32548" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\346\227\240\347\246\201\345\277\214\357\274\201\345\245\263\351\253\230\344\270\255\347\224\237\347\247\201\346\210\277\350\257\235/galkoChanOshieteGalko_v10.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\346\227\240\347\246\201\345\277\214\357\274\201\345\245\263\351\253\230\344\270\255\347\224\237\347\247\201\346\210\277\350\257\235/galkoChanOshieteGalko_v10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..e35011145b7b0f0b1c817bac5e16f8481d59efc8 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\346\227\240\347\246\201\345\277\214\357\274\201\345\245\263\351\253\230\344\270\255\347\224\237\347\247\201\346\210\277\350\257\235/galkoChanOshieteGalko_v10.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:87015b8b4002263a44492a3ea062c47edea2305af3af11f5a03246fed9cd04a0 +size 2040698 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\346\227\240\347\246\201\345\277\214\357\274\201\345\245\263\351\253\230\344\270\255\347\224\237\347\247\201\346\210\277\350\257\235/galkoChanOshieteGalko_v10.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\346\227\240\347\246\201\345\277\214\357\274\201\345\245\263\351\253\230\344\270\255\347\224\237\347\247\201\346\210\277\350\257\235/galkoChanOshieteGalko_v10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..970ae6bdd7d070cb8838e3e618a2b3db5ecd74ed --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\346\227\240\347\246\201\345\277\214\357\274\201\345\245\263\351\253\230\344\270\255\347\224\237\347\247\201\346\210\277\350\257\235/galkoChanOshieteGalko_v10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:6053dd594ff42ef644c391a7bb3ba151324cb0aee2c7da88087776301f5aa9da +size 151122215 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\346\227\240\347\246\201\345\277\214\357\274\201\345\245\263\351\253\230\344\270\255\347\224\237\347\247\201\346\210\277\350\257\235/galkoOshieteGalkoChan_galkoV20.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\346\227\240\347\246\201\345\277\214\357\274\201\345\245\263\351\253\230\344\270\255\347\224\237\347\247\201\346\210\277\350\257\235/galkoOshieteGalkoChan_galkoV20.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..863352ddb011e21a05d38f60016b27cf836d30c2 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\346\227\240\347\246\201\345\277\214\357\274\201\345\245\263\351\253\230\344\270\255\347\224\237\347\247\201\346\210\277\350\257\235/galkoOshieteGalkoChan_galkoV20.civitai.info" @@ -0,0 +1,248 @@ +{ + "id": 9783, + "modelId": 8292, + "name": "Galko v2.0", + "createdAt": "2023-02-12T15:39:48.597Z", + "updatedAt": "2023-02-14T02:19:15.216Z", + "trainedWords": [ + "galko" + ], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": "

New version 2.0

", + "model": { + "name": "Galko (oshiete! galko-chan)", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "galkoOshieteGalkoChan_galkoV20.safetensors", + "id": 9438, + "sizeKB": 9325.5107421875, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-02-12T15:41:03.728Z", + "hashes": { + "AutoV1": "F1D123A7", + "AutoV2": "2A34C04728", + "SHA256": "2A34C0472805384BEABA8183C537DEDB4C7ABC7F012047FEC8F45C028A05E602", + "CRC32": "F4904565", + "BLAKE3": "1794E3D7B19ACD542FA400F5E5E611EC48B82EAD4A284C1CD5E57D67343EF101" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/9783" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/efec681a-eef5-4ecf-2011-9d27f1ede700/width=450/94872.jpeg", + "nsfw": false, + "width": 512, + "height": 768, + "hash": "UWM6q%I;0hay~Vj=oH%1S*It%MM{?ZE4N2n}", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3970260850, + "steps": 35, + "prompt": "masterpiece, best quality, absurdres, wallpaper, girl, beautiful detailed eyes, light blush, large breasts, steam,(gyaru:0.8),(blonde hair), blue eyes, single hair bun,one side up, blue scrunchie , (asymmetrical hair), kogal ,stud earrings ,, (yellow sweater),(white school uniform), (shirt tucked in), (red bowtie), (blue checkered skirt), yellow cardigan,scrun,smile,", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "Model hash": "37a86dca58", + "negativePrompt": "(worst quality, low quality:1.4),monochrome,signature,text," + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/eebb075c-0be6-4c4e-cf1d-1949600ed200/width=450/94873.jpeg", + "nsfw": false, + "width": 512, + "height": 768, + "hash": "U8LzHY000uD4?d0Mbr}%00F|8{Te?rwK9i^g", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1134372859, + "steps": 35, + "prompt": "masterpiece, best quality, absurdres, wallpaper, girl, beautiful detailed eyes, light blush, large breasts, steam,(gyaru:0.8),(blonde hair), blue eyes, single hair bun,one side up, blue scrunchie , (asymmetrical hair), kogal ,stud earrings ,, (yellow sweater),(white school uniform), (shirt tucked in), (red bowtie), (blue checkered skirt), yellow cardigan,scrun", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "Model hash": "37a86dca58", + "negativePrompt": "(worst quality, low quality:1.4),monochrome,signature,text," + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d7664d3c-f2f5-4257-0b49-273df632e700/width=450/94871.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UFLWkR00030d_4MxtQ9aA29Z?H9H%DxtN4NI", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3309894422, + "steps": 35, + "prompt": "masterpiece, best quality, absurdres, wallpaper, girl, beautiful detailed eyes, light blush, large breasts, steam,(gyaru:0.8),(blonde hair), blue eyes, single hair bun,one side up, blue scrunchie , (asymmetrical hair), kogal ,stud earrings ,, (yellow sweater),(white school uniform), (shirt tucked in), (red bowtie), (blue checkered skirt), yellow cardigan,scrun,smile,", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "Model hash": "37a86dca58", + "negativePrompt": "(worst quality, low quality:1.4),monochrome,signature,text," + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b595778e-37f3-4399-6b8d-a61c1089e800/width=450/94870.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UHL:=q-=1-TL~nkrtn-30NsmF~-mK7EQVtIp", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 787863791, + "steps": 35, + "prompt": "masterpiece, best quality, absurdres, wallpaper, girl, beautiful detailed eyes, light blush, large breasts, steam,(gyaru:0.8),(blonde hair), blue eyes, single hair bun,one side up, blue scrunchie , (asymmetrical hair), kogal ,stud earrings ,, blue bikini, blue bikini_skirt,black collar, sunglasses,", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "Model hash": "37a86dca58", + "negativePrompt": "(worst quality, low quality:1.4),monochrome,signature,text," + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/82785244-2c89-4e7b-91aa-6ba917c74b00/width=450/94869.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "ULLzv^k?3Z.8o}T10;s*9c$#^+-ox^%LIUxt", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1171543068, + "steps": 35, + "prompt": "masterpiece, best quality, absurdres, wallpaper, girl, beautiful detailed eyes, light blush, large breasts, steam,(gyaru:0.8),(blonde hair), blue eyes, single hair bun,one side up,flower scrunchie , (asymmetrical hair), kogal ,stud earrings ,, blue bikini, blue bikini_skirt,black collar, sunglasses,hair bun", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "Model hash": "37a86dca58", + "negativePrompt": "(worst quality, low quality:1.4),monochrome,signature,text," + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7249fdc7-36f8-468b-e06c-b4f9e4e57c00/width=450/94868.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UVLDf6579b~U4nEM9as,RCIo%0s.gN-pxtxt", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 332594270, + "steps": 35, + "prompt": "masterpiece, best quality, absurdres, wallpaper, girl, beautiful detailed eyes, light blush, large breasts, steam,(gyaru:0.8),(blonde hair), blue eyes, single hair bun,one side up,bl scrunchie , (asymmetrical hair), kogal ,stud earrings ,, (green off-shouldersweater ), short shorts, necklace, chain belt, midriff", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "Model hash": "37a86dca58", + "negativePrompt": "(worst quality, low quality:1.4),monochrome,signature,text," + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e896d35a-f2d7-4e4e-b538-f8699fe0c900/width=450/94867.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UTKwOK~U02-m~9%Lbb$zaO-p%Lt5KxS#r]t6", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1380263739, + "steps": 35, + "prompt": "masterpiece, best quality, absurdres, wallpaper, girl, beautiful detailed eyes, light blush, large breasts, steam,(gyaru:0.8),(blonde hair), blue eyes, single hair bun,one side up,bl scrunchie , (asymmetrical hair), kogal ,stud earrings ,, (green off-shouldersweater ), short shorts, necklace, chain belt, midriff", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "Model hash": "37a86dca58", + "negativePrompt": "(worst quality, low quality:1.4),monochrome,signature,text," + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9cb42c2d-1b76-468a-4fac-76585a1a0200/width=450/94863.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UPIq1E_29[^j-:x]-;~Vb]%Lw1Io0LRPWUV@", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1507167571, + "steps": 35, + "prompt": "masterpiece, best quality, absurdres, wallpaper, girl, ", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "Model hash": "37a86dca58", + "negativePrompt": "(worst quality, low quality:1.4),monochrome,signature,text," + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/272945e5-1f30-4ec8-b529-fdf64bb2c600/width=450/94874.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UIK,pj?a00RP_LWB%Nt7b@w{pIX8AZWUi_f8", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1507167578, + "steps": 35, + "prompt": "masterpiece, best quality, absurdres, wallpaper, girl, ", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "Model hash": "37a86dca58", + "negativePrompt": "(worst quality, low quality:1.4),monochrome,signature,text," + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/20ffbea7-6516-4dbc-5bc6-e3a4f6defe00/width=450/94866.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UfNl##x@F3wI.ln~tTbIS%Rpb_n+?bV[s;xs", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1574371556, + "steps": 35, + "prompt": "masterpiece, best quality, absurdres, wallpaper, girl, beautiful detailed eyes, light blush, large breasts, steam,(gyaru:0.8),(blonde hair), blue eyes, single hair bun,one side up,blue scrunchie , (asymmetrical hair), kogal ,stud earrings ,, (yellow sweater),(white school uniform), (shirt tucked in), (red bowtie), (blue checkered skirt), yellow cardigan,scrun,classroom, , bouncing breasts , open clothes, breast slip, (inverted_nipples),areola slip,", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "Model hash": "37a86dca58", + "negativePrompt": "(worst quality, low quality:1.4),monochrome,signature,text," + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/9783" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\346\227\240\347\246\201\345\277\214\357\274\201\345\245\263\351\253\230\344\270\255\347\224\237\347\247\201\346\210\277\350\257\235/galkoOshieteGalkoChan_galkoV20.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\346\227\240\347\246\201\345\277\214\357\274\201\345\245\263\351\253\230\344\270\255\347\224\237\347\247\201\346\210\277\350\257\235/galkoOshieteGalkoChan_galkoV20.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..7bda5a30138ee3be0bf0e7f140d34e8b992d587d Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\346\227\240\347\246\201\345\277\214\357\274\201\345\245\263\351\253\230\344\270\255\347\224\237\347\247\201\346\210\277\350\257\235/galkoOshieteGalkoChan_galkoV20.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\346\227\240\347\246\201\345\277\214\357\274\201\345\245\263\351\253\230\344\270\255\347\224\237\347\247\201\346\210\277\350\257\235/galkoOshieteGalkoChan_galkoV20.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\346\227\240\347\246\201\345\277\214\357\274\201\345\245\263\351\253\230\344\270\255\347\224\237\347\247\201\346\210\277\350\257\235/galkoOshieteGalkoChan_galkoV20.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..0a75d01525fe5cde771631a781b60f5faaf4551f --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\231\276\346\227\240\347\246\201\345\277\214\357\274\201\345\245\263\351\253\230\344\270\255\347\224\237\347\247\201\346\210\277\350\257\235/galkoOshieteGalkoChan_galkoV20.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:2a34c0472805384beaba8183c537dedb4c7abc7f012047fec8f45c028a05e602 +size 9549323 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\254\250\350\233\213\343\200\201\346\265\213\351\252\214\343\200\201\345\217\254\345\224\244\345\205\275/hideyoshitest.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\254\250\350\233\213\343\200\201\346\265\213\351\252\214\343\200\201\345\217\254\345\224\244\345\205\275/hideyoshitest.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..6c2578971ddb9039d96254017030b76f618f451f --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\254\250\350\233\213\343\200\201\346\265\213\351\252\214\343\200\201\345\217\254\345\224\244\345\205\275/hideyoshitest.civitai.info" @@ -0,0 +1,330 @@ +{ + "id": 112812, + "modelId": 105190, + "name": "v1.0", + "createdAt": "2023-07-08T09:37:21.531Z", + "updatedAt": "2023-07-08T09:40:03.741Z", + "trainedWords": [ + "hideyoshi kinoshita, brown hair, (green eyes:1.5), hair ornament, hairclip, otoko no ko, trap, hair between eyes,", + "fumizuki academy school uniform, school uniform, see-through, shirt, short sleeves," + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 45, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Hideyoshi Kinoshita - The Idiot, the Tests, and the Summoned Creatures", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "hideyoshitest.safetensors", + "id": 80031, + "sizeKB": 37008.01171875, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-07-08T10:03:36.183Z", + "hashes": { + "AutoV1": "7D185B7C", + "AutoV2": "5A20B3A96B", + "SHA256": "5A20B3A96B58DBEFF205FB0A4EEB85B073271B7E9D9E610C19CB2ECCDE5088B5", + "CRC32": "22E50A1E", + "BLAKE3": "3D25A17A65528F45817A9290D00D04E21C0148C137EB81DB4E6961A583ED4D83" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/112812" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/15dc55e5-8aef-4715-a358-bd41704fb304/width=450/1459403.jpeg", + "nsfw": "None", + "width": 600, + "height": 896, + "hash": "UWI}YL~q?bbvtQt7%Nt7xuR%odxuM{aes:oL", + "meta": { + "Size": "200x300", + "seed": 885629916, + "Model": "cleanlinearmix_alpha", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "d814e1b0bf" + }, + "prompt": "hideyoshikinoshita, ,\nhideyoshi kinoshita, brown hair, (green eyes:1.5), hair ornament, hairclip, otoko no ko, trap, hair between eyes, (flat chest:1.2), short hair,\nBREAK fumizuki academy school uniform, school uniform, see-through, shirt, short sleeves,\nBREAK looking at viewer,\nBREAK indoors, classroom,\nBREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "hideyoshitest", + "type": "lora", + "weight": 1 + }, + { + "hash": "d814e1b0bf", + "name": "cleanlinearmix_alpha", + "type": "model" + } + ], + "Model hash": "d814e1b0bf", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "\"hideyoshitest": "dc16e8c5abd2", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3,", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0dc40c96-ff8f-4f5f-824c-56b3b783913b/width=450/1459402.jpeg", + "nsfw": "None", + "width": 600, + "height": 896, + "hash": "UQH_rk00_NInkWV@NaV@RjIoIU%M-pM{s:of", + "meta": { + "Size": "200x300", + "seed": 885629915, + "Model": "cleanlinearmix_alpha", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "d814e1b0bf" + }, + "prompt": "hideyoshikinoshita, ,\nhideyoshi kinoshita, brown hair, (green eyes:1.5), hair ornament, hairclip, otoko no ko, trap, hair between eyes, (flat chest:1.2), short hair,\nBREAK fumizuki academy school uniform, school uniform, see-through, shirt, short sleeves,\nBREAK looking at viewer,\nBREAK indoors, classroom,\nBREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "hideyoshitest", + "type": "lora", + "weight": 1 + }, + { + "hash": "d814e1b0bf", + "name": "cleanlinearmix_alpha", + "type": "model" + } + ], + "Model hash": "d814e1b0bf", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "\"hideyoshitest": "dc16e8c5abd2", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3,", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2159d949-d671-41d7-aee4-100fcfa8d220/width=450/1459415.jpeg", + "nsfw": "Mature", + "width": 600, + "height": 896, + "hash": "UaLDx?_No~WFW.t8^*t7WBxGxuRkyDNaWWa{", + "meta": { + "Size": "200x300", + "seed": 3109642663, + "Model": "cleanlinearmix_alpha", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "d814e1b0bf" + }, + "prompt": "hideyoshikinoshita, ,\nhideyoshi kinoshita, brown hair, (green eyes:1.5), hair ornament, hairclip, otoko no ko, trap, hair between eyes, (flat chest:1.2), short hair,\nBREAK bikini,\nBREAK looking at viewer,\nBREAK indoors, pool,\nBREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "hideyoshitest", + "type": "lora", + "weight": 1 + }, + { + "hash": "d814e1b0bf", + "name": "cleanlinearmix_alpha", + "type": "model" + } + ], + "Model hash": "d814e1b0bf", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "\"hideyoshitest": "dc16e8c5abd2", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3,", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7b76baec-442e-482a-9711-e256a6f3b7cc/width=450/1459414.jpeg", + "nsfw": "Mature", + "width": 600, + "height": 896, + "hash": "UULWt=_Nx^NIxZog~VxuEMbbx[R-S~j[RQae", + "meta": { + "Size": "200x300", + "seed": 3109642662, + "Model": "cleanlinearmix_alpha", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "d814e1b0bf" + }, + "prompt": "hideyoshikinoshita, ,\nhideyoshi kinoshita, brown hair, (green eyes:1.5), hair ornament, hairclip, otoko no ko, trap, hair between eyes, (flat chest:1.2), short hair,\nBREAK bikini,\nBREAK looking at viewer,\nBREAK indoors, pool,\nBREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "hideyoshitest", + "type": "lora", + "weight": 1 + }, + { + "hash": "d814e1b0bf", + "name": "cleanlinearmix_alpha", + "type": "model" + } + ], + "Model hash": "d814e1b0bf", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "\"hideyoshitest": "dc16e8c5abd2", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3,", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/92086a35-8005-4fd7-aca3-c760d2e2d7fe/width=450/1459420.jpeg", + "nsfw": "Mature", + "width": 600, + "height": 896, + "hash": "UPK1RSMxu5_N_NWU%M%MXmM{^+xaxvj[S#t7", + "meta": { + "Size": "200x300", + "seed": 1386955072, + "Model": "cleanlinearmix_alpha", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "d814e1b0bf" + }, + "prompt": "hideyoshikinoshita, ,\nhideyoshi kinoshita, brown hair, (green eyes:1.5), hair ornament, hairclip, otoko no ko, trap, hair between eyes, (flat chest:1.2), short hair,\nBREAK bikini,\nBREAK looking at viewer,\nBREAK indoors, pool,\nBREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "hideyoshitest", + "type": "lora", + "weight": 1 + }, + { + "hash": "d814e1b0bf", + "name": "cleanlinearmix_alpha", + "type": "model" + } + ], + "Model hash": "d814e1b0bf", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "\"hideyoshitest": "dc16e8c5abd2", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3,", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/02607203-1f92-495a-ac4a-97f36a365ca8/width=450/1459421.jpeg", + "nsfw": "Mature", + "width": 600, + "height": 896, + "hash": "U7JHUE0000Kg0056_39a00?a~pVt0M-oM{xu", + "meta": { + "Size": "200x300", + "seed": 1386955071, + "Model": "cleanlinearmix_alpha", + "model": "control_v11p_sd15_openpose [cab727d4]", + "steps": 25, + "hashes": { + "model": "d814e1b0bf" + }, + "prompt": "hideyoshikinoshita, ,\nhideyoshi kinoshita, brown hair, (green eyes:1.5), hair ornament, hairclip, otoko no ko, trap, hair between eyes, (flat chest:1.2), short hair,\nBREAK bikini,\nBREAK looking at viewer,\nBREAK indoors, pool,\nBREAK , (masterpiece:1.2), best quality, high resolution, unity 8k wallpaper, (illustration:0.8), (beautiful detailed eyes:1.6), extremely detailed face, perfect lighting, extremely detailed CG, (perfect hands, perfect anatomy),", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "hideyoshitest", + "type": "lora", + "weight": 1 + }, + { + "hash": "d814e1b0bf", + "name": "cleanlinearmix_alpha", + "type": "model" + } + ], + "Model hash": "d814e1b0bf", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "none", + "Hires upscale": "3", + "pixel perfect": "False", + "\"hideyoshitest": "dc16e8c5abd2", + "Hires upscaler": "Latent", + "negativePrompt": "easynegative, ng_deepnegative_v1_75t, verybadimagenegative_v1.3,", + "starting/ending": "(0, 1)", + "GoodHands-vanilla": "c05ed279295e\"", + "Denoising strength": "0.7", + "preprocessor params": "(512, 64, 64)\"" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/112812" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\254\250\350\233\213\343\200\201\346\265\213\351\252\214\343\200\201\345\217\254\345\224\244\345\205\275/hideyoshitest.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\254\250\350\233\213\343\200\201\346\265\213\351\252\214\343\200\201\345\217\254\345\224\244\345\205\275/hideyoshitest.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..5db80c28854fd502134e3bccaddcd451bb0c7b0b Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\254\250\350\233\213\343\200\201\346\265\213\351\252\214\343\200\201\345\217\254\345\224\244\345\205\275/hideyoshitest.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\254\250\350\233\213\343\200\201\346\265\213\351\252\214\343\200\201\345\217\254\345\224\244\345\205\275/hideyoshitest.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\254\250\350\233\213\343\200\201\346\265\213\351\252\214\343\200\201\345\217\254\345\224\244\345\205\275/hideyoshitest.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..9256ca808e1baf5810ed625541dc753b4096f7ce --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\254\250\350\233\213\343\200\201\346\265\213\351\252\214\343\200\201\345\217\254\345\224\244\345\205\275/hideyoshitest.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:5a20b3a96b58dbeff205fb0a4eeb85b073271b7e9d9e610c19cb2eccde5088b5 +size 37896204 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\254\250\350\233\213\343\200\201\346\265\213\351\252\214\343\200\201\345\217\254\345\224\244\345\205\275/shimada_minami_v1.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\254\250\350\233\213\343\200\201\346\265\213\351\252\214\343\200\201\345\217\254\345\224\244\345\205\275/shimada_minami_v1.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..616d9696a93b7538c3be185675381af743062955 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\254\250\350\233\213\343\200\201\346\265\213\351\252\214\343\200\201\345\217\254\345\224\244\345\205\275/shimada_minami_v1.civitai.info" @@ -0,0 +1,444 @@ +{ + "id": 67160, + "modelId": 62592, + "name": "v1.0", + "createdAt": "2023-05-10T12:30:27.171Z", + "updatedAt": "2023-05-10T12:31:39.808Z", + "trainedWords": [ + "sm1, school uniform, necktie, red hair, hair ribbon, skirt, white shirt, short sleeves", + "sm1, school uniform, necktie, red hair, hair ribbon, skirt, jacket, long sleeves" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 135, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Shimada Minami \u5cf6\u7530\u7f8e\u6ce2 / Baka to Test to Shokanjyu", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "shimada_minami_v1.safetensors", + "id": 46994, + "sizeKB": 36979.787109375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-10T12:35:38.232Z", + "hashes": { + "AutoV1": "FB89466B", + "AutoV2": "BF3B009D1C", + "SHA256": "BF3B009D1C70AD5FEC060791439CAB99947F40AA08434326F36729640404B23D", + "CRC32": "0A85EACD", + "BLAKE3": "7DDD0FDF4B85DB7704868F0557CBEF01BF549C3750DC1541BC1B1F7CEE165A4F" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/67160" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/fbaccd9c-e643-4cd7-9df6-0bd90e378775/width=450/745744.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UDKA.+,IueS^%g00WAH@00I;58IB00~V.R?Z", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1781131932, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, sm1, school uniform, necktie, red hair, short hair, hair ribbon, skirt, white shirt short sleeves, , cowboy shot, waving, open mouth, smile,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "shimada_minami_v1", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1), (holding:1.5),", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/979037ae-15ce-4b41-bf54-dde962df9ae1/width=450/745737.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UjHCQEIWYPxBPES5Oar?xHbdIooKMxWBxDn$", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3768581029, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, sm1, school uniform, necktie, red hair, short hair, hair ribbon, skirt, jacket,long sleeves, , outdoors, cowboy shot", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "shimada_minami_v1", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1),", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1e732c01-4dee-4a09-9769-2dd9d7bd4581/width=450/745741.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UMIY8;%jBfELT#?^tS$i4pNhpJspt39Ixtog", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2331495245, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, sm1, school uniform, necktie, red hair, short hair, hair ribbon, skirt, white shirt short sleeves, , cowboy shot, outdoors,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "shimada_minami_v1", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1), (holding:1.5),", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8cb0a99d-d4a0-4868-ab8d-0b9093153c5f/width=450/745739.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UFI;t~-=*IQ.02OY9]?GiIMf0KrrD%S^%zxa", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 370833348, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, sm1, school uniform, necktie, red hair, short hair, hair ribbon, skirt, jacket,long sleeves, , dadami, sitting,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "shimada_minami_v1", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1),", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6dd89fff-e5d0-4af7-a9e3-03708c927299/width=450/745746.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UII4w}XS9@_3?aAD$j~C8_x^%M9FQ.Io-;xu", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1309136585, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, sm1, school uniform, necktie, red hair, short hair, hair ribbon, skirt, white shirt short sleeves, , pointing,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "shimada_minami_v1", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1), (holding:1.5),", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7b19c962-014b-44f6-baf6-a5cf308bb24a/width=450/745734.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UDHw.H001H%2o~xu9t%f~UIB~VR*}[IVS~WC", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3116113111, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, sm1, school uniform, necktie, red hair, short hair, hair ribbon, skirt, jacket,long sleeves, , frown, floor, sitting,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "shimada_minami_v1", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1), (holding:1.5),", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/110482de-4df4-451c-8fc2-96280b98bca1/width=450/745740.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UQIE^I%G7CSh.TxYkroynoxByYxt-:-V.RS$", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 4107960921, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, sm1, school uniform, necktie, red hair, short hair, hair ribbon, skirt, white shirt short sleeves, , cowboy shot, outdoors,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "shimada_minami_v1", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1), (holding:1.5),", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/970ad37b-1f7b-4785-bdd3-e5c7d51124c5/width=450/745738.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UjHxQkWDpcxaR%V[IUjZ~WW;tloKM|WBs:ay", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 9018915, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, sm1, school uniform, necktie, red hair, short hair, hair ribbon, skirt, jacket,long sleeves, , smile, hand on hip,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "shimada_minami_v1", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1),", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/99775988-39c7-41aa-83ba-e4aefd15355f/width=450/745743.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UPJaWU~B0dS}OYoc%LNbD%RjT0tR8{$*x]J7", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3362705194, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, sm1, school uniform, necktie, red hair, short hair, hair ribbon, skirt, white shirt short sleeves, , cowboy shot, sitting, bench, eafing, food,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "shimada_minami_v1", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1), (holding:1.5),", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a58fc239-b088-4eac-a61b-6abd4f251d6b/width=450/745736.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UbJ[Cr9F*J-;E2u4M|R5rst7IoniV@NGjY$*", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1362276337, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "model": "f713bab753" + }, + "prompt": "masterpiece, best quality, highres, sm1, school uniform, necktie, red hair, short hair, hair ribbon, skirt, jacket,long sleeves, , smile, reaching out,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "shimada_minami_v1", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + } + ], + "Model hash": "f713bab753", + "Hires steps": "13", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, (worst quality:1.2), low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres graffiti, (low quality lowres simple background:1.1), (holding:1.5),", + "Denoising strength": "0.45" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/67160" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\254\250\350\233\213\343\200\201\346\265\213\351\252\214\343\200\201\345\217\254\345\224\244\345\205\275/shimada_minami_v1.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\254\250\350\233\213\343\200\201\346\265\213\351\252\214\343\200\201\345\217\254\345\224\244\345\205\275/shimada_minami_v1.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..937085c410f250925379655e50453ec7039d66d2 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\254\250\350\233\213\343\200\201\346\265\213\351\252\214\343\200\201\345\217\254\345\224\244\345\205\275/shimada_minami_v1.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\254\250\350\233\213\343\200\201\346\265\213\351\252\214\343\200\201\345\217\254\345\224\244\345\205\275/shimada_minami_v1.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\254\250\350\233\213\343\200\201\346\265\213\351\252\214\343\200\201\345\217\254\345\224\244\345\205\275/shimada_minami_v1.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..4670b04facaee09bf3459537fdf7580ee8537803 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\347\254\250\350\233\213\343\200\201\346\265\213\351\252\214\343\200\201\345\217\254\345\224\244\345\205\275/shimada_minami_v1.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:bf3b009d1c70ad5fec060791439cab99947f40aa08434326f36729640404b23d +size 37867302 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\350\242\253\345\213\207\350\200\205\351\230\237\344\274\215\345\274\200\351\231\244\347\232\204\351\251\255\345\205\275\344\275\277\357\274\214\351\202\202\351\200\205\344\272\206\346\234\200\345\274\272\347\247\215\347\232\204\347\214\253\350\200\263\345\260\221\345\245\263/Kizuki - Beast Tamer - Tania.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\350\242\253\345\213\207\350\200\205\351\230\237\344\274\215\345\274\200\351\231\244\347\232\204\351\251\255\345\205\275\344\275\277\357\274\214\351\202\202\351\200\205\344\272\206\346\234\200\345\274\272\347\247\215\347\232\204\347\214\253\350\200\263\345\260\221\345\245\263/Kizuki - Beast Tamer - Tania.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..0e3c9fe55e5007b4e38276399a8f3e282eef3dd2 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\350\242\253\345\213\207\350\200\205\351\230\237\344\274\215\345\274\200\351\231\244\347\232\204\351\251\255\345\205\275\344\275\277\357\274\214\351\202\202\351\200\205\344\272\206\346\234\200\345\274\272\347\247\215\347\232\204\347\214\253\350\200\263\345\260\221\345\245\263/Kizuki - Beast Tamer - Tania.civitai.info" @@ -0,0 +1,382 @@ +{ + "id": 83657, + "modelId": 78852, + "name": "v1.0", + "createdAt": "2023-05-28T12:22:58.114Z", + "updatedAt": "2023-05-28T12:26:06.959Z", + "trainedWords": [ + "PLEASE CHECK THE DESCRIPTION!" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

Initial Release based on ~140 handpicked, adjusted and edited images

", + "stats": { + "downloadCount": 12, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Kizuki - Beast Tamer - Tania [NSFW Support]", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "Kizuki - Beast Tamer - Tania.safetensors", + "id": 57195, + "sizeKB": 36973.8046875, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-28T12:26:34.696Z", + "hashes": { + "AutoV1": "3129F42D", + "AutoV2": "6E5B41F412", + "SHA256": "6E5B41F412FD4980586C8B00A8F8655F053AB20D5791DC0F7A57B2B5994E7CEB", + "CRC32": "F4E94027", + "BLAKE3": "7E859784E1B97B8366927A4E0FDE4D5BFB9B93418762FA02B3733EEAFB9D9C21" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/83657" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0a320b39-86cf-4bd8-86e4-5f9b819ee52c/width=450/943858.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UPKwa:8_0_xa4-WUPAR+O@n%aKRk?]VsVXo#", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2633968992, + "Model": "Kizuki - Anime Civitai v2 - incl vae", + "steps": 30, + "hashes": { + "vae": "0b204ad0ca", + "model": "662449b537" + }, + "prompt": "(best quality:1.1), (masterpiece:1.4), (absurdres:1.0), portrait, close-up,\n1girl, tania, KizukiAi, dragon girl, dragon horns, red hair, orange eyes, large breasts, long hair, collar, white top, long red skirt, detached sleeves, looking at viewer, oudoors, tavern, (blush:1.1), (smile:1.2),\n", + "sampler": "DDIM", + "cfgScale": 10, + "Clip skip": "2", + "resources": [ + { + "hash": "662449b537", + "name": "Kizuki - Anime Civitai v2 - incl vae", + "type": "model" + } + ], + "Model hash": "662449b537", + "Hires steps": "25", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(low quality:1.4), (worst quality:1.4), (monochrome:0.85),", + "Denoising strength": "0.49" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/25abedbb-3897-485b-ac91-1a4f88af8524/width=450/943860.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UMHxm4=y1FS}?]XRIpxuJ3NHx[aeIBs.j0V[", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 4278167428, + "Model": "Kizuki - Anime Civitai v2 - incl vae", + "steps": 30, + "hashes": { + "vae": "0b204ad0ca", + "model": "662449b537" + }, + "prompt": "(best quality:1.1), (masterpiece:1.4), (absurdres:1.0), cowboy shot,\n1girl, tania, KizukiAi, dragon girl, dragon horns, red hair, orange eyes, large breasts, long hair, collar, white top, (long red skirt:1.2), detached sleeves, thighhighs, dragon tail, looking at viewer, oudoors, forest, (blush:1.1), (smile:1.2), peace sign,\n", + "sampler": "DDIM", + "cfgScale": 10, + "Clip skip": "2", + "resources": [ + { + "hash": "662449b537", + "name": "Kizuki - Anime Civitai v2 - incl vae", + "type": "model" + } + ], + "Model hash": "662449b537", + "Hires steps": "25", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "Variation seed": "2467471608", + "negativePrompt": "(low quality:1.4), (worst quality:1.4), (monochrome:0.85), short skirt, see-through, transparent clothing,", + "Denoising strength": "0.49", + "Variation seed strength": "0.1" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/155fe292-8528-4e97-8d40-ed9c5712504f/width=450/943863.jpeg", + "nsfw": "Soft", + "width": 1536, + "height": 1024, + "hash": "UKJH,IMe0JIVF_M_kp%MIdD~s;jv?wi^IAo4", + "meta": { + "ENSD": "31337", + "Size": "768x512", + "seed": 316792228, + "Model": "Kizuki - Anime Civitai v2 - incl vae", + "steps": 30, + "hashes": { + "vae": "0b204ad0ca", + "model": "662449b537" + }, + "prompt": "best quality, masterpiece, upper body, standing, solo focus,\n1girl, tania, KizukiAi, dragon girl, dragon horns, red hair, orange eyes, large breasts, long hair, cargo shorts, crop top, looking at viewer, village, (blush:1.2), happy, (crowd:0.4), medieval,\n", + "sampler": "DDIM", + "cfgScale": 10, + "Clip skip": "2", + "resources": [ + { + "hash": "662449b537", + "name": "Kizuki - Anime Civitai v2 - incl vae", + "type": "model" + } + ], + "Model hash": "662449b537", + "Hires steps": "25", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "Variation seed": "651581059", + "negativePrompt": "(low quality:1.4), (worst quality:1.4), (monochrome:0.85), wings, dragon tail, collar, white top, long red skirt, detached sleeves", + "Denoising strength": "0.49", + "Variation seed strength": "0.1" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c895e5a9-9aea-46a7-b842-63fb8c28d3c3/width=450/943862.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "UFIXpk}@0_kqyXt6S%V_4mbvkXxa4Tozr?Mx", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2368477156, + "Model": "Kizuki - Anime Civitai v2 - incl vae", + "steps": 30, + "hashes": { + "vae": "0b204ad0ca", + "model": "662449b537" + }, + "prompt": "(best quality:1.1), (masterpiece:1.4), (absurdres:1.0), cowboy shot,\n1girl, tania, KizukiAi, dragon girl, dragon horns, red hair, orange eyes, large breasts, long hair, collar, white top, long red skirt, detached sleeves, thighhighs, dragon tail, looking at viewer, oudoors, forest, (blush:1.1), (grin:1.2), seductive, thong, erotic, naughty face,\n", + "sampler": "DDIM", + "cfgScale": 10, + "Clip skip": "2", + "resources": [ + { + "hash": "662449b537", + "name": "Kizuki - Anime Civitai v2 - incl vae", + "type": "model" + } + ], + "Model hash": "662449b537", + "Hires steps": "25", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "Variation seed": "1784727261", + "negativePrompt": "(low quality:1.4), (worst quality:1.4), (monochrome:0.85),", + "Denoising strength": "0.49", + "Variation seed strength": "0.2" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/93075b90-6d6e-4d8d-9f6c-010b5b56997c/width=450/943861.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1536, + "hash": "UIJj^|?v0dJUTKs=Tdt6KPw|${XS~qt8Z~S5", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1700487217, + "Model": "Kizuki - Anime Civitai v2 - incl vae", + "steps": 30, + "hashes": { + "vae": "0b204ad0ca", + "model": "662449b537" + }, + "prompt": "(best quality:1.1), (masterpiece:1.4), (absurdres:1.0), portrait, close-up,\n1girl, tania, KizukiAi, dragon girl, dragon horns, red hair, orange eyes, large breasts, long hair, collar, white top, long red skirt, detached sleeves, nipples, oudoors, open mouth, (wavy mouth:1.2), (embarrassed:1.1), (blush:1.3), (wide-eyed:1.3), looking at viewer, forest, suprised,\n", + "sampler": "DDIM", + "cfgScale": 10, + "Clip skip": "2", + "resources": [ + { + "hash": "662449b537", + "name": "Kizuki - Anime Civitai v2 - incl vae", + "type": "model" + } + ], + "Model hash": "662449b537", + "Hires steps": "25", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(low quality:1.4), (worst quality:1.4), (monochrome:0.85),", + "Denoising strength": "0.49" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8ecad686-7838-47bf-87f2-2c95c82b863a/width=450/943859.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1536, + "hash": "U6HU??4p00xuCQrX00O@^]nM~Bpc?Y9G00?c", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 598220568, + "Model": "Kizuki - Anime Civitai v2 - incl vae", + "steps": 30, + "hashes": { + "vae": "0b204ad0ca", + "model": "662449b537" + }, + "prompt": "(best quality:1.1), (masterpiece:1.4), (absurdres:1.0),bent over, from behind,\n1girl, tania, KizukiAi, dragon girl, dragon horns, red hair, orange eyes, large breasts, long hair, collar, white top, long red skirt, detached sleeves, thighhighs, looking at viewer, oudoors, forest, (blush:1.1), (seductive smile:1.2), seductive, (anus:1.25), erotic, naughty face,\n", + "sampler": "DDIM", + "cfgScale": 10, + "Clip skip": "2", + "resources": [ + { + "hash": "662449b537", + "name": "Kizuki - Anime Civitai v2 - incl vae", + "type": "model" + } + ], + "Model hash": "662449b537", + "Hires steps": "25", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "Variation seed": "3853881627", + "negativePrompt": "(low quality:1.4), (worst quality:1.4), (monochrome:0.85), dragon tail,", + "Denoising strength": "0.4", + "Variation seed strength": "0.2" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1477fb5a-442d-4519-b966-6257bc5ee70f/width=450/943865.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1536, + "hash": "UcJ%nF~WO?%MRPxaS~bbsAR*I:bHR+R+snWA", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1688117896, + "Model": "Kizuki - Anime Civitai v2 - incl vae", + "steps": 30, + "hashes": { + "vae": "0b204ad0ca", + "model": "662449b537" + }, + "prompt": "best quality, masterpiece, pov, (paizuri:1.4), (penis:1.2), boobjob, 1boy,\n1girl, tania, KizukiAi, dragon girl, dragon horns, red hair, orange eyes, large breasts, long hair, (cum:1.4), (cum on breasts:1.4), excessive cum, smirk, bedroom, cum on body, (blush:1.3), open mouth, happy, smile,\n", + "sampler": "DDIM", + "cfgScale": 10, + "Clip skip": "2", + "resources": [ + { + "hash": "662449b537", + "name": "Kizuki - Anime Civitai v2 - incl vae", + "type": "model" + } + ], + "Model hash": "662449b537", + "Hires steps": "25", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "Variation seed": "1890528222", + "negativePrompt": "(low quality:1.4), (worst quality:1.4), (monochrome:0.85), wings, dragon tail, detached sleeves, collar,", + "Denoising strength": "0.49", + "Variation seed strength": "0.1" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9c479339-397f-4046-8403-a6736f8511b3/width=450/943868.jpeg", + "nsfw": "X", + "width": 1536, + "height": 1536, + "hash": "UMIhT{yE8J?btonlk?t7gi%3xDIUIWx^RjWX", + "meta": { + "ENSD": "31337", + "Size": "768x768", + "seed": 2756779922, + "Model": "Kizuki - Anime Civitai v2 - incl vae", + "steps": 30, + "hashes": { + "vae": "0b204ad0ca", + "model": "662449b537" + }, + "prompt": "(best quality:1.1), (masterpiece:1.4), (absurdres:1.0), full body, dynamic pose,\n1girl, tania, KizukiAi, dragon girl, dragon horns, red hair, orange eyes, large breasts, long hair, micro Bikini, looking at viewer, beach, laughing, open_mouth, (blush:1.3), (wide-eyed:1,4) (wavy mouth:1.2), cleavage, palm tree, water, \n", + "sampler": "DDIM", + "cfgScale": 10, + "Clip skip": "2", + "resources": [ + { + "hash": "662449b537", + "name": "Kizuki - Anime Civitai v2 - incl vae", + "type": "model" + } + ], + "Model hash": "662449b537", + "Hires steps": "25", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "Variation seed": "3452415160", + "negativePrompt": "(low quality:1.4), (worst quality:1.4), (monochrome:0.85), wings, dragon tail, collar, white top, long red skirt, detached sleeves, thighhighs", + "Denoising strength": "0.49", + "Variation seed strength": "0.3" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7f4ed3d4-3086-4756-9fad-dfbe629d1e71/width=450/943866.jpeg", + "nsfw": "Mature", + "width": 1536, + "height": 1536, + "hash": "UMJ[6dkFP;ysB@-VEMX-IU%M-6IUIpOan}s+", + "meta": { + "ENSD": "31337", + "Size": "768x768", + "seed": 2756779922, + "Model": "Kizuki - Anime Civitai v2 - incl vae", + "steps": 30, + "hashes": { + "vae": "0b204ad0ca", + "model": "662449b537" + }, + "prompt": "(best quality:1.1), (masterpiece:1.4), (absurdres:1.0), full body, dynamic pose,\n1girl, tania, KizukiAi, dragon girl, dragon horns, red hair, orange eyes, large breasts, long hair, micro Bikini, looking at viewer, beach, laughing, open_mouth, (blush:1.3), (wide-eyed:1,4) (wavy mouth:1.2), cleavage, palm tree, water, \n", + "sampler": "DDIM", + "cfgScale": 10, + "Clip skip": "2", + "resources": [ + { + "hash": "662449b537", + "name": "Kizuki - Anime Civitai v2 - incl vae", + "type": "model" + } + ], + "Model hash": "662449b537", + "Hires steps": "25", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "Variation seed": "76477065", + "negativePrompt": "(low quality:1.4), (worst quality:1.4), (monochrome:0.85), wings, dragon tail, collar, white top, long red skirt, detached sleeves, thighhighs", + "Denoising strength": "0.49", + "Variation seed strength": "0.49" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/83657" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\350\242\253\345\213\207\350\200\205\351\230\237\344\274\215\345\274\200\351\231\244\347\232\204\351\251\255\345\205\275\344\275\277\357\274\214\351\202\202\351\200\205\344\272\206\346\234\200\345\274\272\347\247\215\347\232\204\347\214\253\350\200\263\345\260\221\345\245\263/Kizuki - Beast Tamer - Tania.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\350\242\253\345\213\207\350\200\205\351\230\237\344\274\215\345\274\200\351\231\244\347\232\204\351\251\255\345\205\275\344\275\277\357\274\214\351\202\202\351\200\205\344\272\206\346\234\200\345\274\272\347\247\215\347\232\204\347\214\253\350\200\263\345\260\221\345\245\263/Kizuki - Beast Tamer - Tania.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..f43e0571bea2fa515dc072fb41665be2907b4d14 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\350\242\253\345\213\207\350\200\205\351\230\237\344\274\215\345\274\200\351\231\244\347\232\204\351\251\255\345\205\275\344\275\277\357\274\214\351\202\202\351\200\205\344\272\206\346\234\200\345\274\272\347\247\215\347\232\204\347\214\253\350\200\263\345\260\221\345\245\263/Kizuki - Beast Tamer - Tania.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\350\242\253\345\213\207\350\200\205\351\230\237\344\274\215\345\274\200\351\231\244\347\232\204\351\251\255\345\205\275\344\275\277\357\274\214\351\202\202\351\200\205\344\272\206\346\234\200\345\274\272\347\247\215\347\232\204\347\214\253\350\200\263\345\260\221\345\245\263/Kizuki - Beast Tamer - Tania.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\350\242\253\345\213\207\350\200\205\351\230\237\344\274\215\345\274\200\351\231\244\347\232\204\351\251\255\345\205\275\344\275\277\357\274\214\351\202\202\351\200\205\344\272\206\346\234\200\345\274\272\347\247\215\347\232\204\347\214\253\350\200\263\345\260\221\345\245\263/Kizuki - Beast Tamer - Tania.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..40426d57bf4b6f7537c524a9fb371ac5e3578a51 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\350\242\253\345\213\207\350\200\205\351\230\237\344\274\215\345\274\200\351\231\244\347\232\204\351\251\255\345\205\275\344\275\277\357\274\214\351\202\202\351\200\205\344\272\206\346\234\200\345\274\272\347\247\215\347\232\204\347\214\253\350\200\263\345\260\221\345\245\263/Kizuki - Beast Tamer - Tania.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:6e5b41f412fd4980586c8b00a8f8655f053ab20d5791dc0f7a57b2b5994e7ceb +size 37861176 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\350\242\253\345\213\207\350\200\205\351\230\237\344\274\215\345\274\200\351\231\244\347\232\204\351\251\255\345\205\275\344\275\277\357\274\214\351\202\202\351\200\205\344\272\206\346\234\200\345\274\272\347\247\215\347\232\204\347\214\253\350\200\263\345\260\221\345\245\263/NAI1_kanadliang-000100.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\350\242\253\345\213\207\350\200\205\351\230\237\344\274\215\345\274\200\351\231\244\347\232\204\351\251\255\345\205\275\344\275\277\357\274\214\351\202\202\351\200\205\344\272\206\346\234\200\345\274\272\347\247\215\347\232\204\347\214\253\350\200\263\345\260\221\345\245\263/NAI1_kanadliang-000100.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..103a72195fd99fc907b437940c9658b2ed5ef66f --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\350\242\253\345\213\207\350\200\205\351\230\237\344\274\215\345\274\200\351\231\244\347\232\204\351\251\255\345\205\275\344\275\277\357\274\214\351\202\202\351\200\205\344\272\206\346\234\200\345\274\272\347\247\215\347\232\204\347\214\253\350\200\263\345\260\221\345\245\263/NAI1_kanadliang-000100.civitai.info" @@ -0,0 +1,391 @@ +{ + "id": 110554, + "modelId": 103245, + "name": "v1.0", + "createdAt": "2023-07-05T01:49:28.860Z", + "updatedAt": "2023-07-05T01:54:52.295Z", + "trainedWords": [ + "kanadliang" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 96, + "ratingCount": 1, + "rating": 5 + }, + "model": { + "name": "Kanade - Beast Tamer - Liang, Beautiful Character Lora !!!", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "NAI1_kanadliang-000100.safetensors", + "id": 78170, + "sizeKB": 36977.662109375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-07-05T01:53:12.488Z", + "hashes": { + "AutoV1": "B6E5C05D", + "AutoV2": "B157080846", + "SHA256": "B157080846246D09601035AA1BE566D8A56772F6AD3ACB8347C410DB87876FAB", + "CRC32": "639E1EAF", + "BLAKE3": "DAF28B18F1DAFAE1286443ED9A86B283A8911467CFEAC792C87DB1DA42D43250" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/110554" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/29944fe7-2c54-42f6-8c69-0e4500b321d6/width=450/1412443.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "UVLghS~p56IUNX%MSgoHk;NIkDs,yD?axFV@", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 4170998509, + "Model": "dorayakimix_v25", + "steps": 30, + "hashes": { + "model": "77ca511f67" + }, + "prompt": "masterpiece, best quality, \nkanadliang, 1girl, solo, light smile, cowboy shot, looking at viewer, outdoors,", + "Version": "v1.2.1", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "77ca511f67", + "name": "dorayakimix_v25", + "type": "model" + }, + { + "hash": "cc74c57fad1a", + "name": "000100", + "type": "lora", + "weight": null + } + ], + "Model hash": "77ca511f67", + "AddNet Enabled": "True", + "AddNet Model 1": "NAI1_kanadliang-000100(cc74c57fad1a)", + "negativePrompt": "EasyNegative, extra fingers, fewer fingers, bad hands, bad anatomy,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.5", + "AddNet Weight B 1": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/cb4d48b6-f4c7-4799-ad4e-fecd86c11492/width=450/1412454.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UCMQO^O90d5UIk4n9uNd%~$zEv?GPW~p^NtR", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1001613007, + "Model": "dorayakimix_v25", + "steps": 30, + "hashes": { + "model": "77ca511f67" + }, + "prompt": "masterpiece, best quality, pov, \nkanadliang, 1girl, solo, cowboy shot, standing, looking at viewer, open mouth, outdoors,", + "Version": "v1.2.1", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "77ca511f67", + "name": "dorayakimix_v25", + "type": "model" + }, + { + "hash": "cc74c57fad1a", + "name": "000100", + "type": "lora", + "weight": null + } + ], + "Model hash": "77ca511f67", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "NAI1_kanadliang-000100(cc74c57fad1a)", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "EasyNegative, extra fingers, fewer fingers, bad hands, bad anatomy,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.7", + "AddNet Weight B 1": "0.7", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/be8d5e7d-0349-4fa0-a911-5f778a223e1f/width=450/1412456.jpeg", + "nsfw": "Soft", + "width": 768, + "height": 1152, + "hash": "UPM%7n~pAIt89FE1E1e-D*M{InbF%MWV%2t7", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1672175223, + "Model": "dorayakimix_v25", + "steps": 30, + "hashes": { + "model": "77ca511f67" + }, + "prompt": "masterpiece, best quality, \nkanadliang, 1girl, solo, wariza, on bed, bare legs, barefoot,", + "Version": "v1.2.1", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "77ca511f67", + "name": "dorayakimix_v25", + "type": "model" + }, + { + "hash": "cc74c57fad1a", + "name": "000100", + "type": "lora", + "weight": null + } + ], + "Model hash": "77ca511f67", + "Hires upscale": "1.5", + "AddNet Enabled": "True", + "AddNet Model 1": "NAI1_kanadliang-000100(cc74c57fad1a)", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "EasyNegative, extra fingers, fewer fingers, bad hands, bad anatomy,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.7", + "AddNet Weight B 1": "0.7", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/442eb946-2a3c-46f8-9f02-acb98754c41f/width=450/1412457.jpeg", + "nsfw": "Soft", + "width": 768, + "height": 1152, + "hash": "UTNcWx~WJB%2xAWBNaRj-pRkWUoc-:kAt6kW", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1055260421, + "Model": "dorayakimix_v25", + "steps": 30, + "hashes": { + "model": "77ca511f67" + }, + "prompt": "masterpiece, best quality, \nkanadliang, 1girl, solo, wariza, on bed, bare legs, barefoot,", + "Version": "v1.2.1", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "77ca511f67", + "name": "dorayakimix_v25", + "type": "model" + }, + { + "hash": "cc74c57fad1a", + "name": "000100", + "type": "lora", + "weight": null + } + ], + "Model hash": "77ca511f67", + "Hires upscale": "1.5", + "AddNet Enabled": "True", + "AddNet Model 1": "NAI1_kanadliang-000100(cc74c57fad1a)", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "EasyNegative, extra fingers, fewer fingers, bad hands, bad anatomy,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.7", + "AddNet Weight B 1": "0.7", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5ed0c894-bc6e-4650-b982-a23208735b33/width=450/1412463.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1280, + "hash": "UhQvRSt7_Nxu?bj[Shj]o~j[M_WVs9a|nijs", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 2155329473, + "Model": "dorayakimix_v25", + "model": "control_v11f1e_sd15_tile [a371b31b]", + "steps": 20, + "hashes": { + "model": "77ca511f67" + }, + "prompt": "masterpiece, best quality,\nkanadliang, 1girl, solo, squatting, spread legs, full body, socks, mary janes, looking at viewer, simple background, white background, open mouth,", + "weight": "1", + "Version": "v1.2.1", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "77ca511f67", + "name": "dorayakimix_v25", + "type": "model" + }, + { + "hash": "cc74c57fad1a", + "name": "000100", + "type": "lora", + "weight": null + } + ], + "Model hash": "77ca511f67", + "resize mode": "Crop and Resize", + "control mode": "My prompt is more important", + "\"preprocessor": "tile_resample", + "Hires upscale": "2", + "pixel perfect": "True", + "AddNet Enabled": "True", + "AddNet Model 1": "NAI1_kanadliang-000100(cc74c57fad1a)", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "EasyNegative, extra fingers, fewer fingers, bad hands, bad anatomy,", + "AddNet Module 1": "LoRA", + "starting/ending": "(0, 1)", + "AddNet Weight A 1": "0.7", + "AddNet Weight B 1": "0.7", + "Denoising strength": "0.5", + "preprocessor params": "(512, 1, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f0ec872b-a3ed-45b7-8775-0e8a1c0ae6e1/width=450/1412473.jpeg", + "nsfw": "None", + "width": 2150, + "height": 4000, + "hash": "URN0*m%g_M~qM{xut7WBRkofWBj?t7ofWBj[", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 77199666, + "Model": "animefull-latest", + "steps": 20, + "Script": "X/Y/Z plot", + "X Type": "AddNet Weight 1", + "Y Type": "AddNet Model 1", + "hashes": { + "model": "a7529df023" + }, + "prompt": "masterpiece, best quality,\nkanadliang, 1girl, solo, cowboy shot, looking at viewer, simple background, white background,", + "Version": "v1.2.1", + "sampler": "DPM++ 2M Karras", + "X Values": "\"0.3,0.4,0.5,0.6,0.7,\"", + "Y Values": "\"None,kanadliang-000060(5470e8b37cfc),kanadliang-000080(7a13ba2139a5),kanadliang-000100(cc74c57fad1a),kanadliang-000120(86cdbcac8a02),kanadliang-000140(4b3378d7370d),kanadliang-000160(5fa96e37693a)\"", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "a7529df023", + "name": "animefull-latest", + "type": "model" + } + ], + "Model hash": "a7529df023", + "negativePrompt": "EasyNegative, extra fingers, fewer fingers, bad hands, bad anatomy," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3353fb87-843f-4b97-b163-63a3448b34cd/width=450/1412491.jpeg", + "nsfw": "None", + "width": 2150, + "height": 4000, + "hash": "UPM7M*_N_3_NkWt6afj[a}WBj[oftQj[oLay", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 77199666, + "Model": "abyssorangemix3AOM3_aom3a1b", + "steps": 20, + "Script": "X/Y/Z plot", + "X Type": "AddNet Weight 1", + "Y Type": "AddNet Model 1", + "hashes": { + "model": "5493a0ec49" + }, + "prompt": "masterpiece, best quality,\nkanadliang, 1girl, solo, cowboy shot, looking at viewer, simple background, white background,", + "Version": "v1.2.1", + "sampler": "DPM++ 2M Karras", + "X Values": "\"0.3,0.4,0.5,0.6,0.7,\"", + "Y Values": "\"None,kanadliang-000060(5470e8b37cfc),kanadliang-000080(7a13ba2139a5),kanadliang-000100(cc74c57fad1a),kanadliang-000120(86cdbcac8a02),kanadliang-000140(4b3378d7370d),kanadliang-000160(5fa96e37693a)\"", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "5493a0ec49", + "name": "abyssorangemix3AOM3_aom3a1b", + "type": "model" + } + ], + "Model hash": "5493a0ec49", + "negativePrompt": "EasyNegative, extra fingers, fewer fingers, bad hands, bad anatomy," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1de77f2d-9d6e-4be2-89c9-a0ae50a80630/width=450/1412492.jpeg", + "nsfw": "Soft", + "width": 2150, + "height": 4000, + "hash": "UPOfx].8?v_NIot7ofbHNHoJWBj[ofofbHoL", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 77199666, + "Model": "dorayakimix_v25", + "steps": 20, + "Script": "X/Y/Z plot", + "X Type": "AddNet Weight 1", + "Y Type": "AddNet Model 1", + "hashes": { + "model": "77ca511f67" + }, + "prompt": "masterpiece, best quality,\nkanadliang, 1girl, solo, cowboy shot, looking at viewer, simple background, white background,", + "Version": "v1.2.1", + "sampler": "DPM++ 2M Karras", + "X Values": "\"0.3,0.4,0.5,0.6,0.7,\"", + "Y Values": "\"None,kanadliang-000060(5470e8b37cfc),kanadliang-000080(7a13ba2139a5),kanadliang-000100(cc74c57fad1a),kanadliang-000120(86cdbcac8a02),kanadliang-000140(4b3378d7370d),kanadliang-000160(5fa96e37693a)\"", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "77ca511f67", + "name": "dorayakimix_v25", + "type": "model" + } + ], + "Model hash": "77ca511f67", + "negativePrompt": "EasyNegative, extra fingers, fewer fingers, bad hands, bad anatomy," + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/110554" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\350\242\253\345\213\207\350\200\205\351\230\237\344\274\215\345\274\200\351\231\244\347\232\204\351\251\255\345\205\275\344\275\277\357\274\214\351\202\202\351\200\205\344\272\206\346\234\200\345\274\272\347\247\215\347\232\204\347\214\253\350\200\263\345\260\221\345\245\263/NAI1_kanadliang-000100.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\350\242\253\345\213\207\350\200\205\351\230\237\344\274\215\345\274\200\351\231\244\347\232\204\351\251\255\345\205\275\344\275\277\357\274\214\351\202\202\351\200\205\344\272\206\346\234\200\345\274\272\347\247\215\347\232\204\347\214\253\350\200\263\345\260\221\345\245\263/NAI1_kanadliang-000100.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..61e96087eabc485139422f209ae2a0c4db96cc38 Binary files /dev/null and "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\350\242\253\345\213\207\350\200\205\351\230\237\344\274\215\345\274\200\351\231\244\347\232\204\351\251\255\345\205\275\344\275\277\357\274\214\351\202\202\351\200\205\344\272\206\346\234\200\345\274\272\347\247\215\347\232\204\347\214\253\350\200\263\345\260\221\345\245\263/NAI1_kanadliang-000100.preview.png" differ diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\350\242\253\345\213\207\350\200\205\351\230\237\344\274\215\345\274\200\351\231\244\347\232\204\351\251\255\345\205\275\344\275\277\357\274\214\351\202\202\351\200\205\344\272\206\346\234\200\345\274\272\347\247\215\347\232\204\347\214\253\350\200\263\345\260\221\345\245\263/NAI1_kanadliang-000100.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\350\242\253\345\213\207\350\200\205\351\230\237\344\274\215\345\274\200\351\231\244\347\232\204\351\251\255\345\205\275\344\275\277\357\274\214\351\202\202\351\200\205\344\272\206\346\234\200\345\274\272\347\247\215\347\232\204\347\214\253\350\200\263\345\260\221\345\245\263/NAI1_kanadliang-000100.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..6441f7722b9e9f6614d35fdd438aa25b9052af09 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\350\242\253\345\213\207\350\200\205\351\230\237\344\274\215\345\274\200\351\231\244\347\232\204\351\251\255\345\205\275\344\275\277\357\274\214\351\202\202\351\200\205\344\272\206\346\234\200\345\274\272\347\247\215\347\232\204\347\214\253\350\200\263\345\260\221\345\245\263/NAI1_kanadliang-000100.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:b157080846246d09601035aa1be566d8a56772f6ad3acb8347c410db87876fab +size 37865126 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\350\242\253\345\213\207\350\200\205\351\230\237\344\274\215\345\274\200\351\231\244\347\232\204\351\251\255\345\205\275\344\275\277\357\274\214\351\202\202\351\200\205\344\272\206\346\234\200\345\274\272\347\247\215\347\232\204\347\214\253\350\200\263\345\260\221\345\245\263/beastTamerGirlpack_01.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\350\242\253\345\213\207\350\200\205\351\230\237\344\274\215\345\274\200\351\231\244\347\232\204\351\251\255\345\205\275\344\275\277\357\274\214\351\202\202\351\200\205\344\272\206\346\234\200\345\274\272\347\247\215\347\232\204\347\214\253\350\200\263\345\260\221\345\245\263/beastTamerGirlpack_01.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..e254e5fc3914e6bea38bfe39b00cdab05ffa5a07 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\350\242\253\345\213\207\350\200\205\351\230\237\344\274\215\345\274\200\351\231\244\347\232\204\351\251\255\345\205\275\344\275\277\357\274\214\351\202\202\351\200\205\344\272\206\346\234\200\345\274\272\347\247\215\347\232\204\347\214\253\350\200\263\345\260\221\345\245\263/beastTamerGirlpack_01.civitai.info" @@ -0,0 +1,439 @@ +{ + "id": 54906, + "modelId": 50377, + "name": "0.1", + "createdAt": "2023-04-25T10:05:06.151Z", + "updatedAt": "2023-04-25T10:08:26.065Z", + "trainedWords": [ + "See \"Girl List\"" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 50, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Beast Tamer - Girlpack LoRA", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "beastTamerGirlpack_01.safetensors", + "id": 39598, + "sizeKB": 295026.6328125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-25T10:19:49.068Z", + "hashes": { + "AutoV1": "A6F67CB3", + "AutoV2": "8E09C9BAC9", + "SHA256": "8E09C9BAC97DFF6C5512DFDB2093A3F978528C68AACAA4A7457DFCDD48EF4D63", + "CRC32": "3C439BC6", + "BLAKE3": "9084F6A1B9A6E75AD6C0BF73D2A7E11027FB35F6D37B69D4B4C37B2048B7ED28" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/54906" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9b1dbb2b-51fa-43a1-8f48-445a3ba52500/width=450/593943.jpeg", + "nsfw": false, + "width": 2828, + "height": 4000, + "hash": "UCJ7p]-6=;R6=ERiT1tm%3Ng_2IA~W%0D%IT", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d95aadd8-2fe9-45a7-1852-4db47cc3d200/width=450/593945.jpeg", + "nsfw": false, + "width": 960, + "height": 1440, + "hash": "UEJtk#000z-40Kv#t.v{t:IT-oS{Ecxtw5R%", + "meta": { + "Size": "480x720", + "seed": 1182997709, + "Model": "abyssorangemix2_Hard", + "steps": 20, + "hashes": { + "model": "e714ee20aa" + }, + "prompt": "kanade, anime art style, 1girl, solo, long_hair, breasts, looking_at_viewer, smile, bangs, brown_hair, shirt, dress, ribbon, animal_ears, bare_shoulders, very_long_hair, closed_mouth, green_eyes, collarbone, hair_ribbon, short_sleeves, outdoors, sky, day, belt, cloud, cat_ears, red_ribbon, blue_sky, animal_ear_fluff, :3, arms_behind_back, pouch, yellow_shirt, belt_pouch", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "e714ee20aa", + "name": "abyssorangemix2_Hard", + "type": "model" + }, + { + "hash": "18ee2c100cb7", + "name": "000006", + "type": "lora", + "weight": null + } + ], + "Model hash": "e714ee20aa", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "BeastTamer_Girlpack_v1-000006(18ee2c100cb7)", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "multiple girls, lowres, text, error, missing arms, missing legs, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, jpeg artifacts, signature, watermark, out of frame, extra fingers, mutated hands, (poorly drawn hands), (poorly drawn face), (mutation), (deformed breasts), (ugly), blurry, (bad anatomy), (bad proportions), (extra limbs), cloned face, flat color, monochrome, limited palette", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.4", + "AddNet Weight B 1": "0.4", + "Denoising strength": "0.6" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6dd10647-d11d-406a-0793-189818a96e00/width=450/593944.jpeg", + "nsfw": false, + "width": 960, + "height": 1440, + "hash": "UfDmO7?wyDs..Tx^o#adout6oJayMxninloz", + "meta": { + "Size": "480x720", + "seed": 439345676, + "Model": "abyssorangemix2_Hard", + "steps": 20, + "hashes": { + "model": "e714ee20aa" + }, + "prompt": "leane, anime art style, 1girl, solo, long_hair, looking_at_viewer, bangs, hat, closed_mouth, purple_eyes, purple_hair, outdoors, v-shaped_eyebrows, black_headwear, frown, portrait", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "e714ee20aa", + "name": "abyssorangemix2_Hard", + "type": "model" + }, + { + "hash": "18ee2c100cb7", + "name": "000006", + "type": "lora", + "weight": null + } + ], + "Model hash": "e714ee20aa", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "BeastTamer_Girlpack_v1-000006(18ee2c100cb7)", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "multiple girls, lowres, text, error, missing arms, missing legs, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, jpeg artifacts, signature, watermark, out of frame, extra fingers, mutated hands, (poorly drawn hands), (poorly drawn face), (mutation), (deformed breasts), (ugly), blurry, (bad anatomy), (bad proportions), (extra limbs), cloned face, flat color, monochrome, limited palette", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.4", + "AddNet Weight B 1": "0.4", + "Denoising strength": "0.6" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/94f5b925-24e0-498a-632b-329081280800/width=450/593947.jpeg", + "nsfw": false, + "width": 960, + "height": 1440, + "hash": "UAKKA#0000s@DzIv%$H@5@9Z}[W8Ep%EeZIn", + "meta": { + "Size": "480x720", + "seed": 807521124, + "Model": "abyssorangemix2_Hard", + "steps": 20, + "hashes": { + "model": "e714ee20aa" + }, + "prompt": "luna, anime art style, 1girl, solo, looking_at_viewer, blush, bangs, blue_eyes, blonde_hair, hair_ornament, dress, bare_shoulders, closed_mouth, collarbone, upper_body, ponytail, flower, hair_flower, medium_hair, off_shoulder, white_dress, blurry, blurry_background, blue_flower", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "e714ee20aa", + "name": "abyssorangemix2_Hard", + "type": "model" + }, + { + "hash": "18ee2c100cb7", + "name": "000006", + "type": "lora", + "weight": null + } + ], + "Model hash": "e714ee20aa", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "BeastTamer_Girlpack_v1-000006(18ee2c100cb7)", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "multiple girls, lowres, text, error, missing arms, missing legs, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, jpeg artifacts, signature, watermark, out of frame, extra fingers, mutated hands, (poorly drawn hands), (poorly drawn face), (mutation), (deformed breasts), (ugly), blurry, (bad anatomy), (bad proportions), (extra limbs), cloned face, flat color, monochrome, limited palette", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.4", + "AddNet Weight B 1": "0.4", + "Denoising strength": "0.6" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/95237bfb-01d9-4e1d-899f-71dd4894fd00/width=450/593953.jpeg", + "nsfw": false, + "width": 960, + "height": 1440, + "hash": "UBG8D$t-4TrB^s+h1Pac+YIV?I?a9bF2~U-n", + "meta": { + "Size": "480x720", + "seed": 3388139160, + "Model": "abyssorangemix2_Hard", + "steps": 20, + "hashes": { + "model": "e714ee20aa" + }, + "prompt": "mina, anime art style, 1girl, solo, long_hair, breasts, looking_at_viewer, bangs, blue_eyes, blonde_hair, long_sleeves, dress, jewelry, medium_breasts, closed_mouth, upper_body, hairband, indoors, necklace, blue_dress, cross, nun, habit, cross_necklace", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "e714ee20aa", + "name": "abyssorangemix2_Hard", + "type": "model" + }, + { + "hash": "18ee2c100cb7", + "name": "000006", + "type": "lora", + "weight": null + } + ], + "Model hash": "e714ee20aa", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "BeastTamer_Girlpack_v1-000006(18ee2c100cb7)", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "multiple girls, lowres, text, error, missing arms, missing legs, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, jpeg artifacts, signature, watermark, out of frame, extra fingers, mutated hands, (poorly drawn hands), (poorly drawn face), (mutation), (deformed breasts), (ugly), blurry, (bad anatomy), (bad proportions), (extra limbs), cloned face, flat color, monochrome, limited palette", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.4", + "AddNet Weight B 1": "0.4", + "Denoising strength": "0.6" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/07fddaaa-a489-4902-6bed-33c0ec3fc700/width=450/593948.jpeg", + "nsfw": false, + "width": 960, + "height": 1440, + "hash": "UNJ726xs0L~AE#bu%1oyMf%1-nfhSvRls;Na", + "meta": { + "Size": "480x720", + "seed": 4014102369, + "Model": "abyssorangemix2_Hard", + "steps": 20, + "hashes": { + "model": "e714ee20aa" + }, + "prompt": "natalie, anime art style, 1girl, solo, long_hair, smile, open_mouth, bangs, brown_hair, shirt, long_sleeves, hat, holding, brown_eyes, collarbone, white_shirt, upper_body, braid, :d, indoors, book, single_braid, beret, green_headwear", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "e714ee20aa", + "name": "abyssorangemix2_Hard", + "type": "model" + }, + { + "hash": "18ee2c100cb7", + "name": "000006", + "type": "lora", + "weight": null + } + ], + "Model hash": "e714ee20aa", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "BeastTamer_Girlpack_v1-000006(18ee2c100cb7)", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "multiple girls, lowres, text, error, missing arms, missing legs, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, jpeg artifacts, signature, watermark, out of frame, extra fingers, mutated hands, (poorly drawn hands), (poorly drawn face), (mutation), (deformed breasts), (ugly), blurry, (bad anatomy), (bad proportions), (extra limbs), cloned face, flat color, monochrome, limited palette", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.4", + "AddNet Weight B 1": "0.4", + "Denoising strength": "0.6" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/791c5b00-8e8f-4020-d216-b593b2f17500/width=450/593950.jpeg", + "nsfw": false, + "width": 960, + "height": 1440, + "hash": "UEK,~S]o00={4-~AE9M{Ty58~A%MBord%Ls9", + "meta": { + "Size": "480x720", + "seed": 1344582010, + "Model": "abyssorangemix2_Hard", + "steps": 20, + "hashes": { + "model": "e714ee20aa" + }, + "prompt": "nina, anime art style, 1girl, solo, long_hair, looking_at_viewer, blush, bangs, blonde_hair, animal_ears, bare_shoulders, closed_mouth, collarbone, yellow_eyes, upper_body, sidelocks, detached_sleeves, japanese_clothes, sleeveless, indoors, kimono, blurry, animal_ear_fluff, fox_ears, blurry_background, fox_girl, hair_rings, white_sleeves, sleeveless_kimono", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "e714ee20aa", + "name": "abyssorangemix2_Hard", + "type": "model" + }, + { + "hash": "18ee2c100cb7", + "name": "000006", + "type": "lora", + "weight": null + } + ], + "Model hash": "e714ee20aa", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "BeastTamer_Girlpack_v1-000006(18ee2c100cb7)", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "multiple girls, lowres, text, error, missing arms, missing legs, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, jpeg artifacts, signature, watermark, out of frame, extra fingers, mutated hands, (poorly drawn hands), (poorly drawn face), (mutation), (deformed breasts), (ugly), blurry, (bad anatomy), (bad proportions), (extra limbs), cloned face, flat color, monochrome, limited palette", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.4", + "AddNet Weight B 1": "0.4", + "Denoising strength": "0.6" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/cec96705-0f4b-4055-fa6a-eeaa936b9100/width=450/593946.jpeg", + "nsfw": false, + "width": 960, + "height": 1440, + "hash": "UUJaJ:~B00WC$wxZENIptRIpIoNH9Gof%2R*", + "meta": { + "Size": "480x720", + "seed": 511931870, + "Model": "abyssorangemix2_Hard", + "steps": 20, + "hashes": { + "model": "e714ee20aa" + }, + "prompt": "sora, anime art style, 1girl, solo, long_hair, smile, bangs, blue_eyes, blonde_hair, hair_ornament, dress, bare_shoulders, closed_mouth, collarbone, upper_body, ponytail, braid, flower, hair_flower, off_shoulder, white_dress, hands_up, rose, own_hands_together, high_ponytail, black_background, brown_background, blue_flower, off-shoulder_dress, blue_rose", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "e714ee20aa", + "name": "abyssorangemix2_Hard", + "type": "model" + }, + { + "hash": "18ee2c100cb7", + "name": "000006", + "type": "lora", + "weight": null + } + ], + "Model hash": "e714ee20aa", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "BeastTamer_Girlpack_v1-000006(18ee2c100cb7)", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "multiple girls, lowres, text, error, missing arms, missing legs, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, jpeg artifacts, signature, watermark, out of frame, extra fingers, mutated hands, (poorly drawn hands), (poorly drawn face), (mutation), (deformed breasts), (ugly), blurry, (bad anatomy), (bad proportions), (extra limbs), cloned face, flat color, monochrome, limited palette", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.4", + "AddNet Weight B 1": "0.4", + "Denoising strength": "0.6" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/737f7e55-ddfd-44a7-2983-c9d649767e00/width=450/593952.jpeg", + "nsfw": false, + "width": 960, + "height": 1440, + "hash": "UVKdSf9y_N%N~VNG%g%158IUIVs+IVE2xuad", + "meta": { + "Size": "480x720", + "seed": 2650196092, + "Model": "abyssorangemix2_Hard", + "steps": 20, + "hashes": { + "model": "e714ee20aa" + }, + "prompt": "stella, anime art style, 1girl, solo, long_hair, looking_at_viewer, smile, bangs, blue_eyes, blonde_hair, hat, closed_mouth, armor, portrait", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "e714ee20aa", + "name": "abyssorangemix2_Hard", + "type": "model" + }, + { + "hash": "18ee2c100cb7", + "name": "000006", + "type": "lora", + "weight": null + } + ], + "Model hash": "e714ee20aa", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "BeastTamer_Girlpack_v1-000006(18ee2c100cb7)", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "multiple girls, lowres, text, error, missing arms, missing legs, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, jpeg artifacts, signature, watermark, out of frame, extra fingers, mutated hands, (poorly drawn hands), (poorly drawn face), (mutation), (deformed breasts), (ugly), blurry, (bad anatomy), (bad proportions), (extra limbs), cloned face, flat color, monochrome, limited palette", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.4", + "AddNet Weight B 1": "0.4", + "Denoising strength": "0.6" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3db0b9ff-fd76-4677-611f-f5c2e61bed00/width=450/593949.jpeg", + "nsfw": false, + "width": 960, + "height": 1440, + "hash": "UaI|UT_2x]n+~V-:OXxZVsNGI:sAE1NGniV@", + "meta": { + "Size": "480x720", + "seed": 1106303223, + "Model": "abyssorangemix2_Hard", + "steps": 20, + "hashes": { + "model": "e714ee20aa" + }, + "prompt": "tania, anime art style, 1girl, solo, long_hair, breasts, looking_at_viewer, smile, bangs, dress, hair_between_eyes, bare_shoulders, closed_mouth, yellow_eyes, upper_body, red_hair, detached_sleeves, horns, sleeveless, indoors, white_dress, blurry, v-shaped_eyebrows, orange_eyes, blurry_background, white_sleeves", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "e714ee20aa", + "name": "abyssorangemix2_Hard", + "type": "model" + }, + { + "hash": "18ee2c100cb7", + "name": "000006", + "type": "lora", + "weight": null + } + ], + "Model hash": "e714ee20aa", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "BeastTamer_Girlpack_v1-000006(18ee2c100cb7)", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "multiple girls, lowres, text, error, missing arms, missing legs, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, jpeg artifacts, signature, watermark, out of frame, extra fingers, mutated hands, (poorly drawn hands), (poorly drawn face), (mutation), (deformed breasts), (ugly), blurry, (bad anatomy), (bad proportions), (extra limbs), cloned face, flat color, monochrome, limited palette", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.4", + "AddNet Weight B 1": "0.4", + "Denoising strength": "0.6" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/54906" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\350\242\253\345\213\207\350\200\205\351\230\237\344\274\215\345\274\200\351\231\244\347\232\204\351\251\255\345\205\275\344\275\277\357\274\214\351\202\202\351\200\205\344\272\206\346\234\200\345\274\272\347\247\215\347\232\204\347\214\253\350\200\263\345\260\221\345\245\263/beastTamerGirlpack_01.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\350\242\253\345\213\207\350\200\205\351\230\237\344\274\215\345\274\200\351\231\244\347\232\204\351\251\255\345\205\275\344\275\277\357\274\214\351\202\202\351\200\205\344\272\206\346\234\200\345\274\272\347\247\215\347\232\204\347\214\253\350\200\263\345\260\221\345\245\263/beastTamerGirlpack_01.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..333a9225b24c66e5d5a169c1046450e45d6372cc --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\350\242\253\345\213\207\350\200\205\351\230\237\344\274\215\345\274\200\351\231\244\347\232\204\351\251\255\345\205\275\344\275\277\357\274\214\351\202\202\351\200\205\344\272\206\346\234\200\345\274\272\347\247\215\347\232\204\347\214\253\350\200\263\345\260\221\345\245\263/beastTamerGirlpack_01.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:043855fcccc9f974444afba34ed399ce134b1dc35d808fcff7e0eb8207911a0c +size 2397333 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\350\242\253\345\213\207\350\200\205\351\230\237\344\274\215\345\274\200\351\231\244\347\232\204\351\251\255\345\205\275\344\275\277\357\274\214\351\202\202\351\200\205\344\272\206\346\234\200\345\274\272\347\247\215\347\232\204\347\214\253\350\200\263\345\260\221\345\245\263/beastTamerGirlpack_01.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\350\242\253\345\213\207\350\200\205\351\230\237\344\274\215\345\274\200\351\231\244\347\232\204\351\251\255\345\205\275\344\275\277\357\274\214\351\202\202\351\200\205\344\272\206\346\234\200\345\274\272\347\247\215\347\232\204\347\214\253\350\200\263\345\260\221\345\245\263/beastTamerGirlpack_01.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..0f7a58254f1ed284fdd1134450900c8b3b32e718 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\350\242\253\345\213\207\350\200\205\351\230\237\344\274\215\345\274\200\351\231\244\347\232\204\351\251\255\345\205\275\344\275\277\357\274\214\351\202\202\351\200\205\344\272\206\346\234\200\345\274\272\347\247\215\347\232\204\347\214\253\350\200\263\345\260\221\345\245\263/beastTamerGirlpack_01.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:8e09c9bac97dff6c5512dfdb2093a3f978528c68aacaa4a7457dfcdd48ef4d63 +size 302107272 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\350\242\253\350\247\243\351\233\207\347\232\204\346\232\227\351\273\221\345\243\253\345\205\265\357\274\21030\345\244\232\345\262\201\357\274\211\345\274\200\345\247\213\344\272\206\346\205\242\347\224\237\346\264\273\347\232\204\347\254\254\344\272\214\344\272\272\347\224\237/chillinInMy30sAfterGetting_01.civitai.info" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\350\242\253\350\247\243\351\233\207\347\232\204\346\232\227\351\273\221\345\243\253\345\205\265\357\274\21030\345\244\232\345\262\201\357\274\211\345\274\200\345\247\213\344\272\206\346\205\242\347\224\237\346\264\273\347\232\204\347\254\254\344\272\214\344\272\272\347\224\237/chillinInMy30sAfterGetting_01.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..b2c81d8348b8ee1692612a95ed568d6a6088e55b --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\350\242\253\350\247\243\351\233\207\347\232\204\346\232\227\351\273\221\345\243\253\345\205\265\357\274\21030\345\244\232\345\262\201\357\274\211\345\274\200\345\247\213\344\272\206\346\205\242\347\224\237\346\264\273\347\232\204\347\254\254\344\272\214\344\272\272\347\224\237/chillinInMy30sAfterGetting_01.civitai.info" @@ -0,0 +1,275 @@ +{ + "id": 50595, + "modelId": 45977, + "name": "0.1", + "createdAt": "2023-04-20T09:16:21.265Z", + "updatedAt": "2023-04-20T09:22:18.847Z", + "trainedWords": [ + "doroye", + "marika", + "redi", + "satome", + "zebiantes" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 88, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Chillin\u2019 in My 30s after Getting Fired from the Demon King\u2019s Army - Girlpack LoRA", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "chillinInMy30sAfterGetting_01.safetensors", + "id": 37065, + "sizeKB": 295025.947265625, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-20T09:21:05.450Z", + "hashes": { + "AutoV1": "FA869920", + "AutoV2": "A922C34E16", + "SHA256": "A922C34E16DB743D6C958C095E00665DCF7D23BBE27ABABCDF85821E25786716", + "CRC32": "CCA7FE1D", + "BLAKE3": "AD24F4A378207B1CCBB54A8A3ABA3EE057E84C7A48509EB53F66A8DA57D7B2D6" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/50595" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6fd9a72c-c4fc-4d11-e8a6-4e57f2261100/width=450/544064.jpeg", + "nsfw": true, + "width": 2828, + "height": 4000, + "hash": "U9LDuxVZ00_N00.-pen2BU=rkqxYtQ-.^iS~", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1f8c2151-46b1-440a-338a-0e2526ab6b00/width=450/544073.jpeg", + "nsfw": true, + "width": 960, + "height": 1440, + "hash": "ULK1H@Xm00~q4n%N%i%14:RPMyWANGWAxWRj", + "meta": { + "Size": "480x720", + "seed": 637090534, + "Model": "abyssorangemix2_Hard", + "steps": 20, + "hashes": { + "model": "e714ee20aa" + }, + "prompt": "doroye, anime art style, 1girl, long_hair, breasts, looking_at_viewer, blonde_hair, large_breasts, gloves, dress, cleavage, bare_shoulders, purple_eyes, braid, twin_braids, parody, circlet", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "e714ee20aa", + "name": "abyssorangemix2_Hard", + "type": "model" + }, + { + "hash": "5d99f3d54bd5", + "name": "000001", + "type": "lora", + "weight": null + } + ], + "Model hash": "e714ee20aa", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "DemonArmy_girlpack_v1-000001(5d99f3d54bd5)", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "multiple girls, lowres, text, error, missing arms, missing legs, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, jpeg artifacts, signature, watermark, out of frame, extra fingers, mutated hands, (poorly drawn hands), (poorly drawn face), (mutation), (deformed breasts), (ugly), blurry, (bad anatomy), (bad proportions), (extra limbs), cloned face, flat color, monochrome, limited palette", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.4", + "AddNet Weight B 1": "0.4", + "Denoising strength": "0.6" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d632cae8-25dd-40aa-dc27-9bf6a3d98d00/width=450/544066.jpeg", + "nsfw": true, + "width": 960, + "height": 1440, + "hash": "UHK,Np010f$e~qr=cFVE^*NHE2WB5SRjsBbu", + "meta": { + "Size": "480x720", + "seed": 1099363356, + "Model": "abyssorangemix2_Hard", + "steps": 20, + "hashes": { + "model": "e714ee20aa" + }, + "prompt": "marika, anime art style, 1girl, solo, long_hair, breasts, blush, bangs, large_breasts, cleavage, collarbone, upper_body, braid, ahoge, short_sleeves, choker, puffy_sleeves, indoors, orange_hair, puffy_short_sleeves, frown, anime_coloring", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "e714ee20aa", + "name": "abyssorangemix2_Hard", + "type": "model" + }, + { + "hash": "5d99f3d54bd5", + "name": "000001", + "type": "lora", + "weight": null + } + ], + "Model hash": "e714ee20aa", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "DemonArmy_girlpack_v1-000001(5d99f3d54bd5)", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "multiple girls, lowres, text, error, missing arms, missing legs, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, jpeg artifacts, signature, watermark, out of frame, extra fingers, mutated hands, (poorly drawn hands), (poorly drawn face), (mutation), (deformed breasts), (ugly), blurry, (bad anatomy), (bad proportions), (extra limbs), cloned face, flat color, monochrome, limited palette", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.4", + "AddNet Weight B 1": "0.4", + "Denoising strength": "0.6" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/af4cd80c-d106-48b4-8668-473963a14a00/width=450/544068.jpeg", + "nsfw": true, + "width": 960, + "height": 1440, + "hash": "UEIW$RIq0K_1_JIo0O^*0MW@Irsj4.s+~AI=", + "meta": { + "Size": "480x720", + "seed": 268889989, + "Model": "abyssorangemix2_Hard", + "steps": 20, + "hashes": { + "model": "e714ee20aa" + }, + "prompt": "redi, anime art style, 1girl, long_hair, breasts, blonde_hair, brown_hair, 1boy, cleavage, medium_breasts, purple_eyes, collarbone, sky, window, night, frown, star_(sky)", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "e714ee20aa", + "name": "abyssorangemix2_Hard", + "type": "model" + }, + { + "hash": "5d99f3d54bd5", + "name": "000001", + "type": "lora", + "weight": null + } + ], + "Model hash": "e714ee20aa", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "DemonArmy_girlpack_v1-000001(5d99f3d54bd5)", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "multiple girls, lowres, text, error, missing arms, missing legs, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, jpeg artifacts, signature, watermark, out of frame, extra fingers, mutated hands, (poorly drawn hands), (poorly drawn face), (mutation), (deformed breasts), (ugly), blurry, (bad anatomy), (bad proportions), (extra limbs), cloned face, flat color, monochrome, limited palette", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.4", + "AddNet Weight B 1": "0.4", + "Denoising strength": "0.6" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/761c107f-d9e9-442f-9ada-4dbb76ba2500/width=450/544067.jpeg", + "nsfw": false, + "width": 960, + "height": 1440, + "hash": "UmI#$3.TEgM|%LWZtSxuNGRjf4n$o~a#e,ae", + "meta": { + "Size": "480x720", + "seed": 1574324110, + "Model": "abyssorangemix2_Hard", + "steps": 20, + "hashes": { + "model": "e714ee20aa" + }, + "prompt": "satome, anime art style, 1girl, solo, blush, short_hair, bangs, blue_eyes, blonde_hair, brown_hair, upper_body, outdoors, sky, day, cloud, sweatdrop, armor, blue_sky, parody, looking_up, shoulder_armor, breastplate", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "e714ee20aa", + "name": "abyssorangemix2_Hard", + "type": "model" + }, + { + "hash": "5d99f3d54bd5", + "name": "000001", + "type": "lora", + "weight": null + } + ], + "Model hash": "e714ee20aa", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "DemonArmy_girlpack_v1-000001(5d99f3d54bd5)", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "multiple girls, lowres, text, error, missing arms, missing legs, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, jpeg artifacts, signature, watermark, out of frame, extra fingers, mutated hands, (poorly drawn hands), (poorly drawn face), (mutation), (deformed breasts), (ugly), blurry, (bad anatomy), (bad proportions), (extra limbs), cloned face, flat color, monochrome, limited palette", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.4", + "AddNet Weight B 1": "0.4", + "Denoising strength": "0.6" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/db5223dc-6d4c-4c34-3c11-7bf8c94ff400/width=450/544069.jpeg", + "nsfw": true, + "width": 960, + "height": 1440, + "hash": "UTF?-2x[0eD*L4R%-rxZXCR:kEs+SkohxuNa", + "meta": { + "Size": "480x720", + "seed": 2192029804, + "Model": "abyssorangemix2_Hard", + "steps": 20, + "hashes": { + "model": "e714ee20aa" + }, + "prompt": "zebiantes, anime art style, 1girl, solo, long_hair, breasts, open_mouth, blue_eyes, large_breasts, gloves, cleavage, hair_between_eyes, very_long_hair, green_eyes, collarbone, swimsuit, outdoors, green_hair, sky, day, elbow_gloves, cloud, leotard, blue_sky", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "e714ee20aa", + "name": "abyssorangemix2_Hard", + "type": "model" + }, + { + "hash": "5d99f3d54bd5", + "name": "000001", + "type": "lora", + "weight": null + } + ], + "Model hash": "e714ee20aa", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "DemonArmy_girlpack_v1-000001(5d99f3d54bd5)", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "multiple girls, lowres, text, error, missing arms, missing legs, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, jpeg artifacts, signature, watermark, out of frame, extra fingers, mutated hands, (poorly drawn hands), (poorly drawn face), (mutation), (deformed breasts), (ugly), blurry, (bad anatomy), (bad proportions), (extra limbs), cloned face, flat color, monochrome, limited palette", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.4", + "AddNet Weight B 1": "0.4", + "Denoising strength": "0.6" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/50595" +} \ No newline at end of file diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\350\242\253\350\247\243\351\233\207\347\232\204\346\232\227\351\273\221\345\243\253\345\205\265\357\274\21030\345\244\232\345\262\201\357\274\211\345\274\200\345\247\213\344\272\206\346\205\242\347\224\237\346\264\273\347\232\204\347\254\254\344\272\214\344\272\272\347\224\237/chillinInMy30sAfterGetting_01.preview.png" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\350\242\253\350\247\243\351\233\207\347\232\204\346\232\227\351\273\221\345\243\253\345\205\265\357\274\21030\345\244\232\345\262\201\357\274\211\345\274\200\345\247\213\344\272\206\346\205\242\347\224\237\346\264\273\347\232\204\347\254\254\344\272\214\344\272\272\347\224\237/chillinInMy30sAfterGetting_01.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..bf2f2a9c01dde3905db19741f99b89cdcfaad985 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\350\242\253\350\247\243\351\233\207\347\232\204\346\232\227\351\273\221\345\243\253\345\205\265\357\274\21030\345\244\232\345\262\201\357\274\211\345\274\200\345\247\213\344\272\206\346\205\242\347\224\237\346\264\273\347\232\204\347\254\254\344\272\214\344\272\272\347\224\237/chillinInMy30sAfterGetting_01.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:c4d1a1baa82e15374771d6ca49259bd8b578d164ca6356bd7ea90d54b0c608f0 +size 1851112 diff --git "a/A-\350\241\250\347\225\252\350\247\222\350\211\262/\350\242\253\350\247\243\351\233\207\347\232\204\346\232\227\351\273\221\345\243\253\345\205\265\357\274\21030\345\244\232\345\262\201\357\274\211\345\274\200\345\247\213\344\272\206\346\205\242\347\224\237\346\264\273\347\232\204\347\254\254\344\272\214\344\272\272\347\224\237/chillinInMy30sAfterGetting_01.safetensors" "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\350\242\253\350\247\243\351\233\207\347\232\204\346\232\227\351\273\221\345\243\253\345\205\265\357\274\21030\345\244\232\345\262\201\357\274\211\345\274\200\345\247\213\344\272\206\346\205\242\347\224\237\346\264\273\347\232\204\347\254\254\344\272\214\344\272\272\347\224\237/chillinInMy30sAfterGetting_01.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..d02460b3d425cca761a731bc1a6a5c7f8e451fe2 --- /dev/null +++ "b/A-\350\241\250\347\225\252\350\247\222\350\211\262/\350\242\253\350\247\243\351\233\207\347\232\204\346\232\227\351\273\221\345\243\253\345\205\265\357\274\21030\345\244\232\345\262\201\357\274\211\345\274\200\345\247\213\344\272\206\346\205\242\347\224\237\346\264\273\347\232\204\347\254\254\344\272\214\344\272\272\347\224\237/chillinInMy30sAfterGetting_01.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:a922c34e16db743d6c958c095e00665dcf7d23bbe27ababcdf85821e25786716 +size 302106570