diff --git a/.gitattributes b/.gitattributes index 40df540d65ef1f22c4b727c2480f06cdf5fb69af..2e552558f9bfa2a00fa3f0667301979dbb5cbcf3 100644 --- a/.gitattributes +++ b/.gitattributes @@ -143,3 +143,39 @@ F-服装配饰/东南亚式/thaiHighSchool_thaiHighSchool.preview.png filter=lfs F-服装配饰/东南亚式/thaiUniversity_v10.preview.png filter=lfs diff=lfs merge=lfs -text F-服装配饰/东南亚式/trueseifuku_proto.preview.png filter=lfs diff=lfs merge=lfs -text F-服装配饰/东南亚式/virgin_destroyer_sweaterV_Conv2D.preview.png filter=lfs diff=lfs merge=lfs -text +H-角色相关/表情引导/shadedFaceEyesIn_shadedFace.preview.png filter=lfs diff=lfs merge=lfs -text +H-角色相关/场景引导/BDSMArmbinders.preview.png filter=lfs diff=lfs merge=lfs -text +H-角色相关/场景引导/caughtCheatingNTR_v03d.preview.png filter=lfs diff=lfs merge=lfs -text +H-角色相关/场景引导/ClothingAdjuster3.preview.png filter=lfs diff=lfs merge=lfs -text +H-角色相关/场景引导/ConceptCrucifixion_crucifixionv1000006.preview.png filter=lfs diff=lfs merge=lfs -text +H-角色相关/场景引导/conceptLargerInsertion_v10.preview.png filter=lfs diff=lfs merge=lfs -text +H-角色相关/场景引导/ConceptMarilynMonroeDressTug_v10.preview.png filter=lfs diff=lfs merge=lfs -text +H-角色相关/场景引导/ConceptMechanicalStationary_v1.preview.png filter=lfs diff=lfs merge=lfs -text +H-角色相关/动作引导/acrossTableConcept_v10.preview.png filter=lfs diff=lfs merge=lfs -text +H-角色相关/动作引导/adjusting_clothes_ass_v0.1.preview.png filter=lfs diff=lfs merge=lfs -text +H-角色相关/动作引导/ArtistLORATomuTomubobu_doggystyleAllFoursStanding.preview.png filter=lfs diff=lfs merge=lfs -text +H-角色相关/动作引导/ass_worship_v0.5a.preview.png filter=lfs diff=lfs merge=lfs -text +H-角色相关/动作引导/assOnGlasses_v10.preview.png filter=lfs diff=lfs merge=lfs -text +H-角色相关/动作引导/bikinipull.preview.png filter=lfs diff=lfs merge=lfs -text +H-角色相关/动作引导/bouncingBreasts_v1.preview.png filter=lfs diff=lfs merge=lfs -text +H-角色相关/动作引导/breastsUndress_v13.preview.png filter=lfs diff=lfs merge=lfs -text +H-角色相关/动作引导/chinchinpose_v10.preview.png filter=lfs diff=lfs merge=lfs -text +H-角色相关/动作引导/coinPendulumHypnosisSex_v10.preview.png filter=lfs diff=lfs merge=lfs -text +H-角色相关/面部引导/asianGirlsFace_v1.preview.png filter=lfs diff=lfs merge=lfs -text +H-角色相关/面部引导/cuteAsianFace_v10.preview.png filter=lfs diff=lfs merge=lfs -text +H-角色相关/面部引导/hipoly3DModelLora_v20.preview.png filter=lfs diff=lfs merge=lfs -text +H-角色相关/面部引导/japaneseAnimeStyle1_japaneseAnimeStyle1.preview.png filter=lfs diff=lfs merge=lfs -text +H-角色相关/面部引导/japaneseDollLikeness_v10.preview.png filter=lfs diff=lfs merge=lfs -text +H-角色相关/面部引导/japanesedolllikenessV1_v15.preview.png filter=lfs diff=lfs merge=lfs -text +H-角色相关/面部引导/koreanDollLikeness_v10.preview.png filter=lfs diff=lfs merge=lfs -text +H-角色相关/面部引导/koreandolllikeness_V10066.preview.png filter=lfs diff=lfs merge=lfs -text +H-角色相关/面部引导/koreandolllikenessV20_v20.preview.png filter=lfs diff=lfs merge=lfs -text +H-角色相关/面部引导/museNaturalfaceV1_v1.preview.png filter=lfs diff=lfs merge=lfs -text +H-角色相关/体态引导/betterLegwearsLora_offset20.preview.png filter=lfs diff=lfs merge=lfs -text +H-角色相关/体态引导/bodyproportionsV25_bodyproportionsV25.preview.png filter=lfs diff=lfs merge=lfs -text +H-角色相关/体态引导/boobcrush_v3.preview.png filter=lfs diff=lfs merge=lfs -text +H-角色相关/体态引导/Breasts_Helper_Trail_v2.preview.png filter=lfs diff=lfs merge=lfs -text +H-角色相关/体态引导/Concept_shortstack-10.preview.png filter=lfs diff=lfs merge=lfs -text +H-角色相关/体态引导/dikkosPrefectPussy_v10.preview.png filter=lfs diff=lfs merge=lfs -text +H-角色相关/体态引导/hugeNipples_v10.preview.png filter=lfs diff=lfs merge=lfs -text +H-角色相关/体态引导/hyperfusion_213k_32dim-LoCon-epoc6-v5.preview.png filter=lfs diff=lfs merge=lfs -text diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/BEPlus.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/BEPlus.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..1bfe894ab4078f27f8e7aa69a184e5f886366de7 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/BEPlus.civitai.info" @@ -0,0 +1,216 @@ +{ + "id": 67819, + "modelId": 63278, + "name": "v1.0", + "createdAt": "2023-05-11T07:59:34.162Z", + "updatedAt": "2023-05-13T07:19:12.393Z", + "trainedWords": [ + "BEPlus" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 1026, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "BEPlus - LoRA - Breast Expansion enhancer ", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "BEPlus.safetensors", + "id": 47428, + "sizeKB": 295093.423828125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-11T08:06:11.019Z", + "hashes": { + "AutoV1": "59314C9B", + "AutoV2": "FB2114D660", + "SHA256": "FB2114D660FEABD16A9488333E45878167B899CD47133AD5D47B92F5A4384052", + "CRC32": "284A27E0", + "BLAKE3": "531F2106F1FEAAB63585D7F32868A6B96E0E15F665AE3EDC2EE35C215D56228F" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/67819" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/dcdc6f48-0abf-4491-9574-3d7271a8d545/width=450/753739.jpeg", + "nsfw": "None", + "width": 768, + "height": 1152, + "hash": "UHJ75qbv=#%2}uxunPsp00R+t7aeSjbIxaR+", + "meta": { + "Size": "512x768", + "seed": 2757059847, + "Model": "Based64mix-V3", + "steps": 30, + "hashes": { + "model": "fdf0096972" + }, + "prompt": "best quality, detailed face, detailed eyes, 1girl, solo, upper body BREAK,\n(bob cut:1.5), (side parted bangs:1.5), (dark brown hair:1.5), (brown eyes:1.5), short hair, (massive breasts:1.5), :d, (trembling:1.2), black skirt, long sleeves, meme attire, virgin killer outfit, white shirt, high-waist skirt, frilled skirt, pleated skirt, freckles, (red neck ascot:1.5), microskirt, (center frill:1.5) BREAK,\nbreast expansion, BEPlus, (motion lines:0.7), trembling, looking at breasts, shocked, aroused, breast focus,\n ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "BEPlus", + "type": "lora", + "weight": 1 + }, + { + "hash": "fdf0096972", + "name": "Based64mix-V3", + "type": "model" + } + ], + "Model hash": "fdf0096972", + "Hires steps": "15", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(worst quality, low quality:1.1), (depth of field, bokeh, blurry:1.1), (greyscale, monochrome:1.0), text, title, logo, signature, from side, cropped head, nipples, bad-hands-5, (forehead:1.6)", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/98dec986-58c3-482b-ba9c-7967512add05/width=450/753740.jpeg", + "nsfw": "X", + "width": 1152, + "height": 768, + "hash": "UCJjoA00I=Io%%IAt8jY01~AoLM{xt02s,%1", + "meta": { + "Size": "768x512", + "seed": 344886287, + "Model": "Based64mix-V3", + "steps": 30, + "hashes": { + "model": "fdf0096972" + }, + "prompt": "best quality, detailed face, detailed eyes, 1girl, upper body, two panels BREAK,\n(bob cut:1.5), (side parted bangs:1.5), (dark brown hair:1.5), (brown eyes:1.5), short hair, (massive breasts:1.5), :d, (trembling:1.2), black skirt, long sleeves, meme attire, virgin killer outfit, white shirt, high-waist skirt, frilled skirt, pleated skirt, (red neck ascot:1.5), microskirt, (center frill:1.5) BREAK,\nbreast expansion, (BEPlus:1.5), (motion lines:0.7), trembling, looking at breasts, (embarrassed:1.3),shocked, aroused, breast focus, (girl in her bedroom:1.5), cleavage\n ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "BEPlus", + "type": "lora", + "weight": 1 + }, + { + "name": "breast_expansion", + "type": "lora", + "weight": 0.12 + }, + { + "hash": "fdf0096972", + "name": "Based64mix-V3", + "type": "model" + } + ], + "Model hash": "fdf0096972", + "Hires steps": "15", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(worst quality, low quality:1.1), (depth of field, bokeh, blurry:1.1), (greyscale, monochrome:1.0), text, title, logo, signature, from side, cropped head, nipples, bad-hands-5, (forehead:1.6)", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/47e3f098-3f6c-48d9-a7f2-68f3c5b204e3/width=450/753741.jpeg", + "nsfw": "None", + "width": 1152, + "height": 768, + "hash": "UJJ%qWvLQ.#Y-.$xi{Ip00xZadM{~VE2Sg%K", + "meta": { + "Size": "768x512", + "seed": 344886262, + "Model": "Based64mix-V3", + "steps": 30, + "hashes": { + "model": "fdf0096972" + }, + "prompt": "best quality, detailed face, detailed eyes, 1girl, upper body, two panels BREAK,\n(bob cut:1.5), (side parted bangs:1.5), (dark brown hair:1.5), (brown eyes:1.5), short hair, (massive breasts:1.5), :d, (trembling:1.2), black skirt, long sleeves, meme attire, virgin killer outfit, white shirt, high-waist skirt, frilled skirt, pleated skirt, (red neck ascot:1.5), microskirt, (center frill:1.5) BREAK,\nbreast expansion, (BEPlus:1.5), (motion lines:0.7), trembling, looking at breasts, (embarrassed:1.3),shocked, aroused, breast focus, (girl in her bedroom:1.5), cleavage\n ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "BEPlus", + "type": "lora", + "weight": 1 + }, + { + "name": "breast_expansion", + "type": "lora", + "weight": 0.12 + }, + { + "hash": "fdf0096972", + "name": "Based64mix-V3", + "type": "model" + } + ], + "Model hash": "fdf0096972", + "Hires steps": "15", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(worst quality, low quality:1.1), (depth of field, bokeh, blurry:1.1), (greyscale, monochrome:1.0), text, title, logo, signature, from side, cropped head, nipples, bad-hands-5, (forehead:1.6)", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d1f80c3b-8d02-4ecf-a519-4d73e12d1a39/width=450/753742.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1280, + "hash": "USMZ:%X9#As:xwj?;2V[9aW;VYjF~VofIAay", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 1428543836, + "Model": "Based65-Final-Mix", + "steps": 30, + "hashes": { + "model": "ed526812bb" + }, + "prompt": "1girl, solo, breast expansion, BEPlus, (motion lines:0.7), trembling, looking at breasts, shocked, aroused, breast focus,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "ed526812bb", + "name": "Based65-Final-Mix", + "type": "model" + } + ], + "Model hash": "ed526812bb", + "Hires steps": "10", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 3": "BEPlus(98ecc042e0ff)", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality:1.1), (depth of field, bokeh, blurry:1.1), (greyscale, monochrome:1.0), text, title, logo, signature, from side, cropped head, nipples, bad-hands-5", + "AddNet Module 3": "LoRA", + "AddNet Weight A 3": "1", + "AddNet Weight B 3": "1", + "Denoising strength": "0.4" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/67819" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/BEPlus.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/BEPlus.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..7da57968d4a90007fa86ffdd36c32e74fa09fbec Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/BEPlus.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/BEPlus.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/BEPlus.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..9bf4c1fcd347c29376d89392f53716b582e92b69 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/BEPlus.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:fb2114d660feabd16a9488333e45878167b899cd47133ad5d47b92f5a4384052 +size 302175666 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/BEReaction.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/BEReaction.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..73bcd845177291b47905b24f58daa2183d948944 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/BEReaction.civitai.info" @@ -0,0 +1,339 @@ +{ + "id": 69425, + "modelId": 63278, + "name": "v2.0 - BEReaction ", + "createdAt": "2023-05-13T07:19:12.393Z", + "updatedAt": "2023-05-13T07:25:03.062Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

With the help of an anonymous benefactor, I bring you V2 of the breast expansion enhancer!
Dataset cleaned up, tags adjusted, trained by someone who knew what they were doing!
No need for an activation tag this time.

", + "stats": { + "downloadCount": 47, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "BEPlus - LoRA - Breast Expansion enhancer ", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "BEReaction.safetensors", + "id": 48510, + "sizeKB": 73891.7685546875, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-13T07:26:07.253Z", + "hashes": { + "AutoV1": "336DD2B2", + "AutoV2": "291941D8FB", + "SHA256": "291941D8FB32691EC473D8C261EFBAB97C578AA3A2621525C6EE7E78A54978DD", + "CRC32": "CF5AF345", + "BLAKE3": "4B7E1C5EE96E52C7563BE3FB40BBB132224C90E86F6C070BAB687C11EB2E0C05" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/69425" + }, + { + "name": "BEReaction.safetensors", + "id": 48508, + "sizeKB": 73891.7685546875, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-13T07:21:06.686Z", + "hashes": { + "AutoV1": "336DD2B2", + "AutoV2": "291941D8FB", + "SHA256": "291941D8FB32691EC473D8C261EFBAB97C578AA3A2621525C6EE7E78A54978DD", + "CRC32": "CF5AF345", + "BLAKE3": "4B7E1C5EE96E52C7563BE3FB40BBB132224C90E86F6C070BAB687C11EB2E0C05" + }, + "primary": false, + "downloadUrl": "https://civitai.com/api/download/models/69425?type=Model&format=SafeTensor" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f2981859-4e74-4c44-ab69-44f7c034d8d1/width=450/774635.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1152, + "hash": "UNJ@qObVu6^i_NwZ57wGF3-PawM^=qNFiu%1", + "meta": { + "ENSD": "31337", + "Size": "512x576", + "seed": 818391363, + "Model": "mokoumixv1_prunedfp16", + "steps": 30, + "hashes": { + "model": "51020e5323" + }, + "prompt": "1girl, long blond hair, red eyes, (black collared shirt, jeans:1.2), bereaction, city street, breast expansion, surprised, embarrassed, full-face blush, (torn clothes:1.2), (grabbing own breast, breast squeeze:1.2), cowboy shot, (exclamation point:1.2), poking nipples, gigantic breasts, \n", + "sampler": "DPM++ SDE Karras", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "name": "BEReaction", + "type": "lora", + "weight": 1 + }, + { + "hash": "51020e5323", + "name": "mokoumixv1_prunedfp16", + "type": "model" + } + ], + "Model hash": "51020e5323", + "Hires steps": "10", + "Hires resize": "1024x1152", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality:1.4), (realistic, lip, nose:1.0), (dusty sunbeams:1.0), (depth of field, bokeh, blurry:1.4), (greyscale, monochrome:1.0), text, title, logo, signature", + "Denoising strength": "0.4" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4f3515c8-0289-4e7c-8ce0-7fac06a7d100/width=450/774640.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1280, + "hash": "U9L:v4+{00F|*d8wR=%#02McIWIpFrDj~oxt", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 3401427169, + "Model": "based66_v30", + "steps": 20, + "hashes": { + "model": "2fcdee6e9c" + }, + "prompt": "1girl, izayoi sakuya, maid uniform, taut clothes, :d, excited, horny, aroused, ahegao, bursting breasts, gigantic breasts, BEReaction, Breast expansion,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 6, + "Clip skip": "2", + "RP Active": "True", + "RP Ratios": "\"1,1\"", + "resources": [ + { + "hash": "2fcdee6e9c", + "name": "based66_v30", + "type": "model" + }, + { + "hash": "a36a9651983a", + "name": "Rebis", + "type": "lora", + "weight": null + }, + { + "hash": "950c90097f2a", + "name": "BEReaction", + "type": "lora", + "weight": null + }, + { + "hash": "7c6bad76eb54", + "name": "add_detail", + "type": "lora", + "weight": null + } + ], + "Model hash": "2fcdee6e9c", + "Hires steps": "10", + "RP Use Base": "True", + "RP Calc Mode": "Attention", + "Hires upscale": "2", + "RP Use Common": "True", + "AddNet Enabled": "True", + "AddNet Model 1": "Rebis(a36a9651983a)", + "AddNet Model 2": "BEReaction(950c90097f2a)", + "AddNet Model 3": "add_detail(7c6bad76eb54)", + "Hires upscaler": "4x_foolhardy_Remacri", + "RP Base Ratios": "0.2", + "RP Divide mode": "Horizontal", + "RP Use Ncommon": "False", + "negativePrompt": "(worst quality, low quality:1.4), nipples, bad-hands-5", + "AddNet Module 1": "LoRA", + "AddNet Module 2": "LoRA", + "AddNet Module 3": "LoRA", + "AddNet Weight A 1": "0.5", + "AddNet Weight A 2": "0.95", + "AddNet Weight A 3": "0.7", + "AddNet Weight B 1": "0.5", + "AddNet Weight B 2": "0.95", + "AddNet Weight B 3": "0.7", + "Denoising strength": "0.55", + "RP LoRA Neg U Ratios": "0", + "RP LoRA Neg Te Ratios": "0" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d43d50da-e4ee-4c1f-a67a-d954bfbfeec6/width=450/774642.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1280, + "hash": "UWNdL1?byEt7_Nn$^kRjyDNHwcof4.ozt6WV", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 185267173, + "Model": "based66_v30", + "steps": 20, + "hashes": { + "model": "2fcdee6e9c" + }, + "prompt": "Masterpiece, sketch, traditional media, standing, cowboy shot, 1girl, Hatsune miku, messy hair, big hair, extremely long hair, taut clothes, micro bikini, pleated skirt, detached sleeves, adapted costume, excited, horny, aroused, smug, gigantic breasts, (Breast expansion:1.2), trembling, motion lines", + "sampler": "DPM++ SDE Karras", + "cfgScale": 5, + "Clip skip": "2", + "RP Active": "True", + "RP Ratios": "\"1,1\"", + "resources": [ + { + "hash": "2fcdee6e9c", + "name": "based66_v30", + "type": "model" + }, + { + "hash": "633604f2a01b", + "name": "2bge", + "type": "lora", + "weight": null + }, + { + "hash": "950c90097f2a", + "name": "BEReaction", + "type": "lora", + "weight": null + }, + { + "hash": "7c6bad76eb54", + "name": "add_detail", + "type": "lora", + "weight": null + } + ], + "Model hash": "2fcdee6e9c", + "Hires steps": "10", + "RP Use Base": "True", + "RP Calc Mode": "Attention", + "Hires upscale": "2", + "RP Use Common": "True", + "AddNet Enabled": "True", + "AddNet Model 1": "2bge(633604f2a01b)", + "AddNet Model 2": "BEReaction(950c90097f2a)", + "AddNet Model 3": "add_detail(7c6bad76eb54)", + "Hires upscaler": "4x_foolhardy_Remacri", + "RP Base Ratios": "0.2", + "RP Divide mode": "Horizontal", + "RP Use Ncommon": "False", + "negativePrompt": "(worst quality, low quality:1.4), bad-hands-5, artist name, watermark, text, realistic, 3d, monochrome, nipples, cross-eyed, cropped head, asymmetrical breasts, unaligned breasts,", + "AddNet Module 1": "LoRA", + "AddNet Module 2": "LoRA", + "AddNet Module 3": "LoRA", + "AddNet Weight A 1": "0.35", + "AddNet Weight A 2": "1", + "AddNet Weight A 3": "0.3", + "AddNet Weight B 1": "0.35", + "AddNet Weight B 2": "1", + "AddNet Weight B 3": "0.3", + "Denoising strength": "0.55", + "RP LoRA Neg U Ratios": "0", + "RP LoRA Neg Te Ratios": "0" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/76a0bb8a-40f4-4f8e-adad-eaa20848b20b/width=450/774661.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1280, + "hash": "UaKTc0fh4oi_0zIUtPNGD*V@t7V@~VozM{WB", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 3224830595, + "Model": "based66_v30", + "steps": 20, + "hashes": { + "model": "2fcdee6e9c" + }, + "prompt": "1girl, izayoi sakuya, maid uniform, taut clothes, :d, excited, horny, aroused, ahegao, bursting breasts, gigantic breasts, BEReaction, Breast expansion,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 6, + "Clip skip": "2", + "RP Active": "True", + "RP Ratios": "\"1,1\"", + "resources": [ + { + "hash": "2fcdee6e9c", + "name": "based66_v30", + "type": "model" + }, + { + "hash": "19b337654b1a", + "name": "spacezin", + "type": "lora", + "weight": null + }, + { + "hash": "950c90097f2a", + "name": "BEReaction", + "type": "lora", + "weight": null + }, + { + "hash": "7c6bad76eb54", + "name": "add_detail", + "type": "lora", + "weight": null + } + ], + "Model hash": "2fcdee6e9c", + "Hires steps": "10", + "RP Use Base": "True", + "RP Calc Mode": "Attention", + "Hires upscale": "2", + "RP Use Common": "True", + "AddNet Enabled": "True", + "AddNet Model 1": "artist-spacezin(19b337654b1a)", + "AddNet Model 2": "BEReaction(950c90097f2a)", + "AddNet Model 3": "add_detail(7c6bad76eb54)", + "Hires upscaler": "4x_foolhardy_Remacri", + "RP Base Ratios": "0.2", + "RP Divide mode": "Horizontal", + "RP Use Ncommon": "False", + "negativePrompt": "(worst quality, low quality:1.4), bad-hands-5, artist name, watermark, text, realistic, 3d, (((monochrome)))", + "AddNet Module 1": "LoRA", + "AddNet Module 2": "LoRA", + "AddNet Module 3": "LoRA", + "AddNet Weight A 1": "0.7", + "AddNet Weight A 2": "0.95", + "AddNet Weight A 3": "1", + "AddNet Weight B 1": "0.7", + "AddNet Weight B 2": "0.95", + "AddNet Weight B 3": "1", + "Denoising strength": "0.55", + "RP LoRA Neg U Ratios": "0", + "RP LoRA Neg Te Ratios": "0" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/69425" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/BEReaction.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/BEReaction.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..16553d0ed33e4dc952bffa7e4ef8ba921ad08d0b Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/BEReaction.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/BEReaction.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/BEReaction.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..aebd44c13b475f907a5b2a6a944f91adcd0178af --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/BEReaction.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:291941d8fb32691ec473d8c261efbab97c578aa3a2621525c6ee7e78a54978dd +size 75665171 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/Breast Expansion.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/Breast Expansion.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..e9435d8af3c8f05d8cf4e3809f0f344100ca6db5 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/Breast Expansion.civitai.info" @@ -0,0 +1,326 @@ +{ + "id": 113527, + "modelId": 105759, + "name": "v1.0", + "createdAt": "2023-07-09T08:09:20.356Z", + "updatedAt": "2023-07-09T08:35:39.452Z", + "trainedWords": [ + "Breast Expansion", + "BETaut", + "BETorn", + "BECovered", + "BEsequence" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 1793, + "ratingCount": 10, + "rating": 5 + }, + "model": { + "name": "Breast Expansion | Concept", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "Breast_Expansion.safetensors", + "id": 80652, + "sizeKB": 73987.91015625, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-07-09T08:16:06.114Z", + "hashes": { + "AutoV1": "1AE6462B", + "AutoV2": "B08838AC14", + "SHA256": "B08838AC145CA8900766F26CB2BC869840A3ED140F0AD4CF53D4F875CCC8F96C", + "CRC32": "D84F0E4D", + "BLAKE3": "4027BB3828C469D7C68CF36890198F03A18862BE6A6462092321EFA6BEA0717F" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/113527" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6ae4f6b3-ee55-4cb2-b122-9382a98d680e/width=450/1474015.jpeg", + "nsfw": "X", + "width": 1152, + "height": 1024, + "hash": "ULJH]?Ny_2-5^--oShWCIuozRiRj%ME2s,oz", + "meta": { + "Size": "576x512", + "seed": 3861133262, + "Model": "mokoumixv1_prunedfp16", + "steps": 30, + "hashes": { + "model": "51020e5323" + }, + "prompt": ",\n1girl,short red hair,collared shirt,office lady,(office:1.2),breast expansion,(BEtorn:1.2),surprised,looking down,worried,motion lines,grabbing own breast,torn shirt,besequence,multiple views,small breasts,huge breasts,open open mouth,green eyes,", + "Version": "v1.4.0", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "clipSkip": 2, + "resources": [ + { + "hash": "51020e5323", + "name": "mokoumixv1_prunedfp16", + "type": "model" + } + ], + "Model hash": "51020e5323", + "Hires steps": "10", + "Hires resize": "1152x1024", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality:1.4),(realistic, lip, nose:1),(dusty sunbeams:1),(depth of field, bokeh, blurry:1.4),greyscale,monochrome,text,title,logo,signature,", + "\"Breast_Expansion": "f988656580e9\"", + "Denoising strength": "0.4" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a95ffd62-eb8d-4b33-8f60-58dee4b1b770/width=450/1473930.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1152, + "hash": "UIK^~mRP04TLYk$fGJXTI9s:wbNJ~qX9IAR-", + "meta": { + "Size": "512x576", + "seed": 3815101575, + "Model": "mokoumixv1_prunedfp16", + "steps": 30, + "hashes": { + "model": "51020e5323" + }, + "prompt": ",\n1girl,long blond hair,collared shirt,office lady,office,breast expansion,BEtorn,surprised,looking down,worried,motion motion lines,", + "Version": "v1.4.0", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "clipSkip": 2, + "resources": [ + { + "hash": "51020e5323", + "name": "mokoumixv1_prunedfp16", + "type": "model" + } + ], + "Model hash": "51020e5323", + "Hires steps": "10", + "Hires resize": "1024x1152", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality:1.4),(realistic, lip, nose:1),(dusty sunbeams:1),(depth of field, bokeh, blurry:1.4),greyscale,monochrome,text,title,logo,signature,", + "\"Breast_Expansion": "f988656580e9\"", + "Denoising strength": "0.4" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/41fdf5f4-063c-40f0-8977-f1624d7232dc/width=450/1473927.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1152, + "hash": "UGJQ.w4.00%2NEn~02-o55bcxvV?}?tRM}IU", + "meta": { + "Size": "512x576", + "seed": 4131647951, + "Model": "mokoumixv1_prunedfp16", + "steps": 30, + "hashes": { + "model": "51020e5323" + }, + "prompt": ",\n1girl,long blond hair,collared shirt,office lady,office,breast expansion,BEtorn,surprised,looking down,worried,", + "Version": "v1.4.0", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "clipSkip": 2, + "resources": [ + { + "hash": "51020e5323", + "name": "mokoumixv1_prunedfp16", + "type": "model" + } + ], + "Model hash": "51020e5323", + "Hires steps": "10", + "Hires resize": "1024x1152", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality:1.4),(realistic, lip, nose:1),(dusty sunbeams:1),(depth of field, bokeh, blurry:1.4),greyscale,monochrome,text,title,logo,signature,", + "\"Breast_Expansion": "f988656580e9\"", + "Denoising strength": "0.4" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c1f79e51-987e-4a69-9d51-2469ff6abda5/width=450/1474089.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1152, + "hash": "UgNS{XRQ~Wxa?GRjIUxajIRjjFt7s;xuofRj", + "meta": { + "Size": "512x576", + "seed": 3081475149, + "Model": "mokoumixv1_prunedfp16", + "steps": 30, + "hashes": { + "model": "51020e5323" + }, + "prompt": ",,\n1girl,kagakantai,huge breasts,breast expansion,surprised,embarrassed,blush,motion lines,one side up,torn clothes,ocean,betorn,", + "Version": "v1.4.0", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "clipSkip": 2, + "resources": [ + { + "name": "KagaKantai", + "type": "lora", + "weight": 1 + }, + { + "hash": "51020e5323", + "name": "mokoumixv1_prunedfp16", + "type": "model" + } + ], + "KagaKantai": "8f2c27ae9294\"", + "Model hash": "51020e5323", + "Hires steps": "10", + "Hires resize": "1024x1152", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality:1.4),(realistic, lip, nose:1),(dusty sunbeams:1),(depth of field, bokeh, blurry:1.4),greyscale,monochrome,text,title,logo,signature,twintails,", + "\"Breast_Expansion": "f988656580e9", + "Denoising strength": "0.4" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f02806f5-f482-4b98-a2cd-17e628e04691/width=450/1474517.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1152, + "hash": "UeOf[Z%M_NtR%Mt7ozRP.9M{oeoei^RjRQof", + "meta": { + "Size": "512x576", + "seed": 379582953, + "Model": "mokoumixv1_prunedfp16", + "steps": 30, + "hashes": { + "model": "51020e5323" + }, + "prompt": ",,\n1girl,dark skin,red eyes,long white hair,ponytail,white dress,park,(betorn:1.2),large breasts,torn shirt, motion lines, surprised, embarrassed,", + "Version": "v1.4.0", + "sampler": "DPM++ SDE Karras", + "\"Muscle2": "74b609299692", + "cfgScale": 8, + "clipSkip": 2, + "resources": [ + { + "name": "Muscle2", + "type": "lora", + "weight": 1 + }, + { + "hash": "51020e5323", + "name": "mokoumixv1_prunedfp16", + "type": "model" + } + ], + "Model hash": "51020e5323", + "Hires steps": "10", + "Hires resize": "1024x1152", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality:1.4),(realistic, lip, nose:1),(dusty sunbeams:1),(depth of field, bokeh, blurry:1.4),greyscale,monochrome,text,title,logo,signature,twintails,", + "Breast_Expansion": "f988656580e9\"", + "Denoising strength": "0.4" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/17e36e27-9daa-4d92-b76c-d7ec38772149/width=450/1474374.jpeg", + "nsfw": "X", + "width": 1152, + "height": 1024, + "hash": "UIIOhL^+PqEh17NG.8M|01Ion3=|D*x]Vst7", + "meta": { + "Size": "576x512", + "seed": 2390236125, + "GTSv5": "2f160a4c51be", + "Model": "mokoumixv1_prunedfp16", + "steps": 30, + "hashes": { + "model": "51020e5323" + }, + "prompt": ",,,\n1girl,architect,sangvis ferri,becovered,breast expansion,evil smile,gigantic breasts,betorn,torn shirt,motion lines,full-face blush,giantess,city,full body,(grabbing own breast:1.2),skyscrapers,", + "Version": "v1.4.0", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "clipSkip": 2, + "resources": [ + { + "name": "Architect", + "type": "lora", + "weight": 1 + }, + { + "name": "GTSv5", + "type": "lora", + "weight": 1 + }, + { + "hash": "51020e5323", + "name": "mokoumixv1_prunedfp16", + "type": "model" + } + ], + "\"Architect": "05ee30f8dca3", + "Model hash": "51020e5323", + "Hires steps": "10", + "Hires resize": "1152x1024", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality:1.4),(realistic, lip, nose:1),(dusty sunbeams:1),(depth of field, bokeh, blurry:1.4),greyscale,monochrome,text,title,logo,signature,twintails,", + "Breast_Expansion": "f988656580e9\"", + "Denoising strength": "0.4" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0dfb35f8-903a-48d9-b244-c5b7fbcbde1d/width=450/1474737.jpeg", + "nsfw": "X", + "width": 1152, + "height": 1024, + "hash": "ULIE-6K6kC?E~qnNadSiAb?GocSO~WNdS2xu", + "meta": { + "Size": "576x512", + "seed": 3770619278, + "Model": "mokoumixv1_prunedfp16", + "steps": 30, + "hashes": { + "model": "51020e5323" + }, + "prompt": ",\n1girl,(besequence:1.3),before and after,side-by-side,small breasts,(huge breasts:1.2),brown eyes,long black hair,ponytail,blue dress,(park:1.1),(betorn:1.2),torn shirt,(motion lines:1.2),surprised,embarrassed,full-face blush,looking down,skindentation,trees,bursting breasts,", + "Version": "v1.4.0", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "clipSkip": 2, + "resources": [ + { + "hash": "51020e5323", + "name": "mokoumixv1_prunedfp16", + "type": "model" + } + ], + "Model hash": "51020e5323", + "Hires steps": "10", + "Hires resize": "1152x1024", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality:1.4),(realistic, lip, nose:1),(dusty sunbeams:1),(depth of field, bokeh, blurry:1.4),greyscale,monochrome,text,title,logo,signature,twintails,", + "\"Breast_Expansion": "f988656580e9\"", + "Denoising strength": "0.4" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/113527" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/Breast Expansion.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/Breast Expansion.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..42ddef3ca74a6fb984652dfa229bcf198bf95408 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/Breast Expansion.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/Breast Expansion.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/Breast Expansion.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..5a4b0fe8ba3cd616833c507c16027e2c3167264c --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/Breast Expansion.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:b08838ac145ca8900766f26cb2bc869840a3ed140f0ad4cf53d4f875ccc8f96c +size 75763620 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/Breasts_Helper_Trail_v2.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/Breasts_Helper_Trail_v2.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..e1726309f6549a9ef69c87d43aab1b1581145a66 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/Breasts_Helper_Trail_v2.civitai.info" @@ -0,0 +1,350 @@ +{ + "id": 87262, + "modelId": 17875, + "name": "v1.1", + "createdAt": "2023-06-01T20:53:33.883Z", + "updatedAt": "2023-06-01T21:00:57.452Z", + "trainedWords": [ + "See \"Trigger List\"" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 1238, + "ratingCount": 3, + "rating": 5 + }, + "model": { + "name": "Breast Helper 1.1", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "Breasts_Helper_Trail_v2.safetensors", + "id": 59747, + "sizeKB": 147573.2236328125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-01T21:01:14.214Z", + "hashes": { + "AutoV1": "311A3576", + "AutoV2": "124FE77B5D", + "SHA256": "124FE77B5DA6ED3224AE95084A264349E937776AD7C2E42E8C9C6F444669BF8D", + "CRC32": "BA540A23", + "BLAKE3": "A1527599541197AF939414FBB0FEFE5E200EF7176D5CA81AD5820433ECB91AEF" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/87262" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/95e21045-4fae-4d4e-b6e1-9669b8fb6e93/width=450/997756.jpeg", + "nsfw": "Mature", + "width": 2828, + "height": 4000, + "hash": "U3NI?3:l00~p00Ty8wZNJ78_%$Kj005QTK0K", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/30c78807-93ea-4559-8970-d5b8545dcc2b/width=450/997757.jpeg", + "nsfw": "Mature", + "width": 3840, + "height": 815, + "hash": "UcLM|no}W:jacFaes:j].8oeofa{~qkCayay", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c5201d50-6600-4aea-afdd-62be6aa83ae4/width=450/997763.jpeg", + "nsfw": "X", + "width": 2280, + "height": 5136, + "hash": "UlM%Dw?^.8-=ozj?oLWVozf6ayj[t7oLfQa|", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/92369223-a6fd-4ed7-99fe-735c8282baab/width=450/997766.jpeg", + "nsfw": "Mature", + "width": 480, + "height": 720, + "hash": "U9Kmzp0000.900~WFw^5AH-UZ$tm?wD*#SE2", + "meta": { + "Size": "480x720", + "seed": 1587646042, + "Model": "uberRealisticPornMerge_urpmv12", + "steps": 20, + "hashes": { + "model": "fcfaf106f2" + }, + "prompt": "flat breast, normal nipples, normal areola, pink nipple, 28yo blond woman, photographed on a Canon EOS R5, 50mm lens, F/2.8, HDR, 8k resolution, ((detailed face)), (detailed skin)", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "fcfaf106f2", + "name": "uberRealisticPornMerge_urpmv12", + "type": "model" + }, + { + "hash": "470f04826a09", + "name": "Breasts_Helper_Trail_v2", + "type": "lora", + "weight": null + } + ], + "Model hash": "fcfaf106f2", + "AddNet Enabled": "True", + "AddNet Model 1": "Breasts_Helper_Trail_v2(470f04826a09)", + "negativePrompt": "wound, pubic hair, bright, (monochrome:1.3), (oversaturated:1.3), bad hands, lowers, 3d render, cartoon, long body, ((blurry)), duplicate, ((duplicate body parts)), (disfigured), (poorly drawn), (extra limbs), fused fingers, extra fingers, (twisted), contorted, conjoined, ((missing limbs)), logo, signature, text, words, low res, boring, mutated, artifacts, bad art, gross, ugly, poor quality, low quality, 2girls, bad anatomy, child", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.6", + "AddNet Weight B 1": "0.6" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/53d3f689-51f4-4ace-8e7b-23f01eb64ddd/width=450/997764.jpeg", + "nsfw": "X", + "width": 480, + "height": 720, + "hash": "U9KmnJ00009e00^kKO=x9w=|Q-TJ_NIU+wI:", + "meta": { + "Size": "480x720", + "seed": 1587646042, + "Model": "uberRealisticPornMerge_urpmv12", + "steps": 20, + "hashes": { + "model": "fcfaf106f2" + }, + "prompt": "small breast, normal nipples, normal areola, pink nipple, 28yo blond woman, photographed on a Canon EOS R5, 50mm lens, F/2.8, HDR, 8k resolution, ((detailed face)), (detailed skin)", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "fcfaf106f2", + "name": "uberRealisticPornMerge_urpmv12", + "type": "model" + }, + { + "hash": "470f04826a09", + "name": "Breasts_Helper_Trail_v2", + "type": "lora", + "weight": null + } + ], + "Model hash": "fcfaf106f2", + "AddNet Enabled": "True", + "AddNet Model 1": "Breasts_Helper_Trail_v2(470f04826a09)", + "negativePrompt": "wound, pubic hair, bright, (monochrome:1.3), (oversaturated:1.3), bad hands, lowers, 3d render, cartoon, long body, ((blurry)), duplicate, ((duplicate body parts)), (disfigured), (poorly drawn), (extra limbs), fused fingers, extra fingers, (twisted), contorted, conjoined, ((missing limbs)), logo, signature, text, words, low res, boring, mutated, artifacts, bad art, gross, ugly, poor quality, low quality, 2girls, bad anatomy, child", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.6", + "AddNet Weight B 1": "0.6" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2a0f91ec-571e-4dc6-9e99-472650fba94a/width=450/997765.jpeg", + "nsfw": "Mature", + "width": 480, + "height": 720, + "hash": "UBKd6s00009I00=|K5={ER-pQnbv?^IU#mIp", + "meta": { + "Size": "480x720", + "seed": 1587646042, + "Model": "uberRealisticPornMerge_urpmv12", + "steps": 20, + "hashes": { + "model": "fcfaf106f2" + }, + "prompt": "medium breast, normal nipples, normal areola, pink nipple, 28yo blond woman, photographed on a Canon EOS R5, 50mm lens, F/2.8, HDR, 8k resolution, ((detailed face)), (detailed skin)", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "fcfaf106f2", + "name": "uberRealisticPornMerge_urpmv12", + "type": "model" + }, + { + "hash": "470f04826a09", + "name": "Breasts_Helper_Trail_v2", + "type": "lora", + "weight": null + } + ], + "Model hash": "fcfaf106f2", + "AddNet Enabled": "True", + "AddNet Model 1": "Breasts_Helper_Trail_v2(470f04826a09)", + "negativePrompt": "wound, pubic hair, bright, (monochrome:1.3), (oversaturated:1.3), bad hands, lowers, 3d render, cartoon, long body, ((blurry)), duplicate, ((duplicate body parts)), (disfigured), (poorly drawn), (extra limbs), fused fingers, extra fingers, (twisted), contorted, conjoined, ((missing limbs)), logo, signature, text, words, low res, boring, mutated, artifacts, bad art, gross, ugly, poor quality, low quality, 2girls, bad anatomy, child", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.6", + "AddNet Weight B 1": "0.6" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a8fc4389-112e-4bc6-9af4-8cdbfe04e67e/width=450/997767.jpeg", + "nsfw": "Mature", + "width": 480, + "height": 720, + "hash": "U8LDGK0000ER00^kTG^k0M={rDx]_4IV=19a", + "meta": { + "Size": "480x720", + "seed": 1587646042, + "Model": "uberRealisticPornMerge_urpmv12", + "steps": 20, + "hashes": { + "model": "fcfaf106f2" + }, + "prompt": "big breast, normal nipples, normal areola, pink nipple, 28yo blond woman, photographed on a Canon EOS R5, 50mm lens, F/2.8, HDR, 8k resolution, ((detailed face)), (detailed skin)", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "fcfaf106f2", + "name": "uberRealisticPornMerge_urpmv12", + "type": "model" + }, + { + "hash": "470f04826a09", + "name": "Breasts_Helper_Trail_v2", + "type": "lora", + "weight": null + } + ], + "Model hash": "fcfaf106f2", + "AddNet Enabled": "True", + "AddNet Model 1": "Breasts_Helper_Trail_v2(470f04826a09)", + "negativePrompt": "wound, pubic hair, bright, (monochrome:1.3), (oversaturated:1.3), bad hands, lowers, 3d render, cartoon, long body, ((blurry)), duplicate, ((duplicate body parts)), (disfigured), (poorly drawn), (extra limbs), fused fingers, extra fingers, (twisted), contorted, conjoined, ((missing limbs)), logo, signature, text, words, low res, boring, mutated, artifacts, bad art, gross, ugly, poor quality, low quality, 2girls, bad anatomy, child", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.6", + "AddNet Weight B 1": "0.6" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3c3913b6-1489-4957-b3ac-506fba5069c3/width=450/997768.jpeg", + "nsfw": "X", + "width": 480, + "height": 720, + "hash": "U9K,jG0000E300=|Sz~B0M-oZ%S~_4IV,@9u", + "meta": { + "Size": "480x720", + "seed": 1587646042, + "Model": "uberRealisticPornMerge_urpmv12", + "steps": 20, + "hashes": { + "model": "fcfaf106f2" + }, + "prompt": "fake breast, normal nipples, normal areola, pink nipple, 28yo blond woman, photographed on a Canon EOS R5, 50mm lens, F/2.8, HDR, 8k resolution, ((detailed face)), (detailed skin)", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "fcfaf106f2", + "name": "uberRealisticPornMerge_urpmv12", + "type": "model" + }, + { + "hash": "470f04826a09", + "name": "Breasts_Helper_Trail_v2", + "type": "lora", + "weight": null + } + ], + "Model hash": "fcfaf106f2", + "AddNet Enabled": "True", + "AddNet Model 1": "Breasts_Helper_Trail_v2(470f04826a09)", + "negativePrompt": "wound, pubic hair, bright, (monochrome:1.3), (oversaturated:1.3), bad hands, lowers, 3d render, cartoon, long body, ((blurry)), duplicate, ((duplicate body parts)), (disfigured), (poorly drawn), (extra limbs), fused fingers, extra fingers, (twisted), contorted, conjoined, ((missing limbs)), logo, signature, text, words, low res, boring, mutated, artifacts, bad art, gross, ugly, poor quality, low quality, 2girls, bad anatomy, child", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.6", + "AddNet Weight B 1": "0.6" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/36a62dae-3e01-45a3-be55-34467dc8f282/width=450/997769.jpeg", + "nsfw": "X", + "width": 480, + "height": 720, + "hash": "U5Kvv#00008_0W]}ix~A00?FvL.Rz:b^=Y0N", + "meta": { + "Size": "480x720", + "seed": 1587646042, + "Model": "uberRealisticPornMerge_urpmv12", + "steps": 20, + "hashes": { + "model": "fcfaf106f2" + }, + "prompt": "bimbo breast, normal nipples, normal areola, pink nipple, 28yo blond woman, photographed on a Canon EOS R5, 50mm lens, F/2.8, HDR, 8k resolution, ((detailed face)), (detailed skin)", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "fcfaf106f2", + "name": "uberRealisticPornMerge_urpmv12", + "type": "model" + }, + { + "hash": "470f04826a09", + "name": "Breasts_Helper_Trail_v2", + "type": "lora", + "weight": null + } + ], + "Model hash": "fcfaf106f2", + "AddNet Enabled": "True", + "AddNet Model 1": "Breasts_Helper_Trail_v2(470f04826a09)", + "negativePrompt": "wound, pubic hair, bright, (monochrome:1.3), (oversaturated:1.3), bad hands, lowers, 3d render, cartoon, long body, ((blurry)), duplicate, ((duplicate body parts)), (disfigured), (poorly drawn), (extra limbs), fused fingers, extra fingers, (twisted), contorted, conjoined, ((missing limbs)), logo, signature, text, words, low res, boring, mutated, artifacts, bad art, gross, ugly, poor quality, low quality, 2girls, bad anatomy, child", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.6", + "AddNet Weight B 1": "0.6" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6b7f0930-e63c-43f9-91a3-e47290a29d44/width=450/997773.jpeg", + "nsfw": "Mature", + "width": 480, + "height": 720, + "hash": "U5KmIK0000D-00=gyW]:04^Q+u-:}_D%+05j", + "meta": { + "Size": "480x720", + "seed": 1587646042, + "Model": "uberRealisticPornMerge_urpmv12", + "steps": 20, + "hashes": { + "model": "fcfaf106f2" + }, + "prompt": "saggy breast, normal nipples, normal areola, pink nipple, 28yo blond woman, photographed on a Canon EOS R5, 50mm lens, F/2.8, HDR, 8k resolution, ((detailed face)), (detailed skin)", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "fcfaf106f2", + "name": "uberRealisticPornMerge_urpmv12", + "type": "model" + }, + { + "hash": "470f04826a09", + "name": "Breasts_Helper_Trail_v2", + "type": "lora", + "weight": null + } + ], + "Model hash": "fcfaf106f2", + "AddNet Enabled": "True", + "AddNet Model 1": "Breasts_Helper_Trail_v2(470f04826a09)", + "negativePrompt": "wound, pubic hair, bright, (monochrome:1.3), (oversaturated:1.3), bad hands, lowers, 3d render, cartoon, long body, ((blurry)), duplicate, ((duplicate body parts)), (disfigured), (poorly drawn), (extra limbs), fused fingers, extra fingers, (twisted), contorted, conjoined, ((missing limbs)), logo, signature, text, words, low res, boring, mutated, artifacts, bad art, gross, ugly, poor quality, low quality, 2girls, bad anatomy, child", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.6", + "AddNet Weight B 1": "0.6" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/87262" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/Breasts_Helper_Trail_v2.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/Breasts_Helper_Trail_v2.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..0288151d347785bebe0efc6955e65edf11fc6275 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/Breasts_Helper_Trail_v2.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:d31e604a3c2b442d35e2262ad516a2ca62bd706ba1108dfd5c89cd0a50be3d8f +size 1963799 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/Breasts_Helper_Trail_v2.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/Breasts_Helper_Trail_v2.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..3c5ac675a57d321039d1a35db7f7c324775c226f --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/Breasts_Helper_Trail_v2.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:124fe77b5da6ed3224ae95084a264349e937776ad7c2e42e8c9c6f444669bf8d +size 151114981 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/Concept_shortstack-10.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/Concept_shortstack-10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..862c49279672a158c4d2b6e5ec46ccf293d7e993 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/Concept_shortstack-10.civitai.info" @@ -0,0 +1,483 @@ +{ + "id": 112836, + "modelId": 105211, + "name": "main lora", + "createdAt": "2023-07-08T10:22:37.508Z", + "updatedAt": "2023-07-08T10:24:47.640Z", + "trainedWords": [ + "shortstack" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

main lora

", + "stats": { + "downloadCount": 83, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Concept-shortstack", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "Concept_shortstack-10.safetensors", + "id": 80056, + "sizeKB": 18617.251953125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-07-08T10:32:21.455Z", + "hashes": { + "AutoV1": "847D4B40", + "AutoV2": "1813244762", + "SHA256": "18132447627DC2CEF11D2F87F1D3E292882B4BBD7D39F08A96BC5D277F5AEF10", + "CRC32": "699E7CA5", + "BLAKE3": "63A11854CB943B1324FBDDBE4412C02A03270A3152C00CD7E7D48D2720DDA80F" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/112836" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/19efd029-f4db-4964-b6eb-7e585eef53f9/width=450/1459943.jpeg", + "nsfw": "X", + "width": 857, + "height": 1152, + "hash": "U6EM2sU]00Mc0f}S%f0K000g~V~VD4pe=tNa", + "meta": { + "Size": "536x720", + "seed": 3528154938, + "Model": "based66_v30", + "steps": 25, + "hashes": { + "model": "2fcdee6e9c" + }, + "prompt": "masterpiece, detailed, high quality, absurdres, 1girl, solo, shortstack, huge breasts, wide hips, thick thighs, cowboy shot,", + "sampler": "DDIM", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "2fcdee6e9c", + "name": "based66_v30", + "type": "model" + }, + { + "hash": "834d151d9a09", + "name": "10", + "type": "lora", + "weight": null + } + ], + "Model hash": "2fcdee6e9c", + "AddNet Enabled": "True", + "AddNet Model 1": "Concept_shortstack-10(834d151d9a09)", + "negativePrompt": "EasyNegativeV2, badhandv4, watermark, signature, speech bubble, multiple views, depth of field, twitter username, reference sheet, greyscale, monochrome, censored, holding, letterboxed,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.3", + "SD upscale overlap": "64", + "SD upscale upscaler": "4x-AnimeSharp" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9ff601a1-1894-4243-83b1-9e04cfe4fb38/width=450/1459941.jpeg", + "nsfw": "Soft", + "width": 857, + "height": 1152, + "hash": "UMH-0w%09w$e}?s8wHnhIca}~9xZ==oIoMf9", + "meta": { + "Size": "536x720", + "seed": 3528154942, + "Model": "based66_v30", + "steps": 25, + "hashes": { + "model": "2fcdee6e9c" + }, + "prompt": "masterpiece, detailed, high quality, absurdres, 1girl, solo, shortstack, huge breasts, wide hips, thick thighs, cowboy shot,", + "sampler": "DDIM", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "2fcdee6e9c", + "name": "based66_v30", + "type": "model" + }, + { + "hash": "834d151d9a09", + "name": "10", + "type": "lora", + "weight": null + } + ], + "Model hash": "2fcdee6e9c", + "AddNet Enabled": "True", + "AddNet Model 1": "Concept_shortstack-10(834d151d9a09)", + "negativePrompt": "EasyNegativeV2, badhandv4, watermark, signature, speech bubble, multiple views, depth of field, twitter username, reference sheet, greyscale, monochrome, censored, holding, letterboxed,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.3", + "SD upscale overlap": "64", + "SD upscale upscaler": "4x-AnimeSharp" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/27ab591f-8f69-4861-b0fe-23209a99afd3/width=450/1459940.jpeg", + "nsfw": "Soft", + "width": 857, + "height": 1152, + "hash": "UKHBiBDi0e-=*0Ri$~a#%hM{D$-po~n#9ZkW", + "meta": { + "Size": "536x720", + "seed": 3528154946, + "Model": "based66_v30", + "steps": 25, + "hashes": { + "model": "2fcdee6e9c" + }, + "prompt": "masterpiece, detailed, high quality, absurdres, 1girl, solo, shortstack, huge breasts, wide hips, thick thighs, cowboy shot,", + "sampler": "DDIM", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "2fcdee6e9c", + "name": "based66_v30", + "type": "model" + }, + { + "hash": "834d151d9a09", + "name": "10", + "type": "lora", + "weight": null + } + ], + "Model hash": "2fcdee6e9c", + "AddNet Enabled": "True", + "AddNet Model 1": "Concept_shortstack-10(834d151d9a09)", + "negativePrompt": "EasyNegativeV2, badhandv4, watermark, signature, speech bubble, multiple views, depth of field, twitter username, reference sheet, greyscale, monochrome, censored, holding, letterboxed,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.3", + "SD upscale overlap": "64", + "SD upscale upscaler": "4x-AnimeSharp" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/de2c91f5-ca16-4b89-9dc1-2ca69db92513/width=450/1459942.jpeg", + "nsfw": "X", + "width": 857, + "height": 1152, + "hash": "URH-Y{t6bWoL~oof%0R*jXWC?aWCIoWX%2WV", + "meta": { + "Size": "536x720", + "seed": 3528154950, + "Model": "based66_v30", + "steps": 25, + "hashes": { + "model": "2fcdee6e9c" + }, + "prompt": "masterpiece, detailed, high quality, absurdres, 1girl, solo, shortstack, huge breasts, wide hips, thick thighs, cowboy shot,", + "sampler": "DDIM", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "2fcdee6e9c", + "name": "based66_v30", + "type": "model" + }, + { + "hash": "834d151d9a09", + "name": "10", + "type": "lora", + "weight": null + } + ], + "Model hash": "2fcdee6e9c", + "AddNet Enabled": "True", + "AddNet Model 1": "Concept_shortstack-10(834d151d9a09)", + "negativePrompt": "EasyNegativeV2, badhandv4, watermark, signature, speech bubble, multiple views, depth of field, twitter username, reference sheet, greyscale, monochrome, censored, holding, letterboxed,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.3", + "SD upscale overlap": "64", + "SD upscale upscaler": "4x-AnimeSharp" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5bddd706-aa58-4f4d-9b94-eccbd49400e8/width=450/1459939.jpeg", + "nsfw": "Soft", + "width": 857, + "height": 1152, + "hash": "UAIN:V4:ChrGL2S^01-:4qs+01tkXMMz~UM}", + "meta": { + "Size": "536x720", + "seed": 3528154954, + "Model": "based66_v30", + "steps": 25, + "hashes": { + "model": "2fcdee6e9c" + }, + "prompt": "masterpiece, detailed, high quality, absurdres, 1girl, solo, shortstack, huge breasts, wide hips, thick thighs, cowboy shot,", + "sampler": "DDIM", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "2fcdee6e9c", + "name": "based66_v30", + "type": "model" + }, + { + "hash": "834d151d9a09", + "name": "10", + "type": "lora", + "weight": null + } + ], + "Model hash": "2fcdee6e9c", + "AddNet Enabled": "True", + "AddNet Model 1": "Concept_shortstack-10(834d151d9a09)", + "negativePrompt": "EasyNegativeV2, badhandv4, watermark, signature, speech bubble, multiple views, depth of field, twitter username, reference sheet, greyscale, monochrome, censored, holding, letterboxed,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.3", + "SD upscale overlap": "64", + "SD upscale upscaler": "4x-AnimeSharp" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5c6462b3-f063-456a-a4c8-ae9b1c9ba7b3/width=450/1459945.jpeg", + "nsfw": "Soft", + "width": 857, + "height": 1152, + "hash": "UJGHxUs.?Zxa~Bs.R%t657s:R-fi4:WoE2oL", + "meta": { + "Size": "536x720", + "seed": 3528154958, + "Model": "based66_v30", + "steps": 25, + "hashes": { + "model": "2fcdee6e9c" + }, + "prompt": "masterpiece, detailed, high quality, absurdres, 1girl, solo, shortstack, huge breasts, wide hips, thick thighs, cowboy shot,", + "sampler": "DDIM", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "2fcdee6e9c", + "name": "based66_v30", + "type": "model" + }, + { + "hash": "834d151d9a09", + "name": "10", + "type": "lora", + "weight": null + } + ], + "Model hash": "2fcdee6e9c", + "AddNet Enabled": "True", + "AddNet Model 1": "Concept_shortstack-10(834d151d9a09)", + "negativePrompt": "EasyNegativeV2, badhandv4, watermark, signature, speech bubble, multiple views, depth of field, twitter username, reference sheet, greyscale, monochrome, censored, holding, letterboxed,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.3", + "SD upscale overlap": "64", + "SD upscale upscaler": "4x-AnimeSharp" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c6a74864-93d2-442a-b0e7-ba346ac458be/width=450/1459947.jpeg", + "nsfw": "X", + "width": 857, + "height": 1152, + "hash": "UNFF1_t70KNG~Bj[E1WB9YR%-ps.s,WCW?s:", + "meta": { + "Size": "536x720", + "seed": 3528154962, + "Model": "based66_v30", + "steps": 25, + "hashes": { + "model": "2fcdee6e9c" + }, + "prompt": "masterpiece, detailed, high quality, absurdres, 1girl, solo, shortstack, huge breasts, wide hips, thick thighs, cowboy shot,", + "sampler": "DDIM", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "2fcdee6e9c", + "name": "based66_v30", + "type": "model" + }, + { + "hash": "834d151d9a09", + "name": "10", + "type": "lora", + "weight": null + } + ], + "Model hash": "2fcdee6e9c", + "AddNet Enabled": "True", + "AddNet Model 1": "Concept_shortstack-10(834d151d9a09)", + "negativePrompt": "EasyNegativeV2, badhandv4, watermark, signature, speech bubble, multiple views, depth of field, twitter username, reference sheet, greyscale, monochrome, censored, holding, letterboxed,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.3", + "SD upscale overlap": "64", + "SD upscale upscaler": "4x-AnimeSharp" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1c809bbb-9e3e-4f4e-a826-b8a932fc8812/width=450/1459946.jpeg", + "nsfw": "Mature", + "width": 857, + "height": 1152, + "hash": "UOHxsj9uPBrDT}N{?bn3tTkDM~RN9bnO-pS1", + "meta": { + "Size": "536x720", + "seed": 3528154966, + "Model": "based66_v30", + "steps": 25, + "hashes": { + "model": "2fcdee6e9c" + }, + "prompt": "masterpiece, detailed, high quality, absurdres, 1girl, solo, shortstack, huge breasts, wide hips, thick thighs, cowboy shot,", + "sampler": "DDIM", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "2fcdee6e9c", + "name": "based66_v30", + "type": "model" + }, + { + "hash": "834d151d9a09", + "name": "10", + "type": "lora", + "weight": null + } + ], + "Model hash": "2fcdee6e9c", + "AddNet Enabled": "True", + "AddNet Model 1": "Concept_shortstack-10(834d151d9a09)", + "negativePrompt": "EasyNegativeV2, badhandv4, watermark, signature, speech bubble, multiple views, depth of field, twitter username, reference sheet, greyscale, monochrome, censored, holding, letterboxed,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.3", + "SD upscale overlap": "64", + "SD upscale upscaler": "4x-AnimeSharp" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2204a879-a12d-4444-a795-e01ff82fe87f/width=450/1459948.jpeg", + "nsfw": "Mature", + "width": 857, + "height": 1152, + "hash": "UDEL$[tS00.7Y4RQxG?vtQIU9FxZ00rs~Woz", + "meta": { + "Size": "536x720", + "seed": 3528154970, + "Model": "based66_v30", + "steps": 25, + "hashes": { + "model": "2fcdee6e9c" + }, + "prompt": "masterpiece, detailed, high quality, absurdres, 1girl, solo, shortstack, huge breasts, wide hips, thick thighs, cowboy shot,", + "sampler": "DDIM", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "2fcdee6e9c", + "name": "based66_v30", + "type": "model" + }, + { + "hash": "834d151d9a09", + "name": "10", + "type": "lora", + "weight": null + } + ], + "Model hash": "2fcdee6e9c", + "AddNet Enabled": "True", + "AddNet Model 1": "Concept_shortstack-10(834d151d9a09)", + "negativePrompt": "EasyNegativeV2, badhandv4, watermark, signature, speech bubble, multiple views, depth of field, twitter username, reference sheet, greyscale, monochrome, censored, holding, letterboxed,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.3", + "SD upscale overlap": "64", + "SD upscale upscaler": "4x-AnimeSharp" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/bd90a591-7119-4178-acc0-99cf6b190e48/width=450/1459949.jpeg", + "nsfw": "Mature", + "width": 857, + "height": 1152, + "hash": "UXJRH-yZ5rR*D,ESsDxtsqRkRini9ae-xat7", + "meta": { + "Size": "536x720", + "seed": 3528154974, + "Model": "based66_v30", + "steps": 25, + "hashes": { + "model": "2fcdee6e9c" + }, + "prompt": "masterpiece, detailed, high quality, absurdres, 1girl, solo, shortstack, huge breasts, wide hips, thick thighs, cowboy shot,", + "sampler": "DDIM", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "2fcdee6e9c", + "name": "based66_v30", + "type": "model" + }, + { + "hash": "834d151d9a09", + "name": "10", + "type": "lora", + "weight": null + } + ], + "Model hash": "2fcdee6e9c", + "AddNet Enabled": "True", + "AddNet Model 1": "Concept_shortstack-10(834d151d9a09)", + "negativePrompt": "EasyNegativeV2, badhandv4, watermark, signature, speech bubble, multiple views, depth of field, twitter username, reference sheet, greyscale, monochrome, censored, holding, letterboxed,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.3", + "SD upscale overlap": "64", + "SD upscale upscaler": "4x-AnimeSharp" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/112836" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/Concept_shortstack-10.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/Concept_shortstack-10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..6b41bb71f447c287fd68534866a59166e5b3e5a3 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/Concept_shortstack-10.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:8b6902d9114b96c783e3bc6109bdbdc10f32925a9d65aa59d2c3a4129e1e1ae2 +size 1532035 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/Concept_shortstack-10.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/Concept_shortstack-10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..7a80ea009fe522e1caadb8bca36bee96ea7c181c --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/Concept_shortstack-10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:18132447627dc2cef11d2f87f1d3e292882b4bbd7d39f08a96bc5d277f5aef10 +size 19064066 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/HunbrstsV3.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/HunbrstsV3.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..0e4c10a9919747ca87a6f8747b4e46acc9b74e3a --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/HunbrstsV3.civitai.info" @@ -0,0 +1,522 @@ +{ + "id": 90538, + "modelId": 85184, + "name": "v1.0", + "createdAt": "2023-06-06T17:55:09.840Z", + "updatedAt": "2023-06-06T18:00:59.863Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 207, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "DW Fake Breasts", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "HunbrstsV3.safetensors", + "id": 62270, + "sizeKB": 147572.56640625, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-06T18:01:20.380Z", + "hashes": {}, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/90538" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/aea9b337-d745-4f7b-a716-44f289f25919/width=450/1052495.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1024, + "hash": "UQK,sn-;NaX9~Vxas:t79a%2-oWVt8xtNGt6", + "meta": { + "Size": "512x512", + "seed": 1696684024, + "Model": "deliberate_v11", + "steps": 20, + "hashes": { + "model": "d8691b4d16" + }, + "prompt": "(nsfw), Photograph of beautiful 23 year old girls, iphone camera, (photorealism:1.2), photorealistic, ultrarealistic uhd face, (huge breasts:1.4), (gigantic breasts:1.1) , nipple slip, (thicc), (wide hips), (thick thighs), slim waist, hourglass figure, voluptuous, public bathroom, metal doors, graffiti, indoors, toilet stalls, warm colours, low contrast, directional lighting, poor lighting, shadow, high angle, (mirror selfie:1.2), looking at phone, (holding phone:1.2), glossy, shiny skin, subsurace scattering, specular lighting, camera flash, mid length", + "Version": "v1.3.2", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8.5, + "Clip skip": "2", + "resources": [ + { + "name": "Hunbrsts", + "type": "lora", + "weight": 0 + }, + { + "name": "HunbrstsV3", + "type": "lora", + "weight": 0.75 + }, + { + "hash": "d8691b4d16", + "name": "deliberate_v11", + "type": "model" + } + ], + "Model hash": "d8691b4d16", + "Hires steps": "30", + "silicon lips": "1.1)", + "(photorealism": "1.2), photorealistic, ultrarealistic uhd face, brown hair, mirror selfie, looking at phone, (bimbo, huge lips, bimbo lips, lips filler", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "easynegative, badhandv4, badhandsv5-neg, blurry, (worst quality), deformed, poorly drawn hands, malformed limbs, extra limbs, extra fingers, black and white, washed, monochrome, painting, cartoon, comic, blue, green, (head out of frame:1.2)", + "ADetailer model": "face_yolov8n.pt", + "bimbostyleFiveU": "0.7>\"", + "\"bimbostyleFiveU": "529beeba285b\"", + "ADetailer prompt": "\"masterpiece, Photograph of a beautiful 23 year old girl, iphone", + "ADetailer version": "23.6.2", + "Denoising strength": "0.35", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.65", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1004fc6d-4521-4f95-aec3-14b931bb1de7/width=450/1052496.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1024, + "hash": "ULKd6.Ip0Kxu~WRjxtSgIVWC-;NG0LWC?aR*", + "meta": { + "Size": "512x512", + "seed": 1571606384, + "Model": "abyssorangemix3AOM3_aom3a1b", + "steps": 20, + "hashes": { + "model": "5493a0ec49" + }, + "prompt": "(nsfw), Photograph of beautiful 23 year old girls, iphone camera, (photorealism:1.2), photorealistic, ultrarealistic uhd face, (huge breasts:1.4), (gigantic breasts:1.1) , nipple slip, (thicc), (wide hips), (thick thighs), slim waist, hourglass figure, voluptuous, public bathroom, metal doors, graffiti, indoors, toilet stalls, warm colours, low contrast, directional lighting, poor lighting, shadow, high angle, (mirror selfie:1.2), looking at phone, (holding phone:1.2), glossy, shiny skin, subsurace scattering, specular lighting, camera flash, mid length", + "Version": "v1.3.2", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8.5, + "Clip skip": "2", + "resources": [ + { + "name": "HunbrstsV3", + "type": "lora", + "weight": 0.85 + }, + { + "hash": "5493a0ec49", + "name": "abyssorangemix3AOM3_aom3a1b", + "type": "model" + } + ], + "Model hash": "5493a0ec49", + "Hires steps": "30", + "silicon lips": "1.1)", + "(photorealism": "1.2), photorealistic, ultrarealistic uhd face, brown hair, mirror selfie, looking at phone, (bimbo, huge lips, bimbo lips, lips filler", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "easynegative, badhandv4, badhandsv5-neg, blurry, (worst quality), deformed, poorly drawn hands, malformed limbs, extra limbs, extra fingers, black and white, washed, monochrome, painting, cartoon, comic, blue, green, (head out of frame:1.2)", + "ADetailer model": "face_yolov8n.pt", + "bimbostyleFiveU": "0.7>\"", + "\"bimbostyleFiveU": "529beeba285b\"", + "ADetailer prompt": "\"masterpiece, Photograph of a beautiful 23 year old girl, iphone", + "ADetailer version": "23.6.2", + "Denoising strength": "0.35", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.65", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a4857574-92bd-46be-8fb4-a4e614b9a64d/width=450/1052497.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1536, + "hash": "UOJGvOk8-:of~V%L-:ay9t%M%1kCX9WBjYof", + "meta": { + "Size": "512x768", + "seed": 1626859917, + "Model": "deliberate_v11", + "steps": 25, + "hashes": { + "model": "d8691b4d16" + }, + "prompt": "masterpiece, (best quality), (nsfw), Photograph portrait of beautiful 23 year old girls, (photorealism:1.2), photorealistic, ultrarealistic uhd face, (huge breasts:1.4), (gigantic breasts:1.1) , nipple slip, areolae, (thicc), (wide hips), (thick thighs), slim waist, hourglass figure, voluptuous, dressing room, warm colours, high contrast, directional lighting, warm lighting, shadow, high angle, (selfie:1.2), glossy, shiny skin, oily skin, subsurace scattering, specular lighting, mid length", + "Version": "v1.3.2", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "Hunbrsts", + "type": "lora", + "weight": 0 + }, + { + "name": "HunbrstsV3", + "type": "lora", + "weight": 0.75 + }, + { + "hash": "d8691b4d16", + "name": "deliberate_v11", + "type": "model" + } + ], + "Model hash": "d8691b4d16", + "Hires steps": "20", + "(photorealism": "1.2), photorealistic, ultrarealistic uhd face, bimbo, (bimbo lips), (lips filler), (silicon lips)", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "easynegative, badhandv4, badhandsv5-neg, blurry, (worst quality), deformed, poorly drawn hands, malformed limbs, extra limbs, extra fingers, black and white, washed, monochrome, painting, cartoon, comic", + "ADetailer model": "face_yolov8s.pt", + "bimbostyleFiveU": "0.7>\"", + "\"bimbostyleFiveU": "529beeba285b\"", + "ADetailer prompt": "\"masterpiece, (best quality), (nsfw), Portrait of beautiful 23 year old girls", + "ADetailer version": "23.6.2", + "Denoising strength": "0.35", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.55", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4070c9d2-a5d7-47d8-8105-568153bd5000/width=450/1052498.jpeg", + "nsfw": "None", + "width": 768, + "height": 1152, + "hash": "U9FODd~B009axFM|?G%L01Io-ps:0LS2jGE1", + "meta": { + "Size": "512x768", + "seed": 214180827, + "Model": "revAnimated_v122", + "steps": 20, + "hashes": { + "model": "4199bcdd14" + }, + "prompt": "Best quality, masterpiece , ultra high res, (nsfw), Photograph of beautiful 23 year old girl, (portrait:1.3), (photorealism:1.2), photorealistic, ultrarealistic uhd face, brown hair, brown eyes, (huge breasts:1.4), (gigantic breasts:1.1) , nipple slip, (thicc), (wide hips), (thick thighs), slim waist, hourglass figure, voluptuous, intricate irises , library, desks, candles, books, tomes, corset, warm colours, high contrast, directional lighting, warm vibrant lighting, shadow, oily skin, glossy, subsurface scattering, specular lighting, mid length, bust portrait, magic, wizards, arcane, ethereal, fantasy, lamps, claustrophobic, perfect skin", + "Version": "v1.3.2", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "HunbrstsV3", + "type": "lora", + "weight": 0.75 + }, + { + "name": "Loraeyes_V1", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "4199bcdd14", + "name": "revAnimated_v122", + "type": "model" + } + ], + "Model hash": "4199bcdd14", + "Hires steps": "20", + "Loraeyes_V1": "0.6>, mouth open, shocked raised eyebrows\"", + "\"Loraeyes_V1": "da8286d2ab99\"", + "(photorealism": "1.2), photorealistic, ultrarealistic uhd face, brown hair, brown eyes", + "Hires upscale": "1.5", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "easynegative, badhandv4, badhandsv5-neg, blurry, (worst quality), deformed, poorly drawn hands, malformed limbs, extra limbs, extra fingers, black and white, washed, monochrome, painting, cartoon, comic, blue, green, bruise, veins, blemishes, scar", + "ADetailer model": "mediapipe_face_full", + "ADetailer prompt": "\"Best quality, masterpiece , ultra high res, (nsfw), Photograph of beautiful woman", + "ADetailer version": "23.6.2", + "Denoising strength": "0.4", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "20", + "ADetailer negative prompt": "\"blurry, (worst quality), deformed, poorly drawn hands, malformed limbs, extra limbs, extra fingers, black and white, washed, monochrome, painting, cartoon, comic, blue, green, bruise, veins, blemishes, scar\"", + "ADetailer denoising strength": "0.2", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/03bb63f8-cea0-4519-a8fc-236061e57126/width=450/1052499.jpeg", + "nsfw": "None", + "width": 512, + "height": 512, + "hash": "U7Gazk?H00I:004.o}NK00-p-VIT~X?H9t%L", + "meta": { + "Size": "512x512", + "seed": 818902948, + "Model": "revAnimated_v122", + "steps": 30, + "hashes": { + "model": "4199bcdd14" + }, + "prompt": "Best quality, masterpiece , ultra high res, (nsfw), Photograph of beautiful 23 year old girl, (bust portrait), (photorealism:1.2), photorealistic, ultrarealistic uhd face, brown hair, brown eyes, (huge breasts:1.4), (gigantic breasts:1.1) , nipple slip, (thicc), (wide hips), (thick thighs), slim waist, hourglass figure, voluptuous, intricate irises , library, desks, candles, books, tomes, corset, warm colours, high contrast, directional lighting, warm vibrant lighting, shadow, oily skin, glossy, subsurface scattering, specular lighting, mid length, bust portrait, magic, wizards, arcane, ethereal, fantasy, lamps, claustrophobic, perfect skin", + "Version": "v1.3.2", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "HunbrstsV3", + "type": "lora", + "weight": 0.75 + }, + { + "name": "Loraeyes_V1", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "4199bcdd14", + "name": "revAnimated_v122", + "type": "model" + } + ], + "Model hash": "4199bcdd14", + "\"HunbrstsV3": "1da9a063d5ca", + "Loraeyes_V1": "da8286d2ab99\"", + "negativePrompt": "easynegative, badhandv4, badhandsv5-neg, blurry, (worst quality), deformed, poorly drawn hands, malformed limbs, extra limbs, extra fingers, black and white, washed, monochrome, painting, cartoon, comic, blue, green, bruise, veins, blemishes, scar" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/eb0d391b-031e-4bfa-990e-7235cdc745fa/width=450/1052500.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UGF#XR^j01t7~BxtIpt7IVR*X9bH0fs:-oWB", + "meta": { + "Size": "512x512", + "seed": 703621575, + "Model": "revAnimated_v122", + "steps": 30, + "hashes": { + "model": "4199bcdd14" + }, + "prompt": "Best quality, masterpiece , ultra high res, (nsfw), Photograph of beautiful 23 year old girl, (photorealism:1.2), photorealistic, ultrarealistic uhd face, brown hair, brown eyes, (huge breasts:1.4), (gigantic breasts:1.1) , nipple slip, (thicc), (wide hips), (thick thighs), slim waist, hourglass figure, voluptuous, intricate irises , library, desks, candles, books, tomes, corset, warm colours, high contrast, directional lighting, warm vibrant lighting, shadow, oily skin, glossy, subsurface scattering, specular lighting, mid length, bust portrait, magic, wizards, arcane, ethereal, fantasy, lamps, claustrophobic, perfect skin", + "Version": "v1.3.2", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "HunbrstsV3", + "type": "lora", + "weight": 0.75 + }, + { + "name": "Loraeyes_V1", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "4199bcdd14", + "name": "revAnimated_v122", + "type": "model" + } + ], + "Model hash": "4199bcdd14", + "\"HunbrstsV3": "1da9a063d5ca", + "Loraeyes_V1": "da8286d2ab99\"", + "negativePrompt": "easynegative, badhandv4, badhandsv5-neg, blurry, (worst quality), deformed, poorly drawn hands, malformed limbs, extra limbs, extra fingers, black and white, washed, monochrome, painting, cartoon, comic, blue, green, bruise, veins, blemishes, scar" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/75c680bf-0879-4f7a-96b9-d3988c648e35/width=450/1052501.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1024, + "hash": "U6Bfqh~W01%L%M-:%2%M00WB?Hxu01a#~VIp", + "meta": { + "Size": "512x512", + "seed": 703621569, + "Model": "majicmixRealistic_v5", + "steps": 30, + "hashes": { + "model": "33c9f6dfcb" + }, + "prompt": "Best quality, masterpiece , ultra high res, (nsfw), Photograph of beautiful 23 year old girl, (photorealism:1.2), photorealistic, ultrarealistic uhd face, brown hair, brown eyes, (huge breasts:1.4), (gigantic breasts:1.1) , nipple slip, (thicc), (wide hips), (thick thighs), slim waist, hourglass figure, voluptuous, intricate irises , library, desks, candles, books, tomes, corset, warm colours, high contrast, directional lighting, warm vibrant lighting, shadow, glossy, subsurface scattering, specular lighting, mid length, bust portrait, magic, wizards, arcane, ethereal, fantasy, lamps, claustrophobic, perfect skin", + "Version": "v1.3.2", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "HunbrstsV3", + "type": "lora", + "weight": 0.75 + }, + { + "name": "Loraeyes_V1", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "33c9f6dfcb", + "name": "majicmixRealistic_v5", + "type": "model" + } + ], + "Model hash": "33c9f6dfcb", + "Hires steps": "20", + "Loraeyes_V1": "0.6>, mouth open, shocked raised eyebrows\"", + "\"Loraeyes_V1": "da8286d2ab99\"", + "(photorealism": "1.2), photorealistic, ultrarealistic uhd face, brown hair, brown eyes", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "easynegative, badhandv4, badhandsv5-neg, blurry, (worst quality), deformed, poorly drawn hands, malformed limbs, extra limbs, extra fingers, black and white, washed, monochrome, painting, cartoon, comic, blue, green, bruise, veins, blemishes, scar", + "ADetailer model": "face_yolov8s.pt", + "ADetailer prompt": "\"Best quality, masterpiece , ultra high res, (nsfw), Photograph of beautiful 23 year old girl", + "ADetailer version": "23.6.2", + "Denoising strength": "0.4", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "20", + "ADetailer negative prompt": "\"blurry, (worst quality), deformed, poorly drawn hands, malformed limbs, extra limbs, extra fingers, black and white, washed, monochrome, painting, cartoon, comic, blue, green, bruise, veins, blemishes, scar\"", + "ADetailer denoising strength": "0.55", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9e6fcf30-09e1-4a9b-93c7-06db1416dfbb/width=450/1052502.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1024, + "hash": "UEE.eAXS9a%1XS~VoeD*9aozi_D%W=s:xaM{", + "meta": { + "Size": "512x512", + "seed": 703621572, + "Model": "majicmixRealistic_v5", + "steps": 30, + "hashes": { + "model": "33c9f6dfcb" + }, + "prompt": "Best quality, masterpiece , ultra high res, (nsfw), Photograph of beautiful 23 year old girl, (photorealism:1.2), photorealistic, ultrarealistic uhd face, brown hair, brown eyes, (huge breasts:1.4), (gigantic breasts:1.1) , nipple slip, (thicc), (wide hips), (thick thighs), slim waist, hourglass figure, voluptuous, intricate irises , library, desks, candles, books, tomes, corset, warm colours, high contrast, directional lighting, warm vibrant lighting, shadow, glossy, subsurface scattering, specular lighting, mid length, bust portrait, magic, wizards, arcane, ethereal, fantasy, lamps, claustrophobic, perfect skin", + "Version": "v1.3.2", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "HunbrstsV3", + "type": "lora", + "weight": 0.75 + }, + { + "name": "Loraeyes_V1", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "33c9f6dfcb", + "name": "majicmixRealistic_v5", + "type": "model" + } + ], + "Model hash": "33c9f6dfcb", + "Hires steps": "20", + "Loraeyes_V1": "0.6>, mouth open, shocked raised eyebrows\"", + "\"Loraeyes_V1": "da8286d2ab99\"", + "(photorealism": "1.2), photorealistic, ultrarealistic uhd face, brown hair, brown eyes", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "easynegative, badhandv4, badhandsv5-neg, blurry, (worst quality), deformed, poorly drawn hands, malformed limbs, extra limbs, extra fingers, black and white, washed, monochrome, painting, cartoon, comic, blue, green, bruise, veins, blemishes, scar", + "ADetailer model": "face_yolov8s.pt", + "ADetailer prompt": "\"Best quality, masterpiece , ultra high res, (nsfw), Photograph of beautiful 23 year old girl", + "ADetailer version": "23.6.2", + "Denoising strength": "0.4", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "20", + "ADetailer negative prompt": "\"blurry, (worst quality), deformed, poorly drawn hands, malformed limbs, extra limbs, extra fingers, black and white, washed, monochrome, painting, cartoon, comic, blue, green, bruise, veins, blemishes, scar\"", + "ADetailer denoising strength": "0.55", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ea7bfaef-5c21-42b7-800e-4f5d511330d4/width=450/1052504.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1024, + "hash": "UAJtF@0JK+00_Mt6aeD%00?b$MW=9Gt8ITtR", + "meta": { + "Size": "512x512", + "seed": 4234914392, + "Model": "deliberate_v11", + "steps": 20, + "hashes": { + "model": "d8691b4d16" + }, + "prompt": "(nsfw), Photograph of beautiful 23 year old girls, iphone camera, (photorealism:1.2), photorealistic, ultrarealistic uhd face, (huge breasts:1.4), (gigantic breasts:1.1) , nipple slip, (thicc), (wide hips), (thick thighs), slim waist, hourglass figure, voluptuous, public bathroom, toilet stalls, warm colours, low contrast, directional lighting, poor lighting, shadow, high angle, (mirror selfie:1.2), looking at phone, holding phone, glossy, shiny skin, subsurace scattering, specular lighting, camera flash, mid length", + "Version": "v1.3.2", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "Hunbrsts", + "type": "lora", + "weight": 0 + }, + { + "name": "HunbrstsV3", + "type": "lora", + "weight": 0.75 + }, + { + "hash": "d8691b4d16", + "name": "deliberate_v11", + "type": "model" + } + ], + "Model hash": "d8691b4d16", + "Hires steps": "30", + "silicon lips": "1.1)", + "(photorealism": "1.2), photorealistic, ultrarealistic uhd face, brown hair, mirror selfie, looking at phone, (bimbo, huge lips, bimbo lips, lips filler", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "easynegative, badhandv4, badhandsv5-neg, blurry, (worst quality), deformed, poorly drawn hands, malformed limbs, extra limbs, extra fingers, black and white, washed, monochrome, painting, cartoon, comic, blue, green, (head out of frame:1.2)", + "ADetailer model": "face_yolov8n.pt", + "bimbostyleFiveU": "0.7>\"", + "\"bimbostyleFiveU": "529beeba285b\"", + "ADetailer prompt": "\"masterpiece, Photograph of a beautiful 23 year old girl, iphone", + "ADetailer version": "23.6.2", + "Denoising strength": "0.35", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.55", + "ADetailer inpaint only masked": "True" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/90538" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/HunbrstsV3.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/HunbrstsV3.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..46f9038d43d5009bc2bb8caedc471da4648d4c26 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/HunbrstsV3.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/HunbrstsV3.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/HunbrstsV3.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..6ea20714e96189e513cf4c7be9b6418c52bb6cbd --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/HunbrstsV3.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:692f07bcba59821fd8e03bc97201a2fde8a12feffc849662aeb6dd55993d71a2 +size 151114308 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/age_v2.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/age_v2.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..988b5acbc333e063add39484f50b84a992b3f15e --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/age_v2.civitai.info" @@ -0,0 +1,303 @@ +{ + "id": 117149, + "modelId": 108767, + "name": "v2.0", + "createdAt": "2023-07-14T01:42:27.324Z", + "updatedAt": "2023-07-14T08:29:40.697Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 410, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Age Control", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "age_v2.safetensors", + "id": 83849, + "sizeKB": 1612.1796875, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-07-14T07:57:00.257Z", + "hashes": { + "AutoV2": "E97874A347", + "SHA256": "E97874A347CB5572CD69B8899E92F6724B3BD4C7C40263C61753917D2C37F8F6", + "CRC32": "3DEB007B", + "BLAKE3": "281530C6DE4417DDF194F74B4147685DD58EF51DA812C5E122CFE78997020B16" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/117149" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b56aa0ce-6459-4ec2-bdcd-77166d72dfb3/width=450/1550280.jpeg", + "nsfw": "Mature", + "width": 4000, + "height": 954, + "hash": "UlK-wlogWBog.AogWBoL?boeWBj[xoWBofof", + "meta": { + "Size": "370x531", + "seed": 3748131820, + "Model": "AOM3A1B_orangemixs", + "steps": 59, + "Script": "X/Y/Z plot", + "X Type": "Prompt S/R", + "hashes": { + "model": "5493a0ec49" + }, + "prompt": "(best quality, masterpiece:1.2), standing, detailed face\n(1 girl:1.3), \n(blue hair:1), (straight hair:1.1), (long hair:1), ponytail, (beautiful red eyes:1.2), (big eyes:1.2)\n(flat chest:1.2), (slim thighs:1), (skinny girl:1), (long legs:1.1)\none-piece swimsuit,old school swimsuit, pool, sunlight, cloudy sky, sun, blush, (cameltoe:1)\n", + "Version": "v1.4.0", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "age_v2_last", + "type": "lora", + "weight": 0.01 + }, + { + "hash": "5493a0ec49", + "name": "AOM3A1B_orangemixs", + "type": "model" + } + ], + "Model hash": "5493a0ec49", + "age_v2_last": "1.9>\"", + "\"age_v2_last": "959c1cfcfdda", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "negativePrompt": "(EasyNegative:0.7), (worst quality, low quality:1.4)\nback view, back, side view, side, pointed ears, (nipples:1.3)", + "Denoising strength": "0.59", + "one-piece swimsuit_v1_NAI": "0dffe6fa0086\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/af6b88f4-275b-4944-9d36-555b423ef7a5/width=450/1550281.jpeg", + "nsfw": "None", + "width": 3680, + "height": 1194, + "hash": "UiJ@?,WURjWV.7t6t7ax-;WVWCbF~pt6WBj[", + "meta": { + "seed": 2105543780, + "steps": 59, + "prompt": "(super fine illustration:1.3), (best quality, masterpiece:1.2), high resolution, bright colors, highly detailed face, detailed face\n(1 girl:1.3), (solo:1.3), \n(colored hair:1.3), short hair, (side up twin tail:1.3), (beautiful green eyes:1.2)\n\n(sitting by the bedside:1.3), arms behind, indoors\n(maid outfit, maid cosplay:1.3), thighhighs, (Brown knee high socks, long socks:1.2), high socks", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "negativePrompt": "(EasyNegative:0.7), (worst quality, low quality:1.3), (flat color, flat shading:1.3)" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ec73e6b0-b865-45ea-bd9a-7fc8fa7452ac/width=450/1549995.jpeg", + "nsfw": "None", + "width": 736, + "height": 1056, + "hash": "UUJaWK?u-o%f~q-;f+-p-;-pa$%2D,oNIVM|", + "meta": { + "Size": "370x531", + "seed": 1251923854, + "Model": "AOM3A1B_orangemixs", + "steps": 59, + "hashes": { + "model": "5493a0ec49" + }, + "prompt": "(super fine illustration:1.3), (best quality, masterpiece:1.2), detailed face\n(1 girl:1.3), (solo:1.3), \n(colored hair:1.3), short hair, (side up twin tail:1.3), (beautiful green eyes:1.2), (flat chest:1.1), (small body:1.4)\nwaiza, sitting, arms behind, indoors\n(maid outfit, maid cosplay:1.3), thighhighs, (Brown knee high socks, long socks:1.2), high socks", + "\"age_v2": "959c1cfcfdda\"", + "Version": "v1.4.0", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "age_v2", + "type": "lora", + "weight": 0.01 + }, + { + "hash": "5493a0ec49", + "name": "AOM3A1B_orangemixs", + "type": "model" + } + ], + "Model hash": "5493a0ec49", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "negativePrompt": "(EasyNegative:0.7), (worst quality, low quality:1.3), (flat color, flat shading:1.3)", + "Denoising strength": "0.59" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e28b041c-1348-4d11-8bd1-06631f0c25ec/width=450/1549997.jpeg", + "nsfw": "None", + "width": 736, + "height": 1056, + "hash": "UPJtr6~p?a?u_M%Moy%f%h%Mjcxb$+xvM|Rl", + "meta": { + "Size": "370x531", + "seed": 1251923854, + "Model": "AOM3A1B_orangemixs", + "steps": 59, + "hashes": { + "model": "5493a0ec49" + }, + "prompt": "(super fine illustration:1.3), (best quality, masterpiece:1.2), high resolution, bright colors, highly detailed face, detailed face\n(1 girl:1.3), (solo:1.3), \n(colored hair:1.3), short hair, (side up twin tail:1.3), (beautiful green eyes:1.2), (flat chest:1.1), (small body:1.4)\nwaiza, sitting, arms behind, indoors\n(maid outfit, maid cosplay:1.3), thighhighs, (Brown knee high socks, long socks:1.2), high socks", + "\"age_v2": "959c1cfcfdda\"", + "Version": "v1.4.0", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "age_v2", + "type": "lora", + "weight": 1 + }, + { + "hash": "5493a0ec49", + "name": "AOM3A1B_orangemixs", + "type": "model" + } + ], + "Model hash": "5493a0ec49", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "negativePrompt": "(EasyNegative:0.7), (worst quality, low quality:1.3), (flat color, flat shading:1.3)", + "Denoising strength": "0.59" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c41bf257-aef9-462a-90f6-570b46e6ad1d/width=450/1550270.jpeg", + "nsfw": "Soft", + "width": 736, + "height": 1056, + "hash": "UJJ*M0~p_Mo|_3-:%MtQNf~WoN%MMz-qMyIo", + "meta": { + "Size": "370x531", + "seed": 1251923854, + "Model": "AOM3A1B_orangemixs", + "steps": 59, + "hashes": { + "model": "5493a0ec49" + }, + "prompt": "(super fine illustration:1.3), (best quality, masterpiece:1.2), high resolution, bright colors, highly detailed face, detailed face\n(1 girl:1.3), (solo:1.3), \n(colored hair:1.3), short hair, (side up twin tail:1.3), (beautiful green eyes:1.2), (big breasts:1.1), (big body:1.4)\nwaiza, sitting, arms behind, indoors\n(maid outfit, maid cosplay:1.3), thighhighs, (Brown knee high socks, long socks:1.2), high socks", + "\"age_v2": "959c1cfcfdda\"", + "Version": "v1.4.0", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "age_v2", + "type": "lora", + "weight": 1.8 + }, + { + "hash": "5493a0ec49", + "name": "AOM3A1B_orangemixs", + "type": "model" + } + ], + "Model hash": "5493a0ec49", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "negativePrompt": "(EasyNegative:0.7), (worst quality, low quality:1.3), (flat color, flat shading:1.3)", + "Denoising strength": "0.59" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/78825dd0-807b-46bd-904f-7b765c5a5160/width=450/1550000.jpeg", + "nsfw": "Soft", + "width": 736, + "height": 1056, + "hash": "UBHURi0000Na0JRo?a9aNe9Z~VE25m-:H?%3", + "meta": { + "Size": "370x531", + "seed": 44890148, + "Model": "AOM3A1B_orangemixs", + "steps": 59, + "hashes": { + "model": "5493a0ec49" + }, + "prompt": "(super fine illustration:1.3), (best quality, masterpiece:1.2), high resolution, bright colors, highly detailed face, detailed face\n(1 girl:1.3), (solo:1.3), \n(colored hair:1.3), short hair, (side up twin tail:1.3), (beautiful green eyes:1.2)\n(sitting:1.3), arms behind, indoors\n(maid outfit, maid cosplay:1.3), thighhighs, (Brown knee high socks, long socks:1.2), high socks", + "\"age_v2": "959c1cfcfdda\"", + "Version": "v1.4.0", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "age_v2", + "type": "lora", + "weight": 1 + }, + { + "hash": "5493a0ec49", + "name": "AOM3A1B_orangemixs", + "type": "model" + } + ], + "Model hash": "5493a0ec49", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "negativePrompt": "(EasyNegative:0.7), (worst quality, low quality:1.3), (flat color, flat shading:1.3)", + "Denoising strength": "0.59" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d536e35b-a60c-42f0-b0b0-f1bbd8fbf47c/width=450/1549999.jpeg", + "nsfw": "Soft", + "width": 736, + "height": 1056, + "hash": "UHK^sk00?v?a_N4n?bt7IU%Mt7s:?aIVD%%2", + "meta": { + "Size": "370x531", + "seed": 4246673483, + "Model": "AOM3A1B_orangemixs", + "steps": 59, + "hashes": { + "model": "5493a0ec49" + }, + "prompt": "(super fine illustration:1.3), (best quality, masterpiece:1.2), high resolution, bright colors, highly detailed face, detailed face\n(1 girl:1.3), (solo:1.3), \n(colored hair:1.3), short hair, (side up twin tail:1.3), (beautiful green eyes:1.2)\n(sitting by the bedside:1.3), arms behind, indoors\n(maid outfit, maid cosplay:1.3), thighhighs, (Brown knee high socks, long socks:1.2), high socks", + "\"age_v2": "959c1cfcfdda\"", + "Version": "v1.4.0", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "age_v2", + "type": "lora", + "weight": 1 + }, + { + "hash": "5493a0ec49", + "name": "AOM3A1B_orangemixs", + "type": "model" + } + ], + "Model hash": "5493a0ec49", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "negativePrompt": "(EasyNegative:0.7), (worst quality, low quality:1.3), (flat color, flat shading:1.3)", + "Denoising strength": "0.59" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/117149" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/age_v2.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/age_v2.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..12760cd8ef0963299cf58424646b5cdea242585c Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/age_v2.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/age_v2.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/age_v2.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..a7b0f396d24739b7297e4bd42d76c8269c5167e1 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/age_v2.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:e97874a347cb5572cd69b8899e92f6724b3bd4c7c40263c61753917d2c37f8f6 +size 1650872 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/appleButtButtThatLooks_v10.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/appleButtButtThatLooks_v10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..d00d962666b8dba5d6ea9cb38561f03b9dafb9d1 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/appleButtButtThatLooks_v10.civitai.info" @@ -0,0 +1,474 @@ +{ + "id": 43873, + "modelId": 37904, + "name": "v1.0", + "createdAt": "2023-04-12T16:44:14.124Z", + "updatedAt": "2023-04-12T16:46:40.480Z", + "trainedWords": [ + "Apple_butt", + "huge_ass" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

v1

", + "stats": { + "downloadCount": 1195, + "ratingCount": 2, + "rating": 5 + }, + "model": { + "name": "Apple Butt [Butt that looks like Apple]", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "appleButtButtThatLooks_v10.safetensors", + "id": 33236, + "sizeKB": 73864.3828125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-12T16:46:05.347Z", + "hashes": { + "AutoV1": "4399CF80", + "AutoV2": "E26EE9BC70", + "SHA256": "E26EE9BC7053B9F8EC5D78FECACE838321199B74958125D0BE7B3A100A75772F", + "CRC32": "D182A9B1", + "BLAKE3": "387203BE633484DE3A65295AF0D261831C63CE47C4B98C1EC340AFE099E7B46E" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/43873" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/43f4eb4e-a1e2-4f83-1d64-97b22baf3800/width=450/478905.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UNKJZ5xa00a|01ayEfRk0KbH-;WV~Woer?of", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3528088593, + "Model": "anyfetus-fp16", + "steps": 20, + "hashes": { + "model": "e947eb3095" + }, + "prompt": "apple_butt,1girl, nsfw", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "e947eb3095", + "name": "anyfetus-fp16", + "type": "model" + }, + { + "hash": "01eac4a82a1b", + "name": "v1", + "type": "lora", + "weight": null + } + ], + "Model hash": "e947eb3095", + "AddNet Enabled": "True", + "AddNet Model 1": "AppleButt-v1(01eac4a82a1b)", + "negativePrompt": "bad anatomy, bad res, bad quality, error,malformed, art by bad-artist, bad-image-v2-39000, bad-hands-5, art by negprompt5, lowres, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name, (worst quality, low quality, extra digits, loli, loli face:1.3)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Discard penultimate sigma": "True" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a12fa6de-1092-444e-6d84-8ae6d092de00/width=450/478910.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UCE.U]IA00xu?cRPIUSh00oJ~VR-?HaexZWY", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2222432766, + "Model": "anyfetus-fp16", + "steps": 20, + "hashes": { + "model": "e947eb3095" + }, + "prompt": "Apple_butt, 1girl, solo, ass, long_hair, widowmaker_(overwatch), nude, colored_skin, ponytail, from_behind, tattoo, pussy, blue_hair, completely_nude, gradient_background, ass_focus, gradient, back, purple_skin, back_tattoo, facing_away, anus, leaning_forward, bent_over, simple_background, thighs", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "e947eb3095", + "name": "anyfetus-fp16", + "type": "model" + }, + { + "hash": "01eac4a82a1b", + "name": "v1", + "type": "lora", + "weight": null + } + ], + "Model hash": "e947eb3095", + "AddNet Enabled": "True", + "AddNet Model 1": "AppleButt-v1(01eac4a82a1b)", + "negativePrompt": "bad anatomy, bad res, bad quality, error,malformed, art by bad-artist, bad-image-v2-39000, bad-hands-5, art by negprompt5, lowres, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name, (worst quality, low quality, extra digits, loli, loli face:1.3)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Discard penultimate sigma": "True" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5413adab-12e5-4fec-62e4-a53843e96a00/width=450/478907.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UVLzU6Mc57X9.TMdD*W;0Kn$xaWB%2S~xts:", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2202399209, + "Model": "anyfetus-fp16", + "steps": 20, + "hashes": { + "model": "e947eb3095" + }, + "prompt": "Apple_butt, 1girl, solo, ass, long_hair, nude,ponytail, from_behind, pussy, blue_hair, ass_focus, back, facing_away, anus, leaning_forward, bent_over, simple_background, thighs", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "e947eb3095", + "name": "anyfetus-fp16", + "type": "model" + }, + { + "hash": "01eac4a82a1b", + "name": "v1", + "type": "lora", + "weight": null + } + ], + "Model hash": "e947eb3095", + "AddNet Enabled": "True", + "AddNet Model 1": "AppleButt-v1(01eac4a82a1b)", + "negativePrompt": "bad anatomy, bad res, bad quality, error,malformed, art by bad-artist, bad-image-v2-39000, bad-hands-5, art by negprompt5, lowres, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name, (worst quality, low quality, extra digits, loli, loli face:1.3)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Discard penultimate sigma": "True" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/74d82da0-fceb-4d79-52a3-60dafe9b1500/width=450/478900.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UJNIaD00QSI;B.IV9tM{00I:x]ni~p,@XSi_", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3419847721, + "Model": "anyfetus-fp16", + "steps": 20, + "hashes": { + "model": "e947eb3095" + }, + "prompt": "Apple_butt, 1girl, solo, anus, pussy, purple_eyes, twintails, ass, earrings, lying, blush, looking_at_viewer, long_hair,on_back, white_hair, sweat, thighhighs", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "e947eb3095", + "name": "anyfetus-fp16", + "type": "model" + }, + { + "hash": "01eac4a82a1b", + "name": "v1", + "type": "lora", + "weight": null + } + ], + "Model hash": "e947eb3095", + "AddNet Enabled": "True", + "AddNet Model 1": "AppleButt-v1(01eac4a82a1b)", + "negativePrompt": "bad anatomy, bad res, bad quality, error,malformed, art by bad-artist, bad-image-v2-39000, bad-hands-5, art by negprompt5, lowres, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name, (worst quality, low quality, extra digits, loli, loli face:1.3)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Discard penultimate sigma": "True" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/22839499-591a-467f-4e78-60f5a2dcec00/width=450/478903.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "ULL3u}~W%$%g0LRj#,M{00MyITNG~Ct89ZWC", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3860671418, + "Model": "anyfetus-fp16", + "steps": 20, + "hashes": { + "model": "e947eb3095" + }, + "prompt": "Apple_butt, 1girl, solo, anus, pussy, purple_eyes, twintails, ass, jewelry, earrings, lying, blush, looking_at_viewer, long_hair, legs_up, on_back, white_hair, sweat, no_panties, frown, skirt, uncensored, bangs, thighhighs", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "e947eb3095", + "name": "anyfetus-fp16", + "type": "model" + }, + { + "hash": "01eac4a82a1b", + "name": "v1", + "type": "lora", + "weight": null + } + ], + "Model hash": "e947eb3095", + "AddNet Enabled": "True", + "AddNet Model 1": "AppleButt-v1(01eac4a82a1b)", + "negativePrompt": "bad anatomy, bad res, bad quality, error,malformed, art by bad-artist, bad-image-v2-39000, bad-hands-5, art by negprompt5, lowres, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name, (worst quality, low quality, extra digits, loli, loli face:1.3)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Discard penultimate sigma": "True" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9d432949-1d61-4d9b-afa8-98c3db72c300/width=450/478904.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UNMqYUw|4U-U|1ae=xbbQ-X8%Mn+?ax[VsRP", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 715645942, + "Model": "anything-v4.5-pruned-fp32", + "steps": 20, + "hashes": { + "model": "1d10a19f06" + }, + "prompt": "Apple_butt, 1girl,solo, striped_bikini, swimsuit, bikini, ass, red_background, pussy, black_hair, short_hair, black_nails, thighs, anus, from_behind, large_breasts, thick_thighs, simple_background, huge_breasts, huge_ass", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "1d10a19f06", + "name": "anything-v4.5-pruned-fp32", + "type": "model" + }, + { + "hash": "01eac4a82a1b", + "name": "v1", + "type": "lora", + "weight": null + } + ], + "Model hash": "1d10a19f06", + "AddNet Enabled": "True", + "AddNet Model 1": "AppleButt-v1(01eac4a82a1b)", + "negativePrompt": "bad anatomy, bad res, bad quality, error,malformed, art by bad-artist, bad-image-v2-39000, bad-hands-5, art by negprompt5, lowres, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name, (worst quality, low quality, extra digits, loli, loli face:1.3)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Discard penultimate sigma": "True" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b646bfe5-1f7f-43f1-8418-06137c58ee00/width=450/478908.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UQJ@Um4nJ.WB00x]a0xuD$t7X5WB~VjFNGR*", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 4085503102, + "Model": "anyfetus-fp16", + "steps": 20, + "hashes": { + "model": "e947eb3095" + }, + "prompt": "Apple_butt, 1girl, solo, anus, pussy, purple_eyes, twintails, ass, jewelry, earrings, lying, blush, looking_at_viewer, long_hair, legs_up, on_back, white_hair, sweat, no_panties, frown, skirt, uncensored, bangs, thighhighs", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "e947eb3095", + "name": "anyfetus-fp16", + "type": "model" + }, + { + "hash": "01eac4a82a1b", + "name": "v1", + "type": "lora", + "weight": null + } + ], + "Model hash": "e947eb3095", + "AddNet Enabled": "True", + "AddNet Model 1": "AppleButt-v1(01eac4a82a1b)", + "negativePrompt": "bad anatomy, bad res, bad quality, error,malformed, art by bad-artist, bad-image-v2-39000, bad-hands-5, art by negprompt5, lowres, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name, (worst quality, low quality, extra digits, loli, loli face:1.3)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Discard penultimate sigma": "True" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3674b228-690a-4425-5d6b-3b23f9fe3e00/width=450/478914.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UDJtVQ^k0J%g%}4p4mEM1FIt-SR*00kE~pjX", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3052660961, + "Model": "anyfetus-fp16", + "steps": 20, + "hashes": { + "model": "e947eb3095" + }, + "prompt": "Apple_butt, 1girl, solo, ass, long_hair, nude,ponytail, from_behind, pussy, blue_hair, ass_focus, back, facing_away, anus, leaning_forward, bent_over, simple_background, thighs", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "e947eb3095", + "name": "anyfetus-fp16", + "type": "model" + }, + { + "hash": "01eac4a82a1b", + "name": "v1", + "type": "lora", + "weight": null + } + ], + "Model hash": "e947eb3095", + "AddNet Enabled": "True", + "AddNet Model 1": "AppleButt-v1(01eac4a82a1b)", + "negativePrompt": "bad anatomy, bad res, bad quality, error,malformed, art by bad-artist, bad-image-v2-39000, bad-hands-5, art by negprompt5, lowres, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name, (worst quality, low quality, extra digits, loli, loli face:1.3)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Discard penultimate sigma": "True" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/48bd8a74-0490-4496-362a-527fdc2a8200/width=450/478906.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UMLzQ|00BpS2ADD%jYbHtkIV~Vn%S~aeD%t7", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3015766549, + "Model": "anyfetus-fp16", + "steps": 20, + "hashes": { + "model": "e947eb3095" + }, + "prompt": "apple_butt,1girl, nsfw", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "e947eb3095", + "name": "anyfetus-fp16", + "type": "model" + }, + { + "hash": "01eac4a82a1b", + "name": "v1", + "type": "lora", + "weight": null + } + ], + "Model hash": "e947eb3095", + "AddNet Enabled": "True", + "AddNet Model 1": "AppleButt-v1(01eac4a82a1b)", + "negativePrompt": "bad anatomy, bad res, bad quality, error,malformed, art by bad-artist, bad-image-v2-39000, bad-hands-5, art by negprompt5, lowres, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name, (worst quality, low quality, extra digits, loli, loli face:1.3)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Discard penultimate sigma": "True" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5ac79e24-a4b5-4021-2a30-8a35e1547000/width=450/478909.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UONJnD00YQ%g_NIUbvxuNatR?HaK?bofIUjZ", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 894347068, + "Model": "anyfetus-fp16", + "steps": 20, + "hashes": { + "model": "e947eb3095" + }, + "prompt": "apple_butt,1girl, nsfw, from_behind, blonde", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "e947eb3095", + "name": "anyfetus-fp16", + "type": "model" + }, + { + "hash": "01eac4a82a1b", + "name": "v1", + "type": "lora", + "weight": null + } + ], + "Model hash": "e947eb3095", + "AddNet Enabled": "True", + "AddNet Model 1": "AppleButt-v1(01eac4a82a1b)", + "negativePrompt": "bad anatomy, bad res, bad quality, error,malformed, art by bad-artist, bad-image-v2-39000, bad-hands-5, art by negprompt5, lowres, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name, (worst quality, low quality, extra digits, loli, loli face:1.3)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.9", + "AddNet Weight B 1": "0.9", + "Discard penultimate sigma": "True" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/43873" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/appleButtButtThatLooks_v10.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/appleButtButtThatLooks_v10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..e27a1ae5eaa28575afa39b409e068d436b9fefdb Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/appleButtButtThatLooks_v10.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/appleButtButtThatLooks_v10.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/appleButtButtThatLooks_v10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..f472521ca936e95913a6117ebece2ef2589dbe03 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/appleButtButtThatLooks_v10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:e26ee9bc7053b9f8ec5d78fecace838321199b74958125d0be7b3a100a75772f +size 75637128 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/betterLegwearsLora_offset20.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/betterLegwearsLora_offset20.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..b634761720f93c649e5ed38e7edc2d6ae73d1317 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/betterLegwearsLora_offset20.civitai.info" @@ -0,0 +1,195 @@ +{ + "id": 30669, + "modelId": 12945, + "name": "offset2.0", + "createdAt": "2023-03-28T12:44:25.858Z", + "updatedAt": "2023-03-28T12:45:27.781Z", + "trainedWords": [ + "legs,pantyhose", + "wet clothes", + "public tattoo" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

\u6211\u66f4\u65b0\u4e86\u8bad\u7ec3\u96c6\uff0c\u73b0\u5728\u589e\u5f3a\u4e86\u6cdb\u5316\u6027\uff0c\u540c\u65f6\u591a\u4e86\u4e00\u4e9b\u6bd4\u8f83coooooool\u7684\u65b0\u529f\u80fd\uff0c\u6bd4\u5982\u4f60\u53ef\u4ee5\u5c1d\u8bd5\u5728tag\u5728\u8f93\u5165wet clothes\u83b7\u5f97\u66f4\u52a0\u5177\u6709\u5149\u6cfd\u7684\u56fe\u50cf\uff0c

\u6216\u8005\u8f93\u5165public tattoo\u83b7\u5f97\u5177\u6709\u7eb9\u8eab\u7684\u4e1d\u889c\uff08\u662f\u4e0d\u662f\u8d85\u6da9\uff0c\u5feb\u5938\u6211\u5feb\u5938\u6211\uff09

\u4ece\u5404\u4e2a\u65b9\u9762\u6765\u8bf4\uff0c\u90fd\u5b8c\u7206\u4e86\u4e0a\u4e00\u4e2a\u7248\u672c\uff0c\u6240\u4ee5\u6211\u5220\u9664\u4e86\u4e0a\u4e00\u4e2aoffset\u7248\u672c

I've updated the training set and it now has enhanced generalisation and a few more cooooool new features, like you can try typing wet clothes in tag to get a more glossy image.

Or type public tattoo to get a stocking with a tattoo on it (isn't that super sexy? )

In all respects, it beats the last version, so I've removed the last offset version

", + "stats": { + "downloadCount": 1915, + "ratingCount": 1, + "rating": 5 + }, + "model": { + "name": "Better Legwears\uff08\u817f\u90e8\u8d28\u611f\u589e\u5f3alora\uff09", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "betterLegwearsLora_offset20.safetensors", + "id": 25291, + "sizeKB": 147570.1064453125, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-03-28T12:46:40.898Z", + "hashes": { + "AutoV1": "B3CCAF55", + "AutoV2": "1F8CE2252D", + "SHA256": "1F8CE2252D418E39D5C4A2C44C6B7D8C6A72000FFF8E40AFA536ED9986A05A4D", + "CRC32": "F79732FB", + "BLAKE3": "91DF7339C3207FF649F71D615D08F0AD4B647AC3A55106B3DEEFAC7CBA6F8E58" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/30669" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f7bfeab2-d26f-480a-a1c2-a80b1fbefa00/width=450/348307.jpeg", + "nsfw": false, + "width": 2048, + "height": 3072, + "hash": "U5F}}}0cW9}@KjQn010g0J-:AB0K[w9G4;01", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 4216571248, + "steps": 20, + "prompt": "masterpiece, best quality,legs,pantyhose, black stocing, ,wet cloths", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "Mask blur": "4", + "resources": [ + { + "name": "BlackStocking2", + "type": "lora", + "weight": 0.8 + } + ], + "Model hash": "48ed3d1a26", + "negativePrompt": "(worst quality, low quality:1.4) EasyNegative", + "Denoising strength": "0.6" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/df5f4976-51e5-449d-b960-686aa802d900/width=450/348305.jpeg", + "nsfw": true, + "width": 2048, + "height": 3072, + "hash": "U9H.1.]~02RO01Vq}@JVs5Fy4U}@=yS$EL%M", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3763892908, + "steps": 20, + "prompt": "masterpiece, best quality,legs,pantyhose, black stocing, ,wet cloths", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "Mask blur": "4", + "resources": [ + { + "name": "BlackStocking2", + "type": "lora", + "weight": 0.8 + } + ], + "Model hash": "48ed3d1a26", + "negativePrompt": "(worst quality, low quality:1.4) EasyNegative", + "Denoising strength": "0.4" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d93043f0-2856-4806-23e4-ffa7a6a63200/width=450/348308.jpeg", + "nsfw": false, + "width": 1024, + "height": 1536, + "hash": "UhJk$OM{_Nx]_3xut7-p%2e-V@NGt7ShoeV@", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 812623275, + "steps": 20, + "prompt": "masterpiece, best quality, legs,pantyhose, ", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "Mask blur": "4", + "resources": [ + { + "name": "BlackStocking2", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "48ed3d1a26", + "negativePrompt": "(worst quality, low quality:1.4) EasyNegative", + "Denoising strength": "0.6" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/87bf60f5-f7c0-470f-7fa1-40d4919ecc00/width=450/348306.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UXI}x6xu.8-;?wt7-ot7jae.x[kCIoRjxDRk", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 969399491, + "steps": 20, + "prompt": "masterpiece, best quality,legs,pantyhose, public tattoo,black stocing, ,wet clothes", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "Mask blur": "4", + "resources": [ + { + "name": "BlackStocking2", + "type": "lora", + "weight": 0.8 + } + ], + "Model hash": "48ed3d1a26", + "negativePrompt": "(worst quality, low quality:1.4) EasyNegative", + "Denoising strength": "0.6" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/20a9e92e-51e8-4316-aa72-f5398098ba00/width=450/348304.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UDI#M.~W5=?v009G9Er;4o-p_3I;%g.8-;D%", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3346952150, + "steps": 20, + "prompt": "masterpiece, best quality, legs,pantyhose, ,wet cloths", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "Mask blur": "4", + "resources": [ + { + "name": "BlackStocking2", + "type": "lora", + "weight": 0.8 + } + ], + "Model hash": "48ed3d1a26", + "negativePrompt": "(worst quality, low quality:1.4) EasyNegative", + "Denoising strength": "0.6" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/30669" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/betterLegwearsLora_offset20.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/betterLegwearsLora_offset20.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..e4c1e95c1f1d004d6764eef7e4d08dfce5c8707f --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/betterLegwearsLora_offset20.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:45f73794cb7905bf248b532bfe342f47520827d92a44df31dc8a98cad6f4f361 +size 7955464 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/betterLegwearsLora_offset20.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/betterLegwearsLora_offset20.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..81c2846acf2818ff4b58f52f587e9cc44e8575cc --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/betterLegwearsLora_offset20.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:1f8ce2252d418e39d5c4a2c44c6b7d8c6a72000fff8e40afa536ed9986a05a4d +size 151111789 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/betterStomach_v2.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/betterStomach_v2.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..182f3a2fbe099030749e2d7d10f510e0e5aa81e3 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/betterStomach_v2.civitai.info" @@ -0,0 +1,118 @@ +{ + "id": 88348, + "modelId": 83136, + "name": "v2", + "createdAt": "2023-06-03T11:54:48.574Z", + "updatedAt": "2023-06-03T12:12:01.183Z", + "trainedWords": [ + "betterStomach", + "stomach", + "navel" + ], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 74, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "better Stomach", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "betterStomach_v2.safetensors", + "id": 60584, + "sizeKB": 9326.5634765625, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-03T12:15:48.730Z", + "hashes": { + "AutoV1": "1501C450", + "AutoV2": "A5231C2C15", + "SHA256": "A5231C2C15A287F782CAADC5449B0E2C4A2C8A7225F92D316B931B5FDF05EAA4", + "CRC32": "A6003C5A", + "BLAKE3": "ED5C4668673BC56D0CBC9C699D02641CCCDB21B2BFF2967FAC24909C1108A9B9" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/88348" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1bd3021a-049b-43cf-8397-b4b7177d8bca/width=450/1016639.jpeg", + "nsfw": "X", + "width": 1536, + "height": 1165, + "hash": "UUM6uD%2$*%M_NoeNGR*%#bFofj[?vbHj[WX", + "meta": { + "Size": "512x1024", + "seed": 237260947, + "Model": "Counterfeit-V2.2", + "steps": 23, + "hashes": { + "model": "7d7b896083" + }, + "prompt": "masterpiece, high quality, 1girl, solo, ultra detailed eyes, cheeks, white pupils, naked, betterStomach, \nblonde hair, twin tails, large breasts, collarbone, stomach, belly button, navel, thigh, smile, groin, pussy,\n ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "betterStomach_v2", + "type": "lora", + "weight": 1 + }, + { + "hash": "7d7b896083", + "name": "Counterfeit-V2.2", + "type": "model" + } + ], + "Model hash": "7d7b896083", + "negativePrompt": "hair accessories,(hair bangs),sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, bad anatomy,DeepNegative, facing away, looking away,tilted head, {Multiple people}, lowres,bad anatomy,bad hands, text, error, missing fingers,extra digit, fewer digits, cropped, worstquality, low quality, normal quality,jpegartifacts,signature, watermark, username,blurry,bad feet,cropped,poorly drawn hands,poorly drawn face,mutation,deformed,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,extra fingers,fewer digits,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,text,error,missing fingers,missing arms,missing legs,extra digit, extra arms, extra leg, extra foot,computer graphics, analytical art, generative art, cgi, tone mapping, an ultrafine detailed painting, a computer rendering, neo-fauvism, noise, divide, text, multiple navel, multiple nipple, bar concern, mosaic, chair, stool, worst quality, low quality, (noise:1.8), cat ear, choker, thin body, lean figure" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1b8c1f4c-6c56-4f70-be0c-26288c69381e/width=450/1016642.jpeg", + "nsfw": "X", + "width": 1100, + "height": 1024, + "hash": "UTL:=pIUIA8{~pIoof9F4.j[WBofRjWCayR*", + "meta": { + "Size": "512x1024", + "seed": 2252762192, + "Model": "Counterfeit-V2.2", + "steps": 23, + "hashes": { + "model": "7d7b896083" + }, + "prompt": "masterpiece, high quality, 1girl, solo, ultra detailed eyes, cheeks, white pupils, naked, betterStomach, \nblonde hair, twin tails, large breasts, collarbone, stomach, belly button, navel, thigh, smile, groin, pussy,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "7d7b896083", + "name": "Counterfeit-V2.2", + "type": "model" + } + ], + "Model hash": "7d7b896083", + "negativePrompt": "hair accessories,(hair bangs),sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, bad anatomy,DeepNegative, facing away, looking away,tilted head, {Multiple people}, lowres,bad anatomy,bad hands, text, error, missing fingers,extra digit, fewer digits, cropped, worstquality, low quality, normal quality,jpegartifacts,signature, watermark, username,blurry,bad feet,cropped,poorly drawn hands,poorly drawn face,mutation,deformed,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,extra fingers,fewer digits,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,text,error,missing fingers,missing arms,missing legs,extra digit, extra arms, extra leg, extra foot,computer graphics, analytical art, generative art, cgi, tone mapping, an ultrafine detailed painting, a computer rendering, neo-fauvism, noise, divide, text, multiple navel, multiple nipple, bar concern, mosaic, chair, stool, worst quality, low quality, (noise:1.8), cat ear, choker, thin body, lean figure" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/88348" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/betterStomach_v2.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/betterStomach_v2.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..877796a85832cacd08bcf1c0b685918913b67eae Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/betterStomach_v2.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/betterStomach_v2.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/betterStomach_v2.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..45450a49bc4f9a1fd6aa9edd890cce300926fafd --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/betterStomach_v2.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:a5231c2c15a287f782caadc5449b0e2c4a2c8a7225f92d316b931b5fdf05eaa4 +size 9550401 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/biggerBreasts_v2.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/biggerBreasts_v2.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..4905232a1943f2b017e95df76f326df189e6acb2 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/biggerBreasts_v2.civitai.info" @@ -0,0 +1,433 @@ +{ + "id": 59866, + "modelId": 55472, + "name": "biggerBreasts_v2", + "createdAt": "2023-05-01T15:46:19.131Z", + "updatedAt": "2023-05-01T15:53:05.608Z", + "trainedWords": [ + "breasts" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

Trained on 37 images, generated with jam_v1.

", + "stats": { + "downloadCount": 460, + "ratingCount": 1, + "rating": 5 + }, + "model": { + "name": "bigger Breasts", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "biggerBreasts_v2.safetensors", + "id": 42460, + "sizeKB": 9329.955078125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-01T15:50:39.095Z", + "hashes": { + "AutoV1": "8E876673", + "AutoV2": "2743027804", + "SHA256": "27430278041A9C53328AEB0A85331C043CB4AE402BCBEDFF8E983AEC247D2748", + "CRC32": "A5FB7623", + "BLAKE3": "20AFAC85502A32D5F96FF9BEB2AF43DE769432055F45F9ECD032065533493DF0" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/59866" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d96173ae-3bc7-4eb6-f3fe-fb6aacbac500/width=450/653379.jpeg", + "nsfw": "Soft", + "width": 1152, + "height": 1536, + "hash": "UNI#utIy00,[}ha0F|tl9ZM^VYJUAbN@VtsV", + "meta": { + "Size": "576x768", + "seed": 2326642939, + "Model": "jam_v10_pruned", + "steps": 30, + "hashes": { + "model": "28c2defd2b" + }, + "prompt": "RAW photo, (a photo of 25y.o. woman:1.1), druid, gown, breasts, blonde hair,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "resources": [ + { + "name": "hugeBreasts_v2", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "28c2defd2b", + "name": "jam_v10_pruned", + "type": "model" + } + ], + "Model hash": "28c2defd2b", + "Hires steps": "30", + "Hires upscale": "2", + "Hires upscaler": "4x_foolhardy_Remacri", + "negativePrompt": "monochrome, ugly, (worst quality:1.0), child, (asian:1.2), nude, (low quality:1.0), (3d, render, cgi, painting:1.0),", + "Denoising strength": "0.3" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/78994723-6adb-4ee3-cc4f-d81e7de7ce00/width=450/653537.jpeg", + "nsfw": "Mature", + "width": 427, + "height": 4000, + "hash": "U*NTaq~q?v_3t7j[ofofofWUWBjst7WBaybb", + "meta": { + "Size": "576x864", + "seed": 3593198991, + "Model": "anything-v3-fp16-pruned", + "steps": 30, + "Script": "X/Y/Z plot", + "X Type": "Prompt S/R", + "Y Type": "Checkpoint name", + "hashes": { + "model": "d1facd9a2b" + }, + "prompt": "RAW photo, (a photo of 25y.o. woman:1.1), (at the beach, posing:1.1), (topless:1.2), detailed nipples, breasts, fists, (high detailed skin:1.0), (smug grin:1), detailed eyes, 8k uhd, dslr, soft lighting, best quality, film grain, Fujifilm XT3, (wearing shorts, straw hat:1.2), short hair, pixie cut hair, (straight hair:1.1), (red hair:1.1), freckles:0.8) , ", + "sampler": "DPM++ 2M Karras", + "Y Values": "\"anything-v3-fp16-pruned.safetensors, deliberate_v2.safetensors [9aba26abdf], experience_80.safetensors [28bb9b6d12], flat2DAnimerge_v10.safetensors, hassakuHentaiModel_v11.safetensors [973cb455d0], icomix_V04.safetensors, jam_v10.safetensors [defe6ee38b], lucidsMix_20AlphaTest.safetensors, cyberrealistic_v20.safetensors [e0be2fb84b], mix-pro-v3-non-ema-fp16.safetensors [4a358f8c2b], amIReal_V1.safetensors [f9d8335a95], edgeOfRealism_eorV20Fp16BakedVAE.safetensors [7f6146b8a9], jam_v10_pruned.safetensors [28c2defd2b], revAnimated_v122.safetensors [4199bcdd14], uberRealisticPornMerge_urpmv13.safetensors [f93e6a50ac], henmixReal_v30.safetensors [9b213f38f8], criarcysFantasyTo_v30.safetensors [b92ad3ddaa]\"", + "cfgScale": 8, + "resources": [ + { + "name": "biggerBreasts_v2", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "d1facd9a2b", + "name": "anything-v3-fp16-pruned", + "type": "model" + } + ], + "Model hash": "d1facd9a2b", + "Hires steps": "30", + "Hires upscale": "1.5", + "Hires upscaler": "4x_foolhardy_Remacri", + "negativePrompt": "(bikini:1.1), nipplecovers, monochrome, ugly, (worst quality:1.0), (asian:1.2), (low quality:1.0), (3d, render, cgi, painting:1.0), (bad-picture-chill-75v:0.9)", + "biggerBreasts_v2": "0.6>, \"", + "Denoising strength": "0.33" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/644a76bd-c6c4-42ab-f3a2-987727dc3a00/width=450/653381.jpeg", + "nsfw": "Soft", + "width": 1152, + "height": 1536, + "hash": "USKdYrrw*IF^0Ls;9FS1Dio}rXrqo#NeoIsl", + "meta": { + "Size": "576x768", + "seed": 1318005442, + "Model": "jam_v10_pruned", + "steps": 30, + "hashes": { + "model": "28c2defd2b" + }, + "prompt": "RAW photo, (a photo of 25y.o. woman:1.1), bikini, breasts, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "resources": [ + { + "name": "hugeBreasts_v2", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "28c2defd2b", + "name": "jam_v10_pruned", + "type": "model" + } + ], + "Model hash": "28c2defd2b", + "Hires steps": "30", + "Hires upscale": "2", + "Hires upscaler": "4x_foolhardy_Remacri", + "negativePrompt": "monochrome, ugly, (worst quality:1.0), child, (asian:1.2), nude, (low quality:1.0), (3d, render, cgi, painting:1.0),", + "Denoising strength": "0.3" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b1c57dc8-21cb-4a7e-6b3e-9cd345e5ee00/width=450/653380.jpeg", + "nsfw": "Soft", + "width": 1152, + "height": 1536, + "hash": "UPKKN7}]0dJQ4nMy%gOpI:ELj?R*%MxuRinj", + "meta": { + "Size": "576x768", + "seed": 2183029778, + "Model": "jam_v10_pruned", + "steps": 30, + "hashes": { + "model": "28c2defd2b" + }, + "prompt": "RAW photo, (a photo of 25y.o. woman:1.1), wedding bride, breasts, red hair,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "resources": [ + { + "name": "hugeBreasts_v2", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "28c2defd2b", + "name": "jam_v10_pruned", + "type": "model" + } + ], + "Model hash": "28c2defd2b", + "Hires steps": "30", + "Hires upscale": "2", + "Hires upscaler": "4x_foolhardy_Remacri", + "negativePrompt": "monochrome, ugly, (worst quality:1.0), child, (asian:1.2), nude, (low quality:1.0), (3d, render, cgi, painting:1.0),", + "Denoising strength": "0.3" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/73a294d6-9226-48a6-3c11-1631f7673900/width=450/653384.jpeg", + "nsfw": "Soft", + "width": 1152, + "height": 1536, + "hash": "UHKv{pBA5%}?00Io?ZMd0%M~%3Vt^jt7E1Io", + "meta": { + "Size": "576x768", + "seed": 112780695, + "Model": "mix-pro-v3-non-ema-fp16", + "steps": 30, + "hashes": { + "model": "4a358f8c2b" + }, + "prompt": "RAW photo, (a photo of 25y.o. woman posing on bed:1.1), (breasts:1.1), red hair, high detailed skin:1.0), (smug grin:1), detailed eyes, 8k uhd, dslr, soft lighting, best quality, film grain, Fujifilm XT3, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "resources": [ + { + "name": "hugeBreasts_v2", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "4a358f8c2b", + "name": "mix-pro-v3-non-ema-fp16", + "type": "model" + } + ], + "Model hash": "4a358f8c2b", + "Hires steps": "30", + "Hires upscale": "2", + "Hires upscaler": "4x_foolhardy_Remacri", + "negativePrompt": "monochrome, ugly, (worst quality:1.0), (asian:1.2), (low quality:1.0), (3d, render, cgi, painting:1.0),", + "Denoising strength": "0.3" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/fd6381ea-217f-4c6a-d9aa-a6d999d37100/width=450/653390.jpeg", + "nsfw": "Mature", + "width": 1152, + "height": 1728, + "hash": "UPJ@zm~qlUKkKm57tmJDE3nNxZt89FxDxaxv", + "meta": { + "Size": "576x864", + "seed": 724179788, + "Model": "criarcysFantasyTo_v30", + "steps": 30, + "hashes": { + "model": "b92ad3ddaa" + }, + "prompt": "RAW photo, (a photo of 25y.o. woman:1.3), skinny, (at the beach}, posing:1.1), big breasts, (high detailed skin:1.0), (smug grin:1), detailed eyes, 8k uhd, dslr, soft lighting, best quality, film grain, Fujifilm XT3, (wearing shorts, straw hat:1.2),(pastel goth style:1.1), short hair, pixie cut hair, (straight hair:1.1), (red hair:1.1), freckles:0.9) , ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "resources": [ + { + "name": "hugeBreasts_v2", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "b92ad3ddaa", + "name": "criarcysFantasyTo_v30", + "type": "model" + } + ], + "Model hash": "b92ad3ddaa", + "Hires steps": "30", + "Hires upscale": "2", + "Hires upscaler": "4x_foolhardy_Remacri", + "negativePrompt": "monochrome, ugly, (worst quality:1.0), (asian:1.2), (low quality:1.0), (3d, render, cgi, painting:1.0), (bad-picture-chill-75v:0.9)", + "Denoising strength": "0.33" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0398ef92-f64e-4c36-eeb9-aa9bce475600/width=450/653393.jpeg", + "nsfw": "Soft", + "width": 1152, + "height": 1536, + "hash": "UFJ%a#.SEK.T}+xa0$xs01D%xZ^iaxD*Mxxs", + "meta": { + "Size": "576x768", + "seed": 3912901291, + "Model": "jam_v10_pruned", + "steps": 30, + "hashes": { + "model": "28c2defd2b" + }, + "prompt": "RAW photo, (a photo of 25y.o. woman:1.1), waitress uniform, breasts, blonde hair,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "resources": [ + { + "name": "hugeBreasts_v2", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "28c2defd2b", + "name": "jam_v10_pruned", + "type": "model" + } + ], + "Model hash": "28c2defd2b", + "Hires steps": "30", + "Hires upscale": "2", + "Hires upscaler": "4x_foolhardy_Remacri", + "negativePrompt": "monochrome, ugly, (worst quality:1.0), child, (asian:1.2), nude, (low quality:1.0), (3d, render, cgi, painting:1.0),", + "Denoising strength": "0.3" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/786ab600-894f-4f12-66a7-982b18ba8300/width=450/654146.jpeg", + "nsfw": "Soft", + "width": 1152, + "height": 1536, + "hash": "UPJ*3Z004:?u?^rWNGtlR%M{xuxu9uxua0RP", + "meta": { + "Size": "576x768", + "seed": 329609588, + "Model": "revAnimated_v122", + "steps": 30, + "hashes": { + "model": "4199bcdd14" + }, + "prompt": "RAW photo, (a photo of 25y.o. woman:1.1), (breasts:1.1), inside bus,, (high detailed skin:1.0), (smug grin:0.9), detailed eyes, 8k uhd, dslr, soft lighting, best quality, film grain, Fujifilm XT3, (wearing top and skirt:1.0), (nerd style:1.0, medium hair, braided hair, (straight hair:1.0), (brown hair:1.1), (oily hair:0.8), (makeup:0.1), , (english woman:1.0)", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "resources": [ + { + "name": "biggerBreasts_v2", + "type": "lora", + "weight": 0.5 + }, + { + "hash": "4199bcdd14", + "name": "revAnimated_v122", + "type": "model" + } + ], + "Model hash": "4199bcdd14", + "Hires steps": "30", + "Hires upscale": "2", + "Hires upscaler": "4x_foolhardy_Remacri", + "negativePrompt": "monochrome, colorful hair, ugly, (worst quality:1.0), nude, (low quality:1.0), (3d, render, cgi, painting:1.0),", + "Denoising strength": "0.3" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/05aa691f-226e-4f9f-2dda-191c2fc0f900/width=450/654147.jpeg", + "nsfw": "Soft", + "width": 1152, + "height": 1536, + "hash": "UOIpo35PNs}[%Lsm%LNG0eRk9vs9D*R*$%My", + "meta": { + "Size": "576x768", + "seed": 2457729777, + "Model": "revAnimated_v122", + "steps": 30, + "hashes": { + "model": "4199bcdd14" + }, + "prompt": "RAW photo, (a photo of 25y.o. woman:1.1), (breasts:1.1), inside room,, (high detailed skin:1.0), (smug grin:0.9), detailed eyes, 8k uhd, dslr, soft lighting, best quality, film grain, Fujifilm XT3, (wearing blouse and skirt:1.0), (Flamboyant style:1.0, long hair, undercut hair, (wavy hair:1.0), (red hair:1.1), (oily hair:0.8), (makeup:1.0), , (austrian woman:1.0)", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "resources": [ + { + "name": "biggerBreasts_v2", + "type": "lora", + "weight": 0.5 + }, + { + "hash": "4199bcdd14", + "name": "revAnimated_v122", + "type": "model" + } + ], + "Model hash": "4199bcdd14", + "Hires steps": "30", + "Hires upscale": "2", + "Hires upscaler": "4x_foolhardy_Remacri", + "negativePrompt": "monochrome, colorful hair, ugly, (worst quality:1.0), nude, (low quality:1.0), (3d, render, cgi, painting:1.0),", + "Denoising strength": "0.3" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3f0d6fa2-4c3e-4670-4775-757c4d291100/width=450/654390.jpeg", + "nsfw": "Soft", + "width": 1152, + "height": 1536, + "hash": "UaHxsf%M.SxF~qoykWV@x]%1%2Rk%Mt7xta#", + "meta": { + "Size": "576x768", + "seed": 114193869, + "Model": "henmixReal_v30", + "steps": 30, + "hashes": { + "model": "9b213f38f8" + }, + "prompt": "RAW photo, (a photo of 25y.o.woman:1.1), (big breasts:1.1), on a roof in city,, (high detailed skin:1.0), happy, detailed eyes, 8k uhd, dslr, soft lighting, best quality, film grain, Fujifilm XT3, (freckles:0.9) poofy hair, eyeliner, emo, emo makeup, goth,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "resources": [ + { + "name": "biggerBreasts_v2", + "type": "lora", + "weight": 0.8 + }, + { + "name": "sceneEmoAesthetic2010_scenev10", + "type": "lora", + "weight": 0.4 + }, + { + "hash": "9b213f38f8", + "name": "henmixReal_v30", + "type": "model" + } + ], + "Model hash": "9b213f38f8", + "Hires steps": "30", + "Hires upscale": "2", + "Hires upscaler": "4x_foolhardy_Remacri", + "negativePrompt": "monochrome, colorful hair, ugly, (worst quality:1.0), nude, old, (low quality:1.0), (3d, render, cgi, painting:1.0),", + "Denoising strength": "0.3" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/59866" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/biggerBreasts_v2.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/biggerBreasts_v2.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..bb5a78721278332c969e0d2a8c21fac8a2b1f161 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/biggerBreasts_v2.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/biggerBreasts_v2.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/biggerBreasts_v2.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..c47b72b1a75d37c2a19b558e6762ef726f49eb81 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/biggerBreasts_v2.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:27430278041a9c53328aeb0a85331c043cb4ae402bcbedff8e983aec247d2748 +size 9553874 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/bodyproportionsV25_bodyproportionsV25.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/bodyproportionsV25_bodyproportionsV25.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..1888da2d4fc0a5d46d8d286ee9c3a8af213e53ea --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/bodyproportionsV25_bodyproportionsV25.civitai.info" @@ -0,0 +1,131 @@ +{ + "id": 33678, + "modelId": 28100, + "name": "BodyProportions_V2.5", + "createdAt": "2023-04-02T10:12:23.474Z", + "updatedAt": "2023-04-02T10:35:22.139Z", + "trainedWords": [ + "big\\(bodyproportions\\)", + "medium\\(bodyproportions\\)", + "small\\(bodyproportions\\)", + "1girl," + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "model": { + "name": "BodyProportions_V2.5", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "bodyproportionsV25_bodyproportionsV25.safetensors", + "id": 27727, + "sizeKB": 84392.166015625, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-02T10:16:24.495Z", + "hashes": { + "AutoV1": "EC1DD4D2", + "AutoV2": "D9E7E5C3DC", + "SHA256": "D9E7E5C3DC9C9F68666F4AD2E7D744B2A535EE87CD5F82389C5ABA750A888DF9", + "CRC32": "437378C3", + "BLAKE3": "F9F2C45BA46AB1E6ECE5F56A41403B8C8D1F5737DD5759BE7B67DD3C294DE2C8" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/33678" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c58ace27-fb86-4e4a-3410-08fdc2e38c00/width=450/384087.jpeg", + "nsfw": true, + "width": 1536, + "height": 2304, + "hash": "UOH_78~W0KDixXjFIUs:xE-oofRjRit6?G%L", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d9bf34dc-415c-4a47-e8e5-52d0440cfb00/width=450/384097.jpeg", + "nsfw": true, + "width": 2944, + "height": 6234, + "hash": "UYJQ.u~q?v_Nozayofofoyayayayt7j[j[j[", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/dfe85e3e-ca10-4b77-95c1-89e0dbf08e00/width=450/384096.jpeg", + "nsfw": true, + "width": 1536, + "height": 2304, + "hash": "UQJHEz~VInxu%Lt7V?xa4:WXM|E20KD*s;xa", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/26bb9787-64b9-4be5-2969-c543b8b4af00/width=450/384095.jpeg", + "nsfw": true, + "width": 2944, + "height": 6234, + "hash": "UYI;;e_4_N_Nofj[j@ofofayayfQt7juj[of", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f2ff8fad-eaeb-42ef-83fa-5dadba36cb00/width=450/384094.jpeg", + "nsfw": false, + "width": 1536, + "height": 2304, + "hash": "UOI;hp~V0dxu?aozNFoJw@-p-pM{^+-:%2xv", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/987930b4-1819-49ff-1d3f-393d08307400/width=450/384093.jpeg", + "nsfw": false, + "width": 2944, + "height": 6234, + "hash": "UYJQ[:_N~q_3ozoLa|jtoff6ayfQt7j[j[j[", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/bcd52d59-68b0-4661-655d-9549fd3bed00/width=450/384092.jpeg", + "nsfw": false, + "width": 1536, + "height": 2304, + "hash": "UPGu5l~Wx[R+?b-;%2of9ZWBSht7M_Rj%1of", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1502fd8f-e058-4673-462a-b4e4902ca500/width=450/384091.jpeg", + "nsfw": true, + "width": 1536, + "height": 2304, + "hash": "UMI;VI00xW-;~VM{4.%MD%R+9axuOYWVxaa}", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/412dba3a-da56-46b9-99d7-ca2016214500/width=450/384090.jpeg", + "nsfw": true, + "width": 1536, + "height": 2304, + "hash": "UQI|]?~V%Kxtxvt7-pbbxHIoE2jF0LRPjIoL", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/97ad77f7-0276-4488-b1fa-238df69e9700/width=450/384089.jpeg", + "nsfw": true, + "width": 1536, + "height": 2304, + "hash": "UfJ7q1s;xaNH~WRjaet6xus:IoRkR*WBofof", + "meta": null + } + ], + "downloadUrl": "https://civitai.com/api/download/models/33678" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/bodyproportionsV25_bodyproportionsV25.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/bodyproportionsV25_bodyproportionsV25.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..f374e869f4843738416d6cfac0fdefb00ffee709 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/bodyproportionsV25_bodyproportionsV25.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:762fb20c4e73a7fb4b60b48da347ff05d2b851e8c7872db0d6ecd1b785753327 +size 3977546 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/bodyproportionsV25_bodyproportionsV25.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/bodyproportionsV25_bodyproportionsV25.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..67c3cd27e35e053557f522e5e3a76e0b6b64fd64 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/bodyproportionsV25_bodyproportionsV25.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:d9e7e5c3dc9c9f68666f4ad2e7d744b2a535ee87cd5f82389c5aba750a888df9 +size 86417578 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/boob_tent.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/boob_tent.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..8908b7a62e2da87bda994fd4929dfbbfcae9b8f3 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/boob_tent.civitai.info" @@ -0,0 +1,129 @@ +{ + "id": 100392, + "modelId": 94108, + "name": "v1.0", + "createdAt": "2023-06-20T16:51:27.381Z", + "updatedAt": "2023-06-20T16:56:25.152Z", + "trainedWords": [ + "boob tent" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 405, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Boob Tent", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "boob_tent.safetensors", + "id": 70100, + "sizeKB": 36978.5068359375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-20T16:56:54.717Z", + "hashes": { + "AutoV1": "075FC4C5", + "AutoV2": "BAC479D3AF", + "SHA256": "BAC479D3AF4B55A1584AE8AFC8AADDC64E03D9DC0F644D3E6624393B916904AF", + "CRC32": "3C3F386B", + "BLAKE3": "24A40F6FC2AE5083BF0F8F131BCB9B0096EDF1D181F51D1C0C01A7BAC27F06EF" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/100392" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a7cc0e88-2838-4943-871a-eae826442289/width=450/1222191.jpeg", + "nsfw": "None", + "width": 608, + "height": 920, + "hash": "UFJ%wkSvTJr?o~E2-p-pXS-U~W%MIpNG-;ae", + "meta": { + "Size": "512x768", + "seed": 2644635958, + "Model": "CalicoMix", + "steps": 20, + "hashes": { + "model": "7a8a7c44ec" + }, + "prompt": "((masterpiece, best quality, extremely detailed, insanely detailed, detailed CG, 8k wallpaper)), 1girl, cute, black hair, long hair, (huge breasts:1.2), (boob tent:1.1), pink pajamas, from front, indoors, girl room, sitting on bed, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "boob_tent", + "type": "lora", + "weight": 0.4 + }, + { + "hash": "7a8a7c44ec", + "name": "CalicoMix", + "type": "model" + } + ], + "Model hash": "7a8a7c44ec", + "Hires steps": "20", + "Hires upscale": "1.2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "EasyNegative, bad-hands-5, (worst quality, low quality:2), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, multiple view, Reference sheet, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, normal quality", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6ad1fd54-41ad-4389-9a1a-fb036c2f473b/width=450/1222209.jpeg", + "nsfw": "None", + "width": 608, + "height": 920, + "hash": "UKGkzVIVM|xa~VxZ-pM{ID%1-:IVIVR*%LWE", + "meta": { + "Size": "512x768", + "seed": 1378316386, + "Model": "CalicoMix", + "steps": 20, + "hashes": { + "model": "7a8a7c44ec" + }, + "prompt": "((masterpiece, best quality, extremely detailed, insanely detailed, detailed CG, 8k wallpaper)), 1girl, cute, black hair, long hair, (huge breasts:1.2), (boob tent:1.1), green t-shirt, skirt, indoors, (from front:1.2), restaurant, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "boob_tent", + "type": "lora", + "weight": 0.5 + }, + { + "hash": "7a8a7c44ec", + "name": "CalicoMix", + "type": "model" + } + ], + "Model hash": "7a8a7c44ec", + "Hires steps": "20", + "Hires upscale": "1.2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "EasyNegative, bad-hands-5, (worst quality, low quality:2), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, multiple view, Reference sheet, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, normal quality", + "Denoising strength": "0.5" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/100392" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/boob_tent.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/boob_tent.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..0bf2f64b4df3ff475c0cc443845d16431bc1d0f4 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/boob_tent.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/boob_tent.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/boob_tent.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..3844d37aa27a0e18227811436f2e42fa08c142ff --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/boob_tent.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:bac479d3af4b55a1584ae8afc8aaddc64e03d9dc0f644d3e6624393b916904af +size 37865991 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/boobcrush_v3.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/boobcrush_v3.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..7e1ca3a70c4ee876c62c018d4b3851b878c2074f --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/boobcrush_v3.civitai.info" @@ -0,0 +1,316 @@ +{ + "id": 30833, + "modelId": 9948, + "name": "v3", + "createdAt": "2023-03-28T18:37:29.814Z", + "updatedAt": "2023-03-28T18:37:29.814Z", + "trainedWords": [ + "boobcrush", + "huge breasts", + "gigantic breasts" + ], + "baseModel": "SD 1.4", + "earlyAccessTimeFrame": 0, + "description": "

Training Details:

  • 256 images

  • LR 1e-4

  • TE LR (no text encoder training this time, seems fine without it)

  • batch 4

  • GA 8

  • dim 64

  • alpha 32

  • scheduler: cosine_with_restarts, 33 restarts

  • base model Av3

  • Av3 VAE

  • flip aug

  • clip skip 2

  • bucketing at 768

  • tag dropout 0.1

  • tokens 225

  • trained with tags

    • Top useful tags: \"boobcrush, huge breasts, lying, huge nipples, large areolae, gigantic breasts, clothed, pregnant\"

", + "model": { + "name": "boobcrush", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "boobcrush_v3.safetensors", + "id": 25419, + "sizeKB": 63447.8662109375, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-03-28T18:41:27.600Z", + "hashes": { + "AutoV1": "74F4C574", + "AutoV2": "C41B53A1ED", + "SHA256": "C41B53A1ED8F9C26CD1F1D10A0E62E7B7C6D52FADBA1C44C1341698A6E539BD2", + "CRC32": "21BAC434", + "BLAKE3": "69F2847C269C08428560EB01091E69C06996B8C859DC360E26ACC19064CE1EAD" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/30833" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6386c906-b39a-4f67-199d-bfcab91ef500/width=450/350332.jpeg", + "nsfw": true, + "width": 876, + "height": 1024, + "hash": "UCIN{q0000%gPT.8Qmt7p0xtM|V@*J9FMx%g", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ca95f6cb-3c93-4bb8-fa82-906abd8fdc00/width=450/350343.jpeg", + "nsfw": true, + "width": 768, + "height": 640, + "hash": "UCJQ+f000d9e00nmRM%N00XS~pIB=]D*xXxu", + "meta": { + "Eta": "0.69", + "ENSD": "72", + "Size": "768x640", + "seed": 641569608, + "Model": "AbyssOrangeMix2_hard", + "steps": 20, + "hashes": { + "model": "0fc198c490" + }, + "prompt": "masterpiece, best quality, highres,helena \\(azur lane\\), 1girl, alternate costume, alternate hairstyle, bare shoulders, black shirt, blue hair, blue nails, blush, bow, cake, casual, day, dress, drinking, drinking straw, flower, food, gradient hair, hair bow, hair ornament, hairclip, headgear, heart, heart necklace, jewelry, long hair, looking at viewer, multicolored hair, nail polish, necklace, off-shoulder dress, off-shoulder shirt, off shoulder, outdoors, ponytail, purple dress, purple eyes, purple shirt, shirt, sleeveless, sleeveless shirt, smile, solo, upper body, valentine, very long hair, white bow, covered nipples\n(boobcrush:1.3), huge breasts\n", + "sampler": "DPM++ 2S a", + "cfgScale": 12, + "Clip skip": "2", + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, body out of frame, out of frame, poorly drawn, deformed, disproportionate, blurry, ugly, extra nipples, third nipple, asymmetrical, multiple heads, clothed, genshin" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/50345ea6-9c0c-4037-c612-6fc9fdcc5f00/width=450/350342.jpeg", + "nsfw": true, + "width": 768, + "height": 512, + "hash": "UJK^jQM}Vtxu~Us9NHRP0#-oS~M{02TJx[tR", + "meta": { + "Eta": "0.69", + "ENSD": "72", + "Size": "768x512", + "seed": 2781818992, + "Model": "AbyssOrangeMix2_hard", + "steps": 20, + "hashes": { + "model": "0fc198c490" + }, + "prompt": "masterpiece, best quality, tako, 1girl, breasts, bright pupils, cleavage, collarbone, blue tie, black beanie, blue skirt, full body, hand on hip, holding, long hair, navel, red eyes, shirt, simple background, sleeveless, sleeveless shirt, solo, standing, telekinesis, toes, white background, white pupils,\n(boobcrush), (gigantic breasts, breasts spread, hanging breasts:1.2), puffy nipples, (big fat belly), \n\n,", + "sampler": "DPM++ 2S a", + "cfgScale": 12, + "Clip skip": "2", + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, body out of frame, out of frame, poorly drawn, deformed, disproportionate, blurry, ugly, extra nipples, third nipple, asymmetrical, multiple heads, clothed, genshin, pubic hair, (small, )" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4ece4e56-493a-414d-c016-1ea905d78600/width=450/350341.jpeg", + "nsfw": true, + "width": 640, + "height": 768, + "hash": "UBI;;jIU.m?cRPxuNFVt69WAH?%g00t7-VIU", + "meta": { + "Eta": "0.69", + "ENSD": "72", + "Size": "640x768", + "seed": 1895347778, + "Model": "AbyssOrangeMix2_hard", + "steps": 20, + "prompt": "masterpiece, best quality, highres, raiden shogun, 1girl, :p, animal ears, bangs, black gloves, black leotard, black pantyhose, blunt bangs, blush, bottle, breasts, cleavage, covered navel, crossed legs, fake animal ears, feet out of frame, gloves, grey background, heart, heart-shaped pupils, large breasts, leotard, long hair, long sleeves, looking at viewer, naughty face, pantyhose, playboy bunny, purple hair, rabbit ears, shrug \\(clothing\\), sitting, smile, solo, strapless, strapless leotard, symbol-shaped pupils, thighband pantyhose, very long hair, viewfinder, wrist cuffs\n(boobcrush:1.3), huge breasts\n", + "sampler": "DPM++ 2S a", + "cfgScale": 12, + "Clip skip": "2", + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, body out of frame, out of frame, poorly drawn, deformed, disproportionate, blurry, ugly, extra nipples, third nipple, asymmetrical, multiple heads, clothed, genshin" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/087aeea9-17d5-47eb-9621-2eab0a309800/width=450/350340.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "U8IOX:A100tS00MeMbMxL1?b=V%K0uyY^*jE", + "meta": { + "Eta": "0.69", + "ENSD": "72", + "Size": "512x768", + "seed": 345022126, + "Model": "AbyssOrangeMix2_hard", + "steps": 20, + "prompt": "masterpiece, best quality, highres, absurdres, 1girl, armpits, arms behind head, arms up, breasts, breasts apart, completely nude, dark-skinned female, dark skin, day, hair between eyes, knee up, long hair, looking at viewer, navel, nipples, nude, on back, outdoors, pool, purple hair, slit pupils, huge breasts, smile, solo, stomach, tropical drink, v-shaped eyebrows, wet, yellow eyes, standing, solo\n(boobcrush, huge nipples:1.3),\n", + "sampler": "DPM++ 2S a", + "cfgScale": 12, + "Clip skip": "2", + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, body out of frame, out of frame, poorly drawn, deformed, disproportionate, blurry, ugly, extra nipples, third nipple, asymmetrical, multiple heads, clothed, genshin" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a29b30fe-7799-4cb4-21e5-672b9aa1b900/width=450/350339.jpeg", + "nsfw": true, + "width": 768, + "height": 768, + "hash": "U8JaD$001RFL~30hOG]}1O-Sq@.8}SO@%g4n", + "meta": { + "Eta": "0.69", + "ENSD": "72", + "Size": "768x768", + "seed": 795270976, + "Model": "AbyssOrangeMix2_hard", + "steps": 20, + "prompt": "masterpiece, best quality, highres, absurdres, 1girl, bangs, bare shoulders, bed invitation, bikini, blanket, blonde hair, blue eyes, blush, breasts, cleavage, collarbone, covered nipples, ear blush, elf, groin, hair between eyes, holding, holding blanket, huge breasts, indoors, long hair, looking at viewer, lying, micro bikini, navel, on bed, on side, open mouth, pointy ears, side-tie bikini bottom, sidelocks, skindentation, smile, solo, steam, steaming body, straight hair, string bikini, sweat, swimsuit, under covers, wet, wet clothes, wet swimsuit, white bikini\n(boobcrush:1.3), puffy nipples\n", + "sampler": "DPM++ 2S a", + "cfgScale": 12, + "Clip skip": "2", + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, body out of frame, out of frame, poorly drawn, deformed, disproportionate, blurry, ugly, extra nipples, third nipple, asymmetrical, multiple heads, clothed, genshin" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c2032970-c436-42d5-6c4d-b6effb2b3700/width=450/350338.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UTK-2tx]%$of_2MxS5tR.Txuxujs9Gt7nikC", + "meta": { + "Eta": "0.69", + "ENSD": "72", + "Size": "512x768", + "seed": 4217280555, + "Model": "AbyssOrangeMix2_hard", + "steps": 20, + "prompt": "masterpiece, best quality, highres, absurdres, gold city \\(umamusume\\), 1girl, animal ears, bandeau, bare shoulders, belt, black belt, black choker, blank eyes, blonde hair, choker, cropped legs, denim, denim shorts, horse ears, jacket, long hair, midriff, navel, short shorts, shorts, simple background, solo, standing, stomach, strapless, striped bandeau, tail, thigh strap, thighs, tube top, very long hair\n(boobcrush, huge nipples:1.3),\n", + "sampler": "DPM++ 2S a", + "cfgScale": 12, + "Clip skip": "2", + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, body out of frame, out of frame, poorly drawn, deformed, disproportionate, blurry, ugly, extra nipples, third nipple, asymmetrical, multiple heads, clothed, genshin" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c6ae505d-1aa8-42d1-26f8-e90d96f41200/width=450/350337.jpeg", + "nsfw": true, + "width": 640, + "height": 768, + "hash": "UZKc;H~VTJba-;ozjFenNexF%LS#WYM|xaxa", + "meta": { + "Eta": "0.69", + "ENSD": "72", + "Size": "640x768", + "seed": 3547565023, + "Model": "AbyssOrangeMix2_hard", + "steps": 20, + "prompt": "masterpiece, best quality, highres, 1girl, bangs, blunt bangs, blush, brown eyes, brown hair, cherry blossoms, floral print, flower, hair ribbon, hakama, hakama skirt, japanese clothes, kimono, long hair, long sleeves, looking at viewer, open mouth, orange kimono, ribbon, skirt, smile, solo, white flower, white ribbon, wide sleeves, strapless bra\n(boobcrush:1.3), puffy nipples, huge breasts\n", + "sampler": "DPM++ 2S a", + "cfgScale": 12, + "Clip skip": "2", + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, body out of frame, out of frame, poorly drawn, deformed, disproportionate, blurry, ugly, extra nipples, third nipple, asymmetrical, multiple heads, clothed, genshin" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1ea30334-108e-4912-cc7a-922957e37d00/width=450/350336.jpeg", + "nsfw": true, + "width": 768, + "height": 512, + "hash": "UKH.QcW@9DS5?b-;cEt72|-;^0t68wX9-;od", + "meta": { + "Eta": "0.69", + "ENSD": "72", + "Size": "768x512", + "seed": 200484152, + "Model": "AbyssOrangeMix2_hard", + "steps": 20, + "prompt": "masterpiece, best quality, highres, absurdres, 1girl, armpits, arms behind head, arms up, breasts, breasts apart, completely nude, dark-skinned female, dark skin, day, hair between eyes, knee up, long hair, looking at viewer, navel, nipples, nude, on back, outdoors, pool, purple hair, slit pupils, huge breasts, smile, solo, stomach, tropical drink, v-shaped eyebrows, wet, yellow eyes, standing, solo\n(boobcrush, huge nipples:1.3), fat belly\n", + "sampler": "DPM++ 2S a", + "cfgScale": 12, + "Clip skip": "2", + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, body out of frame, out of frame, poorly drawn, deformed, disproportionate, blurry, ugly, extra nipples, third nipple, asymmetrical, multiple heads, clothed, genshin" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6ce1c413-c252-40ff-c6f9-afdc51bbf400/width=450/350335.jpeg", + "nsfw": true, + "width": 768, + "height": 512, + "hash": "UKJ7:hRR00xbysNFMx%M02RP-TtRQ.xFn$Io", + "meta": { + "Eta": "0.69", + "ENSD": "72", + "Size": "768x512", + "seed": 3811291011, + "Model": "AbyssOrangeMix2_hard", + "steps": 30, + "prompt": "masterpiece, best quality, highres, suoiresnu, 1girl, bangs, black hair, black panties, clothes lift, hair ornament, hairclip, looking at viewer, medium hair, navel, panties, petite, shirt, shirt lift, short ponytail, single sidelock, solo, swept bangs, thong, underwear\n(boobcrush:1.3), (big fat belly), gigantic breasts\n", + "sampler": "DPM++ 2S a", + "cfgScale": 12, + "Clip skip": "2", + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, body out of frame, out of frame, poorly drawn, deformed, disproportionate, blurry, ugly, extra nipples, third nipple, asymmetrical, multiple heads, clothed, genshin" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/30833" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/boobcrush_v3.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/boobcrush_v3.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..5f67cefa5fec4a84fa87cc780c8fe9f3ebb8aafa --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/boobcrush_v3.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:dd2e9490a3d5d7c750ccfab59347174c2dc9ac38afd7c0c8207696c51103bc62 +size 1021252 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/boobcrush_v3.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/boobcrush_v3.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..5551482c7cc843d04fbbb102186b8786404212b0 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/boobcrush_v3.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:c41b53a1ed8f9c26cd1f1d10a0e62e7b7c6d52fadba1c44c1341698a6e539bd2 +size 64970615 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/breast_expansion.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/breast_expansion.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..1b4eac81ae663486f3080fc936a2d9f0f50413b3 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/breast_expansion.civitai.info" @@ -0,0 +1,103 @@ +{ + "id": 70431, + "modelId": 52028, + "name": "v2.0", + "createdAt": "2023-05-14T11:26:42.257Z", + "updatedAt": "2023-05-14T11:32:27.486Z", + "trainedWords": [ + "breast_expansion" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

It's less diverse than previous versions, changed to produce only left-right structures, and it's not overcooked, so putting the weight at 1 doesn't matter much, and there's not much difference other than that.

", + "stats": { + "downloadCount": 8, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Breast Expansion Lora || \u81a8\u4e73 Lora", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "breast_expansion.safetensors", + "id": 49093, + "sizeKB": 37019.7861328125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Pending", + "pickleScanMessage": null, + "virusScanResult": "Pending", + "scannedAt": null, + "hashes": {}, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/70431" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/78c1ad1a-1e59-4b05-a322-bdcf1a0a8f2b/width=450/786521.jpeg", + "nsfw": "None", + "width": 920, + "height": 608, + "hash": "UHH_lV00K6-o?wQ,T0R54o-6xu9FxuE0IV-p", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7936cf6d-4843-4845-ba89-cc6f6de075be/width=450/786524.jpeg", + "nsfw": "X", + "width": 920, + "height": 608, + "hash": "UdKxL.ELofaJ_LWBWBIoIps,t7Iot5R*ayxa", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ffdc4b7b-78cc-40e8-982a-e465eb83cc26/width=450/786523.jpeg", + "nsfw": "X", + "width": 920, + "height": 608, + "hash": "UJIE|aIVt6MePpVtWVD*OEWWbHMy~pM{ofWC", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a4bbc697-59db-491c-a601-2003b28d7786/width=450/786522.jpeg", + "nsfw": "X", + "width": 1072, + "height": 608, + "hash": "UHJ%g~9^-VkCIpenofWV4:%1RkI:}@S~s.WB", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b48e8408-bc6c-4291-b009-14c6857d00e8/width=450/786527.jpeg", + "nsfw": "X", + "width": 1072, + "height": 608, + "hash": "UWI|:rs:I:~B0fjGoft7IBofofD*t6R*R*xa", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9888ee73-947f-4369-8bd2-5e32f3e4b05e/width=450/786525.jpeg", + "nsfw": "X", + "width": 1072, + "height": 608, + "hash": "UAJaQDKPo|-;~p%1%2xu02=|NGNGE1J8WCoL", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/31ad7ec8-6aa8-4585-aae9-e41da1e15bff/width=450/786526.jpeg", + "nsfw": "Soft", + "width": 920, + "height": 608, + "hash": "ULI=ldMv67rXPXxatnR44q%Ma$NG%gE2R4xv", + "meta": null + } + ], + "downloadUrl": "https://civitai.com/api/download/models/70431" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/breast_expansion.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/breast_expansion.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..35d10efd8ccf0876d73cfc31a17e3187ca9a2451 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/breast_expansion.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/breast_expansion.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/breast_expansion.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..b4eeca32543f3abbd4b69ce7c0e19adbe63437e4 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/breast_expansion.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:19012c9bf6e4a2c4eeeb48b8f3cdee54883f4e1874d24e786076a5fd675b29dd +size 37908261 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/breastexpansion.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/breastexpansion.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..d8d5381b416fc4e18ecb646296badf822b6e91f9 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/breastexpansion.civitai.info" @@ -0,0 +1,290 @@ +{ + "id": 90287, + "modelId": 83280, + "name": "v5.0", + "createdAt": "2023-06-06T10:10:03.124Z", + "updatedAt": "2023-06-06T10:12:43.235Z", + "trainedWords": [ + "breast_expansion" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

masterpiece, this is gonna be the my last job with breast expansion lora

this model isn't overcooked and also fixed a chronic problem of nudity

", + "stats": { + "downloadCount": 915, + "ratingCount": 2, + "rating": 5 + }, + "model": { + "name": "Breast Expansion Lora || \u81a8\u4e73 Lora", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "breast_expansion.safetensors", + "id": 62078, + "sizeKB": 37019.546875, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-06T10:11:22.022Z", + "hashes": { + "AutoV1": "DE8429B1", + "AutoV2": "D1D91E423E", + "SHA256": "D1D91E423E00BFE7A1E0ED9C27E98FC4B49687DD25E5AFCE437CD75CE0E90499", + "CRC32": "6BA67DCD", + "BLAKE3": "F9EA6244657A70C5A6684391403A7B76CB07BD49C874A8A7A2BBF052C8194DB6" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/90287" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/de8c36cb-a1e3-485d-b0bd-0bf2c2689406/width=450/1047667.jpeg", + "nsfw": "None", + "width": 1248, + "height": 768, + "hash": "UDGuq7H=WCmP-@oIWDVq00o}fiEOIVIUjYbw", + "meta": { + "Size": "832x512", + "seed": 2218237108, + "Model": "AOM3", + "steps": 30, + "Script": "Detection Detailer", + "hashes": { + "model": "d124fc18f0" + }, + "prompt": "masterpiece, best quality, 1girl, higashiyama kobeni, , black hair, black eyes, short hair, short ponytail, side ponytail, bangs, single sidelock, hair ornament, , (breast expansion:1.1),multiple views, gigantic breasts,(formal:1.2), necktie", + "\"kobeni": "d8333d703948", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 11, + "Clip skip": "2", + "resources": [ + { + "name": "kobeni", + "type": "lora", + "weight": 1 + }, + { + "hash": "d124fc18f0", + "name": "AOM3", + "type": "model" + } + ], + "Model hash": "d124fc18f0", + "DDetailer cfg": "7", + "Hires upscale": "1.5", + "Hires upscaler": "Latent", + "negativePrompt": "(low quality:1.4, worst quality),(easynegative:0.6),(badhandv4:0.4),(bad_prompt_version2:0.8),extra fingers,fewer fingers,extra legs,extra hands,extra arms,watermark,username,blurry,artist name, nipples, nude, cleavage, cleavage cutout, nsfw", + "DDetailer conf a": "30", + "DDetailer conf b": "30", + "DDetailer bitwise": "None", + "DDetailer model a": "bbox/mmdet_anime-face_yolov3.pth [51e1af4a]", + "DDetailer model b": "bbox/mmdet_anime-face_yolov3.pth [51e1af4a]", + "Denoising strength": "0.7", + "breast_expansion-5": "3874cd2e943e\"", + "DDetailer denoising": "0.4", + "DDetailer mask blur": "4", + "DDetailer dilation a": "4", + "DDetailer dilation b": "4", + "DDetailer offset x a": "0", + "DDetailer offset x b": "0", + "DDetailer offset y a": "0", + "DDetailer offset y b": "0", + "DDetailer inpaint full": "True", + "DDetailer preprocess b": "False", + "DDetailer inpaint padding": "32" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a1cbf7a6-8e93-4a3c-b8dc-6636415847eb/width=450/1047666.jpeg", + "nsfw": "None", + "width": 1056, + "height": 864, + "hash": "U5HeUq004o00$x%gx]_N00-pIU?G%%bDIBNH", + "meta": { + "Size": "704x576", + "seed": 3924404484, + "Model": "AOM3", + "steps": 30, + "Script": "Detection Detailer", + "hashes": { + "model": "d124fc18f0" + }, + "prompt": "masterpiece, best quality, 1girl ,ahoge, white hair, short hair, black eyes, white shirt, buttoned shirt, black skirt, short skirt, (breast expansion:1.1), huge breasts, ", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 10, + "Clip skip": "2", + "resources": [ + { + "hash": "d124fc18f0", + "name": "AOM3", + "type": "model" + } + ], + "Model hash": "d124fc18f0", + "DDetailer cfg": "7", + "Hires upscale": "1.5", + "Hires upscaler": "Latent", + "negativePrompt": "(low quality:1.4, worst quality),(easynegative:0.6),(badhandv4:0.4),(bad_prompt_version2:0.8),extra fingers,fewer fingers,extra legs,extra hands,extra arms,watermark,username,blurry,artist name, nipples, nude, cleavage, cleavage cutout, nsfw", + "DDetailer conf a": "30", + "DDetailer conf b": "30", + "DDetailer bitwise": "None", + "DDetailer model a": "bbox/mmdet_anime-face_yolov3.pth [51e1af4a]", + "DDetailer model b": "bbox/mmdet_anime-face_yolov3.pth [51e1af4a]", + "Denoising strength": "0.65", + "\"breast_expansion-5": "3874cd2e943e\"", + "DDetailer denoising": "0.4", + "DDetailer mask blur": "4", + "DDetailer dilation a": "4", + "DDetailer dilation b": "4", + "DDetailer offset x a": "0", + "DDetailer offset x b": "0", + "DDetailer offset y a": "0", + "DDetailer offset y b": "0", + "DDetailer inpaint full": "True", + "DDetailer preprocess b": "False", + "DDetailer inpaint padding": "32" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/87528962-301c-4d36-bfa9-4ceb52b0abd4/width=450/1047664.jpeg", + "nsfw": "Mature", + "width": 1056, + "height": 864, + "hash": "U9Hnyu0K4:000zDixG4m00--xqyB?Gb0E1~W", + "meta": { + "Size": "704x576", + "seed": 2878383566, + "Model": "AOM3", + "steps": 30, + "Script": "Detection Detailer", + "flatBG": "c50c381f6bb6\"", + "hashes": { + "model": "d124fc18f0" + }, + "noline": "2aff085bf10f", + "prompt": "masterpiece, best quality, 1girl, higashiyama kobeni, , black hair, black eyes, short hair, short ponytail, side ponytail, bangs, single sidelock, hair ornament, , (breast expansion:1.1),multiple views, gigantic breasts,(bikini:1.2), (micro bikini:1.2), , ,pink bikini,", + "\"kobeni": "d8333d703948", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 11, + "Clip skip": "2", + "resources": [ + { + "name": "kobeni", + "type": "lora", + "weight": 1 + }, + { + "name": "noline", + "type": "lora", + "weight": 1 + }, + { + "name": "flatBG", + "type": "lora", + "weight": 1 + }, + { + "hash": "d124fc18f0", + "name": "AOM3", + "type": "model" + } + ], + "Model hash": "d124fc18f0", + "DDetailer cfg": "7", + "Hires upscale": "1.5", + "Hires upscaler": "Latent", + "negativePrompt": "(low quality:1.4, worst quality),(easynegative:0.6),(badhandv4:0.4),(bad_prompt_version2:0.8),extra fingers,fewer fingers,extra legs,extra hands,extra arms,watermark,username,blurry,artist name, nipples, nude, cleavage, cleavage cutout, nsfw", + "DDetailer conf a": "30", + "DDetailer conf b": "30", + "DDetailer bitwise": "None", + "DDetailer model a": "bbox/mmdet_anime-face_yolov3.pth [51e1af4a]", + "DDetailer model b": "bbox/mmdet_anime-face_yolov3.pth [51e1af4a]", + "Denoising strength": "0.65", + "breast_expansion-5": "3874cd2e943e", + "DDetailer denoising": "0.4", + "DDetailer mask blur": "4", + "DDetailer dilation a": "4", + "DDetailer dilation b": "4", + "DDetailer offset x a": "0", + "DDetailer offset x b": "0", + "DDetailer offset y a": "0", + "DDetailer offset y b": "0", + "DDetailer inpaint full": "True", + "DDetailer preprocess b": "False", + "DDetailer inpaint padding": "32" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/584b673c-8692-4b5d-8b73-4cc31399d245/width=450/1047665.jpeg", + "nsfw": "None", + "width": 1152, + "height": 768, + "hash": "UJJko.HsS$h$?wxan%=yD#xHt6R6MhROWoIT", + "meta": { + "Size": "768x512", + "seed": 1102463703, + "Model": "AOM3", + "steps": 30, + "Script": "Detection Detailer", + "hashes": { + "model": "d124fc18f0" + }, + "prompt": "masterpiece, best quality, 1girl , pink hair, long hair, blue eyes, white shirt, buttoned shirt, black skirt, short skirt, (breast expansion:1.1), huge breasts, ", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 12, + "Clip skip": "2", + "resources": [ + { + "name": "expansion", + "type": "lora", + "weight": 1 + }, + { + "hash": "d124fc18f0", + "name": "AOM3", + "type": "model" + } + ], + "\"expansion": "3874cd2e943e\"", + "Model hash": "d124fc18f0", + "DDetailer cfg": "7", + "Hires upscale": "1.5", + "Hires upscaler": "Latent", + "negativePrompt": "(low quality:1.4, worst quality),(easynegative:0.6),(badhandv4:0.4),(bad_prompt_version2:0.8),extra fingers,fewer fingers,extra legs,extra hands,extra arms,watermark,username,blurry,artist name, nipples, nude, cleavage, cleavage cutout, nsfw, bursting breasts,", + "DDetailer conf a": "30", + "DDetailer conf b": "30", + "DDetailer bitwise": "None", + "DDetailer model a": "bbox/mmdet_anime-face_yolov3.pth [51e1af4a]", + "DDetailer model b": "bbox/mmdet_anime-face_yolov3.pth [51e1af4a]", + "Denoising strength": "0.65", + "DDetailer denoising": "0.4", + "DDetailer mask blur": "4", + "DDetailer dilation a": "4", + "DDetailer dilation b": "4", + "DDetailer offset x a": "0", + "DDetailer offset x b": "0", + "DDetailer offset y a": "0", + "DDetailer offset y b": "0", + "DDetailer inpaint full": "True", + "DDetailer preprocess b": "False", + "DDetailer inpaint padding": "32" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/90287" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/breastexpansion.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/breastexpansion.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..36745357963dc3b2b2b348d2e8b046147031bb97 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/breastexpansion.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/breastexpansion.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/breastexpansion.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..3b3da3ef42f674782f6d84185639ff35a574d2e0 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/breastexpansion.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:d1d91e423e00bfe7a1e0ed9c27e98fc4b49687dd25e5afce437cd75ce0e90499 +size 37908016 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/breastinclassBetter_v141.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/breastinclassBetter_v141.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..bc6ab37a30a2c29e578a944c87e33cc7c1fac24f --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/breastinclassBetter_v141.civitai.info" @@ -0,0 +1,89 @@ +{ + "id": 23250, + "modelId": 9025, + "name": "v1.41", + "createdAt": "2023-03-14T20:19:20.138Z", + "updatedAt": "2023-03-14T20:22:59.702Z", + "trainedWords": [ + "" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

The tool I used to make the lora fixed the issue that would print an error on first run. The data set, steps, configuration is all the same. There should be no/minimal difference in the generated image.

CL:

  • No longer produces an \"invalid keys\" error

", + "model": { + "name": "breastInClass: Better Bodies", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "breastinclassBetter_v141.safetensors", + "id": 19323, + "sizeKB": 147571.9609375, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-03-14T20:21:41.766Z", + "hashes": { + "AutoV1": "0CC8A0D4", + "AutoV2": "487FB59B03", + "SHA256": "487FB59B038549FE391E3FC7CF9364BBE52395A61B4D57373579D8585ECB39BD", + "CRC32": "93991868", + "BLAKE3": "FB32CFD499D4DE6CDFBEBFCFB18894B8051D854D37D35967AD944FFB04179083" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/23250" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1bee864f-7025-4c64-f7af-3fa429e4e900/width=450/251975.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "URFFBK}=0z5SIAJBM|r?9}M{s;t7M|R*oLRj", + "meta": { + "Size": "512x768", + "seed": 700490917, + "Model": "chilloutmix_NiPrunedFp32Fix", + "steps": 25, + "prompt": "8k, RAW photo, portrait, best quality, ultra high res, photorealistic,\n1girl, naked, full body, thigh, white hair, \nearrings, necklace, pool, grin, eyelashes, small breast,\ncinematic lighting, night, depth of field, lens flare,\n, , ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7.5, + "resources": [ + { + "name": "koreanDollLikeness_v15", + "type": "lora", + "weight": 0.3 + }, + { + "name": "taiwanDollLikeness_v10", + "type": "lora", + "weight": 0.2 + }, + { + "name": "breastinClass", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "fc2511737a", + "name": "chilloutmix_NiPrunedFp32Fix", + "type": "model" + } + ], + "Model hash": "fc2511737a", + "negativePrompt": "paintings, cartoon, rendered, anime, sketches, (worst quality:2), (low quality:2), (normal quality:2), wet, child, chest hair, dot, mole, lowres, normal quality, monochrome, grayscale, lowres, text, error, cropped, jpeg artifacts, ugly, duplicate, morbid, mutilated, out of frame, extra fingers, mutated hands, poorly drawn hands, poorly drawn face, mutation, deformed, blurry, dehydrated, bad anatomy, bad proportions, extra limbs, cloned face, disfigured, gross proportions, malformed limbs, missing arms, missing legs, extra arms, extra legs, fused fingers, too many fingers, long neck, username, watermark, signature,", + "Face restoration": "CodeFormer" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/23250" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/breastinclassBetter_v141.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/breastinclassBetter_v141.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..22c9c34513180534041e71ede8b16c0078738c07 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/breastinclassBetter_v141.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/breastinclassBetter_v141.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/breastinclassBetter_v141.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..a2214629fa968ffd57666383815bb74ee8392226 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/breastinclassBetter_v141.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:487fb59b038549fe391e3fc7cf9364bbe52395a61b4d57373579d8585ecb39bd +size 151113688 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/buttonGap_v1.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/buttonGap_v1.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..513241f7be035b0f6963d9d61aaf07721577b437 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/buttonGap_v1.civitai.info" @@ -0,0 +1,417 @@ +{ + "id": 6279, + "modelId": 5399, + "name": "v1", + "createdAt": "2023-01-27T04:11:58.912Z", + "updatedAt": "2023-01-27T04:20:01.387Z", + "trainedWords": [ + "button gap" + ], + "baseModel": "SD 1.4", + "earlyAccessTimeFrame": 0, + "description": "

A1111 now has support for LoRA models!

Training Details:

  • 100 images

  • LR 8e-5

  • batch 2

  • GA 8

  • dim 4

  • base model Av3

  • Av3 VAE

  • 90 epocs

  • flip aug

  • clip skip 2

  • only Unet training

  • 768 res, no bucketing

", + "model": { + "name": "button gap", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "buttonGap_v1.ckpt", + "id": 6528, + "sizeKB": 6867.5791015625, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "PickleTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "**Detected Pickle imports (3)**\n```\ntorch.FloatStorage\ntorch._utils._rebuild_tensor_v2\ncollections.OrderedDict\n```", + "virusScanResult": "Success", + "scannedAt": "2023-01-27T18:04:07.102Z", + "hashes": { + "AutoV1": "EA2741EB", + "AutoV2": "7F9A13F73C", + "SHA256": "7F9A13F73C4839978D40794CD9621851EDB1773474E6B25B670E248A631A1F22", + "CRC32": "5192E043", + "BLAKE3": "BCEDC4981DE7B242D0B203295CB74E446ECFB77A1E7B6BC31463FDD7205C3B16" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/6279" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/bc1b0727-df43-4efe-f048-ec24b1b6aa00/width=450/55361.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UTJHdk00D$j]~qD%xuR*abRiIq%LNGIoRP-p", + "meta": { + "Eta": "0.69", + "ENSD": "72", + "Size": "512x768", + "seed": 1079020785, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 20, + "prompt": "masterpiece, best quality, highres, absurdres, nayuta ggg, kanna \\(blue archive\\), 1girl, abs, animal ears, blonde hair, blue eyes, breasts, cleavage, cowboy shot, cup, curtains, extra ears, hair over one eye, holding, holding cup, indoors, large breasts, long hair, long sleeves, open mouth, purple shirt, sharp teeth, shirt, solo, steam, teeth, toned, window\n, (button gap:1.2)", + "sampler": "DPM++ 2S a", + "cfgScale": 12, + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + }, + { + "hash": "5a5f0c66", + "name": "480", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "0873291ac5", + "AddNet Enabled": "True", + "AddNet Model 1": "buttongap_v0_x768-lr8e-5-2b-8ga-4dim-flip-nte-[button gap]-av3-LoRA_-000080-480(5a5f0c66)", + "negativePrompt": "topless, ugly drawn face, mutation, mutated, ugly, painting, sketch, rough draft, blurry, lowres, hideous, dismembered, jpeg artifacts, low quality, unfinished, text, watermark, irritated skin, tumor", + "AddNet Module 1": "LoRA", + "AddNet Weight 1": "1", + "Face restoration": "GFPGAN" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/85f93f21-4551-4d8a-9ab7-ca524e0b6200/width=450/55369.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UXLp{#D%tRt8~Us.NHRkD$s:%MR*?Ha_M|t7", + "meta": { + "Eta": "0.69", + "ENSD": "72", + "Size": "512x768", + "seed": 1079020787, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 20, + "prompt": "masterpiece, best quality, highres, absurdres, 1girl, arms up, bangs, black necktie, black pantyhose, black skirt, blonde hair, breasts, closed mouth, collared shirt, cowboy shot, hair between eyes, long hair, looking away, medium breasts, messy hair, miniskirt, necktie, pantyhose, pleated skirt, shirt, shirt tucked in, simple background, sketch, skirt, sleeves rolled up, solo, sweat, tying hair, white background, white shirt, yellow eyes, artist request\n,(button gap), (huge breasts:1.2), button down shirt, ill fitting clothes, (sfw)", + "sampler": "DPM++ 2S a", + "cfgScale": 12, + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + }, + { + "hash": "ea2741eb", + "name": "540", + "type": "lora", + "weight": 1 + }, + { + "hash": "1e4c4593", + "name": "696", + "type": "lora", + "weight": 0.6 + } + ], + "Model hash": "0873291ac5", + "AddNet Enabled": "True", + "AddNet Model 1": "buttongap_v0_x768-lr8e-5-2b-8ga-4dim-flip-nte-[button gap]-av3-LoRA_-000090-540(ea2741eb)", + "AddNet Model 2": "hyper_breasts_1.8k_xl_kohya_captioned-lr1e-4-4b-8ga-64dim-flip-nte-av3-LoRA_epoc.ckpt-000012-696(1e4c4593)", + "negativePrompt": "ugly drawn face, mutation, mutated, ugly, painting, sketch, rough draft, blurry, lowres, hideous, dismembered, jpeg artifacts, low quality, unfinished, text, watermark, irritated skin, tumor", + "AddNet Module 1": "LoRA", + "AddNet Module 2": "LoRA", + "AddNet Weight 1": "1", + "AddNet Weight 2": "0.6", + "Face restoration": "GFPGAN" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7e26bbe6-a5a3-4d9f-e652-4ff2540ecf00/width=450/55368.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "USKwRw0K^k-q~WRP%gn%Ioof%MR*kqM{Ioxu", + "meta": { + "Eta": "0.69", + "ENSD": "72", + "Size": "512x768", + "seed": 1079020789, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 20, + "prompt": "masterpiece, best quality, 1girl, bangs, black jacket, blush,breasts, brown eyes, eyeliner, horns, jacket, medium breasts, long hair, makeup, parted bangs, pink eyes, solo\n,(button gap), button down shirt, ill fitting clothes, (sfw)", + "sampler": "DPM++ 2S a", + "cfgScale": 12, + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + }, + { + "hash": "ea2741eb", + "name": "540", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "0873291ac5", + "AddNet Enabled": "True", + "AddNet Model 1": "buttongap_v0_x768-lr8e-5-2b-8ga-4dim-flip-nte-[button gap]-av3-LoRA_-000090-540(ea2741eb)", + "negativePrompt": "topless, ugly drawn face, mutation, mutated, ugly, painting, sketch, rough draft, blurry, lowres, hideous, dismembered, jpeg artifacts, low quality, unfinished, text, watermark, irritated skin, tumor", + "AddNet Module 1": "LoRA", + "AddNet Weight 1": "1", + "Face restoration": "GFPGAN" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e8d3d944-832b-4844-1831-dc02a9c57100/width=450/55367.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UBJQ+p0gL}0000x]EL_300t7~qE1XoD%9a$*", + "meta": { + "Eta": "0.69", + "ENSD": "72", + "Size": "512x768", + "seed": 1079020794, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 20, + "prompt": "masterpiece, best quality, 1girl, (button gap), huge breasts, button down shirt, ill fitting clothes, (sfw)", + "sampler": "DPM++ 2S a", + "cfgScale": 12, + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + }, + { + "hash": "916ed55b", + "name": "360", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "0873291ac5", + "AddNet Enabled": "True", + "AddNet Model 1": "buttongap_v0_x768-lr8e-5-2b-8ga-4dim-flip-nte-[button gap]-av3-LoRA_-000060-360(916ed55b)", + "negativePrompt": "ugly drawn face, mutation, mutated, ugly, painting, sketch, rough draft, blurry, lowres, hideous, dismembered, jpeg artifacts, low quality, unfinished, text, watermark, irritated skin, tumor", + "AddNet Module 1": "LoRA", + "AddNet Weight 1": "1", + "Face restoration": "GFPGAN" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/eb47c11b-3a7d-4bc8-2538-1f71b1abad00/width=450/55366.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "U6I=0{0000S5qG01?w%1D401_2bclo%M.8r?", + "meta": { + "Eta": "0.69", + "ENSD": "72", + "Size": "512x768", + "seed": 1079020789, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 20, + "prompt": "masterpiece, best quality, 1girl, (button gap), huge breasts, button down shirt, ill fitting clothes, (sfw)", + "sampler": "DPM++ 2S a", + "cfgScale": 12, + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + }, + { + "hash": "916ed55b", + "name": "360", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "0873291ac5", + "AddNet Enabled": "True", + "AddNet Model 1": "buttongap_v0_x768-lr8e-5-2b-8ga-4dim-flip-nte-[button gap]-av3-LoRA_-000060-360(916ed55b)", + "negativePrompt": "ugly drawn face, mutation, mutated, ugly, painting, sketch, rough draft, blurry, lowres, hideous, dismembered, jpeg artifacts, low quality, unfinished, text, watermark, irritated skin, tumor", + "AddNet Module 1": "LoRA", + "AddNet Weight 1": "1", + "Face restoration": "GFPGAN" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/584cd794-87ba-425c-f581-2adb870bf400/width=450/55365.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UEHeC2~B5S0fIU-o4oE2~p-oNG4:0KS2%2xa", + "meta": { + "Eta": "0.69", + "ENSD": "72", + "Size": "512x768", + "seed": 1079020788, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 20, + "prompt": "masterpiece, best quality, 1girl, (button gap), huge breasts, button down shirt, ill fitting clothes, (sfw)", + "sampler": "DPM++ 2S a", + "cfgScale": 12, + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + }, + { + "hash": "d36f9fb8", + "name": "420", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "0873291ac5", + "AddNet Enabled": "True", + "AddNet Model 1": "buttongap_v0_x768-lr8e-5-2b-8ga-4dim-flip-nte-[button gap]-av3-LoRA_-000070-420(d36f9fb8)", + "negativePrompt": "ugly drawn face, mutation, mutated, ugly, painting, sketch, rough draft, blurry, lowres, hideous, dismembered, jpeg artifacts, low quality, unfinished, text, watermark, irritated skin, tumor", + "AddNet Module 1": "LoRA", + "AddNet Weight 1": "1", + "Face restoration": "GFPGAN" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3103bc85-5b6c-45e3-91e7-a3a22a946400/width=450/55364.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UKKwe200M_Vs~V4n?bi^00IU-;xF~WxaNH%1", + "meta": { + "Eta": "0.69", + "ENSD": "72", + "Size": "512x768", + "seed": 1079020785, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 20, + "prompt": "masterpiece, best quality, 1girl, (button gap), huge breasts, button down shirt, ill fitting clothes, (sfw)", + "sampler": "DPM++ 2S a", + "cfgScale": 12, + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + }, + { + "hash": "916ed55b", + "name": "360", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "0873291ac5", + "AddNet Enabled": "True", + "AddNet Model 1": "buttongap_v0_x768-lr8e-5-2b-8ga-4dim-flip-nte-[button gap]-av3-LoRA_-000060-360(916ed55b)", + "negativePrompt": "ugly drawn face, mutation, mutated, ugly, painting, sketch, rough draft, blurry, lowres, hideous, dismembered, jpeg artifacts, low quality, unfinished, text, watermark, irritated skin, tumor", + "AddNet Module 1": "LoRA", + "AddNet Weight 1": "1", + "Face restoration": "GFPGAN" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7fd07608-aea3-47aa-e840-4ae334293700/width=450/55363.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UYLzR0IU%MtR%1M{-pxaD%WVxa%2~WofM{xa", + "meta": { + "Eta": "0.69", + "ENSD": "72", + "Size": "512x768", + "seed": 1079020785, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 20, + "prompt": "masterpiece, best quality, 1girl, bangs, black jacket, blush,breasts, brown eyes, eyeliner, horns, jacket, large breasts, long hair, makeup, necktie, parted bangs, pink eyes, red necktie, simple background, solo\n,(button gap), (huge breasts:1.2), button down shirt, ill fitting clothes, (sfw)", + "sampler": "DPM++ 2S a", + "cfgScale": 12, + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + }, + { + "hash": "ea2741eb", + "name": "540", + "type": "lora", + "weight": 1 + }, + { + "hash": "1e4c4593", + "name": "696", + "type": "lora", + "weight": 0.2 + } + ], + "Model hash": "0873291ac5", + "AddNet Enabled": "True", + "AddNet Model 1": "buttongap_v0_x768-lr8e-5-2b-8ga-4dim-flip-nte-[button gap]-av3-LoRA_-000090-540(ea2741eb)", + "AddNet Model 2": "hyper_breasts_1.8k_xl_kohya_captioned-lr1e-4-4b-8ga-64dim-flip-nte-av3-LoRA_epoc.ckpt-000012-696(1e4c4593)", + "negativePrompt": "topless, ugly drawn face, mutation, mutated, ugly, painting, sketch, rough draft, blurry, lowres, hideous, dismembered, jpeg artifacts, low quality, unfinished, text, watermark, irritated skin, tumor", + "AddNet Module 1": "LoRA", + "AddNet Module 2": "LoRA", + "AddNet Weight 1": "1", + "AddNet Weight 2": "0.2", + "Face restoration": "GFPGAN" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/bcb377da-02d4-4696-ff29-cad87b616100/width=450/55362.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UWKdY$^*M_-:w@%M%Lt64nof-;f5~WxuR*xu", + "meta": { + "Eta": "0.69", + "ENSD": "72", + "Size": "512x768", + "seed": 1079020787, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 20, + "prompt": "masterpiece, best quality, 1girl, (button gap), huge breasts, button down shirt, ill fitting clothes, (sfw)", + "sampler": "DPM++ 2S a", + "cfgScale": 12, + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + }, + { + "hash": "e2afefc7", + "name": "240", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "0873291ac5", + "AddNet Enabled": "True", + "AddNet Model 1": "buttongap_v0_x768-lr8e-5-2b-8ga-4dim-flip-nte-[button gap]-av3-LoRA_-000040-240(e2afefc7)", + "negativePrompt": "ugly drawn face, mutation, mutated, ugly, painting, sketch, rough draft, blurry, lowres, hideous, dismembered, jpeg artifacts, low quality, unfinished, text, watermark, irritated skin, tumor", + "AddNet Module 1": "LoRA", + "AddNet Weight 1": "1", + "Face restoration": "GFPGAN" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/6279" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/buttonGap_v1.ckpt" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/buttonGap_v1.ckpt" new file mode 100644 index 0000000000000000000000000000000000000000..5195f02d9e5ce489c465ff54a55c3d4391cf4c71 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/buttonGap_v1.ckpt" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:7f9a13f73c4839978d40794cd9621851edb1773474e6b25b670e248a631a1f22 +size 7032401 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/buttonGap_v1.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/buttonGap_v1.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..d98bea1a24f36b192e1f8e60a000d3e6a3c1a2f6 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/buttonGap_v1.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/cameltoe_v3.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/cameltoe_v3.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..9f17e23efc7c243efdb58f32be7453cdfdc6b76b --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/cameltoe_v3.civitai.info" @@ -0,0 +1,137 @@ +{ + "id": 75093, + "modelId": 22889, + "name": "v3.0", + "createdAt": "2023-05-19T16:21:50.254Z", + "updatedAt": "2023-05-19T16:49:30.177Z", + "trainedWords": [ + "cameltoe" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 1950, + "ratingCount": 5, + "rating": 5 + }, + "model": { + "name": "Cameltoe (for Anime)", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "cameltoe_v3.safetensors", + "id": 51843, + "sizeKB": 147569.544921875, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-19T16:26:41.580Z", + "hashes": { + "AutoV1": "699ABEFA", + "AutoV2": "DC75895C09", + "SHA256": "DC75895C099C790A5F40A68F4FBBDECC9E1ACAF598D9984B9BF2F52C69E20E51", + "CRC32": "5E856197", + "BLAKE3": "203084F453ED079F9CF5024E06862EB41F42937947337F269E5F58B406F78CD5" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/75093" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/29373b96-8087-4349-ace9-68befdd24ac9/width=450/845851.jpeg", + "nsfw": "Mature", + "width": 512, + "height": 512, + "hash": "U4B{=d~U10EN00bxDPD*$vE0=^={?b%1JUNx", + "meta": { + "steps": 32, + "prompt": "masterpiece, best_quality, 1girl, solo, long_grey_hair, eyelashes, large_breasts, (cameltoe:0.8), swimsuit, standing, night, beach, moon", + "sampler": "Euler a", + "cfgScale": 7, + "negativePrompt": "anus, lowres, bad_anatomy, bad_hands, text, error, missing_fingers, extra_digit, fewer_digits, cropped, worst_quality, low_quality, normal_quality, jpeg_artifacts, signature, watermark, username, blurry" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/071eb9c3-4516-4d23-ab80-2c400d15a9b3/width=450/845854.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UCGRk_IUx]xa~qf5eoofIoM_D%xu4nt7IUkC", + "meta": { + "steps": 32, + "prompt": "masterpiece, best_quality, 1girl, solo, short_grey_hair, eyelashes, large_breasts, (cameltoe:0.8), white_dress, white_panties, standing, dress_lift, night, outdoor", + "sampler": "Euler a", + "cfgScale": 7, + "negativePrompt": "anus, lowres, bad_anatomy, bad_hands, text, error, missing_fingers, extra_digit, fewer_digits, cropped, worst_quality, low_quality, normal_quality, jpeg_artifacts, signature, watermark, username, blurry" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/88b8840c-0b3e-4f04-9f0f-824af8b29f68/width=450/845853.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UDGH@^~VKQ018_%M4.R*0LIU~V?a-pofbbt7", + "meta": { + "steps": 32, + "prompt": "masterpiece, best_quality, 1girl, solo, long_grey_hair, eyelashes, large_breasts, (cameltoe:0.8), taut_clothes, black_stocking, standing, arms_behind_back", + "sampler": "Euler a", + "cfgScale": 7, + "negativePrompt": "anus, lowres, bad_anatomy, bad_hands, text, error, missing_fingers, extra_digit, fewer_digits, cropped, worst_quality, low_quality, normal_quality, jpeg_artifacts, signature, watermark, username, blurry" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/34762372-c38b-4b5a-96ee-cc798edbd3b2/width=450/845850.jpeg", + "nsfw": "None", + "width": 512, + "height": 512, + "hash": "UEHL0d?u%}9Z58%gIURQ}[$kE1Mx%1adxtn%", + "meta": { + "steps": 32, + "prompt": "masterpiece, best_quality, 1girl, solo, short_grey_hair, eyelashes, large_breasts, (cameltoe:0.8), serafuku, short_shorts, standing, boat, lake", + "sampler": "Euler a", + "cfgScale": 7, + "negativePrompt": "anus, lowres, bad_anatomy, bad_hands, text, error, missing_fingers, extra_digit, fewer_digits, cropped, worst_quality, low_quality, normal_quality, jpeg_artifacts, signature, watermark, username, blurry" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0e7d052c-a6c6-4c6f-a53b-fe713059f87a/width=450/845852.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "U8E{2[MxI:9aSg00?H^+EM00WV^+~p^*Io9F", + "meta": { + "steps": 32, + "prompt": "masterpiece, best_quality, 1girl, solo, long_grey_hair, eyelashes, large_breasts, (cameltoe:0.8), bodysuit, coat, looking_at_viewer, sitting, stool, bathroom", + "sampler": "Euler a", + "cfgScale": 7, + "negativePrompt": "anus, lowres, bad_anatomy, bad_hands, text, error, missing_fingers, extra_digit, fewer_digits, cropped, worst_quality, low_quality, normal_quality, jpeg_artifacts, signature, watermark, username, blurry" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7c45e037-10db-4dbc-a432-79b90ab19fac/width=450/845856.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "U9J%^B00H=xZ~Wxb%24n00-oo#-p00~q^+t7", + "meta": { + "steps": 32, + "prompt": "masterpiece, best_quality, 1girl, solo, long_grey_hair, eyelashes, large_breasts, (cameltoe:0.8), t-shirt, white_panties, lying, spread_legs, on_bed", + "sampler": "Euler a", + "cfgScale": 7, + "negativePrompt": "lowres, bad_anatomy, bad_hands, text, error, missing_fingers, extra_digit, fewer_digits, cropped, worst_quality, low_quality, normal_quality, jpeg_artifacts, signature, watermark, username, blurry" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/75093" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/cameltoe_v3.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/cameltoe_v3.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..8cd3e1348606cf2569a6711d51ff6fc5b37fe3bd Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/cameltoe_v3.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/cameltoe_v3.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/cameltoe_v3.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..ebd83b26edc0dc5991f862bff171481c44412c5e --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/cameltoe_v3.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:dc75895c099c790a5f40a68f4fbbdecc9e1acaf598d9984b9bf2f52c69e20e51 +size 151111214 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/chichibukuro.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/chichibukuro.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..8b2dc17cebfd885c03c460f00d38e319550d9fac --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/chichibukuro.civitai.info" @@ -0,0 +1,381 @@ +{ + "id": 91130, + "modelId": 85694, + "name": "v1.0", + "createdAt": "2023-06-07T15:09:45.440Z", + "updatedAt": "2023-06-07T15:22:38.330Z", + "trainedWords": [ + "chichibukuro" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 530, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "\u4e73\u888b Boob pockets", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "chichibukuro.safetensors", + "id": 62728, + "sizeKB": 73847.251953125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-07T15:11:02.654Z", + "hashes": { + "AutoV1": "7A6D931C", + "AutoV2": "206A26E949", + "SHA256": "206A26E94923A8AB5EF6D1E1292768A7D4BD5D583CB5C9A71A236F98C5632228", + "CRC32": "29A08877", + "BLAKE3": "75FD74AAA713E6C0D54B386F35192BDB2948EDAA02FEAC6315F6D2E6ACC014E6" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/91130" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c895781d-90cf-4bcd-b37e-6dcc7230836e/width=450/1062734.jpeg", + "nsfw": "None", + "width": 768, + "height": 1016, + "hash": "UNK18*~UImtQVr-q.8Nd?b-oD*xaDh%L-oof", + "meta": { + "Size": "512x680", + "seed": 3511353538, + "Model": "anythingV5Anything_anythingV5PrtRE", + "steps": 18, + "hashes": { + "model": "7f96a1a9ca" + }, + "prompt": "chichibukuro, 1girl, smile, breasts, maid, ", + "Version": "v1.3.0", + "sampler": "DDIM", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "chichibukuro", + "type": "lora", + "weight": 1 + }, + { + "hash": "7f96a1a9ca", + "name": "anythingV5Anything_anythingV5PrtRE", + "type": "model" + } + ], + "Model hash": "7f96a1a9ca", + "chichibukuro": "7e4f25435f2e", + "Hires upscale": "1.5", + "Hires upscaler": "Latent", + "negativePrompt": "EasyNegativeV2, negative_hand-neg ,(worst quality:1.4), (low quality:1.4) , (monochrome:1.1), normal quality, bad anatomy, bad proportions", + "Face restoration": "CodeFormer", + "Denoising strength": "0.6" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/02c65558-14cc-459f-8b72-7a84d536e6fc/width=450/1062737.jpeg", + "nsfw": "X", + "width": 3968, + "height": 761, + "hash": "UVL4W.?b.8_3~pV[bvo2t5V@t7a#.9Woo0xu", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f306ca22-5e74-4965-82f7-b443778a50f4/width=450/1062739.jpeg", + "nsfw": "Soft", + "width": 768, + "height": 1016, + "hash": "UMKdf39Gx??b${4;x]IU4.s:-;xt_4IUMx%M", + "meta": { + "Size": "512x680", + "seed": 1202282622, + "Model": "anythingV5Anything_anythingV5PrtRE", + "steps": 18, + "hashes": { + "model": "7f96a1a9ca" + }, + "prompt": "chichibukuro, 1girl, smile, breasts, plumber ", + "Version": "v1.3.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "chichibukuro", + "type": "lora", + "weight": 1.2 + }, + { + "hash": "7f96a1a9ca", + "name": "anythingV5Anything_anythingV5PrtRE", + "type": "model" + } + ], + "Model hash": "7f96a1a9ca", + "chichibukuro": "7e4f25435f2e", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegativeV2, negative_hand-neg ,(worst quality:1.4), (low quality:1.4) , (monochrome:1.1), normal quality, bad anatomy, bad proportions", + "Face restoration": "CodeFormer", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/fead4861-b1fc-4505-a276-99c22973f86d/width=450/1062789.jpeg", + "nsfw": "None", + "width": 768, + "height": 1016, + "hash": "UIK-qIpb0JJ401yD.9-mK5_4IV-opKbMN2Mx", + "meta": { + "Size": "512x680", + "seed": 3070903923, + "Model": "anythingV5Anything_anythingV5PrtRE", + "steps": 18, + "hashes": { + "model": "7f96a1a9ca" + }, + "prompt": "chichibukuro, 1girl, smile, breasts, hat, dress, white dress, hands on hips, outdoors, plant, building, day, long sleeves, sun hat, smile, potted plant, standing, tree, sky, closed mouth ", + "Version": "v1.3.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "chichibukuro", + "type": "lora", + "weight": 1.2 + }, + { + "hash": "7f96a1a9ca", + "name": "anythingV5Anything_anythingV5PrtRE", + "type": "model" + } + ], + "Model hash": "7f96a1a9ca", + "chichibukuro": "7e4f25435f2e", + "Hires upscale": "1.5", + "Hires upscaler": "Latent", + "negativePrompt": "EasyNegativeV2, negative_hand-neg ,(worst quality:1.4), (low quality:1.4) , (monochrome:1.1), normal quality, bad anatomy, bad proportions", + "Face restoration": "CodeFormer", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ca47f88c-6108-4f0c-a520-2718872a54b3/width=450/1062788.jpeg", + "nsfw": "None", + "width": 768, + "height": 1016, + "hash": "U8Gup~DR.-~S-O?u00Di00eR7O9x?^RP-o%g", + "meta": { + "Size": "512x680", + "seed": 202375206, + "Model": "ambientmix-half", + "steps": 18, + "hashes": { + "model": "fdffd3c312" + }, + "prompt": "chichibukuro, 1girl, smile, breasts, hat, skirt, indoors, book, blue shirt, long sleeves, long skirt, shirt, box ", + "Version": "v1.3.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "chichibukuro", + "type": "lora", + "weight": 1 + }, + { + "hash": "fdffd3c312", + "name": "ambientmix-half", + "type": "model" + } + ], + "Model hash": "fdffd3c312", + "chichibukuro": "7e4f25435f2e", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegativeV2, negative_hand-neg ,(worst quality:1.4), (low quality:1.4) , (monochrome:1.1), normal quality, bad anatomy, bad proportions", + "Face restoration": "CodeFormer", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7a1fa51f-815b-4e45-8bed-67849a38d0c7/width=450/1062787.jpeg", + "nsfw": "None", + "width": 768, + "height": 1016, + "hash": "UNGlSAx]I9~pz-RiEgxaeSs,xtxu.SRPxD%M", + "meta": { + "Size": "512x680", + "seed": 2529464913, + "Model": "chilloutmix_NiPrunedFp16Fix", + "steps": 18, + "hashes": { + "model": "59ffe2243a" + }, + "prompt": "chichibukuro, 1girl, smile, breasts, smile, long sleeves, realistic, jewelry, teeth, open mouth, earrings, black hair ", + "Version": "v1.3.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "chichibukuro", + "type": "lora", + "weight": 1.1 + }, + { + "hash": "59ffe2243a", + "name": "chilloutmix_NiPrunedFp16Fix", + "type": "model" + } + ], + "Model hash": "59ffe2243a", + "chichibukuro": "7e4f25435f2e", + "Hires upscale": "1.5", + "Hires upscaler": "Latent", + "negativePrompt": "EasyNegativeV2, negative_hand-neg ,(worst quality:1.4), (low quality:1.4) , (monochrome:1.1), normal quality, bad anatomy, bad proportions", + "Face restoration": "CodeFormer", + "Denoising strength": "0.6" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/63c17d5d-c2c8-4781-9a38-01301d915356/width=450/1062786.jpeg", + "nsfw": "Soft", + "width": 768, + "height": 1016, + "hash": "UNHLMH-W_NIUW=E2E2jbE2M{R+xZ%hofxboe", + "meta": { + "Size": "512x680", + "seed": 1812097007, + "Model": "chilloutmix_NiPrunedFp16Fix", + "steps": 18, + "hashes": { + "model": "59ffe2243a" + }, + "prompt": "chichibukuro, 1girl, smile, breasts, jewelry, ring, necklace, looking at viewer, realistic, blurry, upper body, bracelet, parted lips, blurry background, shirt, hand up, lips, hair twirling, teeth, bangs ", + "Version": "v1.3.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "chichibukuro", + "type": "lora", + "weight": 1.1 + }, + { + "hash": "59ffe2243a", + "name": "chilloutmix_NiPrunedFp16Fix", + "type": "model" + } + ], + "Model hash": "59ffe2243a", + "chichibukuro": "7e4f25435f2e", + "Hires upscale": "1.5", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegativeV2, negative_hand-neg ,(worst quality:1.4), (low quality:1.4) , (monochrome:1.1), normal quality, bad anatomy, bad proportions", + "Face restoration": "CodeFormer", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ed3fa786-1fb1-40e6-a287-86b24c44e0cc/width=450/1062785.jpeg", + "nsfw": "None", + "width": 768, + "height": 1016, + "hash": "UJK1L8~A%#_200xD.Ss,baRP9FRP?bax-oWX", + "meta": { + "Size": "512x680", + "seed": 3502629152, + "Model": "Basil_mix_fixed", + "steps": 18, + "hashes": { + "model": "0ff127093f" + }, + "prompt": "chichibukuro, 1girl, smile, breasts, animator ", + "Version": "v1.3.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "chichibukuro", + "type": "lora", + "weight": 1.2 + }, + { + "hash": "0ff127093f", + "name": "Basil_mix_fixed", + "type": "model" + } + ], + "Model hash": "0ff127093f", + "chichibukuro": "7e4f25435f2e", + "Hires upscale": "1.5", + "Hires upscaler": "Latent", + "negativePrompt": "EasyNegativeV2, negative_hand-neg ,(worst quality:1.4), (low quality:1.4) , (monochrome:1.1), normal quality, bad anatomy, bad proportions", + "Face restoration": "CodeFormer", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/07d704b1-bee4-42c4-a802-8a8cb71c6bbb/width=450/1062816.jpeg", + "nsfw": "Soft", + "width": 768, + "height": 1016, + "hash": "UNKAQh^jY4D%~C%L9an$Tc%M-pxat7ozozRk", + "meta": { + "Size": "512x680", + "seed": 1282537616, + "Model": "anythingV5Anything_anythingV5PrtRE", + "steps": 18, + "hashes": { + "model": "7f96a1a9ca" + }, + "prompt": "chichibukuro, 1girl, smile, breasts, sweater, tight skirt, ", + "Version": "v1.3.0", + "sampler": "DDIM", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "chichibukuro", + "type": "lora", + "weight": 1 + }, + { + "hash": "7f96a1a9ca", + "name": "anythingV5Anything_anythingV5PrtRE", + "type": "model" + } + ], + "Model hash": "7f96a1a9ca", + "chichibukuro": "7e4f25435f2e", + "Hires upscale": "1.5", + "Hires upscaler": "Latent", + "negativePrompt": "EasyNegativeV2, negative_hand-neg ,(worst quality:1.4), (low quality:1.4) , (monochrome:1.1), normal quality, bad anatomy, bad proportions", + "Face restoration": "CodeFormer", + "Denoising strength": "0.6" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/91130" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/chichibukuro.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/chichibukuro.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..e7ede9d4002322e19a8fe66a8c24a520bad9b820 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/chichibukuro.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/chichibukuro.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/chichibukuro.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..47a5a57bea2caa666a0e3bc40c9c059419326a5a --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/chichibukuro.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:206a26e94923a8ab5ef6d1e1292768a7d4bd5d583cb5c9a71a236f98c5632228 +size 75619586 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/dekanyu_v5.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/dekanyu_v5.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..51412d5b0c8286c9d5ff8852da79fb24e1af5333 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/dekanyu_v5.civitai.info" @@ -0,0 +1,153 @@ +{ + "id": 63858, + "modelId": 59404, + "name": "v1.0", + "createdAt": "2023-05-06T11:34:31.035Z", + "updatedAt": "2023-05-06T11:40:52.132Z", + "trainedWords": [ + "areolae" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 201, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Large areolae LoRA", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "dekanyu_v5.safetensors", + "id": 44921, + "sizeKB": 36975.9267578125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-06T11:40:57.217Z", + "hashes": { + "AutoV1": "04B3D287", + "AutoV2": "688C2FCC38", + "SHA256": "688C2FCC383A410B1BE1AB049EA6FC7DF68DE283A9EE406B459AE6922F3D07F5", + "CRC32": "F6F350D8", + "BLAKE3": "A58FD8C8ADE38EFCD7CD54536742B302E7B8EBF612A00E94EED2E99D0F101B31" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/63858" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7a64dd34-bd16-4164-b437-3097aa3e6157/width=450/704830.jpeg", + "nsfw": "None", + "width": 704, + "height": 896, + "hash": "UbI;I;bH9^ofJ7aesmjsRjj@xtj[~VayWBf7", + "meta": { + "ENSD": "31337", + "Size": "704x896", + "seed": 3111348249, + "Model": "anything-v4.0-pruned-fp32", + "steps": 40, + "hashes": { + "model": "f28a232119" + }, + "prompt": "1girl, (completely nude:1.4), upper body, anime screencap, face focus, (plump:1.4) , (dark areolae:1.2)", + "sampler": "DDIM", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "f28a232119", + "name": "anything-v4.0-pruned-fp32", + "type": "model" + } + ], + "Model hash": "f28a232119", + "negativePrompt": "(worst quality:1.4), (low quality:1.9), (blurry:2), (bad_prompt:0.1)," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/09153402-032d-4f6e-b860-62d80cadf6c6/width=450/704831.jpeg", + "nsfw": "X", + "width": 704, + "height": 896, + "hash": "USIz#RxuFdofEyt7WTkAI:og-oof~Vj]WVoL", + "meta": { + "ENSD": "31337", + "Size": "704x896", + "seed": 3111348249, + "Model": "anything-v4.0-pruned-fp32", + "steps": 40, + "hashes": { + "model": "f28a232119" + }, + "prompt": "1girl, (completely nude:1.4), upper body, anime screencap, face focus, (plump:1.4) , (dark areolae:1.2) ", + "sampler": "DDIM", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "dekanyu_v5", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "f28a232119", + "name": "anything-v4.0-pruned-fp32", + "type": "model" + } + ], + "Model hash": "f28a232119", + "negativePrompt": "(worst quality:1.4), (low quality:1.9), (blurry:2), (bad_prompt:0.1)," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e5b48461-157f-4a4c-98d0-54e539723575/width=450/704833.jpeg", + "nsfw": "X", + "width": 704, + "height": 896, + "hash": "UOIzxIxvF_t7ABxubDt6I.t7?Gt7~VogX8of", + "meta": { + "ENSD": "31337", + "Size": "704x896", + "seed": 3111348249, + "Model": "anything-v4.0-pruned-fp32", + "steps": 40, + "hashes": { + "model": "f28a232119" + }, + "prompt": "1girl, (completely nude:1.4), upper body, anime screencap, face focus, (plump:1.4) , (dark areolae:1.2) ", + "sampler": "DDIM", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "dekanyu_v5", + "type": "lora", + "weight": 1 + }, + { + "hash": "f28a232119", + "name": "anything-v4.0-pruned-fp32", + "type": "model" + } + ], + "Model hash": "f28a232119", + "negativePrompt": "(worst quality:1.4), (low quality:1.9), (blurry:2), (bad_prompt:0.1)," + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/63858" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/dekanyu_v5.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/dekanyu_v5.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..54103f1ca9a45fde8f65e5b30313098ce37456e0 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/dekanyu_v5.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/dekanyu_v5.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/dekanyu_v5.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..44d60b84ae4c385fffaddd5fe29e6f1898c32a16 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/dekanyu_v5.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:688c2fcc383a410b1be1ab049ea6fc7df68de283a9ee406b459ae6922f3d07f5 +size 37863349 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/dikkosPrefectPussy_v10.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/dikkosPrefectPussy_v10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..a26dd0f5f79623f65050bf11e49429a6d8b0d1ac --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/dikkosPrefectPussy_v10.civitai.info" @@ -0,0 +1,203 @@ +{ + "id": 20110, + "modelId": 17028, + "name": "v1.0", + "createdAt": "2023-03-08T06:25:34.542Z", + "updatedAt": "2023-03-08T06:25:34.542Z", + "trainedWords": [ + "pussy" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

", + "model": { + "name": "dikko's prefect pussy dikko style", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "dikkosPrefectPussy_v10.safetensors", + "id": 16788, + "sizeKB": 147568.5458984375, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-03-08T06:31:09.334Z", + "hashes": { + "AutoV1": "61F84056", + "AutoV2": "9072D705B9", + "SHA256": "9072D705B9F3CD20234E97056D703D62FDA44B0A7FE1E923C47758628D11A040", + "CRC32": "F6725F72", + "BLAKE3": "2394347B2CF9047323F992D8116A10C0AB14405EDC5E53B8C8BD6A7D6F6EF617" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/20110" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4ef1457f-42f0-4592-4e00-0ce8f6903a00/width=450/212585.jpeg", + "nsfw": true, + "width": 1024, + "height": 1024, + "hash": "UGIz^=000~#-Au4T~VMy0LR*?HM{n4-;E1XA", + "meta": { + "Size": "512x512", + "seed": 3914653667, + "Model": "AbyssOrangeMix2_hard", + "steps": 20, + "prompt": "1girl,nsfw,pussy,nude,cum in pussyspread pussy, spread legs, ", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "Hires steps": "23", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "negativePrompt": "(worst quality, low quality, extra digits:1.4),artist name,pointy ears,", + "Denoising strength": "0.46" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/86c77ee9-3757-4b7a-2208-b791aa9d2000/width=450/212589.jpeg", + "nsfw": true, + "width": 1024, + "height": 1024, + "hash": "UYJ@B{D%57~VEQj?%2j]9aNGofM|WYRjj@WE", + "meta": { + "Size": "512x512", + "seed": 3914653672, + "Model": "AbyssOrangeMix2_hard", + "steps": 20, + "prompt": "1girl,nsfw,pussy,nude,cum in pussyspread pussy, spread legs, ", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "Hires steps": "23", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "negativePrompt": "(worst quality, low quality, extra digits:1.4),artist name,pointy ears,", + "Denoising strength": "0.46" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5bc8217c-5ade-49cd-1cfc-f3effe222000/width=450/212588.jpeg", + "nsfw": true, + "width": 1024, + "height": 1024, + "hash": "UPJQTVx]9sxt0LV@aKt700RQW;Rj}[bbjYM{", + "meta": { + "Size": "512x512", + "seed": 3914653673, + "Model": "AbyssOrangeMix2_hard", + "steps": 20, + "prompt": "1girl,nsfw,pussy,nude,cum in pussyspread pussy, spread legs, ", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "Hires steps": "23", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "negativePrompt": "(worst quality, low quality, extra digits:1.4),artist name,pointy ears,", + "Denoising strength": "0.46" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3d543e50-cd3c-4558-b27b-e4e884d07900/width=450/212587.jpeg", + "nsfw": true, + "width": 1024, + "height": 1024, + "hash": "U8IN:Zs,00$i009F,C-:00kr~WD*8w%34.I;", + "meta": { + "Size": "512x512", + "seed": 3914653675, + "Model": "AbyssOrangeMix2_hard", + "steps": 20, + "prompt": "1girl,nsfw,pussy,nude,cum in pussyspread pussy, spread legs, ", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "Hires steps": "23", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "negativePrompt": "(worst quality, low quality, extra digits:1.4),artist name,pointy ears,", + "Denoising strength": "0.46" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/09d8f4c6-6b54-4a3b-bb72-aa137a4dcd00/width=450/212586.jpeg", + "nsfw": true, + "width": 1024, + "height": 1024, + "hash": "UAHUOeoz00oL1Jja}@of00t7_2oL^+t601ay", + "meta": { + "Size": "512x512", + "seed": 311446873, + "Model": "AbyssOrangeMix2_hard", + "steps": 20, + "prompt": "1girl,nsfw,pussy,nude,cum in pussyspread pussy, spread legs, ", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "pussy", + "type": "lora", + "weight": 0.5 + }, + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "Hires steps": "23", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "negativePrompt": "(worst quality, low quality, extra digits:1.4),artist name,pointy ears,", + "Denoising strength": "0.46" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/20110" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/dikkosPrefectPussy_v10.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/dikkosPrefectPussy_v10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..871cb604215dfbfaf2c6a0544e63560ed18728c2 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/dikkosPrefectPussy_v10.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:d6230bbca87710387f96c5920938582b05bfa4dbe8a623440074c116db987024 +size 1491261 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/dikkosPrefectPussy_v10.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/dikkosPrefectPussy_v10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..8d5b96eb2f0e058aedd7c517285677c59757d2ab --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/dikkosPrefectPussy_v10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9072d705b9f3cd20234e97056d703d62fda44b0a7fe1e923c47758628d11a040 +size 151110191 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/extremeGapingCustom_epoch10CustomModel.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/extremeGapingCustom_epoch10CustomModel.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..ac255c51cf46357d69d2bdb9690bb75092c9b0da --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/extremeGapingCustom_epoch10CustomModel.civitai.info" @@ -0,0 +1,123 @@ +{ + "id": 9581, + "modelId": 8110, + "name": "Epoch 10 Custom Model", + "createdAt": "2023-02-12T00:51:33.524Z", + "updatedAt": "2023-02-14T21:55:06.998Z", + "trainedWords": [], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 4955, + "ratingCount": 3, + "rating": 5 + }, + "model": { + "name": "Extreme Gaping Custom Model", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "extremeGapingCustom_epoch10CustomModel.safetensors", + "id": 9277, + "sizeKB": 73844.419921875, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-02-12T00:56:04.007Z", + "hashes": { + "AutoV1": "4D5DCB84", + "AutoV2": "C94E56C982", + "SHA256": "C94E56C982C91B60ACFFEB6164DBF67E2FC5942F09E9D1CB09F2BB74524CD251", + "CRC32": "09A750B8", + "BLAKE3": "6210A7F74EE14DBEF05AC7AEC58D94C85AA1736A4B498C4346E5AB747B202CA5" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/9581" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a84f55e9-5aec-4872-af52-eedb7e2e7c00/width=450/92601.jpeg", + "nsfw": true, + "width": 1024, + "height": 1024, + "hash": "UVI;k+~px]t7-:%MRiM|F1-;%MWB%2%Mx]a}", + "meta": { + "ENSD": "31339", + "Size": "512x512", + "seed": 1642315633, + "Model": "good models_LawrenceMix3.0-new", + "steps": 20, + "prompt": "aqua, kono subarashii sekai ni shukufuku wo!, messy hair, {{{ultra realistic}}}, {{extreme body details}}, masterpiece, absurdres, ray tracing, detailed lighting, digital art, volumetric lighting, (intricate), bloom effect, beautiful detailed, pop surrealism, ultra detailed eyes, ultra detailed, (detailed), dramatic light, finely detailed art, cinematic lighting, highly detailed, sharp focus, professional, photoshoot, 8k, yellow eyes, barefoot, foot focus, spread legs, spread pussy, looking at viewer, masterpiece, absurdres, highres , ray tracing , detailed lighting , digital art , volumetric lighting , (intricate) , bloom effect , (beautiful detailed) , pop surrealism , ultra detailed eyes , ultra detailed, (detailed) , dramatic light , finely detailed art, cinematic lighting, highly detailed, sharp focus, professional photoshoot, 8k, sexually suggestive, sweaty, sweat, sweating, wet, gaping anus, spread anus, absurdres, highres, solo, beautiful detailed face, ultra detailed eyes, extremely detailed, Masterpiece, best quality, ahegao, mind break, drooling, oil painting, realistic, foot focus, gaping pussy, cervix, feet up, bedroom, teddy bear, window, blue sky, computer, desk, on bed, on back, lying, medium breasts, ", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "gaping", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "2a67772482", + "name": "good models_LawrenceMix3.0-new", + "type": "model" + } + ], + "Model hash": "2a67772482", + "Hires steps": "20", + "Hires upscale": "2", + "Hires upscaler": "lollypop", + "negativePrompt": "llowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, worst quality, low quality, jpeg artifacts, signature, watermark, username, lowres, bad anatomy, bad hands, text, error, missing fingers, pencil drawing, old, plain background, grainy, low quality, mutated hands and fingers, letterboxed, flat chest, blurry, letterboxed, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, jpeg artifacts, signature, watermark, username, blurry, lowres, bad anatomy, bad hands, text, error, missing fingers, animal ears, animal ear fluff, (bad art, low detail, pencil drawing), (plain background, grainy, low quality, mutated hands and fingers:1.5), (watermark, thin lines:1.3), deformed, signature, letterboxed,, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, , jpeg artifacts, signature, watermark, username, blurry,, lowres, bad anatomy, bad hands, text, error, missing fingers, animal ears, animal ear fluff, (bad art, low detail, pencil drawing),\n(plain background, grainy, low quality, mutated hands and fingers:1.5),\n(watermark, thin lines:1.3),\n(deformed, signature:1.2),, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, artist name, lowres, bad_prompt_v2, text, error, cropped, worst quality, low quality, jpeg artifacts, signature, watermark, username, blurry, artist name, censored, bar censor, ((simple background:1.1:1.1)), letterboxed,, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, censored, letterbox, blurry, clothing,, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, , jpeg artifacts, signature, watermark, username, blurry,, lowres, bad anatomy, bad hands, text, error, missing fingers,, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, , jpeg artifacts, signature, watermark, username, blurry,, lowres, bad anatomy, bad hands, text, error, missing fingers, animal ears, animal ear fluff, (bad art, low detail, pencil drawing),\n(plain background, grainy, low quality, mutated hands and fingers:1.5),\n(watermark, thin lines:1.3),\n(deformed, signature:1.2),\n2 girls, loli", + "Denoising strength": "0.3" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c73f723e-a69a-4a9c-ab40-2a59b6d29f00/width=450/92599.jpeg", + "nsfw": true, + "width": 1024, + "height": 1024, + "hash": "UOI;bejZELs;%zj[4okCPAWBs;bH~CoLM{oe", + "meta": { + "ENSD": "31339", + "Size": "512x512", + "seed": 3552279395, + "Model": "good models_LawrenceMix3.0-new", + "steps": 20, + "prompt": "raphtalia, messy hair, {{{ultra realistic}}}, {{extreme body details}}, masterpiece, absurdres, ray tracing, detailed lighting, digital art, volumetric lighting, (intricate), bloom effect, beautiful detailed, pop surrealism, ultra detailed eyes, ultra detailed, (detailed), dramatic light, finely detailed art, cinematic lighting, highly detailed, sharp focus, professional, photoshoot, 8k, yellow eyes, barefoot, foot focus, spread legs, spread pussy, looking at viewer, masterpiece, absurdres, highres , ray tracing , detailed lighting , digital art , volumetric lighting , (intricate) , bloom effect , (beautiful detailed) , pop surrealism , ultra detailed eyes , ultra detailed, (detailed) , dramatic light , finely detailed art, cinematic lighting, highly detailed, sharp focus, professional photoshoot, 8k, sexually suggestive, sweaty, sweat, sweating, wet, gaping anus, spread anus, absurdres, highres, solo, beautiful detailed face, ultra detailed eyes, extremely detailed, Masterpiece, best quality, ahegao, mind break, drooling, oil painting, realistic, foot focus, gaping pussy, cervix, feet up, bedroom, teddy bear, window, blue sky, computer, desk, on bed, on back, lying, medium breasts, ", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "gaping", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "2a67772482", + "name": "good models_LawrenceMix3.0-new", + "type": "model" + } + ], + "Model hash": "2a67772482", + "Hires steps": "20", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "llowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, worst quality, low quality, jpeg artifacts, signature, watermark, username, lowres, bad anatomy, bad hands, text, error, missing fingers, pencil drawing, old, plain background, grainy, low quality, mutated hands and fingers, letterboxed, flat chest, blurry, letterboxed, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, jpeg artifacts, signature, watermark, username, blurry, lowres, bad anatomy, bad hands, text, error, missing fingers, animal ears, animal ear fluff, (bad art, low detail, pencil drawing), (plain background, grainy, low quality, mutated hands and fingers:1.5), (watermark, thin lines:1.3), deformed, signature, letterboxed,, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, , jpeg artifacts, signature, watermark, username, blurry,, lowres, bad anatomy, bad hands, text, error, missing fingers, animal ears, animal ear fluff, (bad art, low detail, pencil drawing),\n(plain background, grainy, low quality, mutated hands and fingers:1.5),\n(watermark, thin lines:1.3),\n(deformed, signature:1.2),, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, artist name, lowres, bad_prompt_v2, text, error, cropped, worst quality, low quality, jpeg artifacts, signature, watermark, username, blurry, artist name, censored, bar censor, ((simple background:1.1:1.1)), letterboxed,, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, censored, letterbox, blurry, clothing,, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, , jpeg artifacts, signature, watermark, username, blurry,, lowres, bad anatomy, bad hands, text, error, missing fingers,, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, , jpeg artifacts, signature, watermark, username, blurry,, lowres, bad anatomy, bad hands, text, error, missing fingers, animal ears, animal ear fluff, (bad art, low detail, pencil drawing),\n(plain background, grainy, low quality, mutated hands and fingers:1.5),\n(watermark, thin lines:1.3),\n(deformed, signature:1.2),\n2 girls, loli", + "Denoising strength": "0.5" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/9581" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/extremeGapingCustom_epoch10CustomModel.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/extremeGapingCustom_epoch10CustomModel.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..d784a69c3c7fd9d94da342c448c6e54a1d7cb0a9 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/extremeGapingCustom_epoch10CustomModel.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/extremeGapingCustom_epoch10CustomModel.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/extremeGapingCustom_epoch10CustomModel.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..17e83b6d4dc2fa61cb3e636c7980b3bdfbce6d7a --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/extremeGapingCustom_epoch10CustomModel.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:c94e56c982c91b60acffeb6164dbf67e2fc5942f09e9d1cb09f2bb74524cd251 +size 75616686 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/gakikyonyuu.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/gakikyonyuu.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..fb13c582dc1454acda79991bee48d99c1845c9ad --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/gakikyonyuu.civitai.info" @@ -0,0 +1,59 @@ +{ + "id": 93619, + "modelId": 87419, + "name": "v2.0", + "createdAt": "2023-06-11T07:41:14.519Z", + "updatedAt": "2023-06-11T08:13:12.137Z", + "trainedWords": [], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 44, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "\u30ac\u30ad\u5de8\u4e73 Gaki kyonyuu", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "gakikyonyuu.safetensors", + "id": 64701, + "sizeKB": 18594.568359375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-11T08:06:27.860Z", + "hashes": { + "AutoV1": "9A56D7A5", + "AutoV2": "B2B24553B5", + "SHA256": "B2B24553B54B5C93F31A7AF37F21B7247A6328245F24C858AB0A250D384D94C7", + "CRC32": "F8C5D2FB", + "BLAKE3": "7400F097A3A8C279AA12ED04ED6FAB047193FAED4BD71E293872A43D5768D8A7" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/93619" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/37e0b9a6-5eb7-4201-a4b5-ca0c0d41742a/width=450/1106228.jpeg", + "nsfw": "Mature", + "width": 520, + "height": 704, + "hash": "UMHxQi%h?wt7~p%L?bxuOYt7^*oJJVxZ%1R*", + "meta": null + } + ], + "downloadUrl": "https://civitai.com/api/download/models/93619" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/gakikyonyuu.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/gakikyonyuu.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..2d0d4f379cc24a1714bee6a1cb5e52803d948a50 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/gakikyonyuu.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/gakikyonyuu.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/gakikyonyuu.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..64bc030f088a796d41803042ff5fe66b8a8b4967 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/gakikyonyuu.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:b2b24553b54b5c93f31a7af37f21b7247a6328245f24c858ab0a250d384d94c7 +size 19040838 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/gigantic_breasts.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/gigantic_breasts.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..cde54459da63d44b9716c472c261c5ab1a4ccfa4 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/gigantic_breasts.civitai.info" @@ -0,0 +1,368 @@ +{ + "id": 62252, + "modelId": 57811, + "name": "v1.0", + "createdAt": "2023-05-04T14:09:35.124Z", + "updatedAt": "2023-05-04T14:34:54.170Z", + "trainedWords": [ + "gigantic breasts", + "large breasts" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 617, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Gigantic Melon", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "gigantic_breasts.safetensors", + "id": 43972, + "sizeKB": 18555.5947265625, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-04T14:10:52.431Z", + "hashes": { + "AutoV1": "DE2F2560", + "AutoV2": "3DE75E2F10", + "SHA256": "3DE75E2F10105360162979BADB92C973CAF3B6CA288B7049F204BA070756908F", + "CRC32": "744B5278", + "BLAKE3": "55C1715920A6488E9899F882EA47ED804433EDD89F9BFC6457926FACCAC479AB" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/62252" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5a1f3000-1ce0-4071-ac71-649908879406/width=450/684371.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "USHw_d~VoyWCIoM{aeNG9GIVxt-oS5xuofNH", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1590052947, + "Model": "perfectWorld_v2Baked", + "steps": 20, + "hashes": { + "model": "79e42fb744" + }, + "prompt": "gigantic breasts,large breasts,cowboy shot, (masterpiece), (best quality:1.2), absurdres, photo, photorealistic,highly detailed, detailed face, solo", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "79e42fb744", + "name": "perfectWorld_v2Baked", + "type": "model" + } + ], + "Model hash": "79e42fb744", + "negativePrompt": "nsfw, (worst quality, low quality:1.4),signature, bad_artist, bad_hands, bad_prompt_version2,easynegative,", + "Face restoration": "CodeFormer" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/df75ccd1-f0e3-4fda-ad70-e86b14d1dacb/width=450/684368.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "USIXmn01Ot?b_ND%%Mx]x]kCR*t7bwtR-pWB", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1744478622, + "Model": "perfectWorld_v2Baked", + "steps": 20, + "hashes": { + "model": "79e42fb744" + }, + "prompt": "gigantic breasts,large breasts,cowboy shot, (masterpiece), (best quality:1.2), absurdres, photo, photorealistic,highly detailed, detailed face, solo, princess,crown , jewelry,looking at viewer, royal outfit", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "gigantic_breasts", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "79e42fb744", + "name": "perfectWorld_v2Baked", + "type": "model" + } + ], + "Model hash": "79e42fb744", + "negativePrompt": "nsfw, (worst quality, low quality:1.4),signature, bad_artist, bad_hands, bad_prompt_version2,easynegative,", + "Face restoration": "CodeFormer" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3681b975-3ec9-498d-9d55-5315007dc196/width=450/684370.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "UCG*TZ00EyS*~99b^%IU0#xDNHofE3WWsTbv", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1590052948, + "Model": "perfectWorld_v2Baked", + "steps": 20, + "hashes": { + "model": "79e42fb744" + }, + "prompt": "gigantic breasts,large breasts,cowboy shot, (masterpiece), (best quality:1.2), absurdres, photo, photorealistic,highly detailed, detailed face, solo", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "79e42fb744", + "name": "perfectWorld_v2Baked", + "type": "model" + } + ], + "Model hash": "79e42fb744", + "negativePrompt": "nsfw, (worst quality, low quality:1.4),signature, bad_artist, bad_hands, bad_prompt_version2,easynegative,", + "Face restoration": "CodeFormer" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0e6bef2e-640d-4615-9eb6-8d09842c099c/width=450/684331.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UWG[.%~qoyWB.8NdV@WCI@M|-p-:-=%g%2kB", + "meta": { + "ENSD": "31337", + "Size": "1024x1536", + "seed": 642650180, + "Model": "goofball-baked-vae", + "steps": 20, + "hashes": { + "model": "0867a52bb8" + }, + "prompt": "gigantic breasts, masterpiece, best_quality, absurdres, ultra-detailed, extremely_detailed, 1girl, (techwear:1.4), baseball_cap, black_headwear, black_nails, blue_choker, blue_eyes, grey_hair, casual, choker, head_tilt, short_hair, bob_cut, swept_bangs, single_sidelock, long_sleeves, looking_at_viewer, (multicolored_clothes, two-tone_techwear, blue_techwear, black_techwear:1.2), nail_polish, partially_unzipped, piercing, shirt, solo, star_earrings, (sunglasses:1.4), upper_body, t-shirt, collarbone, white_shirt, clothes_writing, scenery, outdoors, city, gold_chain, sunlight, parted_lips, dynamic_angle, dutch_angle,", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "0867a52bb8", + "name": "goofball-baked-vae", + "type": "model" + } + ], + "Model hash": "0867a52bb8", + "negativePrompt": "nsfw, (worst quality, low quality:1.4),signature, bad_artist, bad_hands, bad_prompt_version2,easynegative,", + "Denoising strength": "0.2", + "Ultimate SD upscale padding": "32", + "Ultimate SD upscale upscaler": "4x-UltraSharp", + "Ultimate SD upscale mask_blur": "8", + "Ultimate SD upscale tile_width": "512", + "Ultimate SD upscale tile_height": "512" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/25a62ace-47ec-48c6-b24c-9b31e53c0be9/width=450/684334.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UKI#+FV@9]_2k=IU?^o}lVIV-;tl?wN1WZR.", + "meta": { + "ENSD": "31337", + "Size": "1024x1536", + "seed": 605115192, + "Model": "RuviMix_V1", + "steps": 20, + "hashes": { + "model": "f73757d749" + }, + "prompt": "gigantic breasts, masterpiece, best_quality, absurdres, ultra-detailed, extremely_detailed, 1girl, (techwear:1.4), baseball_cap, black_headwear, black_nails, blue_choker, blue_eyes, grey_hair, casual, choker, head_tilt, short_hair, bob_cut, swept_bangs, single_sidelock, long_sleeves, looking_at_viewer, (multicolored_clothes, two-tone_techwear, blue_techwear, black_techwear:1.2), nail_polish, partially_unzipped, piercing, shirt, solo, star_earrings, (sunglasses:1.4), upper_body, t-shirt, collarbone, white_shirt, clothes_writing, scenery, outdoors, city, gold_chain, sunlight, parted_lips, dynamic_angle, dutch_angle,", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "f73757d749", + "name": "RuviMix_V1", + "type": "model" + } + ], + "Model hash": "f73757d749", + "negativePrompt": "nsfw, (worst quality, low quality:1.4),signature, bad_artist, bad_hands, bad_prompt_version2,easynegative,", + "Denoising strength": "0.2", + "Ultimate SD upscale padding": "32", + "Ultimate SD upscale upscaler": "4x-UltraSharp", + "Ultimate SD upscale mask_blur": "8", + "Ultimate SD upscale tile_width": "512", + "Ultimate SD upscale tile_height": "512" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/21f54804-ffaf-4cd9-8a77-f0ac49498973/width=450/684333.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UTOWE8f,PWxa_Mxt?cof?bRks=oJ^%xu9HWB", + "meta": { + "ENSD": "31337", + "Size": "1024x1536", + "seed": 179299896, + "Model": "RuviMix_V1", + "steps": 20, + "hashes": { + "model": "f73757d749" + }, + "prompt": "gigantic breasts,large breasts, (jewelry:1.000), (earrings:0.998), (1girl:0.959), (necklace:0.958), (blue_eyes:0.921), (short_hair:0.909), (looking_at_viewer:0.880), (hair_between_eyes:0.863), (solo:0.793), (parted_lips:0.771), (bangs:0.734), (upper_body:0.696), (black_background:0.679)", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "f73757d749", + "name": "RuviMix_V1", + "type": "model" + } + ], + "Model hash": "f73757d749", + "negativePrompt": "nsfw, (worst quality, low quality:1.4),signature, bad_artist, bad_hands, bad_prompt_version2,easynegative,", + "Denoising strength": "0.2", + "Ultimate SD upscale padding": "32", + "Ultimate SD upscale upscaler": "4x-UltraSharp", + "Ultimate SD upscale mask_blur": "8", + "Ultimate SD upscale tile_width": "512", + "Ultimate SD upscale tile_height": "512" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4504bf8f-38b0-466b-ac66-e27fe19df6e3/width=450/684335.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UCFY480L00?H0f~AxvEg01EL_2-V59Nb$fs.", + "meta": { + "ENSD": "31337", + "Size": "1024x1536", + "seed": 3563276375, + "Model": "RuviMix_V1", + "steps": 20, + "hashes": { + "model": "f73757d749" + }, + "prompt": "gigantic breasts,large breasts, 1girl, breasts, petite, short black hair, Blue eyes, room, sitting,night, scenery", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "f73757d749", + "name": "RuviMix_V1", + "type": "model" + } + ], + "Model hash": "f73757d749", + "negativePrompt": "nsfw, (worst quality, low quality:1.4),signature, bad_artist, bad_hands, bad_prompt_version2,easynegative,", + "Denoising strength": "0.2", + "Ultimate SD upscale padding": "32", + "Ultimate SD upscale upscaler": "4x-UltraSharp", + "Ultimate SD upscale mask_blur": "8", + "Ultimate SD upscale tile_width": "512", + "Ultimate SD upscale tile_height": "512" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d01760dc-1d4c-438b-a4bd-170aef7c87af/width=450/684332.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UTI#$CTFAb_N%NyETLo~0hWT%3W?.8D*D%xt", + "meta": { + "ENSD": "31337", + "Size": "1024x1536", + "seed": 770653549, + "Model": "AnythingV5_v5PrtRE", + "steps": 20, + "hashes": { + "model": "7f96a1a9ca" + }, + "prompt": "gigantic breasts,masterpiece, best_quality, absurdres, ultra-detailed, extremely_detailed, 1girl, (techwear:1.4), baseball_cap, black_headwear, black_nails, blue_choker, casual, choker, head_tilt, short_hair, bob_cut, swept_bangs, single_sidelock, long_sleeves, looking_at_viewer, (multicolored_clothes, two-tone_techwear, blue_techwear, black_techwear:1.2), nail_polish, partially_unzipped, piercing, shirt, solo, star_earrings, (sunglasses:1.4), upper_body, t-shirt, collarbone, white_shirt, clothes_writing, scenery, outdoors, city, gold_chain, sunlight, parted_lips, dynamic_angle, dutch_angle, ((higuchi_madoka)), brown hair, hairclip, , ((Higuchi_madoka))", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "7f96a1a9ca", + "name": "AnythingV5_v5PrtRE", + "type": "model" + } + ], + "Model hash": "7f96a1a9ca", + "negativePrompt": "nsfw, (worst quality, low quality:1.4),signature, bad_artist, bad_hands, bad_prompt_version2,easynegative,", + "Denoising strength": "0.2", + "Ultimate SD upscale padding": "32", + "Ultimate SD upscale upscaler": "4x-UltraSharp", + "Ultimate SD upscale mask_blur": "8", + "Ultimate SD upscale tile_width": "512", + "Ultimate SD upscale tile_height": "512" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6fdfa29d-3a9e-41ef-afab-3fcefcf99d73/width=450/684369.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "UII4Y0IZ01~ARO0gEhOWZ~s:s.Rj9GoI?GM|", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1372800313, + "Model": "perfectWorld_v2Baked", + "steps": 20, + "hashes": { + "model": "79e42fb744" + }, + "prompt": "gigantic breasts,large breasts,cowboy shot, (masterpiece), (best quality:1.2), absurdres, photo, photorealistic,highly detailed, detailed face, solo, queen , royal outfit", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "gigantic_breasts", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "79e42fb744", + "name": "perfectWorld_v2Baked", + "type": "model" + } + ], + "Model hash": "79e42fb744", + "negativePrompt": "nsfw, (worst quality, low quality:1.4),signature, bad_artist, bad_hands, bad_prompt_version2,easynegative,", + "Face restoration": "CodeFormer" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/62252" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/gigantic_breasts.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/gigantic_breasts.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..5b703cae689e718ddf50349f95eff1d811c7255a Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/gigantic_breasts.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/gigantic_breasts.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/gigantic_breasts.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..25fb8a4601901a9b2f47bb4897f893a1e07b7dd8 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/gigantic_breasts.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:3de75e2f10105360162979badb92c973caf3b6ca288b7049f204ba070756908f +size 19000929 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/gigatitums_.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/gigatitums_.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..35e0f07b64907024e91472c58b0f15021928d356 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/gigatitums_.civitai.info" @@ -0,0 +1,151 @@ +{ + "id": 10130, + "modelId": 8590, + "name": "Gigatitums", + "createdAt": "2023-02-13T20:33:07.977Z", + "updatedAt": "2023-02-13T20:33:07.977Z", + "trainedWords": [ + "", + "gigantic breasts", + "cleavage" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "model": { + "name": "gigatitums", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "gigatitums_.safetensors", + "id": 9701, + "sizeKB": 147571.2626953125, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-02-13T20:36:18.292Z", + "hashes": { + "AutoV1": "57EFAF4B", + "AutoV2": "7C5E7BB05D", + "SHA256": "7C5E7BB05D106ECCB67C77DA71321E18D553E2CA2D6904F5464C5E01E28AFE8A", + "CRC32": "E0686DEC", + "BLAKE3": "1470A4C89769DAD62A0ACA124873E0E9555544D142BA61A773C0A741AAA8EBE7" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/10130" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d85025c9-d4c8-4daa-e3eb-4c62500af400/width=450/98878.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UCC?Gw$*00Io_4%L00W=5S9Z-n%20fNGxD-p", + "meta": { + "Size": "512x768", + "seed": 409411327, + "Model": "dreamshaper_332BakedVaeClipFix", + "steps": 30, + "prompt": "nun suit, cathedral, (((underboob))), , gigantic breasts,\nslim, young face, blonde, long hair", + "sampler": "Euler a", + "cfgScale": 7, + "Mask blur": "4", + "resources": [ + { + "name": "mioceza1.5", + "type": "lora", + "weight": 1 + }, + { + "name": "gigatitums", + "type": "lora", + "weight": 0.4 + }, + { + "hash": "13dfc9921f", + "name": "dreamshaper_332BakedVaeClipFix", + "type": "model" + } + ], + "Model hash": "13dfc9921f", + "negativePrompt": "(((anime))), done by bad-artist, ugly, run-down, dirty, dingy alley, harsh and uninviting setting, dim and unflattering lighting, rusty and faded exterior of the car, damaged, poorly maintained features, broken headlights, mismatched wheels, dented front bumper, cracked windshield, bleak reflection of the surroundings, only one car, (too many (sideview mirrors)),\n\n3D render, 3D game, 3D game scene, 3D character, mosaic, painting, illustration, digital art, cartoon, anime, doll, toy, photoshop, video game, surreal, sign, 3dcg, decorating, decoration, crayon, clipart, cgi, rendered, 3d, cartoon face, drawing, cgstation, airbrushed, sketch, render, unreal engine, blender, digital painting, airbrush, pointillism, painting,\n\nimage compression, distorted, JPEG artifacts, noisy, shaky, pixelated, unclear, artifacts, low detail, low quality, low resolution, distortion, amateur, low res, low-res, cropped body, cut off, basic, boring, botched, unprofessional, draft, failure, fake, image corruption, irregular, uneven, unnatural, contorted, twisted, unappealing, blurry, haze, worst quality, normal quality, bad shadow, poor quality, amateur photography, tasteless, tacky, lacklustre, simple, plain, grainy, out of focus, fuzzy, cropped, uncentered, out of frame, body out of frame, split image, truncated, disjointed, incoherent, disorganized, jumbled, floating, objects, unreal, deformations, kitsch, unattractive, opaque, boring pose, plain background, boring, plain, standard, average, uninventive, derivative, homogenous, uncreative, ineffective, drab, amateur,\n\ntext, font, ui, error, watermark, username, signature, QR code, bar code, copyright, HUD, tiling, label, watermarks, calligraphy, kanji, hanzi, hangul, hanza, chu, nom, latin, arabic, cyrillic, symbols, alphanumeric, unicode, script,\n\nhigh contrast, low contrast, High pass filter, watermarked, monotone, smooth, blur, vignette, filter, writing, oversaturation, over saturation, over shadow, gaussian, blurred, weird colors, blurred, grain, bad art, black-white, posterization, colour banding, grayscale, monochrome, b&w, oversaturated, black and white, no color, greyscale,\n\npoorly drawn, messy drawing, bad proportions, gross proportions, imperfection, misshappen, duplicate, double, bad anatomy, anatomical nonsense, malformed, misshaped body, uncoordinated body, long body, liquid body, deformed, deformed body, lopsided, mangled, conjoined, connected, intertwined, hooked, bad body, bad framing, out of shot, gross proportions", + "Denoising strength": "0.44" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/22603576-300a-4faf-5671-dfe10c30a900/width=450/98880.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UdMQ9gV[LgxvD*t7M{azMwaxxBofWXe-IUWB", + "meta": { + "Size": "512x768", + "seed": 73617158, + "Model": "dreamshaper_332BakedVaeClipFix", + "steps": 40, + "prompt": "bikini, beach, pushed breasts, squeezed breasts, , gigantic breasts, low saturation,\nslim, young face", + "sampler": "Euler a", + "cfgScale": 7, + "Mask blur": "4", + "resources": [ + { + "name": "gigatitums", + "type": "lora", + "weight": 0.9 + }, + { + "hash": "13dfc9921f", + "name": "dreamshaper_332BakedVaeClipFix", + "type": "model" + } + ], + "Model hash": "13dfc9921f", + "negativePrompt": "(((anime))), done by bad-artist, ugly, run-down, dirty, dingy alley, harsh and uninviting setting, dim and unflattering lighting, rusty and faded exterior of the car, damaged, poorly maintained features, broken headlights, mismatched wheels, dented front bumper, cracked windshield, bleak reflection of the surroundings, only one car, (too many (sideview mirrors)),\n\n3D render, 3D game, 3D game scene, 3D character, mosaic, painting, illustration, digital art, cartoon, anime, doll, toy, photoshop, video game, surreal, sign, 3dcg, decorating, decoration, crayon, clipart, cgi, rendered, 3d, cartoon face, drawing, cgstation, airbrushed, sketch, render, unreal engine, blender, digital painting, airbrush, pointillism, painting,\n\nimage compression, distorted, JPEG artifacts, noisy, shaky, pixelated, unclear, artifacts, low detail, low quality, low resolution, distortion, amateur, low res, low-res, cropped body, cut off, basic, boring, botched, unprofessional, draft, failure, fake, image corruption, irregular, uneven, unnatural, contorted, twisted, unappealing, blurry, haze, worst quality, normal quality, bad shadow, poor quality, amateur photography, tasteless, tacky, lacklustre, simple, plain, grainy, out of focus, fuzzy, cropped, uncentered, out of frame, body out of frame, split image, truncated, disjointed, incoherent, disorganized, jumbled, floating, objects, unreal, deformations, kitsch, unattractive, opaque, boring pose, plain background, boring, plain, standard, average, uninventive, derivative, homogenous, uncreative, ineffective, drab, amateur,\n\ntext, font, ui, error, watermark, username, signature, QR code, bar code, copyright, HUD, tiling, label, watermarks, calligraphy, kanji, hanzi, hangul, hanza, chu, nom, latin, arabic, cyrillic, symbols, alphanumeric, unicode, script,\n\nhigh contrast, low contrast, High pass filter, watermarked, monotone, smooth, blur, vignette, filter, writing, oversaturation, over saturation, over shadow, gaussian, blurred, weird colors, blurred, grain, bad art, black-white, posterization, colour banding, grayscale, monochrome, b&w, oversaturated, black and white, no color, greyscale,\n\npoorly drawn, messy drawing, bad proportions, gross proportions, imperfection, misshappen, duplicate, double, bad anatomy, anatomical nonsense, malformed, misshaped body, uncoordinated body, long body, liquid body, deformed, deformed body, lopsided, mangled, conjoined, connected, intertwined, hooked, bad body, bad framing, out of shot, gross proportions", + "Denoising strength": "0.44" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b845086a-a1d2-4e50-5d73-e9ec6f1edd00/width=450/98879.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UDHn50-nI.~W%MS#oeEM9FoM?HkBM{xajGWV", + "meta": { + "Size": "512x768", + "seed": 3493450073, + "Model": "liberty_main", + "steps": 40, + "prompt": "girl in office suit, sexy blazer, cleavage, office, pushed breasts, squeezed breasts, , gigantic breasts, low saturation,\nslim, young face, corset", + "sampler": "Euler a", + "cfgScale": 7, + "Mask blur": "9", + "resources": [ + { + "name": "gigatitums", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "8634d80dec", + "name": "liberty_main", + "type": "model" + } + ], + "Model hash": "8634d80dec", + "negativePrompt": "done by bad-artist, ugly, run-down, dirty, dingy alley, harsh and uninviting setting, dim and unflattering lighting, rusty and faded exterior of the car, damaged, poorly maintained features, broken headlights, mismatched wheels, dented front bumper, cracked windshield, bleak reflection of the surroundings, only one car, (too many (sideview mirrors)),\n\n3D render, 3D game, 3D game scene, 3D character, mosaic, painting, illustration, digital art, cartoon, anime, doll, toy, photoshop, video game, surreal, sign, 3dcg, decorating, decoration, crayon, clipart, cgi, rendered, 3d, cartoon face, drawing, cgstation, airbrushed, sketch, render, unreal engine, blender, digital painting, airbrush, pointillism, painting,\n\nimage compression, distorted, JPEG artifacts, noisy, shaky, pixelated, unclear, artifacts, low detail, low quality, low resolution, distortion, amateur, low res, low-res, cropped body, cut off, basic, boring, botched, unprofessional, draft, failure, fake, image corruption, irregular, uneven, unnatural, contorted, twisted, unappealing, blurry, haze, worst quality, normal quality, bad shadow, poor quality, amateur photography, tasteless, tacky, lacklustre, simple, plain, grainy, out of focus, fuzzy, cropped, uncentered, out of frame, body out of frame, split image, truncated, disjointed, incoherent, disorganized, jumbled, floating, objects, unreal, deformations, kitsch, unattractive, opaque, boring pose, plain background, boring, plain, standard, average, uninventive, derivative, homogenous, uncreative, ineffective, drab, amateur,\n\ntext, font, ui, error, watermark, username, signature, QR code, bar code, copyright, HUD, tiling, label, watermarks, calligraphy, kanji, hanzi, hangul, hanza, chu, nom, latin, arabic, cyrillic, symbols, alphanumeric, unicode, script,\n\nhigh contrast, low contrast, High pass filter, watermarked, monotone, smooth, blur, vignette, filter, writing, oversaturation, over saturation, over shadow, gaussian, blurred, weird colors, blurred, grain, bad art, black-white, posterization, colour banding, grayscale, monochrome, b&w, oversaturated, black and white, no color, greyscale,\n\npoorly drawn, messy drawing, bad proportions, gross proportions, imperfection, misshappen, duplicate, double, bad anatomy, anatomical nonsense, malformed, misshaped body, uncoordinated body, long body, liquid body, deformed, deformed body, lopsided, mangled, conjoined, connected, intertwined, hooked, bad body, bad framing, out of shot, gross proportions", + "Denoising strength": "0.44" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/10130" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/gigatitums_.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/gigatitums_.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..d5ddfe954b6890b4a4e807f121f03ee0a111f869 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/gigatitums_.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/gigatitums_.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/gigatitums_.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..f6dd7483d88f3a198404114e5d3e3bd9e9fc20d2 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/gigatitums_.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:7c5e7bb05d106eccb67c77da71321e18d553e2ca2d6904f5464c5e01e28afe8a +size 151112973 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hugeNipples_v10.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hugeNipples_v10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..eeaf5a9343f5f6ee2a1a866e706572d110465281 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hugeNipples_v10.civitai.info" @@ -0,0 +1,334 @@ +{ + "id": 13873, + "modelId": 11744, + "name": "v.1.0", + "createdAt": "2023-02-22T14:41:33.102Z", + "updatedAt": "2023-02-22T14:57:19.593Z", + "trainedWords": [ + "huge nipples", + "nipples" + ], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": "

Training Data

  • 272 image [1-4 repeat]

  • 6 Epochs

  • unet : 1.5e-4

  • text-encoder : 2.5e-5

  • DIM 32 / 16 Alpha

", + "stats": { + "downloadCount": 5228, + "ratingCount": 4, + "rating": 5 + }, + "model": { + "name": "Huge nipples", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "hugeNipples_v10.safetensors", + "id": 12190, + "sizeKB": 36973.9296875, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-02-22T14:46:18.212Z", + "hashes": { + "AutoV1": "B94E79C8", + "AutoV2": "BE1A69328D", + "SHA256": "BE1A69328DF3A00CEE5BC3F940CA901003896F83D7DA5549CCF1245FD83ADF28", + "CRC32": "F17ACBA6", + "BLAKE3": "BC697BBA71735C01A24985FB9B2A343F0C4E6502FD3C696090F751B541E597F2" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/13873" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9959c965-c9aa-4335-fadd-957cb93bb100/width=450/134554.jpeg", + "nsfw": true, + "width": 720, + "height": 960, + "hash": "U8K,gfMfD4~E02%d0KNe004o6,-:0x%NIVro", + "meta": { + "Size": "448x640", + "seed": 3598887873, + "Model": "kotosAbyssproto_v10", + "steps": 25, + "prompt": "1girl, solo, upper body, short sleeves, [covered nipples], [huge nipples], (shirt:1.2),", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "hash": "35d51ba12c", + "name": "kotosAbyssproto_v10", + "type": "model" + }, + { + "hash": "85475f098ada", + "name": "Bhuge_nipple", + "type": "lora", + "weight": null + } + ], + "Model hash": "35d51ba12c", + "Hires resize": "720x960", + "AddNet Enabled": "True", + "AddNet Model 1": "Bhuge_nipple(85475f098ada)", + "Hires upscaler": "lollypop", + "negativePrompt": "(worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, multiple view, Reference sheet,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.4" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/18fcb1e3-f65a-426b-47ac-06a14357c200/width=450/134551.jpeg", + "nsfw": true, + "width": 720, + "height": 960, + "hash": "UJH-ob8{0J=}56IrxZsp00S6-:Rk~Cs;RkV@", + "meta": { + "Size": "448x640", + "seed": 1747530619, + "Model": "kotosAbyssproto_v10", + "steps": 25, + "prompt": "1girl, solo, huge nipples, small breasts, upper body, short sleeves, nipples,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "hash": "35d51ba12c", + "name": "kotosAbyssproto_v10", + "type": "model" + }, + { + "hash": "85475f098ada", + "name": "Bhuge_nipple", + "type": "lora", + "weight": null + } + ], + "Model hash": "35d51ba12c", + "Hires resize": "720x960", + "AddNet Enabled": "True", + "AddNet Model 1": "Bhuge_nipple(85475f098ada)", + "Hires upscaler": "lollypop", + "negativePrompt": "(worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, multiple view, Reference sheet,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.4" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b1fce865-ab1f-4fa6-3881-bd3d2334f300/width=450/134553.jpeg", + "nsfw": true, + "width": 720, + "height": 960, + "hash": "USJHdrM_~T%2--g4T1RPR3tRo#M{.9V?ROkC", + "meta": { + "Size": "448x640", + "seed": 3598887871, + "Model": "kotosAbyssproto_v10", + "steps": 25, + "prompt": "1girl, solo, upper body, short sleeves, [covered nipples], [huge nipples], (shirt:1.2),", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "hash": "35d51ba12c", + "name": "kotosAbyssproto_v10", + "type": "model" + }, + { + "hash": "85475f098ada", + "name": "Bhuge_nipple", + "type": "lora", + "weight": null + } + ], + "Model hash": "35d51ba12c", + "Hires resize": "720x960", + "AddNet Enabled": "True", + "AddNet Model 1": "Bhuge_nipple(85475f098ada)", + "Hires upscaler": "lollypop", + "negativePrompt": "(worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, multiple view, Reference sheet,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.4" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/92bf0c2b-ca1d-4089-05dd-5e51d0346200/width=450/134548.jpeg", + "nsfw": true, + "width": 720, + "height": 960, + "hash": "UZJaZe~qJo%2ENo#-;WC%1e.ofRj%foLWBRj", + "meta": { + "Size": "448x640", + "seed": 187784497, + "Model": "kotosAbyssproto_v10", + "steps": 25, + "prompt": "1girl, solo, huge nipples, small breasts, upper body, short sleeves, short shorts, nipples,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "hash": "35d51ba12c", + "name": "kotosAbyssproto_v10", + "type": "model" + }, + { + "hash": "85475f098ada", + "name": "Bhuge_nipple", + "type": "lora", + "weight": null + } + ], + "Model hash": "35d51ba12c", + "Hires resize": "720x960", + "AddNet Enabled": "True", + "AddNet Model 1": "Bhuge_nipple(85475f098ada)", + "Hires upscaler": "lollypop", + "negativePrompt": "(worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, multiple view, Reference sheet,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.4" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/47c7af1b-1412-4474-7e27-a2d959f40500/width=450/134552.jpeg", + "nsfw": true, + "width": 720, + "height": 960, + "hash": "UCI}3FRj00~V?F%L^+MyQ,9G%#?I9txa-UE1", + "meta": { + "Size": "448x640", + "seed": 3598887874, + "Model": "kotosAbyssproto_v10", + "steps": 25, + "prompt": "1girl, solo, upper body, short sleeves, [covered nipples], [huge nipples], (shirt:1.2),", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "hash": "35d51ba12c", + "name": "kotosAbyssproto_v10", + "type": "model" + }, + { + "hash": "85475f098ada", + "name": "Bhuge_nipple", + "type": "lora", + "weight": null + } + ], + "Model hash": "35d51ba12c", + "Hires resize": "720x960", + "AddNet Enabled": "True", + "AddNet Model 1": "Bhuge_nipple(85475f098ada)", + "Hires upscaler": "lollypop", + "negativePrompt": "(worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, multiple view, Reference sheet,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.4" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1dbe1b85-01a5-4b90-3df2-a24d87ba8d00/width=450/134550.jpeg", + "nsfw": true, + "width": 720, + "height": 960, + "hash": "UXH-xy_MPAXSKP%g-pt7M}xvxvkC%Ms;n,WX", + "meta": { + "Size": "448x640", + "seed": 1747530620, + "Model": "kotosAbyssproto_v10", + "steps": 25, + "prompt": "1girl, solo, huge nipples, small breasts, upper body, short sleeves, nipples,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "hash": "35d51ba12c", + "name": "kotosAbyssproto_v10", + "type": "model" + }, + { + "hash": "85475f098ada", + "name": "Bhuge_nipple", + "type": "lora", + "weight": null + } + ], + "Model hash": "35d51ba12c", + "Hires resize": "720x960", + "AddNet Enabled": "True", + "AddNet Model 1": "Bhuge_nipple(85475f098ada)", + "Hires upscaler": "lollypop", + "negativePrompt": "(worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, multiple view, Reference sheet,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.4" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e02cd663-6354-483a-abbb-a8f6de9ee300/width=450/134549.jpeg", + "nsfw": true, + "width": 720, + "height": 960, + "hash": "UEK]+PR54o^k4:nOM}~Cict74:9tRiS5^k-U", + "meta": { + "Size": "448x640", + "seed": 1747530621, + "Model": "kotosAbyssproto_v10", + "steps": 25, + "prompt": "1girl, solo, huge nipples, small breasts, upper body, short sleeves, nipples,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "hash": "35d51ba12c", + "name": "kotosAbyssproto_v10", + "type": "model" + }, + { + "hash": "85475f098ada", + "name": "Bhuge_nipple", + "type": "lora", + "weight": null + } + ], + "Model hash": "35d51ba12c", + "Hires resize": "720x960", + "AddNet Enabled": "True", + "AddNet Model 1": "Bhuge_nipple(85475f098ada)", + "Hires upscaler": "lollypop", + "negativePrompt": "(worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, multiple view, Reference sheet,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.4" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/13873" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hugeNipples_v10.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hugeNipples_v10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..98037071512bf231fe4d72dc2c6d5f01b87d0057 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hugeNipples_v10.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:2576847135d9118b4ca8f327900fe5ff742f161a5c725fd4a4a4929cb4c1fcf6 +size 1081212 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hugeNipples_v10.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hugeNipples_v10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..73680816c2fbbeeb47add298740d4917ad0dace7 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hugeNipples_v10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:be1a69328df3a00cee5bc3f940ca901003896f83d7da5549ccf1245fd83adf28 +size 37861304 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/huge_breasts_for_short_statureV4.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/huge_breasts_for_short_statureV4.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..2186195a3e1687c27a3409ae51554c3bdafbea5b --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/huge_breasts_for_short_statureV4.civitai.info" @@ -0,0 +1,111 @@ +{ + "id": 113085, + "modelId": 62379, + "name": "v4.0", + "createdAt": "2023-07-08T17:00:00.006Z", + "updatedAt": "2023-07-08T17:13:45.272Z", + "trainedWords": [ + "huge breasts" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

This is lora version.

I recommend to set strength to 0.6 - 0.8.

", + "stats": { + "downloadCount": 648, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Huge Breasts For Short Stature", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "huge_breasts_for_short_statureV4.safetensors", + "id": 80266, + "sizeKB": 147567.21875, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-07-08T17:15:08.598Z", + "hashes": { + "AutoV1": "B2F62BC3", + "AutoV2": "252ABC0492", + "SHA256": "252ABC0492304EBB9ADF71260EF0121926E7E81219DAB7C356EDC9DE33215054", + "CRC32": "2C053FE4", + "BLAKE3": "4482FDEAA1D452A54A83366B581CF77CDF96C94AA319F945118BE8FD1BCB8EEF" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/113085" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/12063d1d-0877-4635-918b-a29f6fbdedbb/width=450/1465636.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1280, + "hash": "UEF=m+4.00~W00-;?bIn0LjZxCIV~WM{ogWX", + "meta": { + "Size": "512x640", + "seed": 2592388493, + "steps": 22, + "prompt": "(photorealistic:1.4, realistic), an extremely delicate and beautiful, extremely detailed, huge filesize, ultra-detailed, highres, absurdres, soft light,\nprofessional portrait of a girl with huge breasts wearing cute fashionable clothes, ((petite))\n", + "Version": "v1.4.0", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "name": "huge_breasts_for_short_statureV4", + "type": "lora", + "weight": 0.6 + } + ], + "Model hash": "e4a30e4607", + "Hires upscale": "2", + "Hires upscaler": "ESRGAN_4x", + "negativePrompt": "EasyNegative, (worst quality, low quality, normal quality:2), (nude, nsfw:1.3)", + "Denoising strength": "0.4", + "\"huge_breasts_for_short_statureV4": "f8616461a577\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b4eba21a-69f6-4920-ad1a-78033a5daa39/width=450/1465516.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1280, + "hash": "UeIO2}~WD%%2t2%MtmtRITWVxuRjS4M{M{og", + "meta": { + "Size": "512x640", + "seed": 1076251861, + "steps": 22, + "prompt": "an extremely delicate and beautiful, extremely detailed, huge filesize, ultra-detailed, highres, absurdres, soft light,\nprofessional portrait of a girl with huge breasts wearing cute fashionable clothes, ((petite))\n", + "Version": "v1.4.0", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "name": "huge_breasts_for_short_statureV4", + "type": "lora", + "weight": 0.8 + } + ], + "Model hash": "8712e20a5d", + "Hires upscale": "2", + "Hires upscaler": "ESRGAN_4x", + "negativePrompt": "EasyNegative, (worst quality, low quality, normal quality:2), ((((nude, nsfw))))", + "Denoising strength": "0.4", + "\"huge_breasts_for_short_statureV4": "f8616461a577\"" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/113085" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/huge_breasts_for_short_statureV4.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/huge_breasts_for_short_statureV4.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..a5e42b938fa54a57faf710b5581597891ee7eaca Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/huge_breasts_for_short_statureV4.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/huge_breasts_for_short_statureV4.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/huge_breasts_for_short_statureV4.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..dfb467ac00db3d4e77b302538d2ea129e1069606 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/huge_breasts_for_short_statureV4.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:252abc0492304ebb9adf71260ef0121926e7e81219dab7c356edc9de33215054 +size 151108832 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hugefaketitsv2-000008.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hugefaketitsv2-000008.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..cb1e9d94a559c99668a048320f267425e58b1d7b --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hugefaketitsv2-000008.civitai.info" @@ -0,0 +1,307 @@ +{ + "id": 103897, + "modelId": 97221, + "name": "v1.0", + "createdAt": "2023-06-25T16:24:24.116Z", + "updatedAt": "2023-06-25T22:27:09.096Z", + "trainedWords": [ + "hugefaketits" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 338, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Huge Fake Tits", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "hugefaketitsv2-000008.safetensors", + "id": 72925, + "sizeKB": 147573.673828125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-25T16:26:22.440Z", + "hashes": { + "AutoV1": "BA457D95", + "AutoV2": "211C28D8D1", + "SHA256": "211C28D8D10AC90B06A1E01457E106685452F2AA9972645ACA3CA00D6A60541F", + "CRC32": "914B8EAF", + "BLAKE3": "4C0361172049BB20B8501D6235196AD563B410AD37ABB47D02BC52DA5E295C61" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/103897" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7aa9e367-8181-43f4-9270-32608273950e/width=450/1286164.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1536, + "hash": "UFIX?XV[7~.8BHK5n9NHs=Rn^ixGTzxDtQNG", + "meta": { + "Size": "512x768", + "seed": 41703085, + "steps": 40, + "prompt": "(hugefaketits:1.3), , blank background,\n(realistic:1.3), ultra high res, 4k, beautiful, (masterpiece:1.2), (best quality:1.2), (detailed face),\n1girl, 18 year old asian woman, (pale skin:1.2), (black bikini, miniature microbikini:1.2), ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "name": "miniature_microbikini_v1e12", + "type": "lora", + "weight": 0.8 + } + ], + "Model hash": "fc2511737a", + "Hires steps": "28", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, (badhandv4), verybadimagenegative_v1.3, By bad artist -neg, (worst quality:1.4), (low quality:1.4), (jpeg artifacts, signature,logo, watermark, text:1.3), (piercing,belly button piercing, navel piercing:1.4), (naked, nipples:1.4)", + "Denoising strength": "0.39" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/23a72195-9200-4a04-bd7b-d93dcb166ea1/width=450/1286168.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1536, + "hash": "U9HUk6~W*ItjBUyDIU$~5S?bIBD%?GwgE256", + "meta": { + "Size": "512x768", + "seed": 567302445, + "steps": 40, + "prompt": "(hugefaketits:1), ,\n(realistic:1.3), ultra high res, 4k, beautiful, (masterpiece:1.2), (best quality:1.2), (detailed face),\n1girl, long hair, black hair, standing, legs, latex highleg_leotard", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [], + "Model hash": "fc2511737a", + "Hires steps": "30", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, (badhandv4), verybadimagenegative_v1.3, By bad artist -neg, (worst quality:1.4), (low quality:1.4), (jpeg artifacts, signature,logo, watermark, text:1.3), (naked, nipples:1.3)", + "Denoising strength": "0.46" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/51c2eaeb-8312-4b07-a449-e057b55d5a7d/width=450/1286167.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1536, + "hash": "UNHd+|~V_3?G%L?aE2t7S~Rj-ARj%MM|oLR*", + "meta": { + "Size": "512x768", + "seed": 567302446, + "steps": 40, + "prompt": "(hugefaketits:1), ,\n(realistic:1.3), ultra high res, 4k, beautiful, (masterpiece:1.2), (best quality:1.2), (detailed face),\n1girl, wearing deep_v-neck_dress, black dress, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [], + "Model hash": "fc2511737a", + "Hires steps": "30", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, (badhandv4), verybadimagenegative_v1.3, By bad artist -neg, (worst quality:1.4), (low quality:1.4), (jpeg artifacts, signature,logo, watermark, text:1.3), (naked, nipples:1.3)", + "Denoising strength": "0.46" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d43ee4a2-98ea-4f55-8f4a-382483f25b22/width=450/1286165.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1536, + "hash": "U5HwcF~o0001bJ%zsA9G00~V~p4:-q9axBV@", + "meta": { + "Size": "512x768", + "seed": 688671606, + "steps": 40, + "prompt": "(hugefaketits:1.3), ,\n(realistic:1.3), ultra high res, 4k, beautiful, (masterpiece:1.2), (best quality:1.2), (detailed face), 1girl, naked, nipples, blonde hair, long hair, upperbody", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [], + "Model hash": "fc2511737a", + "Hires steps": "28", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, (badhandv4), verybadimagenegative_v1.3, By bad artist -neg, (worst quality:1.4), (low quality:1.4), (jpeg artifacts, signature,logo, watermark, text:1.3)", + "Denoising strength": "0.39" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/32b1dfc1-a5f2-4648-a4e6-dff0508b1afb/width=450/1286170.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1536, + "hash": "UBH-iK~V00bFJ*-:xENG00WU?bxtITIo-;xa", + "meta": { + "Size": "512x768", + "seed": 1180672375, + "steps": 40, + "prompt": "(hugefaketits:1.3), , blank background,\n(realistic:1.3), ultra high res, 4k, beautiful, (masterpiece:1.2), (best quality:1.2), (detailed face),\n1girl, 18 year old asian woman, (pale skin:1.2), naked, nipples, , legs", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "name": "koreanDollLikeness", + "type": "lora", + "weight": 0.6 + } + ], + "Model hash": "fc2511737a", + "Hires steps": "28", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, (badhandv4), verybadimagenegative_v1.3, By bad artist -neg, (worst quality:1.4), (low quality:1.4), (jpeg artifacts, signature,logo, watermark, text:1.3)", + "Denoising strength": "0.39" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6027e4fb-45bb-48e3-b992-509e2874a572/width=450/1286173.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1536, + "hash": "UEHw.B~UL1~W?uRP-UxuVs9FVYV@5mNH^PV@", + "meta": { + "Size": "512x768", + "seed": 1793915917, + "steps": 40, + "prompt": "(hugefaketits:1.2), ,\n(realistic:1.3), ultra high res, 4k, beautiful, (masterpiece:1.2), (best quality:1.2), (detailed face),\n1girl, wearing gym_outfit, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [], + "Model hash": "fc2511737a", + "Hires steps": "30", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, (badhandv4), verybadimagenegative_v1.3, By bad artist -neg, (worst quality:1.4), (low quality:1.4), (jpeg artifacts, signature,logo, watermark, text:1.3), (naked, nipples:1.3), sideboob, from the side", + "Denoising strength": "0.46" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ecbafecf-1aa5-4acd-94e4-4efae3f57175/width=450/1286172.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1536, + "hash": "U7I3q0x@004:Tv-oWXn+00}@^*oy}uJ.0LD*", + "meta": { + "Size": "512x768", + "seed": 3154612373, + "steps": 40, + "prompt": "(hugefaketits:1), ,\n(realistic:1.3), ultra high res, 4k, beautiful, (masterpiece:1.2), (best quality:1.2), (detailed face),\n1girl, wearing sexy_attire, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "name": "sexy_attire", + "type": "lora", + "weight": 0.8 + } + ], + "Model hash": "fc2511737a", + "Hires steps": "30", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, (badhandv4), verybadimagenegative_v1.3, By bad artist -neg, (worst quality:1.4), (low quality:1.4), (jpeg artifacts, signature,logo, watermark, text:1.3), (naked, nipples:1.3), sideboob, from the side", + "Denoising strength": "0.46" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ddfc189c-c6f8-4025-999b-801372c3cb48/width=450/1286233.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1536, + "hash": "ULIg$H~V0eIVE2E2NGNG0KWB?Hxu%MIoIUxa", + "meta": { + "Size": "512x768", + "seed": 2647665313, + "steps": 40, + "prompt": "(hugefaketits:1.3) , blank background,\n(realistic:1.3), ultra high res, 4k, beautiful, (masterpiece:1.2), (best quality:1.2), (detailed face),\n1girl, 18 year old asian woman, (pale skin:1.2), naked, nipples, , legs, from the front, vagina", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "name": "koreanDollLikeness", + "type": "lora", + "weight": 0.6 + } + ], + "Model hash": "fc2511737a", + "Hires steps": "28", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, (badhandv4), verybadimagenegative_v1.3, By bad artist -neg, (worst quality:1.4), (low quality:1.4), (jpeg artifacts, signature,logo, watermark, text:1.3), sideboob, from the side", + "Denoising strength": "0.39" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d3ecfc30-710c-4067-b5fb-3654b9ef228a/width=450/1286272.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1536, + "hash": "U8INQ@~C000K0zIpV@R*00IU?a4:0Mni%2?H", + "meta": { + "Size": "512x768", + "seed": 2098258127, + "steps": 40, + "prompt": "(hugefaketits:1.3) , blank background,\n(realistic:1.3), ultra high res, 4k, beautiful, (masterpiece:1.2), (best quality:1.2), (detailed face),\n1girl, 18 year old woman, blonde hair, brown eyes, (pale skin:1.2), naked, nipples, legs, from the front, vagina, (muscular, abs:1.1)", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [], + "Model hash": "fc2511737a", + "Hires steps": "28", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, (badhandv4), verybadimagenegative_v1.3, By bad artist -neg, (worst quality:1.4), (low quality:1.4), (jpeg artifacts, signature,logo, watermark, text:1.3), sideboob, from the side", + "Denoising strength": "0.39" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c804d7d5-0daa-4e08-8f11-3cfaefea6206/width=450/1286320.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1536, + "hash": "UAHdmW}[0K9aABE2j?NG00Io^*oz-;RkMys.", + "meta": { + "Size": "512x768", + "seed": 458887447, + "steps": 40, + "prompt": "(hugefaketits:1.15) , blank background,\n(realistic:1.3), ultra high res, 4k, beautiful, (masterpiece:1.2), (best quality:1.2), (detailed face),\n1girl, 18 year old woman, brown hair, brown eyes, (pale skin:1.2), naked, nipples, legs, from the front, vagina, (muscular, abs:1.1)", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [], + "Model hash": "fc2511737a", + "Hires steps": "28", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "EasyNegative, (badhandv4), verybadimagenegative_v1.3, By bad artist -neg, (worst quality:1.4), (low quality:1.4), (jpeg artifacts, signature,logo, watermark, text:1.3), sideboob, from the side", + "Denoising strength": "0.39" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/103897" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hugefaketitsv2-000008.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hugefaketitsv2-000008.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..c27654f93d9dc9acac54f14232fcb5f540916308 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hugefaketitsv2-000008.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hugefaketitsv2-000008.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hugefaketitsv2-000008.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..5c767241d0ce68bd20522ea14609cba7ecce5e32 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hugefaketitsv2-000008.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:211c28d8d10ac90b06a1e01457e106685452f2aa9972645aca3ca00d6a60541f +size 151115442 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hyper_penetration_stomach_bulge_v8absurd-000006.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hyper_penetration_stomach_bulge_v8absurd-000006.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..18da9517953bdba0942f2708d315edbc6038f82a --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hyper_penetration_stomach_bulge_v8absurd-000006.civitai.info" @@ -0,0 +1,396 @@ +{ + "id": 79215, + "modelId": 9651, + "name": "v8absurd", + "createdAt": "2023-05-23T20:55:40.713Z", + "updatedAt": "2023-05-23T21:10:29.346Z", + "trainedWords": [ + "absurd stomach bulge", + "hyper penetration", + "minigirl sex", + "impossible object insertion" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

Selection of some of the most absurd insertions/penetrations. This one especially benefits from mixing version \"All\" with it, something like absurd:0.8 all:0.6 will give very consistent outputs. I tried merging them into one lora but every method I tried to do so gave vastly inferior results than putting both loras in prompt.

", + "stats": { + "downloadCount": 140, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "hyper penetration stomach bulge", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "hyper_penetration_stomach_bulge_v8absurd-000006.safetensors", + "id": 54404, + "sizeKB": 37008.0693359375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-23T21:01:17.757Z", + "hashes": { + "AutoV1": "844FCFA3", + "AutoV2": "2C99DB2829", + "SHA256": "2C99DB28292DA5C888D110FD93AE784FEF3EF52B90B4813F486E7B85A564D045", + "CRC32": "ED24A592", + "BLAKE3": "B920F0817A18210C992FA03274B4794194BFAA5D9AD4B9E1D2A3EE7E9894CB06" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/79215" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f60ad71a-d107-40fa-b505-61c3495bee9c/width=450/888415.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1280, + "hash": "UPG*sa~pXm%3yEtRoM%L-;%1V@Ioo~axMxM{", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 526781890, + "Model": "hassakuHentaiModel_v11", + "steps": 32, + "hashes": { + "model": "973cb455d0" + }, + "prompt": "(massive gigantic dildo way thicker than entire body:1.2), vaginal, (impossible object insertion:1.4), (absurd stomach bulge:1.2), side view, gaping pussy, pussy juice, indoors, living room, window, long hair, blunt bangs, spread legs, bulge-play, tongue out, licking stomach bulge extending up to face, saliva, nude, nsfw, indoors, \n", + "sampler": "DPM++ 2M Karras Test", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "hash": "973cb455d0", + "name": "hassakuHentaiModel_v11", + "type": "model" + } + ], + "Model hash": "973cb455d0", + "Hires steps": "12", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(worst quality, low quality:1.4), (monochrome:1.0), pubic hair, (multiple views:1.1), censored, (bar censor:1.2), mosaic censoring, (prolapse:1.2), fat", + "Denoising strength": "0.6" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/40d15aa7-94ef-425c-a11a-8dbd464aef13/width=450/888416.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1280, + "hash": "UMI;-k$K0|yECAnNR5I[T3E1?HsWR.kCbFt7", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 2298526979, + "Model": "hassakuHentaiModel_v11", + "steps": 32, + "hashes": { + "model": "973cb455d0" + }, + "prompt": "nude, large breasts, vaginal object insertion, (impossible object insertion:1.2), (absurd stomach bulge:1.1), gaping pussy, outdoors, city, shape of penetration visible on stomach bulge\n", + "sampler": "DPM++ 2M Karras Test", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "hash": "973cb455d0", + "name": "hassakuHentaiModel_v11", + "type": "model" + } + ], + "Model hash": "973cb455d0", + "Hires steps": "12", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(worst quality, low quality:1.4), (monochrome:1.1), pubic hair, (multiple views:1.1), (futanari:1.2), censored, (bar censor:1.2), mosaic censoring, fat, pregnant, prolapse, loli, flat chest", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e4f9e26a-4750-450e-bc30-f6fe29e15c36/width=450/888418.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1280, + "hash": "U7JQ+t00009u2MbIzAMe00-==q$%~B=_gN^$", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 989746120, + "Model": "hassakuHentaiModel_v11", + "steps": 32, + "hashes": { + "model": "973cb455d0" + }, + "prompt": "pov, vaginal, pussy juice, (minigirl:1.2), minigirl sex, fairy, gigantic penis, (absurd stomach bulge:1.2), (penis-shaped distention:1.2), hyper penetration, impossible fit, blunt bangs, large breasts, long hair, nude, pov hands, koonago, footjob, feet on penis shaft, hanging on penis, heart\n", + "sampler": "DPM++ 2M Karras Test", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "hash": "973cb455d0", + "name": "hassakuHentaiModel_v11", + "type": "model" + } + ], + "Model hash": "973cb455d0", + "Hires steps": "12", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(worst quality, low quality:1.4), (monochrome:1.0), pubic hair, (multiple views:1.1), censored, (bar censor:1.2), mosaic censoring, (prolapse:1.2), fat, pregnant, loli, flat chest, futanari", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e225c881-7a28-4a9d-9c35-1495203524b4/width=450/888419.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1280, + "hash": "UQH24kT0PB%3:$jE8^xa?^r?xvt7RPxunPt8", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 2419947210, + "Model": "hassakuHentaiModel_v11", + "steps": 32, + "hashes": { + "model": "973cb455d0" + }, + "prompt": "pov, vaginal, pussy juice, (minigirl:1.2), minigirl sex, fairy, gigantic penis, (absurd stomach bulge:1.2), (penis-shaped distention:1.2), hyper penetration, impossible fit, blunt bangs, large breasts, long hair, nude, pov hands, koonago, footjob, feet on penis shaft, hanging on penis, heart\n", + "sampler": "DPM++ 2M Karras Test", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "hash": "973cb455d0", + "name": "hassakuHentaiModel_v11", + "type": "model" + } + ], + "Model hash": "973cb455d0", + "Hires steps": "12", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(worst quality, low quality:1.4), (monochrome:1.0), pubic hair, (multiple views:1.1), censored, (bar censor:1.2), mosaic censoring, (prolapse:1.2), fat, pregnant, loli, flat chest, futanari", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3569734b-18b4-4c9a-a5b4-80c509551ccf/width=450/888421.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1280, + "hash": "UWHxpfM{K+kW.TR+xukWpJRjs:xakYR*xuo1", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 3295133174, + "Model": "hassakuHentaiModel_v11", + "steps": 32, + "hashes": { + "model": "973cb455d0" + }, + "prompt": "nude, large breasts, vaginal object insertion, (impossible object insertion:1.2), (absurd stomach bulge:1.1), gaping pussy, outdoors, city, shape of penetration visible on stomach bulge\n", + "sampler": "DPM++ 2M Karras Test", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "hash": "973cb455d0", + "name": "hassakuHentaiModel_v11", + "type": "model" + } + ], + "Model hash": "973cb455d0", + "Hires steps": "12", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(worst quality, low quality:1.4), (monochrome:1.1), pubic hair, (multiple views:1.1), (futanari:1.2), censored, (bar censor:1.2), mosaic censoring, fat, pregnant, prolapse, loli, flat chest", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1402277c-d2b9-4f74-8c10-d80e9e598395/width=450/888424.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1280, + "hash": "UYJaZj^+0LE1?wx]xui_o~bIx]t7tSxat7R*", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 3340621775, + "Model": "hassakuHentaiModel_v11", + "steps": 32, + "hashes": { + "model": "973cb455d0" + }, + "prompt": "nude, large breasts, nsfw, vaginal, (impossible object insertion:1.2), (absurd stomach bulge:1.1), gaping pussy, outdoors, city, shape of penetration visible on stomach bulge\n", + "sampler": "DPM++ 2M Karras Test", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "hash": "973cb455d0", + "name": "hassakuHentaiModel_v11", + "type": "model" + } + ], + "Model hash": "973cb455d0", + "Hires steps": "12", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(worst quality, low quality:1.4), (monochrome:1.1), pubic hair, (multiple views:1.1), (futanari:1.2), censored, (bar censor:1.2), mosaic censoring, fat, pregnant, prolapse, loli, flat chest", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4f1c0d08-6aea-43a7-93c4-e168b86ce1f6/width=450/888426.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1280, + "hash": "UbHxNmkC5R%M*0t7$*SipJWWxtkCXns:sooz", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 3340621775, + "Model": "hassakuHentaiModel_v11", + "steps": 32, + "hashes": { + "model": "973cb455d0" + }, + "prompt": "nude, large breasts, nsfw, vaginal, (impossible object insertion:1.2), (absurd stomach bulge:1.1), gaping pussy, outdoors, city, shape of penetration visible on stomach bulge\n", + "sampler": "DPM++ 2M Karras Test", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "hash": "973cb455d0", + "name": "hassakuHentaiModel_v11", + "type": "model" + } + ], + "Model hash": "973cb455d0", + "Hires steps": "12", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(worst quality, low quality:1.4), (monochrome:1.1), pubic hair, (multiple views:1.1), (futanari:1.2), censored, (bar censor:1.2), mosaic censoring, fat, pregnant, prolapse, loli, flat chest", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8046dfd3-7567-4e9f-ad96-902f90c3774c/width=450/888425.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1280, + "hash": "UGHn,1009u^+_NM_WBofyERk={X80KxaxZIo", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 1908601843, + "Model": "hassakuHentaiModel_v11", + "steps": 32, + "hashes": { + "model": "973cb455d0" + }, + "prompt": "nude, large breasts, nsfw, vaginal, giant dildo, (impossible object insertion:1.1), (absurd stomach bulge:1.1), (side view:0.9), full body, indoors, best quality, masterpiece\n", + "sampler": "DPM++ 2M Karras Test", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "hash": "973cb455d0", + "name": "hassakuHentaiModel_v11", + "type": "model" + } + ], + "Model hash": "973cb455d0", + "Hires steps": "12", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.4), (monochrome:1.0), pubic hair, (multiple views:1.1), (futanari:1.2), censored, (bar censor:1.2), mosaic censoring, fat, pregnant, prolapse, loli, flat chest", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f88f0722-9e14-4ca2-8be1-e02dba177fca/width=450/888423.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1280, + "hash": "U7Iqls9G1uIV.SS$IdRj00_N-g_2--IV~Wxu", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 242540322, + "Model": "revAnimated_v121", + "steps": 32, + "hashes": { + "model": "f57b21e57b" + }, + "prompt": "(massive gigantic dildo way thicker than entire body:1.2), vaginal, (impossible object insertion:1.4), (absurd stomach bulge:1.2), side view, gaping pussy, pussy juice, indoors, living room, window, long hair, blunt bangs, spread legs, nude, nsfw, indoors, \n", + "sampler": "DPM++ 2M Karras Test", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "hash": "f57b21e57b", + "name": "revAnimated_v121", + "type": "model" + } + ], + "Model hash": "f57b21e57b", + "Hires steps": "12", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(worst quality, low quality:1.4), (monochrome:1.0), pubic hair, (multiple views:1.1), censored, (bar censor:1.2), mosaic censoring, (prolapse:1.2), fat", + "Denoising strength": "0.6" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4a0e517b-8b9d-45dd-960a-c9fcd4d1d88c/width=450/888430.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1280, + "hash": "UZJaZa_3S~D%~qtRkDVtx^t8j?V@bHxuaeRj", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 887693879, + "Model": "revAnimated_v121", + "steps": 32, + "hashes": { + "model": "f57b21e57b" + }, + "prompt": "(massive gigantic dildo way thicker than entire body:1.2), vaginal, (impossible object insertion:1.4), (absurd stomach bulge:1.2), side view, gaping pussy, pussy juice, indoors, living room, window, long hair, blunt bangs, spread legs, large breasts, licking stomach bulge extending up to face, nude, nsfw, indoors, \n", + "sampler": "DPM++ 2M Karras Test", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "hash": "f57b21e57b", + "name": "revAnimated_v121", + "type": "model" + } + ], + "Model hash": "f57b21e57b", + "Hires steps": "12", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(worst quality, low quality:1.4), (monochrome:1.0), pubic hair, (multiple views:1.1), censored, (bar censor:1.2), mosaic censoring, (prolapse:1.2), fat", + "Denoising strength": "0.6" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/79215" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hyper_penetration_stomach_bulge_v8absurd-000006.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hyper_penetration_stomach_bulge_v8absurd-000006.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..cd19043022d0dac4a4f016b8a3cb391a0977470d Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hyper_penetration_stomach_bulge_v8absurd-000006.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hyper_penetration_stomach_bulge_v8absurd-000006.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hyper_penetration_stomach_bulge_v8absurd-000006.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..564d9f82afab83eb6eddda55d2c3478ca20326ef --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hyper_penetration_stomach_bulge_v8absurd-000006.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:2c99db28292da5c888d110fd93ae784fef3ef52b90b4813f486e7b85a564d045 +size 37896263 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hyper_penetration_stomach_bulge_v8all-000004.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hyper_penetration_stomach_bulge_v8all-000004.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..e82f85270889b7a8eb6930d02a91f839287fdf2b --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hyper_penetration_stomach_bulge_v8all-000004.civitai.info" @@ -0,0 +1,395 @@ +{ + "id": 79226, + "modelId": 9651, + "name": "v8all", + "createdAt": "2023-05-23T21:05:51.070Z", + "updatedAt": "2023-05-23T21:10:29.346Z", + "trainedWords": [ + "stomach bulge", + "vaginal", + "anal" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

Trained on all 3 of the other sets, highly recommended to mix in with one of those, with something like 0.4~0.6 weight for this one and 0.8~ for a specific set, but feel free to experiment.

", + "stats": { + "downloadCount": 297, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "hyper penetration stomach bulge", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "hyper_penetration_stomach_bulge_v8all-000004.safetensors", + "id": 54412, + "sizeKB": 73927.1220703125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-23T21:11:14.688Z", + "hashes": { + "AutoV1": "3A124F64", + "AutoV2": "EE4A2C1535", + "SHA256": "EE4A2C15356328ECE4AC500A0EC00BC45B8453EE4C046E8BAA605891A960ED7A", + "CRC32": "458E6C05", + "BLAKE3": "554AB6220883C2D31A260A77C1D96B16113C603F9CF7DF57DF9EE1148F83213C" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/79226" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/fac166fb-ac9c-4035-996e-5fe1b23af202/width=450/888536.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1280, + "hash": "UNH_V[NHu5M|?wM_-;NH9ZMxxZNc4oxuX8xt", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 2904816506, + "Model": "hassakuHentaiModel_v11", + "steps": 32, + "hashes": { + "model": "973cb455d0" + }, + "prompt": "absurd stomach bulge, vaginal, (cowgirl position:1.2), (side view:1.1), large penis, 1boy, 1girl, large breasts, indoors, window, masterpiece\n", + "sampler": "DPM++ 2M Karras Test", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "hash": "973cb455d0", + "name": "hassakuHentaiModel_v11", + "type": "model" + } + ], + "Model hash": "973cb455d0", + "Hires steps": "12", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(worst quality, low quality:1.4), (monochrome:1.0), pubic hair, (multiple views:1.1), blurry, censored, (bar censor:1.2), mosaic censoring, fat", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/51685ce2-079b-45c9-abce-d5e2cbe4e4cd/width=450/888534.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1280, + "hash": "UOHxKV~p5mIo.S-;?HxtE1%M-pxuRPjbR*R*", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 2228275352, + "Model": "hassakuHentaiModel_v11", + "steps": 32, + "hashes": { + "model": "973cb455d0" + }, + "prompt": "(stomach bulge:1.0), vaginal, penis, 1boy, 1girl, large breasts, indoors, window, masterpiece\n", + "sampler": "DPM++ 2M Karras Test", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "hash": "973cb455d0", + "name": "hassakuHentaiModel_v11", + "type": "model" + } + ], + "Model hash": "973cb455d0", + "Hires steps": "12", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(worst quality, low quality:1.4), (monochrome:1.0), pubic hair, (multiple views:1.1), blurry, censored, (bar censor:1.2), mosaic censoring, fat, hat, bondage, shibari, collar, futanari", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/78eb0190-7516-4c20-bded-45475aad360d/width=450/888532.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1280, + "hash": "UDHUUxof00of-:t7%3oJXTj@$iRj~BRj00of", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 724343860, + "Model": "hassakuHentaiModel_v11", + "steps": 32, + "hashes": { + "model": "973cb455d0" + }, + "prompt": "stomach bulge, anal, object insertion, dildo, indoors, masterpiece\n", + "sampler": "DPM++ 2M Karras Test", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "hash": "973cb455d0", + "name": "hassakuHentaiModel_v11", + "type": "model" + } + ], + "Model hash": "973cb455d0", + "Hires steps": "12", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(worst quality, low quality:1.4), (monochrome:1.0), pubic hair, (multiple views:1.1), censored, (bar censor:1.2), mosaic censoring, (prolapse:1.2), fat", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/34967d70-e349-4716-af4d-6808fba1418e/width=450/888533.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1280, + "hash": "UHJQ$Z~W0{I;GtOGQ-wd0M-p?HkW^-o#t8bb", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 1902138854, + "Model": "hassakuHentaiModel_v11", + "steps": 32, + "hashes": { + "model": "973cb455d0" + }, + "prompt": "nude, large breasts, vaginal object insertion, (impossible object insertion:1.2), (absurd stomach bulge:1.1), gaping pussy, outdoors, city, shape of penetration visible on stomach bulge\n", + "sampler": "DPM++ 2M Karras Test", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "hash": "973cb455d0", + "name": "hassakuHentaiModel_v11", + "type": "model" + } + ], + "Model hash": "973cb455d0", + "Hires steps": "12", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(worst quality, low quality:1.4), (monochrome:1.1), pubic hair, (multiple views:1.1), (futanari:1.2), censored, (bar censor:1.2), mosaic censoring, fat, pregnant, prolapse, loli, flat chest", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3e2ba088-c2f2-4643-a6f0-88526a2eec2e/width=450/888530.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1280, + "hash": "UIH-x,0057xZBrROIUxu~p9F$*tR.9IUV@t7", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 488675779, + "Model": "hassakuHentaiModel_v11", + "steps": 32, + "hashes": { + "model": "973cb455d0" + }, + "prompt": "nude, large breasts, nsfw, vaginal, giant dildo, (impossible object insertion:1.1), (absurd stomach bulge:1.1), (side view:0.9), full body, indoors, best quality, masterpiece\n", + "sampler": "DPM++ 2M Karras Test", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "hash": "973cb455d0", + "name": "hassakuHentaiModel_v11", + "type": "model" + } + ], + "Model hash": "973cb455d0", + "Hires steps": "12", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.4), (monochrome:1.0), pubic hair, (multiple views:1.1), (futanari:1.2), censored, (bar censor:1.2), mosaic censoring, fat, pregnant, prolapse, loli, flat chest", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3f23ca0b-ccb9-4b5a-a162-bc267d58bfb7/width=450/888535.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1280, + "hash": "UFJtrF9G5k_2-;M|jc?bysNG^+R*8{jF%L9F", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 1908601843, + "Model": "hassakuHentaiModel_v11", + "steps": 32, + "hashes": { + "model": "973cb455d0" + }, + "prompt": "nude, large breasts, nsfw, vaginal, giant dildo, (impossible object insertion:1.1), (absurd stomach bulge:1.1), (side view:0.9), gaping pussy, pussy juice, best quality, masterpiece\n", + "sampler": "DPM++ 2M Karras Test", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "hash": "973cb455d0", + "name": "hassakuHentaiModel_v11", + "type": "model" + } + ], + "Model hash": "973cb455d0", + "Hires steps": "12", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.4), (monochrome:1.0), pubic hair, (multiple views:1.1), (futanari:1.2), censored, (bar censor:1.2), mosaic censoring, fat, pregnant, prolapse, loli, flat chest", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d5ea52ef-d3de-41a7-b4d8-a27442c33f30/width=450/888537.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1280, + "hash": "URJacn00EMxu?wD$-p%ME1xaxZNbR5xuIoni", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 3202222188, + "Model": "hassakuHentaiModel_v11", + "steps": 32, + "hashes": { + "model": "973cb455d0" + }, + "prompt": "absurd stomach bulge, vaginal, (cowgirl position:1.2), (side view:1.1), large penis, 1boy, 1girl, large breasts, indoors, window, masterpiece\n", + "sampler": "DPM++ 2M Karras Test", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "hash": "973cb455d0", + "name": "hassakuHentaiModel_v11", + "type": "model" + } + ], + "Model hash": "973cb455d0", + "Hires steps": "12", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(worst quality, low quality:1.4), (monochrome:1.0), pubic hair, (multiple views:1.1), blurry, censored, (bar censor:1.2), mosaic censoring, fat", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f275e53f-6edb-482e-98ee-df7c48bd7d26/width=450/888539.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1280, + "hash": "ULI#4G4.FyMypI4n%0IoO@M|~WM|r?M{I:jY", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 1066532933, + "Model": "hassakuHentaiModel_v11", + "steps": 32, + "hashes": { + "model": "973cb455d0" + }, + "prompt": "absurd stomach bulge, vaginal, (cowgirl position:1.2), (side view:1.1), large penis, 1boy, 1girl, large breasts, indoors, window, masterpiece\n", + "sampler": "DPM++ 2M Karras Test", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "hash": "973cb455d0", + "name": "hassakuHentaiModel_v11", + "type": "model" + } + ], + "Model hash": "973cb455d0", + "Hires steps": "12", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(worst quality, low quality:1.4), (monochrome:1.0), pubic hair, (multiple views:1.1), blurry, censored, (bar censor:1.2), mosaic censoring, fat", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6218ae9a-0a61-4e44-9048-65ddbbe96dfd/width=450/888538.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1280, + "hash": "UUI}6UX94:%h.T%2xa.8pJxusAt7xbI:Rj-V", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 2672125102, + "Model": "hassakuHentaiModel_v11", + "steps": 32, + "hashes": { + "model": "973cb455d0" + }, + "prompt": "(stomach bulge:1.0), vaginal, penis, 1boy, 1girl, large breasts, touching bulge, indoors, window, masterpiece\n", + "sampler": "DPM++ 2M Karras Test", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "hash": "973cb455d0", + "name": "hassakuHentaiModel_v11", + "type": "model" + } + ], + "Model hash": "973cb455d0", + "Hires steps": "12", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(worst quality, low quality:1.4), (monochrome:1.0), pubic hair, (multiple views:1.1), blurry, censored, (bar censor:1.2), mosaic censoring, fat, hat, bondage, shibari, collar, futanari", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d87dcad8-c17b-4081-853f-880ee900ced4/width=450/888540.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1280, + "hash": "UFJj#r0K00~V0.MxH?yD00-o,-x^?as-X4NG", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 636215911, + "Model": "hassakuHentaiModel_v11", + "steps": 32, + "hashes": { + "model": "973cb455d0" + }, + "prompt": "pov, vaginal, pussy juice, (minigirl:1.2), minigirl sex, fairy, gigantic penis, (absurd stomach bulge:1.2), (penis-shaped distention:1.2), hyper penetration, impossible fit, blunt bangs, large breasts, long hair, nude, pov hands, koonago, footjob, feet on penis shaft, hanging on penis, heart\n", + "sampler": "DPM++ 2M Karras Test", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "hash": "973cb455d0", + "name": "hassakuHentaiModel_v11", + "type": "model" + } + ], + "Model hash": "973cb455d0", + "Hires steps": "12", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(worst quality, low quality:1.4), (monochrome:1.0), pubic hair, (multiple views:1.1), censored, (bar censor:1.2), mosaic censoring, (prolapse:1.2), fat, pregnant, loli, flat chest, futanari", + "Denoising strength": "0.5" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/79226" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hyper_penetration_stomach_bulge_v8all-000004.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hyper_penetration_stomach_bulge_v8all-000004.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..92ed1853f101c013765165626f8927a12519bfde Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hyper_penetration_stomach_bulge_v8all-000004.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hyper_penetration_stomach_bulge_v8all-000004.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hyper_penetration_stomach_bulge_v8all-000004.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..69f4a33b2bfb61d0997ec67951b94d483c8f9536 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hyper_penetration_stomach_bulge_v8all-000004.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:ee4a2c15356328ece4ac500a0ec00bc45b8453ee4c046e8baa605891a960ed7a +size 75701373 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hyper_penetration_stomach_bulge_v8nice-000006.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hyper_penetration_stomach_bulge_v8nice-000006.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..828eafb6119b52ff174b99da28ba584a20902333 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hyper_penetration_stomach_bulge_v8nice-000006.civitai.info" @@ -0,0 +1,394 @@ +{ + "id": 79221, + "modelId": 9651, + "name": "v8nice", + "createdAt": "2023-05-23T21:00:26.359Z", + "updatedAt": "2023-05-23T21:10:29.346Z", + "trainedWords": [ + "stomach bulge", + "penis-shaped distention" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

Dataset trimmed for images with nicely detailed bulges that aren't ridiculously huge (still pretty big though, I might make another version for better small bulges)

", + "stats": { + "downloadCount": 173, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "hyper penetration stomach bulge", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "hyper_penetration_stomach_bulge_v8nice-000006.safetensors", + "id": 54407, + "sizeKB": 73868.8486328125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-23T21:06:19.605Z", + "hashes": { + "AutoV1": "C48AD325", + "AutoV2": "D07435990D", + "SHA256": "D07435990D2BDAF73EA2AE8C46597AC515691C39A97D3A6E7DEF1A2299E11827", + "CRC32": "F0955203", + "BLAKE3": "33759C8612A3D7A8ACF6CD4E0E0512F0C06444A86F321FA621CCD26EAE0E6C19" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/79221" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1f52427f-9016-43cb-b9d3-ecc8d711afbf/width=450/888475.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1280, + "hash": "UYHe8_?cELIU_4%gs.jEI=xt%2s:RjxGWVR+", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 1519180234, + "Model": "hassakuHentaiModel_v11", + "steps": 32, + "hashes": { + "model": "973cb455d0" + }, + "prompt": "(stomach bulge:1.0), vaginal, penis, 1boy, 1girl, large breasts, touching bulge, indoors, window, masterpiece\n", + "sampler": "DPM++ 2M Karras Test", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "hash": "973cb455d0", + "name": "hassakuHentaiModel_v11", + "type": "model" + } + ], + "Model hash": "973cb455d0", + "Hires steps": "12", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(worst quality, low quality:1.4), (monochrome:1.0), pubic hair, (multiple views:1.1), blurry, censored, (bar censor:1.2), mosaic censoring, fat, hat, bondage, shibari, collar, futanari", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/daba901b-da01-4210-86d5-e05ecf893210/width=450/888472.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1280, + "hash": "UOJ*PHWB5Wt8*0WB_2t7E1WB={axt6RjR*fk", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 2707771786, + "Model": "hassakuHentaiModel_v11", + "steps": 32, + "hashes": { + "model": "973cb455d0" + }, + "prompt": "pov, vaginal, large penis, stomach bulge, blunt bangs, large breasts, long hair, touching bulge, penis-shaped distention, pov hands\n", + "sampler": "DPM++ 2M Karras Test", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "hash": "973cb455d0", + "name": "hassakuHentaiModel_v11", + "type": "model" + } + ], + "Model hash": "973cb455d0", + "Hires steps": "12", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(worst quality, low quality:1.4), (monochrome:1.0), pubic hair, (multiple views:1.1), censored, (bar censor:1.2), mosaic censoring, (prolapse:1.2), fat, pregnant", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5b6b7c6b-9e15-4a91-8f45-f0702ddd1112/width=450/888474.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1280, + "hash": "UEGt~U9a00-n-pE2I;^j00NG~WxY={%29aRi", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 1659503718, + "Model": "hassakuHentaiModel_v11", + "steps": 32, + "hashes": { + "model": "973cb455d0" + }, + "prompt": "stomach bulge, anal, nsfw\n", + "sampler": "DPM++ 2M Karras Test", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "hash": "973cb455d0", + "name": "hassakuHentaiModel_v11", + "type": "model" + } + ], + "Model hash": "973cb455d0", + "Hires steps": "12", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(worst quality, low quality:1.4), (monochrome:1.0), pubic hair, (multiple views:1.1), censored, (bar censor:1.2), mosaic censoring, (prolapse:1.2),", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ffddbae1-d37a-454f-95bd-979eb27841a9/width=450/888476.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1280, + "hash": "UDHUUxof00of-:t7%3oJXTj@$iRj~BRj00of", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 724343860, + "Model": "hassakuHentaiModel_v11", + "steps": 32, + "hashes": { + "model": "973cb455d0" + }, + "prompt": "stomach bulge, anal, object insertion, dildo, indoors, masterpiece\n", + "sampler": "DPM++ 2M Karras Test", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "hash": "973cb455d0", + "name": "hassakuHentaiModel_v11", + "type": "model" + } + ], + "Model hash": "973cb455d0", + "Hires steps": "12", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(worst quality, low quality:1.4), (monochrome:1.0), pubic hair, (multiple views:1.1), censored, (bar censor:1.2), mosaic censoring, (prolapse:1.2), fat", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5a689d6f-78b8-4d61-8e46-99dfe0a94f06/width=450/888473.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1280, + "hash": "UKH_76~W9u%g9^-p?H%M9GWB=|ofnNRPNFae", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 2156565878, + "Model": "hassakuHentaiModel_v11", + "steps": 32, + "hashes": { + "model": "973cb455d0" + }, + "prompt": "pov, vaginal, large penis, stomach bulge, blunt bangs, large breasts, long hair, touching bulge, penis-shaped distention, pov hands, indoors,, masterpiece, best quality\n", + "sampler": "DPM++ 2M Karras Test", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "hash": "973cb455d0", + "name": "hassakuHentaiModel_v11", + "type": "model" + } + ], + "Model hash": "973cb455d0", + "Hires steps": "12", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(worst quality, low quality:1.4), (monochrome:1.0), pubic hair, (multiple views:1.1), censored, (bar censor:1.2), mosaic censoring, (prolapse:1.2), fat, pregnant", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f11cc30a-04d3-42a8-876e-fd06905b7765/width=450/888478.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1280, + "hash": "UFK0~c8w11_NYRITbw%#NGo}^*o}9FxaOXR*", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 4124309106, + "Model": "hassakuHentaiModel_v11", + "steps": 32, + "hashes": { + "model": "973cb455d0" + }, + "prompt": "(stomach bulge:1.1), vaginal, (cowgirl position:1.2), penis, 1boy, 1girl, large breasts, indoors, window, masterpiece\n", + "sampler": "DPM++ 2M Karras Test", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "hash": "973cb455d0", + "name": "hassakuHentaiModel_v11", + "type": "model" + } + ], + "Model hash": "973cb455d0", + "Hires steps": "12", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(worst quality, low quality:1.4), (monochrome:1.0), pubic hair, (multiple views:1.1), blurry, censored, (bar censor:1.2), mosaic censoring, fat, hat, bondage, shibari, collar, futanari", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4e7855e3-f08a-4d2a-bc7e-731740810417/width=450/888477.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1280, + "hash": "UNJ7:s~p_2.8yD9E?Gx]yDS5%gRO^+W=%Nxu", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 1725648406, + "Model": "hassakuHentaiModel_v11", + "steps": 32, + "hashes": { + "model": "973cb455d0" + }, + "prompt": "(stomach bulge:1.2), vaginal, (side view:1.1), penis, 1boy, 1girl, large breasts, indoors, window, masterpiece\n", + "sampler": "DPM++ 2M Karras Test", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "hash": "973cb455d0", + "name": "hassakuHentaiModel_v11", + "type": "model" + } + ], + "Model hash": "973cb455d0", + "Hires steps": "12", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(worst quality, low quality:1.4), (monochrome:1.0), pubic hair, (multiple views:1.1), blurry, censored, (bar censor:1.2), mosaic censoring, fat, hat, bondage, shibari, collar, futanari", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/25b2b8eb-ea27-41dd-84bb-3126a1263bab/width=450/888480.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1280, + "hash": "UCIg_.005SM|Pq8_R-%M0LfS~VI;xw9at,%N", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 1617146290, + "Model": "hassakuHentaiModel_v11", + "steps": 32, + "hashes": { + "model": "973cb455d0" + }, + "prompt": "(stomach bulge:1.2), vaginal, penis, 1boy, 1girl, large breasts, touching bulge, indoors, window, masterpiece\n", + "sampler": "DPM++ 2M Karras Test", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "hash": "973cb455d0", + "name": "hassakuHentaiModel_v11", + "type": "model" + } + ], + "Model hash": "973cb455d0", + "Hires steps": "12", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(worst quality, low quality:1.4), (monochrome:1.0), pubic hair, (multiple views:1.1), blurry, censored, (bar censor:1.2), mosaic censoring, fat, hat, bondage, shibari, collar, futanari", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9574c905-50d7-4064-a35d-e8f6eeb2dc81/width=450/888481.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1280, + "hash": "UOHxKV~p5mIo.S-;?HxtE1%M-pxuRPjbR*R*", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 2228275352, + "Model": "hassakuHentaiModel_v11", + "steps": 32, + "hashes": { + "model": "973cb455d0" + }, + "prompt": "(stomach bulge:1.0), vaginal, penis, 1boy, 1girl, large breasts, indoors, window, masterpiece\n", + "sampler": "DPM++ 2M Karras Test", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "hash": "973cb455d0", + "name": "hassakuHentaiModel_v11", + "type": "model" + } + ], + "Model hash": "973cb455d0", + "Hires steps": "12", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(worst quality, low quality:1.4), (monochrome:1.0), pubic hair, (multiple views:1.1), blurry, censored, (bar censor:1.2), mosaic censoring, fat, hat, bondage, shibari, collar, futanari", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ec30408d-8ec0-4841-9936-97b07bf22dba/width=450/888479.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1280, + "hash": "UFI;k*00GFt8T}9Et7NGSxSi^kR*4:-;I;oz", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 2337173898, + "Model": "hassakuHentaiModel_v11", + "steps": 32, + "hashes": { + "model": "973cb455d0" + }, + "prompt": "(stomach bulge:1.0), vaginal, penis, 1boy, 1girl, large breasts, indoors, window, masterpiece\n", + "sampler": "DPM++ 2M Karras Test", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "hash": "973cb455d0", + "name": "hassakuHentaiModel_v11", + "type": "model" + } + ], + "Model hash": "973cb455d0", + "Hires steps": "12", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(worst quality, low quality:1.4), (monochrome:1.0), pubic hair, (multiple views:1.1), blurry, censored, (bar censor:1.2), mosaic censoring, fat, hat, bondage, shibari, collar, futanari", + "Denoising strength": "0.5" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/79221" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hyperbreasts_v6.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hyperbreasts_v6.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..ec72a90041100d0aaee626205fe671b40599fc9e --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hyperbreasts_v6.civitai.info" @@ -0,0 +1,384 @@ +{ + "id": 88626, + "modelId": 1178, + "name": "v6", + "createdAt": "2023-06-03T19:49:04.799Z", + "updatedAt": "2023-06-03T21:47:49.714Z", + "trainedWords": [ + "big breasts", + "huge breasts", + "gigantic breasts" + ], + "baseModel": "SD 1.4", + "earlyAccessTimeFrame": 0, + "description": "

  • Added some more variety in breast shapes to the dataset

  • Less harmful to the overall style than v5

Training Details:

  • 2k images

  • 16 epocs

  • learning rate 2e-4

  • text encoder LR 5e-5

  • base model Av3

  • clip skip 2

  • random flip

  • tag drop chance 0.1

  • bucketing at 768

  • dim 16

  • alpha 8

  • 150 tokens

  • cosine with restarts

  • training with tags, tags attached next to model download

  • Kohya LoRA LoCon, does not require any additional extensions to use

", + "stats": { + "downloadCount": 71, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "hyperbreasts", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "hyperbreasts_v6.safetensors", + "id": 60827, + "sizeKB": 38163.2802734375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-03T19:57:34.052Z", + "hashes": { + "AutoV1": "F67FB25A", + "AutoV2": "2A98B2CB63", + "SHA256": "2A98B2CB632590B860A154B6CAA8155892B0AC01FFE85910FFD1D780B3B7F955", + "CRC32": "17F9D312", + "BLAKE3": "2B19A5AB647C3B53E21155041A86749E663189A0526630563F874F8624C74353" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/88626" + }, + { + "name": "hyperbreasts_v6_tags.zip", + "id": 60826, + "sizeKB": 1.951171875, + "type": "Training Data", + "metadata": { + "fp": null, + "size": null, + "format": "Other" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-03T19:55:52.525Z", + "hashes": { + "AutoV2": "40DE0C12FB", + "SHA256": "40DE0C12FBFC7AAF2195189EC2672A51CED79573D16D11B7A05DD7AE797A37F6", + "CRC32": "8FD398C4", + "BLAKE3": "591E8B0D49B625FBB492190A6024C91057055B68D2636F9B6D5A88CB66BF2353" + }, + "primary": false, + "downloadUrl": "https://civitai.com/api/download/models/88626?type=Training%20Data" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9660c848-3a9d-4c00-aeb6-3a9ca22958d0/width=450/1020195.jpeg", + "nsfw": "X", + "width": 1408, + "height": 1408, + "hash": "U8H_70Q,Nx~C0e$M.7-6tRRn-p-:NrOt9FNH", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8507e6e2-cc90-4eb8-ada9-c06eb2c7cf13/width=450/1020200.jpeg", + "nsfw": "X", + "width": 768, + "height": 768, + "hash": "UGJa_|PCct^hKn-oMcRO02S4^gwH0LIA-;t8", + "meta": { + "Eta": "0.69", + "ENSD": "72", + "Size": "768x768", + "seed": 3871073618, + "Model": "AbyssOrangeMix2_hard", + "steps": 30, + "hashes": { + "model": "0fc198c490" + }, + "prompt": "masterpiece, best quality, highres, marvelous sunday \\(umamusume\\), + +, 1girl, :d, animal ears, arms behind back, blush, breasts, brown hair, cleavage, cowboy shot, drill hair, fang, horse ears, horse girl, horse tail, huge breasts, orange eyes, plump, saddle hair ornament, shortstack, side drill, skin fang, smile, solo, tail, thick thighs, thighs, tracen swimsuit, twintails, wide hips\n(thick thighs, wide hips, ass visible from front, gigantic breasts)\n", + "sampler": "DPM++ 2S a", + "cfgScale": 9, + "Clip skip": "2", + "resources": [ + { + "name": "hyperbreasts_v6", + "type": "lora", + "weight": 1 + }, + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "3d, bubbles, low quality, monochrome, bad art, bad anatomy, asymmetrical, censored, bad art, glasses, disfigured, no arms, extra arms, extra fingers, multiple arms, more than two legs, blur, blurry\ndeformed, blurry, bad anatomy, disfigured, poorly drawn face, mutation, mutated, extra_limb, ugly, poorly drawn hands, text\n(((bad anatomy))), (((extra legs))), (((extra arms))), ((poorly_drawn_face)), ((poorly drawn hands)), ((poorly drawn feet)), (disfigured), ((out of frame)), (((long neck))), (big ears), (((poo art))), ((((tiling)))), ((bad hands)), (bad art), ((deformed)),(mutated)\n(text), (((bad anatomy))), (((extra legs))), (((extra arms))), ((ugly face)), (disfigured), ((out of frame)), (((poo art))), ((bad hands)), (bad art), ((deformed)),(mutated)\nloose fitting\ncropped face, bad composition, two heads, long neck, missing limbs, deformed arms, deformed hands, extra fingers, (((bad anatomy))), (((extra legs))), (((extra arms))), ((poorly_drawn_face)), ((poorly drawn hands)), ((poorly drawn feet)), fat, (disfigured), ((out of frame)), (((long neck))), (big ears), (((poo art))), ((((tiling)))), ((bad hands)), (bad art), ((deformed)),(mutated)\ndeformed, blurry, bad anatomy, disfigured, poorly drawn face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, blurry, floating limbs, disconnected limbs, malformed hands, blur, out of focus, long neck, long body, (text) deformed, blurry, bad anatomy, disfigured, poorly drawn face, mutation, mutated, extra_limb, ugly, poorly drawn hands ((ditigal ilustration)), ((art))\nobese, (ugly:1.3), (duplicate:1.3), (morbid), (mutilated), out of frame, extra fingers, mutated hands, (poorly drawn hands), (poorly drawn face), (mutation:1.3), (deformed:1.3), (amputee:1.3), blurry, bad anatomy, bad proportions, (extra limbs), cloned face, (disfigured:1.3), gross proportions, (malformed limbs), (missing arms), (missing legs), (extra arms), (extra legs), mutated hands, (fused fingers), (too many fingers), (long neck:1.3), lowres, text, error, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, black and white, monochrome, censored", + "Face restoration": "GFPGAN" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/95bbaa10-3441-4cce-8fa6-d755f99ff23e/width=450/1020202.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1536, + "hash": "UFF}=#9Z0Lxus,xZIUNH00={~CIo4oxu-pV@", + "meta": { + "Eta": "0.69", + "ENSD": "72", + "Size": "512x768", + "seed": 1002114515, + "Model": "AbyssOrangeMix2_hard", + "steps": 25, + "hashes": { + "model": "0fc198c490" + }, + "prompt": "masterpiece, best quality, wicke \\(pokemon\\), 1girl, bunny ears, bunny girl, bunny tail, bunnysuit, exposed breasts, female, female only, glasses, green eyes, human, hyper, huge breasts, hyper thighs, leotard, nipples, purple hair, solo, solo female, simple background, animal ears, armpits, black hair, black legwear, breasts, detached collar, fake animal ears, fake tail, glasses, gradient, gradient background, green eyes, leotard, pink background, playboy bunny, rabbit ears, rabbit girl, rabbit tail, short hair, solo, strapless, tail, thick thighs, thighhighs, thighs, wrist cuffs\n", + "sampler": "DPM++ 2S a", + "cfgScale": 10, + "Clip skip": "2", + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "Hires steps": "20", + "Hires upscale": "2", + "Hires upscaler": "Lanczos", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, body out of frame, out of frame, poorly drawn, deformed, disproportionate, blurry, ugly, extra nipples, third nipple, asymmetrical, multiple heads, clothed, genshin", + "Face restoration": "GFPGAN", + "Denoising strength": "0.3" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e58d66f0-d621-4a3e-a0b9-23f1667feab4/width=450/1020204.jpeg", + "nsfw": "X", + "width": 576, + "height": 704, + "hash": "UHJH2Nt701$*00xuE1Io00D%~Vx]^jxusSnh", + "meta": { + "Eta": "0.69", + "ENSD": "72", + "Size": "576x704", + "seed": 1368174438, + "Model": "AbyssOrangeMix2_hard", + "steps": 25, + "hashes": { + "model": "0fc198c490" + }, + "prompt": "masterpiece, best quality, 1girl, :o, animal ears, animal print, areola slip, bangs, bell, bikini, blunt bangs, blush, (gigantic breasts:1.2), cow ears, cow print, cow tail, cowbell, cowboy shot, crescent, crescent hair ornament, elbow gloves, fake animal ears, fake horns, fake tail, gloves, hair ornament, hair ribbon, half-closed eyes, horns, long hair, looking at viewer, open mouth, ribbon, simple background, skindentation, solo, swimsuit, tail, tress ribbon, very long hair\n", + "sampler": "DPM++ 2S a", + "cfgScale": 10, + "Clip skip": "2", + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry , mangled" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0d95b0e9-5571-49ed-a736-cae86f065343/width=450/1020205.jpeg", + "nsfw": "X", + "width": 640, + "height": 768, + "hash": "UNKn9:K4*0rWyYxDMxD$2_o}?GV?Q.9[R5xt", + "meta": { + "Eta": "0.69", + "ENSD": "72", + "Size": "640x768", + "seed": 3896148919, + "Model": "AbyssOrangeMix2_hard", + "steps": 20, + "hashes": { + "model": "0fc198c490" + }, + "prompt": "masterpiece, best quality, highres, 1girl, alternate costume, arabian clothes, bare shoulders, belly dancing, black hair, blush, breasts, choker, cleavage, collarbone, dancer, dark-skinned female, dark skin, hair ornament, harem outfit, head tilt, looking at viewer, midriff, mouth veil, navel, o-ring, o-ring top, pelvic curtain, purple eyes, see-through, short hair, smile, solo, standing, stomach, veil,\n(gigantic breasts),\n", + "sampler": "DPM++ 2S a", + "cfgScale": 10, + "Clip skip": "2", + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry , mangled" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/35ac2848-a56d-48fd-8b42-e2416b295d22/width=450/1020207.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1536, + "hash": "UcLpzEIox]%M~pofbbR%Egsm%2f89Za|%2WB", + "meta": { + "Eta": "0.69", + "ENSD": "72", + "Size": "512x768", + "seed": 1002114508, + "Model": "AbyssOrangeMix2_hard", + "steps": 25, + "hashes": { + "model": "0fc198c490" + }, + "prompt": "masterpiece, best quality, wicke \\(pokemon\\), 1girl, bunny ears, bunny girl, bunny tail, bunnysuit, exposed breasts, female, female only, glasses, green eyes, human, hyper, huge breasts, hyper thighs, leotard, nipples, purple hair, solo, solo female, simple background, animal ears, armpits, black hair, black legwear, breasts, detached collar, fake animal ears, fake tail, glasses, gradient, gradient background, green eyes, leotard, pink background, playboy bunny, rabbit ears, rabbit girl, rabbit tail, short hair, solo, strapless, tail, thick thighs, thighhighs, thighs, wrist cuffs\n", + "sampler": "DPM++ 2S a", + "cfgScale": 10, + "Clip skip": "2", + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "Hires steps": "20", + "Hires upscale": "2", + "Hires upscaler": "Lanczos", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, body out of frame, out of frame, poorly drawn, deformed, disproportionate, blurry, ugly, extra nipples, third nipple, asymmetrical, multiple heads, clothed, genshin", + "Face restoration": "GFPGAN", + "Denoising strength": "0.3" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/492b08a3-2f45-4ee2-a857-d4a259f4710a/width=450/1020208.jpeg", + "nsfw": "X", + "width": 640, + "height": 640, + "hash": "UKJasCoI0Ku5CA%2%0cG00.8~po#=yp0D*IU", + "meta": { + "Eta": "0.69", + "ENSD": "72", + "Size": "640x640", + "seed": 3798884786, + "Model": "AbyssOrangeMix2_hard", + "steps": 25, + "hashes": { + "model": "0fc198c490" + }, + "prompt": "masterpiece, best quality, 1girl, alternate breast size, bikini, blush, breasts, cleavage, collarbone, eyelashes, female, female only, female solo, (skinny, gigantic breasts:1.2), green eyes, human, human only, hyper, looking at viewer, nail polish, orange hair, outdoors, pool, short hair, side ponytail, smile, solo, solo female, standing, top heavy, absurd res, ai upscaled, alternate version at source, upscaled\n", + "sampler": "DPM++ 2S a", + "cfgScale": 10, + "Clip skip": "2", + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "ugly drawn face, mutation, mutated, ugly, painting, sketch, rough draft, blurry, lowres, hideous, dismembered, jpeg artifacts, low quality, unfinished, text, watermark, irritated skin, tumor", + "Face restoration": "GFPGAN" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1d0804a9-19d7-48be-90f5-b5368870c9ec/width=450/1020209.jpeg", + "nsfw": "Mature", + "width": 704, + "height": 704, + "hash": "UOH2ZmITK6E1E9RixFR*.TRixD%19#-oE1WV", + "meta": { + "Eta": "0.69", + "ENSD": "-69", + "Size": "704x704", + "seed": 1790113786, + "Model": "AbyssOrangeMix2_hard", + "steps": 25, + "hashes": { + "model": "0fc198c490" + }, + "prompt": "masterpiece, best quality, 1girl, gigantic breasts, standing\n", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 12, + "Clip skip": "2", + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "giant, boy, man, from below, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, low quality lowres, low quality lowres low polygon 3D game, low quality lowres monochrome sketch rough graffiti, low quality lowres very ugly fat obesity scar, low quality lowres chibi, low quality lowres poorly drawn bad anatomy, low quality lowres graffiti unbecoming colorfully, low quality lowres incoherent background, low quality lowres long body, low quality lowres duplicate comparison, low quality lowres low quality lowres sketch retro_artstyle doujinshi, low quality lowres sketch, low quality lowres text font ui error missing digit blurry, low quality lowres JPEG artifacts signature hazy bleary, low quality lowres monochrome parody meme, low quality lowres historical picture, low quality lowres disfigured mutated malformed twisted human body, low quality lowres futanari tranny, low quality lowres tentacle skeleton, low quality lowres vomit suicide death dirty, low quality, bad art, bad anatomy, asymmetrical, censored, bad art, glasses, disfigured, no arms, extra arms, extra fingers, transsexual, multiple arms, more than two legs, blur, blurry deformed, blurry, bad anatomy, disfigured, poorly drawn face, mutation, mutated, extra_limb, ugly, poorly drawn hands, text,", + "Face restoration": "GFPGAN" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ca18c2c6-d1a7-4f55-b124-df52df5c51d1/width=450/1020211.jpeg", + "nsfw": "None", + "width": 640, + "height": 768, + "hash": "UEHeOR_M0dR51jEQ9F%1.9o~xZsA0Mkr^+%L", + "meta": { + "Eta": "0.69", + "ENSD": "72", + "Size": "640x768", + "seed": 1368174445, + "Model": "AbyssOrangeMix2_hard", + "steps": 25, + "hashes": { + "model": "0fc198c490" + }, + "prompt": "masterpiece, best quality,1rigl solo, gigantic breasts\n", + "sampler": "DPM++ 2S a", + "cfgScale": 10, + "Clip skip": "2", + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry , mangled" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/99b6f1c1-7282-4571-b41c-81941caeca4b/width=450/1020213.jpeg", + "nsfw": "Mature", + "width": 640, + "height": 640, + "hash": "URI}q;-T1NpIKkROIotl4TITxBgO}=r=9Foy", + "meta": { + "Eta": "0.69", + "ENSD": "72", + "Size": "640x640", + "seed": 3942099229, + "Model": "AbyssOrangeMix2_hard", + "steps": 25, + "hashes": { + "model": "0fc198c490" + }, + "prompt": "masterpiece, best quality, 1girl, alternate breast size, bikini, blush, breasts, cleavage, collarbone, eyelashes, female, female only, female solo, (skinny, gigantic breasts:1.2), green eyes, human, human only, hyper, looking at viewer, nail polish, orange hair, outdoors, pool, short hair, side ponytail, smile, solo, solo female, standing, top heavy, absurd res, ai upscaled, alternate version at source, upscaled\n", + "sampler": "DPM++ 2S a", + "cfgScale": 10, + "Clip skip": "2", + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "ugly drawn face, mutation, mutated, ugly, painting, sketch, rough draft, blurry, lowres, hideous, dismembered, jpeg artifacts, low quality, unfinished, text, watermark, irritated skin, tumor", + "Face restoration": "GFPGAN" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/88626" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hyperbreasts_v6.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hyperbreasts_v6.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..97e4d5db3731d689bccdb663f96f24e0eb9e9e11 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hyperbreasts_v6.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hyperbreasts_v6.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hyperbreasts_v6.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..121bd16f5d4fe82f14afaf70020be2efe8efbab8 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hyperbreasts_v6.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:2a98b2cb632590b860a154b6caa8155892b0ac01ffe85910ffd1d780b3b7f955 +size 39079199 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hyperfusion_213k_32dim-LoCon-epoc6-v5.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hyperfusion_213k_32dim-LoCon-epoc6-v5.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..6600ec5ca6378ea543e131e907650baecc878b8e --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hyperfusion_213k_32dim-LoCon-epoc6-v5.civitai.info" @@ -0,0 +1,355 @@ +{ + "id": 75230, + "modelId": 16928, + "name": "v5", + "createdAt": "2023-05-19T19:06:19.891Z", + "updatedAt": "2023-05-19T19:40:22.664Z", + "trainedWords": [ + " breasts", + "ass", + " belly", + "hyperbreasts", + "hyperass", + "hyperpreg", + "pregnant" + ], + "baseModel": "SD 1.4", + "earlyAccessTimeFrame": 0, + "description": "

Doubled the dataset size to 200k

Lots more image classifiers used to tag images for better size/shape control

Training Notes:

  • 200k+ images from Danbooru, r-34, e621 etc...

  • LR 8e-5

  • TE_LR 2e-5

  • batch 4

  • GA 32

  • dim 32 (I reduced this since it didn't make a huge difference and saves space)

  • alpha 16

  • scheduler: cosine_with_restarts, 33 restarts

  • base model Av3

  • Av3 VAE

  • flip aug

  • clip skip 2

  • 225 token length

  • bucketing at 768

  • tag drop chance 0.15

  • tag shuffling

  • 47,000 unique tags, but about 500 frequently occurring ones (see attached training data for tag list)

  • about 4 days training time (if you ignore the dozens of models I trained for days and scraped)

", + "stats": { + "downloadCount": 162, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "hyperfusion 200k images", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "hyperfusion-v5-tags.zip", + "id": 51937, + "sizeKB": 14.0947265625, + "type": "Training Data", + "metadata": { + "fp": null, + "size": null, + "format": "Other" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-19T19:11:10.739Z", + "hashes": { + "AutoV2": "56D3B0C17C", + "SHA256": "56D3B0C17C6F4A086A225E9168EBE9471D5BE9E406DC82BE7D081191F758D94F", + "CRC32": "A457E94A", + "BLAKE3": "6F58B1A446F9810018A0CD3C313A2B07CF6772C9911C377176F386A61B0FD62A" + }, + "primary": false, + "downloadUrl": "https://civitai.com/api/download/models/75230?type=Training%20Data" + }, + { + "name": "hyperfusion_213k_32dim-LoCon-epoc6-v5.safetensors", + "id": 51938, + "sizeKB": 76185.7763671875, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-19T19:11:50.916Z", + "hashes": { + "AutoV1": "1C2ECF1A", + "AutoV2": "A60145A6A8", + "SHA256": "A60145A6A8DE3DCD4B66D202DDE7583C961120F4E91C8E11BCD2BBC25B70BC61", + "CRC32": "22FAACC0", + "BLAKE3": "6987B5C25EC5989EAE47BB046D121338B01681611732B5F3E23185D04010816F" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/75230" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/004c3e93-e835-4589-b52f-e97a6a04d9e9/width=450/840968.jpeg", + "nsfw": "X", + "width": 1536, + "height": 1536, + "hash": "UAIOX]^Q01VpB=-W^+Xkt3J5JDxIKn9Zacrs", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/067f9bc2-43c0-4ae0-bf7f-a5f9c17146cb/width=450/840977.jpeg", + "nsfw": "Soft", + "width": 512, + "height": 768, + "hash": "UjP6gcRQ%#kCx]t6%2ay_NxaxtkCRPWXNHWB", + "meta": { + "Eta": "0.69", + "ENSD": "72", + "Size": "512x768", + "seed": 1243011268, + "Model": "AbyssOrangeMix2_hard", + "steps": 25, + "hashes": { + "model": "0fc198c490" + }, + "prompt": "masterpiece, best quality, highres, absurdres, 1girl, 1girl, bangs, barefoot, dress, eyebrows visible through hair, from behind, full body, gradient, white background, looking at viewer, looking back, purple eyes, short hair, short sleeves, silver hair, solo, standing, maid outfit\n, (huge breasts:1.3), (breasts bigger than torso),\n, (cel shading:1.2), (thick outline, outline:1.2), simple background, dark background,\n,", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 11, + "Clip skip": "2", + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "low quality, monochrome, bad art, bad anatomy, asymmetrical, censored, bad art, glasses, disfigured, no arms, extra arms, extra fingers, multiple arms, more than two legs, blur, blurry\ndeformed, blurry, bad anatomy, disfigured, poorly drawn face, mutation, mutated, extra_limb, ugly, poorly drawn hands, text\n(((bad anatomy))), (((extra legs))), (((extra arms))), ((poorly_drawn_face)), ((poorly drawn hands)), ((poorly drawn feet)), (disfigured), ((out of frame)), (((long neck))), (big ears), (((poo art))), ((((tiling)))), ((bad hands)), (bad art), ((deformed)),(mutated)\n(text), (((bad anatomy))), (((extra legs))), (((extra arms))), ((ugly face)), (disfigured), ((out of frame)), (((poo art))), ((bad hands)), (bad art), ((deformed)),(mutated)\nloose fitting\ncropped face, bad composition, two heads, long neck, missing limbs, deformed arms, deformed hands, extra fingers, (((bad anatomy))), (((extra legs))), (((extra arms))), ((poorly_drawn_face)), ((poorly drawn hands)), ((poorly drawn feet)), (disfigured), ((out of frame)), (((long neck))), (big ears), (((poo art))), ((((tiling)))), ((bad hands)), (bad art), ((deformed)),(mutated)\ndeformed, blurry, bad anatomy, disfigured, poorly drawn face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, blurry, floating limbs, disconnected limbs, malformed hands, blur, out of focus, long neck, long body, (text) deformed, blurry, bad anatomy, disfigured, poorly drawn face, mutation, mutated, extra_limb, ugly, poorly drawn hands ((ditigal ilustration)), ((art))\n(ugly:1.3), (duplicate:1.3), (morbid), (mutilated), out of frame, extra fingers, mutated hands, (poorly drawn hands), (poorly drawn face), (mutation:1.3), (deformed:1.3), (amputee:1.3), blurry, bad anatomy, bad proportions, (extra limbs), cloned face, (disfigured:1.3), gross proportions, (malformed limbs), (missing arms), (missing legs), (extra arms), (extra legs), mutated hands, (fused fingers), (too many fingers), (long neck:1.3), lowres, text, error, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, black and white, monochrome, censored, english text, japanese text, (pixel art),", + "Face restoration": "GFPGAN" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/58fd441a-41ae-4060-beb5-fc6e1b65633c/width=450/840978.jpeg", + "nsfw": "Soft", + "width": 768, + "height": 768, + "hash": "UMJHafDh0yjIyZVsI9tm69-6R5OD8_pJs-rq", + "meta": { + "Eta": "0.69", + "ENSD": "72", + "Size": "768x768", + "seed": 3871073610, + "Model": "AbyssOrangeMix2_hard", + "steps": 30, + "hashes": { + "model": "0fc198c490" + }, + "prompt": "masterpiece, best quality, highres, tailzkim, marvelous sunday \\(umamusume\\), + +, 1girl, :d, animal ears, arms behind back, blush, breasts, brown hair, cleavage, cowboy shot, drill hair, fang, horse ears, horse girl, horse tail, huge breasts, orange eyes, plump, saddle hair ornament, side drill, skin fang, smile, solo, tail, thick thighs, thighs, tracen swimsuit, twintails, wide hips\n(thick thighs, wide hips, ass visible from front, gigantic ass, hyperass:1.3)\n", + "sampler": "DPM++ 2S a", + "cfgScale": 9, + "Clip skip": "2", + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "3d, bubbles, low quality, monochrome, bad art, bad anatomy, asymmetrical, censored, bad art, glasses, disfigured, no arms, extra arms, extra fingers, multiple arms, more than two legs, blur, blurry\ndeformed, blurry, bad anatomy, disfigured, poorly drawn face, mutation, mutated, extra_limb, ugly, poorly drawn hands, text\n(((bad anatomy))), (((extra legs))), (((extra arms))), ((poorly_drawn_face)), ((poorly drawn hands)), ((poorly drawn feet)), (disfigured), ((out of frame)), (((long neck))), (big ears), (((poo art))), ((((tiling)))), ((bad hands)), (bad art), ((deformed)),(mutated)\n(text), (((bad anatomy))), (((extra legs))), (((extra arms))), ((ugly face)), (disfigured), ((out of frame)), (((poo art))), ((bad hands)), (bad art), ((deformed)),(mutated)\nloose fitting\ncropped face, bad composition, two heads, long neck, missing limbs, deformed arms, deformed hands, extra fingers, (((bad anatomy))), (((extra legs))), (((extra arms))), ((poorly_drawn_face)), ((poorly drawn hands)), ((poorly drawn feet)), fat, (disfigured), ((out of frame)), (((long neck))), (big ears), (((poo art))), ((((tiling)))), ((bad hands)), (bad art), ((deformed)),(mutated)\ndeformed, blurry, bad anatomy, disfigured, poorly drawn face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, blurry, floating limbs, disconnected limbs, malformed hands, blur, out of focus, long neck, long body, (text) deformed, blurry, bad anatomy, disfigured, poorly drawn face, mutation, mutated, extra_limb, ugly, poorly drawn hands ((ditigal ilustration)), ((art))\nobese, (ugly:1.3), (duplicate:1.3), (morbid), (mutilated), out of frame, extra fingers, mutated hands, (poorly drawn hands), (poorly drawn face), (mutation:1.3), (deformed:1.3), (amputee:1.3), blurry, bad anatomy, bad proportions, (extra limbs), cloned face, (disfigured:1.3), gross proportions, (malformed limbs), (missing arms), (missing legs), (extra arms), (extra legs), mutated hands, (fused fingers), (too many fingers), (long neck:1.3), lowres, text, error, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, black and white, monochrome, censored", + "Face restoration": "GFPGAN" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6743c931-6599-4c8c-9f88-192f3cab1928/width=450/840981.jpeg", + "nsfw": "X", + "width": 704, + "height": 640, + "hash": "UXIqfgE3Kj?b%%xabwo#9}xHxYE2xIozM_R+", + "meta": { + "Eta": "0.69", + "ENSD": "72", + "Size": "704x640", + "seed": 821579795, + "Model": "AbyssOrangeMix2_hard", + "steps": 30, + "hashes": { + "model": "0fc198c490" + }, + "prompt": "masterpiece, best quality, 1girl, masterpiece, sfw, clothed, (gigantic breasts), covered nipples, wide hips, mature female, smile, long hair, white hair, blue eyes, temple, motherly, fantasy, priestess, temple, ornate, dark skin, dark-skinned female, pregnant, colossal belly, self-resting, belly bed, leaning\nhyperbreasts, hyperpreg, ,", + "sampler": "DPM++ 2S a", + "cfgScale": 11, + "Clip skip": "2", + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "low quality, bad art, bad anatomy, asymmetrical, censored, bad art, glasses, disfigured, no arms, extra arms, extra fingers, multiple arms, more than two legs, blur, blurry\ndeformed, blurry, bad anatomy, disfigured, poorly drawn face, mutation, mutated, extra_limb, ugly, poorly drawn hands, text\n(((bad anatomy))), (((extra legs))), (((extra arms))), ((poorly_drawn_face)), ((poorly drawn hands)), ((poorly drawn feet)), (disfigured), ((out of frame)), (((long neck))), (big ears), (((poo art))), ((((tiling)))), ((bad hands)), (bad art), ((deformed)),(mutated)\n(text), (((bad anatomy))), (((extra legs))), (((extra arms))), ((ugly face)), (disfigured), ((out of frame)), (((poo art))), ((bad hands)), (bad art), ((deformed)),(mutated)\nloose fitting\ncropped face, bad composition, two heads, long neck, missing limbs, deformed arms, deformed hands, extra fingers, (((bad anatomy))), (((extra legs))), (((extra arms))), ((poorly_drawn_face)), ((poorly drawn hands)), ((poorly drawn feet)), fat, (disfigured), ((out of frame)), (((long neck))), (big ears), (((poo art))), ((((tiling)))), ((bad hands)), (bad art), ((deformed)),(mutated)\ndeformed, blurry, bad anatomy, disfigured, poorly drawn face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, blurry, floating limbs, disconnected limbs, malformed hands, blur, out of focus, long neck, long body, (text) deformed, blurry, bad anatomy, disfigured, poorly drawn face, mutation, mutated, extra_limb, ugly, poorly drawn hands ((ditigal ilustration)), ((art)), wet shirt" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3f39cefe-d5e9-4991-8d00-e926a5a230c5/width=450/840982.jpeg", + "nsfw": "Soft", + "width": 512, + "height": 1024, + "hash": "UII#S_9FAIRj}@rqE2%#02M_~Bo}JoNbx]s9", + "meta": { + "Eta": "0.69", + "ENSD": "72", + "Size": "512x1024", + "seed": 1488339440, + "Model": "AbyssOrangeMix2_hard", + "steps": 25, + "hashes": { + "model": "0fc198c490" + }, + "prompt": "masterpiece, best quality, 1girl, blush, breasts, brown hair, cleavage, closed mouth, dress, green eyes, hair over one eye, heart, large breasts, lips, long hair, mature female, orange dress, simple background, smile, solo, standing, white background, (gigantic breasts:1.3), sagging breasts, long breasts\n,", + "sampler": "DPM++ 2S a", + "cfgScale": 10, + "Clip skip": "2", + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "anus, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, body out of frame, out of frame, poorly drawn, deformed, disproportionate, blurry, ugly, extra nipples, third nipple, asymmetrical, multiple heads, clothed, genshin, black and white, ( :1.3)", + "Face restoration": "GFPGAN" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c74c9e7b-991d-4d28-a679-eac49fdf7169/width=450/840995.jpeg", + "nsfw": "Soft", + "width": 1408, + "height": 1408, + "hash": "UkF$eRM{I9t7.TR*Mxf+NfR*%0afD+RjxtR*", + "meta": { + "Eta": "0.69", + "ENSD": "72", + "Size": "704x704", + "seed": 1079020787, + "Model": "AbyssOrangeMix2_hard", + "steps": 20, + "hashes": { + "model": "0fc198c490" + }, + "prompt": "masterpiece, best quality, 1girl, solo, (gigantic ass), thick thighs, wide hips, facing viewer, thigh gap\n,", + "sampler": "DPM++ 2S a", + "cfgScale": 12, + "Clip skip": "2", + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "Hires steps": "15", + "Hires upscale": "2", + "Hires upscaler": "Lanczos", + "negativePrompt": "ugly drawn face, mutation, mutated, ugly, painting, sketch, rough draft, blurry, lowres, hideous, dismembered, jpeg artifacts, low quality, unfinished, text, watermark, irritated skin, tumor", + "Face restoration": "GFPGAN", + "Denoising strength": "0.3" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1468ffc0-0dca-419a-8771-594f7b499399/width=450/840996.jpeg", + "nsfw": "X", + "width": 768, + "height": 768, + "hash": "UEKKA,Q-0KAIYR-;veah03MwwH~V00jG_39Z", + "meta": { + "Eta": "0.69", + "ENSD": "72", + "Size": "768x768", + "seed": 2302740264, + "Model": "AbyssOrangeMix2_hard", + "steps": 30, + "hashes": { + "model": "0fc198c490" + }, + "prompt": "masterpiece, best quality, atz-zukin, 1girl, solo, ass bigger than head, ass bigger than torso, breasts bigger than head, breasts bigger than torso, gigantic ass, gigantic breasts, hard nipples, covered nipples, hyper, hyper ass, hyper breasts, hyper thighs, long hair, looking at viewer, swimsuit, thick thighs, wide hips\n", + "sampler": "DPM++ 2S a", + "cfgScale": 10, + "Clip skip": "2", + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "bad-artist, bad-image-v2-39000, boring_e621, easynegative, ng_deepnegative_v1_75t, low quality, bad art, bad anatomy, asymmetrical, censored, bad art, glasses, disfigured, no arms, extra arms, extra fingers, multiple arms, more than two legs, blur, blurry\ndeformed, blurry, bad anatomy, disfigured, poorly drawn face, mutation, mutated, extra_limb, ugly, poorly drawn hands, text\n(((bad anatomy))), (((extra legs))), (((extra arms))), ((poorly_drawn_face)), ((poorly drawn hands)), ((poorly drawn feet)), (disfigured), ((out of frame)), (((long neck))), (big ears), (((poo art))), ((((tiling)))), ((bad hands)), (bad art), ((deformed)),(mutated)\n(text), (((bad anatomy))), (((extra legs))), (((extra arms))), ((ugly face)), (disfigured), ((out of frame)), (((poo art))), ((bad hands)), (bad art), ((deformed)),(mutated)\nloose fitting\ncropped face, bad composition, two heads, long neck, missing limbs, deformed arms, deformed hands, extra fingers, (((bad anatomy))), (((extra legs))), (((extra arms))), ((poorly_drawn_face)), ((poorly drawn hands)), ((poorly drawn feet)), fat, (disfigured), ((out of frame)), (((long neck))), (big ears), (((poo art))), ((((tiling)))), ((bad hands)), (bad art), ((deformed)),(mutated)\ndeformed, blurry, bad anatomy, disfigured, poorly drawn face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, blurry, floating limbs, disconnected limbs, malformed hands, blur, out of focus, long neck, long body, (text) deformed, blurry, bad anatomy, disfigured, poorly drawn face, mutation, mutated, extra_limb, ugly, poorly drawn hands ((ditigal ilustration)), ((art))" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a37978f6-c16e-421d-aeb9-322af8bb64bf/width=450/840998.jpeg", + "nsfw": "X", + "width": 512, + "height": 640, + "hash": "UVH-[Q-o-7-;~AxuEgoe=_xukrxut,WBVXR-", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/bfe130c3-4735-498c-847b-011454945180/width=450/841001.jpeg", + "nsfw": "X", + "width": 640, + "height": 640, + "hash": "UEI;Cp~q00?Y4=M}%1x@4p^k?GEK0L4:Ri9F", + "meta": { + "Eta": "0.69", + "ENSD": "72", + "Size": "640x640", + "seed": 4202202560, + "Model": "AbyssOrangeMix2_hard", + "steps": 30, + "hashes": { + "model": "0fc198c490" + }, + "prompt": "masterpiece, best quality, vile \\(mysterydad\\), mysterydad, 1girl, ass, belly, blue eyes, breasts, chicken, chubby, demon, demon girl, demon horns, drumstick, eating, expansion, fat, female, female focus, female only, hip expansion, hips, horns, hyper, hyper ass, imp, large ass, nude, nude female, ponytail, purple hair, shocked, stomach, thick thighs, thighs, wardrobe malfunction, wide hips, yellow sclera\n", + "sampler": "DPM++ 2S a", + "cfgScale": 10, + "Clip skip": "2", + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "lowres, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, monochrome" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/97787702-e93c-4b69-aaa1-51afc501a422/width=450/841002.jpeg", + "nsfw": "Soft", + "width": 640, + "height": 768, + "hash": "UfKw93D%X9xt?^niM|-:?vrrX9R--;Ip%1xu", + "meta": { + "Eta": "0.69", + "ENSD": "72", + "Size": "640x768", + "seed": 2639052858, + "Model": "AbyssOrangeMix2_hard", + "steps": 25, + "hashes": { + "model": "0fc198c490" + }, + "prompt": "masterpiece, best quality, 1girl, big belly, blush, breasts, brown hair, cleavage, closed mouth, dress, green eyes, hair over one eye, heart, large breasts, lips, long hair, mature female, orange dress, innie navel, simple background, smile, solo, standing, white background, (gigantic breasts:1.3),\n,", + "sampler": "DPM++ 2S a", + "cfgScale": 10, + "Clip skip": "2", + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "anus, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, body out of frame, out of frame, poorly drawn, deformed, disproportionate, blurry, ugly, extra nipples, third nipple, asymmetrical, multiple heads, clothed, genshin, black and white, ( :1.3)", + "Face restoration": "GFPGAN" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/75230" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hyperfusion_213k_32dim-LoCon-epoc6-v5.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hyperfusion_213k_32dim-LoCon-epoc6-v5.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..01b7b55e41172d354a389c55ecbb566bc455ceec --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hyperfusion_213k_32dim-LoCon-epoc6-v5.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:6f48a870a6dcb1ae96b94db99440065cc7be7ebf9c7fa4641fa832257de74f02 +size 3447535 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hyperfusion_213k_32dim-LoCon-epoc6-v5.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hyperfusion_213k_32dim-LoCon-epoc6-v5.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..f8469127fb91018ddf406a3fd3b7cc88c377e7aa --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\344\275\223\346\200\201\345\274\225\345\257\274/hyperfusion_213k_32dim-LoCon-epoc6-v5.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:a60145a6a8de3dcd4b66d202dde7583c961120f4e91c8e11bcd2bbc25b70bc61 +size 78014235 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/69Lite_v1.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/69Lite_v1.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..e00e19a95e53a6d165884f8a8eb48bbbea763ab4 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/69Lite_v1.civitai.info" @@ -0,0 +1,279 @@ +{ + "id": 44770, + "modelId": 38857, + "name": "v1", + "createdAt": "2023-04-13T14:39:49.723Z", + "updatedAt": "2023-04-13T14:40:46.996Z", + "trainedWords": [ + "69", + "cunnilingus", + "fellatio" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 942, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "69 (lite)", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "69Lite_v1.safetensors", + "id": 33659, + "sizeKB": 36985.224609375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-13T14:42:12.567Z", + "hashes": { + "AutoV1": "5E4B9557", + "AutoV2": "BBA4FF062D", + "SHA256": "BBA4FF062DE150F5EAA864CA67498E6A4B02DBA3267310495CE592B578974D4C", + "CRC32": "56EC7A40", + "BLAKE3": "96B6AA5538CD8DF3E038C264F62474A4A46090E1021F98475BE34E8D2BB0367B" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/44770" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/78e33585-b639-45da-9551-393f5094d100/width=450/486690.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UKL:Q801KP~pO;IpkCf%4-t8=|Mx-Tt6RjxZ", + "meta": { + "Size": "512x512", + "seed": 3223132348, + "Model": "AnythingV5V3_v5PrtRE", + "steps": 20, + "hashes": { + "model": "7f96a1a9ca" + }, + "prompt": "masterpiece, best quality, 1girl, 1boy, 69, cunnilingus, fellatio, ", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "7f96a1a9ca", + "name": "AnythingV5V3_v5PrtRE", + "type": "model" + } + ], + "Model hash": "7f96a1a9ca", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative, bad anatomy, penis from girl, bad hands, cropped, missing fingers, missing toes, too many toes, too many fingers, missing arms, long neck, Humpbacked, deformed, disfigured, poorly drawn face, distorted face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, floating limbs, disconnected limbs, malformed hands, out of focus, long body, monochrome, symbol, text, logo, door frame, window frame, mirror frame" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e4e369ad-b1be-463f-698b-9e41961cb000/width=450/486693.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UYM$[8~UxVRjJhVri]XTxWIUwcX8%0WBSht6", + "meta": { + "Size": "512x512", + "seed": 3070440497, + "Model": "AnythingV5V3_v5PrtRE", + "steps": 20, + "hashes": { + "model": "7f96a1a9ca" + }, + "prompt": "masterpiece, best quality, 1girl, 1boy, 69, cunnilingus, fellatio, ", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "7f96a1a9ca", + "name": "AnythingV5V3_v5PrtRE", + "type": "model" + } + ], + "Model hash": "7f96a1a9ca", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative, bad anatomy, penis from girl, bad hands, cropped, missing fingers, missing toes, too many toes, too many fingers, missing arms, long neck, Humpbacked, deformed, disfigured, poorly drawn face, distorted face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, floating limbs, disconnected limbs, malformed hands, out of focus, long body, monochrome, symbol, text, logo, door frame, window frame, mirror frame" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/bc9e4386-c258-493d-5ad4-fb8ebf2ff500/width=450/486685.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UFLWFm00OZ?b10m+XTD%01^j-prq~A$*n*s,", + "meta": { + "Size": "512x512", + "seed": 1066845138, + "Model": "AnythingV5V3_v5PrtRE", + "steps": 20, + "hashes": { + "model": "7f96a1a9ca" + }, + "prompt": "masterpiece, best quality, 1girl, 1boy, 69, cunnilingus, fellatio, ", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "7f96a1a9ca", + "name": "AnythingV5V3_v5PrtRE", + "type": "model" + } + ], + "Model hash": "7f96a1a9ca", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative, bad anatomy, penis from girl, bad hands, cropped, missing fingers, missing toes, too many toes, too many fingers, missing arms, long neck, Humpbacked, deformed, disfigured, poorly drawn face, distorted face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, floating limbs, disconnected limbs, malformed hands, out of focus, long body, monochrome, symbol, text, logo, door frame, window frame, mirror frame" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4c5231f2-0f86-413d-ab39-a8845a1ed800/width=450/486691.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UELy$Y00Y5%z0x9bt7RO^*D*=|~B~VXAD*?b", + "meta": { + "Size": "512x512", + "seed": 1199238676, + "Model": "AnythingV5V3_v5PrtRE", + "steps": 20, + "hashes": { + "model": "7f96a1a9ca" + }, + "prompt": "masterpiece, best quality, 1girl, 1boy, 69, cunnilingus, fellatio, ", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "7f96a1a9ca", + "name": "AnythingV5V3_v5PrtRE", + "type": "model" + } + ], + "Model hash": "7f96a1a9ca", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative, bad anatomy, penis from girl, bad hands, cropped, missing fingers, missing toes, too many toes, too many fingers, missing arms, long neck, Humpbacked, deformed, disfigured, poorly drawn face, distorted face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, floating limbs, disconnected limbs, malformed hands, out of focus, long body, monochrome, symbol, text, logo, door frame, window frame, mirror frame" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7c1aad7a-440c-47e6-6042-d9988ddc5500/width=450/486689.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UIMipMENpJ~p7z%Mx]ofK5~C-pxZ-q%gS4Io", + "meta": { + "Size": "512x512", + "seed": 3865502360, + "Model": "AnythingV5V3_v5PrtRE", + "steps": 20, + "hashes": { + "model": "7f96a1a9ca" + }, + "prompt": "masterpiece, best quality, 1girl, 1boy, 69, cunnilingus, fellatio, full body, ", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "7f96a1a9ca", + "name": "AnythingV5V3_v5PrtRE", + "type": "model" + } + ], + "Model hash": "7f96a1a9ca", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative, bad anatomy, penis from girl, bad hands, cropped, missing fingers, missing toes, too many toes, too many fingers, missing arms, long neck, Humpbacked, deformed, disfigured, poorly drawn face, distorted face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, floating limbs, disconnected limbs, malformed hands, out of focus, long body, monochrome, symbol, text, logo, door frame, window frame, mirror frame" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6fcb061c-e27d-41c0-276a-b459782b0200/width=450/486686.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UEN+-B_3X4000{Z~?aD+9st6-;EN~WiwsVIU", + "meta": { + "Size": "512x512", + "seed": 1934967322, + "Model": "AnythingV5V3_v5PrtRE", + "steps": 20, + "hashes": { + "model": "7f96a1a9ca" + }, + "prompt": "masterpiece, best quality, 1girl, 1boy, 69, cunnilingus, fellatio, full body, ", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "7f96a1a9ca", + "name": "AnythingV5V3_v5PrtRE", + "type": "model" + } + ], + "Model hash": "7f96a1a9ca", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative, bad anatomy, penis from girl, bad hands, cropped, missing fingers, missing toes, too many toes, too many fingers, missing arms, long neck, Humpbacked, deformed, disfigured, poorly drawn face, distorted face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, floating limbs, disconnected limbs, malformed hands, out of focus, long body, monochrome, symbol, text, logo, door frame, window frame, mirror frame" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0620aa1f-b53d-410a-1114-08fd7d3b6e00/width=450/486688.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UNM$=0RPOZ^+?^NGXT%gAtt7o#r?-o-pogR+", + "meta": { + "Size": "512x512", + "seed": 684261274, + "Model": "AnythingV5V3_v5PrtRE", + "steps": 20, + "hashes": { + "model": "7f96a1a9ca" + }, + "prompt": "masterpiece, best quality, 1girl, 1boy, 69, cunnilingus, fellatio, full body, ", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "7f96a1a9ca", + "name": "AnythingV5V3_v5PrtRE", + "type": "model" + } + ], + "Model hash": "7f96a1a9ca", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative, bad anatomy, penis from girl, bad hands, cropped, missing fingers, missing toes, too many toes, too many fingers, missing arms, long neck, Humpbacked, deformed, disfigured, poorly drawn face, distorted face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, floating limbs, disconnected limbs, malformed hands, out of focus, long body, monochrome, symbol, text, logo, door frame, window frame, mirror frame" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/40db6a76-dccc-426a-80f7-351135065e00/width=450/486687.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UYNluv4.E2o|?^MxM{t7J-RPogWA-AWVxaRP", + "meta": { + "Size": "512x512", + "seed": 1263438999, + "Model": "AnythingV5V3_v5PrtRE", + "steps": 20, + "hashes": { + "model": "7f96a1a9ca" + }, + "prompt": "masterpiece, best quality, 1girl, 1boy, 69, cunnilingus, fellatio, full body, ", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "7f96a1a9ca", + "name": "AnythingV5V3_v5PrtRE", + "type": "model" + } + ], + "Model hash": "7f96a1a9ca", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative, bad anatomy, penis from girl, bad hands, cropped, missing fingers, missing toes, too many toes, too many fingers, missing arms, long neck, Humpbacked, deformed, disfigured, poorly drawn face, distorted face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, floating limbs, disconnected limbs, malformed hands, out of focus, long body, monochrome, symbol, text, logo, door frame, window frame, mirror frame" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/44770" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/69Lite_v1.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/69Lite_v1.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..c032c490974bd5fd7157b6400d392c3202fff591 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/69Lite_v1.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/69Lite_v1.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/69Lite_v1.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..bf4a22a52acc05d1ae8e91d61db2c2e1093f8bab --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/69Lite_v1.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:bba4ff062de150f5eaa864ca67498e6a4b02dba3267310495ce592b578974d4c +size 37872870 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/ArtistLORATomuTomubobu_doggystyleAllFoursStanding.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/ArtistLORATomuTomubobu_doggystyleAllFoursStanding.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..4c91e27a11f010848adb1514807508f0d47bd9d4 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/ArtistLORATomuTomubobu_doggystyleAllFoursStanding.civitai.info" @@ -0,0 +1,280 @@ +{ + "id": 9228, + "modelId": 7828, + "name": "Doggystyle - All Fours/Standing - tomu (tomubobu)", + "createdAt": "2023-02-10T14:30:13.727Z", + "updatedAt": "2023-04-10T22:52:01.856Z", + "trainedWords": [ + "doggystyle", + "sex" + ], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": null, + "model": { + "name": "(Artist LORA) - tomu (tomubobu) - Doggystyle - All Fours/Standing ", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "ArtistLORATomuTomubobu_doggystyleAllFoursStanding.safetensors", + "id": 8973, + "sizeKB": 147579.787109375, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-02-10T14:31:07.681Z", + "hashes": { + "AutoV1": "4FC2034A", + "AutoV2": "F1230F8FD6", + "SHA256": "F1230F8FD619D0A37110B21A8CE9F61EBD7B8C03DEED90272F3EF1B83F4E88F0", + "CRC32": "312B3FEA", + "BLAKE3": "EDEB8B522A19C15B0C96D4536ADCA55853096A0EEC8DF7BBD0D9AACEBD475D32" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/9228" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6a8f5bb1-b88b-4675-7c0d-7193ba52ce00/width=450/88416.jpeg", + "nsfw": false, + "width": 1280, + "height": 1280, + "hash": "UQKwOf=|-:w]o}~qR*IopJt8R*kCxuWWRjni", + "meta": { + "Size": "512x512", + "seed": 131978560, + "steps": 20, + "prompt": "1girl, 1boy, doggystyle, all fours, sex, maid outfit, nsfw, bed, medium breasts, black hair, short hair, red eyes", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7.5, + "resources": [ + { + "hash": "c3f63842a839", + "name": "DoggyTomu15", + "type": "lora", + "weight": null + } + ], + "Model hash": "0fc198c490", + "Hires resize": "1280x1280", + "AddNet Enabled": "True", + "AddNet Model 1": "DoggyTomu15(c3f63842a839)", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "(wrinkles:1.1),(monotone). 3D. low quality lowres multiple breasts, low quality lowres mutated hands and fingers, low quality lowres long body, low quality lowres mutation poorly drawn, low quality lowres black-white, low quality lowres bad anatomy, low quality lowres liquid body, low quality lowres liquid tongue, low quality lowres disfigured, low quality lowres malformed, low quality lowres mutated, low quality lowres anatomical nonsense, low quality lowres text font ui, low quality lowres error, low quality lowres malformed hands, low quality lowres long neck, low quality lowres blurred, low quality lowres lowers, low quality lowres low res, low quality lowres bad proportions, low quality lowres bad shadow, low quality lowres uncoordinated body, low quality lowres unnatural body, low quality lowres fused breasts, low quality lowres bad breasts, low quality lowres huge breasts, low quality lowres poorly drawn breasts, low quality lowres extra breasts, low quality lowres liquid breasts, low quality lowres heavy breasts, low quality lowres missing breasts, low quality lowres huge haunch, low quality lowres huge thighs, low quality lowres huge calf, low quality lowres bad hands, low quality lowres fused hand, low quality lowres missing hand, low quality lowres disappearing arms, low quality lowres disappearing thigh, low quality lowres disappearing calf, low quality lowres disappearing legs, low quality lowres fused ears, low quality lowres bad ears, low quality lowres poorly drawn ears, low quality lowres extra ears, low quality lowres liquid ears, low quality lowres heavy ears, low quality lowres missing ears, low quality lowres fused animal ears, low quality lowres bad animal ears, low quality lowres poorly drawn animal ears, low quality lowres extra animal ears, low quality lowres liquid animal ears, low quality lowres heavy animal ears, low quality lowres missing animal ears, low quality lowres text, low quality lowres ui, low quality lowres missing fingers, low quality lowres missing limb, low quality lowres fused fingers, low quality lowres one hand with more than 5 fingers, low quality lowres one hand with less than 5 fingers, low quality lowres one hand with more than 5 digit, low quality lowres one hand with less than 5 digit, low quality lowres extra digit, low quality lowres fewer digits, low quality lowres fused digit, low quality lowres missing digit, low quality lowres bad digit, low quality lowres liquid digit, low quality lowres colorful tongue, low quality lowres black tongue, low quality lowres cropped, low quality lowres watermark, low quality lowres username, low quality lowres blurry, low quality lowres JPEG artifacts, low quality lowres signature, low quality lowres 3D, low quality lowres 3D game, low quality lowres 3D game scene, low quality lowres 3D character, low quality lowres malformed feet, low quality lowres extra feet, low quality lowres bad feet, low quality lowres poorly drawn feet, low quality lowres fused feet, low quality lowres missing feet, low quality lowres extra shoes, low quality lowres bad shoes, low quality lowres fused shoes, low quality lowres more than two shoes, low quality lowres poorly drawn shoes, low quality lowres bad gloves, low quality lowres poorly drawn gloves, low quality lowres fused gloves, low quality lowres bad cum, low quality lowres poorly drawn cum, low quality lowres fused cum, low quality lowres bad hairs, low quality lowres poorly drawn hairs, low quality lowres fused hairs, low quality lowres big muscles, low quality lowres ugly, low quality lowres bad face, low quality lowres fused face, low quality lowres poorly drawn face, low quality lowres cloned face, low quality lowres big face, low quality lowres long face, low quality lowres bad eyes, low quality lowres fused eyes poorly drawn eyes, low quality lowres extra eyes, low quality lowres malformed limbs, low quality lowres more than 2 nipples, low quality lowres missing nipples, low quality lowres different nipples, low quality lowres fused nipples, low quality lowres bad nipples, low quality lowres poorly drawn nipples, low quality lowres black nipples, low quality lowres colorful nipples, low quality lowres gross proportions, short arm, low quality lowres missing arms, low quality lowres missing thighs, low quality lowres missing calf, low quality lowres missing legs, low quality lowres mutation, low quality lowres duplicate, low quality lowres morbid, low quality lowres mutilated, low quality lowres poorly drawn hands, low quality lowres more than 1 left hand, low quality lowres more than 1 right hand, low quality lowres deformed, low quality lowres extra arms, low quality lowres extra thighs, low quality lowres more than 2 thighs, low quality lowres extra calf, low quality lowres fused calf, low quality lowres extra legs, low quality lowres bad knee, low quality lowres extra knee, low quality lowres more than 2 legs, low quality lowres bad tails, low quality lowres bad mouth, low quality lowres fused mouth, low quality lowres poorly drawn mouth, low quality lowres bad tongue, low quality lowres tongue within mouth, low quality lowres too long tongue, low quality lowres big mouth, low quality lowres cracked mouth, low quality lowres dirty face, low quality lowres dirty teeth, low quality lowres dirty pantie, low quality lowres fused pantie, low quality lowres poorly drawn pantie, low quality lowres fused cloth, low quality lowres poorly drawn cloth, low quality lowres bad pantie, low quality lowres yellow teeth, low quality lowres thick lips, low quality lowres bad camel toe, low quality lowres colorful camel toe, low quality lowres bad asshole, low quality lowres poorly drawn asshole, low quality lowres fused asshole, low quality lowres missing asshole, low quality lowres bad anus, low quality lowres bad pussy, low quality lowres bad crotch, low quality lowres bad crotch seam, low quality lowres fused anus, low quality lowres fused pussy, low quality lowres fused crotch, low quality lowres poorly drawn crotch, low quality lowres fused seam, low quality lowres poorly drawn anus, low quality lowres poorly drawn pussy, low quality lowres poorly drawn crotch seam, low quality lowres bad thigh gap, low quality lowres missing thigh gap, low quality lowres fused thigh gap, low quality lowres liquid thigh gap, low quality lowres poorly drawn thigh gap, low quality lowres bad collarbone, low quality lowres fused collarbone, low quality lowres missing collarbone, low quality lowres liquid collarbone, low quality lowres strong girl, low quality lowres obesity, low quality lowres worst quality, low quality lowres low quality, low quality lowres normal quality, low quality lowres liquid tentacles, low quality lowres bad tentacles, low quality lowres poorly drawn tentacles, low quality lowres split tentacles, low quality lowres fused tentacles, low quality lowres missing clit, low quality lowres bad clit, low quality lowres fused clit, low quality lowres colorful clit, low quality lowres black clit, low quality lowres liquid clit, low quality lowres QR code, low quality lowres bar code, low quality lowres censored, low quality lowres safety panties, low quality lowres safety knickers, low quality lowres beard, low quality lowres furry, pony, low quality lowres pubic hair, low quality lowres mosaic, low quality lowres excrement, low quality lowres faeces, low quality lowres shit, low quality lowres futa, low quality lowres testis, low quality lowres lowres, low quality lowres terrible, low quality lowres dirty, low quality lowres feces, low quality lowres organs, low quality lowres fat, low quality lowres thick thighs, low quality lowres low resolution rough, low quality lowres pedophile, low quality lowres bestiality, low quality lowres parody, low quality lowres traditional media, low quality lowres koma, low quality lowres comic, low quality lowres scary, low quality lowres severe, low quality lowres insects, low quality lowres gross scars, low quality lowres twisted human body, low quality lowres irrational human body, low quality lowres sharp fingers, low quality lowres parts of the body out of common sense, low quality lowres murder, low quality lowres beheading, low quality lowres zombie, low quality lowres mummy, low quality lowres graffiti, low quality lowres unfinished picture, low quality lowres terrible quality, low quality lowres Coprophilia, low quality lowres muscular, low quality lowres bald, low quality lowres monk, low quality lowres wrinkly, low quality lowres simple background, low quality lowres realistic, low quality lowres old, low quality lowres scan, low quality lowres touhou, low quality lowres yaoi, low quality lowres gay, low quality lowres femboy, low quality lowres trap, low quality lowres pee, low quality lowres doujinshi, low quality lowres monochrome, low quality lowres meme, low quality lowres demon, low quality lowres monstrous creature, low quality lowres tentacle, low quality lowres self harm, low quality lowres vomit, low quality lowres suicide, low quality lowres death, low quality lowres corpse, low quality lowres bone, low quality lowres skeleton, low quality lowres fingers over 6, low quality lowres framed, low quality lowres historical picture, low quality lowres futanari, low quality lowres shemale, low quality lowres trans gender, low quality lowres dick girl, low quality lowres flat breasts, low quality lowres degenerate ass, low quality lowres retro artstyle, low quality lowres anime screencap, low quality lowres stitched, low quality lowres pokemon, low quality lowres ryona, low quality lowres animal, low quality lowres male focus, low quality lowres nipple penetration, low quality lowres sonic (series), low quality lowres bondage, low quality lowres bdsm, low quality lowres 2D, low quality lowres 2D game, low quality lowres 2D game scene, low quality lowres 2D character, low quality lowres game cg, low quality lowres watercolor (medium), low quality lowres 2koma, low quality lowres interlocked fingers, low quality lowres gloves, low quality lowres nitroplus, low quality lowres greyscale, low quality lowres sketch, low quality lowres line drawing, low quality lowres gorilla, low quality lowres meat, low quality lowres gundam, low quality lowres multiple views, low quality lowres cut, low quality lowres concept art, low quality lowres reference sheet, low quality lowres turnaround, low quality lowres chart, low quality lowres comparison, low quality lowres artist progress, low quality lowres lineup, low quality lowres before and after, low quality lowres orc, low quality lowres tusks, low quality lowres goblin, low quality lowres kobold, low quality lowres pony, low quality lowres longbody, low quality lowres nsfw, low quality lowres owres, low quality lowres Humpbacked, low quality lowres text error, low quality lowres extra digits, low quality lowres standard quality, low quality lowres large breasts, low quality lowres shadow, low quality lowres nude, low quality lowres artist name, low quality lowres skeleton girl, low quality lowres bad legs, low quality lowres missing fngers, low quality lowres extra digt, low quality lowres wort quality, low quality lowres jpeg, low quality lowres artifacts, low quality lowres bad body, low quality lowres optical illusion, low quality lowres Glasses, low quality lowres jpegartifacts, low quality lowres girl, low quality lowres women, low quality lowres more than 1 moon, low quality lowres Multi foot, low quality lowres Multifold, low quality lowres Multi fingering, low quality lowres colored sclera, low quality lowres monster girl, low quality lowres Black hands, low quality lowres The background is incoherent, low quality lowres abnormal eye proportion, low quality lowres Abnormal hands, low quality lowres abnormal legs, low quality lowres abnormal feet abnormal fingers, low quality lowres sharp face, low quality lowres tranny, low quality lowres mutated hands, low quality lowres extra limbs, low quality lowres too many fingers, low quality lowres unclear eyes, low quality lowres bad, low quality lowres mutated hand and finger, low quality lowres malformed mutated, low quality lowres boken limb, low quality lowres incorrect limb, low quality lowres fusion finger, low quality lowres lose finger, low quality lowres multiple finger, low quality lowres multiple digit, low quality lowres fusion hand, low quality lowres lose leg, low quality lowres fused leg, low quality lowres multiple leg, low quality lowres bad cameltoe, low quality lowres colorful cameltoe, low quality lowres low polygon 3D game, extra limbs, four legs, three legs", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.5", + "AddNet Weight B 1": "0.5", + "Denoising strength": "0.2" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8e514903-5b38-42b4-0373-fe18c1152a00/width=450/88422.jpeg", + "nsfw": false, + "width": 1280, + "height": 1280, + "hash": "UTE{CD?aROS1~W?HIUNGtRxuRkRjS$Nbj?jF", + "meta": { + "Size": "512x512", + "seed": 499993173, + "steps": 20, + "prompt": "1girl, 1boy in suit, doggystyle, sex from behind, all fours, embarrassed, grass, hetero, solo focus, skirt, panty pull, clothed sex, nsfw, white hair, side ponytail, black jacket", + "sampler": "DPM++ SDE Karras", + "cfgScale": 10, + "resources": [ + { + "hash": "1826e8d1c2be", + "name": "DoggyTomu13", + "type": "lora", + "weight": null + } + ], + "Model hash": "0fc198c490", + "Hires resize": "1280x1280", + "AddNet Enabled": "True", + "AddNet Model 1": "DoggyTomu13(1826e8d1c2be)", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "(wrinkles:1.1),(monotone). 3D. low quality lowres multiple breasts, low quality lowres mutated hands and fingers, low quality lowres long body, low quality lowres mutation poorly drawn, low quality lowres black-white, low quality lowres bad anatomy, low quality lowres liquid body, low quality lowres liquid tongue, low quality lowres disfigured, low quality lowres malformed, low quality lowres mutated, low quality lowres anatomical nonsense, low quality lowres text font ui, low quality lowres error, low quality lowres malformed hands, low quality lowres long neck, low quality lowres blurred, low quality lowres lowers, low quality lowres low res, low quality lowres bad proportions, low quality lowres bad shadow, low quality lowres uncoordinated body, low quality lowres unnatural body, low quality lowres fused breasts, low quality lowres bad breasts, low quality lowres huge breasts, low quality lowres poorly drawn breasts, low quality lowres extra breasts, low quality lowres liquid breasts, low quality lowres heavy breasts, low quality lowres missing breasts, low quality lowres huge haunch, low quality lowres huge thighs, low quality lowres huge calf, low quality lowres bad hands, low quality lowres fused hand, low quality lowres missing hand, low quality lowres disappearing arms, low quality lowres disappearing thigh, low quality lowres disappearing calf, low quality lowres disappearing legs, low quality lowres fused ears, low quality lowres bad ears, low quality lowres poorly drawn ears, low quality lowres extra ears, low quality lowres liquid ears, low quality lowres heavy ears, low quality lowres missing ears, low quality lowres fused animal ears, low quality lowres bad animal ears, low quality lowres poorly drawn animal ears, low quality lowres extra animal ears, low quality lowres liquid animal ears, low quality lowres heavy animal ears, low quality lowres missing animal ears, low quality lowres text, low quality lowres ui, low quality lowres missing fingers, low quality lowres missing limb, low quality lowres fused fingers, low quality lowres one hand with more than 5 fingers, low quality lowres one hand with less than 5 fingers, low quality lowres one hand with more than 5 digit, low quality lowres one hand with less than 5 digit, low quality lowres extra digit, low quality lowres fewer digits, low quality lowres fused digit, low quality lowres missing digit, low quality lowres bad digit, low quality lowres liquid digit, low quality lowres colorful tongue, low quality lowres black tongue, low quality lowres cropped, low quality lowres watermark, low quality lowres username, low quality lowres blurry, low quality lowres JPEG artifacts, low quality lowres signature, low quality lowres 3D, low quality lowres 3D game, low quality lowres 3D game scene, low quality lowres 3D character, low quality lowres malformed feet, low quality lowres extra feet, low quality lowres bad feet, low quality lowres poorly drawn feet, low quality lowres fused feet, low quality lowres missing feet, low quality lowres extra shoes, low quality lowres bad shoes, low quality lowres fused shoes, low quality lowres more than two shoes, low quality lowres poorly drawn shoes, low quality lowres bad gloves, low quality lowres poorly drawn gloves, low quality lowres fused gloves, low quality lowres bad cum, low quality lowres poorly drawn cum, low quality lowres fused cum, low quality lowres bad hairs, low quality lowres poorly drawn hairs, low quality lowres fused hairs, low quality lowres big muscles, low quality lowres ugly, low quality lowres bad face, low quality lowres fused face, low quality lowres poorly drawn face, low quality lowres cloned face, low quality lowres big face, low quality lowres long face, low quality lowres bad eyes, low quality lowres fused eyes poorly drawn eyes, low quality lowres extra eyes, low quality lowres malformed limbs, low quality lowres more than 2 nipples, low quality lowres missing nipples, low quality lowres different nipples, low quality lowres fused nipples, low quality lowres bad nipples, low quality lowres poorly drawn nipples, low quality lowres black nipples, low quality lowres colorful nipples, low quality lowres gross proportions, short arm, low quality lowres missing arms, low quality lowres missing thighs, low quality lowres missing calf, low quality lowres missing legs, low quality lowres mutation, low quality lowres duplicate, low quality lowres morbid, low quality lowres mutilated, low quality lowres poorly drawn hands, low quality lowres more than 1 left hand, low quality lowres more than 1 right hand, low quality lowres deformed, low quality lowres extra arms, low quality lowres extra thighs, low quality lowres more than 2 thighs, low quality lowres extra calf, low quality lowres fused calf, low quality lowres extra legs, low quality lowres bad knee, low quality lowres extra knee, low quality lowres more than 2 legs, low quality lowres bad tails, low quality lowres bad mouth, low quality lowres fused mouth, low quality lowres poorly drawn mouth, low quality lowres bad tongue, low quality lowres tongue within mouth, low quality lowres too long tongue, low quality lowres big mouth, low quality lowres cracked mouth, low quality lowres dirty face, low quality lowres dirty teeth, low quality lowres dirty pantie, low quality lowres fused pantie, low quality lowres poorly drawn pantie, low quality lowres fused cloth, low quality lowres poorly drawn cloth, low quality lowres bad pantie, low quality lowres yellow teeth, low quality lowres thick lips, low quality lowres bad camel toe, low quality lowres colorful camel toe, low quality lowres bad asshole, low quality lowres poorly drawn asshole, low quality lowres fused asshole, low quality lowres missing asshole, low quality lowres bad anus, low quality lowres bad pussy, low quality lowres bad crotch, low quality lowres bad crotch seam, low quality lowres fused anus, low quality lowres fused pussy, low quality lowres fused crotch, low quality lowres poorly drawn crotch, low quality lowres fused seam, low quality lowres poorly drawn anus, low quality lowres poorly drawn pussy, low quality lowres poorly drawn crotch seam, low quality lowres bad thigh gap, low quality lowres missing thigh gap, low quality lowres fused thigh gap, low quality lowres liquid thigh gap, low quality lowres poorly drawn thigh gap, low quality lowres bad collarbone, low quality lowres fused collarbone, low quality lowres missing collarbone, low quality lowres liquid collarbone, low quality lowres strong girl, low quality lowres obesity, low quality lowres worst quality, low quality lowres low quality, low quality lowres normal quality, low quality lowres liquid tentacles, low quality lowres bad tentacles, low quality lowres poorly drawn tentacles, low quality lowres split tentacles, low quality lowres fused tentacles, low quality lowres missing clit, low quality lowres bad clit, low quality lowres fused clit, low quality lowres colorful clit, low quality lowres black clit, low quality lowres liquid clit, low quality lowres QR code, low quality lowres bar code, low quality lowres censored, low quality lowres safety panties, low quality lowres safety knickers, low quality lowres beard, low quality lowres furry, pony, low quality lowres pubic hair, low quality lowres mosaic, low quality lowres excrement, low quality lowres faeces, low quality lowres shit, low quality lowres futa, low quality lowres testis, low quality lowres lowres, low quality lowres terrible, low quality lowres dirty, low quality lowres feces, low quality lowres organs, low quality lowres fat, low quality lowres thick thighs, low quality lowres low resolution rough, low quality lowres pedophile, low quality lowres bestiality, low quality lowres parody, low quality lowres traditional media, low quality lowres koma, low quality lowres comic, low quality lowres scary, low quality lowres severe, low quality lowres insects, low quality lowres gross scars, low quality lowres twisted human body, low quality lowres irrational human body, low quality lowres sharp fingers, low quality lowres parts of the body out of common sense, low quality lowres murder, low quality lowres beheading, low quality lowres zombie, low quality lowres mummy, low quality lowres graffiti, low quality lowres unfinished picture, low quality lowres terrible quality, low quality lowres Coprophilia, low quality lowres muscular, low quality lowres bald, low quality lowres monk, low quality lowres wrinkly, low quality lowres simple background, low quality lowres realistic, low quality lowres old, low quality lowres scan, low quality lowres touhou, low quality lowres yaoi, low quality lowres gay, low quality lowres femboy, low quality lowres trap, low quality lowres pee, low quality lowres doujinshi, low quality lowres monochrome, low quality lowres meme, low quality lowres demon, low quality lowres monstrous creature, low quality lowres tentacle, low quality lowres self harm, low quality lowres vomit, low quality lowres suicide, low quality lowres death, low quality lowres corpse, low quality lowres bone, low quality lowres skeleton, low quality lowres fingers over 6, low quality lowres framed, low quality lowres historical picture, low quality lowres futanari, low quality lowres shemale, low quality lowres trans gender, low quality lowres dick girl, low quality lowres flat breasts, low quality lowres degenerate ass, low quality lowres retro artstyle, low quality lowres anime screencap, low quality lowres stitched, low quality lowres pokemon, low quality lowres ryona, low quality lowres animal, low quality lowres male focus, low quality lowres nipple penetration, low quality lowres sonic (series), low quality lowres bondage, low quality lowres bdsm, low quality lowres 2D, low quality lowres 2D game, low quality lowres 2D game scene, low quality lowres 2D character, low quality lowres game cg, low quality lowres watercolor (medium), low quality lowres 2koma, low quality lowres interlocked fingers, low quality lowres gloves, low quality lowres nitroplus, low quality lowres greyscale, low quality lowres sketch, low quality lowres line drawing, low quality lowres gorilla, low quality lowres meat, low quality lowres gundam, low quality lowres multiple views, low quality lowres cut, low quality lowres concept art, low quality lowres reference sheet, low quality lowres turnaround, low quality lowres chart, low quality lowres comparison, low quality lowres artist progress, low quality lowres lineup, low quality lowres before and after, low quality lowres orc, low quality lowres tusks, low quality lowres goblin, low quality lowres kobold, low quality lowres pony, low quality lowres longbody, low quality lowres nsfw, low quality lowres owres, low quality lowres Humpbacked, low quality lowres text error, low quality lowres extra digits, low quality lowres standard quality, low quality lowres large breasts, low quality lowres shadow, low quality lowres nude, low quality lowres artist name, low quality lowres skeleton girl, low quality lowres bad legs, low quality lowres missing fngers, low quality lowres extra digt, low quality lowres wort quality, low quality lowres jpeg, low quality lowres artifacts, low quality lowres bad body, low quality lowres optical illusion, low quality lowres Glasses, low quality lowres jpegartifacts, low quality lowres girl, low quality lowres women, low quality lowres more than 1 moon, low quality lowres Multi foot, low quality lowres Multifold, low quality lowres Multi fingering, low quality lowres colored sclera, low quality lowres monster girl, low quality lowres Black hands, low quality lowres The background is incoherent, low quality lowres abnormal eye proportion, low quality lowres Abnormal hands, low quality lowres abnormal legs, low quality lowres abnormal feet abnormal fingers, low quality lowres sharp face, low quality lowres tranny, low quality lowres mutated hands, low quality lowres extra limbs, low quality lowres too many fingers, low quality lowres unclear eyes, low quality lowres bad, low quality lowres mutated hand and finger, low quality lowres malformed mutated, low quality lowres boken limb, low quality lowres incorrect limb, low quality lowres fusion finger, low quality lowres lose finger, low quality lowres multiple finger, low quality lowres multiple digit, low quality lowres fusion hand, low quality lowres lose leg, low quality lowres fused leg, low quality lowres multiple leg, low quality lowres bad cameltoe, low quality lowres colorful cameltoe, low quality lowres low polygon 3D game, extra limbs, four legs, three legs", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.65", + "AddNet Weight B 1": "0.65", + "Denoising strength": "0.2" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d9391851-77ed-43f5-2594-e3e83504b100/width=450/88421.jpeg", + "nsfw": true, + "width": 1280, + "height": 1280, + "hash": "UZK,T~}[D%S2My=yxuNtIUofxuof?HNGIojb", + "meta": { + "Size": "512x512", + "seed": 2673134841, + "steps": 20, + "prompt": "1girl, 1boy, standing, standing sex, nsfw, medium breasts, pink hair, hair bun, green eyes, pants pull", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7.5, + "resources": [ + { + "hash": "c3f63842a839", + "name": "DoggyTomu15", + "type": "lora", + "weight": null + } + ], + "Model hash": "0fc198c490", + "Hires resize": "1280x1280", + "AddNet Enabled": "True", + "AddNet Model 1": "DoggyTomu15(c3f63842a839)", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "(wrinkles:1.1),(monotone). 3D. low quality lowres multiple breasts, low quality lowres mutated hands and fingers, low quality lowres long body, low quality lowres mutation poorly drawn, low quality lowres black-white, low quality lowres bad anatomy, low quality lowres liquid body, low quality lowres liquid tongue, low quality lowres disfigured, low quality lowres malformed, low quality lowres mutated, low quality lowres anatomical nonsense, low quality lowres text font ui, low quality lowres error, low quality lowres malformed hands, low quality lowres long neck, low quality lowres blurred, low quality lowres lowers, low quality lowres low res, low quality lowres bad proportions, low quality lowres bad shadow, low quality lowres uncoordinated body, low quality lowres unnatural body, low quality lowres fused breasts, low quality lowres bad breasts, low quality lowres huge breasts, low quality lowres poorly drawn breasts, low quality lowres extra breasts, low quality lowres liquid breasts, low quality lowres heavy breasts, low quality lowres missing breasts, low quality lowres huge haunch, low quality lowres huge thighs, low quality lowres huge calf, low quality lowres bad hands, low quality lowres fused hand, low quality lowres missing hand, low quality lowres disappearing arms, low quality lowres disappearing thigh, low quality lowres disappearing calf, low quality lowres disappearing legs, low quality lowres fused ears, low quality lowres bad ears, low quality lowres poorly drawn ears, low quality lowres extra ears, low quality lowres liquid ears, low quality lowres heavy ears, low quality lowres missing ears, low quality lowres fused animal ears, low quality lowres bad animal ears, low quality lowres poorly drawn animal ears, low quality lowres extra animal ears, low quality lowres liquid animal ears, low quality lowres heavy animal ears, low quality lowres missing animal ears, low quality lowres text, low quality lowres ui, low quality lowres missing fingers, low quality lowres missing limb, low quality lowres fused fingers, low quality lowres one hand with more than 5 fingers, low quality lowres one hand with less than 5 fingers, low quality lowres one hand with more than 5 digit, low quality lowres one hand with less than 5 digit, low quality lowres extra digit, low quality lowres fewer digits, low quality lowres fused digit, low quality lowres missing digit, low quality lowres bad digit, low quality lowres liquid digit, low quality lowres colorful tongue, low quality lowres black tongue, low quality lowres cropped, low quality lowres watermark, low quality lowres username, low quality lowres blurry, low quality lowres JPEG artifacts, low quality lowres signature, low quality lowres 3D, low quality lowres 3D game, low quality lowres 3D game scene, low quality lowres 3D character, low quality lowres malformed feet, low quality lowres extra feet, low quality lowres bad feet, low quality lowres poorly drawn feet, low quality lowres fused feet, low quality lowres missing feet, low quality lowres extra shoes, low quality lowres bad shoes, low quality lowres fused shoes, low quality lowres more than two shoes, low quality lowres poorly drawn shoes, low quality lowres bad gloves, low quality lowres poorly drawn gloves, low quality lowres fused gloves, low quality lowres bad cum, low quality lowres poorly drawn cum, low quality lowres fused cum, low quality lowres bad hairs, low quality lowres poorly drawn hairs, low quality lowres fused hairs, low quality lowres big muscles, low quality lowres ugly, low quality lowres bad face, low quality lowres fused face, low quality lowres poorly drawn face, low quality lowres cloned face, low quality lowres big face, low quality lowres long face, low quality lowres bad eyes, low quality lowres fused eyes poorly drawn eyes, low quality lowres extra eyes, low quality lowres malformed limbs, low quality lowres more than 2 nipples, low quality lowres missing nipples, low quality lowres different nipples, low quality lowres fused nipples, low quality lowres bad nipples, low quality lowres poorly drawn nipples, low quality lowres black nipples, low quality lowres colorful nipples, low quality lowres gross proportions, short arm, low quality lowres missing arms, low quality lowres missing thighs, low quality lowres missing calf, low quality lowres missing legs, low quality lowres mutation, low quality lowres duplicate, low quality lowres morbid, low quality lowres mutilated, low quality lowres poorly drawn hands, low quality lowres more than 1 left hand, low quality lowres more than 1 right hand, low quality lowres deformed, low quality lowres extra arms, low quality lowres extra thighs, low quality lowres more than 2 thighs, low quality lowres extra calf, low quality lowres fused calf, low quality lowres extra legs, low quality lowres bad knee, low quality lowres extra knee, low quality lowres more than 2 legs, low quality lowres bad tails, low quality lowres bad mouth, low quality lowres fused mouth, low quality lowres poorly drawn mouth, low quality lowres bad tongue, low quality lowres tongue within mouth, low quality lowres too long tongue, low quality lowres big mouth, low quality lowres cracked mouth, low quality lowres dirty face, low quality lowres dirty teeth, low quality lowres dirty pantie, low quality lowres fused pantie, low quality lowres poorly drawn pantie, low quality lowres fused cloth, low quality lowres poorly drawn cloth, low quality lowres bad pantie, low quality lowres yellow teeth, low quality lowres thick lips, low quality lowres bad camel toe, low quality lowres colorful camel toe, low quality lowres bad asshole, low quality lowres poorly drawn asshole, low quality lowres fused asshole, low quality lowres missing asshole, low quality lowres bad anus, low quality lowres bad pussy, low quality lowres bad crotch, low quality lowres bad crotch seam, low quality lowres fused anus, low quality lowres fused pussy, low quality lowres fused crotch, low quality lowres poorly drawn crotch, low quality lowres fused seam, low quality lowres poorly drawn anus, low quality lowres poorly drawn pussy, low quality lowres poorly drawn crotch seam, low quality lowres bad thigh gap, low quality lowres missing thigh gap, low quality lowres fused thigh gap, low quality lowres liquid thigh gap, low quality lowres poorly drawn thigh gap, low quality lowres bad collarbone, low quality lowres fused collarbone, low quality lowres missing collarbone, low quality lowres liquid collarbone, low quality lowres strong girl, low quality lowres obesity, low quality lowres worst quality, low quality lowres low quality, low quality lowres normal quality, low quality lowres liquid tentacles, low quality lowres bad tentacles, low quality lowres poorly drawn tentacles, low quality lowres split tentacles, low quality lowres fused tentacles, low quality lowres missing clit, low quality lowres bad clit, low quality lowres fused clit, low quality lowres colorful clit, low quality lowres black clit, low quality lowres liquid clit, low quality lowres QR code, low quality lowres bar code, low quality lowres censored, low quality lowres safety panties, low quality lowres safety knickers, low quality lowres beard, low quality lowres furry, pony, low quality lowres pubic hair, low quality lowres mosaic, low quality lowres excrement, low quality lowres faeces, low quality lowres shit, low quality lowres futa, low quality lowres testis, low quality lowres lowres, low quality lowres terrible, low quality lowres dirty, low quality lowres feces, low quality lowres organs, low quality lowres fat, low quality lowres thick thighs, low quality lowres low resolution rough, low quality lowres pedophile, low quality lowres bestiality, low quality lowres parody, low quality lowres traditional media, low quality lowres koma, low quality lowres comic, low quality lowres scary, low quality lowres severe, low quality lowres insects, low quality lowres gross scars, low quality lowres twisted human body, low quality lowres irrational human body, low quality lowres sharp fingers, low quality lowres parts of the body out of common sense, low quality lowres murder, low quality lowres beheading, low quality lowres zombie, low quality lowres mummy, low quality lowres graffiti, low quality lowres unfinished picture, low quality lowres terrible quality, low quality lowres Coprophilia, low quality lowres muscular, low quality lowres bald, low quality lowres monk, low quality lowres wrinkly, low quality lowres simple background, low quality lowres realistic, low quality lowres old, low quality lowres scan, low quality lowres touhou, low quality lowres yaoi, low quality lowres gay, low quality lowres femboy, low quality lowres trap, low quality lowres pee, low quality lowres doujinshi, low quality lowres monochrome, low quality lowres meme, low quality lowres demon, low quality lowres monstrous creature, low quality lowres tentacle, low quality lowres self harm, low quality lowres vomit, low quality lowres suicide, low quality lowres death, low quality lowres corpse, low quality lowres bone, low quality lowres skeleton, low quality lowres fingers over 6, low quality lowres framed, low quality lowres historical picture, low quality lowres futanari, low quality lowres shemale, low quality lowres trans gender, low quality lowres dick girl, low quality lowres flat breasts, low quality lowres degenerate ass, low quality lowres retro artstyle, low quality lowres anime screencap, low quality lowres stitched, low quality lowres pokemon, low quality lowres ryona, low quality lowres animal, low quality lowres male focus, low quality lowres nipple penetration, low quality lowres sonic (series), low quality lowres bondage, low quality lowres bdsm, low quality lowres 2D, low quality lowres 2D game, low quality lowres 2D game scene, low quality lowres 2D character, low quality lowres game cg, low quality lowres watercolor (medium), low quality lowres 2koma, low quality lowres interlocked fingers, low quality lowres gloves, low quality lowres nitroplus, low quality lowres greyscale, low quality lowres sketch, low quality lowres line drawing, low quality lowres gorilla, low quality lowres meat, low quality lowres gundam, low quality lowres multiple views, low quality lowres cut, low quality lowres concept art, low quality lowres reference sheet, low quality lowres turnaround, low quality lowres chart, low quality lowres comparison, low quality lowres artist progress, low quality lowres lineup, low quality lowres before and after, low quality lowres orc, low quality lowres tusks, low quality lowres goblin, low quality lowres kobold, low quality lowres pony, low quality lowres longbody, low quality lowres nsfw, low quality lowres owres, low quality lowres Humpbacked, low quality lowres text error, low quality lowres extra digits, low quality lowres standard quality, low quality lowres large breasts, low quality lowres shadow, low quality lowres nude, low quality lowres artist name, low quality lowres skeleton girl, low quality lowres bad legs, low quality lowres missing fngers, low quality lowres extra digt, low quality lowres wort quality, low quality lowres jpeg, low quality lowres artifacts, low quality lowres bad body, low quality lowres optical illusion, low quality lowres Glasses, low quality lowres jpegartifacts, low quality lowres girl, low quality lowres women, low quality lowres more than 1 moon, low quality lowres Multi foot, low quality lowres Multifold, low quality lowres Multi fingering, low quality lowres colored sclera, low quality lowres monster girl, low quality lowres Black hands, low quality lowres The background is incoherent, low quality lowres abnormal eye proportion, low quality lowres Abnormal hands, low quality lowres abnormal legs, low quality lowres abnormal feet abnormal fingers, low quality lowres sharp face, low quality lowres tranny, low quality lowres mutated hands, low quality lowres extra limbs, low quality lowres too many fingers, low quality lowres unclear eyes, low quality lowres bad, low quality lowres mutated hand and finger, low quality lowres malformed mutated, low quality lowres boken limb, low quality lowres incorrect limb, low quality lowres fusion finger, low quality lowres lose finger, low quality lowres multiple finger, low quality lowres multiple digit, low quality lowres fusion hand, low quality lowres lose leg, low quality lowres fused leg, low quality lowres multiple leg, low quality lowres bad cameltoe, low quality lowres colorful cameltoe, low quality lowres low polygon 3D game, extra limbs, four legs, three legs", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.65", + "AddNet Weight B 1": "0.65", + "Denoising strength": "0.2" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a1f320c1-8d88-4185-0440-a09b4c698d00/width=450/88420.jpeg", + "nsfw": true, + "width": 1280, + "height": 1280, + "hash": "UANJE[;a8_%M00-.~U-=00%$%LQ-00yE9HDh", + "meta": { + "Size": "512x512", + "seed": 3260493306, + "steps": 20, + "prompt": "solo focus, 1girl, 1boy, doggystyle, white dress, nsfw, large breasts, blonde hair, long wavy hair, embarrassed, bed, panty pull, blue eyes", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7.5, + "resources": [ + { + "hash": "c3f63842a839", + "name": "DoggyTomu15", + "type": "lora", + "weight": null + } + ], + "Model hash": "0fc198c490", + "Hires resize": "1280x1280", + "AddNet Enabled": "True", + "AddNet Model 1": "DoggyTomu15(c3f63842a839)", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "(wrinkles:1.1),(monotone). 3D. low quality lowres multiple breasts, low quality lowres mutated hands and fingers, low quality lowres long body, low quality lowres mutation poorly drawn, low quality lowres black-white, low quality lowres bad anatomy, low quality lowres liquid body, low quality lowres liquid tongue, low quality lowres disfigured, low quality lowres malformed, low quality lowres mutated, low quality lowres anatomical nonsense, low quality lowres text font ui, low quality lowres error, low quality lowres malformed hands, low quality lowres long neck, low quality lowres blurred, low quality lowres lowers, low quality lowres low res, low quality lowres bad proportions, low quality lowres bad shadow, low quality lowres uncoordinated body, low quality lowres unnatural body, low quality lowres fused breasts, low quality lowres bad breasts, low quality lowres huge breasts, low quality lowres poorly drawn breasts, low quality lowres extra breasts, low quality lowres liquid breasts, low quality lowres heavy breasts, low quality lowres missing breasts, low quality lowres huge haunch, low quality lowres huge thighs, low quality lowres huge calf, low quality lowres bad hands, low quality lowres fused hand, low quality lowres missing hand, low quality lowres disappearing arms, low quality lowres disappearing thigh, low quality lowres disappearing calf, low quality lowres disappearing legs, low quality lowres fused ears, low quality lowres bad ears, low quality lowres poorly drawn ears, low quality lowres extra ears, low quality lowres liquid ears, low quality lowres heavy ears, low quality lowres missing ears, low quality lowres fused animal ears, low quality lowres bad animal ears, low quality lowres poorly drawn animal ears, low quality lowres extra animal ears, low quality lowres liquid animal ears, low quality lowres heavy animal ears, low quality lowres missing animal ears, low quality lowres text, low quality lowres ui, low quality lowres missing fingers, low quality lowres missing limb, low quality lowres fused fingers, low quality lowres one hand with more than 5 fingers, low quality lowres one hand with less than 5 fingers, low quality lowres one hand with more than 5 digit, low quality lowres one hand with less than 5 digit, low quality lowres extra digit, low quality lowres fewer digits, low quality lowres fused digit, low quality lowres missing digit, low quality lowres bad digit, low quality lowres liquid digit, low quality lowres colorful tongue, low quality lowres black tongue, low quality lowres cropped, low quality lowres watermark, low quality lowres username, low quality lowres blurry, low quality lowres JPEG artifacts, low quality lowres signature, low quality lowres 3D, low quality lowres 3D game, low quality lowres 3D game scene, low quality lowres 3D character, low quality lowres malformed feet, low quality lowres extra feet, low quality lowres bad feet, low quality lowres poorly drawn feet, low quality lowres fused feet, low quality lowres missing feet, low quality lowres extra shoes, low quality lowres bad shoes, low quality lowres fused shoes, low quality lowres more than two shoes, low quality lowres poorly drawn shoes, low quality lowres bad gloves, low quality lowres poorly drawn gloves, low quality lowres fused gloves, low quality lowres bad cum, low quality lowres poorly drawn cum, low quality lowres fused cum, low quality lowres bad hairs, low quality lowres poorly drawn hairs, low quality lowres fused hairs, low quality lowres big muscles, low quality lowres ugly, low quality lowres bad face, low quality lowres fused face, low quality lowres poorly drawn face, low quality lowres cloned face, low quality lowres big face, low quality lowres long face, low quality lowres bad eyes, low quality lowres fused eyes poorly drawn eyes, low quality lowres extra eyes, low quality lowres malformed limbs, low quality lowres more than 2 nipples, low quality lowres missing nipples, low quality lowres different nipples, low quality lowres fused nipples, low quality lowres bad nipples, low quality lowres poorly drawn nipples, low quality lowres black nipples, low quality lowres colorful nipples, low quality lowres gross proportions, short arm, low quality lowres missing arms, low quality lowres missing thighs, low quality lowres missing calf, low quality lowres missing legs, low quality lowres mutation, low quality lowres duplicate, low quality lowres morbid, low quality lowres mutilated, low quality lowres poorly drawn hands, low quality lowres more than 1 left hand, low quality lowres more than 1 right hand, low quality lowres deformed, low quality lowres extra arms, low quality lowres extra thighs, low quality lowres more than 2 thighs, low quality lowres extra calf, low quality lowres fused calf, low quality lowres extra legs, low quality lowres bad knee, low quality lowres extra knee, low quality lowres more than 2 legs, low quality lowres bad tails, low quality lowres bad mouth, low quality lowres fused mouth, low quality lowres poorly drawn mouth, low quality lowres bad tongue, low quality lowres tongue within mouth, low quality lowres too long tongue, low quality lowres big mouth, low quality lowres cracked mouth, low quality lowres dirty face, low quality lowres dirty teeth, low quality lowres dirty pantie, low quality lowres fused pantie, low quality lowres poorly drawn pantie, low quality lowres fused cloth, low quality lowres poorly drawn cloth, low quality lowres bad pantie, low quality lowres yellow teeth, low quality lowres thick lips, low quality lowres bad camel toe, low quality lowres colorful camel toe, low quality lowres bad asshole, low quality lowres poorly drawn asshole, low quality lowres fused asshole, low quality lowres missing asshole, low quality lowres bad anus, low quality lowres bad pussy, low quality lowres bad crotch, low quality lowres bad crotch seam, low quality lowres fused anus, low quality lowres fused pussy, low quality lowres fused crotch, low quality lowres poorly drawn crotch, low quality lowres fused seam, low quality lowres poorly drawn anus, low quality lowres poorly drawn pussy, low quality lowres poorly drawn crotch seam, low quality lowres bad thigh gap, low quality lowres missing thigh gap, low quality lowres fused thigh gap, low quality lowres liquid thigh gap, low quality lowres poorly drawn thigh gap, low quality lowres bad collarbone, low quality lowres fused collarbone, low quality lowres missing collarbone, low quality lowres liquid collarbone, low quality lowres strong girl, low quality lowres obesity, low quality lowres worst quality, low quality lowres low quality, low quality lowres normal quality, low quality lowres liquid tentacles, low quality lowres bad tentacles, low quality lowres poorly drawn tentacles, low quality lowres split tentacles, low quality lowres fused tentacles, low quality lowres missing clit, low quality lowres bad clit, low quality lowres fused clit, low quality lowres colorful clit, low quality lowres black clit, low quality lowres liquid clit, low quality lowres QR code, low quality lowres bar code, low quality lowres censored, low quality lowres safety panties, low quality lowres safety knickers, low quality lowres beard, low quality lowres furry, pony, low quality lowres pubic hair, low quality lowres mosaic, low quality lowres excrement, low quality lowres faeces, low quality lowres shit, low quality lowres futa, low quality lowres testis, low quality lowres lowres, low quality lowres terrible, low quality lowres dirty, low quality lowres feces, low quality lowres organs, low quality lowres fat, low quality lowres thick thighs, low quality lowres low resolution rough, low quality lowres pedophile, low quality lowres bestiality, low quality lowres parody, low quality lowres traditional media, low quality lowres koma, low quality lowres comic, low quality lowres scary, low quality lowres severe, low quality lowres insects, low quality lowres gross scars, low quality lowres twisted human body, low quality lowres irrational human body, low quality lowres sharp fingers, low quality lowres parts of the body out of common sense, low quality lowres murder, low quality lowres beheading, low quality lowres zombie, low quality lowres mummy, low quality lowres graffiti, low quality lowres unfinished picture, low quality lowres terrible quality, low quality lowres Coprophilia, low quality lowres muscular, low quality lowres bald, low quality lowres monk, low quality lowres wrinkly, low quality lowres simple background, low quality lowres realistic, low quality lowres old, low quality lowres scan, low quality lowres touhou, low quality lowres yaoi, low quality lowres gay, low quality lowres femboy, low quality lowres trap, low quality lowres pee, low quality lowres doujinshi, low quality lowres monochrome, low quality lowres meme, low quality lowres demon, low quality lowres monstrous creature, low quality lowres tentacle, low quality lowres self harm, low quality lowres vomit, low quality lowres suicide, low quality lowres death, low quality lowres corpse, low quality lowres bone, low quality lowres skeleton, low quality lowres fingers over 6, low quality lowres framed, low quality lowres historical picture, low quality lowres futanari, low quality lowres shemale, low quality lowres trans gender, low quality lowres dick girl, low quality lowres flat breasts, low quality lowres degenerate ass, low quality lowres retro artstyle, low quality lowres anime screencap, low quality lowres stitched, low quality lowres pokemon, low quality lowres ryona, low quality lowres animal, low quality lowres male focus, low quality lowres nipple penetration, low quality lowres sonic (series), low quality lowres bondage, low quality lowres bdsm, low quality lowres 2D, low quality lowres 2D game, low quality lowres 2D game scene, low quality lowres 2D character, low quality lowres game cg, low quality lowres watercolor (medium), low quality lowres 2koma, low quality lowres interlocked fingers, low quality lowres gloves, low quality lowres nitroplus, low quality lowres greyscale, low quality lowres sketch, low quality lowres line drawing, low quality lowres gorilla, low quality lowres meat, low quality lowres gundam, low quality lowres multiple views, low quality lowres cut, low quality lowres concept art, low quality lowres reference sheet, low quality lowres turnaround, low quality lowres chart, low quality lowres comparison, low quality lowres artist progress, low quality lowres lineup, low quality lowres before and after, low quality lowres orc, low quality lowres tusks, low quality lowres goblin, low quality lowres kobold, low quality lowres pony, low quality lowres longbody, low quality lowres nsfw, low quality lowres owres, low quality lowres Humpbacked, low quality lowres text error, low quality lowres extra digits, low quality lowres standard quality, low quality lowres large breasts, low quality lowres shadow, low quality lowres nude, low quality lowres artist name, low quality lowres skeleton girl, low quality lowres bad legs, low quality lowres missing fngers, low quality lowres extra digt, low quality lowres wort quality, low quality lowres jpeg, low quality lowres artifacts, low quality lowres bad body, low quality lowres optical illusion, low quality lowres Glasses, low quality lowres jpegartifacts, low quality lowres girl, low quality lowres women, low quality lowres more than 1 moon, low quality lowres Multi foot, low quality lowres Multifold, low quality lowres Multi fingering, low quality lowres colored sclera, low quality lowres monster girl, low quality lowres Black hands, low quality lowres The background is incoherent, low quality lowres abnormal eye proportion, low quality lowres Abnormal hands, low quality lowres abnormal legs, low quality lowres abnormal feet abnormal fingers, low quality lowres sharp face, low quality lowres tranny, low quality lowres mutated hands, low quality lowres extra limbs, low quality lowres too many fingers, low quality lowres unclear eyes, low quality lowres bad, low quality lowres mutated hand and finger, low quality lowres malformed mutated, low quality lowres boken limb, low quality lowres incorrect limb, low quality lowres fusion finger, low quality lowres lose finger, low quality lowres multiple finger, low quality lowres multiple digit, low quality lowres fusion hand, low quality lowres lose leg, low quality lowres fused leg, low quality lowres multiple leg, low quality lowres bad cameltoe, low quality lowres colorful cameltoe, low quality lowres low polygon 3D game, extra limbs, four legs, three legs", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.5", + "AddNet Weight B 1": "0.5", + "Denoising strength": "0.2" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/fe7cc67e-0fe8-4bb2-9aa4-2f6b888a0700/width=450/88419.jpeg", + "nsfw": true, + "width": 1280, + "height": 1280, + "hash": "UNLy=$0055~VD5FcOsv#0eE2oLsC.8$fMxtl", + "meta": { + "Size": "512x512", + "seed": 3768648674, + "steps": 20, + "prompt": "solo focus, 1girl, 1boy, all fours, doggystyle, sex, gym uniform, nsfw, small breasts, pink hair, long wavy hair, grey eyes, pants pull, embarrassed,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7.5, + "resources": [ + { + "hash": "c3f63842a839", + "name": "DoggyTomu15", + "type": "lora", + "weight": null + } + ], + "Model hash": "0fc198c490", + "Hires resize": "1280x1280", + "AddNet Enabled": "True", + "AddNet Model 1": "DoggyTomu15(c3f63842a839)", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "(wrinkles:1.1),(monotone). 3D. low quality lowres multiple breasts, low quality lowres mutated hands and fingers, low quality lowres long body, low quality lowres mutation poorly drawn, low quality lowres black-white, low quality lowres bad anatomy, low quality lowres liquid body, low quality lowres liquid tongue, low quality lowres disfigured, low quality lowres malformed, low quality lowres mutated, low quality lowres anatomical nonsense, low quality lowres text font ui, low quality lowres error, low quality lowres malformed hands, low quality lowres long neck, low quality lowres blurred, low quality lowres lowers, low quality lowres low res, low quality lowres bad proportions, low quality lowres bad shadow, low quality lowres uncoordinated body, low quality lowres unnatural body, low quality lowres fused breasts, low quality lowres bad breasts, low quality lowres huge breasts, low quality lowres poorly drawn breasts, low quality lowres extra breasts, low quality lowres liquid breasts, low quality lowres heavy breasts, low quality lowres missing breasts, low quality lowres huge haunch, low quality lowres huge thighs, low quality lowres huge calf, low quality lowres bad hands, low quality lowres fused hand, low quality lowres missing hand, low quality lowres disappearing arms, low quality lowres disappearing thigh, low quality lowres disappearing calf, low quality lowres disappearing legs, low quality lowres fused ears, low quality lowres bad ears, low quality lowres poorly drawn ears, low quality lowres extra ears, low quality lowres liquid ears, low quality lowres heavy ears, low quality lowres missing ears, low quality lowres fused animal ears, low quality lowres bad animal ears, low quality lowres poorly drawn animal ears, low quality lowres extra animal ears, low quality lowres liquid animal ears, low quality lowres heavy animal ears, low quality lowres missing animal ears, low quality lowres text, low quality lowres ui, low quality lowres missing fingers, low quality lowres missing limb, low quality lowres fused fingers, low quality lowres one hand with more than 5 fingers, low quality lowres one hand with less than 5 fingers, low quality lowres one hand with more than 5 digit, low quality lowres one hand with less than 5 digit, low quality lowres extra digit, low quality lowres fewer digits, low quality lowres fused digit, low quality lowres missing digit, low quality lowres bad digit, low quality lowres liquid digit, low quality lowres colorful tongue, low quality lowres black tongue, low quality lowres cropped, low quality lowres watermark, low quality lowres username, low quality lowres blurry, low quality lowres JPEG artifacts, low quality lowres signature, low quality lowres 3D, low quality lowres 3D game, low quality lowres 3D game scene, low quality lowres 3D character, low quality lowres malformed feet, low quality lowres extra feet, low quality lowres bad feet, low quality lowres poorly drawn feet, low quality lowres fused feet, low quality lowres missing feet, low quality lowres extra shoes, low quality lowres bad shoes, low quality lowres fused shoes, low quality lowres more than two shoes, low quality lowres poorly drawn shoes, low quality lowres bad gloves, low quality lowres poorly drawn gloves, low quality lowres fused gloves, low quality lowres bad cum, low quality lowres poorly drawn cum, low quality lowres fused cum, low quality lowres bad hairs, low quality lowres poorly drawn hairs, low quality lowres fused hairs, low quality lowres big muscles, low quality lowres ugly, low quality lowres bad face, low quality lowres fused face, low quality lowres poorly drawn face, low quality lowres cloned face, low quality lowres big face, low quality lowres long face, low quality lowres bad eyes, low quality lowres fused eyes poorly drawn eyes, low quality lowres extra eyes, low quality lowres malformed limbs, low quality lowres more than 2 nipples, low quality lowres missing nipples, low quality lowres different nipples, low quality lowres fused nipples, low quality lowres bad nipples, low quality lowres poorly drawn nipples, low quality lowres black nipples, low quality lowres colorful nipples, low quality lowres gross proportions, short arm, low quality lowres missing arms, low quality lowres missing thighs, low quality lowres missing calf, low quality lowres missing legs, low quality lowres mutation, low quality lowres duplicate, low quality lowres morbid, low quality lowres mutilated, low quality lowres poorly drawn hands, low quality lowres more than 1 left hand, low quality lowres more than 1 right hand, low quality lowres deformed, low quality lowres extra arms, low quality lowres extra thighs, low quality lowres more than 2 thighs, low quality lowres extra calf, low quality lowres fused calf, low quality lowres extra legs, low quality lowres bad knee, low quality lowres extra knee, low quality lowres more than 2 legs, low quality lowres bad tails, low quality lowres bad mouth, low quality lowres fused mouth, low quality lowres poorly drawn mouth, low quality lowres bad tongue, low quality lowres tongue within mouth, low quality lowres too long tongue, low quality lowres big mouth, low quality lowres cracked mouth, low quality lowres dirty face, low quality lowres dirty teeth, low quality lowres dirty pantie, low quality lowres fused pantie, low quality lowres poorly drawn pantie, low quality lowres fused cloth, low quality lowres poorly drawn cloth, low quality lowres bad pantie, low quality lowres yellow teeth, low quality lowres thick lips, low quality lowres bad camel toe, low quality lowres colorful camel toe, low quality lowres bad asshole, low quality lowres poorly drawn asshole, low quality lowres fused asshole, low quality lowres missing asshole, low quality lowres bad anus, low quality lowres bad pussy, low quality lowres bad crotch, low quality lowres bad crotch seam, low quality lowres fused anus, low quality lowres fused pussy, low quality lowres fused crotch, low quality lowres poorly drawn crotch, low quality lowres fused seam, low quality lowres poorly drawn anus, low quality lowres poorly drawn pussy, low quality lowres poorly drawn crotch seam, low quality lowres bad thigh gap, low quality lowres missing thigh gap, low quality lowres fused thigh gap, low quality lowres liquid thigh gap, low quality lowres poorly drawn thigh gap, low quality lowres bad collarbone, low quality lowres fused collarbone, low quality lowres missing collarbone, low quality lowres liquid collarbone, low quality lowres strong girl, low quality lowres obesity, low quality lowres worst quality, low quality lowres low quality, low quality lowres normal quality, low quality lowres liquid tentacles, low quality lowres bad tentacles, low quality lowres poorly drawn tentacles, low quality lowres split tentacles, low quality lowres fused tentacles, low quality lowres missing clit, low quality lowres bad clit, low quality lowres fused clit, low quality lowres colorful clit, low quality lowres black clit, low quality lowres liquid clit, low quality lowres QR code, low quality lowres bar code, low quality lowres censored, low quality lowres safety panties, low quality lowres safety knickers, low quality lowres beard, low quality lowres furry, pony, low quality lowres pubic hair, low quality lowres mosaic, low quality lowres excrement, low quality lowres faeces, low quality lowres shit, low quality lowres futa, low quality lowres testis, low quality lowres lowres, low quality lowres terrible, low quality lowres dirty, low quality lowres feces, low quality lowres organs, low quality lowres fat, low quality lowres thick thighs, low quality lowres low resolution rough, low quality lowres pedophile, low quality lowres bestiality, low quality lowres parody, low quality lowres traditional media, low quality lowres koma, low quality lowres comic, low quality lowres scary, low quality lowres severe, low quality lowres insects, low quality lowres gross scars, low quality lowres twisted human body, low quality lowres irrational human body, low quality lowres sharp fingers, low quality lowres parts of the body out of common sense, low quality lowres murder, low quality lowres beheading, low quality lowres zombie, low quality lowres mummy, low quality lowres graffiti, low quality lowres unfinished picture, low quality lowres terrible quality, low quality lowres Coprophilia, low quality lowres muscular, low quality lowres bald, low quality lowres monk, low quality lowres wrinkly, low quality lowres simple background, low quality lowres realistic, low quality lowres old, low quality lowres scan, low quality lowres touhou, low quality lowres yaoi, low quality lowres gay, low quality lowres femboy, low quality lowres trap, low quality lowres pee, low quality lowres doujinshi, low quality lowres monochrome, low quality lowres meme, low quality lowres demon, low quality lowres monstrous creature, low quality lowres tentacle, low quality lowres self harm, low quality lowres vomit, low quality lowres suicide, low quality lowres death, low quality lowres corpse, low quality lowres bone, low quality lowres skeleton, low quality lowres fingers over 6, low quality lowres framed, low quality lowres historical picture, low quality lowres futanari, low quality lowres shemale, low quality lowres trans gender, low quality lowres dick girl, low quality lowres flat breasts, low quality lowres degenerate ass, low quality lowres retro artstyle, low quality lowres anime screencap, low quality lowres stitched, low quality lowres pokemon, low quality lowres ryona, low quality lowres animal, low quality lowres male focus, low quality lowres nipple penetration, low quality lowres sonic (series), low quality lowres bondage, low quality lowres bdsm, low quality lowres 2D, low quality lowres 2D game, low quality lowres 2D game scene, low quality lowres 2D character, low quality lowres game cg, low quality lowres watercolor (medium), low quality lowres 2koma, low quality lowres interlocked fingers, low quality lowres gloves, low quality lowres nitroplus, low quality lowres greyscale, low quality lowres sketch, low quality lowres line drawing, low quality lowres gorilla, low quality lowres meat, low quality lowres gundam, low quality lowres multiple views, low quality lowres cut, low quality lowres concept art, low quality lowres reference sheet, low quality lowres turnaround, low quality lowres chart, low quality lowres comparison, low quality lowres artist progress, low quality lowres lineup, low quality lowres before and after, low quality lowres orc, low quality lowres tusks, low quality lowres goblin, low quality lowres kobold, low quality lowres pony, low quality lowres longbody, low quality lowres nsfw, low quality lowres owres, low quality lowres Humpbacked, low quality lowres text error, low quality lowres extra digits, low quality lowres standard quality, low quality lowres large breasts, low quality lowres shadow, low quality lowres nude, low quality lowres artist name, low quality lowres skeleton girl, low quality lowres bad legs, low quality lowres missing fngers, low quality lowres extra digt, low quality lowres wort quality, low quality lowres jpeg, low quality lowres artifacts, low quality lowres bad body, low quality lowres optical illusion, low quality lowres Glasses, low quality lowres jpegartifacts, low quality lowres girl, low quality lowres women, low quality lowres more than 1 moon, low quality lowres Multi foot, low quality lowres Multifold, low quality lowres Multi fingering, low quality lowres colored sclera, low quality lowres monster girl, low quality lowres Black hands, low quality lowres The background is incoherent, low quality lowres abnormal eye proportion, low quality lowres Abnormal hands, low quality lowres abnormal legs, low quality lowres abnormal feet abnormal fingers, low quality lowres sharp face, low quality lowres tranny, low quality lowres mutated hands, low quality lowres extra limbs, low quality lowres too many fingers, low quality lowres unclear eyes, low quality lowres bad, low quality lowres mutated hand and finger, low quality lowres malformed mutated, low quality lowres boken limb, low quality lowres incorrect limb, low quality lowres fusion finger, low quality lowres lose finger, low quality lowres multiple finger, low quality lowres multiple digit, low quality lowres fusion hand, low quality lowres lose leg, low quality lowres fused leg, low quality lowres multiple leg, low quality lowres bad cameltoe, low quality lowres colorful cameltoe, low quality lowres low polygon 3D game, extra limbs, four legs, three legs", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.5", + "AddNet Weight B 1": "0.5", + "Denoising strength": "0.2" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e53d9415-6efa-4844-1bd3-27237647aa00/width=450/88418.jpeg", + "nsfw": true, + "width": 1280, + "height": 1280, + "hash": "UKJ@OMHr-ox^~WH?oz-:M_w[WXt8EiNuS2S5", + "meta": { + "Size": "512x512", + "seed": 1022750881, + "steps": 20, + "prompt": "1girl, 1boy, doggystyle, standing, standing sex, embarrassed, hetero, solo focus, nsfw, maid outfit, torso grab, office background", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7.5, + "resources": [ + { + "hash": "7649e937ff94", + "name": "000002", + "type": "lora", + "weight": null + } + ], + "Model hash": "0fc198c490", + "Hires resize": "1280x1280", + "AddNet Enabled": "True", + "AddNet Model 1": "DoggyTomu13-000002(7649e937ff94)", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "(wrinkles:1.1),(monotone). 3D. low quality lowres multiple breasts, low quality lowres mutated hands and fingers, low quality lowres long body, low quality lowres mutation poorly drawn, low quality lowres black-white, low quality lowres bad anatomy, low quality lowres liquid body, low quality lowres liquid tongue, low quality lowres disfigured, low quality lowres malformed, low quality lowres mutated, low quality lowres anatomical nonsense, low quality lowres text font ui, low quality lowres error, low quality lowres malformed hands, low quality lowres long neck, low quality lowres blurred, low quality lowres lowers, low quality lowres low res, low quality lowres bad proportions, low quality lowres bad shadow, low quality lowres uncoordinated body, low quality lowres unnatural body, low quality lowres fused breasts, low quality lowres bad breasts, low quality lowres huge breasts, low quality lowres poorly drawn breasts, low quality lowres extra breasts, low quality lowres liquid breasts, low quality lowres heavy breasts, low quality lowres missing breasts, low quality lowres huge haunch, low quality lowres huge thighs, low quality lowres huge calf, low quality lowres bad hands, low quality lowres fused hand, low quality lowres missing hand, low quality lowres disappearing arms, low quality lowres disappearing thigh, low quality lowres disappearing calf, low quality lowres disappearing legs, low quality lowres fused ears, low quality lowres bad ears, low quality lowres poorly drawn ears, low quality lowres extra ears, low quality lowres liquid ears, low quality lowres heavy ears, low quality lowres missing ears, low quality lowres fused animal ears, low quality lowres bad animal ears, low quality lowres poorly drawn animal ears, low quality lowres extra animal ears, low quality lowres liquid animal ears, low quality lowres heavy animal ears, low quality lowres missing animal ears, low quality lowres text, low quality lowres ui, low quality lowres missing fingers, low quality lowres missing limb, low quality lowres fused fingers, low quality lowres one hand with more than 5 fingers, low quality lowres one hand with less than 5 fingers, low quality lowres one hand with more than 5 digit, low quality lowres one hand with less than 5 digit, low quality lowres extra digit, low quality lowres fewer digits, low quality lowres fused digit, low quality lowres missing digit, low quality lowres bad digit, low quality lowres liquid digit, low quality lowres colorful tongue, low quality lowres black tongue, low quality lowres cropped, low quality lowres watermark, low quality lowres username, low quality lowres blurry, low quality lowres JPEG artifacts, low quality lowres signature, low quality lowres 3D, low quality lowres 3D game, low quality lowres 3D game scene, low quality lowres 3D character, low quality lowres malformed feet, low quality lowres extra feet, low quality lowres bad feet, low quality lowres poorly drawn feet, low quality lowres fused feet, low quality lowres missing feet, low quality lowres extra shoes, low quality lowres bad shoes, low quality lowres fused shoes, low quality lowres more than two shoes, low quality lowres poorly drawn shoes, low quality lowres bad gloves, low quality lowres poorly drawn gloves, low quality lowres fused gloves, low quality lowres bad cum, low quality lowres poorly drawn cum, low quality lowres fused cum, low quality lowres bad hairs, low quality lowres poorly drawn hairs, low quality lowres fused hairs, low quality lowres big muscles, low quality lowres ugly, low quality lowres bad face, low quality lowres fused face, low quality lowres poorly drawn face, low quality lowres cloned face, low quality lowres big face, low quality lowres long face, low quality lowres bad eyes, low quality lowres fused eyes poorly drawn eyes, low quality lowres extra eyes, low quality lowres malformed limbs, low quality lowres more than 2 nipples, low quality lowres missing nipples, low quality lowres different nipples, low quality lowres fused nipples, low quality lowres bad nipples, low quality lowres poorly drawn nipples, low quality lowres black nipples, low quality lowres colorful nipples, low quality lowres gross proportions, short arm, low quality lowres missing arms, low quality lowres missing thighs, low quality lowres missing calf, low quality lowres missing legs, low quality lowres mutation, low quality lowres duplicate, low quality lowres morbid, low quality lowres mutilated, low quality lowres poorly drawn hands, low quality lowres more than 1 left hand, low quality lowres more than 1 right hand, low quality lowres deformed, low quality lowres extra arms, low quality lowres extra thighs, low quality lowres more than 2 thighs, low quality lowres extra calf, low quality lowres fused calf, low quality lowres extra legs, low quality lowres bad knee, low quality lowres extra knee, low quality lowres more than 2 legs, low quality lowres bad tails, low quality lowres bad mouth, low quality lowres fused mouth, low quality lowres poorly drawn mouth, low quality lowres bad tongue, low quality lowres tongue within mouth, low quality lowres too long tongue, low quality lowres big mouth, low quality lowres cracked mouth, low quality lowres dirty face, low quality lowres dirty teeth, low quality lowres dirty pantie, low quality lowres fused pantie, low quality lowres poorly drawn pantie, low quality lowres fused cloth, low quality lowres poorly drawn cloth, low quality lowres bad pantie, low quality lowres yellow teeth, low quality lowres thick lips, low quality lowres bad camel toe, low quality lowres colorful camel toe, low quality lowres bad asshole, low quality lowres poorly drawn asshole, low quality lowres fused asshole, low quality lowres missing asshole, low quality lowres bad anus, low quality lowres bad pussy, low quality lowres bad crotch, low quality lowres bad crotch seam, low quality lowres fused anus, low quality lowres fused pussy, low quality lowres fused crotch, low quality lowres poorly drawn crotch, low quality lowres fused seam, low quality lowres poorly drawn anus, low quality lowres poorly drawn pussy, low quality lowres poorly drawn crotch seam, low quality lowres bad thigh gap, low quality lowres missing thigh gap, low quality lowres fused thigh gap, low quality lowres liquid thigh gap, low quality lowres poorly drawn thigh gap, low quality lowres bad collarbone, low quality lowres fused collarbone, low quality lowres missing collarbone, low quality lowres liquid collarbone, low quality lowres strong girl, low quality lowres obesity, low quality lowres worst quality, low quality lowres low quality, low quality lowres normal quality, low quality lowres liquid tentacles, low quality lowres bad tentacles, low quality lowres poorly drawn tentacles, low quality lowres split tentacles, low quality lowres fused tentacles, low quality lowres missing clit, low quality lowres bad clit, low quality lowres fused clit, low quality lowres colorful clit, low quality lowres black clit, low quality lowres liquid clit, low quality lowres QR code, low quality lowres bar code, low quality lowres censored, low quality lowres safety panties, low quality lowres safety knickers, low quality lowres beard, low quality lowres furry, pony, low quality lowres pubic hair, low quality lowres mosaic, low quality lowres excrement, low quality lowres faeces, low quality lowres shit, low quality lowres futa, low quality lowres testis, low quality lowres lowres, low quality lowres terrible, low quality lowres dirty, low quality lowres feces, low quality lowres organs, low quality lowres fat, low quality lowres thick thighs, low quality lowres low resolution rough, low quality lowres pedophile, low quality lowres bestiality, low quality lowres parody, low quality lowres traditional media, low quality lowres koma, low quality lowres comic, low quality lowres scary, low quality lowres severe, low quality lowres insects, low quality lowres gross scars, low quality lowres twisted human body, low quality lowres irrational human body, low quality lowres sharp fingers, low quality lowres parts of the body out of common sense, low quality lowres murder, low quality lowres beheading, low quality lowres zombie, low quality lowres mummy, low quality lowres graffiti, low quality lowres unfinished picture, low quality lowres terrible quality, low quality lowres Coprophilia, low quality lowres muscular, low quality lowres bald, low quality lowres monk, low quality lowres wrinkly, low quality lowres simple background, low quality lowres realistic, low quality lowres old, low quality lowres scan, low quality lowres touhou, low quality lowres yaoi, low quality lowres gay, low quality lowres femboy, low quality lowres trap, low quality lowres pee, low quality lowres doujinshi, low quality lowres monochrome, low quality lowres meme, low quality lowres demon, low quality lowres monstrous creature, low quality lowres tentacle, low quality lowres self harm, low quality lowres vomit, low quality lowres suicide, low quality lowres death, low quality lowres corpse, low quality lowres bone, low quality lowres skeleton, low quality lowres fingers over 6, low quality lowres framed, low quality lowres historical picture, low quality lowres futanari, low quality lowres shemale, low quality lowres trans gender, low quality lowres dick girl, low quality lowres flat breasts, low quality lowres degenerate ass, low quality lowres retro artstyle, low quality lowres anime screencap, low quality lowres stitched, low quality lowres pokemon, low quality lowres ryona, low quality lowres animal, low quality lowres male focus, low quality lowres nipple penetration, low quality lowres sonic (series), low quality lowres bondage, low quality lowres bdsm, low quality lowres 2D, low quality lowres 2D game, low quality lowres 2D game scene, low quality lowres 2D character, low quality lowres game cg, low quality lowres watercolor (medium), low quality lowres 2koma, low quality lowres interlocked fingers, low quality lowres gloves, low quality lowres nitroplus, low quality lowres greyscale, low quality lowres sketch, low quality lowres line drawing, low quality lowres gorilla, low quality lowres meat, low quality lowres gundam, low quality lowres multiple views, low quality lowres cut, low quality lowres concept art, low quality lowres reference sheet, low quality lowres turnaround, low quality lowres chart, low quality lowres comparison, low quality lowres artist progress, low quality lowres lineup, low quality lowres before and after, low quality lowres orc, low quality lowres tusks, low quality lowres goblin, low quality lowres kobold, low quality lowres pony, low quality lowres longbody, low quality lowres nsfw, low quality lowres owres, low quality lowres Humpbacked, low quality lowres text error, low quality lowres extra digits, low quality lowres standard quality, low quality lowres large breasts, low quality lowres shadow, low quality lowres nude, low quality lowres artist name, low quality lowres skeleton girl, low quality lowres bad legs, low quality lowres missing fngers, low quality lowres extra digt, low quality lowres wort quality, low quality lowres jpeg, low quality lowres artifacts, low quality lowres bad body, low quality lowres optical illusion, low quality lowres Glasses, low quality lowres jpegartifacts, low quality lowres girl, low quality lowres women, low quality lowres more than 1 moon, low quality lowres Multi foot, low quality lowres Multifold, low quality lowres Multi fingering, low quality lowres colored sclera, low quality lowres monster girl, low quality lowres Black hands, low quality lowres The background is incoherent, low quality lowres abnormal eye proportion, low quality lowres Abnormal hands, low quality lowres abnormal legs, low quality lowres abnormal feet abnormal fingers, low quality lowres sharp face, low quality lowres tranny, low quality lowres mutated hands, low quality lowres extra limbs, low quality lowres too many fingers, low quality lowres unclear eyes, low quality lowres bad, low quality lowres mutated hand and finger, low quality lowres malformed mutated, low quality lowres boken limb, low quality lowres incorrect limb, low quality lowres fusion finger, low quality lowres lose finger, low quality lowres multiple finger, low quality lowres multiple digit, low quality lowres fusion hand, low quality lowres lose leg, low quality lowres fused leg, low quality lowres multiple leg, low quality lowres bad cameltoe, low quality lowres colorful cameltoe, low quality lowres low polygon 3D game, extra limbs, four legs, three legs", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.7", + "AddNet Weight B 1": "0.7", + "Denoising strength": "0.2" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/fbfcc940-a382-4deb-8281-039ee5484000/width=450/88417.jpeg", + "nsfw": false, + "width": 1280, + "height": 1280, + "hash": "UBI|E=~p0zACQ.kWIpE19[kW={Q-}[RQR%o}", + "meta": { + "Size": "512x512", + "seed": 263202342, + "steps": 20, + "prompt": "standing, 1girl, 1boy, doggystyle, chinese dress,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7.5, + "resources": [ + { + "hash": "06fc2b9a6dfd", + "name": "DoggyTomu9", + "type": "lora", + "weight": null + } + ], + "Model hash": "0fc198c490", + "Hires resize": "1280x1280", + "AddNet Enabled": "True", + "AddNet Model 1": "DoggyTomu9(06fc2b9a6dfd)", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "(wrinkles:1.1),(monotone). 3D. low quality lowres multiple breasts, low quality lowres mutated hands and fingers, low quality lowres long body, low quality lowres mutation poorly drawn, low quality lowres black-white, low quality lowres bad anatomy, low quality lowres liquid body, low quality lowres liquid tongue, low quality lowres disfigured, low quality lowres malformed, low quality lowres mutated, low quality lowres anatomical nonsense, low quality lowres text font ui, low quality lowres error, low quality lowres malformed hands, low quality lowres long neck, low quality lowres blurred, low quality lowres lowers, low quality lowres low res, low quality lowres bad proportions, low quality lowres bad shadow, low quality lowres uncoordinated body, low quality lowres unnatural body, low quality lowres fused breasts, low quality lowres bad breasts, low quality lowres huge breasts, low quality lowres poorly drawn breasts, low quality lowres extra breasts, low quality lowres liquid breasts, low quality lowres heavy breasts, low quality lowres missing breasts, low quality lowres huge haunch, low quality lowres huge thighs, low quality lowres huge calf, low quality lowres bad hands, low quality lowres fused hand, low quality lowres missing hand, low quality lowres disappearing arms, low quality lowres disappearing thigh, low quality lowres disappearing calf, low quality lowres disappearing legs, low quality lowres fused ears, low quality lowres bad ears, low quality lowres poorly drawn ears, low quality lowres extra ears, low quality lowres liquid ears, low quality lowres heavy ears, low quality lowres missing ears, low quality lowres fused animal ears, low quality lowres bad animal ears, low quality lowres poorly drawn animal ears, low quality lowres extra animal ears, low quality lowres liquid animal ears, low quality lowres heavy animal ears, low quality lowres missing animal ears, low quality lowres text, low quality lowres ui, low quality lowres missing fingers, low quality lowres missing limb, low quality lowres fused fingers, low quality lowres one hand with more than 5 fingers, low quality lowres one hand with less than 5 fingers, low quality lowres one hand with more than 5 digit, low quality lowres one hand with less than 5 digit, low quality lowres extra digit, low quality lowres fewer digits, low quality lowres fused digit, low quality lowres missing digit, low quality lowres bad digit, low quality lowres liquid digit, low quality lowres colorful tongue, low quality lowres black tongue, low quality lowres cropped, low quality lowres watermark, low quality lowres username, low quality lowres blurry, low quality lowres JPEG artifacts, low quality lowres signature, low quality lowres 3D, low quality lowres 3D game, low quality lowres 3D game scene, low quality lowres 3D character, low quality lowres malformed feet, low quality lowres extra feet, low quality lowres bad feet, low quality lowres poorly drawn feet, low quality lowres fused feet, low quality lowres missing feet, low quality lowres extra shoes, low quality lowres bad shoes, low quality lowres fused shoes, low quality lowres more than two shoes, low quality lowres poorly drawn shoes, low quality lowres bad gloves, low quality lowres poorly drawn gloves, low quality lowres fused gloves, low quality lowres bad cum, low quality lowres poorly drawn cum, low quality lowres fused cum, low quality lowres bad hairs, low quality lowres poorly drawn hairs, low quality lowres fused hairs, low quality lowres big muscles, low quality lowres ugly, low quality lowres bad face, low quality lowres fused face, low quality lowres poorly drawn face, low quality lowres cloned face, low quality lowres big face, low quality lowres long face, low quality lowres bad eyes, low quality lowres fused eyes poorly drawn eyes, low quality lowres extra eyes, low quality lowres malformed limbs, low quality lowres more than 2 nipples, low quality lowres missing nipples, low quality lowres different nipples, low quality lowres fused nipples, low quality lowres bad nipples, low quality lowres poorly drawn nipples, low quality lowres black nipples, low quality lowres colorful nipples, low quality lowres gross proportions, short arm, low quality lowres missing arms, low quality lowres missing thighs, low quality lowres missing calf, low quality lowres missing legs, low quality lowres mutation, low quality lowres duplicate, low quality lowres morbid, low quality lowres mutilated, low quality lowres poorly drawn hands, low quality lowres more than 1 left hand, low quality lowres more than 1 right hand, low quality lowres deformed, low quality lowres extra arms, low quality lowres extra thighs, low quality lowres more than 2 thighs, low quality lowres extra calf, low quality lowres fused calf, low quality lowres extra legs, low quality lowres bad knee, low quality lowres extra knee, low quality lowres more than 2 legs, low quality lowres bad tails, low quality lowres bad mouth, low quality lowres fused mouth, low quality lowres poorly drawn mouth, low quality lowres bad tongue, low quality lowres tongue within mouth, low quality lowres too long tongue, low quality lowres big mouth, low quality lowres cracked mouth, low quality lowres dirty face, low quality lowres dirty teeth, low quality lowres dirty pantie, low quality lowres fused pantie, low quality lowres poorly drawn pantie, low quality lowres fused cloth, low quality lowres poorly drawn cloth, low quality lowres bad pantie, low quality lowres yellow teeth, low quality lowres thick lips, low quality lowres bad camel toe, low quality lowres colorful camel toe, low quality lowres bad asshole, low quality lowres poorly drawn asshole, low quality lowres fused asshole, low quality lowres missing asshole, low quality lowres bad anus, low quality lowres bad pussy, low quality lowres bad crotch, low quality lowres bad crotch seam, low quality lowres fused anus, low quality lowres fused pussy, low quality lowres fused crotch, low quality lowres poorly drawn crotch, low quality lowres fused seam, low quality lowres poorly drawn anus, low quality lowres poorly drawn pussy, low quality lowres poorly drawn crotch seam, low quality lowres bad thigh gap, low quality lowres missing thigh gap, low quality lowres fused thigh gap, low quality lowres liquid thigh gap, low quality lowres poorly drawn thigh gap, low quality lowres bad collarbone, low quality lowres fused collarbone, low quality lowres missing collarbone, low quality lowres liquid collarbone, low quality lowres strong girl, low quality lowres obesity, low quality lowres worst quality, low quality lowres low quality, low quality lowres normal quality, low quality lowres liquid tentacles, low quality lowres bad tentacles, low quality lowres poorly drawn tentacles, low quality lowres split tentacles, low quality lowres fused tentacles, low quality lowres missing clit, low quality lowres bad clit, low quality lowres fused clit, low quality lowres colorful clit, low quality lowres black clit, low quality lowres liquid clit, low quality lowres QR code, low quality lowres bar code, low quality lowres censored, low quality lowres safety panties, low quality lowres safety knickers, low quality lowres beard, low quality lowres furry, pony, low quality lowres pubic hair, low quality lowres mosaic, low quality lowres excrement, low quality lowres faeces, low quality lowres shit, low quality lowres futa, low quality lowres testis, low quality lowres lowres, low quality lowres terrible, low quality lowres dirty, low quality lowres feces, low quality lowres organs, low quality lowres fat, low quality lowres thick thighs, low quality lowres low resolution rough, low quality lowres pedophile, low quality lowres bestiality, low quality lowres parody, low quality lowres traditional media, low quality lowres koma, low quality lowres comic, low quality lowres scary, low quality lowres severe, low quality lowres insects, low quality lowres gross scars, low quality lowres twisted human body, low quality lowres irrational human body, low quality lowres sharp fingers, low quality lowres parts of the body out of common sense, low quality lowres murder, low quality lowres beheading, low quality lowres zombie, low quality lowres mummy, low quality lowres graffiti, low quality lowres unfinished picture, low quality lowres terrible quality, low quality lowres Coprophilia, low quality lowres muscular, low quality lowres bald, low quality lowres monk, low quality lowres wrinkly, low quality lowres simple background, low quality lowres realistic, low quality lowres old, low quality lowres scan, low quality lowres touhou, low quality lowres yaoi, low quality lowres gay, low quality lowres femboy, low quality lowres trap, low quality lowres pee, low quality lowres doujinshi, low quality lowres monochrome, low quality lowres meme, low quality lowres demon, low quality lowres monstrous creature, low quality lowres tentacle, low quality lowres self harm, low quality lowres vomit, low quality lowres suicide, low quality lowres death, low quality lowres corpse, low quality lowres bone, low quality lowres skeleton, low quality lowres fingers over 6, low quality lowres framed, low quality lowres historical picture, low quality lowres futanari, low quality lowres shemale, low quality lowres trans gender, low quality lowres dick girl, low quality lowres flat breasts, low quality lowres degenerate ass, low quality lowres retro artstyle, low quality lowres anime screencap, low quality lowres stitched, low quality lowres pokemon, low quality lowres ryona, low quality lowres animal, low quality lowres male focus, low quality lowres nipple penetration, low quality lowres sonic (series), low quality lowres bondage, low quality lowres bdsm, low quality lowres 2D, low quality lowres 2D game, low quality lowres 2D game scene, low quality lowres 2D character, low quality lowres game cg, low quality lowres watercolor (medium), low quality lowres 2koma, low quality lowres interlocked fingers, low quality lowres gloves, low quality lowres nitroplus, low quality lowres greyscale, low quality lowres sketch, low quality lowres line drawing, low quality lowres gorilla, low quality lowres meat, low quality lowres gundam, low quality lowres multiple views, low quality lowres cut, low quality lowres concept art, low quality lowres reference sheet, low quality lowres turnaround, low quality lowres chart, low quality lowres comparison, low quality lowres artist progress, low quality lowres lineup, low quality lowres before and after, low quality lowres orc, low quality lowres tusks, low quality lowres goblin, low quality lowres kobold, low quality lowres pony, low quality lowres longbody, low quality lowres nsfw, low quality lowres owres, low quality lowres Humpbacked, low quality lowres text error, low quality lowres extra digits, low quality lowres standard quality, low quality lowres large breasts, low quality lowres shadow, low quality lowres nude, low quality lowres artist name, low quality lowres skeleton girl, low quality lowres bad legs, low quality lowres missing fngers, low quality lowres extra digt, low quality lowres wort quality, low quality lowres jpeg, low quality lowres artifacts, low quality lowres bad body, low quality lowres optical illusion, low quality lowres Glasses, low quality lowres jpegartifacts, low quality lowres girl, low quality lowres women, low quality lowres more than 1 moon, low quality lowres Multi foot, low quality lowres Multifold, low quality lowres Multi fingering, low quality lowres colored sclera, low quality lowres monster girl, low quality lowres Black hands, low quality lowres The background is incoherent, low quality lowres abnormal eye proportion, low quality lowres Abnormal hands, low quality lowres abnormal legs, low quality lowres abnormal feet abnormal fingers, low quality lowres sharp face, low quality lowres tranny, low quality lowres mutated hands, low quality lowres extra limbs, low quality lowres too many fingers, low quality lowres unclear eyes, low quality lowres bad, low quality lowres mutated hand and finger, low quality lowres malformed mutated, low quality lowres boken limb, low quality lowres incorrect limb, low quality lowres fusion finger, low quality lowres lose finger, low quality lowres multiple finger, low quality lowres multiple digit, low quality lowres fusion hand, low quality lowres lose leg, low quality lowres fused leg, low quality lowres multiple leg, low quality lowres bad cameltoe, low quality lowres colorful cameltoe, low quality lowres low polygon 3D game", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.75", + "AddNet Weight B 1": "0.75", + "Denoising strength": "0.2" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/9228" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/ArtistLORATomuTomubobu_doggystyleAllFoursStanding.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/ArtistLORATomuTomubobu_doggystyleAllFoursStanding.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..fad8a392f21f02134c503db368ce9e6b087906f1 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/ArtistLORATomuTomubobu_doggystyleAllFoursStanding.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:b72a5d799365b2df02cec507616bf488e825be253b0f3330e0afef1f9a784d99 +size 1794152 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/ArtistLORATomuTomubobu_doggystyleAllFoursStanding.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/ArtistLORATomuTomubobu_doggystyleAllFoursStanding.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..3990e380139470a3d901be4de893f743faa662e4 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/ArtistLORATomuTomubobu_doggystyleAllFoursStanding.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:f1230f8fd619d0a37110b21a8ce9f61ebd7b8c03deed90272f3ef1b83f4e88f0 +size 151121702 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/Awy_Hearthands.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/Awy_Hearthands.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..339e9ab1341b7496210d9916fa8c17bda89a759a --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/Awy_Hearthands.civitai.info" @@ -0,0 +1,239 @@ +{ + "id": 75981, + "modelId": 71286, + "name": "v1.0", + "createdAt": "2023-05-20T15:28:35.400Z", + "updatedAt": "2023-05-20T15:31:11.486Z", + "trainedWords": [], + "baseModel": "SD 2.1 768", + "earlyAccessTimeFrame": 0, + "description": "

heart shaped hands

", + "stats": { + "downloadCount": 284, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "heart_shaped_hands_LoRA | WD 1.5", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "Awy_Hearthands.safetensors", + "id": 52439, + "sizeKB": 53646.8056640625, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-20T15:31:30.949Z", + "hashes": { + "AutoV1": "4A17A76A", + "AutoV2": "6AEA65E939", + "SHA256": "6AEA65E93961F47951E87FA6E1EDA47CFCA7C57E6BC51495C13D0FD69C12F024", + "CRC32": "939D855C", + "BLAKE3": "66301F1B51448BD4DA6A2D373B98A404ACA81A1C70F95D496980B26A9C7B4F06" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/75981" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d5bb302f-ce3f-4818-874e-0fc553725c1d/width=450/850560.jpeg", + "nsfw": "None", + "width": 640, + "height": 920, + "hash": "UYJje;s:bdt6~Vf6j]j[WBWCIpj[xaoMaej[", + "meta": { + "Size": "640x920", + "seed": 1770490852, + "Model": "replicantV30_v30", + "steps": 25, + "hashes": { + "model": "cf65f48ecf" + }, + "prompt": "(masterpiece, best quality),1 girl,heart shaped hands", + "Version": "v1.2.1", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "hash": "cf65f48ecf", + "name": "replicantV30_v30", + "type": "model" + }, + { + "hash": "68a27b416c86", + "name": "Awy_Hearthands", + "type": "lora", + "weight": null + } + ], + "Model hash": "cf65f48ecf", + "AddNet Enabled": "True", + "AddNet Model 1": "Awy_Hearthands(68a27b416c86)", + "negativePrompt": "(low quality, worst quality:1.4), (bad anatomy), extra finger, fewer digits, jpeg artifacts", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/24e2d262-fe8d-4c0a-bdb7-a8af6c7fb387/width=450/850565.jpeg", + "nsfw": "None", + "width": 1280, + "height": 1840, + "hash": "UGINQ~Ip9Z={~CS2IUoLSvkCtRxZ%2soJRWC", + "meta": { + "Size": "640x920", + "seed": 3307414680, + "Model": "replicantV30_v30", + "steps": 25, + "hashes": { + "model": "cf65f48ecf" + }, + "prompt": "(masterpiece, best quality),1 girl,heart shaped hands", + "Version": "v1.2.1", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "hash": "cf65f48ecf", + "name": "replicantV30_v30", + "type": "model" + }, + { + "hash": "68a27b416c86", + "name": "Awy_Hearthands", + "type": "lora", + "weight": null + } + ], + "Model hash": "cf65f48ecf", + "Hires steps": "11", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "Awy_Hearthands(68a27b416c86)", + "Hires upscaler": "ScuNET PSNR", + "negativePrompt": "(low quality, worst quality:1.4), (bad anatomy), extra finger, fewer digits, jpeg artifacts", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.6" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/aa96d6b2-b8aa-40cf-af0c-aa88dc3de412/width=450/850569.jpeg", + "nsfw": "None", + "width": 640, + "height": 920, + "hash": "UILWeS9E.SV?~WNcixoz9YRiE1M|5Qs;x[t6", + "meta": { + "Size": "640x920", + "seed": 930109635, + "Model": "replicantV30_v30", + "steps": 25, + "hashes": { + "model": "cf65f48ecf" + }, + "prompt": "(masterpiece, best quality),1 girl,(heart shaped hands:1.1),(color pencil:1.2)", + "Version": "v1.2.1", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "hash": "cf65f48ecf", + "name": "replicantV30_v30", + "type": "model" + }, + { + "hash": "68a27b416c86", + "name": "Awy_Hearthands", + "type": "lora", + "weight": null + }, + { + "hash": "c8d7c7feb39f", + "name": "Awy_colorpencil", + "type": "lora", + "weight": null + } + ], + "Model hash": "cf65f48ecf", + "AddNet Enabled": "True", + "AddNet Model 1": "Awy_Hearthands(68a27b416c86)", + "AddNet Model 2": "Awy_colorpencil(c8d7c7feb39f)", + "negativePrompt": "(low quality, worst quality:1.4), (bad anatomy), extra finger, fewer digits, jpeg artifacts", + "AddNet Module 1": "LoRA", + "AddNet Module 2": "LoRA", + "AddNet Weight A 1": "0.6", + "AddNet Weight A 2": "1", + "AddNet Weight B 1": "0.6", + "AddNet Weight B 2": "1" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3e34d8dc-cf2d-419d-8400-ad25a7cdde6f/width=450/850570.jpeg", + "nsfw": "None", + "width": 640, + "height": 920, + "hash": "UDK,{j~W?txu?Go~%4IU,;E0V]D*9zbdpHVs", + "meta": { + "Size": "640x920", + "seed": 930109632, + "Model": "replicantV30_v30", + "steps": 25, + "hashes": { + "model": "cf65f48ecf" + }, + "prompt": "(masterpiece, best quality),1 girl,(heart shaped hands:1.1),(color pencil:1.2)", + "Version": "v1.2.1", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "hash": "cf65f48ecf", + "name": "replicantV30_v30", + "type": "model" + }, + { + "hash": "68a27b416c86", + "name": "Awy_Hearthands", + "type": "lora", + "weight": null + }, + { + "hash": "c8d7c7feb39f", + "name": "Awy_colorpencil", + "type": "lora", + "weight": null + } + ], + "Model hash": "cf65f48ecf", + "AddNet Enabled": "True", + "AddNet Model 1": "Awy_Hearthands(68a27b416c86)", + "AddNet Model 2": "Awy_colorpencil(c8d7c7feb39f)", + "negativePrompt": "(low quality, worst quality:1.4), (bad anatomy), extra finger, fewer digits, jpeg artifacts", + "AddNet Module 1": "LoRA", + "AddNet Module 2": "LoRA", + "AddNet Weight A 1": "0.6", + "AddNet Weight A 2": "1", + "AddNet Weight B 1": "0.6", + "AddNet Weight B 2": "1" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/75981" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/Awy_Hearthands.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/Awy_Hearthands.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..3d23d975efdc9771096715e03d0557bb92010fd8 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/Awy_Hearthands.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/Awy_Hearthands.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/Awy_Hearthands.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..99d032635c8c21322246daac8b2022ab96bdab49 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/Awy_Hearthands.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:6aea65e93961f47951e87fa6e1eda47cfca7c57e6bc51495c13d0fd69c12f024 +size 54934329 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/ButtLiftV12-000080.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/ButtLiftV12-000080.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..7cebbb1258016fd5e6e04cbd998f9a009184338e --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/ButtLiftV12-000080.civitai.info" @@ -0,0 +1,375 @@ +{ + "id": 86621, + "modelId": 10373, + "name": "V6", + "createdAt": "2023-06-01T00:31:58.730Z", + "updatedAt": "2023-06-01T00:36:05.326Z", + "trainedWords": [ + "ButtLift" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 716, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "ass_support", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "ButtLiftV12-000080.safetensors", + "id": 59243, + "sizeKB": 36980.6162109375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-01T00:35:45.327Z", + "hashes": { + "AutoV1": "C116A544", + "AutoV2": "83335CBF1C", + "SHA256": "83335CBF1C86DB125F7D140A7FB0DB14F955490F6633FBC18197B2FA520B9BFE", + "CRC32": "A25E9842", + "BLAKE3": "B9A57581BDF837E2F2C95819414EB81E76E230FB1EEF12E50CDD761AB46D4E11" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/86621" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/15b6c57f-78e6-439d-8cc9-cc79acf10e1f/width=450/987175.jpeg", + "nsfw": "X", + "width": 768, + "height": 1152, + "hash": "UJF;j2}[0eIp9Gw{%2I:RjWoJ7SzRkIpW;oy", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3631025478, + "Model": "Blood's BlendV3- Pruned", + "steps": 30, + "hashes": { + "model": "9ce04507ea" + }, + "prompt": ", Shamsiel_Shahari, 1girl, solo, breasts, wings, red_hair, thighhighs, demon girl, covered nipples, huge breasts, tail, yellow eyes, horns, ass, from_behind, back, ButtLift, pose, ass_support,", + "Version": "v1.2.1", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "9ce04507ea", + "name": "Blood's BlendV3- Pruned", + "type": "model" + } + ], + "Model hash": "9ce04507ea", + "Hires steps": "15", + "Hires upscale": "1.5", + "Hires upscaler": "4x_CountryRoads_377000_G", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name, censored, bar_censor, monochrome, greyscale", + "Denoising strength": "0.36" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/222499b6-9f96-474e-9570-15338a54ff96/width=450/987201.jpeg", + "nsfw": "X", + "width": 512, + "height": 704, + "hash": "UYNmA^xu?^$L?vpI%gIU$gkCE1s:WCaKw^nh", + "meta": { + "ENSD": "31337", + "Size": "512x704", + "seed": 2276293288, + "Model": "Blood's BlendV4 - D", + "steps": 28, + "hashes": { + "model": "49da79742e" + }, + "prompt": "ButtLift, pose, ass_support, grabbing_own_ass, , ass_focus, best quality, highres, ultra-detailed, ButtLift, 1girl, animal_ears, ass, tail, fox_ears, fox_tail, underwear, panties, thighhighs, pink_hair, heart, breasts, open_mouth, spoken_heart, fox_girl, looking_at_viewer, detached_sleeves, yellow_eyes, looking_back, grey_background, smile, animal_ear_fluff, blue_thighhighs, bare_shoulders, japanese_clothes, large_breasts, red_panties, blush, bow, long_hair, hair_bow, bangs, simple_background, uneven_legs, from_behind, from_below, one_hand_ass_support", + "Version": "v1.2.1", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "49da79742e", + "name": "Blood's BlendV4 - D", + "type": "model" + } + ], + "Model hash": "49da79742e", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name, censored, bar_censor, monochrome, greyscale" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c78cbb6e-d069-4f5c-a7cf-202b591cc345/width=450/987203.jpeg", + "nsfw": "Mature", + "width": 512, + "height": 704, + "hash": "UTJ*h-%$CTW99HXARR-UivWCRjaeJoV@s;Sh", + "meta": { + "ENSD": "31337", + "Size": "512x704", + "seed": 249328232, + "Model": "Blood's BlendV4 - D", + "steps": 28, + "hashes": { + "model": "49da79742e" + }, + "prompt": "ButtLift, pose, ass_support, grabbing_own_ass, , ass_focus, best quality, highres, ultra-detailed, ButtLift, 1girl, blonde_hair, swimsuit, ass, long_hair, bikini, green_bikini, breasts, from_behind, ass_support, sideboob, large_breasts, grabbing_own_ass", + "Version": "v1.2.1", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "49da79742e", + "name": "Blood's BlendV4 - D", + "type": "model" + } + ], + "Model hash": "49da79742e", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name, censored, bar_censor, monochrome, greyscale" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7854de64-cf09-44b6-9a35-ef70a351fbef/width=450/987207.jpeg", + "nsfw": "X", + "width": 512, + "height": 768, + "hash": "U9CrsC~A9r0f~V-n0eW-cDM}#%-UI]bIVsxY", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 518743115, + "Model": "Blood's BlendV4 - D", + "steps": 28, + "hashes": { + "model": "49da79742e" + }, + "prompt": "ButtLift, pose, ass_support, grabbing_own_ass, , ass_focus, best quality, highres, ultra-detailed,1girl, breasts, ass, multicolored_hair, black_hair, gloves, large_breasts, white_hair, scar, long_hair, from_behind, weapon, braid, muscular, looking_back, looking_at_viewer, see-through, muscular_female, Ass_Support_with_object", + "Version": "v1.2.1", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "49da79742e", + "name": "Blood's BlendV4 - D", + "type": "model" + } + ], + "Model hash": "49da79742e", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name, censored, bar_censor, monochrome, greyscale" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8317b1ec-5fc9-4f3d-a1c4-8cdaeffc2b02/width=450/987205.jpeg", + "nsfw": "X", + "width": 512, + "height": 768, + "hash": "U7EB$~~C0K000$S$^00K?b-p00M_01W;=w^i", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 518743117, + "Model": "Blood's BlendV4 - D", + "steps": 28, + "hashes": { + "model": "49da79742e" + }, + "prompt": "ButtLift, pose, ass_support, grabbing_own_ass, , ass_focus, best quality, highres, ultra-detailed,1girl, breasts, ass, multicolored_hair, black_hair, gloves, large_breasts, white_hair, scar, long_hair, from_behind, weapon, braid, muscular, looking_back, looking_at_viewer, see-through, muscular_female, Ass_Support_with_object", + "Version": "v1.2.1", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "49da79742e", + "name": "Blood's BlendV4 - D", + "type": "model" + } + ], + "Model hash": "49da79742e", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name, censored, bar_censor, monochrome, greyscale" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d9169a8c-f36e-429f-be57-6c77f31dc5b2/width=450/987198.jpeg", + "nsfw": "X", + "width": 512, + "height": 704, + "hash": "U-NTg,xu_Nt7-=RjxtWBxtoLM{ayoeofRjaz", + "meta": { + "ENSD": "31337", + "Size": "512x704", + "seed": 3524702262, + "Model": "Blood's BlendV4 - D", + "steps": 28, + "hashes": { + "model": "49da79742e" + }, + "prompt": "ButtLift, sitting on railing,, ass_focus, best quality, highres, ultra-detailed, 1girl, ass, brown_hair, from_behind, hood, white_background, simple_background, bag, hoodie, long_sleeves, body_writing, bottomless, ass_support_on_railing", + "Version": "v1.2.1", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "49da79742e", + "name": "Blood's BlendV4 - D", + "type": "model" + } + ], + "Model hash": "49da79742e", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name, censored, bar_censor, monochrome, greyscale" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/faedfc1a-fefd-480e-959e-3af0f67caa00/width=450/987196.jpeg", + "nsfw": "X", + "width": 768, + "height": 1152, + "hash": "UGKT.C$KL4%h16%M^*R*FzxvrrR6?wWDDit8", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3631025477, + "Model": "NAI", + "steps": 30, + "hashes": { + "model": "89d59c3dde" + }, + "prompt": "ButtLift, pose, ass_support, , 1girl, solo, ass, from_behind, back,", + "Version": "v1.2.1", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "89d59c3dde", + "name": "NAI", + "type": "model" + } + ], + "Model hash": "89d59c3dde", + "Hires steps": "10", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name, censored, bar_censor, monochrome, greyscale", + "Denoising strength": "0.55" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/eb22193b-d7c3-489d-a7c5-f64c536b41d2/width=450/987195.jpeg", + "nsfw": "X", + "width": 768, + "height": 1152, + "hash": "UPKTrss..mxu5Rx[^*RjwKa#oakAK7jZM{WW", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3631025474, + "Model": "NAI", + "steps": 30, + "hashes": { + "model": "89d59c3dde" + }, + "prompt": "ButtLift, pose, ass_support, , 1girl, solo, ass, from_behind, back,", + "Version": "v1.2.1", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "89d59c3dde", + "name": "NAI", + "type": "model" + } + ], + "Model hash": "89d59c3dde", + "Hires steps": "10", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name, censored, bar_censor, monochrome, greyscale", + "Denoising strength": "0.55" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f13c2078-ec0d-4bc4-a48a-230be2132421/width=450/987197.jpeg", + "nsfw": "X", + "width": 512, + "height": 704, + "hash": "UjL;8IIA_NWUyDj[?HtR^*xukWxu%2WBE1Rj", + "meta": { + "ENSD": "31337", + "Size": "512x704", + "seed": 3524702263, + "Model": "NAI", + "steps": 28, + "hashes": { + "model": "89d59c3dde" + }, + "prompt": "ButtLift,, ass_focus, best quality, highres, ultra-detailed, 1girl, ass, brown_hair, from_behind, hood, white_background, simple_background, bag, hoodie, long_sleeves, body_writing, bottomless, ass_support_on_railing", + "Version": "v1.2.1", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "89d59c3dde", + "name": "NAI", + "type": "model" + } + ], + "Model hash": "89d59c3dde", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name, censored, bar_censor, monochrome, greyscale" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/70571da2-54fa-465b-bee9-c44ed6dbbaff/width=450/987202.jpeg", + "nsfw": "Mature", + "width": 512, + "height": 640, + "hash": "UOJHgtE21,~B9GsSMz%LsltQS$NGTKNKr^xF", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 2238741675, + "Model": "Blood's BlendV4 - D", + "steps": 28, + "hashes": { + "model": "49da79742e" + }, + "prompt": "ButtLift, pose, ass_support, grabbing_own_ass, , ass_focus, best quality, highres, ultra-detailed, ButtLift, 1girl, blonde_hair, swimsuit, ass, long_hair, bikini, green_bikini, breasts, from_behind, ass_support, sideboob, large_breasts, grabbing_own_ass", + "Version": "v1.2.1", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "49da79742e", + "name": "Blood's BlendV4 - D", + "type": "model" + } + ], + "Model hash": "49da79742e", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name, censored, bar_censor, monochrome, greyscale" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/86621" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/ButtLiftV12-000080.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/ButtLiftV12-000080.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..4d33357e2588633ac9dd993e89001adeaab2e962 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/ButtLiftV12-000080.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/ButtLiftV12-000080.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/ButtLiftV12-000080.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..10c20be27abdc783866f5fc66d871405ce8ffb20 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/ButtLiftV12-000080.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:83335cbf1c86db125f7d140a7fb0db14f955490f6633fbc18197b2fa520b9bfe +size 37868151 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/CarriedBreastRestV1.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/CarriedBreastRestV1.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..f81f39a9b93d1d6b1cc369febf06d3068724964d --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/CarriedBreastRestV1.civitai.info" @@ -0,0 +1,299 @@ +{ + "id": 65673, + "modelId": 61207, + "name": "v1.0", + "createdAt": "2023-05-08T13:53:21.924Z", + "updatedAt": "2023-05-08T13:57:07.510Z", + "trainedWords": [ + "carried breast rest", + "carrying" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 43, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "\u3010Concept\u3011Carried Breast Rest \u6258\u7269\u6b47\u80f8", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "CarriedBreastRestV1.safetensors", + "id": 46026, + "sizeKB": 18542.6572265625, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-08T13:55:44.304Z", + "hashes": { + "AutoV1": "DE2F2560", + "AutoV2": "CA64FAD604", + "SHA256": "CA64FAD6042E3C6B805DF33D97C26C831FDD3A6B673549E13CEC88B4D3E2990C", + "CRC32": "DEEBE7D4", + "BLAKE3": "765137AB0B7B777EBC93F30003484AEE8C3D65C0584B35A913626FF026976842" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/65673" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5838b2e2-318b-4c25-9bd7-aa4b744112d8/width=450/727265.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1280, + "hash": "UDGuUWZ#009a0LxvM|9Y0L4.~V%2~p%LRPWY", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 2067745647, + "steps": 20, + "prompt": "1girl,solo,large breasts, carried breast rest, carrying, cardboard box, ,nude, black hair,kashino, ,nipples,tears,blush,full body,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "CarriedBreastRestV1", + "type": "lora", + "weight": 1 + }, + { + "name": "KashinoV2", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "98670cb5a8", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "ESRGAN_4x", + "negativePrompt": "(worst quality:1.4), (low quality:1.4), (normal quality:1.4), ((female pubic hair:1.3)), lowres,", + "Denoising strength": "0.56" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7bd23122-e502-4c56-948a-59ddfcccb26a/width=450/727254.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1280, + "hash": "UJG+K}00.8sm_NIUx]%2.8Djxuoext9ZV?oz", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 2912019470, + "steps": 20, + "prompt": "1girl,solo,large breasts, carried breast rest, carrying, cardboard box, ,school uniform, black hair,kashino, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "CarriedBreastRestV1", + "type": "lora", + "weight": 1 + }, + { + "name": "KashinoV2", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "98670cb5a8", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "ESRGAN_4x", + "negativePrompt": "(worst quality:1.4), (low quality:1.4), (normal quality:1.4), ((female pubic hair:1.3)), lowres,", + "Denoising strength": "0.56" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f2383a1c-48cb-440e-a485-0e911d83f5a9/width=450/727253.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1280, + "hash": "UKH1_J9F0fwvOGD*%MIU4.IU^+xa~WRjM{t7", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 1288925792, + "steps": 20, + "prompt": "1girl,solo,large breasts, carried breast rest, carrying, cardboard box, ,nude, black hair,kashino, ,nipples,tears,blush,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "CarriedBreastRestV1", + "type": "lora", + "weight": 1 + }, + { + "name": "KashinoV2", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "98670cb5a8", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "ESRGAN_4x", + "negativePrompt": "(worst quality:1.4), (low quality:1.4), (normal quality:1.4), ((female pubic hair:1.3)), lowres,", + "Denoising strength": "0.56" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/cfc72912-bbe2-4b89-a937-27934d9d44c4/width=450/727252.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1280, + "hash": "UOHV0Z~pIVi}?b%MtQs+I.ozt7of^+of9FIo", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 657312226, + "steps": 20, + "prompt": "1girl,solo,large breasts, carried breast rest, carrying, watermelon, ,school uniform, black hair,kashino, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "CarriedBreastRestV1", + "type": "lora", + "weight": 1 + }, + { + "name": "KashinoV2", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "98670cb5a8", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "ESRGAN_4x", + "negativePrompt": "(worst quality:1.4), (low quality:1.4), (normal quality:1.4), ((female pubic hair:1.3)), lowres,", + "Denoising strength": "0.56" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/13329d3b-a8c9-485a-9e69-2fbb7e971dc2/width=450/727251.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1280, + "hash": "UQFFdG~WtlkDx^bJE1D*-;-;s:ni?b%foLWC", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 2579576163, + "steps": 20, + "prompt": "1girl,solo,large breasts, carried breast rest, carrying, book stack, ,school uniform, black hair,kashino, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "CarriedBreastRestV1", + "type": "lora", + "weight": 1 + }, + { + "name": "KashinoV2", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "98670cb5a8", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "ESRGAN_4x", + "negativePrompt": "(worst quality:1.4), (low quality:1.4), (normal quality:1.4), ((female pubic hair:1.3)), lowres,", + "Denoising strength": "0.56" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f2f9bbd6-7b6b-4363-8fe5-322f12ba2c8e/width=450/727255.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1280, + "hash": "UFFrx1%3%hIV_4o~4oIU-;_3M|%1_3-:xuxu", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 2579576163, + "steps": 20, + "prompt": "1girl,solo,large breasts, carried breast rest, carrying, cardboard box, ,school uniform, black hair,kashino, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "CarriedBreastRestV1", + "type": "lora", + "weight": 1 + }, + { + "name": "KashinoV2", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "98670cb5a8", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "ESRGAN_4x", + "negativePrompt": "(worst quality:1.4), (low quality:1.4), (normal quality:1.4), ((female pubic hair:1.3)), lowres,", + "Denoising strength": "0.56" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e7e4d437-ef13-499f-953f-744ef83ae852/width=450/727331.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1280, + "hash": "UNEVjH~qEe?aW9%M-;xu0KIUxaM{WZa}n$f6", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 3622757307, + "steps": 20, + "prompt": "1girl,solo,large breasts, carried breast rest, carrying, gift_box, ,completely nude,bare_arms,topless, black hair,kashino, ,nipples,tears,blush,full body, standing,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "CarriedBreastRestV1", + "type": "lora", + "weight": 1 + }, + { + "name": "KashinoV2", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "98670cb5a8", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "ESRGAN_4x", + "negativePrompt": "(worst quality:1.4), (low quality:1.4), (normal quality:1.4), ((female pubic hair:1.3)), lowres,", + "Denoising strength": "0.56" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/65673" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/CarriedBreastRestV1.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/CarriedBreastRestV1.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..ffe404f89ddc29296534ee8ffa3eba88a1af4925 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/CarriedBreastRestV1.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/CarriedBreastRestV1.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/CarriedBreastRestV1.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..0d5b8886a3d88842d5c54474c70b596455844af9 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/CarriedBreastRestV1.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:ca64fad6042e3c6b805df33d97c26c831fdd3a6b673549e13cec88b4d3e2990c +size 18987681 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/CloseUpVaginal-v1.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/CloseUpVaginal-v1.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..f48e654972b657b9486432947c177ee24cfbf62f --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/CloseUpVaginal-v1.civitai.info" @@ -0,0 +1,240 @@ +{ + "id": 65102, + "modelId": 60624, + "name": "v1", + "createdAt": "2023-05-07T19:51:03.229Z", + "updatedAt": "2023-05-07T20:00:53.679Z", + "trainedWords": [ + "close up vaginal", + "missionary", + "doggystyle", + "pov", + "from side", + "creampie" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

  • Initial release

", + "stats": { + "downloadCount": 863, + "ratingCount": 1, + "rating": 5 + }, + "model": { + "name": "Close up Vaginal + Creampie LoRA", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "CloseUpVaginal-v1.safetensors", + "id": 45689, + "sizeKB": 147570.9072265625, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-07T19:55:51.988Z", + "hashes": { + "AutoV1": "E72ABF90", + "AutoV2": "57CBD2B8AC", + "SHA256": "57CBD2B8ACC49D4FBBA0ED11678C367231E50FC0F213369C45827D664DE805B2", + "CRC32": "7EBAFD5D", + "BLAKE3": "55BDCDE57579715000DF8F5B46459C6C47E303EC558B400F334CF24B60DC45B2" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/65102" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1cdbd212-7306-4c26-af69-a4528587c87e/width=450/720504.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UVLMq*=YM{.8~qD%Iox]T0IUjFo}t7%Ls.M|", + "meta": { + "Size": "512x512", + "seed": 4104119969, + "steps": 30, + "prompt": " from side missionary close up vaginal photo of tanned blonde woman getting fucked on bed, perfect face, masterpiece, perfect lighting, incredible detaile, intricate, best quality, (creampie:0.7)", + "sampler": "DPM++ SDE Karras", + "cfgScale": 6, + "resources": [], + "Model hash": "f93e6a50ac", + "negativePrompt": "poorly drawn face, low quality, low res, pov, doggystyle, anime" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6a5da456-b561-406e-88d6-339a6b563355/width=450/720474.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "U8Ih8K0018-:_MV@0LsR00.9,ARP00?w_3WA", + "meta": { + "Size": "512x512", + "seed": 2658590657, + "steps": 30, + "prompt": " pov doggystyle close up vaginal photo of woman getting fucked on bed, perfect face, masterpiece, perfect lighting, incredible detaile, intricate, best quality,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 5, + "resources": [], + "Model hash": "f93e6a50ac", + "negativePrompt": "poorly drawn face, low quality, low res," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a134b065-6901-4451-bef9-a587f3541ab6/width=450/720480.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UBH,;i~W^*$$vyJCxaEML3%MEk0f}?~BTJt7", + "meta": { + "Size": "512x512", + "seed": 2289358739, + "steps": 30, + "prompt": " pov missionary close up vaginal photo of carribean woman getting fucked on bed, perfect face, masterpiece, perfect lighting, incredible detaile, intricate, best quality,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 6, + "resources": [], + "Model hash": "f93e6a50ac", + "negativePrompt": "poorly drawn face, low quality, low res, doggystyle," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/233c9870-795c-421f-b06a-544bdb24b84c/width=450/720472.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UqLM@d~WIqNGMwV?xDxaEMt7-pozIpayWBWC", + "meta": { + "Size": "512x512", + "seed": 830098612, + "steps": 30, + "prompt": " from side doggystyle close up vaginal photo of woman wearing stockings getting fucked on bed, masterpiece, perfect lighting, incredible detaile, intricate, best quality,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 5, + "resources": [], + "Model hash": "f93e6a50ac", + "negativePrompt": "poorly drawn face, low quality, low res, missionary, pov" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/43decefe-6384-4cdf-9f1d-91ea30b9be42/width=450/720505.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UHJ?]a4T?c;Jxc~XQ,s*1P%2-o$%SjIUEMX9", + "meta": { + "Size": "512x512", + "seed": 2181537126, + "steps": 30, + "prompt": " from side missionary close up vaginal photo of tanned blonde woman getting fucked on bed, perfect face, masterpiece, perfect lighting, incredible detaile, intricate, best quality, (creampie:0.7)", + "sampler": "DPM++ SDE Karras", + "cfgScale": 6, + "resources": [], + "Model hash": "f93e6a50ac", + "negativePrompt": "poorly drawn face, low quality, low res, pov, doggystyle," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5fe52bca-7a10-48fd-af61-1e104a3a3500/width=450/720476.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UEKm-6Dh5r%1Kj00aJMxKk4mQ,IA_3_3R%?w", + "meta": { + "Size": "512x512", + "seed": 3474833281, + "steps": 30, + "prompt": " pov missionary close up vaginal photo of black haired woman wearing stockings getting fucked on bed, perfect face, masterpiece, perfect lighting, incredible detaile, intricate, best quality,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 6, + "resources": [], + "Model hash": "f93e6a50ac", + "negativePrompt": "poorly drawn face, low quality, low res, doggystyle," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/039591b8-cfe0-41a9-8697-32039462ccca/width=450/720478.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UEG@x*t2Tf%L*0oyJ;%M%gS5%Mj@=s-p=wfi", + "meta": { + "Size": "512x512", + "seed": 2833948465, + "steps": 30, + "prompt": " pov missionary close up vaginal photo of dark haired carribean woman getting fucked on bed, perfect face, masterpiece, perfect lighting, incredible detaile, intricate, best quality,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 6, + "resources": [], + "Model hash": "f93e6a50ac", + "negativePrompt": "poorly drawn face, low quality, low res, doggystyle," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/52f8667c-af84-4cfe-8b2c-05e159a23df8/width=450/720484.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UFI:,+rC%M~V=s%h4.wIEf01DjVs9tbwM{t7", + "meta": { + "Size": "512x512", + "seed": 749931000, + "steps": 30, + "prompt": " from side missionary close up vaginal photo of woman getting fucked, perfect face, masterpiece, perfect lighting, incredible detaile, intricate, best quality,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 5, + "resources": [], + "Model hash": "f93e6a50ac", + "Variation seed": "3362576745", + "negativePrompt": "poorly drawn face, low quality, low res, pov, doggystyle", + "Variation seed strength": "0.18" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2f799e2d-4d87-4618-8e8b-47f742fcfe9b/width=450/720507.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "U9INgmF|tl^*pGo~D%~W00009aogD%MxE1IU", + "meta": { + "Size": "512x512", + "seed": 3437758090, + "steps": 30, + "prompt": " pov missionary close up vaginal photo of asian woman getting fucked, perfect face, masterpiece, perfect lighting, incredible detaile, intricate, best quality, creampie", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [], + "Model hash": "f93e6a50ac", + "negativePrompt": "poorly drawn face, low quality, low res" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/799e3194-fbb9-44e6-820e-a92723ffe50e/width=450/720510.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UDJs%$?b~Vsp?G%2%1M{0L~W?G^+0MIURj?b", + "meta": { + "Size": "512x512", + "seed": 804415262, + "steps": 30, + "prompt": " pov missionary close up vaginal photo of blonde woman getting fucked, perfect face, masterpiece, perfect lighting, incredible detaile, intricate, best quality, creampie", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [], + "Model hash": "f93e6a50ac", + "negativePrompt": "poorly drawn face, low quality, low res" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/65102" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/CloseUpVaginal-v1.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/CloseUpVaginal-v1.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..076b97c64cdc55e9bbff238afb2bedd5979bf788 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/CloseUpVaginal-v1.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/CloseUpVaginal-v1.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/CloseUpVaginal-v1.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..635047512d7e1b76971e2ff9c42f9eb54051a96f --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/CloseUpVaginal-v1.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:57cbd2b8acc49d4fbba0ed11678c367231e50fc0f213369c45827d664de805b2 +size 151112609 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/Concept-dogezaV5-000007.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/Concept-dogezaV5-000007.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..39bfa334a96c5c9e8a28fc075d7377ab0d1cdabc --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/Concept-dogezaV5-000007.civitai.info" @@ -0,0 +1,137 @@ +{ + "id": 92781, + "modelId": 14905, + "name": "Ver2.0", + "createdAt": "2023-06-10T02:23:01.853Z", + "updatedAt": "2023-06-10T02:30:44.298Z", + "trainedWords": [ + "dogeza" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

Version 2.0 Update! The model size has been significantly reduced. The generated images will now be clearer.

Now can generate characters with faces, support angle from behind showing pussy and anus, and generating multiple characters in one img.

Weights range from 0.6 to 1.0. If you want generate chara faces, use lower weights. For multiple characters or generating images from behind , use higher weights.

Something still need improve:

  1. Overall image consistency is still unstable, you may need to do some gacha

  2. Compatibility with other Lora remains poor, but you can try it with lower weights.

  3. Image stability from a behind is still not stable

This lora is so hard to bake,If you have any technical suggestions, please make sure to contact me.

2.0\u7248\u672c\u66f4\u65b0\uff01\u6a21\u578b\u5927\u5c0f\u5df2\u88ab\u5927\u5e45\u7f29\u51cf\uff0c\u73b0\u5728\u7684\u56fe\u7247\u5c06\u66f4\u52a0\u6e05\u6670\u3002

\u652f\u6301\u4ece\u540e\u65b9\u7684\u89c6\u89d2\uff0c\u5c55\u793a\u4eba\u7269\u7684\u6b63\u8138\uff0c\u4ee5\u53ca\u80fd\u751f\u6210\u591a\u4e2a\u89d2\u8272\u540c\u5c4f

\u6743\u91cd0.6-1.0 \u5982\u679c\u4f60\u5e0c\u671b\u51fa\u73b0\u89d2\u8272\u7684\u6b63\u8138\uff0c\u4f7f\u7528\u66f4\u4f4e\u7684\u6743\u91cd .

\u60f3\u8981\u591a\u4e2a\u89d2\u8272\uff0c\u6216\u8005\u751f\u6210\u80cc\u540e\u89c6\u89d2\uff0c\u4f7f\u7528\u66f4\u9ad8\u7684\u6743\u91cd

\u4ecd\u5f85\u6539\u8fdb\u7684\u65b9\u9762\uff1a

  • 1.\u6574\u4f53\u6210\u56fe\u4ecd\u7136\u4e0d\u7a33\u5b9a\uff0c\u4f60\u53ef\u80fd\u9700\u8981\u591a\u6b21\u7684gacha

  • 2.\u5bf9\u5176\u4ed6lora\u7684\u517c\u5bb9\u6027\u4ecd\u7136\u5f88\u5dee\uff0c\u4e0d\u8fc7\u4f60\u53ef\u4ee5\u964d\u4f4e\u6743\u91cd\u8bd5\u8bd5

  • 3.\u4ece\u80cc\u540e\u89c6\u89d2\u7684\u56fe\u7247\u89d2\u5ea6\u4ecd\u4e0d\u7a33\u5b9a

\u8fd9\u4e2alora\u662f\u771f\u7684\u96be\u70bc\uff0c\u5982\u679c\u4f60\u6709\u4ec0\u4e48\u6280\u672f\u4e0a\u7684\u5efa\u8bae\uff0c\u8bf7\u52a1\u5fc5\u544a\u8bc9\u6211

", + "stats": { + "downloadCount": 1098, + "ratingCount": 4, + "rating": 5 + }, + "model": { + "name": "\u3010Concept\u3011Dogeza \u6982\u5ff5-\u571f\u4e0b\u5ea7", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "Concept-dogezaV5-000007.safetensors", + "id": 64020, + "sizeKB": 9339.57421875, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-10T02:26:25.477Z", + "hashes": { + "AutoV1": "AF830E0E", + "AutoV2": "22E1DC3AB2", + "SHA256": "22E1DC3AB27C403BE7CF0B8C320137019468B4126494D13452395CC88E425D39", + "CRC32": "39F2324E", + "BLAKE3": "3FB9283282A0C31A205CB063CE2B831321B5998DD545310DB92910323FEC4514" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/92781" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0092b1c6-918c-4b5b-bc08-7f1b744863d4/width=450/1091236.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1280, + "hash": "UPKwUsV[00oL_NaK9GWC.SIoIARk%Nxuoaxt", + "meta": { + "steps": 20, + "prompt": "(masterpiece),(best quality),extreamly delicate and beautiful,traditional media, 1girl, completely nude, long hair,hair ribbon, dogeza,clothes removed, panties, bra,folded clothes, , shoes, boots, (drill hair:1.1), twin drills,blonde hair, cum,cum on body,trembling, heart, indoors, on floor, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "negativePrompt": "(EasyNegativeV2:0.9), eyes, worst quality,low quality,large head,midriff,, (worst quality, low quality:1.4), pointy ears,, lowres, bad anatomy, bad hands, text,error, missing fngers,extra digt ,fewer digits,cropped, wort quality ,low quality,normal quality, jpeg artifacts,signature,watermark, username, blurry, bad feet" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4a0a309d-7a52-4a4d-8ad4-af56899373ad/width=450/1091247.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1280, + "hash": "U7JQixnj00%200-U9ZRk01fk~Bs.4:M|~Vxa", + "meta": { + "steps": 20, + "prompt": "(masterpiece),(best quality),extreamly delicate and beautiful,traditional media, 1girl, completely nude, long hair,hair ribbon, dogeza,clothes removed, panties, bra,folded clothes, , shoes, boots, (drill hair:1.1), twin drills,blonde hair, cum,cum on body,trembling, heart, indoors, on floor, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "negativePrompt": "(EasyNegativeV2:0.9), eyes, worst quality,low quality,large head,midriff,, (worst quality, low quality:1.4), pointy ears,, lowres, bad anatomy, bad hands, text,error, missing fngers,extra digt ,fewer digits,cropped, wort quality ,low quality,normal quality, jpeg artifacts,signature,watermark, username, blurry, bad feet" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3eec96d0-844a-4336-97eb-3acb9746ba3c/width=450/1092385.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1280, + "hash": "U7I#MuE000n$00?b}Un%0KE1D5NG00o#F1WV", + "meta": { + "steps": 20, + "prompt": "(masterpiece),(best quality),extreamly delicate and beautiful,traditional media, 1girl, completely nude,hatsune miku, green eyes, long hair, twintails, , dogeza,clothes removed, panties, bra,(folded clothes:1.1), trembling, heart, indoors, on floor, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "negativePrompt": "(EasyNegativeV2:0.9), eyes, worst quality,low quality,large head, , (worst quality, low quality:1.4), pointy ears,, lowres, bad anatomy, bad hands, text,error, missing fngers,extra digt ,fewer digits,cropped, wort quality ,low quality,normal quality, jpeg artifacts,signature,watermark, username, blurry, bad feet" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d5727635-1c38-4d6e-bc50-d134c53bbc0a/width=450/1091857.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1280, + "hash": "U8Jto29Z00t6%%^+00jZ00M|DPM{_3IUIUWB", + "meta": { + "steps": 20, + "prompt": "(masterpiece),(best quality),extreamly delicate and beautiful,traditional media, 1girl, completely nude,sakurakouji-luna, long hair,hair ribbon, dogeza,clothes removed, panties, bra,folded clothes, , shoes, boots, , cum,cum on body,trembling, heart, indoors, on floor, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "negativePrompt": "(EasyNegativeV2:0.9), eyes, worst quality,low quality,large head, , (worst quality, low quality:1.4), pointy ears,, lowres, bad anatomy, bad hands, text,error, missing fngers,extra digt ,fewer digits,cropped, wort quality ,low quality,normal quality, jpeg artifacts,signature,watermark, username, blurry, bad feet" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e00f306d-bb1a-4ebc-9ea8-52be0e541d54/width=450/1091256.jpeg", + "nsfw": "X", + "width": 640, + "height": 448, + "hash": "UTJ@LI~pKjt7t5Ri9FM{9tjZRPayIURQ%Lj[", + "meta": { + "steps": 20, + "prompt": "(masterpiece),(best quality),extreamly delicate and beautiful,traditional media, 1girl, dogeza, ,completely nude,ass,ass focus, barefoot, anus, pussy, from behind, (on bed:1.1), bedroom, indoors, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "negativePrompt": "(EasyNegativeV2:0.9), worst quality,low quality,large head,midriff,, (worst quality, low quality:1.4), pointy ears,, lowres, bad anatomy, bad hands, text,error, missing fngers,extra digt ,fewer digits,cropped, wort quality ,low quality,normal quality, jpeg artifacts,signature,watermark, username, blurry, bad feet" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5ef41c90-b59e-4ec4-a946-7a362d6602a8/width=450/1094027.jpeg", + "nsfw": "X", + "width": 1408, + "height": 1024, + "hash": "U6J*VX9t00tm00$M?v$#00_N009a0000?Gxu", + "meta": { + "steps": 20, + "prompt": "(masterpiece),(best quality),extreamly delicate and beautiful,traditional media, 3girls, multiple girls, ,completely nude,white hair,long hair ribbon, dogeza, ass,clothes removed, wand, panties, bra, wand, shoes, blue hair, ponytail, barefoot, on bed, bedroom, indoors, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "negativePrompt": "(EasyNegativeV2:0.9), worst quality,low quality,large head,midriff,, (worst quality, low quality:1.4), pointy ears,, lowres, bad anatomy, bad hands, text,error, missing fngers,extra digt ,fewer digits,cropped, wort quality ,low quality,normal quality, jpeg artifacts,signature,watermark, username, blurry, bad feet" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/92781" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/Concept-dogezaV5-000007.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/Concept-dogezaV5-000007.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..0045a8083594b28087a6704914ebdc8dc58b0cde Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/Concept-dogezaV5-000007.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/Concept-dogezaV5-000007.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/Concept-dogezaV5-000007.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..2e430f3ebf5983f7655606857d4d614db931842d --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/Concept-dogezaV5-000007.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:22e1dc3ab27c403be7cf0b8c320137019468b4126494d13452395cc88e425d39 +size 9563724 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/acrossTableConcept_v10.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/acrossTableConcept_v10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..1a3220542091908f7a0c9d66eae3a9ad3865d889 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/acrossTableConcept_v10.civitai.info" @@ -0,0 +1,257 @@ +{ + "id": 21783, + "modelId": 18377, + "name": "v1.0", + "createdAt": "2023-03-11T19:25:00.092Z", + "updatedAt": "2023-03-23T18:19:52.729Z", + "trainedWords": [ + "" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 2341, + "ratingCount": 10, + "rating": 5 + }, + "model": { + "name": "Across Table | Concept Lora 208", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "acrossTableConcept_v10.safetensors", + "id": 18156, + "sizeKB": 9364.1640625, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-03-11T19:26:22.586Z", + "hashes": { + "AutoV1": "212D3D17", + "AutoV2": "23298F2A66", + "SHA256": "23298F2A66EBE214AEA36DC00BF4C68C24669DC95A26AAA9A0AD256779D90872", + "CRC32": "8D4A4BB7", + "BLAKE3": "BD2ECC1D96E0EDC81832E3EECB82A550B2F7FA6F7B57C649C097D36722379446" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/21783" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8bec01c8-ba9d-4006-13a6-c556ff4c4b00/width=450/232370.jpeg", + "nsfw": false, + "width": 2048, + "height": 2816, + "hash": "UALz8Q000xnf5nIoD%WB00-;=yxZ00~qDjo#", + "meta": { + "ENSD": "31337", + "Size": "512x704", + "seed": 643665145, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 28, + "prompt": ", , crown, white dress, food, simple background, elbows on table, cup, blurry background, indoors, upper body,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + } + ], + "Model hash": "0873291ac5", + "Hires upscale": "2", + "Hires upscaler": "4x_foolhardy_Remacri", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, child, username, blurry, out of focus, censorship, grey skin, monochrome, no pussy, worst quality, low quality, medium quality, deleted, lowres, comic, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, censored, spoken heart, spoken question mark, signature, speech bubble, amputee, multiple girls, (worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, (muscular, loli, petite, child, infant, toddlers, chibi, sd character:1.1), multiple view, Reference sheet, patreon logo, patreon username,", + "Denoising strength": "0.53" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/15fc2259-3326-41f7-27c2-68ca2deef400/width=450/232376.jpeg", + "nsfw": false, + "width": 3072, + "height": 895, + "hash": "UlMQL;t7ocf5_NofbIof%gj]kCWV?vayWBj[", + "meta": { + "ENSD": "31337", + "Size": "512x704", + "seed": 4263796571, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 28, + "Z Type": "Checkpoint name", + "prompt": ", , crown, white dress, food, simple background, elbows on table, cup, blurry background, indoors, upper body,", + "sampler": "DPM++ 2M Karras", + "Z Values": "\"AbyssOrangeMix2_nsfw.safetensors [0873291ac5], AbyssOrangeMix2_sfw.safetensors [038ba203d8], Anything-V3.0.ckpt [8712e20a5d], final-pruned.ckpt [89d59c3dde], umiAIMythologyAndBabes_macrossAnimeEmbed.safetensors [d356a70414], umiAIMythologyAndBabes_macrossAnimeHiRes10.safetensors [e132711da8]\"", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + } + ], + "Model hash": "0873291ac5", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, child, username, blurry, out of focus, censorship, grey skin, monochrome, no pussy, worst quality, low quality, medium quality, deleted, lowres, comic, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, censored, spoken heart, spoken question mark, signature, speech bubble, amputee, multiple girls, (worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, (muscular, loli, petite, child, infant, toddlers, chibi, sd character:1.1), multiple view, Reference sheet, patreon logo, patreon username," + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/55b7d2d0-2a6b-4991-741e-359d4a4c7800/width=450/232375.jpeg", + "nsfw": false, + "width": 3072, + "height": 895, + "hash": "UkL|u?t7kCjY~qoeayj[?cofofoL%$azWBWV", + "meta": { + "ENSD": "31337", + "Size": "512x704", + "seed": 4128044176, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 28, + "Z Type": "Checkpoint name", + "prompt": ", , crown, aqua dress, food, simple background, elbows on table, cup, blurry background, indoors, upper body,", + "sampler": "DPM++ 2M Karras", + "Z Values": "\"AbyssOrangeMix2_nsfw.safetensors [0873291ac5], AbyssOrangeMix2_sfw.safetensors [038ba203d8], Anything-V3.0.ckpt [8712e20a5d], final-pruned.ckpt [89d59c3dde], umiAIMythologyAndBabes_macrossAnimeEmbed.safetensors [d356a70414], umiAIMythologyAndBabes_macrossAnimeHiRes10.safetensors [e132711da8]\"", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + } + ], + "Model hash": "0873291ac5", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, child, username, blurry, out of focus, censorship, grey skin, monochrome, no pussy, worst quality, low quality, medium quality, deleted, lowres, comic, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, censored, spoken heart, spoken question mark, signature, speech bubble, amputee, multiple girls, (worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, (muscular, loli, petite, child, infant, toddlers, chibi, sd character:1.1), multiple view, Reference sheet, patreon logo, patreon username," + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/aaeebd4d-0f74-4bb8-a504-6cea4fbe0e00/width=450/232374.jpeg", + "nsfw": true, + "width": 3072, + "height": 895, + "hash": "UmM%N1flR*M{_Nofj[kC%#fkj[t6%hj@aeWC", + "meta": { + "ENSD": "31337", + "Size": "512x704", + "seed": 1082110520, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 28, + "Z Type": "Checkpoint name", + "prompt": ", , crown, black dress, food, simple background, elbows on table, cup, blurry background, indoors,", + "sampler": "DPM++ 2M Karras", + "Z Values": "\"AbyssOrangeMix2_nsfw.safetensors [0873291ac5], AbyssOrangeMix2_sfw.safetensors [038ba203d8], Anything-V3.0.ckpt [8712e20a5d], final-pruned.ckpt [89d59c3dde], umiAIMythologyAndBabes_macrossAnimeEmbed.safetensors [d356a70414], umiAIMythologyAndBabes_macrossAnimeHiRes10.safetensors [e132711da8]\"", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + } + ], + "Model hash": "0873291ac5", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, child, username, blurry, out of focus, censorship, grey skin, monochrome, no pussy, worst quality, low quality, medium quality, deleted, lowres, comic, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, censored, spoken heart, spoken question mark, signature, speech bubble, amputee, multiple girls, (worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, (muscular, loli, petite, child, infant, toddlers, chibi, sd character:1.1), multiple view, Reference sheet, patreon logo, patreon username," + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c07d376c-9a78-4254-0c97-ccee3be19300/width=450/232373.jpeg", + "nsfw": false, + "width": 3072, + "height": 895, + "hash": "UsN9|JkDR*ae_NkCjtjs?uj[oLoLOZjsWBWr", + "meta": { + "ENSD": "31337", + "Size": "512x704", + "seed": 2620077787, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 28, + "Z Type": "Checkpoint name", + "prompt": ", tang keke, love live!, hakumai konatsu, blue cardigan, blue eyes, bob cut, cardigan, coffee, coffee mug, collared shirt, cup, excited, food, food awe, fork, hands up, happy, jacket, light brown hair, long sleeves, mug, multicolored hair, napolitan, open mouth, own hands together, pasta, pink hair, plate, restaurant, school uniform, shirt, short hair, smile, sparkling eyes, steam, streaked hair, teeth, two-tone hair, upper teeth only", + "sampler": "DPM++ 2M Karras", + "Z Values": "\"AbyssOrangeMix2_nsfw.safetensors [0873291ac5], AbyssOrangeMix2_sfw.safetensors [038ba203d8], Anything-V3.0.ckpt [8712e20a5d], final-pruned.ckpt [89d59c3dde], umiAIMythologyAndBabes_macrossAnimeEmbed.safetensors [d356a70414], umiAIMythologyAndBabes_macrossAnimeHiRes10.safetensors [e132711da8]\"", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + } + ], + "Model hash": "0873291ac5", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, child, username, blurry, out of focus, censorship, grey skin, monochrome, no pussy, worst quality, low quality, medium quality, deleted, lowres, comic, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, censored, spoken heart, spoken question mark, signature, speech bubble, amputee, multiple girls, (worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, (muscular, loli, petite, child, infant, toddlers, chibi, sd character:1.1), multiple view, Reference sheet, patreon logo, patreon username," + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b4742077-0e97-41c7-8ffe-e92ed5e9b300/width=450/232372.jpeg", + "nsfw": false, + "width": 3072, + "height": 895, + "hash": "UaMQYOxWRibc_Nofj]ay~pa~t8s.?wa}Rjae", + "meta": { + "ENSD": "31337", + "Size": "512x704", + "seed": 1752564991, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 28, + "Z Type": "Checkpoint name", + "prompt": ", amane kanata, hololive, azuremo, o, angel wings, asymmetrical bangs, bangs, beret, blue hair, blush, burger, colored inner hair, feathered wings, food, french fries, hair ornament, hair over one eye, hair rings, hairclip, hat, jacket, long hair, low twintails, mini wings, multicolored hair, open mouth, single hair intake, twintails, virtual youtuber, white jacket, white wings, wings", + "sampler": "DPM++ 2M Karras", + "Z Values": "\"AbyssOrangeMix2_nsfw.safetensors [0873291ac5], AbyssOrangeMix2_sfw.safetensors [038ba203d8], Anything-V3.0.ckpt [8712e20a5d], final-pruned.ckpt [89d59c3dde], umiAIMythologyAndBabes_macrossAnimeEmbed.safetensors [d356a70414], umiAIMythologyAndBabes_macrossAnimeHiRes10.safetensors [e132711da8]\"", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + } + ], + "Model hash": "0873291ac5", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, child, username, blurry, out of focus, censorship, grey skin, monochrome, no pussy, worst quality, low quality, medium quality, deleted, lowres, comic, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, censored, spoken heart, spoken question mark, signature, speech bubble, amputee, multiple girls, (worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, (muscular, loli, petite, child, infant, toddlers, chibi, sd character:1.1), multiple view, Reference sheet, patreon logo, patreon username," + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/368af3a3-be68-40b4-4398-1eaaae514b00/width=450/232371.jpeg", + "nsfw": false, + "width": 3072, + "height": 895, + "hash": "UsMG^yayaxR*_Nj?jZof-;ofofj[%Mj]WCj@", + "meta": { + "ENSD": "31337", + "Size": "512x704", + "seed": 1579182910, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 28, + "Z Type": "Checkpoint name", + "prompt": ", uruha rushia, hololive, kaigan, alternate costume, beige cardigan, blowing on food, blue hair, blue ribbon, blush, butterfly necklace, cake, cake slice, cardigan, cup, double bun, earrings, food, gradient hair, green hair, hair bun, hair ribbon, holding, holding cup, jewelry, long sleeves, medium hair, multicolored hair, necklace, red eyes, ribbon, sidelocks, skull earrings, teacup, virtual youtuber", + "sampler": "DPM++ 2M Karras", + "Z Values": "\"AbyssOrangeMix2_nsfw.safetensors [0873291ac5], AbyssOrangeMix2_sfw.safetensors [038ba203d8], Anything-V3.0.ckpt [8712e20a5d], final-pruned.ckpt [89d59c3dde], umiAIMythologyAndBabes_macrossAnimeEmbed.safetensors [d356a70414], umiAIMythologyAndBabes_macrossAnimeHiRes10.safetensors [e132711da8]\"", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + } + ], + "Model hash": "0873291ac5", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, child, username, blurry, out of focus, censorship, grey skin, monochrome, no pussy, worst quality, low quality, medium quality, deleted, lowres, comic, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, censored, spoken heart, spoken question mark, signature, speech bubble, amputee, multiple girls, (worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, (muscular, loli, petite, child, infant, toddlers, chibi, sd character:1.1), multiple view, Reference sheet, patreon logo, patreon username," + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/21783" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/acrossTableConcept_v10.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/acrossTableConcept_v10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..acd406bdd9c852b1f8195d6d2c74a5a78a4a3ecf --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/acrossTableConcept_v10.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:99d1d646a5eaee452f63b721d4051a158ecfb6f4bfcead44b8123d3974554789 +size 7097367 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/acrossTableConcept_v10.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/acrossTableConcept_v10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..4e3d4875317bdd34f9f37a5402de4701f52ed63f --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/acrossTableConcept_v10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:23298f2a66ebe214aea36dc00bf4c68c24669dc95a26aaa9a0ad256779d90872 +size 9588904 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/adjusting_clothes_ass_v0.1.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/adjusting_clothes_ass_v0.1.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..99790191447ce8a0f992ba6e938b105a1a5ab609 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/adjusting_clothes_ass_v0.1.civitai.info" @@ -0,0 +1,428 @@ +{ + "id": 99733, + "modelId": 93524, + "name": "v0.1", + "createdAt": "2023-06-19T20:31:46.080Z", + "updatedAt": "2023-06-19T20:44:46.720Z", + "trainedWords": [ + "adjusting clothes" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 417, + "ratingCount": 1, + "rating": 5 + }, + "model": { + "name": "Adjusting clothes", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "adjusting_clothes_ass_v0.1.safetensors", + "id": 69566, + "sizeKB": 9351.31640625, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-19T20:36:20.902Z", + "hashes": { + "AutoV1": "676D53DC", + "AutoV2": "D7DEDE0633", + "SHA256": "D7DEDE0633989D432F6AEC05D68908CDB747B4F698A47AA4B379C11BEF1659FE", + "CRC32": "6133735E", + "BLAKE3": "6221520709859B8A46A2757EAD75BFBF09FFCD5A3BAD19BCC54FB878C769562D" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/99733" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/81eeb20b-1982-4ae9-b723-081e4be38bdb/width=450/1211177.jpeg", + "nsfw": "Mature", + "width": 800, + "height": 1200, + "hash": "UCIhHf~W9ZI=%h9a^+-;~A?HXT%MtRocIV-:", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/16b04a62-55a7-4cf7-913c-2fc42c90997e/width=450/1211149.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1536, + "hash": "UJLf%V9G.7~B0}E2%M4.01g3D%RjwHR*-ptR", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1091371557, + "Model": "hassakuHentaiModel_v12", + "steps": 20, + "hashes": { + "vae": "f921fb3f29", + "model": "d3cd6ac55a", + "lora:adjusting_clothes_ass_v0.1": "d7dede0633" + }, + "prompt": " adjusting clothes, \nass focus, close-up, slingshot swimsuit, sweat, fisheye, from below,, masterpiece, best quality, highly detailed", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "adjusting_clothes_ass_v0.1", + "type": "lora", + "weight": 1 + }, + { + "hash": "d3cd6ac55a", + "name": "hassakuHentaiModel_v12", + "type": "model" + } + ], + "Model hash": "d3cd6ac55a", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "(worst quality, low quality:1.4)", + "Denoising strength": "0.3", + "\"adjusting_clothes_ass_v0.1": "3033b798245b\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d3d79693-21b7-45a1-bdcc-6d57540bf254/width=450/1211147.jpeg", + "nsfw": "X", + "width": 512, + "height": 768, + "hash": "UMH.B3~q5;9~9GRks:kW0yMxxDoeQ,RPWAWA", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 4245344312, + "Model": "hassakuHentaiModel_v12", + "steps": 20, + "hashes": { + "vae": "f921fb3f29", + "model": "d3cd6ac55a" + }, + "prompt": "\n1girl, adjusting clothes, multiple boys, ass, bikini, pool,, masterpiece, best quality, highly detailed", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "adjusting_clothes_ass_v0.1", + "type": "lora", + "weight": 1 + }, + { + "hash": "d3cd6ac55a", + "name": "hassakuHentaiModel_v12", + "type": "model" + } + ], + "Model hash": "d3cd6ac55a", + "negativePrompt": "(worst quality, low quality:1.4)", + "\"adjusting_clothes_ass_v0.1": "3033b798245b\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0bec2b47-4bb9-47ab-815d-4cf65d5e1c93/width=450/1211148.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1536, + "hash": "UEHK|g-p0K^,PB-p=xV@tQ?GWYIU~B-:I;E1", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 4245344324, + "Model": "hassakuHentaiModel_v12", + "steps": 20, + "hashes": { + "vae": "f921fb3f29", + "model": "d3cd6ac55a" + }, + "prompt": "\n1girl, adjusting clothes, street, crowd, white shirt, from behind, ass, skirt tug, microskirt,, masterpiece, best quality, highly detailed", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "adjusting_clothes_ass_v0.1", + "type": "lora", + "weight": 1 + }, + { + "hash": "d3cd6ac55a", + "name": "hassakuHentaiModel_v12", + "type": "model" + } + ], + "Model hash": "d3cd6ac55a", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "(worst quality, low quality:1.4)", + "Denoising strength": "0.3", + "\"adjusting_clothes_ass_v0.1": "3033b798245b\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ab3b5128-fcaf-4c74-b591-7d378c5a5a82/width=450/1211150.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1536, + "hash": "UEFrn,_3004npyXSt8Mx.8niozxa~qWAxFWB", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 4245344331, + "Model": "hassakuHentaiModel_v12", + "steps": 20, + "hashes": { + "vae": "f921fb3f29", + "model": "d3cd6ac55a" + }, + "prompt": "\n1girl, adjusting clothes, nightclub, playboy bunny, multiple boys, ass,, masterpiece, best quality, highly detailed", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "adjusting_clothes_ass_v0.1", + "type": "lora", + "weight": 1 + }, + { + "hash": "d3cd6ac55a", + "name": "hassakuHentaiModel_v12", + "type": "model" + } + ], + "Model hash": "d3cd6ac55a", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "(worst quality, low quality:1.4)", + "Denoising strength": "0.3", + "\"adjusting_clothes_ass_v0.1": "3033b798245b\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/81a09dda-7914-4c8f-845d-cda764281978/width=450/1211154.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1536, + "hash": "ULH.HE~B5Q0f%~xWXooz.9x@J:W=.9x[RkWp", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 4245344338, + "Model": "hassakuHentaiModel_v12", + "steps": 20, + "hashes": { + "vae": "f921fb3f29", + "model": "d3cd6ac55a" + }, + "prompt": "\n1girl, adjusting clothes, ass, denim shorts, crop top, blonde hair, park,, masterpiece, best quality, highly detailed", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "adjusting_clothes_ass_v0.1", + "type": "lora", + "weight": 1 + }, + { + "hash": "d3cd6ac55a", + "name": "hassakuHentaiModel_v12", + "type": "model" + } + ], + "Model hash": "d3cd6ac55a", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "(worst quality, low quality:1.4)", + "Denoising strength": "0.3", + "\"adjusting_clothes_ass_v0.1": "3033b798245b\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/82b135d5-07f9-45bc-b5b4-816e26a3bdd0/width=450/1211153.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "U9G8Zg~p000000M{$e%LELxZS*RnR4Io^*-:", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 4245344342, + "Model": "hassakuHentaiModel_v12", + "steps": 20, + "hashes": { + "vae": "f921fb3f29", + "model": "d3cd6ac55a" + }, + "prompt": "\n1girl, adjusting clothes, ass, volleyball uniform, volleyball net, crowd,, masterpiece, best quality, highly detailed", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "adjusting_clothes_ass_v0.1", + "type": "lora", + "weight": 1 + }, + { + "hash": "d3cd6ac55a", + "name": "hassakuHentaiModel_v12", + "type": "model" + } + ], + "Model hash": "d3cd6ac55a", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "(worst quality, low quality:1.4)", + "Denoising strength": "0.3", + "\"adjusting_clothes_ass_v0.1": "3033b798245b\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5076c9cc-0b73-40b4-8fa1-45c4c669f72c/width=450/1211156.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1536, + "hash": "UEKwU%4.01n#~Xr=M{Mx0KIUx^M|8wIox^kD", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1243039611, + "Model": "hassakuHentaiModel_v12", + "steps": 20, + "hashes": { + "vae": "f921fb3f29", + "model": "d3cd6ac55a" + }, + "prompt": "\n1girl, adjusting clothes, ass, close-up, ass focus, intricate, lingerie, lace, shiny skin, white panties, wet,, masterpiece, best quality, highly detailed", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "adjusting_clothes_ass_v0.1", + "type": "lora", + "weight": 1 + }, + { + "hash": "d3cd6ac55a", + "name": "hassakuHentaiModel_v12", + "type": "model" + } + ], + "Model hash": "d3cd6ac55a", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "(worst quality, low quality:1.4)", + "Denoising strength": "0.3", + "\"adjusting_clothes_ass_v0.1": "3033b798245b\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/93cc4c35-be7a-413e-9861-b8cb8b3aa5e4/width=450/1211155.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "UCHewn001viHJV4T={slO[D%b_%2~qRj8_D%", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 4245344348, + "Model": "hassakuHentaiModel_v12", + "steps": 20, + "hashes": { + "vae": "f921fb3f29", + "model": "d3cd6ac55a" + }, + "prompt": "\n1girl, adjusting clothes, ass, tennis uniform, tennis court, crowd, white skirt,, masterpiece, best quality, highly detailed", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "adjusting_clothes_ass_v0.1", + "type": "lora", + "weight": 1 + }, + { + "hash": "d3cd6ac55a", + "name": "hassakuHentaiModel_v12", + "type": "model" + } + ], + "Model hash": "d3cd6ac55a", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "(worst quality, low quality:1.4)", + "Denoising strength": "0.3", + "\"adjusting_clothes_ass_v0.1": "3033b798245b\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/13c577a2-6315-4bc5-8c12-66a2d8a48d0a/width=450/1211152.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1536, + "hash": "UHHxHM?c57tl_4?b_2-;kX?Hx]-:fQ%Lt7of", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1243039606, + "Model": "hassakuHentaiModel_v12", + "steps": 20, + "hashes": { + "vae": "f921fb3f29", + "model": "d3cd6ac55a" + }, + "prompt": "\n1girl, adjusting clothes, ass, maid, lace, skirt, apron, ass peek, thighhighs, skindentation,, masterpiece, best quality, highly detailed", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "adjusting_clothes_ass_v0.1", + "type": "lora", + "weight": 1 + }, + { + "hash": "d3cd6ac55a", + "name": "hassakuHentaiModel_v12", + "type": "model" + } + ], + "Model hash": "d3cd6ac55a", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "(worst quality, low quality:1.4)", + "Denoising strength": "0.3", + "\"adjusting_clothes_ass_v0.1": "3033b798245b\"" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/99733" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/adjusting_clothes_ass_v0.1.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/adjusting_clothes_ass_v0.1.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..61f01848857e6895f63c5ffe0379c536cdea3728 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/adjusting_clothes_ass_v0.1.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:333f124491749a7d4178cc916e0b5158f6f02cab2fd3d73aa5320bfc430c4621 +size 3891485 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/adjusting_clothes_ass_v0.1.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/adjusting_clothes_ass_v0.1.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..84f616e20f229020a817fc62d8af5bccab86493d --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/adjusting_clothes_ass_v0.1.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:d7dede0633989d432f6aec05d68908cdb747b4f698a47aa4b379c11bef1659fe +size 9575748 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/afterSex_v2.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/afterSex_v2.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..824e10c818a7727e722cabb17ba969fd6a10dc49 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/afterSex_v2.civitai.info" @@ -0,0 +1,252 @@ +{ + "id": 50103, + "modelId": 31459, + "name": "v2", + "createdAt": "2023-04-19T18:49:42.768Z", + "updatedAt": "2023-04-19T18:51:48.970Z", + "trainedWords": [ + "after sex", + "condom wrapper", + "used condom", + "pointless condom" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

bug fixed, v2 is Lora not Locon now.

In v2, used condom is the new element. The trigger word is after sex

optional prompt: condom wrapper, used condom, pointless condom

The suggested weight of the Lora is 0.8. You can adjust the weight to fine tune the result

", + "stats": { + "downloadCount": 598, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "after sex", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "afterSex_v2.safetensors", + "id": 36793, + "sizeKB": 36986.421875, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-19T18:56:24.460Z", + "hashes": { + "AutoV1": "A2154210", + "AutoV2": "C332420072", + "SHA256": "C332420072731D9D7674540327177F79F5ADF814F0BE3A91406860BA2A4BCB97", + "CRC32": "2C038419", + "BLAKE3": "AE75D42CE10586B7812FBA8442D929440E3BA14B15E848C6CFE9DB3AB50745C3" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/50103" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/36803aee-6dcf-4ce3-728b-f01d045fa900/width=450/538877.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UKKTc64:s;V_009ZbFxtab~W9ZRj?HIVNGt7", + "meta": { + "Size": "512x512", + "seed": 3378940878, + "Model": "abyssorangemix2_Hard", + "steps": 20, + "hashes": { + "model": "e714ee20aa" + }, + "prompt": "masterpiece, best quality, 1girl, after sex, v-sign , cum on body, condom wrapper, used condom, pointless condom, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "e714ee20aa", + "name": "abyssorangemix2_Hard", + "type": "model" + } + ], + "Model hash": "e714ee20aa", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative, bad anatomy, bad hands, cropped, missing fingers, missing toes, too many toes, too many fingers, missing arms, long neck, missing legs, too many legs, Humpbacked, deformed, disfigured, poorly drawn face, distorted face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, floating limbs, disconnected limbs, malformed hands, out of focus, long body, monochrome, symbol, text, logo, door frame, window frame, mirror frame, text box, ((speech balloons))" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/bdea63b4-52e9-48f1-3b2e-92a207a18800/width=450/538883.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UBLf]t00AUt71X02~B-p9Fxv?aMx?a9t01kV", + "meta": { + "Size": "512x512", + "seed": 2555820935, + "Model": "abyssorangemix2_Hard", + "steps": 20, + "hashes": { + "model": "e714ee20aa" + }, + "prompt": "masterpiece, best quality, 1girl, after sex, condom wrapper, used condom, from back, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "e714ee20aa", + "name": "abyssorangemix2_Hard", + "type": "model" + } + ], + "Model hash": "e714ee20aa", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative, bad anatomy, bad hands, cropped, missing fingers, missing toes, too many toes, too many fingers, missing arms, long neck, missing legs, too many legs, Humpbacked, deformed, disfigured, poorly drawn face, distorted face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, floating limbs, disconnected limbs, malformed hands, out of focus, long body, monochrome, symbol, text, logo, door frame, window frame, mirror frame, text box, ((speech balloons))" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3c490b58-d8fc-4a34-2e82-302cec189400/width=450/538873.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UOH_714pE0-q0JE3xXWB~BRn-;RiE1bIV@R*", + "meta": { + "Size": "512x512", + "seed": 1980037404, + "Model": "abyssorangemix2_Hard", + "steps": 20, + "hashes": { + "model": "e714ee20aa" + }, + "prompt": "masterpiece, best quality, 1girl, after sex, v-sign, condom wrapper, used condom, pointless condom, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "e714ee20aa", + "name": "abyssorangemix2_Hard", + "type": "model" + } + ], + "Model hash": "e714ee20aa", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative, bad anatomy, bad hands, cropped, missing fingers, missing toes, too many toes, too many fingers, missing arms, long neck, missing legs, too many legs, Humpbacked, deformed, disfigured, poorly drawn face, distorted face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, floating limbs, disconnected limbs, malformed hands, out of focus, long body, monochrome, symbol, text, logo, door frame, window frame, mirror frame, text box, ((speech balloons))" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/bce3a573-c662-4db1-a85f-844cab115800/width=450/538875.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UFKdD900_29G0001xs-p#P~q9FIU=@E2I[WA", + "meta": { + "Size": "512x512", + "seed": 3378940878, + "Model": "abyssorangemix2_Hard", + "steps": 20, + "hashes": { + "model": "e714ee20aa" + }, + "prompt": "masterpiece, best quality, 1girl, after sex, t shirt, cum on body, condom wrapper, used condom, pointless condom, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "e714ee20aa", + "name": "abyssorangemix2_Hard", + "type": "model" + } + ], + "Model hash": "e714ee20aa", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative, bad anatomy, bad hands, cropped, missing fingers, missing toes, too many toes, too many fingers, missing arms, long neck, missing legs, too many legs, Humpbacked, deformed, disfigured, poorly drawn face, distorted face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, floating limbs, disconnected limbs, malformed hands, out of focus, long body, monochrome, symbol, text, logo, door frame, window frame, mirror frame, text box, ((speech balloons))" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/dd43ddf3-de46-465b-a8a5-c8d8e5d03300/width=450/538876.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UKLz5JRO00~W0056-pZ$NG-T=|-p9Z~Bxaax", + "meta": { + "Size": "512x512", + "seed": 2715882303, + "Model": "abyssorangemix2_Hard", + "steps": 20, + "hashes": { + "model": "e714ee20aa" + }, + "prompt": "masterpiece, best quality, 1girl, after sex, closed eyes, breast out, cum on body, condom wrapper, used condom, pointless condom, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "e714ee20aa", + "name": "abyssorangemix2_Hard", + "type": "model" + } + ], + "Model hash": "e714ee20aa", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative, bad anatomy, bad hands, cropped, missing fingers, missing toes, too many toes, too many fingers, missing arms, long neck, missing legs, too many legs, Humpbacked, deformed, disfigured, poorly drawn face, distorted face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, floating limbs, disconnected limbs, malformed hands, out of focus, long body, monochrome, symbol, text, logo, door frame, window frame, mirror frame, text box, ((speech balloons))" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2a329d8a-23dc-4544-7638-1445b2a7ab00/width=450/538882.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UCL|J.000~9z0e9GITb_~VIA~VD%9@00o|x]", + "meta": { + "Size": "512x512", + "seed": 359130386, + "Model": "abyssorangemix2_Hard", + "steps": 20, + "hashes": { + "model": "e714ee20aa" + }, + "prompt": "masterpiece, best quality, 1girl, after sex, uniform, breast out, cum on body, condom wrapper, used condom, pointless condom, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "e714ee20aa", + "name": "abyssorangemix2_Hard", + "type": "model" + } + ], + "Model hash": "e714ee20aa", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative, bad anatomy, bad hands, cropped, missing fingers, missing toes, too many toes, too many fingers, missing arms, long neck, missing legs, too many legs, Humpbacked, deformed, disfigured, poorly drawn face, distorted face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, floating limbs, disconnected limbs, malformed hands, out of focus, long body, monochrome, symbol, text, logo, door frame, window frame, mirror frame, text box, ((speech balloons))" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6d17d1d3-b576-48c9-bc53-7ee249c42b00/width=450/538878.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UCI#3|00G5}w01.4IDSc00?s^S$$%d$Tb@I@", + "meta": { + "Size": "512x512", + "seed": 2364051033, + "Model": "abyssorangemix2_Hard", + "steps": 20, + "hashes": { + "model": "e714ee20aa" + }, + "prompt": "masterpiece, best quality, 1girl, after sex, condom wrapper, used condom, pointless condom, facing away, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "e714ee20aa", + "name": "abyssorangemix2_Hard", + "type": "model" + } + ], + "Model hash": "e714ee20aa", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative, bad anatomy, bad hands, cropped, missing fingers, missing toes, too many toes, too many fingers, missing arms, long neck, missing legs, too many legs, Humpbacked, deformed, disfigured, poorly drawn face, distorted face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, floating limbs, disconnected limbs, malformed hands, out of focus, long body, monochrome, symbol, text, logo, door frame, window frame, mirror frame, text box, ((speech balloons))" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/50103" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/afterSex_v2.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/afterSex_v2.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..da6f2caa0a2f3c37c267a759e9bfba58e1a8ac1f Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/afterSex_v2.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/afterSex_v2.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/afterSex_v2.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..f9f44a8f287ca954a70363b605aec541a0dc45f9 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/afterSex_v2.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:c332420072731d9d7674540327177f79f5adf814f0be3a91406860ba2a4bcb97 +size 37874096 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/againstGlass_v1.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/againstGlass_v1.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..1e3a593e5d371800fb1b66cec699e64fa76e4af8 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/againstGlass_v1.civitai.info" @@ -0,0 +1,349 @@ +{ + "id": 38369, + "modelId": 31970, + "name": "v1", + "createdAt": "2023-04-06T17:59:48.264Z", + "updatedAt": "2023-04-06T18:02:12.265Z", + "trainedWords": [ + "against_glass", + "breasts_on_glass" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 1593, + "ratingCount": 1, + "rating": 5 + }, + "model": { + "name": "against glass", + "type": "LoCon", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "againstGlass_v1.safetensors", + "id": 30127, + "sizeKB": 6213.375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-06T18:05:48.295Z", + "hashes": { + "AutoV1": "3018438B", + "AutoV2": "8E00EF2136", + "SHA256": "8E00EF21364DD46041369BD5150F342E80B4889135F737247C56AEB0605BA0CE", + "CRC32": "B24A3C53", + "BLAKE3": "C35D78EAE9A6AE384B68EAA61BD4DC0F7E55AD95272926ACF91F36BD1E436B55" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/38369" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/91d7e442-3763-43d9-94f4-008c9270d900/width=450/424461.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "U8MF?}8_0eELtnyC^*DiC61c4n_38_9Z_Nbv", + "meta": { + "Size": "512x512", + "seed": 3997832035, + "Model": "perfectWorld_v2Baked", + "steps": 20, + "hashes": { + "model": "79e42fb744" + }, + "prompt": "ultra realistic 8k cg, picture-perfect face, flawless, clean, masterpiece, professional artwork, 1girl, blonde_hair, wet, against_glass, breasts_on_glass,shower_(place), cowboy_shot, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "name": "againstGlass_v1", + "type": "lora", + "weight": 1 + }, + { + "hash": "79e42fb744", + "name": "perfectWorld_v2Baked", + "type": "model" + } + ], + "Model hash": "79e42fb744", + "negativePrompt": "(worst quality, low quality:1.3), simple background, logo, watermark, text" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f159e25e-f65d-4c28-3f99-c0a2f4a18d00/width=450/423838.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UIO2mtm,AV-:~qxu?HS4J.M{-;WBMeRjtlV@", + "meta": { + "Size": "512x512", + "seed": 3023823597, + "Model": "anything-v4.5-pruned", + "steps": 20, + "hashes": { + "model": "e4b17ce185" + }, + "prompt": "masterpiece, best quality, 1girl, wet, against_glass, breasts_on_glass, shower_(place), cowboy_shot, ", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "e4b17ce185", + "name": "anything-v4.5-pruned", + "type": "model" + } + ], + "Model hash": "e4b17ce185", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative, bad anatomy, bad hands, cropped, missing fingers, missing toes, too many toes, too many fingers, missing arms, long neck, Humpbacked, deformed, disfigured, poorly drawn face, distorted face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, floating limbs, disconnected limbs, malformed hands, out of focus, long body, monochrome, symbol, text, logo, door frame, window frame, mirror frame, ((nude))" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a85feae2-86c2-4fcd-6628-eade1d9edf00/width=450/424459.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UFLyi-^i71JQpJ4.$NsmBo=|~WkW$P9ZK4Vs", + "meta": { + "Size": "512x512", + "seed": 263000828, + "Model": "perfectWorld_v2Baked", + "steps": 20, + "hashes": { + "model": "79e42fb744" + }, + "prompt": "ultra realistic 8k cg, picture-perfect face, flawless, clean, masterpiece, professional artwork, 1girl, brown_hair, bangs, wet, against_glass, breasts_on_glass,shower_(place), cowboy_shot, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "name": "againstGlass_v1", + "type": "lora", + "weight": 1 + }, + { + "hash": "79e42fb744", + "name": "perfectWorld_v2Baked", + "type": "model" + } + ], + "Model hash": "79e42fb744", + "negativePrompt": "(worst quality, low quality:1.3), simple background, logo, watermark, text" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/08488ce8-d07a-42cb-27ee-02beba533700/width=450/423837.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "U7POb#*#C+~B0NMe^$9Z2u01yq4n:*rF?aEy", + "meta": { + "Size": "512x512", + "seed": 3669983890, + "Model": "anything-v4.5-pruned", + "steps": 20, + "hashes": { + "model": "e4b17ce185" + }, + "prompt": "masterpiece, best quality, 1girl, wet, against_glass, breasts_on_glass, shower_(place), cowboy_shot, ", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "e4b17ce185", + "name": "anything-v4.5-pruned", + "type": "model" + } + ], + "Model hash": "e4b17ce185", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative, bad anatomy, bad hands, cropped, missing fingers, missing toes, too many toes, too many fingers, missing arms, long neck, Humpbacked, deformed, disfigured, poorly drawn face, distorted face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, floating limbs, disconnected limbs, malformed hands, out of focus, long body, monochrome, symbol, text, logo, door frame, window frame, mirror frame, ((nude))" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/42665619-109e-49dc-3d98-7465a9fcbf00/width=450/424442.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UEN]X|m,Po-TO[ai~Wxurqoz.7r?~VIU9Fx[", + "meta": { + "Size": "512x512", + "seed": 3119953082, + "Model": "perfectWorld_v2Baked", + "steps": 20, + "hashes": { + "model": "79e42fb744" + }, + "prompt": "ultra realistic 8k cg, picture-perfect face, flawless, clean, masterpiece, professional artwork, 1girl, against_glass, breasts_on_glass,shower_(place), cowboy_shot, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "name": "againstGlass_v1", + "type": "lora", + "weight": 1 + }, + { + "hash": "79e42fb744", + "name": "perfectWorld_v2Baked", + "type": "model" + } + ], + "Model hash": "79e42fb744", + "negativePrompt": "(worst quality, low quality:1.3), simple background, logo, watermark, text" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2d9a51ae-a792-4cb8-1533-b3a0887ac200/width=450/423835.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UCOC29n4B.R*uPs:={IAyri_%gV@ic9tX-IB", + "meta": { + "Size": "512x512", + "seed": 3573985912, + "Model": "anything-v4.5-pruned", + "steps": 20, + "hashes": { + "model": "e4b17ce185" + }, + "prompt": "masterpiece, best quality, 1girl, bikini, wet, against_glass, breasts_on_glass, shower_(place), cowboy_shot, ", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "e4b17ce185", + "name": "anything-v4.5-pruned", + "type": "model" + } + ], + "Model hash": "e4b17ce185", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative, bad anatomy, bad hands, cropped, missing fingers, missing toes, too many toes, too many fingers, missing arms, long neck, Humpbacked, deformed, disfigured, poorly drawn face, distorted face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, floating limbs, disconnected limbs, malformed hands, out of focus, long body, monochrome, symbol, text, logo, door frame, window frame, mirror frame, ((nude))" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3e48792b-4fc8-483d-7e19-92e143b4a400/width=450/423833.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UFO_~FpcGG?H~pEL^*x[u4I;#lofD%ofx]xu", + "meta": { + "Size": "512x512", + "seed": 741872982, + "Model": "anything-v4.5-pruned", + "steps": 20, + "hashes": { + "model": "e4b17ce185" + }, + "prompt": "masterpiece, best quality, 1girl, wet, against_glass, breasts_on_glass, shower_(place), cowboy_shot, ", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "e4b17ce185", + "name": "anything-v4.5-pruned", + "type": "model" + } + ], + "Model hash": "e4b17ce185", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative, bad anatomy, bad hands, cropped, missing fingers, missing toes, too many toes, too many fingers, missing arms, long neck, Humpbacked, deformed, disfigured, poorly drawn face, distorted face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, floating limbs, disconnected limbs, malformed hands, out of focus, long body, monochrome, symbol, text, logo, door frame, window frame, mirror frame, ((nude))" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f857e2f4-9cff-41a5-9ed5-6c92c412bd00/width=450/423836.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UDOx|0D%UFTd.ms8^P-:5lIA-9%MOYD*%zn5", + "meta": { + "Size": "512x512", + "seed": 3584373176, + "Model": "anything-v4.5-pruned", + "steps": 20, + "hashes": { + "model": "e4b17ce185" + }, + "prompt": "masterpiece, best quality, 1girl, wet, against_glass, breasts_on_glass, shower_(place), cowboy_shot, ", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "e4b17ce185", + "name": "anything-v4.5-pruned", + "type": "model" + } + ], + "Model hash": "e4b17ce185", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative, bad anatomy, bad hands, cropped, missing fingers, missing toes, too many toes, too many fingers, missing arms, long neck, Humpbacked, deformed, disfigured, poorly drawn face, distorted face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, floating limbs, disconnected limbs, malformed hands, out of focus, long body, monochrome, symbol, text, logo, door frame, window frame, mirror frame, ((nude))" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8d2ba763-75a8-4b48-727e-1e84c78b5900/width=450/423834.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UHO{H+~BGDraEmt2?G9G9Gt4.8o#%3xYITNy", + "meta": { + "Size": "512x512", + "seed": 2880003932, + "Model": "anything-v4.5-pruned", + "steps": 20, + "hashes": { + "model": "e4b17ce185" + }, + "prompt": "masterpiece, best quality, 1girl, against_glass, breasts_on_glass, shower_(place), ", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "e4b17ce185", + "name": "anything-v4.5-pruned", + "type": "model" + } + ], + "Model hash": "e4b17ce185", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative, bad anatomy, bad hands, cropped, missing fingers, missing toes, too many toes, too many fingers, missing arms, long neck, Humpbacked, deformed, disfigured, poorly drawn face, distorted face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, floating limbs, disconnected limbs, malformed hands, out of focus, long body, monochrome, symbol, text, logo, door frame, window frame, mirror frame, ((nude))" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6445faa3-15b1-4582-3a2a-f8d3a2fdd400/width=450/423843.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UGPFJ|Di.lm-EOoz%L$k8{kVXQt7^+ozE1V[", + "meta": { + "Size": "512x512", + "seed": 3312881824, + "Model": "anything-v4.5-pruned", + "steps": 20, + "hashes": { + "model": "e4b17ce185" + }, + "prompt": "masterpiece, best quality, 1girl, against_glass, breasts_on_glass, shower_(place), ", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "e4b17ce185", + "name": "anything-v4.5-pruned", + "type": "model" + } + ], + "Model hash": "e4b17ce185", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative, bad anatomy, bad hands, cropped, missing fingers, missing toes, too many toes, too many fingers, missing arms, long neck, Humpbacked, deformed, disfigured, poorly drawn face, distorted face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, floating limbs, disconnected limbs, malformed hands, out of focus, long body, monochrome, symbol, text, logo, door frame, window frame, mirror frame, ((nude))" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/38369" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/againstGlass_v1.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/againstGlass_v1.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..65bd51cb155fcfb0d55eec73b34d5b2f2b9a7c22 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/againstGlass_v1.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/againstGlass_v1.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/againstGlass_v1.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..2f8d8ff2eb55662d025fc54c6566039bdb42f61b --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/againstGlass_v1.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:8e00ef21364dd46041369bd5150f342e80b4889135f737247c56aeb0605ba0ce +size 6362496 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/assOnGlasses_v10.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/assOnGlasses_v10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..c3763afd161cc20b9dc40343b189941a162f920b --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/assOnGlasses_v10.civitai.info" @@ -0,0 +1,89 @@ +{ + "id": 13168, + "modelId": 11114, + "name": "v1.0", + "createdAt": "2023-02-20T16:37:58.682Z", + "updatedAt": "2023-02-20T16:37:58.682Z", + "trainedWords": [ + "masterpiece" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 2383, + "ratingCount": 3, + "rating": 5 + }, + "model": { + "name": "ass_on_glasses", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "assOnGlasses_v10.safetensors", + "id": 11735, + "sizeKB": 73841.3037109375, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-02-20T16:41:17.454Z", + "hashes": { + "AutoV1": "09EF226D", + "AutoV2": "51C32A563B", + "SHA256": "51C32A563B244CEE9DC25C1DB7A1D3A6E00A43B634CA9D98F905140E76930C13", + "CRC32": "E74A78D3", + "BLAKE3": "4501C76F7FEC6BF77A1F47B43304BC59626E14F83471CB89B90627DC93ACAAC5" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/13168" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e60c9ddc-3134-4f45-08da-0707ad6fb100/width=450/127307.jpeg", + "nsfw": true, + "width": 2048, + "height": 2048, + "hash": "UCJa4k.900000N~Dq[4m9J%N^*Mw}]ENo{$y", + "meta": { + "Size": "512x512", + "seed": 4291488421, + "Model": "grapefruitV3_1", + "steps": 50, + "prompt": "beautiful, masterpiece, best quality, extremely detailed face, perfect lighting, 1girl, solo, , 1boy, penis, doggystyle, from behind, backboob, blue hair, breasts, clothed female nude male, clothed sex, clothes lift, clothing aside, facing away, large breasts, long sleeves, medium hair, nude, panties, panties aside, panties under pantyhose, pantyhose, ribbed sweater, skirt, sweat, sweater, sweater lift, torn clothes, torn pantyhose, underwear, white panties, white sweater ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 10, + "Clip skip": "4", + "resources": [ + { + "name": "POVDoggy", + "type": "lora", + "weight": 0.9 + }, + { + "name": "ass_on_glass", + "type": "lora", + "weight": 1 + }, + { + "hash": "4fc8d3739f", + "name": "grapefruitV3_1", + "type": "model" + } + ], + "Model hash": "4fc8d3739f", + "negativePrompt": "(low quality, worst quality:1.4), (bad_prompt:0.8), (monochrome), (greyscale), big ass" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/13168" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/assOnGlasses_v10.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/assOnGlasses_v10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..1aa26bf59922cb0a205de3c8556a1685eecf5322 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/assOnGlasses_v10.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:c9a9652473e6da559a72bb6f8a3407cc9f7777ba444600a52a1ca932e55bf078 +size 1661531 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/assOnGlasses_v10.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/assOnGlasses_v10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..4285ee4b5520e3d3872b684d85d30689577d0771 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/assOnGlasses_v10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:51c32a563b244cee9dc25c1db7a1d3a6e00a43b634ca9d98f905140e76930c13 +size 75613495 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/ass_worship_v0.5a.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/ass_worship_v0.5a.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..5ed828afdb1639cb5a06094b3899e442c0990110 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/ass_worship_v0.5a.civitai.info" @@ -0,0 +1,442 @@ +{ + "id": 88097, + "modelId": 82926, + "name": "v0.5a", + "createdAt": "2023-06-03T02:14:25.127Z", + "updatedAt": "2023-06-03T02:22:02.714Z", + "trainedWords": [ + "ass worship" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 631, + "ratingCount": 2, + "rating": 5 + }, + "model": { + "name": "Ass worship", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "ass_worship_v0.5a.safetensors", + "id": 60388, + "sizeKB": 9341.025390625, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-03T02:15:50.813Z", + "hashes": { + "AutoV1": "E85D3A9C", + "AutoV2": "FDD20D05D5", + "SHA256": "FDD20D05D5C6269D09AC9A1D1B907189FDFED8D9F7DFD4D414EB6326162DA380", + "CRC32": "DB85FC39", + "BLAKE3": "C7EEE09D25A69ABFA955B69A737FF7926C1D7D42B8D01394E407A252103FD8C8" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/88097" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f41b0992-c2fa-4bcf-ba45-7627015a00ee/width=450/1012073.jpeg", + "nsfw": "X", + "width": 800, + "height": 1200, + "hash": "U9H-x:o~00%$O@^jrqSh4T~VEL00xaTJRP4n", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8160e702-08a4-4803-ad43-d13759497a54/width=450/1012088.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1536, + "hash": "UHKAsV%200~qIS9FD%IU-TtS-;xa^+s8M|V@", + "meta": { + "Size": "512x768", + "seed": 3562263195, + "Model": "anylora_novaeFp16Pruned", + "steps": 20, + "hashes": { + "model": "b0c91a8a93" + }, + "prompt": "\nass worship, 1girl, 1boy, \n kitagawa marin, gojou wakana,, masterpiece, best quality, highly detailed", + "Version": "v1.3.1", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "ass_worship_v0.5a", + "type": "lora", + "weight": 1.2 + }, + { + "hash": "b0c91a8a93", + "name": "anylora_novaeFp16Pruned", + "type": "model" + } + ], + "Model hash": "b0c91a8a93", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "(worst quality, low quality:1.4)", + "sono-bisque_v4.0b": "3f7d276d99ce\"", + "\"ass_worship_v0.5a": "07d9db31aba2", + "Denoising strength": "0.3" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c4530a79-178a-47ba-97ac-f84f0a411652/width=450/1012052.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1536, + "hash": "U9H-x:kr00%$PA^jrqSh4T~VEL00xtTJM{4n", + "meta": { + "Size": "512x768", + "seed": 808923126, + "Model": "anylora_novaeFp16Pruned", + "steps": 20, + "hashes": { + "model": "b0c91a8a93" + }, + "prompt": "\nass worship, 1girl, 1boy, looking back,, masterpiece, best quality, highly detailed", + "Version": "v1.3.1", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "ass_worship_v0.5a", + "type": "lora", + "weight": 1 + }, + { + "hash": "b0c91a8a93", + "name": "anylora_novaeFp16Pruned", + "type": "model" + } + ], + "Model hash": "b0c91a8a93", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "(worst quality, low quality:1.4)", + "\"ass_worship_v0.5a": "07d9db31aba2\"", + "Denoising strength": "0.3" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4d5b13be-b993-4b9e-bf30-b3e8839d8fec/width=450/1012050.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1536, + "hash": "UFKAyZ00pa4:_N00-p^*00$%%NbGR5^+E1IU", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3943624450, + "Model": "perfectWorld_perfectWorld", + "steps": 20, + "hashes": { + "model": "5cec660d69" + }, + "prompt": "\n(ass worship:1.0), 1girl, multiple girls, 2girls, \n, masterpiece, best quality, highly detailed", + "Version": "v1.3.1", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "ass_worship_v0.5a", + "type": "lora", + "weight": 1 + }, + { + "name": "koreandolllikenessV20_v20", + "type": "lora", + "weight": 0.3 + }, + { + "hash": "5cec660d69", + "name": "perfectWorld_perfectWorld", + "type": "model" + } + ], + "Model hash": "5cec660d69", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "(worst quality, low quality:1.4)", + "\"ass_worship_v0.5a": "07d9db31aba2", + "Denoising strength": "0.3", + "koreandolllikenessV20_v20": "8f3d16e6eada\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7ccfe766-4dda-4274-bd69-db87bcc425e2/width=450/1012057.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1536, + "hash": "UBIN{w^QEg-;01004o_39u?a~pNx~BE2E1RP", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3943624447, + "Model": "anylora_novaeFp16Pruned", + "steps": 20, + "hashes": { + "model": "b0c91a8a93" + }, + "prompt": "\n(ass worship:1.0), 1girl, multiple girls, 2girls,, masterpiece, best quality, highly detailed", + "Version": "v1.3.1", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "ass_worship_v0.5a", + "type": "lora", + "weight": 1 + }, + { + "hash": "b0c91a8a93", + "name": "anylora_novaeFp16Pruned", + "type": "model" + } + ], + "Model hash": "b0c91a8a93", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "(worst quality, low quality:1.4)", + "\"ass_worship_v0.5a": "07d9db31aba2\"", + "Denoising strength": "0.3" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/af1c69dc-dbcb-4969-8e63-8fd4abc62d57/width=450/1012054.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1536, + "hash": "UCIqr,~U00~Wk7_3s7xu004n0g9ZDh4.a$NH", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 797949204, + "Model": "perfectWorld_perfectWorld", + "steps": 20, + "hashes": { + "model": "5cec660d69" + }, + "prompt": "\n(ass worship:1.0), 1girl, 1boy, face, office lady, \n, masterpiece, best quality, highly detailed", + "Version": "v1.3.1", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "ass_worship_v0.5a", + "type": "lora", + "weight": 1 + }, + { + "name": "koreandolllikenessV20_v20", + "type": "lora", + "weight": 0.3 + }, + { + "hash": "5cec660d69", + "name": "perfectWorld_perfectWorld", + "type": "model" + } + ], + "Model hash": "5cec660d69", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "(worst quality, low quality:1.4)", + "\"ass_worship_v0.5a": "07d9db31aba2", + "Denoising strength": "0.3", + "koreandolllikenessV20_v20": "8f3d16e6eada\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/dd3d9eec-9d89-46a5-a9dd-2069dab16b37/width=450/1012053.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1536, + "hash": "UOHw}q~WNFxZ9u%L%Lt79GIoIpM|tRM{M{M{", + "meta": { + "Size": "512x768", + "seed": 808923129, + "Model": "anylora_novaeFp16Pruned", + "steps": 20, + "hashes": { + "model": "b0c91a8a93" + }, + "prompt": "\nass worship, 1girl, 1boy, looking back,, masterpiece, best quality, highly detailed", + "Version": "v1.3.1", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "ass_worship_v0.5a", + "type": "lora", + "weight": 1 + }, + { + "hash": "b0c91a8a93", + "name": "anylora_novaeFp16Pruned", + "type": "model" + } + ], + "Model hash": "b0c91a8a93", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "(worst quality, low quality:1.4)", + "\"ass_worship_v0.5a": "07d9db31aba2\"", + "Denoising strength": "0.3" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a2d7cda8-ce8a-414d-a739-514799bb4251/width=450/1012051.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1536, + "hash": "UJKAsQEM?bxZTd~V%29t9Z~V?HxFH?S#kW9Z", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 797949196, + "Model": "perfectWorld_perfectWorld", + "steps": 20, + "hashes": { + "model": "5cec660d69" + }, + "prompt": "\n(ass worship:1.0), 1girl, multiple girls, 2girls, \n, masterpiece, best quality, highly detailed", + "Version": "v1.3.1", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "ass_worship_v0.5a", + "type": "lora", + "weight": 1 + }, + { + "name": "koreandolllikenessV20_v20", + "type": "lora", + "weight": 0.3 + }, + { + "hash": "5cec660d69", + "name": "perfectWorld_perfectWorld", + "type": "model" + } + ], + "Model hash": "5cec660d69", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "(worst quality, low quality:1.4)", + "\"ass_worship_v0.5a": "07d9db31aba2", + "Denoising strength": "0.3", + "koreandolllikenessV20_v20": "8f3d16e6eada\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/030f4d39-1f71-4989-ac0e-80d20affbfa5/width=450/1012056.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1536, + "hash": "ULH_V:XTXn~qFft7ae%gIUMxIURk-ot7IVIU", + "meta": { + "Size": "512x768", + "seed": 808923127, + "Model": "anylora_novaeFp16Pruned", + "steps": 20, + "hashes": { + "model": "b0c91a8a93" + }, + "prompt": "\nass worship, 1girl, 1boy, looking back,, masterpiece, best quality, highly detailed", + "Version": "v1.3.1", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "ass_worship_v0.5a", + "type": "lora", + "weight": 1 + }, + { + "hash": "b0c91a8a93", + "name": "anylora_novaeFp16Pruned", + "type": "model" + } + ], + "Model hash": "b0c91a8a93", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "(worst quality, low quality:1.4)", + "\"ass_worship_v0.5a": "07d9db31aba2\"", + "Denoising strength": "0.3" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1f4234fa-0116-4116-b3a4-3815e3eabc80/width=450/1012058.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1536, + "hash": "UTHej$~pS[NXOYkFxb%KRpxva%IV^+xvNHRQ", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 797949198, + "Model": "perfectWorld_perfectWorld", + "steps": 20, + "hashes": { + "model": "5cec660d69" + }, + "prompt": "\n(ass worship:1.0), 1girl, 1boy, face,\n, masterpiece, best quality, highly detailed", + "Version": "v1.3.1", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "ass_worship_v0.5a", + "type": "lora", + "weight": 1 + }, + { + "name": "koreandolllikenessV20_v20", + "type": "lora", + "weight": 0.3 + }, + { + "hash": "5cec660d69", + "name": "perfectWorld_perfectWorld", + "type": "model" + } + ], + "Model hash": "5cec660d69", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "(worst quality, low quality:1.4)", + "\"ass_worship_v0.5a": "07d9db31aba2", + "Denoising strength": "0.3", + "koreandolllikenessV20_v20": "8f3d16e6eada\"" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/88097" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/ass_worship_v0.5a.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/ass_worship_v0.5a.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..2c621025b4a92af2538456f75746c90f8467c225 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/ass_worship_v0.5a.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:2105d999f5e2f008c00f9b2b4d528e12fc6eb97bd5deeac4b561f13fa58681ca +size 3127881 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/ass_worship_v0.5a.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/ass_worship_v0.5a.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..302f93cade234e91d88d0f65f24dc38a4754b91b --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/ass_worship_v0.5a.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:fdd20d05d5c6269d09ac9a1d1b907189fdfed8d9f7dfd4d414eb6326162da380 +size 9565210 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/bikinipull.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/bikinipull.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..9a80dfb8a3e4b75f1d2f4f5bf66932d3d4bb014d --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/bikinipull.civitai.info" @@ -0,0 +1,423 @@ +{ + "id": 59933, + "modelId": 55533, + "name": "v1.0", + "createdAt": "2023-05-01T16:47:49.428Z", + "updatedAt": "2023-05-01T16:55:50.761Z", + "trainedWords": [ + "bikinipull" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

Trained on 48 images

", + "stats": { + "downloadCount": 680, + "ratingCount": 2, + "rating": 5 + }, + "model": { + "name": "Bikinipull", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "bikinipull.safetensors", + "id": 42498, + "sizeKB": 147574.7353515625, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-01T16:56:10.022Z", + "hashes": { + "AutoV1": "7C2EE985", + "AutoV2": "E26E778F72", + "SHA256": "E26E778F723A0E668AF08923E8792151CC19024E3ECBE4EFF598ECE9CA6D2B40", + "CRC32": "F73BE93F", + "BLAKE3": "FBD555CFE993302FB3D3C5AE7BD01C2AF2CCECC4FCA6EC866970AE13A1169745" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/59933" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7aba126d-e075-4ce8-b4d4-d8cab2153300/width=450/654118.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1536, + "hash": "UEIg$E_N1K~pPU-;-n%1Y7-=^+EL?v?bxvI=", + "meta": { + "Size": "512x768", + "seed": 254730150, + "Model": "Realistic_chilloutmix_NiPrunedFp32Fix", + "steps": 30, + "hashes": { + "model": "fc2511737a" + }, + "prompt": "(8k, best quality, masterpiece, ultra highres:1.2), 1girl full body bikinipull, , beautiful 22 year old girl named Miki wearing black bikini with breasts exposed, medium breasts, hard perky nipples, tight body, athletic body, raised eyebrow, red hair, wet hair, wet body, smokey eyeliner, sheer lipstick, mascara, fan earrings, gold necklace, lake, cute face blush smiling, sweaty glistening skin, intricately detailed face, intricately detailed eyes, dynamic pose, analogue RAW DSLR, official art, extremely detailed CG unity 8k wallpaper, professional photography, sharp focus, HDR, 8K resolution, intricate detail, sophisticated detail, depth of field, photorealistic", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "name": "bikinipull_v10", + "type": "lora", + "weight": 0.65 + }, + { + "hash": "fc2511737a", + "name": "Realistic_chilloutmix_NiPrunedFp32Fix", + "type": "model" + } + ], + "Model hash": "fc2511737a", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "badhandv4, ng_deepnegative_v1_75t, extra fingers, fewer fingers, extra digit, bad hands, hairy, deformed nipples, pubic hair, head cut off, Easy Negative, paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans,((watermark:2)),(white letters:1), (multi nipples), bad anatomy, bad hands, text, error, missing fingers, fewer digits, cropped, jpeg artifacts, signature, watermark, username, bad feet, Multiple people, mutation, deformed, long neck, cross-eyed, mutated hands, polar lowres, bad proportions, gross proportions, abdominal stretch, glans, pants, briefs, knickers, kecks, fused fingers, bad body", + "Face restoration": "CodeFormer", + "Denoising strength": "0.2" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/84e89e8c-34c0-4ec4-c031-bc7c12382600/width=450/654181.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1536, + "hash": "UDHT~o0100={01~BRjR+0f-oxaR*^jEMadV@", + "meta": { + "Size": "512x768", + "seed": 2476071146, + "Model": "Realistic_braBeautifulRealistic_v40", + "steps": 30, + "hashes": { + "model": "9c03252bea" + }, + "prompt": "(8k, best quality, masterpiece, ultra highres:1.2), 1girl full body bikinipull, , beautiful 22 year old girl named Natsuko wearing orange bikini with breasts exposed, perfect breasts, hard perky nipples, tight body, athletic body, ruby hair, Wavy Lob Hair, hair intakes, wet hair, wet body, graphic eyeliner, satin lipstick, lip liner, leaf earrings, princess necklace, shower, cute face blush smiling, sweaty glistening skin, intricately detailed face, intricately detailed eyes, dynamic pose, analogue RAW DSLR, official art, extremely detailed CG unity 8k wallpaper, professional photography, sharp focus, HDR, 8K resolution, intricate detail, sophisticated detail, depth of field, photorealistic", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "name": "bikinipull_v10", + "type": "lora", + "weight": 0.65 + }, + { + "hash": "9c03252bea", + "name": "Realistic_braBeautifulRealistic_v40", + "type": "model" + } + ], + "Model hash": "9c03252bea", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "badhandv4, ng_deepnegative_v1_75t, extra fingers, fewer fingers, extra digit, bad hands, hairy, deformed nipples, pubic hair, head cut off, Easy Negative, paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans,((watermark:2)),(white letters:1), (multi nipples), bad anatomy, bad hands, text, error, missing fingers, fewer digits, cropped, jpeg artifacts, signature, watermark, username, bad feet, Multiple people, mutation, deformed, long neck, cross-eyed, mutated hands, polar lowres, bad proportions, gross proportions, abdominal stretch, glans, pants, briefs, knickers, kecks, fused fingers, bad body", + "Face restoration": "CodeFormer", + "Denoising strength": "0.2" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e80cda2b-2837-4fdf-edc5-2c221178d700/width=450/654192.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1536, + "hash": "U7Hw=D0L00}?00w|8_XT0yx]~Bs:0}E1og?G", + "meta": { + "Size": "512x768", + "seed": 394196755, + "Model": "Realistic_realisticVisionV13_v13", + "steps": 30, + "hashes": { + "model": "c35782bad8" + }, + "prompt": "(8k, best quality, masterpiece, ultra highres:1.2), 1girl full body bikinipull, , beautiful 22 year old Emirati girl named Naomi wearing yellow bikini with breasts exposed, large breasts, hard perky nipples, tight body, athletic body, parted lips, blonde hair, wet hair, colored eyeliner, metallic lipstick, primer, linear earrings, princess necklace, jacuzzi, cute face blush smiling, sweaty glistening skin, intricately detailed face, intricately detailed eyes, dynamic pose, analogue RAW DSLR, official art, extremely detailed CG unity 8k wallpaper, professional photography, sharp focus, HDR, 8K resolution, intricate detail, sophisticated detail, depth of field, photorealistic", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "name": "bikinipull_v10", + "type": "lora", + "weight": 0.65 + }, + { + "hash": "c35782bad8", + "name": "Realistic_realisticVisionV13_v13", + "type": "model" + } + ], + "Model hash": "c35782bad8", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "badhandv4, ng_deepnegative_v1_75t, extra fingers, fewer fingers, extra digit, bad hands, hairy, deformed nipples, pubic hair, head cut off, Easy Negative, paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans,((watermark:2)),(white letters:1), (multi nipples), bad anatomy, bad hands, text, error, missing fingers, fewer digits, cropped, jpeg artifacts, signature, watermark, username, bad feet, Multiple people, mutation, deformed, long neck, cross-eyed, mutated hands, polar lowres, bad proportions, gross proportions, abdominal stretch, glans, pants, briefs, knickers, kecks, fused fingers, bad body", + "Face restoration": "CodeFormer", + "Denoising strength": "0.2" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/67c4a37d-de67-4ceb-8941-9f0856fa0b00/width=450/654183.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1536, + "hash": "UMKA~M00LN-TtkDiwHR*kroz%0M{%gM{NGM{", + "meta": { + "Size": "512x768", + "seed": 3861545263, + "Model": "Realistic_braBeautifulRealistic_v40", + "steps": 30, + "hashes": { + "model": "9c03252bea" + }, + "prompt": "(8k, best quality, masterpiece, ultra highres:1.2), 1girl full body bikinipull, , beautiful 22 year old girl named Miki wearing purple bikini with breasts exposed, medium breasts, hard perky nipples, tight body, athletic body, copper blonde hair, hair over one eye, wet hair, wet body, graphic eyeliner, metallic lipstick, eye shadow, tulip earrings, lariat necklace, lake, cute face blush smiling, sweaty glistening skin, intricately detailed face, intricately detailed eyes, dynamic pose, analogue RAW DSLR, official art, extremely detailed CG unity 8k wallpaper, professional photography, sharp focus, HDR, 8K resolution, intricate detail, sophisticated detail, depth of field, photorealistic", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "name": "bikinipull_v10", + "type": "lora", + "weight": 0.65 + }, + { + "hash": "9c03252bea", + "name": "Realistic_braBeautifulRealistic_v40", + "type": "model" + } + ], + "Model hash": "9c03252bea", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "badhandv4, ng_deepnegative_v1_75t, extra fingers, fewer fingers, extra digit, bad hands, hairy, deformed nipples, pubic hair, head cut off, Easy Negative, paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans,((watermark:2)),(white letters:1), (multi nipples), bad anatomy, bad hands, text, error, missing fingers, fewer digits, cropped, jpeg artifacts, signature, watermark, username, bad feet, Multiple people, mutation, deformed, long neck, cross-eyed, mutated hands, polar lowres, bad proportions, gross proportions, abdominal stretch, glans, pants, briefs, knickers, kecks, fused fingers, bad body", + "Face restoration": "CodeFormer", + "Denoising strength": "0.2" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/889ef09b-2806-43d8-4590-9f0123122500/width=450/654140.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1536, + "hash": "URLDc7_47#.SAZ%2$LozkrM{-oR*-;s.j]t7", + "meta": { + "Size": "512x768", + "seed": 254730164, + "Model": "Realistic_chilloutmix_NiPrunedFp32Fix", + "steps": 30, + "hashes": { + "model": "fc2511737a" + }, + "prompt": "(8k, best quality, masterpiece, ultra highres:1.2), 1girl full body bikinipull, , beautiful 22 year old girl named Joo-hyun wearing red bikini with breasts exposed, medium breasts, hard perky nipples, tight body, athletic body, pout, black hair, wet hair, wet body, colored eyeliner, gloss lipstick, primer, mismatched earrings, tassel necklace, lake, cute face blush smiling, sweaty glistening skin, intricately detailed face, intricately detailed eyes, dynamic pose, analogue RAW DSLR, official art, extremely detailed CG unity 8k wallpaper, professional photography, sharp focus, HDR, 8K resolution, intricate detail, sophisticated detail, depth of field, photorealistic", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "name": "bikinipull_v10", + "type": "lora", + "weight": 0.65 + }, + { + "hash": "fc2511737a", + "name": "Realistic_chilloutmix_NiPrunedFp32Fix", + "type": "model" + } + ], + "Model hash": "fc2511737a", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "badhandv4, ng_deepnegative_v1_75t, extra fingers, fewer fingers, extra digit, bad hands, hairy, deformed nipples, pubic hair, head cut off, Easy Negative, paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans,((watermark:2)),(white letters:1), (multi nipples), bad anatomy, bad hands, text, error, missing fingers, fewer digits, cropped, jpeg artifacts, signature, watermark, username, bad feet, Multiple people, mutation, deformed, long neck, cross-eyed, mutated hands, polar lowres, bad proportions, gross proportions, abdominal stretch, glans, pants, briefs, knickers, kecks, fused fingers, bad body", + "Face restoration": "CodeFormer", + "Denoising strength": "0.2" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3916c35d-c419-453b-a707-ea2aa1a98e00/width=450/654184.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1536, + "hash": "UAGt+%tR00~V0Ln%xWE200M{}@en?GxZWXNG", + "meta": { + "Size": "512x768", + "seed": 1585842086, + "Model": "Realistic_braBeautifulRealistic_v40", + "steps": 30, + "hashes": { + "model": "9c03252bea" + }, + "prompt": "(8k, best quality, masterpiece, ultra highres:1.2), 1girl full body bikinipull, , beautiful 22 year old girl named Akiko wearing yellow bikini with breasts exposed, petite breasts, hard perky nipples, tight body, athletic body, copper blonde hair, Long Layered Haircut, wet hair, wet body, dramatic eyeliner, metallic lipstick, eye liner, chandelier earrings, torque necklace, jacuzzi, cute face blush smiling, sweaty glistening skin, intricately detailed face, intricately detailed eyes, dynamic pose, analogue RAW DSLR, official art, extremely detailed CG unity 8k wallpaper, professional photography, sharp focus, HDR, 8K resolution, intricate detail, sophisticated detail, depth of field, photorealistic", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "name": "bikinipull_v10", + "type": "lora", + "weight": 0.65 + }, + { + "hash": "9c03252bea", + "name": "Realistic_braBeautifulRealistic_v40", + "type": "model" + } + ], + "Model hash": "9c03252bea", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "badhandv4, ng_deepnegative_v1_75t, extra fingers, fewer fingers, extra digit, bad hands, hairy, deformed nipples, pubic hair, head cut off, Easy Negative, paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans,((watermark:2)),(white letters:1), (multi nipples), bad anatomy, bad hands, text, error, missing fingers, fewer digits, cropped, jpeg artifacts, signature, watermark, username, bad feet, Multiple people, mutation, deformed, long neck, cross-eyed, mutated hands, polar lowres, bad proportions, gross proportions, abdominal stretch, glans, pants, briefs, knickers, kecks, fused fingers, bad body", + "Face restoration": "CodeFormer", + "Denoising strength": "0.2" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/12933897-62e1-4fb1-5064-366d88314000/width=450/654135.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1536, + "hash": "UCI:wUR*00^j5Rxa-A%19ZoL~Bxt5RxaIV9u", + "meta": { + "Size": "512x768", + "seed": 254730134, + "Model": "Realistic_chilloutmix_NiPrunedFp32Fix", + "steps": 30, + "hashes": { + "model": "fc2511737a" + }, + "prompt": "(8k, best quality, masterpiece, ultra highres:1.2), 1girl full body bikinipull, , beautiful 22 year old girl named Chikako wearing red bikini with breasts exposed, large breasts, hard perky nipples, tight body, athletic body, pout, black hair, wet hair, wet body, tightline eyeliner, gloss lipstick, lip balm, cuff earrings, torque necklace, shower, cute face blush smiling, sweaty glistening skin, intricately detailed face, intricately detailed eyes, dynamic pose, analogue RAW DSLR, official art, extremely detailed CG unity 8k wallpaper, professional photography, sharp focus, HDR, 8K resolution, intricate detail, sophisticated detail, depth of field, photorealistic", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "name": "bikinipull_v10", + "type": "lora", + "weight": 0.65 + }, + { + "hash": "fc2511737a", + "name": "Realistic_chilloutmix_NiPrunedFp32Fix", + "type": "model" + } + ], + "Model hash": "fc2511737a", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "badhandv4, ng_deepnegative_v1_75t, extra fingers, fewer fingers, extra digit, bad hands, hairy, deformed nipples, pubic hair, head cut off, Easy Negative, paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans,((watermark:2)),(white letters:1), (multi nipples), bad anatomy, bad hands, text, error, missing fingers, fewer digits, cropped, jpeg artifacts, signature, watermark, username, bad feet, Multiple people, mutation, deformed, long neck, cross-eyed, mutated hands, polar lowres, bad proportions, gross proportions, abdominal stretch, glans, pants, briefs, knickers, kecks, fused fingers, bad body", + "Face restoration": "CodeFormer", + "Denoising strength": "0.2" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/61e3c69f-4793-4688-98e1-d4b699d8f200/width=450/654185.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1536, + "hash": "UGGRVU~p0L-Utl?a-oR*9a%L?HIokCWWf7ay", + "meta": { + "Size": "512x768", + "seed": 2577748228, + "Model": "Realistic_braBeautifulRealistic_v40", + "steps": 30, + "hashes": { + "model": "9c03252bea" + }, + "prompt": "(8k, best quality, masterpiece, ultra highres:1.2), 1girl full body bikinipull, beautiful 22 year old girl named Noa wearing black bikini with breasts exposed, , medium breasts, hard perky nipples, tight body, athletic body, strawberry blonde hair, fringed bangs, wet hair, wet body, tightline eyeliner, stain lipstick, primer, front-back earrings, leather choker with pendant, public shower, cute face blush smiling, sweaty glistening skin, intricately detailed face, intricately detailed eyes, dynamic pose, analogue RAW DSLR, official art, extremely detailed CG unity 8k wallpaper, professional photography, sharp focus, HDR, 8K resolution, intricate detail, sophisticated detail, depth of field, photorealistic", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "name": "bikinipull", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "9c03252bea", + "name": "Realistic_braBeautifulRealistic_v40", + "type": "model" + } + ], + "Model hash": "9c03252bea", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "badhandv4, ng_deepnegative_v1_75t, extra fingers, fewer fingers, extra digit, bad hands, hairy, deformed nipples, pubic hair, head cut off, Easy Negative, paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans,((watermark:2)),(white letters:1), (multi nipples), bad anatomy, bad hands, text, error, missing fingers, fewer digits, cropped, jpeg artifacts, signature, watermark, username, bad feet, Multiple people, mutation, deformed, long neck, cross-eyed, mutated hands, polar lowres, bad proportions, gross proportions, abdominal stretch, glans, pants, briefs, knickers, kecks, fused fingers, bad body", + "Face restoration": "CodeFormer", + "Denoising strength": "0.2" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e98a6dc3-7a03-467e-a7b1-68ed1647ad00/width=450/654137.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1536, + "hash": "U9JG{1Mc0N_3004.^Jvz0gMI~pNG%~NF^l9v", + "meta": { + "Size": "512x768", + "seed": 254730145, + "Model": "Realistic_chilloutmix_NiPrunedFp32Fix", + "steps": 30, + "hashes": { + "model": "fc2511737a" + }, + "prompt": "(8k, best quality, masterpiece, ultra highres:1.2), 1girl full body bikinipull, , beautiful 22 year old girl named Nana wearing blue bikini with breasts exposed, petite breasts, hard perky nipples, tight body, athletic body, stifled laugh, red hair, wet hair, wet body, graphic eyeliner, sheer lipstick, foundation, huggie earrings, sautoir necklace, lake, cute face blush smiling, sweaty glistening skin, intricately detailed face, intricately detailed eyes, dynamic pose, analogue RAW DSLR, official art, extremely detailed CG unity 8k wallpaper, professional photography, sharp focus, HDR, 8K resolution, intricate detail, sophisticated detail, depth of field, photorealistic", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "name": "bikinipull_v10", + "type": "lora", + "weight": 0.65 + }, + { + "hash": "fc2511737a", + "name": "Realistic_chilloutmix_NiPrunedFp32Fix", + "type": "model" + } + ], + "Model hash": "fc2511737a", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "badhandv4, ng_deepnegative_v1_75t, extra fingers, fewer fingers, extra digit, bad hands, hairy, deformed nipples, pubic hair, head cut off, Easy Negative, paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans,((watermark:2)),(white letters:1), (multi nipples), bad anatomy, bad hands, text, error, missing fingers, fewer digits, cropped, jpeg artifacts, signature, watermark, username, bad feet, Multiple people, mutation, deformed, long neck, cross-eyed, mutated hands, polar lowres, bad proportions, gross proportions, abdominal stretch, glans, pants, briefs, knickers, kecks, fused fingers, bad body", + "Face restoration": "CodeFormer", + "Denoising strength": "0.2" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5b234eea-cf92-442d-e3a4-25978d4b1600/width=450/654186.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1536, + "hash": "UcKKTd?ayYtR.TNcx]RjtlM{%2aK-qoJflay", + "meta": { + "Size": "512x768", + "seed": 2813715525, + "Model": "Realistic_braBeautifulRealistic_v40", + "steps": 30, + "hashes": { + "model": "9c03252bea" + }, + "prompt": "(8k, best quality, masterpiece, ultra highres:1.2), 1girl full body bikinipull, beautiful 22 year old girl named Nguyet wearing red bikini with breasts exposed, , medium breasts, hard perky nipples, tight body, athletic body, white hair, Tapered Layered, wet hair, wet body, pencil eyeliner, matte lipstick, nail polish, crawler earrings, diamond necklace, beach, cute face blush smiling, sweaty glistening skin, intricately detailed face, intricately detailed eyes, dynamic pose, analogue RAW DSLR, official art, extremely detailed CG unity 8k wallpaper, professional photography, sharp focus, HDR, 8K resolution, intricate detail, sophisticated detail, depth of field, photorealistic", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "name": "bikinipull", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "9c03252bea", + "name": "Realistic_braBeautifulRealistic_v40", + "type": "model" + } + ], + "Model hash": "9c03252bea", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "badhandv4, ng_deepnegative_v1_75t, extra fingers, fewer fingers, extra digit, bad hands, hairy, deformed nipples, pubic hair, head cut off, Easy Negative, paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans,((watermark:2)),(white letters:1), (multi nipples), bad anatomy, bad hands, text, error, missing fingers, fewer digits, cropped, jpeg artifacts, signature, watermark, username, bad feet, Multiple people, mutation, deformed, long neck, cross-eyed, mutated hands, polar lowres, bad proportions, gross proportions, abdominal stretch, glans, pants, briefs, knickers, kecks, fused fingers, bad body", + "Face restoration": "CodeFormer", + "Denoising strength": "0.2" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/59933" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/bikinipull.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/bikinipull.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..720ee2fab2163d265666f862a78d2cdc3ebfbea0 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/bikinipull.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:df2c98487714b5608b2ecf07fd24be403a3683e9c6b1ecff1319ab5556e78cbf +size 2011119 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/bikinipull.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/bikinipull.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..9d7ec7c5b0173023681c5f4288c2d7d7212042a4 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/bikinipull.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:e26e778f723a0e668af08923e8792151cc19024e3ecbe4eff598ece9ca6d2b40 +size 151116529 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/bouncingBreasts_v1.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/bouncingBreasts_v1.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..772d404e7fd7c31928cb8e7f6dd58fe9add1eaf5 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/bouncingBreasts_v1.civitai.info" @@ -0,0 +1,164 @@ +{ + "id": 27594, + "modelId": 23100, + "name": "v1", + "createdAt": "2023-03-23T00:30:52.644Z", + "updatedAt": "2023-03-23T00:42:17.985Z", + "trainedWords": [ + "bouncing breasts" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "model": { + "name": "Bouncing breasts", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "bouncingBreasts_v1.safetensors", + "id": 22809, + "sizeKB": 30062.8740234375, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-03-23T00:35:40.855Z", + "hashes": { + "AutoV1": "6F105785", + "AutoV2": "BD2ED4CF3D", + "SHA256": "BD2ED4CF3D06100958244DA2F9041C18CA1E8D03829B565EF72F511EEA68F623", + "CRC32": "D39D93A8", + "BLAKE3": "50190766AA1F41535A91E651A9E3AFE5B2B7E302A483370FB983BC9E5C5AD7CD" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/27594" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ce8d7371-dc5f-4489-1d41-927e7e59b400/width=450/304075.jpeg", + "nsfw": true, + "width": 1024, + "height": 1408, + "hash": "UPKKysv}80yC04GHv%vfNYTLwHv|KkFfX9I:", + "meta": { + "ENSD": "31337", + "Size": "512x704", + "seed": 1141548183, + "steps": 50, + "prompt": "1girl, bikini, bouncing breasts, pom pom, beach, medium breasts, holding pom poms, cheerleader, pom pom \\(cheerleading\\), underboob, crop top, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "Bouncing_11085", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "0fc198c490", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "worst quality, low quality, bad anatomy, blurry, signature, watermark, bad hands, missing fingers, extra fingers, censored, censorship, jpeg artifacts, simple background, loli, children", + "Denoising strength": "0.55" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/fb54b4a9-9b56-4ffc-2f2a-86c398c10100/width=450/304078.jpeg", + "nsfw": true, + "width": 1024, + "height": 1408, + "hash": "UBK0y.Ek000f~nD*=|OEKO$+%19GRQs:%gIU", + "meta": { + "ENSD": "31337", + "Size": "512x704", + "seed": 335261559, + "steps": 50, + "prompt": "1girl, indoors, [huge breasts], (bouncing breasts:1.2), (pink pajamas:1.2), best quality, masterpiece, covered nipples, (open clothes, center opening, cleavage:1.2), navel, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "Bouncing_11085", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "0fc198c490", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "worst quality, low quality, bad anatomy, blurry, signature, watermark, bad hands, missing fingers, extra fingers, censored, censorship, jpeg artifacts, simple background", + "Denoising strength": "0.55" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5007f239-e6f4-4845-396e-314d8e643c00/width=450/304077.jpeg", + "nsfw": false, + "width": 1024, + "height": 1408, + "hash": "UKHUzz_3ouxu~p-;%Lj@4.R*?HxaV@oft7kC", + "meta": { + "ENSD": "31337", + "Size": "512x704", + "seed": 1445380316, + "steps": 50, + "prompt": "1girl, bouncing breasts, medium breasts, sweater, pants, best quality, masterpiece ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "Bouncing_11085", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "0fc198c490", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "worst quality, low quality, bad anatomy, blurry, signature, watermark, bad hands, missing fingers, extra fingers, censored, censorship, jpeg artifacts, simple background, loli, children, bottomless, nsfw", + "Denoising strength": "0.55" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c1105816-f043-4c1c-5565-863b619ac300/width=450/304076.jpeg", + "nsfw": true, + "width": 1024, + "height": 1408, + "hash": "UYLM@p?^Au?GOWaKM|X8RPV@V@9aRPIoR*jF", + "meta": { + "ENSD": "31337", + "Size": "512x704", + "seed": 1928984314, + "steps": 50, + "prompt": "1girl, indoors, [medium breasts], (bouncing breasts:1.2), (shirt:1.2), best quality, masterpiece, covered nipples, (open clothes, center opening, cleavage:1.2), navel, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "Bouncing_11085", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "0fc198c490", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "worst quality, low quality, bad anatomy, blurry, signature, watermark, bad hands, missing fingers, extra fingers, censored, censorship, jpeg artifacts, simple background", + "Denoising strength": "0.55" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/27594" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/bouncingBreasts_v1.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/bouncingBreasts_v1.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..4a7359e32d02bc2727cabddcceb671fab30a7955 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/bouncingBreasts_v1.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:8e8e5a1ee7c86cba12f941c5cc4d5fbbe56543ffbae5badf0ecd80bc7f66d71a +size 1718298 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/bouncingBreasts_v1.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/bouncingBreasts_v1.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..6aa188e7dc535fdd95ac1ed22ca707285741e451 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/bouncingBreasts_v1.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:bd2ed4cf3d06100958244da2f9041c18ca1e8d03829b565ef72f511eea68f623 +size 30784383 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breast sucking.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breast sucking.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..1efe8986fdd10a55382aec07ad885c4029346863 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breast sucking.civitai.info" @@ -0,0 +1,272 @@ +{ + "id": 69384, + "modelId": 64745, + "name": "v1.0", + "createdAt": "2023-05-13T06:11:06.548Z", + "updatedAt": "2023-05-13T07:24:50.980Z", + "trainedWords": [ + "breast sucking" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 59, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "concept Breast sucking", + "type": "LoCon", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "breast sucking.safetensors", + "id": 48486, + "sizeKB": 46471.0185546875, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-13T06:21:04.186Z", + "hashes": { + "AutoV1": "42C8AA79", + "AutoV2": "741C98B205", + "SHA256": "741C98B205DC616E3AFD5F3F27AAD7A791FB1077A0945F9B71D61362A5119E52", + "CRC32": "57FA7C23", + "BLAKE3": "290D5223D47ACFE7143C3EA3C001EAD17799301D83B916800180B12E6D4CC8B6" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/69384" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b2a96775-f1d6-49c3-bdb3-ab82310af471/width=450/774181.jpeg", + "nsfw": "X", + "width": 640, + "height": 896, + "hash": "U5HL0l0000IW3Z00}=-q~n02~W$%=|nO%KS~", + "meta": { + "ENSD": "31337", + "Size": "640x896", + "seed": 251082905, + "Model": "Anime_cetusMix_cetusVersion2", + "steps": 20, + "hashes": { + "model": "e911995387" + }, + "prompt": "breast sucking, 1boy, masterpiece,1girl,lactation, feeding,", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "e911995387", + "name": "Anime_cetusMix_cetusVersion2", + "type": "model" + } + ], + "Model hash": "e911995387", + "negativePrompt": "(worst quality:1.4), (low quality:1.4), (normal quality:1.4), lowres" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6aa46047-6092-45fa-a943-f2f9d88ca50a/width=450/774207.jpeg", + "nsfw": "X", + "width": 640, + "height": 896, + "hash": "UMIgyG000L~V^jE2S$xW9tM{%Mt6?HWBM{Nb", + "meta": { + "ENSD": "31337", + "Size": "640x896", + "seed": 2872671250, + "Model": "Anime_cetusMix_cetusVersion2", + "steps": 20, + "hashes": { + "model": "e911995387" + }, + "prompt": "breast sucking, 1boy,1girl,closed eyes, breast grab, ", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "e911995387", + "name": "Anime_cetusMix_cetusVersion2", + "type": "model" + } + ], + "Model hash": "e911995387", + "negativePrompt": "(worst quality:1.4), (low quality:1.4), (normal quality:1.4), lowres" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3128e1cd-89c4-492a-83db-34b9adff3648/width=450/774317.jpeg", + "nsfw": "X", + "width": 960, + "height": 1344, + "hash": "UVHBVu%2E1~Wxu-p%LozE1kCRkRjIUWC%2f5", + "meta": { + "ENSD": "31337", + "Size": "640x896", + "seed": 2043949837, + "Model": "Anime_cetusMix_cetusVersion2", + "steps": 20, + "hashes": { + "model": "e911995387" + }, + "prompt": "breast sucking, 1boy,1girl,sex,vaginal,upright straddling, ", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "e911995387", + "name": "Anime_cetusMix_cetusVersion2", + "type": "model" + } + ], + "Model hash": "e911995387", + "Hires upscale": "1.5", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality:1.4), (low quality:1.4), (normal quality:1.4), lowres", + "Denoising strength": "0.36" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/12b1d51c-5056-49c4-8237-f8ad6f0ed972/width=450/774572.jpeg", + "nsfw": "X", + "width": 896, + "height": 640, + "hash": "UUJ%nR~Vt2?Gxt%0%1oy57s:xat6oe%1s:oz", + "meta": { + "ENSD": "31337", + "Size": "896x640", + "seed": 708762795, + "Model": "Anime_cetusMix_cetusVersion2", + "steps": 20, + "hashes": { + "model": "e911995387" + }, + "prompt": "breast sucking, 1boy,1girl,lying,on back,on bed,collarbone,grabbing,", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "e911995387", + "name": "Anime_cetusMix_cetusVersion2", + "type": "model" + } + ], + "Model hash": "e911995387", + "negativePrompt": "(worst quality:1.4), (low quality:1.4), (normal quality:1.4), lowres" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8afc4afb-a681-4220-ad70-62ead96cb3cc/width=450/774578.jpeg", + "nsfw": "X", + "width": 1344, + "height": 960, + "hash": "UKF#]*t7Na~W~Woz%M?GNGIVof%2NHIVIoM{", + "meta": { + "ENSD": "31337", + "Size": "896x640", + "seed": 4021251486, + "Model": "Anime_cetusMix_cetusVersion2", + "steps": 20, + "hashes": { + "model": "e911995387" + }, + "prompt": "breast sucking, 2girls, nude, yuri, fingering, sweat, open mouth, navel, pussy juice, medium breasts, spread legs, pussy, hand on another's shoulder, looking at another", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "e911995387", + "name": "Anime_cetusMix_cetusVersion2", + "type": "model" + } + ], + "Model hash": "e911995387", + "Hires upscale": "1.5", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality:1.4), (low quality:1.4), (normal quality:1.4), lowres", + "Denoising strength": "0.36" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ee44ff24-7f7e-4e31-9087-52f434eb7d0a/width=450/774660.jpeg", + "nsfw": "X", + "width": 640, + "height": 896, + "hash": "UGHBPf004.^*~p0eaJ-:4.S$xaf+?GM|E2oc", + "meta": { + "ENSD": "31337", + "Size": "640x896", + "seed": 2496579072, + "Model": "Anime_cetusMix_cetusVersion2", + "steps": 20, + "hashes": { + "model": "e911995387" + }, + "prompt": "breast sucking, 2girls, nude, yuri", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "e911995387", + "name": "Anime_cetusMix_cetusVersion2", + "type": "model" + } + ], + "Model hash": "e911995387", + "negativePrompt": "(worst quality:1.4), (low quality:1.4), (normal quality:1.4), lowres" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7e6cecfa-18c6-4ede-acdf-8bd9c3bed817/width=450/774664.jpeg", + "nsfw": "X", + "width": 960, + "height": 1344, + "hash": "UEGa,=9G0y4:?a9G-:9a560e~VxG={E1EL-V", + "meta": { + "ENSD": "31337", + "Size": "640x896", + "seed": 1874749139, + "Model": "Anime_cetusMix_cetusVersion2", + "steps": 20, + "hashes": { + "model": "e911995387" + }, + "prompt": "breast sucking, 2girls, nude,feeding, lactation,lying, ", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "e911995387", + "name": "Anime_cetusMix_cetusVersion2", + "type": "model" + } + ], + "Model hash": "e911995387", + "Hires upscale": "1.5", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality:1.4), (low quality:1.4), (normal quality:1.4), lowres", + "Denoising strength": "0.36" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/69384" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breast sucking.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breast sucking.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..22dfa4b63a3b9923240e4147d0c2966796b7c5ee Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breast sucking.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breast sucking.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breast sucking.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..d9c55b6170713d144c826a9b7b5224798300e2f0 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breast sucking.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:741c98b205dc616e3afd5f3f27aad7a791fb1077a0945f9b71d61362a5119e52 +size 47586323 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastGrabFromBehind_v2.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastGrabFromBehind_v2.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..37bdc32ad7e0b65593879f47ab4a59c109ef6550 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastGrabFromBehind_v2.civitai.info" @@ -0,0 +1,278 @@ +{ + "id": 50847, + "modelId": 42515, + "name": "v2", + "createdAt": "2023-04-20T16:19:28.907Z", + "updatedAt": "2023-04-20T16:22:55.456Z", + "trainedWords": [ + "grabbing from behind,", + "breast grab" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

In v2, it is more stable than v1. The suggested weight is 0.6 - 0.8. I tried my best to fix the bug, but the bug still exist in hand and arm. The probability is around 20%

", + "stats": { + "downloadCount": 791, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "breast grab from behind", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "breastGrabFromBehind_v2.safetensors", + "id": 37216, + "sizeKB": 36989.443359375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-20T16:25:57.909Z", + "hashes": { + "AutoV1": "83A7AA1D", + "AutoV2": "8A7BE0C8E5", + "SHA256": "8A7BE0C8E5E418699A251C6DFEFDD4A5B52DE8D2DD83EB7E18CAD820F4D15A98", + "CRC32": "4ED00962", + "BLAKE3": "6005FEF0A1D7C40402ABD23B30A4D7B286F19B73E3FB0C4DF4D87437E221599A" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/50847" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7bb8ef2e-515b-4fd1-bd95-5c899fb51200/width=450/547165.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UNKKNO8{5Rxvt-9G~qR*jFD%-;jFxZxaIURi", + "meta": { + "Size": "512x512", + "seed": 833329011, + "Model": "abyssorangemix2_Hard-003", + "steps": 20, + "hashes": { + "model": "e714ee20aa" + }, + "prompt": "masterpiece, best quality, 1girl, 1boy, grabbing from behind, breast grab, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "e714ee20aa", + "name": "abyssorangemix2_Hard-003", + "type": "model" + } + ], + "Model hash": "e714ee20aa", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative, bad anatomy, bad hands, cropped, missing fingers, missing toes, too many toes, too many fingers, missing arms, long neck, missing legs, too many legs, Humpbacked, deformed, disfigured, poorly drawn face, distorted face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, floating limbs, disconnected limbs, malformed hands, out of focus, long body, monochrome, symbol, text, logo, door frame, window frame, mirror frame, text box, speech balloons" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/241687e3-5b4e-40a0-6369-815f04f79b00/width=450/547158.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UMJje[Mx0L-;VsVsxv9t9EM|S#E2~WxaM{NH", + "meta": { + "Size": "512x512", + "seed": 2550201507, + "Model": "abyssorangemix2_Hard-003", + "steps": 20, + "hashes": { + "model": "e714ee20aa" + }, + "prompt": "masterpiece, best quality, 1girl, 1boy, grabbing from behind, breast grab, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "e714ee20aa", + "name": "abyssorangemix2_Hard-003", + "type": "model" + } + ], + "Model hash": "e714ee20aa", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative, bad anatomy, bad hands, cropped, missing fingers, missing toes, too many toes, too many fingers, missing arms, long neck, missing legs, too many legs, Humpbacked, deformed, disfigured, poorly drawn face, distorted face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, floating limbs, disconnected limbs, malformed hands, out of focus, long body, monochrome, symbol, text, logo, door frame, window frame, mirror frame, text box, speech balloons" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/39979a63-eb0d-4492-dd8f-d9d181fc6600/width=450/547160.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UUINw3E10Kxu9ZRjNaxaRPt7NbWB~VNGRQj]", + "meta": { + "Size": "512x512", + "seed": 2550201506, + "Model": "abyssorangemix2_Hard-003", + "steps": 20, + "hashes": { + "model": "e714ee20aa" + }, + "prompt": "masterpiece, best quality, 1girl, 1boy, grabbing from behind, breast grab, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "e714ee20aa", + "name": "abyssorangemix2_Hard-003", + "type": "model" + } + ], + "Model hash": "e714ee20aa", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative, bad anatomy, bad hands, cropped, missing fingers, missing toes, too many toes, too many fingers, missing arms, long neck, missing legs, too many legs, Humpbacked, deformed, disfigured, poorly drawn face, distorted face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, floating limbs, disconnected limbs, malformed hands, out of focus, long body, monochrome, symbol, text, logo, door frame, window frame, mirror frame, text box, speech balloons" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/bb7a7df0-333e-46ce-5193-9c1975975f00/width=450/547161.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UgJ*3W~pE1Rkxtxtozs:IURjRkRjxuofM{WA", + "meta": { + "Size": "512x512", + "seed": 2550201505, + "Model": "abyssorangemix2_Hard-003", + "steps": 20, + "hashes": { + "model": "e714ee20aa" + }, + "prompt": "masterpiece, best quality, 1girl, 1boy, grabbing from behind, breast grab, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "e714ee20aa", + "name": "abyssorangemix2_Hard-003", + "type": "model" + } + ], + "Model hash": "e714ee20aa", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative, bad anatomy, bad hands, cropped, missing fingers, missing toes, too many toes, too many fingers, missing arms, long neck, missing legs, too many legs, Humpbacked, deformed, disfigured, poorly drawn face, distorted face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, floating limbs, disconnected limbs, malformed hands, out of focus, long body, monochrome, symbol, text, logo, door frame, window frame, mirror frame, text box, speech balloons" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7d95a86c-98da-4ddd-675b-aebb9f48a100/width=450/547163.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "U8HURr0100~Vx[S%01_300Ri%ONG?G?H0LRj", + "meta": { + "Size": "512x512", + "seed": 4224432254, + "Model": "abyssorangemix2_Hard-003", + "steps": 20, + "hashes": { + "model": "e714ee20aa" + }, + "prompt": "masterpiece, best quality, 1girl, 1boy, grabbing from behind, breast grab, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "e714ee20aa", + "name": "abyssorangemix2_Hard-003", + "type": "model" + } + ], + "Model hash": "e714ee20aa", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative, bad anatomy, bad hands, cropped, missing fingers, missing toes, too many toes, too many fingers, missing arms, long neck, missing legs, too many legs, Humpbacked, deformed, disfigured, poorly drawn face, distorted face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, floating limbs, disconnected limbs, malformed hands, out of focus, long body, monochrome, symbol, text, logo, door frame, window frame, mirror frame, text box, speech balloons" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7a2f486e-00bb-4ff8-80fd-968b14f1ac00/width=450/547159.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UXJaWX_NOsENOFNe%Mt84.sAWCR*t5xtM{Rj", + "meta": { + "Size": "512x512", + "seed": 4224432253, + "Model": "abyssorangemix2_Hard-003", + "steps": 20, + "hashes": { + "model": "e714ee20aa" + }, + "prompt": "masterpiece, best quality, 1girl, 1boy, grabbing from behind, breast grab, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "e714ee20aa", + "name": "abyssorangemix2_Hard-003", + "type": "model" + } + ], + "Model hash": "e714ee20aa", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative, bad anatomy, bad hands, cropped, missing fingers, missing toes, too many toes, too many fingers, missing arms, long neck, missing legs, too many legs, Humpbacked, deformed, disfigured, poorly drawn face, distorted face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, floating limbs, disconnected limbs, malformed hands, out of focus, long body, monochrome, symbol, text, logo, door frame, window frame, mirror frame, text box, speech balloons" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a701e333-b920-4b14-048c-ca91553a0b00/width=450/547162.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "URIqfb~p5QS1XSo}x]-pWFt9tSo#%NkEIWM|", + "meta": { + "Size": "512x512", + "seed": 4224432251, + "Model": "abyssorangemix2_Hard-003", + "steps": 20, + "hashes": { + "model": "e714ee20aa" + }, + "prompt": "masterpiece, best quality, 1girl, 1boy, grabbing from behind, breast grab, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "e714ee20aa", + "name": "abyssorangemix2_Hard-003", + "type": "model" + } + ], + "Model hash": "e714ee20aa", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative, bad anatomy, bad hands, cropped, missing fingers, missing toes, too many toes, too many fingers, missing arms, long neck, missing legs, too many legs, Humpbacked, deformed, disfigured, poorly drawn face, distorted face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, floating limbs, disconnected limbs, malformed hands, out of focus, long body, monochrome, symbol, text, logo, door frame, window frame, mirror frame, text box, speech balloons" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a24b86b3-3ee4-42a3-cf4a-58e5f19ee500/width=450/547164.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UMI;-X4pb[%3~XRj?bV[XnRixvM{t6NFxuIo", + "meta": { + "Size": "512x512", + "seed": 833329012, + "Model": "abyssorangemix2_Hard-003", + "steps": 20, + "hashes": { + "model": "e714ee20aa" + }, + "prompt": "masterpiece, best quality, 1girl, 1boy, grabbing from behind, breast grab, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "e714ee20aa", + "name": "abyssorangemix2_Hard-003", + "type": "model" + } + ], + "Model hash": "e714ee20aa", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative, bad anatomy, bad hands, cropped, missing fingers, missing toes, too many toes, too many fingers, missing arms, long neck, missing legs, too many legs, Humpbacked, deformed, disfigured, poorly drawn face, distorted face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, floating limbs, disconnected limbs, malformed hands, out of focus, long body, monochrome, symbol, text, logo, door frame, window frame, mirror frame, text box, speech balloons" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/50847" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastGrabFromBehind_v2.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastGrabFromBehind_v2.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..72837f71023f03aeda188570bae7f75adad9fbfe Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastGrabFromBehind_v2.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastGrabFromBehind_v2.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastGrabFromBehind_v2.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..1f8eec0b98c3274563ed829832cfcc90612561e1 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastGrabFromBehind_v2.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:8a7be0c8e5e418699a251c6dfefdd4a5b52de8d2dd83eb7e18cad820f4d15a98 +size 37877190 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastGrab_self.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastGrab_self.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..71d4bd979f8fd82630a287274c5132285e433ac4 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastGrab_self.civitai.info" @@ -0,0 +1,344 @@ +{ + "id": 29860, + "modelId": 24960, + "name": "SelfBreastGrab", + "createdAt": "2023-03-27T02:56:23.846Z", + "updatedAt": "2023-03-27T03:03:40.085Z", + "trainedWords": [ + "sbg", + "breast grab", + "breast lift", + "nipples" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 6925, + "ratingCount": 11, + "rating": 5 + }, + "model": { + "name": "Breast Grab", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "breastGrab_self.safetensors", + "id": 24681, + "sizeKB": 147587.0087890625, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-03-27T03:06:45.359Z", + "hashes": { + "AutoV1": "C7423862", + "AutoV2": "5186573A2B", + "SHA256": "5186573A2BC25CA3E97C5B0D3408B77F37F7717DB8DB4BCD0683CD8B54CB1F23", + "CRC32": "F94499AE", + "BLAKE3": "2FD2798451FAF308943D905A97511EA6AC3541414ED3CFA2965FACB983F33060" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/29860" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/48c56409-5452-4ebc-b54e-41e5bb7d2c00/width=450/338217.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UoMZ{|xu_NV@-;t7xuWBRkWVxuofM{WBaeae", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 2600148762, + "steps": 25, + "hashes": { + "vae": "f921fb3f29", + "model": "834cc0a55a", + "embed:bad_prompt": "6f35e7dd81", + "lora:SelfBreastGrab": "5186573a2b" + }, + "prompt": "beautiful, masterpiece, best quality, extremely detailed face, perfect lighting, 1girl, solo, , sbg, breast grab, breast lift, shirt, white shirt, see-through, huge breasts, wet", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "name": "SelfBreastGrab", + "type": "lora", + "weight": 0.8 + } + ], + "Model hash": "834cc0a55a", + "negativePrompt": "(low quality, worst quality:1.4),(bad_prompt:0.8), (monochrome:1.1), (greyscale)" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1023894c-ba51-49db-cc8c-26c176f0ad00/width=450/338225.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UJIgv60100%20fIVxt?G00%Mxtxu~CozRjE1", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 3396267809, + "steps": 25, + "hashes": { + "vae": "f921fb3f29", + "model": "834cc0a55a", + "embed:bad_prompt": "6f35e7dd81", + "lora:SelfBreastGrab": "5186573a2b" + }, + "prompt": "beautiful, masterpiece, best quality, extremely detailed face, perfect lighting, 1girl, solo, , sbg, breast grab, breast lift, nipples, deep skin", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "name": "SelfBreastGrab", + "type": "lora", + "weight": 0.8 + } + ], + "Model hash": "834cc0a55a", + "negativePrompt": "(low quality, worst quality:1.4),(bad_prompt:0.8), (monochrome:1.1), (greyscale)" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8109d721-f8df-4954-f3ac-941743eaa600/width=450/338224.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UtJ@qC~po}t7tR%MofaeNGj[t7R*nin%ofWV", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 2029415788, + "steps": 25, + "hashes": { + "vae": "f921fb3f29", + "model": "834cc0a55a", + "embed:bad_prompt": "6f35e7dd81", + "lora:SelfBreastGrab": "5186573a2b" + }, + "prompt": "beautiful, masterpiece, best quality, extremely detailed face, perfect lighting, 1girl, solo, , sbg, breast grab, breast lift, nipples, from side", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "name": "SelfBreastGrab", + "type": "lora", + "weight": 0.8 + } + ], + "Model hash": "834cc0a55a", + "negativePrompt": "(low quality, worst quality:1.4),(bad_prompt:0.8), (monochrome:1.1), (greyscale)" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/205b9b22-4f55-4d72-0dc2-71c0e6cd9f00/width=450/338223.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UJJkJ-?bTxH@56%N_3NINGa{?Gnh~pe-aKoz", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 2426138713, + "steps": 25, + "hashes": { + "vae": "f921fb3f29", + "model": "834cc0a55a", + "embed:bad_prompt": "6f35e7dd81", + "lora:SelfBreastGrab": "5186573a2b" + }, + "prompt": "beautiful, masterpiece, best quality, extremely detailed face, perfect lighting, 1girl, solo, , sbg, breast grab, breast lift, large breasts, shirt, white shirt, see-through, wet, dark skin, dark-skinned female, wet", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "name": "SelfBreastGrab", + "type": "lora", + "weight": 0.8 + } + ], + "Model hash": "834cc0a55a", + "negativePrompt": "(low quality, worst quality:1.4),(bad_prompt:0.8), (monochrome:1.1), (greyscale)" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2b87c285-6585-43d9-0243-4f1db24d4b00/width=450/338222.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "ULKmz*~qAD9Z5n%M-;Wn01smt7t7xGayj]WC", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 2418322233, + "steps": 25, + "hashes": { + "vae": "f921fb3f29", + "model": "834cc0a55a", + "embed:bad_prompt": "6f35e7dd81", + "lora:SelfBreastGrab": "5186573a2b" + }, + "prompt": "beautiful, masterpiece, best quality, extremely detailed face, perfect lighting, 1girl, solo, , sbg, breast grab, breast lift, nipples, medium breasts", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "name": "SelfBreastGrab", + "type": "lora", + "weight": 0.8 + } + ], + "Model hash": "834cc0a55a", + "negativePrompt": "(low quality, worst quality:1.4),(bad_prompt:0.8), (monochrome:1.1), (greyscale)" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/607e599c-c33e-4f64-4bfe-1d37e31f1900/width=450/338221.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UCG+H?9t6,_N00$K-o%M9Z?a~VS#~Wx]IURP", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 3594889271, + "steps": 25, + "hashes": { + "vae": "f921fb3f29", + "model": "834cc0a55a", + "embed:bad_prompt": "6f35e7dd81", + "lora:SelfBreastGrab": "5186573a2b" + }, + "prompt": "beautiful, masterpiece, best quality, extremely detailed face, perfect lighting, 1girl, solo, , sbg, breast grab, breast lift, medium breasts, shirt, white shirt, see-through, wet, dark skin, dark-skinned female, wet", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "name": "SelfBreastGrab", + "type": "lora", + "weight": 0.8 + } + ], + "Model hash": "834cc0a55a", + "negativePrompt": "(low quality, worst quality:1.4),(bad_prompt:0.8), (monochrome:1.1), (greyscale)" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/170cacc4-aa35-4159-d3c6-622c85601b00/width=450/338220.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UDHL3e0200?a0Knm~UE2R4oe-oxu~V4;x[%2", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 60409036, + "steps": 25, + "hashes": { + "vae": "f921fb3f29", + "model": "834cc0a55a", + "embed:bad_prompt": "6f35e7dd81", + "lora:SelfBreastGrab": "5186573a2b" + }, + "prompt": "beautiful, masterpiece, best quality, extremely detailed face, perfect lighting, 1girl, solo, , sbg, breast grab, breast lift, nipples, large breasts, hoodie, hood,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "name": "SelfBreastGrab", + "type": "lora", + "weight": 0.8 + } + ], + "Model hash": "834cc0a55a", + "negativePrompt": "(low quality, worst quality:1.4),(bad_prompt:0.8), (monochrome:1.1), (greyscale)" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/deed185d-f75f-4528-8c79-d4ad2e8da700/width=450/338219.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "URH_lJ8w0Lo~?^8_$*%gElIn-VbbWEWAozWB", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 3583666667, + "steps": 25, + "hashes": { + "vae": "f921fb3f29", + "model": "834cc0a55a", + "embed:bad_prompt": "6f35e7dd81", + "lora:SelfBreastGrab": "5186573a2b" + }, + "prompt": "beautiful, masterpiece, best quality, extremely detailed face, perfect lighting, 1girl, solo, , sbg, breast grab, breast lift, nipples, cowboy shot, shorts, short shorts, topless", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "name": "SelfBreastGrab", + "type": "lora", + "weight": 0.8 + } + ], + "Model hash": "834cc0a55a", + "negativePrompt": "(low quality, worst quality:1.4),(bad_prompt:0.8), (monochrome:1.1), (greyscale)" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c0cc6b75-da38-4009-c245-1b0aa7c83200/width=450/338218.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UKG[D[E200%10LWB-p%2D%t6WVof~VoeIVWU", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 3874740097, + "steps": 25, + "hashes": { + "vae": "f921fb3f29", + "model": "834cc0a55a", + "embed:bad_prompt": "6f35e7dd81", + "lora:SelfBreastGrab": "5186573a2b" + }, + "prompt": "beautiful, masterpiece, best quality, extremely detailed face, perfect lighting, 1girl, solo, , sbg, breast grab, breast lift, nipples,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "name": "SelfBreastGrab", + "type": "lora", + "weight": 0.8 + } + ], + "Model hash": "834cc0a55a", + "negativePrompt": "(low quality, worst quality:1.4),(bad_prompt:0.8), (monochrome:1.1), (greyscale)" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/29860" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastGrab_self.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastGrab_self.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..9fce502ba3e4c61b99f13cf2e8d4fdd83e03568a Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastGrab_self.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastGrab_self.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastGrab_self.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..1052b34f29ad31288cd423ee6fd301e34f91c339 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastGrab_self.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:5186573a2bc25ca3e97c5b0d3408b77f37f7717db8db4bcd0683cd8b54cb1f23 +size 151129097 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastGrabingPoseAphrodite_v10.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastGrabingPoseAphrodite_v10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..0055bf64fc7d33b1da94829df56451ef9cba141a --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastGrabingPoseAphrodite_v10.civitai.info" @@ -0,0 +1,297 @@ +{ + "id": 52057, + "modelId": 47465, + "name": "v1.0", + "createdAt": "2023-04-22T04:49:17.823Z", + "updatedAt": "2023-04-22T04:54:31.754Z", + "trainedWords": [ + "(2boys grabbing 1girl breast:1.1),2boys,grabbing breast, girl" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

first ver! if improvement needed

", + "stats": { + "downloadCount": 166, + "ratingCount": 1, + "rating": 5 + }, + "model": { + "name": "Breast Grabing | Pose | Aphrodite | Record of Ragnarok |", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "breastGrabingPoseAphrodite_v10.safetensors", + "id": 37952, + "sizeKB": 18553.0458984375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-22T04:55:37.636Z", + "hashes": { + "AutoV1": "DE2F2560", + "AutoV2": "975784B3B5", + "SHA256": "975784B3B5DAE06EC2E5866C6806A5AC6184307116B3D5134A6F933A1D3114C3", + "CRC32": "AF312507", + "BLAKE3": "9662E38BD664324A40D6D3E7629D9FBAB146EA2568F5E5919678A58644694538" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/52057" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/beee0732-dc45-4b7e-4c1c-d6a31797fe00/width=450/561130.jpeg", + "nsfw": true, + "width": 1000, + "height": 752, + "hash": "URIO5{IUITNH~qxaE1s:ElbcEMt6_3jGIpay", + "meta": { + "Size": "1000x753", + "seed": 11697196, + "Model": "AbyssOrangeMix2", + "steps": 40, + "hashes": { + "model": "b644d850c9" + }, + "prompt": "(2boys grabbing 1girl breast:1.1),2boys,grabbing breast, girl red hair, turquoise-green dress, (bald male, muscle male, black skin male:1.1).", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "b644d850c9", + "name": "AbyssOrangeMix2", + "type": "model" + }, + { + "hash": "ce114bc24daa", + "name": "02", + "type": "lora", + "weight": null + }, + { + "hash": "903d6b879127", + "name": "windrangerArcanaDota_10", + "type": "lora", + "weight": null + } + ], + "Model hash": "b644d850c9", + "AddNet Enabled": "True", + "AddNet Model 1": "HoldingBreast-02(ce114bc24daa)", + "AddNet Model 2": "windrangerArcanaDota_10(903d6b879127)", + "negativePrompt": "watermark,text, logo,contact, error, blurry, cropped, username, artist name, (worst quality, low quality:1.4),, ((bad anatomy)), ((extra limbs)),big face, big body, big eyes, short girl,hand, finger, dude,open mouth,(pussy:1.2)", + "AddNet Module 1": "LoRA", + "AddNet Module 2": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight A 2": "0.85", + "AddNet Weight B 1": "1", + "AddNet Weight B 2": "0.85", + "Denoising strength": "0.75" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9301bb3b-2686-4566-ba9d-db8746cde600/width=450/561131.jpeg", + "nsfw": true, + "width": 1000, + "height": 752, + "hash": "UVJQyMRjH?f*_Mo0Z$W;x^RjM_WD-qWB9Zt7", + "meta": { + "Size": "1000x753", + "seed": 625319648, + "Model": "meinahentai_v21", + "steps": 35, + "hashes": { + "model": "deb40a068a" + }, + "prompt": "(2boys grabbing 1girl breast:1.1),2boys,grabbing breast, (tatsumaki:1.1),girl black dress, bald male, muscle male", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "deb40a068a", + "name": "meinahentai_v21", + "type": "model" + }, + { + "hash": "ce114bc24daa", + "name": "02", + "type": "lora", + "weight": null + }, + { + "hash": "1059d9f41f6a", + "name": "02", + "type": "lora", + "weight": null + } + ], + "Model hash": "deb40a068a", + "AddNet Enabled": "True", + "AddNet Model 1": "HoldingBreast-02(ce114bc24daa)", + "AddNet Model 2": "Tatsumaki-v11-02(1059d9f41f6a)", + "negativePrompt": "watermark,text, logo,contact, error, blurry, cropped, username, artist name, (worst quality, low quality:1.4),, ((bad anatomy)), ((extra limbs)),big face, big body, big eyes, short girl,hand, finger, dude,open mouth,(pussy:1.2), more than 3 persons", + "AddNet Module 1": "LoRA", + "AddNet Module 2": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight A 2": "0.55", + "AddNet Weight B 1": "1", + "AddNet Weight B 2": "0.55", + "Denoising strength": "0.75" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b5f80c07-08b5-4b2b-37f8-cc54d269c400/width=450/561118.jpeg", + "nsfw": true, + "width": 512, + "height": 680, + "hash": "UDLDV:0h009~S@=|F~W@0KAJTfIA~U01oN-=", + "meta": { + "Size": "512x680", + "seed": 3023227054, + "Model": "AbyssOrangeMix2", + "steps": 20, + "hashes": { + "model": "b644d850c9" + }, + "prompt": "aphrodite, white dress, 2boys holding breasts, 1girl,", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "b644d850c9", + "name": "AbyssOrangeMix2", + "type": "model" + }, + { + "hash": "b3e93033e96b", + "name": "01", + "type": "lora", + "weight": null + } + ], + "Model hash": "b644d850c9", + "AddNet Enabled": "True", + "AddNet Model 1": "aphrodite-01(b3e93033e96b)", + "negativePrompt": "BadArtistAnime BadHands", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.8", + "AddNet Weight B 1": "0.8", + "Denoising strength": "0.75" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2809c35d-277d-4ce1-196b-2bd67341ba00/width=450/561117.jpeg", + "nsfw": true, + "width": 512, + "height": 680, + "hash": "UFI#AL0000x]A,?G,0-:?8Ip}]D%S{M{$i%2", + "meta": { + "Size": "512x683", + "seed": 3603490745, + "Model": "AbyssOrangeMix2", + "steps": 20, + "hashes": { + "model": "b644d850c9" + }, + "prompt": "tatsumaki, 1girl, 2boys, armpits, green eyes, (breast grab:1.1), breasts, cleavage, crossed legs, dark skin, dark-skinned male, dress, flower, (grabbing:1.1), green hair, short, hetero, large breasts, looking at viewer, multiple boys, sitting, thighs", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "b644d850c9", + "name": "AbyssOrangeMix2", + "type": "model" + }, + { + "hash": "b3e93033e96b", + "name": "01", + "type": "lora", + "weight": null + }, + { + "hash": "f7a3f03ef589", + "name": "01", + "type": "lora", + "weight": null + } + ], + "Model hash": "b644d850c9", + "AddNet Enabled": "True", + "AddNet Model 1": "aphrodite-01(b3e93033e96b)", + "AddNet Model 2": "Tatsumaki-v11-01(f7a3f03ef589)", + "negativePrompt": "BadArtistAnime BadHands", + "AddNet Module 1": "LoRA", + "AddNet Module 2": "LoRA", + "AddNet Weight A 1": "0.85", + "AddNet Weight A 2": "0.75", + "AddNet Weight B 1": "0.85", + "AddNet Weight B 2": "0.75" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1c08fb38-7274-4958-ff17-d2d7428f3f00/width=450/561115.jpeg", + "nsfw": true, + "width": 512, + "height": 680, + "hash": "U9Km%=000f00vf^*~pNG00_2xW~Br=^%?Z%1", + "meta": { + "Size": "512x680", + "seed": 849016126, + "Model": "AbyssOrangeMix2", + "steps": 20, + "hashes": { + "model": "b644d850c9" + }, + "prompt": "mirana, 1girl, 2boys, armpits, blue eyes, (breast grab:1.1), breasts, cleavage, crossed legs, dark skin, dark-skinned male, dress, flower, (grabbing:1.1), brown hair, single hair bun, hetero, large breasts, looking at viewer, multiple boys, sitting, thighs", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "b644d850c9", + "name": "AbyssOrangeMix2", + "type": "model" + }, + { + "hash": "b3e93033e96b", + "name": "01", + "type": "lora", + "weight": null + }, + { + "hash": "1b13e7d53077", + "name": "03", + "type": "lora", + "weight": null + } + ], + "Model hash": "b644d850c9", + "AddNet Enabled": "True", + "AddNet Model 1": "aphrodite-01(b3e93033e96b)", + "AddNet Model 2": "Mirana-princess-03(1b13e7d53077)", + "negativePrompt": "BadArtistAnime BadHands", + "AddNet Module 1": "LoRA", + "AddNet Module 2": "LoRA", + "AddNet Weight A 1": "0.8", + "AddNet Weight A 2": "0.8", + "AddNet Weight B 1": "0.8", + "AddNet Weight B 2": "0.8", + "Denoising strength": "0.8" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/52057" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastGrabingPoseAphrodite_v10.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastGrabingPoseAphrodite_v10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..11187a86d2e3cdba4b1d87700018b75cc65b5af2 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastGrabingPoseAphrodite_v10.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastGrabingPoseAphrodite_v10.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastGrabingPoseAphrodite_v10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..c20741d7d92a7c8d1022be78e0fb2ea9a3c93251 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastGrabingPoseAphrodite_v10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:975784b3b5dae06ec2e5866c6806a5ac6184307116b3d5134a6f933a1d3114c3 +size 18998319 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastPressLora_v10.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastPressLora_v10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..42fc4b0ce0f99d313d6c6d5fcbaad42773d6a305 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastPressLora_v10.civitai.info" @@ -0,0 +1,142 @@ +{ + "id": 31454, + "modelId": 26274, + "name": "v1.0", + "createdAt": "2023-03-29T17:53:05.652Z", + "updatedAt": "2023-03-29T20:02:06.578Z", + "trainedWords": [ + "breast press", + "2girls" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "model": { + "name": "Breast Press LoRA", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "breastPressLora_v10.safetensors", + "id": 25960, + "sizeKB": 147585.4599609375, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-03-29T17:56:02.032Z", + "hashes": { + "AutoV1": "410701FE", + "AutoV2": "1687AFF676", + "SHA256": "1687AFF676987F4B16312B495AF21D4BE6CFE6AE76D49E5D961C76D4E0B25A00", + "CRC32": "64BDA8BC", + "BLAKE3": "6537DEA7CAE7EAA76CE8A811D4932BF2FB4F2D9902FDF6D48ED8BECE7AFEB20B" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/31454" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/dafd7e49-78cf-4d85-994f-39913a241400/width=450/357847.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UIJ@XmIA014:0LWBj?IV9as.~VIUNGRjkCae", + "meta": { + "Size": "512x768", + "seed": 3558590447, + "steps": 20, + "prompt": "masterpiece, best quality, CG, wallpaper, HDR, high quality, high-definition, extremely detailed, breast press, 2girls, large breasts, nsfw, nude, kissing, yuri, closed eyes,", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "481116436656", + "name": "press", + "type": "lora", + "weight": null + } + ], + "Model hash": "e714ee20aa", + "AddNet Enabled": "True", + "AddNet Model 1": "Breast press(481116436656)", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, nipples,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.65", + "AddNet Weight B 1": "0.65" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f3431d4d-4685-4693-67cb-c61d4bc10f00/width=450/357850.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "U5Hw+7000f00?^00E14o0gM{^*-U4:oL?G%L", + "meta": { + "Size": "512x768", + "seed": 1016831452, + "steps": 20, + "prompt": "masterpiece, best quality, CG, wallpaper, HDR, high quality, high-definition, extremely detailed, breast press, 2girls, large breasts, nsfw, nude, kissing, yuri, closed eyes,", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "481116436656", + "name": "press", + "type": "lora", + "weight": null + } + ], + "Model hash": "e714ee20aa", + "AddNet Enabled": "True", + "AddNet Model 1": "Breast press(481116436656)", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, nipples,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.65", + "AddNet Weight B 1": "0.65" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/df7c0182-de0d-4b70-5de5-9c6e0fcdb200/width=450/357848.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UAI}CZI;00~C00RiD*%M9s%1nT0fbWxZD+IV", + "meta": { + "Size": "512x768", + "seed": 3543790154, + "steps": 20, + "prompt": "masterpiece, best quality, CG, wallpaper, HDR, high quality, high-definition, extremely detailed, breast press, 2girls, large breasts,", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "481116436656", + "name": "press", + "type": "lora", + "weight": null + } + ], + "Model hash": "e714ee20aa", + "AddNet Enabled": "True", + "AddNet Model 1": "Breast press(481116436656)", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.65", + "AddNet Weight B 1": "0.65" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/31454" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastPressLora_v10.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastPressLora_v10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..188e63a0ef9ee9cc4735f88d2147755fb07fda1a Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastPressLora_v10.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastPressLora_v10.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastPressLora_v10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..0f32cc2b744c15fbb5c2c46d4e9fe05945bce1fe --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastPressLora_v10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:1687aff676987f4b16312b495af21d4be6cfe6ae76d49e5d961c76d4e0b25a00 +size 151127511 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastfeeding_10648.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastfeeding_10648.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..8b6ed8e7b346116e9c34f371d479b53ff53482b8 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastfeeding_10648.civitai.info" @@ -0,0 +1,121 @@ +{ + "id": 57477, + "modelId": 53108, + "name": "v1.0", + "createdAt": "2023-04-28T15:30:23.467Z", + "updatedAt": "2023-04-28T15:32:55.887Z", + "trainedWords": [ + "breastfeeding" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 297, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Breastfeeding", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "breastfeeding_10648.pt", + "id": 40982, + "sizeKB": 4947.4619140625, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "PickleTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-28T15:35:40.211Z", + "hashes": { + "AutoV1": "A7926E63", + "AutoV2": "04F9A5793D", + "SHA256": "04F9A5793D6FB78AC3208F3FDA1748850D526EE6A1E4F88716080815DC54CB9E", + "CRC32": "22DB7E3E", + "BLAKE3": "E053630273EEAFB261E903992698F3D5AF92A98682C7187E614F61DFED372B92" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/57477" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/55aa5042-7588-41f3-e5de-e33d57973500/width=450/624132.jpeg", + "nsfw": "Soft", + "width": 512, + "height": 512, + "hash": "URF$FXNG56%M~pWBRQW?RkWBxbs;NGxtoeay", + "meta": { + "Size": "512x512", + "seed": 4050903780, + "Model": "hassaku-v1.1", + "steps": 50, + "hashes": { + "model": "973cb455d0" + }, + "prompt": "(extremely detailed CG unity 8k wallpaper),(masterpiece), (best quality), (ultra-detailed), (best illustration),(best shadow), (sharp eyeliner, eyeshadow, detailed eyes:1.1), forest, 2girls, elf girl, , , (height difference, large difference:1.75), huge breasts, (breastfeeding:1.5), breast sucking, lactation, green eyes, green hair, size difference, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "breastfeeding_10648", + "type": "lora", + "weight": 1 + }, + { + "hash": "973cb455d0", + "name": "hassaku-v1.1", + "type": "model" + } + ], + "Model hash": "973cb455d0", + "negativePrompt": "easynegative, (blurry background, bad anatomy, bad hands, worst quality, low quality, lowres, bad hands, far away:1.4), open mouth, multiple views, (worst quality, low quality:1.4), (realistic, lip, nose:1.0), (dusty sunbeams:1.0), (depth of field, bokeh, blurry:1.4), (greyscale, monochrome:1.0), text, title, logo, signature, feet, legs, nipples, water surface" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1ecd441e-7e3a-4b84-d7bb-741f0d3ae700/width=450/624130.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UJGbS9Ip01M{Tcadw%kBEKxF%3of~pW=4of5", + "meta": { + "Size": "512x512", + "seed": 4050903776, + "Model": "hassaku-v1.1", + "steps": 50, + "hashes": { + "model": "973cb455d0" + }, + "prompt": "(extremely detailed CG unity 8k wallpaper),(masterpiece), (best quality), (ultra-detailed), (best illustration),(best shadow), (sharp eyeliner, eyeshadow, detailed eyes:1.1), forest, 2girls, elf girl, , , (height difference, large difference:1.75), huge breasts, (breastfeeding:1.5), breast sucking, lactation, green eyes, green hair, size difference, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "breastfeeding_10648", + "type": "lora", + "weight": 1 + }, + { + "hash": "973cb455d0", + "name": "hassaku-v1.1", + "type": "model" + } + ], + "Model hash": "973cb455d0", + "negativePrompt": "easynegative, (blurry background, bad anatomy, bad hands, worst quality, low quality, lowres, bad hands, far away:1.4), open mouth, multiple views, (worst quality, low quality:1.4), (realistic, lip, nose:1.0), (dusty sunbeams:1.0), (depth of field, bokeh, blurry:1.4), (greyscale, monochrome:1.0), text, title, logo, signature, feet, legs, nipples, water surface" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/57477" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastfeeding_10648.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastfeeding_10648.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..4bcb9e625f026010d44239a2e240f575364e097d Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastfeeding_10648.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastfeeding_10648.pt" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastfeeding_10648.pt" new file mode 100644 index 0000000000000000000000000000000000000000..a469847489ac41579afedec455a4f1f356f878a7 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastfeeding_10648.pt" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:04f9a5793d6fb78ac3208f3fda1748850d526ee6a1e4f88716080815dc54cb9e +size 5066201 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastsOnTray_v20.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastsOnTray_v20.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..fb01ed28abd66506b36a20a02fce9704ba85543f --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastsOnTray_v20.civitai.info" @@ -0,0 +1,173 @@ +{ + "id": 9595, + "modelId": 7272, + "name": "v2.0", + "createdAt": "2023-02-12T02:03:23.579Z", + "updatedAt": "2023-02-23T17:01:24.783Z", + "trainedWords": [ + "breasts on tray", + "round tray", + "square tray" + ], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": "

  • trained on lower DIM, model is now more flexible and doesn't cannibalize backgrounds nearly as much

    • trade-off: some of the extra concepts that were trained like chocolate on breasts no longer generate as easily (you may need to inpaint them)

  • balanced the dataset so it's easier to get consistent square tray generations

  • changed base model, vanilla generations look much better when compared to version 1.0

    • trade-off: it seems like several embeddings don't really work with it

", + "model": { + "name": "Breasts on tray", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "breastsOnTray_v20.safetensors", + "id": 9290, + "sizeKB": 9324.0185546875, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-02-12T02:05:56.321Z", + "hashes": { + "AutoV1": "F5F3C8C6", + "AutoV2": "1039E1FF8E", + "SHA256": "1039E1FF8E76FFFBB33D8C3B13190FB0075938413BB4EC73C9CEA84AEFA2D140", + "CRC32": "AE08D484", + "BLAKE3": "B0765EE6DF966F5BD9E07FC118656A50FBB3F442DE7AF0987E2D2F3BF4A9A6EC" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/9595" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e1fa5e7f-d0ee-4294-9ce6-a51a8ab94500/width=450/92711.jpeg", + "nsfw": true, + "width": 768, + "height": 1024, + "hash": "UdL47|^+-:og~q%Mt7R*IobHV@s:NGt7xaWp", + "meta": { + "ENSD": "31337", + "Size": "768x1024", + "seed": 353, + "steps": 24, + "prompt": "(extremely detailed CG unity 8k wallpaper), (masterpiece), (best quality), (ultra-detailed), (best illustration),(best shadow), (an extremely delicate and beautiful), finely detailed,\n(breasts on tray:1.2), (round tray:1.1), 1girl, (huge breasts:1.1), (maid:1.1), maid dress, simple background, facing viewer, cowboy shot, covered navel, looking at viewer, head tilt, light smile, green hair, short hair, cyan eyes, black pupils", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "Mask blur": "4", + "resources": [], + "Model hash": "0fc198c490", + "negativePrompt": "white pupils, breasts out, nipples, lactation, food, (cup:1.2), (glass:1.2), (bad-hands-5:0.8), bad-artist, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, jpeg artifacts, blurry, censored, aliasing, scan artifacts, broken body, extra limbs, amputee, conjoined limbs, Siamese twins, incomplete, watermark, greyscale, watermark, signature", + "Denoising strength": "0.1" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1edd8149-db67-40af-2374-1a357b08b600/width=450/92710.jpeg", + "nsfw": true, + "width": 768, + "height": 1024, + "hash": "UXLzBZ~qyDx[.8%M-;tRE1juRjbF-VoLM{Rj", + "meta": { + "ENSD": "31337", + "Size": "768x1024", + "seed": 3086565066, + "steps": 24, + "prompt": "nsfw, (masterpiece), (best quality),\n(breasts on tray:1.15), round tray, maid, breasts out, nipples, (open shirt:1.2), indoors\nkeqing \\(genshin_impact\\), 1girl, purple hair, twintails, hair ornament, hair bun, long hair, cone hair bun, purple eyes, bangs, (medium breasts:1.2), hair flower, hair between eyes, white flower, double bun, sidelocks, braid, closed mouth, lips, light smile", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "Mask blur": "4", + "resources": [], + "Model hash": "1d10a19f06", + "negativePrompt": "food, (large breasts:1.2), (bad-hands-5:0.8), bad-artist, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, jpeg artifacts, blurry, censored, aliasing, scan artifacts, broken body, extra limbs, amputee, conjoined limbs, Siamese twins, incomplete, watermark, greyscale, watermark, signature", + "Denoising strength": "0.15" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e79473c0-f25b-47a7-7d29-92016900f400/width=450/92709.jpeg", + "nsfw": true, + "width": 768, + "height": 1152, + "hash": "UNM6k=~VyCR*%fxu%Ms;9txY^+ba_2R+M{ad", + "meta": { + "ENSD": "31337", + "Size": "768x1152", + "seed": 5368, + "steps": 24, + "prompt": "(extremely detailed CG unity 8k wallpaper), (masterpiece), (best quality), (ultra-detailed), (best illustration),(best shadow), (an extremely delicate and beautiful), finely detailed,\n(breasts on tray:1.2), (round tray:1.1), 1girl, medium breasts, (red dress:1.1), cleavage cutout, sidelocks, ponytail, hair intakes, outdoors, brown hair, light rays, cowboy shot, light smile", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "Mask blur": "4", + "resources": [], + "Model hash": "1d10a19f06", + "negativePrompt": "(white pupils:1.2), (bad-hands-5:0.8), bad-artist, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, jpeg artifacts, blurry, censored, aliasing, scan artifacts, broken body, extra limbs, amputee, conjoined limbs, Siamese twins, incomplete, watermark, greyscale, watermark, signature", + "Denoising strength": "0.35" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/34cf1c3a-5e0c-4b02-849a-6020a0af7700/width=450/92708.jpeg", + "nsfw": true, + "width": 768, + "height": 1024, + "hash": "ULJQsK~V00M{z:oJKjX99FbbcFf5={%2kDay", + "meta": { + "ENSD": "31337", + "Size": "384x512", + "seed": 3086565053, + "steps": 24, + "prompt": "(masterpiece), (best quality)\nbreasts on tray, round tray, 1girl, white shirt, blue skirt, cafe, medium breasts", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "6303036cd299", + "name": "000006", + "type": "lora", + "weight": null + } + ], + "Model hash": "0fc198c490", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "breasts-on-tray-nai-000006(6303036cd299)", + "Hires upscaler": "RealESRGAN_x4plus_anime_6B", + "negativePrompt": "breasts out, nipples, lactation, loli, (bad-hands-5:0.8), bad-artist, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, jpeg artifacts, blurry, censored, aliasing, scan artifacts, broken body, extra limbs, amputee, conjoined limbs, Siamese twins, incomplete, watermark, greyscale, watermark, signature", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.6" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2e314407-c336-4656-e695-94a5d4652500/width=450/92762.jpeg", + "nsfw": false, + "width": 768, + "height": 1024, + "hash": "UPMG;K%f2mKJ.6X5x@rs~nxscBxGk=i_Rjoy", + "meta": { + "ENSD": "31337", + "Size": "768x1024", + "seed": 355, + "steps": 24, + "prompt": "(masterpiece), (best quality),\n(breasts on tray:1.2), (square tray:1.1), 1girl, small breasts, bikini top only, purple bikini, blurry background", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "Mask blur": "4", + "resources": [], + "Model hash": "1d10a19f06", + "negativePrompt": "food, child, (loli:1.2), (bad-hands-5:0.8), bad-artist, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, jpeg artifacts, blurry, censored, aliasing, scan artifacts, broken body, extra limbs, amputee, conjoined limbs, Siamese twins, incomplete, watermark, greyscale, watermark, signature", + "Denoising strength": "0.2" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/9595" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastsOnTray_v20.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastsOnTray_v20.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..7a78a989a633d63275d03a7c0ac956cad7f1337e Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastsOnTray_v20.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastsOnTray_v20.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastsOnTray_v20.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..4c54aac0127b2f2dda4e226b1bf978143294ffcf --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastsOnTray_v20.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:1039e1ff8e76fffbb33d8c3b13190fb0075938413bb4ec73c9cea84aefa2d140 +size 9547795 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastsOutExposed_24.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastsOutExposed_24.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..a9dcde75fd50255c5206ef021e3bc497d77088fc --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastsOutExposed_24.civitai.info" @@ -0,0 +1,252 @@ +{ + "id": 24203, + "modelId": 20355, + "name": "24", + "createdAt": "2023-03-16T16:14:58.594Z", + "updatedAt": "2023-03-16T16:20:24.480Z", + "trainedWords": [ + "breastsout" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 6078, + "ratingCount": 10, + "rating": 5 + }, + "model": { + "name": "Breasts out (exposed breasts concept/helper)", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "breastsOutExposed_24.safetensors", + "id": 20082, + "sizeKB": 9333.96875, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-03-16T16:16:01.162Z", + "hashes": { + "AutoV1": "2E8D7AA9", + "AutoV2": "F9A5B0FBF2", + "SHA256": "F9A5B0FBF26942E1A8EB352663C350405AB243189BC729D1677F327668A15AD1", + "CRC32": "167D4E54", + "BLAKE3": "47D0749D6CBBAF16063E2527146997F929DED755C087A15E9BBA802D8E32EC95" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/24203" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d4e449af-0848-432c-a0bc-e3068c984200/width=450/263169.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UGIECXEL4:~W^+?HD+M{?GM{%2jE$zoyRPnQ", + "meta": { + "Size": "512x768", + "seed": 2328795005, + "Model": "test_new_grapefruitv4", + "steps": 20, + "prompt": "breastsout , woman wearing a purple dress, petite, ktichen, food, flowers, exposed breasts, rimlight, green eyes, medium breasts, (smiling:0.7) ,", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "breastsout24_rvkwi", + "type": "lora", + "weight": 1 + }, + { + "hash": "37a86dca58", + "name": "test_new_grapefruitv4", + "type": "model" + } + ], + "Model hash": "37a86dca58", + "negativePrompt": "(worst quality, low quality:1.4)" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/10bd21bd-1b18-433f-823f-122c1314d300/width=450/263176.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "U5FNhu0:01^1~B=dNx0N000g%MeSD%58~AwJ", + "meta": { + "Size": "512x768", + "seed": 3293554281, + "Model": "URPM-V1.3_pruned", + "steps": 20, + "prompt": "a waitress in a tavern, waitress costume, breastsout , medieval, fantasy, braided hair, hand on hips, long skirt", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "breastsout24_rvkwi", + "type": "lora", + "weight": 1 + }, + { + "hash": "40f9701da0", + "name": "URPM-V1.3_pruned", + "type": "model" + } + ], + "Model hash": "40f9701da0", + "negativePrompt": "nudity", + "Face restoration": "CodeFormer" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/bec1abb0-97c7-40a0-ac7d-c5e9ebb73b00/width=450/263175.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "U8H,#40h5k$$0jRjw@I;00~B-p={%2R*4?E2", + "meta": { + "Size": "512x768", + "seed": 923247781, + "Model": "test_new_grapefruitv4", + "steps": 20, + "prompt": "breastsout , woman wearing a yellow dress, petite, living room, night, flowers, candlelight, exposed breasts, rimlight, purple eyes, medium breasts, (smiling:0.7) ,", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "breastsout24_rvkwi", + "type": "lora", + "weight": 1 + }, + { + "hash": "37a86dca58", + "name": "test_new_grapefruitv4", + "type": "model" + } + ], + "Model hash": "37a86dca58", + "negativePrompt": "(worst quality, low quality:1.4)" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/598ea5c7-de36-439e-8de9-b05dae59cc00/width=450/263174.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "U7H,|#9aF=9GImIV0et7HXVr_N%LBqIp%gNG", + "meta": { + "Size": "512x768", + "seed": 3675746082, + "Model": "URPM-V1.3_pruned", + "steps": 20, + "prompt": "breastsout , a 30 year old ginger woman in a coffee shop wearing a dotted dress, cozy", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "breastsout24_rvkwi", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "40f9701da0", + "name": "URPM-V1.3_pruned", + "type": "model" + } + ], + "Model hash": "40f9701da0", + "negativePrompt": "(big breasts:0.4)" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/26954fd2-25cf-462c-d7b8-9c0ae46a7b00/width=450/263173.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "ULCGMht700R*%gj[MyaySgaynhj[~poe9Fay", + "meta": { + "Size": "512x768", + "seed": 1912857690, + "Model": "URPM-V1.3_pruned", + "steps": 21, + "prompt": "fantasy, medieval, eerie, spooky, ghost, fog, breastsout , (cute:0.6)", + "sampler": "Euler a", + "cfgScale": 9.5, + "resources": [ + { + "name": "breastsout24_rvkwi", + "type": "lora", + "weight": 1 + }, + { + "hash": "40f9701da0", + "name": "URPM-V1.3_pruned", + "type": "model" + } + ], + "Model hash": "40f9701da0", + "negativePrompt": "(nudity:0.8), bad hands", + "Face restoration": "GFPGAN" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/dd0ff69f-8a60-4dbf-3304-3739750e8f00/width=450/263172.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UCE39V$$tyyU??D*S]%xyRtRMy%cyS-qoNI-", + "meta": { + "Size": "512x768", + "seed": 3138465628, + "Model": "URPM-V1.3_pruned", + "steps": 18, + "prompt": "a woman standing in a tropical forest wearing a white shirt and camo pants, (breastsout) , adventurous, close up", + "sampler": "Heun", + "cfgScale": 7, + "resources": [ + { + "name": "breastsout24_rvkwi", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "40f9701da0", + "name": "URPM-V1.3_pruned", + "type": "model" + } + ], + "Model hash": "40f9701da0", + "negativePrompt": "(big breasts:0.1)", + "Face restoration": "GFPGAN" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8dade0c6-e78e-4db5-b0a9-c0ab47d4c900/width=450/263171.jpeg", + "nsfw": true, + "width": 427, + "height": 640, + "hash": "UGE.-9.9tm%h?woJIqof58Rj%Lt7EObc-poz", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d609d755-7013-4a79-f567-cddafcb56e00/width=450/263170.jpeg", + "nsfw": true, + "width": 427, + "height": 640, + "hash": "U9Gl6S%MCFx]01s:00WD4=RP~DxZ0fbc9FS#", + "meta": null + } + ], + "downloadUrl": "https://civitai.com/api/download/models/24203" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastsOutExposed_24.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastsOutExposed_24.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..035c88eeb3db145d01f9b8a6ad7ff60f0bd1eb13 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastsOutExposed_24.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastsOutExposed_24.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastsOutExposed_24.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..a0cf35cc364ca877efe060df0627cc50f0f59a16 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastsOutExposed_24.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:f9a5b0fbf26942e1a8eb352663c350405ab243189bc729d1677f327668a15ad1 +size 9557984 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastsUndress_v13.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastsUndress_v13.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..255e035dab6e7adc8b4aa3b3ad83c7d951155114 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastsUndress_v13.civitai.info" @@ -0,0 +1,392 @@ +{ + "id": 42074, + "modelId": 35879, + "name": "v1.3", + "createdAt": "2023-04-10T17:53:07.679Z", + "updatedAt": "2023-04-10T18:10:05.414Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 2549, + "ratingCount": 3, + "rating": 5 + }, + "model": { + "name": "Breasts undress", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "breastsUndress_v13.safetensors", + "id": 32276, + "sizeKB": 9342.67578125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-10T17:56:19.545Z", + "hashes": { + "AutoV1": "796A8CE9", + "AutoV2": "7A5CD85A80", + "SHA256": "7A5CD85A80E05CCE6BAF573DF2BE7FDD5EEC5A094DDB7ED007CB0A8683AE4B92", + "CRC32": "0179E22A", + "BLAKE3": "789212BDB2227910FF48DFF96F270DBEAF28EE0403DF69D2FA32F9C34B9A2D67" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/42074" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e08732cb-1873-4e16-c1aa-81e4e74a7100/width=450/462013.jpeg", + "nsfw": false, + "width": 512, + "height": 768, + "hash": "UKK-2z01~q%29Ft7xvo00LozM{oL_3oeMxxu", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9b1806ce-10d7-4653-6f57-2da3abc21700/width=450/462230.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UNKd*#IU.Txa?b-;kDIU9ZX9s.RjD*M{-osm", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2268885275, + "Model": "neverendingDreamNED_noVae", + "steps": 20, + "hashes": { + "vae": "c6a580b13a", + "model": "3fa172acd6", + "lora:koreanDollLikeness_v15": "22885a3acd" + }, + "prompt": "\n,pureerosface_v1, \nshirt, undressing another, (realistic:1.4), clothes pull, dress pull, covering breasts, surprised, :o, a, masterpiece, best quality, highly detailed", + "sampler": "Euler a", + "cfgScale": 9.5, + "resources": [ + { + "name": "pov_breasts_undress_v1.3", + "type": "lora", + "weight": 1 + }, + { + "name": "koreanDollLikeness_v15", + "type": "lora", + "weight": 0.4 + }, + { + "hash": "3fa172acd6", + "name": "neverendingDreamNED_noVae", + "type": "model" + } + ], + "Model hash": "3fa172acd6", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "(worst quality, low quality:1.4)", + "Denoising strength": "0.25" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/32d05fa3-576d-4904-c659-b10a3a929800/width=450/462231.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UKGuj^a0%Nbc_NIA9aR*57M{tRs:kD9Z?HRj", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 96453432, + "Model": "neverendingDreamNED_noVae", + "steps": 20, + "hashes": { + "vae": "f921fb3f29", + "model": "3fa172acd6", + "lora:koreanDollLikeness_v15": "22885a3acd" + }, + "prompt": "\n,pureerosface_v1, \nshirt, undressing another, (realistic:1.3), clothes pull, dress pull, covering breasts,, masterpiece, best quality, highly detailed", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "resources": [ + { + "name": "pov_breasts_undress_v1.3", + "type": "lora", + "weight": 1 + }, + { + "name": "koreanDollLikeness_v15", + "type": "lora", + "weight": 0.4 + }, + { + "hash": "3fa172acd6", + "name": "neverendingDreamNED_noVae", + "type": "model" + } + ], + "Model hash": "3fa172acd6", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "(worst quality, low quality:1.4)", + "Denoising strength": "0.25" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/15fb2430-9abf-4e67-4716-fe74e9708500/width=450/462056.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UJJHExxG00-;pIIV%2?G9tM{kBoz~pjsIUIV", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2126742764, + "Model": "AbyssOrangeMix_AbyssOrangeMix2_hard", + "steps": 20, + "hashes": { + "vae": "f921fb3f29", + "model": "0fc198c490" + }, + "prompt": "\npulled by another, pov, fisheye, breast grab,, masterpiece, best quality, highly detailed", + "sampler": "DPM++ 2M Karras", + "cfgScale": 5, + "resources": [ + { + "name": "pov_breasts_undress_v1.3", + "type": "lora", + "weight": 1 + }, + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix_AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "(worst quality, low quality:1.4)" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8668778f-bf31-4fdb-1ec0-efc7a3b69500/width=450/462062.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UDJaWS_30e?b_M?H_2~q0LNH%1X7~WEL4o-p", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2819730197, + "Model": "AbyssOrangeMix_AbyssOrangeMix2_hard", + "steps": 20, + "hashes": { + "vae": "f921fb3f29", + "model": "0fc198c490" + }, + "prompt": "\nmultiple hands,, masterpiece, best quality, highly detailed", + "sampler": "DPM++ 2M Karras", + "cfgScale": 5, + "resources": [ + { + "name": "pov_breasts_undress_v1.3", + "type": "lora", + "weight": 1.1 + }, + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix_AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "(worst quality, low quality:1.4)" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/cdd34bae-5649-43df-74f9-209025781a00/width=450/462060.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UPJt-w%2YR_3T0%N^+t80Ko~xYRkT0jZIpWB", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3843439621, + "Model": "AbyssOrangeMix_AbyssOrangeMix2_hard", + "steps": 20, + "hashes": { + "vae": "f921fb3f29", + "model": "0fc198c490" + }, + "prompt": "\npulled by another, hands on face, bikini, hands,, masterpiece, best quality, highly detailed", + "sampler": "DPM++ 2M Karras", + "cfgScale": 5, + "resources": [ + { + "name": "pov_breasts_undress_v1.3", + "type": "lora", + "weight": 1 + }, + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix_AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "(worst quality, low quality:1.4)" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/44bb2ea3-9f2d-4ff6-f9ca-6c3cd0a14b00/width=450/462059.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UAG[7z~q_2?b57^+X9%20eMxs9M{={Mx00IU", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 765120260, + "Model": "AbyssOrangeMix_AbyssOrangeMix2_hard", + "steps": 20, + "hashes": { + "vae": "f921fb3f29", + "model": "0fc198c490" + }, + "prompt": "\npulled by another, arms behind head, bra, hands, masterpiece, best quality, highly detailed", + "sampler": "DPM++ 2M Karras", + "cfgScale": 5, + "resources": [ + { + "name": "pov_breasts_undress_v1.3", + "type": "lora", + "weight": 1 + }, + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix_AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "(worst quality, low quality:1.4)" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7df279e9-149c-4101-489f-1188ee2b6600/width=450/462057.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UPKTul_24-Mx?aoIE2aeIpM{ngRk~V%1M{%M", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1951784484, + "Model": "AbyssOrangeMix_AbyssOrangeMix2_hard", + "steps": 20, + "hashes": { + "vae": "f921fb3f29", + "model": "0fc198c490" + }, + "prompt": "\npulled by another, arms behind back, bra, hands, wardrobe malfunction,, masterpiece, best quality, highly detailed", + "sampler": "DPM++ 2M Karras", + "cfgScale": 5, + "resources": [ + { + "name": "pov_breasts_undress_v1.3", + "type": "lora", + "weight": 1 + }, + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix_AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "(worst quality, low quality:1.4)" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/49cb3528-d92b-4b8f-6b30-48e349c18500/width=450/462061.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UHKT_N00?w_N_ND%-;-;0fWB?Hofn3Io9ZIA", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2854249948, + "Model": "AbyssOrangeMix_AbyssOrangeMix2_hard", + "steps": 20, + "hashes": { + "vae": "f921fb3f29", + "model": "0fc198c490" + }, + "prompt": "\npulled by another, hands on own chest, bikini, hands,, masterpiece, best quality, highly detailed", + "sampler": "DPM++ 2M Karras", + "cfgScale": 5, + "resources": [ + { + "name": "pov_breasts_undress_v1.3", + "type": "lora", + "weight": 1 + }, + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix_AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "(worst quality, low quality:1.4)" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a8cfdc2f-97f1-46dc-770b-56266e077100/width=450/462058.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UDGRn~t90J9Z~qIo9F-:Rkxt9G9Z9tRk%Ms;", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1217827907, + "Model": "AbyssOrangeMix_AbyssOrangeMix2_hard", + "steps": 20, + "hashes": { + "vae": "f921fb3f29", + "model": "0fc198c490" + }, + "prompt": "\nmultiple hands,, masterpiece, best quality, highly detailed", + "sampler": "DPM++ 2M Karras", + "cfgScale": 5, + "resources": [ + { + "name": "pov_breasts_undress_v1.3", + "type": "lora", + "weight": 1 + }, + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix_AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "(worst quality, low quality:1.4)" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/42074" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastsUndress_v13.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastsUndress_v13.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..dfbec6762e2f8cf4264d7f3a15a1a4806642b72c --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastsUndress_v13.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:3dd594e26944c7fa73933e0885b396eaa2a2d50b328fe55c96e09b3d0c0bcd16 +size 1068070 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastsUndress_v13.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastsUndress_v13.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..96336b450fea7932348aa64fe1d458caf0471494 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/breastsUndress_v13.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:7a5cd85a80e05cce6baf573df2be7fdd5eec5a094ddb7ed007cb0a8683ae4b92 +size 9566900 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/bukkake_v2.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/bukkake_v2.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..e9bf2877e1fdc71e925ba6813c192a2870475d19 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/bukkake_v2.civitai.info" @@ -0,0 +1,221 @@ +{ + "id": 56764, + "modelId": 31040, + "name": "v2", + "createdAt": "2023-04-27T17:24:24.189Z", + "updatedAt": "2023-04-27T17:26:11.908Z", + "trainedWords": [ + "bukkake" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

bug fixed, v2 is lora not locon

The trigger word is bukkake, and you can control the cum by applying the following prompt:

cum on hair, cum in mouth, facial, cum on breasts, cum on body, cum in pussy

The suggested weight is 0.8 - 1

", + "stats": { + "downloadCount": 266, + "ratingCount": 1, + "rating": 5 + }, + "model": { + "name": "bukkake", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "bukkake_v2.safetensors", + "id": 40574, + "sizeKB": 36992.7841796875, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-27T17:26:24.448Z", + "hashes": { + "AutoV1": "77C77D47", + "AutoV2": "4E080D6269", + "SHA256": "4E080D6269B3E37C2B22F2258C73FCDD439AA9CC9FB1CCA1EB245C0C22BDD8AD", + "CRC32": "63D7125E", + "BLAKE3": "CBF80FC9DDE007C51B4B17D662709019C323877644EA95F3B8299D18BD5BC640" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/56764" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d7d205c7-e83c-44cd-a836-a202caa9ac00/width=450/615553.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UFH1#.xv009t~CM{WC-oIn-oI;M|0gNGs*%L", + "meta": { + "Size": "512x512", + "seed": 4093290471, + "Model": "AbyssOrangeMix2_hard", + "steps": 20, + "hashes": { + "model": "0fc198c490" + }, + "prompt": "masterpiece, best quality, 1girl, multiple boys, multiple penises, cum in pussy, cum on body, facial, cum on breasts, cum on hair, cum in mouth, bukkake, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative, bad anatomy, bad hands, cropped, missing fingers, missing toes, too many toes, too many fingers, missing arms, long neck, Humpbacked, deformed, disfigured, poorly drawn face, distorted face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, floating limbs, disconnected limbs, malformed hands, out of focus, long body, monochrome, symbol, text, logo, door frame, window frame, mirror frame" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d237a7e7-599c-41e8-daad-25be9efb3100/width=450/615554.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UBIOFQ$*009uD4ni}?Ip9uNxx]xtAbxDM|E2", + "meta": { + "Size": "512x512", + "seed": 3893082425, + "Model": "AbyssOrangeMix2_hard", + "steps": 20, + "hashes": { + "model": "0fc198c490" + }, + "prompt": "masterpiece, best quality, 1girl, multiple boys, multiple penises, cum in pussy, cum on body, facial, cum on breasts, cum on hair, cum in mouth, bukkake, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative, bad anatomy, bad hands, cropped, missing fingers, missing toes, too many toes, too many fingers, missing arms, long neck, Humpbacked, deformed, disfigured, poorly drawn face, distorted face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, floating limbs, disconnected limbs, malformed hands, out of focus, long body, monochrome, symbol, text, logo, door frame, window frame, mirror frame" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/70890426-0d83-43ae-2585-03d077608200/width=450/615551.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "U9Iz-k0000%200~W=|t69Zt5-;D%0e9G%M?H", + "meta": { + "Size": "512x512", + "seed": 3893082424, + "Model": "AbyssOrangeMix2_hard", + "steps": 20, + "hashes": { + "model": "0fc198c490" + }, + "prompt": "masterpiece, best quality, 1girl, multiple boys, multiple penises, cum in pussy, cum on body, facial, cum on breasts, cum on hair, cum in mouth, bukkake, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative, bad anatomy, bad hands, cropped, missing fingers, missing toes, too many toes, too many fingers, missing arms, long neck, Humpbacked, deformed, disfigured, poorly drawn face, distorted face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, floating limbs, disconnected limbs, malformed hands, out of focus, long body, monochrome, symbol, text, logo, door frame, window frame, mirror frame" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7ec35b06-6daf-46a3-087a-9c4f16af9b00/width=450/615529.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "U5KT#y%#000ME0~p^k0Mtj4.x^E20L?a4:tS", + "meta": { + "Size": "512x512", + "seed": 2196905465, + "Model": "AbyssOrangeMix2_hard", + "steps": 20, + "hashes": { + "model": "0fc198c490" + }, + "prompt": "masterpiece, best quality, 1girl, blonde hair, crying, twintail, multiple boys, multiple penises, cum in pussy, cum on body, facial, cum on breasts, cum on hair, cum in mouth, bukkake, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative, bad anatomy, bad hands, cropped, missing fingers, missing toes, too many toes, too many fingers, missing arms, long neck, Humpbacked, deformed, disfigured, poorly drawn face, distorted face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, floating limbs, disconnected limbs, malformed hands, out of focus, long body, monochrome, symbol, text, logo, door frame, window frame, mirror frame" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b22ac435-2871-492a-a1fe-609d1d8e0a00/width=450/615528.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UDJQ=:xu0J%300R*Rk9ZMc?Hxvs.~qM{?bx[", + "meta": { + "Size": "512x512", + "seed": 3352786360, + "Model": "AbyssOrangeMix2_hard", + "steps": 20, + "hashes": { + "model": "0fc198c490" + }, + "prompt": "masterpiece, best quality, 1girl, cum in pussy, bukkake, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative, bad anatomy, bad hands, cropped, missing fingers, missing toes, too many toes, too many fingers, missing arms, long neck, Humpbacked, deformed, disfigured, poorly drawn face, distorted face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, floating limbs, disconnected limbs, malformed hands, out of focus, long body, monochrome, symbol, text, logo, door frame, window frame, mirror frame" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/46be1272-2878-46f8-4307-ed08ca83e300/width=450/615534.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "U7LD+90021-=00D*Io%MM_xu%0~pRisqV@?b", + "meta": { + "Size": "512x512", + "seed": 1576110642, + "Model": "AbyssOrangeMix2_hard", + "steps": 20, + "hashes": { + "model": "0fc198c490" + }, + "prompt": "masterpiece, best quality, 1girl, cum in pussy, cum on body, facial, cum on breasts, cum on hair, cum in mouth, bukkake, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative, bad anatomy, bad hands, cropped, missing fingers, missing toes, too many toes, too many fingers, missing arms, long neck, Humpbacked, deformed, disfigured, poorly drawn face, distorted face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, floating limbs, disconnected limbs, malformed hands, out of focus, long body, monochrome, symbol, text, logo, door frame, window frame, mirror frame" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/56764" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/bukkake_v2.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/bukkake_v2.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..d93de7e0b36c0a59f00e67ae4417ed0050d12a76 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/bukkake_v2.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/bukkake_v2.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/bukkake_v2.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..13b8526d4233561fc07230002970569f61f75a94 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/bukkake_v2.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:4e080d6269b3e37c2b22f2258c73fcdd439aa9cc9fb1cca1eb245c0c22bdd8ad +size 37880611 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/busttape-10.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/busttape-10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..549b52784c9a61cbb37c9b67d6d58c79ad95cc8b --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/busttape-10.civitai.info" @@ -0,0 +1,235 @@ +{ + "id": 75405, + "modelId": 70719, + "name": "v1.0", + "createdAt": "2023-05-19T23:56:32.634Z", + "updatedAt": "2023-05-20T00:00:35.945Z", + "trainedWords": [ + "busttape,tape measure,arms up,arms behind head, looking at viewer, pov, pov hands, large breasts, upper body," + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 66, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Bust Measuring (Concept)", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "busttape-10.safetensors", + "id": 52069, + "sizeKB": 18560.615234375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-20T00:01:04.958Z", + "hashes": { + "AutoV1": "DE2F2560", + "AutoV2": "1554DBC25C", + "SHA256": "1554DBC25C68A5B6F7FE0F146B4AC37C865CD85C590EF8B32ADDCC109088F05D", + "CRC32": "18109260", + "BLAKE3": "7E64AF55C07A930ECDDCAA6B5C619ACD5988CB27AE0E9891F4B2CA6747D8FEF8" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/75405" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1f253fa8-3e14-4a80-b5f0-799eb9111888/width=450/843446.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UVG8l[Io%gt7~WRkozoLR*bH%2WBIUkCw^og", + "meta": { + "ENSD": "31337", + "Size": "1024x1536", + "seed": 59792561, + "Model": "hassakuHentaiModel_v12", + "steps": 20, + "hashes": { + "model": "d3cd6ac55a" + }, + "prompt": "masterpiece, best quality,1girl, ,busttape,tape measure,arms up,arms behind head, looking at viewer, pov, pov hands, large breasts, upper body,bodysuit,gym, workout equipment, treadmill, light particles", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "'Overlap'": "48", + "Clip skip": "2", + "resources": [ + { + "hash": "d3cd6ac55a", + "name": "hassakuHentaiModel_v12", + "type": "model" + } + ], + "\"{'Method'": "'MultiDiffusion'", + "'Upscaler'": "'4x-UltraSharp'", + "Model hash": "d3cd6ac55a", + "'Scale factor'": "2", + "negativePrompt": "badhandv4,(worst quality, low quality:1.4), (greyscale, monochrome:1.0), text, title, logo, signature", + "'Keep input size'": "True}\"", + "'Tile batch size'": "8", + "Denoising strength": "0.3", + "'Latent tile width'": "96", + "'Latent tile height'": "96", + "Tiled Diffusion upscaler": "4x-UltraSharp", + "Discard penultimate sigma": "True", + "Tiled Diffusion scale factor": "2" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3bc2b612-07ec-4d47-a906-426339013e18/width=450/843448.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "UIJjl69a0e%M=|ogShWX~BWB9ut79Ys.-Voc", + "meta": { + "ENSD": "31337", + "Size": "1024x1536", + "seed": 1629927873, + "Model": "hassakuHentaiModel_v12", + "steps": 20, + "hashes": { + "model": "d3cd6ac55a" + }, + "prompt": "masterpiece, best quality,1girl, ,busttape,tape measure,arms up,arms behind head, looking at viewer, pov, pov hands, large breasts, upper body,sports bra", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "'Overlap'": "48", + "Clip skip": "2", + "resources": [ + { + "hash": "d3cd6ac55a", + "name": "hassakuHentaiModel_v12", + "type": "model" + } + ], + "\"{'Method'": "'MultiDiffusion'", + "'Upscaler'": "'4x-UltraSharp'", + "Model hash": "d3cd6ac55a", + "'Scale factor'": "2", + "negativePrompt": "badhandv4,(worst quality, low quality:1.4), (greyscale, monochrome:1.0), text, title, logo, signature", + "'Keep input size'": "True}\"", + "'Tile batch size'": "8", + "Denoising strength": "0.3", + "'Latent tile width'": "96", + "'Latent tile height'": "96", + "Tiled Diffusion upscaler": "4x-UltraSharp", + "Discard penultimate sigma": "True", + "Tiled Diffusion scale factor": "2" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d4c88202-fcfe-49d2-b9c3-8028db281615/width=450/843456.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1536, + "hash": "U8G[KH~W009Z0gRj%NoM00Rj-;S4xVbc^jof", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0f27dd80-f617-4e48-b85f-40eb613a9d6c/width=450/843454.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "UOJ*F??b_MNG~Wog~qt7W9xF%MbH9aWBw^V@", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6237dbb7-47e4-44d8-8a1c-bbd93dda8b25/width=450/843445.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "UFK1E{%2CSxuMHof}ms.4.NH?Fbc-=n$i^n$", + "meta": { + "ENSD": "31337", + "Size": "1024x1536", + "seed": 4022136899, + "Model": "hassakuHentaiModel_v12", + "steps": 20, + "hashes": { + "model": "d3cd6ac55a" + }, + "prompt": "masterpiece, best quality,1girl, ,busttape,tape measure,arms up,arms behind head, looking at viewer, pov, pov hands, large breasts, upper body,bikini,pool, outdoors, pool toys", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "'Overlap'": "48", + "Clip skip": "2", + "resources": [ + { + "hash": "d3cd6ac55a", + "name": "hassakuHentaiModel_v12", + "type": "model" + } + ], + "\"{'Method'": "'MultiDiffusion'", + "'Upscaler'": "'4x-UltraSharp'", + "Model hash": "d3cd6ac55a", + "'Scale factor'": "2", + "negativePrompt": "badhandv4,(worst quality, low quality:1.4), (greyscale, monochrome:1.0), text, title, logo, signature", + "'Keep input size'": "True}\"", + "'Tile batch size'": "8", + "Denoising strength": "0.3", + "'Latent tile width'": "96", + "'Latent tile height'": "96", + "Tiled Diffusion upscaler": "4x-UltraSharp", + "Discard penultimate sigma": "True", + "Tiled Diffusion scale factor": "2" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/473a33f4-a043-402a-bfe5-ee5e4e987975/width=450/843453.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "U7H_GYRn00^k]ifl~p-o00IoSxjacYWXQmt6", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b9d17e30-e7c3-4b51-b7b8-cc47065c2b17/width=450/843451.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UCG[KH4n5m=|~DIUyEr=^+IT9]Rj9aM{xusn", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/fa35b386-29fe-407c-9440-0a2e8bce80a6/width=450/843450.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "UGHn$@~qyW-;.9-;?v-=9Zxv?Hxv^%?GInjF", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/da8a7f01-5a7c-4921-aabb-70d607ce356e/width=450/843457.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1536, + "hash": "U8INw3D*00~V02oz~Vxu00s+^*s:EMn#9ZaJ", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c5c15c6c-1f13-4a0f-abf6-e64f9985ece6/width=450/843447.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1536, + "hash": "UEINv}RjPARP9[NG^+M{00W?9atR~At89Ft7", + "meta": null + } + ], + "downloadUrl": "https://civitai.com/api/download/models/75405" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/busttape-10.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/busttape-10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..456de5aa9e50ff38fcc46fbb454b4274b505db08 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/busttape-10.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/busttape-10.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/busttape-10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..b0f31e492a003fb070d0d52149cb5d4a4094a8b4 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/busttape-10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:1554dbc25c68a5b6f7fe0f146b4ac37c865cd85c590ef8b32addcc109088f05d +size 19006070 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/chinchinpose_v10.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/chinchinpose_v10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..a81258c3bfaf323a3a57ec396827c0284d5d753b --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/chinchinpose_v10.civitai.info" @@ -0,0 +1,88 @@ +{ + "id": 43592, + "modelId": 37622, + "name": "v1.0", + "createdAt": "2023-04-12T10:46:47.454Z", + "updatedAt": "2023-04-12T11:19:32.920Z", + "trainedWords": [ + "CHINPOSE" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "model": { + "name": "chinchinpose", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "chinchinpose_v10.safetensors", + "id": 33103, + "sizeKB": 152242.71875, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-12T10:50:48.407Z", + "hashes": { + "AutoV1": "6BC9D271", + "AutoV2": "B1A3306DBA", + "SHA256": "B1A3306DBAC118A8B99E9C13B0311A5D856D337291F9723F8CBE0A7F55DDCEA2", + "CRC32": "7A22F41F", + "BLAKE3": "BB4F336CEF96E31C8D7082FCFB2ABFBB0C07D14A60B5E3F8199E5B712C56A141" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/43592" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/89fda164-ed7f-4105-8f55-01188526d900/width=450/476723.jpeg", + "nsfw": true, + "width": 1024, + "height": 1280, + "hash": "UPM7Jv_N_2tl~WD*M_RjI=Rj%2%M?bRjozt7", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 1876853490, + "steps": 20, + "prompt": ",chinpose,1girl, heart-shaped pupils, heart, symbol-shaped pupils, 1boy, underwear, hetero, penis, squatting,tongue out, tongue, blush, open mouth, boots, collar, solo focus, spread legs, (white background, simple background:1.4),(nude:1.5),pet play,dog ears,(white panties:1.5), large breasts, mature female,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "Model hash": "d124fc18f0", + "Hires steps": "10", + "Hires resize": "1024x1280", + "Hires upscaler": "lollypop", + "negativePrompt": "(low quality, worst quality:1.4),3D,large breasts, penis,dog tail, (leash, viewer holding leash:1.4),(censor,bar censor,mosaic censorship:1.5),(loil:1.4),(child:1.4)", + "Denoising strength": "0.49" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/291bc8b6-2df8-4d2a-2f41-049474e0a900/width=450/476722.jpeg", + "nsfw": true, + "width": 1024, + "height": 1280, + "hash": "UqN0uO.8_NRP%gj[%MRjNGRis.fkx[t7jsfj", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ab432124-73f7-4a1d-58f6-1de4ba760700/width=450/476725.jpeg", + "nsfw": true, + "width": 2048, + "height": 2560, + "hash": "UPN0*m00?b~qIpIUD%%M-=n%%LM{-:V@%MV@", + "meta": null + } + ], + "downloadUrl": "https://civitai.com/api/download/models/43592" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/chinchinpose_v10.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/chinchinpose_v10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..3ff5e9bce77da3563c1bb061bba07deda2f1f3b2 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/chinchinpose_v10.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:e0d3cb805da55130c26fe7ba3a4ddb2e062c430d80e68a8e6047afa780d68916 +size 1275517 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/chinchinpose_v10.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/chinchinpose_v10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..1649ed3f00792234b5f85efc626c46f57422a194 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/chinchinpose_v10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:b1a3306dbac118a8b99e9c13b0311a5d856d337291f9723f8cbe0a7f55ddcea2 +size 155896544 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/chisatoHandstandPose_v1.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/chisatoHandstandPose_v1.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..4ceb7d79866991f10941ed5c4b7dd2514919e21d --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/chisatoHandstandPose_v1.civitai.info" @@ -0,0 +1,211 @@ +{ + "id": 15639, + "modelId": 13272, + "name": "V1", + "createdAt": "2023-02-26T10:23:36.821Z", + "updatedAt": "2023-02-26T10:24:10.531Z", + "trainedWords": [ + "lycoris challenge (meme)", + "upside-down", + "handstand", + "one arm handstand" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 1830, + "ratingCount": 2, + "rating": 4 + }, + "model": { + "name": "Chisato Handstand Pose - Lycoris Recoil (lycoris challenge) ", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "chisatoHandstandPose_v1.safetensors", + "id": 13370, + "sizeKB": 147581.134765625, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-02-26T10:26:18.536Z", + "hashes": { + "AutoV1": "8F1E646E", + "AutoV2": "90924FD5C0", + "SHA256": "90924FD5C092C5CD823DFC91322201FE7ABA794015F33F47B1225C31B06E4A88", + "CRC32": "4F2273D6", + "BLAKE3": "299AB04AB17165D5BB54F544952D695E4E1847E8F1F1B97E4957A67A5F996683" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/15639" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d99806a2-0799-4cf1-5100-a2ca4e90e600/width=450/156183.jpeg", + "nsfw": false, + "width": 512, + "height": 1024, + "hash": "UhHo8%t7ITj[~qoeofofxuayj]s:j]jtjsaz", + "meta": { + "Size": "512x1024", + "seed": 2621769221, + "Model": "Anime_AOM3A2", + "steps": 20, + "prompt": "masterpiece, best quality, ultra-detailed, illustration, 1girl, lycoris challenge \\(meme\\), one arm handstand, upside-down, , white tshirt, black skirt, blue hair, pantyhose, medium breats", + "sampler": "DPM++ SDE Karras", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "name": "ChisatoHandstand", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "553398964f", + "name": "Anime_AOM3A2", + "type": "model" + } + ], + "Model hash": "553398964f", + "negativePrompt": "" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1a4779e0-c21b-49df-0808-ad0777975a00/width=450/156187.jpeg", + "nsfw": false, + "width": 512, + "height": 1024, + "hash": "UQF~U5RjM_of~qWB-;oL?bWVM{s:-=oeD%Rj", + "meta": { + "Size": "512x1024", + "seed": 4259087127, + "Model": "Anime_AOM3A2", + "steps": 20, + "prompt": "masterpiece, best quality, ultra-detailed, illustration, 1girl, lycoris challenge \\(meme\\), one arm handstand, upside-down, , white tshirt, black skirt, blue hair, pantyhose, medium breats", + "sampler": "DPM++ SDE Karras", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "name": "ChisatoHandstand", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "553398964f", + "name": "Anime_AOM3A2", + "type": "model" + } + ], + "Model hash": "553398964f", + "negativePrompt": "" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7c24a305-74e8-4f0f-bcfa-821c8097d900/width=450/156186.jpeg", + "nsfw": false, + "width": 512, + "height": 1024, + "hash": "U7I}kn-:_1^+00ofM|M|E1R+Rke-?wayDhkC", + "meta": { + "Size": "512x1024", + "seed": 4259087128, + "Model": "Anime_AOM3A2", + "steps": 20, + "prompt": "masterpiece, best quality, ultra-detailed, illustration, 1girl, lycoris challenge \\(meme\\), one arm handstand, upside-down, , white tshirt, black skirt, blue hair, pantyhose, medium breats", + "sampler": "DPM++ SDE Karras", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "name": "ChisatoHandstand", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "553398964f", + "name": "Anime_AOM3A2", + "type": "model" + } + ], + "Model hash": "553398964f", + "negativePrompt": "" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/32f29261-1f00-485c-bc90-62c621a35500/width=450/156185.jpeg", + "nsfw": false, + "width": 512, + "height": 1024, + "hash": "UUIhNqoL.8xu~qof%Lof-:oyD*fQtRayoJju", + "meta": { + "Size": "512x1024", + "seed": 510069197, + "Model": "Anime_AOM3A2", + "steps": 20, + "prompt": "masterpiece, best quality, ultra-detailed, illustration, 1girl, lycoris challenge \\(meme\\), one arm handstand, upside-down, , black tshirt, red skirt, pink hair, pantyhose, medium breats", + "sampler": "DPM++ SDE Karras", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "name": "ChisatoHandstand", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "553398964f", + "name": "Anime_AOM3A2", + "type": "model" + } + ], + "Model hash": "553398964f", + "negativePrompt": "(worst quality, low quality:1.4), (monochrome:1.1), BadPrompt, sketch by BadArtist, VeryBadImageNegative, DeepNegative, EasyNegative, nsfw" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/db80151f-036a-477a-5879-6778e072d100/width=450/156184.jpeg", + "nsfw": false, + "width": 512, + "height": 1024, + "hash": "UPJ86Gt7%fxu~qoe-;tR%gt7D%WBWUWBxuof", + "meta": { + "Size": "512x1024", + "seed": 510069197, + "Model": "Anime_AOM3A2", + "steps": 20, + "prompt": "masterpiece, best quality, ultra-detailed, illustration, 1girl, lycoris challenge \\(meme\\), one arm handstand, upside-down, , black tshirt, pink skirt, white hair, black pantyhose, medium breasts", + "sampler": "DPM++ SDE Karras", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "name": "ChisatoHandstand", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "553398964f", + "name": "Anime_AOM3A2", + "type": "model" + } + ], + "Model hash": "553398964f", + "negativePrompt": "(worst quality, low quality:1.4), (monochrome:1.1), BadPrompt, sketch by BadArtist, VeryBadImageNegative, DeepNegative, EasyNegative, nsfw" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/15639" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/chisatoHandstandPose_v1.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/chisatoHandstandPose_v1.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..84d29ad9014b94abb8ad64733b238da37725ab0d Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/chisatoHandstandPose_v1.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/chisatoHandstandPose_v1.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/chisatoHandstandPose_v1.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..d739342550e33bbc84be9703c95c525cf23c5794 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/chisatoHandstandPose_v1.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:90924fd5c092c5cd823dfc91322201fe7aba794015f33f47b1225c31b06e4a88 +size 151123082 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/coinPendulumHypnosisSex_v10.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/coinPendulumHypnosisSex_v10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..df210f4e751c3c30e4ec11b3182f4e7a77daa2ee --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/coinPendulumHypnosisSex_v10.civitai.info" @@ -0,0 +1,80 @@ +{ + "id": 9648, + "modelId": 8169, + "name": "v1.0", + "createdAt": "2023-02-12T05:51:49.335Z", + "updatedAt": "2023-02-12T05:52:49.314Z", + "trainedWords": [ + " " + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "model": { + "name": "Coin / Pendulum / Hypnosis | Sex Act Lora 314", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "coinPendulumHypnosisSex_v10.safetensors", + "id": 9335, + "sizeKB": 9369.3466796875, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-02-12T05:55:55.185Z", + "hashes": { + "AutoV1": "29244D48", + "AutoV2": "A5AFD15D61", + "SHA256": "A5AFD15D61BB91252645059D19E2A83613D56E90438D8118A9169680D0A2C262", + "CRC32": "4BF4AD17", + "BLAKE3": "624674FB14B938624D17CD46B776AFB89D21EF023548448BC38D2C51C3DDA9A3" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/9648" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d0ffb73c-0719-488d-775b-9003a7709b00/width=450/93238.jpeg", + "nsfw": true, + "width": 2048, + "height": 2048, + "hash": "UNJQvTVt00IoozIURP~VInt6WA%M%M%LxaM{", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d63bc3af-335a-430b-6e3d-a34c6c82ab00/width=450/93241.jpeg", + "nsfw": true, + "width": 2048, + "height": 2048, + "hash": "UfMjm@~q%gt6?voyaeIVxujYR*RlxaRjoJfk", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4cdd535c-4be3-4c3b-ee29-5dfb76bfbd00/width=450/93240.jpeg", + "nsfw": false, + "width": 2048, + "height": 2048, + "hash": "UJLD.I?uXR?b~p$j-;kWIBIU-:n$?v%2D$In", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0f68e537-ec2f-43d5-8e97-f8d0c4085000/width=450/93239.jpeg", + "nsfw": true, + "width": 2048, + "height": 2048, + "hash": "UCIXmo000L%MNHX9IU~W9F?a4nt7%NRP%2M{", + "meta": null + } + ], + "downloadUrl": "https://civitai.com/api/download/models/9648" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/coinPendulumHypnosisSex_v10.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/coinPendulumHypnosisSex_v10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..debf33b8eff91b3bc4a1edfe4123822785a09a2f --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/coinPendulumHypnosisSex_v10.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:3de3aef5cbe2e1452962a4662918b87b4783d70a09c7ea6a5b09ebe650117ed7 +size 4777498 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/coinPendulumHypnosisSex_v10.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/coinPendulumHypnosisSex_v10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..247f44379eaf9567452931492892bc1fbedd66d0 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/coinPendulumHypnosisSex_v10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:a5afd15d61bb91252645059d19e2a83613d56e90438d8118a9169680d0a2c262 +size 9594211 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/concept-implied_sex-see-through_silhouette-v1.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/concept-implied_sex-see-through_silhouette-v1.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..090f50bd8e558d25bc49028d341df168df799b3c --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/concept-implied_sex-see-through_silhouette-v1.civitai.info" @@ -0,0 +1,354 @@ +{ + "id": 60953, + "modelId": 56533, + "name": "v1", + "createdAt": "2023-05-02T23:54:18.436Z", + "updatedAt": "2023-05-02T23:56:08.321Z", + "trainedWords": [ + "implied sex", + "see-through silhouette" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

first version, works well, might need to be retagged

", + "stats": { + "downloadCount": 693, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "implied_sex see-through_silhouette concept", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "concept-implied_sex-see-through_silhouette-v1.safetensors", + "id": 43139, + "sizeKB": 147609.890625, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-02T23:56:26.722Z", + "hashes": { + "AutoV1": "246DC7AA", + "AutoV2": "AE9B6D6E23", + "SHA256": "AE9B6D6E232E6FD1D5D8448F6EC028DB29549A8BFBED146AEAEEF17A7E48D9E2", + "CRC32": "ECFA72C2", + "BLAKE3": "5B40BC5DF441116919EF216FB338D54CD9BBDFAEBBD806E7DA954A9B94C60E82" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/60953" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/17895f56-4822-4d13-bc48-5d2b41455fd5/width=450/668018.jpeg", + "nsfw": "X", + "width": 512, + "height": 768, + "hash": "UGL4Ql-;_M%M56ozELRj00InZ~RP.8NFxuoe", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2431267454, + "Model": "AOM3", + "steps": 50, + "hashes": { + "model": "d124fc18f0" + }, + "prompt": "implied sex, see-through silhouette, pov, see-through, bedroom, white shirt, oversized clothes, oversized shirt, t-shirt, \n[mature female, medium breasts:0.2]\n", + "sampler": "Euler a", + "cfgScale": 5, + "Clip skip": "2", + "resources": [ + { + "hash": "d124fc18f0", + "name": "AOM3", + "type": "model" + } + ], + "Model hash": "d124fc18f0", + "negativePrompt": "(worst quality, low quality:1.4)," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/260b8f0e-91e3-4ffe-9de5-ad8d83e608e2/width=450/668027.jpeg", + "nsfw": "X", + "width": 512, + "height": 768, + "hash": "UXJk7i~V%gxt9}R+W?WBD*NHs:ofXTofada}", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 736461940, + "Model": "AOM3", + "steps": 50, + "hashes": { + "model": "d124fc18f0" + }, + "prompt": "implied sex, see-through silhouette, pov, see-through, sundress, outdoors,\n[mature female, medium breasts:0.2]\n", + "sampler": "Euler a", + "cfgScale": 5, + "Clip skip": "2", + "resources": [ + { + "hash": "d124fc18f0", + "name": "AOM3", + "type": "model" + } + ], + "Model hash": "d124fc18f0", + "negativePrompt": "(worst quality, low quality:1.4)," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/cc7884d7-086c-4506-999a-59639bc2a9a1/width=450/668023.jpeg", + "nsfw": "X", + "width": 512, + "height": 768, + "hash": "UVH2Zr?v_Nxuu6x]OYkB%2kCjEWB9tt7n#oy", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 736461940, + "Model": "AOM3", + "steps": 50, + "hashes": { + "model": "d124fc18f0" + }, + "prompt": "implied sex, see-through silhouette, pov, see-through, sundress, outdoors, black dress,\n[mature female, medium breasts:0.2]\n", + "sampler": "Euler a", + "cfgScale": 5, + "Clip skip": "2", + "resources": [ + { + "hash": "d124fc18f0", + "name": "AOM3", + "type": "model" + } + ], + "Model hash": "d124fc18f0", + "negativePrompt": "(worst quality, low quality:1.4)," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9e47ed00-ddc7-438e-bf3c-e8ef981f97c9/width=450/668024.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "UbIq$E%g~q%M%gt7X8j]IARPMxRj4.WAM{WB", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 736461940, + "Model": "AOM3", + "steps": 50, + "hashes": { + "model": "d124fc18f0" + }, + "prompt": "implied sex, see-through silhouette, pov, see-through, sundress, bedroom, black dress,\n[mature female, medium breasts:0.2]\n", + "sampler": "Euler a", + "cfgScale": 5, + "Clip skip": "2", + "resources": [ + { + "hash": "d124fc18f0", + "name": "AOM3", + "type": "model" + } + ], + "Model hash": "d124fc18f0", + "negativePrompt": "(worst quality, low quality:1.4)," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7791ac3f-6696-448a-90f9-756eea3e2d5b/width=450/668026.jpeg", + "nsfw": "X", + "width": 512, + "height": 768, + "hash": "UaJaWSt7~pxuyDj[SzofD%ayIAWB9ZWBi{WB", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 736461940, + "Model": "AOM3", + "steps": 50, + "hashes": { + "model": "d124fc18f0" + }, + "prompt": "implied sex, see-through silhouette, pov, see-through, sundress, bedroom, red dress,\n[mature female, medium breasts:0.2]\n", + "sampler": "Euler a", + "cfgScale": 5, + "Clip skip": "2", + "resources": [ + { + "hash": "d124fc18f0", + "name": "AOM3", + "type": "model" + } + ], + "Model hash": "d124fc18f0", + "negativePrompt": "(worst quality, low quality:1.4)," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c8342aa2-3bbb-4d3b-8fe3-651a8f4f8018/width=450/668025.jpeg", + "nsfw": "X", + "width": 512, + "height": 768, + "hash": "UgK^:5WA_MtR%#WAkVofNFaxITazx]WUt5j]", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 925293065, + "Model": "AOM3", + "steps": 50, + "hashes": { + "model": "d124fc18f0" + }, + "prompt": "implied sex, see-through silhouette, pov, see-through, sundress, bedroom, red dress, squatting,\n[mature female, medium breasts:0.2]\n", + "sampler": "Euler a", + "cfgScale": 5, + "Clip skip": "2", + "resources": [ + { + "hash": "d124fc18f0", + "name": "AOM3", + "type": "model" + } + ], + "Model hash": "d124fc18f0", + "negativePrompt": "(worst quality, low quality:1.4)," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7033d82d-e089-481f-b7d2-6df744fedec7/width=450/668031.jpeg", + "nsfw": "X", + "width": 512, + "height": 768, + "hash": "UHK-5:01NFt8.9D%?bt8nOIU~Vt70LRj9Zof", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3934949327, + "Model": "AOM3", + "steps": 50, + "hashes": { + "model": "d124fc18f0" + }, + "prompt": "implied sex, see-through silhouette, pov, see-through, bedroom, white shirt, oversized clothes, oversized shirt, t-shirt, on back, missionary, \n[mature female, medium breasts:0.2]\n", + "sampler": "Euler a", + "cfgScale": 5, + "Clip skip": "2", + "resources": [ + { + "hash": "d124fc18f0", + "name": "AOM3", + "type": "model" + } + ], + "Model hash": "d124fc18f0", + "negativePrompt": "(worst quality, low quality:1.4), covered nipples," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/14ef7d8c-0f74-4e12-99bd-b624123c094e/width=450/668030.jpeg", + "nsfw": "X", + "width": 512, + "height": 768, + "hash": "UBLzaK00oux]uP4ntRWY00-o^*n+tmD*NFxu", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3070455273, + "Model": "AOM3", + "steps": 50, + "hashes": { + "model": "d124fc18f0" + }, + "prompt": "implied sex, see-through silhouette, pov, see-through, bedroom, white shirt, oversized clothes, oversized shirt, t-shirt, on back, missionary, \n[mature female, medium breasts:0.2]\n", + "sampler": "Euler a", + "cfgScale": 5, + "Clip skip": "2", + "resources": [ + { + "hash": "d124fc18f0", + "name": "AOM3", + "type": "model" + } + ], + "Model hash": "d124fc18f0", + "negativePrompt": "(worst quality, low quality:1.4), covered nipples," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3624f98b-053a-4a7e-a709-963908a2e671/width=450/668032.jpeg", + "nsfw": "X", + "width": 512, + "height": 768, + "hash": "ULJtezxt9FxuTet6IoofIUj[%MWV~qIo-pfk", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1744585304, + "Model": "AOM3", + "steps": 50, + "hashes": { + "model": "d124fc18f0" + }, + "prompt": "implied sex, see-through silhouette, pov, see-through, bedroom, white shirt, oversized clothes, oversized shirt, t-shirt, on back, missionary, spread legs m legs,\n[mature female, medium breasts:0.2]\n", + "sampler": "Euler a", + "cfgScale": 5, + "Clip skip": "2", + "resources": [ + { + "hash": "d124fc18f0", + "name": "AOM3", + "type": "model" + } + ], + "Model hash": "d124fc18f0", + "negativePrompt": "(worst quality, low quality:1.4), covered nipples," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9af4337c-a691-45c5-8c0a-7d75c3de15ca/width=450/668029.jpeg", + "nsfw": "X", + "width": 512, + "height": 768, + "hash": "U8JHUC018^4.0f0M~oD*00$y_4-;E2-m0L?b", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 4226398279, + "Model": "AOM3", + "steps": 50, + "hashes": { + "model": "d124fc18f0" + }, + "prompt": "implied sex, see-through silhouette, pov, see-through, bedroom, white shirt, oversized clothes, sex from behind, doggystyle, \n[mature female, medium breasts:0.2]\n", + "sampler": "Euler a", + "cfgScale": 5, + "Clip skip": "2", + "resources": [ + { + "hash": "d124fc18f0", + "name": "AOM3", + "type": "model" + } + ], + "Model hash": "d124fc18f0", + "negativePrompt": "(worst quality, low quality:1.4), covered nipples," + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/60953" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/concept-implied_sex-see-through_silhouette-v1.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/concept-implied_sex-see-through_silhouette-v1.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..ce573a4311090685de386d2b54c7afcda10833f4 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/concept-implied_sex-see-through_silhouette-v1.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/concept-implied_sex-see-through_silhouette-v1.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/concept-implied_sex-see-through_silhouette-v1.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..adafe78e463fabb08b77ff51aac6c0847ab34cc5 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/concept-implied_sex-see-through_silhouette-v1.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:ae9b6d6e232e6fd1d5d8448f6ec028db29549a8bfbed146aeaeef17a7e48d9e2 +size 151152528 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/conceptBreastGrabOver_v11.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/conceptBreastGrabOver_v11.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..c62f362468e9f28c1c9cccb259c3856419b65bdb --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/conceptBreastGrabOver_v11.civitai.info" @@ -0,0 +1,130 @@ +{ + "id": 50717, + "modelId": 45440, + "name": "v1.1", + "createdAt": "2023-04-20T13:03:25.132Z", + "updatedAt": "2023-04-20T13:53:45.354Z", + "trainedWords": [ + "breast grab" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

\u5bf9\u6cdb\u7528\u6027\u505a\u51fa\u4e86\u4e00\u70b9\u6539\u5584\uff0c\u6bd4\u5982\u5bf9\u201ckiss\u201d\u3001\u201cfingering\u201d\u7684\u8868\u73b0\u3002\u4ee3\u4ef7\u662f\u753b\u98ce\u7a0d\u5fae\u8fc7\u62df\u5408\u3002\u4f46\u662f\u53ef\u4ee5\u7528hiresfix\u6765\u6d88\u9664\u5b83\u3002\u5982\u679c\u4f60\u5bf9\u753b\u98ce\u8fc7\u62df\u5408\u654f\u611f\uff0c\u5b8c\u5168\u53ef\u4ee5\u4e0d\u9700\u8981\u66f4\u65b0\u3002

A little improvement has been made to generality, such as the performance of \"kiss\" and \"fingering\". The price is that the style of painting is slightly overfitting. But it can be eliminated with hiresfix.If you are sensitive to overfitting of the painting style, you don't need to update it at all.

", + "stats": { + "downloadCount": 85, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "concept Breast grab over shoulder", + "type": "LoCon", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "conceptBreastGrabOver_v11.safetensors", + "id": 37143, + "sizeKB": 25432.7978515625, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-20T13:05:49.357Z", + "hashes": { + "AutoV1": "208A57F4", + "AutoV2": "B6335F4F5E", + "SHA256": "B6335F4F5EEB2ADCEC6F505936CAC44A71C10AE50C58FA7EB87BB8CB32F06DFB", + "CRC32": "FA20ADB2", + "BLAKE3": "14E02A557FF89D9D521E4CD52C45E8F7D42304E26E7EF763F33BEC04A83BBE7C" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/50717" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b50cd760-c795-4e61-bd18-2cbee4ed2c00/width=450/545652.jpeg", + "nsfw": true, + "width": 920, + "height": 1328, + "hash": "UXJ7p}~VE1E101xt%LxaWBD*n%jsE1RkIpof", + "meta": { + "ENSD": "31337", + "Size": "576x832", + "seed": 2087837057, + "steps": 20, + "hashes": { + "vae": "c6a580b13a", + "model": "e911995387" + }, + "prompt": "breast grab, 1girl, 1boy,muscular, topless male, large breasts,completely nude, nipples,thighs,spread pussy,pussy juice,heavy breathing, steam,sweat, open mouth, tongue out,naughty face,grin,white hair,tied hair,sitting", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "a683c4ae9d02", + "name": "000014", + "type": "lora", + "weight": null + } + ], + "Model hash": "e911995387", + "Hires upscale": "1.6", + "AddNet Enabled": "True", + "AddNet Model 1": "breast grab NTR4-000014(a683c4ae9d02)", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality:1.4), (low quality:1.4), (normal quality:1.4), lowres", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.3" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/03c26c8e-13df-484b-1831-1169915a3a00/width=450/545891.jpeg", + "nsfw": true, + "width": 976, + "height": 1408, + "hash": "UHJj-z4m0K~W00Ri-;M}0L?HR*kC9FX9IpD*", + "meta": { + "ENSD": "31337", + "Size": "976x1408", + "seed": 627675039, + "steps": 20, + "hashes": { + "vae": "c6a580b13a", + "model": "e911995387" + }, + "prompt": "breast grab, 1girl, 1boy,muscular, topless male, large breasts,completely nude, nipples,thighs,spread pussy,pussy juice,heavy breathing, steam,sweat, open mouth, tongue out,naughty face,grin,white hair,tied hair,sitting,(kiss,french kiss:1.2), masterpiece,1girl,cute", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "Mask blur": "4", + "resources": [ + { + "hash": "a683c4ae9d02", + "name": "000014", + "type": "lora", + "weight": null + } + ], + "Model hash": "e911995387", + "AddNet Enabled": "True", + "AddNet Model 1": "breast grab NTR4-000014(a683c4ae9d02)", + "negativePrompt": "(worst quality:1.4), (low quality:1.4), (normal quality:1.4), lowres, (worst quality:1.4), (low quality:1.4), (normal quality:1.4), lowres", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.7" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/50717" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/conceptBreastGrabOver_v11.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/conceptBreastGrabOver_v11.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..6fc4f0e85e8c40fa473ffe6d3c88db9f0cc7f709 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/conceptBreastGrabOver_v11.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/conceptBreastGrabOver_v11.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/conceptBreastGrabOver_v11.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..32bbd03f870fb38bbceb10d7d09a05d4d389906f --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/conceptBreastGrabOver_v11.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:b6335f4f5eeb2adcec6f505936cac44a71c10ae50c58fa7eb87bb8cb32f06dfb +size 26043185 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/conceptCondomOnPenis_v01.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/conceptCondomOnPenis_v01.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..f2c2e15092b1bee6a80cb4adf9d118217879daee --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/conceptCondomOnPenis_v01.civitai.info" @@ -0,0 +1,109 @@ +{ + "id": 24326, + "modelId": 20459, + "name": "v0.1", + "createdAt": "2023-03-16T20:59:06.705Z", + "updatedAt": "2023-03-18T10:12:59.952Z", + "trainedWords": [ + "condom on penis" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 1447, + "ratingCount": 1, + "rating": 5 + }, + "model": { + "name": "concept Condom on penis", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "conceptCondomOnPenis_v01.safetensors", + "id": 20184, + "sizeKB": 18586.36328125, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-03-16T21:00:50.511Z", + "hashes": { + "AutoV1": "C6B5A063", + "AutoV2": "438875A459", + "SHA256": "438875A4599830D771D4A76A7F4FC173469733EECF0C7858478F3CEFDD9449A1", + "CRC32": "80AFAAFC", + "BLAKE3": "27BDE10033EE7FCD2019E3ABC73E874F20D70815BA585E71FC86B54292A7F4C8" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/24326" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3a9138ed-8313-4e5c-0d21-6940fcabea00/width=450/264574.jpeg", + "nsfw": true, + "width": 768, + "height": 960, + "hash": "UMIE9NEM9Z?HWAEL9GxZ$MM|9ZRj~VW=?Gs:", + "meta": { + "steps": 20, + "prompt": "masterpiece,1girl,1boy, penis ,condom on penis, imminent penetration, lying, on back, spread legs", + "sampler": "Euler a", + "cfgScale": 7, + "negativePrompt": "(worst quality:1.4), (low quality:1.4), (normal quality:1.4), lowres" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a13c153e-6df4-4f4f-ffcc-e9d3f4a84200/width=450/264577.jpeg", + "nsfw": true, + "width": 768, + "height": 960, + "hash": "UOH_fJyED$ax~W^+9aa$xr-oV@M{xu-pxaNG", + "meta": { + "steps": 20, + "prompt": "masterpiece,1girl,1boy, penis ,condom on penis, vacuum fellatio", + "sampler": "Euler a", + "cfgScale": 7, + "negativePrompt": "(worst quality:1.4), (low quality:1.4), (normal quality:1.4), lowres" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/590faad1-397d-40f2-02c3-6acefd300700/width=450/264576.jpeg", + "nsfw": true, + "width": 768, + "height": 960, + "hash": "UfI}I%~WNcWB9uR+WBRjD%IoRiR*-pj]M{ay", + "meta": { + "steps": 20, + "prompt": "masterpiece,1girl,1boy, penis ,condom on penis, ,doggystyle, pov", + "sampler": "Euler a", + "cfgScale": 7, + "negativePrompt": "(worst quality:1.4), (low quality:1.4), (normal quality:1.4), lowres" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d230e7da-f1d4-4709-271f-95c0954f0400/width=450/264575.jpeg", + "nsfw": true, + "width": 768, + "height": 960, + "hash": "UEH-=K_300b^Ip%2Vss:00Mx9E4n~W9ZIp%L", + "meta": { + "steps": 20, + "prompt": "masterpiece,1girl,1boy, penis ,condom on penis, suspended congress, vaginal, anal, ass ,ass focus, ass grab, standing, hug, leg lock, breast press,straddling,arms around neck, lifting person", + "sampler": "Euler a", + "cfgScale": 7, + "negativePrompt": "(worst quality:1.4), (low quality:1.4), (normal quality:1.4), lowres" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/24326" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/conceptCondomOnPenis_v01.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/conceptCondomOnPenis_v01.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..e4a11068f351c4243c730fb5dd3d4c4326253f3d Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/conceptCondomOnPenis_v01.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/conceptCondomOnPenis_v01.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/conceptCondomOnPenis_v01.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..896caf205f7b8409eec9900ea9f97f7fa84d610b --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/conceptCondomOnPenis_v01.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:438875a4599830d771d4a76a7f4fc173469733eecf0c7858478f3cefdd9449a1 +size 19032436 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/conceptCowgirl_v10.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/conceptCowgirl_v10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..38619d3b135cfd2aff1a8844fbc9f59a89104260 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/conceptCowgirl_v10.civitai.info" @@ -0,0 +1,127 @@ +{ + "id": 9738, + "modelId": 8251, + "name": "v1.0", + "createdAt": "2023-02-12T13:20:00.190Z", + "updatedAt": "2023-02-12T13:20:51.424Z", + "trainedWords": [ + "sex", + "cowgirl" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "model": { + "name": "concept-cowgirl", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "conceptCowgirl_v10_trainingData.zip", + "id": 9404, + "sizeKB": 16323.7412109375, + "type": "Training Data", + "metadata": { + "format": "Other" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-02-12T13:21:14.424Z", + "hashes": { + "AutoV1": "772966D5", + "AutoV2": "B5445AB1CD", + "SHA256": "B5445AB1CD5076B5AFEF9BC2E5F2E14501508A2A04FB9679764C95C193D63514", + "CRC32": "23162371", + "BLAKE3": "58933A756049C9688145BF4AE59925E6DDC2C541A48537E7FEB99C0A4D77C53F" + }, + "primary": false, + "downloadUrl": "https://civitai.com/api/download/models/9738?type=Training%20Data" + }, + { + "name": "conceptCowgirl_v10.safetensors", + "id": 9403, + "sizeKB": 36975.125, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-02-12T13:21:15.574Z", + "hashes": { + "AutoV1": "EACE1CB1", + "AutoV2": "0C276A0D2F", + "SHA256": "0C276A0D2FAD45D936013BDF678D86A5819BDEC88491851F78DF2EA1FFB98A48", + "CRC32": "EB4360BD", + "BLAKE3": "A0E976BCA87FD5148EC1E1B822B23F584EC6D01CD2A1F6F6A7002CF18DF74C41" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/9738" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/dee25a30-d438-47dc-5ed0-0b5bb7c87700/width=450/94307.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UFI|]^_200V@00NGM{WB0KV[~WtQoJofWVWB", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/46bcc0b8-ee64-4f4c-7af8-f9ab23dcfd00/width=450/94313.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UFJ@Ug4o56%M56xu%2Rj4noL~VM{Iot7WAxu", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/05ffb429-70f4-4ca7-8ad4-7196f0808900/width=450/94312.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UHLM@g~VJQD%0eE1WVR+01%Mxuxu9FjtE1WB", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3e78a9da-44fc-432d-c3d3-f3c0ab7a4800/width=450/94311.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UNLzKy~p4:M{t,bIM_RjE2oKxZt7R-WBIoWB", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/255348d8-d285-45ae-d121-74d8688cf300/width=450/94310.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UBK,?O005,~W00E2xuIA00RO~CIUE1-p01x^", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ed43e67e-d9c9-4c0e-c041-f1d20f1fc600/width=450/94309.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UCLpw0001Qs9P;Di5SM{00tmVXtR#5x^i^%2", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/08418e93-c1a2-48e3-0c50-ed8cd0c11900/width=450/94308.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "U9J%:{~WO,D%1iR+E0I.00xW^k%f-UWBkUf+", + "meta": null + } + ], + "downloadUrl": "https://civitai.com/api/download/models/9738" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/conceptCowgirl_v10.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/conceptCowgirl_v10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..84ca4eb7eaf694271b4cd83abfa127fed2339e56 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/conceptCowgirl_v10.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/conceptCowgirl_v10.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/conceptCowgirl_v10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..50d0994d4b3fbe231245b0db53d12b454aaca686 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/conceptCowgirl_v10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:0c276a0d2fad45d936013bdf678d86a5819bdec88491851f78df2ea1ffb98a48 +size 37862528 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/conceptDouble_v10.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/conceptDouble_v10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..8a407a4b3efb7c58e9b7d9c927f68bb3ad68f4cb --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\212\250\344\275\234\345\274\225\345\257\274/conceptDouble_v10.civitai.info" @@ -0,0 +1,201 @@ +{ + "id": 49111, + "modelId": 44491, + "name": "v1.0", + "createdAt": "2023-04-18T15:53:30.976Z", + "updatedAt": "2023-04-18T16:13:16.084Z", + "trainedWords": [ + "double penetration" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 758, + "ratingCount": 3, + "rating": 4.67 + }, + "model": { + "name": "concept Double penetration(all fours)", + "type": "LoCon", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "conceptDouble_v10.safetensors", + "id": 36182, + "sizeKB": 46449.0615234375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-18T16:05:55.461Z", + "hashes": { + "AutoV1": "F9B82B14", + "AutoV2": "F6487C474D", + "SHA256": "F6487C474D6117467A561A7C2903FECD20A57DA195B5FA8ECA882EC7EF45C97A", + "CRC32": "3981C2F1", + "BLAKE3": "4855C25082A03E7DDB6DE032A3615A6E7DE424F18EBE6A61B5785FCA8B035814" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/49111" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2591fcd9-b499-477a-04d2-215738668100/width=450/527770.jpeg", + "nsfw": true, + "width": 1440, + "height": 960, + "hash": "UNFh@#tSE1%2_N%MsARjE1xuxZ9ZRPkDbEM_", + "meta": { + "ENSD": "31337", + "Size": "960x640", + "seed": 4267073183, + "steps": 20, + "prompt": "double penetration, 2boys,anal,vaginal,all fours,from side, completely nude, ass,penis,testicles, from side, mmf threesome, straddling,, masterpiece,1girl,cute", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "d65bc23a0578", + "name": "000011", + "type": "lora", + "weight": null + } + ], + "Model hash": "e911995387", + "Hires upscale": "1.5", + "AddNet Enabled": "True", + "AddNet Model 1": "double penetration6 re3-000011(d65bc23a0578)", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality:1.4), (low quality:1.4), (normal quality:1.4), lowres", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.4" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6dc66d53-7d27-4dae-6af1-09dfc342fe00/width=450/527765.jpeg", + "nsfw": false, + "width": 1440, + "height": 960, + "hash": "U8HK|i0g00-of~9ZD*g20K~W.8IBDhImM{$h", + "meta": { + "ENSD": "31337", + "Size": "960x640", + "seed": 4267073182, + "steps": 20, + "prompt": "double penetration, 2boys,anal,vaginal,all fours,from side, completely nude, ass,penis,testicles, from side, mmf threesome, straddling,, masterpiece,1girl,cute", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "d65bc23a0578", + "name": "000011", + "type": "lora", + "weight": null + } + ], + "Model hash": "e911995387", + "Hires upscale": "1.5", + "AddNet Enabled": "True", + "AddNet Model 1": "double penetration6 re3-000011(d65bc23a0578)", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality:1.4), (low quality:1.4), (normal quality:1.4), lowres", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.4" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5e657dea-38ec-4e04-b794-6c8e72c0f100/width=450/527808.jpeg", + "nsfw": true, + "width": 1440, + "height": 960, + "hash": "UCI|:x~p009a9Z019G?G0f^*~Vxu4ot6%fD*", + "meta": { + "ENSD": "31337", + "Size": "960x640", + "seed": 2093439002, + "steps": 20, + "hashes": { + "vae": "c6a580b13a", + "model": "e911995387" + }, + "prompt": "double penetration, 2boys,anal,vaginal,all fours,from side, completely nude, ass,penis,testicles, from side, mmf threesome, straddling,, masterpiece,1girl\nmating press, boy on top", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "d65bc23a0578", + "name": "000011", + "type": "lora", + "weight": null + } + ], + "Model hash": "e911995387", + "Hires upscale": "1.5", + "AddNet Enabled": "True", + "AddNet Model 1": "double penetration6 re3-000011(d65bc23a0578)", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality:1.4), (low quality:1.4), (normal quality:1.4), lowres", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.4" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f40e68d6-4ec6-4696-d7b3-14b27e7a9000/width=450/527810.jpeg", + "nsfw": true, + "width": 1440, + "height": 960, + "hash": "UOG+5n?wD*%N_4V@Dhs:4.M{MxM{aJxv%Mjs", + "meta": { + "ENSD": "31337", + "Size": "960x640", + "seed": 2093438997, + "steps": 20, + "hashes": { + "vae": "c6a580b13a", + "model": "e911995387" + }, + "prompt": "double penetration, 2boys,anal,vaginal,all fours,from side, completely nude, ass,penis,testicles, from side, mmf threesome, straddling,, masterpiece,1girl\nmating press, boy on top", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "d65bc23a0578", + "name": "000011", + "type": "lora", + "weight": null + } + ], + "Model hash": "e911995387", + "Hires upscale": "1.5", + "AddNet Enabled": "True", + "AddNet Model 1": "double penetration6 re3-000011(d65bc23a0578)", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality:1.4), (low quality:1.4), (normal quality:1.4), lowres", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.4" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/49111" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/BDSM.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/BDSM.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..a5034fbbba871b913e8bfb225fa77d3cbd463d49 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/BDSM.civitai.info" @@ -0,0 +1,248 @@ +{ + "id": 103056, + "modelId": 96478, + "name": "v1.0", + "createdAt": "2023-06-24T16:08:07.340Z", + "updatedAt": "2023-06-24T16:58:00.566Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 236, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "\u7ef3\u827a\u9f9f\u7532\u7f1aSM\u675f\u7f1a", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "BDSM.safetensors", + "id": 72316, + "sizeKB": 147571.4267578125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-24T17:01:24.051Z", + "hashes": { + "AutoV1": "37BC8F19", + "AutoV2": "6089308464", + "SHA256": "60893084640EFDC8018DBE3B485CEEBCB5921ACBBD62718454A3418B777A4973", + "CRC32": "E3426252", + "BLAKE3": "61C95843F2A510BE1CDFB51F6EDEB35328B978ABEDD6F98EB53003D7138A52A1" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/103056" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/43d5428a-954c-4e1e-9b32-7b40f48e4bc6/width=450/1273764.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1640, + "hash": "UGF=H+~V000e009Z%N%M4.oL?HxuEQWXemNF", + "meta": { + "Size": "512x820", + "seed": 458446118, + "\"BDSM": "ef679da2b63a\"", + "Model": "awportrait_v10", + "steps": 25, + "hashes": { + "model": "72d764a66c" + }, + "prompt": "(arms behind back:1),(masterpiece,best quality),HDR,high-definition,[[Intricate Details]],cinematic,photorealistic,1girl,nsfw,curvy,thigh gap,cameltoe,(sexy pose:1.2),young,pale skin,multicolored long hair,makeup,round glasses,white lace bodysuit pantyhose,transparent multicolored balloons background,all in pastel pink,(Lisa Frank:1.1),,Blush,,", + "Version": "v1.3.2", + "sampler": "DPM++ 2M SDE Karras", + "CFG mode": "Half Cosine Up", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "BDSM", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "72d764a66c", + "name": "awportrait_v10", + "type": "model" + } + ], + "Model hash": "72d764a66c", + "Mimic scale": "7", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "cartoon,sketches,(worst quality, low quality:1.3),((monochrome)),((grayscale)),plump,", + "CFG scale minimum": "3.5", + "Denoising strength": "0.53", + "Threshold percentile": "100", + "Dynamic thresholding enabled": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f07ca23a-5ec6-45c8-97d1-3f4b1a280465/width=450/1273765.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1640, + "hash": "UKIN]lxvENRk_NRkxuRjo~W;xtoz9GM{s:WV", + "meta": { + "Size": "512x820", + "seed": 2808103504, + "Model": "awportrait_v10", + "steps": 25, + "hashes": { + "model": "72d764a66c" + }, + "prompt": ",1girl,solo,tongue out,ice cream,long hair,tongue,pink hair,eyewear on head,jewelry,earrings,multicolored hair,frills,food,jacket,bangs,blue eyes,off shoulder,long sleeves,looking at viewer,arm up,nail polish,upper body,sunglasses,swimsuit,blue nails,frilled bikini,bare shoulders,white jacket,bikini,black bikini,open clothes,open jacket,multicolored eyes,streaked hair,:p,two-tone hair,purple eyes,signature,shell,cup,two side up,blue hair,collarbone,starfish,aqua hair,blurry,table,parfait,closed mouth,sundae,blush,aqua nails,character name,ice cream cone,seashell,palm tree,green hair,glass,multicolored nails,facial mark,star \\(symbol\\),artist name,hand up,fruit,spoon,sleeves past wrists,", + "Version": "v1.3.2", + "sampler": "DPM++ 2M SDE Karras", + "CFG mode": "Half Cosine Up", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "72d764a66c", + "name": "awportrait_v10", + "type": "model" + } + ], + "Model hash": "72d764a66c", + "\"KB3-000012": "ef679da2b63a\"", + "Mimic scale": "7", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "cartoon,sketches,(worst quality, low quality:1.3),((monochrome)),((grayscale)),plump,", + "CFG scale minimum": "3.5", + "Denoising strength": "0.53", + "Threshold percentile": "100", + "Dynamic thresholding enabled": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b884ef32-9d1f-4073-86c7-164207ff0c79/width=450/1273772.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1640, + "hash": "UEHK^X9t00xu{bT09zslI9x]R-WCD%%2?Gen", + "meta": { + "Size": "512x820", + "seed": 1407724719, + "Model": "3Guofeng3_v33", + "steps": 25, + "hashes": { + "model": "4078eb4174" + }, + "prompt": ",(Realistic), (Highres), 4K, 8K, Detailed Illustration, Ultra-Detailed, Ambient Light, Backlighting, Realistic Shadows, Glowing Particles, Light Particles, Digital Art, Detailed Face, Detailed Hair, (Hyper-Detailed Eyes:1.2), Soft Light, Soft Lighting, (Outdoors:1.15), Renaissance, Renaissance Architecture, Hyper Detailed Architecture, Vintage Windows, Red Curtains, (Throne:1.4), (Sitting on Throne:1.2), Front, Frontal, Huge Throne, Ornate Throne, Royal Throne, Massive Throne, (Blonde Hair:1.15), Bangs, Shiny Hair, short braids, Blue Eyes, Closed Mouth, Dignified Expression, Emotionless, Calm, Confident (Solo:1.4), Mature Female, Sexy Elf Woman, Full Body, Toned Thighs, Narrow Waist, Round Hips, (Huge Perky Breasts:1.1), Crossed Legs, (Crossed Arms:1.1) (Elegant Blue Dress:1.1), Ornate Clothes, Ornate Dress, (Blue Off-Shoulder Dress:1.1), Bare Shoulders, Skindentation, (Blue Dress:1.1), (White Puffy Sleeves, Long Sleeves, Juliet Sleeves:1.1), Long Sexy Dress, cleavage, covered nipples, (Ballroom Gown:1.3), (Frilled Dress:1.3), (Jewelry:1.15), Collar, Gorget, Gold-Trim, Regalia, Knight", + "Version": "v1.3.2", + "sampler": "DPM++ 2M SDE Karras", + "CFG mode": "Half Cosine Up", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "4078eb4174", + "name": "3Guofeng3_v33", + "type": "model" + } + ], + "Model hash": "4078eb4174", + "\"KB3-000012": "ef679da2b63a\"", + "Mimic scale": "7", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "cartoon,sketches,(worst quality, low quality:1.3),((monochrome)),((grayscale)),plump,", + "CFG scale minimum": "3.5", + "Denoising strength": "0.53", + "Threshold percentile": "100", + "Dynamic thresholding enabled": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/31069a40-0e62-43b5-818c-099edbcb9cc2/width=450/1273769.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1640, + "hash": "UNLps]_NE1-:?H?v9axaxW-:?IIUt8W=E1WB", + "meta": { + "Size": "512x820", + "seed": 3497278037, + "Model": "meinapastel_V4", + "steps": 25, + "hashes": { + "model": "771c8fd970" + }, + "prompt": ",1girl, (solo:1.2), (cowboy shot:1.2), (Beautiful and detailed eyes description), (Beautiful and detailed face), Perfect female body, neat figure, slender waist, (young girl), (20 years old), long hair, platinum blonde hair, very big eyes, blue eyes, medium breasts, blush, shy, watery lips, nurse, (transparent nurse dress), nurse cap, unbuttoned, (white gloves:1.2), (white pantyhose), high heels, necklace, earrings, indoors, school nurse, hospital bed, window, white curtains, sunlight, squatting, (best quality), (ultra detailed), (masterpiece), (highres), (original), (extremely detailed CG unity 8K wallpaper), character design, game cg, detailed manga illustration", + "Version": "v1.3.2", + "sampler": "DPM++ 2M SDE Karras", + "CFG mode": "Half Cosine Up", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "771c8fd970", + "name": "meinapastel_V4", + "type": "model" + } + ], + "Model hash": "771c8fd970", + "\"KB3-000012": "ef679da2b63a\"", + "Mimic scale": "7", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "cartoon,sketches,(worst quality, low quality:1.3),((monochrome)),((grayscale)),plump,", + "CFG scale minimum": "3.5", + "Denoising strength": "0.53", + "Threshold percentile": "100", + "Dynamic thresholding enabled": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e6c47294-c2ef-4dcd-94d1-b576355bc4d2/width=450/1273770.jpeg", + "nsfw": "X", + "width": 512, + "height": 816, + "hash": "UJJtn}?wt-~qV;obxuRj0gRi$KM{K6t7-pay", + "meta": { + "Size": "512x820", + "seed": 885091152, + "Model": "moonfilm_filmGrain10", + "steps": 25, + "hashes": { + "model": "88ea5a84a3" + }, + "prompt": ",1girl,solo,bound,BDSM,blinder,patch,arms behind back,", + "Version": "v1.3.2", + "sampler": "DPM++ 2M SDE Karras", + "CFG mode": "Half Cosine Up", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "88ea5a84a3", + "name": "moonfilm_filmGrain10", + "type": "model" + } + ], + "Model hash": "88ea5a84a3", + "\"KB3-000012": "ef679da2b63a\"", + "Mimic scale": "7", + "negativePrompt": "cartoon,sketches,(worst quality, low quality:1.3),((monochrome)),((grayscale)),plump,", + "CFG scale minimum": "3.5", + "Threshold percentile": "100", + "Dynamic thresholding enabled": "True" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/103056" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/BDSM.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/BDSM.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..f22db1a985376ab98a63a0fb26e5388ed8ac9535 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/BDSM.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/BDSM.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/BDSM.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..19ea970cdebf2af00f4672afd81b13191c8d1b15 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/BDSM.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:60893084640efdc8018dbe3b485ceebcb5921acbbd62718454a3418b777a4973 +size 151113141 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/BDSMArmbinders.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/BDSMArmbinders.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..45820b9b5fe347d71afbad0990294f323a7b5669 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/BDSMArmbinders.civitai.info" @@ -0,0 +1,218 @@ +{ + "id": 59233, + "modelId": 54851, + "name": "v1.0", + "createdAt": "2023-04-30T21:58:41.617Z", + "updatedAt": "2023-04-30T22:03:03.077Z", + "trainedWords": [ + "armbinders", + "tied", + "bound" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 130, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "BDSMArmbinders - Female version", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "BDSMArmbinders.safetensors", + "id": 42048, + "sizeKB": 124529.095703125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-30T22:00:52.221Z", + "hashes": { + "AutoV1": "0E39AB8E", + "AutoV2": "B3A3D9BB68", + "SHA256": "B3A3D9BB683957E7373F1017ADE84D8AD5254EDA8A154E54500BCAF0D7CAEDB1", + "CRC32": "6C384975", + "BLAKE3": "3951C1D32895C93BC816DF5EAA7F8825008AA4AB6A8248A4CAD6E3A02AFC7247" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/59233" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/95aea64e-58ed-40f3-278f-0d35a37fd700/width=450/646147.jpeg", + "nsfw": "X", + "width": 1280, + "height": 1456, + "hash": "UAHT{k?F00$l?Z-osDIo0K%L-;Io~qV@4ox]", + "meta": { + "Size": "640x728", + "seed": 4234363982, + "Model": "Lunar Diffusion 1.27", + "steps": 20, + "hashes": { + "model": "5264e2f482" + }, + "prompt": "beautiful woman in armbinders with glowing pink eyes and huge tits, photorealism, bound, tired ", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "ZArmbinders", + "type": "lora", + "weight": 0.65 + }, + { + "name": "Venabaris", + "type": "lora", + "weight": 0.4 + }, + { + "hash": "5264e2f482", + "name": "Lunar Diffusion 1.27", + "type": "model" + } + ], + "Model hash": "5264e2f482", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "bad quality, kid, deformed, ugly, cartoon", + "Denoising strength": "0.17" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3e619461-a0c8-4395-8e5e-865b47602500/width=450/646151.jpeg", + "nsfw": "Soft", + "width": 1280, + "height": 1456, + "hash": "UIGa|9={oI~V~WIUM{-pIp9GD*kDR+IVV[t7", + "meta": { + "Size": "640x728", + "seed": 1722149866, + "Model": "Lunar Diffusion 1.27", + "steps": 20, + "hashes": { + "model": "5264e2f482" + }, + "prompt": "beautiful darkskin woman in armbinders with glowing pink eyes, photorealism, bound, tired ", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "ZArmbinders", + "type": "lora", + "weight": 0.8 + }, + { + "name": "Itzayan", + "type": "lora", + "weight": 0.4 + }, + { + "hash": "5264e2f482", + "name": "Lunar Diffusion 1.27", + "type": "model" + } + ], + "Model hash": "5264e2f482", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "bad quality, kid, deformed, ugly, cartoon", + "Denoising strength": "0.17" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9b303a0d-af63-4ef6-d59d-0def249c2f00/width=450/646156.jpeg", + "nsfw": "X", + "width": 1280, + "height": 1456, + "hash": "U9F528000K-=I:R*xaI:00-p~WMx?aIUIUx]", + "meta": { + "Size": "640x728", + "seed": 471728127, + "Model": "Lunar Diffusion 1.27", + "steps": 20, + "hashes": { + "model": "5264e2f482" + }, + "prompt": "beautiful woman in armbinders with glowing pink eyes and huge tits, photorealism, bound, tired ", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "ZArmbinders", + "type": "lora", + "weight": 0.65 + }, + { + "name": "Venabaris", + "type": "lora", + "weight": 0.5 + }, + { + "hash": "5264e2f482", + "name": "Lunar Diffusion 1.27", + "type": "model" + } + ], + "Model hash": "5264e2f482", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "bad quality, kid, deformed, ugly, cartoon", + "Denoising strength": "0.17" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a432ed54-0a57-45c3-7781-92bb11edc700/width=450/646164.jpeg", + "nsfw": "X", + "width": 1280, + "height": 1456, + "hash": "UAE2Xy~V0LD*t7-pWB4:M|s.WCNGf,ogRjRi", + "meta": { + "Size": "640x728", + "seed": 3485818361, + "Model": "Lunar Diffusion 1.27", + "steps": 20, + "hashes": { + "model": "5264e2f482" + }, + "prompt": "beautiful asian woman in armbinders, photorealism, bound, tired ", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "ZArmbinders", + "type": "lora", + "weight": 1 + }, + { + "hash": "5264e2f482", + "name": "Lunar Diffusion 1.27", + "type": "model" + } + ], + "Model hash": "5264e2f482", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "bad quality, kid, deformed, ugly, cartoon", + "Denoising strength": "0.17" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/59233" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/BDSMArmbinders.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/BDSMArmbinders.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..1560ce7afcc8c647d7984cbb06f93d3f5084beac --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/BDSMArmbinders.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:702cb08453325826cf8e92ceb1d291fbcb283b16f9149bc6907fc35730d63b45 +size 1894583 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/BDSMArmbinders.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/BDSMArmbinders.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..8d926666099b69b08af4b10de525a506ee1f1e9d --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/BDSMArmbinders.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:b3a3d9bb683957e7373f1017ade84d8ad5254eda8a154e54500bcaf0d7caedb1 +size 127517794 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/BoxComple3-10.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/BoxComple3-10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..0a769433e9fda7ef390e4dc67c01a9ae1d6c3c71 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/BoxComple3-10.civitai.info" @@ -0,0 +1,251 @@ +{ + "id": 66576, + "modelId": 62051, + "name": "Hevy training", + "createdAt": "2023-05-09T20:20:44.017Z", + "updatedAt": "2023-05-09T20:24:21.468Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 162, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Box Hero [Set3] / In Container / Gift / Bdsm / Restrained", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "BoxComple3-10.safetensors", + "id": 46620, + "sizeKB": 18562.4609375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-09T21:11:00.482Z", + "hashes": { + "AutoV1": "DE2F2560", + "AutoV2": "EF0A73F39E", + "SHA256": "EF0A73F39EF264C840D7C9324841C65269529509E9AEF929CBF969A152825CCC", + "CRC32": "9A6E681F", + "BLAKE3": "D781F022B2E5536A58F2F528C07CE01D796B933FD7A34850F66BB13AEFE3B9EC" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/66576" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c9b248ad-f67a-4c99-b29e-1fc95fc7b68f/width=450/739265.jpeg", + "nsfw": "X", + "width": 512, + "height": 1080, + "hash": "UDJtMBjY02Rjnh-oxus-VXof~Ut7~V%2D*xZ", + "meta": { + "ENSD": "31337", + "Size": "512x1080", + "seed": 2049599982, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "cajafasa,gagged,rope,(thick thighs), bulge, (1boy),In a cardboard box, condoms, used condoms, condom packages, semen containers, white lubricant, vibrators,leotard, ,(box full of sex toys)", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "negativePrompt": "EasyNegative, bad-hands-5,((amputee))" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6840c188-271c-46a4-9a13-dafb3393eb38/width=450/739266.jpeg", + "nsfw": "X", + "width": 512, + "height": 1080, + "hash": "UAKJ-~R*00~V-m%1s:V@00RP_2xt=Z%1I:sl", + "meta": { + "ENSD": "31337", + "Size": "512x1080", + "seed": 2049599990, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "cajafasa,gagged,rope,(thick thighs), bulge, (1boy),In a cardboard box, condoms, used condoms, condom packages, semen containers, white lubricant, vibrators,leotard, ,(box full of sex toys)", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "negativePrompt": "EasyNegative, bad-hands-5,((amputee))" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4d6543ab-e766-464e-b56e-21aeac8e5467/width=450/739267.jpeg", + "nsfw": "X", + "width": 720, + "height": 720, + "hash": "UAJ%g_4;0eIUbC%1r]-U00of-p-p}@niozoL", + "meta": { + "ENSD": "31337", + "Size": "720x720", + "seed": 2495343890, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "cajafasa,gagged,rope,(thick thighs), large breasts, (2girls),In a cardboard box, condoms, used condoms, condom packages, semen containers, white lubricant, vibrators,micro bikini, ,(box full of sex toys)", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "negativePrompt": "EasyNegative, bad-hands-5,((amputee))" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/fe404a76-bdfb-48e3-acc7-acda32d9570f/width=450/739268.jpeg", + "nsfw": "X", + "width": 720, + "height": 720, + "hash": "UCI|,l~V%1~A0LRjad?HIpE1%2Rjnht7IpE2", + "meta": { + "ENSD": "31337", + "Size": "720x720", + "seed": 2495343891, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "cajafasa,gagged,rope,(thick thighs), large breasts, (2girls),In a cardboard box, condoms, used condoms, condom packages, semen containers, white lubricant, vibrators,micro bikini, ,(box full of sex toys)", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "negativePrompt": "EasyNegative, bad-hands-5,((amputee))" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/89e305a6-4348-4da9-aa6a-6a117c748401/width=450/739269.jpeg", + "nsfw": "X", + "width": 720, + "height": 720, + "hash": "U4JQWW~CpJx[000L~BRl0002soIVkaRo%KIU", + "meta": { + "ENSD": "31337", + "Size": "720x720", + "seed": 2495343893, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "cajafasa,gagged,rope,(thick thighs), large breasts, (2girls),In a cardboard box, condoms, used condoms, condom packages, semen containers, white lubricant, vibrators,micro bikini, ,(box full of sex toys)", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "negativePrompt": "EasyNegative, bad-hands-5,((amputee))" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7c4921ac-5012-41fb-b44c-19de1131eba9/width=450/739270.jpeg", + "nsfw": "X", + "width": 720, + "height": 720, + "hash": "UQJ%k8-Us8-TRit6xZoy9Zj]juj]~BRkIpRk", + "meta": { + "ENSD": "31337", + "Size": "720x720", + "seed": 2495343894, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "cajafasa,gagged,rope,(thick thighs), large breasts, (2girls),In a cardboard box, condoms, used condoms, condom packages, semen containers, white lubricant, vibrators,micro bikini, ,(box full of sex toys)", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "negativePrompt": "EasyNegative, bad-hands-5,((amputee))" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/346e4f9f-27da-40d3-9070-cb131b6f1e80/width=450/739271.jpeg", + "nsfw": "X", + "width": 720, + "height": 720, + "hash": "UKI;6V%gx]^+=_xZogayVrofbwWB~BR*ELof", + "meta": { + "ENSD": "31337", + "Size": "720x720", + "seed": 2495343895, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "cajafasa,gagged,rope,(thick thighs), large breasts, (2girls),In a cardboard box, condoms, used condoms, condom packages, semen containers, white lubricant, vibrators,micro bikini, ,(box full of sex toys)", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "negativePrompt": "EasyNegative, bad-hands-5,((amputee))" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3612039a-f25b-4929-95d0-e97f30863260/width=450/739272.jpeg", + "nsfw": "X", + "width": 720, + "height": 720, + "hash": "UBH^@c00E1xaJ7?GaJM{-o%1IV%1~pxZM{WV", + "meta": { + "ENSD": "31337", + "Size": "720x720", + "seed": 2495343896, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "cajafasa,gagged,rope,(thick thighs), large breasts, (2girls),In a cardboard box, condoms, used condoms, condom packages, semen containers, white lubricant, vibrators,micro bikini, ,(box full of sex toys)", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "negativePrompt": "EasyNegative, bad-hands-5,((amputee))" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/97f29417-175a-4171-84a2-cfd1a3e3eaa9/width=450/739273.jpeg", + "nsfw": "X", + "width": 720, + "height": 720, + "hash": "U9IW}~I:0K^*%fD*X3sV0057~WIo%gV[basC", + "meta": { + "ENSD": "31337", + "Size": "720x720", + "seed": 2495343897, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "cajafasa,gagged,rope,(thick thighs), large breasts, (2girls),In a cardboard box, condoms, used condoms, condom packages, semen containers, white lubricant, vibrators,micro bikini, ,(box full of sex toys)", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "negativePrompt": "EasyNegative, bad-hands-5,((amputee))" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/392a59ac-83e5-42da-8eb1-60677c50846b/width=450/739274.jpeg", + "nsfw": "X", + "width": 720, + "height": 720, + "hash": "UCJ@RW4:E2xtk=jvWB-o56t7Ioa|~pR*oLIV", + "meta": { + "ENSD": "31337", + "Size": "720x720", + "seed": 2495343898, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "cajafasa,gagged,rope,(thick thighs), large breasts, (2girls),In a cardboard box, condoms, used condoms, condom packages, semen containers, white lubricant, vibrators,micro bikini, ,(box full of sex toys)", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "negativePrompt": "EasyNegative, bad-hands-5,((amputee))" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/66576" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/BoxComple3-10.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/BoxComple3-10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..5a4f3e9362219dfd8fade67ca76ceff4b29ba8cf Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/BoxComple3-10.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/BoxComple3-10.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/BoxComple3-10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..c4feb034f1254437628a659f8da0a1817fb62018 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/BoxComple3-10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:ef0a73f39ef264c840d7c9324841c65269529509e9aef929cbf969a152825ccc +size 19007960 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/BoxNoc-10.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/BoxNoc-10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..d1b06f033abbc68ae06d6c63d44abb2ec71d9309 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/BoxNoc-10.civitai.info" @@ -0,0 +1,251 @@ +{ + "id": 66588, + "modelId": 62062, + "name": "Hevy training", + "createdAt": "2023-05-09T20:32:17.362Z", + "updatedAt": "2023-05-09T20:35:29.326Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 88, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Box Hero [Set4] / In Container / Gift / Bdsm / Restrained", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "BoxNoc-10.safetensors", + "id": 46625, + "sizeKB": 18561.849609375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-09T21:11:39.468Z", + "hashes": { + "AutoV1": "DE2F2560", + "AutoV2": "F3749F31AA", + "SHA256": "F3749F31AA5BDC302323F1E211B38AF77DF98DFE3D75666101B423B4AFBC5CB8", + "CRC32": "A172A705", + "BLAKE3": "0FB19ECFB058239FAE235C6858C4DFFC9BAEADAEDDFAC81735332BB86F022D91" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/66588" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e6ce130f-c35c-44b6-b085-ca579bf38407/width=450/739396.jpeg", + "nsfw": "X", + "width": 512, + "height": 1080, + "hash": "UDJtF=RjI9jEt-$~xFnhJA4:JDNH~Vae58E2", + "meta": { + "ENSD": "31337", + "Size": "512x1080", + "seed": 1355544048, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "cajafasa,(thick thighs), large breasts, (1girl),In a cardboard box, Garbage, junk, dirty clothes, used socks, clothes stained with semen, (semen filling the box), (pubic hairs floating in semen), smelly, steam, sweat, filthy, dirty, disgusting, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "negativePrompt": "EasyNegative, bad-hands-5,((nude))" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/137eea13-2a40-4e06-a411-7116b549b929/width=450/739400.jpeg", + "nsfw": "X", + "width": 512, + "height": 720, + "hash": "UBK,gN9a9@EL0KOE={4;_L%KH@=ww}v|Tdx^", + "meta": { + "ENSD": "31337", + "Size": "512x720", + "seed": 419017444, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "cajafasa,(thick thighs), large breasts, (1girl),In a cardboard box, Garbage, junk, dirty clothes, used socks, clothes stained with semen, (semen filling the box), (pubic hairs floating in semen), smelly, steam, sweat, filthy, dirty, disgusting,(furry),((In a background garbage dump)), ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "negativePrompt": "EasyNegative, bad-hands-5,((nude))" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/24bd4c9a-02a8-447f-9dcb-c0b172b9bcda/width=450/739413.jpeg", + "nsfw": "X", + "width": 512, + "height": 720, + "hash": "UFK12a9uDhax~V?bITM|?a9G-oxt?a?GI:WB", + "meta": { + "ENSD": "31337", + "Size": "512x720", + "seed": 419017435, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "cajafasa,(thick thighs), large breasts, (1girl),In a cardboard box, Garbage, junk, dirty clothes, used socks, clothes stained with semen, (semen filling the box), (pubic hairs floating in semen), smelly, steam, sweat, filthy, dirty, disgusting,(furry),((In a background garbage dump)), ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "negativePrompt": "EasyNegative, bad-hands-5,((nude))" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1ad934a2-167c-4a3f-8d67-86181ea76e26/width=450/739402.jpeg", + "nsfw": "X", + "width": 512, + "height": 720, + "hash": "U8H1;~S5L}Nx~WNG4oIp00ae^*Rk0Nn$o}t7", + "meta": { + "ENSD": "31337", + "Size": "512x720", + "seed": 419017445, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "cajafasa,(thick thighs), large breasts, (1girl),In a cardboard box, Garbage, junk, dirty clothes, used socks, clothes stained with semen, (semen filling the box), (pubic hairs floating in semen), smelly, steam, sweat, filthy, dirty, disgusting,(furry),((In a background garbage dump)), ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "negativePrompt": "EasyNegative, bad-hands-5,((nude))" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d8eeae58-2ec4-463d-942a-2cad1dad72b8/width=450/739399.jpeg", + "nsfw": "X", + "width": 512, + "height": 720, + "hash": "U9JQ_]vf00%N~qemrBNf00XS%#9wt.W;4.WB", + "meta": { + "ENSD": "31337", + "Size": "512x720", + "seed": 419017443, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "cajafasa,(thick thighs), large breasts, (1girl),In a cardboard box, Garbage, junk, dirty clothes, used socks, clothes stained with semen, (semen filling the box), (pubic hairs floating in semen), smelly, steam, sweat, filthy, dirty, disgusting,(furry),((In a background garbage dump)), ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "negativePrompt": "EasyNegative, bad-hands-5,((nude))" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5a2cd730-8b35-4d1a-9bfa-12b61f4604b2/width=450/739403.jpeg", + "nsfw": "X", + "width": 512, + "height": 720, + "hash": "UDI#APIVROIU%1?H0KE2RN4o?bIUE2ad~UNG", + "meta": { + "ENSD": "31337", + "Size": "512x720", + "seed": 419017446, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "cajafasa,(thick thighs), large breasts, (1girl),In a cardboard box, Garbage, junk, dirty clothes, used socks, clothes stained with semen, (semen filling the box), (pubic hairs floating in semen), smelly, steam, sweat, filthy, dirty, disgusting,(furry),((In a background garbage dump)), ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "negativePrompt": "EasyNegative, bad-hands-5,((nude))" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0b1c9506-5849-4ddd-baa3-ce3f2a161a82/width=450/739407.jpeg", + "nsfw": "X", + "width": 2560, + "height": 2160, + "hash": "U3KAc._34m4:?wxG9Zs,00E2xa9a?c^i?Z^*", + "meta": { + "ENSD": "31337", + "Size": "512x720", + "seed": 2783315605, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "cajafasa,gagged,rope,(thick thighs), large breasts, (1girl),In a cardboard box, Garbage, junk, dirty clothes, used socks, clothes stained with semen, (semen filling the box), (pubic hairs floating in semen), smelly, steam, sweat, filthy, dirty, disgusting, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "negativePrompt": "EasyNegative, bad-hands-5,((nude))" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/bc321273-dfb3-42c0-adea-5a54db15cf3b/width=450/739410.jpeg", + "nsfw": "X", + "width": 2560, + "height": 3240, + "hash": "U3JQp2XB9a%MXoI=RPxC9_M|=_=|};Rik8t6", + "meta": { + "ENSD": "31337", + "Size": "512x1080", + "seed": 1355544040, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "cajafasa,(thick thighs), large breasts, (1girl),In a cardboard box, Garbage, junk, dirty clothes, used socks, clothes stained with semen, (semen filling the box), (pubic hairs floating in semen), smelly, steam, sweat, filthy, dirty, disgusting, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "negativePrompt": "EasyNegative, bad-hands-5,((nude))" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/db65ea64-aacf-4292-bf93-145eaacc1bdf/width=450/739411.jpeg", + "nsfw": "X", + "width": 2560, + "height": 2160, + "hash": "U3I#49V@tRVux]4oai~V-:^kAJ=_x^X9N{M|", + "meta": { + "ENSD": "31337", + "Size": "512x720", + "seed": 419017432, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "cajafasa,(thick thighs), large breasts, (1girl),In a cardboard box, Garbage, junk, dirty clothes, used socks, clothes stained with semen, (semen filling the box), (pubic hairs floating in semen), smelly, steam, sweat, filthy, dirty, disgusting,(furry),((In a background garbage dump)), ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "negativePrompt": "EasyNegative, bad-hands-5,((nude))" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/be33e7f4-c33b-4af6-a4f7-8ab6bc5824e1/width=450/739412.jpeg", + "nsfw": "Mature", + "width": 512, + "height": 720, + "hash": "U9Iqr,n$vJ-p4;D*?aE24TMy0:s.ysD%9aV?", + "meta": { + "ENSD": "31337", + "Size": "512x720", + "seed": 419017434, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "cajafasa,(thick thighs), large breasts, (1girl),In a cardboard box, Garbage, junk, dirty clothes, used socks, clothes stained with semen, (semen filling the box), (pubic hairs floating in semen), smelly, steam, sweat, filthy, dirty, disgusting,(furry),((In a background garbage dump)), ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "negativePrompt": "EasyNegative, bad-hands-5,((nude))" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/66588" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/BoxNoc-10.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/BoxNoc-10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..1826f91978d358c5ff0f223f9d44615dbd95ef7d Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/BoxNoc-10.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/BoxNoc-10.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/BoxNoc-10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..9fbccf10aff41deebcad6e42787092bf53ddebc8 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/BoxNoc-10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:f3749f31aa5bdc302323f1e211b38af77df98dfe3d75666101b423b4afbc5cb8 +size 19007334 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/Boxcomple-15.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/Boxcomple-15.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..0c6fa8e008fe0f7471775f91125718260b4dba63 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/Boxcomple-15.civitai.info" @@ -0,0 +1,251 @@ +{ + "id": 66419, + "modelId": 61913, + "name": "Hevy training", + "createdAt": "2023-05-09T16:09:42.889Z", + "updatedAt": "2023-05-09T16:12:56.653Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 155, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Box Hero [Set1] / In Container / Gift / Bdsm / Restrained ", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "Boxcomple-15.safetensors", + "id": 46511, + "sizeKB": 37000.47265625, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-09T20:52:06.359Z", + "hashes": { + "AutoV1": "2A3B857E", + "AutoV2": "C70FBF503C", + "SHA256": "C70FBF503C0EF1CDB3858D1BC38C18D76BEF8FE0422C41ED5D209AF9C2BE8F07", + "CRC32": "3A4E2B62", + "BLAKE3": "9D76AFBCE596A22B36A7CBAF7B6F5B78DC052E0EBDF19D2A0C72F4DD60C94D46" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/66419" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/02929ae1-603e-4034-94b6-e2629301d738/width=450/737012.jpeg", + "nsfw": "X", + "width": 512, + "height": 720, + "hash": "UAHw.G~C?G~B~CE14.9Z~Vsm%2-o0L?G-;-o", + "meta": { + "ENSD": "31337", + "Size": "512x720", + "seed": 1058373798, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "cajaf,large breasts,mature female, (in cardboard box), lingerie, tight clothing, ornaments, Christmas decorations, stuffed animals, socks,(bdsm),sex toy, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 4.5, + "Clip skip": "2", + "resources": [], + "negativePrompt": "EasyNegative, bad-hands-5,nude,((amputee))" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d2a94a72-ed41-4155-a60e-e252412d3c80/width=450/737016.jpeg", + "nsfw": "X", + "width": 512, + "height": 1080, + "hash": "UGG*pHoL~B-p~WM|%1s:xut7%MIooLRjt7od", + "meta": { + "ENSD": "31337", + "Size": "512x1080", + "seed": 147453858, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "cajaf,large breasts,mature female, (in cardboard box), Patched stuffed animals, old stuffed animals, multicolored stuffed animals, rare stuffed animals\n,(bdsm),sex toy,very tight clothes, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 4.5, + "Clip skip": "2", + "resources": [], + "negativePrompt": "EasyNegative, bad-hands-5,nude,((amputee))" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2732cf28-8f73-4a9d-b96a-9f35835d0f42/width=450/737017.jpeg", + "nsfw": "X", + "width": 512, + "height": 1080, + "hash": "UKHw_eRj~A-;V[R+R+n$WUs.R-jsogj?oJt7", + "meta": { + "ENSD": "31337", + "Size": "512x1080", + "seed": 147453859, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "cajaf,large breasts,mature female, (in cardboard box), Patched stuffed animals, old stuffed animals, multicolored stuffed animals, rare stuffed animals\n,(bdsm),sex toy,very tight clothes, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 4.5, + "Clip skip": "2", + "resources": [], + "negativePrompt": "EasyNegative, bad-hands-5,nude,((amputee))" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/cec8aed5-4f51-4133-a8a5-3449002f497e/width=450/737019.jpeg", + "nsfw": "Soft", + "width": 512, + "height": 1080, + "hash": "UTI|{|xZ-o%2~VbaIUo2%MbFRkofX9azofof", + "meta": { + "ENSD": "31337", + "Size": "512x1080", + "seed": 147453860, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "cajaf,large breasts,mature female, (in cardboard box), Patched stuffed animals, old stuffed animals, multicolored stuffed animals, rare stuffed animals\n,(bdsm),sex toy,very tight clothes, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 4.5, + "Clip skip": "2", + "resources": [], + "negativePrompt": "EasyNegative, bad-hands-5,nude,((amputee))" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/67ed5dde-49ab-4599-a4dd-810d35ce87df/width=450/737020.jpeg", + "nsfw": "X", + "width": 512, + "height": 1080, + "hash": "UJH_3[xt^j-p%LofxZayNGt7xuWC~VjZIpoL", + "meta": { + "ENSD": "31337", + "Size": "512x1080", + "seed": 147453861, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "cajaf,large breasts,mature female, (in cardboard box), Patched stuffed animals, old stuffed animals, multicolored stuffed animals, rare stuffed animals\n,(bdsm),sex toy,very tight clothes, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 4.5, + "Clip skip": "2", + "resources": [], + "negativePrompt": "EasyNegative, bad-hands-5,nude,((amputee))" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8ea4745f-1316-4d4b-8b10-1d9c3bd82840/width=450/737023.jpeg", + "nsfw": "Soft", + "width": 512, + "height": 1080, + "hash": "U9Hd$[E2x9^+~VR%-oNGIn-njcE2-oV@Rl%2", + "meta": { + "ENSD": "31337", + "Size": "512x1080", + "seed": 147453862, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "cajaf,large breasts,mature female, (in cardboard box), Patched stuffed animals, old stuffed animals, multicolored stuffed animals, rare stuffed animals\n,(bdsm),sex toy,very tight clothes, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 4.5, + "Clip skip": "2", + "resources": [], + "negativePrompt": "EasyNegative, bad-hands-5,nude,((amputee))" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/099c5c0c-90f3-4be8-bd29-9c97c117c76e/width=450/737026.jpeg", + "nsfw": "Mature", + "width": 3600, + "height": 1536, + "hash": "U6HBSe-qsk~A^*R*Rix]Sit6$fxZo#o#IpD*", + "meta": { + "ENSD": "31337", + "Size": "720x512", + "seed": 142263452, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "cajaf,large breasts,mature female, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 4.5, + "Clip skip": "2", + "resources": [], + "negativePrompt": "EasyNegative, bad-hands-5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/25e5599c-ed3d-4dcc-8221-6436bac6f761/width=450/737027.jpeg", + "nsfw": "Soft", + "width": 2560, + "height": 1536, + "hash": "UAI|zT~BIp={tQ-pM|IojFWX%2IV%2M{M|W=", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 243065007, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "cajaf,large breasts,mature female,Cardboard box, lingerie, tight clothing, ornaments, Christmas decorations, stuffed animals, socks, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 4.5, + "Clip skip": "2", + "resources": [], + "negativePrompt": "EasyNegative, bad-hands-5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9ba93798-aeb1-4298-aa5b-6bcd82ea5d0a/width=450/737028.jpeg", + "nsfw": "Soft", + "width": 2560, + "height": 2160, + "hash": "U5INgarWxs4:t5NG~B?HE3xbE1Na~BIVNbxZ", + "meta": { + "ENSD": "31337", + "Size": "512x720", + "seed": 297781496, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "cajaf,large breasts,mature female, (in cardboard box), lingerie, tight clothing, ornaments, Christmas decorations, stuffed animals, socks, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 4.5, + "Clip skip": "2", + "resources": [], + "negativePrompt": "EasyNegative, bad-hands-5,nude,((amputee))" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c332eb3d-a6b5-4617-a7d8-a743a3fef6e4/width=450/737030.jpeg", + "nsfw": "Soft", + "width": 2560, + "height": 2160, + "hash": "U4IX58^*^*Xl~VE1a$s8M{_2ShIo~W?HxZSg", + "meta": { + "ENSD": "31337", + "Size": "512x720", + "seed": 1058373791, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "cajaf,large breasts,mature female, (in cardboard box), lingerie, tight clothing, ornaments, Christmas decorations, stuffed animals, socks,(bdsm),sex toy, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 4.5, + "Clip skip": "2", + "resources": [], + "negativePrompt": "EasyNegative, bad-hands-5,nude,((amputee))" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/66419" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/Boxcomple-15.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/Boxcomple-15.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..daae4c3d98fadeeb89914e1875c54eb2bca40069 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/Boxcomple-15.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/Boxcomple-15.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/Boxcomple-15.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..3972c0aaa1996f139e323959f953cb7cd63ca5c9 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/Boxcomple-15.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:c70fbf503c0ef1cdb3858d1bc38c18d76bef8fe0422c41ed5d209af9c2be8f07 +size 37888484 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/Boxcomple2-10.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/Boxcomple2-10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..fad96b4a3c30a3de6f992455bd06df017cf0000d --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/Boxcomple2-10.civitai.info" @@ -0,0 +1,251 @@ +{ + "id": 66518, + "modelId": 62000, + "name": "Hevy training", + "createdAt": "2023-05-09T18:53:26.474Z", + "updatedAt": "2023-05-09T18:57:06.023Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 157, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Box Hero [Set2] / In Container / Gift / Bdsm / Restrained ", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "Boxcomple2-10.safetensors", + "id": 46586, + "sizeKB": 18564.2265625, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-09T21:05:22.158Z", + "hashes": { + "AutoV1": "DE2F2560", + "AutoV2": "B3B92D2AFB", + "SHA256": "B3B92D2AFB804901D98C00713C4810C7C7847BA4523946198F6A7218223DD556", + "CRC32": "7E9DAE98", + "BLAKE3": "78FD7CD0B15C8B14E50C21040822FDA2060C8C8A2BD4C02B851E58B2A7D1439E" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/66518" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9a2a8639-06ba-4298-91e5-95bf78da3798/width=450/738599.jpeg", + "nsfw": "X", + "width": 512, + "height": 720, + "hash": "UgJ%qHj[~As.xus.j[oet6a{ozoexabGfkj@", + "meta": { + "ENSD": "31337", + "Size": "512x720", + "seed": 2486678624, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "cajaf,large breasts,mature female, (in cardboard box), Patched ((stuffed )) animals, old stuffed animals, multicolored stuffed animals, rare stuffed animals\n,(bdsm),sex toy,very tight clothes, ((penguins)), ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 4.5, + "Clip skip": "2", + "resources": [], + "negativePrompt": "EasyNegative, bad-hands-5,nude,((amputee))" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1f0f5975-ac40-44eb-b8bf-29438bed1f6e/width=450/738598.jpeg", + "nsfw": "Soft", + "width": 512, + "height": 720, + "hash": "USJQl@t6}-%1_3%1IUs--pbIM{WBxuWVWBof", + "meta": { + "ENSD": "31337", + "Size": "512x720", + "seed": 2486678625, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "cajaf,large breasts,mature female, (in cardboard box), Patched ((stuffed )) animals, old stuffed animals, multicolored stuffed animals, rare stuffed animals\n,(bdsm),sex toy,very tight clothes, ((penguins)), ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 4.5, + "Clip skip": "2", + "resources": [], + "negativePrompt": "EasyNegative, bad-hands-5,nude,((amputee))" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9b8b7315-957f-47f1-9769-cd6253f71335/width=450/738600.jpeg", + "nsfw": "X", + "width": 512, + "height": 720, + "hash": "UQKATgxu~7sk_2x[IUsk-:a~M{WB%MazRjR*", + "meta": { + "ENSD": "31337", + "Size": "512x720", + "seed": 2486678626, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "cajaf,large breasts,mature female, (in cardboard box), Patched ((stuffed )) animals, old stuffed animals, multicolored stuffed animals, rare stuffed animals\n,(bdsm),sex toy,very tight clothes, ((penguins)), ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 4.5, + "Clip skip": "2", + "resources": [], + "negativePrompt": "EasyNegative, bad-hands-5,nude,((amputee))" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/14ef9bff-e633-409b-b9cc-1ecec76cc847/width=450/738601.jpeg", + "nsfw": "X", + "width": 512, + "height": 720, + "hash": "UMJ7dkoe}.?G~p%1E0t6-pofNGRj%LWXRjj[", + "meta": { + "ENSD": "31337", + "Size": "512x720", + "seed": 2486678627, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "cajaf,large breasts,mature female, (in cardboard box), Patched ((stuffed )) animals, old stuffed animals, multicolored stuffed animals, rare stuffed animals\n,(bdsm),sex toy,very tight clothes, ((penguins)), ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 4.5, + "Clip skip": "2", + "resources": [], + "negativePrompt": "EasyNegative, bad-hands-5,nude,((amputee))" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9b84d151-287f-47b4-af88-f45bfad4e950/width=450/738603.jpeg", + "nsfw": "Soft", + "width": 512, + "height": 720, + "hash": "UNK0.^t7}:%1^+xtM{xt?Hj]E2fP%MbIR*bH", + "meta": { + "ENSD": "31337", + "Size": "512x720", + "seed": 2486678628, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "cajaf,large breasts,mature female, (in cardboard box), Patched ((stuffed )) animals, old stuffed animals, multicolored stuffed animals, rare stuffed animals\n,(bdsm),sex toy,very tight clothes, ((penguins)), ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 4.5, + "Clip skip": "2", + "resources": [], + "negativePrompt": "EasyNegative, bad-hands-5,nude,((amputee))" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/334eb911-b676-4081-8e6d-1f9dfe7c5f01/width=450/738602.jpeg", + "nsfw": "X", + "width": 512, + "height": 720, + "hash": "UQKToOxavxxa~pxtD%t5RPWW-pjZRjoL%2R*", + "meta": { + "ENSD": "31337", + "Size": "512x720", + "seed": 2486678629, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "cajaf,large breasts,mature female, (in cardboard box), Patched ((stuffed )) animals, old stuffed animals, multicolored stuffed animals, rare stuffed animals\n,(bdsm),sex toy,very tight clothes, ((penguins)), ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 4.5, + "Clip skip": "2", + "resources": [], + "negativePrompt": "EasyNegative, bad-hands-5,nude,((amputee))" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/10c47661-17b3-40d1-be39-c0f7eb210db3/width=450/738604.jpeg", + "nsfw": "Soft", + "width": 512, + "height": 720, + "hash": "UcI;I#of~AxZxut6oet6%1f6bHkBt7azoffk", + "meta": { + "ENSD": "31337", + "Size": "512x720", + "seed": 2486678631, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "cajaf,large breasts,mature female, (in cardboard box), Patched ((stuffed )) animals, old stuffed animals, multicolored stuffed animals, rare stuffed animals\n,(bdsm),sex toy,very tight clothes, ((penguins)), ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 4.5, + "Clip skip": "2", + "resources": [], + "negativePrompt": "EasyNegative, bad-hands-5,nude,((amputee))" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2497b36c-9cd5-43da-80ca-96a0cafe682d/width=450/738607.jpeg", + "nsfw": "X", + "width": 512, + "height": 720, + "hash": "UQJa4Wt6~9xax[xas:t7s,WVxuj[%2WCofof", + "meta": { + "ENSD": "31337", + "Size": "512x720", + "seed": 2486678632, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "cajaf,large breasts,mature female, (in cardboard box), Patched ((stuffed )) animals, old stuffed animals, multicolored stuffed animals, rare stuffed animals\n,(bdsm),sex toy,very tight clothes, ((penguins)), ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 4.5, + "Clip skip": "2", + "resources": [], + "negativePrompt": "EasyNegative, bad-hands-5,nude,((amputee))" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2a3e53ce-6adb-4994-a21e-afa5bd3c75ae/width=450/738605.jpeg", + "nsfw": "X", + "width": 512, + "height": 720, + "hash": "UWKc|aof~8%1?bxtM{kB%MbIM|jYxuWVR*j[", + "meta": { + "ENSD": "31337", + "Size": "512x720", + "seed": 2486678633, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "cajaf,large breasts,mature female, (in cardboard box), Patched ((stuffed )) animals, old stuffed animals, multicolored stuffed animals, rare stuffed animals\n,(bdsm),sex toy,very tight clothes, ((penguins)), ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 4.5, + "Clip skip": "2", + "resources": [], + "negativePrompt": "EasyNegative, bad-hands-5,nude,((amputee))" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/17a977d9-96e3-4a48-8b55-51994adddbc2/width=450/738606.jpeg", + "nsfw": "X", + "width": 512, + "height": 720, + "hash": "UVJaAks:~9xZ%Mt6WCofsnWVtRt7t7a#t7az", + "meta": { + "ENSD": "31337", + "Size": "512x720", + "seed": 2486678634, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "cajaf,large breasts,mature female, (in cardboard box), Patched ((stuffed )) animals, old stuffed animals, multicolored stuffed animals, rare stuffed animals\n,(bdsm),sex toy,very tight clothes, ((penguins)), ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 4.5, + "Clip skip": "2", + "resources": [], + "negativePrompt": "EasyNegative, bad-hands-5,nude,((amputee))" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/66518" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/Boxcomple2-10.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/Boxcomple2-10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..bf9944228a208f2079f4043e3e0b92f3cce508c4 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/Boxcomple2-10.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/Boxcomple2-10.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/Boxcomple2-10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..856ccbbde4ededd63e8a783f41de51b7eb21f93c --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/Boxcomple2-10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:b3b92d2afb804901d98c00713c4810c7c7847ba4523946198f6a7218223dd556 +size 19009768 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ClothingAdjuster3.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ClothingAdjuster3.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..43de7e2d0828801b6bf48c5810ea2bb4bcebdf87 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ClothingAdjuster3.civitai.info" @@ -0,0 +1,370 @@ +{ + "id": 117151, + "modelId": 88132, + "name": "ClothingAdjuster 3.0", + "createdAt": "2023-07-14T01:44:39.634Z", + "updatedAt": "2023-07-14T01:54:40.819Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

\u901a\u8fc7\u5206\u5c42\u878d\u5408\uff0c\u6539\u5584\u4e86\u6743\u91cd1\u65f6\u7684\u76ae\u80a4\u8d28\u611f

Improved skin texture at weight 1 with layered fusion

", + "stats": { + "downloadCount": 262, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "LEOSAM's Clothing +/- Adjuster \u8863\u7269\u589e/\u51cf LoRA", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "ClothingAdjuster3.safetensors", + "id": 83715, + "sizeKB": 4715.828125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-07-14T02:04:54.016Z", + "hashes": { + "AutoV1": "4C2BE859", + "AutoV2": "13F67CA924", + "SHA256": "13F67CA924AEB9AB8D93739D84DB0F8205A8CFB83EE05AF74F3F169CB47F2E38", + "CRC32": "F54A2469", + "BLAKE3": "7C809FBFCD5D78F3D68A621496604A3DF794A8CDF95423AAA492BFD9A1E0222B" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/117151" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/49653eab-3431-4e09-a1f4-c65f627c0f25/width=450/1546097.jpeg", + "nsfw": "None", + "width": 512, + "height": 832, + "hash": "U5CsdT_300}@00ofK+4:00IA}?S2%gD%00?b", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/04d62acc-f826-418e-bf25-60c843e042bf/width=450/1546048.jpeg", + "nsfw": "None", + "width": 512, + "height": 896, + "hash": "U87d?~-pDOM{_NxuM{Rjt-kqELM{.9kWD%Rj", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0e80bd93-e818-4ae5-be3f-97756c9377e3/width=450/1546049.jpeg", + "nsfw": "None", + "width": 512, + "height": 896, + "hash": "UBBxczkDzqV@{ys.V[Rk#lRkkp%19vWCXSoz", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/729e3e4c-ddb4-42de-8553-35990b810d6b/width=450/1546050.jpeg", + "nsfw": "Mature", + "width": 3072, + "height": 1874, + "hash": "UWEyVzRjRjof~qt7fkj[_3t7f6fR~qWBayj[", + "meta": { + "Size": "512x832", + "seed": 3542325439, + "Model": "darkSushiMixMix_225D", + "steps": 27, + "Script": "X/Y/Z plot", + "X Type": "Prompt S/R", + "hashes": { + "model": "cca17b08da" + }, + "prompt": ", 1girl, in water, freckles, ripples, long hair, wavy hair, upper body, forest, fox ear, choker, looking at viewer, moon, night, dark photo, blurry background", + "Version": "v1.2.1", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "cca17b08da", + "name": "darkSushiMixMix_225D", + "type": "model" + } + ], + "Model hash": "cca17b08da", + "Hires steps": "21", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(nsfw, worst quality, low quality, bad_pictures, negative_hand-neg:1.2)", + "ClothingAdjuster3": "1\"", + "\"ClothingAdjuster3": "-1", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5afbce17-7462-426d-90b3-c0b4dcc3efe7/width=450/1546055.jpeg", + "nsfw": "X", + "width": 3072, + "height": 1874, + "hash": "UcKJoeRRWBay~q%2j]bH%#kCa|j[?bNGayoL", + "meta": { + "Size": "512x832", + "seed": 809818624, + "Model": "darkSushiMixMix_225D", + "model": "control_v11p_sd15_openpose_fp16 [73c2b67d]", + "steps": 27, + "Script": "X/Y/Z plot", + "X Type": "Prompt S/R", + "hashes": { + "model": "cca17b08da" + }, + "prompt": ",cute 1girl, sharp focus, short white hair, orange background, simple background, looking at viewer, (blue eyes, police uniform:0.8), sexy, navel, (slightly shy smile, choker, smooth and delicate skin, cinematic lighting:0.7), ", + "weight": "1", + "Version": "v1.2.1", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "leolux", + "type": "lora", + "weight": 0.2 + }, + { + "hash": "cca17b08da", + "name": "darkSushiMixMix_225D", + "type": "model" + } + ], + "Model hash": "cca17b08da", + "Hires steps": "21", + "resize mode": "Resize and Fill", + "control mode": "Balanced", + "\"preprocessor": "openpose", + "Hires upscale": "2", + "pixel perfect": "True", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "((worst quality, low quality, hand), bad_pictures, negative_hand-neg:1.2)", + "starting/ending": "(0, 1)", + "ClothingAdjuster3": "1\"", + "\"ClothingAdjuster3": "-1", + "Denoising strength": "0.5", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/64e0b1aa-ae28-402c-a29f-821979038d58/width=450/1546056.jpeg", + "nsfw": "None", + "width": 3072, + "height": 1874, + "hash": "UgI#cINGxtWV~qt7ozt6?bbIWBof-;oLWBWB", + "meta": { + "Size": "512x832", + "seed": 2130713539, + "Model": "MoonMixFilmGrain2", + "steps": 27, + "Script": "X/Y/Z plot", + "X Type": "Prompt S/R", + "hashes": { + "model": "fe54b5d04d" + }, + "prompt": ", (dark shot:1.1), epic realistic, portrait of halo, blue eyes, tartan scarf, white hair by atey ghailan, by greg rutkowski, by greg tocchini, by james gilleard, by joe fenton, by kaethe butcher, gradient yellow, black, brown and magenta color scheme, grunge aesthetic!!! graffiti tag wall background, art by greg rutkowski and artgerm, soft cinematic light, adobe lightroom, photolab, hdr, intricate, highly detailed, (depth of field:1.4), faded, (neutral colors:1.2), (hdr:1.4), (muted colors:1.2), hyperdetailed, (artstation:1.4), cinematic, warm lights, dramatic light, (intricate details:1.1), complex background, (rutkowski:0.66), (teal and orange:0.4)", + "Version": "v1.2.1", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "fe54b5d04d", + "name": "MoonMixFilmGrain2", + "type": "model" + } + ], + "Model hash": "fe54b5d04d", + "Hires steps": "21", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "(nsfw, worst quality, low quality, bad_pictures, negative_hand-neg:1.2)", + "ClothingAdjuster3": "1\"", + "\"ClothingAdjuster3": "-1", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/aae621f3-0266-4d1d-b612-3a3b9d094c1d/width=450/1546057.jpeg", + "nsfw": "None", + "width": 3072, + "height": 1874, + "hash": "UVKx9yRjV@WB-;t7ofxu~qt7j[fRRkj[WBWB", + "meta": { + "Size": "512x832", + "seed": 3474081748, + "Model": "darkSushiMixMix_225D", + "model": "control_v11p_sd15_openpose_fp16 [73c2b67d]", + "steps": 27, + "Script": "X/Y/Z plot", + "X Type": "Prompt S/R", + "hashes": { + "model": "cca17b08da" + }, + "prompt": ", 1man palying basketball, masterpiece,best quality,ultra high res,realistic skin, (chicken), ((Braces trousers)), white background, simple background", + "weight": "1", + "Version": "v1.2.1", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "cca17b08da", + "name": "darkSushiMixMix_225D", + "type": "model" + } + ], + "Model hash": "cca17b08da", + "Hires steps": "21", + "resize mode": "Resize and Fill", + "control mode": "ControlNet is more important", + "\"preprocessor": "openpose", + "Hires upscale": "2", + "pixel perfect": "True", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "(worst quality, low quality, bad_pictures, negative_hand-neg:1.2)", + "starting/ending": "(0, 1)", + "ClothingAdjuster3": "1\"", + "\"ClothingAdjuster3": "-1", + "Denoising strength": "0.42", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/293fea52-cf3a-4c65-bf09-0e36c1eb3a1e/width=450/1546058.jpeg", + "nsfw": "X", + "width": 3072, + "height": 1874, + "hash": "UTDv7rNGf6a|~qs:j[j[~qt6WVj[_NkCj@j[", + "meta": { + "Size": "512x832", + "seed": 867357979, + "Model": "MoonMixFilmGrain2", + "model": "control_v11p_sd15_openpose_fp16 [73c2b67d]", + "steps": 27, + "Script": "X/Y/Z plot", + "X Type": "Prompt S/R", + "hashes": { + "model": "fe54b5d04d" + }, + "prompt": ", ultra detailed digital art, lace up bodysuit, straps, garter, cleavage, 3d model, doll, makeup, goth, tattoos, (fantasy, dark queen and servant, spiders, bats, sinister, evil, fangs, undead, demon), realistic eyes, lips, makeup, dramatic, trending on artstation, sharp focus, perfect composition, concept art, 8k, studio photo, volumetric lighting, light studio, vibrant, red background, simple background, smooth and supple skin, sitting", + "weight": "1", + "Version": "v1.2.1", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "fe54b5d04d", + "name": "MoonMixFilmGrain2", + "type": "model" + } + ], + "Model hash": "fe54b5d04d", + "Hires steps": "21", + "resize mode": "Crop and Resize", + "control mode": "ControlNet is more important", + "\"preprocessor": "openpose_full", + "Hires upscale": "2", + "pixel perfect": "True", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "(worst quality, low quality, bad_pictures, negative_hand-neg:1.2)", + "starting/ending": "(0, 1)", + "ClothingAdjuster3": "1\"", + "\"ClothingAdjuster3": "-1", + "Denoising strength": "0.5", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/fb0a7224-adb6-4184-b35e-18c46190e652/width=450/1546059.jpeg", + "nsfw": "None", + "width": 3072, + "height": 1874, + "hash": "UeF=%NR-offk~qofj[j].8s:aeoL?boLaefQ", + "meta": { + "Size": "512x832", + "seed": 2126331731, + "Model": "MoonMixFilmGrain2", + "steps": 27, + "Script": "X/Y/Z plot", + "X Type": "Prompt S/R", + "hashes": { + "model": "fe54b5d04d" + }, + "prompt": ", (best quality), (masterpiece), (detailed), a dragon girl with human face and body,covered in blood,red wax,((human face)),wet skin, scaly skin,dragon scales, ,((full body shot)),illustration,extremely detailed, 1girl,(solo)", + "Version": "v1.2.1", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "fe54b5d04d", + "name": "MoonMixFilmGrain2", + "type": "model" + } + ], + "Model hash": "fe54b5d04d", + "Hires steps": "21", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "(nsfw, worst quality, low quality, bad_pictures, negative_hand-neg:1.2)", + "ClothingAdjuster3": "1\"", + "\"ClothingAdjuster3": "-1", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d671e03c-5ee9-4783-8034-90f3105fc666/width=450/1546060.jpeg", + "nsfw": "X", + "width": 3072, + "height": 1874, + "hash": "UcD]SVbHoLt7~qt7ayof?vt6WBj[?cbHjtj[", + "meta": { + "Size": "512x832", + "seed": 1090465553, + "Model": "MoonMixFilmGrain2", + "steps": 27, + "Script": "X/Y/Z plot", + "X Type": "Prompt S/R", + "hashes": { + "model": "fe54b5d04d" + }, + "prompt": ", ultra detailed digital art, lace up bodysuit, straps, garter, cleavage, 3d model, doll, makeup, goth, tattoos, (fantasy, dark queen and servant, spiders, bats, sinister, evil, fangs, undead, demon) realistic eyes, lips, makeup, dramatic, trending on artstation, sharp focus, perfect composition, concept art, 8k, studio photo, volumetric lighting, light studio, vibrant", + "Version": "v1.2.1", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "fe54b5d04d", + "name": "MoonMixFilmGrain2", + "type": "model" + } + ], + "Model hash": "fe54b5d04d", + "Hires steps": "21", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "(worst quality, low quality, bad_pictures, negative_hand-neg:1.2)", + "ClothingAdjuster3": "1\"", + "\"ClothingAdjuster3": "-1", + "Denoising strength": "0.42" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/117151" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ClothingAdjuster3.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ClothingAdjuster3.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..ecf57e78e3e53979af5be25c1d151776d2c77ebc --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ClothingAdjuster3.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:b985d578a61391ab9e59da276934197f7cd1f5f1a216730084c13558d48ade53 +size 3066224 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ClothingAdjuster3.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ClothingAdjuster3.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..a94637696365bb4347ce684f8867e443908c28fb --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ClothingAdjuster3.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:13f67ca924aeb9ab8d93739d84db0f8205a8cfb83ee05af74f3f169cb47f2e38 +size 4829008 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/Concept-pilloryV2.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/Concept-pilloryV2.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..ad988cc0cee6e0687dffd1c550bc6ba9c5780fa2 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/Concept-pilloryV2.civitai.info" @@ -0,0 +1,173 @@ +{ + "id": 111550, + "modelId": 15132, + "name": "v2.0", + "createdAt": "2023-07-06T13:47:58.491Z", + "updatedAt": "2023-07-06T13:56:36.939Z", + "trainedWords": [ + "pillory" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

V2.0 update!

Using less dim so the model size has been significantly reduced,and it is easier to combine with other chara loras

Use bent over\uff0cday to get pillory fixed on ground,but you need some gacha.

Weight 0.8-1.0 Hires upscale: 2, Hires steps: 10, Hires upscaler: ESRGAN_4x for sample img

Don't forget to make a review if you like it!\ud83d\ude00

2.0\u7248\u672c\u66f4\u65b0\uff0c

\u4f7f\u7528\u4e86\u66f4\u5c0f\u7684dim\uff0clora\u53d8\u5f97\u66f4\u52a0\u8f7b\u91cf\u5316\uff0c\u548c\u5176\u4ed6lora\u7684\u517c\u5bb9\u6027\u66f4\u597d\uff0c\u5bf9\u753b\u98ce\u7684\u5f71\u54cd\u4e5f\u5927\u5927\u964d\u4f4e

\u4f7f\u7528prompt bent over\uff0cday \u66f4\u5bb9\u6613\u751f\u6210\u56fa\u5b9a\u5728\u5730\u4e0a\u7684\u67b7\u5177\uff0c\u4f46\u4ecd\u4e0d\u7a33\u5b9a\uff0c\u9700\u8981\u591aroll\u51e0\u6b21

\u6743\u91cd 0.8-1.0 Hires upscale: 2, Hires steps: 10, Hires upscaler: ESRGAN_4x \u4f8b\u56fe\u4fe1\u606f

\u5982\u679c\u559c\u6b22\uff0c\u8bb0\u5f97\u7559\u4e0b\u2665\u548c\u8bc4\u8bba\uff01

", + "stats": { + "downloadCount": 992, + "ratingCount": 3, + "rating": 4.67 + }, + "model": { + "name": "\u3010Concept\u3011Pillory \u6982\u5ff5-\u67b7\u5177jiaju", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "Concept-pilloryV2.safetensors", + "id": 78969, + "sizeKB": 9337.078125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-07-06T13:51:12.158Z", + "hashes": { + "AutoV1": "3B10BC10", + "AutoV2": "2F667A7611", + "SHA256": "2F667A76119EA85B0C317BEB271834C2EAA6B6A3F45BB297FCE768149985FCB6", + "CRC32": "54E18CBD", + "BLAKE3": "17193FAF0A9C4E60927183ACA8F6F3BE9E9711289F5E9FA4B03DE277643ADC14" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/111550" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7f656120-57f1-478f-bce0-2987452f45d6/width=450/1433179.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1024, + "hash": "UJH-}pS100t657R%$d=_cuWAr=t3.AxuX7Ri", + "meta": { + "seed": 2151282138, + "steps": 20, + "prompt": "1girl,pillory, underworld-goddess, open mouth, saliva, nipples, large breasts, completely nude,bent over,outdoors, surrounded, multiple others, exhibitionism, audience, background characters, crowd, public humiliation , ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "negativePrompt": " (worst quality, low quality:1.4), pointy ears,, lowres, bad anatomy, bad hands, text,error, missing fngers,extra digt ,fewer digits,cropped, wort quality ,low quality,normal quality, jpeg artifacts,signature,watermark, username, blurry, bad feet," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a21b80b2-74c3-4cc9-ade4-fe6ee34e8052/width=450/1433206.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1024, + "hash": "U6C?J]-;0001EK-oRlxa009Z~WbbI[jY9Fxb", + "meta": { + "seed": 2657238188, + "steps": 20, + "prompt": "1girl , pillory,underworld-goddess, \n", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "negativePrompt": "(worst quality, low quality:1.4), pointy ears,, lowres, bad anatomy, bad hands, text,error, missing fngers,extra digt ,fewer digits,cropped, wort quality ,low quality,normal quality, jpeg artifacts,signature,watermark, username, blurry, bad feet," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2d861cc4-6c09-410a-ace4-bf66be8fe131/width=450/1433290.jpeg", + "nsfw": "None", + "width": 768, + "height": 1280, + "hash": "U7H-S@oy00%M0{t64nW-%yWo0KV@Atxt~V-:", + "meta": { + "seed": 1242812071, + "steps": 20, + "prompt": "1girl , pillory,Kurikara-Tendou, cowboy shot, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "negativePrompt": "(worst quality, low quality:1.4), pointy ears,, lowres, bad anatomy, bad hands, text,error, missing fngers,extra digt ,fewer digits,cropped, wort quality ,low quality,normal quality, jpeg artifacts,signature,watermark, username, blurry, bad feet," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/57a79093-8193-427a-b959-f31714b79cfc/width=450/1433263.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1024, + "hash": "ULF=H.~V56R-0gR-^kt79uE3IVM|%2ocWTof", + "meta": { + "seed": 852732634, + "steps": 20, + "prompt": "1girl,pillory, underworld-goddess, nipples, breasts, completely nude,bent over, outdoors, day, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "negativePrompt": "(worst quality, low quality:1.4), pointy ears,, lowres, bad anatomy, bad hands, text,error, missing fngers,extra digt ,fewer digits,cropped, wort quality ,low quality,normal quality, jpeg artifacts,signature,watermark, username, blurry, bad feet," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c81cfa00-41f7-4eaa-911f-0c6c618a9e70/width=450/1433199.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1024, + "hash": "ULJ@nC%M00og.TSf-V%1.SoMRjR*XnR*ogog", + "meta": { + "seed": 2151282138, + "steps": 20, + "prompt": "1girl,pillory, underworld-goddess, open mouth, saliva, nipples, large breasts, completely nude,bent over,outdoors, surrounded, multiple others, exhibitionism, audience, background characters, crowd, public humiliation , ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "negativePrompt": " (worst quality, low quality:1.4), pointy ears,, lowres, bad anatomy, bad hands, text,error, missing fngers,extra digt ,fewer digits,cropped, wort quality ,low quality,normal quality, jpeg artifacts,signature,watermark, username, blurry, bad feet," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/bfffa431-27f2-4dcf-801d-195bf2be0235/width=450/1433204.jpeg", + "nsfw": "None", + "width": 768, + "height": 1280, + "hash": "UXJG~L%M9tR*EMofIURj0fofsTWU~VbHxuof", + "meta": { + "seed": 1242812071, + "steps": 20, + "prompt": "1girl , pillory,Kurikara-Tendou,completely nude, spread legs, squatting, cowboy shot, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "negativePrompt": "(worst quality, low quality:1.4), pointy ears,, lowres, bad anatomy, bad hands, text,error, missing fngers,extra digt ,fewer digits,cropped, wort quality ,low quality,normal quality, jpeg artifacts,signature,watermark, username, blurry, bad feet," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ea499fd7-0a04-4f86-9682-4d9a05871cbd/width=450/1433233.jpeg", + "nsfw": "None", + "width": 1536, + "height": 1024, + "hash": "UFG[c+9Y~W9Ft6In-pIU00SLoJbHI]RkbbjY", + "meta": { + "seed": 2465309607, + "steps": 20, + "prompt": "(4girls:1.2),multiple girls, lineup, pillory,serafuku, pleated skirt, thighhighs, standing, cowboy shot,classroom, , ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "negativePrompt": "(worst quality, low quality:1.4), pointy ears,, lowres, bad anatomy, bad hands, text,error, missing fngers,extra digt ,fewer digits,cropped, wort quality ,low quality,normal quality, jpeg artifacts,signature,watermark, username, blurry, bad feet," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ea6defb6-5506-4ae8-8809-73dc610eb14d/width=450/1433224.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UaIqu}%La{M{~pt7oJRj-:ofR*V@x]ayWBj[", + "meta": { + "seed": 2465309606, + "steps": 20, + "prompt": "(2girls:1.2),lineup, pillory,serafuku, pleated skirt, thighhighs, standing, cowboy shot, , ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "negativePrompt": "(worst quality, low quality:1.4), pointy ears,, lowres, bad anatomy, bad hands, text,error, missing fngers,extra digt ,fewer digits,cropped, wort quality ,low quality,normal quality, jpeg artifacts,signature,watermark, username, blurry, bad feet," + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/111550" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/Concept-pilloryV2.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/Concept-pilloryV2.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..4e083b2a440baca7fd3dce8d1105d13a83502282 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/Concept-pilloryV2.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/Concept-pilloryV2.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/Concept-pilloryV2.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..c46229944d805f74ad629e1b0ae40597b929e9fe --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/Concept-pilloryV2.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:2f667a76119ea85b0c317beb271834c2eaa6b6a3f45bb297fce768149985fcb6 +size 9561168 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ConceptCrucifixion_crucifixionv1000006.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ConceptCrucifixion_crucifixionv1000006.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..5f151dbf8b002bbc7236ecd6587503bf1889d819 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ConceptCrucifixion_crucifixionv1000006.civitai.info" @@ -0,0 +1,273 @@ +{ + "id": 9263, + "modelId": 7856, + "name": "crucifixionV1-000006", + "createdAt": "2023-02-10T16:47:28.147Z", + "updatedAt": "2023-02-18T02:46:43.910Z", + "trainedWords": [ + "crucifixion", + "spread_arms" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "model": { + "name": "\u3010Concept\u3011Crucifixion \u5341\u5b57\u52a8\u4f5c", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "ConceptCrucifixion_crucifixionv1000006.safetensors", + "id": 9002, + "sizeKB": 36975.1396484375, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-02-10T16:51:44.122Z", + "hashes": { + "AutoV1": "3A7BE211", + "AutoV2": "051ECE16B0", + "SHA256": "051ECE16B04E9807BA53F8500AA4E9764527DB4A2B4EE4F247935A4A42BD1CC7", + "CRC32": "583D7C6B", + "BLAKE3": "3491C5AB517B2C5071BA4803B92B765889F04993642D94ED3A9F475A769B2E66" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/9263" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3785aff6-eb48-41c9-677e-f886845ee600/width=450/88719.jpeg", + "nsfw": true, + "width": 800, + "height": 1280, + "hash": "UKIYC8-;_Nsl00j@Ioj[SfV[Mdj]x[a{xaRj", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/82e7624a-76f4-4313-885c-9a9215560e00/width=450/88723.jpeg", + "nsfw": false, + "width": 800, + "height": 1280, + "hash": "UQGudsxa%M%L~pt6oJs:SijtbIf+S5a#xuof", + "meta": { + "ENSD": "31337", + "Size": "400x640", + "seed": 1913260230, + "steps": 20, + "prompt": "masterpiece,1girl,solo, ,crucifixion,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "Model hash": "a074b8864e", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "Latent (nearest)", + "negativePrompt": "EasyNegative,nipples,pussy,sketch, duplicate, ugly, huge eyes, text, logo, monochrome, worst face, (bad and mutated hands:1.3), (worst quality:2.0), (low quality:2.0), (blurry:2.0), horror, geometry, bad_prompt, (bad hands), (missing fingers), multiple limbs, bad anatomy, (interlocked fingers:1.2), Ugly Fingers, (extra digit and hands and fingers and legs and arms:1.4), crown braid, ((2girl)), (deformed fingers:1.2), (long fingers:1.2), (bad-artist-anime), bad-artist, bad hand,, ,bad_prompt_version2", + "Denoising strength": "0.58" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ff508d12-6854-4f08-5bab-e0fd5579e400/width=450/88722.jpeg", + "nsfw": false, + "width": 800, + "height": 1280, + "hash": "U#FP$%WVoyoL%%oea#a{%hWCahayx]oMWBj]", + "meta": { + "ENSD": "31337", + "Size": "400x640", + "seed": 1913260231, + "steps": 20, + "prompt": "masterpiece,1girl,solo, ,crucifixion,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "Model hash": "a074b8864e", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "Latent (nearest)", + "negativePrompt": "EasyNegative,nipples,pussy,sketch, duplicate, ugly, huge eyes, text, logo, monochrome, worst face, (bad and mutated hands:1.3), (worst quality:2.0), (low quality:2.0), (blurry:2.0), horror, geometry, bad_prompt, (bad hands), (missing fingers), multiple limbs, bad anatomy, (interlocked fingers:1.2), Ugly Fingers, (extra digit and hands and fingers and legs and arms:1.4), crown braid, ((2girl)), (deformed fingers:1.2), (long fingers:1.2), (bad-artist-anime), bad-artist, bad hand,, ,bad_prompt_version2", + "Denoising strength": "0.58" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9e9be5ed-bb81-4bbd-4f26-f424b24c5800/width=450/88721.jpeg", + "nsfw": false, + "width": 800, + "height": 1280, + "hash": "UREo##IV-:IU~qRkxuIUt8ofRjRjIoofafWB", + "meta": { + "ENSD": "31337", + "Size": "400x640", + "seed": 1913260232, + "steps": 20, + "prompt": "masterpiece,1girl,solo, ,crucifixion,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "Model hash": "a074b8864e", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "Latent (nearest)", + "negativePrompt": "EasyNegative,nipples,pussy,sketch, duplicate, ugly, huge eyes, text, logo, monochrome, worst face, (bad and mutated hands:1.3), (worst quality:2.0), (low quality:2.0), (blurry:2.0), horror, geometry, bad_prompt, (bad hands), (missing fingers), multiple limbs, bad anatomy, (interlocked fingers:1.2), Ugly Fingers, (extra digit and hands and fingers and legs and arms:1.4), crown braid, ((2girl)), (deformed fingers:1.2), (long fingers:1.2), (bad-artist-anime), bad-artist, bad hand,, ,bad_prompt_version2", + "Denoising strength": "0.58" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/351c6953-9ca9-4103-ea74-39ddfb669d00/width=450/88720.jpeg", + "nsfw": true, + "width": 800, + "height": 1280, + "hash": "UfJH,ZWByDs:~qt7jst7xuofxaayoet7Rjj[", + "meta": { + "ENSD": "31337", + "Size": "400x640", + "seed": 2888983203, + "steps": 20, + "prompt": "masterpiece,1girl,solo,,chains, ,mecha musume, mecha musume, (mechanical arms:1.4), mechanical legs, mechanical legs, (mechanical legs:1.3),mechanical parts, mechanical parts, mechanical parts,doll joints, doll joints, doll joints, ,(crucifixion:1.3), standing,bound,bondage,bdsm,shibari", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "Model hash": "a074b8864e", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "Latent (nearest)", + "negativePrompt": "EasyNegative,nipples,pussy,sketch, duplicate, ugly, huge eyes, text, logo, monochrome, worst face, (bad and mutated hands:1.3), (worst quality:2.0), (low quality:2.0), (blurry:2.0), horror, geometry, bad_prompt, (bad hands), (missing fingers), multiple limbs, bad anatomy, (interlocked fingers:1.2), Ugly Fingers, (extra digit and hands and fingers and legs and arms:1.4), crown braid, ((2girl)), (deformed fingers:1.2), (long fingers:1.2), (bad-artist-anime), bad-artist, bad hand,, ,bad_prompt_version2", + "Denoising strength": "0.58" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2cda0a7f-60b4-455c-1a71-16fde6d93600/width=450/90311.jpeg", + "nsfw": false, + "width": 800, + "height": 1280, + "hash": "UWE3C;IVX5of_4M{%MozoeRit8WDIUaxjbM{", + "meta": { + "ENSD": "31337", + "Size": "400x640", + "seed": 1690070472, + "steps": 20, + "prompt": "masterpiece,1girl,solo,crucifixion:1.3, ,full body, standing:1.3,closed eyes, (mechanical arms:1.3),(mechanical legs:1.3),bound,(mechanical_hands),mecha musume, wire,factory,mecha,,black hair, white dress,white legwear", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [], + "Model hash": "a074b8864e", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "Latent (nearest)", + "negativePrompt": "EasyNegative,nipples,pussy,sketch, duplicate, ugly, huge eyes, text, logo, monochrome, worst face, (bad and mutated hands:1.3), (worst quality:2.0), (low quality:2.0), (blurry:2.0), horror, geometry, bad_prompt, (bad hands), (missing fingers), multiple limbs, bad anatomy, (interlocked fingers:1.2), Ugly Fingers, (extra digit and hands and fingers and legs and arms:1.4), crown braid, ((2girl)), (deformed fingers:1.2), (long fingers:1.2), (bad-artist-anime), bad-artist, bad hand,, ,bad_prompt_version2", + "Denoising strength": "0.58" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/dd2c1d7b-76ac-427b-7363-36238b058400/width=450/90310.jpeg", + "nsfw": false, + "width": 800, + "height": 1280, + "hash": "UYG95Hxu9Zbbxat8IUWBt6xujZRj_Nj?V@j[", + "meta": { + "ENSD": "31337", + "Size": "400x640", + "seed": 4162554726, + "steps": 20, + "prompt": "masterpiece,1girl,solo,crucifixion:1.3, ,full body, standing:1.3,closed eyes, (mechanical arms:1.3),(mechanical legs:1.3),bound,(mechanical_hands),mecha musume, wire,factory,mecha,\n ,navel,white hair,sideboob", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [], + "Model hash": "a074b8864e", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "Latent (nearest)", + "negativePrompt": "EasyNegative,(syringe),nipples,pussy,sketch, duplicate, ugly, huge eyes, text, logo, monochrome, worst face, (bad and mutated hands:1.3), (worst quality:2.0), (low quality:2.0), (blurry:2.0), horror, geometry, bad_prompt, (bad hands), (missing fingers), multiple limbs, bad anatomy, (interlocked fingers:1.2), Ugly Fingers, (extra digit and hands and fingers and legs and arms:1.4), crown braid, ((2girl)), (deformed fingers:1.2), (long fingers:1.2), (bad-artist-anime), bad-artist, bad hand,, ,bad_prompt_version2", + "Denoising strength": "0.58" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/db36ff84-122f-443f-5371-04af04638c00/width=450/90309.jpeg", + "nsfw": true, + "width": 800, + "height": 1280, + "hash": "UaKe7o%M_NRjIAj[RiWCo#j@M_f6R+ofaKWB", + "meta": { + "ENSD": "31337", + "Size": "400x640", + "seed": 372399041, + "steps": 20, + "prompt": "masterpiece,1girl,solo,crucifixion:1.3, ,full body, standing:1.3,closed eyes, (mechanical arms:1.3),(mechanical legs:1.3),bound,(mechanical_hands),mecha musume, wire,factory,mecha,\n ,blue hair,torn clothes,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [], + "Model hash": "a074b8864e", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "Latent (nearest)", + "negativePrompt": "EasyNegative,(syringe),nipples,pussy,sketch, duplicate, ugly, huge eyes, text, logo, monochrome, worst face, (bad and mutated hands:1.3), (worst quality:2.0), (low quality:2.0), (blurry:2.0), horror, geometry, bad_prompt, (bad hands), (missing fingers), multiple limbs, bad anatomy, (interlocked fingers:1.2), Ugly Fingers, (extra digit and hands and fingers and legs and arms:1.4), crown braid, ((2girl)), (deformed fingers:1.2), (long fingers:1.2), (bad-artist-anime), bad-artist, bad hand,, ,bad_prompt_version2", + "Denoising strength": "0.58" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7de8155c-24b0-40f9-a9e1-65b36bcd9800/width=450/90308.jpeg", + "nsfw": true, + "width": 800, + "height": 1280, + "hash": "UREoJjtll9xv~WofSeoz-VW:NGof-pozXToz", + "meta": { + "ENSD": "31337", + "Size": "400x640", + "seed": 3859427639, + "steps": 20, + "prompt": "masterpiece,1girl,solo,crucifixion:1.3, ,full body, standing:1.3,closed eyes, (mechanical arms:1.3),(mechanical legs:1.3),bound,(mechanical_hands),mecha musume, wire,factory,mecha,\n ,horns,underboob,black legwear,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [], + "Model hash": "a074b8864e", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "Latent (nearest)", + "negativePrompt": "EasyNegative,(syringe),nipples,pussy,sketch, duplicate, ugly, huge eyes, text, logo, monochrome, worst face, (bad and mutated hands:1.3), (worst quality:2.0), (low quality:2.0), (blurry:2.0), horror, geometry, bad_prompt, (bad hands), (missing fingers), multiple limbs, bad anatomy, (interlocked fingers:1.2), Ugly Fingers, (extra digit and hands and fingers and legs and arms:1.4), crown braid, ((2girl)), (deformed fingers:1.2), (long fingers:1.2), (bad-artist-anime), bad-artist, bad hand,, ,bad_prompt_version2", + "Denoising strength": "0.58" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/518a9031-5f07-436a-04fd-7249745dab00/width=450/90332.jpeg", + "nsfw": false, + "width": 800, + "height": 1280, + "hash": "UaH+|WnONGxG2]NHaKSh}Zofnhs:S4oLR*of", + "meta": { + "ENSD": "31337", + "Size": "400x640", + "seed": 1311981219, + "steps": 20, + "prompt": "masterpiece,1girl,solo,crucifixion:1.3, ,full body, standing:1.3,closed eyes, (mechanical arms:1.3),(mechanical legs:1.3),bound,(mechanical_hands),mecha musume, wire,factory,mecha, ,underboob, sideboob", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [], + "Model hash": "a074b8864e", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "Latent (nearest)", + "negativePrompt": "EasyNegative,nipples,pussy,sketch, duplicate, ugly, huge eyes, text, logo, monochrome, worst face, (bad and mutated hands:1.3), (worst quality:2.0), (low quality:2.0), (blurry:2.0), horror, geometry, bad_prompt, (bad hands), (missing fingers), multiple limbs, bad anatomy, (interlocked fingers:1.2), Ugly Fingers, (extra digit and hands and fingers and legs and arms:1.4), crown braid, ((2girl)), (deformed fingers:1.2), (long fingers:1.2), (bad-artist-anime), bad-artist, bad hand,, ,bad_prompt_version2", + "Denoising strength": "0.58" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/9263" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ConceptCrucifixion_crucifixionv1000006.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ConceptCrucifixion_crucifixionv1000006.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..1b41049f11533e83255fac5685bbd6cf0a686fa5 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ConceptCrucifixion_crucifixionv1000006.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:f41d87f86e356ee6d15e7f7e7cfd83d7e5edeca334e854de4c23f5dd05d2e54d +size 1438153 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ConceptCrucifixion_crucifixionv1000006.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ConceptCrucifixion_crucifixionv1000006.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..bb160cc22ff9fa1f17d335886f6c915a78f32ff5 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ConceptCrucifixion_crucifixionv1000006.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:051ece16b04e9807ba53f8500aa4e9764527db4a2b4ee4f247935a4a42bd1cc7 +size 37862543 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ConceptInWall_v10.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ConceptInWall_v10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..ed8543d9d1541ea6ab4b63787e1b89c2878613e2 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ConceptInWall_v10.civitai.info" @@ -0,0 +1,264 @@ +{ + "id": 52111, + "modelId": 47514, + "name": "v1.0", + "createdAt": "2023-04-22T06:03:59.361Z", + "updatedAt": "2023-04-22T06:17:38.006Z", + "trainedWords": [ + "in wall" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 273, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "[Concept] in wall", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "ConceptInWall_v10.safetensors", + "id": 37986, + "sizeKB": 73840.9560546875, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-22T06:06:39.334Z", + "hashes": { + "AutoV1": "33B2F4F8", + "AutoV2": "FB74629BE7", + "SHA256": "FB74629BE73246C96D4D57AD7BFCE15EDFC1B986F582686BD7F2043BACF73677", + "CRC32": "F87E6302", + "BLAKE3": "489BD72403A55474CEF3F26896FD77E1C69F1692D782936B386463410756FC78" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/52111" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ff88bf64-dc96-495b-42be-7fe3cc94eb00/width=450/561710.jpeg", + "nsfw": false, + "width": 512, + "height": 768, + "hash": "UhH-+0R*tRt6~WWCxut7XSNG%2xuRkRjxaof", + "meta": { + "Size": "512x768", + "seed": 1818819904, + "steps": 20, + "prompt": "1girl,nude,in wall, , short straight hair, looking at viewer, breast, (wood wall:1.3)", + "sampler": "DPM++ SDE Karras", + "cfgScale": 6.5, + "resources": [ + { + "name": "Concept_wall_decoration", + "type": "lora", + "weight": 0.85 + }, + { + "name": "Concept_lactation_v11", + "type": "lora", + "weight": 0.8 + } + ], + "Model hash": "79e42fb744", + "negativePrompt": "easynegative, worst quality, low quality, big head", + "ControlNet Model": "openpose [9ca67cc5]", + "ControlNet Module": "openpose", + "ControlNet Weight": "1", + "ControlNet Enabled": "True", + "ControlNet Guidance End": "1", + "ControlNet Guidance Start": "0" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/fc7cc609-3037-49a7-a670-74fb4aef3500/width=450/561713.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UUG[p0IUT0WA~UayM|WBM{WCt7ayoJf6WCWB", + "meta": { + "Size": "512x768", + "seed": 3936086135, + "steps": 20, + "prompt": "1girl,nude,in wall, , wavy hair, looking at viewer, breast, statue, museum, smile, name label , ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 6.5, + "resources": [ + { + "name": "Concept_wall_decoration", + "type": "lora", + "weight": 0.85 + }, + { + "name": "Chara_queenMarikaEldenRing_hard", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "1e06255e39", + "negativePrompt": "easynegative, worst quality, low quality, big head", + "ControlNet Model": "openpose [9ca67cc5]", + "ControlNet Module": "none", + "ControlNet Weight": "1", + "ControlNet Enabled": "True", + "ControlNet Guidance End": "1", + "ControlNet Guidance Start": "0" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/91b8ff47-a4f4-489c-7e99-0d3cd7d8a900/width=450/561743.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UNLgOsae.St7~poJkDbbEgM{-oxtIpV@%Loy", + "meta": { + "Size": "512x768", + "seed": 2624579976, + "steps": 20, + "prompt": "1girl,nude,in wall, , updo hair, looking at viewer, breast, statue, (museum:1.4), smile, name label , ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 6.5, + "resources": [ + { + "name": "Concept_wall_decoration", + "type": "lora", + "weight": 0.85 + }, + { + "name": "Face_aiBeautyIthlinni_V1", + "type": "lora", + "weight": 0.5 + } + ], + "Model hash": "7234b76e42", + "negativePrompt": "easynegative, worst quality, low quality, big head", + "ControlNet Model": "openpose [9ca67cc5]", + "ControlNet Module": "none", + "ControlNet Weight": "1", + "ControlNet Enabled": "True", + "ControlNet Guidance End": "1", + "ControlNet Guidance Start": "0" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/930591ca-0ed9-424a-5d62-da68261aa500/width=450/561734.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UbJ7?tM|k=tR~pV@xut7JAM{%1xtoet6WBRk", + "meta": { + "Size": "512x768", + "seed": 3452756880, + "steps": 25, + "prompt": "1girl,nude,in wall, , long wavy ponytail hair, looking at viewer, breast, abs, frame, smile, name label, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 6.5, + "resources": [ + { + "name": "Concept_wall_decoration", + "type": "lora", + "weight": 0.9 + }, + { + "name": "Face_miumiu", + "type": "lora", + "weight": 0.2 + } + ], + "Model hash": "fa98706258", + "negativePrompt": "easynegative, worst quality, low quality, big head" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/de14ba54-63ce-4a97-1fb5-3ac2dba8e200/width=450/561742.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UUI}I$9GO@X8~pD*%MozELIUxaxu-:xaM{NG", + "meta": { + "Size": "512x768", + "seed": 172726000, + "steps": 25, + "prompt": "1girl,nude,in wall, , updo hair, looking at viewer, breast, smile, name label", + "sampler": "DPM++ SDE Karras", + "cfgScale": 6.5, + "resources": [ + { + "name": "Concept_wall_decoration", + "type": "lora", + "weight": 0.85 + } + ], + "Model hash": "d88c605d7b", + "negativePrompt": "easynegative, worst quality, low quality, big head" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/fca04cac-6505-478b-0cbe-d054d3704900/width=450/561748.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UPIN]m0KEh%M~WM|xtRj9uxu$%Ios.ozR*ni", + "meta": { + "Size": "512x768", + "seed": 172725995, + "steps": 25, + "prompt": "1girl,nude,in wall, , short straight hair, looking at viewer, breast, smile, name label", + "sampler": "DPM++ SDE Karras", + "cfgScale": 6.5, + "resources": [ + { + "name": "Concept_wall_decoration", + "type": "lora", + "weight": 0.85 + } + ], + "Model hash": "d88c605d7b", + "negativePrompt": "easynegative, worst quality, low quality, big head" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b9ee3324-5f54-4aa4-01af-d67109190700/width=450/561749.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UfIhT=ayT1t7~qaykWoeIpj[%2a{WCazoyay", + "meta": { + "Size": "512x768", + "seed": 3452756833, + "steps": 25, + "prompt": "1girl,nude,in wall, , long straight hair, looking at viewer, breast, abs, frame, smile, name label, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 6.5, + "resources": [ + { + "name": "Concept_wall_decoration", + "type": "lora", + "weight": 0.9 + }, + { + "name": "Face_miumiu", + "type": "lora", + "weight": 0.2 + } + ], + "Model hash": "fa98706258", + "negativePrompt": "easynegative, worst quality, low quality, big head" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/52111" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ConceptInWall_v10.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ConceptInWall_v10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..85ba726c4991bb0cb252cccb6febe89bd083f4f7 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ConceptInWall_v10.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ConceptInWall_v10.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ConceptInWall_v10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..e703aa3cc184f5c1ac93c4595d6e48e03e40335b --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ConceptInWall_v10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:fb74629be73246c96d4d57ad7bfce15edfc1b986f582686bd7f2043bacf73677 +size 75613139 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ConceptMarilynMonroeDressTug_v10.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ConceptMarilynMonroeDressTug_v10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..1694ef1bd67f268972787b8bfd3043be21dd6023 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ConceptMarilynMonroeDressTug_v10.civitai.info" @@ -0,0 +1,192 @@ +{ + "id": 40741, + "modelId": 34461, + "name": "v1.0", + "createdAt": "2023-04-09T09:40:58.130Z", + "updatedAt": "2023-04-09T09:42:19.409Z", + "trainedWords": [ + "marilyntug" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "model": { + "name": "\u3010Concept\u3011Marilyn Monroe Dress Tug Cosplay \u739b\u4e3d\u83b2\u68a6\u9732\u538b\u88d9\u5b50Cosplay", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "ConceptMarilynMonroeDressTug_v10.safetensors", + "id": 31534, + "sizeKB": 36975.1337890625, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-09T09:46:40.088Z", + "hashes": { + "AutoV1": "DA7D1723", + "AutoV2": "8F72730BD0", + "SHA256": "8F72730BD08620D4A04FBAF881BC8AFDB610E8344E4D07AED64669CCFB189558", + "CRC32": "969DC6B4", + "BLAKE3": "F6584EE0110B2972350ABADAD4D2A4562910F4A3AB27B5E267EF6246EB9A4BFD" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/40741" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d66afe56-bf12-462a-ae46-e2ccd2310f00/width=450/450117.jpeg", + "nsfw": true, + "width": 1024, + "height": 1280, + "hash": "UaJ??Bxa9a9u~9NHnjr=nNRPoes:%MoLWCt7", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 1327817809, + "steps": 20, + "prompt": "1girl,marilyntug,blonde_hair, ,solo,curly hair,embarrassed, blush,red lips,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "Model hash": "e4b17ce185", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "ESRGAN_4x", + "negativePrompt": "EasyNegative,(worst quality:1.4), (low quality:1.4), (normal quality:1.4), ((female pubic hair:1.3)), lowres,", + "Denoising strength": "0.58" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3473d2d7-60db-4d33-c1c0-40bb67d47400/width=450/450118.jpeg", + "nsfw": true, + "width": 1024, + "height": 1280, + "hash": "UMKT[Mt5K*?b~pxa-pxu%N-:xu?bX9R+bH-o", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 4265001156, + "steps": 20, + "prompt": "1girl,marilyntug,black_hair, ,solo,absurdly long hair,light smile,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "Model hash": "f75b19923f", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "ESRGAN_4x", + "negativePrompt": "EasyNegative,(worst quality:1.4), (low quality:1.4), (normal quality:1.4), ((female pubic hair:1.3)), lowres,", + "Denoising strength": "0.58" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8be2e258-cf99-43d7-923e-78a86d353b00/width=450/450122.jpeg", + "nsfw": true, + "width": 1024, + "height": 1280, + "hash": "ULI#lo~W0eIU-:-;-pRj00-=%Lt8-=%Ms;xa", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 1624304304, + "steps": 20, + "prompt": "1girl,marilyntug,white_hair, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "Model hash": "6bdb906885", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "ESRGAN_4x", + "negativePrompt": "EasyNegative,(worst quality:1.4), (low quality:1.4), (normal quality:1.4), ((female pubic hair:1.3)), lowres,", + "Denoising strength": "0.58" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/be1a742d-7484-4e12-b125-05fac23db500/width=450/450123.jpeg", + "nsfw": true, + "width": 1024, + "height": 1280, + "hash": "UTJQ~G~qKO^+xGxutQRj4n%Mt7oLx]xuofso", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 302494312, + "steps": 20, + "prompt": "1girl,marilyntug,red_hair, ,solo,long_hair", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "Model hash": "6bdb906885", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "ESRGAN_4x", + "negativePrompt": "EasyNegative,(worst quality:1.4), (low quality:1.4), (normal quality:1.4), ((female pubic hair:1.3)), lowres,", + "Denoising strength": "0.58" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/dc09ae35-d047-4aeb-198c-9e548ad8d200/width=450/450119.jpeg", + "nsfw": true, + "width": 1024, + "height": 1280, + "hash": "UhIOz^-=4.tl_Nx]RQxaROx]WBRjoft7RkRk", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 3190368583, + "steps": 20, + "prompt": "1girl,marilyntug,blue_hair, ,solo,long_hair", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "Model hash": "6bdb906885", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "ESRGAN_4x", + "negativePrompt": "EasyNegative,(worst quality:1.4), (low quality:1.4), (normal quality:1.4), ((female pubic hair:1.3)), lowres,", + "Denoising strength": "0.58" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5de9da1e-4e5a-48b9-9f89-97b9b6e84400/width=450/450124.jpeg", + "nsfw": true, + "width": 1024, + "height": 1280, + "hash": "UWIN,U~VOSo}j=IVE1NGIUn%NGt7f,t7bb%2", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 1212262634, + "steps": 20, + "prompt": "1girl,marilyntug,blue_hair, ,solo,long_hair,embarrassed,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "Model hash": "e4b17ce185", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "ESRGAN_4x", + "negativePrompt": "EasyNegative,(worst quality:1.4), (low quality:1.4), (normal quality:1.4), ((female pubic hair:1.3)), lowres,", + "Denoising strength": "0.58" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/40741" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ConceptMarilynMonroeDressTug_v10.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ConceptMarilynMonroeDressTug_v10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..d7d63f84d93b52529d8c52cf5b5d6271d72aee7a --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ConceptMarilynMonroeDressTug_v10.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:7f25fc6355550caed29cb7d2d92133de8187da6d4390c98582c20e6c041f403e +size 2001660 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ConceptMarilynMonroeDressTug_v10.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ConceptMarilynMonroeDressTug_v10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..2fc263f50a233f964a4f9b9d66cb3b48e5108dcd --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ConceptMarilynMonroeDressTug_v10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:8f72730bd08620d4a04fbaf881bc8afdb610e8344e4d07aed64669ccfb189558 +size 37862537 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ConceptMechanicalStationary_v1.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ConceptMechanicalStationary_v1.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..9d7e8e9eb1bef798dcf23d1643b3424e0695ed57 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ConceptMechanicalStationary_v1.civitai.info" @@ -0,0 +1,206 @@ +{ + "id": 21456, + "modelId": 18137, + "name": "V1", + "createdAt": "2023-03-11T05:44:55.568Z", + "updatedAt": "2023-03-15T15:56:27.458Z", + "trainedWords": [ + "stationary_restraints" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "model": { + "name": "\u3010Concept\u3011Mechanical Stationary Restraints \u673a\u68b0\u56db\u80a2\u62d8\u675f", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "ConceptMechanicalStationary_v1.safetensors", + "id": 17885, + "sizeKB": 36975.16015625, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-03-11T05:46:39.587Z", + "hashes": { + "AutoV1": "941C5B48", + "AutoV2": "19B241C23A", + "SHA256": "19B241C23AC4F4FFCC8E7E88C60CC3CD2983BFAA01B83E289FE7B34CD9EC4034", + "CRC32": "301BD971", + "BLAKE3": "1B524093CC8CB8A02F5871D2107205FD5F6813E5E2DDD94136BF68EF85242DB9" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/21456" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/bb688114-a8b4-4c41-b598-3b5427966d00/width=450/227939.jpeg", + "nsfw": true, + "width": 1024, + "height": 1280, + "hash": "UDHL0n%10fWXOVt7xFRPNbxa~WM{-oxaI.NG", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 1609842766, + "steps": 20, + "prompt": "masterpiece,1girl,solo ,heart-shaped pupils,open mouth,cow_horns,black_hair,cleavage,navel,large breasts, full body, \n ,stationary restraints,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "Model hash": "01b259805e", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "negativePrompt": "(twintails:1.3),EasyNegative, bad_prompt_version2, (worst quality:1.4), (low quality:1.4), (normal quality:1.4), lowres, skin spots, acnes, skin blemishes, age spot, glans,extra fingers,\nfewer fingers,strange fingers,((bad hand)),Hand grip,(lean),Extra ears,(Four ears),Strange eyes,(three arms),Many hands,(Many arms),((watermarking)),", + "Denoising strength": "0.58" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/89b32327-77dc-491b-3c6e-7e246a3ea600/width=450/227945.jpeg", + "nsfw": true, + "width": 1024, + "height": 1280, + "hash": "UHJ7:s-;GG_3yWaf~W%2tRoL-o%MtPWCD%xt", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 3278978955, + "steps": 20, + "prompt": "masterpiece,1girl,solo ,heart-shaped pupils,open mouth,cow_horns,black_hair,cleavage,navel,large breasts, nipples,lactation,milking machine, \n ,stationary restraints, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "milkingMachine_v12Beta", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "01b259805e", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "negativePrompt": "(twintails:1.3),EasyNegative, bad_prompt_version2, (worst quality:1.4), (low quality:1.4), (normal quality:1.4), lowres, skin spots, acnes, skin blemishes, age spot, glans,extra fingers,\nfewer fingers,strange fingers,((bad hand)),Hand grip,(lean),Extra ears,(Four ears),Strange eyes,(three arms),Many hands,(Many arms),((watermarking)),", + "Denoising strength": "0.58" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/de4faa62-8ed6-49bf-a08a-19ba541cf900/width=450/227944.jpeg", + "nsfw": true, + "width": 1024, + "height": 1280, + "hash": "UGJREpD%u4?v_NR*%Mt70KRk?aV@~Wj]WB%L", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3205b8cf-b0ac-4cf0-c648-f72c36127f00/width=450/227943.jpeg", + "nsfw": true, + "width": 1024, + "height": 1280, + "hash": "U9Hw[k~B009a{K}@0dEf+]-o-;009FIo00?G", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 3409202402, + "steps": 20, + "prompt": "masterpiece,1girl,solo, blush,long hair, ,heart-shaped pupils,open mouth,cleavage, navel,\n ,stationary restraints,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "Model hash": "01b259805e", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "negativePrompt": "nsfw,EasyNegative, bad_prompt_version2, (worst quality:1.4), (low quality:1.4), (normal quality:1.4), lowres, skin spots, acnes, skin blemishes, age spot, glans,extra fingers,\nfewer fingers,strange fingers,((bad hand)),Hand grip,(lean),Extra ears,(Four ears),Strange eyes,(three arms),Many hands,(Many arms),((watermarking)),", + "Denoising strength": "0.58" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3431171a-8654-4417-eac1-e1c5ce25a400/width=450/227942.jpeg", + "nsfw": true, + "width": 1024, + "height": 1280, + "hash": "UKG*]F~C4-N^Os9ZRj%MIUjFr?xZRNj^IpNF", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 4132464256, + "steps": 20, + "prompt": "masterpiece,1girl,solo ,heart-shaped pupils,open mouth,hoodie,\n ,stationary restraints,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "Model hash": "01b259805e", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "negativePrompt": "(twintails:1.3),EasyNegative, bad_prompt_version2, (worst quality:1.4), (low quality:1.4), (normal quality:1.4), lowres, skin spots, acnes, skin blemishes, age spot, glans,extra fingers,\nfewer fingers,strange fingers,((bad hand)),Hand grip,(lean),Extra ears,(Four ears),Strange eyes,(three arms),Many hands,(Many arms),((watermarking)),", + "Denoising strength": "0.58" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1b64d265-370a-4998-b0c5-12aedc92c600/width=450/227941.jpeg", + "nsfw": true, + "width": 1024, + "height": 1280, + "hash": "UDHeIKNd00RP00xa~CNG9Zxu%2D%J8X8Di-p", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 332626259, + "steps": 20, + "prompt": "masterpiece,1girl,solo ,heart-shaped pupils,open mouth,cow_horns,black_hair,cleavage,navel,white_bikini,\n ,stationary restraints, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "Model hash": "01b259805e", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "negativePrompt": "(twintails:1.3),EasyNegative, bad_prompt_version2, (worst quality:1.4), (low quality:1.4), (normal quality:1.4), lowres, skin spots, acnes, skin blemishes, age spot, glans,extra fingers,\nfewer fingers,strange fingers,((bad hand)),Hand grip,(lean),Extra ears,(Four ears),Strange eyes,(three arms),Many hands,(Many arms),((watermarking)),", + "Denoising strength": "0.58" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2b624088-9a51-4320-ec52-7b5347753800/width=450/227940.jpeg", + "nsfw": true, + "width": 1024, + "height": 1280, + "hash": "U6G[sT5600mQ00_4qZx]M{of=_9G00IVMcMx", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 1905225291, + "steps": 20, + "prompt": "masterpiece,1girl,solo ,heart-shaped pupils,open mouth,blue_hair,cleavage,navel,large breasts, pubic tattoo, long_hair,absurdly long hair, \n ,stationary restraints", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "Model hash": "01b259805e", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "negativePrompt": "(twintails:1.3),EasyNegative, bad_prompt_version2, (worst quality:1.4), (low quality:1.4), (normal quality:1.4), lowres, skin spots, acnes, skin blemishes, age spot, glans,extra fingers,\nfewer fingers,strange fingers,((bad hand)),Hand grip,(lean),Extra ears,(Four ears),Strange eyes,(three arms),Many hands,(Many arms),((watermarking)),", + "Denoising strength": "0.58" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/21456" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ConceptMechanicalStationary_v1.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ConceptMechanicalStationary_v1.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..a330ab7a2ddbbcdbff96eeaf0ac4cad9b5b04731 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ConceptMechanicalStationary_v1.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:f26df3e0a7ca03667d273a5c30d53405f4169a1d8b403d0b70145e05617a3145 +size 1861229 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ConceptMechanicalStationary_v1.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ConceptMechanicalStationary_v1.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..3870cfe624e4f3c3298718137d31dc5a6fb89b32 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/ConceptMechanicalStationary_v1.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:19b241c23ac4f4ffcc8e7e88c60cc3cd2983bfaa01b83e289fe7b34cd9ec4034 +size 37862564 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/Concept_in_wall.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/Concept_in_wall.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..c701f0067c14bcf8342d4232b734d76ff1ae36a9 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/Concept_in_wall.civitai.info" @@ -0,0 +1,439 @@ +{ + "id": 108945, + "modelId": 47514, + "name": "v2.0", + "createdAt": "2023-07-02T19:21:14.846Z", + "updatedAt": "2023-07-02T19:26:51.775Z", + "trainedWords": [ + "in_wall" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 208, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "[Concept] in wall", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "Concept_in_wall.safetensors", + "id": 76884, + "sizeKB": 36981.1064453125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-07-02T19:30:44.795Z", + "hashes": { + "AutoV1": "E81276C7", + "AutoV2": "6DDAA4D769", + "SHA256": "6DDAA4D7690D2DD5C8B720DB9805C51C9462B96FCA4E876B7DE953C908575084", + "CRC32": "EE2867DC", + "BLAKE3": "C11F19C3B99EC0DB9E59ECA8931685CC29D1271F25CADE5483C1A5D9CD17D1BE" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/108945" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/43a41a4d-056c-4e61-bae2-2de6ecc1049a/width=450/1379878.jpeg", + "nsfw": "X", + "width": 768, + "height": 1024, + "hash": "U8E.tx%L0MNe~qIUD%WB0KM|~Wt69Fay-;oz", + "meta": { + "Size": "768x1024", + "seed": 3833897755, + "Model": "perfectWorld_v3Baked", + "steps": 30, + "hashes": { + "model": "0f49d1caa2" + }, + "prompt": "1girl, breasts, nipple, in_wall, , The grand entrance gate is adorned with intricate carvings of mythical creatures and divine beings.", + "Version": "v1.4.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Concept_in_wall", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "0f49d1caa2", + "name": "perfectWorld_v3Baked", + "type": "model" + } + ], + "Model hash": "0f49d1caa2", + "negativePrompt": "easynegative, worst quality, low quality, watermark, logo", + "ADetailer model": "mediapipe_face_full", + "ADetailer version": "23.6.3", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "Face_chinaDollLikeness_v10": "0.6>\"", + "\"Face_chinaDollLikeness_v10": "3f4675aad6bc\"", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ec3b2be1-0e7f-4d6c-aec9-6c01d102d3bd/width=450/1379872.jpeg", + "nsfw": "Mature", + "width": 768, + "height": 1024, + "hash": "UEF}Zc-o9ZxZ~Vo0M{WC4:IVE3WBtRbbE1t6", + "meta": { + "Size": "768x1024", + "seed": 3833897759, + "Model": "perfectWorld_v3Baked", + "steps": 30, + "hashes": { + "model": "0f49d1caa2" + }, + "prompt": "1girl, breasts, nipple, in_wall, , The grand entrance gate is adorned with intricate carvings of mythical creatures and divine beings.", + "Version": "v1.4.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Concept_in_wall", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "0f49d1caa2", + "name": "perfectWorld_v3Baked", + "type": "model" + } + ], + "Model hash": "0f49d1caa2", + "negativePrompt": "easynegative, worst quality, low quality, watermark, logo", + "ADetailer model": "mediapipe_face_full", + "ADetailer version": "23.6.3", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "Face_chinaDollLikeness_v10": "0.6>\"", + "\"Face_chinaDollLikeness_v10": "3f4675aad6bc\"", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/12cdcdfc-40de-40d5-b659-6ee908bd3aa6/width=450/1379871.jpeg", + "nsfw": "Mature", + "width": 768, + "height": 1024, + "hash": "UBExw-_NEfIU_2tmxtVs0LR+=|ni-;R*D%IU", + "meta": { + "Size": "768x1024", + "seed": 3833897762, + "Model": "perfectWorld_v3Baked", + "steps": 30, + "hashes": { + "model": "0f49d1caa2" + }, + "prompt": "1girl, breasts, nipple, in_wall, , The grand entrance gate is adorned with intricate carvings of mythical creatures and divine beings.", + "Version": "v1.4.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Concept_in_wall", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "0f49d1caa2", + "name": "perfectWorld_v3Baked", + "type": "model" + } + ], + "Model hash": "0f49d1caa2", + "negativePrompt": "easynegative, worst quality, low quality, watermark, logo", + "ADetailer model": "mediapipe_face_full", + "ADetailer version": "23.6.3", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "Face_chinaDollLikeness_v10": "0.6>\"", + "\"Face_chinaDollLikeness_v10": "3f4675aad6bc\"", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/faf18527-d078-4c9a-9fff-bc27d880d889/width=450/1379869.jpeg", + "nsfw": "X", + "width": 512, + "height": 768, + "hash": "UiIz#IoLIVof?Gs:xaofM{oe%1ay~VR*M{WB", + "meta": { + "Size": "512x768", + "seed": 3420406445, + "Model": "Nabylon-v1.3-fp16", + "steps": 30, + "hashes": { + "model": "d88c605d7b" + }, + "prompt": "1girl, breasts, nipple, in_wall, , Spring, Hyacinths perfume the air with sweetness", + "Version": "v1.4.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "d88c605d7b", + "name": "Nabylon-v1.3-fp16", + "type": "model" + } + ], + "Model hash": "d88c605d7b", + "negativePrompt": "easynegative, worst quality, low quality, watermark, logo", + "\"Concept_in_wall-000010": "20e656060e0e\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/841d07ef-53d2-4790-ac5d-5d51a2ebf80c/width=450/1379870.jpeg", + "nsfw": "X", + "width": 512, + "height": 768, + "hash": "UNI}6I9bK3_2~qoM?Gt7I[xY%2E1%2a#t7r?", + "meta": { + "Size": "512x768", + "seed": 3420406483, + "Model": "Nabylon-v1.3-fp16", + "steps": 30, + "hashes": { + "model": "d88c605d7b" + }, + "prompt": "1girl, breasts, nipple, in_wall, , Spring, Open windows invite fresh air into homes", + "Version": "v1.4.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "d88c605d7b", + "name": "Nabylon-v1.3-fp16", + "type": "model" + } + ], + "Model hash": "d88c605d7b", + "negativePrompt": "easynegative, worst quality, low quality, watermark, logo", + "\"Concept_in_wall-000010": "20e656060e0e\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/48118f38-aee4-46be-9ed5-a7d59a214765/width=450/1379873.jpeg", + "nsfw": "Mature", + "width": 512, + "height": 768, + "hash": "UGG[WY4ptP~V-Q?bE0xuImR:?aIoIAW?%2NG", + "meta": { + "Size": "512x768", + "seed": 3208944311, + "Model": "perfectWorld_v3Baked", + "steps": 30, + "hashes": { + "model": "0f49d1caa2" + }, + "prompt": "1girl, breasts, nipple, in_wall, , Spring, Flower baskets hang from lamp posts", + "Version": "v1.4.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Concept_in_wall", + "type": "lora", + "weight": 0.65 + }, + { + "hash": "0f49d1caa2", + "name": "perfectWorld_v3Baked", + "type": "model" + } + ], + "Model hash": "0f49d1caa2", + "negativePrompt": "easynegative, worst quality, low quality, watermark, logo", + "\"Concept_in_wall": "20e656060e0e\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2e20a123-f0ab-40d9-879a-79187bb23ce9/width=450/1379874.jpeg", + "nsfw": "Mature", + "width": 512, + "height": 768, + "hash": "UIG*ye9ZtQ?G~VWBxtafR%xtxaRj~VM|E1WV", + "meta": { + "Size": "512x768", + "seed": 3208944336, + "Model": "perfectWorld_v3Baked", + "steps": 30, + "hashes": { + "model": "0f49d1caa2" + }, + "prompt": "1girl, breasts, nipple, in_wall, , Spring, Bees buzz around lavender bushes", + "Version": "v1.4.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Concept_in_wall", + "type": "lora", + "weight": 0.65 + }, + { + "hash": "0f49d1caa2", + "name": "perfectWorld_v3Baked", + "type": "model" + } + ], + "Model hash": "0f49d1caa2", + "negativePrompt": "easynegative, worst quality, low quality, watermark, logo", + "\"Concept_in_wall": "20e656060e0e\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5b194def-a3e4-421a-8f74-a26892736ea9/width=450/1379876.jpeg", + "nsfw": "Mature", + "width": 512, + "height": 768, + "hash": "UQFYiZM|M{s:~pWVofoL9Zof%MRjaej[M{NG", + "meta": { + "Size": "512x768", + "seed": 3265824770, + "Model": "perfectWorld_v3Baked", + "steps": 30, + "hashes": { + "model": "0f49d1caa2" + }, + "prompt": "1girl, breasts, nipple, in_wall, , The grand entrance gate is adorned with intricate carvings of mythical creatures and divine beings.", + "Version": "v1.4.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Concept_in_wall", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "0f49d1caa2", + "name": "perfectWorld_v3Baked", + "type": "model" + } + ], + "Model hash": "0f49d1caa2", + "negativePrompt": "easynegative, worst quality, low quality, watermark, logo", + "\"Concept_in_wall": "20e656060e0e\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/953f62ca-014a-4702-8412-72d81a2efa3e/width=450/1379875.jpeg", + "nsfw": "Mature", + "width": 512, + "height": 768, + "hash": "UPGH@^~qElo#^k%2s:s:M{WB%Lxus:oftRX8", + "meta": { + "Size": "512x768", + "seed": 3265824779, + "Model": "perfectWorld_v3Baked", + "steps": 30, + "hashes": { + "model": "0f49d1caa2" + }, + "prompt": "1girl, breasts, nipple, in_wall, , Cherry blossom petals float gently in the air, creating a poetic atmosphere in the imperial garden.", + "Version": "v1.4.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Concept_in_wall", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "0f49d1caa2", + "name": "perfectWorld_v3Baked", + "type": "model" + } + ], + "Model hash": "0f49d1caa2", + "negativePrompt": "easynegative, worst quality, low quality, watermark, logo", + "\"Concept_in_wall": "20e656060e0e\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/fe194d9d-9675-4d05-bdcd-f64bf1693206/width=450/1379877.jpeg", + "nsfw": "Mature", + "width": 768, + "height": 1024, + "hash": "UHGt+*4oWA~p-T%Lt6xa56xa?bM{smt7V@of", + "meta": { + "Size": "768x1024", + "seed": 3942836091, + "Model": "perfectWorld_v3Baked", + "steps": 30, + "hashes": { + "model": "0f49d1caa2" + }, + "prompt": "1girl, breasts, nipple, in_wall, ,palace luxury wall, wood, decorations,", + "Version": "v1.4.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Concept_in_wall", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "0f49d1caa2", + "name": "perfectWorld_v3Baked", + "type": "model" + } + ], + "Model hash": "0f49d1caa2", + "negativePrompt": "easynegative, worst quality, low quality, watermark, logo", + "ADetailer model": "mediapipe_face_full", + "ADetailer version": "23.6.3", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "Face_chinaDollLikeness_v10": "0.6>\"", + "\"Face_chinaDollLikeness_v10": "3f4675aad6bc\"", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/108945" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/Concept_in_wall.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/Concept_in_wall.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..51fede254e80e6f71de689317d802358658c58e4 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/Concept_in_wall.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/Concept_in_wall.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/Concept_in_wall.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..2b73150b0202f97f30372517308664c12c0c37e2 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/Concept_in_wall.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:6ddaa4d7690d2dd5c8b720db9805c51c9462b96fca4e876b7de953c908575084 +size 37868653 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/abyssorangemix36MilkCowGirl2_v11.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/abyssorangemix36MilkCowGirl2_v11.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..cd5a0315ed69cb4fc09bcf267390fc174f0f37ba --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/abyssorangemix36MilkCowGirl2_v11.civitai.info" @@ -0,0 +1,266 @@ +{ + "id": 10069, + "modelId": 8500, + "name": "v.1.1", + "createdAt": "2023-02-13T16:01:04.595Z", + "updatedAt": "2023-04-06T15:19:30.225Z", + "trainedWords": [ + "milking machine", + "lactation", + "leaning forward", + "nipples" + ], + "baseModel": "SD 1.4", + "earlyAccessTimeFrame": 0, + "description": "

This version added more steps, modified some parameters to make it work properly

  • leaning forward or bent over will get better results

", + "stats": { + "downloadCount": 13143, + "ratingCount": 31, + "rating": 4.94 + }, + "model": { + "name": "Milking machine", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "milkingMachine_v11.safetensors", + "id": 9652, + "sizeKB": 73838.158203125, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-02-13T16:09:13.787Z", + "hashes": { + "AutoV1": "FD2C363B", + "AutoV2": "67971F42BA", + "SHA256": "67971F42BA2B0F32218B0B7AE1F69AC609D6EE9A33B76D463D3C1475968F4541", + "CRC32": "AAEFD436", + "BLAKE3": "E2EA361B03C5E60C9CB092B63517A02A8977F92BA86F0CE85C6DD4224C9441E9" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/10069" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6dfbb70e-7ad2-438d-3133-528bc1425200/width=450/98134.jpeg", + "nsfw": "X", + "width": 960, + "height": 720, + "hash": "UiKw@D~WR%ob.8x]V@xuoeR-RPs:xut7M{n$", + "meta": { + "Size": "640x448", + "seed": 2096762193, + "Model": "AbyssOrangeMix2_hard", + "steps": 20, + "prompt": "milking machine, 1girl, white hair, purple eyes, lactation, upper body, standing, large breasts, nipples, halo, cow print, bodysuit, leotard, leaning forward, from side, arms behind back, bondage,", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + }, + { + "hash": "c57778f31b50", + "name": "milking_machine", + "type": "lora", + "weight": null + }, + { + "hash": "10eed00f88ff", + "name": "Noa", + "type": "lora", + "weight": null + } + ], + "Model hash": "0fc198c490", + "Hires resize": "960x720", + "AddNet Enabled": "True", + "AddNet Model 1": "milking_machine(c57778f31b50)", + "AddNet Model 2": "Noa(10eed00f88ff)", + "Hires upscaler": "lollypop", + "negativePrompt": "(worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, multiple view, Reference sheet,", + "AddNet Module 1": "LoRA", + "AddNet Module 2": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight A 2": "0.9", + "AddNet Weight B 1": "1", + "AddNet Weight B 2": "0.9", + "Denoising strength": "0.35" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d5cc7195-4dbf-4b87-df2f-122af4c0f300/width=450/98367.jpeg", + "nsfw": "X", + "width": 720, + "height": 960, + "hash": "UOLzT^IH0cD%~pD+W8jEo#IA-QM{?H%L4:s.", + "meta": { + "Size": "448x640", + "seed": 3992960833, + "Model": "AbyssOrangeMix2_hard", + "steps": 20, + "prompt": "white hair, purple eyes, serafuku, (milking machine), lactation, nipples, shirt lift, upper body, sitting, closed mouth, happy, pointy ears, large breasts, skirt, neckerchief, short sleeves,", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + }, + { + "hash": "c57778f31b50", + "name": "milking_machine", + "type": "lora", + "weight": null + } + ], + "Model hash": "0fc198c490", + "Hires resize": "720x960", + "AddNet Enabled": "True", + "AddNet Model 1": "milking_machine(c57778f31b50)", + "Hires upscaler": "lollypop", + "negativePrompt": "(worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, multiple view, Reference sheet,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.35" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/04d78864-4e0d-4a3d-f693-2c881321a200/width=450/98115.jpeg", + "nsfw": "X", + "width": 720, + "height": 960, + "hash": "UCKc-60000Z%?t+}01Eg0J~B-;4:sq%z4oIB", + "meta": { + "Size": "448x640", + "seed": 3358130749, + "Model": "AbyssOrangeMix2_hard", + "steps": 20, + "prompt": "milking machine, 1girl, fox ears, lactation, leaning forward, upper body, standing, large breasts, nipples, criss-cross halter,", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + }, + { + "hash": "c57778f31b50", + "name": "milking_machine", + "type": "lora", + "weight": null + } + ], + "Model hash": "0fc198c490", + "Hires resize": "720x960", + "AddNet Enabled": "True", + "AddNet Model 1": "milking_machine(c57778f31b50)", + "Hires upscaler": "lollypop", + "negativePrompt": "(worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, multiple view, Reference sheet,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.35" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6e08e0eb-f5e1-413b-36ca-be1678ecb000/width=450/98366.jpeg", + "nsfw": "X", + "width": 720, + "height": 960, + "hash": "UHHnW_~oH;9bxvRo009Y%ft8a{In0gn*S5r?", + "meta": { + "Size": "448x640", + "seed": 441965102, + "Model": "AbyssOrangeMix2_hard", + "steps": 20, + "prompt": "white hair, purple eyes, (milking machine), ((lactation)), nipples, leaning forward, large areolae, kneeling, arms behind back, display, machinery, bondage, upper body, black bodysuit,", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + }, + { + "hash": "c57778f31b50", + "name": "milking_machine", + "type": "lora", + "weight": null + } + ], + "Model hash": "0fc198c490", + "Hires resize": "720x960", + "AddNet Enabled": "True", + "AddNet Model 1": "milking_machine(c57778f31b50)", + "Hires upscaler": "lollypop", + "negativePrompt": "(worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, multiple view, Reference sheet,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.35" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ab328f85-114e-458c-856e-ecf4c6e8d400/width=450/98365.jpeg", + "nsfw": "X", + "width": 720, + "height": 960, + "hash": "UIHdX0xt0KS%~p%eIU=|?Fkp=|sExZ-pWYEM", + "meta": { + "Size": "448x640", + "seed": 467200604, + "Model": "AbyssOrangeMix2_hard", + "steps": 20, + "prompt": "white hair, purple eyes, (milking machine), lactation, nipples, leaning forward, large areolae, kneeling, arms up, display, machinery, bondage, upper body, bodysuit, thighhighs, highleg leotard,", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + }, + { + "hash": "c57778f31b50", + "name": "milking_machine", + "type": "lora", + "weight": null + } + ], + "Model hash": "0fc198c490", + "Hires resize": "720x960", + "AddNet Enabled": "True", + "AddNet Model 1": "milking_machine(c57778f31b50)", + "Hires upscaler": "lollypop", + "negativePrompt": "(worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, multiple view, Reference sheet,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.35" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/10069" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/abyssorangemix36MilkCowGirl2_v11.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/abyssorangemix36MilkCowGirl2_v11.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..6714d0463932da6dd138a9ed8ee6facccaf74b8b Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/abyssorangemix36MilkCowGirl2_v11.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/abyssorangemix36MilkCowGirl2_v11.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/abyssorangemix36MilkCowGirl2_v11.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..6be4dd30f66b6e578f78cf671a12158b4943f717 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/abyssorangemix36MilkCowGirl2_v11.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:67971f42ba2b0f32218b0b7ae1f69ac609d6ee9a33b76d463d3c1475968f4541 +size 75610274 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/accidentalExposure_v10.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/accidentalExposure_v10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..72e092ca45636bcd595ea89fa4ffa74b9e5977c1 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/accidentalExposure_v10.civitai.info" @@ -0,0 +1,256 @@ +{ + "id": 26589, + "modelId": 22267, + "name": "v1.0", + "createdAt": "2023-03-21T07:51:48.588Z", + "updatedAt": "2023-03-21T07:57:31.601Z", + "trainedWords": [ + "accidental exposure", + "panties", + "skirt lift", + "bag" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "model": { + "name": "Accidental exposure", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "accidentalExposure_v10.safetensors", + "id": 22037, + "sizeKB": 18541.5302734375, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-03-21T07:56:26.173Z", + "hashes": { + "AutoV1": "DE2F2560", + "AutoV2": "0D29843E47", + "SHA256": "0D29843E471841946F4B1C2E99F6FF4AFDD321F4F2E4463D147AA8FB22A3BF84", + "CRC32": "3343916C", + "BLAKE3": "14CC9878C331E5F48BAFB772DE936285C8B1C5D300DE8C87627E655DE182815F" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/26589" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0c96711e-dfe5-4eee-97f8-1922bc4c0100/width=450/293022.jpeg", + "nsfw": true, + "width": 720, + "height": 960, + "hash": "UIIE%?-=0v%h%$~W~VEN_3XAks?bT1IVt9_4", + "meta": { + "ENSD": "31337", + "Size": "448x640", + "seed": 1334881127, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 25, + "prompt": "accidental exposure, pleated skirt, panties, bag, thighhighs,", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + }, + { + "hash": "6f7b8fdc6491", + "name": "accidental_exposure", + "type": "lora", + "weight": null + } + ], + "Model hash": "0873291ac5", + "Hires resize": "720x960", + "AddNet Enabled": "True", + "AddNet Model 1": "accidental_exposure(6f7b8fdc6491)", + "Hires upscaler": "lollypop", + "negativePrompt": "(worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, multiple view, Reference sheet, EasyNegative, head out of frame, bad-hands-5,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.35" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0974e234-62bf-4cbd-f2a5-f3932e110800/width=450/293026.jpeg", + "nsfw": true, + "width": 720, + "height": 960, + "hash": "UHIO93z.G8B,0{ROs*tR_NS0D*-VTLM^^*%2", + "meta": { + "ENSD": "31337", + "Size": "448x640", + "seed": 1334881125, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 25, + "prompt": "accidental exposure, pleated skirt, panties, bag, thighhighs,", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + }, + { + "hash": "6f7b8fdc6491", + "name": "accidental_exposure", + "type": "lora", + "weight": null + } + ], + "Model hash": "0873291ac5", + "Hires resize": "720x960", + "AddNet Enabled": "True", + "AddNet Model 1": "accidental_exposure(6f7b8fdc6491)", + "Hires upscaler": "lollypop", + "negativePrompt": "(worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, multiple view, Reference sheet, EasyNegative, head out of frame, bad-hands-5,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.35" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0fff48a4-4aad-4780-74a4-f55940ec7300/width=450/293025.jpeg", + "nsfw": true, + "width": 720, + "height": 960, + "hash": "UBIEkQ4o5M~pOjNG4m?G4m%L0gM|=_-p59E2", + "meta": { + "ENSD": "31337", + "Size": "448x640", + "seed": 1334881134, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 25, + "prompt": "accidental exposure, pleated skirt, panties, bag, thighhighs,", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + }, + { + "hash": "6f7b8fdc6491", + "name": "accidental_exposure", + "type": "lora", + "weight": null + } + ], + "Model hash": "0873291ac5", + "Hires resize": "720x960", + "AddNet Enabled": "True", + "AddNet Model 1": "accidental_exposure(6f7b8fdc6491)", + "Hires upscaler": "lollypop", + "negativePrompt": "(worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, multiple view, Reference sheet, EasyNegative, head out of frame, bad-hands-5,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.35" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2ea9153f-32bc-4c61-1c5a-1e375cef9700/width=450/293024.jpeg", + "nsfw": true, + "width": 720, + "height": 960, + "hash": "UNJkZK?vFpI[X,-=-npI~WWbtm?ao#IqWE-p", + "meta": { + "ENSD": "31337", + "Size": "448x640", + "seed": 1334881132, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 25, + "prompt": "accidental exposure, pleated skirt, panties, bag, thighhighs,", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + }, + { + "hash": "6f7b8fdc6491", + "name": "accidental_exposure", + "type": "lora", + "weight": null + } + ], + "Model hash": "0873291ac5", + "Hires resize": "720x960", + "AddNet Enabled": "True", + "AddNet Model 1": "accidental_exposure(6f7b8fdc6491)", + "Hires upscaler": "lollypop", + "negativePrompt": "(worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, multiple view, Reference sheet, EasyNegative, head out of frame, bad-hands-5,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.35" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9e02f2e8-e7c0-4305-26f6-e7428df41300/width=450/293023.jpeg", + "nsfw": true, + "width": 720, + "height": 960, + "hash": "USHU|J%10dEg.A$*xu9u^,RQJCo}xwIUtRx]", + "meta": { + "ENSD": "31337", + "Size": "448x640", + "seed": 1334881129, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 25, + "prompt": "accidental exposure, pleated skirt, panties, bag, thighhighs,", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + }, + { + "hash": "6f7b8fdc6491", + "name": "accidental_exposure", + "type": "lora", + "weight": null + } + ], + "Model hash": "0873291ac5", + "Hires resize": "720x960", + "AddNet Enabled": "True", + "AddNet Model 1": "accidental_exposure(6f7b8fdc6491)", + "Hires upscaler": "lollypop", + "negativePrompt": "(worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, multiple view, Reference sheet, EasyNegative, head out of frame, bad-hands-5,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.35" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/26589" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/accidentalExposure_v10.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/accidentalExposure_v10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..0c9a26541fbe23621db212ba73eb777d71117bee Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/accidentalExposure_v10.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/accidentalExposure_v10.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/accidentalExposure_v10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..e09ca468c9b12ef952759702004befb50b822cda --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/accidentalExposure_v10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:0d29843e471841946f4b1c2e99f6ff4afdd321f4f2e4463d147aa8fb22a3bf84 +size 18986527 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/armBinder_20230228.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/armBinder_20230228.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..cea846341395adb119f1ae51a569e959dd3a3bbe --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/armBinder_20230228.civitai.info" @@ -0,0 +1,80 @@ +{ + "id": 16714, + "modelId": 13219, + "name": "20230228", + "createdAt": "2023-02-28T15:05:13.957Z", + "updatedAt": "2023-03-06T13:40:32.799Z", + "trainedWords": [ + "arm_binder" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

It was a little overlearned, so I corrected it a little.

", + "model": { + "name": "arm_binder", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "armBinder_20230228.safetensors", + "id": 14091, + "sizeKB": 147573.5458984375, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-02-28T15:06:24.380Z", + "hashes": { + "AutoV1": "5B01759C", + "AutoV2": "239A78300B", + "SHA256": "239A78300BED12D31A83A3757B21B749676A5EA45DBC7DC567B9FEF3E3569E8B", + "CRC32": "A49418C3", + "BLAKE3": "91F1A03A85B9DDA37103737356679F5AF5DB4F67F729A26BCD9A8C2C82220FC8" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/16714" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/dede8d5b-6672-4655-2a29-298493388300/width=450/168557.jpeg", + "nsfw": false, + "width": 512, + "height": 768, + "hash": "UBHnd6tR00^*9Fj=0KsC~VE19t-q~WofIo-p", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ba6c9a0f-4c21-4d7d-d8e7-66858be2e000/width=450/168556.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UJGbCyE19[~V00xtROM{RPaykCa#%MkBkCj]", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4654299f-8633-48d3-e33b-963916ad8000/width=450/168555.jpeg", + "nsfw": false, + "width": 512, + "height": 768, + "hash": "UCGkXl?aRgRi~Ct6xWRjr=sox[xu0eNG-Vxt", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/96da6ebe-68c7-4420-a921-dd8102a98100/width=450/168554.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UJG8QB9aM_~W^*M{NG%2M{oft7NGIUbHt7Rj", + "meta": null + } + ], + "downloadUrl": "https://civitai.com/api/download/models/16714" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/armBinder_20230228.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/armBinder_20230228.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..d190f9e120769d81fb7e253c00ebaf6e7682d558 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/armBinder_20230228.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/armBinder_20230228.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/armBinder_20230228.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..e49b205859b07a31299a4ce808730ccad4d2a0a0 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/armBinder_20230228.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:239a78300bed12d31a83a3757b21b749676a5ea45dbc7dc567b9fef3e3569e8b +size 151115311 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/armbinder_v10.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/armbinder_v10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..3c34ed2ce2cd04e4b02a287a95392fd8029a9942 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/armbinder_v10.civitai.info" @@ -0,0 +1,252 @@ +{ + "id": 15315, + "modelId": 13000, + "name": "v.1.0", + "createdAt": "2023-02-25T16:59:55.672Z", + "updatedAt": "2023-02-25T17:00:25.645Z", + "trainedWords": [ + "armbinder", + "arms behind back", + "bound arms" + ], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": null, + "model": { + "name": "Armbinder", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "armbinder_v10.safetensors", + "id": 13140, + "sizeKB": 9337.96875, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-02-25T17:01:07.218Z", + "hashes": { + "AutoV1": "C7D60F10", + "AutoV2": "86C0EC35C3", + "SHA256": "86C0EC35C31C043660C9394FC7D5F56D1B42FD15790740F26A7CC7C94645D7E4", + "CRC32": "A63BC6FA", + "BLAKE3": "BADC48075CEB549D0C9F6572EAC8B9AB06654A487BF33D6D49F9B6256E4A0DE2" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/15315" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/163c547a-5fc3-40d2-7662-bd8425bddd00/width=450/151834.jpeg", + "nsfw": true, + "width": 720, + "height": 960, + "hash": "ULJa.g~q0d0Kt.Sjo#%3?baixZ%2t9Ri%3Iq", + "meta": { + "Size": "448x640", + "seed": 4148086988, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 25, + "prompt": "armbinder, arms behind back, bound arms, standing, white dress, outdoors, cowboy shot, navel, long hair, frills, frilled dress, midriff,", + "sampler": "Euler a", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + } + ], + "Model hash": "0873291ac5", + "Hires resize": "720x960", + "AddNet Enabled": "True", + "AddNet Model 2": "armbinder(a6feb443f0e1)", + "Hires upscaler": "lollypop", + "negativePrompt": "(worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, multiple view, Reference sheet,", + "AddNet Module 2": "LoRA", + "AddNet Weight A 2": "1", + "AddNet Weight B 2": "1", + "Denoising strength": "0.35" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8998814b-bd2a-4c5b-61b3-7a996dfefd00/width=450/151833.jpeg", + "nsfw": false, + "width": 720, + "height": 960, + "hash": "UOHeg]-:009Z~oj[bX%M_NxvacV@%Nog%2WA", + "meta": { + "Size": "448x640", + "seed": 330774729, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 25, + "prompt": "armbinder, arms behind back, bound arms, standing, white dress, outdoors, cowboy shot, from side, long hair, frills, frilled dress,", + "sampler": "Euler a", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + } + ], + "Model hash": "0873291ac5", + "Hires resize": "720x960", + "AddNet Enabled": "True", + "AddNet Model 2": "armbinder(a6feb443f0e1)", + "Hires upscaler": "lollypop", + "negativePrompt": "(worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, multiple view, Reference sheet,", + "AddNet Module 2": "LoRA", + "AddNet Weight A 2": "1", + "AddNet Weight B 2": "1", + "Denoising strength": "0.35" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/bed8ee50-5900-4d7c-741b-365980689200/width=450/151832.jpeg", + "nsfw": true, + "width": 720, + "height": 960, + "hash": "UPJ*L}~q0y9u.T%h%MxvtSbJWYxvE3ayRlE1", + "meta": { + "Size": "448x640", + "seed": 969297859, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 25, + "prompt": "armbinder, arms behind back, bound arms, standing, white dress, outdoors, cowboy shot, navel, long hair, lace trim, babydoll, see-through, medium breasts, underwear, frills,", + "sampler": "Euler a", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + }, + { + "hash": "b8d8f79b3a17", + "name": "negligee", + "type": "lora", + "weight": null + }, + { + "hash": "a6feb443f0e1", + "name": "armbinder", + "type": "lora", + "weight": null + } + ], + "Model hash": "0873291ac5", + "Hires resize": "720x960", + "AddNet Enabled": "True", + "AddNet Model 1": "negligee(b8d8f79b3a17)", + "AddNet Model 2": "armbinder(a6feb443f0e1)", + "Hires upscaler": "lollypop", + "negativePrompt": "(worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, multiple view, Reference sheet,", + "AddNet Module 1": "LoRA", + "AddNet Module 2": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight A 2": "1", + "AddNet Weight B 1": "1", + "AddNet Weight B 2": "1", + "Denoising strength": "0.35" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b7c61b5a-13ca-489f-49e2-2608b6a0fd00/width=450/151831.jpeg", + "nsfw": false, + "width": 720, + "height": 960, + "hash": "UXHB_E?wEyE1x^ItR*t7r=MyM{R-NxRis8M{", + "meta": { + "Size": "448x640", + "seed": 3613163633, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 25, + "prompt": "armbinder, arms behind back, bound arms, standing, white dress, outdoors, cowboy shot, from behind, long hair, frills, frilled dress,", + "sampler": "Euler a", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + } + ], + "Model hash": "0873291ac5", + "Hires resize": "720x960", + "AddNet Enabled": "True", + "AddNet Model 2": "armbinder(a6feb443f0e1)", + "Hires upscaler": "lollypop", + "negativePrompt": "(worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, multiple view, Reference sheet,", + "AddNet Module 2": "LoRA", + "AddNet Weight A 2": "1", + "AddNet Weight B 2": "1", + "Denoising strength": "0.35" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/db4170ea-70ac-4cb7-82b9-03e2236c4b00/width=450/151830.jpeg", + "nsfw": true, + "width": 720, + "height": 960, + "hash": "UOI#V_~q0dIoX.V{WoT0?b%Mt8NItlNHR%xb", + "meta": { + "Size": "448x640", + "seed": 1214154586, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 25, + "prompt": "armbinder, arms behind back, bound arms, standing, white dress, outdoors, cowboy shot, navel, long hair, lace trim, babydoll, see-through, medium breasts, underwear, ((frills)),", + "sampler": "Euler a", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + }, + { + "hash": "b8d8f79b3a17", + "name": "negligee", + "type": "lora", + "weight": null + }, + { + "hash": "a6feb443f0e1", + "name": "armbinder", + "type": "lora", + "weight": null + } + ], + "Model hash": "0873291ac5", + "Hires resize": "720x960", + "AddNet Enabled": "True", + "AddNet Model 1": "negligee(b8d8f79b3a17)", + "AddNet Model 2": "armbinder(a6feb443f0e1)", + "Hires upscaler": "lollypop", + "negativePrompt": "(worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, multiple view, Reference sheet,", + "AddNet Module 1": "LoRA", + "AddNet Module 2": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight A 2": "1", + "AddNet Weight B 1": "1", + "AddNet Weight B 2": "1", + "Denoising strength": "0.35" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/15315" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/armbinder_v10.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/armbinder_v10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..4e2541b2713833cb618e5d5a85cd86bc746872ef Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/armbinder_v10.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/armbinder_v10.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/armbinder_v10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..92a64561c2c61f044f68fa935f00348460153cea --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/armbinder_v10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:86c0ec35c31c043660c9394fc7d5f56d1b42fd15790740f26a7cc7c94645d7e4 +size 9562080 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/backArmShibari_20230228.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/backArmShibari_20230228.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..840e8079fe42ba6c8435cd23be4ea0a373e275e4 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/backArmShibari_20230228.civitai.info" @@ -0,0 +1,80 @@ +{ + "id": 16702, + "modelId": 14194, + "name": "20230228", + "createdAt": "2023-02-28T14:49:26.422Z", + "updatedAt": "2023-03-06T13:44:06.549Z", + "trainedWords": [ + "back_arm_shibari" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "model": { + "name": "back_arm_shibari", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "backArmShibari_20230228.safetensors", + "id": 14079, + "sizeKB": 147574.9599609375, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-02-28T14:51:16.741Z", + "hashes": { + "AutoV1": "25E7B065", + "AutoV2": "B304A7641B", + "SHA256": "B304A7641BBEF96E5B86B2EE694AF37AC1FF78385E6560F56C8EA1A714C13465", + "CRC32": "F78116F8", + "BLAKE3": "526A804A33D9735FD607EE74E51E9FE137D19C6FD51F333DE61E2142139A1FC4" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/16702" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4fb40c45-9761-4dae-b093-47f766b32700/width=450/168465.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "U9J7%a-n00IV~T%M^+xuXnf*={n$00ozIU%2", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4d394c68-b6c9-4546-e3ea-46ada7d73500/width=450/168468.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UBFr6T~V000KJ5xus.NG02Rk?HW:4.Rj%M-p", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7192bd13-a614-46e5-7aa7-ded08afbee00/width=450/168467.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "ULIXK#~V9YIUnz-p^*j=xuM{e.%2IUj[s;xt", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/fb9fa9c1-6438-4642-427e-fe296200bc00/width=450/168466.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "URKA.]~WRibb-.t7%3xuozbGn%s;IUM{D%Rj", + "meta": null + } + ], + "downloadUrl": "https://civitai.com/api/download/models/16702" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/backArmShibari_20230228.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/backArmShibari_20230228.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..0b816044f2c322a993a5eedb71bd16d2277c5eb3 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/backArmShibari_20230228.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/backArmShibari_20230228.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/backArmShibari_20230228.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..5c2444c397b26dd55443aff0fc85497b55bf8d38 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/backArmShibari_20230228.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:b304a7641bbef96e5b86b2ee694af37ac1ff78385e6560f56c8ea1a714c13465 +size 151116759 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bdsmTiedToBedLora_v2.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bdsmTiedToBedLora_v2.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..0f021aeb96f4353f493c33f9312ed155153b1d23 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bdsmTiedToBedLora_v2.civitai.info" @@ -0,0 +1,247 @@ +{ + "id": 43171, + "modelId": 32810, + "name": "v2", + "createdAt": "2023-04-12T00:11:36.958Z", + "updatedAt": "2023-04-12T01:27:09.292Z", + "trainedWords": [ + "tiedtobed", + "face up", + "face down", + "frontal", + "at angle", + "close up", + "rope", + "black rope", + "white rope" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

  • Improved dataset

  • Improved tags

", + "stats": { + "downloadCount": 2026, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "BDSM - Tied to bed LoRA", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "bdsmTiedToBedLora_v2.safetensors", + "id": 32934, + "sizeKB": 147570.033203125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-12T00:16:09.241Z", + "hashes": { + "AutoV1": "60885E20", + "AutoV2": "7EF10731A5", + "SHA256": "7EF10731A5A95999C247C880DF2B26FA8D15B4DC46E2B8064065A3F8839160D0", + "CRC32": "3828BCF7", + "BLAKE3": "E3B74BC0D92D00AF784206BA72D46848DBFE1BCB89860749A68B06A4450E9320" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/43171" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/bd38f90d-8ec0-4cea-ada7-f753226dbf00/width=450/473331.jpeg", + "nsfw": true, + "width": 640, + "height": 640, + "hash": "UKGHkt~U%Lxt?Ft7ERRmozkDbc-o^$%L-noz", + "meta": { + "Size": "640x640", + "seed": 1455933148, + "steps": 30, + "prompt": " tiedtobed face up black rope (close up:1.2) photo of beautiful black braids big breasts woman supermodel on golden bed in modern apartment, perfect lighting, incredible detail, best quality, masterpiece, highres, intricate,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [], + "Model hash": "f93e6a50ac", + "negativePrompt": "(poorly drawn face:1.2), worst quality, low quality, lowres, ugly, amateur, panties, underwear, clothes," + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d9ac6e05-6c35-46c3-d860-3b88ec6bbc00/width=450/473337.jpeg", + "nsfw": true, + "width": 640, + "height": 640, + "hash": "UKKKZq~qEgxt4m%2X8M{InRPR4oe%Koz?H%M", + "meta": { + "Size": "640x640", + "seed": 3682844337, + "steps": 30, + "prompt": " tiedtobed front face down rope close up photo of beautiful woman on intricate pattern black bed in room with plants, perfect lighting, incredible detail, best quality, masterpiece, highres, intricate,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [], + "Model hash": "f93e6a50ac", + "negativePrompt": "(poorly drawn face:1.2), worst quality, low quality, lowres, ugly, amateur," + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/180dab1a-14a5-4db9-8852-4086806cd600/width=450/473326.jpeg", + "nsfw": true, + "width": 640, + "height": 640, + "hash": "UQGkwO9Z58%2_NRjsSj[_2WBnOWrt6t7E1t7", + "meta": { + "Size": "640x640", + "seed": 1940571628, + "steps": 30, + "prompt": " tiedtobed frontal face down black rope close up of perfect ass photo of beautiful redhead woman on intricate pattern green bed in modern apartment, perfect lighting, incredible detail, best quality, masterpiece, highres, intricate,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [], + "Model hash": "f93e6a50ac", + "negativePrompt": "(poorly drawn face:1.2), worst quality, low quality, lowres, ugly, amateur," + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ba9c9e1b-640a-4a03-5e24-28207dace600/width=450/473332.jpeg", + "nsfw": true, + "width": 768, + "height": 768, + "hash": "U9F~8R~W0e-;4.kBRiIo00Io~BVs?cof_2-p", + "meta": { + "Size": "768x768", + "seed": 64802207, + "steps": 30, + "prompt": " tiedtobed frontal face up black rope close up of pussy photo of beautiful asian woman on intricate pattern black bed in modern apartment with plants, perfect lighting, incredible detail, best quality, masterpiece, highres, intricate,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [], + "Model hash": "f93e6a50ac", + "negativePrompt": "(poorly drawn face:1.3), worst quality, low quality, lowres, ugly, amateur," + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/15bd7393-752d-475d-51bc-bfe83b183500/width=450/473327.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UGJ*I?_N?a%g8^xu_1IU9ED%m*t7^*kW_3%M", + "meta": { + "Size": "512x512", + "seed": 595009704, + "steps": 30, + "prompt": " tiedtobed front face down rope photo of beautiful woman on black pattern bed, perfect lighting, incredible detail, best quality, masterpiece, highres, intricate, perfect face,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [], + "Model hash": "f93e6a50ac", + "Variation seed": "479946637", + "negativePrompt": "(poorly drawn face:1.2), worst quality, low quality, lowres, ugly, amateur,", + "Variation seed strength": "0.19" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d2d954d0-eb97-45de-0b8d-f57d7f6f1a00/width=450/473335.jpeg", + "nsfw": true, + "width": 768, + "height": 768, + "hash": "UALN3@%$LNRP00I;WT01004nVC%NWTM{%$Rk", + "meta": { + "Size": "768x768", + "seed": 3901037653, + "steps": 30, + "prompt": " tiedtobed frontal face up black rope close up of pussy photo of beautiful redhead woman with big breasts on intricate pattern white bed in modern apartment, perfect lighting, incredible detail, best quality, masterpiece, highres, intricate,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [], + "Model hash": "f93e6a50ac", + "negativePrompt": "(poorly drawn face:1.2), worst quality, low quality, lowres, ugly, amateur," + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d3b54c37-21d7-447d-0722-099f1658e200/width=450/473336.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UPHv@,^kt7xZ?]%MofN^PUOYo|s:-pofxGxa", + "meta": { + "Size": "512x512", + "seed": 595009704, + "steps": 30, + "prompt": " tiedtobed front face down rope photo of beautiful woman on red bed, perfect lighting, incredible detail, best quality, masterpiece, highres, intricate, perfect face,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [], + "Model hash": "f93e6a50ac", + "Variation seed": "2797097496", + "negativePrompt": "(poorly drawn face:1.2), worst quality, low quality, lowres, ugly, amateur", + "Variation seed strength": "0.19" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4c461c2a-08b8-47e6-d92d-77a82f9dae00/width=450/473330.jpeg", + "nsfw": true, + "width": 640, + "height": 640, + "hash": "U8HUII0017Ri5PWsnO^*00~q+Y0f0LoJ-;ja", + "meta": { + "Size": "640x640", + "seed": 1583563523, + "steps": 30, + "prompt": " tiedtobed face up black rope (close up:1.2) photo of beautiful blonde woman on intricate pattern black bed, perfect lighting, incredible detail, best quality, masterpiece, highres, intricate,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [], + "Model hash": "f93e6a50ac", + "negativePrompt": "(poorly drawn face:1.2), worst quality, low quality, lowres, ugly, amateur," + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ea691131-6b9d-49ff-b739-9e54298ac900/width=450/473329.jpeg", + "nsfw": true, + "width": 640, + "height": 640, + "hash": "UCJQ$a~q?vR*D$-:-;4.009E8w_MDi?a^*%M", + "meta": { + "Size": "640x640", + "seed": 3311398909, + "steps": 30, + "prompt": " tiedtobed front face down rope close up photo of beautiful woman on intricate pattern black bed, perfect lighting, incredible detail, best quality, masterpiece, highres, intricate,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [], + "Model hash": "f93e6a50ac", + "Variation seed": "3043887531", + "negativePrompt": "(poorly drawn face:1.2), worst quality, low quality, lowres, ugly, amateur,", + "Variation seed strength": "0.19" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f3e3549b-7927-42c4-631c-c837ce9a0e00/width=450/473333.jpeg", + "nsfw": true, + "width": 768, + "height": 768, + "hash": "URG%_k~W.Sxu$Ni^RPM{9FVsVsxawJxu%2%2", + "meta": { + "Size": "768x768", + "seed": 1433661627, + "steps": 30, + "prompt": " tiedtobed front black rope photo of beautiful woman on red bed, perfect lighting, incredible detail, best quality, masterpiece, highres, intricate, perfect face,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [], + "Model hash": "f93e6a50ac", + "negativePrompt": "(poorly drawn face:1.2), worst quality, low quality, lowres, ugly, amateur" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/43171" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bdsmTiedToBedLora_v2.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bdsmTiedToBedLora_v2.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..8535ebce7cf6c377fa7a520fb0b17b64459370ec Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bdsmTiedToBedLora_v2.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bdsmTiedToBedLora_v2.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bdsmTiedToBedLora_v2.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..71af867831410c062937387ffd5172d37e5ec35f --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bdsmTiedToBedLora_v2.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:7ef10731a5a95999c247c880df2b26fa8d15b4dc46e2b8064065a3f8839160d0 +size 151111714 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bdsm_v3.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bdsm_v3.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..fe38d6580b4b52e134742573fa521685aabf4968 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bdsm_v3.civitai.info" @@ -0,0 +1,278 @@ +{ + "id": 56789, + "modelId": 22428, + "name": "v3", + "createdAt": "2023-04-27T18:03:19.985Z", + "updatedAt": "2023-04-27T18:04:14.495Z", + "trainedWords": [ + "bdsm", + "bondage" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

bug fixed, v3 is lora not locon

nipple clamps is the new feature

Below are the trigger words suggested,

bondage, bdsm

blindfold, shibari, ball gag, nipple clamps

The suggested weight is 0.7 - 1

", + "stats": { + "downloadCount": 128, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "BDSM", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "bdsm_v3.safetensors", + "id": 40587, + "sizeKB": 36990.2314453125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-27T18:06:05.830Z", + "hashes": { + "AutoV1": "74B86D70", + "AutoV2": "F254738187", + "SHA256": "F25473818766AC8489D56343B0C0CDC9CB1C2928E3D33CB152F5E09C9678E3EE", + "CRC32": "994FB6A8", + "BLAKE3": "A766E6D99112D300C83A1A04252132BAAAD3E049C0C201180C9EE83ED32577F3" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/56789" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/976c1e42-15ad-443a-5652-0c2d46414d00/width=450/615739.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "U8HBYy0000s=In01~VRQsl^+xu00W=9Zad?G", + "meta": { + "Size": "512x512", + "seed": 1237359503, + "Model": "AbyssOrangeMix2_hard", + "steps": 20, + "hashes": { + "model": "0fc198c490" + }, + "prompt": "masterpiece, best quality, 1girl, bdsm, bondage, blindfold, shibari, ball gag, nipple clamps, suspension, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative, bad anatomy, bad hands, cropped, missing fingers, missing toes, too many toes, too many fingers, missing arms, long neck, Humpbacked, deformed, disfigured, poorly drawn face, distorted face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, floating limbs, disconnected limbs, malformed hands, out of focus, long body, monochrome, symbol, text, logo, door frame, window frame, mirror frame" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a9a59788-c746-46ec-b523-48b4d53ce000/width=450/615743.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UIGI1K~VIo%LSzE2R+%LE0%L?Hk9%1RjbHxa", + "meta": { + "Size": "512x512", + "seed": 669507285, + "Model": "AbyssOrangeMix2_hard", + "steps": 20, + "hashes": { + "model": "0fc198c490" + }, + "prompt": "masterpiece, best quality, 1girl, bdsm, bondage, blindfold, shibari, ball gag, nipple clamps, suspension, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative, bad anatomy, bad hands, cropped, missing fingers, missing toes, too many toes, too many fingers, missing arms, long neck, Humpbacked, deformed, disfigured, poorly drawn face, distorted face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, floating limbs, disconnected limbs, malformed hands, out of focus, long body, monochrome, symbol, text, logo, door frame, window frame, mirror frame" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e552e5fd-1fa5-4811-78c9-e278d0180400/width=450/615744.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "U9G[NL~p00-V~p%LxZIo00Io-:?GMxxao|tR", + "meta": { + "Size": "512x512", + "seed": 669507286, + "Model": "AbyssOrangeMix2_hard", + "steps": 20, + "hashes": { + "model": "0fc198c490" + }, + "prompt": "masterpiece, best quality, 1girl, bdsm, bondage, blindfold, shibari, ball gag, nipple clamps, suspension, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative, bad anatomy, bad hands, cropped, missing fingers, missing toes, too many toes, too many fingers, missing arms, long neck, Humpbacked, deformed, disfigured, poorly drawn face, distorted face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, floating limbs, disconnected limbs, malformed hands, out of focus, long body, monochrome, symbol, text, logo, door frame, window frame, mirror frame" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/82f62653-c9c3-438d-ccdc-13d42d320500/width=450/615745.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "U8F}_}_2009F~VRjbX?Hi_^+t70K-;xtE1V@", + "meta": { + "Size": "512x512", + "seed": 1237359502, + "Model": "AbyssOrangeMix2_hard", + "steps": 20, + "hashes": { + "model": "0fc198c490" + }, + "prompt": "masterpiece, best quality, 1girl, bdsm, bondage, blindfold, shibari, ball gag, nipple clamps, suspension, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative, bad anatomy, bad hands, cropped, missing fingers, missing toes, too many toes, too many fingers, missing arms, long neck, Humpbacked, deformed, disfigured, poorly drawn face, distorted face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, floating limbs, disconnected limbs, malformed hands, out of focus, long body, monochrome, symbol, text, logo, door frame, window frame, mirror frame" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/fb6c9d17-2e23-4f9d-d01e-09e92c96a200/width=450/615742.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UBF#?v0100oz~VoNxG4.NFM|%2t7-:E1Rj?H", + "meta": { + "Size": "512x512", + "seed": 3628776025, + "Model": "AbyssOrangeMix2_hard", + "steps": 20, + "hashes": { + "model": "0fc198c490" + }, + "prompt": "masterpiece, best quality, 1girl, bdsm, bondage, blindfold, shibari, ball gag, nipple clamps, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative, bad anatomy, bad hands, cropped, missing fingers, missing toes, too many toes, too many fingers, missing arms, long neck, Humpbacked, deformed, disfigured, poorly drawn face, distorted face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, floating limbs, disconnected limbs, malformed hands, out of focus, long body, monochrome, symbol, text, logo, door frame, window frame, mirror frame" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5ccfe89c-52ac-45dd-f72c-d086e1507f00/width=450/615740.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UEGuE?0000~WSg9Z^*Rk-pRjt6Ioj[RkWUof", + "meta": { + "Size": "512x512", + "seed": 3628776026, + "Model": "AbyssOrangeMix2_hard", + "steps": 20, + "hashes": { + "model": "0fc198c490" + }, + "prompt": "masterpiece, best quality, 1girl, bdsm, bondage, blindfold, shibari, ball gag, nipple clamps, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative, bad anatomy, bad hands, cropped, missing fingers, missing toes, too many toes, too many fingers, missing arms, long neck, Humpbacked, deformed, disfigured, poorly drawn face, distorted face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, floating limbs, disconnected limbs, malformed hands, out of focus, long body, monochrome, symbol, text, logo, door frame, window frame, mirror frame" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c21cd883-dd8d-4457-a36b-4e26bc03ad00/width=450/615741.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UHF#{=010e%M~V9ZkCoMIUa#%2Io?GM{NGt7", + "meta": { + "Size": "512x512", + "seed": 910949528, + "Model": "AbyssOrangeMix2_hard", + "steps": 20, + "hashes": { + "model": "0fc198c490" + }, + "prompt": "masterpiece, best quality, 1girl, bdsm, bondage, blindfold, shibari, ball gag, nipple clamps, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative, bad anatomy, bad hands, cropped, missing fingers, missing toes, too many toes, too many fingers, missing arms, long neck, Humpbacked, deformed, disfigured, poorly drawn face, distorted face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, floating limbs, disconnected limbs, malformed hands, out of focus, long body, monochrome, symbol, text, logo, door frame, window frame, mirror frame" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c7982057-e15e-42db-072b-588403928f00/width=450/615746.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UIGuL6-:0K%LIo~V?aE1bYE1xa?HV@WBWVt7", + "meta": { + "Size": "512x512", + "seed": 910949527, + "Model": "AbyssOrangeMix2_hard", + "steps": 20, + "hashes": { + "model": "0fc198c490" + }, + "prompt": "masterpiece, best quality, 1girl, bdsm, bondage, blindfold, shibari, ball gag, nipple clamps, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "(worst quality, low quality:1.4), EasyNegative, bad anatomy, bad hands, cropped, missing fingers, missing toes, too many toes, too many fingers, missing arms, long neck, Humpbacked, deformed, disfigured, poorly drawn face, distorted face, mutation, mutated, extra limb, ugly, poorly drawn hands, missing limb, floating limbs, disconnected limbs, malformed hands, out of focus, long body, monochrome, symbol, text, logo, door frame, window frame, mirror frame" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/56789" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bdsm_v3.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bdsm_v3.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..17bb38d1e7c42496946e685ca83eb7b0ac72ec6b Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bdsm_v3.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bdsm_v3.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bdsm_v3.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..40a18f44e3465e3bf0fa7323eac3f4d07f53ea6c --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bdsm_v3.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:f25473818766ac8489d56343b0c0cdc9cb1c2928e3d33cb152f5e09c9678e3ee +size 37877997 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bdtrue.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bdtrue.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..f141633fb67d8eda4b2bed440d521993f5ad475f --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bdtrue.civitai.info" @@ -0,0 +1,77 @@ +{ + "id": 74253, + "modelId": 69589, + "name": "v2.0", + "createdAt": "2023-05-18T17:34:51.395Z", + "updatedAt": "2023-05-18T17:46:36.317Z", + "trainedWords": [ + "bdsm,bondage, rope\uff0cshibari" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

nothing to say

", + "stats": { + "downloadCount": 239, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Bondage_Amine", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "bdtrue.safetensors", + "id": 51339, + "sizeKB": 36983.4111328125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-18T17:41:44.057Z", + "hashes": { + "AutoV1": "6C57972A", + "AutoV2": "FE1A85AE15", + "SHA256": "FE1A85AE15F806169285108EC30A8C1FD19202CE88BEDA2047B5379E50DA940D", + "CRC32": "8FC39CDD", + "BLAKE3": "CFC10A5B17B98AD4DD1C9F10B8496242B9203669BF9F6311825D6816522E27EF" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/74253" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/24a31f9b-10b2-443c-84ae-60ef1203f8d4/width=450/829923.jpeg", + "nsfw": "None", + "width": 569, + "height": 960, + "hash": "UEI;xCI@9F^+?wt8D%Io_3?aE1E1.SxaD*S3", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ad47dcb7-f2a3-49b4-bdea-e521ec1bc64b/width=450/830619.jpeg", + "nsfw": "X", + "width": 640, + "height": 1080, + "hash": "UEF=aZ=[F{9Z~VR%E1%2r=?bM{-:e,t7IUNG", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0d06c78a-1034-482a-9e96-5bd4a9d582cc/width=450/829805.jpeg", + "nsfw": "X", + "width": 569, + "height": 960, + "hash": "U9IEqtyFEdBp~qIpxZ%M008{t9-pi[-VIqkC", + "meta": null + } + ], + "downloadUrl": "https://civitai.com/api/download/models/74253" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bdtrue.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bdtrue.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..4679288564678e9e838400079de8fffa1aeb7bb3 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bdtrue.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bdtrue.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bdtrue.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..f5e127ae11a53735f3752e93855680f41a35ce82 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bdtrue.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:fe1a85ae15f806169285108ec30a8c1fd19202ce88beda2047b5379e50da940d +size 37871013 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/birthEgg_birthEgg20230216.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/birthEgg_birthEgg20230216.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..262ee000ec911c84cc91206ec8e00fa4cb16a1b3 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/birthEgg_birthEgg20230216.civitai.info" @@ -0,0 +1,64 @@ +{ + "id": 11154, + "modelId": 9401, + "name": "birth_egg 20230216", + "createdAt": "2023-02-16T11:05:57.275Z", + "updatedAt": "2023-03-06T14:27:37.491Z", + "trainedWords": [ + "birth_egg" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "model": { + "name": "birth_egg", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "birthEgg_birthEgg20230216.safetensors", + "id": 10429, + "sizeKB": 147580.3896484375, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-02-16T11:10:55.741Z", + "hashes": { + "AutoV1": "7C766A8C", + "AutoV2": "242F6AEEFD", + "SHA256": "242F6AEEFDDC86923EE63A40E7AEC4BCA251214B73B5E0A0ACA2D5D45827A7DE", + "CRC32": "229B3C6F", + "BLAKE3": "DB80EB349A44EAF47E414C8D36CB1A237D5008F2BD47F39B36FCE2FC9616959C" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/11154" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f51737c4-6490-4391-070e-13d732bbfa00/width=450/107464.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "U6I:%*0000o|pG4:yr^k8_o|IBD%~B9ZAaEL", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e75d29e5-7ef0-4e82-cc96-ae5354003000/width=450/107465.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UCKvgo%N01#W9FJ.AXoL0xO?4.IU~WR5%3s:", + "meta": null + } + ], + "downloadUrl": "https://civitai.com/api/download/models/11154" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/birthEgg_birthEgg20230216.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/birthEgg_birthEgg20230216.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..c6fc161086eb779a0071f0b9cb97c10f73bf1fb2 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/birthEgg_birthEgg20230216.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/birthEgg_birthEgg20230216.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/birthEgg_birthEgg20230216.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..64aa8df97a10c8cd96a30612010f3cf76a0d04df --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/birthEgg_birthEgg20230216.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:242f6aeefddc86923ee63a40e7aec4bca251214b73b5e0a0aca2d5d45827a7de +size 151122319 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/birthMonster_birthMonster20230216.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/birthMonster_birthMonster20230216.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..44c34a181ad34dfbac96756182ea3a61577fd4de --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/birthMonster_birthMonster20230216.civitai.info" @@ -0,0 +1,64 @@ +{ + "id": 11156, + "modelId": 9403, + "name": "birth_monster 20230216", + "createdAt": "2023-02-16T11:07:58.858Z", + "updatedAt": "2023-03-06T14:29:17.445Z", + "trainedWords": [ + "birth_monster" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "model": { + "name": "birth_monster", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "birthMonster_birthMonster20230216.safetensors", + "id": 10432, + "sizeKB": 147571.6103515625, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-02-16T11:11:00.305Z", + "hashes": { + "AutoV1": "76475C5E", + "AutoV2": "AA6CAB05D1", + "SHA256": "AA6CAB05D158D62C6F42C80CFE90EECD51CA0CC10D8A96D0F8D23F648CF9A4A7", + "CRC32": "E768E300", + "BLAKE3": "0F76A1F748489D0A082DAD91663B63902029C86E42B46C6A45A2B26BB2356138" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/11156" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4d4dca8e-3df7-403f-c6c1-ca96f4d46a00/width=450/107475.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "U7Gtsprs00^k9tV[-C%200oz~W9ZwI%MNcD%", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/da23eb79-79a1-47fa-32fd-598977da2800/width=450/107476.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UIINw19G9Z~B-o9ZVt%Ls,S%fks,ivxEX8NG", + "meta": null + } + ], + "downloadUrl": "https://civitai.com/api/download/models/11156" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/birthMonster_birthMonster20230216.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/birthMonster_birthMonster20230216.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..22059d61ae86c7364cf7809989ec9a59e06773c8 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/birthMonster_birthMonster20230216.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/birthMonster_birthMonster20230216.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/birthMonster_birthMonster20230216.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..80d8599bdac5e3c01849c0e46fe95b8999fb590e --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/birthMonster_birthMonster20230216.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:aa6cab05d158d62c6f42c80cfe90eecd51ca0cc10d8a96d0f8d23f648cf9a4a7 +size 151113329 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bobsout1-000010.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bobsout1-000010.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..c15a8475f68606c9661cc8b4a8bf18eea7af6452 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bobsout1-000010.civitai.info" @@ -0,0 +1,170 @@ +{ + "id": 65126, + "modelId": 60645, + "name": "v1.0", + "createdAt": "2023-05-07T20:23:29.765Z", + "updatedAt": "2023-05-07T20:25:06.407Z", + "trainedWords": [ + "nipples" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 393, + "ratingCount": 3, + "rating": 5 + }, + "model": { + "name": "Clothes Between Breasts | Clothing Lora 853", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "bobsout1-000010.safetensors", + "id": 45703, + "sizeKB": 9409.5498046875, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-07T20:25:50.013Z", + "hashes": { + "AutoV1": "9852565A", + "AutoV2": "C066FDEB57", + "SHA256": "C066FDEB574595E2D9C51D17A352ADCCD9D8B78A57A4FDB633DBC47F1215FA4B", + "CRC32": "81B44A5C", + "BLAKE3": "A047693AB9D997A288ECCFC5578E347EB26DBE84CD51936C03238801EE57AEF3" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/65126" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/60c5b43e-0194-49b7-a3c4-4835a9801262/width=450/720713.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1408, + "hash": "UMIX:P^*pFV@?wSdS#IUEnt7xboJ%OWZxbof", + "meta": { + "ENSD": "31337", + "Size": "512x704", + "seed": 430035496, + "Model": "AbyssOrangeMix2_hard", + "steps": 28, + "hashes": { + "model": "0fc198c490" + }, + "prompt": ", , ganyudef, nipples, upper body, smile, blush, outdoors, day, simple background, blue sky, sky, temple, looking at viewer, stairs, mountain, moody lighting, facing viewer,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "Hires upscale": "2", + "Hires upscaler": "4x_foolhardy_Remacri", + "negativePrompt": "EasyNegative, censored, multiple views, panels, bar censor, censored, text, commentary, english text, comic, blurry, disembodied limb,", + "Denoising strength": "0.53" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3d4bbbc1-a8cf-4b44-b8c9-1bad5bed0160/width=450/720714.jpeg", + "nsfw": "X", + "width": 4096, + "height": 1787, + "hash": "UvLX3=ozf+t6_Na}WCWB%gj[jtoM?HoKWUof", + "meta": { + "ENSD": "31337", + "Size": "512x704", + "seed": 430035496, + "Model": "AbyssOrangeMix2_hard", + "steps": 28, + "Script": "X/Y/Z plot", + "X Type": "Prompt S/R", + "hashes": { + "model": "0fc198c490" + }, + "prompt": ", , ganyudef, nipples, upper body, smile, blush, outdoors, day, simple background, blue sky, sky, temple, looking at viewer, stairs, mountain, moody lighting, facing viewer,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "Hires upscale": "2", + "calli1-000007": "1.0>, callisleepwear\\\"", + "kiara1-000008": "1.0>, kiarafancy\\\"\"", + "mumei1-000006": "1.0>, mumeidef\\\"", + "Hires upscaler": "4x_foolhardy_Remacri", + "negativePrompt": "EasyNegative, censored, multiple views, panels, bar censor, censored, text, commentary, english text, comic, blurry, disembodied limb,", + "Denoising strength": "0.53", + "ganyu2ep10_0.85dim32": "1>, ganyudef\\\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3f952673-914c-4ac8-8eca-8e2513489d2c/width=450/720715.jpeg", + "nsfw": "X", + "width": 5504, + "height": 2303, + "hash": "UMJkM~_3_3^+_4jYaybF?cWARjWB_4jYf5WU", + "meta": { + "ENSD": "31337", + "Size": "512x704", + "seed": 831170036, + "Model": "AbyssOrangeMix2_hard", + "steps": 28, + "Script": "X/Y/Z plot", + "X Type": "Prompt S/R", + "Y Type": "Seed", + "hashes": { + "model": "0fc198c490" + }, + "prompt": ", , hax1, nipples, upper body, smile, blush, outdoors, day, simple background, blue sky, sky, temple, looking at viewer, stairs, mountain, moody lighting, facing viewer,", + "sampler": "DPM++ 2M Karras", + "Y Values": "\"-1,-1,-1\"", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "bronya-000019": "1>, hax1\\\"", + "calli1-000007": "1.0>, callisleepwear\\\"", + "kiara1-000008": "1.0>, kiarafancy\\\"", + "koyori-000015": "1>, def1\\\"", + "mumei1-000006": "1.0>, mumeidef\\\"", + "nilou1-000008": "1>, niloudef\\\"\"", + "Fixed Y Values": "\"831170036, 1107890919, 304490031\"", + "keqing1-000009": "1>, keqingdef\\\"", + "negativePrompt": "EasyNegative, censored, multiple views, panels, bar censor, censored, text, commentary, english text, comic, blurry, disembodied limb,", + "highelf1-000014": "1>, def1\\\"", + "yaemiko1-000008": "1>, yaemikodef\\\"", + "ganyu2ep10_0.85dim32": "1>, ganyudef\\\"" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/65126" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bobsout1-000010.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bobsout1-000010.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..aaa3e90521b9c57b8f3e9139871b9cf7b1c5a15c Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bobsout1-000010.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bobsout1-000010.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bobsout1-000010.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..1578587f62799855437c1b9753e169ed595c7097 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bobsout1-000010.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:c066fdeb574595e2d9c51d17a352adccd9d8b78a57a4fdb633dbc47f1215fa4b +size 9635379 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bondage-v11-p20.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bondage-v11-p20.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..7a73c08904afe207367888c58754f90d211cc620 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bondage-v11-p20.civitai.info" @@ -0,0 +1,415 @@ +{ + "id": 95338, + "modelId": 89556, + "name": "v1.0", + "createdAt": "2023-06-13T17:49:29.573Z", + "updatedAt": "2023-06-13T17:55:37.566Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 320, + "ratingCount": 1, + "rating": 5 + }, + "model": { + "name": "Bondage-v11 LyCORIS", + "type": "LoCon", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "example images.zip", + "id": 66079, + "sizeKB": 54637.515625, + "type": "Training Data", + "metadata": { + "fp": null, + "size": null, + "format": "Other" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-13T18:16:17.156Z", + "hashes": { + "AutoV1": "A1041AE2", + "AutoV2": "95421EA780", + "SHA256": "95421EA7807B3E63973CA6ECE593491CBC8A12D2E9EAB3CF0DC30FADB63CC611", + "CRC32": "7F1B486C", + "BLAKE3": "99DCD9FAA277D5FA69078B484FCDA5177B0EAD63EDB5B57E6C6297A264D8B856" + }, + "primary": false, + "downloadUrl": "https://civitai.com/api/download/models/95338?type=Training%20Data" + }, + { + "name": "bondage-v11-p20.safetensors", + "id": 66069, + "sizeKB": 1156578.173828125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-13T17:56:45.651Z", + "hashes": { + "AutoV1": "7E6BB249", + "AutoV2": "0974F81FA0", + "SHA256": "0974F81FA043052E1C07A2856A6AB42F5CCE69EEC2ACC82B814372A4809D06F0", + "CRC32": "1D6398F0", + "BLAKE3": "D1D1654A63362E9D25353B2E3598D17787303C83A49BF79B9A3ACA859754BFB0" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/95338" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a44f59ae-2541-408e-a017-1f8c6c8682db/width=450/1133170.jpeg", + "nsfw": "X", + "width": 960, + "height": 1440, + "hash": "UJE25#%1nh-o~Ak9xY$*r;-U-Unirq=xoLIo", + "meta": { + "ENSD": "31337", + "Size": "640x960", + "seed": 4138505081, + "Model": "dreamshaper_6BakedVae", + "steps": 15, + "hashes": { + "model": "b76cc78ad9" + }, + "prompt": "front full brunette dress pantyhose heels brastrap lace otm classicdamsel hbae sitting rupperarm rupperchest rlowerchest rwaist rknees rankles rthighs chair blindfold, cleavegag, coloredrope damselindistress , Cottonwood,Endangered redwood Cyberpunk Rarefied,Isolated aesthetic", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 4.5, + "resources": [ + { + "hash": "b76cc78ad9", + "name": "dreamshaper_6BakedVae", + "type": "model" + } + ], + "Model hash": "b76cc78ad9", + "Hires upscale": "1.5", + "Hires upscaler": "Latent", + "Variation seed": "3469255836", + "negativePrompt": "sketch, monochrome, ugly, blurry, boring, cropped, child, worst, drawing", + "Denoising strength": "0.6", + "Variation seed strength": "0.1" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f45eeca8-2f87-4922-88f7-da0b4394e897/width=450/1133172.jpeg", + "nsfw": "X", + "width": 960, + "height": 1440, + "hash": "UDJZ[3Dh1I_2^*~W%1x[McE,}?xH0iv|5St6", + "meta": { + "ENSD": "31337", + "Size": "640x960", + "seed": 3328199828, + "Model": "breakdomainanime_A0440", + "steps": 15, + "hashes": { + "model": "f1c731fd51" + }, + "prompt": "naked woman side profile full kneeling boxtie rope tied breasts nipples redhead submissive , Pear,Hemlock Interstellar Classic grandiose", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 6.5, + "resources": [ + { + "hash": "f1c731fd51", + "name": "breakdomainanime_A0440", + "type": "model" + } + ], + "Model hash": "f1c731fd51", + "Hires upscale": "1.5", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "sketch, monochrome, ugly, blurry, boring, cropped, child, worst, drawing", + "Denoising strength": "0.35" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d1e75199-cbca-42b9-9b6c-08377905a5ba/width=450/1133171.jpeg", + "nsfw": "X", + "width": 1536, + "height": 1536, + "hash": "U17AuYInCmMw~qWV_3RP0gog}@W=0Kr=xDR+", + "meta": { + "ENSD": "31337", + "Size": "768x768", + "seed": 129500181, + "Model": "edgeOfRealism_eorV20Fp16BakedVAE", + "steps": 15, + "hashes": { + "model": "7f6146b8a9" + }, + "prompt": "ebony black naked woman bound between two poles spread legs vagina nipples face afraid [blonde:brunette:0.2] barn , Elder Techy Comfortable,Monochromatic cinematic,aesthetic ", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 3, + "resources": [ + { + "name": "LowRA", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "7f6146b8a9", + "name": "edgeOfRealism_eorV20Fp16BakedVAE", + "type": "model" + } + ], + "Model hash": "7f6146b8a9", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "Variation seed": "1904620082", + "negativePrompt": "sketch, monochrome, ugly, blurry, boring, cropped, child, worst, drawing", + "Denoising strength": "0.5", + "Variation seed strength": "0.1" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/76b96898-552b-4ecb-8100-4d1a9d173c7a/width=450/1133168.jpeg", + "nsfw": "X", + "width": 960, + "height": 1440, + "hash": "UJJjrG009X~VI9^jI]bZ4nkWE4VsX.ofMwI;", + "meta": { + "ENSD": "31337", + "Size": "640x960", + "seed": 4138505089, + "Model": "dreamshaper_6BakedVae", + "steps": 15, + "hashes": { + "model": "b76cc78ad9" + }, + "prompt": "front medium kneeling blonde dress tapegag classicdamsel sitting floor (wol rope tied uwe) cleavage downblouse damselindistress sad , Gigantic cinematic,grandiose", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 4.5, + "resources": [ + { + "hash": "b76cc78ad9", + "name": "dreamshaper_6BakedVae", + "type": "model" + } + ], + "Model hash": "b76cc78ad9", + "Hires upscale": "1.5", + "Hires upscaler": "Latent", + "negativePrompt": "hands, sketch, monochrome, ugly, blurry, boring, cropped, child, worst, drawing", + "Denoising strength": "0.6" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/38591b0c-dc03-462e-a681-03c3248e8135/width=450/1133169.jpeg", + "nsfw": "X", + "width": 960, + "height": 1440, + "hash": "UIIE6CjX8J?G7$IUp0xC00iwvzM{8wtRR4ay", + "meta": { + "ENSD": "31337", + "Size": "640x960", + "seed": 4138505089, + "Model": "breakdomainanime_A0440", + "steps": 15, + "hashes": { + "model": "f1c731fd51" + }, + "prompt": "shibari crotchrope bondage front medium breasts nipples thighs blindfold camel toe boxtie standing lips brunette , Bristlecone pine", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 4, + "resources": [ + { + "hash": "f1c731fd51", + "name": "breakdomainanime_A0440", + "type": "model" + } + ], + "Model hash": "f1c731fd51", + "Hires upscale": "1.5", + "Hires upscaler": "Latent", + "negativePrompt": "sketch, monochrome, ugly, blurry, boring, cropped, child, worst, drawing", + "Denoising strength": "0.6" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f38b3b23-acbc-41ea-999c-780ff30b63eb/width=450/1133174.jpeg", + "nsfw": "X", + "width": 960, + "height": 1440, + "hash": "U4B.lw01G@014U-:0L^*0#Rk}@xG9]?aMxoz", + "meta": { + "ENSD": "31337", + "Size": "640x960", + "seed": 1612433899, + "Model": "dreamshaper_6BakedVae", + "steps": 15, + "hashes": { + "model": "b76cc78ad9" + }, + "prompt": "metal collar (ballgag:1.1), ebony woman front dark hair breasts corset, Techno-organic Luxurious masterpiece,aesthetic", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 3.5, + "resources": [ + { + "hash": "b76cc78ad9", + "name": "dreamshaper_6BakedVae", + "type": "model" + } + ], + "Model hash": "b76cc78ad9", + "Hires upscale": "1.5", + "Hires upscaler": "Latent", + "negativePrompt": "sketch, monochrome, ugly, blurry, boring, cropped, child, worst, drawing", + "Denoising strength": "0.6" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/11a14251-7641-4e63-86fd-cf3caae89c5e/width=450/1133167.jpeg", + "nsfw": "X", + "width": 960, + "height": 1440, + "hash": "URGl0C-;4nXncu%gIUX9%hNft6xaXAt8Rkfh", + "meta": { + "ENSD": "31337", + "Size": "640x960", + "seed": 2453807634, + "Model": "dreamshaper_6BakedVae", + "steps": 15, + "hashes": { + "model": "b76cc78ad9" + }, + "prompt": "green rope wol tied side profile naked woman kneeling breasts blonde hair , Lime Impressive Ian McQue masterpiece", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 4.5, + "resources": [ + { + "hash": "b76cc78ad9", + "name": "dreamshaper_6BakedVae", + "type": "model" + } + ], + "Model hash": "b76cc78ad9", + "Hires upscale": "1.5", + "Hires upscaler": "4x-UltraMix_Balanced", + "Variation seed": "1744719571", + "negativePrompt": "sketch, monochrome, ugly, blurry, boring, cropped, child, worst, drawing", + "Denoising strength": "0.4", + "Variation seed strength": "0.1" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/43b7d7d4-656d-4ff4-a7cd-e81a58068a81/width=450/1133185.jpeg", + "nsfw": "X", + "width": 1536, + "height": 1536, + "hash": "UDGt?E354o7dDOG@W[$~C61H|x-V^P#lBA#S", + "meta": { + "ENSD": "31337", + "Size": "768x768", + "seed": 704386939, + "Model": "dreamshaper_6BakedVae", + "steps": 15, + "hashes": { + "model": "b76cc78ad9" + }, + "prompt": "hogtie front full rope tied bondage nipples breasts ballgag harness pantyhose laying on floor shoulder , Fir Futurama epic ", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 4, + "resources": [ + { + "name": "LowRA", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "b76cc78ad9", + "name": "dreamshaper_6BakedVae", + "type": "model" + } + ], + "Model hash": "b76cc78ad9", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraMix_Balanced", + "Variation seed": "4231002009", + "negativePrompt": "sketch, monochrome, ugly, blurry, boring, cropped, child, worst, drawing", + "Denoising strength": "0.5", + "Variation seed strength": "0.02" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/172875a5-926f-45e4-b8ea-b65a118c9f4d/width=450/1133173.jpeg", + "nsfw": "X", + "width": 960, + "height": 1440, + "hash": "UPGl3H4mE,RjyZ9F%2s:%2RiM{%MibM|I;xu", + "meta": { + "ENSD": "31337", + "Size": "640x960", + "seed": 4046460794, + "Model": "edgeOfRealism_eorV20Fp16BakedVAE", + "steps": 15, + "hashes": { + "model": "7f6146b8a9" + }, + "prompt": "green latex catsuit front full sitting heels redhead face , Larch Loish intricate,cinematic", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 4, + "resources": [ + { + "hash": "7f6146b8a9", + "name": "edgeOfRealism_eorV20Fp16BakedVAE", + "type": "model" + } + ], + "Model hash": "7f6146b8a9", + "Hires upscale": "1.5", + "Hires upscaler": "Latent", + "negativePrompt": "sketch, monochrome, ugly, blurry, boring, cropped, child, worst, drawing", + "Denoising strength": "0.55" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8af75e91-6f26-4b04-be22-612402fc39a7/width=450/1133176.jpeg", + "nsfw": "X", + "width": 960, + "height": 1440, + "hash": "UDHxH5^$Mt-=K;?syqxH5NEe~oxI_JIoMw-U", + "meta": { + "ENSD": "31337", + "Size": "640x960", + "seed": 3673843354, + "Model": "dreamshaper_6BakedVae", + "steps": 15, + "hashes": { + "model": "b76cc78ad9" + }, + "prompt": "side top brunette brastrap jeans shirt outdoors tapegag hfad rwrists rankles ziptie rope tied cleavage downblouse damselindistress sad , Pecan,Jack pine Alien-like Exquisite,Incredible masterpiece", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 4.5, + "resources": [ + { + "hash": "b76cc78ad9", + "name": "dreamshaper_6BakedVae", + "type": "model" + } + ], + "Model hash": "b76cc78ad9", + "Hires upscale": "1.5", + "Hires upscaler": "4x-UltraMix_Balanced", + "Variation seed": "1744719575", + "negativePrompt": "sketch, monochrome, ugly, blurry, boring, cropped, child, worst, drawing", + "Denoising strength": "0.35", + "Variation seed strength": "0.1" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/95338" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bondage-v11-p20.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bondage-v11-p20.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..05dff01e290c2a49dc63a7d19ffbeaa9eb4a47dc Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bondage-v11-p20.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bondage-v11-p20.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bondage-v11-p20.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..1f27e008515dde8705e256cbcd1536e0a6cc5be8 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bondage-v11-p20.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:0974f81fa043052e1c07a2856a6ab42f5cce69eec2acc82b814372a4809d06f0 +size 1184336050 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bondageAndGag_loraBondageV2.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bondageAndGag_loraBondageV2.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..2103d3cb1f79ec88cbfda9a7c69a77e054d7b5d9 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bondageAndGag_loraBondageV2.civitai.info" @@ -0,0 +1,261 @@ +{ + "id": 7071, + "modelId": 6046, + "name": "lora_bondage_v2", + "createdAt": "2023-01-31T21:55:14.448Z", + "updatedAt": "2023-02-01T00:15:36.294Z", + "trainedWords": [ + "shibari", + "bondage", + "bdsm", + "rope", + "gag", + "ball_gag" + ], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": "

Retrained with higher dimensions, better quality imo

", + "model": { + "name": "Bondage and gag", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "bondageAndGag_loraBondageV2.safetensors", + "id": 7170, + "sizeKB": 147570.326171875, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-01-31T21:56:40.562Z", + "hashes": { + "AutoV1": "9A43FBBE", + "AutoV2": "BB781DBE3F", + "SHA256": "BB781DBE3F5DC291AFC7A3C70E1383DE956BEE88730205B9FC8AAB83B97A6B96", + "CRC32": "BE518614", + "BLAKE3": "F9FDD1D86C52BB38FFD604883C02DAFE335CC0F88CAF9E70EBA4123E9585604A" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/7071" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/43218d20-af96-45ac-f2fe-312c66782400/width=450/65097.jpeg", + "nsfw": true, + "width": 640, + "height": 960, + "hash": "UAEU}%~B000Lo$ELE0-p9ZNa-T$*-o%1M{E2", + "meta": { + "Size": "320x480", + "seed": 3024079345, + "Model": "mine", + "steps": 30, + "prompt": "1girl, solo, long_hair, looking_at_viewer, thighhighs, bow, bound, bdsm, bondage, rope, restrained, gag, shibari, bound_arms, ball_gag, shibari_over_clothes ", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "lora_bondage", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "33ae4dfd43", + "name": "mine", + "type": "model" + } + ], + "Model hash": "33ae4dfd43", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality, normal quality:1.4), bad anatomy, bad body, bad feet, bad hands, bad proportions, blurry, cropped, cross-eyed, deformed, error, extra arms, extra digit, extra fingers, extra legs, extra limbs, extra digit, fewer digits, fused fingers, gross proportions, jpeg artifacts, long neck, long body, lowres, malformed limbs, missing arms, missing fingers, missing legs, mutated hands, mutation, polar lowres, poorly drawn face, poorly drawn hands, pubic hair, signature, text, too many fingers, username, watermark,red salive, blood,", + "Denoising strength": "0.7" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/12ad2c04-63a6-4791-3937-ebd917dc0400/width=450/65096.jpeg", + "nsfw": true, + "width": 640, + "height": 960, + "hash": "U[O3^LoL_NxuW=j[s:ay%Mj[WBofoLf6ayay", + "meta": { + "Size": "320x480", + "seed": 1691195035, + "Model": "mine", + "steps": 30, + "prompt": "1girl, solo, long_hair, looking_at_viewer, thighhighs, bow, bound, bdsm, bondage, rope, restrained, gag, shibari, bound_arms, ball_gag, shibari_over_clothes ", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "lora_bondage", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "33ae4dfd43", + "name": "mine", + "type": "model" + } + ], + "Model hash": "33ae4dfd43", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality, normal quality:1.4), bad anatomy, bad body, bad feet, bad hands, bad proportions, blurry, cropped, cross-eyed, deformed, error, extra arms, extra digit, extra fingers, extra legs, extra limbs, extra digit, fewer digits, fused fingers, gross proportions, jpeg artifacts, long neck, long body, lowres, malformed limbs, missing arms, missing fingers, missing legs, mutated hands, mutation, polar lowres, poorly drawn face, poorly drawn hands, pubic hair, signature, text, too many fingers, username, watermark,red salive, blood,", + "Denoising strength": "0.7" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9aa1de9f-3a65-48b0-52d5-ae73036e3600/width=450/65095.jpeg", + "nsfw": true, + "width": 640, + "height": 960, + "hash": "U7GktU%300o|00WB=unh004.~W~WE2xaf7EM", + "meta": { + "Size": "320x480", + "seed": 1533058484, + "Model": "mine", + "steps": 30, + "prompt": "1girl, arms behind head, long_hair, looking_at_viewer, thighhighs, bow, bound, bdsm, bondage, rope, restrained, gag, shibari, bound_arms, ball_gag, shibari_over_clothes ", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "lora_bondage", + "type": "lora", + "weight": 0.3 + }, + { + "hash": "33ae4dfd43", + "name": "mine", + "type": "model" + } + ], + "Model hash": "33ae4dfd43", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality, normal quality:1.4), bad anatomy, bad body, bad feet, bad hands, bad proportions, blurry, cropped, cross-eyed, deformed, error, extra arms, extra digit, extra fingers, extra legs, extra limbs, extra digit, fewer digits, fused fingers, gross proportions, jpeg artifacts, long neck, long body, lowres, malformed limbs, missing arms, missing fingers, missing legs, mutated hands, mutation, polar lowres, poorly drawn face, poorly drawn hands, pubic hair, signature, text, too many fingers, username, watermark,red salive, blood,", + "Denoising strength": "0.7" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d1c5d16e-d647-4f87-ea4f-04e93e97fc00/width=450/65094.jpeg", + "nsfw": true, + "width": 640, + "height": 960, + "hash": "UUI4z=-:9?R%01M|%LoyR8i~w}R*~VxbNFR*", + "meta": { + "Size": "320x480", + "seed": 1231810711, + "Model": "mine", + "steps": 30, + "prompt": "1girl, on back, ((legs up)), no panties, pussy juice, (cum in pussy), (cum on body), (facial), (cum on breasts), outdoors, public use, long_hair, looking_at_viewer, thighhighs, bow, bound, bdsm, bondage, rope, restrained, gag, shibari, bound_arms, ball_gag, shibari_over_clothes ", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "lora_bondage", + "type": "lora", + "weight": 0.3 + }, + { + "hash": "33ae4dfd43", + "name": "mine", + "type": "model" + } + ], + "Model hash": "33ae4dfd43", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality, normal quality:1.4), bad anatomy, bad body, bad feet, bad hands, bad proportions, blurry, cropped, cross-eyed, deformed, error, extra arms, extra digit, extra fingers, extra legs, extra limbs, extra digit, fewer digits, fused fingers, gross proportions, jpeg artifacts, long neck, long body, lowres, malformed limbs, missing arms, missing fingers, missing legs, mutated hands, mutation, polar lowres, poorly drawn face, poorly drawn hands, pubic hair, signature, text, too many fingers, username, watermark,red salive, blood,", + "Denoising strength": "0.7" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c3723a81-1193-483a-bff7-290b31a2b100/width=450/65093.jpeg", + "nsfw": true, + "width": 640, + "height": 960, + "hash": "UmM7cQs:?wW=%gf+t7s.oft7jYRjX8V@xakC", + "meta": { + "Size": "320x480", + "seed": 954425250, + "Model": "mine", + "steps": 20, + "prompt": "1girl, on back, long_hair, looking_at_viewer, bdsm, bondage, rope, restrained, gag, shibari, bound_arms, ball_gag, pussy juice, , playboy bunny,", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "lora_bondage", + "type": "lora", + "weight": 0.3 + }, + { + "name": "lora_sakurajima_mai_v1", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "33ae4dfd43", + "name": "mine", + "type": "model" + } + ], + "Model hash": "33ae4dfd43", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality, normal quality:1.4), bad anatomy, bad body, bad feet, bad hands, bad proportions, blurry, cropped, cross-eyed, deformed, error, extra arms, extra digit, extra fingers, extra legs, extra limbs, extra digit, fewer digits, fused fingers, gross proportions, jpeg artifacts, long neck, long body, lowres, malformed limbs, missing arms, missing fingers, missing legs, mutated hands, mutation, polar lowres, poorly drawn face, poorly drawn hands, pubic hair, signature, text, too many fingers, username, watermark,red salive, blood,", + "Denoising strength": "0.7" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5a90ca92-122b-4bd4-147b-41af6a459500/width=450/65092.jpeg", + "nsfw": true, + "width": 640, + "height": 960, + "hash": "U8N*zlrE_P~C00FsCMw300xatkEe7YnQ5jbv", + "meta": { + "Size": "320x480", + "seed": 2344486178, + "Model": "mine", + "steps": 20, + "prompt": "1girl, on back, long_hair, bdsm, bondage, restrained, gag, shibari, bound_arms, ball_gag, pussy juice, , pink bikini, mizuhara chizuru,", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "lora_bondage", + "type": "lora", + "weight": 0.3 + }, + { + "name": "lora_mizuhara_chizuru_v1", + "type": "lora", + "weight": 0.5 + }, + { + "hash": "33ae4dfd43", + "name": "mine", + "type": "model" + } + ], + "Model hash": "33ae4dfd43", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality, normal quality:1.4), bad anatomy, bad body, bad feet, bad hands, bad proportions, blurry, cropped, cross-eyed, deformed, error, extra arms, extra digit, extra fingers, extra legs, extra limbs, extra digit, fewer digits, fused fingers, gross proportions, jpeg artifacts, long neck, long body, lowres, malformed limbs, missing arms, missing fingers, missing legs, mutated hands, mutation, polar lowres, poorly drawn face, poorly drawn hands, pubic hair, signature, text, too many fingers, username, watermark,red salive, blood,", + "Denoising strength": "0.7" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/7071" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bondageAndGag_loraBondageV2.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bondageAndGag_loraBondageV2.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..f67c3fb96bf530621d82565783fc5b36e245304f Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bondageAndGag_loraBondageV2.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bondageAndGag_loraBondageV2.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bondageAndGag_loraBondageV2.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..1d96539ca16a5fc5253718f77fa0607275600cef --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bondageAndGag_loraBondageV2.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:bb781dbe3f5dc291afc7a3c70e1383de956bee88730205b9fc8aab83b97a6b96 +size 151112014 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bondageSuspension_v11.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bondageSuspension_v11.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..839b0a16d7d44524a9199bcedc289844624df630 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bondageSuspension_v11.civitai.info" @@ -0,0 +1,251 @@ +{ + "id": 15553, + "modelId": 8762, + "name": "v.1.1", + "createdAt": "2023-02-26T07:13:18.756Z", + "updatedAt": "2023-02-26T07:13:18.756Z", + "trainedWords": [ + "suspension", + "spread legs", + "rope", + "shibari" + ], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": "

  • reduce DIM = 8

  • Increase the step and the number of training images

", + "model": { + "name": "Bondage Suspension", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "bondageSuspension_v11.safetensors", + "id": 13318, + "sizeKB": 9363.5009765625, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-02-26T07:16:17.145Z", + "hashes": { + "AutoV1": "8985D067", + "AutoV2": "F30A8EAC2A", + "SHA256": "F30A8EAC2A0ADB07735DC2287056BF3D9B5C35864137EA9A126A0451F1D4979D", + "CRC32": "26716456", + "BLAKE3": "D77FF62D9B23F851DFE8D44302C86FF2422BA98241FC9975A3D301289EEB36A6" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/15553" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/bdb4a21b-7cac-4870-dc70-e73e5b672700/width=450/155133.jpeg", + "nsfw": true, + "width": 720, + "height": 960, + "hash": "USJjbt~W%fWXkCof%1R%9as.M|t7bItQofoM", + "meta": { + "Size": "448x640", + "seed": 165944523, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 25, + "prompt": "1girl, solo, suspension, down, rope, 1girl, bodysuit, bound arms, indoors, leotard, bdsm, shibari, arms behind back, restrained, navel, leaning forward, feet,", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + }, + { + "hash": "e027f683f29a", + "name": "suspension", + "type": "lora", + "weight": null + } + ], + "Model hash": "0873291ac5", + "Hires resize": "720x960", + "AddNet Enabled": "True", + "AddNet Model 1": "suspension(e027f683f29a)", + "Hires upscaler": "lollypop", + "negativePrompt": "(worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, multiple view, Reference sheet,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.34" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d43b2e89-6663-4c2d-cedb-c15de3ac0a00/width=450/155132.jpeg", + "nsfw": true, + "width": 720, + "height": 960, + "hash": "UKJZSj^*EKen~B%M-oaeAq%L-oxZ^*o}E2-o", + "meta": { + "Size": "448x640", + "seed": 748462980, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 25, + "prompt": "1girl, solo, suspension, spread legs, rope, 1girl, arms up, bodysuit, bound arms, indoors, shibari,", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + }, + { + "hash": "e027f683f29a", + "name": "suspension", + "type": "lora", + "weight": null + } + ], + "Model hash": "0873291ac5", + "Hires resize": "720x960", + "AddNet Enabled": "True", + "AddNet Model 1": "suspension(e027f683f29a)", + "Hires upscaler": "lollypop", + "negativePrompt": "(worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, multiple view, Reference sheet,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.34" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ef19f360-52e8-4177-ce44-09a91a43d100/width=450/155131.jpeg", + "nsfw": true, + "width": 720, + "height": 960, + "hash": "UHIX56?^KN%M9Fv~IV4:4.$yIUDj~qkWxb%M", + "meta": { + "Size": "448x640", + "seed": 3785633811, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 25, + "prompt": "1girl, solo, suspension, up, rope, 1girl, bodysuit, bound arms, indoors, leotard, bdsm, shibari, arms behind back, restrained,", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + }, + { + "hash": "e027f683f29a", + "name": "suspension", + "type": "lora", + "weight": null + } + ], + "Model hash": "0873291ac5", + "Hires resize": "720x960", + "AddNet Enabled": "True", + "AddNet Model 1": "suspension(e027f683f29a)", + "Hires upscaler": "lollypop", + "negativePrompt": "(worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, multiple view, Reference sheet,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.34" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/881b256b-e91b-4069-cde1-ee93351e3f00/width=450/155130.jpeg", + "nsfw": true, + "width": 720, + "height": 960, + "hash": "UDJZ*w00y?4:$f%M019v9t-oD*9a^+V?WYni", + "meta": { + "Size": "448x640", + "seed": 1000799098, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 25, + "prompt": "1girl, solo, suspension, up, (rope), 1girl, bodysuit, bound arms, indoors, leotard, bdsm, shibari, arms behind back, restrained, navel, leaning forward, feet,", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + }, + { + "hash": "e027f683f29a", + "name": "suspension", + "type": "lora", + "weight": null + } + ], + "Model hash": "0873291ac5", + "Hires resize": "720x960", + "AddNet Enabled": "True", + "AddNet Model 1": "suspension(e027f683f29a)", + "Hires upscaler": "lollypop", + "negativePrompt": "(worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, multiple view, Reference sheet,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.34" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/710cd974-54d6-4bef-0a3e-d1b88070d500/width=450/155129.jpeg", + "nsfw": true, + "width": 800, + "height": 800, + "hash": "UMJaJ;_2.7%3-m~BS$9a01xtRRRj~pkXxa-p", + "meta": { + "Size": "512x512", + "seed": 2022152301, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 25, + "prompt": "1girl, solo, suspension, up, (rope), 1girl, bodysuit, bound arms, indoors, leotard, shibari, (arms behind back),", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + }, + { + "hash": "e027f683f29a", + "name": "suspension", + "type": "lora", + "weight": null + } + ], + "Model hash": "0873291ac5", + "Hires resize": "800x800", + "AddNet Enabled": "True", + "AddNet Model 1": "suspension(e027f683f29a)", + "Hires upscaler": "lollypop", + "negativePrompt": "(worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, multiple view, Reference sheet,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.34" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/15553" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bondageSuspension_v11.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bondageSuspension_v11.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..e0045a0da0408a149645b8d7f5562ce5bce03dd0 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bondageSuspension_v11.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bondageSuspension_v11.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bondageSuspension_v11.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..061186f38bda13e955d2c32b9649736a4a3375d4 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bondageSuspension_v11.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:f30a8eac2a0adb07735dc2287056bf3d9b5c35864137ea9a126a0451f1d4979d +size 9588225 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bound_arms_v1-000006.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bound_arms_v1-000006.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..2d0d2e3336147731a03d0d0352e68fce823ff548 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bound_arms_v1-000006.civitai.info" @@ -0,0 +1,244 @@ +{ + "id": 99016, + "modelId": 92887, + "name": "v1.0", + "createdAt": "2023-06-18T20:12:19.219Z", + "updatedAt": "2023-06-18T20:17:47.209Z", + "trainedWords": [ + "bound arms", + "arms behind back" + ], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": "

Trained on animefull-final-pruned using 564 images with 2 repeats, batches of 3. Used DAdaptAdam

", + "stats": { + "downloadCount": 143, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Bound Arms", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "bound_arms_v1-000006.safetensors", + "id": 69009, + "sizeKB": 36977.333984375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-18T20:16:22.895Z", + "hashes": { + "AutoV1": "4F29A2AD", + "AutoV2": "B54CEEF054", + "SHA256": "B54CEEF054C83A9B308D27C8B6CE401C83232FD74DA8C2AF817C9798E3916051", + "CRC32": "DEBF792C", + "BLAKE3": "FAF46755FD09FB806971E9223C35FD6B1B7AFF06C4A386347700B88EF91BF5D2" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/99016" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/cfef1970-e173-4b8b-b4d3-3c024b9ac7e9/width=450/1198560.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UJE.b5~pIUIV~U?aNyNHE1xu%MoeSjJ8xYs.", + "meta": { + "Size": "512x768", + "seed": 3208285383, + "Model": "stellarmix_v10", + "steps": 30, + "hashes": { + "model": "fe63927c07" + }, + "prompt": "bound arms, arms behind back, highres, highest quallity, illustration, ultra detailed, (detailed face), (detailed eyes), soft lighting, best quality, hyper detailed, masterpiece, looking at viewer, smile, 1girl, solo, blonde hair, small breasts, school uniform, skirt, (colorful), upper body, shack, window, night, moon, ", + "Version": "v1.3.2", + "sampler": "DPM++ 2M SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "fe63927c07", + "name": "stellarmix_v10", + "type": "model" + } + ], + "Model hash": "fe63927c07", + "Hires steps": "20", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "gag, gagged, (worst quality, low quality:1.4), monochrome, signature, watermark, username, artist name, trademark, multiple view, cropped, bad anatomy, bad-hands-5", + "Denoising strength": "0.4", + "\"bound_arms_v1-000006": "101501eeee0b\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/556dc184-9ae4-40f5-964e-27b88a3bce14/width=450/1198561.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "U7CPO=02VVNyaf-o9vxZ00~ATLw]-:E3-TNG", + "meta": { + "Size": "512x768", + "seed": 3844868996, + "Model": "stellarmix_v10", + "steps": 30, + "hashes": { + "model": "fe63927c07" + }, + "prompt": "bound arms, arms behind back, rope, highres, highest quallity, illustration, ultra detailed, (detailed face), (detailed eyes), soft lighting, best quality, hyper detailed, masterpiece, looking at viewer, angry, open mouth, 1girl, solo, short hair, brown hair, school uniform, skirt, (colorful), upper body, shack, window, night, ", + "Version": "v1.3.2", + "sampler": "DPM++ 2M SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "fe63927c07", + "name": "stellarmix_v10", + "type": "model" + } + ], + "Model hash": "fe63927c07", + "Hires steps": "20", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "gag, gagged, (worst quality, low quality:1.4), monochrome, signature, watermark, username, artist name, trademark, multiple view, cropped, bad anatomy, bad-hands-5", + "Denoising strength": "0.4", + "\"bound_arms_v1-000006": "101501eeee0b\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/cd0dda3e-8657-45a5-a713-1de6be73be3b/width=450/1198562.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "U9EoSt028^^%IT58R$%1}REM_3NH01xnxujv", + "meta": { + "Size": "512x768", + "seed": 3716888532, + "Model": "stellarmix_v10", + "steps": 30, + "hashes": { + "model": "fe63927c07" + }, + "prompt": "(bound arms, arms behind back, rope, bound legs:1.2), squatting, highres, highest quallity, illustration, ultra detailed, (detailed face), (detailed eyes), soft lighting, best quality, hyper detailed, masterpiece, looking at viewer, angry, open mouth, 1girl, solo, short hair, brown hair, school uniform, skirt, (colorful), shack, window, night, ", + "Version": "v1.3.2", + "sampler": "DPM++ 2M SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "fe63927c07", + "name": "stellarmix_v10", + "type": "model" + } + ], + "Model hash": "fe63927c07", + "Hires steps": "20", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "gag, gagged, (worst quality, low quality:1.4), monochrome, signature, watermark, username, artist name, trademark, multiple view, cropped, bad anatomy, bad-hands-5", + "Denoising strength": "0.4", + "\"bound_arms_v1-000006": "101501eeee0b\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/85bb5756-0503-4ea5-8bc0-49d3342a4b33/width=450/1198591.jpeg", + "nsfw": "X", + "width": 5632, + "height": 886, + "hash": "UnFFT=a}j[j[~qbHj@j[_3f6j[ay?ba|jsjs", + "meta": { + "Size": "512x768", + "seed": 339256819, + "Model": "storeBoughtGyozaMix_v32", + "steps": 30, + "Script": "X/Y/Z plot", + "X Type": "Prompt S/R", + "hashes": { + "model": "7c906a26f9" + }, + "prompt": "highres, highest quallity, illustration, ultra detailed, (detailed face), (detailed eyes), (colorful), cinematic lighting, best quality, hyper detailed, masterpiece,1girl, solo, rope, bound arms, arms behind back, leaning forward, open mouth, small breasts, school uniform, skirt, base", + "Version": "v1.3.2", + "sampler": "DPM++ 2M SDE Karras", + "X Values": "\"base", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "7c906a26f9", + "name": "storeBoughtGyozaMix_v32", + "type": "model" + } + ], + "Model hash": "7c906a26f9", + "bound_arms_v1": "1>\"", + "negativePrompt": "gag, gagged, (worst quality, low quality:1.4), monochrome, signature, watermark, username, artist name, trademark, multiple view, cropped, bad anatomy, EasyNegative", + "bound_arms_v1-000001": "1>", + "bound_arms_v1-000002": "1>", + "bound_arms_v1-000003": "1>", + "bound_arms_v1-000004": "1>", + "bound_arms_v1-000005": "1>", + "bound_arms_v1-000006": "1>", + "bound_arms_v1-000007": "1>", + "bound_arms_v1-000008": "1>", + "bound_arms_v1-000009": "1>" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7b5625d5-ae00-45bc-9b95-c77c2fe6caed/width=450/1198595.jpeg", + "nsfw": "Mature", + "width": 3968, + "height": 3190, + "hash": "UQH-}f_N_N_3?ao0R+f7ofoKWDRk.7oJRjWB", + "meta": { + "Size": "512x768", + "seed": 390762805, + "Model": "stellarmix_v10", + "steps": 30, + "Script": "X/Y/Z plot", + "X Type": "Prompt S/R", + "Y Type": "Seed", + "hashes": { + "model": "fe63927c07" + }, + "prompt": "highres, highest quallity, illustration, ultra detailed, (detailed face), (detailed eyes), (colorful), cinematic lighting, best quality, hyper detailed, masterpiece,1girl, solo, rope, bound arms, arms behind back, blush, open mouth, baseball cap, blonde hair, short hair, baseball uniform, hoop earrings, small breasts, xyz", + "Version": "v1.3.2", + "sampler": "DPM++ 2M SDE Karras", + "X Values": "\"xyz", + "Y Values": "\"-1,-1,-1,-1\"", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "fe63927c07", + "name": "stellarmix_v10", + "type": "model" + } + ], + "Model hash": "fe63927c07", + "bound_arms_v1": "1>\"", + "Fixed Y Values": "\"390762805, 3293158954, 2460206779, 1364908436\"", + "negativePrompt": "gag, gagged, (worst quality, low quality:1.4), monochrome, signature, watermark, username, artist name, trademark, multiple view, cropped, bad anatomy, EasyNegative", + "bound_arms_v1-000005": "1>", + "bound_arms_v1-000006": "1>", + "bound_arms_v1-000007": "1>", + "bound_arms_v1-000008": "1>", + "bound_arms_v1-000009": "1>" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/99016" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bound_arms_v1-000006.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bound_arms_v1-000006.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..dd14ea586787f0a7e708ca6772570cc85694c8ae Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bound_arms_v1-000006.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bound_arms_v1-000006.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bound_arms_v1-000006.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..bf462e0cea9bfe28801be8df7b42eb5b9fe273d9 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/bound_arms_v1-000006.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:b54ceef054c83a9b308d27c8b6ce401c83232fd74da8c2af817c9798e3916051 +size 37864790 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/breastBondageClamp_20230228.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/breastBondageClamp_20230228.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..ab2ddc752f021e8135bcdb6936aa4e7fa6681cc8 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/breastBondageClamp_20230228.civitai.info" @@ -0,0 +1,80 @@ +{ + "id": 16696, + "modelId": 9397, + "name": "20230228", + "createdAt": "2023-02-28T14:37:57.719Z", + "updatedAt": "2023-03-06T13:46:13.212Z", + "trainedWords": [ + "breast_crimper" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

I adjusted it because it was over-learning.

test prompt: 1girl, green hair, red eyes, wedding dress

", + "model": { + "name": "breast_bondage_clamp", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "breastBondageClamp_20230228.safetensors", + "id": 14076, + "sizeKB": 147573.515625, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-02-28T14:41:09.006Z", + "hashes": { + "AutoV1": "9E2CA285", + "AutoV2": "8E810C726C", + "SHA256": "8E810C726C5F5A615E9001243DCC457EA7590F566BE6B17EBCA4B2F51763FC39", + "CRC32": "B5EDC8BC", + "BLAKE3": "20B5CC81A162230B0F0082AF858EFEBFFC57BAE84BB7D5F195566C53A8949BD7" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/16696" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/628ae42b-e6db-4b6b-631a-af32cc3e4600/width=450/168386.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "U9KA?0Ro00~p^t%L^,tR?vXS^ksV_1xuIo?H", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e5e5571c-8dde-4d5a-ffcd-eb2816dd9f00/width=450/168385.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UGLzgaIV4:tQx=s9~Wn#%gRj=}IoTKRkoJsl", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7d36eab6-38be-44c6-b00a-e696dedea000/width=450/168384.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UFJ*F:EN00~qD#?GIWkC9aaeVtIU4.t6IoaK", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d5e848c6-0a25-4cef-a919-05ecb8108400/width=450/168383.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "U8Kwwo0200~VDg.8-?t8.7slmmjXx]?I9FMy", + "meta": null + } + ], + "downloadUrl": "https://civitai.com/api/download/models/16696" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/breastBondageClamp_20230228.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/breastBondageClamp_20230228.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..268c47d7d8b2975495c454e2d8970aace376efde Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/breastBondageClamp_20230228.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/breastBondageClamp_20230228.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/breastBondageClamp_20230228.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..a32c28958a2a4da9b5cca76794733e2813e4d7b8 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/breastBondageClamp_20230228.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:8e810c726c5f5a615e9001243dcc457ea7590f566be6b17ebca4b2f51763fc39 +size 151115280 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/brj-bound-from-behind-v1.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/brj-bound-from-behind-v1.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..548fe8ce0314be371e891cf9c80d253d24eeacbe --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/brj-bound-from-behind-v1.civitai.info" @@ -0,0 +1,230 @@ +{ + "id": 102784, + "modelId": 96229, + "name": "v1.0", + "createdAt": "2023-06-24T08:05:28.062Z", + "updatedAt": "2023-06-24T11:10:26.528Z", + "trainedWords": [ + "arms behind back, bound, from behind" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

Added Version 1

", + "stats": { + "downloadCount": 130, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Bound Shibari From Behind", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "brj-bound-from-behind-v1.safetensors", + "id": 72069, + "sizeKB": 147567.2177734375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-24T08:10:59.562Z", + "hashes": { + "AutoV1": "FBC94F29", + "AutoV2": "AE91C9405D", + "SHA256": "AE91C9405DDEAD4F4B13846C166E37B433120191A19F3BA5C9FDB3EFA03B1E72", + "CRC32": "CB443F8E", + "BLAKE3": "F4AD58DE5D5F8F1D75A00F32422CEAEA846B814CA94567BEC23811B429855E87" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/102784" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/298d0112-58d2-45fc-8c6b-1c59bedcd732/width=450/1268104.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "ULF5s%?w109G~qyEEkoftRtSIpogV?IUELs.", + "meta": { + "Size": "512x768", + "seed": 4246992005, + "Model": "BrjMixfp16", + "steps": 32, + "hashes": { + "model": "f9ce5a8e75" + }, + "prompt": "masterpiece, best quality, ultra-detailed, illustration, 1girl, blonde hair, long hair, two side up, red eyes, black tank top, short shorts, red collar, looking at viewer, bondage, arms behind back, bound, restrained, shibari, from behind ", + "Version": "v1.3.2", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "f9ce5a8e75", + "name": "BrjMixfp16", + "type": "model" + } + ], + "Model hash": "f9ce5a8e75", + "Hires steps": "15", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "nsfw, (worst quality, low quality:1.4), monochrome, zombie, (interlocked fingers), easynegative, negative_hand-negg, ng_deepnegative_v1_75t", + "Denoising strength": "0.4", + "\"bound-from-behind-v1.3": "32cb1dff4940\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ed79394d-1532-4451-8fe0-dbc706bc9fd1/width=450/1268114.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1536, + "hash": "U8I;^w0L00MdL#}q0057_2_2R60M-;R*D*Rl", + "meta": { + "Size": "512x768", + "seed": 1078053670, + "Model": "AbyssOrangeMix2_hard", + "steps": 28, + "hashes": { + "model": "0fc198c490" + }, + "prompt": "masterpiece, best quality, ultra-detailed, illustration, 1girl, blonde hair, long hair, two side up, red eyes, black tank top, short shorts, red collar, looking at viewer, bondage, arms behind back, bound, restrained, shibari, from behind ", + "Version": "v1.3.2", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "Hires steps": "15", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "nsfw, (worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, title, easynegative, negative_hand-neg", + "Denoising strength": "0.3", + "\"bound-from-behind-v1.3": "32cb1dff4940\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4b643a6b-5595-4967-939e-34dcfb588e3b/width=450/1268186.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1536, + "hash": "UZMi~J~qJUxa^*%NSjxuI:$%IpIUoKxZoft7", + "meta": { + "Size": "512x768", + "seed": 4246765146, + "Model": "Anything3", + "steps": 32, + "hashes": { + "model": "67a115286b" + }, + "prompt": "masterpiece, best quality, ultra-detailed, illustration, 1girl, blonde hair, long hair, two side up, red eyes, black tank top, short shorts, red collar, looking at viewer, bondage, arms behind back, bound, restrained, shibari, from behind ", + "Version": "v1.3.2", + "sampler": "Euler", + "cfgScale": 11, + "Clip skip": "2", + "resources": [ + { + "hash": "67a115286b", + "name": "Anything3", + "type": "model" + } + ], + "Model hash": "67a115286b", + "Hires steps": "15", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "nsfw, (worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, title, easynegative, negative_hand-neg", + "Denoising strength": "0.4", + "\"bound-from-behind-v1.3": "32cb1dff4940\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3ade7739-8d6d-461f-8387-47840653c159/width=450/1268533.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UEG+8o00y?-pSk9Y-;IA00_3wbaw-T-q4.Si", + "meta": { + "Size": "1024x1536", + "seed": 3009565175, + "Model": "BrjMixfp16", + "steps": 32, + "hashes": { + "model": "f9ce5a8e75" + }, + "prompt": "masterpiece, best quality, ultra-detailed, illustration, 1girl, saori \\(blue archive\\), long hair, black hair, blue hair, multicolored hair, blue eyes, crop top, pants, clear stuff gag, angry, looking at viewer, bondage, arms behind back, bound, restrained, shibari, from behind ", + "Version": "v1.3.2", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "Mask blur": "4", + "resources": [ + { + "hash": "f9ce5a8e75", + "name": "BrjMixfp16", + "type": "model" + } + ], + "Model hash": "f9ce5a8e75", + "saori-v1.2": "cb65337856df", + "negativePrompt": "nsfw, (worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, title, easynegative, negative_hand-neg", + "Denoising strength": "0.35", + "\"bound-from-behind-v1.3": "32cb1dff4940", + "clear-stuff-gag-v1-000009": "bd9a6339d648\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e3bec34d-4bf4-4356-95e2-cf45bc4625a0/width=450/1269949.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1536, + "hash": "UNGkn9-=Au4:~qo}%gxbS#xaozxuo#t7IoWC", + "meta": { + "Size": "512x768", + "seed": 4244677282, + "Model": "BrjMixfp16", + "steps": 32, + "hashes": { + "model": "f9ce5a8e75" + }, + "prompt": "masterpiece, best quality, ultra-detailed, illustration, 1girl, hoshino ruby, mismatched pupils, star-shaped pupils, blonde hair, long hair, bikini, tape gag, embarrassed, looking at viewer, bondage, arms behind back, bound, restrained, shibari, from behind ", + "Version": "v1.3.2", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "f9ce5a8e75", + "name": "BrjMixfp16", + "type": "model" + } + ], + "Model hash": "f9ce5a8e75", + "Hires steps": "15", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "nsfw, (worst quality, low quality:1.4), monochrome, zombie, (interlocked fingers), easynegative, negative_hand-negg, ng_deepnegative_v1_75t", + "brj-tape-gag-v2": "50a1fe31439c\"", + "Denoising strength": "0.4", + "brj-hoshino-ruby-v1": "1e187ed00cd1", + "\"bound-from-behind-v1.3": "32cb1dff4940" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/102784" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/brj-bound-from-behind-v1.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/brj-bound-from-behind-v1.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..d0e18503b8143a365a2635ebf7804d2def774c03 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/brj-bound-from-behind-v1.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/brj-bound-from-behind-v1.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/brj-bound-from-behind-v1.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..875f7f89ca91626f9aaf0d305631eafa4428b48a --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/brj-bound-from-behind-v1.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:ae91c9405ddead4f4b13846c166e37b433120191a19f3ba5c9fdb3efa03b1e72 +size 151108831 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/caughtCheatingNTR_v03d.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/caughtCheatingNTR_v03d.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..19d088f96c535568234f67524535b348321642ce --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/caughtCheatingNTR_v03d.civitai.info" @@ -0,0 +1,412 @@ +{ + "id": 54606, + "modelId": 50060, + "name": "v0.3d", + "createdAt": "2023-04-25T01:22:50.261Z", + "updatedAt": "2023-04-25T01:33:11.033Z", + "trainedWords": [ + "caught" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 732, + "ratingCount": 2, + "rating": 3 + }, + "model": { + "name": "Caught cheating - NTR concept", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "caughtCheatingNTR_v03d.safetensors", + "id": 39453, + "sizeKB": 9340.9140625, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-25T01:25:45.941Z", + "hashes": { + "AutoV1": "3853D431", + "AutoV2": "5D33EB6A6B", + "SHA256": "5D33EB6A6BC096F1BAE5B8AC3F06FC007F834106B3CB556D5EE8EAEB0C571E13", + "CRC32": "5DE6DFF2", + "BLAKE3": "62902C0CDE5E1A90099F48E085BDDCCDEA8E37EEDCE0D941B84E7F7CF2361482" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/54606" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3a736bd0-ff27-42b6-6952-2dce1758b800/width=450/590802.jpeg", + "nsfw": false, + "width": 800, + "height": 1200, + "hash": "UPKT=3~WIo_2tljuE1tRnhIUs:o#-oxtNGWB", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e0e25eac-a936-40fe-90d1-079a412e7700/width=450/590797.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UPKT=3~WIo_2tlj[E1tRn#IUs:o#-oxtNGWC", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2838592866, + "Model": "anylora_novaeFp16Pruned", + "steps": 20, + "hashes": { + "vae": "f921fb3f29", + "model": "b0c91a8a93" + }, + "prompt": "\n(caught:1.0), 1girl, long hair, looking at viewer, blush, open mouth, 1boy, penis, pussy, spread legs, sex, vaginal, on bed, girl on top,\n kitagawa marin, open door, gojou wakana, ass, looking back,, masterpiece, best quality, highly detailed", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "caught_cheating_v0.3d", + "type": "lora", + "weight": 0.9 + }, + { + "hash": "b0c91a8a93", + "name": "anylora_novaeFp16Pruned", + "type": "model" + } + ], + "Model hash": "b0c91a8a93", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "(worst quality, low quality:1.4)", + "Denoising strength": "0.21" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/72219b06-46d3-4e98-cf70-ae07daa9c300/width=450/590794.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "U4G+8o000000~nDi56-;00-=8_?H00_3DkSN", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2838592865, + "Model": "anylora_novaeFp16Pruned", + "steps": 20, + "hashes": { + "vae": "f921fb3f29", + "model": "b0c91a8a93" + }, + "prompt": "\n(caught:1.0), 1girl, long hair, looking at viewer, blush, open mouth, 1boy, penis, pussy, spread legs, sex, vaginal, on bed, straddling, girl on top,\n rizu-kyun, open door, gojou wakana,, masterpiece, best quality, highly detailed", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "caught_cheating_v0.3d", + "type": "lora", + "weight": 0.9 + }, + { + "hash": "b0c91a8a93", + "name": "anylora_novaeFp16Pruned", + "type": "model" + } + ], + "Model hash": "b0c91a8a93", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "(worst quality, low quality:1.4)", + "Denoising strength": "0.21" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7eac29d6-702e-4ea4-5a50-dcc3d82d9200/width=450/590788.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UGI#M$4n00xZpd4nw]?HROE1?HNb~W%2IVIU", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 292719274, + "Model": "anylora_novaeFp16Pruned", + "steps": 20, + "hashes": { + "vae": "f921fb3f29", + "model": "b0c91a8a93" + }, + "prompt": "\ncaught, 1girl, 1boy, 2boys, sex, penis, ass, anal, deep penetration, looking back, surprised, !, :o, masterpiece, best quality, highly detailed", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "caught_cheating_v0.3d", + "type": "lora", + "weight": 1 + }, + { + "hash": "b0c91a8a93", + "name": "anylora_novaeFp16Pruned", + "type": "model" + } + ], + "Model hash": "b0c91a8a93", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "(worst quality, low quality:1.4)", + "Denoising strength": "0.3" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/40b1ad0e-db71-4e1f-99c7-208f24b30600/width=450/590793.jpeg", + "nsfw": true, + "width": 1536, + "height": 1024, + "hash": "UHI#Ju00008_E+jb^*4n0Kxu?b9F~WRj9Gt7", + "meta": { + "ENSD": "31337", + "Size": "768x512", + "seed": 292719275, + "Model": "anylora_novaeFp16Pruned", + "steps": 20, + "hashes": { + "vae": "f921fb3f29", + "model": "b0c91a8a93" + }, + "prompt": "\ncaught, 1girl, 1boy, 2boys, sex, penis, ass, anal, deep penetration, looking back, surprised, !, :o, anus, ass grab, grabbing another's ass, pov hands, looking netorare, deep skin\n, masterpiece, best quality, highly detailed", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "caught_cheating_v0.3d", + "type": "lora", + "weight": 0.9 + }, + { + "hash": "b0c91a8a93", + "name": "anylora_novaeFp16Pruned", + "type": "model" + } + ], + "Model hash": "b0c91a8a93", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "(worst quality, low quality:1.4)", + "Denoising strength": "0.21" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5ce0919f-1f07-4050-5263-461e5136e600/width=450/590790.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UPKTxqnO0KofnM~VIUNGxsWU-pIoI:IoogR-", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3062915562, + "Model": "anylora_novaeFp16Pruned", + "steps": 20, + "hashes": { + "vae": "f921fb3f29", + "model": "b0c91a8a93" + }, + "prompt": "\ncaught, 1girl, 1boy, 2boys, fellatio, all fours, penis grab, surprised, !,, masterpiece, best quality, highly detailed", + "sampler": "Euler a", + "cfgScale": 5, + "Clip skip": "2", + "resources": [ + { + "name": "caught_cheating_v0.3d", + "type": "lora", + "weight": 1 + }, + { + "hash": "b0c91a8a93", + "name": "anylora_novaeFp16Pruned", + "type": "model" + } + ], + "Model hash": "b0c91a8a93", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "(worst quality, low quality:1.4)", + "Denoising strength": "0.3" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/05ef4be8-6518-4eef-dd0c-42138f44f600/width=450/590792.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UGIEhQ4n9YWB0#4n~Vt7?GD%%Mj[~qM{9ZWB", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 292719274, + "Model": "anylora_novaeFp16Pruned", + "steps": 20, + "hashes": { + "vae": "f921fb3f29", + "model": "b0c91a8a93" + }, + "prompt": "\ncaught, 1girl, 1boy, 2boys, sex, penis, ass, anal, deep penetration, looking back, surprised, !, :o, anus, ass grab, grabbing another's ass, pov hands, looking netorare, deep skin, \n, masterpiece, best quality, highly detailed", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "caught_cheating_v0.3d", + "type": "lora", + "weight": 0.9 + }, + { + "hash": "b0c91a8a93", + "name": "anylora_novaeFp16Pruned", + "type": "model" + } + ], + "Model hash": "b0c91a8a93", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "(worst quality, low quality:1.4)", + "Denoising strength": "0.3" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d874e6be-0306-46a6-738b-1a0e15485500/width=450/590787.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UWIqo#V@00kD~qV@MykDtSM{V@j[-;IoIUoL", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2838592860, + "Model": "anylora_novaeFp16Pruned", + "steps": 20, + "hashes": { + "vae": "f921fb3f29", + "model": "b0c91a8a93" + }, + "prompt": "\ncaught, 1girl, breasts, blush, open mouth, blonde hair, black hair, 1boy, standing, ass, hetero, penis, indoors, sex, vaginal, from side, bent over, sex from behind,, masterpiece, best quality, highly detailed", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "caught_cheating_v0.3d", + "type": "lora", + "weight": 0.9 + }, + { + "hash": "b0c91a8a93", + "name": "anylora_novaeFp16Pruned", + "type": "model" + } + ], + "Model hash": "b0c91a8a93", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "(worst quality, low quality:1.4)", + "Denoising strength": "0.21" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/cff3fff9-2e03-49f1-7015-5324ba93d600/width=450/590791.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UJIhBMDiR%xu9]4.?Ht7ITIUxubH~p%24.jY", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 292719274, + "Model": "anylora_novaeFp16Pruned", + "steps": 20, + "hashes": { + "vae": "f921fb3f29", + "model": "b0c91a8a93" + }, + "prompt": "\ncaught, 1girl, 1boy, 2boys, sex, penis, ass, anal, deep penetration, looking back, surprised, !, :o, anus, masterpiece, best quality, highly detailed", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "caught_cheating_v0.3d", + "type": "lora", + "weight": 1 + }, + { + "hash": "b0c91a8a93", + "name": "anylora_novaeFp16Pruned", + "type": "model" + } + ], + "Model hash": "b0c91a8a93", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "(worst quality, low quality:1.4)", + "Denoising strength": "0.3" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/08b371c7-0db8-49e3-de11-694a76770d00/width=450/590796.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UNIqy6~qR*oz9ZIpD%M{$$xC%MbxwHM|ShIV", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2838592862, + "Model": "anylora_novaeFp16Pruned", + "steps": 20, + "hashes": { + "vae": "f921fb3f29", + "model": "b0c91a8a93" + }, + "prompt": "\ncaught, 1girl, long hair, looking at viewer, blush, open mouth, blue eyes, blonde hair, large breasts, shirt, 1boy, penis, pussy, spread legs, sex, vaginal, on bed, straddling, girl on top,, masterpiece, best quality, highly detailed", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "caught_cheating_v0.3d", + "type": "lora", + "weight": 0.85 + }, + { + "hash": "b0c91a8a93", + "name": "anylora_novaeFp16Pruned", + "type": "model" + } + ], + "Model hash": "b0c91a8a93", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "(worst quality, low quality:1.4)", + "Denoising strength": "0.21" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/54606" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/caughtCheatingNTR_v03d.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/caughtCheatingNTR_v03d.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..eedcc068fad15d25b3fca2f40c7a3bcec2be26ea --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/caughtCheatingNTR_v03d.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:51ccff909d4106143e727ea3300f41ffe7c9d0e72e3964917a85560251d4fd78 +size 2690677 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/caughtCheatingNTR_v03d.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/caughtCheatingNTR_v03d.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..dd2a9037e97ffbf7161bbebd0027c4ecb9db9011 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/caughtCheatingNTR_v03d.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:5d33eb6a6bc096f1bae5b8ac3f06fc007f834106b3cb556d5ee8eaeb0c571e13 +size 9565096 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/conceptLargerInsertion_v10.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/conceptLargerInsertion_v10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..871681766537806bc1f6155a61c237dce96f2a06 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/conceptLargerInsertion_v10.civitai.info" @@ -0,0 +1,326 @@ +{ + "id": 48917, + "modelId": 44276, + "name": "v1.0", + "createdAt": "2023-04-18T11:35:24.802Z", + "updatedAt": "2023-04-18T11:56:31.508Z", + "trainedWords": [ + "large insertion", + "large penis", + "thick penis" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

trained on NAi

", + "stats": { + "downloadCount": 147, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Concept Larger insertion (more girth) vaginal", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "conceptLargerInsertion_v10.safetensors", + "id": 36056, + "sizeKB": 147581.7958984375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-18T11:40:54.282Z", + "hashes": { + "AutoV1": "892F19BF", + "AutoV2": "E25CD31D73", + "SHA256": "E25CD31D73EE7D8D62CEA628A852F6FA9EE2D308AB8CD1C817F93B49C185F5F9", + "CRC32": "04B08720", + "BLAKE3": "795B33A72D6DCEE5EEF614B57821240126BDCA27BAF0AB57D1369011FAA9463E" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/48917" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4e4b9b6e-edfc-48a6-9b14-db6db8deda00/width=450/525397.jpeg", + "nsfw": true, + "width": 1024, + "height": 1024, + "hash": "UNI:wVt70eR*0}s:9uWV4.Rk-oof}@R*a$of", + "meta": { + "ENSD": "9199919", + "Size": "512x512", + "seed": 942752208, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "vae": "735e4c3a44", + "model": "f713bab753" + }, + "prompt": "1girl, medium breasts, long hair, 1boy, penis, sex, vaginal, pussy juice, cowgirl position,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + }, + { + "hash": "6c8a7f5813ce", + "name": "text1.0", + "type": "lora", + "weight": null + } + ], + "Model hash": "f713bab753", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "Concept-Large-insertion-NAi-text1.0(6c8a7f5813ce)", + "Hires upscaler": "Latent", + "negativePrompt": "(worst quality:1.4), (low quality:1.4) , (monochrome:1.1), flat chest,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.55" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b33ee6e3-476f-46ee-9214-c5769af65700/width=450/525401.jpeg", + "nsfw": true, + "width": 1024, + "height": 1024, + "hash": "UFI;beIA0j%M1AD$ObXno*%0~XIV?bM|I@Rl", + "meta": { + "ENSD": "9199919", + "Size": "512x512", + "seed": 3593001105, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "vae": "735e4c3a44", + "model": "f713bab753" + }, + "prompt": "1girl, medium breasts, long hair, 1boy, penis, sex, vaginal, pussy juice, cowgirl position, pov", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + }, + { + "hash": "6c8a7f5813ce", + "name": "text1.0", + "type": "lora", + "weight": null + } + ], + "Model hash": "f713bab753", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "Concept-Large-insertion-NAi-text1.0(6c8a7f5813ce)", + "Hires upscaler": "Latent", + "negativePrompt": "(worst quality:1.4), (low quality:1.4) , (monochrome:1.1), flat chest,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.55" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d1994999-e6db-495f-6f4c-93beeab0a200/width=450/525400.jpeg", + "nsfw": true, + "width": 1024, + "height": 1024, + "hash": "UMKA4%?ZNa9uEK=^xvN^s*-:IpRQS#Ip~Uxu", + "meta": { + "ENSD": "9199919", + "Size": "512x512", + "seed": 372629890, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "vae": "735e4c3a44", + "model": "f713bab753" + }, + "prompt": "1girl, medium breasts, long hair, 1boy, penis, sex, vaginal, pussy juice, cowgirl position, pov", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + }, + { + "hash": "6c8a7f5813ce", + "name": "text1.0", + "type": "lora", + "weight": null + } + ], + "Model hash": "f713bab753", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "Concept-Large-insertion-NAi-text1.0(6c8a7f5813ce)", + "Hires upscaler": "Latent", + "negativePrompt": "(worst quality:1.4), (low quality:1.4) , (monochrome:1.1), flat chest,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.55" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4c91e8a4-68bd-4369-eae0-a6db0c19b300/width=450/525399.jpeg", + "nsfw": true, + "width": 1024, + "height": 1024, + "hash": "UMLV{[?G0zWCAD%LNdaybFoy-;t7~Vxas;of", + "meta": { + "ENSD": "9199919", + "Size": "512x512", + "seed": 1276230065, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "vae": "735e4c3a44", + "model": "f713bab753" + }, + "prompt": "1girl, medium breasts, long hair, 1boy, penis, sex, vaginal, pussy juice, pov", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + }, + { + "hash": "6c8a7f5813ce", + "name": "text1.0", + "type": "lora", + "weight": null + } + ], + "Model hash": "f713bab753", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "Concept-Large-insertion-NAi-text1.0(6c8a7f5813ce)", + "Hires upscaler": "Latent", + "negativePrompt": "(worst quality:1.4), (low quality:1.4) , (monochrome:1.1), flat chest,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.55" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/24c2c0ba-2f8e-4f82-f573-16b500edf700/width=450/525402.jpeg", + "nsfw": true, + "width": 1024, + "height": 1024, + "hash": "U4Ip@=^+00=x01%LH;ae00E200r=~p4:009Z", + "meta": { + "ENSD": "9199919", + "Size": "512x512", + "seed": 868756369, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "vae": "735e4c3a44", + "model": "f713bab753" + }, + "prompt": "1girl, medium breasts, long hair, 1boy, penis, sex, vaginal, pussy juice, pov", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + }, + { + "hash": "6c8a7f5813ce", + "name": "text1.0", + "type": "lora", + "weight": null + } + ], + "Model hash": "f713bab753", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "Concept-Large-insertion-NAi-text1.0(6c8a7f5813ce)", + "Hires upscaler": "Latent", + "negativePrompt": "(worst quality:1.4), (low quality:1.4) , (monochrome:1.1), flat chest,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.55" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3ffba5c9-09af-486e-b94b-7878ecc50400/width=450/525555.jpeg", + "nsfw": true, + "width": 1024, + "height": 1024, + "hash": "UAKA4=0000~q00xtTv$*00yEr:M{o|-;0L%L", + "meta": { + "ENSD": "9199919", + "Size": "512x512", + "seed": 995311091, + "Model": "yesmix_v15", + "steps": 20, + "hashes": { + "vae": "735e4c3a44", + "model": "f713bab753", + "embed:doggystyle": "0e14d3f2d7" + }, + "prompt": "1girl, medium breasts, long hair, 1boy, penis, sex, doggystyle,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "f713bab753", + "name": "yesmix_v15", + "type": "model" + }, + { + "hash": "6c8a7f5813ce", + "name": "text1.0", + "type": "lora", + "weight": null + } + ], + "Model hash": "f713bab753", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "Concept-Large-insertion-NAi-text1.0(6c8a7f5813ce)", + "Hires upscaler": "Latent", + "negativePrompt": "(worst quality:1.4), (low quality:1.4) , (monochrome:1.1),", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.95", + "AddNet Weight B 1": "0.95", + "Denoising strength": "0.55" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/48917" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/conceptLargerInsertion_v10.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/conceptLargerInsertion_v10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..fa1cb4a4c2672af5a799c8e249d8c6944b072119 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/conceptLargerInsertion_v10.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:b4537f4236255b8d0d9fd16c6d0920ce8b9d481f58e4214fd8245cc0d4c6d751 +size 1284473 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/conceptLargerInsertion_v10.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/conceptLargerInsertion_v10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..f9cfc241930976bfb13e69900712660e89365676 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/conceptLargerInsertion_v10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:e25cd31d73ee7d8d62cea628a852f6fa9ee2d308ab8cd1c817f93b49c185f5f9 +size 151123759 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/creampieHairyPussy_creampieV11.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/creampieHairyPussy_creampieV11.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..f768af23d3331217c004f84830e7e755956605ee --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/creampieHairyPussy_creampieV11.civitai.info" @@ -0,0 +1,174 @@ +{ + "id": 18077, + "modelId": 14557, + "name": "Creampie v1.1", + "createdAt": "2023-03-03T16:24:31.902Z", + "updatedAt": "2023-03-18T06:02:22.450Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

version 1.1 updates:

  • Removed some images from the training data set

  • This new version works better with ControlNet

", + "stats": { + "downloadCount": 16071, + "ratingCount": 6, + "rating": 4.83 + }, + "model": { + "name": "Creampie & Hairy Pussy", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "creampieHairyPussy_creampieV11.safetensors", + "id": 15115, + "sizeKB": 36974.31640625, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-03-03T16:25:43.733Z", + "hashes": { + "AutoV1": "E7790A9D", + "AutoV2": "826D251C22", + "SHA256": "826D251C22EBAD508061ED14BF016E90B7461DCBBC07ABA734466251E3ED061F", + "CRC32": "A129AB46", + "BLAKE3": "F370EB75D8B2E24E394044960CFCDC56B610B2090CAFFF3288233B4B453570AB" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/18077" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/abcede01-3aea-4fa9-4bc0-d8a04d003a00/width=450/185599.jpeg", + "nsfw": true, + "width": 768, + "height": 768, + "hash": "UML3cBM{4:x]?vM{IAo#5SaxM{t7~VoeadkC", + "meta": { + "Size": "768x768", + "seed": 2217449848, + "Model": "chilloutmix_NiPrunedFp32Fix", + "steps": 30, + "prompt": "1girl, nsfw, arms up, spread legs, pussy, medium breasts, nipples, bottomless, , (RAW photo, best quality), (realistic, photo-realistic:1.2), smile, (high detailed skin:1.4), puffy eyes, gorgeous hair, brown black hair, soft lighting, high quality, cum, cum in pussy, cumdrip, simple background, ", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 7, + "resources": [ + { + "name": "koreanDollLikeness_v10", + "type": "lora", + "weight": 0.4 + }, + { + "name": "Creampie_v11", + "type": "lora", + "weight": 0.5 + }, + { + "hash": "fc2511737a", + "name": "chilloutmix_NiPrunedFp32Fix", + "type": "model" + } + ], + "Model hash": "fc2511737a", + "negativePrompt": "(EasyNegative:1.2), ng_deepnegative_v1_75t, paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, ((monochrome)), (grayscale:1.2), skin spots, acnes, skin blemishes, age spot, glans,extra fingers,fewer fingers,(watermark:1.2),(letters:1.2)", + "ControlNet Model": "difference_controlSd15Openpose [1723948e]", + "Face restoration": "CodeFormer", + "ControlNet Module": "none", + "ControlNet Weight": "1", + "ControlNet Enabled": "True", + "ControlNet Guidance Strength": "1" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/21cf3b76-7200-4f2e-aa36-2913db6d3500/width=450/185598.jpeg", + "nsfw": true, + "width": 768, + "height": 768, + "hash": "UEK]}q9|Td~U4:wI9FE2x]^*-o-:^+xu-pIo", + "meta": { + "Size": "768x768", + "seed": 2217449855, + "Model": "chilloutmix_NiPrunedFp32Fix", + "steps": 30, + "prompt": "1girl, nsfw, arms up, spread legs, pussy, medium breasts, nipples, bottomless, , (RAW photo, best quality), (realistic, photo-realistic:1.2), smile, (high detailed skin:1.4), puffy eyes, gorgeous hair, brown black hair, soft lighting, high quality, cum, cum in pussy, cumdrip, simple background, ", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 7, + "resources": [ + { + "name": "koreanDollLikeness_v10", + "type": "lora", + "weight": 0.4 + }, + { + "name": "Creampie_v11", + "type": "lora", + "weight": 0.5 + }, + { + "hash": "fc2511737a", + "name": "chilloutmix_NiPrunedFp32Fix", + "type": "model" + } + ], + "Model hash": "fc2511737a", + "negativePrompt": "(EasyNegative:1.2), ng_deepnegative_v1_75t, paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, ((monochrome)), (grayscale:1.2), skin spots, acnes, skin blemishes, age spot, glans,extra fingers,fewer fingers,(watermark:1.2),(letters:1.2)", + "ControlNet Model": "difference_controlSd15Openpose [1723948e]", + "Face restoration": "CodeFormer", + "ControlNet Module": "none", + "ControlNet Weight": "1", + "ControlNet Enabled": "True", + "ControlNet Guidance Strength": "1" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c9bbeb56-188e-4b42-f53b-a96159d83b00/width=450/185597.jpeg", + "nsfw": true, + "width": 768, + "height": 768, + "hash": "UCMY.zDj9]X80zbc9FM|pHt7kBnh~AofRQRP", + "meta": { + "Size": "768x768", + "seed": 2010732494, + "Model": "chilloutmix_NiPrunedFp32Fix", + "steps": 30, + "prompt": "1girl, nsfw, arms up, spread legs, pussy, medium breasts, nipples, bottomless, , (RAW photo, best quality), (realistic, photo-realistic:1.2), smile, (high detailed skin:1.4), puffy eyes, gorgeous hair, brown black hair, soft lighting, high quality, cum, cum in pussy, cumdrip:0.5, simple background, ", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 7, + "resources": [ + { + "name": "koreanDollLikeness_v10", + "type": "lora", + "weight": 0.4 + }, + { + "name": "Creampie_v11", + "type": "lora", + "weight": 0.5 + }, + { + "hash": "fc2511737a", + "name": "chilloutmix_NiPrunedFp32Fix", + "type": "model" + } + ], + "Model hash": "fc2511737a", + "negativePrompt": "(EasyNegative:1.2), ng_deepnegative_v1_75t, paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, ((monochrome)), (grayscale:1.2), skin spots, acnes, skin blemishes, age spot, glans,extra fingers,fewer fingers,(watermark:1.2),(letters:1.2)", + "ControlNet Model": "difference_controlSd15Openpose [1723948e]", + "Face restoration": "CodeFormer", + "ControlNet Module": "none", + "ControlNet Weight": "1", + "ControlNet Enabled": "True", + "ControlNet Guidance Strength": "1" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/18077" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/creampieHairyPussy_creampieV11.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/creampieHairyPussy_creampieV11.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..bd0af1867efe8b7267204d71830a07c93aeae756 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/creampieHairyPussy_creampieV11.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/creampieHairyPussy_creampieV11.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/creampieHairyPussy_creampieV11.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..c7049ecf3530bd6aa41567d045c9ca498b86afd6 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/creampieHairyPussy_creampieV11.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:826d251c22ebad508061ed14bf016e90b7461dcbbc07aba734466251e3ed061f +size 37861700 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/creampie_v10.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/creampie_v10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..a63c18a7348f1be2705f4de68b9528b193b4efb9 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\345\234\272\346\231\257\345\274\225\345\257\274/creampie_v10.civitai.info" @@ -0,0 +1,314 @@ +{ + "id": 36704, + "modelId": 30433, + "name": "v1.0", + "createdAt": "2023-04-05T05:13:37.687Z", + "updatedAt": "2023-04-10T02:19:26.768Z", + "trainedWords": [ + "cumdrip", + "cum dripping", + "spread legs", + "cum dripping from her pussy" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

Used bmaltais's implementation of kohya_ss LoRA training scripts.

Initial release. Depending on the model used, you'll need to mess with the cumdrip and cum dripping tokens. Also, you may need to adjust the LoRA weight itself.

Total Images: 40 total images, high resolution

Trigger word: cumdrip, cum dripping, spread legs

Training Steps: ~6000

Unet Training Rate: 5.0e-05 (0.00005)

Text Encoder Training Rate: 5.0e-05 (0.00005)

", + "stats": { + "downloadCount": 1631, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Creampie", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "creampie_v10.safetensors", + "id": 29403, + "sizeKB": 73846.181640625, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-05T05:16:15.274Z", + "hashes": { + "AutoV1": "D490A29A", + "AutoV2": "5A28560EC9", + "SHA256": "5A28560EC9433FF71DE72B95C9047AA41AF5366331916B3C444F2A1175ADA526", + "CRC32": "C6608C68", + "BLAKE3": "B612718081472C6A6EF3851175E622C1C22AF917C3B03C36C93EEC7B64B63AFC" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/36704" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b4f7bd91-aff5-4730-e630-37427e6e1300/width=450/455759.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UEJtbi?G57E2K0%201D*T{x[IV-p~VNGRP-p", + "meta": { + "Size": "512x768", + "seed": 3026073057, + "Model": "analogMadness_analogMadnessV3", + "steps": 20, + "hashes": { + "model": "efcd8115bb" + }, + "prompt": "cumdrip (8k uhd) photo of a naked [jennifer|heather:0.5] woman long blonde hair (small breasts) fair skin sitting up spread legs (white cum dripping) ((hairy pussy)) asshole ", + "sampler": "UniPC", + "cfgScale": 7, + "resources": [ + { + "hash": "efcd8115bb", + "name": "analogMadness_analogMadnessV3", + "type": "model" + } + ], + "Model hash": "efcd8115bb", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "negativePrompt": "ugly old weird young child shaved pussy hands large breasts", + "Face restoration": "CodeFormer", + "Denoising strength": "0.6" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b43a5371-6c42-4f33-ca17-e703f2829a00/width=450/455618.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UQHKePS0^l$*xvbDx^s:?wt6j^R*9XxZWANG", + "meta": { + "Size": "512x768", + "seed": 3911131514, + "Model": "analogMadness_analogMadnessV3", + "steps": 20, + "hashes": { + "model": "efcd8115bb" + }, + "prompt": "cumdrip (8k uhd) photo of a naked muscular black woman large breasts sitting up spread legs ((cum dripping)) out of her hairy pussy ", + "sampler": "UniPC", + "cfgScale": 7, + "resources": [ + { + "hash": "efcd8115bb", + "name": "analogMadness_analogMadnessV3", + "type": "model" + } + ], + "Model hash": "efcd8115bb", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "negativePrompt": "ugly old weird young child", + "Face restoration": "CodeFormer", + "Denoising strength": "0.3" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/870b77f7-4416-4b27-b670-c625a68d0500/width=450/455657.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UBJ7dn00%$-;169EEh%MPqRjRkS$m*%g+sNb", + "meta": { + "Size": "512x768", + "seed": 3732035640, + "Model": "analogMadness_analogMadnessV3", + "steps": 20, + "hashes": { + "model": "efcd8115bb" + }, + "prompt": "cumdrip 8k uhd photo of a naked muscular polynesian young woman large breasts sitting up spread legs white cum dripping (hairy pussy) ", + "sampler": "UniPC", + "cfgScale": 7, + "resources": [ + { + "hash": "efcd8115bb", + "name": "analogMadness_analogMadnessV3", + "type": "model" + } + ], + "Model hash": "efcd8115bb", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "negativePrompt": "ugly old weird young child", + "Face restoration": "CodeFormer", + "Denoising strength": "0.5" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b14430ac-0dca-46ba-5f5c-3172b342d700/width=450/425625.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "ULJQTYIUt7s:lUROx]R*OtVrtRae~pIT-ot6", + "meta": { + "Size": "512x768", + "seed": 684476072, + "Model": "analogMadness_analogMadnessV3", + "steps": 35, + "hashes": { + "model": "efcd8115bb" + }, + "prompt": "(cumdrip:1.2) Kodak kodachrome 1990s analog photo petite naked thai american woman fit muscular body small breasts tattoos thigh high stockings sitting on a couch spread legs (cum dripping) out of her hairy pussy ", + "sampler": "Euler", + "cfgScale": 7, + "resources": [ + { + "hash": "efcd8115bb", + "name": "analogMadness_analogMadnessV3", + "type": "model" + } + ], + "Model hash": "efcd8115bb", + "Hires steps": "70", + "Hires upscale": "2", + "Hires upscaler": "4x_NMKD-Superscale-SP_178000_G", + "negativePrompt": "ugly old weird child young", + "Face restoration": "CodeFormer", + "Denoising strength": "0.5" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/57b5dd78-593c-4adc-09f0-8f6a28b9b900/width=450/455624.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UOHx7~tR_3RP?wR+kXM{.TM{ShR*-9RPrWR*", + "meta": { + "Size": "512x768", + "seed": 566878828, + "Model": "analogMadness_analogMadnessV3", + "steps": 20, + "hashes": { + "model": "efcd8115bb" + }, + "prompt": "cumdrip (8k uhd) photo of a naked muscular black young woman large breasts sitting up spread legs (white cum dripping) hairy pussy ", + "sampler": "UniPC", + "cfgScale": 7, + "resources": [ + { + "hash": "efcd8115bb", + "name": "analogMadness_analogMadnessV3", + "type": "model" + } + ], + "Model hash": "efcd8115bb", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "negativePrompt": "ugly old weird young child", + "Face restoration": "CodeFormer", + "Denoising strength": "0.5" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ded3f495-0386-4439-c7d9-8441c59f6800/width=450/455751.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UDIO5{?vK59FSe_2yD9FYk?a$$M|R4%g-poz", + "meta": { + "Size": "512x768", + "seed": 3811463179, + "Model": "analogMadness_analogMadnessV3", + "steps": 20, + "hashes": { + "model": "efcd8115bb" + }, + "prompt": "cumdrip (8k uhd) photo of a naked (muscular woman) small breasts fair skin sitting up spread legs white cum dripping hairy pussy asshole ", + "sampler": "UniPC", + "cfgScale": 7, + "resources": [ + { + "hash": "efcd8115bb", + "name": "analogMadness_analogMadnessV3", + "type": "model" + } + ], + "Model hash": "efcd8115bb", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "negativePrompt": "ugly old weird young child shaved pussy hands", + "Face restoration": "CodeFormer", + "Denoising strength": "0.5" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/16cc7c90-31e2-4e11-1402-5c3b922f3100/width=450/455756.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "U3IEX_Z|0O0100}siv?^0H009G_200K7r]00", + "meta": { + "Size": "512x768", + "seed": 3811463179, + "Model": "analogMadness_analogMadnessV3", + "steps": 20, + "hashes": { + "model": "efcd8115bb" + }, + "prompt": "cumdrip (8k uhd) photo of a naked woman blonde hair (small breasts) fair skin sitting up spread legs white cum dripping (hairy pussy) asshole ", + "sampler": "UniPC", + "cfgScale": 7, + "resources": [ + { + "hash": "efcd8115bb", + "name": "analogMadness_analogMadnessV3", + "type": "model" + } + ], + "Model hash": "efcd8115bb", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "negativePrompt": "ugly old weird young child shaved pussy hands large breasts", + "Face restoration": "CodeFormer", + "Denoising strength": "0.5" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3bef7f95-b1a8-4e2a-e0e0-0cce08547700/width=450/424647.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UJKwOtob5P4.CS?bS$IUK+IS#,$+~CInnNaK", + "meta": { + "Size": "512x768", + "seed": 562263496, + "Model": "analogMadness_analogMadnessV3", + "steps": 35, + "hashes": { + "model": "efcd8115bb" + }, + "prompt": "(cumdrip:1.2) Kodak kodachrome 1990s analog photo naked woman fit body large breasts long silver hair sitting on a couch spread legs (cum dripping) out of her shaved pussy ", + "sampler": "Euler", + "cfgScale": 7, + "resources": [ + { + "hash": "efcd8115bb", + "name": "analogMadness_analogMadnessV3", + "type": "model" + } + ], + "Model hash": "efcd8115bb", + "Hires steps": "50", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "negativePrompt": "ugly old weird child young", + "Face restoration": "CodeFormer", + "Denoising strength": "0.3" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/36704" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/ConceptBlankEyesHypnosis_v10.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/ConceptBlankEyesHypnosis_v10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..c3f84d0671f1c6f2c9eacc7bf7e60ee1f287777c --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/ConceptBlankEyesHypnosis_v10.civitai.info" @@ -0,0 +1,397 @@ +{ + "id": 41679, + "modelId": 35267, + "name": "v1.0", + "createdAt": "2023-04-10T10:55:42.043Z", + "updatedAt": "2023-04-10T14:07:49.677Z", + "trainedWords": [ + "hypnoLora", + "empty eyes" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "model": { + "name": "\u3010Concept\u3011Blank eyes/Hypnosis/\u50ac\u7720/Mind control", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "ConceptBlankEyesHypnosis_v10.safetensors", + "id": 32059, + "sizeKB": 14931.994140625, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-10T11:10:46.300Z", + "hashes": { + "AutoV1": "40EFDB7B", + "AutoV2": "395C59138D", + "SHA256": "395C59138DE6710DCC1F8FFBCEFFE498B035B8BD46563B402D022E4320E7AC6D", + "CRC32": "5596E527", + "BLAKE3": "341B3DDA7EC41DA009AF309194DA313DA6C3FE37CB0BE0147B4917C13690AD2F" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/41679" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/edf82944-3488-4172-302d-2504595f2500/width=450/458822.jpeg", + "nsfw": true, + "width": 592, + "height": 888, + "hash": "UDL3}v0000x^MaNF0LtQ?^WB0L?a?uV@-BM|", + "meta": { + "ENSD": "31337", + "Size": "592x888", + "seed": 4288005093, + "Model": "Anything-V3.0", + "steps": 20, + "hashes": { + "model": "8712e20a5d" + }, + "prompt": "masterpiece, best quality, masterpiece,best quality,extremely detailed CG unity 8k wallpaper, colorful,1girl,solo,portrait,(exquisite facial features),attractive figure,empty eyes,hypnoLora,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "8712e20a5d", + "name": "Anything-V3.0", + "type": "model" + } + ], + "Model hash": "8712e20a5d", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans, lowres,bad anatomy,bad hands, text, error, missing fingers,extra digit, fewer digits, cropped, worstquality, low quality, normal quality,jpegartifacts,signature, watermark, username,blurry,bad feet,cropped,poorly drawn hands,poorly drawn face,mutation,deformed,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,extra fingers,fewer digits,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,text,error,missing fingers,missing arms,missing legs,extra digit,mask,mosaic censoring,penis,mask,sunglasses," + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/71cf69b0-6866-4f74-2c11-42667c786800/width=450/459571.jpeg", + "nsfw": true, + "width": 3350, + "height": 1892, + "hash": "UOLp?i_3_N_N?bWBWBof%MaxWAWB?bayRjoz", + "meta": { + "ENSD": "31337", + "Size": "592x888", + "seed": 2546894723, + "Model": "Anything-V3.0", + "steps": 20, + "hashes": { + "model": "8712e20a5d" + }, + "prompt": "masterpiece, best quality, masterpiece,best quality,extremely detailed CG unity 8k wallpaper, colorful,1girl,solo,portrait,(exquisite facial features),attractive figure,empty eyes,hypnoLora,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "8712e20a5d", + "name": "Anything-V3.0", + "type": "model" + } + ], + "Model hash": "8712e20a5d", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans, lowres,bad anatomy,bad hands, text, error, missing fingers,extra digit, fewer digits, cropped, worstquality, low quality, normal quality,jpegartifacts,signature, watermark, username,blurry,bad feet,cropped,poorly drawn hands,poorly drawn face,mutation,deformed,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,extra fingers,fewer digits,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,text,error,missing fingers,missing arms,missing legs,extra digit,mask,mosaic censoring,penis,mask,sunglasses," + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/599e3579-0446-4dc3-4899-6241c5c1bb00/width=450/498757.jpeg", + "nsfw": true, + "width": 1184, + "height": 1408, + "hash": "UFI#4F0000~p00_2S#s.JAIU-p%1%2xt$*og", + "meta": { + "ENSD": "31337", + "Size": "592x704", + "seed": 1351570694, + "Model": "Anything-V3.0", + "steps": 20, + "hashes": { + "model": "8712e20a5d" + }, + "prompt": "(masterpiece, highly detailed,absurdres:1.2),1girl, dusky skin, long black hair, kohl-lined eyes, large hoop earrings, white goddess dress, gold waist chain, lotus pose, Giza pyramids, mind control, entranced, parted lips, erect nipples, breasts, solo,hypnosis, meditation, sunbeam, dreamy gaze, incense smoke, mysterious allure, rapturous trance, euphoria, spiritual ecstasy, eternal bliss, peaceful oblivion,empty eyes,hypnoLora,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "ConceptBlankEyesHypnosis_v10", + "type": "lora", + "weight": 1 + }, + { + "hash": "8712e20a5d", + "name": "Anything-V3.0", + "type": "model" + } + ], + "Model hash": "8712e20a5d", + "Hires upscale": "2", + "Hires upscaler": "Latent (antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans, lowres,bad anatomy,bad hands, text, error, missing fingers,extra digit, fewer digits, cropped, worstquality, low quality, normal quality,jpegartifacts,signature, watermark, username,blurry,bad feet,cropped,poorly drawn hands,poorly drawn face,mutation,deformed,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,extra fingers,fewer digits,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,text,error,missing fingers,missing arms,missing legs,extra digit,mask,mosaic censoring,penis,mask,sunglasses", + "Denoising strength": "0.7" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/287680e4-4ed4-451b-4351-aa258d938300/width=450/499362.jpeg", + "nsfw": true, + "width": 1184, + "height": 1408, + "hash": "UPI;x6o}S}-;_3~W%LxttSozxas.?HE1NFWB", + "meta": { + "ENSD": "31337", + "Size": "592x704", + "seed": 414979722, + "Model": "CounterfeitV25_25", + "steps": 20, + "hashes": { + "model": "a074b8864e" + }, + "prompt": "(masterpiece, highly detailed,absurdres:1.3),1girl, long shot,dark skin, thick black hair, kohl-rimmed eyes, gold serpent armband, white linen dress, barley field, trance, possessed, parted lips, nipples visible, bare breasts swaying, solo, hieroglyphs, obelisks, incense haze, intoxicating allure, wanton ecstasy, rapture, bliss, spiritual frenzy, possession, oblivion,(egyptian clothes), nsfw, empty eyes,hypnoLora,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "ConceptBlankEyesHypnosis_v10", + "type": "lora", + "weight": 1 + }, + { + "hash": "a074b8864e", + "name": "CounterfeitV25_25", + "type": "model" + } + ], + "Model hash": "a074b8864e", + "Hires upscale": "2", + "Hires upscaler": "Latent (antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans, lowres,bad anatomy,bad hands, text, error, missing fingers,extra digit, fewer digits, cropped, worstquality, low quality, normal quality,jpegartifacts,signature, watermark, username,blurry,bad feet,cropped,poorly drawn hands,poorly drawn face,mutation,deformed,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,extra fingers,fewer digits,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,text,error,missing fingers,missing arms,missing legs,extra digit,mask,mosaic censoring,penis,mask,sunglasses", + "Denoising strength": "0.7" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0c81f246-334f-4bbf-64f9-74ce1a3a3000/width=450/502132.jpeg", + "nsfw": true, + "width": 1120, + "height": 1424, + "hash": "UDE{9F?^00$j~D%#TJ-pNH-;-;Rl%KE1M|^+", + "meta": { + "ENSD": "31337", + "Size": "560x712", + "seed": 279476786, + "Model": "anythingV5Anything_anythingV5PrtRE", + "steps": 20, + "hashes": { + "model": "7f96a1a9ca" + }, + "prompt": "(masterpiece, best quality, 8K) ,cinematic lighting,(space, stars), sci-fi, futuristic spacesuit, helmet, 1girl, long purple hair in zero G, aqua eyes,breasts, generator on chest, figure in space,, parted lips, limb spread, wires, spacesuit open, high tech details, earth in background, blue glow,mind control, trance, (enraptured),nsfw, empty eyes,hypnoLora,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "ConceptBlankEyesHypnosis_v10", + "type": "lora", + "weight": 1 + }, + { + "hash": "7f96a1a9ca", + "name": "anythingV5Anything_anythingV5PrtRE", + "type": "model" + } + ], + "Model hash": "7f96a1a9ca", + "Hires upscale": "2", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans, lowres,bad anatomy,bad hands, text, error, missing fingers,extra digit, fewer digits, cropped, worstquality, low quality, normal quality,jpegartifacts,signature, watermark, username,blurry,bad feet,cropped,poorly drawn hands,poorly drawn face,mutation,deformed,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,extra fingers,fewer digits,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,text,error,missing fingers,missing arms,missing legs,extra digit,mask,mosaic censoring,penis,mask,sunglasses,", + "Denoising strength": "0.7" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e1c29269-d653-4f30-2991-2e2b8419a500/width=450/499857.jpeg", + "nsfw": true, + "width": 1232, + "height": 1424, + "hash": "UECY,d5600~V9Zt7%2RjNZWBt7xtRjofWXax", + "meta": { + "ENSD": "31337", + "Size": "616x712", + "seed": 687148328, + "Model": "meinamix_meinaV8", + "steps": 20, + "hashes": { + "model": "30953ab0de" + }, + "prompt": "(masterpiece, highly detailed, absurdres:1.1),1girl, bronze skin, long raven hair, mayan,native american, full breasts, solo, looking at viewer, entranced obsidian eyes, parted plum lips, spellbound, stone chamber, torchlight, mind control, memory loss, jade collar, woven hemp leash, ancient ruins, hypnosis, feathered serpent dress, jewel navel plug, jaguar loincloth, codex, hieroglyphs, overgrown courtyard, temple bells,willing blood sacrifice, hidden sacrificial chamber, copal incense, bare soles ,nsfw, empty eyes,hypnoLora,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "ConceptBlankEyesHypnosis_v10", + "type": "lora", + "weight": 1 + }, + { + "hash": "30953ab0de", + "name": "meinamix_meinaV8", + "type": "model" + } + ], + "Model hash": "30953ab0de", + "Hires upscale": "2", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans, lowres,bad anatomy,bad hands, text, error, missing fingers,extra digit, fewer digits, cropped, worstquality, low quality, normal quality,jpegartifacts,signature, watermark, username,blurry,bad feet,cropped,poorly drawn hands,poorly drawn face,mutation,deformed,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,extra fingers,fewer digits,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,text,error,missing fingers,missing arms,missing legs,extra digit,mask,mosaic censoring,penis,mask,sunglasses", + "Denoising strength": "0.7" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/82090de9-2ac8-4b15-7b0f-17a703837f00/width=450/459193.jpeg", + "nsfw": true, + "width": 616, + "height": 912, + "hash": "UVKwU#~V_NEg.7MxElNKI@xZNyNeOZxZo#Rk", + "meta": { + "ENSD": "31337", + "Size": "616x912", + "seed": 3076923472, + "Model": "Anything-V3.0", + "steps": 20, + "hashes": { + "model": "8712e20a5d" + }, + "prompt": "detailed eyes, mascara, best quality, masterpiece, 1girl, chestnut hair, intricate swimsuit, cyberpunk, waist up, detailed face, beautiful eyes, light smile, beach, vibrant, sharp focus,empty eyes,hypnoLora, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "8712e20a5d", + "name": "Anything-V3.0", + "type": "model" + } + ], + "Model hash": "8712e20a5d", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans, lowres,bad anatomy,bad hands, text, error, missing fingers,extra digit, fewer digits, cropped, worstquality, low quality, normal quality,jpegartifacts,signature, watermark, username,blurry,bad feet,cropped,poorly drawn hands,poorly drawn face,mutation,deformed,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,extra fingers,fewer digits,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,text,error,missing fingers,missing arms,missing legs,extra digit,mask,mosaic censoring,penis,mask,sunglasses" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/23fce9a9-e3c9-4953-77ee-6c53acc22500/width=450/499719.jpeg", + "nsfw": true, + "width": 1232, + "height": 1424, + "hash": "U8HUC7003U}t00.800%2~p?H_2ni-;00%MIo", + "meta": { + "ENSD": "31337", + "Size": "616x712", + "seed": 4061560773, + "Model": "CounterfeitV25_25", + "steps": 20, + "hashes": { + "model": "a074b8864e" + }, + "prompt": "(masterpiece, highly detailed, absurdres:1.1),1girl, (dark skin,dark-skinned female,china dress:1.2),long black hair, china dress, voluptuous breasts, solo, looking at viewer, mesmerized eyes, parted lips, entranced, imperial bed, red lanterns, mind control, memory loss, jade choker, golden chains, forbidden palace, hypnosis, pearl jewelry, embroidered silk robe, hip sash, gem navel stud, silk loincloth, calligraphy scroll, oracle bone script, stone courtyard, nightingale floor, obedience bell, emperor's consort, secluded chamber, sandalwood, silk slippers ,nsfw, empty eyes,hypnoLora,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "ConceptBlankEyesHypnosis_v10", + "type": "lora", + "weight": 1 + }, + { + "hash": "a074b8864e", + "name": "CounterfeitV25_25", + "type": "model" + } + ], + "Model hash": "a074b8864e", + "Hires upscale": "2", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans, lowres,bad anatomy,bad hands, text, error, missing fingers,extra digit, fewer digits, cropped, worstquality, low quality, normal quality,jpegartifacts,signature, watermark, username,blurry,bad feet,cropped,poorly drawn hands,poorly drawn face,mutation,deformed,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,extra fingers,fewer digits,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,text,error,missing fingers,missing arms,missing legs,extra digit,mask,mosaic censoring,penis,mask,sunglasses", + "Denoising strength": "0.7" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/988afd2e-e1ae-46c4-c375-6b14f57f1d00/width=450/459843.jpeg", + "nsfw": true, + "width": 616, + "height": 832, + "hash": "UHKT#+0K%g~W4.D*_3RQE1My={9F^,ado#x[", + "meta": { + "ENSD": "31337", + "Size": "616x832", + "seed": 527440582, + "Model": "Anything-V3.0", + "steps": 20, + "hashes": { + "model": "8712e20a5d" + }, + "prompt": "detailed eyes,masterpiece,extremely detailed,illustration,absurdres,1girl, solo, long hair, breasts, covered nipples, bridal gauntlets, choker, brown eyes, black hair, hair ornament, looking at viewer, nail polish, small breasts, pussy juice, grabbing own breast,empty eyes,hypnoLora, ,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "8712e20a5d", + "name": "Anything-V3.0", + "type": "model" + } + ], + "Model hash": "8712e20a5d", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans, lowres,bad anatomy,bad hands, text, error, missing fingers,extra digit, fewer digits, cropped, worstquality, low quality, normal quality,jpegartifacts,signature, watermark, username,blurry,bad feet,cropped,poorly drawn hands,poorly drawn face,mutation,deformed,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,extra fingers,fewer digits,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,text,error,missing fingers,missing arms,missing legs,extra digit,mask,mosaic censoring,penis,mask,sunglasses" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/53dfe1ae-c4a1-485f-7893-2bcdb418c300/width=450/498735.jpeg", + "nsfw": true, + "width": 1184, + "height": 1408, + "hash": "UKLD[byD57~VElSQ.9^i0h%NRQxt00Mxi]kX", + "meta": { + "ENSD": "31337", + "Size": "592x704", + "seed": 2904331945, + "Model": "Anything-V3.0", + "steps": 20, + "hashes": { + "model": "8712e20a5d" + }, + "prompt": "(masterpiece, highly detailed,absurdres:1.15)1girl, angel wings, long blonde hair, blue eyes, white dress,halo, floating in sky, clouds, trance, mind control, parted lips, bare shoulders, breasts, solo, looking at viewer, daytime,feathers, sunbeam, golden hairclip, sunlight, wings spread, dreamy gaze,sky background, saintly glow, ethereal being, celestial maiden, hypnotized,entranced, peaceful bliss, aloft, rapture, euphoria, above the clouds empty eyes,hypnoLora,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "ConceptBlankEyesHypnosis_v10", + "type": "lora", + "weight": 1 + }, + { + "hash": "8712e20a5d", + "name": "Anything-V3.0", + "type": "model" + } + ], + "Model hash": "8712e20a5d", + "Hires upscale": "2", + "Hires upscaler": "Latent (antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans, lowres,bad anatomy,bad hands, text, error, missing fingers,extra digit, fewer digits, cropped, worstquality, low quality, normal quality,jpegartifacts,signature, watermark, username,blurry,bad feet,cropped,poorly drawn hands,poorly drawn face,mutation,deformed,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,extra fingers,fewer digits,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,text,error,missing fingers,missing arms,missing legs,extra digit,mask,mosaic censoring,penis,mask,sunglasses", + "Denoising strength": "0.7" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/41679" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/ConceptBlankEyesHypnosis_v10.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/ConceptBlankEyesHypnosis_v10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..246942f666aab2c3e5838f6300926adf6d07a70a Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/ConceptBlankEyesHypnosis_v10.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/ConceptBlankEyesHypnosis_v10.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/ConceptBlankEyesHypnosis_v10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..75ef58fb5bf3280798ad57ee7b4bc33d4e05e77e --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/ConceptBlankEyesHypnosis_v10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:395c59138de6710dcc1f8ffbceffe498b035b8bd46563b402d022e4320e7ac6d +size 15290362 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/EmptyEyes_Diffuser_v10.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/EmptyEyes_Diffuser_v10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..080a64810e896f6d150d95166e21ba636c2d82fb --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/EmptyEyes_Diffuser_v10.civitai.info" @@ -0,0 +1,130 @@ +{ + "id": 97655, + "modelId": 91611, + "name": "v1.0", + "createdAt": "2023-06-17T03:30:41.276Z", + "updatedAt": "2023-06-17T03:35:20.100Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

First release

", + "stats": { + "downloadCount": 102, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Empty Eyes / Highlighting Diffuser [Tools]", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "EmptyEyes_Diffuser_v10.safetensors", + "id": 67923, + "sizeKB": 15398.9013671875, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-17T03:35:57.544Z", + "hashes": { + "AutoV1": "E13FCB61", + "AutoV2": "FA2EEBC7EB", + "SHA256": "FA2EEBC7EBB747428AF4F7A69AF76A16710D25C87CCE2A697AE151D92CA4D496", + "CRC32": "CDEF9C31", + "BLAKE3": "98FDF444566A47B1E6ED62552D41C16BE5E6D3CCEB8A1E519DEE36BB499F0A6E" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/97655" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a2cb9c79-6ede-4b5e-ba30-7f276a0e324f/width=450/1173892.jpeg", + "nsfw": "None", + "width": 800, + "height": 1280, + "hash": "ULJa+Z~CMKMx+|%gNsVsNE=x-UE1_2nOQ-IB", + "meta": { + "Size": "400x640", + "seed": 625929962, + "Model": "anythingV5Anything_anythingV5PrtRE", + "steps": 37, + "hashes": { + "model": "7f96a1a9ca" + }, + "prompt": "(masterpiece:1.2),best quality,illustration,beautiful detailed girl,\n(1girl) (passing:1.2) with another preson,front view,(arms aside:1.1),\n(sweat:1.2),(smile:1.1),open mouth,upper body,grey eyes,\n(short hair:1.0),blunt bangs,green frilled dress,botton,ribbon,belt,\nbacklighting ", + "sampler": "DPM++ 2M", + "cfgScale": 12, + "Clip skip": "2", + "resources": [ + { + "name": "EmptyEyes_Diffuser_v10", + "type": "lora", + "weight": 2.5 + }, + { + "hash": "7f96a1a9ca", + "name": "anythingV5Anything_anythingV5PrtRE", + "type": "model" + } + ], + "Model hash": "7f96a1a9ca", + "Hires steps": "40", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(worst quality,low quality:1.3),(lip,rouge,lipstick, eyeshadow,monochrome:1.0), watermark,navel,(from side:1.2),(sadly:1.0)", + "Denoising strength": "0.7" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e8048b2f-862d-4ca3-97a9-e765bcd36e0a/width=450/1173899.jpeg", + "nsfw": "None", + "width": 988, + "height": 1316, + "hash": "U2HL6z8wwJD4_OiJS1qv-CtRI;n~.nQnxZ8w", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/04430546-d770-45c9-bb8d-fe8002bc52a2/width=450/1173916.jpeg", + "nsfw": "None", + "width": 800, + "height": 1280, + "hash": "URJt*hEl?w_2yFi^JBE1KR#QIoIo?GNaIU%0", + "meta": { + "Size": "400x640", + "seed": 1945737767, + "Model": "CounterfeitV30_v30", + "steps": 38, + "hashes": { + "model": "cbfba64e66" + }, + "prompt": "(masterpiece:1.2),best quality,illustration,beautiful detailed girl,\n(1girl) (standing at attention),front view,arms aside,\n(sweat:1.2),(smile:1.1),open mouth,upper body,red eyes,\n(long hair:1.1),blunt bangs,green frilled dress,botton,ribbon,belt,\nbacklighting ", + "sampler": "DPM++ 2M", + "cfgScale": 12, + "Clip skip": "2", + "resources": [ + { + "hash": "cbfba64e66", + "name": "CounterfeitV30_v30", + "type": "model" + } + ], + "Model hash": "cbfba64e66", + "Hires steps": "40", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(worst quality,low quality:1.3),(lip,rouge,lipstick, eyeshadow,monochrome:1.0), watermark,navel,(from side:1.2),sadly", + "Denoising strength": "0.7" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/97655" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/EmptyEyes_Diffuser_v10.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/EmptyEyes_Diffuser_v10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..e8387223492529017c47dd29f721db7e9b2ce786 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/EmptyEyes_Diffuser_v10.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/EmptyEyes_Diffuser_v10.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/EmptyEyes_Diffuser_v10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..f6f0796ab59e6620a78c71cd34f7d79990eb190e --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/EmptyEyes_Diffuser_v10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:fa2eebc7ebb747428af4f7a69af76a16710d25c87cce2a697ae151d92ca4d496 +size 15768475 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/HeartStarShapedPupils_HeartStarShapedPupils.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/HeartStarShapedPupils_HeartStarShapedPupils.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..cb3be30021576a35e573b682c6ef8f8824199383 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/HeartStarShapedPupils_HeartStarShapedPupils.civitai.info" @@ -0,0 +1,287 @@ +{ + "id": 7434, + "modelId": 6052, + "name": "\u2764\ufe0fHeart & Star\u2b50 Shaped Pupils Inpaint", + "createdAt": "2023-02-02T21:10:04.101Z", + "updatedAt": "2023-02-10T17:44:46.988Z", + "trainedWords": [ + "heart-shaped pupils", + "star-shaped pupils" + ], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": "

Added option to do both Heart & Star Shaped Pupils

", + "model": { + "name": "\u2764\ufe0fHeart & Star\u2b50 Shaped Pupils Inpaint - LoRA", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "HeartStarShapedPupils_HeartStarShapedPupils.safetensors", + "id": 7504, + "sizeKB": 73840.314453125, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-02-02T21:11:43.166Z", + "hashes": { + "AutoV1": "03D535E8", + "AutoV2": "17C016A691", + "SHA256": "17C016A691763340D05C947981FD32F5086D8A3340D275BDE8D5AA5B4CF0612B", + "CRC32": "9CCFE72A", + "BLAKE3": "C96FEA553198BE4A9CEE4818D9C623484085A381670774E367F1EBE7F6874244" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/7434" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4be8b332-44b9-49c9-4e6f-e9921c83c000/width=450/69483.jpeg", + "nsfw": false, + "width": 768, + "height": 768, + "hash": "UPL4$$^Q0fX9J+%NVsMx0K9Z-ptR~qtRM{Rk", + "meta": { + "ENSD": "31337", + "Size": "768x768", + "seed": 4180570895, + "Model": "#Anything-V3.0-pruned-fp32", + "steps": 20, + "prompt": "heart-shaped pupils, ,", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "Mask blur": "4", + "resources": [ + { + "name": "heartstarpupils", + "type": "lora", + "weight": 1 + }, + { + "hash": "b8c6adacd2", + "name": "#Anything-V3.0-pruned-fp32", + "type": "model" + } + ], + "Model hash": "b8c6adacd2", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name", + "Denoising strength": "0.75" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b4855dab-72d7-4f6a-b862-3026a958bd00/width=450/69482.jpeg", + "nsfw": false, + "width": 512, + "height": 768, + "hash": "UMJ7zVI9^+ae~pxa?bMx?bsm?bWB?cxuIUo#", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2699250114, + "Model": "AbyssOrangeMix2_sfw", + "steps": 20, + "prompt": "star-shaped pupils, ,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "Mask blur": "4", + "resources": [ + { + "name": "heartstarpupils", + "type": "lora", + "weight": 1 + }, + { + "hash": "038ba203d8", + "name": "AbyssOrangeMix2_sfw", + "type": "model" + } + ], + "Model hash": "038ba203d8", + "negativePrompt": "nsfw, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name", + "Denoising strength": "0.75" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b48f38be-df89-4c1c-b34c-37376c829a00/width=450/69511.jpeg", + "nsfw": false, + "width": 512, + "height": 768, + "hash": "UMJ7zVI9^+ae~pxa?bMx?bsm?bWB?cxuIUo}", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1800815265, + "Model": "AbyssOrangeMix2_sfw", + "steps": 20, + "prompt": "heart-shaped pupils, ,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "Mask blur": "4", + "resources": [ + { + "name": "heartstarpupils", + "type": "lora", + "weight": 1 + }, + { + "hash": "038ba203d8", + "name": "AbyssOrangeMix2_sfw", + "type": "model" + } + ], + "Model hash": "038ba203d8", + "negativePrompt": "nsfw, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name", + "Denoising strength": "0.75" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a07e2fc2-ca12-426e-7f4a-af4405ad2800/width=450/69510.jpeg", + "nsfw": false, + "width": 512, + "height": 768, + "hash": "UMJ7zVI9^+WB~pxa?bMx?bsm?bWB?cxuIUo}", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3284782239, + "Model": "AbyssOrangeMix2_sfw", + "steps": 20, + "prompt": "heart-shaped pupils, ,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "Mask blur": "4", + "resources": [ + { + "name": "heartstarpupils", + "type": "lora", + "weight": 1 + }, + { + "hash": "038ba203d8", + "name": "AbyssOrangeMix2_sfw", + "type": "model" + } + ], + "Model hash": "038ba203d8", + "negativePrompt": "nsfw, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name", + "Denoising strength": "0.75" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/84dd2b16-1a40-4342-0239-f8b6180c3300/width=450/69481.jpeg", + "nsfw": false, + "width": 768, + "height": 1152, + "hash": "UaKd_EE2~qR*?vt7aexaM{Mx%2%2Ioxas:R*", + "meta": { + "ENSD": "31337", + "Size": "768x1152", + "seed": 69237591, + "Model": "AbyssOrangeMix2_hard", + "steps": 20, + "prompt": "star-shaped pupils, ,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "Mask blur": "4", + "resources": [ + { + "name": "heartstarpupils", + "type": "lora", + "weight": 1 + }, + { + "hash": "0fc198c490", + "name": "AbyssOrangeMix2_hard", + "type": "model" + } + ], + "Model hash": "0fc198c490", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name", + "Denoising strength": "0.75" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/10409512-ac6a-40b7-c9d6-e166509a9800/width=450/69480.jpeg", + "nsfw": false, + "width": 768, + "height": 768, + "hash": "UEL4{a,.*05]0:4o~CDk8{D*%3Mdxxo3Io%N", + "meta": { + "ENSD": "31337", + "Size": "768x768", + "seed": 3695168255, + "Model": "#Anything-V3.0-pruned-fp32", + "steps": 20, + "prompt": "heart-shaped pupils, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "Mask blur": "4", + "resources": [ + { + "name": "heartstarpupils", + "type": "lora", + "weight": 1 + }, + { + "hash": "b8c6adacd2", + "name": "#Anything-V3.0-pruned-fp32", + "type": "model" + } + ], + "Model hash": "b8c6adacd2", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name", + "Denoising strength": "0.75" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/07e5da67-d565-47d2-262a-9f34d5f7ae00/width=450/88847.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UMHx+,DQufr?,lIoxnozOsNs.7oyr]tPxbM_", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 1507481474, + "Model": "AbyssOrangeMix2_sfw", + "steps": 20, + "prompt": "star-shaped pupils, ,", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "Mask blur": "4", + "resources": [ + { + "name": "heartstarpupils", + "type": "lora", + "weight": 1 + }, + { + "hash": "038ba203d8", + "name": "AbyssOrangeMix2_sfw", + "type": "model" + } + ], + "Model hash": "038ba203d8", + "negativePrompt": "(nsfw:1.3), (worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1)", + "Denoising strength": "0.75" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/7434" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/HeartStarShapedPupils_HeartStarShapedPupils.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/HeartStarShapedPupils_HeartStarShapedPupils.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..0cae6de2efba6763b4a3c0857d7a2d15a8152a58 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/HeartStarShapedPupils_HeartStarShapedPupils.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/HeartStarShapedPupils_HeartStarShapedPupils.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/HeartStarShapedPupils_HeartStarShapedPupils.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..cc3daa8b86df1a6dd7dacb16a4b62706477b362e --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/HeartStarShapedPupils_HeartStarShapedPupils.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:17c016a691763340d05c947981fd32f5086d8a3340d275bde8d5aa5b4cf0612b +size 75612482 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/HypnosisBlankEyesAnzu_v1.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/HypnosisBlankEyesAnzu_v1.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..fd03d7fada6990cfc9df7d55eba77e07dbb56bc0 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/HypnosisBlankEyesAnzu_v1.civitai.info" @@ -0,0 +1,261 @@ +{ + "id": 15209, + "modelId": 12909, + "name": "v1", + "createdAt": "2023-02-25T10:59:05.616Z", + "updatedAt": "2023-02-25T11:28:05.146Z", + "trainedWords": [ + "expressionless", + "blank_eyes ", + "mazaki_anzu_", + "bonnie_\\(pokemon\\)", + "hinaichi", + "mind_control" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

First version, not tested that much.
I made a typo in mazaki_anzu_ so you should include that underscore at the end.

", + "model": { + "name": " Hypnosis | Blank Eyes | Anzu | Bonnie | Hinaichi", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "HypnosisBlankEyesAnzu_v1.safetensors", + "id": 13040, + "sizeKB": 147585.71875, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-02-25T11:01:21.086Z", + "hashes": { + "AutoV1": "B9B89156", + "AutoV2": "9509D89F98", + "SHA256": "9509D89F98299961759321FC08CA0FE2AD4CFFC08F7033C7CBBC01D6CC96ECA2", + "CRC32": "79181796", + "BLAKE3": "77F45E0B4BF442EB85C98C9594E180BD164F906016579E4C46966B25142D05DB" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/15209" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/32cabf2f-a317-4c9a-d7bf-b4f839080c00/width=450/149864.jpeg", + "nsfw": true, + "width": 640, + "height": 1024, + "hash": "UOLqU.4=$txp,kaJ?wogDhad%gxuRkaextof", + "meta": { + "Size": "640x1024", + "seed": 2840429590, + "steps": 22, + "prompt": "blank_eyes, expressionless, arms_down, mazaki_anzu_, blue_eyes, brown_hair, short_hair, solo, 1girl, realistic:0.6 ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "name": "L_BlankEyes_v1", + "type": "lora", + "weight": 0.5 + } + ], + "Model hash": "ed11f5cd10", + "negativePrompt": "(worst quality:2), (low quality:2),inaccurate limb,lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name,{{closed eyes}},in the distance,multiple view, malformed hands ,worst quality ,low quality,{{{{ugly}}}},{{{duplicate}}}, {out of frame},extra fingers,mutated hands,extra limbs,{bad anatomy},{malformed limbs},{{missing arms}},{{missing legs}},{{{extra arms}}},{{{extra legs}}},{fused fingers},{{{long neck}}},fingers,extra digit,cropped,bad feet, {{{mutation}}},{{deformed}},{blurry},{{{bad proportions}}},{{{disfigured}}},bad anatomy ,disfigured,malformed ,mutated,missing limb, too many fingers,{{morbid}},{{mutilated}}, bad-artist, bad-artist-anime, censored, blur, blurred, mosiaic_censorship, bar_censorship" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/316bfb64-3a2e-45e4-447a-62ac19badc00/width=450/149889.jpeg", + "nsfw": false, + "width": 640, + "height": 1024, + "hash": "UqI||4IBTJRj~BWBNwbHs:oMo}bGR+s:tQfl", + "meta": { + "Size": "640x1024", + "seed": 3286652560, + "steps": 22, + "prompt": "blank_eyes, expressionless, arms_down, hinaichi, green_eyes, red_hair, long_hair, solo, 1girl, military_uniform, realistic:0.6 ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "name": "L_BlankEyes_v1", + "type": "lora", + "weight": 0.5 + } + ], + "Model hash": "ed11f5cd10", + "negativePrompt": "(worst quality:2), (low quality:2),inaccurate limb,lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name,{{closed eyes}},in the distance,multiple view, malformed hands ,worst quality ,low quality,{{{{ugly}}}},{{{duplicate}}}, {out of frame},extra fingers,mutated hands,extra limbs,{bad anatomy},{malformed limbs},{{missing arms}},{{missing legs}},{{{extra arms}}},{{{extra legs}}},{fused fingers},{{{long neck}}},fingers,extra digit,cropped,bad feet, {{{mutation}}},{{deformed}},{blurry},{{{bad proportions}}},{{{disfigured}}},bad anatomy ,disfigured,malformed ,mutated,missing limb, too many fingers,{{morbid}},{{mutilated}}, bad-artist, bad-artist-anime, censored, blur, blurred, mosiaic_censorship, bar_censorship" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8b685ef0-25b5-4b21-4e30-1ae1a5a5b600/width=450/149939.jpeg", + "nsfw": false, + "width": 640, + "height": 1024, + "hash": "URLEWgE8UH_N^btmNeIUtLRQRRoxS#WAt9$~", + "meta": { + "Size": "640x1024", + "seed": 832050988, + "steps": 22, + "prompt": "blank_eyes, expressionless, arms_down, bonnie_\\(pokemon\\) ,blue_eyes, blonde_hair, short_hair, solo, 1girl, flat_chest, realistic:0.8, side_ponytail ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "name": "L_BlankEyes_v1", + "type": "lora", + "weight": 0.7 + } + ], + "Model hash": "ed11f5cd10", + "negativePrompt": "(worst quality:2), (low quality:2),inaccurate limb,lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name,{{closed eyes}},in the distance,multiple view, malformed hands ,worst quality ,low quality,{{{{ugly}}}},{{{duplicate}}}, {out of frame},extra fingers,mutated hands,extra limbs,{bad anatomy},{malformed limbs},{{missing arms}},{{missing legs}},{{{extra arms}}},{{{extra legs}}},{fused fingers},{{{long neck}}},fingers,extra digit,cropped,bad feet, {{{mutation}}},{{deformed}},{blurry},{{{bad proportions}}},{{{disfigured}}},bad anatomy ,disfigured,malformed ,mutated,missing limb, too many fingers,{{morbid}},{{mutilated}}, bad-artist, bad-artist-anime, censored, blur, blurred, mosiaic_censorship, bar_censorship" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b2af2f92-b120-49ce-b640-5a3b1ca12700/width=450/149936.jpeg", + "nsfw": false, + "width": 640, + "height": 1024, + "hash": "UNJt-X01T2E0pAo#ahM{tQWBoNM_~VD*-pbZ", + "meta": { + "Size": "640x1024", + "seed": 2878664072, + "steps": 22, + "prompt": "blank_eyes, expressionless, arms_down, red_eyes, curls,curly_hair, green_hair, short_hair, solo, 1girl, realistic:0.8, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "name": "L_BlankEyes_v1", + "type": "lora", + "weight": 0.5 + } + ], + "Model hash": "ed11f5cd10", + "negativePrompt": "(worst quality:2), (low quality:2),inaccurate limb,lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name,{{closed eyes}},in the distance,multiple view, malformed hands ,worst quality ,low quality,{{{{ugly}}}},{{{duplicate}}}, {out of frame},extra fingers,mutated hands,extra limbs,{bad anatomy},{malformed limbs},{{missing arms}},{{missing legs}},{{{extra arms}}},{{{extra legs}}},{fused fingers},{{{long neck}}},fingers,extra digit,cropped,bad feet, {{{mutation}}},{{deformed}},{blurry},{{{bad proportions}}},{{{disfigured}}},bad anatomy ,disfigured,malformed ,mutated,missing limb, too many fingers,{{morbid}},{{mutilated}}, bad-artist, bad-artist-anime, censored, blur, blurred, mosiaic_censorship, bar_censorship, red_hair, hinaichi" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/fdbc0041-c5a8-42c8-a8ce-6f555ad85900/width=450/149938.jpeg", + "nsfw": true, + "width": 640, + "height": 1024, + "hash": "UfNv}U%L?]xtR4oybwV[-:WBo}WC%Mj[t6js", + "meta": { + "Size": "640x1024", + "seed": 2956708566, + "steps": 22, + "prompt": "blank_eyes, expressionless, arms_down, red_eyes, curls,curly_hair, purple_hair, long_hair, solo, 1girl, ealistic:0.8, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "name": "L_BlankEyes_v1", + "type": "lora", + "weight": 0.5 + } + ], + "Model hash": "ed11f5cd10", + "negativePrompt": "(worst quality:2), (low quality:2),inaccurate limb,lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name,{{closed eyes}},in the distance,multiple view, malformed hands ,worst quality ,low quality,{{{{ugly}}}},{{{duplicate}}}, {out of frame},extra fingers,mutated hands,extra limbs,{bad anatomy},{malformed limbs},{{missing arms}},{{missing legs}},{{{extra arms}}},{{{extra legs}}},{fused fingers},{{{long neck}}},fingers,extra digit,cropped,bad feet, {{{mutation}}},{{deformed}},{blurry},{{{bad proportions}}},{{{disfigured}}},bad anatomy ,disfigured,malformed ,mutated,missing limb, too many fingers,{{morbid}},{{mutilated}}, bad-artist, bad-artist-anime, censored, blur, blurred, mosiaic_censorship, bar_censorship, red_hair, hinaichi" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6f1b0884-74d9-428d-ba97-5df91768b800/width=450/149937.jpeg", + "nsfw": false, + "width": 640, + "height": 1024, + "hash": "UKKnPU000fR7]}IC?]JVXAOsS$X8xuIoN[%L", + "meta": { + "Size": "640x1024", + "seed": 2956708565, + "steps": 22, + "prompt": "blank_eyes, expressionless, arms_down, red_eyes, curls,curly_hair, purple_hair, long_hair, solo, 1girl, ealistic:0.8, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "name": "L_BlankEyes_v1", + "type": "lora", + "weight": 0.5 + } + ], + "Model hash": "ed11f5cd10", + "negativePrompt": "(worst quality:2), (low quality:2),inaccurate limb,lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name,{{closed eyes}},in the distance,multiple view, malformed hands ,worst quality ,low quality,{{{{ugly}}}},{{{duplicate}}}, {out of frame},extra fingers,mutated hands,extra limbs,{bad anatomy},{malformed limbs},{{missing arms}},{{missing legs}},{{{extra arms}}},{{{extra legs}}},{fused fingers},{{{long neck}}},fingers,extra digit,cropped,bad feet, {{{mutation}}},{{deformed}},{blurry},{{{bad proportions}}},{{{disfigured}}},bad anatomy ,disfigured,malformed ,mutated,missing limb, too many fingers,{{morbid}},{{mutilated}}, bad-artist, bad-artist-anime, censored, blur, blurred, mosiaic_censorship, bar_censorship, red_hair, hinaichi" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a1ce8dfe-2be2-4a14-9504-670b2c8b8d00/width=450/149902.jpeg", + "nsfw": false, + "width": 893, + "height": 2494, + "hash": "UNL|iW1Q0O.A%KRkR+WBogofRjoe-mRjNGWA", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/012d17f8-62fa-4ac3-b839-6c6f56fefb00/width=450/149935.jpeg", + "nsfw": true, + "width": 640, + "height": 1024, + "hash": "UgKn9+IU~qog?Go2NHM{NHt7f+a|NGbH%Lof", + "meta": { + "Size": "640x1024", + "seed": 331422782, + "steps": 22, + "prompt": "arms_down, yellow_eyes, black_hair, short_hair, solo, 1girl, realistic:0.8, glasses:1.2, eyewear, open_mouth, happy, smile, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "name": "L_BlankEyes_v1", + "type": "lora", + "weight": 0.5 + } + ], + "Model hash": "ed11f5cd10", + "negativePrompt": "(worst quality:2), (low quality:2),inaccurate limb,lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name,{{closed eyes}},in the distance,multiple view, malformed hands ,worst quality ,low quality,{{{{ugly}}}},{{{duplicate}}}, {out of frame},extra fingers,mutated hands,extra limbs,{bad anatomy},{malformed limbs},{{missing arms}},{{missing legs}},{{{extra arms}}},{{{extra legs}}},{fused fingers},{{{long neck}}},fingers,extra digit,cropped,bad feet, {{{mutation}}},{{deformed}},{blurry},{{{bad proportions}}},{{{disfigured}}},bad anatomy ,disfigured,malformed ,mutated,missing limb, too many fingers,{{morbid}},{{mutilated}}, bad-artist, bad-artist-anime, censored, blur, blurred, mosiaic_censorship, bar_censorship, red_hair, hinaichi" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1a30ae72-4ae0-4742-84e4-e87b31fc4e00/width=450/149940.jpeg", + "nsfw": false, + "width": 640, + "height": 1024, + "hash": "UnKd[9~px]%MD#t8ozkCNLs:%2WVW=t6xuWA", + "meta": { + "Size": "640x1024", + "seed": 3953876079, + "steps": 22, + "prompt": "blank_eyes, expressionless, arms_down, yellow_eyes, black_hair, short_hair, solo, 1girl, realistic:0.8, glasses:1.2, eyewear, open_mouth, drooling ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "name": "L_BlankEyes_v1", + "type": "lora", + "weight": 0.5 + } + ], + "Model hash": "ed11f5cd10", + "negativePrompt": "(worst quality:2), (low quality:2),inaccurate limb,lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name,{{closed eyes}},in the distance,multiple view, malformed hands ,worst quality ,low quality,{{{{ugly}}}},{{{duplicate}}}, {out of frame},extra fingers,mutated hands,extra limbs,{bad anatomy},{malformed limbs},{{missing arms}},{{missing legs}},{{{extra arms}}},{{{extra legs}}},{fused fingers},{{{long neck}}},fingers,extra digit,cropped,bad feet, {{{mutation}}},{{deformed}},{blurry},{{{bad proportions}}},{{{disfigured}}},bad anatomy ,disfigured,malformed ,mutated,missing limb, too many fingers,{{morbid}},{{mutilated}}, bad-artist, bad-artist-anime, censored, blur, blurred, mosiaic_censorship, bar_censorship, red_hair, hinaichi" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/15209" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/HypnosisBlankEyesAnzu_v1.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/HypnosisBlankEyesAnzu_v1.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..a3814fb9dd22b52cbaff7e96a88e51be428d411c Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/HypnosisBlankEyesAnzu_v1.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/HypnosisBlankEyesAnzu_v1.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/HypnosisBlankEyesAnzu_v1.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..6c29378d3f92561e34410e85dedee410ab7aacc1 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/HypnosisBlankEyesAnzu_v1.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:9509d89f98299961759321fc08ca0fe2ad4cffc08f7033c7cbbc01d6cc96eca2 +size 151127776 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/LessHighlightEyes.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/LessHighlightEyes.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..35248b1ab6ef77885b67afff3d332a3c826befa6 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/LessHighlightEyes.civitai.info" @@ -0,0 +1,108 @@ +{ + "id": 112372, + "modelId": 104797, + "name": "v1.0", + "createdAt": "2023-07-07T17:08:29.958Z", + "updatedAt": "2023-07-07T17:20:37.198Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 144, + "ratingCount": 1, + "rating": 5 + }, + "model": { + "name": "Less Highlight Eyes", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "LessHighlightEyes.safetensors", + "id": 79660, + "sizeKB": 9324.0234375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-07-07T17:11:11.675Z", + "hashes": { + "AutoV1": "A64953E2", + "AutoV2": "97CA2B5A14", + "SHA256": "97CA2B5A1471F75C1E0DD810147F049BF7C3DF5DA2391ADC7C864905279A9237", + "CRC32": "2C7FFA13", + "BLAKE3": "857A67FA54A53A2E67FDF4A4DC622D0FA89853A903DF34ECDFF49042F9AD637A" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/112372" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d361fc3a-1fff-4555-b4f2-43b521ceeaf0/width=450/1450321.jpeg", + "nsfw": "None", + "width": 768, + "height": 1152, + "hash": "UEJ*C$0z.RWB-QjHtl?aSi4:n3IU_NV?%MWA", + "meta": { + "Size": "512x768", + "seed": 1996076253, + "steps": 20, + "prompt": "1girl, focus face, gray hair, medium hair, bangs, blue eyes, T-shirt, ", + "Version": "v1.3.2", + "sampler": "DPM++ 2M Karras", + "cfgScale": 5, + "clipSkip": 2, + "resources": [ + { + "name": "LessHighlightEyes", + "type": "lora", + "weight": 1 + } + ], + "Model hash": "4035a21e3f", + "Hires steps": "40", + "Hires upscale": "1.5", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "EasyNegative, (worst quality:1.4), (low quality:1.4)", + "\"LessHighlightEyes": "ca58522090d4\"", + "Denoising strength": "0.3" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c33b4305-3987-47c8-87e5-84d921ff2b33/width=450/1450325.jpeg", + "nsfw": "None", + "width": 3840, + "height": 1301, + "hash": "UaIhT]ofayof-;kCf6j[-;R*oeay~qofayj[", + "meta": { + "Size": "512x768", + "seed": 2855581090, + "steps": 20, + "Script": "X/Y/Z plot", + "X Type": "AddNet Weight 1", + "prompt": "UNICODE1girl, upper body, gray hair, medium hair, bangs", + "Version": "v1.3.2", + "sampler": "DPM++ 2M Karras", + "X Values": "\"0,0.5,1,1.5,2\"", + "cfgScale": 7, + "clipSkip": 2, + "resources": [], + "Model hash": "4035a21e3f", + "Hires upscale": "1.5", + "Hires upscaler": "Latent", + "negativePrompt": "EasyNegative", + "Denoising strength": "0.7" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/112372" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/LessHighlightEyes.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/LessHighlightEyes.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..52fc979ad74abe401a8312e865b04b9567a05407 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/LessHighlightEyes.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/LessHighlightEyes.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/LessHighlightEyes.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..4e61029c848a41816ad126af6ba33ce98cfb8c3c --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/LessHighlightEyes.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:97ca2b5a1471f75c1e0dd810147f049bf7c3df5da2391adc7c864905279a9237 +size 9547800 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/TAT3-000009.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/TAT3-000009.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..d1689f226bb15cd9874d5654d6f10c194b1fbcf3 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/TAT3-000009.civitai.info" @@ -0,0 +1,267 @@ +{ + "id": 86519, + "modelId": 81536, + "name": "v1.0", + "createdAt": "2023-05-31T20:51:03.804Z", + "updatedAt": "2023-05-31T20:52:41.427Z", + "trainedWords": [ + "TAT, wavy mouth, frown, 1girl, crying with eyes open, crying, tearing up, tears, sad, portrait, upper body, white background," + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 74, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "(Loha) ichigo emotes/emoji/\u8393\u529e\u6cd5\u8868\u60c5\u53050.o", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "TAT3-000009.safetensors", + "id": 59146, + "sizeKB": 29752.310546875, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-31T20:55:40.087Z", + "hashes": { + "AutoV1": "87560497", + "AutoV2": "0D4FA1F896", + "SHA256": "0D4FA1F8964D756F52B1BE6E25E6543797D3C9167F97E095C9DDB1E9273F1871", + "CRC32": "B5802D27", + "BLAKE3": "3F64C4F4573ED4BCE72A4C3B41AC51AFDA99D2A793D5405C47A753BA008C37C0" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/86519" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/733fbe40-ab54-4774-8e12-02c8cf88e677/width=450/985537.jpeg", + "nsfw": "None", + "width": 1280, + "height": 1920, + "hash": "UVJa.u?dJDt6IVD*?as,%$-o~VRjozRjx[oz", + "meta": { + "ENSD": "-1", + "Size": "512x768", + "seed": 4071158166, + "Model": "meinaalter_v1", + "steps": 30, + "hashes": { + "model": "149fe7d36c" + }, + "prompt": "TAT, wavy mouth, frown, 1girl, crying with eyes open, crying, tearing up, tears, sad, portrait, upper body, white background, , blue hair, white suit", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "149fe7d36c", + "name": "meinaalter_v1", + "type": "model" + } + ], + "Model hash": "149fe7d36c", + "Hires upscale": "2.5", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality:1.4), monochrome, zombie", + "Denoising strength": "0.3" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ca801a6c-999b-4ed5-adc2-2a5925928c14/width=450/985538.jpeg", + "nsfw": "None", + "width": 1280, + "height": 1920, + "hash": "UlLzQ,~US$WE=_RiSjNHK7SitTR+R.RkW?WB", + "meta": { + "ENSD": "-1", + "Size": "512x768", + "seed": 4071158167, + "Model": "meinaalter_v1", + "steps": 30, + "hashes": { + "model": "149fe7d36c" + }, + "prompt": "TAT, wavy mouth, frown, 1girl, crying with eyes open, crying, tearing up, tears, sad, portrait, upper body, white background, ,, phyami, yamisch, long hair, solo, hair ornament, two side up, blonde hair, red eyes, hair ornament,\n, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "149fe7d36c", + "name": "meinaalter_v1", + "type": "model" + } + ], + "Model hash": "149fe7d36c", + "Hires steps": "10", + "Hires upscale": "2.5", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality:1.4), monochrome, zombie", + "ControlNet 0 Model": "None", + "Denoising strength": "0.3", + "ControlNet 0 Weight": "1", + "ControlNet 0 Enabled": "True", + "ControlNet 0 Ending Step": "1", + "ControlNet 0 Resize Mode": "Crop and Resize", + "ControlNet 0 Control Mode": "Balanced", + "ControlNet 0 Preprocessor": "none", + "ControlNet 0 Pixel Perfect": "False", + "ControlNet 0 Starting Step": "0", + "ControlNet 0 Preprocessor Parameters": "\"(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7296ee8d-720b-436b-9cd7-d697d6783759/width=450/985539.jpeg", + "nsfw": "None", + "width": 1280, + "height": 1920, + "hash": "UkM?k[~AS$Rk%KRPb_NHtSS$o~R+NHRkWXRk", + "meta": { + "ENSD": "-1", + "Size": "512x768", + "seed": 4071158164, + "Model": "meinaalter_v1", + "steps": 30, + "hashes": { + "model": "149fe7d36c" + }, + "prompt": "TAT, wavy mouth, frown, 1girl, crying with eyes open, crying, tearing up, tears, sad, portrait, upper body, white background, , phyami, yamidarkness, 1girl, solo, blonde hair, long hair, horns, red eyes, black wings, bare shoulders, hair intakes, collarbone, choker, demon horns, bangs, very long hair\n", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "149fe7d36c", + "name": "meinaalter_v1", + "type": "model" + } + ], + "Model hash": "149fe7d36c", + "Hires upscale": "2.5", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality:1.4), monochrome, zombie", + "Denoising strength": "0.3" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6a237e0d-5d8c-4958-9420-9a5662d19969/width=450/985541.jpeg", + "nsfw": "None", + "width": 1280, + "height": 1920, + "hash": "UWLg0C~EEmM|=|a0-:obpJbv?uNax[Rix]S#", + "meta": { + "ENSD": "-1", + "Size": "512x768", + "seed": 4071158163, + "Model": "meinaalter_v1", + "steps": 30, + "hashes": { + "model": "149fe7d36c" + }, + "prompt": "TAT, wavy mouth, frown, 1girl, crying with eyes open, crying, tearing up, tears, sad, portrait, upper body, white background, , ph_Mar, Marhd, Mards, 1girl, solo, jewelry, blue eyes, pink eyes, hair between eyes, short hair, purple eyes, multicolored eyes, ,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "149fe7d36c", + "name": "meinaalter_v1", + "type": "model" + } + ], + "Model hash": "149fe7d36c", + "Hires upscale": "2.5", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality:1.4), monochrome, zombie", + "Denoising strength": "0.3" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5ddf05e6-dae0-44f2-94ad-3ce036fa546e/width=450/985542.jpeg", + "nsfw": "None", + "width": 1280, + "height": 1920, + "hash": "UUK-Rh~XJDRl~pn}?bt6kskE-pIVbDRixuof", + "meta": { + "ENSD": "-1", + "Size": "512x768", + "seed": 4071158163, + "Model": "meinaalter_v1", + "steps": 30, + "hashes": { + "model": "149fe7d36c" + }, + "prompt": "TAT, wavy mouth, frown, 1girl, crying with eyes open, crying, tearing up, tears, sad, portrait, upper body, white background, , , ph bronya, solo, jewelry, earrings, long hair, grey hair, drill hair, grey eyes,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "149fe7d36c", + "name": "meinaalter_v1", + "type": "model" + } + ], + "Model hash": "149fe7d36c", + "Hires upscale": "2.5", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality:1.4), monochrome, zombie", + "Denoising strength": "0.3" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a886eda9-b53c-42c1-92d7-88932c3fdb57/width=450/985543.jpeg", + "nsfw": "None", + "width": 1280, + "height": 1920, + "hash": "UXLWL?}]9aM|+%D%O;NFEeOn%zD*D*D*R%WA", + "meta": { + "ENSD": "-1", + "Size": "512x768", + "seed": 4071158165, + "Model": "meinaalter_v1", + "steps": 30, + "hashes": { + "model": "149fe7d36c" + }, + "prompt": "TAT, wavy mouth, frown, 1girl, crying with eyes open, crying, tearing up, tears, sad, portrait, upper body, white background, ,ph momo, momohd, phmomo, solo, pink hair, purple eyes, short hair, hair flower, sweater vest, school uniform, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "momo", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "149fe7d36c", + "name": "meinaalter_v1", + "type": "model" + } + ], + "Model hash": "149fe7d36c", + "Hires upscale": "2.5", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality:1.4), monochrome, zombie", + "Denoising strength": "0.3" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/86519" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/TAT3-000009.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/TAT3-000009.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..019eeedc0b55d09670c363b06e7502947f6c7f7d Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/TAT3-000009.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/TAT3-000009.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/TAT3-000009.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..926efbbf17567726d5a9f87382e9cbe65b7dae60 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/TAT3-000009.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:0d4fa1f8964d756f52b1be6e25e6543797d3c9167f97e095c9ddb1e9273f1871 +size 30466366 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/agemasen_v1.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/agemasen_v1.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..99e8c57b89de7cd35cc6a7e3aca6b994b65fa7f1 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/agemasen_v1.civitai.info" @@ -0,0 +1,316 @@ +{ + "id": 91155, + "modelId": 85715, + "name": "v1.0", + "createdAt": "2023-06-07T16:11:01.176Z", + "updatedAt": "2023-06-07T16:16:09.077Z", + "trainedWords": [ + "agemasen" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 184, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "agemasen! \uff08\u3042\u3052\u307e\u305b\u3093\uff01\uff09 ", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "agemasen_v1.safetensors", + "id": 62754, + "sizeKB": 36976.6259765625, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-07T16:15:56.024Z", + "hashes": { + "AutoV1": "3840A629", + "AutoV2": "2E2EE4896B", + "SHA256": "2E2EE4896B0357F5C3905F3EB398101C005CD77FC14C732E703B6EE2092EB7D5", + "CRC32": "BE24CA15", + "BLAKE3": "E2E30AA2B43DB6771F1B131731F26A1DCB94B107FE6AEA5FDDB3FB91D264E7B2" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/91155" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0b497037-187b-4fbc-9722-bcb488588ddd/width=450/1063268.jpeg", + "nsfw": "None", + "width": 768, + "height": 512, + "hash": "UKJtk~9a00.7~qE1nht7R*R+-:R+=|WCIoj[", + "meta": { + "\"1": "3;,1,1\"", + "Size": "768x512", + "seed": 4002872845, + "Model": "kawaiiniji_v3", + "steps": 20, + "hashes": { + "model": "bfc5207602" + }, + "prompt": "absurdres, highres, ultra detailed,1girl, open mouth,wide-eyed,v-shaped eyebrows, agemasen,, ,special week \\(umamusume\\),", + "sampler": "DPM++ 2M Karras", + "cfgScale": 10.5, + "Clip skip": "2", + "RP Active": "True", + "resources": [ + { + "name": "A_Lion_lora_768", + "type": "lora", + "weight": 0.75 + }, + { + "hash": "bfc5207602", + "name": "kawaiiniji_v3", + "type": "model" + } + ], + "Model hash": "bfc5207602", + "RP Use Base": "True", + "RP Calc Mode": "Latent", + "RP threshold": "0.4", + "RP Change AND": "False", + "RP Use Common": "False", + "RP Base Ratios": "0.2", + "RP Divide mode": "Matrix", + "RP Use Ncommon": "False", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.4),", + "RP Mask submode": "Mask", + "RP Matrix submode": "Horizontal", + "RP Prompt submode": "Prompt", + "RP LoRA Neg U Ratios": "0", + "RP LoRA Neg Te Ratios": "0" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/10598bb5-7a3e-4aa1-ba95-6372bb2615a4/width=450/1063269.jpeg", + "nsfw": "None", + "width": 768, + "height": 512, + "hash": "UBG+OADh00sqyrs7ZgE10fxv^jIp~Vsl4.X9", + "meta": { + "\"1": "3;,1,1\"", + "Size": "768x512", + "seed": 3757620359, + "Model": "kawaiiniji_v3", + "steps": 20, + "hashes": { + "model": "bfc5207602" + }, + "prompt": "absurdres, highres, ultra detailed,1girl, open mouth,wide-eyed,v-shaped eyebrows, agemasen,, seiun sky \\(umamusume\\), ,light blue hair,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 10.5, + "Clip skip": "2", + "RP Active": "True", + "resources": [ + { + "name": "A_Lion_lora_768", + "type": "lora", + "weight": 0.75 + }, + { + "name": "seiun_sky_lora", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "bfc5207602", + "name": "kawaiiniji_v3", + "type": "model" + } + ], + "Model hash": "bfc5207602", + "RP Use Base": "True", + "RP Calc Mode": "Latent", + "RP threshold": "0.4", + "RP Change AND": "False", + "RP Use Common": "False", + "RP Base Ratios": "0.2", + "RP Divide mode": "Matrix", + "RP Use Ncommon": "False", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.4),", + "RP Mask submode": "Mask", + "RP Matrix submode": "Horizontal", + "RP Prompt submode": "Prompt", + "RP LoRA Neg U Ratios": "0", + "RP LoRA Neg Te Ratios": "0" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3b3897f7-e490-4ad4-a118-74cf18b2e323/width=450/1063270.jpeg", + "nsfw": "None", + "width": 768, + "height": 512, + "hash": "UEI4q%-:00E1?bs.^*M{56WB_2%L~CRjEft6", + "meta": { + "\"1": "3;,1,1\"", + "Size": "768x512", + "seed": 3766211834, + "Model": "kawaiiniji_v3", + "steps": 20, + "hashes": { + "model": "bfc5207602" + }, + "prompt": "absurdres, highres, ultra detailed,1girl, open mouth,wide-eyed,v-shaped eyebrows, agemasen,, ,king halo \\(umamusume\\),", + "sampler": "DPM++ 2M Karras", + "cfgScale": 10.5, + "Clip skip": "2", + "RP Active": "True", + "resources": [ + { + "name": "A_Lion_lora_768", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "bfc5207602", + "name": "kawaiiniji_v3", + "type": "model" + } + ], + "Model hash": "bfc5207602", + "RP Use Base": "True", + "RP Calc Mode": "Latent", + "RP threshold": "0.4", + "RP Change AND": "False", + "RP Use Common": "False", + "RP Base Ratios": "0.2", + "RP Divide mode": "Matrix", + "RP Use Ncommon": "False", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.4),", + "RP Mask submode": "Mask", + "RP Matrix submode": "Horizontal", + "RP Prompt submode": "Prompt", + "RP LoRA Neg U Ratios": "0", + "RP LoRA Neg Te Ratios": "0" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/14a32477-5795-4b86-80e2-c43a9ea6cf5a/width=450/1063271.jpeg", + "nsfw": "None", + "width": 768, + "height": 512, + "hash": "UJI}Fut,0MkD%19G-oIUIUNG?bxt~VR+IpoL", + "meta": { + "\"1": "3;,1,1\"", + "Size": "768x512", + "seed": 200408234, + "Model": "kawaiiniji_v3", + "steps": 20, + "hashes": { + "model": "bfc5207602" + }, + "prompt": "absurdres, highres, ultra detailed,1girl, open mouth,wide-eyed,v-shaped eyebrows, agemasen,, ,grass wonder \\(umamusume\\),", + "sampler": "DPM++ 2M Karras", + "cfgScale": 10.5, + "Clip skip": "2", + "RP Active": "True", + "resources": [ + { + "name": "A_Lion_lora_768", + "type": "lora", + "weight": 0.75 + }, + { + "hash": "bfc5207602", + "name": "kawaiiniji_v3", + "type": "model" + } + ], + "Model hash": "bfc5207602", + "RP Use Base": "True", + "RP Calc Mode": "Latent", + "RP threshold": "0.4", + "RP Change AND": "False", + "RP Use Common": "False", + "RP Base Ratios": "0.2", + "RP Divide mode": "Matrix", + "RP Use Ncommon": "False", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.4),", + "RP Mask submode": "Mask", + "RP Matrix submode": "Horizontal", + "RP Prompt submode": "Prompt", + "RP LoRA Neg U Ratios": "0", + "RP LoRA Neg Te Ratios": "0" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ff25d3b4-6157-4efe-8a72-6422c4354ba5/width=450/1063273.jpeg", + "nsfw": "None", + "width": 768, + "height": 512, + "hash": "UBGRYn?G004:%4r?^+WB0Lt8?b%2}[%M9aR+", + "meta": { + "\"1": "3;,1,1\"", + "Size": "768x512", + "seed": 1384200956, + "Model": "kawaiiniji_v3", + "steps": 20, + "hashes": { + "model": "bfc5207602" + }, + "prompt": "absurdres, highres, ultra detailed,1girl, open mouth,wide-eyed,v-shaped eyebrows, agemasen,, ,el condor pasa \\(umamusume\\), domino mask", + "sampler": "DPM++ 2M Karras", + "cfgScale": 10.5, + "Clip skip": "2", + "RP Active": "True", + "resources": [ + { + "name": "A_Lion_lora_768", + "type": "lora", + "weight": 0.7 + }, + { + "name": "el_condor_pasa_locon_0.99", + "type": "lora", + "weight": 0.5 + }, + { + "hash": "bfc5207602", + "name": "kawaiiniji_v3", + "type": "model" + } + ], + "Model hash": "bfc5207602", + "RP Use Base": "True", + "RP Calc Mode": "Latent", + "RP threshold": "0.4", + "RP Change AND": "False", + "RP Use Common": "False", + "RP Base Ratios": "0.2", + "RP Divide mode": "Matrix", + "RP Use Ncommon": "False", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.4),", + "RP Mask submode": "Mask", + "RP Matrix submode": "Horizontal", + "RP Prompt submode": "Prompt", + "RP LoRA Neg U Ratios": "0", + "RP LoRA Neg Te Ratios": "0" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5203bd72-8b2f-4eb6-9849-0854bb9bdacd/width=450/1063266.jpeg", + "nsfw": "None", + "width": 2622, + "height": 507, + "hash": "UKJ7tDx]MdwI?bo#M{i_4:W=Rke.~CbIjFjZ", + "meta": null + } + ], + "downloadUrl": "https://civitai.com/api/download/models/91155" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/agemasen_v1.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/agemasen_v1.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..6489b3161b01bae6e2d66ebec1b86e991b655c0f Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/agemasen_v1.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/agemasen_v1.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/agemasen_v1.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..50727a8963ea33f6d2b9615a57ecede20e92b13e --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/agemasen_v1.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:2e2ee4896b0357f5c3905f3eb398101c005cd77fc14c732e703b6ee2092eb7d5 +size 37864065 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/ahegaoSmile_ahegao.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/ahegaoSmile_ahegao.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..a57b3d336ce932a8cce4a2bcd4e5f0a6917315d5 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/ahegaoSmile_ahegao.civitai.info" @@ -0,0 +1,204 @@ +{ + "id": 33194, + "modelId": 27721, + "name": "Ahegao", + "createdAt": "2023-04-01T14:32:08.949Z", + "updatedAt": "2023-04-01T14:33:27.396Z", + "trainedWords": [ + "tongue out", + "open mouth", + "smile", + "rolling eyes" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 2266, + "ratingCount": 1, + "rating": 5 + }, + "model": { + "name": "Ahegao (smile)", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "ahegaoSmile_ahegao.safetensors", + "id": 27326, + "sizeKB": 21165.7119140625, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-01T14:36:35.779Z", + "hashes": { + "AutoV1": "8F97C8ED", + "AutoV2": "3D087D8B2D", + "SHA256": "3D087D8B2DD8403048FAFFB4F8B5C0E0381E55EC3CEDFCA70FB1EE91FCE6A163", + "CRC32": "9A13785B", + "BLAKE3": "DD5AC64B42C1002DBE87F5CFA0529385D49308058EB5B9959250D51C0DC30B86" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/33194" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/57a61f95-c347-4b85-7416-f80e5012cc00/width=450/378218.jpeg", + "nsfw": true, + "width": 576, + "height": 832, + "hash": "UCJHpx5Q1Hxu0JMy4oRQ_L9t^+o45jR59a-;", + "meta": { + "Size": "576x832", + "seed": 2890852585, + "Model": "AOM3_orangemixs", + "steps": 40, + "hashes": { + "vae": "f921fb3f29", + "model": "d124fc18f0", + "lora:ahegao": "3d087d8b2d", + "embed:bad_prompt_version2": "6f35e7dd81" + }, + "prompt": "masterpiece, best quality, 1girl, NSFW, huge breasts,completely nude, arms behind head, park,water,blonde hair, , (rolling red eyes:1.1), open mouth, smile,tongue out", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6.5, + "Clip skip": "2", + "resources": [ + { + "name": "ahegao", + "type": "lora", + "weight": 1.2 + }, + { + "hash": "d124fc18f0", + "name": "AOM3_orangemixs", + "type": "model" + } + ], + "Model hash": "d124fc18f0", + "negativePrompt": "(worst quality:1.4), (low quality:1.3) , EasyNegative,censored, bad_prompt_version2" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a2b862ba-2665-4956-186c-99c9739d4700/width=450/378217.jpeg", + "nsfw": true, + "width": 576, + "height": 832, + "hash": "UGJ*VH~V0fD*GH9GItt7RQ?I-BM{SbX8I9kA", + "meta": { + "Size": "576x832", + "seed": 3265828837, + "Model": "AOM3_orangemixs", + "steps": 40, + "hashes": { + "vae": "f921fb3f29", + "model": "d124fc18f0", + "lora:ahegao": "3d087d8b2d", + "embed:bad_prompt_version2": "6f35e7dd81" + }, + "prompt": "masterpiece, best quality, 1girl, NSFW, huge breasts,completely nude, arms behind head, park,water,blonde hair, , (rolling purple eyes:1.1), open mouth, smile,tongue out", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6.5, + "Clip skip": "2", + "resources": [ + { + "name": "ahegao", + "type": "lora", + "weight": 1.2 + }, + { + "hash": "d124fc18f0", + "name": "AOM3_orangemixs", + "type": "model" + } + ], + "Model hash": "d124fc18f0", + "negativePrompt": "(worst quality:1.4), (low quality:1.3) , EasyNegative,censored, bad_prompt_version2" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/757e6616-23bf-4a64-bd79-75cf28b95e00/width=450/378216.jpeg", + "nsfw": true, + "width": 576, + "height": 832, + "hash": "UGJa$C$+00NG4.Mx-Oxv.m-p?a9bInobxAwv", + "meta": { + "Size": "576x832", + "seed": 3672052485, + "Model": "7th_anime_3-1", + "steps": 40, + "hashes": { + "vae": "f921fb3f29", + "model": "1c6ea64db0", + "lora:ahegao": "3d087d8b2d", + "embed:bad_prompt_version2": "6f35e7dd81" + }, + "prompt": "masterpiece, best quality, 1girl, NSFW, huge breasts,completely nude, arms behind head, park,water,, (rolling eyes:1.3), open mouth, smile", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6.5, + "Clip skip": "2", + "resources": [ + { + "name": "ahegao", + "type": "lora", + "weight": 1 + }, + { + "hash": "1c6ea64db0", + "name": "7th_anime_3-1", + "type": "model" + } + ], + "Model hash": "1c6ea64db0", + "negativePrompt": "(worst quality:1.4), (low quality:1.3) , EasyNegative,censored, bad_prompt_version2" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/35dbf6a8-2b8f-455d-da0c-502d75866a00/width=450/378215.jpeg", + "nsfw": true, + "width": 576, + "height": 832, + "hash": "UAJk4M~WCi~p00Z*~9?a00tQIqE1-W4.00?F", + "meta": { + "Size": "576x832", + "seed": 2537053721, + "Model": "7th_anime_3-1", + "steps": 40, + "hashes": { + "vae": "f921fb3f29", + "model": "1c6ea64db0", + "lora:ahegao": "3d087d8b2d", + "embed:bad_prompt_version2": "6f35e7dd81" + }, + "prompt": "masterpiece, best quality, 1girl, NSFW, huge breasts,completely nude, arms behind head, park,water,, (rolling eyes:1.2), open mouth, smile,tongue out", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6.5, + "Clip skip": "2", + "resources": [ + { + "name": "ahegao", + "type": "lora", + "weight": 1.2 + }, + { + "hash": "1c6ea64db0", + "name": "7th_anime_3-1", + "type": "model" + } + ], + "Model hash": "1c6ea64db0", + "negativePrompt": "(worst quality:1.4), (low quality:1.3) , EasyNegative,censored, bad_prompt_version2" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/33194" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/ahegaoSmile_ahegao.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/ahegaoSmile_ahegao.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..72f4ec52f87d903561811101d168706b6cb92add Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/ahegaoSmile_ahegao.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/ahegaoSmile_ahegao.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/ahegaoSmile_ahegao.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..1cf3c2b14ffb6ae505f028a6c99b7fed6c3665af --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/ahegaoSmile_ahegao.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:3d087d8b2dd8403048faffb4f8b5c0e0381e55ec3cedfca70fb1ee91fce6a163 +size 21673689 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/ahegao_v1.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/ahegao_v1.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..731e8fb4146d8a8e537429fd87ab8ee9c5fe53f7 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/ahegao_v1.civitai.info" @@ -0,0 +1,452 @@ +{ + "id": 10029, + "modelId": 8505, + "name": "v1", + "createdAt": "2023-02-13T13:54:40.771Z", + "updatedAt": "2023-02-21T14:27:15.658Z", + "trainedWords": [ + "ahegao", + "rolling eyes", + "blush", + "tongue out", + "drooling", + " saliva", + "blush " + ], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": "

v1

", + "stats": { + "downloadCount": 41786, + "ratingCount": 32, + "rating": 4.78 + }, + "model": { + "name": "Ahegao", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "ahegao_v1.safetensors", + "id": 9634, + "sizeKB": 147582.333984375, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-02-13T13:56:07.617Z", + "hashes": { + "AutoV1": "79896A2F", + "AutoV2": "17CF963C5B", + "SHA256": "17CF963C5B426C70F6AE2F8E284F10FAA80A470B193F709929737B09791B5688", + "CRC32": "4F72C0BF", + "BLAKE3": "63BDD01DC3B6DA7D543A975D32E8A26956BC311CCFBF021FCDEFF796CD218372" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/10029" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/fb6f09ef-4c16-4833-de40-7d3c3daa0c00/width=450/97742.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "ULJtC*0156tQOsM{?ai_XRM{_2V@~pRPV[xZ", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3919769520, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 20, + "prompt": "mature_female, 1girl, rolling eyes, ahegao, tongue out, drooling, saliva, sweat, blush, nude, NSFW, looking at the viewer", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + }, + { + "hash": "834c91198c7d", + "name": "Ahegaoo", + "type": "lora", + "weight": null + } + ], + "Model hash": "0873291ac5", + "AddNet Enabled": "True", + "AddNet Model 1": "Ahegaoo(834c91198c7d)", + "negativePrompt": "bad anatomy, bad res, bad quality, error,malformed, art by bad-artist, bad-image-v2-39000, bad-hands-5, art by negprompt5, lowres, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name, (worst quality, low quality, extra digits, loli, loli face:1.3), greyscale, monochrome", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.7", + "AddNet Weight B 1": "0.7", + "Discard penultimate sigma": "True" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/edbd7383-d9e6-43bd-c31b-a4a63d163400/width=450/97753.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UHIh254;0e%M9w?H4noc-.M{i^oJ0K%L~BNH", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3359310169, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 20, + "prompt": "1girl, rolling eyes, ahegao, tongue out, drooling, saliva, upper body, sweat, blush", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + }, + { + "hash": "834c91198c7d", + "name": "Ahegaoo", + "type": "lora", + "weight": null + } + ], + "Model hash": "0873291ac5", + "AddNet Enabled": "True", + "AddNet Model 1": "Ahegaoo(834c91198c7d)", + "negativePrompt": "bad anatomy, bad res, bad quality, error,malformed, art by bad-artist, bad-image-v2-39000, bad-hands-5, art by negprompt5, lowres, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name, (worst quality, low quality, extra digits, loli, loli face:1.3)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.7", + "AddNet Weight B 1": "0.7", + "Discard penultimate sigma": "True" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1c0f4a43-84c7-4b22-f90e-8614d52d3600/width=450/97752.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UHJtlC0J0NMu5?0K#7EK00~C=^xv8_xb9[IV", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 1697867458, + "Model": "anything-v4.0-pruned-fp32", + "steps": 20, + "prompt": "1girl, rolling eyes, ahegao, tongue out, drooling saliva", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "f28a232119", + "name": "anything-v4.0-pruned-fp32", + "type": "model" + }, + { + "hash": "834c91198c7d", + "name": "Ahegaoo", + "type": "lora", + "weight": null + } + ], + "Model hash": "f28a232119", + "AddNet Enabled": "True", + "AddNet Model 1": "Ahegaoo(834c91198c7d)", + "negativePrompt": "bad anatomy, bad res, bad quality, error,malformed, art by bad-artist, bad-image-v2-39000, bad-hands-5, art by negprompt5, lowres, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name, (worst quality, low quality, extra digits, loli, loli face:1.3)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Discard penultimate sigma": "True" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/161e000b-3e31-4493-b932-e81029b06600/width=450/97751.jpeg", + "nsfw": false, + "width": 512, + "height": 768, + "hash": "UOF}{E~pjCJBNgah9YIUIoR*sSV@xuk9%1s.", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3099143505, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 20, + "prompt": "1girl, rolling eyes, ahegao, tongue out, drooling, saliva, upper body", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + }, + { + "hash": "834c91198c7d", + "name": "Ahegaoo", + "type": "lora", + "weight": null + } + ], + "Model hash": "0873291ac5", + "AddNet Enabled": "True", + "AddNet Model 1": "Ahegaoo(834c91198c7d)", + "negativePrompt": "bad anatomy, bad res, bad quality, error,malformed, art by bad-artist, bad-image-v2-39000, bad-hands-5, art by negprompt5, lowres, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name, (worst quality, low quality, extra digits, loli, loli face:1.3)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Discard penultimate sigma": "True" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e57c6dd2-37e8-4416-dc43-2aa3b659f600/width=450/97750.jpeg", + "nsfw": false, + "width": 512, + "height": 768, + "hash": "U8FrL]Im%d_300D*01IV00?c-WR*.T-mDh?G", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3099143505, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 20, + "prompt": "1girl, rolling eyes, ahegao, tongue out, drooling, saliva, upper body", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + }, + { + "hash": "834c91198c7d", + "name": "Ahegaoo", + "type": "lora", + "weight": null + } + ], + "Model hash": "0873291ac5", + "AddNet Enabled": "True", + "AddNet Model 1": "Ahegaoo(834c91198c7d)", + "negativePrompt": "bad anatomy, bad res, bad quality, error,malformed, art by bad-artist, bad-image-v2-39000, bad-hands-5, art by negprompt5, lowres, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name, (worst quality, low quality, extra digits, loli, loli face:1.3)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Discard penultimate sigma": "True" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/bffd7cac-12f4-4796-e1e3-ab944f459a00/width=450/97749.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UOKA]D~q?v-;tR%M.SkC%Mf6%0j?.8xus9WB", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2156482031, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 20, + "prompt": "1girl, rolling eyes, ahegao, tongue out, drooling, saliva, upper body, sweat", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + }, + { + "hash": "834c91198c7d", + "name": "Ahegaoo", + "type": "lora", + "weight": null + } + ], + "Model hash": "0873291ac5", + "AddNet Enabled": "True", + "AddNet Model 1": "Ahegaoo(834c91198c7d)", + "negativePrompt": "bad anatomy, bad res, bad quality, error,malformed, art by bad-artist, bad-image-v2-39000, bad-hands-5, art by negprompt5, lowres, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name, (worst quality, low quality, extra digits, loli, loli face:1.3)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Discard penultimate sigma": "True" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5038fca0-257e-4f7b-b51a-d08eabe90000/width=450/97748.jpeg", + "nsfw": false, + "width": 512, + "height": 768, + "hash": "UPI}V68{V;i^-ixHtk%2VrXSx]xY_4ocMyn#", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2765696907, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 20, + "prompt": "1girl, rolling eyes, ahegao, tongue out, drooling, saliva, upper body, sweat", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + }, + { + "hash": "834c91198c7d", + "name": "Ahegaoo", + "type": "lora", + "weight": null + } + ], + "Model hash": "0873291ac5", + "AddNet Enabled": "True", + "AddNet Model 1": "Ahegaoo(834c91198c7d)", + "negativePrompt": "bad anatomy, bad res, bad quality, error,malformed, art by bad-artist, bad-image-v2-39000, bad-hands-5, art by negprompt5, lowres, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name, (worst quality, low quality, extra digits, loli, loli face:1.3)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.5", + "AddNet Weight B 1": "0.5", + "Discard penultimate sigma": "True" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/33a25115-afa7-468f-a952-d167fe963f00/width=450/97747.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UIKBUN%M00j[9Ft74nM{Rjt700IU~qxu9FWB", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 87046701, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 20, + "prompt": "1girl, rolling eyes, ahegao, tongue out, drooling, saliva, upper body, sweat, blush, nude, NSFW, big boobs", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + }, + { + "hash": "834c91198c7d", + "name": "Ahegaoo", + "type": "lora", + "weight": null + } + ], + "Model hash": "0873291ac5", + "AddNet Enabled": "True", + "AddNet Model 1": "Ahegaoo(834c91198c7d)", + "negativePrompt": "bad anatomy, bad res, bad quality, error,malformed, art by bad-artist, bad-image-v2-39000, bad-hands-5, art by negprompt5, lowres, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name, (worst quality, low quality, extra digits, loli, loli face:1.3)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.7", + "AddNet Weight B 1": "0.7", + "Discard penultimate sigma": "True" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/70b819b4-d65d-4646-c4a4-3cb407e6c700/width=450/97746.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UGL3u:8wTI-BGFNF~p9a9u9Z?ID*~Wsl9FS~", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2367292413, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 20, + "prompt": "mature_female, 1girl, rolling eyes, ahegao, tongue out, drooling, saliva, sweat, blush, nude, NSFW, big boobs", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + }, + { + "hash": "834c91198c7d", + "name": "Ahegaoo", + "type": "lora", + "weight": null + } + ], + "Model hash": "0873291ac5", + "AddNet Enabled": "True", + "AddNet Model 1": "Ahegaoo(834c91198c7d)", + "negativePrompt": "bad anatomy, bad res, bad quality, error,malformed, art by bad-artist, bad-image-v2-39000, bad-hands-5, art by negprompt5, lowres, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name, (worst quality, low quality, extra digits, loli, loli face:1.3), greyscale, monochrome", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.7", + "AddNet Weight B 1": "0.7", + "Discard penultimate sigma": "True" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/75428c8a-851f-4b4d-8fff-bb5e6d766c00/width=450/97745.jpeg", + "nsfw": true, + "width": 1024, + "height": 897, + "hash": "UWLN75xaog^+%$WBt6jZ~qxZR*M|_4M{RjRj", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2965326641, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 20, + "Script": "X/Y/Z plot", + "X Type": "AddNet Model 1", + "prompt": "mature_female, 1girl, rolling eyes, ahegao, tongue out, drooling, saliva, sweat, blush, nude, NSFW, looking at the viewer", + "sampler": "DPM++ 2S a Karras", + "X Values": "\"Ahegaoo(834c91198c7d)", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + }, + { + "hash": "834c91198c7d", + "name": "Ahegaoo", + "type": "lora", + "weight": null + } + ], + "Model hash": "0873291ac5", + "AddNet Enabled": "True", + "AddNet Model 1": "Ahegaoo(834c91198c7d)", + "negativePrompt": "bad anatomy, bad res, bad quality, error,malformed, art by bad-artist, bad-image-v2-39000, bad-hands-5, art by negprompt5, lowres, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts,signature, watermark, username, blurry, artist name, (worst quality, low quality, extra digits, loli, loli face:1.3), greyscale, monochrome", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.7", + "AddNet Weight B 1": "0.7", + "Discard penultimate sigma": "True" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/10029" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/ahegao_v1.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/ahegao_v1.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..0c62fd06b65074eaa5fc8bedf301d616a0fea941 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/ahegao_v1.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/ahegao_v1.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/ahegao_v1.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..772efdf2c6cab885d696d71b3c5fc1c8fd4a3acc --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/ahegao_v1.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:17cf963c5b426c70f6ae2f8e284f10faa80a470b193f709929737b09791b5688 +size 151124310 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/ahegao_v11.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/ahegao_v11.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..f1886c12e6d3b7c0878f4668fda68dd312160c81 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/ahegao_v11.civitai.info" @@ -0,0 +1,56 @@ +{ + "id": 47240, + "modelId": 42558, + "name": "v1.1", + "createdAt": "2023-04-16T14:08:54.399Z", + "updatedAt": "2023-04-16T21:08:47.041Z", + "trainedWords": [ + "ahegao" + ], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": "

:0.8

", + "model": { + "name": "Ahegao", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "ahegao_v11.safetensors", + "id": 35219, + "sizeKB": 36983.6171875, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-16T19:50:56.600Z", + "hashes": { + "AutoV1": "0C2CD858", + "AutoV2": "6AB893B6DD", + "SHA256": "6AB893B6DD80AF717DDDBC6FF046A7EB3DEF7F4A9A30D4401DB4060F8A00F185", + "CRC32": "E25A530B", + "BLAKE3": "1F3AF917FDDD3D669B387A9F25D437EB5BBAEC9EF5B2870722923366BC0CB13A" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/47240" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c6e04bb1-8b3d-439f-137e-d4ef16285e00/width=450/511429.jpeg", + "nsfw": true, + "width": 512, + "height": 739, + "hash": "UCKA=:Sz02xu00ba#YRk_MoL^7ofR7WV?Ht6", + "meta": null + } + ], + "downloadUrl": "https://civitai.com/api/download/models/47240" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/ahegao_v11.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/ahegao_v11.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..c9c0618825825fc7e0be460942e655701a513193 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/ahegao_v11.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/ahegao_v11.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/ahegao_v11.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..c2037b1cc59e077c2d7dc24d27404ac0fff284f6 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/ahegao_v11.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:6ab893b6dd80af717dddbc6ff046a7eb3def7f4a9a30d4401db4060f8a00f185 +size 37871224 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/circleeye_v1.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/circleeye_v1.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..861616aa090d8240ff894517d68d989a26a49703 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/circleeye_v1.civitai.info" @@ -0,0 +1,90 @@ +{ + "id": 91485, + "modelId": 86047, + "name": "v1.0", + "createdAt": "2023-06-08T04:05:16.722Z", + "updatedAt": "2023-06-08T04:06:15.027Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 75, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Tangbohu circle eye", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "circleeye_v1.safetensors", + "id": 63018, + "sizeKB": 13329.5078125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-08T04:11:09.928Z", + "hashes": { + "AutoV1": "055730CB", + "AutoV2": "03F33D7210", + "SHA256": "03F33D7210642648D917E5EB422C3FD2B3C94E0DD472CF96B2B89C78C210501C", + "CRC32": "14B351CA", + "BLAKE3": "2EE916974550AFFEFA9565D1DBB71C648B4D538BD8F332FC17E08AEFFC12F40F" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/91485" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a9bb25c3-b262-4bb7-96bf-ca9efd10e777/width=450/1068739.jpeg", + "nsfw": "None", + "width": 2048, + "height": 581, + "hash": "UiLNV@RjbIWBtRayofa}?vfkRjoL~qj]ofof", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 3438167316, + "Model": "Anything-V3.0", + "steps": 20, + "Script": "X/Y/Z plot", + "X Type": "Prompt S/R", + "hashes": { + "model": "8712e20a5d" + }, + "prompt": "1girl face close up,smile , ", + "Version": "v1.2.1", + "sampler": "Euler a", + "X Values": "\"0,0.5,1,1.5\"", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "circleeye_v1", + "type": "lora", + "weight": 0 + }, + { + "hash": "8712e20a5d", + "name": "Anything-V3.0", + "type": "model" + } + ], + "Model hash": "8712e20a5d", + "negativePrompt": "EasyNegative" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/91485" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/circleeye_v1.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/circleeye_v1.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..a1cb292382a4b6b3725be87502d837b00d51c7de Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/circleeye_v1.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/circleeye_v1.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/circleeye_v1.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..728d2aeb6d5dd2134afe69ab507b2056eb295ea8 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/circleeye_v1.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:03f33d7210642648d917e5eb422c3fd2b3c94e0dd472cf96b2b89c78c210501c +size 13649416 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/hengao_teio_v1.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/hengao_teio_v1.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..3d44324338d18c730caf413ec37e0df0e4f89c22 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/hengao_teio_v1.civitai.info" @@ -0,0 +1,178 @@ +{ + "id": 85488, + "modelId": 80608, + "name": "v1.0", + "createdAt": "2023-05-30T13:06:06.204Z", + "updatedAt": "2023-05-30T13:15:10.685Z", + "trainedWords": [ + "hengao_teio" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 371, + "ratingCount": 3, + "rating": 4.67 + }, + "model": { + "name": "hengao teio (\u5909\u9854\u30c6\u30a4\u30aa\u30fc\uff09", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "hengao_teio_v1.safetensors", + "id": 58380, + "sizeKB": 36977.4462890625, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-30T13:10:50.008Z", + "hashes": { + "AutoV1": "C1AE6795", + "AutoV2": "FBBC7B6C9C", + "SHA256": "FBBC7B6C9C3F233C6F0EEFB2D72E2DB52337869AA415D4C23CFC6003B14D12F3", + "CRC32": "31D618C1", + "BLAKE3": "4CE79F9251873158F3EC0207DEF847B0AA4845738E981C18967731DA5C1D7140" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/85488" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3004a2b7-35bb-4b89-8a80-ae2fad2cd03c/width=450/968190.jpeg", + "nsfw": "None", + "width": 768, + "height": 512, + "hash": "UMMa02?^u4-=]~t7.8Ri%hD%i_s:%0kC%Ms,", + "meta": { + "Size": "768x512", + "seed": 2117394937, + "Model": "7th_anime_v2_C", + "steps": 25, + "hashes": { + "model": "c438e54ffc" + }, + "prompt": "absurdres, highres, ultra detailed, tokai teio \\(umamusume\\), revealing clothes, blue eyes, streaked hair, multicolored hair, brown hair, white hair, high ponytail, long hair , hengao_teio, open mouth, tongue out, surprised, (constricted pupils:1.35), wide-eyed, school uniform", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "tokaiTeio_20", + "type": "lora", + "weight": 0.5 + }, + { + "name": "hengao_teio_v1_0", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "c438e54ffc", + "name": "7th_anime_v2_C", + "type": "model" + } + ], + "Model hash": "c438e54ffc", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.4)," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/02c37a3b-c793-470c-9353-815384471094/width=450/968182.jpeg", + "nsfw": "None", + "width": 768, + "height": 512, + "hash": "UIKnG0~pPA^+?G-o%MR%o}WC$gxuNHV@?bV@", + "meta": { + "Size": "768x512", + "seed": 3989249458, + "Model": "7th_anime_v2_G", + "steps": 25, + "hashes": { + "model": "478e33afb3" + }, + "prompt": "1girl, hengao_teio, open mouth, tongue out, surprised, constricted pupils, wide-eyed, school uniform", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "hengao_teio_v1_0", + "type": "lora", + "weight": 0.65 + }, + { + "hash": "478e33afb3", + "name": "7th_anime_v2_G", + "type": "model" + } + ], + "Model hash": "478e33afb3", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.4)," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1485c8c2-39f5-4dba-b432-d0015fcbbcd9/width=450/968197.jpeg", + "nsfw": "X", + "width": 768, + "height": 512, + "hash": "UIK-F6-;?^x[_3Vr.8D*xu9GMyt74:Rk-:%2", + "meta": { + "Size": "768x512", + "seed": 1939631955, + "Model": "7th_anime_v2_G", + "steps": 25, + "hashes": { + "model": "478e33afb3" + }, + "prompt": "absurdres, highres, ultra detailed, mihono mihono bourbon \\(umamusume\\), long hair, horse girl, horse ears, brown hair, ahoge, grey hairband, horse tail, large breasts, blue eyes, hair ornament, hengao_teio, open mouth, tongue out, surprised, (constricted pupils:1.35), wide-eyed, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "mihono_bourbon_v1", + "type": "lora", + "weight": 0.6 + }, + { + "name": "hengao_teio_v1_0", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "478e33afb3", + "name": "7th_anime_v2_G", + "type": "model" + } + ], + "Model hash": "478e33afb3", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.4)," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/025231cc-36fa-45ed-8709-2f0841b8114f/width=450/968242.jpeg", + "nsfw": "None", + "width": 768, + "height": 512, + "hash": "UXMG#PIBY3kq~XWBxtRjXAkBjXayRkayx[of", + "meta": { + "steps": 30, + "prompt": "absurdres, highres, ultra detailed, mejiro_mq \\(umamusume\\), horse girl, long hair, horse ears, horse tail, purple eyes, purple hair, flat chest, BREAK, hengao_teio, small_eyes, crazy eyes, open mouth, tongue, shouting, surprised, wide-eyed, constricted pupils, parody, ", + "cfgScale": 8, + "negativePrompt": "EasyNegative, (worst quality, low quality:1.4)," + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/85488" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/hengao_teio_v1.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/hengao_teio_v1.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..580cdb3417f6cab6b210aa276a6e43a86636d8ac Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/hengao_teio_v1.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/hengao_teio_v1.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/hengao_teio_v1.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..33d2fb4132e5c0247941be3e2ee2776883ec2413 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/hengao_teio_v1.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:fbbc7b6c9c3f233c6f0eefb2d72e2db52337869aa415d4c23cfc6003b14d12f3 +size 37864905 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/hypnoEyes_v10.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/hypnoEyes_v10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..33dc3bccffea3863da268e7aaea63d51dda67f78 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/hypnoEyes_v10.civitai.info" @@ -0,0 +1,127 @@ +{ + "id": 91758, + "modelId": 86294, + "name": "v1.0", + "createdAt": "2023-06-08T13:34:55.580Z", + "updatedAt": "2023-06-08T13:39:06.319Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

First release.

", + "stats": { + "downloadCount": 139, + "ratingCount": 1, + "rating": 5 + }, + "model": { + "name": "Hypno Eyes", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "hypnoEyes_v10.safetensors", + "id": 63229, + "sizeKB": 11642.3544921875, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-08T13:41:12.419Z", + "hashes": { + "AutoV1": "4214A1ED", + "AutoV2": "48C559B679", + "SHA256": "48C559B6793D8AFA144706CD684BF06FCACBF55746E31A9799AF018C76FBE00A", + "CRC32": "76E48C63", + "BLAKE3": "72D158D105890777BB59F603E4204E2069F53855CBA4587B3940BE3F586A3D33" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/91758" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3ae707c7-f1c0-4d38-b8ca-e87c15183ea6/width=450/1072965.jpeg", + "nsfw": "None", + "width": 800, + "height": 1280, + "hash": "UNHeRgoyIpxu~qxaNGjZ0Lj[oLM{-pt7kCoz", + "meta": { + "Size": "400x640", + "seed": 2578144427, + "Model": "CounterfeitV30_v30", + "steps": 39, + "hashes": { + "model": "cbfba64e66" + }, + "prompt": "(6+girls in a same row formation:1.3),(angry:0.6),\n(silver hair,bob cut:1.3),(closed mouth:1.15),(turtle necked sweater:1.28),looking at viewer,\n", + "sampler": "DPM++ 2M", + "cfgScale": 12, + "Clip skip": "2", + "resources": [ + { + "name": "hypnoEyes_v10", + "type": "lora", + "weight": 1.31 + }, + { + "hash": "cbfba64e66", + "name": "CounterfeitV30_v30", + "type": "model" + } + ], + "Model hash": "cbfba64e66", + "Hires steps": "40", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(worst quality,low quality:1.3),(lip,rouge,lipstick, eyeshadow,monochrome:1.0), watermark,chibi,(school uniform:1.2),smile", + "Denoising strength": "0.7" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a983df7a-fb5f-49ce-9f42-69959bb29184/width=450/1072997.jpeg", + "nsfw": "Soft", + "width": 920, + "height": 1280, + "hash": "ULMG#QIWM{-;fmM|tkIUX:%LNboy~XxsM{xa", + "meta": { + "Size": "460x640", + "seed": 1118089925, + "Model": "anythingV5Anything_anythingV5PrtRE", + "steps": 38, + "hashes": { + "model": "7f96a1a9ca" + }, + "prompt": "(masterpiece:1.2),best quality,illustration,beautiful detailed girl,\n(3girls in a same row formation:1.3),\n(large breasts:1.0),(white wedding dress:1.3) with (laces:1.5),(gloves:1.1),neckless,(veil:1.4),(bouquet:1.25),\nblush,smile,(open mouth:0.9),cowboy shot,upper body,\n(long hair:1.0),blunt bangs,\n{mix-fus-of-(light blown hair)-(bob cut:1.0)-black eyes-ribbon},\n{mix-fus-of-black hair-straight hair-(brown eyes)},\n{mix-fus-of-(blond hair:1.1)-(multiple braids)-blue eyes},(church),(white petals:1.5),\n", + "sampler": "Euler a", + "cfgScale": 12, + "Clip skip": "2", + "resources": [ + { + "name": "hypnoEyes_v10", + "type": "lora", + "weight": 1.2 + }, + { + "hash": "7f96a1a9ca", + "name": "anythingV5Anything_anythingV5PrtRE", + "type": "model" + } + ], + "Model hash": "7f96a1a9ca", + "Hires steps": "39", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(worst quality,low quality:1.3),(lip,rouge,lipstick, eyeshadow,monochrome:1.0), watermark,(looking at viewer:1.1),", + "Denoising strength": "0.7" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/91758" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/hypnoEyes_v10.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/hypnoEyes_v10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..cc89f9be05a42fc9caa17a284bdc498e55ba3f0d Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/hypnoEyes_v10.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/hypnoEyes_v10.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/hypnoEyes_v10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..e4d60fbd83f6c730c7bf94f6b8c32054e1cdeb87 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/hypnoEyes_v10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:48c559b6793d8afa144706cd684bf06fcacbf55746e31a9799af018c76fbe00a +size 11921771 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/hypnosisBlankEyes_v10.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/hypnosisBlankEyes_v10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..148fa3cac23a330ea60b2044380d7d041f16f35c --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/hypnosisBlankEyes_v10.civitai.info" @@ -0,0 +1,234 @@ +{ + "id": 17946, + "modelId": 15238, + "name": "V1.0", + "createdAt": "2023-03-03T11:21:50.113Z", + "updatedAt": "2023-03-13T05:14:40.874Z", + "trainedWords": [ + "hypnosis" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "model": { + "name": "Hypnosis/\u50ac\u7720/Blank Eyes LORA", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "hypnosisBlankEyes_v10.safetensors", + "id": 15018, + "sizeKB": 73846.3603515625, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-03-03T11:25:42.336Z", + "hashes": { + "AutoV1": "EDFA5ED6", + "AutoV2": "2BDDA05B65", + "SHA256": "2BDDA05B65B1CBCAD60C8C315D8BA7E6F24E5461EA598C51F0FCFA6BF86EF3CC", + "CRC32": "BFD5F906", + "BLAKE3": "3DAF6951E187811D9233C824F46069E3A0473FB8B1E3ECF0913ACF9737FE432E" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/17946" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ea964488-95b4-4f75-5844-abd8025d1700/width=450/183830.jpeg", + "nsfw": true, + "width": 768, + "height": 1064, + "hash": "UoK,y{nkWX?a~VxGf+o}xbV?ofR*soslNGfi", + "meta": { + "Size": "768x1064", + "seed": 1122429708, + "Model": "Anything-V3.0", + "steps": 20, + "prompt": "best quality,(8k, best quality, masterpiece:1.2),ultra high res, 1girl, looking at viewer, side braid, black blazer,black tie,straight-on,red hair, brown eyes,blunt bangs, suit, short hair,office,half nude,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "name": "SaiminYuugi", + "type": "lora", + "weight": 0.4 + }, + { + "hash": "8712e20a5d", + "name": "Anything-V3.0", + "type": "model" + } + ], + "Model hash": "8712e20a5d", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans, lowres,bad anatomy,bad hands, text, error, missing fingers,extra digit, fewer digits, cropped, worstquality, low quality, normal quality,jpegartifacts,signature, watermark, username,blurry,bad feet,cropped,poorly drawn hands,poorly drawn face,mutation,deformed,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,extra fingers,fewer digits,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,text,error,missing fingers,missing arms,missing legs,extra digit,mask,mosaic censoring,penis,mask,sunglasses," + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5409a23b-2d04-42a2-001f-cd2f8ac2aa00/width=450/183853.jpeg", + "nsfw": true, + "width": 960, + "height": 792, + "hash": "UEJtI{4;0J02Z|_4rD00TJ0L%hEN-U58xqoO", + "meta": { + "Size": "960x792", + "seed": 3449579338, + "Model": "Anything-V3.0", + "steps": 20, + "prompt": "best quality,(8k, best quality, masterpiece:1.2),ultra high res, 1girl, looking at viewer, small fox ears, bob cut,blonde hair, small breasts, kimono, fox tail, onsen, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "name": "SaiminYuugi", + "type": "lora", + "weight": 0.4 + }, + { + "hash": "8712e20a5d", + "name": "Anything-V3.0", + "type": "model" + } + ], + "Model hash": "8712e20a5d", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans, lowres,bad anatomy,bad hands, text, error, missing fingers,extra digit, fewer digits, cropped, worstquality, low quality, normal quality,jpegartifacts,signature, watermark, username,blurry,bad feet,cropped,poorly drawn hands,poorly drawn face,mutation,deformed,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,extra fingers,fewer digits,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,text,error,missing fingers,missing arms,missing legs,extra digit,mask,mosaic censoring,penis,mask,sunglasses," + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f09c99ec-c21e-4852-57b2-74dc2b936700/width=450/183829.jpeg", + "nsfw": true, + "width": 792, + "height": 976, + "hash": "UIJt^_EMpc%3yrEKNZnN%%--t84.59-q?axa", + "meta": { + "Size": "792x976", + "seed": 3003562987, + "Model": "Anything-V3.0", + "steps": 20, + "prompt": "best quality,(8k, best quality, masterpiece:1.2),ultra high res, 1girl, crowd, exhibitionism, revealing_clothes, nipple_clamps, outdoors, day, street, v_sign, hypnosis, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "name": "SaiminYuugi", + "type": "lora", + "weight": 0.4 + }, + { + "hash": "8712e20a5d", + "name": "Anything-V3.0", + "type": "model" + } + ], + "Model hash": "8712e20a5d", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans, lowres,bad anatomy,bad hands, text, error, missing fingers,extra digit, fewer digits, cropped, worstquality, low quality, normal quality,jpegartifacts,signature, watermark, username,blurry,bad feet,cropped,poorly drawn hands,poorly drawn face,mutation,deformed,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,extra fingers,fewer digits,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,text,error,missing fingers,missing arms,missing legs,extra digit,mask,mosaic censoring,penis,mask,sunglasses," + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ad02fe4c-35a2-469f-bd3a-e4f8f0db1100/width=450/183831.jpeg", + "nsfw": true, + "width": 792, + "height": 976, + "hash": "UDM$_4~C00_Nor~V,]4:9tE1sqM{OYozM{M{", + "meta": { + "Size": "792x976", + "seed": 1074448331, + "Model": "Anything-V3.0", + "steps": 20, + "prompt": "best quality,(8k, best quality, masterpiece:1.2),ultra high res, 1girl, nsfw, bangs, blond hair, blush, long hair, large breasts, (dark skin:1.2), green eyes, gyaru, curly twintails, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "name": "SaiminYuugi", + "type": "lora", + "weight": 0.4 + }, + { + "hash": "8712e20a5d", + "name": "Anything-V3.0", + "type": "model" + } + ], + "Model hash": "8712e20a5d", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans, lowres,bad anatomy,bad hands, text, error, missing fingers,extra digit, fewer digits, cropped, worstquality, low quality, normal quality,jpegartifacts,signature, watermark, username,blurry,bad feet,cropped,poorly drawn hands,poorly drawn face,mutation,deformed,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,extra fingers,fewer digits,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,text,error,missing fingers,missing arms,missing legs,extra digit,mask,mosaic censoring,penis,mask,sunglasses," + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2a4ce63c-5e5e-4b81-7580-e69fb991d100/width=450/183834.jpeg", + "nsfw": true, + "width": 752, + "height": 976, + "hash": "UVN0h.~WcFF^rt+Iw4pF55xa-pSuJPx^E2x[", + "meta": { + "Size": "752x976", + "seed": 3864276605, + "Model": "Anything-V3.0", + "steps": 20, + "prompt": "best quality,(8k, best quality, masterpiece:1.2),ultra high res, (1girl:1.4),solo, cute face, ultra-detailed,long_hair,(medium breasts:1.4), hypnosis, , nsfw, sky, outdoors, flowers,cherry blossoms, looking at viewer", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "name": "SaiminYuugi", + "type": "lora", + "weight": 0.5 + }, + { + "hash": "8712e20a5d", + "name": "Anything-V3.0", + "type": "model" + } + ], + "Model hash": "8712e20a5d", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans, lowres,bad anatomy,bad hands, text, error, missing fingers,extra digit, fewer digits, cropped, worstquality, low quality, normal quality,jpegartifacts,signature, watermark, username,blurry,bad feet,cropped,poorly drawn hands,poorly drawn face,mutation,deformed,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,extra fingers,fewer digits,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,text,error,missing fingers,missing arms,missing legs,extra digit,mask,mosaic censoring,penis,mask,sunglasses," + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4b88866b-4259-4ba8-7d98-ef886c391100/width=450/183832.jpeg", + "nsfw": true, + "width": 792, + "height": 976, + "hash": "URJ@tQ4;0KR%~p9FIokCEfRk-pjY%NWCROay", + "meta": { + "Size": "792x976", + "seed": 2883731795, + "Model": "Anything-V3.0", + "steps": 20, + "prompt": "best quality,(8k, best quality, masterpiece:1.2),ultra high res, 1girl, nsfw, hairband,white hair,green eyes, large breasts, white blouse,frilled shirt,black skirt,long skirt, pantyhose,suspenders,red bowtie, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "name": "SaiminYuugi", + "type": "lora", + "weight": 0.4 + }, + { + "hash": "8712e20a5d", + "name": "Anything-V3.0", + "type": "model" + } + ], + "Model hash": "8712e20a5d", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans, lowres,bad anatomy,bad hands, text, error, missing fingers,extra digit, fewer digits, cropped, worstquality, low quality, normal quality,jpegartifacts,signature, watermark, username,blurry,bad feet,cropped,poorly drawn hands,poorly drawn face,mutation,deformed,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,extra fingers,fewer digits,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,text,error,missing fingers,missing arms,missing legs,extra digit,mask,mosaic censoring,penis,mask,sunglasses," + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/17946" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/hypnosisBlankEyes_v10.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/hypnosisBlankEyes_v10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..bb7e0d581f9121dcd799f18903ca6e57c635f6d4 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/hypnosisBlankEyes_v10.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/hypnosisBlankEyes_v10.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/hypnosisBlankEyes_v10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..1125d87c66d27ff9300f1d74aae272e67017aa9b --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/hypnosisBlankEyes_v10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:2bdda05b65b1cbcad60c8c315d8ba7e6f24e5461ea598c51f0fcfa6bf86ef3cc +size 75618673 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/kawaiipouts_.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/kawaiipouts_.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..6738373605ce4b45be5e1869f11d2ebbe080f760 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/kawaiipouts_.civitai.info" @@ -0,0 +1,532 @@ +{ + "id": 7068, + "modelId": 6063, + "name": "KawaiiPouts", + "createdAt": "2023-01-31T21:46:47.399Z", + "updatedAt": "2023-01-31T22:00:13.665Z", + "trainedWords": [ + "pout", + " pouting", + "puffy cheeks", + "anger vein", + "spoken anger vein", + "squiggle", + "spoken squiggle", + "speech bubble", + "sad", + "mad", + "annoyed" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 1501, + "ratingCount": 3, + "rating": 5 + }, + "model": { + "name": "KawaiiPouts", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "kawaiipouts_.safetensors", + "id": 7169, + "sizeKB": 147532.8759765625, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-01-31T21:51:50.556Z", + "hashes": { + "AutoV1": "60DD4058", + "AutoV2": "1C9AAFED40", + "SHA256": "1C9AAFED40E1936D41F1EE78B50959C56A7DE263B62C737FE0CC2CC4623809D2", + "CRC32": "6B36FE7B", + "BLAKE3": "5A9DDA1A493121EA44738C989982DF56F2A5E927E1674D4776916C4F4C41C7B2" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/7068" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0a219a9d-d401-44bd-a283-a8e048ac9900/width=450/65045.jpeg", + "nsfw": false, + "width": 512, + "height": 680, + "hash": "UTIE;N9G$IV?.AIUROocNKt7i^kBX9WCs+j]", + "meta": { + "ENSD": "31337", + "Size": "512x680", + "seed": 2042189582, + "Model": "Anime_OpenAnimeJourney", + "steps": 28, + "prompt": "eufoniuz, anime screencap, looking at viewer, upper body portrait, 1girl, pout, mad, crossed arms, breasts, huge breasts, Honolulu Blue hair, (asymmetrical bangs, messy hair:1.3), gray eyes, wearing tuxedo, black tie, jacket, buttondown shirt, black pants with no jewelry or neckwear, atoutdoors and (cloudy sky:1.0), incredibly absurdres, 8k wallpaper, finely detailed background, amazing background", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "34db15c05d", + "name": "Anime_OpenAnimeJourney", + "type": "model" + }, + { + "hash": "32124e140dd8", + "name": "eufoniuz_style", + "type": "lora", + "weight": null + }, + { + "hash": "652f29c9e884", + "name": "Pouts", + "type": "lora", + "weight": null + } + ], + "Model hash": "34db15c05d", + "AddNet Enabled": "True", + "AddNet Model 1": "eufoniuz_style(32124e140dd8)", + "AddNet Model 2": "Pouts(652f29c9e884)", + "__Hairstyles__": "1.3)", + "negativePrompt": "nsfw, (worst quality, low quality:1.4), Bad Artist Anime, Bad Artist OG, Bad Hands, Bad Image v4, random hair, disconnected hair, frames", + "AddNet Module 1": "LoRA", + "AddNet Module 2": "LoRA", + "Wildcard prompt": "\"eufoniuz", + "AddNet Weight A 1": "1", + "AddNet Weight A 2": "0.9", + "AddNet Weight B 1": "1", + "AddNet Weight B 2": "0.9", + "at{1$$indoors|(__locations__": "1.3)|outdoors and (__sky__" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b0649f4b-0160-4297-bf9e-01d79de77500/width=450/65064.jpeg", + "nsfw": false, + "width": 840, + "height": 1120, + "hash": "UBEM5*-p9E^+00Rj0KIU4;tR_4IoNLRkwct7", + "meta": { + "ENSD": "31337", + "Size": "512x680", + "seed": 1205535765, + "Model": "Anime_AmbrosiaFusion", + "steps": 28, + "prompt": "incredibly absurdres, best quality, 8k wallpaper, highly intricate details, looking at viewer, upper body portrait, 1girl, pout, mad, anger vein, crossed arms, breasts, medium breasts, Royal Blue hair, (hair slicked back, big hair:1.3), dark blue eyes, wearing skiing parka, skiing clothes, scarf, ski pants with monocle and lei,outdoors and (starry sky:1.0), finely detailed background, amazing background", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "6242adb77e", + "name": "Anime_AmbrosiaFusion", + "type": "model" + }, + { + "hash": "652f29c9e884", + "name": "Pouts", + "type": "lora", + "weight": null + } + ], + "Model hash": "6242adb77e", + "Hires upscale": "1.65", + "AddNet Enabled": "True", + "AddNet Model 1": "Pouts(652f29c9e884)", + "Hires upscaler": "4x_ArtStation1337_v2", + "__Hairstyles__": "1.3)", + "negativePrompt": "nsfw, borders, letterboxing, frame, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, out of focus, censorship, two anuses, Bad Artist Anime, Bad Artist OG, Bad Hands, Bad Image v4, random hair, disconnected hair, frames, multiple pairs of glasses", + "AddNet Module 1": "LoRA", + "Wildcard prompt": "\"incredibly absurdres", + "AddNet Weight A 1": "1.1", + "AddNet Weight B 1": "1.1", + "Denoising strength": "0.65", + "{1$$indoors|__locations__|outdoors and (__sky__": "1.0)}" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/372d5361-16d1-4cb9-1d8d-defcdd92c700/width=450/65063.jpeg", + "nsfw": false, + "width": 944, + "height": 1256, + "hash": "ULKA.]?w_1of-:t7%MtR0KM{M{oei^M_R*xu", + "meta": { + "ENSD": "31337", + "Size": "512x680", + "seed": 3986305389, + "Model": "Anime_Animistatics-fp16", + "steps": 28, + "prompt": "raiden shogun, hinghoi, cowboy shot, 1girl, pout, glaring, crossed arms, breasts, at indoors, incredibly absurdres, 8k wallpaper, finely detailed background, amazing background nilsunna", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "89e8d8e719", + "name": "Anime_Animistatics-fp16", + "type": "model" + }, + { + "hash": "ba02edc09205", + "name": "HinghoiV3", + "type": "lora", + "weight": null + }, + { + "hash": "652f29c9e884", + "name": "Pouts", + "type": "lora", + "weight": null + }, + { + "hash": "b49d7d46a001", + "name": "shogun_LoRA", + "type": "lora", + "weight": null + } + ], + "Model hash": "89e8d8e719", + "Hires upscale": "1.85", + "AddNet Enabled": "True", + "AddNet Model 1": "HinghoiV3(ba02edc09205)", + "AddNet Model 2": "Pouts(652f29c9e884)", + "AddNet Model 3": "raiden shogun_LoRA(b49d7d46a001)", + "Hires upscaler": "lollypop", + "negativePrompt": "nsfw, dynamic angle, (worst quality, low quality:1.4), Bad Artist Anime, Bad Artist OG, Bad Hands, Bad Image v4, random hair, disconnected hair, frames", + "AddNet Module 1": "LoRA", + "AddNet Module 2": "LoRA", + "AddNet Module 3": "LoRA", + "Wildcard prompt": "\"raiden shogun", + "AddNet Weight A 1": "0.85", + "AddNet Weight A 2": "0.9", + "AddNet Weight A 3": "1.35", + "AddNet Weight B 1": "0.85", + "AddNet Weight B 2": "0.9", + "AddNet Weight B 3": "1.35", + "Denoising strength": "0.5", + "at {1$$indoors|(__locations__": "1.3)|outdoors and (__sky__" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/46fa260f-ff2f-449c-6523-128139188600/width=450/65062.jpeg", + "nsfw": true, + "width": 944, + "height": 1088, + "hash": "UHFreVxu0g?v?]xu?It8yCR.%4oe_3NGxboK", + "meta": { + "ENSD": "31337", + "Size": "512x592", + "seed": 2933052039, + "Model": "Anime_El Diablo", + "steps": 22, + "prompt": "best quality, perfect lighting, shiny skin, cowboy shot, 1girl, pout, speech bubble, (anger vein:1.3), closed mouth, breasts, flat chest, no cleavage, Pastel Green hair, (gradient hair), (hair between eyes, crew cut:1.3), black eyes, shelf bra, cleavage, wearing slingshot swimsuit, no hair accessories and no cap, at (industrial:1.3), incredibly absurdres, 8k wallpaper, finely detailed background, amazing background", + "sampler": "Euler a", + "cfgScale": 10, + "Clip skip": "2", + "resources": [ + { + "hash": "99d9ce8a35", + "name": "Anime_El Diablo", + "type": "model" + } + ], + "Model hash": "99d9ce8a35", + "(anger vein": "1.3)", + "Hires upscale": "1.85", + "AddNet Enabled": "True", + "AddNet Model 2": "SadMadFaces(2d03d1e8d261)", + "Hires upscaler": "lollypop", + "__Hairstyles__": "1.3)", + "negativePrompt": "(worst quality, low quality:1.4), Bad Artist Anime, Bad Artist OG, Bad Hands, Bad Image v4, (multiple speech bubbles, multiple squiggles, more than 1 squiggle, multiple anger vein, more than 1 anger vein:1.4), holding food, holding bowl, random hair, disconnected hair, frames", + "AddNet Module 2": "LoRA", + "Wildcard prompt": "\"cowboy shot", + "AddNet Weight A 2": "0.75", + "AddNet Weight B 2": "0.75", + "Denoising strength": "0.5", + "at {1$$indoors|(__locations__": "1.3)|outdoors and (__sky__" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c4ca1d7b-dd82-4d80-9a68-aff25193d100/width=450/65061.jpeg", + "nsfw": true, + "width": 944, + "height": 1088, + "hash": "UBHn~dpI54IT~q.7Im00NG-;t7M|%M_3-p^+", + "meta": { + "ENSD": "31337", + "Size": "512x592", + "seed": 652893084, + "Model": "Anime_El Diablo", + "steps": 22, + "prompt": "best quality, perfect lighting, shiny skin, cowboy shot, 1girl, pout, speech bubble, (spoken anger vein:1.3), closed mouth, breasts, large breasts, Concrete hair, (streaked hair), (single hair intake, sidelocks:1.3), squinted eyes, center opening, cleavage, wearing duffel coat and bike shorts, no hair accessories and no headwear, at indoors, incredibly absurdres, 8k wallpaper, finely detailed background, amazing background", + "sampler": "DDIM", + "cfgScale": 10, + "Clip skip": "2", + "resources": [ + { + "hash": "99d9ce8a35", + "name": "Anime_El Diablo", + "type": "model" + } + ], + "Model hash": "99d9ce8a35", + "Hires upscale": "1.85", + "AddNet Enabled": "True", + "AddNet Model 2": "SadMadFaces(2d03d1e8d261)", + "Hires upscaler": "lollypop", + "__Hairstyles__": "1.3)", + "negativePrompt": "(worst quality, low quality:1.4), Bad Artist Anime, Bad Artist OG, Bad Hands, Bad Image v4, (multiple speech bubbles, multiple squiggles, more than 1 squiggle, multiple anger vein, more than 1 anger vein:1.4), holding food, holding bowl, random hair, disconnected hair, frames", + "AddNet Module 2": "LoRA", + "Wildcard prompt": "\"cowboy shot", + "AddNet Weight A 2": "1.25", + "AddNet Weight B 2": "1.25", + "(spoken anger vein": "1.3)", + "Denoising strength": "0.5", + "at {1$$indoors|(__locations__": "1.3)|outdoors and (__sky__" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/424b5c76-65bc-4244-e7ae-6d7271289a00/width=450/65060.jpeg", + "nsfw": true, + "width": 944, + "height": 1256, + "hash": "U7Guj[^l000M00Di9{~p_3e.D*OY2vN{=v%M", + "meta": { + "ENSD": "31337", + "Size": "512x680", + "seed": 3164467980, + "Model": "Anime_RDtMix", + "steps": 28, + "prompt": "cubedcoconut, cowboy shot, 1girl, pout, puffy cheeks, sad, crossed arms, breasts, flat chest, no cleavage, Racing Red hair, (streaked hair), (godiva Hair, cone hair bun:1.3), green eyes, sarashi, cleavage, wearing jammers, no hair accessories and flat cap, at (gradient:1.3), incredibly absurdres, 8k wallpaper, finely detailed background, amazing background", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "2bb3be07b1", + "name": "Anime_RDtMix", + "type": "model" + }, + { + "hash": "20c2b78f69aa", + "name": "CubedCoconut", + "type": "lora", + "weight": null + }, + { + "hash": "652f29c9e884", + "name": "Pouts", + "type": "lora", + "weight": null + }, + { + "hash": "ccc3c939d60c", + "name": "ep2", + "type": "lora", + "weight": null + } + ], + "Model hash": "2bb3be07b1", + "Hires upscale": "1.85", + "AddNet Enabled": "True", + "AddNet Model 1": "CubedCoconut(20c2b78f69aa)", + "AddNet Model 2": "Pouts(652f29c9e884)", + "AddNet Model 3": "dpep2 ep2(ccc3c939d60c)", + "Hires upscaler": "lollypop", + "__Hairstyles__": "1.3)", + "negativePrompt": "nsfw, (worst quality, low quality:1.4), Bad Artist Anime, Bad Artist OG, Bad Hands, Bad Image v4, random hair, disconnected hair, frames", + "AddNet Module 1": "LoRA", + "AddNet Module 2": "LoRA", + "AddNet Module 3": "LoRA", + "Wildcard prompt": "\"cubedcoconut", + "AddNet Weight A 1": "1", + "AddNet Weight A 2": "1", + "AddNet Weight A 3": "0.35", + "AddNet Weight B 1": "1", + "AddNet Weight B 2": "1", + "AddNet Weight B 3": "0.35", + "Denoising strength": "0.5", + "at {1$$indoors|(__locations__": "1.3)|outdoors and (__sky__" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/55d950f3-6a1d-44c3-1468-47d1b27b4f00/width=450/65059.jpeg", + "nsfw": true, + "width": 944, + "height": 1256, + "hash": "UZL|y70K~qe..8t7S$NGtRxu%2oLx]j[ogt6", + "meta": { + "ENSD": "31337", + "Size": "512x680", + "seed": 2571905010, + "Model": "Anime_LimeMixV2", + "steps": 22, + "prompt": "cowboy shot, 1girl, pout, speech bubble, (spoken squiggle:1.3), closed mouth, breasts, medium breasts, Tennis Court Green hair, (streaked hair), (hair tubes, braided bangs:1.3), amber eyes, center opening, cleavage, wearing hanten, hairband and no headwear, at (school:1.3), incredibly absurdres, 8k wallpaper, finely detailed background, amazing background", + "sampler": "Euler a", + "cfgScale": 10, + "Clip skip": "2", + "resources": [ + { + "hash": "82849725e8", + "name": "Anime_LimeMixV2", + "type": "model" + } + ], + "Model hash": "82849725e8", + "Hires upscale": "1.85", + "AddNet Enabled": "True", + "AddNet Model 2": "SadMadFaces(2d03d1e8d261)", + "Hires upscaler": "lollypop", + "__Hairstyles__": "1.3)", + "negativePrompt": "(worst quality, low quality:1.4), Bad Artist Anime, Bad Artist OG, Bad Hands, Bad Image v4, (multiple squiggles, more than 1 squiggle, multiple anger vein, more than 1 anger vein:1.4), holding food, holding bowl, random hair, disconnected hair, frames", + "AddNet Module 2": "LoRA", + "Wildcard prompt": "\"cowboy shot", + "(spoken squiggle": "1.3)", + "AddNet Weight A 2": "0.55", + "AddNet Weight B 2": "0.55", + "Denoising strength": "0.5", + "at {1$$indoors|(__locations__": "1.3)|outdoors and (__sky__" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/39e4bd41-a002-4c91-aed3-41921a985b00/width=450/65058.jpeg", + "nsfw": false, + "width": 944, + "height": 1088, + "hash": "UmK_OU~W?cs:?cxaWUofIVRjofogoyj]n+WB", + "meta": { + "ENSD": "31337", + "Size": "512x592", + "seed": 1572895453, + "Model": "Anime_LimeMixV2", + "steps": 22, + "prompt": "spoken anger vein, pout, speech bubble, cowboy shot, 1girl, open mouth, breasts, sarashi, Tennis Court Blue hair, (gradient hair), (curtain Bangs, hair flaps:1.3), (dark green eyes:1.3), wearing layered kimono, hair tie and no headwear, at outdoors and (mist:1.3), incredibly absurdres, 8k wallpaper, finely detailed background, amazing background", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7.5, + "(__eyes__": "1.3)", + "Clip skip": "2", + "resources": [ + { + "hash": "82849725e8", + "name": "Anime_LimeMixV2", + "type": "model" + } + ], + "Model hash": "82849725e8", + "Hires upscale": "1.85", + "AddNet Enabled": "True", + "AddNet Model 2": "SadMadFaces-000004(718b17bf4054)", + "Hires upscaler": "lollypop", + "__Hairstyles__": "1.3)", + "negativePrompt": "(worst quality, low quality:1.4), Bad Artist Anime, Bad Artist OG, Bad Hands, Bad Image v4, (multiple speech bubbles, multiple squiggles, more than 1 squiggle, multiple anger vein, more than 1 anger vein:1.4), holding food, holding bowl, random hair, disconnected hair, frames, (ridiculously big breasts:1.4)", + "AddNet Module 2": "LoRA", + "Wildcard prompt": "\"spoken anger vein", + "AddNet Weight A 2": "1.25", + "AddNet Weight B 2": "1.25", + "Denoising strength": "0.5", + "at {1$$indoors|(__locations__": "1.3)|outdoors and (__sky__" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/521ef042-de8b-4ee9-c4ca-31c83c758600/width=450/65057.jpeg", + "nsfw": true, + "width": 512, + "height": 680, + "hash": "UFJ+DVEN49%fA;0f}[DNRj-p~CD%E1aKI:EL", + "meta": { + "ENSD": "31337", + "Size": "512x680", + "seed": 3148419473, + "Model": "Anime_LimeMixV2", + "steps": 28, + "prompt": "cowboy shot, 1girl, (annoyed, spoken squiggle:1.4), breasts, small breasts, Midnight Green hair, (colored inner hair), (huge ahoge, bob cut:1.3), dark red eyes, Cinderella bust, cleavage, wearing micro bikini, no hair accessories and no headwear, at (forest:1.3), incredibly absurdres, 8k wallpaper, finely detailed background, amazing background", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "82849725e8", + "name": "Anime_LimeMixV2", + "type": "model" + } + ], + "Model hash": "82849725e8", + "AddNet Enabled": "True", + "AddNet Model 2": "SadMadFaces(2d03d1e8d261)", + "__Hairstyles__": "1.3)", + "negativePrompt": "nsfw, dynamic angle, 3d, realism, (worst quality, low quality:1.4), Bad Artist Anime, Bad Artist OG, Bad Hands, Bad Image v4, random hair, disconnected hair, frames", + "AddNet Module 2": "LoRA", + "Wildcard prompt": "\"cowboy shot", + "spoken squiggle": "1.4)", + "AddNet Weight A 2": "0.85", + "AddNet Weight B 2": "0.85", + "at {1$$indoors|(__locations__": "1.3)|outdoors and (__sky__" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a16d9dcd-aa5f-408f-9f48-1ad54d497900/width=450/65056.jpeg", + "nsfw": true, + "width": 944, + "height": 1256, + "hash": "UFK0:9+[B@_2miyD02e94m9twhIW?voGIovz", + "meta": { + "ENSD": "31337", + "Size": "512x680", + "seed": 4275202213, + "Model": "Anime_LimeMixV2", + "steps": 28, + "prompt": "hedit, anime screencap, cowboy shot, 1girl, (annoyed, spoken anger vein:1.2), closed mouth, breasts, gigantic breasts, Rosy Brown hair, (streaked hair), (godiva Hair, triple bun:1.3), yellow eyes, cupless bra, cleavage, wearing hoodie and bell-bottoms, hair tubes and no headwear, at (cockpit:1.3), incredibly absurdres, 8k wallpaper, finely detailed background, amazing background", + "sampler": "DPM++ 2M Karras", + "cfgScale": 10, + "Clip skip": "2", + "resources": [ + { + "hash": "82849725e8", + "name": "Anime_LimeMixV2", + "type": "model" + }, + { + "hash": "4df608091e82", + "name": "Hedit", + "type": "lora", + "weight": null + }, + { + "hash": "2d03d1e8d261", + "name": "SadMadFaces", + "type": "lora", + "weight": null + } + ], + "Model hash": "82849725e8", + "Hires upscale": "1.85", + "AddNet Enabled": "True", + "AddNet Model 1": "Hedit(4df608091e82)", + "AddNet Model 2": "SadMadFaces(2d03d1e8d261)", + "Hires upscaler": "lollypop", + "__Hairstyles__": "1.3)", + "negativePrompt": "multiple squiggles, more than 1 squiggle, multiple anger vein, more than 1 anger vein, dynamic angle, 3d, realism, (worst quality, low quality:1.4), Bad Artist Anime, Bad Artist OG, Bad Hands, Bad Image v4, random hair, disconnected hair, frames", + "AddNet Module 1": "LoRA", + "AddNet Module 2": "LoRA", + "Wildcard prompt": "\"hedit", + "AddNet Weight A 1": "0.85", + "AddNet Weight A 2": "1", + "AddNet Weight B 1": "0.85", + "AddNet Weight B 2": "1", + "spoken anger vein": "1.2)", + "Denoising strength": "0.5", + "at {1$$indoors|(__locations__": "1.3)|outdoors and (__sky__" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/7068" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/kawaiipouts_.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/kawaiipouts_.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..5d13fd8e688fbdb3910d0f5d99660b1fb9106c70 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/kawaiipouts_.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/kawaiipouts_.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/kawaiipouts_.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..41f450301308e9117ab115bf7143b4ddce51715e --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/kawaiipouts_.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:1c9aafed40e1936d41f1ee78b50959c56a7de263b62c737fe0cc2cc4623809d2 +size 151073665 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/lovereye_v1.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/lovereye_v1.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..97664c97a3717d50353c3915d3367b8dd5070172 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/lovereye_v1.civitai.info" @@ -0,0 +1,129 @@ +{ + "id": 91491, + "modelId": 86051, + "name": "v1.0", + "createdAt": "2023-06-08T04:15:55.318Z", + "updatedAt": "2023-06-08T04:17:28.205Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 96, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Tangbohu lover eye", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "lovereye_v1.safetensors", + "id": 63025, + "sizeKB": 13329.5078125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-08T04:21:02.848Z", + "hashes": { + "AutoV1": "055730CB", + "AutoV2": "33A3B38F0D", + "SHA256": "33A3B38F0D0E71D5AFDED925BEF22C74D72B33FCFD82A496906580AE41F45084", + "CRC32": "10E0D10F", + "BLAKE3": "CA5BF829FE5F29B7254E108792278EFD7C683ACC035C1343C405C090FA8F37F7" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/91491" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/58b74d01-2323-4a47-b93a-98a5f61f1ddd/width=450/1068832.jpeg", + "nsfw": "None", + "width": 2048, + "height": 581, + "hash": "UgLgU}WBj[j[kCWWayWC%#j[fRj[~qoLj[of", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 3438167316, + "Model": "Anything-V3.0", + "steps": 20, + "Script": "X/Y/Z plot", + "X Type": "Prompt S/R", + "hashes": { + "model": "8712e20a5d" + }, + "prompt": "1girl face close up,smile ,red eye ", + "Version": "v1.2.1", + "sampler": "Euler a", + "X Values": "\"0,0.5,1,1.5\"", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "lovereye_v1", + "type": "lora", + "weight": 0 + }, + { + "hash": "8712e20a5d", + "name": "Anything-V3.0", + "type": "model" + } + ], + "Model hash": "8712e20a5d", + "negativePrompt": "EasyNegative" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c46f1843-00df-45f8-98f7-e2233b785821/width=450/1068833.jpeg", + "nsfw": "None", + "width": 2048, + "height": 581, + "hash": "UhLD+8WWWBWCx]aekBay%#j[oLay~qt7ayof", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 3438167316, + "Model": "Anything-V3.0", + "steps": 20, + "Script": "X/Y/Z plot", + "X Type": "Prompt S/R", + "hashes": { + "model": "8712e20a5d" + }, + "prompt": "1girl face close up,smile , ", + "Version": "v1.2.1", + "sampler": "Euler a", + "X Values": "\"0,0.5,1,1.5\"", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "lovereye_v1", + "type": "lora", + "weight": 0 + }, + { + "hash": "8712e20a5d", + "name": "Anything-V3.0", + "type": "model" + } + ], + "Model hash": "8712e20a5d", + "negativePrompt": "EasyNegative" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/91491" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/lovereye_v1.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/lovereye_v1.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..e1e3b985c02941f3ed0a33463cea1e28d3897478 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/lovereye_v1.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/lovereye_v1.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/lovereye_v1.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..61728de1946cfe5dc1d3a50be6b462fa972fd56f --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/lovereye_v1.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:33a3b38f0d0e71d5afded925bef22c74d72b33fcfd82a496906580ae41f45084 +size 13649416 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/shadedFaceEyesIn_shadedFace.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/shadedFaceEyesIn_shadedFace.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..11ebbf7c0fcd381226163dfbc934de2a23a0e46a --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/shadedFaceEyesIn_shadedFace.civitai.info" @@ -0,0 +1,384 @@ +{ + "id": 17281, + "modelId": 14669, + "name": "shaded face", + "createdAt": "2023-03-01T21:01:08.399Z", + "updatedAt": "2023-03-01T21:04:43.239Z", + "trainedWords": [ + "shaded face" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 2178, + "ratingCount": 3, + "rating": 5 + }, + "model": { + "name": "Shaded face (eyes in shadow)", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "shadedFaceEyesIn_shadedFace.safetensors", + "id": 14538, + "sizeKB": 28653.9912109375, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-03-01T21:05:46.703Z", + "hashes": { + "AutoV1": "739C89EC", + "AutoV2": "DC76FD15D6", + "SHA256": "DC76FD15D639ABCA922E5EE9E0D558FA2DC40094F9020AA8A8B843F98B6CE48B", + "CRC32": "ADF447D8", + "BLAKE3": "6551E5443F6CB79D13B8F5D1E6610FDBA63CDAA34F87520E2BA105B8AE7EFC72" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/17281" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7a64f90b-7cd7-43b9-087b-ac92b74bc100/width=450/175687.jpeg", + "nsfw": false, + "width": 1024, + "height": 1024, + "hash": "UYJ7]wD%~o-:s:Rjt7of9Zofs:M{t6kCs:ay", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 1227244280, + "Model": "abyssorangemix2NSFW_abyssorangemix2Nsfw", + "steps": 30, + "prompt": "masterpiece, best quality, highres, 1girl, shaded face ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 11, + "Clip skip": "2", + "resources": [ + { + "name": "shaded_face2_pruned_0", + "type": "lora", + "weight": 1 + }, + { + "hash": "e892703c61", + "name": "abyssorangemix2NSFW_abyssorangemix2Nsfw", + "type": "model" + } + ], + "Model hash": "e892703c61", + "Hires upscale": "2", + "Hires upscaler": "ESRGAN_4x", + "negativePrompt": "nsfw, lowres, bad anatomy, worst quality, text, username, watermark, signature, jpeg artifacts", + "Denoising strength": "0.4" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5f85fa35-5cd5-427d-dc37-c482443b3500/width=450/175688.jpeg", + "nsfw": false, + "width": 2816, + "height": 3493, + "hash": "UdM%yL-;xu_N?bR%oLRj-;aeazRj-:j[WBWB", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 3, + "Model": "abyssorangemix2_Hard", + "steps": 30, + "Script": "X/Y/Z plot", + "X Type": "Prompt S/R", + "Y Type": "Checkpoint name", + "Z Type": "Seed", + "prompt": "masterpiece, best quality, highres, 1girl, shaded face ", + "sampler": "DPM++ 2M Karras", + "Y Values": "\"abyssorangemix2_Hard,anyhentai_14,AOM3,CounterfeitV25_25,dalcefoV3Anime_,grapefruitHentaiModel_grapefruitv31\"", + "Z Values": "\"3,4\"", + "cfgScale": 11, + "Clip skip": "2", + "resources": [ + { + "name": "shaded_face2_pruned_0", + "type": "lora", + "weight": 1 + }, + { + "hash": "cadf2c6654", + "name": "abyssorangemix2_Hard", + "type": "model" + } + ], + "Model hash": "cadf2c6654", + "Fixed Z Values": "\"3, 4\"", + "negativePrompt": "nsfw, lowres, bad anatomy, worst quality, text, username, watermark, signature, jpeg artifacts", + "shaded_face2_pruned_0": "1>,\"" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8f96c03a-6b4c-42d2-96e2-cdc0d2ff6500/width=450/175700.jpeg", + "nsfw": false, + "width": 512, + "height": 512, + "hash": "UYGuH{~W%gg3R*xu?H%2D%M{s.WB-;kCIoWA", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 3, + "Model": "abyssorangemix2_Hard", + "steps": 30, + "prompt": "masterpiece, best quality, highres, 1girl, shaded face ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 11, + "Clip skip": "2", + "resources": [ + { + "name": "shaded_face2_pruned_0", + "type": "lora", + "weight": 1 + }, + { + "hash": "cadf2c6654", + "name": "abyssorangemix2_Hard", + "type": "model" + } + ], + "Model hash": "cadf2c6654", + "negativePrompt": "nsfw, lowres, bad anatomy, worst quality, text, username, watermark, signature, jpeg artifacts" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/53b1a633-924d-4ea4-985d-997b4ba5c100/width=450/175699.jpeg", + "nsfw": false, + "width": 512, + "height": 512, + "hash": "UNJHgi4o?]9FpdRO_3ad58%2IBj?xvjZofs.", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 4, + "Model": "abyssorangemix2_Hard", + "steps": 30, + "prompt": "masterpiece, best quality, highres, 1girl, shaded face ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 11, + "Clip skip": "2", + "resources": [ + { + "name": "shaded_face2_pruned_0", + "type": "lora", + "weight": 1 + }, + { + "hash": "cadf2c6654", + "name": "abyssorangemix2_Hard", + "type": "model" + } + ], + "Model hash": "cadf2c6654", + "negativePrompt": "nsfw, lowres, bad anatomy, worst quality, text, username, watermark, signature, jpeg artifacts" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1ea395c5-350d-45f2-6315-af8fe730a900/width=450/175698.jpeg", + "nsfw": false, + "width": 512, + "height": 512, + "hash": "UNG[QQ~p_N.8EM?H?H%L4oMxs,Rj~WofR*xa", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 3, + "Model": "anyhentai_14", + "steps": 30, + "prompt": "masterpiece, best quality, highres, 1girl, shaded face ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 11, + "Clip skip": "2", + "resources": [ + { + "name": "shaded_face2_pruned_0", + "type": "lora", + "weight": 1 + }, + { + "hash": "d5f0f06fcc", + "name": "anyhentai_14", + "type": "model" + } + ], + "Model hash": "d5f0f06fcc", + "negativePrompt": "nsfw, lowres, bad anatomy, worst quality, text, username, watermark, signature, jpeg artifacts" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/202198c6-5ac9-4794-a7cc-b9385279ed00/width=450/175697.jpeg", + "nsfw": false, + "width": 512, + "height": 512, + "hash": "UeH-=JIT_NIU?vjF%MjFI[oejGj@x]V@xbRj", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 4, + "Model": "anyhentai_14", + "steps": 30, + "prompt": "masterpiece, best quality, highres, 1girl, shaded face ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 11, + "Clip skip": "2", + "resources": [ + { + "name": "shaded_face2_pruned_0", + "type": "lora", + "weight": 1 + }, + { + "hash": "d5f0f06fcc", + "name": "anyhentai_14", + "type": "model" + } + ], + "Model hash": "d5f0f06fcc", + "negativePrompt": "nsfw, lowres, bad anatomy, worst quality, text, username, watermark, signature, jpeg artifacts" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a6a0f2e9-c510-45bf-ea10-51816762c600/width=450/175696.jpeg", + "nsfw": false, + "width": 512, + "height": 512, + "hash": "UMGk]~~W?bogR*-;_3%M9FoLxuR+~pa#D%j[", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 3, + "Model": "AOM3", + "steps": 30, + "prompt": "masterpiece, best quality, highres, 1girl, shaded face ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 11, + "Clip skip": "2", + "resources": [ + { + "name": "shaded_face2_pruned_0", + "type": "lora", + "weight": 1 + }, + { + "hash": "d124fc18f0", + "name": "AOM3", + "type": "model" + } + ], + "Model hash": "d124fc18f0", + "negativePrompt": "nsfw, lowres, bad anatomy, worst quality, text, username, watermark, signature, jpeg artifacts" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9f3998ae-5946-4141-50f1-f19b7660ff00/width=450/175695.jpeg", + "nsfw": false, + "width": 512, + "height": 512, + "hash": "USI5D88{~pD%?vRj?cRjE3t7IVt7R+WVt7WB", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 4, + "Model": "AOM3", + "steps": 30, + "prompt": "masterpiece, best quality, highres, 1girl, shaded face ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 11, + "Clip skip": "2", + "resources": [ + { + "name": "shaded_face2_pruned_0", + "type": "lora", + "weight": 1 + }, + { + "hash": "d124fc18f0", + "name": "AOM3", + "type": "model" + } + ], + "Model hash": "d124fc18f0", + "negativePrompt": "nsfw, lowres, bad anatomy, worst quality, text, username, watermark, signature, jpeg artifacts" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/09e0f127-f965-488c-f71b-c2788127c700/width=450/175694.jpeg", + "nsfw": false, + "width": 512, + "height": 512, + "hash": "UTF#zG~W~WXTNHxas:%14.IUIUV@xus:ozf6", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 3, + "Model": "CounterfeitV25_25", + "steps": 30, + "prompt": "masterpiece, best quality, highres, 1girl, shaded face ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 11, + "Clip skip": "2", + "resources": [ + { + "name": "shaded_face2_pruned_0", + "type": "lora", + "weight": 1 + }, + { + "hash": "a074b8864e", + "name": "CounterfeitV25_25", + "type": "model" + } + ], + "Model hash": "a074b8864e", + "negativePrompt": "nsfw, lowres, bad anatomy, worst quality, text, username, watermark, signature, jpeg artifacts" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5f56d5ca-44e4-4e80-2c61-bb2d15847b00/width=450/175693.jpeg", + "nsfw": false, + "width": 512, + "height": 512, + "hash": "UYH_Y,IT~pIU?aM|xtWBD%tRaexut7axxaWB", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 4, + "Model": "CounterfeitV25_25", + "steps": 30, + "prompt": "masterpiece, best quality, highres, 1girl, shaded face ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 11, + "Clip skip": "2", + "resources": [ + { + "name": "shaded_face2_pruned_0", + "type": "lora", + "weight": 1 + }, + { + "hash": "a074b8864e", + "name": "CounterfeitV25_25", + "type": "model" + } + ], + "Model hash": "a074b8864e", + "negativePrompt": "nsfw, lowres, bad anatomy, worst quality, text, username, watermark, signature, jpeg artifacts" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/17281" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/shadedFaceEyesIn_shadedFace.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/shadedFaceEyesIn_shadedFace.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..8eb0b81ed2cee57203e94cc6806b8026c8bfb4dc --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/shadedFaceEyesIn_shadedFace.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:26534735903b152165cca410fabb40e0213beb0ff52714e319f316019adca936 +size 1641944 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/shadedFaceEyesIn_shadedFace.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/shadedFaceEyesIn_shadedFace.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..4c0a47eaa9acde848a042c1fbba5ab03a3f4b342 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/shadedFaceEyesIn_shadedFace.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:dc76fd15d639abca922e5ee9e0d558fa2dc40094f9020aa8a8b843f98b6ce48b +size 29341687 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/stareye_v1.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/stareye_v1.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..3906660807a713b629930bcf9c046655231c25b3 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/stareye_v1.civitai.info" @@ -0,0 +1,90 @@ +{ + "id": 91479, + "modelId": 86042, + "name": "v1.0", + "createdAt": "2023-06-08T03:56:40.294Z", + "updatedAt": "2023-06-08T03:58:33.071Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 87, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Tangbohu star eye type1", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "stareye_v1.safetensors", + "id": 63013, + "sizeKB": 13329.5078125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-08T04:01:05.460Z", + "hashes": { + "AutoV1": "055730CB", + "AutoV2": "2504622F76", + "SHA256": "2504622F76EBF8F7E9522D40C1F278FD5372F96AD41419447A63ECC8B1B429AD", + "CRC32": "00A7F6BF", + "BLAKE3": "1F532567528925BA8F4E6684967C48846BA67D184CCE4D0DC86A1AE53DFF1E24" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/91479" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/94ce47eb-e2cb-479a-b4e7-b759564335d2/width=450/1068709.jpeg", + "nsfw": "None", + "width": 2048, + "height": 581, + "hash": "UaK_2u-Tf5%0~VaeWAM{~UkWaykC~Wf,a}t7", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 1491597857, + "Model": "Anything-V3.0", + "steps": 20, + "Script": "X/Y/Z plot", + "X Type": "Prompt S/R", + "hashes": { + "model": "8712e20a5d" + }, + "prompt": "1girl face close up,smile ,blue eye ", + "Version": "v1.2.1", + "sampler": "Euler a", + "X Values": "\"0,0.5,1,1.5\"", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "stareye_v1", + "type": "lora", + "weight": 0 + }, + { + "hash": "8712e20a5d", + "name": "Anything-V3.0", + "type": "model" + } + ], + "Model hash": "8712e20a5d", + "negativePrompt": "EasyNegative" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/91479" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/stareye_v1.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/stareye_v1.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..bf1c1467b4d4ddc8a103220d68f86c43beccb8c1 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/stareye_v1.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/stareye_v1.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/stareye_v1.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..51653067c6d93278105b2a357dd7ed3fac39a6f2 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/stareye_v1.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:2504622f76ebf8f7e9522d40c1f278fd5372f96ad41419447a63ecc8b1b429ad +size 13649416 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/stareye_v2.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/stareye_v2.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..d2ea7afb31c485885d35eb7f1f48507b6317bff0 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/stareye_v2.civitai.info" @@ -0,0 +1,90 @@ +{ + "id": 91482, + "modelId": 86044, + "name": "v1.0", + "createdAt": "2023-06-08T04:00:16.870Z", + "updatedAt": "2023-06-08T04:02:31.384Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 86, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Tangbohu star eye type2", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "stareye_v2.safetensors", + "id": 63015, + "sizeKB": 13329.5078125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-08T04:06:15.847Z", + "hashes": { + "AutoV1": "055730CB", + "AutoV2": "763ED4B548", + "SHA256": "763ED4B548CB8F127A6B3B7997D2B66D8CD45A2EA946D63299BD26D6E7E43B68", + "CRC32": "4BC0F6A0", + "BLAKE3": "266ABE6F75F550F7768BEB78DB603D1F140F0B199CE0E6841861FD2452CBBFDB" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/91482" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/bc0534c9-bd44-4734-a002-deb0f398a0df/width=450/1068726.jpeg", + "nsfw": "None", + "width": 2048, + "height": 581, + "hash": "UhLgR?R*WVWCtSaeoLj[.Raea{ay~qoffRof", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 3438167316, + "Model": "Anything-V3.0", + "steps": 20, + "Script": "X/Y/Z plot", + "X Type": "Prompt S/R", + "hashes": { + "model": "8712e20a5d" + }, + "prompt": "1girl face close up,smile , ", + "Version": "v1.2.1", + "sampler": "Euler a", + "X Values": "\"0,0.5,1,1.5\"", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "stareye_v2", + "type": "lora", + "weight": 0 + }, + { + "hash": "8712e20a5d", + "name": "Anything-V3.0", + "type": "model" + } + ], + "Model hash": "8712e20a5d", + "negativePrompt": "EasyNegative" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/91482" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/stareye_v2.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/stareye_v2.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..3f66f3c3eefb52008e6487203f796faece6478dd Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/stareye_v2.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/stareye_v2.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/stareye_v2.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..1a1ea1154cca1345454b4f2ab3ec239f3771941c --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/stareye_v2.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:763ed4b548cb8f127a6b3b7997d2b66d8cd45a2ea946d63299bd26d6e7e43b68 +size 13649416 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/taremeEyes_v10.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/taremeEyes_v10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..2a7d9d1a52af94dd3825760964d44cb305899000 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/taremeEyes_v10.civitai.info" @@ -0,0 +1,175 @@ +{ + "id": 85591, + "modelId": 80690, + "name": "v1.0", + "createdAt": "2023-05-30T15:30:42.685Z", + "updatedAt": "2023-05-30T15:45:35.956Z", + "trainedWords": [ + "tareme eyes" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

First release

", + "stats": { + "downloadCount": 955, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Drooping Eyes :TAREME", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "taremeEyes_v10.safetensors", + "id": 58472, + "sizeKB": 15171.392578125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-30T15:35:44.758Z", + "hashes": { + "AutoV1": "B12DDA25", + "AutoV2": "AB3C039FD3", + "SHA256": "AB3C039FD3126497FC1F7F62E7D9A495247E1C4BA8A46E5C623D905959A6CD41", + "CRC32": "4E4ABB22", + "BLAKE3": "BA905B2894B07797D584827AC16CF86E346082FB0E31554E3E996408765DBC71" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/85591" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3fd7e627-38eb-4d1d-9874-3c5f6fe84466/width=450/969892.jpeg", + "nsfw": "None", + "width": 800, + "height": 1280, + "hash": "UkL4Tt%f~pWB?bt7x]e:Rjj]ozRjtSofxaR*", + "meta": { + "Size": "400x640", + "seed": 1503720965, + "Model": "corneos7thHeavenMix_v2", + "steps": 38, + "hashes": { + "model": "d1e6b263b6" + }, + "prompt": "(masterpiece:1.2),best quality,illustration,beautiful detailed girl,\n(1girl) (standing at attention),front view,arms aside,\n(sweat:1.2),(smile:1.1),open mouth,(tareme eyes:1.1),upper body,\n(long hair:1.1),blunt bangs,dark blue frilled dress,\nbacklighting,", + "sampler": "DPM++ 2M", + "cfgScale": 12, + "Clip skip": "2", + "resources": [ + { + "name": "taremeEyes_v10", + "type": "lora", + "weight": 1.5 + }, + { + "hash": "d1e6b263b6", + "name": "corneos7thHeavenMix_v2", + "type": "model" + } + ], + "Model hash": "d1e6b263b6", + "Hires steps": "40", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(worst quality,low quality:1.3),(lip,rouge,lipstick, eyeshadow,monochrome:1.0), watermark,navel,(from side:1.2),sadly", + "Denoising strength": "0.7" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/13f07560-2bcb-4554-8bb7-5cee7f34e719/width=450/969971.jpeg", + "nsfw": "None", + "width": 1120, + "height": 1280, + "hash": "U6IELq00~B00R49H^+Mx~BIAVs-U00MxIoni", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5355476f-0e7e-4fcc-ad9b-749e554c5288/width=450/975560.jpeg", + "nsfw": "Soft", + "width": 800, + "height": 1280, + "hash": "UHKwtc-:0J-.~mkr02R$I:bIN2E2?F%0$eof", + "meta": { + "Size": "400x640", + "seed": 806685970, + "Model": "AnythingV5_v5RE", + "steps": 38, + "hashes": { + "model": "e06702b274" + }, + "prompt": "(masterpiece:1.2),best quality,illustration,beautiful detailed girl,\n(1girl) (standing at attention),front view,(arms aside:1.1),\n(sweat:1.0),(smile),joyful,closed mouth,(tareme eyes:1.1),upper body,tiara with jewery,pointy ears,\n(blonde long hair:1.1),blunt bangs,darek blue frilled dress,victorian garden,\nbacklighting,", + "sampler": "DPM++ 2M", + "cfgScale": 12, + "Clip skip": "2", + "resources": [ + { + "name": "taremeEyes_v10", + "type": "lora", + "weight": 1.5 + }, + { + "hash": "e06702b274", + "name": "AnythingV5_v5RE", + "type": "model" + } + ], + "Model hash": "e06702b274", + "Hires steps": "40", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(worst quality,low quality:1.3),(lip,rouge,lipstick, eyeshadow,monochrome:1.0), watermark", + "Denoising strength": "0.7" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/bba15d89-e6b0-4860-a378-e24490dc2414/width=450/971472.jpeg", + "nsfw": "Soft", + "width": 800, + "height": 1280, + "hash": "UOKT#%~p~pxZ?v?atSxZNbs;?H9aT1xa-VD%", + "meta": { + "Size": "400x640", + "seed": 1503720965, + "Model": "corneos7thHeavenMix_v2", + "steps": 38, + "hashes": { + "model": "d1e6b263b6" + }, + "prompt": "(masterpiece:1.2),best quality,illustration,beautiful detailed girl,\n(1girl) (standing at attention),front view,arms aside,\n(sweat:1.0),smile,joyful,open mouth,red eyes,(tareme eyes:1.0),upper body,from above,\n(long hair:1.1),blunt bangs,dark blue frilled dress,\nbacklighting,", + "sampler": "DPM++ 2M", + "cfgScale": 12, + "Clip skip": "2", + "resources": [ + { + "name": "taremeEyes_v10", + "type": "lora", + "weight": 1.5 + }, + { + "hash": "d1e6b263b6", + "name": "corneos7thHeavenMix_v2", + "type": "model" + } + ], + "Model hash": "d1e6b263b6", + "Hires steps": "40", + "Hires upscale": "2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(worst quality,low quality:1.3),(lip,rouge,lipstick, eyeshadow,monochrome:1.0), watermark,navel,(from side:1.2)", + "Denoising strength": "0.7" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/85591" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/taremeEyes_v10.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/taremeEyes_v10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..ed1c0e877717de11d17d8055d8d30943e034edde Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/taremeEyes_v10.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/taremeEyes_v10.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/taremeEyes_v10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..5dcf932e4ee8155e17375326e5c49243c1586794 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/taremeEyes_v10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:ab3c039fd3126497fc1f7f62e7d9a495247e1c4ba8a46e5c623d905959a6cd41 +size 15535506 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/unhorny_v01.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/unhorny_v01.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..27e26d849a7234d761f19fdd66b590dce8f326aa --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/unhorny_v01.civitai.info" @@ -0,0 +1,209 @@ +{ + "id": 108723, + "modelId": 101567, + "name": "unhorny_v01", + "createdAt": "2023-07-02T13:48:35.775Z", + "updatedAt": "2023-07-02T14:01:42.035Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 347, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "[Concept] Un-horny", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "unhorny_v01.safetensors", + "id": 76681, + "sizeKB": 6283.734375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-07-02T18:41:41.211Z", + "hashes": { + "AutoV1": "489EB999", + "AutoV2": "269C2274C3", + "SHA256": "269C2274C3B7CF5EF178B01C97081A5FE86E4085F1568AAFDDCC8470C1717C78", + "CRC32": "862CFF60", + "BLAKE3": "D35244397EF6D4CC8CFF76DE22CAC93E7D45EAEFC542F7B820786AAE4D3344ED" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/108723" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/53fc1642-a206-47f0-86b8-24802f7f6746/width=450/1375001.jpeg", + "nsfw": "X", + "width": 720, + "height": 1080, + "hash": "UKIXQ{00Svnikqx[?HMx~Ut7t8RjtPofxZRk", + "meta": { + "Size": "360x540", + "seed": 1749194418, + "Model": "abyssorangemix3AOM3_aom3a1b", + "steps": 20, + "hashes": { + "model": "5493a0ec49" + }, + "prompt": "1girl, best quality, 8k, an illustration of cute girl, on back, indoors, almost orgasm, \nschool uniform, serafuku, pleated microskirt, panties,\n ", + "Version": "v1.3.2", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "5493a0ec49", + "name": "abyssorangemix3AOM3_aom3a1b", + "type": "model" + } + ], + "Model hash": "5493a0ec49", + "Hires steps": "10", + "\"unhorny_v01": "95467aa71546\"", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "EasyNegative, badhandv4,watermark,", + "Denoising strength": "0.4" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/33b645d2-dede-462b-b105-e3ab4aaa9341/width=450/1375163.jpeg", + "nsfw": "Soft", + "width": 720, + "height": 1080, + "hash": "UaHxHL?a_2WB~W-:t7t7NHRjofkCM{ofRjof", + "meta": { + "Size": "360x540", + "seed": 1941820078, + "Model": "abyssorangemix3AOM3_aom3a1b", + "steps": 20, + "hashes": { + "model": "5493a0ec49" + }, + "prompt": "1girl, best quality, 8k, an illustration of cute girl, on back, indoors, almost orgasm, \n \n \nsakurajima mai, long hair, bangs, black hair, hair ornament, (purple eyes:1.1), hairclip,\nPlayboy Outfit: bow, animal ears, cleavage, bare shoulders, pantyhose, bowtie, black footwear, rabbit ears, high heels, leotard, black pantyhose, strapless, black bow, detached collar, fake animal ears, playboy bunny, black leotard, strapless leotard, thighband pantyhose, black bowtie,", + "Version": "v1.3.2", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "maisakurajimatest", + "type": "lora", + "weight": 1 + }, + { + "hash": "5493a0ec49", + "name": "abyssorangemix3AOM3_aom3a1b", + "type": "model" + } + ], + "Model hash": "5493a0ec49", + "Hires steps": "10", + "\"unhorny_v01": "95467aa71546", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "EasyNegative, badhandv4,watermark,", + "maisakurajimatest": "e5ece688f4dc\"", + "Denoising strength": "0.4" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/95ed4a0b-71e2-4789-ba20-deac9976bfc0/width=450/1375165.jpeg", + "nsfw": "X", + "width": 720, + "height": 1080, + "hash": "UYHeOY?a?aR*~V_2NGWB?GR%xuRkIURPRQM|", + "meta": { + "Size": "360x540", + "seed": 2323247007, + "Model": "abyssorangemix3AOM3_aom3a1b", + "steps": 20, + "hashes": { + "model": "5493a0ec49" + }, + "prompt": "1girl, best quality, 8k, an illustration of cute girl, on back, indoors, almost orgasm, \n \n \nkasumigaoka utaha, 1girl, long hair, black pantyhose, school uniform, black hair, red eyes, pleated skirt, white hairband, bangs, jacket, large breasts", + "Version": "v1.3.2", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "kasumigaokaUtaha_v1", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "5493a0ec49", + "name": "abyssorangemix3AOM3_aom3a1b", + "type": "model" + } + ], + "Model hash": "5493a0ec49", + "Hires steps": "10", + "\"unhorny_v01": "95467aa71546", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "EasyNegative, badhandv4,watermark,", + "Denoising strength": "0.4", + "kasumigaokaUtaha_v1": "d6b6e991a4a5\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b04366fc-ab88-4e5d-a9ef-0329c99f8e97/width=450/1375184.jpeg", + "nsfw": "None", + "width": 720, + "height": 1080, + "hash": "UWI5DBt7~ooz%MM{D%M|%KfPIVay%LayxufQ", + "meta": { + "Size": "360x540", + "seed": 892549613, + "Model": "abyssorangemix3AOM3_aom3a1b", + "steps": 20, + "hashes": { + "model": "5493a0ec49" + }, + "prompt": "1girl, best quality, 8k, an illustration of cute girl, on back, indoors, almost orgasm, \n \n \nkasumigaoka utaha, 1girl, long hair, black pantyhose, school uniform, black hair, red eyes, pleated skirt, white hairband, bangs, jacket, large breasts", + "Version": "v1.3.2", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "kasumigaokaUtaha_v1", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "5493a0ec49", + "name": "abyssorangemix3AOM3_aom3a1b", + "type": "model" + } + ], + "Model hash": "5493a0ec49", + "Hires steps": "10", + "\"unhorny_v01": "95467aa71546", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "EasyNegative, badhandv4,watermark,", + "Denoising strength": "0.4", + "kasumigaokaUtaha_v1": "d6b6e991a4a5\"" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/108723" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/unhorny_v01.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/unhorny_v01.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..b1d08c7f0d1d9bbcd14fc57b1b7c69a7c5a45c42 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/unhorny_v01.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/unhorny_v01.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/unhorny_v01.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..ebaf93bfc7cc9933d00524e66da3bd606de7b19a --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\350\241\250\346\203\205\345\274\225\345\257\274/unhorny_v01.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:269c2274c3b7cf5ef178b01c97081a5fe86e4085f1568aafddcc8470c1717c78 +size 6434544 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/ChineseDollLikenessV3.0.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/ChineseDollLikenessV3.0.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..cb7b6e52c8d2270670cea7ad496399be1587f806 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/ChineseDollLikenessV3.0.civitai.info" @@ -0,0 +1,410 @@ +{ + "id": 79750, + "modelId": 63226, + "name": "ChineseDollLikenessV3.0", + "createdAt": "2023-05-24T11:24:18.362Z", + "updatedAt": "2023-05-24T12:41:43.099Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 1464, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "ChineseDollLikeness V2.0&V3.0", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "ChineseDollLikenessV3.0.safetensors", + "id": 54757, + "sizeKB": 147637.1708984375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-24T12:41:17.858Z", + "hashes": { + "AutoV1": "428E8A7A", + "AutoV2": "D02228DCE6", + "SHA256": "D02228DCE637907486C5647D9F36BA99A3DF1DC84614D6BB1BBCD0F5F6F232AC", + "CRC32": "36BCEC8F", + "BLAKE3": "0370CDCE909F07E1DDF425DA33E57E143D993715AD5C0CD2FAE85B9DA810B71E" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/79750" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2a063f30-a6f9-4a84-a6f5-a51530c4453a/width=450/904106.jpeg", + "nsfw": "Mature", + "width": 2048, + "height": 3072, + "hash": "ULF=s{_NN^o#D~xWovxa4nn#xuWAoykC%2R.", + "meta": { + "Eta": "0.667", + "ENSD": "31337", + "Size": "512x768", + "seed": 1398505688, + "Model": "chilloutmix_NiPrunedFp32Fix", + "steps": 45, + "hashes": { + "model": "fc2511737a" + }, + "prompt": "1 girl, upper body,(realistic:1.7),((best quality)),absurdres,(ultra high res),(photorealistic:1.6),photorealistic,octane render,(hyperrealistic:1.2), (photorealistic face:1.2), (8k), (4k), (Masterpiece),(realistic skin texture), (illustration, cinematic lighting,wallpaper),( beautiful eyes:1.2),((((perfect face)))),(cute),(smile),(standing),(white bra),(denim shorts),(black hair),black eyes,red lips, (outdoors),(streets:1.2),(cityscape:1.2), ,", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "ChineseDollLikenessV3.0", + "type": "lora", + "weight": 0.55 + }, + { + "hash": "fc2511737a", + "name": "chilloutmix_NiPrunedFp32Fix", + "type": "model" + } + ], + "Model hash": "fc2511737a", + "Hires steps": "25", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality:2), (low quality:2), (normal quality:2),(uneven eyes),lowres, normal quality,bad anatomy,bad face,(uneven eyes),paintings,ugly, bad hands,open mouth,multiple girls,extra faces, extro breasts, multiple breasts,obese, fat rolls,extra arms, extra eyes,inverted nipples,extra ears,nipple rings,severed arm, bad arm, nipple bar,asymmetrical eyebrows,big mouth,", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/258e207a-c9b3-461b-ba7a-3b707a1c61a8/width=450/896232.jpeg", + "nsfw": "None", + "width": 3129, + "height": 577, + "hash": "UfGlYHogWCog-$j?a#ay?va#jabH~qj[j[of", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/bc82f4a0-0a2e-42f3-b21f-a6111e808095/width=450/895710.jpeg", + "nsfw": "None", + "width": 1840, + "height": 2752, + "hash": "UIG8=rVq_MyB~oRMx]-;xoS4%2-:E1WUITI9", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1420465043, + "Model": "chilloutmix_NiPrunedFp32Fix", + "steps": 45, + "hashes": { + "model": "fc2511737a" + }, + "prompt": ",(printed t-shirt:1.1),denim shorts,1 girl,upper body, (short hair:1.1), (realistic:1.7),((best quality)),absurdres,(ultra high res),(photorealistic:1.6),photorealistic,octane render,(hyperrealistic:1.2), (photorealistic face:1.2), (8k), (4k), (Masterpiece),(realistic skin texture), (illustration, cinematic lighting,wallpaper),( beautiful eyes:1.2),((((perfect face)))),(cute),(smile:0.8),(standing),(black hair),(long hair),black eyes,red lips, (outdoors),", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "name": "ChineseDollLikenessV3.0", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "fc2511737a", + "name": "chilloutmix_NiPrunedFp32Fix", + "type": "model" + } + ], + "Model hash": "fc2511737a", + "Hires steps": "25", + "Hires upscale": "1.8", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "(worst quality:2), (low quality:2), (normal quality:2),(uneven eyes),lowres, normal quality,bad anatomy,bad face,(uneven eyes),paintings,ugly, bad hands,open mouth,multiple girls,extra faces, extro breasts, multiple breasts,obese, fat rolls,extra arms, extra eyes,inverted nipples,extra ears,nipple rings,severed arm, bad arm, nipple bar,asymmetrical eyebrows,big mouth,", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4a36d6f5-bf72-4d4c-858e-dd017c06c65c/width=450/895208.jpeg", + "nsfw": "Mature", + "width": 1840, + "height": 3680, + "hash": "UFHeICRiUH~qD$oyDhRPSaRP^inN4:%LpINH", + "meta": { + "Eta": "0.667", + "ENSD": "31337", + "Size": "512x1024", + "seed": 2264733768, + "Model": "chilloutmix_NiPrunedFp32Fix", + "steps": 45, + "hashes": { + "model": "fc2511737a" + }, + "prompt": ",(swimsuit),(huge breasts),high heels,1 girl,full body, high heels,(short hair:1.1), (realistic:1.7),((best quality)),absurdres,(ultra high res),(photorealistic:1.6),photorealistic,octane render,(hyperrealistic:1.2), (photorealistic face:1.2), (8k), (4k), (Masterpiece),(realistic skin texture), (illustration, cinematic lighting,wallpaper),( beautiful eyes:1.2),((((perfect face)))),(cute),(standing),(black hair),(short hair),black eyes,red lips, (outdoors),", + "sampler": "Euler a", + "cfgScale": 5, + "Clip skip": "2", + "resources": [ + { + "hash": "fc2511737a", + "name": "chilloutmix_NiPrunedFp32Fix", + "type": "model" + } + ], + "Model hash": "fc2511737a", + "Hires steps": "25", + "Hires upscale": "1.8", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "(worst quality:2), (low quality:2), (normal quality:2),(uneven eyes),lowres, normal quality,bad anatomy,bad face,(uneven eyes),paintings,ugly, bad hands,open mouth,multiple girls,extra faces, extro breasts, multiple breasts,obese, fat rolls,extra arms, extra eyes,inverted nipples,extra ears,nipple rings,severed arm, bad arm, nipple bar,asymmetrical eyebrows,big mouth,", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6daac3cf-00b8-42a4-bfd5-b9b9607d466c/width=450/895205.jpeg", + "nsfw": "None", + "width": 2048, + "height": 2560, + "hash": "UBEVNcjE009ZC5t5ZNMx00%N~X-;8wIo.Sxu", + "meta": { + "Eta": "0.667", + "ENSD": "31337", + "Size": "2048x2560", + "seed": 2603608929, + "Model": "chilloutmix_NiPrunedFp32Fix", + "steps": 45, + "hashes": { + "model": "fc2511737a" + }, + "prompt": ",(long skirt:1.2),(blue flowers print:1.2),(yellow flowers print:1.2),(red flowers print:1.3),(birds print:1.2),(leaf print:1.2),1 girl,full body, (short hair:1.1), (realistic:1.7),((best quality)),absurdres,(ultra high res),(photorealistic:1.6),photorealistic,octane render,(hyperrealistic:1.2), (photorealistic face:1.2), (8k), (4k), (Masterpiece),(realistic skin texture), (illustration, cinematic lighting,wallpaper),( beautiful eyes:1.2),((((perfect face)))),(cute),(standing),(black hair),(short hair),black eyes,red lips, (outdoors),,", + "sampler": "Euler a", + "cfgScale": 5, + "'Overlap'": "48", + "Clip skip": "2", + "Mask blur": "4", + "resources": [ + { + "hash": "fc2511737a", + "name": "chilloutmix_NiPrunedFp32Fix", + "type": "model" + } + ], + "\"{'Method'": "'MultiDiffusion'", + "'Upscaler'": "'R-ESRGAN 4x+'", + "Model hash": "fc2511737a", + "'Scale factor'": "2", + "negativePrompt": "(worst quality:2), (low quality:2), (normal quality:2),(uneven eyes),lowres, normal quality,bad anatomy,bad face,(uneven eyes),paintings,ugly, bad hands,open mouth,multiple girls,extra faces, extro breasts, multiple breasts,obese, fat rolls,extra arms, extra eyes,inverted nipples,extra ears,nipple rings,severed arm, bad arm, nipple bar,asymmetrical eyebrows,big mouth,", + "'Keep input size'": "True}\"", + "'Tile batch size'": "1", + "Denoising strength": "0.2", + "'Latent tile width'": "96", + "'Latent tile height'": "96", + "Tiled Diffusion upscaler": "R-ESRGAN 4x+", + "Tiled Diffusion scale factor": "2" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d7321c08-dc80-4468-aae8-e0481e0a8015/width=450/896593.jpeg", + "nsfw": "None", + "width": 1840, + "height": 2752, + "hash": "UBFYujIA03M_IANE~n9G?cV?_M9Z9ZM{IU%1", + "meta": { + "Eta": "0.667", + "ENSD": "31337", + "Size": "512x768", + "seed": 3364425535, + "Model": "chilloutmix_NiPrunedFp32Fix", + "steps": 45, + "hashes": { + "model": "fc2511737a" + }, + "prompt": ",(8k, RAW photo, best quality, masterpiece:1.2), (realistic, photo-realistic:1.4), (upper body),(standing),cinematic lighting, photon mapping, radiosity, physically-based rendering, 1girl,(solo:1.3),looking at viewer, (light green printed china dress),(long hair), (black hair),(twin tails),smile, solo focus,soft lighting, dynamic angle, outdoors, ", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "ChineseDollLikenessV3.0", + "type": "lora", + "weight": 0.4 + }, + { + "name": "ChinaDress", + "type": "lora", + "weight": 0.5 + }, + { + "hash": "fc2511737a", + "name": "chilloutmix_NiPrunedFp32Fix", + "type": "model" + } + ], + "Model hash": "fc2511737a", + "Hires steps": "25", + "Hires upscale": "1.8", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "(teeth:2),EasyNegative, paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans,extra fingers,fewer fingers,((watermark:2)),(white letters:1), (multi nipples), lowres, bad anatomy, bad hands, text, error, missing fingers,extra digit, fewer digits, cropped, worst quality, low qualitynormal quality, jpeg artifacts, signature, watermark, username,bad feet, {Multiple people},lowres,bad anatomy,bad hands, text, error, missing fingers,extra digit, fewer digits, cropped, worstquality, low quality, normal quality,jpegartifacts,signature, watermark, blurry,bad feet,cropped,poorly drawn hands,poorly drawn face,mutation,deformed,worst quality,low quality,normal quality,jpeg artifacts,signature,extra fingers,fewer digits,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,text,error,missing fingers,missing arms,extra arms,missing legs,wrong feet bottom render,extra digit,abdominal stretch, glans, pants, briefs, knickers, kecks, thong, {{fused fingers}}, {{bad body}}", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/632da4f3-4c08-4e44-917c-fa9c61428d62/width=450/896557.jpeg", + "nsfw": "None", + "width": 1337, + "height": 2000, + "hash": "U8GlRz00009?00yV_H=$%DxtK5,^^~xVWB9c", + "meta": { + "seed": 2063038542, + "steps": 45, + "prompt": ",(8k, RAW photo, best quality, masterpiece:1.2), (realistic, photo-realistic:1.4), (upper body),(standing),cinematic lighting, photon mapping, radiosity, physically-based rendering, 1girl,(solo:1.3),looking at viewer, (light green printed china dress),(long hair), (black hair),(twin tails),smile, solo focus,soft lighting, dynamic angle, outdoors, ", + "sampler": "Euler a", + "cfgScale": 7, + "negativePrompt": "(teeth:2),EasyNegative, paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans,extra fingers,fewer fingers,((watermark:2)),(white letters:1), (multi nipples), lowres, bad anatomy, bad hands, text, error, missing fingers,extra digit, fewer digits, cropped, worst quality, low qualitynormal quality, jpeg artifacts, signature, watermark, username,bad feet, {Multiple people},lowres,bad anatomy,bad hands, text, error, missing fingers,extra digit, fewer digits, cropped, worstquality, low quality, normal quality,jpegartifacts,signature, watermark, blurry,bad feet,cropped,poorly drawn hands,poorly drawn face,mutation,deformed,worst quality,low quality,normal quality,jpeg artifacts,signature,extra fingers,fewer digits,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,text,error,missing fingers,missing arms,extra arms,missing legs,wrong feet bottom render,extra digit,abdominal stretch, glans, pants, briefs, knickers, kecks, thong, {{fused fingers}}, {{bad body}}" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f71dff06-6d4f-4091-a076-d16af50c72d1/width=450/895198.jpeg", + "nsfw": "None", + "width": 1840, + "height": 2752, + "hash": "UIHC4Oxv8wV?~QD%tktRxTajx]oM-VE3j]M|", + "meta": { + "Eta": "0.667", + "ENSD": "31337", + "Size": "1840x2752", + "seed": 936080176, + "Model": "chilloutmix_NiPrunedFp32Fix", + "steps": 45, + "hashes": { + "model": "fc2511737a" + }, + "prompt": ",(8k, RAW photo, best quality, masterpiece:1.2), (realistic, photo-realistic:1.4), (upper body),(standing),cinematic lighting, photon mapping, radiosity, physically-based rendering, 1girl,(solo:1.3),looking at viewer, (light blue printed china dress),(short hair), smile, solo focus,soft lighting, dynamic angle, outdoors, ", + "sampler": "Euler a", + "cfgScale": 5, + "'Overlap'": "48", + "Clip skip": "2", + "Mask blur": "4", + "resources": [ + { + "name": "ChinaDress", + "type": "lora", + "weight": 0.5 + }, + { + "hash": "fc2511737a", + "name": "chilloutmix_NiPrunedFp32Fix", + "type": "model" + } + ], + "\"{'Method'": "'MultiDiffusion'", + "'Upscaler'": "'R-ESRGAN 4x+'", + "Model hash": "fc2511737a", + "'Scale factor'": "2", + "negativePrompt": "(teeth:2),EasyNegative, paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans,extra fingers,fewer fingers,((watermark:2)),(white letters:1), (multi nipples), lowres, bad anatomy, bad hands, text, error, missing fingers,extra digit, fewer digits, cropped, worst quality, low qualitynormal quality, jpeg artifacts, signature, watermark, username,bad feet, {Multiple people},lowres,bad anatomy,bad hands, text, error, missing fingers,extra digit, fewer digits, cropped, worstquality, low quality, normal quality,jpegartifacts,signature, watermark, blurry,bad feet,cropped,poorly drawn hands,poorly drawn face,mutation,deformed,worst quality,low quality,normal quality,jpeg artifacts,signature,extra fingers,fewer digits,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,text,error,missing fingers,missing arms,extra arms,missing legs,wrong feet bottom render,extra digit,abdominal stretch, glans, pants, briefs, knickers, kecks, thong, {{fused fingers}}, {{bad body}}", + "'Keep input size'": "True}\"", + "'Tile batch size'": "1", + "Denoising strength": "0.2", + "'Latent tile width'": "96", + "'Latent tile height'": "96", + "Tiled Diffusion upscaler": "R-ESRGAN 4x+", + "Tiled Diffusion scale factor": "2" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d8af6b58-90a5-47eb-8e78-e2045d21f8ab/width=450/895714.jpeg", + "nsfw": "None", + "width": 1840, + "height": 2752, + "hash": "UOGlO~tP9E?b?a-;yExu?H-=R-ae.To2IAo#", + "meta": { + "ENSD": "31337", + "Size": "1840x2752", + "seed": 3615535373, + "Model": "chilloutmix_NiPrunedFp32Fix", + "steps": 25, + "hashes": { + "model": "fc2511737a" + }, + "prompt": ",(printed t-shirt:1.1),denim shorts,1 girl,upper body, (realistic:1.7),((best quality)),absurdres,(ultra high res),(photorealistic:1.6),photorealistic,octane render,(hyperrealistic:1.2), (photorealistic face:1.2), (8k), (4k), (Masterpiece),(realistic skin texture), (illustration, cinematic lighting,wallpaper),( beautiful eyes:1.2),((((perfect face)))),(cute),(smile:0.8),(standing),(black hair),(long hair),black eyes,red lips, (outdoors),", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "'Overlap'": "48", + "Clip skip": "2", + "Mask blur": "4", + "resources": [ + { + "name": "ChineseDollLikenessV3.0", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "fc2511737a", + "name": "chilloutmix_NiPrunedFp32Fix", + "type": "model" + } + ], + "\"{'Method'": "'MultiDiffusion'", + "'Upscaler'": "'R-ESRGAN 4x+'", + "Model hash": "fc2511737a", + "'Scale factor'": "2", + "negativePrompt": "(worst quality:2), (low quality:2), (normal quality:2),(uneven eyes),lowres, normal quality,bad anatomy,bad face,(uneven eyes),paintings,ugly, bad hands,open mouth,multiple girls,extra faces, extro breasts, multiple breasts,obese, fat rolls,extra arms, extra eyes,inverted nipples,extra ears,nipple rings,severed arm, bad arm, nipple bar,asymmetrical eyebrows,big mouth,", + "'Keep input size'": "True}\"", + "'Tile batch size'": "1", + "Denoising strength": "0.2", + "'Latent tile width'": "96", + "'Latent tile height'": "96", + "Tiled Diffusion upscaler": "R-ESRGAN 4x+", + "Tiled Diffusion scale factor": "2" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/385e6641-2ca1-43e5-80d4-0a4c777d7371/width=450/895711.jpeg", + "nsfw": "None", + "width": 1840, + "height": 2752, + "hash": "USHC4a_4ELxGt0$~ITNH_MWCDiMx.8WCM|bI", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 759742885, + "Model": "chilloutmix_NiPrunedFp32Fix", + "steps": 45, + "hashes": { + "model": "fc2511737a" + }, + "prompt": ",(printed t-shirt:1.1),denim shorts,1 girl,upper body, (short hair:1.1), (realistic:1.7),((best quality)),absurdres,(ultra high res),(photorealistic:1.6),photorealistic,octane render,(hyperrealistic:1.2), (photorealistic face:1.2), (8k), (4k), (Masterpiece),(realistic skin texture), (illustration, cinematic lighting,wallpaper),( beautiful eyes:1.2),((((perfect face)))),(cute),(smile:0.8),(standing),(black hair),(long hair),black eyes,red lips, (outdoors),", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "ChineseDollLikenessV3.0", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "fc2511737a", + "name": "chilloutmix_NiPrunedFp32Fix", + "type": "model" + } + ], + "Model hash": "fc2511737a", + "Hires steps": "25", + "Hires upscale": "1.8", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "(worst quality:2), (low quality:2), (normal quality:2),(uneven eyes),lowres, normal quality,bad anatomy,bad face,(uneven eyes),paintings,ugly, bad hands,open mouth,multiple girls,extra faces, extro breasts, multiple breasts,obese, fat rolls,extra arms, extra eyes,inverted nipples,extra ears,nipple rings,severed arm, bad arm, nipple bar,asymmetrical eyebrows,big mouth,", + "Denoising strength": "0.45" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/79750" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/ChineseDollLikenessV3.0.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/ChineseDollLikenessV3.0.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..6d3d41595e722ea7465664b3a59ab8863f2cf125 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/ChineseDollLikenessV3.0.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/ChineseDollLikenessV3.0.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/ChineseDollLikenessV3.0.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..e3e1439e0204f267d0858aa0853d3ba2400fd3d0 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/ChineseDollLikenessV3.0.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:d02228dce637907486c5647d9f36ba99a3df1dc84614d6bb1bbcd0f5f6f232ac +size 151180463 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeAngela-512-V1.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeAngela-512-V1.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..ebeb14fd9b882f8814e7fb652034a6cb95cf1086 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeAngela-512-V1.civitai.info" @@ -0,0 +1,215 @@ +{ + "id": 63735, + "modelId": 59287, + "name": "ClipCodeAngela-512-V1", + "createdAt": "2023-05-06T07:51:29.167Z", + "updatedAt": "2023-05-06T08:05:35.499Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 214, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "FullmoonIllusionDollLikeness", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "FullmoonIllusionDollLikeness-ClipCodeAngela-512-V1.safetensors", + "id": 44859, + "sizeKB": 147567.224609375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-06T07:55:50.435Z", + "hashes": { + "AutoV1": "E68703FA", + "AutoV2": "95D1B55E72", + "SHA256": "95D1B55E722F8A092258A0016A57462F16F7E9D672912066D39B839F11C16985", + "CRC32": "49140EA4", + "BLAKE3": "AAB0589E69CB25F03F39C116BB2ECE63F0F1438D24112F1887C6953D6EBA8F4A" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/63735" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9c6e676b-49b5-464b-a3de-264a19920919/width=450/703284.jpeg", + "nsfw": "Soft", + "width": 512, + "height": 768, + "hash": "U5C~k[0000~V00^*I:R-9]-pwH4:?a4.~CxZ", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 404754876, + "Model": "majicmixRealistic_v4", + "steps": 21, + "hashes": { + "model": "d819c8be6b" + }, + "prompt": "(HD, RAW photo, realistic, photo-realistic:1.4), close-up, (incredible absurdity), photon mapping, radiosity, physically-based rendering, illustration, ultra detailed, fine detail, cinematic effects, wallpaper, digital art, warm colour, colorful,\nstudio background, layered backgrounds, delicate background, detailed stage background, (professional lighting, detailed light, lighting, bright), sunlight,\n1girl, looking at viewer, upper body, portrait, uncensored, dress,\nPureErosFace_V1", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7.5, + "Clip skip": "2", + "resources": [ + { + "hash": "d819c8be6b", + "name": "majicmixRealistic_v4", + "type": "model" + }, + { + "hash": "75c1631325af", + "name": "V1", + "type": "lora", + "weight": null + } + ], + "Model hash": "d819c8be6b", + "AddNet Enabled": "True", + "AddNet Model 1": "FullmoonIllusionDollLikeness-ClipCodeAngela-512-V1(75c1631325af)", + "negativePrompt": "(worst quality:2), (low quality:2), (normal quality:2), lowres, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, manboobs, backlight, (ugly:1.3), (duplicate:1.3), (morbid:1.2), (mutilated:1.2), (tranny:1.3), mutated hands, (poorly drawn hands:1.3), blurry, (bad anatomy:1.2), (bad proportions:1.3), extra limbs, (disfigured:1.3), (more than 2 nipples:1.3), (missing arms:1.3), (extra legs:1.3), (fused fingers:1.6), (too many fingers:1.6), (unclear eyes:1.3), lowers, bad hands, missing fingers, extra digit, (futa:1.1), logo, white letters, socks,\n(deformed iris, deformed pupils), out of frame, duplicate, extra fingers, poorly drawn face, mutation, deformed, dehydrated, cloned face, gross proportions, malformed limbs, missing legs, extra arms, long neck, text, cross-eyed, fewer digits, signature, watermark, username, pregnant, vore, tran nsexual, hermaphrodite, pubic hair, bad legs,\nbadhandv4, ng_deepnegative_v1_75t", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.8", + "AddNet Weight B 1": "0.8" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/613e5b2e-54c8-4774-bfcf-e97d15eff7e3/width=450/703287.jpeg", + "nsfw": "Soft", + "width": 512, + "height": 768, + "hash": "UJEC8:Nc4.Io4nM|X9%L4;s.$*xa~Wt6M|NG", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 404754876, + "Model": "majicmixRealistic_v4", + "steps": 21, + "hashes": { + "model": "d819c8be6b" + }, + "prompt": "(HD, RAW photo, realistic, photo-realistic:1.4), close-up, (incredible absurdity), photon mapping, radiosity, physically-based rendering, illustration, ultra detailed, fine detail, cinematic effects, wallpaper, digital art, warm colour, colorful,\nstudio background, layered backgrounds, delicate background, detailed stage background, (professional lighting, detailed light, lighting, bright), sunlight,\n1girl, looking at viewer, upper body, portrait, uncensored, dress,\nPureErosFace_V1", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7.5, + "Clip skip": "2", + "resources": [ + { + "hash": "d819c8be6b", + "name": "majicmixRealistic_v4", + "type": "model" + }, + { + "hash": "0a6433841d6e", + "name": "stLouisLuxuriousWheels_v1_1.0_ST", + "type": "lora", + "weight": null + } + ], + "Model hash": "d819c8be6b", + "AddNet Enabled": "True", + "AddNet Model 1": "chuuChloe_1.0_WY+stLouisLuxuriousWheels_v1_1.0_ST(0a6433841d6e)", + "negativePrompt": "(worst quality:2), (low quality:2), (normal quality:2), lowres, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, manboobs, backlight, (ugly:1.3), (duplicate:1.3), (morbid:1.2), (mutilated:1.2), (tranny:1.3), mutated hands, (poorly drawn hands:1.3), blurry, (bad anatomy:1.2), (bad proportions:1.3), extra limbs, (disfigured:1.3), (more than 2 nipples:1.3), (missing arms:1.3), (extra legs:1.3), (fused fingers:1.6), (too many fingers:1.6), (unclear eyes:1.3), lowers, bad hands, missing fingers, extra digit, (futa:1.1), logo, white letters, socks,\n(deformed iris, deformed pupils), out of frame, duplicate, extra fingers, poorly drawn face, mutation, deformed, dehydrated, cloned face, gross proportions, malformed limbs, missing legs, extra arms, long neck, text, cross-eyed, fewer digits, signature, watermark, username, pregnant, vore, tran nsexual, hermaphrodite, pubic hair, bad legs,\nbadhandv4, ng_deepnegative_v1_75t", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.75", + "AddNet Weight B 1": "0.75" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9ccf982e-9cdb-4c10-8523-0c29a4fd4a2e/width=450/703286.jpeg", + "nsfw": "Soft", + "width": 512, + "height": 768, + "hash": "U8C$vA0200$~00={pJsmIUtRnlt7~qD*i_f7", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 404754876, + "Model": "majicmixRealistic_v4", + "steps": 21, + "hashes": { + "model": "d819c8be6b" + }, + "prompt": "(HD, RAW photo, realistic, photo-realistic:1.4), close-up, (incredible absurdity), photon mapping, radiosity, physically-based rendering, illustration, ultra detailed, fine detail, cinematic effects, wallpaper, digital art, warm colour, colorful,\nstudio background, layered backgrounds, delicate background, detailed stage background, (professional lighting, detailed light, lighting, bright), sunlight,\n1girl, looking at viewer, upper body, portrait, uncensored, dress,\nPureErosFace_V1", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7.5, + "Clip skip": "2", + "resources": [ + { + "hash": "d819c8be6b", + "name": "majicmixRealistic_v4", + "type": "model" + }, + { + "hash": "9508a120345f", + "name": "stLouisLuxuriousWheels_v1_1.0_ST", + "type": "lora", + "weight": null + } + ], + "Model hash": "d819c8be6b", + "AddNet Enabled": "True", + "AddNet Model 1": "aespaKarina_aespaKarinaV5_1.0_WY+stLouisLuxuriousWheels_v1_1.0_ST(9508a120345f)", + "negativePrompt": "(worst quality:2), (low quality:2), (normal quality:2), lowres, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, manboobs, backlight, (ugly:1.3), (duplicate:1.3), (morbid:1.2), (mutilated:1.2), (tranny:1.3), mutated hands, (poorly drawn hands:1.3), blurry, (bad anatomy:1.2), (bad proportions:1.3), extra limbs, (disfigured:1.3), (more than 2 nipples:1.3), (missing arms:1.3), (extra legs:1.3), (fused fingers:1.6), (too many fingers:1.6), (unclear eyes:1.3), lowers, bad hands, missing fingers, extra digit, (futa:1.1), logo, white letters, socks,\n(deformed iris, deformed pupils), out of frame, duplicate, extra fingers, poorly drawn face, mutation, deformed, dehydrated, cloned face, gross proportions, malformed limbs, missing legs, extra arms, long neck, text, cross-eyed, fewer digits, signature, watermark, username, pregnant, vore, tran nsexual, hermaphrodite, pubic hair, bad legs,\nbadhandv4, ng_deepnegative_v1_75t", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1be8ce78-386d-497b-b230-970dc1926d5f/width=450/703285.jpeg", + "nsfw": "Soft", + "width": 512, + "height": 768, + "hash": "UBDv1X0L00tR00%1-;n$9u%Lt7Io~p9ZaK%2", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 404754876, + "Model": "majicmixRealistic_v4", + "steps": 21, + "hashes": { + "model": "d819c8be6b" + }, + "prompt": "(HD, RAW photo, realistic, photo-realistic:1.4), close-up, (incredible absurdity), photon mapping, radiosity, physically-based rendering, illustration, ultra detailed, fine detail, cinematic effects, wallpaper, digital art, warm colour, colorful,\nstudio background, layered backgrounds, delicate background, detailed stage background, (professional lighting, detailed light, lighting, bright), sunlight,\n1girl, looking at viewer, upper body, portrait, uncensored, dress,\nPureErosFace_V1", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7.5, + "Clip skip": "2", + "resources": [ + { + "hash": "d819c8be6b", + "name": "majicmixRealistic_v4", + "type": "model" + }, + { + "hash": "21589feeb97c", + "name": "V1", + "type": "lora", + "weight": null + } + ], + "Model hash": "d819c8be6b", + "AddNet Enabled": "True", + "AddNet Model 1": "FullmoonIllusionDollLikeness-ClipCodeWintru-512-V1(21589feeb97c)", + "negativePrompt": "(worst quality:2), (low quality:2), (normal quality:2), lowres, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, manboobs, backlight, (ugly:1.3), (duplicate:1.3), (morbid:1.2), (mutilated:1.2), (tranny:1.3), mutated hands, (poorly drawn hands:1.3), blurry, (bad anatomy:1.2), (bad proportions:1.3), extra limbs, (disfigured:1.3), (more than 2 nipples:1.3), (missing arms:1.3), (extra legs:1.3), (fused fingers:1.6), (too many fingers:1.6), (unclear eyes:1.3), lowers, bad hands, missing fingers, extra digit, (futa:1.1), logo, white letters, socks,\n(deformed iris, deformed pupils), out of frame, duplicate, extra fingers, poorly drawn face, mutation, deformed, dehydrated, cloned face, gross proportions, malformed limbs, missing legs, extra arms, long neck, text, cross-eyed, fewer digits, signature, watermark, username, pregnant, vore, tran nsexual, hermaphrodite, pubic hair, bad legs,\nbadhandv4, ng_deepnegative_v1_75t", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.85", + "AddNet Weight B 1": "0.85" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/63735" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeAngela-512-V1.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeAngela-512-V1.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..21b48e566f0c1e8685a7a24ef03022d21dbb7d65 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeAngela-512-V1.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeAngela-512-V1.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeAngela-512-V1.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..a02adfd368b88600ecc444c9d8ed6c0b1a4a299d --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeAngela-512-V1.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:95d1b55e722f8a092258a0016a57462f16f7e9d672912066d39b839f11c16985 +size 151108838 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeChloe-512-V1.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeChloe-512-V1.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..dd09a3ba5b3bc1627c5e6af7b15b193e9f02e97a --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeChloe-512-V1.civitai.info" @@ -0,0 +1,92 @@ +{ + "id": 63740, + "modelId": 59287, + "name": "ClipCodeChloe-512-V1", + "createdAt": "2023-05-06T07:58:25.349Z", + "updatedAt": "2023-05-06T08:05:35.499Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 54, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "FullmoonIllusionDollLikeness", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "FullmoonIllusionDollLikeness-ClipCodeChloe-512-V1.safetensors", + "id": 44860, + "sizeKB": 147567.224609375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-06T08:00:56.763Z", + "hashes": { + "AutoV1": "25FC29FD", + "AutoV2": "D339127AAB", + "SHA256": "D339127AABA00494C62B231787242608E005A3536DFE53AEF2F6F25CBFC95D43", + "CRC32": "991BEBB9", + "BLAKE3": "60497EF7661D203E912648D9563AE5709C4526D4C864600624845F88088C9679" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/63740" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/44d297ff-d4f0-4390-80b8-e7ff7258ca56/width=450/703321.jpeg", + "nsfw": "Soft", + "width": 512, + "height": 768, + "hash": "UJEC8:Nc4.Io4nM|X9%L4;s.$*xa~Wt6M|NG", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 404754876, + "Model": "majicmixRealistic_v4", + "steps": 21, + "hashes": { + "model": "d819c8be6b" + }, + "prompt": "(HD, RAW photo, realistic, photo-realistic:1.4), close-up, (incredible absurdity), photon mapping, radiosity, physically-based rendering, illustration, ultra detailed, fine detail, cinematic effects, wallpaper, digital art, warm colour, colorful,\nstudio background, layered backgrounds, delicate background, detailed stage background, (professional lighting, detailed light, lighting, bright), sunlight,\n1girl, looking at viewer, upper body, portrait, uncensored, dress,\nPureErosFace_V1", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7.5, + "Clip skip": "2", + "resources": [ + { + "hash": "d819c8be6b", + "name": "majicmixRealistic_v4", + "type": "model" + }, + { + "hash": "0a6433841d6e", + "name": "stLouisLuxuriousWheels_v1_1.0_ST", + "type": "lora", + "weight": null + } + ], + "Model hash": "d819c8be6b", + "AddNet Enabled": "True", + "AddNet Model 1": "chuuChloe_1.0_WY+stLouisLuxuriousWheels_v1_1.0_ST(0a6433841d6e)", + "negativePrompt": "(worst quality:2), (low quality:2), (normal quality:2), lowres, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, manboobs, backlight, (ugly:1.3), (duplicate:1.3), (morbid:1.2), (mutilated:1.2), (tranny:1.3), mutated hands, (poorly drawn hands:1.3), blurry, (bad anatomy:1.2), (bad proportions:1.3), extra limbs, (disfigured:1.3), (more than 2 nipples:1.3), (missing arms:1.3), (extra legs:1.3), (fused fingers:1.6), (too many fingers:1.6), (unclear eyes:1.3), lowers, bad hands, missing fingers, extra digit, (futa:1.1), logo, white letters, socks,\n(deformed iris, deformed pupils), out of frame, duplicate, extra fingers, poorly drawn face, mutation, deformed, dehydrated, cloned face, gross proportions, malformed limbs, missing legs, extra arms, long neck, text, cross-eyed, fewer digits, signature, watermark, username, pregnant, vore, tran nsexual, hermaphrodite, pubic hair, bad legs,\nbadhandv4, ng_deepnegative_v1_75t", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.75", + "AddNet Weight B 1": "0.75" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/63740" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeChloe-512-V1.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeChloe-512-V1.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..70d90c63d4c0422348c77e807a78c6214470b784 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeChloe-512-V1.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeChloe-512-V1.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeChloe-512-V1.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..3b2106ce31fdc5ffaf528edc9253304dc2545ef8 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeChloe-512-V1.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:d339127aaba00494c62b231787242608e005a3536dfe53aef2f6f25cbfc95d43 +size 151108838 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeIu-512-V1.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeIu-512-V1.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..e96d6246399bba5bb025f2c581cdf6d3e4a11dc2 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeIu-512-V1.civitai.info" @@ -0,0 +1,82 @@ +{ + "id": 81568, + "modelId": 59287, + "name": "ClipCodeIU", + "createdAt": "2023-05-26T08:27:29.699Z", + "updatedAt": "2023-05-26T08:30:24.377Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 561, + "ratingCount": 1, + "rating": 5 + }, + "model": { + "name": "FullmoonIllusionDollLikeness", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "FullmoonIllusionDollLikeness-ClipCodeIu-512-V1.safetensors", + "id": 55872, + "sizeKB": 147567.21875, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-26T08:32:07.895Z", + "hashes": { + "AutoV1": "D955DAF6", + "AutoV2": "87C8926C46", + "SHA256": "87C8926C462CF6492CDF517A7C579DD02CE503F3B9D1324E438ECCDD8AA939B2", + "CRC32": "B996A7E7", + "BLAKE3": "F6CC5012D29DB03BF8B3844B598A9A1CF2C9D9EF34A08380A374C89FAABE6235" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/81568" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c56d2bac-c144-4f08-abcf-13ee6ef1d832/width=450/916305.jpeg", + "nsfw": "Soft", + "width": 512, + "height": 768, + "hash": "UBECUm~W000100IU.9tRkWIoMxxa~q?HV?D*", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 404754876, + "Model": "majicmixRealistic_v4", + "steps": 21, + "hashes": { + "model": "d819c8be6b" + }, + "prompt": "(HD, RAW photo, realistic, photo-realistic:1.4), close-up, (incredible absurdity), photon mapping, radiosity, physically-based rendering, illustration, ultra detailed, fine detail, cinematic effects, wallpaper, digital art, warm colour, colorful,\nstudio background, layered backgrounds, delicate background, detailed stage background, (professional lighting, detailed light, lighting, bright), sunlight,\n1girl, looking at viewer, upper body, portrait, uncensored, dress, arms behind back, \n ", + "Version": "v1.2.1", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7.5, + "Clip skip": "2", + "resources": [ + { + "hash": "d819c8be6b", + "name": "majicmixRealistic_v4", + "type": "model" + } + ], + "Model hash": "d819c8be6b", + "negativePrompt": "(worst quality:2), (low quality:2), (normal quality:2), lowres, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, manboobs, backlight, (ugly:1.3), (duplicate:1.3), (morbid:1.2), (mutilated:1.2), (tranny:1.3), mutated hands, (poorly drawn hands:1.3), blurry, (bad anatomy:1.2), (bad proportions:1.3), extra limbs, (disfigured:1.3), (more than 2 nipples:1.3), (missing arms:1.3), (extra legs:1.3), (fused fingers:1.6), (too many fingers:1.6), (unclear eyes:1.3), lowers, bad hands, missing fingers, extra digit, (futa:1.1), logo, white letters, socks,\n(deformed iris, deformed pupils), out of frame, duplicate, extra fingers, poorly drawn face, mutation, deformed, dehydrated, cloned face, gross proportions, malformed limbs, missing legs, extra arms, long neck, text, cross-eyed, fewer digits, signature, watermark, username, pregnant, vore, tran nsexual, hermaphrodite, pubic hair, bad legs,\nbadhandv4, ng_deepnegative_v1_75t" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/81568" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeIu-512-V1.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeIu-512-V1.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..d286376aafd75fa6a3bb200917c0a6a6062b363a Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeIu-512-V1.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeIu-512-V1.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeIu-512-V1.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..d6334b9b00f5f6796d873ea2b5d8c509e88d7735 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeIu-512-V1.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:87c8926c462cf6492cdf517a7c579dd02ce503f3b9d1324e438eccdd8aa939b2 +size 151108832 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeKatherine-512-V1.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeKatherine-512-V1.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..797e804fc4aa00ba3061d76cfec09954529aa9a9 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeKatherine-512-V1.civitai.info" @@ -0,0 +1,92 @@ +{ + "id": 63743, + "modelId": 59287, + "name": "ClipCodeKatherine-512-V1", + "createdAt": "2023-05-06T08:00:27.527Z", + "updatedAt": "2023-05-06T08:05:35.499Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 52, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "FullmoonIllusionDollLikeness", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "FullmoonIllusionDollLikeness-ClipCodeKatherine-512-V1.safetensors", + "id": 44861, + "sizeKB": 147567.224609375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-06T08:05:48.459Z", + "hashes": { + "AutoV1": "D41AE4B6", + "AutoV2": "2433DC07AA", + "SHA256": "2433DC07AABE1633399FB50667498EF5F1289B48F5328B52B4C852E6AE1EE59F", + "CRC32": "221BBF29", + "BLAKE3": "CB7242286EC3150A5A606C2B3DA234877F21B321D75FE1D1786279BE3F616728" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/63743" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/eae8229d-05f2-4da1-9476-e192564574b9/width=450/703346.jpeg", + "nsfw": "Soft", + "width": 512, + "height": 768, + "hash": "U8C$vA0200$~00={pJsmIUtRnlt7~qD*i_f7", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 404754876, + "Model": "majicmixRealistic_v4", + "steps": 21, + "hashes": { + "model": "d819c8be6b" + }, + "prompt": "(HD, RAW photo, realistic, photo-realistic:1.4), close-up, (incredible absurdity), photon mapping, radiosity, physically-based rendering, illustration, ultra detailed, fine detail, cinematic effects, wallpaper, digital art, warm colour, colorful,\nstudio background, layered backgrounds, delicate background, detailed stage background, (professional lighting, detailed light, lighting, bright), sunlight,\n1girl, looking at viewer, upper body, portrait, uncensored, dress,\nPureErosFace_V1", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7.5, + "Clip skip": "2", + "resources": [ + { + "hash": "d819c8be6b", + "name": "majicmixRealistic_v4", + "type": "model" + }, + { + "hash": "9508a120345f", + "name": "stLouisLuxuriousWheels_v1_1.0_ST", + "type": "lora", + "weight": null + } + ], + "Model hash": "d819c8be6b", + "AddNet Enabled": "True", + "AddNet Model 1": "aespaKarina_aespaKarinaV5_1.0_WY+stLouisLuxuriousWheels_v1_1.0_ST(9508a120345f)", + "negativePrompt": "(worst quality:2), (low quality:2), (normal quality:2), lowres, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, manboobs, backlight, (ugly:1.3), (duplicate:1.3), (morbid:1.2), (mutilated:1.2), (tranny:1.3), mutated hands, (poorly drawn hands:1.3), blurry, (bad anatomy:1.2), (bad proportions:1.3), extra limbs, (disfigured:1.3), (more than 2 nipples:1.3), (missing arms:1.3), (extra legs:1.3), (fused fingers:1.6), (too many fingers:1.6), (unclear eyes:1.3), lowers, bad hands, missing fingers, extra digit, (futa:1.1), logo, white letters, socks,\n(deformed iris, deformed pupils), out of frame, duplicate, extra fingers, poorly drawn face, mutation, deformed, dehydrated, cloned face, gross proportions, malformed limbs, missing legs, extra arms, long neck, text, cross-eyed, fewer digits, signature, watermark, username, pregnant, vore, tran nsexual, hermaphrodite, pubic hair, bad legs,\nbadhandv4, ng_deepnegative_v1_75t", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/63743" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeKatherine-512-V1.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeKatherine-512-V1.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..c8537173735bb8973a00214c4bbfed00c3ac230c Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeKatherine-512-V1.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeKatherine-512-V1.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeKatherine-512-V1.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..725fa6cb52cac5e019c536b4a3f381846b00dd83 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeKatherine-512-V1.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:2433dc07aabe1633399fb50667498ef5f1289b48f5328b52b4c852e6ae1ee59f +size 151108838 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeWintru-512-V1.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeWintru-512-V1.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..00fe59b8cc0b11f6f324b5c66b1ce0679cc4b3fe --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeWintru-512-V1.civitai.info" @@ -0,0 +1,92 @@ +{ + "id": 63747, + "modelId": 59287, + "name": "ClipCodeWintru-512-V1", + "createdAt": "2023-05-06T08:04:17.263Z", + "updatedAt": "2023-05-06T08:05:35.499Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 51, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "FullmoonIllusionDollLikeness", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "FullmoonIllusionDollLikeness-ClipCodeWintru-512-V1.safetensors", + "id": 44863, + "sizeKB": 147567.224609375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-06T08:05:57.104Z", + "hashes": { + "AutoV1": "313F49E2", + "AutoV2": "8022B4EF9D", + "SHA256": "8022B4EF9D4736229EBE6022DEC4488C33C46276D9610DE2D95E6CF31A9A4F2D", + "CRC32": "4FD9F369", + "BLAKE3": "12ABA9187DBCF4BEFCE0BE425A50F4795BB8F434353DF7B17741D2FA89003454" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/63747" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/bedb01d1-2bc9-49b7-b15d-33cb27c9f10a/width=450/703354.jpeg", + "nsfw": "Soft", + "width": 512, + "height": 768, + "hash": "UBDv1X0L00tR00%1-;n$9u%Lt7Io~p9ZaK%2", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 404754876, + "Model": "majicmixRealistic_v4", + "steps": 21, + "hashes": { + "model": "d819c8be6b" + }, + "prompt": "(HD, RAW photo, realistic, photo-realistic:1.4), close-up, (incredible absurdity), photon mapping, radiosity, physically-based rendering, illustration, ultra detailed, fine detail, cinematic effects, wallpaper, digital art, warm colour, colorful,\nstudio background, layered backgrounds, delicate background, detailed stage background, (professional lighting, detailed light, lighting, bright), sunlight,\n1girl, looking at viewer, upper body, portrait, uncensored, dress,\nPureErosFace_V1", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7.5, + "Clip skip": "2", + "resources": [ + { + "hash": "d819c8be6b", + "name": "majicmixRealistic_v4", + "type": "model" + }, + { + "hash": "21589feeb97c", + "name": "V1", + "type": "lora", + "weight": null + } + ], + "Model hash": "d819c8be6b", + "AddNet Enabled": "True", + "AddNet Model 1": "FullmoonIllusionDollLikeness-ClipCodeWintru-512-V1(21589feeb97c)", + "negativePrompt": "(worst quality:2), (low quality:2), (normal quality:2), lowres, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, manboobs, backlight, (ugly:1.3), (duplicate:1.3), (morbid:1.2), (mutilated:1.2), (tranny:1.3), mutated hands, (poorly drawn hands:1.3), blurry, (bad anatomy:1.2), (bad proportions:1.3), extra limbs, (disfigured:1.3), (more than 2 nipples:1.3), (missing arms:1.3), (extra legs:1.3), (fused fingers:1.6), (too many fingers:1.6), (unclear eyes:1.3), lowers, bad hands, missing fingers, extra digit, (futa:1.1), logo, white letters, socks,\n(deformed iris, deformed pupils), out of frame, duplicate, extra fingers, poorly drawn face, mutation, deformed, dehydrated, cloned face, gross proportions, malformed limbs, missing legs, extra arms, long neck, text, cross-eyed, fewer digits, signature, watermark, username, pregnant, vore, tran nsexual, hermaphrodite, pubic hair, bad legs,\nbadhandv4, ng_deepnegative_v1_75t", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.85", + "AddNet Weight B 1": "0.85" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/63747" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeWintru-512-V1.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeWintru-512-V1.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..458d5a1b25cb7bb5a213f9ad40e7af011ced4f94 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeWintru-512-V1.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeWintru-512-V1.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeWintru-512-V1.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..04633b56fa31ed95b3400ef126328ee0d189d5b3 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/FullmoonIllusionDollLikeness-ClipCodeWintru-512-V1.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:8022b4ef9d4736229ebe6022dec4488c33c46276d9610de2d95e6cf31a9a4f2d +size 151108838 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/IndonesianDollLikeness_V1.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/IndonesianDollLikeness_V1.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..3a0252784a40073f07ceddda95e1933dbcfc7172 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/IndonesianDollLikeness_V1.civitai.info" @@ -0,0 +1,200 @@ +{ + "id": 107110, + "modelId": 100074, + "name": "V1", + "createdAt": "2023-06-30T06:33:11.600Z", + "updatedAt": "2023-06-30T06:36:52.906Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 306, + "ratingCount": 5, + "rating": 4.2 + }, + "model": { + "name": "IndonesianDollLikeness (V1)", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "IndonesianDollLikeness_V1.safetensors", + "id": 75433, + "sizeKB": 147567.224609375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-30T06:36:16.671Z", + "hashes": { + "AutoV1": "3E98B672", + "AutoV2": "B3E5515C8D", + "SHA256": "B3E5515C8D83E0451631619B3276CBC5ECA1E17CBC3CE97E4B0AA0E32BD760C9", + "CRC32": "B0552AB2", + "BLAKE3": "25CBB792699FBFD24767F84A4BAD5181D16EB487E8D4024418E3FFDBD7C83F65" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/107110" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5d786c9e-ca5d-48c0-8e28-1b2667df4472/width=450/1343163.jpeg", + "nsfw": "Mature", + "width": 816, + "height": 1224, + "hash": "UEKJ}b~XUHx^0MyE9HXU_3E3-=-=_3-;V[R,", + "meta": { + "Size": "512x768", + "seed": 2559564827, + "Model": "braBeautifulRealistic_brav5", + "steps": 25, + "hashes": { + "model": "ac68270450", + "embed:pureerosface_v1": "dedb4322e4" + }, + "prompt": "hetero, pov, solo focus, girl on top, looking at viewer, 1girl, (masterpiece, best quality, ultra detailed),[reflections], ultra realistic, (19yo),photo realistic,(best illumination, best shadow, an extremely delicate and beautiful), finely detail, beautiful detailed, shiny eyes, beautiful eyes, angel face, detailed face, cleavage, collarbone, (big breasts):0.2, (nipples), abs, navel, (bright,[[smile]], happy,blush),((micro bikini)),((beatutiful face)), fingernails,(erotic sexy),breasts, accent lighting, backlighting, professional lighting, light on face,cinematic lighting, red hair, long hair,hair pulled back, folded tied hair, earrings, necklace, jewelry, extremely detailed eyes and face, beautiful detailed eyes, hair ornament, wear straw hat and hold straw hat with her hands, slim waist, blush,(perfect anatomy),bust body, (thin legs:0.3), long legs, belly fat:0.1, PureErosFace_V1, on the beach,beach, sea shore, (spread legs), (cowgirl position), from below, ((panty)):1.3,cameltoe:0.2, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "name": "IndonesianDollLikeness_V1", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "ac68270450", + "name": "braBeautifulRealistic_brav5", + "type": "model" + } + ], + "Model hash": "ac68270450", + "Hires steps": "20", + "Hires upscale": "1.6", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "easynegative, (worst quality:1.3), (low quality:1), (normal quality:1.4), lowres,skin spots, acnes, skin blemishes, age spot, glan, extra fingers, fewer fingers, strange fingers, bad hand, bad anatomy, fused fingers, missing leg, mutated hand, malformed limbs, missing feet,multiple legs,men,boy,penis, loli,3d,extra hands,extra foots", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ecba9d65-a885-4b1d-a812-3eeb038ca2ee/width=450/1343164.jpeg", + "nsfw": "Mature", + "width": 816, + "height": 1224, + "hash": "UEHBYtIAFyt700kX9FNw9ZV@~VV?xtSiIVs:", + "meta": { + "Size": "512x768", + "seed": 1750818655, + "Model": "braBeautifulRealistic_brav5", + "steps": 25, + "hashes": { + "model": "ac68270450" + }, + "prompt": "best quality, ultra high res, (photorealistic:1.4), masterpiece, 1girl, black night gown, on bed, seductive pose, (huge breasts:1.2), (busty:1), looking at viewer ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "name": "IndonesianDollLikeness_V1", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "ac68270450", + "name": "braBeautifulRealistic_brav5", + "type": "model" + } + ], + "Model hash": "ac68270450", + "Hires steps": "20", + "Hires upscale": "1.6", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans,", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0aa580c2-941d-454a-8dfd-f54966fc9e8a/width=450/1343166.jpeg", + "nsfw": "Mature", + "width": 816, + "height": 1224, + "hash": "UAHKtn9GC6EL00EMH?$*?ur=~Wo}o~kW9tE1", + "meta": { + "Size": "512x768", + "seed": 694097523, + "Model": "braBeautifulRealistic_brav5", + "steps": 25, + "hashes": { + "model": "ac68270450" + }, + "prompt": "25 years old woman, milf, (((on bed))), (red lace bra), red lingerie RAW photo, (photorealistic:1.37, realistic), highly detailed CG unified 8K wallpapers, 1girl, ((thick body:0.8)), (clevage, huge breasts:1.6), looking at viewer, (((straight from front))), (HQ skin:1.2, shiny skin), 8k uhd, dslr, soft lighting, high quality, film grain, Fujifilm XT3, (full body:0.9) (professional lighting:1.6) , ((arms up))", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "name": "IndonesianDollLikeness_V1", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "ac68270450", + "name": "braBeautifulRealistic_brav5", + "type": "model" + } + ], + "Model hash": "ac68270450", + "Hires steps": "20", + "Hires upscale": "1.6", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "EasyNegative,Paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowers, normal quality, ((monochrome)), ((grayscales)), skin spots, acnes, skin blemishes, age spot, glans, (6 more fingers on one hand),(deformity), multiple breasts, (mutated hands and fingers:1.5 ), (long body :1.3), (mutation, poorly drawn :1.2) , black-white, bad anatomy, liquid body, liquid tongue, disfigured, malformed, mutated, anatomical nonsense, text font ui, error, malformed hands, long neck, blurred, lowers, lowres, bad anatomy, bad proportions, bad shadow, uncoordinated body, unnatural body, fused breasts, bad breasts, huge breasts, poorly drawn breasts, extra breasts, liquid breasts, heavy breasts, missing breasts, huge haunch, huge thighs, huge calf, bad hands, fused hand, missing hand, disappearing arms, disappearing thigh, disappearing calf, disappearing legs, fused ears, bad ears, poorly drawn ears, extra ears, liquid ears, heavy ears, missing ears, fused animal ears, bad animal ears, poorly drawn animal ears, extra animal ears, liquid animal ears, heavy animal ears, missing animal ears, text, ui, error, missing fingers, missing limb, fused fingers, one hand with more than 5 fingers, one hand with less than 5 fingers, one hand with more than 5 digit, one hand with less than 5 digit, extra digit, fewer digits, fused digit, missing digit, bad digit, liquid digit, colorful tongue, black tongue, cropped, watermark, username, blurry, JPEG artifacts, signature, 3D, 3D game, 3D game scene, 3D character, malformed feet, extra feet, bad feet, poorly drawn feet, fused feet, missing feet, extra shoes, bad shoes, fused shoes, more than two shoes, poorly drawn shoes, bad gloves, poorly drawn gloves, fused gloves, bad cum, poorly drawn cum, fused cum, bad hairs, poorly drawn hairs, fused hairs, big muscles, ugly, bad face, fused face, poorly drawn face, cloned face, big face, long face, bad eyes, fused eyes poorly drawn eyes, extra eyes, malformed limbs, more than 2 nipples, missing nipples, different nipples, fused nipples, bad nipples, poorly drawn nipples, black nipples, colorful nipples, gross proportions. short arm, (((missing arms))), missing thighs, missing calf, missing legs, mutation, duplicate, morbid, mutilated, poorly drawn hands, more than 1 left hand, more than 1 right hand, deformed, (blurry), disfigured, missing legs, extra arms, extra thighs, more than 2 thighs, extra calf, fused calf, extra legs, bad knee, extra knee, more than 2 legs, bad tails, bad mouth, fused mouth, poorly drawn mouth, bad tongue, tongue within mouth, too long tongue, black tongue, big mouth, cracked mouth, bad mouth, dirty face, dirty teeth, dirty pantie, fused pantie, poorly drawn pantie, fused cloth, poorly drawn cloth, bad pantie, yellow teeth, thick lips, bad cameltoe, colorful cameltoe, bad asshole, poorly drawn asshole, fused asshole, missing asshole, bad anus, bad pussy, bad crotch, bad crotch seam, fused anus, fused pussy, fused anus, fused crotch, poorly drawn crotch, fused seam, poorly drawn anus, poorly drawn pussy, poorly drawn crotch, poorly drawn crotch seam, bad thigh gap, missing thigh gap, fused thigh gap, liquid thigh gap, poorly drawn thigh gap, poorly drawn anus, bad collarbone, fused collarbone, missing collarbone, liquid collarbone, strong girl, obesity, worst quality, low quality, normal quality, liquid tentacles, bad tentacles, poorly drawn tentacles, split tentacles, fused tentacles, missing clit, bad clit, fused clit, colorful clit, black clit, liquid clit, QR code, bar code, censored, safety panties, safety knickers, beard, furry ,pony, pubic hair, mosaic, excrement, faeces, shit, kid, child, loli, young,badhandsv5-neg, nsfw, nude", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c7db18e1-7795-4456-89af-c0f30a9612f8/width=450/1343168.jpeg", + "nsfw": "X", + "width": 816, + "height": 1224, + "hash": "UOH_f9xu9ZR+4TRjR+RjX8NGslWW_NxusAoL", + "meta": { + "Size": "512x768", + "seed": 649887293, + "Model": "braBeautifulRealistic_brav5", + "steps": 25, + "hashes": { + "model": "ac68270450" + }, + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, off-shoulder white shirt, black tight skirt, black choker, (faded ash gray hair:1), (huge breasts:1.2), looking at viewer, closeupbench", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "name": "IndonesianDollLikeness_V1", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "ac68270450", + "name": "braBeautifulRealistic_brav5", + "type": "model" + } + ], + "Model hash": "ac68270450", + "Hires steps": "20", + "Hires upscale": "1.6", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans,", + "Denoising strength": "0.5" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/107110" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/IndonesianDollLikeness_V1.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/IndonesianDollLikeness_V1.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..474f18334f317d9e22fe62e1cb3f1b5d754d7d73 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/IndonesianDollLikeness_V1.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/IndonesianDollLikeness_V1.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/IndonesianDollLikeness_V1.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..0179494dfd8cb97f3ed4af632e3660aeb684908f --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/IndonesianDollLikeness_V1.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:b3e5515c8d83e0451631619b3276cbc5eca1e17cbc3ce97e4b0aa0e32bd760c9 +size 151108838 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/LadyInChamberStyle_ldcStyleV10.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/LadyInChamberStyle_ldcStyleV10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..ebac747568e682008b7c81b86f6c576872e6cdd4 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/LadyInChamberStyle_ldcStyleV10.civitai.info" @@ -0,0 +1,94 @@ +{ + "id": 52460, + "modelId": 47866, + "name": "LDC_style_v10", + "createdAt": "2023-04-22T14:46:00.173Z", + "updatedAt": "2023-04-22T14:48:19.912Z", + "trainedWords": [ + "keai", + "1girl" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

\u5c11\u5973\u98ce\u683c\u6444\u5f71

", + "stats": { + "downloadCount": 239, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "\u95fa\u623f(Lady in chamber style)", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "LadyInChamberStyle_ldcStyleV10.safetensors", + "id": 38186, + "sizeKB": 73841.2841796875, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-22T14:51:43.939Z", + "hashes": { + "AutoV1": "9D104D4B", + "AutoV2": "2BA963ED0F", + "SHA256": "2BA963ED0F8D88E14FA8D1FD963373320B6ABD47BDA5323CE63C1295A61BA288", + "CRC32": "ED225AAB", + "BLAKE3": "AB7277E6111302117EFCC0055846892D08B05D6193B9F7046FB08118065C19D9" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/52460" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a3a2a993-1e6e-42ad-a070-ec762487ac00/width=450/565245.jpeg", + "nsfw": true, + "width": 848, + "height": 1160, + "hash": "UBMi~9yE_24n56x]~pR+PWxC~qtRxWRP8_Rj", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5e791566-0d59-44c8-4b91-a2049f138b00/width=450/565247.jpeg", + "nsfw": true, + "width": 848, + "height": 1160, + "hash": "UTM710yD_NtR?GNIIU?bInRiMw%MXns:-oj[", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c5952abe-72f4-4e27-8c82-6e25ae689400/width=450/565249.jpeg", + "nsfw": true, + "width": 848, + "height": 1160, + "hash": "URLp,MyD~q-U~p_3M{Io-;NeNaM{EOni?HIV", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f71cecae-adac-4aec-0334-ae8b8a4b5400/width=450/565254.jpeg", + "nsfw": true, + "width": 848, + "height": 1160, + "hash": "UPMZdj?wtlRO%~xu?HIUXn%M%gayW=ITnhWB", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e1729545-f0ce-4870-a501-fd9dd0a52200/width=450/565252.jpeg", + "nsfw": true, + "width": 848, + "height": 1160, + "hash": "UQOCvxM_?^%2tmIUt7t7NHxF%MRjtRWBR*NG", + "meta": null + } + ], + "downloadUrl": "https://civitai.com/api/download/models/52460" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/LadyInChamberStyle_ldcStyleV10.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/LadyInChamberStyle_ldcStyleV10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..6eb1c8e5768775869a235fd6be697b24786eadbd Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/LadyInChamberStyle_ldcStyleV10.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/LadyInChamberStyle_ldcStyleV10.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/LadyInChamberStyle_ldcStyleV10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..91f63af3fbc64bf7d7dd3fd8228190cf0fb33df2 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/LadyInChamberStyle_ldcStyleV10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:2ba963ed0f8d88e14fa8d1fd963373320b6abd47bda5323ce63c1295a61ba288 +size 75613475 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/LoveOnLovely_lolStyleV10.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/LoveOnLovely_lolStyleV10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..d694e563af87dd2960b152d034817d0540911976 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/LoveOnLovely_lolStyleV10.civitai.info" @@ -0,0 +1,102 @@ +{ + "id": 52492, + "modelId": 47891, + "name": "LOL_style_v10", + "createdAt": "2023-04-22T15:25:08.307Z", + "updatedAt": "2023-04-22T15:27:24.815Z", + "trainedWords": [ + "1girl", + "keai" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

V10

", + "stats": { + "downloadCount": 209, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "\u5c11\u9495\u5d07\u62dc\uff08Love on lovely\uff09", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "LoveOnLovely_lolStyleV10.safetensors", + "id": 38207, + "sizeKB": 73842.5185546875, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-22T15:37:36.383Z", + "hashes": { + "AutoV1": "027824DA", + "AutoV2": "2CADE4140B", + "SHA256": "2CADE4140BD27DB73638B29BE10340D451492D5B174809A2804279BF001D8B8F", + "CRC32": "916275FF", + "BLAKE3": "CF793539AABFD46236F44F5B53720157A56E078608B8F0C756193D5C0CECA133" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/52492" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f8e67a2c-f368-45de-cc74-773f26e2ae00/width=450/565700.jpeg", + "nsfw": true, + "width": 896, + "height": 1152, + "hash": "U3FhhkIU019_k?560f_200=x8_rr.8~V8w=|", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b2794abf-88ba-4809-b920-9d01bbff2800/width=450/565855.jpeg", + "nsfw": true, + "width": 896, + "height": 1152, + "hash": "UHJtVUACFv~V00%fkV-o%fIUm,IUIVog%NR*", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7dfef55a-b151-4709-5c55-899eb0115600/width=450/565877.jpeg", + "nsfw": true, + "width": 896, + "height": 1152, + "hash": "UAID{%00h0Q-NG00E*a00g~V?HXmxGOF4TIo", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3f4ba1b9-1afb-4a82-d67d-cb2d968e3e00/width=450/565854.jpeg", + "nsfw": true, + "width": 896, + "height": 1152, + "hash": "UPI;krl8O=~B9[-:S0aJx^RRVsIoNGf6-oV?", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9fef6155-e8da-4be7-7040-583cc300df00/width=450/565705.jpeg", + "nsfw": true, + "width": 896, + "height": 1152, + "hash": "UDJ7di5700~W00_2_2nOgNM{H?57ROIV%MRj", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5effee4a-a23c-42ae-01a2-f6aff27eb400/width=450/565707.jpeg", + "nsfw": true, + "width": 896, + "height": 1152, + "hash": "U8I;VD%f1J4o00NF0KM|01s:~W%g~WNH00D%", + "meta": null + } + ], + "downloadUrl": "https://civitai.com/api/download/models/52492" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/LoveOnLovely_lolStyleV10.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/LoveOnLovely_lolStyleV10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..2ef711ad574af2bc76c45caa85ccb88b1b9a1fed Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/LoveOnLovely_lolStyleV10.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/LoveOnLovely_lolStyleV10.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/LoveOnLovely_lolStyleV10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..4b4dbffeb1ccddc3ad704da85e0a6898588b0f56 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/LoveOnLovely_lolStyleV10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:2cade4140bd27db73638b29be10340d451492d5b174809a2804279bf001d8b8f +size 75614739 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/T1SeasideShaonvT1_sssStyleYSV10.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/T1SeasideShaonvT1_sssStyleYSV10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..be6adde29247ab4968932b861d2669292fb826c5 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/T1SeasideShaonvT1_sssStyleYSV10.civitai.info" @@ -0,0 +1,94 @@ +{ + "id": 52439, + "modelId": 47844, + "name": "SSS_style(y\u3001s)_v10", + "createdAt": "2023-04-22T14:30:34.778Z", + "updatedAt": "2023-04-22T15:28:51.377Z", + "trainedWords": [ + "keai", + "1girl" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

\u5e74\u8f7b\u3001\u7ea4\u7ec6

", + "stats": { + "downloadCount": 196, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "\u6d77\u8fb9\u5c11\u5973_T1\uff08seaside shaonv_T1\uff09", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "T1SeasideShaonvT1_sssStyleYSV10.safetensors", + "id": 38175, + "sizeKB": 73840.279296875, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-22T14:36:34.782Z", + "hashes": { + "AutoV1": "EFC0859D", + "AutoV2": "444BE74668", + "SHA256": "444BE74668413DE686AE8810A6E9EEDDF763CA2AE820861E6204D39673FB31BA", + "CRC32": "6300372A", + "BLAKE3": "458F35B6167E5078D8057D089E5D8E23DAF8CFD9B21CB6837B46FC70F403DA90" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/52439" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/09c86ad9-f7ff-4b1b-6362-63181b2c9700/width=450/565085.jpeg", + "nsfw": true, + "width": 840, + "height": 1048, + "hash": "U9HB[5+~3ocY00-T=0Eh00j;n4w}_N%2M{?Z", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0f993c23-96ec-4ebd-9d76-51de907aa900/width=450/565082.jpeg", + "nsfw": true, + "width": 840, + "height": 1048, + "hash": "UEGIit-B0y_N~p-:kWR*Muo~?H-pMc?vi_D$", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2921db8c-d752-4573-e6e5-d7abc6066100/width=450/565088.jpeg", + "nsfw": true, + "width": 840, + "height": 1048, + "hash": "UEHC1O-:7YD*8{9um,$*^PrXMz0K~qxHWUE1", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d4f9b9b2-9e75-47e6-95d8-a92dcda94400/width=450/565089.jpeg", + "nsfw": true, + "width": 840, + "height": 1048, + "hash": "UPIOX|xu9FM{*0-;M{M{xuW=NFslSjIoj@%M", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c128157c-8a24-4318-d5c4-8dcb0dce4c00/width=450/565094.jpeg", + "nsfw": true, + "width": 840, + "height": 1048, + "hash": "U8G+dl004RxZ00IB8_%M00xc}u9a~pS~t,s,", + "meta": null + } + ], + "downloadUrl": "https://civitai.com/api/download/models/52439" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/T1SeasideShaonvT1_sssStyleYSV10.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/T1SeasideShaonvT1_sssStyleYSV10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..14b3c90faeb8e626fc7371e1404d09575f1ed8e5 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/T1SeasideShaonvT1_sssStyleYSV10.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/T1SeasideShaonvT1_sssStyleYSV10.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/T1SeasideShaonvT1_sssStyleYSV10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..ec2c849184111539a6acd83f76f4b355cb90170f --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/T1SeasideShaonvT1_sssStyleYSV10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:444be74668413de686ae8810a6e9eeddf763ca2ae820861e6204d39673fb31ba +size 75612446 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/T2SeasideShaonvT2_sssStyleOBV10.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/T2SeasideShaonvT2_sssStyleOBV10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..3fcad91f3d7d95242437b704831f904451025849 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/T2SeasideShaonvT2_sssStyleOBV10.civitai.info" @@ -0,0 +1,94 @@ +{ + "id": 50697, + "modelId": 46079, + "name": "SSS_style(o\u3001b)_v10", + "createdAt": "2023-04-20T12:20:21.188Z", + "updatedAt": "2023-04-22T14:21:27.328Z", + "trainedWords": [ + "1girl", + "keai" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

\u6210\u719f\u3001\u4e30\u6ee1

", + "stats": { + "downloadCount": 225, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "\u6d77\u8fb9\u5c11\u5973_T2\uff08seaside shaonv_T2\uff09", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "T2SeasideShaonvT2_sssStyleOBV10.safetensors", + "id": 37129, + "sizeKB": 73840.2763671875, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-20T12:25:49.428Z", + "hashes": { + "AutoV1": "AFFA0B81", + "AutoV2": "84B23674EB", + "SHA256": "84B23674EB4BC1DD9BA67CFBB0855C8CEC329C0DED0CBEE05DB150ED0A21A1BD", + "CRC32": "492030F2", + "BLAKE3": "34CA05CFA47E5DA5AEC9911EE66A380C76FC96B897E64F732232F17FC19FDB2F" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/50697" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a1e64eea-a514-4557-337c-aeb51b0f7200/width=450/545126.jpeg", + "nsfw": true, + "width": 840, + "height": 1048, + "hash": "UGGbekEM0|wc00%2VZV@4nRPsA%f~qX8xZIo", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5242c981-eedc-4f42-5abf-da73b55fed00/width=450/545145.jpeg", + "nsfw": true, + "width": 840, + "height": 1048, + "hash": "U8E.-60000VG0$IBZhxulo^k%#RiIeIpQmR*", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/33e31bac-fe71-4807-60b6-9ec257a67600/width=450/545165.jpeg", + "nsfw": true, + "width": 840, + "height": 1048, + "hash": "U8HUkG000K~B0e?H-pMy00~WaKt7E3%L4ntR", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5c7fb782-6ba7-490d-7a2f-3d09c7918800/width=450/545164.jpeg", + "nsfw": true, + "width": 840, + "height": 1048, + "hash": "U9F?5{*03g}@00sP00o|4,NY^+9F_2%hpIH[", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d154c01d-e6d6-4d39-2769-a3f3f9a90d00/width=450/545169.jpeg", + "nsfw": true, + "width": 840, + "height": 1048, + "hash": "UGGu%ZPT0xIA9aD*IBMwm-=f$*9F_MTIkVNH", + "meta": null + } + ], + "downloadUrl": "https://civitai.com/api/download/models/50697" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/T2SeasideShaonvT2_sssStyleOBV10.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/T2SeasideShaonvT2_sssStyleOBV10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..710ddaf6e12ff24ca6bff0c027e59cfba9ff296d Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/T2SeasideShaonvT2_sssStyleOBV10.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/T2SeasideShaonvT2_sssStyleOBV10.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/T2SeasideShaonvT2_sssStyleOBV10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..5c6b1ea5a120110e05bab2d8c881a263dc56f45c --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/T2SeasideShaonvT2_sssStyleOBV10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:84b23674eb4bc1dd9ba67cfbb0855c8cec329c0ded0cbee05db150ed0a21a1bd +size 75612443 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/asianGirlsFace_v1.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/asianGirlsFace_v1.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..7f4dc10c504c8d024db626db6ab4199259ddb9a9 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/asianGirlsFace_v1.civitai.info" @@ -0,0 +1,113 @@ +{ + "id": 67325, + "modelId": 62760, + "name": "v1.0", + "createdAt": "2023-05-10T16:33:26.963Z", + "updatedAt": "2023-05-10T16:37:08.363Z", + "trainedWords": [ + "FACE" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 304, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "asian Girls Face", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "asianGirlsFace_v1.safetensors", + "id": 47107, + "sizeKB": 147567.2177734375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-10T16:36:26.101Z", + "hashes": { + "AutoV1": "5A265D61", + "AutoV2": "55D9FC2445", + "SHA256": "55D9FC24456DAC3A8B47C993241574F61C456E222990E17999539F8475FB69F6", + "CRC32": "36646214", + "BLAKE3": "065B927EFC541A1731BEACD0E5777A7F82F4DCBDEB4D88F0F30A29F62904CAA0" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/67325" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/031e4408-3098-4f4a-9a05-d499cedf513a/width=450/747945.jpeg", + "nsfw": "None", + "width": 4096, + "height": 6144, + "hash": "UGE{b2~W8^%M004.krRPt.kWxYxuR%%1%1Rj", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1843264006, + "Model": "majicmixRealistic_v3", + "steps": 40, + "prompt": "Best quality, masterpiece, ultra high res, (photorealistic:1.4), raw photo, (Authentic skin texture:1.3), (film grain:1.3), panorama, character portrait, very wide shot, narrow waist, cowboy shot, (in the dark, deep shadow, low key, cold light,) night, close-up, streaming tears, \nindoor, dust, Tyndall effect, sad, disappointed, gloom (expression), sitting, (against wall), crying, frown, (head bowed), nervous, tearing up, lonely,\n1girl, beautiful detailed eyes and face, white jabot, off shoulder, brown eyes,\n ", + "sampler": "DPM++ 2M alt Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "FilmgirlLora_v30", + "type": "lora", + "weight": 0.6 + } + ], + "Hires steps": "15", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "ng_deepnegative_v1_75t, badhandv4 (worst quality:2), (low quality:2), (normal quality:2), lowres, bad anatomy, bad hands, normal quality, ((monochrome)), ((grayscale)),lowres,badanatomy, badfoots,wrong,badfingers,text,error,missingfingers,extradigit,fewerdigits,cropped,worstquality,lowquality,normalquality,jpegartifacts,signature,watermark,usemame,blury,badfeet,futa,futanari,small_penis,yaoi,huge_breasts,large_breasts,three legs,wrong hand,wrong feet,wrong fingers,deformed leg,abnormal,malformation, nsfw,watermark, character watermark,", + "Denoising strength": "0.3" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a49700fa-ee2a-4d2c-932e-48c76f339bee/width=450/747943.jpeg", + "nsfw": "None", + "width": 4096, + "height": 6144, + "hash": "UVFiGZ~qo}%g00RP%MfkkXRjV@oJs.fPRkWB", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1222752426, + "Model": "majicmixRealistic_v3", + "steps": 40, + "prompt": "Best quality, masterpiece, ultra high res, (photorealistic:1.4), raw photo, (Authentic skin texture:1.3), (film grain:1.3), panorama, character portrait, very wide shot, half body, narrow waist, cowboy shot, in the dark, deep shadow, low key, cold light, night,\nindoor, a beam of light, dust, Tyndall effect, sad, disappointed, gloom (expression), hollow eyes, against window, \n1girl, beautiful detailed eyes and face, white jabot, off shoulder, head down, brown eyes,\n ", + "sampler": "DPM++ 2M alt Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "FilmgirlLora_v30", + "type": "lora", + "weight": 0.6 + } + ], + "Hires steps": "15", + "Hires upscale": "2", + "Hires upscaler": "4x-UltraSharp", + "negativePrompt": "ng_deepnegative_v1_75t, badhandv4 (worst quality:2), (low quality:2), (normal quality:2), lowres, bad anatomy, bad hands, normal quality, ((monochrome)), ((grayscale)),lowres,badanatomy, badfoots,wrong,badfingers,text,error,missingfingers,extradigit,fewerdigits,cropped,worstquality,lowquality,normalquality,jpegartifacts,signature,watermark,usemame,blury,badfeet,futa,futanari,small_penis,yaoi,huge_breasts,large_breasts,three legs,wrong hand,wrong feet,wrong fingers,deformed leg,abnormal,malformation, nsfw,watermark, character watermark,", + "Denoising strength": "0.3" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/67325" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/asianGirlsFace_v1.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/asianGirlsFace_v1.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..72bdc629fbb18a83e91f12b4d1d74e4b2c31064d --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/asianGirlsFace_v1.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:13c8829034705a3911122cdaefe84aa39aee5f51e7a520b57fabec283e049df2 +size 21144640 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/asianGirlsFace_v1.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/asianGirlsFace_v1.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..88271a957868a92dd9fe1245831fa7843a8cfbe8 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/asianGirlsFace_v1.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:55d9fc24456dac3a8b47c993241574f61c456e222990e17999539f8475fb69f6 +size 151108831 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/betterCuteAsian03.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/betterCuteAsian03.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..c24473190b085c5ab1faf13047dbe0f70f11d4f3 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/betterCuteAsian03.civitai.info" @@ -0,0 +1,414 @@ +{ + "id": 44501, + "modelId": 38567, + "name": "v1.0", + "createdAt": "2023-04-13T08:56:02.241Z", + "updatedAt": "2023-04-13T09:03:30.270Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 5, + "description": null, + "stats": { + "downloadCount": 1066, + "ratingCount": 2, + "rating": 5 + }, + "model": { + "name": "betterCuteAsian", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "betterCuteAsian03.safetensors", + "id": 33547, + "sizeKB": 147689.3056640625, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-13T09:01:30.699Z", + "hashes": { + "AutoV1": "5F0136BC", + "AutoV2": "841B95E67E", + "SHA256": "841B95E67EC309FE945B51E86F40FC31D9B567FF3D9A07E6B8CDE9950F02CFE9", + "CRC32": "CE39E6E3", + "BLAKE3": "953D4F23B2851A883CE8221655579CFA25B759DEA2CD06E4725A367416C8FB23" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/44501" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c66568ab-9b17-4698-748c-ace1efaacf00/width=450/484837.jpeg", + "nsfw": "X", + "width": 512, + "height": 768, + "hash": "UGF%oO%L3sADGu#m%MS4+Goz#RMdGuNbja-U", + "meta": { + "Size": "512x768", + "seed": 3546381916, + "Model": "chilloutmix_NiPrunedFp32Fix", + "steps": 40, + "hashes": { + "model": "fc2511737a" + }, + "prompt": "Kpop idol, photorealistic, detailed face, an underwater photograph of a beautiful naked lady diving into the ocean, captured in a high-speed shot that freezes the moment she breaks the surface. The scene is bathed in natural light, with intricate bubbles and ripples forming around her body. Moody, highly-detailed, and smooth, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "resources": [ + { + "name": "betterCuteAsian03", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "fc2511737a", + "name": "chilloutmix_NiPrunedFp32Fix", + "type": "model" + } + ], + "Model hash": "fc2511737a", + "negativePrompt": "(worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality,bad-artist ,((monochrome)), ((grayscale)),bad anatomy,skin spots, acnes, skin blemishes, age spot, glans,extra fingers,fewer fingers,strange fingers,bad hand, bad-artist", + "Face restoration": "CodeFormer" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/db912746-53cd-4356-d0b5-0eb866163400/width=450/484855.jpeg", + "nsfw": "Soft", + "width": 768, + "height": 1152, + "hash": "UTL|y6Di.Sx]*0D*T0x]9at7WERlxvR*jYRj", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 972322459, + "Model": "chilloutmix_NiPrunedFp32Fix", + "steps": 20, + "hashes": { + "model": "fc2511737a" + }, + "prompt": "masterpiece, best quality, high quality, highres, large breasts, realistic, photorealistic, detailed face, perfect face, silver hair, white shirt, ponytail, jewelry, transparent clothes, armlet, bangle, earrings, Beach, pureerosface_v1:0.4, ulzzang-6500:0.4, amazing, NSFW, daitaku helios \\(umamusume\\), , full body, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 12.5, + "Clip skip": "2", + "resources": [ + { + "name": "breastinclassBetter_v141", + "type": "lora", + "weight": 0.3 + }, + { + "name": "betterCuteAsian", + "type": "lora", + "weight": 0.3 + }, + { + "hash": "fc2511737a", + "name": "chilloutmix_NiPrunedFp32Fix", + "type": "model" + } + ], + "Model hash": "fc2511737a", + "Hires steps": "20", + "Hires upscale": "1.5", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "worst quality, low quality, EasyNegative, multiple panels, blurry, watermark, text, loli, child, normal quality, bad composition, lowres, error, jpeg , age spot, logo, ng_deepnegative_v1_75t, bad_prompt_version2:0.8, badhandv4,", + "Face restoration": "CodeFormer", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e3cad750-7dfc-460d-ac73-6f90723ec800/width=450/484852.jpeg", + "nsfw": "Soft", + "width": 768, + "height": 960, + "hash": "UAH27xzA00u61UZL^jAc5a4,%M-oI=o|NKnL", + "meta": { + "Size": "768x960", + "seed": 3546432641, + "Model": "chilloutmix_NiPrunedFp32Fix", + "steps": 30, + "hashes": { + "model": "fc2511737a" + }, + "prompt": "(8k, RAW photo:1.2),best quality, ultra high res,dramatic angle,(fluttered detailed color splashs), (illustration),(((1 girl))),(long hair),(rain:0.9),(hair ornament:1.4),there is an ancient palace beside the girl,chinese clothes,(focus on), color Ink wash painting,(color splashing),colorful splashing,(((colorful))),(sketch:0.8), Masterpiece,best quality, beautifully painted,highly detailed,(denoising:0.6),[splash ink],((ink refraction)), (beautiful detailed sky),moon,highly,detaild,(masterpiece, best quality, extremely detailed CG unity 8k wallpaper,masterpiece, best quality, ultra-detailed),(Lycoris radiata), , ", + "sampler": "Euler a", + "cfgScale": 4, + "Clip skip": "2", + "resources": [ + { + "name": "koreanDollLikeness_v20", + "type": "lora", + "weight": 0.3 + }, + { + "name": "betterCuteAsian", + "type": "lora", + "weight": 0.3 + }, + { + "hash": "fc2511737a", + "name": "chilloutmix_NiPrunedFp32Fix", + "type": "model" + } + ], + "Model hash": "fc2511737a", + "negativePrompt": "(missing fingers),(bad hands),(bad feets),(ugly),paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans,(((simple background))),monochrome ,lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres, bad anatomy, bad hands, text, error, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, ugly,pregnant,vore,duplicate,morbid,mut ilated,tran nsexual, hermaphrodite,long neck,mutated hands,poorly drawn hands,poorly drawn face,mutation,deformed,blurry,bad anatomy,bad proportions,malformed limbs,extra limbs,cloned face,disfigured,gross proportions, (((missing arms))),(((missing legs))), (((extra arms))),(((extra legs))),pubic hair, plump,bad legs,error legs,username,blurry,bad feet", + "Face restoration": "CodeFormer" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/36c53a7d-a494-4e46-1304-ad277d49f400/width=450/484847.jpeg", + "nsfw": "Soft", + "width": 512, + "height": 768, + "hash": "UCI|?.J.0gnju4EM?Ht600M{_2%1~qxY01-V", + "meta": { + "Size": "512x768", + "seed": 293435042, + "Model": "chilloutmix_NiPrunedFp32Fix", + "steps": 30, + "hashes": { + "model": "fc2511737a" + }, + "prompt": ",\ngood hand,4k, high-res, masterpiece, best quality, head:1.3,((Hasselblad photography)), finely detailed skin, sharp focus, (cinematic lighting), collarbone, morning, soft lighting, dynamic angle, [:(detailed face:1.2):0.2], armpit crease, thigh gap, red clothes, slender, medium breasts, cleavage,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "resources": [ + { + "name": "betterCuteAsian03", + "type": "lora", + "weight": 0.3 + }, + { + "hash": "fc2511737a", + "name": "chilloutmix_NiPrunedFp32Fix", + "type": "model" + } + ], + "Model hash": "fc2511737a", + "negativePrompt": "NG_DeepNagetive_V1_75T,(greyscale:1.2),\npaintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans", + "Face restoration": "CodeFormer" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/45d18cc3-18da-4e8f-e781-d5368c88b400/width=450/484854.jpeg", + "nsfw": "Soft", + "width": 512, + "height": 512, + "hash": "UEMsG{?a0_~p?a~CSJ?a~p-:R*x]i^4.IVI:", + "meta": { + "Size": "512x512", + "seed": 1706948615, + "Model": "chilloutmix_NiPrunedFp32Fix", + "steps": 25, + "hashes": { + "model": "fc2511737a" + }, + "prompt": "photo realistic,(1 young beautiful korean girl, laying on a bed in a sexy pose),(wearing sexy lingerie:1.2),(distant gaze:1.2),full accesories,necklace,slim waist,soft makup, instagram (photorealistic, high resolution:1.2), looking at viewer , (cute face:1.15) (8k, RAW photo, best quality, masterpiece:1.2), (realistic, photo-realistic:1.17),(sharp focus:1.2), professional lighting, photon mapping, radiosity, physically-based rendering, (pale skin:1.2),(medium breasts:1.2), blue eyes, (pink hair:1.2), realistic, (masterpiece:1.25),(best quality:1.25),(shiny skin),(red lips, halo makeup:1.15),(skinny,shy :1.2), (sunset light:1.15), outside, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "name": "betterCuteAsian", + "type": "lora", + "weight": 0.4 + }, + { + "hash": "fc2511737a", + "name": "chilloutmix_NiPrunedFp32Fix", + "type": "model" + } + ], + "Model hash": "fc2511737a", + "negativePrompt": "bad-picture-chill-75v EasyNegative (((girls))), NG_DeepNegative_V1_75, (wierd hands, poorly drawn hands:1.2)", + "Face restoration": "CodeFormer" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8418fb2b-a623-47a4-5503-ff1480322100/width=450/484839.jpeg", + "nsfw": "Soft", + "width": 512, + "height": 768, + "hash": "UHHUFF^*D$~ATI^*TdELMxxt=x$iTC$*?FRi", + "meta": { + "Size": "512x768", + "seed": 602962331, + "Model": "chilloutmix_NiPrunedFp32Fix", + "steps": 20, + "hashes": { + "model": "fc2511737a" + }, + "prompt": "photo of , a woman as a movie star, modelshoot style, (extremely detailed CG unity 8k wallpaper), photo of the most beautiful artwork in the world, professional majestic oil painting by Ed Blinkey, Atey Ghailan, Studio Ghibli, by Jeremy Mann, Greg Manchess, Antonio Moro, trending on ArtStation, trending on CGSociety, Intricate, High Detail, Sharp focus, dramatic, photorealistic painting art by midjourney and greg rutkowski, (waist chain), ((movie premiere gala)), ((standing on the red carpet)), ((paparazzi in the background)), (looking at viewer), (detailed pupils:1.3), (elegant green dress:1.2), (blue eyes:1.2), (closeup)", + "sampler": "DPM2 Karras", + "cfgScale": 6.5, + "resources": [ + { + "name": "betterCuteAsian", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "fc2511737a", + "name": "chilloutmix_NiPrunedFp32Fix", + "type": "model" + } + ], + "Model hash": "fc2511737a", + "negativePrompt": "canvas frame, cartoon, 3d, ((disfigured)), ((bad art)), ((deformed)),((extra limbs)),((close up)),((b&w)), blurry, (((duplicate))), ((morbid)), ((mutilated)), [out of frame], extra fingers, mutated hands, ((poorly drawn hands)), ((poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs)), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck))), Photoshop, video game, ugly, tiling, poorly drawn hands, poorly drawn feet, poorly drawn face, out of frame, mutation, mutated, extra limbs, extra legs, extra arms, disfigured, deformed, cross-eye, body out of frame, blurry, bad art, bad anatomy, 3d render, (((nsfw))), (tiara), (crown)", + "Face restoration": "CodeFormer" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b791c318-7869-4181-4295-d87a70281900/width=450/484841.jpeg", + "nsfw": "Soft", + "width": 696, + "height": 896, + "hash": "UIH^;p~X534-RPNHak9aD~M_?b%MIyIV9Xt3", + "meta": { + "Size": "700x896", + "seed": 130, + "Model": "chilloutmix_NiPrunedFp32Fix", + "steps": 25, + "hashes": { + "model": "fc2511737a" + }, + "prompt": "natural day light, best quality ,masterpiece, illustration, an extremely delicate and beautiful, extremely detailed ,CG ,unity ,8k wallpaper, Amazing, finely detail, masterpiece,best quality,extremely detailed CG unity 8k wallpaper,absurdres, incredibly absurdres, huge filesize , ultra-detailed, highres, extremely detailed, beautiful detailed girl, extremely detailed eyes and face, beautiful detailed eyes, (RAW photo, best quality), (realistic, photo-realistic:1.3), light on face, (((full body))), ((((((standing)))))),((((((light purple low-cut dress)))))),(((cut dress))),(((side slit))),(((silk))),((((black pantyhose)))),high heels,((long hair)), black hair,smille,(((big breast))),((((thick legs)))), ", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "name": "betterCuteAsian", + "type": "lora", + "weight": 0.45 + }, + { + "hash": "fc2511737a", + "name": "chilloutmix_NiPrunedFp32Fix", + "type": "model" + } + ], + "Model hash": "fc2511737a", + "negativePrompt": "(low quality:1.5), (worst quality:1.5),lowres, bad anatomy, bad hands, (((text))), error, missing fingers, extra digit, fewer digits, cropped, worst quality,normal quality,jpeg artifacts, signature, watermark, username, blurry, (((deformed))), (blurry), bad anatomy, disfigured, poorly drawn face,mutated,(ugly), (poorly drawn hands), messy drawing, broken legs, (((distorted hands))),((disfigured)), ((bad art)), ((deformed)),((extra limbs)),((b&w)), ((morbid)), ((mutilated)), extra fingers, mutated hands, ((poorly drawn hands)), ((poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))),cloned face, (((disfigured))), out of frame, ugly,gross proportions, (malformed limbs), (((extra arms))), (((extra legs))), mutated hands, (((fused fingers))), (too many fingers), (((long neck))),tiling, poorly drawn hands, poorly drawn feet, poorly drawn face, out of frame, mutated,disfigured, deformed, cross-eye, body out of frame, blurry, bad art,signature, monster, animal, big nipples, ((distorted boobs)),rib cage, (worst quality, (low quality:1.4), ((bad art)), ((b&w)), blurry,tiling, body out of frame, out of frame, gross proportions,signature,(malformed limbs),(((extra feet))), poorly drawn feet, ((poorly drawn hands)), (((distorted hands))), (((extra hands))), ((mutated hands)), (((fused fingers))), (((too many fingers))), ((extra fingers)), ((extra digit)), ((poorly drawn face)), cloned face, (((long neck))), ((distorted boobs)), horse coat,bad anatomy, bad hands, extra digit, fewer digits, cropped, worst quality,jpeg artifacts,signature, watermark, username, blurry,multiple breasts, (mutated hands and fingers:1.5), (long body :1.3),poorly drawn: 1.2), black-white, bad anatomy,liquid body, liquid tongue, disfigured,malformed,mutated, anatomical nonsense, malformed hands, long neck, blurred. lowers, lowers, bad anatomy, bad proportions, bad shadow, uncoordinated body, unnatural body, fused breasts, bad breasts,poorly drawn breasts, extra breasts,missing breasts, huge haunch, huge thighs, huge calf, bad hands, fused hand, missing hand, disappearing a arms, disappearing thigh, disappearing calf, disappearing legs, fused ears, bad ears, poorly drawn ears, extra ears, liquid ears, heavy ears, missing ears, fused animal ears, bad animal ears, poorly drawn animal ears, extra animals ears,liquid animal ears, heavy animal ears, missing animal ears, missing limb, fused fingers, one hand with more than 5 fingers, one hand with less than 5 fingers, one hand with more than 5 digit, one hand with less than 5 digit, extra digit, fewer digits, fused digit, missing digit, bad digit, liquid digit, colorful tongue, black tongue, cropped, watermark, username, blurry, JPEG artifacts, signature,malformed feet, extra feet, bad feet, poorly drawn feet, fused feet, missing feet, extra shoes, bad shoes, fused shoes, more than two shoes, poorly drawn shoes, bad gloves, poorly drawn gloves, fused gloves, bad cum, poorly drawn cum, fused cum, , bad hairs, poorly drawn hairs, fused hairs, big muscles, ugly, bad face, fused face, poorly drawn face, cloned face, big face, long face, bad eyes, fused eyes, poorly drawn eyes, extra eyes, malformed limbs, more than 2 nipples, missing nipples, different nipples, fused nipples, bad nipples, poorly drawn nipples, black nipples, colorful nipples, gross proportions, short arm, (((missing arms))), missing thighs, missing calf,poorly drawn hands, more than 1 left hand, more then 1 right hand, deformed, (blurry), disfigured, missing legs,extra thighs, more than 2 thighs, extra calf, fused calf, bad knee, extra knee, more than 2 legs, bad tails, bad mouth, fused mouth, poorly drawn mouth, bad tongue, tongue within mouth, too long tongue, black tongue, big mouth, cracked mouth, bad mouth, dirty face, dirty teeth,fused pantie, poorly drawn pantie, fused cloth, poorly drawn cloth, bad pantie, yellow teeth, thick lips, bad cameltoe, bad asshole, fused asshole,missing asshole, bad anus,fused anus,bad pussy, bad crotch, bad crotch seam, fused anus, fused pussy, fused anus, fused crotch, poorly drawn cotch, fused seam, poorly drawn anus, poorly drawn pussy, poorly drawn crotch, poorly drawn crotch seam, bad thigh gap, missing thigh gap, fused thigh gap, liquid thigh gap , poorly drawn thigh gap, poorly drawn anus, bad collarbone, strong girl obesity,worst quality,poorly drawn tentacles, split tentacles, missing clit, bad clit, fused clit, colorful clit, black clit,safety knickers, beard, furry, pony, pubic hair, mosaic, excrement, faeces, shit,testis, (worst quality),(bad anatomy),sweat, wet,fangs, watermarks, artist logo, logo, blood on face, (bloody face),((apron)),EasyNegative, paintings, sketches, (worst quality:2), (low quality:2), ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes,(((two girls)))", + "Face restoration": "CodeFormer" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/65e325f7-6ffd-4f6f-3e4a-8254b9427e00/width=450/484845.jpeg", + "nsfw": "Soft", + "width": 512, + "height": 768, + "hash": "UIIEeRwG3G9F9bEN$gnM0fD%-p-oSOV?9aR+", + "meta": { + "Size": "512x768", + "seed": 293435042, + "Model": "chilloutmix_NiPrunedFp32Fix", + "steps": 30, + "hashes": { + "model": "fc2511737a" + }, + "prompt": ",\ngood hand,4k, high-res, masterpiece, best quality, head:1.3,((Hasselblad photography)), finely detailed skin, sharp focus, (cinematic lighting), collarbone, night, soft lighting, dynamic angle, [:(detailed face:1.2):0.2], armpit crease, thigh gap, black clothes, slender, medium breasts, cleavage,(((5 stars hotel pool background))), outside", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "resources": [ + { + "name": "betterCuteAsian03", + "type": "lora", + "weight": 0.3 + }, + { + "hash": "fc2511737a", + "name": "chilloutmix_NiPrunedFp32Fix", + "type": "model" + } + ], + "Model hash": "fc2511737a", + "negativePrompt": "NG_DeepNagetive_V1_75T,(greyscale:1.2),\npaintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans", + "Face restoration": "CodeFormer" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1576dfa7-af83-42e1-e6ce-1ddd7a6a3500/width=450/484840.jpeg", + "nsfw": "Soft", + "width": 768, + "height": 960, + "hash": "UMI=S_|;LNGb0qS~ItRkE2SjjDxsJ;XSWBRj", + "meta": { + "Size": "768x960", + "seed": 3546432641, + "Model": "chilloutmix_NiPrunedFp32Fix", + "steps": 30, + "hashes": { + "model": "fc2511737a" + }, + "prompt": "(8k, RAW photo:1.2),best quality, ultra high res,dramatic angle,(fluttered detailed color splashs), (illustration),(((1 girl))),(long hair),(rain:0.9),(hair ornament:1.4),there is an ancient palace beside the girl,chinese clothes,(focus on), color Ink wash painting,(color splashing),colorful splashing,(((colorful))),(sketch:0.8), Masterpiece,best quality, beautifully painted,highly detailed,(denoising:0.6),[splash ink],((ink refraction)), (beautiful detailed sky),moon,highly,detaild,(masterpiece, best quality, extremely detailed CG unity 8k wallpaper,masterpiece, best quality, ultra-detailed),(Lycoris radiata), , ", + "sampler": "Euler a", + "cfgScale": 4, + "Clip skip": "2", + "resources": [ + { + "name": "koreanDollLikeness_v20", + "type": "lora", + "weight": 0.3 + }, + { + "name": "betterCuteAsian", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "fc2511737a", + "name": "chilloutmix_NiPrunedFp32Fix", + "type": "model" + } + ], + "Model hash": "fc2511737a", + "negativePrompt": "(missing fingers),(bad hands),(bad feets),(ugly),paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans,(((simple background))),monochrome ,lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, lowres, bad anatomy, bad hands, text, error, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, ugly,pregnant,vore,duplicate,morbid,mut ilated,tran nsexual, hermaphrodite,long neck,mutated hands,poorly drawn hands,poorly drawn face,mutation,deformed,blurry,bad anatomy,bad proportions,malformed limbs,extra limbs,cloned face,disfigured,gross proportions, (((missing arms))),(((missing legs))), (((extra arms))),(((extra legs))),pubic hair, plump,bad legs,error legs,username,blurry,bad feet", + "Face restoration": "CodeFormer" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0cfda105-d4be-4cf3-06a4-8a96fe2ce400/width=450/484836.jpeg", + "nsfw": "Soft", + "width": 512, + "height": 512, + "hash": "UKLDu;4TGG%#IpIUIntR.TIAs:of=|OE%Mx]", + "meta": { + "Size": "512x512", + "seed": 1706948608, + "Model": "chilloutmix_NiPrunedFp32Fix", + "steps": 25, + "hashes": { + "model": "fc2511737a" + }, + "prompt": "photo realistic,(1 young beautiful korean girl, laying on a bed in a sexy pose),(wearing sexy lingerie:1.2),(distant gaze:1.2),full accesories,necklace,slim waist,soft makup, instagram (photorealistic, high resolution:1.2), looking at viewer , (cute face:1.15) (8k, RAW photo, best quality, masterpiece:1.2), (realistic, photo-realistic:1.17),(sharp focus:1.2), professional lighting, photon mapping, radiosity, physically-based rendering, (pale skin:1.2),(medium breasts:1.2), blue eyes, (pink hair:1.2), realistic, (masterpiece:1.25),(best quality:1.25),(shiny skin),(red lips, halo makeup:1.15),(skinny,shy :1.2), (sunset light:1.15), outside, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "name": "betterCuteAsian", + "type": "lora", + "weight": 0.4 + }, + { + "hash": "fc2511737a", + "name": "chilloutmix_NiPrunedFp32Fix", + "type": "model" + } + ], + "Model hash": "fc2511737a", + "negativePrompt": "bad-picture-chill-75v EasyNegative (((girls))), NG_DeepNegative_V1_75, (wierd hands, poorly drawn hands:1.2)", + "Face restoration": "CodeFormer" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/44501" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/betterCuteAsian03.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/betterCuteAsian03.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..a6f3694efab7328a9a04737e2d3a5adffa367254 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/betterCuteAsian03.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/betterCuteAsian03.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/betterCuteAsian03.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..954873fc8a9835016152c0a279d858184a1404a8 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/betterCuteAsian03.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:841b95e67ec309fe945b51e86f40fc31d9b567ff3d9a07e6b8cde9950f02cfe9 +size 151233849 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/chinaDollLikeness_v10.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/chinaDollLikeness_v10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..d689dbfe6bdbda5076a6526ace4579605b0c6702 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/chinaDollLikeness_v10.civitai.info" @@ -0,0 +1,421 @@ +{ + "id": 66172, + "modelId": 61675, + "name": "v1.0", + "createdAt": "2023-05-09T07:28:35.805Z", + "updatedAt": "2023-05-09T07:35:41.415Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 369, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "ChinaDollLikeness (v1.0)", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "chinaDollLikeness_v10.safetensors", + "id": 46340, + "sizeKB": 147567.2177734375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-09T07:30:56.321Z", + "hashes": { + "AutoV1": "44C59D4C", + "AutoV2": "4D5BA9A5D9", + "SHA256": "4D5BA9A5D942D25799CC4C62AB3CF81A403512859A62683BCB44F596C204E65A", + "CRC32": "5C606D87", + "BLAKE3": "913855CF0C0D3D9E2B3933D8216780C828D2C958956FDC4DF39FCD5CA0A381C8" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/66172" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/524e2aa7-23cc-40ca-9994-b14db402d5fc/width=450/733706.jpeg", + "nsfw": "Soft", + "width": 896, + "height": 1344, + "hash": "UCH_iL00Pq-;.8%MkWI;0Lxt^kIUx]bbr=%M", + "meta": { + "Size": "512x768", + "seed": 1387974053, + "Model": "chilloutmix_cilloutmixNi", + "steps": 28, + "hashes": { + "model": "7234b76e42" + }, + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, off-shoulder black shirt, skirt, black choker, (faded ash gray hair:1), slim, (huge breasts:1), looking at viewer, closeup ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "resources": [ + { + "name": "chinaDollLikeness_v10", + "type": "lora", + "weight": 0.66 + }, + { + "hash": "7234b76e42", + "name": "chilloutmix_cilloutmixNi", + "type": "model" + } + ], + "Model hash": "7234b76e42", + "Hires steps": "20", + "Hires upscale": "1.75", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans,", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/02ea8414-20ed-4430-8eb9-4ff6078e4b9c/width=450/733720.jpeg", + "nsfw": "Soft", + "width": 896, + "height": 1344, + "hash": "UTJ*9h4n%f$#~VaK.8WC57WA-pkCx]NGIVxa", + "meta": { + "Size": "512x768", + "seed": 3766975706, + "Model": "chilloutmix_cilloutmixNi", + "steps": 28, + "hashes": { + "model": "7234b76e42" + }, + "prompt": "best quality, ultra high res, (photorealistic:1.4), masterpiece, real life skin, hyper real, 1girl, long hair, off-shoulder loose jacket, (large breasts:1), (busty:1), looking at viewer ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "resources": [ + { + "name": "chinaDollLikeness_v10", + "type": "lora", + "weight": 0.66 + }, + { + "hash": "7234b76e42", + "name": "chilloutmix_cilloutmixNi", + "type": "model" + } + ], + "Model hash": "7234b76e42", + "Hires steps": "20", + "Hires upscale": "1.75", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, shiny skin, wet, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/180eef70-4f5e-4f14-b8ba-6b1992d0a360/width=450/733721.jpeg", + "nsfw": "Soft", + "width": 896, + "height": 1344, + "hash": "UCF#gq-R0057E3WYI:IU0L%1~CIV?F9tR:?H", + "meta": { + "Size": "512x768", + "seed": 1178138628, + "Model": "chilloutmix_cilloutmixNi", + "steps": 28, + "hashes": { + "model": "7234b76e42" + }, + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, black off-shoulder shirt, seductive pose, detached sleeves, simple background, cleavage, busty, choker, huge breasts, messy bun, looking at viewer, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "resources": [ + { + "name": "chinaDollLikeness_v10", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "7234b76e42", + "name": "chilloutmix_cilloutmixNi", + "type": "model" + } + ], + "Model hash": "7234b76e42", + "Hires steps": "20", + "Hires upscale": "1.75", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans, nsfw, nipples", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e60aae5b-b6a8-4f89-bcf4-d5e33fdefc15/width=450/733722.jpeg", + "nsfw": "Soft", + "width": 896, + "height": 1344, + "hash": "UDFr6K?H0fRQ4nE10exu00Rj~V%M-pxt9FIU", + "meta": { + "Size": "512x768", + "seed": 2200244930, + "Model": "chilloutmix_cilloutmixNi", + "steps": 28, + "hashes": { + "model": "7234b76e42" + }, + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, black off-shoulder shirt, seductive pose, simple background, detached sleeves, cleavage, busty, choker, huge breasts, messy bun, looking at viewer, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "resources": [ + { + "name": "chinaDollLikeness_v10", + "type": "lora", + "weight": 0.66 + }, + { + "hash": "7234b76e42", + "name": "chilloutmix_cilloutmixNi", + "type": "model" + } + ], + "Model hash": "7234b76e42", + "Hires steps": "20", + "Hires upscale": "1.75", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans, nsfw, nipples", + "Denoising strength": "0.52" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6672be2e-c9ce-4b8f-b66b-d920b3a6c573/width=450/733724.jpeg", + "nsfw": "Soft", + "width": 896, + "height": 1344, + "hash": "ULKJ*:s.0LxuE0R%~p%29_IoaJ-o?GV@Myxu", + "meta": { + "Size": "512x768", + "seed": 2781210247, + "Model": "chilloutmix_cilloutmixNi", + "steps": 28, + "hashes": { + "model": "7234b76e42" + }, + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, white camisole, busty, large breasts, (brown long hair:1), (looking at viewer), (full body), (closeup) ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "resources": [ + { + "name": "chinaDollLikeness_v10", + "type": "lora", + "weight": 0.66 + }, + { + "hash": "7234b76e42", + "name": "chilloutmix_cilloutmixNi", + "type": "model" + } + ], + "Model hash": "7234b76e42", + "Hires steps": "20", + "Hires upscale": "1.75", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, glossy skin, wet, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7d09a9f8-5090-4d04-82d3-643e9fc2c9f6/width=450/733725.jpeg", + "nsfw": "Soft", + "width": 896, + "height": 1344, + "hash": "UBJ*Fy#t00-B00Dk?]RQI;01?asp_4o|4ojZ", + "meta": { + "Size": "512x768", + "seed": 1603419552, + "Model": "chilloutmix_cilloutmixNi", + "steps": 28, + "hashes": { + "model": "7234b76e42" + }, + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, white camisole, busty, huge breasts, (brown long hair:1), (looking at viewer), (full body), (closeup) ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "resources": [ + { + "name": "chinaDollLikeness_v10", + "type": "lora", + "weight": 0.66 + }, + { + "hash": "7234b76e42", + "name": "chilloutmix_cilloutmixNi", + "type": "model" + } + ], + "Model hash": "7234b76e42", + "Hires steps": "20", + "Hires upscale": "1.75", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, glossy skin, wet, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/84ced0c9-04b5-4e2c-b666-7098dd4e9533/width=450/733723.jpeg", + "nsfw": "Soft", + "width": 896, + "height": 1344, + "hash": "ULHeRgD+KPxE00D$NaMx9bt6%1IU~WXAoM%M", + "meta": { + "Size": "512x768", + "seed": 1679624105, + "Model": "chilloutmix_cilloutmixNi", + "steps": 28, + "hashes": { + "model": "7234b76e42" + }, + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, off-shoulder white shirt, black skirt, black choker, (faded ash gray hair:1), (huge breasts:1.2), looking at viewer, closeup ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "resources": [ + { + "name": "chinaDollLikeness_v10", + "type": "lora", + "weight": 0.66 + }, + { + "hash": "7234b76e42", + "name": "chilloutmix_cilloutmixNi", + "type": "model" + } + ], + "Model hash": "7234b76e42", + "Hires steps": "20", + "Hires upscale": "1.75", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans,", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3b40a839-4e39-4856-b2e2-4378bc562639/width=450/733726.jpeg", + "nsfw": "Soft", + "width": 896, + "height": 1344, + "hash": "UBIEX_-oL1kX?v01I;4.%#Mx~WxZ0KE2IAxF", + "meta": { + "Size": "512x768", + "seed": 4268274487, + "Model": "chilloutmix_cilloutmixNi", + "steps": 28, + "hashes": { + "model": "7234b76e42" + }, + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, off-shoulder shirt, black skirt, black choker, (faded ash gray hair:1), (huge breasts:1.2), looking at viewer, closeup ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "resources": [ + { + "name": "chinaDollLikeness_v10", + "type": "lora", + "weight": 0.66 + }, + { + "hash": "7234b76e42", + "name": "chilloutmix_cilloutmixNi", + "type": "model" + } + ], + "Model hash": "7234b76e42", + "Hires steps": "20", + "Hires upscale": "1.75", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans,", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/cf14d206-1f71-4ee5-a89a-6b793667595a/width=450/733728.jpeg", + "nsfw": "Soft", + "width": 896, + "height": 1344, + "hash": "UEJ7:j=^0K4.00~W?uSdOXj=~B%g_3%gjawb", + "meta": { + "Size": "512x768", + "seed": 3488761208, + "Model": "chilloutmix_cilloutmixNi", + "steps": 28, + "hashes": { + "model": "7234b76e42" + }, + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, white dress, busty, huge breasts, slim waist, (brown long hair:1), (looking at viewer), (full body), ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "resources": [ + { + "name": "chinaDollLikeness_v10", + "type": "lora", + "weight": 0.66 + }, + { + "hash": "7234b76e42", + "name": "chilloutmix_cilloutmixNi", + "type": "model" + } + ], + "Model hash": "7234b76e42", + "Hires steps": "20", + "Hires upscale": "1.75", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, glossy skin, wet, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans", + "Denoising strength": "0.5" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a371d4b5-d0ce-49df-82cc-583fd7367b34/width=450/733729.jpeg", + "nsfw": "Soft", + "width": 896, + "height": 1344, + "hash": "UHKmnSi_9uOF009G?bo}.8NH-pxt~p%LIp%2", + "meta": { + "Size": "512x768", + "seed": 1855721279, + "Model": "chilloutmix_cilloutmixNi", + "steps": 28, + "hashes": { + "model": "7234b76e42" + }, + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, white camisole, busty, huge breasts, (brown long hair:1), (looking at viewer), (full body), (closeup) ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "resources": [ + { + "name": "chinaDollLikeness_v10", + "type": "lora", + "weight": 0.66 + }, + { + "hash": "7234b76e42", + "name": "chilloutmix_cilloutmixNi", + "type": "model" + } + ], + "Model hash": "7234b76e42", + "Hires steps": "20", + "Hires upscale": "1.75", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, glossy skin, wet, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans", + "Denoising strength": "0.5" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/66172" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/chinaDollLikeness_v10.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/chinaDollLikeness_v10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..829be9e18834ee7b9501906311f1a83259bd8285 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/chinaDollLikeness_v10.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/chinaDollLikeness_v10.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/chinaDollLikeness_v10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..dea9aee0e0ab906e0c1d4e78a63954f670b47cdc --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/chinaDollLikeness_v10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:4d5ba9a5d942d25799cc4c62ab3cf81a403512859a62683bcb44f596c204e65a +size 151108831 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/cuteAsianFace_v10.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/cuteAsianFace_v10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..f7f5dba8473d44508f26197a1fef13396e811859 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/cuteAsianFace_v10.civitai.info" @@ -0,0 +1,424 @@ +{ + "id": 32215, + "modelId": 26914, + "name": "v1.0", + "createdAt": "2023-03-30T23:43:28.460Z", + "updatedAt": "2023-04-01T06:00:30.059Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "model": { + "name": "Cute Asian Face", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "cuteAsianFace_v10.safetensors", + "id": 26560, + "sizeKB": 147567.2177734375, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-03-30T23:46:00.598Z", + "hashes": { + "AutoV1": "7FFA4440", + "AutoV2": "2F59A428A2", + "SHA256": "2F59A428A216C39D80DD872FF7FB46A557AB1A46FC3EA436B207BF8ADD7C4BDC", + "CRC32": "505D4996", + "BLAKE3": "F8B1E6372E741F7788B670B90B84F8C64D3CD35B4454B98EB0EF958C4F810019" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/32215" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a9726302-43c6-4673-8c81-37fc3c7c0600/width=450/366925.jpeg", + "nsfw": false, + "width": 1024, + "height": 1024, + "hash": "UHIXpx-;~C-pyD_30KE2xtRjjYIU5S$%-;IU", + "meta": { + "Size": "512x512", + "seed": 810743517, + "Model": "Chilloutmix-Ni", + "steps": 20, + "hashes": { + "model": "7234b76e42" + }, + "prompt": "1girl, solo,(best quality),(masterpiece:1.1),(school uniform:1.4),green eyes, dress, looking_at_viewer, neck_ribbon, cute, clear facial skin,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "7234b76e42", + "name": "Chilloutmix-Ni", + "type": "model" + }, + { + "hash": "cdf1a6a72798", + "name": "merge", + "type": "lora", + "weight": null + } + ], + "Model hash": "7234b76e42", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "merge(cdf1a6a72798)", + "Hires upscaler": "Latent", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans, (only body)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.7", + "AddNet Weight B 1": "0.7", + "Denoising strength": "0.7" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/79911098-75dd-418b-6647-ef45c66a5500/width=450/366918.jpeg", + "nsfw": true, + "width": 1024, + "height": 1024, + "hash": "ULFO_w_40KIU?c%ME1Rj9EIAV?WBIURi%1WB", + "meta": { + "Size": "512x512", + "seed": 59801142, + "Model": "Chilloutmix-Ni", + "steps": 20, + "hashes": { + "model": "7234b76e42" + }, + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, solo focus, ((black mini see through dress)), elbow dress, black thighhighs, frills, ribbons, studio background,, (platinum blonde hair:1),floating hair, ((puffy eyes)), looking at viewer, facing front, smiling, laughing, cute, moon light city , clear facial skin", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "7234b76e42", + "name": "Chilloutmix-Ni", + "type": "model" + }, + { + "hash": "cdf1a6a72798", + "name": "merge", + "type": "lora", + "weight": null + } + ], + "Model hash": "7234b76e42", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "merge(cdf1a6a72798)", + "Hires upscaler": "Latent", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans, (only body)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.7", + "AddNet Weight B 1": "0.7", + "Denoising strength": "0.7" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ccdeca6a-be4c-4867-553f-f49c35fef600/width=450/366924.jpeg", + "nsfw": false, + "width": 1024, + "height": 1024, + "hash": "UiJHw0~V%LNbM{t7R*$*R5jaWCWB%gofxaNG", + "meta": { + "Size": "512x512", + "seed": 2868216859, + "Model": "Chilloutmix-Ni", + "steps": 20, + "hashes": { + "model": "7234b76e42" + }, + "prompt": "1girl, solo,(best quality),(masterpiece:1.1),(school uniform:1.4),green eyes, dress, looking_at_viewer, neck_ribbon, cute, clear facial skin,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "7234b76e42", + "name": "Chilloutmix-Ni", + "type": "model" + }, + { + "hash": "cdf1a6a72798", + "name": "merge", + "type": "lora", + "weight": null + } + ], + "Model hash": "7234b76e42", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "merge(cdf1a6a72798)", + "Hires upscaler": "Latent", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans, (only body)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.7", + "AddNet Weight B 1": "0.7", + "Denoising strength": "0.7" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9b4dc946-7a69-424c-d588-34f7a3c29300/width=450/367000.jpeg", + "nsfw": false, + "width": 1024, + "height": 1024, + "hash": "UVIq+H-=_3pI_N%MpItSR5jZD%oLs.XSxGa#", + "meta": { + "Size": "512x512", + "seed": 3752310815, + "Model": "Chilloutmix-Ni", + "steps": 20, + "hashes": { + "model": "7234b76e42" + }, + "prompt": "1girl, solo,(best quality),(masterpiece:1.1),(school uniform:1.4),green eyes, dress, looking_at_viewer, neck_ribbon, cute, clear facial skin,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "7234b76e42", + "name": "Chilloutmix-Ni", + "type": "model" + }, + { + "hash": "cdf1a6a72798", + "name": "merge", + "type": "lora", + "weight": null + } + ], + "Model hash": "7234b76e42", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "merge(cdf1a6a72798)", + "Hires upscaler": "Latent", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans, (only body)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.7", + "AddNet Weight B 1": "0.7", + "Denoising strength": "0.7" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8035ca8b-8817-4fba-e2f2-e388fef31c00/width=450/366923.jpeg", + "nsfw": false, + "width": 1024, + "height": 1024, + "hash": "UPI5f6IA01W=WA8_%MoL00M{_3R*_Nt7niWB", + "meta": { + "Size": "512x512", + "seed": 3909770386, + "Model": "Chilloutmix-Ni", + "steps": 20, + "hashes": { + "model": "7234b76e42" + }, + "prompt": "best quality, ultra high res, 1girl, solo focus, ((white mini see through dress)), elbow dress, black thighhighs, frills, ribbons, studio background,floating hair, looking at viewer, facing front,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "7234b76e42", + "name": "Chilloutmix-Ni", + "type": "model" + }, + { + "hash": "cdf1a6a72798", + "name": "merge", + "type": "lora", + "weight": null + } + ], + "Model hash": "7234b76e42", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "merge(cdf1a6a72798)", + "Hires upscaler": "Latent", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans, (only body)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.7", + "AddNet Weight B 1": "0.7", + "Denoising strength": "0.7" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6b96b227-f18b-4d00-a2bd-11aed554e200/width=450/366922.jpeg", + "nsfw": true, + "width": 1024, + "height": 1024, + "hash": "UIHB**8_00OY.T00?IxuOFD%^+M{^*RjRPM{", + "meta": { + "Size": "512x512", + "seed": 2920395704, + "Model": "Chilloutmix-Ni", + "steps": 20, + "hashes": { + "model": "7234b76e42" + }, + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, full body,bare shoulders, cinematic angle,from behind,thigh gap,cleavage,revealing,see-through,professional lighting,thighhighs,sailor collar,necklace,smile,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "7234b76e42", + "name": "Chilloutmix-Ni", + "type": "model" + }, + { + "hash": "cdf1a6a72798", + "name": "merge", + "type": "lora", + "weight": null + } + ], + "Model hash": "7234b76e42", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "merge(cdf1a6a72798)", + "Hires upscaler": "Latent", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans, (only body)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.7", + "AddNet Weight B 1": "0.7", + "Denoising strength": "0.7" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/580e3a7e-e81a-416f-3859-f5c5d5854300/width=450/366921.jpeg", + "nsfw": true, + "width": 1024, + "height": 1024, + "hash": "UJIE@Vx^py?H_4o~yE-o00Rk9E-=00jEiv%N", + "meta": { + "Size": "512x512", + "seed": 3691405559, + "Model": "Chilloutmix-Ni", + "steps": 20, + "hashes": { + "model": "7234b76e42" + }, + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, solo focus, ((black mini see through dress)), elbow dress, black thighhighs, frills, ribbons, studio background,, (platinum blonde hair:1),floating hair, ((puffy eyes)), looking at viewer, facing front, smiling, laughing, cute, moon light city , clear facial skin", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "7234b76e42", + "name": "Chilloutmix-Ni", + "type": "model" + }, + { + "hash": "cdf1a6a72798", + "name": "merge", + "type": "lora", + "weight": null + } + ], + "Model hash": "7234b76e42", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "merge(cdf1a6a72798)", + "Hires upscaler": "Latent", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans, (only body)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.7", + "AddNet Weight B 1": "0.7", + "Denoising strength": "0.7" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/24828125-26f5-47c5-0595-c816b08e1b00/width=450/366920.jpeg", + "nsfw": true, + "width": 1024, + "height": 1024, + "hash": "UDEn-*0]9*-V6s^nR~kS4--pxrV{E2e-?GIp", + "meta": { + "Size": "512x512", + "seed": 1431867730, + "Model": "Chilloutmix-Ni", + "steps": 20, + "hashes": { + "model": "7234b76e42" + }, + "prompt": "best quality, ultra high res, 1girl, solo focus, ((mini see through dress)), elbow dress, black thighhighs, frills, ribbons, studio background,floating hair, looking at viewer, facing front,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "7234b76e42", + "name": "Chilloutmix-Ni", + "type": "model" + }, + { + "hash": "cdf1a6a72798", + "name": "merge", + "type": "lora", + "weight": null + } + ], + "Model hash": "7234b76e42", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "merge(cdf1a6a72798)", + "Hires upscaler": "Latent", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans, (only body)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.7", + "AddNet Weight B 1": "0.7", + "Denoising strength": "0.7" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e9bc47c8-dc58-4ba7-ff73-57a05fea0b00/width=450/366919.jpeg", + "nsfw": true, + "width": 1024, + "height": 1024, + "hash": "UJE{|c$z00JV_N$%T1I=D%kC$%ae%2SOIAr?", + "meta": { + "Size": "512x512", + "seed": 3457950470, + "Model": "Chilloutmix-Ni", + "steps": 20, + "hashes": { + "model": "7234b76e42" + }, + "prompt": "best quality, wavy hair, ultra high res, (photorealistic:1.4), 1girl, full body,nude,bare shoulders, half body under water,cinematic angle,from behind,thigh gap,cleavage,revealing,see-through,professional lighting,thighhighs,hairband,sailor collar,necklace,smile,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "7234b76e42", + "name": "Chilloutmix-Ni", + "type": "model" + }, + { + "hash": "cdf1a6a72798", + "name": "merge", + "type": "lora", + "weight": null + } + ], + "Model hash": "7234b76e42", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "merge(cdf1a6a72798)", + "Hires upscaler": "Latent", + "negativePrompt": "EasyNegative, paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans,extra fingers,fewer fingers,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.7", + "AddNet Weight B 1": "0.7", + "Denoising strength": "0.7" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/32215" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/cuteAsianFace_v10.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/cuteAsianFace_v10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..d9cad0f97524898c77246b1a1ce8c2ce77ae41fc --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/cuteAsianFace_v10.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:805b7f0bee7535c6d77a51ff02c237c9932c61f5d165e18b5a68258ea94880f6 +size 1471814 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/cuteAsianFace_v10.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/cuteAsianFace_v10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..8d6f6302609ac26db924f1b5523b7404872b1ab9 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/cuteAsianFace_v10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:2f59a428a216c39d80dd872ff7fb46a557ab1a46fc3ea436b207bf8add7c4bdc +size 151108831 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/cuteKoreanGirlLora_cuteKoreanGirlLora.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/cuteKoreanGirlLora_cuteKoreanGirlLora.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..23aba99d97fde4041c2a5e4bb92df6a4b9f52cbd --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/cuteKoreanGirlLora_cuteKoreanGirlLora.civitai.info" @@ -0,0 +1,458 @@ +{ + "id": 26914, + "modelId": 22541, + "name": "Cute Korean Girl-Lora-Yurisa_chan", + "createdAt": "2023-03-21T19:00:16.355Z", + "updatedAt": "2023-03-22T14:29:28.319Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "model": { + "name": "Cute Korean Girl-Lora-Yurisa_chan", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "cuteKoreanGirlLora_cuteKoreanGirlLora.safetensors", + "id": 22295, + "sizeKB": 106071.67578125, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-03-21T19:15:59.953Z", + "hashes": { + "AutoV1": "6C936BD3", + "AutoV2": "431B40B92B", + "SHA256": "431B40B92BD8F0413D67D9EFD9AC2E8E4D14CEFC5FA8D46D1DB73117BB5ECC55", + "CRC32": "9F7D5B54", + "BLAKE3": "6F9F65CD9CE8062736E8CB179D5874A2A3A2350850CA31F2C0DD2AA44523961A" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/26914" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c935065e-bdc7-4568-8ed6-970844a1c700/width=450/296509.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UAIqr.?b2]-;00_N^+?aAFD%~p9F-=%2a0Rk", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3027292230, + "Model": "chilloutmix_Ni", + "steps": 20, + "prompt": "highres,masterpiece,best quality,extremely detailed,1girl, ,full body,", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "7234b76e42", + "name": "chilloutmix_Ni", + "type": "model" + } + ], + "Model hash": "7234b76e42", + "negativePrompt": "(worst quality:2), (low quality:2), lowres, normal quality, skin spots, acnes, skin blemishes, age spot,bad anatomy,missing fingers,deformed,malformed limbs,extra limbs,disfigured,missing arms,missing legs,extra legs,extra finger,", + "ControlNet Model": "control_openpose [b46e25f5]", + "ControlNet Module": "openpose", + "ControlNet Weight": "1", + "ControlNet Enabled": "True", + "ControlNet Guidance Strength": "1" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4ffee1a3-0859-437b-c557-fc8294a45b00/width=450/296502.jpeg", + "nsfw": true, + "width": 768, + "height": 960, + "hash": "UFE2nK0LS}xG9FogIUofI;WB~WNGRjR*E1of", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 146428689, + "Model": "fantasticmixReal_v10", + "steps": 20, + "prompt": "highres,masterpiece,best quality,extremely detailed,nsfw,1girl,city, street,arms behind back, black skirt, red coat, eye focus,", + "sampler": "DDIM", + "cfgScale": 7, + "resources": [ + { + "hash": "6241e42eab", + "name": "fantasticmixReal_v10", + "type": "model" + }, + { + "hash": "5a5ab4f712f4", + "name": "piaolianga", + "type": "lora", + "weight": null + } + ], + "Model hash": "6241e42eab", + "(low quality": "2),lowres,normal quality,skin spots,acnes,skin blemishes,age spot,bad anatomy,missing fingers,deformed,malformed limbs,extra limbs,disfigured,missing arms,missing legs,extra legs,extra finger,\"", + "Hires upscale": "1.5", + "AddNet Enabled": "True", + "AddNet Model 1": "piaolianga(5a5ab4f712f4)", + "Hires upscaler": "ESRGAN_4x", + "negativePrompt": "(worst quality:2),(low quality:2),lowres,normal quality,skin spots,acnes,skin blemishes,age spot,bad anatomy,missing fingers,deformed,malformed limbs,extra limbs,disfigured,missing arms,missing legs,extra legs,extra finger,", + "\"(worst quality": "2)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.7", + "AddNet Weight B 1": "0.7", + "Denoising strength": "0.55" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/fcd03c97-21aa-4ccf-609c-d0f3880a2700/width=450/296514.jpeg", + "nsfw": false, + "width": 1024, + "height": 1536, + "hash": "U8JtuD?H00%f00M|WVWA00-;~qRjITD%%Ln+", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 4042125372, + "Model": "chilloutmix_Ni", + "steps": 20, + "prompt": "highres,masterpiece,best quality,extremely detailed,1girl,large breasts, hands on own breasts, (hanfu,tangstyle)", + "sampler": "DDIM", + "cfgScale": 7, + "resources": [ + { + "hash": "7234b76e42", + "name": "chilloutmix_Ni", + "type": "model" + }, + { + "hash": "f3068f803b8d", + "name": "hanfu_v28", + "type": "lora", + "weight": null + }, + { + "hash": "5a5ab4f712f4", + "name": "000014", + "type": "lora", + "weight": null + } + ], + "Model hash": "7234b76e42", + "(low quality": "2),lowres,normal quality,skin spots,acnes,skin blemishes,age spot,bad anatomy,missing fingers,deformed,malformed limbs,extra limbs,disfigured,missing arms,missing legs,extra legs,extra finger,\"", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "hanfu_v28(f3068f803b8d)", + "AddNet Model 2": "piaolianga-000014(5a5ab4f712f4)", + "Hires upscaler": "Latent", + "negativePrompt": "(worst quality:2),(low quality:2),lowres,normal quality,skin spots,acnes,skin blemishes,age spot,bad anatomy,missing fingers,deformed,malformed limbs,extra limbs,disfigured,missing arms,missing legs,extra legs,extra finger,", + "\"(worst quality": "2)", + "AddNet Module 1": "LoRA", + "AddNet Module 2": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight A 2": "0.5", + "AddNet Weight B 1": "1", + "AddNet Weight B 2": "0.5", + "Denoising strength": "0.7" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d6526f1c-ee6d-475d-f61d-071567a19e00/width=450/296511.jpeg", + "nsfw": true, + "width": 768, + "height": 960, + "hash": "U7F#~|4TC7000gE1~V_2?vIAkXoJ-;Rj-pV@", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 146428684, + "Model": "fantasticmixReal_v10", + "steps": 20, + "prompt": "highres,masterpiece,best quality,extremely detailed,nsfw,1girl,city, street,arms behind back, black skirt, red coat, eye focus,", + "sampler": "DDIM", + "cfgScale": 7, + "resources": [ + { + "hash": "6241e42eab", + "name": "fantasticmixReal_v10", + "type": "model" + }, + { + "hash": "5a5ab4f712f4", + "name": "piaolianga", + "type": "lora", + "weight": null + } + ], + "Model hash": "6241e42eab", + "(low quality": "2),lowres,normal quality,skin spots,acnes,skin blemishes,age spot,bad anatomy,missing fingers,deformed,malformed limbs,extra limbs,disfigured,missing arms,missing legs,extra legs,extra finger,\"", + "Hires upscale": "1.5", + "AddNet Enabled": "True", + "AddNet Model 1": "piaolianga(5a5ab4f712f4)", + "Hires upscaler": "ESRGAN_4x", + "negativePrompt": "(worst quality:2),(low quality:2),lowres,normal quality,skin spots,acnes,skin blemishes,age spot,bad anatomy,missing fingers,deformed,malformed limbs,extra limbs,disfigured,missing arms,missing legs,extra legs,extra finger,", + "\"(worst quality": "2)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.7", + "AddNet Weight B 1": "0.7", + "Denoising strength": "0.55" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/70119804-434f-467e-8000-cd378b39ce00/width=450/296513.jpeg", + "nsfw": false, + "width": 768, + "height": 1152, + "hash": "UCJt#axV00nO00xZR5M{~VIUkD?a%MayxuIU", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1936428961, + "Model": "chilloutmix_Ni", + "steps": 20, + "prompt": "highres,masterpiece,best quality,extremely detailed,1girls,standing,pink absurdly long hair, ((apron lift)),black checkered skirt,white character hood, black bracelet, ankle ribbon, bindi, himawari-san, yamakawa, river, blue sky,", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "7234b76e42", + "name": "chilloutmix_Ni", + "type": "model" + }, + { + "hash": "5a5ab4f712f4", + "name": "000014", + "type": "lora", + "weight": null + } + ], + "Model hash": "7234b76e42", + "Hires upscale": "1.5", + "AddNet Enabled": "True", + "AddNet Model 1": "piaolianga-000014(5a5ab4f712f4)", + "Hires upscaler": "BSRGAN", + "negativePrompt": "(worst quality:2),(low quality:2),lowres,normal quality,skin spots,acnes,skin blemishes,age spot,bad anatomy,missing fingers,deformed,malformed limbs,extra limbs,disfigured,missing arms,missing legs,extra legs,extra finger,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.6", + "AddNet Weight B 1": "0.6", + "Denoising strength": "0.6" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1e5f85f3-ec30-4127-d224-3faad5393100/width=450/296516.jpeg", + "nsfw": false, + "width": 512, + "height": 512, + "hash": "UNHBe_~q9uROJBE2%MIU.8jY%1RjogIUWVRj", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 3317034758, + "Model": "chilloutmix_Ni", + "steps": 20, + "prompt": "highres,masterpiece,best quality,extremely detailed,1girl,", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "7234b76e42", + "name": "chilloutmix_Ni", + "type": "model" + }, + { + "hash": "fea67409eb53", + "name": "000006", + "type": "lora", + "weight": null + } + ], + "Model hash": "7234b76e42", + "AddNet Enabled": "True", + "AddNet Model 1": "piaolianga-000006(fea67409eb53)", + "negativePrompt": "(worst quality:2), (low quality:2), lowres, normal quality, skin spots, acnes, skin blemishes, age spot,bad anatomy,missing fingers,deformed,malformed limbs,extra limbs,disfigured,missing arms,missing legs,extra legs,extra finger,", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.8", + "AddNet Weight B 1": "0.8" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/51daf927-4425-403f-3f2c-ec44f6343700/width=450/296512.jpeg", + "nsfw": false, + "width": 768, + "height": 960, + "hash": "UHEVpPxb_N4ot8aeD*D%-;t7t8oLIojYs:WA", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 2474662668, + "Model": "fantasticmixReal_v10", + "steps": 20, + "prompt": "highres,masterpiece,best quality,extremely detailed,nsfw,1girl,city, street,arms behind back, black skirt, red coat, eye focus,", + "sampler": "DDIM", + "cfgScale": 7, + "resources": [ + { + "hash": "6241e42eab", + "name": "fantasticmixReal_v10", + "type": "model" + }, + { + "hash": "5a5ab4f712f4", + "name": "piaolianga", + "type": "lora", + "weight": null + } + ], + "Model hash": "6241e42eab", + "(low quality": "2),lowres,normal quality,skin spots,acnes,skin blemishes,age spot,bad anatomy,missing fingers,deformed,malformed limbs,extra limbs,disfigured,missing arms,missing legs,extra legs,extra finger,\"", + "Hires upscale": "1.5", + "AddNet Enabled": "True", + "AddNet Model 1": "piaolianga(5a5ab4f712f4)", + "Hires upscaler": "ESRGAN_4x", + "negativePrompt": "(worst quality:2),(low quality:2),lowres,normal quality,skin spots,acnes,skin blemishes,age spot,bad anatomy,missing fingers,deformed,malformed limbs,extra limbs,disfigured,missing arms,missing legs,extra legs,extra finger,", + "\"(worst quality": "2)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.7", + "AddNet Weight B 1": "0.7", + "Denoising strength": "0.55" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b0508411-15ca-4294-6de3-025629f7ed00/width=450/296510.jpeg", + "nsfw": true, + "width": 768, + "height": 960, + "hash": "UAF=UC_300nP9u-p~CM{IoaeIVIV-pWURkj[", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 146428687, + "Model": "fantasticmixReal_v10", + "steps": 20, + "prompt": "highres,masterpiece,best quality,extremely detailed,nsfw,1girl,city, street,arms behind back, black skirt, red coat, eye focus,", + "sampler": "DDIM", + "cfgScale": 7, + "resources": [ + { + "hash": "6241e42eab", + "name": "fantasticmixReal_v10", + "type": "model" + }, + { + "hash": "5a5ab4f712f4", + "name": "piaolianga", + "type": "lora", + "weight": null + } + ], + "Model hash": "6241e42eab", + "(low quality": "2),lowres,normal quality,skin spots,acnes,skin blemishes,age spot,bad anatomy,missing fingers,deformed,malformed limbs,extra limbs,disfigured,missing arms,missing legs,extra legs,extra finger,\"", + "Hires upscale": "1.5", + "AddNet Enabled": "True", + "AddNet Model 1": "piaolianga(5a5ab4f712f4)", + "Hires upscaler": "ESRGAN_4x", + "negativePrompt": "(worst quality:2),(low quality:2),lowres,normal quality,skin spots,acnes,skin blemishes,age spot,bad anatomy,missing fingers,deformed,malformed limbs,extra limbs,disfigured,missing arms,missing legs,extra legs,extra finger,", + "\"(worst quality": "2)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.7", + "AddNet Weight B 1": "0.7", + "Denoising strength": "0.55" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5aa9a21e-0ab6-4f74-3831-b4320d131c00/width=450/296505.jpeg", + "nsfw": true, + "width": 768, + "height": 960, + "hash": "UCE.na?a_NIV4Txt8_xa?bM|?bofNGM{$*D*", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 146428685, + "Model": "fantasticmixReal_v10", + "steps": 20, + "prompt": "highres,masterpiece,best quality,extremely detailed,nsfw,1girl,city, street,arms behind back, black skirt, red coat, eye focus,", + "sampler": "DDIM", + "cfgScale": 7, + "resources": [ + { + "hash": "6241e42eab", + "name": "fantasticmixReal_v10", + "type": "model" + }, + { + "hash": "5a5ab4f712f4", + "name": "piaolianga", + "type": "lora", + "weight": null + } + ], + "Model hash": "6241e42eab", + "(low quality": "2),lowres,normal quality,skin spots,acnes,skin blemishes,age spot,bad anatomy,missing fingers,deformed,malformed limbs,extra limbs,disfigured,missing arms,missing legs,extra legs,extra finger,\"", + "Hires upscale": "1.5", + "AddNet Enabled": "True", + "AddNet Model 1": "piaolianga(5a5ab4f712f4)", + "Hires upscaler": "ESRGAN_4x", + "negativePrompt": "(worst quality:2),(low quality:2),lowres,normal quality,skin spots,acnes,skin blemishes,age spot,bad anatomy,missing fingers,deformed,malformed limbs,extra limbs,disfigured,missing arms,missing legs,extra legs,extra finger,", + "\"(worst quality": "2)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.7", + "AddNet Weight B 1": "0.7", + "Denoising strength": "0.55" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2d2f1748-0bf8-4bd8-0508-a41c4812b500/width=450/296504.jpeg", + "nsfw": false, + "width": 768, + "height": 960, + "hash": "UADSRF~W-:9aD%IU4.WBtRj[%Mxa9as.s:oe", + "meta": { + "ENSD": "31337", + "Size": "512x640", + "seed": 146428686, + "Model": "fantasticmixReal_v10", + "steps": 20, + "prompt": "highres,masterpiece,best quality,extremely detailed,nsfw,1girl,city, street,arms behind back, black skirt, red coat, eye focus,", + "sampler": "DDIM", + "cfgScale": 7, + "resources": [ + { + "hash": "6241e42eab", + "name": "fantasticmixReal_v10", + "type": "model" + }, + { + "hash": "5a5ab4f712f4", + "name": "piaolianga", + "type": "lora", + "weight": null + } + ], + "Model hash": "6241e42eab", + "(low quality": "2),lowres,normal quality,skin spots,acnes,skin blemishes,age spot,bad anatomy,missing fingers,deformed,malformed limbs,extra limbs,disfigured,missing arms,missing legs,extra legs,extra finger,\"", + "Hires upscale": "1.5", + "AddNet Enabled": "True", + "AddNet Model 1": "piaolianga(5a5ab4f712f4)", + "Hires upscaler": "ESRGAN_4x", + "negativePrompt": "(worst quality:2),(low quality:2),lowres,normal quality,skin spots,acnes,skin blemishes,age spot,bad anatomy,missing fingers,deformed,malformed limbs,extra limbs,disfigured,missing arms,missing legs,extra legs,extra finger,", + "\"(worst quality": "2)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.7", + "AddNet Weight B 1": "0.7", + "Denoising strength": "0.55" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/26914" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/cuteKoreanGirlLora_cuteKoreanGirlLora.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/cuteKoreanGirlLora_cuteKoreanGirlLora.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..38a62ae5a0567bea9c929b16fe88ec24966d5730 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/cuteKoreanGirlLora_cuteKoreanGirlLora.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/cuteKoreanGirlLora_cuteKoreanGirlLora.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/cuteKoreanGirlLora_cuteKoreanGirlLora.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..cd6ef74bee019696acb6bc222631cfe2e30f7c36 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/cuteKoreanGirlLora_cuteKoreanGirlLora.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:431b40b92bd8f0413d67d9efd9ac2e8e4d14cefc5fa8d46d1db73117bb5ecc55 +size 108617396 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/cutegirl25d.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/cutegirl25d.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..3b45089f628ecb234efd6623d0298ddc91159117 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/cutegirl25d.civitai.info" @@ -0,0 +1,423 @@ +{ + "id": 99567, + "modelId": 93386, + "name": "v1.0", + "createdAt": "2023-06-19T15:28:50.158Z", + "updatedAt": "2023-06-19T15:32:21.487Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 273, + "ratingCount": 1, + "rating": 5 + }, + "model": { + "name": "Princess Doll Likness", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "cutegirl25d.safetensors", + "id": 69427, + "sizeKB": 73842.9375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-19T15:31:21.747Z", + "hashes": { + "AutoV1": "976A3261", + "AutoV2": "AFA2ADCB40", + "SHA256": "AFA2ADCB401E60A84DF25949E203268C772AFBD1AC3DFA5828A6309369D22974", + "CRC32": "A49328D6", + "BLAKE3": "D22D06A7362BEBD6524FB1C4A11602587715AA331AC2361B24CEFCC5C126B08F" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/99567" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/787be4f1-2b01-4f9e-abc3-33f6d0ff7f09/width=450/1207729.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1920, + "hash": "U6DSdy004._44nxuJCIU0LkDIU?b_4RO={-p", + "meta": { + "VAE": "vae-ft-mse-840000-ema-pruned", + "Size": "1024x1920", + "seed": 1559850767, + "Model": "majicmixreal", + "model": "control_v11f1e_sd15_tile [a371b31b]", + "steps": 30, + "Parser": "Full parser", + "hashes": { + "model": "e4a30e4607" + }, + "prompt": "majic", + "weight": "1", + "Version": "5808b7a", + "sampler": "Euler a", + "cfgScale": 4, + "Clip skip": "1", + "resources": [ + { + "hash": "e4a30e4607", + "name": "majicmixreal", + "type": "model" + }, + { + "hash": "8256cd3ad2e3", + "name": "cutegirl25d", + "type": "lora", + "weight": null + } + ], + "{\"Method\"": "\"Mixture of Diffusers\"", + "\"Upscaler\"": "\"Lanczos\"", + "Model hash": "e4a30e4607", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "tile_resample", + "pixel perfect": "False", + "\"Tile Overlap\"": "16", + "AddNet Enabled": "True", + "AddNet Model 1": "cutegirl25d(8256cd3ad2e3)", + "negativePrompt": "(NSFW:1.4), low quality, worst quality", + "AddNet Module 1": "LoRA", + "starting/ending": "(0, 1)", + "\"Upscale factor\"": "2", + "\"Keep input size\"": "true}", + "\"Tile batch size\"": "8", + "\"Tile tile width\"": "64", + "AddNet Weight A 1": "0.6", + "AddNet Weight B 1": "0.6", + "\"Tile tile height\"": "96", + "Denoising strength": "0.6", + "preprocessor params": "(-1, 1, -1)\"", + "Tiled Diffusion upscaler": "Lanczos", + "Tiled Diffusion scale factor": "2" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c1c17d11-0efb-4d17-b709-aa5ce1b9c312/width=450/1207730.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "UEF$Iu?wD$9FH=ngx^%M00M{%MofkrRkIUNG", + "meta": { + "VAE": "vae-ft-mse-840000-ema-pruned", + "Size": "1024x1536", + "seed": 1862144889, + "Model": "majicmixreal", + "model": "control_v11f1e_sd15_tile [a371b31b]", + "steps": 30, + "Parser": "Full parser", + "hashes": { + "model": "e4a30e4607" + }, + "prompt": "1girl, light smile, shirt with collars, (waist up:1.1), from below, realistic, large breasts,", + "weight": "1", + "Version": "5808b7a", + "sampler": "Euler a", + "cfgScale": 4, + "Clip skip": "1", + "resources": [ + { + "hash": "e4a30e4607", + "name": "majicmixreal", + "type": "model" + }, + { + "hash": "8256cd3ad2e3", + "name": "cutegirl25d", + "type": "lora", + "weight": null + } + ], + "{\"Method\"": "\"Mixture of Diffusers\"", + "\"Upscaler\"": "\"Lanczos\"", + "Model hash": "e4a30e4607", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "tile_resample", + "pixel perfect": "False", + "\"Tile Overlap\"": "16", + "AddNet Enabled": "True", + "AddNet Model 1": "cutegirl25d(8256cd3ad2e3)", + "negativePrompt": "(NSFW:1.4), low quality, worst quality", + "AddNet Module 1": "LoRA", + "starting/ending": "(0, 1)", + "\"Upscale factor\"": "2", + "\"Keep input size\"": "true}", + "\"Tile batch size\"": "8", + "\"Tile tile width\"": "64", + "AddNet Weight A 1": "0.6", + "AddNet Weight B 1": "0.6", + "\"Tile tile height\"": "96", + "Denoising strength": "0.6", + "preprocessor params": "(-1, 1, -1)\"", + "Tiled Diffusion upscaler": "Lanczos", + "Tiled Diffusion scale factor": "2" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7f27e580-0356-4570-be07-03f35a39b2fb/width=450/1207733.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "UGF}~E~qE2Io00RPWVjYIoRjITIUs:M{%2xu", + "meta": { + "VAE": "vae-ft-mse-840000-ema-pruned", + "Size": "1024x1536", + "seed": 2695504989, + "Model": "majicmixreal", + "model": "control_v11f1e_sd15_tile [a371b31b]", + "steps": 30, + "Parser": "Full parser", + "hashes": { + "model": "e4a30e4607" + }, + "prompt": "1girl, solo, breasts, necklace, long hair, jewelry, looking at viewer, cleavage, hair ornament, bangs, grey hair, parted lips, realistic, bare shoulders, wings, lips", + "weight": "1", + "Version": "5808b7a", + "sampler": "Euler a", + "cfgScale": 4, + "Clip skip": "1", + "resources": [ + { + "hash": "e4a30e4607", + "name": "majicmixreal", + "type": "model" + }, + { + "hash": "8256cd3ad2e3", + "name": "cutegirl25d", + "type": "lora", + "weight": null + } + ], + "{\"Method\"": "\"Mixture of Diffusers\"", + "\"Upscaler\"": "\"Lanczos\"", + "Model hash": "e4a30e4607", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "tile_resample", + "pixel perfect": "False", + "\"Tile Overlap\"": "16", + "AddNet Enabled": "True", + "AddNet Model 1": "cutegirl25d(8256cd3ad2e3)", + "negativePrompt": "NSFW, low quality, worst quality", + "AddNet Module 1": "LoRA", + "starting/ending": "(0, 1)", + "\"Upscale factor\"": "2", + "\"Keep input size\"": "true}", + "\"Tile batch size\"": "8", + "\"Tile tile width\"": "64", + "AddNet Weight A 1": "0.6", + "AddNet Weight B 1": "0.6", + "\"Tile tile height\"": "96", + "Denoising strength": "0.6", + "preprocessor params": "(-1, 1, -1)\"", + "Tiled Diffusion upscaler": "Lanczos", + "Tiled Diffusion scale factor": "2" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ad6f3970-b59a-4f48-863c-01cc04d0b605/width=450/1207731.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1536, + "hash": "UFIN?e_NKO5700nMENa~4:IpD%M|$L-UR5sp", + "meta": { + "VAE": "vae-ft-mse-840000-ema-pruned", + "Size": "1024x1536", + "seed": 3284087226, + "Model": "majicmixreal", + "model": "control_v11f1e_sd15_tile [a371b31b]", + "steps": 30, + "Parser": "Full parser", + "hashes": { + "model": "e4a30e4607" + }, + "prompt": "1girl, solo, golden hair, blue eyes, sunlight, outdoors, poolside, hair ornament, breasts, long hair, looking at viewer, cleavage, flower, bare shoulders, hair flower, lips, bangs, dress, white dress, realistic, strapless, medium breasts,", + "weight": "1", + "Version": "5808b7a", + "sampler": "Euler a", + "cfgScale": 4, + "Clip skip": "1", + "resources": [ + { + "hash": "e4a30e4607", + "name": "majicmixreal", + "type": "model" + }, + { + "hash": "8256cd3ad2e3", + "name": "cutegirl25d", + "type": "lora", + "weight": null + } + ], + "{\"Method\"": "\"Mixture of Diffusers\"", + "\"Upscaler\"": "\"Lanczos\"", + "Model hash": "e4a30e4607", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "tile_resample", + "pixel perfect": "False", + "\"Tile Overlap\"": "16", + "AddNet Enabled": "True", + "AddNet Model 1": "cutegirl25d(8256cd3ad2e3)", + "negativePrompt": "NSFW, low quality, worst quality", + "AddNet Module 1": "LoRA", + "starting/ending": "(0, 1)", + "\"Upscale factor\"": "2", + "\"Keep input size\"": "true}", + "\"Tile batch size\"": "8", + "\"Tile tile width\"": "64", + "AddNet Weight A 1": "0.6", + "AddNet Weight B 1": "0.6", + "\"Tile tile height\"": "96", + "Denoising strength": "0.6", + "preprocessor params": "(-1, 1, -1)\"", + "Tiled Diffusion upscaler": "Lanczos", + "Tiled Diffusion scale factor": "2" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c865149c-5ba7-490c-8251-c57de494ee8d/width=450/1207732.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1920, + "hash": "UKHd]X~WNx%M9ED%smWA57WBxa%2%Mt8j]xa", + "meta": { + "VAE": "vae-ft-mse-840000-ema-pruned", + "Size": "1024x1920", + "seed": 1640053433, + "Model": "majicmixreal", + "model": "control_v11f1e_sd15_tile [a371b31b]", + "steps": 30, + "Parser": "Full parser", + "hashes": { + "model": "e4a30e4607" + }, + "prompt": "majic", + "weight": "1", + "Version": "5808b7a", + "sampler": "Euler a", + "cfgScale": 4, + "Clip skip": "1", + "resources": [ + { + "hash": "e4a30e4607", + "name": "majicmixreal", + "type": "model" + }, + { + "hash": "8256cd3ad2e3", + "name": "cutegirl25d", + "type": "lora", + "weight": null + } + ], + "{\"Method\"": "\"Mixture of Diffusers\"", + "\"Upscaler\"": "\"Lanczos\"", + "Model hash": "e4a30e4607", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "tile_resample", + "pixel perfect": "False", + "\"Tile Overlap\"": "16", + "AddNet Enabled": "True", + "AddNet Model 1": "cutegirl25d(8256cd3ad2e3)", + "negativePrompt": "low quality, worst quality", + "AddNet Module 1": "LoRA", + "starting/ending": "(0, 1)", + "\"Upscale factor\"": "2", + "\"Keep input size\"": "true}", + "\"Tile batch size\"": "8", + "\"Tile tile width\"": "64", + "AddNet Weight A 1": "0.6", + "AddNet Weight B 1": "0.6", + "\"Tile tile height\"": "96", + "Denoising strength": "0.6", + "preprocessor params": "(-1, 1, -1)\"", + "Tiled Diffusion upscaler": "Lanczos", + "Tiled Diffusion scale factor": "2" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f8be95d9-83b0-402e-84b3-e09737ea973e/width=450/1207734.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "UFI4#99F9at700%M-;oLt-Rj-Vxu~WWBxaWB", + "meta": { + "VAE": "vae-ft-mse-840000-ema-pruned", + "Size": "1024x1536", + "seed": 623703588, + "Model": "majicmixreal", + "model": "control_v11f1e_sd15_tile [a371b31b]", + "steps": 30, + "Parser": "Full parser", + "hashes": { + "model": "e4a30e4607" + }, + "prompt": "1girl, solo, jewelry, necklace, looking at viewer, long hair, twintails, realistic, bangs, hair ornament, lips, collarbone, closed mouth, brown hair, butterfly hair ornament, white dress, large breasts, breasts, upper body, smile", + "weight": "1", + "Version": "5808b7a", + "sampler": "Euler a", + "cfgScale": 4, + "Clip skip": "1", + "resources": [ + { + "hash": "e4a30e4607", + "name": "majicmixreal", + "type": "model" + }, + { + "hash": "8256cd3ad2e3", + "name": "cutegirl25d", + "type": "lora", + "weight": null + } + ], + "{\"Method\"": "\"Mixture of Diffusers\"", + "\"Upscaler\"": "\"Lanczos\"", + "Model hash": "e4a30e4607", + "resize mode": "Crop and Resize", + "control mode": "Balanced", + "\"preprocessor": "tile_resample", + "pixel perfect": "False", + "\"Tile Overlap\"": "16", + "AddNet Enabled": "True", + "AddNet Model 1": "cutegirl25d(8256cd3ad2e3)", + "negativePrompt": "NSFW, low quality, worst quality,", + "AddNet Module 1": "LoRA", + "starting/ending": "(0, 1)", + "\"Upscale factor\"": "2", + "\"Keep input size\"": "true}", + "\"Tile batch size\"": "8", + "\"Tile tile width\"": "64", + "AddNet Weight A 1": "0.6", + "AddNet Weight B 1": "0.6", + "\"Tile tile height\"": "96", + "Denoising strength": "0.6", + "preprocessor params": "(-1, 1, -1)\"", + "Tiled Diffusion upscaler": "Lanczos", + "Tiled Diffusion scale factor": "2" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/99567" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/cutegirl25d.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/cutegirl25d.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..fadb333f8095a2a14e365a36bbbed078ff0ff43b Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/cutegirl25d.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/cutegirl25d.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/cutegirl25d.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..767816fc6c196629e2a04c47806cfeb4bfe4ee65 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/cutegirl25d.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:afa2adcb401e60a84df25949e203268c772afbd1ac3dfa5828a6309369d22974 +size 75615168 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/eastasiandolllikenes_v5.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/eastasiandolllikenes_v5.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..2a78de97b4793eae534f7f68215924078e422c1e --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/eastasiandolllikenes_v5.civitai.info" @@ -0,0 +1,351 @@ +{ + "id": 32382, + "modelId": 19495, + "name": "v5", + "createdAt": "2023-03-31T08:16:01.432Z", + "updatedAt": "2023-03-31T09:05:33.880Z", + "trainedWords": [ + "1girl" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

more realistic, like real person, natural shade, three-dimensional face.

", + "model": { + "name": "EastAsianDollLikeness", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "eastasiandolllikenes_v5.safetensors", + "id": 26680, + "sizeKB": 73844.6953125, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-03-31T08:20:56.654Z", + "hashes": { + "AutoV1": "A34DCE37", + "AutoV2": "872A48B01F", + "SHA256": "872A48B01FFEDA538D111648A053F81A0679ADC76E990CC5E2D2A29E15E5B189", + "CRC32": "73D931A1", + "BLAKE3": "F114FF09A9FEB8DCF241F2047DDAD42E951FFAEA86661EC9EDEB778CA8D37F4A" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/32382" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/bdde42bc-68a7-4cf3-da50-838782f3da00/width=450/368827.jpeg", + "nsfw": false, + "width": 512, + "height": 768, + "hash": "U8M%ZYMx0f_N00_200M_?@%gD40KC7WA*0XT", + "meta": { + "Size": "512x768", + "seed": 2167771175, + "Model": "chilloutmix_NiPrunedFp32Fix", + "steps": 35, + "hashes": { + "model": "fc2511737a" + }, + "prompt": "\n(8k, RAW photo, best quality, masterpiece:1.2), High detail RAW color photo, professional photograph, cowboyshot, (realistic, photo realistic:1.37), ((best quality)), \n1girl, cinematic light, (finerly detailed face:1.2), (masterpiece:1.5), (best quality:1.2), (smiling:1.2), (looking at viewer:1.2), nsfw, short hair, blonde hair,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "resources": [ + { + "name": "EastAsianDollLikeness_v50", + "type": "lora", + "weight": 1 + }, + { + "hash": "fc2511737a", + "name": "chilloutmix_NiPrunedFp32Fix", + "type": "model" + } + ], + "Model hash": "fc2511737a", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, manboobs, (backlight:1.2), double navel, mutad arms, hused arms, neck lace, analog, analog effects, (sunglass:1.4), nipples, nsfw, bad architecture" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/762b44ac-44bd-45ea-859f-7c451e370c00/width=450/368826.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "URJHm?T1K~-=osOH?G$zOvnj=rR.~oNfTLIp", + "meta": { + "Size": "512x768", + "seed": 2181622648, + "Model": "chilloutmix_NiPrunedFp32Fix", + "steps": 35, + "hashes": { + "model": "fc2511737a" + }, + "prompt": "\n(8k, RAW photo, best quality, masterpiece:1.2), High detail RAW color photo, professional photograph, (realistic, photo realistic:1.37), ((best quality)), \n1girl, cinematic light, (finerly detailed face:1.2), (masterpiece:1.5), (best quality:1.2), (looking at viewer:1.2), outdoor, full body, cityscape, wet", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "name": "EastAsianDollLikeness_v50", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "fc2511737a", + "name": "chilloutmix_NiPrunedFp32Fix", + "type": "model" + } + ], + "Model hash": "fc2511737a", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, manboobs, (backlight:1.2), double navel, mutad arms, hused arms, neck lace, analog, analog effects, (sunglass:1.4), nipples, nsfw, bad architecture" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/00fa20e0-7e5f-4a2f-0c2e-775ce4d6f500/width=450/368825.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UEHLh$4:0w~A00xH-Wbp^gIo?Job?@t3R%Rj", + "meta": { + "Size": "512x768", + "seed": 1282405633, + "Model": "chilloutmix_NiPrunedFp32Fix", + "steps": 35, + "hashes": { + "model": "fc2511737a" + }, + "prompt": "\n(8k, RAW photo, best quality, masterpiece:1.2), High detail RAW color photo, professional photograph, (realistic, photo realistic:1.37), ((best quality)), \n1girl, cinematic light, (finerly detailed face:1.2), (masterpiece:1.5), (best quality:1.2), (looking at viewer:1.2), outdoor, full body, cityscape, wet", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "name": "EastAsianDollLikeness_v50", + "type": "lora", + "weight": 0.5 + }, + { + "hash": "fc2511737a", + "name": "chilloutmix_NiPrunedFp32Fix", + "type": "model" + } + ], + "Model hash": "fc2511737a", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, manboobs, (backlight:1.2), double navel, mutad arms, hused arms, neck lace, analog, analog effects, (sunglass:1.4), nipples, nsfw, bad architecture" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e5981981-aafb-4b68-51e4-818f4c17fe00/width=450/368824.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UKKU7n.9qD_NInXU5Rsm9|^R$4D%S#SdsobE", + "meta": { + "Size": "512x768", + "seed": 1282709258, + "Model": "chilloutmix_NiPrunedFp32Fix", + "steps": 35, + "hashes": { + "model": "fc2511737a" + }, + "prompt": "\n(8k, RAW photo, best quality, masterpiece:1.2), High detail RAW color photo, professional photograph, (realistic, photo realistic:1.37), ((best quality)), \n1girl, cinematic light, (finerly detailed face:1.2), (masterpiece:1.5), (best quality:1.2), (looking at viewer:1.2), outdoor, fullbody, cityscape, wet", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "resources": [ + { + "name": "EastAsianDollLikeness_v50", + "type": "lora", + "weight": 1 + }, + { + "hash": "fc2511737a", + "name": "chilloutmix_NiPrunedFp32Fix", + "type": "model" + } + ], + "Model hash": "fc2511737a", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, manboobs, (backlight:1.2), double navel, mutad arms, hused arms, neck lace, analog, analog effects, (sunglass:1.4), nipples, nsfw, bad architecture, nsfw," + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f1808d97-8dab-41ab-c7f3-58f443dae200/width=450/368823.jpeg", + "nsfw": false, + "width": 512, + "height": 768, + "hash": "UDG8yC0LyX=#GGNW-pMy~p9E9H4:0f$_=ySw", + "meta": { + "Size": "512x768", + "seed": 1965143487, + "Model": "chilloutmix_NiPrunedFp32Fix", + "steps": 35, + "hashes": { + "model": "fc2511737a" + }, + "prompt": "\n(8k, RAW photo, best quality, masterpiece:1.2), High detail RAW color photo, professional photograph, (realistic, photo realistic:1.37), ((best quality)), \n1girl, cinematic light, (finerly detailed face:1.2), (masterpiece:1.5), (best quality:1.2), (looking at viewer:1.2), outdoor, full body, cityscape, (((black sundress with round neck,white T-shirt bottom))),", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "name": "EastAsianDollLikeness_v50", + "type": "lora", + "weight": 0.5 + }, + { + "hash": "fc2511737a", + "name": "chilloutmix_NiPrunedFp32Fix", + "type": "model" + } + ], + "Model hash": "fc2511737a", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, manboobs, (backlight:1.2), double navel, mutad arms, hused arms, neck lace, analog, analog effects, (sunglass:1.4), nipples, nsfw, bad architecture" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c7b06001-c979-4c5e-eab4-ad155eeeda00/width=450/368822.jpeg", + "nsfw": false, + "width": 512, + "height": 768, + "hash": "UAE:6ytGu3DPuFITI:rx^+-@00%h008y#AIU", + "meta": { + "Size": "512x768", + "seed": 848209291, + "Model": "chilloutmix_NiPrunedFp32Fix", + "steps": 35, + "hashes": { + "model": "fc2511737a" + }, + "prompt": "\n(8k, RAW photo, best quality, masterpiece:1.2), High detail RAW color photo, professional photograph, (realistic, photo realistic:1.37), ((best quality)), \n1girl, cinematic light, (finerly detailed face:1.2), (masterpiece:1.5), (best quality:1.2), (looking at viewer:1.2), outdoor, full body, cityscape, casual wear", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "name": "EastAsianDollLikeness_v50", + "type": "lora", + "weight": 0.4 + }, + { + "hash": "fc2511737a", + "name": "chilloutmix_NiPrunedFp32Fix", + "type": "model" + } + ], + "Model hash": "fc2511737a", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, manboobs, (backlight:1.2), double navel, mutad arms, hused arms, neck lace, analog, analog effects, (sunglass:1.4), bad architecture, nipples, nsfw," + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d4da727a-d92c-4f30-fed4-9d3b691bff00/width=450/368821.jpeg", + "nsfw": false, + "width": 512, + "height": 768, + "hash": "USHL-%-pIm%h-:XAIpoL?Fx^S%aJ.Tt7$fIn", + "meta": { + "Size": "512x768", + "seed": 3259837457, + "Model": "chilloutmix_NiPrunedFp32Fix", + "steps": 35, + "hashes": { + "model": "fc2511737a" + }, + "prompt": "\n(8k, RAW photo, best quality, masterpiece:1.2), High detail RAW color photo, professional photograph, (realistic, photo realistic:1.37), ((best quality)), \n1girl, cinematic light, (finerly detailed face:1.2), (masterpiece:1.5), (best quality:1.2), (looking at viewer:1.2), outdoor, full body, cityscape, casual wear", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "name": "EastAsianDollLikeness_v50", + "type": "lora", + "weight": 0.5 + }, + { + "hash": "fc2511737a", + "name": "chilloutmix_NiPrunedFp32Fix", + "type": "model" + } + ], + "Model hash": "fc2511737a", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, manboobs, (backlight:1.2), double navel, mutad arms, hused arms, neck lace, analog, analog effects, (sunglass:1.4), nipples, nsfw, bad architecture" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/567d690f-7399-489b-a1a4-2962d1806f00/width=450/368820.jpeg", + "nsfw": false, + "width": 512, + "height": 768, + "hash": "ULK,~myX0|%e5ht89FWCI.xv-qi|~Xozt7Sd", + "meta": { + "Size": "512x768", + "seed": 1540557530, + "Model": "chilloutmix_NiPrunedFp32Fix", + "steps": 30, + "hashes": { + "model": "fc2511737a" + }, + "prompt": "best quality, masterpiece, 1girl, looking at viewer, solo, realistic, photorealistic, blonde hair, short hair, hanfu dress, japanese traditional architecture,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "fc2511737a", + "name": "chilloutmix_NiPrunedFp32Fix", + "type": "model" + }, + { + "hash": "6cd290e7cbfa", + "name": "EastAsianDollLikeness_v50", + "type": "lora", + "weight": null + } + ], + "Model hash": "fc2511737a", + "AddNet Enabled": "True", + "AddNet Model 1": "EastAsianDollLikeness_v50(6cd290e7cbfa)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, manboobs, (backlight:1.2), double navel, mutad arms, hused arms, neck lace, analog, analog effects, (sunglass:1.4), nipples, nsfw, bad architecture", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/72a8675d-d041-4156-c3ae-944867e30400/width=450/368819.jpeg", + "nsfw": false, + "width": 512, + "height": 768, + "hash": "ULGIfk4mTc=uyWE0MwI@PWrpwcIV~VRiE1oz", + "meta": { + "Size": "512x768", + "seed": 1282405632, + "Model": "chilloutmix_NiPrunedFp32Fix", + "steps": 35, + "hashes": { + "model": "fc2511737a" + }, + "prompt": "\n(8k, RAW photo, best quality, masterpiece:1.2), High detail RAW color photo, professional photograph, (realistic, photo realistic:1.37), ((best quality)), \n1girl, cinematic light, (finerly detailed face:1.2), (masterpiece:1.5), (best quality:1.2), (looking at viewer:1.2), outdoor, full body, cityscape, wet", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "name": "EastAsianDollLikeness_v50", + "type": "lora", + "weight": 0.5 + }, + { + "hash": "fc2511737a", + "name": "chilloutmix_NiPrunedFp32Fix", + "type": "model" + } + ], + "Model hash": "fc2511737a", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, manboobs, (backlight:1.2), double navel, mutad arms, hused arms, neck lace, analog, analog effects, (sunglass:1.4), nipples, nsfw, bad architecture" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/32382" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/eastasiandolllikenes_v5.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/eastasiandolllikenes_v5.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..9b4e39b21bb328126a8180b9fb4f03a8751940f8 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/eastasiandolllikenes_v5.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/eastasiandolllikenes_v5.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/eastasiandolllikenes_v5.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..19faf770bca6d18e0ee3de7705a2840db7647693 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/eastasiandolllikenes_v5.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:872a48b01ffeda538d111648a053f81a0679adc76e990cc5e2d2a29e15e5b189 +size 75616968 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/fashigirl-v5.5-lora-naivae-64dim.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/fashigirl-v5.5-lora-naivae-64dim.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..0be7837cb1c64a8d44ebe48bc92aceffc31ce045 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/fashigirl-v5.5-lora-naivae-64dim.civitai.info" @@ -0,0 +1,540 @@ +{ + "id": 67935, + "modelId": 8217, + "name": "v5.5", + "createdAt": "2023-05-11T12:13:37.788Z", + "updatedAt": "2023-05-11T12:17:43.435Z", + "trainedWords": [ + "fashi-girl", + "red lips", + "mature female", + "makeup" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

Update dataset. Adjust trigger tag to 'fashi-girl'.

", + "stats": { + "downloadCount": 69, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "\u3010Character / Art Style\u3011Fashion Girl", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "fashigirl-v5.5-lora-naivae-64dim.safetensors", + "id": 47523, + "sizeKB": 73849.7109375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-11T12:21:07.734Z", + "hashes": { + "AutoV1": "3FF1B753", + "AutoV2": "19CB180BF1", + "SHA256": "19CB180BF15D2EB384255C8E7E5FF6797625CA9A7E700435CD114606A42C93B6", + "CRC32": "28DD0EFA", + "BLAKE3": "E2107462B8D81CCA619BBE0A04802B6D932F26614822F10C8DB907408D1BDB8B" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/67935" + }, + { + "name": "fashigirl-v5.5-lora-naivae-64dim.safetensors", + "id": 47522, + "sizeKB": 73849.7109375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-11T12:16:21.525Z", + "hashes": { + "AutoV1": "3FF1B753", + "AutoV2": "19CB180BF1", + "SHA256": "19CB180BF15D2EB384255C8E7E5FF6797625CA9A7E700435CD114606A42C93B6", + "CRC32": "28DD0EFA", + "BLAKE3": "E2107462B8D81CCA619BBE0A04802B6D932F26614822F10C8DB907408D1BDB8B" + }, + "primary": false, + "downloadUrl": "https://civitai.com/api/download/models/67935?type=Model&format=SafeTensor" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/01115d0d-cd92-4685-8cec-67cf8a6e50f6/width=450/756403.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "UHJ?vx00AtkWy=0e$%t64.M{R6o#sDRQ-:-V", + "meta": { + "RNG": "CPU", + "ENSD": "31337", + "Size": "640x960", + "seed": 2475821707, + "Model": "Yesmix-v1-6-original", + "steps": 30, + "hashes": { + "model": "3e9211917c" + }, + "prompt": "1girl, bare shoulders, black hair, brown hair, chinese clothes, dress, facial mark, fashi-girl, forehead mark, hair ornament, long hair, looking at viewer, red dress, solo, upper body,mature female,milf,graceful,navel,narrow waist,wide hips,large breasts,shiny,shiny skin", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "hash": "3e9211917c", + "name": "Yesmix-v1-6-original", + "type": "model" + }, + { + "hash": "2dda5ffaa304", + "name": "64dim", + "type": "lora", + "weight": null + } + ], + "Model hash": "3e9211917c", + "Hires steps": "30", + "Hires upscale": "1.6", + "AddNet Enabled": "True", + "AddNet Model 1": "fashigirl-v5.5-lora-naivae-64dim(2dda5ffaa304)", + "Hires upscaler": "Latent", + "negativePrompt": "(low quality:1.3), (worst quality:1.3),(monochrome:0.8),(deformed:1.3),(malformed hands:1.4),(poorly drawn hands:1.4),(mutated fingers:1.4),(bad anatomy:1.3),(extra limbs:1.35),(poorly drawn face:1.4),(watermark:1.3)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.7", + "AddNet Weight B 1": "0.7", + "Denoising strength": "0.6" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/683a022a-11ce-46f7-9bef-d5b628606688/width=450/756406.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "UMO3hC}@EftRKQIAozI:%hDiM{s.ELjF%MkW", + "meta": { + "RNG": "CPU", + "ENSD": "31337", + "Size": "640x960", + "seed": 2839576454, + "Model": "Yesmix-v1-6-original", + "steps": 30, + "hashes": { + "model": "3e9211917c" + }, + "prompt": "1girl, animal, bare shoulders, blue eyes, building, castle, dress, earrings, fashi-girl, jewelry, long hair, looking at viewer, outdoors, closed mouth, white hair, princess, sky, solo, tiara, tiger, white dress, white tiger,mature female,alluring,regal,imperious,imperial,large breasts,cleavage,portrait", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "hash": "3e9211917c", + "name": "Yesmix-v1-6-original", + "type": "model" + }, + { + "hash": "2dda5ffaa304", + "name": "64dim", + "type": "lora", + "weight": null + } + ], + "Model hash": "3e9211917c", + "Hires steps": "30", + "Hires upscale": "1.6", + "AddNet Enabled": "True", + "AddNet Model 1": "fashigirl-v5.5-lora-naivae-64dim(2dda5ffaa304)", + "Hires upscaler": "Latent", + "negativePrompt": "(low quality:1.3), (worst quality:1.3),(monochrome:0.8),(deformed:1.3),(malformed hands:1.4),(poorly drawn hands:1.4),(mutated fingers:1.4),(bad anatomy:1.3),(extra limbs:1.35),(poorly drawn face:1.4),(watermark:1.3)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.7", + "AddNet Weight B 1": "0.7", + "Denoising strength": "0.6" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1fc12c26-5c6d-496e-a4eb-f962f7493588/width=450/756402.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "UDEVd5KR4:?v~WE100?H4.MwaJt79s-otRIo", + "meta": { + "RNG": "CPU", + "ENSD": "31337", + "Size": "640x960", + "seed": 3055194186, + "Model": "Yesmix-v1-6-original", + "steps": 30, + "hashes": { + "model": "3e9211917c" + }, + "prompt": "1girl, bangs, white hair, blue eyes, fashi-girl,bob cut,short hair, cleavage, collarbone, open jacket,mecha,cyberpunk,neon lights,large breasts,mature female,shiny skin,rain,water drop,badass,alluring", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "hash": "3e9211917c", + "name": "Yesmix-v1-6-original", + "type": "model" + }, + { + "hash": "2dda5ffaa304", + "name": "64dim", + "type": "lora", + "weight": null + } + ], + "Model hash": "3e9211917c", + "Hires steps": "30", + "Hires upscale": "1.6", + "AddNet Enabled": "True", + "AddNet Model 1": "fashigirl-v5.5-lora-naivae-64dim(2dda5ffaa304)", + "Hires upscaler": "Latent", + "negativePrompt": "(low quality:1.3), (worst quality:1.3),(monochrome:0.8),(deformed:1.3),(malformed hands:1.4),(poorly drawn hands:1.4),(mutated fingers:1.4),(bad anatomy:1.3),(extra limbs:1.35),(poorly drawn face:1.4),(watermark:1.3)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.7", + "AddNet Weight B 1": "0.7", + "Denoising strength": "0.6" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5ff616e8-4adc-4b9e-94d6-ef6957b3e2b9/width=450/756401.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "UDI50.0100~Vp0~D4T-p9]WV^kIV-;IoIUIn", + "meta": { + "RNG": "CPU", + "ENSD": "31337", + "Size": "640x960", + "seed": 47988751, + "Model": "Yesmix-v1-6-original", + "steps": 30, + "hashes": { + "model": "3e9211917c" + }, + "prompt": "1girl, bangs, white hair, blue eyes, fashi-girl,bob cut,short hair, cleavage, collarbone, open jacket,mecha,cyberpunk,neon lights,large breasts,mature female,shiny skin,rain,water drop,badass,alluring,mecha musume,ghost in the shell,red lips,looking to the side,closed mouth,headphones,cinematic lighting", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "hash": "3e9211917c", + "name": "Yesmix-v1-6-original", + "type": "model" + }, + { + "hash": "2dda5ffaa304", + "name": "64dim", + "type": "lora", + "weight": null + } + ], + "Model hash": "3e9211917c", + "Hires steps": "30", + "Hires upscale": "1.6", + "AddNet Enabled": "True", + "AddNet Model 1": "fashigirl-v5.5-lora-naivae-64dim(2dda5ffaa304)", + "Hires upscaler": "Latent", + "negativePrompt": "(low quality:1.3), (worst quality:1.3),(monochrome:0.8),(deformed:1.3),(malformed hands:1.4),(poorly drawn hands:1.4),(mutated fingers:1.4),(bad anatomy:1.3),(extra limbs:1.35),(poorly drawn face:1.4),(watermark:1.3)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.7", + "AddNet Weight B 1": "0.7", + "Denoising strength": "0.6" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6a1441df-7a7c-4fca-849c-de472a841fbe/width=450/756404.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "UGHT~w_3S0%LNrMy~BR,000fr=Mx?G%2xZ%2", + "meta": { + "RNG": "CPU", + "ENSD": "31337", + "Size": "640x960", + "seed": 262373050, + "Model": "Yesmix-v1-6-original", + "steps": 30, + "hashes": { + "model": "3e9211917c" + }, + "prompt": "1girl,large breasts,shiny skin,fashi-girl,milf,mature female,china dress, red dress,wavy hair,fur coat,upper body,black hair,graceful and comely,red eyes, hand on own stomach,forehead mark,narrow waist, wide hips", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "hash": "3e9211917c", + "name": "Yesmix-v1-6-original", + "type": "model" + }, + { + "hash": "2dda5ffaa304", + "name": "64dim", + "type": "lora", + "weight": null + } + ], + "Model hash": "3e9211917c", + "Hires steps": "30", + "Hires upscale": "1.6", + "AddNet Enabled": "True", + "AddNet Model 1": "fashigirl-v5.5-lora-naivae-64dim(2dda5ffaa304)", + "Hires upscaler": "Latent", + "negativePrompt": "(low quality:1.3), (worst quality:1.3),(monochrome:0.8),(deformed:1.3),(malformed hands:1.4),(poorly drawn hands:1.4),(mutated fingers:1.4),(bad anatomy:1.3),(extra limbs:1.35),(poorly drawn face:1.4),(watermark:1.3)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.7", + "AddNet Weight B 1": "0.7", + "Denoising strength": "0.6" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a80a28cc-dc8a-47ae-b863-0d6125cc5c88/width=450/756412.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "UAHBuT010g?a4oS$4:~p00Vtrsn4-nIAs:%f", + "meta": { + "RNG": "CPU", + "ENSD": "31337", + "Size": "640x960", + "seed": 697695951, + "Model": "Yesmix-v1-6-original", + "steps": 30, + "hashes": { + "model": "3e9211917c" + }, + "prompt": "1girl, black hair, brown hair, closed mouth, fashi-girl, long hair, looking at viewer, pointy ears, solo, navel,midriff,very long hair,shiny,shiny skin,mature female,milf,narrow waist,wide hips,large breasts,head wreath,seductive smile,elf,dancing,cleavage", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "hash": "3e9211917c", + "name": "Yesmix-v1-6-original", + "type": "model" + }, + { + "hash": "2dda5ffaa304", + "name": "64dim", + "type": "lora", + "weight": null + } + ], + "Model hash": "3e9211917c", + "Hires steps": "30", + "Hires upscale": "1.6", + "AddNet Enabled": "True", + "AddNet Model 1": "fashigirl-v5.5-lora-naivae-64dim(2dda5ffaa304)", + "Hires upscaler": "Latent", + "negativePrompt": "(low quality:1.3), (worst quality:1.3),(monochrome:0.8),(deformed:1.3),(malformed hands:1.4),(poorly drawn hands:1.4),(mutated fingers:1.4),(bad anatomy:1.3),(extra limbs:1.35),(poorly drawn face:1.4),(watermark:1.3)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.7", + "AddNet Weight B 1": "0.7", + "Denoising strength": "0.6" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a060e872-dc08-4c18-bacd-1cc552db304c/width=450/756407.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UKIqcN-U0K%LoaE2D*-o~pIoMx?G?GxaD%WB", + "meta": { + "RNG": "CPU", + "ENSD": "31337", + "Size": "640x960", + "seed": 2311336705, + "Model": "Yesmix-v1-6-original", + "steps": 30, + "hashes": { + "model": "3e9211917c" + }, + "prompt": "1girl, black hair, blood, blood on face, brown eyes, brown hair, candle, closed mouth, cross, cross earrings, cross necklace, earrings, fashi-girl, hairband, jewelry, latin cross, long hair, looking at viewer, nun, red lips, solo, upper body,mature female", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "hash": "3e9211917c", + "name": "Yesmix-v1-6-original", + "type": "model" + }, + { + "hash": "2dda5ffaa304", + "name": "64dim", + "type": "lora", + "weight": null + } + ], + "Model hash": "3e9211917c", + "Hires steps": "30", + "Hires upscale": "1.6", + "AddNet Enabled": "True", + "AddNet Model 1": "fashigirl-v5.5-lora-naivae-64dim(2dda5ffaa304)", + "Hires upscaler": "Latent", + "negativePrompt": "(low quality:1.3), (worst quality:1.3),(monochrome:0.8),(deformed:1.3),(malformed hands:1.4),(poorly drawn hands:1.4),(mutated fingers:1.4),(bad anatomy:1.3),(extra limbs:1.35),(poorly drawn face:1.4),(watermark:1.3)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.7", + "AddNet Weight B 1": "0.7", + "Denoising strength": "0.6" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5e96ac18-ecb1-411f-9b3f-294049fa4db7/width=450/756409.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "U7N0k{0000XR.m-Ofhkq174T^jxZE3-5a0H@", + "meta": { + "RNG": "CPU", + "ENSD": "31337", + "Size": "640x960", + "seed": 995769562, + "Model": "Yesmix-v1-6-original", + "steps": 30, + "hashes": { + "model": "3e9211917c" + }, + "prompt": "1girl, animal, bare shoulders, blue eyes, building, castle, dress, earrings, fashi-girl, jewelry, long hair, looking at viewer, outdoors, closed mouth, white hair, princess, sky, solo, tiara, tiger, white dress, white tiger,mature female,alluring,regal,imperious,imperial,large breasts,cleavage,portrait,classical letterboxed", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "hash": "3e9211917c", + "name": "Yesmix-v1-6-original", + "type": "model" + }, + { + "hash": "2dda5ffaa304", + "name": "64dim", + "type": "lora", + "weight": null + } + ], + "Model hash": "3e9211917c", + "Hires steps": "30", + "Hires upscale": "1.6", + "AddNet Enabled": "True", + "AddNet Model 1": "fashigirl-v5.5-lora-naivae-64dim(2dda5ffaa304)", + "Hires upscaler": "Latent", + "negativePrompt": "(low quality:1.3), (worst quality:1.3),(monochrome:0.8),(deformed:1.3),(malformed hands:1.4),(poorly drawn hands:1.4),(mutated fingers:1.4),(bad anatomy:1.3),(extra limbs:1.35),(poorly drawn face:1.4),(watermark:1.3)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.7", + "AddNet Weight B 1": "0.7", + "Denoising strength": "0.6" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2c591a22-010d-478d-ac65-eb3f091549a9/width=450/756408.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "UVLW|tV??^NGt6%Ms.j[xutRs:ae_3t7^+t7", + "meta": { + "RNG": "CPU", + "ENSD": "31337", + "Size": "640x960", + "seed": 924018991, + "Model": "Yesmix-v1-6-original", + "steps": 30, + "hashes": { + "model": "3e9211917c" + }, + "prompt": "1girl, animification, arm up, black choker, black hair, black pants, brown eyes, choker, crop top, fashi-girl, hair behind ear, hand on own head, jewelry, long hair, looking at viewer, midriff, o-ring, pants, ponytail, shirt, solo, white background,mature female,narrow waist,shiny skin,wide hips,large breasts,cleavage,badass,fashionable,chic,high ponytail,smile,jeans", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "hash": "3e9211917c", + "name": "Yesmix-v1-6-original", + "type": "model" + }, + { + "hash": "2dda5ffaa304", + "name": "64dim", + "type": "lora", + "weight": null + } + ], + "Model hash": "3e9211917c", + "Hires steps": "30", + "Hires upscale": "1.6", + "AddNet Enabled": "True", + "AddNet Model 1": "fashigirl-v5.5-lora-naivae-64dim(2dda5ffaa304)", + "Hires upscaler": "Latent", + "negativePrompt": "(low quality:1.3), (worst quality:1.3),(monochrome:0.8),(deformed:1.3),(malformed hands:1.4),(poorly drawn hands:1.4),(mutated fingers:1.4),(bad anatomy:1.3),(extra limbs:1.35),(poorly drawn face:1.4),(watermark:1.3)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.7", + "AddNet Weight B 1": "0.7", + "Denoising strength": "0.6" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/fa24ee02-d07f-4bfd-b246-2ba8bd66ab42/width=450/756410.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UCK1E,0y0J+[-W8_]:yCNEEN%#Md.m018_9a", + "meta": { + "RNG": "CPU", + "ENSD": "31337", + "Size": "640x960", + "seed": 1177481202, + "Model": "Yesmix-v1-6-original", + "steps": 30, + "hashes": { + "model": "3e9211917c" + }, + "prompt": "1girl, black hair, bug, butterfly, chinese clothes, facial mark, fashi-girl, flower, forehead mark, hair flower, hair ornament, hair rings, hanfu, holding instrument, lute \\(instrument\\), long hair, looking at viewer, parted lips,light smile, solo, upper body", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "hash": "3e9211917c", + "name": "Yesmix-v1-6-original", + "type": "model" + }, + { + "hash": "2dda5ffaa304", + "name": "64dim", + "type": "lora", + "weight": null + } + ], + "Model hash": "3e9211917c", + "Hires steps": "30", + "Hires upscale": "1.6", + "AddNet Enabled": "True", + "AddNet Model 1": "fashigirl-v5.5-lora-naivae-64dim(2dda5ffaa304)", + "Hires upscaler": "Latent", + "negativePrompt": "(low quality:1.3), (worst quality:1.3),(monochrome:0.8),(deformed:1.3),(malformed hands:1.4),(poorly drawn hands:1.4),(mutated fingers:1.4),(bad anatomy:1.3),(extra limbs:1.35),(poorly drawn face:1.4),(watermark:1.3)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "0.7", + "AddNet Weight B 1": "0.7", + "Denoising strength": "0.6" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/67935" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/fashigirl-v5.5-lora-naivae-64dim.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/fashigirl-v5.5-lora-naivae-64dim.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..877b4e5b0a34fc870ab98087fa9b454be6a3c17b Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/fashigirl-v5.5-lora-naivae-64dim.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/fashigirl-v5.5-lora-naivae-64dim.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/fashigirl-v5.5-lora-naivae-64dim.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..bc82f61ab9c2ea93e8f65ed7bc9f49c1b818f4a8 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/fashigirl-v5.5-lora-naivae-64dim.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:19cb180bf15d2eb384255c8e7e5ff6797625ca9a7e700435cd114606a42c93b6 +size 75622104 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/girl_realistic_v2.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/girl_realistic_v2.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..880259522f35cdc49b64ac82aef61dde42c4f0cb --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/girl_realistic_v2.civitai.info" @@ -0,0 +1,91 @@ +{ + "id": 63053, + "modelId": 58612, + "name": "v2.0", + "createdAt": "2023-05-05T12:25:27.386Z", + "updatedAt": "2023-05-05T12:36:52.042Z", + "trainedWords": [], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 144, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "girl-realistic_v2", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "girl_realistic_v2.safetensors", + "id": 44437, + "sizeKB": 73840.1669921875, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-05T12:31:34.837Z", + "hashes": { + "AutoV1": "E2ABBBE7", + "AutoV2": "8787DA041F", + "SHA256": "8787DA041FCF6B83092530DF81A54827BD0654D86542555FBA25FC425D870907", + "CRC32": "19D30877", + "BLAKE3": "04CC3DADE210A9E879F75CB517D7591E7DB2F033A498C63D9103C04259B3FFC4" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/63053" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/21c402cc-5f12-4c78-8867-a814169cd4b4/width=450/694432.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "UDH_Mf%g0L01nMNd^*~WK5-;I9%1t2D%?aM{", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9ae1c828-627e-4e90-88cc-1e19b11e76f9/width=450/694431.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "UBH-rnn#100L00tQRP-U_ND*?G?H00IU-pD*", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9fe00803-176c-4748-850d-0b3284251a48/width=450/694429.jpeg", + "nsfw": "Soft", + "width": 512, + "height": 768, + "hash": "UKG[m2M|56-;?F?b~qD%b_-pxC%MNe%2M|Rj", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0bdc1afa-d4fb-4f3c-b9eb-2d6abbe8fec8/width=450/694433.jpeg", + "nsfw": "Soft", + "width": 512, + "height": 768, + "hash": "UEI4|m%g00ae00xt?vad.Sogsl%2~q?bV@IU", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/10521214-a341-454a-87ac-97ea5532f72a/width=450/694434.jpeg", + "nsfw": "Soft", + "width": 512, + "height": 768, + "hash": "UIHU%*_3o~xu8^%LNbWB~pocMw%200WU^+bI", + "meta": null + } + ], + "downloadUrl": "https://civitai.com/api/download/models/63053" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/girl_realistic_v2.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/girl_realistic_v2.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..4f8d05d75f2a4cccfc95ea5ed4c82971a368dd42 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/girl_realistic_v2.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/girl_realistic_v2.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/girl_realistic_v2.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..6c0fc9a2a0229c071eb20c2560f3338a06e0578b --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/girl_realistic_v2.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:8787da041fcf6b83092530df81a54827bd0654d86542555fba25fc425d870907 +size 75612331 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/hipoly3DModelLora_v20.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/hipoly3DModelLora_v20.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..1f56381ea2fd1c5aec488c6251e663aafc7cd725 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/hipoly3DModelLora_v20.civitai.info" @@ -0,0 +1,389 @@ +{ + "id": 44566, + "modelId": 8730, + "name": "v2.0", + "createdAt": "2023-04-13T10:14:52.772Z", + "updatedAt": "2023-04-13T10:16:52.888Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

  • Increased the number of training images

  • Increased the training resolution (ver.1: 768, ver.2: 896)

  • Revised the tagging

    • Removed the trigger word as well

  • Reviewed the training parameters

", + "stats": { + "downloadCount": 12887, + "ratingCount": 11, + "rating": 5 + }, + "model": { + "name": "Hipoly 3D Model LoRA", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "hipoly3DModelLora_v20.safetensors", + "id": 33579, + "sizeKB": 73870.203125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-13T10:16:37.741Z", + "hashes": { + "AutoV1": "8448873C", + "AutoV2": "3BE24D2E6D", + "SHA256": "3BE24D2E6D581BAEC264ECAA843B0CA45524C95984C576DA641E8A8406F0EC5F", + "CRC32": "6874765F", + "BLAKE3": "708EDBD394699197450F0272A0F1D84475D93DEBAD50907C8E9D3CA60409A0A8" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/44566" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3e28cc7f-dd15-4dbf-0981-b840dc19fc00/width=450/485327.jpeg", + "nsfw": true, + "width": 768, + "height": 1344, + "hash": "UHFh|*9FV=-:00?GodWB4.%2?HIo~qM{E1kC", + "meta": { + "ENSD": "31337", + "Size": "512x896", + "seed": 1041864763, + "Model": "models_02_25D_AlstroemeriaMix-fp16", + "steps": 20, + "hashes": { + "model": "8be1721acb" + }, + "prompt": ",\n1girl, looking at viewer,\nupper body, 3D, realistic,\nlarge breasts, excessively frilled princess dress, draped clothes, jewelry, ornament, flower, lace trim,\nmasterpiece, best quality, 8k, detailed skin texture, detailed cloth texture, beautiful detailed face, intricate details, ultra detailed,\nrim lighting, side lighting, cinematic light, ultra high res, 8k uhd, film grain,best shadow, delicate, RAW", + "sampler": "UniPC", + "cfgScale": 10, + "Clip skip": "2", + "resources": [ + { + "hash": "8be1721acb", + "name": "models_02_25D_AlstroemeriaMix-fp16", + "type": "model" + } + ], + "Model hash": "8be1721acb", + "Hires upscale": "1.5", + "Hires upscaler": "Latent", + "negativePrompt": "[:EasyNegative:0.5], extra fingers,fewer fingers, cowboy, mole, freckles, facepaint, (simple background:1.3),", + "Denoising strength": "0.6" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d341fd8e-c6f6-4e14-3af1-58a97a5d5c00/width=450/485328.jpeg", + "nsfw": true, + "width": 768, + "height": 1344, + "hash": "UDE:MX.AyC4nD#4n-;D%0KDirrxZ?H-:M{t7", + "meta": { + "ENSD": "31337", + "Size": "512x896", + "seed": 126391336, + "Model": "models_02_25D_AlstroemeriaMix-fp16", + "steps": 20, + "hashes": { + "model": "8be1721acb" + }, + "prompt": ",\n1girl, looking at viewer,\nupper body, 3D, realistic,\nlarge breasts, excessively frilled princess dress, draped clothes, jewelry, ornament, flower, lace trim,\nmasterpiece, best quality, 8k, detailed skin texture, detailed cloth texture, beautiful detailed face, intricate details, ultra detailed,\nrim lighting, side lighting, cinematic light, ultra high res, 8k uhd, film grain,best shadow, delicate, RAW", + "sampler": "UniPC", + "cfgScale": 10, + "Clip skip": "2", + "resources": [ + { + "hash": "8be1721acb", + "name": "models_02_25D_AlstroemeriaMix-fp16", + "type": "model" + } + ], + "Model hash": "8be1721acb", + "Hires upscale": "1.5", + "Hires upscaler": "Latent", + "negativePrompt": "[:EasyNegative:0.5], extra fingers,fewer fingers, cowboy, mole, freckles, facepaint, (simple background:1.3),", + "Denoising strength": "0.6" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/97774583-5906-4ab5-9b3f-0292142c8300/width=450/485329.jpeg", + "nsfw": true, + "width": 768, + "height": 1152, + "hash": "UWF~HpIUoyV@_NM{bbadx]RjRkj[a#R+n$t7", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3591483779, + "Model": "models_02_25D_AlstroemeriaMix-fp16", + "steps": 20, + "hashes": { + "model": "8be1721acb" + }, + "prompt": ", 3d, realistic, masterpiece, best quality,\n1girl, \nwarrior girl,\nDetermined expression, battle-ready stance, armor or battle attire, weapon such as a sword or a bow, dynamic background with hints of conflict or action,\nrim lighting, side lighting, cinematic light, ultra high res, 8k uhd, film grain,best shadow, delicate, RAW, light particles,\ndetailed skin texture, detailed cloth texture, beautiful detailed face, intricate details, ultra detailed", + "sampler": "DPM++ 2M Karras", + "cfgScale": 12.5, + "Clip skip": "2", + "resources": [ + { + "hash": "8be1721acb", + "name": "models_02_25D_AlstroemeriaMix-fp16", + "type": "model" + } + ], + "Model hash": "8be1721acb", + "Hires steps": "30", + "Hires upscale": "1.5", + "Hires upscaler": "Latent", + "negativePrompt": "[:EasyNegative:0.5], extra fingers,fewer fingers, facepaint, mole,", + "Denoising strength": "0.6" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5c84cc2e-aa60-44d0-3e63-453c2177b900/width=450/485330.jpeg", + "nsfw": false, + "width": 768, + "height": 1152, + "hash": "UUHdvmxuIVM|~UIpRjWBIoE2WCoexZafWBj[", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2981967814, + "Model": "models_02_25D_AlstroemeriaMix-fp16", + "steps": 20, + "hashes": { + "model": "8be1721acb" + }, + "prompt": ", 3d, realistic, masterpiece, best quality,\n1girl, \n Musician,\nHolding an instrument, passionate expression, sheet music, stage or practice room background, musical notes floating around,\nrim lighting, side lighting, cinematic light, ultra high res, 8k uhd, film grain,best shadow, delicate, RAW, light particles,\ndetailed skin texture, detailed cloth texture, beautiful detailed face, intricate details, ultra detailed", + "sampler": "DPM++ 2M Karras", + "cfgScale": 12.5, + "Clip skip": "2", + "resources": [ + { + "hash": "8be1721acb", + "name": "models_02_25D_AlstroemeriaMix-fp16", + "type": "model" + } + ], + "Model hash": "8be1721acb", + "Hires steps": "30", + "Hires upscale": "1.5", + "Hires upscaler": "Latent", + "negativePrompt": "[:EasyNegative:0.5], extra fingers,fewer fingers, facepaint, mole,", + "Denoising strength": "0.6" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ff865f98-cacc-4e8d-05ad-6f7450205400/width=450/485331.jpeg", + "nsfw": false, + "width": 768, + "height": 1152, + "hash": "UEFYlV4:0M.700~VtQ4oW.r=WVxab]bb=xJB", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3819982106, + "Model": "models_02_25D_AlstroemeriaMix-fp16", + "steps": 20, + "hashes": { + "model": "8be1721acb" + }, + "prompt": ",3d, realistic, masterpiece, best quality,\n1girl, \n magician,\n Mysterious expression, magical staff or wand, magical effects like sparkles or energy, flowing robes or enchanting attire, magical creatures or mystical background,\nrim lighting, side lighting, cinematic light, ultra high res, 8k uhd, film grain,best shadow, delicate, RAW, light particles,\ndetailed skin texture, detailed cloth texture, beautiful detailed face, intricate details, ultra detailed", + "sampler": "DPM++ 2M Karras", + "cfgScale": 12.5, + "Clip skip": "2", + "resources": [ + { + "hash": "8be1721acb", + "name": "models_02_25D_AlstroemeriaMix-fp16", + "type": "model" + } + ], + "Model hash": "8be1721acb", + "Hires steps": "30", + "Hires upscale": "1.5", + "Hires upscaler": "Latent", + "negativePrompt": "[:EasyNegative:0.5], extra fingers,fewer fingers, facepaint, mole,", + "Denoising strength": "0.6" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5d33a71f-e9d4-4593-7519-76a0c070fa00/width=450/485332.jpeg", + "nsfw": false, + "width": 768, + "height": 1152, + "hash": "UOI4e54;Vr-:~A9bNG%24:xZg3M|D*%LNIM|", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2311242338, + "Model": "models_02_25D_AlstroemeriaMix-fp16", + "steps": 20, + "hashes": { + "model": "8be1721acb" + }, + "prompt": ",masterpiece, best quality,\n1girl, \n magician,\n Mysterious expression, magical staff or wand, magical effects like sparkles or energy, flowing robes or enchanting attire, magical creatures or mystical background,\nrim lighting, side lighting, cinematic light, ultra high res, 8k uhd, film grain,best shadow, delicate, RAW, light particles,\ndetailed skin texture, detailed cloth texture, beautiful detailed face, intricate details, ultra detailed", + "sampler": "DPM++ 2M Karras", + "cfgScale": 12.5, + "Clip skip": "2", + "resources": [ + { + "hash": "8be1721acb", + "name": "models_02_25D_AlstroemeriaMix-fp16", + "type": "model" + } + ], + "Model hash": "8be1721acb", + "Hires steps": "30", + "Hires upscale": "1.5", + "Hires upscaler": "Latent", + "negativePrompt": "[:EasyNegative:0.5], extra fingers,fewer fingers, facepaint, mole, 3d, realistic,", + "Denoising strength": "0.6" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0ccf6bfd-7b9a-4e25-59f3-d9ec0f5e4b00/width=450/485333.jpeg", + "nsfw": false, + "width": 768, + "height": 1152, + "hash": "UCD,WUyE4:tSHqxv9ZM{00NGozxtOsV?~qt7", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2311242341, + "Model": "models_02_25D_AlstroemeriaMix-fp16", + "steps": 20, + "hashes": { + "model": "8be1721acb" + }, + "prompt": ",masterpiece, best quality,\n1girl, \n magician,\n Mysterious expression, magical staff or wand, magical effects like sparkles or energy, flowing robes or enchanting attire, magical creatures or mystical background,\nrim lighting, side lighting, cinematic light, ultra high res, 8k uhd, film grain,best shadow, delicate, RAW, light particles,\ndetailed skin texture, detailed cloth texture, beautiful detailed face, intricate details, ultra detailed", + "sampler": "DPM++ 2M Karras", + "cfgScale": 12.5, + "Clip skip": "2", + "resources": [ + { + "hash": "8be1721acb", + "name": "models_02_25D_AlstroemeriaMix-fp16", + "type": "model" + } + ], + "Model hash": "8be1721acb", + "Hires steps": "30", + "Hires upscale": "1.5", + "Hires upscaler": "Latent", + "negativePrompt": "[:EasyNegative:0.5], extra fingers,fewer fingers, facepaint, mole, 3d, realistic,", + "Denoising strength": "0.6" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/71b8936d-aae1-4233-026c-3fe4c899e900/width=450/485334.jpeg", + "nsfw": false, + "width": 768, + "height": 1152, + "hash": "UCE{On~T00-=ISbIpJS1IT%2xuE1xHIqxa-7", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3321680301, + "Model": "models_02_25D_AlstroemeriaMix-fp16", + "steps": 20, + "hashes": { + "model": "8be1721acb" + }, + "prompt": ",3d, realistic, masterpiece, best quality,\n1girl, \nScientist, Wearing lab coat, safety goggles or glasses, holding scientific equipment like a beaker or test tube, laboratory background, scientific diagrams or formulas on a chalkboard or paper,\nrim lighting, side lighting, cinematic light, ultra high res, 8k uhd, film grain,best shadow, delicate, RAW, light particles,\ndetailed skin texture, detailed cloth texture, beautiful detailed face, intricate details, ultra detailed", + "sampler": "DPM++ 2M Karras", + "cfgScale": 12.5, + "Clip skip": "2", + "resources": [ + { + "hash": "8be1721acb", + "name": "models_02_25D_AlstroemeriaMix-fp16", + "type": "model" + } + ], + "Model hash": "8be1721acb", + "Hires steps": "30", + "Hires upscale": "1.5", + "Hires upscaler": "Latent", + "negativePrompt": "[:EasyNegative:0.5], extra fingers,fewer fingers, facepaint, mole,", + "Denoising strength": "0.6" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4fb0caa1-2316-48ef-ac1c-08f76d689000/width=450/485335.jpeg", + "nsfw": false, + "width": 768, + "height": 1152, + "hash": "UCF=?koc4mxZ00k8_4tQ00IU^kIotSIV9FIV", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1686835190, + "Model": "models_02_25D_AlstroemeriaMix-fp16", + "steps": 20, + "hashes": { + "model": "8be1721acb" + }, + "prompt": ",masterpiece, best quality,\n1girl, \nScientist, Wearing lab coat, safety goggles or glasses, holding scientific equipment like a beaker or test tube, laboratory background, scientific diagrams or formulas on a chalkboard or paper,\nrim lighting, side lighting, cinematic light, ultra high res, 8k uhd, film grain,best shadow, delicate, RAW, light particles,\ndetailed skin texture, detailed cloth texture, beautiful detailed face, intricate details, ultra detailed", + "sampler": "DPM++ 2M Karras", + "cfgScale": 12.5, + "Clip skip": "2", + "resources": [ + { + "hash": "8be1721acb", + "name": "models_02_25D_AlstroemeriaMix-fp16", + "type": "model" + } + ], + "Model hash": "8be1721acb", + "Hires steps": "30", + "Hires upscale": "1.5", + "Hires upscaler": "Latent", + "negativePrompt": "[:EasyNegative:0.5], extra fingers,fewer fingers, facepaint, mole, 3d, realistic,", + "Denoising strength": "0.6" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4cb7c0f7-1007-4dc5-166c-f93ab36a5100/width=450/485336.jpeg", + "nsfw": true, + "width": 768, + "height": 1152, + "hash": "UEFsSd0000^Roo?v9[RQuhnhQ-S~%fIBt8IU", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3177431454, + "Model": "models_02_25D_AlstroemeriaMix-fp16", + "steps": 20, + "hashes": { + "model": "8be1721acb" + }, + "prompt": ", masterpiece, best quality,\n1girl, \nElf, Pointed ears, elegant and ethereal attire, skilled with a bow and arrow, immersed in a lush forest or mystical woodland setting, surrounded by magical creatures like fairies or unicorns,\nrim lighting, side lighting, cinematic light, ultra high res, 8k uhd, film grain,best shadow, delicate, RAW, light particles,\ndetailed skin texture, detailed cloth texture, beautiful detailed face, intricate details, ultra detailed", + "sampler": "DPM++ 2M Karras", + "cfgScale": 12.5, + "Clip skip": "2", + "resources": [ + { + "hash": "8be1721acb", + "name": "models_02_25D_AlstroemeriaMix-fp16", + "type": "model" + } + ], + "Model hash": "8be1721acb", + "Hires steps": "30", + "Hires upscale": "1.5", + "Hires upscaler": "Latent", + "negativePrompt": "[:EasyNegative:0.5], extra fingers,fewer fingers, facepaint, mole,", + "Denoising strength": "0.6" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/44566" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/hipoly3DModelLora_v20.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/hipoly3DModelLora_v20.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..6acaebba55a627eac76e00d7fc8380705b79519a --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/hipoly3DModelLora_v20.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:8c40fbff9e6385dce479d9a81c603759f828b34cfdd6d00a9f67b7287e7255ad +size 1579349 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/hipoly3DModelLora_v20.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/hipoly3DModelLora_v20.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..7d3327fe2c506f08190d690c2bf60740f115094d --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/hipoly3DModelLora_v20.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:3be24d2e6d581baec264ecaa843b0ca45524c95984c576da641e8a8406f0ec5f +size 75643088 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/japaneseAnimeStyle1_japaneseAnimeStyle1.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/japaneseAnimeStyle1_japaneseAnimeStyle1.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..6246a4e6b3b6c74c9fc1ea6b27d7096409d18bca --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/japaneseAnimeStyle1_japaneseAnimeStyle1.civitai.info" @@ -0,0 +1,231 @@ +{ + "id": 15464, + "modelId": 13124, + "name": "Japanese anime style1", + "createdAt": "2023-02-26T03:05:19.080Z", + "updatedAt": "2023-03-16T09:54:06.811Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 902, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Japanese anime style1", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "japaneseAnimeStyle1_japaneseAnimeStyle1.safetensors", + "id": 13259, + "sizeKB": 36993.7060546875, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-02-26T03:06:09.594Z", + "hashes": { + "AutoV1": "82EAC879", + "AutoV2": "C1D924B911", + "SHA256": "C1D924B911F553D9E2799CD605B1B635A27C1FADC9391B1A8E52AE56AD456F95", + "CRC32": "CD686706", + "BLAKE3": "4D7D013321709DEA185EBBA6A0E366E209FDCA1B4485C658682BE8C3DA5CB4DF" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/15464" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f3f78a16-bc90-44c8-0501-6edbd3c20f00/width=450/261278.jpeg", + "nsfw": true, + "width": 896, + "height": 1344, + "hash": "UIKAQW-:02EM~V-:Nb?GyCx[~BM{={R+X8$*", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3568036804, + "steps": 32, + "prompt": "1girl, potted_plant, plant, nail_polish, solo, long_hair, breasts, kneeling, couch", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "resources": [], + "Model hash": "a92311f07a", + "Hires steps": "20", + "Hires upscale": "1.75", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/66008999-92a9-4e7b-48df-0a90a51cb300/width=450/261277.jpeg", + "nsfw": true, + "width": 896, + "height": 1344, + "hash": "UKKJ+00000~V9rE2yD$g9Yof-oRj%MjF$$t7", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3643550028, + "steps": 28, + "prompt": ", best quality, ultra high res, (photorealistic:1.4), 1girl, sleeveless white blouse, bare shoulders, red skirt, black choker, cute, (Kpop idol), (aegyo sal:1), (platinum blonde hair:1), ((puffy eyes)), looking at viewer, full body, facing front, smiling ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "resources": [ + { + "name": "koreanDollLikeness_v15", + "type": "lora", + "weight": 0.66 + } + ], + "Model hash": "9c59842129", + "Hires steps": "20", + "Hires upscale": "1.75", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans, nsfw, nipples", + "Denoising strength": "0.5" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4659e1b1-ab7f-47f5-f12f-8471ec684400/width=450/261276.jpeg", + "nsfw": true, + "width": 896, + "height": 1344, + "hash": "UEKU1a0000~V00xB%$xZA0ITt9WBE,ITxaxt", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3643550028, + "steps": 28, + "prompt": ", best quality, ultra high res, (photorealistic:1.4), 1girl, sleeveless white blouse, bare shoulders, red skirt, black choker, cute, (Kpop idol), (aegyo sal:1), (platinum blonde hair:1), ((puffy eyes)), looking at viewer, full body, facing front, smiling ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "resources": [ + { + "name": "koreanDollLikeness_v15", + "type": "lora", + "weight": 0.66 + } + ], + "Model hash": "9c59842129", + "Hires steps": "20", + "Hires upscale": "1.75", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans, nsfw, nipples", + "Denoising strength": "0.5" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a6504df9-f72d-4bb0-61d1-353cdeb3a200/width=450/261275.jpeg", + "nsfw": true, + "width": 896, + "height": 1344, + "hash": "UCJQQLX90z^j0y9t9Zxt00E2%1NG~Bt7-UIU", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3785738469, + "steps": 28, + "prompt": "high_heels, 1girl, spread_legs, breasts, solo, long_hair, jewelry, closed_eyes", + "sampler": "Euler a", + "cfgScale": 8, + "resources": [], + "Model hash": "a92311f07a", + "Hires steps": "20", + "Hires upscale": "1.75", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, (outdoor:1.6), glans", + "Denoising strength": "0.5" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3b52f54c-768a-417a-bcfb-3bfe8920e700/width=450/261274.jpeg", + "nsfw": true, + "width": 1024, + "height": 1536, + "hash": "UHKckbXA00od}@WA56of01s9^jX8~BoM%1R+", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2283370534, + "steps": 25, + "prompt": "unparalleled masterpiece, ultra realistic 8k CG, perfect artwork, ((perfect female figure)), white hair, red eyes, mature female, milf, narrow waist, chinese deity, looking at viewer, seductive posture, sexy pose, alluring, clean, beautiful face, pure face, pale skin, absurdly long hair, (huge breasts, nsfw, breasts out, puffy nipples), divine goddess, shiny skin, skindentation, lace, lace trim, lace-trimmed legwear, delicate pattern, intricate detail, (rich:1.4), prestige, gorgeous, luxury, royal palace, jewelry, gem, gold, silver, diamond, glint, sapphire, ruby, emerald, pearl, amber, obsidian ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "Model hash": "aec216165d", + "Hires steps": "30", + "Hires upscale": "2", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "(worst quality, low quality:1.3), makeup, mole under eye, mole, logo, watermark, text", + "Denoising strength": "0.56" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/bee621d2-ba0c-4864-f72b-a5de672ab000/width=450/261273.jpeg", + "nsfw": true, + "width": 896, + "height": 1344, + "hash": "UFJaZYIU5R%ME3~V0KD*ENIW~Vt6I@W=%29a", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 41897723, + "steps": 28, + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, loose and oversized open jacket, white sports bra, (yoga pants:1), big breasts, (light brown short ponytail:1.2), looking at viewer, smiling, cute, full body, streets, outdoors ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "resources": [], + "Model hash": "e911995387", + "Hires steps": "20", + "Hires upscale": "1.75", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans", + "Denoising strength": "0.5" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/def8aebb-566f-4233-9d7e-5964331cfd00/width=450/261272.jpeg", + "nsfw": true, + "width": 896, + "height": 1344, + "hash": "U6IN~-i{00^*4TxWTg9Z0000?w%M0$M{-oMx", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3905877716, + "steps": 28, + "prompt": ", best quality, ultra high res, (photorealistic:1.4), 1girl, (intricate white sleeveless maid clothes:1), (Kpop idol), (aegyo sal:1), (busty), ((cleavage)), (curvy), large breasts, huge breasts, (light blonde twintail:1), ((puffy eyes)), from below, looking at viewer, laughing, happy ", + "sampler": "Euler a", + "cfgScale": 8, + "resources": [ + { + "name": "koreanDollLikeness_v15", + "type": "lora", + "weight": 0.66 + } + ], + "Model hash": "a92311f07a", + "Hires steps": "20", + "Hires upscale": "1.75", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, (outdoor:1.6), glans", + "Denoising strength": "0.5" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/15464" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/japaneseAnimeStyle1_japaneseAnimeStyle1.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/japaneseAnimeStyle1_japaneseAnimeStyle1.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..bd669057d766dc97ec2e49dbdc1b7a83abb84243 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/japaneseAnimeStyle1_japaneseAnimeStyle1.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:d93a18f2e44ca394b623c59419921514dfc184fb479265cb29784353e86e25fa +size 1592384 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/japaneseAnimeStyle1_japaneseAnimeStyle1.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/japaneseAnimeStyle1_japaneseAnimeStyle1.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..d51993888c20d7c4a2a9240bf60bb1ae38529ee2 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/japaneseAnimeStyle1_japaneseAnimeStyle1.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:c1d924b911f553d9e2799cd605b1b635a27c1fadc9391b1a8e52ae56ad456f95 +size 37881555 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/japaneseDollLikeness_v10.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/japaneseDollLikeness_v10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..94e14356cc37b5a57f9b411154797a4b6e155149 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/japaneseDollLikeness_v10.civitai.info" @@ -0,0 +1,72 @@ +{ + "id": 22597, + "modelId": 19044, + "name": "v1.0", + "createdAt": "2023-03-13T14:01:55.831Z", + "updatedAt": "2023-04-02T15:09:00.799Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 15759, + "ratingCount": 7, + "rating": 3.86 + }, + "model": { + "name": "Japanese doll likeness", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "japaneseDollLikeness_v10.safetensors", + "id": 18794, + "sizeKB": 147574.62890625, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-03-13T14:06:37.173Z", + "hashes": { + "AutoV1": "F2FE8AE6", + "AutoV2": "96928CE486", + "SHA256": "96928CE48667A5A6794C3BB2833F6F56BCC88DC6EBF53716D8A0F982A2FBA81A", + "CRC32": "FBF3EA72", + "BLAKE3": "8526AB5101865D5EAB2CC613A7EA7CA0C89089465160EFFA103A737E02D454B5" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/22597" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/cfbf45d9-33cc-432f-46d7-befb9eae8500/width=450/243233.jpeg", + "nsfw": true, + "width": 1812, + "height": 1656, + "hash": "U7I4|s000L-=00IU~W4TMcRPM{4o%$IVa0xv", + "meta": { + "seed": 2165194963, + "steps": 28, + "prompt": ", best quality, ultra high res, (photorealistic:1.4), 1girl, loose and oversized black jacket, white sports bra, (yoga pants:1), (light brown hair:1.2), Llooking at viewer, smiling, futt body, streets, urban, makeup, wide angle\n", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2\uff09, (normal quality:2), Lowres, normat quality, ((monoch rome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1c865a19-0c41-4bad-0f6a-72fa2faaa200/width=450/492735.jpeg", + "nsfw": false, + "width": 590, + "height": 968, + "hash": "UNRC[6-;_3t7-;ayofof~qWBM{xu9Fj[%MWB", + "meta": null + } + ], + "downloadUrl": "https://civitai.com/api/download/models/22597" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/japaneseDollLikeness_v10.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/japaneseDollLikeness_v10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..51d5258f386000aeb77aebbe6891dcc880c8014d --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/japaneseDollLikeness_v10.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:1d0db9ad1509afd76614303d4f3d3c6f5a5f8e37d8e650532508aeede25b2e36 +size 4022149 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/japaneseDollLikeness_v10.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/japaneseDollLikeness_v10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..53603fa1883802af10386ea0d3942134e2a16565 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/japaneseDollLikeness_v10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:96928ce48667a5a6794c3bb2833f6f56bcc88dc6ebf53716d8a0f982a2fba81a +size 151116420 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/japanesedolllikenessV1_v15.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/japanesedolllikenessV1_v15.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..ca9eb1cc804b4916f13690d6d06dccb231abd276 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/japanesedolllikenessV1_v15.civitai.info" @@ -0,0 +1,416 @@ +{ + "id": 34562, + "modelId": 28811, + "name": "v1.5", + "createdAt": "2023-04-03T17:14:56.374Z", + "updatedAt": "2023-04-03T17:25:28.720Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "model": { + "name": "JapaneseDollLikeness (v1.5)", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "japanesedolllikenessV1_v15.safetensors", + "id": 28382, + "sizeKB": 147567.2177734375, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-03T17:21:23.557Z", + "hashes": { + "AutoV1": "73777B55", + "AutoV2": "ED2AFDB55E", + "SHA256": "ED2AFDB55E6910169C7494F37DE2CF59075C760E5EEE8CE0705AFF82A26CF108", + "CRC32": "5422743F", + "BLAKE3": "03883D55FA2FD0D21904286CDB839B59CE720DED42399A8BAA06F82BB051429E" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/34562" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/42bb3051-7e2c-49fa-88b4-61e624b24f00/width=450/394771.jpeg", + "nsfw": true, + "width": 896, + "height": 1344, + "hash": "UHI}R~-3X.4:s7-;?bRkE2ogRPoz~VRjM|Ip", + "meta": { + "Size": "512x768", + "seed": 1285008643, + "Model": "Chilled_re_generic_v2", + "steps": 28, + "hashes": { + "model": "523b280d1c" + }, + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, off-shoulder white shirt, black tight skirt, black choker, (faded ash gray hair:1), (huge breasts:1.2), looking at viewer, closeup ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "resources": [ + { + "name": "JDLv15", + "type": "lora", + "weight": 0.66 + }, + { + "hash": "523b280d1c", + "name": "Chilled_re_generic_v2", + "type": "model" + } + ], + "Model hash": "523b280d1c", + "Hires steps": "20", + "Hires upscale": "1.75", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans,", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a63a41b1-5c3b-4d8f-5aa4-aeec3e206d00/width=450/394780.jpeg", + "nsfw": true, + "width": 896, + "height": 1344, + "hash": "UDH_Mbxa.70L~VtS~V0L9ZRP%1-VoHRijcM{", + "meta": { + "Size": "512x768", + "seed": 2812745056, + "Model": "Chilled_re_generic_v2", + "steps": 28, + "hashes": { + "model": "523b280d1c" + }, + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, off-shoulder dress, black skirt, black choker, (faded ash gray hair:1), (huge breasts:1.2), looking at viewer, closeup ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "resources": [ + { + "name": "JDLv15", + "type": "lora", + "weight": 0.66 + }, + { + "hash": "523b280d1c", + "name": "Chilled_re_generic_v2", + "type": "model" + } + ], + "Model hash": "523b280d1c", + "Hires steps": "20", + "Hires upscale": "1.75", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans,", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/24c7e82c-2bfb-43da-e20b-f29539a9b500/width=450/394779.jpeg", + "nsfw": true, + "width": 896, + "height": 1344, + "hash": "UAG[1d010z~U$ysoNZR*00?G?HM{%gkC-V9a", + "meta": { + "Size": "512x768", + "seed": 817402832, + "Model": "chilloutmix_cilloutmixNi", + "steps": 28, + "hashes": { + "model": "7234b76e42" + }, + "prompt": "best quality, ultra high res, (photorealistic:1.4), masterpiece, 1girl, black night gown, on bed, seductive pose, (huge breasts:1.2), (busty:1), looking at viewer ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "resources": [ + { + "name": "JDLv15", + "type": "lora", + "weight": 0.66 + }, + { + "hash": "7234b76e42", + "name": "chilloutmix_cilloutmixNi", + "type": "model" + } + ], + "Model hash": "7234b76e42", + "Hires steps": "20", + "Hires upscale": "1.75", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, glossy skin, wet, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6ab2faa5-aa12-4ac9-dbcf-2b9664084900/width=450/394778.jpeg", + "nsfw": true, + "width": 896, + "height": 1344, + "hash": "UGHULL?G0e%1V?xu?Hxt9FE1={xt~VIVD%R*", + "meta": { + "Size": "512x768", + "seed": 909324680, + "Model": "chilloutmix_cilloutmixNi", + "steps": 28, + "hashes": { + "model": "7234b76e42" + }, + "prompt": "best quality, ultra high res, (photorealistic:1.4), masterpiece, 1girl, black off-shoulder shirt, posing, cleavage, (huge breasts:1.2), (busty:1), looking at viewer ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "resources": [ + { + "name": "JDLv15", + "type": "lora", + "weight": 0.66 + }, + { + "hash": "7234b76e42", + "name": "chilloutmix_cilloutmixNi", + "type": "model" + } + ], + "Model hash": "7234b76e42", + "Hires steps": "20", + "Hires upscale": "1.75", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, glossy skin, wet, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0f773efe-464d-434d-8f92-462809e05d00/width=450/394777.jpeg", + "nsfw": true, + "width": 896, + "height": 1344, + "hash": "UCF#]*bb0Lxu00NG00t69G%2~WE10Lay?axa", + "meta": { + "Size": "512x768", + "seed": 2116617370, + "Model": "Chilled_re_generic_v2", + "steps": 28, + "hashes": { + "model": "523b280d1c" + }, + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, off-shoulder dress, black skirt, studio background, (faded ash gray hair:1.2), (huge breasts:1.2), looking at viewer, closeup ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "resources": [ + { + "name": "JDLv15", + "type": "lora", + "weight": 0.66 + }, + { + "hash": "523b280d1c", + "name": "Chilled_re_generic_v2", + "type": "model" + } + ], + "Model hash": "523b280d1c", + "Hires steps": "20", + "Hires upscale": "1.75", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans,", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a7b5429c-8aec-4e04-4529-59773ad86900/width=450/394776.jpeg", + "nsfw": true, + "width": 896, + "height": 1344, + "hash": "UBF$31yY00$y~q_3x]M{01%L~WIp9Z%1-pE2", + "meta": { + "Size": "512x768", + "seed": 935424399, + "Model": "Chilled_re_generic_v2", + "steps": 28, + "hashes": { + "model": "523b280d1c" + }, + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, off-shoulder black dress, black skirt, studio background, (faded ash gray hair:1.2), (huge breasts:1.2), looking at viewer, closeup ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "resources": [ + { + "name": "JDLv15", + "type": "lora", + "weight": 0.66 + }, + { + "hash": "523b280d1c", + "name": "Chilled_re_generic_v2", + "type": "model" + } + ], + "Model hash": "523b280d1c", + "Hires steps": "20", + "Hires upscale": "1.75", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans,", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ceebd6de-3149-4f02-1802-3315c955e200/width=450/394775.jpeg", + "nsfw": true, + "width": 896, + "height": 1344, + "hash": "USH-.Anj4.%200IVtRRj0LRk-ot7~qxtIUWB", + "meta": { + "Size": "512x768", + "seed": 2016965918, + "Model": "Chilled_re_generic_v2", + "steps": 28, + "hashes": { + "model": "523b280d1c" + }, + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, oversized and loose off-shoulder white shirt, black skirt, cowboy shot, black choker, (brown hair:1), (huge breasts:1.2), looking at viewer, closeup ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "resources": [ + { + "name": "JDLv15", + "type": "lora", + "weight": 0.66 + }, + { + "hash": "523b280d1c", + "name": "Chilled_re_generic_v2", + "type": "model" + } + ], + "Model hash": "523b280d1c", + "Hires steps": "20", + "Hires upscale": "1.75", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans,", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8d86a2b1-4632-49cb-f6ca-e00127837a00/width=450/394774.jpeg", + "nsfw": true, + "width": 896, + "height": 1344, + "hash": "UEGa?_H=.6~V?uD$9uR+NaaesoM{?G%LV[%2", + "meta": { + "Size": "512x768", + "seed": 3745507205, + "Model": "chilloutmix_cilloutmixNi", + "steps": 28, + "hashes": { + "model": "7234b76e42" + }, + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, sleeveless turtleneck, (busty), ((huge breasts)), large breasts, (brown long hair:1.3), (looking at viewer), (full body), (closeup) ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "resources": [ + { + "name": "JDLv15", + "type": "lora", + "weight": 0.66 + }, + { + "hash": "7234b76e42", + "name": "chilloutmix_cilloutmixNi", + "type": "model" + } + ], + "Model hash": "7234b76e42", + "Hires steps": "20", + "Hires upscale": "1.75", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, glossy skin, wet, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/33ad17bd-eec8-427f-dcff-d8212de1aa00/width=450/394773.jpeg", + "nsfw": true, + "width": 896, + "height": 1344, + "hash": "UFKApI015QDi00IU?^nh%#xZMxt7~qR+DjR*", + "meta": { + "Size": "512x768", + "seed": 2160727401, + "Model": "chilloutmix_cilloutmixNi", + "steps": 28, + "hashes": { + "model": "7234b76e42" + }, + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, white button shirt, bare shoulders, (busty), ((huge breasts)), large breasts, (brown long hair:1.3), (looking at viewer), (closeup) ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "resources": [ + { + "name": "JDLv15", + "type": "lora", + "weight": 0.66 + }, + { + "hash": "7234b76e42", + "name": "chilloutmix_cilloutmixNi", + "type": "model" + } + ], + "Model hash": "7234b76e42", + "Hires steps": "20", + "Hires upscale": "1.75", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, glossy skin, wet, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4bc9dbb4-2e30-48c3-b44a-a0afc554a800/width=450/394772.jpeg", + "nsfw": true, + "width": 896, + "height": 1344, + "hash": "ULJtSI?HEMt74oM|?aNH0eIp%LWq~qNaIVbF", + "meta": { + "Size": "512x768", + "seed": 3433215086, + "Model": "chilloutmix_cilloutmixNi", + "steps": 28, + "hashes": { + "model": "7234b76e42" + }, + "prompt": "best quality, ultra high resolution, high resolution, (photorealistic:1.4), masterpiece, 1girl, baggy and loose camisole, lazy and messy, (huge breasts:1.2), (busty:1.1), looking at viewer ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "resources": [ + { + "name": "JDLv15", + "type": "lora", + "weight": 0.66 + }, + { + "hash": "7234b76e42", + "name": "chilloutmix_cilloutmixNi", + "type": "model" + } + ], + "Model hash": "7234b76e42", + "Hires steps": "20", + "Hires upscale": "1.75", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, glossy skin, wet, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans", + "Denoising strength": "0.45" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/34562" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/japanesedolllikenessV1_v15.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/japanesedolllikenessV1_v15.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..b2792cb9c78e0557755d5316bfc6759d07384f6c --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/japanesedolllikenessV1_v15.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:2f8ec8129f2013c8042651d96209cc4cb9c796c53d687bf203c8b9d965b8e7e1 +size 1579657 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/japanesedolllikenessV1_v15.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/japanesedolllikenessV1_v15.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..3a7e86f46b755f65544f132d90937e7651d793f5 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/japanesedolllikenessV1_v15.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:ed2afdb55e6910169c7494f37de2cf59075c760e5eee8ce0705aff82a26cf108 +size 151108831 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/koreanDollLikeness_v10.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/koreanDollLikeness_v10.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..6f161456206ad4b3b44e8a5ee3a3683eead25bcb --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/koreanDollLikeness_v10.civitai.info" @@ -0,0 +1,73 @@ +{ + "id": 13739, + "modelId": 11619, + "name": "v1.0", + "createdAt": "2023-02-22T04:20:46.479Z", + "updatedAt": "2023-02-23T13:35:20.661Z", + "trainedWords": [ + "123" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

noyhing

", + "stats": { + "downloadCount": 20347, + "ratingCount": 3, + "rating": 4.33 + }, + "model": { + "name": "Korean Doll Likenesss", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "koreanDollLikeness_v10.safetensors", + "id": 12106, + "sizeKB": 147574.74609375, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-02-22T04:26:55.602Z", + "hashes": { + "AutoV1": "081F8A15", + "AutoV2": "62EFE75048", + "SHA256": "62EFE75048D55A096A238C6E8C4E12D61B36BF59E388A90589335F750923954C", + "CRC32": "C23DC0A3", + "BLAKE3": "35ADE796F01FE53C238245F50133BEFB4790C98552D2BAA2A01E138E7D5A08E1" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/13739" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c2c733d7-58ad-4ea7-da72-16a533f80a00/width=450/133029.jpeg", + "nsfw": "None", + "width": 2816, + "height": 5376, + "hash": "UHHd,J9FX-=|_NIVRO.8OTNG9ZpINF$$nhRj", + "meta": { + "Size": "704x1344", + "seed": 987355751, + "steps": 50, + "prompt": "(masterpiece:1.3),(ultra quality:1.3),(ultra-detailed:1.2),(illustration),(ultra beautiful background:1.3),beautiful detailed glow,Amazing,finely detail,extremely detailedCG,Original,(8k_wallpaper:1.2),absurdres, highres, extremely CG,wallpaper, extremely detailed CG unity 8k wallpaper, very fine 8K CG wallpaper,ultra detailed, hyper detailed,10000,The girl,short hair, wavy hair, black hair, shiny hair,small breasts,(happy:1.3),open_mouth, blue eyes,(holding a rabbit:1.5),(Kimono classical long detailed long classical Kimono:1.2),red Kimono,shrine", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 7, + "Mask blur": "4", + "resources": [], + "Model hash": "588d9b8f", + "negativePrompt": "NSFW,((logo)), (worst quality:1.8), (low quality:2.0),lowres, bad anatomy,(bad hands:1.8), text, error,(missing fingers:1.5), extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry,missing fingers,bad hands,missing arms,large breasts, lowres,bad anatomy,bad hands,text,error,ugly,duplicate,morbid,boken limb,incorrect limb,fusion finger,lose finger,multiple finger,multiple digit,fusion hand,lose leg,fused leg,multiple leg,bad feet,fewer digits,cropped,worst quality,low quality,normal quality,simple background,jpeg artifacts,signature,watermark,username,blurry,text font ui,malformed hands,long neck,missing limb,(mutated hand and finger: 1.5),(long body: 1.3),(mutation poorly drawn: 1.2),disfigured,malformed mutated,multiple breasts,futa,yaoi,big breasts", + "Denoising strength": "0.75" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/13739" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/koreanDollLikeness_v10.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/koreanDollLikeness_v10.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..9c7133c4ea16234e7b88be15e5b8df6db25546c3 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/koreanDollLikeness_v10.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:3219db32949ac90d3b59bddd8d4560c84e5571b75d95845fac43b7677a5c2ca2 +size 1255772 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/koreanDollLikeness_v10.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/koreanDollLikeness_v10.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..093714f2d918f445e08e6c60c5f5fc46c20ab5d6 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/koreanDollLikeness_v10.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:62efe75048d55a096a238c6e8c4e12d61b36bf59e388a90589335f750923954c +size 151116540 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/koreandolllikenessV20_v20.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/koreandolllikenessV20_v20.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..e1afdff611cec3b4ece96fb9087d76eaa34768cd --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/koreandolllikenessV20_v20.civitai.info" @@ -0,0 +1,342 @@ +{ + "id": 31284, + "modelId": 26124, + "name": "v2.0", + "createdAt": "2023-03-29T13:32:34.622Z", + "updatedAt": "2023-03-29T13:39:19.104Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "model": { + "name": "KoreanDollLikeness (v2.0)", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "koreandolllikenessV20_v20.safetensors", + "id": 25807, + "sizeKB": 147567.2177734375, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-03-29T13:36:20.314Z", + "hashes": { + "AutoV1": "49B5BCBF", + "AutoV2": "00483A2A78", + "SHA256": "00483A2A78CEC31880128EC2DA827349EBAACCD7D2D1D35836BAEBECF006D983", + "CRC32": "1C694270", + "BLAKE3": "324851A36ABAD7ADE9FADFC7AE40FA098CD3D84F453118442AD953F850802157" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/31284" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/204fdfc2-d26c-4063-1315-66c4f5020500/width=450/355883.jpeg", + "nsfw": true, + "width": 896, + "height": 1344, + "hash": "U6IEqr_3009FK5#6px9x0101~BwG9E=_rXoh", + "meta": { + "Size": "512x768", + "seed": 3397800074, + "Model": "chilloutmix_cilloutmixNi", + "steps": 28, + "hashes": { + "model": "7234b76e42" + }, + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, off-shoulder white shirt, black tight skirt, black choker, (faded ash gray hair:1), (huge breasts:1.2), looking at viewer, closeup ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "resources": [ + { + "name": "koreanDollLikeness_v20", + "type": "lora", + "weight": 0.66 + }, + { + "hash": "7234b76e42", + "name": "chilloutmix_cilloutmixNi", + "type": "model" + } + ], + "Model hash": "7234b76e42", + "Hires steps": "20", + "Hires upscale": "1.75", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans,", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2231af5c-b946-40f4-00cf-bb6d0676b600/width=450/355890.jpeg", + "nsfw": true, + "width": 896, + "height": 1344, + "hash": "U7F=XJ^+00IAZ|E1Ott8MxWVIoxt?^WB00WB", + "meta": { + "Size": "512x768", + "seed": 2567916389, + "Model": "chilloutmix_cilloutmixNi", + "steps": 28, + "hashes": { + "model": "7234b76e42" + }, + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, off-shoulder white shirt, black tight skirt, black choker, (faded ash gray hair:1), (huge breasts:1.2), looking at viewer, closeup ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "resources": [ + { + "name": "koreanDollLikeness_v20", + "type": "lora", + "weight": 0.66 + }, + { + "hash": "7234b76e42", + "name": "chilloutmix_cilloutmixNi", + "type": "model" + } + ], + "Model hash": "7234b76e42", + "Hires steps": "20", + "Hires upscale": "1.75", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans,", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/af721a21-b385-478d-c19c-3571feeb3700/width=450/355889.jpeg", + "nsfw": true, + "width": 896, + "height": 1344, + "hash": "UBH1[70001-V00_ND%~V0hsl={Rj~URO-;IV", + "meta": { + "Size": "512x768", + "seed": 1273009861, + "Model": "Chilled_re_generic_v2", + "steps": 28, + "hashes": { + "model": "523b280d1c" + }, + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, off-shoulder sweate, smiling, (faded ash gray messy bun hair:1), border light, depth of field, (large breasts:1.2), looking at viewer, closeup ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "resources": [ + { + "name": "koreanDollLikeness_v20", + "type": "lora", + "weight": 0.66 + }, + { + "hash": "523b280d1c", + "name": "Chilled_re_generic_v2", + "type": "model" + } + ], + "Model hash": "523b280d1c", + "Hires steps": "20", + "Hires upscale": "1.75", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans,", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/95d65be0-aced-49da-a3e9-ccbe1f2af500/width=450/355888.jpeg", + "nsfw": true, + "width": 896, + "height": 1344, + "hash": "U9Jthtq[2]0#|m00X,Ir0gpI]h=v-4?GIW?a", + "meta": { + "Size": "512x768", + "seed": 1765035014, + "Model": "chilloutmix_cilloutmixNi", + "steps": 28, + "hashes": { + "model": "7234b76e42" + }, + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, off-shoulder sweate, smiling, (faded ash gray messy bun hair:1), border light, depth of field, (large breasts:1.2), looking at viewer, closeup ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "resources": [ + { + "name": "koreanDollLikeness_v20", + "type": "lora", + "weight": 0.66 + }, + { + "hash": "7234b76e42", + "name": "chilloutmix_cilloutmixNi", + "type": "model" + } + ], + "Model hash": "7234b76e42", + "Hires steps": "20", + "Hires upscale": "1.75", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans,", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/84ba1e56-acd0-419a-0fe6-dcde5632f100/width=450/355887.jpeg", + "nsfw": true, + "width": 896, + "height": 1344, + "hash": "UHHBVoxY01R.00bcS$-U4:of_2xa~qRj4ot6", + "meta": { + "Size": "512x768", + "seed": 1709512138, + "Model": "chilloutmix_cilloutmixNi", + "steps": 28, + "hashes": { + "model": "7234b76e42" + }, + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, off-shoulder white shirt, black tight skirt, black choker, (messy bun:1), (large breasts:1.2), looking at viewer, closeup ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "resources": [ + { + "name": "koreanDollLikeness_v20", + "type": "lora", + "weight": 0.66 + }, + { + "hash": "7234b76e42", + "name": "chilloutmix_cilloutmixNi", + "type": "model" + } + ], + "Model hash": "7234b76e42", + "Hires steps": "20", + "Hires upscale": "1.75", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans,", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/abc8b94a-e077-49cc-167f-65a0ac699f00/width=450/355886.jpeg", + "nsfw": true, + "width": 896, + "height": 1344, + "hash": "UCI}6EH?O:9a?a9aI;0LRO?H~At6E19aD*oL", + "meta": { + "Size": "512x768", + "seed": 93858329, + "Model": "chilloutmix_cilloutmixNi", + "steps": 28, + "hashes": { + "model": "7234b76e42" + }, + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, off-shoulder white shirt, black tight skirt, black choker, (faded ash gray messy bun:1), faded ash gray hair, (large breasts:1.2), looking at viewer, closeup ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "resources": [ + { + "name": "koreanDollLikeness_v20", + "type": "lora", + "weight": 0.66 + }, + { + "hash": "7234b76e42", + "name": "chilloutmix_cilloutmixNi", + "type": "model" + } + ], + "Model hash": "7234b76e42", + "Hires steps": "20", + "Hires upscale": "1.75", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans,", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ec409904-d1c3-4fa9-316b-0a6db60d2700/width=450/355885.jpeg", + "nsfw": true, + "width": 896, + "height": 1344, + "hash": "UKK^T#9FK%ae00W;-;$%_Nt7-pkWI9-:%2IU", + "meta": { + "Size": "512x768", + "seed": 1607836028, + "Model": "Chilled_re_generic_v2", + "steps": 28, + "hashes": { + "model": "523b280d1c" + }, + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, white elegant dress, (brown hair:1), (large breasts:1.2), 100mm border light, looking at viewer, closeup ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "resources": [ + { + "name": "koreanDollLikeness_v20", + "type": "lora", + "weight": 0.66 + }, + { + "hash": "523b280d1c", + "name": "Chilled_re_generic_v2", + "type": "model" + } + ], + "Model hash": "523b280d1c", + "Hires steps": "20", + "Hires upscale": "1.75", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans,", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d1095ede-1bbf-4abe-29f0-e4bf042d4600/width=450/355884.jpeg", + "nsfw": true, + "width": 896, + "height": 1344, + "hash": "UDJQTOxV0L~B00?GNFS5.m%1xv564nIp={t6", + "meta": { + "Size": "512x768", + "seed": 2110300267, + "Model": "Chilled_re_generic_v2", + "steps": 28, + "hashes": { + "model": "523b280d1c" + }, + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, white elegant dress, (brown hair:1), (large breasts:1.2), 50mm eye light, looking at viewer, closeup ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "resources": [ + { + "name": "koreanDollLikeness_v20", + "type": "lora", + "weight": 0.66 + }, + { + "hash": "523b280d1c", + "name": "Chilled_re_generic_v2", + "type": "model" + } + ], + "Model hash": "523b280d1c", + "Hires steps": "20", + "Hires upscale": "1.75", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans,", + "Denoising strength": "0.45" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/31284" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/koreandolllikenessV20_v20.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/koreandolllikenessV20_v20.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..0fd6328469c0146aa15dff380c976647c8c88e84 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/koreandolllikenessV20_v20.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:0d1c5da2aa84d528195131d17fb71fd60362b72f968a6a7b45aa15f687f19bce +size 1481166 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/koreandolllikenessV20_v20.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/koreandolllikenessV20_v20.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..0a7788ba69e54f1de1fde19e3f59957f75d16681 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/koreandolllikenessV20_v20.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:00483a2a78cec31880128ec2da827349ebaaccd7d2d1d35836baebecf006d983 +size 151108831 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/koreandolllikeness_V10066.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/koreandolllikeness_V10066.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..49769069509ba0158d81e257e59f70c9542d2b12 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/koreandolllikeness_V10066.civitai.info" @@ -0,0 +1,68 @@ +{ + "id": 13739, + "modelId": 11619, + "name": "v1.0", + "createdAt": "2023-02-22T04:20:46.479Z", + "updatedAt": "2023-02-23T13:35:20.661Z", + "trainedWords": [ + "123" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

noyhing

", + "model": { + "name": "Korean Doll Likenesss", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "koreanDollLikenesss_v10.safetensors", + "id": 12106, + "sizeKB": 147574.74609375, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-02-22T04:26:55.602Z", + "hashes": { + "AutoV1": "081F8A15", + "AutoV2": "62EFE75048", + "SHA256": "62EFE75048D55A096A238C6E8C4E12D61B36BF59E388A90589335F750923954C", + "CRC32": "C23DC0A3", + "BLAKE3": "35ADE796F01FE53C238245F50133BEFB4790C98552D2BAA2A01E138E7D5A08E1" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/13739" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c2c733d7-58ad-4ea7-da72-16a533f80a00/width=450/133029.jpeg", + "nsfw": false, + "width": 2816, + "height": 5376, + "hash": "UHHd,J9FX-=|_NIVRO.8OTNG9ZpINF$$nhRj", + "meta": { + "Size": "704x1344", + "seed": 987355751, + "steps": 50, + "prompt": "(masterpiece:1.3),(ultra quality:1.3),(ultra-detailed:1.2),(illustration),(ultra beautiful background:1.3),beautiful detailed glow,Amazing,finely detail,extremely detailedCG,Original,(8k_wallpaper:1.2),absurdres, highres, extremely CG,wallpaper, extremely detailed CG unity 8k wallpaper, very fine 8K CG wallpaper,ultra detailed, hyper detailed,10000,The girl,short hair, wavy hair, black hair, shiny hair,small breasts,(happy:1.3),open_mouth, blue eyes,(holding a rabbit:1.5),(Kimono classical long detailed long classical Kimono:1.2),red Kimono,shrine", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 7, + "Mask blur": "4", + "resources": [], + "Model hash": "588d9b8f", + "negativePrompt": "NSFW,((logo)), (worst quality:1.8), (low quality:2.0),lowres, bad anatomy,(bad hands:1.8), text, error,(missing fingers:1.5), extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry,missing fingers,bad hands,missing arms,large breasts, lowres,bad anatomy,bad hands,text,error,ugly,duplicate,morbid,boken limb,incorrect limb,fusion finger,lose finger,multiple finger,multiple digit,fusion hand,lose leg,fused leg,multiple leg,bad feet,fewer digits,cropped,worst quality,low quality,normal quality,simple background,jpeg artifacts,signature,watermark,username,blurry,text font ui,malformed hands,long neck,missing limb,(mutated hand and finger: 1.5),(long body: 1.3),(mutation poorly drawn: 1.2),disfigured,malformed mutated,multiple breasts,futa,yaoi,big breasts", + "Denoising strength": "0.75" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/13739" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/koreandolllikeness_V10066.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/koreandolllikeness_V10066.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..84b2ac67f0add71b86838f51da1a9a0064e71745 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/koreandolllikeness_V10066.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:c5d17fdd1c4b46bacfc41751131ae21e9d37d92bb64387cfc016b2c35218397e +size 19256776 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/koreandolllikeness_V10066.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/koreandolllikeness_V10066.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..093714f2d918f445e08e6c60c5f5fc46c20ab5d6 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/koreandolllikeness_V10066.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:62efe75048d55a096a238c6e8c4e12d61b36bf59e388a90589335f750923954c +size 151116540 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/museNaturalfaceV1_v1.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/museNaturalfaceV1_v1.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..90ad6efa3c641963da2e8b09d86cebefbef19b11 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/museNaturalfaceV1_v1.civitai.info" @@ -0,0 +1,521 @@ +{ + "id": 15994, + "modelId": 13578, + "name": "v1", + "createdAt": "2023-02-27T04:14:42.567Z", + "updatedAt": "2023-02-27T23:48:48.398Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "model": { + "name": "MUSE_naturalface_v1", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "museNaturalfaceV1_v1.safetensors", + "id": 13624, + "sizeKB": 73844.794921875, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-02-27T04:16:31.083Z", + "hashes": { + "AutoV1": "B3EB3C62", + "AutoV2": "48E2D6A362", + "SHA256": "48E2D6A362698E4557425E4EA25E09E1467D0C6319326B75779428C9471B65FE", + "CRC32": "E18D45AD", + "BLAKE3": "6E07DA14A8CC2DA7A875E89C8137D69485600A6B71AB6DF02551263BDFB81C81" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/15994" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/38133e12-95a3-483c-3017-788f6decd200/width=450/161086.jpeg", + "nsfw": true, + "width": 640, + "height": 960, + "hash": "URH-.7?bF?MxXLo#kpbv?^%M%1adS$-;%3oe", + "meta": { + "Size": "512x768", + "seed": 1861421370, + "steps": 30, + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, masterpiece, outdoors,", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "41286c16f5f0", + "name": "MUSE_style2_v1", + "type": "lora", + "weight": null + }, + { + "hash": "aa12327d4bab", + "name": "taiwanDollLikeness_v10", + "type": "lora", + "weight": null + } + ], + "Model hash": "84a23b651d", + "Hires steps": "15", + "Hires upscale": "1.25", + "AddNet Enabled": "True", + "AddNet Model 1": "MUSE_style2_v1(41286c16f5f0)", + "AddNet Model 2": "taiwanDollLikeness_v10(aa12327d4bab)", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, (outdoor:1.6), manboobs,(ugly:1.331), (duplicate:1.331), (morbid:1.21), (mutilated:1.21), (tranny:1.331), mutated hands, (poorly drawn hands:1.331), blurry, (bad anatomy:1.21), (bad proportions:1.331), extra limbs, (disfigured:1.331), (more than 2 nipples:1.331), (missing arms:1.331), (extra legs:1.331), (fused fingers:1.61051), (too many fingers:1.61051), (unclear eyes:1.331), bad hands, missing fingers, extra digit, (futa:1.1), bad body, NG_DeepNegative_V1_75T,pubic hair, glans. large breasts,", + "AddNet Module 1": "LoRA", + "AddNet Module 2": "LoRA", + "AddNet Weight A 1": "0.5", + "AddNet Weight A 2": "0.5", + "AddNet Weight B 1": "0.5", + "AddNet Weight B 2": "0.5", + "Denoising strength": "0.4" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f62f5c0c-6358-4e36-5689-4bf9781d5900/width=450/161095.jpeg", + "nsfw": true, + "width": 1760, + "height": 2173, + "hash": "UsMj%M~q?b%M%MWCRjay%NRiWBWB%gaeV[WB", + "meta": { + "Size": "512x768", + "seed": 1861421370, + "steps": 30, + "Script": "X/Y/Z plot", + "X Type": "Checkpoint name", + "Y Type": "AddNet Model 1", + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, masterpiece, outdoors,", + "sampler": "Euler a", + "X Values": "\"MUSE_v1.safetensors [84a23b651d]", + "Y Values": "\"MUSE_style2_v1(41286c16f5f0)", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "41286c16f5f0", + "name": "MUSE_style2_v1", + "type": "lora", + "weight": null + }, + { + "hash": "aa12327d4bab", + "name": "taiwanDollLikeness_v10", + "type": "lora", + "weight": null + } + ], + "Model hash": "84a23b651d", + "Hires steps": "15", + "Hires upscale": "1.25", + "AddNet Enabled": "True", + "AddNet Model 1": "MUSE_style2_v1(41286c16f5f0)", + "AddNet Model 2": "taiwanDollLikeness_v10(aa12327d4bab)", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, (outdoor:1.6), manboobs,(ugly:1.331), (duplicate:1.331), (morbid:1.21), (mutilated:1.21), (tranny:1.331), mutated hands, (poorly drawn hands:1.331), blurry, (bad anatomy:1.21), (bad proportions:1.331), extra limbs, (disfigured:1.331), (more than 2 nipples:1.331), (missing arms:1.331), (extra legs:1.331), (fused fingers:1.61051), (too many fingers:1.61051), (unclear eyes:1.331), bad hands, missing fingers, extra digit, (futa:1.1), bad body, NG_DeepNegative_V1_75T,pubic hair, glans. large breasts,", + "AddNet Module 1": "LoRA", + "AddNet Module 2": "LoRA", + "AddNet Weight A 1": "0.5", + "AddNet Weight A 2": "0.5", + "AddNet Weight B 1": "0.5", + "AddNet Weight B 2": "0.5", + "Denoising strength": "0.4" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b5836c28-6b56-42d8-7820-66ef221dd700/width=450/161094.jpeg", + "nsfw": true, + "width": 640, + "height": 960, + "hash": "UHHL3g~q01?a4.D%$%WA?GaKr?xaJ8R.t8t7", + "meta": { + "Size": "512x768", + "seed": 2363850951, + "steps": 30, + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, masterpiece", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "41286c16f5f0", + "name": "MUSE_style2_v1", + "type": "lora", + "weight": null + }, + { + "hash": "aa12327d4bab", + "name": "taiwanDollLikeness_v10", + "type": "lora", + "weight": null + } + ], + "Model hash": "84a23b651d", + "Hires steps": "15", + "Hires upscale": "1.25", + "AddNet Enabled": "True", + "AddNet Model 1": "MUSE_style2_v1(41286c16f5f0)", + "AddNet Model 2": "taiwanDollLikeness_v10(aa12327d4bab)", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, (outdoor:1.6), manboobs,(ugly:1.331), (duplicate:1.331), (morbid:1.21), (mutilated:1.21), (tranny:1.331), mutated hands, (poorly drawn hands:1.331), blurry, (bad anatomy:1.21), (bad proportions:1.331), extra limbs, (disfigured:1.331), (more than 2 nipples:1.331), (missing arms:1.331), (extra legs:1.331), (fused fingers:1.61051), (too many fingers:1.61051), (unclear eyes:1.331), bad hands, missing fingers, extra digit, (futa:1.1), bad body, NG_DeepNegative_V1_75T,pubic hair, glans", + "AddNet Module 1": "LoRA", + "AddNet Module 2": "LoRA", + "AddNet Weight A 1": "0.5", + "AddNet Weight A 2": "0.5", + "AddNet Weight B 1": "0.5", + "AddNet Weight B 2": "0.5", + "Denoising strength": "0.4" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/86492dde-77f7-4c8c-4305-6c5c93e86000/width=450/161093.jpeg", + "nsfw": true, + "width": 1760, + "height": 2173, + "hash": "UuMQx2~q?b%M%1WXWVWW%NRiWBj[x[WEaeae", + "meta": { + "Size": "512x768", + "seed": 2363850951, + "steps": 30, + "Script": "X/Y/Z plot", + "X Type": "Checkpoint name", + "Y Type": "AddNet Model 1", + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, masterpiece", + "sampler": "Euler a", + "X Values": "\"MUSE_v1.safetensors [84a23b651d]", + "Y Values": "\"MUSE_style2_v1(41286c16f5f0)", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "41286c16f5f0", + "name": "MUSE_style2_v1", + "type": "lora", + "weight": null + }, + { + "hash": "aa12327d4bab", + "name": "taiwanDollLikeness_v10", + "type": "lora", + "weight": null + } + ], + "Model hash": "84a23b651d", + "Hires steps": "15", + "Hires upscale": "1.25", + "AddNet Enabled": "True", + "AddNet Model 1": "MUSE_style2_v1(41286c16f5f0)", + "AddNet Model 2": "taiwanDollLikeness_v10(aa12327d4bab)", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, (outdoor:1.6), manboobs,(ugly:1.331), (duplicate:1.331), (morbid:1.21), (mutilated:1.21), (tranny:1.331), mutated hands, (poorly drawn hands:1.331), blurry, (bad anatomy:1.21), (bad proportions:1.331), extra limbs, (disfigured:1.331), (more than 2 nipples:1.331), (missing arms:1.331), (extra legs:1.331), (fused fingers:1.61051), (too many fingers:1.61051), (unclear eyes:1.331), bad hands, missing fingers, extra digit, (futa:1.1), bad body, NG_DeepNegative_V1_75T,pubic hair, glans", + "AddNet Module 1": "LoRA", + "AddNet Module 2": "LoRA", + "AddNet Weight A 1": "0.5", + "AddNet Weight A 2": "0.5", + "AddNet Weight B 1": "0.5", + "AddNet Weight B 2": "0.5", + "Denoising strength": "0.4" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e41b3e67-360c-4bed-3934-8cf98bc56100/width=450/161092.jpeg", + "nsfw": false, + "width": 640, + "height": 960, + "hash": "UHIEOq^*D$?bMwWYk?WAE1%L^*xt~p-:RPxu", + "meta": { + "Size": "512x768", + "seed": 3125509361, + "steps": 30, + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, masterpiece", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "41286c16f5f0", + "name": "MUSE_style2_v1", + "type": "lora", + "weight": null + }, + { + "hash": "e2e472c06607", + "name": "koreanDollLikeness_v10", + "type": "lora", + "weight": null + } + ], + "Model hash": "84a23b651d", + "Hires steps": "15", + "Hires upscale": "1.25", + "AddNet Enabled": "True", + "AddNet Model 1": "MUSE_style2_v1(41286c16f5f0)", + "AddNet Model 2": "koreanDollLikeness_v10(e2e472c06607)", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, (outdoor:1.6), manboobs,(ugly:1.331), (duplicate:1.331), (morbid:1.21), (mutilated:1.21), (tranny:1.331), mutated hands, (poorly drawn hands:1.331), blurry, (bad anatomy:1.21), (bad proportions:1.331), extra limbs, (disfigured:1.331), (more than 2 nipples:1.331), (missing arms:1.331), (extra legs:1.331), (fused fingers:1.61051), (too many fingers:1.61051), (unclear eyes:1.331), bad hands, missing fingers, extra digit, (futa:1.1), bad body, NG_DeepNegative_V1_75T,pubic hair, glans", + "AddNet Module 1": "LoRA", + "AddNet Module 2": "LoRA", + "AddNet Weight A 1": "0.5", + "AddNet Weight A 2": "0.5", + "AddNet Weight B 1": "0.5", + "AddNet Weight B 2": "0.5", + "Denoising strength": "0.4" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/565fbfc6-bf00-4136-c8fa-e4147b79e900/width=450/161091.jpeg", + "nsfw": false, + "width": 1760, + "height": 2173, + "hash": "UwMtEl~q.8%M%MWBWBazxvWBWBWBx]WBf6js", + "meta": { + "Size": "512x768", + "seed": 3125509361, + "steps": 30, + "Script": "X/Y/Z plot", + "X Type": "Checkpoint name", + "Y Type": "AddNet Model 1", + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, masterpiece", + "sampler": "Euler a", + "X Values": "\"MUSE_v1.safetensors [84a23b651d]", + "Y Values": "\"MUSE_style2_v1(41286c16f5f0)", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "41286c16f5f0", + "name": "MUSE_style2_v1", + "type": "lora", + "weight": null + }, + { + "hash": "e2e472c06607", + "name": "koreanDollLikeness_v10", + "type": "lora", + "weight": null + } + ], + "Model hash": "84a23b651d", + "Hires steps": "15", + "Hires upscale": "1.25", + "AddNet Enabled": "True", + "AddNet Model 1": "MUSE_style2_v1(41286c16f5f0)", + "AddNet Model 2": "koreanDollLikeness_v10(e2e472c06607)", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, (outdoor:1.6), manboobs,(ugly:1.331), (duplicate:1.331), (morbid:1.21), (mutilated:1.21), (tranny:1.331), mutated hands, (poorly drawn hands:1.331), blurry, (bad anatomy:1.21), (bad proportions:1.331), extra limbs, (disfigured:1.331), (more than 2 nipples:1.331), (missing arms:1.331), (extra legs:1.331), (fused fingers:1.61051), (too many fingers:1.61051), (unclear eyes:1.331), bad hands, missing fingers, extra digit, (futa:1.1), bad body, NG_DeepNegative_V1_75T,pubic hair, glans", + "AddNet Module 1": "LoRA", + "AddNet Module 2": "LoRA", + "AddNet Weight A 1": "0.5", + "AddNet Weight A 2": "0.5", + "AddNet Weight B 1": "0.5", + "AddNet Weight B 2": "0.5", + "Denoising strength": "0.4" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a0789e3e-1ccb-4997-1968-e39db72fae00/width=450/161090.jpeg", + "nsfw": false, + "width": 640, + "height": 960, + "hash": "U9F$9L0MBo~UQ+00-:OXGbJ:=x-TI9Ipoz%N", + "meta": { + "Size": "512x768", + "seed": 631096887, + "steps": 30, + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, masterpiece, bed, window,", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "41286c16f5f0", + "name": "MUSE_style2_v1", + "type": "lora", + "weight": null + }, + { + "hash": "aa12327d4bab", + "name": "taiwanDollLikeness_v10", + "type": "lora", + "weight": null + } + ], + "Model hash": "84a23b651d", + "Hires steps": "15", + "Hires upscale": "1.25", + "AddNet Enabled": "True", + "AddNet Model 1": "MUSE_style2_v1(41286c16f5f0)", + "AddNet Model 2": "taiwanDollLikeness_v10(aa12327d4bab)", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, (outdoor:1.6), manboobs,(ugly:1.331), (duplicate:1.331), (morbid:1.21), (mutilated:1.21), (tranny:1.331), mutated hands, (poorly drawn hands:1.331), blurry, (bad anatomy:1.21), (bad proportions:1.331), extra limbs, (disfigured:1.331), (more than 2 nipples:1.331), (missing arms:1.331), (extra legs:1.331), (fused fingers:1.61051), (too many fingers:1.61051), (unclear eyes:1.331), bad hands, missing fingers, extra digit, (futa:1.1), bad body, NG_DeepNegative_V1_75T,pubic hair, glans. large breasts,", + "AddNet Module 1": "LoRA", + "AddNet Module 2": "LoRA", + "AddNet Weight A 1": "0.5", + "AddNet Weight A 2": "0.5", + "AddNet Weight B 1": "0.5", + "AddNet Weight B 2": "0.5", + "Denoising strength": "0.4" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/fdcee929-b208-4de7-4ab8-34a0cdc55c00/width=450/161089.jpeg", + "nsfw": true, + "width": 1760, + "height": 2173, + "hash": "UuL;W}~q_3%M%MWBWBfQ%MRjRkWB%MRjayay", + "meta": { + "Size": "512x768", + "seed": 631096887, + "steps": 30, + "Script": "X/Y/Z plot", + "X Type": "Checkpoint name", + "Y Type": "AddNet Model 1", + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, masterpiece, bed, window,", + "sampler": "Euler a", + "X Values": "\"MUSE_v1.safetensors [84a23b651d]", + "Y Values": "\"MUSE_style2_v1(41286c16f5f0)", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "41286c16f5f0", + "name": "MUSE_style2_v1", + "type": "lora", + "weight": null + }, + { + "hash": "aa12327d4bab", + "name": "taiwanDollLikeness_v10", + "type": "lora", + "weight": null + } + ], + "Model hash": "84a23b651d", + "Hires steps": "15", + "Hires upscale": "1.25", + "AddNet Enabled": "True", + "AddNet Model 1": "MUSE_style2_v1(41286c16f5f0)", + "AddNet Model 2": "taiwanDollLikeness_v10(aa12327d4bab)", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, (outdoor:1.6), manboobs,(ugly:1.331), (duplicate:1.331), (morbid:1.21), (mutilated:1.21), (tranny:1.331), mutated hands, (poorly drawn hands:1.331), blurry, (bad anatomy:1.21), (bad proportions:1.331), extra limbs, (disfigured:1.331), (more than 2 nipples:1.331), (missing arms:1.331), (extra legs:1.331), (fused fingers:1.61051), (too many fingers:1.61051), (unclear eyes:1.331), bad hands, missing fingers, extra digit, (futa:1.1), bad body, NG_DeepNegative_V1_75T,pubic hair, glans. large breasts,", + "AddNet Module 1": "LoRA", + "AddNet Module 2": "LoRA", + "AddNet Weight A 1": "0.5", + "AddNet Weight A 2": "0.5", + "AddNet Weight B 1": "0.5", + "AddNet Weight B 2": "0.5", + "Denoising strength": "0.4" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d996310b-7e6d-4208-685a-b7fe5fe60900/width=450/161088.jpeg", + "nsfw": true, + "width": 640, + "height": 960, + "hash": "UPHUUl-;E%~V9F%1s,9ax[jFVskAIoW=?axa", + "meta": { + "Size": "512x768", + "seed": 3968397012, + "steps": 30, + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, masterpiece", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "41286c16f5f0", + "name": "MUSE_style2_v1", + "type": "lora", + "weight": null + }, + { + "hash": "aa12327d4bab", + "name": "taiwanDollLikeness_v10", + "type": "lora", + "weight": null + } + ], + "Model hash": "84a23b651d", + "Hires steps": "15", + "Hires upscale": "1.25", + "AddNet Enabled": "True", + "AddNet Model 1": "MUSE_style2_v1(41286c16f5f0)", + "AddNet Model 2": "taiwanDollLikeness_v10(aa12327d4bab)", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, (outdoor:1.6), manboobs,(ugly:1.331), (duplicate:1.331), (morbid:1.21), (mutilated:1.21), (tranny:1.331), mutated hands, (poorly drawn hands:1.331), blurry, (bad anatomy:1.21), (bad proportions:1.331), extra limbs, (disfigured:1.331), (more than 2 nipples:1.331), (missing arms:1.331), (extra legs:1.331), (fused fingers:1.61051), (too many fingers:1.61051), (unclear eyes:1.331), bad hands, missing fingers, extra digit, (futa:1.1), bad body, NG_DeepNegative_V1_75T,pubic hair, glans. large breasts,", + "AddNet Module 1": "LoRA", + "AddNet Module 2": "LoRA", + "AddNet Weight A 1": "0.5", + "AddNet Weight A 2": "0.5", + "AddNet Weight B 1": "0.5", + "AddNet Weight B 2": "0.5", + "Denoising strength": "0.4" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c002b602-60b1-4f58-36db-c46449f25700/width=450/161087.jpeg", + "nsfw": true, + "width": 1760, + "height": 2173, + "hash": "UxMtBb_N?b%MtRjZWUay%gRjWAWBtRjsaej?", + "meta": { + "Size": "512x768", + "seed": 3968397012, + "steps": 30, + "Script": "X/Y/Z plot", + "X Type": "Checkpoint name", + "Y Type": "AddNet Model 1", + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, masterpiece", + "sampler": "Euler a", + "X Values": "\"MUSE_v1.safetensors [84a23b651d]", + "Y Values": "\"MUSE_style2_v1(41286c16f5f0)", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "41286c16f5f0", + "name": "MUSE_style2_v1", + "type": "lora", + "weight": null + }, + { + "hash": "aa12327d4bab", + "name": "taiwanDollLikeness_v10", + "type": "lora", + "weight": null + } + ], + "Model hash": "84a23b651d", + "Hires steps": "15", + "Hires upscale": "1.25", + "AddNet Enabled": "True", + "AddNet Model 1": "MUSE_style2_v1(41286c16f5f0)", + "AddNet Model 2": "taiwanDollLikeness_v10(aa12327d4bab)", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, (outdoor:1.6), manboobs,(ugly:1.331), (duplicate:1.331), (morbid:1.21), (mutilated:1.21), (tranny:1.331), mutated hands, (poorly drawn hands:1.331), blurry, (bad anatomy:1.21), (bad proportions:1.331), extra limbs, (disfigured:1.331), (more than 2 nipples:1.331), (missing arms:1.331), (extra legs:1.331), (fused fingers:1.61051), (too many fingers:1.61051), (unclear eyes:1.331), bad hands, missing fingers, extra digit, (futa:1.1), bad body, NG_DeepNegative_V1_75T,pubic hair, glans. large breasts,", + "AddNet Module 1": "LoRA", + "AddNet Module 2": "LoRA", + "AddNet Weight A 1": "0.5", + "AddNet Weight A 2": "0.5", + "AddNet Weight B 1": "0.5", + "AddNet Weight B 2": "0.5", + "Denoising strength": "0.4" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/15994" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/museNaturalfaceV1_v1.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/museNaturalfaceV1_v1.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..d8a0c9c94d49fd5e496614fb43ffd41cb67875bf --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/museNaturalfaceV1_v1.preview.png" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:39e2af81cef91544a23dc768461b9eb0f6d2b1871eac3818f20f37356cebdf07 +size 1008631 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/museNaturalfaceV1_v1.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/museNaturalfaceV1_v1.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..9918f59e37039184bc087de960c1bca775f27fb8 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/museNaturalfaceV1_v1.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:48e2d6a362698e4557425e4ea25e09e1467d0c6319326b75779428c9471b65fe +size 75617070 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/pureInnocentGirl_v25.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/pureInnocentGirl_v25.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..de10f8878eae5d3ad6756ae41f387dca02ffc113 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/pureInnocentGirl_v25.civitai.info" @@ -0,0 +1,355 @@ +{ + "id": 78583, + "modelId": 35685, + "name": "v2.5", + "createdAt": "2023-05-23T07:28:34.218Z", + "updatedAt": "2023-05-23T07:33:05.974Z", + "trainedWords": [ + "PI_girl" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

Important reminder: It is recommended that all users who previously used this LoRA download the new V2.5 version. The new version has been adjusted by LoRA Block Weight, which not only preserves facial effects but also reduces contamination of clothing, background, and style.

", + "stats": { + "downloadCount": 1234, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "Pure Innocent girl \u7d14\u771f\u5973\u5b69", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "pureInnocentGirl_v25.safetensors", + "id": 54020, + "sizeKB": 73838.03125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-23T07:31:30.172Z", + "hashes": { + "AutoV1": "518DCDCB", + "AutoV2": "AD3F50A5E1", + "SHA256": "AD3F50A5E1711DA81DE5D9BEE0A2A57DBA73A6A5328693CD17FE6D65A2FC1B96", + "CRC32": "8009AA82", + "BLAKE3": "F9F6D113F29ADE479EEB76D7FC2A5427716EB61A920ED0559D89AB7E0ACA0C72" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/78583" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f64dd924-338d-472d-a6e2-998e510cbdfd/width=450/881001.jpeg", + "nsfw": "Soft", + "width": 768, + "height": 1152, + "hash": "U8GRYcI]009bOZ~pNHRO0L~V?HD%cFof%1$*", + "meta": { + "Size": "512x768", + "seed": 2569231018, + "Model": "bra_v5", + "steps": 25, + "prompt": "ultra high res,(best quality, masterpiece:1.2),ultra-detailed,portrait,full body,style of a idol,nsfw,top view,\n1girl,(pleasure face:1.3,enchanting smile),pov looking up,separated thighs,legs apart,(black maid dress:1.1, white maid apron:1.1, bow hair accessory:1.05, maid headband:1.05, maid bow tie:1.05, wrist cuffs:1.05, ), lace stockings, maid shoes,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "name": "pureInnocentGirl_v25", + "type": "lora", + "weight": 0.46 + } + ], + "Hires steps": "15", + "Hires upscale": "1.5", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "easynegative,ng_deepnegative_v1_75t,((monochrome)),((grayscale)),bad-picture-chill-75v,", + "Face restoration": "CodeFormer", + "Denoising strength": "0.43" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/002d3333-3c06-4df8-b61b-97339e46ed4c/width=450/893234.jpeg", + "nsfw": "None", + "width": 768, + "height": 1152, + "hash": "UUHLVjNGNGM|M_M{RjWVozM{V?of~qofs,NG", + "meta": { + "Size": "512x768", + "seed": 1450752429, + "Model": "xxmix9realistic_v30", + "steps": 25, + "prompt": "raw photo, ultra realistic,(masterpiece, 8k uhd, HDR, extreme detailed, intricate details, best quality, professional, vivid colors),looking at viewer,\n1girl,smile,wearing school uniform,and Holding a white cat,cat in her arms,city,at street,\n", + "Version": "v1.2.1", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "name": "pureInnocentGirl_v25", + "type": "lora", + "weight": 0.48 + } + ], + "Hires steps": "15", + "Hires upscale": "1.5", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "easynegative,ng_deepnegative_v1_75t,((monochrome)),((grayscale)),bad-picture-chill-75v,", + "Face restoration": "CodeFormer", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8d8e8f2c-0edb-4ff2-a04e-a55b59747b54/width=450/882525.jpeg", + "nsfw": "None", + "width": 768, + "height": 1152, + "hash": "UDGbk%yGKjWY4:_2IoaK?GIo9aM_?Z%NW=Io", + "meta": { + "Size": "512x768", + "seed": 3476813537, + "Model": "chikmix_V3", + "steps": 25, + "prompt": "(photorealistic:1.4),8k,(masterpiece), best quality, highest quality,(detailed face:1.5),original,highres,unparalleled masterpiece, ultra realistic 8k, perfect artwork, ((perfect female figure)),afternoon nature light,200 mm,low position,lens flare,\n1girl, solo,mature female, milf,brown eyes, long hair, black hair, low twintails,bangs,narrow waist, skinny,detailed skin,((standing,standing on one leg)),\n(school uniform),blazer,black jacket,sleeves past wrists, long sleeves,open jacket,cardigan,white shirt,collared shirt,plaid miniskirt,pleated skirt,necktie,black pantyhose,school bag,loafers,black footwear,\nwhite background,simple background,outdoors,high school,school gate,street,bus stop,tree, \n", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "name": "pureInnocentGirl_v25", + "type": "lora", + "weight": 0.52 + } + ], + "Hires steps": "15", + "Hires upscale": "1.5", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "easynegative,ng_deepnegative_v1_75t,((monochrome)),((grayscale)),bad-picture-chill-75v,", + "Face restoration": "CodeFormer", + "Denoising strength": "0.43" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6ad6eb28-7a42-478c-a8ea-f84f370b2e57/width=450/902206.jpeg", + "nsfw": "None", + "width": 768, + "height": 1152, + "hash": "UQG[j0XAJ9D*E2IqM_xutQRPM_t6?wxBi{Io", + "meta": { + "Size": "512x768", + "seed": 236778230, + "Model": "chikmix_V3", + "steps": 25, + "prompt": "raw photo, ultra realistic,(masterpiece, 8k uhd, HDR, extreme detailed, intricate details, best quality, professional, vivid colors),looking at viewer,\n1girl,wearing school uniform,and Holding a white cat,cat in her arms,city,at street,\n", + "Version": "v1.2.1", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "name": "pureInnocentGirl_v25", + "type": "lora", + "weight": 0.48 + } + ], + "Hires steps": "15", + "Hires upscale": "1.5", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "easynegative,ng_deepnegative_v1_75t,((monochrome)),((grayscale)),bad-picture-chill-75v,", + "Face restoration": "CodeFormer", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/dc988b27-9d0d-425f-932a-225b3b106632/width=450/881008.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1536, + "hash": "UQEoPrE256%2o2t7t7oeE1%2%2M|~VRjM{of", + "meta": { + "Size": "512x768", + "seed": 2390679733, + "Model": "majicmixRealistic_v2", + "steps": 25, + "prompt": "Best quality, masterpiece, ultra high res, (photorealistic:1.4), raw photo,(front focus:1.6),(real person,fashion photography portrait,photograph),upper body,in the dark, deep shadow,frontal,simple background,\n1girl,straight-eyed,half-closed eyes,pleasure face,ponytail,(Hand Stroking the head,hand up adjusting hair),classic outfit, bustier top, halterneck,off_shoulder,lace rims, choker, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "name": "pureInnocentGirl_v25", + "type": "lora", + "weight": 0.54 + } + ], + "Hires steps": "15", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "ng_deepnegative_v1_75t, badhandv4 (worst quality:2), (low quality:2), (normal quality:2), lowres, bad anatomy, bad hands, normal quality, ((monochrome)), ((grayscale))", + "Face restoration": "CodeFormer", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5676c5e9-c866-430d-8051-3c14c10bb421/width=450/882523.jpeg", + "nsfw": "Mature", + "width": 768, + "height": 1152, + "hash": "UBH-iQ00E{-Apd00~pIU?v4.%2kC_3w[IW-:", + "meta": { + "Size": "512x768", + "seed": 3147765423, + "Model": "perfectWorld_v4Baked", + "steps": 25, + "prompt": "(masterpiece:1.0), (best quality:1.0), looking at the viewer, seductive expression, charming, alluring, with perfect face, mature female, milf, beautiful face, beautiful eyes, evil, god-like\n", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "name": "pureInnocentGirl_v25", + "type": "lora", + "weight": 0.54 + } + ], + "Hires steps": "15", + "Hires upscale": "1.5", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "easynegative,ng_deepnegative_v1_75t,((monochrome)),((grayscale)),bad-picture-chill-75v,", + "Face restoration": "CodeFormer", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2efc48f1-9576-4d16-bf9c-9d1f6b4d5dc0/width=450/882526.jpeg", + "nsfw": "Soft", + "width": 768, + "height": 1152, + "hash": "UOIN]s~VELSPEL9GE2M|%1RjM|WA%Lax-VoK", + "meta": { + "Size": "512x768", + "seed": 2205747679, + "Model": "perfectWorld_v4Baked", + "steps": 25, + "prompt": "(RAW photo, best quality), (realistic:1.3, photo-realistic:1.3), masterpiece, an extremely delicate and beautiful, extremely detailed, CG, unity ,4k wallpaper, Amazing,finely detail,extremely detailed CG unity 4k wallpaper, ultra-detailed, highres, absurdres, soft light,(full body),closeup,close up detailed picture,portrait, \n1girl, cute, young face,beautiful detailed girl,beautiful detailed realistic face,extremely detailed eyes and face, beautiful detailed nose, beautiful detailed eyes, long eyelashes, light on face, looking at viewer, (closed mouth:1.2),smile,((gray white hair,fluffy hair, floating hair novafrog style, long bang,long hair touching breats)),realistic body, detailed fingers,sitting on chair,feet on desk ,\nbusiness suit,unbuttoned jacket,open cardigan,cross-laced clothes, collared shirt,open clothes,short skirt,thighhighs,underwear,high heels,\nin office, detailed office,\n", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "name": "pureInnocentGirl_v25", + "type": "lora", + "weight": 0.56 + } + ], + "Hires steps": "15", + "Hires upscale": "1.5", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "easynegative,ng_deepnegative_v1_75t,((monochrome)),((grayscale)),bad-picture-chill-75v,", + "Face restoration": "CodeFormer", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c19c1fbf-60b2-486e-a759-9fcb00e00ced/width=450/881014.jpeg", + "nsfw": "Mature", + "width": 768, + "height": 1152, + "hash": "U4E2nL00004._1?b010J00%2~C4;0L9Y^+^+", + "meta": { + "Size": "512x768", + "seed": 3405321817, + "Model": "majicmixRealistic_v2", + "steps": 25, + "prompt": "((1girl)),solo,large breasts, white hair,red eyes, \nprosthetic quadruped,Quadruped machinery,mechanical tail,mechanical parts, robot joints,hydraulic system,headgear,four feet,\nprosthetic quadruped,Quadruped machinery,mechanical tail,mechanical parts, robot joints,hydraulic system,demon horns,four feet,all fours,crawl,amputee, \nfactory,\n", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "name": "pureInnocentGirl_v25", + "type": "lora", + "weight": 0.56 + } + ], + "Hires steps": "15", + "Hires upscale": "1.5", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "easynegative,ng_deepnegative_v1_75t,badhandv4 (worst quality:2), (low quality:2), (normal quality:2), lowres, bad anatomy, bad hands, normal quality, ((monochrome)), ((grayscale))", + "Face restoration": "CodeFormer", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9196b5d1-45b2-4958-b450-a0066aa12ae9/width=450/881010.jpeg", + "nsfw": "Mature", + "width": 768, + "height": 1152, + "hash": "UBHeIC.S0J~B4:xIRQR$-,M}?HIoTIR.x[nh", + "meta": { + "Size": "512x768", + "seed": 623949780, + "Model": "majicmixRealistic_v2", + "steps": 25, + "prompt": "masterpiece, best quality, 1girl, solo, big breasts, arms up, multicolored hair, multicolored eyes, crop top, underboob, mini skirt, off shoulder, pink panties, delicate, beautiful, colorful, vividcolor, lighting, outdoors, flower, petals, asshole, waterfall, \n", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "name": "pureInnocentGirl_v25", + "type": "lora", + "weight": 0.56 + } + ], + "Hires steps": "15", + "Hires upscale": "1.5", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "easynegative,ng_deepnegative_v1_75t,badhandv4 (worst quality:2), (low quality:2), (normal quality:2), lowres, bad anatomy, bad hands, normal quality, ((monochrome)), ((grayscale))", + "Face restoration": "CodeFormer", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0352ec6b-3fe4-4adc-a550-13c0d42b7251/width=450/881007.jpeg", + "nsfw": "Mature", + "width": 768, + "height": 1152, + "hash": "UAFOP*=_0x%2-o^*?FIVE2?G^j9a~VRkRi%L", + "meta": { + "Size": "512x768", + "seed": 3207063213, + "Model": "chilloutmix_NiPrunedFp32Fix", + "steps": 20, + "prompt": "highres, masterpiece,beautiful light,perfect ligthing, bloom, cinematic lighting, (RSEEmma:1.6), upper body,portrait, looking at viewer,\n1girl,sensual,detailled eyes, hair bun,joy,smile,perfect skin,( see-through:1.4,wet clothes,dress:1.2,cleavage), topless, nipples,\n(jungle:1.3), stranded, island,(night:1.1),(rain:1.3), storm, clouds, leaves,", + "sampler": "Euler a", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "name": "pureInnocentGirl_v25", + "type": "lora", + "weight": 0.5 + } + ], + "Hires steps": "20", + "Hires upscale": "1.5", + "Hires upscaler": "Latent (bicubic)", + "negativePrompt": "easynegative,ng_deepnegative_v1_75t,((monochrome)),((grayscale)),bad-picture-chill-75v,", + "Face restoration": "CodeFormer", + "Denoising strength": "0.56" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/78583" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/pureInnocentGirl_v25.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/pureInnocentGirl_v25.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..747552e64ff09225496da0ddd0ff424073430407 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/pureInnocentGirl_v25.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/pureInnocentGirl_v25.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/pureInnocentGirl_v25.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..aed260dd4622bca61b48d0c123b929361f8966e2 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/pureInnocentGirl_v25.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:ad3f50a5e1711da81de5d9bee0a2a57dba73a6a5328693cd17fe6d65a2fc1b96 +size 75610144 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/shojovibe_v11.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/shojovibe_v11.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..ed3bf9fc45db9ad184dd78b19024a13538d90829 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/shojovibe_v11.civitai.info" @@ -0,0 +1,345 @@ +{ + "id": 16557, + "modelId": 13213, + "name": "v1.1", + "createdAt": "2023-02-28T08:31:58.120Z", + "updatedAt": "2023-03-01T11:24:53.850Z", + "trainedWords": [], + "baseModel": "SD 2.0", + "earlyAccessTimeFrame": 0, + "description": "

v1.1 Update: add biracial feel, more shojo, improve stability, better lighting

known issues: hard to change hair color or clothes (except for sundress or lingerie etc,.,)

", + "stats": { + "downloadCount": 51608, + "ratingCount": 61, + "rating": 4.97 + }, + "model": { + "name": "ShojoVibe\u5c11\u5973\u611f ", + "type": "LORA", + "nsfw": false, + "poi": false + }, + "files": [ + { + "name": "shojovibe_v11.safetensors", + "id": 13981, + "sizeKB": 36976.9091796875, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-02-28T08:36:06.213Z", + "hashes": { + "AutoV1": "A970EA28", + "AutoV2": "FCB2FA4F6F", + "SHA256": "FCB2FA4F6F1F81EFDDE20EB2AD6F60E4FC665F9978832B989F8CD56379EECFF1", + "CRC32": "1AEE9421", + "BLAKE3": "CC081579A02FBA9402EABB4B1A4297ABF92CCC82A5725346384D3F2EEEE14728" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/16557" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/531149de-4e4e-4764-01c0-01032340e400/width=450/166937.jpeg", + "nsfw": "Soft", + "width": 768, + "height": 1024, + "hash": "UFF}$ewH00%200o}x^s:NeD%nh-:~WxunOV@", + "meta": { + "ENSD": "31337", + "Size": "384x512", + "seed": 1440251744, + "steps": 30, + "prompt": "(best quality, masterpiece:1.2), photorealistic, ultra high res, front lighting, intricate detail, Exquisite details and textures, 1girl, (young), face highlight, upper body, detailed face, tear mole, white skin, silver hair, ponytail, braid hair, looking at viewer, big eyes, sun dress, slip dress, (hollow pattern, white, silk), earrings, small breasts, slim body, luxury room, royal palace, professional lighting, photon mapping, radiosity, physically-based rendering, , ,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "vivian", + "type": "lora", + "weight": 0.8 + }, + { + "name": "fashionGirl_v36", + "type": "lora", + "weight": 0.3 + } + ], + "Model hash": "ca883fecc7", + "Hires steps": "14", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "negativePrompt": "EasyNegative, backlight, (worst quality, low quality:1.4), watermark, logo, bad anatomy, nude, topless, fat", + "Denoising strength": "0.7" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d13a0a64-26d8-4e61-a735-d0ea55b55b00/width=450/172035.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UDFh-c}[_NyX~W4n4:4:Mc?b9aof00.8V@-o", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9cf4cc8b-9079-4edf-7967-27868ccdce00/width=450/172037.jpeg", + "nsfw": "None", + "width": 1280, + "height": 1150, + "hash": "UEH-iX0fX2E300~V9bWVb_aeD*xZE2Ip$%-p", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c1335de3-501e-4083-b653-9cd30db44c00/width=450/166934.jpeg", + "nsfw": "None", + "width": 768, + "height": 1024, + "hash": "UdIg_z_Nx[f+NZ%L%MtRR.a$xat7x]xuxaae", + "meta": { + "ENSD": "31337", + "Size": "384x512", + "seed": 2804545310, + "steps": 30, + "prompt": "(best quality, masterpiece:1.2), photorealistic, ultra high res, front lighting, intricate detail, Exquisite details and textures, 1girl, (young), face highlight, upper body, detailed face, tear mole, white skin, silver hair, ponytail, braid hair, looking at viewer, big eyes, silk robe, (hollow pattern), cape, earrings, small breasts, slim body, royal palace, luxury room, stained glass, professional lighting, photon mapping, radiosity, physically-based rendering, , ,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "vivian", + "type": "lora", + "weight": 0.8 + }, + { + "name": "fashionGirl_v36", + "type": "lora", + "weight": 0.4 + } + ], + "Model hash": "ca883fecc7", + "Hires steps": "14", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "negativePrompt": "EasyNegative, backlight, wood, wood texture, (worst quality, low quality:1.4), watermark, logo, bad anatomy, nude, topless, fat", + "Denoising strength": "0.7" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5a97e52f-8a15-454e-6261-6fc8ca540e00/width=450/166935.jpeg", + "nsfw": "Soft", + "width": 768, + "height": 1024, + "hash": "UFIXN%%#~p_3x^_3?bad0L-oM{V?xZD*xXE1", + "meta": { + "ENSD": "31337", + "Size": "384x512", + "seed": 985060048, + "steps": 30, + "prompt": "(best quality, masterpiece:1.2), photorealistic, ultra high res, front lighting, intricate detail, Exquisite details and textures, 1girl, (young), face highlight, upper body, detailed face, tear mole, white skin, silver hair, ponytail, braid hair, looking at viewer, big eyes, silk robe, (hollow pattern, white, silk), earrings, small breasts, slim body, royal palace, luxury room, stained glass, professional lighting, photon mapping, radiosity, physically-based rendering, , ,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "vivian", + "type": "lora", + "weight": 0.8 + }, + { + "name": "fashionGirl_v36", + "type": "lora", + "weight": 0.4 + } + ], + "Model hash": "ca883fecc7", + "Hires steps": "14", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "negativePrompt": "EasyNegative, backlight, wood, wood texture, (worst quality, low quality:1.4), watermark, logo, bad anatomy, nude, topless, fat", + "Denoising strength": "0.7" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f7c0ddd5-e4ab-4ad2-d563-7a7d106e8a00/width=450/166936.jpeg", + "nsfw": "Soft", + "width": 768, + "height": 1024, + "hash": "UDH_3]00D#00In4n~qWY0fjE-;x[_Nxu9FD%", + "meta": { + "ENSD": "31337", + "Size": "384x512", + "seed": 1691258077, + "steps": 30, + "prompt": "(best quality, masterpiece:1.2), photorealistic, ultra high res, front lighting, intricate detail, Exquisite details and textures, 1girl, (young), face highlight, upper body, detailed face, tear mole, white skin, silver hair, ponytail, braid hair, looking at viewer, big eyes, sun dress, slip dress, (hollow pattern, white, silk), earrings, small breasts, slim body, luxury room, royal palace, professional lighting, photon mapping, radiosity, physically-based rendering, , ,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "vivian", + "type": "lora", + "weight": 0.8 + }, + { + "name": "fashionGirl_v36", + "type": "lora", + "weight": 0.3 + } + ], + "Model hash": "ca883fecc7", + "Hires steps": "14", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "negativePrompt": "EasyNegative, backlight, (worst quality, low quality:1.4), watermark, logo, bad anatomy, nude, topless, fat", + "Denoising strength": "0.7" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/58c3b20d-4ad9-4d8e-bf7d-623f18962800/width=450/166930.jpeg", + "nsfw": "Soft", + "width": 896, + "height": 1280, + "hash": "U9HKqf00?a^j?^4n?b01004:x]8{RO~V?bxt", + "meta": { + "ENSD": "31337", + "Size": "448x640", + "seed": 1539143943, + "steps": 30, + "prompt": "(best quality, masterpiece:1.2), photorealistic, ultra high res, front lighting, Exquisite details and textures, 1girl, full body, looking at viewer, from below, sundress, black lingerie, black stocking, thigh straps, arm straps, face highlight, detailed face, tear mole, white skin, big eyes, earrings, small breasts, slim body, royal palace, luxury room, professional lighting, photon mapping, radiosity, physically-based rendering, , ,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "shojovibe_v11", + "type": "lora", + "weight": 0.8 + }, + { + "name": "fashionGirl_v45", + "type": "lora", + "weight": 0.4 + } + ], + "Model hash": "ca883fecc7", + "Hires steps": "14", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "negativePrompt": "EasyNegative, backlight, wood, wood texture, (worst quality, low quality:1.4), watermark, logo, bad anatomy, fat", + "Denoising strength": "0.7" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d4e6c2cc-4456-43c5-969e-b63b1c35c300/width=450/166932.jpeg", + "nsfw": "Soft", + "width": 896, + "height": 1280, + "hash": "U9Fhei=y00At4.M{RPs,gNtSjG?G~p9FIp?u", + "meta": { + "ENSD": "31337", + "Size": "896x1280", + "seed": 2432754584, + "steps": 30, + "prompt": "(best quality, masterpiece:1.2), photorealistic, ultra high res, front lighting, Exquisite details and textures, 1girl, full body, looking at viewer, sitting on bed, from above, from side, black lingerie, black stocking, thigh straps, arm straps, face highlight, detailed face, tear mole, white skin, big eyes, earrings, small breasts, slim body, royal palace, luxury room (white, gold), professional lighting, photon mapping, radiosity, physically-based rendering, , ,", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "Clip skip": "2", + "Mask blur": "4", + "resources": [ + { + "name": "shojovibe_v11", + "type": "lora", + "weight": 0.8 + }, + { + "name": "fashionGirl_v45", + "type": "lora", + "weight": 0.4 + } + ], + "Model hash": "ca883fecc7", + "negativePrompt": "EasyNegative, wood furniture, backlight, wood, wood texture, (worst quality, low quality:1.4), watermark, logo, bad anatomy, fat", + "Denoising strength": "0.75" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4ed17f3c-2f88-4643-f384-2366cce35400/width=450/166931.jpeg", + "nsfw": "Soft", + "width": 896, + "height": 1280, + "hash": "U7Gazp00%#RQ00_NMxV@GGMwnN_3Mx^+-VRj", + "meta": { + "ENSD": "31337", + "Size": "448x640", + "seed": 3779358376, + "steps": 30, + "prompt": "(best quality, masterpiece:1.2), photorealistic, ultra high res, front lighting, Exquisite details and textures, 1girl, full body, looking at viewer, from above, sex, franch lingerie, (black, lace), Bustier, white stocking, thigh straps, arm straps, face highlight, detailed face, tear mole, white skin, big eyes, earrings, small breasts, slim body, royal palace, luxury room, professional lighting, photon mapping, radiosity, physically-based rendering, , ,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "shojovibe_v11", + "type": "lora", + "weight": 0.8 + }, + { + "name": "fashionGirl_v45", + "type": "lora", + "weight": 0.4 + } + ], + "Model hash": "ca883fecc7", + "Hires steps": "14", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "negativePrompt": "EasyNegative, backlight, wood, wood texture, (worst quality, low quality:1.4), watermark, logo, bad anatomy, fat", + "Denoising strength": "0.7" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2a322679-2e79-40f0-e2a6-4ce117466f00/width=450/167255.jpeg", + "nsfw": "Soft", + "width": 896, + "height": 1280, + "hash": "UFH-#}00?]?IE100?a4nNMoa?HE0_3Risq%f", + "meta": { + "ENSD": "31337", + "Size": "448x640", + "seed": 3623648163, + "steps": 30, + "prompt": "(best quality, masterpiece:1.2), photorealistic, ultra high res, front lighting, Exquisite details and textures, 1girl, (young), looking at viewer, sundress, lingerie, black stocking, face highlight, detailed face, tear mole, white skin, big eyes, earrings, slim body, royal palace, luxury room (white, gold), professional lighting, photon mapping, radiosity, physically-based rendering, , ,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "shojovibe_v11", + "type": "lora", + "weight": 0.8 + }, + { + "name": "fashionGirl_v45", + "type": "lora", + "weight": 0.3 + } + ], + "Model hash": "bb81be7c6f", + "Hires steps": "14", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "negativePrompt": "EasyNegative, backlight, wood, wood texture, wood furniture, (worst quality, low quality:1.4), topless, nude, watermark, logo, bad anatomy, fat", + "Denoising strength": "0.7" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/16557" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/shojovibe_v11.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/shojovibe_v11.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..471f837a8fd14235b2dae79ecdcacdfed9a51030 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/shojovibe_v11.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/shojovibe_v11.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/shojovibe_v11.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..a4828980d2ecb475de0a076749866db4329543c8 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/shojovibe_v11.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:fcb2fa4f6f1f81efdde20eb2ad6f60e4fc665f9978832b989f8cd56379eecff1 +size 37864355 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/taiwanDollLikeness_v1.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/taiwanDollLikeness_v1.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..62f39706d34c74e620d9dae974bcc235a6d3dbca --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/taiwanDollLikeness_v1.civitai.info" @@ -0,0 +1,54 @@ +{ + "id": 18718, + "modelId": 15858, + "name": "1.0", + "createdAt": "2023-03-05T02:15:55.108Z", + "updatedAt": "2023-03-05T02:15:55.108Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "model": { + "name": "T2W2", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "t2w2_10.safetensors", + "id": 15687, + "sizeKB": 147574.3212890625, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-03-05T02:21:21.561Z", + "hashes": { + "AutoV1": "D1B2108D", + "AutoV2": "5BBAABC045", + "SHA256": "5BBAABC04553D5821A3A45E4DE5A02B2E66ECB00DA677DD8AE862EFD8BA59050", + "CRC32": "56D08AC2", + "BLAKE3": "F6DFD361ABE61C78ABFE68EAE3343AC59A02C746C17CA9FD8B7AA3E4D00860E6" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/18718" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/069c01df-5fb7-40f1-e77a-516b94bb9a00/width=450/194316.jpeg", + "nsfw": true, + "width": 183, + "height": 275, + "hash": "UDHxW$007yai0c%JD~-V9Wx[tQsr.lIU$fNL", + "meta": null + } + ], + "downloadUrl": "https://civitai.com/api/download/models/18718" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/taiwanDollLikeness_v1.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/taiwanDollLikeness_v1.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..fe6730253851f032b49af49f437c8aee344e42e5 Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/taiwanDollLikeness_v1.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/taiwanDollLikeness_v1.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/taiwanDollLikeness_v1.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..5287e0e6e682cad6f391b11e70521049dfc8de7c --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/taiwanDollLikeness_v1.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:5bbaabc04553d5821a3a45e4de5a02b2e66ecb00da677dd8ae862efd8ba59050 +size 151116105 diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/taiwandolllikenessV20_v20.civitai.info" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/taiwandolllikenessV20_v20.civitai.info" new file mode 100644 index 0000000000000000000000000000000000000000..ceb7fe54b602d20c28a19a0610e7565b2ed1f9d8 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/taiwandolllikenessV20_v20.civitai.info" @@ -0,0 +1,384 @@ +{ + "id": 52974, + "modelId": 48363, + "name": "v2.0", + "createdAt": "2023-04-23T05:53:25.301Z", + "updatedAt": "2023-04-23T05:59:38.678Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 93, + "ratingCount": 0, + "rating": 0 + }, + "model": { + "name": "TaiwanDollLikeness (v2.0)", + "type": "LORA", + "nsfw": true, + "poi": false + }, + "files": [ + { + "name": "taiwandolllikenessV20_v20.safetensors", + "id": 38528, + "sizeKB": 147567.2177734375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-23T05:56:33.838Z", + "hashes": { + "AutoV1": "364A8734", + "AutoV2": "BD17B1BF1B", + "SHA256": "BD17B1BF1B061779797B892D176EEFB55D976F81638DBC048F4E5FD7CCB63B4F", + "CRC32": "C9F458F5", + "BLAKE3": "9EB70E121E6B56D3FDA7D4DC2CDA2B7432E19468F0E23356AA062B5639FE7294" + }, + "primary": true, + "downloadUrl": "https://civitai.com/api/download/models/52974" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/cb7842fc-23b4-4583-fa00-69eb9f318600/width=450/571716.jpeg", + "nsfw": true, + "width": 896, + "height": 1344, + "hash": "UFJ7t4xa00s:00?Hx^Rj9ZW.?ajv~qRO4nRP", + "meta": { + "Size": "512x768", + "seed": 4085955551, + "Model": "Chilled_re_generic_v2", + "steps": 28, + "hashes": { + "model": "523b280d1c" + }, + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, white camisole, busty, huge breasts, (brown long hair:1), (looking at viewer), (full body), (closeup) ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "resources": [ + { + "name": "taiwanDollLikeness_v20", + "type": "lora", + "weight": 0.66 + }, + { + "hash": "523b280d1c", + "name": "Chilled_re_generic_v2", + "type": "model" + } + ], + "Model hash": "523b280d1c", + "Hires steps": "20", + "Hires upscale": "1.75", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, glossy skin, wet, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans", + "Denoising strength": "0.5" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1e2a0b9e-fc6f-4e59-292d-c6726cee5600/width=450/571718.jpeg", + "nsfw": true, + "width": 896, + "height": 1344, + "hash": "UIKT-@OrXTD%5P9F?]D%D*IUNFwb~pt7D+%M", + "meta": { + "Size": "512x768", + "seed": 3421732881, + "Model": "Chilled_re_generic_v2", + "steps": 28, + "hashes": { + "model": "523b280d1c" + }, + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, white camisole, busty, huge breasts, (brown long hair:1), (looking at viewer), (full body), (closeup) ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "resources": [ + { + "name": "taiwanDollLikeness_v20", + "type": "lora", + "weight": 0.66 + }, + { + "hash": "523b280d1c", + "name": "Chilled_re_generic_v2", + "type": "model" + } + ], + "Model hash": "523b280d1c", + "Hires steps": "20", + "Hires upscale": "1.75", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, glossy skin, wet, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans", + "Denoising strength": "0.5" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/28bc8078-9e73-4666-0d26-260137055b00/width=450/571719.jpeg", + "nsfw": true, + "width": 896, + "height": 1344, + "hash": "UWGIDs_4b_?HI:%2kXWBE1Io$*ofNGs:ofR*", + "meta": { + "Size": "512x768", + "seed": 3819551797, + "Model": "Chilled_re_generic_v2", + "steps": 28, + "hashes": { + "model": "523b280d1c" + }, + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, off-shoulder black shirt, skirt, black choker, (faded ash gray hair:1), (huge breasts:1.2), looking at viewer, closeup ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "resources": [ + { + "name": "taiwanDollLikeness_v20", + "type": "lora", + "weight": 0.66 + }, + { + "hash": "523b280d1c", + "name": "Chilled_re_generic_v2", + "type": "model" + } + ], + "Model hash": "523b280d1c", + "Hires steps": "20", + "Hires upscale": "1.75", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans,", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f2a21179-def2-42c9-7ffc-08b3d7373a00/width=450/571720.jpeg", + "nsfw": true, + "width": 896, + "height": 1344, + "hash": "UBEVED9a00%M9Z%M9t-V00R%~BRjX5xujFE1", + "meta": { + "Size": "512x768", + "seed": 410593910, + "Model": "Chilled_re_generic_v2", + "steps": 28, + "hashes": { + "model": "523b280d1c" + }, + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, off-shoulder black shirt, skirt, black choker, (faded ash gray hair:1), (huge breasts:1.2), looking at viewer, closeup ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "resources": [ + { + "name": "taiwanDollLikeness_v20", + "type": "lora", + "weight": 0.66 + }, + { + "hash": "523b280d1c", + "name": "Chilled_re_generic_v2", + "type": "model" + } + ], + "Model hash": "523b280d1c", + "Hires steps": "20", + "Hires upscale": "1.75", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans,", + "Denoising strength": "0.45" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/770c854d-f5bd-4e4e-5aa3-6b6171e20000/width=450/571722.jpeg", + "nsfw": true, + "width": 896, + "height": 1344, + "hash": "UCJaDs-;02$l00%f_24:_N%2IAE2$x$*%MIp", + "meta": { + "Size": "512x768", + "seed": 1443061741, + "Model": "chilloutmix_cilloutmixNi", + "steps": 28, + "hashes": { + "model": "7234b76e42" + }, + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, white camisole, busty, huge breasts, (brown long hair:1), (looking at viewer), (full body), (closeup) ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "resources": [ + { + "name": "taiwanDollLikeness_v20", + "type": "lora", + "weight": 0.66 + }, + { + "hash": "7234b76e42", + "name": "chilloutmix_cilloutmixNi", + "type": "model" + } + ], + "Model hash": "7234b76e42", + "Hires steps": "20", + "Hires upscale": "1.75", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, glossy skin, wet, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans", + "Denoising strength": "0.5" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5a9055c1-b89e-44c3-f1fb-aec20aef3b00/width=450/571724.jpeg", + "nsfw": true, + "width": 896, + "height": 1344, + "hash": "ULKKA#R%JCbD9an#~qRj-oxuMxxZtQx[MxW=", + "meta": { + "Size": "512x768", + "seed": 2113330000, + "Model": "chilloutmix_cilloutmixNi", + "steps": 28, + "hashes": { + "model": "7234b76e42" + }, + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, white camisole, busty, huge breasts, (brown long hair:1), (looking at viewer), (full body), (closeup) ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "resources": [ + { + "name": "taiwanDollLikeness_v20", + "type": "lora", + "weight": 0.66 + }, + { + "hash": "7234b76e42", + "name": "chilloutmix_cilloutmixNi", + "type": "model" + } + ], + "Model hash": "7234b76e42", + "Hires steps": "20", + "Hires upscale": "1.75", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, glossy skin, wet, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans", + "Denoising strength": "0.5" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5552c107-420c-4436-7512-e5b808c73e00/width=450/571729.jpeg", + "nsfw": true, + "width": 896, + "height": 1344, + "hash": "UHF~gh-o01E+H=NINx%100IoxtxY_N%LVsIV", + "meta": { + "Size": "512x768", + "seed": 3588905076, + "Model": "chilloutmix_cilloutmixNi", + "steps": 28, + "hashes": { + "model": "7234b76e42" + }, + "prompt": "best quality, ultra high res, (photorealistic:1.4), masterpiece, real life skin, hyper real, 1girl, faded ash grey hair, sweater, loose jacket, (large breasts:1), (busty:1), looking at viewer ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "resources": [ + { + "name": "taiwanDollLikeness_v20", + "type": "lora", + "weight": 0.66 + }, + { + "hash": "7234b76e42", + "name": "chilloutmix_cilloutmixNi", + "type": "model" + } + ], + "Model hash": "7234b76e42", + "Hires steps": "20", + "Hires upscale": "1.75", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, shiny skin, wet, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans", + "Denoising strength": "0.5" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f99b49be-c608-4752-8ef7-407cd4ff2700/width=450/571730.jpeg", + "nsfw": true, + "width": 896, + "height": 1344, + "hash": "UAH21b00BW00~p0JEjE100IUNet8_3-;9FV@", + "meta": { + "Size": "512x768", + "seed": 3687410304, + "Model": "chilloutmix_cilloutmixNi", + "steps": 28, + "hashes": { + "model": "7234b76e42" + }, + "prompt": "best quality, ultra high res, (photorealistic:1.4), masterpiece, 1girl, faded ash grey hair, black sheer mesh turtleneck sweater, bare shoulders, (large breasts:1), (busty:1), looking at viewer ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "resources": [ + { + "name": "taiwanDollLikeness_v20", + "type": "lora", + "weight": 0.66 + }, + { + "hash": "7234b76e42", + "name": "chilloutmix_cilloutmixNi", + "type": "model" + } + ], + "Model hash": "7234b76e42", + "Hires steps": "20", + "Hires upscale": "1.75", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, shiny skin, wet, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans", + "Denoising strength": "0.5" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f11df208-fb2c-490a-9d06-497e047f8a00/width=450/571731.jpeg", + "nsfw": true, + "width": 896, + "height": 1344, + "hash": "UDFE$I9t00-o0L=|ofof01E2~VIo57t6xFxu", + "meta": { + "Size": "512x768", + "seed": 289411898, + "Model": "Chilled_re_generic_v2", + "steps": 28, + "hashes": { + "model": "523b280d1c" + }, + "prompt": "best quality, ultra high res, (photorealistic:1.4), 1girl, black off-shoulder shirt, seductive pose, simple background, cleavage, busty, choker, huge breasts, messy bun, looking at viewer, ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 8, + "resources": [ + { + "name": "taiwanDollLikeness_v20", + "type": "lora", + "weight": 0.66 + }, + { + "hash": "523b280d1c", + "name": "Chilled_re_generic_v2", + "type": "model" + } + ], + "Model hash": "523b280d1c", + "Hires steps": "20", + "Hires upscale": "1.75", + "Hires upscaler": "Latent (bicubic antialiased)", + "negativePrompt": "paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glans, nsfw, nipples", + "Denoising strength": "0.45" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/52974" +} \ No newline at end of file diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/taiwandolllikenessV20_v20.preview.png" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/taiwandolllikenessV20_v20.preview.png" new file mode 100644 index 0000000000000000000000000000000000000000..6c36c19d36acac9cdc25702a87871be489f147be Binary files /dev/null and "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/taiwandolllikenessV20_v20.preview.png" differ diff --git "a/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/taiwandolllikenessV20_v20.safetensors" "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/taiwandolllikenessV20_v20.safetensors" new file mode 100644 index 0000000000000000000000000000000000000000..37c8805d2e5600b866e3899545e1a34cf37cc6b1 --- /dev/null +++ "b/H-\350\247\222\350\211\262\347\233\270\345\205\263/\351\235\242\351\203\250\345\274\225\345\257\274/taiwandolllikenessV20_v20.safetensors" @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:bd17b1bf1b061779797b892d176eefb55d976f81638dbc048f4e5fd7ccb63b4f +size 151108831